Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
common factor of 2100514 and 325. 13 What is the greatest common factor of 571946032 and 8680? 1736 What is the highest common factor of 237495167 and 39? 13 What is the highest common factor of 10 and 1127837130? 10 Calculate the highest common divisor of 41292360 and 483. 69 Calculate the greatest common divisor of 1566949704 and 1564. 1564 What is the highest common divisor of 6 and 1595288868? 6 What is the highest common divisor of 2299 and 1124332? 121 What is the highest common factor of 208 and 11626667? 13 What is the highest common factor of 21488256 and 95616? 1152 What is the highest common factor of 6904318 and 1066? 82 Calculate the greatest common factor of 11381 and 117865829. 599 Calculate the highest common factor of 885 and 104153172. 177 Calculate the greatest common factor of 2200816 and 730868. 8212 Calculate the greatest common divisor of 650611682 and 14. 14 What is the greatest common factor of 342 and 82140192? 342 Calculate the greatest common factor of 268 and 395524. 4 What is the greatest common divisor of 7543146 and 35334? 78 Calculate the greatest common factor of 58990 and 64230. 10 Calculate the highest common divisor of 692 and 1725296822. 346 What is the greatest common factor of 50454683 and 109? 109 What is the highest common factor of 3244184 and 287048? 5416 What is the greatest common factor of 55601223 and 134? 67 Calculate the highest common factor of 766621374 and 2406. 2406 Calculate the highest common factor of 420079 and 3421. 11 What is the greatest common factor of 201 and 84832586? 67 Calculate the greatest common divisor of 455590 and 1210. 10 Calculate the highest common factor of 15181 and 530689. 323 Calculate the highest common divisor of 232 and 231100. 4 What is the greatest common divisor of 91 and 24893148? 7 What is the highest common divisor of 4108 and 477902126? 2054 Calculate the greatest common factor of 2016508 and 16276. 52 What is the greatest common factor of 8897238 and 27474? 1446 Calculate the highest common divisor of 166 and 88872582. 166 What is the highest common divisor of 209344925 and 2575? 2575 What is the greatest common divisor of 463 and 974819? 1 What is the highest common factor of 632 and 6831464? 8 What is the highest common divisor of 8 and 357901928? 8 What is the greatest common factor of 99012 and 2517924? 444 Calculate the greatest common factor of 45504069 and 2964. 741 What is the highest common factor of 6741 and 5117427? 63 Calculate the greatest common factor of 33156935 and 65. 5 What is the greatest common factor of 61398 and 53136? 162 Calculate the highest common factor of 97353785 and 26865. 995 What is the highest common divisor of 850420 and 4545? 505 What is the highest common divisor of 49044352 and 518? 14 Calculate the highest common factor of 33847 and 286704. 1991 Calculate the highest common divisor of 1092401 and 377. 29 What is the greatest common factor of 7244 and 320074329? 1811 What is the greatest common factor of 83691 and 31790? 17 What is the highest common factor of 3773 and 87331321? 77 Calculate the highest common divisor of 37 and 18968050. 37 Calculate the greatest common factor of 36133590 and 380. 10 What is the highest common factor of 27982126 and 2? 2 Calculate the greatest common divisor of 122598 and 16009. 7 What is the greatest common divisor of 146045055 and 195? 195 Calculate the greatest common factor of 71709130 and 1299. 433 What is the greatest common divisor of 172510 and 10550? 10 What is the greatest common factor of 823291978 and 618? 206 Calculate the highest common factor of 699143 and 703. 19 Calculate the greatest common divisor of 36732231 and 351. 27 What is the highest common divisor of 3552198 and 182? 26 Calculate the highest common divisor of 102222 and 4632802. 1262 What is the highest common factor of 97535 and 5385? 5 Calculate the greatest common factor of 107 and 8248951. 107 What is the highest common divisor of 144 and 203973808? 16 Calculate the greatest common divisor of 17492349 and 14. 7 Calculate the highest common factor of 32686649 and 531. 59 Calculate the highest common divisor of 1077752 and 43. 43 Calculate the highest common divisor of 3690 and 46539. 9 Calculate the highest common factor of 108 and 14732757. 9 What is the greatest common divisor of 396 and 483315096? 132 What is the greatest common factor of 6069 and 130494? 21 What is the highest common divisor of 2100424 and 6? 2 What is the greatest common factor of 6328 and 2000552? 904 Calculate the highest common factor of 1539 and 24813. 27 Calculate the highest common factor of 4976 and 26528. 16 Calculate the greatest common divisor of 117417027 and 182. 91 What is the highest common factor of 1870848 and 6804? 252 What is the greatest common divisor of 317 and 2240873? 317 Calculate the greatest common divisor of 7 and 54482. 1 Calculate the highest common factor of 5550 and 5918002. 74 What is the greatest common divisor of 1307 and 62686334? 1307 Calculate the highest common divisor of 2470 and 190011172. 494 What is the greatest common divisor of 13581 and 60731214? 1509 Calculate the greatest common divisor of 79817400 and 6064. 3032 Calculate the highest common factor of 116830793 and 74. 37 Calculate the highest common factor of 7062 and 1812441114. 7062 Calculate the greatest common factor of 549 and 819274347. 549 What is the greatest common divisor of 60801897 and 48? 3 What is the greatest common factor of 19995 and 228889? 43 Calculate the greatest common divisor of 27800 and 118700. 100 Calculate the greatest common divisor of 525 and 270585. 105 Calculate the highest common divisor of 35501424 and 60648. 3192 Calculate the greatest common factor of 693 and 49780953. 9 Calculate the highest common factor of 665 and 301836185. 665 What is the greatest common divisor of 30 and 55576605? 15 Calculate the greatest common factor of 1996242 and 51. 51 Calculate the greatest common factor of 220 and 104836. 4 Calculate the highest common divisor of 38710 and 1696870. 490 What is the highest common factor of 1330 and 181572265? 665 Calculate the greatest common factor of 870 and 649955830. 290 What is the highest common factor of 17463 and 6297? 3 What is the greatest common factor of 2014909098 and 717? 717 Calculate the highest common factor of 20 and 12878080. 20 Calculate the greatest common factor of 273354 and 99661098. 9426 What is the greatest common divisor of 39775 and 887075? 925 Calculate the greatest common factor of 33815919 and 1851. 1851 Calculate the greatest common divisor of 82749028 and 1178. 38 What is the greatest common divisor of 1468452 and 27492? 948 What is the greatest common divisor of 5672 and 51413844? 2836 Calculate the greatest common factor of 117305962 and 76. 38 Calculate the greatest common divisor of 66969634 and 212. 106 What is the greatest common factor of 5093508 and 4764? 12 Calculate the highest common factor of 128180 and 32708. 884 Calculate the highest common factor of 71270 and 26633599. 7127 Calculate the highest common divisor of 13689 and 9237033. 1521 Calculate the greatest common divisor of 12593490 and 630. 210 Calculate the highest common divisor of 15570 and 2546560. 1730 What is the highest common factor of 449385 and 57? 3 Calculate the highest common divisor of 796446297 and 3798. 1899 Calculate the greatest common divisor of 1932384 and 1056. 96 What is the greatest common factor of 2026245 and 1335? 15 What is the greatest common divisor of 97662312 and 198? 198 What is the highest common divisor of 17 and 225300? 1 Calculate the highest common factor of 61659 and 7908255. 279 Calculate the greatest common factor of 19508 and 187892. 4 What is the highest common divisor of 610 and 3275395? 305 Calculate the highest common divisor of 67300 and 187700. 100 What is the greatest common factor of 342 and 117624294? 18 Calculate the greatest common divisor of 5951043 and 491211. 4347 Calculate the highest common factor of 8 and 2183638. 2 Calculate the highest common factor of 4638 and 9321. 3 Calculate the greatest common factor of 9408 and 43969856. 3136 What is the greatest common divisor of 145688395 and 4190? 2095 Calculate the greatest commo	{ "pile_set_name": "DM Mathematics" }
a prime number? False Is 3432293 a composite number? True Is 157556983 a prime number? False Is 19273873 prime? False Is 118273811 prime? False Is 13708939 composite? False Is 22995223 composite? False Is 71601385 a composite number? True Is 2304823 prime? True Is 89455217 prime? False Is 156756293 composite? True Is 165798079 a prime number? True Is 156181127 a composite number? False Is 36800573 prime? True Is 73294591 composite? True Is 16344217 composite? False Is 735937 a composite number? False Is 1001107 composite? False Is 1969933 a composite number? True Is 807361 a composite number? True Is 1344641 prime? True Is 35297131 a composite number? False Is 34976941 composite? False Is 2462341 a prime number? False Is 45008213 prime? True Is 3429287 composite? False Is 31238581 prime? False Is 6624581 a prime number? True Is 833905 a composite number? True Is 4209245 a composite number? True Is 478570589 composite? True Is 1086859 composite? False Is 1626733 a composite number? True Is 2160959 a prime number? False Is 197000527 composite? True Is 1658113 a prime number? False Is 18895951 a composite number? False Is 49597237 a prime number? True Is 822897926 composite? True Is 60813561 prime? False Is 8692729 composite? True Is 43712887 a prime number? True Is 2995413 a composite number? True Is 105315011 composite? False Is 29210719 composite? True Is 30470347 a composite number? False Is 15174371 composite? False Is 296957803 prime? True Is 781534298 a prime number? False Is 204102781 a composite number? True Is 20325562 a composite number? True Is 206025011 prime? True Is 82226647 composite? False Is 4984886 composite? True Is 6763129 prime? True Is 57241559 a composite number? False Is 14454703 prime? True Is 529981243 a prime number? False Is 74253551 composite? True Is 2895301 composite? False Is 477784949 a composite number? True Is 9620093 prime? False Is 138991 a composite number? True Is 49253289 a prime number? False Is 17507491 composite? False Is 940721 a composite number? False Is 15686947 a prime number? True Is 80179819 composite? True Is 544972555 prime? False Is 144764569 a composite number? False Is 3600773 a composite number? True Is 42724219 a prime number? True Is 2094817 a prime number? False Is 448837891 a composite number? True Is 11537443 prime? True Is 543811 prime? True Is 11504137 composite? False Is 219911 prime? True Is 10584401 a composite number? True Is 1370393 a prime number? False Is 31518386 a prime number? False Is 6762037 a composite number? False Is 40149303 composite? True Is 4170931 a prime number? False Is 2473253 composite? True Is 17186387 a prime number? False Is 22302263 composite? False Is 1667321 a composite number? False Is 645313 composite? False Is 191526565 composite? True Is 5717633 composite? True Is 43829633 a prime number? True Is 83957402 composite? True Is 4674833 prime? True Is 2527341 composite? True Is 880409 composite? False Is 603719029 a prime number? True Is 89455 a composite number? True Is 1075391 prime? True Is 8373983 prime? True Is 123515009 prime? True Is 1216321 prime? False Is 2348323 composite? True Is 13277741 prime? False Is 30989649 a prime number? False Is 187442197 a prime number? False Is 15053767 a prime number? False Is 1218131 a prime number? True Is 106109257 composite? True Is 7732271 a prime number? False Is 1840169 a composite number? True Is 131476009 composite? True Is 860395 prime? False Is 10724303 a prime number? False Is 96156043 composite? True Is 64578707 a composite number? False Is 19610113 composite? True Is 3570694 a prime number? False Is 130597447 a composite number? False Is 180969823 a prime number? True Is 30838603 a composite number? False Is 21748717 prime? True Is 1157267 prime? False Is 28269039 composite? True Is 62270773 a composite number? True Is 2232959173 prime? False Is 2532593 a prime number? False Is 1936999 composite? False Is 701791 a composite number? False Is 10825279 a prime number? True Is 70980977 prime? True Is 41895499 prime? True Is 338047 a prime number? False Is 92273017 a prime number? True Is 4332929 a prime number? True Is 470665633 composite? True Is 1684741 composite? False Is 17122745 a composite number? True Is 18480503 a composite number? False Is 623 prime? False Is 98813413 a prime number? True Is 10139867 composite? False Is 77084617 prime? False Is 3434219 a composite number? True Is 12569 prime? True Is 2795154913 prime? False Is 1314379 a composite number? True Is 32149151 composite? False Is 113809737 a prime number? False Is 7174697 a prime number? False Is 5064303 composite? True Is 106643791 a composite number? True Is 162859054 composite? True Is 3364763 composite? False Is 41205967 composite? True Is 24690958 composite? True Is 287403251 composite? False Is 122651 a composite number? False Is 5049091 a composite number? True Is 66938797 a composite number? False Is 7651409 composite? True Is 7099781 prime? False Is 8610709 prime? False Is 180075409 composite? True Is 28387 a prime number? True Is 2809183 a composite number? True Is 19000153 a composite number? False Is 20843443 a composite number? False Is 1702661 a prime number? True Is 108061783 a prime number? False Is 95597 prime? True Is 2837389 a composite number? True Is 176031469 prime? True Is 20418439 composite? False Is 416497 composite? False Is 156387587 a composite number? False Is 13260761 a prime number? False Is 78055489 a composite number? True Is 1305229 a prime number? True Is 880471 prime? False Is 121216881 composite? True Is 16261633 composite? False Is 225250887 prime? False Is 190396963 a composite number? False Is 9067493 a composite number? True Is 136846817 a prime number? True Is 817541287 composite? False Is 223528579 composite? False Is 6889507 prime? False Is 5636291 prime? True Is 707081 a composite number? True Is 23540669 a prime number? True Is 4147943 composite? False Is 9065599 a composite number? True Is 190105133 composite? False Is 55515833 a composite number? False Is 142169 a prime number? True Is 16941389 composite? True Is 566089 composite? False Is 4930693 a prime number? True Is 1473933561 prime? False Is 85442059 a prime number? True Is 27316207 composite? True Is 247483751 a composite number? False Is 2272583 prime? False Is 580611631 a composite number? False Is 1661158 a prime number? False Is 1682333 a composite number? False Is 55813897 a composite number? True Is 3386091 a composite number? True Is 12113557 composite? False Is 48892981 a prime number? True Is 47712061 a composite number? True Is 2118269 prime? True Is 73826401 a prime number? False Is 1782427 a prime number? False Is 256285 a prime number? False Is 6009161 composite? True Is 27226501 a prime number? False Is 10726109 a prime number? False Is 125281577 a prime number? False Is 677112103 prime? True Is 262681231 composite? False Is 55017349 a composite number? False Is 720749 composite? True Is 56770907 composite? False Is 6208603 a composite number? False Is 160123 a prime number? False Is 261249091 a prime number? True Is 1818407 composite? False Is 19184749 prime? False Is 299061131 a composite number? False Is 20306291 composite? False Is 5727751 composite? False Is 17992757 a prime number? True Is 17047 composite? False Is 36034547 prime? True Is 8042315 a composite number? True Is 44732057 composite? False Is 40920029 prime? False Is 11597515 composite? True Is 10241087 prime? True Is 200333 a composite number? True Is 2277061 a prime number? True Is 704541 prime? False Is 26758621 composite? True Is 20714243 a composite number? True Is 595817 a composite number? False Is 4056641 prime? True Is 133315909 a prime number? True Is 192731494 prime? False Is 3878089 composite? True Is 3413219 composite? True Is 1368413 a composite number? True Is 16766963 composite? False Is 8571151 a prime number? True Is 4755331 a prime number? False Is 116900123 composite? True Is 6013141 a prime number? True Is 370034167 composite? False Is 20613823 a composite number? True Is 8141921 composite? True Is 104049167 a composite number? False Is 31916091 composite? True Is 79055147 prime? True Is 51656771 prime? False Is 43215743 a prim	{ "pile_set_name": "DM Mathematics" }
biggest value in 2, 0, -0.5, -1/23? -0.5 Which is the fourth smallest value? (a) 1 (b) 0.04 (c) 0.2 (d) -0.05 a What is the second smallest value in 0, 0.1, -74, 3, -1/6? -1/6 What is the third smallest value in -1/706, -2, 2? 2 Which is the second smallest value? (a) -2 (b) -1713 (c) -3/7 a Which is the third biggest value? (a) -3/11 (b) 4 (c) -0.6 c Which is the second smallest value? (a) 2 (b) 3 (c) -5 a Which is the second smallest value? (a) -17 (b) 5/6 (c) -1/13 (d) -2/15 (e) -0.5 e Which is the second biggest value? (a) -0.2 (b) 1 (c) 5 (d) -5 b Which is the biggest value? (a) 1/54 (b) -0.4 (c) 2/7 (d) 1/5 c Which is the third smallest value? (a) 5/11 (b) -4 (c) 74 (d) -0.4 a What is the smallest value in 458, -3, -6, -0.2, -2? -6 Which is the second smallest value? (a) -3 (b) -47 (c) 0.4 (d) -1 a Which is the smallest value? (a) 3/19 (b) -2/15 (c) 0.5 b Which is the smallest value? (a) 0.5 (b) -1/26 (c) 4/5 (d) 1 b What is the second smallest value in -41, 53/7, 2/7? 2/7 Which is the fourth biggest value? (a) 5 (b) -1/2 (c) 1/11 (d) 2 b What is the third biggest value in -19, -1/5, -2/11? -19 What is the smallest value in -0.3, 3/7, -0.1, -3/8? -3/8 What is the fourth biggest value in 1, 4, 8/67, 5? 8/67 What is the second smallest value in -0.4, 4, -5, 21? -0.4 What is the biggest value in 0.4, -2/5, -10/27? 0.4 What is the smallest value in 4/27, -0.4, 0.2, -3.1? -3.1 What is the biggest value in -0.022, -24, 3? 3 What is the biggest value in 0.014, 2, -5? 2 What is the smallest value in -0.19, -7, 8, 0? -7 What is the second smallest value in 762.7, 4, 0? 4 What is the third smallest value in -4, 5262, 1, 5? 5 Which is the third smallest value? (a) -0.4 (b) 1 (c) 329.2 c Which is the second smallest value? (a) -5 (b) 2/19 (c) 0.5 (d) 0.4 b Which is the second biggest value? (a) 0.51 (b) 7/2 (c) -5 (d) 2/11 a What is the fourth smallest value in 1/6, 4, -1/7, 2/13, 2/7? 2/7 What is the third biggest value in -1, -73, 5, 0.1? -1 What is the fourth biggest value in 0.2, -0.4, 3/5, 7.5, -1/6? -1/6 What is the biggest value in -2/7, -4, -1, 0.19? 0.19 Which is the second biggest value? (a) -0.2 (b) 0.01 (c) -4 (d) 0.9 b What is the biggest value in -3, -4, 7, -2/5? 7 What is the fourth biggest value in 3, -10, -0.3, 0.03? -10 What is the fourth smallest value in -4, 1/3, 4, -1/9? 4 Which is the second smallest value? (a) -2 (b) 2/11 (c) -4.6 (d) 0.2 (e) 6 a What is the fourth biggest value in -2/3, 4, 14, -4, -2/7? -2/3 Which is the third biggest value? (a) -2 (b) -4 (c) 0 (d) -1/5 a What is the biggest value in -5, -1/15, 0.2, 2.4? 2.4 Which is the second biggest value? (a) 13 (b) -10 (c) -1/7 c What is the smallest value in 1, 1.3, -3/7? -3/7 Which is the second biggest value? (a) -14 (b) 33 (c) 0.1 c Which is the third smallest value? (a) -1/9 (b) -0.3 (c) -0.1 (d) -0.79 a Which is the smallest value? (a) 2/5 (b) 3 (c) -7 (d) -0.2 c What is the fifth smallest value in -0.3, 0.4, 0.2, -1/3, -2? 0.4 What is the smallest value in 2, 1/324, -0.5, -5? -5 What is the second biggest value in 117, 0, -2, -3? 0 What is the second biggest value in -2, 1/4, 2, -13? 1/4 What is the smallest value in -3, 5, 2/367, 4? -3 What is the third biggest value in 10, -3, 2/5? -3 Which is the third biggest value? (a) -0.07 (b) -0.359 (c) -2/7 b What is the second biggest value in -1/2, 2/3, -0.08? -0.08 Which is the smallest value? (a) 4 (b) 5 (c) -1/6 (d) 0.14 c Which is the second smallest value? (a) -142 (b) 2 (c) -4 (d) 3 c Which is the second biggest value? (a) -0.5 (b) 13 (c) 2 (d) 0.3 (e) -0.3 c Which is the third smallest value? (a) 3 (b) 0 (c) -2/9 (d) 0.3 (e) 11/5 d Which is the third smallest value? (a) 4/3 (b) 0.05 (c) -3/7 a Which is the second smallest value? (a) 2 (b) 1 (c) -11.2 b Which is the fifth biggest value? (a) -1 (b) 1/7 (c) 1/22 (d) 0.5 (e) 0.2 a What is the fifth smallest value in 3/7, 0.5, -30, -4, -1? 0.5 Which is the second smallest value? (a) -1/2 (b) -2 (c) -0.4 (d) 2 (e) 1/87 a Which is the biggest value? (a) -0.5 (b) 0.5 (c) -1/4 b Which is the second biggest value? (a) 0.24 (b) 0.1 (c) 2/3 (d) -0.4 a What is the smallest value in 15, 0.04, 60? 0.04 What is the smallest value in 0.76, 5, -2/15? -2/15 Which is the third biggest value? (a) 7 (b) -3 (c) 70 b Which is the second biggest value? (a) 4 (b) 0.4 (c) -6 b Which is the smallest value? (a) 0.4 (b) -1/2 (c) -5/9 c Which is the second biggest value? (a) 0 (b) -3/4 (c) 3 a Which is the smallest value? (a) -3 (b) 0 (c) 1 (d) 0.34 (e) 2 a What is the third smallest value in -4/7, 1, 5/4, -1/5? 1 What is the biggest value in 2, 1, -14? 2 What is the fourth biggest value in 5/3, 9, -0.3, 0? -0.3 What is the biggest value in -0.5, 2, -5/9, 5, 0? 5 What is the biggest value in -1/5, -24.5, -20? -1/5 Which is the fourth smallest value? (a) 18.1 (b) 20/11 (c) -1/8 (d) 4 a Which is the biggest value? (a) -1 (b) 5 (c) -9 (d) 2/3 (e) -14/3 b Which is the second biggest value? (a) -5 (b) 1/4 (c) 6 (d) 2/3 (e) 0.05 d What is the biggest value in 0.1, 0.02, -5, -10, 1/4? 1/4 Which is the third smallest value? (a) -1/2 (b) -3/7 (c) 2/3 c What is the third biggest value in 5, -0.25, 1, -1/6? -1/6 What is the second smallest value in 4/3, 2/11, 342? 4/3 What is the third smallest value in -0.4, 3/11, 3/62? 3/11 What is the fourth biggest value in -2/21, 4, -0.5, -15, 2/3? -0.5 What is the fourth biggest value in -51, -0.4, 1, 1/4? -51 What is the third smallest value in -0.5, 3, -2, -3/29? -3/29 Which is the biggest value? (a) 5 (b) 0.95 (c) 3 a Which is the biggest value? (a) 0.3 (b) 3/7 (c) -36 (d) -1/7 (e) -2 b Which is the second biggest value? (a) 0.3 (b) -2/13 (c) 5 (d) -140 (e) 1/4 a Which is the second biggest value? (a) 8 (b) 0 (c) 0.3 c What is the fourth biggest value in -0.014, -6, 3/8, 4? -6 What is the biggest value in -0.3, -38/7, 2/11? 2/11 Which is the third biggest value? (a) 1.8 (b) -0.08 (c) 6 b Which is the biggest value? (a) 3 (b) -2 (c) 2/25 (d) 126 (e) 4 d Which is the third biggest value? (a) -8 (b) 0.17 (c) 3 a What is the smallest value in -5, -4, 3, -105, -1/5? -105 Which is the second biggest value? (a) -3 (b) -2/11 (c) 2/21 b What is the fifth biggest value in 2, 8, -8, -5, 3? -8 Which is the third smallest value? (a) -5 (b) -0.5 (c) -83 b What is the second biggest value in -130.2, 4, 5? 4 Which is the second biggest value? (a) -0.3 (b) -1/4 (c) 6 (d) -14 (e) -1 b Which is the third smallest value? (a) -0.14 (b) -34 (c) 0 c What is the smallest value in 4, -2/13, -1, -0.6? -1 What is the smallest value in 44, -104, 3? -104 Which is the third biggest value? (a) 7 (b) -0.2 (c) 11/2 b What is the third smallest value in 546, -2, -1/6? 546 Which is the second biggest value? (a) 1/8 (b) -3/8 (c) -1.8 b What is the fourth smallest value in 0, 0.1, -1/4, -169, 4/3? 0.1 Which is the fourth smallest value? (a) 32 (b) 2 (c) 4/5 (d) -0.4 a Which is the biggest value? (a) -1/4 (b) -5 (c) -2.5 (d) -1.3 a What is the biggest value in 2, 3/2, 0, -3/16? 2 What is the third smallest value in 4, -3, -24? 4 Which is the biggest value? (a) 0.6 (b) -223 (c) 1 c What is the third biggest value in -2, 62.2, 1? -2 Which is the smallest value? (a) -0.1 (b) -2/3 (c) 3/4 b What is the second smallest value in -1/2, 0.8, 1? 0.8 Which is the second smallest value? (a) 2/23 (b) 1 (c) 0 a Which is the fourth biggest value? (a) 0.1 (b) 3 (c) 1.7 (d) 2/3 a Which is the second smallest value? (a) -0.1 (b) -4 (c) 0.21 (d) -0.5 (e) -1/14 d What is the biggest value in -2, 5, 1071? 1071 What is the fifth biggest value in -2/25, -5, -2/15, -3, 0? -5 What is the biggest value in -0.2, -0.034, -1.6? -0.034 Which is the smallest value? (a) -71 (b) -3/4 (c) -3 a Which is the biggest value? (a) 13 (b) 3/28 (c) 4/5 a Which is the second biggest value? (a) -3/8 (b) 4 (c) 3 (d) 5 b Which is the third smallest value? (a) 1 (b) 71 (c) 0.05 (d) 0.4 a Which is the biggest value? (a) -0.4 (b) 499 (c) -4 b Which is the third biggest value? (a) 0 (b) 2 (c)	{ "pile_set_name": "DM Mathematics" }
the nearest to 0.2 in 0.31, 4, -4? 0.31 Which is the closest to 0.6? (a) 2/3 (b) -0.244 (c) 1/5 (d) 0.1 a Which is the nearest to -0.32? (a) 2 (b) 0.1 (c) -48 b What is the closest to 2/7 in 1/2, 0.4, -3/121? 0.4 Which is the nearest to 2/15? (a) 7 (b) -5 (c) -0.11 c Which is the nearest to 3? (a) 3/20 (b) -5 (c) -4/3 a What is the nearest to -0.3 in 3, 0, -33/8? 0 What is the closest to -0.137 in 2/7, -4, -1, -0.1? -0.1 What is the closest to 118 in -0.2, 2/5, 5? 5 Which is the closest to 7/5? (a) -0.1 (b) 0.1 (c) -0.4 (d) 0.5 d What is the nearest to 0.2 in -0.3, 14/13, 2? -0.3 Which is the nearest to 0? (a) 3/7 (b) 1 (c) -0.5 (d) -5 a What is the nearest to 3 in 2/7, 161, 4? 4 Which is the nearest to -1? (a) -0.1 (b) 1/10 (c) 4/7 a What is the nearest to 1/4 in -8, -1/4, 3, -3? -1/4 What is the nearest to -1 in 0.5, 2, -1, -37? -1 Which is the closest to 3/2? (a) -2/65 (b) 3 (c) -6 (d) 4 b What is the nearest to 25 in 5, 0.3, -2/7? 5 What is the closest to -2/3 in 2/3, -1/2, 2/9, 1640? -1/2 Which is the closest to -38? (a) 0.1 (b) 0.2 (c) 0.3 a What is the nearest to 9 in 2/13, 1/8, -0.039, -2? 2/13 Which is the closest to 0.2? (a) 1/4 (b) 0.2 (c) 2 b Which is the nearest to 0? (a) 2/3 (b) 2/13 (c) 0.1 (d) -1020 c Which is the nearest to 0? (a) -0.289 (b) 3/7 (c) -5 (d) -0.5 a Which is the closest to -3? (a) -0.05 (b) 2 (c) -2/13 (d) 2/9 c Which is the closest to -11? (a) 0.3 (b) 2 (c) -3 c Which is the nearest to -2/5? (a) -3 (b) 2 (c) 5 b What is the nearest to -0.1 in 1/5, 10, 1, 4? 1/5 What is the nearest to 0.2 in -21, 8, 0.2? 0.2 Which is the nearest to 3? (a) 0.102 (b) -1 (c) 2 c Which is the nearest to 3? (a) -1/5 (b) 6 (c) -42 b Which is the nearest to -2/3? (a) 0.5 (b) 1/5 (c) -7 b What is the nearest to 1/2 in 2, -1/4, -385? -1/4 What is the nearest to 0 in 41/4, -0.3, -2/5? -0.3 What is the nearest to 4 in -25, 4/3, 0.2? 4/3 What is the nearest to 2 in 1/33, 4, 3? 3 Which is the closest to -0.16? (a) -1 (b) 1 (c) -2/3 (d) 2/9 d Which is the nearest to -9? (a) 0.01 (b) -1/2 (c) 3 b What is the nearest to 0 in 2/7, 0.4, 3? 2/7 Which is the closest to -2/5? (a) 1/3 (b) -2/9 (c) -0.2 (d) 3 b Which is the closest to 0? (a) 2/17 (b) -1/3 (c) -5 (d) -0.068 d What is the closest to -1 in -4, 0.3, 14, 4/3? 0.3 Which is the closest to 16? (a) -0.2 (b) -4 (c) 5 (d) -7 c Which is the closest to 0? (a) -2/59 (b) -0.1 (c) 0.5 a Which is the closest to 0.1? (a) 1.9 (b) -0.1 (c) 0.01 (d) 0.45 c What is the closest to 0 in -0.1, 3/5, 272? -0.1 Which is the nearest to -9? (a) 0 (b) 5 (c) -1 (d) 2/5 c Which is the nearest to -0.26? (a) -0.4 (b) 15 (c) -4/9 a What is the closest to 2/11 in 0.5, -3, 1/5? 1/5 Which is the nearest to -1/4? (a) -1 (b) 0.3 (c) -2 b Which is the closest to 6/59? (a) 4 (b) 3 (c) -1/6 (d) -2/5 c What is the nearest to 1 in 26/23, 0, 0.5, -0.2? 26/23 What is the closest to 1 in 2/7, -3, 15/62, 0.3? 0.3 What is the nearest to 1/4 in 3, 2/81, -1/4? 2/81 Which is the closest to -0.23? (a) -3/5 (b) -0.5 (c) -0.2 (d) 1 c Which is the closest to -0.1? (a) 14 (b) 1 (c) -31 b What is the closest to 2 in -5, 2, -1/3, 1? 2 Which is the closest to 0.1? (a) -14/3 (b) -1 (c) 12 b Which is the nearest to 1/2? (a) -1 (b) 96 (c) -0.3 (d) 0 d Which is the closest to 2/7? (a) -0.5 (b) 10/7 (c) -37 (d) -3 a Which is the nearest to -0.05? (a) 3/4 (b) 5 (c) -2/5 (d) -0.5 c Which is the nearest to -0.02? (a) -5/2 (b) -3 (c) 1 (d) -0.6 d Which is the closest to 0.1? (a) 5 (b) 0.2 (c) 8 (d) 3 b Which is the nearest to 2? (a) -0.5 (b) -55 (c) 2 c Which is the nearest to 1? (a) -1 (b) -0.4 (c) -0.02 (d) -2/7 c Which is the closest to -0.4? (a) 2/33 (b) -1 (c) -0.2 c What is the closest to 4.9 in -0.5, -1, 4/7? 4/7 What is the closest to -0.06 in -65, -0.3, 4? -0.3 Which is the nearest to -6? (a) 0.4 (b) -0.1 (c) 0.3 (d) -2/7 d What is the closest to 2 in -14, 15, -4? -4 What is the closest to 0 in -107, 0.5, 5? 0.5 Which is the closest to 33/7? (a) -0.1 (b) 2 (c) 2/199 (d) 2/5 b Which is the nearest to 1? (a) 1 (b) -0.16 (c) -5 (d) -1 a Which is the nearest to 0.1? (a) 39 (b) 6 (c) 0.6 (d) 1 c What is the closest to -0.17 in -3, -0.3, 0, 1/2? -0.3 What is the nearest to -0.1 in -1/4, 1/2, 2/7, 1/4? -1/4 What is the closest to 3 in 41, -1/2, -12, 1/6? 1/6 Which is the closest to 0? (a) 7788 (b) -1/5 (c) 3/7 (d) -2 b What is the nearest to 6/7 in 6/5, 0.4, -2? 6/5 What is the closest to -5 in -5, -0.3, 0.4, 0.2? -5 Which is the nearest to 1? (a) -2/5 (b) -2 (c) -1/6 c Which is the closest to 0.001? (a) 2/7 (b) -2 (c) 0 c What is the closest to -6 in 2/7, -111, -4? -4 Which is the closest to 12? (a) 3 (b) -5 (c) -2 a Which is the closest to 2/21? (a) -0.5 (b) -5 (c) 0 (d) 0.1 d What is the nearest to -5 in -1/3, -4, 2, 1/3? -4 Which is the nearest to 0? (a) -2/3 (b) -0.3 (c) -29 (d) 4 b What is the closest to 13 in 0.5, -58, -0.04? 0.5 What is the nearest to -0.1 in 11, -67, -5? -5 What is the nearest to 0 in 2/9, 0.12, -1/4, -0.5? 0.12 Which is the nearest to 1/6? (a) 2 (b) 7 (c) 1/17 c What is the closest to -0.1 in 0.3, -2/151, 6? -2/151 Which is the nearest to -5? (a) 0 (b) 1 (c) 0.1 a Which is the closest to -0.03? (a) 19 (b) -5 (c) 0.5 (d) 4 c What is the nearest to -2 in 6, -1, -16? -1 Which is the closest to -9? (a) -0.2 (b) 0.4 (c) -4 (d) -118 c Which is the nearest to -2/7? (a) -0.09 (b) 12 (c) -0.1 c Which is the nearest to 2/15? (a) -0.5 (b) -1 (c) -0.4 (d) 0.1 d What is the nearest to -2 in -0.4, 5, -235? -0.4 What is the nearest to 2/7 in 268, 0.2, -4? 0.2 What is the nearest to 1 in 4, -2/81, 0? 0 What is the closest to -0.1 in 0.1, 4, -1, -2/51? -2/51 What is the closest to -2/9 in 0.01, 3, 5, 0.5? 0.01 Which is the closest to 2/3? (a) 0 (b) -2/11 (c) -0.1 (d) -1/2 a What is the closest to -3 in 8, 1, 0.3, 2/17? 2/17 Which is the nearest to -1? (a) -3 (b) 17 (c) -0.4 c Which is the nearest to 0? (a) -2/11 (b) -2 (c) 3 (d) 4 a Which is the nearest to 0? (a) -100 (b) 5/6 (c) 2 b Which is the closest to 1/3? (a) -3 (b) -0.5 (c) 0.1167 c What is the nearest to 3/5 in 0.5, -6, -2/15, 1? 0.5 What is the closest to -2/13 in 2, -0.4, -0.05? -0.05 What is the nearest to -2 in -0.1, 2/5, 98/9? -0.1 Which is the nearest to 1? (a) -7.92 (b) 0.1 (c) 4 b Which is the closest to -1? (a) 4 (b) 0.5 (c) 15 (d) -4 b What is the nearest to -1/3 in -3/161, 2/11, -3? -3/161 What is the closest to -54 in 0.4, -2/9, 2? -2/9 What is the nearest to -1 in 7/2, 2, 1, -0.2? -0.2 Which is the nearest to 0.1? (a) 5/11 (b) -0.3 (c) -5 (d) -0.1 d What is the nearest to 2358 in 5, 1, -5? 5 Which is the closest to -1? (a) -0.4 (b) 3.2 (c) 0 (d) 1/8 a Which is the nearest to -4? (a) -0.5 (b) 3/10 (c) -2 (d) 2/21 c What is the closest to -2/13 in -0.4, -2/57, 0.1, -5? -2/57 What is the nearest to 0.2 in 65/2, 1/3, -0.1? 1/3 Which is the nearest to 0.1? (a) 18 (b) 5 (c) 2/11 (d) -2 c What is the nearest to 0 in -39, -4, -1/4, -5? -1/4 What is the closest to 26 in 0, 0.1, -0.4? 0.1 What is the closest to 5 in -5, -3, -1/3? -1/3 What is the nearest to -3 in -1, 3, 0.1? -1 Which is the nearest to 11? (a) 1 (b) 8 (c) -0.5 b Which is the closest to 283? (a) -2/19 (b) 0 (c) 0.3 (d) 3 d What is the closest to -4 in -0.5, -1, 7? -1 Which is the nearest to 0? (a) -5/2 (b) -0.2 (c) -3 b Which is the nearest to 35? (a) 5 (b) 0.3 (c) -0.3 a Which is the closest to -6? (a) 0.06 (b) 0.69 (c) 0.3 (d) 4 a Which is the nearest to -2/7? (a) -3/4 (b) 0.5 (c) 0.3 (d) 5 a Which is the nearest to 1? (a) -0.2 (b) 5 (c) 1 (d) -2/3 c What is the nearest to -0.3 in -16, -5, 0.3, -0.3? -0.3 What is the closest to 1/3 in 3, -2/3, -0.058? -0.058 Which is the nearest to -45? (a) -5 (b) 2/3 (c) 5 (d) -3 a Which is the nearest to 2? (a) -3/2 (b) -70 (c) 2 c Which is the nearest to -3? (a) 1/269 (b) 4 (c) -0.1 c Which is the closest to -0.1? (a) -12 (b) -0.5 (c) 20 b What is the closest to -2 in -0.3, 3/2, 2/11? -0.3 What is the nearest to 0.2 in -6, 0.05, 29? 0.05 What is the nearest to 1 in -4/3, -2/15, -3, 0.05? 0.05 What is t	{ "pile_set_name": "DM Mathematics" }
the terms in -259f2 - 635f*2 - 452f*2 - 314f*2. -1660f*2 Collect the terms in -3 + 80s*2 - 4 - 93s*2 + 7. -13s*2 Collect the terms in -3j - 30655j2 - 30680j*2 + 3j + 61355j2. 20j*2 Collect the terms in 4 + 630w - 34w - 2w*3 - 2. -2w*3 + 596w + 2 Collect the terms in -15 - 2 + 17 - 37o + 6o*3. 6o*3 - 37o Collect the terms in -498p + 1 - 348p + 853p - 1. 7p Collect the terms in -13311u + 26621u - 13311u. -u Collect the terms in 127962y + 4 - 4. 127962y Collect the terms in -772448 + 772448 + 42b*2. 42b*2 Collect the terms in 61c*2 - 354 - 358 + 712. 61c*2 Collect the terms in 36i*2 + 12i*2 - 2i*2 + 26i*2. 72i*2 Collect the terms in 1536q - 2928q + 1407q. 15q Collect the terms in 466a - 142 + 433 - 140 - 147. 466a + 4 Collect the terms in -50o - 41o - 3o*2 + 105o - 14o. -3o*2 Collect the terms in 4927 + 2385 + 0x - 2x. -2x + 7312 Collect the terms in 180p2 + 172 - 186 - 21p*2. 159p*2 - 14 Collect the terms in 439 - 217 + 985h*2 - 222 - 255h*2. 730h*2 Collect the terms in 2d - 20d + 17d - 210d2 + 28d*2. -182d*2 - d Collect the terms in -344k*2 + 344k*2 - 324k*3 + 10k. -324k3 + 10k Collect the terms in -10q2 - 3q*3 - 7q*2 + 7q*2 + 10q*2. -3q*3 Collect the terms in -4114v*3 - 2v*2 - 1890v*3 - 3v + 4v. -6004v*3 - 2v*2 + v Collect the terms in 6b*3 + 17b*2 - 60b + 21b3 - 29b*3 + 60b. -2b3 + 17b*2 Collect the terms in 5n - 8n + 36n + 13n. 46n Collect the terms in 3730551 - 3730551 + r2. r2 Collect the terms in 2u - 257 + 93u*2 + 257. 93u*2 + 2u Collect the terms in 4315858 - 4315858 + 2l2. 2l*2 Collect the terms in -295m*3 + 100m*3 + 153m*3. -42m*3 Collect the terms in 238s*3 - 5961 + 5961 - 95s*3 - 142s3. s3 Collect the terms in -21566f3 + 15862f*3 - 23894f*3. -29598f3 Collect the terms in -i3 - 70i3 - 22 + 22. -71i*3 Collect the terms in -1599o - 1600o + 4802o + 1 + 0 - 1601o. 2o + 1 Collect the terms in 780f3 + 2f - 2f - 860f*3 + 2. -80f*3 + 2 Collect the terms in -3x + 2x + x + 605 - x. -x + 605 Collect the terms in -s - 196 - 8s - 36. -9s - 232 Collect the terms in -273t*2 - 225t*2 - 1036t*2 - 3t + 3t. -1534t*2 Collect the terms in 205482 - 205482 - 3r. -3r Collect the terms in 16j*3 - 222 + 222 - 16j*3 + 2j*3. 2j*3 Collect the terms in -20z - 12z - 28z + 63z. 3z Collect the terms in 27a - 15a - 14a + 22a - 15a. 5a Collect the terms in -39h - 2 + 0 + 3 - 1 + 33h. -6h Collect the terms in 2q + 6962632 - 7q2 - 6962632 + 23q*2. 16q*2 + 2q Collect the terms in -404399 + 13f3 + 404399. 13f*3 Collect the terms in -258 + 731u + 129 + 5u + 129. 736u Collect the terms in 13x + 1198 - 8x + 1179 - 2377. 5x Collect the terms in -b + 1173309 - 1173309. -b Collect the terms in -4w*3 + 1133w + 1147w + 1135w - 3415w. -4w*3 Collect the terms in 5g*3 + 14439g - 14439g + 3g*3. 8g*3 Collect the terms in -3f - 14 + 33 - 13 - 11. -3f - 5 Collect the terms in -8405162h - 4 + 4 + 8405162h - 10h*2. -10h*2 Collect the terms in 138z*2 + 239z*2 + 241z*2 - 409z*2. 209z*2 Collect the terms in 227159n*2 - 113590n*2 - 113586n*2. -17n*2 Collect the terms in 5q - 10q - 3q*2 + 102 + 5q + q*2. -2q*2 + 102 Collect the terms in 4y - 4y - 7282y*3 + 7729y*3. 447y3 Collect the terms in -m2 + 8m + 0 - 4 + 14m + 15m. -m2 + 37m - 4 Collect the terms in -32m - 125m - 38m - 37m + 230m. -2m Collect the terms in -57131s3 + 114242s*3 - 57118s*3. -7s*3 Collect the terms in 155o + 92o - 525 + 526 - 3o. 244o + 1 Collect the terms in -3d*2 + 12d*3 + 33d*3 - 40d*3. 5d*3 - 3d*2 Collect the terms in -3d + 55d - 10d - 13d - 5d. 24d Collect the terms in 67014 + 2q*3 - 67014. 2q*3 Collect the terms in 114129z - 114103z - 1 + 1. 26z Collect the terms in -3234q2 - 36q + 14q + 22q. -3234q2 Collect the terms in 1316q*2 - 1319q*2 + 16q - 23q. -3q*2 - 7q Collect the terms in 582999 + 2p2 - p2 - 582999. p2 Collect the terms in 375666p + 375670p - 751332p. 4p Collect the terms in -394f - 4 + 4 + 396f. 2f Collect the terms in -36x + 189x - 21x - 73x. 59x Collect the terms in -12 - 6 - 143t - 4. -143t - 22 Collect the terms in -252i - 14i3 - 2i*3 + 534i - 285i. -16i*3 - 3i Collect the terms in -535q3 + 2492q - 2492q. -535q*3 Collect the terms in -o - 36650o*2 + 18322o*2 + o + 18331o*2. 3o*2 Collect the terms in 20s*2 + 129s*2 - 281s*2 + 133s2. s2 Collect the terms in 13w2 - 3040w - 3054w + 6094w. 13w2 Collect the terms in 7k2 - 13 - 15 + k2 + 7. 8k2 - 21 Collect the terms in -8q*3 + 38676 - 7q*3 - 77347 + 38671. -15q*3 Collect the terms in 2 + 1421y*2 - 2 + 210y*2 - 124y*2. 1507y2 Collect the terms in -84 - 67 + v2 + 151 - 6v2. -5v*2 Collect the terms in -509 + 200o + 509 - 66o - 68o. 66o Collect the terms in -1 + 10f + 1 - 16f - f. -7f Collect the terms in -20p2 + 8p*2 - 72p*3 - 251p*3. -323p*3 - 12p*2 Collect the terms in 705c - 354c + 182c*2 + 231c*2 - 351c. 413c2 Collect the terms in -6o*3 - 59o + 12o + 18o + 18o + 11o - 6o2. -6o*3 - 6o2 Collect the terms in -k2 + 382543067 - 382543067. -k2 Collect the terms in -n2 - 762n + 2 + 7n*2 - 3 - 186n. 6n2 - 948n - 1 Collect the terms in -967j - 817j - 1469j. -3253j Collect the terms in 681g2 - 305g*2 - 293g*2 - 212g*2. -129g*2 Collect the terms in 7s - 1341 + 648 + 693. 7s Collect the terms in -189882s + 379746s - 189864s + 5s2. 5s*2 Collect the terms in 51o*3 - o - 21o*3 + 2o - 26o. 30o*3 - 25o Collect the terms in 87 - 50 + 4c - 8 - 10 - 19. 4c Collect the terms in -1991z - 9z*3 + 3z*3 + 1991z. -6z3 Collect the terms in -f2 + 6f*2 + 14f*2 - 24f*2. -5f*2 Collect the terms in 2w + 82843 - 82843 - 2w + 107w*2. 107w*2 Collect the terms in -148y + 199y + 207y + 212y + 97y. 567y Collect the terms in 12719 + f - 12719 + 4f. 5f Collect the terms in 4d*2 - 18d*2 - 164d*2. -178d*2 Collect the terms in 6y - 6y + 44y*3 + 18y*3. 62y*3 Collect the terms in 62b + 96b - 159b. -b Collect the terms in -8n - 19895 + 19895. -8n Collect the terms in -19a - 42a + 60a. -a Collect the terms in 123z*3 - 120z*3 + 6517z*2 - 6540z*2. 3z*3 - 23z*2 Collect the terms in 82q*3 - 91q*3 + 25q*3. 16q*3 Collect the terms in 10q - 870q3 + 55q*3 - 10q. -815q3 Collect the terms in -56j + 71j - 685 + 340 + 346. 15j + 1 Collect the terms in 5f2 - 46f*2 - 42f + 12f2 - 40f*2. -69f*2 - 42f Collect the terms in -2s + 1969642s*3 + 2s - 1969639s3. 3s*3 Collect the terms in -77u*2 - 92u*2 + 2u*2 + 11u*2 + 3 - 5. -156u*2 - 2 Collect the terms in 2y - 90y2 - 207y*2 - 2y - 598 + 601. -297y2 + 3 Collect the terms in -28512q*2 + 14200q*2 + 14263q*2. -49q*2 Collect the terms in -3r*3 - 3680 - 3689 + 11072 - 3703. -3r*3 Collect the terms in 13y + 10y - 1424 - 27y. -4y - 1424 Collect the terms in -324 + 8p + 10p - 34p + 15p. -p - 324 Collect the terms in -230f - 233f - 18f*2 + 21f*2 + 463f. 3f2 Collect the terms in -6820o*3 + 11788o*3 - 4965o*3. 3o*3 Collect the terms in 0 + 0 + 15136h*2 + 3795h*2. 18931h*2 Collect the terms in -257z*2 - 211z*2 - 55z*3 + 154z*3 + 468z*2. 99z*3 Collect the terms in -26o + o*2 - 24o - 576o3 + 50o. -576o3 + o2 Collect the terms in 228z*3 + 9297z - 9297z. 228z*3 Collect the terms in -369d*2 - 26d - 20d + 49d + 376d2. 7d*2 + 3d Collect the terms in 37o2 + 33o*2 + 22o - 73o2 - 22o. -3o2 Collect the terms in 3j - 333 + 0j + 108 + 114 + 111. 3j Collect the terms in -3 - 1063l2 - 444l*2 + 2. -1507l*2 - 1 Collect the terms in -34v*2 + 11v - 42v2 + 75v2. -v2 + 11v Collect the terms in 78 - 120 + 4f*2 - 5f2. -f2 - 42 Collect the terms in -3 - 11i + 4i + 17i. 10i - 3 Collect the terms in -512 + 512 - 5122f2 + 5078f*2. -44f**2 Collect	{ "pile_set_name": "DM Mathematics" }
3847 composite? False Is 2126129 prime? True Is 187903813 composite? True Is 209099 prime? False Is 40109519 a composite number? True Is 17927797 a prime number? True Is 47565239 a prime number? False Is 53863867 composite? False Is 164359537 a composite number? False Is 271727 a prime number? False Is 486601 a composite number? False Is 30092357 a prime number? True Is 4018115 a composite number? True Is 81033143 a composite number? True Is 739817165 a composite number? True Is 1262377 composite? False Is 16329719 a prime number? False Is 151591 composite? True Is 3827611 composite? False Is 4564187 composite? True Is 2388893 composite? True Is 2686993 a composite number? False Is 1976413 a prime number? False Is 12324761 composite? False Is 201257 composite? True Is 1435901 a prime number? True Is 87519 prime? False Is 7721761 a prime number? True Is 22336499 composite? False Is 4764469 a composite number? False Is 186587309 a composite number? False Is 9067087 prime? True Is 21630787 prime? False Is 175992409 a prime number? False Is 3471935 a composite number? True Is 4722427 a composite number? True Is 73957613 prime? False Is 7318397 composite? False Is 39731579 prime? True Is 106473671 a composite number? False Is 1716761 a composite number? False Is 17591233 composite? True Is 2109235 composite? True Is 18065617 composite? False Is 517429637 a composite number? True Is 971765 a composite number? True Is 337849 a prime number? False Is 12258013 composite? True Is 611057 composite? False Is 258650113 composite? False Is 230450933 a prime number? False Is 554621 a composite number? True Is 273218989 a prime number? False Is 51755731 composite? False Is 2090927 composite? True Is 152557 a composite number? True Is 8733409 a composite number? True Is 24834319 prime? False Is 4020493 composite? False Is 141247123 a prime number? True Is 3307559 prime? True Is 19706543 a prime number? True Is 1960033 composite? False Is 117148657 prime? True Is 1353643 composite? True Is 144635917 a composite number? False Is 10575911 a composite number? False Is 3213227 prime? False Is 115601807 composite? False Is 197760295 a prime number? False Is 3453403 a composite number? False Is 52890907 a prime number? True Is 4533349 prime? True Is 26149247 a composite number? True Is 210057 prime? False Is 6773189 prime? True Is 78482951 prime? True Is 1399549 a composite number? False Is 194344891 a prime number? False Is 3357593 a composite number? False Is 76202953 composite? False Is 1542661 prime? True Is 11859395 composite? True Is 82615963 a prime number? True Is 8460215 prime? False Is 846901 a composite number? True Is 2518951 prime? True Is 13879499 composite? True Is 699562679 prime? False Is 2407511 a prime number? False Is 10468351 composite? True Is 8931493 a prime number? True Is 243305903 prime? False Is 819193 composite? True Is 38282693 composite? False Is 49095839 composite? True Is 38839763 a composite number? False Is 21672481 a composite number? False Is 3561763 prime? False Is 16054141 a prime number? True Is 759042743 prime? True Is 278777 a prime number? False Is 5170351 prime? True Is 2239465 a composite number? True Is 7331147 prime? True Is 418699037 composite? True Is 328618151 a prime number? True Is 17056037 composite? False Is 52689067 prime? False Is 332293 prime? False Is 93523031 a composite number? True Is 694817 composite? True Is 37841149 prime? True Is 267767287 a composite number? False Is 20621 prime? False Is 9686647 a prime number? True Is 9794311 a composite number? False Is 55169251 a prime number? False Is 3832993 a prime number? True Is 9296057 prime? False Is 34753519 composite? True Is 384535 a prime number? False Is 51587351 composite? False Is 6030589 composite? True Is 556185605 a prime number? False Is 4621639 composite? True Is 331651 composite? False Is 1117513 a composite number? False Is 98389637 a prime number? False Is 24340583 a prime number? False Is 235505527 composite? True Is 12272711 a prime number? False Is 11740501 composite? False Is 157234493 prime? False Is 10661837 a prime number? False Is 29321119 a composite number? True Is 170535362 prime? False Is 965003 a composite number? True Is 4669051 prime? True Is 8187749 a composite number? True Is 1570837 prime? True Is 7026013 a composite number? False Is 373547123 composite? False Is 33721747 prime? True Is 42035417 a prime number? True Is 1013603 composite? False Is 187273 prime? True Is 231066457 a prime number? True Is 409271017 composite? True Is 18123781 composite? True Is 4541837 a composite number? True Is 98986378 prime? False Is 14694571 prime? True Is 9399979 a prime number? False Is 1908041 composite? False Is 153631969 a prime number? True Is 184453067 a prime number? False Is 184160681 prime? True Is 59663767 composite? False Is 930595 a prime number? False Is 54207229 a composite number? False Is 22602831 a composite number? True Is 7340407 a prime number? False Is 126682814 a composite number? True Is 296073803 a composite number? True Is 1079242 a composite number? True Is 2127469 prime? False Is 1314772769 prime? True Is 104250931 composite? False Is 1432901 composite? True Is 101809667 prime? False Is 283580389 prime? False Is 5849969 prime? True Is 605959 prime? False Is 330325661 prime? True Is 334193 composite? True Is 1760722 a composite number? True Is 189464879 a composite number? False Is 12580483 composite? False Is 5313797 a prime number? True Is 1195663 prime? False Is 41914063 a prime number? True Is 288243719 composite? False Is 4260209 a prime number? True Is 804443 a prime number? True Is 2134205 composite? True Is 3960409 prime? False Is 26924693 composite? True Is 2497476265 composite? True Is 1105801 a prime number? False Is 392361589 composite? False Is 2677937 composite? False Is 13550557 prime? True Is 1923611 a prime number? True Is 105326261 a prime number? False Is 13415399 a prime number? True Is 4279083 a prime number? False Is 682411 composite? False Is 135533 prime? True Is 892817333 composite? False Is 2220419 prime? True Is 4020671 prime? True Is 20216458 prime? False Is 817837 a composite number? False Is 22573703 a prime number? True Is 1279939 prime? False Is 28136939 composite? True Is 39460535 prime? False Is 5826785 a prime number? False Is 208572889 a prime number? False Is 4351 a composite number? True Is 357933593 a prime number? True Is 64768651 composite? False Is 2627743 composite? True Is 33924434 prime? False Is 33648157 a composite number? False Is 9582121 prime? False Is 21316091 a prime number? True Is 612923 prime? True Is 19231321 a composite number? True Is 276018133 composite? False Is 135517189 a prime number? True Is 3802187 a composite number? False Is 8215153 a composite number? False Is 67466293 a composite number? False Is 5770343 a prime number? True Is 35130253 prime? False Is 2236943 prime? True Is 11870393 composite? False Is 523741 a prime number? True Is 234280803 prime? False Is 1085551 composite? False Is 117556451 a composite number? True Is 125262781 composite? True Is 1266101 a composite number? False Is 5420917 a composite number? False Is 39374903 a composite number? True Is 84897335 prime? False Is 619967 composite? False Is 3083683 a prime number? True Is 18957247 a composite number? False Is 5729029 a prime number? False Is 2660417 composite? False Is 1399799 a composite number? True Is 47773541 a composite number? False Is 170107867 a prime number? False Is 257746249 a prime number? True Is 573569 a composite number? False Is 7344041 a prime number? True Is 1387667 composite? False Is 5175187 composite? False Is 8519101 a prime number? False Is 820271 prime? True Is 76112987 composite? False Is 56959863 a composite number? True Is 20058301 prime? True Is 15360109 a prime number? True Is 837714113 prime? True Is 333841 a composite number? True Is 6585983 prime? True Is 5158411 composite? False Is 1520567 composite? True Is 119519 composite? True Is 665529519 a composite number? True Is 5493811 prime? True Is 3204538 a composite number? True Is 2163529 a composite number? True Is 19447339 composite? True Is 120449523 composite? True Is 1528559 prime? Fals	{ "pile_set_name": "DM Mathematics" }
he remainder when 18 is divided by c + w/(28/(-8)). 3 Let d = 734 + -648. Calculate the remainder when d is divided by 85. 1 Let c(l) = 17l - 359. What is the remainder when c(30) is divided by 80? 71 What is the remainder when 72 is divided by (1/(-3))/(452/(-150) - -3)? 22 What is the remainder when ((-650)/(-4) - -4) + 4/(-8) is divided by 62? 42 Suppose 5q - 5 = 0, 30 = -4v + 2q - 4. Let y = v + 17. Suppose -4k + 2k = -52. Calculate the remainder when k is divided by y. 8 Suppose 1479 = 6f + 1281. Calculate the remainder when f is divided by 17. 16 Suppose -18u + 12u = 54. Let r = 27 + u. What is the remainder when 33 is divided by r? 15 Let l = 76 + -52. Calculate the remainder when 131 is divided by l. 11 Suppose 5z + 3j - 15 = 2j, -5 = j. Suppose -3r - z + 127 = 0. Calculate the remainder when r is divided by 21. 20 Let t be (-4)/1 - (2 - 14). Let k be t + 10/(-15)6. Suppose 101 = kj - 5w, -2j = 3w + w - 18. What is the remainder when 93 is divided by j? 17 Let r = 699 + -670. What is the remainder when 74 is divided by r? 16 Let m(h) = 6h + 32 + 0h - 38 + 3h. Suppose 5i = -p - 5, 4 = 2p - 4i - 14. Calculate the remainder when m(p) is divided by 14. 11 What is the remainder when 112 is divided by ((-288)/168)/(2/(-28)1)? 16 Let c(v) = 2v*2 - 31v - 98. Calculate the remainder when 736 is divided by c(20). 80 Let g(k) = k*2 - 21k + 293. Calculate the remainder when g(10) is divided by 31. 28 Let y(x) = 5x2 - 15x + 11. What is the remainder when y(4) is divided by 22? 9 Suppose -2h + 7 = -3. Let i = 429 - 417. Let t = i + h. Calculate the remainder when 33 is divided by t. 16 Let r be (-9 + 3)/(3/(-8)). Let w = 9 + r. What is the remainder when 49 is divided by w? 24 Suppose 0 = 31o - 34o + 105. What is the remainder when o is divided by 13? 9 Let p(n) = -52n - 772. Let z = -30 - -59. What is the remainder when p(-17) is divided by z? 25 Let y = -304 - -312. Suppose 0 = 3a - 2a - 31. Calculate the remainder when a is divided by y. 7 Let c = 330 - 300. Calculate the remainder when c is divided by 16. 14 Let s(q) = -4q - 1. Let r = -76 - -76. Suppose r = 2w - 16. Calculate the remainder when s(-8) is divided by w. 7 Let c(o) = -o*2 - 14o - 16. Let m be c(-12). Suppose mw = 12w - 68. What is the remainder when 83 is divided by w? 15 Let n = -16 + 9. Let f(x) = 3x2 + x + 14. Let d(c) = c2 + c + 1. Let v(r) = 4d(r) - f(r). Calculate the remainder when v(n) is divided by 5. 3 Let w = 132 + -124. What is the remainder when 190 is divided by w? 6 Let b = -39 + 44. Suppose -37 - 129 = -2v - 4l, -2v + bl + 148 = 0. Calculate the remainder when v is divided by 27. 25 Suppose -25 = -f - 5y + 5, 0 = 4y - 12. Let o be 6/15 + (-111)/f. Let b = o - -10. What is the remainder when 9 is divided by b? 0 Let w = -13 + 22. Let l = -16 + 10. What is the remainder when -6l/w7 is divided by 10? 8 Suppose 0 = 4y + 4g + 60, 2y + g = 2g - 18. Let a(z) = -3z - 16. What is the remainder when 33 is divided by a(y)? 16 Suppose -38t = 35t - 4964. What is the remainder when 313 is divided by t? 41 Let r(m) = -m3 - 41m*2 - 51m - 193. What is the remainder when r(-40) is divided by 81? 4 Let o(y) = 128y - 22. Calculate the remainder when o(12) is divided by 101. 100 Let t(g) = g3 - 13g*2 + 31g + 32. Calculate the remainder when 173 is divided by t(10). 5 Let l be 12/(-3) + (2 - (0 - -2)). Let u(p) = -9p2 - 2p - 1. Let m be u(-1). Let a = l - m. Calculate the remainder when 8 is divided by a. 0 Let d(y) = -2y + 164. Let q be d(36). Suppose 2v = -0v. Suppose z = -3s + 16, v = -0z + 4z - 2s - q. Calculate the remainder when 86 is divided by z. 20 Let y = 60 + -64. What is the remainder when 5 is divided by ((-2)/(-3))/((-3)/90y)? 0 Let x = -35 + 39. Calculate the remainder when 70 is divided by (x + 0)6/1. 22 Let g be 1/(9/147)6. Suppose -m - g = -5m - h, -2h = -3m + 68. Suppose 0 = 10s - 14s + 184. Calculate the remainder when s is divided by m. 22 Let z(l) = 2l*2 - 10l - 110. What is the remainder when z(-35) is divided by 117? 116 Let x = -70 - -98. Let s = -30 - -35. Suppose -8h - 8 = -4h, -5q + 30 = sh. Calculate the remainder when x is divided by q. 4 Let k(j) = j*3 + 5j*2 + 12 - 14 + j - 2j. Let r be k(-5). Suppose -71 + 2 = -rq. What is the remainder when q is divided by 5? 3 Suppose -2v - 96 = -2w, -w - 18 - 36 = v. Let n be (-46)/11 - 18/(-99). Let q = n - v. What is the remainder when q is divided by 10? 7 Let l = 92 + -58. Calculate the remainder when l is divided by 14. 6 Suppose 0w + 88 = -4w. Let s = w - -37. Calculate the remainder when s is divided by 4. 3 Suppose 0 = -316g + 312g + 20. What is the remainder when 9 is divided by g? 4 Let s(z) = z3 + 4z*2 + 3z + 2. Let o be s(-4). Let l = 35 + o. Calculate the remainder when 49 is divided by l. 24 What is the remainder when 45 is divided by ((-6)/(-24))/((-6)/(-480))? 5 Let m be -6 + 4 - -15. Suppose 0 = 2f + mv - v - 40, v = 2. What is the remainder when (-551)/(-8) - 6/(-48) is divided by f? 15 Calculate the remainder when (-56)/(-7) - 0 - -87 is divided by 31. 2 Suppose -h + 10 = 5y, -22h + 23 = -17h - 2y. Let o(l) = -l2 + 5l + 1. Calculate the remainder when o(3) is divided by h. 2 Suppose -273 = -8n + 207. What is the remainder when n is divided by 16? 12 Suppose 3h = 4v - 474, -40v + 2h - 364 = -43v. What is the remainder when v is divided by 62? 58 Let b = 146 + -141. Suppose 5a - 27 + 2 = 0, 40 = v - ba. Calculate the remainder when v is divided by 11. 10 Let m(h) = -27h - 60. Calculate the remainder when m(-4) is divided by 10. 8 Let r be -3236/(-48) - (-4)/16. Calculate the remainder when 93 is divided by ((-3)/(-2))/(r/190). 17 Let j = -625 - -640. What is the remainder when 92 is divided by j? 2 Let s = -704 + 747. What is the remainder when 229 is divided by s? 14 Let f(j) = 9j - 31. Calculate the remainder when 21 is divided by f(4). 1 Let o(b) be the second derivative of -b3/3 + 3b*2 + 7b. What is the remainder when 34 is divided by o(-3)? 10 Suppose -3d + 2f + 479 = 0, 3f + 1140 = 5d + 342. What is the remainder when d is divided by 21? 12 Let j be (-44)/(-66) - (0 + 268/6). Let i = j + 63. What is the remainder when 53 is divided by i? 15 Let s = -16 + 23. Let f(a) = a*2 + 8a + 20. Let d be f(-6). Suppose v = -4y + d, -3v + y = 3 - 40. Calculate the remainder when v is divided by s. 5 Let p = -18 - -22. Suppose 0 = -ps + 36 - 8. Calculate the remainder when 27 is divided by s. 6 Let w = -2 - 26. Let n = w - -28. Suppose -2f + nf = -38. Calculate the remainder when f is divided by 11. 8 Let z(j) = j3 + 9j*2 + 5j - 9. Let n(o) = o*2 - o - 29. Let t be n(0). Let b = t - -21. What is the remainder when 41 is divided by z(b)? 11 Let a(q) = 2q*2 + 10q + 16. Suppose -2v + 5f + 1 = 0, -4v + 3f + 9 = -0f. Calculate the remainder when a(-5) is divided by v. 1 Suppose 26x - 25x = -5y + 7379, 0 = 2y - 2x - 2942. Calculate the remainder when y is divided by 87. 83 Let g = 29 - 21. Suppose a = 155 - 35. Suppose -4h - a = -2p - 10, 5h = -20. Calculate the remainder when p is divided by g. 7 Suppose -11l - 5 + 104 = 0. Suppose -6v + lv - 60 = 0. Calculate the remainder when 48 is divided by v. 8 Let h be (-1204)/(-32) - (-12)/32. Suppose 8r - 122 = h. Calculate the remainder when r is divided by 13. 7 Let i(x) = x3 - 3x*2 - 3x. Let f be i(4). Let y = -32 - -57. Calculate the remainder when y is divided by 39/6 - (-2)/f. 4 Let a(z) = -z*3 - 4z*2 - 17z - 96. Let f = -3 + 8. Calculate the remainder when a(-5) is divided by f. 4 Suppose 0g - 5g = 2n - 78, 3g - 3n - 30 = 0. Calculate the remainder when 0 + 88/6 - (-4)/(-6) is divided by g. 0 Let n = 132 + -122. Suppose 0 = 5c - nc - 3w + 67, 2c = 5w + 2. What is the remainder when 38 is divided by c? 5 Let z be (1/(-3))/((-15)/135). Suppose 3v + 0h = -zh + 135, 27 = v - 5h. What is the remainder when v is divided by (-3 + 4)/(1/15)? 12 Suppose 33x - 343 = 185. What is the remainder when 84 is divided by x? 4 Suppose t = 5n + 7 - 39, 0 = -n + 1. Let z = 53 + t. Let u = z - 21. What is the remainder when 7 is divided by u? 2 Suppose -85 = -34*m + 85. Calcula	{ "pile_set_name": "DM Mathematics" }
in 30x + 32x + 29x - 133x + 37x. -5x Collect the terms in 2 - 2 + 10c. 10c Collect the terms in 35 - 17 + m - 18. m Collect the terms in -5j3 + 19j*3 - 4j*3. 10j3 Collect the terms in -z3 - 70z2 - 67z*2 + 137z2. -z3 Collect the terms in 2 + 156t2 - 163t*2 - 2. -7t*2 Collect the terms in 0l*2 - 7l*2 - 24l*2. -31l*2 Collect the terms in 2592i*3 - 866i*3 - 862i*3 - 870i*3. -6i*3 Collect the terms in 49x + 51x - 148x + 49x. x Collect the terms in g3 - 23g + 95g + 45g. g*3 + 117g Collect the terms in 2 - 182h - 2. -182h Collect the terms in 1169h2 - 581h*2 - 590h*2. -2h*2 Collect the terms in 6k*2 - 16k*2 + 30k*2. 20k*2 Collect the terms in 4113k - 7k3 - 4113k - 2k3. -9k*3 Collect the terms in 46j*3 + 48j*3 - 95j3. -j3 Collect the terms in -11m2 - 2m*2 + 8m*2. -5m*2 Collect the terms in 167k*2 + 54k*2 - 6 + 5 + 2. 221k*2 + 1 Collect the terms in 57v - 56v + 3 - 3 + v2. v2 + v Collect the terms in -6510 - 2b + 6510. -2b Collect the terms in 348o*2 + 354o*2 - 699o*2. 3o*2 Collect the terms in -h + 0h + 0h + 3h - 211h2. -211h*2 + 2h Collect the terms in -7 + 5 + 6 - i + 9. -i + 13 Collect the terms in 3 - 10o3 - o + 3o - 2o. -10o*3 + 3 Collect the terms in 4u*3 - 34u + 0u3 - 4u*3 + 6u*3. 6u*3 - 34u Collect the terms in 2q3 + 4 - 4 + q - q. 2q*3 Collect the terms in -19j*3 - 1 + 1 + 21j*3. 2j*3 Collect the terms in -89n*3 + 1 - 1 + 0n*3. -89n*3 Collect the terms in -189 + 376 - 2s*2 - 7s*2 - 187. -9s*2 Collect the terms in -39i - 337i3 + 39i. -337i3 Collect the terms in -1052o*2 - 4 + 4. -1052o*2 Collect the terms in 5197 - 12w - 5197. -12w Collect the terms in 10o - 6o - 3 + 3 + 0. 4o Collect the terms in 12w2 - 3w*2 - 7w - 2w2. 7w*2 - 7w Collect the terms in 0m3 + 19m*3 - 2m*3 + 26m*3. 43m*3 Collect the terms in -2o + 2o - 8o*3. -8o*3 Collect the terms in 225f - 458f + 229f. -4f Collect the terms in -110k + 55k + 57k. 2k Collect the terms in -4s*2 - 33s*2 - 4s*2. -41s*2 Collect the terms in 0r*3 - 16r*3 + 5r*3 + 10r3. -r3 Collect the terms in -98q + 3q*3 + 5q*3 + 94q. 8q3 - 4q Collect the terms in -48f3 + 67f*3 - 66f*3. -47f*3 Collect the terms in 184r*3 + 17r*2 - 11r*2 - 6r*2. 184r*3 Collect the terms in -10t - 3t + 15t*3 + 11t. 15t3 - 2t Collect the terms in b*2 + 4b*3 - 32b*3 + 4b*2. -28b*3 + 5b*2 Collect the terms in -227v*2 - 3v*3 + 227v*2. -3v*3 Collect the terms in -8d*2 + 2d*3 + 8d*2. 2d*3 Collect the terms in -79s + 39s + 43s. 3s Collect the terms in -7p - 17p2 + 7p. -17p2 Collect the terms in -8v*2 - 13v*2 + 3v*2 - 21v*2. -39v*2 Collect the terms in -14433i + 3i2 + 14433i. 3i2 Collect the terms in 675r + 685r - 1357r. 3r Collect the terms in -1 + 5t - 4 - 4t. t - 5 Collect the terms in 0c*3 - 6c*3 + 0c*3 - 7c. -6c3 - 7c Collect the terms in h*3 - 6h3 - h3 + 0h3. -6h*3 Collect the terms in -23 - 9m*2 + 8m2 + 191. -m2 + 168 Collect the terms in -119r - 116r + 230r. -5r Collect the terms in 33h3 - 29h*3 + 4h*2 - 15h*2. 4h*3 - 11h*2 Collect the terms in -3l*3 + 20l*2 + 0l*3 + 9l*2 - 29l*2. -3l*3 Collect the terms in 22v*2 + 42v*2 + 52v*2 - 168v*2. -52v*2 Collect the terms in 6d - 5d + 2 - 19d. -18d + 2 Collect the terms in -84535033 + f3 + 84535033. f3 Collect the terms in -85 + 85 + 5u*3 - 4u3. u3 Collect the terms in -11x2 + 8x*2 - 9x*2 + 13x2. x2 Collect the terms in -54h - 58h - 22h. -134h Collect the terms in -89p - 89p - 2 + 2 + 175p. -3p Collect the terms in 23z2 - 15z*2 - 8z*2 - 7z*3. -7z*3 Collect the terms in 114m*2 - 114m*2 + 7m*3 - 6m3. m3 Collect the terms in 49k + 59k - 108k + k3. k3 Collect the terms in 34l*2 + 6844l - 6844l - 16l*2 - 16l*2. 2l*2 Collect the terms in -16c*2 + 5c + 6c - 4c. -16c2 + 7c Collect the terms in -100 + 180 + 2z2 - 80. 2z*2 Collect the terms in -65c + 21c + 6c*2 + 22c + 22c. 6c*2 Collect the terms in 15n*3 + 148 - 148. 15n*3 Collect the terms in -4 + 5 - 1 + 18k*2. 18k*2 Collect the terms in -61149 + 5v*3 + 61149. 5v*3 Collect the terms in 13g - 17g + 3g. -g Collect the terms in 147g + 142g - 285g. 4g Collect the terms in -26j3 - 3j*2 + 3j*2 + 30j*3. 4j*3 Collect the terms in -2d + 6d + 0d. 4d Collect the terms in 31r + 4r3 + 5r*3 - 31r. 9r3 Collect the terms in 17 - 17 + k3 + 60k*2 - 60k2. k3 Collect the terms in 3v + 11v + 3v. 17v Collect the terms in 3d2 - 3d*2 + 2d*2 - 279d + 279d. 2d*2 Collect the terms in 113r - 55r - 57r. r Collect the terms in 382w3 + 3 - 3 - 32w*3. 350w*3 Collect the terms in -49p*3 + 248p*3 - 2 + 2. 199p*3 Collect the terms in 22w + 15 - 44 + 17 + 12. 22w Collect the terms in -1 + 1 - 5 + 0 - 13y. -13y - 5 Collect the terms in 9u - u + 4u - 3u + 0u. 9u Collect the terms in 47 + 49 - 96 - 5q3. -5q*3 Collect the terms in -16i*2 - 3430 + 3430. -16i*2 Collect the terms in -6d*3 + 10d*3 - 4d*3 - 6d*3. -6d*3 Collect the terms in -462o*2 - 462o*2 + 921o*2. -3o*2 Collect the terms in -37g - 29g + 68g. 2g Collect the terms in 4h*2 + 19h - 6h - 13h. 4h2 Collect the terms in 103p*3 - 204p*3 + 100p3. -p3 Collect the terms in -31z + 3z - 50z + 3z. -75z Collect the terms in 3a*3 + 26a*3 + 3a*3. 32a*3 Collect the terms in g - 6g + 2g. -3g Collect the terms in -10i - 24i - 80i - 10i. -124i Collect the terms in -5j*3 + 36j*2 + 0j*3 - 76j*2 + 40j*2. -5j*3 Collect the terms in 227k3 + k2 - k*2 - 229k*3. -2k*3 Collect the terms in -232383h*2 + 9h*3 + 232383h*2. 9h*3 Collect the terms in 2r - 9r + 3r. -4r Collect the terms in 3j - 5j + 9j. 7j Collect the terms in 1 - 11f*3 + 45f*3 + 33f*3 + 37f*3. 104f*3 + 1 Collect the terms in -4c + 11c + 7c*3 + 5c. 7c3 + 12c Collect the terms in 38j2 - 45j*2 - 24 - 20 + 44. -7j*2 Collect the terms in 4 - 1 + 14s + 3 - 2. 14s + 4 Collect the terms in 54a - 15a - 14a - 12a - 11a. 2a Collect the terms in -6f*3 - 2856 + 2856. -6f*3 Collect the terms in -7j + 45 - 47 + 2j - 8j. -13j - 2 Collect the terms in 0x*2 + 4x*2 + 8x*2 + 2x*2 - 1. 14x*2 - 1 Collect the terms in -22q2 - q3 + 0q3 + 2q3. q3 - 22q2 Collect the terms in -22v*3 + 43v*3 - 17v*3. 4v*3 Collect the terms in 9m*2 + 17m*2 - 19m*2. 7m*2 Collect the terms in 4y*2 - 13y*2 + 2y*2 + 5y*2. -2y*2 Collect the terms in 7y*2 + 113723 - 113723. 7y*2 Collect the terms in 272f - 96f - 88f - 86f. 2f Collect the terms in 3s - 25 + 5s - s. 7s - 25 Collect the terms in 9r - 4r - 8r. -3r Collect the terms in 47l*2 - 2 + 2. 47l*2 Collect the terms in -8p*2 - 26p*2 - 13p*2. -47p*2 Collect the terms in 3 - 2 + 1 - 59f. -59f + 2 Collect the terms in -3j*2 - 1048 + 516 + 532. -3j*2 Collect the terms in -275g*2 + 142g*2 + 398g*2. 265g*2 Collect the terms in 22k*2 - 107k*2 + 42k*2. -43k*2 Collect the terms in -2h*2 + 6h + 6h2 - 7h*2. -3h*2 + 6h Collect the terms in 23v3 - 64v*3 + 1933v - 1933v. -41v3 Collect the terms in -q2 - 15q - 12q + 41q - 14q. -q2 Collect the terms in a2 + 216a - 106a - 2a3 - 110a. -2a3 + a2 Collect the terms in 13 - 8 - 5 - 8k. -8k Collect the terms in 7n - 2n + 2n - 11n. -4n Collect the terms in 105 + 0y3 + y3 - 63 - 42. y3 Collect the terms in 11428u*2 - 5716u*2 - 5713u2. -u2 Collect the terms in -3c - c - 7c + 2c. -9c Collect the terms in 5426 - 10832 + 5406 - a3 - a3. -2a3 Collect the terms in -l3 + 8l*3 - 4l*3. 3l*3 Collect the terms in 44d*2 + 144d*2 + 24d*2. 212d*2 Collect the terms in 15a - 4 + 3 + 0a. 15a - 1 Collect the terms in 51 - 17b - 51. -17b Collect the terms in -180x - 279x*2 + 180x + 16x2. -263x**2 Collect the terms in 327 - 327	{ "pile_set_name": "DM Mathematics" }
be 384/8 + -1. Let r be (-595)/72 - 4/g. Let n = -5/36 + r. Find the common denominator of n and 59/5. 40 Let c be 15/(-2)-72. Calculate the least common multiple of 12 and 10/30 - c/(-9). 12 Let z(d) = 10d*2 - 6d. What is the smallest common multiple of z(3) and 18? 72 Let g = -5620 + 3259. Let c = -23589/10 - g. What is the common denominator of c and -10(6 + 484/(-90))? 90 Let c = -1105 + 511. Find the common denominator of 274/40 + 2-1 and (-1407)/c + (-2)/(-9). 220 Let k = 8181/2 + -49171/12. What is the common denominator of -53/6 and k? 12 Let i(r) = r*2 + 57r - 628. What is the least common multiple of 440 and i(12)? 2200 Let b(d) = d*3 - 4d*2 + 3d. Calculate the smallest common multiple of 18 and b(4). 36 Let y = 6923 - 41435/6. Find the common denominator of 68/75 and y. 150 Let l = 13/80 - 3813/80. What is the common denominator of 45/28 and l? 28 Let d(c) = c*3 + 2c*2 - c + 1. Let o be d(-2). Suppose 5 = -oz + 4z. Let n = z - 4. Calculate the common denominator of -109/10 and n. 10 Find the common denominator of (50/(-48))/((-245)/70(-5)/35) and ((-2)/44)/(2/(-124)). 132 Let m(g) = g*2 - 19g + 12. Let f be m(7). Calculate the least common multiple of 48 and ((-3)/(-2))/(0 + (-4)/f). 432 Let f(t) = t + 13. Let y be f(-8). Find the common denominator of -61/10 and (-69)/18y/7. 210 Let z = 1 + 1. Let a = 3805 - 3801. What is the least common multiple of a and z? 4 Suppose 0 = -7r + 3r - 104. Calculate the common denominator of -3 - r3/84 and 109/14. 14 Let q be 5/(-2)(55 + -5). What is the common denominator of (-1)/2 - q/5 and -117/14? 14 Let p be -3((-465)/(-9) - -1). Calculate the common denominator of (2/32)/(3/p) and ((-111)/50)/((-2)/5). 120 Let k = -14936 + 4286628/287. Find the common denominator of k and -113/12. 3444 Let y = 36/5 - 391/30. What is the common denominator of y and 19/12? 12 Let t(y) = 8y + 12. Let n be t(-12). Calculate the common denominator of (-581)/n - (3 - -1) and -107/34. 204 Let z = 39 - 45. Calculate the common denominator of (z - -8)(-71)/6 and 22/9. 9 Let u = 3/18409 + 7381844/1012495. Let a = u - 36/5. Find the common denominator of a and 67/3. 33 What is the least common multiple of ((-540)/40)/(6/(-32)) and 33? 792 Suppose 0 = 50m - 80m + 6480. Calculate the smallest common multiple of m and 4. 216 Let h = 8 + 12. Let a(o) = -o*2 + 11o + 25. Let u be a(13). Calculate the least common multiple of h and u/((-2)/4 - 35/(-77)). 220 Suppose 0 = 13q + 212 + 74. Let p = -16 - q. What is the smallest common multiple of 6 and p? 6 Find the common denominator of (-8050)/1764 - 2(-2)/14 and 85/21. 126 Let m = 61115217/488 - 125236. Find the common denominator of m and -151/18. 4392 Let o = 5332/321 - -6/107. Let d = -69 - -78. Find the common denominator of o and (-18)/3(-37)/d. 3 Let k = -41227207 + 9070002157/220. Let q = k - 893/11. What is the common denominator of q and -55/12? 60 Let q = -953/2 + 464. What is the common denominator of (-1554)/1232 - 15/40 and q? 22 Let d = 451/747 + -4/83. Let y = -245 + 4108/17. Let a = y + 1787/102. Find the common denominator of a and d. 18 Suppose -3g + 5g - 36 = 0. Suppose 13j = o + 15j - 2, -4o - 2j = -38. What is the smallest common multiple of g and o? 36 Let f = -148/41 + 10539/1886. Calculate the common denominator of f and 51/11. 506 Let f = 8569 - 171291/20. Find the common denominator of 137/110 and f. 220 Let u(o) = 7o*3 - 9o*2 + 2o + 12. Calculate the smallest common multiple of 14 and u(3). 126 Let h = -404 - -405. What is the smallest common multiple of h and 29? 29 Let v = -2/3023 + -51329/93713. What is the common denominator of v and 107/10? 310 What is the least common multiple of ((-25)/(75/(-54)))/(1 + 0) and 24? 72 Suppose -42 = -8x + 126. Calculate the least common multiple of x and 369. 2583 Let a(s) = -s3 - 4s*2 + 2s + 5. Let q be a(-4). What is the least common multiple of (-35)/q + 2/6 and 6? 12 Suppose -18b = -36b + 540. Calculate the smallest common multiple of b and 25. 150 Let w(a) = 4a + 4. Let j(u) = 7u + 7. Let o(x) = -3j(x) + 5w(x). What is the lowest common multiple of o(-2) and 4? 4 Suppose 3j = -2w + 8j + 88, -176 = -4w - j. Calculate the least common multiple of 10 and (80/22)/2 - (-8)/w. 10 Let j = -11771 + 1577377/134. What is the common denominator of j and 55/16? 1072 Let m(w) = -w*3 - 3w. Let t be (6/21)/((-1)/(-7)). Let u be m(t). What is the common denominator of -49/10 and u/(-18)4/14? 90 Let h(c) = c3 - 4c*2 - 2c - 11. Calculate the least common multiple of h(5) and 5. 20 Let n = 2234/95 - 3/190. Let i be (-2)/(-5) - (-64834764)/5775840. Let j = 2/12033 - i. What is the common denominator of n and j? 8 Let m be 2/331212314 - (-3)/(-9). Let s = m + -35/92. What is the common denominator of -113/6 and s? 18 Suppose 0s + 5s = 0. Suppose s = 4n - n + 45. What is the common denominator of 71/4 and (-16)/96 - 112/n? 20 Suppose -26x = -943 + 33. What is the lowest common multiple of x and 60? 420 Let k be ((-61)/(-4)-6)/(3/4). What is the common denominator of -10(k/24 + 3) and 47/9? 18 Let n = -1068/13 + 287723/3510. What is the common denominator of n and -65/297? 2970 Let k = 0 - -10. Suppose kl + 150 = 5u + 5l, u + l = 22. Calculate the least common multiple of 4 and u. 52 Let o = -20467/62640 - 28/783. Find the common denominator of -23/24 and o. 240 Find the common denominator of 143/6 and ((-2)/(18/(-1071)))/(-6). 6 Suppose -32m = -27m - 370. Calculate the least common multiple of m and 24. 888 Suppose 27w = 26w - 6. Calculate the lowest common multiple of 14 and (((-80)/w)/(-10))/((-2)/12). 56 Let x = -51 + 52. What is the common denominator of 11/4 and x/(-8)(-5 + 10) - -2? 8 Let u(x) = -x2 - 3x - 1. Let y be u(-3). Suppose -b = -4b + 48. Calculate the smallest common multiple of b and 4(0 - -3 - y). 16 Suppose 2i + 2i - 717 = -f, i + 3f = 171. What is the common denominator of (2/3)/((-12)/i) and 1/34? 34 Let y be 01/2 + -168. Find the common denominator of ((-9)/(-60))/(36/y) and -51/14. 70 Let s(k) = -k*3 - 8k*2 - 2k + 2. Let o be s(-7). What is the common denominator of (3 + (0 - -31))/o and 28/3? 33 What is the common denominator of -81/16 and (237/1422)/(1 - 72/73)? 48 Suppose 5a + 3l = -269, -4a - l = 2l + 217. Find the common denominator of 6 - 3 - a/(-64) and (-262)/88 + (-2)/8. 176 Let k = -7 + 9. Calculate the smallest common multiple of -1 + 0 + 4 - 1 and (12/(-8))/(k/(-12)). 18 Let n = -19954201/304 - -65639. Find the common denominator of -49/8 and n. 304 Let n be (-1225)/65 + 6/(-39). Let y = n - -29. What is the smallest common multiple of 4 and y? 20 Calculate the lowest common multiple of 14 and ((-1884)/30)/((-9)/315). 2198 Suppose -5f + f = 192. Let v(r) = r2 + 5r + 10. Calculate the least common multiple of v(-6) and f3/9-1. 16 Let k(v) = -v*3 - 15v*2 - 19v - 4. What is the smallest common multiple of k(-14) and 12? 132 Suppose -5b + 27 = 4p, 2b + 3p - 2p - 9 = 0. Suppose -x - 47 = -7y + 2y, -33 = -by + 3x. What is the smallest common multiple of y and 8? 72 Let u = -26 + 37. Suppose -z + 3z = 5d - 59, -z + 31 = 3d. Calculate the lowest common multiple of u and d. 11 Let s = -252 - -258. What is the smallest common multiple of 8 and s? 24 Let k = -688 + 739. Calculate the lowest common multiple of 42 and k. 714 Suppose 23c + 199 = -537. Find the common denominator of 47/24 and c. 24 Let y be (-1)/(3/(-21)-1). What is the least common multiple of (-12)/(-7) + (-4)/(-14) and (y/(-5))/((-4)/(-20))? 14 Let v(q) = q*2 - 11q - 40. Let o be v(14). Suppose -os - 5y = -64 - 11, -5y = -5s + 135. Calculate the lowest common multiple of s and 10. 30 Let z = 160/113 + -234663/452. Let r = z + 505. Calculate the common denominator of 1/12(-15)/(-10) and r. 8 Suppose 0w = 3w + 615. Calculate the common denominator of 55/4 and (w/120 + 1)/(1/(-2)). 12 Let b = 23 - 21. Find the common denominator of 2363/731 - (2/b + 2) and -36/5. 215 Suppose 4x = 5n + 80, -4x + 3n - 2n + 64 = 0. Let p be ((-36)/x)/(6/(-15)). Suppose -6t + 0t = -p. What is the least common multiple of t and 10? 10 Let y(x) = 57x2 - 5x - 7. What is the least common multiple of y(-1) and 240? 2640	{ "pile_set_name": "DM Mathematics" }
g(m). Let q(o) = -o3 + o2 - o. Give q(p). 0 Let n(m) = -m*3 + 1. Suppose -2q + 5q = 63. Let i(r) = -3r*2 + 6r + 24. Let h be i(5). Let j = q + h. Give n(j). 1 Let w(u) = -6u2 + 1. Let i be -3 - (-4)/(-4)-2. Suppose -27 = -r + 5h, 17 = -4r - h - 4h. Let y be (-2r/(-4))/i. Determine w(y). -5 Let w(d) be the third derivative of 0d + 1/120d*6 + 8d*2 - 1/10d*5 + 2/3d*3 + 1/4d4 + 0. Give w(5). 9 Let v(d) be the second derivative of d3/6 - 2d2 - 4d. Let s(t) = -2t + 7. Let g(j) = -3s(j) - 5v(j). Determine g(4). 3 Let f(n) = 309n*2 - 300n2 + n - 1 + 2 + 2. Determine f(-2). 37 Let z(p) = -p2 - 11p - 6. Suppose -2c + 561 - 579 = 0. Give z(c). 12 Let t(z) = 13 + 9z + 486z*2 - 487z*2 - 2z + 4z. Calculate t(9). 31 Let o(m) = -2m + 3. Let p = 35 - 22. Let h(g) = g*2 - 8g - 2 + 0g2 + pg. Let c be h(-6). Determine o(c). -5 Let l be -3(10/(-3))/(-10). Let q(j) = -37j2 - 1. Give q(l). -38 Let q be 1 + ((-4)/(-3))/((-6)/(-18)). Let x(n) = -n2 - 2n + 6. Determine x(q). -29 Let d(q) = q3 - 9q*2 + 6q + 6. Suppose 0 = 19f - 27 - 125. Calculate d(f). -10 Let n(z) = 4z - 1. Let h(s) = s*3 + 8s*2 - 2s + 6. Let v be h(-8). Let f = v - 21. Give n(f). 3 Let m(w) be the first derivative of w6/120 + w5/20 + w4/12 + w3/3 - 3w2/2 - 21. Let r(f) be the second derivative of m(f). Give r(-3). -4 Let c(i) = i3 + 11i*2 + 25i + 7. Let r be c(-8). Let m(u) = 16u2 - 1. Calculate m(r). 15 Let j(t) = -t - 1. Let c(q) = -2q*3 + 4q*2 - 2q + 1. Let n be c(2). Let a be (7 + -6)(n - -1). What is j(a)? 1 Let i(n) = -23n - 3n2 + 7n*2 + 52n - 26n - n2. Calculate i(-3). 18 Let s(h) = -h + 4. Let w(g) = g2 + 2g + 4. Let m be w(0). Suppose 5l - 1 = -5x + 9, 3l = -x - m. What is s(x)? -1 Let s(i) = -i2 + 9i + 3. Let c = -22 - -1. Let u = 30 + c. Determine s(u). 3 Let p(n) = -n - 5. Let m(w) be the first derivative of -w4/4 + w3/3 - w*2/2 - 3w - 42. Let o be m(0). Calculate p(o). -2 Let q be 24/(-5)(-5)/(-2)-3. Suppose 14o = -q + 8. Let t(i) be the first derivative of i4/2 + i3 + i2/2 - i + 1. Determine t(o). -7 Let x be (-3)/9 - 7/(-3). Let y(r) = 4r + 0r2 + r + 5 - 7rx + r3. Give y(6). -1 Suppose -9h - 10 = -11h. Let o(t) = -3t2 + 5t + 6. Give o(h). -44 Let a be 24/6015/2. Let b(t) be the second derivative of 1/2t*2 + 5t + 0ta + 1/5t*5 - 1/6t*4 + 0. Give b(1). 3 Let l(r) = -90r2 - r3 + 42r2 + 49r*2 + 4r + 3. Suppose 0 = -2f + f + 3. Suppose -4x - 12 = fb + 8, 0 = x - 5b - 18. Calculate l(x). 7 Let g = -270 + 272. Let d(o) be the third derivative of -1/12o4 + 0o - 5og + 1/30o*5 - 2/3o*3 + 1/120o*6 + 0. Determine d(-3). -7 Let q(m) = -m + 7 + 2m - 3. Let p be q(-4). Let r(b) = b2 - b + 22. What is r(p)? 22 Let b(k) = k2 - 3k2 + 6 + 3k - 3 + 0. Let h = -10 + 13. Calculate b(h). -6 Let z(d) = d*2 - 13d - 120. Let h be z(-6). Let s(r) = -r*2 - 8r - 3. Determine s(h). 9 Suppose 78 = 16q - 3q. Let g(p) = p*3 - 6p*2 - 4p + 12. Give g(q). -12 Let m = -1111 - -1111. Let w(n) = 2n + 29. What is w(m)? 29 Let z(x) = 2x*2 + 33x - 97. Let d be z(-19). Let f(h) = -3h3 - 2h*2 - 2h - 2. Determine f(d). 18 Let y be (2 + -2)/(0 - 1). Let l(t) = -13t3 + 7t + 13. Let x(s) = -11s3 + 6s + 12. Let m(f) = 5l(f) - 6x(f). What is m(y)? -7 Suppose -4n + 3n + 2t + 10 = 0, -3n + 2t + 18 = 0. Suppose i = -2g - 0g + 6, i = ng + 30. Let q = -12 + i. Let k(r) = r2 - r + 1. Determine k(q). 3 Let o(j) = -j3 + 2j2 - 2j - 1. Let k be (-6)/(-18) + 132/9. Suppose -k = 5z, -15 = -3b - 2z + 4z. Calculate o(b). -16 Let j(a) = -a*3 + 4a*2 + 14a + 4. Let s(k) = 2k - 16. Let g be s(11). Determine j(g). 16 Let n(i) = -3i*3 + 13i*2 + 6i + 18. Let s(p) = -7p3 + 26p*2 + 13p + 37. Let q(z) = 9n(z) - 4s(z). What is q(-13)? -12 Let s(y) be the third derivative of y*5/60 - 7y4/24 + y3/6 + 114y2. Determine s(3). -11 Let z(k) be the first derivative of -2 - 6k - 7/2k2 - 1/3k*3. What is z(-6)? 0 Let d = 17 - 17. Suppose -5o = d, -4o = 3w - o - 3. Let u(l) = 6l + 2 - 3 + 0. Determine u(w). 5 Let k(c) = -3c - 4. Let x be (-1)/((-273)/69 + 4). Let t = -26 - x. Give k(t). 5 Let t(p) = -14p + 387 - p + p - 9p - 386. Calculate t(1). -22 Let h be (-826)/(-295) - 8/10. Let y(o) = -o*2. Calculate y(h). -4 Suppose 0 + 5 = a + 5j, -2j = -3a - 2. Let f(i) be the second derivative of -1/3i4 + 9i + i*2 + 1/3i*3 + a. What is f(2)? -10 Suppose 64 = -14u + 18u. Let x(i) = -26i*2 + 7 + 27i*2 - 7 + ui3. Let m(d) = d2 + 8d + 13. Let p be m(-6). Calculate x(p). 17 Let s(f) be the second derivative of f5/20 + 5f*4/4 + 5f*3/2 + 7f*2/2 + 215f. Determine s(-14). -7 Let j(y) = -11y + 70. Let p be j(6). Let k(r) = -3r + 7. Calculate k(p). -5 Let o = 20 + -31. Let w(h) = -11 + h - 16 + 34. Determine w(o). -4 Suppose 4y - 57 = -61. Let h(t) = -16t3 - t - 1. Determine h(y). 16 Let v(t) be the second derivative of -t6/360 - t*5/60 + 7t*4/6 - 13t. Let y(j) be the third derivative of v(j). Determine y(3). -8 Let a(q) = -3q - 1. Let h = -2 + 1. Let j be -4h/1215. Suppose 2 - 17 = 5x - 4b, 0 = jx - 3b + 10. Determine a(x). -4 Let s(y) = 3y*2 + 7. Let k(p) = 5p*2 - p + 14. Let x(d) = -4k(d) + 7s(d). Determine x(-5). -2 Let a(l) = -3l - 9. Suppose -3h - 5r = 41, -4h - 5r - 18 = 35. Let c(g) = 1. Let x(y) = hc(y) - a(y). Calculate x(3). 6 Let n(i) = 0 + 13 + 4 - 4i + 3i - i2. Suppose 3j = t + 9, 0 = -5t + 3j + 14 - 23. Give n(t). 17 Let v(h) = -h*2 + 3h + 2. Let k(s) = s*3 + 8s*2 + 3s. Let p be k(-8). Let q = 28 + p. Give v(q). -2 Let l(w) = -w*3 - 7w*2 - 4w + 14. Suppose 0 = -340d + 355d + 90. Give l(d). 2 Let u(w) = -w*2 + 2w + 2. Let f = -17 + 44. Let m be f + -20 - 2(0 - -1). Give u(m). -13 Let c be 38/(-247) - 3/((-39)/470). Suppose 45 - c = 3p. Let l(r) = -r*2 + 3r + 1. Determine l(p). 1 Suppose -37v + 80 = -21v. Let a(g) = 6g + 4. Determine a(v). 34 Let w(n) be the first derivative of 3n2/2 + n - 51. Let m be (-2)/(-8) + (-330)/40. Let p = m - -10. Calculate w(p). 7 Let r = -43 - 48. Let o = 94 + r. Let y(w) = w3 - w*2 - 5w + 3. Determine y(o). 6 Let k(d) be the first derivative of 5d - 7/2d*2 + 2/3d*3 - 11. Determine k(4). 9 Suppose 12 = 3y + y. Suppose 4h = yh - 5, -28 = -3f + 2h. Let a(j) = -j + 4. Give a(f). -2 Let z(w) = w*2 - 7w - 12. Let y = 184 + -174. Determine z(y). 18 Let x(r) = r*2 - r + 7r - 2r2 + 4 - 2r. Determine x(6). -8 Let d(p) be the third derivative of -p8/20160 + p7/840 - p6/144 - p5/30 + 6p2. Let b(k) be the third derivative of d(k). Calculate b(5). 0 Let y(m) = -m + 21m*3 - 6m*2 + 2m*2 - 20m3 + m2 + 2. What is y(4)? 14 Let p(h) be the first derivative of h4/4 + h3/3 + h*2/2 - 16h - 235. Give p(0). -16 Let n = -727 - -729. Let g(j) = -3j + 5 + 0 - 6. Determine g(n). -7 Let h = -1575 + 1575. Let i(k) = -k3 - k2 + 13. Determine i(h). 13 Let q(f) = f3 - f2 - f - 1. Let n(j) = 2j - 2. Let a = 12 - 11. Suppose 3y - 4d + a = 3, 2d = -4y + 10. Let u be n(y). Determine q(u). 1 Let q(g) = -g*3 - 5g*2 + 6g + 2. Let w be q(-6). Suppose 11f = 9f - 24. Let n be (5/(-30))/(w/f). Let v(b) = -2b2 - b + 1. What is v(n)? -2 Suppose -19k - 369 = 22k. Let h(s) = -4s - 29. What is h(k)? 7 Let d be 10/613. Let n(j) = -3j3 - 9j*2 + 4j - 2. Let l(m) = 29m3 + 83m*2 - 37m + 17. Let a(g) = 2l(g) + 19n(g). What is a(d)? 6 Let m(v) = v*2 - 2. Suppose 35 = -10g + 55. What is m(g)? 2 Let x(v) = -2v2 - 9v - 2. Let y(j) = -4j2 - 3j + 1. Suppose -9r = r - 10. Let k be y(r). Calculate x(k). -20 Let l(b) = -1. Let f(m) = -2m*2 - 5m - 8. Let v(j) = f(j) - 2l(j). Let a(c) = 7 + 1 + c2 - 1 + 2c*2 + 6c. Let p(u) = -5a(u) - 6v(u). What is p(-2)? -11 Let c(a) be the second derivative of -a*3/6 + 9a*2/2 + 2a + 4. Determine c(4). 5 Let j(d) = -2d + 6470d*2 + 1 + 6466d*2 - 12937d*2. What is j(-2)? 1 Let k(o) = -o. Let f be k(0). Suppose fv + 2v = -10. Let m(q) = -42q - 42q + 4 + 85q. Give m(v). -1 Let u = -1 + 0. Let z(i) = 4i2 - 44i*3 - 53i*3 + 98i*3 - 3i**2. Calculate z(u). 0 Suppose	{ "pile_set_name": "DM Mathematics" }
- z2 + z2). -z*5 Expand (6a*3 + 5a*3 - 4a*3)(-1 + 1 + 1) + (a - a + 2a)(0 + 0 + a*2). 9a3 Expand -6 + 6 + r5 - 2r5 + 0r5 + r5 + (r*3 + 3r*3 - 6r*3)(-2r2 + 5r*2 - 5r2) + r5 + 7r5 - 3r*5. 9r*5 Expand -r + r - 3r*2 + (-5 + r + 5)(-9r + 5 - 5) - 2r*2 + 0r2 + r2. -13r2 Expand (-3 - j + 3)(-3 + 2 - 2)(-8j*2 + 8j*2 + 3j*3). 9j*4 Expand (1 + 3 - 2)(-37p2 + 37p*2 - 4p*4). -8p*4 Expand -2 - 7h*2 + 2 + (0h + h + h)(2h + 0 + 0) - 2h2 + 0 + 0. -5h*2 Expand (-2x*4 - 2x*2 + 3x*2 + 4x*4)(1 + 0 + 2). 6x4 + 3x*2 Expand (1 - 2 + 0)(a3 + a - a). -a3 Expand (4s - 2s - s)(-3 - 3 + 0)(9s + 4s - 10s). -18s*2 Expand 2p + p*3 - 2p + (-7p2 + 3p*2 + 8p*2)(-1 + 1 - p). -3p3 Expand (2x + 0x - 4x)(-4x + x + x) + (2x - 2x + x)(3x - 4x - x) - x + x - x2. x2 Expand 51g*2 - 21g*2 + 49g*2 + (5g + g - 5g)(2g - 5g + 4g) + 0g*2 - 4g*2 + 5g*2. 81g2 Expand -4 + g5 + 3 + g*5 + (-2g + 2g - 2g*2)(3g3 + 0g + 0g) - g5 + 2g5 + g5. -2g5 - 1 Expand (0 + 0 + 2a)(2 + 3 - 3). 4a Expand (-3 + 3 + 2)(i + 3 - 3)(0 - 1 + 3). 4i Expand (-4r - r + 3r)(0r + 2r - 3r) - r2 + 6r*2 + 2r*2. 9r*2 Expand (3s*3 + 8s*3 - 2s*3)(-s*2 + 4 - 4). -9s5 Expand o2 + 0o2 - 2o*2 + 3o2 - o2 - 4o2 + (o - o + o)(-2o + 2o - o) - 2o2 - 3 + 3. -6o2 Expand z2 - 2 + 0 + 0z2 + (-4 + 3 + 2)(-2z + z2 + 2z). 2z2 - 2 Expand (-3a + 5 + 4a + 1)(2a2 - 5a*2 + 2a2). -a3 - 6a2 Expand (-2 + 6 + 1)(0 - 3s + 0). -15s Expand (-3 + 4 + 1 + (-4 + 3 + 0)(2 + 0 + 0) - 3 + 3 - 3 + 3 + 3 - 5)(4 - 4 + 2l5). -4l*5 Expand (-6 + 6 + 14)(2d - 2 + 2)(-d*2 + 0 + 0). -28d*3 Expand (26x - 12x - 12x + (-3 - 3 + 4)(-2 - x + 2))(3x3 + 0x*3 - 2x*3). 4x*4 Expand (2v + 2v3 - 2v)(-22 + 71 + 66). 230v*3 Expand (5 - 2 - 4)(-v + 0v - v) + (-1 + 0 + 2)(3v - 3v + 2v). 4v Expand -3n + 2n*3 + 3n + (4n2 - 3n*2 - 2n*2)(-2n + 2n - 2n) + 7n*3 + 5n*3 + 9n*3. 25n*3 Expand 5c2 - c2 - 3c2 + 3c*2 + 0c*2 - 4c*2 + (-3 + 3 - c)(c + 1 - 1) - c*2 + 2 - 2 + (c + 8c - 4c)(-1 + 1 - c). -7c2 Expand (1 + 1 - 12u + 9u)(5u3 + 2u - 2u). -15u*4 + 10u*3 Expand (-f + 3f + 0f)(0f4 + 4f*4 - 2f*4) + (5f - 4f - 2f)(-6 + 6 + 2f*4). 2f*5 Expand ((-6l*2 + 2l*2 + 3l*2)(-2l - 4 + 4) + 0l*2 + 0l*2 + 2l*3)(1 + 0 - 5) + 5l3 - 3l3 - l3. -15l3 Expand (-3q + q - q)(-5 - q + 5) - 2q2 - q2 + 0q2 + (0q - 4q + 5q)(-1 - q + 1 + (1 - 2 + 2)(q + q - 3q) - 2q + 2 - 2). -4q2 Expand (4 + t - 4)(31 - 15 + 15 + 14). 45t Expand (-3z - 2z + 4z)(2 + 11 + 2). -15z Expand (-7 + 9 - 1)(2s*4 + 2s*4 - 2s*4 - 2s*5). -2s*5 + 2s*4 Expand (-p + 2p*3 + p)(-p - 2p + p) + 2p4 - p4 + p*4 + 0p4 + p4 - 2p4 - 14p + 21p - 2p*4 - 6p. -5p4 + p Expand 12a - 29 + 29 - 3a - a + 5a - a + 0 + 0 - a - a + a - 3a + 0a + a + (-2a + a - a)(-2 - 1 + 1) + 3a - a + 0a + a - 3a + 3a + 4a - 4a - a. 15a Expand (a + 0a + 3a)(-a - 1 + 1) + (2a + 2 - 2)(-5a + 4a + 2a) + (a + a - 3a)(0a + 2a - a). -3a*2 Expand ((8 + 2 - 2)(2 + 2 - 2) + 1 + 0 - 3)(-m - 6m + 4m). -42m Expand -5u + u2 + u3 + 5u + (-3 - 1 + 2)(-2u*3 + 3u3 + u3) - 4u3 + 2u*3 + 0u*3. -5u3 + u2 Expand (-2s - s + 0s)(4 + 0s + 2s + 0s). -6s2 - 12s Expand 3 - n2 - 3 + n2 - n*2 + 2n*2 + (-5 + 2 + 1)(n2 - n2 - 3n2). 7n*2 Expand (6 - 1 - 3)(r - 2 + 2) + r + 4r - 3r + (-4 + 4 + r)(-1 - 1 + 0) + r - 1 + 1. 3r Expand (4 - 4 + v - 1)(-3v*3 + 4v*3 - 3v*3) + 0v*4 - 3v*4 - 5v*4. -10v*4 + 2v*3 Expand 0f4 - f4 + 3f4 + 5f*4 - 6f*4 - 2f*4 + (-2f - 2 + 2)(-4f3 + f3 + 4f3). -3f*4 Expand 3n - n*3 - 2n + 0n + (-16n - 3n2 + 16n)(-2n + 0n - n). 8n*3 + n Expand (0 + 2o + 0)(2o + 2 - 2)(5 - 1 + 3). 28o*2 Expand (11 - 6 + 19)(-8 - 3n4 + 8). -72n*4 Expand (6 + 1 + 6)(-2y + 4y - 4y). -26y Expand (-1 + 1 - 2q)(q*2 + 0q*2 - 2q*2). 2q*3 Expand ((3i + 2 - 2)(0 + 1 + 1) + i - 3i + i)(3i*2 - 3i*2 + 2i*3). 10i4 Expand (-j2 + 2j2 - 2j*2)(0 + 2 - 5)(5j3 + j3 - 3j3 + (-4 + 4 + 2j*2)(-j + 0 + 0) + 1 + j3 - 1 - j + j3 + j). 9j5 Expand ((x + 1 - 1)(-2 - 2 + 3) - 2x - x + x)(-2 + 5 - 2)(10 + 1 - 2). -27x Expand (1 + p + 1 + 2p)(-p + 4p - p). 6p*2 + 4p Expand (-1 - k + 1)(2k - 5k + 2k) + k*2 + 557k + 65 - 557k. 2k*2 + 65 Expand (5 + 0 - 4)(-2 + 0 + 0)(-3y + 4y + y). -4y Expand 24 - 24 - 5w5 + (3w*2 + 0w*2 - 4w*2)(-4w3 + 2w*3 + 4w*3). -7w5 Expand (-i2 + 5i2 - 3i*2)(0i - 2i + 4i) - 2i*3 - 2i*3 + 5i*3 + 5i*3 + 4i*2 - 4i*2. 8i*3 Expand -2f2 - f3 + 2f2 + 2f*3 + 2f*3 - 2f*3 + (1 - 3 + 1)(-2f - 2f*3 + 2f). 3f3 Expand o3 + 3o*3 - 2o3 + o3 + 4o3 - 3o*3 + (-2o*2 + 0o2 + o2)(-49 + 49 - 2o). 6o3 Expand 2 - 6c - 2 + (0 + 6 - 4)(-3c + 3c + 2c) + 2c + 0c - 3c. -3c Expand ((0l + 4l - 3l)(-4l + 5l - 3l) - 5l*2 + 2l2 + l2)(l - 2l - 3l). 16l*3 Expand -3l*4 - 2l*3 + 2l3 - l4 + 1 - 1 + (2l + 0l + 0l)(-l*3 - l + l) - 2l*4 - 2 + 2 + (-1 - 2 + 2)(-2l4 - 3l*4 + 4l*4). -7l*4 Expand 0h*5 + 0h5 - h5 + (0 + 6 + 2 + (-6 + 3 + 1)(-5 + 2 + 1))(-5h5 + 4h5 - h5). -25h5 Expand -z2 - 4z*2 + 2z*2 + (50 + 5z - 50)(-5z - 1 + 2z + z). -13z*2 - 5z Expand (6 - 4 - 3)(3m3 + m3 - 6m3) + 4m*3 - 4m3 - m3. m*3 Expand (9l*2 + 9l*2 - 6l*2)(0l2 - 4l2 - l2). -60l4 Expand (-6 + 6 - 7)(4i2 + i2 - 3i*2)(-1 + 2 - 4)(0i + i + i). 84i3 Expand (0 - 2 + 0)(-3 + 3 + g)(-3g + 2g - 3g). 8g2 Expand (5 - 4 + 2)(4 - 4 + 3m)(2m2 + 5 - 7 + 0 - m). 18m*3 - 9m*2 - 18m Expand (-5t3 + 3t*3 + 3t*3)(2t2 + 2t*2 - 2t*2)(-11 + 4 - 2). -18t5 Expand (-3v*4 - 11v4 + v4)(1 - 1 - 1). 13v*4 Expand (-2l + 0 + 0)(l + 5l - 4l) + l2 + 6l*2 - 6l*2 + (-3l + 3l + l)(-4l + l + l). -5l2 Expand l5 - 5l5 + 5l*5 + (-4 + 0 + 2)(0l + 6l - 3l)(-l*4 - 3l*4 + 2l*4). 13l*5 Expand (-13o - 15o - 10o)(0 + 1 - 3)(-3 + 2 + 3)(4o + 2o3 - 4o). 304o4 Expand (-7a + 4a + 0a)(5a - 5a4 - 5a). 15a5 Expand (-4n + 2n - 7 + 3)(0 - 1 - 2). 6n + 12 Expand 3w*2 - 3w + 3w + (w - 1 + 1)(-2w - 5 + 5) - 1 + 1 - 2w2. -w2 Expand 5j + 3j - 6j + 2j + j - 2j + (5 - 1 - 2)(-2j + 4j + 0j) - 2 - 2j + 2 - 10 + 6j + 10 + (-4 + 5 - 2)(0j + 2j - j) + 4 - 4 - 2j. 8j Expand (2 - 2 + 3s2)(4s - 3s + 0s) + (-s2 + 1 - 1)(-2s + 3s - 3s). 5s*3 Expand (-d + 2d - 4d)(4 + 3 - 1). -18d Expand (-16k + 112k - 59k)(3k + 2k - 3k). 74k2 Expand (0 + 7 - 2)(-q - 2q + 2q). -5q Expand -5l4 + l4 + 4l5 - 5l*5 + (-2 + 2 + 2l)(5 - l4 - 5) + 5l4 - l5 - 5l4. -4l*5 - 4l*4 Expand 24s - 27s - 2s*2 + 4s*2 + (-5s + 0s + 4s)(-s - s + 0s). 4s2 - 3s Expand (2 + 2 - 1)(6u - 8u + u). -3u Expand (-2 + 6 - 3)(f3 + 0f*2 + 0f*2 + (0f - 2f + 0f)(-f2 + f2 + 2f*2) - 2f*3 + 2f*3 - 2f*3). -5f*3 Expand (2v - 2v - 2v*2)(v + 2 - 2). -2v3 Expand (-2g3 + g2 - g*2)(4 - 4 - 4)(1 + 2g*2 - 1). 16g*5 Expand 24b*2 - 24b*2 + 6b*4 + 21b4 + (b3 - b3 + b3)(-b + 2b + 0b). 28b4 Expand (m2 + 0m2 + 2m*2)(3m + 0m - 7m). -12m*3 Expand (-4m*2 + 3m*2 - 3m*2)(-3m - m + 2m) - 3m3 + m3 + 0m*3. 6m*3 Expand -2 + 2 + 2u*3 + (2u - 2u - u2)(-30u - 51u + 49u) - 4 + 4 + u3. 35u*3 Expand (14 + 4 - 5 + 1 - 1 - 1 + (-4 + 5 + 0)(0 + 2 - 3) + 0 - 1 + 2 - 2 + 1 + 0)(c - 2c + 2c). 11c Expand 1 + h*2 - 1 + ((0h + h - 3h)(4 - 2 - 1) - 3h + 5h - 3h)(0h + 0h + 2h). -5h*2 Expand (-3w3 - w3 + 0w3 + (-w + w + w)(-w*2 - 2w*2 + 2w*2))(0w + 0w - w)(-3 - 6 + 4). -25w*4 Expand ((-3b + 6b - b)(0b2 + 2b2 - b2) - b*3 - b + b)(-136 + 136 - 12b2). -12b**5	{ "pile_set_name": "DM Mathematics" }
-2 Let s = -53 + -73. Let c be s/7(-4)/6. Suppose 4l - 10 = -2. Solve lz - c = -2 for z. 5 Let s = -6 - -1. Let p(m) = -m2 - 4m - 2. Let f be p(-3). Let h = f - s. Solve 5z - 1 = -h for z. -1 Let p = -58 - -62. Solve 15q - 16q = p for q. -4 Suppose 1882x - 1881x = 5. Solve -1 + x = -k for k. -4 Let p be (-32)/(-6) + -5 + (-64)/(-6). Suppose -15x + px + 12 = 0. Solve -xn = n + 8 for n. -2 Let z be 3 - 3 - -1 - -14. Suppose -2i - 3i = -z. Let c(o) = o + 14. Let m be c(-11). Solve il = 4l + m for l. -3 Suppose 25b - 11b - 42 = 0. Let o(r) = -r*2 - 4r + 5. Let p be o(-5). Suppose -2k + bk = p. Solve 4m - 1 - 3 = k for m. 1 Let m = 1373 - 1349. Solve -m = -7a - a for a. 3 Let n = -32 + 45. Let q = n + 7. Let k = 20 - q. Solve k = m + 4m for m. 0 Suppose -34 + 10 = -2d. Let y = d - 13. Let p be y01/(-3). Solve -3s - 9 + 0 = p for s. -3 Suppose -23f = -25f. Suppose 8l - 16 = -f. Suppose -lw - 23 = -33. Solve wu + 9 = -6 for u. -3 Let h(q) = -q*3 - 28q*2 + 33q + 117. Let j be h(-29). Solve 4s + j = 5s for s. 1 Let u be (-3)/(4 - 55/10). Let m be u + (1 - -1) + -4. Let s = 9 + -6. Solve m = -8c + sc + 10 for c. 2 Let w = -526 - -530. Solve -wy = -27 + 31 for y. -1 Let n = -434 + 443. Solve 16 + n = -5h for h. -5 Let s = 735 - 730. Solve su - 14 = 6 for u. 4 Let l be (-46)/(-8) + 6/(-8). Let r be (16/(-6))/(6/(-45)). Suppose -2o - 25 = -7o. Solve l + r = ob for b. 5 Let p = 55 - 20. Let c be 1 + (-7)/(p/(-10)). Solve -2t - ct = -20 for t. 4 Let j be (-3)/8 + 3/8. Suppose j = f - 3m - 5, 0f - 2f + 4m = -8. Solve c - f - 1 = 0 for c. 3 Let a(m) = 3m2 + 15m - 8. Let b be a(-7). Suppose -5z + 1 + b = 0. Suppose -5d + zd = 6. Solve d = -0w - w for w. -3 Let k be 3((-23)/3 + 4). Let i = k + 16. Solve it = 5 + 15 for t. 4 Let k(j) = j + 9 - 3 - 1 + 4. Let u be k(-5). Solve 2c + u = -2c for c. -1 Let w be 4 + (6/(-2) - (-11 + 9)). Solve 0n - wn - 6 = 0 for n. -2 Let n = 4 - -7. Let o = n + -2. Solve a = 4a - o for a. 3 Let g = -16 + 18. Solve -20 + 10 = -gq for q. 5 Let z(m) = 5m. Let p be z(-1). Suppose x - 10 = 3x. Let q = x - p. Solve u + 4u - 20 = q for u. 4 Let i be (-4)/2 - (-23 - -14). Solve -40 = -ij - 12 for j. 4 Suppose -17 = -2u - 1. Let n be ((-44)/u - -3)-2. Suppose -nr = -4r. Solve -a = -ra + 4 for a. -4 Let i be ((-2)/(-4))/((-21)/(-84)). Let p be 68/20 - i/5. Solve -h - ph = 0 for h. 0 Let g(o) = -2o - 42. Let j = 159 + -180. Let t be g(j). Solve -d - d = t for d. 0 Let w = -1261 + 1275. Solve -16a + 8 = -wa for a. 4 Let t(f) = f3 + 5f*2 - 14f - 35. Let w be t(-6). Suppose -3o + 6o - 9 = 0. Solve 5r = -w + o for r. -2 Suppose 58 = -8n - 726. Let o = n - -58. Let t = -35 - o. Solve -20 - t = -5c for c. 5 Suppose 2y - 10 = 20. Let d = -10 + y. Let h = 10 - d. Solve -h + 2 = -b for b. 3 Let o = -2253 + 2314. Solve 9d - 16 = -o for d. -5 Let w(u) = 5u + 6. Let h be w(-2). Let x be ((-18)/h)/((-6)/(-12)). Solve 0 = k + 2k + x for k. -3 Let g be 3/(15/2204). Suppose -2f + g = -5z, -5f - 3 + 17 = z. Solve s = fs + 2 for s. -1 Let i(g) = -g*2 - 16g + 31. Let w be i(-17). Solve wn = 12n + 8 for n. 4 Let z(j) = j*3 + 10j*2 + 4j + 5. Let h be z(-10). Let g = 24 + h. Let u = g - -15. Solve -t + 15 = ut for t. 3 Let d be 4 + 0 - (4 - 1). Let z be ((-48)/(-18))/((-2)/(-3)). Let w = z - d. Solve -4n = 15 - w for n. -3 Let s(x) = -x*3 + 6x*2 - x + 7. Let o be s(6). Let u be 2/1(-153)/(-6). Let h = u - 48. Solve -hn + 2n = -o for n. 1 Let h(q) = -6q. Suppose 5g + 0z = 4z + 20, 3z + 15 = -3g. Let v be h(g). Solve vx + 2x = 8 for x. 4 Let d = 370 + -363. Solve 1 + d = -2p for p. -4 Suppose -278y - 204 = -284y. Solve -32 = i - y for i. 2 Let w = 24 - 20. Let n(p) = p2 - 2p - 9. Let d be n(w). Let y be (0/8)/(1d). Solve -4 = -h - yh for h. 4 Suppose 4a + 3w = 24, -171a = -172a - w + 7. Solve -7 = 2f + a for f. -5 Let r = 2 - 1. Suppose 4y - 11 = 5. Let u be 38/y + 3/2. Solve -2n + r - u = 0 for n. -5 Let m = 62 - 58. Solve 0 = -5b + mb + 2 for b. 2 Let j(w) = -9w - 2. Let p be j(-2). Suppose -6y + 8 = -2y. Solve p = yz + 2z for z. 4 Suppose -5h + 15 = -2h. Solve -b - hb = -12 for b. 2 Suppose 3l - 2 = 2k, l + 53k - 56k + 11 = 0. Let n = -2 + 4. Suppose 4a = na. Solve ax + lx = 0 for x. 0 Suppose 8l + 20 = 3l, 0 = 5f + 4l - 209. Solve f = 10p - p for p. 5 Let n = -76 + 42. Let f = 36 + n. Solve 1 = fr + 3 for r. -1 Let x(i) be the second derivative of i4/12 - 5i3/6 - i2/2 - 28i. Let j be x(6). Solve 4g = jg + 2 for g. -2 Suppose -3v - 3u = -0u - 6, -3v = 4u - 4. Let g(s) = s - 5. Let f be g(4). Let t be (-2)/(-12) - f/(-6). Solve -vy - 12 = -ty for y. -3 Let d be 6/(-12) + (-30)/(-4). Suppose -c + j + 3 = 0, 4c + 2j - d = 11. Solve 0k = ck - 12 for k. 3 Let l(b) = -5b + 6. Let o be l(3). Let u be (-24)/o12/8. Solve -8 = -0x - ux for x. 2 Let k(q) = -3 + 2q - 3 - 4q + 8. Let c be k(0). Solve -4g - 2 - c = 0 for g. -1 Suppose 2z = 3 + 13. Let u(l) = -2l2 + 17l - 8. Let f be u(z). Solve 4x = -f + 4 for x. 1 Suppose 6z - 4 - 20 = 0. Suppose 0 = -0q + 2q - 8. Suppose 3s - qs = 0. Solve -zb - 5 - 3 = s for b. -2 Let d(m) = -9m*2 + 3m + 8. Let p be d(-4). Let b = p - -154. Solve -5 = 7i - bi for i. -5 Let n be (82/(-3))/((1 + 1)/(-6)). Let q = n - 78. Solve 0l = ql + 8 for l. -2 Let j(n) = -n*2 + 28n + 93. Let c be j(31). Solve -a + ca = 0 for a. 0 Suppose 5 = 4h - 3. Let d = 257 - 255. Suppose j - 7 = 5. Solve -dg = -j + h for g. 5 Suppose -9r + 275 = -14r. Let i = r - -60. Solve -26 = iu - 6 for u. -4 Suppose 0 = -5x + 3x + 20. Suppose -2b - 4k = -4, 4b - 2b = 2k + x. Solve 4 = -bo - 16 for o. -5 Suppose 93 = y + 5r, -y + 147 = -2r + 40. Let h = 110 - y. Solve -hn = -4n for n. 0 Suppose -24i = -12i - 12. Solve 0 = -6p - i - 23 for p. -4 Suppose -5d = -2d - a + 40, -a + 10 = -d. Let i be -4 + d/12-4. Solve -y - i = -2 for y. 1 Let u = -426 + 426. Solve i = -i - ui for i. 0 Let z be (-3)/(-2)20/6. Suppose zn = -11 + 41. Suppose 3m - n = 6. Solve -3a + 4a = m for a. 4 Suppose 2c + 0 = 6, 0 = 3w + 4c. Let y be (w/(-4))/(3/62). Solve -5t - y = 4 for t. -1 Suppose 0 = 4s, -i - 5s + 3 = -3s. Suppose 0x - 5x - 20 = 0. Let t be (-4)/(x/i) + -3. Solve t = -5r - 0r + 5 for r. 1 Let m(s) = s*2 + s + 1. Let f(y) = 10y*2 + 11y - 1. Let r(o) = f(o) - 5m(o). Let p be r(1). Solve -10k + 15 = -pk for k. 3 Let f be 65 + (-95)/(-38)24/(-10). Solve 4j + 71 - f = 0 for j. -3 Let w = -58 + 56. Let p be -9(((-84)/9)/4 - w). Solve 0 = -pg - 0g + 6 for g. 2 Let s be 13 - -1(0/(-4))/(-2). Suppose -st = -9t - 4. Solve -5o - t = 4 for o. -1 Let s = -14 + 17. Suppose -2l = 5a - 10 - 11, -a = 4l - 15. Suppose aq = -2w + 8, 4 = 2q - w + 1. Solve -3i = -qi - s for i. 3 Suppose 73w = 75w. Suppose w = 10k - 13k. Solve k = -0l - 5l - 20 for l. -4 Suppose -25 = -16p + 887. Solve p = 5g + 32 for g. 5 Suppose -45n - 18 = -51n. Solve -20 = nv - 8 for v. -4 Suppose -3f = -3s + 69, 4f = s + f - 33. Let b = 29 - s. Let z = -8 + b. Solve 0 = 2x - z + 1 for x. 1 Suppose -2a + 6a = 0, 0 = -7o + 2a. Solve o = 6n - 17 - 13 for n. 5 Let c(h) = -2h2 + 8h + 19. Let b be c(5). Suppose -3v = -15 - 12. Let z = b - v. Solve -q + 0q = z for q. 0 Let u(c) = -c*3 + 27c*2 - 9c + 247. Let k be u(27). Solve 28 = 8i + k for i. 3 Suppose 41x + 127 = 660. Solve -x + 19 = 3h for h. 2 Suppose 3 = j + 1. Let m be 6 - (6/3 + 0 + 16 + -14). Solve 0 = jt - m - 0 for t. 1 Suppose -22i + 18i + 12 = 0. Solve is + 2 = 4s for s. 2 Let k(i) = -i + 14. Let s be k(14). Suppose d + 3 = s, 1 + 4 = 2b - d. Solve p = -5 + b for p. -4 Let u be 11/(-22) - 37/(-2). Suppose 4f - 40 = -f + 5k, 5k + u = 3f. Suppose f = -4j + 27. Solve -jp + 0 = 8 for p. -2 Let s = 166 - 161. Solve sx + 2 = 3x for x. -1 Let t = -125 - -127. Solve 2 - 12 = tk for k. -5 Let w = 13 - 31. Let a be w/(-36) - 6/(-4). Solve 3 = -as + 1 for s. -1 Suppose -49 = -5l + 2f + 26, 3l - f = 45. Solve 2v = -v - l for v. -5 Suppose 6f - 7f = -4i + 29, 3 = i + 4f. Solve iq = q for q. 0 Suppose 0 = 3v - 4r - 308, -3r = -5v + 271 + 257. Solve -j + 28*j	{ "pile_set_name": "DM Mathematics" }
1? (a) j (b) 1/7 (c) 0.3 b Let g = 2026.3 - 2026. Which is the closest to g? (a) 0.2 (b) -0.3 (c) 5 (d) -32 a Let z be ((-2)/3)/(28/12). Let w = -4.3 + 0.3. Let y = 213/35 + -29/5. What is the nearest to -2/5 in w, z, y? z Let o = 215.82 + -218. Let x = -0.18 - o. Let j = 97/255 + 1/51. Which is the nearest to -1/4? (a) x (b) j (c) -0.2 c Suppose -3m + 19 - 7 = 0. Which is the nearest to -1? (a) -1/7 (b) 1 (c) m a Let j = 0 - -2. Let n = 0.804 + 0.036. Let x = 4.16 + n. Which is the nearest to 1? (a) x (b) 0.4 (c) j b Let n = -8 + 20. Let w be ((-6)/(-16))/(n/(-4)). Let g be 0/(12/(-4)) + 4. What is the closest to -1/5 in -4, w, g? w Let v = 1 - 1.1. Let u = 0.065 - -0.235. Let d = 0.46 + -0.06. What is the nearest to v in d, u, 1/6? 1/6 Let x = 136 - 135. What is the closest to x in -4, 0, 15? 0 Let m = 512.1 + -512. Which is the nearest to -2/5? (a) 4/7 (b) 0 (c) 0.4 (d) m b Suppose -9h - 48 = -3. Which is the nearest to 2/5? (a) 3/10 (b) 3/2 (c) h a Let p be (-9)/82/(-3). Let u = -640.454 + 641. Let t = 0.046 - u. Which is the nearest to 1/3? (a) p (b) t (c) -2/5 a Let p be -3(-4 - 26/(-6)). What is the nearest to 3 in p, 2, -0.2? 2 Let f = -45 - -45. Which is the nearest to 0? (a) -11 (b) 2 (c) -1/8 (d) f d Let z = -0.795 + 7.795. What is the nearest to z in -3, 1, -1/3? 1 Suppose -38o - 2208 = -50o. What is the nearest to o in 0.1, 0.5, 4? 4 Suppose -94j = -89j + 10. Let x be 1 + 9 + -4 + (2 - j). Let o = 0 - -0.1. Which is the nearest to 1? (a) x (b) -2/9 (c) o c Suppose 60i - 220 - 20 = 0. Which is the nearest to 0.1? (a) 12.8 (b) -2 (c) i b Suppose -6 = 2d + 5n + 7, 5n = -d - 19. Let i be 0 - (-1 + 3)d. What is the nearest to 2 in -1/2, i, 2/5? 2/5 Let o = 5.17 + -0.17. Let s = -4 + o. Let p = -9 + 10. Which is the closest to p? (a) 5 (b) s (c) 4 b Let m = 1 - 0. Let q = -9.992 - -10.092. Let h = -0.36 - -0.06. Which is the closest to q? (a) m (b) h (c) -0.5 b Let a be (9/155)/(-1 + -2). What is the closest to 2 in -2, -3/23, a? -3/23 Let n = -4.17 - -77.17. Which is the closest to 0? (a) -0.1 (b) n (c) -0.4 (d) -5 a Let s = 13 + -133/10. What is the closest to -2 in -6, s, 4? s Let q be -12/4-1. Let v = -1.9428 - 0.0572. What is the closest to -2/7 in q, v, -1? -1 Let u = 127.09 + -127. Which is the nearest to 2/3? (a) u (b) -2 (c) 2/5 c Let a be (6/(-9) - 16/(-42))/(-4). What is the closest to -3 in 4/7, -4, a? -4 Let n = 0.834 + -0.334. What is the closest to 2 in n, -0.1, 4? n Let s = -0.9 - 0.1. Let z = -65/38 - -4/19. What is the nearest to z in 1/3, 0.4, s? s Let p be (1/(-5))/((-8)/(-10)). Let w = 6056 - 6058. Which is the nearest to 1? (a) -2/7 (b) p (c) w b Let x = 3.6 - 3.5. Let a be 6/(-14) + (2 - 1). Suppose 4w = -l + 8, -2w = -2l - 3 - 1. What is the closest to l in a, 1/5, x? x Let y be ((-28)/6)/(2/(-3)). Suppose 5m = y - 2. Let f = 1.7 - 2. Which is the nearest to m? (a) f (b) 3 (c) 0.3 c Let y = -1.112 - -1.412. Let j = 0 + -2. What is the closest to j in y, -1/8, -3? -3 Let w = -39 - -38.7. What is the closest to -1 in -0.05, -4, w? w Let u = 3.072 + 1.928. What is the nearest to -0.9 in 0.4, -0.1, u, 4? -0.1 Let n = -433 + 456.05. Let g = -23 + n. Let u = 0 + 0.1. What is the nearest to -1 in u, -0.4, g? -0.4 Let l = -7 + 2. Let v be 99/(-66)(3 - 1). What is the nearest to -1/2 in v, -1/7, l? -1/7 Let f = 1.347 + -6.347. What is the closest to f in -2/7, 29, -1? -1 Let s = -26.1 + 21.1. Which is the nearest to 0.1? (a) 2/3 (b) -2/3 (c) -3/5 (d) s a Let u = 1903/3 + -633. What is the nearest to 84 in 1, u, 2/3, 5? 5 Let v = 1 + 2. Let w(h) = -2h - 16. Let z be w(-9). What is the closest to 1/2 in v, z, -0.3? -0.3 Let r = -2.02 - -2.02. Which is the closest to r? (a) 7 (b) -0.1 (c) -0.4 b Let n(v) = v*3 - 4v*2 + 3v + 6. Let q be n(3). Let g be ((-67)/33 - -2)q. Which is the closest to -0.1? (a) -2/23 (b) 2/3 (c) g a Let p = 2.3 + 7.7. Let q = -13 + p. Suppose -3t - 3s - 3 = 0, 2 = -0s - 2s. What is the nearest to 1/4 in q, t, -5? t Let y = 1 - 0. Let k(d) be the third derivative of d5/60 - d4/12 - 2d*3/3 - 20d*2. Let f be k(0). Which is the nearest to -0.1? (a) f (b) y (c) 0.2 c Let n be (-4)/(-3 + -1)6. Let y = -19 + 1. Let u be n/y - 26/(-6). What is the closest to 1 in u, 0, -1/2? 0 Let h be (3 + -2)(0 + 1). Let q be 1(h - (-20)/(-12)). Which is the closest to q? (a) 1 (b) 5 (c) -2 c Let h = 355 + -1421/4. Suppose w - 3w - 14 = 0. Let t = w + 6. Which is the nearest to -0.1? (a) 0.4 (b) h (c) t b Suppose -3h - 4 = -w + h, -4h = -3w - 4. Let t = 77 - 60.9. Let i = -16 + t. Which is the nearest to i? (a) w (b) -2/15 (c) 0.2 c Let k = 8 - 8.1. What is the closest to 1/2 in -1, k, -1/3, 31? k Let h be (-1 - -4 - 43/15)-3. What is the closest to h in 3, -1, 0.03? 0.03 Let v = -0.211 - -1.211. Let k = -0.4 - -0.2. Which is the closest to -0.2? (a) -5 (b) k (c) v b Let w(m) = 6m*3 + 2m*2 - 6m + 3. Let g be w(1). What is the closest to -1 in 0.5, -3, g? 0.5 Let u = -13 + -1. Let g = u + 13.6. What is the closest to 1/4 in -6, g, 2/7? 2/7 Suppose -57z = -122z - 260. What is the closest to 1 in z, 0.2, -1/2? 0.2 Let o = -0.1 + 0.3. Let r = -19 + 58/3. Let t = -82.15 - -86.15. Which is the nearest to r? (a) t (b) o (c) -3/5 b Let b = 3 - 6. Let h be 9/5 - (-1)/5. Let z be ((-4)/(-40))/(h/(-8)). What is the nearest to z in b, 5/4, -1? -1 Let h = -243/4 + 61. Let s = -11541 - -11545. What is the closest to h in s, 0, -4? 0 Suppose h + 3 = 2. Let z = 0.21 - 0.1. Let m = -0.89 - z. Which is the nearest to h? (a) m (b) -0.3 (c) -0.1 a Let j = 0.322 + 0.178. Which is the closest to -1/25? (a) -0.4 (b) 5 (c) j a Let p = -1.41 + 1.71. What is the nearest to 1 in 2, 4, p? p Let l = -0.0176 + 4.0176. Which is the nearest to -1/4? (a) 2/19 (b) 1/2 (c) l (d) -1/4 d Let n = 254.897 - 255. Let o = n + -0.007. What is the nearest to -1 in 2/19, -1/3, o? -1/3 Let h = 2.04 - 0.14. Let r = 1.4 - h. Let p = -11 - -6. What is the closest to -1/4 in r, 0.2, p? r Let i = -38.4 - -39. Let m = i - 0.2. What is the nearest to -2/3 in m, -0.2, -0.1? -0.2 Let x = 2.6 + -1.588. Let r = x - 0.012. What is the closest to r in 0, -9, -1/2? 0 Let w be 5 - (2 - (-3 + 2)). Let x = -0.131 + -0.869. Which is the nearest to w? (a) x (b) 0.5 (c) 3/7 b Let z = -177 + 1237/7. Let p = -979/4 - -4907/20. Which is the closest to z? (a) p (b) 0.4 (c) -2 b Let k = -6.86 + 6.66. Let r = 23/4 + -53/12. Which is the nearest to 0.3? (a) k (b) -1/6 (c) r b Let h = 3 + -3.5. Let l be 14/(-3) - (6 + (-102)/18). Let r be 2/3 + 32/(-42). Which is the nearest to -2/7? (a) h (b) l (c) r c Let d = -0.5 + -1.3. Let i = -2 - d. Which is the nearest to -1? (a) i (b) -4 (c) 3 a Let o = 14.17 + -14.11. Which is the closest to 2/9? (a) 2/29 (b) 1/6 (c) 2/9 (d) o c Suppose 0 = 106n - 139n + 99. Which is the closest to -3? (a) -17 (b) -5 (c) 0.2 (d) n b Suppose 33p - 4 = 95. Which is the closest to -3? (a) p (b) 2 (c) 0.3 (d) -3 d Let h = 113 - 216. Let o = h + 103. Which is the closest to -0.04? (a) -0.1 (b) o (c) 0.2 b Suppose 4u - 18 = -6. Let n = -2 + u. Let c be 4 - (4 + 0 + 1). What is the nearest to c in -3/7, n, -2/3? -2/3 Let x be (-18)/(-75)(-30)/9. Let h be (-4)/10 + 49/70. Let l = h - 4/5. What is the closest to l in x, 5/2, -2? x Let y = -192 - -195. Let j(u) = -u2 + 4u + 2. Let r be j(3). Let p = -0.1 + 0.2. Which is the closest to p? (a) r (b) 3/2 (c) y b Let l be (-3)/6-20/1. Let m(u) = u*2 + 8u + 9. Let n be m(-6). Let p be (6/(-4))/(n/(-4)). Which is the nearest to l? (a) 4/7 (b) -1/5 (c) p b Let w = -2822/7 + 403. Which is the closest to 0? (a) 1/9 (b) w (c) -5 a Let k = 0.224 + 0.076. What is the nearest to 4 in -0.3, 4, k? 4 Let h = -1.9 - -4.9. Let c = -0.13 + -4.75. Let u = c + -0.12. What is the nearest to 2 in h, 0.4, u? h Let k = 7/23 - 127/115. Let f = 5.1115 - 0.1115. Let z = 9 + -6. Which is the closest to 1? (a) z (b) f (c) k c Let o be ((-27)/18)/(3/(-4)). Suppose -2k + o = -8. Let i(v) = -v3 + 4v*2 + 3v + 5. Let w be i(k). Which is the closest to -0.2? (a) -2/3 (b) 2/7 (c) w a Let i = 3.2 + -8.5. Let v = -5 - i. What is the closest to v in -0.1, -	{ "pile_set_name": "DM Mathematics" }
hich is the second smallest value? (a) 1/3 (b) -3/7 (c) -13361 b Which is the fifth smallest value? (a) -3 (b) 4/3 (c) -0.09 (d) -1/2 (e) 293 e Which is the third smallest value? (a) 2 (b) 0.055 (c) -2/11 (d) -0.3 b Which is the second smallest value? (a) -4 (b) 9 (c) -3 (d) 1/4 (e) 0 (f) -1/141 c What is the fourth biggest value in -3/7, -75, 5, 14/183? -75 Which is the fifth smallest value? (a) -3 (b) 4 (c) -13.4 (d) 3/2 (e) -83 b What is the biggest value in -31, 2.5, 308? 308 What is the second biggest value in 0.029, 11, -12, 4? 4 What is the fourth smallest value in 0.06, 4/5, 859/12, 3? 859/12 Which is the fourth biggest value? (a) -0.07 (b) 0.066 (c) 1/5 (d) -172 d What is the biggest value in -16/7, 2/5, 5, 7/5? 5 Which is the biggest value? (a) -192 (b) 0 (c) -0.02 b What is the second biggest value in 1/1231, -0.3, -321? -0.3 What is the third biggest value in 870, -0.5, -1, -4, 0.3? -0.5 Which is the fourth smallest value? (a) 0.2 (b) -11/3 (c) 0.5 (d) -5.6 c What is the smallest value in -0.4, 4, -2, 0.5, 11/54? -2 What is the biggest value in -5/28664, 4, 6? 6 Which is the fifth smallest value? (a) -0.47 (b) -1 (c) 2/13 (d) -3/11 (e) 0.1 (f) -6 e What is the smallest value in 2, 1, -4/41, -37.5? -37.5 What is the fourth smallest value in -2/41, 1.6, -2, 0.4, -2/119? 0.4 What is the second smallest value in 2, 35, -12/11, -4/9, 4? -4/9 Which is the fourth biggest value? (a) -28508 (b) 0.4 (c) -8 (d) -1/10 a Which is the fourth smallest value? (a) 0.1 (b) 1 (c) -0.4 (d) 21758 d Which is the sixth biggest value? (a) -0.04 (b) -0.4 (c) -2/23 (d) 0 (e) -11.9 (f) -5 e Which is the biggest value? (a) -2 (b) -5 (c) 772/9 c Which is the biggest value? (a) 43 (b) 4 (c) -2/13 (d) -0.04 (e) 0.5 a Which is the second smallest value? (a) 779308 (b) -1/2 (c) -3 (d) -0.3 b What is the second smallest value in 11092, -0.2, -5/3? -0.2 What is the second biggest value in -0.04, 0.032, -2/3? -0.04 Which is the third smallest value? (a) 6884 (b) 2/11 (c) 1/2 a What is the fourth biggest value in -465/4, -1/6, 5, -1/3? -465/4 What is the second smallest value in 221.4, 0.5, -1/9, -3.9, 0.4? -1/9 What is the second biggest value in 3/2, -0.4, 15987, -5? 3/2 Which is the second biggest value? (a) -1 (b) -0.3 (c) -3264 a Which is the fourth biggest value? (a) 0 (b) -15 (c) -13 (d) 1/8 (e) -3 c Which is the fourth biggest value? (a) 0.5 (b) 0.6 (c) -2/5 (d) 1.1 (e) -148/5 c Which is the biggest value? (a) 5 (b) -0.03 (c) -149 (d) 0 a What is the smallest value in -54, 1, 1.6? -54 What is the third smallest value in -0.2, -4, -2114/3, 3/8, -3, -16/3? -4 What is the smallest value in 3/7, -1/6, -2, -2/1079, -3? -3 What is the fourth smallest value in -2/21, 167, -0.5, 7, 0? 7 Which is the fourth smallest value? (a) 25/4 (b) -5 (c) 1/4 (d) 6.4 (e) 0.3 a What is the fifth biggest value in -3, -3/2, 2.7, -9/8, 0.3, -3/5? -3/2 Which is the second biggest value? (a) -1 (b) -5 (c) -8753 b What is the second smallest value in 1/4, 0.8, -218788? 1/4 What is the fifth smallest value in -10, -1, 27, 2, -1/2, -4? 2 Which is the smallest value? (a) 209 (b) -11 (c) 4 (d) -0.2 b Which is the smallest value? (a) 3 (b) 13 (c) -4/7 (d) 0.5 (e) -30 (f) 3/2 e What is the third biggest value in 5, 1, 3/5, 25, 0.03? 1 What is the second biggest value in -0.4, 0.4, 3.90904? 0.4 What is the biggest value in -0.02, -1, 0.084, 4? 4 What is the third smallest value in 5, 9, 0.4, -2/3, -0.4, -206/13? -0.4 What is the smallest value in 6, 45, -0.3, -3, -4/9? -3 Which is the second smallest value? (a) -1 (b) -5 (c) 6.78 (d) 1/4 (e) 2/11 a What is the third biggest value in -2, 0.1, 3/13, -3, 2/31, 2/9? 0.1 Which is the third smallest value? (a) -3/5 (b) -0.061 (c) -0.1 (d) -33 (e) -2 (f) 2/13 a What is the smallest value in 1/6, -16, 0, -3, -52? -52 Which is the second smallest value? (a) -8 (b) 1/19 (c) -5 (d) -4 (e) -1 c Which is the second smallest value? (a) -2/11 (b) -46722 (c) 3/7 a What is the smallest value in -14, -6/7, 3, -0.7? -14 What is the fourth smallest value in -0.2, 1, -1059, 2? 2 Which is the fifth biggest value? (a) -0.1 (b) 2/15 (c) -0.4 (d) 15 (e) -2/9 c Which is the smallest value? (a) -4409 (b) 125 (c) -0.3 a What is the sixth biggest value in -60, 0.5, 46, 0.1, -7, -0.3? -60 What is the fifth biggest value in -4, 4, 3, 587, -5? -5 What is the second smallest value in 91, -1, -3/4, -5? -1 Which is the second biggest value? (a) -0.5 (b) -532 (c) -4 (d) 2/9 (e) 0.1 e What is the third biggest value in 575, -3, -3/5, 0.4, -52? -3/5 What is the third smallest value in -2.6, -9, -277, 0.3? -2.6 Which is the third smallest value? (a) 0.3 (b) -98 (c) 4 (d) 0.4 (e) -5/4 a What is the second biggest value in -0.014, 0.1, -16, -0.3? -0.014 Which is the fourth biggest value? (a) -0.8 (b) 0.5 (c) 2 (d) -0.3 (e) 17 (f) -0.4 d Which is the smallest value? (a) -0.2 (b) 47/4 (c) -1/2 (d) 5 (e) 8 c Which is the fourth smallest value? (a) 1 (b) -1 (c) 67 (d) -5 c Which is the fourth biggest value? (a) -2/19 (b) -19 (c) -7 (d) -2/3 (e) 1/3 (f) 45 d What is the smallest value in -3/460, -4/19, 1? -4/19 What is the second smallest value in -1/9, -549, 63? -1/9 Which is the third smallest value? (a) 0.1 (b) 49 (c) 4 (d) 14 (e) 5/4 (f) 0.2 e What is the sixth smallest value in 3, -2/65, 2/9, 0.5, -1343, 2? 3 Which is the second smallest value? (a) 5 (b) -88/9 (c) -4 (d) 0.2 (e) 1/2 (f) 4 c What is the fifth smallest value in -4, 3, 1, -5, -4/9, 9? 3 What is the smallest value in -3, -19.6, -97? -97 Which is the second smallest value? (a) 0.04 (b) 427681 (c) -1 a What is the fourth smallest value in -0.257, -17, 33/4, 1/9? 33/4 What is the second smallest value in -0.06, -1, 0.3, 8, -0.4? -0.4 What is the fifth smallest value in 4, -1, 237, -5, 22? 237 What is the second biggest value in -1, 4, 226.9? 4 Which is the fifth smallest value? (a) 0.3 (b) -0.3 (c) 1/3 (d) -1/4 (e) 3 (f) 2/9 c Which is the biggest value? (a) 62/11 (b) 389 (c) 2 b What is the third smallest value in 1, -4, -0.5, 1/2, -12.01? -0.5 Which is the second biggest value? (a) 5 (b) -0.09 (c) -0.821 b What is the fourth smallest value in 0, -6, -0.4, 1/5, 2/57? 2/57 Which is the smallest value? (a) -207.5 (b) 19 (c) 1 a Which is the second biggest value? (a) 2/77 (b) 0.273 (c) 10 b What is the biggest value in -2, -5, -0.2, -975? -0.2 What is the sixth smallest value in -4, -0.02, -4/9, -5, -0.4, 1/6? 1/6 Which is the third smallest value? (a) -1/3 (b) 7 (c) -3/2 (d) -1/2 (e) -537/2 (f) 14 d Which is the third biggest value? (a) -0.1 (b) 340 (c) -27 (d) 3 a Which is the smallest value? (a) 0.2 (b) 2 (c) -1 (d) -13482 d Which is the biggest value? (a) 0 (b) 3/20 (c) -2/11 (d) -4 (e) -0.5 (f) -6 b What is the second biggest value in -1, -222, -0.28, 1, 30? 1 What is the second biggest value in -2.5, -7, 13.6, -3? -2.5 Which is the second smallest value? (a) 11 (b) -1/3 (c) -83 (d) -0.314 b What is the second smallest value in -5/3, 0.1, -15, -2? -2 Which is the second smallest value? (a) -0.6 (b) -2 (c) -6 (d) 2/5 (e) 1/10 b Which is the fourth smallest value? (a) 1 (b) -55 (c) -5/3 (d) -7 (e) 3 (f) -5 c Which is the smallest value? (a) -6 (b) 2/9 (c) 0.5 (d) 465 (e) -12 e What is the smallest value in -5, 18, -4323/5? -4323/5 What is the biggest value in 2/3, 3/4, 51/262? 3/4 Which is the smallest value? (a) 2/11 (b) -0.3 (c) 70062 b What is the fourth smallest value in -6/11, -0.9173, 10, -3? 10 What is the fifth biggest value in -2/9, 35, 4, -0.42, -1/3? -0.42 What is the second biggest value in 536, 1/22, -2, 0? 1/22 Which is the second biggest value? (a) 0 (b) -6 (c) 4 (d) 851 (e) 2/13 (f) -3/4 c What is the biggest value in 12/5, 2/13, -3, 2/7, -1/47, 77? 77 Which is the sixth biggest value? (a) 4/5 (b) 0.3 (c) 5/3 (d) -6/17 (e) 1/33 (f) -1 f Which is the second biggest value? (a) -52 (b) -1/140 (c) -0.4 c Which is the smallest value? (a) 2 (b) -46430 (c) 1/6 b Which is the smallest value? (a) 1 (b) -3/8 (c) 262/7 b Which is the sixth biggest value? (a) -	{ "pile_set_name": "DM Mathematics" }
h4 Expand (1 - 3 + 3)(6c - 6c + 5c) + ((1 - c - 1)(0 - 1 - 1) + 4 + 2c - 4 - c + 0 + 0 + 9c - 20c - 25c)(-3 - 4 + 1). 203c Expand (143l2 - 506l*2 - 972l*2)(10 + 3 - 2). -14685l2 Expand (w + 65 - 74 - 4w)(85w + 5 + 36 - 39). -255w2 - 771w - 18 Expand ((2 + 2b - 2)(b*2 + 2b*2 - 2b*2) + 2b3 - b3 + b*3)(64 - 25 + 30)(6b - b*2 - 6b). -276b5 Expand (4 - 3 + 0)(-1289l + 2554l - 1305l - 7). -40l - 7 Expand (0 + 3p + 0)(3206 - 3206 + 873p2). 2619p*3 Expand -m + 4m - 2m + (3 - 4 + 0)(3m - 4m + 0m) + m - m - m - m - m + 3m - 2m + 3m - 2m + (12m + 18m - m)(-1 - 3 + 0)(0 + 4 + 0). -463m Expand (0z2 - 3z*2 + 5z*2)(4z3 - z3 - 5z*3) + (0z*2 + 9z*2 + 3z*2)((0z + 0z - z*2)(-2z + 2z - 12z) + 2z*3 + 3z*3 - 3z*3). 164z*5 Expand (3s*2 - 132s*5 - 74s*2 + 142s*5)(1 - 1 + 1). 10s5 - 71s*2 Expand (3m + 4m - 5m)(4 - 4 - 2)(4 - 2 - 1) + 1 - 1 + 2m + 2 - m - 2 + (0 + 2 - 3)(-2m + 3m + m) - 1008104 + 2298m + 1008104 + 3m - 4m + 3m. 2295m Expand (-5 + 0 + 4)(-11 + 3 + 2)(3 + 0 - 2)(549f - 830f + 416f). 810f Expand (-3 + 1 - 1)(-4 + 4 - 2o) - 11o + 36o - 14 + 1. 31o - 13 Expand -b + b - 3b5 - b5 + 4b5 - 5b*5 + (-2b*3 - 2b*3 + 3b*3)(2 - 2 + b*2) + (2 + 5 - 3)(37b5 - 24b*5 + 24b*5). 142b*5 Expand (2 + j - 2)(-1 + 1 + 2)(-7061 - 3515j + 7061) + 2j2 + 2j - 2j. -7028j*2 Expand (4 - 5 + 0)(4u + 4 - 4) + 369 - 53u - 369 + 5 - 3u - 5. -60u Expand 461w5 + 455w*5 - 265w*5 + (28w - 6w3 - 28w)(-w - w2 + w) - 3w5 - w5 + 5w5 - 1. 658w*5 - 1 Expand (-35 + 3 - 4 - 6)(-1829v + 26 + 921v + 920v). -504v - 1092 Expand (4y - 2y - 3y)(471 + 705 + 3559 + 6970). -11705y Expand (0x + 0x + x + (2x + 0x - x)(0 + 1 + 0))(-4x + 0x - 1 + 5x)(-90x*2 - 746x*2 - 206x*2) + (4x*2 - 5x*2 + 2x*2)(-x2 + x2 + x*2). -2083x*4 + 2084x*3 Expand (39p - 670 + 670 + (0 + 2p + 0)(-3 + 4 + 1) - 4p + 0p + 3p)(-28 + 29 - 15 - 25 - 21). -2520p Expand (-9r*4 + 19r*4 - 161r*4 + (-3r3 + r3 + 3r3)(0r + 2r - 4r))(6r - r + 2r) + r3 + r5 - r*3. -1070r*5 Expand (4a - 5a + 0a + (-6a + 3a + a)(-3 - 4 + 5) + 0a + 4a + 0a + 310a - 202039 + 202039)(-a*4 + 0a*3 + 0a*3)(-3 + 3 - 5). 1585a5 Expand (43y - 18y + 9y)(-16y + 24y + 33y). 1394y2 Expand (-3b2 + b2 + 6b2)(-242b2 - b + 5 + 2 + 237b2) + (-1 + 1 + b2)(b2 + b2 + 0b*2). -18b*4 - 4b*3 + 28b2 Expand -3 + 2 - o2 - 29o + 31o + (-o - 26 + 26)(4 + 0 - 5 + o). -2o*2 + 3o - 1 Expand (38 - 10 - 120 - 160 - 21)(-g2 - g2 + 13g*2). -3003g*2 Expand (-17r + 33 - 33)(4r*2 + 142r + 3 - 142r). -68r*3 - 51r Expand (-2 + 10p + 2)(-15 + 14p + 15) + 2 - 2 - 17p*2 + 3p*2 + 3p*2 - 8p*2 + (-5 + 5 - 2p)(0 + 0 - 2p). 125p2 Expand (-f5 + 5 - 5)(-1 + 1 + 2)(50 + 24 + 15) + f2 - f5 - f2 + (2f*4 + 4f*4 - 5f*4)(-2f - 2f + 3f). -180f*5 Expand (1083a + 2288a + 1366a - 1115a + 467a)(-3 - 2 + 4). -4089a Expand (-r*2 + 3r*2 + 0r*2)(-2r2 - r2 + 8r*2) + (37r*2 - 1647 + 1647)(r*2 - 3r*2 - 3r*2). -175r*4 Expand (3j + 2 - 2)(2 - 2 + 3)(2j - 4j - j + (3 - 3 + 1)(3j - 2j - 3j))(0j3 + j3 + 6j3). -315j*5 Expand (6z - 5z + 4z)(-23 + 101 + 106 - 30). 770z Expand (11647f + 0 + 0 - 11585f)(4f + 2f - 5f + 1 - 1 - f + 2f + 0f - f + (3f - f - 3f)(0 - 1 - 1) - f + 2f + f). 310f2 Expand 5m + 5m - 12m + 12m2 + 7m*2 + 2m - 2m + (2m + 0 + 0)(0m + 13m - 2m). 41m2 - 2m Expand (-s + 2 - 2)(2 + 3 - 3) + (-249 - 191s - 199s + 393s)(4 - 4 + 3). 7s - 747 Expand (4x3 - 5 + 5)(-248x - 278x + 165x). -1444x*4 Expand (-67z + 91z - 15z - 14)(1 - 3z - 1). -27z2 + 42z Expand (97s2 + 129s*2 - 42s*2)(5 - 4s - 5). -736s*3 Expand -5p - p + 3p + (-2 + 2 - 6p)(-4 + 4 - 1) + (0 + 3 - 5)(2p + 0 + 0) + 5p - p - 16p. -13p Expand (-13723l2 + 16234l*2 + l - l)(-1 + 1 - l2 + (-l2 - l*2 + 0l*2)(-2 - 2 + 5) - 2l2 - l2 + l2)(2 + 0 + 0). -25110l4 Expand -5i + i + 2i - 63 + 63 - 17i + (5 + 0 + 2)(-3i + 3i + 2i) + 9i - 18i - 26i. -40i Expand (-i*2 - 5i*2 + 8i*2)(-3i3 + i3 + 5i*3) + 49i*5 - 64i*2 - 47i*5 + 49i*2. 8i*5 - 15i2 Expand -i4 - 13i3 + 13i*3 + (2i3 - i3 + 3i3)(-i + 2i - 2i) - 18i4 - 62i*4 - 17i*4. -102i*4 Expand (68 + 38 - 28 + 16)(-92o3 + 240o*3 + 91o*3). 22466o*3 Expand (-23a*2 - 44a*2 - 7a*2)(9a2 + 4a*2 - 14a*2)(-a - a + a). -74a5 Expand ((-2k + 2k + 2k)(0k - 2k + k) + 70 - 53k*2 - 133 + 64)(k + k + 0k). -110k*3 + 2k Expand 0q2 - 2q*5 + 0q*2 + (52q*2 + 206 - 208 + 270q*2)(18q3 + 0q*3 + 6q3) - q5 - 2q5 + q5. 7724q*5 - 48q*3 Expand ((d + d - 8d)(-2 + 0 - 3) + 2d - 5d + 2d)(125 - 12 - 47). 1914d Expand (-4274339 + 4274339 + 4007o2)((-2 + 4 - 1)(-2o + 1 - 1) + 2o - 3o + 0o). -12021o*3 Expand 31n*3 - 112n*3 + 60n*3 - 5n*3 - 4n + 4n + 2n*3 - 2n*3 - 2n*3 + (4n*2 - 5n*2 + 2n*2)(2n - 2n + n) - 5n3 - 4n + 4n. -32n*3 Expand (-5 + 0 + 2)(-3a5 - 3a*5 + 5a5) + (-a4 + 4a4 - a4)(376a - 34a - 37a + 2) - 2a5 - a5 + 6a5. 616a*5 + 4a*4 Expand ((2 - 2 - v)(-4 + 5 - 3) - 2v - v + 4v)(-1 + 3 + 1)(-4373 - 122 + 708). -34083v Expand (86 - 86 + 3w*2)(6 - 6 - 3w)(-5w2 + 8w*2 + 4w*2). -63w*5 Expand (-2l + 1 - 1)(540 - 209 + 1587). -3836l Expand (-741l + 118l - 235l)(4 - 2 - 4). 1716l Expand 11 - 11 - 4m + (-4 + 6 - 3)(m - 6m - 4m)(-8 + 3 - 1) + 0m + m + m. -56m Expand (5 - 3 - 4)(-5 + 2 + 1)(-8 - 24g + 5742g*2 - 5745g*2 + 17). -12g*2 - 96g + 36 Expand (1 + 4 - 32)(3a*2 - 7a*2 + 0a*2) - 2a + 2a - a + 13a*2. 121a*2 - a Expand (-261m + 30 + 19 + 259m)(11m - 8m - 6m). 6m*2 - 147m Expand (3 - 1 - 4)(-130 - 602 - 92 - 305)(2y + 0y - 6y). -9032y Expand -28z4 - 9z*4 + 33z*4 - 61z*2 + 0z*3 + 0z*3 + 4z4 + (-3 - z4 + 3)(-6 + 1 + 4). z4 - 61z*2 Expand (-60w*2 + 60w*2 + 54w*3)(-7 + 4 - 1) + (7w2 + 0w*2 - 2w*2)(w + 0w + 0w). -211w3 Expand (-3d*2 - 302d - 2041808d3 - 2 + 4083604d*3 - 2041802d*3)(-1 + 2 - 2). 6d3 + 3d*2 + 302d + 2 Expand k*2 + 0k*2 - 3k*2 - 3k*5 - 4k*4 + (1 - 6k + 5k + 0k)(-5k4 + k4 + 3k4). -2k*5 - 5k*4 - 2k*2 Expand (1 - 1 + 1 + 4)(-d + 2d + 0d)((d + 4 - 4)(-8d2 + 6d*3 + 8d*2) + 4d*4 - 9d*4 - 15d*4). -70d*5 Expand (-i + 227i*2 + 0i - 228i2)(281i2 - 44i*2 + 51i*2). -288i*4 - 288i*3 Expand (-123w*2 + 50w*3 + 26w*3 + 122w*2)(-170 - 64w + 170). -4864w*4 + 64w*3 Expand (2 + 0 - 1)(-3710i + 1903i + 1003i + (-4i - i + 3i)(-5 + 9 + 4)). -820i Expand (6j*2 - 3j*2 + 3j*2 + (2 - 2 + j)(-1 + 1 + 4j))(24j - 2j + j)(j + j - 3j). -230j4 Expand (0j*2 - 3j*2 + 2j*2)(-3495j2 - 2934j*2 - 3480j*2). 9909j*4 Expand (5f + 11f2 + 5f - 2f)(21 + 1 + 8). 330f2 + 240f Expand (-3r - 3r + 4r)((-11r3 + 28r*3 + 0r*3)(-11 + 11 - r) + (2r + 0r + 0r)(-r*3 + 2r*3 - 4r*3)) + (-2r*4 - 2 + 2)(2r + 0r - r). 44r5 Expand -3k + 3k + 2k*5 + (3k - 3k - k4)(0 - k + 0) - 2k5 - k5 + 5k*5 + 15k*2 - 24082k*5 - 11k*2 + 23294k*5. -783k*5 + 4k*2 Expand 18k*5 - 15k*5 - 7k*5 + (22k*3 - 13k*3 + 12k*3)(-k + 2k2 + k). 38k5 Expand h3 - 4h3 + 4h*3 + (3h*2 - 2h2 + h2)(2h + h - 2h) - 1 + 1 - 2h*3 - 61 - 8h*3 + 3502h - 19h3 - 3502h. -26h3 - 61 Expand (100h*2 - 59676h + 59676h)(3 - 3 + 2) - h*2 + 2h*2 - 4h*2. 197h*2 Expand 259 + 81i - 259 + (i - 2i - i)(-3 + 1 + 4) - 15 + 15 - 5i. 72i Expand (3710 - 3710 - 111j)(-1 + 2 - 5)(6 - 3 - 1)(2j + 4j - 7j + (-1 - 1 + 3)(4j - 2j - 4j) + 3 + j - 3). -1776j*2 Expand (2 - 5 + 0)(-4w + 6w + 0w) + 22106 + 438w - 22106 + (2 + 3 - 6)(0 + w + 0) + 0w + 3w - w. 433w Expand (-1 + 3 - 3)*(165 + z + 195 - 106). -z - 254 Expand (-1	{ "pile_set_name": "DM Mathematics" }
e Let m(w) = 25 - 8w + 3w*2 + 75w + 11w - 2w. Let c be m(-25). Suppose c = 3z + 2z - 4870. Is z composite? True Suppose 0h - h - 3p + 23 = 0, 0 = 3h + 5p - 57. Let q(l) = 3l2 - 16l + 45. Is q(h) prime? True Let g be 0 + (-1)/(2/(-6)). Let o(j) be the second derivative of 103j3/3 + 8j*2 - 10778j. Is o(g) prime? False Suppose -2a = -c + 132129, -102c + 97c + 660629 = 6a. Is c composite? True Let k(x) = 3x2 + 5x - 11. Let d be (-1 - -2)/(2/22). Suppose -9 = -4s + d. Is k(s) composite? False Suppose -3x + 14331 = -2o + 6o, -17910 = -5o - 5x. Suppose 2u + 13923 = -5h + 4950, -2h - 5u - o = 0. Let k = h + 3132. Is k a composite number? True Suppose 0 = -45m + 18002297 - 5991302. Is m a prime number? False Let o = -81 - -73. Let c(k) = -4 - 31k + 21 - 29k. Is c(o) composite? True Let k = 2140 + 791. Let x = 4455 - k. Is (1/3)/(4/x) composite? False Let z(f) = -4f*3 + 92f*2 + 35f + 128. Is z(21) a prime number? True Let s(x) = 1864x2 + 21x - 82. Is s(9) a prime number? True Let d(j) = -j*3 - 8j*2 - 10j - 29. Suppose 23 = -33k + 29k + 5n, 3n = -4k - 63. Is d(k) composite? True Let h = 63 + -51. Suppose -5l + 13 = -h. Suppose lu + 1002 = 2857. Is u composite? True Let i(f) be the first derivative of 7f*4 + 4f*3/3 - 11f*2/2 - 33f - 1. Is i(10) a prime number? False Suppose 5l + 91 = 306. Suppose 7 - l = -3g. Is g/102 + 12984/34 prime? False Let x(m) = -1121m - 4407. Is x(-10) prime? True Let k be ((-13)/(-39))/((-2)/18). Let r(q) = 52q2 + 5. Let c be r(k). Let w = -262 + c. Is w composite? False Let f(m) be the second derivative of m3/2 - 10m2 + 23m. Let y be f(8). Is 804/y(-1)/((-3)/5) prime? False Suppose 8q - 4q = 5c + 430430, 2c + 107609 = q. Is q prime? False Let r = -512 + 507. Let b(i) = -11i*3 + 9i*2 + 7i - 6. Is b(r) composite? False Let a(x) be the first derivative of -77x6/40 - x4/24 + 7x*3/6 - 7x2/2 + 30. Let r(y) be the second derivative of a(y). Is r(-3) prime? True Let w(a) = a3 + 5a2 - 8a - 12. Let m be w(-6). Suppose 2f + 13f + 30 = m. Is 2936 - (3/4)/(f/8) prime? True Suppose -25128 = -8i - i. Suppose 0 = 4g + 3s - i, 2g - 3g = 2s - 693. Is g a composite number? False Let p(b) be the third derivative of -13b6/60 + b5/60 - b4/6 + b3/6 + b2. Let u be p(-3). Let g = 1059 - u. Is g prime? False Let z(r) = 32r*2 + 8r + 14. Let b be z(-9). Suppose -5w + b = -1391. Is w prime? False Let v(l) = 44l + 74l - l - 9l + 32l + 37. Is v(27) a prime number? False Suppose -411708 = -3i + 3n, 5i - 3n = 218611 + 467575. Is i a prime number? True Suppose 0 = -6a + 2a + 28. Let s be 1/a - (-13)/7. Suppose sl - 1921 = -l - 5x, -l - 2x = -639. Is l a composite number? False Suppose 5r + 3g - 57859 = 0, 78r - g - 46294 = 74r. Is r a composite number? True Suppose 0 = 4t + 46336 - 12680. Is (-62)/155 + t/(-10) composite? True Let w(x) = 4x*2 + 6x + 49. Let g be w(26). Suppose g + 6858 = v. Is v a composite number? False Let m(v) = 4v - 4. Let p be m(5). Suppose -a + 9a = p. Suppose -ah + 5k + 391 = -50, 5h - 2k = 1071. Is h a composite number? True Let y(b) = 8b2 - 11b - 10. Let z be y(-1). Suppose -zm = -63451 - 56312. Is m composite? True Suppose 0 = -x + 3l + 62842, 2x - 37438 = -2l + 88270. Is x a composite number? False Let u = 9489 - 17038. Let c = 13481 + u. Suppose 5t = c + 4273. Is t prime? False Let j(y) = 111y*2 - 30y + 6. Let c(m) = -m*2 - m + 2. Let l(x) = -2c(x) + j(x). Is l(9) composite? True Suppose 4o + 2p = -43 - 43, -5o - 5p = 120. Let n(x) = x*3 + 19x*2 - 14x - 151. Is n(o) a composite number? True Let m(b) = 4b3 + 6b*2 - 9b - 16. Let z be m(-4). Let p = -115 - z. Is (217005/p)/3 + (-4)/10 composite? True Suppose 232155 = 5v + 4a - 114259, 4a = 4. Suppose 0 = -3i + x + v, i + 2x - 23105 = 6x. Is i a composite number? True Is 10 - (35872362/(-99) + (-6)/(-66)) composite? False Suppose 0 = -4l - 79l + 1377385. Is l a composite number? True Let c(u) = -10307u3 - u2 - 2u - 2. Let b be c(-1). Suppose -b = -2j - 3z, -4j + z = -3z - 20572. Is j prime? True Is (-1195)/239(0 + -22391) a composite number? True Suppose 4h - 5 = -17. Let x(u) = -25u2 - 4u + 7. Let b be x(h). Let c = 351 + b. Is c prime? False Let i = 61346 + -28506. Suppose -11839 + i = 2w + 3r, -52490 = -5w + 5r. Is w prime? True Let h(d) = -12d3 - 6d*2 + 7d - 13. Let p(a) = 25a3 + 12a*2 - 15a + 26. Let r(k) = 9h(k) + 4p(k). Is r(-6) a composite number? False Let a(n) = 281n2 - 2n + 12. Let s be a(8). Suppose -8k = -3k - s. Suppose -d - 4d - 3575 = -2l, k = 2l + 2d. Is l a prime number? False Let l(q) be the first derivative of 5q4/2 - 14q*3/3 + 12q*2 + 27q - 32. Is l(14) composite? True Let z(b) = 2452b3 + 8b*2 + 17b - 40. Is z(3) a prime number? False Let j(m) = -218m + 3. Suppose 1259 = -3q + 1256. Is j(q) composite? True Suppose 7 = 3r - 2. Suppose 6x = rx - 2x. Suppose 27b - 9b - 3798 = x. Is b prime? True Let v(n) = 7n3 - n2 - 3n + 3. Let i be v(1). Let y(l) = 1817l - 103. Is y(i) a composite number? False Let h = 33024 + -13881. Suppose -2k - 1861 = -3m - h, 5k + 4m = 43205. Is k prime? True Let t be (0 + -1)(339 + 6). Let s = 1020 + t. Let a = s + -344. Is a prime? True Suppose -14611 = 3k - 5m, -4m + 0m - 9748 = 2k. Let x = k - -17814. Is ((-28)/6)/(4(-3)/x) a prime number? False Let p = 7 - 3. Let d = 9460 + -5032. Suppose ph + d = 10976. Is h prime? True Suppose 0 = -28q - 73q + 10237431 + 5670170. Is q a prime number? False Suppose 24m - 29m = 3n - 1747537, -5n = -6m - 2912533. Is n prime? True Let j(y) = -3y3 - 4y*2 + 2y - 14. Let f be j(-6). Let q(b) = 24b - 23. Let a be q(-8). Let x = f + a. Is x a prime number? True Let p = -183 + 185. Is ((-180)/(-150))/(p/25735) composite? True Let r = 3941 + -1426. Suppose -4a = -2p - a + r, p - 3a = 1256. Is p prime? True Is (66966790/(-770))/(((-2)/7)/2) a prime number? True Suppose 178g = -112g - 26g + 9281236. Is g a composite number? True Let q(o) = -27o*3 - 9o*2 - 12o + 7. Suppose s + 44 = -10s. Is q(s) prime? False Suppose 0 = 3h - 13 - 8. Suppose -4y = 3j - 0j + h, -2y + 2j + 14 = 0. Suppose 0 = -yd + 246 + 512. Is d composite? False Is 200044 - (-1 - (15/(-20))/((-1)/8)) a composite number? True Suppose 22r + 2 = -526. Let w(v) = -64v + 199. Is w(r) a prime number? False Let d = -412 - -272. Is (-216605)/(-9) + d/630 prime? False Let y(f) = 9f + 59. Let p be y(-7). Let z(v) = -188v + 29. Is z(p) a prime number? False Suppose 3v = -7v + 350. Suppose 5z - 3a = -v, z - a + 0a + 9 = 0. Is 21/(z/(-1354)) composite? False Suppose 0 = 9z - 54465 - 297020 + 29924. Is z a prime number? True Let d be (-24008)/(-18) + -5 - 6/(-27). Let k = 1960 - d. Is k composite? False Let t = -422606 - -701745. Is t a composite number? True Let d = 133 + -128. Suppose -3z + 0p + dp = -38694, 0 = 5p + 15. Is z a prime number? True Let l = 177912 - -63257. Is l composite? False Suppose 3f = 15, -5f + 27030 = 16x - 21x. Let n = x + 8708. Is n prime? True Suppose 421 + 1119 = 4s. Suppose 0 = 3u + 4y - 5049, 3y - s = -u + 1303. Is u composite? True Suppose 14f - 51571 = 2f - f. Is f a prime number? True Suppose -2p + 562933 = 218375. Is p a composite number? False Let a = -255 + 309. Is 2/(a/120993) + (-4)/18 a prime number? True Let w be 5420/6 - (-24)/36. Suppose w = 6o - 3260. Is o prime? False Suppose -5979334 = -108z + 4595004 - 233662. Is z prime? True Let y = 1151097 - 765966. Is y prime? False Let c(q) = -33464q + 201. Is c(-5) a prime number? True Is 40/(-35) - 9/((-63)/7193761) a prime number? True Let b = 479 + -475. Suppose 5m - 117920 = -4w + 39821, bm - w = 126197. Is m composite? True Suppose -3j + 19235 = -53s + 49s, 12828 = 2j + 2s. Let h be (0 - -2 - 0) + 8. Suppose -j = -d - hd. Is d prime? False Suppose -5f + 40 = -5j, 3j - 52 = -5f + 2j. Let o be 10(2/10)/((-4)/f). Is 2/o - (-1071)/15 composite? False Suppose -q = -25x + 30x - 11, 2x - 2 = 0. Let l(g) = 19g + 28. Let w(n) = 37n + 55. Let v(i) = -5l(i) + 3w(i). Is v(q) a composite number? True Suppose -2o = -12*o - 20. Let	{ "pile_set_name": "DM Mathematics" }
+ 2f. Let d(q) = -5q. Calculate d(b(j)). -320j2 Let s(n) = 7618n*2 - 286758 + 286758. Let b(v) = 3v. Determine b(s(h)). 22854h2 Let r(w) = 241w - 993. Let f(l) = -30l. Determine r(f(s)). -7230s - 993 Let u(j) = j. Let p(l) be the first derivative of 246l2 + l - 4346. Calculate p(u(v)). 492v + 1 Let v(u) = -9 - 4u + 9 + 0. Let g(d) = 570d*2. Let x(w) = 44w*2. Let c(p) = 3g(p) - 38x(p). Give c(v(k)). 608k*2 Let m(q) = -10127q + q*2 + 10127q. Let a(c) = -2c - 59. Determine a(m(y)). -2y*2 - 59 Let w(q) = 178103q. Let a(c) = 2c - 7. Give w(a(f)). 356206f - 1246721 Let h(w) = -3w - 12. Let n(p) = -2p - 2259. Give n(h(v)). 6v - 2235 Let x(a) = 33971a. Let r(v) = 774v. Give r(x(p)). 26293554p Let c(w) = -w. Let j(f) = 1016641115f. Calculate j(c(b)). -1016641115b Let x(g) = -13049g. Let k(i) = -i2 + 173i. What is k(x(n))? -170276401n2 - 2257477n Let s(m) = 3m. Let f(q) = 6q - 7. Let g(z) = 3z - 3. Let t = 19 - -11. Let k = t - 16. Let c(j) = kg(j) - 6f(j). Calculate c(s(y)). 18y Let i(j) = 2011j2 + 2j + 1. Let o(s) = -3789s. Calculate i(o(g)). 28870963731g*2 - 7578g + 1 Let k(t) = 4t - 3. Let v(h) = 17h - 13. Let u(a) = -26k(a) + 6v(a). Suppose -34z + 495 = -899. Let q(j) = 6j*2 - 80 + 3j*2 + z + 37. Determine q(u(s)). 36s*2 - 2 Let t(a) = 19a*2 - 1349a. Let p(c) = -7c2 - 4c. Let v(o) = 3p(o) + t(o). Let b(d) = -2d*2. What is v(b(f))? -8f*4 + 2722f*2 Let k(i) be the third derivative of -1/12i*4 - 4 + 1/2i*3 - 5i*2 + 0i. Let q(c) = 2c2. Calculate k(q(l)). -4l*2 + 3 Let b be (10 - 2) + -10 + 4. Suppose p = -x - 2 + 12, -23 = -3x + 4p. Let j(h) = 0h - xh2 + 0h + 8hb. Let a(k) = -3k*2. Give a(j(s)). -3s4 Let t(r) be the third derivative of -r5/30 + r*3/3 - 116r*2 + 5r. Let m(n) = -4n2. What is t(m(j))? -32j*4 + 2 Let b(s) = 6s - 267. Let q(j) = -99585j. Determine b(q(p)). -597510p - 267 Let f(y) = 34y - 2. Let t(z) = 40z - 1. Let j(q) = -4f(q) + 6t(q). Let x(n) = -37n2. Calculate j(x(p)). -3848p*2 + 2 Let v(l) = -24l*2 - 9l - 36. Let s(h) = -11h2 - 4h - 16. Let k(z) = -9s(z) + 4v(z). Let f(c) = 0 - 1 + 76c - 1 + 4. What is k(f(d))? 17328d*2 + 912d + 12 Let r(y) = -39343139y2. Let g(u) = 8u. What is r(g(n))? -2517960896n2 Let f(k) = 7182715k. Let s(d) = -2d - 5. What is f(s(w))? -14365430w - 35913575 Let h(v) = -9v - 9. Let n(a) = -48a - 51. Let j(s) = 34h(s) - 6n(s). Let i(l) = -l*2 - 9. Determine i(j(r)). -324r*2 - 9 Let h(i) be the first derivative of -5i*3 + 150. Let n(f) = 9f*2 + 6f + 6. Let a(u) = -u*2 - u - 1. Let q(r) = -18a(r) - 3n(r). Determine q(h(t)). -2025t*4 Let q(n) = -32n*2. Let g be 146176/12 + -4 - (-2)/3. Let w(j) = -12178j + gj + 3j*2. Give q(w(o)). -288o*4 Let u(y) = 9y. Let q(b) = -b*2 + 2. Let h(x) = -2x*2 - 51x + 71. Let t be h(-26). Let f(o) = 6o2 - 15. Let n(m) = tq(m) + 6f(m). Give u(n(s)). -81s*2 Let o(c) = 12126c*2. Let k(r) = -89r. Determine k(o(v)). -1079214v2 Let o(k) = -k. Let g = 642 + -1131. Let x be g(-3)/63 - (-2)/(-7). Let z(n) = -7n + 3n + xn. What is o(z(a))? -19a Let y(i) = i*2 - 1563i + 3. Let n(a) = 921a. What is n(y(c))? 921c*2 - 1439523c + 2763 Let d(o) be the first derivative of -o*2/2 + 2072. Let c(m) = 23m*2 - 12m. What is c(d(j))? 23j2 + 12j Let d(i) = 6i2. Let j(q) = -16033368q*2. What is d(j(g))? 1542413336540544g*4 Let w(v) be the first derivative of -2v*3/3 - 2173. Let f(p) = -535p*2. Determine w(f(d)). -572450d*4 Let s(b) = 57b*2. Let o(w) = 6w*2 - 15w + 3. Let k(g) = -30g2 + 70g - 14. Let l(h) = -3k(h) - 14o(h). What is l(s(v))? 19494v4 Let d(a) = -31779a*2. Let v(l) = 101l*2. Determine v(d(o)). 102000388941o*4 Let l(q) = -2q*2. Let h(s) = -153854s*2 + 1162. Give h(l(z)). -615416z*4 + 1162 Let o(f) = 3f - 2. Let g(z) = -32162 + 64322 - 32161 - 17z2. What is g(o(m))? -153m*2 + 204m - 69 Let p(w) = -7w2 - 2w + 372. Let x(d) = 0d - 19d + 67d - 27d - 20d. What is x(p(z))? -7z*2 - 2z + 372 Let r(c) = 177157448c2. Let g(o) = o2. Determine r(g(w)). 177157448w*4 Let i(b) = -83170b. Let d(w) = 47w - 1. What is i(d(v))? -3908990v + 83170 Let r(x) be the third derivative of -13x4/24 - 425x*2. Let n(f) = 59f*2. Give r(n(l)). -767l*2 Suppose 4n - 12 = -4t, -5t - 23n + 7 = -26n. Let x(r) = -tr - r + 73r*2 - 67r*2 + 3r. Let g(f) = -f + 0f + 0f. Calculate x(g(i)). 6i2 Let y(p) = -4750p*2. Let j(c) = -182c*2 + 16c + 48. Let d(m) = -34m2 + 3m + 9. Let r(v) = 16d(v) - 3j(v). Give r(y(g)). 45125000g4 Let r(o) be the first derivative of -8o*3/3 + 3. Let q(m) = -17m*2 - 14m + 7. Let l(t) = 7t2 + 6t - 3. Let j(p) = 7l(p) + 3q(p). What is r(j(c))? -32c4 Let w(i) = 2i. Let s(h) be the second derivative of -137h4/4 - h3/6 - 6h - 274. Determine w(s(l)). -822l2 - 2l Let c(q) = 4q - 180. Let m(v) = -v + 50. Let u(h) = 5c(h) + 18m(h). Let n(p) = -35p*2 + 2 + 11p*2 - 13p*2. Determine u(n(i)). -74i2 + 4 Let q(m) = m2 + 21m. Let f(h) = 679h*2. What is q(f(b))? 461041b*4 + 14259b*2 Let n(x) = -9276x + 1. Let h(m) = -m - 85. What is h(n(f))? 9276f - 86 Let j(v) = -4v. Let l(p) = -2p2 + 4112662. Determine j(l(b)). 8b*2 - 16450648 Let v(q) = -265q*2 + 45q + 45. Let g = 288 - 243. Let j(b) = 12b2 - 2b - 2. Let m(k) = gj(k) + 2v(k). Let u(o) = -14o. Calculate u(m(y)). -140y*2 Let c(u) be the third derivative of -3u*5/5 + 97u*2. Suppose 13 = 4q + 5d, -6d + 2d + 4 = 0. Let j(m) = -mq + m - m. Give c(j(t)). -36t*4 Let h(s) = -106080142s. Let d(w) = 7w2. Determine d(h(j)). 78770975687181148j*2 Let m(l) = 1843678l. Let g(y) = 4y2. Determine g(m(o)). 13596594270736o*2 Let w(n) = -5n. Let p(v) = -15v - 50. Let h(t) = -498 + 247 - 4t + 239. Let x be 4/18 - 104/(-18). Let r(m) = xp(m) - 25h(m). Give w(r(q)). -50q Let a(q) = 2q*2. Let y(f) = -27558232f*2. What is y(a(t))? -110232928t*4 Let k(o) = 41o*2 - 2o. Let i(j) = 61 - 26 - 35 + 5j2 - 2j*2. Calculate i(k(d)). 5043d*4 - 492d*3 + 12d*2 Let h(b) = 4555b. Let a(j) = 1949j2. Determine a(h(q)). 40437900725q*2 Let q(w) = 2w*2 - 132w. Let n(b) be the first derivative of b*2 - 742. Determine q(n(s)). 8s*2 - 264s Let j(b) = 39b2. Let p(i) = -993i*2 - 8i + 32. Let k(u) = 331u2 + 3u - 12. Let q(m) = 8k(m) + 3p(m). Give j(q(x)). 4272879x4 Let h(b) = b. Let q(w) be the third derivative of 14w*2 + 16w*2 + 17w*4 + 11w*4 - 23w*4. What is q(h(y))? 120y Let t(p) = 51p2. Let v(r) = 396r*2 + 19800r. Let j(q) = q*2 + 75q. Let y(l) = -264j(l) + v(l). Calculate t(y(c)). 888624c*4 Let n(t) = -66t. Let q(o) = 37o2 + 38o - 76. Let y(u) = 2u2 + 2u - 4. Let c(g) = 2q(g) - 38y(g). Calculate c(n(j)). -8712j2 Let c(l) = 1285l. Let k(j) = 2j2 - 3948. What is c(k(z))? 2570z*2 - 5073180 Let j(b) = 31 - 2b - 31. Let i(p) be the first derivative of -p*2/2 + 31p + 1330. What is j(i(l))? 2l - 62 Let y(d) = -2d - 131680605. Let i(a) = -a. Calculate i(y(o)). 2o + 131680605 Let h(a) = 243973a. Let r(k) = k. What is r(h(d))? 243973d Let v(z) = 3z. Let d(c) = 6324688c. Give v(d(l)). 18974064l Let c(a) = 74455341a. Let l(o) = o2. What is c(l(z))? 74455341z*2 Let c(f) = -f - 4f2 + f. Let j(i) be the third derivative of -i4/6 + 2009i2 + 4i. Calculate c(j(t)). -64t2 Let w(a) = -1254967a*2. Let y(s) = -57s*2. Determine w(y(p)). -4077387783p*4 Let q(l) = -2l*2. Let o be 3 - (-60)/(-16) - 45/(-12). Let y(a) be the first derivative of 9a*3 + 8a*3 + 3a*3 - 5a*o - 23. Determine y(q(n)). 180n4 Let m(u) = -u2 + 27u + 36. Let l(i) = 71i. Determine m(l(x)). -5041x2 + 1917x + 36 Let n(z) be the second derivative of z*4/4 - 5z + 4. Let b(a) = 24a + 24. Determine n(b(g)). 1728g*2 + 3456g + 1728 Suppose 0 = -5v + 13v - 144. Let o(a) = -va + 4a - 4a - 10a. Let z(k) = 905 - 2k - 905. Determine z(o(m)). 56m Let x(q) = -120q. Let t(h) = 4h*2 + 618h - 1. Determine x(t(n)). -480n2 - 74160n + 120 Let b(d) be the first derivative of -22d3/3 - 50. Let c(n) = 74n*2 - 38n*	{ "pile_set_name": "DM Mathematics" }
116, -20092227, -30138338, -40184449, -50230560, -60276671? -10046111z - 5 What is the s'th term of 492, 1820, 3988, 7002, 10868, 15592? s3 + 414s*2 + 79s - 2 What is the j'th term of 17592042, 17592075, 17592120, 17592183, 17592270, 17592387? j*3 + 26j + 17592015 What is the k'th term of 64673576, 129347098, 194020622, 258694148, 323367676, 388041206, 452714738? k*2 + 64673519k + 56 What is the k'th term of 3064842, 3064801, 3064738, 3064653, 3064546, 3064417? -11k2 - 8k + 3064861 What is the t'th term of 4186, 8528, 13064, 17794, 22718? 97t2 + 4051t + 38 What is the q'th term of 550, 402, 140, -296, -966? -10q3 + 3q*2 - 87q + 644 What is the l'th term of 1764, 2172, 2854, 3810, 5040, 6544, 8322? 137l2 - 3l + 1630 What is the x'th term of 162278, 324227, 486176? 161949x + 329 What is the i'th term of -733, -1474, -2221, -2974, -3733, -4498, -5269? -3i*2 - 732i + 2 What is the m'th term of -228263, -456581, -684897, -913211? m*2 - 228321m + 57 What is the h'th term of 6809, 55870, 189171, 448832, 876973, 1515714, 2407175, 3593476? 7020h3 - 79h - 132 What is the p'th term of 3678, 4931, 6184, 7437? 1253p + 2425 What is the n'th term of -2469, -10508, -24091, -43218, -67889, -98104? -2772n*2 + 277n + 26 What is the n'th term of 16138, 15935, 15732? -203n + 16341 What is the r'th term of 38220, 38256, 38292, 38328, 38364? 36r + 38184 What is the w'th term of -3539147, -3539123, -3539101, -3539081, -3539063? -w*2 + 27w - 3539173 What is the m'th term of 109572865, 219145729, 328718593, 438291457? 109572864m + 1 What is the y'th term of -13528, -15835, -18156, -20497, -22864, -25263, -27700? -y3 - y2 - 2297y - 11229 What is the a'th term of -3372, -2866, -2382, -1932, -1528, -1182, -906, -712? -2a3 + a2 + 517a - 3888 What is the s'th term of 258658, 517353, 776084, 1034851, 1293654, 1552493? 18s2 + 258641s - 1 What is the d'th term of -49248, -48228, -47218, -46218, -45228, -44248? -5d2 + 1035d - 50278 What is the u'th term of 176747, 706987, 1590757, 2828087, 4419007, 6363547, 8661737, 11313607? 5u3 + 176735u*2 + 7 What is the b'th term of 217456, 217461, 217470, 217483? 2b*2 - b + 217455 What is the t'th term of -171, -3669, -13743, -33681, -66771, -116301, -185559, -277833? -548t*3 + 338t + 39 What is the x'th term of -85940, -85963, -86002, -86057, -86128, -86215? -8x2 + x - 85933 What is the m'th term of 12463259, 12463265, 12463271? 6m + 12463253 What is the m'th term of 8617949, 34471766, 77561461, 137887034? 8617939m2 + 10 What is the m'th term of 3879, 15605, 35153, 62523, 97715, 140729, 191565? 3911m*2 - 7m - 25 What is the d'th term of 125, -23, -621, -1957, -4319, -7995, -13273? -48d3 + 63d*2 - d + 111 What is the a'th term of -2462, -19755, -66714, -158165, -308934, -533847, -847730? -2471a*3 - 7a*2 + 25a - 9 What is the k'th term of 99374, 198886, 298398, 397910, 497422, 596934? 99512k - 138 What is the b'th term of 134287698, 134287697, 134287696, 134287695, 134287694? -b + 134287699 What is the j'th term of 88910, 88348, 87794, 87248, 86710? 4j*2 - 574j + 89480 What is the r'th term of 2735548, 2735525, 2735502, 2735479? -23r + 2735571 What is the p'th term of 80442, 161188, 241932, 322674? -p2 + 80749p - 306 What is the y'th term of -7916, -7715, -7300, -6605, -5564? 11y3 + 41y*2 + y - 7969 What is the s'th term of -96984374, -96984365, -96984356, -96984347, -96984338, -96984329? 9s - 96984383 What is the z'th term of 26234, 105282, 237032, 421484? 26351z2 - 5z - 112 What is the b'th term of -582253, -2329004, -5240253, -9316000? -582249b2 - 4b What is the k'th term of -75642, -74375, -73108, -71841, -70574, -69307? 1267k - 76909 What is the m'th term of -9942802, -19885603, -29828404, -39771205, -49714006, -59656807? -9942801m - 1 What is the z'th term of 69214, 136261, 203296, 270313, 337306? -z*3 + 67054z + 2161 What is the s'th term of -1266, -1724, -2436, -3402? -127s2 - 77s - 1062 What is the u'th term of -100304, -200532, -300688, -400778, -500808, -600784, -700712, -800598? -u*3 + 42u*2 - 100347u + 2 What is the g'th term of -1208317, -1208175, -1208031, -1207885, -1207737, -1207587? g*2 + 139g - 1208457 What is the v'th term of -10340, -21086, -31832, -42578? -10746v + 406 What is the x'th term of 163, 692, 1597, 2866, 4487, 6448? -2x*3 + 200x*2 - 57x + 22 What is the b'th term of 61919, 123821, 185655, 247421, 309119, 370749, 432311? -34b2 + 62004b - 51 What is the a'th term of 18856, 18083, 17310, 16537, 15764, 14991? -773a + 19629 What is the s'th term of 905007, 1810037, 2715067, 3620097? 905030s - 23 What is the x'th term of -9081973, -9081970, -9081965, -9081958, -9081949? x*2 - 9081974 What is the u'th term of -3376144, -6752293, -10128448, -13504609, -16880776, -20256949, -23633128? -3u*2 - 3376140u - 1 What is the p'th term of -90, 452, 2808, 8166, 17714, 32640? 198p3 - 281p*2 - p - 6 What is the j'th term of -3931, -8540, -13149, -17758, -22367? -4609j + 678 What is the u'th term of 57638326, 57638352, 57638392, 57638452, 57638538? u3 + u2 + 16u + 57638308 What is the i'th term of 6264081, 12528166, 18792253, 25056342, 31320433, 37584526, 43848621? i2 + 6264082i - 2 What is the q'th term of 42527, 42516, 42507, 42500? q*2 - 14q + 42540 What is the h'th term of 352, 1359, 3062, 5479, 8628, 12527, 17194? 3h3 + 330h*2 - 4h + 23 What is the w'th term of 99917, 104384, 108851, 113318? 4467w + 95450 What is the d'th term of 12697948, 25395924, 38093900, 50791876? 12697976d - 28 What is the m'th term of 19331774, 19331786, 19331786, 19331768, 19331726, 19331654? -m*3 + 19m + 19331756 What is the o'th term of 1045614, 1045465, 1045316, 1045167, 1045018? -149o + 1045763 What is the r'th term of 780, 3657, 8332, 14805, 23076, 33145? 899r*2 + 180r - 299 What is the u'th term of -24889, -49675, -74461, -99247? -24786u - 103 What is the g'th term of 56, 298, 480, 620, 736, 846, 968? 3g*3 - 48g*2 + 365g - 264 What is the b'th term of -57461853, -114923721, -172385589, -229847457? -57461868b + 15 What is the f'th term of 425700, 1702884, 3831530, 6811644, 10643232? f3 + 425725f*2 + 2f - 28 What is the u'th term of 611712, 612435, 613158? 723u + 610989 What is the t'th term of 3895, 8167, 12435, 16699? -2t*2 + 4278t - 381 What is the x'th term of 133, 154, 177, 208, 253? x*3 - 5x*2 + 29x + 108 What is the t'th term of 191370, 374629, 557888, 741147? 183259t + 8111 What is the d'th term of 1860, 7617, 17372, 31227, 49284, 71645, 98412, 129687? 17d*3 + 1897d*2 - 53d - 1 What is the z'th term of 1896, 2614, 3794, 5436? 231z2 + 25z + 1640 What is the m'th term of 9443, 19858, 30267, 40664, 51043, 61398, 71723, 82012? -m*3 + 3m*2 + 10413m - 972 What is the b'th term of 576068, 1152115, 1728162, 2304209, 2880256? 576047b + 21 What is the h'th term of 1252658, 1252347, 1252034, 1251719, 1251402, 1251083? -h2 - 308h + 1252967 What is the a'th term of 8620186, 17240406, 25860628, 34480852, 43101078? a*2 + 8620217a - 32 What is the j'th term of 124167184, 248334359, 372501536, 496668715, 620835896, 745003079, 869170264? j*2 + 124167172j + 11 What is the b'th term of 682, 1059, 2074, 4045, 7290, 12127? 53b3 + b2 + 3b + 625 What is the o'th term of 58974, 58951, 58926, 58905, 58894, 58899, 58926? o*3 - 7o*2 - 9o + 58989 What is the x'th term of -964210, -1929943, -2895676, -3861409, -4827142? -965733x + 1523 What is the n'th term of -37165576, -37165571, -37165566, -37165561, -37165556, -37165551? 5n - 37165581 What is the p'th term of -8262, -32978, -74172, -131844? -8239p2 + p - 24 What is the h'th term of -7398, -7671, -7950, -8235, -8526, -8823? -3h*2 - 264h - 7131 What is the t'th term of 9486339, 9486331, 9486309, 9486267, 9486199, 9486099, 9485961, 9485779? -t3 - t2 + 2t + 9486339 What is the c'th term of -1082232, -2164477, -3246722, -4328967, -5411212? -1082245c + 13 What is the x'th term of -126463, -132006, -137549, -143092, -148635? -5543x - 120920 What is the i'th term of 17246, 69318, 156108, 277622, 433866? i3 + 17353i*2 + 6i - 114 What is the h'th term of 10310, 20626, 30944	{ "pile_set_name": "DM Mathematics" }
ate the greatest common divisor of 15 and 60720. 15 What is the highest common factor of 8 and 6444808? 8 Calculate the highest common divisor of 7089824 and 64. 32 Calculate the highest common divisor of 4224 and 3003. 33 Calculate the highest common factor of 2562 and 10458. 42 Calculate the greatest common factor of 1838384 and 4272. 1424 What is the highest common divisor of 936 and 1898? 26 What is the greatest common factor of 2830 and 40? 10 What is the greatest common factor of 5184 and 8937? 27 Calculate the greatest common divisor of 131235 and 1560. 195 Calculate the greatest common divisor of 8512 and 20368. 304 Calculate the greatest common divisor of 16036 and 114. 38 What is the highest common divisor of 165 and 329538? 33 What is the highest common factor of 125870 and 164? 82 Calculate the greatest common divisor of 20 and 4735. 5 What is the greatest common factor of 105 and 6585? 15 What is the highest common factor of 6294 and 60? 6 What is the highest common factor of 80 and 98380? 20 Calculate the greatest common divisor of 1146353 and 327. 109 What is the highest common divisor of 34 and 149039? 17 What is the highest common factor of 1340088 and 204? 12 Calculate the highest common factor of 3895837 and 121. 121 What is the greatest common factor of 990 and 11190? 30 What is the highest common factor of 309033 and 36? 9 Calculate the greatest common divisor of 9344 and 5548. 292 What is the highest common divisor of 117 and 93990? 39 Calculate the greatest common divisor of 2421 and 1251. 9 Calculate the highest common factor of 21206 and 463766. 922 Calculate the greatest common factor of 146415 and 7491. 681 Calculate the highest common factor of 417534 and 4242. 606 What is the highest common divisor of 14336 and 91? 7 What is the greatest common divisor of 23675 and 1000? 25 Calculate the highest common factor of 650095 and 230. 115 Calculate the greatest common divisor of 129137 and 183. 61 Calculate the greatest common divisor of 420 and 426405. 105 Calculate the highest common divisor of 5752 and 32355. 719 Calculate the greatest common divisor of 3873 and 159. 3 Calculate the highest common divisor of 5 and 25658. 1 Calculate the highest common divisor of 143 and 6318. 13 Calculate the highest common divisor of 9675 and 15867. 387 What is the highest common factor of 14790 and 120? 30 Calculate the greatest common divisor of 2983 and 1727. 157 Calculate the highest common divisor of 16 and 45326. 2 Calculate the highest common factor of 1080 and 7270. 10 Calculate the greatest common factor of 3392 and 3008. 64 What is the greatest common factor of 17 and 175729? 17 What is the greatest common divisor of 109926 and 5022? 558 Calculate the highest common factor of 526440 and 560. 40 Calculate the greatest common factor of 210 and 23910. 30 Calculate the highest common factor of 165 and 2513720. 55 Calculate the highest common divisor of 50 and 179650. 50 What is the greatest common divisor of 828 and 136332? 36 What is the highest common factor of 26582 and 74? 2 What is the highest common divisor of 1427797 and 7? 7 Calculate the highest common divisor of 2996 and 2716. 28 What is the greatest common factor of 36 and 4596? 12 What is the highest common divisor of 6717200 and 1120? 560 Calculate the greatest common divisor of 13659 and 17603. 29 What is the greatest common factor of 1435 and 70725? 205 What is the greatest common factor of 4640 and 7840? 160 Calculate the greatest common factor of 102 and 4362. 6 What is the greatest common divisor of 5825 and 665? 5 Calculate the highest common divisor of 199944 and 1560. 24 What is the highest common divisor of 414384 and 80? 16 Calculate the greatest common divisor of 5152 and 37835. 161 Calculate the highest common factor of 2546 and 18. 2 Calculate the highest common factor of 9375 and 930. 15 What is the greatest common factor of 527660 and 224? 28 Calculate the greatest common factor of 8178 and 131741. 47 What is the greatest common factor of 13528 and 589? 19 Calculate the greatest common factor of 475434 and 72. 18 What is the highest common factor of 72 and 161832? 24 What is the highest common divisor of 51480 and 280? 40 Calculate the greatest common divisor of 2694 and 294095. 449 Calculate the greatest common factor of 15736 and 140. 28 What is the highest common divisor of 5789 and 49? 7 What is the highest common factor of 165 and 5500? 55 Calculate the highest common factor of 3625 and 530555. 145 What is the greatest common factor of 228036 and 372? 372 What is the highest common divisor of 284597 and 17? 17 Calculate the greatest common factor of 324 and 50844. 12 Calculate the highest common factor of 279771 and 6. 3 What is the highest common factor of 5090 and 50? 10 What is the greatest common factor of 468 and 1065636? 468 Calculate the greatest common factor of 2900 and 5539. 29 Calculate the highest common divisor of 18979 and 1. 1 What is the greatest common divisor of 444705 and 2578? 1289 Calculate the highest common divisor of 5583055 and 19. 19 Calculate the greatest common factor of 6 and 108126. 6 What is the greatest common divisor of 67041 and 9477? 351 What is the greatest common divisor of 638106 and 42? 42 Calculate the greatest common factor of 38800 and 1200. 400 What is the greatest common factor of 304 and 16492? 76 Calculate the greatest common divisor of 237424 and 144. 16 Calculate the highest common divisor of 3060 and 414360. 180 Calculate the highest common factor of 42792 and 600. 24 Calculate the highest common divisor of 635025 and 75. 75 Calculate the greatest common divisor of 46588 and 19. 19 Calculate the greatest common divisor of 996 and 9545. 83 What is the greatest common factor of 21287 and 56? 7 Calculate the highest common factor of 10 and 514610. 10 Calculate the highest common divisor of 4692 and 2754. 102 Calculate the greatest common divisor of 76 and 21147. 19 What is the greatest common factor of 1103943 and 145? 29 What is the highest common factor of 14750 and 350? 50 Calculate the highest common factor of 42824 and 7950. 106 Calculate the highest common divisor of 1355 and 15989. 271 What is the highest common factor of 128 and 2752? 64 What is the highest common factor of 3132 and 13032? 36 What is the highest common divisor of 2020 and 77568? 404 Calculate the highest common factor of 632 and 117868. 316 Calculate the highest common divisor of 96 and 130512. 48 What is the highest common divisor of 8925 and 17? 17 Calculate the greatest common divisor of 1514043 and 9. 9 What is the greatest common divisor of 928 and 69194? 58 What is the greatest common divisor of 50840 and 615? 205 What is the greatest common divisor of 1417 and 53192? 109 What is the highest common factor of 208077 and 258? 129 Calculate the greatest common divisor of 216315 and 69255. 855 What is the highest common factor of 8055 and 153? 9 Calculate the highest common factor of 35 and 107422. 7 Calculate the highest common divisor of 38829 and 42. 21 What is the highest common factor of 6648 and 1104? 24 Calculate the greatest common factor of 2921520 and 48. 48 What is the greatest common divisor of 96 and 6847392? 96 What is the highest common factor of 4232 and 712? 8 What is the highest common factor of 4916 and 8? 4 What is the greatest common factor of 83693 and 3175? 127 Calculate the highest common factor of 1878136 and 104. 104 What is the greatest common factor of 1513172 and 310? 62 What is the greatest common factor of 302 and 11170? 2 Calculate the highest common divisor of 11101 and 51. 17 What is the greatest common factor of 6 and 102570? 6 What is the highest common factor of 1580 and 126716? 316 Calculate the greatest common divisor of 10230 and 961. 31 Calculate the highest common divisor of 36015 and 107310. 735 What is the greatest common factor of 15 and 16593? 3 Calculate the highest common factor of 23520 and 180. 60 Calculate the greatest common factor of 36 and 3628. 4 What is the greatest common divisor of 87 and 907584? 87 Calculate the greatest common divisor of 7908 and 16. 4 What is the highest common divisor of 188 and 1316? 188 Calculate the greatest common divisor of 193645 and 15	{ "pile_set_name": "DM Mathematics" }
there between 4:14 AM and 1:34 PM? 560 What is 445 minutes before 5:51 AM? 10:26 PM How many minutes are there between 6:19 AM and 1:45 PM? 446 How many minutes are there between 10:43 PM and 1:58 AM? 195 How many minutes are there between 1:58 AM and 7:20 AM? 322 What is 264 minutes before 12:29 PM? 8:05 AM What is 359 minutes after 12:28 PM? 6:27 PM What is 631 minutes before 4:06 AM? 5:35 PM What is 491 minutes after 11:36 PM? 7:47 AM How many minutes are there between 3:04 PM and 7:04 PM? 240 How many minutes are there between 7:19 PM and 7:05 AM? 706 How many minutes are there between 6:50 PM and 5:36 AM? 646 What is 680 minutes after 7:38 PM? 6:58 AM What is 132 minutes before 3:05 AM? 12:53 AM What is 25 minutes after 2:47 PM? 3:12 PM How many minutes are there between 9:51 AM and 8:56 PM? 665 How many minutes are there between 2:03 PM and 5:18 PM? 195 What is 402 minutes after 5:00 PM? 11:42 PM What is 279 minutes after 9:12 PM? 1:51 AM How many minutes are there between 12:10 PM and 6:24 PM? 374 What is 25 minutes after 9:25 AM? 9:50 AM How many minutes are there between 4:59 PM and 2:37 AM? 578 How many minutes are there between 12:40 AM and 9:02 AM? 502 What is 6 minutes after 1:18 PM? 1:24 PM What is 402 minutes before 8:51 PM? 2:09 PM What is 115 minutes after 12:53 AM? 2:48 AM What is 388 minutes before 6:55 PM? 12:27 PM What is 463 minutes after 4:24 AM? 12:07 PM What is 107 minutes before 8:42 AM? 6:55 AM How many minutes are there between 3:13 PM and 5:10 PM? 117 What is 667 minutes before 7:41 AM? 8:34 PM What is 586 minutes after 6:33 AM? 4:19 PM What is 2 minutes before 1:55 PM? 1:53 PM What is 237 minutes before 3:03 PM? 11:06 AM How many minutes are there between 11:47 PM and 3:10 AM? 203 What is 400 minutes before 11:39 AM? 4:59 AM What is 386 minutes after 11:18 PM? 5:44 AM How many minutes are there between 12:07 PM and 5:11 PM? 304 What is 676 minutes before 5:16 PM? 6:00 AM How many minutes are there between 7:27 AM and 3:37 PM? 490 What is 235 minutes before 8:09 AM? 4:14 AM What is 448 minutes before 2:30 PM? 7:02 AM What is 376 minutes after 5:23 PM? 11:39 PM What is 424 minutes after 9:54 AM? 4:58 PM What is 670 minutes after 5:24 PM? 4:34 AM What is 525 minutes before 9:25 AM? 12:40 AM How many minutes are there between 1:00 PM and 11:47 PM? 647 How many minutes are there between 1:43 PM and 7:06 PM? 323 What is 104 minutes after 3:29 PM? 5:13 PM What is 568 minutes after 4:04 PM? 1:32 AM How many minutes are there between 7:58 AM and 2:46 PM? 408 What is 446 minutes after 10:08 PM? 5:34 AM How many minutes are there between 10:27 AM and 3:27 PM? 300 What is 504 minutes before 8:51 PM? 12:27 PM How many minutes are there between 7:51 AM and 3:44 PM? 473 How many minutes are there between 10:47 AM and 8:31 PM? 584 What is 664 minutes before 5:08 PM? 6:04 AM How many minutes are there between 3:42 AM and 2:23 PM? 641 How many minutes are there between 6:08 PM and 2:32 AM? 504 What is 655 minutes before 8:06 PM? 9:11 AM How many minutes are there between 6:34 PM and 8:59 PM? 145 What is 20 minutes before 3:30 AM? 3:10 AM What is 473 minutes before 12:00 AM? 4:07 PM What is 237 minutes before 2:57 AM? 11:00 PM How many minutes are there between 11:45 AM and 4:41 PM? 296 How many minutes are there between 11:02 AM and 9:32 PM? 630 What is 128 minutes after 6:34 PM? 8:42 PM What is 502 minutes after 2:05 AM? 10:27 AM How many minutes are there between 3:47 AM and 8:39 AM? 292 How many minutes are there between 6:52 AM and 7:55 AM? 63 What is 315 minutes before 1:15 AM? 8:00 PM How many minutes are there between 9:32 AM and 10:21 AM? 49 What is 496 minutes after 11:08 AM? 7:24 PM What is 424 minutes after 11:47 AM? 6:51 PM How many minutes are there between 8:31 PM and 10:37 PM? 126 How many minutes are there between 8:34 AM and 10:50 AM? 136 How many minutes are there between 2:15 AM and 5:08 AM? 173 How many minutes are there between 5:39 AM and 3:44 PM? 605 What is 468 minutes before 8:22 AM? 12:34 AM What is 238 minutes after 8:21 AM? 12:19 PM What is 153 minutes after 9:45 PM? 12:18 AM How many minutes are there between 12:57 AM and 11:15 AM? 618 What is 627 minutes before 7:39 AM? 9:12 PM How many minutes are there between 9:22 AM and 3:34 PM? 372 What is 418 minutes before 3:22 PM? 8:24 AM What is 325 minutes before 1:06 PM? 7:41 AM How many minutes are there between 5:06 PM and 5:57 PM? 51 What is 170 minutes after 11:36 AM? 2:26 PM What is 62 minutes after 7:44 AM? 8:46 AM How many minutes are there between 7:20 AM and 4:39 PM? 559 How many minutes are there between 5:13 AM and 1:14 PM? 481 How many minutes are there between 1:29 PM and 7:28 PM? 359 How many minutes are there between 12:50 AM and 5:15 AM? 265 How many minutes are there between 6:24 PM and 11:16 PM? 292 How many minutes are there between 7:23 AM and 6:42 PM? 679 How many minutes are there between 10:13 AM and 9:55 PM? 702 How many minutes are there between 1:33 AM and 9:20 AM? 467 What is 197 minutes after 11:03 PM? 2:20 AM How many minutes are there between 11:07 PM and 7:34 AM? 507 How many minutes are there between 2:02 AM and 2:14 AM? 12 What is 685 minutes after 1:08 AM? 12:33 PM How many minutes are there between 5:37 PM and 10:32 PM? 295 What is 398 minutes after 3:15 AM? 9:53 AM What is 488 minutes before 2:32 AM? 6:24 PM What is 576 minutes after 10:33 PM? 8:09 AM What is 578 minutes before 10:57 AM? 1:19 AM How many minutes are there between 3:06 AM and 2:49 PM? 703 What is 663 minutes after 1:52 PM? 12:55 AM How many minutes are there between 7:59 AM and 11:36 AM? 217 How many minutes are there between 8:12 PM and 12:08 AM? 236 How many minutes are there between 4:49 PM and 3:33 AM? 644 How many minutes are there between 8:20 AM and 4:48 PM? 508 How many minutes are there between 3:52 PM and 10:06 PM? 374 How many minutes are there between 9:54 PM and 6:52 AM? 538 What is 19 minutes before 8:16 PM? 7:57 PM How many minutes are there between 11:31 PM and 4:31 AM? 300 How many minutes are there between 6:59 AM and 8:10 AM? 71 What is 69 minutes after 6:03 PM? 7:12 PM How many minutes are there between 3:29 AM and 2:50 PM? 681 What is 681 minutes before 4:31 AM? 5:10 PM What is 492 minutes after 11:06 PM? 7:18 AM What is 400 minutes before 11:26 AM? 4:46 AM What is 624 minutes before 5:24 PM? 7:00 AM How many minutes are there between 8:15 AM and 10:15 AM? 120 What is 173 minutes after 11:21 PM? 2:14 AM What is 176 minutes after 8:06 PM? 11:02 PM What is 402 minutes before 12:00 AM? 5:18 PM What is 184 minutes before 5:45 PM? 2:41 PM How many minutes are there between 10:53 AM and 11:37 AM? 44 What is 624 minutes after 7:36 PM? 6:00 AM How many minutes are there between 11:36 AM and 2:10 PM? 154 What is 586 minutes before 10:25 PM? 12:39 PM What is 543 minutes after 10:58 PM? 8:01 AM How many minutes are there between 6:21 AM and 12:37 PM? 376 What is 588 minutes after 11:43 PM? 9:31 AM What is 132 minutes before 3:22 PM? 1:10 PM What is 254 minutes after 12:45 AM? 4:59 AM How many minutes are there between 4:44 PM and 4:24 AM? 700 How many minutes are there between 6:01 PM and 10:21 PM? 260 What is 618 minutes before 11:36 PM? 1:18 PM What is 524 minutes before 6:43 PM? 9:59 AM How many minutes are there between 10:10 AM and 10:05 PM? 715 What is 14 minutes before 8:14 AM? 8:00 AM What is 371 minutes after 11:17 AM? 5:28 PM How many minutes are there between 12:16 AM and 5:12 AM? 296 What is 332 minutes after 1:40 PM? 7:12 PM What is 90 minutes after 4:30 AM? 6:00 AM How many minutes are there between 11:38 AM and 8:12 PM? 514 How many minutes are there between 12:13 PM and 1:06 PM? 53 How many minutes are there between 1:36 PM and 10:42 PM? 546 How many minutes are there between 8:42 PM and 2:55 AM? 373 How many minutes are there between 3:24 AM and 6:39 AM? 195 What is 321 minutes before 8:33 PM? 3:12 PM How many minutes are there between 12:35 AM and 6:28 AM? 353 What is 410 minutes before 9:09 AM? 2:19 AM How many minutes are there between 7:44 PM and 3:32 AM? 468 What is 401 minutes after 3:42 PM? 10:23 PM How many minutes are there between 10:40 PM and 1:09 AM? 149 What is 354 minutes before 7:47 PM? 1:53 PM What is 520 minu	{ "pile_set_name": "DM Mathematics" }
o letters picked without replacement from {g: 3, q: 8}? 24/55 Three letters picked without replacement from bbbnbnbbbnbbbn. What is prob of picking 3 n? 1/91 Two letters picked without replacement from vwauauuu. Give prob of picking 1 u and 1 v. 1/7 Calculate prob of picking 1 t and 1 f when two letters picked without replacement from {t: 5, n: 1, f: 2, y: 1, s: 6}. 2/21 Four letters picked without replacement from ooseeeeowo. Give prob of picking 2 e, 1 w, and 1 o. 4/35 Two letters picked without replacement from {w: 1, h: 1, v: 4, b: 2}. What is prob of picking 1 b and 1 h? 1/14 Two letters picked without replacement from {r: 1, u: 1, e: 1}. Give prob of picking 1 u and 1 r. 1/3 Calculate prob of picking 2 p when two letters picked without replacement from xpxpqpp. 2/7 Calculate prob of picking 3 b when three letters picked without replacement from {o: 4, m: 5, b: 7}. 1/16 Two letters picked without replacement from {k: 2, b: 1, n: 7, u: 2}. What is prob of picking 1 n and 1 b? 7/66 What is prob of picking 1 r and 2 c when three letters picked without replacement from rrjjccjjc? 1/14 Two letters picked without replacement from {j: 3, r: 2}. What is prob of picking 2 r? 1/10 What is prob of picking 1 v and 1 z when two letters picked without replacement from {q: 2, l: 1, v: 2, z: 4, u: 6}? 8/105 Two letters picked without replacement from ecmjble. Give prob of picking 1 j and 1 m. 1/21 Four letters picked without replacement from qqqq. What is prob of picking 4 q? 1 Calculate prob of picking 2 q, 1 s, and 1 h when four letters picked without replacement from ddddhdddqddfdsdf. 0 Two letters picked without replacement from {x: 1, d: 7, e: 4, p: 1, m: 3}. Give prob of picking 2 d. 7/40 Four letters picked without replacement from {q: 2, b: 2, v: 1, y: 1, c: 1}. Give prob of picking 1 c, 1 y, and 2 q. 1/35 What is prob of picking 1 w and 1 q when two letters picked without replacement from {z: 3, q: 1, w: 1}? 1/10 Two letters picked without replacement from {j: 15, g: 3, p: 2}. Give prob of picking 1 p and 1 g. 3/95 Four letters picked without replacement from {r: 1, z: 12}. Give prob of picking 1 r and 3 z. 4/13 Calculate prob of picking 1 l and 1 d when two letters picked without replacement from sldsfmmmssvds. 1/39 Calculate prob of picking 1 l and 1 p when two letters picked without replacement from amemmlmmmlmmmpppe. 3/68 Four letters picked without replacement from tbjtbbtzztftbtbztbt. Give prob of picking 1 z and 3 t. 14/323 Calculate prob of picking 1 g, 1 b, and 1 o when three letters picked without replacement from svyvvygvyobv. 1/220 Calculate prob of picking 2 n and 1 s when three letters picked without replacement from {q: 7, s: 4, n: 5, r: 2, d: 2}. 2/57 What is prob of picking 1 k, 1 y, and 1 l when three letters picked without replacement from kttlymxtxxttmlm? 2/455 Calculate prob of picking 2 n and 2 r when four letters picked without replacement from {n: 2, r: 7, a: 9}. 7/1020 Three letters picked without replacement from {i: 1, a: 5, c: 1, h: 1, s: 2}. Give prob of picking 1 a and 2 s. 1/24 Four letters picked without replacement from eekekkkeesffs. Give prob of picking 1 s and 3 k. 8/715 What is prob of picking 1 i and 1 d when two letters picked without replacement from dddiiidd? 15/28 Two letters picked without replacement from {o: 1, d: 1, e: 1, m: 2}. Give prob of picking 1 e and 1 o. 1/10 What is prob of picking 1 v and 1 k when two letters picked without replacement from {v: 2, h: 1, p: 1, k: 4, b: 3}? 8/55 What is prob of picking 1 p and 1 a when two letters picked without replacement from wphajhjwehjaa? 1/26 Calculate prob of picking 4 t when four letters picked without replacement from ttttettte. 5/18 Two letters picked without replacement from fqckcpcfscssccccckc. Give prob of picking 1 q and 1 f. 2/171 Four letters picked without replacement from zwzwwwwwwwwzzwwwwww. Give prob of picking 4 w. 455/1292 Three letters picked without replacement from {b: 19, n: 1}. What is prob of picking 1 b and 2 n? 0 Calculate prob of picking 1 j, 1 f, and 1 e when three letters picked without replacement from {f: 1, o: 2, j: 1, e: 1, s: 2, w: 2}. 1/84 What is prob of picking 1 j and 1 t when two letters picked without replacement from {c: 5, t: 2, j: 3}? 2/15 Calculate prob of picking 1 s and 2 x when three letters picked without replacement from sswwxxsxsxx. 8/33 What is prob of picking 1 q and 1 z when two letters picked without replacement from zhejq? 1/10 What is prob of picking 1 h, 2 a, and 1 p when four letters picked without replacement from ppppphhpappppappphpp? 3/323 What is prob of picking 1 s and 1 r when two letters picked without replacement from rrsrrrrrrrrrrrrrrrr? 2/19 Four letters picked without replacement from qcdqdjjcdjjddjqjc. Give prob of picking 1 d and 3 q. 1/476 What is prob of picking 2 e and 1 j when three letters picked without replacement from eejjjeeeexjexxeeee? 55/204 Four letters picked without replacement from znnznznnnn. Give prob of picking 2 n and 2 z. 3/10 Three letters picked without replacement from {v: 1, a: 2, d: 3, p: 9, i: 3}. What is prob of picking 1 d, 1 a, and 1 i? 3/136 Two letters picked without replacement from {e: 4, q: 1, d: 2, m: 3, c: 4}. What is prob of picking 2 c? 6/91 Two letters picked without replacement from {n: 1, w: 2, g: 1}. Give prob of picking 2 w. 1/6 Calculate prob of picking 3 o and 1 z when four letters picked without replacement from {o: 4, z: 2, y: 5}. 4/165 Two letters picked without replacement from {w: 4, d: 6, b: 1}. Give prob of picking 2 d. 3/11 Calculate prob of picking 3 z when three letters picked without replacement from {x: 2, z: 4}. 1/5 Calculate prob of picking 2 u when two letters picked without replacement from ulycuclfujcyl. 1/26 What is prob of picking 2 s when two letters picked without replacement from ssssaass? 15/28 What is prob of picking 2 l and 2 w when four letters picked without replacement from lkrwwyywwyklly? 18/1001 Four letters picked without replacement from nqniiudqqqqqqqqqds. Give prob of picking 1 s, 1 u, and 2 i. 1/3060 Two letters picked without replacement from vvomaqaqvvvvaav. Give prob of picking 1 a and 1 v. 4/15 What is prob of picking 2 s when two letters picked without replacement from vvsvvvvsvvvv? 1/66 What is prob of picking 2 x and 1 p when three letters picked without replacement from pxpxpxypdfp? 1/11 What is prob of picking 3 m when three letters picked without replacement from {i: 1, u: 3, s: 5, m: 6, x: 2}? 1/34 What is prob of picking 1 m and 1 p when two letters picked without replacement from aamzapzazzzpalz? 2/105 Two letters picked without replacement from myoooyomoooomyyooom. What is prob of picking 1 y and 1 o? 44/171 Three letters picked without replacement from {t: 4, r: 5, h: 6, w: 5}. What is prob of picking 2 w and 1 t? 2/57 Four letters picked without replacement from czoczck. Give prob of picking 2 z, 1 k, and 1 o. 1/35 Two letters picked without replacement from {d: 5, m: 3}. Give prob of picking 2 d. 5/14 What is prob of picking 2 s and 1 p when three letters picked without replacement from {w: 4, s: 3, b: 2, p: 1, h: 4, t: 6}? 1/380 Four letters picked without replacement from aaaaaaaaaa. Give prob of picking 4 a. 1 What is prob of picking 1 b and 1 j when two letters picked without replacement from yyoyoyyyobyyjoybbj? 2/51 What is prob of picking 1 q and 1 c when two letters picked without replacement from {q: 2, n: 1, g: 1, s: 1, v: 1, c: 2}? 1/7 What is prob of picking 1 k and 1 t when two letters picked without replacement from {u: 1, t: 1, z: 1, k: 1, i: 3}? 1/21 Three letters picked without replacement from xmrrbmrrrmxmxbm. What is prob of picking 1 x and 2 m? 6/91 What is prob of picking 1 f and 1 r when two letters picked without replacement from {k: 2, r: 1, g: 2, b: 6, f: 3, o: 4}? 1/51 Calculate prob of picking 2 k, 1 t, and 1 w when four letters picked without replacement from wgkwkkgwtkt. 6/55 Calculate prob of picking 1 v and 1 x when two letters picked without replacement from {x: 1, v: 2, z: 1, n: 1, y: 2}. 2/21 Calculate prob of picking 1 i and 3 j when four letters picked without replacement from {b: 4, j: 6, l: 6, i: 2}. 2/153 What is prob of picking 1 i and 2 p when th	{ "pile_set_name": "DM Mathematics" }
- 4 + 4)(3 - 3 - r2 + (0 - 2 + 4)(2r2 + 2r*2 - 2r*2) - 2r2 + r2 - 3r2). -3r*3 Expand -3 + 3 + u + (0u + 3u - u)(3 - 5 + 0) - 12 - 5 + 33u + 18. 30u + 1 Expand -45044q3 + 10q*4 + 45044q*3 + 3q2 + 25 + (-q2 + 0q2 + 0q*2)(-2q2 + 0q*2 + 3q*2). 9q*4 + 3q*2 + 25 Expand (-2 + 0 + 0)(-2 + 11w + 1 + 8w) + (3w - 2w - 4w)(3 + 1 - 5). -35w + 2 Expand v + 1 - 1 + (-4 + 3 - 2)(-4v + 4v + 8v). -23v Expand (-4j - 2j + 5j)(21j2 - 8j*2 - 14j2 - 41). j3 + 41j Expand (-776i - 48 + 101 - 51)(2 - 2 + 2i)(0 - 1 + 2)(4 - 5 + 0). 1552i2 - 4i Expand (0 + 3 + 3)(-x5 - x5 + 4x5) + (x5 + 3x5 - 7x*5)(-4 + 0 + 2). 18x5 Expand (-y + 1 + 4 - 3)(-10y - 33y - 12y). 55y*2 - 110y Expand (-215i + 10 + 211i + 2)(0 + 0 - 3i*2). 12i*3 - 36i*2 Expand z + z + 0z + (3 + 1 - 3)(-51z - 16z + 0z + (z - 1 + 1)(-2 - 1 + 4)). -64z Expand (-2l - 2l*3 + 2l)(142l*2 - 262l*2 + 163l*2). -86l*5 Expand (2 - 2 + i + (0 + 0 + 2)(-2i + 6i - 2i) + 38 - 10i - 38)(0i*3 + 0i*3 + 2i*3). -10i*4 Expand -3j*5 + 7j*5 - 3j*5 + (2j4 + j4 - j*4)(3j - 4j - 2j) - 4j + 4j - 5j*5. -10j*5 Expand (-2y*2 - 3y*2 + 4y*2)(-1276y + 92y + 987y + 4078y). -3881y3 Expand 282c*4 - 27352c + 27352c + (-c3 + 0 + 0)(-2c + 0c + 0c) - 2 + c4 + 2 + (c3 + c3 - 4c*3)(2 - c - 2) + 4c4 - 3c*4 + 0c*4. 288c*4 Expand (-5 + 5 - 1 - 1 - 4 + 3 + (-4 + 5 - 2)(4 - 3 + 1) - 5 + 2 + 2)(6 - 6 + 4i) + 0i + i - 3i. -26i Expand 2p - 1 + 1 + 133p - 129p + 149p + (4 - 4 - 3)(-p - 5p + 4p). 161p Expand (-36132 + 1211u*5 + 36132)(3 - 3 - 2)(3 + 0 - 5). 4844u*5 Expand (6 + 6 + 29)(2c + 19c + 18c). 1599c Expand (3f - 5f + 4f)(2 + 2 - 2)(108 + 18 + 70). 784f Expand (-2 + 1 - 1)((-3y + 7y - 2y)(-3y*2 - y + y) - 2y3 + y3 + 2y3 + 37y*3 - 2y*3 + 33y*3). -126y*3 Expand -2l*5 + 3l*2 - 3l*2 + (-19 + 24l + 19)(-5l*2 + 13l*2 - 3l2 + l4). 22l5 + 120l*3 Expand (3u + 0u + 0u)(-4u + 3u + 2u)(-3u - 2u3 + 3u + (4u + 0u - 2u)(-4u2 - u2 + 2u*2)). -24u*5 Expand (3 - 7 + 0)(r - 2r - r)(-9 + 7 + 4)(2 - 3 + 0). -16r Expand (0o + 0o + 2o + (3 - 3 + 1)(6o - 3o - o) - 30o + 540 - 540)(3o - 3o - o*4). 26o*5 Expand (562 - 10r*2 - 323 - 281)(4r2 - 4r*2 - 2r*2). 20r*4 + 84r*2 Expand (2i + 2 - 2)(0 - 2 + 3) + 2i + 0i + 0i + 2i - i + 0i - i + i + 2i + (-10 + 10 - 20i)(-3 + 7 - 2). -33i Expand (24v2 + 515v - 515v)(-9v + 4v + 19v2 - 22v*2). -72v*4 - 120v3 Expand (p2 + 0p2 + 0p*2)(2 - 2 - p*2) - 2p*4 + 3p*3 - 3p*3 - 3p - 2p4 + 3p + 8p4 - 8p*3 + 11p3 - p3. 3p4 + 2p*3 Expand (-325x + 184x + 179x)(2x - 3x + 0x) + x - x - 2 - 2x - 2x*2. -40x*2 - 2x - 2 Expand 2c4 - 3c*4 + 0c*4 + (8c + 14c - 38c)(1 - 2c*3 - 1). 31c*4 Expand (-2 + 0 + 0)(o - 3 - o - o)(-3 + o2 + 3)(33o2 - 73o*2 - 113o*2). -306o*5 - 918o*4 Expand (19g + 868 - 868)(29g + 2 - 29g + 44g*3). 836g*4 + 38g Expand (o2 - o2 - 3o4)(3o - 2o + 0o) + 117o - 117o + 32o*5. 29o*5 Expand (0 - 3 + 4)(5 + s - 5 + 2s + 0s - s + 3s - s - 3s + 2s - s + 0s + (0 - 1 - 1)(-4s + 3s + 0s) + 0s + 3s - 5s + 16s + 5s + s). 24s Expand 3t5 + t - t + (t3 + t4 - t3)(t - 2t - t) + 0t*5 + 14t*5 + 3t5 + (t3 + 0t3 + 2t*3)(3 - 3 + t*2). 21t*5 Expand -k + 0k + 3k + (0k - k + 2k)(3 - 4 + 0) - k + k + 2k. 3k Expand -u*3 + 6u*3 - 2u*3 + 2611 + 42u*3 - 2611 + (-u + 4u - u)(-4u - u*2 + 4u). 43u3 Expand (-2v - v + 7v)(4v - v - 2v) - v + v - v*2 + (-v - v + 3v)(-2v + v + 2v) - 4v*2 - 4v*2 + 3v2. -v2 Expand (2c3 - 3c*3 + 2c*3)(-c*2 + 5c2 - c2) + (3c3 - 23c*3 - 42c*3)(c*2 - 2c*2 + 2c*2). -59c*5 Expand (0 + 0 - 3m)(-6 + 3 + 1) - 1 - 2 + 6m - 9m + 0m + 4m - 3m. 4m - 3 Expand 5723q - 38q2 - 5723q + (-3 + q + 3)(2q - 2q - 2q) + 0q2 + 2q2 - q2 + (5q - q - 2q)(2q - 2 + 2). -35q2 Expand (-8i - 8i + 26i)(0 + 2 - 4) + (-2 + 1 + 3)(6i + 0i - 3i). -14i Expand (4g5 - 7g*5 + 2g*5)(-4 - 2 + 5) + 2g5 - g2 + g2 + 0g*5 + 0g*5 + 2g*5 + (6g*4 - 2g*4 - 2g*4)(0g - 8g - 6g). -23g*5 Expand (11 + 11 - 9)(-4n - 2n + 3n)(-3 - 2 + 3). 78n Expand (15l*5 - 13l*5 - 24l*5)(4 - 1 - 2) + (l*2 - 2l3 - l2)(l - l2 - l). -20l*5 Expand -l - l + 5l + 37l - 15l - 57l + (-1 + l + 1)(1 + 1 - 1) - 2l - 2l + 5l. -30l Expand (-2w4 - 3w*4 + 7w*4)(-16w + 8w + 4w + 2). -8w*5 + 4w*4 Expand (-1522 + 18l + 1522)(2l*2 + 0l*2 - 10l*2). -144l*3 Expand (13 - 21x*2 + 22x*2 + 2 + 2x)(-26x*3 - 2362x + 2362x). -26x*5 - 52x*4 - 390x*3 Expand 0u*3 + 0u*3 - 2u3 + (5 + u2 + 3 - 1)(-7u - 5u - 3u). -17u3 - 105u Expand (-2 + 6 - 1)(-19 + 2 + 2)(-220k3 + 4k*4 + 220k*3). -180k*4 Expand (10o*2 - 4o + 4o)(3 + 1 - 1 + 2o). 20o*3 + 30o*2 Expand (-5 + 3 - 1)(4t4 - 4 + 4)(0 + 0 + t) + 2t5 - 9t3 - t5 - 7t5. -18t*5 - 9t*3 Expand (-2v + 3v + v)(31 + 29 - 57)(4v*3 - 5v*3 - 2v*3). -18v*4 Expand (6 - 8 + 40)(-d - d + 0d)(-d + 2d + 0d - 2). -76d2 + 152d Expand (-4y3 + y3 + 7y*3)(4 + 0 - 3) + y2 - y2 + y*3 - 24 + 2y*3 + 24. 7y*3 Expand (-16 - 2 - 5)(2 + 0 - 1)(3x + 2x - 2x)(2 + 1 - 6). 207x Expand (32a2 + 3a*2 + 28a*2)(4 - 4 + 1). 63a2 Expand ((6 - 2 - 3)(0f + 2f + f) + (f + f + 0f)(-1 + 1 + 1))(7f - 3 + 3). 35f2 Expand -3j5 - j5 + 2j5 + (0j*2 + 0j*2 - 2j*3)(18j2 + 7j*2 + 15j*2) + 3j*5 - 2j*5 - 3j*5. -84j*5 Expand (1 + 0 + 1)(17w2 + 11w*2 - 29w*2 + 12w). -2w2 + 24w Expand (-5z + 5z - 2z)(7z - 7z - 7z2)(9 + 2 + 1)(0 + 2 - 1). 168z*3 Expand (-4r + 4 - 12r - 44r)((3 - 4 + 0)(r - r - r) + 4r + 0r - 2r). -180r*2 + 12r Expand (-4 + 0 + 2)(2n + 0n + 0n + 3)(-313 + 313 + 36n). -144n2 - 216n Expand (-13 + 3f2 + 11f*2 - 16f*2)(6f3 - f3 - f3). -8f*5 - 52f*3 Expand (3h - 3h - 59h - 1)(-2 + h4 + 2). -59h5 - h4 Expand (1 + 0 - 9 + 0 - 1 - 2 + (5 - 2 - 1)(-1 + 1 + 2))(3 - 3 - 2k). 14k Expand -3 - i*4 + 3 + (-5i4 + i4 + 2i4)(3 + 2 - 3) + 0i4 + 6i*4 - 3i*4 + (i + 28i + 0i)(0i2 + 0i*2 + 2i*3). 56i*4 Expand (30q - 60q + 39q)(0 - 7 + q2 + 2). 9q*3 - 45q Expand (2f + 2f - 3f)(-3f - 8f - 3f)((-f*2 + f - f)(4f + 3f - 6f) - 2f - f*3 + 2f). 28f5 Expand (-4 + 9l + 3l - 10l)(9l + l + 22l). 64l*2 - 128l Expand (1 - 7 + 2)(-2 + 4 - 1)(t + 2t - 2t)(1 + 3 - 2). -8t Expand ((-4 + 1 + 1)(1 + 5 - 4) + 0 - 1 + 2)(2754s3 - 2709s*3 - 2s + 4s). -135s*3 - 6s Expand (-4 + 6 - 5)(-1 - 1 + 1)(-2 + 2 - 2c2) + 4c*2 - 5c*2 + 0c*2 - 11c*2 - 38c + 38c + (c + c - 4c)(0 + 2c + 0). -22c2 Expand (-2 + 2 + 2r)(-470 + 239 + 985). 1508r Expand (4s4 - 4s*4 + 4s4 + (s3 - 4s3 + s3)(-s - 4s + 3s))((3 + 4 - 5)(-4s + 3s - 2s) + 38s + 17s - 13s). 288s5 Expand (0d + 4d - 2d)(-9d*2 + 48d*4 + 9d2 + d4 - d4 + d4 - 4d4 + d4 + d4 + (d4 + 2 - 2)(2 + 0 - 3)). 92d5 Expand (0 - 1 - 1)(-2p4 + 18p*4 + 19p*4 - 56298p*2 + 56298p*2). -70p*4 Expand (-3 - 5 + 4)(-3 + 7s - 11s - 2s). 24s + 12 Expand (-1 + 2 + 0)((-3j + 4j + 0j)(-j + 1 - 1) + (4j - 2j - j)(-89j - 12j + 50j)). -52j*2 Expand (10q*3 - 4q*3 - 2q*3)(-3 + 4 - 2) + 2q2 - 2q*2 + 2q*3. -2q*3 Expand (-110 + 95 - 88)(0i4 + 0i*4 + 2i*5). -206i*5 Expand (-2 - 2 + 1 + (-4 + 5 + 2)(-1 - 1 + 4 + (-2 + 2 + 1)(-2 + 5 - 2) + 29 - 31 - 72))(2u4 + 0 + 0). -432u*4 Expand 225g*5 + 79g*5 - 508g*5 + (2g*4 + 2g*4 - 3g*4)(0 - 1 + 2)(0g + 5g - 3g). -202g5 Expand (-3k - 2k + 3k)(-69k*2 + 17k*2 - 6k*4 + 5k*4). 2k*5 + 104k*3 Expand (-24116 + 40o*3 + 24116 - 4o)(-2o + 2o + o2). 40o*5 - 4o*3 Expand (-22 - 4 - 21)(-2 + 2 - z + 3z + z - 3z - 5z + 3z	{ "pile_set_name": "DM Mathematics" }
m cttccctc. 15/28 Three letters picked without replacement from vdioyyo. Give prob of picking 1 i and 2 y. 1/35 Three letters picked without replacement from {y: 7, b: 1}. Give prob of picking 1 b and 2 y. 3/8 Calculate prob of picking 1 i and 1 f when two letters picked without replacement from {i: 2, s: 7, f: 1}. 2/45 What is prob of picking 1 r and 3 t when four letters picked without replacement from {t: 5, r: 9}? 90/1001 Three letters picked without replacement from jpjjappj. What is prob of picking 2 j and 1 a? 3/28 Two letters picked without replacement from {h: 3, w: 4, g: 4, r: 5, s: 3}. What is prob of picking 1 h and 1 g? 4/57 Two letters picked without replacement from onnioioo. Give prob of picking 2 i. 1/28 Calculate prob of picking 2 w when two letters picked without replacement from {k: 1, y: 2, l: 4, c: 1, w: 2}. 1/45 Two letters picked without replacement from zszd. Give prob of picking 1 s and 1 d. 1/6 What is prob of picking 3 m when three letters picked without replacement from dmmddddm? 1/56 What is prob of picking 2 t when two letters picked without replacement from tzztzttt? 5/14 Calculate prob of picking 1 u and 1 c when two letters picked without replacement from {o: 2, u: 2, m: 3, v: 1, c: 4}. 4/33 Calculate prob of picking 1 q and 1 t when two letters picked without replacement from {t: 5, d: 2, k: 5, w: 2, n: 1, q: 1}. 1/24 Two letters picked without replacement from {h: 3, y: 4}. Give prob of picking 2 h. 1/7 Four letters picked without replacement from isiiiiiiiiiiiiiiiii. Give prob of picking 1 s and 3 i. 4/19 Two letters picked without replacement from {t: 2, h: 4, y: 4}. Give prob of picking 1 y and 1 t. 8/45 Calculate prob of picking 1 b and 1 x when two letters picked without replacement from {x: 3, b: 1, w: 1, u: 2, t: 3}. 1/15 What is prob of picking 1 n and 1 s when two letters picked without replacement from {n: 1, s: 1, b: 3, x: 1, v: 1}? 1/21 Three letters picked without replacement from {y: 2, q: 2, r: 1}. What is prob of picking 1 r, 1 y, and 1 q? 2/5 What is prob of picking 1 i and 1 c when two letters picked without replacement from ceeifcfci? 1/6 Two letters picked without replacement from rwwrwr. Give prob of picking 2 r. 1/5 Calculate prob of picking 3 u when three letters picked without replacement from {u: 3, h: 8}. 1/165 Calculate prob of picking 2 t when two letters picked without replacement from {t: 7, g: 4}. 21/55 Two letters picked without replacement from {c: 1, g: 3, e: 1, f: 1, j: 3, y: 2}. What is prob of picking 1 f and 1 e? 1/55 Three letters picked without replacement from xxxxxxhxxxxh. Give prob of picking 1 h and 2 x. 9/22 Two letters picked without replacement from gggggpvvgvgggeg. What is prob of picking 1 g and 1 v? 2/7 Calculate prob of picking 1 l and 1 a when two letters picked without replacement from lasvlaalllalaatatl. 49/153 Three letters picked without replacement from {u: 1, z: 1, n: 1, x: 1, p: 1}. Give prob of picking 1 z, 1 x, and 1 u. 1/10 What is prob of picking 4 f when four letters picked without replacement from {f: 7}? 1 Two letters picked without replacement from {w: 4, d: 4, y: 6, q: 4, i: 2}. What is prob of picking 1 d and 1 q? 8/95 What is prob of picking 1 j and 1 s when two letters picked without replacement from {j: 2, d: 1, a: 1, s: 2}? 4/15 Two letters picked without replacement from ljbdbcl. What is prob of picking 2 b? 1/21 Four letters picked without replacement from {l: 4, b: 4, p: 2}. What is prob of picking 1 b, 2 p, and 1 l? 8/105 Two letters picked without replacement from bhhhbhhhhhhbhbhb. Give prob of picking 2 b. 1/12 What is prob of picking 1 e and 2 r when three letters picked without replacement from grgrrerggg? 1/20 What is prob of picking 1 r and 1 s when two letters picked without replacement from {r: 2, y: 1, s: 3, g: 1}? 2/7 Two letters picked without replacement from {b: 2, z: 3}. What is prob of picking 2 b? 1/10 Calculate prob of picking 1 i and 1 d when two letters picked without replacement from ildlifllllliyiid. 1/12 Two letters picked without replacement from dddjdddjjjdjd. Give prob of picking 1 d and 1 j. 20/39 What is prob of picking 1 b, 2 v, and 1 o when four letters picked without replacement from obboobobbvbonbo? 0 Calculate prob of picking 2 m and 1 o when three letters picked without replacement from {m: 2, w: 3, o: 3, z: 7}. 3/455 Calculate prob of picking 3 x when three letters picked without replacement from xqqqllxxqqxqxxxxql. 7/102 Calculate prob of picking 2 l when two letters picked without replacement from lllvxvvlx. 1/6 Three letters picked without replacement from ccocococomc. What is prob of picking 1 m and 2 o? 2/55 Three letters picked without replacement from {h: 16, s: 1, b: 3}. Give prob of picking 2 h and 1 s. 2/19 What is prob of picking 2 y and 1 o when three letters picked without replacement from fyoyfyoo? 9/56 Calculate prob of picking 1 e, 1 c, and 2 f when four letters picked without replacement from {e: 4, c: 1, t: 1, f: 3, z: 2, j: 1}. 4/165 Two letters picked without replacement from bvbwibggivvbjbbjvbb. What is prob of picking 2 b? 28/171 Three letters picked without replacement from {g: 1, q: 1, o: 2, d: 1}. What is prob of picking 1 d, 1 g, and 1 q? 1/10 What is prob of picking 2 s when two letters picked without replacement from {c: 3, p: 1, e: 1, v: 1, s: 2, h: 4}? 1/66 Calculate prob of picking 1 p and 1 b when two letters picked without replacement from {e: 1, b: 1, j: 2, v: 3, p: 5}. 5/66 What is prob of picking 1 n and 2 o when three letters picked without replacement from {k: 2, n: 1, d: 1, o: 4}? 3/28 Four letters picked without replacement from {w: 3, u: 1, i: 3, b: 1, t: 2}. What is prob of picking 1 t and 3 w? 1/105 Two letters picked without replacement from {y: 11, u: 2, v: 7}. What is prob of picking 1 y and 1 u? 11/95 What is prob of picking 1 r and 1 v when two letters picked without replacement from {v: 1, t: 2, r: 4, l: 4, c: 1, d: 6}? 4/153 Four letters picked without replacement from {k: 9, a: 1, z: 9}. What is prob of picking 1 k, 2 z, and 1 a? 27/323 Calculate prob of picking 1 g, 1 q, and 2 x when four letters picked without replacement from xqqqqgoohgxbgqqqg. 1/85 Calculate prob of picking 1 b and 1 z when two letters picked without replacement from {z: 8, k: 1, b: 11}. 44/95 Four letters picked without replacement from nccnii. What is prob of picking 1 c, 1 n, and 2 i? 4/15 Four letters picked without replacement from {e: 6, t: 13}. Give prob of picking 1 t and 3 e. 65/969 Calculate prob of picking 1 d and 2 h when three letters picked without replacement from ohhoohohoodoozooh. 1/68 Four letters picked without replacement from ikdidsssukdmsd. What is prob of picking 4 d? 1/1001 Four letters picked without replacement from rrvfvvrwvrrrrwvrrf. Give prob of picking 1 f and 3 v. 1/153 Two letters picked without replacement from zzzzzzzzzzzjjzzzjz. Give prob of picking 2 z. 35/51 What is prob of picking 2 q and 2 c when four letters picked without replacement from {q: 2, c: 17}? 2/57 What is prob of picking 1 z and 3 p when four letters picked without replacement from {z: 1, t: 1, p: 3}? 1/5 Three letters picked without replacement from {a: 1, n: 1, u: 4, t: 4, v: 1, h: 3}. Give prob of picking 1 n, 1 u, and 1 t. 4/91 What is prob of picking 1 m and 1 x when two letters picked without replacement from {x: 4, f: 7, m: 2}? 4/39 Three letters picked without replacement from {i: 3, g: 2, t: 3}. Give prob of picking 1 i, 1 g, and 1 t. 9/28 Four letters picked without replacement from {f: 2, q: 1, o: 4}. Give prob of picking 4 o. 1/35 Two letters picked without replacement from {d: 1, i: 1, z: 1, p: 1, k: 2, x: 1}. Give prob of picking 1 k and 1 d. 2/21 Calculate prob of picking 1 d and 1 p when two letters picked without replacement from {p: 1, d: 1, g: 1, k: 2, v: 1, t: 2}. 1/28 Two letters picked without replacement from {q: 1, l: 6, e: 3, g: 1, a: 6, n: 3}. What is prob of picking 1 e and 1 n? 9/190 Calculate prob of picking 2 y and 1 o when three letters picked without replacement from {o: 12, y: 6}. 15/68 Calculate prob of picking 2 z when two letters picked without replacement from rrrvvrzzjjvjnzs. 1/35 Three letters picked without replacement from {y: 1, g:	{ "pile_set_name": "DM Mathematics" }
to five decimal places. 0.00001 Round -14891103.4 to the nearest one thousand. -14891000 Round 749445.0605 to the nearest one hundred. 749400 What is -14251.4218 rounded to the nearest one thousand? -14000 What is 4322095.67 rounded to the nearest ten thousand? 4320000 What is 0.000578878324 rounded to six decimal places? 0.000579 What is -0.00325145718 rounded to five dps? -0.00325 What is 4.0591257 rounded to one dp? 4.1 Round 2331863390 to the nearest one hundred thousand. 2331900000 Round -529.1630161 to the nearest 10. -530 Round -22.9072802 to two dps. -22.91 Round -177.019072 to the nearest one hundred. -200 What is 0.001546852902 rounded to 5 decimal places? 0.00155 Round -0.46896025 to 1 decimal place. -0.5 Round 4.21412245 to 4 decimal places. 4.2141 What is -0.04711486287 rounded to six dps? -0.047115 Round -1.244072542 to 5 decimal places. -1.24407 Round 0.00078275173 to 6 decimal places. 0.000783 What is -2.377206345 rounded to two decimal places? -2.38 Round -330.14455 to one decimal place. -330.1 What is 9534.365089 rounded to the nearest one hundred? 9500 What is 0.000135529451 rounded to six decimal places? 0.000136 What is -0.000000104216767 rounded to seven dps? -0.0000001 Round -2739.653506 to the nearest 10. -2740 What is -1299.0022901 rounded to two dps? -1299 Round 321.29633 to one dp. 321.3 What is -1.68031819 rounded to two decimal places? -1.68 What is 401.3429054 rounded to the nearest ten? 400 What is 0.01043494179 rounded to 5 dps? 0.01043 What is -5137.083 rounded to the nearest 10? -5140 What is -0.01121953374 rounded to six dps? -0.01122 Round -4177826726 to the nearest one million. -4178000000 What is -0.01669493792 rounded to 6 dps? -0.016695 What is -0.45952278 rounded to 3 decimal places? -0.46 What is 35.19363288 rounded to 3 decimal places? 35.194 Round 1.94290456 to 3 decimal places. 1.943 Round -0.002674385218 to six decimal places. -0.002674 What is 0.00000418491774 rounded to seven dps? 0.0000042 Round -325332512.4 to the nearest 10000. -325330000 Round 357183.6237 to the nearest 1000. 357000 What is 3485018.087 rounded to the nearest ten thousand? 3490000 Round 25.1808965 to the nearest integer. 25 Round -3.493274 to 1 decimal place. -3.5 Round -0.000199965555 to seven dps. -0.0002 Round -34123522.6 to the nearest one million. -34000000 What is -2300.64283 rounded to the nearest one thousand? -2000 Round -393339.843 to the nearest 100000. -400000 Round -378170.944 to the nearest ten thousand. -380000 What is -216.1945412 rounded to the nearest 10? -220 What is 155949.40985 rounded to the nearest ten? 155950 Round -3156.5667 to the nearest integer. -3157 Round -1604107.681 to the nearest 100. -1604100 Round -41755.768 to the nearest 100. -41800 Round -805988686 to the nearest 10000. -805990000 What is -5350078.7 rounded to the nearest 1000? -5350000 What is -12.66713878 rounded to the nearest integer? -13 Round -4.311418 to one decimal place. -4.3 Round -0.000285535961 to 4 dps. -0.0003 What is 26700323290 rounded to the nearest one million? 26700000000 What is 0.569877936 rounded to four decimal places? 0.5699 What is 6084959870 rounded to the nearest one million? 6085000000 What is -12158.094244 rounded to the nearest 100? -12200 Round -0.064579951 to two dps. -0.06 Round 0.00007210781 to four decimal places. 0.0001 Round -0.0113401385 to three dps. -0.011 What is -22044095700 rounded to the nearest one million? -22044000000 What is -0.0000038802836 rounded to 7 decimal places? -0.0000039 Round -0.009063879 to 4 decimal places. -0.0091 What is -580.18625 rounded to the nearest ten? -580 What is 57153840.4 rounded to the nearest 100000? 57200000 What is -16599265 rounded to the nearest one hundred thousand? -16600000 What is -132586392 rounded to the nearest 10000? -132590000 What is 948.728444 rounded to the nearest 100? 900 What is -0.00000487300698 rounded to six dps? -0.000005 What is -4236.4425 rounded to the nearest 10? -4240 What is 16264409893 rounded to the nearest 100000? 16264400000 What is -61419.0225 rounded to the nearest one thousand? -61000 What is 229.7638342 rounded to 2 decimal places? 229.76 What is -0.742444376 rounded to two decimal places? -0.74 Round -0.0000042707865 to 6 decimal places. -0.000004 What is -23658.891 rounded to the nearest ten? -23660 What is 124300400320 rounded to the nearest one million? 124300000000 What is 51144562 rounded to the nearest 10000? 51140000 Round 0.00226754042 to seven dps. 0.0022675 What is 0.0003685358697 rounded to six decimal places? 0.000369 What is -267735.9836 rounded to the nearest ten? -267740 What is 1789.1794 rounded to the nearest integer? 1789 Round 0.00000033763355 to seven decimal places. 0.0000003 Round 0.01651572541 to four decimal places. 0.0165 Round -11161105600 to the nearest one million. -11161000000 What is -30433724300 rounded to the nearest one million? -30434000000 Round -183.59003 to two dps. -183.59 What is -1248.945914 rounded to the nearest one hundred? -1200 Round 67380495.56 to the nearest one hundred thousand. 67400000 Round 0.09250655 to three decimal places. 0.093 What is 1.29757323 rounded to 3 dps? 1.298 What is 69302507.7 rounded to the nearest 10000? 69300000 What is -875704.886 rounded to the nearest one hundred? -875700 Round 0.02603376134 to seven dps. 0.0260338 Round -0.0702040265 to 5 dps. -0.0702 What is -18.3672991 rounded to zero dps? -18 Round -52832.8234 to the nearest 10. -52830 Round 1371855.03 to the nearest 100000. 1400000 What is 52781.6438 rounded to the nearest 10? 52780 What is -0.0172510216 rounded to three dps? -0.017 What is 6.647077588 rounded to 0 decimal places? 7 What is -4771739034 rounded to the nearest 100000? -4771700000 Round -80304.0786 to the nearest ten thousand. -80000 What is -182.83065286 rounded to zero dps? -183 Round 4835.359696 to the nearest ten. 4840 Round -0.1944465466 to 4 decimal places. -0.1944 What is -0.000759051608 rounded to 6 dps? -0.000759 What is 57771253.9 rounded to the nearest one thousand? 57771000 What is 9697832.73 rounded to the nearest one million? 10000000 Round -0.0010546989427 to seven dps. -0.0010547 Round -151930370 to the nearest 1000000. -152000000 What is -13199.707785 rounded to the nearest one thousand? -13000 What is -438.132995 rounded to zero dps? -438 What is -14755543.9 rounded to the nearest 1000000? -15000000 What is 5212.50004 rounded to the nearest 100? 5200 What is 3.57771578 rounded to the nearest integer? 4 Round 422865.7602 to the nearest one hundred. 422900 What is 1045926910 rounded to the nearest 100000? 1045900000 What is 0.0000020981082 rounded to six decimal places? 0.000002 Round 8737862.41 to the nearest 100. 8737900 Round -639.53299 to the nearest 10. -640 What is -0.0221969348 rounded to five decimal places? -0.0222 Round -1.05315599 to three dps. -1.053 What is -94825001 rounded to the nearest 1000000? -95000000 What is -0.000008079461025 rounded to 7 dps? -0.0000081 Round -16895.46514 to the nearest ten. -16900 Round 0.7766518141 to one decimal place. 0.8 What is 0.236866323 rounded to two dps? 0.24 What is 134704.018 rounded to the nearest 10000? 130000 What is 3.18909956 rounded to 2 decimal places? 3.19 What is 4.5685786 rounded to one decimal place? 4.6 Round -2.040635632 to one dp. -2 What is 84.7479078 rounded to the nearest ten? 80 Round -30236863900 to the nearest one million. -30237000000 What is 944.5787439 rounded to the nearest 10? 940 What is 0.0020920349 rounded to 6 dps? 0.002092 What is -21.8979992 rounded to three dps? -21.898 What is 0.0000012463470874 rounded to seven decimal places? 0.0000012 What is -135449.9739 rounded to the nearest 10? -135450 What is -20.57870555 rounded to two decimal places? -20.58 What is 0.041227487 rounded to 2 dps? 0.04 What is -4.51457148 rounded to 4 dps? -4.5146 Round 0.0023729794424 to 7 dps. 0.002373 What is -0.0017548434103 rounded to 4 dps? -0.0018 What is -89.5236289 rounded to 2 decimal places? -89.52 What is -0.36907453 rounded to three dps? -0.369 What is -0.000052452821 rounded to 5 decimal places? -0.00005 Round 36059.6535 to the nearest one thousand. 36000 What is 0.00000080790216 rounded to seven dps? 0.0000008 What is -0.14749313 rounded to 4 d	{ "pile_set_name": "DM Mathematics" }
se -4x - 2x + 30 = 0. Which is the biggest value? (a) -4 (b) 6 (c) x b Let q = -605/8 - -76. Which is the smallest value? (a) -1 (b) q (c) -0.5 a Let x = -84 - -589/7. Let j = -841/40 - -107/5. What is the biggest value in -4/5, j, x? j Let i = -27.051 - -0.051. Let n = i - -24. Let h = 0.5 - 0.2. What is the third smallest value in h, -1/6, n? h Let j = 238.2 + -238. Let p = 0.2 + 0. Let b = 0.8 + p. What is the second biggest value in -0.3, j, b? j Suppose 0 = -2n + 1 - 5. Let v = n + 2. Let u be -3 - (v + -7)1. Which is the second biggest value? (a) 2 (b) 1 (c) u a Let h = -17 - -8. Let t = 5 + h. Let v = t + 3.8. What is the second biggest value in 1/2, -2/5, v? v Let r = 7 - 10. Suppose 2o - o - 14 = 0. Let w be (10/(-5))/(o/2). Which is the smallest value? (a) r (b) 0.2 (c) w a Let a = -0.94 + -2.06. What is the biggest value in -4, 0.8, a? 0.8 Let v = 49 + -52. Let h = -1 - -1.2. Which is the second biggest value? (a) v (b) h (c) 0.5 b Let m = -5 - -4.98. Which is the second smallest value? (a) m (b) -0.5 (c) -2 b Let z = 4 + -6. Let p = 4 + z. Which is the smallest value? (a) 5 (b) p (c) -1 c Let p = 1.1 + -1.2. What is the second smallest value in -0.2, p, -1? -0.2 Let v = -0.6 + -0.4. Let l = 2.94 + 0.06. Let d = l + -2.9. Which is the second biggest value? (a) 5 (b) v (c) d c Let f = 193/4 + -48. Let b = 6 + -12. Let c = b - -7. What is the third smallest value in 3, f, c? 3 Suppose 6 = 2o + o. Let n(l) = 2l2 + 3l + 2. Let f be n(-2). Let h be (o/6)/(f + -3). Which is the third smallest value? (a) -0.1 (b) -2 (c) h c Let d = -2/71 + -132/355. What is the second biggest value in -2/7, d, 2? -2/7 Let r = 0 - 0.06. Let d = -4.06 - r. Suppose -3f - 2q - 5 = 0, -4f - q = -0q. Which is the third biggest value? (a) 2/11 (b) f (c) d c Let x = -43.51 - -44. Let w = -0.2 - -0.19. Let h = w - x. What is the third biggest value in -2, h, 4? -2 Let b = 1/52 - 131/52. What is the smallest value in -4, 0.06, b? -4 Suppose 3w + o = -13 - 1, 5w - 4o + 12 = 0. Let g = 1 - 1. Let r = -5 + g. What is the biggest value in r, w, 5? 5 Let b be (121)/((-11)/22). What is the second biggest value in -2, -7, b? b Let g = 0.05 + 0.75. Which is the third biggest value? (a) -0.1 (b) g (c) -0.3 c Let t = -22 - -17. What is the third smallest value in 2/9, 1/2, -1, t? 2/9 Suppose -3l + 5 = -4l. Suppose 3u = 3s, 9u - 2 = 3s + 4u. Which is the smallest value? (a) 2/5 (b) s (c) l c Let f = 25 - 88. What is the second smallest value in f, 0.1, 2/3? 0.1 Let l = 33.2 - 30. Let m = -0.8 - l. Let v = 0 + -0.5. What is the third smallest value in 5, m, v? 5 Let s = 0 - -0.5. Let h = -0.18 - -0.28. Which is the third biggest value? (a) s (b) h (c) -5 c Let l = 1 - -4. Which is the second biggest value? (a) 1 (b) l (c) -3 a Suppose -2i = 2i - 16. Suppose -s = -is. Let v be 5(1 - s) + -2. Which is the third smallest value? (a) -3 (b) 0.2 (c) v c Let s = 25882/31155 + -314/2077. Let w = s + -2/155. What is the second biggest value in w, 0, -0.5? 0 Let u = 2.8 + 2.2. Let p be (2/32)/((-3)/4). What is the third smallest value in -4, p, u? u Let g be 1(-13)/6 + 2. Let z = 2.96 + 0.04. Let l = z - 3.2. Which is the smallest value? (a) 5 (b) l (c) g b Let m = -147 + 1027/7. Which is the fourth biggest value? (a) 0 (b) m (c) -3 (d) -0.1 c Let v be 4/(216/52 - 4). Let c = v + -26. Let s = -5 - 0. What is the biggest value in -0.2, c, s? c Let h be 3/12 - 552/32. Let y be (2/(-12))/((-2)/212). Let p = y + h. What is the biggest value in 0.3, -2, p? p Suppose -3f + 153 = 3y, 1 + 3 = -2y. Let m = 157/3 - f. Let h = -1.9 - 0.1. Which is the smallest value? (a) h (b) 5 (c) m a Let w = 75 - 221/3. What is the fourth smallest value in 1/3, 3, w, -3? 3 Let x = -3 - -7/3. Which is the second biggest value? (a) 3 (b) x (c) -1/4 c Let q = 649/7 - 93. Which is the third smallest value? (a) 0.1 (b) q (c) 3 (d) -3/4 a Let o = 1 - 6. Let y = 2 + o. Let q be 10/(-8) + (-1)/(-1). What is the second smallest value in y, q, -0.5? -0.5 Let m = -0.556 - -0.156. What is the smallest value in 3, m, -1, -1/3? -1 Let c = -10 - -12. What is the third smallest value in -3, c, 0.1? c Let v = -0.64 - 0.06. Let g = v - -0.4. What is the biggest value in 0.4, g, -2/7? 0.4 Let k = -12 - -7. Let n = -15 + 15.1. Let u = -0.6 + n. Which is the second smallest value? (a) k (b) u (c) 0.2 b Let g(j) = j*3 + 16j*2 - 18j - 22. Let o be g(-17). Which is the second biggest value? (a) -0.3 (b) o (c) -4 c Let n be 376/(-336) - 4/(-14). Let q = n - -11/42. Which is the second smallest value? (a) -1 (b) q (c) 0.5 b Let f = 23 - 12. Let v = f - 11.4. Let h be (-1 + (-1)/(-2))/(-1). What is the smallest value in -1/2, h, v? -1/2 Let f = -0.6 + 0.6. Suppose -9p + 13p = 16. What is the smallest value in p, f, -2/17? -2/17 Let h = -19.2 + -5.8. Let d = 26 + h. Which is the second biggest value? (a) -2/15 (b) d (c) -7 a Let d = 0.088 + 0.012. What is the third smallest value in d, 2/7, -3, -2/7? d Let x be (8/16)/(1/6). Let g be x/(-72) - (-1)/(-8). What is the smallest value in g, 1/5, -3? -3 Let o = -47/2 + 25. Let x = 0.01 + 0.19. Which is the second biggest value? (a) -1 (b) o (c) x c Let q be 2/1 + (-9)/5. Let d be ((-4)/35)/(259/(-35) + 7). Which is the third smallest value? (a) 5 (b) d (c) q a Let b be (-8)/(-36) - (-32)/18. What is the second smallest value in b, -0.2, -3, -4/5? -4/5 Let a = 49 + -195/4. Let i = -1 - -2. Let r = i - 1.1. What is the third biggest value in r, a, -0.5? -0.5 Let q = -0.2 - 0. Let c = 4 - 2. Let u(b) = b*2 + 3b - 11. Let x be u(-5). What is the second biggest value in x, q, c? q Let n be (10/(-28))/((-7)/28). Which is the third smallest value? (a) n (b) -0.3 (c) 5 c Let q = -1/3 + 5/6. Suppose -5v + 12 + 3 = 0. Let w be (-11)/(-12) + (-2)/v. What is the third biggest value in -4, q, w? -4 Let m = -8 - -11. Let s = 4.37 - 4.27. Which is the smallest value? (a) 4 (b) m (c) s c Let z = 83 - 81. Let v be (-2)/4 - 4/(-6). What is the third biggest value in v, 1, z? v Suppose -3h + 5h + y = 277, 4h = -y + 557. Let g = h + -557/4. What is the smallest value in -0.1, -1, g? -1 Let p = -3 - -2.9. Let c = -1.2 - -1.2. What is the smallest value in -4, p, c? -4 Let v be 12/108 + 28/(-90). Which is the second smallest value? (a) v (b) -2/5 (c) 4/7 a Let u = -2.8 - -3. Let z be (-8)/(-66)(-3)/12. Let o = z + -7/132. What is the second biggest value in u, o, -1? o Suppose -2v = -5q, -2q + v + 6 = -v. Let f be -2 - ((-1)/(-1) - 6). Suppose b - 5w + 20 = 0, 2b + 2w + 3 = -1. What is the smallest value in q, b, f? b Let s = 51 - 99/2. What is the biggest value in s, -1/3, -2? s Let k be (-15)/(-10) + 2/12. What is the third smallest value in k, -0.3, -1/2, -0.02? -0.02 Let d(s) = 34s. Let j be d(1). Let y be (-3)/2 + j/(-12). Let w = -29/6 - y. Which is the third biggest value? (a) 3/5 (b) 0.3 (c) w c Let m = 2.39 + 0.21. Let j = m + -3. What is the second biggest value in j, -2/13, -2/11? -2/11 Let b = 4 + -6. Let i = -10.9 - -11.88. Let l = i + 0.02. What is the third biggest value in b, 0, l? b Let w = 18 + -16. Which is the biggest value? (a) w (b) -0.4 (c) 0.5 a Let q = 7.7 + -8. Let s = -2 + -3. Which is the biggest value? (a) 5 (b) s (c) q a Let x = 2 - 3. Suppose 5l + 26 + 19 = 0. Let q = l + 10. What is the second smallest value in x, q, -0.6? -0.6 Let d(p) = p + 1. Let i be d(-2). Let s be (i/(-21))/(3/(-6)). Let m be 10/4-12. Which is the biggest value? (a) -1/10 (b) m (c) s c Let j be -5(-1)/(-21)17. Let f = -1116 + 7772/7. Let s = j - f. What is the third biggest value in s, -3, 5? -3 Suppose -t + 4t = 12. Let y = 5 - 4. Which is the biggest value? (a) y (b) 5 (c) t b Let k = 64 + -63. What is the smallest value in 0.3, 0.2, 5, k? 0.2 Let t = -17 + 79. Let y = t - 308/5. Let m = 1 - 0.7. What is the second biggest value in 1/3, m, y? 1/3 Let f = 0.405 + 1.595. Suppose -4d + 132 = 2q - 0*d, 0 = -q + d + 72. Let s = q + -487/7. Which is the third biggest value? (a) s (b) f (c) 1 a Let r = 0.1 - -3.7. Let p = r - 7.6. Let m = p - -4. Which is the biggest value? (a) -1 (b) 0.3 (c) m b Let v = 20.2 - -6.8. Let u = 26.9 - v. Which is	{ "pile_set_name": "DM Mathematics" }
s 14 divide 820? False Is 105 a factor of 47565? True Does 6 divide 720? True Is 22 a factor of 18942? True Is 133 a multiple of 7? True Does 253 divide 18625? False Is 8 a factor of 67588? False Does 98 divide 24108? True Is 2147 a multiple of 11? False Is 928 a multiple of 14? False Is 115 a factor of 690? True Is 6 a factor of 984? True Is 57 a factor of 13192? False Does 116 divide 4315? False Is 35 a factor of 1400? True Is 140 a factor of 1685? False Does 7 divide 2653? True Is 36 a factor of 8666? False Does 21 divide 47886? False Is 65 a factor of 45771? False Does 112 divide 67516? False Is 12 a factor of 6916? False Does 34 divide 16348? False Is 1490 a multiple of 10? True Is 25 a factor of 42161? False Does 96 divide 2798? False Is 1383 a multiple of 12? False Is 8 a factor of 456? True Is 7 a factor of 236? False Is 125 a factor of 1676? False Does 3 divide 414? True Is 16327 a multiple of 26? False Is 1408 a multiple of 17? False Does 69 divide 1556? False Is 434 a multiple of 31? True Is 11 a factor of 3265? False Does 18 divide 3474? True Is 18858 a multiple of 21? True Is 609 a multiple of 21? True Is 3887 a multiple of 33? False Does 36 divide 11628? True Is 6076 a multiple of 28? True Is 2575 a multiple of 6? False Is 56 a factor of 885? False Is 26 a factor of 39286? True Does 13 divide 16241? False Does 6 divide 4740? True Does 17 divide 26843? True Does 285 divide 42465? True Does 116 divide 30001? False Is 5 a factor of 2402? False Does 22 divide 286? True Is 45 a multiple of 2? False Does 2 divide 6? True Is 31249 a multiple of 17? False Does 10 divide 2127? False Is 73 a factor of 1314? True Is 56 a factor of 3136? True Is 16295 a multiple of 76? False Is 1971 even? False Is 27293 a multiple of 49? True Is 1742 a multiple of 13? True Is 16267 a multiple of 70? False Does 101 divide 3636? True Is 19800 a multiple of 36? True Does 10 divide 10629? False Does 55 divide 13091? False Is 2750 a multiple of 36? False Is 452 even? True Is 5597 a multiple of 33? False Does 10 divide 12164? False Is 2416 a multiple of 37? False Is 2395 a multiple of 13? False Is 19 a factor of 1159? True Is 6605 a multiple of 8? False Is 56615 a multiple of 65? True Is 8 a factor of 1788? False Is 20 a factor of 31659? False Is 4 a factor of 264? True Does 33 divide 1881? True Is 29 a factor of 58261? True Does 14 divide 7841? False Is 290 a multiple of 7? False Is 28 a factor of 505? False Is 6344 a multiple of 52? True Is 2565 a multiple of 19? True Is 9502 a multiple of 17? False Does 41 divide 2296? True Does 15 divide 1184? False Does 45 divide 104715? True Is 1097 a multiple of 4? False Is 95 a factor of 1532? False Is 8980 a multiple of 20? True Does 25 divide 553? False Is 55 a factor of 42955? True Does 19 divide 82726? True Does 10 divide 104? False Does 41 divide 1148? True Does 2 divide 1248? True Does 45 divide 1057? False Is 1927 a multiple of 43? False Is 24 a factor of 581? False Does 32 divide 14848? True Is 19 a factor of 960? False Is 2282 a multiple of 4? False Does 131 divide 7991? True Is 361 a multiple of 2? False Is 8067 a multiple of 3? True Does 3 divide 2538? True Is 210 a multiple of 3? True Is 1909 a multiple of 8? False Is 1898 a multiple of 11? False Does 71 divide 45582? True Does 4 divide 676? True Is 504 a multiple of 63? True Does 189 divide 26532? False Is 1662 a multiple of 16? False Does 4 divide 2712? True Is 15 a factor of 2760? True Is 78 a multiple of 51? False Is 570 a multiple of 15? True Is 19 a factor of 893? True Does 20 divide 15880? True Is 2002 a multiple of 14? True Does 29 divide 2969? False Is 1319 a multiple of 37? False Is 1204 a multiple of 14? True Is 1001 a multiple of 11? True Is 18156 a multiple of 68? True Is 5 a factor of 17745? True Is 13 a factor of 9399? True Is 1475 a multiple of 4? False Does 86 divide 19025? False Does 9 divide 255? False Is 133 a factor of 11438? True Does 16 divide 634? False Is 640 a multiple of 16? True Does 110 divide 6311? False Is 1584 a multiple of 12? True Is 26560 a multiple of 166? True Is 47930 a multiple of 95? False Does 7 divide 1262? False Is 23 a factor of 69? True Is 59 a factor of 41959? False Is 23 a factor of 506? True Is 51597 a multiple of 147? True Is 62 a factor of 5890? True Does 85 divide 2295? True Is 50 a multiple of 50? True Is 8587 a multiple of 71? False Is 21 a factor of 197? False Does 21 divide 858? False Is 31 a factor of 1240? True Is 9 a factor of 3381? False Is 18 a factor of 13212? True Does 15 divide 6424? False Is 10 a factor of 2110? True Is 432 a multiple of 9? True Is 529 a multiple of 15? False Is 10 a factor of 3080? True Is 12 a multiple of 6? True Is 504 a multiple of 2? True Is 30919 a multiple of 10? False Is 577 a multiple of 29? False Is 20 a factor of 647? False Is 1012 a multiple of 11? True Does 100 divide 12124? False Is 350 a multiple of 50? True Is 10 a factor of 2620? True Is 43 a factor of 473? True Is 4788 a multiple of 28? True Is 1890 a multiple of 4? False Is 72 a factor of 2736? True Does 3 divide 23? False Is 180 a factor of 56415? False Does 11 divide 151239? True Is 2 a factor of 21736? True Is 2 a factor of 10? True Does 11 divide 20144? False Is 693 a multiple of 99? True Does 24 divide 2568? True Is 4356 a multiple of 19? False Is 15 a factor of 2865? True Does 107 divide 8490? False Is 904 a multiple of 8? True Does 43 divide 33680? False Is 760 a multiple of 40? True Is 2300 a multiple of 13? False Is 24522 a multiple of 38? False Is 11 a factor of 761? False Does 2 divide 155? False Is 3 a factor of 5690? False Is 672 a multiple of 21? True Is 10 a factor of 2020? True Is 131 a multiple of 6? False Does 25 divide 5901? False Is 907 a multiple of 8? False Does 13 divide 572? True Is 18 a factor of 252? True Is 2 a factor of 996? True Does 13 divide 130? True Does 86 divide 9511? False Is 6611 a multiple of 11? True Is 3442 a multiple of 8? False Is 29 a factor of 3915? True Does 75 divide 67582? False Does 32 divide 6944? True Is 9750 a multiple of 78? True Is 17 a factor of 115859? False Does 3 divide 604? False Is 10 a factor of 142? False Is 12080 a multiple of 31? False Is 1003 a multiple of 17? True Is 35 a factor of 942? False Is 57 a factor of 1710? True Does 42 divide 1703? False Does 24 divide 631? False Is 45 a factor of 238? False Is 37 a factor of 15466? True Does 7 divide 351? False Is 35250 a multiple of 15? True Is 13872 a multiple of 202? False Is 13624 a multiple of 4? True Does 18 divide 104490? True Is 23 a factor of 350? False Is 34008 a multiple of 104? True Is 901 a multiple of 3? False Is 26295 a multiple of 3? True Is 3 a factor of 258? True Is 98016 a multiple of 131? False Is 37 a factor of 1036? True Is 3 a factor of 4255? False Does 34 divide 3010? False Is 71 a factor of 994? True Is 10 a factor of 8880? True Is 8827 a multiple of 97? True Is 314 a multiple of 3? False Is 527 a multiple of 14? False Does 7 divide 392? True Is 4 a factor of 14660? True Is 12 a factor of 2484? True Does 32 divide 1024? True Is 7 a factor of 623? True Does 12 divide 39444? True Is 10 a factor of 16716? False Is 6 a factor of 942? True Does 74 divide 1113? False Does 72 divide 1944? True Does 49 divide 7826? False Is 15 a factor of 2687? False Is 1763 even? False Does 74 divide 900? False Is 40 a factor of 19330? False Does 13 divide 6903? True Is 1814 a multiple of 85? False Does 79 divide 1659? True Is 49288 a multiple of 67? False Does 14 divide 742? True Is 27 a factor of 9666? True Does 14 divide 125077? False Is 340 a multiple of 85? True Is 1036 a multiple of 28? True Is 2439 even? False Is 60 a multiple of 30? True Is 1135 a multiple of 18? False Does 30 divide 4590? True Is 20 a factor of 7678? False Is 48 a factor of 432? True Is 94 a multiple of 6? False Is 720 a multiple of 36? True Is 26968 a multiple of 224? False Is 64 a factor of 477? False Is 17 a factor of 3689? True Is 20349 a multiple of 119? True Is 82 a factor of 6560? True Is 37737 a multiple of 9? True Is 110 a factor of 3630? True Is 40 a factor of 480? True Is 2662 a multiple of 121? True Does 26 divide 572? True Is 14 a factor of 2716? True Does 19 divide 1452? False Is 2716 a multiple of 5? False Is	{ "pile_set_name": "DM Mathematics" }
50)49 assuming h is positive. h(-1470) Simplify ((m(-16)/m)/m)/(m/((m(-1/14)/mm)/mm)) assuming m is positive. m(-267/14) Simplify (uu/(u/u*5)(uu11)/u)/(u/(uu*(2/15))u/(uu/u8)) assuming u is positive. u(152/15) Simplify (s(-19)/ss)/s16 assuming s is positive. s(-35) Simplify (g/g0)(-15)g(-2/13)/g6 assuming g is positive. g(-275/13) Simplify oo/o*15ooo/o(-41) assuming o is positive. o31 Simplify (z/z*(-6))/(z/(zz/z*4)z)(z/(z(z*(3/5)z)/z))(-11/2) assuming z is positive. z(63/10) Simplify (uu(u/(((uu36)/u)/u))/u)/((uu/u(18/5))/u) assuming u is positive. u(-152/5) Simplify (((d/((dd14)/d))/d)/d)/d(-36) assuming d is positive. d21 Simplify (o(2/5)/o(-2))(-2/77) assuming o is positive. o(-24/385) Simplify (ii/((i/(i/((ii17)/i))i)/i))/ii(-7/4) assuming i is positive. i(-71/4) Simplify k3/k3 assuming k is positive. 1 Simplify t(-1/2)t/(((tt/(tt/t*(-2/9)t))/t)/t) assuming t is positive. t(67/18) Simplify (j(-4)/j)14 assuming j is positive. j(-70) Simplify (vv(-4/5))/(v0v) assuming v is positive. v(-4/5) Simplify r(1/3)r/(r/(rr/(r*2/rr)))(((((r/r(-3/8)rr)/r)/r)/r)/r)/rr8 assuming r is positive. r(161/24) Simplify w/(w*0w)w5(w(1/2))(-1/4) assuming w is positive. w(39/8) Simplify (z/z(-10))/z(2/21) assuming z is positive. z(229/21) Simplify a*(-17)a(-1/8) assuming a is positive. a(-137/8) Simplify (m*(-7)m)4 assuming m is positive. m(-24) Simplify (z(zz*(-2)/zz)/z)/z(-34) assuming z is positive. z33 Simplify i(2/5)/i(-11) assuming i is positive. i(57/5) Simplify (y(-4/9)/(y(yy(-15))/y))(2/67) assuming y is positive. y*(244/603) Simplify ((ll*(-2/13))/(ll/((l/(l/(l/l*(-13)))l)/l)l))(-3/23) assuming l is positive. l(-462/299) Simplify (l/((ll(-1/3))/l))(-1/33)/(l*(-2/7)l)(-8/11) assuming l is positive. l(332/693) Simplify ((k(1/2)/k)/k(-2/5))40 assuming k is positive. k(-4) Simplify (g/((g/(g/(g(((g/(g/(g(g/g*(-1))/g)))/gg)/g)/g))g)/g))/((g(2/7)gg)/gg)g/(g9g)g3 assuming g is positive. g(-58/7) Simplify ((((z(1/3)z)/z)/z)11)(2/35) assuming z is positive. z*(-44/105) Simplify (u/(u/((uu4)/u)))41 assuming u is positive. u164 Simplify (k/k(2/7)k)/kk(-9) assuming k is positive. k(-58/7) Simplify (r/r(2/5))(2/5)/(r*2r/((r/(rr/(rrr(-5/2))rr))/r)) assuming r is positive. r(-363/50) Simplify p(3/4)/p(p/(p/p*(3/7))p)/p(p0/p)/((p(1/6)/p)/p) assuming p is positive. p(85/84) Simplify (f(-3/4)/(f/(f3/f)))(-1/5) assuming f is positive. f(-1/20) Simplify (aaa(2/9)((a*(-11/2)a)/a)/a)(2/35) assuming a is positive. a(-11/45) Simplify (uu((u/u(-5))/u)/u)(-1/57) assuming u is positive. u(-2/19) Simplify a(-12)a(-3/13)/a assuming a is positive. a(-172/13) Simplify w(-26)/(ww(-2)) assuming w is positive. w(-25) Simplify (mmm/(mmm*(1/4)mmm)mm*1mm)(-4) assuming m is positive. m(-7) Simplify (f/f(-2/3)f(-17))(-39) assuming f is positive. f598 Simplify (g(2/17)/g)7 assuming g is positive. g(-105/17) Simplify (w(-12)/(w/(w0w)))(-2/27) assuming w is positive. w(8/9) Simplify (ii*3i(-5))(-37/2) assuming i is positive. i*(37/2) Simplify mm/(m/m*18)m/m6 assuming m is positive. m14 Simplify x*5x*(-5)(x(xx(xx*4x)/xx)/x)/x(-1/2) assuming x is positive. x(17/2) Simplify (a12a(-14))(-1/5) assuming a is positive. a(2/5) Simplify ((z/(z/z(-1/3)))/(zz(1/23)/z))(-2/71) assuming z is positive. z(52/4899) Simplify ((x(-1/4))(-12))(-33) assuming x is positive. x(-99) Simplify (v(-1/4))(1/6)v/(v/(v*(-2/13)v))v((v/(vv/v(-1/5)))/v)/v assuming v is positive. v(-2177/1560) Simplify bb/(b*(-4/7)b)bbb/b(-5/7) assuming b is positive. b(37/7) Simplify ((l(2/7))(-13/7))(-3/4) assuming l is positive. l(39/98) Simplify (l(-6)/(ll*3ll))(-2/29) assuming l is positive. l(24/29) Simplify (((y5/y)/y)30)(-37) assuming y is positive. y(-3330) Simplify ((b(b(b/(bb/((bb(1/2)bb)/b)bb))/b)/b)/b)/(b/b(-37)) assuming b is positive. b(-79/2) Simplify ((ffff*1f)(6/31))(2/71) assuming f is positive. f(60/2201) Simplify s(-1)s/(sss/(s9/s)) assuming s is positive. s5 Simplify lll(-1/2)ll(1/14)l*(1/9)ll/(l(1/3)/ll)l assuming l is positive. l(337/63) Simplify (qq*(1/6)q(7/3))/(q1)14 assuming q is positive. q(-21/2) Simplify (z*6/(zz*(-2)))/(zz*(-4)z(-1)) assuming z is positive. z11 Simplify (kk/(kk(-2/7)/k))4k(2/19)kk6 assuming k is positive. k(2161/133) Simplify p/(p/(((p(2/9)p)/p)/p))pp/(pp(2/7))(p2)(-47) assuming p is positive. p(-5926/63) Simplify i5i2(((ii/(i10/i))/ii)/i)/i(-3/4) assuming i is positive. i(-1/4) Simplify l*(-2/7)/(l(l(l(-6)/l)/ll)/l)(l(-2)/l)(-27) assuming l is positive. l(607/7) Simplify ((pp(3/2))/(p(-8)pp))(-2) assuming p is positive. p(-17) Simplify (d/d(-1/17))/d13 assuming d is positive. d(-203/17) Simplify ((y(-14)y)/y)/(y/((y36/y)/y)) assuming y is positive. y19 Simplify jj*(2/25)j(-5/9) assuming j is positive. j(118/225) Simplify u*(3/10)u*(1/13)u*(-6)u/u1 assuming u is positive. u(-731/130) Simplify (r/r(-1))(8/7)r(-2/15)/r(1/2) assuming r is positive. r(347/210) Simplify j/(jj*3/j)j/((jj14)/j) assuming j is positive. j(-15) Simplify ((b5b)/(b*(2/7)bb))/(b(-7)/bb/b(-8)) assuming b is positive. b(19/7) Simplify r*(-1/5)r*(2/7)(rr1)(8/3) assuming r is positive. r(569/105) Simplify l8/l((l/l4)/l)/l assuming l is positive. l2 Simplify ((k(1/3))(3/7))48 assuming k is positive. k(48/7) Simplify q4/(q(-2/9)q)(q/q*0q)(-7) assuming q is positive. q(-97/9) Simplify (uu/(uu10))/(u/u(-2/17)u) assuming u is positive. u(-189/17) Simplify (g/(gg(-1)))(-1/24)gg/g*(-2)ggg6 assuming g is positive. g(287/24) Simplify yy(-7/3)y/y*(3/2)((yy(-1))/y)(9/7) assuming y is positive. y(-131/42) Simplify b(b*(-1/3)b)/bb((b/b*7)/bb)/b(b(2/9)b)17 assuming b is positive. b(139/9) Simplify ((g/(gg(-2/21)/gg))/gg(-2/19))/(((g(3/8)g)/g)/(g/(gg/(g(-5)/g)))) assuming g is positive. g(-26765/3192) Simplify www(-2/55)(((w(32/5)/w)/w)/w)/w assuming w is positive. w(48/11) Simplify v(2/9)/v(3/11) assuming v is positive. v*(-5/99) Simplify (nn(-1/8))/((n/n(-2/41))/nnn) assuming n is positive. n(-385/328) Simplify l(-2)/(ll/(ll*(2/5)))(ll/(l/(l0l))l)4 assuming l is positive. l(47/5) Simplify (x3/x(-1))(-1/17) assuming x is positive. x(-4/17) Simplify i/(i/(ii/(ii(-18))iiii))i(2/23) assuming i is positive. i(531/23) Simplify ((g*(5/2)g)/(g(-6)/g))7 assuming g is positive. g(147/2) Simplify i(-8/11)ii/((iii/(i/(((i/(i*(-7/2)/ii))/i)/i))i)/i) assuming i is positive. i(-71/22) Simplify (z(-12)/(zzz/(z/(z/z13))))(27/7) assuming z is positive. z(-54/7) Simplify z/(z/z9)z(-22) assuming z is positive. z(-13) Simplify ((cc/(cc(-1/4)/c))/c(-1/4))/((c/c(1/2))/c(3/4)) assuming c is positive. c*(11/4) Simplify (t/(t/(tt/(t/(tt/t1tt)))))/tt/(t*9/tttt)t assuming t is positive. t(-6) Simplify u(-27/4)/u8 assuming u is positive. u(-59/4) Simplify (x(-2/9)x/(x*0x))(2/5) assuming x is positive. x(-4/45) Simplify s*(-13)s(s(s/(ssss7/ss))/s)/s assuming s is positive. s(-22) Simplify ((q(-2/13)/q)/q(-2/15))(-44) assuming q is positive. q*(8756/195) Simplify (t/((tt*(1/3))/tt))/((t/(t/(t/t*(-1/6))))/t)t*(-1/4)t3 assuming t is positive. t(9/4) Simplify (n/n(-1))/(n/((n/n(-2/53))/nn)) assuming n is positive. n(108/53) Simplify (u5/uu(1/4))/(u0uu(-5/2)/u) assuming u is positive. u(27/4) Simplify ((ff(2/3))(-3/14))(-4/21) assuming f is positive. f(10/147) Simplify (z4/(zz(-1/10)/z))(-20/9) assuming z is positive. z(-82/9) Simplify (m(-1/7))(-3/7) assuming m is positive. m(3/49) Simplif	{ "pile_set_name": "DM Mathematics" }
30d2 + 6422d*2 + 6429d*2. 11d*2 Collect the terms in -396b + 104b + 60b + 4 + 181b + 111b - 3. 60b + 1 Collect the terms in -89 + 89 + 877407r + 31516457r. 32393864r Collect the terms in 11255 + 11856 + 3m - 4m + 0m - 23114. -m - 3 Collect the terms in 2k*2 + 8k*2 - 8k2 - k3 + 0k3 - 1802 - 5k. -k*3 + 2k*2 - 5k - 1802 Collect the terms in 3 - 4 - 15074731f + 2. -15074731f + 1 Collect the terms in 185 - 3470f - 18 - 2982f. -6452f + 167 Collect the terms in 11p*2 + 23 + 587p*2 + 24 - 47. 598p*2 Collect the terms in 70915y + 181y2 - 597y*2 - 70915y. -416y2 Collect the terms in 3446 + 3448 - 12o*3 + 3431 + 3449 - 13774. -12o*3 Collect the terms in 0 + 4v*2 - 91152v + 0 + 91156v. 4v*2 + 4v Collect the terms in -30462k3 + 110725k*3 + 38576k*3. 118839k*3 Collect the terms in -8 + 8 + 15711x*2 + 15716x*2 - 68x + 68x - 31431x*2. -4x*2 Collect the terms in -1287u*3 + 174u*3 + 740u*3 + 165u*3 + 180u*3. -28u*3 Collect the terms in -108 - 14a + 311 - 104 + 14a - 103 - 161a*2. -161a*2 - 4 Collect the terms in -157486i*2 + 690 - 690 + 156465i*2. -1021i*2 Collect the terms in -57452a*2 + 28723a*2 + 28731a*2 - 269. 2a*2 - 269 Collect the terms in -167 + 10p*2 - 122 - 14p*2 + 285. -4p*2 - 4 Collect the terms in -18u + 86u2 - 24u - 30u + 16u + 56u. 86u*2 Collect the terms in -437a + 1982a - 453a - 657a + 8a*3 - 435a. 8a3 Collect the terms in 24694y*3 + 2146y*3 + 2359y*3 + 851y*3. 30050y*3 Collect the terms in 232i + 248i3 - 681i*3 - 231i - 1817i3. -2250i*3 + i Collect the terms in -1396516 + z + 228636 + 5z - 2z2. -2z*2 + 6z - 1167880 Collect the terms in -363c - 792c + 1160c - 3. 5c - 3 Collect the terms in -13t3 - 21840985t + 10920495t + 10920490t. -13t3 Collect the terms in -2 + 144v*2 + 79v*3 + 11v*2 - 16. 79v*3 + 155v*2 - 18 Collect the terms in -25620o + 12861o + 12752o. -7o Collect the terms in -681x - 678x - 679x - 743x + 2786x. 5x Collect the terms in 271 - 24063t - 271. -24063t Collect the terms in 208h*2 - 55h*2 - 53h*2 - 36h*2 - 24h*2. 40h*2 Collect the terms in 6852438 - 6852438 + 4l*2. 4l*2 Collect the terms in 821s + 1111s - 970s - 68 - 68 - 965s. -3s - 136 Collect the terms in 56131j2 - 18680j*2 - 18730j*2 - 18721j*2 + 5j*3. 5j*3 Collect the terms in 65 + 85o*2 + 16o*2 - o + 21o*2 - 65. 122o*2 - o Collect the terms in 73007j*3 + 9 + 173j*3 - 6 - 3. 73180j*3 Collect the terms in 38869g*3 - 116839g*3 + 38799g*3 + 38941g*3. -230g*3 Collect the terms in 2c*2 - 558 - 4c - 2070 - c2 + 427. c2 - 4c - 2201 Collect the terms in 536746l - 536746l + 44l*2. 44l*2 Collect the terms in 11s*2 - 6764944s + 20294878s - 6764995s - 6764939s. 11s2 Collect the terms in -b2 - 7b2 - 10b*2 + 25b*2 - 3b*2 + 28477b. 4b2 + 28477b Collect the terms in -11846u - 33073u*2 + 11846u. -33073u2 Collect the terms in -4654c*2 + 6666c*2 + 2 + 7375c*2. 9387c*2 + 2 Collect the terms in 168q*2 + 165q*2 + 166q*2 + 164q*2 - 878q*2 + 211q*2. -4q*2 Collect the terms in 541 - 168 + 546 - 4u*2 + 5u2 - 919. u2 Collect the terms in 2236q2 - 3549q*2 + 1321q*2. 8q*2 Collect the terms in 17f + 17f - 37f + 3f2 - 5. 3f*2 - 3f - 5 Collect the terms in 17 + 2451192d - 17. 2451192d Collect the terms in -39k + 186k - 38k - 126 - 42k + 123 - 70k. -3k - 3 Collect the terms in -57z2 + 57z*2 + 730070z*3. 730070z*3 Collect the terms in -91h*2 - 439h + 210h - 41h*2 + 229h - 14h2. -146h*2 Collect the terms in -76523y*2 - 31543y*2 - 20964y*2 + 10335y*2. -118695y*2 Collect the terms in 495n*3 + 496n*3 + 632n*3. 1623n*3 Collect the terms in 1656371j + 722656j - 269567j. 2109460j Collect the terms in -1130g - 170g - 696g - 379g - 312g. -2687g Collect the terms in 8114j*2 - 16073j*2 + 8001j*2. 42j*2 Collect the terms in 266 - 7773d - 95 - 84 - 87. -7773d Collect the terms in -3 + 23c - 23c - 21c + 22. -21c + 19 Collect the terms in 838z - 19z2 - 2026z + 1156z + 8z*2 + 9z*2. -2z*2 - 32z Collect the terms in -4 + 2529w2 + 2162w*2 - 4690w2. w2 - 4 Collect the terms in t*2 + 7171341t3 - t2 - 2481854t3. 4689487t*3 Collect the terms in 17136s - 10667s - 11775s. -5306s Collect the terms in 3114d + 197337d + 202026d. 402477d Collect the terms in 2q - 186q2 - 3q - 11 + q - 499q2 + 688q*2. 3q*2 - 11 Collect the terms in 116u + 114u + 23u + 136u - 113u + 233u. 509u Collect the terms in 4652475v - 9306166v + 4653684v. -7v Collect the terms in 3488o + 294 + 3341o - 6828o. o + 294 Collect the terms in -16t*2 - 18769 + 9769 + 16t*2 + 9000 + 34t*3. 34t*3 Collect the terms in -929c*3 - 204855c - 646c3 + 204856c. -1575c3 + c Collect the terms in -3181s - s*2 - 3173s + 6347s. -s2 - 7s Collect the terms in 443x3 - 2x + 820x2 + 2x - 832x2. 443x*3 - 12x*2 Collect the terms in -92l*3 - 12l*2 - 102l*3 - 26l*3 + 14l*2. -220l*3 + 2l*2 Collect the terms in 552040t - 1103269t + 551228t - 16 + 16. -t Collect the terms in 116962s + 115849s - 232772s. 39s Collect the terms in 10t2 + 6799591t - 13598743t + 6799152t. 10t2 Collect the terms in 912835y*2 - 4 + 4 + 913206y*2 - 1826046y*2. -5y*2 Collect the terms in -81015314m + 162030636m - 81015315m. 7m Collect the terms in -4k + 3k + k - 488885k*2. -488885k*2 Collect the terms in 10q*2 + 9q*2 - 2q + 3069 - 20q2. -q2 - 2q + 3069 Collect the terms in 33r3 - 11r - 35r + 9r*3 - 40r + 88r. 42r*3 + 2r Collect the terms in 4q3 - 579q + 680q - 6q*3 + 7q*3 - 101q. 5q3 Collect the terms in 237r*2 - 386r*2 - 37r - 86r + 149r2 + r3. r*3 - 123r Collect the terms in 17 - 37057t + 5 - 36 + 14. -37057t Collect the terms in 454045g2 + 2g*3 - 2 + 142152g*2 + 0 - 162263g*2. 2g*3 + 433934g*2 - 2 Collect the terms in -106w*3 - 2088703 + 2088703. -106w*3 Collect the terms in -150 + 370 - 8 + 737 + 1078 + 2q. 2q + 2027 Collect the terms in 2l + 0l + 176585718 - 176585706. 2l + 12 Collect the terms in -444938 + 444938 + 283j - 90j. 193j Collect the terms in -10 - 16z*3 + 17z*3 - 13z*2 + 123z*2 - 12z - 6. z*3 + 110z*2 - 12z - 16 Collect the terms in 7z2 + 58198 - 3z - 3z - z2 - 58205 + 6z. 6z2 - 7 Collect the terms in 34 + 26 - 10808r - 60. -10808r Collect the terms in 130c*2 + 20c - 59c2 + 5 - 70c2. c2 + 20c + 5 Collect the terms in 1323q*3 + 1156q*3 - 4330q*3 + 1526q*3. -325q*3 Collect the terms in 23383y - 663 - 11689y - 11693y + 2y2 - 99. 2y*2 + y - 762 Collect the terms in 4w*3 + 1076w - 10w3 - 346 - 1072w. -6w3 + 4w - 346 Collect the terms in -i*2 + 3079i + 3092i + 2599 - 6163i. -i*2 + 8i + 2599 Collect the terms in -56 + 35 - 208 - 4m2 + 8m. -4m2 + 8m - 229 Collect the terms in -237 + 29w - 57w + 25w + 456 - 228. -3w - 9 Collect the terms in -56731w + 113594w - 56863w - 8w*3. -8w*3 Collect the terms in 17850 + 301d - 17850 - 76d. 225d Collect the terms in -996 - 18u3 + 57u*3 + 1991 - 33u*3 - 995. 6u*3 Collect the terms in 80165 - 36347 + v - 43818 + 4v. 5v Collect the terms in -4o + 536829o3 + 5o - 9o + 6o. 536829o3 - 2o Collect the terms in 3 + 5x3 - 6 + x3 + 2 + 2374x*2. 6x*3 + 2374x*2 - 1 Collect the terms in -2386h + 6947h + 3 + 2 - 2173h - 2396h. -8h + 5 Collect the terms in -5417g + 39589g + 3088g + 16355g - 1493g. 52122g Collect the terms in -1420m3 - 67m*2 + 128m*2 + 454m*3 - 61m*2 + 494m*3 + 478m*3. 6m*3 Collect the terms in -229558h*2 - 9h*3 - 229953h*2 + 459511h*2. -9h*3 Collect the terms in p - 21172 - 21877 + 43025. p - 24 Collect the terms in 0c + 491c3 - 4c*2 + 0c - 500c3 + 4c*2. -9c3 Collect the terms in -x3 - 4x + 352314649852x*2 - 352314649852x2. -x3 - 4x Collect the terms in -366408o + 2 - 37460o - 2. -403868o Collect the terms in -81 - 14*x + 416 -	{ "pile_set_name": "DM Mathematics" }
2, -23 = 5d - 2l for d. -5 Let k = -29 - -26. Let m be 1(2/k)/1-3. Solve 0 = 3f - o - 13, -mo = 2f - 4o - 10 for f. 4 Let l(g) = -g*3 + 5g*2 + 17g - 4. Let u(k) = -k - 7. Let h be u(-14). Let b be l(h). Solve x - b = 4c, -14 = 4c - 2x + 8 for c. -3 Suppose -37 = -3o + p + 9, -3p = 3o - 30. Solve 3r + 2v = o, -v - 10 - 5 = -4r for r. 4 Let g be 1 - (-14 - (0 - 0)). Let r be 28/(-6)(-45)/(-30) - -7. Solve r = w - c - 5, 4w - g = c - 4 for w. 2 Let s(u) = 2u - 7. Let j be s(5). Let b = 11 - -26. Suppose -4n = -b + 21. Solve -jk = -2p + 21, -p + 0p - 17 = nk for p. 3 Let g(s) = -s2 - 7s + 4. Let n be g(0). Solve 6h - 4h = 3p + 5, 5h - np - 16 = 0 for h. 4 Let z be ((-20)/(-4) - 9/2)10. Solve 2k - 2t + 25 = -7t, 0 = -5k - zt - 25 for k. 0 Let b be ((-56)/(-16) - 0)/((-1)/6). Let p be b/140-5 - (-2)/8. Solve -n + p = -3d - 2n, 5n = 3d - 23 for d. 1 Let m be (-15)/(-8) + 18/144. Suppose 3o = -0o + 12, -3o = mi - 16. Suppose -5d + 3 = -i. Solve j = -t - d, -5t + 0t - 3j = 7 for t. -2 Let v = -19 - -22. Suppose -vw + 9 = 3. Let j be w(5 + 0 + -4). Solve 3b = 4b - jc - 15, 5c + 25 = 0 for b. 5 Let g be 9(2 + 0)/2. Suppose 6j = gj - 9. Suppose jy + r - 10 = -r, 2y + 3r = 0. Solve 2b + 10 = -w, yw = b + 2w - 4 for b. -4 Let b = -20 + 19. Suppose 0 = -z + 16 - 15. Let y be b/2(z + -1). Solve -3x - 25 = 7j - 2j, y = x + 5j + 15 for x. -5 Let o(i) = 4i - 4. Let b be o(5). Suppose 0 - 14 = -3l - k, 5l - 2k = b. Solve -y - 7 = -3v, lv = -4y - 0 + 4 for y. -1 Suppose -u + 8 = 3a, 0 = 40a - 41a + 5u - 8. Solve 0 = -2x + 3q - 25, -3x - 10 = -ax - q for x. -5 Suppose 0 = -3j + 20 - 8. Let z be (-7)/(-14)(j - -2). Solve -l = 2y - z - 6, 5l - 4y - 3 = 0 for l. 3 Let b = 3 + -2. Suppose -r + b = -3. Suppose -rt + 0o - 2o + 38 = 0, 0 = t - o - 14. Solve j = 2f - 5, -4f = -4j - 27 + t for j. -3 Suppose -12u = -8u + l - 40, 3u + 5l = 47. Solve 0 = -3k - 3o - u, -4k - 3 = o - 0o for k. 0 Suppose 10f + 13f = 92. Solve -4j + 3l + 13 = 0, fl = 1 - 13 for j. 1 Let u = 178 + -173. Solve 0v - uv = -4p, -3v = -p for p. 0 Let s be 0/(2/(1/((-1)/2))). Suppose sw = 5w - 20. Solve wb + 0 + 2 = 2r, -4b - 20 = 4r for r. -3 Suppose -6 = -15i + 24. Solve -2o = 6, -5k + o - io - 28 = 0 for k. -5 Suppose -2w + 18 = 51v - 47v, 0 = 2v - 4w + 16. Solve -4s - 20 = 4f, 23 + v = -5s + 3f for s. -5 Suppose -21c = -20c. Suppose c = 4s - 21 - 79. Let w = s - 21. Solve -2l - wv + 2 = 0, 5l + 2v + 2 = -v for l. -1 Suppose -12v + 7v = -140. Let o = -4 + v. Solve -r + 0p + 24 = 5p, -2p = 4r - o for r. 4 Let j = -77 + 77. Suppose 5f - 17 = 2n, -f - 2n - 1 + 2 = j. Solve -3w + 4t + 3 = 0, 0w - t = fw - 3 for w. 1 Let i = 0 + 2. Let w = -10 + 43. Suppose -w = -j - 2v, 5j - 7j + v = -46. Solve -3n - in = -j, 3z + 2n = 19 for z. 3 Let v = 13 + -7. Let i be -2 + 2 + ((-40)/5)/(-4). Suppose -5h = -4n - v, 5 = ih + 3n - 2n. Solve -3x + 6 = -3p, 0 = hp - 0p - 4x + 14 for p. 3 Let u be -96(-3 + 14/4). Let h = 78 + u. Let r be (3 - 1)15/6. Solve -5z = -rj - h, -5z = -2j + 1 - 25 for j. -2 Suppose -7m - m - 232 = 0. Let z = m - -32. Suppose -zw + 14 = 2c, 0 = -4w - 3c + 9 + 10. Solve 5 + 3 = -4l - 2y, -wl + 4y - 20 = 0 for l. -3 Let v = -18 - -23. Suppose vj = -2y + 10 + 4, j - y = 0. Solve 3m + k + 9 = -m, m - jk = 0 for m. -2 Suppose -26o = -13o - 364. Let d be (8/o)/((-4)/(-28)1). Solve k - 5y + 17 = 2k, 5 = -dk + 3y for k. 2 Suppose 4t + 4o = -8, 5o = 5t + o - 35. Let n be 4/(-3)15/10. Let s be (3 + n)7 + -3. Solve 3p + 2c = p - 2, sp = tc - 32 for p. -5 Let p = 348 - 344. Solve -3j = -4h - 2j + 20, -20 = -ph - 3j for h. 5 Suppose -34 = -113m + 111m - 4q, 5q = 4m + 23. Suppose -8 = o - 3o. Solve 0n - mh + 3 = 3n, -h = on - 7 for n. 2 Let l(g) = g*2 - 2g - 1. Suppose 2i = -5f - 55, -2i - 3f - 38 = 7. Let z be 9/i(2 - 7). Let j be l(z). Solve jh + 3h + 3c = 14, 0 = -5c + 15 for h. 1 Let w = 26 + -19. Suppose -7z + 30 = 9. Solve -1 = l + m, -zl = -m - 2 - w for l. 2 Let z = -28 - -53. Solve -h + z = -5g - 5h, g - h - 4 = 0 for g. -1 Suppose 3k - 12 = -3. Let d = -26 - -33. Suppose -5c = -4o + d, -3o + 4 = -c - 4c. Solve kz = -or + 10 - 28, 19 = -3z - 4r for z. -5 Let i(j) = j*3 + 8j*2 + 17j + 29. Let l be i(-4). Solve 3t + 20 = -4q, -l = 4q - 4t - 5 for q. -5 Let m be (5/(-2))/(5/(-10)). Suppose -24 - 1 = -mn. Solve -x + q - 4 = 0, 13 = -4x + 2q - n for x. -5 Let n be 1975/75 - (-2)/3. Suppose 0 = -14s + n + 1. Solve 3 = 2z + sx + x, -5z - 5x + 5 = 0 for z. 0 Let j(x) = -9x + 3. Let p be j(2). Let a = p - -10. Let k be (-117)/(-45) - 2/a. Solve 2t - m + 2 = 7, -5t + km = -10 for t. 5 Let p(t) = t + 5. Suppose 3j - 18 = 6j. Let v be p(j). Let m be (7 + -10)/(1v). Solve m = 2w - 4z + 1, -3z + 26 = 4w for w. 5 Let n(m) = m2 + 1. Let x(p) = 5p*2 - 8p + 6. Let g(t) = 4n(t) - x(t). Let w be g(6). Let l = -9 + w. Solve 28 = -4o + 2r, -5o - 3r + l = 14 for o. -5 Let m(c) = -c2 - 3c - 1. Let t be m(3). Let k = t - -13. Let h be k/(-8) - (-34)/8. Solve -4a = 3n + 8, hn + 3a - 2a + 2 = 0 for n. 0 Let s(k) = -2k + 8. Let b = 19 - 19. Let d be s(b). Let l be (-1)/2 + 20/d. Solve -f - m - 15 = 3m, -m - l = 2f for f. 1 Suppose 53 - 8 = 9g. Let x(j) = 3j - 3. Let l be x(2). Solve 0 = 3f + 6, -p - gf = -lf - 1 for p. 5 Let x be 1188/252 + 2/284. Solve -xg - b - 4 = -3g, 3b + 5 = g for g. -1 Let n(k) = -5k2 + k3 + 2k2 - k3 + k3 + k. Let t be n(3). Suppose -19 = -3o - 4. Solve -tw - 15 = oj, 2w - 3w + 5j = -15 for w. 0 Suppose 2r + 6 = 4g - 2, -20 = 2g + 5r. Solve g = -4o + 3p - 14, 2o - 3p = -0o - 10 for o. -2 Suppose 5h = -13 - 32. Let z = h + 7. Let w = z + 7. Solve 0 = wx + 20, 4x + x + 32 = -4u for u. -3 Suppose 0 = -251u + 250u + 3. Solve c = 2l + 4 + 2, 9 = 5c - ul for c. 0 Let t(y) = -2y - 8. Let s be t(-5). Suppose -b = -s - 0. Suppose 2 = bk - 8. Solve -a - kp = 0, -5p = -2a - 0a for a. 0 Suppose -26v + 5 = x - 23v, 0 = -4x + 3v + 5. Solve 3i - 2z + 13 = -0z, 3i + xz = 7 for i. -1 Let t = -502 + 505. Solve -24 - 8 = 4m - ta, 45 = -5m + 5a for m. -5 Suppose -25 = -0y - 5y. Let b = 22 + 32. Let i = 58 - b. Solve 4l = -ir + yr + 20, 5r = -2l - 12 for r. -4 Suppose -3s - s = -6s. Solve -3t + 4x + sx - 6 = 0, -3x + 5 = -2t for t. 2 Suppose 3w = 3i - 6, -3i - 4w = i + 8. Solve 20 = -4k + d, 0 = -k - d - id - 5 for k. -5 Let u = 61 - 49. Solve u = -0b - 4b - 3w, 0 = 4b + 4w + 16 for b. 0 Let l(h) be the first derivative of h4 - 4h*3/3 + 5h*2/2 - 4h + 14. Let x be l(2). Solve -4u = i - 22, 2i - 7 = -5u + x for i. 2 Let w = -562 - -577. Solve 4c - 11 = y + c, 5y = c + w for y. 4 Let s(l) = l + 9. Let g be s(-6). Suppose -g = -3f + 2f. Suppose 12 = x + fx. Solve -25 = -2c - c - 5p, -3c - xp + 15 = 0 for c. 0 Suppose 2f + 24 = 5f. Suppose -17n + 12n = -5m - 10, 0 = 3m - 4n + 11. Solve -p = -3y - y, mp = 4y + f for y. 1 Let j be (-58)/(-5) + 2/5. Let h = 43 - 25. Let t = h - j. Solve u - 4i = 3u - 8, 0 = 5u + 3i - t for u. 0 Let z(w) = w*2 + 9w - 6. Let n be z(-10). Solve -3r + 44 - 15 = -4p, -4p - nr = 8 for p. -5 Suppose -9u - 1813 = -1840. Solve -uo - 10 = 2d, -2o - 3 - 8 = -3d for o. -4 Suppose -69 = 3j - 66, 4k - j - 29 = 0. Solve a + 5d = -k, 5a = a + 5d - 3 for a. -2 Suppose -4 = -5j + 11. Suppose -q = -5a + 29, 7q = ja + 8q - 11. Solve 0t + at + 4v = -35, -5v = -4t + 13 for t. -3 Let l = 26 + -23. Suppose 4y - lx = 2x + 1, -5y + 5 = -5x. Solve -2z - 6 = 2c - 4, -2z + y = -c for c. -2 Suppose 0 = -2h + 7h - 60. Let o be h/(-6) - (1 + -9). Let r be 1/(o/5 - 1). Solve rw = v - 19, 0 = -w - 3v + 6v - 15 for w. -3 Let s be (11 - 11)/13 - 0. Solve -4f - i + 7 = s, -12f = -10f - 4i - 8 for f. 2 Let w be 2/(-3) - (-2)/3. Suppose 5c = m, 5c + 5m = -wm. Solve 0 = 4n + 5q - 7, 4n + cq = -q + 11 for n. 3 Let d be 12/16-26(-12)/9. Let n be d - (-3)/(0 + 3). Solve 4l + n = 5w, 9w - 5l = 4w + 30 for w. 3 Let l(n) = n*3 + 19n**2 - n - 16. Let b be l(-19). Suppose	{ "pile_set_name": "DM Mathematics" }
2 + rg + 0 + 0g + 0 wrt g. 4 Let t(h) be the first derivative of -39/2h2 + 0h + 29 - 11/4h4 + h3. What is the second derivative of t(c) wrt c? -66c + 6 Suppose -7l - 4 = -214. Differentiate -91y*3 + ly*3 - 94 + 20 wrt y. -183y*2 Find the third derivative of -46 + 56b*2 + 54b*2 + 711b5 + b3 + 49b2 - 30 - 162b*2 - 3b wrt b. 42660b2 + 6 Suppose -5r = -15 + 10. Suppose 0 = 2p, b - 1 = p + r. What is the derivative of 3lb + 15 + l2 + 3l2 wrt l? 14l Find the second derivative of 2957y2 + 407y - 2673y - 2231y*2 + 26y + 3373y2 wrt y. 8198 What is the second derivative of 160331r + 91r4 - 163671r - 1321r4 wrt r? -14760r*2 Let u(p) = -610p2 + 753. Let h(k) = -k2 + 2. Let t(f) = 12h(f) + 3u(f). Find the first derivative of t(o) wrt o. -3684o Let p be 8 - ((-20)/5 + 10). Let t = -176 + 645. What is the second derivative of 469 + 17i*2 - t - pi wrt i? 34 Let g(d) = 4d + 16. Let o be g(-3). Let u(b) be the first derivative of 4 - o + b5 + 2b*2 - 3. Find the second derivative of u(q) wrt q. 60q*2 Let l = -350 - -477. Differentiate -42 + 66u*2 - lu*2 + 62u*2 - 4u*3 wrt u. -12u*2 + 2u Let s(w) be the second derivative of -223w3/6 - 1792w*2 - 3418w. What is the derivative of s(n) wrt n? -223 Find the first derivative of 3070 - 72q + 263q - 525q - 159 - 1065q wrt q. -1399 Let d = -103 - -196. Find the second derivative of 13 - 2y - 2y + 0y - dy*3 - 2y*4 - 9y*3 wrt y. -24y*2 - 612y Let y(m) be the second derivative of m*6/15 - 29m*4/12 + 130m*3/3 + 293m + 1. Find the second derivative of y(f) wrt f. 24f2 - 58 Let o(x) = x4 + x2 + 8x - 1. Let r(c) = -6685c4 - 2c*2 - 16c - 240. Let h(s) = -2o(s) - r(s). What is the derivative of h(y) wrt y? 26732y*3 Let x(r) be the third derivative of 17/105r*7 - 1/120r*6 + 0 - 1/12r*4 + 0r*5 + 0r + 3r2 - 19/6r*3. What is the second derivative of x(z) wrt z? 408z*2 - 6z Let d(a) = -27a + 20a - 12 + 15a. Let n be d(5). Find the second derivative of nq*4 + 15q + 27q4 - 51q*4 wrt q. 48q*2 Let v(b) be the first derivative of 43b*7/14 + 79b*4/12 + 21b - 102. Let x(y) be the first derivative of v(y). Find the third derivative of x(u) wrt u. 7740u2 Let v(y) be the first derivative of -7y - 16 - 5/3y3 + 7y*2. What is the second derivative of v(d) wrt d? -10 Suppose 6 = -3q - 0. Let n be (-9)/q - 66/(-44). Find the third derivative of -17b2 + 47b*2 - 24b*2 - 14b*n wrt b. -1680b*3 Let m(k) be the third derivative of 1/20k*6 - 11k*2 + 0k + 0 - 1/105k7 + 0k*4 - 37/2k*3 + 0k*5. What is the first derivative of m(x) wrt x? -8x*3 + 18x*2 Let l(f) be the first derivative of -417f*7/7 - 6f5/5 - f4/4 + 1035f3 + 2845. Find the third derivative of l(y) wrt y. -50040y*3 - 144y - 6 Let i(w) be the third derivative of -w*8/112 - 57w*6/8 - 23w*5/3 - 5w*4/12 - 2808w*2 + 1. What is the third derivative of i(f) wrt f? -180f*2 - 5130 Find the third derivative of -102z*4 + 113z*2 - 176z*4 + 41z*4 - 2z*5 + 251z*2 wrt z. -120z*2 - 5688z Let b be (6 - 1) + (23 - 25). Find the second derivative of -1 - 4 - 7 - 109ab + 12 + 221a wrt a. -654a Let b(v) be the third derivative of -v8/336 + 107v7/210 + v6/120 + 19v4/3 + v3/2 + 14v*2 - 12v + 1. What is the second derivative of b(z) wrt z? -20z3 + 1284z*2 + 6z What is the second derivative of -16r + 186 - 191 - 19 - 1482r*2 wrt r? -2964 Let x(q) be the third derivative of -261q*5/20 + 227q*3 - 932q*2. What is the derivative of x(s) wrt s? -1566s Let n = -8130 + 8130. Let m(f) be the second derivative of -2/3f3 + 11/12f*4 + nf*2 + 0 - f. Find the second derivative of m(t) wrt t. 22 Find the first derivative of 743m*2 - 1957m*2 - 2205 + 1321m*2 + 1238m*2 wrt m. 2690m Let u be 0/((-2)/(-4) - 2/(-4)). Suppose 5o = 5, 5z - 3o + 5o - 12 = u. What is the first derivative of 10 + 7 + 11 + 6mz + 9m*2 wrt m? 30m Let n(w) be the first derivative of -17w7/420 - 33w*4/8 + 56w*3/3 + 89. Let t(j) be the third derivative of n(j). Differentiate t(y) with respect to y. -102y*2 Suppose 34v - 29v = 95. Suppose 13 = 2f - v. Differentiate 7 + f - u*2 + 12u*2 - 4 wrt u. 22u Let r(l) = 4l3 + 94l + 252. Suppose 2 = -41g + 43. Let j(s) = -s3 - s - 1. Let c(q) = gr(q) + 3j(q). Differentiate c(h) with respect to h. 3h2 + 91 Let q(b) be the second derivative of b4/4 + b3/6 + b2/2 - 11b. Let r be q(-1). What is the derivative of 20u*r + 3 - 20u*3 + 8u*4 wrt u? 32u*3 Let z(u) be the third derivative of 0u - 5 + 25/42u7 + 0u*3 + 0u*6 + 23u*2 + 4/3u*5 - 1/12u*4. What is the third derivative of z(v) wrt v? 3000v Find the third derivative of -4 - 222n + 4 + 2n*2 + 5767n*4 - 53n + 5 - 10 wrt n. 138408n Let k(o) = 2o - 18. Let c be k(12). Suppose -42 = -5s - w, 2s = 40w - 42w + 20. Find the second derivative of -cb + 0b + 37b3 - 11b*3 + sb wrt b. 156b Find the third derivative of 105x - 75x - 3 + 4496x*3 - 50x + 10x2 + 2x*2 wrt x. 26976 Let c(q) be the third derivative of 0 + 0q + q*2 + 91/24q*4 + 14/3q*3. What is the first derivative of c(j) wrt j? 91 Suppose 3h + 2s = 7s + 5, 2s = h. Let a(k) = k2 - 13k + 32. Let d be a(h). What is the second derivative of 28x + 2x*2 + 7x*d + 11x*2 wrt x? 40 Let t be (-46)/506 - 1718/(-22). What is the third derivative of 2y*3 + 50y*2 + ty*2 - 96y*2 wrt y? 12 Suppose 2b - 2 = 0, 2b - 1 = -3f + b. Suppose 0 = -fd + 2d - 8. Find the second derivative of 7h5 + 11h - 6hd + 16h*5 + 6h*4 wrt h. 460h3 Find the first derivative of -345 + 760 + a2 + a*2 + 865 + 4a*2 wrt a. 12a Let f(r) be the second derivative of 0r5 - 29/28r*8 + 0r*3 - 1/2r*2 + r - 3/2r*4 + 0r*6 - 19 + 0r*7. What is the third derivative of f(v) wrt v? -6960v*3 Let s(t) be the second derivative of -777t*3/2 - 1550t*2 - 11t - 4. Differentiate s(o) with respect to o. -2331 Let l(d) be the first derivative of -d*2 + 108 - d + 40/3d*3. Find the second derivative of l(u) wrt u. 80 What is the third derivative of -337i*4 - 6895i*2 - 10107i*3 + 10103i*3 - 164i*4 wrt i? -12024i - 24 Let l = 16 + -23. Let o(x) = x*2 + 6x - 5. Let b be o(l). Find the first derivative of -bd + d - 2 + d - 7d*3 wrt d. -21d*2 Let h(y) be the second derivative of -11y*5/10 + 19y*4/6 + 896y3 + y2 - 1455y. Find the second derivative of h(w) wrt w. -132w + 76 Let u be ((-32)/6 + 6)6. Find the third derivative of -99j*2 + 15j4 + ju - 6j4 wrt j. 240j What is the third derivative of -6m2 + 294m*5 + 9 + 5m*2 - 8812m*5 - 3m*2 - 149 wrt m? -511080m*2 Let g(d) = 47585d*2 - 28185d + 50. Let s(m) = -11897m2 + 7046m - 12. Let f(x) = 6g(x) + 25s(x). Find the second derivative of f(j) wrt j. -23830 Let h(a) = -384a3 - 429a*2 + 3a. Let j(t) = 389t3 + 429t*2 - 4t. Let n(y) = -4h(y) - 3j(y). What is the third derivative of n(l) wrt l? 2214 Suppose 4i + 7r + 162 = 2r, -5r + 180 = -5i. Let f = i - -40. What is the first derivative of 7b*2 - 3 + 6b*f - 13b*2 + 8b*3 wrt b? 24b*2 Suppose l = -l + 32. What is the second derivative of -3u*3 + lu*3 + 11u - 3u2 - 7u*3 - 8u*3 wrt u? -12u - 6 Let i(y) = y*2 + 21y + 20. Let k be i(-20). Suppose 4a - 52 + 16 = k. Differentiate -6g*3 - 3g*3 - 21g*4 + 38 + ag*3 with respect to g. -84g*3 What is the third derivative of -62z + 0z4 - 16z*2 + 60z + 7046z5 + 0z*4 - 5 + 9z*2 wrt z? 422760z*2 Let l(s) be the third derivative of -6s - 3/20s5 + 2s*2 + 0 + 0s*3 + 4/105s*7 + 0s*6 + 0s*4. Find the third derivative of l(h) wrt h. 192h Let s(k) be the second derivative of -1/12k4 - 97/42k*7 + 1 - 79k + 0k6 + 0k*5 + 0k*2 + 29/6k*3. What is the third derivative of s(w) wrt w? -5820w*2 Let i(a) be the second derivative of 0a*2 - 21/10a*6 + a + 0a*4 + 103 + 0a*5 + 37/2a*3. What is the second derivative of i(o) wrt o? -756o*2 Let t(x) = -5x + 130. Let z be t(23). Find the second derivative of n - 86 + z - 7n2 - 31 - 2n**3 + 15 wrt n. -1	{ "pile_set_name": "DM Mathematics" }
60a + 58 Let p(r) be the third derivative of 11r4/24 - r2. Let f(b) be the third derivative of -b*4/6 - 598b*2 - 8b. Give p(f(w)). -44w Let t(m) = -148m + 10m2 + 13m*2 + 148m. Let s(a) = 23a2 - 3a - 9. Let f(l) = 15l2 - 2l - 6. Let i(y) = 3f(y) - 2s(y). Determine t(i(x)). 23x4 Let z(r) = 1141 - 1141 - 3r. Suppose 6b + 42 = 13b. Let m(p) = 3p2 + 5p*2 - bp*2. Calculate m(z(f)). 18f*2 Let f(u) be the second derivative of -337u*3/3 + 23u - 16. Let v(h) = 7h2. Determine v(f(j)). 3179932j*2 Let i(o) = 152o - 7. Let y(v) = 87v - 4. Let z(n) = -4i(n) + 7y(n). Let h(g) = 832g*2. Give z(h(k)). 832k*2 Let g(q) be the third derivative of 1165q*4/24 - 412q*2. Let f(w) = 5w*2. Calculate g(f(h)). 5825h*2 Let o(c) = 1115c. Let n(j) = -31507j - 2. What is o(n(b))? -35130305b - 2230 Let q be (-3 - (-8 + 2))4. Suppose l = -ql + 78. Let b(g) = 4 + lg - 4 - 8g. Let r(j) = -6j. Give b(r(s)). 12s Let g(x) = -x*2. Let w(l) = -505l + 135l2 - 507l + 1012l - 650l*2. Calculate w(g(c)). -515c*4 Let f(b) = 3b*2 - 6. Let n(d) = -11d*2 - 1699d - d*2 + 1699d - 13d2. Determine f(n(o)). 1875o*4 - 6 Let o(t) = 5940818t. Let c(w) = -4w2. What is o(c(p))? -23763272p*2 Let b(t) = 383 - 383 - 35t*2. Let n(a) = 2a*3 - 3a*2 + 2a - 2. Let g be n(2). Let i(f) = f - gf + 3f. Calculate i(b(d)). 70d2 Suppose 3x - 2b = 7 + 11, 0 = -5x + 3b + 30. Let h(g) = 2g + 13 - 10 + x + 14. Let c(w) = w*2. Determine h(c(d)). 2d*2 + 23 Let w(c) = -9182c*2 - 1636. Let j(x) = 3x. What is j(w(v))? -27546v2 - 4908 Let d(t) = -7t. Let f(m) = 90m. Let k(r) = 27d(r) + f(r). Let c(z) = 5z - 2z + 3z - 3z. Calculate k(c(y)). -297y Let v(i) = 1356483768i. Let s(j) = 2j. Give s(v(y)). 2712967536y Let z(c) = -4c + 6. Let s(f) = 20f - 33. Let k(j) = 3s(j) + 16z(j). Let g(a) = 2a2 - 38a. Determine g(k(q)). 32q2 + 200q + 132 Let f = -25 + 27. Let z(a) = a. Let s(d) = -10d. Let k(x) = fs(x) + 18z(x). Let u(y) be the second derivative of -y3 + 2y. What is k(u(g))? 12g Let n(m) = 3624925m. Let l(z) = 5z. Calculate n(l(u)). 18124625u Let j(c) = -8c2 - 10c + 7. Let y(w) = 9w2 + 6w - 4. Let u(z) = 4j(z) + 7y(z). Let t(q) = 2q. Determine u(t(n)). 124n*2 + 4n Let p(c) be the second derivative of c*5/30 + 13c*2 - 68c. Let z(x) be the first derivative of p(x). Let f(g) = 5g. Determine f(z(d)). 10d2 Let y(b) be the third derivative of b5/60 + 67b3/6 - 5b*2 - 8. Let g(t) be the first derivative of y(t). Let p(c) = 30c*2. What is p(g(j))? 120j*2 Let t(q) = 2q + 2095. Let r(w) = 3983w. What is r(t(c))? 7966c + 8344385 Let u(r) be the second derivative of r5/3 - r4/8 + 117r2/2 + 67r + 2. Let p(c) be the first derivative of u(c). Let v(x) = 3x2. Determine v(p(g)). 1200g*4 - 360g*3 + 27g*2 Let w(t) = -25689t. Let i(r) = -4798r - 2. Give i(w(k)). 123255822k - 2 Let i(t) = 2t2. Let n(a) = -81a + 36229a2 - 36221a*2 - 12a. Calculate n(i(b)). 32b4 - 186b*2 Let y(p) be the second derivative of -19p*4 - 108p + 15p4 + 9p*4. Let w(a) = 3a*2. What is w(y(s))? 10800s*4 Let q(k) = -4k*2. Let z(d) = -3 - 50d - 8 + 171d + 123d. Let t(f) = 49f - 2. Let b(r) = 11t(r) - 2z(r). Calculate q(b(n)). -10404n*2 Let m(u) = -7u. Let z(b) be the third derivative of -b*5/15 + 8b*3 + 72b*2. Let i(t) be the first derivative of z(t). Give i(m(j)). 56j Let m(j) be the first derivative of 7j3/6 - 55j - 52. Let r(o) be the first derivative of m(o). Let q(g) = -g*2. Give q(r(s)). -49s*2 Let c(b) = -1703b - 6. Let q(x) = 20x2. Determine q(c(w)). 58004180w*2 + 408720w + 720 Let z(y) = 2y2. Let f(o) = -7742814o. Determine z(f(l)). 119902337277192l2 Let p(o) = -o - 1. Suppose -3v = -5j - 11, -5v + 8 + 17 = -5j. Let l(f) = 11 - 6 + vf + 0. Let q(z) = l(z) + 5p(z). Let r(m) = -33m. Give q(r(a)). -66a Let v(h) = 324 + 15h*2 - 47 - 272. Let o(r) = -5r + r + r + r. What is v(o(m))? 60m2 + 5 Let r(x) = -4650x - 37988. Let f(b) = -2b. Determine r(f(m)). 9300m - 37988 Let q(w) be the second derivative of 1/30w5 + 0w*3 + 0w*4 + 0 + 8w - w*2. Let i(u) be the first derivative of q(u). Let c(x) = -26x. What is c(i(y))? -52y2 Let m(x) be the first derivative of -7x*2 + 14x - 569. Let u(q) = -6q2. Determine u(m(y)). -1176y*2 + 2352y - 1176 Let z(t) = -156t - 26. Let y(f) = 6 + 5f + 35f + 4f - 5f. Let a(k) = 13y(k) + 3z(k). Let c(l) = 2l*2 - 2l*2 + 2l*2. Determine c(a(w)). 3042w*2 Let t(w) = -23w*2. Let o(c) be the third derivative of 0c*3 - 1/15c*5 + 0c - 106c2 + 0c*4 + 0. Calculate t(o(x)). -368x*4 Let g(k) = -2k. Let o(q) be the first derivative of -130q2 + 28 - 42 - 57 - 140 + 256q*2. What is g(o(f))? -504f Let a(t) = -20572t2 + 8065t. Let w(v) = 2v2. Give a(w(y)). -82288y*4 + 16130y*2 Let v(u) = -7556u. Let z(f) = -f + 64. Let h(j) = 4j - 224. Let k(w) = -2h(w) - 7z(w). Calculate k(v(x)). 7556x Let d(u) = 4u2 + 0u*2 - 3u*2. Let r(m) = -31m*2 + 4m - 16. Let b(o) = -101o2 + 13o - 52. Let l(w) = -4b(w) + 13r(w). What is d(l(f))? f*4 Let g(r) = -8r*2 + 5r*2 + 4r*2. Let d(u) be the second derivative of -10u*4/3 - 5u + 514. Calculate d(g(j)). -40j4 Let s(r) = 29r + 10. Let t(j) = 44j + 15. Let y(k) = 3s(k) - 2t(k). Let v(i) be the second derivative of i4/6 + 65i*2/2 + i. Calculate y(v(h)). -2h*2 - 65 Let y(h) = 87350h. Let m(i) = -281i. Give m(y(a)). -24545350a Let i(b) = -14448b. Let q(a) = 12327a. Give i(q(j)). -178100496j Let l(b) be the third derivative of b4/12 + 5b*2. Let q(c) = -137c - 9. What is q(l(m))? -274m - 9 Let m(j) = 237j*2 + 227j*2 - 465j*2. Let r(v) be the third derivative of 0 + 0v*3 - 1/20v*5 + 0v*4 + 0v + 2v2. Give r(m(i)). -3i*4 Let n(d) = -466811d*2. Let x(b) = -64b. Determine n(x(f)). -1912057856f2 Let b(t) = 16t2. Let l(p) be the third derivative of -p5/15 + 13p4/12 + 1779p*2. Give l(b(y)). -1024y*4 + 416y2 Let l(b) be the first derivative of b2 + 21. Let o(y) = 50y2 - 5y - 1. Let v(q) = 124q2 - 12q - 2. Let t(j) = -12o(j) + 5v(j). Give t(l(r)). 80r2 + 2 Let s be 97/19 + 20/(-190). Let k(d) = 17d + 12. Let m(h) = 17h + 10. Let n(x) = sk(x) - 6m(x). Let f(r) = 8r. Calculate n(f(g)). -136g Let y(r) be the first derivative of -68r*3/3 - 1854. Let f(c) = 7c*2. What is f(y(g))? 32368g*4 Let q = 25 + -25. Suppose -2g - 7g + 18 = q. Let u(b) = -73b*g + 37b*2 + 39b2. Let m(w) = -w2. Determine m(u(d)). -9d4 Let t(v) = -18758350v*2. Let f(w) = -2w. Determine t(f(b)). -75033400b2 Let h(k) = -2k - 4. Let r be 4/18 - 14/(-18). Let x(m) = 33 - m - 3 - 5 + 2 - 26. Let f(u) = rh(u) + 4x(u). Let z(q) = -9q. What is f(z(d))? 54d Let j be 8/3 + 6/(-9). Let f(o) = 2o3 - 2o*2 - 3o + 2. Let c be f(j). Let u(v) = 40v - 14 - c + 16. Let d(s) = s2. Calculate d(u(n)). 1600n*2 - 160n + 4 Let u(i) = -4i. Let t(x) = 18285x*2 - 10x. What is u(t(b))? -73140b2 + 40b Let f(x) = -82x. Let y(k) = -44k - 59k - 12 + 10 + 89k. Determine y(f(m)). 1148m - 2 Let n(g) = 7982g*2. Let i(v) = -1885v. Give n(i(l)). 28361841950l2 Let t(h) = h. Let n(q) = q + 1. Let l(v) = -236v - 240v - 244v + 708v + 1 - 5. Suppose 0 = 2k + 3k + 100. Let g(f) = kn(f) - 5l(f). Calculate g(t(j)). 40j Let k(u) = -14u2 + 248348u. Let a(x) = -4x2. What is k(a(s))? -224s*4 - 993392s*2 Let n(d) = 69d + 2. Let z(i) = 37i. Let q be (-130)/(-65)((-38)/(-4) - 1). Let b(a) = -105a. Let f(m) = qz(m) + 6b(m). Give f(n(h)). -69h - 2 Let o(t) = 10t2 + 2. Let v(f) = 2f2 - 18. Let b be (12/8)/(9/24). Let d(j) = -j2 + 8. Let s(q) = bv(q) + 9d(q). Determine s(o(n)). -100n4 - 40n*2 - 4 Let q(n) = 1109n*2 - 4710683 + 46n*2 + 928n*2 + 4710683. Let a(k) = -2k*2. Calculate q(a(h)). 8332h*4 Let g(v) = 2846v*2 - 5701v*2 + 2856v*2. Let f(m) = -4m*2 - 11m - 6. Let p(q) = 4q2 + 11q + 5. Let d(s) = -5f(s) - 6p(s). Give g(d(x)). 16x4 + 88x*3 + 121x*2 Let c(w) = 42w*2. Suppose 16 = n + 148b - 144b, -8 = n - 2b. Let x(f) be the first deri	{ "pile_set_name": "DM Mathematics" }
18 + 818p3 + 825p*3 - 1642p*3 as fp + q + op2 + tp*3 and give q. -18 Rearrange 5n + 3 - 3 + 2 - 2 - 2n + 2n - n + n + (-2 + 0 + 0)(-2 + 2 - n) - n + 1 - 1 - 40n + 2 + 11n - 19n to the form dn + l and give d. -42 Rearrange (0 + 0 - 2)(7t + 6t2 - t2 - 9t) to gt*2 + bt + r and give b. 4 Rearrange 73 + 70 + 77 - 1417r - 220 to u + dr and give d. -1417 Express -3r2 + 0r*2 + 2r*2 + (-60r - 93 + 93)(r - r - 2r) as or2 + vr + g and give g. 0 Rearrange -57i2 + 0 - 3 + 60i*2 - i - 2i*3 to fi*2 + d + vi + qi3 and give d. -3 Rearrange -955 - 938 + 1893 - 2t + 102t2 to the form wt + ht2 + o and give w. -2 Rearrange (0 + 1 - 7)(5 + 1 - 4)(2w + 3w - 4w)(-5w + 6w + 0w) + 221w2 - 110w*2 - 130w*2 to s + yw + ow2 and give o. -31 Express -1 + 2h + 6 + 1 + (-9 - 7 + 7)(3h - 5h + h) in the form qh + y and give y. 6 Express 9o3 + 10o*3 + 16o - 14o3 + (4o2 + o2 - 3o2)(0 - o + 0) as q + jo2 + fo + mo3 and give f. 16 Rearrange (-3 + 4 + 1)(-50m + 575m - 200m - 1 + 3) to zm + i and give z. 650 Rearrange 491g + 60449 - 60449 to o + hg and give h. 491 Express -46 + 7o + 46 + (-o + 0o + 7o + (-4o + 2o + 3o)(-3 - 3 + 5))(1 + 4 - 4)(0 - 4 + 3) as do + w and give d. 2 Rearrange (9 - 4c - 9)(-3 - 4 + 5) + 2c - 4c + 0c - 6c - 5c + 4c to xc + q and give x. -1 Rearrange (2 - 1 - 3)(1 + 5 - 5)(-a + 2a*2 + a) + (0a - 8a + 0a)(-3a - a + 6a) to the form za*2 + ha + n and give z. -20 Express (4r2 - r2 - 5r*2)(21 + 19 - 25) + 10r2 - 2r*2 + 0r*2 as pr + q + hr2 and give q. 0 Express (129t - 737t - 470t)(2t*2 - 4t + 4t) in the form u + at*3 + ot*2 + ct and give u. 0 Rearrange -3 + 2 - 546y + 1 + 77y to the form ty + x and give t. -469 Rearrange (2 + 1305n + 100n2 - 1305n)(n - 4n + 2n + (-5n + 0n + 4n)(2 + 0 - 1))(1 - 4 - 2) to the form dn + wn*2 + p + ln*3 and give p. 0 Express (-112r + 112r - 4r*2)(-11r - 16r*2 + 3r*2 - 5107 + 5105) as kr*4 + yr*2 + dr*3 + q + hr and give d. 44 Rearrange -w2 - w3 - 4w3 - w2 - 2 + 2w*2 to rw*3 + lw + yw2 + n and give n. -2 Rearrange 365w*4 + 43w3 + w2 - 3 + 5 - 363w4 to the form qw*3 + y + aw*2 + dw + kw4 and give y. 2 Rearrange -v + 2v*2 + 1230 - 1251 + v to kv + x + hv2 and give x. -21 Express 39a - 114a + 38a + 39a + 69 as ja + q and give q. 69 Rearrange 3d4 + 0d4 - d4 + (1 + 3 - 2)(414d*4 + 214 - 214) to the form zd*3 + f + kd + yd4 + pd*2 and give y. 830 Rearrange -5x*3 + 4x*3 - 4x*3 - 6x*2 + 14x*3 to the form nx + ix2 + kx*3 + o and give k. 9 Rearrange -38 + 4k*3 - 2k*3 - 7k*3 + 34 to the form fk*3 + ak + uk2 + y and give y. -4 Express -206k + 414k - 208k + 55k2 in the form yk*2 + lk + x and give y. 55 Express 3j4 - j4 - 341j*2 + 110j*2 + 113j*2 + 119j*2 - 23j as hj3 + gj*2 + kj + x + aj4 and give k. -23 Express -895p - 12307 + 12307 as a + up and give a. 0 Rearrange 4a + a4 - a3 + 2 + 13a2 - 16a*2 - 8a*2 to the form ca + l + ba2 + oa*4 + na*3 and give c. 4 Rearrange (168 - 95 + 365)(d + 0d + 0d) to yd + c and give c. 0 Express -5 - 7 + 4w*3 + 0w*3 - 3w*3 in the form iw*2 + z + qw*3 + hw and give q. 1 Express 3g - 94g*3 - 93g*3 + 58g*3 + (3 - 2 - 2)(2g2 + g3 - 2g2) - g3 - 4g3 + 3g*3 as dg*3 + bg*2 + ag + h and give d. -132 Rearrange -142 - 127 + 268 + 1402h to the form oh + j and give o. 1402 Rearrange (1 + 10 + 1)(74h*2 + 75h*2 - 2h - 155h2 - 3) to the form gh*2 + th + c and give t. -24 Rearrange 3r + 13r - 5r + (-2r + r + 2r)(71 + 211 - 48) to sr + h and give s. 245 Express 1 + 1 - 8 - 1553n + 1431n in the form an + h and give a. -122 Express -21 + v*2 + 231 + 3v*2 + 30 - 3v*2 as wv*2 + mv + u and give w. 1 Express (-3c + 5c - 3c)(13 - 29 + 17 + 808c + 182c) as kc + a + uc*2 and give u. -990 Rearrange -21 + 18 - 266 + 2r to the form u + qr and give q. 2 Express (27 - 67 - 38)(j - 3 + 3)(4j - j + 0j) in the form gj + hj2 + l and give h. -234 Rearrange (-24i + 110 - 110)(0 - 2 + 0)(-3 + 3 + 5i) to k + hi*2 + li and give h. 240 Rearrange -2g2 - 2g*4 - 8 - 11991g + 11989g + 3g2 + g3 to the form p + bg + ag*3 + ug*4 + dg*2 and give p. -8 Rearrange (3i - 3i + 4i)(-2i + 2i2 + 2i) + 4i3 + 0i*3 - 6i*3 to gi*2 + s + fi + vi3 and give v. 6 Rearrange -69x*3 - 1 + 13x*3 - 2x + 1 to the form jx2 + r + qx + yx3 and give y. -56 Express 173x*2 + 168x*2 - 340x*2 + 6x + 2x4 in the form rx*2 + c + vx*3 + mx*4 + lx and give l. 6 Express -a*4 - 5a*4 + 4a*4 + (-3a*4 + 4a*4 - 3a*4)(10 - 13 - 10) - 4a4 + a4 + 2a*4 in the form ra*3 + ma*4 + t + ja*2 + qa and give m. 23 Rearrange -182l2 + 161l*2 - 192l*2 - 165l*2 to pl + zl2 + w and give z. -378 Express -t + 0t - 6t + (-3t + 2t - t)(2 - 1 + 0) + 0t - 3t + t - 7t + t + 4t as h + bt and give b. -13 Rearrange (265x - 2 - 152x - 131x)(0 - 3 - 2) to q + ax and give a. 90 Rearrange -10c3 - 2c*3 + 2c*3 + 7c*2 - c + 11c*3 - 6c*4 to the form pc*3 + b + uc*4 + zc*2 + yc and give y. -1 Express (3z - 3 + 3)(0z2 - 68z*2 - 32z*2) as gz*2 + yz*3 + h + fz and give y. -300 Rearrange (0 + 0 + 4)(9864 - 9864 + 750b*4) to tb*2 + yb*3 + fb + gb4 + w and give f. 0 Rearrange -462k*3 - 2k - 28 - 43 + 69 + 2k to tk*3 + f + sk + qk2 and give f. -2 Rearrange -7m*3 - 5m*4 + 4m*3 + 3m4 - m4 - 2m + 2m*3 to zm*4 + o + sm + km3 + wm2 and give s. -2 Rearrange (3 + z2 - 1 + 0)(2z + z + 2z) to the form pz*3 + bz*2 + n + sz and give p. 5 Express 61m + 36m + 1 - 19m - 4 in the form k + um and give u. 78 Express -k + 200k2 + 109k*2 - 52k*2 + 61k*2 in the form mk*2 + j + xk and give m. 318 Express (-4x2 + 2x2 + x2)(22x + 237 - 237) + (-2x2 + 2x*2 - 2x*3)(-4 + 0 - 3) in the form u + gx3 + fx*2 + qx and give u. 0 Express (-2k - 1 + 1)(2 + 0 - 1) - 607k - 616k + 68k - 760k in the form h + mk and give m. -1917 Rearrange -83h - 582h - 31h - 277h to the form ah + u and give a. -973 Rearrange (-484 - 269 - 1284)(-3u4 + u4 + 3u4) to hu*4 + au*3 + wu*2 + g + xu and give h. -2037 Express (-1 + 4 - 5 + (0 - 1 + 0)(2 - 2 + 2) - 17 - 7 + 13)(2v - 7 + 7) in the form q + yv and give y. -30 Rearrange (0y + 3y - 4y)(-6 + 1 + 3 + (2 - 3 + 0)(0 - 3 + 2) + 1 + 2 - 1 + 5 - 3 + 1) to a + fy and give f. -4 Express (32p - 18727 + 18727)(-86p2 + 86p*2 + 4p3) + p3 + p4 - p3 in the form mp + zp*4 + q + xp*2 + gp*3 and give z. 129 Rearrange (20p - 104 + 2p2 + 104)(-6p + 3p - 3p) to the form jp + up3 + n + gp*2 and give g. -120 Rearrange 3t*4 + 132 + 20t*3 - 131 - 6t*2 - 21t*3 to jt*2 + it*3 + lt*4 + x + st and give l. 3 Rearrange 364d2 + 696d*2 + 53d*2 + (-d - 1 + 1 + 1)(d + d + 0d) to the form id*2 + md + v and give i. 1111 Express 103 + 0u3 - 5u*2 - 3u*3 - 106 as h + vu*2 + gu + su3 and give s. -3 Express (-2 + 6 - 2)(3g + 90g + 240g) in the form mg + v and give m. 666 Rearrange (1 + 2 + 2)(-6w - 3w + w)(-4 + 1 + 6) to yw + t and give y. -120 Express (-29v*2 + 29v*2 - 48v*3)(-2 + 1 + 0) as j + zv3 + xv + wv2 and give z. 48 Express 78x + 278x - 155x + 203x in the form dx + w and give d. 404 Express 2y4 - 2000y*3 + 2002y*3 - 2y*2 - 2y + 5y4 as ty*3 + s + my + oy2 + vy*4 and give m. -2 Rearrange (-8g + 0g - 3g)(-2g - 2 + 2) + 18g - 18g - 13g2 to bg + a + vg2 and give v. 9 Express (-3 + 0 + 1)(-130p - 60p + 551p)(0 - p*2 + 0) in the form mp*2 + yp*3 + rp + j and give y. 722 Rearrange -5o3 + 6o*3 - 4187o*4 + 4234o*4 + 4 to fo*2 + m + vo + to3 + ro*4 and give t. 1 Express 0n*2 - 4n + 9 + 12n - n3 + n2 - 12 as jn*2 + mn*3 + fn + d and give m. -1 Rearrange 3i2 + 25i*2 + 7i - 20i2 + 74i*2 to o + ai*2 + gi and give g. 7 Express -2234a + 90 + a*3	{ "pile_set_name": "DM Mathematics" }
(4/9)/c)/cc)/c)) assuming c is positive. c(598/21) Simplify ((uu/(u/((u/(u*(2/43)/u))/u)u))*14u*(3/2)u16)15 assuming u is positive. u(39795/86) Simplify ((c/c7)/c0)/(c/c(1/2))*34(c*(4/5)/(cc(-1/14)))/(c(2/35)c/(c/c(-1/4))) assuming c is positive. c(-3211/140) Simplify ((ccc/(c/(c(-2/3)/c))cc)(5/7))(1/44)(c*(-5)c/(c(ccc(-4)c)/c)c)/(c(1/2))45 assuming c is positive. c(-3229/132) Simplify ((b(1/8)b/(b0/b))/(b(4/5)b(-1/16)))(-45) assuming b is positive. b(-999/16) Simplify (((f(2/9)(f/(f*(6/7)f))/ff)/(f0f)4)25)(26/5) assuming f is positive. f(-37960/63) Simplify ((q*(6/11)q(qq/((q/(q/(q/q*(1/13)q))qq)/qq))/q)/(q(-1)/(q/q(1/5))))/((q(6/11)/q)/(q(-3/7)/q))(4/5) assuming q is positive. q(-1786/5005) Simplify ((o(-1/4)o/(((o*4o)/o)/o)(o(-2/7)o)(-30))(-4/7))(-35) assuming o is positive. o(-3315/7) Simplify (((s29)(-5/7))(-28))16 assuming s is positive. s*9280 Simplify ((aa(2/13))/a(2/15))/((a/a*4a)/a*2)(a*(-1)a)*(-19/2)(aaa*(-2/15)a)/(a*(-1)aa) assuming a is positive. a(1343/195) Simplify ((c(3/8)c*4)/(c/(c(c(c/(c/(cc*(-1))))/c)/c)c5))/(c(-2/7)/(c/(ccc*(-7)c))c6cc/(cc*(1/3))c) assuming c is positive. c(-673/168) Simplify l/((l/l(-4))/llll)l*(-1/3)ll(1/5)/((ll*(-7))/ll)(ll*9ll/(l(2/13)lll))(7/5) assuming l is positive. l(2584/195) Simplify (o*(-3/2)ooo(-1/4)/o)(-14)o(-2/3)/o(-6)oo(-2/3)(o1/o)/o assuming o is positive. o(91/6) Simplify ((x4)50)*(-19/5)(x*5/(xx/x(4/5)))(2/11) assuming x is positive. x(-41762/55) Simplify (((q0/q)/q)(-10))(11/2)((q0)(13/2))(4/23) assuming q is positive. q110 Simplify (((g(g/(g/(ggg*(2/15))))/ggg)/(g/g(-1/4)))/(gg*(-2/9)g*1g))/(((((g((gg*(-1))/gg)/g)/g)/g)/g)(-1/2))12 assuming g is positive. g*(-3221/180) Simplify ((((jjj/(j(-19)j))/j)/j(2/9))/((j(-10/3)j)/(j/j2)))(6/13) assuming j is positive. j(380/39) Simplify ((s(-6)ss0)/(ss/(s/s*(2/3))s/s*(2/3)ss))/(s(-2/5)ss(-7))(-2/13) assuming s is positive. s(-649/65) Simplify ((k7/k)/(k/(k(kk(-5))/k)))6(k0/k)(1/61)k(k*6/kk)/kk/(k/(kk*(-1/11)k)) assuming k is positive. k*(9322/671) Simplify ((uu/(uu(1/4)uuuu))/(uu/u*(2/11)uu))/(u/(uu*(-1))u*(-2/3)/uu)(u(-1/2)uu/(u/(u5u)u))48 assuming u is positive. u(33871/132) Simplify ((((gg(-2/3))/g)/g)(-4/25))*(-2/79)(g/(gg/(g/(gg*(5/4)/g)g)g))/g(-2/15)(g*(-2)g)/(g/(g/(g/g*3))g) assuming g is positive. g(-355/316) Simplify (((y/y(4/5))/yy(-4)y*(-2/9)y/(yy6/y))(36/7))17 assuming y is positive. y(-30668/35) Simplify ((xx*(-1/4)x)(-8)/((x6/x)/(x/(x/x*1)x)))/((xx/x(-1/2))/(x/x6)(x(-2/3))(12/7)) assuming x is positive. x(-327/14) Simplify a(-2/17)aa*5aa(-1/4)/(aaaa/a*0)a(-2)/(a/(a/a2)a)a*(3/2)/(aa(1/4)) assuming a is positive. a(-36/17) Simplify (iii*(-2/11)i(i(-5/7)i)/ii)(-6)i(2/35)/i6i(-2)i(1/5) assuming i is positive. i(-10151/385) Simplify ((x*(-2)x/(x/(x/x*(-1/4)x))(x/(xx(-1/2)))(-4/17))(-1/10))3 assuming x is positive. x(-27/680) Simplify (u(-2)/uu/(u/((u9u)/u)))*(-35)(u/u*(-7))/(u/(uu*7u))u(-7)/(u(-6)/u) assuming u is positive. u(-194) Simplify (k9/(k/((k/(kk*(-3/5))kkk)/k)))24/(k(2/13)k(2/3)k)(-12/5) assuming k is positive. k(3364/13) Simplify (p(-14/11))48/((p*33pp)/(p35p)) assuming p is positive. p*(-661/11) Simplify ((ss(-21/8))/(((s/s(-5))/sss)/s))/(s*(4/19)s19) assuming s is positive. s(-4079/152) Simplify (((n/((nn(2/5))/n))/n)/n)25/(n(1/2))(-9/10)(n*2nn(-2/5))/(n/(n((nn/n1)/n)/nnn))(-48) assuming n is positive. n(-1599/20) Simplify ((r/(r/r11))/(r/r(-3)))43(r/((r(-2/3)/r)/r))(1/9)/(r*(-2/19)r(-1/4)) assuming r is positive. r(619217/2052) Simplify ((x/(((x(x/x(-11))/x)/x)/x))/((x(2/9)/x)/x))(-3/10)(xx/(xx/(xx2)x))/(xxx/x*(-3))xx(-2)x(2/15) assuming x is positive. x(-27/10) Simplify (w*6w)/(w*(4/7)/w)(w1/w)35(w(5/2)/(w/w(-2)))/((w(-2/7)w)/((w/(ww5)w)/w)) assuming w is positive. w(17/14) Simplify ((m(5/4)/(m(-1/7)/m))/(m(-2/13)/m*5))/((m((m/m*5)/mm)/m)/(mm(2/3)))36 assuming m is positive. m(77003/364) Simplify ((((jjjjj(4/7)/jjj)/j)/j)/j(j(j/(j(-13)j))/jj)/jjj(-29)j/(jj/((jj*(-36)jj)/j)))31 assuming j is positive. j(-10292/7) Simplify ((pp(-13))/p)14/(((pp(-25))/p)/(pp(-5/11))) assuming p is positive. p(-1721/11) Simplify (k*3/kk(3/4))37/((((k/(k/k*(-3)))/kk)/k)(-9))(-15) assuming k is positive. k(2567/4) Simplify (s(-3/10)/s*16(s(2/37)/s)/((s/s3s)/s))0 assuming s is positive. 1 Simplify ((z/((z/(z/(zz*8zz)z))/z)z)/(z(zz/(z/z(-8)))/zz))*(-2/25)(z(-2/7))(-2/9)/((z/(z(-1)/z))/(z(2/9)z)) assuming z is positive. z(-286/175) Simplify ((((d(d/d(2/13))/d)/d(-26))(-15/7))(-4/13))43 assuming d is positive. d(900420/1183) Simplify ((s*(-6)/(ss/s*(-2/3)))/((sss(-5))/(s/s(-3))))/((s0)49)20 assuming s is positive. s(-5/3) Simplify (yy*(-2/17)y*(-22)y(4/11)/y(4/11))(7/2) assuming y is positive. y(-2513/34) Simplify (w/(w*(2/9)ww)(w*27/ww)/w)/((www*(7/5))/(w/(ww*36ww))) assuming w is positive. w(-748/45) Simplify n/(n(-2)/nn)((nn*(-1/2)/n)/n)/n(n*2/nn)/(n*(-2/21)n)(n7/(n/n(-2/11)))/(n(1/2))45 assuming n is positive. n(-3485/231) Simplify ((y(-1/2))23(y2)(-5))(-35) assuming y is positive. y(1505/2) Simplify ((d*(-1/2)d)*(-18)(d(1/2))17)/(((dd1/d)/ddd)(-1/92)/((d(-2)d)/d(1/4))) assuming d is positive. d(-159/92) Simplify (rr(1/2))15/(r/(rr*2/rr)rr*(-5/2))r(r/(rr*(-2)/rrrr))/rrrr(1/4)r(-6)/(r5/r) assuming r is positive. r(73/4) Simplify ((b6)*(-13)/(bb5)(-14/9))14 assuming b is positive. b(-2884/3) Simplify (((t/(t/(t(4/3)/t)))/t(3/5))/(t/t*(-3)t(-12)))(-7/3) assuming t is positive. t(-812/45) Simplify ((i15i)(-9)/(i(-9))(8/9))(-1) assuming i is positive. i136 Simplify (b/b(-3/5))/(b((b*(-6)b)/b)/bbb)((b/(bbb0))/b)(-50)(b*(-5)b1)29 assuming b is positive. b(-52/5) Simplify ((q(-5/7)q(-7)/q)/(((q/q15)/q)/((q(-3/20)q)/q)))42 assuming q is positive. q(2577/10) Simplify (k7/k0)*(14/11)/((kk*(-10)k)/k(-1))(-2) assuming k is positive. k*(-56/11) Simplify (kkk1k*(2/7)k*9k(-2/19))(-1) assuming k is positive. k*(-1620/133) Simplify ((k/((k/(kk*30)k)/k))/(k/k*(22/3))kk((k/(k/(kkk*28kk)))/k)/kk/(kkk*(-14)k)k)(3/4) assuming k is positive. k(247/4) Simplify ((g/((((gg1)/g)/g)/g))/g(-2/9)g3/ggg/((ggg(-3))/g)g)/((g*(-6)/(((ggg2)/g)/g))/(g/g(2/5)g(3/5)/g)) assuming g is positive. g(784/45) Simplify ((zz/(zzz(1/4)))(2/43)/(z(-1/4)z)(4/11))(5/3) assuming z is positive. z(-1345/2838) Simplify ((((x/(x0/x))/xx(x*(-3/2)x)/xx)/(x/x(-1/4))(24/11))(2/9))(-21) assuming x is positive. x(63/11) Simplify (f(6/5)f7)/(f(2/15)f(5/3)ff)(ff(-1/4))(1/15)(f*(-2/23)f)/f7 assuming f is positive. f(-753/460) Simplify ((oo/(o/o(1/4)o)o)/oo)1/(o(-1/6)/(o/(ooo/(o*(1/10)o))))(o2)(-11/5)/(o/(o(-1)o))(36/7) assuming o is positive. o(-3791/420) Simplify ((t/(t*(1/10)tt))(-15)/((tt*(-14)tt)/t(-8/7)))(-1/8) assuming t is positive. t(-369/112) Simplify (d/(d(14/11)d))*46((d(((d/d(-2/5))/dd)/d)/d)/d)(-17) assuming d is positive. d(-2659/55) Simplify (((t(-5/6)/t)/t(-4))/(t*(1/9)t(2/73)))34 assuming t is positive. t(45305/657) Simplify (t/t(-1))*(-2/3)t*3t*(-5)((t/t*(-6)t)/tt)/t(-8)(t*(1/4)tt)/t(-4/3) assuming t is positive. t(65/4) Simplify (zz*(-1)z)*(3/11)((zz(2/25))/zz)/z*(1/3)((zz(1/11)/zz)/(z/((z(z/(z(-4)/z))/z)/z)))/((z/z3)/(zz/z*0z)) assuming z is positive. z(9166/825) Simplify (b(2/9)	{ "pile_set_name": "DM Mathematics" }
k) + 6c(k). What is o(6)? 5 Let m(z) = 3 + 311z - 312z + 0 - 2. Let f = -17 - -27. Determine m(f). -9 Let j = -295 + 317. Let h(z) = z2 - 20z - 38. Give h(j). 6 Let j = 1490 - 1476. Let w(b) = 2b2 - 29b + 18. Determine w(j). 4 Let c(g) = 2g3 + 12g*2 - 3g - 62. Let w(f) = -f*3 - 6f*2 + f + 28. Let s(a) = 3c(a) + 7w(a). Give s(-5). -5 Let m(x) = 0 + 0 - 24 + 6 + 5x + 13. What is m(-4)? -25 Let y(i) be the first derivative of i*3/3 + 2i*2 + i - 2. Suppose 0 = 3m + 2g + 12, -3g = m + 17 - 13. What is y(m)? 1 Let m = -25 + 29. Suppose 0 = mz + b - 13, 0 = 2z + z - 3b - 6. Let f(o) = -7o + z + o*2 + 1 + 1. Determine f(5). -5 Let a be -3-34/(-12). Let c(m) = -m3 - 3m*2 - 2m - 2. Let n be c(a). Let g(q) = 6 + q*2 - 2 - 8q + n - 3. Calculate g(6). -7 Suppose 13 = 2b + 1. Let a(f) = -7f*2 + 6f*2 + 2f*2 + 2 - bf - 2f2. Let h = 0 - 6. Determine a(h). 2 Suppose 0 = -y + 2y + 5. Let r(c) = -2c3 - 13c2 - 8. Let s(a) = -a3 - 6a2 + a - 4. Let d(p) = -2r(p) + 5s(p). What is d(y)? -4 Let d(c) = -c - 17. Let l(s) = -2s*3 + 3s + 4. Let f be l(-3). Let y = 35 - f. Let p be d(y). Let z(t) = -2t2 - t + 3. What is z(p)? -12 Let p(l) = -34l + 75l + 1 - 14l*2 - 43l. Determine p(1). -15 Let t(y) = -y + 77. Let m(d) = -56. Let x(i) = 3m(i) + 2t(i). Calculate x(-11). 8 Let l(i) be the third derivative of i6/120 + i5/12 - i*4/12 + 2i2. Let v be l(-6). Let w = v - -25. Let o(u) = -u2 - u + 1. Calculate o(w). -1 Let a(q) be the first derivative of q*2/2 - 8q + 1. Suppose -5d = -4c - 10, -3 - 1 = -2d + 2c. Let z be (-3)/(18/(-22)) + d/6. What is a(z)? -4 Let x(o) = -4o2 - 8o - 4. Let v be x(-7). Let h = -152 - v. Let y(l) = l*3 + 7l*2 - 8l - 6. Calculate y(h). -6 Let g(n) = 3n3 + 6n*2 + 15n - 31. Let i(r) = 2r3 + 6r*2 + 16r - 28. Let b(v) = 3g(v) - 4i(v). Determine b(8). -5 Suppose -7k + 4 + 3 = 0. Let m(c) = c3 + 3c*2 + c - 4. Let w be m(2). Let h(n) = wn + k + 3 - 14n. Give h(-4). -12 Suppose 44 = -4s + 4x, 0 = 4s - x + 3x + 44. Let z = s + 11. Let g(d) = -d - 14. Determine g(z). -14 Let t(k) = k3 - k2 + 2k - 2. Suppose 27 = -271z + 280z. What is t(z)? 22 Suppose -j = j + 3g + 16, 5g + 35 = -5j. Let h be j + 3 + 28. Let b = 13 - h. Let d(u) = 8u + 1. Determine d(b). -7 Let b = -10 - -12. Let d(o) = 9o*2 + 0 - 8ob + 2. Let a = -3 - -6. Determine d(a). 11 Let t be (40/(-12))/(4/(-6)). Let a(u) = 35843 - u3 - 4u - 4u2 + u3 + u3 - 35846. What is a(t)? 2 Let c(j) = -j3 + 7j2 - j + 2. Let s be c(6). Suppose 4r - s = -0. Let y(z) = 2z - z + r + 4 - 3. Give y(-7). 2 Let n(c) = -c - 9. Suppose r + 75 = m - 0m, 4r + 2m + 276 = 0. Let u = -79 - r. Give n(u). -1 Let d(x) = 2x3 + 3x2 + x. Let v be (9 + -6)/((-6)/4). Determine d(v). -6 Let o(g) = g3 + 4g2 - 1. Let z = -1066 + 1063. Give o(z). 8 Let s(a) = a2 + 4a - 7. Suppose -47 = -3h - 4j, 4j + 16 = h + 3h. Let g(l) = -l*2 + 10l - 15. Let d be g(h). Calculate s(d). 5 Let o(b) = 2b2 - 21b - 23. Let d(a) = -a*2 + 10a + 11. Let u(j) = 5d(j) + 2o(j). What is u(9)? 0 Let h(y) be the first derivative of 1/2y2 - 4y - 1/3y3 + 1/6y*4 - 1/5y5 - 3. Let m(i) be the first derivative of h(i). Calculate m(1). -3 Let y(s) = s3 + s + 1. Let c(n) = 5n3 - 5n*2 + 10n - 1. Let m(i) = c(i) - 4y(i). Give m(4). 3 Let a(y) = -2y*2 + 8y - 8. Let d be (12/(-21))/((-72)/14 + 5). Determine a(d). -8 Let a(u) = 5u - 7. Let b be a(3). Let j(t) = 0t - t*2 - 5t + bt + 2. Let r be j(4). Let i(y) = -2y*3 - 2y*2 + 2y. Give i(r). 4 Let g(n) = 7n3 - 14n*2 - 10n. Let y(o) = -12o3 + 26o*2 + 19o + 1. Let c(b) = -7g(b) - 4y(b). What is c(-5)? 1 Let i be 24/9 + -2 + 130/30. Let o = i + 0. Let p(j) be the second derivative of j5/20 - j4/2 + j*3 - 5j*2/2 + 2j. Calculate p(o). 0 Let m(i) = -i - 7. Suppose -3a + 17 = -16. What is m(a)? -18 Let o be -1(3 + -2 + -15). Suppose -12z + oz - 4 = 0. Suppose -z = 4q + 6. Let m(b) = b3 + 2b*2 - b - 1. Calculate m(q). 1 Let q(r) = -4r3 + r2 + 1 - 4r + 6r*3 - 2r*2 + 3r. Let n = 43 + -42. What is q(n)? 1 Let f(y) = -13y3 + 9y*2 - 7y - 19. Let m(i) = 5i3 - 3i*2 + 2i + 6. Let d(l) = -3f(l) - 8m(l). Calculate d(-4). 5 Let z = 0 + -4. Let y(d) = d*2 + 4 - 5d2 + d - d2 + d2 - d3. Give y(z). 0 Suppose -i = -5b + 2i + 6, 5i - 3 = 4b. Let a = 11 + -8. Let t(n) = 11 + 0n - an - 7. Determine t(b). -5 Let f(k) be the second derivative of -7k5/10 - k4/6 + k3/3 - k2/2 - k. Let h(a) = 14a*2 + 28a + 1. Let x be h(-2). Calculate f(x). -15 Let n(s) = 4s - 2 + s - 2 - s2. Let u be 3/(-5) - 1671/15. Let t = u - -116. Determine n(t). 0 Suppose 0 = -51c + 48c - 5d + 37, -5c + 4d = 0. Let x(n) = -n*2 - 4n - 3. What is x(c)? -35 Let k(q) = -2q2 - 1. Let m be k(1). Let t(i) = i3 + 2i*2 - 3i - 4. Let r(z) = 3z3 + 6z*2 - 9z - 12. Let s(n) = mr(n) + 8t(n). Calculate s(-3). 4 Let q(i) = -i*3 + 9i*2 - 12i + 12. Let c(m) = -17m - 77. Let y be c(-5). Determine q(y). -20 Let t(j) be the third derivative of 1/24j*4 + 1/120j6 - j2 - 1/3j3 - 1/6j*5 + 0j + 15. Determine t(10). 8 Let r(g) = g*3 - 5g*2 + 2g + 4. Suppose -4s = -5o + 18, 6o = 7o + s. What is r(o)? -4 Let k(w) = -w*2 - 3w. Let m(l) = l. Let d = 38 + -37. Let j(f) = dk(f) - m(f). What is j(-2)? 4 Let v(c) = -c2 - 8c. Let y be v(-7). Let a(l) = 13l + 6 - 12l + 0l + 3l - 5l. Calculate a(y). -1 Let x(z) = z2 + 8z + 7. Let i(w) be the second derivative of w*5/10 - 5w4/3 - w3/2 + 12w2 + w + 3. Let k be i(10). Give x(k). -5 Let g(p) = -p2 + p + 10. Let c be g(-2). Let y(l) = l2 - 7l + 7. Calculate y(c). -5 Let k(b) = b. Let d(i) = 13i - 5. Let c(n) = -7n + 3. Let j(v) = -5c(v) - 2d(v). Let u(t) = -j(t) + 5k(t). Determine u(4). -11 Suppose -w = -58 + 72. Let h(k) = -3k - 48. Determine h(w). -6 Let b(w) = w*2 + 28w*3 + 0w + 5w - 4w - 1. Give b(1). 29 Let f(s) be the third derivative of -s*2 + 1/120s6 + 0 - s3 + 1/20s5 + 0s - 1/4s4. Suppose -6d + d - 8 = 2o, 0 = 2d. Determine f(o). 2 Let s(m) = -m - 1. Let k(p) = -3p - 1. Let g(a) = 2k(a) - 5s(a). Let b(q) = 2q*3 - 34q2 - q + 17. Let c be b(17). Determine g(c). 3 Let z = 1208 - 1187. Let p(l) = -l2 + 20l + 24. Determine p(z). 3 Let z(f) = -10f*2 + 46f - 117. Let o(u) = 7u2 - 31u + 78. Let s(d) = -7o(d) - 5z(d). Determine s(10). 9 Let i(o) = 1. Let y(d) = -d + 3. Let k(f) = 3f - 5. Let l(w) = -2k(w) - 5y(w). Let b(t) = 4i(t) - l(t). Calculate b(-7). 2 Let d be -39(42/(-18) - -2). Let y(v) = v3 - 14v*2 + 14v - 12. Determine y(d). 1 Let j(n) be the first derivative of n6/360 - n5/15 + n*4/8 - 7n3/3 - 23. Let y(l) be the third derivative of j(l). Determine y(7). -4 Let k(f) = -f2 + 9f - 7. Suppose 0 = -2p + 4 + 10. Let c = 14 - p. What is k(c)? 7 Suppose 0 = 3j + 2i - 25, -4i + 2i + 35 = 5j. Suppose -2g = -5d - 111, 4d + 190 = 4g - 14. Let y(r) = 2r + r + r*2 - 6r - 53 + g. Calculate y(j). 5 Let g(o) = 162 + 2o3 + 0o - 6o3 + 3o*3 - 3o - 158 - 3o2. What is g(-2)? 6 Let w(q) = -q2 - 4q + 8. Suppose 202 - 167 = -7f. What is w(f)? 3 Let f(n) = -2n*2 + 8n - 10. Let i(d) = d*2. Let v(y) = -f(y) - 3i(y). What is v(-8)? 10 Let k(j) be the second derivative of 5j3/6 + 2j*2 - 8j. Let t(n) = 4n + 4. Let y(h) = 5k(h) - 6t(h). Suppose 4f - 2f = 0. Give y(f). -4 Let z(i) = -31i + 29i + 16 + i + 5i. Determine z(0). 16 Let x(z) be the third derivative of 1/24z4 + 1/6z*3 + 1/60z*5 - 5z*2 + 0 + 0z. What is x(-3)? 7 Let t(r) = r - 3. Let g = 95 + -91. Suppose gc - 36 = -14c. What is t(c)? -1 Let m(f) = -f*2 + 6f - 1. Let c be (1/(-2))/(3/(-30)). Let k be m(c). Suppose 2v + k = 4v. Let p(b) = b*2 - 2. What is p(v)? 2 Suppose 0 = 108n - 106n - 12. Let u(q) be the first derivative of q4/4 - 7q*3/3 + 3q*2 - 3q + 1. Determine u(n). -3 Let u(x) = -x*2 - 6x + 10. Let c be u(-7). Let t = 1 + c. Suppose -18 = -tg - 6. Let r(o) = -o + 4. Determine r(g). 1 Let f(o) = -7o*3 + 2o*2 - 1. Suppose 18 = -2m + 16, -3k - 3m = 0. What is f(k)? -6 Suppose 0 = 18*f - 56 + 110. Let p	{ "pile_set_name": "DM Mathematics" }
sor of 135474700 and 850? 850 Calculate the greatest common divisor of 2968986 and 56704. 886 What is the highest common divisor of 16383 and 95503? 43 What is the highest common divisor of 95985 and 19355? 395 What is the greatest common factor of 5355 and 19030795? 35 What is the greatest common divisor of 19483683 and 113373? 969 What is the greatest common divisor of 6478 and 706769234? 6478 What is the greatest common divisor of 585958894 and 63182? 9026 Calculate the highest common factor of 188 and 2036624. 4 What is the greatest common factor of 291 and 12765879? 291 Calculate the greatest common factor of 636546651 and 244. 61 Calculate the highest common divisor of 9588722 and 2704. 338 Calculate the greatest common factor of 1616 and 2168066. 202 Calculate the highest common divisor of 9360 and 226432. 16 What is the greatest common factor of 89152 and 79272844? 5572 What is the greatest common divisor of 576 and 18983232? 576 Calculate the greatest common factor of 2754 and 60219. 9 What is the highest common divisor of 7566182 and 26? 26 Calculate the highest common factor of 22788 and 4165140. 2532 Calculate the highest common divisor of 3437 and 108176629. 491 What is the greatest common divisor of 9324 and 1261552? 148 Calculate the greatest common factor of 12845094 and 78. 6 Calculate the highest common factor of 187 and 454828. 11 What is the highest common factor of 17750534 and 1168? 146 Calculate the greatest common factor of 11169 and 3490083. 153 Calculate the greatest common factor of 2634 and 1506. 6 What is the greatest common factor of 2700031 and 8003? 151 What is the highest common divisor of 109394 and 277439? 659 Calculate the highest common factor of 41134 and 201871. 131 Calculate the highest common divisor of 1023 and 27246923. 341 What is the highest common divisor of 99 and 1902471681? 33 Calculate the greatest common divisor of 4194876 and 132. 12 What is the highest common divisor of 9 and 11234139? 3 Calculate the highest common factor of 1264 and 46153064. 632 What is the greatest common divisor of 342325 and 76725? 25 What is the highest common factor of 3272925 and 10407675? 11325 What is the greatest common factor of 3374024 and 340? 68 Calculate the greatest common divisor of 2600139168 and 18. 18 What is the greatest common factor of 1890154 and 474? 158 What is the greatest common factor of 1633152 and 15744? 384 Calculate the highest common divisor of 457824 and 2856631. 4769 What is the highest common divisor of 6686 and 2146319662? 6686 What is the greatest common divisor of 426228 and 18678? 66 What is the greatest common factor of 36452 and 25431579? 701 Calculate the greatest common factor of 171 and 4451680791. 171 What is the greatest common divisor of 1026 and 164120784? 114 What is the highest common factor of 803721 and 6? 3 Calculate the highest common divisor of 36 and 970460220. 12 Calculate the greatest common factor of 108472 and 74987528. 8344 What is the greatest common divisor of 4711716 and 213? 3 Calculate the greatest common factor of 293296464 and 86. 86 Calculate the greatest common divisor of 1678 and 1486. 2 Calculate the highest common factor of 24 and 2912008. 8 What is the greatest common factor of 21917 and 128247? 217 Calculate the highest common factor of 3440332 and 1372. 28 What is the greatest common divisor of 83312 and 72226297? 5207 What is the greatest common factor of 180 and 20447870? 10 Calculate the greatest common divisor of 19250 and 1705. 55 Calculate the highest common factor of 410486 and 3607200. 334 Calculate the highest common divisor of 7172 and 2130304. 44 What is the greatest common divisor of 21858186 and 126? 42 Calculate the highest common divisor of 87 and 131625. 3 What is the highest common divisor of 1010505 and 2610? 435 Calculate the highest common divisor of 1196 and 12319996. 1196 What is the greatest common factor of 19540628 and 21530? 4306 Calculate the highest common factor of 283920 and 14045590. 1690 What is the greatest common divisor of 660 and 746268? 12 Calculate the greatest common divisor of 30 and 2457098790. 30 What is the highest common factor of 1113 and 524133960? 1113 What is the highest common factor of 5264 and 3332490? 14 Calculate the highest common divisor of 19460513 and 758. 379 Calculate the greatest common divisor of 2331297414 and 102. 102 Calculate the highest common factor of 22900646 and 8768. 274 What is the greatest common divisor of 539121 and 160446? 561 What is the highest common divisor of 56193668 and 8? 4 What is the highest common divisor of 4293561 and 7749? 123 What is the highest common divisor of 1 and 3561285? 1 What is the greatest common divisor of 35352874 and 2326? 2326 Calculate the highest common factor of 487 and 5688647. 487 Calculate the highest common factor of 76122 and 482922. 18 What is the highest common divisor of 929912 and 252? 4 Calculate the greatest common factor of 3640400 and 216400. 400 Calculate the greatest common divisor of 466490 and 20. 10 Calculate the greatest common factor of 35453193 and 381. 381 What is the highest common divisor of 130 and 1278370? 10 Calculate the greatest common divisor of 1900 and 17465940. 380 Calculate the highest common factor of 26513739 and 413. 7 What is the greatest common divisor of 17915683 and 101? 101 What is the greatest common factor of 35568 and 2457? 117 What is the highest common divisor of 224 and 1806672? 112 Calculate the highest common factor of 23019648 and 3020. 604 Calculate the greatest common divisor of 238000 and 944384. 1904 Calculate the highest common factor of 597413 and 2727412. 2111 Calculate the highest common factor of 113739275 and 26. 13 Calculate the greatest common divisor of 5227614 and 84. 42 Calculate the greatest common factor of 7670421 and 26631. 99 Calculate the greatest common factor of 1610 and 17533530. 70 Calculate the greatest common factor of 117051430 and 5. 5 Calculate the greatest common divisor of 5054 and 1333382. 38 Calculate the highest common divisor of 2326 and 1866784798. 2326 What is the highest common divisor of 94 and 20550421? 47 What is the highest common divisor of 135960 and 118596? 12 What is the greatest common divisor of 240108 and 26367? 561 Calculate the highest common factor of 21103472 and 75737. 1429 Calculate the highest common divisor of 31 and 7017811. 31 Calculate the highest common factor of 2 and 2234026. 2 Calculate the greatest common divisor of 5829 and 8375. 67 Calculate the highest common divisor of 109235 and 39190. 5 Calculate the greatest common factor of 69200 and 139600. 400 Calculate the greatest common divisor of 183748500 and 12. 12 Calculate the greatest common divisor of 31730 and 3872105. 95 What is the highest common factor of 13884 and 1752588? 1068 What is the highest common divisor of 1450 and 393298? 58 What is the highest common divisor of 1011582 and 26026? 286 What is the highest common divisor of 3513240 and 460? 20 What is the highest common divisor of 32897 and 123732? 491 What is the greatest common factor of 3286 and 4400047? 31 Calculate the highest common factor of 918531285 and 42. 21 What is the highest common divisor of 82260 and 51210? 90 Calculate the highest common factor of 29552252 and 1747. 1747 What is the greatest common divisor of 382 and 97510657? 191 What is the greatest common factor of 9600 and 401775? 75 Calculate the highest common factor of 5370 and 303468366. 1074 What is the highest common factor of 5489075 and 356? 89 Calculate the highest common factor of 72825053 and 2674. 1337 Calculate the highest common factor of 6190 and 180142618. 1238 What is the highest common factor of 435 and 242471610? 435 What is the highest common factor of 4802224 and 320? 16 What is the greatest common divisor of 869 and 9838265? 79 What is the greatest common divisor of 105 and 6236370? 105 Calculate the greatest common divisor of 468 and 6553638. 234 What is the greatest common divisor of 530 and 15489410? 10 Calculate the highest common divisor of 43007439 and 1971. 219 What is the highest common factor of 10585790 and 2255? 205 Calculate the highest common factor of 44872 and 1218076. 284 Calculate the highest co	{ "pile_set_name": "DM Mathematics" }
e second biggest value in 0, 20/13, -4, 5, 2/17? 20/13 What is the fourth smallest value in -1/5, 0.1, -0.4, 1/4? 1/4 What is the fourth smallest value in 2/7, -4/17, 3, 4? 4 What is the fourth smallest value in -2, 2/29, -1/2, 15? 15 Which is the third biggest value? (a) -1/337 (b) 2 (c) 0 (d) -2/5 a Which is the third smallest value? (a) 2/9 (b) 2 (c) 0 (d) 7 b What is the third smallest value in -18, -3, 1? 1 Which is the third smallest value? (a) -0.8 (b) 1 (c) 5 (d) 1/41 b What is the third smallest value in -35, -1/10, -13? -1/10 Which is the smallest value? (a) -3/26 (b) -5 (c) -4 (d) -2/9 b What is the second biggest value in -1/100, 0.13, -1/2? -1/100 What is the second biggest value in 12, -0.3, 1/4, 1/2? 1/2 Which is the second smallest value? (a) 0.1 (b) -0.413 (c) -0.3 c What is the third smallest value in 13, -0.1, -1? 13 Which is the second smallest value? (a) -0.1 (b) 2/9 (c) -54 (d) -1 d What is the third biggest value in -5, 0.3, 3/7, -1/5? -1/5 What is the fourth smallest value in 463, 3, 0.3, 2? 463 Which is the smallest value? (a) -1/5 (b) 5 (c) 3 (d) 20/119 a What is the fourth biggest value in 0.2, -2, -11/7, 3? -2 What is the second biggest value in -2/9, -0.069, -1? -2/9 What is the second smallest value in 2, -2/9, 1.8, 0.2? 0.2 What is the fourth biggest value in -1/6, -1, -127, 1? -127 What is the second smallest value in -5, 0.98, -0.1? -0.1 Which is the third smallest value? (a) -0.64 (b) -1 (c) -0.5 c Which is the fourth biggest value? (a) -3 (b) -12 (c) 2/23 (d) 5 (e) -0.14 a What is the second smallest value in 2, 6, -2/3, 0.5? 0.5 What is the third biggest value in -3, -1/6, -1/8, 0.3? -1/6 Which is the fourth smallest value? (a) -1 (b) -27 (c) 2 (d) 0.4 c What is the fourth biggest value in 0.3, -0.2, 29, 5? -0.2 Which is the biggest value? (a) -10 (b) 0 (c) 13 (d) -5 c Which is the smallest value? (a) -5 (b) 2.405 (c) 0 (d) 0.2 (e) 2 a Which is the second smallest value? (a) -1/12 (b) -1/129 (c) -5 a Which is the third smallest value? (a) 0 (b) -4 (c) -0.45 (d) 3 a What is the third biggest value in 2, 0.2, 7, 4? 2 What is the biggest value in -2, -206, -2/13? -2/13 What is the biggest value in -3, 0.5, 11? 11 Which is the smallest value? (a) -3 (b) 2/7 (c) 42 a What is the fourth smallest value in 0.4, -1, 2, 12, 0.5? 2 Which is the second biggest value? (a) 4 (b) -506 (c) -0.2 (d) -1/2 c Which is the smallest value? (a) 5 (b) 3 (c) -2 (d) -2/5 (e) 186 c Which is the smallest value? (a) 1 (b) -2 (c) -70 c What is the smallest value in 19/5, 0.4, 0.3, -4/5? -4/5 Which is the second smallest value? (a) 10 (b) 0.1 (c) -0.03 b What is the second smallest value in -0.1, 0.25, -3, 0.03? -0.1 Which is the biggest value? (a) 25 (b) -6 (c) 4 (d) -0.4 a Which is the smallest value? (a) 0.3 (b) -0.4 (c) -2/3 (d) 0.02 c Which is the fifth biggest value? (a) -5 (b) -0.1 (c) -2/3 (d) -1 (e) 2/87 a What is the fifth biggest value in 0, -3, 0.2, -34, -0.5? -34 What is the biggest value in 1/37, -0.3, 3, -4, -1/4? 3 What is the biggest value in 295, -0.4, 1? 295 Which is the smallest value? (a) -3 (b) 0.7 (c) 140 a What is the smallest value in -0.4, 0.049, -2? -2 Which is the second smallest value? (a) -20 (b) -1/3 (c) 0.2 b What is the second biggest value in -4, -43, -5, 0.1? -4 What is the second smallest value in 1, 1/10, 0.04, 157? 1/10 Which is the fourth smallest value? (a) -2 (b) 4 (c) 0 (d) -1.24 b What is the second biggest value in -1/4, 3, -2/237, 3/8? 3/8 What is the second biggest value in -59/33, 1, 2/3? 2/3 Which is the second smallest value? (a) -2/11 (b) -127 (c) 5 (d) -3 d What is the smallest value in 1, -2/11, 0, -5/204? -2/11 What is the fourth smallest value in 1, -2/25, 0.5, 0.53? 1 Which is the third biggest value? (a) -0.3 (b) 2/13 (c) 5/2 (d) -6/11 (e) -13 a What is the third biggest value in 4/3, 0.17, -9? -9 Which is the second smallest value? (a) -0.07 (b) 2/17 (c) -0.2 (d) 2/5 a What is the third smallest value in 6/11, -12.4, 3, 0.5? 6/11 Which is the fourth smallest value? (a) 0.5 (b) 0.2 (c) -59 (d) 4/9 a What is the fourth biggest value in -1, -14/19, 8, 3, -5? -1 Which is the biggest value? (a) 0.5 (b) -2 (c) 0.1 (d) 13.4 (e) 0.08 d Which is the fourth smallest value? (a) 0.1 (b) 0.016 (c) 0 (d) 4 d Which is the second smallest value? (a) 0.2 (b) 83 (c) -6 a What is the biggest value in 2/9, -6/31, -120? 2/9 What is the third biggest value in -2/9, -2/7, -25, -0.03? -2/7 Which is the second smallest value? (a) 1 (b) -2 (c) 63/2 a What is the smallest value in 9, 11/3, -0.3? -0.3 What is the second smallest value in -21, -1/7, -5, -2? -5 Which is the third smallest value? (a) -0.3 (b) -1 (c) 51 c Which is the fifth biggest value? (a) -2 (b) -0.09 (c) 23 (d) -0.5 (e) 1/5 a What is the smallest value in 41, -0.08, -5? -5 Which is the fourth biggest value? (a) -141 (b) 1 (c) 0.2 (d) -0.4 a Which is the second biggest value? (a) -7/3 (b) 1/12 (c) 0.07 c What is the third biggest value in -5, -11/16, -0.5? -5 What is the smallest value in 1/5, -0.3, -2, 206? -2 Which is the smallest value? (a) -2 (b) -580 (c) 2/9 b Which is the smallest value? (a) -330/7 (b) 3 (c) 2/5 (d) 4 a Which is the third biggest value? (a) 1 (b) 1/7 (c) 2/5 (d) -19 b Which is the third smallest value? (a) 0.15 (b) -2 (c) 0.08 a What is the third smallest value in -9, 5, 2? 5 Which is the biggest value? (a) 0 (b) -0.5 (c) -6 (d) -0.3 a What is the fourth smallest value in -46, 2, -2, 4? 4 Which is the third smallest value? (a) -2 (b) -0.8 (c) -1 (d) -6 (e) -0.5 c What is the biggest value in 4/3, -53/4, -0.02? 4/3 What is the third smallest value in -13, -0.43, 0.6? 0.6 What is the second smallest value in -1/9, 0.3, 1, 0.2, -4? -1/9 What is the third smallest value in -1964, 0.5, -0.2? 0.5 What is the biggest value in 0.1, 5, 35, -2? 35 What is the third biggest value in 4, -0.477, -3/4? -3/4 Which is the third smallest value? (a) 4/5 (b) -0.4 (c) 1/5 (d) 4055 a What is the second smallest value in 1/6, 584, -0.5? 1/6 What is the third biggest value in 0.3, -4, 2/9, 134? 2/9 What is the second smallest value in -4/63, -1/2, -2? -1/2 Which is the smallest value? (a) 0.6 (b) -5 (c) -19 (d) -0.1 c Which is the biggest value? (a) 1 (b) -7 (c) 2/3 (d) 0.1 a Which is the fourth biggest value? (a) -7 (b) 4 (c) -5 (d) 7 a What is the fifth biggest value in 0, -5, -0.03, -1/3, -7/5? -5 What is the second biggest value in 3/2, 3, 135, -2/7? 3 Which is the third biggest value? (a) 0 (b) -1 (c) -2/9 b What is the third biggest value in -62, -0.33, 0.3? -62 Which is the smallest value? (a) 0 (b) 28 (c) 2/5 (d) 1/11 a Which is the second biggest value? (a) -16 (b) 9 (c) 2/5 c What is the fourth biggest value in 96, -1/13, 0.2, 0.1? -1/13 Which is the second smallest value? (a) 2 (b) -4 (c) -2/21 (d) 0.09 c What is the biggest value in 3/7, 1/5, 1/3, 1? 1 What is the second smallest value in 1701/2, 0.2, -5? 0.2 What is the biggest value in -16, 1/8, 1/7, 4? 4 Which is the fifth biggest value? (a) 0.2 (b) 0.15 (c) -0.06 (d) 1/6 (e) 2 c What is the second smallest value in 0.1, 0.3, -42/5? 0.1 What is the fourth smallest value in -2, -3, -0.14, -4? -0.14 What is the second smallest value in -2, 4, 0.04, 91, -4? -2 Which is the third smallest value? (a) -3/4 (b) -0.085 (c) 1/2 c Which is the third biggest value? (a) 0.4 (b) -3 (c) -57 c Which is the second smallest value? (a) 0 (b) 4/111 (c) -2/3 a Which is the second smallest value? (a) -2/3 (b) -5 (c) 15 (d) -0.2 a Which is the smallest value? (a) 2/5 (b) -5 (c) 0.1 b What is the biggest value in -3, -0.7, 2/7, 45/8? 45/8 What is the third biggest value in 1/25, 5, 14? 1/25 Which is the third biggest value? (a) 4 (b) -40 (c) -15 b Which is the second biggest value? (a) 3 (b) -3 (c) 41 a Which is the fourth biggest value? (a) 0.3 (b) -4 (c) -8 (d) 1.5 (e) 1/7 b Which is the third smallest value? (a) -0.1 (b) -459 (c) 3 c Which is the second smallest value? (a) 675 (b) 3/5 (c) -4 b What is the biggest value in 5, 1/6, -6, -1/7? 5 What is the second big	{ "pile_set_name": "DM Mathematics" }
greatest common divisor of 1924 and 37? 37 Calculate the greatest common divisor of 1503 and 18. 9 Calculate the greatest common factor of 1010 and 5. 5 What is the greatest common factor of 26 and 6123? 13 Calculate the highest common factor of 323 and 3043. 17 Calculate the highest common factor of 86610 and 30. 30 Calculate the highest common divisor of 42 and 1806. 42 Calculate the highest common divisor of 2192 and 16. 16 What is the greatest common divisor of 96 and 162? 6 Calculate the highest common divisor of 154 and 286. 22 What is the highest common factor of 548 and 10138? 274 Calculate the highest common divisor of 1272 and 24. 24 Calculate the greatest common divisor of 208 and 572. 52 Calculate the highest common divisor of 47 and 16027. 47 Calculate the highest common divisor of 2234 and 1. 1 Calculate the highest common divisor of 17262 and 18. 18 What is the highest common divisor of 20 and 710? 10 Calculate the greatest common divisor of 63 and 28. 7 Calculate the greatest common divisor of 83 and 10043. 83 Calculate the greatest common divisor of 9 and 153. 9 What is the highest common factor of 45 and 20? 5 What is the greatest common divisor of 32 and 1376? 32 Calculate the greatest common factor of 91 and 13. 13 Calculate the highest common divisor of 66 and 1056. 66 Calculate the highest common divisor of 113 and 11413. 113 Calculate the greatest common divisor of 392 and 504. 56 What is the greatest common factor of 272 and 16? 16 Calculate the greatest common divisor of 168 and 15183. 21 Calculate the highest common divisor of 50 and 98950. 50 Calculate the greatest common factor of 15 and 13. 1 Calculate the highest common factor of 6 and 10. 2 Calculate the highest common divisor of 1 and 422. 1 Calculate the highest common factor of 75 and 200. 25 What is the highest common divisor of 16 and 284? 4 Calculate the greatest common divisor of 396 and 17622. 198 What is the highest common divisor of 1 and 2? 1 Calculate the greatest common divisor of 84 and 348. 12 Calculate the greatest common divisor of 7320 and 240. 120 What is the greatest common divisor of 92 and 644? 92 What is the greatest common factor of 90 and 36090? 90 What is the highest common divisor of 645 and 2064? 129 Calculate the highest common factor of 4154 and 67. 67 What is the greatest common divisor of 704 and 11? 11 What is the greatest common factor of 126 and 16422? 42 What is the highest common divisor of 54 and 1782? 54 What is the greatest common factor of 45 and 5760? 45 What is the highest common divisor of 574 and 34727? 287 Calculate the greatest common divisor of 3712 and 116. 116 Calculate the greatest common divisor of 48 and 5872. 16 What is the greatest common divisor of 23 and 2507? 23 Calculate the greatest common divisor of 112 and 52. 4 Calculate the highest common factor of 82 and 41. 41 What is the greatest common divisor of 60 and 1380? 60 Calculate the highest common divisor of 77 and 6116. 11 Calculate the highest common divisor of 3 and 15. 3 What is the greatest common factor of 98 and 476? 14 Calculate the highest common factor of 1378 and 106. 106 Calculate the highest common factor of 5858 and 303. 101 Calculate the highest common factor of 5425 and 75. 25 Calculate the highest common factor of 2952 and 576. 72 What is the greatest common divisor of 1285 and 5? 5 What is the greatest common divisor of 7373 and 101? 101 What is the highest common divisor of 440 and 352? 88 Calculate the greatest common divisor of 2091 and 123. 123 What is the greatest common factor of 559 and 65? 13 Calculate the greatest common divisor of 152 and 8. 8 Calculate the greatest common divisor of 110 and 77. 11 Calculate the greatest common factor of 243 and 27. 27 Calculate the highest common factor of 4675 and 75. 25 What is the highest common factor of 1737 and 27? 9 Calculate the highest common factor of 361 and 19. 19 What is the highest common divisor of 14 and 40586? 14 What is the greatest common divisor of 2210 and 299? 13 What is the greatest common factor of 108 and 252? 36 Calculate the highest common factor of 1209 and 195. 39 Calculate the greatest common factor of 630 and 360. 90 Calculate the greatest common factor of 74 and 2. 2 What is the highest common factor of 22 and 7? 1 What is the greatest common divisor of 35 and 50120? 35 What is the highest common divisor of 48 and 36? 12 What is the highest common factor of 56 and 56? 56 What is the greatest common divisor of 21 and 1701? 21 Calculate the greatest common factor of 75 and 390. 15 What is the highest common factor of 92 and 69? 23 What is the highest common divisor of 51 and 493? 17 What is the greatest common factor of 13336 and 16? 8 What is the greatest common factor of 8652 and 7? 7 Calculate the greatest common divisor of 60 and 280. 20 Calculate the highest common factor of 8295 and 525. 105 What is the highest common divisor of 24 and 1320? 24 Calculate the highest common factor of 22 and 11. 11 Calculate the highest common factor of 288 and 1632. 96 Calculate the highest common divisor of 991 and 1. 1 What is the highest common divisor of 24 and 72? 24 What is the greatest common divisor of 43 and 129? 43 Calculate the highest common divisor of 350 and 6475. 175 What is the highest common factor of 5540 and 160? 20 Calculate the greatest common divisor of 5516 and 28. 28 What is the highest common divisor of 144 and 45? 9 What is the greatest common divisor of 70 and 910? 70 Calculate the highest common factor of 7305 and 240. 15 What is the highest common divisor of 1491 and 781? 71 What is the greatest common factor of 630 and 5166? 126 Calculate the highest common factor of 3741 and 15. 3 Calculate the highest common divisor of 4619 and 1639. 149 What is the greatest common divisor of 522 and 72? 18 Calculate the highest common factor of 1074 and 120. 6 Calculate the highest common factor of 98 and 266. 14 What is the highest common factor of 104 and 221? 13 What is the greatest common divisor of 1023 and 33? 33 What is the highest common divisor of 18 and 98? 2 What is the greatest common divisor of 270 and 240? 30 What is the greatest common divisor of 41285 and 230? 115 Calculate the highest common divisor of 17 and 85. 17 What is the greatest common factor of 690 and 300? 30 What is the greatest common divisor of 99 and 48? 3 What is the highest common factor of 32 and 11744? 32 Calculate the highest common factor of 10 and 90. 10 Calculate the greatest common divisor of 3 and 17. 1 What is the highest common factor of 306 and 578? 34 What is the highest common factor of 118 and 1829? 59 Calculate the highest common factor of 264 and 44616. 264 Calculate the highest common factor of 14 and 45080. 14 Calculate the highest common factor of 73 and 1. 1 What is the highest common divisor of 405 and 145? 5 Calculate the greatest common factor of 1131 and 117. 39 Calculate the greatest common factor of 9282 and 39. 39 What is the greatest common factor of 36428 and 28? 28 What is the greatest common factor of 574 and 49? 7 What is the greatest common divisor of 21904 and 16? 16 Calculate the highest common factor of 72 and 20028. 12 Calculate the highest common factor of 20 and 68. 4 What is the highest common factor of 84 and 84? 84 Calculate the highest common factor of 84 and 1372. 28 Calculate the highest common factor of 21810 and 15. 15 What is the highest common divisor of 194 and 9506? 194 What is the highest common factor of 204 and 84? 12 What is the greatest common divisor of 726 and 594? 66 Calculate the greatest common divisor of 154 and 7. 7 What is the greatest common divisor of 696 and 1305? 87 Calculate the highest common divisor of 448 and 420. 28 Calculate the highest common divisor of 2292 and 12. 12 Calculate the highest common factor of 1984 and 576. 64 Calculate the greatest common divisor of 1633 and 23. 23 What is the greatest common divisor of 480 and 24? 24 Calculate the greatest common factor of 165 and 3905. 55 Calculate the greatest common factor of 675 and 10. 5 What is the greatest common factor of 80 and 580? 20 Calculate the greatest common factor of 816 and 17. 17 Calculate the highest common factor of 176 and 16.	{ "pile_set_name": "DM Mathematics" }
/7)a)(-45)a(-1/4)/(a/a(-3)a) assuming a is positive. a(-2127/28) Simplify (g(-4/3)/g)(28/5)(((g*(-4)g)/g)/g)30 assuming g is positive. g(-2446/15) Simplify ((bb(1/15)b)/(b*(-3/10)b))/(b*(2/9)b*(-1/3)bb) assuming b is positive. b(-47/90) Simplify (h/((h/(h(-3/4)/h)h)/h))/(h/h*(-13/4))h*(-2/29)/(h/(h/(hhh(-11)))) assuming h is positive. h(85/29) Simplify (f/(f/(f18ff))((f/f(-11/4))/f)/f)/(f/f(1/8)f)(3/2) assuming f is positive. f(303/16) Simplify ((ii/(i((ii*6ii)/i)/iii))/i(1/2)(i/(iiii2))/i(4/7))(-22) assuming i is positive. i(2013/7) Simplify ((v(v/v1)/v)(40/7)/((v*1/vv)/v(2/5)))41 assuming v is positive. v*(-123/5) Simplify (zz*(-5)z/((z/z*(-17))/z)z)/((z/z(-7))/z(-19)) assuming z is positive. z*(-46) Simplify ((cc(1/27))/(c/(c9/c)))/(c(2/9)/c(-2/3)) assuming c is positive. c*(193/27) Simplify tt*(9/5)tt13(t(1/15)/t)/t(1/2) assuming t is positive. t(461/30) Simplify z13/((z/(zz/z11zzz))/z)z(-3/5)((z/(z*(2/19)z))/z)/z assuming z is positive. z(408/95) Simplify (g(14/9)/(g(2/9)/g))16 assuming g is positive. g*(112/3) Simplify ((n/(nn*(12/11)n))/n(-17))/((n(1/5)/nn)/(n/(((nn*12/nn)/n)/n))) assuming n is positive. n(259/55) Simplify (h2)*2/(h(h/h*(1/10))/hh(h9/h)/h) assuming h is positive. h(-49/10) Simplify ((y/(y/y1))(-1/2)y*(1/5)y(1/4))(-12) assuming y is positive. y(3/5) Simplify ((o(-2/5)o/(oo(-7)))(3/10))(3/40) assuming o is positive. o(297/2000) Simplify (((h/(h*1h)h)15)(-2/85))(2/45) assuming h is positive. 1 Simplify ((w(-6)(w/w*(-2/15))/w)/((ww/w0)/w)(-2/71))(-41) assuming w is positive. w(254938/1065) Simplify j(jj*(24/11))/jjjj/(j*(-28)jj)jj(-3)j(2/55) assuming j is positive. j(1662/55) Simplify (r(17/6)/r(-33))(-37) assuming r is positive. r(-7955/6) Simplify ((ll(3/2))/(lll11lll))/(ll(-3))(-12) assuming l is positive. l(-75/2) Simplify (u/((u(3/4)uu)/u))/uu*(-2/33)(u/(u/(uu/u(-6))))/(u/(uuu/(u(uu(-2/5))/u))) assuming u is positive. u(5009/660) Simplify (r(-1)r)*(1/23)/((rr(2/3))/r)(7/5) assuming r is positive. r(-14/15) Simplify d17/d*9(d/((dd/(d(9/5)/d)d)/d))/((dd(-7))/d) assuming d is positive. d(74/5) Simplify (u19)(-2/21)(u*0uu)/(u(-13/2)u) assuming u is positive. u(239/42) Simplify (k(4/7)k/(kk/k(-14)))/(k(-6/7)/kkkk/(k(-6/7)/k)) assuming k is positive. k(-122/7) Simplify (d(-11/2)/d(1/8))/((d/(d/((d/d27)/d)))/d(-19)) assuming d is positive. d(19/8) Simplify (((z(-3/7))(6/7))29)45 assuming z is positive. z(-23490/49) Simplify (uu/u*(-1/4)u)/((uu/u(2/3))/u)uu/(u/(u16u))u(1/13)/u assuming u is positive. u(3119/156) Simplify ((k(3/7)kk/(kk/(k/(kk/(k1k)k)))k)/((kk(3/7)/k)/(k4/k)))36 assuming k is positive. k144 Simplify (l(-2/13))44/((l/l16)/l(-10/7)) assuming l is positive. l(619/91) Simplify (r4/r9)/(r(rr((rr8/r)/rr)/r)/r)(-6/5) assuming r is positive. r(29/5) Simplify (kkk/(k/((k*(2/5)k)/k))kk)/(k*19k)k(-2/7)k(-4/23) assuming k is positive. k(-12928/805) Simplify ((oo15ooooo)(13/2))28 assuming o is positive. o3822 Simplify (i(3/8)/i(-1/9))(-3/13) assuming i is positive. i(-35/312) Simplify (s10/s(-18))/(s6)43 assuming s is positive. s(-230) Simplify (((ff(-1)/f)/f)/(ff/(ff(-2/3))f))/((ff(1/12)f)/(f/((f*6f)/f))) assuming f is positive. f(-47/4) Simplify (t(-1/34)/t*(-27))/(t/(tt*(-27))t)(3/11) assuming t is positive. t(7231/374) Simplify z*(-3)z*(2/25)(z/(z/z11))/z(1/8) assuming z is positive. z(1591/200) Simplify (f(-2/7))*(-18)f(f(-2/11)/f)/ff(-8/5) assuming f is positive. f(909/385) Simplify (r(1/6))(-2/23)((rr5)/r)40 assuming r is positive. r*(13799/69) Simplify qq/(q*(-1/8)/q)qqqq5q*(-6)/(q/(qq(1/25))) assuming q is positive. q(1033/200) Simplify (g*9/((gg*1)/gg))/(g(7/6)/(g(-12)/g)) assuming g is positive. g(-43/6) Simplify (x(-2/7)xx)12/(x2xxx/x(9/2)) assuming x is positive. x(281/14) Simplify ((o/o2)(-2/77)(o/(oo2oo))(1/12))(14/9) assuming o is positive. o(-142/297) Simplify ((o((((o*(-14/3)o)/o)/o)/o)/o)/o(9/2))/(o(-5/12)o12) assuming o is positive. o(-91/4) Simplify ((o10/(o/(o((oo/(o9/o))/o)/oo)))(-18))(5/7) assuming o is positive. o(-270/7) Simplify (h(-11)hhhh*(7/3)h)(-45) assuming h is positive. h210 Simplify (w/w(-3/11))/w(-2/9)w4w1 assuming w is positive. w(643/99) Simplify (xx6/xx(-14))/(x(-6)x)(-2/9) assuming x is positive. x(-82/9) Simplify (gg/g(2/3))(-12/5)/(gg(-8/3))(1/50) assuming g is positive. g(-19/6) Simplify (w20/w)/(w(1/41)/w)(w*(-2/19)w)/(w/w*(-30)w) assuming w is positive. w(-8670/779) Simplify (z2/z)*(-2/29)z*(-5/8)zzz*(-10)z assuming z is positive. z*(-1785/232) Simplify ((iii(5/8)i)(4/27))20 assuming i is positive. i(290/27) Simplify (((r(-12/11))(-2/11))(3/16))(4/11) assuming r is positive. r(18/1331) Simplify (ii/(i/i(-2/17)))(-4/3)/((i/i(2/33)i)/((i/i(-3))/i)) assuming i is positive. i(-65/561) Simplify ((n/(n/((n/((n*10n)/n))/n)))(2/11))(-2/17) assuming n is positive. n*(40/187) Simplify ((gg*(-1)/ggg)49g*(4/7)g/(g/g2))(29/3) assuming g is positive. g*(10469/21) Simplify (dddd(1/6))42/(d(2/13))(1/35) assuming d is positive. d*(60513/455) Simplify z/(z((z*(-1/3)/z)/z)/z)zz1/zz(-10)/(z(2/7)/z) assuming z is positive. z*(-104/21) Simplify ((b/(bb*(-6))b(b/(b/(bb/b*11))bb)/b)(6/5))35 assuming b is positive. b(-42) Simplify jj/((((j/j*(-15)j)/j)/jj)/jjj)jj0(jj1/j)/(j/((j(-7)/j)/j)) assuming j is positive. j(-23) Simplify ((x1)(1/2)x*(-1/4)/((x(x/(xx1))/x)/x))(2/33) assuming x is positive. x(3/22) Simplify v(-2/11)v*16(v*25v)/(v*(4/3)vvv) assuming v is positive. v(1237/33) Simplify (o(3/5)/o(o(-4)o)/o(o(-1)/o)(8/17))(-8/7) assuming o is positive. o(3632/595) Simplify ((u15)(2/31))41 assuming u is positive. u(1230/31) Simplify y3/y((y/((yy(-4/5)/y)/y))/yy)/y(y2)(-8) assuming y is positive. y(-61/5) Simplify (j/j(-4))/(j/(j(-15)j))j(-1/2)/(j/(jj/(jj/j(-2)j))) assuming j is positive. j(-29/2) Simplify (((f/f(4/3))/(ff1))/(f(-2/15)ff(2/7)))(-37) assuming f is positive. f(4514/35) Simplify (b(1/2))(-5/9)bb(-2)b/b*(2/9) assuming b is positive. 1/sqrt(b) Simplify (zz/(z/z*(-22))zz(-5/4)z)/(z/z(5/7))(2/21) assuming z is positive. z*(-11923/588) Simplify (ss/(s(((s(4/7)ss)/s)/ss)/s))*(1/25)((s/(s/(s/((s/(ssss/s(1/3)))/s))))/s)(-29) assuming s is positive. s(-55816/525) Simplify mm*7mmm/((m(mm*(-3/4))/m)/m)m*(3/16)mm(m*(2/3)m)/mm assuming m is positive. m(749/48) Simplify (((gg*(-2/3)/ggg)/g(-4))(-26/5))(-18) assuming g is positive. g(2496/5) Simplify (g/(g/g(1/4))g9)/(g(-2))(-4/13) assuming g is positive. g(449/52) Simplify h/(h/h*9)h/h*(-1/16)h*(-1/10)h/h10 assuming h is positive. h(77/80) Simplify (((jj((jj/(j/(jj/j*(1/5)))j)/j)/jj)/(jj/(j/j(1/2))))(-3/26))(-1/10) assuming j is positive. j(99/2600) Simplify (((oo(-3)/o)/(o(-9)o))/(oo10o(8/5)))(-10/17) assuming o is positive. o(76/17) Simplify ((k(-3/8)/k(-1))(-1/5))(-19) assuming k is positive. k(19/8) Simplify (www*26w/w(-10))/((w/(w(-19)/w)w)/w)(8/11) assuming w is positive. w(261/11) Simplify (a(1/2)/aa)/a*(3/4)(aaa(aa*(-5)a)/aa)/a(-4/7) assuming a is positive. a(9/28) Simplify (bb*(-1/3)/b(b/b*(-1/7))/b)/(b/(b/(bb/((b*22/b)/b)bb))b/(b/b*(1/33)b)) assuming b is positive. b*(1292/77) Simplify (w/(www(-1/36)w))*(3/19)((w/(w*(-13)/w))/ww)/((w/(w/(ww1)))/w) assuming w is positive. w(3121/228) Simplify (g/(g/g(1/16)))/g17g(-1/6)/g8 assuming g is positive. g(-1205/48) Simplify s/(s(-30)/s)s*(	{ "pile_set_name": "DM Mathematics" }
ncreasing order. -3, 1/8, 0.26, 4 Sort 1/11, -16/11, -0.5 in ascending order. -16/11, -0.5, 1/11 Sort 0, 4, -549. -549, 0, 4 Put 1.12, -2/3, -1, -3/4, 6 in decreasing order. 6, 1.12, -2/3, -3/4, -1 Sort 4, -13, -2, -12. -13, -12, -2, 4 Sort -158, 8, 7 in increasing order. -158, 7, 8 Sort -5, -469, 1 in descending order. 1, -5, -469 Sort 53, -5, 4, -4, 3. -5, -4, 3, 4, 53 Sort -4, 1, 0, -1, 5 in descending order. 5, 1, 0, -1, -4 Sort 0, -33, -2/7, -0.1, 6 in descending order. 6, 0, -0.1, -2/7, -33 Sort 4, 1, -4, 0.15 in descending order. 4, 1, 0.15, -4 Put -5, 4, -2, -47, 2/3 in increasing order. -47, -5, -2, 2/3, 4 Sort 1, 4, 0, -3, -2. -3, -2, 0, 1, 4 Sort -3, -1, 16, -2, 3 in increasing order. -3, -2, -1, 3, 16 Sort -4, 7, 57 in increasing order. -4, 7, 57 Sort 1, -7, 3, -23 in decreasing order. 3, 1, -7, -23 Put -4, 17, 5 in descending order. 17, 5, -4 Put 1/4, 1, 55, -5 in increasing order. -5, 1/4, 1, 55 Sort 0, 2, -207 in decreasing order. 2, 0, -207 Sort 4, 6, 0.4 in descending order. 6, 4, 0.4 Put 12/7, -0.3, -1/7, -0.1 in decreasing order. 12/7, -0.1, -1/7, -0.3 Sort 2, 40, -0.2 in decreasing order. 40, 2, -0.2 Put -0.2, 0.266, -0.1 in ascending order. -0.2, -0.1, 0.266 Sort -6/13, -2/9, -1/8 in descending order. -1/8, -2/9, -6/13 Put 2/9, 3, -4, 5/21 in decreasing order. 3, 5/21, 2/9, -4 Sort 0, -1/5, 0.1. -1/5, 0, 0.1 Sort -4/5, -0.5, -0.2, -13/10, -2 in increasing order. -2, -13/10, -4/5, -0.5, -0.2 Put -2, -1/5, 1/4, 4 in decreasing order. 4, 1/4, -1/5, -2 Sort 2, -2, 5, 0 in ascending order. -2, 0, 2, 5 Sort -18, -0.2, 1.2. -18, -0.2, 1.2 Sort 5, 4, -24, -34 in descending order. 5, 4, -24, -34 Sort -1, 0, 4, -47 in increasing order. -47, -1, 0, 4 Put 17, 1, -4 in increasing order. -4, 1, 17 Sort -19.2, 2, 2/19 in ascending order. -19.2, 2/19, 2 Put 0.1, -0.5, -4, -7/17 in decreasing order. 0.1, -7/17, -0.5, -4 Sort 4, 2, 0 in descending order. 4, 2, 0 Sort -5, 2, -2, -14 in ascending order. -14, -5, -2, 2 Put -26, -3, 4, -2 in increasing order. -26, -3, -2, 4 Put 7, -5, -1, 2/5 in decreasing order. 7, 2/5, -1, -5 Put -279, 0, 2 in decreasing order. 2, 0, -279 Sort 13, -4, 69, 0 in descending order. 69, 13, 0, -4 Sort -2, -3, 252, 5, 0. -3, -2, 0, 5, 252 Put 0.1, -220, 4/7, 1/4 in decreasing order. 4/7, 1/4, 0.1, -220 Put 12, 3, -5, -1 in decreasing order. 12, 3, -1, -5 Sort -3/8, 0.1, -2/15. -3/8, -2/15, 0.1 Sort 1, -5, 1308 in increasing order. -5, 1, 1308 Sort -5, 3, -4, -3 in decreasing order. 3, -3, -4, -5 Put 2, -0.09, -0.1 in increasing order. -0.1, -0.09, 2 Put -0.26, 0.4, 4/3 in increasing order. -0.26, 0.4, 4/3 Put 0, 4/25, -1/7 in decreasing order. 4/25, 0, -1/7 Put 6, 2, 17 in descending order. 17, 6, 2 Put 3/7, 1, -3, 35 in increasing order. -3, 3/7, 1, 35 Sort -232, -0.5, -2/5 in increasing order. -232, -0.5, -2/5 Put 29.8, 4, -1/2, -0.3, 0.2 in descending order. 29.8, 4, 0.2, -0.3, -1/2 Sort 4/3, 0.5, -2/199 in decreasing order. 4/3, 0.5, -2/199 Put -10, 4, 2, -15, -1 in descending order. 4, 2, -1, -10, -15 Sort -1, 1.6, 5 in increasing order. -1, 1.6, 5 Sort 2, -1, 5, -1/7. -1, -1/7, 2, 5 Sort -1/4, -2/5, -490, -4/5 in increasing order. -490, -4/5, -2/5, -1/4 Put 0.4, -2, 5, -18 in decreasing order. 5, 0.4, -2, -18 Put -11, 0, 5 in increasing order. -11, 0, 5 Sort 0.5, 1.218, 5 in decreasing order. 5, 1.218, 0.5 Put -1, 14, -5 in decreasing order. 14, -1, -5 Sort 4, 3, -32 in ascending order. -32, 3, 4 Put 0, 11, 2, -14, -5 in ascending order. -14, -5, 0, 2, 11 Put 2, -3, -2, 16 in descending order. 16, 2, -2, -3 Sort 140, 48, -3 in decreasing order. 140, 48, -3 Put 4, -11, 5, 7 in descending order. 7, 5, 4, -11 Put 3, 4, -209 in descending order. 4, 3, -209 Put 38, 0.08, 0 in increasing order. 0, 0.08, 38 Sort -3, 131, 0 in ascending order. -3, 0, 131 Put 2/9, -13, 0.5, -2 in descending order. 0.5, 2/9, -2, -13 Sort 0.01, 0.1, -1.4. -1.4, 0.01, 0.1 Put -2, -36, 2, 3, 1 in descending order. 3, 2, 1, -2, -36 Put 2/9, 4, -0.3, -44 in decreasing order. 4, 2/9, -0.3, -44 Sort 2, 2/9, -0.3 in descending order. 2, 2/9, -0.3 Sort 0, -9, -1 in ascending order. -9, -1, 0 Sort 2/7, 1.6, 2/5, -1.1 in decreasing order. 1.6, 2/5, 2/7, -1.1 Sort 5, 13, -5 in descending order. 13, 5, -5 Sort 86, 0.4, 6 in decreasing order. 86, 6, 0.4 Sort 83, 2, -2. -2, 2, 83 Sort -2, 11, 0, 2 in ascending order. -2, 0, 2, 11 Sort -1/7, -0.1, 4/9, -2/15, 2 in decreasing order. 2, 4/9, -0.1, -2/15, -1/7 Sort 2, -0.2, -5, 1/6. -5, -0.2, 1/6, 2 Sort 5, 3, 4, 14. 3, 4, 5, 14 Sort 10, -5, 12 in decreasing order. 12, 10, -5 Put -3, 1.06, 0.5 in descending order. 1.06, 0.5, -3 Put 36, -25, 2 in decreasing order. 36, 2, -25 Sort -5, 52, -1 in ascending order. -5, -1, 52 Put -3, -4, 0, 6, -30 in decreasing order. 6, 0, -3, -4, -30 Sort 4, -8, 3, -2 in increasing order. -8, -2, 3, 4 Put -3, -15, -1 in decreasing order. -1, -3, -15 Sort -2, -6, -1, 5, 34 in ascending order. -6, -2, -1, 5, 34 Put 2, -5, -31, 5 in decreasing order. 5, 2, -5, -31 Put -352, 0, -1 in decreasing order. 0, -1, -352 Put -0.5, -0.3, 2/15, 4, -3/2 in decreasing order. 4, 2/15, -0.3, -0.5, -3/2 Sort -8, 1/8, 10 in ascending order. -8, 1/8, 10 Sort -1, 2, 27 in descending order. 27, 2, -1 Put -3, 136, 5 in decreasing order. 136, 5, -3 Sort 0.4, -0.5, 7, -4, -22. -22, -4, -0.5, 0.4, 7 Sort 72, 3, -14 in descending order. 72, 3, -14 Sort 1/21, -0.3, -5, 0.2, 1/25. -5, -0.3, 1/25, 1/21, 0.2 Put -0.3, -5, -0.2, 0.1, -6 in descending order. 0.1, -0.2, -0.3, -5, -6 Put 6, 3, -3, 42, 0 in ascending order. -3, 0, 3, 6, 42 Sort 6, 2/3, 2/9, -2 in ascending order. -2, 2/9, 2/3, 6 Sort 2, -22, 5, 1. -22, 1, 2, 5 Sort 3, -3, -153, -5, -4. -153, -5, -4, -3, 3 Put 4, -3, 0, 5 in decreasing order. 5, 4, 0, -3 Sort -7, -2, -6 in increasing order. -7, -6, -2 Sort 5, 867, 1 in descending order. 867, 5, 1 Sort 32, 2/33, -5, -4/5 in descending order. 32, 2/33, -4/5, -5 Sort -3, -1, 13, 3 in increasing order. -3, -1, 3, 13 Sort 0.05, -0.4, 5/6, 5, -3. -3, -0.4, 0.05, 5/6, 5 Sort -1, 5, 4, -3 in ascending order. -3, -1, 4, 5 Put -8, -126, -5 in descending order. -5, -8, -126 Put 5, -5, 2/19, 1/2 in descending order. 5, 1/2, 2/19, -5 Sort -0.2, 0, -3, 0.6 in increasing order. -3, -0.2, 0, 0.6 Sort -7, -5, -9, 5, 6. -9, -7, -5, 5, 6 Sort -1, 17, 0, 5, 9. -1, 0, 5, 9, 17 Put 4, 1/5, -1, 1 in descending order. 4, 1, 1/5, -1 Put 0.2, 2/5, -0.3, -0.1 in ascending order. -0.3, -0.1, 0.2, 2/5 Sort -4, 458, 5 in decreasing order. 458, 5, -4 Put 5/2, -5, -31, 0 in increasing order. -31, -5, 0, 5/2 Put 2, 3, 1/81, 1/2 in descending order. 3, 2, 1/2, 1/81 Put -105, 0, -168 in ascending order. -168, -105, 0 Sort 0.055, -0.09, 3/8, 1 in ascending order. -0.09, 0.055, 3/8, 1 Sort 331, 1, -1, -2 in ascending order. -2, -1, 1, 331 Sort -0.05, -3/8, 3 in descending order. 3, -0.05, -3/8 Put -40, -6, -1, -3 in decreasing order. -1, -3, -6, -40 Sort -1, 0, 1, 47 in descending order. 47, 1, 0, -1 Put -2, -1, -21, 1 in decreasing order. 1, -1, -2, -21 Put 0.5, 2/7, -5 in decreasing order. 0.5, 2/7, -5 Put -1/19, -3, -5, 5, 3 in descending order. 5, 3, -1/19, -3, -5 Put -1, 3, -582 in ascending order. -582, -1, 3 Sort -4, 0.28, -3/4 in descending order. 0.28, -3/4, -4 Put 2, 10, 1 in decreasing order. 10, 2, 1 Put -6, -1/2, -5, -3/2 in descending order. -1/2, -3/2, -5, -6 Sort -42, -2, -3. -42, -3, -2 Sort 5, 4, 1, -14, 2 in descending order. 5, 4, 2, 1, -14 Sort -5, -11, 0 in descending order. 0, -5, -11 Put -1, -23, -0.5, 0.3 in decreasing order. 0.3, -0.5, -1, -23 Put 13, 3, -6 in decreasing order. 13, 3, -6 Sort -1, 4, 0, -2, 2 in descending order. 4, 2, 0, -1, -2 Put 11, -17, 22 in ascending order. -17, 11, 22 Sort 0, -4, -213 in increasing order. -213, -4, 0 Sort 4, -1, 1/8 in ascending order. -1, 1/8, 4 Put -3/71, 0, -0.4, 0.4 in ascending order. -0.4, -3/71, 0, 0.4 Sort 0.4, -61, -1/3, -0.4. -61, -0.4, -1/3, 0.4 Sort -25, 1, 9. -25, 1, 9 Put 1/128, -23, -2 in increasing order. -23, -2, 1/128 Sort 2601, -0.1, -0.5, 0.2, 1. -0.5, -0.1, 0.2, 1, 2601 Sort 2, -0.101, -7. -7, -0.101, 2 Sort 1, -3, 3, 29 in decreasing order. 29, 3, 1, -3 Put 4, -2/7, -3, -0.4, -10/71 in increasing order. -3, -0.4, -2/7, -10/71, 4 Sort 22, -14, -1. -14, -1, 22 Put 1, 5, 30, -1 in increasing order. -1, 1, 5, 30 Put 2, -7, 3, 2/17 in descendin	{ "pile_set_name": "DM Mathematics" }
= -h*2 - h + 1. Let k(l) = zm(l) - g(l). Is k(5) a multiple of 3? True Let m(s) = s3 - s2 - 2. Let f be m(2). Suppose 8 = fu - 6. Is 3 a factor of u? False Let l(x) = -5x*3 + 14x*2 - 20x - 9. Let d(n) = n*3 - 3n*2 + 4n + 2. Let g(p) = 11d(p) + 2l(p). Let k be g(4). Does 9 divide ((-6)/k)/((-6)/88)? False Let l(d) = -d*2 + 7d - 2. Suppose 3v + 2v = -30. Let p be 68/18 - v/27. Does 4 divide l(p)? False Let l = -37 - -100. Does 19 divide l? False Suppose -2f + 128 = -4y, -f - 3y + 49 = -0y. Is f a multiple of 26? False Let i be 181/(1 + 1). Suppose -101 = -2s - i. Is s a multiple of 11? False Let i be 70 - (8 - (0 - -4)). Suppose i = 4w + p, 5p = 4w - 0w - 78. Does 7 divide w? False Suppose 7 = 3g + 16. Let w(d) = -3d - 4. Does 2 divide w(g)? False Let l = 43 - 25. Is l a multiple of 6? True Let r(l) = l*3 + 5l*2 - 6l. Let j be r(-6). Let x(i) = i + 21. Is x(j) a multiple of 21? True Let k = 62 - 42. Is k even? True Let c be (4/(-14))/(6/(-84)). Suppose -18 = -cg + g. Is g a multiple of 6? True Let k(r) = r3 + r2 - 2r + 2. Suppose 0n + 4n - 8 = 0. Is 5 a factor of k(n)? True Does 9 divide (31 + 4)1 - -1? True Let v(d) = -d3 - 5d*2 - 3d - 2. Let u(a) = a - 9. Let k be u(6). Let f be v(k). Is (-123)/f - 2/11 a multiple of 11? True Let h = 21 - 16. Suppose -63 = -2z - 5n, 2z = hn + 28 + 5. Is 8 a factor of z? True Let h(a) = -2a3 - 9a*2 - 12a + 3. Let j(l) = l*3 + 5l*2 + 6l - 1. Let t(z) = 2h(z) + 5j(z). Let n be t(-6). Is 10 a factor of 16 + (1 - (n + -1))? False Suppose 2v = 5m - 0 + 2, -v = -2m. Let d = m - -4. Is d even? True Does 2 divide 42/(-4)8/(-6)? True Let z(c) = 8c + 8. Does 14 divide z(2)? False Let h(g) = -g + 14. Let q be h(8). Suppose qz - 13 = 5z. Is 8 a factor of z? False Suppose 0 = -3c + 114 + 222. Is c a multiple of 14? True Suppose 0 = -0c + 5c. Does 13 divide 24 - (-5 - -3) - c? True Suppose 3j - 9 = -0j. Let q be 10-10j/(-12). Suppose 0 = 3m - q - 53. Does 15 divide m? False Let t be (-7)/(-28) - (-18)/(-8). Does 3 divide 11/(-22) + (-13)/t? True Suppose 2q + q = -t - 5, 4q + 50 = 3t. Does 3 divide t? False Let v(j) = -6j + 15. Let q be v(-8). Suppose -q - 81 = -4h. Is h a multiple of 10? False Suppose 2q = 88 + 88. Does 11 divide q? True Let o be 3(150/9 + -2). Let k = -26 + o. Does 9 divide k? True Suppose -8g + 90 = -5g. Is g a multiple of 6? True Is 26 a factor of ((-453)/6 - 2)/((-4)/8)? False Suppose -c = -3g - 35 - 58, -c + 4g + 98 = 0. Is 18 a factor of c? False Suppose 2m = 2d + 2d - 658, 4m + 506 = 3d. Is d a multiple of 27? True Let g = -120 + -101. Let w = 102 + g. Does 15 divide 1/4 - w/4? True Suppose 2l = -a + 37, a = -4l - 2 + 75. Suppose -2c + 3v = -41, l = -4c + 5c - 4v. Suppose 2x + 6p - c = p, -p = -2x + 10. Is 3 a factor of x? True Suppose 3c = 158 - 47. Is 3 a factor of c? False Let g(s) = -2s3 + s2 + 4s + 4. Let v be g(-3). Let h = -19 + v. Is h a multiple of 12? True Let s(d) = -2d. Let p(r) = 9r*3 + 15r*2 + r + 21. Let a(l) = 4l*3 + 7l*2 + 10. Let c(i) = 7a(i) - 3p(i). Let t be c(-5). Does 6 divide s(t)? True Suppose -3j + 82 = m - 2m, 2j - 83 = -5m. Let g = -17 + j. Does 12 divide g? True Suppose 7p - 1 = 6p. Is (-104)/(-4)(p + 0) a multiple of 13? True Suppose -5v = 1 + 4. Let o be ((-5)/((-5)/(-201)))/v. Suppose -5b - 51 = -o. Is b a multiple of 10? True Let z(q) = -q*3 - 6q*2 + 2q + 7. Let l be z(-6). Let k be 2/l - (-2)/5. Is (-19)/(-4)(4 + k) a multiple of 17? False Let w = -28 + 59. Let x = w - 13. Is x a multiple of 18? True Suppose 2 = 2s - 3s. Let g be 9/s4/(-6). Let a(p) = 3p - 4. Is a(g) a multiple of 5? True Suppose 2f - 3f = p - 200, -p + 5f = -230. Does 7 divide p? False Suppose -65 = -3q - 2q. Suppose -4k + 70 = b + 28, -k + b = -q. Does 5 divide k? False Let w(p) = 4p - 5. Let o(b) = -9b + 11. Let u(m) = -2o(m) - 5w(m). Let d be u(2). Is 15 a factor of (4 - 2)/d - -17? True Suppose u + 3u = 0. Suppose -6c + 2c + 12 = u. Suppose -ca = -3 - 30. Is a a multiple of 10? False Suppose -3g - 8 - 4 = 0, 2y + 4 = -g. Let u(a) = a2 + 4a - 23. Let o(d) = 2d2 + 7d - 47. Let m(s) = -4o(s) + 7u(s). Does 7 divide m(y)? False Suppose 4p + p + s = -228, 0 = 4s - 8. Let b = p + 88. Is b a multiple of 16? False Suppose 3d - m = 132, -4d + 5m = -6d + 88. Does 16 divide d? False Let t = -31 + 10. Let u = -12 - t. Is 5 a factor of u? False Let q be ((-2)/4)/((-5)/10). Suppose -q + 0 = -v. Does 6 divide (v/3)/(1/69)? False Suppose -b + 2q + 55 = 4q, -5b - 4q + 251 = 0. Is 20 a factor of b? False Suppose -37 = -7p - 9. Suppose -pt - t + 75 = 0. Does 4 divide t? False Let l = -57 - 3. Let v be 43-21/2. Let z = v - l. Is z a multiple of 17? True Let i(g) = 2g2 - 8g - 1. Suppose 9o - 4o + 3u - 39 = 0, -3o = -u - 15. Does 12 divide i(o)? False Is 4 a factor of (-47)/(-4) + 1/4? True Let p(g) = -g2. Let j be p(0). Let a(k) = -k2 + 15. Is 5 a factor of a(j)? True Let r = -4 - -4. Suppose -3d - v + rv + 50 = 0, 3d - 3v - 42 = 0. Is 14 a factor of d? False Let y be ((-2)/(-7))/(-1)-14. Suppose 108 = yq - 192. Is q a multiple of 25? True Let d be (-1)/(2 - (-85)/(-43)). Let r be -2(2 + d/2). Let m = 65 - r. Is 13 a factor of m? True Suppose 4b - 5j = -j + 8, 2b + 4j = -8. Does 14 divide -2 + b/(-2) - -71? False Suppose 62 = 5r - 4q, 2r + 2q = 7q + 18. Let u be 0/6 + r2. Suppose -b - 4 + u = 0. Is 8 a factor of b? True Let g = 9 + -6. Let l = 5 - g. Is 5 a factor of (l/3)/((-4)/(-78))? False Let r(b) = b + 30. Is r(8) a multiple of 4? False Suppose -12o + 5h + 245 = -8o, -h = o - 59. Is o a multiple of 13? False Suppose -c + w = 27, 0c = -3c - 5w - 89. Does 7 divide (c/(-6))/(8/12)? True Let g be (-1128)/(-27) - 4/(-18). Suppose -t = -0t - g. Suppose s - 2s = -t. Does 12 divide s? False Let w(h) = 65h - 8. Does 17 divide w(3)? True Let u be 6/(-4)(-16)/3. Suppose -q + x + 2 = -4, -19 = -4q + 3x. Let o = q + u. Does 3 divide o? True Let n be 6(1/(-2) + 2). Let g(m) = -6m3 - 3m*2 - 7m - 11. Let a(w) = -3w3 - w2 - 3w - 5. Let q(t) = na(t) - 4g(t). Is 15 a factor of q(-2)? False Let c(y) = y*3 + 18y*2 + 16y - 15. Let l be c(-17). Suppose 3j = lj + 9. Is j even? False Let v = -7 + 6. Let m = v - -1. Suppose mz - 5p - 8 = -z, -4z + 4p + 64 = 0. Is 9 a factor of z? True Let v = 22 + 49. Suppose -v = -5w + 124. Is 13 a factor of w? True Suppose -2q = -3m - 15, -5m = -3q + 15 + 9. Let y be (-1)/q + 385/21. Let x = 27 - y. Is 9 a factor of x? True Let s(z) be the second derivative of 9z*4/2 + 2z. Does 27 divide s(-1)? True Suppose 0 = -4u - 103 + 383. Is u a multiple of 9? False Let r(k) = k2 - 1. Suppose 5l + 4n - 2 = 0, -5l + 7 = n - 1. Let t be r(l). Let j = 8 + t. Is j a multiple of 8? False Suppose 0 = -c - p + 48, 148 = 3c + 5p - 3p. Does 13 divide c? True Suppose 2o - 2 = 2c, 0o - 2c - 2 = 5o. Suppose -3i = -oi - 57. Is 4 a factor of i? False Suppose p + z + 11 = -3p, -4 = -4p - 4z. Let d be (-2)/8 - 21/p. Suppose -115 = -5u - 4s, du + 0s - 2s - 85 = 0. Is 11 a factor of u? False Let h = 75 - -7. Suppose -o + 59 = 2l - 3, 3l = 4o + h. Is 22 a factor of l? False Let z = 1 - 2. Suppose 2k + h - 74 = -0k, -110 = -3k - h. Does 10 divide k/2 + -1 + z? False Let y = 7 + -3. Suppose -4x + 7x + 15 = 0, -yx = 4a - 76. Does 12 divide a? True Let z(a) = 48a3 - a2 - a + 2. Is z(1) a multiple of 16? True Let b = -15 + 31. Is 11 a factor of b? False Suppose -g + 2p - 4 = -0g, 0 = 2p - 6. Suppose q - g = -0q. Does 2 divide q? True Suppose 4f = -5u - 0f - 37, 4f - 8 = 0. Does 12 divide -1u/618? False Suppose 45 = 2l + 3l. Let p = l - 2. Is 3 a factor of p? False Let o(n) = n - 3. Let r(h) = -3h + 5. Let c(g) = 5o(g) + 2r(g). Is c(-11) a multiple of 5? False Let r(p) = p - 5. Let y be r(4). Let j = -8 + y. Let q(t) = t*3 + 10t*2 + 8t + 11. Is 13 a factor of q(j)? False Let b be (4/(-6))/((-10)/45). Suppose 0 = 3o + 6 + b. Is 12 a factor of (11 + o)(1 - -2)? True Suppose 4s - 50 = -s. Is s even? True Suppose -184 = -5f + 236. Is f a multiple of 17? False Let i(o) = o*2 - 6o + 13. Is i(12) a multiple of 17? True Suppo	{ "pile_set_name": "DM Mathematics" }
True Is 32720347955 a composite number? True Is 6977650859 a composite number? True Is 6760847609 prime? True Is 2726168257 a composite number? False Is 191177659 prime? False Is 10779435077 prime? False Is 18397330547 prime? True Is 13165578799 prime? False Is 636467669 a prime number? False Is 43610455397 composite? True Is 32852039459 composite? False Is 125156849791 a prime number? False Is 965992691 composite? False Is 6506614337 composite? True Is 47534650573 a prime number? False Is 1499921243 composite? False Is 11930799641 a composite number? False Is 94350900635 composite? True Is 34139095855 composite? True Is 1496480941 a composite number? False Is 1525212635 a composite number? True Is 139131722309 composite? False Is 110955457527 prime? False Is 23951011961 a prime number? True Is 780119713 prime? False Is 3991206343 a composite number? False Is 832340993 a prime number? False Is 873791339 composite? True Is 2633511434 prime? False Is 7907571493 prime? True Is 1376628119 a composite number? False Is 172291082477 composite? False Is 22925974811 prime? False Is 22293710057 composite? False Is 221957849 prime? True Is 6321534559 prime? False Is 27071036651 a prime number? True Is 242814549801 a prime number? False Is 11172727 a composite number? True Is 1879215839 prime? True Is 118114141 composite? True Is 8712832253 a prime number? True Is 53834711173 prime? False Is 3315104999 a composite number? False Is 1444261289 a prime number? False Is 17218422145 a composite number? True Is 1279578367 a composite number? True Is 289989443 prime? False Is 1934839006 a composite number? True Is 22699782331 composite? False Is 2447955289 prime? False Is 4563517739 a composite number? True Is 22353183131 a prime number? True Is 9141522365 a composite number? True Is 961814743 a prime number? False Is 2658496177 prime? True Is 57655461917 composite? False Is 68247307 a prime number? False Is 408801665 a prime number? False Is 731742841 a composite number? False Is 61439381 a composite number? False Is 2010603779 a prime number? True Is 5241832103 a composite number? False Is 1200460385357 composite? False Is 58466633 a prime number? False Is 480607009 prime? False Is 1896223787 prime? True Is 904090223 a composite number? False Is 637104463 composite? True Is 22968034373 a composite number? True Is 59972065103 a prime number? True Is 703556669 composite? True Is 85932654109 prime? False Is 14051808313 prime? True Is 15058982039 a composite number? True Is 637646173 a prime number? False Is 6177391709 a prime number? True Is 30646920511 prime? False Is 2451344089 a prime number? True Is 163927727 a prime number? True Is 7117216791 composite? True Is 35978587457 a composite number? True Is 13862159303 prime? False Is 1811750273 a composite number? True Is 10681898207 a prime number? True Is 201466361 a prime number? False Is 27976744361 composite? True Is 53256309 prime? False Is 64157601749 prime? False Is 4054354859 a composite number? False Is 112886999003 prime? True Is 1027921651 prime? False Is 3580098605 a composite number? True Is 986095553 composite? False Is 70254284327 a prime number? False Is 75523453 composite? True Is 92653655179 composite? True Is 25521987991 a composite number? False Is 55054541 prime? True Is 16662356237 a composite number? True Is 501879869 composite? False Is 8670512441 a prime number? True Is 184636772899 a prime number? True Is 367936013 a composite number? True Is 9481318441 prime? False Is 51874132801 a composite number? False Is 2145600385 a composite number? True Is 116184073 a composite number? True Is 8359177669 prime? True Is 2364576358 prime? False Is 7313639449 prime? False Is 8581007009 a composite number? False Is 14329038557 composite? True Is 8267864911 prime? True Is 193234092863 a composite number? True Is 1980020401 prime? False Is 20860648903 composite? True Is 118694429 prime? False Is 1565493497 prime? True Is 2971589077 a composite number? False Is 27211602893 prime? False Is 384557269 composite? True Is 103955264573 a composite number? False Is 3158407861 a composite number? True Is 112318207 a prime number? True Is 308253115 a composite number? True Is 40917470222 a prime number? False Is 871937678 a prime number? False Is 1685045281 prime? False Is 918609899 prime? True Is 6651126571 a composite number? False Is 321141395981 prime? False Is 430205495 a prime number? False Is 1359062717 a prime number? True Is 13958354929 prime? True Is 116746501 prime? False Is 26035656005 composite? True Is 43972129 prime? True Is 154577745007 prime? False Is 4860969173 prime? True Is 651517057 composite? True Is 28915396769 composite? True Is 185583347 a prime number? True Is 9054269009 prime? True Is 4295050051 a prime number? False Is 14162320423 a prime number? True Is 2480636849 prime? True Is 2115738929 prime? True Is 752129701 a prime number? True Is 525727103 composite? True Is 100627421 prime? True Is 25436579731 a composite number? True Is 50999198231 a composite number? True Is 2122495633 composite? True Is 1063141451 a prime number? True Is 12023870354 prime? False Is 7065514769 prime? False Is 349533913 prime? True Is 69427731151 prime? True Is 5804584699 composite? True Is 1844084531 prime? False Is 338720807 composite? False Is 299646329 a composite number? True Is 971586911 a composite number? True Is 48411137213 a composite number? True Is 7664123354 a composite number? True Is 1443165161 prime? True Is 8873145907 a composite number? True Is 334049581 a prime number? True Is 5210778037 a prime number? False Is 895444411 prime? True Is 56316707 composite? False Is 9294376835 composite? True Is 14359959373 prime? True Is 11085565397 composite? False Is 645824087 a prime number? False Is 19453932907 a prime number? False Is 131794571 a prime number? False Is 8658121291 a prime number? False Is 648672943 a composite number? True Is 667102561 prime? False Is 6557651 a composite number? False Is 675185339 composite? False Is 4658241623 a composite number? True Is 11894197013 a composite number? False Is 49898972977 prime? False Is 1967686387 a composite number? True Is 85499797909 a composite number? True Is 5008243802 a composite number? True Is 54413129 composite? True Is 874534867 prime? True Is 1988084311 composite? False Is 13588019015 a composite number? True Is 20643537133 a composite number? False Is 3135564473 prime? False Is 205634878 a composite number? True Is 1515229429 a prime number? False Is 13979581333 composite? False Is 687813443 composite? False Is 13147341989 a prime number? False Is 8600912711 prime? False Is 6670723291 a prime number? False Is 100774234439 a prime number? False Is 949065659 a composite number? False Is 6046551835 a composite number? True Is 30157567949 a composite number? True Is 170591498477 prime? True Is 11127754779 prime? False Is 351105397 composite? True Is 2338806247 a composite number? False Is 1838641559 composite? False Is 1987763761 prime? True Is 16472595691 prime? True Is 1048112101 a prime number? False Is 179541352281 prime? False Is 995853499 a prime number? True Is 281043659047 a prime number? False Is 24638402251 composite? False Is 6295930217 composite? False Is 97064083 prime? False Is 2367583733 a composite number? False Is 4285873299 a composite number? True Is 329045531 a composite number? False Is 24370977737 a composite number? False Is 3808140163 composite? False Is 363233987 a prime number? True Is 110758157 composite? False Is 99355849 prime? True Is 705427831 a prime number? True Is 192852503 prime? True Is 6640379923 a prime number? True Is 20691513221 prime? True Is 3351439519 a composite number? True Is 10148936671 a composite number? True Is 228725323 prime? True Is 7371479171 composite? True Is 942679711 composite? False Is 14700305573 prime? False Is 708940129 prime? True Is 107789965313 a composite number? True Is 186749604401 prime? False Is 47065339 a prime number? False Is 1810820629 a prime number? False Is 832864997 prime? True Is 65770975429 composite? False Is 232128257399 composite? True Is 14031978011 a composite number? False Is 70502387 a composite number? True Is 1471681637 prime? False Is 7789225517	{ "pile_set_name": "DM Mathematics" }
-5 Let d(w) = 28w2 + 7w - 2. Suppose 6o = -3o + 9. Let v be d(o). Solve -5k - v = -8 for k. -5 Let k = 625 - 611. Suppose -13 = kt - 41. Solve -tn + 8n - 6 = 0 for n. 1 Let f = 440 - 402. Suppose 0 = 20i - f - 2. Solve 3q - q - i = 0 for q. 1 Let f(w) = -w*2 - 15w + 161. Let a be f(-22). Suppose 10 - 2 = 2c. Suppose -az = -cz - 6. Solve -s - zs = -15 for s. 5 Let b(f) = -173 + 75 - 24f + 100 + 2f*2. Let q be b(12). Solve qn - 3 = -n for n. 1 Suppose 2c - 6 = 7m, 4m - 12 = 3m - 4c. Solve -8f + 9f = -mf for f. 0 Let b = -2232 - -2248. Solve 13q = -bq for q. 0 Let g = -354 + 335. Let y(l) = -4l2 - 78l - 34. Let w be y(g). Solve 0 = 2o + w - 8 for o. 2 Let w be (31 - (1 - 2))(-231 - -251). Solve -w = 12s - 580 for s. -5 Suppose 10s - 102 - 8 = 0. Suppose -4r - r + s = 4q, 2q + 8 = 2r. Suppose -6 + 21 = rt. Solve 0 = -tu - 32 + 12 for u. -4 Let k be 96/(-160)10/(-6). Suppose m - 5o = 7, 5m + o = -3o + 6. Let r(v) = -v*3 + 11v*2 - 10v + 7. Let h be r(10). Solve h = my + k for y. 3 Suppose 4z = -4b + 48, -155z + 151z - 12 = -2b. Solve -bh = 6h - 32 for h. 2 Let y(b) = 7b2 - 5b - 15. Let v(r) = -11r2 + 8r + 23. Let z(i) = 5v(i) + 8y(i). Let u be z(-3). Solve -ua + 5 = a for a. 1 Let t(g) = g2 - 2g - 2g2 + 10g - 6 - 1. Let r be t(7). Suppose h - 7 - 11 = -3z, r = h - 4z + 3. Solve 0i - 3i - h = 0 for i. -3 Let y(g) = -13g - 69. Let l be y(-6). Suppose ln - 221 + 41 = 0. Solve 7o = 12o + n for o. -4 Let s(t) = -t*3 - 12t*2 + 92t + 1113. Let h be s(-13). Solve -hx = -97x + 55 for x. 5 Let v be (3(-1 + (-14)/(-6)))/((-5)/(-30)). Solve vp - 10p + 70 = 0 for p. -5 Suppose 10 = 5k - 3l + 2, -3k = 2l - 20. Suppose 0 = -kq - 2 + 22. Solve qg = 6g - 2 for g. 2 Suppose 2u + 13t - 8t - 35 = 0, 4u + 2t - 46 = 0. Suppose -u = -48k + 46k. Solve -j = kj - 18 for j. 3 Let i be (-204)/(-21) + 16/56. Let f(r) = 3r - 2. Let t be f(2). Suppose 2 = 2m - 5c - 8, -i = -tm + 5c. Solve ml - 16 = 4l for l. -4 Let l(g) = g3 + 8g*2 + 6g - 6. Let p be l(-7). Suppose -73 = -30u - 115u + 797. Solve 7n = un - p for n. -1 Let t(d) = 5d - 32. Let z be t(-22). Let p = z - -147. Solve pv + 5 = -20 for v. -5 Let n be 22 + 1 - (-4 + (11 - -2)). Solve -44p = n + 30 for p. -1 Let c be -50((-90)/6 + 14). Solve -5a + 180 = -ca for a. -4 Let c(p) = 3p3 + p2 - 34p + 35. Let t be c(1). Solve -11 = -3n - t for n. 2 Let a = -42 + 43. Let f = 2 - 5. Let k be (1/fa)/((-6)/36). Solve k = -z - 0 for z. -2 Let g = -91 - -73. Let q = -46 - g. Let j be (-24)/36 + q/(-6). Solve l + 6 = jl for l. 2 Let o(q) = 4q*2 + 14q - 5. Let t be o(-4). Let m(u) = -t - u*2 + 2 - 2 + 0u*2 + 10u. Let v be m(5). Solve -3j = -7 + v for j. -5 Suppose 254y - f - 22 = 253y, -5y = 3f - 126. Solve 4 = -14s - y for s. -2 Suppose -f + 393z - 392z = -13, -24 = -f + 2z. Suppose -p + 4 = -m - 2, 2m = -4p. Let j be (2/6)/(p/12). Solve -j = fa - 3a for a. 2 Let x be -2172/(-56) - 19. Solve 9f + 8 = xf for f. -8 Suppose 302p - 326p + 696 = 0. Solve 14c = -pc - 129 for c. -3 Suppose 0y + 14 = -2y - 5c, y + 4c + 13 = 0. Let k be 14 + -1 + y + 2. Let x = k - 18. Solve -z + 2z = x for z. 0 Let p(l) = -6l + 4. Let o be p(-4). Suppose 0 = -4c - 3q + o, -q - 1 - 15 = -5c. Suppose 55g - 102g = 0. Solve 0 = -gu + cu + 4 for u. -1 Suppose u = -d - 30 + 34, -12 = d - 3u. Solve d = 17g - 155 + 53 for g. 6 Suppose -h = -2h + 64. Let r(y) = -22y + 822. Let c be r(40). Let p = c + h. Solve 0 = m - p + 5 for m. 1 Suppose -4a - 50 = -22. Let h be (9 + -5)/((4/a)/(-2)). Let t = h + 3. Solve 5j = -t + 2 for j. -3 Suppose 5z - 13z = 0. Suppose zc - 2c = 4q - 8, 2q = -5c + 12. Solve 3s - 15 = -cs for s. 3 Suppose 2h + 3q = 34, 5h + 126 = 3q + 127. Suppose p = 2b - 11, 0b + 16 = b - 4p. Solve -h + b = -c for c. 1 Let r(z) = 236z - 4466. Let a be r(19). Solve 0 = 36f - af - 18 for f. 1 Let p be (17/(-51))/((-2)/36). Suppose 3n - 2t = 10, -5n = 2t - pt - 16. Solve -nd - d = 25 for d. -5 Suppose 4b - 20 = -2x, -4b = 5x - 36 - 2. Let d(y) = -4y + 17y - xy + y2 + 4 - 3y. Let g be d(-3). Solve g = p - 0 for p. 1 Suppose 29x - 32x = 5z + 2, -4 = 5z + x. Let i be (-5 + z)(-3)/9 + 5. Solve 0 = -iv + 37 - 2 for v. 5 Let m(c) = c*2 - 67c + 1242. Let f be m(23). Solve 37j - f = -45 for j. 5 Let o(r) = -r2 + 4r + 2. Let h be o(-12). Let s = h + 283. Let z = s - 81. Solve -n - z = 2n for n. -4 Let w be (-2 - 0)(1827/(-42) - -12). Solve 0 = wr + 28 + 413 for r. -7 Let o = 6059 - 6056. Solve 0 = -ol - 0l - 21 for l. -7 Let b(k) = 1739k*2 - 19k + 45 + 6k - 1740k*2. Let g be b(-15). Solve -c = 11 - g for c. 4 Suppose 11a = 24 - 90. Let n be (-10 - a)6/(-8). Solve -12 = nq - 15 for q. 1 Suppose 351s - 428s + 1042 = -1422. Solve -so + 568 = 39o for o. 8 Let h = -289 - -107. Let w = h - -185. Solve -2u = u - w for u. 1 Let y = -114 - -117. Let b be (68/12 + -4)y. Solve -15 = bk - 0k for k. -3 Let c(s) = -13s2 - 4s*3 + 10s*2 + 6 - 8s + 0s3 + 5s*3. Let w be c(5). Let k = 16 - w. Solve k = o - 6o for o. 0 Let z(i) = 6i - 7 - i3 + 22i*2 - 7i - 32i2. Let t = -4 + -6. Let m be z(t). Solve -m = 2h - 5 for h. 1 Let y(q) = q*3 + 46q*2 - 102q - 2503. Let v be y(-47). Solve -vt + 67t + 105 = 0 for t. 7 Let c = -136 - -197. Suppose 4r + 17 = c. Solve 0 = 5t + 4 + r for t. -3 Let x(d) = d*3 + 9d*2 - 72d - 378. Let t be x(-6). Solve 46g - t = 22 for g. 4 Let w be (-20)/8 - (-95)/38. Suppose x - 5 = -2s - 2x, 3x = s - 7. Let g = s + -3. Solve z + g = -wz for z. -1 Suppose 0 = -286s + 210s + 608. Solve -7o = -so + 7 for o. 7 Let k(q) = -2q*2 + 15q + 63. Suppose -2b + 38c + 10 = 40c, -4b + 2c = -50. Let z be k(b). Solve zr = 11r + 4 for r. 2 Let u(m) = -15m*2 + 648m - 129. Let z be u(43). Solve z = 32o + 4o for o. 0 Let q(c) = 127c + 387. Let x be q(-3). Suppose -45 = -10j + 5j. Solve -xk = -jk for k. 0 Let v be (9/(-9))/(1/(-131)). Let q = -131 + v. Solve -5x - 3 - 2 = q for x. -1 Let h = -312 - -348. Let x be (-3)/((-7)/9 - 8/h). Let p = -5 + 7. Solve -pf = -1 - x for f. 2 Let t be -8(-5 - -2) - 3. Let g = t - 9. Suppose -9h = -gh + 15. Solve -9 + h = -r for r. 4 Let s = 8 + 4. Suppose 6y + 2y = -6y + 28. Solve yu - s = 5u for u. -4 Suppose 642 + 1533 = 24u + 567. Solve -uk = -79k for k. 0 Let y(n) = n*3 + 7n*2 + 6n + 6. Let v be y(-6). Let w(i) = i + v + 11 + 3 + 0i. Let b be w(-15). Solve 0 = 3u - bu - 8 for u. -4 Let k(w) = 4w - 17. Let d be k(5). Suppose -4l + 179 = da, -2l + 32 = -l + 5a. Suppose 48i - li - 2 = 0. Solve -u = -iu for u. 0 Let b = 80 - 86. Let c be (-18 - 2)/(-2 + 0) + b. Solve -m = -2m + c for m. 4 Suppose 508f - 429f - 1390 + 126 = 0. Solve 0 = -540v + 532v + f for v. 2 Suppose -3n + 4n - 4s = -5, s = -2n - 19. Let w(l) = -2l - 2. Let a be w(n). Solve -14h = -ah + 4 for h. 2 Suppose -159 = -2n - 3i, -3 = 14i - 11i. Solve -16j + 15 = -n for j. 6 Suppose -17 = -4f + 31. Suppose 10645 = -2i + 10665. Solve -fb + 6 = -ib for b. 3 Suppose -m - 3u = -11, -2u - 2 + 16 = 4m. Let l = -1701 + 1720. Let w be (m/5)/(l/95). Solve 0x = -x + w for x. 2 Let b(l) = -6l3 - 57l*2 + 30l + 7. Let k be b(-10). Solve 27y + k + 20 = 0 for y. -1 Suppose -r = -4, -2r = -m - 21 + 44. Solve -8u + 41 = -m for u. 9 Suppose -75 = 2s - 5. Let c be (35/2)/((-3)/6 - 0). Let d = c - s. Solve -x + 3 = -dx for x. 3 Let v = 31 - 28. Suppose -5s + 3x = 146, -6 = vs + 3x + 96. Let y = 31 + s. Solve y = -3n - 14 - 1 for n. -5 Let a = 101 - 13. Suppose -5b = 20, -3b + 66 = -126i + 127i. Solve -5x + i = a for x. -2 Let v be 1 - (-2)/(2-1). Let x be (-1)/(3/1548) - (-3 - -3). Let z = 519 + x. Solve 0g + g + z = v for g. -3 Let g be 21 - 156/104(-2)/(-3). Solve -16u - g = -4 for u. -1 Let f = -3273 - -3764. Solve -6s + f = 467 for s. 4 Let v be -2 + 0 + (-2 - -20). Suppose 48 = -t - v. Let j = t + 68. Solve k = -k - j for k. -2 Let a(h) = -h*3 + 13h*2 - 2h + 29. Let l be a(13). Suppose -w = lw - 8. Suppose 0 = -wy + 6 - 2, -4y - 4 = -3d. Solve 4x - 3x + d = 0 for x. -4 Suppose -69r + 1757 + 1883 = -4r. Sol	{ "pile_set_name": "DM Mathematics" }
late the highest common factor of 67 and 402. 67 Calculate the highest common divisor of 123490 and 4770. 530 Calculate the highest common factor of 133 and 179550. 133 What is the greatest common divisor of 13737 and 399? 57 What is the highest common factor of 11738801 and 31? 31 Calculate the greatest common divisor of 104 and 1252004. 52 Calculate the highest common divisor of 119957 and 27616. 863 Calculate the highest common factor of 978275 and 1090. 545 What is the greatest common divisor of 8 and 185176? 8 Calculate the highest common factor of 1106027 and 65. 13 What is the highest common divisor of 6667 and 2486? 113 What is the highest common factor of 144 and 1372944? 48 Calculate the greatest common factor of 154352 and 88. 88 Calculate the greatest common divisor of 6175 and 12545. 65 Calculate the highest common divisor of 1092 and 35896. 28 What is the highest common divisor of 14 and 2238852? 14 Calculate the greatest common divisor of 1114 and 24363180. 1114 Calculate the highest common divisor of 740988 and 648. 324 Calculate the greatest common factor of 122 and 276574. 122 What is the greatest common factor of 17228440 and 20? 20 What is the greatest common divisor of 3492 and 1353732? 1164 Calculate the greatest common factor of 198 and 997194. 66 What is the highest common factor of 5 and 4132? 1 What is the highest common divisor of 2 and 793167? 1 What is the highest common divisor of 15786 and 351? 9 Calculate the highest common factor of 72 and 1482. 6 Calculate the highest common factor of 314 and 1093819. 157 What is the greatest common divisor of 120770 and 520? 130 Calculate the greatest common factor of 29 and 2204783. 29 Calculate the greatest common factor of 36456 and 720. 24 What is the highest common divisor of 594 and 4374? 54 Calculate the highest common divisor of 45721 and 923. 13 What is the highest common factor of 342 and 24567? 57 What is the highest common divisor of 265 and 2751230? 265 What is the highest common divisor of 82328 and 656? 328 What is the greatest common divisor of 519424 and 4096? 256 Calculate the highest common divisor of 249932 and 4. 4 Calculate the highest common divisor of 7689 and 48. 3 What is the highest common divisor of 10481 and 13157? 223 Calculate the greatest common factor of 70750 and 2264. 566 Calculate the greatest common divisor of 101630 and 60. 10 What is the greatest common factor of 68 and 141572? 4 Calculate the highest common factor of 961406 and 1076. 538 Calculate the highest common factor of 208 and 37808. 16 Calculate the greatest common divisor of 3526 and 2537. 43 What is the greatest common factor of 141 and 75717? 141 Calculate the highest common factor of 4068 and 27. 9 Calculate the highest common divisor of 13293 and 6300. 63 Calculate the highest common divisor of 567 and 3143. 7 Calculate the greatest common divisor of 22 and 84403. 11 What is the highest common divisor of 155 and 3788665? 155 What is the highest common factor of 9860 and 17? 17 Calculate the greatest common divisor of 110983 and 116. 29 Calculate the highest common factor of 8229 and 9022. 13 Calculate the highest common factor of 4680 and 71695. 65 Calculate the highest common factor of 32 and 19960. 8 What is the greatest common factor of 1200 and 477200? 400 Calculate the greatest common factor of 7426 and 46136. 158 Calculate the highest common divisor of 943750 and 302. 302 What is the greatest common divisor of 181689 and 21? 3 Calculate the greatest common divisor of 7335 and 135. 45 Calculate the highest common divisor of 296 and 31006. 74 Calculate the greatest common factor of 1866 and 18. 6 What is the highest common divisor of 1003440 and 555? 555 What is the greatest common divisor of 557 and 82? 1 What is the greatest common factor of 256074 and 156? 78 What is the greatest common divisor of 324972 and 648? 324 What is the greatest common divisor of 124040 and 1120? 280 Calculate the greatest common divisor of 70 and 1106. 14 What is the greatest common divisor of 1370 and 430? 10 What is the greatest common factor of 2912 and 105404? 52 What is the highest common factor of 209 and 97527? 19 Calculate the greatest common factor of 78540 and 8160. 1020 What is the highest common divisor of 672264 and 27? 9 Calculate the greatest common divisor of 3138 and 30. 6 Calculate the highest common divisor of 114050 and 2300. 50 Calculate the highest common divisor of 18546 and 143. 11 Calculate the highest common factor of 3591 and 1638. 63 What is the greatest common factor of 545 and 109? 109 What is the greatest common factor of 10 and 106510? 10 What is the highest common divisor of 436 and 3644? 4 Calculate the greatest common divisor of 6777 and 466107. 753 What is the greatest common divisor of 19 and 36119? 19 What is the greatest common factor of 695868 and 206? 206 What is the highest common factor of 15966171 and 117? 117 What is the highest common divisor of 118840 and 40? 40 What is the highest common divisor of 68614 and 17458? 406 Calculate the greatest common factor of 917 and 2471. 7 What is the greatest common factor of 129 and 940453? 43 Calculate the greatest common factor of 129096 and 891. 99 What is the highest common factor of 1578950 and 1725? 575 What is the highest common divisor of 465159 and 141? 141 Calculate the highest common divisor of 1337 and 197303. 191 What is the greatest common divisor of 525 and 6531? 21 What is the highest common factor of 11039 and 747? 83 What is the highest common divisor of 5278 and 47684? 182 What is the greatest common factor of 102619 and 9820? 491 What is the greatest common factor of 4 and 34148? 4 Calculate the greatest common divisor of 18286662 and 51. 51 What is the greatest common divisor of 21311 and 31613? 101 Calculate the greatest common divisor of 56 and 327880. 56 What is the greatest common factor of 83 and 1023722? 83 What is the greatest common factor of 311060 and 1812? 604 What is the highest common divisor of 5012 and 20764? 716 What is the greatest common factor of 1197 and 3771? 9 Calculate the highest common divisor of 1935 and 510. 15 Calculate the greatest common divisor of 612 and 293556. 204 What is the greatest common factor of 14347785 and 1095? 1095 What is the greatest common factor of 25 and 522100? 25 What is the highest common divisor of 720 and 202320? 720 What is the greatest common factor of 2200 and 3320? 40 Calculate the greatest common divisor of 160210 and 222. 74 What is the greatest common divisor of 9703 and 124? 31 Calculate the greatest common factor of 37112 and 200. 8 What is the greatest common divisor of 351 and 9598446? 351 What is the highest common factor of 1610 and 22862? 322 What is the highest common factor of 115905 and 15? 15 What is the highest common divisor of 14667 and 45? 3 What is the highest common divisor of 3612 and 37668? 516 Calculate the highest common factor of 290530 and 15980. 170 Calculate the greatest common factor of 1598435 and 15. 5 Calculate the greatest common divisor of 45405 and 2025. 45 What is the greatest common factor of 11988 and 192? 12 What is the highest common factor of 67659 and 342? 57 Calculate the highest common factor of 406 and 1792. 14 Calculate the highest common divisor of 24 and 47454. 6 Calculate the highest common factor of 1253 and 119751. 179 Calculate the highest common factor of 40 and 1307840. 40 Calculate the greatest common divisor of 4026 and 5856. 366 What is the highest common divisor of 11704 and 8932? 308 Calculate the greatest common divisor of 1218 and 186. 6 What is the greatest common factor of 1432 and 4833? 179 Calculate the greatest common factor of 75117 and 2744. 343 Calculate the greatest common divisor of 11092718 and 2548. 1274 What is the highest common divisor of 48 and 30288? 48 Calculate the greatest common factor of 11055 and 1320. 165 What is the greatest common divisor of 202 and 64943? 101 What is the highest common divisor of 886860 and 30? 30 What is the highest common factor of 30 and 522285? 15 Calculate the greatest common divisor of 5252 and 56. 4 Calculate the highest common divisor of 422 and 54. 2 Calculate the highest common factor of 708 and 912. 12 Calculat	{ "pile_set_name": "DM Mathematics" }
rder. -5, -4, -2, -1, -26/27, 5, 12 Put -277119, 1/4, 2/9, -0.5, -4, 4 in descending order. 4, 1/4, 2/9, -0.5, -4, -277119 Sort 1098, 4, -5, 1, -3, 2 in decreasing order. 1098, 4, 2, 1, -3, -5 Put -31, -1, 17, 2, 309 in descending order. 309, 17, 2, -1, -31 Sort -40, 3, 1, 141, 2, -3. -40, -3, 1, 2, 3, 141 Put 3, 64440, -1, -12, -7, 0 in ascending order. -12, -7, -1, 0, 3, 64440 Put -3, -2, 1/387, 19 in ascending order. -3, -2, 1/387, 19 Sort 3, 140, -0.7, -19, 0.05, -5/3. -19, -5/3, -0.7, 0.05, 3, 140 Put 67/5, 1/6, -22729 in descending order. 67/5, 1/6, -22729 Sort -5, 79445, -22 in ascending order. -22, -5, 79445 Sort 2, 1, -1920, -5, 12, -7 in decreasing order. 12, 2, 1, -5, -7, -1920 Sort -7, 4, -1805, -19 in descending order. 4, -7, -19, -1805 Sort 1, -0.15, -33.1, -4, -1/68, -5 in ascending order. -33.1, -5, -4, -0.15, -1/68, 1 Sort 1123166, -1, 3, -5. -5, -1, 3, 1123166 Sort 26, 2, 401, -7, -4 in descending order. 401, 26, 2, -4, -7 Sort -67, -15, 55, -5, -3, -129 in ascending order. -129, -67, -15, -5, -3, 55 Put -195443, 13, -14 in decreasing order. 13, -14, -195443 Sort -57, 33, -7267, -2, 2, -5 in descending order. 33, 2, -2, -5, -57, -7267 Sort 61, 4, 17566 in decreasing order. 17566, 61, 4 Sort 0.05, -16/9, 1, -2/9, -143. -143, -16/9, -2/9, 0.05, 1 Sort -2, 6, -5, -47, -16179 in decreasing order. 6, -2, -5, -47, -16179 Put -1, -39, 11317, 8 in increasing order. -39, -1, 8, 11317 Sort -689, -1288, 7 in descending order. 7, -689, -1288 Sort 1, 0, 26, 4, 3, 6, -363 in increasing order. -363, 0, 1, 3, 4, 6, 26 Put -2011, -2, -1503 in increasing order. -2011, -1503, -2 Put -3, 98, 158, -1, 1/10 in increasing order. -3, -1, 1/10, 98, 158 Sort 0.01, 17/5, -1/6, -2/15, 0. -1/6, -2/15, 0, 0.01, 17/5 Sort 7, 1, 8, -4, -13387, -10, -1 in decreasing order. 8, 7, 1, -1, -4, -10, -13387 Sort -2, 1, -11, -3, -15, -8, -210 in decreasing order. 1, -2, -3, -8, -11, -15, -210 Put -4, -1134, -1/9261, -1 in decreasing order. -1/9261, -1, -4, -1134 Sort 3, -1, 31, 1, -8 in decreasing order. 31, 3, 1, -1, -8 Sort 5, 107, 2, -11, 455 in ascending order. -11, 2, 5, 107, 455 Sort -1, -3, 6, 0, 22, -18, -2 in ascending order. -18, -3, -2, -1, 0, 6, 22 Put -22, -2/17, 4, 1.3, -3, 51/4 in decreasing order. 51/4, 4, 1.3, -2/17, -3, -22 Put -1, -116, -966, -27 in descending order. -1, -27, -116, -966 Put 0, 869/4, -3/2, 2/7, 2/9, 59 in increasing order. -3/2, 0, 2/9, 2/7, 59, 869/4 Sort 10/3, 6, 4, -687. -687, 10/3, 4, 6 Put -31, -1, 3, 4, 14, 5 in increasing order. -31, -1, 3, 4, 5, 14 Sort -3, 0, 26, 56, -28, -5 in ascending order. -28, -5, -3, 0, 26, 56 Sort 26, -194, -315. -315, -194, 26 Sort 4, 3, -172, 0.02741 in descending order. 4, 3, 0.02741, -172 Sort -246, 4, 16, -5, 5, -2, -6 in ascending order. -246, -6, -5, -2, 4, 5, 16 Sort -375, 1, 3, 19/4, -4, -5 in increasing order. -375, -5, -4, 1, 3, 19/4 Put 0.06, 0, 0.3, 2, -55, -1.88 in decreasing order. 2, 0.3, 0.06, 0, -1.88, -55 Put -1, 4, -473, -2, 81, 3 in decreasing order. 81, 4, 3, -1, -2, -473 Sort -3.766, -18, 3/8, 2, 58, 1 in decreasing order. 58, 2, 1, 3/8, -3.766, -18 Sort 57, 5, -93, -3670. -3670, -93, 5, 57 Sort 28, -2/1825, 2, 0.4, 3/4. -2/1825, 0.4, 3/4, 2, 28 Put 0.24, -54909, 2/5, 0.012 in ascending order. -54909, 0.012, 0.24, 2/5 Sort 5, -62/23585, -1/4 in ascending order. -1/4, -62/23585, 5 Sort 1/835, -3.3, 5, -7/5, 1/2. -3.3, -7/5, 1/835, 1/2, 5 Sort -0.4, -24992, 38, 0 in decreasing order. 38, 0, -0.4, -24992 Sort 3, -888552, 6 in descending order. 6, 3, -888552 Put -232, -491, -3, 7, 5 in increasing order. -491, -232, -3, 5, 7 Put 0.5, -3459645, 0.3, -0.3 in decreasing order. 0.5, 0.3, -0.3, -3459645 Sort -370, 223, -2/15, 2 in increasing order. -370, -2/15, 2, 223 Put 13, -4602, -10 in descending order. 13, -10, -4602 Put 8, 2, -5, -4, -322, -7, -3 in decreasing order. 8, 2, -3, -4, -5, -7, -322 Sort 3, 393, 7057, -3, -5. -5, -3, 3, 393, 7057 Sort 7, -523057, 3 in decreasing order. 7, 3, -523057 Sort 608739.6, -32, 0.3 in increasing order. -32, 0.3, 608739.6 Put -22, 6, 21586 in ascending order. -22, 6, 21586 Put -79, -11, -4, -101, 5, -5 in descending order. 5, -4, -5, -11, -79, -101 Put -1757, -10, -3133/6, -5 in decreasing order. -5, -10, -3133/6, -1757 Put 2, -4, -2, 0, 75, -2956 in increasing order. -2956, -4, -2, 0, 2, 75 Sort -1, 2, 63, 17, 175, -4, -5 in increasing order. -5, -4, -1, 2, 17, 63, 175 Put 10529, -4, 52, 3, -1 in decreasing order. 10529, 52, 3, -1, -4 Sort 2, 155, -6/5, 2/93, 0, 0.25. -6/5, 0, 2/93, 0.25, 2, 155 Put 4, -97/90728, -1/2 in decreasing order. 4, -97/90728, -1/2 Put -81, 5, 15, 65 in decreasing order. 65, 15, 5, -81 Put 89, -4, -1/2, 10333 in ascending order. -4, -1/2, 89, 10333 Sort -3, -17, 2, -105360. -105360, -17, -3, 2 Sort -19037, 3, 5, -1, -5, 19 in descending order. 19, 5, 3, -1, -5, -19037 Sort -2, -25835, 2, -4, 106. -25835, -4, -2, 2, 106 Sort 2/13, -5, -2/7, 4, 0, 123495. -5, -2/7, 0, 2/13, 4, 123495 Put 1813, -3, -39000 in descending order. 1813, -3, -39000 Sort -272, 1/4, -5/6, -2, -5, 8. -272, -5, -2, -5/6, 1/4, 8 Sort 34975, -2/15, -1/19 in ascending order. -2/15, -1/19, 34975 Sort -347, -3, -101, 3, 558 in decreasing order. 558, 3, -3, -101, -347 Put -1336, 1/7, -4, -1/55 in descending order. 1/7, -1/55, -4, -1336 Put 13, -41, 2, 12, -37, -5 in decreasing order. 13, 12, 2, -5, -37, -41 Put -418, -3, -14637/8, 0 in ascending order. -14637/8, -418, -3, 0 Put 1/3, -1, 9, 2/7, 3.4, 409/6 in decreasing order. 409/6, 9, 3.4, 1/3, 2/7, -1 Put 2428, 438, 4, -5 in increasing order. -5, 4, 438, 2428 Put 5423, -4, -3, -8441 in descending order. 5423, -3, -4, -8441 Sort -148460, -2, 21, -4 in increasing order. -148460, -4, -2, 21 Sort -3, -2, -1277, 4469 in decreasing order. 4469, -2, -3, -1277 Sort -0.97, 2/27, 5, 39, -5/24. -0.97, -5/24, 2/27, 5, 39 Sort -0.14, 1066375, 4/7 in descending order. 1066375, 4/7, -0.14 Put -11, 11, 248932, -3 in increasing order. -11, -3, 11, 248932 Put -5, -3, 0, -7, -140815 in ascending order. -140815, -7, -5, -3, 0 Sort 1944, 0, -195 in ascending order. -195, 0, 1944 Sort 2/7, -20, 1126/25, 0 in descending order. 1126/25, 2/7, 0, -20 Put 4, 313, 792, 1, 0, 5 in decreasing order. 792, 313, 5, 4, 1, 0 Put -3, -1, 0.2, 0.06, -68418 in increasing order. -68418, -3, -1, 0.06, 0.2 Sort 1/134, 6, 2/7, 2/27, 3/5. 1/134, 2/27, 2/7, 3/5, 6 Sort 196, 12, 3, -2, 5, 0. -2, 0, 3, 5, 12, 196 Sort 5, 2, 3, -793, 0, 4, 7 in decreasing order. 7, 5, 4, 3, 2, 0, -793 Put 3, -29422, 5.8 in decreasing order. 5.8, 3, -29422 Sort -2/7, -0.3, 0.1, 50813, -47. -47, -0.3, -2/7, 0.1, 50813 Put -45, 3, -1939, 8, -3 in increasing order. -1939, -45, -3, 3, 8 Sort -806, 173, 3, 4, 2, -1, 1 in increasing order. -806, -1, 1, 2, 3, 4, 173 Put -7, -11, 64, 4, -4 in descending order. 64, 4, -4, -7, -11 Put 451, -2/25, 75198 in increasing order. -2/25, 451, 75198 Put 0, 7, 798, 17 in decreasing order. 798, 17, 7, 0 Sort -21, -2/3, 2/17, 1, -93/19. -21, -93/19, -2/3, 2/17, 1 Sort -75295, -8, 5. -75295, -8, 5 Sort 3083606, 4, -26 in decreasing order. 3083606, 4, -26 Sort 484, 3, -170, 4, 0, 40 in descending order. 484, 40, 4, 3, 0, -170 Sort -1, -1230.9, -0.048 in descending order. -0.048, -1, -1230.9 Put 30, 5, 3, 1506250 in decreasing order. 1506250, 30, 5, 3 Sort -949, -2, -11, -4, -3, -8, 5 in descending order. 5, -2, -3, -4, -8, -11, -949 Sort -269, 22, 236 in descending order. 236, 22, -269 Sort -0.4, 32/19, -96, 16, -3, -4 in decreasing order. 16, 32/19, -0.4, -3, -4, -96 Put 0.17, 0, 1/66, -0.1, 1/6 in ascending order. -0.1, 0, 1/66, 1/6, 0.17 Put -30658, -82, -9 in ascending order. -30658, -82, -9 Sort 2174, 121, 3 in increasing order. 3, 121, 2174 Put 0.4, 1, -5214/13, 0.5 in increasing order. -5214/13, 0.4, 0.5, 1 Sort -7/8, -3, 4, 0.5, 18, 5, 0.18 in increasing order. -3, -7/8, 0.18, 0.5, 4, 5, 18 Sort 5, -903199, -66, 3, -4 in increasing order. -903199, -66, -4, 3, 5 Sort -12, -524, -0.02, -48, -0.04 in descending order. -0.02, -0.04, -12, -48, -524 Put 1863, -4, 3, -14929 in decreasing order. 1863, 3, -4, -14929 Sort 2, 5, -0.14, 2/9, 3/1112, -4 in descending order. 5, 2, 2/9, 3/1112, -0.14, -4 Sort -72, -5, -84523 in increasing order. -84523, -72, -5 Sort -2, 3/17, 2/11, 0.6242 in decreasing order. 0.6242, 2/11, 3/17, -2 Sort -4	{ "pile_set_name": "DM Mathematics" }
in 350.7555 minutes? 21045.33 What is seventeen halves of a litre in millilitres? 8500 What is 3/50 of a kilometer in centimeters? 6000 What is 3/32 of a day in minutes? 135 How many millilitres are there in fourty-five eighths of a litre? 5625 What is 5335.595 micrometers in centimeters? 0.5335595 How many months are there in thirteen fifths of a decade? 312 What is 43.61137 litres in millilitres? 43611.37 How many millilitres are there in 36.41919l? 36419.19 What is 89019.94 years in decades? 8901.994 What is 50.0548t in kilograms? 50054.8 Convert 1178.96g to tonnes. 0.00117896 What is 820.98234 minutes in days? 0.570126625 How many seconds are there in 23/6 of a hour? 13800 How many centimeters are there in 0.5115528um? 0.00005115528 What is seven eighths of a meter in millimeters? 875 How many milliseconds are there in 54656.41s? 54656410 How many litres are there in 8501.114 millilitres? 8.501114 What is 289479.2 days in seconds? 25011002880 What is 395395.4 micrograms in nanograms? 395395400 How many millilitres are there in 3/50 of a litre? 60 What is one quarter of a millennium in decades? 25 Convert 44644.68 seconds to milliseconds. 44644680 What is 0.769099ns in microseconds? 0.000769099 What is 13/5 of a kilogram in grams? 2600 How many minutes are there in 6/5 of a hour? 72 Convert 10098.84 millilitres to litres. 10.09884 How many millilitres are there in 9278.659l? 9278659 How many days are there in 229484.016 milliseconds? 0.002656065 What is 4/15 of a millennium in months? 3200 What is 121222.6ms in microseconds? 121222600 Convert 16592.1441 hours to weeks. 98.7627625 What is 7/4 of a litre in millilitres? 1750 What is 43/2 of a minute in seconds? 1290 How many decades are there in 230035.1 years? 23003.51 What is 10/3 of a day in minutes? 4800 What is 98591.84 milligrams in tonnes? 0.00009859184 How many decades are there in 8474.819 years? 847.4819 How many milliseconds are there in 13/4 of a second? 3250 How many hours are there in sixty-nine halves of a week? 5796 Convert 931.8778 decades to years. 9318.778 Convert 244672.26 months to millennia. 20.389355 What is 17/10 of a litre in millilitres? 1700 What is 11/2 of a hour in seconds? 19800 What is 462.5277nm in meters? 0.0000004625277 How many centimeters are there in 1/5 of a kilometer? 20000 What is 4.574713l in millilitres? 4574.713 What is twenty-one quarters of a second in milliseconds? 5250 What is 145528.2 milliseconds in hours? 0.0404245 Convert 0.7501078 weeks to minutes. 7561.086624 How many micrograms are there in 3/50 of a milligram? 60 Convert 352.1505m to centimeters. 35215.05 How many micrograms are there in eleven eighths of a milligram? 1375 What is 9/10 of a microgram in nanograms? 900 How many months are there in one fifteenth of a decade? 8 How many years are there in 32194.49 millennia? 32194490 Convert 137612.79us to weeks. 0.000000227534375 What is 0.4240439 seconds in milliseconds? 424.0439 Convert 6184.36 decades to centuries. 618.436 What is eight fifteenths of a day in minutes? 768 What is 3/28 of a week in minutes? 1080 What is 17/2 of a meter in millimeters? 8500 What is 1243.93 decades in years? 12439.3 Convert 261366.1um to centimeters. 26.13661 How many hours are there in 25/4 of a day? 150 Convert 487351.8 kilometers to micrometers. 487351800000000 What is 353.923l in millilitres? 353923 Convert 0.2505903mg to kilograms. 0.0000002505903 How many millennia are there in 71702.71 decades? 717.0271 Convert 0.9817716cm to millimeters. 9.817716 What is 81/4 of a litre in millilitres? 20250 What is three tenths of a gram in milligrams? 300 What is 0.6186892 years in months? 7.4242704 Convert 264.606912 milliseconds to days. 0.00000306258 How many millilitres are there in fourty-three quarters of a litre? 10750 How many millilitres are there in 381.8431l? 381843.1 How many minutes are there in ten thirds of a day? 4800 How many nanograms are there in 1822.147 tonnes? 1822147000000000000 What is 6/5 of a millennium in centuries? 12 What is 34.87026mm in nanometers? 34870260 What is 1/5 of a centimeter in millimeters? 2 What is 26/5 of a tonne in kilograms? 5200 How many decades are there in six fifths of a century? 12 How many years are there in one fifth of a decade? 2 Convert 35072.95ng to grams. 0.00003507295 What is 11/4 of a microgram in nanograms? 2750 How many centuries are there in three fifths of a millennium? 6 How many micrometers are there in fourty-five eighths of a millimeter? 5625 Convert 326089.9l to millilitres. 326089900 What is 73052.4 nanograms in micrograms? 73.0524 What is 19/4 of a litre in millilitres? 4750 How many millilitres are there in 7/2 of a litre? 3500 How many nanoseconds are there in seven halves of a microsecond? 3500 What is eleven halves of a century in months? 6600 How many millimeters are there in three tenths of a meter? 300 What is three fifths of a kilogram in grams? 600 What is 0.4621287 hours in milliseconds? 1663663.32 How many litres are there in 0.6389012 millilitres? 0.0006389012 How many seconds are there in twenty-eight thirds of a hour? 33600 What is 13/4 of a kilogram in grams? 3250 How many seconds are there in 4/3 of a minute? 80 Convert 144967.23 months to millennia. 12.0806025 What is 3/5 of a microgram in nanograms? 600 What is 9.761316cm in nanometers? 97613160 What is 55/2 of a millennium in decades? 2750 What is 7/2 of a gram in milligrams? 3500 How many months are there in twenty-one fifths of a decade? 504 Convert 75.9398 micrometers to nanometers. 75939.8 How many nanometers are there in 31882.11km? 31882110000000000 Convert 1502.37 millennia to centuries. 15023.7 How many microseconds are there in 84188.37 days? 7273875168000000 How many centimeters are there in 3/5 of a kilometer? 60000 Convert 1775.753469us to weeks. 0.0000000029361003125 Convert 49273.6734 minutes to weeks. 4.88826125 How many minutes are there in 54/5 of a hour? 648 How many milliseconds are there in 32.63135 weeks? 19735440480 What is 69869.9 decades in centuries? 6986.99 How many months are there in twenty-one fifths of a decade? 504 How many nanometers are there in thirteen fifths of a micrometer? 2600 How many grams are there in 82907.38 milligrams? 82.90738 How many litres are there in 322.6589 millilitres? 0.3226589 How many minutes are there in twenty-nine halves of a hour? 870 What is one fifth of a century in decades? 2 What is 0.7357005 months in decades? 0.0061308375 What is 5/8 of a kilometer in centimeters? 62500 What is 1/10 of a milligram in nanograms? 100000 How many nanograms are there in thirty-four fifths of a microgram? 6800 What is 58.96279ml in litres? 0.05896279 What is 11/8 of a tonne in kilograms? 1375 How many millimeters are there in fifty-seven halves of a meter? 28500 How many millilitres are there in 5/4 of a litre? 1250 How many minutes are there in 13/4 of a hour? 195 How many milligrams are there in 1/10 of a gram? 100 What is one quarter of a meter in centimeters? 25 What is one fifth of a micrometer in nanometers? 200 How many millennia are there in 52344.25 centuries? 5234.425 How many nanometers are there in 749556.5km? 749556500000000000 How many litres are there in 320.9799ml? 0.3209799 How many millilitres are there in 13/4 of a litre? 3250 How many nanoseconds are there in 5.349807 microseconds? 5349.807 What is one sixteenth of a millennium in months? 750 How many nanograms are there in 16.18438t? 16184380000000000 How many seconds are there in 2/15 of a day? 11520 How many months are there in 1/6 of a millennium? 2000 How many nanograms are there in 3/25 of a microgram? 120 How many months are there in 1/30 of a century? 40 How many millimeters are there in nine tenths of a meter? 900 What is 1002.216 litres in millilitres? 1002216 How many hours are there in three sevenths of a week? 72 How many meters are there in 48/5 of a kilometer? 9600 How many meters are there in 29.31258 centimeters? 0.2931258 What is 3/40 of a microgram in nanograms? 75 How many milligrams are there in 54/5 of a gram? 10800 How many months are there in 11/2 of a millennium? 66000 What is 4/7 of a week in hours? 96 Convert 151244.28 months to centuries. 126.0369 How many grams are there in 11/	{ "pile_set_name": "DM Mathematics" }
+ 4. Let i(s) = -4s2 + 3. Let v(a) = -a2 + 17a - 19. Let p be v(16). Give pn(g) + 4i(g). -g*2 Let v(f) = 3f. Let p(d) = -2d. Suppose -5n + 7 + 8 = 0. Determine np(m) + v(m). -3m Let r = 3 + -7. Let l(d) = 4d + 2 - 5 + 9 - 2d*2 - 5. Let b(z) = -3z*2 + 5z + 1. Calculate rl(u) + 3b(u). -u*2 - u - 1 Let f(p) = 4p + 0p2 + 4p2 - p2 - 9p + 4. Suppose 0 = -3c + 8c + 25. Let v(s) = -2s*2 + 4s - 3. Calculate cv(u) - 4f(u). -2u2 - 1 Let l(s) = -2s*2 + 47s - 29. Let c be l(23). Let v(q) = -7q - 6. Let g(j) = 4j + 4. Let p(z) = 5z + 5. Let w(o) = 6g(o) - 5p(o). Give cw(n) + v(n). -n Let w(b) = b + 1. Let v = 5 - 11. Let s(g) = g + 11. Let h be s(-5). Let i(f) = -h + 8f + 0f + 14. Calculate vw(m) + i(m). 2m + 2 Let j(v) = -2v2 + 7v + 13. Let n(b) = 4b2 + 9 - 9b*2 + 5b + 4b2. Determine -5j(w) + 7n(w). 3w2 - 2 Let q(c) be the second derivative of c4/6 - c*3/2 + 3c*2/2 + 42c. Let r(i) = i*2 - 2i + 2. Let s(m) = -2m - 9. Let n be s(-6). Give nr(h) - 2q(h). -h2 Let s(n) = 16n2. Let w(v) = v2. What is 2s(r) - 40w(r)? -8r2 Let y(p) = -2p*2 - p - 4. Let f(z) = -3z*2 - 2z - 7. Calculate -3f(i) + 5y(i). -i2 + i + 1 Let y(z) = -z2 - z + 2. Let b(k) = -3 + k*2 + 1 + k + 0. Determine -5b(d) - 4y(d). -d2 - d + 2 Let s(w) = 2w - 1. Let x(q) = 4 - 5 + 4q - 1. Let h(f) = -5f + 131. Let j be h(24). Give js(m) - 6x(m). -2m + 1 Let f(h) = h. Let k(j) = j. Give 12f(r) - 3k(r). 9r Let b(u) = 6u - 2. Let q(o) be the first derivative of -7o*2/2 + 2o - 17. Determine -4b(y) - 3q(y). -3y + 2 Let z(x) = -13x - 17. Let n(r) = -9r - 11. What is 8n(g) - 5z(g)? -7g - 3 Let u(f) = f3 + f2. Let m(k) = -5k3 + 2k*2. Let v = -154 + 152. Determine vu(o) + m(o). -7o3 Let y(t) = -4t. Let r(a) = a. Let q be -3((-6)/(4 + -1) - -3). Determine qy(f) - 8r(f). 4f Let g(v) = 4v - 5. Let s(a) = a - 1. Suppose -3x - 3 = -18. Give xs(t) - g(t). t Let i(f) be the second derivative of -f4/6 + f2 - 2f. Let j = -7 + 5. Let o(z) = z3 - z2 + 1. Let u = 4 + -3. What is jo(n) + ui(n)? -2n3 Let j(c) = 6c + 13. Let i = 5 - 5. Let v(n) = 3n - n + 4 + in. Give -2j(y) + 7v(y). 2y + 2 Let g(y) = 3y*3 - 4y2 + 4. Let m(k) = k3 + 3k2 - 6. Let p(z) = 2z*3 + 9z*2 - 17. Let h(i) = 8m(i) - 3p(i). Calculate -3g(n) + 4h(n). -n3 Let v(n) = n2 + 2n + 4. Let m be v(-2). Let q(a) = 15 - 16a + 16a - 8a2 - ma2. Let l(d) = d2 - 1. Calculate -15l(x) - q(x). -3x*2 Suppose 9 = -t + 2s, 2s = -2s. Let a(v) = 13v - 9. Let c(q) = 2 + q - 2q - 2q. Determine tc(k) - 2a(k). k Let j(z) = -8z. Let a(x) = -12x. Let b(l) = -l2 - 9l. Let k be b(-8). Give kj(c) - 5a(c). -4c Let h(f) = 3f*3 - 5. Let r(d) be the first derivative of -5d*4/4 + 8d + 5. Determine 8h(z) + 5r(z). -z*3 Let f(t) = 16t + 7. Let u be -214/(-4) - 0. Let r(c) = -11c - 1. Let g(x) = 1. Let z(n) = 4g(n) - r(n). Calculate uz(p) - 5f(p). -3p Let d(h) be the second derivative of 0 + 5/2h2 + 3h - 1/3h3. Let m = -5 - 0. Let f(c) = 2c - 6. What is md(w) - 4f(w)? 2w - 1 Let h(p) = 3p*2 + p - 2. Let o(y) = 3y*2 + 2y - 2. Let v = 57 - 54. Give vo(u) - 4h(u). -3u2 + 2u + 2 Let d(u) = -3u + 5. Let w(m) = 1. Let f(o) = -2. Let i(t) = -f(t) - w(t). Give -d(g) + 5i(g). 3g Let w(d) = 8d*2 + d + 4. Let v(y) = 8y*2 + y + 3. Calculate 3v(k) - 2w(k). 8k*2 + k + 1 Let m(u) = -u - 1. Let b(r) = 6r + 10. Let y(w) = -b(w) - 5m(w). Let f(d) = -3. What is -5f(i) + 3y(i)? -3i Let d(h) = h*3 - 3h + 10. Let k(z) = z - 1. Give 2d(j) + 6k(j). 2j3 + 14 Let h(b) = 2b*3 + 2b*2 - 1. Let c be h(1). Let w(o) = 4o*2 - 3o - 3 + 0o - 8o*2. Let p(z) = 11z*2 + 8z + 8. What is cp(f) + 8w(f)? f*2 Let h(b) = 7b + 2. Let a(d) = 85d + 25. Determine 4a(j) - 50h(j). -10j Let k(d) = d3 - d2 - d. Let t(z) = 2z3 - 5z*2 - 5z. Calculate 5k(s) - t(s). 3s*3 Let r(v) = 3v + 3. Let c be ((-24)/48)/((-1)/(-14)). Let n(s) = -2s - 2. What is cn(q) - 5r(q)? -q - 1 Let k(g) = 6g - 5. Let i(h) = 5h - 5. Determine -3i(r) + 4k(r). 9r - 5 Let f(p) = -p + 6. Let t = 22 + -19. Let o be 28/24t2. Let q(h) = h - 7. What is of(n) + 6q(n)? -n Let d(y) = 14y2 + 5y + 8. Let f(m) = -9m2 - 3m - 5. Give -5d(x) - 8f(x). 2x2 - x Let o(t) = -1. Let a(b) = 45b + 9. What is a(v) + 9o(v)? 45v Let s(v) = -2v3 + 11v*2 - 8v + 6. Suppose 0 = 5t - 35 - 5. Let o be 2/t - 26/8. Let p(x) = x3 - 4x*2 + 3x - 2. Calculate os(b) - 8p(b). -2b3 - b2 - 2 Let d(v) = 2v - 1. Let z(j) be the first derivative of -j + 1. Let h = -1 - -3. Calculate hz(g) - d(g). -2g - 1 Suppose -4x = 5g + 24, 2g - 16 = -4x + 7g. Suppose 18w - 15 = 13w. Let p(s) = s3 - 3s2 + s - 1. Let d(z) = z3 - z*2. Give wd(f) + xp(f). 2f*3 - f + 1 Let d be (4/2)/((-2)/(-3)). Suppose 2q = -q - d. Let x(v) = 6v - 5. Let l(h) = -5h + 4. Let o(k) = 3l(k) + 2x(k). Let j(s) = -s. Calculate qo(b) + 2j(b). b - 2 Let y(h) = 3h2 + 4h - 4. Let b(n) = n + 7n2 - 9 + 10n - 2n. Suppose -4g + 13g - 36 = 0. What is gb(o) - 9y(o)? o2 Let n(m) = -4m + 21. Let u(p) = 2p - 14. Let w(g) = -6g + 41. Let o(c) = 8u(c) + 3w(c). Give -6n(s) + 11o(s). 2s - 5 Let o(q) = 3q2. Let j(a) = a2 - a. Let g(r) = -4r2 + 3r. Let n(u) = g(u) + 3j(u). Give -4n(d) - o(d). d*2 Let v(r) = -5r*2 - 2r + 2. Let h(c) = -6c2 - 2c + 2. Let t = -19 + 25. What is th(f) - 7v(f)? -f*2 + 2f - 2 Let k(u) = -4u2 - 2u. Let z(f) = -f*2. Calculate k(n) + z(n). -5n*2 - 2n Let k(r) = r2 - 1. Let g(u) = u3 + 4u2 - 5. Calculate -g(s) + 3k(s). -s3 - s2 + 2 Let j(w) = 4w. Let v(q) = -9q. Let d be (-4)/(-2) + 50/10. What is dj(o) + 3v(o)? o Suppose 14 = p + 17. Let o(l) = -6l - 2. Let g(a) = a + 1. What is pg(q) - o(q)? 3q - 1 Let o(c) = 13c. Let k(t) = -72t. Determine 5k(x) + 27o(x). -9x Let j(l) = 2l + 4. Suppose 8 = -t + 3p - 0, p + 9 = -2t. Let s(r) = -2r - 5. What is tj(a) - 4s(a)? -2a Let l(x) = -x2 + 10x - 4. Let v(n) = -3n2 + 20n - 9. Give -9l(b) + 4v(b). -3b2 - 10b Let j(p) be the first derivative of 1 - 2p2 + 5p*2 + 0p*2 + 0. Let y(t) = 12t - 11t - 8t. Give -5j(b) - 4y(b). -2b Let v be -1 + (2 + -4)1. Suppose 5a - 3 = 7. Let j(w) = 4w + 0 - 3 + a - 2w2 - 2. Let m(o) = -o2 + 2o - 2. Give vj(c) + 5m(c). c*2 - 2c - 1 Let n(a) = -4a2 + 15a + 2. Let g be (-3)/(1 - 3/2). Let r(t) = -2t2 + 2t*2 - 1 - 2t - gt + 2t*2. Determine -6n(u) - 11r(u). 2u*2 - 2u - 1 Let o(z) = z2 - z + 5. Let g(t) = t2 - t. Let y(q) = -4q2 + 3q + 11. Let c(l) = 6g(l) + y(l). Suppose 6 = -r + 9. Calculate rc(h) - 7o(h). -h2 - 2h - 2 Let c(z) = z2 - z + 1. Let h be ((-24)/32)/(2/8). Let j(q) = -q3 - 3q2 + 4q - 1. Suppose -5y - 3 - 2 = 0. Give hc(a) + yj(a). a3 - a - 2 Let g(b) = 3b*3 + 8b*2 + b. Let d(q) = -4q*3 - 7q*2 - q. Give -4d(u) - 3g(u). 7u*3 + 4u*2 + u Let l(c) = -1. Let x(w) = 14w - 2. What is -6l(b) + 3x(b)? 42b Let g(v) = 7v + 7. Let y(b) be the third derivative of -b5/60 + b4/4 + b*3 - 14b*2 - 2b. Calculate -6g(z) + 7y(z). -7z2 Let k(y) = y2 - y - 1. Let p(r) = -2r*3 - 5r*2 + 5r + 5. Suppose 5t - 7 = 2x + 8, -t - x + 10 = 0. Give tk(v) + p(v). -2v*3 Let z(o) = -215o + 55. Let w(k) = 8k - 2. What is -55w(v) - 2z(v)? -10v Let n(y) = -3 + 6y - 10 + 16. Let g(m) = 5m + 2. What is -7g(j) + 6n(j)? j + 4 Let c be ((-34)/(-4))/((-2)/(-4)). Let g(u) = 20u - 14. Let l(s) = 11s - 1. Let q(d) = 23d - 1. Let m(j) = 9l(j) - 4q(j). Determine cm(y) - 6g(y). -y - 1 Let v(g) = -11g - 8. Let n(x) = 32x + 23. Let i(w) = -6n(w) - 17v(w). Let b(s) = -s. Determine 6b(d) - i(d). -d + 2 Let h(p) = p. Let f(j) = -2j - 1. Suppose 0 = 3x + x - 20. Let s = x - 6. Determine sf(r) - 4h(r). -2r + 1 Let u(k) = -k3 + 1. Let g(p) = 4p3 + p2 - 4. Give g(r) + 3u(r). r3 + r2 - 1 Let x(l) = -14l3 - l2 - l - 1. Let g be x(-1). Let n(t) = -5t + 8. Let c(b) = 11b - 17. Determine gn(i) + 6c(i). i + 2 Let x(b) = b*3 + 4b*2. Let h(z) = -2z*3 + 12z*2 - 9z + 7. Let t be h(5). Let i(k)	{ "pile_set_name": "DM Mathematics" }
+ 28 = 0. Is 4((-241)/x - 2) composite? False Suppose -7m - 14785 + 57898 = 0. Is m composite? True Let n(j) = j - 5. Let q be n(8). Suppose 721 + 50 = qx. Is x a composite number? False Suppose -3h = -3p + 51, 5h + 1 = 4p - 3p. Is p a prime number? False Let u be 266/(21/(-2)). Suppose -d - z = -5, 5z - 19 = -d - d. Is (u - -3)(-3 + d) composite? False Suppose 0 = -2i - 4u + 400, 13i = 15i + u - 403. Is i a prime number? False Suppose 6d - 2d = 3k - 58, -2k + 40 = -3d. Let b = 99 + k. Is b a prime number? True Let j(o) = 6o2 - 31o - 6. Is j(-11) a composite number? False Let p(d) = -36d - 5. Suppose -4r + 5 = -11. Suppose -q + 0q = -3y - 18, -4y + rq - 24 = 0. Is p(y) prime? True Let r(z) be the third derivative of z7/840 - z6/180 + 5z4/24 + z3/6 - 3z*2. Let q(u) be the first derivative of r(u). Is q(4) a prime number? True Suppose -105 = -p + 214. Is p composite? True Suppose -5a = 5d - 3925, 0d - 3d = 2a - 2355. Is d a composite number? True Suppose 2h - 308 = -4f, -4f - 664 = -3h - h. Suppose 5l = 2l - h. Let o = 80 + l. Is o a composite number? True Suppose -m - 528 + 1615 = 0. Is m a prime number? True Suppose -2 = 3n + 10. Let x be (-90)/n + 12/8. Let k = x + -17. Is k prime? True Suppose 3w = -0w + 12. Suppose 5a = h - 6 - 50, -wa + 84 = 2h. Is h a composite number? True Let b(k) = k2 + 6. Let c be b(7). Suppose m = -21 + c. Is m a composite number? True Let t = -78 - -25. Let r(x) = -x3 + x*2 + x + 54. Let y be r(0). Is (-1)/(y/t - -1) a prime number? True Let g(v) = 233v + 2. Is g(1) composite? True Suppose -24 - 36 = y. Let f = y + 271. Is f a prime number? True Let f = 23 + -12. Let x = f - 3. Suppose -3o = -xo + 105. Is o prime? False Let s be (-2)/(-2) + (10 - 3). Suppose 0 = -sb + 12b - 636. Is b a prime number? False Suppose 4k = 5c - 2499, 0 = 5c - 2k + 3k - 2494. Is c a composite number? False Let f be 14/6 + 2/3. Suppose -3m - 85 = 2q, q - fm + 4m = -45. Let c = q + 85. Is c a prime number? False Let c be (204/8)/((-2)/8). Let v = c + 189. Is v prime? False Suppose 3a - 7a + 212 = -5q, -4a + 224 = -2q. Is a a prime number? False Is (-8 - -4 - -1) + 3910/1 composite? False Let x(n) = n*3 - 5n*2 + 3n + 4. Let q be x(4). Let h = 0 - q. Suppose 2u - 5v + 6 = h, 0 = 2v - 9 + 1. Is u composite? False Suppose 655 = s + 4s. Is s a composite number? False Let r = -8 - -12. Suppose 0 = 4f - ri, -7f + 5i = -3f. Is (f - (-4)/(-6))-51 prime? False Let o = -605 + 1092. Is o prime? True Let x be 2/((-88)/(-87) - 1). Suppose u - x = -u. Is u a composite number? True Suppose 5v = v + 88. Suppose -2j + v = -40. Is j composite? False Let t = 614 - 355. Is t composite? True Suppose 20 = 4v - 48. Let q = 130 - v. Is q prime? True Let d = 1739 + -1030. Is d a composite number? False Suppose 30s + 4535 = 35s. Is s prime? True Is ((-15)/(-6))/(7/1414) a composite number? True Suppose 3t - 10 = 4t. Is t/(2 - (-48)/(-21)) composite? True Let x(a) = a2 - 10a + 5. Let j be x(10). Let f(n) = n*2 - 5n + 1. Let w be f(j). Is (w/2)/(4/536) a composite number? False Let d = -108 + 159. Is d a composite number? True Suppose 0 = f - 138 - 111. Let o be 1 + f + 3 - 2. Suppose y - o = -0y. Is y composite? False Let j(o) = -o2 + 65. Let m = -6 - -6. Is j(m) prime? False Let o be (-3)/(3(-3)/6). Suppose 0 = -c + oy - 15, 8c - 3y + 68 = 3c. Is -3-1c/(-3) a composite number? False Let w = -32 - -51. Is w a prime number? True Let i be 12(-15)/18-2. Suppose -4o = t - 239, -i = -o - 4t + 51. Is o a composite number? False Let a(x) be the second derivative of -x5/20 - x4/2 + 7x2/2 - 4x. Is a(-6) composite? False Let c = 0 - -3. Suppose -ck + 11 = -10. Is k composite? False Let x be -2((-158)/3)/((-8)/12). Suppose 3i - 715 = 188. Let z = i + x. Is z composite? True Suppose 0 = 3d - 926 - 481. Is d prime? False Let g = 35 - 13. Is g a prime number? False Suppose 6 = w - 4q - 1, q - 14 = -5w. Suppose 0 = z - wo - 46, -2o = -5z - o + 216. Is z a prime number? True Suppose 8i - 3i = -4m + 427, -i + 95 = 4m. Is i composite? False Let n(u) = -22u - 4. Is n(-5) prime? False Suppose l + 5 = 0, -4t + 4l + 39 = -3t. Suppose 4g + t = -3m + 169, -83 = -2m + 3g. Is m composite? True Is 6/36 - (-35290)/12 prime? False Let r(b) = 27b*3 - 5b*2 + 4b + 1. Is r(3) a composite number? True Let b(v) = -v*3 - 6v*2 + 8v + 4. Let l be b(-7). Let k(a) = 14a2 + a - 4. Is k(l) a prime number? False Suppose 12 = 4z + 4o, 4z - 4 = -0z + 4o. Suppose 3r + 2 - 5 = 3b, 5b - 16 = -zr. Suppose rl - 15 = 60. Is l a prime number? False Suppose 3 = 2o - 1. Is (-8)/o(-113)/4 prime? True Let s be (-3)/(6/(-4))452. Suppose n - 5n + s = 0. Suppose 3k - k = n. Is k a prime number? True Let i be -3 + (0/3 - -3). Suppose i = -4g + 8, -3h = -6h + 3g + 48. Suppose -2v = -h - 34. Is v a composite number? True Suppose 2 = 2u, 4j + 5u - 17 = j. Let l be ((-6)/j)/(12/(-32)). Suppose 0 = 2b + i - li - 95, 3i = 4b - 181. Is b a composite number? False Let m(c) = -6c + 1 + 0c2 + 0 + c2 + 4. Suppose -5y + 5k = -25, 4y + 2k - k - 35 = 0. Is m(y) prime? False Let h(v) = 53v + 3. Is h(8) a prime number? False Let y be 495/12 - (-2)/(-8). Suppose 3k - l = 5k - y, -94 = -3k + 5l. Is k prime? True Suppose -3 = -5g - 3d, 5 = 2g - 4g + 5d. Let z be g - (1 + 0 + 15). Let m = 81 + z. Is m a prime number? False Suppose v + v - 6 = 0. Suppose 0 = -2n - 6, -4n = vs - 8s + 202. Is s a composite number? True Suppose 154 + 137 = 3x. Is x a prime number? True Let a(r) = -4r - 1. Let n be a(-1). Let y be (1 - 2) + n - -52. Suppose -5l + 71 = -y. Is l a composite number? True Let q be 0 + -3 + 6 - -44. Suppose 0a + 3l - q = -4a, a + 5l - 16 = 0. Is a prime? True Suppose -266 = -u + 141. Is u composite? True Let d = 8 + -12. Is 75/2 - d/(-8) composite? False Let s(u) = -3u*3 - 13u*2 - 6u - 1. Let l(h) = -13h3 - 52h*2 - 23h - 3. Let v(n) = 2l(n) - 9s(n). Is v(-5) a composite number? False Suppose -12p + 2a + 828 = -10p, -394 = -p + 5a. Is p composite? False Let v(i) = 3i + 1. Let h be v(8). Let x = 33 + h. Is x prime? False Suppose 1574 = 30b - 28b. Is b composite? False Suppose -3y + 0y + 180 = 3l, 123 = 2y + 5l. Is y a composite number? False Suppose 4i = 3i + 11. Is i prime? True Suppose t + n = 455, 2n - 1824 = -4t - 3n. Is t a composite number? True Let h(y) = 619y + 64. Is h(7) prime? True Suppose -o = k + k + 27, 0 = 3o - 3k + 54. Let w = 72 + o. Is w prime? False Let o be -3 - (-2 - (3 - 31)). Suppose 4s + 2b + 64 = 0, 0s = -3s - 2b - 50. Let x = s - o. Is x a prime number? False Suppose 3g - 4g = -170. Let n = 361 - g. Is n prime? True Suppose 0 = -4j - 5v + 1936, -j + 3v = -3j + 970. Is j a composite number? False Let y(g) = -43g - 5. Let q(z) = z + 1. Let u(o) = -4q(o) - y(o). Let r(k) = 38k + 1. Let w(m) = 6r(m) - 5u(m). Is w(2) a prime number? True Let c(j) = -j*2 + j - 2. Let d be c(-2). Let s be 4/(-6) - d/3. Suppose 54 = 4m + u, m = 2m + su - 17. Is m composite? False Let s = -10 - -33. Suppose 14 + s = t. Is t composite? False Let i be -63/6-1. Suppose -im + 3p + 47 = 2p, -5m - 2p = -71. Is (-10)/m - (-514)/6 composite? True Let v be 29/(-3) + 1/(-3). Let z(c) = c3 + 11c*2 + 8c + 3. Is z(v) prime? True Suppose -z = -345 + 91. Is z prime? False Let l(q) = -4q + 7. Is l(-8) a prime number? False Suppose a + 0m - 8 = 4m, 2m = -3a - 4. Let z = -2 + a. Let x = z + 9. Is x a composite number? False Suppose 4r - 2r = -3s + 1742, 2r = s + 1758. Is r prime? True Suppose 3i + 65 = 4i. Is i prime? False Let m = 487 - 279. Let l = m + -117. Is l composite? True Let k(c) = 2c*3 + 6c*2 + 16c + 7. Is k(10) a composite number? False Let d(y) = -6y3 - 3y + 4. Is d(-5) composite? False Let c(b) = b*3 + 5b*2 + 4b + 3. Let n be c(-4). Is (-59)/((-4 - 0) + n) a composite number? False Let q be 39/18 + (-1)/6. Suppose -o + 3m - 29 = -qo, 102 = 4o - 2m. Is o a composite number? True Suppose 2f + 3o - 18 = 0, -2f + 0o - 5o = -26. Let l(x) = f - 5 - 7x - 3 + 3. Is l(-3) a composite number? False Suppose -1022 = -3*h + 433. Suppose 0	{ "pile_set_name": "DM Mathematics" }
rm of 433, 1517, 3253, 5641, 8681? 326r2 + 106r + 1 What is the w'th term of -106, -160, -214, -268, -322, -376? -54w - 52 What is the p'th term of 8764, 17480, 26192, 34900? -2p*2 + 8722p + 44 What is the b'th term of -1418, -2858, -4304, -5762, -7238? -b*3 + 3b*2 - 1442b + 22 What is the o'th term of 14751, 14819, 14931, 15087, 15287? 22o2 + 2o + 14727 What is the s'th term of 130042, 130067, 130090, 130111, 130130, 130147, 130162? -s*2 + 28s + 130015 What is the f'th term of 1851, 1914, 1967, 2004, 2019, 2006, 1959, 1872? -f3 + f2 + 67f + 1784 What is the l'th term of -2600, -5207, -7812, -10421, -13040, -15675? -l3 + 7l*2 - 2621l + 15 What is the s'th term of 1318261, 1318256, 1318241, 1318210, 1318157, 1318076, 1317961, 1317806? -s3 + s2 - s + 1318262 What is the g'th term of 3672, 7273, 10800, 14253, 17632, 20937? -37g2 + 3712g - 3 What is the h'th term of 3274, 3083, 2892? -191h + 3465 What is the n'th term of -3092, -3053, -3014, -2975, -2936, -2897? 39n - 3131 What is the c'th term of 8, -3, -18, -37, -60, -87? -2c2 - 5c + 15 What is the c'th term of 180124, 360247, 540370, 720493, 900616? 180123c + 1 What is the d'th term of -90327, -180650, -270971, -361290? d2 - 90326d - 2 What is the x'th term of 391, 1572, 3543, 6304? 395x2 - 4x What is the c'th term of -12072, -11941, -11812, -11685, -11560? -c*2 + 134c - 12205 What is the f'th term of 116, 211, 44, -517, -1604, -3349, -5884, -9341? -22f3 + f2 + 246f - 109 What is the c'th term of -83082, -83083, -83084? -c - 83081 What is the k'th term of -1171, -4660, -10463, -18580? -1157k2 - 18k + 4 What is the n'th term of 3114, 6270, 9426? 3156n - 42 What is the z'th term of 3420, 3128, 2834, 2538, 2240, 1940, 1638? -z2 - 289z + 3710 What is the l'th term of -51, -226, -731, -1740, -3427, -5966? -29l3 + 9l*2 + l - 32 What is the b'th term of 92053, 184111, 276169, 368227, 460285, 552343? 92058b - 5 What is the u'th term of 245, 921, 2053, 3641, 5685? 228u2 - 8u + 25 What is the a'th term of -103508, -103509, -103510, -103511, -103512, -103513? -a - 103507 What is the d'th term of 20, 307, 1098, 2651, 5224, 9075, 14462, 21643? 43d3 - 6d*2 + 4d - 21 What is the y'th term of -890, -1941, -2992, -4043, -5094, -6145? -1051y + 161 What is the y'th term of 88, 131, 186, 253, 332, 423, 526? 6y*2 + 25y + 57 What is the i'th term of 248, 493, 740, 989, 1240, 1493? i*2 + 242i + 5 What is the m'th term of 118105, 118108, 118111, 118114, 118117? 3m + 118102 What is the a'th term of -333, -804, -1413, -2166, -3069? -a3 - 63a*2 - 275a + 6 What is the b'th term of 1019, 4006, 8985, 15956, 24919, 35874? 996b2 - b + 24 What is the m'th term of -1932, -1925, -1914, -1899, -1880, -1857? 2m*2 + m - 1935 What is the a'th term of -193, -297, -381, -433, -441, -393? 2a*3 - 2a*2 - 112a - 81 What is the s'th term of 659512, 1319023, 1978534? 659511s + 1 What is the h'th term of 7104, 7077, 7050? -27h + 7131 What is the a'th term of -732445, -732441, -732435, -732427, -732417, -732405, -732391? a*2 + a - 732447 What is the f'th term of -594, -1930, -3266, -4602, -5938? -1336f + 742 What is the o'th term of 940672, 940674, 940678, 940684? o*2 - o + 940672 What is the f'th term of -24, -82, -150, -228, -316? -5f*2 - 43f + 24 What is the g'th term of -698, -1746, -3134, -4868, -6954, -9398, -12206? -g*3 - 164g*2 - 549g + 16 What is the o'th term of 3645, 7293, 10965, 14673, 18429? 2o3 + 3634o + 9 What is the c'th term of 913, 1759, 2429, 2833, 2881, 2483, 1549, -11? -15c3 + 2c*2 + 945c - 19 What is the o'th term of 1155804, 2311612, 3467420, 4623228, 5779036, 6934844? 1155808o - 4 What is the z'th term of 20, 174, 452, 854, 1380, 2030? 62z*2 - 32z - 10 What is the a'th term of -1646, -13220, -44640, -105830, -206714? -1654a3 + a2 + a + 6 What is the f'th term of 52, 71, 88, 103? -f2 + 22f + 31 What is the v'th term of 3453, 13749, 30901, 54903, 85749? -v*3 + 3434v*2 + v + 19 What is the f'th term of -6814, -6820, -6822, -6820? 2f*2 - 12f - 6804 What is the w'th term of 12009, 12013, 12021, 12033, 12049? 2w2 - 2w + 12009 What is the f'th term of -3239651, -3239650, -3239649, -3239648, -3239647? f - 3239652 What is the o'th term of 10693, 21381, 32069, 42757? 10688o + 5 What is the w'th term of -379074, -758149, -1137224? -379075w + 1 What is the h'th term of 41596, 41629, 41688, 41785, 41932, 42141, 42424? 2h3 + h2 + 16h + 41577 What is the x'th term of -210198, -210221, -210244? -23x - 210175 What is the j'th term of -382, -808, -1218, -1606, -1966, -2292, -2578, -2818? j3 + 2j*2 - 439j + 54 What is the p'th term of 1482, 2991, 4500, 6009, 7518, 9027? 1509p - 27 What is the z'th term of 100322, 100337, 100352? 15z + 100307 What is the l'th term of 376, 496, 358, -38, -692? -129l2 + 507l - 2 What is the z'th term of -79, -192, -387, -670, -1047, -1524? -z*3 - 35z2 - z - 42 What is the l'th term of -36008, -36007, -35998, -35975, -35932, -35863, -35762? l3 - 2l2 - 36007 What is the y'th term of 340, 401, 462? 61y + 279 What is the g'th term of 1310, 2388, 3466, 4544? 1078g + 232 What is the d'th term of -3533, -3523, -3503, -3467, -3409, -3323, -3203, -3043? d3 - d2 + 6d - 3539 What is the f'th term of 1399, 1420, 1461, 1528, 1627? f*3 + 4f*2 + 2f + 1392 What is the d'th term of 51, 107, 247, 513, 947, 1591, 2487? 7d3 + 7d + 37 What is the y'th term of -2510, -4634, -6760, -8888, -11018? -y*2 - 2121y - 388 What is the c'th term of 357, 749, 1179, 1647? 19c2 + 335c + 3 What is the s'th term of -53, -216, -513, -962, -1581? -3s3 - 49s*2 + 5s - 6 What is the t'th term of -18393, -18379, -18351, -18303, -18229, -18123, -17979, -17791? t3 + t2 + 4t - 18399 What is the k'th term of -457, -487, -505, -511, -505, -487, -457? 6k*2 - 48k - 415 What is the d'th term of 14093, 14102, 14117, 14138, 14165, 14198, 14237? 3d2 + 14090 What is the m'th term of -1282, -2665, -4048? -1383m + 101 What is the p'th term of 49, 180, 367, 592, 837? -3p3 + 46p*2 + 14p - 8 What is the t'th term of 12443, 12437, 12453, 12503, 12599, 12753, 12977, 13283? 2t3 - t2 - 17t + 12459 What is the q'th term of 40, 66, 90, 112? -q*2 + 29q + 12 What is the j'th term of 210463, 210457, 210451, 210445? -6j + 210469 What is the w'th term of 51321, 51234, 51147, 51060? -87w + 51408 What is the r'th term of 2596326, 2596325, 2596324? -r + 2596327 What is the p'th term of -52, -144, -256, -394, -564, -772? -p*3 - 4p*2 - 73p + 26 What is the u'th term of 2930, 3048, 3382, 4040, 5130? 18u3 - 8u + 2920 What is the r'th term of -1121, -1321, -1523, -1727? -r*2 - 197r - 923 What is the m'th term of -856, -1122, -1388? -266m - 590 What is the l'th term of -1290, -1381, -1472? -91l - 1199 What is the o'th term of -4677, -9357, -14037, -18717, -23397? -4680o + 3 What is the n'th term of -108899, -108880, -108863, -108848, -108835, -108824, -108815? -n2 + 22n - 108920 What is the v'th term of 2062, 4124, 6188, 8254? v*2 + 2059v + 2 What is the l'th term of 6663, 6659, 6653, 6645, 6635? -l*2 - l + 6665 What is the q'th term of 37, 169, 505, 1141, 2173, 3697, 5809, 8605? 16q*3 + 6q*2 + 2q + 13 What is the j'th term of -59762, -59763, -59764, -59765, -59766? -j - 59761 What is the a'th term of 384762, 384765, 384768? 3a + 384759 What is the r'th term of -416803, -416802, -416799, -416794, -416787? r2 - 2r - 416802 What is the o'th term of 1061, 1024, 989, 956? o*2 - 40o + 1100 What is the m'th term of 1643735, 3287469, 4931203, 6574937? 1643734m + 1 What is the g'th term of 37925, 37923, 37921, 37919, 37917, 37915? -2g + 37927 What is the p'th term of -254, -580, -896, -1196, -1474, -1724, -1940, -2116? p3 - p2 - 330p + 76 What is the w'th term of -371, -766, -1175, -1604, -2059? -w3 - w2 - 385w + 16 What is the c'th term of 107, 209, 237, 155, -73? -6c3 - c2 + 147c - 33 What is the m'th term of 87041, 87042, 87043, 87044, 87045, 87046? m + 87040 What is the x'th term of -1912, -2006, -2100, -2194, -2288, -2382? -94x - 1818 What is the y'th term of 1954, 3922, 5890, 7858, 9826? 1968y - 14 What is	{ "pile_set_name": "DM Mathematics" }
= 5v2 - v - 6. Let d(h) be the second derivative of h4/12 + h3/6 - h2/2 - h - 1. What is 6d(s) - x(s)? s*2 + 7s Suppose 0k - 24 = -4k + 4j, 0 = -4j - 12. Let q(u) = -2u2 - ku + 2 - 1 - 3. Let y = -738 + 735. Let s(l) = l*2 + l + 1. What is ys(o) - q(o)? -o2 - 1 Let l(n) = n3 - n*2 - 1. Let h(b) = 7b*3 + 311b*2 - 6. Calculate -h(g) + 6l(g). -g*3 - 317g*2 Let x(j) = -j + 3. Let h(r) = 1. Let q = -70 + 69. What is qx(n) + 6h(n)? n + 3 Let v(c) be the second derivative of -c3/6 + 9c - 4. Let u(l) = 5l + 2. Give -u(p) - 4v(p). -p - 2 Let w(j) = -j2 + j + 1. Let o(l) = l2 - l. Let f(m) = m*2 + 18m + 60. Let u be f(-5). Give uo(t) - 4w(t). -t*2 + t - 4 Let d(t) = -2t*2 + 16. Let n(u) = 2u*2 - 17. Determine -3d(a) - 2n(a). 2a2 - 14 Let s(y) = -y3 - 5y2 + 33y + 157. Let c be s(-6). Let k(u) = -7u2 - 7u - 12. Let w(v) = -11v2 - 11v - 18. Determine cw(b) + 8k(b). -b*2 - b - 6 Let b(q) = 7q*2 + 8q + 9. Let w(f) = -8f2 - 9f - 9. What is 6b(d) + 5w(d)? 2d2 + 3d + 9 Let u be ((-2)/(-5))/((-5)/25). Let z(c) = -4c + 1. Let t(f) = 192f + 180f - 373f. Calculate uz(o) + 7t(o). o - 2 Let d(g) = -4g - 5. Let c(r) be the first derivative of -r2/2 - r + 1. Let m be 5/2108/606. Let u be (m/(-12))/((-2)/(-16)3). Calculate uc(a) + d(a). 2a + 1 Let q(v) = -3v2 - 19v - 9. Let z(n) = 2n3 - 16n*2 - 96n - 48. Give 16q(i) - 3z(i). -6i3 - 16i Let f(g) = -g - 1. Let u(v) = -v. Let l(k) = 3f(k) + 6u(k). Let r(j) = -17j - 7. Give 5l(t) - 2r(t). -11t - 1 Let o(y) = 2y + 3. Let x(t) = 440t + 2 - 1 - 441t. Give o(f) - 2x(f). 4f + 1 Let y(o) = -2o*3 - 4o*2 - 4. Let v(x) = -3x*3 + 66 - 37 - 5x*2 - 34. Calculate 4v(n) - 5y(n). -2n*3 Let c(x) = -3x3 + x2 - x + 2. Suppose -8f = -2f - 6. Let d(t) = -t3 + t2 - t + 1. What is fd(y) - c(y)? 2y*3 - 1 Let s(a) = a - 1. Let h(r) = 18r + 6. Give -h(q) + s(q). -17q - 7 Let n(t) = 6t*2 - 7t + 1. Let x(s) = -2s2 + 2s. Let b(w) = -2w3 - 33w*2 - 14w + 39. Let u be b(-16). Give ux(q) + 2n(q). -2q2 + 2 Let u(q) = 1039q - 11. Let o(y) = -3116y + 30. Calculate -4o(n) - 11u(n). 1035n + 1 Let h(o) = o*2 + o + 2. Let k = -3 - -7. Let s(d) be the second derivative of 0 + d + 1/2d*2 + 1/6d*3. Determine ks(c) - 2h(c). -2c*2 + 2c Let n be ((-6)/4)/((-24)/32). Let y(q) = -3q + 2q*2 + 2q - q*n + 1. Suppose 0m = 4m + 4. Let c(x) = -8x*2 + 5x - 8. Determine mc(g) - 6y(g). 2g2 + g + 2 Let j(z) = 83z*3 - 3z*2 - 6z - 3. Let y(i) = -167i3 + 5i*2 + 10i + 5. Give 5j(n) + 3y(n). -86n3 Let o(f) = -f - 7. Let l(g) = 4g + 20. Let c(m) = -4l(m) - 11o(m). Let r(j) = -6j - 2. Give 2c(y) - 3r(y). 8y Let i(b) = 5b2 - 9 + 4b - 6b + 7 - 2b. Let t(x) be the second derivative of -2x - 3/2x*3 + 0 + 11/12x*4 - 5/2x*2. Give 9i(p) - 4t(p). p2 + 2 Let w(p) = -p2 - 1. Suppose 0 = 4g, 0 = 5f - 4f + 5g - 10. Let b(i) = 12i*2 + 10. Determine fw(k) + b(k). 2k2 Suppose 0 = x - 3x + 26. Let y(o) = -4o3 + 2o*2 + 13. Let b(j) = 2j*2 - 3j*3 + 6 - 17j2 + j3 + 5j2 + 11j*2. Determine xb(v) - 6y(v). -2v3 + v2 Let k(t) = -2t - 1. Let f(d) = 9d + 5. Let z(b) = -11b - 6. Let q(v) = 6f(v) + 5z(v). Determine -k(s) - 3q(s). 5s + 1 Let a(w) = -2w*2 - 4w - 7. Let o be 0 + -1 + -6 + 3. Let z be 2/((-3)/(-42)o). Let x(t) = 2t*2 + 3t + 6. Calculate zx(p) - 6a(p). -2p2 + 3p Let s = 127 - 125. Let f(n) = -325n + 325n + 8ns. Let h(y) = y2. Calculate f(u) - 12h(u). -4u2 Let h(o) = -24o + 3. Let c(d) = -3d + 1. Determine -2c(t) + h(t). -18t + 1 Let n(q) = -7q + 38. Let g(u) = 10u - 59. Determine 5g(y) + 7n(y). y - 29 Let i(v) = -1. Let z(o) be the third derivative of o8/20160 + o6/720 - o5/20 - 8o2. Let n(x) be the third derivative of z(x). Determine i(m) + n(m). m2 Let j(s) = -7s - 1. Let k(z) be the first derivative of z2/2 + z - 118. Calculate j(b) + k(b). -6b Let g(o) be the first derivative of -8 - 17/2o2 + 17/3o*3 + 3/2o*4 - 3o. Let y(x) = 2x3 + 6x*2 - 6x - 1. Determine -6g(b) + 17y(b). -2b3 + 1 Let o(s) = 5s*2 + 7s - 9. Let q(x) = -14x2 - 22x + 26. Determine 17o(d) + 6q(d). d*2 - 13d + 3 Let x(d) = -5d3 - 2. Let w = -1053 + 1035. Let z(k) = -21k*3 - 9. What is wx(g) + 4z(g)? 6g*3 Let d(g) = -51g*2 + 6g + 11. Let a(m) = -m*2 + m + 4. Give -6a(w) + d(w). -45w2 - 13 Let y(h) = -6h*2 + 4h - 2. Let d(v) = -6v2 + 5v - 3. Determine -3d(a) + 4y(a). -6a2 + a + 1 Let v be 88/10 - 5/(-25). Let o(w) = -4w*3 + 5w*2 - 9. Suppose 5g = 4g. Suppose gr = 2r + 4. Let p(i) = -i3 + i2 - 2. What is ro(a) + vp(a)? -a3 - a2 Let p(y) = -30y + 23. Let g(i) = -20i + 16. Give -7g(o) + 5p(o). -10o + 3 Let l(o) = -o + 2 + 3 - 2 - 3 + 1. Let a(m) = -3m - 6. Determine -a(g) - 6l(g). 9g Let n(q) = q - 38q*2 + 2q - 3 + 24q2 + 7q2. Let a(u) = u2 - u + 1. Calculate 6a(c) + 2n(c). -8c2 Let l(s) = -1 + 4 - s - 4. Let q(c) be the third derivative of c4/6 + 2c*3/3 - 5c*2 + 30. Give -26l(a) - 6q(a). 2a + 2 Let p be (-2)/4(3 + 4 + -8). Let c(o) be the first derivative of 3o - 2 + po2. Let m(n) = 4n + 13. Determine 26c(g) - 6m(g). 2g Let i(w) = 2 - w - 5 + 5w. Let j(s) = -9s + 7. Suppose m = 2m - 2n - 6, 3m - n - 3 = 0. Suppose m = -k + 5 - 0. What is ki(g) + 2j(g)? 2g - 1 Let s(x) = 8x + 4x - 6x. Let o(y) = -18y. Let f be (-38/(-6))/2. Calculate fo(d) + 7s(d). 6d Suppose -4l = 5o + 56, -7 = l - o - 2. Let f(k) = 3k - 4. Let h(x) = 19x - 32x + 5 + 5 + 7. What is lf(b) - 2h(b)? -b + 2 Suppose 0t + 3t = -15, -2g = -4t - 54. Let s(k) = -20k2 + 20k - 11. Let p(d) = -7d2 + 7d - 4. Give gp(n) - 6s(n). n2 - n - 2 Let z(x) be the first derivative of x - 34. Let c(u) be the second derivative of u5/20 + 3u2/2 - 6u. Calculate c(i) - z(i). i*3 + 2 Let k(z) = -4z*3 - 3z - 3. Let l(v) = -17v3 - 13v - 13. Let b = -17 + 23. Give bl(s) - 26k(s). 2s3 Let o(j) = 350j*3 - 3j*2 + 6. Let y(f) = 11550f*3 - 100f*2 + 200. Calculate -100o(r) + 3y(r). -350r*3 Let t(n) = 3n*2 - 13n + 2. Let j(q) = 7q2 - 27q + 4. Give 6j(u) - 13t(u). 3u2 + 7u - 2 Let j(y) = -2y3 - y. Let i be 2/63/1. Let z be (2 - i)(-19 - -8). Let f = -12 - z. Let o(c) = -c. Give fo(h) + j(h). -2h3 Let l(h) = 8h*3 + 43h*2 + 9h + 25. Let s(n) = 3n3 + 21n*2 + 4n + 11. Calculate -4l(u) + 9s(u). -5u3 + 17u*2 - 1 Let r(w) = -2w + 6. Suppose -50s - 105 = -29s. Let y(f) = 2f - 5. Determine sy(u) - 4r(u). -2u + 1 Let u be -10(-2)/15-6. Let n(p) = -p + 1. Let f(q) = 6q - 8. Let b = 314 + -315. Determine bf(i) + un(i). 2i Let k(a) = a*3 - 2a + 1. Let l(t) = -2t3 - 15t*2 + 6t - 5. Determine 4k(m) + l(m). 2m*3 - 15m*2 - 2m - 1 Let l(t) = 12t + 1653. Let v(n) = -n - 150. Determine 4l(s) + 45v(s). 3s - 138 Let q(c) = -7c2 - 7c - 3. Let u(y) = 7y2 + 7y + 4. Calculate -6q(b) - 5u(b). 7b2 + 7b - 2 Let q be -4(-2 - 28/(-16)). Let w = 93 + -95. Let y(z) = z - 1. Let f(g) = 5g. Determine qf(a) + wy(a). 3a + 2 Let m(w) = -6w + 6. Let b(v) = -v - 1. Let i(q) = -b(q) - m(q). Let c(a) = -a + 3. Let p(s) = -5s + 13. Let x(y) = 4c(y) - p(y). What is -i(t) + 6x(t)? -t - 1 Let p(l) = -4l - 2. Let g(y) = 9y + 4. What is 6g(s) + 13p(s)? 2s - 2 Let p(h) be the second derivative of -h5/5 - h4/4 - 3h2 - 256h. Let l(z) = z3 + z2 + 1. Determine 3l(r) + p(r). -r3 - 3 Let a(d) = d - 1. Suppose 5 = 5y - 5. Let s(r) = 159r + 1 + 167r - 329r. Calculate ys(o) + 4a(o). -2o - 2 Let x(c) = 1. Let v(t) = 10t - 3. Let j(p) = -1 + 4 - 15p - 2 + 12p. Let s(o) = 7j(o) + 2v(o). Determine -2s(k) + 3x(k). 2k + 1 Let v(l) = l + 1. Let d be v(-6). Let b(p) = 2p + 3. Suppose -y - 3s + 11 = -6, 5s - 25 = 0. Let k(z) = -4 + y + 0 + 1. What is dk(x) - b(x)? -2x + 2 Let i(c) be the third derivative of c5/30 + 11c*4/24 + 5c*3/6 + 385c2 - 2. Let j(f) = f2 + 5f + 2. Give 4i(z) - 9j(z). -z2 - z + 2 Let a(n) = 48n - 33n - 14n*2 - 32n. Let h(g) = 5g2 + 6g. Give 6a(m) + 17h(m). m*2 Let c(y) = y	{ "pile_set_name": "DM Mathematics" }
4:39 PM and 5:27 PM? 48 What is 300 minutes before 8:05 PM? 3:05 PM How many minutes are there between 5:23 PM and 11:35 PM? 372 How many minutes are there between 7:07 AM and 7:02 PM? 715 What is 266 minutes after 1:37 AM? 6:03 AM How many minutes are there between 4:27 AM and 5:30 AM? 63 How many minutes are there between 3:14 AM and 7:18 AM? 244 What is 144 minutes before 4:52 AM? 2:28 AM What is 50 minutes after 12:42 AM? 1:32 AM What is 89 minutes after 10:44 PM? 12:13 AM What is 405 minutes before 7:10 AM? 12:25 AM How many minutes are there between 9:48 AM and 3:15 PM? 327 How many minutes are there between 5:06 PM and 3:45 AM? 639 What is 320 minutes after 7:30 AM? 12:50 PM How many minutes are there between 4:25 PM and 10:51 PM? 386 What is 430 minutes before 11:12 AM? 4:02 AM How many minutes are there between 7:36 AM and 4:34 PM? 538 What is 20 minutes before 10:48 AM? 10:28 AM What is 291 minutes before 4:27 PM? 11:36 AM How many minutes are there between 5:57 PM and 5:29 AM? 692 How many minutes are there between 10:03 PM and 5:22 AM? 439 How many minutes are there between 4:53 PM and 9:39 PM? 286 What is 692 minutes after 2:09 PM? 1:41 AM What is 607 minutes before 3:11 PM? 5:04 AM What is 324 minutes after 7:42 PM? 1:06 AM How many minutes are there between 2:27 PM and 3:38 PM? 71 What is 610 minutes after 1:46 AM? 11:56 AM How many minutes are there between 3:59 AM and 6:55 AM? 176 How many minutes are there between 10:24 PM and 12:56 AM? 152 What is 121 minutes after 12:43 AM? 2:44 AM How many minutes are there between 1:14 PM and 10:52 PM? 578 How many minutes are there between 6:52 AM and 11:38 AM? 286 What is 405 minutes before 1:17 PM? 6:32 AM How many minutes are there between 11:42 AM and 9:24 PM? 582 What is 175 minutes before 4:31 PM? 1:36 PM What is 705 minutes after 11:26 AM? 11:11 PM What is 703 minutes after 3:41 PM? 3:24 AM How many minutes are there between 4:10 PM and 9:42 PM? 332 What is 458 minutes before 10:14 PM? 2:36 PM How many minutes are there between 9:10 AM and 10:41 AM? 91 What is 418 minutes after 4:31 PM? 11:29 PM What is 543 minutes after 4:48 AM? 1:51 PM How many minutes are there between 6:04 PM and 4:48 AM? 644 What is 612 minutes before 1:09 PM? 2:57 AM What is 96 minutes before 7:07 AM? 5:31 AM What is 630 minutes after 12:20 AM? 10:50 AM How many minutes are there between 2:08 PM and 2:44 PM? 36 What is 209 minutes after 6:34 PM? 10:03 PM How many minutes are there between 11:22 PM and 10:47 AM? 685 How many minutes are there between 4:49 PM and 10:48 PM? 359 What is 463 minutes after 9:39 PM? 5:22 AM How many minutes are there between 5:46 AM and 3:53 PM? 607 What is 549 minutes after 3:39 PM? 12:48 AM What is 14 minutes after 12:53 AM? 1:07 AM How many minutes are there between 9:35 AM and 4:34 PM? 419 How many minutes are there between 7:09 AM and 10:05 AM? 176 How many minutes are there between 5:55 PM and 12:58 AM? 423 What is 69 minutes after 7:15 AM? 8:24 AM How many minutes are there between 4:14 AM and 4:50 AM? 36 What is 714 minutes before 8:04 AM? 8:10 PM How many minutes are there between 6:06 PM and 9:11 PM? 185 How many minutes are there between 3:38 AM and 12:51 PM? 553 What is 502 minutes after 7:37 AM? 3:59 PM What is 184 minutes after 8:24 AM? 11:28 AM How many minutes are there between 1:03 AM and 12:40 PM? 697 What is 69 minutes after 11:20 PM? 12:29 AM How many minutes are there between 11:43 PM and 3:34 AM? 231 What is 439 minutes before 10:36 PM? 3:17 PM How many minutes are there between 6:34 AM and 9:19 AM? 165 What is 231 minutes after 8:10 AM? 12:01 PM What is 406 minutes before 4:24 AM? 9:38 PM What is 209 minutes after 1:53 PM? 5:22 PM What is 20 minutes before 4:55 AM? 4:35 AM What is 394 minutes after 3:39 AM? 10:13 AM What is 609 minutes after 9:29 PM? 7:38 AM How many minutes are there between 3:36 AM and 12:52 PM? 556 What is 120 minutes after 12:16 AM? 2:16 AM How many minutes are there between 1:30 PM and 2:03 PM? 33 How many minutes are there between 9:18 PM and 5:00 AM? 462 What is 155 minutes before 7:42 PM? 5:07 PM How many minutes are there between 1:57 PM and 12:08 AM? 611 How many minutes are there between 3:54 PM and 3:04 AM? 670 How many minutes are there between 4:06 AM and 6:59 AM? 173 What is 153 minutes before 10:43 AM? 8:10 AM What is 107 minutes before 8:47 AM? 7:00 AM How many minutes are there between 7:59 AM and 5:32 PM? 573 What is 374 minutes before 3:14 PM? 9:00 AM How many minutes are there between 2:54 PM and 4:45 PM? 111 What is 120 minutes before 7:23 AM? 5:23 AM How many minutes are there between 2:46 AM and 1:38 PM? 652 What is 546 minutes after 7:16 PM? 4:22 AM How many minutes are there between 10:24 AM and 10:14 PM? 710 What is 327 minutes after 2:54 PM? 8:21 PM How many minutes are there between 8:55 PM and 4:19 AM? 444 How many minutes are there between 2:28 AM and 3:28 AM? 60 What is 467 minutes before 1:34 PM? 5:47 AM How many minutes are there between 4:47 PM and 2:30 AM? 583 How many minutes are there between 6:45 PM and 5:24 AM? 639 What is 270 minutes after 6:56 PM? 11:26 PM How many minutes are there between 10:25 AM and 4:39 PM? 374 What is 107 minutes after 8:10 AM? 9:57 AM What is 132 minutes before 2:06 PM? 11:54 AM What is 325 minutes after 7:12 AM? 12:37 PM How many minutes are there between 7:42 PM and 4:48 AM? 546 How many minutes are there between 1:12 AM and 6:16 AM? 304 What is 688 minutes after 11:32 AM? 11:00 PM How many minutes are there between 3:15 AM and 1:45 PM? 630 How many minutes are there between 7:55 PM and 4:41 AM? 526 How many minutes are there between 2:53 AM and 10:58 AM? 485 How many minutes are there between 5:29 AM and 5:49 AM? 20 How many minutes are there between 6:20 AM and 1:00 PM? 400 What is 283 minutes before 9:24 AM? 4:41 AM How many minutes are there between 2:58 AM and 1:08 PM? 610 What is 388 minutes before 12:11 PM? 5:43 AM What is 253 minutes after 11:38 AM? 3:51 PM How many minutes are there between 1:01 PM and 11:18 PM? 617 How many minutes are there between 5:42 PM and 8:07 PM? 145 How many minutes are there between 3:12 AM and 1:58 PM? 646 How many minutes are there between 12:53 AM and 11:10 AM? 617 How many minutes are there between 10:11 AM and 12:12 PM? 121 How many minutes are there between 6:12 PM and 1:50 AM? 458 What is 39 minutes after 7:27 AM? 8:06 AM How many minutes are there between 8:06 PM and 2:50 AM? 404 How many minutes are there between 1:49 PM and 5:04 PM? 195 What is 321 minutes after 1:32 PM? 6:53 PM What is 107 minutes after 7:39 PM? 9:26 PM What is 388 minutes before 10:27 AM? 3:59 AM How many minutes are there between 4:53 PM and 9:13 PM? 260 How many minutes are there between 11:23 AM and 4:18 PM? 295 What is 260 minutes after 7:59 AM? 12:19 PM How many minutes are there between 4:36 PM and 7:47 PM? 191 What is 617 minutes before 3:41 PM? 5:24 AM What is 588 minutes after 3:06 AM? 12:54 PM What is 337 minutes before 9:57 PM? 4:20 PM How many minutes are there between 7:56 PM and 5:52 AM? 596 What is 139 minutes before 6:43 PM? 4:24 PM What is 501 minutes after 2:32 PM? 10:53 PM What is 530 minutes before 8:59 PM? 12:09 PM How many minutes are there between 11:56 PM and 2:28 AM? 152 What is 6 minutes before 8:46 PM? 8:40 PM What is 480 minutes after 5:18 PM? 1:18 AM What is 520 minutes before 2:24 PM? 5:44 AM How many minutes are there between 3:14 AM and 3:50 AM? 36 What is 386 minutes before 8:43 AM? 2:17 AM What is 139 minutes after 7:14 AM? 9:33 AM How many minutes are there between 4:02 PM and 12:46 AM? 524 What is 400 minutes after 11:48 PM? 6:28 AM What is 156 minutes after 7:22 AM? 9:58 AM What is 69 minutes after 5:05 PM? 6:14 PM What is 2 minutes after 8:58 AM? 9:00 AM How many minutes are there between 12:18 AM and 5:16 AM? 298 What is 591 minutes before 7:12 AM? 9:21 PM How many minutes are there between 9:54 PM and 11:44 PM? 110 What is 585 minutes after 4:01 PM? 1:46 AM How many minutes are there between 2:48 PM and 6:48 PM? 240 How many minutes are there between 11:18 AM and 11:13 PM? 715 What is 517 minutes before 2:25 PM? 5:48 AM What is 88 minutes after 3:18 PM? 4:46 PM How many minutes are there between 9:21 PM and 10:03 PM?	{ "pile_set_name": "DM Mathematics" }
= 4v - 9, -zh = 2v + 15. Let w be (h/3)/(1/(-12)). Solve 4 = -2f - w for f. -4 Let s = -900 - -904. Solve -5m - 9 = sm for m. -1 Let v = -338 - -340. Solve 0x = x + v for x. -2 Let v be -3 + 23/2. Let g be 12/(1/6 - (-10)/12). Let s be 2/9 - 3g/162. Solve 3r + v - 9 = s for r. 3 Let q(s) = -s3 + s2 + s + 18. Let n be q(0). Let i = 26 - n. Solve iy - 3 = 5y for y. 1 Suppose -2g - 63l = -64l + 3, 5l - 15 = 0. Solve -4w + g = -12 for w. 3 Let w = 31 + -27. Let a(j) = -3j - 1. Let o(y) = y*3 + 7y*2 + 5y - 7. Let h be o(-6). Let z be a(h). Solve 0 = ws - zs for s. 0 Suppose 11r = 9r - 6. Let q be (-1)/(32/12 + r). Let v = -7 + 7. Solve -qa - a + 8 = v for a. 2 Let s(j) = -1. Let f(c) be the third derivative of -c4/24 + 7c*3/6 - 5c*2. Let o(l) = -f(l) - 5s(l). Let n be o(5). Solve -v = -nv - 4 for v. -2 Let b(r) = -6r + 306. Let o be b(50). Solve 9d = od - 15 for d. -5 Suppose -3i + 19 = 5u + 1, 0 = -4u + 3i + 36. Let f = -31 - -41. Suppose -7j + fj - u = 0. Solve -a = -ja for a. 0 Suppose -192 - 24 = -12t. Let v = -17 - -4. Let w = t + v. Solve 0m - m = -w for m. 5 Let b(p) be the first derivative of -p2 - 10p - 7. Let w be b(-5). Let a(s) = -s*2 + s + 1. Let i be a(0). Solve wk = -k - i for k. -1 Suppose 9d = 6d + 9. Solve 1 = -dj - 8 for j. -3 Let g(n) = n3 - 7n*2 + 13n - 10. Let s be g(5). Solve -10 = -sl - 15 for l. -1 Let h = 714 - 712. Let b be ((-2)/(-3))/(2/3). Solve -x = -hx - b for x. -1 Let w(x) = x - 1. Let r be w(1). Let h be (0 - 5)/(1/(-2)). Let s = h + -6. Solve rq = -sq for q. 0 Let n(c) = -9c + 21. Let p be n(2). Solve 20 = j + pj for j. 5 Let u(g) = 2g2 - 2g. Suppose 4t - 8 = -8. Let v be u(t). Solve w - 3w - 10 = v for w. -5 Let k = -14 + 30. Let v be 33/(-15) + 2 - k/(-5). Solve 0 = vt - 2t for t. 0 Let b = 159 + -151. Solve -6z + bz = 0 for z. 0 Let g = 14 - 12. Suppose 2d - 2 = g. Suppose -3t + 3x = dx - 9, -x = -3. Solve -ty = -y for y. 0 Let x = 54 + -97. Let s = 45 + x. Solve 0 = -3l + 4l + s for l. -2 Suppose -5b + 45 = 5s, 5s - 18b + 22b - 42 = 0. Solve 5a - s + 31 = 0 for a. -5 Let t be (-1)/((-8)/(-6)) - (-63)/4. Solve -x - 4x + t = 0 for x. 3 Let f(i) = -4i + 6. Let n be f(-3). Let v be (-3)/6 + n/4. Suppose 4b = 0, 2b - v - 4 = -4g. Solve 4c - 5c - g = 0 for c. -2 Let s(m) = m*3 + 6m*2 + 8m + 10. Let a be s(-4). Solve -2z - a + 6 = 0 for z. -2 Let p be 2/(((-80)/(-75))/8). Let k be p/(-75) - 412/(-10). Solve 16 = -5b + k for b. 5 Let q = -61 - -69. Let t be 2/q - (-14)/8. Solve -5b + t = -7b for b. -1 Suppose -3w = -6w + 12. Let m = w + -3. Solve -n + m = -2 for n. 3 Let t(v) be the first derivative of 8v + 1/2v*2 - 10. Let y be t(-6). Solve 3a + y + 10 = 0 for a. -4 Let c = -416 + 427. Solve -5 = 4h + c for h. -4 Let t be 8/24 + 8/3. Suppose -m + tm - u - 7 = 0, -2u = m + 4. Let p = 1 + 1. Solve -pq = mq + 16 for q. -4 Let g(y) = -y - 1. Let t(i) = i3 - 6i*2 + 6i - 4. Let s(d) = 4g(d) + t(d). Let k be s(6). Let b be 0(-1 + (-3)/(-2)). Solve -2a + ka + 8 = b for a. -4 Let t be (-15)/35 + 34/14. Let k(u) = u*2 + 5u - 6. Let n be k(-6). Let i be 16 - 9 - (0 + -1). Solve -i = tb - n for b. -4 Let b(y) = y2 + 4y - 16. Let p be b(-7). Suppose -pt + 25 = -10. Suppose 0 = 4m + 3s - 18 - 10, -32 = -5m - 3s. Solve ma - 13 - t = 0 for a. 5 Suppose 87 = 4z - 9. Let v(g) = g3 - 2g*2 + 3g - 2. Let k be v(2). Solve -kx = z - 8 for x. -4 Let a be (128/(-24))/(14/(-21)). Solve 0 = -8o - 0o - a for o. -1 Let v(w) = -w3 + 5w*2 + 15w + 1. Let t be v(7). Suppose 3c + 8 - t = 0. Solve -g + cg + 2 = 0 for g. 2 Suppose -4 = -d - 0. Let j be 5 + 1(d - 4). Suppose q - 4y + 12 = -4q, -2q - y + 3 = 0. Solve q = -jp - 8 - 2 for p. -2 Let k = 194 + -194. Solve 2o + ko + 2 = 0 for o. -1 Suppose -c = 2c - 9. Let o(y) = y*3 - 5y*2 - 7y + 8. Let l = 12 + -6. Let q be o(l). Solve c = p + q for p. 1 Suppose 3p - 7 = -s, -3s - 2s - 3p + 23 = 0. Suppose 0u + 4u = sh + 12, -5u + 11 = -4h. Let x be (1/(-1) - -3) + u. Solve -2g + 11 - x = 0 for g. 5 Let o be (4 + -5)/(((-1)/21)/1). Let k = 23 - o. Solve 0 = -2z + k + 2 for z. 2 Let t = 110 + -82. Suppose 3j + 2k = 10, -k + t = 4j - 2k. Solve 0 = -2s - 4 - j for s. -5 Let f(v) = -11v - 200. Let k be f(-19). Solve kb - 13 = -4 for b. 1 Let l = 30 - -14. Suppose 11r - l = 44. Solve -r = -4f + 8f for f. -2 Suppose 0 = 2d - 8, -3j = 5d - 0 - 26. Suppose 2r - r - 6 = -4b, -5r + 30 = jb. Let i be (2/3)/(r/36). Solve -iy + 2 = 10 for y. -2 Suppose -q = c - 4, 2c + 2c + q = 13. Let g = 10 - 5. Suppose 4z = -3 - g, -3z = cf + 3. Solve d - f - 1 = 0 for d. 2 Let h be 141/9 + -3 + 4/3. Solve 0 = -13a + ha - 1 for a. 1 Let j be -1(-3 - -1 - (-2 + 0)). Solve ji + 4i = 3i for i. 0 Suppose -4y - 3g + 82 = 0, -2g = -3y - 16 + 69. Let d = y + -19. Solve 4h + 12 = -dh for h. -3 Let n = -8 + 10. Let v(s) be the second derivative of s4/3 - s3/6 - s*2/2 + 4s. Let m be v(-2). Solve nj + 7 = m for j. 5 Suppose -32 = 3r - 2. Let z = 14 + r. Let y be 1z/(-8)-30. Solve n + y = 4n for n. 5 Suppose -68 + 23 = -15l. Solve la - 60 + 63 = 0 for a. -1 Suppose -4l - 4r = -6r - 2, -4r + 10 = -l. Suppose 3q + g = 4g + 3, q + lg - 13 = 0. Solve -qk - 20 = -0k for k. -4 Suppose -2o - 6o + 32 = 0. Suppose 8 = -15r + 8. Solve r = -9d + od for d. 0 Suppose 0 = -2l + j + 2, -4 - 4 = -4l + j. Solve -lc + 3 = -0 for c. 1 Let d(j) = 4j2 - 3j - 26. Let u(g) = -5g2 + 6g + 27. Let i(q) = -6d(q) - 5u(q). Let l = -22 + 32. Let k be i(l). Solve 5n + k - 6 = 0 for n. 1 Let y = 52 + -52. Let x(q) = q3 - q2 + 4q + 2. Let h be x(y). Solve h + 0 = -g for g. -2 Let u = 350 - 334. Solve 3y + 1 = u for y. 5 Let b be (24/10 - 0) + 28/(-70). Suppose -b + 2 = -4h. Solve h = -0r + r - 4 for r. 4 Suppose 33i - 904 = 1043. Solve -54y - 20 = -iy for y. 4 Let u be (-1 + (-3)/3 + 4)/(-2). Let l = 13 + u. Solve 4f - l = -0f for f. 3 Let r = 4 + -1. Suppose 0 = -2z + 6z - 2f - 6, 2z + f - 5 = 0. Solve -rj = -5j + z for j. 1 Suppose -4f = 3t - 70, 0 = -18f + 19f - 3t - 10. Solve 12i - 4i = -f for i. -2 Let y be (4 - 55)/(-3) - -10. Solve yk + 10 = 17k for k. -1 Let q = 29 - 20. Suppose -65 = -3c - 2c. Let m = c - q. Solve a = 2a - m for a. 4 Let k be 288/112 + (-4)/7. Let i be 3/(-9)0/(-5). Solve i = ky - 19 + 9 for y. 5 Suppose 0g = -5g - 20. Let l be (2 - (-1)/4) + 1/g. Solve -3r - 5 = -l for r. -1 Let o be 5/15(3 - 6/2). Let a be o((-10)/4 - -3) + 0. Solve -2j + j = a for j. 0 Let j = 25 + -15. Let d(i) = -i*3 + 10i*2 + 6i - 19. Let k be d(j). Suppose 4h - 19 = k. Solve -2p - 3p = -h for p. 3 Let a = -376 - -387. Solve 2l + a = 17 for l. 3 Let n = -324 - -305. Suppose 0 = 5k - 2i - 111, 0i - 3i - 109 = -5k. Let o = n + k. Solve -od = -2d for d. 0 Let h(d) be the third derivative of -d4/24 + 7d*3/6 + 3d*2. Let u be h(-3). Let y be 0/((2 - -1) + -2). Solve y = 4b + u - 2 for b. -2 Let b be 7 + (-7)/(21/9). Suppose 0 - 3 = -3x + 4d, 4x = bd + 8. Solve 38 = xa + 13 for a. 5 Suppose -5i + 377 = 5n + 72, -5i - 5 = 0. Solve 0 = -9y + 40y - n for y. 2 Let z = -51 - -54. Suppose -5n - 2s = -zs - 50, 0 = -3s. Solve -4q - n = -2q for q. -5 Suppose -79 = -z + 23. Solve -99 = -3t - z for t. -1 Let w = -18 + 19. Let h be (w - 1) + 9/3. Suppose -5 = -4o + h. Solve -o = 4m - 18 for m. 4 Let i(s) = -2s - 2 - 1 + 1 + 3. Let g be i(-3). Suppose -g = -3z + 5. Solve -z = 3o - 19 for o. 5 Let f = -253 - -299. Solve -6 + f = -10l for l. -4 Suppose v - 30 = 5x, -8x + 12 = -11x. Solve -6s = -v - 8 for s. 3 Suppose 0q - 2q + 78 = 4w, 5w = -4q + 93. Suppose -3t - 3 = -w. Solve -tl + l = 0 for l. 0 Let h = 2 + 0. Let r = -2056 + 2059. Solve 0 = rb - hb - 5 for b. 5 Suppose 3t + 0t + 5h = -2, 4t - 8 = 4h. Let j be (3/(-5) + t)/(60/600). Solve jq = -12 + 4 for q. -2 Suppose -74 + 306 = 8j. Solve 2n = -j + 33 for n. 2 Let d = 778 - 769. Solve -20n = -dn for n. 0 Let r be (-8 + 7)0/1. Suppose 2b + 2b - 16 = r. Solve 2p - 4p = b for p. -2 Suppose 5082k - 1056 = 5076k. Solve 0 = -kc + 174*c for c. 0 Suppose 3 = j + 33. Let a be (-16 - -2	{ "pile_set_name": "DM Mathematics" }
8 = 7t. Does 26 divide d? True Suppose -5t - 60 = -6t + 5j, -4t = -2j - 294. Is t a multiple of 16? False Suppose 8 = -4o - 4. Does 6 divide (-6 + 0)/(-2) - o? True Suppose -2q + 25 = 3q. Suppose 0 = t - qt + 28. Is 3 a factor of t? False Suppose -5x = -0x. Suppose 3h - 6 - 30 = x. Does 14 divide h/(-18)(-198)/4? False Suppose 0m = -2m + 20. Suppose -2i - 3i = 5r - 50, -m = -i + r. Is i a multiple of 10? True Suppose 5f + 78 = -22. Let h = 31 + f. Does 4 divide h? False Suppose -2d = 1 - 5. Suppose 2l + 3l = -4c - d, -2l = -2c + 8. Is l + 0 + 2 - -13 a multiple of 6? False Let p be (12 - 3)(-6)/9. Let b = 32 - p. Is 21 a factor of b? False Let d(i) = -i + 63. Suppose 0 = s + 4 - 10. Suppose f - 2p = -s, -f = -3f + 5p - 15. Is 17 a factor of d(f)? False Suppose -2u = -0u - 64. Let p be 2296/u + (-1)/(-4). Suppose w = 5w - p. Is 18 a factor of w? True Suppose 0 = 4w - 2w - 306. Suppose 5l - w = -0l + p, -2p = -l + 27. Is 14 a factor of l? False Suppose -29 - 16 = -5k. Does 3 divide k? True Let j be (-4 + 1)(-112)/24. Let q be 4/(-14) + 424/j. Suppose 0 = k - 2a - q, 4k + 0a + 4a = 132. Does 16 divide k? True Suppose -19 = -5s + 21. Is s a multiple of 8? True Let b(r) = 3r*2 + r + 1. Let p be b(-1). Suppose pk - 32 = -k. Is 4 a factor of k? True Let r be 0 - 2(-2)/4. Let m(z) = -1 + 2z + z2 - r + 5 + z3 - 2z3. Is m(-3) a multiple of 19? False Let l be (135/(-4))/((-2)/8). Is 9 a factor of l(8/(-12) + 1)? True Let d be 5/106/(-1). Let o = 15 + d. Is o a multiple of 8? False Suppose 0 = 2q + 3 - 29. Suppose 73 = 5z + q. Suppose 0 = -4s + z, -r - 3s = -0s - 21. Is 10 a factor of r? False Does 9 divide 7/(-42) + (-109)/(-6)? True Let t(r) be the second derivative of 13r4/12 - r3/2 + 3r. Let z be t(2). Suppose c = -c + z. Does 12 divide c? False Let c(d) = d*2 - 5d - 2. Let w be c(6). Suppose wj - 1 + 15 = -x, -8 = 2x - 2j. Is 20/x(-1 - 8) a multiple of 15? True Let w(o) = o*2 - 11o + 15. Is 2 a factor of w(10)? False Suppose -2m - 5h + 8 = 0, 4m + h + 8 = 2m. Let a = 18 - m. Does 9 divide a? False Let x = -14 + 24. Is x a multiple of 3? False Let w(p) = 40p + 29. Is w(5) a multiple of 24? False Suppose -1 - 7 = 4s. Let p = s + 24. Is p a multiple of 5? False Let n(t) = t*3 - 5t*2 - 7t + 2. Suppose 0 = -g - 3, 3p - 5 = -2g + 10. Is n(p) a multiple of 17? True Is 9 a factor of 2 + -3(-42)/9? False Let d = -3 - -6. Suppose 0q - 2q - dx + 30 = 0, 42 = 3q + 3x. Is q a multiple of 9? False Let a(d) = 6d + 5. Let j be a(4). Suppose l - z - 7 = 0, -2l + 0l - z + j = 0. Does 6 divide l? True Let f(z) = -7z*3 - 3z*2 - 2z + 2. Let y(d) = -d*2 - 12d - 13. Let m be y(-11). Does 25 divide f(m)? True Suppose -3 = -3d - 6. Does 8 divide (4 - (4 + d))16? True Let m = -16 + 22. Let a be 3/m - 1/2. Suppose a = 4k - 5k + 24. Does 11 divide k? False Let m be (3 - 380) + 2 - 0. Let l = -253 - m. Suppose 0 = -5b + 2i + l, -65 - 30 = -4b - i. Does 8 divide b? True Let i = -143 - -17. Let v = i - -176. Let n = v - 25. Is n a multiple of 17? False Let a(b) = -b3 + 3b*2 + b - 4. Let c be a(3). Let d = 3 + c. Does 2 divide d? True Suppose -2l + 90 = -60. Is l a multiple of 25? True Does 36 divide 35 - (5 - 3) - -3? True Let n(u) = -26u + 3. Let j be n(2). Let d = 80 + j. Is d a multiple of 31? True Is (-1)/((-68)/22 - -3) a multiple of 2? False Let b be ((-7)/(-3))/((-2)/(-6)). Let n = b - 12. Let f(c) = -6c - 1. Is 10 a factor of f(n)? False Suppose -3m - 79 = -4m. Does 26 divide m? False Is 2 a factor of (6/(-4))/(((-60)/88)/15)? False Let p(b) = -2b + 21. Does 25 divide p(-11)? False Suppose 4o - 5x - 23 = 2o, 5o + x = 98. Let l = -2 + o. Is 17 a factor of l? True Suppose 8l = -l + 216. Is l a multiple of 2? True Let y be 01/2 - 10. Let o(f) = -f + 1. Is 11 a factor of o(y)? True Let f(i) = i. Let n be (15/(-10))/((-6)/20). Let o(b) = -3b*2 + 7b + 2. Let c(a) = nf(a) - o(a). Is c(-3) a multiple of 9? False Let l = 135 - -136. Is 9 a factor of l? False Let r = 261 + -52. Is r a multiple of 19? True Does 10 divide ((-2)/(-5))/((-7)/(-1575))? True Let v = 5 + -3. Let t = v + 2. Suppose 143 = 5b + ty - 3y, 4b - 4y = 124. Is 16 a factor of b? False Let b(n) = n*2 - 4n - 2. Let a be b(5). Let p(l) = 24l - 6. Let c(f) = 12f - 3. Let t(g) = 13c(g) - 6p(g). Is 14 a factor of t(a)? False Suppose 0 = -3j + 3 + 3. Suppose c - 2 = j. Let h(s) = -s + 9. Is h(c) a multiple of 4? False Let q(m) = m3 + 6m*2 + m - 1. Let w be q(-4). Suppose -c + 3z - 2z + w = 0, -4c + 105 = -z. Is 13 a factor of c? True Let g(l) = -4l2 + l + 3. Let c be g(-3). Let d = -20 - c. Is d a multiple of 4? True Suppose m = -2y + 176, -y - m = 3y - 356. Does 15 divide y? True Suppose -d - 3 = -40. Suppose -26 - d = -3p. Is p a multiple of 8? False Let i = 428 - 248. Is i a multiple of 15? True Let b = 123 - 74. Is 7 a factor of b? True Let t(b) = 2b2 + b - 2. Is 13 a factor of t(-3)? True Let j(a) = -a2 + 6a - 3. Let q be j(5). Suppose -qt = -p - 4 - 29, 3t - 5p = 46. Does 15 divide t? False Let k(t) be the first derivative of -t3/3 - 11t*2/2 + 5t + 1. Suppose 4f + 2u = -34, 26 = -3f + f + 2u. Is k(f) a multiple of 15? True Let i = 10 + -6. Suppose -39 = -ij + j. Is j a multiple of 13? True Suppose w + w = 5b + 6, b + 3 = w. Let r = 6 - 2. Suppose 0 = -rm - w + 15. Is m a multiple of 3? True Does 65 divide 6/42130/45? False Let y(t) = 9t2 + 2t - 5. Is 19 a factor of y(-3)? False Let y(w) = -18w3 + w2 + w + 1. Let h be y(-1). Suppose 4v - 1 - h = 0. Is v a multiple of 5? True Let h be (-2)/(-6)(-2 - -8). Suppose -4t - 9 = -1, 0 = -c - ht - 2. Suppose -2z - 10 = -3z + 4w, -2z + 50 = -cw. Is 15 a factor of z? True Let g = 0 - -2. Suppose 0o = o - 3. Suppose o + g = -d, 145 = 5m - 5d. Does 12 divide m? True Does 3 divide ((-27)/(-3))/3 - -2? False Let m(o) = -o - 14. Let j be m(0). Is 7 a factor of 94/14 + (-4)/j? True Let f(t) = t2 + 6t. Does 25 divide f(7)? False Let g(f) = -13f - 2. Is 3 a factor of g(-2)? True Is 1/21(81 - -1) a multiple of 24? False Suppose s - n = 2n + 12, 5s - 20 = -5n. Is s a multiple of 6? True Let f(n) = n*3 + 8n*2 - 12n - 12. Let k(w) = w*3 + 2w*2 - 2w - 1. Let j be k(-3). Let y be (6/j)/(3/18). Is 8 a factor of f(y)? False Let r(l) = -4l + 7. Let x = -6 - -12. Let n be r(x). Let t = n - -31. Does 5 divide t? False Let d(r) = -15r + 14. Is 17 a factor of d(-3)? False Let r = -16 - -13. Does 12 divide r/4 + (-1323)/(-36)? True Suppose 2r - 6r = -4a, 3r - 2a = 0. Suppose 3q + o + 122 = 0, 5q = 4o - 1 - 174. Let k = r - q. Is k a multiple of 13? True Let m be (3/(-2))/((-4)/88). Let b = m + 28. Is 19 a factor of b? False Let p be (-1)/(-2)-61. Let r = 0 - p. Does 4 divide 1/r + 46/6? True Suppose 84 = 2w - 0w. Suppose 5r + 3m = 37, -5m - 2 + w = 4r. Does 5 divide r? True Suppose 2x + 2n = 307 + 207, 4n = x - 232. Does 36 divide x? True Suppose 0v - 3v - 246 = 0. Let l = -117 - v. Let w = -21 - l. Does 11 divide w? False Let t(n) = 20n*2. Let y be t(1). Suppose 4o = s + 21, -5o - 3s + 2 = -y. Let i(m) = -m*3 + 5m*2 + 2m + 2. Is i(o) a multiple of 5? False Let s(b) = b + 1. Let u = 6 - 4. Let x be s(u). Suppose -k = -xk + 20. Is 6 a factor of k? False Suppose -i + 0i + 11 = 4a, -2i = -a - 13. Let k = i - -2. Is 3 a factor of k? True Let j be (-1 - -3 - 4) + 23. Suppose -s = -2s + j. Is s a multiple of 21? True Let m = -30 - -52. Does 10 divide m? False Is 6/6 + -2 - -18 a multiple of 17? True Suppose 0h - 3h = -84. Suppose -t = -0t - h. Does 14 divide t? True Let j(l) = -l3 - l2 + 3l + 205. Does 41 divide j(0)? True Let j(t) be the first derivative of -3t4 + t + 3. Let f be (1 + -3)/2 - 0. Does 13 divide j(f)? True Let v(d) = -d2 + 7d - 5. Does 3 divide v(5)? False Let p = 8 + -8. Suppose p = -2m + 5w + 3, -2m - 4w = 2m - 76. Is m a multiple of 2? True Let n(d) = -d*3 + 4d*2 + 6d. Let x be n(5). Suppose v - xs + 1 = -1, 2v = -3s + 9. Does 10 divide 74/v + (-2)/(-6)? False Suppose c + 4p = 26, 8 = -c - 3p + 39. Is 23 a factor of c? True Let f(u) = -2u + 5. Let m be f(5). Let p(r) = r*3 + 5r*2 - 8r - 4. Let a be p	{ "pile_set_name": "DM Mathematics" }
3 - 2v3. -1793v*3 Expand (-431b*2 + 196b*2 + 193b*2)(2b - 4b + 3b)(-48 + 15 + 10 + (-5 + 2 + 5)(0 - 3 + 1)). 1134b*3 Expand (2 + 1 - 1)(5b3 - 5b*3 + 3b*5) - 4b*5 - 2b*5 + 8b*5 + 26b*2. 8b*5 + 26b*2 Expand -5a - 5 + 12 + 4a + (87a + 93a + 0a)(4 + 9 + 3). 2879a + 7 Expand 4l4 + 3l*4 - 5l*4 + (2l + l*2 - 2l)(-10 + 10 - 7l2) - l4 + 2l - 2l + l3 - l3 + 6l4 + (-4 + 3 - 1)(l*4 + l - l). -2l*4 Expand -90765a*3 + 3a - 4a + 90768a*3 + 1111a*2 + (2a + 2 - 2)(-2a - 2a2 + 2a). -a*3 + 1111a*2 - a Expand (33 - 21 - 60)(-3w + 2w + 3w)(0w + 7w + 2 - 1). -672w2 - 96w Expand (-2x2 + x2 + 2x*2 + (0x + 3x - 2x)(0 + 0 - 2x) - x*2 + 2x*2 - 15x*2)(5x - 2x + 3x + (-3 + 7 - 2)(4x - 5x + 0x)). -60x*3 Expand (-4y*3 + 3y3 - y3)((-111 + 111 - 10y)(82 - 82 - 5y) + 2y - 2y + y*2 + (y - 2 + 2)(-2y + 2y - 2y) + 0y*2 + 2y*2 - 4y*2). -94y*5 Expand (1 - 5 + 5)(-2 - 2 + 5)(-2 - 3r + 2)(2 - 20 + 91r*3 - 96r*3). 15r*4 + 54r Expand -3p3 + 2p3 - p3 + (-59 - 28 - 1)(6p*3 - 2p*3 - 2p*3). -178p*3 Expand (141 + 49 - 1)(2 - i - 5 + 2)((11i - 6i - 6i)(3 - 1 - 3) - 3i + 4i + 0i) + (-4i + 5i - 3i)(-2i + 6i - 2i). -382i*2 - 378i Expand 2v5 + 3v*5 - 4v*5 - 177789v*4 + 177789v*4 - 87v*5 + 4v3 + (v5 - 2v5 + 0v*5)(2 - 1 + 1). -88v5 + 4v*3 Expand (-333z - 66z - 39z)(-3z*4 - 2z*4 + 3z*4) + 3z - 3z - 4z*5. 872z*5 Expand 4x*3 - 2 + 2 + (2x - x + x)(-8x*2 + 0x*2 + 0x*2) - 5x*2 - 6x + 9x + 2x*3 + 0x. -10x3 - 5x*2 + 3x Expand -3m - m + 6m + (-4m + m + m)(-3 + 2 + 3) + 4m - 4m - 4m - 7m - 25 + 8m + 14. -5m - 11 Expand 209 - 8h - 211 + 2h + (3 + 2 + 13)(-3h + h - h). -60h - 2 Expand (4 + 1 - 4)(-v + 2 - 2) + 29v - 18v - 19v - 16v. -25v Expand (-6 - 2 + 7)(2u3 - u2 + u2) - 1 + 1 - u3 + (3u - 4u - 2u)(1 + 3u*2 - 1) + (2u*3 + 5u3 + u3)(1 + 3 - 2). 4u*3 Expand (0 - 2m + 0 + (4m - 5m + 5m)(2 - 3 + 0))(-481 + 768 + 812)(0m + 0m - 3m). 19782m*2 Expand (-2l*4 - 1 + 1)(-248 - 259 + 149)(-8 - 4 + 1 + (1 + 2 - 2)(0 - 4 + 3)) + (-l*2 + 2l2 + l2)(2l*2 + l - l). -8588l*4 Expand (-3q + 0q + 2q)(-1 - 1 - 3) - 470q + 3911 - 3911. -465q Expand -1 - d + 1 + 4d + d - 3d - 4 - d + 4 + 2d - d + 0d + 2d - 4 + 4 + d + 0d - 3d + (0 - 1 + 0)(2 + d - 2) - 3 - 2d + 3 + 502 + 280d - 502. 278d Expand (0p + 0p - 5p)((-2 + 0 + 3)(0 - 2 + 0) - 3 - 3 + 4) + (-3p - 3p + 4p)(35 - 51 - 39). 130p Expand -50b2 - 80b*3 + 50b*2 + (0b*2 - 3b2 + b2)(-18b + 9 - 9) + (-b*2 + 2b - 2b)(21 + 4b - 21). -48b*3 Expand 0o*5 + 2o*5 + 0o*5 - 3o - o*5 + 3o + (-o*4 - 5o*3 + 5o*3)(2o - 2o - 2o) - 2132o*3 + 65o*5 + 2132o*3 - 5o*5 + 4o*5 - 2o*5. 65o5 Expand -o5 + o5 + o5 + 0o - 2o*5 + 0o + (0o2 + 0o2 + o2)(2o*3 - 4o3 + o3) + 6o5 - 2o*4 + 0o*4 - 16o*4. 4o*5 - 18o*4 Expand (-y - y + 0y)(-1098 - 1172 - 44). 4628y Expand (-1397v + 1397v - 3305v2)(4 + 0 - 2). -6610v2 Expand (-238s + 282s - 240s)(-6 - 9 - 12 + 7). 3920s Expand (13 + 4 + 0)(-3 + 2m + 1 + 1)(-1 + 4 - 2)(3 - 6 + 6)(2m*2 + 0m + 0m)(369 - 369 - 89m). -18156m*4 + 9078m*3 Expand -23p*4 + 23p*4 + 3p*5 - 2p + 2p - p5 + (-6 + 0 + 0)(0p5 - 4p5 - p5). 32p5 Expand (c2 + c2 + c2)(17 - 480c + 225c + 229c). -78c*3 + 51c*2 Expand (1 + 2 - 2)(-3g3 + g3 + 4g3) - g3 - 3 + 3 - 4570 + 11g3 - 76g*3 + 4568. -64g*3 - 2 Expand (-s - s + s)(4 - 3 + 5) + s - 4s + 6s + (4 - 4 - 2s)(-4 + 2 + 0) + s + 10s + 19s. 31s Expand (q - q - 2q)(0q*2 + 0q*2 - 2q*4) - 45q + 45q + 25q*5 + 204q*4 - 41q*5 - 204q*4 + 2q. -12q5 + 2q Expand 201p + 6p*5 - 201p + 2p2 - 2p2 + p5 + (-2 + 2 - 2p2)(4 + 2p3 - 4) - p5 - 2p*5 + 4p*5 - 39p*5 + 20p*5 - 17p*5. -32p*5 Expand (118 - 56 + 116)(-2a + 5a - 4a) + 24a - 45a - 48a - 8a. -255a Expand -249i5 + 495i*5 - 315i*5 + (-2i - 1 + 1)(0i*4 + 3i*4 - 5i*4) - 4i5 + i5 + 2i5 - 2i*5 - 2i*5 + 3i*5. -67i*5 Expand (3r*2 + 3r - 3r)(r - 3r + 0r)(93 - 93 + 370r*2). -2220r*5 Expand (-1072 - 628 + 197 + 176)(o*3 - 2o*3 + 0o*3). 1327o*3 Expand (26u*2 - 17 + 17)(-4 + 2 + 7) - 58 - 7u2 + 58. 123u*2 Expand (24s + 13s - 19s)(-2s*3 + 4s - 4s) + (5s - 3s + 0s)(-17s*3 - 19s*3 - 27s*3). -162s*4 Expand (-10r + 2r + 5r)(146 + 25r*3 - 146) + (-r + 0r + 2r)(-2 + r*3 + 2). -74r*4 Expand (2 - 1 + 2)((1 + 0 - 3)(-2r + 5r - 2r) + 2r - 3r + 2r - r - 1 + 1 + 344r - 377r + 2115r). 6240r Expand (100b + 159b - 11b)(-10b + 10b - 2b*3) - 4b + 4b - b4. -497b4 Expand ((-5 - z2 + 5)(-z + 3z - z) + 6z3 - 5z*3 - 2z*3 - 55z*3 + 194z*3 + 85z*3)(4 - 3z2 - 1 - 1). -666z*5 + 444z*3 Expand (2 - 2 + u)(u*3 + 3u*3 - 5u*3) - 6u*4 - 39612u - 90 + 39612u. -7u*4 - 90 Expand (3g*2 + 0g*2 - 6g*2)(1 + 16 - 4)(12 + 6 + 3). -819g*2 Expand (3 - 2 + 3)(5 + 0 - 2)(-1 + 2 + 1)(t*2 + 0 + 0)(-26t + 14 + 28t + 26). 48t3 + 960t*2 Expand -83j + 162j + 104j + 12j - 4j + 2j + (-2 + 2 + 2)(3j + 2j - 4j). 195j Expand -3368l2 - 1020l + 340l + 338l + 342l + (l2 + 3 - 3)(0 + 5 - 3) + 0l2 - l2 + 6l*2. -3361l*2 Expand (16i + 0i - i)(-105 - 100 - 22). -3405i Expand 12h*3 - 12h*3 - 7h5 - h5 - h*5 + 0h*5 + (-2h2 - h2 + 2h2)(-1 + 1 - h*3) - 87h*5 + 193h*5 + 157h*5. 255h*5 Expand (3r + 0r2 - 4r + r*2)(3 + 4 - 4)(-13r*2 + 8r*2 - 8r*2). -39r*4 + 39r*3 Expand (-161r + 80r + 83r + 8r3)(r + 26r + 19r). 368r4 + 92r*2 Expand (2x - 4x + 3x + (-6 + 3 + 10)(2x - 4x + 3x))(2x + 0x - 4x)(-4 + 64 - 8). -832x*2 Expand (2 - 2 + 2)(-2 - 3 + 7)(310157 + 0p - 310158 - 3p). -12p - 4 Expand (2 - 4 + 0 + 28 - 48 - 23 + (-1 + 4 - 1)(3 - 5 + 0))(f + 3f - 7f)(0f*3 + 0f*3 - 2f*3). -294f*4 Expand (4g - 2g - g)(824g - 426g - 397g + 1446). g2 + 1446g Expand (91 - 26114c + 62 + 58 - 211)(-3c3 - c3 + 3c*3). 26114c*4 Expand 2v*5 - v + 0v*5 + 2v + (-6v2 + 6v*2 - 9v*3)(0v2 - v2 + 5v*2) + 356v*5 - 97v*5 - 157v*5. 68v5 + v Expand (y2 - 2y2 + 0y*2)(2y + 0 + 0) + (y + 0 + 0)(0y2 - 2y*2 + 0y*2) - 3 + 3 - 2y*3 - 54y*3 - 459 + 459. -60y3 Expand -3 - f3 + 3 + (-3f - 3f + 4f)(-f*2 + 3f*2 - 4f2) - f3 + 3f3 - f3 + 0f + 2f3 + 0f - 239628f + 2377f*3 + 239628f. 2383f3 Expand -54y*2 + 21y*2 + 10y*2 + (-1 + 1 + y)(-y - 4y + 3y) - 4y2 + 5y*2 - 3y*2 + (10y + 12y + 32y)(0 + 0 + 2y). 81y2 Expand (-3n + 8n - 2n)(-8n*2 - 7 + 7) + (4n*2 - 3n*2 + 0n*2)(-4n + 5 - 5). -28n*3 Expand (5 - 4 - 2 + (-3 - 1 + 6)(2 + 1 - 5) + 1 - 2 + 3)(-5v + 0v + 4v) + (-1 + 0 + 0)(2v + v - 4v) - 2 + v + 2 + (-106v + 42v + 32v)(-4 + 14 + 0). -315v Expand (-3q3 - 2q + 2q)(989 + 1045 - 2129). 285q3 Expand (-u2 + 0u*2 - 2u*2)(0 + 0 + 2u + (2 - 2u - 2)(-1 - 3 + 2) - 2 + 2u + 2 + 154u + 4408u + 2015u). -19755u3 Expand f + f2 - f + (2f + 0 + 0)(-4f + 2 - 2) - 26f*2 + 19f + 18f2 + 33f. -15f2 + 52f Expand (4x - x + x)(-324 - 2979 - 1629 - 297 + 270). -19836x Expand (3 + 0 + 3)(-658 - 79 + 27)(-p + 0p + 2p). -4260p Expand 5t - 5t + 3t3 + (22 - 22 - 2t)(-24t*2 + t + 72t*2 - 37t*2). -19t*3 - 2t*2 Expand (83f*3 + 22f*3 + 255f*3)(-3 - 1 + 0)(-1 + 1 + 2f) - 3f4 - 4f*4 + 5f*4 + (-3f - f + 6f)(-f*3 - 2f*3 + 5f*3). -2878f*4 Expand (-6 + 6 + 7m*2)((-7 + 3 + 2)(2 + m - 2) - 2510 - 6m + 2510). -56m3 Expand (1 + y - 1 + 4y - 4y + y - y + 2y - 2y + (4y - y - 4y)(0 + 0 - 2) + 0y + 2y - y + 3y + 0y + 0y)(-84272 + 84262 + 1306y - 60y). 8722y2 - 70y Expand (4 + 2s + 12 - 23)(3s + 0s + s)(11 - 8 + 12). 120s*2 - 420s Expand (-28 + 28 - 32d)(2d + 4d - 2d) - 6d*2 - 1458d + 1458d. -134d**2 Expand	{ "pile_set_name": "DM Mathematics" }
433o + 429o. Which is the second smallest value? (a) z (b) 0 (c) x b Let k = -18930 + 75731/4. What is the fifth smallest value in -1, -5, 1/7, k, -4? k Let z = -0.79 - -0.09. Let g = -55.57 + 55.17. Suppose 3l = 4h + 22, 5l - 2 = 2h + 16. Which is the biggest value? (a) l (b) z (c) g a Let a = 6.4 - -10.6. Let s = a + -17.2. What is the third biggest value in s, -0.3, 11? -0.3 Let a be 44/57 - (-10 + 4/(-12) + 11). What is the biggest value in -4, a, -4.3? a Suppose 4h - 4 = 5h. Suppose 5u - 5q - 737 = -237, 4u - 400 = -q. Let t be 5/(u/(-12)) - -1. Which is the biggest value? (a) 1 (b) t (c) h a Suppose 15 - 3 = -6n. Let f = 0.0271 - 0.5271. Suppose -1 = -3p - 10. Which is the second smallest value? (a) 3 (b) n (c) f (d) p b Let h = -331/279 + 54/31. What is the third biggest value in -5, h, -2? -5 Let z(h) = 215h + 639. Let w be z(-3). What is the second biggest value in w, -7/3, 0.2? -7/3 Suppose -16z + 90 = -10z. Let m be (1 - -3)z/40. What is the fourth smallest value in 0.4, 0.1, -4, m? m Let m = -24.567 + 24.767. What is the second biggest value in 0, 19, -0.6, m? m Let f = 7.405 + -7.2. Let l = 0.605 - f. Which is the fourth biggest value? (a) 2 (b) l (c) 5 (d) 0.2 d Let y be 10/2 + 370/(-70). Let t = -515 + 510. What is the second smallest value in t, y, 2? y Let x = 1/1091 + -122197/5455. Let c = -1446/65 - x. What is the second biggest value in 1/2, c, 2, 3/4? 3/4 Let i = 47075 + -47106. Let t = -64 + 830/13. What is the second smallest value in -3, t, i, 4/5? -3 Let o = 722 - 721.3. What is the second biggest value in 0.07, 0.02, o, -2, -4? 0.07 Let n = 45 + -63. Let k = -13 - n. Let t = -3.151 - -0.151. Which is the third biggest value? (a) t (b) -2 (c) k a Let q = -3.994 - -4.494. Let l be ((-16)/12)/(1/3). Which is the second smallest value? (a) 1/4 (b) l (c) 2/17 (d) q c Let a = 1.006 + -1.206. Let s = 126.208 - 126. What is the second smallest value in 5, a, s? s Let w = 818 + -1229.9. Let r = -390 - w. Let n = r - 22. Which is the third smallest value? (a) 2 (b) 24 (c) n b Let l be 2 - 8/5 - 7788/45. Let t = l + 171. Let f = -199 - -204. Which is the fourth smallest value? (a) f (b) 2 (c) 0 (d) t a Let f = 2440 - 175681/72. What is the second biggest value in f, -0.11, -3, 4? f Let w = -383 - -381. Let k = 200.3 + -200. What is the second smallest value in k, w, 29/6? k Let z = 249.6 + -249.5. What is the third biggest value in 4, -52, z? -52 Let g = 17.05 - 16.99. What is the smallest value in g, 2/5, 0, -0.04? -0.04 Let l = 743/13 + -57. Let a = 0.0101 - -0.2899. What is the second smallest value in l, a, 195? a Let r = -1.27 - 3.73. Let p = -1.364 - -1.264. Let d be 192/476 + 4/(-14). What is the fourth smallest value in d, p, r, -6? d Let i = 302 + -309. Let j be (-3 - (-14)/i) + -47. Let v = -1 - -0.9. What is the smallest value in v, 0.3, -0.5, j? j Let x be 207 - 183 - 101/4. Let i = 5.89 - -0.11. What is the biggest value in 2/9, i, x, 0.4? i Let u = -10076 + 10076.4. Which is the biggest value? (a) -0.3 (b) u (c) 5 (d) -174 c Let f = 0.5 + -0.1. Let b be (3/(-6))/((-71)/(-12) - 6). Let t be (b/30)/((-14)/105). What is the smallest value in -4, t, -22, f? -22 Let r be (-2170)/(-682) + (-2 - 1). What is the smallest value in -5/2, r, 6.9? -5/2 Let f = -3 + 3. Suppose 305i = 1109 + 2856. Which is the fourth smallest value? (a) i (b) -4 (c) 4 (d) f a Let t = -2 + 1.98. Let v = -1787/180 - -458/45. Which is the third smallest value? (a) 4 (b) v (c) t (d) -5 b Let x = -145.284 - -145.384. Let o = -0.14 - -0.23. Which is the third biggest value? (a) x (b) o (c) -3/2 c Let j = 359.992 + -360. Let o = -2.492 + j. What is the second biggest value in 3, o, 4/3? 4/3 Let u be (2 - 2)(5 + -11 + 88/16). Which is the third biggest value? (a) -3 (b) u (c) 72 (d) -2 d Suppose -169h = -174h - 20. Let s be (-3)/((-6)/(-10)) - (-9 - h). What is the second biggest value in 0.1, s, -141? s Let g be 3 - (132/12 - 3). What is the smallest value in 2/15, -46, 0.2, g? -46 Let y = 4.248 + -3.748. What is the second biggest value in 1906, 0.3, y? y Let q(s) = s2 + 19s - 100. Let z be q(5). Let n be -1(3/z - (-6)/(-15)). Which is the fourth biggest value? (a) 0.03 (b) n (c) -2 (d) -2/7 c Let f(p) = -167p + 2338. Let t be f(14). What is the third smallest value in t, -12, 3? 3 Let s be 28 + -4 + (-39)/(-12) + 21/(-4). Which is the smallest value? (a) s (b) -2/5 (c) -2/57 b Suppose 47s = -153s + 13s - 935. What is the fourth smallest value in 5, s, -3, 1/5, -0.1? 1/5 Let r be 6/424(4 + -10). Let u be 5/((-5)/2) - r/99. Which is the biggest value? (a) u (b) -8/11 (c) 2 c Let g(o) be the third derivative of 0o + 0 + 7o2 + 2/3o*3 - 1/24o*4. Let k be g(7). What is the biggest value in k, 1/5, 4/3? 4/3 Let l be (6(-10)/(-8))/3. Let s be 4(1 + 15/(-12)). Let t be (-1)/(-18)-8 + 0/s. Which is the fourth smallest value? (a) t (b) l (c) 4 (d) -2 c Let r = -2.92 + -0.08. Let l = -53433 + 53432.7. Which is the third smallest value? (a) 4.4 (b) l (c) r a Let m(r) = 18r + 51. Let x be m(5). Let l = x - 989/7. Which is the third biggest value? (a) -4 (b) l (c) 1/12 a Suppose 20 = 37z - 42z. Let o = -6 - z. Let y be (o/2)/(3 - (-1 - 1)). Which is the smallest value? (a) -0.1 (b) 4 (c) y c Let p be (-2 - 11) + (26 - 17) - -8. Which is the fifth biggest value? (a) -1 (b) 386 (c) p (d) -0.3 (e) 3 a Let i = 3.3 - -0.7. Let t = 661.5 + -661. Which is the second biggest value? (a) i (b) t (c) -12 b Let o = 59.7 + -56.7. Let f be 2/(-41/(-4)). Which is the fourth smallest value? (a) -3 (b) o (c) f (d) 0.5 b Let c be -3(-14)/(-105)(-100)/(-60). Let z = 6.4 - 7. Let r = 0.7 - z. What is the third biggest value in c, 1, r? c Let j = 3794 - 3796. Which is the biggest value? (a) -205/18 (b) j (c) -5 b Suppose -4 = -q - 1. Let w be (-75)/27 + (3 - 0). Let k = 119/9 - 211/18. Which is the third biggest value? (a) w (b) k (c) q a Let l be (-76)/(-28)-5 + 13. Let o = 2/115 + 337/460. Which is the biggest value? (a) -0.1 (b) l (c) -26 (d) o d Let l = 489 + -737. Let r = l + 247. Let j = -335/7 + 48. Which is the fourth biggest value? (a) r (b) j (c) 0 (d) 1 a Let f = -22 - -2. Let i = f - -44. Let u be -3(-1 - 2)/i. What is the third smallest value in 4, 2, u? 4 Let x be -1(-1 - -2)9. Let z(q) = q + 13. Let h be z(x). Suppose 0 = hu + u + 20. Which is the second smallest value? (a) -2/3 (b) u (c) -3/5 a Let k = -3.83 - -8.83. Let q = -1 - 3. Let f be (-8)/16q/(-6). Which is the biggest value? (a) -1 (b) k (c) f b Let g = 39 + -46.3. Let q = -4.5 - g. Let r = 7.8 - q. Which is the fourth biggest value? (a) 1 (b) -3/7 (c) r (d) -0.4 b Let y = -98 + 97.53. Let g = -6.47 - y. What is the third biggest value in 4, g, -1/3? g Let r be 4/(-6)33/35. Let f = r - -7/10. Let n be 12 - 7 - (1 - 0). Which is the biggest value? (a) n (b) 0.3 (c) f a Let v = -82.27 + -0.73. Let c = v - -130. Let u = c - 45. What is the second biggest value in 1/2, u, -19? 1/2 Let x = 112 + -115. Suppose -4u = 22 - 2. What is the third smallest value in u, x, 0.1? 0.1 Suppose -5d + 2g + 2g = 8, 0 = -5d + 5g - 5. Let y = -553 + 496. Let z be 6/y - (-1 - (-60)/76). Which is the biggest value? (a) -1/2 (b) z (c) d b Let o be (-9)/364 + 5 + 45/(-12). What is the third smallest value in o, -217, -1? o Let b(w) = -w*3 - 8w*2 - 7w - 3. Let t be b(-7). Let v be (28/6 + t)-3. Let r = -8168 - -8165. What is the second biggest value in r, v, 0.4, 3? 0.4 Let k be 30/4 - (283 + -264). What is the third biggest value in 47, 3, k? k Suppose 4s + 315 - 2503 = 5z, -5s - 5z = -2780. Let u = 556 - s. Which is the third smallest value? (a) u (b) 8/7 (c) -4 a Let l = 13550 - 14158.9. Let s = 609 + l. What is the fourth smallest value in 4, -2/9, s, -0.8? 4 Let l = 0.276 - -14.624. Let w = 11.9 - l. What is the second smallest value in w, 1, -0.5? -0.5 Let c be 71/142 - 7/2(-45)/(-21). What is the biggest value in -9, -8/7, -0.1, c? -0.1 Let x = -6.2 - 1.8. Let d = -4591 + 206621/45. Let q = 1/45 + d. What is the third biggest value in x, q, 3? x Let y = -17934 - -17933.5. Which is the fourth biggest value? (a) y (b) -0.2 (c) 2/9 (d) -0.	{ "pile_set_name": "DM Mathematics" }
-3n. Solve -j + nw + 24 = 2w, -2j = -4w - 18 for j. -1 Suppose -b - 10 = -3b, -196 = 3d + 4b. Let q = -69 - d. Solve -22 = -ql + 5g, 5l + 0g + g = -10 for l. -1 Let i = -24 + 79. Suppose 5n = -6n + i. Solve 0 = c - 5d + 26, -nc = -c - 5d + 29 for c. -1 Let l be (45/(-60))/(2/120). Let m = -40 - l. Solve -v - 23 = 5u, -4u + 11 = -3u - mv for u. -4 Let x be 2/(-6) + (-170)/30. Let k be 8 - (x - (-2 - 1)). Let q = -11 + k. Solve -4a + a = 0, q = i + 4a + 5 for i. -5 Suppose -8 = 162a - 164a. Suppose 6l - 4l + 8 = au, -3u = 4l + 5. Solve 0 = -2s - 4o + 10, 1 = s - o - u for s. 3 Let c(v) = v*2 + 15v + 53. Let u be c(-10). Solve a + 1 = 0, 5 = 3q + ua - 1 for q. 3 Suppose 30a = 131 - 11. Solve -c - 1 = ak, 2k + 18 = 2c - 6c for c. -5 Let p = 9 + -268. Let x be p/(-91) + (-4)/(-26). Solve -g - xz = -6g + 28, -3g + 5z = -20 for g. 5 Let l be (-2)/77/(-2)2. Solve -w + lw = 2a - 9, 3w = -5a - 5 for w. -5 Suppose 2a = 2d + 24, 2a - d = 4a - 9. Let u = a - 2. Suppose 16h = 14h + 4. Solve s - 4 = -ul, l - hs + 3 = -5 for l. 0 Let l(m) = 8m*2 + 3. Let y be l(-2). Let j = -31 + y. Solve ju - 5h - 3 = 8, -5h = -2u + 3 for u. 4 Let u(x) = x3 + 3x*2 + 3x + 11. Let g be u(-3). Solve 9s + 14 = 5s - d, 0 = gs + 2d + 4 for s. -4 Let u(v) = -v*2 + v + 5. Suppose 0 = -10x - x. Let i be u(x). Solve h - 14 = 3k + k, -5k = -ih + 10 for h. -2 Let r = 499 - 496. Solve 2f = -5j - 10, 2f - 26 = -rj + 7j for f. 5 Let b = 353 + -349. Let x be ((-1)/4)/(1/(-4)). Solve -3m = 5l - x - 15, -m + 10 = bl for l. 2 Suppose 240 = 8f - 2f. Let q = f + -32. Let i be (-1)/2 - 9/(-2). Solve 3t = -s - q, -t = -is + t + 10 for s. 1 Suppose -4k - 4 = 0, 5k + 21 = 5l - l. Suppose a = -0a + 3. Let r(p) = -p2 - 4p - 3. Let s be r(-3). Solve -ah = -b + 11, s - l = -2b for h. -3 Let v be (-6)/(((-6)/(-10))/(45/(-50))). Solve m - 6 = -2y, 5y = -0m - m + v for y. 1 Let t = 74 - 69. Solve -4n - t = 4m - 1, 0 = -5n - 2m + 4 for n. 2 Suppose -3f + d = -2d + 27, 3f + 5d = -35. Let z = -2 - f. Suppose -16 = -2h + z. Solve n + 11 = -5c + c, -4n - h = 0 for c. -2 Let p = 600 + -597. Solve -4r = 12, l = -pl - 3r - 5 for l. 1 Suppose 4l - 3g + 2g + 262 = 0, -l - 68 = g. Let h = -40 - l. Let o be (2/(-4))/((-1)/h). Solve -m = -w + 2m - o, w + 3m = 17 for w. 2 Suppose 54j - 19 = 89. Solve l + 7 = -3r, -3r - 9 = -jl + 5l for r. -2 Suppose -5j = -3t - 0t + 107, 16 = -4j. Let y = 213 + -207. Suppose o - y = -p, -5p - 4o = -0o - t. Solve 0 = 2u - f + 8, -20 = pu + 2f - f for u. -4 Suppose -18p + 76 = 40. Solve -3y - 2m + 8 = 0, -2y = -2m - pm for y. 2 Suppose 35a - 183 = -26a. Solve 3 = 2i - 3, 3i + a = 4f for f. 3 Let n = 548 - 548. Solve n = -3l + 2c - 7, -2l = -4l + 4c - 18 for l. 1 Suppose 2l - 5j + 2j - 20 = 0, j = 4l - 20. Suppose -s = -f - 1 - 0, 0 = 5s - lf - 8. Solve -4z + z - 4d = 3, 3d - s = -z for z. -5 Let o be 4-1 + (-52)/(-13). Suppose -m = -om + 19. Let p = 22 + m. Solve pd = 0, 0l - 2 = 2l + 3d for l. -1 Let w(y) = 3y2 - 2y + 1. Let o be w(1). Suppose -oa = -5a + 6. Solve -6 = -3x + am, 2x = -5m + 2 + 2 for x. 2 Let q(l) = 32l + 228. Let k be q(-7). Solve 2v = 5g + 17, v - kv - 4g = 32 for v. -4 Let r = 35 - 25. Let i(x) = 8 + 11x - 2x2 + 3x*2 - rx. Let s be i(0). Solve 18 = 3p + 3b, -3p + sp + 3b - 22 = 0 for p. 2 Let k be (2/(-4))/((-2)/12). Suppose -2b + 4 = kr - 14, 3b + r - 34 = 0. Solve b = -2j + 3m, -3j - 5m = -3 + 2 for j. -3 Let b(l) = -l3 + l2 - l + 51. Let n be b(0). Suppose nf = 43f + 16. Solve -d = 4z - f, 2z + 3d + 2d = -8 for z. 1 Let s be 52/(-16) + (-1)/(-4). Let n = 0 - s. Solve 3u = 2q - 17, -3u - 20 = -nq - 2 for u. -5 Suppose -2i + 359 = 351. Suppose -iq - 3a = 2a - 13, 3q - a - 5 = 0. Solve -3z + 4o = 3o + 3, 0 = 2z + qo - 6 for z. 0 Suppose 2 = -q, -t - 2q - q + 7 = 0. Let m = -6 + t. Suppose -5u + mu + 3r = 13, 4r = -3u + 19. Solve 0 = -a - 2l - 2, a - 4l + 3 = -u for a. -4 Let i(t) = -t*3 - 4t + 6. Let s be i(0). Let z be -3 + s/2 - -3. Solve 12 = -4n, -n - 11 = -zo - 5 for o. 1 Suppose -2q + 4 + 13 = -5a, -5a = 3q - 13. Suppose -4p + 3x - 4x = -5, p = x. Let f = p + -1. Solve 3l = b, f = 4l - q + 2 for b. 3 Let a be (-3)/(-2) - (-60)/24. Solve 30 + a = -5q - 3g, -22 = 5q - g for q. -5 Suppose -2p = -4v + 66, -3p = -5v + 2p + 80. Solve -v = 5u + 4s, -14s = 4u - 12s + 10 for u. -1 Suppose 6d - 885 = 435. Let w be d/11 + (-2)/1. Solve -5z + 18 - 1 = 4u, 4u + w = 2z for z. 5 Let r = -144 + 150. Suppose -3v + r = -2v. Solve -j - 3 = 0, vw + 5j + 17 = 7w for w. 2 Let i be (-12 - -6) + 15 - 8. Let a be 12/9 + (-2)/(-3). Solve 0 = -3d + ak + i, k = 3d + 2 - 1 for d. -1 Let q be (-1 + 2)(3 - 3). Let r be (1/((-2)/(-5)))/((-8)/(-144)). Suppose 3v = -0k - 3k + r, -v = -4k - 15. Solve l + 5 = c - q, 5c - v = 0 for l. -2 Let q be ((-36)/63)/(2/(-7)). Suppose q = -v + 5y, v - 2v + 25 = 4y. Solve 0x + 2x + 3w = v, -2x + 3w = -7 for x. 5 Let v be (1/3)/(-3(-7)/189). Suppose -3i = vg - 9, 6 = -i + 3i + 5g. Solve 4s = -5n - 7, -n + 2s + 10 = in for n. 1 Let c be 1/((-21)/(-27) - (-10)/45). Let h be 0/(4 + (c - 7)). Solve 2s = 4s + d + 2, -5s + 3d - 5 = h for s. -1 Let u = 469 + -469. Solve -7 - 5 = 4m + 4d, u = -m + d + 5 for m. 1 Suppose 5g - 147 = 33. Suppose 0 = 19x - 15x - g. Solve -r = -2d + r - 12, 2d - x = -5r for d. -3 Let w = -2 - -4. Let f be (-7 + 8)15. Let a = 52 + -49. Solve -32 = ao - 5z, 19 + 9 = -wo + fz for o. -4 Let r = -207 - -209. Suppose -2f - 8 = 0, -3k + 3f - 4f + 11 = 0. Suppose -kl - 11 = -3q + r, -4q = l - 25. Solve 3g = d + 2, -4g - 3d + q = -g for g. 1 Let j(g) = 3g + 33. Let s be j(-10). Let f = -16 + 16. Solve -3l + h - 15 = f, -2h + 15 = sh for l. -4 Let m(y) = 74y - 70. Let w be m(1). Solve -24 = -4x - 0t - 4t, 0 = 3x - wt - 4 for x. 4 Let r = 1 - -2. Let z(c) = -2c2 + 13c + 234. Let b be z(-8). Solve -rk - bg = 25, -2k + g + 15 = -4g for k. -5 Suppose 6y + 3a - 7 = y, 4y - 13 = 5a. Suppose 5x - 46 = -5g - 11, 5g = -yx + 20. Solve -5t = -2t - u + 6, t + g = -3u for t. -2 Let s be 3 + (-54)/(-3) - 0. Let q = s + -19. Solve 2d - 4 = -qd, -c + 3 = 3d for c. 0 Suppose -4t = t - 20. Let z(a) = a - 9. Let i(f) = -1. Let n(s) = 4i(s) - z(s). Let x be n(4). Solve tp + 3 = 2r + x, -p = 0 for r. 1 Let h be ((-1)/(-1)-2)/2 + 3. Suppose 2t - 5k - 9 = 20, -ht + 4k = -30. Solve o - 5l - t = 0, 4o + 2l = -10 - 10 for o. -3 Suppose -5p - 1 = 3j - 8, 5j + 45 = 3p. Let q be 16/3 + 2/j. Suppose 2z = qz - 12. Solve zi - 5i - 5 = -2u, 3i = -u + 20 for u. 5 Suppose -q - 2i = -3i - 55, -2q + 110 = 4i. Let k = -51 + q. Solve kz = -s + 7, -3 + 0 = 3s for z. 2 Suppose u = 9u. Solve 0 = 2t + 4a - 12, 5t - 2a + u = -18 for t. -2 Let a = -65 - -77. Suppose -14q = -aq - 24. Solve -5h + 4s = -29, -3h + 2s + q = -h for h. 5 Suppose 5j = o + 20, 5 = -2j - o + 13. Solve -jt + 3r = -0r - 9, 4r = -12 for t. 0 Let k = 2357 + -2351. Let h(u) = u2 - 3u - 8. Let c be h(6). Solve kt - t - 10 = -5l, -l + 2t - c = 0 for l. -2 Let r(f) = f - 27. Let s be r(12). Let i be (-6)/s - 36/(-10). Suppose 3b = 2c - 15, -c + 0b = -ib - 10. Solve -4w - 2 = c, 0 = 4x - 4w - 4 for x. -1 Let q(a) = a*2 + 2a - 7. Suppose 5j = -2w - 32, -8 - 18 = 5w - j. Let k be q(w). Solve -f + 6f - 15 = 5n, -4f + k = n for f. 4 Suppose 76p - 56p = 100. Solve -p = -5l - 0, -2 = -c - 4l for c. -2 Suppose -5i + 108 = 3j, 7i - 12i = -2j - 128. Solve -5d = 3x + i, 2x = -2d - 3 - 9 for x. -3 Suppose -4q - 6 = -2q - 5u, 2u + 4 = 0. Let i(v) = -v2 - 8v + 5. Let h be i(q). Solve 0 = -r + 3r + z + 7, 20 = -5r - hz for r. -3 Let s = 36 - 40. Let d be -2((-2)/3)/(s/(-6)). Solve -2 = q - 4t, 0q + t + d = -q for q. -2 Let j be (3 - -5)/(-4) - -4. Suppose ju = 7u - 20. Solve 5i + 8 = -n, 3i = 3n - 2i + u for n. -3 Let t be 8 - 6(-8)/(-6). Solve tl = 4l - n, 0 = 4n for l. 0 Suppose -i + 9 = 7. Solve -3 = -is + 6s + 5y, s + 5y - 3 = 0 for s. -2 Let g(k) be the third derivative of -k**4/1	{ "pile_set_name": "DM Mathematics" }
nd 675707700 to the nearest 1000000. 676000000 Round -41.26432 to 2 dps. -41.26 What is 0.000102459 rounded to six dps? 0.000102 Round 0.00169067 to four dps. 0.0017 What is 21.6704 rounded to 1 decimal place? 21.7 Round -0.94605 to the nearest integer. -1 What is -0.1994658 rounded to 3 decimal places? -0.199 What is 224420.1 rounded to the nearest 10000? 220000 Round 0.0051356812 to six dps. 0.005136 What is -0.3601335 rounded to three dps? -0.36 Round 341613 to the nearest 10000. 340000 What is 0.00026633337 rounded to 6 decimal places? 0.000266 What is 4492761.3 rounded to the nearest 1000000? 4000000 What is -728328.1 rounded to the nearest ten thousand? -730000 Round -1101995 to the nearest one million. -1000000 What is -1.881037 rounded to two dps? -1.88 Round 0.0007629365 to five dps. 0.00076 Round -0.0000771854 to six dps. -0.000077 Round -0.0057671 to 4 decimal places. -0.0058 Round -983335 to the nearest one hundred thousand. -1000000 Round 0.00000833208 to seven dps. 0.0000083 Round -0.0000830385 to 5 dps. -0.00008 What is 0.00000707612 rounded to 7 decimal places? 0.0000071 What is -262192 rounded to the nearest one hundred? -262200 What is 169466000 rounded to the nearest 1000000? 169000000 What is 0.000000263764 rounded to six dps? 0 What is -1289600000 rounded to the nearest one million? -1290000000 What is -3.375885 rounded to 3 dps? -3.376 Round -44.238041 to 2 dps. -44.24 Round -0.000234584 to 4 decimal places. -0.0002 What is 5827.145 rounded to the nearest 10? 5830 Round 0.00002734546 to seven decimal places. 0.0000273 What is -50520.96 rounded to the nearest ten thousand? -50000 Round 11249970 to the nearest ten thousand. 11250000 Round 0.00001774325 to seven dps. 0.0000177 What is 0.03651026 rounded to 2 decimal places? 0.04 Round 0.000531117 to 4 dps. 0.0005 What is -76965.2 rounded to the nearest 100? -77000 Round 2357.2685 to the nearest ten. 2360 Round 0.0590873 to 2 decimal places. 0.06 Round -0.050176219 to 4 decimal places. -0.0502 Round 22826300 to the nearest one million. 23000000 Round -0.0820415 to three decimal places. -0.082 Round -3130.8 to the nearest 1000. -3000 What is 0.051245466 rounded to three dps? 0.051 Round 418131 to the nearest 1000. 418000 What is 33.98964 rounded to the nearest ten? 30 What is -27.4204 rounded to one dp? -27.4 Round 0.0000470916 to 6 decimal places. 0.000047 What is -23.428 rounded to the nearest one hundred? 0 What is 0.031774 rounded to 2 dps? 0.03 Round 6413.141 to the nearest one hundred. 6400 Round 67.132 to 0 dps. 67 Round 1695.32 to the nearest integer. 1695 What is -18603.77 rounded to the nearest one hundred? -18600 Round -3956.0215 to 0 decimal places. -3956 What is -7.09002 rounded to zero dps? -7 Round -45489.79 to the nearest 1000. -45000 What is 656292600 rounded to the nearest one hundred thousand? 656300000 What is 0.000112816047 rounded to 6 decimal places? 0.000113 What is -0.108398 rounded to one dp? -0.1 What is -0.000001564421 rounded to 7 dps? -0.0000016 Round 4510.3512 to the nearest one hundred. 4500 Round -821780 to the nearest 10000. -820000 Round 293460 to the nearest 100000. 300000 What is 10.163288 rounded to two dps? 10.16 Round -14625.821 to the nearest one thousand. -15000 What is -343.9912 rounded to one dp? -344 Round 1177.4445 to the nearest 10. 1180 What is -3.11087 rounded to 1 dp? -3.1 Round -0.000255609 to 7 dps. -0.0002556 What is -0.02969373 rounded to five dps? -0.02969 Round -0.10342 to three dps. -0.103 What is 0.00049299345 rounded to seven dps? 0.000493 Round -482695.1 to the nearest 1000. -483000 Round 9498.61 to the nearest 10000. 10000 What is 1681.3 rounded to the nearest one thousand? 2000 What is 0.0001523882 rounded to five decimal places? 0.00015 What is -0.00002428725 rounded to 6 decimal places? -0.000024 What is 660.6763 rounded to the nearest one hundred? 700 What is -5.3644 rounded to two decimal places? -5.36 Round 0.06463582 to four dps. 0.0646 What is -0.0000058386 rounded to six decimal places? -0.000006 Round 16439.96 to the nearest 1000. 16000 What is -0.01684633 rounded to 5 decimal places? -0.01685 What is -0.003711138 rounded to 4 dps? -0.0037 Round -3801866 to the nearest 100000. -3800000 What is 373157 rounded to the nearest one hundred thousand? 400000 Round -502.12744 to 0 dps. -502 What is -816.25 rounded to the nearest ten? -820 What is 0.000003658985 rounded to seven decimal places? 0.0000037 Round -13.4322 to the nearest integer. -13 What is 0.1886311 rounded to two dps? 0.19 What is 498168900 rounded to the nearest 100000? 498200000 Round -0.00010778028 to 6 decimal places. -0.000108 Round -677663 to the nearest one thousand. -678000 What is 2.788734 rounded to the nearest integer? 3 What is -1.9009095 rounded to 3 dps? -1.901 Round 27388700 to the nearest one million. 27000000 What is -0.0000025086671 rounded to seven decimal places? -0.0000025 Round 15.35256 to 1 decimal place. 15.4 Round -0.0000417514 to 5 dps. -0.00004 Round 18042930 to the nearest one hundred thousand. 18000000 Round 0.000122121609 to five decimal places. 0.00012 What is -0.000634606 rounded to 4 dps? -0.0006 Round -422346 to the nearest ten thousand. -420000 Round 1088.2958 to one decimal place. 1088.3 What is -26.677581 rounded to 0 dps? -27 What is -0.0010814033 rounded to 6 dps? -0.001081 Round -2706290 to the nearest one hundred thousand. -2700000 Round 1664.015 to the nearest one hundred. 1700 What is -11071.82 rounded to the nearest one hundred? -11100 What is 0.001864284 rounded to five dps? 0.00186 Round 1863320000 to the nearest 1000000. 1863000000 What is 3.8042847 rounded to three decimal places? 3.804 Round -0.23829206 to three dps. -0.238 Round -18650.08 to the nearest 100. -18700 Round 9836.7 to the nearest ten thousand. 10000 Round 0.0002234548 to 7 decimal places. 0.0002235 Round 0.001120339 to five dps. 0.00112 What is -0.13394305 rounded to three decimal places? -0.134 What is -481932 rounded to the nearest 1000? -482000 Round 160511350 to the nearest 10000. 160510000 Round -0.36732 to three dps. -0.367 Round -2545.45 to the nearest 10. -2550 Round -36.1265 to the nearest 10. -40 Round 0.6224303 to one decimal place. 0.6 Round -0.000239283 to five dps. -0.00024 Round -9.07001 to the nearest integer. -9 Round 4015.61 to the nearest ten. 4020 Round -0.002456 to 4 dps. -0.0025 Round 0.4305051 to four decimal places. 0.4305 Round 83486.2 to the nearest 10000. 80000 What is 2.009679 rounded to two dps? 2.01 Round 0.0000004500283 to seven decimal places. 0.0000005 Round 10.25392 to two dps. 10.25 Round 6072470 to the nearest 10000. 6070000 Round 65457800 to the nearest one million. 65000000 What is 7.637286 rounded to 3 decimal places? 7.637 What is 23080.25 rounded to the nearest 1000? 23000 What is -0.00761218 rounded to 2 dps? -0.01 What is 521281200 rounded to the nearest one hundred thousand? 521300000 What is 49326.83 rounded to the nearest one thousand? 49000 Round 692350000 to the nearest one million. 692000000 What is -10.593723 rounded to 1 dp? -10.6 Round 0.823459 to 2 dps. 0.82 What is -0.2461601 rounded to two dps? -0.25 What is 0.00054988783 rounded to five dps? 0.00055 What is -0.000000690287 rounded to 7 decimal places? -0.0000007 What is 0.04235094 rounded to 2 dps? 0.04 Round -25.56822 to the nearest integer. -26 What is 0.0000005828 rounded to 7 dps? 0.0000006 What is -0.00001584363 rounded to 6 decimal places? -0.000016 What is 0.0041549 rounded to 4 dps? 0.0042 What is 208623.2 rounded to the nearest 10000? 210000 What is -5.8409 rounded to 1 decimal place? -5.8 Round -280113 to the nearest 100000. -300000 What is 0.0992158 rounded to four dps? 0.0992 Round 0.58803 to 0 decimal places. 1 What is 0.0952523 rounded to 4 dps? 0.0953 Round 0.0000081238 to five dps. 0.00001 Round 57273.2 to the nearest one hundred. 57300 Round 0.00511676 to three dps. 0.005 Round 0.007659744 to two dps. 0.01 Round -0.0020009554 to 7 dps. -0.002001 What is -105977.62 rounded to the nearest 10000? -110000 What is 0.00757154 rounded to 5 dps? 0.00757 What is -6.04134 rounded to 1 decimal place? -6 Round -4.876502 to 2 dps. -4.88 What is 0.001505351 rounded to 5 dps? 0.00151 What is 8.195632 rounded to the nearest int	{ "pile_set_name": "DM Mathematics" }
55 = 0. Let d(l) = 3l2 + 56l + 24. What is the remainder when p is divided by d(-19)? 42 Suppose 2f - 5q + 7q = 12, 4q = 16. Suppose -fr = -5r - 4g + 13, -4r - 2g = -24. Calculate the remainder when r is divided by 7. 0 Suppose 2047 = 28v + 1655. Let a(b) be the first derivative of -b*3/3 + 8b*2 - 7b + 1. What is the remainder when a(6) is divided by v? 11 Suppose -20 = 4j - 4, 0 = 4o - 2j - 20. What is the remainder when 18 is divided by o? 0 Let x(d) = -2d - 7. Let r be x(-5). Suppose 4 = rf - 20. Calculate the remainder when 19 is divided by f - (-3)/3-1. 5 Suppose -3b = -b - 28. Suppose -778i + 400 = -768i. What is the remainder when i is divided by b? 12 Let m be -2(-9)/(9/2). Suppose -12 - 9 = -g - u, mg = 5u + 66. Calculate the remainder when g is divided by 10. 9 Let c = 131 - 31. What is the remainder when c is divided by 53? 47 Suppose -7g + 3g + 4 = 0, 3p = -g + 1468. Calculate the remainder when p is divided by 82. 79 Suppose l = -2l + 3m + 1044, -1377 = -4l + m. Calculate the remainder when l is divided by 15. 13 Let p = -309 - -328. Calculate the remainder when 70 is divided by p. 13 Suppose 2m - 60 = -4. What is the remainder when 50 is divided by m? 22 Let x = -21 - -38. Calculate the remainder when (-1 + -8 + 11)32 is divided by x. 13 Let y(j) = 11j + 17. What is the remainder when y(9) is divided by 24? 20 Suppose -5t + t - 60 = 0. Let j = t + 12. Calculate the remainder when 70 is divided by j - (3 - 2) - -22. 16 What is the remainder when 203 is divided by (225 - 242)/(12/(-2))? 16 Let d(j) = 2j*3 + 14j*2 - 2j - 9. Calculate the remainder when d(-6) is divided by 13. 10 Suppose -11u + 9 = -8u. Suppose -4f = -4, -2v - uf + 77 = -0v. Calculate the remainder when v is divided by 13. 11 Let v = -691 + 711. What is the remainder when 797 is divided by v? 17 Suppose -786 = -4k - 2d, 4k = -d + 138 + 643. Calculate the remainder when k is divided by 23. 10 Let h(t) = -7t - 198. Let z = -18 + 39. Calculate the remainder when h(-34) is divided by z. 19 Let f be (0 + 0)8/(-24). Suppose f = -4o + 6o - 30. Calculate the remainder when o is divided by 16 + -16 + 14. 3 Suppose r - 26 = 2c + 32, r + 3c = 63. Suppose 0 = -4t + 5y + 67 + 77, 0 = 3t + 2y - 85. What is the remainder when r is divided by t? 29 Suppose 3s + 0d - 697 = 2d, 2s = -5d + 471. What is the remainder when s is divided by 9? 8 Suppose 16 = 4d - 32. Suppose -6r + 72 = -210. What is the remainder when r is divided by d? 11 Suppose -2q - 1 = -c + 2, -4c - 36 = 4q. What is the remainder when 76 is divided by -1310/c1? 24 Suppose -13u - 131 = 246. Let o = u + 47. What is the remainder when 46 is divided by o? 10 Calculate the remainder when (66/(-55))/((-3)/485) is divided by 5. 4 Suppose 388 - 25 = 11t. What is the remainder when 94 is divided by t? 28 Suppose 158 + 150 = 22m. Calculate the remainder when 103 is divided by m. 5 Suppose 0 = 61g - 65g + 12. What is the remainder when 43 is divided by g? 1 Let f be (-148)/(-6) + 32/(-48). Suppose -6c + 75 = 5n - c, -4n + 5c + f = 0. What is the remainder when 62 is divided by n? 7 Let j(f) = -f2 - 7f - 10. Let h = 23 - 27. Let r(b) = 5b2. What is the remainder when r(-1) is divided by j(h)? 1 What is the remainder when (22 - 1241/34)-2 is divided by 36? 29 Suppose 3n + 3w - 67 + 10 = 0, 87 = 5n + 3w. What is the remainder when 321 is divided by n? 6 Let q(x) = -2x3 + x2 + 2. Let p be q(0). Suppose -84 = -pj + 58. What is the remainder when j is divided by 19? 14 Let j(r) = -r2 + 11r - 1. Let k = -6 - -14. What is the remainder when j(k) is divided by 5? 3 Let w(b) = 11b - b - 2 - 1 - b3 + 6b*2. Suppose 27 - 167 = -20h. Calculate the remainder when 35 is divided by w(h). 17 Let c = -403 + 456. What is the remainder when 576 is divided by c? 46 Let i(y) = 25y - 6. Let p = -13 - -12. Let t(x) = -31x + 1. Calculate the remainder when i(4) is divided by t(p). 30 Suppose 5x + 3i - 320 = 2i, 5x = -5i + 320. Calculate the remainder when x is divided by 36. 28 Suppose 0 = -4c + x - 0x + 23, 0 = -4c - 3x + 27. Suppose -9i + 189 = -ci. Calculate the remainder when i is divided by (-67)/(-5) - 4/10. 11 Suppose 3y + 203 + 173 = 5x, -y + 146 = 2x. Calculate the remainder when 366 is divided by x. 70 Suppose -w + 44 = -5w. Let c(z) = 6z2 + z + 2. Let r be c(-2). Let v = r - w. Calculate the remainder when v is divided by 12. 11 Let o be -12 + (-6)/(4 + -1). Let n(g) = -g2 - 12g + 32. Calculate the remainder when 13 + (2 + -2)/(-1) is divided by n(o). 1 Suppose -26 = -0h - h. What is the remainder when h is divided by 7? 5 Suppose -12u = -41 - 1795. Calculate the remainder when u is divided by 68. 17 Let m(t) = -t + 2. Let z be m(-4). Let w = z + -4. Suppose -n - 16 = -2h, 5h - wh + 5n - 37 = 0. Calculate the remainder when 35 is divided by h. 8 Suppose -3y + 48 = g, 2y - 18 = g + 3g. Calculate the remainder when 114 is divided by y. 9 Let d(a) = -a + 7. Let m be d(4). Calculate the remainder when 42/(-35)(-10)/m is divided by 1. 0 Suppose 7h - 1 - 13 = 0. Suppose 5o + 13 = u + 87, -u + 31 = ho. What is the remainder when 57 is divided by o? 12 Let y = -157 - -97. Let d = -31 - y. What is the remainder when 85 is divided by d? 27 Suppose -l + 8 = -4j + 31, j = 4l + 32. Let p(b) = -3b - 18. Calculate the remainder when 8 is divided by p(l). 2 Let c be -5 + (4 - 1) - -2. Calculate the remainder when -6 + 2 - c - -11 is divided by 3. 1 Let l(f) = -8f - 21. Let g(y) = -17y - 41. Let j(r) = -6g(r) + 13l(r). What is the remainder when 40 is divided by j(-24)? 19 Suppose 8w - 41 = 159. Let p = w + -21. What is the remainder when 21 is divided by p? 1 Suppose 2n - 6 = 0, n - 271 = -0k - 4k. Calculate the remainder when k is divided by 29. 9 Let f = 23 - -25. Suppose -5y + f - 3 = 0. Let x(s) = s*2 + 11s + 13. What is the remainder when y is divided by x(-10)? 0 Suppose -4 = 4r - 2d, 0 = 7r - 2r + d + 12. Let m(v) = 3v2 - 2v - 4. What is the remainder when 16 is divided by m(r)? 4 What is the remainder when 119 is divided by (-5)/(-4) + -1 + (-4071)/(-276)? 14 Suppose 5f - 84f + 1817 = 0. What is the remainder when 64 is divided by f? 18 Suppose 203 = j - 3g, -g = 4j + j - 983. Calculate the remainder when j is divided by 12. 5 Let c = -10 - -19. Let v = 14 - c. Suppose 0 = -vz, -l - 5z + 26 = -19. Calculate the remainder when l is divided by 16. 13 Let d = -5766 - -5820. Let r = -18 + 25. What is the remainder when d is divided by r? 5 Let q(i) = 11i - 381. Suppose -5v - 3g = -253, v - g = -0g + 57. What is the remainder when v is divided by q(36)? 8 Calculate the remainder when (5/5 + 1)46/4 is divided by (9/(-2))/3-10. 8 Suppose 5z = 15, z = -5n + 24 + 34. Let r(o) = o*3 + 9o2 + o - 2. Calculate the remainder when r(-8) is divided by n. 10 Let m(p) = -p2 - 8p + 1. Let c(j) = -52j + 245. Calculate the remainder when c(4) is divided by m(-7). 5 Suppose 4y - 5y + i + 85 = 0, 4y = 3i + 336. Calculate the remainder when y is divided by 42. 39 Let m = 8 - 2. Suppose 2t = mt. Suppose -2h + j + 14 = t, -5h + 29 = j - 5j. What is the remainder when h is divided by 6? 3 Let r = 260 - 246. What is the remainder when r is divided by 5? 4 Let i(s) = -s3 + 31s*2 + 62s + 1. What is the remainder when 58 is divided by i(-2)? 4 Let k = -5 - -25. Suppose -t - 4t = -k. Suppose tq - 24 = -0q. What is the remainder when 20 is divided by q? 2 Let g = -49 - -53. Suppose -3y - 215 = -gq, -3y = -5q + 139 + 126. Calculate the remainder when q is divided by 18 + -1 + 0/2. 16 Suppose -5x = 0, -4m + 25 + 19 = -4x. What is the remainder when (-85)/(-2) + 9/(-18) is divided by m? 9 Suppose -v = -3, -c = c + v - 67. What is the remainder when c is divided by 12? 8 Let u(c) = -2c3 - 45c*2 + 24c + 29. Calculate the remainder when 11 is divided by u(-23). 5 Let v be 3/9-328. Suppose 0 = -0r - 2r + 68. Calculate the remainder when r is divided by 4/(-14) - 26/v10. 7 Let z(p) = -p3 - p*2 + p + 2. Let h = -14 - -23. Let u = 6 - h. What is the remainder when 48 is divided by z(u)? 14 Let b = -1967 - -2035. What is the remainder when b is divided by (-1 -	{ "pile_set_name": "DM Mathematics" }
nd 11:15 PM? 391 What is 344 minutes after 7:10 PM? 12:54 AM What is 160 minutes before 2:58 AM? 12:18 AM How many minutes are there between 4:56 AM and 5:52 AM? 56 What is 607 minutes after 7:41 PM? 5:48 AM What is 274 minutes after 4:25 AM? 8:59 AM What is 374 minutes before 7:41 AM? 1:27 AM What is 97 minutes before 12:27 PM? 10:50 AM How many minutes are there between 4:08 PM and 11:46 PM? 458 What is 385 minutes after 2:22 AM? 8:47 AM How many minutes are there between 4:15 PM and 3:48 AM? 693 How many minutes are there between 2:17 AM and 11:33 AM? 556 How many minutes are there between 6:24 PM and 8:27 PM? 123 What is 176 minutes before 12:08 PM? 9:12 AM What is 543 minutes after 4:23 PM? 1:26 AM What is 249 minutes after 10:01 AM? 2:10 PM How many minutes are there between 3:43 PM and 2:01 AM? 618 How many minutes are there between 5:33 PM and 12:27 AM? 414 How many minutes are there between 11:24 PM and 9:48 AM? 624 How many minutes are there between 6:07 AM and 3:27 PM? 560 How many minutes are there between 12:37 PM and 11:46 PM? 669 What is 254 minutes after 4:57 PM? 9:11 PM How many minutes are there between 7:33 AM and 3:45 PM? 492 How many minutes are there between 3:26 AM and 12:54 PM? 568 What is 552 minutes before 8:13 AM? 11:01 PM How many minutes are there between 2:24 PM and 1:08 AM? 644 What is 152 minutes after 3:36 PM? 6:08 PM How many minutes are there between 11:56 PM and 10:06 AM? 610 What is 399 minutes after 6:31 PM? 1:10 AM What is 591 minutes before 4:43 PM? 6:52 AM What is 155 minutes after 11:23 PM? 1:58 AM What is 539 minutes before 6:07 AM? 9:08 PM What is 421 minutes before 6:10 AM? 11:09 PM How many minutes are there between 10:32 PM and 8:44 AM? 612 How many minutes are there between 1:49 AM and 3:27 AM? 98 What is 320 minutes after 3:30 PM? 8:50 PM What is 77 minutes before 1:21 AM? 12:04 AM What is 582 minutes after 11:28 PM? 9:10 AM What is 120 minutes before 1:35 AM? 11:35 PM How many minutes are there between 1:40 PM and 12:41 AM? 661 What is 702 minutes before 4:59 PM? 5:17 AM What is 181 minutes after 6:11 AM? 9:12 AM How many minutes are there between 7:38 AM and 2:06 PM? 388 How many minutes are there between 9:00 AM and 3:58 PM? 418 How many minutes are there between 11:19 AM and 2:15 PM? 176 How many minutes are there between 5:58 PM and 11:13 PM? 315 What is 552 minutes after 4:21 PM? 1:33 AM How many minutes are there between 3:52 AM and 11:16 AM? 444 What is 588 minutes before 4:17 AM? 6:29 PM What is 680 minutes before 12:25 PM? 1:05 AM What is 132 minutes after 4:39 AM? 6:51 AM How many minutes are there between 1:47 AM and 1:06 PM? 679 What is 589 minutes after 1:54 AM? 11:43 AM What is 679 minutes after 5:26 AM? 4:45 PM What is 446 minutes before 9:50 PM? 2:24 PM What is 260 minutes before 11:50 AM? 7:30 AM What is 264 minutes after 8:19 PM? 12:43 AM What is 303 minutes after 1:47 PM? 6:50 PM How many minutes are there between 7:30 AM and 12:09 PM? 279 How many minutes are there between 5:58 AM and 8:45 AM? 167 What is 270 minutes after 4:23 PM? 8:53 PM What is 680 minutes after 8:23 AM? 7:43 PM How many minutes are there between 2:13 AM and 1:38 PM? 685 What is 25 minutes after 3:22 PM? 3:47 PM How many minutes are there between 4:13 PM and 11:11 PM? 418 How many minutes are there between 7:12 AM and 6:34 PM? 682 How many minutes are there between 4:26 PM and 11:07 PM? 401 How many minutes are there between 1:18 PM and 11:28 PM? 610 How many minutes are there between 7:14 AM and 6:58 PM? 704 What is 240 minutes before 8:53 AM? 4:53 AM How many minutes are there between 1:14 AM and 3:21 AM? 127 What is 430 minutes before 11:45 AM? 4:35 AM What is 170 minutes after 3:24 PM? 6:14 PM How many minutes are there between 5:26 PM and 6:56 PM? 90 How many minutes are there between 12:53 PM and 11:54 PM? 661 What is 88 minutes before 10:47 PM? 9:19 PM What is 38 minutes after 3:44 AM? 4:22 AM How many minutes are there between 11:25 AM and 6:59 PM? 454 How many minutes are there between 10:22 PM and 1:33 AM? 191 How many minutes are there between 8:10 AM and 9:39 AM? 89 How many minutes are there between 6:50 PM and 8:57 PM? 127 How many minutes are there between 11:00 PM and 9:36 AM? 636 How many minutes are there between 2:14 AM and 1:01 PM? 647 How many minutes are there between 9:40 AM and 12:13 PM? 153 How many minutes are there between 10:09 AM and 9:36 PM? 687 How many minutes are there between 9:28 PM and 10:03 PM? 35 How many minutes are there between 8:24 AM and 4:58 PM? 514 What is 543 minutes after 12:21 PM? 9:24 PM What is 251 minutes after 5:11 PM? 9:22 PM How many minutes are there between 9:35 PM and 1:06 AM? 211 What is 355 minutes after 7:09 AM? 1:04 PM How many minutes are there between 7:48 PM and 11:10 PM? 202 How many minutes are there between 12:08 PM and 1:50 PM? 102 What is 123 minutes after 4:53 PM? 6:56 PM How many minutes are there between 7:58 AM and 5:22 PM? 564 How many minutes are there between 8:17 PM and 10:57 PM? 160 What is 605 minutes after 8:42 AM? 6:47 PM How many minutes are there between 12:42 PM and 12:36 AM? 714 What is 2 minutes after 3:03 PM? 3:05 PM What is 152 minutes before 8:33 AM? 6:01 AM What is 665 minutes before 11:48 PM? 12:43 PM What is 585 minutes before 3:36 PM? 5:51 AM What is 71 minutes before 9:34 PM? 8:23 PM What is 315 minutes after 5:20 PM? 10:35 PM How many minutes are there between 4:54 PM and 1:18 AM? 504 How many minutes are there between 8:49 PM and 9:27 PM? 38 What is 700 minutes after 6:58 PM? 6:38 AM How many minutes are there between 10:16 AM and 2:46 PM? 270 What is 121 minutes after 2:48 AM? 4:49 AM How many minutes are there between 6:58 PM and 9:45 PM? 167 What is 535 minutes after 10:08 PM? 7:03 AM What is 12 minutes before 7:52 AM? 7:40 AM What is 429 minutes after 6:26 AM? 1:35 PM What is 641 minutes before 1:40 PM? 2:59 AM How many minutes are there between 12:30 PM and 7:30 PM? 420 What is 502 minutes after 4:21 AM? 12:43 PM How many minutes are there between 3:28 AM and 9:28 AM? 360 How many minutes are there between 3:06 PM and 1:13 AM? 607 How many minutes are there between 4:52 PM and 9:17 PM? 265 What is 96 minutes before 4:31 PM? 2:55 PM What is 89 minutes before 7:06 AM? 5:37 AM How many minutes are there between 7:54 PM and 12:45 AM? 291 What is 251 minutes after 8:33 PM? 12:44 AM How many minutes are there between 8:10 PM and 7:43 AM? 693 What is 139 minutes after 4:41 PM? 7:00 PM How many minutes are there between 7:12 PM and 3:34 AM? 502 What is 252 minutes before 2:22 AM? 10:10 PM How many minutes are there between 6:14 PM and 7:36 PM? 82 How many minutes are there between 9:35 AM and 3:48 PM? 373 How many minutes are there between 7:07 AM and 4:14 PM? 547 How many minutes are there between 2:34 AM and 1:20 PM? 646 How many minutes are there between 2:29 PM and 6:39 PM? 250 What is 211 minutes after 2:20 PM? 5:51 PM What is 625 minutes before 10:23 PM? 11:58 AM How many minutes are there between 3:20 PM and 4:16 PM? 56 What is 9 minutes before 11:27 PM? 11:18 PM How many minutes are there between 6:30 PM and 6:20 AM? 710 What is 354 minutes after 12:05 AM? 5:59 AM What is 703 minutes before 10:31 PM? 10:48 AM How many minutes are there between 6:08 PM and 12:14 AM? 366 How many minutes are there between 4:32 PM and 9:53 PM? 321 How many minutes are there between 11:17 PM and 1:07 AM? 110 What is 88 minutes before 12:33 PM? 11:05 AM How many minutes are there between 8:07 PM and 1:44 AM? 337 How many minutes are there between 1:46 AM and 5:50 AM? 244 What is 197 minutes after 3:17 AM? 6:34 AM What is 448 minutes after 1:02 PM? 8:30 PM What is 681 minutes before 8:29 AM? 9:08 PM What is 52 minutes after 1:14 AM? 2:06 AM What is 111 minutes before 7:05 PM? 5:14 PM How many minutes are there between 9:24 PM and 11:41 PM? 137 What is 661 minutes before 3:42 PM? 4:41 AM What is 702 minutes before 5:31 AM? 5:49 PM What is 583 minutes after 4:10 PM? 1:53 AM How many minutes are there between 5:47 PM and 10:38 PM? 291 How many minutes are there between 6:34 AM and 5:36 PM? 662 What is 394 minutes after 5:41 AM? 12:15 PM What is 92 minutes after 1:09 PM? 2:41 PM How many minutes are there between 6:03 AM and 8:	{ "pile_set_name": "DM Mathematics" }
lacement from {g: 3, f: 12}. What is prob of sequence ggff? 11/455 Two letters picked without replacement from lssslssisssssisssli. What is prob of sequence sl? 13/114 Two letters picked without replacement from omomooommmmmo. What is prob of sequence om? 7/26 Two letters picked without replacement from {h: 11, k: 1}. What is prob of sequence kh? 1/12 Three letters picked without replacement from {p: 1, a: 1, r: 2, x: 1, e: 1, z: 1}. Give prob of sequence rrp. 1/105 Three letters picked without replacement from txxtxxttxxx. Give prob of sequence txx. 28/165 Two letters picked without replacement from lttlllltll. Give prob of sequence ll. 7/15 Two letters picked without replacement from jsjiezt. Give prob of sequence ti. 1/42 Three letters picked without replacement from fcfffcffffffcfff. What is prob of sequence cfc? 13/560 Three letters picked without replacement from egmbrrrgygyegr. Give prob of sequence rgb. 2/273 What is prob of sequence dfd when three letters picked without replacement from {k: 6, f: 4, z: 2, d: 3}? 4/455 Calculate prob of sequence goyw when four letters picked without replacement from {w: 1, i: 1, y: 1, o: 1, g: 1}. 1/120 Three letters picked without replacement from {k: 8, v: 3, q: 1, g: 5, t: 2}. What is prob of sequence vkv? 8/969 What is prob of sequence gk when two letters picked without replacement from gdgwlyldkdgdkyy? 1/35 Calculate prob of sequence sysy when four letters picked without replacement from {y: 2, s: 5}. 1/21 What is prob of sequence sdss when four letters picked without replacement from {d: 2, s: 5}? 1/7 Calculate prob of sequence xx when two letters picked without replacement from {u: 1, w: 1, x: 3, r: 2}. 1/7 Two letters picked without replacement from yllliyizzlilloyz. What is prob of sequence il? 3/40 Two letters picked without replacement from {t: 1, p: 1, s: 2, x: 3}. Give prob of sequence ss. 1/21 What is prob of sequence su when two letters picked without replacement from rsrusjuuuususjjug? 7/68 Two letters picked without replacement from aciani. Give prob of sequence aa. 1/15 Three letters picked without replacement from {e: 5, h: 3, m: 1, b: 6}. What is prob of sequence hbb? 3/91 Calculate prob of sequence jj when two letters picked without replacement from jjjjjjj. 1 Calculate prob of sequence gx when two letters picked without replacement from {g: 6, x: 4}. 4/15 What is prob of sequence bnn when three letters picked without replacement from dtndbdn? 1/105 What is prob of sequence ssee when four letters picked without replacement from sesnnssessssenssenee? 15/646 Three letters picked without replacement from {t: 4, n: 7}. What is prob of sequence ttn? 14/165 Four letters picked without replacement from {q: 1, k: 17}. Give prob of sequence kqkk. 1/18 Calculate prob of sequence ii when two letters picked without replacement from iarirrtaia. 1/15 Calculate prob of sequence ooo when three letters picked without replacement from {s: 4, o: 5, t: 5}. 5/182 Two letters picked without replacement from {d: 4, o: 16}. What is prob of sequence do? 16/95 Four letters picked without replacement from nnebieeeibim. Give prob of sequence nmii. 1/990 What is prob of sequence oo when two letters picked without replacement from oooooozzzozzvoozoo? 55/153 What is prob of sequence ahn when three letters picked without replacement from {e: 1, a: 3, w: 1, n: 3, h: 3}? 3/110 Two letters picked without replacement from {g: 1, v: 1, d: 2, j: 4, c: 1, k: 3}. Give prob of sequence vg. 1/132 Calculate prob of sequence wwvr when four letters picked without replacement from {w: 6, r: 1, v: 4, s: 3, j: 1}. 1/273 What is prob of sequence rlh when three letters picked without replacement from hhhooorhaolaohor? 1/336 What is prob of sequence ql when two letters picked without replacement from dddlddldddddddddq? 1/136 Three letters picked without replacement from {p: 1, k: 1, w: 1, q: 2}. What is prob of sequence wqq? 1/30 Two letters picked without replacement from ssssissssssssss. What is prob of sequence is? 1/15 Four letters picked without replacement from yqqqqkjqcqjqqqkqqqck. What is prob of sequence jjck? 1/9690 Four letters picked without replacement from cyyhyjjjvvhcvhchvh. Give prob of sequence yyvc. 1/1020 Four letters picked without replacement from {q: 9, h: 2, o: 2}. Give prob of sequence ohoh. 1/4290 What is prob of sequence dd when two letters picked without replacement from {d: 6, y: 7}? 5/26 Calculate prob of sequence kks when three letters picked without replacement from ssskkks. 4/35 Three letters picked without replacement from {v: 1, b: 1, w: 1, i: 1, s: 2, p: 1}. What is prob of sequence vbp? 1/210 What is prob of sequence bgg when three letters picked without replacement from igggybbggbbgbidl? 5/112 What is prob of sequence zx when two letters picked without replacement from txtzzxxtxxztx? 3/26 Four letters picked without replacement from uuummmmbbummuub. Give prob of sequence bbmm. 1/182 Calculate prob of sequence ykg when three letters picked without replacement from pypkgpkgkpy. 2/165 Three letters picked without replacement from mccc. What is prob of sequence mcc? 1/4 What is prob of sequence zt when two letters picked without replacement from mmddmrdtmddlrzr? 1/210 Calculate prob of sequence ii when two letters picked without replacement from {o: 10, i: 10}. 9/38 Two letters picked without replacement from {d: 5, w: 1, b: 1, o: 3, p: 1}. Give prob of sequence ow. 3/110 What is prob of sequence gg when two letters picked without replacement from {e: 3, g: 12}? 22/35 Calculate prob of sequence tot when three letters picked without replacement from ototooo. 1/21 What is prob of sequence jj when two letters picked without replacement from zjzzzzzzjzzzjzzjzj? 10/153 Calculate prob of sequence oooi when four letters picked without replacement from {o: 11, i: 1}. 1/12 Two letters picked without replacement from kkbxzz. What is prob of sequence kx? 1/15 Four letters picked without replacement from {y: 4, s: 2, p: 2, i: 5}. Give prob of sequence yipy. 1/143 Two letters picked without replacement from {h: 15, r: 5}. What is prob of sequence rr? 1/19 Calculate prob of sequence yzp when three letters picked without replacement from {z: 1, p: 2, l: 1, y: 3}. 1/35 Two letters picked without replacement from {u: 9, v: 10}. Give prob of sequence vu. 5/19 Two letters picked without replacement from {p: 3}. What is prob of sequence pp? 1 What is prob of sequence ut when two letters picked without replacement from {t: 5, u: 2, p: 5}? 5/66 Calculate prob of sequence qqb when three letters picked without replacement from qqbqqqqqbbbqb. 70/429 Four letters picked without replacement from {n: 7, x: 5}. Give prob of sequence xxxn. 7/198 Calculate prob of sequence wukl when four letters picked without replacement from ckcukwkkkl. 1/1008 Two letters picked without replacement from ggggxgxxgx. What is prob of sequence xx? 2/15 Calculate prob of sequence gpv when three letters picked without replacement from {p: 1, g: 2, f: 1, n: 2, v: 4}. 1/90 Four letters picked without replacement from eieiiiedieddideiiii. What is prob of sequence iddi? 15/1292 Calculate prob of sequence dg when two letters picked without replacement from {g: 3, d: 2}. 3/10 What is prob of sequence la when two letters picked without replacement from {a: 1, c: 3, l: 3}? 1/14 Three letters picked without replacement from {r: 1, t: 1, u: 1, l: 2, i: 1, j: 1}. What is prob of sequence utr? 1/210 Calculate prob of sequence bst when three letters picked without replacement from {t: 1, s: 1, j: 1, e: 1, i: 2, b: 1}. 1/210 Two letters picked without replacement from {i: 2, m: 4, l: 1, g: 3, x: 1}. Give prob of sequence xl. 1/110 Two letters picked without replacement from vauhwumuhvwvuvvwauhu. What is prob of sequence wu? 9/190 What is prob of sequence ddv when three letters picked without replacement from vgddvdvggvvvgvvd? 1/35 Calculate prob of sequence rgg when three letters picked without replacement from uxxgxrxruguxgrgurugu. 2/171 Three letters picked without replacement from {r: 1, i: 4, d: 2, v: 1}. Give prob of sequence drd. 1/168 Calculate prob of sequence vv when two letters picked without replacement from {r: 2, v: 4}. 2/5 What is prob of sequen	{ "pile_set_name": "DM Mathematics" }
om {j: 2, s: 2, q: 1, x: 1, p: 1, l: 2}. Give prob of picking 2 j and 1 p. 1/84 Three letters picked without replacement from myyymmmgyygmyy. What is prob of picking 3 m? 5/182 Three letters picked without replacement from {o: 2, w: 5, h: 5}. Give prob of picking 3 w. 1/22 What is prob of picking 1 h and 1 k when two letters picked without replacement from {h: 1, v: 3, k: 3, y: 1, m: 6, n: 5}? 1/57 What is prob of picking 2 w when two letters picked without replacement from {w: 3, k: 11}? 3/91 What is prob of picking 1 k and 1 c when two letters picked without replacement from wwck? 1/6 Three letters picked without replacement from {j: 2, d: 4, p: 10}. Give prob of picking 3 d. 1/140 Two letters picked without replacement from {f: 1, t: 2, l: 1, j: 3, n: 3}. Give prob of picking 2 t. 1/45 Calculate prob of picking 1 d and 1 c when two letters picked without replacement from fcjcccmjcccsdcs. 8/105 Four letters picked without replacement from zzzzz. Give prob of picking 4 z. 1 Three letters picked without replacement from {s: 9, h: 11}. Give prob of picking 1 s and 2 h. 33/76 What is prob of picking 2 b and 1 w when three letters picked without replacement from {w: 5, p: 8, b: 3}? 3/112 Three letters picked without replacement from {s: 4, x: 1, h: 1, c: 5}. What is prob of picking 2 c and 1 s? 8/33 Two letters picked without replacement from {v: 5, g: 4, e: 8}. What is prob of picking 1 g and 1 v? 5/34 Three letters picked without replacement from igvviwiigrrv. What is prob of picking 1 v and 2 i? 9/110 What is prob of picking 1 w and 1 q when two letters picked without replacement from {w: 8, q: 5, u: 5}? 40/153 Calculate prob of picking 2 n and 1 t when three letters picked without replacement from {t: 1, n: 2, q: 2, g: 1, h: 1, v: 2}. 1/84 Two letters picked without replacement from {r: 3, i: 4, u: 6, q: 4}. Give prob of picking 2 u. 15/136 Two letters picked without replacement from {y: 4, e: 2}. Give prob of picking 2 e. 1/15 Calculate prob of picking 2 g, 1 c, and 1 o when four letters picked without replacement from {g: 2, o: 2, c: 1, t: 3, z: 4}. 2/495 Four letters picked without replacement from {t: 3, c: 6, m: 4, k: 2}. What is prob of picking 4 m? 1/1365 Two letters picked without replacement from oqqoooqpqoq. What is prob of picking 1 q and 1 o? 5/11 What is prob of picking 1 o and 1 t when two letters picked without replacement from {t: 5, g: 5, b: 2, j: 5, o: 2}? 10/171 Calculate prob of picking 1 i and 1 a when two letters picked without replacement from vtiatmma. 1/14 Two letters picked without replacement from kxkkkgllklkkkllk. Give prob of picking 1 l and 1 g. 1/24 Two letters picked without replacement from {a: 2, u: 1, d: 4, q: 2, b: 7}. What is prob of picking 2 d? 1/20 Calculate prob of picking 1 l, 1 q, and 1 h when three letters picked without replacement from lldlhhql. 1/7 What is prob of picking 1 e, 1 y, and 1 n when three letters picked without replacement from {y: 1, n: 1, x: 1, e: 1, h: 1}? 1/10 Two letters picked without replacement from rrvrevqrr. What is prob of picking 2 r? 5/18 Two letters picked without replacement from {y: 5, d: 5, e: 3}. What is prob of picking 1 e and 1 y? 5/26 What is prob of picking 1 b and 1 n when two letters picked without replacement from {y: 2, b: 1, n: 1, v: 1}? 1/10 What is prob of picking 2 m when two letters picked without replacement from smxssxxssxmsmmsxsss? 2/57 Calculate prob of picking 2 a when two letters picked without replacement from {b: 4, a: 10}. 45/91 What is prob of picking 1 y and 1 c when two letters picked without replacement from {l: 1, y: 4, h: 2, c: 2, v: 7}? 1/15 Two letters picked without replacement from {k: 7, l: 1, t: 10, b: 1}. Give prob of picking 2 t. 5/19 Two letters picked without replacement from lllllqzzz. What is prob of picking 2 z? 1/12 Calculate prob of picking 1 b and 3 m when four letters picked without replacement from {m: 7, b: 12}. 35/323 Two letters picked without replacement from yccczyzxzvz. Give prob of picking 1 y and 1 z. 8/55 What is prob of picking 1 o and 1 s when two letters picked without replacement from {w: 9, s: 1, z: 3, o: 5}? 5/153 Calculate prob of picking 2 d and 1 f when three letters picked without replacement from xjddfdj. 3/35 Two letters picked without replacement from tduuuquuuduuudu. Give prob of picking 1 u and 1 t. 2/21 What is prob of picking 2 b when two letters picked without replacement from {j: 1, n: 4, b: 3}? 3/28 Two letters picked without replacement from {y: 1, f: 1, q: 2, p: 1, e: 1, m: 1}. Give prob of picking 1 m and 1 p. 1/21 What is prob of picking 4 r when four letters picked without replacement from rrrrrrrrrlrerrr? 11/21 Four letters picked without replacement from hjjjjjsschjshsjcjjj. What is prob of picking 3 j and 1 c? 20/323 What is prob of picking 1 p and 3 t when four letters picked without replacement from oddoooxpdosttdto? 1/1820 Four letters picked without replacement from {d: 9, o: 2, p: 6}. What is prob of picking 3 p and 1 d? 9/119 Two letters picked without replacement from kmhllhhhllm. Give prob of picking 1 l and 1 m. 8/55 Three letters picked without replacement from kqqeqqbqk. What is prob of picking 1 e and 2 k? 1/84 What is prob of picking 2 k when two letters picked without replacement from {k: 3}? 1 Three letters picked without replacement from zkzgkzzkbka. Give prob of picking 1 k, 1 g, and 1 z. 16/165 What is prob of picking 1 j and 1 m when two letters picked without replacement from {m: 6, y: 1, j: 8}? 16/35 Two letters picked without replacement from wwwwczckcc. What is prob of picking 1 c and 1 k? 4/45 Calculate prob of picking 2 m and 1 u when three letters picked without replacement from umpmummmmmpumuum. 9/28 Three letters picked without replacement from zazzoaaowrooaawrvwao. Give prob of picking 1 a, 1 o, and 1 z. 3/38 What is prob of picking 1 e and 1 v when two letters picked without replacement from {e: 3, o: 2, l: 2, q: 1, b: 1, v: 6}? 6/35 Two letters picked without replacement from fjtuucsc. Give prob of picking 1 s and 1 f. 1/28 Three letters picked without replacement from sssiissssssssssssss. What is prob of picking 2 s and 1 i? 16/57 Calculate prob of picking 1 i and 1 q when two letters picked without replacement from {m: 9, i: 2, q: 1, k: 3, n: 3, l: 1}. 2/171 What is prob of picking 1 j and 1 q when two letters picked without replacement from {f: 1, q: 5, s: 2, j: 1}? 5/36 What is prob of picking 2 n when two letters picked without replacement from nddnjnd? 1/7 Calculate prob of picking 1 d, 1 i, and 1 r when three letters picked without replacement from {i: 1, r: 1, d: 1, w: 4, c: 1}. 1/56 Calculate prob of picking 1 u, 1 m, and 1 c when three letters picked without replacement from vgcum. 1/10 Four letters picked without replacement from {b: 1, z: 3, i: 6, h: 8, e: 1}. What is prob of picking 1 z, 1 e, 1 i, and 1 b? 3/646 Three letters picked without replacement from ddgdddedddgddddeg. Give prob of picking 2 e and 1 g. 3/680 What is prob of picking 3 c when three letters picked without replacement from ccccyccyc? 5/12 Two letters picked without replacement from {q: 1, h: 1, x: 1, f: 1, i: 1, o: 2}. Give prob of picking 1 q and 1 f. 1/21 Three letters picked without replacement from kkkkkkk. What is prob of picking 3 k? 1 Three letters picked without replacement from frrrrprprirpbi. Give prob of picking 3 r. 5/52 Calculate prob of picking 1 v and 1 o when two letters picked without replacement from {o: 2, e: 4, v: 6, c: 1}. 2/13 Four letters picked without replacement from jjvvvvjvvjjjjvjvvj. What is prob of picking 2 j and 2 v? 36/85 What is prob of picking 1 o, 1 p, and 1 f when three letters picked without replacement from {e: 2, n: 5, p: 1, f: 1, o: 6, z: 2}? 3/340 Calculate prob of picking 2 a and 1 d when three letters picked without replacement from fadfyfayflff. 1/220 Two letters picked without replacement from ieliziieieieie. What is prob of picking 2 i? 3/13 Two letters picked without replacement from nekqv. What is prob of picking 1 v and 1 e? 1/10 Two letters picked without replacement from {p: 8, q: 2, s: 5, y: 2}. Give prob of picking 1 q and 1 s. 5/68 What is prob of picking 1 z and 1 p when two letters picked without replacement fro	{ "pile_set_name": "DM Mathematics" }
st common multiple of 50 and o? 550 Let o = 42765/16 + -2671. Let a = -81551/4977250 + 1/5375. What is the common denominator of a and o? 7408 Suppose 5j + 4r - 12 = 2, -4j + 6 = -2r. Let h(z) = 4z - 1. Let x be h(j). Suppose -xi + 10 = -18. Calculate the least common multiple of i and 16. 16 Suppose -5z - 25 = -5m, 3m + 3z + 2z + 1 = 0. Calculate the common denominator of (m80/45)/10 and 52/3. 15 Let c = 1 - -1. Let r(p) = -5p3 - 25p*2 - 115p + 99. Calculate the lowest common multiple of c and r(-5). 674 Let g = 789898 - 876786601/1110. Find the common denominator of 97/592 and g. 8880 Suppose -3v + 2f = -v - 6, v - 3f - 7 = 0. What is the common denominator of 33/112 and v + -1 + (-5270)/(-1984)? 224 Let h be ((-9)/(-4))/((-57)/(-304)). Suppose -12 = -6x + h. Calculate the lowest common multiple of 10 and x. 20 Suppose -t - 442 = q, -1774 = 4t + 6q - 4q. Let h = -1310/3 - t. Find the common denominator of (-5210)/300 + (-8)/10 and h. 6 Let o(b) = b2 - 4b - 2. Suppose -4i = 3g - 585, 4i - 610 = -17g + 19g. What is the smallest common multiple of o(-4) and i? 150 Calculate the lowest common multiple of 615 and 10(-13)/117-81. 3690 What is the least common multiple of 276 and (-1 + (-226)/4)(-41)/((-1640)/(-192))? 276 Let s = -4018 + 2352. Let d = s - -15016/9. Calculate the common denominator of d and (484/1815)/(2 - 33/30). 27 Let v = -2009 - -16085/8. Calculate the common denominator of v and -67/5478. 21912 Suppose 41m - 78m = -74. What is the lowest common multiple of 553 and m? 1106 Let x be 73906/172333 - 3/7. Let r = x - 130141/42204. Calculate the common denominator of -187/60 and r. 60 Let g(s) = 100s + 906. Suppose 3r - 18 = -3c, 2c = -2c + 4r + 8. Suppose -2p = -cp + 16. Calculate the lowest common multiple of p and g(-9). 24 Find the common denominator of 23/550 and (95/(-69) - -1)/(3025/(-330)). 12650 Let q = 6185 - 5089. What is the smallest common multiple of 64 and q? 8768 Suppose d = 3d - 10. Suppose 2l + 3l - w = -209, -dl = 2w + 212. Find the common denominator of -2 - (6/8)/(l/(-406)) and 53/23. 92 Suppose 2y - 4z = 10, z + 24 = -y + 23. Let d(k) = 2k*2 - 4k - 1. Let m be d(4). Calculate the least common multiple of 10 and (y + m/(-10))-44. 110 Let p(c) = -c2 + 69c + 657. Calculate the smallest common multiple of 50 and p(76). 250 Let m = 11654 + -11616. Let d(g) = 5g + 2. Calculate the smallest common multiple of d(2) and m. 228 Let y = -1221 + 1271. Calculate the smallest common multiple of y and 1245. 12450 Suppose -9 = 2m - 5, 4a + 1544 = -2m. What is the common denominator of (1 - (-2370)/a) + 5 and -13/7? 77 Let r = -4/177323 - 16487119/173776540. Find the common denominator of r and 107/735. 2940 Suppose -82 = -v + 2s, -9v + v + 5s + 623 = 0. Suppose -42 = -5y - 2y. Calculate the smallest common multiple of v and y. 228 Suppose 0 = 4s - 80 - 84. Suppose 0 = 3v - s - 4. Calculate the least common multiple of 2 and (2 + (-70)/v)-13. 8 Let b = -69894353/404 - -173006. What is the common denominator of b and -53/7? 2828 Let f = -1914644/49 + 39074. What is the common denominator of f and 50/144/(-14)? 49 Suppose 52u + 140 = 66u. What is the smallest common multiple of 15 and u? 30 Let f(u) = -u*3 + 3u*2 - 2. Suppose 10 = 3d + 4. What is the lowest common multiple of f(d) and 4? 4 Suppose 17a + 883 + 1361 = 0. Calculate the common denominator of 127/18 and ((-476)/a - -3) + -5. 198 Suppose 4w - 9 = 7w, 0 = -5h - 2w - 6. Suppose -3v - 2x + 1690 = h, 4v - 4x + 372 = 2612. What is the lowest common multiple of v and 10? 2810 Let g(o) = 2o*2 + 7o + 4. Let m be g(0). Find the common denominator of -2 + (-270)/252 + (-1 - m) and -41/22. 154 Suppose -2f + 31 + 47 = -4k, 0 = 5f + k - 162. Suppose p = 2j - f - 52, 3j + 3p = 132. Let s = j + -41. Calculate the lowest common multiple of 20 and s. 20 Let d = 14272 + -1027607/72. Calculate the common denominator of -5/144 and d. 144 Let h = -108375/3584168 - -1/15449. Find the common denominator of 29/3 and h. 696 Suppose 4r - 4o + o = 107, 113 = 4r - o. Suppose i + r = 381. Find the common denominator of i/(-102) + (-2)/(-17) and -30/7. 21 Find the common denominator of 11/365 and 3422/(-522) - 12-4. 3285 Let z be (-65550)/40 - 2/(-4). Let f = z - -1648. Calculate the common denominator of f and ((-654)/8)/3 - -2. 4 Let j = 3/28523 - -199565/912736. Find the common denominator of (-4)/14 + 1958/1120 and j. 160 Let i be (62/27)/(4007/1335 - 3). Let t = i + -1535. What is the common denominator of (-2)/(-4)94/5 and t? 45 Suppose 137 - 29 = 4d. Suppose 6 = -0a - 2a - 4c, 5a = 3c + 24. Let p(q) = 2q2 - 7q + 9. Calculate the smallest common multiple of p(a) and d. 54 Let z be (-5 - -111)/(0 + 2). Let j = -47 + z. What is the smallest common multiple of j and 42? 42 Suppose -228 = -6g + 432. Suppose -y - 10 + g = 0. Suppose c - 4 - y = -3i, -2c - 56 = -2i. Calculate the least common multiple of i and 15. 165 Let z(q) = 24q - 1780. What is the lowest common multiple of (-3)/(-2) - 305/(-10) and z(75)? 160 Let i = -6547 - -6889. Calculate the least common multiple of 798 and i. 2394 What is the common denominator of 19/502 and (-22 - -13)2/((-252)/(-39))? 3514 Suppose -10y - 1288 = -6y. Let i = -184 - y. Let n = i - 134. What is the smallest common multiple of 16 and n? 16 Suppose -l + y = -34, -15y - 10 = -20y. Suppose o + 1 = 6. Suppose og = -2h + 38, 3h - 36 = -5g - h. Calculate the least common multiple of g and l. 72 Let w(a) = -3a - 4. Let m(r) = -r3 + r2 + r + 74. Let v be m(0). Let g = v + -56. Calculate the lowest common multiple of w(-6) and g. 126 Let s be 5858/18 - (-180)/(-20). Let d = s - 1925239/6084. What is the common denominator of d and 37/14? 4732 Let n(z) be the first derivative of -23z*4/4 - 4z3/3 - z2 + 109. Calculate the smallest common multiple of 18 and n(-1). 126 Let x(i) = -i*3 + 8i*2 - 8i - 12. Let v be x(6). Let z be 6/(-354)2/v2. Let d = 1229/1770 - z. Find the common denominator of -81/20 and d. 20 Let m = -98 + 97. Let b(y) = -y*3 - 9y*2 - 11y - 16. Let q be b(-8). What is the common denominator of (12/q)/((-99)/78 - m) and -27/11? 77 Let q = -235 - -346. Calculate the common denominator of (-30)/(-8)18/q and -101/2. 74 Let o(h) = -h2 - h + 10. Let b be o(0). Let i(y) = -y3 + 10y*2 + 2. Suppose 759 = -334l + 4767. Calculate the lowest common multiple of l and i(b). 12 Let c = -244033/22 + 11095. Calculate the common denominator of c and (510/2400)/(12/51). 2112 Suppose 5w - 680 = 5s, 2w - 265 = 3s + 7. Suppose -13 = -135y + wy. Calculate the smallest common multiple of 20 and y/2634-1 + 3. 20 Calculate the common denominator of (-177)/4(-48)/(-7560) and 85/294. 1470 Let r = 6636418213/6485 - 1023349. Calculate the common denominator of 35/8 and r. 51880 Let j(s) = s*2 - 12s - 562. What is the least common multiple of 264 and j(-19)? 2376 Suppose -4v - 128 = -f - 4f, v = -2f - 32. Let p be v/58(-9)/(-495). Let q = -128939/25520 + p. Calculate the common denominator of -1/18 and q. 144 Suppose a - 2 = -0. Suppose s = 5 - 4, 4v = as + 46. Suppose -5b + z + 67 = 0, 9 = 4b - 4z - 35. Calculate the least common multiple of v and b. 84 Let u be (-3 + 3)/(35/5 + -6). What is the common denominator of u/(-2) + (-126)/(-720) and 73/48? 240 Let n = -14453497/65122750 + 3/174125. Calculate the common denominator of -36/5 and n. 1870 Find the common denominator of 93/74 and 934/(-192) - ((-864)/208 - (-4)/26). 3552 Let t = -354 + 566. Suppose -4h - 20 = t. Let a = h - -68. What is the smallest common multiple of 4 and a? 20 Let t = 176829/38870 - 548/115. Find the common denominator of 101/312 and t. 4056 Let j = 2672/9 - 54151/180. Calculate the common denominator of j and 81/4898. 48980 Let r = 15259 + -2716113/178. What is the common denominator of -43/32 and r? 2848 What is the common denominator of (4/(-270))/(6/792) and (-58)/(-10) + 1127/(-483)? 45 Suppose 0 = 4f - 0f. Calculate the smallest common multiple of 10(3 + (-18)/15 + f) and 21. 126 Let r = 80206/27 + -2971. What is the common denominator of r and -65/957? 8613 Suppose 32j = 50j - 54. Suppose -jn - 100 = -8*n. Calcula	{ "pile_set_name": "DM Mathematics" }
descending order. 1/3, 1/5, -62 Sort -2, 0.4, -0.5, -22 in descending order. 0.4, -0.5, -2, -22 Put -2, 1, -1, 31 in decreasing order. 31, 1, -1, -2 Sort -5, 0, 5, 1, 323 in ascending order. -5, 0, 1, 5, 323 Put 7, 3, -1605 in increasing order. -1605, 3, 7 Put 2, -3, 1, -5 in ascending order. -5, -3, 1, 2 Sort 917, 4, 0. 0, 4, 917 Sort 2/7, -0.03, -2/17, -1 in descending order. 2/7, -0.03, -2/17, -1 Sort 582, -1/5, -4, 2/5 in ascending order. -4, -1/5, 2/5, 582 Sort 3, 1, 18, 4, -2. -2, 1, 3, 4, 18 Sort 8, 3, -5, -1 in decreasing order. 8, 3, -1, -5 Sort -235, 5, 4. -235, 4, 5 Sort -5, 12, -1/4, 5, 2. -5, -1/4, 2, 5, 12 Sort 11, -6, 3, -2 in decreasing order. 11, 3, -2, -6 Put -3, 0.02, -5, 5 in descending order. 5, 0.02, -3, -5 Sort -3, 2, 21 in increasing order. -3, 2, 21 Sort -4, 5, 2, -47. -47, -4, 2, 5 Sort -5, 5, -6, -10.27 in decreasing order. 5, -5, -6, -10.27 Put 1, -34, 2, -2/7, 0.4 in ascending order. -34, -2/7, 0.4, 1, 2 Put 0.1, 1/4, -1, -78 in descending order. 1/4, 0.1, -1, -78 Sort 0.4, 0.5, -1/52, -4/9 in decreasing order. 0.5, 0.4, -1/52, -4/9 Put -1, 21, -4 in decreasing order. 21, -1, -4 Sort 1/5, 0.3, 1, 136, -1 in ascending order. -1, 1/5, 0.3, 1, 136 Sort -0.01, -71, -0.1, 1/2. -71, -0.1, -0.01, 1/2 Sort 4/47, -3, -8, 2/5 in ascending order. -8, -3, 4/47, 2/5 Sort -5, 1/5, 0, -84. -84, -5, 0, 1/5 Put 9, -1, 476 in ascending order. -1, 9, 476 Put 0, 2, -4, 6, -11 in decreasing order. 6, 2, 0, -4, -11 Put 0.4, 920, -1, -2 in ascending order. -2, -1, 0.4, 920 Put -217, 0.1, 2/15 in decreasing order. 2/15, 0.1, -217 Sort -3, 1/5, -94, 2 in increasing order. -94, -3, 1/5, 2 Put -0.11, -2/3, 52, 1/5, 2/11 in decreasing order. 52, 1/5, 2/11, -0.11, -2/3 Sort -7, 4, 5 in ascending order. -7, 4, 5 Sort 11, 1, 2 in ascending order. 1, 2, 11 Put 3, 6, 1, 2 in decreasing order. 6, 3, 2, 1 Sort 2/13, 4, -1368, -3 in decreasing order. 4, 2/13, -3, -1368 Put 0.005, 3/4, -3/8, 3, -0.3 in decreasing order. 3, 3/4, 0.005, -0.3, -3/8 Put -49, -3, 2, -388 in descending order. 2, -3, -49, -388 Sort 90, 3, -3, -5. -5, -3, 3, 90 Sort 3, -4, 2/11. -4, 2/11, 3 Sort -3/4, -13, -2/7. -13, -3/4, -2/7 Sort -45, 5, 11, 1 in decreasing order. 11, 5, 1, -45 Sort 23, -14, 1. -14, 1, 23 Sort 19, 0, -4, 2 in ascending order. -4, 0, 2, 19 Sort 5, -4, -2. -4, -2, 5 Sort 4, 126, 5, -4 in descending order. 126, 5, 4, -4 Put 0.3, -5, 2/17, -0.5, 2 in descending order. 2, 0.3, 2/17, -0.5, -5 Put 0, -1, 5, 104/11 in increasing order. -1, 0, 5, 104/11 Sort 0.3, 3, -5, 8, -0.2 in descending order. 8, 3, 0.3, -0.2, -5 Put 5, -29, 3 in decreasing order. 5, 3, -29 Put -1/3, -3, -0.3 in ascending order. -3, -1/3, -0.3 Sort 1/2, 3, -48, 7, 4 in ascending order. -48, 1/2, 3, 4, 7 Put 22, 5, -5, 2/3 in descending order. 22, 5, 2/3, -5 Put 2, -3, 10/19 in decreasing order. 2, 10/19, -3 Sort -7, -4, -41, -2. -41, -7, -4, -2 Put 1, 5, -1, 3 in descending order. 5, 3, 1, -1 Sort -8, -4, -225 in increasing order. -225, -8, -4 Sort -2, -31, 0 in ascending order. -31, -2, 0 Put 1/4, 5, -4, 14 in ascending order. -4, 1/4, 5, 14 Put -7, -9, -3, -1, 2 in increasing order. -9, -7, -3, -1, 2 Sort -2/7, -5, -0.29, 0 in descending order. 0, -2/7, -0.29, -5 Sort 19, 3, -3 in descending order. 19, 3, -3 Put -5, 0.2, -3, -10, -0.7 in decreasing order. 0.2, -0.7, -3, -5, -10 Put 3, -120, -6, 4 in decreasing order. 4, 3, -6, -120 Sort 4, -8, 1, 465 in increasing order. -8, 1, 4, 465 Sort 5, -2, -19 in decreasing order. 5, -2, -19 Put -5, -4, -78 in descending order. -4, -5, -78 Sort -2, -3, 112, -1. -3, -2, -1, 112 Sort -2/5, -0.11, -0.9, -5 in decreasing order. -0.11, -2/5, -0.9, -5 Sort -3, 0, 3 in decreasing order. 3, 0, -3 Put 8, 12, 5, -3 in descending order. 12, 8, 5, -3 Sort 1.4, -0.1, 5, 7/4 in ascending order. -0.1, 1.4, 7/4, 5 Sort -2, 4, 25, 0. -2, 0, 4, 25 Sort 2, 3, -6, 7 in descending order. 7, 3, 2, -6 Sort -1/13, 6, 0.04, -2. -2, -1/13, 0.04, 6 Sort 2, 37, 5 in descending order. 37, 5, 2 Put 8, -5, 7 in increasing order. -5, 7, 8 Put 3, -1, -7 in ascending order. -7, -1, 3 Sort 5, 1, 18, 2. 1, 2, 5, 18 Sort 2, 3, 11, 1 in descending order. 11, 3, 2, 1 Put -1/6, 0.4, 1/3, -2, -0.132 in decreasing order. 0.4, 1/3, -0.132, -1/6, -2 Sort 1/5, -3, 0.5, -4/7. -3, -4/7, 1/5, 0.5 Put 14, -30, -2 in descending order. 14, -2, -30 Sort -30, 3, 2/11, -4, 0.7. -30, -4, 2/11, 0.7, 3 Put -293, -2, 1 in ascending order. -293, -2, 1 Put -4, 12, -2, 23, 0 in decreasing order. 23, 12, 0, -2, -4 Sort 153, -4, -3 in decreasing order. 153, -3, -4 Sort -4, 4, 1/4, -0.1, 8/5 in increasing order. -4, -0.1, 1/4, 8/5, 4 Sort 5, -2, 12, 0 in decreasing order. 12, 5, 0, -2 Put 3, 35, 0, 5 in descending order. 35, 5, 3, 0 Sort 2/5, -1/3, -4. -4, -1/3, 2/5 Put 3, -6, 12, 4 in decreasing order. 12, 4, 3, -6 Put -2.17, -1/2, -3 in increasing order. -3, -2.17, -1/2 Put 0.5, -1, -6.1, -1/7 in descending order. 0.5, -1/7, -1, -6.1 Put 155, -1, 1/7 in ascending order. -1, 1/7, 155 Sort -647, 4, -3, 1. -647, -3, 1, 4 Sort 191, 3, 2, -3, -1 in increasing order. -3, -1, 2, 3, 191 Sort -1/3, 5, 1, 7 in descending order. 7, 5, 1, -1/3 Sort 0.2, -2/5, -13, 4. -13, -2/5, 0.2, 4 Sort 44, -3, -8 in descending order. 44, -3, -8 Sort 2, 22, -8, -2 in ascending order. -8, -2, 2, 22 Sort -5, 1, -2, 3 in increasing order. -5, -2, 1, 3 Sort -4, -381, -2, -0.3 in decreasing order. -0.3, -2, -4, -381 Put -7.9, 1/2, -0.1, -4, 0.1 in descending order. 1/2, 0.1, -0.1, -4, -7.9 Sort 1, 4, -2, -1. -2, -1, 1, 4 Sort 3, -2, -4, -5, -25 in descending order. 3, -2, -4, -5, -25 Sort -3, -20, -5, 4 in ascending order. -20, -5, -3, 4 Sort 8570, -0.1, -0.2 in decreasing order. 8570, -0.1, -0.2 Put 1, 3, -174, -4, -5 in increasing order. -174, -5, -4, 1, 3 Put 3, -3, -0.1, -7.2 in decreasing order. 3, -0.1, -3, -7.2 Sort -3/7, 1/4, -1, -2. -2, -1, -3/7, 1/4 Sort -268, -3, -7 in ascending order. -268, -7, -3 Put 0, -48, 33, 1 in decreasing order. 33, 1, 0, -48 Sort -5, 2, -2, 2675, -4 in ascending order. -5, -4, -2, 2, 2675 Sort 1, -4, -5, 0 in ascending order. -5, -4, 0, 1 Put 5, -2, -5/28, 1 in descending order. 5, 1, -5/28, -2 Sort 4, 3, -1, 2. -1, 2, 3, 4 Put -1, -3/5, 2, 0.3 in decreasing order. 2, 0.3, -3/5, -1 Put 0.5, -39, -1, 1/11 in descending order. 0.5, 1/11, -1, -39 Put -18, -1, -26, 3 in decreasing order. 3, -1, -18, -26 Sort 4, -1/7, 27.1 in increasing order. -1/7, 4, 27.1 Sort 4, -1, 28, -3, -5 in increasing order. -5, -3, -1, 4, 28 Sort 2, 0, -43, -3, 0.11 in ascending order. -43, -3, 0, 0.11, 2 Sort -318, -5, 15. -318, -5, 15 Put 1, 1/3, 3/4, 8, -1 in ascending order. -1, 1/3, 3/4, 1, 8 Put -0.5, 4, -3/11 in decreasing order. 4, -3/11, -0.5 Sort 4, -1, 8, 9 in descending order. 9, 8, 4, -1 Put -5, 78, 2 in decreasing order. 78, 2, -5 Sort -3.2, -1/2, -2 in decreasing order. -1/2, -2, -3.2 Sort 5, -5, -8 in descending order. 5, -5, -8 Put -2, 5, -71, -4 in descending order. 5, -2, -4, -71 Sort -1, 19, 4, -5 in ascending order. -5, -1, 4, 19 Sort 38, -1, 5, -4, -3 in increasing order. -4, -3, -1, 5, 38 Sort -6, -40, 3 in increasing order. -40, -6, 3 Put -2, 3, 217 in decreasing order. 217, 3, -2 Put -0.1, 2, 3/4, 0.2, -2 in descending order. 2, 3/4, 0.2, -0.1, -2 Put 0, -0.02, 5, -0.3 in increasing order. -0.3, -0.02, 0, 5 Sort -1, 8, -4, 1, -2 in decreasing order. 8, 1, -1, -2, -4 Sort -7, -30, 1, 3 in decreasing order. 3, 1, -7, -30 Put 400, -1, -4, 0.5, 0.2 in ascending order. -4, -1, 0.2, 0.5, 400 Sort -1/2249, -0.2, -1/2, -1/11. -1/2, -0.2, -1/11, -1/2249 Sort -4, 1, 0, 6, -7 in decreasing order. 6, 1, 0, -4, -7 Sort 4, -3, 6. -3, 4, 6 Sort -5/2, -9, -5 in decreasing order. -5/2, -5, -9 Sort 4, -3/4, 24 in ascending order. -3/4, 4, 24 Sort 3/2, -185, -3/2 in descending order. 3/2, -3/2, -185 Put 0.3, 1/2, -1/8, -0.5 in increasing order. -0.5, -1/8, 0.3, 1/2 Sort -4, 5, -45, -3 in decreasing order. 5, -3, -4, -45 Sort 6, 0, -0.2, -0.1 in ascending order. -0.2, -0.1, 0, 6 Sort -3, 4, 9, 3, -1 in increasing order. -3, -1, 3, 4, 9 Sort 0.5, 6, 4/7, 1.4, -0.3 in decreasing order. 6, 1.4, 4/7, 0.5, -0.3 Sort 102, -2, -5 in ascending order. -5, -2, 102 Sort 43, 47, 3, -1 in descending order. 47, 43, 3, -1 Put -0.3, -4, -0.7 in ascending order. -4, -0.7, -0.3 Sort -5, -6, 172 in descending order. 172, -5, -6 Put 1, 0, 4, 3,	{ "pile_set_name": "DM Mathematics" }
is positive. r*(135/7) Simplify ((h/((h(h/(h*4/hh)hh)/h)/hhh))*(-3/10)/((hh/h*(-4/15))/hhh/h(-13/5)))(-11) assuming h is positive. h(407/6) Simplify (x(-4/5)x(-4))/((x/((x/((x/x1)/xx))/x))/x(3/8))(x(-1))(6/13)((x(-1)x)/x)8 assuming x is positive. x(-7221/520) Simplify ff(-5)(f*(2/7)/f)/ff(f(-2/3)f)*(4/3)(f/(f*9/f)f4)(3/10) assuming f is positive. f(-3257/630) Simplify ((d/(d/d36)d/((d/(d/(d(dd(-7)/d)/d)))/d))/(d(2/5)d)(-4/19))22 assuming d is positive. d(94666/95) Simplify (a(15/2)/aaa*(3/7)a*(-4)a*(-39)/aa)(1/41) assuming a is positive. a(-491/574) Simplify ((w*(-39)w)/w29)/(w(-6))(-6/5) assuming w is positive. w(-371/5) Simplify ((((rrr2/r)6)30)32)(12/5) assuming r is positive. r41472 Simplify ((t/(t*(3/2)t))(-5)/(t(1/7)tt(-7)))0 assuming t is positive. 1 Simplify ((h0/h1)/((hh(-2)/hh)/h*(3/5)))/((hh*1h)/h*(-1/3)h*3h(-1/4)) assuming h is positive. h(-329/60) Simplify ((f(2/3))(9/13)/((ff(((f/f*(-4)f)/fff)/f)/f)/f)(-3/5))(-3/25) assuming f is positive. f(-792/1625) Simplify (((m(-6)/mm)/mmm/(m/(mmm/(m/m(-2/9))mm)))/(m1)(3/10))/((m6/m)/m8)(-18) assuming m is positive. m(-5087/90) Simplify (p(-2)/(pp/(p/(p/p*(2/7)))p))/(((p*(-3/5)pp)/p)/p(-2))(p(-3)/((p(1/8)p)/p))/(p/(p/(p(-1/6)p))p(-2/15)/p) assuming p is positive. p(-2783/280) Simplify ((w(-2))(-9)(w/(w(-2/3)/w))(-35))(-2/37) assuming w is positive. w(452/111) Simplify (((f*16/ff)/(f*(2/11)f)((f(-14)f)/f)/(f/(ff13)))(-24))43 assuming f is positive. f(-156864/11) Simplify (q(3/7)qq(-1/16)(q/q8)(1/25))(-8) assuming q is positive. q(-3041/350) Simplify ((i/(i/((i/i*6)/i)))/(ii*(-2/5))i*(1/6)iiii(-3)i)/((i(1/6))(-5/2))(-36) assuming i is positive. i(-613/30) Simplify ((c(2/5))(-25))*(-39)/(((c(c(-2/7)/c)/c)/c(-3/5))/(c/c*(-4/7)(ccc*(-1)cc)/c)) assuming c is positive. c(13799/35) Simplify ((((h/((h(-10)hh)/h))/(h(-1)/hh))/(h*(-1/12)hhh/(h/h(2/27))))(-8/7))(-5/8) assuming h is positive. h(695/108) Simplify (((w/w*(-7)w)/ww(2/21)w)/((w/(ww/(ww11)))/((w/w(-2/21))/www)))(-5/8) assuming w is positive. w(-5/42) Simplify ((bb(2/7))1/(bb(-1/4))40)/((b*8/bb(2/3))/(b/(b(-5)/b)b(-2))) assuming b is positive. b(-659/21) Simplify ((z4)(-47))9(z(1/4))(7/2)(z(-2))(-48) assuming z is positive. z(-12761/8) Simplify (y2/(y/y(3/5)))(-13/7)(y*(-1/4)y/(yy0/y))/(y(-1/5)/(y/y(-7))) assuming y is positive. y(837/140) Simplify ((n(-1)/n)(-24))(-11)(n(-1))21n/n(1/4)n*(-1/4)n assuming n is positive. n*(-1095/2) Simplify ((((ff(-3/35))/f)/f(-6))/(f/(f*(-2/7)f)(f/(ff(-17)))/f))(-2) assuming f is positive. f*(726/35) Simplify d(d*(-7)/d)/dd*(-3/8)(d0)(-5/3)d/(d(-5)/dd)d0dd(6/5)d/(d/(dd/((d/(d/(d(-1)/d)dd))/d)d)) assuming d is positive. d(313/40) Simplify (u(-1)u(-1/2)u1/(u/(u(-2/13)/uu)))/(u(-4/9)/(u/(uuu(-4/9)u)))(-1/13) assuming u is positive. u(-367/234) Simplify ((s(1/5))(1/9))*(-1/82)s*(1/11)s*(-3/2)/s(s/(s/s(2/7)))(1/4) assuming s is positive. s(-664277/284130) Simplify (w(-1))*(-4/9)/((www/(w/w0)w)/((ww(2/13))/w))((w/(w/(w*(-1)w))w)/w)(-2/9)w(-1)/w(-4/3) assuming w is positive. w*(-242/117) Simplify ggg(-26)g*(-28)(g14/g)/(g/(g4g)g) assuming g is positive. g*(-36) Simplify ((ss*(-10)sss/(s*(-23)ss))/(s(14/3))(-12))8 assuming s is positive. s568 Simplify (kk/((((k/(kk1/k))/k)/k)/k))35/(k3k(k(-4/5)k)/k)(k/(kk*3)k(1/9))17 assuming k is positive. k*(5521/45) Simplify (h/(hh*(-2))h)/(h*6/h)h*5hh/(hh*(-6))(hh(-1/4)/h)/h(6/11)(h1)(-1/27) assuming h is positive. h*(10891/1188) Simplify (ww(-2))36(w(5/4)/w)/ww18 assuming w is positive. w(-75/4) Simplify ((u/((u*(-1/2)/uuu)/u))(-8)(u/(u(2/5)/u))33)/((u*(-1/6)/u)/(uu*1/u)(u(1/2))(2/41)) assuming u is positive. u(52819/1230) Simplify (((z/z4)/z)/zzzz(-5)z(z/z(2/23))/zz(3/4))/(z(-4)z/(zz((zz*(-2)/z)/z)/zz))(-2/87) assuming z is positive. z(-51089/8004) Simplify f/f*(2/7)(f/(f/(ff/((ff*(-1)ff)/f))))/f(f0)28((f/(f/f(2/5)f))28)31 assuming f is positive. f(-18203/35) Simplify (g(-6)/g)/((g/g*(-2/13))/g)g/g*0g*(2/5)/g(g(g0g)/g)5/(g1)(-3/2) assuming g is positive. g(-33/130) Simplify ((m/((m/((mmm*(-1)/m)/m))/mmm))(-28))39(m*(-10)(m6/m)/m)(2/5) assuming m is positive. m(10908/5) Simplify (m/((m/m(-6))/m)m5)/((mm6)/((m/m(-2))/m))((m(1/5)m)/mm0)/((m(-2)/m)/(m/(m/(mm*(-5))m))) assuming m is positive. m(-34/5) Simplify (l(1/15)l(1/8))(3/7)/((ll*(-2/7)/lll(2/7))/(ll/l*0l/l(-1))) assuming l is positive. l(863/280) Simplify (zz(3/2)zz/z7)/(z9(z*(-7)/zzz)/zz)((z(-2/9)/zzz)43)(1/35) assuming z is positive. z(-409/90) Simplify (zz*(-12)/z)/zz/((z/(z*(6/11)/z))/z)z*(1/82)/(z(z*(-8)z)/zz) assuming z is positive. z(-5811/902) Simplify (g(-5)g*(-2/11)g*7g/(g/((g(g/(g/(g/g(-9))))/g)/g)))/(g(2/9)(((g*0/g)/gg)/g)/gg(gg7/gg)/g(2/39)) assuming g is positive. g(5981/1287) Simplify ((i*(2/5)i)*44i*7ii(-1/9))/((i/(ii(-1/2)))(-16)((ii*(1/4)i)/i)(-10)) assuming i is positive. i(8099/90) Simplify (t*3ttt(-7/2))/(t(-1))*(1/33)((t/(t/t(-1/9)))/t(-6))/(t/(t*(-3)t)tt8/t) assuming t is positive. t(-709/198) Simplify (((hhhhhhh*(-4/9)hh)/h(-2/69))/((h/(h(-1/22)hh))/h(3/7)))(2/59) assuming h is positive. h(285871/940401) Simplify (y/(y/(y((y*4/y)/y)/y)y)yy/y*(-5)y*5y/(yyy/y(-7)))/((y(-2/9))*(-21)y*(-5/4)yy(-4)) assuming y is positive. y(43/12) Simplify (b(4/3)/bb/(b*(-2/11)b))/(b/(bb2))(-19)((b(-2)/b)/(b(-4/9)bb))/(b(-6)/(b/((b/b(-6))/b))) assuming b is positive. b(-4063/99) Simplify (w0w)(-1/33)/(w(-2/7)/(w/w6))((((www0/w)/w)/w)(-18))(-49) assuming w is positive. w(-204838/231) Simplify (y*(3/5)((yy(-2/3))/y)/y)(1/15)/(yy*(1/5)(y(y/y(-6)y)/y)/y)(-50) assuming y is positive. y(92234/225) Simplify (l(l/(l/l(-4/7)l))/l((l/(ll*0))/l)/lll(-7)l/(l*(-2/9)l))/((ll1)(-36))(-32) assuming l is positive. l(-145741/63) Simplify ((bb*(-1/11)b)/b(bb*(-7/3))/b(b*(11/6)b)/b(-2/39))(-43) assuming b is positive. b(-53879/858) Simplify ((j/j(1/3))(3/7))48/(((j(3/5)/j)/(j/(j/j(-3/2)j)))/(j/(jj*1)j)21) assuming j is positive. j(813/70) Simplify (((d(1/5)/d)/d(-2/5))/((dd/(d(-15)/d))/((d(-17)/d)/d)))(-49) assuming d is positive. d(9163/5) Simplify ((r(-21)/(r17r))/((r/(r/(r9/r)))/(r/r27)))(-6) assuming r is positive. r438 Simplify (((n(-2/25)/n)/((n(2/9)nn)/nn))/(n(-4)nn/(nnn/(n5/n))n))/((n/(n*(-2/9)/nn))/(n*(-1)/n)nn(6/11)n/n5) assuming n is positive. n(-10073/2475) Simplify ((c3)(-21/4)/(((cc29)/c)/ccc(-28)c))(-35) assuming c is positive. c(2485/4) Simplify ((y(yyyyy(-1)yy)/y)10y*(-6)y*(-2/23))/(((y/(yy/y*1))/yy)*(-25/4)y(-1/5)/(y(5/3)y)) assuming y is positive. y(16139/345) Simplify (jj/j7)/j(-2)jjj12j/(jj(14/11)j) assuming j is positive. j(96/11) Simplify ((q/(q(-2/5)q)q*3q)/(qq/q(-2)q/(qq5)))/(q4/((q/q5)/q)(q(-2/7))(-1/36)) assuming q is positive. q*(-2273/630) Simplify (((vv/(v/v*(-4/7)))/v(v/(vvv/(v/(v/v*(7/2)v))))/v)/((v/(vv(18/7)/v))/(vvv(4/7)v)))6 assuming v is positive. v(171/7) Simplify (k*(-47)/(kk*(2/25))kk(-46)/kk/(k*31k))(4/15) assuming k is positive. k(-12508/375) Simplify (t*(2/87)/tt11)/((t(-11)/t)/t)(-2/95) assuming t is positive. t(80578/8265) Simplify (((pp(-1/2))/p)/(p6/pp)(p/(pp/((p/p*(-7))/pp)))/pp2)/((p(1/3)/p(-1/2))/(p(-1/4)p/p4)) assuming p is positive. p(-31/12) Simplify (n/(n/(n*(-9)/n))n*14(nn(1/3)/nn)	{ "pile_set_name": "DM Mathematics" }
placement from {m: 3, b: 1, y: 3, a: 4}? 3/55 Calculate prob of picking 2 y and 2 x when four letters picked without replacement from {f: 5, x: 6, y: 1, u: 1, d: 6}. 0 Two letters picked without replacement from bggvvgbvgggvggvgv. What is prob of picking 2 v? 15/136 Calculate prob of picking 1 i and 1 f when two letters picked without replacement from fffwliwwwwzzwff. 1/21 Calculate prob of picking 2 w and 1 x when three letters picked without replacement from yxaxxywwtyax. 1/55 Three letters picked without replacement from yxodoxyoyxxxdxd. What is prob of picking 1 o and 2 d? 9/455 Two letters picked without replacement from {i: 1, o: 1, e: 3, t: 12, a: 1, k: 2}. Give prob of picking 2 t. 33/95 What is prob of picking 1 j and 3 k when four letters picked without replacement from kjkkjlllll? 1/105 What is prob of picking 2 q and 1 b when three letters picked without replacement from ulluqlbqlqllq? 3/143 What is prob of picking 1 c and 1 y when two letters picked without replacement from cyylylylll? 4/45 Four letters picked without replacement from {r: 3, a: 12}. Give prob of picking 4 a. 33/91 Four letters picked without replacement from {d: 3, n: 3}. Give prob of picking 2 d and 2 n. 3/5 What is prob of picking 1 i and 1 f when two letters picked without replacement from {p: 3, w: 2, i: 2, s: 2, f: 4, l: 1}? 8/91 Four letters picked without replacement from ffulxdqdq. Give prob of picking 1 f and 3 l. 0 What is prob of picking 1 c, 1 m, 1 o, and 1 s when four letters picked without replacement from mmscsmccso? 9/70 Two letters picked without replacement from wkppkuuutkwkukku. Give prob of picking 1 k and 1 p. 1/10 What is prob of picking 1 t, 1 f, and 1 c when three letters picked without replacement from {t: 5, g: 1, f: 4, x: 1, m: 2, c: 2}? 8/91 Calculate prob of picking 1 o and 1 v when two letters picked without replacement from vvvoovvv. 3/7 Two letters picked without replacement from jvhavxjjvxjvhjj. What is prob of picking 1 h and 1 a? 2/105 Calculate prob of picking 2 o and 2 a when four letters picked without replacement from oaaoaoaaoaoaooaaoo. 36/85 Two letters picked without replacement from {i: 2, o: 1, d: 1, x: 2, m: 1, y: 1}. Give prob of picking 1 o and 1 y. 1/28 What is prob of picking 1 z and 1 b when two letters picked without replacement from kzzzkbz? 4/21 What is prob of picking 1 t, 1 e, and 1 w when three letters picked without replacement from {l: 1, t: 1, c: 1, e: 2, g: 2, w: 2}? 1/21 Four letters picked without replacement from {o: 1, s: 5, e: 5, w: 1}. Give prob of picking 1 s and 3 e. 10/99 Calculate prob of picking 2 v when two letters picked without replacement from {z: 3, c: 2, v: 7}. 7/22 Calculate prob of picking 1 e, 1 y, and 1 b when three letters picked without replacement from oyeebbbeee. 1/8 Three letters picked without replacement from {f: 1, w: 2, k: 1, r: 4}. Give prob of picking 1 r, 1 w, and 1 k. 1/7 Two letters picked without replacement from {t: 14, w: 4}. What is prob of picking 1 w and 1 t? 56/153 Two letters picked without replacement from awg. What is prob of picking 1 w and 1 g? 1/3 Four letters picked without replacement from llymllym. What is prob of picking 1 y and 3 l? 4/35 Four letters picked without replacement from {o: 1, j: 3, c: 4, f: 12}. What is prob of picking 3 c and 1 f? 16/1615 Four letters picked without replacement from {c: 5, j: 2}. Give prob of picking 4 j. 0 Two letters picked without replacement from {e: 3, f: 2, l: 10, i: 1, o: 1, c: 1}. Give prob of picking 1 e and 1 f. 2/51 Calculate prob of picking 2 g when two letters picked without replacement from {w: 4, g: 3}. 1/7 Two letters picked without replacement from ooooddooooodoooodooo. Give prob of picking 2 o. 12/19 Three letters picked without replacement from {v: 3, k: 8}. What is prob of picking 1 k and 2 v? 8/55 Three letters picked without replacement from whxmxxqxxhhxxwxf. Give prob of picking 2 w and 1 f. 1/560 What is prob of picking 3 z when three letters picked without replacement from {f: 15, z: 3, x: 2}? 1/1140 Calculate prob of picking 4 y when four letters picked without replacement from yyylyyyylyyyll. 30/143 Three letters picked without replacement from jjccjccjcjjc. Give prob of picking 3 j. 1/11 Four letters picked without replacement from {s: 3, u: 3}. Give prob of picking 1 s and 3 u. 1/5 Two letters picked without replacement from {e: 1, r: 2, g: 1, l: 2, i: 1}. Give prob of picking 1 l and 1 r. 4/21 Calculate prob of picking 1 q and 2 k when three letters picked without replacement from {w: 1, u: 3, k: 2, i: 4, q: 2}. 1/110 Two letters picked without replacement from czkjcuu. Give prob of picking 1 k and 1 z. 1/21 What is prob of picking 3 n and 1 i when four letters picked without replacement from {r: 3, n: 6, u: 2, q: 1, i: 2}? 40/1001 Two letters picked without replacement from {q: 3, a: 3, d: 5, y: 2, e: 1, k: 1}. Give prob of picking 1 k and 1 d. 1/21 What is prob of picking 1 k and 2 r when three letters picked without replacement from {k: 7, r: 9}? 9/20 Four letters picked without replacement from lwwlpawwlapl. Give prob of picking 1 l, 2 p, and 1 w. 16/495 Four letters picked without replacement from sppppppqoqqpsq. What is prob of picking 1 s, 1 o, and 2 q? 12/1001 Three letters picked without replacement from {t: 1, k: 2, d: 2, y: 1, b: 10}. Give prob of picking 1 d, 1 b, and 1 k. 1/14 Three letters picked without replacement from {m: 1, c: 1, d: 2, r: 5, y: 1}. Give prob of picking 2 r and 1 d. 1/6 Two letters picked without replacement from {t: 1, f: 4, y: 9}. Give prob of picking 1 t and 1 y. 9/91 What is prob of picking 1 r and 1 e when two letters picked without replacement from arrreeeoearorerrrerr? 6/19 Calculate prob of picking 1 u and 1 c when two letters picked without replacement from {o: 1, x: 1, u: 1, c: 1, n: 1}. 1/10 What is prob of picking 2 q and 1 i when three letters picked without replacement from qqiiiiiqqqiiiiqq? 27/80 Calculate prob of picking 1 p and 2 x when three letters picked without replacement from {p: 1, x: 3, z: 2, r: 4, k: 2}. 3/220 Four letters picked without replacement from bbbppbbp. What is prob of picking 4 b? 1/14 Two letters picked without replacement from {u: 2, n: 8, j: 9}. What is prob of picking 2 j? 4/19 Two letters picked without replacement from qqhqzizizqa. Give prob of picking 1 a and 1 i. 2/55 Calculate prob of picking 4 h when four letters picked without replacement from ybhhbyhhhb. 1/42 What is prob of picking 1 x and 1 p when two letters picked without replacement from pxoooeoooxop? 2/33 Three letters picked without replacement from {y: 1, j: 1, o: 3, h: 2}. Give prob of picking 1 y, 1 h, and 1 j. 2/35 Calculate prob of picking 1 a and 2 r when three letters picked without replacement from {q: 3, r: 2, o: 3, m: 3, l: 1, a: 7}. 7/969 Two letters picked without replacement from {w: 2, f: 7, z: 3, q: 3}. Give prob of picking 1 w and 1 f. 2/15 Two letters picked without replacement from pwpafawfawfffwpfp. What is prob of picking 1 a and 1 f? 9/68 Three letters picked without replacement from nhhhhhphk. Give prob of picking 1 k, 1 p, and 1 h. 1/14 Two letters picked without replacement from iitrtttl. What is prob of picking 2 i? 1/28 Three letters picked without replacement from {u: 4, n: 16}. What is prob of picking 3 u? 1/285 Calculate prob of picking 2 a, 1 e, and 1 w when four letters picked without replacement from {h: 1, e: 4, a: 5, w: 5, s: 1}. 10/91 Three letters picked without replacement from {v: 1, y: 11, s: 8}. What is prob of picking 1 v and 2 y? 11/228 What is prob of picking 1 l and 1 d when two letters picked without replacement from {l: 3, i: 5, q: 2, d: 1, u: 1}? 1/22 What is prob of picking 2 a and 1 z when three letters picked without replacement from {c: 2, u: 4, f: 1, z: 1, a: 2, o: 2}? 1/220 Calculate prob of picking 2 p and 2 l when four letters picked without replacement from hwwllupuwhhlhl. 0 Two letters picked without replacement from bwbwwwbkk. Give prob of picking 1 b and 1 w. 1/3 Two letters picked without replacement from qlxqhqqqqqxqhqhlqqh. Give prob of picking 2 h. 2/57 Two letters picked without replacement from gtghgthttqgq. What is prob of picking 2 h? 1/66 What is prob of picking 1 m, 1 p, and 1 u wh	{ "pile_set_name": "DM Mathematics" }
0125 Calculate -61344268 divided by 2. -30672134 What is -53 divided by -184507? 53/184507 What is 1592928210 divided by 318585642? 5 1663554072 divided by -6 -277259012 1303799700 divided by 86919980 15 43 divided by -297743 -43/297743 -17536080 divided by 10 -1753608 5305459 divided by 53 100103 Calculate -889 divided by -4075. 889/4075 -40910163 divided by 59549 -687 Divide -4515 by 119. -645/17 Calculate 128292888 divided by -3. -42764296 Divide -1062981 by -98. 1062981/98 Divide -21879012 by 51846. -422 Divide -160 by 264498. -80/132249 Divide -125253 by -92. 125253/92 -46980962 divided by 1526 -30787 Calculate 28 divided by 20247929. 28/20247929 Divide -16569 by 4820. -16569/4820 -24 divided by 2176773 -8/725591 -127673 divided by 52 -9821/4 7475544 divided by -276872 -27 Divide -3761 by 5936. -3761/5936 -1535856 divided by -6 255976 Divide -213338826 by -1. 213338826 Calculate -21016380 divided by 1000780. -21 Divide -9847572 by 703398. -14 What is 243191991 divided by 4227? 57533 Divide 7461756 by -21818. -342 What is 3319184 divided by -414898? -8 Calculate -1 divided by 2020292. -1/2020292 Divide -4114344 by -78. 52748 -459275616 divided by 1594707 -288 7308036 divided by 203001 36 Divide -19370489 by 3083. -6283 -23744 divided by -2818 11872/1409 What is -13965606 divided by -131751? 106 What is -390442668 divided by -66? 5915798 4075065 divided by 90557 45 Divide 450496 by 112624. 4 38102988 divided by 1507 25284 Divide -61152355 by -7645. 7999 Divide -950079 by 4299. -221 What is -1 divided by -710055? 1/710055 What is 74275790 divided by -10? -7427579 -266752 divided by -33 266752/33 Calculate 213822280 divided by 12026. 17780 32794201 divided by 13 32794201/13 Calculate -52980300 divided by 13690. -3870 What is -213763066 divided by 96203? -2222 239 divided by -471883 -239/471883 Divide 1231 by 5135. 1231/5135 What is -46697916 divided by -7782986? 6 What is 402352512 divided by -76? -5294112 -7635 divided by 509 -15 Calculate 5499 divided by -1393. -5499/1393 What is 83487420 divided by -6957285? -12 Divide -8142898 by 239497. -34 -107496920 divided by -5374846 20 Calculate -74205635 divided by -73109. 1015 What is 128629788 divided by 651? 197588 Calculate 20077 divided by 55. 20077/55 What is 11860 divided by -9275? -2372/1855 1704435 divided by -21 -568145/7 What is -1584 divided by 5800? -198/725 What is 66588848 divided by -16? -4161803 Divide -2 by -10109984. 1/5054992 Divide -16285 by 735. -3257/147 Divide 398588868 by -33215739. -12 Divide 87 by 336842. 87/336842 What is 40341069 divided by 373? 108153 Calculate 115673768 divided by 1238. 93436 1767636 divided by -10 -883818/5 2614365 divided by -585 -4469 64724100 divided by 63455 1020 -20793904 divided by -38 547208 Calculate -146594139 divided by -1. 146594139 -16355405 divided by -11 1486855 What is -146470 divided by -5? 29294 Divide -14 by 7097651. -14/7097651 Calculate -22103757 divided by 4. -22103757/4 Divide 12341617 by 17. 12341617/17 What is -154 divided by -472504? 77/236252 Calculate 9973001 divided by 3. 9973001/3 Calculate 18015824 divided by -253744. -71 What is 744144 divided by -8? -93018 What is -16761095 divided by 13? -1289315 -581765 divided by 21 -581765/21 Calculate 10177334 divided by 16934. 601 Divide -33551 by 202. -33551/202 Calculate 24665884 divided by -1. -24665884 Divide 107203736 by -53. -2022712 Calculate -283943010 divided by -510. 556751 Divide 19753371 by 9603. 2057 Calculate -5 divided by -3024649. 5/3024649 What is -5 divided by -1708765? 1/341753 Divide 9 by 976093. 9/976093 What is -3 divided by 375554? -3/375554 What is -395 divided by -152964? 395/152964 1180080 divided by 131120 9 Calculate -3831024 divided by -8. 478878 Divide 640849 by 1361. 640849/1361 Calculate -29482585 divided by -4895. 6023 Divide 5 by -2601645. -1/520329 Divide 430582161 by 5. 430582161/5 Divide 1 by -180569382. -1/180569382 -2706564 divided by 12 -225547 Divide -44904992 by -16. 2806562 Divide -91775795 by 2. -91775795/2 Calculate -19471130 divided by 7042. -2765 Divide -369183154 by -11909134. 31 What is -1033 divided by 47953? -1033/47953 What is -350907885 divided by 70181577? -5 -35797408 divided by -2 17898704 6420 divided by -11165 -1284/2233 What is 788781 divided by -262927? -3 844516 divided by 19 844516/19 153449300 divided by -4 -38362325 Calculate 1 divided by -946168. -1/946168 Divide 74019348 by -6. -12336558 What is -44489108 divided by -22244554? 2 Calculate -20503548 divided by 6. -3417258 What is -42520497 divided by -2833? 15009 Calculate -10037027 divided by -110297. 91 483 divided by 764 483/764 What is -1 divided by -30074550? 1/30074550 -4814280 divided by -106984 45 -1589 divided by 37184 -227/5312 -239583 divided by -12 79861/4 24090556 divided by 76 316981 What is -1281453852 divided by 225172? -5691 -73729 divided by 9 -73729/9 -119046540 divided by -6 19841090 -13074542 divided by 13591 -962 Divide 75 by -2270491. -75/2270491 -157816 divided by 19727 -8 692514 divided by 158 4383 -2 divided by 19959597 -2/19959597 34971760 divided by -1 -34971760 What is 38 divided by -17875998? -1/470421 Divide 9748 by 697. 9748/697 Calculate 7041359 divided by -14639. -481 What is -225754640 divided by -45150928? 5 What is -3 divided by 88030333? -3/88030333 Calculate -13870220 divided by -99073. 140 Divide -214585470 by 42917094. -5 What is 0 divided by 414393092? 0 What is 6509172 divided by -6? -1084862 What is 88696123 divided by 16153? 5491 Divide 55663 by 1214. 55663/1214 What is 137722020 divided by 5? 27544404 Divide -723 by -268780. 723/268780 Divide -183 by -160782. 61/53594 66322101 divided by -291 -227911 Calculate -2892900 divided by 6. -482150 Calculate -234006 divided by 29. -234006/29 Divide -10394769 by -944979. 11 Divide -158044 by -961. 158044/961 Calculate 10251732 divided by 89. 115188 What is 1513 divided by 5206? 1513/5206 300512360 divided by -22090 -13604 51228513 divided by 9797 5229 22481 divided by 1778 22481/1778 -128416 divided by -158 64208/79 3 divided by -4167830 -3/4167830 What is -5067408 divided by 9264? -547 What is -292365978 divided by -6? 48727663 Calculate 85245930 divided by 22. 3874815 -1032 divided by 202986 -172/33831 -2 divided by -4350787 2/4350787 137 divided by -7546866 -137/7546866 Calculate 6464 divided by -247. -6464/247 Calculate -301340189 divided by 5. -301340189/5 What is -6 divided by 5608158? -1/934693 Divide 1794 by -28002. -23/359 -10339517 divided by -71 145627 What is 4 divided by -9620406? -2/4810203 Calculate 5877 divided by 1071. 653/119 Divide -112980071 by -2. 112980071/2 Calculate 145057104 divided by -139344. -1041 What is 360935544 divided by -6? -60155924 Calculate -655200 divided by -1680. 390 Divide -1437 by 85. -1437/85 Calculate -738814102 divided by 4. -369407051/2 What is 8118376 divided by 39992? 203 Divide -12195 by 6115. -2439/1223 Divide -20762 by 1092. -1483/78 What is 83002 divided by -1860? -41501/930 Divide 3413672 by 54. 1706836/27 -245264110 divided by -13573 18070 Divide 43523 by -157. -43523/157 What is 1143987 divided by 3? 381329 What is -2 divided by -82045257? 2/82045257 3305 divided by 291711 3305/291711 Divide -4531 by 39292. -4531/39292 Calculate -527 divided by 54416. -527/54416 Calculate 31494642 divided by -4. -15747321/2 Divide -10129 by 194. -10129/194 Divide 23386616 by 23386616. 1 What is 1464133 divided by 160? 1464133/160 Divide 23128061 by 121. 191141 Calculate 308173255 divided by -1247665. -247 What is 22 divided by 121806? 11/60903 Divide 1778211 by -3. -592737 Divide -92 by -1825465. 92/1825465 -32167944 divided by 612 -52562 Divide -55424094 by 6. -9237349 Divide -70 by -218. 35/109 Divide -55 by -167920. 11/33584 Calculate -4602900 divided by -1534300. 3 -12385344 divided by 48192 -257 Calculate -181552146 divided by 30258691. -6 Divide -27199230 by 1813282. -15 What is -183742065 divided by -35685? 5149 37 divided by 1055531 37/1055531 -112709 divided by 701 -112709/701 27534 divided by -7614 -4589/1269 Calculate 97714892 divided by -4. -24428723 -151684195 divided by 101461 -1495 Divide 459332 by 23. 459332/23 Calculate -24577824 divided by -12. 2048152 12624948 divided by 106092 119 Divide -2957250 by -2957250. 1 351004	{ "pile_set_name": "DM Mathematics" }
= 26 - 25.99966. Round p to four decimal places. 0.0003 Let c = 0.01 - -3.99. Let t = -4.0000075 + c. Round t to 6 dps. -0.000008 Suppose -8 = 5t - 133. Let v be t/2(-6 + 3526). What is v rounded to the nearest ten thousand? 40000 Suppose -5k + 4x + 679984 = -0x, -8 = -2x. Round k to the nearest ten thousand. 140000 Let y = -1906022.765974 + 1912124.6. Let g = y - 6091.834. Let d = -10 + g. What is d rounded to five decimal places? 0.00003 Let c = -476009 + 476014.49879. Let t = c - 5.5. Round t to 4 dps. -0.0012 Suppose -10j = -6j - 1400000. Suppose 5s + 0s = -j. Round s to the nearest one hundred thousand. -100000 Let p = -187.00000037 - -187. What is p rounded to 6 decimal places? 0 Let y = 53 + -112. Let h = 58.9999827 + y. Round h to 6 decimal places. -0.000017 Suppose w + p + 2 + 1 = 0, 4w - 3p - 23 = 0. Suppose -2m + m + 4u = -290, -4m - wu + 1070 = 0. Round m to the nearest one hundred. 300 Let p = -1 - -1.016. Let i = p + -45.016. Let a = i - -44.999938. Round a to five dps. -0.00006 Let t = 211.77 + -13.47. Let s = -215 + t. Round s to 0 dps. -17 Let g = -4.8 + 4.7999924. What is g rounded to six dps? -0.000008 Suppose 3k - 7k = -56. Let x = -103 + k. Round x to the nearest ten. -90 Let h = -5.3 - 24.7. Let a = -30.00029 - h. Round a to four dps. -0.0003 Suppose 5k = 4d - 3249980, -4k + 5d - 3249975 = k. What is k rounded to the nearest one hundred thousand? -700000 Let n = 8619.58 - 8619.53299958. Let u = n - 0.047. Round u to seven dps. 0.0000004 Let r = 0.7878 + -51.0778. Let g = -50 - r. What is g rounded to 1 dp? 0.3 Let i(g) = -19g3 + 17g*2 + 13g - 11. Let h be i(11). What is h rounded to the nearest 10000? -20000 Let d = 9 - 11. Let t be -3323068(1 + 6/d). Let s = t - 3646136. What is s rounded to the nearest one million? 3000000 Let d(g) = 8265322g*3 + 1. Let m be d(-1). Let u(v) = -14346v*2 - 8v + 1. Let t be u(10). Let b = t + m. Round b to the nearest one million. -10000000 Let q = 17 + 1. Let h = 17.43 - q. Let u = h + -0.14. What is u rounded to one dp? -0.7 Let f = -36 + 22. Let r be (-4)/f + 772/(-7). Round r to the nearest 100. -100 Let b = -121.00096 + 121. Round b to 3 dps. -0.001 Let u = 4.89 - 4.2. Let b = u - 0.6900059. What is b rounded to 6 decimal places? -0.000006 Let l = -6 + -1. Let y = l - -7.0007. Round y to 4 dps. 0.0007 Let b = 22697 + -22717.978. Let g = b + -0.022. Let u = 20.82 + g. Round u to 1 decimal place. -0.2 Let f = 26 + -26.07. Round f to two decimal places. -0.07 Let p be 6/27 - (-58)/(-18). Let v = p + 5. Suppose vs - 96 = 8. What is s rounded to the nearest 10? 50 Let f = 15 + -15.24. Let t = f - 0.164. Let c = -0.4 - t. What is c rounded to 3 dps? 0.004 Let j be 3199988/(-8) - 3/2. What is j rounded to the nearest 100000? -400000 Let q(h) = 332h. Let k be q(1). Suppose -5n - 148 = k. What is n rounded to the nearest 10? -100 Let n(v) = 700009v*2 + 7v - 13. Let c(j) = -350004j2 - 3j + 6. Let f(g) = -9c(g) - 4n(g). Let z be f(-2). What is z rounded to the nearest 100000? 1400000 Suppose -4w + 3w - 25600004 = -4f, -4f + 2w + 25600008 = 0. Round f to the nearest one hundred thousand. 6400000 Let y be (-13001)/2 - ((-15)/10 - -1). Round y to the nearest 1000. -7000 Suppose -1182174 = 2f + 4u + 13817814, 37500009 = -5f + 3u. What is f rounded to the nearest one million? -8000000 Let a = 14.9 - 14.899535. What is a rounded to 4 dps? 0.0005 Suppose m + 9 = -0. Round m to the nearest 10. -10 Let m = -37 - -37.00075. What is m rounded to 4 decimal places? 0.0008 Let x = -26189 - 27910. Let u = -114099 - x. Round u to the nearest ten thousand. -60000 Let h = -57592.188 + 57697. Let g = 0.188 + h. Let r = g - 105.047. Round r to two decimal places. -0.05 Let l = 18 - 10. Suppose -3d = -ld. Round d to the nearest ten thousand. 0 Suppose -5z + 9909 + 37481 = -3q, 2 = -z. What is q rounded to the nearest 1000? -16000 Suppose 12400 = 66z - 68z. What is z rounded to the nearest 1000? -6000 Let t be -1 + 1 - (-2 + -4). Let a = 4414253 + -1914278. Suppose tx - x + a = -r, 5r + 12500020 = 4x. What is r rounded to the nearest one million? -3000000 Suppose -1891 = i - s - 19491, -i + 2s = -17600. Round i to the nearest 10000. 20000 Let u = 80579 - 180579. Round u to the nearest 100000. -100000 Let u = -10 - -10.004. What is u rounded to 3 dps? 0.004 Let i = -212.3070719 + 256.307074. Let o = i - 44. What is o rounded to six decimal places? 0.000002 Let d = 1126 - 1597. Let p = -182 - d. Suppose 3u - 161 = p. What is u rounded to the nearest ten? 150 Suppose 4j - 447 = 145. Round j to the nearest ten. 150 Let z = -8.93 - -9. Let n = -0.07000003 + z. Let c = 0 - n. Round c to 7 dps. 0 Let t(q) = -14647901q*3 + 2q*2 - 1. Let p be t(-1). Let d = -9847902 + p. Round d to the nearest one million. 5000000 Let f = -16.7 + 16.69999765. Round f to 6 decimal places. -0.000002 Let b = -0.76 - -0.2. Let h = b + 0.55999878. What is h rounded to 7 decimal places? -0.0000012 Let c = 18019 + -18020.8994. Let h = 1.9 + c. Round h to 4 dps. 0.0006 Suppose -5n - 5492560 = -53992560. Round n to the nearest one million. 10000000 Suppose -3f - 15 = -6f. Suppose -ft - 52367632 + 146867632 = 0. Round t to the nearest one million. 19000000 Let g = -276.0111 + 276. Round g to 3 decimal places. -0.011 Let a = -5 + 0. Let f = a + 8. Suppose -3n = -v + fv + 569996, -2n - 379994 = 3v. Round n to the nearest one hundred thousand. -200000 Let w = 4.36 - 4.36000199. What is w rounded to 7 decimal places? -0.000002 Let s = 0.028 - 59.028. Let i = 58.9999921 + s. Round i to 6 dps. -0.000008 Let t(r) be the first derivative of r3/6 - 2r*2 + 3r - 2. Let u(h) be the first derivative of t(h). Let s be u(3). Round s to the nearest 10. 0 Let c = -0.01 + 13.01. Let g = 12.999993 - c. Round g to 5 dps. -0.00001 Let c = -117.999906 + 118. What is c rounded to 5 decimal places? 0.00009 Let u = 1366040 + -1366039.98436414. Let n = -44.01550086 + u. Let x = n + 44. What is x rounded to five decimal places? 0.00014 Let k = 129 - 129.000127. What is k rounded to five dps? -0.00013 Let h = -3192.0683 - -3190. Let g = -2.06 - h. What is g rounded to three decimal places? 0.008 Let f = -891.9999571 - -892. What is f rounded to 6 dps? 0.000043 Let h = 3 + -1. Let p be (2 - (h - 0)) + 4. Round p to the nearest ten. 0 Suppose 4h = 3v + 32 + 9, 2h - 4v = 28. Let a be 1/(-2) + 4/h. What is a rounded to 6 dps? 0 Let s = 24 - 26. Let a = -2.8 - s. Round a to one dp. -0.8 Let a = -214.0234 + 214. Round a to three dps. -0.023 Let a = -84 + 85.73. Let n = a + 24.67. What is n rounded to the nearest integer? 26 Let u = -66 + 65.924. Round u to 1 decimal place. -0.1 Let l = 12113.7309 - 12113. Let b = -0.0314 + l. Let m = -0.7 + b. Round m to three dps. -0.001 Let l = 23.87 - 21. What is l rounded to one decimal place? 2.9 Let o = 121 + -4. Round o to the nearest ten. 120 Let f = 11.00072 - 11. What is f rounded to four decimal places? 0.0007 Let k = -3.39815 + 3.4. Round k to four decimal places. 0.0019 Suppose -q - 12 - 8 = -3t, -3t + 4q + 35 = 0. Let u(r) = -r + 5 + 9r*2 - t. Let m be u(4). What is m rounded to the nearest 100? 100 Let w(q) = 3549997q - 12. Let u be w(-4). Round u to the nearest 1000000. -14000000 Let u = 0.04 + 0. Let c = u + -0.84. Let w = -0.800006 - c. Round w to five dps. -0.00001 Let j = 1109 + -1073.54. Let h = 35 - j. Round h to 1 decimal place. -0.5 Let u be (-10 + 5 - -2) + (-1820006)/(-2). What is u rounded to the nearest one hundred thousand? 900000 Let c = 4481.8 + -4474.800025. Let b = -7 + c. What is b rounded to five decimal places? -0.00003 Let a = -0.98 + 1.492. What is a rounded to one decimal place? 0.5 Let a = 159.0000396 - 159. What is a rounded to 5 dps? 0.00004 Let u be 13410006/15 + ((-30)/(-25))/(-3). What is u rounded to the nearest 100000? 900000 Let y = 0.08086 - 0.0408. Let m = 19 - 18.96. Let j = m - y. What is j rounded to 4 dps? -0.0001 Let z = -2.2 - -2.02. Let b = 407725 + -407725.180009. Let x = z - b. What is x rounded to 6 dps? 0.000009 Let v = 69 - 134. Let j = v + 73.8. What is j rounded to the nearest integer? 9 Let a be (-2)/(-8) + 2286/(-24). What is a rounded to the nearest ten? -100 Let x = -1.3 - 4.18. Let u =	{ "pile_set_name": "DM Mathematics" }
0). Round t to the nearest 100000. -800000 Let t = 21209.8 - -79583.2. Let l = 100793.056023 - t. Let h = -0.056 + l. What is h rounded to 5 decimal places? 0.00002 Let i = 1531 - 571. What is i rounded to the nearest 100? 1000 Let y = -58 - -95. Let k = -95 + 50.8. Let w = y + k. What is w rounded to 0 decimal places? -7 Let n = 81.9999846 - 82. Round n to 6 dps. -0.000015 Let t = 10 - 9.999994. Round t to 6 decimal places. 0.000006 Let w = -866489 + 1618355. Suppose -4831866 = 4m - w. Round m to the nearest 100000. -1000000 Let q = -1 - -2. Let w = 320529 + -530527. Let o be (0 - q) + w + -1. Round o to the nearest ten thousand. -210000 Let x = 156.9 - -22.1. Let g = 180.19 - x. Round g to 1 decimal place. 1.2 Let w = 670633.604 + -671807. Let f = -1168 - w. Let z = 0.004 + f. Round z to the nearest integer. 5 Let y = -20.9 + 3.9. Let f = y - -17.32. Round f to one dp. 0.3 Suppose 0 = 2q + 3d - 28871, -2q + 13822 = 4d - 15048. Suppose -n - q = 963. What is n rounded to the nearest 1000? -15000 Let k = 0.06 - 0.08. Let c = k + 0.0200048. Round c to 6 decimal places. 0.000005 Let y = -258.7 + 238. Round y to zero decimal places. -21 Let y be 3195(-28)/42. Round y to the nearest one hundred. -400 Let n = 3 + -2.81. Let h = n + 1.921. Let l = 2.1 - h. Round l to 3 decimal places. -0.011 Let p(r) = -165r3 + r2 + 5r + 11. Let d be p(7). What is d rounded to the nearest 1000? -57000 Let p = 92.9999278 - 93. Round p to 5 decimal places. -0.00007 Suppose 0k - 5 = k + a, -k - 5a - 13 = 0. Let c be 2/(4 + k + 0). Let s be (-1)/1c - -1100002. What is s rounded to the nearest 1000000? 1000000 Let j = 11111138 - -3214272. Suppose -o = 5y + 5800015, -4y + 14674578 = -5o - j. Round o to the nearest one million. -6000000 Let s(n) = n2 - 3n + 4. Let p be s(3). Suppose -3d + 4a - 479980 = 0, 9a - pa = -25. Round d to the nearest one hundred thousand. -200000 Let z = -9 + 14. Suppose -za = -113203 - 326797. Round a to the nearest ten thousand. 90000 Let u = 15.35 - -2.75. What is u rounded to 0 decimal places? 18 Let p = 12 + -11.1. Let c = p - 0.886. Let k = 0.01358 - c. Round k to four decimal places. -0.0004 Let p = 4 + -4.8. Let t = p - -0.1. Round t to 0 dps. -1 Let z = -424203 - -424232.00017. Let v = 29 - z. Round v to 4 decimal places. -0.0002 Let j = 0.92 + -0.92000061. What is j rounded to 7 decimal places? -0.0000006 Let l = -1075 + 1074.083. Let v = 0.9 + l. Round v to two decimal places. -0.02 Let c = -704.0698 - -704. Let k = -0.07 - c. Round k to 4 decimal places. -0.0002 Let o = -87.8 - -78. What is o rounded to zero dps? -10 Let f be (-8)/(-6)3790435/58. Round f to the nearest one thousand. 38000 Let r(p) = 3p - 22442200. Let k(a) = -4a + 22442201. Let d(n) = 4k(n) + 5r(n). Let t be d(0). Let s = t + 15942196. Round s to the nearest one million. -7000000 Let z = 589329 - -279570. Let f = z + -370911. Let y be (-2)/(-5) + f/30. Round y to the nearest 1000. 17000 Let p = 17393 + 36607. Suppose 3t - t = p. What is t rounded to the nearest ten thousand? 30000 Let c = -0.06 - 0.01. Let a = -83 + 82.927. Let k = c - a. Round k to 3 dps. 0.003 Suppose 3v - 21 = -4y - 2v, 2y = 2v + 6. Let t(z) = 5 + 4 - 8z - y + 4. Let g be t(9). Round g to the nearest ten. -60 Let i = -19.06 - 114.24. Let g = 156 + i. What is g rounded to zero dps? 23 Let c be 2/8 + 12065635/4. Let s = c + 4383611. Suppose 2b + 2k = 3k - 14800005, -4k + s = -b. What is b rounded to the nearest one million? -7000000 Let k be 2/4-15164. What is k rounded to the nearest 100? -1200 Let h = 2.28 - 2.1. Let u = -0.37 + 0.08. Let p = u + h. What is p rounded to one decimal place? -0.1 Let a = 5.4 - 5.4067. Round a to three decimal places. -0.007 Let u = -0.06 - 5.04. Let z = u - 1.6. What is z rounded to the nearest integer? -7 Suppose 24 = 3s - v - 4v, -3s = 3v. Let t be s/((-213)/70 - -3). What is t rounded to the nearest one hundred? -100 Let k = -2.872 - 1374.128. Let l = k + 1376.9317. Let t = 0.079 + l. Round t to 3 decimal places. 0.011 Let y = 12 + -12. Suppose -3300 = 3h - yh. Round h to the nearest 1000. -1000 Let k = -0.06 + 0.07. Let m = k + -0.013. Round m to two dps. 0 Let k = -1456.11673 - -1395.3574249. Let d = -61.05931 - k. Let l = d - -0.3. What is l rounded to six dps? -0.000005 Let m = 1832712808385149187 + -1832712817831062804.00000067. Let p = m - -9445913708. Let y = p - 91. What is y rounded to 7 dps? -0.0000007 Let a = -89 - -89.83. What is a rounded to 1 dp? 0.8 Let s(g) be the first derivative of 6511g2/2 - 3g + 2. Let x be s(3). Suppose 4h = -470 - x. What is h rounded to the nearest ten thousand? -10000 Let p = -0.21 - 2.79. Let c = p + 2.999905. Round c to 5 dps. -0.0001 Let o = -21.00098 - -21. What is o rounded to 4 decimal places? -0.001 Let n = 31 - 2. Let l = 5693069019.00000051 - 5693069048. Let c = l + n. What is c rounded to 7 decimal places? 0.0000005 Let m = 155188.1 - -3388428. Let z = 3543568.100054 - m. Let n = z - -48. What is n rounded to 5 dps? 0.00005 Let i = -0.8 + -0.2. Let a = 1.02 + i. Let c = -1.58 - a. Round c to one decimal place. -1.6 Let s = -47217696.0000045 - -47217680. Let q = 14.5 - -1.5. Let c = q + s. What is c rounded to six decimal places? -0.000005 Let y = -2.12 - 0.37. What is y rounded to one decimal place? -2.5 Let r = -79.9895 + 80. What is r rounded to 2 dps? 0.01 Let y = 1.072 + 0.032. Let p = y - 1.29. Let z = p - -0.13. Round z to 2 dps. -0.06 Let b = -0.96 - 184.04. Let t = 47 + b. Let l = -138.114 - t. What is l rounded to two dps? -0.11 Suppose f - 2 = -3f - 2p, -2f - 4p = 14. Let a be (1 - f - -1)-2. Suppose 20239 = -ag + 226239. What is g rounded to the nearest ten thousand? 100000 Let t be (-4)/18 + (-396372)/(-54). What is t rounded to the nearest 1000? 7000 Suppose -5 - 1 = -3l, 0 = -2f - 2l + 176. Round f to the nearest 10. 90 Let h = -1233 - -1233.09996. Let m = -0.1 + h. What is m rounded to 4 decimal places? 0 Suppose 0 = -4g + 4h + 24, 5h = 5g + 2h - 22. Suppose -c + 14 = g. Let m be (-4798)/6 - 4/c. Round m to the nearest one thousand. -1000 Suppose 726000 = -2k - 4k. What is k rounded to the nearest 10000? -120000 Let s = -8 + 5. Let g be 111968 + 2(2 + s). Suppose -m + 38966 = g. Round m to the nearest ten thousand. -70000 Let y = 0.032989 - 0.033. What is y rounded to five decimal places? -0.00001 Suppose -3n = 2q - 21, n + q - 2 = 6. Let h be 3752/n + (-6)/15. What is h rounded to the nearest one hundred? 800 Let c = -0.385 + -8.135. Let s = -0.88 + c. Round s to the nearest integer. -9 Suppose 0 = -3s + 3b + 360000, -2b + 6b = 0. Round s to the nearest one hundred thousand. 100000 Let b = 6.904 + -7. Round b to two dps. -0.1 Let y = -13608616 + 32408616. Suppose x = 5x - y. Round x to the nearest 1000000. 5000000 Let w = 0.37 + -0.18. Let d = 0.19000015 - w. Round d to 7 dps. 0.0000002 Let i = -1 - -1.2. Let d = -9 - i. Let v = -2 - d. Round v to zero dps. 7 Let f = 41862701726989699.0000057 - 41862699791223761. Let k = f - 1935766070. Let i = k - -132. Round i to 6 dps. 0.000006 Let n = 3.4 - 3.564. Let q = 0.1640119 + n. Round q to six dps. 0.000012 Let y = -0.22 + -1.84. What is y rounded to one dp? -2.1 Let h = 65 - 17. Let p = 222102136.9999942 - 222102089. Let s = h - p. Round s to six decimal places. 0.000006 Let p = 9 + -9.00026. Round p to four decimal places. -0.0003 Let h = 0.4 + 0.6. Let w = h + -0.9. Let k = w + -0.10000007. Round k to seven decimal places. -0.0000001 Let u = 1.7 + 5.3. Let c = u + -7.016. Round c to two dps. -0.02 Let n(m) = -m + 3. Let h be n(-6). Let t(p) = 5p + 12. Let s be t(h). What is s rounded to the nearest 10? 60 Suppose -20 = 2a - c, 5a + 18 = -2c - 14. Let g = a - -13. Suppose gq - 440 + 40 = 0. What is q rounded to the nearest 10? 80 Let s = 16881 - 16880.83981. Let g = 2.83993 + s. Let l = -3 + g. What is l rounded to 4 decimal places? 0.0001 Let c be (1 + -10)(-5)/15. Let k be 6(55000/c - 0). Round k to the nearest 100000. 100000 Let t = 5.9 - 11. Let f = t - -4.81. Let z = 1.03 + f. What is z rounded to 1 decimal place? 0.7 Suppose b - 198 + 657 = 3g, -g + 3b = -161. Suppose -460 = -6*q + g. What is q rounded to the nearest ten? 100 Let g = -5.5 + 0.5. Let v = g	{ "pile_set_name": "DM Mathematics" }
q + 14 = 0, 0 = 3x + 2q + 11. Let d = 21 - x. Let f = d + 12. What is the tens digit of f? 3 Let j = 16 + -10. Let g = 88 - 89. Let b = g + j. What is the units digit of b? 5 Let y(c) = -c*3 - 3c*2 - 2c + 1. Let s = 9 - 12. Let i be y(s). Suppose 5h - 27 = 2q + 63, 5q = -2h + i. What is the units digit of h? 6 Let y(t) = 0t2 + 5 + 3t*3 - t + 4t - 2t2 + 4t*2. Let c be y(-2). Let p = 28 + c. What is the units digit of p? 1 Let s(v) = 1 + 7v + 8 - 12. Let a be s(11). Suppose 0z - a = -2z. What is the units digit of z? 7 Let b(v) = 6v2 + v - 1. Let w be b(2). Suppose 65 = 5t - w. Suppose -2l + 5 = -l, -g + 5l - t = 0. What is the units digit of g? 7 Let z(q) = q*2 - 12q - 14. Let i = -26 + 40. What is the units digit of z(i)? 4 Let y(t) = 6t + 77. What is the units digit of y(6)? 3 Let s = 28 + 28. Let t = s - 30. What is the units digit of t? 6 Let p(q) = -q3 - 9q*2 - 6q + 21. Let o be p(-8). Suppose -ob = -5v + 735, 5v - b = 2v + 443. What is the units digit of v? 8 Suppose 0 = 16t - t - 2130. What is the tens digit of t? 4 Suppose 853 + 326 = 3n. What is the hundreds digit of n? 3 What is the tens digit of ((-1307)/(-9) - -2) + (-16)/72? 4 Let g(x) = -x*3 - 23x*2 + 30x - 8. What is the hundreds digit of g(-25)? 4 Suppose 0 = -w - 5 + 3. Let l = 1 - w. Let f(j) = 3j + 2. What is the units digit of f(l)? 1 Suppose 0 = a - 7 + 8. Let j be (-24)/(-30) - a/5. What is the tens digit of 71 + j(3 - 1)? 7 Let i be (04/12)/(-1). Suppose -r + ir - 246 = -5z, 2r = 4z - 198. What is the tens digit of z? 4 Let a(v) = -v2 - v + 11v*2 + 0v*2. Suppose 6f = f + 10, -z + f = 3. What is the tens digit of a(z)? 1 Suppose 3i - 839 = -n, -12i + 16i + 3n - 1117 = 0. What is the hundreds digit of i? 2 Suppose -3s + 7899 = -4l, -4s - 5l + 10525 = -8l. What is the thousands digit of s? 2 Let k(v) be the first derivative of 43v*2/2 - 2v + 2. Let b be 36/(-162)18/(-4). What is the units digit of k(b)? 1 Let q = 239 - -103. Suppose 3h - q = -3z, -3z + h + 183 = -163. What is the tens digit of z? 1 Suppose -2c + 3x + 3666 = 7x, 3c + 3x - 5514 = 0. What is the units digit of c? 3 Let a(g) = -8g2 - g2 + 3g2 - 4g2 + g3 - 14 + 4g. Let o be a(10). Suppose -30 - o = -4w. What is the units digit of w? 4 Suppose -6z + 3z = -5c - 3111, z - c = 1039. What is the hundreds digit of z? 0 Let d be (-2 + 1)/((-1)/7). Let p = d + 70. Suppose 3z - 25 = p. What is the tens digit of z? 3 Let j = 7 - 5. Let o(z) = -z + 144. Let c be o(0). Suppose jp = -p + c. What is the tens digit of p? 4 Suppose -6 = -9k + 12. Suppose 4p + 5b - 636 = 0, 3b = kp - 4p + 316. What is the hundreds digit of p? 1 Let k = 10 + -6. Let d = k + -11. Let r = d - -9. What is the units digit of r? 2 Let s(q) = -2q*2 + 11q - 13. Let x be s(3). What is the units digit of -9x/(-4)(11 - 1)? 5 Let s(y) = 2y3 + 5y*2 + 8y + 4. What is the units digit of s(4)? 4 Suppose 0 = -4k + 8k + 4g, 4k + 2g - 10 = 0. Suppose -kc + 27 = -5m - 63, 58 = 3c + m. Suppose 0a - c = -a. What is the units digit of a? 9 Let j(o) = 1093o*2 - 5o + 4. What is the tens digit of j(-2)? 8 Let l(k) = 2k - 5. Let v be l(4). Let g(o) = -o3 - 3o*2 + 16o - 15. Let s be g(-7). Suppose 4b - vf - 29 = s, -b = -f - 24. What is the tens digit of b? 2 Suppose z - l - 217 - 283 = 0, 0 = -2l - 4. What is the hundreds digit of z? 4 Let j(k) = 38k - 12k + 7 - 22k. What is the tens digit of j(19)? 8 Let b be (-1 - 0)(0 - 2). Suppose 2w - 230 = -bg + 6g, 0 = 4g + 8. What is the tens digit of w? 1 Let r(i) = -i + 18. Let p be r(6). Suppose t - 58 = -3m, -3t + 4m + 160 = p. What is the units digit of t? 2 Suppose -3u + 11557 = -5g, 7g - 6g = -3u + 11545. What is the tens digit of u? 4 Let o = -20 + 23. Suppose 0k + ok - 5c - 23 = 0, 5k = -3c - 7. What is the units digit of (24/(-40))/(k/(-10))? 6 Suppose -3g + 1484 + 1063 = 0. What is the units digit of g? 9 Suppose -4g - g + 757 = c, 0 = -2g - 5c + 312. Let q = g + -59. What is the units digit of q? 2 Let i = 60 - 56. Suppose 2s + 12 = 2v, -2v = 3v - 2s - 18. Suppose -j = -2c + i, -vj + c - 2c = -17. What is the units digit of j? 6 Let u(z) = z*3 + 17z*2 - 19z - 19. Let d be u(-18). What is the tens digit of (0 - d) + (-7)/(14/(-180))? 9 Suppose l - 105 = -2l. Let u = -214 - -192. Let o = u + l. What is the tens digit of o? 1 Suppose -2c + 490 = 3c. Suppose 3h - 6h = -30. Suppose -3g - c = -hg. What is the tens digit of g? 1 Suppose -1036r + 1038r - 1018 = 0. What is the units digit of r? 9 Suppose -68 = 5m - 28. Let z(g) = g + 2. Let h(l) = l*2 + 13l - 6. Let i(n) = -h(n) + 5z(n). What is the units digit of i(m)? 6 What is the thousands digit of 4/(-7) + 412800/336? 1 What is the units digit of (-37723)/(-85) - (-2)/10? 4 Let m = 2989 + -1456. What is the units digit of m? 3 Let f(b) be the second derivative of 7b*3/6 + 26b. What is the units digit of f(14)? 8 Let b(g) = 3g + 6. Let s be b(-1). Suppose -5w + 4z + 206 = -2w, -4w + 258 = sz. What is the tens digit of w? 6 Let g(s) = -36s3 + 8s*2 - 4s - 3. What is the thousands digit of g(-5)? 4 What is the tens digit of (-225 - 11/11)(-2)/4? 1 What is the units digit of (-1)/(97662/16278 - 6)? 3 Suppose j + 2c = 90, 304 + 122 = 5j + 4c. Suppose 5b = b - 2d + j, -6 = -2d. Suppose 2a - 22 - b = 5i, -5a = -i - 68. What is the units digit of a? 3 What is the units digit of 4/(-50) + (-245014)/(-175)? 0 Let o = 935 - 724. What is the tens digit of o? 1 Let q = -14 + 102. Suppose q + 177 = 5u. What is the units digit of u? 3 Let t be (10/4 - -1)2. Suppose 2k = 5n + tk - 115, 3k = 15. Suppose -4s = -3s - n. What is the units digit of s? 8 Suppose 5d - 13 - 7 = 0, d = -2p + 314. Suppose b - p = -4i, 0i - 692 = -4b + 2i. What is the hundreds digit of b? 1 Suppose 0s - 2s = l - 56, s + 269 = 4l. Let x = l - 25. What is the units digit of x? 1 Suppose -2c = -c + 1116. What is the tens digit of ((-2)/(-3))/((-24)/c)? 3 Let o(w) = 8w - 172. Let h(d) = -3d + 57. Let m(f) = -11h(f) - 4o(f). What is the tens digit of m(25)? 8 Let q be -34((-1)/2 + -2). Suppose -5o - 163 = -4y, -3o = 2y + 2y + q. Let j = -17 - o. What is the tens digit of j? 1 Let a be 2(2/1 - 4). Let u(d) = -14d + 3. What is the units digit of u(a)? 9 Suppose -3304 - 953 = -11c. What is the hundreds digit of c? 3 Suppose -s = 3s - 5k - 214, 0 = -3k - 6. Suppose -2d + 6 = -3w, 0 = d - 3w + 4w + 2. Suppose -2i - i + s = d. What is the units digit of i? 7 Let p(t) = t + 4. Let m be p(0). Suppose -x = mx. Suppose xu = -3u + 75. What is the units digit of u? 5 Let z(o) = 130o2 + 2o + 8. What is the hundreds digit of z(-2)? 5 Suppose 3c + 44 = f, c + 4c + 3f = -50. Let t be (-3)/(-4) + c/(-52). What is the units digit of 4 - ((t - 4) + -37)? 4 Let a(x) = x3 + 5x*2 + 12x - 45. What is the hundreds digit of a(5)? 2 What is the hundreds digit of (-8710)/39(-495)/25? 4 Let i = 5597 + -3181. What is the units digit of i? 6 Let r(g) = 4g*3 - 1. Let y be r(-1). What is the units digit of y/1(0 - 3)? 5 Let m = -1 + 11. Suppose m = -l + 108. What is the tens digit of l? 9 Let g(f) = -2f3 - 7f*2 - 2f + 9. Suppose -u - 2a - 10 = 0, -11 = -5u + 2a - 1. Let r = -4 - u. What is the tens digit of g(r)? 3 Let p(f) = 51f*3 + 22f*2 - 70f + 2. What is the thousands digit of p(3)? 1 Let f(k) = -k*3 + 2k - 1. Let a be f(1). Let w(r) = 0 - r - 5r + a. What is the units digit of w(-1)? 6 Suppose 0 = 2i + 5x - 7, x = -5i - 0i + 29. What is the units digit of (4/i)/((-24)/(-54))60? 0 Let r = 248 - 449. Let t be r/(-3) - (2 - -2). What is the units digit of (4/(-7))/((-9)/t)? 4 Let w be (-10)/45 + (-492)/(-27). Let b = w + 3. What is the units digit of b? 1 Let b(g) = 4g - 7 + 9 - 6. What is the tens digit of b(14)? 5 What is the units digit of (-2)/(-22) + (-6588)/(-11)? 9 Suppose -28581 = -16f + 9f. What is the hundreds digit of f? 0 Suppose -10h + 5h = -275. Suppose 0 = -2z + 4, -3p = -0z - z - h. Let g = 44 - p. What is the tens digit of g? 2 Suppose 73 = 3u + w, -2u + w = u - 65. Suppose -10 = -3*a + u. What is the tens digit of a? 1 Suppose -	{ "pile_set_name": "DM Mathematics" }
-30g + 1214. Is g prime? True Suppose q - 11q = 22700. Is (-5)/202q a composite number? True Let d = 50 - 46. Suppose q + 762 = dq. Is q a composite number? True Let j = 9 - 5. Suppose jh - h - 9 = 0. Suppose hi + z = 109, -5z - 12 = -2. Is i prime? True Let u(g) = 392g - 17. Suppose -35s + 36s - 3 = 0. Is u(s) a composite number? True Let f(v) = -117v - 716. Is f(-47) prime? True Is (-2)/(7/((-91658)/4)) prime? True Let t(y) = -3y - 7. Let j be t(-8). Let m = -17 + j. Is -191(4 - (m + 5)) composite? False Suppose -4y = 11100 + 5676. Let q = y - -7787. Is q composite? False Suppose 2g = 7g - 25. Suppose 0 = -gi - i + 2502. Let r = i - 200. Is r a prime number? False Let q = 21 + -24. Let x be -13(-2)/1 - q. Let i = x - -2. Is i a prime number? True Is (-60)/(-270) - (-26287)/9 a prime number? False Suppose 7 + 8 = 5z. Suppose 485 = zt - 442. Is t a composite number? True Let p(q) = -518q + 3. Suppose 4j - 1 = 5j. Is p(j) a prime number? True Suppose -314972 = -9c - 107189. Is c prime? True Let x be 1 + (-3 + 2)/(-1). Suppose -xr - 2r + 5s + 10 = 0, 2s = -r - 4. Suppose -2t - 15 + 121 = r. Is t prime? True Suppose 11k = -10k - 126. Let b = -28 - -40. Is 9/k(-904)/b prime? True Let n = -251 + 447. Is 3 + -4 + (n - 4) a prime number? True Let o = 1217 + -316. Suppose 6d - 1325 = o. Is d prime? False Is ((-1416)/4 - -7)/(4/(-20)) composite? True Let w = -60 - -91. Suppose 34r - 423 = wr. Is r a prime number? False Let h(x) = 4044x2 + 29x - 51. Is h(2) a composite number? False Let f(d) = d*3 + 21d*2 - d - 23. Let y be f(-21). Is ((-42)/(-12))/(y/(-508)) a composite number? True Let p(g) = -610g3 - g2. Let q be p(-1). Suppose 2386 + q = 5y. Let u = y + -421. Is u a composite number? True Suppose -u + 3y + 2 = -4, -5u = 4y - 11. Suppose 0 = -4x + un + 27, -4x - n + 22 = n. Is ((-4)/x)/(40/(-108060)) a composite number? False Suppose -w = 1 + 2. Let o be (10/(-4))/(w/6). Suppose -30 - o = -5y. Is y composite? False Suppose 2b - 5d = -193, 0 = 3d - 7d + 4. Let a(c) = 89c - 2. Let n be a(-2). Let h = b - n. Is h composite? True Let f(h) = 6h + 4. Let p be f(1). Suppose -5864 = pl - 14l. Is l a prime number? False Let a = 28 - 33. Let t(x) = -36x + 22. Is t(a) a composite number? True Suppose 0 = 3g + 2g + 2b - 14309, g - 4b = 2853. Is g a prime number? True Let l = 57994 + -20465. Is l prime? True Let h be (30/25)/(2/(-20)). Let r be 8/(44/h + 3). Is 2/(-4) + (-2226)/r a composite number? True Let a(c) = 200c - 4. Let k be a(-3). Let n = k + 1023. Is n a prime number? True Let o(r) = -245r - 71. Is o(-6) composite? False Let m(g) = 121g*3 + 2g*2 - g - 1. Let y be m(3). Suppose y - 1082 = 3b. Is b a prime number? True Let k = 21 + -21. Suppose x = -kx + 766. Suppose 41 = -5w + x. Is w prime? False Let o = 29 + -25. Suppose 5v + t = ot + 4718, -4717 = -5v + 2t. Is v composite? True Suppose -q = 4w - 3q - 35994, -q - 3 = 0. Is w prime? False Suppose -5n + 16180 = -925. Is n a prime number? False Suppose 2004 = 6n - 0n. Let z = n - 87. Is z composite? True Suppose 0 = 4r + p - 6p - 1, 0 = -2r - 2p - 22. Let j be (-2 - 4)/(r/4). Suppose -657 = jd - 5d + 4a, -3d + 2056 = 5a. Is d prime? True Let g(h) = h*2 - 11h + 7. Let v be g(9). Let n = v + 11. Suppose n = 2j - 8 + 2, -3o + 3j + 1914 = 0. Is o composite? False Let c = -3562 - -5799. Is c prime? True Let a(s) = 3s*2 + 43. Let u be a(0). Suppose -u = l - 2l. Is l a composite number? False Let w be 26/5 - 7/35. Suppose -y - d = y + 122, -287 = wy - 2d. Let g = 84 + y. Is g a composite number? True Suppose -489 = -26y + 23y + d, -326 = -2y - 4d. Is y a prime number? True Let c be (16/(-5))/(8/(-20)). Is (1618/c)/((-1)/(-4)) prime? True Suppose -1172 = 6u - 4556. Suppose 7y - u - 535 = 0. Is y prime? True Let l(b) = -14b + 25. Let t be l(-9). Let k = -54 + t. Is k a composite number? False Suppose 0 = 8w - 13129 - 22143. Is w composite? False Let a(u) = -9u3 - 2u*2 - 19u - 1. Is a(-12) a composite number? True Let p(b) = -244b - 3. Let d be p(-1). Let t = 460 - d. Is t composite? True Let n(f) = 463f*2 + 24f - 70. Is n(3) a prime number? False Let n(f) = f*2 - 7f - 10. Suppose 3q = 2 - 14. Is n(q) prime? False Suppose -2l = 4d + 2l - 12, -3l = 4d - 9. Suppose d = -3p + 319 + 392. Is p prime? False Suppose -6p + 14p = 4168. Let q = -360 + p. Is q a composite number? True Is (-4)/8-1 - (-28285)/2 prime? True Let i = 27779 - 10548. Is i composite? False Let m(b) = -b*2 - 12b - 12. Let r be m(-11). Let k(i) = 3i + 4. Let f(o) = o. Let t(a) = rk(a) + 4f(a). Is t(18) a prime number? False Let d be (-1 + 0)(1 + -1221). Let f(r) = 13r - 23. Let w be f(2). Suppose -q - 4q = wn - d, -5n + 5q + 2100 = 0. Is n a composite number? True Let c(x) = 42x - 14. Let r(a) = 14a - 5. Let y(s) = -4c(s) + 11r(s). Let k be (-3)/((10/(-6))/(-5)). Is y(k) a composite number? False Suppose -671342 = 41f - 55f. Is f a composite number? True Let b(w) = -2w*3 - 5w*2 + 8w - 1. Let h be (-1)/4 + (-368)/64. Is b(h) prime? False Suppose 3t + 132 = 4d, -179 = 5t - d + 41. Is (t/4)/((-2)/821) prime? False Let p(x) = 15x3 - 6x*2 + 6x + 2. Is p(5) prime? False Let f = -145 - -149. Suppose -1197 = -5i - fi. Is i a composite number? True Is 2500/28 + (-10)/35 composite? False Suppose 113323 = 3w - 5b, -b + 151120 = 4w - 2b. Is w composite? False Let a be (-1 - -1)/(2/2). Suppose -4j = -d - 8, 4j - 56 = -3d - aj. Suppose -c - d = -134. Is c a composite number? True Is -76771(2/(-5))/(94/235) a composite number? False Suppose -10x + 11242 + 15368 = 0. Is x prime? False Suppose -8q + 2875 = -3q. Let p = q + -175. Let c = 234 + p. Is c composite? True Suppose 0 = 4w - 2g - 7 + 1, 2w = -4g + 18. Let i be (w - 1)/(10/455). Suppose -2a - 23 = -i. Is a prime? False Suppose a = -14a + 60. Suppose 3m = av + 3135, -m + v = 5v - 1061. Is m a composite number? False Let m be (48/(-30))/((-12)/5 - -2). Is (-4 + 7 - m) + 1 + 2609 a prime number? True Suppose 11z - 10156 = 16431. Suppose -7m - 646 + z = 0. Is m a composite number? True Let m = 2445 - 1342. Is m a prime number? True Let g = 80594 + -36421. Is g prime? False Let m = 115146 + -72505. Is m a composite number? False Let w(l) = 22176l*2 + 31l + 32. Is w(-1) a composite number? True Let h(o) = -11o + 7. Let y = 12 - 18. Let z be h(y). Suppose -r + z = -2k - 58, -2r + 254 = -2k. Is r a composite number? True Suppose -3v + 23931 = -3d, -30v + 28v + 4d = -15950. Is v a prime number? False Suppose -4z + 234 = -z. Suppose 2f = 5f - 3. Suppose -j - f = -z. Is j prime? False Suppose -d + 3047 = -5l, 2d - l = -3l + 6070. Suppose -d = -9r + 374. Is r a composite number? False Let r be (-24)/(-2)(-8)/(-32). Suppose 5j = 6j - r. Suppose jn = 5k + 370, -n = -k - 176 + 56. Is n composite? True Suppose -5b = 4w - 8b - 2642, -4 = -2b. Let k = 1295 - w. Is k composite? True Suppose -5n - 4p + 22 - 94 = 0, -4n - 2p = 54. Let a(g) = 5g - 1. Let z(o) = -5o + 2. Let x(q) = -4a(q) - 3z(q). Is x(n) prime? False Suppose 11 = -8p + 3. Is p/(5708/1903 + -2 + -1) a composite number? True Suppose 2d - 9a + 8a = 35140, 87851 = 5d - 3a. Is d composite? False Let g(j) = -21j - 5. Let i be 3/((-18)/(-20))3. Suppose 6m = m - i. Is g(m) a prime number? True Suppose -3v + 30174 = g, g + g = -3v + 60351. Suppose 12n - 1995 = g. Is n a prime number? False Let w(s) = -s2 + 10s. Let t be w(5). Suppose 20l - tl = -100. Suppose -k - n + 531 = 0, l = -2n - 3n. Is k composite? True Suppose -3883 - 598 = -z. Is z a prime number? True Suppose -2f - 5i + 15 = 0, -16 = 3f - 3i + 14. Let k(x) = 56x2 - 18x + 9. Is k(f) a composite number? False Let q(j) = -2j2 + 33j - 3. Suppose f + 4 = 0, 3i - 6i + 64 = -4f. Is q(i) prime? True Is (14/(-7))/(22/(-47308)) composite? True Let w be 2104/10 + (-10)/25. Let b = w + -143. Let q = b - -22. Is q a composite number? False Let r(n) = 1. Let t(d) = -310d - 8. Let p(z) = 5r(z) + t(z). Is p(-1) composite? False Suppose u - 3665 = -4u. Let m(v) = -76v - 6. Let w be m(-1). Suppose -u + w = -3q. Is q prime? False Let y be -14*18/(-24). Let j(t) =	{ "pile_set_name": "DM Mathematics" }
f 13460 and 55. 5 Calculate the greatest common divisor of 1879560 and 640. 40 Calculate the greatest common factor of 106942 and 44. 22 Calculate the greatest common divisor of 132 and 9348. 12 Calculate the highest common factor of 8 and 1905832. 8 What is the greatest common divisor of 1092 and 3675? 21 Calculate the highest common divisor of 1806579 and 9. 9 Calculate the highest common divisor of 533996 and 48. 4 What is the highest common factor of 18126 and 12654? 342 Calculate the highest common factor of 621659 and 269. 269 What is the greatest common divisor of 124 and 12652? 4 What is the greatest common divisor of 1108 and 48? 4 What is the greatest common divisor of 3 and 270591? 3 What is the greatest common factor of 3773 and 44? 11 Calculate the highest common factor of 1079184 and 48. 48 Calculate the highest common divisor of 116 and 1430222. 58 What is the highest common factor of 1200 and 3540? 60 Calculate the highest common divisor of 42048 and 13797. 657 What is the greatest common factor of 38538 and 24? 6 What is the greatest common divisor of 100 and 14380? 20 What is the highest common factor of 133246 and 34? 34 What is the greatest common divisor of 133 and 154? 7 Calculate the greatest common divisor of 3232 and 256. 32 Calculate the greatest common divisor of 175 and 427945. 35 What is the highest common factor of 252210 and 210? 210 What is the greatest common factor of 2298322 and 91? 13 What is the greatest common divisor of 25830 and 164? 82 What is the highest common factor of 1465 and 280? 5 Calculate the greatest common divisor of 3212 and 88. 44 Calculate the highest common divisor of 10142 and 1078. 22 What is the highest common factor of 12551 and 104483? 163 What is the greatest common divisor of 341455 and 10? 5 Calculate the highest common factor of 2351755 and 1655. 1655 What is the highest common divisor of 332275 and 225? 25 Calculate the greatest common divisor of 555828 and 39. 39 What is the greatest common divisor of 336 and 3464? 8 What is the highest common divisor of 136 and 10648? 8 What is the greatest common factor of 4239 and 2041? 157 What is the highest common factor of 680 and 39576? 136 Calculate the highest common divisor of 41 and 3676. 1 Calculate the highest common divisor of 3162 and 6018. 102 What is the highest common divisor of 58 and 110374? 58 Calculate the greatest common factor of 189 and 14472. 27 Calculate the greatest common factor of 140 and 194980. 20 What is the greatest common divisor of 3999 and 35346? 129 Calculate the highest common divisor of 12 and 256456. 4 Calculate the highest common factor of 76 and 18808. 4 Calculate the greatest common divisor of 688 and 11888. 16 Calculate the greatest common factor of 25038 and 1872. 234 What is the greatest common divisor of 1632 and 64362? 102 What is the greatest common factor of 429 and 663? 39 What is the greatest common divisor of 116 and 4670914? 58 What is the greatest common divisor of 2043 and 2484? 9 Calculate the greatest common factor of 31428 and 16684. 388 What is the greatest common divisor of 432 and 33318? 54 Calculate the highest common divisor of 101903 and 181. 181 What is the greatest common divisor of 21648 and 8976? 528 Calculate the highest common factor of 92484 and 28. 28 Calculate the highest common divisor of 33624 and 225094. 934 Calculate the highest common divisor of 16132 and 13024. 148 Calculate the highest common divisor of 11926 and 4556. 134 What is the highest common divisor of 41306 and 5358? 38 What is the greatest common factor of 48763 and 22? 11 Calculate the highest common divisor of 819 and 96759. 117 Calculate the greatest common factor of 5454 and 88072. 202 What is the greatest common factor of 630631 and 199? 199 Calculate the greatest common factor of 250 and 12790. 10 Calculate the greatest common factor of 1685 and 445. 5 Calculate the greatest common divisor of 82854 and 18. 18 Calculate the highest common factor of 16210 and 125. 5 What is the greatest common divisor of 533850 and 150? 150 What is the highest common factor of 316 and 1746611? 79 Calculate the greatest common factor of 85086 and 3712. 58 Calculate the greatest common divisor of 17121 and 351. 39 What is the highest common divisor of 165 and 7771940? 55 What is the highest common divisor of 533976 and 192? 24 What is the greatest common factor of 107216 and 104? 8 Calculate the highest common factor of 28 and 2706508. 28 What is the highest common factor of 5097011 and 29? 29 Calculate the greatest common divisor of 2068 and 8460. 188 Calculate the greatest common factor of 564 and 940. 188 Calculate the highest common divisor of 66638 and 31222. 466 Calculate the greatest common factor of 979 and 539. 11 What is the highest common divisor of 13 and 102132? 1 Calculate the highest common factor of 616 and 342232. 88 Calculate the greatest common divisor of 14192 and 5072. 16 Calculate the highest common factor of 591604 and 39636. 1468 What is the greatest common divisor of 957 and 1089385? 319 What is the greatest common divisor of 2346 and 810152? 782 Calculate the greatest common factor of 497130 and 70. 10 What is the highest common factor of 658 and 5875? 47 What is the greatest common divisor of 1121 and 44545? 59 What is the greatest common divisor of 114206 and 1751? 17 Calculate the highest common divisor of 282 and 16262. 94 Calculate the highest common divisor of 1240 and 25760. 40 What is the greatest common factor of 870 and 890? 10 Calculate the highest common divisor of 170541 and 63. 63 Calculate the greatest common divisor of 484 and 6688. 44 Calculate the greatest common factor of 27778 and 43. 43 What is the greatest common factor of 68541 and 27537? 201 Calculate the highest common factor of 138 and 2873298. 138 What is the greatest common divisor of 28 and 46118? 2 Calculate the greatest common factor of 1208288 and 183. 61 Calculate the highest common divisor of 45486 and 27. 9 Calculate the highest common divisor of 78 and 1615848. 78 What is the greatest common factor of 52112 and 64? 16 Calculate the greatest common factor of 82784 and 468. 52 What is the greatest common divisor of 120 and 24210? 30 What is the greatest common divisor of 1404 and 29770? 26 What is the highest common divisor of 60 and 2060730? 30 Calculate the highest common factor of 1577807 and 19096. 2387 Calculate the greatest common divisor of 5535 and 1150173. 1107 Calculate the highest common divisor of 60 and 705. 15 Calculate the highest common divisor of 1095 and 127385. 365 What is the highest common factor of 177 and 10561? 59 Calculate the highest common divisor of 788 and 373315. 197 What is the greatest common factor of 346 and 1358223? 173 What is the highest common divisor of 30 and 610? 10 Calculate the highest common factor of 189071 and 43. 43 Calculate the highest common divisor of 4410 and 1230. 30 Calculate the greatest common factor of 191731 and 109. 109 What is the highest common factor of 1750 and 2030? 70 Calculate the highest common divisor of 76 and 172197. 19 What is the highest common divisor of 1071 and 41293? 119 Calculate the highest common factor of 10461 and 3927. 33 Calculate the greatest common divisor of 7728 and 110208. 336 What is the highest common factor of 5157521 and 5305? 1061 Calculate the greatest common divisor of 2641 and 513. 19 What is the highest common divisor of 175 and 925? 25 Calculate the highest common factor of 880 and 1296. 16 What is the highest common factor of 395 and 755? 5 Calculate the greatest common divisor of 488 and 17488. 8 What is the greatest common divisor of 78 and 1590719? 13 What is the highest common factor of 2457 and 87815? 91 Calculate the greatest common divisor of 472880 and 16. 16 What is the highest common factor of 993438 and 108? 54 What is the highest common divisor of 2185570 and 20? 10 Calculate the greatest common divisor of 348 and 20242. 58 What is the highest common factor of 1421 and 5537? 49 What is the greatest common factor of 2714 and 1062? 118 Calculate the greatest common factor of 714 and 1106. 14 What is the greatest common divisor of 2695 and 36520? 55 Calculate the greatest common factor of 69472 and	{ "pile_set_name": "DM Mathematics" }
3 + 136u - 396. -4(u - 99)(u - 3)/3 Factor 3s*4 + 24s*3 - 135s*2 + 108s. 3s(s - 3)(s - 1)(s + 12) What is m in -m*3 + 1076m*2 - 288365m - 581042 = 0? -2, 539 Factor -4f3/7 - 4f*2/7 + 8f/7. -4f(f - 1)(f + 2)/7 Factor -2x*2/5 + 38x/5 + 8. -2(x - 20)(x + 1)/5 Solve -2f4/3 - 8f*3 - 32f*2 - 160f/3 - 32 = 0 for f. -6, -2 Factor 5b2 + 480b + 4300. 5(b + 10)(b + 86) Suppose -5w4 + 10w*2 - 5 = 0. Calculate w. -1, 1 Solve 2g*2/9 + 70g/3 + 392 = 0 for g. -84, -21 Factor s*3/6 - 37s*2/6 - 36s + 42. (s - 42)(s - 1)(s + 6)/6 Let q4/4 - q3/2 - 5q2 - 6q = 0. What is q? -2, 0, 6 Let 2j5 - 22j*4 + 64j*3 + 16j*2 - 288j + 288 = 0. Calculate j. -2, 2, 3, 6 Factor -3f2 - 3f + 6. -3(f - 1)(f + 2) Suppose -9o2 - 141o/5 - 18/5 = 0. Calculate o. -3, -2/15 What is s in -s*2/7 + 5s/7 - 6/7 = 0? 2, 3 Factor -2c2/13 + 22c/13 - 56/13. -2(c - 7)(c - 4)/13 Let -4g4 - 12g*3 - 4g*2 + 12g + 8 = 0. Calculate g. -2, -1, 1 Solve -z*3/2 + 2z*2 - 5z/2 + 1 = 0. 1, 2 Suppose 5p2 - 25p - 250 = 0. Calculate p. -5, 10 Solve -3g3 + 1221g*2 - 126048g + 367236 = 0 for g. 3, 202 Suppose -27b4/2 + 57b*3/4 - 3b*2/4 = 0. What is b? 0, 1/18, 1 Factor 2c*2 + 264c + 8712. 2(c + 66)2 Factor 2n*4/5 - 12n*3/5 + 2n*2/5 + 48n/5 + 32/5. 2(n - 4)2(n + 1)*2/5 Find i, given that -5i*5 + 100i*4 + 25i*3 - 500i*2 - 20i + 400 = 0. -2, -1, 1, 2, 20 Factor -3m4 + 108m*3 - 1242m*2 + 4860m - 6075. -3(m - 15)2(m - 3)*2 Let -8c*3 + 692c*2 + 1772c + 712 = 0. What is c? -2, -1/2, 89 Factor 44d3 - 404d*2 + 72d. 4d(d - 9)(11d - 2) Factor -5h3 - 210h*2 - 1125h - 1620. -5(h + 3)2(h + 36) What is f in 9f4 - 75f*3 - 54f*2 = 0? -2/3, 0, 9 Solve 3i*3 - 57i*2 + 144i = 0. 0, 3, 16 Factor 4g2 - 80g - 3200. 4(g - 40)(g + 20) Factor -n*3/4 + 5n*2/4 + 13n/4 + 7/4. -(n - 7)(n + 1)2/4 Find a such that -8a*3/19 + 10a*2/19 + 36a/19 + 18/19 = 0. -1, -3/4, 3 Factor d*2/4 - 2045d/2 + 4182025/4. (d - 2045)*2/4 Determine f so that -5103f*3/5 - 15444f*2/5 - 13579f/5 - 2738/5 = 0. -37/27, -2/7 What is q in 5q5 + 18q*4 - 13q*3 - 18q*2 + 8q = 0? -4, -1, 0, 2/5, 1 Factor 4b3 - 76b*2 + 64b + 144. 4(b - 18)(b - 2)(b + 1) Find r such that -2r*2 - 10r + 28 = 0. -7, 2 Solve -2o4 + 4o*3 + 2o*2 - 4o = 0. -1, 0, 1, 2 Factor -k*2/2 + 3k/4 + 5/4. -(k + 1)(2k - 5)/4 Solve 7q4 - 5q*3 - 16q*2 - 4q = 0 for q. -1, -2/7, 0, 2 Factor -d*2/4 + 605d/4 + 303/2. -(d - 606)(d + 1)/4 Factor t4/3 + 10t*3/3 - 16t*2 - 30t + 117. (t - 3)*2(t + 3)(t + 13)/3 Factor 4f*4/3 - 16f*3/3 - 64f*2 - 448f/3 - 320/3. 4(f - 10)(f + 2)*3/3 Find h, given that -3h*2/4 + 2013h/4 = 0. 0, 671 Factor m*2 + 6m - 72. (m - 6)(m + 12) Find o such that 2o*2/7 + 20o + 350 = 0. -35 Factor y*2 + 233y - 234. (y - 1)(y + 234) Factor -4w*3 - 288w*2 - 6144w - 40960. -4(w + 16)2(w + 40) Factor 2h3/7 - 828h*2/7 + 85698h/7. 2h(h - 207)*2/7 Find n, given that -2n*2 + 58n - 108 = 0. 2, 27 What is l in -l*3/8 - 9l*2/8 - 5l/2 - 3/2 = 0? -6, -2, -1 Factor w*5/2 + 7w*4 + 12w3 - w2 - 25w/2 - 6. (w - 1)(w + 1)*3(w + 12)/2 Factor 2v2/5 + 88v/5 + 968/5. 2(v + 22)2/5 Let -o5 + 8o*4 - 19o*3 + 12o*2 = 0. Calculate o. 0, 1, 3, 4 Find h such that -4h*4 - 64h*3 + 340h*2 + 400h = 0. -20, -1, 0, 5 Suppose -a*2/3 + 224a/3 - 3328/3 = 0. What is a? 16, 208 Determine k, given that -k*5/6 - 55k4/6 + k3 + 161k2/3 - 437k/6 + 55/2 = 0. -55, -3, 1 Suppose -36w5/5 + 296w*4/5 - 388w*3/5 - 576w*2/5 + 144w/5 = 0. Calculate w. -1, 0, 2/9, 3, 6 Factor -4x2/7 - 230x/7 - 108. -2(x + 54)(2x + 7)/7 Factor -3i*4 - 35i*3 - 21i*2 + 11i. -i(i + 1)(i + 11)(3i - 1) Solve -3s2 + 117s = 0. 0, 39 Solve -g*4 - 89g*3 + 379g*2 + 641g - 930 = 0. -93, -2, 1, 5 Let -726u2/7 + 472u/7 + 8/7 = 0. What is u? -2/121, 2/3 Suppose p*5 + 217p*4 + 858p*3 + 1282p*2 + 853p + 213 = 0. Calculate p. -213, -1 Solve -5w5/3 - 10w*4/3 + 60w*3 - 430w*2/3 + 385w/3 - 40 = 0. -8, 1, 3 Find r, given that -6r5/7 + 118r*4/7 + 320r*3/7 - 240r*2/7 - 544r/7 + 352/7 = 0. -2, 2/3, 1, 22 Let 2r5/5 - 4r*4 + 12r*3 - 16r*2 + 10r - 12/5 = 0. Calculate r. 1, 6 Solve -2o2 - 304o + 1570 = 0 for o. -157, 5 Find b, given that 5b4 - 125b*3 - 885b*2 - 1395b = 0. -3, 0, 31 Determine a, given that -4a2 - 164a + 1128 = 0. -47, 6 Suppose 4q2 + 668q - 672 = 0. What is q? -168, 1 Factor 4b3/5 + 204b*2/5 - 864b/5 + 176. 4(b - 2)2(b + 55)/5 Solve i*3/2 - 9i*2 - 61i/2 - 21 = 0 for i. -2, -1, 21 Factor -f*3/2 - 407f*2 - 1625f/2 - 406. -(f + 1)*2(f + 812)/2 Factor -z*4 + 15z*3 - 12z*2 - 28z. -z(z - 14)(z - 2)(z + 1) Let -b2/2 - 19b + 132 = 0. Calculate b. -44, 6 Find z such that 2z5/7 - 4z*4/7 - 32z*3/7 + 4z*2/7 + 30z/7 = 0. -3, -1, 0, 1, 5 Factor 34l2 - 1872l + 110. 2(l - 55)(17l - 1) Determine a so that 2a*3 - 37a*2 + 49a + 34 = 0. -1/2, 2, 17 Factor 2u4/9 + 32u*3/9 + 10u*2/3. 2u*2(u + 1)(u + 15)/9 Suppose 2t*3 + 6t*2 - 36t = 0. What is t? -6, 0, 3 Factor 3y3 - 156y*2 - 165y + 318. 3(y - 53)(y - 1)(y + 2) Factor 2z*2 + 244z + 7442. 2(z + 61)2 What is b in -b2 - 12b = 0? -12, 0 Factor 2m3 - 122m*2 + 230m + 354. 2(m - 59)(m - 3)(m + 1) Suppose 3s*3 + 1959s*2 - 3927s + 1965 = 0. Calculate s. -655, 1 Factor -5h4 + 5h*2. -5h*2(h - 1)(h + 1) Let -o5/6 - 4o*4 - 21o*3/2 + 2o*2/3 + 14o = 0. Calculate o. -21, -2, 0, 1 Determine g, given that 4g4 + 140g*3 + 384g*2 - 16g - 512 = 0. -32, -2, 1 Factor 2n4/3 + 1200n*3 + 540000n*2. 2n*2(n + 900)*2/3 Factor -2x*4 + 38x*2 - 60x. -2x(x - 3)(x - 2)(x + 5) Suppose 6x4/5 - 194x*3/5 - 554x*2/5 - 214x/5 + 28 = 0. Calculate x. -2, -1, 1/3, 35 Solve -2m3/7 + 122m*2/7 - 2368m/7 + 14848/7 = 0 for m. 16, 29 Let -3j4 - 1317j*3 - 193158j*2 - 9528252j - 9336408 = 0. Calculate j. -146, -1 Factor 2v4/9 - 376v*3/9 - 758v*2/9 - 380v/9. 2v(v - 190)(v + 1)2/9 Factor 2l*2/15 - 2l/3 + 4/5. 2(l - 3)(l - 2)/15 Factor -2s3/3 + 38s*2/3 - 66s + 54. -2(s - 9)2(s - 1)/3 Solve -2u3/3 + 352u*2/3 + 710u/3 + 356/3 = 0. -1, 178 Find v such that 2v4/7 - 6v*3/7 - 22v*2/7 + 6v/7 + 20/7 = 0. -2, -1, 1, 5 Solve 5s4/6 - s3/6 - 65s*2/6 - 47s/6 + 2 = 0 for s. -3, -1, 1/5, 4 Factor 3v2 + 96v + 693. 3(v + 11)(v + 21) What is l in 3l4 + 3l*3 - 81l*2 - 243l - 162 = 0? -3, -1, 6 Find h, given that 7h2/9 + 484h/9 = 0. -484/7, 0 Let -j5 - j4 + 5j3 - 3j*2 = 0. Calculate j. -3, 0, 1 Factor -2j*4/21 - 80j*3/21 - 50j*2/3. -2j*2(j + 5)(j + 35)/21 Let 5u*5 - 105u*4 + 195u*3 - 95u2 = 0. What is u? 0, 1, 19 Determine n so that -n3/12 + 5n2/3 - 25n/12 - 125/2 = 0. -5, 10, 15 Factor -n*2/5 - 62n - 309/5. -(n + 1)(n + 309)/5 Let 10o*3 + 83o*2 + 174o + 45 = 0. Calculate o. -5, -3, -3/10 Factor -2d4/17 + 8d*3/17 - 12d*2/17 + 8d/17 - 2/17. -2(d - 1)4/17 What is p in -5p*3 - 1175p*2 + 2365p - 1185 = 0? -237, 1 Let -4l5/3 - 12l*4 - 100l*3/3 - 36l*2 - 40l/3 = 0. Calculate l. -5, -2, -1, 0 Determine q so that -2q2 + 44q + 96 = 0. -2, 24 Factor 5s4/4 + 5s*3/4 - 5s*2 - 5s. 5s(s - 2)(s + 1)(s + 2)/4 Factor a*4/7 + 62a*3/7 - 9a2. a2(a - 1)(a + 63)/7 Determine z so that 2z5/23 + 72z*4/23 - 496z*3/23 + 348z*2/23 + 494z/23 - 420/23 = 0. -42, -1, 1, 5 Find j, given that -2j3/3 + 32j*2/9 + 182j/9 + 16 = 0. -8/3, -1, 9 Factor 3x2/7 - 27x/7 - 108/7. 3(x - 12)(x + 3)/7 Let 10p4/7 + 18p*3 + 368p*2/7 - 24p = 0. What is p? -7, -6, 0, 2/5 Solve -2j4/3 - 11j*3 + 56j*2/3 + 11j - 18 = 0. -18, -1, 1, 3/2 Find h, given that h*2/4 + 19h/4 - 30 = 0. -24, 5 Suppose -3z4 - 3726z*3 + 9z*2 + 11184z + 7452 = 0. What is z? -1242, -1, 2 Solve -11c2/6 + 2229c + 1216/3 = 0. -2/11, 1216 Find s such that 3s3 - 87s*2 + 792s - 2160 = 0. 5, 12 Solve 3a5/4 - 18a*4 + 135a*3/4 - 33a*2/2 = 0. 0, 1, 22 Let -45c**5 + 24	{ "pile_set_name": "DM Mathematics" }
i. Let c be (-1)/((-4 + 8)/16). Put -5, i, c in decreasing order. c, -5, i Suppose -5g = -3m + 34, -4g + 3m + 11 = -8g. Let w = g + 9. Let i = 6957 - 6969. Sort i, w, -3/4 in descending order. w, -3/4, i Let u be (1 - 1) + -3 - -2. Let z = 1284 + -1296. Sort z, -2, u in ascending order. z, -2, u Let m be 2/(-8)-20. Suppose 2z + 3 - 1 = m. Let r = 0.16 + -0.06. Sort -3, -5, z, r in decreasing order. r, z, -3, -5 Suppose -13m + 1152 + 24 = 8m. Put -3, -4, m in decreasing order. m, -3, -4 Let a = -1028/31 - -14547/434. Put 2, 0.2, 1/10, a, -6 in increasing order. -6, 1/10, 0.2, a, 2 Suppose h - 4 = 3h. Let v(c) = c2 + 33c - 30. Let o be v(-34). Let n be ((-135)/20 + 8)(o - 0). Sort h, -1, n, 0. h, -1, 0, n Suppose -4m = -4r - 138 - 234, 2r + 174 = -m. Put r, 4, 2 in decreasing order. 4, 2, r Suppose -2m - m + 4v - 1647 = 0, -m + 2v - 551 = 0. Sort m, -1, 4 in ascending order. m, -1, 4 Suppose -97q - 11 = 3o - 95q, 0 = -2o - 4q - 18. Sort 4, 12, o. o, 4, 12 Let n be (20/(-7))/((-72)/14 - -5). Suppose 0h - 4h = 0. Suppose -n = 5z - hz. Sort z, -1, -0.2 in decreasing order. -0.2, -1, z Let p(x) = -x*2 + 7x + 3. Let b be p(0). Suppose -2t + b = 5. Suppose 7h + 15 = 10h. Sort 0, -3, t, h in descending order. h, 0, t, -3 Let q = -31493 - -31491. Let x = -10 + 18. Sort x, -3, -5, q in ascending order. -5, -3, q, x Let h(u) = 27u + 30. Let g be h(14). Suppose g = -59a + 57a. Let t be a/(-119) + (-2)/1. Sort t, 0.2, 2/3 in increasing order. t, 0.2, 2/3 Let o be (0 + -3)/((-16)/(240/(-9))). Let f be (-2)/6((0 - -6) + -6). Sort -1, o, f. o, -1, f Let t = -26.91 + 26.899. Sort 0.1, t, 0, -2/7. -2/7, t, 0, 0.1 Let k(o) = 2o*3 - 24o*2 + 2o - 28. Let t be k(12). Let i = -4 + 19. Let r = i - 14.9. Put -5, r, t in decreasing order. r, t, -5 Let l be ((-3)/(-12)-2)/(4 + (-28)/8). Suppose -b - 2f - 3 = -0f, 4b + 18 = -5f. Put b, -2, l, 3 in descending order. 3, l, -2, b Let a be (326 - 324)(-1 + 1/(-2)). Sort 0, a, -2, 62, 3. a, -2, 0, 3, 62 Let r = 5.851 + -6.851. Put r, 0.2, 13/2, 0.5 in descending order. 13/2, 0.5, 0.2, r Let b = 12 - 17. Let c = -139.06 + 139. Let v = 0.06 + c. Sort b, v, 0.1, 6 in increasing order. b, v, 0.1, 6 Let p be (-4)/62 - (-12 + (-4940)/(-310)). Sort p, -1, -619, 3. -619, p, -1, 3 Let t(m) = m*3 - 4m*2 - 8m + 15. Let d be 4(3 - (0 - 7/(-4))). Let c be t(d). Put -64, c, -3 in decreasing order. c, -3, -64 Suppose 0 = 96u + 2u + 4u - 102. Let d(l) = 0l + l2 + l3 + 0l - 2l3. Let x be d(0). Put x, u, 4, 3 in descending order. 4, 3, u, x Let y(s) = 7s + 2 - 2s + s3 + 3s*2 + 4s*2. Let n be y(-6). Let z = 33/4 - n. Put -1/8, z, -4 in descending order. z, -1/8, -4 Let k(j) = 17j - 15. Let o be k(12). Let d = o + -195. Sort -1, 2, -2, d. d, -2, -1, 2 Let y = 68 + -26. Let s = y - 33. Suppose -17b = -20b - s. Sort b, 5, 2, -4 in increasing order. -4, b, 2, 5 Suppose -3n - 4 = l, 0n = -2n. Let t be (-3)/9-2(-828)/(-184). Put t, -41, l in ascending order. -41, l, t Let p = 2.72 + -0.72. Let z = -2 + p. Sort -0.3, 2/9, z. -0.3, z, 2/9 Let t = 2226.6 + -2227. Sort -2/9, -0.427, -0.5, t in increasing order. -0.5, -0.427, t, -2/9 Let p = -8627 + 8626. Sort 0.2, -2/11, p, -3/8, 6 in descending order. 6, 0.2, -2/11, -3/8, p Let l = 3523.6 + -3523.9. Let u = 0.2 - 0.3. Put -5, u, -1, l in descending order. u, l, -1, -5 Let i be 471/3925(-20)/6. Let s = 0.2 - 0.05. Sort s, i, 2 in decreasing order. 2, s, i Let w(x) = x*2 + 1191x + 9463. Let f be w(-8). Suppose 6 = 5v - 2v. Suppose -vr + 6r = 4m - 4, -3m = r + 13. Sort m, -42, f in increasing order. -42, m, f Suppose -2m + 2u + 42 = 0, 2u = 4m - 42 - 50. Suppose 0 = ma - 6a - 76. Let x = -1 - -4. Sort a, -4, x in decreasing order. a, x, -4 Let g = -139/81 + 121/81. Put 0.1, 62/7, -3, g, -1 in ascending order. -3, -1, g, 0.1, 62/7 Let t = -98 - -59. Let i(a) = -4a2 + 136a + 611. Let d be i(38). Sort -5, t, d. t, -5, d Let k = 9 - -5. Suppose 2 + k = -4m. Let s(w) = -w2 + 6w + 2. Let n be s(6). Sort 1, m, n, -3. m, -3, 1, n Let t(l) = l*2 - 4l + 4. Let i be t(3). Let n be 2/8 - (330/(-216) + 4). Sort n, i, -5 in decreasing order. i, n, -5 Suppose 142f = 143f - 4. Let d(i) = i*2 - 4i + 4. Let h be d(f). Suppose -9l - 15 = -hl. Sort -4, 2, l, -13. -13, -4, l, 2 Let n = 4183 + -4191. Sort 2/11, n, 0.3, 19 in increasing order. n, 2/11, 0.3, 19 Suppose -608 = -5p - 3s, p - 108 = -5s + s. Let o be 1/((-14)/p) - 28/196. Let g = 21 + o. Sort 0, g, 4 in increasing order. 0, 4, g Let j = -16 - -11. Let p be (1105/153)/((-20)/(-12)) - 8/(-12). Put 2, j, p, 3 in increasing order. j, 2, 3, p Suppose 4h = -4f + 9f + 193, 2h = f + 89. Suppose 17a = 10a + h. Let n = -8 - -13. Put -3, n, a in decreasing order. a, n, -3 Let h(j) = -j2 - 5j - 4. Let d be h(-4). Suppose 0v - p = -v + 1, 3v - 5p = 5. Suppose v = 8u - 457 + 497. Put u, -2, d in ascending order. u, -2, d Let p be (156/(-390))/((-87)/(-15) - 2). Put 3, p, 4, -3 in ascending order. -3, p, 3, 4 Let p(k) = 3k - 19. Let d be p(-21). Let n = 78 + d. Let q(s) = -s3 + 6s*2 - 5s + 5. Let o be q(5). Sort n, -5, o. -5, n, o Let m = -2649 + 2596. Put -5, m, -0.3 in decreasing order. -0.3, -5, m Let k(m) = -m*2 - 11m + 667. Let a be k(21). Sort 0, 27, 2, a, -9 in decreasing order. 27, 2, 0, a, -9 Let i = 146688.2 - 146689. Let r be (2/8)/(2/4). Sort -0.2, r, i, -2 in descending order. r, -0.2, i, -2 Suppose -2m = -0m - 8, -3d - 2m = -23. Suppose 3 = y + 4s, -dy + 3s + 2s = 10. Let o be (y/(-4))/((11/(-8))/(-11)). Sort -21, -1, o in increasing order. -21, -1, o Let x = 2235 + -2234.5. Sort -1, x, 12/151 in descending order. x, 12/151, -1 Suppose -2h + 6h - 12 = 0, 4h + 3 = -5o. Suppose 0 = n - a + 35, -3n - 117 = -0n + a. Let y = n - -41. Sort -4, 5, o, y. -4, o, y, 5 Suppose 3f - 5t = f + 2, t - 14 = -2f. Suppose 9g - 13g - 3x + 5 = 0, 0 = -2x + f. Sort 0.1, -2/7, g, 2/5. g, -2/7, 0.1, 2/5 Let s(h) = -3h*2 - 12h + 4. Let l be s(-9). Let z = l + 109. Let a = -13 - -10. Sort a, 0, z in decreasing order. 0, a, z Suppose -9n - 45 = -v, 2n - 20 = -3v - 30. Let k be 4/(-14) - 15/21. Sort 1, n, -63, k in decreasing order. 1, k, n, -63 Suppose q = 4k - 2k + 8, 0 = -q - 3k - 2. Suppose -qg = 3a + 31 + 19, 2g + 36 = 4a. Put g, -1, 1 in descending order. 1, -1, g Let p = -3901 - -3904. Sort 2, 22/21, p, 2/7 in decreasing order. p, 2, 22/21, 2/7 Let q be (-3)/24-1 + 63/72. Let d be (41)/(1 - 2). Suppose 5n + 19 = 3z, -5z + 9 = -n + 4n. Sort d, z, q. d, q, z Let x(d) = 22d + 551. Let s be x(-25). Let t(f) = f3 - 10f*2 + 16f + 4. Let g be t(8). Sort s, 172, g in decreasing order. 172, g, s Let a = 0.214 + -0.254. Let n = 1/7 + -16/63. Suppose -2r + 18 = 2b, 3r - r - 23 = -3b. Sort a, n, -3, r. -3, n, a, r Suppose 2b + 37 - 1 = 6b. Sort b, 46, 2 in descending order. 46, b, 2 Suppose 0 = -3y + 3j + 21, -430j - 14 = -428j. Let r(s) = -s*3 - 5s*2 - 3s - 1. Let f be r(-3). Sort f, y, -5 in decreasing order. y, -5, f Suppose -3t + 14 = 2o - 2, 22 = 3t + 5o. Put 11, -5, 1, t in descending order. 11, t, 1, -5 Suppose 4l - 3l = -5x - 8, 3x + l = -6. Let h be -2 - (-3)/2-2. Let j be (-39)/(-6) + -3 - 6/(-12). Sort h, j, -2, x in ascending order. h, -2, x, j Let i = 9643 + -9647. Sort 1/3, 1/6, 2/17, i in decreasing order. 1/3, 1/6, 2/17, i Let i = 142 - 171. Let t = 29.5 + i. Put -13, t, -3 in ascending order. -13, -3, t Let w be -1((7 - -3) + -10). Sort -1, w, 258, -4 in decreasing order. 258, w, -1, -4 Suppose 0 = 2c - 4c - f - 882, 5c = -4f - 2208. Let d = c + 444. Put 6, d, 0 in decreasing order. 6, d, 0 Suppose -5g - 5 = 0, z + 0z + 2g + 5 = 0. Let h = 667 - 665. Let i be 84/(-105)(h - 7). Sort -5, z, i, -4 in decreasing order. i, z, -4, -5 Let o(m) = m*3 + 56m*2 + 58m + 157. Let s be o(-55). Sort s, 1, 4, -2, 0. s, -2, 0, 1, 4 Let p = 5196.6 + -5198. Sort -0.9, p, -1/5 in decreasing order. -1/5, -0.9, p Let l = 397 - 710. Let x = -311 - l. Suppose 1 + 16 = 3y + u, -u = 2y - 13. Sort y, x, 1, -3. -3, 1, x, y Let n = -2381 + 2386. Put 284, 2, n in descending order. 284, n, 2 Suppose 0 = -f + 5f + f. Suppose 1434 = 4b + 1450. Sort -3, f, b. b, -3, f Let x = 0.062 - 2.762. L	{ "pile_set_name": "DM Mathematics" }
rime factors of 3493. 7, 499 What are the prime factors of 1973? 1973 What are the prime factors of 20777? 79, 263 What are the prime factors of 27236? 2, 11, 619 List the prime factors of 369. 3, 41 List the prime factors of 178. 2, 89 What are the prime factors of 1509? 3, 503 What are the prime factors of 2976? 2, 3, 31 List the prime factors of 4257. 3, 11, 43 List the prime factors of 22025. 5, 881 List the prime factors of 96. 2, 3 What are the prime factors of 60567? 3, 13, 1553 What are the prime factors of 10551? 3, 3517 List the prime factors of 23645. 5, 4729 List the prime factors of 513. 3, 19 What are the prime factors of 12507? 3, 11, 379 List the prime factors of 148847. 73, 2039 What are the prime factors of 32481? 3, 401 List the prime factors of 157. 157 What are the prime factors of 2905? 5, 7, 83 What are the prime factors of 3538? 2, 29, 61 What are the prime factors of 125017? 125017 List the prime factors of 984. 2, 3, 41 What are the prime factors of 6896? 2, 431 What are the prime factors of 394? 2, 197 What are the prime factors of 11208? 2, 3, 467 List the prime factors of 13545. 3, 5, 7, 43 List the prime factors of 2851. 2851 List the prime factors of 40693. 40693 List the prime factors of 1199. 11, 109 List the prime factors of 317. 317 What are the prime factors of 3182? 2, 37, 43 What are the prime factors of 69061? 69061 List the prime factors of 16570. 2, 5, 1657 What are the prime factors of 10338? 2, 3, 1723 What are the prime factors of 165? 3, 5, 11 List the prime factors of 94782. 2, 3, 15797 List the prime factors of 22592. 2, 353 List the prime factors of 1624. 2, 7, 29 What are the prime factors of 3196? 2, 17, 47 List the prime factors of 6169. 31, 199 What are the prime factors of 224? 2, 7 What are the prime factors of 2077? 31, 67 What are the prime factors of 3513? 3, 1171 What are the prime factors of 6585? 3, 5, 439 What are the prime factors of 6000? 2, 3, 5 List the prime factors of 4521. 3, 11, 137 What are the prime factors of 20243? 31, 653 What are the prime factors of 602? 2, 7, 43 List the prime factors of 32531. 32531 List the prime factors of 7017. 3, 2339 What are the prime factors of 180061? 7, 29, 887 What are the prime factors of 1597? 1597 List the prime factors of 1217. 1217 What are the prime factors of 19880? 2, 5, 7, 71 List the prime factors of 12757. 12757 What are the prime factors of 1469? 13, 113 List the prime factors of 1906. 2, 953 What are the prime factors of 377? 13, 29 What are the prime factors of 36811? 131, 281 List the prime factors of 291. 3, 97 List the prime factors of 215. 5, 43 List the prime factors of 7796. 2, 1949 List the prime factors of 20355. 3, 5, 23, 59 List the prime factors of 46007. 13, 3539 What are the prime factors of 5510? 2, 5, 19, 29 List the prime factors of 10913. 7, 1559 What are the prime factors of 2556? 2, 3, 71 What are the prime factors of 372? 2, 3, 31 What are the prime factors of 48662? 2, 29, 839 What are the prime factors of 45037? 29, 1553 List the prime factors of 5018. 2, 13, 193 What are the prime factors of 1497? 3, 499 List the prime factors of 1757. 7, 251 What are the prime factors of 2523? 3, 29 List the prime factors of 466. 2, 233 List the prime factors of 676. 2, 13 List the prime factors of 11950. 2, 5, 239 List the prime factors of 66. 2, 3, 11 List the prime factors of 1070. 2, 5, 107 What are the prime factors of 1662? 2, 3, 277 List the prime factors of 670. 2, 5, 67 List the prime factors of 267. 3, 89 What are the prime factors of 1082? 2, 541 What are the prime factors of 14853? 3, 4951 What are the prime factors of 568? 2, 71 List the prime factors of 1882. 2, 941 What are the prime factors of 16209? 3, 1801 List the prime factors of 688. 2, 43 List the prime factors of 34134. 2, 3, 5689 What are the prime factors of 1689? 3, 563 List the prime factors of 1810. 2, 5, 181 List the prime factors of 3540. 2, 3, 5, 59 What are the prime factors of 272? 2, 17 List the prime factors of 69950. 2, 5, 1399 List the prime factors of 25872. 2, 3, 7, 11 What are the prime factors of 3137? 3137 What are the prime factors of 3052? 2, 7, 109 List the prime factors of 1628. 2, 11, 37 List the prime factors of 25131. 3, 8377 List the prime factors of 78220. 2, 5, 3911 List the prime factors of 8768. 2, 137 List the prime factors of 1103. 1103 What are the prime factors of 1193? 1193 List the prime factors of 3941. 7, 563 What are the prime factors of 31? 31 What are the prime factors of 1628? 2, 11, 37 List the prime factors of 3280. 2, 5, 41 List the prime factors of 502. 2, 251 List the prime factors of 9235. 5, 1847 What are the prime factors of 3311? 7, 11, 43 List the prime factors of 72383. 72383 What are the prime factors of 1778? 2, 7, 127 What are the prime factors of 70127? 23, 3049 List the prime factors of 26526. 2, 3, 4421 What are the prime factors of 38838? 2, 3, 6473 List the prime factors of 184942. 2, 89, 1039 List the prime factors of 22177. 67, 331 What are the prime factors of 1794? 2, 3, 13, 23 What are the prime factors of 75? 3, 5 List the prime factors of 222. 2, 3, 37 What are the prime factors of 4965? 3, 5, 331 List the prime factors of 4593. 3, 1531 List the prime factors of 6715. 5, 17, 79 What are the prime factors of 59827? 29, 2063 What are the prime factors of 3084? 2, 3, 257 What are the prime factors of 101652? 2, 3, 43, 197 List the prime factors of 9147. 3, 3049 What are the prime factors of 1616? 2, 101 List the prime factors of 14334. 2, 3, 2389 List the prime factors of 501. 3, 167 What are the prime factors of 30602? 2, 11, 13, 107 What are the prime factors of 5858? 2, 29, 101 What are the prime factors of 3912? 2, 3, 163 List the prime factors of 120. 2, 3, 5 List the prime factors of 15235. 5, 11, 277 What are the prime factors of 1369? 37 What are the prime factors of 302? 2, 151 List the prime factors of 97. 97 List the prime factors of 7424. 2, 29 What are the prime factors of 35204? 2, 13, 677 What are the prime factors of 1427? 1427 List the prime factors of 4458. 2, 3, 743 List the prime factors of 67197. 3, 13, 1723 List the prime factors of 1813. 7, 37 List the prime factors of 2014. 2, 19, 53 List the prime factors of 1250. 2, 5 List the prime factors of 1745. 5, 349 What are the prime factors of 38682? 2, 3, 7, 307 List the prime factors of 1312. 2, 41 List the prime factors of 17955. 3, 5, 7, 19 List the prime factors of 6072. 2, 3, 11, 23 List the prime factors of 19898. 2, 9949 List the prime factors of 529. 23 List the prime factors of 1241. 17, 73 What are the prime factors of 3067? 3067 List the prime factors of 40185. 3, 5, 19, 47 What are the prime factors of 536? 2, 67 List the prime factors of 60740. 2, 5, 3037 List the prime factors of 1012. 2, 11, 23 What are the prime factors of 10654? 2, 7, 761 What are the prime factors of 6607? 6607 What are the prime factors of 2186? 2, 1093 What are the prime factors of 981? 3, 109 List the prime factors of 25794. 2, 3, 1433 What are the prime factors of 6954? 2, 3, 19, 61 What are the prime factors of 2059? 29, 71 What are the prime factors of 2604? 2, 3, 7, 31 List the prime factors of 12604. 2, 23, 137 What are the prime factors of 4332? 2, 3, 19 What are the prime factors of 28707? 3, 7, 1367 List the prime factors of 1103. 1103 List the prime factors of 75946. 2, 13, 23, 127 List the prime factors of 84071. 13, 29, 223 List the prime factors of 5053. 31, 163 List the prime factors of 7392. 2, 3, 7, 11 List the prime factors of 51965. 5, 19, 547 What are the prime factors of 1116? 2, 3, 31 What are the prime factors of 41769? 3, 7, 13, 17 List the prime factors of 5769. 3, 641 List the prime factors of 8545. 5, 1709 List the prime factors of 145. 5, 29 What are the prime factors of 7795? 5, 1559 List the prime factors of 758. 2, 379 List the prime factors of 7716. 2, 3, 643 What are the prime factors of 69429? 3, 23143 List the prime factors of 48150. 2, 3, 5, 107 What are the prime factors of 16630? 2, 5, 1663 What are the prime factors of 37605? 3, 5, 23, 109 List the prime factors of 164276. 2, 7, 5867 What are the prime factors of 27137? 11, 2467 What are the prime factors of 1177? 11, 107 List the prim	{ "pile_set_name": "DM Mathematics" }
from wwwwwwtwtwtw. Give prob of picking 2 t. 1/22 Calculate prob of picking 1 y and 1 x when two letters picked without replacement from {r: 6, y: 1, x: 7}. 1/13 Two letters picked without replacement from wff. Give prob of picking 1 f and 1 w. 2/3 What is prob of picking 1 o and 1 t when two letters picked without replacement from obotkook? 1/7 What is prob of picking 1 q and 1 x when two letters picked without replacement from qqxbxbqbqxqqb? 3/13 Two letters picked without replacement from {p: 7, t: 2}. What is prob of picking 2 p? 7/12 Two letters picked without replacement from ccffccc. What is prob of picking 2 f? 1/21 Three letters picked without replacement from pmppmmpmmmppm. Give prob of picking 3 p. 10/143 Three letters picked without replacement from duddddduddduddduud. Give prob of picking 2 d and 1 u. 65/136 What is prob of picking 1 m and 3 x when four letters picked without replacement from {m: 2, x: 3}? 2/5 Calculate prob of picking 4 j when four letters picked without replacement from jjjjjjjjjj. 1 What is prob of picking 2 c and 1 j when three letters picked without replacement from eggjccjtgjggtcjc? 3/70 Three letters picked without replacement from umfm. What is prob of picking 1 m, 1 u, and 1 f? 1/2 Calculate prob of picking 1 e, 1 z, and 1 f when three letters picked without replacement from ofzzeozoeezzeoo. 4/91 Three letters picked without replacement from zdkksqnd. Give prob of picking 1 k and 2 q. 0 Three letters picked without replacement from nlwssnsplplhnnn. Give prob of picking 1 w, 1 h, and 1 s. 3/455 Two letters picked without replacement from {q: 3, z: 9}. Give prob of picking 2 q. 1/22 Calculate prob of picking 1 b and 1 w when two letters picked without replacement from {f: 1, b: 1, w: 1, s: 1, o: 1}. 1/10 What is prob of picking 2 u when two letters picked without replacement from uuufusufl? 5/18 Two letters picked without replacement from {s: 1, r: 5, b: 7, z: 2, p: 3}. What is prob of picking 1 p and 1 s? 1/51 Three letters picked without replacement from {v: 11, x: 9}. What is prob of picking 2 x and 1 v? 33/95 Calculate prob of picking 1 v and 3 d when four letters picked without replacement from {f: 9, d: 4, w: 1, v: 1}. 4/1365 Three letters picked without replacement from {o: 3, g: 13}. What is prob of picking 2 g and 1 o? 117/280 Calculate prob of picking 2 t and 2 q when four letters picked without replacement from tqtqccttqctttctt. 27/455 Calculate prob of picking 1 d and 1 c when two letters picked without replacement from {q: 3, z: 3, r: 1, g: 3, c: 2, d: 1}. 1/39 Four letters picked without replacement from ttwcjtjtwwcct. Give prob of picking 2 j and 2 t. 2/143 Three letters picked without replacement from {d: 5, e: 2}. Give prob of picking 1 d and 2 e. 1/7 Four letters picked without replacement from {u: 5, j: 1, r: 1, d: 2}. What is prob of picking 3 u and 1 d? 10/63 Four letters picked without replacement from ydqeyeqdeddddesydy. What is prob of picking 1 s, 1 y, and 2 e? 2/255 Calculate prob of picking 4 o when four letters picked without replacement from {g: 2, x: 1, o: 4}. 1/35 Four letters picked without replacement from {f: 1, o: 3, d: 2, n: 2, z: 12}. What is prob of picking 1 d, 1 z, and 2 n? 8/1615 Two letters picked without replacement from pifzizipzzzziipri. Give prob of picking 1 i and 1 p. 9/68 Three letters picked without replacement from {m: 2, l: 2, o: 3, q: 9}. What is prob of picking 2 q and 1 m? 9/70 Calculate prob of picking 3 j when three letters picked without replacement from {e: 4, j: 6}. 1/6 Calculate prob of picking 1 d and 1 u when two letters picked without replacement from uhhhddd. 1/7 Two letters picked without replacement from wqmdq. Give prob of picking 1 d and 1 m. 1/10 Calculate prob of picking 1 v and 1 f when two letters picked without replacement from {v: 4, f: 3}. 4/7 Three letters picked without replacement from vvmmmvvmvvvvvvvmmv. Give prob of picking 3 v. 55/204 Three letters picked without replacement from {n: 9, f: 1, w: 7, s: 1, x: 1, d: 1}. What is prob of picking 1 f, 1 n, and 1 d? 3/380 Calculate prob of picking 2 a when two letters picked without replacement from nanannanna. 2/15 What is prob of picking 2 f and 1 v when three letters picked without replacement from txvlfftxxvxfxfxv? 9/280 What is prob of picking 1 a, 1 x, 1 u, and 1 t when four letters picked without replacement from {x: 4, t: 1, u: 4, d: 2, a: 3}? 48/1001 What is prob of picking 1 k and 2 e when three letters picked without replacement from ehekk? 1/5 What is prob of picking 1 s and 1 t when two letters picked without replacement from {t: 3, s: 1}? 1/2 What is prob of picking 1 n and 1 s when two letters picked without replacement from {g: 2, v: 4, n: 2, s: 1}? 1/18 Two letters picked without replacement from {p: 1, u: 2, g: 2}. Give prob of picking 1 p and 1 u. 1/5 Calculate prob of picking 2 u and 1 o when three letters picked without replacement from {u: 2, p: 10, o: 7, l: 1}. 7/1140 Calculate prob of picking 3 q when three letters picked without replacement from {q: 7, h: 1}. 5/8 Calculate prob of picking 1 m and 1 x when two letters picked without replacement from mxxmyyyoxmm. 12/55 Four letters picked without replacement from {f: 8, j: 3}. Give prob of picking 2 j and 2 f. 14/55 What is prob of picking 1 v and 2 g when three letters picked without replacement from vffgfgf? 1/35 Three letters picked without replacement from {y: 1, g: 17}. Give prob of picking 3 g. 5/6 Calculate prob of picking 1 s and 1 o when two letters picked without replacement from oosoozsszoozszsb. 1/4 Calculate prob of picking 2 x when two letters picked without replacement from xxxxttxtxxxxxx. 55/91 What is prob of picking 1 l, 2 c, and 1 r when four letters picked without replacement from {l: 1, r: 1, w: 1, f: 4, c: 5}? 2/99 What is prob of picking 3 b when three letters picked without replacement from {x: 3, b: 9}? 21/55 Calculate prob of picking 1 t and 2 p when three letters picked without replacement from {p: 3, t: 3}. 9/20 Four letters picked without replacement from aaztztttttpttaar. Give prob of picking 1 z and 3 t. 4/65 Two letters picked without replacement from {w: 3, o: 3, d: 1, a: 3, n: 2, i: 4}. Give prob of picking 1 n and 1 a. 1/20 Two letters picked without replacement from tytyttt. Give prob of picking 2 t. 10/21 Two letters picked without replacement from {o: 5, n: 1, r: 1, j: 3, e: 1}. What is prob of picking 1 o and 1 j? 3/11 What is prob of picking 2 v when two letters picked without replacement from sssssssvvvs? 3/55 Calculate prob of picking 1 x and 1 q when two letters picked without replacement from {x: 6, q: 2}. 3/7 What is prob of picking 2 l and 2 f when four letters picked without replacement from llllkfllklff? 7/55 Three letters picked without replacement from {z: 1, x: 5, h: 1, k: 2}. Give prob of picking 1 h, 1 k, and 1 x. 5/42 What is prob of picking 1 d and 1 x when two letters picked without replacement from {d: 1, l: 1, c: 2, x: 2}? 2/15 Three letters picked without replacement from {b: 1, p: 4, l: 5}. What is prob of picking 3 p? 1/30 Four letters picked without replacement from zqbhooww. What is prob of picking 1 z, 1 o, 1 b, and 1 w? 2/35 What is prob of picking 2 v and 1 h when three letters picked without replacement from hvvlvlqlqffqfvhjfvqf? 1/57 What is prob of picking 3 i and 1 c when four letters picked without replacement from {i: 5, c: 3}? 3/7 What is prob of picking 2 i and 1 b when three letters picked without replacement from {q: 2, t: 5, i: 5, b: 1, m: 6}? 10/969 Calculate prob of picking 2 p when two letters picked without replacement from {l: 4, p: 2, u: 3}. 1/36 Four letters picked without replacement from {a: 6, r: 4, q: 7}. Give prob of picking 1 q and 3 a. 1/17 Calculate prob of picking 3 r when three letters picked without replacement from lrlvlllvrll. 0 What is prob of picking 1 u and 1 n when two letters picked without replacement from {v: 1, n: 1, y: 1, x: 1, u: 1, t: 2}? 1/21 Four letters picked without replacement from vavvmmaamaia. What is prob of picking 1 m and 3 i? 0 Three letters picked without replacement from hclpwwcpcwwcrl. What is prob of picking 2 p and 1 r? 1/364 Two letters picked without replacement from bqets. What i	{ "pile_set_name": "DM Mathematics" }
e nearest to 0? (a) 0.34 (b) 0.1 (c) -9 b Which is the nearest to -0.1? (a) 4 (b) 620.8 (c) -1 (d) 0.14 d What is the nearest to 36105 in -0.1, -1/6, -2, -0.3? -0.1 Which is the closest to -1/9? (a) -2/9 (b) -26 (c) -0.2 (d) 0.2 c What is the closest to 0 in -4, 2/5, -383? 2/5 Which is the closest to -1? (a) 0.42 (b) -26.1 (c) -1/15 (d) 0.3 (e) 5 c What is the nearest to -3/10 in -0.5, 37/3, -3, -1/4, -2/9? -1/4 Which is the nearest to 0? (a) 22.7 (b) -0.5 (c) -1/5 (d) 3/10 (e) 1/7 e What is the nearest to 0 in -20, 3, 49, 1/5? 1/5 What is the nearest to -0.3 in -0.1, 5, 3, -33? -0.1 What is the closest to -169 in -1/2, -0.038, 0? -1/2 Which is the nearest to 5/6? (a) 0.4 (b) 9 (c) 0.67 (d) -3 (e) 5 c What is the nearest to -152 in -5, -0.2, 2/469? -5 What is the nearest to -2 in -5, -0.6, 0.2, -2/47, -1? -1 What is the nearest to 0 in 0.2, 0.023, 16, 1? 0.023 What is the closest to 0 in -45724, 2/5, 2? 2/5 What is the nearest to 0 in 0.12, -1, -2, 450? 0.12 What is the nearest to 1/5 in 38816, 0.01, 2? 0.01 What is the closest to -0.09 in -0.2, 0.3, 2/289? 2/289 Which is the nearest to 0? (a) 2/167 (b) -56 (c) 3/2 (d) 4 (e) -3 a Which is the nearest to -12.5? (a) -3 (b) 8 (c) 2/5 (d) -0.03 (e) -2/17 a What is the closest to -35.6 in -2, 0.06, 0, -0.5? -2 What is the nearest to 0.1 in -0.5, -1, 6, 0.37, -4/3? 0.37 Which is the nearest to 13? (a) -3 (b) -2 (c) 3/8 c What is the nearest to -6 in 34, -3/8, 0.54, 4, 3? -3/8 Which is the closest to -53? (a) 2 (b) -3 (c) -3/2 (d) 41 b Which is the nearest to 0.2? (a) -5 (b) 928 (c) 5 (d) 0.3 (e) 2/9 e What is the closest to -3089 in -0.5, 0.4, -3, -1.2? -3 What is the closest to 0 in 4, -409, -5/3, 2, 1? 1 Which is the nearest to 3/4? (a) -3/31 (b) 5 (c) -4/9 (d) 13 a What is the closest to -0.1 in -11.3, 0.1, 7, 2, -0.4? 0.1 Which is the nearest to -54? (a) 6/5 (b) 27 (c) 0.2 c Which is the closest to -2401? (a) -5 (b) 0 (c) 4/7 a What is the nearest to -942.7 in -3/5, 2, -1/4, 0.9? -3/5 What is the closest to 2961 in -5, 1, 4/5? 1 Which is the closest to 38/67? (a) 1/7 (b) 1/5 (c) 0.3 (d) 0.1 c Which is the closest to 0.1? (a) 2 (b) 0.25 (c) 2.88 (d) -2/19 b What is the closest to 0 in 1, -6.611, 2, 4, 1/11? 1/11 What is the nearest to 0 in -6/19, -53, -3, 0.42? -6/19 What is the closest to -21 in 2/15, -4, 0.5, 3/5? -4 What is the closest to -3 in 0.496, 0.3, 2, 0.4, -0.05? -0.05 Which is the closest to 1993? (a) 4/3 (b) -5/3 (c) 0.27 (d) 6/7 (e) 1 a What is the nearest to 2/3 in -4, 2, 1/30, 48, 0? 1/30 Which is the nearest to 2/7? (a) 3 (b) 1346 (c) -0.1 c Which is the nearest to 0? (a) -1/4 (b) -548 (c) 2/7 (d) -0.3 (e) -22 a What is the closest to -59 in -8, -0.4, 4/9, -24? -24 What is the nearest to 1 in 5, 1/7, 0.4, 1229? 0.4 Which is the nearest to 160? (a) -5 (b) -5/18 (c) 4 (d) 2 c What is the nearest to -1/4 in -3, -2/11, -3.68, 2/21, -5? -2/11 What is the closest to -1/2 in 6, -4, 188/31? -4 Which is the closest to 2? (a) 5 (b) 331 (c) -5 (d) 1 (e) 0.1 d What is the closest to -0.7 in -1/335, -1, 0.5, 72, -0.5? -0.5 Which is the closest to 215? (a) -3/4 (b) 2/19 (c) 0.3 c What is the closest to 2 in 35414, 0.5, -0.1? 0.5 Which is the closest to 0? (a) -1069 (b) 1 (c) -7 b What is the closest to -1/2 in 3, 278/85, -1/4? -1/4 What is the closest to 0.05 in 1/6, 1, -0.6? 1/6 Which is the nearest to -1? (a) 3 (b) 52 (c) -34 a What is the closest to -1 in -1/4, 80, -18? -1/4 Which is the closest to -111? (a) -1 (b) 10/7 (c) 0.3 a What is the nearest to -1 in 0, -17, 40, -3.1, 0.2? 0 What is the closest to 1 in -1/5, 852, 1, -1/31? 1 Which is the closest to -3? (a) 226 (b) -31 (c) 4 (d) -4 d What is the closest to 1 in 0.1, 8, -12, 0.058, 0.3? 0.3 What is the closest to -0.1 in 0.2, 4/5, -2/11, -5? -2/11 Which is the nearest to 0.1? (a) 1/4 (b) -23/2192 (c) 0 c Which is the closest to -2? (a) -10/427 (b) -1/24 (c) 2/5 (d) 2 (e) -4 b Which is the closest to 2? (a) -18.6 (b) -4 (c) 5 (d) 11/4 d What is the nearest to -3 in -2, 3, 4110? -2 What is the nearest to -1.266 in 3/8, 3/2, 3/4? 3/8 Which is the closest to 3/4? (a) 3695 (b) -1/5 (c) 0.2 c Which is the nearest to -267.1? (a) 0 (b) 0.2 (c) -0.3 (d) -1 d What is the closest to 270 in -7, 1/3, -2/7? 1/3 What is the nearest to -10 in 4, -0.4, -4, -11, 56? -11 Which is the nearest to -2? (a) 12 (b) -0.251 (c) -55 (d) 0 b Which is the nearest to 9/38? (a) -13 (b) -4/11 (c) -2 b Which is the nearest to 3/19? (a) -3/32 (b) 64 (c) 0.3 c Which is the nearest to -46? (a) 0.074 (b) 1/10 (c) 2/3 (d) -0.4 d What is the nearest to -3 in -0.2, -0.29, -2/13? -0.29 Which is the closest to 1? (a) -0.04 (b) -1/40 (c) 4 (d) 9/103 d What is the nearest to 0 in 0.5, -3, 1/4, 535? 1/4 Which is the nearest to 7? (a) 5 (b) 2/9 (c) -5 (d) -10 (e) -0.1 a Which is the nearest to -0.1? (a) -2/103 (b) -0.2 (c) 3/29 a What is the closest to -7.472 in 0.2, 2, -5, -0.4? -5 Which is the nearest to -2? (a) -5 (b) 23 (c) 1.16 a Which is the nearest to 0? (a) -0.5 (b) -0.087 (c) -1/6 (d) -540 b Which is the closest to 5344? (a) -1.1 (b) -3 (c) -2 (d) 2/23 d What is the closest to -2 in -3/7, 3/4, 0.05412? -3/7 What is the closest to 0.3 in -2/5, 0.06, -2868? 0.06 What is the nearest to -10 in -2/19, -10, -3.7, 2? -10 What is the closest to -1 in 7, 2.5, -1? -1 Which is the closest to -2/3? (a) 0.6 (b) -570 (c) 4 a Which is the closest to 1? (a) 2 (b) 0.013 (c) 0.038 c What is the closest to -1 in -0.2, 1099, 59? -0.2 Which is the nearest to 4? (a) -9 (b) -0.07 (c) -3 b Which is the nearest to -1? (a) -5 (b) -0.4 (c) -0.012 (d) 0.5 b Which is the closest to 1/2? (a) -598 (b) 3 (c) 5 (d) -2/3 (e) 2/9 e Which is the nearest to -0.2? (a) 9.2 (b) 0.5 (c) -7/5 b Which is the closest to 73? (a) -8.4 (b) -4/7 (c) 0 c What is the closest to -1 in 139, 3, 8, -3/4? -3/4 Which is the nearest to 0? (a) 2/9 (b) -0.3 (c) 1/240 (d) -2/15 (e) -2/11 c What is the nearest to 9/4 in 3/5, -34, -13? 3/5 What is the closest to -624 in -2/21, 1.01, -1/7? -1/7 Which is the nearest to 1/3? (a) -10 (b) 0.03 (c) 1/2 (d) 4 c What is the closest to -2/3 in 0.2, -3, 2254/3? 0.2 What is the closest to -1 in -3, 2/3, 7974? 2/3 What is the nearest to 8/69 in 0.2, -0.2, 3, -1/11, -14? 0.2 What is the closest to 0.1 in 0.4, 0, 21, -0.029? 0 What is the nearest to 0.056379 in 0.5, 4, 6? 0.5 Which is the nearest to -1443? (a) -2 (b) 2/45 (c) -73 c What is the closest to 1 in -0.05, -0.17, -3, -0.4, 0.3? 0.3 What is the nearest to 0.109 in 1/4, -3/7, -5, 1/7? 1/7 Which is the closest to -2? (a) -11 (b) -5/3 (c) -124 (d) -2/5 b Which is the nearest to 90? (a) 5/4 (b) 0.03 (c) -0.17 a What is the nearest to 11 in 0, -1/2, -33/5, 2, 0.3? 2 What is the nearest to 0.2 in -175, -0.4, -1/4, -0.1? -0.1 What is the nearest to 1/2 in -105, -5, 194? -5 Which is the nearest to 0.2? (a) 3/2 (b) -12.1 (c) 31 a Which is the closest to 3? (a) 0 (b) 3765 (c) -2 a What is the nearest to 19 in 2, 82.5, -3? 2 What is the closest to 0.1 in 3, 0, 0.077, -0.0148, 2? 0.077 What is the closest to 34 in -1/3, -2, -2/7, 0.4? 0.4 What is the nearest to 0.3 in 0, -3/2, 0.5, -14? 0.5 Which is the nearest to 2/9? (a) -2.14 (b) 488 (c) -3/4 c Which is the nearest to -8? (a) -1 (b) 4 (c) 2 (d) -0.2 a What is the closest to -56/9 in -4, -0.03, -2? -4 Which is the nearest to -0.4? (a) -1/76 (b) -24 (c) 0.09 (d) 1/5 a Which is the closest to 2/5? (a) -0.5 (b) -8.8 (c) -4/7 (d) -18 a Which is the closest to -7.4? (a) -1 (b) -0.2 (c) 0.0758 a Which is the nearest to -1? (a) 11 (b) 3/787 (c) 2/9 b What is the nearest to 0.08 in 5, -2, 1/39, -4? 1/39 What is the closest to 2/11 in 0.5, -8, 2, -0.03359? -0.03359 What is the closest to 1 in 2/5, 6/19, 0, 3/5? 3/5 What is the nearest to -1 in 161, 7, 1/32, 0.01? 0.01 What is the nearest to 0.05 in -4, -7, -5/14? -5/14 Which is the closest to -6/7? (a) -3/2 (b) 8 (c) -5046 a What is the nearest to 1 in -5, -2, -11/5, -25, -1? -1 What is the nearest to 1 in -5/3, 16, 720/13? -5/3 What is the nearest to 0.1 in -4, 0.34, 6? 0.34 What is the closest to 3/5 in 0.1, 157, -0.7, -	{ "pile_set_name": "DM Mathematics" }
derivative of a(b) wrt b. -14982b What is the second derivative of 6d*3 - 105d + 94d2 + 416d + 7d3 - 6d*3 - 189d wrt d? 42d + 188 Let w(o) be the third derivative of -221o6/40 - o5/30 - 772o3/3 - 393o*2. Differentiate w(j) wrt j. -1989j*2 - 4j Find the second derivative of -122q2 + 37q*2 - 1772q*2 - 65q - 1020q + 2 - 1369q*2 wrt q. -6452 Find the first derivative of -300q*4 + 1788q*4 + 885 + 947 wrt q. 5952q*3 Let h be 10/2 + 7 + -9. Suppose -3m + 47 - 14 = -3w, m + 3w = -5. What is the first derivative of hz4 - 32 - mz4 - z4 + 2z4 wrt z? -12z*3 Suppose -14j + c = -10j - 16, 0 = -2j - c + 2. Find the second derivative of g + 2g + 3457 - 129g*j - 3454 wrt g. -774g Let m(x) = 2x3 - 17x*2 - 6x + 1. Let y be m(9). Let u = 33 - y. Find the second derivative of 24ku + 290k*4 - 290k*4 + 28k wrt k. 480k3 Suppose 3o = -2i - 10, -2i - 2o = -o + 2. Suppose l - 6l + 13 = 2x, 0 = x - 3l - 12. Find the third derivative of -1 - i + 2 + xv2 - 10v*5 wrt v. -600v*2 Suppose 0s - 5s = -990. Suppose 11y = 2y + s. Differentiate -yr + 22r + 18r*4 + 16 wrt r. 72r*3 Let l(q) be the first derivative of -47q*4/6 + 257q*3/6 + 90q*2 + 22. Let s(a) be the second derivative of l(a). What is the derivative of s(o) wrt o? -188 Suppose 4i + 151 = -3l - 0i, i = -4l - 223. Let m = l + 66. Differentiate -7n - 4n - 8n + m + 3n with respect to n. -16 Let o(v) = 52v - 8. Let x(m) = -5m - 3. Let j(c) = 9c + 5. Let p(u) = -4j(u) - 7x(u). Let s(d) = -2o(d) - 2p(d). What is the derivative of s(l) wrt l? -102 Suppose 6m + 152 + 328 = 0. Let g = 120 + m. Find the second derivative of -36i*4 + 5i - 21i + gi wrt i. -432i2 What is the third derivative of 454x*2 + 32979x*3 - 65965x*3 - 1 + 559x*2 - 15x*4 + 32984x*3 - 357x*5 wrt x? -21420x*2 - 360x - 12 Let m be (-2)/(-8) - (-157)/314. Let a(p) be the first derivative of -33/2p2 + 0p*3 + mp*4 + 0p + 40. Find the second derivative of a(w) wrt w. 18w Let p(r) = -r2 + 11r + 1. Suppose -18 - 78 = -12f. Let y be p(f). Find the third derivative of yc*4 + 106c*2 - 76c*2 + 4c*4 wrt c. 696c What is the second derivative of 2995m2 + 605035m*3 + 1569m*2 - 605033m*3 - 203m + 4028m wrt m? 12m + 9128 Let g(b) be the second derivative of 0 - 1/6b4 + 0b*5 + 77b + 5/14b7 + 7/30b*6 + 0b*2 - 10/3b*3. Find the third derivative of g(y) wrt y. 900y*2 + 168y Suppose -3r = -0r - 9, 0 = j - r - 1. What is the second derivative of 87c + c + 24c*j - 36c + 66c4 wrt c? 1080c*2 Let z(w) be the first derivative of 23w6/10 - w4 - 58w + 90. Let k(t) be the first derivative of z(t). Find the third derivative of k(b) wrt b. 1656b Let i be -6(12/8)/(-3). Let m be ((-8)/9)/(6/(-27)). Find the second derivative of n4 - in*m + 4n - 9n - n wrt n. -24n*2 What is the derivative of -109t*3 - 1386 - 3t - 2t + 199t*3 + 5t wrt t? 270t2 Suppose 0 = -2h - 3s - 83, -4s + 116 = -0h - 4h. Let c be (1 - 2)h1. Find the third derivative of -69i5 + 37i*5 - 10i*2 + ci*5 wrt i. 120i*2 Differentiate 1231846d - 236 + 377d3 - 1231846d with respect to d. 1131d2 Let i = -67 - -77. Find the second derivative of -59c*2 + 17c*3 + ic*3 - 25c + 59c2 wrt c. 162c Find the second derivative of -168 + 246 - 6164g4 + 8 + 3g + 11g wrt g. -73968g*2 Let w = -74 + 76. Suppose wy - 7 = -2b + 5y, 3b - y - 7 = 0. Find the second derivative of -19x*2 - 2x*2 - 2x*b - 39x - 7x2 wrt x. -60 Let o(k) be the third derivative of -40k*4 - 1160k*3/3 + 1009k*2. What is the first derivative of o(g) wrt g? -960 Let k be 0 + (-3 - -4)4. Let z be -9(k/3)/(-4). Find the second derivative of -zy - 18y4 + 31y*4 - 20y*4 wrt y. -84y*2 Let b = 115 + -113. What is the second derivative of -2u*2 - 1 + 25u*4 + 184u + 2ub - 199u wrt u? 300u2 Let b(i) be the second derivative of 221i*4/12 + 620i*3 + 19i + 13. Find the second derivative of b(a) wrt a. 442 Let w be ((-39)/(-15) + -3)/((-1)/55). Differentiate -5q - wq + 49 - 29q with respect to q. -56 What is the second derivative of -530l - 101l - 867l*2 + 72l*2 wrt l? -1590 Let a(r) be the first derivative of 0r*3 + 25r*2 + 2r + 0r4 - 17/5r*5 - 53. Find the second derivative of a(u) wrt u. -204u*2 Let k(q) be the first derivative of -158q*6/3 - 3q*5/5 - 1275q*2/2 + 542. Find the second derivative of k(i) wrt i. -6320i*3 - 36i*2 Suppose 5n = -2m + 950, -630 + 129 = -m + 4n. Suppose -18u + m = -13u. Find the first derivative of -u + 43 - 19q + 49 wrt q. -19 Let o(n) = 4n*2 + 5n - 6. Suppose -4s = -23 + 19. Let d be o(s). What is the second derivative of -45h + 0h2 - 14h*d + 8h*2 - 8h*2 wrt h? -84h Suppose l - 59 = 2s + 96, -2l = 4s - 286. What is the derivative of 35m*2 + 41m*2 - l + 112m*2 wrt m? 376m Suppose 3t - 8 = -2y, t - 3y + 6 = -8y. Suppose -3h + 75 = 3r - 0r, -t = -2h. Find the first derivative of 11w3 + 9w*3 - rw*3 + 8 wrt w. -9w*2 Let v(p) = -32 - 12p - 2p + 39p - 4p + 0p. Let s(c) = -c - 1. Suppose -2j - 6 = 2. Let f(w) = js(w) - v(w). What is the first derivative of f(n) wrt n? -17 Let j(d) = -4d2 + 14d + 7. Let l be j(4). Let a be (-75)/l - 4 - 0. What is the second derivative of -17u2 + 98u - 15u2 - au wrt u? -64 Let b be ((-342)/45 + 8)/((-2)/(-15)). Suppose 5m = a - 47, 4a + 0m - 166 = -2m. What is the third derivative of av2 - 3v*3 + 19v*3 + 3vb wrt v? 114 Let k(l) = l2 + 12l - 2. Let p be k(-13). Let i(b) be the first derivative of -12b - p + 13b - 10b*2 - 23b. What is the derivative of i(j) wrt j? -20 Let t be 26/65 - (-52)/20. Find the first derivative of 14a3 - 11a*3 + 62 + 8a*t + 16a*3 - 29 - 4a wrt a. 81a2 - 4 What is the third derivative of 16875c*2 - 277c*5 - 15792c*2 - 841c*5 wrt c? -67080c2 Let q = -42 + 43. Let k(p) = -p3 + p - 1. Let x(z) = 56z4 + 4z*3 - 3z + 57. Let b(d) = qx(d) + 4k(d). What is the second derivative of b(t) wrt t? 672t2 Let h(u) = -u2 - 5u - 4. Let w be h(-2). Find the second derivative of -72a + 137a - 18aw + 3 - 71a + 2a4 wrt a. 24a2 - 36 Let i(g) = -g2 + 4g + 1. Let s be i(2). Find the second derivative of -4n*2 + 5n*2 + 55n - 47n + sn*2 wrt n. 12 Find the third derivative of 1751u - 583u + 1626u*2 - 582u - 586u - 12065u*3 wrt u. -72390 Differentiate 6j + 24352 - 31691 - 6j - 3020j*4 wrt j. -12080j*3 Let v(j) be the first derivative of 24j + 53j + 2267 - 8j*2 + 29j - 2156. Differentiate v(a) with respect to a. -16 Let l(n) be the first derivative of 59n5/20 - 49n*2/2 - 46n + 53. Let d(y) be the first derivative of l(y). What is the first derivative of d(u) wrt u? 177u2 Suppose 0 = 17f - 35f + 36. What is the second derivative of -4v*f + 72v*2 - 55v - 47v + 79v*2 wrt v? 294 Suppose 2f - 6 = 38. Suppose 4c + 3v - 1 = f, -v = 5c - 15. What is the second derivative of -u + 8u + 9u2 + 13u + 4uc wrt u? 26 Let q(o) be the second derivative of -o7/14 + 11o*5/10 + 7o*3/6 + 33o*2 - 883o. Find the second derivative of q(d) wrt d. -60d3 + 132d Let b(g) be the second derivative of -23g - 29g*2 + 2 + 5/2g*3. What is the first derivative of b(k) wrt k? 15 Let i be (-141)/(-21) + 0 + (-8)/(-28). What is the third derivative of 3s + 83s3 + 2s*2 + is + 75s + 46s wrt s? 498 Let h(s) be the third derivative of 11s6/40 + 701s4/24 + s2 - 1229. Find the second derivative of h(t) wrt t. 198t Let x(h) be the first derivative of -h4/2 - 2833h*3/3 + 41h*2 + 23h + 3560. Find the second derivative of x(y) wrt y. -12y - 5666 Let g(f) be the first derivative of 0f + 0f4 - 17/60f*5 - 11/2f*2 + 11 + 13/3f*3. Let c(w) be the second derivative of g(w). Differentiate c(r) wrt r. -34r Let l(r) = -6749r3 - 30r*2 - 779. Let s(k) = 20248k*3 + 103k*2 + 2339. Let a(x) = 7l(x) + 2s(x). Find the third derivative of a(d) wrt d. -40482 Let d(m) be the first derivative of -12067m*7/7 + 31m*3/3 + 13m**2/2 - 7276. What is the third derivative of d(p) wrt p? -1	{ "pile_set_name": "DM Mathematics" }
12. Let u = -32 + 22. Let d be w(u). What is the highest common factor of k and d? 4 Let f be ((-4)/(-14) - (-354)/(-14))/(-1). What is the highest common divisor of 275 and f? 25 Let k = -37 + 93. Let s = -34 + 48. Calculate the greatest common factor of s and k. 14 Let s = 72 - 67. Suppose l + 4d = 6l - 108, -3l + 62 = -d. Calculate the highest common factor of l and s. 5 Let k = -12 + 48. Suppose -4m = -4x - 12, -4x + 2m + 1 = 7. Suppose -3w - y + 29 = x, 2y - 7 = -3. What is the highest common factor of w and k? 9 Let y(t) = 3t - 1. Let b be y(2). What is the highest common factor of 45 and b? 5 Let j be (-4)/(-3 + 1) + 3. Let g(m) = -27m + 1. Let s be g(-2). Calculate the highest common divisor of s and j. 5 Let y(q) = -q3 + 2q*2 + 2. Let g be y(-2). Let k = 42 - 40. What is the greatest common divisor of g and k? 2 Suppose -8v + 3v = 0. Let z be (-2 - (-1 + v)) + 6. What is the greatest common divisor of 5 and z? 5 Let d(u) = u2 - 5u. Let c be d(6). Calculate the greatest common divisor of c and 24. 6 Let p be (18/8)/(7/252). Calculate the highest common divisor of p and 27. 27 Let z(k) be the third derivative of k5/30 - k4/8 - k*3/2 - 3k*2. Let j be z(3). Calculate the highest common factor of j and 18. 6 Let y = 21 + 36. What is the highest common factor of y and 38? 19 Suppose n + 3n = 16. Let m = 7 - n. Let l be 121 + -2m/6. What is the greatest common factor of l and 15? 15 Let z be 34/1824. Suppose z = 2h - h. Calculate the highest common factor of 8 and h. 8 Let x be (16/(-5))/((-16)/280). Suppose 5q - 28 = 7. Calculate the greatest common divisor of x and q. 7 Let s(i) be the second derivative of -i5/20 - i4/3 + i3/2 + i2/2 + i. Let b be s(-5). Calculate the highest common factor of b and 66. 11 Let s(r) = -r + 5. Let i be s(-5). Suppose a - 18 - i = 0. Calculate the greatest common divisor of 7 and a. 7 Let f = 53 + -37. Suppose 96 = h + 3h. What is the greatest common factor of f and h? 8 Let n(q) = q + 21. Let d be n(-7). What is the greatest common factor of d and 35? 7 Let p be (-2)/(-10) + (-195)/(-25). Let d be ((-180)/p)/(3/(-4)). Suppose 5x - 69 = 6. Calculate the highest common divisor of x and d. 15 Let s = 12 - -1. Calculate the highest common factor of s and 117. 13 Let h = -6 - -14. Suppose -6v + 12 = -2v. Suppose vp - 80 = -2p. Calculate the greatest common divisor of p and h. 8 Let n be (-1 - -77) + 0 + -1. Suppose 2a - 27 = 3. Calculate the greatest common divisor of n and a. 15 Let t = -3 + 5. Let f = -21 - -7. Let r = -4 - f. What is the greatest common divisor of r and t? 2 Suppose -5s + 5h = -25, -10 = -5s + 3s - 5h. Let k(w) = -w - 2. Let m be k(-6). Suppose 5 = mo + 1. What is the highest common factor of s and o? 1 Let b(h) = -h3 - h2 + h. Let m be b(-2). Let o be (-6 + m)/(-2) + 10. What is the highest common divisor of 36 and o? 12 Suppose -32 = -j + 2j. Let p = 52 + j. Let u = -11 + p. What is the greatest common factor of 63 and u? 9 Let u = 388 + -268. What is the greatest common factor of 24 and u? 24 Let q(h) = 0h - 7 - 3h2 - 4h + 4h2. Let y be q(6). What is the greatest common divisor of 45 and y? 5 Let s be (217/(-14) - -4)4/(-2). Calculate the greatest common divisor of s and 46. 23 Let s(j) = -5j - 6. Let p be s(5). Let o = p - -53. Calculate the highest common divisor of o and 66. 22 Suppose -4y + b + 136 = 0, -y + 21 = 3b - 0b. Calculate the greatest common factor of y and 33. 33 Suppose -3k = -3d + 27, 5d - 23 = -3k + 14. Calculate the greatest common divisor of d and 8. 8 Let q be (9 - 6)/(2/84). What is the highest common divisor of 14 and q? 14 Let i be (-4 - (-43 - 0))1/3. What is the highest common factor of 39 and i? 13 Suppose 2f - 6 + 0 = 0. Suppose 0 = 5r - fr - 36. What is the highest common divisor of 18 and r? 18 Let b be 1 + 19 - (-4 + 2). Let h = -3 - -5. Let a = h + 0. What is the greatest common divisor of b and a? 2 Let v be 117/27 + (-1)/3. Let p = 43 + -15. What is the highest common divisor of v and p? 4 Suppose 0x + 15 = -5x. Let h be (0 + x)56/(-6). What is the greatest common factor of 4 and h? 4 Let g = 20 - 11. Calculate the highest common factor of g and 9. 9 Let h = -9 - -14. Suppose -b + 4s - 4 = 9s, 0 = 5b + hs - 20. What is the highest common factor of 4 and b? 2 Let n = 47 + -43. Calculate the greatest common divisor of n and 44. 4 Let s = -27 + 32. Calculate the greatest common divisor of 55 and s. 5 Let z = 31 + -23. Calculate the highest common divisor of z and 8. 8 Suppose -3n + 71 - 11 = 0. Let c = 0 + 0. Suppose ci - 150 = -5i. What is the greatest common factor of i and n? 10 Suppose -4y - 24 + 112 = 0. Suppose -322 - 305 = -19g. Calculate the highest common factor of g and y. 11 Let p be (-6)/(3 - 6) - -24. Calculate the greatest common divisor of p and 65. 13 Let r be ((-8)/10)/((-8)/800). Suppose -6w = -w - r. What is the highest common factor of 4 and w? 4 Let h = -627 - 25. Let l = 1002 + h. Suppose 0v + 5v = l. Calculate the greatest common factor of 14 and v. 14 Let n = 27 + -24. Let f(m) = 0m - 4 + m*3 + 0m - m. Let t be f(n). What is the highest common divisor of 60 and t? 20 Let o(y) = 3y. Let c(m) = -5m + 1. Let g(i) = 3c(i) + 4o(i). Let h be g(-9). What is the greatest common divisor of h and 5? 5 Suppose j = 3i - 30, -2i - i - 5j = -12. Calculate the greatest common factor of 9 and i. 9 Let z = 383 + -266. What is the highest common factor of 13 and z? 13 Let u(f) be the first derivative of f4/4 - 10f*3/3 + 14f - 1. Let d be u(10). Calculate the greatest common factor of d and 14. 14 Suppose 0 - 3 = -3h, 5z + 3h - 1773 = 0. Suppose -3m - 2m + 340 = 0. Suppose -2t = m - z. Calculate the highest common divisor of t and 13. 13 Suppose 3l - l + 4d = 236, -2l = -d - 216. What is the greatest common factor of 20 and l? 10 Suppose 5u - 48 = 3u. What is the highest common factor of u and 8? 8 Let f(x) = x2 + 7x + 37. Let w be f(-8). Let a be 4/(-2) + 8 + 2. Let y = -3 + a. Calculate the highest common factor of w and y. 5 Let v be (3/4)/(13/416). Calculate the highest common divisor of 192 and v. 24 Let t = 70 + -35. Calculate the highest common factor of 7 and t. 7 Let a be (8/(-24))/((-2)/(-78)). Let c be (-5)/(-5)a/1. Let h = c + 26. What is the greatest common factor of h and 52? 13 Suppose 31 = 4h + l, -l + 12 + 11 = 3h. What is the greatest common factor of 64 and h? 8 Let m(g) = -g3 + 7g*2 - 5g. Let u be m(6). Let t = u - 1. Let o be (t/(-3) - -1)-6. What is the highest common divisor of o and 36? 4 Suppose 0 = 5y - 9 - 1. Suppose 5s + 3j - 75 = 0, -56 = -ys + 3j + j. Suppose -4b - b = -60. Calculate the highest common factor of b and s. 6 Let b = 61 - 43. Let h = 6 - 2. Suppose -4n + 573 = -5t + 4t, 2t + 570 = hn. What is the highest common factor of b and n? 18 Let s(q) = q*2 - 6q + 3. Let i be s(7). What is the greatest common divisor of 80 and i? 10 Let q be 297/5 + 3/5. Suppose 5r = 2r + q. What is the highest common divisor of 10 and r? 10 Let j = 24 - -30. Let f = j + 0. Calculate the highest common factor of 6 and f. 6 Suppose -3h - 18 = -5f + 23, 2f + 5h - 4 = 0. Calculate the greatest common factor of f and 14. 7 Suppose 0 = -4c + 81 + 99. Let s(h) = 9h - 3. Let p be s(2). Calculate the greatest common factor of c and p. 15 Suppose 0 = l + 4l - 5z - 150, 0 = -l + 4z + 27. Calculate the highest common divisor of 1 and l. 1 Suppose 0z = -z + 38. Let r be (-9 - -10) + z + 1. Calculate the greatest common factor of 5 and r. 5 Let q be 4/235/14. Suppose -q = -l + 6. Calculate the greatest common factor of l and 55. 11 Let t = 3 - 1. Suppose tq = q - 2o + 2, 0 = -q - o + 7. Calculate the greatest common factor of q and 6. 6 Suppose 5n - 2 - 8 = 0, -2n = 4i + 112. Let o = 74 + i. What is the greatest common divisor of o and 9? 9 Let j be 86/5 - (-4)/(-20). What is the highest common factor of j and 34? 17 Let t(m) = 25m + 1. Let f be t(5). Let n = f + 42. Suppose -y - n = -4y - 3u, 4u + 256 = 4y. What is the highest common factor of y and 12? 12 Suppose -4w - 12 = -5v, -4w = 2v + 9 + 3. Let k(p) = p + 7 + 7 + 0p. Let c be k(v). What is the highest common factor of	{ "pile_set_name": "DM Mathematics" }
der. -5, -1, q, l Let m be -1410/(-420)9. Sort 11, -2, m, -1 in descending order. 11, m, -1, -2 Suppose -2t - 4i + 19 + 19 = 0, -4t + 3i = -54. Suppose -t = -r - 19. Sort 4, 8, r. r, 4, 8 Let r be (2/(-3))/((-315)/27 + 12). Sort 3, 9, r. r, 3, 9 Suppose 336 - 32 = 19t. Sort -1, 4, t, -5 in decreasing order. t, 4, -1, -5 Let i = -100 + 60. Let c = 40.5 + i. Sort -2/29, 1, c in decreasing order. 1, c, -2/29 Let d be ((-1)/2)/((-1)/(-6)). Let q = 21 + -23. Let n be 4 + (-9)/3 + 2/q. Put 2, n, d in decreasing order. 2, n, d Let j = -0.863 + 1.063. Sort j, -2, -7 in increasing order. -7, -2, j Let a = -13 + 8. Let h be (1/34)/((-1)/4). Let l be 14/(-21) + 28/105. Sort l, h, a. a, l, h Let l be 4641/1428 + (-1)/(-4)-1. Sort -4, -1, 24, l in ascending order. -4, -1, l, 24 Let v = -1 + 1.3. Let d = 12788/7 + -1827. Sort v, -2/5, d, 0.5. -2/5, d, v, 0.5 Let h be ((-56)/24)/((-28)/48). Sort h, 66, 1, 5 in decreasing order. 66, 5, h, 1 Let s(f) = -f*3 - 37f*2 - 266f + 106. Let i be s(-27). Suppose 1 + 19 = -5c + 5g, 4c + 3g = -9. Sort 3, i, 0, c in decreasing order. 3, 0, i, c Let u(q) be the third derivative of -q*6/120 + 7q*5/60 - 5q4/24 + q3/2 - 4q2. Let s be u(6). Suppose 16 = 5c - s. Sort -1, c, 2 in ascending order. -1, 2, c Suppose -66y + 59y = 77. Sort 0, -1, y in ascending order. y, -1, 0 Let r be (0/1)/(-12). Let n be (1 - (-18)/(-4))/(2/(-4)). Suppose -25 = -no - 4. Sort r, -4, o in ascending order. -4, r, o Suppose -y = -4y + 15. Suppose -4o - 21 = 3h - 0o, 3 = -3h + 2o. Let b be 106/(-22) - ((-12)/(-22))/3. Put y, b, h in ascending order. b, h, y Let z = -2402 - -2402. Put -0.02, z, 3 in descending order. 3, z, -0.02 Let i be (5 - -95)/53/4. Suppose -4z - m + 4 = -5m, m + 9 = 5z. Put z, i, -2 in increasing order. -2, z, i Let i(f) = f*2 - 8f + 9. Let n be i(7). Let b be ((-2)/(-1(-4 - -3)))/n. Let r = -2 - -7. Sort b, -5, r in descending order. r, b, -5 Suppose -21r = -58r + 2216 - 2142. Let z(n) = -7n3 - n2 + n + 1. Let o be z(-1). Sort -2, o, r, 4. -2, r, 4, o Let p = 38 - 102. Let z = p - -64. Sort z, 9, -1. -1, z, 9 Suppose -2y + 0y + 5c = -40, 0 = -2c. Sort y, 1, 2/11 in decreasing order. y, 1, 2/11 Let x(y) = y + 3. Let v be x(-1). Let c(p) = -p*2 + 7p + 11. Let o be c(8). Suppose 3 = vj - o. Sort -3, j, 1 in decreasing order. j, 1, -3 Let l be 1850/(-550) + 4/11. Let p be (5/(-2))/(1 - -2). Put p, l, -0.2, 3 in ascending order. l, p, -0.2, 3 Let a be (3 - (-1 - 253))/((-42)/(-42)). Put -1, -3/5, a in decreasing order. a, -3/5, -1 Let t = 0.238 - 0.128. Sort t, 3/4, 4 in increasing order. t, 3/4, 4 Let j = 85/58 + 1/29. Let p = 23 + -20. Let f = -5 + p. Put -1/4, j, f in decreasing order. j, -1/4, f Let x(u) = u - 11. Let l be x(6). Let r(c) = c + 18. Let p be r(-10). Suppose p = w + w. Sort l, -4, w in decreasing order. w, -4, l Let h be ((-106)/88)/(3/(-12)) + (35 - 40). Let n = 9 - 16. Let a = n + 10. Sort a, h, -0.8 in increasing order. -0.8, h, a Let q = -1 - -1.5. Let n = -11098/19 + 584. Put q, -4, n in ascending order. -4, n, q Let t = 0.0942 - 10.0942. Put 5, -0.3, t, 4 in increasing order. t, -0.3, 4, 5 Let s = -16 - -11. Let i = -4.9 - -8.9. Put s, i, -2 in increasing order. s, -2, i Let a = -2596/16420221 - 1/5553. Let s = -411026/8871 - a. Let m = s + 46. Put -2/13, 4/3, m in increasing order. m, -2/13, 4/3 Let j = 260.7 - 261. Sort -2/35, 1/2, j, -2 in descending order. 1/2, -2/35, j, -2 Let j = 391 - 391.05. Put 1, j, 0.1, 0 in decreasing order. 1, 0.1, 0, j Let t be (-326/24 - -2)4. Sort 2, -44, t, -2 in increasing order. -44, t, -2, 2 Suppose 0 = -125f + 135f - 40. Put 0.24, -1, f, 0 in decreasing order. f, 0.24, 0, -1 Let p(v) = -v3 + 3v*2 + 21v - 15. Let j be p(6). Put -11, -1, -3, j in descending order. j, -1, -3, -11 Let v = 0.6 - 12. Let f = v + 11. Let n = -0.64 - 0.36. Put n, f, 2/9 in descending order. 2/9, f, n Let s = -290 - -296. Put s, 0, 7 in decreasing order. 7, s, 0 Let m be (-18)/12 - (-22)/4. Suppose ml - 3 = 3w - 6w, -2w = 6. Sort 0, 5, l in ascending order. 0, l, 5 Suppose -7l = -51l + 44. Sort -37, 2/5, 4, l. -37, 2/5, l, 4 Suppose 0y + 3y - 63 = 0. Let o be 8/(-5) + y/35. Sort 2, -4, o, 0. -4, o, 0, 2 Suppose 4b - 4l = 0, b + 2l = -4 + 19. Suppose bw + 0 = -10. Suppose 6y - 10y - 15 = -z, 5y = 5z - 30. Put w, y, -4 in decreasing order. w, y, -4 Let w = -1235153/323 + 3824. Sort 1/2, w, 1. w, 1/2, 1 Let f = -35115264295/3096 + 11342140. Let o = -2/387 - f. Let u = 0 - 0.2. Sort o, -3, u in increasing order. -3, o, u Suppose 0 = -3r + 15, -4s + 3r + 38 = -27. Suppose -z - 5 + 4 = 0, 4z - s = -3k. Let m be (-6)/k(-4)/(-6). Put -4, m, 3 in decreasing order. 3, m, -4 Suppose 4d + 4a - 52 = 0, -2a - 37 = -4d - 3a. Suppose -c + 9 = dc. Put c, -3, -1 in decreasing order. c, -1, -3 Let j = 0.13 + -1.63. Let x = 0.5 + j. Let c = -2 + -2. Put -1/2, x, c in ascending order. c, x, -1/2 Let z(c) = c*2 + c + 2. Let o be z(0). Suppose -oy + 2 = -5d, 0y + 28 = 5y - d. Suppose y = 3j - 3l + 2l, 0 = l. Put -1, -2, j in increasing order. -2, -1, j Let g = 67 - 57. Suppose -gu + 2u - 32 = 0. Put -2/3, 3/4, -3, u in increasing order. u, -3, -2/3, 3/4 Let u be -1(-6)/10(2 - 7). Sort -1, u, -2. u, -2, -1 Let g(l) = 2l2 + 8l + 4. Let j be g(-1). Put -30, -1, j in descending order. -1, j, -30 Let o = -141.4 + 39.1. Let u = o - -102. Put -2/15, -0.8, u in ascending order. -0.8, u, -2/15 Suppose -135 + 23 = -4u. Let f be 210/u4/(-6). Sort 4, -3, f in increasing order. f, -3, 4 Let s be (-52)/14 + 10/(-35). Sort 5, -1, s, 4 in increasing order. s, -1, 4, 5 Let k = -497 + 494. Sort -2, -107, k in descending order. -2, k, -107 Let r = 111 - 110. Put 3, -0.3, r in increasing order. -0.3, r, 3 Let l be 0 + 1 + 3/3. Suppose 48o - 12 = 51o, -29 = 3j + 5o. Put j, 4, l in ascending order. j, l, 4 Let m = 274 + -273.7. Sort -0.1, 2, 0.1, m. -0.1, 0.1, m, 2 Let k = 1 + -2. Suppose 3d + 10330 = 10345. Sort 2, k, 0, d in ascending order. k, 0, 2, d Suppose 157y = 179y - 242. Put 17, -3, y in decreasing order. 17, y, -3 Suppose x - 4 = -3. Let p be (-3)/((99/(-6))/x). Sort p, 3, 5/12 in descending order. 3, 5/12, p Let p be (38/(-2) - -13)/((-2)/9). Put -6, p, -2 in decreasing order. p, -2, -6 Suppose 0 = u - 3s + 5, 5s = 7u - 3u - 15. Suppose 2p - u = 2d, -4d - 5p - 56 = -0p. Sort d, -2, 2 in increasing order. d, -2, 2 Suppose -2z - 5f = 30, 16z = 12z + 2f - 12. Put 0, 151, z, -1 in increasing order. z, -1, 0, 151 Let h = -49 - -51. Let v = -16 - -21. Sort h, v, -50. -50, h, v Suppose -9g - 54 = -18. Sort g, 4, -5, -81 in ascending order. -81, -5, g, 4 Suppose -3m + 4 = -5. Suppose 124 = -143j + 81j. Put 1, m, j in descending order. m, 1, j Suppose -h - 11 = -2d, h = 2d - 2h - 13. Suppose 293c + 108 = 347c. Sort c, 1, -10, d. -10, 1, c, d Let j be ((-10)/(-4))/((-1)/2). Put 1, 8, j in increasing order. j, 1, 8 Suppose m - 79 = 18. Let y = 90 - m. Let c(o) = 2o2 - 2o - 1. Let b be c(-1). Sort b, -5, y in decreasing order. b, -5, y Let q = 29.6 - 29.4. Put 2, 12/13, q in decreasing order. 2, 12/13, q Suppose -31q = -25 - 37. Sort q, -49, 1 in decreasing order. q, 1, -49 Let u = -0.74 - -0.34. Let p = -0.34 + -14.66. Let s = 15.3 + p. Put u, s, 1 in descending order. 1, s, u Let i = -294 - -319.1. Let k = 25 - i. Let q = -1 + 1. Put k, q, -5 in increasing order. -5, k, q Suppose 21k = 41 + 64. Put k, -1, 0 in ascending order. -1, 0, k Let j be -14 + 04/(-24). Sort 1.5, j, 4/3 in descending order. 1.5, 4/3, j Let j = 29.8 - 32. Let u = -1.9 - j. Sort u, 1, -4 in ascending order. -4, u, 1 Let a = 365 - 364. Sort -5, a, 14 in descending order. 14, a, -5 Let k(f) = -10f - 85. Let i be k(-9). Put -67, -2, 4, i in descending order. i, 4, -2, -67 Let x = 121 - 121. Sort 8, x, -4, -5 in increasing order. -5, -4, x, 8 Let n be 9 - 3 - (0 - -3). Suppose -5f - 5 = 0, -nf + 3 + 3 = 3k. Put k, 2, -4 in decreasing order. k, 2, -4 Let t = 824 + -824.5. Put 0.7, t, 10, -5 in increasing order. -5, t, 0.7, 10 Let u = -29 - -18. Let v = 10.79 + u. Let m = v - 0.29. Sort 0.4, m, 2/7 in increasing order. m, 2/7, 0.4 Let r be 0/((-8)/41). Let n(s) = -s3 + s2 + 9. Let i be n(r). Put i, 1, 2 in increasi	{ "pile_set_name": "DM Mathematics" }
18m + 2d for m. 6 Solve 27 = 4k + 2y + 61, 56y + 1291 = k for k. 3 Solve 9p + 348 = -811n + 807n - 185, 2p + 4n - 36 + 142 = 0 for p. -61 Solve 0 = -5s + 5, 5f - 5s + 40296 = 40281 for f. -2 Solve y - 822r + 4 = -817r - 6, 186 = -22y - 4r + 308 for y. 5 Solve 3o - 95 = -2n, 41o - 39o - 146n + 5830 = 0 for o. 5 Solve 29 = -8298u + 8300u + l + 2, -2l = -5u + 54 for u. 12 Solve 0 = 9c - 6c + 4u - 103, 24c - 29c - 85 = 16u - 21u for c. 5 Solve 2s + 13 = -12g + 14g - 5, 0 = 3s + 3g - 27 for s. 0 Solve 0 = 5y + 15, -4d - 11897755 + 11897735 = 4y for d. -2 Solve -31 = 4w + 3i, 102w + i + 25 = 208w - 111w for w. -4 Solve 4j + 40 = -6w, -33w = -43j - 38w - 192 for j. -4 Solve -g - 15 = -5g + o, g = -30005o + 30006o for g. 5 Solve 2o - 4d + 52 = -15o - 37, -6o + 10o - 3d + 58 = 0 for o. -1 Solve 0 = t - 4289 + 4332, 4p = -4t - 168 for p. 1 Solve 11t - 2j = -24, -969 = 3t + 5j - 968 for t. -2 Solve 2r - 112 + 72 = 2q, 12r + 22q = 18q + 256 for r. 21 Solve 1258i - 1384i = -5292, 2q + 3i = 130 for q. 2 Solve -4i = 5l - 180, -4i = 141688l - 141694l - 136 for i. 40 Solve -44 = 2o + 2j, 25o - 7601 = -5j - 7811 for o. -5 Solve -5r - 61m + 180m - 111 = 61m + 54m, -4m + 4 = -3m for r. -19 Solve 156d - 80d = -4v + 74d - 22, 0 = 5d + 31 - 6 for v. -3 Solve 0 = -2432x + 2428x + 4w - 264, w = 5x + 318 for x. -63 Solve 4f - 1212 = 6s - s - s + 7s, 117 = -f - s for f. -5 Solve 6r = 9r - 2z - 18, 0 = 3r - 105z + 28z - 243 for r. 4 Solve 8 = -10g + 2i - 3i + 13 - 116, 5i - 17 = 2g for g. -11 Solve 0 = 2z + 3q - 32163 + 32161, -6z - 26 = 3q - q - q for z. -5 Solve 5b + 5p - 375 = 0, 2b + b + p - 19272 = -19197 for b. 0 Solve l - f + 28 = 25, 2l - 6l - 8l + 4f = -28 for l. 5 Solve 1020w = 1024w - b - 48, 54 = -6w - 2b for w. 3 Solve 0 = -c + 63v + 4094, -3c - c = -2c + 383v - 382v + 67 for c. -1 Solve t - 5y - 20 - 5 = -17, -80 = -10t - y for t. 8 Solve 5i + 7b - 77 = 0, 0 = -6363i + 6355i + 3b + 109 for i. 14 Solve 0 = k + 2i + 12, 0 = 42109k - 42106k + i + 16 for k. -4 Solve r + 2 = -3s, 48r = 42r - 5s - 51 for r. -11 Solve 4f = -m - 50, 21f - 16f + 57 = -378m + 374m for f. -13 Solve 0 = 3o - 4w - 4, 5o - 24 + 56 = -2w + 30 for o. 0 Solve -709x + 712x = 36n + 108, -4n = x + 44 for n. -5 Solve 11b - 4b - 96 = 3b + 3z, -9z = -5b + 208 + 80 for b. 0 Solve -13l - 7r = -2, 2r + 157 = 139 for l. 5 Solve -4i + 5y - 10 = i, 5y = 36i + 76 + 89 for i. -5 Solve -3151s + 3168s - 26 = 4d, -3s + 2 = -2d for d. 2 Solve 188p + 4148 = 3524s - 3520s, -4s + p + 100 = -3p for s. 3 Solve 0 = -m - 319l + 313l + 147, -2l + 39 = -3m for m. 3 Solve -28a - 2u - 63 = -13, 0 = -13a + 9a + 5u - 23 for a. -2 Solve z - 238 = -5x, z + 3x = -30958 + 31100 for z. -2 Solve -c + 16 = 2u, -129u + 11c + 13c - 22c = -101 for u. 1 Solve 8f + 22f = 31f - 2l + 1, 0 = -5f - l + 6 for f. 1 Solve 5d + 2u + 191 = 5, 0u + 5u - 162 = 4d for d. -38 Solve 203212d - 203216d - 5c - 61 = 0, -3c - 7 = -5d for d. -4 Solve 0 = -6v + 3h + 17 - 56, -10 + 53 = v + 4h for v. -1 Solve 4w - u + 3 = -2, 5w = -53u + 54u - 112 + 108 for w. 1 Solve 526y = 524y - 2a + 22, -y - 5a = -10y - 83 for y. -2 Solve -c - 27 = 2u - 8c, 3u = 69c - 70c + 17 for u. 4 Solve -5h + 51 - 11 = -5i, 0 = 18h - 23h + 26i + 250 for h. -2 Solve 2f + g - 12 = f + 2f + 5g, 632f = 621f + 2g + 6 for f. 0 Solve 356f = d + 351f, -10f + 90 = -8d for d. -15 Solve -5g - 56400 = 5j - 56375, -3g = -7j - 5 for j. -2 Solve 0 = -2l - 23565a + 23567a - 14, 3a = l + 31 for l. 5 Solve d - 86 = -5f, -4d + 0d - 4f - 9 + 65 = 0 for d. -4 Solve -21x + 1600w - 1605w - 61 = 0, 4w = 3x + x - 30 + 2 for x. -1 Solve -5i + 8r = -9i + 6r - 34, 0i - 81 = 5i + 8r for i. -5 Solve -19f + 15f + 8 + 3 = -14r + 9r, 0 = -5r + 25 for f. 9 Solve -4w - 73 = -21v + 44, v - 2w - 31 = -8 - 12 for v. 5 Solve -3v = -42i - 1650, 25i - 26i - 51 = -3v for i. -39 Solve 3n = 3o + 48, -3254 = 2n - 4o - 3328 for n. -5 Solve -330 = -16p + 2g, -1239p + 1239p - 3g = 15 for p. 20 Solve 3j + 12 = -5 + 5, 502s = 256s + 251s + 5j + 15 for s. 1 Solve 0 = -2a - j + 27, 18j - 222 + 54 = 2a - 84j + 114 for a. 12 Solve -6b - 85 = -4y - 7, -81b + 4 = -3y - 79b + 30 for y. 0 Solve 1515030w - 1515032w = -3x - 39, 12w + 2x = 174 for w. 15 Solve u = q - 21, 90 = -477q + 479q + 10u for q. 25 Solve -5s + 185 = -8k, 14 = 7s - 2s - 4k - 72 - 79 for s. 29 Solve -2m + 16o - 18o = -m - 3, 2m - 33 = 8m + 3m - 2o for m. -3 Solve 3x + 21 = -3i, 14x - 19x + 90 - 103 = 3i for i. -11 Solve -3y + 9 = 1252f - 1253f, 0 = -4f + 6y - 6 for f. 6 Solve 6l - 5 = -q, -1842439q = 2l - 1842444q - 7 for l. 1 Solve 3r - 15 - 20 = -9o + 10, r + 4o - 21 = 0 for r. -3 Solve 33785t - 10 + 47 = 33780t + 3f, -2t + 2f - 26 = 0 for t. 1 Solve -4a = -i + 9, 4a - 7i + 8i - 6i = -77 for a. 2 Solve 5a + 5z = -150, -12 + 54 + 312 = -3a - 14z - 110 for a. 4 Solve 0 = -j - d + 6d - 35, -2d - 457 - 921 = 46j for j. -30 Solve 2529b = 2533b + 153p - 8560, -b + 5p = 282 for b. -2 Solve 2q - 23 = -w, -3w + 73 = 23749q - 23739q for w. 21 Solve -3t + 60016 + 60019 = 4s + 120042, 4s = 3t + 47 for s. 5 Solve 6y + 221 = 245, 3y = -10t + 2 for t. -1 Solve s + 8 = -4w, 7s = 9s - 7s + w + 44 for s. 8 Solve 3l + 12q - 15q = -q + 19, -2l + 22 + 36 = -24q for l. 5 Solve n + 45 = -4q, 0n + n + 1 = q - 8q - 74 for n. -5 Solve 0 = -4b + 4l - 12, 29b - 19b + 2l - 15 = 15b - 6l for b. -3 Solve -18z = -23z + s - 3s + 79, -102s - 88 = -5z - 101s for z. 17 Solve 2380w + b + 48 = 2377w, 0 = 4w + 4b + 192 for w. 0 Solve 3d + 46 = -t + 5d, 0 = -23t - d - 1238 + 415 for t. -36 Solve -2r + 307 + 186 = 9p, 16p - 27p + r - 136 = -742 for p. 55 Solve 52c + 20b - 38b + 21b = 263, -4c + 2b = 3b - 21 for c. 5 Solve -4y + 43b + 97 = 44b, -y - 2b = -26 for y. 24 Solve 5y + 2i = -38, -2y - 89i = -84i + 116 for y. 2 Solve 3h - 2l + 8 = 0, 141h + 4l + 12 = 140h - 26 + 68 for h. 2 Solve 4k - 2r + 24 = 0, r - 5 = -3 for k. -5 Solve t = -o + 53, 3t = 106o - 2t - 1856 - 3984 for o. 55 Solve c + 18c + 0c = 4n - 42 + 4, -n - 3c - 6 = 0 for n. 0 Solve -4m - 563t + 56 = -564t, -46 = -2m + 5t for m. 13 Solve 4j = -2m - 3m - 135 - 2, 4j - 825 + 701 = 4m for j. 2 Solve -28298h + y = -28302h + 4 + 1, -3h + 21 = 5y - 38 for h. -2 Solve 4q + u + 41 = 0, q + 7569 = 16u + 7575 for q. -10 Solve -5v - 4s - 18 = 0, -v = 5718s - 5720s - 2 for v. -2 Solve -8j + 64 = -2m, 4m + 72j - 70j = 34 for m. 4 Solve -4l + 5u - 467 = -6l - 520, -9u + 4 - 54 = 49 for l. 1 Solve 4 = 3v - f, -v - 276415 = 51f - 276211 for v. 0 Solve 0 = 9u + 3q + 3, -23448u + 4q - 66 = -23446u for u. -5 Solve 7a - 3a + 4d - 42 = -a - 0d, -8a - d = -24 for a. 2 Solve 132m - 1 = -26o + 23o + 134m, -7o + 3m - 3 = 3 for o. -3 Solve 5223t + 4u = 5225t + 72, -t - 3u + 0u = -44 for t. -4 Solve -5q = 3x + 11, -3675x + 3681x = -q - 13 for q. -1 Solve -6d = 2h - 50 - 26, -2d - 19h = -14h - 190 for d. 0 Solve 4c - 660l + 28 = -664l, 4c + 6l + 24 = 0 for c. -9 Solve 6l - 20 = 11l + 612m - 619m, 4m + 20 = 0 for l. -11 Solve 11c + 194a + 61 = 189a, -2a + 7 = -c - 1 for c. -6 Solve -66196j + 24 = -66188j + 4y, -3y = j + y - 3y - 3 for j. 3 Solve 2b - 330 = -32s, -5b + 83 = 3b + s + 33 for b. 5 Solve -2i + i - 423p + 422p = -22, -30i = -4p - 830 for i. 27 Solve 4f + 6g + 2g = 6g + 14, 31f - 26 = g for f. 1 Solve 2a = 2w - 48987 + 49055, 10a + w + 45 = 0 for a. -1 Solve 2v - 2w + 0 + 6 = 6v + 8, -w = 5 for v. 2 Solve 4x - 485 = -7r, 2r + 66x = 126x - 59x + 145 for r. 71 Solve 777k = -2h + 783k + 20, 38 = 5h - 3k for h. 7 Solve -2d - 6 = -12d + 11d + 4l, -9d + 39 = 2l - 9 for d. 6 Solve -4g - 2t + 10 = 0, -68g + 39g + 25g - 4t = -0t - 20 for g. 0 Solve 3g + 1075 = -7r + 394, -2g = g + r + 105 for g. -3 Solve 4r - 197 = -7a, 12r - 39202a + 122 = -39200a for r. -5 Solve -8 = -2a + 4h, 689a = 697a + h - 1	{ "pile_set_name": "DM Mathematics" }
y = t + -0.7. What is y rounded to 3 dps? 0.003 Let j = -359.999999252 - -360. What is j rounded to 7 decimal places? 0.0000007 Suppose -2729b = -2725b - 7136. Round b to the nearest one hundred. 1800 Let i = 32 + -30. Suppose x - is = 2s - 8, 4x - 13 = s. Let z be -4 + (1 - 1599985)/x. What is z rounded to the nearest one hundred thousand? -400000 Let o = -0.042 + -0.048. Let a = -0.09039 - o. Round a to 4 decimal places. -0.0004 Let f = 269 - 268.998217. What is f rounded to four decimal places? 0.0018 Let x(l) = 16l + 14. Let f be x(-4). Let b be (-9205)/f + 1/(-10). Round b to the nearest 10. 180 Let u = 22.23488 - 35.23391. Let g = 17.8 - 4.8. Let j = u + g. Round j to 4 decimal places. 0.001 Let b = 38.17 - 38. Let m = b - 9.17. Let v = -8.992 - m. What is v rounded to 3 dps? 0.008 Let l(k) = 599k3 + 10k*2 - k + 10. Suppose 2 = 4u - 10. Suppose -ux - 30 = -6x. Let v be l(x). Round v to the nearest one hundred thousand. 600000 Suppose -3z = 5o + z - 32999998, -4o + 26399993 = 5z. Let p be (o - 9/3) + 1. Suppose -3l = -l - p. What is l rounded to the nearest 1000000? 3000000 Let y be ((-1)/3)/(7/(-84)). Suppose 0f + y = 2f. Suppose -fm + 4w = 39608, -3m + 17039 = 5w + 76429. Round m to the nearest one thousand. -20000 Suppose 4j = -2j + 24. Suppose 2d - h + 40 = 0, 3d - jh + 41 = -19. What is d rounded to the nearest ten? -20 Let h = 270 + -71.4. Let n = -193.54 + 12.54. Let z = n + h. Round z to zero dps. 18 Let s = 576.12 + -558. Let p = 5.18 + s. Let r = p + -24.93. What is r rounded to 1 dp? -1.6 Let p = -25895.887 + 25977. Let l = p + -81. Round l to two decimal places. 0.11 Let h = -0.42 + 0.48. Let p = -0.06000055 + h. Round p to seven decimal places. -0.0000006 Let i(v) = 2v2 - 9v + 1. Let x be i(7). Let o be (-170)/8 - (-9)/x. Round o to the nearest 10. -20 Let l = -37 - -36.77. Let y = l + -1.07. Let j = y - -1.29999965. Round j to seven dps. -0.0000004 Let x = -1630 + -60. Round x to the nearest 1000. -2000 Let d = 17 + -73. Let x = d + 61.4. Round x to the nearest integer. 5 Let w(l) = -l + 11. Let q be ((-4)/(-6))/((-10)/(-105)). Let y be w(q). Suppose -yx - 112545754 + 25745754 = 0. What is x rounded to the nearest 1000000? -22000000 Let h = -31 - -34. Suppose -hw - 2497 + 79 = 0. Let n be (2 - w/5)-62500. What is n rounded to the nearest 1000000? -10000000 Let o = -446 - -446.02618. Round o to three decimal places. 0.026 Let k be (-32)/(-176) + (-27500004)/22. What is k rounded to the nearest one million? -1000000 Let j = -3505 - -3504.98401. What is j rounded to two dps? -0.02 Let p be -607(-996 + 20/5-1). What is p rounded to the nearest one hundred thousand? 600000 Let x(o) = -562506o*2 - 11o + 2. Let u be x(-2). Round u to the nearest one hundred thousand. -2300000 Let p = -34335 - 49415. What is p rounded to the nearest 1000? -84000 Let f = -11876 - 68124. What is f rounded to the nearest one hundred thousand? -100000 Let k = 41 + -38. Suppose 4s - j - 1919994 = j, 0 = -4s + kj + 1919991. Round s to the nearest one hundred thousand. 500000 Let b = -16.73 + -0.27. Let a = b + 16.96. What is a rounded to one dp? 0 Let h = 24 - -77. Let b = -127.1 + h. What is b rounded to the nearest integer? -26 Let r = 809.023 + -809. What is r rounded to three decimal places? 0.023 Let h = 23.099842 + -23.1. What is h rounded to 4 decimal places? -0.0002 Let l = -1053.073 - -1052. Let w = -0.137 + l. What is w rounded to 1 dp? -1.2 Let a = 23 - 9. Let k = a + -11. Suppose u = 6m - 2m - 998, -5u - km = 4944. Round u to the nearest 100. -1000 Let v(x) = 72x*2 - 3x + 6. Let g be v(-4). Let j = 4770 - g. What is j rounded to the nearest one thousand? 4000 Let l = -158 - -18. Let g = 139.99999813 + l. What is g rounded to 7 decimal places? -0.0000019 Let f be (4 - 0) + (-4 - 672/(-7)). Let s = 56 - -41. Suppose f = -c - s. Round c to the nearest ten. -190 Let z = -141.66 + 1.66. Let b = z + 140.0077. Round b to 3 decimal places. 0.008 Let d = 410 + -372. What is d rounded to the nearest one hundred? 0 Let v = 191.6 - -35.4. Let n = v + -227.107. Let a = 17.907 + n. What is a rounded to 0 dps? 18 Let b = -944994834043 + 944994420307.700113. Let s = 413734 + b. Let x = -1.3 - s. What is x rounded to five dps? -0.00011 Let t = 19.7 - 19.700001166. Round t to 6 decimal places. -0.000001 Suppose 118c = 112c - 48420. What is c rounded to the nearest 1000? -8000 Let x = -15.76 - -15.5874. Let l = 0.17 + x. Round l to 2 dps. 0 Let r = -0.08 - -12.08. Let k = 159.8 - 147.809. Let u = r - k. Round u to two dps. 0.01 Let z = -18.477 - -52.353. Let w = 0.776 - z. Round w to the nearest integer. -33 Let v = -390.52 + 381. Let n = v + 3.1. Round n to 0 dps. -6 Let y = 3.83 - 3.83346. Round y to 4 decimal places. -0.0035 Let w = -31 + 37. Let z = w - 5.9993. Round z to 4 dps. 0.0007 Let m(t) = -7t2 + 3t - 7 + 2t3 + 5t - t*3. Let z be m(6). Let x(k) = 999k*2 + 4k + 5. Let c be x(z). Round c to the nearest ten thousand. 30000 Suppose -4o - 5u = 18, -o - 6u + u - 12 = 0. Let a(v) = -389v*2 + v - 2. Let r be a(o). Round r to the nearest one hundred. -1600 Let y = -49 - -11. Let f = y + 16. Let h = 22.00000085 + f. What is h rounded to 7 decimal places? 0.0000009 Let f(y) = -y + 33. Let s be f(17). Suppose 0 = -3k + 59 + s. Suppose -11 - k = -a. Round a to the nearest ten. 40 Let g be (-5 + 0)(-6 - -9). Let q(d) = d2 + 15d + 3. Let h be q(g). Suppose 2v + 4900000 = -hv. Round v to the nearest one hundred thousand. -1000000 Let n = 129463 - 129443.0062. Let c = n - 20. Round c to three decimal places. -0.006 Let v = -2.51 + 236.51. Let i = 232.06 - v. What is i rounded to one decimal place? -1.9 Let f = -114 + 183. Let p = -69.000049 + f. Round p to four dps. 0 Let q = -41.21 - 5.39. What is q rounded to the nearest ten? -50 Let o = -63.135781423 + 0.135784323. Let r = 9.3 - 72.3. Let y = o - r. What is y rounded to 6 decimal places? 0.000003 Let v = -4.7 - -4.792. Let d = v - 1.072. What is d rounded to one decimal place? -1 Let n = 225.9 - 131. Let l = n - -14.1. Let z = 108.999871 - l. What is z rounded to 5 dps? -0.00013 Let s = -0.29 - -0.01. Let p = -513036.719991 + 513037. Let y = s + p. Round y to five decimal places. 0.00001 Let p = -36 - -37.31. Let l = 0.72 - p. Round l to one dp. -0.6 Suppose -442 = 2j - 1802. Suppose 2t + t + 2q = -408, -q - j = 5t. Round t to the nearest ten. -140 Let z = -199350 + 97350. What is z rounded to the nearest ten thousand? -100000 Let z = -273 - -107. Let r = -166.00000645 - z. What is r rounded to 6 dps? -0.000006 Let a = 13671979763.6889 - 13549093651.688851. Let j = a + -122886030. Let k = j - 82. What is k rounded to five decimal places? 0.00005 Let f be 648774/210 - 3/((-15)/(-2)). What is f rounded to the nearest one thousand? 3000 Let u = -37.5253 - 0.0747. What is u rounded to the nearest 10? -40 Let i(v) = 3v2 - 9v + 6. Let m be i(3). Suppose -m = -2x - 2. Suppose -xp = 4p - 378000. Round p to the nearest 10000. 60000 Let k(g) = -4 + 4 + g2 - 8g - 11 - 3. Let y be k(-6). Round y to the nearest one hundred. 100 Let h be 2/9 - (-312)/54. Let t = h + 0. Suppose -616 = -tx + 2x. Round x to the nearest 10. 150 Suppose -2782186 = -28x + 126157814. Round x to the nearest 100000. 4600000 Suppose -3p + 4d + 1150196 = 0, -3d + 59044 - 442441 = -p. What is p rounded to the nearest 10000? 380000 Let c = -4164 + 26809. Let y(z) = 1 - 7 - 3z - 10689z*2 - 2z - cz2. Let k be y(-6). What is k rounded to the nearest one million? -1000000 Let y = -919553162.3013767721 - 1966536.6986305279. Let g = y + 921519546. Let q = g - -153. Round q to 6 decimal places. -0.000007 Let g = -1272.999998688 + 1273. What is g rounded to 7 decimal places? 0.0000013 Let a = 10382.5994107 - 1.5930107. Let i = a + -10405. Let u = 24 + i. What is u rounded to three dps? 0.006 Let c = -485 + 490.48. Round c to the nearest integer. 5 Suppose -5l - 137292235 + 39282345 = 0. Suppose -4v = -r + 10, 2 = v - 2v. Let m be l/99 - r/9. Round m to the nearest ten thousand. -200000 Suppose 0 = 2n - 3n. Suppose 5c - 14 = -4l - nl, 7 = c + 5l. Suppose 94421 = 2z + g + 24423, -cz - 3*g = -69994. Round z to the nearest ten thousand. 40000 Let z =	{ "pile_set_name": "DM Mathematics" }
0 = -g - 4g. Let k be g/70 + 1200/(-14). Is 10 a factor of k/(-3) + (-8)/(-6)? True Suppose -50l = -53l + 21. Suppose 166 = 5p + 3f, -4f - 38 = -p - lf. Is p a multiple of 8? True Let q be 4 + 2 + (1 - 2). Let m(t) = 3t*2 - 5t + 11. Let c be m(-4). Suppose v = -qo + 402 - c, 2v - 134 = -2o. Does 12 divide o? False Let p(c) = 2c*3 + 122c*2 - 20c + 5. Does 16 divide p(-61)? False Suppose 2r = -4q + 1966, 4q + 1189 = -3r + 4130. Is 13 a factor of r? True Suppose 0 = -8n + 12700 - 3676. Is 8 a factor of n? True Let k be 961 - (3 - -2). Suppose y - k = -43. Is 9 a factor of y? False Let p be (-9 - -4 - -4) + 274. Suppose v + 0v = p. Let m = v - 160. Does 15 divide m? False Let x(i) = 8i - 25. Let w be x(14). Suppose 94 = wa - 85a. Is 2 a factor of a? False Let o be (-1 - -5) + -1 + 18. Suppose -o + 168 = 7q. Is 7 a factor of q? True Suppose -4l = 4a + 8, -4a = -0a - 5l - 10. Suppose -108 = -3z - az. Is z a multiple of 9? True Let m(l) = -l*3 - 16l*2 - 2l - 8. Let o be (-36 - -18) + (0 - -2). Does 3 divide m(o)? True Let s(f) = -f*2 - 6f - 2. Let h be s(-4). Suppose -hv + 2v = -16. Suppose -3p + 3m + 66 = 0, 0m - 4m - v = 0. Does 21 divide p? True Suppose 0 = 2p + 2p - 2r - 14, 4p + 7 = -5r. Let x(o) = -19 - o - po - 2o + o. Is x(-7) a multiple of 7? False Suppose 12y + 3q - 14 = 11y, 2q = 3y + 2. Suppose -yr = -46 - 70. Is 3 a factor of r? False Let l = 9 - 13. Let u(o) = 4o*3 + 4o*2 + 11. Let f(z) = -7z*3 - 7z*2 + z - 21. Let g(y) = 3f(y) + 5u(y). Does 5 divide g(l)? False Is 21 a factor of ((-11319)/14)/(-7)(-4 - -8)? True Suppose 82p - 5170 = 69696. Is 33 a factor of p? False Does 7 divide -12((-392)/(-48) + -11)? False Let c(k) = k*2 + 8k - 2. Let j be c(-6). Let a = j + 30. Is a a multiple of 4? True Let w = 13 - 25. Let k(o) = -o*2 - 13o + 6. Let v be k(w). Let d = v + 18. Is 15 a factor of d? False Let p be 1 + 2/(-2)-1. Suppose 0 = d - 1, 0 = -5t - 0t - 3d + 373. Suppose 4i = -2s - i + 46, ps - 2i = t. Is s a multiple of 13? False Let s = 10585 + -6875. Does 61 divide s? False Let n(z) = 63z + 471. Does 20 divide n(3)? True Suppose 5u - 4x - 12205 = -9x, 4u = -x + 9776. Suppose -9a + u = 105. Is 44 a factor of a? False Suppose 80j - 92j + 13452 = 0. Is 59 a factor of j? True Let m be 4 + (-2 - -2) + -2. Suppose -3z + 622 = -2g, g - 428 = -mz - g. Is 25 a factor of z? False Is 4(-222)/84-7 a multiple of 5? False Suppose -11f - 35 = -6f. Is f/(-70)-4 + (-2394)/(-10) a multiple of 11? False Does 27 divide 2/9 + 17755/9 - 2? True Let t(n) = -n*3 + 3n*2 - 2n + 2. Let x be t(3). Let z = x - -5. Suppose a - 7 = -z. Does 6 divide a? True Let z = -5 + 2. Let l be z/236/(-27). Suppose 3y + 99 = lf, 64 + 50 = 2f + 2y. Is f a multiple of 18? True Suppose 826 + 2266 = 2i - s, i = -3s + 1560. Is i a multiple of 36? True Suppose -2l = -11 + 1, 0 = -5v + 4l + 20. Is (2376/(-96))/(2(-1)/v) a multiple of 35? False Suppose 2b - 6b = 5g - 346, -5b = 5g - 350. Is 16 a factor of g? False Let s(a) = 8a3 + 2a*2 - 14a - 16. Let u(l) = 3l3 + l2 - 5l - 5. Let i(g) = 4s(g) - 11u(g). Is i(-4) a multiple of 3? False Suppose -5d = 3d. Let j(g) = 6g + 30. Does 2 divide j(d)? True Let i(u) = 185u*2 + 5u + 1. Is i(-2) a multiple of 43? True Is (-2)/17 + (-49380)/(-102) a multiple of 44? True Suppose 4w = 4, 7q - 2w = 4q + 631. Is 12 a factor of q? False Let m be ((-1 + 454)/(-3))/(-1). Suppose 4o - 519 = -5q - m, -214 = -2o + 5q. Suppose 0a + 5r - o = -4a, 50 = 2a + 2r. Is a a multiple of 20? False Let l = 24 + -26. Let h be (259 - (-2 - -3)) + l. Let r = h - 173. Is r a multiple of 19? False Let q = -5 - -5. Suppose 3a - k + 24 = q, 5k + 24 = -2a - a. Let h(l) = -l*2 - 8l + 5. Does 3 divide h(a)? False Let y(j) = 1152j + 6. Is y(1) a multiple of 25? False Suppose 0 = -3762h + 3755h + 7504. Is h a multiple of 47? False Let c(b) = b3 - 13b*2 - 60b + 74. Is 26 a factor of c(17)? False Suppose -2r - 3r + 15 = 0. Suppose -3j - 311 = -4a, -2a - rj = -7j - 168. Is a a multiple of 9? False Suppose 3q = 4c + 3 + 14, c + 2q - 4 = 0. Let r = c + 14. Does 2 divide r? True Suppose 4a - 14 = 3x - 43, -x = 4a + 1. Suppose 0 = -xy + 4y. Suppose -5g = s - 44, 0s - 3s + 2g + 98 = y. Does 17 divide s? True Let s(n) = n3 - 6n*2 - 12n - 4. Let w be s(9). Let r = w + -43. Suppose 4g + r = 4y, 2g = -4y + 69 - 11. Is y a multiple of 16? False Let x be (-69)/(-18) - 2/(-12). Suppose -i + 116 = -0i + 2d, -xd = 5i - 556. Suppose 2a - 3f = i, f = -a - 4f + 28. Is 16 a factor of a? True Is 6 + (-21)/7-141 a multiple of 12? False Suppose h = -f - 0h + 3, f - h - 3 = 0. Suppose -y + f = -2. Suppose 205 = yc - 15. Does 22 divide c? True Let o = 193 + -157. Is o a multiple of 4? True Let g = -65 + 100. Is 8 a factor of (-88)/(-5) + (-21)/g? False Suppose -3u = -0k + 3k - 9120, -u - 3034 = -k. Does 80 divide k? False Is (-35 - -1791)(-3)/(-4) a multiple of 70? False Is 7 a factor of (-280)/6(-990)/275? True Let r be (-2 + 364)/(4 + -2). Suppose -5o + v + r = 0, -2o + 54 = -6v + v. Suppose -2a - 5g + 2g = 2, 3g = 5a - o. Does 3 divide a? False Let n be (-4)/3(-9)/2. Let p(j) = 2j + 52. Is 16 a factor of p(n)? True Suppose -36n + 6890 = -11074. Does 8 divide n? False Let c = -67 - -63. Is 2/(c + (-3750)/(-935)) a multiple of 31? False Let j be (318)/3 - -3. Let x = 54 - j. Does 20 divide x? False Let k(x) = 10x*2 - 7x + 6. Let f be k(-7). Suppose 2l = 6l + 4u - 520, -4l + f = -u. Does 15 divide l? True Suppose 2z = -2i + 5z + 413, -4i + 861 = z. Suppose -110 = -6g + i. Does 27 divide g? True Let p(k) = -k2 + 31k - 24. Is p(28) a multiple of 20? True Suppose -3i = -14i + 3366. Does 9 divide i? True Suppose 246z + 38675 = 259z. Is z a multiple of 17? True Suppose 5d = -b - 4b + 860, -9 = 3b. Suppose -6 = -3m + 12. Suppose 3n = 2w + d, -n + w = -53 - m. Is n a multiple of 19? True Let y(a) = 4a + 19. Let k be y(-7). Let l = k - -17. Is 2 a factor of l? True Does 22 divide -35/(-3) + 149? True Suppose 2q = -2u + 42, -117 = -5u - 0q + q. Suppose 14z - uz = -1386. Does 14 divide z? True Let r(n) = -n*3 + 17n*2 + 3n + 14. Let q be r(17). Let u = q - -73. Does 23 divide u? True Is 50/3(1170/12)/13 a multiple of 19? False Let b(k) = -39k*3 - 3k*2 - k - 4. Let i(j) = -40j*3 - 2j*2 - 3. Let y(t) = 2b(t) - 3i(t). Does 5 divide y(1)? False Let l(k) = 16k - 37. Let g be 245/(1 - -9). Is 31 a factor of l(g)? True Suppose 0 = 12m - 1860 - 1308. Is m a multiple of 8? True Let u(p) = -24p - 40. Is u(-6) a multiple of 2? True Let w be 60/28/5. Suppose -11t = -10t - w. Does 4 divide t? True Let u = 685 - 218. Let o = u - 232. Is o a multiple of 23? False Let n be -2(-1)/(-2) + -12. Let c = n + 141. Is c a multiple of 33? False Suppose 6h - 47 - 19 = 0. Suppose 2a - ha = -288. Does 4 divide a? True Let y = -466 - -470. Does 4 divide y? True Let g = -640 - -1121. Does 13 divide g? True Suppose -6r + 6 = -8r. Let o be 7/4 + r/(-12). Suppose 0t - 4j + 106 = 3t, -ot = 2j - 68. Is t a multiple of 19? False Let i(r) = r + 50. Is i(-24) a multiple of 13? True Let g = 745 - 1066. Does 5 divide (-5)/40 - g/8? True Suppose p - 4m = -48, 0 = p - 5m + 19 + 25. Let q = p - -81. Does 4 divide q? False Suppose -5i = 98 - 473. Suppose -5k = 4h - 400, 3k - 4h - 197 = i. Is 11 a factor of k? False Let w = 38 + -7. Let p be w-14/4. Is 14 a factor of (-7)/((-7)/(-3)) - p? True Suppose 24 = 5b + 2c, -4c + 18 = -2b + 7b. Let d(l) = l3 - l2 - 3l + 6. Let y be d(b). Suppose -s - 2s + y = 0. Is 19 a factor of s? False Suppose 1 = z + 4, 0 = -2f - 5z + 89. Suppose -5u + u = f. Let i(l) = l*2 + 13l + 12. Is 6 a factor of i(u)? True Let p(a) = a - 2a + 0a + 1 + 0a. Let c(h) = -24h + 11. Let q(j) = 2c(j) - 22p(j). Does 13 divide q(-1)? True Is (3/18)/(((-171)/38826)/(-19)) a multiple of 9? False Suppose 557 = 3d + 2i, 0i - 940 = -5d - i. Is d a multiple of 16? False Let s(j) = -10j + 59. Is s(-7) a multiple of 6? False Let g(b) = b3 - 6b*2 + 6b + 5. Let i be g(7). Let w be (-2)/(-15) + i/(-45). Let f = 4 - w. Is f a multiple of	{ "pile_set_name": "DM Mathematics" }
832071/108. Calculate the common denominator of 49/30 and v. 540 Let p(f) = 7f + 39. Suppose -6m - 4g - 18 = -3m, 0 = m + 5g + 17. Calculate the smallest common multiple of 80 and p(m). 400 Let c(m) = -m3 - 7m*2 + 5m - 113. Calculate the lowest common multiple of 1688 and c(-9). 1688 Suppose -5o + 0o = -310. Let x = o - 137. What is the common denominator of -29/18 and 465/x10/36? 18 Calculate the common denominator of ((-32)/(-160))/(408/2310) and -27. 68 Let r be 1/(-4)0/(8/(-4)). Suppose -4 = -3k - 2i + 16, r = 4k + 4i - 32. What is the smallest common multiple of k and 21? 84 Suppose -2x = 5f - 349 + 74, 2f = -2. Calculate the lowest common multiple of 380 and x. 2660 Suppose -q = -2t - 470, -t + 373 = -4q + 2309. Calculate the lowest common multiple of 24 and q. 1944 Let q = -2/3199 + -233521/9597. Calculate the common denominator of 14/2455 and q. 7365 Suppose 4a = -t + 2627 + 1602, 4t + 1036 = a. What is the least common multiple of 18 and a? 3168 Let h = -3613/2 - -1767. Let s = -26459/3992 + 3/998. Let t = s + -255/8. Calculate the common denominator of h and t. 2 Let u(i) = 5i*2 - 3i - 2. Let k be u(-1). Suppose k = n + 2. Suppose 8 = -3o + no. Calculate the smallest common multiple of o and 18. 72 Let v = -2097326/515 + 20363/5. Find the common denominator of v and 62/25. 2575 Let m(b) = -b*2 + 5b - 2. Let p(l) = 2l2 + 1065l + 0l2 - 18 - 4 - 1036l - 3l2. Calculate the lowest common multiple of m(2) and p(28). 12 Suppose -12 = -3c, 0 = 5h - 4c + 25 + 26. Let j = 26 - h. Calculate the least common multiple of j and 3. 33 Let h = 29 + -34. What is the lowest common multiple of (h + 295/35)/(2/14) and 32? 96 Suppose -14l - 200 = -34l. Suppose -lp - 332 = -4122. What is the smallest common multiple of p and 4? 1516 Let k = -434505254857/18 + 270719795273909/11214. Let t = 2052924 - k. Let o = t + 2/89. Calculate the common denominator of o and 45/11. 77 Suppose b + 196v - 194v = 24, -87 = -3b - v. What is the smallest common multiple of 1950 and b? 1950 Let a = -155 + 162. Calculate the common denominator of (3/9)/(a/(2121/(-10))) and 55/164. 820 Let s = 6317 + -6293. Let z(p) = 32p3 + p2 - 1. Calculate the least common multiple of s and z(1). 96 What is the common denominator of (-1 - 6369/(-6471))/(12/9) and 23/22? 15818 Let j(u) be the second derivative of 5u*3/6 - 35u*2/2 + u - 51. Let p = 0 + 2. What is the smallest common multiple of p and j(11)? 20 Let l = 1836 + -20195/11. Calculate the common denominator of -6/349 and l. 3839 Suppose -5w + 491 - 141 = 0. Let n(v) = -v*3 + 79v*2 - 77v - 139. Let j be n(78). Let l = w + j. Calculate the lowest common multiple of l and 33. 99 Let l = 258 + -218. What is the least common multiple of 80 and (-4 - (l/(-12))/1)-96? 320 Let d be 76810/(-8700) - 4/10. Let o = d + 9/145. Find the common denominator of 205/189/30 and o. 12 Let t be (5/(-3))/(-5(-6)/(-90)). Calculate the least common multiple of (t/2 + -2)/((-3)/(-126)) and 18. 126 Suppose -2u - n = 50, u - 3 = 4n - 10. Let l = u - -43. Let h = -482006 + 482028. What is the smallest common multiple of l and h? 220 Suppose 672 = 32j - 25j. Let n(v) = -v3 + 7v*2 - 5v - 10. What is the least common multiple of j and n(5)? 480 Let n be (2/(-3))/((-6)/(-9)) + -5. What is the common denominator of (-1)/7 + 13180/8960 and n/(-16)31(-1)/3? 64 Let j = -5 - 155. Calculate the common denominator of 96 - 102 - 878/j and 51/8. 80 Let x(n) = -4n + 4. Let q be x(13). Let s = q + 69. Suppose 11l - 8l - s = 0. What is the common denominator of l and 69/8? 8 Let t = 5806 - 4266. What is the smallest common multiple of t and 224? 12320 Suppose -3d = 106 - 541. Let x = -358 + 2197/6. Find the common denominator of d/(-8)(-2)/20 and x. 48 Calculate the common denominator of 59/469 and 76238/4104(-3)/(-67). 2814 Let l(o) = -4o*3 + 2o*2 + 8o + 15. Let u be l(-6). Find the common denominator of (3/9)/((-707)/u) and -31/3. 303 Let w = 2031 - 9960. Let a = w - -63517/8. Calculate the common denominator of -101/126 and a. 504 Let l = -35614 + 7728188/217. Calculate the common denominator of -39/56 and l. 1736 Let p = -14183 - -468115/33. Find the common denominator of -97/222 and p. 2442 Let q = -289153/23544 + 332/27. What is the common denominator of 57/5 and q? 4360 Suppose 0 = -c + 3 + 9. Find the common denominator of -85/18 and (4/(-28))/(c/2086). 18 Let p = -6 + 81. Suppose 5k - p - 145 = 0. What is the least common multiple of k and 72? 792 Calculate the lowest common multiple of 2445 and ((-30)/4 - (-58 + 56))12/(-22). 2445 Let i be (3/2)/((-12)/167824). Let u = i + 587305/28. Calculate the common denominator of u and 55/6. 84 Find the common denominator of (-98)/22 + (-17 - -4 - (-14 + -1)) and (-21)/(432/(-298)). 1188 Let n be (-4)/10 - 424/(-10). What is the common denominator of ((-65)/3 + (-7)/n)/(-8) and 49/72? 144 Let u = -45 - -50. Suppose 2z = 6z - 4b + 588, 2b = uz + 726. Calculate the common denominator of (-78)/z10 - (1 + 0) and -23/10. 60 Suppose 0b + 848 = b. Suppose -2g - 3g + m + 1066 = 0, 2m = 4g - b. What is the common denominator of -53/2 and (-1)/(-5) - (g/40 - 5)? 20 Let u(k) = k*3 + 6k*2 + 10k + 27. Let n be u(-5). Suppose -3q - nq + 40 = 0. Calculate the smallest common multiple of 8 and q. 8 Let k(j) = -j*2 + 7j - 2. Let t(s) = 82 - 27 - 28 - 26. Let o(y) = k(y) + t(y). What is the smallest common multiple of 52 and o(5)? 468 Let i = -2 - -38. Suppose -9w = -13w - z + 137, 4w = -3z + 123. Calculate the least common multiple of i and w. 36 Suppose 2o = -107 + 103. Calculate the common denominator of -51/28 and (50 - 2)/(-3)o/84. 84 Suppose 3d - 3b = 18907 - 3760, b - 10095 = -2d. Let j = d + -40439/8. Find the common denominator of j and (2/22)/(49/(-2401)) + 9. 88 Let m be (2/126)/((-14)/17509). Let j = m + 1252. Find the common denominator of 23/18 and j. 126 Let n = 4493 - 15524. Let g be (n/(-150))/((-4)/5). Let z = g - -641/8. Find the common denominator of z and -57/2. 10 Suppose -66p = -61p + 4z + 5, -2p + 5z = -31. What is the lowest common multiple of p and 434? 1302 Let c(u) = 7u*2 + 5u + 378. What is the lowest common multiple of c(-11) and 45? 1170 Let c = -50 - -87. Let v = c + -39. Calculate the common denominator of 23/22 and -42043/(-4896) - v/(-17). 264 Let s = 84 + -82. Let a be (s/(-4))/(20/(-440)). Suppose a = -l + 19. Calculate the least common multiple of l and 6. 24 Suppose 16 + 44 = 10z. Let w be (-5 - -3)(-15)/(-10). What is the lowest common multiple of z and (w + 8 + 1)/1? 6 Let l = -20655/2 + 9278. Let y = l + 1075. Find the common denominator of y and -53/5. 10 What is the common denominator of 47/45 and 4228/302 - 14345/1032? 15480 Let q = 21/2 - 99/13. Let m = -349 - -717/2. What is the common denominator of m and q? 26 Find the common denominator of (-22)/(-120)(-20)/((-10880)/(-561)) and -23/640. 640 Let q be (30 - 80) + -1 + 1. Let j = 64 + q. What is the least common multiple of 92 and j? 644 What is the least common multiple of 14 and 48(-8 + ((-1488)/(-18))/8)? 112 Let v be (2 - (-201)/9) + (-2)/(-3). Suppose 20 = -vs + 30s. Suppose -9 = sb - 57. What is the smallest common multiple of 4 and b? 12 Calculate the common denominator of (40 + -46)/((-53)/(-17) + -5) and 157/21318. 170544 Calculate the common denominator of ((-459)/3060)/(((-48)/(-610))/(-2)) and -61/2596. 10384 Calculate the common denominator of 34/45 and (-2708)/(-12084) - (30/(-114))/5. 2385 Let i = 48 - 34. Suppose -72q + 84q + 54q = 1452. Calculate the smallest common multiple of i and q. 154 Suppose -3p + 24 = 3z, -30p - 31 = -3z - 26p. Suppose 4a = 5a - 24. What is the smallest common multiple of z and a? 72 Suppose 4b = -5l + 72, -5l - 18 = -b - 75. Calculate the least common multiple of 1116 and l. 1116 Let s = 22 + 327. Suppose 0 = u - 350 + s. Let p = 337 - 1028/3. Calculate the common denominator of p and u. 3 Let t = 632204707/302148 - 2049154/10791. Let j = t - 20920/11. Find the common denominator of j and 51/56. 168 Let c = 28490 + -28457. What is the smallest common multiple of c and 23? 759 Let t(g) = -8g - 54. Let d be t(2). Suppose -4o - 4c = 100, o + c = -2*	{ "pile_set_name": "DM Mathematics" }
(sqrt(2057) + -1)-4 + (1(2sqrt(102) - sqrt(102)))/(5sqrt(24)/sqrt(4) - sqrt(6)) + 5)*2. -14763sqrt(17)/2 + 8408609/16 Simplify (sqrt(72)2)2 + sqrt(72) + (sqrt(6)/sqrt(3)4 - sqrt(2)) + -4 + ((-3sqrt(242))2 - 3sqrt(16)/sqrt(8)). 6sqrt(2) + 2462 Simplify ((-5((sqrt(76) + -1)-4 + (sqrt(76) - (sqrt(76) + (1 + sqrt(76))5))) - 1(-2 + -2 + sqrt(76))3) + 3)*2. 3360sqrt(19) + 134464 Simplify ((5(sqrt(77)1 + sqrt(77) + sqrt(77) + sqrt(77)) + -3sqrt(77)2)/(sqrt(21)/(sqrt(6)/(3sqrt(2)))) + 4)2-3. -2300/3 - 112sqrt(11) Simplify (-6(sqrt(1000) + -2sqrt(1000)) - (sqrt(1000) - -3(sqrt(1000)1 + sqrt(1000))))/((sqrt(200)/sqrt(2) - sqrt(25))/(sqrt(5) + 2sqrt(320) + sqrt(320))). -250sqrt(2) Simplify -5((sqrt(98)/sqrt(2)2 - sqrt(49))/(sqrt(7) + (sqrt(1008) - ((sqrt(1008) - 1sqrt(1008)) + sqrt(1008))) + sqrt(1008)) + sqrt(28)/(-3sqrt(144)) + 2). -10 - 25sqrt(7)/234 Simplify -6((-2sqrt(784) - sqrt(784))/(sqrt(648) + sqrt(648)-3) - (-5 + sqrt(162)2 + (sqrt(162) - 3sqrt(162))3)*2). 2153sqrt(2) + 15702 Simplify (sqrt(72) - (4 + sqrt(72) + -2) - -3sqrt(72)-3 - (-2 + sqrt(72) + sqrt(72) + 1 + (1 + sqrt(72))1))2. 288sqrt(2) + 10372 Simplify (4(sqrt(245) - (-2 + sqrt(245))-6) + -4 - (sqrt(245) - (5 + sqrt(245)5) - (5 + (sqrt(245) - (sqrt(245) + sqrt(245)1)))))*2. -18228sqrt(5) + 237209 Simplify 1 + 1(5 + (2sqrt(91)16)/(-1sqrt(448)-4))*2. 15sqrt(13)/4 + 1781/64 Simplify -5(((-4 + sqrt(1872) + 0 - (sqrt(1872) + -1 + sqrt(1872))3)-2)2 + 4 + sqrt(1872) + 0 + 3 + -3). -936040 - 2460sqrt(13) Simplify ((5sqrt(152) - sqrt(152))-5 + 3-4sqrt(152))/((sqrt(200) - (sqrt(200) + sqrt(200)1-1)) + 6(sqrt(200) - sqrt(200)2)). 32sqrt(19)/25 Simplify (((sqrt(120)/sqrt(4))/sqrt(10) + -1sqrt(75))*2 + -4 - (sqrt(363) + 2 + -3)-2)4. 88sqrt(3) + 168 Simplify sqrt(1872) + -1sqrt(1872) + sqrt(13) + sqrt(1573) + sqrt(1573)2 - (-2 + sqrt(143)/(3sqrt(891) - sqrt(11))). 2 + 883sqrt(13)/26 Simplify (-2sqrt(99)-2 - sqrt(99) - sqrt(99))/(sqrt(576)2) + ((-1sqrt(891) + -5 - (sqrt(891) - (3 + (1sqrt(891) - sqrt(891))))) + -3)2. 1441sqrt(11)/8 + 3589 Simplify sqrt(20)/((sqrt(4) - sqrt(16)/sqrt(4))-6 + sqrt(4)) + -3 + (sqrt(180) + 3 + sqrt(5) + sqrt(500) + -4)2. -33sqrt(5) + 1443 Simplify (4-1(sqrt(170) + sqrt(170)2)-4)/(sqrt(160) + sqrt(10) + (-3sqrt(90) - sqrt(10))). -48sqrt(17)/5 Simplify -65(1sqrt(198)/(4sqrt(9)))/(3(sqrt(11) - sqrt(2816))). sqrt(2)/6 Simplify sqrt(21)/(sqrt(7) + (sqrt(42) + sqrt(672))/sqrt(6))-6 + 4 + 3sqrt(6)/sqrt(128). -5sqrt(3)/8 + 4 Simplify ((1 + (sqrt(931) + 0 - sqrt(931)) - -5-2sqrt(931)) + -2 + 3)*23 + 2. -840sqrt(19) + 279314 Simplify (((sqrt(133)-4 + sqrt(133))-6 - sqrt(133))4)/((5(sqrt(84) - (sqrt(84) + (sqrt(84) - sqrt(84)2 - sqrt(84)))))/sqrt(12)) + 4 + -3. 1 + 34sqrt(19)/5 Simplify (((sqrt(75)-13 - sqrt(75)) + 4)4)*2 + 1 + (-1sqrt(75) + 4)4. -2580sqrt(3) + 19473 Simplify (2((4 + sqrt(1573) + sqrt(1573) + sqrt(1573) + -1 + sqrt(1573) + sqrt(1573))1 - (sqrt(1573) + 1 + sqrt(1573) + -5)6)-4)*2. -266112sqrt(13) + 4979584 Simplify ((sqrt(4356)1 - sqrt(4356))/(-6sqrt(300)) - -4(4 + sqrt(432) + -2 + sqrt(432))-1)*2. 1536sqrt(3) + 27712 Simplify 6(-3(3 + (sqrt(2299) + 1)-5)45)2. 4752000sqrt(19) + 1241546400 Simplify ((4 + (sqrt(847) + 1 - sqrt(847)))*2 + -5 + (5 + (sqrt(847) - ((sqrt(847) - sqrt(847)2) + sqrt(847) + 3)))*2)-63. -15678 - 792sqrt(7) Simplify 4 + ((2(2sqrt(350)2 + sqrt(350)))/(31sqrt(700)))2. 86/9 Simplify (0 + (4 + (sqrt(847) - (-5 + sqrt(847)-2)) + -2)2 + -4)2 + 3. 1320sqrt(7) + 30595 Simplify -2 + (((-1sqrt(45))2 - sqrt(5)) + (sqrt(405)-2)*2)-4 - ((sqrt(385)/(1sqrt(11) + sqrt(11)))/(sqrt(7) - (sqrt(448)-1 + sqrt(448)))3)2. -26693/4 + 4sqrt(5) Simplify 4(((3sqrt(153))/sqrt(9)6-4 + 1)*2 + -1). -576sqrt(17) + 352512 Simplify (-2sqrt(40)/sqrt(2) + 6(4sqrt(20) + sqrt(20)))/(3-2sqrt(1440)-3). 7sqrt(2)/54 Simplify ((sqrt(540) + sqrt(540) + sqrt(540)1)/(sqrt(33)/(sqrt(44) + sqrt(11))) + ((-1sqrt(385))/sqrt(11))/(sqrt(7)1-5 - sqrt(7)))2. 528125/36 Simplify ((6(sqrt(605) + -2)2 + -4(1 + sqrt(605) + sqrt(605) - sqrt(605)) + 4)-5 + -1)2. -104720sqrt(5) + 982161 Simplify -2 + 4 + (2 + (sqrt(242) - (sqrt(242) + 2))*2 + 2 + 2)-4. -38 Simplify (4(sqrt(78) + sqrt(78) + 44sqrt(78))5)/((sqrt(162) - sqrt(162)2)/((sqrt(24) + sqrt(384))/sqrt(8))). -600sqrt(13) Simplify ((1sqrt(756)-2)/(sqrt(12)-2-5))/(-3(sqrt(144) + (sqrt(144) - (sqrt(144) - (sqrt(144) + sqrt(144)25))))). sqrt(7)/720 Simplify (((sqrt(931) + (sqrt(931) - (-1 + sqrt(931))) + -2 - sqrt(931)2-4) + 4)5 + -1)*2. 8820sqrt(19) + 1885471 Simplify (-2 + -3 + 2sqrt(1377)4)*2 + -3((sqrt(612) - ((0 + sqrt(612))6)2) + sqrt(612)1-5). -648sqrt(17) + 154249 Simplify (2((3 + sqrt(68))1 + 5 + 0 + sqrt(68) + 1sqrt(68) + -4))2. 192sqrt(17) + 2512 Simplify (-1 + (0 + 0 + sqrt(7) + -1 + (sqrt(175) + 0 - sqrt(175)) + 1(0 + sqrt(7)))2 + 0)5. -20sqrt(7) + 140 Simplify (-6(0 + sqrt(3)) + -5 + -1sqrt(3))2-4 - ((sqrt(432) - (sqrt(432) + (-4(sqrt(432) + 0 + sqrt(432)))2)) + -5). -280sqrt(3) + 26965 Simplify (4((sqrt(66) - sqrt(66)3) + sqrt(66)) - (6-1sqrt(66) + sqrt(66)))/(-3(sqrt(36)/sqrt(6) - sqrt(6)) - sqrt(54)/(sqrt(36)/sqrt(4))). -sqrt(11) Simplify 2(2(sqrt(84) - 1sqrt(84)) - sqrt(84) - sqrt(84))/((sqrt(168)/sqrt(3))/sqrt(8)) + 5. -8sqrt(3) + 5 Simplify (12sqrt(3520)3)/((-1-1sqrt(66))/(-1sqrt(600))). -480sqrt(5) Simplify -1((-4sqrt(99)3 - (sqrt(99) + sqrt(99) + -2 + sqrt(99))-2)*2 + -5)4. -14300 - 576sqrt(11) Simplify -6(-2 + sqrt(320)6) + ((sqrt(120) + sqrt(120)-1)/sqrt(12))/((sqrt(2) - (sqrt(200) + sqrt(200)-1)) + sqrt(2)). -288sqrt(5) + 12 Simplify (((1 + sqrt(1377))-1 + sqrt(1377) + (sqrt(1377)21 - sqrt(1377)) - ((sqrt(1377)-1 + -5 - (3 + sqrt(1377) + 1)) + 4))4)2. 3456sqrt(17) + 198544 Simplify ((5sqrt(60)21)/((2sqrt(108) + sqrt(108) - sqrt(108))3))2 + 3. 368/81 Simplify -6((sqrt(475) + sqrt(475)53 + 1)*2 + -3 + sqrt(475)-23 + 0). -729588 - 780sqrt(19) Simplify (sqrt(833) + -1 + -1 + -1 - ((1 + sqrt(833))-3 - -3(sqrt(833) + 0)))*2 + -4. 829 Simplify (6(0 + sqrt(162) + 4 + -5 + -1))*2 + 0. -1296sqrt(2) + 5976 Simplify (3 + (sqrt(325) + sqrt(325)2 + -3 - (21sqrt(325) + sqrt(325)))2 + (sqrt(325) + 3 + sqrt(325) + 5)2 + 2(sqrt(325) + 0))-6. -8256 - 1020sqrt(13) Simplify (-5(4((5 + sqrt(1300)-2 - sqrt(1300)) + -1)4 + 5))*2. -1656000sqrt(13) + 74999025 Simplify (-1sqrt(567) + 2 + (sqrt(567) + 1sqrt(567))6 - (sqrt(175) + -4 + sqrt(175) - sqrt(14)/(-2sqrt(2))))*2. 1062sqrt(7) + 219447/4 Simplify ((sqrt(1425) - 5(sqrt(1425) + sqrt(1425)-2))3)/(sqrt(48)/(2sqrt(400))). 900sqrt(19) Simplify 3 + (-5(5 + sqrt(12)/sqrt(6))1 - ((sqrt(200) - sqrt(20)/sqrt(40)) + -3)). -29sqrt(2)/2 - 19 Simplify (3 + 1 + sqrt(432) + sqrt(432)21 - (3 + sqrt(432)1 + 2 + sqrt(432) + sqrt(432)))22. 2 Simplify 3(((1sqrt(700) + sqrt(700) - sqrt(700))65)*2 + (((2 + sqrt(252))6 - sqrt(252)) + sqrt(252) + -4)*2). 1728sqrt(7) + 1917408 Simplify 4((sqrt(28) - sqrt(2268)1 - sqrt(28))/sqrt(4))*2-3 + (sqrt(14)/sqrt(8) + -5 - ((-1sqrt(343))2 + -1sqrt(7) + 5)). -7157 + 3sqrt(7)/2 Simplify (4 + 2sqrt(99) + -3 + 2 + 1sqrt(99))2 - ((sqrt(99) - -2(-4sqrt(99))2) + 4sqrt(99)-2). -2268 + 75sqrt(11) Simplify (-6(((sqrt(500) + (sqrt(500) - (3 + sqrt(500) - sqrt(500))))5 - (sqrt(500) - 2sqrt(500))-4)-1 + 3))2. -77760sqrt(5) + 659664 Simplify (3(-2 + (sqrt(76) - 2sqrt(76))6) + 4 + ((1 + sqrt(76) - sqrt(76)) + -4 - (sqrt(76) - (4 + -1sqrt(76)))) + 5)*2. -320sqrt(19) + 30416 Simplify (((sqrt(78) + sqrt(78)-1)-4 + (sqrt(78)1-6 - sqrt(78)))-4)/(51sqrt(384) + sqrt(384) + ((sqrt(384) - 1sqrt(384))-3 - sqrt(384))). 7sqrt(13)/10 Simplify (-1sqrt(147)/sqrt(3) + sqrt(98)/(sqrt(6)/sqrt(3)))/(sqrt(252)-4-3). 0 Simplify (((sqrt(156)/sqrt(3)-5)/(sqrt(4) + sqrt(64)1 + sqrt(4)) - (3 + -3 + sqrt(65)/(sqrt(25)/sqrt(5))))-4)2. 6292/9 Simplify (sqrt(252) + -3)2 + 2 - ((-2 + sqrt(252))-3 + sqrt(252) - sqrt(252)) - (sqrt(3402)1 - sqrt(42))/(sqrt(294)1 - sqrt(6))3. -22sqrt(7) + 257 Simplify (-5((sqrt(78)	{ "pile_set_name": "DM Mathematics" }
r o5 + o5 + 2o2 + 3o*4 - 2o*h - 5o*4. 2o*2(o - 1)*2(o + 1) Let a be (-6)/(3/(-1))-2. Let p be (-1)/5 - a/20. Solve -2/5s*3 + 2/5s + 0s2 + p = 0 for s. -1, 0, 1 Let q(b) be the first derivative of b5/15 - 7b*4/24 + 2b3/9 + b2/3 + 1. What is k in q(k) = 0? -1/2, 0, 2 Suppose -6 = 6u - 30. Factor -2/7d + 10/7du + 26/7d*3 - 4/7 + 18/7d*2. 2(d + 1)*3(5d - 2)/7 Let c(x) be the second derivative of x6/15 - x5/2 + 4x*4/3 - 4x*3/3 + 5x. Factor c(f). 2f(f - 2)*2(f - 1) Let u(r) be the first derivative of 9/2r2 - 3r*4 + 0r*5 - 6r + 1 + 2r3 + 1/2r*6. Find x such that u(x) = 0. -2, -1, 1 Let v be 37/(-2) + (-6)/(-12). Let c be (-8)/(-6)v/(-20). Determine q, given that 3/5q2 + 3/5 + cq = 0. -1 Let 2/11 - 8/11z3 + 8/11z - 6/11z4 + 4/11z*2 = 0. What is z? -1, -1/3, 1 Let i be 2/5 - 96/(-10). Suppose 4 - 4 - 2m*2 + im - 8m = 0. What is m? 0, 1 Let r be ((-14)/(-36) - 2/6)/1. Let j(n) be the second derivative of -n + 0 - 1/18n*3 + rn*4 - 1/60n*5 + 0n*2. Let j(v) = 0. What is v? 0, 1 Factor 15/7h - 18/7 - 3/7h2. -3(h - 3)(h - 2)/7 Let d = 247/10 - 121/5. Solve 5/2q + 1 + 2q2 + dq*3 = 0 for q. -2, -1 Factor -2/11f*2 - 4/11 + 6/11f. -2(f - 2)(f - 1)/11 Let y(d) be the third derivative of -d6/360 + d5/36 - 7d4/72 + d3/6 + 5d*2. Factor y(x). -(x - 3)(x - 1)*2/3 Let g(x) be the first derivative of 0x*3 + 1/9x*6 + 0x - 4 + 1/3x2 + 0x*5 - 1/3x*4. Factor g(f). 2f(f - 1)2(f + 1)*2/3 Let f = -3/76 - -179/684. Let j be ((-12)/(-21))/(-2)-7. Solve -4/9w - fwj + 0 = 0. -2, 0 Let s(i) be the third derivative of i6/30 - 8i5/15 + 8i*4/3 + 2i*2 - 24i. Find r such that s(r) = 0. 0, 4 Let o = 3 + -3. Factor o - 8/7a + 8/7a*2 - 2/7a*3. -2a(a - 2)2/7 Let h(p) be the second derivative of 0p*2 + 1/12p*4 + 3p - 1/12p3 + 0. Factor h(t). t(2t - 1)/2 Let l(b) be the third derivative of b8/252 - b6/90 + 3b*2. Factor l(d). 4d*3(d - 1)(d + 1)/3 Let s be (-33)/(-12) - (-1)/4. Let l(u) be the first derivative of s + 10/9u*3 + 2/15u*5 + 0u + 2/3u2 + 2/3u*4. Solve l(r) = 0 for r. -2, -1, 0 Let a be (-3)/(-3) + (-122)/348. Let t = a + 1/58. Factor tc*5 - 3c*4 - 14/3c*2 + 16/3c*3 + 2c - 1/3. (c - 1)*4(2c - 1)/3 Let x(t) be the third derivative of 0t*4 + 0t - 1/80t6 - t3 + 0 + 3/40t*5 + 8t*2. Determine a so that x(a) = 0. -1, 2 Solve -1/3v*4 + 5/3v*3 - 8/3v*2 + 0 + 4/3v = 0. 0, 1, 2 Let u(p) be the second derivative of p*6/70 - 3p*5/14 + 33p*4/28 - 20p*3/7 + 24p*2/7 - 8p. Factor u(g). 3(g - 4)2(g - 1)*2/7 Let d = -5894/11 - -536. Factor dk*3 + 0 + 2/11k - 4/11k2. 2k(k - 1)2/11 Let m(a) be the first derivative of -a4/14 - 8a*3/21 - 4a*2/7 - 8. What is n in m(n) = 0? -2, 0 Suppose 0 = 2q + 5s + 4, -2s + 0s = -q + 7. Suppose 3i - 3 = 3, i = qb - 4. Determine a, given that 2/5a*3 + 0 - 2/5a*b + 0a = 0. 0, 1 Let j(o) = 4o4 + 14o*3 + 22o*2 + 6o - 6. Let p(u) = u3 + u2 + u + 1. Let x(t) = -j(t) - 6p(t). Find n such that x(n) = 0. -3, -1, 0 Let y(o) = -o - 4 - 2o + 1 - o2. Let h(n) be the second derivative of n4/6 + 5n3/6 + 5n*2/2 + 4n. Let b(c) = 3h(c) + 5y(c). Factor b(z). z*2 Let q = 6102053 + -12429882557/2037. Let r = -2/291 - q. Factor -2/7p*3 - rp*2 + 0 + 0p. -2p2(p + 1)/7 Let n = -12 + 14. Suppose z = -nz. Determine b, given that 1/2b3 + b2 + zb + 0 = 0. -2, 0 Let w(f) be the first derivative of -f6/360 + f5/180 + f2/2 + 2. Let o(x) be the second derivative of w(x). Determine v, given that o(v) = 0. 0, 1 Let l(s) = -9s*3 - 22s*2 - 15s - 2. Let b(q) = -q*2 + 1. Let d(h) = b(h) - l(h). Factor d(x). 3(x + 1)*2(3x + 1) Let s(w) be the first derivative of 0w - 2w2 - 2/5w*5 - 4 - 2w*4 - 10/3w*3. Factor s(v). -2v(v + 1)2(v + 2) Let t(i) be the third derivative of -i*5/60 + 7i*4/24 + 2i*2 + 11i. Factor t(m). -m(m - 7) Let p be (-12)/(-2)18/(-27) - -4. Factor -2/5 + 2/5l2 + pl. 2(l - 1)(l + 1)/5 Let o(g) = 6g4 - 6g2 + 4. Let n(a) = a4 - a3 - a2 + a + 1. Let z(s) = -4n(s) + o(s). Find y, given that z(y) = 0. -2, -1, 0, 1 Let h(u) be the third derivative of 0 + 0u + 1/66u4 + 0u*3 + 3/110u5 - u2 + 7/660u6. Factor h(j). 2j(j + 1)(7j + 2)/11 Let o(m) be the second derivative of -3m + 0m2 + 0m*3 - 1/15m*4 + 0 + 1/50m*5. Factor o(v). 2v*2(v - 2)/5 Suppose 8f - 10f = -4. Factor -1/3 - 1/3yf + 2/3y. -(y - 1)*2/3 Factor -6p*2 + 223p - 223p + 2p*2 + 4. -4(p - 1)(p + 1) Let u(d) be the third derivative of -d5/15 - 5d4/24 - d3/6 + 3d2. Let x(j) = -3j*2 - 4j - 1. Let g(l) = 2u(l) - 3x(l). Factor g(z). (z + 1)*2 Let u(w) be the third derivative of -7w6/180 + w5/30 + w*4/9 - 43w*2. Factor u(t). -2t(t - 1)(7t + 4)/3 Let v = 81/70 + -5/14. Factor 1/5a*3 + 0 - 1/5a - va2 + 4/5a*4. a(a - 1)(a + 1)(4a + 1)/5 Let g(w) be the third derivative of 0w*3 + 4w*2 + 0w*5 + 1/240w*6 + 0w + 0 + 0w4. Factor g(q). q3/2 Let c(q) be the second derivative of -q7/1260 + q6/180 + q4/12 + 2q. Let b(d) be the third derivative of c(d). Factor b(i). -2i(i - 2) Let c(g) be the second derivative of -g5/80 + g4/16 - g*3/12 + 10g. Factor c(v). -v(v - 2)(v - 1)/4 Let w(d) = -d3 - d2 - 1. Let r(h) = h*3 + 6h*2 + 5h + 2. Let n(z) = -r(z) - 2w(z). Let y be n(5). Factor 2/3 - 2/3s*2 + ys. -2(s - 1)(s + 1)/3 Let i(j) be the first derivative of j5/120 + j4/24 + j3/12 + j2/2 - 1. Let s(k) be the second derivative of i(k). Let s(t) = 0. What is t? -1 Let 0 - 5r3 + 8r*3 + 13r*2 - 12 - 4r2 = 0. What is r? -2, 1 Let y(p) be the first derivative of -p4/36 - p*3/18 + p + 2. Let x(r) be the first derivative of y(r). Suppose x(k) = 0. Calculate k. -1, 0 Let n(b) be the third derivative of 2b7/735 + b6/42 + b5/15 + b4/14 - 13b2. Let n(f) = 0. Calculate f. -3, -1, 0 Suppose -3w = -6w. Let i(x) be the second derivative of 0x*2 + 2x + 1/6x3 + w + 1/42x*7 + 0x*6 + 0x*4 - 1/10x*5. Find p, given that i(p) = 0. -1, 0, 1 Suppose -3g = -0 - 6. Factor -2 + 2xg - 13x + 13x. 2(x - 1)(x + 1) Let y(i) be the third derivative of -1/140i*7 + 1/40i*5 + 0 + 0i - 1/24i4 + 1/672i*8 + 1/240i*6 + 0i*3 - 2i*2. Determine c so that y(c) = 0. -1, 0, 1, 2 Let u(q) be the third derivative of 3q*2 + 1/480q*5 + 0 + 0q*4 + 0q + 1/3q3 - 1/1440q*6. Let r(g) be the first derivative of u(g). Factor r(b). -b(b - 1)/4 Let h = 17 + -16. Let l be -4 + -52h/(-11). Factor 2/11s*2 + 8/11 + ls. 2(s + 2)2/11 Let z(a) be the third derivative of a6/90 + 2a*5/15 + 4a*4/9 + 47a*2. Find g such that z(g) = 0. -4, -2, 0 Let o be (6 - 0)(-20)/(-30). Suppose -c*2 - 5c*2 - 8c*4 + 2c - oc2 + 16c*3 = 0. What is c? 0, 1/2, 1 Suppose 0 - 1/3q - 1/6q2 = 0. Calculate q. -2, 0 Let g(x) be the third derivative of 0 + 1/60x5 + x2 + 2/3x3 - 1/6x*4 + 0x. Suppose g(t) = 0. What is t? 2 Let p(x) be the third derivative of 1/30x4 + 6x*2 + 0x + 0x3 + 1/1050x*7 + 1/120x*6 + 0 + 2/75x*5. Suppose p(m) = 0. What is m? -2, -1, 0 Suppose -3 = 4k - 11. Suppose 8 = -l + 2l - kf, l = -4f - 16. Factor 3/4q*4 + 0q + 0 + 3/2q3 + lq*2. 3q*3(q + 2)/4 Let p(j) be the third derivative of 1/180j5 + 0j + 0j3 + 0 + j2 + 1/72j*4. Suppose p(s) = 0. What is s? -1, 0 Let n(h) be the third derivative of -11h6/160 + h5/40 - 17h2. Let n(z) = 0. What is z? 0, 2/11 Let u = -14 + 25. What is t in -1 - t2 + 7t*2 - 3t*2 - u - 9t = 0? -1, 4 Let d(j) be the third derivative of j8/11200 - j4/4 + 3j2. Let s(q) be the second derivative of d(q). Solve s(k) = 0 for k. 0 Let d(s) = -s3 - 2s*2 + 3s + 2. Let z be d(-3). Suppose 0 = -zo - 2o. Factor -8r2 - r + or*2 - r. -2r(4r + 1) Let c = -45 - -47. Factor -1/4kc + 0 + 1/4k. -k(k - 1)/4 Determine t so that 3t*5 + 8t*2 + 0t*5 - 8t*4 - 4t + 3t5 - 2t*5 = 0. -1, 0, 1 Let d(w) = 1. Let a(k) = 2k*2 + 4k - 20. Let m(z) = 2a(z) + 28d(z). Factor m(f). 4(f - 1)(f + 3) Let f be 2 + (1 - 1)/((-2)/(-1)). Factor	{ "pile_set_name": "DM Mathematics" }
-6a147 In base 11, what is 6 - 27624? -27619 In base 6, what is -151 + 1543? 1352 In base 8, what is 24 + -6454? -6430 In base 9, what is -35211 + -15? -35226 In base 11, what is 125916 + -3? 125913 In base 4, what is -103000 + -1013? -110013 In base 15, what is -4 + 946a3? 9469e In base 10, what is -219 - 644? -863 In base 7, what is 35 + 11061? 11126 In base 2, what is -1 - -10101010101010? 10101010101001 In base 3, what is 210 - 102011210110? -102011202200 In base 16, what is -55 + -5f5? -64a In base 2, what is 0 - 101000001001111011? -101000001001111011 In base 9, what is 76146 + 3? 76150 In base 15, what is 53 + 266? 2b9 In base 8, what is -2 - 6531? -6533 In base 4, what is -1012002123 + -1? -1012002130 In base 4, what is 10111 - -23231? 100002 In base 3, what is 2 + 22121202221? 22121210000 In base 10, what is -3 + -41856? -41859 In base 8, what is 52 + 62460? 62532 In base 2, what is 1110010000110101 - 0? 1110010000110101 In base 16, what is -2e - 33da? -3408 In base 10, what is -976830 - 0? -976830 In base 15, what is -5d - 4e1? -54e In base 11, what is -3 - 119a1? -119a4 In base 13, what is -16ca + -5ca? -1cc7 In base 3, what is 110122210100 - -2? 110122210102 In base 4, what is 22213 + 1301? 30120 In base 9, what is 0 - -587417? 587417 In base 8, what is -370 + 262? -106 In base 12, what is -6302 + -1? -6303 In base 13, what is 1a + c8b7? c904 In base 8, what is -67004 + -3? -67007 In base 2, what is 100100111001 + 100001? 100101011010 In base 9, what is 61530 - -1? 61531 In base 2, what is 11111001101 + -10010? 11110111011 In base 4, what is 1310233 - -200? 1311033 In base 5, what is -3 - 1242242? -1242300 In base 5, what is 12 - -1314430? 1314442 In base 14, what is 19 + -13a9? -1390 In base 3, what is 220 + -1101101122? -1101100202 In base 8, what is -5 + -272571? -272576 In base 7, what is 1042 - 1124? -52 In base 10, what is -997 - -28? -969 In base 7, what is 324 + -2433? -2106 In base 12, what is 37736 + -4? 37732 In base 3, what is -12 - 200102001101? -200102001120 In base 4, what is -2 - -1011211331? 1011211323 In base 7, what is 2 + -425554? -425552 In base 16, what is 0 + 743a? 743a In base 15, what is 7c1 + 9? 7ca In base 6, what is 2255 - -101? 2400 In base 8, what is 20761 - -5? 20766 In base 6, what is 10 + -23311230? -23311220 In base 16, what is -1b77 + 4? -1b73 In base 6, what is 2 + 1355530? 1355532 In base 14, what is -503a87 - -5? -503a82 In base 15, what is -3 - -72385? 72382 In base 7, what is 0 - 3000616? -3000616 In base 12, what is -7 + 6b385? 6b37a In base 4, what is 223231 + 221? 230112 In base 13, what is -93c - -9? -933 In base 3, what is 121111012012 - -20? 121111012102 In base 11, what is 4 - -27550? 27554 In base 8, what is 1177 + 12? 1211 In base 7, what is -302620 - -116? -302501 In base 12, what is -1 - -255b13? 255b12 In base 15, what is -23 + -13c43? -13c66 In base 5, what is -104403 - 141? -110044 In base 12, what is -1 - 44260? -44261 In base 3, what is 210202210200 + -2? 210202210121 In base 8, what is -11 + -5001? -5012 In base 14, what is -b8 + 485? 3ab In base 11, what is -30497 - -12? -30485 In base 10, what is 961 + -4? 957 In base 16, what is -37f - -1ce? -1b1 In base 8, what is -5 - 65276? -65303 In base 5, what is 434 + -1100? -111 In base 2, what is -100 - -100000111001010001010? 100000111001010000110 In base 9, what is 1763 + 3? 1766 In base 11, what is 1890 + 110? 19a0 In base 12, what is -1047 + -402? -1449 In base 8, what is 11360 - -4? 11364 In base 6, what is -13010210 + -2? -13010212 In base 9, what is 3 + 27568? 27572 In base 16, what is -6efc + 4? -6ef8 In base 3, what is 0 - -210111012? 210111012 In base 8, what is 2214 - -1? 2215 In base 7, what is -552 + 2244? 1362 In base 14, what is d8d18 - 1? d8d17 In base 14, what is -5 + -56240? -56245 In base 5, what is 4134 - 33? 4101 In base 7, what is -146 - -1302? 1123 In base 12, what is 76062 + 1? 76063 In base 12, what is -141 + 42b4? 4173 In base 12, what is 369 + -5? 364 In base 5, what is -23 + -2202022? -2202100 In base 8, what is 1674 + 110? 2004 In base 7, what is 6255436 + -3? 6255433 In base 6, what is -23253 + 242? -23011 In base 11, what is 26822 - 4? 26819 In base 5, what is 313112 + 14? 313131 In base 10, what is 0 + 237473? 237473 In base 10, what is 10600412 - 2? 10600410 In base 13, what is -2 + -2c4b? -2c50 In base 16, what is 10e2d - -2? 10e2f In base 9, what is -1381280 - -1? -1381278 In base 14, what is 29aa5 + -3? 29aa2 In base 2, what is 101000 - -100111101? 101100101 In base 4, what is 131231312 + 12? 131231330 In base 8, what is 4 - -14777? 15003 In base 6, what is -14533040 - -3? -14533033 In base 16, what is 1 - -48d0? 48d1 In base 9, what is 131301 - 3? 131287 In base 4, what is 1232330 + 331? 1233321 In base 2, what is -101 - -100001100110111? 100001100110010 In base 7, what is 2400 + -31? 2336 In base 5, what is 2 - 201321? -201314 In base 8, what is 10 - -3344? 3354 In base 11, what is 6a2 + 3? 6a5 In base 3, what is -20 - 101110210? -101111000 In base 14, what is -1c + 7a? 5c In base 14, what is -6 - 1a970? -1a976 In base 15, what is -550b93 + 2? -550b91 In base 9, what is 2066 - 6622? -4545 In base 11, what is -1588329 + 5? -1588324 In base 2, what is -1001 + -1000110110011100? -1000110110100101 In base 15, what is -8da4 - 2? -8da6 In base 9, what is -248 + 4432? 4173 In base 16, what is 4f5 - -7b? 570 In base 10, what is 1911 - 1512? 399 In base 13, what is -6516 + -3? -6519 In base 16, what is -5 + 163d? 1638 In base 14, what is -17d70 - -2? -17d6c In base 9, what is 1187 + 1350? 2547 In base 10, what is -7464 + -5? -7469 In base 13, what is -3 + 719b5? 719b2 In base 14, what is a77 + -11? a66 In base 14, what is -4 - 12a7a3? -12a7a7 In base 8, what is -5 + -310047? -310054 In base 3, what is 0 + 2101200? 2101200 In base 11, what is 827 - -18? 844 In base 3, what is -1012021 + -122? -1012220 In base 13, what is 11 - 61237? -61226 In base 2, what is 10 - -10110111111? 10111000001 In base 15, what is -d0 - -1c38? 1b58 In base 3, what is -1220 + -11000002222? -11000011212 In base 11, what is -3766 - -3a? -3727 In base 13, what is 9b6 - 22? 994 In base 9, what is 7 - 75374? -75366 In base 9, what is 1715 - -114? 1830 In base 10, what is 7468 + -4? 7464 In base 2, what is 1001110111000000100100 + 1? 1001110111000000100101 In base 16, what is -5 - -5782? 577d In base 12, what is -5 - -454306? 454301 In base 5, what is 2 - 242201? -242144 In base 5, what is 123304 + 144? 124003 In base 11, what is 5 - -51a4? 51a9 In base 4, what is -2 - 1222131? -1222133 In base 15, what is -5 + b4b2? b4ac In base 14, what is 1 - c901? -c900 In base 7, what is -12 - 3342611? -3342623 In base 5, what is -14 - 1031242? -1031311 In base 8, what is -737272 + 4? -737266 In base 12, what is 9 + -11b6? -11a9 In base 14, what is -18 - -850? 836 In base 6, what is 2 - -1131110? 1131112 In base 15, what is -6 + 33b3? 33ac In base 2, what is 100 - -10101111011? 10101111111 In base 14, what is -3 + acd68? acd65 In base 6, what is 12111330 - -13? 12111343 In base 7, what is 14312 + 2? 14314 In base 10, what is 703 - 56? 647 In base 8, what is -636145 + 1? -636144 In base 9, what is 203 + 15516? 15720 In base 9, what is 58740 + 5? 58745 In base 12, what is 1a + 2681a? 26838 In base 11, what is -4 - 290693? -290697 In base 13, what is 110 + -9? 104 In base 9, what is -173 + 271? 87 In base 4, what is 110001330 + 113? 110002103 In base 2, what is -101010 - 1010000111100? -1010001100110 In base 2, what is -11000110000 + -1010? -11000111010 In base 14, what is -11bc6 + 16? -11bb0 In base 16, what is -62 - 347d? -34df In base 7, what is 141562 - 2? 141560 In base 12, what is 8504 + -183? 8341 In base 6, what is -14 + 3553? 3535 In base 13, what is 637b - 72? 6309 In base 9, what is 158166 + 1? 158167 In base 6, what is 22 - -40153? 40215 In base 7, what is -5 + -126241? -126246 In base 5, what is -4 - 342141? -342200 In base 2, what is -110000110 + -100110001? -1010110111 In base 15, what is 4d + -1227? -11c9 In base 7, what is -4 - 1326? -1333 In base 16, what is 57 - -47f? 4d6 In base 4, what is 103101301 + 1? 103101302 In base 5, what is 3214242 - 13? 3214224 In base 14, what is -29 + b1b? ad2 In base 5, what is 2322132333 + 1	{ "pile_set_name": "DM Mathematics" }
. Let t be (-124)/(-10) - (-10)/o. What is the highest common divisor of t and 30? 6 Let s = 30 - 26. Suppose -sv - 2o = -3o - 125, -5v + 154 = o. What is the greatest common divisor of v and 341? 31 Suppose -6c = -10c - 132. Let w = -27 - c. Suppose 0 = s + ws - 56. Calculate the highest common factor of 64 and s. 8 Let b = 57 - 41. Suppose -4y = 4j - 9j + 560, -3j + 336 = 3y. What is the highest common divisor of j and b? 16 Let m = -130 + 194. Let t = m - -13. Calculate the highest common factor of 11 and t. 11 Let r = 162 + 76. What is the highest common factor of r and 14? 14 Let q be ((-10)/(-7))/(8 - (-4142)/(-518)). Calculate the highest common factor of q and 74. 74 Let h(m) = 4 + 3m - 5m - 8m + 2m. Let x be h(3). Let k be 4/(-6)(x + 2). Calculate the highest common factor of k and 60. 12 Suppose 6v = 3v - 5h, 4v - 5h - 35 = 0. Let g(a) = -a*2 - 13a - 14. Let x be g(-11). Let n = x + 12. Calculate the greatest common factor of v and n. 5 Let r(t) = t*2 + 8t - 6. Let n be r(-9). Suppose 0 = -l + 2, 37 = -nu - 0u - l. Let f = -4 - u. What is the highest common factor of f and 3? 3 Let z be 4/(-9) + ((-386)/(-18))/1. Calculate the highest common divisor of 819 and z. 21 Let z = 116 + -42. Suppose 3s = 5s - 2n - 130, s - 4n - z = 0. Suppose -s - 343 = -5b. Calculate the greatest common divisor of b and 27. 27 Let d = 8 + -5. Let r be ((-42)/56)/((-2)/32). What is the highest common factor of d and r? 3 Suppose -3o + 0o - 6 = 0, -3o = 2f - 94. Suppose 0 = 2s - k - f, 5s - 119 = 4k + 6. Calculate the highest common divisor of 10 and s. 5 Suppose -5l + 2d = 269, 0 = -l + 2d - 5d - 64. Let h = l - -106. Calculate the greatest common factor of 17 and h. 17 Let o = 2 + 2. Let u be 8/(0 + o/16). Calculate the greatest common factor of 80 and u. 16 Let n be -1 + (13 - 4) - -22. Calculate the highest common factor of n and 312. 6 Let i(a) = 4a2 + 29a - 165. Let j be i(5). Calculate the highest common factor of 480 and j. 80 Suppose 3j + 5o = 8j + 165, 141 = -4j - 5o. Let u = j - -50. What is the highest common divisor of u and 24? 8 Let k be 3 + (-3)/(9/(-6)) + 0. Suppose -k = -u, -r = -2r - 3u + 70. Suppose 0 = d - 1 - 10. What is the greatest common divisor of r and d? 11 Let z(q) = 113q - 196. Let d be z(2). Suppose 0 = 4k - w - 124 + 9, 3k - 70 = 4w. What is the greatest common factor of d and k? 30 Suppose 4d = -7d + 1122. What is the highest common factor of d and 170? 34 Let m be 2(-3)/(-12)0. Let l = m + 3. Let n be ((-3)/2)/(2/(-12)). What is the highest common divisor of l and n? 3 Let l(v) = v - 9. Let m = 16 - 4. Let z be l(m). Let h(s) = 4s*2 - 4s + 2. Let r be h(z). What is the greatest common divisor of 65 and r? 13 Let u = -6078 + 9214. What is the greatest common divisor of u and 112? 112 Suppose 5h - 118 = -4q, -2q + q - 2h = -31. Let x = -448 + 457. Calculate the greatest common divisor of x and q. 9 Let d = 67 - 47. Let q = -25 - -32. Suppose -5l = -ql + 16. Calculate the greatest common factor of l and d. 4 Let x be 5/(-1) + 0 - -49. Calculate the highest common divisor of 1188 and x. 44 Suppose 2m - 33 = 19. Suppose -g = -m - 4. Suppose 95 = -3d + 155. What is the highest common factor of d and g? 10 Let b(z) = 4z3 + 2z*2 - 4z - 3. Let s be b(5). Let m = -368 + s. Let i = m - 63. What is the greatest common divisor of i and 24? 24 Let g = -609 - -801. What is the greatest common divisor of 3 and g? 3 Let g = 2183 - 1270. What is the highest common factor of g and 11? 11 Suppose -5o + 69 + 51 = 0. Let l be (-126)/24o/(-9). Calculate the greatest common factor of 35 and l. 7 Suppose -6r - 30 + 30 = 0. Suppose k + 24 = 2n - rn, -90 = -5n - 5k. Calculate the highest common factor of n and 98. 14 Suppose -z = 2z - 96. Suppose z = 4h + 4d, 3h + d + 8 = 4h. Suppose 0 = 6n - 3 - 3. What is the highest common factor of n and h? 1 Suppose -5f = 4o - 29, -o + 2f - 3 - 6 = 0. Let r = -894 - -895. Calculate the greatest common divisor of o and r. 1 Let s = 144 + -84. Let i = -57 + s. Calculate the greatest common factor of i and 2. 1 Let r(t) = -3t2 - 5 + 0 + 4t*2 + 7 + 3t. Let p be r(-7). Calculate the highest common divisor of p and 12. 6 Let s = 2484 + -1484. What is the greatest common divisor of 40 and s? 40 Let y(v) = 44v3 - 5v + 5. Let k be y(1). Calculate the highest common factor of k and 198. 22 Let c(l) = -2l3 + 26l*2 - 60l + 9. Let k be c(9). What is the greatest common factor of k and 273? 39 Let b(y) = -101y - 526. Let x be b(-6). What is the greatest common factor of x and 12? 4 Let p = -205 + 365. Let i = -116 + p. Calculate the greatest common divisor of i and 110. 22 Let u = -292 + 367. What is the highest common divisor of 105 and u? 15 Let w be ((-4)/3)/(0 + 4/(-24)). What is the greatest common factor of 8 and w? 8 Let d = 113 - 113. Suppose d = -4i + 5 + 195. Suppose -2l - 5r + 5 = 0, 3l + 3r - 17 = 4. Calculate the greatest common factor of i and l. 10 Suppose u + 6 + 14 = 3s, 2u - s = -60. Let o be (u/24)/(2/(-12)). Let v = o + -5. Calculate the highest common divisor of v and 27. 3 Let g be (-10)/(0 - 2/3). Let j be ((-1)/(-1))/(4/(0 - -80)). Let a be -3j/12-1. What is the greatest common divisor of g and a? 5 Suppose 45u - 47u = -704. What is the greatest common factor of u and 22? 22 Let k be (-4)/(-28) + (-26)/(-14). Suppose -x + 8 = -k. What is the greatest common divisor of 40 and x? 10 Let w = 273 - 86. Let g(o) = 10o - 23. Let s be g(12). Let x = 114 - s. What is the greatest common divisor of x and w? 17 Let x(r) = -22r*3 + 2r*2 + 7r + 6. Let v be x(-2). Calculate the highest common divisor of 66 and v. 22 Let r = 381 + -201. Suppose 28 = 2w + 4a, 3w - 75 = -0w + 5a. What is the highest common factor of w and r? 20 Let y = 938 + -788. Let t be 24((-5)/(-2) - 0). Calculate the highest common factor of t and y. 30 Let p(s) = 22s + 118. Let l be p(-5). What is the greatest common factor of l and 8? 8 Let y(k) = -k3 - 7k*2 - 10k + 11. Let z be y(-5). Calculate the greatest common divisor of 77 and z. 11 Let a = -150 - -180. Let u = -22 + 67. What is the greatest common divisor of a and u? 15 Let f be 1484/14 - (-14)/(-49). What is the highest common divisor of 126 and f? 42 Suppose 0 = x + 5, 0 = -10n + 5n + x + 115. Suppose -42h = -46 - 38. What is the highest common factor of h and n? 2 Let f be 36 + 1 + 5 + -2. Let t(m) = -m*2 - 24m - 28. Let w be t(-21). Let x = 51 - w. What is the greatest common divisor of f and x? 8 Let o be (11 - 1) + (1 + -3 - 5). Calculate the highest common factor of o and 3. 3 Let w = 106 + 34. Let v(q) = q*2 + 120q + 2431. Let h be v(-25). Calculate the greatest common factor of h and w. 28 Let y(j) = 2j3 + 22j2 + j + 26. Let h be y(-11). Let n be 7/((-35)/h) - -21. Calculate the greatest common divisor of 9 and n. 9 Let u = 30 - -18. Let w(d) be the third derivative of -d5/30 - d*4/24 + 2d*3 + 27d*2. Let x be w(0). Calculate the highest common divisor of x and u. 12 Let v(s) = 2s - 31. Let k be v(18). Suppose 10 = -kh + 7h. Calculate the greatest common divisor of h and 40. 5 Suppose k + 357 = 6k - 4m, 5m + 15 = 0. Calculate the highest common factor of k and 23. 23 Let z(o) = 2o*2 - 4o. Let i be z(3). Let q be 1/(-3) - (-140)/i. Let v = -22 + q. Calculate the greatest common factor of 1 and v. 1 Suppose 0 = g + 7g - 520. Calculate the greatest common divisor of g and 5. 5 Let q(u) = 5u*2 + u + 1. Let w be q(-1). Let t = 6 - 4. Suppose 0 = -ts + 9 + w. What is the highest common factor of 7 and s? 7 Let a be ((-36)/42)/3 + 30/7. Suppose -5d = -ad - 39. What is the greatest common divisor of 13 and d? 13 Suppose 12c - 35 = 7c. Calculate the greatest common divisor of 49 and c. 7 Suppose c - 2 = -0c. Suppose -l - 56 = -5t, 0 = -t + l + 6 + c. Calculate the highest common divisor of 120 and t. 12 Suppose -191 = -z - 63. Suppose -2x = -7x + 50. Let m be (-156)/(-10) + 4/x. Calculate the greatest common factor of m and z. 16 Let n = -2504 + 2544. Let u(j) = j - 8. Let w be u(8). Let f be 9 - ((2 - 1) + w). What is the greatest common divisor of n and f? 8 Let f(o) = -3o - 6o*2 + 0o - 2o*3 - 6	{ "pile_set_name": "DM Mathematics" }
4c + 3o + 19 = 0. Let n be y(c). Let q = n - 3. Solve -q = 3j - 2l, -5j + l - 3l = -11 for j. 1 Let n(v) = v*2 + 6v + 6. Let b be n(-7). Solve 0p = h + 5p - b, p - 2 = 0 for h. 3 Let t be 4 - (-1 - 2)/(-3). Solve 0o + o - 1 = -s, -to + 3s + 15 = 0 for o. 3 Suppose 0 = 2r - 27 - 1. Solve -2c - f - 17 = 3c, 5c + r = -2f for c. -4 Let w = -53 + 55. Solve 3o - 9 = -0p + p, 2p - 6 = -wo for o. 3 Let c(d) = 15d + 2. Let g be c(1). Let l = -9 + g. Solve 2q - 3h + 4 = q, 2q + 4h + l = 0 for q. -4 Let u(i) = -5i. Let v = 3 + -4. Let z be u(v). Suppose 3y - 3q - 11 = 4, -3y + 4q + 20 = 0. Solve y = -l - zm + 2, l - 2 + 0 = 4m for l. 2 Let i(l) = -l*3 + 4l*2 + 6l - 4. Let h be i(5). Suppose -h = -3r + 14. Solve -x + 4g = 15, 2x = -x + rg - 17 for x. 1 Suppose 18 = -k + 20. Solve -5d + 20 = 2c + 3c, 14 = kc - 4d for c. 5 Let p = 9 + -7. Suppose -25 = 3i - 8i - 4f, -13 = pi - 3f. Let n be (0 - i)/(2/(-10)). Solve -4 = -4z - 3s + 1, 30 = nz - s for z. 5 Suppose 0c - 3c + 6 = 0. Suppose -ci = -10 - 0. Solve 3n + iv = 28, v = 4n - v + 6 for n. 1 Let v be (-56)/26 - 2/(-13). Let z(s) = -2s*3 - 3s*2 - 3s - 3. Let n be z(v). Solve 4t + 3y = -n + 1, -2 = 4t + y for t. 0 Let f(s) = -2s - 25. Let h be f(-14). Solve -3 - h = -x - 5n, x + 10 = 3n for x. -4 Let t = -45 - -45. Solve 3p - 2v + 4 = -2p, 2p - 2v + 4 = t for p. 0 Let n = 11 - 7. Solve -3o = -3k - 4o, 0 = -nk + 5o for k. 0 Let p be (-76)/114 - 23/(-3). Solve -3t + 6 = 5o - p, 3 = 3t + 3o for t. -4 Suppose -u + 0v - 2v + 27 = 0, 5v - 10 = 0. Solve 20 = -5k + 5z, 3k - 4z = 6k - u for k. 1 Let k = -1 - 1. Let d(o) = -o*2 - 10o - 2. Let a(t) = t. Let c(g) = 6a(g) + d(g). Let h be c(k). Solve -hu = 2w + w + 15, 0 = -w - u - 6 for w. -3 Let q be ((-8)/(-10) - -3) + 11/55. Solve d + 3n = -8, -d - n = -qn - 4 for d. -2 Suppose 4j - 2l - 18 = 0, -2j - 2l = -0j. Solve 3n = 3d - 5 + 2, 2n = jd for d. -2 Let j(w) = -w*2 + 6w + 19. Let h be j(8). Solve -hv + 4s + 16 = 0, -v + 4 = -s - 0s for v. 0 Let m = -20 + 36. Solve -4 = -3u + 4t, -2t - 8 - m = 4u for u. -4 Let s = -10 + 14. Suppose 2m + s = 4m. Suppose y = my - 7. Solve -c - 5q = -14, -5c = -0q + 4q - y for c. -1 Let q(k) = -k + 6. Let s be q(6). Let l be (12)/((-6)/(-9)). Suppose 6 = -x + lx. Solve -5r - v + sv + 21 = 0, xr = 5v + 7 for r. 4 Let p(y) = y*2 + 5y - 9. Let s = -1 - -1. Suppose sa = 2a + 14. Let q be p(a). Solve i + 3i + f = 7, -3i + qf + 34 = 0 for i. 3 Let g(i) = -2i*2 + 7i + 8. Let y be g(6). Let d be (-62)/y - 4/(-22). Solve 4l = -ds - 9, 5l - 3s + 6 = -5s for l. 0 Suppose 15i - 23 - 7 = 0. Solve -x - 15 = -3c, c + ix - 15 = -2c for c. 5 Let n = 3 + 27. Solve -4g = -g - 2s - 7, 5s = -5g - n for g. -1 Let k be (-1 - -2 - 1)-1. Let l = k + 3. Suppose 0 = -ld - 3a + 9, 0 = -a + 3a. Solve 0 = -2p - 5r - 12, dp - 3r - 4 = p for p. -1 Suppose 5z + 2h + 6 = 0, -3z - 2h - 2 - 4 = 0. Let o = 2 + z. Let n = 5 - o. Solve -3a = -8f + 3f - 6, 0 = -nf + 3a for f. -3 Suppose 0 = -5u - 2i + 6, i - 8 = 5i. Solve -27 = 5y + uq, -4y + 4q - 16 + 0 = 0 for y. -5 Let j be 8/20(-30)/(-2). Let p = j - 4. Solve 8 + p = 4w - 2q, -3w - 5q = -1 for w. 2 Let m be (3 - -2)/(2 - 1). Suppose v = mv - 24. Suppose -3a = -va. Solve 0p = -4p - 16, -3h + 4p + 16 = a for h. 0 Suppose 143d - 4o - 20 = 146d, 3d + 3o = -15. Let t = 5 - 2. Suppose -6b + 9 = -tb. Solve -n + b = -2a, 4a = -4 - d for n. 1 Let q(l) = 3l + 20. Let d be q(-5). Solve r - 3a + 8 = -0r, -da + 17 = 2r for r. 1 Let x(b) = -2b - 5. Let r be x(-4). Solve 5 = 3c + rs - 2s, -2c = -2s + 2 for c. 1 Suppose -2 = r - 12. Solve -5x + 10 = -u + 4u, 3u + r = 5x for x. 2 Suppose 4i = 4i + 8i. Solve 5r + in + 3 = 4n, 5 = 3r + n for r. 1 Let v = -43 + 46. Solve 3c - 6 = 2s, vs + 15 = c - 2s for c. 0 Let n = 19 + -11. Solve -n = -5l + 3w + 4, 2l = -4w + 10 for l. 3 Suppose 4x - 34 = 3x + 2r, -5x - 4r + 114 = 0. Solve 5a = 4i + x, a - 14 = 2a + 4i for a. 2 Let o = 17 + -17. Solve -h - 5l + 1 + 4 = o, h = -4l + 3 for h. -5 Let h be 9 + -1 - (-3 - -4). Suppose hf - 20 = 3f. Solve -fb + 3a + 30 = 2a, -4a - 20 = 0 for b. 5 Let t = -11 - -14. Solve z = -0z - 3l, -tl = 5z for z. 0 Suppose 5u = -15, 2d + 5u + 15 = 4. Let h(v) = v*2 + 3. Let j be h(0). Solve 0 = f + jo + d, -f + 0 - 2 = -o for f. -2 Let f = 1 - 53. Let u = f - -74. Solve 2o - 7 - 11 = 5d, 2o = -5d - u for o. -1 Suppose 0v - v - 8 = -5b, -v + 4b - 6 = 0. Solve -5w = -vg - 2, 3 = -2w - 0w - 3g for w. 0 Let r(q) = -q - 5. Suppose -2p - 14 = -2. Let f be r(p). Suppose -2a + f = -4d + 13, 5d - a = 21. Solve 2i + 21 = ds, 2i + 2s - 18 + 4 = 0 for i. 2 Suppose r + 2 = 2q, 3q + 3r = -2r + 16. Let x(y) = -y + 3. Let o be x(-6). Suppose o - 11 = -h. Solve s = -qd - 2d - 8, 3s - d - h = 0 for s. 0 Let j be (-10)/(-4)(-1 - -3). Let w be j(-2 + 3) + 0. Suppose -3z = 3h + 2h - 24, 4h - wz + 3 = 0. Solve 3b - m + 6 = -0, -hm - 21 = 4b for b. -3 Suppose 4r - 4 - 12 = 0. Let o = 9 - 1. Suppose 4p = op. Solve p = -v - 4q - 13, 4v - v + 23 = -rq for v. -5 Suppose u - 44 = -5k, -5u + 38 = 5k - 2. Solve 5t + k = 29, 5f = 3t - 37 for f. -5 Let m(y) = -y3 + 8y*2 - 7y. Let l be m(7). Solve l = 4p + 2q - 12, 5p = q + 2q + 37 for p. 5 Suppose 3w = 2o + 31, -o - 30 + 11 = -5w. Let p be -7((-36)/o)/(-3). Let b be (0/3)/2 + 17. Solve j + b = -5a, -a = -pa + 3j - 9 for a. -3 Let h be ((-1 + -2)/(-3))/1. Let l be 0 + h + 2 + 0. Solve -3f - d + 1 = -l, 4f - 16 = -4d for f. 0 Let l = 10 - 13. Let p be ((-6)/(-4))/(l/(-10)). Solve 29 = 4a + a - 2q, -35 = -5a + pq for a. 5 Let m be 6/(-15) - 18/5. Let x be (-6)/(-3) + (m - -6). Solve 2a + 10 = xv, -a - v - 4v = -16 for a. 1 Let j(g) = g2 - g. Let m(r) = -r3 + 6r*2 - r + 8. Let p be m(6). Let b be j(p). Solve -2k - 7 = -3u, 9u = -bk + 4u + 1 for k. -2 Suppose d + 4x = 17, 4d + 4x = 5d + 7. Let c be (2 - 0)/((-2)/(-3)). Solve cg = -t - d, 5t + 3g + 20 = -5 for t. -5 Let x = 2 - 2. Let m be (0 - x)(-1 - 0). Solve -4t - 4f - 28 = 0, -3t + mf - 24 = 4f for t. -4 Let x be (5 - (3 + -3)/3) + -1. Solve 4p + 3l - 4 = 0, xl = -4p + 2l + 8 for p. 4 Suppose 0 = -5o + x + 129 - 24, -2o = -3x - 55. Let r be 2/((-16)/o)-4. Solve 5u = -5h + r, 4u = -4h + h + 6 for u. 0 Let m(v) = v*2 + 14v + 17. Let o be m(-13). Solve 3b + oy = 2y - 17, -3b - 13 = -2y for b. -5 Let p be 2 - (-2 - -2)1. Solve 3m + 2 = -4b - 0m, m = pb + 6 for b. -2 Let w(m) = -m*2 - 8m - 7. Suppose 0 = x - 3x - 4, 5o + 32 = -x. Let n be w(o). Solve -3 = -2d - 2d + g, -5 = -ng for d. 1 Suppose y + 0y - 1 = 0. Let g = y - -37. Let k = 54 - g. Solve 3 = m + t, -4t + 44 - k = -4m for m. -2 Suppose -3a = -0a - 12. Suppose -h - ah = 0. Solve -4q = 3o - 15, 4o = -hq - 3q + 13 for o. 1 Let z be 4/14 + (-4)/14. Suppose -5x + 15 = -0x. Suppose z + x = n. Solve -17 = -3g + v, v + n = -2 for g. 4 Let l be ((-18)/(-8))/((-6)/(-16)). Let z(o) = -3o*2 - 7 - 7o + 4o2 + 3o. Let a be z(l). Solve 5b = 5t - a, 1 = -3b - b + t for b. 0 Suppose 3m - 27 = -2w, 10 = -0m + 2m. Let z = w + -3. Let v be 4/(-26) - 84/(-39). Solve 1 = 5f + 4r, -vf + 5f - zr = -21 for f. -3 Let a = 57 - 28. Solve 2c - a = 5y, 0 = -5y + y + c - 22 for y. -5 Let b be 4(-2)/20 - 32/(-5). Solve 1 = f - g - 2, -4f - b = 5g for f. 1 Let l = 2 + 1. Let d = 13 - 11. Solve 0 = -dm + 3n - 13, ln - n = -5m + 15 for m. 1 Let y(a) = 2a3 - 11a*2 - 3a + 6. Let p be y(6). Solve 4l + p = 4f + l, -1 = -3f - 2l for f. 3 Let z = 7 - 3. Suppose zp = 5 - 57. Let f be (-3)/1 - (p + 5). Solve 4q = -2i - 12, fq + 2 = 5i + 17 for i. -4 Suppose 5k = -h - 0h + 2, 8 = 4h + 4k. Solve -5a = -2m + 19, h = -a - 3m - 12 for a. -5 Suppose y = -r - 3 + 12, 4y = 20. Solve -d = ri + 25, 10 = 3d - i - 4i for d. -5 Let w be (1 - -1)/((-2)/(-4)). Solve 0 = -wb + f + 17, -9 = -2f - f for b. 5 Suppose -5q + w = -8 - 6, 4q - 4w - 8 = 0. Solve -g + 4g + 24 = -3r, 0 = qg + 15 for r. -3 Let a(r) = -r + 10. Let g be a(6). Suppose 3*v + 16 +	{ "pile_set_name": "DM Mathematics" }
.1. What is f rounded to 4 dps? -0.003 Let j = 26.9 + -12.3. Let r = j - -6.2. Let b = 21 - r. Round b to one decimal place. 0.2 Let r be 701844022/143 - ((-12)/39)/(-2). Round r to the nearest one million. 5000000 Let o(g) = g3 + g2 - 8g - 2. Let x be o(-3). Suppose -7 = xm - 15. Suppose 19 = mn + 121. What is n rounded to the nearest 10? -50 Let k = 9227.08513 + -9227. What is k rounded to two dps? 0.09 Let f be (-9 + -171)(10700/(-3))/2. Round f to the nearest one hundred thousand. 300000 Let u = 241.998944 + -242. Round u to 5 decimal places. -0.00106 Let o = -66251 - -68185.87. Let s = o - 1946. Round s to 0 decimal places. -11 Let t(p) = p*2 - 2p - 1. Let i be t(5). Let h = -20 + i. Let n = 69 + h. What is n rounded to the nearest ten? 60 Let j be (-12)/(-20) - (-25071)/15. What is j rounded to the nearest one hundred? 1700 Let x = -1904 + 3222. Let g = 1318.0571 - x. Round g to 2 decimal places. 0.06 Let a = -0.0324 + 0.0964. What is a rounded to 3 dps? 0.064 Suppose 4d - 2g + 34836 = -308208, d = -5g - 85750. What is d rounded to the nearest one thousand? -86000 Suppose n = 4l + 181, -n - 4n + 5l + 950 = 0. Round n to the nearest 100. 200 Let f = -22.2 - -22.2388. Round f to 2 dps. 0.04 Let a = -326.999991 - -327. What is a rounded to five decimal places? 0.00001 Let o = -6674 - -7360.3. Round o to the nearest ten. 690 Let k = -21.3 - -23. Let n = 82.13 + -83. Let w = n + k. What is w rounded to one dp? 0.8 Let o = 405.929 - 407. What is o rounded to 1 decimal place? -1.1 Let g = -420 - -416.17. Let x = 4.1 + g. Let p = 1.57 - x. Round p to the nearest integer. 1 Let h = -0.99 - -5.09. Let n = 3.45 - h. Round n to 1 decimal place. -0.7 Suppose 296b - 5g + 1470 = 298b, -2 = -g. Round b to the nearest one thousand. 1000 Let p = -1034 - -4084. What is p rounded to the nearest one thousand? 3000 Let q = 42 + -16. Let r = 26.00005 - q. What is r rounded to 5 decimal places? 0.00005 Let m = -10.01 + 0.01. Let d = -6.9 - m. Let h = -2.3 - d. What is h rounded to the nearest integer? -5 Let o = 39.6 + 13.4. Let x = -79 + o. Let h = x + 25.996. Round h to 2 dps. 0 Suppose 3t - 34 = 188. Suppose -5 + t = w. Let d = 36 - w. Round d to the nearest 10. -30 Let n(r) = 13619981r - 95. Let w be n(-5). Round w to the nearest one million. -68000000 Let t = 11044 - 11043.88122. Round t to 2 decimal places. 0.12 Let b(c) = -73c*2 + 73c*2 - 4 - 38c*3. Suppose 0 = -m - 7m - 16. Let y be b(m). Round y to the nearest one thousand. 0 Suppose 0 = -5i + 4i - 4, 0 = -4p + 2i + 65840008. Round p to the nearest 1000000. 16000000 Let m = 105016768 + -71185552. Let g = m + -54731216. What is g rounded to the nearest one million? -21000000 Let s = -10.5 - -0.5. Let q = -32 - s. Let w = q - -22.0000045. Round w to six dps. 0.000005 Let h = 6.1 - 12.36. What is h rounded to the nearest integer? -6 Suppose -22a + 21a - 27299 = w, 4w - a = -109201. What is w rounded to the nearest 1000? -27000 Let q = -0.1467415 + 0.1465. Round q to 5 decimal places. -0.00024 Let b = 100.2 - 100.199997445. What is b rounded to 6 decimal places? 0.000003 Let w = 0.018 - 62.018. Let n = 11505573.02 + -11505635.0200029. Let l = n - w. Round l to six dps. -0.000003 Let u = -907531446.000223 - -907531993. Let y = -136 + 683. Let r = u - y. Round r to 5 dps. -0.00022 Let x(i) = -27277i - 108. Let v be x(-4). Round v to the nearest ten thousand. 110000 Suppose 0q = -3q + 6. Suppose q = -7b - 12. Let h be (b15)/(3/4500). What is h rounded to the nearest ten thousand? -50000 Let a = -489756 - -489757.699928. Let j = a - 1.7. What is j rounded to five decimal places? -0.00007 Let d = 50 - 163. Let z = d - -112.41. Round z to one dp. -0.6 Let x = -727 - -596.6. Let p = x - -191. Let z = -51 + p. What is z rounded to the nearest integer? 10 Let t be (7040/(-48))/((-1)/(-3825)). What is t rounded to the nearest one hundred thousand? -600000 Let j = 438612 + -306712. Round j to the nearest ten thousand. 130000 Let y(m) = -11668m - 24. Let h = 22 - 40. Let n be y(h). Suppose -3x = -4x - n. What is x rounded to the nearest ten thousand? -210000 Let m = 10210 - 10210.00007381. Round m to six decimal places. -0.000074 Let n = 76.2 + -3.2. Let x = 73.000088 - n. What is x rounded to 5 decimal places? 0.00009 Let x = -1.3 - -1.24. Let a = 0.05999952 + x. What is a rounded to 7 dps? -0.0000005 Let p = -124.86 + 127. Round p to zero dps. 2 Let y(f) = 5521f*2 - 10f + 41. Let a be y(7). What is a rounded to the nearest 10000? 270000 Let m = 27622.5189 - 27621. Let z = -0.246 - -1.776. Let f = m - z. Round f to 3 decimal places. -0.011 Let b = -27607.01 + 23301.1. Let q = b - -4275.91085. Let j = q + 30. What is j rounded to 4 decimal places? 0.0009 Let o = 3997 - 4022.016. Let l = o - -0.016. Let q = l - -25.0148. Round q to three decimal places. 0.015 Let b = 0.17 + -0.22. Let v = b - -6.05. Let w = v - 5.99999999. What is w rounded to seven dps? 0 Let b = 3 - 5. Let l(i) = 5i2 + 3i*2 - i - 7i*2 + 3i. Let c be l(b). What is c rounded to three decimal places? 0 Let s = -23 - -38. Let q be (-12875470)/3 + 5/s. Let k = 1908177 - q. Round k to the nearest one million. 6000000 Let g = -0.1596 + 0.159597018. Round g to seven decimal places. -0.000003 Suppose n + 4704 = -11q + 13q, 4n = -16. Round q to the nearest 1000. 2000 Let a = 63 - -71. Let k = 134.000219 - a. What is k rounded to 5 dps? 0.00022 Let t = 232026.414 + -231542. Let n = t + -485. Let l = n - -0.096. What is l rounded to 1 dp? -0.5 Suppose f + 5d - 62885 = 0, 2f - 3597 = -d + 122209. Suppose 60995 + f = 4k. Suppose -5j + 5x = -k, 2j - 24825 = -2j - 5x. Round j to the nearest 1000. 6000 Let s = 418900 - 418899.9226974. Let u = 0.0774 - s. Round u to five dps. 0.0001 Let q = -413526.5575 - -85.5575. Let h = q + 413514.9963. Let y = h + -74. Round y to three dps. -0.004 Let j = -13 - -16. Suppose 4z + 76646 = jz. Let h = z - 354. What is h rounded to the nearest ten thousand? -80000 Let p = -983.0002276 - -983. What is p rounded to five dps? -0.00023 Let x = 11.506 - 163.916. Let a = -154.1107 - x. Let n = 1.7 + a. What is n rounded to three dps? -0.001 Let l be (808 + 2)(-11200)/(-24). What is l rounded to the nearest ten thousand? 380000 Suppose 172 = 4n - 2g + 6g, 3n - 123 = -g. Let j be n(1270/(-3))/(4/90). Round j to the nearest ten thousand. -380000 Suppose -3p + 3k = 0, -3k + 0k - 4 = -5p. Suppose -pl - 10092687 + 4012687 = 0. What is l rounded to the nearest 1000000? -3000000 Let l = -1.165 + -14.095. Let p = 16 + l. Round p to 1 decimal place. 0.7 Let z = 18761325 - 18761184.99891. Let r = z + -140. What is r rounded to four dps? 0.0011 Let o = -0.0029 - 0.0293. Round o to 3 dps. -0.032 Let a = 1.54 + -1.53999989. What is a rounded to seven dps? 0.0000001 Suppose 13y - 9y = 23704. Suppose 3s + y = -2867. Let x = -5461 - s. Round x to the nearest one hundred. -2500 Suppose -11 = -4p + 69. Let g(q) = -2 + p + 263016q + 294883q - 157900q. Let z be g(18). Round z to the nearest one million. 7000000 Let d = -5 + 5.6. Let m = d - 9.1. Round m to 0 decimal places. -9 Let x = -303 - -302.9328. Round x to 2 decimal places. -0.07 Suppose 0 = 5o - 25, c + 4c - 3o = 0. Let x be (3 - c) + -2 - 20. Round x to the nearest ten. -20 Let a = 1776 - 1776.00000779. Round a to 6 dps. -0.000008 Let n(s) = 4s*3 + 3s*2 + 26s - 36. Let o be n(-7). What is o rounded to the nearest one hundred? -1400 Let n = 521.999759 + -522. Round n to 5 dps. -0.00024 Let w = 12416 - 30241.1. Let h = 17898.159 + w. Let o = h - 73. What is o rounded to two decimal places? 0.06 Suppose p - 16 = -4n, -5p + 5 = n + 4n. Suppose nz - 3k = 217, 2k - 115 = -7z + 4z. What is z rounded to the nearest ten? 40 Let v = -2.85 - -128.85. Let d = 125.999954 - v. Round d to five decimal places. -0.00005 Let f(h) be the first derivative of h*4/4 + 4h3/3 - h2/2 - 4h - 2. Let t be f(-4). Suppose 3o - 2940 = -t*o. Round o to the nearest one hundred. 1000 Let b = -34.996 + 34. Round b to 1 decimal place. -1 Let d = 0.2726 + -0.26043. Round d to four decimal places. 0.0122 Let t = 18 + -41. Let l = t + 21.9. Let k = -13.3 + l. Round k to zero dps. -14 Let n = -51321721 - -51321579.999892. Let d	{ "pile_set_name": "DM Mathematics" }
ve of x(p) wrt p? -1126p Let n(u) be the second derivative of -307u*7/3 - 7u*3/6 + 150u*2 - 3700u. Find the second derivative of n(l) wrt l. -85960l3 What is the third derivative of -16h*5 - 105983h*3 + 10h + 5269h2 + 106231h*3 - 10h wrt h? -960h2 + 1488 Let n(b) = -24b - 1. Let w(r) = -r - 1. Suppose s + g - 2g - 6 = 0, 23 = 3s - 4g. Let j(d) = sn(d) + 3w(d). What is the derivative of j(o) wrt o? -27 What is the third derivative of -154k + 328k5 - k2 - 3k*2 + 7k*2 - 2k*2 + 1340k*5 wrt k? 100080k*2 Let m = 8 - 5. Let y(b) be the second derivative of 0b*m + 0 + 0b*2 + 0b*5 - 14b + 11/30b6 + 1/4b*4. Find the third derivative of y(r) wrt r. 264r Suppose -11k - 368 = -1820. What is the second derivative of -208 - 91t + 109t - 45t*2 + 208 + kt wrt t? -90 Let y(g) be the third derivative of 168 - 1/6g3 + 0g + 73/40g6 + 0g5 + g2 + 35/24g4. What is the second derivative of y(j) wrt j? 1314j Suppose -4o = 22o - 52. What is the second derivative of ox3 - 2x*3 - 11x*3 - 1650x*2 + 1651x*2 - 80x wrt x? -66x + 2 Let a be (-632)/123/(-2). Let d = a + -67. Find the third derivative of y*4 - 2y*2 + 2y*2 + dy*2 + 8y*2 wrt y. 24y Let o(f) = 21f3 - 16f*2 - 25. Let m(b) = -10b*3 + 8b*2 + 13. Let v = 41 + -35. Let l(t) = vo(t) + 13m(t). Find the first derivative of l(d) wrt d. -12d*2 + 16d Find the third derivative of 4k2 + 3027k*3 + 2k4 - k2 + 116 + 7k2 + 23 - 142 wrt k. 48k + 18162 Let q = 108 - 74. What is the third derivative of 3x4 + 3x*3 + qx*4 + 26x - 25x - 4x*3 + 18x*2 wrt x? 888x - 6 What is the second derivative of -54 - 2357a3 - 2131a*3 + 1 + 21a - 1551a3 wrt a? -36234a Let f(l) = -316l2 - 132l - 130. Let s(m) = 2m2 + 12m - 1. Let k(r) = 6f(r) + 66s(r). What is the first derivative of k(o) wrt o? -3528o Let s(q) = -9747q*4 - 36q*2 - 13929q. Let p(r) = 1393r4 + 5r*2 + 1990r. Let d(t) = -22p(t) - 3s(t). Find the second derivative of d(l) wrt l. -16860l2 - 4 Let g(s) be the third derivative of 0s*3 - 79/120s*6 + 0s*4 + 23/20s*5 - 2s*2 + 0 - 4s. What is the third derivative of g(c) wrt c? -474 Let g(q) be the second derivative of -71q4/4 - 7q*3/6 - 77q*2/2 - 657q. Find the second derivative of g(c) wrt c. -426 Let v be 0 - 8/(32/(-12))1. Find the first derivative of 13 - 1 + 24f - 3fv - 17f - 1 + 17f3 wrt f. 42f*2 + 7 Let f(p) = p. Let l be f(0). Suppose 0 = -14v + 42. What is the first derivative of l - 21 + v + 18i wrt i? 18 Suppose -3 = -3y + 15. What is the third derivative of -22a5 - 5a2 - a2 - ya2 - 7a*5 wrt a? -1740a2 Let t(a) be the second derivative of -a5/10 + 969a4/4 - a3/6 - 418a*2 + 3504a. Find the first derivative of t(k) wrt k. -6k2 + 5814k - 1 Let p be (-3 + 81/12)/((-3)/12). Let d = p - -27. What is the second derivative of -dw + 15w*5 - 19w*3 + 19w*3 wrt w? 300w*3 What is the third derivative of 38t*6 + 457t + 17t2 - 25t*2 + 353t*6 + 12t*2 wrt t? 46920t*3 Suppose -19s + 21s - 84 = 0. Suppose -4p = -20, 3z = -4p + s + 8. Find the third derivative of 7u2 - 11u*6 - 4u*2 + zu*2 wrt u. -1320u*3 Suppose 3h - 1 - 4 = -5a, -4h = -5a - 65. Let j(b) be the first derivative of -77b + 17b + 8 + hb*2 + 39b. Differentiate j(d) with respect to d. 20 Let d(x) = x*3 + 2x*2 + 2x + 1. Let i(n) = -1317n3 + 772n*2 - 8n - 5. Let b(p) = -4d(p) - i(p). What is the third derivative of b(u) wrt u? 7878 Let h(a) be the third derivative of 0a*3 + 8 + 0a*6 + 0a*4 + 11/42a*7 + 0a - 43/30a5 + 6a*2. Find the third derivative of h(d) wrt d. 1320d What is the third derivative of 147 - 9515o4 - 154o + 2o2 + 40o - 49 + 40o + 75o wrt o? -228360o Let k(l) be the second derivative of -6617l*3/6 - 4711l*2/2 + 6357l. Differentiate k(h) wrt h. -6617 Let a be 9/4 - ((-20)/(-16) - 1). What is the second derivative of -699t5 - 7 + at + 586t5 + 33 wrt t? -2260t*3 Let x be 4 + 1 + -1 + -1. Let v = -354 - -356. What is the third derivative of -6b*2 + xb*6 + 12b*v + 5b*2 wrt b? 360b*3 Let z(a) be the third derivative of -2993a*7/210 + 385a*4/12 - 29a*2. Find the second derivative of z(f) wrt f. -35916f*2 Let s(a) = 53a - 49. Let o be s(2). What is the third derivative of 60d3 + 137d*2 + 101d*2 + 2d*4 - od*2 - 27d*3 wrt d? 48d + 198 Let t(n) = -426n2 - 182n - 9126. Let z(d) = -85d2 - 39d - 1825. Let m(v) = -3t(v) + 14z(v). Differentiate m(q) with respect to q. 176q Suppose -26 = -6d + 34. What is the second derivative of d - 19t + 7t*3 + 56t - 16t - 16t - 6t2 wrt t? 42t - 12 Let t be (-4)/(-4)1 - 39. Let b = t + 40. What is the second derivative of 0o + o*b + 8o*2 - 6o - o*2 wrt o? 16 Let y be 2/6(-24 + 36). Find the second derivative of -316r2 + 4r*y - 4r + 311r2 - 1 + 9r wrt r. 48r2 - 10 Let p(i) be the third derivative of -11i8/336 - i6/40 - 7i5/20 - 1563i*4/4 - 2i*2 - 105i + 2. What is the second derivative of p(t) wrt t? -220t3 - 18t - 42 What is the first derivative of 457m + 661 + 21 - 1612m wrt m? -1155 Let v = 8936/9 + -35465/36. Let h(w) be the first derivative of -11w + 0w*3 + 0w*2 + 26 - vw*4. Differentiate h(x) with respect to x. -93x*2 Let q = 9419 - 9415. Let t(i) be the third derivative of -6i*2 + 13/8i*q + 1 - 17/3i*3 + 0i. Differentiate t(y) wrt y. 39 Let u be -107 + 3/(-1(-3)/(-2)). Let g = u - -111. What is the derivative of 31j*3 + 10j*2 - 14j*g + 8 + 4j*2 wrt j? 93j*2 Let g be (-6)/(-15) + (-162)/(-45). Find the third derivative of 13a*2 + 14a*g - 507a*3 + 507a*3 wrt a. 336a Let x(j) be the first derivative of -j*6/120 + 9j3/2 + j2/2 + 25j + 118. Let d(m) be the second derivative of x(m). Differentiate d(h) wrt h. -3h*2 Let s be (-12)/(-27)9/2. Find the third derivative of m*4 + 26m*4 + 4m*4 - 103m*s + 32m*2 wrt m. 744m Let q(u) be the first derivative of -145u6/6 + 7u*5/5 + 72u*3 + 10u + 2239. What is the third derivative of q(y) wrt y? -8700y2 + 168y Let w(b) be the first derivative of -443b4/4 - 2b*3/3 + 430b - 903. Find the third derivative of w(v) wrt v. -2658 Let g(k) be the third derivative of -1017k6/40 + 31k*5/30 - 9003k*2. What is the third derivative of g(z) wrt z? -18306 Let u(k) be the third derivative of 153k*4/8 - 221k*3 + 2095k*2. Find the first derivative of u(m) wrt m. 459 What is the first derivative of 152694v*2 - 153904v*2 + 1519 + 3835 wrt v? -2420v Differentiate -1425x3 + 11197x*2 - 425 - 3343 - 4333 - 11198x*2 with respect to x. -4275x*2 - 2x Suppose 14z + 15 = 19z. Suppose -k - zp + 296 = 0, p = 3k + 2p - 872. Find the first derivative of 3j - 3j - 288j*2 + 14 + kj*2 wrt j. 4j Let w(n) = 9567n3 - 143n + 667. Let r(a) = 3189a3 - 52a + 223. Let y(x) = -11r(x) + 4w(x). Differentiate y(l) with respect to l. 9567l2 Let s(r) be the second derivative of -51r*5/10 - 7r*3/6 + 195r*2/2 - 2r + 122. What is the derivative of s(v) wrt v? -306v2 - 7 Let a(f) = -2f*2 + 35f + 3. Let v be a(17). What is the second derivative of 20 - v - 49r5 - 64r + 12r5 wrt r? -740r*3 Let z be (1 - (6 - 2)) + 5. Find the third derivative of 63a*z - 183a + 63a3 + 12a*2 + 183a wrt a. 378 Let q(n) be the second derivative of -67n3 - 49n + 1 - 1 + 47n3 - 60n + 16n2. What is the derivative of q(h) wrt h? -120 Suppose -8b = -6 - 10. Let c be (2/16b)/(5/60). What is the third derivative of 14g*2 + cg*2 - 16g*6 + 14g*2 wrt g? -1920g*3 Let u(w) be the second derivative of 0w*6 + 0w*2 - 1/12w*4 + 3/10w*5 + 0 - 1/42w*7 - 41w + 11/6w3. Find the third derivative of u(g) wrt g. -60g2 + 36 Let n(k) = k3 + 15k2 + 10. Let w be n(-15). Suppose wc = 8c + 24. What is the derivative of 8i*2 + 33i*2 - ci*2 - 24 wrt i? 58i Let q = 45 + -15. Let h be 4/(-20) - (-1 + (-52)/10). Find the third derivative of 19f2 + qf*h - 4 + 5 - 1 wrt f. 3600f*3 Let b(f) = -7f*2 + 40f - 55. Let g(v) = -2v2 + 10v - 14. Suppose 20c = 17c + 18. Let j(a) = c	{ "pile_set_name": "DM Mathematics" }
in the form ao3 + vo + so2 + p and give a. -12 Rearrange (-49 + 97 - 50)(2 + 2 - 5)(-3x + 4x + x) to qx + r and give q. 4 Rearrange -13x + 13x + 1 + 0 + 5x2 + x4 to the form hx + p + gx3 + wx*2 + ox*4 and give o. 1 Express -14g*2 - 1 - 3g*3 + 3 - 2g*3 + 9g*2 in the form ag*2 + y + ug*3 + bg and give a. -5 Rearrange (-9 + 10 + 13)(-i + 0i + 2i - 2i + 0i + i - i + 4 - 4 + (-2i + 0i + 0i)(0 - 6 + 4) + 0i + 2i - i + 0 + 0 - 2i) to yi + p and give y. 28 Express 1 - v2 - 20v + 20v - 15v*2 in the form sv + b + nv2 and give n. -16 Express -z2 - 4z*2 + 4z*2 + 0z*2 as p + wz + vz2 and give v. -1 Express -5 - 6w*3 - 5w*3 + 4 in the form u + cw*3 + hw + lw2 and give h. 0 Rearrange m2 + 0m + 0m + (3 + 0 - 5)(-3m + 3m - 2m2) + (-39 + 39 + 3m)(0m - m + 3m) to the form om + u + hm2 and give u. 0 Rearrange (-158 - 2 - 3 - 10)(-4g + 4g - g) to vg + a and give v. 173 Express v - 45v*4 - 4v - 3 + 41v4 + 5 in the form yv*2 + l + ov*4 + cv + wv3 and give l. 2 Express -4u*3 - 26u*3 - 9u + 3 + 9u + 2u*4 as n + fu*4 + au*2 + vu*3 + mu and give f. 2 Rearrange (-1 - 1 + 3)(-11p + 0p + 2p) to the form m + ip and give m. 0 Rearrange 75n*2 - 74n*2 - 53n*2 to the form rn + xn2 + v and give x. -52 Rearrange (-6q*2 - 3q - 156 + 156)(3q - 2q - 3q) to u + kq + hq*3 + oq*2 and give o. 6 Rearrange -6 - 795q*2 + 0 + 793q*2 to dq*2 + t + wq and give d. -2 Express 4u - 53u*3 - 3 - 5u*2 + 1 + 55u*3 in the form tu*2 + p + du*3 + bu and give d. 2 Rearrange -101 + 18g2 + 52 + 48 to the form j + rg*2 + og and give r. 18 Rearrange (-5b + 5b + 3b2)(-1 - 1 + 7) - 4b2 + b - 5b*2 + 0b*2 to the form d + pb + yb2 and give y. 6 Rearrange 66 - n + 2n*2 + 0n - 8 - 11 to the form an2 + kn + l and give a. 2 Express -t4 - t2 - 2t3 - 2t*4 + 0t*2 + 2 - 6t*4 in the form zt*2 + x + lt*4 + vt*3 + it and give v. -2 Express (2h4 + 4h*4 - 4h*4)(-6 + 2 - 1)(1 + 1 - 4) in the form mh*2 + ph*4 + dh*3 + zh + f and give p. 20 Rearrange -d*2 - 2d*2 - 2 + 18d*2 to the form zd + j + cd2 and give j. -2 Rearrange 0d3 - d2 + 4d2 - d3 to qd + cd3 + s + od*2 and give c. -1 Express -2h + 0h + 3 + 3h - 2h2 + (8 + 2h - 8)(2h - 3h - h) in the form rh*2 + j + lh and give r. -6 Rearrange (-6 + 0 + 3)(2t4 - t4 - 2t4) + t4 + 0t*2 + 0t*2 + 4t4 - t4 + t*4 to pt*2 + ct*4 + rt + nt3 + s and give r. 0 Express -2g*3 - g - 2g2 - g4 + 8g + 4g*3 as r + dg*4 + yg*3 + kg + og2 and give o. -2 Express 22f + 5f - 8f + (-3 + 3 - 2f)(5 - 5 + 1) as o + vf and give v. 17 Express 8w*2 + 13w + 5 - 3 - 8w2 + w3 in the form dw*2 + u + vw + mw3 and give u. 2 Rearrange (-2z*3 - 1 + 1)(-3 - 6 + 4) + 0z3 - z3 + 0z*3 + (-1 + 0 + 2)(0z3 - 2z*3 + 0z*3) to the form c + rz*3 + qz*2 + az and give r. 7 Express (0 - 3 + 1)(10c - 6c + 3c)(-2c + 3c + 4c) in the form r + ac + uc*2 and give u. -70 Express -1 - 2m*2 - 2m*2 + 6m*2 + 2 - 2m*3 in the form gm + dm3 + t + im*2 and give d. -2 Express (6 - 2n - 6)(-2n + 0n + 0n - 2) in the form r + wn2 + fn and give f. 4 Express (4 - 4 + 3z)(-7 - 2 - 8) in the form h + xz and give x. -51 Express -4k*2 + 2k2 - k2 - 4k2 in the form d + zk + qk2 and give q. -7 Rearrange (b + 8b - 5b)(23 + 26 - 21) + 0 + 0 - 2b to l + rb and give r. 110 Express -2u - 3 + 2u3 - u + 1 + u4 + 2u2 + 4u in the form bu + vu*3 + ju*2 + ru*4 + c and give b. 1 Rearrange (-x + 2x + 0x)(56x3 + 56x*3 - 107x*3) to the form fx*3 + w + yx + ix2 + ox*4 and give o. 5 Rearrange 0 - 2b*3 + 116b + 4b3 - 1 - 115b - 9b2 to the form xb + gb3 + v + yb*2 and give y. -9 Express (-1 - 4 + 2)((0 - 3 + 1)(-2v + 0v + 0v) - 66 - 7v + 66 + 0 + 0 + 2v) in the form qv + d and give q. 3 Express 4h - 35h2 - 4h - 43h2 as ih + q + uh2 and give u. -78 Express (-3n2 + n2 - n*2)(-4n + 0n + 13n) - 3 + n3 + 3 as zn*3 + kn*2 + t + mn and give t. 0 Express 3i2 + 0i*2 + 2609i + 26i3 - 2610i as ti3 + ui + mi2 + p and give t. 26 Rearrange 307x*4 - 303x4 + x2 + 2x3 + 5 - x3 to the form wx*3 + ux + px4 + ax2 + s and give w. 1 Express (s2 + 4s2 - 2s*2)(-5 - 25 - 22) in the form ns + i + qs*2 and give q. -156 Express (3a - 4a - a)(-4a + 2a + 0a)(-1 + 1 - 3a)(-1 - 5 + 2) as ka + wa*2 + s + fa*3 and give f. 48 Rearrange (0k*3 + 0k3 + k3)(-1 - 6 + 2)(0k - k + 3k) to bk4 + ak + d + fk3 + qk*2 and give b. -10 Express 13 - 2 - 5 + 10w as ow + h and give o. 10 Rearrange 238 + 125t*3 - 238 - 2t*3 + 1 - 1 + (t + 1 - 1)(2t2 + 3t*2 - 7t*2) to the form m + bt*3 + nt*2 + it and give b. 121 Rearrange 33x - 19x - x*2 - 3 - 10x + x*3 + 1 to the form y + hx*3 + zx + jx2 and give j. -1 Rearrange -258l + 0 + 270l + 0 to c + bl and give b. 12 Express 26r2 - 52 - 8r*2 - 6r*2 - 14r*2 in the form ur*2 + br + o and give u. -2 Rearrange 0d3 + 3 - 10d*2 - 1 + 15d*2 - 2d*3 to the form yd*3 + ud + ld2 + b and give y. -2 Rearrange 2f2 - f4 + 0 - 1 + 8f3 + 2 to the form zf*2 + kf*4 + yf + bf3 + u and give b. 8 Express (0o + 0o - o + 1)(-2o + 2o + 3o2) in the form go*3 + to + wo2 + a and give g. -3 Rearrange (2w - w + 0w)(-32 + 60 - 68 - 129) to cw + q and give c. -169 Express j3 + 0j*3 - 3j*3 + (4j - 5j - j)(-j*2 - 1 + 1) - 8 - 5j*3 + 8 in the form ij + lj2 + pj*3 + f and give p. -5 Express 6v*3 - 4 - 2v - 11v3 + 2 in the form z + sv*2 + uv*3 + hv and give h. -2 Express -15a4 + a + 2a*3 - 2a*2 - a as ia*4 + f + na + pa3 + oa*2 and give o. -2 Express (-i + i + 2i)(0i*3 + 2i*3 - 4i*3) - 13i*4 - 27 + 3i4 + i3 + 13i4 in the form n + ti*2 + zi*3 + bi + xi4 and give z. 1 Express -3 + 8 + 64z - 5 in the form u + gz and give u. 0 Rearrange 5y + 4y - 2y to by + m and give b. 7 Express (3 - 3 + 2k)(-5k - k - 2k) + (3k - 2k + 11 - 8)(2k + 3k - 3k) as qk*2 + ck + d and give q. -14 Rearrange (2h - 2h + 3h)(0 + 0 - 1)(-2 - 2 + 1 + (2 + 11 - 7)(4 + 2 - 4)) to uh + a and give u. -27 Express -m3 + 2m*3 - 4 + 8 in the form dm + um3 + j + lm*2 and give j. 4 Express 4 + 17k + 1 - 13k in the form dk + j and give j. 5 Express 0b2 - b2 - b2 + (3b*2 - 5b*2 + 3b*2)(-7 + 2 - 29) as lb2 + nb + y and give l. -36 Express 12f - 5f + 3f as wf + z and give w. 10 Rearrange 3 + 2v2 - 3 + 0 - 3v*4 - 2v*3 - v to the form lv + bv4 + sv*2 + cv*3 + n and give c. -2 Rearrange 3t*2 - 5t*3 - 13t*3 - 8t*3 to wt*2 + v + ht + jt3 and give w. 3 Express k2 - 2k - k*2 + 2k*2 + 2k4 + k3 as ok2 + rk*4 + xk + f + mk3 and give m. 1 Express (-13 + 4 - 7)(-4 + 1 + 6)(-2s - 4 + 4) in the form i + js and give j. 96 Rearrange (-2 - 1 - 2t - 1)(-1 - 1 - 2)(t - 1 + 1) to the form gt2 + k + mt and give k. 0 Rearrange 3w4 - w4 - 3w*4 + (1 - 5w*2 - 1)(2w2 - 4w*2 + 3w*2) to j + vw*4 + bw*2 + sw*3 + kw and give v. -6 Rearrange l*2 + 3l*3 - l + 9l + 2l3 - 2l*3 to y + ol + vl3 + wl*2 and give o. 8 Rearrange 12u - 19u2 - 12u to nu2 + o + ku and give o. 0 Rearrange (7t - 3t + 0t + (0 - 3 + 1)(-t - 4t + 4t) + 2t + 0t + 0t)(-6t + 2t + 7t) to mt + r + ot2 and give o. 24 Express (4 + 1 - 1)(2v2 + v - v) + (-5 + 2 + 1)(2v2 - 1 + 1) as qv + d + sv2 and give s. 4 Express 1 + 2l*2 - 1 + (-3l + 2l + 0l)(1 - 3l - 1) - l2 - l2 - 2l2 in the form cl*2 + j + ul and give c. 1 Express 72j - 100j - 102j as p + dj and give d. -130 Express (-1 - 1 + 4)(8g + 3g - 2g) - 2g - 3 + 3 + (-g + 4g - 5g)(6 - 1 - 4) + g + 2g - 2g in the form vg + n and give v. 15 Express (2 - 4 + 3)(-7 - 1 + 4 - 3k2) as ik + uk2 + a and give u. -3 Rearrange (0w + 3w - 4w)(-w3 - 2w*3 + 5w3) + (-w2 + w*2 - 10w*3)(w - 3 + 3) to k*w	{ "pile_set_name": "DM Mathematics" }
2w - 4w + 3w)(-1 + 0 - 1) + (-w - 3 + 3)(-5 - 2 + 4) to the form zw + h and give z. 1 Rearrange (-1 + 1 - h + (5 + 0 - 3)(-5h + 7h + 3h))(-h + 3h - 4h) + h2 + 0h*2 + 0h*2 to the form a + ch*2 + gh and give c. -17 Rearrange 12x2 - 26x2 - 35 + 11 + x3 + 16x2 to the form sx*2 + f + qx + vx3 and give s. 2 Express (2 - 2 - 2a)(-a + 3a - 3a + (0 + 2 - 1)(9a - a - a)) in the form m + pa*2 + la and give p. -12 Rearrange 8f3 + f + f - 7f*3 to x + tf*2 + jf + pf3 and give j. 2 Express (-2m*2 - 29m - 6 + 29m)(9m - 20m - 9m) as bm*2 + vm + am3 + n and give v. 120 Rearrange -80g - 88g - 2 + 2 + (0 - 2g + 0)(-1 - 5 + 4) to ig + a and give i. -164 Rearrange (-14m + 5m*2 + 14m)(-1 - 2 + 4) - 5m*2 - 2m*2 + 5m*2 + 5m*2 - 2m*2 - 2m*2 to nm + l + ym2 and give y. 4 Rearrange -3r + 3r2 + 3r - 21r - 19r*2 + 21r + (-2r - 2r + 3r)(-4 + 4 - r) to the form yr2 + vr + a and give y. -15 Express -71 + 138 - 197n2 - 67 in the form in*2 + b + qn and give i. -197 Express 5582y - 5582y - 68y2 in the form cy*2 + wy + r and give w. 0 Express -42j + 19j + j*4 + 22j - 2j2 + j4 as cj*3 + vj*4 + l + tj + zj2 and give t. -1 Express (0k2 - k2 + 4k2)(-3 + 3k2 + 3) - 5k*4 - 11k*4 + 13k*4 as dk*4 + xk + fk3 + s + vk*2 and give d. 6 Rearrange (3j - 5j + 0j)(-14 - 6 + 1) + (-3 - 2 + 4)(-3j + 3j + j) + 4j + 0j - 3j to the form dj + s and give d. 38 Rearrange 0 - 2f - 2f + 2 + (-2f + 0f + f)(-1 - 2 + 2) - 6f + 4f - 11f to nf + a and give n. -16 Rearrange 9b + 2b2 - 2b2 - b3 - b to the form kb2 + pb + l + fb3 and give p. 8 Express m + 5m + 3m in the form k + am and give a. 9 Rearrange 8s + 4s + 4s + 22s to the form c + ws and give w. 38 Express (3b + 2 - 2b + b)(3b + 0 + 0) in the form jb + v + wb2 and give w. 6 Express -1 - 25w*4 + 2 - w + 27w*4 + (3w*2 + 0w*2 - 2w*2)(5w2 - 13w*2 - 10w*2) in the form o + lw + tw3 + kw*2 + gw*4 and give g. -16 Express -259b*4 + 3b*2 + 2b - 2b + 2 + 254b*4 as ib*2 + rb*4 + f + pb + mb3 and give r. -5 Express -45r + 15r + 20r + r*2 as or + ir2 + t and give t. 0 Rearrange 11 - 6 - 114d + 110d to y + fd and give f. -4 Express (5s2 + 0s*2 - 3s*2)(-3 + 2 - 1) + 4s - 4s - 2s2 - 155s + 5 + 155s - 2s*2 as js*2 + ts + d and give j. -8 Express 0x3 + 2x*3 + 7 + 6 - 4 as z + vx*2 + dx*3 + nx and give z. 9 Express 5 + 5 - 10 + a*2 + 4a as pa2 + na + w and give p. 1 Rearrange 12m - 12m + 8m2 + (m2 + 0m + 0m)(0 + 0 - 1) to the form zm + wm2 + b and give w. 7 Express (-a + a2 + a)(3a - 3a - a) - 21a*3 + 21a - 21a - 3a*3 + 2a*3 - 2a*3 in the form qa*3 + oa*2 + ua + p and give o. 0 Rearrange -7q - 4q - 3 + 3 to the form d + wq and give w. -11 Express 8 + 56 + 10m*2 - 2m*2 - 9m*2 as u + tm*2 + lm and give t. -1 Express 10o + 4o + 0o + (-o - o + 4o)(0 - 4 + 2) + 5 - 3o - 5 in the form b + ho and give h. 7 Express -13 + 13 - 7x - 12x + 3x*2 in the form vx*2 + tx + u and give u. 0 Rearrange (-h - 2 + 1 + 0h)(1 - 2 + 2)(47 - 13 + 2) to g + fh and give f. -36 Rearrange 4n - 22n + 53n to c + an and give c. 0 Express 2v - v + 42v*2 + 28v*2 + 5v*2 in the form tv*2 + sv + f and give t. 75 Express 21w - 6w - 7w as lw + i and give l. 8 Rearrange -18o + 8o*2 + 18o to h + no2 + ro and give h. 0 Rearrange -3 + 3 + 2q + (5q - 1 + 1)(-5 + 2 + 2) to yq + r and give y. -3 Rearrange -106i2 - 1748i + 1748i + (-i2 + 2i - 2i)(4 - 2 - 1) to the form li + p + qi*2 and give q. -107 Rearrange ((3a + 2a - 6a)(-1 + 1 + a) - 6 - 2a*2 + 6)(a + a - 4a + (1 + 0 - 3)(9 - 4a - 9) - 3a + a - a) to na2 + q + ha + za3 and give z. -9 Rearrange 1 - 9g*2 + 5g*2 - 4g*3 + 6g*2 + 3g to ng3 + x + qg + ag2 and give a. 2 Express -4f*3 + 0f*3 - 2f*3 - 4f*3 + f - f + (-3f*2 + 2f2 - f2)(-2f + f + 0f) in the form l + if*3 + cf + rf2 and give i. -8 Express -d3 + 18d + 7 - 24 - 18d in the form z + ld + kd3 + nd*2 and give z. -17 Rearrange (2k*2 + 2k*2 - 3k*2)(-k + 1 - 1) + (-3k2 + 0k*2 - 4k*2)(0k + k + k) to fk*2 + vk*3 + z + hk and give v. -15 Rearrange 6m3 - m2 - 2m - 3m3 + 0m2 - m2 to i + wm2 + km + bm3 and give w. -2 Rearrange -2v - 2v + 0v + (3 - 2 - 3)(-5 + 2 + 1)(2 - 1 - 3)(-v - 3v + 2v) to b + cv and give c. 12 Express 39k + 5k*2 + 0k*2 + 7k*2 - 11k*2 as gk + ck2 + z and give g. 39 Rearrange -2r*3 - 2r*4 - 2r + 56r2 - 56r*2 + 5 to the form jr*4 + hr + wr2 + l + dr*3 and give h. -2 Express -31y + 4 - 2 - 30y2 + 31y as x + dy2 + sy and give d. -30 Express 3a4 + 4a + a*3 - 3a + 0a as ta*3 + ja + na2 + x + qa*4 and give q. 3 Express -28 - 18l + 28 - 25l in the form q + bl and give q. 0 Express -k*2 + 3k*2 - 4k*2 - k in the form v + lk + ck2 and give l. -1 Express 3 + 30l*2 + l + 0l - 30l2 - l3 in the form sl*3 + zl*2 + xl + w and give x. 1 Rearrange (-32k + 20k - 41k)(0k + 0k - k) to the form bk + tk*2 + q and give t. 53 Express 0v - v - v + (-3 + 0 + 2)(-v + v + v) - 4 - v + 4 in the form s + pv and give p. -4 Express 3m4 + 2m*3 - 4m*2 - 4m + 2m + 6m*2 as om + gm3 + ym*2 + hm*4 + l and give g. 2 Rearrange (-2 + 2 - 2t*3)(-3t + 4t - 3 - 2t) to kt + st4 + ht*3 + b + xt*2 and give h. 6 Express (3n + 2n - 7n)((-4n - n + 3n)(0 + 0 + 3n2) - 4n*3 + 0 + 0) as yn*2 + cn*3 + kn*4 + qn + j and give k. 20 Express -22i + 15i - 9i in the form ai + q and give a. -16 Rearrange 23 + 4r4 - 23 - 3r*3 - r + 3r to hr2 + pr + ir4 + l + cr*3 and give i. 4 Rearrange (0 - 2 + 1)(14l + 4l - l)(3l*3 - 2l*3 + 0l*3) to rl + wl4 + pl*3 + il*2 + d and give i. 0 Rearrange -166r*3 + 2r*2 + 0r2 + r4 + 163r3 + 2r to the form lr2 + h + gr*3 + zr + ur4 and give g. -3 Express -2a*2 - 4a*3 - 64a - a*2 + 5a3 + a4 + 66a as va*3 + qa*2 + ia + ra4 + d and give v. 1 Express -21c3 + 2 + c4 + c*2 + 21c*3 - c - 4 in the form fc*3 + n + gc*2 + vc*4 + xc and give n. -2 Express -f*3 - f - 2f*3 + 7f*3 - 3f*3 + 4 in the form kf*3 + uf + z + yf2 and give z. 4 Express (1 + 2 - 1 + (-2 + 1 + 0)(4 + 1 - 4) + (1 - 3 + 1)(4 + 0 - 3) - 1 + 3 + 0)(-3r - 2r + 3r)(0r - 2r - r) in the form vr2 + ir + b and give v. 12 Rearrange d - 248d2 + 245d*2 + 14d to the form g + rd2 + wd and give w. 15 Rearrange -4d3 + 9 - 9 + (-2d*2 + 3d*2 + 0d*2)(-d + 1 - 1) to ld2 + u + fd*3 + gd and give f. -5 Express -26c - 25c + 15c - 12c as oc + l and give o. -48 Rearrange 168z*2 + 332 - 332 to yz*2 + r + dz and give r. 0 Express -887f3 + 2f*2 + 888f3 - f2 + f*2 - 5f + 6 in the form lf2 + q + gf + df3 and give g. -5 Rearrange 765 - 765 - 18f*2 to p + lf*2 + df and give l. -18 Express 6x4 - 1 - 19x*3 + 3x - 7x4 - x as vx*3 + jx + lx2 + o + bx*4 and give j. 2 Rearrange (1 - 5 - 3)(v - v - 2 + v) to the form m + kv and give k. -7 Rearrange (-4l - l - 3l)(0l2 + l2 + 0l*2) + 3l*3 - 4l*3 - 3l*3 + 3l*2 + 2l*3 - 3l*2 to yl*2 + a + xl + hl3 and give h. -10 Express -5p + p*4 + 4 + 3p + 1 - 2p3 in the form o + yp*3 + sp*2 + kp*4 + ap and give k. 1 Rearrange d*4 - 119d3 - d2 + 2d + 234d*3 + 3 - 114d*3 to pd*4 + bd*3 + od + h + yd2 and give b. 1 Rearrange -20g*2 + 41g*2 + 23g*2 to dg + a + og2 and give o. 44 Rearrange -2s + 6s3 - 2 - 4s*3 + 3s to ws3 + ps + us2 + i and give p. 1 Rearrange (-2x + 6x - 2x)(x3 + 64x - 64x - 13) to the form ix*3 + jx + d + sx2 + ax*4 and give j. -26 Express 14c*2 + c + 4c*4 - 12c*2 - 7c*3 - 1 + c - 3c*4 as uc*2 + p + gc*3 + vc*4 + sc and give u. 2 Rearrange 3i - 2i + 0i + (0i - 4i + 3i)(-3 + 2 + 0) - i + 0i + 2i + 0i + 0i - 4i + 0i - 3i + i + 0 + 0 - 2i to the form p + wi and give w. -5 Exp	{ "pile_set_name": "DM Mathematics" }
+ 105. Let c be q(n). Calculate the greatest common divisor of c and 5. 5 Let c be (-50)/4(-28)/5. Let h = -40 + c. What is the highest common divisor of 10 and h? 10 Suppose -2j + 159 + 129 = 0. Let m = 20 - 11. Let u = m - -9. Calculate the greatest common factor of j and u. 18 Let p be (-1384)/(-30) - (-1)/(-15)2. Suppose 3h + 5i - 65 = 0, 5i + 29 = 4h - p. What is the greatest common divisor of 10 and h? 10 Let o = -288 + 320. Calculate the greatest common factor of 224 and o. 32 Let b be (-20)/70 - (-1581)/21. What is the highest common divisor of b and 105? 15 Let h = 3 + 11. Suppose 0 = -8p + 128 + 40. What is the greatest common divisor of h and p? 7 Suppose 71k = 529 + 394. Let y(w) = w - 1. Let a(r) = -10r + 6. Let q(u) = a(u) + 4y(u). Let g be q(-4). What is the highest common factor of k and g? 13 Suppose 29g = 35g - 18. Suppose -3m = 9, -3m + 45 + 48 = gy. Calculate the highest common factor of y and 102. 34 Suppose g + 300 = 6g. Calculate the highest common factor of g and 12. 12 Suppose 3a = -x - 0a + 39, x - 57 = 3a. What is the greatest common factor of x and 912? 48 Suppose -2x = 4z - 32, 9z - 12z = -2x + 4. Calculate the highest common divisor of x and 256. 8 Let x be 8(-4)/(32/(-20)). Let u be 15(-2)/(-12)4. What is the highest common factor of x and u? 10 Let i(y) = y + 53. Let d be i(-9). Calculate the greatest common factor of 110 and d. 22 Let x = 269 - 238. What is the greatest common factor of 403 and x? 31 Suppose 3g + 441 = 28b - 27b, -5b + 2262 = 4g. Calculate the highest common divisor of b and 36. 18 Suppose -3d = -4a - 136, a = 4a + 12. What is the highest common divisor of 32 and d? 8 Suppose -2505 = -6h + 663. Calculate the greatest common factor of 33 and h. 33 Let y(u) = u2 - 4u + 4. Let a be y(8). Let g = a - 1. What is the highest common factor of g and 7? 7 Let h = 11 - 11. Suppose h = -c + 4c - 3. Let f be -3 + c - (2 + -28). What is the highest common factor of f and 16? 8 Let k be (-53 + 59)16/6. Suppose -4n = 41 - 137. What is the highest common factor of n and k? 8 Suppose 3b - 87 = -81. Let v = 2 + 3. Suppose -l - b = -4u, -3 = vl + u - 56. Calculate the greatest common factor of l and 50. 10 Suppose -4d - 2m = -222, 4d = -0d - m + 225. Let j = -27 + d. Suppose 0 = 3l + l - 360. Calculate the highest common factor of j and l. 30 Let n = 66 + -71. Let l(r) = -r2 - 8r - 1. Let o be l(n). Let z = 45 + -10. What is the greatest common factor of z and o? 7 Let r(o) = 23o - 4. Let h be r(4). Let b(v) = v2 + 6v - 16. Let l be b(-9). Calculate the greatest common factor of h and l. 11 Let c = -405 - -423. Suppose -3r + 2n = -0r - 37, 2n = -5r + 35. What is the highest common divisor of c and r? 9 Suppose 0t - 2t + 84 = 2f, t + 5f = 38. Calculate the highest common factor of 172 and t. 43 Let c be 4 + (3 + -2 - 1). Let o = -619 + 1175. Suppose cn - 6n + o = 5z, 4n + 208 = 2z. Calculate the greatest common divisor of 10 and z. 10 Let h(g) = -3g - 9. Let d be h(-17). Suppose 0z = -3z + d. What is the highest common factor of z and 14? 14 Let c = 132 - 104. Calculate the highest common divisor of c and 147. 7 Let l = -13 - -17. Suppose 5q + l = -21, 3q = -2y + 49. What is the greatest common factor of y and 256? 32 Let w(a) be the first derivative of -a*4/4 + 14a3/3 + a2 - 20a + 2. Let s = -8 + 22. Let q be w(s). What is the greatest common factor of 2 and q? 2 Let t(g) = -2g - 4g + g2 + 0g*2 - 9. Let y be t(-6). Let l = -7 - -14. Calculate the greatest common divisor of l and y. 7 Suppose 4g = g + 165. Let i(m) be the second derivative of m4/12 + m3/6 + 11m2 - m. Let p be i(0). Calculate the greatest common factor of g and p. 11 Let s be ((-1 + 1)-1)/2. Suppose s = -2c - c + 9. Suppose -ch - 90 = -4h. What is the highest common factor of 18 and h? 18 Let u be 4/1 + -1 + -2. Let r = -19 - -22. Suppose 0 = -2d - 3f - 11, -3d + r = -f - 8. Calculate the greatest common factor of d and u. 1 Let t = 32 + -77. Let d(w) = 17w2 - w - 1. Let h be d(-2). Let u = t + h. What is the highest common factor of u and 3? 3 Let o be (-6)/(-4)40/(-30) - -15. What is the greatest common divisor of 39 and o? 13 Let u be 31 + (-2 - -1). Let s = -8 + u. Let a(r) = -r2 - 7r + 2. Let c be a(s). Calculate the greatest common divisor of c and 40. 8 Let d be (-2)/2 - -175. Let k = -1279 + 1464. What is the highest common factor of d and k? 37 Suppose -3f = 2w - 100, w - 5f - 22 = 54. What is the greatest common divisor of 224 and w? 56 Suppose -11y - 154 = -506. Calculate the highest common divisor of y and 608. 32 Let l be (-2 + 22/1)/1. Let v = 54 - 49. Let m = 55 - v. Calculate the greatest common divisor of m and l. 10 Suppose -2f - 15 = -45. Let l = f + -8. Let c be -32((-84)/16)/l. What is the greatest common divisor of 6 and c? 6 Suppose -3q - 8 = -2v - 55, 3q = -5v + 19. What is the highest common divisor of q and 221? 13 Let c(a) = -29a + 9. Let g(n) = -2n. Let r(h) = c(h) - 6g(h). Let k be r(-3). What is the highest common divisor of k and 24? 12 Let y be (-105)/21 + -1 + 16. Suppose -k + 23 = 3z, -2k + 0z = -2z - 38. Let v = 35 - k. Calculate the highest common divisor of v and y. 5 Let k(l) = l*3 - l - 2. Suppose -10 - 2 = -2r - 4b, 0 = -b + 2. Let g be k(r). Let d = 88 + -78. Calculate the greatest common factor of g and d. 2 Suppose -10z + 36 = -8z. Suppose -3s - z = -6s. Calculate the greatest common divisor of 66 and s. 6 Let q(x) = -2x - 27. Let j = -53 + 34. Let b be q(j). Calculate the greatest common divisor of 33 and b. 11 Let a(p) = -95p + 10. Let v(y) = -32y + 3. Let n(f) = -3a(f) + 8v(f). Let s be n(6). Calculate the highest common divisor of s and 24. 24 Suppose o = -2o + 15. Let d(g) = g3 + 7g*2 + 4g + 5. Let h be d(-5). Calculate the highest common factor of h and o. 5 Let c = 22 + 95. Suppose cq - 115q = 26. Calculate the greatest common divisor of 130 and q. 13 Let g = 40 - 16. Suppose -3u + 10 = 5z, 3z - u - 2 = 4. Let m = 4 + z. Calculate the greatest common factor of m and g. 6 Let w(t) = 2t*2 - t + 10. Let y be w(5). Let m = y + -15. Suppose 2p - 18 + 2 = 0. What is the greatest common divisor of p and m? 8 Suppose -149 = -19g + 136. Calculate the greatest common divisor of g and 5. 5 Let s be -2 + 2019/(-4)96/(-18). Calculate the greatest common divisor of s and 10. 10 Suppose 4f - 116 = -262a + 267a, 0 = -5f - 5a + 100. Suppose 4z - 3v - 156 = 0, -3z - 3v + 168 = 2z. What is the highest common factor of z and f? 12 Suppose 53z + 2015 = 58z. Calculate the greatest common divisor of z and 221. 13 Suppose 0r - 4r - 30 = -5d, 0 = 4d - 2r - 18. Let c(p) = -p2 + 4p - 1. Let u be c(d). Let h = 10 - u. Calculate the highest common factor of 7 and h. 7 Suppose 0j - 4q + 20 = j, -3j + q = -21. Suppose 0 = 332y - 327y - 160. What is the highest common divisor of y and j? 8 Let s be (-10)/(-1)124/8. Suppose -9l = -322 + 43. What is the greatest common divisor of l and s? 31 Suppose 0l + 8 = 4l. Let b be (l/5)/((-5)/(-225)). Let a = 15 + -6. Calculate the greatest common factor of b and a. 9 Let u be (-12)/15 - 338/(-10). Let r(c) = 70c - 8. Let j be r(2). What is the greatest common factor of j and u? 33 Let d be 16 - (5 - (5 - (4 - 2))). Calculate the greatest common divisor of 924 and d. 14 Suppose 0 = 24w - 6w - 7434. Calculate the greatest common divisor of 59 and w. 59 Let q(n) = 3n2 + 11n - 93. Let x be q(-9). Suppose -244 - 878 = -2s. What is the greatest common divisor of x and s? 51 Suppose 711 = 6u - 1989. Let v be (-66)/(-5)(u/(-12))/(-5). What is the highest common factor of v and 11? 11 Let c be (-2 - -2)/(4 - 6). Suppose -5m - 5 = 0, c = 4n - 4m - 2 - 2. Let t be 3 - n/(4 + 0). What is the greatest common divisor of t and 21? 3 Let y be (42/4)/(2/4). What is the greatest common factor of y and 42? 21 Suppose 2w + 3v + 60 = 192, -4w + 308 = -5v. What is the greatest common factor of w and 234? 18 Let u = 18 - 12. Suppose -5o - 5t = -150, 41t = o + 38t - 30. What is the highest common factor of u and o? 6 Let q = 43 + -40. Suppose -20 = 6t - 9t + a, qa - 31 = -4t. Calculate the greatest c	{ "pile_set_name": "DM Mathematics" }
5). What is the common denominator of (61 - 4)/(t/(-4)) and -33/10? 10 Calculate the smallest common multiple of -443/(-3) and 12. 48 Let l = -21987/18448 + 5/1153. What is the common denominator of l and -77/64? 64 Let z = -154 - -160. What is the lowest common multiple of 21 and z? 42 Let a be ((104/(-12))/1)/3. Let o = a - -163/18. Let y = 875/4 - 221. What is the common denominator of y and o? 12 Let v(u) = u + 2. Let q be v(10). Let n = -215 + 111. Calculate the common denominator of (108/112)/(q/n) and 49/18. 126 Let c = 69 - 57. Calculate the smallest common multiple of 57 and c. 228 Suppose 0 = t - 6t + 65. Suppose 4s - 22 = -a, -4a + 3s + 37 = -t. What is the smallest common multiple of (-10)/(-25) + 0 + 88/5 and a? 126 Let q = -1880 + 13119/7. Suppose -65u + 66u = 9. Calculate the common denominator of q and u. 7 Let l(j) = 2802j2 + 12j + 4. Calculate the least common multiple of 14 and l(-1). 19558 Find the common denominator of (-3 - -8) + 6/((-1440)/1202) and 145/36. 360 Suppose 0 = -10b + 7b + 24. Calculate the lowest common multiple of 288 and b. 288 Let p be (-8)/(-24)(11 - 2). Suppose 5j + p = 6j. What is the least common multiple of j and 1? 3 Let g be (-267)/4 - 4/16. Let m = 97 + g. What is the smallest common multiple of m and 15? 30 Let b be 1 - (4 - 1944/28). Let g = b + -3842/63. What is the common denominator of g and 56/11? 99 Calculate the least common multiple of 80/30(-9)/(-6) + 36 and 40. 40 Let s = -29 - -54. Suppose 22d - sd + 18 = 0. Calculate the least common multiple of d and 9. 18 Let f = 692322 - 318467999/460. What is the common denominator of f and -87/8? 920 Let l = 575656031506/159870381 - 9763320/2711. Let f = l - 2/1787. What is the common denominator of 35/39 and f? 429 Suppose 4d = 3u + 41, 35 = -4d + 5u + 82. Suppose 12j - 54 = 66. Calculate the smallest common multiple of j and d. 40 Suppose -15d + 67 + 8 = 0. Let z(r) = -r*3 + 4r*2 + 3r + 11. Calculate the least common multiple of z(5) and d. 5 Let i be 1313/(-72553). Let x = i - -329333/100458. Find the common denominator of 41/4 and x. 36 Let y = 398705/161007 - 1/7667. What is the common denominator of -49/16 and y? 336 Let f = -96974 - -47787. Let a = 5804029/118 + f. What is the common denominator of a and -115/14? 826 Calculate the common denominator of -38/11 and (24/80)/((-9)/((-3645)/(-6))). 44 What is the common denominator of 2 + 2 - (-1245)/(-216) and -29/22? 792 Suppose -15r - 12r + 405 = 0. What is the lowest common multiple of r and 30? 30 Let l = -15/76 - 177/836. Let f = l + 183/44. What is the common denominator of f and 62(-66)/80? 20 Calculate the common denominator of 157/90 and (2 - (-183)/(-150)) + (-12)/9. 450 Suppose 51w = 56w - 80. Find the common denominator of -85/38 and 145/36 + w/72. 76 Let r(n) = 20n2 - 101n + 477. What is the least common multiple of 531 and r(5)? 4248 Let i = -63/20 - 3/5. Calculate the common denominator of i and -45/32. 32 Suppose 51u - 50 - 409 = 0. Suppose 15 = 3a + 3y, 3y = 8 + 4. Calculate the least common multiple of u and a. 9 Suppose 128 = 6f + 614. What is the common denominator of -30/7 and (-6)/(-2) + (f/(-21) - 2)? 7 Calculate the common denominator of (-6)/27(-7 + (-1841)/28) and 20/41. 246 Let w(a) be the first derivative of -a*4/4 - 7a*3/3 - 5a*2/2 + 3a + 5. Let t be w(-5). What is the common denominator of 0 + 4/(-80)t and -11/5? 10 Suppose -252 = 31a - 33a. What is the smallest common multiple of a and 14? 126 Let r(n) = -2n*3 + 2n*2 + 2n. Let i(y) = 9y - 61. Calculate the least common multiple of i(7) and r(-2). 20 Let u(p) = -p + 10. Let b be u(6). Suppose -d - 5o + 10 = 0, bd - 2o = 2 + 38. Calculate the smallest common multiple of d and 6. 30 Suppose -370 = 2c - 4q, 0c + 3q = c + 188. Let d = c + 393/2. Calculate the common denominator of d and 23/2. 2 Suppose 0 = -8w + 15 + 9. Suppose -l - wl = 0. Suppose -5c + 106 = 4u, l = -5c - 5u + 152 - 47. Calculate the least common multiple of c and 10. 110 Suppose -5z - 44 = 1. Let y(d) = -d2 - 10d + 5. What is the smallest common multiple of y(z) and 10? 70 Calculate the common denominator of (45/240)/(9/236) and -157/336. 336 Find the common denominator of 872/117628/(-48) and 99/8. 504 Suppose g - 4h + 3h = 38, 2g - h = 78. What is the least common multiple of 70 and g? 280 Let i(t) = 139t - 5. Let l be i(-3). Let r = l + 1336/3. What is the common denominator of 137/18 and r? 18 Suppose 3x + 520 = -2x - v, -2x = 4v + 190. Let f = -93 - x. Calculate the lowest common multiple of 9 and f. 36 Let u = 4 - 3. Let z = 396 + -338. Calculate the least common multiple of z and 1/u2 + 12. 406 Let a = 18728/921 - 1/921. Calculate the common denominator of a and 46/143. 429 Let d = 30 + -26. Let r be (3/d)/(9/(-5826)). Let p = r + 531. Calculate the common denominator of p and -18/7. 14 Let i = 1452049591/1590 + -4566147/5. Let t = 62/53 - i. Find the common denominator of t and (2/12)/(9/219). 18 What is the lowest common multiple of 8 and (-1)/((-212)/1010 - (-12)/60)? 808 Let t(x) = x3 + x2 + 2x - 19. Let q be t(0). Let v = 49 + q. Calculate the common denominator of 6/15 + (-213)/v and 7/16. 80 Suppose -4v = 7 + 9. Let g(f) = 8f - 4. Let m be g(v). What is the common denominator of ((-3)/m)/((-2)/(-580)) and -125/18? 18 Let b be (-4 - (-52 + -4)) + 1. Suppose 2l = 3k - 34, 4k = -7l + 2l + b. What is the least common multiple of 30 and k? 60 Let d be (-15 + 16)(1 + 1). Let i be (-11 - -5)(-1)/d. Suppose -ia - 3 = -45. What is the smallest common multiple of 16 and a? 112 Let j be 27/(-909)(-1)/33. Let f = -92217/4444 + j. What is the common denominator of 63/104 and f? 104 Let t be (-1 - -4) + -2 + 4. Let s be 366/t60/2. Let y = 13079/6 - s. Find the common denominator of 17/12 and y. 12 Let z = 327 + -2291/7. Calculate the common denominator of 47/8 and z. 56 Let w = 1826/13 + -26435/182. Calculate the common denominator of 69/106 and w. 742 Let b be 3/(-6)98 + 41. Calculate the common denominator of 21/8 and (-6)/b - (-569)/120. 8 Let o = 12 + -10. Suppose oa = 10, -m = m + 3a - 31. Suppose 2i - 16 = -4r + 16, 5r = 4i - 51. Calculate the lowest common multiple of m and i. 56 Let x = -23 + 25. Suppose xy + 4n - 17 = 1, 5y + 2n - 21 = 0. What is the lowest common multiple of y and 6? 6 Let a(y) = -6299y*2 - 4y - 3. Let i be a(-1). Let m = -94529/15 - i. Find the common denominator of -26/27 and m. 135 Let s = 53 - 35. What is the least common multiple of s and 27? 54 Let h = 88 + -85. What is the least common multiple of 4 and 18/(-2)(-3)/9h? 36 Let d = 538 + -4826/9. Calculate the common denominator of 31/177 and d. 531 Suppose 56v - 723 = 61. Calculate the lowest common multiple of 190 and v. 1330 Let v be 1/((-3)/(-246)2). Let k = -63 + v. Calculate the common denominator of -42/11 and k. 11 Suppose 3l - 140 = -l - 4m, 0 = 2l + 4m - 68. Calculate the smallest common multiple of 4 + 124/(-32) + 611/104 and l. 36 Let v = 19379/10058 - 246/107. Find the common denominator of v and -42/517. 1034 Let a = 333001/1171544 + -2/13313. Find the common denominator of a and -57/40. 440 What is the least common multiple of 0 + (-6)/2 - -30 and 2/5 - (-392)/70? 54 Let s = -1063/5 + 23671/110. Calculate the common denominator of s and -119/40. 440 Let t = 4073190 + -1393029269/342. Let r = 37/19 - t. Calculate the common denominator of r and 8/15. 90 Let d(c) = -261c3 + c - 1. Calculate the lowest common multiple of 63 and d(-1). 2331 Let f(a) = 55a - 125. Calculate the smallest common multiple of 4 and f(5). 300 Let r = 17/413 + -40401/8260. Find the common denominator of 73/(-48) + (-5)/120-8 and r. 80 Let t = -39 + 69. What is the smallest common multiple of t and 40? 120 Let p = 67/18 + -1327/180. Calculate the common denominator of -63/44 and p. 220 Suppose s = 21s - 240. Calculate the smallest common multiple of 72 and s. 72 Suppose t + 3b = -0b, -t = -b - 12. Let x be t/(36/(-16)) - -23. Suppose 0 = -5d + x + 26. What is the least common multiple of 13 and d? 117 Let m(h) = -4h + 2. Suppose 7z + 2 = 8z. Suppose -10 = -zb, -4b - 35 = -5*y + 45. Calculate the least common multiple of y and m(-2). 20	{ "pile_set_name": "DM Mathematics" }
he units digit of j? 9 Let g = -168 - -2374. What is the thousands digit of g? 2 Let d be 4/(-6)(-4 - -1). Suppose -3 = -df + f. Suppose fj - 57 = 3n, 2n = 3j + 4n - 42. What is the units digit of j? 6 Suppose -3s + 15068 = 4a, 17s - 10045 = 15s - 3a. What is the thousands digit of s? 5 Let f = 172 + -99. What is the tens digit of f? 7 Let b = 444 + -388. What is the tens digit of b? 5 Let p(m) = -3m + 2. Let o(w) = -w + 2w - 5w + 2 + 2w. Let z(k) = 4o(k) - 3p(k). What is the units digit of z(2)? 4 Let u(g) = -24g - 5. Let v = 11 + -8. Suppose i - vr = -2, 2r = 5i + 5r + 10. What is the tens digit of u(i)? 4 Let t be ((-1)/(5/6))/(69/(-21160)). Suppose 24l = 20l + t. What is the units digit of l? 2 What is the hundreds digit of 8/84 + 77455/147? 5 Let v = 33 - 58. Let p = 18 + v. Let b = -3 - p. What is the units digit of b? 4 Let k(i) = i2 - 17i - 15. Let u be k(18). What is the units digit of 9(-4 - (-50)/u)? 4 Let c(k) be the second derivative of -1/12k*4 + 7/3k*3 + 0 - 4k - 5/2k2. What is the units digit of c(13)? 8 Let y = 264 - 220. What is the tens digit of y? 4 Let h be 0/(-2) + (-3 - -35). Let a be h-1(-5)/10. Let l = 28 - a. What is the tens digit of l? 1 Let q = 108 + 746. What is the hundreds digit of q? 8 Let x(t) = 7t + 101. Let s = -1 - -1. What is the units digit of x(s)? 1 Suppose -8w = -2397 - 1923. What is the tens digit of w? 4 What is the tens digit of 4/(-10)-58 + 6/(-30)? 2 Suppose 66441 = 46u - 6055. What is the units digit of u? 6 Suppose -3g - 2y = 327 - 1186, 0 = -5g + y + 1423. What is the units digit of g? 5 Let g be (0 + -16)/(-1(-3)/3). Let t(a) = -6a - 7. Let y be t(8). Let p = g - y. What is the tens digit of p? 3 Suppose -3v + j + 1005 = -3j, 0 = j - 3. What is the tens digit of v? 3 Suppose 417 = 4b - 2b - 3d, b = -3d + 204. What is the hundreds digit of b? 2 Let x = -626 - -1725. What is the hundreds digit of x? 0 Let w = 3466 - 1015. What is the thousands digit of w? 2 Suppose -7r + 18 = -r. Suppose 0 = -s + p - 3p + 5, 2s = 3p + r. Suppose 6n - sn = 132. What is the tens digit of n? 4 Let o = 1822 - 1298. What is the hundreds digit of o? 5 Let g = 16 - 14. Suppose -10r + gr = -8. What is the units digit of r? 1 Let r(m) = 644m2 + m - 4. What is the tens digit of r(1)? 4 Suppose 2a + 524 = -4g, -4g - 648 + 120 = 3a. Let x(h) = h - 91. Let f be x(0). Let j = f - g. What is the units digit of j? 8 Let z(m) = 2m*2 + 37m + 1. Let x(w) = w*2 + 19w + 1. Let q(h) = 11x(h) - 6z(h). Let k be q(-13). Suppose 6 = ky + 1. What is the units digit of y? 1 Suppose 3w + 3m = 5505, 3m + 1827 = 16w - 15w. What is the units digit of w? 3 Suppose -8s + 0s = -32. Suppose 0 = d + f - 12, s = d + d - 2f. What is the units digit of d? 7 Let v(d) = -d3 + 13d*2 + 4. Let c be v(13). Let u(t) = 11t - 4. What is the units digit of u(c)? 0 Let m be -1(-3)/4 + (-21)/(-4). What is the tens digit of (-28)/(-6)(9 + m)? 7 Let h(z) = -z*2 + 13z - 7. Let j be h(12). Suppose jo - 526 = -3f, -2 = f - 4. Suppose -2c = -o + 2. What is the tens digit of c? 5 Suppose -104 = -5w + 41. Suppose -3h = -2h - w. What is the units digit of h? 9 Suppose 17b = 1751 + 2278. What is the tens digit of b? 3 Suppose 28 + 221 = h. Suppose -5d + 3p = -h, 0 = -3d + p - 4p + 159. What is the tens digit of d? 5 Suppose -15377 + 4681 = -4q. What is the units digit of q? 4 Let u = -18 - -5. Let c = -4 - u. Suppose 0 = -5f + 46 + c. What is the tens digit of f? 1 Let i(b) = -23b + 174. What is the tens digit of i(-33)? 3 Let p = -1118 - -1600. Suppose -3q = 5a - 798, -7q = -3a - 8q + p. What is the hundreds digit of a? 1 Let o(f) = 5f*2 - 10f - 2. Suppose 0 = 4p + 2z - 20, -p - 2p + 13 = 2z. What is the units digit of o(p)? 3 Suppose 3 = 3m + 6. Let j be 0 + (-1 + 0)/m. What is the units digit of j/((-66)/68 - -1)? 4 Let f(t) = t2 - 3t - 11. Let x be f(6). Let l(h) = -4 + h - 4h + 2 - x. What is the units digit of l(-5)? 6 Let w(s) = 5s + 49. Let j be w(-9). Suppose 3x = 3m + 537, 0 = -2x - jm - 65 + 453. What is the hundreds digit of x? 1 Suppose 2i - 11 + 51 = 0. What is the tens digit of (-3)/i5 - (-969)/4? 4 Let p(m) = -m*3 - 14m*2 - 2m - 10. Let z be p(-14). Let h = z + -21. What is the tens digit of 24 - h/(-12)0? 2 Let a = 369 - 205. Suppose 4q + 0q = a. What is the tens digit of q? 4 Suppose -2t = -3k + 115, -t + 6t = 4k - 305. Let n = 113 + t. What is the tens digit of n? 4 Let h(k) = -7k3 - k2. Let x be (-4)/(-2) + -31. What is the units digit of h(x)? 6 Let t(a) = 5a*2 - 7a - 11. Suppose 4n + 5g + 27 = 0, -2n + 5g + 3 = 2g. What is the units digit of t(n)? 5 Suppose 10s = 4s + 18. What is the units digit of s? 3 Let c = -34 - 37. What is the tens digit of (c/(-2))/((-4)/(-8))? 7 Let p(o) = -o3 - 5o*2 - 6o + 14. Let c be p(-6). Let a be (35 - -1)(-9)/6. Let k = a + c. What is the tens digit of k? 3 Suppose 0 = -0x - x - 73. Let s = 91 + x. What is the tens digit of s? 1 Suppose 2247 = 33f + 267. What is the units digit of f? 0 Suppose y + 5 - 25 = 0. Let z be y/(-6)(2 + 1). What is the units digit of 25/z(0 - 4)? 0 Let z = 9 + -11. Let u be (118 - 1)(z - -1). Let t = -81 - u. What is the tens digit of t? 3 What is the hundreds digit of 2 + 3/(-2) - (-13559)/26? 5 Suppose 4d - 354 = 94. Suppose -x = -d - 11. What is the units digit of x? 3 Let i be -41 - (-10 - -2). Let m be i - (2 + (1 - 3)). Suppose mu = 5y + 41, -y + 87 - 14 = 5u. What is the units digit of u? 4 Let v = 6802 + -2089. What is the thousands digit of v? 4 Let r = -690 - -1156. What is the units digit of r? 6 What is the units digit of 0 + 2/3 + (-478431)/(-459)? 3 Suppose 3f = 165o - 162o + 5244, -5f - 5o + 8790 = 0. What is the tens digit of f? 5 Let x(q) = 166q2 - 2q + 3. What is the tens digit of x(1)? 6 Let i be 4/(-7) - (-2723)/49. Suppose 59 = -5h - 4n, -2h - 3h - i = 5n. Let d = h + 25. What is the tens digit of d? 1 Suppose 1934 = -16p + 8958. What is the hundreds digit of p? 4 Let s(c) = c*2 - 8c + 7. Let f be s(10). Let q = f + -2. What is the units digit of 1(-3)/((-3)/q)? 5 Let x be 22/(-99) + 40/18. Suppose -w + xs + 10 = -0w, -15 = -3w + s. Suppose 49 + 41 = 2z + wa, -a = 5. What is the units digit of z? 5 Suppose 2v = -2v - 2y + 338, 420 = 5v + 5y. What is the units digit of -32v/(-30)? 7 Let o(x) = 127x2 + x + 6. What is the tens digit of o(-3)? 4 Let n = -491 - -767. What is the hundreds digit of n? 2 Let b(j) be the second derivative of j5/20 + 7j4/12 + 2j3/3 + j2 - 6j. What is the units digit of b(-5)? 2 Let r be 9/6 + (-69)/(-2). Suppose 34f + 286 = rf. What is the tens digit of f? 4 Suppose 9k - 2q = 5k + 1940, -k + 488 = -2q. What is the tens digit of k? 8 Suppose -7h + 5c - 141 = -11h, 0 = 3h + 3c - 105. Let t(f) = f*3 + 5f*2 - 4f + 1. Let a be t(-6). Let z = a + h. What is the tens digit of z? 2 Let v be (-12)/(-1)(-4)/(-6). Let k = v + -8. Suppose k = 4y - 7 - 5. What is the units digit of y? 3 Let k(v) = -v + 11. Let q be k(11). Suppose -3d + 6d + 24 = q. What is the units digit of 43/2 + (-12)/d? 3 Let n = 38 + -22. Let b = 9 - 8. Let g = b + n. What is the tens digit of g? 1 Let k(h) = h*2 + 3h - 1. Let w be k(2). Suppose -10x = -wx - 42. What is the units digit of x? 2 Let j be (-3)/((-20)/(-8) - 3). Suppose r + 4 = 2r. Suppose -rm = -jm + 44. What is the units digit of m? 2 Let c(a) = -9a + 1416. What is the tens digit of c(0)? 1 Let y(g) = 2g2 - 4. Let n be y(4). Suppose 0 = -2l + 4o + n, -4l + l + 27 = -3o. What is the tens digit of 1/(l/2)36? 1 Suppose 228 - 893 = -r - 3h, -2h = -5r + 3257. What is the tens digit of r? 5 Let z be (-96)/24 + -2 + 1. Let r(j) be the first derivative of -j3/3 - 3j*2 + 5j - 2. What is the tens digit of r(z)? 1 Let r(s) = 19s - 3. Let l be r(4). Suppose 3x + 5j = 127, 2x + j + 0j = l. What is the tens digit of x? 3 Let l(f) = 11f*2 + 3f + 2f - 3f - f - 1. Let t be 5(-1(-6)/(-10) - -1). What is the units digit of l(t)? 5 Let v be 1 + (-5 - -2 - -2). Suppose -25 = -m - 4b, -2m - 2m - 5b + 100 = v. What is the tens digit of m? 2 Suppose -4x + j = -1387, -4x	{ "pile_set_name": "DM Mathematics" }
v + 13)/2 Factor n5 - n5 + 108n4 - 71n*4 + 3n*5 - 3n*3 - 61n*4 + 24n*2. 3n*2(n - 8)(n - 1)(n + 1) Let r be (-367198)/(-31655) + 6/15(-1)/2. Let n = -7182/5 + 1446. Solve -15x*2 - 21/5x*4 + nx - 12/5 + 3/5x5 + rx*3 = 0. 1, 2 Let z(x) = -72x*3 + 291x*2 - 678x + 459. Let g(v) = 7v3 - 29v*2 + 68v - 46. Let r(d) = 21g(d) + 2z(d). Determine q, given that r(q) = 0. 1, 4 Let i(b) = -226b + 414. Let w be i(5). Let c = w - -718. Factor -1/6m - 1/6mc + 0. -m(m + 1)/6 Let y = 20092 + -20092. Let w(s) be the third derivative of 0s3 - 1/24s*6 + 0 + 5/24s*4 - 1/126s*7 + 1/36s*5 + ys + 23s2. Factor w(r). -5r(r - 1)(r + 1)(r + 3)/3 Let k = -124 + 129. Determine y so that -6y*k + 11y*5 - 19y*3 + 14y*3 = 0. -1, 0, 1 Let -483a*3 - 303a + 194a2 - 37a*2 + 93a*4 - 162 + 1086a + 212a2 = 0. What is a? -1, 6/31, 3 Suppose 12z - 36 = -6z. Suppose -78t*z - 5t*5 + 19t*5 - 36t - 58t3 - 16t*5 - 18t4 = 0. What is t? -3, -2, -1, 0 Let d(y) be the first derivative of -y5/30 - y*4/3 - 5y*3/9 - 90y - 195. Let u(f) be the first derivative of d(f). Factor u(o). -2o(o + 1)(o + 5)/3 Let s(o) be the first derivative of 5o4/4 + o3/3 - 5o2 - 6o + 127. Let z(v) = -26v3 - 6v*2 + 48v + 28. Let k(r) = -14s(r) - 3z(r). Factor k(u). 4u(u + 1)(2u - 1) Factor 1/4s2 + 1139/2s + 2277/4. (s + 1)(s + 2277)/4 Let m(s) = s2 - 24s + 137. Let w be m(9). Factor 8z3 - 22 + 35z - 3z2 - 11z*w + 2z*3 + 9z*3 - 18z*3. (z - 11)(z - 2)(z - 1) Let w = -3215/68 + 808/17. Let -wd*2 + 21/2 + 11/4d = 0. Calculate d. -3, 14 Let o(y) be the second derivative of -3y5/100 + 141y*4/10 - 20433y*3/10 + 115926y*2/5 + 165y - 2. Solve o(t) = 0 for t. 4, 139 Let f(o) be the second derivative of 5/48o4 - 3/2o*2 + 0 - 79o - 7/6o3. Factor f(z). (z - 6)(5z + 2)/4 Let u(l) = -l3 + 99l*2 - 1110l - 685. Let m be u(86). Factor -34/3a4 - 128/3a*2 + 0a - 160/3am + 0 - 2/3a*5. -2a*2(a + 1)(a + 8)2/3 Let q(d) = 85d*2 + 13d - 27. Let w be q(-5). Let a = -22347/11 + w. Determine t, given that -6/11t2 - at - 8/11 = 0. -2, -2/3 Let d(h) be the third derivative of 1 - 17h2 + 1/28h*8 - 1/10h*6 + 0h*4 + 0h*3 + 0h - 1/30h5 + 1/105h*7. Suppose d(a) = 0. Calculate a. -1, -1/6, 0, 1 Suppose 0 = -3j - u - 2, 6j + u + 9 = 10j. Let s(o) = -3o2 - 26o + 2. Let t(r) = -r*2 - 2r + 1. Let k(l) = js(l) - 2t(l). Factor k(g). -g(g + 22) Factor 2z*3 - 6400 + 15552z*2 - 7856z*2 + 3520z - 7860z2. 2(z - 40)*2(z - 2) Let u(z) = 19z3 + 2878z*2 + 3731z - 3828. Let v(q) = -78q3 - 11511q*2 - 14907q + 15312. Let p(s) = -21u(s) - 5v(s). Find n such that p(n) = 0. -319, -2, 2/3 Let p(v) be the first derivative of -v6/18 - v5 - 5v4/12 + 115v*3/9 - 25v*2 + 56v/3 - 854. Find b such that p(b) = 0. -14, -4, 1 Let o(z) = -8z2 - 345z - 3716. Let a be o(-22). Factor 20/3 + 10/3qa - 15q. 5(q - 4)(2q - 1)/3 Let w(p) = 3p*5 - 5p*4 + 26p*3 - 32p*2 - 2p + 2. Let m(x) = 5x5 - 6x*4 + 27x*3 - 34x*2 - 3x + 3. Let s(o) = -2m(o) + 3w(o). Factor s(r). -r*2(r - 2)*2(r + 7) Let s(m) be the third derivative of m*6/5 - 49m*5/20 + 37m*4/4 - 33m*3/2 + 2396m*2. Factor s(k). 3(k - 1)*2(8k - 33) Let p = -27/16 + 113/48. Suppose 57g - 36g - 84 = 0. Factor 10/3m - g - pm2. -2(m - 3)(m - 2)/3 Factor -64/9 - 28/3s*2 + 64/3s + 10/9s3. 2(s - 4)*2(5s - 2)/9 Suppose 0 = 2n - 3m, 2n + 4m = -1494 + 1494. Factor 2g + g*4 + 1/2g*5 - 2g*2 + n - 3/2g*3. g(g - 1)*2(g + 2)*2/2 Let i(l) be the third derivative of 0 + 0l - 1/72l5 - 5/6l*3 + 37l*2 - 25/144l*4. Let i(u) = 0. Calculate u. -3, -2 Suppose -9z + 169 = -11. Let q be (18/255)/(12/z). Find s such that qs3 + 0 + 6/17s*2 + 4/17s = 0. -2, -1, 0 Let i(s) = 7s3 - 69s*2 + 20s + 78. Let x(h) = 6h3 - 60h*2 + 18h + 79. Let l(o) = -5i(o) + 6x(o). Factor l(r). (r - 14)(r - 3)(r + 2) Let u(i) be the third derivative of -i*6/50 + 9i*5/25 + 61i*4/40 + 21i*3/10 - 282i*2 - 5. Find t such that u(t) = 0. -1, -1/2, 21/2 Let b(z) = 32z + 136. Let n be b(-4). Let w be 16/n - (1 + -5)/(-8). Factor 3/2 - 3f + wf*2. 3(f - 1)*2/2 Let h(k) = -7k*2 - 233k - 900. Let g(i) = 8i2 + 227i + 900. Let z(u) = 2g(u) + 3h(u). Factor z(b). -5(b + 4)(b + 45) Let q(k) be the third derivative of k*5/20 + 3k4/8 + k3 + 3083k2 + 2k. What is g in q(g) = 0? -2, -1 Let x(p) = -p*2 + 4p. Let c be x(2). Factor -644a3 + 330a*3 - 10a*2 + 319a*3 + 5a*c. 5a*2(a - 1)(a + 2) Let h = 551/1143 + -33/127. Factor 0 + 2/9j + hj2. 2j(j + 1)/9 Let h(c) be the second derivative of 2/9c*3 + 1/120c*5 + 1/3c*2 - 70 + c + 5/72c*4. Let h(l) = 0. Calculate l. -2, -1 Determine a so that 3/2 + 85/2a + 14a2 = 0. -3, -1/28 Let x(j) be the third derivative of j6/300 - 193j*5/300 + 473j*4/120 - 47j*3/5 - 1731j*2 - 2j. Factor x(b). (b - 94)(b - 1)(2b - 3)/5 Let q(v) = -v3 + 26v*2 + 108v - 48. Let j be q(-4). Factor 0 + 0a + ja*2 - 3/2a*3 + 1/4a4. a3(a - 6)/4 Suppose 11832 + 5148 = 20a. Find w, given that -425w2 + aw*2 - w - 423w2 = 0. 0, 1 Let s(c) be the second derivative of c4/6 - c*2/2 - 3c + 1. Let x(o) = o*2 - 140o - 3. Let m(z) = -3s(z) + x(z). Solve m(b) = 0. -28, 0 Factor 5u*5 - 3290u*2 + 993u - 1715 + 2595u - 115u*4 + 950u*3 + 577u. 5(u - 7)3(u - 1)*2 Let s = 84 - 24. Let l be (5 - 2)/(s/16). Factor 24/5h - lh2 + 2/5h*4 + 18/5 - 8/5h*3. 2(h - 3)*2(h + 1)2/5 Let y(t) be the second derivative of t4/9 - 2600t3/9 + 95t. Factor y(w). 4w(w - 1300)/3 Let w(q) = 2q2 - 45q - 11. Let u be w(23). Suppose -45j + uj*2 + 15j + 14j2 + 5j*2 + 4 - 5j*2 = 0. Calculate j. 2/13, 1 Solve 26611 + 5y*2 - 1500y + 35299 + 36075 + 46881 - 32366 = 0. 150 Find z, given that z*3 - 3/2z + 1/2z5 + 0 + 2z*2 - 2z*4 = 0. -1, 0, 1, 3 Let g(q) be the first derivative of -2q*5/35 + 4q*4/7 + 352q*3/21 - 768q*2/7 - 18432q/7 + 4331. Factor g(j). -2(j - 12)2(j + 8)*2/7 Solve 0 + 0d*2 - 332/15d*4 - 2/5d*5 + 0d - 22/3d3 = 0 for d. -55, -1/3, 0 Suppose -97l = -1149l + 2104. Determine z so that z - 5/2z*2 + l - 1/4z5 + z4 - 1/4z3 = 0. -1, 2 Let q(i) be the first derivative of 2i*3/33 + 40i*2/11 - 1850. Factor q(g). 2g(g + 40)/11 Let y(n) be the first derivative of -n7/105 + n6/20 + n5/30 - n4/4 - 38n2 - 67. Let p(t) be the second derivative of y(t). Solve p(b) = 0 for b. -1, 0, 1, 3 Let z be 28/4 + -3 + -6. Let r be ((-1)/z)/(13/(-26)). Let k(b) = b2. Let j(u) = -6u2 + 5u + 10. Let f(a) = rj(a) - k(a). Factor f(o). 5(o - 2)(o + 1) Let k(j) = -15j*3 - 2751j*2 - 5242j - 8. Let n(a) = -20a3 - 3672a*2 - 6989a - 11. Let c(f) = -11k(f) + 8n(f). Factor c(h). 5h(h + 2)(h + 175) Let l(t) = 2t*3 + 320t*2 + 312t + 36. Let d(q) = 16q3 + 2561q*2 + 2496q + 294. Let o(f) = 12d(f) - 98l(f). Factor o(b). -4b(b + 1)(b + 156) Let x(v) be the first derivative of 0v*2 - 8/15v*3 + 0v - 1/5v4 + 1. Suppose x(y) = 0. Calculate y. -2, 0 Suppose -9z + o = -10z, 3z - z = -o. Let r(u) be the second derivative of 2/5u2 + 1/12u*4 + 12u + z + 4/15u3 + 1/100u*5. What is t in r(t) = 0? -2, -1 Find h such that -25h - 666246h2 + 666326h*2 - 20h*4 + 70h*3 + 15h*3 = 0. -1, 0, 1/4, 5 Let l(a) be the second derivative of 5/12a*4 - 1/4a*5 + 117a + 0 + 5/6a3 - 5/2a*2. Factor l(v). -5(v - 1)*2(v + 1) Let o be (4617/(-72) - 2)/(20/(-160)). Factor -23g2 - 1/3g*3 - og - 12167/3. -(g + 23)*3/3 Let v be (-50)/60(-1)/(-5)36/(-2). Factor 2/13r*4 - 8/13r - 10/13rv + 16/13r*2 + 0. 2r(r - 2)2(r - 1)/13 Suppose 2y + 2j + 14 - 12 = 0, 3j = -20y + 31. Find n, given that 1058/3 + 2/3ny + 92/3n = 0. -23 Let c(t) be the second derivative of t*6/60 - 7t*5/4 + 51t*4 + 35t*3/6 - 1225t*2/4 + 2t - 2. Let c(q) = 0. What is q? -1, 1, 35 Let d(c) be the first derivative of c*5/180 - 7c4/72 + c3/3 - 51c*2 + 50. Let x(g) be the second derivative of d(g). Factor x(w). (w - 6)	{ "pile_set_name": "DM Mathematics" }
h or u? u Suppose -3n + 4c + 3 = 0, 1 = 5n + c - 4. Let k be (-3)/19716/24. Is k < n? True Let l = 495 + -492. Which is smaller: 2/9 or l? 2/9 Suppose 2b + 69 = 5x, -2b + x = 3x + 76. Let g = 137 + b. Let u = g - 498/5. Is u > -0.16? True Suppose -43r + 42r = -15. Suppose -rl - 1009 = -259. Which is bigger: -51 or l? l Let b be 13/(-65) + (-38)/10. Suppose -2g = 3a + 3g - 24, 4a = 2g + 32. Let h = a + -14. Is b at most as big as h? False Let c be 4(-1)/13/(-12). Let v(o) = -o3 + o2 - 1. Let h be v(0). Let t be -6 + 3 - (h + 1). Is t at most c? True Let p be (10/(-3))/(16/24). Let v(b) = b*3 + 6b*2 + 6b + 4. Let g be v(p). Which is bigger: -2 or g? g Let l(h) = h - 3. Let s be l(3). Let z = -0.79 + 1.19. Are z and s non-equal? True Let l be (31/(-51))/(-4 + 7). Let v = 1/51 - l. Is v not equal to 1? True Let q be (-141)/(-188) + 95/(-4). Is q equal to -24? False Let c = 2 - 2. Suppose r - 2r - 1 = c. Let u = 0 + r. Which is smaller: -2 or u? -2 Let h(l) = l3 + 21l*2 + 20l - 1. Let n be h(-20). Let a = -30 - n. Which is smaller: a or -28? a Suppose -2p - 785 = -p. Let w be ((-6)/5)/(-4 - p/200). Which is smaller: w or 18? w Let x = 0.6 + 2.4. Let c = 2.9 - x. Let s = -3407 - -91991/27. Is c > s? False Let q be 111/185(-1)/3. Is q greater than or equal to -0.2? True Let o(w) = -5w + 32. Let b be o(9). Which is smaller: -19 or b? -19 Suppose -o + 125 = -5y, 5o = 2y - 29 + 56. Which is smaller: y or -24? y Let c be 4/(12 + (-29458)/2453). Is c < -447? False Let d = 3.52 + -3.62. Which is greater: d or 200? 200 Suppose -4o = -4l + 16, -o - 2l = -l. Let n(q) = -2q*2 - 35q - 8. Let t be n(-17). Let z be t + -4 - 1 - o. Are 6 and z non-equal? False Let m be (-7788)/472(-1 + 3). Suppose 0 = -3w - 78 - 18. Are w and m unequal? True Let c(l) = l*2 - 8l - 66. Let b be c(-5). Is b greater than -13/48? False Let u = -8 + 4.6. Let a = u + 1.4. Which is smaller: a or -3? -3 Let c = -169/3 - -1823/33. Let p be (-7)/(35/20) + 4. Which is smaller: p or c? c Let f = 3 + -3.2. Let k = f - 0. Let w = 13792 + -13785. Is k greater than or equal to w? False Suppose -3 = -4r + 5. Suppose -3v + 50 - r = 0. Let w be (-4)/(-10) + v/(-40). Are w and -1/9 unequal? True Let l = 228 + -235. Which is smaller: 4 or l? l Suppose -31q = -27q + 572. Let f = 281/2 + q. Are 4 and f equal? False Let h = -24 - -24.34. Let f = -16.66 - h. Let v = f + 17. Which is smaller: v or 9? v Suppose 48y = -36835 + 6259. Which is smaller: y or 0? y Let a(o) = -1 - 14o - 4 - o*3 - 3 + 15o*2. Let f be a(14). Let i = 5 + f. Which is smaller: i or -1? i Suppose -21d + 25d - 288 = 0. Suppose 5g - 48 = d. Is 25 equal to g? False Let l be (-58)/(-7) - (-2)/(-7). Let b be 1 + -1 - l/2. Suppose 48 = -11j + 4. Is b >= j? True Suppose -5l + 37 = -18. Suppose 52 + 80 = 12q. Are q and l unequal? False Suppose -44y - 48 = 4y. Which is bigger: y or -139/5? y Let f = 88 - 86. Let r = -2 + 1. Let m = f - r. Are -1 and m non-equal? True Suppose -q = 3q + 2w - 14, -3q + 23 = 4w. Let j = 0 + q. Let p = 65/36 - 14/9. Is p greater than j? False Let u be 6/(-9)21/6454. Is 0 at most as big as u? False Let r(p) = -p*3 + 14p*2 - 14p + 18. Let s be r(13). Suppose 4o + 11 = -1, 2d - o = -s. Which is smaller: d or -3? d Let h = -37 + 35. Is 0.514 bigger than h? True Let c = -178 + 169.9. Let u = -146 - -138. Let a = c - u. Which is greater: a or -0.06? -0.06 Let p = 509/2149 - -15/307. Let w = -8 - -8.32. Let g = -0.3 + w. Is g > p? False Suppose -3n - 276 = -3z, 2z + 2n - 315 = -135. Let o = z - 1455/16. Let m be (-1)/(-3) - (-4)/(-3). Is m <= o? True Let h = 18 - 13. Let d = 37/12 + -10/3. Which is smaller: h or d? d Let q be 43(-9)/((-27)/16). Let p = 70 - q. Does 4 = p? False Let x be ((-64)/(-12) + -7 - -2)0. Which is bigger: x or 103? 103 Suppose 9y - 6y = 3l - 45, -4l = 4y + 60. Let k be 226/(-15) - (-4)/10. Does y = k? False Let y be (3 - 448/35)(1 + -6). Suppose -5p - v + 188 = -p, -2p + 84 = 3v. Is p greater than y? False Let i be (-50)/(-5)(-4)/(-10). Suppose 0t = it + 5r - 5, 0 = -2t + 5r - 5. Suppose t = 3x - z - 3, -4x - 4z + 5 - 1 = 0. Is 9/5 greater than x? True Suppose 2i + 90 = 3l, l + 24 = i + 55. Is l smaller than 21? False Suppose 12o - 17o = 0. Let z be o + 39/(-15) + 3. Is z >= 4? False Suppose 27k - 712 = 31k. Which is smaller: -0.1 or k? k Let f = 794 - 910. Are f and -461/4 non-equal? True Let s be 2 + 4/(-2) + 1. Let u be (0/(-12))/(2s). Is u less than 3/20? True Suppose -6 = 2d + 4q, -2d - 2q - 7 = -5d. Is d >= 2/101? True Let p = -17 - -5. Let b = p + 9. Let u = 4 + b. Which is greater: -0.08 or u? u Let r(g) = 6g3 - g2 - 2g + 2. Let q be r(1). Suppose -q = -a + 6a. Let n be (-3)/(-7)(0 - 14/(-40)). Is n at least as big as a? True Let j = 0.159 - -0.141. Is j at most as big as -4/21? False Let y = -1 - -0.86. Let k = -4.25 + 6.25. Which is smaller: y or k? y Let q = 20 - 8. Let o = 3.6 + 1.4. Let m = q - o. Is m greater than or equal to 0.2? True Let u(c) = -c3 + 7c*2 - 8c - 1. Let y(i) = -i*3 + 7i*2 - 7i - 1. Let j(h) = 5u(h) - 6y(h). Let z be j(7). Is z greater than or equal to 15? True Let k = 422 - 422. Which is smaller: k or 1/1396? k Let g = -6.192 - -0.192. Let x be 0/(-6) + (-2)/8. Which is smaller: g or x? g Let g = -11299/7 + 122782/63. Let z = g + -334. Is z less than 2? True Suppose -5n - 2x + 1186 = -2106, 2x - 1972 = -3n. Does 661 = n? False Suppose -5k + k = -2i + 180, -145 = 3k + i. Let w = k - -39. Do -4 and w have the same value? False Let z be ((-10)/(-7))/(8/14). Let m be 6/(-21)322/184. Which is greater: m or z? z Let h = -59 - -59. Let n be (-1)/4 + 5073/(-12). Let f = n - -7193/17. Are h and f nonequal? True Suppose 9q = 7q + 4t - 24, 56 = -3q + 2t. Which is smaller: q or -26? -26 Suppose g - 5w = 180, 3g = g - w + 349. Suppose r = -4r + g. Let x be -49(-2)/2. Is r bigger than x? False Suppose 0 = -p + 4j - 21, -3p + 4j - 12 - 11 = 0. Let z = 120/77 + -14/11. Are z and p non-equal? True Suppose -2v - 2s = -96, -6v + 204 = -v - 4s. Is 43 at least as big as v? False Let q(j) = -54j*3 + 5j. Let k be q(2). Are -422 and k equal? True Let q be (-2 + 11)(-2 - -3). Let x be q/(-6) + 3/2. Is 7/12 at most x? False Let l = -105350247/2015 - -52283. Is 0 at most as big as l? False Let z(u) = u3 - 6u*2 + 11u - 20. Let s = -285 + 289. Let d be z(s). Suppose -3t - 31 = 3x - 8x, 5t = -5x - 25. Which is smaller: d or t? d Let v(p) = 4p - 6. Let q be v(2). Let r = 5002/33 - 452/3. Does q = r? False Let i = -3753 + 3756. Let p be (-12)/((-6)/97). Which is greater: i or p? i Let y = 374/7 + -741/14. Which is smaller: -91 or y? -91 Suppose w + w - 3m = -2476, 5w + 5m = -6215. Let k = w - -6256/5. Do k and 9 have different values? True Let r = -11 + 25. Suppose -2p + 3 = 4u - 19, -r = p - 3u. Suppose p = -h - 0. Is h != -2? True Suppose -198 = -18c + 51c. Suppose 0 = -y + h + 4h + 60, -5h - 10 = 0. Suppose -4v - 5g + 16 = 61, -5g = 5v + y. Which is smaller: v or c? c Let m = 0.025 + -21.025. Let w = -20.99 - m. Let b = -0.09 - w. Which is greater: b or -2/5? b Let l = 23 + -21.9. Let q = -1.36 + l. Let p = q + 0.36. Which is greater: -12/5 or p? p Let k = -7 + 5. Let f = -883/15 - -53741/930. Let x = 18/31 + f. Which is greater: k or x? x Let o be (-74)/8 + (-12)/(-48). Let n be -3((-12)/o)/2. Is -3/5 > n? True Let v be (-15)/(-6) + 3/2. Let b = -13 + 15. Which is smaller: b or v? b Let t = 18.4 + -19. Let c = t + -1.4. Which is smaller: c or -5? -5 Suppose 2a + 92 = -4o - 72, o - 292 = 4a. Are -72 and a equal? False Let a(n) = n2 + 8n + 10. Let k be a(-7). Suppose -h - k = -2h. Suppose i + 2t = h - 2, -3i = t + 2. Which is smaller: -2/15 or i? i Let l = -1.523 - 0.777. Is l less than or equal to 0.8? True Let j(n) = 54n2 - 1. Let x be j(1). Let i be x/246 + 3/(-18). Let g(z) = z3 - 10z2 + 14z + 16. Let a be g(8). Which is smaller: a or i? a Let y(q) = -6q - 16. Suppose 0 = 2o - 4o - 6. Let a be y(o). Is a bigger than 13/5? False Let t = 667 + -668. Which is smaller: -16/35 or t? t Suppose -2t - 2 = 4b, 5t - 21 - 7 = b. Suppose 2k + 2m + 7 = 3k, 22 = tk + 3m. Suppose 0 = -4i -	{ "pile_set_name": "DM Mathematics" }
Let h be (-11)/7 + z + -2. Is 0 < h? True Suppose 4q + 8 = 3x - 2x, -5x + 6 = -3q. Is -5/6 greater than or equal to x? False Suppose 3 = 2c - c. Let v(z) = z - 5. Let t be v(c). Let l = t + 0. Does l = -2? True Let o = -1 + 23. Let w be o/8 - (-1)/4. Let j be 0 - ((-3)/w - -2). Is j greater than or equal to 2/5? False Let c = 1.8 + -2. Let p = 0.143 - -14.057. Let k = 14 - p. Are c and k equal? True Let t be ((-16)/(-18))/((-2)/33). Let y = -15 - t. Which is smaller: y or 0? y Let j = 38 + -47. Which is smaller: j or -1? j Let d(n) = -n*3 - 9n*2 + 11n + 11. Let l be d(-10). Suppose j + 72 = -0j. Let u be (-34)/j + 6/(-27). Is l greater than or equal to u? True Let p(q) = 3q*2 + 0q*2 + 7q - 4q2 + 2. Let k be (-1)/(-2) + 273/42. Let i be p(k). Is 3 less than or equal to i? False Let t = 5 - 3. Let m be (-33)/(-5) + t/5. Let o be (-4)/16 + m/12. Is -1 > o? False Let b(k) = k2 - 1. Let h be b(1). Let n = -1572505/8771 + -10/8771. Let x = 179 + n. Is h greater than x? True Let h be (-1236)/72 - (-2)/12. Let c = 13 + h. Is c at least as big as 1? False Let i = -4 - -4.05. Let y = i + 0.15. Let d = -2/15 + -11/30. Which is smaller: y or d? d Let t = -0.24 - 10.76. Which is greater: 0 or t? 0 Let n be 20/(-15) - (-318)/225. Which is smaller: n or -1? -1 Suppose 0h - 3h + 9 = 0. Let a be h(1 + 2 + -2). Is a at most as big as 3? True Let n be 3/(-2)80/(-15). Let l = n + -6. Let h = l + -3. Which is smaller: h or -2/7? h Let w be (-9 - -5)/(-43/2). Let y(g) = -g*3 + 4g*2 - 2g - 3. Let f be y(3). Which is smaller: f or w? f Let t be 1/3-13. Let u be (-2)/(t3 - -2). Suppose -m + 3d = -ud, 0 = -5m + 4d. Is -1/5 > m? False Let o(b) = -b2 - 13b - 14. Let h be o(-5). Is 26 at most as big as h? True Let h = 1.5 + -4.1. Let m = 1.4 - h. Do 1 and m have the same value? False Let d be (-41)/(((-22)/(-6))/1). Let u = -11 - d. Let o be (-26)/117 + (-4)/18-1. Which is smaller: u or o? o Let z = 0.2 + -0.3. Let h = 23/177 + 1/295. Is z at most h? True Let k = 72.1 + -13.1. Which is smaller: k or -0.1? -0.1 Let t = 47.7 - 48. Is 5 != t? True Let g = 88 - -279. Let b be 3671/10 - 27/18. Let y = b - g. Is -2 < y? True Suppose -4p - 761 = 3f, 2f + 5p - 172 + 684 = 0. Let s = f + 1251/5. Is s less than or equal to 0? True Suppose -x = -5x - 404. Is -102 not equal to x? True Let n(q) = 8q + 3. Let j be n(-1). Suppose -2i - 4k - 10 = 0, 3i + 4k = 3 - 16. Which is smaller: i or j? j Suppose 0 - 2 = -2a. Suppose h - 1 = 1. Suppose -3 = hy - a. Is -1/2 less than y? False Suppose -z + 5 = -6z. Let h be 1/(-1(z + 0)). Suppose 4 = -l - 3l + 4w, l - 4w = -7. Is h bigger than l? False Suppose -4z = 3h - 0h + 12, 9 = h - 3z. Suppose 0 = -hi + i - 5v + 24, -v + 58 = -3i. Which is smaller: -0.1 or i? i Let x = -5 + 7. Let u(q) = 0q*2 + 8 + 3q - 3q2 + 5q + 4qx. Let r be u(-7). Which is greater: r or 4/5? r Let p = 6 + -15. Let j = -0.072 + 8.972. Let i = j + p. Do -2 and i have the same value? False Suppose -2q = 2q. Let w be 6/33 + -1 + 1. Which is greater: w or q? w Let j(q) = q3 + 7q*2 + 6q - 1. Let h be j(-6). Let v be (-10 + 9)/(1 + 2). Which is smaller: v or h? h Let y = 50 - 48. Let g = 3 - 4. Are g and y equal? False Let f = -4503/7 - -646. Which is greater: 2 or f? f Let g be (528/(-135))/(-2) + (-6)/15. Which is bigger: g or 3? 3 Let s be 4/3 - (-14)/(-35). Is 0 bigger than s? False Let j = -1.22 - 0.08. Let f = -0.7 + j. Which is bigger: 0 or f? 0 Let w = -16/65 - 2/13. Which is bigger: 0 or w? 0 Suppose 0 = -3f - 0f - 12. Are 2 and f non-equal? True Let r be (-28)/12 - (-7 + 5). Let b(g) be the third derivative of g4/12 - g3/6 + 2g2. Let j be b(1). Is j > r? True Suppose -6 = 4v - 2j, 4j + 23 = -4v - 13. Which is smaller: v or 1/2? v Let c(k) = -k2 + 4k - 3. Let u be c(3). Suppose -2m + 5g - 20 = 0, -3m - 2g + 5 + 3 = u. Is m at most as big as 2/3? True Let s = -1 - -1. Is s > -3/4? True Let n = 67/527 + 7/31. Is n < 0? False Let t(j) = 6j2 - 15j2 - j + 1 - 3 - j3 - 1. Let z be t(-9). Which is bigger: z or -2/3? z Let x = -18 + 16. Is -2 != x? False Suppose 38 = t + t. Which is greater: 18 or t? t Let o be (0 - -2)/(88/(-6)). Let x = o - 5/44. Let p(k) = k*3 - k + 1. Let c be p(0). Is x >= c? False Let o = 13.4 - -1.6. Which is smaller: -1 or o? -1 Suppose -4h = -5q + 28, 2h + 9q = 4q - 14. Which is bigger: 2 or h? 2 Let z = 0.475 + 0.525. Let m = 2.5 - 3. Which is greater: z or m? z Suppose 20o + 3 = 19o. Is -28/9 bigger than o? False Let v = -0.5 - -0.2. Which is smaller: v or -2/11? v Suppose 3g + 16 = 4v - 7, 0 = -5v - 2g. Suppose -4 = -k - 3, u = 2k. Is u at most as big as v? True Let w(x) = x + 4. Let a be w(-4). Suppose 0z + 2z = 362. Let o = z + -2171/12. Is o at most as big as a? False Let a = -0.06 - 0.74. Let q = a + 0.3. Which is smaller: q or -0.1? q Let l be ((-44)/52 + 1)-2792. Let v = -430 - l. Is 1 < v? False Suppose -2b = -1 - 3, -4b + 3 = 5w. Let p(h) = -3h*2 + h - 1. Let k be (2/8)/((-2)/(-8)). Let o be p(k). Which is greater: o or w? w Let j = -0.1 + 0. Let n(o) = -47o - 1. Let u be n(3). Let w = 992/7 + u. Which is bigger: j or w? j Suppose 11r - 90 = 6r. Which is smaller: 17 or r? 17 Suppose 2m = -2m - 92. Let g = m + 33. Which is bigger: g or 9? g Let u be (-4)/(-480)3 - 12/30. Which is smaller: u or -1? -1 Let c be 2 + (-19 + 0)-1. Let z be c/14 + (-34)/28. Is -2/7 at most as big as z? True Let r = 0.072 - 7.072. Is r at most 2/11? True Let y = -154/3 + 281/6. Which is smaller: -4 or y? y Let g = 43 + -74. Is g at most -31? True Let c(n) = -3n - 8. Let f be c(-8). Is f greater than 17? False Let r be (-3)/668/(-6). Are 7 and r nonequal? True Let w(i) be the first derivative of -3i2/2 - i + 5. Let o be w(5). Is -16 != o? False Let n = -7 - -15. Let l be (-72)/(-105) + n/(-28). Do l and -0.1 have different values? True Suppose -3q = o - 8 - 1, 0 = -2o - 4q + 16. Let h be 5/(-15) + 2/o. Does 0 = h? True Suppose -4v = -16, -4v + 23 = -5n - 2v. Let u be 1/((-27)/(-6))n. Let o be (-6)/27 + 16/(-9). Which is bigger: u or o? u Suppose 2 = -5r + 3r. Let b = -2 - -1.9. Let l = -0.2 - b. Does l = r? False Let b = -8.7 + 1.7. Let j = b - -4. Let k = j - -3.2. Is k at least as big as 2? False Suppose -5s = -2j - 2j - 1, 5j - s - 25 = 0. Are j and 5 nonequal? True Let w = -31 - -26. Is w > -2? False Let w = 1.09 + 0.11. Let c = 1 - w. Let v = -0.4 - c. Which is bigger: v or -1? v Let p = 10 + -14. Let v be 2/(p/21). Let x be 6/9 - 14/3. Which is bigger: x or v? v Suppose 4n - 4 = 4. Let s(a) = -3a*2 + 0 + 2a3 + a - n - a3. Let c be s(3). Which is greater: c or 3? 3 Suppose 0 = -4a + 4h - 24, -5a - 5h = 32 + 28. Let b be ((-3)/9)/(3/a). Let i = -1 + 1. Which is greater: i or b? b Suppose k + 6 + 6 = 3f, -2f = -k - 9. Let s(r) = -r*3 - 2r*2 - 2r - 1. Let q be s(-2). Suppose p - 3p - qa = 11, -p - 3a = 7. Which is bigger: k or p? k Let b = 7 - 6. Suppose -3l - 5 = p, -b = 3p - 4l + 1. Is p smaller than -2? False Let q = -133/3 + 45. Which is smaller: q or -0.06? -0.06 Suppose 2f - 5 = -3f. Let u be (-130)/(-56) + 2/8. Let a = u + -19/7. Which is bigger: a or f? f Let m = -15 + 14.93. Let j(s) = -s*2 - 18s. Let c be j(-18). Which is bigger: m or c? c Let a = 14/15 - 8/5. Suppose 3x + 15 - 15 = 0. Is a >= x? False Let v(u) = -u3 + 3u*2 + 3. Let g be v(3). Let j(r) = 3r*2 - 1. Let d be j(1). Is g != d? True Suppose -y + 31 = -5r, y + 5r = r - 14. Let s be y/(-9) - 120/(-99). Is s at most as big as 1? True Suppose -3x + 3v = 0, 0v - 3 = x - 4v. Let q be (-15)/10 + (-2)/(-4). Let s be (q/6)/((-18)/(-24)). Which is smaller: s or x? s Let l be (0/5 - 5) + (8 - -5). Suppose b - 45 = -4b. Which is smaller: b or l? l Let w be (3 + (-9)/2)/(15/(-5)). Which is greater: 86 or w? 86 Let j = 2.3 - 2.2. Let f = -0.2 + 1.2. Which is bigger: f or j? f Let v = -7191/4585 - 2/655. Is v > -2? True Suppose 2y + 5d - 14 = -83, 2y + 42 = 4d. Is 0 greater than or equal to y? True Let d = 87 + -45. Do d and 43 have the same value? False Let d = 0.05 + 1.95. Let f = d - 2.1. Which is bigger: f or 2? 2 Suppose -3*a + 17 = -4. Let g = 7 - a. Let x be 8/(-77) + 4/14. Which is smaller: x or	{ "pile_set_name": "DM Mathematics" }
5257 is divided by 321? 317 Calculate the remainder when 1607 is divided by 622. 363 Calculate the remainder when 105 is divided by 4. 1 Calculate the remainder when 33452 is divided by 1286. 16 Calculate the remainder when 3212 is divided by 1670. 1542 What is the remainder when 12248 is divided by 5829? 590 What is the remainder when 3593 is divided by 262? 187 Calculate the remainder when 5098 is divided by 189. 184 What is the remainder when 31056 is divided by 480? 336 Calculate the remainder when 4324 is divided by 199. 145 What is the remainder when 4591 is divided by 82? 81 What is the remainder when 8377 is divided by 2766? 79 Calculate the remainder when 1608 is divided by 528. 24 Calculate the remainder when 4640 is divided by 1449. 293 What is the remainder when 76247 is divided by 61? 58 What is the remainder when 24054 is divided by 23? 19 What is the remainder when 24960 is divided by 1085? 5 What is the remainder when 287 is divided by 146? 141 What is the remainder when 751 is divided by 336? 79 Calculate the remainder when 3152 is divided by 789. 785 What is the remainder when 1388 is divided by 752? 636 What is the remainder when 531 is divided by 17? 4 Calculate the remainder when 762 is divided by 125. 12 Calculate the remainder when 73783 is divided by 232. 7 What is the remainder when 2506 is divided by 58? 12 Calculate the remainder when 37967 is divided by 94. 85 What is the remainder when 261812 is divided by 1870? 12 What is the remainder when 3920 is divided by 229? 27 Calculate the remainder when 10838 is divided by 774. 2 Calculate the remainder when 5521 is divided by 1139. 965 What is the remainder when 89166 is divided by 10? 6 Calculate the remainder when 3137 is divided by 1003. 128 What is the remainder when 4109 is divided by 110? 39 Calculate the remainder when 16219 is divided by 26. 21 Calculate the remainder when 174723 is divided by 145. 143 Calculate the remainder when 79509 is divided by 8833. 12 What is the remainder when 24523 is divided by 227? 7 What is the remainder when 39825 is divided by 23? 12 What is the remainder when 1496 is divided by 14? 12 What is the remainder when 16805 is divided by 16515? 290 Calculate the remainder when 1438 is divided by 242. 228 What is the remainder when 10942 is divided by 390? 22 What is the remainder when 31764 is divided by 15875? 14 Calculate the remainder when 48109 is divided by 144. 13 Calculate the remainder when 1595 is divided by 403. 386 Calculate the remainder when 13813 is divided by 75. 13 What is the remainder when 19130 is divided by 104? 98 Calculate the remainder when 35869 is divided by 1196. 1185 What is the remainder when 4930 is divided by 137? 135 Calculate the remainder when 219 is divided by 64. 27 What is the remainder when 563296 is divided by 279? 274 Calculate the remainder when 118539 is divided by 5644. 15 Calculate the remainder when 148883 is divided by 292. 255 What is the remainder when 911 is divided by 462? 449 Calculate the remainder when 53401 is divided by 9. 4 What is the remainder when 75108 is divided by 75107? 1 Calculate the remainder when 739079 is divided by 46. 43 Calculate the remainder when 3148 is divided by 1047. 7 What is the remainder when 10842080 is divided by 543? 542 What is the remainder when 839669 is divided by 7? 5 Calculate the remainder when 14410 is divided by 52. 6 What is the remainder when 1334 is divided by 396? 146 Calculate the remainder when 2149 is divided by 1007. 135 What is the remainder when 58615 is divided by 32? 23 Calculate the remainder when 46833 is divided by 19. 17 What is the remainder when 15424 is divided by 2470? 604 Calculate the remainder when 26067 is divided by 840. 27 What is the remainder when 839905 is divided by 148? 5 What is the remainder when 14746 is divided by 378? 4 What is the remainder when 117263 is divided by 4? 3 What is the remainder when 129081 is divided by 64515? 51 What is the remainder when 70471 is divided by 183? 16 Calculate the remainder when 213666 is divided by 118. 86 What is the remainder when 940 is divided by 466? 8 Calculate the remainder when 71888 is divided by 266. 68 What is the remainder when 6769 is divided by 539? 301 What is the remainder when 24973 is divided by 1388? 1377 What is the remainder when 23555 is divided by 52? 51 What is the remainder when 427953 is divided by 25173? 12 Calculate the remainder when 162243 is divided by 185. 183 Calculate the remainder when 348548 is divided by 309. 305 What is the remainder when 15371 is divided by 255? 71 Calculate the remainder when 16365 is divided by 22. 19 Calculate the remainder when 1302 is divided by 446. 410 What is the remainder when 12718 is divided by 4210? 88 Calculate the remainder when 662586 is divided by 220856. 18 Calculate the remainder when 783987 is divided by 128. 115 What is the remainder when 365 is divided by 119? 8 Calculate the remainder when 4148 is divided by 1023. 56 Calculate the remainder when 65448 is divided by 385. 383 Calculate the remainder when 179699 is divided by 5. 4 What is the remainder when 431896 is divided by 431882? 14 What is the remainder when 87232 is divided by 1179? 1165 Calculate the remainder when 59365 is divided by 8. 5 What is the remainder when 1734162 is divided by 801? 798 Calculate the remainder when 1571 is divided by 27. 5 What is the remainder when 38539 is divided by 73? 68 Calculate the remainder when 2901 is divided by 1575. 1326 What is the remainder when 827 is divided by 808? 19 Calculate the remainder when 1217 is divided by 597. 23 What is the remainder when 128609 is divided by 887? 881 What is the remainder when 59614 is divided by 8? 6 What is the remainder when 7255 is divided by 22? 17 Calculate the remainder when 442972 is divided by 241. 14 What is the remainder when 95469 is divided by 12? 9 Calculate the remainder when 345812 is divided by 238. 236 What is the remainder when 33170 is divided by 56? 18 What is the remainder when 58478 is divided by 140? 98 What is the remainder when 5992 is divided by 5? 2 Calculate the remainder when 5238 is divided by 536. 414 Calculate the remainder when 31160 is divided by 541. 323 What is the remainder when 10724 is divided by 1185? 59 Calculate the remainder when 73994 is divided by 25. 19 What is the remainder when 7061 is divided by 438? 53 Calculate the remainder when 76972 is divided by 17. 13 What is the remainder when 7109 is divided by 6013? 1096 Calculate the remainder when 315 is divided by 241. 74 Calculate the remainder when 79648 is divided by 179. 172 What is the remainder when 11095 is divided by 2643? 523 What is the remainder when 868 is divided by 89? 67 Calculate the remainder when 3225 is divided by 545. 500 What is the remainder when 76297 is divided by 25? 22 What is the remainder when 112831 is divided by 155? 146 What is the remainder when 399805 is divided by 6? 1 Calculate the remainder when 197946 is divided by 1070. 1066 Calculate the remainder when 881 is divided by 801. 80 What is the remainder when 150186 is divided by 103? 12 What is the remainder when 17934 is divided by 195? 189 Calculate the remainder when 2516805 is divided by 84. 81 Calculate the remainder when 9301 is divided by 49. 40 Calculate the remainder when 78486 is divided by 15. 6 Calculate the remainder when 1388 is divided by 1374. 14 Calculate the remainder when 3054 is divided by 137. 40 What is the remainder when 3839 is divided by 804? 623 What is the remainder when 107 is divided by 89? 18 Calculate the remainder when 20678 is divided by 6863. 89 What is the remainder when 10974 is divided by 2660? 334 Calculate the remainder when 130388 is divided by 562. 4 Calculate the remainder when 8262 is divided by 437. 396 What is the remainder when 2903 is divided by 95? 53 What is the remainder when 148544 is divided by 3229? 10 Calculate the remainder when 48006 is divided by 96. 6 Calculate the remainder when 24911 is divided by 408. 23 What is the remainder when 680032 is divided by 17? 15 Calculate the remainder when 15310 is divided by 56. 22 What is the remainder when 5081 is divided by 23? 21 Calculate the remainder when 2149991 is divided by 14. 11 Calculat	{ "pile_set_name": "DM Mathematics" }
. Let m(w) = -2r(w) + 5u(w). Does 21 divide m(-5)? True Suppose -4d + 6 = 2v - 20, 4v = 4d - 56. Suppose -dc = -7c - l - 1228, -5l = c - 636. Is 44 a factor of c? True Suppose 4z = -j + 6411, -3j + 2582 = 5z - 16637. Is 19 a factor of j? True Let m(t) = -t*2 + 7t + 34. Suppose 5i = -5j + 80, j - 4i - 8 = 18. Let g be m(j). Let q = -83 - g. Does 15 divide q? False Let b = -55 - -55. Does 6 divide 19 - 1 - (-2 - b) - 4? False Let z(s) = -s2 - 36s - 135. Let u be z(-26). Suppose ua + 6000 = 135a. Is 20 a factor of a? True Let t = 192 - 126. Let y = 115 - t. Suppose 5f = 3w - y, 5f - 3 = -5w + 92. Does 9 divide w? True Suppose 2c = h + 51723, -h + 29137 = c + 3289. Does 221 divide c? True Suppose -m + 22 = 3r, -r - 5 = -4m + 5. Let s be ((-2866)/14)/(-1) + r/21. Suppose -5h - 2y + s = 3y, 3h - 139 = y. Does 20 divide h? False Suppose 4y = 13 + 3. Let o(d) be the third derivative of d6/40 - d5/15 + d4/8 - d3/3 - 2d2 - 25d. Does 27 divide o(y)? False Suppose -3074w = -2928w - 3412458. Does 11 divide w? False Let u(g) = -8 + 4g2 - 4g - 4g2 - g3 - 6g*2 + 15g*2. Let z be (-1)/((-9)/64/42). Is 31 a factor of u(z)? True Suppose -10b = -b + 3753. Let l = 801 + b. Does 24 divide l? True Suppose -20h = -24h - 3l + 232, 4 = -l. Let a(b) = -b + 217. Let v be a(0). Suppose v = 4z + h. Is z a multiple of 13? True Is 3 a factor of 973 - 1((-13 - -3) + 3)? False Suppose 104z - 123539 = -218z + 542357. Is z a multiple of 44? True Let g be -3183(-4)/18. Let z = g - 112. Does 5 divide z? True Suppose -8442 = -5k + 3s, 3s = k - 1830 + 156. Is 141 a factor of k? True Suppose 7r - r = -3324. Is (4 - r - 3)2/2 a multiple of 15? True Let y(g) = -g3 + 3g*2 + g + 1. Let z be y(4). Let l(j) = 36j - 7. Let s(d) = 8d - 1. Let q(b) = l(b) - 5s(b). Is q(z) a multiple of 14? True Let a(k) = -k*3 - 42k*2 + 34k - 64. Is a(-45) a multiple of 60? False Suppose 0 = -w + 264 + 221. Suppose -w = 2s + 363. Let z = s - -602. Is z a multiple of 17? False Let h(i) = -16i + 25. Let c(k) = 11k - 17. Let b(q) = 7c(q) + 5h(q). Let g be b(-12). Suppose -72 = -5p - l + 5l, 2p = -5l + g. Does 8 divide p? True Suppose -2v = -5z + 9770, 15z + 4v + 7804 = 19z. Does 86 divide z? False Let c = 1311 + -1029. Does 5 divide c? False Suppose l = -2p + 23306, -p + 11646 = 41l - 44l. Is p a multiple of 4? True Let y(g) = 19g + 166. Suppose -76z = -77z + 6. Is 28 a factor of y(z)? True Suppose 0 = -2h - 17h + 3933. Let w = h - 144. Is 9 a factor of w? True Let o(w) = -2w3 + 72w*2 + 44w - 5. Is o(36) a multiple of 69? False Let x(n) = 2n2 + 30n + 7. Let r be x(-15). Let v(f) = 0 - 2 + r - 95f. Does 15 divide v(-2)? True Suppose -11b - 3 = 96. Let h(q) = -q + 0q + q3 + 9q*2 + 14 + 6 - 2. Does 3 divide h(b)? True Let j(r) = 254r3 + r2 + 9r - 2. Let v(b) = -127b*3 - 5b + 1. Let n(z) = -3j(z) - 5v(z). Does 44 divide n(-1)? False Let m(v) = -v*3 - 22v*2 - 43v - 48. Let c be m(-20). Suppose -4g + 48 - c = 0. Does 2 divide g? False Let d = -3280 - -4097. Is 35 a factor of d? False Suppose 34 = 10j + 7j. Is (-42 + -5 + 0)(-7 + j) a multiple of 76? False Suppose 213p + 1646298 = 600p. Is 6 a factor of p? True Suppose 559 + 347 + 3798 = 12n. Does 186 divide n? False Let t(g) be the third derivative of -g6/120 + 11g*5/30 + 23g*4/24 + 4g*3 - 86g*2 + 2g. Does 12 divide t(23)? True Let b = 61 - 56. Let f be (18765/6)/b - (-7)/14. Suppose -l = 4l + 4s - f, 0 = -2l + 2s + 254. Is l a multiple of 23? False Suppose 2c - 67 = k, 56 = c - 0k - 5k. Suppose 11w - c = 24. Suppose o + 2r = -3r + 233, 4o = -wr + 1007. Does 43 divide o? True Let n(l) = l + 8. Let s be n(-13). Suppose 4h + 5r - 156 = 2h, 3r = -5h + 409. Does 9 divide 2 + s + h + 1? True Let c = 232 + -152. Suppose -78a - 6 = -ca. Is 13 a factor of (a - (-22)/(-10))(24 + 1)? False Let l(c) = -6c3 - 9c*2 - c + 239. Is 27 a factor of l(-14)? False Suppose -225t = -222t - 6. Suppose -tj = -5r - 30, -2j + 2r + r + 22 = 0. Suppose 0 = jq - 1688 + 208. Is q a multiple of 37? True Let h = -15 + 8. Let y be (-8)/16 + h/2. Is (22/(-6))/(y/72) a multiple of 7? False Let j(t) = t3 + t2 + 26t + 12. Suppose 36 + 44 = 8o. Does 14 divide j(o)? True Let f(b) = -12b + 44. Let t(w) = 18w - 50. Let z(r) = 19r - 51. Let y(a) = -6t(a) + 5z(a). Let q(o) = -6f(o) + 5y(o). Is 9 a factor of q(9)? False Let y(t) be the third derivative of t6/120 - 11t*5/30 + 23t4/12 - t3/6 - 28t2 + 3. Let i be 30/(-1 - 10/(-4)). Does 37 divide y(i)? False Is 84 a factor of (284 - (25 + -21))/(2/33)? True Is 125 a factor of ((-17250)/(-24))/(8/64)? True Let n = 130 - 120. Let r(x) = -x2 + 20x - 30. Is 7 a factor of r(n)? True Suppose 0 = 30c - 417916 + 212291 - 415075. Is c a multiple of 14? False Let j(f) = -22f - 59. Let h be j(-14). Let b = -93 + h. Does 13 divide b? True Let i(h) = h*2. Let w(l) = -23l*2 - l + 5. Let q(u) = -5i(u) - w(u). Does 11 divide q(-5)? True Let f be -2 - 12011/(-6) - (-3)/18. Suppose c + 803 = -0d + 2d, -5d + c = -f. Is d a multiple of 21? True Let p = 10042 + -5028. Is 46 a factor of p? True Suppose 2v + 136 = 140. Suppose i + 2w = 8, -vw + 8 = -6i + 4i. Suppose z + o - 75 = 0, i = o - 0 + 3. Is 6 a factor of z? True Let c be ((-58)/(-4))/((-9)/(-54)). Suppose 617 = 11b - c. Is 32 a factor of b? True Let j = 12 - -28. Let m = 2 + 3. Suppose -h = -mh + j. Is h a multiple of 2? True Does 113 divide (-150)/(-6) + -24 + 30283? True Let k(x) = -107x - 139. Let c be (4/16)/((-4)/1602). Is k(c) a multiple of 18? True Is 45 a factor of (-138)/(-2)(3 - (-90)/(-27))-824? False Let l(o) = o*3 + 2o*2 - 7o + 5152. Is l(0) a multiple of 16? True Suppose 0 = -2v + 5g + 39030, 0 = -4v - 4g - 26104 + 104080. Does 12 divide v? True Is ((-50 - -2)/12)/(-210/73045) a multiple of 31? False Suppose -20l + 72 = -8l. Suppose -2t = lg - 5g, t + g = 0. Suppose 0 = -5n + y + 602, 5y - 2y + 6 = t. Is n a multiple of 40? True Let z(v) = -9v + 17. Let n(f) = -9f + 17. Let u(a) = -4n(a) + 6z(a). Let r be u(5). Let p = -43 - r. Is 13 a factor of p? True Let u(p) = 203p + 53. Let h(l) = 40l + 11. Let d(j) = 33h(j) - 6u(j). Does 27 divide d(3)? True Let d = 124 + -118. Let r = d + 69. Suppose 0 = q - 3j - 135, -2j + r + 219 = 2q. Does 8 divide q? True Let j = 9868 + -5260. Is 16 a factor of j? True Is (-26405)/(-110) + 7 + 2325/(-330) a multiple of 10? True Suppose -4n - 16 = 0, -5k = -k + 5n + 20012. Is (2 - 1/(-2))/((-21)/k) a multiple of 12? False Let r be (-56)/(-6)(1 - -2). Let i = r + -26. Suppose -if + 43 + 39 = 0. Is 6 a factor of f? False Let x = -98 - -100. Suppose 2r = -2r + 20, -50 = -5c + xr. Does 3 divide c? True Let p(m) = 22m - m*2 + 363 - 706 + 361. Is p(11) a multiple of 14? False Let c = -2226 - -6862. Is 38 a factor of c? True Let w be ((-15)/20)/(3/(-12)). Suppose 5z = 6z - w. Suppose 5y - m - m - 165 = 0, 4y - 139 = zm. Is 3 a factor of y? False Suppose 2a = -3h + 3229 + 3968, 2h = 4a - 14402. Is 20 a factor of a? True Let j = -302 - -426. Suppose -4l + 4c = -j, -3c = -2l - 0 + 62. Is l even? False Let v(p) be the second derivative of 10/3p3 + p2 + 8p + 0. Is v(7) a multiple of 13? False Suppose 69 = -2c - 155. Let u = 27 - c. Suppose 2o - 3o + 85 = 3w, 0 = 5w + o - u. Is w a multiple of 11? False Suppose 34105 = 16a - 45155 + 5324. Is a a multiple of 32? False Let i(y) = 1308y3 - 6y*2 + 27y - 9. Does 5 divide i(2)? True Let l = 0 - -154. Let b be (-2 - -3) + -1 + -83. Let d = l + b. Does 9 divide d? False Let r(j) = 189j - 130. Let v be r(5). Suppose 9i = 706 + v. Is 48 a factor of i? False Suppose 0d - 4d + 16 = 0. Suppose 0 = -f - 4u + 24, 4f - 3u = -du + 111. Does 11 divide (7/2)/(7/f)? False Suppose 14k - 19k = -1495. Suppose z = -0z - k. Is 23 a factor of z/((1/(-1))/(-1)-1)? True Let p(d) be the first derivative of -d*3/3 - 4d*2 - 13d - 1. Let m = -130 + 126. Is 2 a factor of p(m)? False Let u = 23423 - 19016. Is u a multiple of 9? False Let l(z) = z*3 - 10z*2 - 12z - 7. Let n be l(13). Let w = -219 + n. Does 16 divide w? False Suppose -s + 3i - 6 = -36, -5s	{ "pile_set_name": "DM Mathematics" }
he v'th term of 20865, 83449, 187767, 333825, 521629, 751185, 1022499? v*3 + 20861v*2 - 6v + 9 What is the j'th term of 612379, 1224755, 1837129, 2449501, 3061871, 3674239? -j*2 + 612379j + 1 What is the v'th term of -394, -826, -1262, -1702, -2146? -2v2 - 426v + 34 What is the u'th term of -25014, -50028, -75042, -100056? -25014u What is the j'th term of 85, 57, -33, -221, -543, -1035, -1733, -2673? -6j*3 + 5j*2 - j + 87 What is the i'th term of 277, 1042, 2291, 4024, 6241, 8942, 12127? 242i*2 + 39i - 4 What is the o'th term of -18653, -37307, -55959, -74609, -93257, -111903? o*2 - 18657o + 3 What is the f'th term of -5997, -11994, -17991, -23988? -5997f What is the s'th term of -4946, -9894, -14846, -19802, -24762, -29726, -34694? -2s*2 - 4942s - 2 What is the w'th term of 30743, 61489, 92237, 122987, 153739, 184493? w*2 + 30743w - 1 What is the t'th term of 419, 477, 535, 593, 651? 58t + 361 What is the j'th term of -152, -283, -414, -545? -131j - 21 What is the q'th term of -1749, -2379, -2995, -3591, -4161, -4699, -5199, -5655? q3 + q2 - 640q - 1111 What is the x'th term of 557, 2333, 5323, 9527, 14945? 607x*2 - 45x - 5 What is the q'th term of -394, -317, -204, -61, 106? -q*3 + 24q*2 + 12q - 429 What is the w'th term of 242, 456, 640, 794? -15w2 + 259w - 2 What is the t'th term of -29, -36, -1, 100, 291, 596? 4t3 - 3t*2 - 26t - 4 What is the f'th term of -1154, -4617, -10394, -18491, -28914, -41669, -56762? -f*3 - 1151f*2 - 3f + 1 What is the y'th term of -7028, -14048, -21068, -28088, -35108, -42128? -7020y - 8 What is the r'th term of 85, -1156, -2397, -3638? -1241r + 1326 What is the r'th term of -1790, -1813, -1852, -1907, -1978, -2065, -2168? -8r2 + r - 1783 What is the t'th term of -279, -388, -493, -594, -691, -784? 2t*2 - 115t - 166 What is the c'th term of 434, 1433, 3002, 5153, 7898, 11249? 2c3 + 273c*2 + 166c - 7 What is the n'th term of 1237, 4969, 11195, 19921, 31153? n*3 + 1241n*2 + 2n - 7 What is the o'th term of 22176, 44312, 66446, 88578? -o*2 + 22139o + 38 What is the m'th term of -64578, -64596, -64614, -64632? -18m - 64560 What is the l'th term of -330860, -661725, -992590? -330865l + 5 What is the p'th term of -694, -483, -274, -67, 138, 341, 542? -p*2 + 214p - 907 What is the k'th term of -266839, -533674, -800509, -1067344, -1334179, -1601014? -266835k - 4 What is the v'th term of 18696, 18704, 18716, 18732, 18752, 18776, 18804? 2v*2 + 2v + 18692 What is the i'th term of -14, 73, 208, 391, 622, 901, 1228? 24i2 + 15i - 53 What is the t'th term of 1737, 7019, 15823, 28149, 43997, 63367, 86259? 1761t2 - t - 23 What is the v'th term of -58, -146, -288, -484? -27v*2 - 7v - 24 What is the j'th term of 40710, 40696, 40672, 40638, 40594, 40540? -5j2 + j + 40714 What is the i'th term of 8909510, 8909508, 8909506, 8909504, 8909502, 8909500? -2i + 8909512 What is the i'th term of -94793, -94794, -94795, -94796? -i - 94792 What is the w'th term of 1044, 2041, 3044, 4053, 5068, 6089, 7116? 3w2 + 988w + 53 What is the c'th term of 1131801, 1131800, 1131799, 1131798? -c + 1131802 What is the i'th term of 4885, 9776, 14667, 19558? 4891i - 6 What is the p'th term of 75, 185, 311, 453? 8p*2 + 86p - 19 What is the r'th term of -135168, -135176, -135184, -135192, -135200, -135208? -8r - 135160 What is the s'th term of 616, 2592, 5922, 10606, 16644, 24036? 677s*2 - 55s - 6 What is the k'th term of 5019, 20135, 45329, 80601? 5039k2 - k - 19 What is the g'th term of 251, 719, 1629, 3203, 5663, 9231, 14129, 20579? 37g3 - g2 + 212g + 3 What is the v'th term of 967, 943, 923, 907? 2v*2 - 30v + 995 What is the a'th term of -2898, -5788, -8678, -11568, -14458, -17348? -2890a - 8 What is the v'th term of 488, 545, 608, 677? 3v*2 + 48v + 437 What is the f'th term of 5698, 5712, 5730, 5758, 5802, 5868? f*3 - 4f*2 + 19f + 5682 What is the s'th term of 252334, 252328, 252322, 252316? -6s + 252340 What is the v'th term of 203, 739, 1625, 2855, 4423, 6323, 8549, 11095? -v3 + 181v*2 + 23 What is the f'th term of 447, 1624, 3529, 6162, 9523? 364f*2 + 85f - 2 What is the j'th term of -2385, -9550, -21493, -38214, -59713, -85990, -117045? -2389j2 + 2j + 2 What is the y'th term of 228, 523, 1006, 1671, 2512, 3523, 4698, 6031? -y*3 + 100y*2 + 2y + 127 What is the l'th term of 4143, 4171, 4197, 4221, 4243, 4263? -l*2 + 31l + 4113 What is the i'th term of -366077, -366067, -366057, -366047? 10i - 366087 What is the m'th term of -1664, -3350, -5036, -6722, -8408, -10094? -1686m + 22 What is the m'th term of 149897, 299799, 449701, 599603, 749505, 899407? 149902m - 5 What is the v'th term of -2111, -2121, -2131, -2141? -10v - 2101 What is the s'th term of 64, 168, 192, 136? -40s2 + 224s - 120 What is the y'th term of -10932, -43738, -98414, -174960, -273376? -10935y2 - y + 4 What is the s'th term of 6722738, 6722737, 6722736, 6722735, 6722734? -s + 6722739 What is the q'th term of -114, -312, -656, -1146, -1782? -73q*2 + 21q - 62 What is the y'th term of 49, 115, 293, 637, 1201, 2039, 3205, 4753? 9y3 + 2y*2 - 3y + 41 What is the x'th term of -634, -2242, -4926, -8686, -13522? -538x2 + 6x - 102 What is the c'th term of 91, 177, 279, 403, 555, 741? c*3 + 2c*2 + 73c + 15 What is the l'th term of 1417, 2478, 2841, 2158, 81? -58l3 - l2 + 1470l + 6 What is the t'th term of 15157, 15156, 15155, 15154, 15153? -t + 15158 What is the q'th term of 39007, 39011, 39015, 39019, 39023? 4q + 39003 What is the c'th term of -239275, -239253, -239231? 22c - 239297 What is the j'th term of -160, -312, -460, -604? 2j2 - 158j - 4 What is the h'th term of 1311, 1362, 1499, 1764, 2199, 2846? 7h3 + h2 - h + 1304 What is the l'th term of -49559, -49581, -49603? -22l - 49537 What is the n'th term of -1597, -6314, -14175, -25180? -1572n2 - n - 24 What is the k'th term of -993, -2076, -3133, -4164, -5169, -6148? 13k*2 - 1122k + 116 What is the s'th term of -99, -24, 131, 390, 777, 1316, 2031? 4s3 + 16s*2 - s - 118 What is the f'th term of -39, -374, -1279, -3036, -5927? -47f*3 - 3f*2 + 3f + 8 What is the d'th term of 22216, 22201, 22170, 22117, 22036? -d*3 - 2d*2 - 2d + 22221 What is the r'th term of -537, -494, -435, -360? 8r2 + 19r - 564 What is the y'th term of 128266, 513066, 1154400, 2052268, 3206670? 128267y2 - y What is the u'th term of -16392, -32149, -47904, -63657, -79408, -95157? u2 - 15760u - 633 What is the u'th term of -994, -799, -606, -415, -226, -39? -u*2 + 198u - 1191 What is the k'th term of -37, -72, -99, -118, -129, -132? 4k2 - 47k + 6 What is the f'th term of 365, 623, 881, 1139, 1397? 258f + 107 What is the q'th term of 1625, 1656, 1721, 1826, 1977, 2180? q3 + 11q*2 - 9q + 1622 What is the m'th term of -5219, -5182, -5117, -5018, -4879, -4694, -4457? m*3 + 8m*2 + 6m - 5234 What is the d'th term of -105625, -422490, -950599, -1689952, -2640549, -3802390, -5175475? -105622d2 + d - 4 What is the h'th term of 2968, 3366, 3766, 4168? h2 + 395h + 2572 What is the v'th term of 395, 1575, 3541, 6293? 393v2 + v + 1 What is the f'th term of -2646845, -5293693, -7940541, -10587389, -13234237, -15881085? -2646848f + 3 What is the x'th term of -2824, -11302, -25432, -45214, -70648? -2826x2 + 2 What is the m'th term of 67362, 67360, 67356, 67350, 67342? -m2 + m + 67362 What is the w'th term of -2148, -4472, -6796, -9120? -2324w + 176 What is the i'th term of 432, 1799, 4076, 7263, 11360, 16367? 455i2 + 2i - 25 What is the d'th term of 721, 655, 543, 379, 157? -d*3 - 17d*2 - 8d + 747 What is the w'th term of -511, -914, -1317, -1720? -403w - 108 What is the h'th term of -53, 3, 93, 217, 375, 567, 793? 17h*2 + 5h - 75 What is the h'th term of 1006210, 1006215, 1006232, 1006267, 1006326, 1006415, 1006540? h*3 - 2h + 1006211 What is the h'th term of 26161, 26162, 26163, 26164? h + 26160 What is the d'th term of 6662, 6661, 6660, 6659, 6658? -d + 6663 What is the o'th term of 6319, 6517, 6717, 6919, 7123, 7329? o*2 + 195o + 6123 What is the z'th term of -926, -934, -946, -956, -958, -946, -914? z*3 - 8z*2 + 9z	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.