Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
Round k to the nearest 1000000. 13000000 Let l = 147.0399 + -147. Let o = l + 0.03192. Round o to two dps. 0.07 Let f = 0.197798 + 0.030492. What is f rounded to 2 dps? 0.23 Let w = -7.275 - -7.233. Let n = -28 - -28.041. Let q = n + w. What is q rounded to 3 dps? -0.001 Let l = -302091 - -302785.695. Let y = -694 + l. Round y to two dps. 0.7 Let a = -74397 + 75080.23. What is a rounded to the nearest 100? 700 Let c = 14173.7 - 15200. What is c rounded to the nearest 100? -1000 Let h = 639 + -2009. Let k = h + 1370.0000603. Round k to 5 decimal places. 0.00006 Let i = -165.467 + 164.1. Let x = -0.218 - i. Let r = 1.1 - x. Round r to two dps. -0.05 Let t = 50753 + -282803. What is t rounded to the nearest 10000? -230000 Let d = -0.084871 + 0.14077345. Let t = -0.0559 + d. Round t to 7 dps. 0.0000025 Suppose -5g = -9g + 72. Let d = 2 + g. Let c be (d/(-3))/((-14)/268800). What is c rounded to the nearest one hundred thousand? 100000 Suppose -5o = 3a - 65, 5o = 3a - a - 10. Suppose 14u = au + 125. Let d = u - -125. What is d rounded to the nearest ten? 0 Let y = -0.03127 - -0.035432. Round y to 3 dps. 0.004 Let l = 28 + 1.1. Let r = l - 29.09843. Round r to four dps. 0.0016 Let n = 20143.9699376 - 20144. Let a = n + 0.03. Round a to 5 dps. -0.00006 Let c = -795 - -975. Let b = -171.6 + c. What is b rounded to 0 decimal places? 8 Let a = 0.846 - 0.5163. Let x = 6.9 + -7.23. Let v = a + x. What is v rounded to four dps? -0.0003 Suppose 5x = 4x + 2, -12604 = 3h - 5x. Let m = h - -9338. Round m to the nearest one hundred. 5100 Let v = -1321 + 381. Let t = 940.0000000453 + v. Round t to 7 dps. 0 Let t = 0.2 - -13. Let y = -14.145 + t. Round y to 1 decimal place. -0.9 Let s = -200.03625 + 200. What is s rounded to three dps? -0.036 Let o(k) = -k3 - k2 - 2k - 3. Let y be o(3). Suppose 0 = 2j + 2, c - 11j + 48 = -10j. Let m = c - y. What is m rounded to the nearest ten? 0 Let u = -216 + 215. Let n = -3 + 0. Let m be -43 + (-2 - u) + n. What is m rounded to the nearest 10? -50 Let y = -3491.5 + -6025.1. What is y rounded to the nearest one thousand? -10000 Suppose -599067 = 9j - 2734587. What is j rounded to the nearest ten thousand? 240000 Let a = 101 - 76. Suppose 0 = -4g + a - 37. Let m be -4(-92098)/(-12) + 2/g. What is m rounded to the nearest one thousand? -31000 Let f = -56 + 56.01. Let t = f + -0.010213. Round t to 4 decimal places. -0.0002 Let b = -0.026 + -60.974. Let c = b + 63. Let y = c + -2.0115. What is y rounded to 3 decimal places? -0.012 Let t = -140.991 + 2.691. Let n = -21.9 - t. Round n to the nearest integer. 116 Let l = 180.881008 - -0.037992. What is l rounded to 0 decimal places? 181 Let j = 42.87 + -40.7. Let k = j + -2.1700592. What is k rounded to 6 dps? -0.000059 Let c = 0.0649 + -0.069397. What is c rounded to three dps? -0.004 Let t = -9.3881 + 9.26. Let c = -0.0147 + t. What is c rounded to 2 dps? -0.14 Let s = 18 - 7. Let v = s - 9.1. Let u = -2.16 + v. What is u rounded to 1 dp? -0.3 Let b = -54 + 53.908. Let y = -55.908 + b. Let z = y + 55.99934. What is z rounded to 4 dps? -0.0007 Let g = 41.025 - 0.025. Let n = 39.55 - g. Let l = 1.44999887 + n. Round l to seven decimal places. -0.0000011 Let h = 4.17 + -0.17. Let t = h + 1. Let j = -4.99999876 + t. What is j rounded to seven dps? 0.0000012 Let g = 36.4 + -36. Let v = g - 4.76. What is v rounded to 0 dps? -4 Let a = -0.038171 - -259929.038171. Let g = a - 259880.00032. Let j = -49 + g. Round j to 4 dps. -0.0003 Let d = -78.6 + -19.4. Let g = d + 86.2. Let h = 5.7 + g. Round h to the nearest integer. -6 Let q = -342.092 + 331.9. Round q to one decimal place. -10.2 Let s = 5532.0007611 + -5532. What is s rounded to 5 decimal places? 0.00076 Let t = 0.249 - 24.349. Let m = t + 24.3179. What is m rounded to 2 dps? 0.22 Suppose -15n - 9138438 = -18n. Let x = n + -4322146. Round x to the nearest 100000. -1300000 Let z = -54460892.9999972 + 54460547. Let l = z - -346. What is l rounded to 7 dps? 0.0000028 Let s = -497775229 - -251925314. Let v = s + 168319024. Let g = 44030891 + v. Round g to the nearest 1000000. -34000000 Let o(v) = v3 - 21v*2 - 131v + 47. Let n be o(26). Suppose -62s + ns = 22099. What is s rounded to the nearest one hundred? -500 Let x = 250 - 491. Let h = x + 241.0000038. Round h to 7 dps. 0.0000038 Suppose 0 = -14u + 18041 + 8685. Round u to the nearest 10000. 0 Let o = 1511 - 633. Let a = -935.9 + o. Round a to the nearest 10. -60 Let p = 0.4659 + -0.465544. Round p to 3 dps. 0 Let l = 1698 - 1001. Let f = l - 697.000469. Round f to five decimal places. -0.00047 Let u = 0.8210945 - 178.8272345. Let b = 178 + u. What is b rounded to 2 dps? -0.01 Let r = -513 + 486. Let i = 820584955.999999882 + -820584983. Let u = r - i. Round u to 7 dps. 0.0000001 Let m = 112387 + -347837. What is m rounded to the nearest one thousand? -235000 Let n = 49.46 + -0.46. Let j = n + -48.99887. What is j rounded to 4 dps? 0.0011 Let z = 4.5 - 65.3. Let t = z + 71. Let m = t + -10.2000082. Round m to 6 dps. -0.000008 Let y = 1739.177 + -1729.7. Round y to 1 dp. 9.5 Let v = 1166.9296 + -1166. Round v to two dps. 0.93 Let c = 1297094912 + -1297095044.9999098. Let w = c - -133. Round w to five decimal places. 0.00009 Suppose 2g + t = -4t + 14010604, 2g - 14010616 = t. Let y = -1276307 + g. Round y to the nearest 100000. 5700000 Let s = 556 + -1026. Let b = 478.72 + s. Round b to 1 dp. 8.7 Let w = 1077699594 - 669449594. Round w to the nearest 1000000. 408000000 Let d = 77.59 - 1.59. Let n = 49.5 - d. Let g = n + 26.123. Round g to one decimal place. -0.4 Let x = -2513.69 - -6.69. Let d = -2507.00001273 - x. Round d to six decimal places. -0.000013 Suppose 4j + 194 = 2i, 4j + 56 = 3j + 2i. Let m = j - -51. Suppose 6w = mw + 17200. Round w to the nearest one thousand. 17000 Let z = 2805411438.203823 + 436.796177. Let l = 2805411861.40000111 - z. Let m = l - -13.6. What is m rounded to seven dps? 0.0000011 Let y = 372 + -184. Let x = y + 344. Let n = x + -531.471. What is n rounded to 1 decimal place? 0.5 Let h(o) = 2o*2 + o + 1. Let f(c) = 115922c*2 + 16c + 2. Let g(x) = f(x) + h(x). Let b be g(9). Round b to the nearest one million. 9000000 Let m = -0.65 + 65.95. Let q = m - 30.1. Let r = -70 + q. Round r to the nearest integer. -35 Let p be 52/(1(2 - 3)). Let a be 23/5 + (p/20 - -3). Suppose al - 991 = -7741. What is l rounded to the nearest one hundred? -1400 Let o(v) = v*2 - 119v + 3404. Let x be o(74). Suppose -4h - 5r + 296 = -3r, 0 = 4h - 2r - 296. Let n = x - h. Round n to two decimal places. 0 Suppose 19 = 2p + n + 2n, -5n + 33 = 4p. Suppose 6 + p = 4h. Suppose -hu - u = 69900000. What is u rounded to the nearest one million? -23000000 Let i = -2538 - -2017.25. Let b = i + 505. What is b rounded to zero decimal places? -16 Let r = -38426 + 35981.7. Round r to the nearest one hundred. -2400 Let p = -1.752 - -1.75201861. What is p rounded to 6 dps? 0.000019 Suppose 3m = 2r + 132399, -1562r = -3m - 1567r + 132441. What is m rounded to the nearest one thousand? 44000 Let o = -250.1 - -22.1. Let n = 225.4 + o. What is n rounded to the nearest integer? -3 Let b = -8159367927364 + 8159384459834.000235. Let v = 16532372 - b. Let c = 98 + v. What is c rounded to 5 decimal places? -0.00024 Suppose -6d + 2699544 - 7879490 = 7932454. Round d to the nearest ten thousand. -2190000 Let u = -0.331 + 187.331. Let v = u + -187.0126. What is v rounded to 3 decimal places? -0.013 Let k(q) = 178q + 203. Let b be k(23). Suppose -2g + 5l = b, -4g - 51l - 8539 = -50l. What is g rounded to the nearest 100? -2100 Let a = -0.41555 - -0.02905. What is a rounded to two dps? -0.39 Let g = 560 - 563. Let d be (-19981)/(-58)(-2)/(-3)g. What is d rounded to the nearest ten? -690 Let m = 0.00382737 + -0.00362. Round m to six dps. 0.000207 Let q(y) = -109000y*3 + 5y*2 - y - 5. Let v be q(1). Suppose 2b - 5*b = 0. Let i be (b - 3) + 4 + v. What is i rounded to the nearest 10000? -110000 Let x = 10726446.000196 + -10726375. Let u = -71 + x. What is u rounded to 5 decimal places? 0.0002 Let k = 170658039 - 170657639.999435. Let h = k - 399. Round h to four decimal places. 0.0006 Let q = 174.27 + -230.6. Let r = -1.33 - q. L	{ "pile_set_name": "DM Mathematics" }
uz(j) + 11f(j). -2j - 1 Let v(m) = 2m*3 - 3m + 2. Let w(r) = -3r3 + 5r - 4. Suppose 43 = -q - y + 51, q - 10 = -2y. Determine qw(i) + 10v(i). 2i*3 - 4 Let y(z) = 13z - 23z + 5 + 1 - 3. Let b(c) = -11c + 4. Give -3b(l) + 4y(l). -7l Let v(q) = -2q*2 + 3q + 52. Let u(c) = c. Give 4u(f) - v(f). 2f*2 + f - 52 Let y = -2 + -1. Let g(x) = 47x + 44x - 4x*3 - 2x*3 + 7x*2 - 98x + 4x3. Let h(c) = -c3 + 3c*2 - 3c. Calculate yg(p) + 7h(p). -p*3 Suppose 2i + 7i = 189. Suppose -16j = -ij - 15. Let d(a) = -7a*2 + 2a*2 + 0 + 0 + 3 + 4a. Let y(h) = -14h2 + 11h + 8. Give jy(o) + 8d(o). 2o2 - o Let g(s) = -8s*3 - 128s*2 + 8s + 5. Let o(c) = -23c3 - 381c*2 + 23c + 14. Determine 17g(m) - 6o(m). 2m3 + 110m*2 - 2m + 1 Let p(t) = -128t + 2688. Let n(l) = -6. What is 1344n(u) + 3p(u)? -384u Let n(x) = -9x + 10. Let i(a) = 10a - 11. Let m(p) = 6i(p) + 7n(p). Let t(j) = 39j + 5 + 43j - 86j. Determine 6m(b) - 5t(b). 2b - 1 Let o(u) = u*2 - u - 1. Let q(v) = 0v*3 + 6v + 3v - 5v*2 - 2v*3 - 3v*3 + 5 + 3v*3. Give 5o(h) + q(h). -2h3 + 4h Let l(t) = -1026t3 - 247t - 247. Let z(g) = 25g3 + g + 1. Let i(y) = -y - 1. Let k(n) = -5i(n) + z(n). Determine -247k(h) - 6l(h). -19h3 Let p(o) = 72o - 7. Let b(x) = -36x + 3. Give -5b(w) - 2p(w). 36w - 1 Let p(g) = 5g2 - 3. Let s(o) = -9o*2 + 6. Let l(n) = -6p(n) - 3s(n). Let j(c) = -3c*2. Give 6j(r) - 5l(r). -3r*2 Let o(c) = 8c + 121. Let j be o(-15). Let p(f) = f*3 + 1. Let q(g) = -2g3 + g2 - 4. What is jq(a) + 3p(a)? a3 + a2 - 1 Let i(o) = 6o3 - 5o*2 - 5o. Let a(b) = 3b3 - 3b*2 - 3b. Suppose 4p - 5m = -2 - 8, -5p + 3m - 19 = 0. What is pa(h) + 3i(h)? 3h3 Let x = 858 + -853. Let q(j) = -29j - 5. Let a(z) = -43z - 7. What is xa(c) - 7q(c)? -12c Let r(f) = 7f + 2. Let z(k) = -8k - 1. Let x be 91/(21/(-3)) - -11. Calculate xz(o) - 3r(o). -5o - 4 Let b = -1374 + 1381. Let z(l) = -13l*3 + 3l - 7. Let f(h) be the third derivative of -3h6/40 + h4/12 - 5h*3/6 + 2h*2. Determine bf(c) - 5z(c). 2c*3 - c Let y = 992 - 985. Let r(j) = -22j - 7. Let z(d) = 11d + 4. Calculate yz(m) + 4r(m). -11m Let r(s) = -2s + 59. Let v(w) = w - 28. What is 6r(u) + 10v(u)? -2u + 74 Suppose 0 - 35 = -35r. Let v(u) = 4u + 1. Let h(q) = 1. Calculate rh(p) - v(p). -4p Let z(y) = 4y - 2. Let p(d) be the first derivative of -d2/2 + d + 69. Determine 5p(l) + z(l). -l + 3 Let m(q) be the first derivative of -q*3/3 - 3. Let u be (17 - 16)((-2 - -4) + -1). Let v(o) = -2o2 - 2. What is uv(t) - 4m(t)? 2t*2 - 2 Let b(h) = -7h - 12. Let q(a) = 7a + 12. Determine -5b(w) - 4q(w). 7w + 12 Let g(k) = -3k - 2. Suppose -3j - 70 = -5y, 5j = -2y - 2 - 1. Let o(f) = 16 + y + 0 + 39f. Let x = -180 + 153. Determine xg(b) - 2o(b). 3b Let s(j) = 2j3 - j3 + 0j - j - 1. Let m = 6 + -7. Let r(y) = -2y2 - 5 - y3 - 3y3 + 8y*3 + 3y*2 - 5y. Determine mr(o) + 5s(o). o3 - o2 Let w(j) = -j2 - 83. Let f(u) = -u2 - 83. Give -6f(d) + 5w(d). d*2 + 83 Let h(x) = -x - 8. Let d = 21 - 27. Let l(i) = -2i - 17. Suppose -43 + 17 = -2a. Calculate ah(g) + dl(g). -g - 2 Let h(k) = 91k - 1. Let s(f) = f*2 + 279f - 3. Calculate 7h(q) - 2s(q). -2q2 + 79q - 1 Let h(b) = 6b2 - 5b - 3. Let r(n) = -n + 5. Let c be r(-6). Suppose 30 = ci - 5i. Let a(w) = -7w2 + 6w + 3. Calculate ia(g) + 6h(g). g2 - 3 Let d(p) = -p2 - 7p - 6. Let g(v) = -v. What is d(s) - 5g(s)? -s*2 - 2s - 6 Let y(t) = -14t - 5. Suppose 5k = 91 - 21. Let d(n) = n - 18. Let x be d(k). Let j(c) = -5c - 2. Suppose -l + 11 = -0. Determine lj(h) + xy(h). h - 2 Let j(x) = 9x*3 + 4x*2 - 6. Let c be (11 - 8) + (1 - (2 - 3)). Let u(k) = 6k*2 - 3k*2 + 716k - 716k - 5 + 8k*3. Calculate cj(m) - 6u(m). -3m*3 + 2m*2 Let z(x) = 3x + 12. Let q(p) = -13p - 50. Calculate 4q(i) + 18z(i). 2i + 16 Let t be 8 - -2 - -1(3 + -2). Suppose -5o - 19 - t = 0. Let f(n) = 8n2 + 3n + 4. Let y(v) = 15v2 + 6v + 7. Determine oy(s) + 11f(s). -2s2 - 3s + 2 Let q(z) = -z*3 + 3z*2 + 3z - 3. Let n(u) = -3u2 + 7u + 8. Let x(c) = -c*2 + 3c + 3. Let f(t) = 2n(t) - 5x(t). What is -3f(o) - q(o)? o3 Let m(d) = -7d. Let k be m(-1). Suppose 3a = 2 + k. Let b(c) = -4c + 2 + ac - 3. Let f(o) = -o - 1. Calculate 5b(i) - 6f(i). i + 1 Let j(k) = -32k*3 - 3k*2 + 8k + 4. Let z(h) = -65h3 - 7h*2 + 20h + 9. What is 5j(b) - 2z(b)? -30b3 - b2 + 2 Let m(c) = 134c - 8. Let g(z) = -71z + 4. Calculate -5g(y) - 2m(y). 87y - 4 Let h(r) = -90r - 1. Let g(x) = 89x + 1. What is 6g(i) + 5h(i)? 84i + 1 Suppose 0 = -a - 2a + 9. Let f(c) = 1 + 2c - ac - c. Let x(y) = 2y - 2. Calculate 2f(u) + 3x(u). 2u - 4 Let m(i) = -6i3 + i. Let h(f) = 31f*3 + 2f*2 - f. Give h(w) + 6m(w). -5w3 + 2w*2 + 5w Let a(z) = -64z2 - 9z - 17. Let n be (1 + -10)(3 + 0 + -2). Let w(s) = 16s*2 + 2s + 4. Calculate nw(g) - 2a(g). -16g2 - 2 Let s(u) = -u2 - 2u - 12. Let i(k) = -k - 1. Suppose -604b = -613b - 36. What is bi(g) + s(g)? -g2 + 2g - 8 Let a(m) = -6m2 - 4m + 5. Let u be (1/2 - 1)-4. Let q(g) = -6g*2 + 3g*2 + 7 - 6g*u - 6g. What is 7a(p) - 5q(p)? 3p2 + 2p Let b(l) = 20l3 + 6l*2 - 6l + 63. Let z(h) = 3h3 + h2 - h - 1. Give b(w) - 6z(w). 2w3 + 69 Let o(n) = 2n - 1. Let a = 177 + -180. Let s(t) = t. What is as(w) + 2o(w)? w - 2 Let b be (2 - 1)/((-17)/(-68)). Let g(v) be the second derivative of -v4/4 + v3 + 5v2/2 + 6v. Let s(y) = 2y2 - 5y - 4. Calculate bg(x) + 5s(x). -2x2 - x Let j(b) = 6b + 179. Let h(u) = 3u + 178. Determine 3h(t) - 2j(t). -3t + 176 Let b = 97 - 92. Let w be (-1)/33/(-1). Suppose -bt + 6 - w = 0. Let l(o) = -6o2 + 2. Let r(g) = g2. Give tl(q) + 4r(q). -2q*2 + 2 Suppose -2s + 3s = 3. Let z(m) = -m2 - m + 3. Let t(p) = 2. Let r(w) = 10. Let x(i) = r(i) - 4t(i). Give sx(y) - 2z(y). 2y2 + 2y Let x(t) be the second derivative of t3/2 + t2/2 + 7t - 2. Let c(a) = 13a + 5. What is -2c(q) + 9x(q)? q - 1 Let j(i) be the second derivative of 2i4/3 + 7i*3/3 - 3i2/2 - i. Let o(s) be the first derivative of -s3 - 5s2/2 + s - 723. Give 6j(q) + 17o(q). -3q*2 - q - 1 Let z(n) = 12n. Let x be z(2). Let h(q) = -4q - 12q + xq. Let j(g) = -g. Give h(a) + 4j(a). 4a Let j(i) be the second derivative of -i3/3 - 3i*2/2 - i + 7. Let r(b) = 4b + 7. Let t be (-6)/((-1)/(-1)) - 1. Calculate tj(d) - 3r(d). 2d Let x(k) = k2 + k + 2. Suppose -9 = -2y - 3. Let b(q) = -q*2 - 1. Determine yb(g) + 2x(g). -g2 + 2g + 1 Let u = 90 - 85. Let y(a) = a*2 - a - 1. Let c(n) = 11n*2 - 6n - 9. Let f(g) = c(g) - 6y(g). Let v(w) = 9w*2 + w - 5. What is uf(z) - 3v(z)? -2z*2 - 3z Let c(o) = 8o - 7. Let s be (-3)/(2/4 - (-1)/2). Let w(p) = -7p + 6. Give sc(b) - 4w(b). 4b - 3 Suppose 4s - r = 19, 2s = 2r + r - 3. Let f = -77 + 53. Let k = f + 46. Let p(d) = 7d2 + 4d - 11. Let n(v) = -2v2 - v + 3. Give kn(t) + sp(t). -2t*2 + 2t Let n(f) = -6f + 1009. Let x(j) = -4j + 673. What is 5n(i) - 8x(i)? 2i - 339 Let l = -64 + 144. Let p = l + -89. Let n(f) = 5f*3 + 6f*2 - 2f. Let k(y) = 11y3 + 13y*2 - 5y. What is pn(g) + 4k(g)? -g*3 - 2g*2 - 2g Let x(q) = -15q3 + 84q*2 + 4q + 1. Let r(j) = -41j3 + 252j*2 + 11j + 2. Determine 4r(v) - 11x(v). v*3 + 84v*2 - 3 Let m = 1 + 1. Let s(o) = -5o*m + 0o*2 + 1 + 0 + 6o*2. Let l(h) = 2h*3 - 3h*2 - 3. Calculate 2l(g) + 6s(g). 4g*3 Let o(v) = -1477v*2 - v + 3 + 1478v*2 - 3. Let z(k) = -3k*2 + 6k - 2. Calculate -4o(w) - z(w). -w2 - 2w + 2 Let h(p) = -p*2 - 4p - 2. Let a = -1144 + 1138. Let n(x) = -3x2 - 9x - 5. What is an(r) + 15h(r)? 3r2 - 6r Suppose 4y + k - 29 = 0, 3y + 4k - 105 = -93. Let a(g) = 4g - 20. Let u(p) = -6p + 30. Give ya(d) + 5u(d). 2d - 10 Let o(l) = 5l2 + 6l. Let z(i) = 11i2 + i + 4. Let d(n) = -10n*2 + 3n - 5. Let q(b) = 4d(b) + 5z(b). Determine 17o(c) - 6q(c). -5c2 Let n(u) = u - 2. Let b be -62/(20/(-5)). Let h be (-6 + b)*2/(-3). Let	{ "pile_set_name": "DM Mathematics" }
28u + 4 + 32u wrt u? -180u2 Let u(l) be the third derivative of -l7/105 - 13l*6/30 + 13l*3/2 - 180l*2. Find the first derivative of u(z) wrt z. -8z*3 - 156z*2 Let t(q) be the third derivative of 2 - 16/3q*3 + 3q*2 + 0q + 0q4 - 7/60q*5. Find the first derivative of t(u) wrt u. -14u Let c(i) = -i*2 - 7i - 4. Let n be c(-6). Suppose 0 = -3r + 3, 2v + 7r = nr + 11. Differentiate -4 + 3k2 - 2k*4 + 7k*4 - vk*2 with respect to k. 20k*3 Let m(n) be the first derivative of -61n*2 - 198n + 180. What is the derivative of m(o) wrt o? -122 Let c(m) be the second derivative of 13m8/28 + m6/15 - 5m4/6 + m3/6 - 89m - 1. Find the third derivative of c(y) wrt y. 3120y*3 + 48y Let b(a) be the second derivative of 9/2a3 - a4 - 13a + 0a2 + 0. Find the second derivative of b(i) wrt i. -24 Let y(x) be the second derivative of -22x + 0 - 9/2x3 - 1/2x*2. What is the derivative of y(u) wrt u? -27 Suppose -2s - 2 = -6. Let q be (11/44)/((-1)/(-12)). Find the third derivative of 0w3 + 4wq - w3 + 2ws wrt w. 18 Let f be (-15)/35 - (-101)/7. Find the second derivative of 0v + fv2 - 3v - 2v2 wrt v. 24 Find the second derivative of 142n*3 + 110n - 147n3 - 203n*4 + 208n*4 wrt n. 60n*2 - 30n Let p(k) = -2k3 - 12k + 6. Let d(a) be the first derivative of 0a - 1/2a*2 + 5. Let f(i) = 12d(i) - p(i). Differentiate f(m) wrt m. 6m2 Let g(b) = b2 + b + 3. Let i be g(-3). Suppose 4y - y - i = 0. Find the third derivative of 4f2 + yf*5 - 14f*2 + 8f*2 wrt f. 180f*2 Let w(f) be the third derivative of 0f*3 + 7/8f*4 - 13f*2 + 0 + 0f*6 + 6/35f*7 + 0f*5 + 0f. What is the second derivative of w(o) wrt o? 432o2 Let d(o) = 10o*3 + 4o*2 - 49o + 4. Let p(g) = 11g3 + 3g*2 - 51g + 3. Let l(i) = 3d(i) - 4p(i). What is the second derivative of l(w) wrt w? -84w Let w(j) = 9j + 7. Let h(i) = i - 1. Let p(s) = 4s + 5. Let g(k) = -2h(k) - 2p(k). Let v(x) = -6g(x) - 5w(x). Find the first derivative of v(f) wrt f. 15 Let p(x) = -7x*2 - 11x + 38. Let c(t) = -2t2 - 1. Let v(w) = 3c(w) + p(w). Find the first derivative of v(k) wrt k. -26k - 11 Let a = -1 + -11. Let r = a + 32. What is the second derivative of -rb - 3b5 + 23b + 6b5 wrt b? 60b*3 Let c(k) be the second derivative of -23k6/30 + k3 + 89k2/2 + 2k + 207. Find the first derivative of c(s) wrt s. -92s3 + 6 Let h(n) be the third derivative of -1/30n*7 + 0n*6 + 0n*5 + 0n + 0 + 7/24n4 - 2n*2 + 0n*3. What is the second derivative of h(i) wrt i? -84i*2 Let p(a) be the second derivative of -77a*5/20 - 115a*2/2 - 10a + 5. Differentiate p(n) wrt n. -231n2 Let j(r) be the first derivative of -39r*5 + 34r + 203. What is the first derivative of j(s) wrt s? -780s3 Let x(n) = 39n - 3. Let y(k) = 19k - 2. Suppose 4z + 0z = -2u - 8, 3u - 3z = 33. Let b(j) = ux(j) - 11y(j). Find the first derivative of b(q) wrt q. 25 Let r = -119 + 124. Find the second derivative of 18k - 10k - 11k + 45k + rk5 wrt k. 100k*3 Find the second derivative of 39 - 29h*4 + 29h - 17h - 11h wrt h. -348h2 Let f be 24 + (-4 - (-7 + 5)). Find the first derivative of 6d*2 - 10d*2 - f - 4d*2 wrt d. -16d Let p(r) = -321r + 318. Let s(l) = -319l + 315. Let q(v) = 2p(v) - 3s(v). Find the first derivative of q(h) wrt h. 315 Let l(i) = -32i2 + 18i - 20. Let y(f) = -f*2 + f - 2. Let r(q) = -3l(q) + 30y(q). Find the second derivative of r(s) wrt s. 132 Let c(j) = 0 + 7 + 13j*2 - 14j + 0 - 12j. Let p(o) = -4o*2 + 9o - 2. Let l(h) = 2c(h) + 7p(h). What is the second derivative of l(m) wrt m? -4 Let h(j) be the second derivative of 17j5/20 - 5j*3/2 + 3j*2/2 + 40j. Let k(t) = -1. Let q(i) = h(i) + 3k(i). Find the second derivative of q(f) wrt f. 102f Let n(o) be the second derivative of -o*4/12 + 77o*3/6 - 93o*2/2 + 190o. Differentiate n(u) with respect to u. -2u + 77 Let f be 4/16 - 23/(-4). Let h = f + -3. What is the second derivative of 10 - 6t*h + 2t - 10 wrt t? -36t Differentiate 0 - 10 + 1311g*3 - 19 - 1346g*3 wrt g. -105g*2 Let h(s) = 4s + 23. Let y(o) = 3o + 15. Let z(u) = -5h(u) + 8y(u). Let l(b) = 21b + 26. Let a(j) = -4l(j) + 22z(j). Differentiate a(f) wrt f. 4 What is the second derivative of -40x + 1 + 2x*5 + 20x*5 + 7x + 2x4 wrt x? 440x*3 + 24x*2 Let x be (-1)/2 - 42/(-4). What is the first derivative of -24 + x + 15 - 14w*2 wrt w? -28w Let z(t) be the third derivative of -5t8/16 - t5/6 - t3/2 + 87t*2. Find the third derivative of z(w) wrt w. -6300w*2 What is the first derivative of -154p*3 + 383p*3 + 750 + 210 - 212 wrt p? 687p*2 Suppose 0r = 9r - 108. Find the third derivative of -6b*3 + 23b*3 - 2b*4 + 3b*4 + rb*2 wrt b. 24b + 102 What is the derivative of 0o4 - 4o*4 + 359 + 275 - 9o*4 + 12o*4 + 193o*3 wrt o? -4o*3 + 579o*2 Suppose -590 = -3v + v. Find the second derivative of v - 295 - 2u - 11u + 6u2 wrt u. 12 What is the third derivative of 288u*6 + 2u*2 + 51u + 322u6 - 110u*6 + 156u wrt u? 60000u3 Suppose 15o = 23o - 24. Let z(t) = -11t*5 + 37t. Let v(d) = 12d5 - 38d. Let r(c) = oz(c) + 2v(c). Find the second derivative of r(p) wrt p. -180p3 Let f(i) = -6i + 53i2 + 0i - 31i2 - 33i*2 - 3. Let y(k) = 21k*2 + 13k + 7. Let l(u) = 13f(u) + 6y(u). Differentiate l(b) with respect to b. -34b Find the first derivative of -21d*2 + 21d*2 + 2d + 21d3 - 63d*3 - 95d*3 - 428 wrt d. -411d*2 + 2 Let b(h) = 11h - 40. Let i be b(4). Find the second derivative of -32m - 2m*4 + 15m*4 + 45m*i - 12m*4 wrt m. 552m*2 Let g(u) be the first derivative of 9u*4/4 - 8u*3/3 - 2u*2 + 40u + 37. What is the second derivative of g(k) wrt k? 54k - 16 Find the first derivative of 49w*2 - 54 - 82w*2 + 55w2 - w4 wrt w. -4w3 + 44w Let r(h) be the third derivative of -11/24h4 + 0h*3 - 4h*2 + 0h + 0 + 1/5h5. What is the second derivative of r(p) wrt p? 24 Let z(o) = -o. Let d be (4/(-18) - (-7)/(-9)) + 5. Let w(v) = 12v*2 + 7v. Let x(h) = dz(h) - w(h). What is the second derivative of x(p) wrt p? -24 Find the third derivative of 1381k*5 + 3k - 1239k5 - 380k*2 - 3k wrt k. 8520k2 Differentiate -112 - 3b*3 - 30b*2 + 30b*2 with respect to b. -9b*2 Let n be -6 + 1 - (-26)/13. Let u be 9/n(-4 + 3). Find the third derivative of uv2 + v3 - 76v + 76v wrt v. 6 Let z(u) = -9u*5 - 69u*2 - 74u + 1. Let y(g) = 4g5 + 34g*2 + 38g - 1. Let i(j) = 5y(j) + 2z(j). What is the second derivative of i(h) wrt h? 40h3 + 64 Let x(g) = -g3 + g2 + 1. Let s(q) = 141q*3 - 2q*2 - 2q - 510. Let h(p) = -s(p) - 2x(p). What is the second derivative of h(l) wrt l? -834l Suppose 0 = -4b + 3 + 5. Let z be b/5 - (-13)/5. Find the third derivative of -2o*2 + zo*6 - o + o - 7o*6 wrt o. -480o3 Let r(h) be the first derivative of -h5/5 + 15h4/4 + 206h*3 + 691. Find the third derivative of r(t) wrt t. -24t + 90 Let g = 26 + -24. Let h be (8 - -8)/(g + 0). What is the second derivative of 8c2 + 4c*2 - hc*2 + 5c + 8c wrt c? 8 Let t be ((-4)/(-6))/(16/216). Let p = 18 - t. What is the first derivative of pf*4 + 16f - 5 - 16f wrt f? 36f*3 What is the second derivative of 94c + 25c3 - 11c*3 - 4c*5 + 23c wrt c? -80c3 + 84c Let g(f) be the first derivative of -4 - f*3 - 2/3f*6 + 0f + 0f4 + 0f*2 + 0f*5. Find the third derivative of g(c) wrt c. -240c*2 Let s(a) be the first derivative of 14a*6/3 + 23a*2/2 - 31. Find the second derivative of s(u) wrt u. 560u3 Let k(m) = -m3 - 7m2 + m + 15. Let c be k(-7). What is the second derivative of 2r*5 + 23r - 30r5 + cr - r wrt r? -560r3 Let w(l) = 24l*3 - 3l*2 - 11. Let p(o) = -4o*2 - 14 - 20 + 78o*3 - 4o*2 - 6o*3. Let b(g) = 3p(g) - 8w(g). Differentiate b(a) wrt a. 72a*2 Let m(z) = -25z*2 + 6z + 19. Let h(y) = 176y2 - 40y - 132. Let a(s) = -6h(s) - 40m(s). Differentiate a(c) wrt c. -112c Suppose 8b = 4b + 2m - 6, -12 = -4b - 4m. Let k = b - -2. What is the second derivative of 5uk - 6u	{ "pile_set_name": "DM Mathematics" }
y*3/5 - 556y*2/5 - 96y = 0. -8, -5, -1, 0, 6 Factor -2s2/7 + 240s/7 - 864. -2(s - 84)(s - 36)/7 Suppose -2l3/9 - 338l*2/9 + 340l/9 = 0. Calculate l. -170, 0, 1 Find l such that -2l2/9 + 437338l/9 = 0. 0, 218669 Determine h, given that -45h3/2 - 47h*2 + 667h/2 + 30 = 0. -5, -4/45, 3 Determine f, given that -3f4/8 - 117f*3/8 + 471f*2/4 - 144f - 276 = 0. -46, -1, 4 Factor 2b3/11 + 510b*2/11 + 1492b/11 - 5040/11. 2(b - 2)(b + 5)(b + 252)/11 Factor 5o*3 - 95o*2 + 80o + 180. 5(o - 18)(o - 2)(o + 1) Suppose 3x*2 - 1584x + 24576 = 0. Calculate x. 16, 512 Solve -2u5 + 1336u*4 - 214976u*3 - 2709248u*2 - 11010560u - 14796800 = 0. -4, 340 Find g such that 4g3 - 11480g*2 + 8327972g - 130325056 = 0. 16, 1427 Find j such that 4j4 + 3524j*3 - 14204j*2 - 38964j - 21240 = 0. -885, -1, 6 Factor 5g3 + 41510g*2 - 124625g - 415250. 5(g - 5)(g + 2)(g + 8305) Factor -2j*5/5 - 548j*4/5 - 36426j*3/5 + 152344j*2/5 - 154568j/5. -2j(j - 2)*2(j + 139)*2/5 Factor -2b*2/5 - 73456b/5 - 674472992/5. -2(b + 18364)2/5 Solve -84q*3 + 204q*2 - 69q - 6 = 0. -1/14, 1/2, 2 Find r, given that 5r4 - 840r*3 - 7340r*2 + 52080r + 126720 = 0. -12, -2, 6, 176 Suppose -2g3/9 + 652g*2/9 - 52480g/9 - 107584/9 = 0. Calculate g. -2, 164 Factor -5x3/3 + 1246x*2 - 202752x - 11604384. -(x - 396)*2(5x + 222)/3 Determine l so that 15l*4 + 694l*3 - 13132l*2/3 + 14680l/3 - 4576/3 = 0. -52, 2/3, 22/5 Factor -5c2 + 6945c + 105300. -5(c - 1404)(c + 15) Factor y*3 + 148y*2 + 75y - 10584. (y - 8)(y + 9)(y + 147) Let 5x2 + 155x - 900 = 0. What is x? -36, 5 Let 5h5 + 30h*4 - 250h*2 - 405h - 180 = 0. Calculate h. -4, -3, -1, 3 Suppose -2d2/3 - 16364d - 100417686 = 0. What is d? -12273 What is a in 2a3 + 794a*2 + 75110a - 741762 = 0? -203, 9 Factor 6w2/7 - 897w/7 - 1818/7. 3(w + 2)(2w - 303)/7 Let -2k*5/5 + 128k*4/5 + 138k*3/5 - 512k*2/5 - 104k = 0. Calculate k. -2, -1, 0, 2, 65 Solve -j*2 - 10892j - 29658916 = 0 for j. -5446 Let 3w5 + 648w*4 + 1860w*3 - 12150w*2 - 1863w + 11502 = 0. What is w? -213, -6, -1, 1, 3 Determine l, given that 23l5/3 - 94l*4/3 - 101l*3 + 94l*2/3 + 280l/3 = 0. -2, -1, 0, 1, 140/23 Find x such that 3x3 - 1086x*2 - 89217x = 0. -69, 0, 431 Factor -100s4 - 31595s*3 - 2494820s*2 + 124820s. -5s(s + 158)*2(20s - 1) Factor -4v*2/3 + 7364v - 110360/3. -4(v - 5518)(v - 5)/3 Solve p*3 + 3280p*2 + 35959p = 0 for p. -3269, -11, 0 What is l in 25l5 + 11905l*4 + 26005l*3 - 30825l*2 - 7110l = 0? -474, -3, -1/5, 0, 1 Factor -q*2 - 465q - 33464. -(q + 89)(q + 376) Factor -2n*2/11 - 3006n/11 + 3008/11. -2(n - 1)(n + 1504)/11 Find y, given that -y*2/6 - 156y = 0. -936, 0 Find p, given that 2p3/3 - 394p*2/3 - 2012p/3 - 1616/3 = 0. -4, -1, 202 Find s, given that -3s3/5 - 14550s*2 + 291036s/5 - 291048/5 = 0. -24254, 2 Factor -3q3/8 + 495q*2/4 + 45549q/8 + 123039/2. -3(q - 372)(q + 21)*2/8 Factor -2r*3/3 + 56r*2 + 58r - 340/3. -2(r - 85)(r - 1)(r + 2)/3 Solve -3u*3 + 1989u*2 - 119994u + 118008 = 0 for u. 1, 66, 596 Suppose -k*3/7 + 228k*2/7 + 6435k/7 + 42926/7 = 0. Calculate k. -13, 254 Solve -4k3 - 3140k*2 - 614652k + 617796 = 0 for k. -393, 1 Find m such that 2m2 + 44m + 144 = 0. -18, -4 Factor -5h4 + 154h*3 + 1141h*2 + 222h. -h(h - 37)(h + 6)(5h + 1) Factor 67t2/2 - 29147t/2 + 435. (t - 435)(67t - 2)/2 Let 3d2/2 + 56643d/2 = 0. Calculate d. -18881, 0 Suppose 3h4/5 + 1581h*3 + 7159617h*2/5 + 2406754539h/5 + 161557452936/5 = 0. Calculate h. -849, -88 Suppose -t*4/5 - 247t*3/5 - 967t*2/5 + 243t = 0. Calculate t. -243, -5, 0, 1 Determine m, given that 5m5 + 220m*4 + 3225m*3 + 17170m*2 + 23120m = 0. -17, -8, -2, 0 What is z in -3z5 - 2352z*4 + 85998z*3 + 2352z*2 - 85995z = 0? -819, -1, 0, 1, 35 Find h such that -3h3 + 510h*2 - 17664h - 355488 = 0. -14, 92 Suppose y*4/3 - 39y*3 + 332y*2 - 2608y/3 + 576 = 0. What is y? 1, 4, 108 Determine z, given that -3z5/4 - 1509z*4/4 - 93723z*3/2 + 294879z*2/2 + 1735833z/4 + 960135/4 = 0. -253, -1, 5 Factor c*2/3 + 1451c/3 + 30470. (c + 66)(c + 1385)/3 Let 15m*5 - 66m*4 - 3051m*3 + 4350m*2 - 1248m = 0. What is m? -13, 0, 2/5, 1, 16 Suppose 5k4 + 195k*3 - 4765k*2 - 195k + 4760 = 0. What is k? -56, -1, 1, 17 Factor 3q3 - 242934q*2 + 4918077363q. 3q(q - 40489)*2 Let -6i*2/11 + 2349408i/11 - 229988247936/11 = 0. What is i? 195784 Let 10h3/3 + 674h*2/3 + 11068h/3 + 1440 = 0. Calculate h. -40, -27, -2/5 Determine o so that 4o4 + 3160o*3 - 137856o*2 + 1594240o - 2662400 = 0. -832, 2, 20 Determine f, given that 2f2/5 - 41034f/5 - 82076/5 = 0. -2, 20519 Determine t, given that -3t2 + 89076t - 661211148 = 0. 14846 Solve -39i4/4 + 123i*3/4 + 2097i*2/2 - 2307i + 330 = 0 for i. -10, 2/13, 2, 11 Factor o*2 - 72016o + 1296576064. (o - 36008)*2 Determine g so that -8g*3/5 + 1648g*2/5 - 62746g/5 - 2412286/5 = 0. -23, 229/2 Suppose -5j4 - 50j*3 + 2235j*2 - 14200j + 25520 = 0. What is j? -29, 4, 11 Suppose d*5/2 - 45d*4/2 + 83d*3/2 + 129d*2/2 = 0. What is d? -1, 0, 3, 43 Factor -2t*2 - 92t - 720. -2(t + 10)(t + 36) Let -r*3/2 - 319r*2 + 3209r/2 - 1929 = 0. What is r? -643, 2, 3 Determine s, given that 5s2 - 15635s = 0. 0, 3127 Factor -2t2 + 211238t. -2t(t - 105619) Solve -4t3/3 + 1376t*2 + 24892t/3 + 6920 = 0 for t. -5, -1, 1038 Factor -q*2/4 - 5059q/4 - 38967. -(q + 31)(q + 5028)/4 What is h in h3/2 + 461h*2/2 + 59799h/2 + 2378475/2 = 0? -275, -93 Suppose -b*5/3 - 311b*4/3 - 7903b*3 + 73319b*2/3 - 49298b/3 = 0. What is b? -157, 0, 1, 2 Solve 3n5 - 9n*4 - 735n*3 + 2889n*2 + 732n - 2880 = 0. -16, -1, 1, 4, 15 Find b, given that b*3/2 + 2796b*2 - 11191b/2 - 8391 = 0. -5594, -1, 3 Factor 2a2/5 - 400092a/5 - 400094/5. 2(a - 200047)(a + 1)/5 Find s, given that -3s4/4 + 101505s*3/2 - 3439493175s*2/4 + 42898550625s - 535835671875 = 0. 25, 33810 Find i such that 2i2 - 855548i + 91495297538 = 0. 213887 Let 34404g2 - 8g = 0. Calculate g. 0, 2/8601 Determine f, given that 20f4 - 135f*3 - 60f*2 + 365f + 270 = 0. -1, 2, 27/4 Factor -4x3 - 79596x*2 - 159180x - 79588. -4(x + 1)2(x + 19897) Let -q*5/3 + 671q*4/3 - 38733q*3 + 407895q*2 - 1425600q + 1633500 = 0. What is q? 3, 5, 330 Find q, given that 6q4 - 2267q*3/2 + 99485q*2/2 + 54939q + 12744 = 0. -3/4, -1/3, 72, 118 Find d such that 5d2 + 29480d + 323675 = 0. -5885, -11 Suppose -2k5/11 - 8170k*4/11 + 2k*3/11 + 8170k*2/11 = 0. Calculate k. -4085, -1, 0, 1 Solve 2a*4/11 + 36a*3/11 - 548a/11 + 510/11 = 0 for a. -17, -5, 1, 3 Factor 4z3 + 715z*2 - 3859z + 920. (z - 5)(z + 184)(4z - 1) Suppose -2v*5 + 189v*4 + 31586v*3 + 1173348v*2 + 13277088v - 6935841 = 0. Calculate v. -33, 1/2, 193 Suppose -5m5 - 2215m*4 + 13470m*3 = 0. What is m? -449, 0, 6 Factor 2a*3 + 1008a*2 + 119658a - 1878268. 2(a - 14)(a + 259)*2 Factor 3m*3 + 1482m*2 + 4425m + 2946. 3(m + 1)(m + 2)(m + 491) Factor 4u*4 - 15536u*3 - 15540u*2. 4u*2(u - 3885)(u + 1) Solve -2m*3/21 + 156m*2/7 - 7750m/7 - 500000/21 = 0 for m. -16, 125 Factor 5z3 + 2294825z*2 + 4589635z + 2294815. 5(z + 1)2(z + 458963) Suppose -11w3 - 2906w*2 - 6292w - 1048 = 0. Calculate w. -262, -2, -2/11 Solve -f*5/2 + 1751f*4/6 + 7388f*3/3 + 7118f*2/3 - 8288f/3 = 0. -7, -2, 0, 2/3, 592 Let -242l5 - 5720l*4 - 20886l*3 + 8168l*2 - 760l = 0. Calculate l. -19, -5, 0, 2/11 Factor 3x3 - 2112x*2 + 448527x - 25447230. 3(x - 307)2(x - 90) Solve 2g5 + 15472g*4 + 29907362g*3 - 59938532g*2 - 119629480g + 239506576 = 0 for g. -3869, -2, 2 Solve -3t2/2 + 2187t/2 - 19197 = 0. 18, 711 Let 6m4 - 2572m*3/3 - 984m*2 + 10288m/3 + 3840 = 0. What is m? -2, -10/9, 2, 144 Factor -2h4/5 - 42h*3 - 1552h*2/5. -2h*2(h + 8)(h + 97)/5 Suppose -2s*4/9 - 1814s*3/3 - 3621626s*2/9 + 36665750s/3 + 234437500/9 = 0. What is s? -1375, -2, 3	{ "pile_set_name": "DM Mathematics" }
5l, -m + 2m = -al + 626. Calculate the greatest common divisor of l and 18. 18 Let p = -3013 + 3023. Suppose 23 - 55 = -4c. Calculate the greatest common factor of p and c. 2 Let w = 1242 - 1174. Calculate the highest common factor of w and 629. 17 Let i be -2 - 5 - -4 - -54. Suppose 4k - 2k = 5d - 214, 4d - 185 = -3k. Suppose i = 7q + d. What is the greatest common factor of q and 1? 1 Suppose -157 = -7p + 123. Let l = p + -35. What is the highest common factor of l and 135? 5 Suppose 5l = -4h + l, 5h - 4 = -3l. Suppose -299x - 1260 = -317x. Suppose -hr + x + 16 = 0. What is the greatest common divisor of 215 and r? 43 Let q = 886 + -328. Let x = 23 + 39. Calculate the highest common factor of q and x. 62 Let o = 222 + -87. Let f be (-19 - -15)/(3 - 1). Let n be (-285)/(-20) - f6/16. What is the highest common divisor of o and n? 15 Let d be 277866/3483 - (-4)/18. Calculate the highest common factor of d and 1296. 16 Let w = 335 + 1485. Let b be ((-6)/(-7))/(26/w). Calculate the greatest common divisor of 480 and b. 60 Let c(d) = -2d*3 - 12d*2 - 12d - 7. Let h be c(-5). Suppose 2p + 4v - 24 = 0, -8 = hp + 7v - 12v. Calculate the greatest common factor of p and 10. 2 Let g(k) = -k3 + 3k*2 + 8k - 16. Let l be g(4). Suppose 3a - 1037 = -0a + 2u, l = -3u - 3. Calculate the greatest common factor of 30 and a. 15 Let d = 1406 + 13734. Calculate the greatest common factor of 20 and d. 20 Let a(x) = x*3 - 17x*2 + 52x - 339. Let z be a(22). What is the highest common divisor of 105 and z? 15 Let w be (72/(-28))/((-4)/28). Let p be 21/(-27) - (-2)/(-9). Let q = 11 - p. What is the highest common factor of w and q? 6 Let w be (4/18 + 325/(-450))4. Let g(m) = -19m*3 + 3m*2 + 3m + 4. Let r be g(w). What is the greatest common divisor of r and 54? 54 Let x = -2437 + 2482. Calculate the greatest common divisor of x and 645. 15 Let q = -33 - -65. Suppose -q = 3p - 7p. Suppose -5t + r = -p, -4t + 3r + 10 = -3t. What is the highest common divisor of t and 3? 1 Let m be (-234)/(-702)(2840/1 - 2) + 6. What is the greatest common factor of 2023 and m? 119 Let w = -176 + 159. Let g(f) = f + 72. Let x(r) = -1. Let i(q) = g(q) + 2x(q). Let t be i(w). What is the greatest common divisor of t and 477? 53 Suppose -n + 20379 = 5b, 18n + 30 = 13n. What is the greatest common factor of 216 and b? 27 Let k be ((-24)/(-22))/2 - ((-1422576)/99 + -21). Calculate the highest common factor of 82 and k. 41 Let b be (6 - 3/2)88/3. Let l = b + -101. Let x be l + -5 + 3 - (-5 - -6). Calculate the highest common divisor of x and 70. 14 Let n(q) = -15 + 3q2 + 7 + 3q + 8q. Let k be n(-4). Let h be 136 - (1 - 4 - k). Calculate the highest common factor of h and 15. 15 Let h = -17575 + 17610. Calculate the greatest common divisor of h and 80. 5 Let t(i) = 7i + 1. Let w be t(2). Let d(s) = 2s3 - 33s*2 + 109s + 3. Let n be d(12). Calculate the highest common factor of n and w. 15 Suppose 201 + 525 = 33x. Suppose -s = -0s - 11. What is the highest common factor of s and x? 11 Let h = 174 - 157. Suppose -2m - 158 = -4r, -5m = 4r - 120 - h. What is the highest common divisor of 323 and r? 19 Let p = -492 + 564. Suppose px + 588 = 76x. What is the greatest common divisor of 49 and x? 49 Suppose 0 = 40j - 43j + 198. What is the highest common factor of j and 48? 6 Suppose -24l + 26l = -10. Let v = 13 - l. Suppose 4 = 4j - 2j. Calculate the highest common factor of v and j. 2 Let h(u) = -88u + 135. Let k be h(-13). Let m = -207 + k. Calculate the greatest common divisor of m and 16. 16 Let a be (-3)/2(-1 - 1). Suppose 2360 = -0c + 10c + 10c. Suppose -286 = -ar - 2r + 3v, 3v + c = 2r. Calculate the greatest common divisor of 7 and r. 7 Let v(s) = -3s2 - 14s - 7 + 1 + 2s2 - 3. Let k be v(-13). Suppose -kw = -18 - 50. What is the highest common divisor of 68 and w? 17 Let n be 16 - 1760/((-100)/10). What is the highest common factor of n and 3216? 48 Suppose 2a + 17 = 5y, -2y = a + 3y - 44. Calculate the highest common divisor of 1059 and a. 3 Let v = -3420 - -3509. What is the greatest common factor of v and 4717? 89 Let v(m) = 17m2 + 23m - 196. Let h be v(7). Calculate the highest common factor of 42 and h. 42 Let u be (6 + (9 - 9))/(10/5). Calculate the highest common divisor of 127 and u. 1 Suppose 5z - 5q = -0q + 180, 4q = -3z + 136. Let a be 21/(-9)(-1 + -2). Let p be (-3)/a + (-38)/(-7). What is the greatest common divisor of p and z? 5 Suppose -4g - 4f + 68 = 0, 5g - 16 = 2f + 69. Let z(x) = 17x + 17. Let y be z(0). Calculate the greatest common divisor of y and g. 17 Suppose 14u + 836 = 276. Let b be 4/(-5)300/u. Calculate the greatest common divisor of 6 and b. 6 Let z(c) = -17c*3 - 9c*2 - 10c - 32. Let d be z(-4). What is the greatest common factor of d and 136? 136 Let c(q) = q*2 - q - 3. Let a(j) = -47j + 41. Let t(p) = a(p) + 2c(p). Let y be t(24). Let g = 104 + -49. What is the highest common divisor of y and g? 11 Let w be -1 - (-10 + -1 + -1). Suppose 0 = 6r - wr + 150. Let g be 160/r66/8. Calculate the highest common factor of 11 and g. 11 Let n = 1521 + -1494. Suppose -5y = -5k - 75, -y - k = -6k - 3. What is the greatest common factor of n and y? 9 Suppose -2z - 5h = -11, 4z - 19h - 11 = -18h. Suppose -5n + 2c + 64 = 3c, zn + 3c = 48. What is the highest common divisor of 372 and n? 12 Suppose 4m - 3 - 13 = 0. Suppose -g - 3n = n + 201, -2g - mn - 402 = 0. Let j = g + 370. Calculate the greatest common factor of j and 13. 13 Let u be (-19 - (-880 - 11)) + -1. What is the highest common divisor of u and 1541? 67 Let w = -13488 - -17250. Calculate the greatest common divisor of 114 and w. 114 Suppose -3l + 3879 = 3s, 46l - 44l + 3s = 2582. What is the greatest common divisor of l and 1? 1 Suppose -3692 = -150n + 79n. Let m = -6 + 7. Let b = n - m. What is the greatest common factor of 3 and b? 3 Suppose 4s = 4h - 500, 5s = 3h - 175 - 198. Let l = 24 + h. Let o = 3930 + -3900. Calculate the highest common factor of l and o. 30 Suppose 5j - 1845 = -4p - p, -4p = -5j + 1791. What is the highest common factor of 33 and j? 33 Suppose 13s = -30s + 1118. Let t be (-30)/(-9)(-24)/(-20). Suppose tv - 291 = 125. What is the highest common divisor of v and s? 26 Let w = 70 - 34. Suppose 4 = i + 4j, 2i - 6j = 52 - 2. Let r = w - i. What is the greatest common divisor of r and 180? 20 Let v(o) = -33o + 7299. Let s be v(69). Calculate the highest common divisor of 465 and s. 93 Let o = 111 + -93. Suppose 8s = 2s + o. Calculate the greatest common divisor of s and 8. 1 Suppose o - 16778 = -5w, 16763 = 5w - 3o - o. Calculate the highest common factor of w and 110. 55 Let h(x) = x2 + 19x + 347. Let u be h(-25). Calculate the highest common factor of 175 and u. 7 Suppose 8f + 29 = 9f + 5p, 4f = -3p + 31. Suppose -49 - 87 = -fu. What is the greatest common factor of u and 51? 17 Let a(k) = 4k - 3. Let m be a(2). Let i(f) = 3f - 7. Let z be i(m). Suppose 6r - 1312 - 1120 = -32r. What is the greatest common divisor of z and r? 8 Suppose -5o + 1730 = -2s - 3s, 3s + 1038 = -5o. Let v = s - -347. What is the highest common factor of v and 23? 1 Let o be (10/30)/(2/(-37062)-3). What is the greatest common divisor of o and 29? 29 Let r be 8 + (4/8 - (-12)/8). Suppose 5m - rm + 350 = -2i, 5i - 97 = -m. What is the greatest common factor of 16 and m? 8 Suppose 10b - 2605 - 1576 + 1461 = 0. What is the greatest common factor of b and 3842? 34 Let w be (-2)/(-10) - (-2 + (-1140)/50). Suppose b + w - 55 = -4h, -2b + h + 51 = 0. Let n = 283 - 192. What is the greatest common factor of n and b? 13 Let m(l) = 353l*2 + 82l - 237. Let w be m(3). Calculate the greatest common factor of w and 162. 54 Suppose 432 = 5b + 4v, -2b + 63 = 5v - 120. What is the greatest common factor of b and 28? 28 Let u(t) = 84t2 - 35t + 130. Let p be u(5). Calculate the greatest common divisor of 45 and p. 15 Let s = -1174 - -344. Let g = s + 902. What is the highest common factor of 324 and g? 36 Suppose 1310 = 4y + 2r, 4y + 2r = -3*r + 1307. Let t = y + -193. Let p = -5 + 20. What is the greatest common factor	{ "pile_set_name": "DM Mathematics" }
(-4/3) assuming i is positive. i(-20/13) Simplify uu(1/10)uu(uuuu(5/8)/uuu)/uuu assuming u is positive. u(349/40) Simplify (h3)(2/17) assuming h is positive. h(6/17) Simplify (qq/(q/((q/(q/(q*(-7)/qqq)))/q)))/(qq*(2/11)qq) assuming q is positive. q(-101/11) Simplify (q/q(-1/3))(1/80) assuming q is positive. q(1/60) Simplify (t(3/2))(2/15) assuming t is positive. t(1/5) Simplify (qqq(-1/20))/q(2/27) assuming q is positive. q(1013/540) Simplify v(2/7)v*2v((vv/(((vv/(v(v/(v*(1/6)v))/v))/vv)/vv))/v)/(vv/(v/(vv*(-1/4)vv))) assuming v is positive. v(-137/84) Simplify j/j4((j/j(3/4))/j)/j assuming j is positive. j(-19/4) Simplify (((j2/j)/j)31)(-20) assuming j is positive. 1 Simplify (p/p29)/(pp0p) assuming p is positive. p(-30) Simplify x(3/7)x/((xxx(-2/57)x)/x) assuming x is positive. x(-214/399) Simplify (h(-2/3)/(h*2h))/(h0)8 assuming h is positive. h(-11/3) Simplify (y/y(-2/25))/(y/((y/y(6/13))/y)) assuming y is positive. y(-124/325) Simplify (c*(-3)c/(c*(3/2)c))28 assuming c is positive. c(-126) Simplify ((hh/h(-2/5))/hh)(2/9)/(h1)(38/3) assuming h is positive. h(-182/15) Simplify ((nn/(nn*(1/2)))/nn(5/2)/n)/(n9/(n/(n*(-8)/n)n)) assuming n is positive. n*3 Simplify (oo*5/oo)/oooo/o(4/5)oo((o/o1)/o)31 assuming o is positive. o*(-109/5) Simplify (ll*(-4/3))/l(ll(1/7))/ll assuming l is positive. l*(-4/21) Simplify (ff(2/3))(-28/5)/(ff/(f/(ff*0))f/f5) assuming f is positive. f(-22/3) Simplify (hh36)/hh(-21) assuming h is positive. h15 Simplify (a1)8 assuming a is positive. a*8 Simplify ((vv/(v/((v/(vv/(v/(vv*(-2/17)))vv))/vv)))/v*(2/11))/((v/(vv/v(-6)))/((v(-7)v)/v)) assuming v is positive. v(-386/187) Simplify s(-5/3)ss(-3/10) assuming s is positive. s(-29/30) Simplify (k/(kkk/(kk/k*(-2/7))k)kk*(-6)/kkkk)/((kk(-1/2))/((kk*(1/4)k)/kk)) assuming k is positive. k(-55/28) Simplify (t((((tt/t2)/t)/t)/t)/t)(2/49) assuming t is positive. t(-6/49) Simplify (ss/(sss(1/3)))(-4/5)(s/(s(1/4)/s))/ss/(s(1/11)/s) assuming s is positive. s(1931/660) Simplify (k*1k)/(k/k*7)k*(1/5)k(k(-6)k)/k assuming k is positive. k(16/5) Simplify x(-11/4)/(x/(((xx/((xx/(x/(xx(-1/2)x))x)/x))/xx)/x)) assuming x is positive. x*(-21/4) Simplify (v/(vv*(2/17)/v))/vv/((v/(vv/(vv/v*(-16)v)v))/v) assuming v is positive. v(-257/17) Simplify (k(-1/2)/(k12/k))(-5) assuming k is positive. k(115/2) Simplify (a/(a(a/(a/(a/a*(-1/8))))/aa))/(a/((aaa/(aa4)a)/a))((a(5/3)/a)/a)/(aa*(2/7)/aaa) assuming a is positive. a(-1133/168) Simplify (g3/(gg(-2/3)))/(g(-2/5))(2/91) assuming g is positive. g(3652/1365) Simplify ((s(7/5)/s)/(s/s(2/5)sss))(3/7) assuming s is positive. s(-48/35) Simplify (jj*(1/7)jj)/j(-1/2)j3/j(-7/5) assuming j is positive. j(563/70) Simplify (h(-2))(-2) assuming h is positive. h4 Simplify (u(-4/7)/u)14 assuming u is positive. u(-22) Simplify g(-1/4)/(gg(2/7))(g*(6/7)g)/g(-2) assuming g is positive. g(65/28) Simplify h*(-2/23)/(h/(h/(hh*(-6/7)h))) assuming h is positive. h*(-198/161) Simplify (ll(2/45))(-2/15) assuming l is positive. l(-94/675) Simplify (u/(u(-1/4)u))/(uu*(-5))u*(-2/9)uu/(uu*(1/3)u) assuming u is positive. u(133/36) Simplify ((p/p(1/4))/pp(2/15))/(p1)(-7) assuming p is positive. p(413/60) Simplify (x/x(-24))/(x/(x(12/11)x)) assuming x is positive. x(287/11) Simplify (g(-4)gg*(-5)g)/(g*11gg/(gg(-9)/g)) assuming g is positive. g(-29) Simplify (y/(y/(y/y(2/21))))/y(-17) assuming y is positive. y*(376/21) Simplify (qq/(q/(q/q*(5/2))q))/q4 assuming q is positive. q(-11/2) Simplify ((o/o*(4/13))/oo)/o20 assuming o is positive. o(-251/13) Simplify (h*7hh/(h((h(h/((h1h)/h))/hhh)/hh)/hhh)h)/(((hh(-2/5))/h)/hh)7 assuming h is positive. h(44/5) Simplify j*(1/2)j/(j/(j*(4/9)/j))(jj(-2/5)j)17 assuming j is positive. j(2443/90) Simplify ((pp(-2))/p)39 assuming p is positive. p(-78) Simplify ((zzz6zz)/((zz6)/z))(-6) assuming z is positive. z*(-24) Simplify ((p((p/p*(-17)p)/pp)/p)/pp)/ppp(2/21) assuming p is positive. p(401/21) Simplify (bb/(b/(b3b)bb))/(b/b(-21)) assuming b is positive. b(-19) Simplify (f(-3/4))(-6) assuming f is positive. f(9/2) Simplify (s(4/5)/s5)/(s(-1/3)/(s/(s/s(2/13)))) assuming s is positive. s(-724/195) Simplify h*14hh(4/5)/h assuming h is positive. h(74/5) Simplify (o1)(-16)/(o(-3/4)oo(-1/4)) assuming o is positive. o(-16) Simplify (q7)47 assuming q is positive. q329 Simplify (zz*9z(-6))(1/27) assuming z is positive. z*(4/27) Simplify (mm1)47/((mm/m(-2/3)m)/(m/m(-3))) assuming m is positive. m(283/3) Simplify (((yyy*4)/y)/(yy*(7/4)/y))/((y(y(-4)/y)/y)/((y/y(-6)yyy)/yy)) assuming y is positive. y(73/4) Simplify (n(-1/3))*(-41)(n(-1))(-3/13) assuming n is positive. n(542/39) Simplify v(-13)vv(2/67) assuming v is positive. v(-802/67) Simplify u/u*0u*(-11)uu assuming u is positive. u(-8) Simplify (w(-1))(-29) assuming w is positive. w29 Simplify (ii*(-33))/((ii28)/i) assuming i is positive. i(-60) Simplify z*(-4/7)(z/(z/(((zz/(z/(z(-2/13)z))z)/z)/z)))/z assuming z is positive. z(-66/91) Simplify x(6/5)x/((x*(3/2)xx)/x) assuming x is positive. x(-3/10) Simplify ((ss*(1/9))/ss(-4/3))/(s1/(ss/(s(-2)/s))) assuming s is positive. s(25/9) Simplify uuuu*6(u*(-2/19)u)/u(u/u(-1))(-8) assuming u is positive. u(-135/19) Simplify ((g/(g/(g/(ggg/(g(2/5)g))))g)/g)(-8/11)(g/(g*(-1/4)g))48 assuming g is positive. g(684/55) Simplify (d/d(-19))8 assuming d is positive. d160 Simplify (x(-2/15)/x*(1/5))/(xx(1/3)/x)(-2/7) assuming x is positive. x(-5/21) Simplify ((w(-2/15))(-2/73))(-32) assuming w is positive. w(-128/1095) Simplify (k(-7/3))(2/13) assuming k is positive. k(-14/39) Simplify ((t/t0)/t)(5/2)/(t/(tt/t(-2))t*3t) assuming t is positive. 1/t Simplify b(-1/37)/b(2/15) assuming b is positive. b*(-89/555) Simplify (mm/m*(3/10)mm9/m)11 assuming m is positive. m(1177/10) Simplify (x/(x/((xx/x*(-4/7)x)/x)))(-17) assuming x is positive. x(-306/7) Simplify (t*(-1/9)/t(tt(-6))/t)/((t(tt(-1/4))/t)/(tt/(t/t4))) assuming t is positive. t(-103/36) Simplify mm(-2/3)m/(mm/m(1/5))m*(-2/5)m6 assuming m is positive. m(77/15) Simplify (((nn(6/17))/n)/nnn/(n(13/3)/n))(-28) assuming n is positive. n(2828/51) Simplify (oooo*(-2)o)*(2/55)/(o(o/o*(-2/19))/oo/o*(2/9)o) assuming o is positive. o(-26431/9405) Simplify (t18)(-31) assuming t is positive. t(-558) Simplify j*(-4)jj(-2/3)j assuming j is positive. j(-8/3) Simplify (b/b(-7))/(((b((b/(b5/b))/b)/b)/bb)/b)(((b9/b)/b)/bbb)/(bb/(bbb/b(-7))) assuming b is positive. b29 Simplify ((r/(r/r(-3)))/r(-5))/(r(-1/2)/r)(1/4) assuming r is positive. r*(19/8) Simplify (pp(9/4))/(p/p(-2/9)) assuming p is positive. p*(73/36) Simplify (d/(dd/(d/(d*(14/3)d))dd))/((d/(d(-7)/d))/d) assuming d is positive. d(-47/3) Simplify z*(1/2)z(z/(z/(zz*(-2))))/z(z*(2/17)z)/z(-7) assuming z is positive. z(259/34) Simplify (l9)34 assuming l is positive. l306 Simplify r/(r/(r/(r/r(28/5)rr)))(r(-2/41)r)/r assuming r is positive. r(728/205) Simplify ((r1)(-27/4))(4/9) assuming r is positive. r(-3) Simplify (a(-1))(-27) assuming a is positive. a27 Simplify ((b/(bb/b(-4/5)))/b)/(b/b(-5/12)) assuming b is positive. b(-253/60) Simplify ((w(-1/2)w)(10/3))(-49) assuming w is positive. w(-245/3) Simplify u(-26/3)(u/u(-2/65)u)/uu assuming u is positive. u(-1294/195) Simplify (uu*5u/(uu(2/31)u))(14/9) assuming u is positive. u(238/31) Simplify (z*(-1)/zzz)(1/23) assuming z is positive. 1 Simplify p/p8p*8p(p(-1/4))*45 a	{ "pile_set_name": "DM Mathematics" }
/10, -469421, -1, -4/3 in decreasing order. 1/10, -1, -4/3, -469421 Put 5, 6596800, -13 in decreasing order. 6596800, 5, -13 Sort -1, -3, 1, -2432, 2, 0, 15 in descending order. 15, 2, 1, 0, -1, -3, -2432 Sort 2, -2, -3, -4, 12871, 0 in descending order. 12871, 2, 0, -2, -3, -4 Sort -0.143113, -68, 2/17 in descending order. 2/17, -0.143113, -68 Put -16, 5, -8, -1, 0, -2017, -3 in ascending order. -2017, -16, -8, -3, -1, 0, 5 Put -1, 5, -6, -42, -92 in descending order. 5, -1, -6, -42, -92 Put 2, 3, 7, -7, 706 in ascending order. -7, 2, 3, 7, 706 Sort -564, 211891, -5 in decreasing order. 211891, -5, -564 Sort 290, 779, 43, 3. 3, 43, 290, 779 Sort 8, 0, 21995, 64. 0, 8, 64, 21995 Sort 436, -0.5, -950 in descending order. 436, -0.5, -950 Sort 1/7, -93, 0.2, 30, 58 in increasing order. -93, 1/7, 0.2, 30, 58 Put -20343, 225, 3, 5 in decreasing order. 225, 5, 3, -20343 Put 2, -3, 96, -0.1, 5, -119, -0.2 in decreasing order. 96, 5, 2, -0.1, -0.2, -3, -119 Put 189354, -3, 0.1, 0.3, 155 in decreasing order. 189354, 155, 0.3, 0.1, -3 Sort -20, 0.85, -569, 3, -1 in descending order. 3, 0.85, -1, -20, -569 Put 30, 8, 27, 0, -35, -2 in decreasing order. 30, 27, 8, 0, -2, -35 Sort 0.5, -47542, 7/3, 7 in decreasing order. 7, 7/3, 0.5, -47542 Sort 2/58647, 0.3, 91 in increasing order. 2/58647, 0.3, 91 Sort 1, 21, -72, 0, -481, -5, -3 in decreasing order. 21, 1, 0, -3, -5, -72, -481 Put 2, -1, 3/5, -8/5, 6/53, -7/4 in descending order. 2, 3/5, 6/53, -1, -8/5, -7/4 Put -21, 2, 45, -0.2, 4/7, 1 in ascending order. -21, -0.2, 4/7, 1, 2, 45 Sort -874, 19, -31 in ascending order. -874, -31, 19 Put -5, 9, 4, 110, -13, -3 in decreasing order. 110, 9, 4, -3, -5, -13 Sort -10803, 23, -4, -400. -10803, -400, -4, 23 Put 1, 70, 372, 3 in decreasing order. 372, 70, 3, 1 Put 867, -1279.5, 0.3 in increasing order. -1279.5, 0.3, 867 Sort -5, 855, 31, 0.73 in ascending order. -5, 0.73, 31, 855 Sort -17, 4886, -5, 5, 12, -9 in ascending order. -17, -9, -5, 5, 12, 4886 Sort 10945, 5, 1/2, 53/67. 1/2, 53/67, 5, 10945 Sort -2, -844, -5196 in increasing order. -5196, -844, -2 Put 3, -4, -1, 1802, -801 in descending order. 1802, 3, -1, -4, -801 Sort 92, 3, -2, 3084, 14, -3 in descending order. 3084, 92, 14, 3, -2, -3 Put -684, -38, -5983 in increasing order. -5983, -684, -38 Sort -0.4, 0.4, -8, -524, 1467 in decreasing order. 1467, 0.4, -0.4, -8, -524 Sort -44/57, 1/4, 546 in decreasing order. 546, 1/4, -44/57 Put -280/3, -1/43, -13/57, 5 in decreasing order. 5, -1/43, -13/57, -280/3 Sort 24, -2521954, 4 in decreasing order. 24, 4, -2521954 Put 5, 22, -5, -2, -4, 43495 in ascending order. -5, -4, -2, 5, 22, 43495 Sort -5, -2/31835, -4, -1, 293 in ascending order. -5, -4, -1, -2/31835, 293 Sort 8, 1445, 149, 5, -1 in descending order. 1445, 149, 8, 5, -1 Sort 4, 0.3, 5, -0.1, -233.81. -233.81, -0.1, 0.3, 4, 5 Sort -5, 268565, 1, 2, 0 in ascending order. -5, 0, 1, 2, 268565 Sort -11, -2/7, 247, -3, -0.2, 11 in descending order. 247, 11, -0.2, -2/7, -3, -11 Put 812, 0, 19/3, 1, -56, -4 in ascending order. -56, -4, 0, 1, 19/3, 812 Sort 73, -38, 4/9, -2/5, 9/7. -38, -2/5, 4/9, 9/7, 73 Put -1/60, -44.2, 3.8, -0.3 in descending order. 3.8, -1/60, -0.3, -44.2 Sort -6, -0.04, -3/4, -51643, 2/17 in decreasing order. 2/17, -0.04, -3/4, -6, -51643 Put -9, 99, 10, 18, 0, -2 in ascending order. -9, -2, 0, 10, 18, 99 Sort 199, 12, 28, 2, 0 in descending order. 199, 28, 12, 2, 0 Sort -6, -0.043644, 2. -6, -0.043644, 2 Sort 1, 1427, -3, 65 in descending order. 1427, 65, 1, -3 Put -508, -2, 4, 5, 2, -112, 3 in decreasing order. 5, 4, 3, 2, -2, -112, -508 Put 67, 16, 1/4438 in increasing order. 1/4438, 16, 67 Put -22, 2, -18653 in descending order. 2, -22, -18653 Sort 8, -5/2, -10, 29/6, 0.27. -10, -5/2, 0.27, 29/6, 8 Put 561, 6440, -4, 0.9 in increasing order. -4, 0.9, 561, 6440 Sort 7, 2, -465, 3291, 1/3, 4, -4 in decreasing order. 3291, 7, 4, 2, 1/3, -4, -465 Sort 0.06, -2, 3, 2, 1, 957.6, 5 in increasing order. -2, 0.06, 1, 2, 3, 5, 957.6 Put 2/7, -21, -209, 82/9 in decreasing order. 82/9, 2/7, -21, -209 Put -36, 94, -2, 1, 64, 3, -1 in increasing order. -36, -2, -1, 1, 3, 64, 94 Sort -0.4, 2, 1160/7, -2712 in descending order. 1160/7, 2, -0.4, -2712 Sort -2327, -1, -80, -4. -2327, -80, -4, -1 Sort -11, -5, 226, -0.3, -4, -93 in descending order. 226, -0.3, -4, -5, -11, -93 Put 4, 1/4, -54, -100 in descending order. 4, 1/4, -54, -100 Sort -37, 3, -92, -44, -0.7. -92, -44, -37, -0.7, 3 Sort -4, -463, -22/3, -40 in descending order. -4, -22/3, -40, -463 Put -1, 175, -2, 21, -9 in descending order. 175, 21, -1, -2, -9 Put 12, 0, 82, 1/5, 3, 13, 0.05 in increasing order. 0, 0.05, 1/5, 3, 12, 13, 82 Sort -2, 5, 0.106, -3, -23 in increasing order. -23, -3, -2, 0.106, 5 Sort -63, -89593, -1/5 in descending order. -1/5, -63, -89593 Put 4.18, -241/6, -30 in ascending order. -241/6, -30, 4.18 Put -370, -94962, 0 in descending order. 0, -370, -94962 Sort -4, -37, 7340. -37, -4, 7340 Sort 2, 6, -5, -42, 120, 0, -3 in descending order. 120, 6, 2, 0, -3, -5, -42 Put 245, 2, -1, -28, -98 in descending order. 245, 2, -1, -28, -98 Put 6, -1, 21, 40, -292, 3, 2 in ascending order. -292, -1, 2, 3, 6, 21, 40 Sort -3, 1/7, -38, 0.162, 232 in increasing order. -38, -3, 1/7, 0.162, 232 Sort -2427, 12, 4, -3, 2/3, 3/4 in decreasing order. 12, 4, 3/4, 2/3, -3, -2427 Sort -4/3, 2/3, 13583710. -4/3, 2/3, 13583710 Put -15, 60, 2, -3794 in ascending order. -3794, -15, 2, 60 Put 0, 4065, 2, 297 in decreasing order. 4065, 297, 2, 0 Put 3, -3, -6, 4, -1258 in decreasing order. 4, 3, -3, -6, -1258 Sort -5, -4137, 3, 4, 0, -2, 1. -4137, -5, -2, 0, 1, 3, 4 Sort -5, 4390, 2344, -4 in increasing order. -5, -4, 2344, 4390 Sort -58334, 0, -1442 in descending order. 0, -1442, -58334 Sort -2/7, 21073905, -2 in descending order. 21073905, -2/7, -2 Sort -72, 1, -1/4, -2/339, -6 in descending order. 1, -2/339, -1/4, -6, -72 Sort 657, 17, 5, 3 in decreasing order. 657, 17, 5, 3 Put 2, -2, 3, 174, 73 in descending order. 174, 73, 3, 2, -2 Put -2/25, 97, 0, -3/4, -2/2923 in descending order. 97, 0, -2/2923, -2/25, -3/4 Put 5518, -6066, -4 in decreasing order. 5518, -4, -6066 Sort -114, 5, -1, -40, -567 in decreasing order. 5, -1, -40, -114, -567 Sort 18, 1228/9, 0.1, -1/5, 4, -6. -6, -1/5, 0.1, 4, 18, 1228/9 Put 364, -0.5, -37, 2/11, 0.19 in increasing order. -37, -0.5, 2/11, 0.19, 364 Put 0, 1, -3, -49, 4, 3, 23 in descending order. 23, 4, 3, 1, 0, -3, -49 Sort 99.6, 42.01, 4, -0.04 in decreasing order. 99.6, 42.01, 4, -0.04 Sort 4, 0.1, -28555/19 in ascending order. -28555/19, 0.1, 4 Put -0.4, 0.01, 0.09, 20173, 12 in increasing order. -0.4, 0.01, 0.09, 12, 20173 Put 2/11, 2, 1, -2/35, -3/7, -2/33 in descending order. 2, 1, 2/11, -2/35, -2/33, -3/7 Sort 0, -3, -96302, 9 in ascending order. -96302, -3, 0, 9 Put -5, -2/5, -2/3, 3.155, -0.3296 in decreasing order. 3.155, -0.3296, -2/5, -2/3, -5 Sort 0, 0.5, -16, 247, -7740 in ascending order. -7740, -16, 0, 0.5, 247 Sort 5, 3, 0, -1/2, -0.34902 in descending order. 5, 3, 0, -0.34902, -1/2 Sort -373, 2, -1/20, 3, -0.2, -0.13 in decreasing order. 3, 2, -1/20, -0.13, -0.2, -373 Put 13, -10, 26, 0.01, 2/65, -1 in descending order. 26, 13, 2/65, 0.01, -1, -10 Sort -307/16, 9/10, -0.1, 9 in descending order. 9, 9/10, -0.1, -307/16 Sort -20, 1, -1, -13, 9, -9 in increasing order. -20, -13, -9, -1, 1, 9 Put 13/5, 2/65, 4/15, 0, 5, 3, 0.5 in increasing order. 0, 2/65, 4/15, 0.5, 13/5, 3, 5 Sort -3, -212, 4, 36, -73 in descending order. 36, 4, -3, -73, -212 Put 4, 1212, -3, 71, 3, 2, -5 in descending order. 1212, 71, 4, 3, 2, -3, -5 Sort -3, -14543, 201 in ascending order. -14543, -3, 201 Sort -6, -3, 3/5, 55, -3.7, -0.55 in decreasing order. 55, 3/5, -0.55, -3, -3.7, -6 Sort -27, -4, -2/5, 0.4, 3/2, 2 in increasing order. -27, -4, -2/5, 0.4, 3/2, 2 Put 0.148, 18, -1918, -12 in decreasing order. 18, 0.148, -12, -1918 Put -373, -290, -1346 in increasing order. -1346, -373, -290 Put -368.956, 0.4, 7 in descending order. 7, 0.4, -368.956 Put 4, -21, 5, -2, -4, -16, 0 in descending order. 5, 4, 0, -2, -4, -16, -21 Put 2355.75, 1, -13/3 in decreasing order. 2355.75, 1, -13/3 Put -961, -5, -3, 1, 5, 74 in increasing order. -961, -5, -3, 1, 5, 74 Sort 2/29, 0.1, -3416.86 in ascending order. -3416.86, 2/29	{ "pile_set_name": "DM Mathematics" }
+ q + 18 - 2. What is the units digit of h(i)? 8 Let d(y) = y*2 + 3y - 1. What is the units digit of d(2)? 9 Let k = 240 + -171. Let b be k/(-12) - 1/4. Let i(j) = j*2 + 5j + 3. What is the units digit of i(b)? 9 Suppose -337 = -3v + 5y, 5v - 5y - 95 = 470. What is the tens digit of v? 1 Let p(a) = -2a3 - 8a*2 + 10a - 1. What is the hundreds digit of p(-7)? 2 Suppose 4 + 111 = 5s. Let i = s + -13. What is the tens digit of i? 1 Let x(u) be the third derivative of -u4/3 - u3/6 - 3u*2. What is the units digit of x(-3)? 3 Let x(d) = d. Let w be 4/(-10) + (-4)/(-10). Suppose w = 5i - 4k - 30, -2i + 6i - 24 = 3k. What is the units digit of x(i)? 6 What is the tens digit of 6141/92 + (-6)/8? 6 Let n(t) be the third derivative of -t5/60 + t4/4 + 2t3/3 - 2t*2. Suppose 4s + 5u = s + 10, -4s - 5u + 15 = 0. What is the units digit of n(s)? 9 Let q(t) be the first derivative of 2t*3/3 - 3t*2/2 + t - 2. Let l be q(2). What is the units digit of l/(-12) - 26/(-8)? 3 Let m be -2 + 15/(-9)-3. Suppose -6q - 3w = -3q - 21, -11 = -mq - w. What is the units digit of q? 2 Suppose p - 60 - 5 = 0. What is the units digit of p? 5 Suppose -4l = 4, -5p + 4l + 6 + 8 = 0. Suppose -3v - pr + 107 = 0, -v + 0r + 37 = 2r. What is the tens digit of v? 3 Let p(g) = g2 + 4g. Let u be p(-4). Suppose u = 5h - 14 - 6. Suppose 2x + 25 = 3w - 12, -w = hx + 11. What is the units digit of w? 9 Suppose 3v - 33 = 3q, -q - 10 = q. Suppose 30 = -d + vd. Suppose -2u - 4 = 0, u - du + 11 = 3t. What is the units digit of t? 7 Let x be -2 - (0 + 9-3). Let a = -43 + 61. Let l = x - a. What is the units digit of l? 7 Let k(s) = s3 + 11s*2 - 13. What is the units digit of k(-10)? 7 Suppose 5c + 4v - 43 = 0, -3c + 17 = -2v - 0v. Let b = 8 - 5. Let t = c - b. What is the units digit of t? 4 Suppose 0 = 30t - 31t + 185. What is the units digit of t? 5 Let m(o) = -o*3 + 2o - 1. Let h be m(5). What is the units digit of (h/10)/((-2)/5)? 9 Let q be 19/(-3)2. Let j = q - -8. What is the units digit of j? 2 Suppose -14 = 3k - g + 9, -4k + 2g = 32. Let i = k - -12. Suppose -l + 0l = -i. What is the units digit of l? 5 Suppose 0 = -z + 38 + 18. What is the units digit of z? 6 Let c(u) be the second derivative of u*4/6 - 11u*3/6 + 9u*2/2 + u. Let y be c(8). Suppose 2w + 3a - 2a = 41, 3w - y = a. What is the units digit of w? 8 Let d = 5 + -8. Let p be d(3 - (-20)/(-6)). What is the units digit of 0 - p/(3/(-6))? 2 Let h(r) = -9r3 + r2. Let m be h(-1). Let n be m/(-25) - (-34)/10. What is the units digit of 5 - (3 - (n + -2))? 3 Let s(t) = t - 2. Let u be s(2). Suppose uo = 2o - 28. What is the units digit of o/2 + (-6 - -3)? 4 Suppose q + q = -4w + 698, -w - 2q + 182 = 0. Suppose 3s - w = -52. What is the units digit of (-16)/s + (-94)/(-10)? 9 Let k be (7 - -1)/(10/(-20)). What is the units digit of (-24)/k4/3? 2 Let d(b) = -4b + 53. What is the units digit of d(-15)? 3 Let m = 14 - 10. What is the units digit of (18/m)/((-7)/(-14))? 9 Suppose t = -3m + 8, -2m - m + 2t = -2. Let r be (-1)/(-2) - (-52)/(-8). What is the units digit of m/(-6) - 8/r? 1 Suppose -3r = 7 + 8. What is the units digit of 2/r - 284/(-10)? 8 Let l = -14 - -51. What is the tens digit of l? 3 Let v be ((-4)/10)/((-1)/10). What is the tens digit of (-13)/((-2)/v1)? 2 Suppose 3991 = 19c - 6c. What is the hundreds digit of c? 3 Let i(o) = o3 - 8o*2 + 10o - 1. Suppose -4z - 40 = -4l, -l + 5 = -2z - 8. What is the units digit of i(l)? 0 Suppose -c + 0w + 11 = 4w, 5w = 4c - 2. Let v(m) = 3m. What is the units digit of v(c)? 9 Suppose 2t - t - 5c = 27, -t - 3 = c. Let z be (-511)/(-1). Suppose -l - z = -tl. What is the units digit of l? 5 Suppose -f + 2q = -2q - 151, -5f = -4q - 771. What is the tens digit of f? 5 Suppose -345 + 15 = 5f. What is the units digit of f/(-14) + 6/21? 5 Let u = -81 + 148. What is the tens digit of u? 6 Let m be (-1)/5 - (-122)/10. Let r be (1/(-2))/(3/m). What is the units digit of (-7)/(-3) - r/(-6)? 2 Suppose 2q = -3 + 1, 2 = -b + 5q. What is the units digit of (-22)/b + 9/(-63)? 3 Let z = -15 + 1. Suppose k + 3 = n + 21, -6 = 2k. Let a = z - n. What is the units digit of a? 7 What is the units digit of (-1)/(-1) - (-26 + 22)? 5 Suppose 2i - 57 = 57. Suppose -7 = 2z - i. What is the units digit of z? 5 Suppose 8 = 2l - 2y, -2 = -2y + 4. What is the units digit of l? 7 Let c be 4/(-18) - 8/(-36). Suppose y - 5y + 28 = c. What is the units digit of y? 7 Let x = -13 + 19. Let u(b) = -b2 + 7b + 1. What is the units digit of u(x)? 7 Suppose 0 = -3w - 6, -4o + 0w = 4w - 96. What is the tens digit of o? 2 Let k(d) = d*2 - 6. Let b(y) = -10y*2 + 65. Let p(s) = 6b(s) + 65k(s). Let c(h) = h3 + 3h*2 + 1. Let j be c(-3). What is the units digit of p(j)? 5 Suppose -s = 4i + 7, i = -3s + 6 + 6. Let y = s + 1. Suppose 0 = 3h - 2p - 9 - 34, -h + y = p. What is the tens digit of h? 1 Let w be 4/18 + 222/(-27). Suppose -u - 5 - 6 = 0. Let f = w - u. What is the units digit of f? 3 Suppose 2m - 108 = 116. Suppose -3o = -4o + 4g + 44, 3o - 2g - m = 0. What is the units digit of o? 6 Let c = 0 - 3. Let i = 1 - c. What is the units digit of i? 4 Suppose 0 = i - 6 + 2. Suppose 0 = -iw + 2w + 2. Suppose 2 = 3o - w. What is the units digit of o? 1 Suppose -3w = 5q - 11, 0w - 16 = -2w + q. Let t = -2 + 20. What is the units digit of t/14 + (-2)/w? 1 Let y be 9/31/1. Suppose yv + 8 = 2. What is the units digit of ((-6)/(-4))/((-1)/v)? 3 Let i be (-10 - -2)/(-2 + 0). Suppose -ib = -15 - 1. What is the units digit of b? 4 Let y = 468 - 194. What is the hundreds digit of y? 2 Let c(w) = 7w*2 - 3w - 7. What is the tens digit of c(-5)? 8 Let s(v) be the second derivative of v4/6 - v3/2 + v. Suppose -g - 4b - 6 = 8, 4g = -4b - 8. What is the units digit of s(g)? 2 Let k = 177 + -38. What is the units digit of k? 9 Suppose -5y - i = -0i - 99, -5y + 95 = 5i. What is the tens digit of y? 2 Suppose 4q - q = -2d + 671, -4d = 4q - 1336. What is the hundreds digit of d? 3 Let v(w) be the third derivative of w5/12 + w3/6 - 2w*2. Let r be v(1). Suppose n - 2n = -r. What is the units digit of n? 6 Let k = 44 + 47. What is the units digit of k? 1 Let m(d) = -7d - 20. What is the tens digit of m(-10)? 5 Suppose -3x - x - 32 = 0. Let b = -6 - x. Suppose 0 = 3j - 4u - 35, bj + 3j - 5 = -4u. What is the units digit of j? 5 Suppose -18 = 4q + 38. Let h = 16 + q. What is the units digit of h? 2 Let c be ((-6)/(-4))/((-7)/(-14)). Suppose 2w + 5m = 40, m = cw + 1 - 27. What is the tens digit of w? 1 What is the units digit of (2/(-6))/((-10)/1110)? 7 Let l(c) be the second derivative of c4/2 - c2/2 + 2c. Let b be l(1). Suppose -4m = -4d + 4, -bd + 17 + 9 = 2m. What is the units digit of d? 4 Let d = -96 + 121. What is the units digit of d? 5 Let w = -8 - -13. Suppose wv - 4r + 0r = 13, r + 7 = 2v. Suppose -vy + 38 = -12. What is the units digit of y? 0 Let w(i) be the second derivative of -i5/20 + 13i4/12 + i3/2 - 3i2 - 8i. What is the tens digit of w(13)? 3 Suppose 4n = 5n - 18. What is the units digit of n? 8 Let f(l) = 2l - 9. Let q(s) = -1 + 3s*2 + 0 + 5s*2. Let b be q(-1). What is the units digit of f(b)? 5 Let s be (-3626)/(-30) - (-4)/30. What is the units digit of (-24)/(-60)(s - 1)? 8 Let p(f) be the third derivative of f5/60 - f4/8 + 2f3/3 - f2. What is the units digit of p(5)? 4 What is the units digit of (-96)/(-2) + 2 + 2? 2 Let g(c) = -c - 5. Let q be g(-6). Suppose -2f - 5 = -3f. Let y = q + f. What is the units digit of y? 6 Suppose -2c - 3p = -p - 204, 0 = -p - 5. What is the hundreds digit of c? 1 Suppose 2l - 3z = -2, 4l + 2z - z = -4. What is the units digit of -3 + 6 - (l + -14)? 8 Let u be 24/9 - (-4)/(-6). Suppose uj - 10 = -0j. Suppose 44 = 3h + h - 3n, 5n - 20 = -jh. What is the units digit of h? 8 Suppose -2j + 20 = 3j. Suppose jk - 24 = -2l, 16 = 2l + 5k - 12. What is the units digit of l? 4 Let c be -2 + 3 - (-3 + 0). Suppose -h - ch + 92 = 3u, 2u - 2h = 56. What is the tens digit of u? 2 What is the tens digit of ((-6)/9)/((-1)/48)? 3 Suppose -5	{ "pile_set_name": "DM Mathematics" }
b = z - 4.9. Let y = -13 + 13.4. Sort -3, b, y in decreasing order. y, -3, b Let a be (-37)/(-9) + 6/(-54). Sort a, -1, -31 in ascending order. -31, -1, a Let u(p) = -32p + 77. Let j be u(2). Put 2/5, j, -0.07 in descending order. j, 2/5, -0.07 Suppose -617c = -615c - 2. Let o = 0 - -5. Sort o, -5, -2/13, c. -5, -2/13, c, o Let c be 2((-6)/(-2) - -1). Let a = 33.63 + -34.63. Sort c, 1/2, a, 0 in ascending order. a, 0, 1/2, c Let q = 8.5 - 49.5. Let i = q + 45. Put 2/9, i, -4 in ascending order. -4, 2/9, i Let c = -1283 - -1280. Put -1, c, 5, 43 in descending order. 43, 5, -1, c Suppose 0 = -5m - 5x + 210, 2m - 92 + 0 = -4x. Let o = -36 + m. Put o, -25, 5 in decreasing order. 5, o, -25 Let f be 94(0 + (-2)/(-4)). Let w = f + -49. Sort 3, 5, 6, w in descending order. 6, 5, 3, w Let o(b) = -b3 + 5b*2 - b - 4. Let r be o(4). Let h = 7 - r. Sort 4, h, 2. h, 2, 4 Let l = 61/355 + 2/71. Let a = -1.9 - -4.9. Let u be 64/84 - -22/(-12). Sort a, l, u in descending order. a, u, l Let b be 6/(-18) + 45/297. Put 68, 2/5, b, 0.2 in descending order. 68, 2/5, 0.2, b Let m = 150 + -90. Let s be 288/m - ((-8)/(-10) + -1). Put 4, s, -2 in ascending order. -2, 4, s Let u be (2/6)/((-1)/(-39)). Let b = 8 - u. Sort b, 1/3, 2/5. b, 1/3, 2/5 Let d(n) = -n*3 - 7n*2 + 7n - 11. Let y be d(-8). Let f = -0.1 - 1.9. Let v = f + 1. Put y, v, 1/2 in decreasing order. 1/2, v, y Suppose 5l = 6l + 3. Suppose -4m - m - 5 = 0. Let p be (-1)/(-8) - 136/64. Put l, p, m in decreasing order. m, p, l Let t be (-6 - -5) + (-28)/(-2). Suppose -u + 3d = 3u + t, u = 2d - 2. Sort 1, u, -6 in descending order. 1, u, -6 Let o = 84 - 49. Let x be (-14)/3010/o. Let w = -444.9 + 445. Sort w, 0.3, x in ascending order. x, w, 0.3 Let p = 691 + -690. Put -0.01, 5, p, 3 in increasing order. -0.01, p, 3, 5 Suppose 72 + 1 = 73q. Let s(t) = t*3 + 5t*2 - t - 3. Let c be s(-5). Put c, -5, q in descending order. c, q, -5 Let a = -1.06 + 9.16. Let r = a - 12.1. Put -0.1, -1/5, 0.7, r in increasing order. r, -1/5, -0.1, 0.7 Suppose 1 + 1 = -2k. Let g = -11 - -2. Let r = g + 7. Put r, k, 0 in decreasing order. 0, k, r Let x = 63 - 61. Let y be 1/((-4)/(-8)x1). Put -1, y, 2 in descending order. 2, y, -1 Let g = 30 + -12. Let c = g + -15. Suppose -f - 10 = -cf. Sort -4, 1, f in ascending order. -4, 1, f Let b(q) = q2 + 37q + 74. Let i be b(-35). Put 31, 2, -1, i in decreasing order. 31, i, 2, -1 Let m(b) = -2b + 10. Let t be m(9). Let g be (2 - (-1 + 4)) + -2. Put 5, g, -4, t in decreasing order. 5, g, -4, t Let t be 6(0 - (-1)/(-1)). Let k = -9 - t. Sort k, -0.5, 0.6. k, -0.5, 0.6 Suppose 2w + 2w - 16 = 0. Let c(n) = -n*3 + 5n*2 - 3n. Let o be c(w). Suppose ov - 8 = -0. Sort 8, -4, v in increasing order. -4, v, 8 Let s = -8.02 + 0.02. Let d be (-4)/(-10) + 256/(-620). Let j = -163/620 - d. Sort s, -0.5, j in ascending order. s, -0.5, j Let j(w) = -5w*3 - 2w*2 + 12w + 13. Let k be j(-1). Let s(x) = -x + 10. Let r be s(7). Sort -1, k, r in ascending order. -1, r, k Let j = 9 - 5. Let l = -6945 + 6943. Sort 5, l, -3, j. -3, l, j, 5 Let h(y) = y*2 - 14y + 18. Let i be h(12). Let p be i/15 + (-44)/(-10). Sort -23, p, 5, 1 in decreasing order. 5, p, 1, -23 Let d = -1138/19 - -60. Suppose -4j - 2m + 252 = 30, 5j = m + 295. Let s = j - 176/3. Sort s, -2, d in descending order. d, s, -2 Let i be (-17)/(2295/18) + (-8)/(-10). Put 20/7, -5, i in descending order. 20/7, i, -5 Let x = 28 + -28. Let q = -16 - -19. Suppose 21 = qm - xm. Put -3, m, -4 in decreasing order. m, -3, -4 Let a = -0.11 + 0.29. Let x = a + -0.68. Let b = 8 - 5. Sort b, x, 4 in decreasing order. 4, b, x Let d = -0.2 - 3.8. Let f be (12/24)/((-1)/(-10)). Suppose 3n - fw = -0w - 34, 3w = -2n - 10. Sort d, -0.2, n in decreasing order. -0.2, d, n Let b be 1/(-6 - (-308)/52). Sort b, 1, 3. b, 1, 3 Suppose 3p - 2v + 4v - 7 = 0, p = 2v - 11. Let x = -6 + 10. Sort p, x, -2, 2 in ascending order. -2, p, 2, x Suppose m + 2 = 0, -r - 3r - m = 6. Let v = -992 - -970. Sort r, v, 3 in descending order. 3, r, v Let m = 0.811 - -40.289. Let d = 41 - m. Put -7, d, -0.3 in increasing order. -7, -0.3, d Let u = 16 - 10.1. Let d = u - 5.8. Put 25, d, 4/7 in increasing order. d, 4/7, 25 Let u(s) = -s2 - 6s - 6. Let l be u(-4). Let v be -3(-2 - (-1 - 0)). Let t = -8 + 3. Sort v, t, l. t, l, v Let z = 931 - 933. Sort 15, 3, z, -5 in increasing order. -5, z, 3, 15 Let h = 1.653 + -15.583. Let b = 6 - -8. Let z = b + h. Put 1, -1/5, z in decreasing order. 1, z, -1/5 Let i = 16 + -33. Let d(b) = -2b + 8. Let y be d(-6). Let s = i + y. Put -3, -0.2, s in ascending order. -3, -0.2, s Let k be -1 + (24/(-36) - 1/3). Suppose -10j - 24 = -6j. Let v = 9 - 5. Put j, k, v in descending order. v, k, j Suppose -w = 4j - 16, -2w = 3w + 5j - 110. Suppose 609 = -16t - 5t. Let f = t + w. Put f, 5, 1/3 in increasing order. f, 1/3, 5 Let z be 8/(-20) - 1116/(-40). Let a be -1 + 0/((-2)/2). Put z, 5, 1, a in ascending order. a, 1, z, 5 Let x(l) = 6l - 7. Let k be x(2). Let w = -25 + k. Let m = w + 16. Sort m, 3, -2. m, -2, 3 Let q = 22 + -58. Let d = -77 + 115. Let a = d + q. Sort -1/2, a, -5 in decreasing order. a, -1/2, -5 Suppose -5i - g = -29, -4i + 5i + 2g = 4. Let j = 77 + -77.5. Sort j, i, 0.5. j, 0.5, i Let x be (5 + -4 - 3) + -2. Let a be 7 + 4 + x - 3. Sort 9, 2, a, -1 in increasing order. -1, 2, a, 9 Let x = -3452 + 3452.1. Let m = -819/11 + 61771/836. Let b = 6/19 + m. Sort -0.3, b, x in descending order. x, b, -0.3 Let u = 4 + 1. Suppose 5 = -3m + un - 0, -4n = -3m - 7. Let x = 93 + -89. Put m, x, -3 in decreasing order. x, -3, m Let q be (-10)/(-3) + 17/(-51). Sort 3/5, 2/7, 6/7, q in descending order. q, 6/7, 3/5, 2/7 Let k(p) = p*3 + 6p*2 + 7p + 12. Let g be k(-5). Suppose 15 = -6n + 3n. Sort 4, g, n, -1 in decreasing order. 4, g, -1, n Let j(h) = -h*3 + 8h*2 + 2h - 10. Let x be j(8). Let k = -8 + 9. Let r be k(-7)/(7/(-2)). Put r, x, 3 in decreasing order. x, 3, r Suppose -b - 5 = -6b, -b = -5j - 36. Put -5, j, 5 in decreasing order. 5, -5, j Let x(r) be the second derivative of r4/12 + r3 + r2 + 6r. Let h be x(-6). Sort 0.2, h, 0.21 in ascending order. 0.2, 0.21, h Let c = 0.06 + -17.06. Let f = 17.054 + 0.146. Let x = f + c. Put 0.3, -1, x in descending order. 0.3, x, -1 Let r be ((-6)/(-18))/((-2)/18). Sort 0.3, 3, r, -1/7 in ascending order. r, -1/7, 0.3, 3 Suppose 5l = -m - 54, l = -3l - 2m - 42. Let j be 36/(-5) - 4/(-20). Let q = j - -8. Put l, q, -1 in decreasing order. q, -1, l Let s = -10 + 41/4. Put s, -8, 3 in ascending order. -8, s, 3 Let i = -1/259 - -263/1036. Let m(d) = -d2 + 2d - 1. Let b be m(3). Let h be (-30)/b(-2)/(-10). Sort 0.4, h, i in decreasing order. h, 0.4, i Suppose w = 23 - 20. Suppose 0 = -i - 4i + 25. Put 0.5, 0.1, w, i in descending order. i, w, 0.5, 0.1 Let c = 13.7 + -9.44. Let v = c + -0.26. Let h = -1.5 + 2. Sort h, v, 1/3 in decreasing order. v, h, 1/3 Let r(f) = -f*3 + 7f*2 + 3f - 5. Let p be r(1). Suppose 0 = 5t + 4n - 2n + 21, 4t + 3n + 14 = 0. Put 0, p, t in decreasing order. p, 0, t Let d = 37 + -36.5. Put -2, 2, d, 3 in descending order. 3, 2, d, -2 Let b(v) = -7v - 325. Let n be b(-46). Put -5, 4, n in decreasing order. 4, n, -5 Suppose 0 = -w + 6w + 10. Let k be (w/(-2) - 1)-1. Put k, -1, 1 in descending order. 1, k, -1 Let p = 26 - 26.8. Sort 4/9, 1, p in ascending order. p, 4/9, 1 Let g(j) = -63j + 121. Let m be g(2). Sort -15, -4, m, 2 in decreasing order. 2, -4, m, -15 Let i be ((-6)/(-5))/((-2)/(-5)). Let z = 2616 - 2620. Put -3, i, z in decreasing order. i, -3, z Let u = 15.73 - -0.27. Let n = -15.9 + u. Let b = -3.1 + n. Put -4, -1, b in ascending order. -4, b, -1 Let i(k) = k + 2. Let x be i(0). Let f be (-12)/48 - x/8. Put -3, -3/4, f, 0.4 in decreasing order. 0.4, f, -3/4, -3 Let p = -0.752 + 1.752. Put -51, 3/4, p in increasing order. -51, 3/4, p Suppose -2u + 14 = -2h, 5h - 4h = 5u - 23. Let j(x) = x*2 - 4x - 3. Let d be j(4). Let y be (-1 - d)/(4/(-8)). Sort u, y, -3 in ascending order. y, -3, u Let f(i) = -i*2 + 23i - 125. Let h be f(8). Sort h, 4, 186, 1. h, 1, 4, 186 Let v(r) = -r*2 - 29r + 211. Let d be v(6). Let u = -4 + 3.8. Sort u, -6, d in decreasing order. d, u,	{ "pile_set_name": "DM Mathematics" }
p + 35, 2p + 236 - 26 = 6w. Solve 0 = -253f + 248f + w for f. 7 Suppose -5m + 156 = -19m + 226. Solve 1363 = mu + 1378 for u. -3 Let b be (1 - 2/5) + (-2313)/(-45). Solve -55k - 3 = -bk for k. -1 Suppose -524l = -523l - 2n - 26, -5l = 6n + 62. Suppose 4r + 0 = 16. Suppose 3y + 9 = rb, -b - 9 = 3b + 3y. Solve -3w + 1 + l = b for w. 1 Suppose 3b - 2 = 7. Suppose -6y + y - 4j + 37 = 0, -4y - bj + 29 = 0. Suppose 5 = -2r + 3k, 0 = 5k - 4k - y. Solve -ri = -i - 8 for i. 2 Suppose 2b + 0 - 6 = 0. Let d(c) = 2c - 1. Let x be d(b). Let j = -835243 + 835259. Solve 9 + j = xg for g. 5 Suppose 31j + 31x = 32j - 248, 24 = 4j - 3x. Let d = 4 + 30. Solve j = 30c - dc + 12 for c. 3 Suppose u - 15 - 21 = -4a, 0 = -5a + 3u + 28. Suppose ay = 6y - 5y. Solve yv - 10 = -2v for v. 5 Suppose l = 4i + 11, -70 = 8l - 13l + 5i. Solve -ly + 21y = -12 for y. -2 Let l = 7210 + -1256. Suppose -3c - 5948 = -l. Let g be (-1)/(2/(-2)) + 0. Solve cf = -g - 1 for f. -1 Suppose -q + 2g + g = -2, 2q = -4g + 24. Let o be (11 - 6) + -6 - (3 - q). Solve -om = -9m + 10 for m. 2 Let g(o) = 2o + 28. Let k(p) = -2p*2 - 7p + 1. Let s be k(-5). Let n be g(s). Suppose -4d + 5 - 1 = 0. Solve -u - d = -n for u. -1 Let h(r) = -13. Let b(j) = j + 70. Let y(o) = b(o) + 4h(o). Let p be y(-12). Let a = -4 - -6. Solve -ak = -0k + p for k. -3 Let l(n) = 204n - 816. Let m be l(4). Solve m = -24q + 21q + 21 for q. 7 Let p(c) = -c3 - 4c*2 - 6c + 5. Let g be p(-3). Let r be (39/(-9))/((-1)/3). Let u = g - r. Solve d = -4 - u for d. -5 Suppose 6x = x + 105. Let y(i) = -31i - 11i2 - x + 27i + 12i2. Let s be y(7). Solve s = -r - 3 - 0 for r. -3 Let c be 10/((2/(-4))/(-1)). Suppose 4s + 0s - 2l = 16, -2s + c = 5l. Solve -sx + 14 - 4 = 0 for x. 2 Let g be 2396/13777 - 8/46. Let v = 7 - -2. Solve g = u + 7 - v for u. 2 Suppose -18x + 11x = -322. Suppose -4l + x = -2l. Suppose -l = 4r - 83. Solve 2m + 3m = -r for m. -3 Let n(q) = -q*3 + 3q*2 + 2q - 1. Let y be n(3). Suppose -4o = -3m - 98 - 59, -4m = -4. Solve -13w - o = -yw for w. -5 Suppose r = 5n - 33, n - 3r - 11 = 4. Suppose nd = 9d - 6. Suppose -15 = -2o + 1. Solve -2h - o = dh for h. -2 Let k = -13818 - -13872. Solve -k = 36n - 27n for n. -6 Let g = 58 + -54. Suppose -2q + 2n - 4 = 0, -5 = q - gn - 0. Let d be 2/41(q + 1). Solve r + 3r = d for r. 0 Suppose 4w + 3z - 1 = 4, 2z = -2w. Suppose wu - 5 = 5. Let s(m) = 111m + 333. Let r be s(-3). Solve r = 5a - ua for a. 0 Suppose 0 = -s + 9 - 4. Let v be (84/126)/(2/36). Suppose 4l - 3z - v = 0, 5l = -0z + z + 4. Solve l = sx - 12 + 27 for x. -3 Suppose -15 = -8p + 9. Suppose pa - 2c = 2 + 2, -2a + 2c + 2 = 0. Suppose -au = 5w + 1, w = 4u - 10 + 1. Solve -ur = -5r for r. 0 Suppose -3s + 57 = 2f, -3f + 37 = 5s - 59. Suppose 21m + 20 = 25m - 4v, -3m + s = -5v. Solve x = mx + 4 for x. -4 Let s = -714 - -616. Let v be 11 + (9 - s/(-7)). Solve -v = k - 4 for k. -2 Let n(q) = -q2 - q - 1. Let h(r) = 3r*2 - 21r - 4. Let s(b) = -h(b) - n(b). Let f be s(11). Solve -2d + d - f = 0 for d. -5 Let y be 450/6613 - (-25)/((-2475)/(-36)). Solve ya = 97a - 72 for a. 9 Let w be ((-8)/((-32)/(-10)))/((-1)/2). Let d(v) be the first derivative of -v*2/2 + v - 16. Let h be d(-1). Solve wf - h = -17 for f. -3 Let w = -2 - -7. Let s be ((-4)/w)/((-2)/5). Suppose -su + u + 3 = 0. Solve u = p - 2 for p. 5 Let r = -318 + 322. Suppose o + r = 0, 3k - 12o + 16o - 17 = 0. Solve 0 = -3t + 2 - k for t. -3 Let q be (3 + -4 - 4 - (-42)/21)/(-1). Solve -33j = -qj for j. 0 Let a(u) = u3 + 4u*2 - 46u + 128. Let i be a(3). Solve ik = k - 416 for k. -8 Suppose 10p - 5p = 3r + 9, -5r - 2 = -4p. Suppose -9s + 5s = -2t - 4, -t - 4 = -ps. Solve -s = 2u - 0 for u. -1 Suppose 25b + 2s + 74 = 30b, 4b + 4s - 48 = 0. Solve -b = 2g - 9g for g. 2 Let w(o) = o*3 + 22o*2 + 33o + 776. Let k be w(-22). Solve 4a = ka + 92 for a. -2 Let q(r) = -r3 - r2 + 2r. Let p be (-8)/(-14) + 24/(-42). Let d be q(p). Suppose 2v - v - 3 = d. Solve -vc - 2 - 4 = 0 for c. -2 Let m(g) = 22g3 + g2 - g - 1. Let f be m(-1). Let u = 23 + f. Suppose -3 = -ub + 1. Solve -bk = -k for k. 0 Let n be (-6)/4 + (-55)/(-10). Let o be (-1 - n) + 6(-5)/(-10). Let l(b) = 8b*2 + 11b - 1. Let r be l(o). Solve 3z = -6 - r for z. -5 Let i be -1((-12)/4 - -5). Let p be i/(-30)12 - (-92)/10. Solve p = 5x - 7x for x. -5 Suppose 24 = 10g - 116. Suppose 4i - gi + 13i = 0. Solve -24 = -it - 6t for t. 4 Suppose 0 = 80i - 780 - 340. Solve 11l - 52 - i = 0 for l. 6 Let k be 28 + (-3 - -3 - (-1 - -5)). Solve -10g = -2g + k for g. -3 Let z = 350 + -278. Suppose 0 = 149b - 157b + z. Solve -bm = -10m - 3 for m. -3 Let t = 153 - 150. Let b be t/((-9)/3)(-16)/8. Solve y = -b - 3 for y. -5 Suppose 0 = -3c + 5z + 217, -3c + 236 = c + 4z. Let y = c + -60. Solve -2b = -b - y for b. 4 Suppose -u + 6 = -0. Suppose -u = -3m + 2g, 4m - 3g - 6 = 2. Let c = 23 + -17. Solve -mx + cx = 20 for x. 5 Let q = -35 + 40. Let i be (q/(-3) + 2)3. Let k be (-2)/1 + (1 - -6 - i). Solve -k - 1 = -a for a. 5 Let u(b) = -b*3 - 15b*2 + 33b - 25. Let h be u(-16). Let j = -290 - h. Solve -4n - 15 = -jn for n. 5 Let p be 556/(-10)40/(-16). Suppose 0 = v - 3r - 46, -5r - 61 = -5v + p. Solve va = 32a for a. 0 Let u(g) = -4g + 90. Let q be u(-17). Let n = q - 156. Solve nb + 0b + 4 = 0 for b. -2 Let p(a) = -43a - 2738. Let r be p(-64). Solve 0 = -ru - 884 + 912 for u. 2 Suppose 4w - 158s + 153s - 166 = 0, w - 4s - 47 = 0. Solve -wr + 62r = -138 for r. -6 Let f = 7409 + -7374. Solve -53r = -fr + 126 for r. -7 Let h(b) = 4b*2 + 133b + 269. Let o be h(-2). Solve -23t + 119 = -o for t. 6 Let l(v) = 4v*3 - 34v*2 - 15v - 27. Let p be l(9). Solve p = -52y + 139 + 121 for y. 5 Let y be -7 - (-9 - (4 + -1 - 5)). Suppose 4h - 2a = 2h + 6, 5h - 15 = -2a. Solve -2b + yb - hb = 0 for b. 0 Let r(u) = -9. Let z(j) = j + 1. Let m(k) = r(k) + 3z(k). Let n be m(4). Suppose 4p - 5o - 30 = p, -1 = -2p - 3o. Solve ps - n = 14 for s. 4 Let x(d) = 19d - 1732. Let b be x(93). Solve 30i - 10 = bi for i. -2 Let t(c) = -6c - 72. Let m be t(-12). Suppose 20h - 38 + 18 = m. Solve -5 = -6n + h for n. 1 Suppose -38 - 5 = -u - 5c, -96 = -3u - 4c. Let p = 0 + u. Solve -13 + p = 3b for b. 5 Let u(a) = a3 - 15a*2 + 48a + 20. Let d be u(10). Let x be 408/20 - ((-24)/15 + 1). Solve -16i + xi + 25 = d for i. -5 Let c(o) = -589o - 2925. Let p be c(-5). Solve pf = 25f + 25 for f. -5 Suppose 5y - 855 = 3n + 873, 4y + n = 1396. Suppose -3a - 342 = -y. Solve l = l + al for l. 0 Let k = -25 - -13. Let a be ((-288)/k)/(3/4). Suppose 4y + 4d + d = -13, -4d - a = -4y. Solve -yx - 2x + 10 = 0 for x. 2 Let z(d) = d*3 + 9d*2 - 2d - 13. Let l be z(-9). Suppose 3j = lj - 6. Suppose -3p - 5w = -13, 5w + 2 = -j. Solve 0 = t + p - 4 for t. -2 Let n = -141 - -138. Let r be (4 - -5 - n) + -1. Solve -25 = -rw + 16w for w. -5 Suppose -2o + 10 = 4v, 3v + o - 1 = 8. Let q be 1 + (-2 - (-16)/v). Suppose -5 = 3f - 2d, 2d - 20 + 14 = 2f. Solve -5 - f = qb for b. -2 Let h = 81 - 77. Let q be 2/h(13 + -7). Solve 0 = -4b + 5b + q for b. -3 Let t be (-57)/(-11) + -3 - 4/22. Let y(m) = -9m2 - 2m. Let s be y(t). Let f be (-56)/10s/16. Solve 4l + 2 + f = 0 for l. -4 Suppose 9 = -7i + 10i. Suppose 2n = 5l - 52, 2n = il + 4n - 44. Solve l = -5j + 2j for j. -4 Let s be 5 + -3 + 15/5. Let a = -371 + 371. Solve af + sf = -25 for f. -5 Let s = -36 - -43. Suppose 9w + 1138 - 1192 = 0. Solve -s + 31 = -wq for q. -4 Suppose -37h + 102 = -53h + 33h. Let k(o) = -o*2 - 5o. Let t be k(-5). Suppose -5i = 2x - 18, -9 = 3i - 4x + 1. Solve -ib = -h - t for b. 3 Let w be 3627/(-19) + (-60)/570. Let b = w - -194. Solve 4v + 1 = bv for v. -1 Let w = 195 - 43. Let z = w + -105. Solve -3u - 53 = -z for u. -2 Let t be ((-11)/(-66)-207)/(2/(-8)). Solve 0 = 407l - 384l + t for l. -6 Let m = -266 - -292. Suppose -2a = -7s + 3s - 38, 2s = -4a + m. Solve -10p + ap + 5 = 0 for p. 5 Suppose -4i - 2o + 40 = 0, -40i - 5o - 5 = -45*i. Let s = 19	{ "pile_set_name": "DM Mathematics" }
rm of -1704, -1739, -1788, -1857, -1952, -2079, -2244, -2453? -t3 - t2 - 25t - 1677 What is the c'th term of -4755338, -4755343, -4755358, -4755389, -4755442? -c3 + c2 - c - 4755337 What is the c'th term of 6711, 6748, 6785, 6822, 6859, 6896? 37c + 6674 What is the f'th term of -9691, -9641, -9587, -9529, -9467, -9401? 2f2 + 44f - 9737 What is the l'th term of 399376, 399359, 399340, 399319, 399296, 399271, 399244? -l*2 - 14l + 399391 What is the a'th term of -278882, -278881, -278880, -278879, -278878, -278877? a - 278883 What is the p'th term of 69, 264, 549, 894, 1269, 1644, 1989, 2274? -5p3 + 75p*2 + 5p - 6 What is the a'th term of -660, -651, -636, -609, -564, -495, -396, -261? a*3 - 3a*2 + 11a - 669 What is the i'th term of -32901, -65803, -98705, -131607, -164509? -32902i + 1 What is the q'th term of -15143, -15132, -15115, -15092, -15063, -15028? 3q*2 + 2q - 15148 What is the s'th term of -77731, -77735, -77729, -77707, -77663, -77591, -77485? s3 - s2 - 8s - 77723 What is the c'th term of -352, -1356, -3038, -5410, -8484, -12272? -2c*3 - 327c*2 - 9c - 14 What is the y'th term of 57, 400, 1339, 3174, 6205, 10732, 17055? 50y3 - 2y*2 - y + 10 What is the u'th term of 741, 2991, 6743, 11997? 751u*2 - 3u - 7 What is the j'th term of 3679, 7385, 11121, 14881, 18659? -j*3 + 21j*2 + 3650j + 9 What is the m'th term of 775479, 775468, 775445, 775404, 775339, 775244, 775113? -m*3 - 4m + 775484 What is the p'th term of -116, -266, -482, -764, -1112, -1526? -33p2 - 51p - 32 What is the x'th term of 17840, 17843, 17846, 17849, 17852? 3x + 17837 What is the q'th term of -1155811, -1155810, -1155809, -1155808, -1155807, -1155806? q - 1155812 What is the p'th term of 723, 1177, 1941, 3021, 4423, 6153, 8217? p3 + 149p*2 + 573 What is the h'th term of -341081, -341079, -341077, -341075, -341073? 2h - 341083 What is the a'th term of 98, 89, 58, -7, -118? -2a3 + a2 + 2a + 97 What is the h'th term of 44519, 88952, 133309, 177596, 221819? h*3 - 44h*2 + 44558h + 4 What is the l'th term of 27024, 27007, 26982, 26949? -4l2 - 5l + 27033 What is the d'th term of 71071, 71062, 71053, 71044, 71035? -9d + 71080 What is the p'th term of 205, 214, 305, 520, 901? 7p3 - p2 - 37p + 236 What is the i'th term of 995, 2001, 2981, 3923, 4815, 5645, 6401? -2i3 - i2 + 1023i - 25 What is the s'th term of 154, 292, 420, 538? -5s*2 + 153s + 6 What is the l'th term of 8552, 8440, 8252, 7982, 7624, 7172, 6620, 5962? -l*3 - 32l*2 - 9l + 8594 What is the o'th term of 73, -9, -125, -275, -459? -17o2 - 31o + 121 What is the x'th term of 485372, 970742, 1456114, 1941488, 2426864, 2912242? x*2 + 485367x + 4 What is the w'th term of -2445, -2391, -2337, -2283? 54w - 2499 What is the l'th term of 32, -29, -212, -577, -1184, -2093, -3364? -10l3 - l2 + 12l + 31 What is the w'th term of -8500, -16997, -25474, -33925, -42344, -50725, -59062, -67349? w3 + 4w*2 - 8516w + 11 What is the j'th term of 32, 138, 304, 524, 792? -j*3 + 36j*2 + 5j - 8 What is the q'th term of 120, 223, 340, 471, 616, 775? 7q2 + 82q + 31 What is the y'th term of -60, -90, -94, -60, 24, 170? 2y3 + y2 - 47y - 16 What is the w'th term of -154, -336, -518, -700, -882, -1064? -182w + 28 What is the u'th term of 66747, 66756, 66751, 66726, 66675, 66592, 66471, 66306? -u3 - u2 + 19u + 66730 What is the y'th term of -6406, -12749, -19088, -25423, -31754, -38081, -44404? 2y2 - 6349y - 59 What is the k'th term of 22, 45, 66, 73, 54, -3, -110? -2k3 + 11k*2 + 4k + 9 What is the t'th term of -2568, -20601, -69546, -164859, -321996, -556413, -883566? -2576t3 - t + 9 What is the x'th term of 3868, 3883, 3878, 3841, 3760, 3623, 3418, 3133? -2x*3 + 2x*2 + 23x + 3845 What is the p'th term of -310, -581, -810, -997? 21p2 - 334p + 3 What is the g'th term of -205, -301, -419, -565, -745, -965, -1231? -g*3 - 5g*2 - 74g - 125 What is the c'th term of 1, 19, 55, 109? 9c2 - 9c + 1 What is the c'th term of 2804, 11263, 25362, 45101, 70480? 2820c2 - c - 15 What is the x'th term of 29395, 58790, 88185, 117580? 29395x What is the r'th term of 167, 170, 175, 182, 191? r*2 + 166 What is the f'th term of -2071, -2068, -2065, -2062, -2059, -2056? 3f - 2074 What is the a'th term of -4429, -8818, -13207, -17596, -21985, -26374? -4389a - 40 What is the l'th term of 4830, 4803, 4768, 4719, 4650? -l3 + 2l*2 - 26l + 4855 What is the t'th term of 1809827, 1809820, 1809809, 1809794, 1809775, 1809752? -2t2 - t + 1809830 What is the b'th term of -83, 57, 439, 1183, 2409, 4237, 6787? 20b3 + b2 - 3b - 101 What is the w'th term of 8, 42, 84, 134, 192, 258, 332? 4w*2 + 22w - 18 What is the p'th term of -68, -1275, -4546, -10913, -21408, -37063? -172p3 - 3p + 107 What is the z'th term of -2578, -2591, -2604, -2617? -13z - 2565 What is the x'th term of -138113, -138076, -138039, -138002, -137965? 37x - 138150 What is the h'th term of 95, 218, 425, 716? 42h2 - 3h + 56 What is the w'th term of -384, -1288, -2798, -4914? -303w2 + 5w - 86 What is the j'th term of -4593, -4676, -4759? -83j - 4510 What is the n'th term of 4309, 4333, 4365, 4405, 4453? 4n*2 + 12n + 4293 What is the b'th term of -247, -411, -513, -547, -507, -387, -181? b*3 + 25b*2 - 246b - 27 What is the r'th term of 32, 107, 208, 335, 488, 667? 13r2 + 36r - 17 What is the u'th term of -55862, -55858, -55854, -55850, -55846, -55842? 4u - 55866 What is the p'th term of -24892, -24894, -24896, -24898? -2p - 24890 What is the w'th term of 215, 1461, 4653, 10703, 20523, 35025, 55121, 81723? 152w3 + 61w*2 - w + 3 What is the l'th term of -77305, -154609, -231913, -309217, -386521? -77304l - 1 What is the z'th term of 2053, 8372, 18911, 33676, 52673, 75908, 103387, 135116? z*3 + 2104z2 - 52 What is the o'th term of 1293, 2207, 3109, 3993, 4853, 5683, 6477, 7229? -o3 + 921o + 373 What is the t'th term of -251, -1022, -2311, -4118, -6443, -9286, -12647? -259t*2 + 6t + 2 What is the t'th term of 3594, 13533, 29820, 52455? 3174t2 + 417t + 3 What is the d'th term of 4891, 4921, 4951, 4981, 5011, 5041? 30d + 4861 What is the h'th term of -73009, -146022, -219035? -73013h + 4 What is the x'th term of -50, -261, -808, -1853, -3558? -27x3 - 6x*2 - 4x - 13 What is the s'th term of 3402, 3544, 3792, 4158, 4654, 5292, 6084? 2s3 + 41s*2 + 5s + 3354 What is the f'th term of -3142, -2883, -2624? 259f - 3401 What is the a'th term of -491687, -983377, -1475069, -1966763? -a2 - 491687a + 1 What is the m'th term of 1619, 1310, 1003, 698, 395, 94? m*2 - 312m + 1930 What is the u'th term of -588, -1186, -1784? -598u + 10 What is the u'th term of -2765, -2710, -2659, -2612? -2u*2 + 61u - 2824 What is the c'th term of -219, -820, -1827, -3240, -5059, -7284, -9915? -203c2 + 8c - 24 What is the y'th term of -111598, -111602, -111610, -111622, -111638? -2y2 + 2y - 111598 What is the p'th term of 275073, 275074, 275075, 275076, 275077, 275078? p + 275072 What is the h'th term of -2864, -5704, -8544, -11384, -14224? -2840h - 24 What is the h'th term of -30235, -60469, -90703, -120937? -30234h - 1 What is the o'th term of -2577, -5145, -7713, -10281, -12849, -15417? -2568o - 9 What is the a'th term of -194, -569, -942, -1313, -1682, -2049, -2414? a2 - 378a + 183 What is the h'th term of -658, -3010, -9402, -21856, -42394, -73038? -337h3 + 2h*2 + h - 324 What is the v'th term of -174, -410, -728, -1170, -1778, -2594, -3660? -7v3 + v2 - 190v + 22 What is the g'th term of -231948, -231944, -231940? 4g - 231952 What is the l'th term of 145, 165, 187, 205, 213, 205? -l*3 + 7l*2 + 6l + 133 What is the p'th term of 341, 322, 321, 338? 9p2 - 46p + 378 What is the k'th term of -9912, -19810, -29708, -39606, -49504, -59402? -9898k - 14 What is the x'th term of -282, -563, -848, -1137, -1430, -1727, -2028? -2x*2 - 275x - 5 What is the y'th term of -161426, -161430, -161434? -4y - 161422 What is the o'th term of 80, 569, 1462, 2819, 4700, 7165, 10274? 10o*3 + 142o*2 - 7o - 65 What is the x'th term of -219276, -438549, -657822, -877095, -1096368? -219	{ "pile_set_name": "DM Mathematics" }
63) + 332/198 and g. 110 Suppose -4616h - 1984 = -4864h. Let m = 25 - 60. Let w = m + 77. What is the least common multiple of w and h? 168 Suppose -3y - 149o + 54 = -145o, y + 3o = 18. Calculate the least common multiple of y and 354. 1062 Let n = 2/9495 + 512708/104445. Let s = -23346441/5237774 + -7/55721. Let k = s - 2/47. What is the common denominator of k and n? 22 Suppose 12 = 10a - 28. Suppose 2w - 2 = -2k - w, 3w = -ak + 10. What is the lowest common multiple of 159 and k? 636 Suppose -17u + 20u = 18. Suppose 2g = -ug + 96. Suppose 3h = -13 + 40. Calculate the least common multiple of h and g. 36 Let d(o) = o*2 + 2o - 1754. Let x be d(0). Let b = 10547/6 + x. Find the common denominator of b and -83/12. 12 Calculate the least common multiple of 438 and (6/45)/(49/35) - 36784/(-84). 438 Suppose 3p - 736 = 2p. Suppose -4 + 2 = n, -5a - 2n + p = 0. Calculate the common denominator of 4 - 1 - 5/(90/a) and 125/18. 18 Suppose 0 = -g - 3c + 7, -g - 13c + 1 = -16c. Let t(w) = w3 - 36. Let z be t(0). Let n = z + 50. Calculate the least common multiple of g and n. 28 Suppose z - 2p - 5 - 5 = 0, 27 = 3z - 3p. Find the common denominator of 11/((-440)/448) + 7 and (-2009)/140 - z/20. 20 Let g be 0 + -105 + (-4)/(-20)0. Calculate the lowest common multiple of 12 and (4/12)/((-7)/g). 60 Let i = 6 + -13. Let v(m) = -m2 - 8m - 4. What is the smallest common multiple of (-2)/8 - (-16)/((-1024)/(-336)) and v(i)? 15 Let z = 711 - 724. Calculate the common denominator of z + 12 + (-101)/(-56) and 65/42. 168 Let h = 332/99 - 28/9. Let f = -35 + 23. What is the common denominator of ((-158)/f)/(3 - 4) and h? 66 Suppose 0 = 4a - 691 + 291. What is the lowest common multiple of 772 and a? 19300 Suppose -v - 22 = -0v - 5w, -4v - 16 = -2w. Let u(g) = -5g*3 - 2g*2 - 5g - 2. What is the least common multiple of 28 and u(v)? 280 Let w be -2 + 3 - 9384/30. Let j = 21727/70 + w. What is the common denominator of j and 89/154? 770 Suppose 0 = 2k - 2a + 244, -4k = -14a + 12a + 492. Calculate the smallest common multiple of 1(-3)/(k/24 + 5) and (-1)/(-2)-13-8. 468 Let q = 82775353/960 + -431122/5. Find the common denominator of q and 121/48. 960 Suppose 0 = 32u + 14u - 19872. Calculate the lowest common multiple of 72 and u. 432 Find the common denominator of 69/260 - (-27)/351 and 113/120. 1560 Let o(n) = -3n + 1. Let u be o(-1). Suppose -36 = y - uy. Calculate the least common multiple of 3/2-44(-274)/822 and y. 132 Let m = -282 + -33. Let r = 325 + m. What is the least common multiple of r and 50? 50 Let f = 54/193 - -9481/4053. Find the common denominator of f and 22/141. 987 Suppose -o = -3o - 4m - 12, 3o = 2m + 6. Suppose 2q - 2v = 4q, 5q - v + 12 = o. What is the common denominator of 65/2 and q/9 - (-67)/18? 2 Let b be ((-31)/1263)/((-7)/((-1110704)/(-4896))). Let u = 6/7157 + b. What is the common denominator of -47/165 and u? 2970 Suppose -507z - 1571 = -6134. Calculate the lowest common multiple of z and 6219. 6219 Let g = -175586/1485 - -6518/55. What is the common denominator of g and -31/216? 2376 Suppose 0 = 4w + w - 50. Let z = 7 - w. Calculate the lowest common multiple of 34 and 4z/(-6) - -41. 102 Suppose 2o - 11 + 7 = 3v, 0 = -3o + 4v + 5. What is the lowest common multiple of (2 + -5 - o) + 96/12 and 24? 24 Let u(m) = m*2 - 6m - 2. Let b = -277 - -279. Suppose 0 = 4h - bp - 720, -4p + 7p = 12. Calculate the smallest common multiple of u(8) and h. 182 Let t = -3880755/16 + 242681. Let m = t + -4112989/30736. Let j = 148221/72998 + m. Calculate the common denominator of 61/4 and j. 76 Let a(i) = 2i. Suppose -22z + 48 = -10z. Suppose l + 0 - 2 = -k, -zk - 2l = -12. Calculate the smallest common multiple of k and a(3). 12 Suppose -2s - 2 = 0, -s - 32 = -4k - 7. Calculate the common denominator of (-79)/(-21)k/16 and (24/(-20))/(-3) + (12971/(-70))/17. 56 Let r(w) = -13w + 11. Let q be r(7). Let j = 107 + q. Calculate the smallest common multiple of (-1)/(-3) + 156/18 and j. 27 Let d = -2712 + 3240. What is the smallest common multiple of 624 and d? 6864 Let v = 18835 - 18682. What is the least common multiple of 680 and v? 6120 Let o(f) = -17f*3 - 3f*2 - 22f - 8. What is the smallest common multiple of 700 and o(-3)? 4900 Let o = -2332773/6352 + 1/6352. Let w = o + 39763/108. Find the common denominator of w and -89/36. 108 Suppose -16x + 5314 = -4290 - 252. Calculate the least common multiple of 32 and x. 2464 Let i = 316104/19 + -16644. Let f = i + 1497/76. Calculate the common denominator of f and 145/22/(-20). 4 Let f = 10237 - -3713. Let j = f + -3627011/260. Let x = -1452/17 - -23773/306. Calculate the common denominator of j and x. 2340 Suppose 0 = -0q + 4q - 72. Let l = 339483 - 339111. What is the lowest common multiple of l and q? 1116 Let t(l) = l*3 + 14l*2 + 15l + 26. Let c be t(-13). Suppose 0 = 4i - 5o - 294, -5i - o + 4o + 374 = c. What is the smallest common multiple of i and 5? 380 Suppose -27 = -11l + 6. Let f be (10/14)/(7/49). Suppose -fx - 17 = w - 54, lx = -w + 27. What is the smallest common multiple of w and 3? 12 Let h = -40/453 - 25393/25368. Find the common denominator of ((-14)/(-8))/((-16)/(-52)) and h. 112 Calculate the common denominator of (-32/12 - (-45)/198)-17 and (1 - 92/34) + 2. 187 What is the least common multiple of (5 - 1-2)(-492)/861 - -1502 and 7? 1498 Let d be (18/4)/(20/2760). Find the common denominator of -99/28 and -5 - 1/((-84)/d). 28 Let q = 412735/2917574 + -52/4573. Find the common denominator of q and -85/522. 5742 Suppose 4c + 6 = 2c. What is the common denominator of (-64 + -1)/(c + 1) and 665/(-175)(-20)/324? 2 Let j = 265 + -155. Suppose 2i + 3i = j. What is the lowest common multiple of 10/(-4)(6 - (-310)/(-25)) and i? 176 Suppose -o = o + 4v - 4, -3o + 17 = -5v. Suppose os = 3s. Suppose sx = 2h + x - 32, -5h = 4x - 74. Calculate the smallest common multiple of 6 and h. 18 Suppose 9r - 135 = 45. Suppose -8s + 20 = -r. Suppose -sz + 11 = -2z + 2y, 0 = 5y + 10. What is the smallest common multiple of 3 and z? 15 Let g = 189 + -79. Calculate the least common multiple of 5 - 2 - 37/(-1) and g. 440 Let x be 2 + (-7)/(-14)-4. Calculate the smallest common multiple of 3 - -39 - (0 - x) and 63. 126 Let d = 23 - 26. Let n(j) = -7j - 10. Let k be n(d). Suppose 3u - k = 55. What is the least common multiple of 78 and u? 858 Let m be (-59)/(-1) + 1 + 1 + 0. Calculate the common denominator of (31 - 31) + m/(-28) and -97/28. 28 Let q be 0/2 + -2 + 3 + 2. Suppose -2v - 4m = -67 - 5, v - 27 = -5m. Calculate the smallest common multiple of 1/(q/(-4))-3 and v. 84 Let b be (-53)/(-11) - 20/(-110). Let f(m) = 10m - 11m + 16 - 4. Calculate the smallest common multiple of f(b) and 9. 63 Find the common denominator of -31/312 and (6 - 506/104)/(39 - 3). 1872 Calculate the smallest common multiple of 1036 and 294 + (15 + 18 - 19). 11396 Let j = -106 + -3. What is the common denominator of 109/6 and (-36)/(-48)(j/27 - -1)? 18 Suppose 7h - 101 = 116. Let y = h - 71. What is the common denominator of -31/15 and ((-15)/y)/((-54)/(-776))? 90 Suppose 8b - 344862 = -335550. Calculate the least common multiple of b and 97. 1164 Let b = 4409 - 401210/91. Find the common denominator of b and -23/28. 364 Let u(s) = -s + 5. Let o be u(7). Let q be 2234/3 - (o - (-1 + 1)). Let b = -2967/4 + q. What is the common denominator of 77/2 and b? 12 Let k = -140 - -138. Let b be (665/(-139) - k)/((-37)/7). Let n = -47/139 - b. What is the common denominator of 23/5 and n? 185 Suppose 0 = w - 4q + 10593 - 2149, w - 3q = -8443. Let t = w - -202631/24. Find the common denominator of t and -19/28. 168 Suppose 11h - 66 = 14h. Let q = -2237/30 + 1406/15. Find the common denominator of q and (-2 + -41)1/h. 66 Let b = -27 - -25. Let w be (-3)/(3 + (-4 - b)). Find the common denominator of 53/2 and (w/(-27))/((4/1)/492). 6 Let f = 64763/13 - 122402603/24570. What is the common denominator of 127/70 and f? 1890 Suppose 58 + 386 = 3g. Let r(q) = 2q*2 + 802q + 3970. Calculate the smallest common multiple of r(-5) and g. 740 Suppose -12*p + 1375 = -173. Let o = p - 111. Calculate the common d	{ "pile_set_name": "DM Mathematics" }
d. Let q be y(-5). Find the third derivative of 8c6 - 147c + qc + 7c*2 wrt c. 960c*3 Let g = 5 - -5. Let o(j) = j - 8. Let u be o(g). What is the third derivative of 2p*3 - 4p*2 - 3p*u + 2p3 + p3 wrt p? 30 Let m(f) = f - 3 + 5 - 3 + 3. Let y be m(3). Find the second derivative of -11ly + 2l - 8l + 8l*5 wrt l. -60l*3 Suppose -3d + 2c - 6 = -7d, -d + c = -9. Suppose -3v - 2v - da + 25 = 0, 4v - 41 = a. What is the second derivative of -3u3 + 532 - 532 + vu wrt u? -18u Let d(k) be the third derivative of -k6/120 - k5/20 + 13k*4/6 + 152k*2. Find the second derivative of d(m) wrt m. -6m - 6 Let k be (2 + -4)-1 - -12. Let q = -12 + k. Find the second derivative of 7m + 3m - 2m*2 + 2m*q - 4m*3 wrt m. -24m Let v = 22 + -19. Let g = 4 + 0. What is the second derivative of 2s + 2s - vs + gs*5 wrt s? 80s*3 Find the third derivative of 70g*3 + 2g*4 + 8g*2 - 2g*2 - 31g*3 wrt g. 48g + 234 Let k(i) = 139i2 + 98i + 2. Let z(v) = 2v + 1. Let a(s) = k(s) - 2z(s). What is the second derivative of a(f) wrt f? 278 Let d(z) be the third derivative of -27z5/20 + z4/2 + 17z3/6 + z2 + 287. Find the second derivative of d(l) wrt l. -162 Let p(q) = q - 3. Let t be p(7). What is the derivative of -1 - 4 - 5x - t + 10x wrt x? 5 Let x(f) be the first derivative of 245f4/4 + 198f - 410. What is the first derivative of x(a) wrt a? 735a2 Let k(j) be the first derivative of 5j*4/8 + 17j*3/6 + 17j*2/2 + 41. Let a(u) be the second derivative of k(u). What is the derivative of a(l) wrt l? 15 What is the third derivative of -325m*3 - 167m*3 + 539m*2 + 116340m - 116340m wrt m? -2952 Let d(m) be the third derivative of -29m*7/210 - 131m5/30 - m2 - 32. Find the third derivative of d(z) wrt z. -696z Let d(q) = 8q - 4. Let i(t) = 24t - 13. Suppose -38 = -2s - 4. Let u(r) = sd(r) - 6i(r). What is the derivative of u(g) wrt g? -8 Find the first derivative of 178j - 4 + 18 + 75j + 34 - 5 wrt j. 253 Let g(w) be the second derivative of 0w5 + 11w + 0w2 + 0 - 4/15w*6 + 0w*4 - 7/6w*3. Find the second derivative of g(v) wrt v. -96v*2 Let i(p) be the third derivative of 29p*6/40 + 58p*3/3 - 138p*2. Differentiate i(b) wrt b. 261b*2 Let h(m) be the third derivative of 29m*6/30 + 241m*5/60 + 132m*2. What is the third derivative of h(u) wrt u? 696 Let j(p) be the first derivative of -159p*7/7 - 21p*3 + 65. Find the third derivative of j(y) wrt y. -19080y3 Let v(a) be the first derivative of a6/8 - a*5/15 + 7a*2/2 + 4. Let f(q) be the second derivative of v(q). Find the third derivative of f(g) wrt g. 90 Let g(k) be the third derivative of -235k*4/12 + 136k*3 - 320k*2. Differentiate g(l) wrt l. -470 Let v(d) = -4d*4 + 15d*3 + 2d*2 + 5d + 573. Let s(a) = 3a3 + 2a*2 + a. Let g(k) = 5s(k) - v(k). Differentiate g(x) with respect to x. 16x3 + 16x Let i(c) be the first derivative of -203c3/3 + 24c2 - c + 373. What is the second derivative of i(s) wrt s? -406 Let h(x) be the third derivative of -x8/42 + x*5/20 + 19x*4/6 - 10x*2 - 2x. What is the second derivative of h(u) wrt u? -160u3 + 6 Let g(b) = 379b*3 - 1176b*2 + 16b + 8. Let s(r) = 126r3 - 392r*2 + 6r + 3. Let w(o) = -3g(o) + 8s(o). What is the third derivative of w(i) wrt i? -774 Let f(z) be the third derivative of -z*4/24 + 13z*3/6 - 11z*2. Let q be f(11). What is the third derivative of 2v3 + vq + 2v3 + 7v*2 wrt v? 24 Suppose -k = 4k - 35. Find the second derivative of -kq3 + 13q - 2q3 - 23q wrt q. -54q Let v(h) be the second derivative of -23h*6/3 - 26h3/3 - h2 + 107h. Find the second derivative of v(c) wrt c. -2760c2 Let i(w) = -w2 + 2w + 7. Let y be i(3). Find the second derivative of 15d + yd5 + 7d*5 - 6d - 2d5 wrt d. 180d*3 What is the second derivative of 12d*3 + 21 + 50d*2 + 33d*3 - 20d*2 - d - 25d*2 wrt d? 270d + 10 Suppose 4f + 3n - 10 = -0f, f + 4 = -4n. Find the third derivative of -5xf - 27x4 - x2 + 33x2 wrt x. -768x What is the second derivative of -60m + 2 - 73m*2 + 0m*2 - 20m*2 + 14m*2 wrt m? -158 Let w(m) be the third derivative of -5m*6/12 + 3m*4 - 64m*2. Find the second derivative of w(h) wrt h. -300h Let j(y) = -25y - 24. Suppose 18 + 48 = 6k. Let u(f) = -5f - 5. Let g(i) = ku(i) - 2j(i). Differentiate g(o) wrt o. -5 Let t(k) be the third derivative of k4/24 + 2k*3/3 - 4k2. Let v be t(-2). What is the second derivative of sv + 6s + 2s*2 - s - 4s*2 wrt s? -2 Let i(j) be the first derivative of 26/3j*3 + 0j*2 - 27 + 45j. Differentiate i(s) wrt s. 52s Suppose -a = a - 13a. Let b(m) be the first derivative of am4 - 2/5m*5 + 0m + 1/3m3 + 0m*2 + 3. Find the third derivative of b(o) wrt o. -48o Let m(a) be the third derivative of 129a5/20 - a4/12 - 23a*3/3 - 38a*2 - 5a. What is the second derivative of m(g) wrt g? 774 Let w = 16 + 4. What is the second derivative of -2i - 5i*4 - wi + 9i wrt i? -60i*2 Let u = -1003/5 + 201. Let x(n) be the first derivative of -6n + un5 + 0n*2 - 6 + 0n*4 + 0n*3. Differentiate x(z) with respect to z. 8z*3 What is the second derivative of -162h + 11737h3 - 5h*4 - 11737h*3 - 15h*4 wrt h? -240h*2 Let i(v) be the second derivative of -83v*6/15 - 129v*2 - 398v. Find the first derivative of i(r) wrt r. -664r3 Let a(z) = -6z*2 + 21z - 111. Let h(f) = 8f2 - 21f + 112. Let l(i) = 6a(i) + 5h(i). What is the first derivative of l(k) wrt k? 8k + 21 Let g = -7 - -16. Differentiate 6r*4 - 4r*4 + 21r4 + g + r4 with respect to r. 96r3 Let o(g) = -235g*3 - 4g - 11. Let f(b) = 471b3 + 10b + 23. Let m(u) = 2f(u) + 5o(u). Differentiate m(r) with respect to r. -699r2 Differentiate 44d*2 + 10d - 70 - 14d - d2 + 5d with respect to d. 86d + 1 Find the second derivative of -3o*3 - 6 + 56o*3 - 10o*3 + 2o wrt o. 258o Let j be 5 - (8/(-4) + 5). Let o = 4 - j. Find the second derivative of -2i*2 + 2i - 2i + 0i*o - 6i wrt i. -4 Let c(a) be the second derivative of 0a7 + 0a*2 + 0a*6 + 0a*3 + 15a - 9/56a8 - 1/12a*4 + 0 + 0a*5. What is the third derivative of c(q) wrt q? -1080q*3 Let b(p) be the first derivative of 331p*3/3 - 147p - 371. What is the derivative of b(l) wrt l? 662l What is the third derivative of -990y*3 - 55 + 170y*2 + 12y*2 + 57 wrt y? -5940 Suppose 6 = t + 2. What is the third derivative of 8m*t + 4m*4 + 6m*4 + 19m*2 - 4m*4 wrt m? 336m Let d(x) be the first derivative of 149x5/5 - x4/2 - 38x - 135. Find the first derivative of d(z) wrt z. 596z3 - 6z*2 Let c(d) be the first derivative of 5d8/336 + d4/6 - d*3/3 + 26. Let w(r) be the third derivative of c(r). Find the first derivative of w(g) wrt g. 100g*3 Let u be (-6)/((-36)/(-69))-4. Differentiate 11 - l*3 + 12l*3 - ul*4 - 11l*3 with respect to l. -184l*3 Let k(b) = 5b*5 - 6b*4 - 5b*3 + 3b - 6. Let j(t) = -t5 + t4 + 2t3 + t + 1. Let l(r) = 6j(r) + k(r). Find the second derivative of l(d) wrt d. -20d3 + 42d Let g(a) be the first derivative of -5/3a3 + 0a*2 - 14 - 20a. What is the first derivative of g(z) wrt z? -10z Suppose 26 = 2n - 96. Find the second derivative of 33c5 - nc*5 - 34c + 31c5 wrt c. 60c*3 Suppose 10 = 2m, 0l - 5l + m = 90. Let s = -16 - l. What is the first derivative of -3v4 - s - 1 - 2 wrt v? -12v*3 Suppose 0 = -5i - 25, 5d - 4d - 3i = 6. Let u(g) = g2 + 4g + 12. Let s be u(d). What is the first derivative of 2m3 + 59 - 5m*3 - s wrt m? -9m*2 Let s be (16 - 2) + (-3 - 0/(-3)). Differentiate 4y + 3y - sy + 24 + 3y wrt y. -1 Let b(h) be the third derivative of 0 + 0h + 0h5 + 12h*2 + 7/24h*4 - 4/15h*6 + 0h*3. What is the second derivative of b(m) wrt m? -192m Find the third derivative of -330 - 39i3 - 17i*2 + 330 wrt i. -234 Find the third derivative of 0g4 - g4 + 2g3 + 4g*4 - 21g*2 - 4 + 1 + 1 wrt g. 72g + 12 Let t be 7 + (0 - 0/4). Suppose -6 = -3l, -a + l = -4l + t. Find the second derivative of -1 - z*3 + 1 + 0z*a + 3z wrt z.	{ "pile_set_name": "DM Mathematics" }
0.7 (c) 62 (d) -2/15 (e) -5 (f) 4 f Which is the fifth smallest value? (a) 0.12 (b) 0.2 (c) 0 (d) -4 (e) -70 (f) -3 a Which is the second smallest value? (a) -4 (b) 4 (c) -2/21 (d) -3/4 (e) 502/5 d Which is the fourth biggest value? (a) 5/8 (b) -0.2 (c) 0.3 (d) 6529/2 b What is the third biggest value in 17, -13/5, 0.032? -13/5 Which is the smallest value? (a) 26 (b) -0.1 (c) -33 (d) 8 c Which is the sixth smallest value? (a) 0.5 (b) 1574 (c) -0.4 (d) -4 (e) 0.2 (f) -1 b What is the second smallest value in -5, -332/55, 0, 2, -0.2? -5 Which is the fifth smallest value? (a) 13 (b) -3/7 (c) 3 (d) -2 (e) 3/14 (f) 4 f Which is the biggest value? (a) 2/3 (b) -125 (c) 3 (d) 1/5 (e) 2/5 c What is the fourth biggest value in 1, -1/5, 0.213, -1/2? -1/2 What is the smallest value in 0.04, 30674, -0.1? -0.1 Which is the sixth smallest value? (a) -5/3 (b) 4 (c) 3/5 (d) -34/25 (e) 16 (f) 0.3 e Which is the second smallest value? (a) 0 (b) 621 (c) 0.5 (d) -5 (e) -2/3 e What is the smallest value in -5, -0.3, -1/4, -5/548, 2/9? -5 Which is the third biggest value? (a) 5 (b) -212935 (c) 2 b Which is the fifth smallest value? (a) -4 (b) 4 (c) 3 (d) 0.1 (e) 59.6 e Which is the second smallest value? (a) 0.74 (b) -0.5 (c) 2/3 (d) -1 b What is the smallest value in 32/7, 152, -0.3? -0.3 Which is the third smallest value? (a) -5 (b) 5 (c) 105 (d) -0.05 (e) -0.5 d What is the fourth biggest value in -0.3, 0.124, 1.2, 0.9? -0.3 Which is the fifth biggest value? (a) -19 (b) 2 (c) -48 (d) -0.4 (e) 1 c Which is the smallest value? (a) -8 (b) -3 (c) 818 a Which is the second biggest value? (a) -1/17 (b) 1 (c) -0.7 (d) -1/49 d Which is the biggest value? (a) 2.6 (b) 0.04 (c) 6 (d) -16 c Which is the third biggest value? (a) -2/15 (b) -5/21 (c) -4 (d) -2/5 d Which is the smallest value? (a) 380/7 (b) -1 (c) 0.5 (d) 3/2 (e) -2 e What is the biggest value in 2013, 5/4, -6? 2013 Which is the fourth smallest value? (a) -0.5 (b) -2/5 (c) -3/2 (d) 0.12 (e) -37 b Which is the fifth smallest value? (a) 50 (b) 4 (c) -3 (d) -0.3 (e) -2 a What is the smallest value in 5/67, 5, 42, -0.2? -0.2 Which is the second smallest value? (a) -0.2 (b) 13.69 (c) 1/2 (d) -0.04 d Which is the third smallest value? (a) -5 (b) 0.03 (c) -1/22 (d) 3 (e) 2/13 b What is the biggest value in -141, 347, -13? 347 Which is the fifth smallest value? (a) 25 (b) 2/3 (c) -1/4 (d) 3 (e) 2588 (f) -1 a What is the third biggest value in 1/5, -29, 2, 1/85? 1/85 What is the fifth smallest value in 0, 9.83, 5, -8, 0.2? 9.83 What is the smallest value in 6/13, 12330, 2, 2/17? 2/17 Which is the fourth smallest value? (a) -2/5 (b) -64 (c) 1 (d) 3/4 (e) 0.2 d What is the smallest value in -2/7, -17, 442? -17 What is the fifth smallest value in 12, 1, 0.3, -5, 1/12, 1/14? 1 What is the smallest value in 6/13, 2/41, 244, 1? 2/41 Which is the third biggest value? (a) -1 (b) 1/5 (c) -0.0944 (d) 2/5 (e) -0.4 c What is the third biggest value in -4, 125.3, -69? -69 What is the smallest value in 3, 123, 15, -2, -0.7? -2 Which is the smallest value? (a) 2/3 (b) -8 (c) 1308 b What is the fifth biggest value in 78, 0.2, -263, -5, -0.2? -263 Which is the smallest value? (a) 7/4 (b) 0.1 (c) -6/5 (d) -0.8 (e) 5 c What is the fourth biggest value in -13, -89, -1/5, -5, -0.5? -13 Which is the smallest value? (a) -10014 (b) 11 (c) -4 (d) 0.5 a What is the fourth smallest value in -1, 5, -2/5, -3, 2/5, 31766? 2/5 Which is the second biggest value? (a) -6753 (b) -4/23 (c) -0.11 b What is the third smallest value in -2, -31, -26? -2 Which is the second smallest value? (a) 5 (b) -1.3 (c) 3 (d) 27 c Which is the second smallest value? (a) -1/2 (b) 1/4 (c) 3 (d) -141 (e) 1/155 a Which is the second smallest value? (a) 2 (b) 0.3 (c) -2309.94 b Which is the second smallest value? (a) -5 (b) -0.4 (c) 0.4 (d) 114 b What is the third biggest value in -9, -19/5, -15, -0.5? -9 What is the fifth smallest value in -1/16, -1, -0.4, 4, -16.7, -0.3? -1/16 What is the second biggest value in -6, 0.3, 4, -5, 0.8, 0.1? 0.8 What is the third smallest value in -7967, 0.025, 3? 3 Which is the fourth biggest value? (a) 5 (b) 3 (c) -0.2 (d) 0.1 (e) -0.57 c What is the biggest value in 7, -1/6, 0, -0.4? 7 What is the fourth biggest value in -703, 5, 0.3, -1? -703 What is the fifth biggest value in -1/5, 0, -0.4, 0.2, 0.014? -0.4 Which is the third smallest value? (a) -143/2 (b) 5 (c) 2/5 (d) 3/8 c Which is the biggest value? (a) -335 (b) 0 (c) -182 b Which is the smallest value? (a) -84.8 (b) 1.3 (c) -3/5 a Which is the second biggest value? (a) 0.4 (b) 1/12 (c) -25 (d) 6 a Which is the biggest value? (a) -2/83073 (b) 1/3 (c) 6 c Which is the biggest value? (a) 2902 (b) -7 (c) -4 a What is the fourth smallest value in 12, -0.3, 3, 4, 1, 0.02? 3 Which is the second smallest value? (a) -1/5 (b) -0.1 (c) -2 (d) -108 (e) -3/7 c What is the fifth smallest value in -0.5, -1/5, -5, 4, 3/5, -6/7? 3/5 What is the biggest value in 3471, 3, -0.1, 4? 3471 Which is the third smallest value? (a) 0.4 (b) -6 (c) -2/3 (d) -6/19 d Which is the second biggest value? (a) -1 (b) -1104 (c) -3 (d) -1/2 (e) 1/3 d What is the biggest value in -22, -70, 5? 5 What is the second biggest value in -106, -2, 93? -2 What is the second biggest value in 2/237, 5, -0.08? 2/237 What is the fourth smallest value in -2, -0.5, 317, 0.107, 0.4? 0.4 Which is the biggest value? (a) -3.11 (b) 3 (c) -0.2 (d) -4 (e) 4 e Which is the third smallest value? (a) 5/4 (b) 12 (c) -5372 b What is the fourth smallest value in 1/6, 11, -2/3, 1.7? 11 Which is the third smallest value? (a) 205 (b) 0.533 (c) 3 a What is the biggest value in 6/1147, -4, 0.5? 0.5 Which is the second smallest value? (a) -441/8 (b) 3 (c) 16 b What is the third biggest value in -8, -18/2467, -5? -8 What is the second smallest value in 3, 13/40, -14, -5, 2? -5 Which is the biggest value? (a) 0.2 (b) -8145 (c) 3/4 (d) 1/2 c What is the second biggest value in -8/21, -17, 14? -8/21 Which is the fourth smallest value? (a) -4 (b) 5 (c) -27 (d) -2/21 (e) -2/2343 e Which is the fourth biggest value? (a) 1312 (b) -13 (c) 1 (d) 15 (e) -2 e What is the biggest value in 0.5, 0.023, 13? 13 What is the third biggest value in -2/3, -67, -2, 3, -2.2? -2 What is the fourth smallest value in 4/7, 0.1, 5/6, 1/2, 0.33, -3/7? 1/2 Which is the smallest value? (a) 8 (b) -4 (c) 0 (d) 3.7 (e) -16/3 e Which is the second biggest value? (a) 0.81 (b) 8 (c) -5 (d) -1 a Which is the smallest value? (a) -3 (b) -0.69 (c) -2/5 (d) 8 (e) -1/3 a What is the biggest value in -3/5, 4, -4/5, 14081, -8? 14081 Which is the second smallest value? (a) 1 (b) 9 (c) 11/2 (d) 1/2 (e) 4 a Which is the biggest value? (a) 5 (b) -1/7 (c) 1/18 (d) 15 (e) 0.3 d What is the fourth smallest value in -2/3, 2/9, -17, -298, 3/2? 2/9 What is the fourth biggest value in -3.1, -0.5, -5, 3, 12? -3.1 Which is the biggest value? (a) 6 (b) 0.086 (c) 24/11 a What is the smallest value in -156, 6/41, 1/2, 1, -2/15? -156 Which is the fifth biggest value? (a) -3/2 (b) -1.84 (c) 2 (d) 0.2 (e) -2 e Which is the third smallest value? (a) -1 (b) -5 (c) 1/5 (d) 6718 (e) 2 c What is the fourth smallest value in 2.917, 0.2, -2/23, -6, 1/3? 1/3 What is the smallest value in -1, 5, -0.8383? -1 Which is the fourth biggest value? (a) -4122 (b) 2/3 (c) 2/9 (d) -5/2 (e) 3 d Which is the smallest value? (a) 0.4 (b) -27469 (c) -26 b Which is the fourth smallest value? (a) -1 (b) -33/10 (c) -5 (d) -4/5 (e) -4 (f) 1/5 a Which is the third smallest value? (a) -1 (b) 0.39 (c) -56 b Which is the biggest value? (a) 1/9 (b) 1 (c) -42 (d) -12/5 b What is the third smallest value in 0.04, -5, -58/13, -6, 4? -58/13 Which is the third biggest value? (a) -0.2 (b) -19.2 (c) -55 c Which is the third biggest value? (a) 0.1 (b) 89/4 (c) -3 (d) 0.08 d Which is the second smallest value? (a) 4 (b) 17 (c) -29 (d) 215 (e) -4 e What is the sixth biggest value in -12/5, -0.07, -4, -1, 5, 0.1? -4 What is the fourth smallest value in -2858, -4/3, 0.	{ "pile_set_name": "DM Mathematics" }
1 in ascending order. -9, -5, -1, 4, 23 Put -6808, 30, 2 in decreasing order. 30, 2, -6808 Put 21, -5, -6, 0 in ascending order. -6, -5, 0, 21 Put 4, 2, 1, -188, -1, -5 in descending order. 4, 2, 1, -1, -5, -188 Put 8, -3, 0, -1593 in increasing order. -1593, -3, 0, 8 Put -0.1, 2512, 0, 3, -9/7 in increasing order. -9/7, -0.1, 0, 3, 2512 Put 0.6, 134/3, 0, 1/3, -2, 0.1 in ascending order. -2, 0, 0.1, 1/3, 0.6, 134/3 Put -1, -2/181, 3/2 in decreasing order. 3/2, -2/181, -1 Put 1, 4.72, 59, -5/2, -2, -0.5 in descending order. 59, 4.72, 1, -0.5, -2, -5/2 Put -2, 3, 4, -4, -90, 2 in increasing order. -90, -4, -2, 2, 3, 4 Sort -2, -3, -0.3, -3/7, 16, 21 in descending order. 21, 16, -0.3, -3/7, -2, -3 Put -44, 0.07, 3, -0.7, 0.5 in decreasing order. 3, 0.5, 0.07, -0.7, -44 Sort 2/11, -0.11, 1, -1/6, -2523 in increasing order. -2523, -1/6, -0.11, 2/11, 1 Sort 10, 154, 5 in decreasing order. 154, 10, 5 Put -2, -4, 339, 86, -5 in ascending order. -5, -4, -2, 86, 339 Sort -2/9, 3/7, -2, 3/5, 8157, 0.1 in decreasing order. 8157, 3/5, 3/7, 0.1, -2/9, -2 Sort 17940, 1, 0 in increasing order. 0, 1, 17940 Sort 0.5, 137, -209, 5, -1. -209, -1, 0.5, 5, 137 Sort 10, 2, 5, -827. -827, 2, 5, 10 Sort 4, -164033, -1 in ascending order. -164033, -1, 4 Put -8, -4, 430, -5 in increasing order. -8, -5, -4, 430 Sort -0.084, 19, 0.03, 0.3 in decreasing order. 19, 0.3, 0.03, -0.084 Sort 0, -3, 7, -75 in decreasing order. 7, 0, -3, -75 Put -114, 0, 283 in decreasing order. 283, 0, -114 Sort -5, -1/2, -16827. -16827, -5, -1/2 Sort 1408, -0.24, 1/19 in ascending order. -0.24, 1/19, 1408 Sort 99, -25, -1, 0.7 in ascending order. -25, -1, 0.7, 99 Sort 0, 140867, 1, 3 in ascending order. 0, 1, 3, 140867 Sort -26, -4, -2, 441. -26, -4, -2, 441 Put 0, 3, -161, -4 in increasing order. -161, -4, 0, 3 Sort 242, -3, -4, 2. -4, -3, 2, 242 Sort -1, 35, -6, 10, 2 in increasing order. -6, -1, 2, 10, 35 Sort -0.3, -3, -1, 10, 4/9 in increasing order. -3, -1, -0.3, 4/9, 10 Put -3, -724, 5, -21, 2, 1 in descending order. 5, 2, 1, -3, -21, -724 Sort -1272, -7/5, -0.2, 2, 5 in decreasing order. 5, 2, -0.2, -7/5, -1272 Put 10, 0.3, -647, 2/3 in descending order. 10, 2/3, 0.3, -647 Put 3, -5, 193987 in increasing order. -5, 3, 193987 Sort 2, 271, 7434 in decreasing order. 7434, 271, 2 Put 1, -329, -424 in decreasing order. 1, -329, -424 Sort -1/122, 0.07, -1 in descending order. 0.07, -1/122, -1 Sort -1, 10, -1758, 3 in ascending order. -1758, -1, 3, 10 Sort 0.3, -4.67, 1/8 in ascending order. -4.67, 1/8, 0.3 Sort -1, -6, -3, -0.08, 7/111, 0 in decreasing order. 7/111, 0, -0.08, -1, -3, -6 Put -349, 46, 1, 3 in descending order. 46, 3, 1, -349 Put 6.8, -0.1, -5, -6, -7, 5/4 in descending order. 6.8, 5/4, -0.1, -5, -6, -7 Put 2, 4, 7, -42, -4, -34 in decreasing order. 7, 4, 2, -4, -34, -42 Sort -2, -2/11795, -1 in ascending order. -2, -1, -2/11795 Sort -11, 0.4, -4, 115, -9. -11, -9, -4, 0.4, 115 Sort 2, -9/10, 10 in increasing order. -9/10, 2, 10 Put -1, 17, 0, 87, -8 in descending order. 87, 17, 0, -1, -8 Sort 26, 1, 95, -1. -1, 1, 26, 95 Sort 7412, -4, 4 in decreasing order. 7412, 4, -4 Put -2, -5, 3, -139, 2/5, 1.1 in descending order. 3, 1.1, 2/5, -2, -5, -139 Sort -5, -228545, 2 in descending order. 2, -5, -228545 Put -2, 0.0312, 468 in decreasing order. 468, 0.0312, -2 Put -65, 10, 0.1 in decreasing order. 10, 0.1, -65 Put -0.2, -0.98, 0.003 in decreasing order. 0.003, -0.2, -0.98 Put -52, -10, -31 in increasing order. -52, -31, -10 Sort 0, -4/15, -29. -29, -4/15, 0 Sort -4, 2, -144, -19 in descending order. 2, -4, -19, -144 Put 1, -58, 1187, 5, -5 in descending order. 1187, 5, 1, -5, -58 Sort 3, -775, 10 in ascending order. -775, 3, 10 Sort 1, 4694, 226 in descending order. 4694, 226, 1 Put -44/3, -23, -2/11, 3 in decreasing order. 3, -2/11, -44/3, -23 Sort 6, -1, -8, -81. -81, -8, -1, 6 Sort 21, 3, -1, 4, -8 in increasing order. -8, -1, 3, 4, 21 Put -1/2, -0.4, -0.2, -5, -61 in ascending order. -61, -5, -1/2, -0.4, -0.2 Put -189/62, -3, -0.2, -5 in ascending order. -5, -189/62, -3, -0.2 Sort -4, -13, 3, 2, -3118. -3118, -13, -4, 2, 3 Put -10, 3, -1, 4, -603 in decreasing order. 4, 3, -1, -10, -603 Sort 0.07, 2, -1, -4, -75. -75, -4, -1, 0.07, 2 Sort 66087, -3/8, 2/13 in decreasing order. 66087, 2/13, -3/8 Sort 26/3, 591, -1.1. -1.1, 26/3, 591 Put 55, 2, 275 in descending order. 275, 55, 2 Sort 2, -3491, -2 in descending order. 2, -2, -3491 Put -2, -1, 521, 22 in decreasing order. 521, 22, -1, -2 Sort -3, -5/3, -201, 4 in decreasing order. 4, -5/3, -3, -201 Sort 100, -9, 1, 7 in ascending order. -9, 1, 7, 100 Put 1/6, -0.2, 0.02, -141/13, 2/9 in increasing order. -141/13, -0.2, 0.02, 1/6, 2/9 Put -5, -2, 3, -9, 0, -4 in increasing order. -9, -5, -4, -2, 0, 3 Sort 1468, 4, 13 in descending order. 1468, 13, 4 Put -5850, 3, -5 in descending order. 3, -5, -5850 Put 3, 1, -107, 2, 23, -4 in ascending order. -107, -4, 1, 2, 3, 23 Sort 73, 3, -5, -4, -3. -5, -4, -3, 3, 73 Put 7, 5, -2, -6/53 in increasing order. -2, -6/53, 5, 7 Put -4, -6, -3, -8, 2076, 2 in ascending order. -8, -6, -4, -3, 2, 2076 Put -0.02, 0.02, -1/10, -3, -0.8 in ascending order. -3, -0.8, -1/10, -0.02, 0.02 Put -390, 1.2, -15 in descending order. 1.2, -15, -390 Put -241.4, 2/11, 1/15 in ascending order. -241.4, 1/15, 2/11 Sort 1, 10, -1, -4, -7, 4 in ascending order. -7, -4, -1, 1, 4, 10 Put 276, 2/13, 4, -1, 1 in increasing order. -1, 2/13, 1, 4, 276 Sort 0.43, -1/24, -7, -0.04. -7, -1/24, -0.04, 0.43 Put -761, -0.3, 3 in descending order. 3, -0.3, -761 Sort -102, 0, -560 in decreasing order. 0, -102, -560 Put 3, 6, -4, -582 in ascending order. -582, -4, 3, 6 Put -35, 0, 1/3 in increasing order. -35, 0, 1/3 Put -1956, -6, -2, -4 in decreasing order. -2, -4, -6, -1956 Sort 50, 3.89, -0.3. -0.3, 3.89, 50 Sort 2/11, 2/3, -4, -60 in decreasing order. 2/3, 2/11, -4, -60 Sort -1/261, 7, -0.4, -1.1 in ascending order. -1.1, -0.4, -1/261, 7 Sort 1/479, -15, 3 in increasing order. -15, 1/479, 3 Put 4, 5, 0, -257715 in ascending order. -257715, 0, 4, 5 Put 0, 20, -4, 1, 6 in decreasing order. 20, 6, 1, 0, -4 Sort -2, -0.3, -2393, 1/4, -7, 0.2. -2393, -7, -2, -0.3, 0.2, 1/4 Sort 4, -11088, 2, 9 in descending order. 9, 4, 2, -11088 Sort -66, -2/3, 3381 in descending order. 3381, -2/3, -66 Sort 5, 1493, 19, 4, 0. 0, 4, 5, 19, 1493 Put 406, -10, 1, 5, -16, 4 in increasing order. -16, -10, 1, 4, 5, 406 Sort 0.1, 4/17, 1/8, 53, -1. -1, 0.1, 1/8, 4/17, 53 Sort -128, 2, -16 in decreasing order. 2, -16, -128 Sort 53.4, -50, 2. -50, 2, 53.4 Sort 3, 3/7, -0.5, -7, -1/3, 2/9 in increasing order. -7, -0.5, -1/3, 2/9, 3/7, 3 Put 1, 0.018, 162 in decreasing order. 162, 1, 0.018 Sort -2/5, 0.9645, 1/6 in decreasing order. 0.9645, 1/6, -2/5 Put 5, 4, 0.26, -4, -3 in increasing order. -4, -3, 0.26, 4, 5 Put 2, -0.1, 4/9, -410/17 in descending order. 2, 4/9, -0.1, -410/17 Put -1, -45022/5, -14 in decreasing order. -1, -14, -45022/5 Put -0.056, -1/2, -34, 4, 0.5, -14 in increasing order. -34, -14, -1/2, -0.056, 0.5, 4 Sort -569, -32, -3, 3, 0 in ascending order. -569, -32, -3, 0, 3 Put -1, -4, 1 in increasing order. -4, -1, 1 Put 1/6, 7, 42 in ascending order. 1/6, 7, 42 Sort 0.3, 16, 3, 2, 0, 6681. 0, 0.3, 2, 3, 16, 6681 Put 127425, 2, -7, -2 in descending order. 127425, 2, -2, -7 Put 330.3, -0.008, 0.5, -4/3 in decreasing order. 330.3, 0.5, -0.008, -4/3 Put 8, 2, -48, 5, -12 in decreasing order. 8, 5, 2, -12, -48 Sort -17, -13, 2, -134 in descending order. 2, -13, -17, -134 Put -1, -3, -5, 5, -4, -20 in descending order. 5, -1, -3, -4, -5, -20 Put -1, -19744/3, -8 in decreasing order. -1, -8, -19744/3 Sort -2/5, 0.1, -3/4, 0.4, 1565 in decreasing order. 1565, 0.4, 0.1, -2/5, -3/4 Sort 373, 2, -13, -3/7, -3, 1.5 in descending order. 373, 2, 1.5, -3/7, -3, -13 Sort -0.3, -1, 685, -1/3, 4 in increasing order. -1, -1/3, -0.3, 4, 685 Put -0.3, -0.6, 5, 3, -1.1, 4 in increasing order. -1.1, -0.6, -0.3, 3, 4, 5 Put 420, 2, -1, 39 in ascending order. -1, 2, 39, 420 Sort 2/7, -0.177, -1/6 in ascending order. -0.177, -1/6, 2/7 Sort -501996, 3, -0.3, -2/13 in descending order. 3, -2/13, -0.3, -501996 Put 1, -78, 4, -8 in increasing order. -78, -8, 1, 4 Sort 192, 5/3, 2, -1, -1/101 in decreasing order. 192, 2, 5/3, -1/101, -1 Sort 2, -2, 276, -1/8, 0.2 in	{ "pile_set_name": "DM Mathematics" }
lculate t(z). 5 Suppose 2g - 7 = -0g - c, 4g - 5c + 7 = 0. Let x(t) = 2t2 - 1. Determine x(g). 7 Let o(z) = -z2 - 7z - 12. Suppose 2j - 27 = 5x - 0x, 0 = -2j + 2. What is o(x)? -2 Suppose 3j - 6 = -3m, -3j + 4m - 4 = 25. Let z(p) = p + 5. What is z(j)? 2 Let q(z) = -z*3 + 3z*2 + 8z - 2. Let s be q(5). Let g(w) = -w*2 - 12w + 5. Calculate g(s). 5 Suppose a + 2a - 20 = -2h, -3h = -5a + 8. Let d(i) = 2i + 3. What is d(a)? 11 Let m = 8 + -5. Let g(y) = 4y - 1 - 2 - y*2 + 0. What is g(m)? 0 Let y(f) = 31f*3 + 2f - 1. Suppose 0 = -6p + 4 + 2. Give y(p). 32 Let p(d) be the third derivative of d7/5040 + d6/180 + d5/60 - d2. Let v(j) be the third derivative of p(j). Let w = 27 + -30. Calculate v(w). 1 Let c be (-32)/6 + (-2)/3. Let x = c - -1. Let p(d) = 6d*2 + 43d - d*3 - 13d2 + d2 - 49d - 1 - 3. Calculate p(x). 1 Let y(a) = 5a3 + a2. Let d be 0 + ((-9)/3)/(-3). Give y(d). 6 Let j(a) = -1. Let m(y) = 2y3 - 2y*2 - y - 2. Suppose -2c = 2c. Suppose 3x - x + 2 = c. Let d(o) = xj(o) + m(o). Give d(2). 5 Let m(b) = 2b. Let s be m(3). Let u(r) = -r*3 + 0r*3 + 0r*3 - 6 + 6r2. Determine u(s). -6 Let q(i) be the third derivative of -i5/60 - i4/24 - i3/2 + 2i2 - 5. Give q(-3). -9 Let r(i) = -i + 6. Let g be r(4). Let j = g + -4. Let v(l) = 2l3 + l2 - l - 1. Give v(j). -11 Let r(l) = l*3 + 2l2 - l. Let t(o) = -o - 21. Let v be t(-19). Calculate r(v). 2 Let k(o) be the second derivative of o5/20 - 7o4/12 + 5o*3/6 + 4o*2 + 16o. Calculate k(6). 2 Let p = 14 - 9. Let g(n) be the third derivative of n6/120 - n5/10 + n4/4 - n3/3 + 2n2. What is g(p)? 3 Suppose 0 = l, -3d + 5l + 0 = 6. Let p(x) = -4x*3 - 2x*2 - 2x + 1. Calculate p(d). 29 Let p(g) = 4g - 2g*2 - 1 - 4g*3 - 7g + 5g3. Let k(c) = c2 - 7c + 4. Let w be k(8). Suppose -z + 4q - 1 = 0, 0 = -5z - 2q + w + 5. What is p(z)? -1 Let b(m) = -3m*3 - 2m2 + 1. Let s(f) = f3 + 5f2 - f - 1. Let r be s(-5). Let c = -5 + r. Determine b(c). 2 Let z(h) = 2h*3 + 2h + 1. Let p(q) = q*3 - 11q*2 - q + 10. Let x be p(11). Give z(x). -3 Let i(r) = -r - 1. Let t be i(-1). Let a = 6 - 3. Let p(u) = tu + 3u + 2 + u2 + 6u - au. Determine p(-5). -3 Let m(o) = -14o*2 - 4o + 10. Let p(z) = -z*2 - 8z + 9. Let a be p(-10). Let n(b) = -5b2 - b + 3. Let d(q) = an(q) + 4m(q). Calculate d(-5). 7 Let f(o) = -8 - 4o + 3o + 4. Give f(-7). 3 Suppose -i - 30 = i. Let r(a) = -a + 8. Let j be r(17). Let f = i - j. Let l(z) = z + 2. What is l(f)? -4 Let r = -41 - -40. Let d(l) = -13l*3 + 5l*2 - 5l - 2. Let x(t) = 7t3 - 2t*2 + 2t + 1. Let p(y) = -2d(y) - 5x(y). Calculate p(r). 8 Let x(k) = 6k2 + 15k + 1. Let r(y) = 2y2 + 5y. Let q(d) = 8r(d) - 3x(d). What is q(-3)? -6 Suppose 0 = -5b + 3m + 23, b + 0b - 2m - 6 = 0. Let z(d) = bd + d3 + d - 5d - d*2 - d. Let l(u) = -u - 10. Let a be l(-10). What is z(a)? 0 Let a(v) = 4 - 5v - v2 - 3 - 4. Let r(o) = -o3 - 3o2 + 2o - 4. Let k be r(-4). Suppose -2l + l = -3t - k, 5t = -3l - 30. Calculate a(t). 3 Let b = 11/12 + -1/4. Let q(i) be the third derivative of 0i + 0i*4 + 0 + 1/120i6 + i2 - 1/12i5 + bi3. Determine q(5). 4 Let t(v) be the second derivative of -v3/6 + 2v2 - 6v. Determine t(-3). 7 Let v be ((-6)/(-9)-6)/(-1). Let n(r) = 5r - r*2 + 3 + 1 - 2r. Let h be n(v). Let m(z) = z*2 + z - 2. Give m(h). -2 Let c(i) = -1 - 3 + 0 + 1 + 2i. What is c(4)? 5 Let z(g) = -g*2 - 6g + 4. Let i(c) = c*3 - 7c*2 - c + 9. Let k be i(7). Suppose -5v - 5 = -0l + l, 0 = 4l + kv + 20. What is z(l)? 9 Let z(h) = 4h*2 + 1. Let a be z(1). Let r be (1-1)/(a/(-5)). Suppose 2m - 3 = -r. Let v(c) = 3c*3 + c - 1. Determine v(m). 3 Suppose 2d + 0d - 4 = 0. Let o(r) = 4r - 2. Determine o(d). 6 Let q(w) = -w*2 + w + 1. Let i(u) = -4u*2 + u + 8. Let s(y) = -2y*2 + 4. Let m(f) = 3i(f) - 7s(f). Let d(v) = m(v) + 3q(v). Give d(4). 7 Let d = 10 + 1. Let j = d - 7. Let o(c) = -c*2 + 3c - 4. Give o(j). -8 Suppose 0g = -8g - 88. Let d(r) = -r*2 - 10r + 9. Determine d(g). -2 Suppose -i = -5i. Suppose 4c + i = -4. Let l(j) = -2j3 - 5j*2 - j + 4. Let y(b) = 5b*3 + 9b*2 + 2b - 7. Let f(d) = 7l(d) + 4y(d). What is f(c)? -6 Let u(r) be the second derivative of r5/20 - r4/2 - r*3 - 9r*2/2 + 10r. Give u(7). -2 Let f(p) = -p*2 + 1. Suppose 3o - 5 = -2z - 16, -z = -4o. Calculate f(o). 0 Let d(w) = w*3 + 2w*2 - w + 1. Let g be (-1 + 0)(-2 - 6). Let k = 5 - g. Determine d(k). -5 Let z = -13 + 8. Let u(w) = 3 + w*3 - 4 + 2w*3 - 2w*3 - w. Let j(b) = -7b*3 - 5b*2 + 6b + 1. Let v(h) = -j(h) - 6u(h). Calculate v(z). 5 Let a(m) = -3m + 8m2 + 3m. Suppose 3 = v + 4w + 11, -5v = -2w - 26. Suppose vs + 3 = 7. Give a(s). 8 Let c(b) be the first derivative of -b*4/4 - 5b3/3 + b2 + 5b - 16. Determine c(-5). -5 Let x(l) = 3l - 3. Let n be x(3). Let p(z) = 2z - 3. Give p(n). 9 Let q(b) = -1 + b + 0b + 2. Let m be q(-4). Let v(d) = -30d2 + 0d + 32d2 + 4d + 2. What is v(m)? 8 Let m(g) be the first derivative of g*4/12 - 7g*3/6 + 2g*2 - 2g + 2. Let d(u) be the first derivative of m(u). What is d(5)? -6 Let o(v) be the third derivative of -v6/60 - v5/20 - v4/12 - v3/2 + 4v2. Let c be o(-2). Let l(b) = 2b - 7. Give l(c). 3 Let o(n) = n*2 + n - 1. Let q(l) = 2l + 1. Let y = 2 + -1. Let k be q(y). Suppose -4c + k = 15. Give o(c). 5 Suppose 3z + d = 24, -4z - 3d - 2d = -21. Suppose 2j + 2j = 4p - 20, 5j = -3p - z. Let a(f) = -f*3 + 2f2 + f. Determine a(p). 2 Let p(x) be the third derivative of -x5/60 + 5x4/24 + x3 - x2. Determine p(7). -8 Suppose -3o + o + 27 = -5i, 3i - 3o + 18 = 0. Let g(h) = 7h + 1. Let p be g(1). Let a(z) = -5z + 1 + 4z - p. Calculate a(i). -2 Let p(m) be the first derivative of 1/3m3 + 2 + 1/2m*2 + m + 1/6m*4. Let l(a) be the first derivative of p(a). What is l(-1)? 1 Let y(a) be the first derivative of 4 + 9a - 2a3 - 1/4a*4 + 3/2a2. What is y(-6)? -9 Let p(b) = -b2 - b + 2. Let l = 2 + 1. Suppose 0 = w - lw. Calculate p(w). 2 Let s(x) = -x2 + 3x + 4. Let b be s(5). Let w(c) = -c*2 - 9c - 2. Calculate w(b). 16 Let r(y) = 2y2 + 4y - 2. Let f(s) = 2s2 + 3s - 2. Let c(i) = 4f(i) - 3r(i). Let v be c(0). Let j(l) = l*3 - 2l*2 - 4l - 2. What is j(v)? -10 Let i(v) = 2v2 - 2v. Let o be i(2). Let t be o - 2/((-1)/1). Let u(s) = s + 1. Determine u(t). 7 Let l(x) be the third derivative of x*2 - 1/120x*6 + 0 + 1/30x*5 - 1/24x*4 + 0x + 1/2x3. What is l(3)? -9 Let o(n) = n + 1. Let b be (-2 - -4 - 1)5/5. Give o(b). 2 Let s(w) = w + 2. Let q be (-2)/6 + (-8)/3. Let g(z) = -z*3 - 3z*2 - 3z - 4. Let r be g(q). Suppose 4x = r + 15. What is s(x)? 7 Let f(k) be the third derivative of -k4/12 + 5k*3/6 - 41k2. What is f(8)? -11 Let s(l) = -l3 + 7l2 - 7l + 4. Let h be s(6). Let x(k) = -7k2 - 3k - 2. Calculate x(h). -24 Let b = -13 + 19. Let x = -4 + b. Let d(u) = -3 - 2u2 + 2 - u + 3. Give d(x). -8 Let r(c) = -c - 3. Let t be r(0). Let p be (-3 - 11/t)-9. Let g(w) = -w*2 - 6w - 7. Give g(p). -7 Let u(n) = n*2 + 3n - 6. Let h be 15/(-5) + -1 + -1. What is u(h)? 4 Let x(v) = -v*2 + 5v - 1. Let r(f) = f*2 + 6f + 5. Let g be r(-6). Calculate x(g). -1 Let x be (2/(-4))/((-9)/36). Suppose 6 + x = -p - 4a, -5a - 10 = -3p. Let j(c) = c3 + c2 + c + 6. Calculate j(p). 6 Let n(h) = -7h - 11. Let o(r) = 18r - 33r - 5 + 12r. Let f(j) = 2n(j) - 5o(j). Determine f(-4). -1 Let r(b) = b2 - 9. Let t be 2/(-1) - (1 - 0). Let o = 3 - t. Let d(f) = f - 6. Let c be d(o). Calculate r(c). -9 Suppose 4k + 4 + 6 = -5w, -3k = 15. Let v(a) = -2 + a*3 + 6a*w - 2 + 4a - a. Give v(-5). 6 Let t(b) = b3 + b2 + b. Suppose 4z + 0i - 2i - 14 = 0, -i = -4z + 15. Suppose 0 = 4o + z + 4. What is t(o)? -6 Let o(f) be the first derivative of 0f*3 - 1 + 0f*2 + 3/4f*4 - f. Suppose -2 = -4u + 2m, -4u - u + 5m = 0. What is o(u)? 2 Let n = -8 + 8. Suppose d + 4m = 2m + 2, n = d - m - 5. Suppose -3w - 2 = d. Let i(r) = -r - 2. What is i(w)? 0 Let w(s) = -s**2 - 1. Let c = 4 - -4. Let p = 9 - c. What is w(p)? -2	{ "pile_set_name": "DM Mathematics" }
24? False Does 147 divide 553082? False Is 702 a factor of 1724112? True Is 12 a factor of 769317? False Is 132 a factor of 122797? False Is 38 a factor of 5342889? False Is 2319684 a multiple of 102? True Is 1831249 a multiple of 15? False Does 131 divide 109988? False Is 5096936 a multiple of 134? False Is 174 a factor of 5569919? False Does 305 divide 736052? False Is 3041980 a multiple of 22? False Does 454 divide 18921358? True Is 38859 a multiple of 69? False Is 6 a factor of 6941017? False Is 33878899 a multiple of 233? True Is 20 a factor of 972800? True Does 187 divide 1114146? True Is 3673138 a multiple of 7? True Does 80 divide 819186? False Is 27422 a multiple of 41? False Does 18 divide 1087690? False Is 431 a factor of 175177? False Is 18 a factor of 216682? False Does 28 divide 218232? True Is 337 a factor of 291168? True Is 131 a multiple of 20? False Is 1674175 a multiple of 835? True Does 36 divide 705492? True Is 19226262 a multiple of 66? True Is 13 a factor of 1202175? True Does 7 divide 17517218? False Does 14 divide 880138? True Is 352768 a multiple of 52? True Is 3413410 a multiple of 1694? True Does 171 divide 58256? False Is 101656 a multiple of 17? False Does 35 divide 1388342? False Does 25 divide 288825? True Does 33 divide 9791913? False Does 66 divide 531432? True Is 10 a factor of 4685496? False Is 129366 a multiple of 173? False Is 20 a factor of 4992438? False Is 1847274 a multiple of 31? False Does 16 divide 3025058? False Does 16 divide 1692112? True Is 394 a factor of 143810? True Is 9857492 a multiple of 297? False Is 4 a factor of 27517? False Is 121230 a multiple of 6? True Is 881 a factor of 1606944? True Is 12 a factor of 595966? False Is 156889 a multiple of 484? False Does 12 divide 148408? False Does 622 divide 1357204? True Does 34 divide 88530? False Does 654 divide 915600? True Does 7 divide 114366? True Is 22 a factor of 26598? True Is 210 a factor of 35543? False Does 80 divide 346470? False Is 221480 a multiple of 245? True Does 11 divide 65410? False Is 55 a factor of 1344860? True Is 259 a factor of 13425524? True Does 342 divide 189442? False Is 4 a factor of 374872? True Is 1824519 a multiple of 753? True Is 494410 a multiple of 5? True Does 48 divide 48912? True Is 199 a factor of 350117? False Does 8 divide 618992? True Is 149 a factor of 681478? False Is 125530 a multiple of 73? False Is 424424 a multiple of 56? True Is 364918 a multiple of 132? False Is 9 a factor of 41751? True Does 99 divide 3319576? False Is 393550 a multiple of 8? False Is 21 a factor of 582057? True Is 33 a factor of 7927260? True Does 93 divide 2550387? False Does 31 divide 2445691? False Is 124071 a multiple of 225? False Is 82804 a multiple of 21? False Does 15 divide 102795? True Is 18 a factor of 505854? True Is 42907 a multiple of 32? False Is 663681 a multiple of 33? False Does 36 divide 349308? True Is 12610179 a multiple of 9? True Is 16 a factor of 25459? False Is 20 a factor of 725040? True Does 157 divide 32696783? False Does 17 divide 25687? True Does 79 divide 130626? False Is 542 a factor of 175608? True Does 21 divide 2780524? False Is 4349928 a multiple of 11? True Does 29 divide 264074? True Does 26 divide 65077? False Is 412 a factor of 225364? True Is 378392 a multiple of 7? True Is 5406 a multiple of 256? False Is 2037 a factor of 1672377? True Is 119459 a multiple of 35? False Does 341 divide 190001? False Is 4215900 a multiple of 690? True Is 27 a factor of 905580? True Does 16 divide 177103? False Is 34 a factor of 26325? False Is 24 a factor of 21404? False Is 1752534 a multiple of 294? True Is 241462 a multiple of 37? True Is 19 a factor of 2679? True Is 188775 a multiple of 143? False Is 9094596 a multiple of 14? True Is 11 a factor of 7556615? True Does 38 divide 210709? False Is 539040 a multiple of 160? True Does 143 divide 6469374? False Is 56 a factor of 5040? True Is 135736 a multiple of 38? True Does 7 divide 30904? False Is 89 a factor of 526209? False Is 90 a factor of 157770? True Is 3136472 a multiple of 571? False Is 120960 a multiple of 12? True Does 29 divide 4151118? True Does 28 divide 501651? False Is 41 a factor of 235402? False Is 132 a factor of 3173808? True Does 62 divide 354616? False Is 23 a factor of 55469? False Is 19 a factor of 289645? False Is 8108177 a multiple of 49? True Is 21962400 a multiple of 300? True Is 1025932 a multiple of 229? False Is 85 a factor of 2749653? False Does 12 divide 298562? False Does 54 divide 48762? True Is 77 a factor of 306117? False Does 7 divide 1481? False Is 91 a factor of 180677? False Is 272664 a multiple of 12? True Is 25 a factor of 1508216? False Does 61 divide 263337? True Is 24 a factor of 297576? True Is 10 a factor of 1080920? True Is 17 a factor of 3529? False Does 78 divide 43473? False Is 96 a factor of 492444? False Does 192 divide 262350? False Does 47 divide 1749935? False Is 26243 a multiple of 7? True Is 115 a factor of 15065? True Is 52 a factor of 2023216? True Does 66 divide 2730156? True Is 146 a factor of 26134? True Does 12 divide 14117988? True Is 2236526 a multiple of 923? False Is 55 a factor of 2944643? False Is 90219 a multiple of 36? False Does 119 divide 3426574? False Is 1874635 a multiple of 17? False Does 20 divide 381782? False Is 28 a factor of 117768? True Does 6 divide 21449? False Is 195839 a multiple of 12? False Does 10 divide 109340? True Is 316476 a multiple of 298? True Is 20 a factor of 738248? False Is 5756804 a multiple of 7? False Is 13 a factor of 6126302? True Is 23 a factor of 931684? True Does 43 divide 24740501? False Is 61940 a multiple of 10? True Is 2825340 a multiple of 1470? True Is 120 a factor of 173640? True Is 5 a factor of 663225? True Does 33 divide 288911? False Does 362 divide 17738? True Does 686 divide 155142? False Is 164226 a multiple of 219? False Is 77045 a multiple of 17? False Is 639147 a multiple of 177? True Is 246 a factor of 7428160? False Does 431 divide 192226? True Does 14 divide 217574? True Does 196 divide 933744? True Is 716649 a multiple of 52? False Is 1268715 a multiple of 43? True Is 173801 a multiple of 4? False Does 10 divide 25620? True Is 40 a factor of 50? False Does 13 divide 11635? True Does 308 divide 18319113? False Is 12 a factor of 806700? True Is 1541272 a multiple of 157? False Is 1985455 a multiple of 1047? False Does 121 divide 92323? True Does 18 divide 10596662? False Does 128 divide 2099968? True Is 362604 a multiple of 134? True Is 263 a factor of 331030? False Does 40 divide 285083? False Is 35 a factor of 177520? True Does 36 divide 5003244? True Does 35 divide 4259134? False Is 2750471 a multiple of 306? False Is 5757331 a multiple of 41? False Is 231198 a multiple of 15? False Is 59 a factor of 2887? False Does 28 divide 52675? False Is 75 a factor of 217050? True Is 769942 a multiple of 464? False Is 156 a factor of 356756? False Does 181 divide 2253450? True Is 83 a factor of 633622? True Is 66 a factor of 258473? False Is 11 a factor of 2948? True Is 93 a factor of 930? True Is 11 a factor of 19848224? True Is 5782784 a multiple of 128? True Is 43 a factor of 7283954? False Is 42615 a multiple of 316? False Is 5933166 a multiple of 32? False Is 7 a factor of 178269? True Does 1412 divide 11294588? True Is 569592 a multiple of 324? True Is 1313 a factor of 2970832? False Is 11 a factor of 142231? False Does 311 divide 803035? False Does 52 divide 7332? True Is 11 a factor of 16798760? True Is 3278133 a multiple of 649? False Does 476 divide 81396? True Is 379457 a multiple of 17? True Is 3 a factor of 171693? True Is 58014 a multiple of 23? False Does 15 divide 478142? False Does 476 divide 2909696? False Is 825 a factor of 8233333? False Does 5 divide 1319195? True Does 48 divide 22272? True Is 562025 a multiple of 7? False Does 60 divide 246516? False Is 1550070 a multiple of 90? True Does 32 divide 694336? True Does 1125 divide 31360500? True Is 16 a factor of 274468? False Is 57 a factor of 17237? False Is 6 a factor of 202094? False Is 21760 a multiple of 136? True Is 72864 a multiple of 198? True Does 90 divide 5437800? True Is 31 a factor of 2074489? True Is 25 a factor of 3201371? False Does 1233 divide	{ "pile_set_name": "DM Mathematics" }
ed without replacement from {s: 1, h: 2, l: 9, z: 4, n: 4}. 4/95 What is prob of picking 4 r when four letters picked without replacement from ntrntrtrnnrrnnnnt? 1/476 Three letters picked without replacement from bbgbgbgb. What is prob of picking 3 g? 1/56 Four letters picked without replacement from fyxxwsa. Give prob of picking 1 a, 1 s, 1 y, and 1 f. 1/35 What is prob of picking 1 n and 1 r when two letters picked without replacement from pwllnlrrnr? 2/15 Calculate prob of picking 3 l when three letters picked without replacement from {l: 4, b: 10}. 1/91 Three letters picked without replacement from eieaiajajaae. Give prob of picking 3 e. 1/220 Three letters picked without replacement from {x: 3, g: 5, m: 2}. Give prob of picking 3 g. 1/12 Three letters picked without replacement from xpilullxpixixl. Give prob of picking 1 x and 2 p. 1/91 Three letters picked without replacement from acwaawaccwwyayw. Give prob of picking 2 y and 1 c. 3/455 Calculate prob of picking 1 z and 1 j when two letters picked without replacement from jfxjxfzzffzxfxx. 2/35 What is prob of picking 1 p and 2 j when three letters picked without replacement from {i: 8, p: 1, v: 1, j: 4, o: 1, b: 1}? 3/280 Four letters picked without replacement from {g: 3, w: 4, l: 1}. What is prob of picking 2 w and 2 g? 9/35 Three letters picked without replacement from mdmdgmrdrrrr. What is prob of picking 3 d? 1/220 Four letters picked without replacement from {j: 9, c: 9}. What is prob of picking 3 j and 1 c? 21/85 What is prob of picking 1 z and 1 n when two letters picked without replacement from nnfozlzwl? 1/9 Calculate prob of picking 1 o and 1 c when two letters picked without replacement from ccboooooococoococooc. 42/95 Three letters picked without replacement from {w: 1, n: 2, d: 8, v: 1, m: 5}. Give prob of picking 1 d, 1 w, and 1 v. 1/85 Calculate prob of picking 1 v, 1 s, and 1 a when three letters picked without replacement from {a: 3, z: 2, x: 1, s: 3, t: 3, v: 1}. 9/286 Two letters picked without replacement from {s: 2, a: 2, c: 1}. Give prob of picking 1 s and 1 c. 1/5 Two letters picked without replacement from uuui. Give prob of picking 1 u and 1 i. 1/2 Three letters picked without replacement from {b: 2, j: 11, m: 4, y: 2}. What is prob of picking 2 m and 1 b? 4/323 Two letters picked without replacement from {n: 2, h: 1, p: 1, u: 1}. Give prob of picking 2 n. 1/10 What is prob of picking 3 o when three letters picked without replacement from {g: 8, o: 3}? 1/165 What is prob of picking 1 c and 2 q when three letters picked without replacement from cqcyqycq? 9/56 Calculate prob of picking 1 m and 2 x when three letters picked without replacement from {c: 3, x: 1, y: 3, m: 6}. 0 What is prob of picking 2 q when two letters picked without replacement from soitoqifqfos? 1/66 Two letters picked without replacement from {d: 1, g: 1, y: 2, a: 1, h: 1, i: 1}. What is prob of picking 1 h and 1 a? 1/21 Four letters picked without replacement from ammaxxxmxmx. What is prob of picking 2 x and 2 a? 1/33 Calculate prob of picking 2 k and 1 b when three letters picked without replacement from {s: 2, e: 2, n: 2, b: 4, k: 2}. 1/55 Four letters picked without replacement from {j: 4, y: 3, w: 6, o: 2}. Give prob of picking 2 o, 1 j, and 1 y. 4/455 Three letters picked without replacement from vpprrrfprrrpppfppvp. Give prob of picking 3 r. 20/969 Calculate prob of picking 2 c and 2 t when four letters picked without replacement from {w: 1, j: 2, t: 3, c: 6}. 1/11 Three letters picked without replacement from qqqqqqqeqqeq. What is prob of picking 2 q and 1 e? 9/22 Three letters picked without replacement from {u: 1, t: 1, j: 2, d: 7, c: 2, n: 1}. Give prob of picking 1 t, 1 c, and 1 n. 1/182 What is prob of picking 2 z when two letters picked without replacement from {q: 3, z: 3, o: 13}? 1/57 Three letters picked without replacement from {x: 3, d: 2, s: 5, h: 10}. What is prob of picking 3 x? 1/1140 Calculate prob of picking 3 o when three letters picked without replacement from eeo. 0 Two letters picked without replacement from {i: 1, p: 1, z: 1, r: 1, d: 1}. What is prob of picking 1 p and 1 d? 1/10 Four letters picked without replacement from ufuuffuffu. Give prob of picking 2 f and 2 u. 10/21 Two letters picked without replacement from swsrrirrsqi. Give prob of picking 2 s. 3/55 Three letters picked without replacement from prrwo. Give prob of picking 1 r, 1 w, and 1 o. 1/5 Calculate prob of picking 2 p when two letters picked without replacement from pqppppppq. 7/12 Four letters picked without replacement from ksxkbxx. What is prob of picking 2 k and 2 x? 3/35 Three letters picked without replacement from ppepppppppppppepee. What is prob of picking 1 p and 2 e? 7/68 Three letters picked without replacement from pppqqppqpq. Give prob of picking 3 q. 1/30 Four letters picked without replacement from {w: 2, s: 7, i: 1}. Give prob of picking 1 w and 3 s. 1/3 Three letters picked without replacement from szoozozos. What is prob of picking 2 s and 1 o? 1/21 Calculate prob of picking 2 u when two letters picked without replacement from {u: 4, k: 9, g: 6}. 2/57 Four letters picked without replacement from ynvvvyyyynyy. Give prob of picking 2 v and 2 n. 1/165 Four letters picked without replacement from {j: 1, z: 18}. What is prob of picking 4 j? 0 Calculate prob of picking 2 d and 1 u when three letters picked without replacement from {f: 7, u: 2, d: 3, z: 3}. 6/455 What is prob of picking 2 k and 1 u when three letters picked without replacement from vkkkvkmmu? 1/14 What is prob of picking 1 q, 1 k, and 1 g when three letters picked without replacement from {k: 1, g: 13, q: 1}? 1/35 Two letters picked without replacement from {f: 1, y: 1, n: 1, a: 1, q: 1}. What is prob of picking 1 n and 1 f? 1/10 Calculate prob of picking 2 g when two letters picked without replacement from {g: 6}. 1 Two letters picked without replacement from {s: 2, g: 3, y: 1, b: 3, r: 1}. Give prob of picking 1 s and 1 b. 2/15 Calculate prob of picking 2 k when two letters picked without replacement from {k: 10}. 1 What is prob of picking 1 o and 3 k when four letters picked without replacement from {o: 1, k: 12}? 4/13 Three letters picked without replacement from {w: 3, g: 4, z: 2, k: 2, l: 7}. Give prob of picking 1 w and 2 g. 3/136 Two letters picked without replacement from aakvkannsaanaaanaana. What is prob of picking 1 a and 1 k? 11/95 Calculate prob of picking 1 w and 1 r when two letters picked without replacement from {s: 4, r: 6, w: 4, n: 1}. 8/35 Calculate prob of picking 1 m and 1 g when two letters picked without replacement from hkggmghggw. 1/9 Calculate prob of picking 2 w and 1 l when three letters picked without replacement from {g: 2, e: 1, o: 2, w: 2, l: 12}. 4/323 Two letters picked without replacement from {k: 1, t: 2, f: 1, l: 1}. What is prob of picking 1 l and 1 k? 1/10 Three letters picked without replacement from {h: 3, f: 1}. What is prob of picking 1 f and 2 h? 3/4 Three letters picked without replacement from {s: 1, o: 4, f: 3, b: 1, d: 5, x: 6}. What is prob of picking 1 b, 1 s, and 1 x? 1/190 Two letters picked without replacement from asvskxk. What is prob of picking 1 v and 1 x? 1/21 Two letters picked without replacement from ooooooofooofoooooff. Give prob of picking 2 o. 35/57 What is prob of picking 2 l and 1 h when three letters picked without replacement from {h: 2, f: 1, j: 1, l: 2}? 1/10 What is prob of picking 2 n and 2 u when four letters picked without replacement from uununuu? 2/7 Three letters picked without replacement from {p: 5, r: 11}. Give prob of picking 1 r and 2 p. 11/56 What is prob of picking 1 t and 1 b when two letters picked without replacement from bbkddkbtbbddvddn? 1/24 Two letters picked without replacement from {e: 5, g: 1, x: 1, z: 1, l: 3, w: 2}. Give prob of picking 1 l and 1 x. 1/26 Calculate prob of picking 3 k when three letters picked without replacement from krrrzzkkzkrkkzzzk. 7/136 What is prob of picking 1 i, 1 o, and 2 b when four letters picked without replacement from oboopooooooooooqboi? 7/1938 Calculate prob of picking 2 z and 1 h when three letters picked without replacement from zzkxxhoqqxxkkxxhqo. 1/408 Calculate prob of picking 1 z	{ "pile_set_name": "DM Mathematics" }
. Let h(o) be the first derivative of p(o). Determine h(q(j)). 9j2 Let m(n) = 26n*2. Let i(g) = -199g. What is m(i(z))? 1029626z2 Let x(p) = 5p - 3p - 2p + 24p2. Let k(a) = -a. Determine k(x(z)). -24z*2 Let t(l) = 19l2 + 13. Let a(g) = g2. Give t(a(y)). 19y4 + 13 Let a(r) = -22r - 3. Let u(i) = i + 34. Calculate a(u(j)). -22j - 751 Let y(q) = -q. Let v be y(-2). Let i(o) = 4o2 + ov - 4o2. Let d(g) = -2g*2. What is i(d(x))? 4x*4 Suppose -13 = 3g - 2p - 2p, 0 = -5p + 5. Let s(r) = 11r + 5. Let n(m) = -6m - 3. Let x(c) = gs(c) - 5n(c). Let b(t) = 2t*2. Calculate x(b(v)). -6v*2 Let o(u) = -5u*2 + 8u. Let f(r) = -r. Give o(f(n)). -5n2 - 8n Let d(a) = -4a. Let n(q) = -q - 3. Let y be n(-4). Let s(u) = 0 + 4u - 4 - y. Let p(z) = -6z + 8. Let x(l) = 5p(l) + 8s(l). Determine d(x(f)). -8f Let a(w) = -44w2 - 4. Let r(j) = 72j. What is r(a(z))? -3168z2 - 288 Let p(a) be the third derivative of -a4/24 - 2a2. Let s(y) = -y2 - 5y + 5. Let i(v) = 1 - 2 - 2v + 3. Let h(t) = 5i(t) - 2s(t). What is p(h(q))? -2q2 Let p(i) = -7i. Let o(f) = -7f + 11. Let u(q) = -4q + 6. Let y(z) = -6o(z) + 11u(z). Calculate y(p(k)). 14k Let w(k) = 13k*2. Let c(s) = 24s*2. Give w(c(d)). 7488d*4 Let z(h) = -h. Let a(p) = 134p + 1. Determine a(z(r)). -134r + 1 Let w(q) = 18q*2 - 7q + 13q2 + 7q. Let v(m) = -2m. What is w(v(d))? 124d2 Let b(a) be the third derivative of -a4/24 - 21a2. Let x(m) = 20m*2 + 2. Calculate b(x(l)). -20l*2 - 2 Let w(h) = 5h*2. Let c(t) = -3t. Let f(l) = 6l. Let z(q) = 5c(q) + 3f(q). Give w(z(s)). 45s*2 Let u(c) = -c. Let w(q) be the second derivative of 0q*2 - 5/3q*3 + 0 - 11q. Calculate w(u(v)). 10v Let v(l) = l3 + 7l*2 - 2l - 14. Let y be v(-7). Let b(d) be the second derivative of y + 0d2 - 2d + 1/3d4 + 0d*3. Let c(n) = n. What is c(b(o))? 4o*2 Let a(r) = 4878r*2. Let s(m) = -4m. Determine s(a(u)). -19512u2 Let o(d) = -d. Let l(q) be the second derivative of 37q*4/12 - 34q. Calculate l(o(k)). 37k2 Let c(u) = 6u + 14 - 14. Let t(m) = -10m. What is t(c(n))? -60n Let s(l) = -2l2. Let u(f) = -7f. Let h(j) = -112j. Let i(k) = 3h(k) - 49u(k). Calculate i(s(w)). -14w*2 Let f(p) = -8p - 2. Let x(l) = -3l + 2. Let h(a) = -7a + 5. Let t(z) = -2h(z) + 5x(z). Determine t(f(m)). 8m + 2 Let y(o) = 2o*2 + 392o. Let l(x) = -2x. What is y(l(n))? 8n*2 - 784n Let b(n) = -38n2 - 1. Let o(u) = u2. Give o(b(v)). 1444v*4 + 76v*2 + 1 Let r(z) = 12z*2. Let u(i) = 2i. Determine r(u(s)). 48s2 Let q(w) = -163w + 17. Let f(z) = z. Calculate f(q(o)). -163o + 17 Let o(l) = l2. Let z(u) = 1. Let n(g) = -17g - 153. Let j(d) = -2n(d) - 306z(d). What is o(j(x))? 1156x2 Let b(y) = -1830y*2 - 2. Let h(v) = -3v*2. Calculate b(h(p)). -16470p*4 - 2 Let w(b) = 104b - 23. Let c(k) = 2k. Determine w(c(g)). 208g - 23 Let v = 9 - 7. Let w(b) = -7b + 0b - vb. Let d(c) = -2c*2. Calculate w(d(t)). 18t2 Let z(s) = -s. Let k(h) be the second derivative of -h3/2 - 4h. Calculate k(z(t)). 3t Let n(s) = 18s. Let m(y) = -29y*2. Give m(n(r)). -9396r*2 Let y(k) = -3k*2. Let m(l) = 6l. Calculate m(y(t)). -18t2 Let f(r) = -r. Let q(u) = 17u. Let j(i) = -18i. Let z(l) = 4j(l) + 5q(l). Determine f(z(w)). -13w Let n(t) = t*2. Let x(f) = 2f. Let w(j) = -j. Let p(a) = -3w(a) - 2x(a). Calculate p(n(d)). -d2 Let q = -1 + 7. Let x(c) be the third derivative of -c4/6 - 6c2. Let r(h) = 3h. Let t(l) = qr(l) + 5x(l). Let f(w) = 7w. Give f(t(a)). -14a Let a(z) = z*2. Let s(l) = 12l*2 - 4l - 4. Let b(p) = 24p2 - 9p - 9. Let u(r) = -4b(r) + 9s(r). Calculate a(u(v)). 144v4 Let q(i) = i2 + 343. Let x(z) = -6z*2. Determine q(x(k)). 36k*4 + 343 Let u(d) = 6d. Let m(h) = -16h. Calculate m(u(f)). -96f Let f(a) = 3a. Let n(m) = 9m. Let r(l) = 11f(l) - 4n(l). Let j(o) = o. Give r(j(d)). -3d Let w(p) = -41p + 35. Let r(s) = -3s. Calculate w(r(k)). 123k + 35 Let l(q) = q. Let h(r) = 115r + 2. Calculate l(h(i)). 115i + 2 Let y(l) = 2l2. Let u(s) be the third derivative of 5s*4/24 - 2s*3/3 - 21s*2. What is y(u(j))? 50j*2 - 80j + 32 Let k(x) = -3x - 3x - 11 + 11. Let r(c) = -3c. Calculate r(k(z)). 18z Let g(j) = -2j2 - 43. Let k(i) = 5i. Calculate g(k(r)). -50r2 - 43 Let t(p) be the second derivative of p4/6 + p. Let a be 5 - (-1)/(3/6). Let m(j) = 4j + a - 7. Calculate m(t(w)). 8w2 Let i(b) = 2 - 4b - 2. Let t(u) = 8u. Let o = 9 - 6. Let h(q) = -3q. Let c(z) = ot(z) + 7h(z). Determine c(i(n)). -12n Let k(a) = 2a + a + 6a - 5 - 4a - 2a2. Let r(n) = -2n*2 + 6n - 6. Let y(v) = 6k(v) - 5r(v). Let h(u) = -u*2. Determine y(h(x)). -2x4 Let t = 13 - 8. Let f(m) = -m2 + tm2 - m2. Let p(u) = -u + 0u - u. Give p(f(j)). -6j2 Let z(a) = -124a*2. Let p(q) = 8q - 8. Determine p(z(f)). -992f2 - 8 Let n(f) = -5f*2. Suppose 9 = 2g + q, 7 = 4g - 4q - 5. Let c(u) = -3u + gu - u - 2u. Calculate n(c(l)). -20l*2 Let f(k) = 5k. Let u(l) = -437l2. Determine u(f(i)). -10925i*2 Let y(a) = -4a. Let x(m) = -28m - 35m + 61m. Calculate x(y(f)). 8f Let x(l) = 2l2. Let f(u) = -1914u*2. Calculate f(x(m)). -7656m*4 Let h(d) = 2d. Let a(r) be the third derivative of -r*5/60 - 3r*2. Give a(h(s)). -4s*2 Let v be 2/(-4) + 108/(-8). Let i = -10 - v. Let p(x) = -2x - i + 4. Let m(t) = -2t2. Give p(m(l)). 4l*2 Let s(h) = -h. Suppose -3p = -0p - 12. Let d(x) = x - px + 2x - 3x. What is d(s(b))? 4b Let p(i) = -59i*2. Let y(l) = -61l. Give y(p(b)). 3599b2 Let f(l) be the first derivative of -l6/360 - l3/3 + 3. Let u(d) be the third derivative of f(d). Let i(k) = -4k. Give i(u(r)). 4r2 Let k(d) = 2d*2. Let i(n) = 2. Suppose -m + 9 = -4m. Let b(a) = a + 3. Let t(g) = mi(g) + 2b(g). Give t(k(h)). 4h2 Let w(b) be the second derivative of -5b*4/12 - b. Let c be 10/3 + (-2)/6. Let m(j) = -4j2 - j2 + cj2. Calculate m(w(t)). -50t*4 Let z(b) = -2b*2. Suppose -3 - 23 = -v. Let g(x) = 9x. Let j(r) = -2r. Let f(o) = vj(o) + 6g(o). Determine f(z(n)). -4n*2 Let y(n) = -6n + 24. Let r(c) = -1. Let b(x) = 24r(x) + y(x). Let f(a) = -a2. Determine f(b(t)). -36t*2 Let s(t) = 85t*2. Let i(q) = 7q. Give i(s(c)). 595c2 Let i(a) = -270a*2. Let g(u) = 3u. Determine i(g(d)). -2430d2 Let n(a) = -10a*2 - 4. Suppose 0 = -x - 0x + 4. Let g(f) = 81f2 + 33. Let t(m) = xg(m) + 33n(m). Let j(l) = 2l. Determine j(t(h)). -12h2 Let w(t) = 41t. Let x(r) = 9r2. What is w(x(o))? 369o*2 Let w(a) = 2 + 19a - 18a - 2. Let h be w(2). Let g(v) = hv - 4v + v. Let c(x) = -2x*2. Give g(c(j)). 2j*2 Let i(f) = 3f. Suppose 4c + 0c - 8 = 0. Let q(b) = 6b + cb + b - 4b. What is i(q(r))? 15r Let h(d) = -2d. Let l = 18 + -12. Let c(t) = -8t*2 + 7t. Let f(v) = 8v2 - 6v. Let o(n) = lc(n) + 7f(n). What is o(h(b))? 32b2 Let k(d) = -25d + 177 - 177. Let o(b) = -2b2. Give o(k(j)). -1250j2 Let o(w) = w2. Let i(t) = 5t - 1. Calculate i(o(k)). 5k*2 - 1 Let k(y) = 2y*2. Suppose 9 = -2t - 1, 0 = -3x + 5t + 25. Let v(b) = -15b + 0 + 18b + x. What is k(v(h))? 18h2 Let r(t) = 3t*2 + 4t. Let k(h) = -6h2 - 9h. Let z(j) = -4k(j) - 9r(j). Let p(x) = -53 - 56 + 109 + 3x. Determine z(p(b)). -27b*2 Let r(s) = -s. Suppose -u = -q - 6, -u = 3u + q - 4. Let d(y) = 2y - 6y - uy + 5y. What is r(d(g))? g Let b(k) = -2k. Let r(a) = -2a - 4. Let u(n) = -6 - 2n + 0 + 3. Let l(p) = -3r(p) + 4u(p). Determine b(l(o)). 4o Let v(i) = 2i2. Let w(u) = -8u*2 + 10. Suppose 3 = 3f, 4f - 4 = z + 1. Let n(c) = -c2 + 1. Let g(r) = zw(r) + 10n(r). Determine g(v(o)). -8o4 Let n(l) be the first derivative of l5/60 + l*3 + 2. Let t(o) be the third derivative of n(o). Let q(f) = f. Calculate q(t(r)). 2r Let c(y) = -2y. Let t(w) = -w2 + 4. Let v be 22/5 + 4/(-10). Let m(n) = 6 + 1 - 5n*2 + 2n*2 + 2. Let h(j) = vm(j) - 9t(j). Give h(c(g)). -12g*2 Let b(c) = -18c. Let i(t) = -3t. Let x(r) = -10r. Let d(u) = 7i(u) - 2x(u). Calculate d(b(w)). 18w Let d(z) = 2z. Let j(k) = -19*k - 4 + 6 - 2. Determine	{ "pile_set_name": "DM Mathematics" }
have the same value? False Suppose 4m - 2b = -5 + 9, 2m - 3b = -2. Suppose -4r - 20 = -5p, p - r = -0r + 4. Suppose p = 4t - 2t. Is m smaller than t? False Let i be (21/(-12))/(-7) - 381/228. Is -0.1 smaller than i? False Suppose -i - 3k + 100 = 0, -5i - 3k + 533 = k. Let m = i - 61. Do -1/2 and m have the same value? False Suppose 1 = -5f + a + 10, -4f = -4a - 20. Suppose -6j - 3q + 4 = -5j, 0 = 4j - q - 3. Let g be (14 - 14) + j2. Which is smaller: g or f? f Let y(n) = -n*2 - 37n - 18. Let p be y(-37). Is -9 equal to p? False Let u be ((-4)/5)/((-110)/(-100)). Is u greater than -0.8? True Let p(d) = d*3 + 11d*2 + 17d - 10. Let m(x) = -x*3 - 4x*2. Let o be m(-3). Let r be p(o). Which is smaller: 0 or r? r Let u = -5/173 + 397/19722. Which is greater: u or 0? 0 Suppose 4w = -6w + 20. Let l be (w + 0)(-6)/26. Which is bigger: -1 or l? l Let q = -1607 - -1232. Is -377 greater than q? False Let v be 1 + ((-24)/(-9))/2. Let t(k) be the second derivative of k*3/6 + 9k*2/2 - 3k. Let o be t(-8). Which is smaller: o or v? o Suppose 6i = 2i + 4w + 32, -2i - 3w + 11 = 0. Suppose io - 4o = 6, -2m = -3o + 4. Is m at least as big as -2/71? True Suppose 4i + 5 = 25. Suppose 2k + i + 57 = 0. Which is bigger: -32 or k? k Suppose -5h + 14 = -3h. Suppose 5a = 10, h = -j + 8a - 6a. Is j at most as big as -25/9? True Let s = 2.82 - -34.28. Let i = s - 37. Let z be (48/(-26))/1 - -2. Is z greater than or equal to i? True Let c = -0.1 - 4.9. Suppose 0 = -5g - 57 - 433. Let f be 2/(-8) + g/(-168). Which is greater: c or f? f Let y = 15 + -12. Suppose a = -y + 5. Suppose 0t + 3t = 3o - 12, -5o - t + a = 0. Which is bigger: o or -1/3? o Suppose 2g + 13 - 17 = 0. Let z be -7 - -6(1 - g/4). Is z bigger than -2/35? False Let l(y) = y3 + 5y*2 + 2y - 5. Let t be l(-5). Let i(v) = 6v3 + v2 - 4v - 2. Let w be i(-2). Let x = w + 24. Is x greater than t? True Let c = 215 - 217. Suppose f + 970 = -3t, 5f + 1983 = -5t + 353. Let v be (t/(-21))/(c/3). Is v equal to -23? True Suppose 0 = -106q + 41q. Let a = 8.5 + -6. Are q and a equal? False Let q = -3049 + 1147. Is -1902 greater than or equal to q? True Suppose 0u + 36 = -6u. Is -2 at most u? False Let o(z) = z2 - 7z + 6. Let q be o(5). Suppose 0k - 71 = -5k - b, 2k - 22 = -2b. Suppose -3 = -3s - k. Is q at most s? True Let c(v) = -v3 - v2 + v - 1. Let t be c(1). Let i be (-456)/(-376) + (t - -1). Let y = -561/235 - i. Are y and -2 non-equal? True Suppose 4l = -64 - 32. Let u be l/(-10) + 1 - 4. Which is bigger: u or 0.3? 0.3 Let c be (13/6 - 2)4. Let f = 1/3 - c. Let r = 30.8 + -31. Which is bigger: f or r? r Let r be (-2)/(-4)(-8)/4. Let c be r/(2/(-68)-2). Is c smaller than -16? True Let y be 1918/2055 + ((-6)/(-5))/(-2). Suppose -q + 3z - 4 = 4, 21 = -5q - 4z. Let b(c) = -c*2 - 5c + 1. Let k be b(q). Do k and y have the same value? False Let a = 21.16 - 19.3. Let n = -2.83 + a. Let q = -0.03 + n. Is 1 <= q? False Let i = -119 + -42. Is 0.2 equal to i? False Let u be 5/324/20. Let r be (4 - 7)/(3/u). Which is smaller: -9/5 or r? r Let n = 52 - 6. Let m = n + -33. Is m at least as big as 13? True Let g = -20 + 32. Let m be (-19)/4 - 3/g. Is -7/6 smaller than m? False Suppose -94v = -80v - 3542. Does v = 1/4? False Let k be (-9)/(-6)-2 - -209. Suppose -389 - k = -5o. Let s = 953/8 - o. Are 1/3 and s unequal? True Let i = 1894 - 1894. Suppose -s - 142 = -3s. Let j be -2 - ((-286)/s - -2). Is i equal to j? False Suppose -15s = 4s - 19. Is -1/1649 bigger than s? False Let r = 20 - 18. Suppose -2b = -b - rb. Is -6 smaller than b? True Let g be 5/(-28) - 2/(-8). Suppose -3o - 9 = b - 8, -b - 3 = o. Which is bigger: o or g? o Let m be 2813(-2)/(-24). Which is bigger: m or 137? 137 Suppose 0n - 4n = 0, -2r + 3n = -22. Suppose -4f - 2o + 3 = -r, f + 5o - 26 = 0. Which is smaller: f or -2/5? -2/5 Suppose -3s + 2s + 3 = 0. Suppose -su + g = 12, 5g - g = -u + 9. Is -4 greater than u? False Let w = 217 + -137. Which is smaller: 79 or w? 79 Suppose -7g - 310 = -44. Let h = g + 24. Which is bigger: h or -15? h Suppose -4r - 5 = -h - 0h, 1 = -r. Let d be 0 - ((-121)/28 + 4). Let l = 4/7 - d. Are h and l non-equal? True Let s(i) = 2i - 10. Suppose -m + 2h = -4m + 39, -4h = -4m + 52. Let a be s(m). Is a bigger than 16? False Let d be (-4)/(16/(-20)) - (11 - 6). Let m = 662 - 1103. Let w = m + 3964/9. Which is smaller: d or w? w Let u = -49883/10 - -4982. Let j = 79/30 + u. Is -5 equal to j? False Let v = -137 - -547/4. Let f be (38/8)/(1/(-4)). Is f less than or equal to v? True Suppose -60l - 354 = -54l. Which is bigger: l or -57? -57 Let k(i) = i*2 - 12i - 7. Let n be k(9). Which is smaller: n or -35? -35 Let o = -846 + 847. Let p be (-964)/2380 + 3/7. Is p <= o? True Suppose -5 = -3o + 49. Suppose 2s = -3v + 51, 3s - 4v + 13 = 47. Are o and s unequal? False Let q(c) = c3 - 7c*2 - 6c - 8. Let o be q(8). Suppose 0 = 4g - 12 - o. Let s be 1/g - 12/(-120). Which is greater: s or 1? 1 Suppose 0 = -27x + 157 - 130. Which is smaller: -6/401 or x? -6/401 Let s = 108761/1148 + -379/4. Is s less than -1? False Suppose -5 + 1 = -4a. Let i be (-5 + -1)/(20/35). Let t = i + 11. Which is greater: a or t? a Let x be (6/(-7))/(5/(-35)). Suppose 2q = xq - 12. Is q > 3? False Let d(m) be the first derivative of m3/3 - 11m*2/2 - 9m + 11. Let w be d(12). Let s be (1 - 1) + -3 - -5. Is s != w? True Suppose -j - 12 = 5r, -3r + 6 + 0 = 5j. Suppose -2t - jd = 1 - 16, -2t - 5d + 17 = 0. Suppose l = 7 - t. Which is greater: 4/17 or l? l Let g = 118.6 + -119. Is g < 29? True Let f be (-1)/5-1388/(-4). Which is bigger: -18 or f? -18 Suppose -4d = 7d - 693. Let h be 32/(-72) - (-1)/d. Which is greater: 0.1 or h? 0.1 Let q be 4/(-1)27/(-6). Suppose -2a + q = -0a. Suppose -ab + 7b + 38 = 0. Is b greater than or equal to 18? True Let i = -811 - -799. Let b = -9 - -17. Let w be 3/(i/b)-4. Which is smaller: 9 or w? w Let j = -6 - -17/3. Let l(g) = 7g - 22. Let i be l(4). Let r = -7 + i. Do r and j have the same value? False Let u = -7 + 11. Suppose 3r + 1 = 2t - u, 0 = 4r - 3t + 6. Suppose -2a - 3w = -0 + 4, 0 = 4a - 5w + 8. Is a smaller than r? False Let s(f) = -f*3 + 7f*2 - 23f + 16. Let q be s(5). Are -40 and q equal? False Let m be 19 - 8/(-1) - (-4 - 1). Which is smaller: 36 or m? m Suppose 5p - w = -295, -2p - 2w - w = 135. Let q be 705/p + 2/(-8). Let a be q/810/(-33). Is a < -1? False Let u = 232.06 + -232. Is u greater than or equal to 6? False Let o be 39/(-637)(-6)/(-9). Which is smaller: o or 1? o Let x = 12993/1048 + -99/8. Is x < 1? True Let j(b) = -b3 - 9b*2 + 12b + 8. Let n be j(-10). Suppose -10 - 20 = 3p. Is p not equal to n? True Let m = -656.2 - -664. Which is smaller: m or -3? -3 Let k be 5/153/11. Which is bigger: k or 3/167? k Let s(t) = t - 3. Suppose -b + 3 = -2. Let g be s(b). Which is bigger: 0.17 or g? g Suppose -g + 0b - 5b - 21 = 0, 0 = 5g + b + 81. Let q = 432 + -448. Is q at most as big as g? True Let v = 0.2 + 3.8. Let s = -75 - -183. Let n = s + -110. Is n smaller than v? True Suppose 0 = 2t - 0 - 10. Let x be -1 - (-4 - t - -3). Suppose 2f + 12 = xf. Is -0.2 at least as big as f? False Let l = 0.045 + -0.009. Let q = -8.964 - l. Are 0.1 and q unequal? True Let t(j) = 3j*3 - 8j*2 - 2j - 3. Let o be t(3). Is o bigger than -5/11? True Suppose 5g - 7g - 466 = -3c, 2c = -g + 299. Is -3 != c? True Let g = -23 - -6. Let n = g - -17.1. Which is smaller: n or -12? -12 Let a = -80/989 + 2012/989. Which is greater: a or 1? a Let n be 12/28 - 66/154. Which is bigger: 3/488 or n? 3/488 Let y(q) = 29q + 2. Let m be y(1). Let s = -26 - -57. Does m = s? True Suppose 1 + 20 = -21m. Let r(i) = -i*3 - 5i*2 + 1. Let a be r(-4). Which is bigger: a or m? m Let q = 20716/595 - 174/5. Which is smaller: -1 or q? -1 Let s = -213.89 - -213. Let i = s - -0.49. Which is smaller: i or -0.1? i Let o = 48.3 - 51. Let i = 2.57 + o. Let p = -0.07 + i. Is p > 4? False Let m = -3335/9 - -11194/45. Which is greater: m or -121? -121 Suppose -3i + 6 + 3 = 0, -l - 5i - 206 = 0. Is -218 equal to l? False Let p be 420/(-24)(-8)/10. Let w be 4/p - 120/(-70). Is	{ "pile_set_name": "DM Mathematics" }
(b) k (c) i c Let m = 0.2 - 0.3. Let z = 2443/2 - 5103/4. Let n = 54 + z. Which is the nearest to n? (a) -1/3 (b) 1/3 (c) m a Let p be (1 + 1)/2 + -5. Which is the closest to 1/6? (a) p (b) -1/5 (c) -5 b Let z = 118 + -117.7. What is the closest to 0 in z, 5, -2/19? -2/19 Let v be (3 - (-56)/(-26)) + -1. Let r be 1 - -1 - 51. Which is the closest to 0.1? (a) v (b) r (c) 2 a Let p = -0.09 - -0.09. Let v = 15/56 + -1/8. Let u = -0.3 - -0.4. What is the closest to u in 2, p, v? v Let o = -74.3 + 80. Let t = o + -6. Let f = 4 + -3. Which is the nearest to f? (a) -2 (b) 2 (c) t b Let k = -1.8 + -0.2. Let q = 7 - 7.3. Which is the nearest to -1? (a) q (b) 0.3 (c) k a Let t = -73 - -50. Let k = 22 + t. Which is the closest to 1? (a) -2 (b) 2 (c) k b Let h = -3 + 9. Let u = h + -8. Which is the nearest to -2? (a) -0.2 (b) -2/9 (c) u c Suppose -2m - 2m = 20. Let y = -4 - m. Let g be 4/(-8) - (-2)/y. Which is the closest to -0.1? (a) g (b) -5 (c) 1/5 c Let l be -2(0 + -1)/(-4). What is the closest to 1/4 in 0.3, 0.1, l? 0.3 Let j = 6.7 - 6.63. What is the closest to 1/3 in -0.3, j, 0.5? 0.5 Let s = 9 + -15. Let v be 48/(-21) - s/3. Which is the closest to v? (a) -2/5 (b) -0.2 (c) -0.1 b Let d = 22 + -27. Which is the closest to 1? (a) d (b) 3 (c) 2 c Let q be (-638)/(-1122) - 2/6. What is the closest to -0.2 in q, 0.4, 2? q Let m = -21 + 21. Let q = 0 + -0.2. Let z = 0.46 + -0.06. What is the nearest to m in z, -3/5, q? q Let f(w) = -w*3 - 5w*2 - 2w + 3. Let t be f(-4). What is the closest to 2 in 0.3, t, -0.1? 0.3 Let l = 7 + -7.3. Let z = l + -0.2. Let d be (0(-1)/(-2))/(-1). Which is the nearest to d? (a) 1 (b) z (c) -4/7 b Let m = -0.4 + 0.8. Let b = -15 - -10. What is the closest to 1 in 2/21, b, m? m Let x = -192 - -767/4. What is the nearest to x in 0.5, -2, 4? 0.5 Let h = 2 - 4. Which is the closest to -2? (a) -3/2 (b) 0 (c) h c Let u = 5 + -10. Let i = -2.19 - -0.19. Which is the nearest to -2/5? (a) 0 (b) u (c) i a Let k = -0.09 + 0.49. What is the closest to -0.1 in k, -0.07, 2? -0.07 Let f be 30/4(-2)/(-10). What is the closest to 1 in -5/6, f, -6? f Let s be (-4)/(-18) - 4/(-63). Let k be 2 + (-2)/43. Let j(m) = -m3 + 3m + 2. Let o be j(-2). Which is the nearest to k? (a) s (b) -1 (c) o a Let x = -0.07 - 5.93. Let n = x + 10. Which is the nearest to -2/5? (a) 0 (b) -1 (c) n a Let t = -0.02 - -0.06. Which is the nearest to 0.1? (a) -1 (b) 0 (c) t c Let x = 5 + -8. Which is the nearest to 1/4? (a) x (b) 5 (c) 0.2 c Let z = -0.067 + 1.067. Which is the nearest to z? (a) 0.5 (b) -5 (c) 3 a Let p be ((-6)/(-14) - 1) + 1. Let r = -33 + 30. What is the nearest to -0.1 in r, 0.5, p? p Let u be (-1)/8-14 - 2. Let a = 3 + -2.8. Let m = 0.17 + 0.13. What is the closest to a in 4/5, m, u? m Let o = 9 + -9. Which is the closest to -1/2? (a) -3 (b) o (c) -2 b Let p = -72 - -74. Let r = 0.2 + -0.3. Which is the nearest to r? (a) p (b) 3/4 (c) 5 b Let u be (2/2)/(-1)5. Suppose -2b - 2n + 0 = -10, -4b + 20 = -5n. Let w be (b/15)/((-16)/(-6)). What is the nearest to 2/7 in u, w, 4? w Let p = -41/4 - -43/4. What is the nearest to 2 in -9, p, 2? 2 Let m = 18 - 17. What is the closest to m in -0.2, 3/4, -4? 3/4 Let t be (-2)/(-7) + 2/(-56). Let i = 1.6 + -1.9. What is the closest to 1 in i, t, -2/3? t Let r(h) = 6h + 0h3 - h3 + 2h3 - 3h*2 - 2h*3 + 6. Let u be r(-4). What is the nearest to 0.1 in 0, u, 1/2? 0 Let l = 0 + -0.4. Let a = 39 + -39.1. What is the closest to l in -2, 0.5, a? a Let k = 4 + -5. Let l = 22 - 21. Which is the nearest to l? (a) k (b) 5 (c) -0.5 c Let z = 0.17 + -0.17. Let o = -5 - z. Let n = 1.2 - 0.2. What is the closest to 0.1 in -1, o, n? n Suppose -4p + 3p + 8 = 0. Let t(i) = i - 9. Let q be t(p). Let d be (-3)/(0 + q) - 2. Which is the closest to 1/2? (a) d (b) 1/4 (c) -1 b Let j = -0.9 - 0.1. Let u be 0/(-5) + -1 + -3. What is the nearest to 1 in u, 0.1, j? 0.1 Let x = -17.5 - -18. Let k = 2.2 + -4.2. Which is the nearest to k? (a) 0.3 (b) 3 (c) x a Let p = 168 - 145. What is the closest to 1 in -4/3, 0.2, p? 0.2 Let h = 50 + -45. Let n = -6 - -8. What is the nearest to n in 0.4, h, -5? 0.4 Let y = -58.8 + 59. What is the closest to -0.1 in y, -2/7, 4? -2/7 Suppose 0 = 2d - 45 + 55. What is the nearest to -2/9 in -4, d, 2? 2 Suppose -5r + 0m = 5m - 20, 5r + 2m = 8. Let v be r - -2 - (1 + 4). What is the closest to -1 in 0, 2/3, v? 0 Let g = -107/3 - -36. Suppose 3n + 6 = n + 5m, 4n = 4m. Suppose -4v - 3 = -5w + 6, 5v - 30 = -nw. What is the closest to g in v, 2/3, 0.4? 0.4 Let w be 0/2 - 2/6. Let m be -5(48/(-15) - -4). Which is the closest to w? (a) m (b) -2/3 (c) -0.5 c Let v = 12 - 11.7. What is the nearest to 0 in -1, 0.4, v? v Let o = -0.6 - -0.5. Let p = -0.24 + 0.34. Which is the closest to o? (a) -1/2 (b) p (c) 1 b Let r = 1.1 - 1. Which is the closest to r? (a) 1 (b) 4 (c) -3 a Let k = -10 + 4. Let d = -8 - k. Let l = -1 - d. Which is the closest to l? (a) -3 (b) -5 (c) -0.2 c Let k be ((-6)/(-9))/(7-1). Let y(o) = o - 1. Let q be y(5). Suppose 2x = 5h - 10, -h = -3h - 3x + q. What is the nearest to -1 in k, -1/7, h? -1/7 Let d = -10 - -9.5. Suppose l + 4i - 29 = -i, -5 = -i. Suppose 3z - 12 = 4f, 3 = -lf - 2z + 11. Which is the nearest to f? (a) 0.4 (b) 4 (c) d a Let u(z) = -2z + 3. Let l be u(-2). Which is the nearest to 0.1? (a) -0.1 (b) l (c) -1/2 a Let o = 22 - 14. Let h = o + -7. Which is the nearest to 0? (a) -5 (b) 0.2 (c) h b Suppose 0 = -i - 2u + 8, -4u - 68 = -i - 3i. Suppose h = -n + 4, -4n - 2 = -i. Which is the closest to 1? (a) 0 (b) 0.3 (c) h c Let w = 24 - 19. What is the closest to -1/2 in 2, w, 2/11? 2/11 Let d = 2 + 2. Let i = -6 + 5.6. Let s = -157/10 + 31/2. Which is the closest to 1? (a) i (b) s (c) d b Let m = -0.14 + -7.86. Let u = 7 + m. Let v be (-2)/30(-2)/(-1). Which is the closest to u? (a) -0.2 (b) v (c) -0.4 c Let j be (-4)/(-8) - (-1)/2. Let n = -1.39 + 1.89. What is the closest to j in 0.4, -0.5, n? n Let s = -6.7 + 7. Let b = 2/151 - -296/453. What is the nearest to b in -5, s, 0? s Let d = 0.009 + 0.191. Which is the nearest to d? (a) 1/6 (b) -5/6 (c) 3 a Let t = -96/115 - -10/23. Which is the closest to 2/5? (a) 1/4 (b) t (c) 4 a Let d = 222/7 - 32. Suppose 6 = 3k - 6k. Let z be (1 + k)2 + 2. Which is the nearest to d? (a) 0.4 (b) z (c) 0.3 b Let w = 6.1 + -2.1. Suppose 8t + 4 = 4t. Which is the nearest to t? (a) w (b) 5 (c) -3/7 c Suppose 1 = 4r - g - 0, -g - 1 = 2r. Let s be (r/(-3))/(-21). Let y = -0.3 - -0.5. Which is the nearest to s? (a) -5 (b) 0.4 (c) y c Let l = 1 + 1. Let z = 0.28 + 0.02. Which is the nearest to -1? (a) z (b) l (c) 3/4 a Let u = 41 + -40.5. Let s = -1 - -1. Suppose 0 = 3i + 5 + 1. What is the nearest to i in 5, u, s? s Suppose -7 - 13 = 5v. Let s be v(-2 - 39/(-24)). Which is the closest to -2/3? (a) 0.4 (b) 3/4 (c) s a Let g be (1 + -7)/(-36) + 8/(-12). Let q be -1(-1)/(7/2). Which is the closest to g? (a) 0.5 (b) 5 (c) q c Let b = -10 + 5. Let s = 9/34 + 4/17. What is the closest to 0 in 0, s, b? 0 Let o = 0.2 + -0.4. Let j = 0.3 + o. Let y = -5.8 + 7.8. Which is the nearest to j? (a) -1/4 (b) -2/3 (c) y a Let n = -0.2 - -0.2. Let q = -0.1 - n. Suppose 8 = i - 5i. What is the closest to -0.1 in 1, i, q? q Let s = 1 + -1. Let l = 0 + -1. Let m = l - s. What is the nearest to m in 0.4, 0.1, -4? 0.1 Let m = -0.071 + 1.071. What is the nearest to m in 3/7, -1, 6? 3/7 Let v = -0.4 + 0.3. Which is the closest to 0? (a) 2/7 (b) 1 (c) v c Let y be -2 - (1-2 - -2). Let n = -2.5 - -6. Let a = -3 + n. What is the closest to 0.1 in 4, a, y? a Let p = 1178/7 - 168. Let w be (81/(-6))/(3 - 9) - 2. Which is the closest to w? (a) p (b) -5 (c) -3/2 a Let x = -0.72 - -0.79. Let m = -0.36 - 0.04. Which is the nearest to -1? (a) -0.5 (b) x (c) m a Let t be (-3)/2 - (-4)/(-8). Let u(m) = -m*2 + m - 2. Let s be u(0). Let w be -1(3/s)/3. What is the closest to w in 0.4, -1, t? 0.4 Let m be -5(-1 + (-23)/(-25)). Let t = 0.7 - -6.3. Let d = t + -5. What is the nearest to 1 in m, 2/7, d? m Let m(s) = -s3 - 7s*2 - 6s + 5. Let r be m(-6). What is the closest to 0	{ "pile_set_name": "DM Mathematics" }
in -0.5, 1, j? j Let p(w) = -4w + 16w - 7 - w*3 + 5w*2 - 4w. Let u be p(6). Suppose -v - 4v = 3l + 14, 0 = -4l - 2v. Which is the closest to 3? (a) -0.4 (b) u (c) l c Let u = 0.6 - 0.1. Let y be (-1)/3 + (-16)/6. Let x = 0.6 - 0.4. What is the closest to 2/5 in u, y, x? u Let f be (-2 - -3)/(1/(-2)). Let y be (-88)/(-234) + (-4)/18. Which is the nearest to -1? (a) f (b) 6 (c) y a Let y = 6 + -3. Let c = 3.1 - 3. What is the closest to c in 1/3, -3/4, y? 1/3 Let g be (-4)/6(-45)/(-10). Let v = 1 - 2. What is the nearest to v in g, 0.3, 3? 0.3 Let j(u) = 5u*3 + 2u*2. Let h be j(-1). Suppose -l - 4l + r + 3 = 0, 5r - 5 = 5l. Let q = 0 + 0.1. What is the closest to l in q, -0.1, h? q Let x = -2.8 - -2. Let l = -2.8 - x. Let c = 61 - 243/4. What is the nearest to 1 in -1/6, l, c? c Let r = -34 - -56. Let l be r/(-26) + (-1 - -2). What is the closest to -2/7 in l, -5, 0? 0 Let p = 11 - 10. Which is the nearest to p? (a) 4 (b) 0.5 (c) -3 b Let t = -16 - -16.1. Which is the closest to t? (a) -4 (b) -1 (c) 0.5 c Let k = 1.1 - 1.3. Let f be ((-6)/(-16))/((-9)/4). Which is the closest to 0.1? (a) f (b) 0.2 (c) k b Let d = 19 + -10. Let f = 10 - d. Which is the closest to -1? (a) -2 (b) 0.3 (c) f a Let w = 25.8 + -26. What is the closest to w in 4, 1/9, -5? 1/9 Let h be 4(3/(-2) - -1). Which is the nearest to h? (a) -3/2 (b) -8 (c) -0.1 a Let v = 4/249 - 2519/83. Let s = 31 + v. Let j = 3.3 + 0.7. What is the closest to s in 0.2, -2/21, j? 0.2 Let k be 30/14 + (1 - -2). Let r = k + -38/7. What is the closest to 2/7 in r, -4, -6? r Let i = 1 + -1.1. Let g = i + -0.3. Let d = 5 + -9. Which is the closest to 2/9? (a) g (b) d (c) -3 a Let l = -0.192 - 0.008. Which is the nearest to -2? (a) -1/10 (b) l (c) 3 b Let t = 53/2 + -79/3. Let j = -2 - -3. Let v = j - 0.9. Which is the closest to 1/3? (a) 5 (b) t (c) v b Let c be (-7)/412/28. Let d = -0.02 - 0.08. Suppose 1 - 4 = 3k. What is the nearest to k in c, d, 0.3? c Let a be 46/14 + (-1 - 2). Let y = -16 + 26. Let p be y/(-4)(-4)/(-20). What is the nearest to p in 0.4, -2, a? a Let p = -13 - -11.6. Let c = -3 - -2. Let q = c - p. What is the nearest to -1/2 in 2, q, 1? q Let g = -0.048 + -0.052. Which is the closest to g? (a) 1 (b) -0.7 (c) -5 b Let d = 155 + -1393/9. Let q = 0.9 + -1. Let h(j) = -j*2 + 7j - 11. Let k be h(5). What is the nearest to q in d, -3/7, k? d Let g = 0.1 + -1.1. Let m = 0.3 + 8.3. Let k = -9 + m. What is the nearest to g in -3, -1/2, k? -1/2 Let y be 6/(-105)110/2. Which is the closest to y? (a) 5/3 (b) -4 (c) 4 a Let u = 10 + -11. Let h = 4 - 6. Let c = 2 + h. What is the closest to u in c, 0.1, -2/5? -2/5 Suppose -3d + 13 - 10 = 0. Which is the nearest to d? (a) -0.1 (b) 2/7 (c) 0.3 c Let w = -20 + 11. Let m = w - -8.5. What is the nearest to 1 in m, 5, 4? m Let i be (-3 - -815)12/98. Let w = i + -99. Which is the nearest to -0.3? (a) -1/3 (b) 5 (c) w a Let f = -0.66 - 0.34. What is the closest to f in 0, -2/7, -0.3? -0.3 Let r(s) = -s*2 - 22s - 61. Let t be r(-19). Which is the closest to -0.1? (a) t (b) 0.2 (c) -2/11 c Let h be (2 + -3)3/6. Which is the nearest to -0.1? (a) h (b) -2 (c) 0 c Let n = -0.1 + -0.9. Let l = 1 + -0.7. Which is the closest to 2/5? (a) n (b) 3/5 (c) l c Let x = -2.06 - -0.06. Let q = 0.03 + -0.03. Which is the nearest to q? (a) -1/3 (b) x (c) -0.3 c Suppose 0 = -5k + 3w - 18, 6k + 4w = k - 11. Let i be k + 1 - (-5)/3. What is the nearest to -1/3 in i, 0.1, -0.3? i Let l = 1 + 1. Let q = -2.1 - -0.1. Let r = 0 + q. Which is the nearest to 1? (a) l (b) r (c) -3 a Let u = -267/55 + 60/11. What is the closest to 0 in 3, u, -1/5? -1/5 Let h(j) = 3j - 26. Let d be h(10). Which is the closest to -3? (a) 0.1 (b) 2 (c) d a Let o = 0.65 - 0.3. Let y = o - -0.05. Let k = 0.3 - y. What is the closest to 2 in 3, k, 0.5? 3 Let n(m) = 2m2 - 2m. Let r be n(2). Suppose -rc + 4 + 8 = 0. Let v be (-5)/(-4)((-24)/(-15))/4. What is the nearest to 1 in v, -2/5, c? v Let q = -21.1 + 21. Let n be 4/15623. What is the closest to q in 5, n, 0? 0 Let y = 327/830 + 1/166. Suppose 0 = h + 3t - 5, 4h - 2t = -t + 7. Suppose -2 = -2s + h, 0 = z - 2s + 4. What is the nearest to z in 2/11, 0.2, y? 2/11 Let r be ((-24)/162)/((-4)/6). Let m be 19/(-7) + (-4)/14. Let v = -4 - m. Which is the closest to -1? (a) r (b) 3 (c) v c Let l(g) = 2g - 8 - 4g + 3g. Let o be l(9). What is the nearest to 2 in o, -2/9, -2? o Suppose -3o - 5v = -15 - 14, -o + 4v - 13 = 0. Suppose -2r + r - 2 = 5n, -2n = 5r + 10. Which is the closest to n? (a) o (b) -0.1 (c) -4 b Let z = -38 - -34. What is the nearest to -2 in 1/3, -2/13, z? -2/13 Let i = -0.2 - 1.8. Let y = -3 - i. Let n = 5 - 5.4. What is the closest to 2/3 in y, n, 4? n Let s = 0.2 - 0.4. Let y = -0.6 - s. Let a = -155 + 155.2. What is the closest to a in -4, 1, y? y Let d = 427/5 - 85. Which is the closest to 1? (a) d (b) 4 (c) -5 a Let t(x) = 4x*2 - x. Let i be t(-1). Let o be (-9)/4 - (-30)/(-40). What is the nearest to o in i, 0.5, 3? 0.5 Let x = 0 - 0.2. Let r be 29 + -27 + (4 - 0) - 2. What is the closest to -3 in r, 1, x? x Let n = -5.06 + 5. Let s = 0.34 - n. Let h be 1 - (5/(-3) + 2). What is the closest to 0.1 in 2, s, h? s Let f = 1.6 - 10.6. Let j = f - -8.6. Which is the nearest to -0.1? (a) -0.2 (b) j (c) 0.3 a Suppose 4x = 0, 2b + 6x - x = 56. Let g be 2 - (-2 + b/12). What is the nearest to -5 in 0.3, -1/10, g? -1/10 Let u(n) = -n*3 - 4n*2 + 6n + 1. Let t be u(-5). Which is the nearest to 1? (a) -0.5 (b) -1 (c) t a Let x = -0.3 - 0.7. What is the nearest to 1/4 in x, -1/4, 0.2? 0.2 Let a be (1/(-4))/(33/8). Let j be 2 - 14/(-11)-1. Let h = a + j. What is the nearest to h in 0.2, 4, 0.5? 0.5 Let f = -1019/9 - -113. Which is the closest to 0.1? (a) f (b) 2/9 (c) 2 b Let o = 1/16 - 39/112. Which is the nearest to o? (a) -4/3 (b) 2 (c) 0.1 c Let p = 3.61 - -0.39. Which is the closest to 1? (a) -13/4 (b) p (c) -0.1 c Let t be (-1)/4 + (-138)/24. Let p be (4 + t)/((-4)/5). What is the closest to -0.1 in 0, p, 2? 0 Let d = 41 + -37. What is the nearest to d in -0.1, -2/3, -4? -0.1 Suppose -5m + 5 = 3l - 5, -m - 3l + 14 = 0. Let a be m/(-2)22. Let d = 7 + -7. What is the nearest to -1 in d, a, 1? d Let m = -0.4 + 0. What is the closest to -2/3 in 0, m, -0.2? m Suppose 2q - 9v + 5v = 4, 5q + v + 23 = 0. What is the closest to 0 in -5, 3, q? 3 Let p = -2.1 + -1.9. What is the closest to 0 in -0.2, p, 0? 0 Let q(x) = -8x - 4. Let p be q(-1). Which is the nearest to -0.5? (a) p (b) -3/7 (c) 3 b Let i(z) = -z2 - 3z + 0z2 - 2 + 5z. Let j be i(3). Let a be 1 + 0 + (2 - 2). What is the nearest to 0 in j, 2, a? a Let m = 134 - 134. What is the closest to m in -1, 4, 9? -1 Let o be 4 - 13/(-6)(-3 - -1). Which is the closest to o? (a) 0.3 (b) 2/9 (c) 4 b Let g = 0 - -0.1. Let i be ((-6)/10)/((-7)/(-5)). What is the closest to g in i, -3, -0.1? -0.1 Let d be 6/(-8) - 4/(-16). Let u = -7 + 6.7. Let s(y) = y3 + 4y*2 - 4y + 5. Let g be s(-5). What is the nearest to 0.1 in d, u, g? g Let m be (-1)/8-4(0 - 1). Suppose r - 6 = -5u, 2u + 1 = r + 2r. Which is the closest to -0.1? (a) u (b) m (c) -0.3 c Let g = -26 - -26. Let z = -0.3 - 0.2. What is the nearest to g in 2/9, z, -1? 2/9 Let x = 0 - 0.1. Let d = x + 0.2. Let q = 71/198 + -3/22. What is the closest to d in 1/8, -3/7, q? 1/8 Let v be 86/110 - 2/11. Let a(y) = y2 - 8y + 6. Let x be a(6). Let w(j) = j*2 + 7j + 3. Let t be w(x). What is the closest to -1/2 in t, v, 0.1? 0.1 Let y = 0.06 + -0.56. Which is the closest to 0? (a) -3 (b) -0.4 (c) y b Let q = -4.4 - -4.5. Which is the nearest to q? (a) 0.2 (b) -1/5 (c) 3 a Let y = -44 + 44.1. Which is the closest to -0.1? (a) 2 (b) y (c) -2/13 c Suppose -4y + 5 = 4n - 7, -2y + 2n + 14 = 0. What is the nearest to -2 in 2/9, -0.3, y? -0.3 Let k = 35 - 37. Let d = -8 - -11. Suppose j - 16 = -dj. Which is the closest to k? (a) 1/2 (b) j (c) 3 a Let t(o) = -o3 + 15o*2 + o - 20. Let y be t(15). Which is the nearest to 1/8? (a) 4 (b) y (c) -1 c Suppose -5s = 5k + 8 + 2, -3s = -k + 14. Let u be (s/5)/((-30)/(-5)). Let w = 4.05 - 0.05. Which is the	{ "pile_set_name": "DM Mathematics" }
32 + -3? -335 In base 7, what is 520 + 4? 524 In base 14, what is 81 - 39? 46 In base 3, what is 200 + -11? 112 In base 6, what is -1551 - -3? -1544 In base 4, what is -1 + 32131? 32130 In base 10, what is -27 + -38? -65 In base 2, what is -10110 - 110001? -1000111 In base 12, what is 3 - 33? -30 In base 11, what is -29 + -38? -66 In base 3, what is 2 - -201? 210 In base 7, what is -2630 - -3? -2624 In base 9, what is -33 - -1? -32 In base 3, what is 2222 - -22? 10021 In base 16, what is 2 + -1a7? -1a5 In base 14, what is -746 - -6? -740 In base 9, what is -11 - 315? -326 In base 14, what is 6d8 + -3? 6d5 In base 13, what is -150 + 46? -107 In base 7, what is -12 + -1421? -1433 In base 3, what is 10121 + 11? 10202 In base 7, what is 13 - -501? 514 In base 15, what is -2 - 94? -96 In base 7, what is 2 + 21260? 21262 In base 2, what is -1101101 + 0? -1101101 In base 16, what is 197e + -4? 197a In base 4, what is -2301 - 2? -2303 In base 3, what is -1022 + 10? -1012 In base 4, what is 2 - -1? 3 In base 8, what is 4 + 3562? 3566 In base 16, what is -37b + 0? -37b In base 13, what is 2c1 + -3? 2bb In base 10, what is -2 + -163? -165 In base 9, what is 3035 - -4? 3040 In base 12, what is -1b - -13? -8 In base 11, what is -1973 - 3? -1976 In base 16, what is 4 - 669? -665 In base 8, what is 2 - 2014? -2012 In base 15, what is 111 - 3? 10d In base 5, what is 210443 + 3? 211001 In base 4, what is 331 - -2102? 3033 In base 10, what is -5 - -1729? 1724 In base 2, what is 0 + 1100? 1100 In base 7, what is -1 + -201? -202 In base 13, what is 7 + -64? -5a In base 2, what is 11000010 - 1111111? 1000011 In base 4, what is 3 - -10133? 10202 In base 8, what is 3 - -1125? 1130 In base 4, what is 3 + 300? 303 In base 15, what is 1 + -958? -957 In base 13, what is 33 - 2c? 4 In base 14, what is -42 + 0? -42 In base 7, what is -35 + 222? 154 In base 13, what is 2360 + -3? 235a In base 9, what is -5 + -157? -163 In base 4, what is 1001 + -101? 300 In base 12, what is 20b + 3? 212 In base 3, what is -20102212 - -2? -20102210 In base 11, what is 315 - -5? 31a In base 4, what is 11 + -3032? -3021 In base 7, what is 4 + -4? 0 In base 14, what is 17 + 1a? 33 In base 8, what is -41 + -6? -47 In base 7, what is -2 + 411? 406 In base 16, what is -2 + -8? -a In base 14, what is 2 - -3? 5 In base 13, what is -2 + -26? -28 In base 8, what is 4 + -21? -15 In base 2, what is -10 - -1111101? 1111011 In base 8, what is 3 + 257? 262 In base 15, what is a + -88? -7d In base 15, what is a57 - -2? a59 In base 8, what is 36 + 464? 522 In base 15, what is -4 + 3c? 38 In base 15, what is -6 + 1a? 14 In base 10, what is 6 - -858? 864 In base 8, what is -2146 - 2? -2150 In base 10, what is 36 - 109? -73 In base 3, what is -1010002 - 1? -1010010 In base 8, what is -17327 + -4? -17333 In base 3, what is -22101 - 11? -22112 In base 15, what is -69 - -1? -68 In base 3, what is 0 - -1110? 1110 In base 2, what is -10 + -11101110? -11110000 In base 11, what is -1 - 5? -6 In base 5, what is 24243 - -2? 24300 In base 8, what is 46 + 32? 100 In base 5, what is 323 - 2? 321 In base 2, what is 1 - -11000? 11001 In base 2, what is -10111 - -1100010111? 1100000000 In base 11, what is -5 + -1783? -1788 In base 7, what is -3156 + -2? -3161 In base 2, what is 100 - -11110000? 11110100 In base 13, what is 4 - 34? -30 In base 6, what is 2233 - 1? 2232 In base 7, what is 33 + -22? 11 In base 5, what is 0 - -104? 104 In base 13, what is -27 - -7? -20 In base 3, what is 1222 - 2? 1220 In base 10, what is 328 - 5? 323 In base 15, what is -6b - 5? -71 In base 15, what is -5 - -dd1? dcb In base 13, what is -8c - -a? -82 In base 4, what is 1 + -2130233? -2130232 In base 16, what is -a - 161? -16b In base 5, what is -32 - 43? -130 In base 4, what is 11 - -1? 12 In base 7, what is -3 - 345? -351 In base 13, what is -15a + -3? -160 In base 12, what is 1 + 64? 65 In base 14, what is -1 - ad? -b0 In base 2, what is -10 + 11010001? 11001111 In base 2, what is -1 - 10000001? -10000010 In base 13, what is -2 - 232? -234 In base 6, what is -124551 + 5? -124542 In base 11, what is 24 - -3? 27 In base 8, what is -211 - -5? -204 In base 12, what is -3 + -20? -23 In base 6, what is 3 + 401? 404 In base 2, what is -10 - 100110010100? -100110010110 In base 12, what is 5 - 2a? -25 In base 5, what is -4 - 14144? -14203 In base 16, what is 41 + -2? 3f In base 9, what is -2675 + -3? -2678 In base 8, what is 2 - -71? 73 In base 9, what is -4 + 711? 706 In base 12, what is -97 - -1? -96 In base 4, what is -3 + -132? -201 In base 16, what is -c + f? 3 In base 10, what is -3 - 181? -184 In base 15, what is -5 - 34a? -350 In base 4, what is -2 - -101210? 101202 In base 6, what is -1 + 500? 455 In base 14, what is 1 + -49? -48 In base 6, what is 2 + -2002? -2000 In base 10, what is -34 + -1? -35 In base 4, what is -33 - 0? -33 In base 10, what is 9 + -5? 4 In base 6, what is 3 - 15441? -15434 In base 6, what is 3311 - 0? 3311 In base 3, what is -121022121 + 12? -121022102 In base 3, what is -200020 - -10? -200010 In base 6, what is 4 + -51? -43 In base 14, what is -66 + 20? -46 In base 15, what is -2a - -2? -28 In base 10, what is 0 + -101? -101 In base 16, what is 1a + -20a? -1f0 In base 2, what is -10110100001 - -1111? -10110010010 In base 6, what is 2 + -40? -34 In base 8, what is -2 - 475? -477 In base 12, what is 3 + -3913? -3910 In base 16, what is 9 + 11? 1a In base 16, what is be + 1d? db In base 14, what is -1 - -26? 25 In base 8, what is 1 - -130? 131 In base 5, what is 1443 + -4? 1434 In base 12, what is 0 - -34? 34 In base 13, what is -4 + 5a? 56 In base 8, what is -7 + -20? -27 In base 12, what is -179 - -25? -154 In base 4, what is -2 + -3113? -3121 In base 6, what is 51 - -230? 321 In base 11, what is -403 - 4? -407 In base 16, what is -2 + -38? -3a In base 3, what is -2020 - -201? -1112 In base 3, what is -11 + 0? -11 In base 12, what is -2 - -2b04? 2b02 In base 15, what is 1ba - e? 1ab In base 3, what is -102101 - -11? -102020 In base 5, what is 4412 - -12? 4424 In base 14, what is 17 + d? 26 In base 12, what is -3b - 1? -40 In base 2, what is 1 + -11011100? -11011011 In base 9, what is 6 - 42? -35 In base 10, what is 16 + -21? -5 In base 8, what is -532 - -3? -527 In base 3, what is -1011 + 12121? 11110 In base 8, what is 1756 - -3? 1761 In base 16, what is -1 - -15? 14 In base 9, what is 66 + 2? 68 In base 2, what is -111101 + 101011000? 100011011 In base 15, what is 73 - a? 68 In base 14, what is -c - -7b? 6d In base 14, what is -cdd + 4? -cd9 In base 2, what is -1001011011 - 0? -1001011011 In base 4, what is -2 - 23? -31 In base 6, what is -22 + -2301? -2323 In base 10, what is -10 + 5? -5 In base 7, what is 5 + -1256? -1251 In base 4, what is -32100 + 10? -32030 In base 6, what is 122 + 24? 150 In base 9, what is -2 + -158? -161 In base 10, what is -690 + 1? -689 In base 11, what is -56 + -10? -66 In base 5, what is 1310000 - 2? 1304443 In base 14, what is -4 - -49b? 497 In base 12, what is 2 + -42? -40 In base 11, what is -466 + 2? -464 In base 14, what is 4 + 2a? 30 In base 10, what is -5 + 192? 187 In base 14, what is -9dc - 3? -a01 In base 12, what is -10 + -a? -1a In base 3, what is 11 + 10112? 10200 In base 16, what is -8 + -142? -14a In base 5, what is 3210 + 3? 3213 In base 2, what is -110 - 1000? -1110 In base 13, what is 54 - -1? 55 In base 4, what is -110 + -3? -113 In base 12, what is b - 6? 5 In base 11, what is -6 + 5a? 54 In base 8, what is 0 - -436? 436 In base 14, what is 912 - 5? 90b In base 9, what is 8 + 104? 113 In base 9, what is -221 - -6? -214 In base 14, what is -2 + 87? 85 In base 14, what is -1 - 1cb? -1cc In base 3, what is -22111 - 2? -22120 In base 6, what is -15 + -1245? -1304 In base 2, what is 1100100010 - -1? 1100100011 In base 4, what is -211 - 1? -212 In base 14, what is 24b + 3? 250 In base 9, what is 17 - -177? 205 In base 7, what is -202 - 10? -212 In base 10, what is 2 - -808? 810 In base 6, what is 4 - -1242? 1250 In base 8, what is -2 - -5? 3 In base 4, what is 1001 - 13? 322 In base 15, what is -2 + 7b? 79 In base 2, what is -11100 + -110001? -1001101 In base 12, what is 12 - -8? 1a In base 7, what is -203 + 0? -203 In base 5, what is -3 - 24? -32 In base 16, what is -3	{ "pile_set_name": "DM Mathematics" }
+ 0f4 - 4f*4)(f + 3f - f) + 2f*5 - 4f5 + f5. -22f5 Expand (0 + 0 - 3d*2)(d*2 + 5d*2 - 2d*2)(-3d + 4d - 3d). 24d*5 Expand (3y*3 - 7y*3 + 2y*3)(3 - 3 - 2y) - y2 - 7y*4 + 10y*4 + 5y*2. 7y*4 + 4y*2 Expand (-2r - 1 + 1)(8 + 3 - 7) - 2 + 2 - 2r + (1 + 1 - 3)(3r + 2r - 3r) - 6r + 3r + 4r. -11r Expand (-2 + 3 - 5)(-w2 - 2w*2 + 2w*2). 4w*2 Expand (3j + 5 - 5)(-3j - j + 2j)(3j + 2j - j). -24j3 Expand ((-4 + 1 - 3)(-3 - 1 - 2) - 3 + 1 + 3)(-3n*2 + 5n*2 - 3n*3 + 2n*3). -37n*3 + 74n*2 Expand n - 2n4 - n + (n3 + n*3 + 0n*3)(5n + 0n - 3n) + 1 - 14n4 - 1 + (-n3 + 0n3 - n3)(3n - 6n + n). -8n4 Expand h + h + h + (-3 - 2h + 3)(0 - 2 + 0) - 8h + 40 - 40. -h Expand (0 - 1 + 0)(-3g - 9g - 38g). 50g Expand (-4r*3 + 6r*3 - 7r*3)(-r + 2r - 3r) + r*4 + r - r. 11r*4 Expand (-2b*4 - 4b*2 + 10b*3 - 10b*3)(5 + 0 - 3). -4b4 - 8b*2 Expand -1 + 2p + 1 + (-11 + 4p + 11 + (p + 2 - 2)(1 + 1 - 4))(4 - 6 + 0). -2p Expand (-1 - 1 + 5)(3 - 4c - 3). -12c Expand ((5 + 0 - 4)(2 + 0 - 1) + 1 - 1 + 1 + (1 - 2 + 3)(5 + 0 - 2))(15f4 - 3f*4 + 9f*4). 168f*4 Expand (-2 + 2 + 2b*3)(-3 + 2b - 3 + 4). 4b*4 - 4b*3 Expand (-2q + 2q - 2q*2)(-2q - 3 + 3) + 2q - 2q3 - 2q + (2q2 - 3q*2 + 0q*2)(-q - 2q + q) + 3q - 3q3 - 3q. q*3 Expand (1 - 2 - 2)(0b2 - 2b*2 + 4b*2) + 8b*2 - 9b*2 - 8b*2. -15b2 Expand (-z + z2 + z)(5z - 3z - 3z) + (7 - 3z - 7)(2z2 + 4 - 4). -7z*3 Expand (0 - 1 + 3)(-4a + 6a - a + (4a - 6a + 3a)(-2 + 6 - 3) - 2a + 4a - a - 2a - a + 0a + 6a - 3a - 4a + (3 + 0 - 4)(a - 1 + 1)). -4a Expand (1 + 1 + 5547l - 5551l)(4l4 - 2l*4 - 3l*4). 4l*5 - 2l*4 Expand -28c*4 - 149c*3 + 149c3 + (-c3 - c*3 + 4c*3)(-4c + 6c - 4c). -32c*4 Expand (2p*5 + 0p*3 + 0p*3)(0 + 8 - 3) + 25p + 2p*5 + 0p*5 - 31p. 12p5 - 6p Expand -5g2 + 2g*2 - 3g*2 + (2g - 5g + 4g)(0g - 3g + 7g). -2g2 Expand (9i*2 + 6i*2 - 6i*2)(i - i + i + (-2i - 2 + 2)(1 + 0 + 0) - 3 + 3 - 6i). -63i*3 Expand (9j*3 - 16 + 16 + 0j*3 - 3j*3 + 2j*3 + (-4j + 4j + 2j)(-3j2 + j2 + 0j2))(-5j2 + 5j2 + j2). 4j5 Expand 3t - 4t + 2t + 7 + 7 + 2t - 8 + 2t - 3t + 2t + (-5 + 6 - 3)(-4t + 4t - t) + 4t + t - 3t. 8t + 6 Expand (2y + 3y - 3y + y2)((y + y - 3y)(1 - y*2 - 1) + 2y*2 - 2y*3 - 2y2). -y5 - 2y4 Expand -133 + 133 - 14w + 0w + 5w - 3w + (-5 + 5 - 1)(3w + 0w - w) + w + 1 - 1. -13w Expand (-2p - p + 2p)(-3 + 5p + 3) - 11 + 11 - 14p*2. -19p*2 Expand (0c - 3c + 0c)(3c + 42c - 9c). -108c2 Expand (9c*2 + 74 - 74)(-c*2 + 0c*2 + 0c*2). -9c4 Expand i5 + 2i2 - 2i*2 + (2i*2 - 2i*2 - 2i*2)(-2i3 + 2i*3 - 2i*3) + 2i*5 + 0i*5 - 3i*5 + 0i*2 - 2i*5 + 0i*2. 2i*5 Expand (-4j + 2j + 3j)(0 - 1 + 0) - 2j + 4j + 4j. 5j Expand 4w4 + w4 - 4w4 + (-w + w - 2w*3)(-2w + w + 0w) - 9w2 + 22w*2 + 5w*4 - 10w*2. 8w*4 + 3w*2 Expand (3 - 3 + 2)(4 + 3c + 3 - 4). 6c + 6 Expand (0 + 5 - 2)(5 + w - 5) - 3w + 6w - 4w. 2w Expand (-2m*3 - 2m*3 + 5m*3)(-17m2 + 38 - 38 - 2m*2 + 4m - 4m + (m - 3m + m)(-2m + 3m - 2m) + 4m2 + 0m*2 - 6m*2). -20m5 Expand -q5 + 0q4 + 0q*4 + 3q*2 - 3q*2 - 3q*5 + (-3 + 3q*2 + 3)(-3q3 - 2q*3 + 4q*3). -7q*5 Expand 2p*4 + 2p*4 - 3p*4 - 5p*2 + 5p2 + p4 + (3p3 - 4p3 - p3)(0p - p - p) + (-2 + 2 + 2p)(0p3 - p3 - p3). 2p*4 Expand -159s3 + s4 + 5s2 + 159s*3 - 2s*5 + (4s*2 + 3s*2 - 4s*2)(3s3 - 2s*3 + 2s*3). 7s5 + s4 + 5s2 Expand -3d*4 - 5d + 5d + (2d - 4d + 0d)(-d3 + 3d*3 - 4d*3) + 0d*3 + 0d*3 - 2d*4 - 4d*2 - 3d*4 + 4d2 - d4 - 2d4 + d4. -6d*4 Expand (-1 + 1 - 2)(-1 - 4t + 1) + (-3t + 3t - 2t)(-6 + 2 + 5) - t + 0t - t. 4t Expand (-s3 - 2s*2 - 2s*3 + 0s*3)(-3s - 2s + 4s). 3s*4 + 2s*3 Expand (-l + 0l + 0l)(0l + 10l + 0l). -10l*2 Expand (2y + 0 + 0 + (-y - 2 + 2)(2 - 3 + 3) - 2y + 0y + y - 3y - y - 2y)(-3 + 1 + 1). 7y Expand 0 - 2j + 0 + (-10 - 6 - 1)(-j + 2j + 0j). -19j Expand 5k - 5k - k3 - k3 - k*3 + 0k*3 + (k - k + 2k)(k - 2k*2 - k) + 2k + 2k3 - 2k - 3k3 - k3 + 2k*3 + 4k*3 + 0k*2 + 0k*2. -3k*3 Expand (8b*2 + 53 - 53)(2b - b + b). 16b*3 Expand (2t - 7t + 2t)(-2t*2 + 3t - 3t)(-2t + 2 - 2). -12t*4 Expand (-1 + 1 + 3)(-4 + 3 + 0v4 + v4). 3v*4 - 3 Expand (0v*2 + 0v*2 + 3v*3)(-1 + 3 + 2) + v - 2v3 - v. 10v*3 Expand 2u + 3u - 6u + (-4 - 2u + 4)(2 + 0 - 3) + (3u - 2u - 3u)(-2 - 3 + 4). 3u Expand -3q + 4q + 0q + q + 3q - 3q + (-3 + 3 - 2q)(4 + 0 - 3) - 2q - q + 2q - 2q - q + q + 3q - 7q + q + (-2 - 1 + 5)(q + 2 - 2). -4q Expand (0 + 2 - 1)(2n + n - 5n)(8 + 16 - 2). -44n Expand (2 + 1 - 2)(3h - 6h + 2h)(-4 + 4 - 2h*2)(0h - 4h + 5h). 2h*4 Expand (-2k - 40 + 40 + 9k3)(0k + 0k + 2k). 18k*4 - 4k*2 Expand (-1 + 1 + 7z)(z2 + 0z*2 + 0z*2) + (z - 2z + 0z)(-5z2 + z2 + 2z*2) - 2z*2 + 2z*2 + 2z*3. 11z*3 Expand (-3h + 5h + 0h + (h + h - 4h)(3 - 4 + 0) + 5h + 0h - 4h - 7h - 4 + 4)(1 + 2 - 4). 2h Expand (-l3 + l3 + l*3)(2l + 2l - l + (1 + 0 - 3)(3l + 3l - 5l)). l*4 Expand -5 + 10 - 7 - p - 4 + 2p + 4 + (0 + p + 0)(-2 + 1 - 1) - p + p + p + 0 + 0 - 2p + p - 4p + 2p. -3p - 2 Expand (1 - 1 + 4l + (0 - 4 + 5)(0 + 0 + 2l))(0 - 2 + 5). 18l Expand (0 - 2 + 1)(4 - 4 + 4r)(-2 - 4r*3 + 2) + 3r4 - r4 + 0r4. 18r*4 Expand (-8t + 7t + 0t + 2t2)(2t2 - 5t*2 + 4t*2). 2t4 - t3 Expand (-10 - 2 + 4)(-m2 - 2m2 + m2). 16m2 Expand -4s*5 + 8s*5 + 9s*5 + (-2s*2 - 2s*2 + 3s*2)(5s3 + 0s*3 - 4s*3). 12s*5 Expand (2n + 5n - 4n)(-2n + 2 - 2) - 3n2 + 3n*2 - 3n*2 + 7n*2 + 0 - 15n*2 + 2. -17n*2 + 2 Expand (-2o*2 + 2o2 - o3 + (-4 - o*2 + 4)(-2o + 4o - o) - 3o3 + 0o*3 + 2o3 + o3 + 0o2 + 0o2 + 0 - o3 + 0)(-18 + 7 + 10). 3o*3 Expand 33i*2 + 31i*2 - 67i*2 + (-2i + 5 - 5)(3 + 2i - 3) + i*2 - 4i*2 + 2i*2. -8i*2 Expand (-2w + 0 + 0)(3w - 13 - 4w + 14). 2w*2 - 2w Expand (5f4 - f4 - 2f*4)(-22f - 22f + 36f) + 2f*5 + 2 - f - 2. -14f*5 - f Expand (-2 + 2 - 2r)(0 - 1 + 0)(4r - r - 9r). -12r2 Expand (-11g + 36 - 36)(-g - g + 0g)(2g - g + 0g). 22g*3 Expand (-2n*2 - 3n*2 + 4n*2)(-1 + 5 - 1). -3n2 Expand (5 - 2h - 5)(-10h*3 - 5h*3 + 2h*3). 26h*4 Expand (0 - 2u + 0)(-u + 3u - 4u) + (3 - 1 - 1)(-2u2 + 3u2 + u2). 6u2 Expand (3 - 3v + v + 4v)(-2 - 3 + 2)(-6v - 6 + 6). 36v2 + 54v Expand (g*2 + 0g*2 - 2g*2 + (-2g*2 + 0g2 + g2)(5 + 4 - 2) + g2 + 2g*2 + 0g*2)(2 + 4 - 5). -5g2 Expand v - v - 2v5 + (-1 - v4 + 1)(-1 + 1 + v) + 4v*5 - 5v*5 + 5v*5 + 3v*4 - 12v5 + v4 + 14v5. 3v*5 + 4v*4 Expand (-3t + 3t - 2t*2)(0t + 5t - 4t) + 7t*3 - 15t*3 + 5t3 + 4 + t3 - 4 - t - t*3 + t. -5t*3 Expand -3r*4 - 1 + r - 2r*4 + 4r4 + (r2 + 2r2 - r2)(4r - 3r*2 - 4r). -7r4 + r - 1 Expand (-w2 + w2 + w2)(-144 + 6w2 + 144). 6w*4 Expand (3 - 3 - g)(2g4 - 3g*4 + 4g*4 + 2g*3). -3g*5 - 2g*4 Expand (3k - 6k - 7k)(-1 + 2 - 6)(1 - 1 + 1). 50k Expand (4 + 1 - 3)(-2 - 5t + 2) + t - 3t + 4t + 9t - 17 + 17. t Expand (3 + 3 - 2)(0m*2 + 2m*2 - 3m*2)(-m3 + m3 + 2m3). -8m*5 Expand ((-2 + 0 + 1)(2 + 1 - 1) + 0 + 2 - 1)(3f + 0f - 2f). -f Expand (3k - 3k + 3k)(0k - 3k*2 + 0k) - 3k3 + 0k*3 + 2k*3. -10k*3 Expand (0h2 + h2 + 0h2)(2h + 1 - 1) + 4h*3 + 9h*2 - 9h*2. 6h*3 Expand (-5b*3 + 5b3 + b3)((3 + 2 - 6)(-3b - 2b + 6b) - 40 - 5b + 40). -6b4 Expand -2l3 - l5 + 2l3 + (0l + 3l - 4l)(-1 + 1 - l4) - l - 2l*5 + l - 2l5 - l5 + 4l5 - 3 + l5 + 5 - 4l*5. -4l*5 + 2 Expand -2j*3 + 2j*3 - 7j*4 + (2j	{ "pile_set_name": "DM Mathematics" }
h biggest value? (a) 8/7 (b) -1 (c) -2/9 (d) 2 b Which is the second smallest value? (a) -2 (b) 9883 (c) 4 c Which is the fourth biggest value? (a) -1.99 (b) -1 (c) 0.5 (d) 2/5 (e) -2/9 b What is the biggest value in 531, -1, 0.2? 531 Which is the fifth smallest value? (a) 4/7 (b) -2/9 (c) 0 (d) -12 (e) 1 e What is the fourth smallest value in -5, -0.5, -0.2, 0.5? 0.5 Which is the fourth smallest value? (a) 0.08 (b) -2/13 (c) -5 (d) 0.3 (e) -35 a Which is the third biggest value? (a) 5/3 (b) -2/13 (c) -4 (d) -0.3 (e) 52 b What is the third smallest value in -2, 3, -1.17? 3 What is the fourth biggest value in -1/7, -4.8, -0.5, -5? -5 What is the third biggest value in -54, -4, 3? -54 Which is the second smallest value? (a) 0.4 (b) -0.2 (c) -3 (d) 14/17 b What is the biggest value in 0.06, -1, 1? 1 What is the second biggest value in 24/5, 1/14, 3/5? 3/5 What is the biggest value in 9, 2, 0.4, 0.3, -0.3? 9 Which is the second biggest value? (a) 5/4 (b) -7 (c) 1/3 c Which is the smallest value? (a) 10 (b) -1 (c) 0 (d) 3 b What is the fourth smallest value in 1, -0.1573, 2/3, 3? 3 Which is the smallest value? (a) -3/4 (b) 5 (c) 1/4 (d) 3.1 a What is the biggest value in -2/7, 0.5, 53? 53 What is the fourth smallest value in 5, -84/41, -0.2, 1? 5 What is the smallest value in -0.5, -4/77, 2/5, -4, -0.08? -4 Which is the third smallest value? (a) 1987 (b) 4/9 (c) 0.6 a Which is the second biggest value? (a) 1/3 (b) -0.09 (c) 1/16 c Which is the biggest value? (a) 0.5 (b) -0.3 (c) -15/8 a Which is the smallest value? (a) -0.1 (b) 36 (c) -2 c Which is the second smallest value? (a) -0.4 (b) -6 (c) -10 b Which is the second smallest value? (a) -3/32 (b) -3/4 (c) 1 a What is the third smallest value in 38, 0, 19, 1/4? 19 Which is the third smallest value? (a) -2/19 (b) 0.857 (c) -2/5 b Which is the smallest value? (a) -4 (b) 0.08 (c) 4 a What is the third smallest value in -1/3, 1, -56.7? 1 Which is the biggest value? (a) -1 (b) -1/28 (c) 0.1 (d) 4 d Which is the third biggest value? (a) 1/11 (b) 2/3 (c) -5 (d) -2/11 (e) 38 a Which is the biggest value? (a) -0.1 (b) 0.4 (c) -72 b What is the biggest value in 19, -2, 4, 14? 19 Which is the third biggest value? (a) -541 (b) 3 (c) 0.1 a What is the second smallest value in 5, -2, 0, 12, -0.05? -0.05 What is the second biggest value in 1.6, -7, -0.2, -3/7? -0.2 What is the second smallest value in -12, -1/45, -5? -5 What is the fourth smallest value in 2, -4, -1945, 1? 2 What is the third biggest value in -0.5, 0.4, 4.65? -0.5 Which is the third smallest value? (a) -286 (b) 2/9 (c) 1/4 (d) -0.3 b What is the fourth biggest value in 0.1, -2, 8, 1, 4? 0.1 What is the biggest value in 0.1, -3, 0.09, 0.5? 0.5 What is the smallest value in -333, 1, 0? -333 Which is the second biggest value? (a) 1/6 (b) 2 (c) -5 (d) 1/3 (e) 2/3 e Which is the third smallest value? (a) 1 (b) 3/5 (c) -0.12 (d) 433/5 a What is the fourth smallest value in 8, -1, 9, 4, -3? 8 Which is the smallest value? (a) -0.5 (b) 21 (c) -5 c Which is the second smallest value? (a) 1 (b) -73 (c) 1/2 c What is the second smallest value in -2, 5, 1, 0, -0.3? -0.3 Which is the biggest value? (a) -3 (b) 0.2 (c) 1/2 (d) -5/4 c What is the third smallest value in -3, 37, 3/4, 1/7? 3/4 Which is the second smallest value? (a) -2 (b) 0.4 (c) 0.02 (d) 5 c Which is the second biggest value? (a) -172 (b) -13 (c) 6 b Which is the third smallest value? (a) 2 (b) -1/2 (c) -9/28 a Which is the second smallest value? (a) 1/3 (b) 1 (c) 1/11 a Which is the third biggest value? (a) -1/703 (b) -5 (c) 4 (d) 2 a Which is the second biggest value? (a) -0.4 (b) 2/3 (c) 0 (d) -13 c Which is the third smallest value? (a) 903 (b) 1/4 (c) 0 (d) -1/4 (e) -0.1 c What is the third smallest value in 1/3, -8, -5, -0.1? -0.1 What is the fifth biggest value in -0.1, 0, 5, -16/7, -4? -4 What is the biggest value in 126, -0.08, 1/4? 126 Which is the third smallest value? (a) 2/3 (b) -0.4 (c) 23 (d) 147 c Which is the biggest value? (a) -8 (b) -219 (c) -0.2 c Which is the second smallest value? (a) 4 (b) -0.04 (c) 0.1 (d) -13/3 (e) -0.7 e What is the second smallest value in -5, -31.08, 0.5, 2/11, 1/3? -5 What is the biggest value in 13, -1, -0.5? 13 What is the fourth biggest value in -4, -1/8, -1, 19? -4 What is the third smallest value in 0, -0.02, 9/8? 9/8 Which is the third biggest value? (a) 5 (b) -2 (c) 697 (d) 3 (e) -1/7 d What is the smallest value in -4, -3, 86, -1, -6? -6 What is the fourth biggest value in 0.4, 3.4, 2/3, 0? 0 Which is the smallest value? (a) -1 (b) 1/4 (c) -1/18 (d) 2/9 (e) 0 a What is the biggest value in -0.287, -3, -6? -0.287 Which is the second smallest value? (a) 158 (b) -5 (c) 4 (d) 3 (e) -2 e What is the second biggest value in 8, -31, 0.5, -0.2? 0.5 Which is the fourth biggest value? (a) -1 (b) 1.22 (c) 0.2 (d) -0.5 a What is the second biggest value in 2/149, -3, 2? 2/149 What is the biggest value in -2, 5, -1/1707? 5 What is the smallest value in 7/2, -3, -5? -5 What is the third biggest value in -50, -3, -1? -50 Which is the fourth smallest value? (a) -2 (b) -2/5 (c) -0.11 (d) 5 (e) 5/2 e What is the third smallest value in -31, 16, 0.5? 16 Which is the second smallest value? (a) 117 (b) -0.1 (c) 0.1 (d) 3 c What is the second biggest value in -2/13, 1/3, 0.2, -0.8, -1? 0.2 What is the fourth smallest value in 2/3, -0.1258, -5, 3/5, 2? 2/3 What is the second smallest value in 2, -40, 1/7? 1/7 What is the second biggest value in 0.3, -5, -1/9? -1/9 Which is the biggest value? (a) 51 (b) -2/17 (c) -2 a What is the biggest value in 0, 4, 0.03, 0.2, 0.5? 4 Which is the biggest value? (a) -41 (b) -0.3 (c) -5 (d) -0.5 b What is the second biggest value in -3, 29, -0.3? -0.3 Which is the second smallest value? (a) 3.7 (b) 0 (c) -4 b Which is the second biggest value? (a) -3/8 (b) 1/25 (c) -0.6 a Which is the biggest value? (a) 3/7 (b) 0.9 (c) -1 b What is the biggest value in 1/6000, 0.2, 2/7? 2/7 What is the third smallest value in 3.7, -0.14, 6? 6 Which is the biggest value? (a) 0.05 (b) -49 (c) -4 a Which is the second smallest value? (a) -9 (b) 2/7 (c) 9 b What is the fourth biggest value in 0, 0.2, 4, 13? 0 What is the smallest value in -1, -0.8, 5, 3/2? -1 Which is the third biggest value? (a) -2/31 (b) 1/4 (c) 2 a What is the biggest value in 1/5, -2/7, -21? 1/5 Which is the biggest value? (a) 3 (b) -0.5 (c) 3.15 (d) 0.2 (e) -1 c What is the third smallest value in -27, 3, 0.4, -2/11, 0.9? 0.4 Which is the fourth biggest value? (a) -2/3 (b) 0.1 (c) -0.2 (d) 3/8 a What is the third biggest value in 4/5, 0.5, 16/7? 0.5 What is the biggest value in -20, -2/3, -0.1? -0.1 Which is the fourth biggest value? (a) -5 (b) -0.5 (c) 0 (d) -0.3 (e) -12 a Which is the second biggest value? (a) -2 (b) 5/13 (c) 2/11 c Which is the second biggest value? (a) 0.2 (b) 0.4 (c) 22 (d) -6/11 b Which is the smallest value? (a) -3/4 (b) 0 (c) 2/7 (d) 1 a Which is the second smallest value? (a) -1 (b) 1402 (c) 4 c What is the smallest value in -4, 96, -0.1, 5? -4 What is the third biggest value in 0.4, -1/158, -1, -2, 1? -1/158 What is the second biggest value in 0, -3, 3/5, -4? 0 Which is the biggest value? (a) -1/203 (b) 1 (c) 3 (d) -1 c What is the second biggest value in -8, 6/19, -0.1? -0.1 What is the fourth biggest value in 5, -0.09, -139, -2/9? -139 What is the fourth biggest value in -1/10, 0.3, -2/3, 18? -2/3 What is the fifth smallest value in 0.1, -3, -0.5, 4, 18.1? 18.1 Which is the third smallest value? (a) -3/8 (b) 5/13 (c) 0.2 b What is the second biggest value in 5, -3, -1/4? -1/4 Which is the second biggest value? (a) 2/17 (b) -5 (c) -0.4 (d) 0.39 (e) -4 a Which is the third biggest value? (a) 2 (b) 0.5 (c) 1/10 (d) 0.8 (e) -4 b Which is the biggest value? (a) -6 (b) 3 (c) 30/7 c What is the third smallest value in 3, 1, 8, 3/4? 3 What is the third biggest value in 3, 3/2, 0.04, -8/11, -1.1? 0.04 Which is the second smallest value? (a) -4 (b) 0 (c) -54 a Which is the second smallest value? (a) 6 (b) -361 (	{ "pile_set_name": "DM Mathematics" }
e ten thousands digit of 120681? 2 What is the hundreds digit of 899? 8 What is the tens digit of 642? 4 What is the units digit of 5723? 3 What is the thousands digit of 19330? 9 What is the thousands digit of 3561? 3 What is the thousands digit of 9370? 9 What is the hundreds digit of 5327? 3 What is the units digit of 30365? 5 What is the hundreds digit of 7225? 2 What is the tens digit of 18119? 1 What is the hundreds digit of 931? 9 What is the tens digit of 7964? 6 What is the hundreds digit of 6686? 6 What is the units digit of 103? 3 What is the units digit of 3016? 6 What is the units digit of 491? 1 What is the hundreds digit of 4991? 9 What is the units digit of 103065? 5 What is the units digit of 65? 5 What is the thousands digit of 65755? 5 What is the ten thousands digit of 14836? 1 What is the thousands digit of 33573? 3 What is the ten thousands digit of 27452? 2 What is the units digit of 28517? 7 What is the thousands digit of 4494? 4 What is the thousands digit of 1066? 1 What is the ten thousands digit of 88668? 8 What is the tens digit of 797? 9 What is the thousands digit of 186678? 6 What is the thousands digit of 1663? 1 What is the units digit of 3590? 0 What is the thousands digit of 3400? 3 What is the hundreds digit of 611? 6 What is the tens digit of 1219? 1 What is the units digit of 3761? 1 What is the hundreds digit of 3300? 3 What is the hundreds digit of 23313? 3 What is the thousands digit of 12736? 2 What is the thousands digit of 4750? 4 What is the hundreds digit of 2063? 0 What is the units digit of 14186? 6 What is the units digit of 3492? 2 What is the tens digit of 24382? 8 What is the hundreds digit of 2722? 7 What is the units digit of 110251? 1 What is the ten thousands digit of 17736? 1 What is the hundreds digit of 247? 2 What is the tens digit of 9687? 8 What is the thousands digit of 9256? 9 What is the units digit of 1263? 3 What is the tens digit of 96903? 0 What is the units digit of 66907? 7 What is the hundreds digit of 18072? 0 What is the tens digit of 22539? 3 What is the units digit of 675? 5 What is the tens digit of 9246? 4 What is the tens digit of 11811? 1 What is the tens digit of 23725? 2 What is the hundreds digit of 6574? 5 What is the tens digit of 8027? 2 What is the units digit of 9870? 0 What is the hundreds digit of 1208? 2 What is the thousands digit of 77871? 7 What is the hundreds digit of 10374? 3 What is the thousands digit of 29663? 9 What is the hundreds digit of 946? 9 What is the units digit of 2708? 8 What is the units digit of 12149? 9 What is the hundreds digit of 12786? 7 What is the hundreds digit of 41179? 1 What is the units digit of 4777? 7 What is the tens digit of 1415? 1 What is the hundreds digit of 541? 5 What is the ten thousands digit of 55259? 5 What is the tens digit of 44366? 6 What is the thousands digit of 53518? 3 What is the hundred thousands digit of 117349? 1 What is the hundreds digit of 8937? 9 What is the hundreds digit of 5758? 7 What is the hundreds digit of 869? 8 What is the hundreds digit of 29242? 2 What is the thousands digit of 5089? 5 What is the units digit of 5362? 2 What is the units digit of 66429? 9 What is the tens digit of 428? 2 What is the hundreds digit of 23521? 5 What is the thousands digit of 8772? 8 What is the units digit of 1525? 5 What is the units digit of 660? 0 What is the units digit of 4652? 2 What is the units digit of 939? 9 What is the tens digit of 568? 6 What is the hundreds digit of 5843? 8 What is the hundreds digit of 51500? 5 What is the units digit of 7857? 7 What is the thousands digit of 28971? 8 What is the tens digit of 65134? 3 What is the units digit of 713? 3 What is the tens digit of 16361? 6 What is the ten thousands digit of 85109? 8 What is the tens digit of 2636? 3 What is the ten thousands digit of 89610? 8 What is the tens digit of 88696? 9 What is the ten thousands digit of 24354? 2 What is the units digit of 27781? 1 What is the units digit of 914? 4 What is the thousands digit of 10116? 0 What is the hundreds digit of 42930? 9 What is the thousands digit of 2752? 2 What is the hundreds digit of 2244? 2 What is the units digit of 409? 9 What is the tens digit of 754? 5 What is the units digit of 4289? 9 What is the hundreds digit of 22890? 8 What is the thousands digit of 31585? 1 What is the units digit of 43217? 7 What is the units digit of 62580? 0 What is the thousands digit of 1176? 1 What is the thousands digit of 3724? 3 What is the hundreds digit of 161? 1 What is the ten thousands digit of 57694? 5 What is the hundreds digit of 11326? 3 What is the units digit of 34418? 8 What is the thousands digit of 2413? 2 What is the thousands digit of 7002? 7 What is the units digit of 9399? 9 What is the units digit of 5268? 8 What is the hundreds digit of 4727? 7 What is the ten thousands digit of 53161? 5 What is the hundreds digit of 2708? 7 What is the units digit of 3409? 9 What is the units digit of 52482? 2 What is the tens digit of 5976? 7 What is the units digit of 49509? 9 What is the tens digit of 3821? 2 What is the ten thousands digit of 143825? 4 What is the ten thousands digit of 75689? 7 What is the tens digit of 5543? 4 What is the ten thousands digit of 23520? 2 What is the thousands digit of 1945? 1 What is the thousands digit of 1036? 1 What is the hundreds digit of 194? 1 What is the tens digit of 2125? 2 What is the tens digit of 8576? 7 What is the tens digit of 18518? 1 What is the units digit of 3257? 7 What is the ten thousands digit of 59526? 5 What is the units digit of 109739? 9 What is the units digit of 1888? 8 What is the tens digit of 1319? 1 What is the units digit of 47568? 8 What is the units digit of 114539? 9 What is the units digit of 3582? 2 What is the thousands digit of 61554? 1 What is the thousands digit of 8569? 8 What is the thousands digit of 7554? 7 What is the tens digit of 1020? 2 What is the thousands digit of 11869? 1 What is the tens digit of 102722? 2 What is the thousands digit of 5608? 5 What is the units digit of 155924? 4 What is the units digit of 26350? 0 What is the thousands digit of 8583? 8 What is the units digit of 22063? 3 What is the thousands digit of 4898? 4 What is the units digit of 1099? 9 What is the units digit of 5597? 7 What is the units digit of 10913? 3 What is the units digit of 9928? 8 What is the units digit of 2665? 5 What is the hundreds digit of 912? 9 What is the ten thousands digit of 10013? 1 What is the tens digit of 43276? 7 What is the units digit of 5242? 2 What is the units digit of 8765? 5 What is the units digit of 30795? 5 What is the thousands digit of 1116? 1 What is the units digit of 2999? 9 What is the hundreds digit of 22422? 4 What is the hundreds digit of 329? 3 What is the tens digit of 16234? 3 What is the hundreds digit of 727? 7 What is the ten thousands digit of 12317? 1 What is the ten thousands digit of 28595? 2 What is the units digit of 5613? 3 What is the units digit of 97? 7 What is the units digit of 1208? 8 What is the hundreds digit of 25612? 6 What is the hundreds digit of 92845? 8 What is the tens digit of 15426? 2 What is the thousands digit of 5632? 5 What is the hundreds digit of 567? 5 What is the units digit of 804? 4 What is the thousands digit of 80500? 0 What is the units digit of 6966? 6 What is the thousands digit of 7536? 7 What is the units digit of 117320? 0 What is the ten thousands digit of 38320? 3 What is the tens digit of 990? 9 What is the units digit of 1061? 1 What is the units digit of 937? 7 What is the hundreds digit of 4888? 8 What is the units digit of 3507? 7 What is the units digit of 1920? 0 What is the ten thousands digit of 15141? 1 What is the tens digit of 337? 3 What is the thousands digit of 3708? 3 What is the thousands digit of 5679? 5 What is the tens digit of 803? 0 What is the thousands digit of 9199? 9 What is the tens digit of 140124? 2 What is the tens digit of 3164? 6 What is the units digit of 83707? 7 What is the units digit of 70475? 5 What is the hundreds digit of 1566? 5 What is the units digit of 7869? 9 What is the hundreds digit of 13441? 4 What is the thousands digit of 79651? 9 What is the tens digit of 3624	{ "pile_set_name": "DM Mathematics" }
for h. 3 Let a = -21 + 14. Let f = -2 - a. Suppose 3t = -fz + 26, 6t = 3t + 4z - 10. Solve tu + 5 = -3u for u. -1 Let o = 492 + 234. Suppose -o + 718 = -2c. Suppose 2 - 10 = -2i. Solve -ch - i = 4 for h. -2 Let v be (-4 - 12)/4 - (-32 + -202). Solve u = -v + 235 for u. 5 Suppose 0b - 10 = -5b. Suppose 5j - 5 = bo, -5j + 0o = 3o - 30. Let l be 0/5j/(-6) + 3. Solve -lf - 2 = -5 for f. 1 Let b be (-2)/(-16) - (-5)/82453/55. Solve -19v = -bv + 27 for v. 3 Let t = -364 - -355. Let q be -2 - (12/(-3) - t - 9). Solve qx + 6 = 4 for x. -1 Let v = -7 + 10. Let t be (-44)/(-21) + 28/(-294). Solve -tb = b - v for b. 1 Suppose -h = -b + 64 - 67, -3h - 7 = 5b. Suppose 4 = 5j - 11. Solve -j = r - h for r. -2 Let h(v) = -10v. Let p be h(-1). Let w be (((-266)/(-14))/(-19))/(2/(-6)(-1 + 2)). Solve wx = px - 35 for x. 5 Let v(w) = -w2 + 30w + 240. Let k be v(-6). Solve -102f = -110f - k for f. -3 Suppose 0q = 2q - 4c - 544, 0 = -3q - 3c + 843. Let f = 280 - q. Solve 4m + fm = 30 for m. 5 Let u be 10/4(-136)/(-68). Suppose -3g + 3 = f, -13g - u = -18g. Let y be 13 - 3/((-6)/4). Solve fr = 5r + y for r. -3 Let f be (-8)/(-36) - 480/(-27). Let h be 21/2f/21. Suppose -q + 4q - 2t = h, 3q = t + 6. Solve 0 = -0u - u - q for u. -1 Let z be (-31 + 36)403/65. Solve 20a = za + 33 for a. -3 Let j = 187 + -179. Let o be 3 - (22/(-18) - j/(-36)). Let f(t) = 3t*3 - 1. Let v be f(1). Solve -14 + v = -ok for k. 3 Let d(o) = -o*3 + 8o*2 + 25o - 214. Let a be d(6). Solve aw + 42 = w for w. -6 Let k be 3 - (-1)/(5 - 4). Suppose -kt = -4f - f - 27, 2t + 4f + 6 = 0. Solve -5o = -t + 13 for o. -2 Let b(y) = 7y2 - 17y - 23. Let n(g) = 17g2 - 34g - 45. Let r(l) = 7b(l) - 3n(l). Let v be r(-6). Solve a = va - 15 for a. 5 Let w(x) = x - 11. Let v be w(-4). Let k be (-192)/v + (-4)/5. Suppose h = -5l - 20, 3h + 2l + l + k = 0. Solve -3t - 6 = -ht for t. -2 Let r(k) = k*2 - 23k - 4. Let t be r(15). Let q = -114 - t. Let n be 1/4 - 11/(-4). Solve 2u - q = -nu for u. 2 Let b = 500 - 416. Let w be (-144)/(-63) - 38/b. Solve 0 = 10r - w + 52 for r. -5 Let x = -72 + 54. Let p be (12/x1)/((-2)/6). Suppose -m - 2 = -0u + 2u, 0 = 2m + 2u + 2. Solve -i = -mi - p for i. 2 Let c be ((-176)/264)/(2/(-9)). Solve cy + 246 = 240 for y. -2 Let c(f) = f3 - 10f*2 + 10f - 2. Let p be c(9). Let s(k) = -3 + 12 + 0k - k + p. Let u be s(16). Solve u = 3j - 5j - 10 for j. -5 Suppose v + 31 = 3s, 4s + v - 3v = 40. Suppose -s = -d - 3. Solve dk + 2 = 6k for k. -1 Let o be (40/16)/((3/(-2))/(-3)). Suppose 9t - 14t + 105 = 0. Let a = t + -12. Solve -o + a = d for d. 4 Suppose -15 = 2f - 17f. Let y be -6(-3)/(-2) - (-2)/2. Let w = -5 - y. Solve wz = -14 - f for z. -5 Suppose 0 = -11k + 27 + 28. Suppose 5p - 10p = -2s - 8, 9 = 2p + ks. Solve -16 = pg - 6g for g. 4 Suppose 4v = 6v. Let i be (-10)/((-5 + 0)/(-15)). Let k be -2i/183. Solve v = 2j + k - 4 for j. -3 Suppose -4q - 128s = -129s - 1602, -5q + 2008 = -4s. Solve 53g = 3g - q for g. -8 Suppose 0 = -3w + 4p + 7, -w + 0w + 3 = -p. Suppose 0 = wy - 20, 5r - 556 = -0y - 4y. Suppose -9z + r = -72. Solve -3f + z = f for f. 5 Let k(v) = -v3 + 13v*2 - 35v + 148. Let t be k(11). Solve -17 + t = -4d for d. 3 Suppose 0 = 5h + 4z - 20, 10z = 6z. Let o be (-14)/(126/(-45)) + h + -1. Solve 2i + o = 4i for i. 4 Suppose m = -5m - 294. Let w = 43 + m. Let d be 2/((w/12)/(-1 + 0)). Solve -2c + d = -0 for c. 2 Let p(y) = 8y*3 - 186y*2 + 46y. Let t be p(23). Solve t = 73s + 820 - 163 for s. -9 Suppose -61a + 66a - 105 = 0. Solve -55 = az - 10z for z. -5 Let r be (1 + 4/(-6))/(33/4554). Solve 12m = rm - 68 for m. 2 Suppose 179m = 156m + 690. Solve 0 = 7z + mz + 259 for z. -7 Suppose 0f - 120 = 5f. Suppose 7o - 8o - 4a - 22 = 0, o = -3a - 24. Let c = f - o. Solve c = -q - q for q. -3 Let z(k) be the third derivative of k5/60 - k4/2 + 5k*3/6 + 23k*2. Let g be z(10). Let t be (-108)/81g/4. Solve -6v = -tv for v. 0 Let q = -40 + 81. Let i = q - 35. Solve 3f = f + i for f. 3 Let c be 4 - (9 - 11 - -2). Let o be 4 + 2/(-1) + -5. Let t be o/(-6) - (-6)/c. Solve -ta - a = 0 for a. 0 Let o(n) = 2 - 4n + 22 + n + 6. Let u be o(8). Let x be (12/15)/(14/35). Solve 0 = -xp - p + u for p. 2 Suppose 3j - n - 380 = 0, n - 6 = -5. Let t = j - 115. Let s = 72 + -72. Solve -3h + 7h + t = s for h. -3 Let f be -682(-36)/3432 - 2/(-39)-3. Solve -fc + 8c = 6 for c. 6 Suppose -3g = 5x - 62, -5x + g - 16 = -62. Suppose t = 3q - x, -9t + 5t = 4q - 40. Solve qw + 8 = w for w. -2 Let a(y) = 4y*3 + 197y*2 - 150y + 31. Let j be a(-50). Solve 18n + 26 = jn for n. 2 Suppose 4i + 2144 = 5w, -5w + 2i = -999 - 1143. Let n = 430 - w. Solve 3j - n = -14 for j. -4 Let k = 24 + -16. Suppose -i = -2 - k. Let q be (-6)/(-4) - (-5)/i. Solve qj - 7j = 15 for j. -3 Suppose 0 = p - 5n - 81, -11n - 12 = -8n. Solve -125 = -62h + p for h. 3 Let h be (-3986)/(-2) - (270 + -283). Solve ho - 2000o + 6 = 0 for o. -1 Suppose -2t = -2v - 10, t - 4 = -3v - 11. Suppose -4w + 5 = tn - 17, -2w = -8. Solve -15 = 8d - nd for d. -3 Suppose -12 + 20 = 4s. Suppose 0 = sf - 26 + 14. Suppose -fg = 7g. Solve -4a - 12 = -ga for a. -3 Suppose 65 = 423v - 201v - 209v. Solve -vp + 22 = 2 for p. 4 Let r = -1836 + 1845. Solve -13 = -rq - 4 for q. 1 Let v(g) = -g*3 - 17g*2 + 8g - 36. Let c be v(-18). Let t = -486 + 343. Let k = t + c. Solve 3a + k - 4 = 0 for a. 1 Suppose -5646f = -5670f. Solve f = 5i + 479 - 444 for i. -7 Let g(u) = -87u - 4758. Let y be g(-57). Solve 116i = 49i + y for i. 3 Let t = 14 + -221. Let l = -205 - t. Solve -3b = -b + l for b. -1 Suppose 6o - 3o = -2x + 595, 0 = 4x + 4. Suppose 0 = -2k - 3k - 3y - o, -4y - 50 = k. Let z = k + 42. Solve -h - zh = 0 for h. 0 Let p = -28 - -22. Let v be p/(-27)-21(-6)/(-4). Let r(n) = n3 + 8n*2 + 6n - 5. Let x be r(v). Solve 0 = b + xb for b. 0 Let i = -27 - -30. Suppose 5b + 4q + 6 = 0, -2b - 2q + i = 7. Solve -j + 1 = -bj for j. -1 Let p = -463 - -714. Let f = p - 251. Solve 0 = -fs - 8s + 32 for s. 4 Let y be -5 - -6 - (-1 + -1). Suppose 0i = -i - 4t, yt - 2 = -i. Suppose -17 = z - 8r + 13r, 23 = z - 5r. Solve i - z = -h for h. -5 Let b(s) be the second derivative of s*4/6 - 10s3/3 + s2/2 + 58s. Let y be b(10). Solve -y = 2o - 11 for o. 5 Let t be 21/1472/27. Solve 0 = -tl - 12 for l. -3 Suppose 4r + 424 - 4 = 0. Let q be (-19)/(-5) + r/(-25) + -4. Let b = 11 + -8. Solve 2 = -bs + qs for s. 2 Suppose 2b - 28 = -2s, 2b - 5s = 45 - 10. Let a be (4 - 3) + -1 - 172/2. Let n = 91 + a. Solve 0i + b = -ni for i. -3 Suppose -2s = -10, -o + 96 = -0o + s. Let a be 7552/(-88) - 7(-12)/(-462). Let n = a + o. Solve -6h + nh - 1 = 0 for h. -1 Let w be (1128/470)/(56/(-30) - -2). Solve wm - 19m = 3 for m. -3 Let i(m) = m*3 - 7m*2 + 7m - 1. Let j be i(6). Let g be (26/(-4) + 0)(-42)/91 + 2. Solve jp = 10 - g for p. 1 Suppose 0 = 3q - q - 5q. Suppose -22 = -c + 64. Let z = c + -82. Solve -zl = -ql + 16 for l. -4 Let p(m) = 3m2 + 32m - 38. Suppose -8l + 4l = -2h + 50, 4l + 47 = -h. Let u be p(l). Solve 9b = 4b - u for b. -2 Suppose -8j = 4j - 12. Let p be 3 + j + 10/2 + -7. Solve 5 - 1 = pi for i. 2 Let b(t) = 3t*2 + 3t + 2. Suppose 2i - j = 0, -10i + 5i - 3 = -j. Let d be b(i). Solve -dp + 5p = -15 for p. -5 Suppose -3 - 1 = 2y, 3y + 50 = n. Let r = n - 42. Suppose 0 = 4x + 2v + rv - 20, -x + 6 = 2v. Solve 2p - p = x for p. 4 Suppose 72 = -19o + 300. Suppose -4c = -x - 3x - o, -4c + 22 = x. Solve -6r = -xr - 4 for r. 1 Suppose -12t = 8t + 5t - 32t. Solve 73u - 88u - 45 = t for u. -3 Suppose 50 = -16k + 4338. Let m = 271 - k. Solve 7 = mf - 8 for f. 5 Let d = 1 - -4. Suppose 15r + 10413 = -8r + 10643. Solve dg - rg - 10 = 0 for g. -2 Let s(l) = -9l - 102. Let x be s(25). Let u = x + 334. Solve -5o - u = 8 for o. -3 Let w be 2/18 + (-119)/(-63). Suppose -a + 5a = wr + 4, 0 = -3r + a - 1. Let p be ((-2 - -2) + 3)(r + 1). Solve -5 + p = -k for k. 2 Let x be (-15)/(-810)122358. Solve 518 = 6*k + x for k. -1 Let k be ((-42)/35)/(4/(-	{ "pile_set_name": "DM Mathematics" }
y (((s0/s)/s)/s)/((s/s11)/s)(s/(ss(-3/17)))(-15/11) assuming s is positive. s(1451/187) Simplify (w/w(-2))43/((w/w7)/w(-1/3)) assuming w is positive. w(404/3) Simplify n(3/4)/(n/(n8n))(n/(nn(-11)))/n(5/2) assuming n is positive. n(69/4) Simplify r(3/13)/r(1/3)r*24/rrr(-13/3)r assuming r is positive. r(802/39) Simplify o7/o*(-2/11)(o/(o(o/(o/o(-3/11)))/oo)o)/(o(-2)/o) assuming o is positive. o(126/11) Simplify ((v/(v/(vv*6))v(2/7))/((v(4/7)v)/v(-1/3)))0 assuming v is positive. 1 Simplify ((ss/(s/((s/s(2/5))/s)))/s)49/(s/(s(1/2)/s))(1/8) assuming s is positive. s(-1583/80) Simplify ((j(-4)(j/(j/(j/((jj/(j5/j))/j))))/j)/(j0)(-47))(8/7) assuming j is positive. j(-8/7) Simplify (((g(-1/3)g)/g)/(g(1/15)/g))/(g/((g/(g(-1/3)g))/g))(1/2) assuming g is positive. g(-7/30) Simplify ((l*21l)/l(1/66))(7/3) assuming l is positive. l*(10157/198) Simplify ((tt*2t)/t*(1/8)(tt(1/3)/t)36)(-9/2) assuming t is positive. t(-1143/16) Simplify (x(x/x(-1/7))/x)/x(-1/3)(x(-2/19)x)/x10 assuming x is positive. x(-3044/399) Simplify (rrr*3)/(rrr(-1)/rr)(r(-1/3))(-7/3) assuming r is positive. r(43/9) Simplify (qq/(qq(3/5))qq(-5/4)(qq(-1/6))/(q(1/4)q))27 assuming q is positive. q(-36/5) Simplify (oo(3/11)ooo(-15))25 assuming o is positive. o*(-3225/11) Simplify ((zz(-1))5z3z(-4/3))(-30) assuming z is positive. z*(-50) Simplify (((pp(2/15))(1/22))(-12))(-1) assuming p is positive. p(34/55) Simplify (u/(u(1/4)uu)u)23(u/u(-2/9))35 assuming u is positive. u(1333/36) Simplify (c(-4)c)/c(-3/5)(c12)(-22) assuming c is positive. c(-1332/5) Simplify ((p/p29)/(pp20p))49 assuming p is positive. p(-2450) Simplify (h*(1/48)/h)/(hhh(1/17)h)(h(-1/2))(-12) assuming h is positive. h(1601/816) Simplify ((aa(-2/3))/a)(-11/2)/(aa11)(1/4) assuming a is positive. a(2/3) Simplify w(-16)www*(1/14)w(-8/7)/w(-11/6) assuming w is positive. w(-278/21) Simplify ((n15n(n/(n/n*(8/5)))/nn)(-2/97))12 assuming n is positive. n*(-2112/485) Simplify ((aa(-4/9))/(a4/a))/(a/a*8aa0) assuming a is positive. a(32/9) Simplify (kk/(kk(2/11)/kk)k(-20))/(k/k9)25 assuming k is positive. k(1989/11) Simplify (k7/k(3/7))/(k/(k/(kk*(-6)))k(-24/5)) assuming k is positive. k(573/35) Simplify (s(-1/3)/s10)/(s/s*(-3)((s/(s/(s9/s)))/s)/s) assuming s is positive. s(-61/3) Simplify (w*(2/11)ww)(1/2)ww((w/(ww(2/37)))/w)/www(-1/7) assuming w is positive. w(5396/2849) Simplify (n(-4/27)/n(((nnn*(-15)/nnn)/n)/n)/n)/(n(-2/39)/n30) assuming n is positive. n(4880/351) Simplify ((x/(x/(x/(xx/x*(-2/5)))x))*(24/11)(x(-1/3))28)(7/6) assuming x is positive. x(-8414/495) Simplify ((o/o*(-5)o)(-1/2))(-8/7) assuming o is positive. o4 Simplify (i(-15)i37)/(i(-2)(i(-32)/i)/i) assuming i is positive. i58 Simplify (((yy17/yy)/y)(20/9))(-10/9) assuming y is positive. y*(-3400/81) Simplify ((zz/z*(-1/9))/zz*(-17))/(zz*(1/10)z(zz/(z/(zzz/(z/((z/(z/((z*8z)/z)))/z)))))/z) assuming z is positive. z(-2429/90) Simplify (n(1/5)n)(4/13)/(n3/n)16 assuming n is positive. n(-2056/65) Simplify (z(-1/8)/(z(-8)zz)(z(1/3))(-46))(-27/2) assuming z is positive. z(2043/16) Simplify (q/(q*(-27)q)qq(q(-25)q)/q)/(q/(q*(8/9)q)qqq/(q(q*23/q)/qq)) assuming q is positive. q*(224/9) Simplify ((a/((aaa(-14))/a))/aa/(aa/a(-1/11)))/(a(4/17)aa(-2/3)) assuming a is positive. a(6362/561) Simplify (q/(((q(-9/4)q)/q)/q))/((q/((q*(1/34)q)/q))/q)q(-8)/q25 assuming q is positive. q(-1953/68) Simplify o/(o(-1/40)/o)oo7oooo/(o/o(-3))o/o(-22) assuming o is positive. o(1321/40) Simplify ((l*(5/2)/ll/(l*1/l))/(ll/(l/l(-1)))(-1/17))(3/5) assuming l is positive. l(3/2) Simplify ((b*27b)/(b*(-10)b))/(b(-31)/(b(-38)b)) assuming b is positive. b31 Simplify ((r/(r(-2/13)/r))/r)(-4)((r/(r(rrr(-1/13))/r))/r)(-3/11) assuming r is positive. r(-45/11) Simplify (b(-3/7))(-42)(b5)(-4/19) assuming b is positive. b(322/19) Simplify (j(-3/10)/(((j*(2/17)j)/j)/j))/(j/j(-1/17))(-29) assuming j is positive. j(5319/170) Simplify (a(-2/31))(-18)/(a(4/15)a/((aa28)/a)) assuming a is positive. a(12971/465) Simplify (((g/(g*0/g))/gg*3g)/((g/g*(5/6))/(gg7)))(-29) assuming g is positive. g(-2233/6) Simplify ((j/(j(1/4)/jjj))*34/(jj*7/jjj/(jj/j(1/7))))(-1/30) assuming j is positive. j(73/140) Simplify (t(2/7))27/((t(-1/5)/tt)/((t/(t(9/7)/tt)tt)/t)) assuming t is positive. t(302/35) Simplify ((j(-1/50))(-25))(-36/11) assuming j is positive. j(-18/11) Simplify ((u(-13)/uu2)41)(-27) assuming u is positive. u13284 Simplify qqqq/q*(2/15)qq(1/10)((qq6qq)/q)(-2/27) assuming q is positive. q(1181/270) Simplify f(1/15)ff(-12)((ff(4/9)/f)/f)/f(6/17) assuming f is positive. f(-9059/765) Simplify ((c/c(-6)c*(-1)c)/(c(-5)/c(-6/5)))(-32) assuming c is positive. c(-1728/5) Simplify ((g11/g)/(g/(g/g(6/7))))/(g*(3/8)g(-13)) assuming g is positive. g(1219/56) Simplify ((s/s(1/37))/s(-1/18))/(s19/s25) assuming s is positive. s(4681/666) Simplify ((s/(s(3/4)/s))/(s(s/((s/(s(-2/5)/s))/s))/s))/(ss*(-2/9)sss)9 assuming s is positive. s(-647/20) Simplify a/(aa(-7)a)aaa/a(-4/17)a(a(-1/2))37 assuming a is positive. a(-281/34) Simplify (l(-2/5)/l)(3/22)(l(-6))(-8) assuming l is positive. l(5259/110) Simplify (a37aa)/(a*(-8)/aa)(aa/(aa(-10/11))a)/a(-5/4) assuming a is positive. a(2251/44) Simplify (p/p(-2/7))44(p/(p/(pp*(2/15)p)p))/p(1/3) assuming p is positive. p(2008/35) Simplify g(-21)g*(-5/9)g*(-4)ggg3 assuming g is positive. g(-185/9) Simplify ((zz(7/3))/z)35/((zz*(4/7)z)/(z/(zz0)zz)) assuming z is positive. z(1703/21) Simplify b(-3/7)/(bb/b*(-2/7))(b(-1/5))(-24) assuming b is positive. b(73/35) Simplify z(-22)z/(zz*(-2/17)z)(z(-15))(2/101) assuming z is positive. z(-39799/1717) Simplify ((((m(m/m*0m)/mm)/m)/m)(-1)/(m/m0)27)(3/17) assuming m is positive. m(-84/17) Simplify (m(-41)/(m/(m(-23)m)m))/(((mm/(m*(-2/15)/m)m)/m)/(m(-5/9)/m)) assuming m is positive. m(-3136/45) Simplify (a26/a(-1/14))(6/11) assuming a is positive. a(1095/77) Simplify (ss/(ss*(1/4)s)s/((ss/(s/(s/s*(3/7))))/ss)s)/(((s/(ss/s*(-3/8)))/ss)/(s*8ss)) assuming s is positive. s(647/56) Simplify ((y(2/23)/y)15)17 assuming y is positive. y(-5355/23) Simplify ((v/(v/v(6/5))v)/vvv/(v/(v/v30)))/(v(1/16)/(v0/v)) assuming v is positive. v(-2229/80) Simplify ((j(j/((j(-10)j)/j))/jjj)/(j/j(2/117)))/((j(-5/6)jj)/j(-4/21)) assuming j is positive. j(17461/1638) Simplify (((u*3u)/u(-4))/(u(2/3))(-2/67))13 assuming u is positive. u(20956/201) Simplify ((g/((g/(g/(g(2/3)g)))/g))/(g/g(2/13))g*(-1/7)ggg/g(7/5))22 assuming g is positive. g*(28358/1365) Simplify (((z/((z/(zz*(-26/5)/zz)z)/z))/z)/(zz/(zz/(z(z*(-13)zz)/z))))/((zz*(-17))/(zz/(z*(-15/7)/zzzzz))) assuming z is positive. z(803/35) Simplify (uu(uu*5)/uu)/((u(u/(u/(uu*13u)))/u)/u)u10/(u(-12)u) assuming u is positive. u15 Simplify (u(-21)uuu5)/(u/(uu*(-3/5))uu(-1/5)/uu) assuming u is positive. u*(-77/5) Simplify ((hhh(-3))/h)(-4/13)h*(-2)/(h/(hh4)) assuming h is positive. h(34/13) Simplify (z(-25)/(z(-5/17)/z))(-2) assuming z is positive. z(806/17) Simplify ((g*(-1/8)(g*(3/4)g)/g)4)0 assuming g is positive. 1 Simplify (((z(1/9)/z)/z)/z)/(z/(z(-3/2)/z)z)(z5)(1/4) assuming z is positive. z(-221/36) Simplify ((((i2/i)/i)/i)(1/36)/(i(-1/3)i)2)(-39) assuming i is positive. i(637/12) Simplify (n4)15/(n(-3/7)nnn2) assuming n is positive. n(395/7) Simplify ((z(-15)/z)/(z(-17)/z))/(	{ "pile_set_name": "DM Mathematics" }
- 4? -74509428 In base 4, what is 23 - -22210113022? 22210113111 In base 8, what is 23114027 - -4? 23114033 In base 15, what is -3335 - 8ac? -3be2 In base 4, what is 22 + 11320023310? 11320023332 In base 2, what is -11 - 100001000001111? -100001000010010 In base 8, what is 514052 - -5774? 522046 In base 12, what is -4 + 961a90? 961a88 In base 13, what is 510149 + 19? 510165 In base 11, what is -2 - 1942687? -1942689 In base 12, what is -917 + -64226? -64b41 In base 10, what is 664596 + 0? 664596 In base 12, what is 830 - 6a17a? -6954a In base 6, what is 45205 - 12215? 32550 In base 15, what is -2 + -3e3439? -3e343b In base 15, what is 3b247 - 30? 3b217 In base 13, what is 1c22 - 1bb4? 3b In base 14, what is 4aca6b3 - 2? 4aca6b1 In base 9, what is -556102877 - -2? -556102875 In base 3, what is -12 + 202020222012222? 202020222012210 In base 12, what is 32b077 + -34? 32b043 In base 16, what is -511 - -1962? 1451 In base 7, what is -56000 - -12252? -43415 In base 11, what is 2523074 - 5? 252306a In base 12, what is 4 + -39b4154? -39b4150 In base 16, what is 1f + 8761c? 8763b In base 11, what is 9a9964 + 444? 9aa2a8 In base 11, what is 37852170 - -2? 37852172 In base 8, what is 33532531 + 0? 33532531 In base 2, what is 110000111100100 + -101101011? 110000001111001 In base 15, what is -ae1 + 5dc80? 5d18e In base 13, what is 8cab + -2060? 6c4b In base 13, what is -47586b63 + -2? -47586b65 In base 9, what is -3206270 + -2? -3206272 In base 15, what is -309e6 - a6? -30a9c In base 5, what is 112 - 322041233? -322041121 In base 16, what is -2af - -2c9a0? 2c6f1 In base 7, what is -3413016 + -426? -3413445 In base 14, what is -13450 + 170? -132c0 In base 6, what is 2020102 - 1310? 2014352 In base 5, what is -214403034301 + 3? -214403034243 In base 8, what is 232055 + 24? 232101 In base 5, what is -4341 - 40431140? -40441031 In base 4, what is 121132 - -13230? 201022 In base 11, what is -3696a8 - -19? -36968a In base 9, what is -5 - 224614142? -224614147 In base 15, what is -2cdc + 97? -2c45 In base 15, what is -51e - 11086? -115a5 In base 2, what is -1011101011110 + 1110111? -1011011100111 In base 14, what is 2 - -1dc53c? 1dc540 In base 9, what is -4 + 2888035? 2888031 In base 4, what is 0 - -22210030122? 22210030122 In base 3, what is 1 - 10201021202012210? -10201021202012202 In base 16, what is -1 - 9cc947? -9cc948 In base 15, what is -1 - 263938? -263939 In base 14, what is 90cb - -1b80? ac6b In base 4, what is 231221020 + 33022? 231320102 In base 14, what is -d - -12cca28? 12cca19 In base 6, what is -24023222 + -1? -24023223 In base 15, what is -1012969 + -e? -1012978 In base 9, what is 3377763 - -4? 3377767 In base 5, what is 1040 + -120201142? -120200102 In base 12, what is 45086226 - 5? 45086221 In base 4, what is 121030310 + 2201? 121033111 In base 7, what is 42265 - 16412? 22553 In base 9, what is 102413447 - -5? 102413453 In base 8, what is -7 - 22455131? -22455140 In base 4, what is -10302133210 - 22? -10302133232 In base 14, what is 4d5bbc + 10? 4d5bcc In base 15, what is -327e11 + -2? -327e13 In base 13, what is -82bc + -9085? -14374 In base 8, what is 22 - 617643? -617621 In base 5, what is -4234 - 131443? -141232 In base 2, what is -1110000 - -100100100111101? 100100011001101 In base 8, what is 72365 + 53? 72440 In base 5, what is -223 + -2100323? -2101101 In base 6, what is 14120 - -11533440? 11552000 In base 3, what is -20 + 101121111021212? 101121111021122 In base 2, what is -1001111010100011110000101111 + -1? -1001111010100011110000110000 In base 16, what is -90f7 + -d09? -9e00 In base 6, what is 40 - -1303134555? 1303135035 In base 6, what is -3121503 - 20? -3121523 In base 8, what is 606307 + -1? 606306 In base 4, what is -30111100 - 10112? -30121212 In base 12, what is -1244a93 + -a? -1244aa1 In base 5, what is -2304324241401 - 0? -2304324241401 In base 12, what is 1b10 - -185a? 376a In base 9, what is 55 + -3127645? -3127580 In base 12, what is -151 - 52b214? -52b365 In base 11, what is 260 + -239025? -238875 In base 10, what is 5208258 + 1? 5208259 In base 9, what is 20653126 - -3? 20653130 In base 16, what is 33ea8 + 21? 33ec9 In base 12, what is -650418 - -56? -650382 In base 4, what is 1133 + -1123230312? -1123223113 In base 10, what is -9657 + 79? -9578 In base 12, what is -3b59 + 32b8? -861 In base 9, what is 4 + 27540512? 27540516 In base 3, what is -21101120110 + -212? -21101121022 In base 8, what is -2654106 + -76? -2654204 In base 15, what is 19e4c4 + 9? 19e4cd In base 5, what is -11 + 110042003001? 110042002440 In base 6, what is -1144411 - -105554? -1034413 In base 10, what is 424 + 229550? 229974 In base 13, what is -2bb - 18041? -1832c In base 6, what is 5152455 + 202? 5153101 In base 6, what is 51004135155 + 5? 51004135204 In base 6, what is 14551032 + -5320? 14541312 In base 3, what is -2 + -20221110001? -20221110010 In base 8, what is 133477 - 555? 132722 In base 5, what is -11040 + -13223242? -13234332 In base 4, what is -312 + -11102233? -11103211 In base 15, what is -29ed5a8 + 1? -29ed5a7 In base 2, what is -1100110101100 - 10010010001111? -11111000111011 In base 7, what is -3661 + 424606? 420615 In base 15, what is -3560133 + 2? -3560131 In base 3, what is -22120 + -1020001102? -1020100222 In base 12, what is -64 + 57a102? 57a05a In base 2, what is -10 + -10000011010010100001110? -10000011010010100010000 In base 2, what is 0 - -10001101011011001101? 10001101011011001101 In base 13, what is -30 + 3b09a56? 3b09a26 In base 9, what is 2 + 603721? 603723 In base 16, what is 2 + 14c65f? 14c661 In base 7, what is -55 + -2336503? -2336561 In base 6, what is 235444 - 2202? 233242 In base 5, what is 1041410 + -3002234? -1410324 In base 13, what is 7a - -17143b? 1714b8 In base 13, what is -1 + -60cccb? -60cccc In base 7, what is -32052 - -2022? -30030 In base 4, what is 11 - -112333210033? 112333210110 In base 6, what is 1 + 50334401? 50334402 In base 12, what is -12 - -119604? 1195b2 In base 2, what is 1101011011110100010 + -10001? 1101011011110010001 In base 2, what is 10000100110011011011 + 11010010? 10000100110110101101 In base 6, what is 12 - -1033143030? 1033143042 In base 8, what is 1071630 - -1262? 1073112 In base 2, what is 100001010111 - 110000001111100010? -101111101110001011 In base 12, what is 9537a5 - -4? 9537a9 In base 6, what is 4 - 404000052? -404000044 In base 10, what is 95190193 + 10? 95190203 In base 11, what is -493 - -474? -1a In base 11, what is 4589954 + 41? 4589995 In base 6, what is 1012 - 211054? -210042 In base 10, what is -4709730 - -2? -4709728 In base 12, what is 0 - -16555843? 16555843 In base 7, what is -26116 - -2045? -24041 In base 8, what is -11 + -24064474? -24064505 In base 8, what is 6736 - -17070? 26026 In base 6, what is 13 - -13052121? 13052134 In base 3, what is 2021002102 - -12022? 2021021201 In base 13, what is 6a518 - 1b? 6a4ca In base 7, what is 10535 - 10233? 302 In base 3, what is 112200212220 + -2012? 112200210201 In base 8, what is -221575463 - 2? -221575465 In base 13, what is -ba18 - 1159? -cb74 In base 6, what is 5535122301 + 3? 5535122304 In base 16, what is 7a + 258845? 2588bf In base 2, what is -111010100110 - -1101011000000? 110000011010 In base 3, what is -2000102022 + 211? -2000101111 In base 8, what is 125575 + 464? 126261 In base 13, what is 7c371b2 + -2? 7c371b0 In base 7, what is 2263555455 + 4? 2263555462 In base 12, what is 6a125 + 423? 6a548 In base 2, what is -10101100110 - 10010101000100? -10101010101010 In base 13, what is 2 - -213469? 21346b In base 16, what is -9483 - 17ed? -ac70 In base 14, what is -10263 + -122? -10385 In base 8, what is -133211041 - -5? -133211034 In base 12, what is -336 - -a8496? a8160 In base 11, what is 116546143 - -5? 116546148 In base 16, what is 11 - -90b0b? 90b1c In base 12, what is 23b3 - a069? -7876 In base 7, what is -30652 + 12044? -15605 In base 13, what is 4b7 - 4281? -3a97 In base 3, what is -100100111200 - -200? -100100111000 In base 3, what is -22122200001201 + 12? -22122200001112 In base 14, what is 5 + a921c? a9223 In base 10, what is -209 - -1867? 1658 In base 9, what is 17604 - -144? 17748 In base 15, what is -1 + -4cdaa07? -4cdaa08 In base 9, what is -135 - -1651413? 1651267 In base 13, what is 53cc1 - 16?	{ "pile_set_name": "DM Mathematics" }
11401i for i. -18 Solve -1327i - 13764 = -3323i + 1624i for i. 37 Solve 5792z - 124423 + 400195 = 3734z for z. -134 Solve 0 = -204l - 810 + 10398 for l. 47 Solve -5628g = 4874g - 366549 - 431603 for g. 76 Solve -667v + 764v - 172 = 1186 for v. 14 Solve 936f - 74589 = -651f for f. 47 Solve -719s - 37075 = 452s + 40101 - 13942 for s. -54 Solve -8981y + 633888 - 500108 = 1740y - 745342 for y. 82 Solve -101l = 114l - 381l - 4316 for l. -26 Solve 1186 = 50d - 1114 for d. 46 Solve -8543w - 430w - 7430w - 458208 = -2084w for w. -32 Solve 58980c + 2933 = 57786c - 49603 for c. -44 Solve 301173 = -3632s - 89451 + 86873 - 81241 for s. -106 Solve -4318g - 1686g = 50g + 635g - 494986 for g. 74 Solve 3058i + 313228 = 53577 - 244817 + 125276 for i. -124 Solve 708n - 14478 = 22338 for n. 52 Solve 568a + 7880 = -226a + 6a for a. -10 Solve 74812 = -523y - 350y + 468y + 1673y for y. 59 Solve -41r - 2322 - 9882 = -493r for r. 27 Solve 137a + 965 = -5337 for a. -46 Solve -463r = -8811 - 18520 - 14802 for r. 91 Solve 91g + 101g - 3280 = 28g for g. 20 Solve -35t + 2128223 - 2138063 = 129t for t. -60 Solve 372d - 11654 - 3598 = 0 for d. 41 Solve -187b + 50b + 20b - 150b + 4806 = 0 for b. 18 Solve 670t + 1809 + 2992 + 9939 = 0 for t. -22 Solve 176v = -48v + 122v + 510 for v. 5 Solve 63728d = 63042d - 87808 for d. -128 Solve -491o - 24o - 6471 = -16383 - 39013 for o. 95 Solve -1247v - 83v = -5320 for v. 4 Solve -3120p - 3067p + 1188 = -6055p for p. 9 Solve 0 = 532m + 302m + 27522 for m. -33 Solve 499n + 71n - 11740 = -46510 for n. -61 Solve 1228079k - 1228062k = -561 for k. -33 Solve -126g + 529 - 6997 = 33g - 27g for g. -49 Solve 4093r - 3521 + 7298 - 12633 = 36167 for r. 11 Solve 53901 - 202091 = -2030q for q. 73 Solve 77 = 324x - 275x - 2128 for x. 45 Solve -376885 = -14293k - 1243928 - 648015 for k. -106 Solve -1918 = -770u + 585u + 1227 for u. 17 Solve 3124 = -212l + 740 + 488 - 3616 for l. -26 Solve 151292 = -1313d + 2701d for d. 109 Solve 1980n - 291n = -409n - 8392 for n. -4 Solve 0 = 252k + 171k + 669k + 32760 for k. -30 Solve -640 - 1234 = 253m - 103 for m. -7 Solve -14u + 8u = -101 - 241 for u. 57 Solve -26f + 234 = 75f - 342 - 131 for f. 7 Solve 242m + 2961776 = 2942174 for m. -81 Solve 37z + 27z - 204 = 13z for z. 4 Solve -124z - 12426 + 5013 = 50z + 10161 for z. -101 Solve 348v = 37v - 11v - 2740 - 1768 for v. -14 Solve 270 = -265h + 211h for h. -5 Solve 0 = -856y - 36990 + 182 for y. -43 Solve 598d + 9d - 6556 = -107d + 118d for d. 11 Solve -4686 + 889 = 282q + 2689 for q. -23 Solve -16q = 528q + 88q - 111q + 2605 for q. -5 Solve 954 = 188u - 3558 for u. 24 Solve 626o = -638o - 53088 for o. -42 Solve 368m + 240138 = -917m - 3162m for m. -54 Solve -37 - 10 - 18 = -106d + 41 for d. 1 Solve -1361q - 39324 = -4088q - 4846 + 20062 for q. 20 Solve 117i + 322 - 634 = 171i + 2280 for i. -48 Solve 52k + 299k = 17k - 116k + 16650 for k. 37 Solve -253 + 929 = 58p - 661 + 61 for p. 22 Solve 8633m - 5583 - 4347 - 707 = -2004 for m. 1 Solve 0 = 299555d - 301904d - 91611 for d. -39 Solve 71109 - 279582 = -6764r + 102671 for r. 46 Solve 14514b + 348657 = 10765b for b. -93 Solve 3031y = -2135y + 408114 for y. 79 Solve -71s = -73208 + 75125 for s. -27 Solve 3913p - 131039 = -308585 - 245058 for p. -108 Solve 84247 = -3857c + 109c - 24445 for c. -29 Solve -2984w = 756w + 2124 + 5356 for w. -2 Solve 707r + 144 - 140 - 380 = 331 for r. 1 Solve 25781 = -403y + 6437 for y. -48 Solve -5099 - 8629 = -1383p + 556p + 651p for p. 78 Solve -138x + 467 + 2829 = -495 + 341 for x. 25 Solve 20f + 5656f = -613008 for f. -108 Solve -12124 = -759u + 326u for u. 28 Solve -520r + 2455 = -1615 - 4446 + 196 for r. 16 Solve -1145l - 57008 = -343l - 4274l + 54096 for l. 32 Solve 2492 = 176o - 3140 for o. 32 Solve 1906z + 3794z - 1862z = -12298 + 108248 for z. 25 Solve -1428g = -213g + 140940 for g. -116 Solve -3221 = 182a - 3533 - 9880 for a. 56 Solve -172673 = -2188j - 28265 for j. 66 Solve 0 = -110k + 33k - 53k - 4718 - 8672 for k. -103 Solve -466w = 10114w + 184419 - 314384 - 388455 for w. 49 Solve 7c - 24c + 1708 = -0c + 11c for c. 61 Solve 2060f + 64834 = -15506 for f. -39 Solve 282 = -244393l + 244487l for l. 3 Solve 330 - 49 = -11r + 17 for r. -24 Solve -38739 = 188n - 26143 for n. -67 Solve f - 1939 = -f - 4f - 1597 for f. 57 Solve -69p - 55p - 46p = 51p - 259p for p. 0 Solve -218p - 8670 - 20295 = 46p - 5733 for p. -88 Solve -80d + 10348 - 13388 = 0 for d. -38 Solve 50j + 4108 - 98 = 810 for j. -64 Solve -133r - 1653 - 3137 = 796 for r. -42 Solve -66902m = -66825m - 1649 - 45 for m. 22 Solve -35o - 42923 + 41383 = 0 for o. -44 Solve -1632y + 128 = -1634y for y. -64 Solve 65g + 25 + 18 = 66g for g. 43 Solve 106 = -76u - 228 + 1270 + 1268 for u. 29 Solve -6u + 1883747 = 1883057 for u. 115 Solve 653k - 1578 + 21168 = 0 for k. -30 Solve -138689 = -5126p + 168259 + 139014 for p. 87 Solve 102j - 41j + 51j = -45j + 9734 for j. 62 Solve -783o = 845o - 32579 + 81419 for o. -30 Solve -106z + 576021 = 570509 for z. 52 Solve 40i + 17178 = 449i for i. 42 Solve 98w + 426 + 24 = -908 - 112 for w. -15 Solve 0 = -1867k + 1418k + 20654 for k. 46 Solve 22j + 180j = -354j - 188j - 20j for j. 0 Solve 42151 = 2146r - 26521 for r. 32 Solve 13400 = -2051w + 2587w for w. 25 Solve 58 + 66 = -76a - 28 for a. -2 Solve 2450m = 3639m + 40426 for m. -34 Solve 2016u + 1374u = 232u + 104214 for u. 33 Solve 304w - 428w - 1376 = -156w for w. 43 Solve -27x - 12x - 40x - 4662 = -116x for x. 126 Solve 222g - 653g - 2384g = -380025 for g. 135 Solve -12189 + 24501 - 11966 = -346s for s. -1 Solve -4498t = -4309t - 14019 + 1734 for t. 65 Solve 4619 = -16u + 383u - 4015 + 1294 for u. 20 Solve -2497l - 77572 = -1551l for l. -82 Solve -1166k - 1160148 + 1162480 = 0 for k. 2 Solve 0 = -1401f - 3297f - 1894f - 744896 for f. -113 Solve 6256y - 93y - 23032 = -2664y + 515415 for y. 61 Solve -75r - 18r + 1103 = -385 for r. 16 Solve -49q + 64q + 54q - 5520 = 0 for q. 80 Solve -184 = 50j - 47 + 113 for j. -5 Solve -452164q + 730 + 172 = -452175q for q. -82 Solve 2256i = 6638i - 105168 for i. 24 Solve 434u - 64035 + 35825 = 0 for u. 65 Solve 58604 = -1365p + 169p for p. -49 Solve 10s + 52s - 1284 + 2507 = -4171 for s. -87 Solve 602o - 272o + 3000 = -303o - 41943 for o. -71 Solve 55c + 24417 = 743c + 94c - 13119 for c. 48 Solve 956j - 152j - 8488 = 14624 - 4620 for j. 23 Solve 23780 = 3771q - 3191q for q. 41 Solve 190b + 17b - 4480 = 79b for b. 35 Solve -46g = 28g - 6g - 13g + 2695 for g. -49 Solve -202x - 12348 = -422x + 367x for x. -84 Solve 1006z + 47909 = 90642 + 78993 for z. 121 Solve -7308n = 253545 + 175081 + 243710 for n. -92 Solve 1973u - 1793u = -2700 for u. -15 Solve -144742i - 5146 = -144899i + 14636 for i. 126 Solve -835n - 483n + 19441 + 42057 - 10096 = 0 for n. 39 Solve -40p + 192p = -110p + 2882 for p. 11 Solve -1475 - 928 = 134d + 85d + 1101 for d. -16 Solve 0 = 267g + 142g - 151g + 3107 - 19619 for g. 64 Solve -118b + 14417 = 7455 for b. 59 Solve -143184 + 17001 = -5166w - 12531 for w. 22 Solve -506w + 1081 = -553w for w. -23 Solve 0 = 588d + 113230 - 106174 for d. -12 Solve 870f + 24057 = -1173 for f. -29 Solve 869b = 1209 + 5160 + 12749 for b. 22 Solve -102i + 9061 + 629 = -306 for i. 98 Solve 1324i - 22134 + 5035 = 11530 + 15063 for i. 33 Solve -4011q = 1115q - 204043 - 88139 for q. 57 Solve 161s + 8799 + 5854 = -78s - 165 for s. -62 Solve -2271o = -5541o - 19620 for o. -6 Solve -255x + 10 + 158 + 53 = -289 for x. 2 Solve -1788c + 786c + 6288 - 168 = -24942 for c. 31 Solve -29x - 324x - 282x = -69850 for x. 110 Solve -75b + 27668 = 22343 for b. 71 Solve 76m - 674m - 50m = 418m + 13858 for m. -13 Solve 607a - 177a - 86400 = -4370a for a. 18 Solve 1030g + 207247 = 165017 for g. -41 Solve -193b - 5193 = 3072 + 1578 for b. -51 Solve 0 = -24738m + 24773m + 2065 for m. -59 Solve 12607z = 2967 + 97889 for z. 8 Solve 1457x + 2616x = 694x - 335x + 263694 for x. 71 Solve 261728 = 11760	{ "pile_set_name": "DM Mathematics" }
m) = -19m - 85. Let z(l) = 10l + 51. Let t(u) = 3j(u) + 5z(u). Let h(b) be the first derivative of b*2 + 3. Determine t(h(x)). -14x Let j(q) = 39217q + 39263q + q*2 - 78480q. Let k(d) be the third derivative of d4/3 + d2. Determine k(j(x)). 8x2 Let p(f) = -9f - 230 + 230 + 7f. Let l(t) = -635t. Determine l(p(i)). 1270i Let y(m) be the second derivative of -m5/120 - m3/6 + 26m*2 + 2m + 37. Let n(u) be the second derivative of y(u). Let b(j) = j2 + 36. Give b(n(r)). r2 + 36 Let m(v) = 18v2 + 4. Let l(b) be the third derivative of 0b*3 + 0 - 2b - 1/60b5 + 0b*4 + 70b*2. Calculate l(m(g)). -324g*4 - 144g2 - 16 Let f(l) = -l2 - 34l. Let c be (-5)/(30/(-24)) + 12. Let z(h) = 16h*2 + 18h*2 - 52h*2 + ch*2. What is f(z(j))? -4j*4 + 68j*2 Let u(a) = a. Suppose -3b - 67 + 286 = 0. Let h(o) = -16o + 78o + bo - 32o. What is h(u(x))? 103x Let o(n) be the first derivative of 2n*2 - 9n + 9586. Let m(t) = -5t. Calculate o(m(x)). -20x - 9 Let t be (-150)/1008/(-6). Let f(v) = -51v*2 + 25v*t + 25v*2. Let i(s) = s. Let n(p) = 2p. Let h(m) = -5i(m) + 3n(m). Calculate h(f(q)). -q*2 Let p(b) = 13b. Let m(r) = 46r - 34. Let i(q) = -72q + 54. Let t(n) = -5i(n) - 8m(n). Determine p(t(v)). -104v + 26 Let q(c) = -3c - 56. Let r(k) = -k*2 + 1. Let h(i) = 3i*2 - 6. Let p(l) = -h(l) - 6r(l). What is q(p(b))? -9b2 - 56 Let r(o) = -7409 + 3o - 2o + 7094 + 0o. Let u(x) = 6x2. Determine r(u(h)). 6h*2 - 315 Let d(v) = -3v2. Let z(p) = -p2 - 12. Let l(u) = 6u2 + 74. Let m(b) = 2l(b) + 11z(b). Determine d(m(r)). -3r*4 - 96r*2 - 768 Let z(f) be the third derivative of 7f*4/24 + 8f3 - f2 + 110f. Let y(d) = 86d*2 - 33d*2 - 55d*2. Determine y(z(m)). -98m*2 - 1344m - 4608 Let f(u) = -29u - 10. Let k(x) = 44x + 16. Let s(l) = 8f(l) + 5k(l). Let z(p) = -3p - 2. Calculate s(z(g)). 36g + 24 Let o(n) = 23546n. Let b(h) = 55h. Let z(c) = -854b(c) + 2o(c). Let j(f) = -f*2. Give j(z(i)). -14884i2 Let q(y) = y2 + 12y. Let c(x) be the first derivative of 5/3x*3 + 71 + 0x + 0x2. Calculate q(c(t)). 25t*4 + 60t*2 Let t(r) = -119r. Let u = -16 - -16. Let v(j) = -2j - 3j + 8j - 2j + uj. Calculate t(v(y)). -119y Let w(j) = 150j. Let m(x) = -3934016x. Calculate m(w(g)). -590102400g Let j(b) = 166b - 38. Let v(w) = -81w. Calculate j(v(o)). -13446o - 38 Let n(v) = 109v + 183v - 293v. Let s(r) = 944r. Calculate s(n(z)). -944z Let p(j) = 6j*2. Let t(y) be the second derivative of 29y*4/4 - y - 323. Give t(p(s)). 3132s*4 Let t(l) = 9l + 7. Let s(w) = -4w - 3. Let j(k) = -7s(k) - 3t(k). Let z(a) be the first derivative of 29a*3 - 411. What is z(j(b))? 87b2 Let h(s) be the second derivative of -s3/3 - 2s. Let n(b) = -107b - 15. Let f(v) = -3206v - 455. Let r(i) = -3f(i) + 91n(i). What is h(r(o))? 238o Let k = 1786 - 880. Let a(z) = k - 906 + 3z2. Let t(s) = 5s + 3s - 10s. What is t(a(g))? -6g2 Let y(s) = 2s*2 + 13s + 16. Let m be y(-12). Let j = 150 + -144. Let x(d) = -9d - 150 + m - 7d - jd. Let p(f) = -f2. Calculate p(x(k)). -484k*2 - 88k - 4 Let y(c) = 513c + 512c - 1041c. Let f(a) = 2a - 152. Give y(f(q)). -32q + 2432 Let d(h) = -5h. Let l(y) = -55y + 305668. Determine d(l(m)). 275m - 1528340 Let i(n) be the first derivative of -13 + 0n2 + 2/3n*3 + 0n. Let p(z) = -12z - 21. Let v(w) = w + 1. Let g(x) = -2p(x) - 42v(x). Determine i(g(o)). 648o*2 Let y(f) = 198f*2. Let k(q) = -33852q*2. Give y(k(p)). 226899664992p*4 Let v(g) be the first derivative of 12g*2 + 15g*2 - 37g*2 - 76 + 18g*2. Let t(n) = n. What is v(t(k))? 16k Let k(n) = 11n. Let f(o) be the third derivative of -27o*2 + 0 + 1/15o*5 + 0o + 0o3 + 0o*4. Give f(k(t)). 484t*2 Let w(a) = -106a - 4 + 5 - 2. Let o(i) be the second derivative of i*4/6 - 57i. Calculate o(w(b)). 22472b2 + 424b + 2 Let o(z) = -6 + 6 + 820z2 - 424z*2 - 417z2. Let x(k) = k2. Give x(o(w)). 441w4 Let u(s) = -9s*2. Let z(l) = 23l*2 + 17l + 171. Let o(g) = -16g2 - 12g - 122. Let n(q) = 17o(q) + 12z(q). Give u(n(d)). -144d4 + 1584d*2 - 4356 Let r(t) = 20t + 3. Suppose 3g - 3 = -3l, -3g + l + 9 = g. Let c(j) = -28416j - gj2 + 28416j. Give r(c(d)). -40d2 + 3 Let i(v) = -v2 - 4. Let a(o) = -o2 - 12. Let r(k) = a(k) - 3i(k). Let y(x) = -4723x. Give y(r(z)). -9446z*2 Let g(x) = 5x. Let s(d) = -1850d - 13. Let f(y) = 309y + 2. Let o(c) = 13f(c) + 2s(c). Calculate o(g(p)). 1585p Let u(a) be the second derivative of -a4/6 - 2a. Let q = 43 - 40. Let x(y) = 94y2 + q - 91y*2 - 3. Determine x(u(c)). 12c*4 Let i(f) = -179f - 5. Let r(l) = 36l + 1. Let v(c) = i(c) + 5r(c). Let x(u) be the second derivative of 185u3/6 + u2 + 3u. Determine v(x(m)). 185m + 2 Let l(q) = -53q*2 + 6q - 1. Let y(v) be the second derivative of -v*3/2 + 3908v + 1. What is l(y(o))? -477o2 - 18o - 1 Let u(m) = -11m2. Let p be ((-14)/(-2))/(150/34500). Let r(a) = -10a - p + 1610 - a*2. Determine r(u(z)). -121z*4 + 110z*2 Let g(i) = -8i2 - i2 + 2i2. Let l(q) be the second derivative of 0q*3 - 70q + 0 + 1/12q4 + 0q*2. Determine g(l(b)). -7b*4 Let y(s) = 5s. Let d(h) be the third derivative of -33h2 + 0 - 2h + 1/6h3 - 1/24h*4. Determine y(d(l)). -5l + 5 Let k(m) = -m + 740134. Let d(s) = -9s. Calculate d(k(f)). 9f - 6661206 Let z(r) = -631869r. Let o(l) = 16l. Determine o(z(i)). -10109904i Let r(b) = -b - 7774. Let p(v) = -1959v*2. Determine r(p(y)). 1959y*2 - 7774 Let y(f) = 31f*2. Let t(x) be the first derivative of -30x*2 + 2x - 3887. What is y(t(u))? 111600u2 - 7440u + 124 Let y(j) = 3j + 1. Let z(f) = 10f*2 + 18f + 4979. Give z(y(q)). 90q2 + 114q + 5007 Let g(f) = -f. Let o(m) be the first derivative of -397m2/2 + 571. What is o(g(b))? 397b Let i(d) = -101d - 29d + 229d - 96d. Let u(a) = -205a2 + 3a. Give i(u(r)). -615r2 + 9r Let b(h) = -6h2. Let x(a) = -3733 + 3733 - 522a. Determine b(x(d)). -1634904d2 Let z(r) = -2r. Let n be (-1 - -1) + 0 + (31 - 23). Let m(a) = 12a2 + a - 5a - 19a2 + na. Determine m(z(j)). -28j2 - 8j Let f(n) = -601n. Let o(z) = -5z*2 + 2098. Give o(f(k)). -1806005k*2 + 2098 Suppose 0 = -79j + 78j + 165. Let a(f) = 133f - jf + 75f. Let l(w) = -4w. Calculate a(l(o)). -172o Let q(l) = 13l. Let x(k) be the third derivative of 7k*5/60 - 401k*2. Calculate q(x(t)). 91t*2 Let f(l) = -6l*2. Let r(s) = 108 - 284 + 184 + 23s*2. Calculate f(r(z)). -3174z*4 - 2208z*2 - 384 Let u(f) = -1007f. Let k(d) = -7d2 - 13d*2 + 21d*2 + 58d - 58d. Determine u(k(x)). -1007x*2 Let m(x) = x + 19. Let g(w) = 1. Let c(l) = -2g(l) + m(l). Let j(t) be the first derivative of t*2/2 + 2702. Give j(c(s)). s + 17 Let s(m) = 33019778m. Let o(u) = -10u. What is o(s(t))? -330197780t Let c(o) = 7o + 4o - 21o + 8o + 8o. Let k(i) = 24i*2 - 4i - 4. Let l(t) = -24t2 + 5t + 5. Let s(u) = 5k(u) + 4l(u). Calculate s(c(y)). 864y2 Let f(m) = m2. Let v(p) be the second derivative of -595p*3/3 - 898p. Determine v(f(o)). -1190o2 Let v(o) = 6o*2. Suppose 0b + 5b = -t + 30, 5b = -2t + 35. Let s(u) = -u2 + u. Let j(f) = 15f*2 + 5f. Let x(m) = ts(m) - j(m). What is x(v(p))? -720p*4 Let z(w) = -3w. Let i(r) = 59931r2 + 6r. Give z(i(u)). -179793u2 - 18u Suppose 4t = -13 - 7. Let z(g) = -4g - 18. Let h be z(t). Let f(a) = 3a - 6a - ha + a. Let x(y) = -3y. Calculate f(x(q)). 12q Let d(c) be the first derivative of -c3/3 - 15. Let y(s) be the first derivative of -2s*2 + 420. Determine y(d(v)). 4v*2 Let x(r) = 5r*2 + 27r + 5. Let f(w) be the first derivative of -w*3/3 + 2638. Determine x(f(n)). 5n*4 - 27n*2 + 5 Let z(s) = -2s - 2s + 17s. Let o(k) be the second derivative of k*4/8 - 481k*2/2 - 87k - 2. Let x(i) be the first derivative of o(i). Calculate x(z(p)). 39p Let h(y) be the first derivative of y2 + 6. Suppose 6r - 89 + 17 = 0. Let g(o) = -12o - ro - 5o + 31o. Give g(h(p)). 4p Let y(t) = t2. Let l(o) = -4931632o. What is l(y(c))? -4931632c2 Let g(i) = -7722i +	{ "pile_set_name": "DM Mathematics" }
(r) = -r*3 - 10r*2 - 13r - 6. Let a be 3/6(-2 - 16). Is j(a) a multiple of 6? True Suppose 0 = 3m - 5 - 10. Let j(y) = y*3 - 6y*2 + 5y + 4. Does 4 divide j(m)? True Suppose v = -1 + 4. Let h be (-8 - 0)10/(-4). Is 10 a factor of v/((-6)/h)-1? True Suppose -4u - 40 = -4m, 0 = 3m - u + 3u - 10. Suppose 2p + 12 = mp. Is p a multiple of 3? True Let q(k) = k3 - k2 + k + 9. Let d be ((4 + -4)/1)/3. Is 9 a factor of q(d)? True Let i = -1 - -11. Is 10 a factor of i? True Suppose -3l - l + q = -55, 5q - 47 = -3l. Let c(d) = -d3 + d2 - d + 228. Let r be c(0). Does 16 divide r/l - 6/21? True Let d be (2 + 16/(-6))-3. Suppose -31 = -da + k + 34, 115 = 4a - 5k. Suppose -a + 105 = 2f. Is 20 a factor of f? False Let x(s) = -s*2 + 9s - 1. Let l be x(10). Let t(f) = f*2 + 7f - 12. Does 9 divide t(l)? False Let f(x) = 6x3 + 2x*2 - 7x + 1. Let o(j) = 5j3 + 2j*2 - 8j + 1. Let w(d) = 6f(d) - 5o(d). Let i be w(1). Let r = 22 - i. Is 5 a factor of r? True Let w be -2 - (-3 + 4 - 77). Let t be (-1)/3 - w/(-6). Let o = 32 - t. Is 10 a factor of o? True Suppose 6o - 73 = 5. Does 13 divide o? True Suppose -m = 2m. Suppose 4r - 41 = -r - 3x, -r - 3x + 13 = m. Is 3 a factor of r? False Let a = -65 + 110. Does 6 divide a? False Is 6 a factor of (-1)/(2/(-6))(13 - 1)? True Let b = 16 - -29. Let z = 139 - b. Is 17 a factor of z? False Let u(c) = -c*3 + 4c*2 + c - 1. Let g be u(4). Suppose -g = -v + 13. Is 8 a factor of v? True Suppose -8y + 225 = -3y. Does 15 divide y? True Let m be 6/33 + 62/22. Suppose mz - 5z + 20 = 0. Does 4 divide z? False Suppose -32 + 5 = -5h + 4m, -2h - 9 = 5m. Let j(s) = 8s*2 - 4s - 1. Is j(h) a multiple of 12? False Suppose 4d - 105 = 55. Is 22 a factor of d? False Let w = 44 + -27. Does 6 divide w? False Let l = 21 - -49. Is 14 a factor of l? True Suppose -4w = -2n - 3n - 127, -4n + 70 = 2w. Suppose -t - 155 = -3d, -d + t + 4t = -w. Is 15 a factor of d? False Let k = 6 - 4. Suppose a = -a + k. Suppose -h + a + 2 = 0. Is h a multiple of 2? False Let b(d) = d*3 - 10d*2 - 15d - 2. Let j be b(11). Let a = -16 - j. Is a a multiple of 20? False Suppose -4 = -4v, -5g + v + 115 = -g. Is 29 a factor of g? True Let z be 0 - 1 - (-24)/6. Suppose 18 - 243 = -zx. Is x a multiple of 35? False Let v(f) = 2f*3 - 4f*2 - 2f + 4. Suppose -g - 3 = -2g. Is v(g) a multiple of 5? False Let q = -11 - -4. Suppose n - 3f = -247, -n - 74 = 5f + 213. Does 18 divide n/(-14) + (-2)/q? False Let x = 7 - 7. Suppose xm - 3m + v = -59, -5v + 29 = 3m. Does 5 divide m? False Let x be ((-8)/3)/((-2)/3). Suppose k = -k + x. Is (10 + -1)(k - 1) a multiple of 6? False Let v(m) be the first derivative of m*4/4 - 14m3/3 + m2/2 + 6. Is v(14) a multiple of 4? False Let g(n) = -13n + 21. Does 11 divide g(-6)? True Let r = -4 + 4. Suppose g + 3q - 49 = r, 3q + 128 + 117 = 5g. Is 21 a factor of g? False Let d = -2 - 0. Let q = 13 + d. Is q a multiple of 11? True Let r(m) = m*2 + 5m + 5. Is r(5) a multiple of 12? False Let g be (-4 - -3)/(3/(-72)). Suppose 0 = -3n - 6s + 3s + g, -3s = -12. Suppose -n = -b + 4. Does 5 divide b? False Let y(k) = 16k2 + 3k + 1. Let i be y(-4). Suppose -10a + 5a = -i. Is a a multiple of 13? False Let m be (64/(-20))/(1/5). Let d = m + 28. Does 12 divide d? True Is 2 + 98/(2 - 0) + -1 a multiple of 5? True Suppose -j + s = j - 126, 5j = -s + 322. Does 8 divide j? True Suppose 0 = -5v - 77 + 32. Does 3 divide 03/v + 7? False Let x(d) = 2d*2 - 2d - 4. Let k be x(-3). Let h be 242/10 + (-4)/k. Let i = h + 17. Is 15 a factor of i? False Suppose 12 = l - 3l - h, -30 = 5l - 5h. Let t(j) = -j - 2. Let q be t(l). Suppose -4p = -m - p + 50, qm = -5p + 115. Is 13 a factor of m? False Let c(y) = y*2 - 3y. Let k be c(3). Suppose k = 6n - 3n - 81. Is n a multiple of 14? False Let v be 584/(-4) + 1 + 1. Let u be (3/(-6))/(2/v). Let f = u - 16. Is f a multiple of 20? True Let w(l) = -l*2 + 7l + 2. Is w(5) a multiple of 12? True Suppose 20 = w + 4w. Suppose -wp - p + 99 = q, -p + q = -21. Is 14 a factor of p? False Let t = 464 + -308. Suppose -4z - 48 = -t. Is z a multiple of 19? False Let p(r) = -3 - 2r + 4 + r*2 + 2 + 3. Is p(5) a multiple of 6? False Suppose 0 = 2g + 5d - 60, 4g - 14 = 5d + 46. Let z = g + 0. Is 12 a factor of z? False Suppose 3w = 4y - 3y - 77, 2y - w - 164 = 0. Is y a multiple of 16? False Let a = 210 - 109. Is 20 a factor of a? False Let s be 23/3 + 2/(-3). Let k(i) = -4i + 10. Let p be k(s). Let w = -11 - p. Does 4 divide w? False Let v(g) = -g*3 + 8g*2 - 10g + 9. Let a be 24/32 + 42/8. Does 16 divide v(a)? False Let j(d) = d*3 + 10d - 10d2 + 2d - 1 - d*2 + 3. Does 12 divide j(10)? False Is 19 a factor of (-1)/1-93 + 2? True Suppose -w + 0 = -2p + 3, 0 = -2p + 8. Let s = -5 + w. Does 5 divide -2(s - 5 - -1)? False Suppose -4x = -8, 3r + 5x = 120 - 47. Is r a multiple of 7? True Let a = 10 + -5. Suppose r = at - 3r - 107, 3t + 2r = 51. Is 19 a factor of t? True Suppose 63 = -y + 4y. Is y a multiple of 11? False Let u = -34 - -67. Is 14 a factor of u? False Let m = 18 + -30. Does 22 divide (m/14)/(3/(-168))? False Let u(f) = -f3 + 8f*2 + 9f + 4. Let g be u(9). Let l(y) = 11y - 4. Does 20 divide l(g)? True Does 18 divide -6 + 0 + 5 + (0 - -365)? False Suppose 2m = -0m - 5b + 1, -2m = 2b - 4. Suppose 2l - 25 = m. Is 6 a factor of l? False Let o(t) be the first derivative of 2t*3/3 + 5t*2 - 10t - 9. Let f = 4 + -12. Is 13 a factor of o(f)? False Suppose f + 22 = 24. Suppose 4v = 20, -ft - 4v + 85 = -v. Does 15 divide t? False Let q = -3 + 6. Suppose qz - 12 = 4z - 4p, -2p - 8 = 3z. Does 9 divide 11 - 3/6z? False Is 20/(4/6(-17)/(-51)) a multiple of 6? True Let l = 361 + -165. Is l a multiple of 52? False Suppose -a + 120 = 2a. Does 19 divide a? False Suppose o + 264 = 9o. Is o a multiple of 11? True Let w = -119 - -171. Is 26 a factor of w? True Let b(c) = c*3 - 9c*2 + 7. Let o be b(9). Let s(f) = 2f - 8. Is s(o) even? True Let j = -202 + 343. Is 12 a factor of j? False Suppose -34r - 600 = -37r. Is r a multiple of 25? True Let w(s) = 14s2. Suppose -l + 22 = -5i - 4, -10 = 2i. Is 14 a factor of w(l)? True Let m = 6 + -4. Let b(w) = -w3 + 4w*2 - 2w - 2. Let s be b(-3). Suppose 0 = -x - 2x - c + s, 0 = mx + c - 43. Is 10 a factor of x? False Let u = -3 + 4. Let d(h) = -3h + 3 - u - 5. Does 7 divide d(-5)? False Let z be -1(-5 - -2)1. Suppose -5l + 3j = -l - 222, -l - zj = -63. Is 18 a factor of l? False Let v be 8(-1 + (-3)/(-2)). Suppose 4u + 6 = -2l + vl, 4u = l + 3. Is 7 a factor of l? False Let t = -12 - -71. Is 7 a factor of t? False Let t = -38 + 14. Is (t/20)/(6/(-40)) a multiple of 4? True Suppose -2g + 8p - 8 = 4p, 0 = -3g - 5p + 10. Is 1 + g/3 - -59 a multiple of 20? True Suppose 2k + 2r - 6 = 0, 0k - 5r + 15 = -k. Let l be 52 + 2/(k - -2). Let b = 75 - l. Does 10 divide b? False Let k(d) = 39d2 + d + 1. Is 5 a factor of k(-1)? False Suppose -41 = -3h - 2. Is h a multiple of 5? False Let a(l) = -l - 2. Let m be a(-9). Suppose 2 - m = 5b. Is 7 a factor of -2 + -1 + b + 12? False Suppose 8 = -6q + 7q. Is q a multiple of 4? True Let a(k) = k2 + 11k - 7. Let u be a(-12). Suppose -n + u = -12. Suppose -21 = -o - 4b, o - 3b - n = -6b. Is o a multiple of 3? False Let f(w) = -6 - 3w + 2w - 2w. Let o = -11 - -7. Does 3 divide f(o)? True Let u = -2 + 2. Suppose un = -5i + 3n - 27, 5i + n = -11. Let a = i - -8. Does 2 divide a? False Let q = 239 - 100. Let x = 1 + 1. Suppose -5v - xg + 131 = 0, 5v + 0g = 2g + q. Is v a multiple of 11? False Suppose 0 = -0b + 2b - 98. Is 10 a factor of b? False Suppose 0 = 8c - c. Let b = 46 + c. Does 8 divide b? False Suppose -9r + 15r = 540. Does 10 divide r? True Suppose -184 + 898 = 3w. Does 5 divide w/12 - (-1)/6? True Suppose -3j - 16 = -7j. Let f = -3 + j. Let z(g) = 10g*3 + 2g*2 - 2g + 1. Does 11 divide z(f)? True Let c = 44 - 84. Let x = 73 + c. Is 16 a factor of x? False Let h = -9 + 11. Suppose -hu = -4u + 88. Is 11 a factor of u? True Let r(l) = 2l3 - l2 - 5l + 8. Is r(4) a multiple of 11? False Let o(x) = x*2 + 12x + 9. Let z(c)	{ "pile_set_name": "DM Mathematics" }
3952? 832934 What comes next: 16059, 16130, 16201? 16272 What is next in -893, -850, -805, -758, -709, -658? -605 What comes next: 3, 56, 119, 192, 275? 368 What comes next: 892, 1804, 2726, 3664, 4624, 5612, 6634, 7696? 8804 What comes next: 3351, 6687, 10019, 13341, 16647, 19931, 23187, 26409? 29591 What is next in -283, -538, -813, -1114, -1447? -1818 What is next in 225, 907, 2045, 3639, 5689, 8195? 11157 What is the next term in 56, 78, 148, 290, 528, 886, 1388, 2058? 2920 What is next in 27776, 27609, 27442, 27275, 27108, 26941? 26774 What is the next term in 261, 244, 199, 114, -23? -224 What is next in -301714, -603417, -905120, -1206823, -1508526, -1810229? -2111932 What comes next: -552, -1015, -1478, -1941, -2404? -2867 What comes next: -876772, -876779, -876786, -876793, -876800, -876807? -876814 What is next in -50, -72, -106, -152, -210, -280? -362 What is the next term in 827, 340, -147, -634, -1121? -1608 What comes next: 27426, 27428, 27430, 27432, 27434? 27436 What is the next term in -1073, -1066, -1051, -1022, -973, -898? -791 What is the next term in 123, 282, 437, 588, 735? 878 What is the next term in -137, -1042, -3377, -7856, -15193, -26102, -41297? -61492 What is next in -27947, -55923, -83933, -111983, -140079, -168227? -196433 What is the next term in -42181, -42157, -42119, -42061, -41977, -41861, -41707? -41509 What is the next term in -12, 82, 258, 534, 928, 1458, 2142, 2998? 4044 What is the next term in -129391, -129387, -129381, -129373, -129363? -129351 What comes next: 1893, 1849, 1807, 1767, 1729, 1693? 1659 What is the next term in 222, 109, -50, -279, -602, -1043? -1626 What comes next: -19850, -39702, -59552, -79400, -99246, -119090? -138932 What is next in -1800, -3642, -5496, -7368, -9264? -11190 What is next in -56, 74, 420, 1090, 2192, 3834, 6124, 9170? 13080 What comes next: 1438, 1526, 1614, 1702, 1790, 1878? 1966 What comes next: 954, 1927, 2920, 3933? 4966 What comes next: -3247, -12891, -28935, -51373, -80199? -115407 What is the next term in -3771, -7525, -11279? -15033 What is the next term in -65622, -262483, -590584, -1049925, -1640506, -2362327? -3215388 What comes next: -18, 2, 32, 72, 122, 182, 252? 332 What is next in -883489, -883489, -883491, -883495, -883501, -883509? -883519 What comes next: 499, 2042, 4613, 8212, 12839, 18494? 25177 What comes next: 43, 118, 235, 388, 571, 778? 1003 What comes next: -3061, -12309, -27731, -49333, -77121? -111101 What is the next term in 3755, 7501, 11249, 14999, 18751, 22505? 26261 What comes next: 73, 256, 561, 988, 1537? 2208 What is next in 12249, 24471, 36689, 48903? 61113 What is the next term in -36, -31, 48, 243, 596, 1149? 1944 What comes next: 268, 428, 584, 736, 884, 1028? 1168 What is next in 26287, 52592, 78897? 105202 What is the next term in -104602, -104603, -104604, -104605? -104606 What comes next: -361, -449, -601, -823, -1121? -1501 What comes next: -167, -329, -489, -647? -803 What is next in -39, 182, 545, 1038, 1649? 2366 What is the next term in 9784, 9778, 9772? 9766 What is the next term in -3, 12, 9, -6, -27, -48? -63 What is the next term in -224, -739, -1604, -2825, -4408, -6359, -8684, -11389? -14480 What is next in 2043, 1907, 1533, 801, -409? -2217 What is the next term in 284, 406, 366, 164, -200, -726? -1414 What is the next term in 153, 256, 357, 456, 553, 648, 741? 832 What is the next term in -379, -195, -25, 131, 273? 401 What is next in -263, -1251, -2897, -5201, -8163? -11783 What is the next term in -14644, -29280, -43916, -58552, -73188, -87824? -102460 What is the next term in 3955, 3961, 3971, 3985, 4003? 4025 What is the next term in 739, 2943, 6605, 11719, 18279? 26279 What comes next: 79, 337, 961, 2131, 4027? 6829 What comes next: -42904, -85805, -128710, -171619? -214532 What comes next: -81823, -81817, -81809, -81799, -81787, -81773? -81757 What is next in 6006, 24033, 54080, 96147? 150234 What is the next term in -494, -2014, -4574, -8198, -12910, -18734, -25694, -33814? -43118 What comes next: -5127, -10211, -15295, -20379? -25463 What is next in -1014, -2062, -3110? -4158 What is next in -7185, -14368, -21553, -28740? -35929 What is next in -10, 69, 208, 407, 666? 985 What is next in 859, 861, 857, 847, 831, 809? 781 What is next in -287772, -287769, -287766, -287763, -287760, -287757? -287754 What is the next term in -2482, -2488, -2506, -2542, -2602? -2692 What comes next: 319, 2280, 7591, 17926, 34959, 60364, 95815, 142986? 203551 What is the next term in -110, -207, -296, -377, -450, -515, -572? -621 What comes next: -530, -2073, -4640, -8237, -12870, -18545, -25268, -33045? -41882 What comes next: 21, -1553, -5829, -14157, -27887, -48369, -76953? -114989 What comes next: 350, 466, 582, 698, 814, 930? 1046 What comes next: -61, 261, 805, 1577, 2583, 3829, 5321, 7065? 9067 What is the next term in -225, -94, 101, 360, 683? 1070 What comes next: -69, -609, -1607, -3063? -4977 What is the next term in 39764, 39766, 39768, 39770, 39772? 39774 What is next in 1579, 1563, 1535, 1495, 1443? 1379 What is the next term in -912, -1757, -2602? -3447 What is next in -196, 324, 1734, 4478, 9000? 15744 What is the next term in -110, -322, -762, -1550, -2806, -4650? -7202 What is the next term in 0, -48, -132, -252, -408, -600, -828? -1092 What is the next term in -947, -3865, -8761, -15635? -24487 What is next in 148477, 148474, 148471, 148468, 148465, 148462? 148459 What comes next: 704, 1393, 2078, 2759? 3436 What is the next term in -23054, -23052, -23056, -23072, -23106, -23164, -23252, -23376? -23542 What is next in -74343, -74340, -74339, -74340, -74343? -74348 What is the next term in 1407, 2835, 4285, 5757, 7251, 8767, 10305? 11865 What is next in -3981, -7997, -12001, -15987, -19949, -23881? -27777 What is next in -648, -412, -176? 60 What is next in -79854, -159712, -239572, -319434? -399298 What comes next: -7655430, -7655432, -7655434, -7655436? -7655438 What comes next: 33, 257, 675, 1383, 2477, 4053, 6207, 9035? 12633 What is next in -2607, -5228, -7863, -10518, -13199, -15912? -18663 What comes next: 51, 118, 201, 306, 439? 606 What is next in 3139, 6222, 9299, 12364, 15411, 18434, 21427? 24384 What is the next term in 13807, 27614, 41421, 55228? 69035 What comes next: 38, 20, -66, -268, -634? -1212 What is next in -853, -2897, -4941, -6985, -9029? -11073 What is next in 829, 3285, 7377, 13105, 20469? 29469 What comes next: -2332, -2625, -2910, -3181, -3432, -3657, -3850, -4005? -4116 What is the next term in 8634, 17266, 25898, 34530, 43162, 51794? 60426 What is the next term in -28886, -57761, -86626, -115475, -144302, -173101? -201866 What comes next: 117678, 117660, 117642? 117624 What is next in 91089, 182208, 273327? 364446 What is the next term in -327, -169, 465, 1575? 3161 What is the next term in 128, 176, 252, 368, 536, 768? 1076 What is the next term in -155, -299, -433, -551, -647? -715 What is next in -148378, -296761, -445146, -593533? -741922 What comes next: 454, 513, 572? 631 What is the next term in 511, 1957, 4365, 7735? 12067 What is the next term in 91, 102, 47, -74, -261, -514? -833 What is next in -64885, -129782, -194679, -259576, -324473, -389370? -454267 What is the next term in -486, -454, -422? -390 What is the next term in 1715, 3442, 5187, 6962, 8779? 10650 What comes next: -2793, -2789, -2785, -2781, -2777, -2773? -2769 What comes next: 185, 750, 1703, 3050, 4797, 6950? 9515 What comes next: 274, 558, 842? 1126 What is the next term in 405, 792, 1177, 1560, 1941, 2320? 2697 What comes next: -27991, -55983, -83975, -111967? -139959 What is next in -7306, -7295, -7274, -7243, -7202, -7151? -7090 What comes next: 653, 1082, 1511? 1940 What comes next: -317, -1763, -4329, -8009, -12797, -18687, -25673? -33749 What comes next: 211638, 211632, 211628, 211626, 211626? 211628 What is next in 586, 2412, 5470, 9760, 15282, 22036? 30022 What is the next term in 9490, 37954, 85394, 151810, 237202, 341570, 464914? 607234 What is the next term in -20487, -20393, -20299, -20205, -20111? -20017 What is the next term in -330, -971, -1956, -3315, -5078, -7275, -9936? -13091 What is the next term in 1452, 2905, 4358, 5811, 7264, 8717? 10170 What is next in 65, 108, 171, 266,	{ "pile_set_name": "DM Mathematics" }
5l2 + l2 + 3l*2)(-3l + l + 3l). l*3 Expand 8b - 7 + 7 + 3 - b - 3 + (2 - 2 + 2)(0b + b + b) - 3b + 5b - 3b. 10b Expand (8z - 11z - 9z + (z + 0z + 0z)(0 - 1 + 0) + 0z + 4z - 3z + (-3 - 2 + 6)(-2z + 4 - 4))(-z - z + 0z). 28z*2 Expand (3g*2 - 3g*2 - 2g*2)(3g - 4g*3 - 3g + g*3 + 0g*2 + 0g*2 + (-4 + 4 - g)(-2g2 + 5g2 - g2) - g3 - g3 + g*3). 12g*5 Expand (-43f*2 - 371f + 371f)(0f2 + 0f2 - f2). 43f4 Expand -2z + 2z + 3z*2 + (2z - 2z - 4z)(z + z - z). -z2 Expand (0t - 4t + 1 - 8t)(3t + 0t - t). -24t*2 + 2t Expand (-4c2 + 0c + 0c)(4c - 6c + 7c). -20c*3 Expand (880d + 96d2 - 880d)(-3 + 1 + 3). 96d*2 Expand (0l + 2l - l + (-l - 3l + 5l)(-1 - 3 + 6) + 2l - l + 0l + 3 - l - 3)(-l4 - 2l*4 + 2l*4). -3l*5 Expand (-3 + 3 - 2)(-5s + 53s - 9s) + 2 - 2 + 2s + 0s - 5s + 4s + (4s - s - s)(-3 - 2 + 3) - 2s - 2s + 2s - 2s + 5 - 5. -85s Expand (0 - 1 - 1)(-5z2 + z2 + 7z2)(2 - 3z + 5z - 7 + z*2). -6z*4 - 12z*3 + 30z*2 Expand (-12o*4 - 1 + 1)(-9 + 2o + 9). -24o*5 Expand (-3c3 - c3 + 5c3)(5c - 5c + 2c + (1 - 4 + 1)(4c - 5c + 2c) + 1 - 1 - c - 2c + 0c - 2c). -5c4 Expand -9 + 0h*4 - 12h4 + 10 - h4 + 0h4 - h4 + (2h*2 + 3 - 3)(-2h2 - 4h*2 + 4h2) + h4 - h4 + h4. -17h4 + 1 Expand (-3u - 2u + 6u)(7 + 2 + 0). 9u Expand (-2v3 + 3v3 + v3)(3v2 + v2 - 5v2) - v4 + v5 + v4 - 20v + 27 + 2v5 - 27. v5 - 20v Expand 0u5 - 2u*5 + 4u*5 + (-3 + 3 - u)(u*4 - 3u*3 + 3u*3) + 5 - 5 - 2u*5 + (-2u*4 + 4u*2 - 4u*2)(-3u - u + 8u). -9u5 Expand (-j - 2j + j)(-2j*2 + 19j*2 + 0j*4 + 2j3 + j4). -2j5 - 4j*4 - 34j*3 Expand 2j - 3j - j + (2 - 3 + 3)(-4j + 0j + 5j) + 0j - 2j + 3j - 1 + 1 - 4j. -3j Expand 0t + 0t - 2t2 + 4t - 4t - 5t2 - t + t - t2 - 1 + 2t2 + 1 + (-4t + 0t + 3t)(1 - 1 - 2t) + 0t2 - t2 + 2t*2. -3t*2 Expand (z + z - 3z)(5 + 0 - 3)(7z - z - 3z)(-1 - 3 - 4). 48z*2 Expand 3r*2 - r + r + (-2r + 5r - 2r)(2r + 4 - 5 + 0). 5r2 - r Expand 2b - 2b + b3 + (b - 2b + 3b)(0b + 0b - 2b2) + 3b*3 + 3b*3 - 4b3 + 0 + b3 + 0 - 22b + 21b*3 - 44b*3 + 25b*3. 2b*3 - 22b Expand -2w5 + 2w5 - w5 + (-w2 + w2 - 2w5)(-1 - 1 + 1) + 4w4 - 2w*4 - 2w*5 + 4w4. -w5 + 6w4 Expand -3w4 + w4 + 4w4 + 74w*3 - 12w*4 - 74w*3 + 3w*4 + 0w*4 - 2w4 + (1 + w4 - 1)(0 + 2 - 4). -11w*4 Expand (3 - 4 - 1)((1 - 1 - 3f)(3 - 2 + 1) - 4 - 5f + 4). 22f Expand (-h - 183 + 183)(2h + 0 + 0). -2h2 Expand (-6g2 - g + g2 + 3g2)(-9g2 - 4g*3 + 9g*2). 8g*5 + 4g*4 Expand (-2a*4 + 8a*4 + 2a*4)(-4 + 4 + 2)(22a - 20a + 21a). 368a5 Expand (4 - 4 - 2n)(0 + 2 - 3)(n + 3n - 6n + (-3 + 0 + 1)(-2n - 3n + 3n)). 4n2 Expand 3t + 9t3 - 2t*4 - 9t*3 + (-4 + 4 + 2t*4)(-3 + 3 + 2) - 4t + t4 + 4t. 3t4 + 3t Expand -4d2 + d2 + 2d2 + (-d2 - 2d2 + 4d*2)(4 - 4 - 1) + 4d - 2d*2 - 4d - 3 + 3 - d*2 + (-5d + 3d + d)(-2d + 1 - 1). -3d*2 Expand (-1 - 3 + 5)(-7w - 7 - w + 5w). -3w - 7 Expand (-n2 + 2n*2 + 3n*2)(8n3 - 8n + 8n). 32n*5 Expand (2 - 2 + 1)(-3i + 2i + 2i)(-5 + 2 + 24). 21i Expand (-2 + 2 - 2j + (-3 + 2 + 0)(3 - 3 + j) + 2j - j - 3j - 3j + 0j + 2j - 4j - 2j + 0j)(-3j + 2j + 2j). -12j*2 Expand (-4 + 7 - 4)(2t5 + 2t*5 - 3t5). -t5 Expand (-4 - b*3 + 4)(-2b + 2b - 2b2)(-4 + 1 + 8). 10b5 Expand (-2a*2 + 2a*2 - 2a3 + a3 - 6a3 - 2a3 + a3 + a3 - a3 + (-1 - 1 + 1)(-a3 + 0 + 0))(-6a - 3a*2 + 0a*2 + 4a). 21a5 + 14a*4 Expand (2 - 2 - 2)(-x + 0x - x) + 2x - 4x - 3x. -x Expand (-14n5 - 4n*5 + 11n*5)(5 - 3 - 5). 21n5 Expand -3g*5 + 4g*5 + 0g*5 + (2g3 - g5 - 2g3)(2 + 0 + 0) - 5g5 - 6g*2 + 6g*2 + 2g*5 + 0g*5 - 4g5 + g5 - 3g3 + 3g*3. -7g*5 Expand (-130 + 130 - 19v)(4v - 5v - v - 2). 38v*2 + 38v Expand 3m + 23 - 23 - 4m + 4m + m + 2m - 3 + 3 + 0 + 0 - 2m + (-4 + 0 + 5)(-2m + 4 - 4). 2m Expand -2h3 + 2h*3 - 2h*3 + (5 + 4h*2 - 5)(10h - 17h - 11h). -74h*3 Expand (-41t - 35t + 9t)(0t - 2t + 0t). 134t2 Expand (-2l*3 + 0l + 0l)((-2l + 3l - 2l)(-1 + 3 - 3) - 3l + 2l - l)(22 - 16 + 18). 48l*4 Expand 8x*5 + 11x*5 - 33x*5 + (-2 + 2 - 2x)(2x*2 + 0 + 0)(x*2 - x + x). -18x*5 Expand (0 - 1 - 7)(0o + 2o - o + (-3o + 4o + o)(-1 - 2 + 1)) - 5o - 6o + 5o. 18o Expand 2j*4 - 2j4 - j4 + (-j + j + 2j)(0j2 + 2j*3 + 0j*2) + (0j3 + j3 + j*3)(-3j + 2j + 2j) + 4j*4 - 2j*4 - 3j*4. 4j*4 Expand -3j*2 + 0j2 + j2 + (4j2 - 17 + 17)(-1 - 1 + 3). 2j2 Expand (2z*2 + 4z*2 + z - 2z*2)(-z + z*3 + z). 4z5 + z4 Expand -p - 4 + 4 + p - 2p - 2p + (-2p - 2p + 6p)(-1 + 0 + 4). 2p Expand (-4 - 1 + 4)(-1 - 3 + 1)(2z - 4z + z). -3z Expand (-2g2 + 0 + 0)(-2 + 0 + 1) - 3g2 + 4g*2 - 2g*2 - g - 516g*2 + g + 525g*2. 10g*2 Expand (3 + 9 - 1)(4m + 0 - 1 - 2m). 22m - 11 Expand (-5y*2 - 5 - 1 + 7)(4y2 + 2y2 - y2). -25y4 + 5y2 Expand (-r2 + 1 - 1)(5 + 4r - 5)(1 - 3 - 1)(-2 + 1 + 0). -12r3 Expand (0 + 0 + 1)(-4 + 3 + 5 + (3 + 0 - 4)(2 - 2 + 2))(2 - u - 2). -2u Expand (3a - 3a - 4a)(0 - 3 + 2)(-1 + 3 - 4)(2 + 0 + 0). -16a Expand (-3 + 0 + 5)(-30m + 8m - 9m). -62m Expand 5 + 2z - 5 - z*2 + (3 + 7 - 3)(-z + z + 2z2). 13z*2 + 2z Expand (-2 + 2 - 2o)(-4 + 4 + 1) + (4 - 2 + 0)(2o - 16o + 0o). -30o Expand 2y - 14 + 0 - 4y + (y + 0 + 0)(-3 + 0 + 2). -3y - 14 Expand (14v + 6v + 4v)(2 - 4 + 4) - v + 2v + v. 50v Expand (-1 - b - 2b + 3)(2b - 65 + 65). -6b2 + 4b Expand (1 - 2 - 1)(5 + 2 + 0)(l3 - l3 + 2l5) - 3l5 + l5 + 3l5. -27l*5 Expand (2j + j*2 - 2j)(3j - 9j + 1 - 3j). -9j3 + j2 Expand (-4 - 3 + 5)(-n*5 + 2n*2 - 2n*2) - 3n*4 + 2n*5 + 3n4 + n4 - n5 - n4 + 5n4 + n5 - 5n*4 + 34n*3 + 7n*5 - 34n*3. 11n*5 Expand (-1 - 4 + 2)(0m2 + 4m*2 - 2m*2) + (-3m*2 + 2m2 - m2)(4 - 1 - 1). -10m*2 Expand (-9 - 40 + 9)(-2h2 + 3 - 3). 80h*2 Expand (5v + 4v - 2v)(-1 - 4 + 2) - 2v + v - v + (4v - 2v - v)(-1 - 1 + 3). -22v Expand -4f + 6f - f + (-4f + 2f + 5f)(-4 + 4 - 1). -2f Expand (-f - 3 + 3)(0 + 2 - 1)(1 - 1 + 2f). -2f2 Expand (-4c + 3c - c)(12 - 4 + 5). -26c Expand (3 + 1 - 2)(d*4 + 2d - 2d). 2d*4 Expand (0 + 2 - 3)(-3 - 4 + 4)(4w - w + w). 12w Expand (15 - 14h - 15)(2 + 2 - 6). 28h Expand 2t + t - t + (2t + 2t - 5t)(2 - 3 + 2). t Expand (j2 - j2 - j3)(0j2 + 0j2 - j2) - 2j5 + 3j*5 - 2j*5 + (-j - j + 4j)(4j*4 - 3j*4 + 0j*4). 2j*5 Expand -7u*5 + 13u - 13u + (1 - 1 - 2u)(-4u4 + u4 - u4). u5 Expand (-3x + 3x + 2x)(152 - 152 + 13x). 26x*2 Expand (2 - 1 + 0 + (-1 + 6 - 3)(0 + 0 - 2) + 3 - 3 - 1)(57a*2 - 271a + 271a - 2a*5). 8a*5 - 228a*2 Expand (-12t - 6 + 23t - 13t)(3 - 2 - 3). 4t + 12 Expand -n*5 - 2n5 - n5 + (2n - n + 0n)(2 - 4 - 1)((4n3 - 2n*3 + 0n*3)(0n + n + 2n) - 3n4 + n4 + 4n*4). -28n*5 Expand (3a*3 - 2a3 + a3)(-1 - 8 + 6). -6a*3 Expand (-2h - h + 4h)(2h4 + 18 - 18 + (0h - 2h + h)(5h3 - 3h*3 - 4h*3) + 1 - 1 + 2h*4). 6h*5 Expand ((-1 + 2k + 1)(-2 - 1 + 5) + k + 2 - 2 + (-8k + 3k + 3k)(-2 + 3 + 0) + 0k - 3k + k)(-5k + 3k - 3k). -5k*2 Expand (2b + 3b - 8b + (4 - 3 + 0)(11 + b - 11))(-2b3 + b3 + 3b*3) + (-2b*2 + 2b*2 - 2b*3)(5b - b - 2b) - b4 - b4 + 0b4. -10b4 Expand s2 - s2 + s4 + (-6s + s + 3s)(3s*3 + 2s3 - s3). -7s4 Expand -8l*4 + 12l*4 + 14l4 + (l2 - 2l + 2l)(-6l2 + l2 + 3l2) + 2l*4 + 3l*4 - 6l*4 + 5l*4 - 4l*4 - 3l*4. 13l*4 Expand 3p*2 - 2p*2 + 0p*2 + (p - 2p + 3p)(0p + 5p - 6p) + 5p*2 - 4p*2 - 3p*2 + 2 - 2 - 9p*2. -12p*2 Expand (0z - z - z)(-4 - 3 + 3) + 4z -	{ "pile_set_name": "DM Mathematics" }
7 for t. -1 Let h be ((-6)/(-4) + -1)8. Suppose m - h = -m. Suppose -6g = -g - 10. Solve -5p - j + 1 = 7, 3p - g = -mj for p. -2 Let w(b) = -13b*2 - 2b - 4. Let c be w(-2). Let l = c + 59. Solve -5x - 4u = -6, 2x - 2u = u + l for x. 2 Let i(v) = -v*2 + 8v + 9. Suppose 6 = -5a - 24. Let s = 3 - a. Let t be i(s). Solve t = -3o - 4b + 29, -13 = -5b + 12 for o. 3 Let g(d) = -d*2 + 33d - 268. Let k be g(18). Solve -3t - 27 = 4b, -kb - t + 3 = 14 for b. -3 Suppose -531 = 2w + 7w. Let x = w + 63. Solve 2j - 6j - a = -15, 0 = -3j + xa - 3 for j. 3 Let y(k) = -174k + 353. Let p be y(2). Solve pl = -2u + 5, 5u - 21 = -5l + l for l. -1 Let r(j) be the second derivative of -j*3/3 + 4j*2 + 4j. Let p be r(0). Let n = -3 + 3. Solve nx - 2x - 14 = -4v, -v - x = -p for v. 5 Let k be (-26)/(-8) + (-2)/8. Suppose 6v + 122 = 44. Let m = v - -17. Solve l - 11 = kq - 28, -4l - 36 = -mq for l. -5 Suppose -8 = -2v + v. Suppose 16m - 20m + v = 0. Solve 0 = mw - z - 2, 0 = w - 5z + 17 for w. 3 Suppose 22 = 2p + 5y, -2p + 70 = 2p - 3y. Solve -2d = 5m + 13, 2m = -3m + d - p for m. -3 Let r = 5 + -2. Suppose 5q - 41 = 3g, -rq + g = -8q + 53. Let x = q - 7. Solve 5m = xu - 1, 4m - 7 = m - 2u for m. 1 Let y(m) = m2 + 6m + 3. Let n be y(-6). Suppose 2w + 19 = 5c, nc + 1 = 2c + 2w. Suppose 4f - c = 3. Solve -2q = -fg - 16, 3g + 12 = 3 for q. 5 Let i = -67 - -67. Suppose 4t = 3h + h, -t + 5h = i. Solve 2q + q - y = 11, t = -2q - 2y + 2 for q. 3 Suppose 8 = -3g - 4m + 24, 3m = -15. Suppose -9 = -3x, 2x = -3b - 0b + 30. Let k = g - b. Solve -3u + kp + 1 = 2, -p = 2u + 8 for u. -3 Let o(z) = -z3 - 2z*2 + 2z + 6. Let t be o(-2). Suppose -5u + 4j = -8, -4u + t = u - j. Solve 2d + ud - 4s = -2, -2d + 13 = s for d. 5 Suppose j = 2s + 2, 4s - 3s - 3 = 0. Let a = j - 8. Suppose 3m + a - 6 = 0. Solve 8 = mz - 2o, -5z + 2z + 10 = -2o for z. 2 Let s(t) = -2t + 3. Let j be s(-2). Suppose y + 31 = -5z + 8z, -1 = 2z - 5y. Suppose 5r + z = jr. Solve -4n + 5p = r, 3n + 2p = 6p - 4 for n. -4 Let o = 4 - -22. Suppose -n = 4f + 4 + 1, -4f - 2n = 10. Suppose f = 4l - o + 6. Solve 3d + 3a - 18 = 0, ld + 2a + a = 20 for d. 1 Suppose -3y - 5z + 39 = -0y, y - 17 = -3z. Suppose -13 - y = -7f. Let x(g) = -g - 3. Let d be x(-5). Solve 4n = 2v + 8, dn = fv + 2v - 4 for n. 3 Let z = -1065 + 1065. Solve z = y - 2q + 9, 4y + 1 = q - 21 for y. -5 Suppose 12t - 24 = 276. Suppose -2a - t = -31. Solve -8 = -3q + ar - r, r + 18 = 5q for q. 4 Suppose 21m = i + 19m + 8, 5m = 3i + 19. Solve 5y - 30 = 4n, 3n + 2y + 1 = in for n. -5 Let w(y) = 0y + 7y + 4 - 9y - y2 + 9. Let t be w(-4). Solve 3v = tf + 14, -2v - v + f + 10 = 0 for v. 3 Let g(r) = r + 8. Let w be g(-10). Let o be -1(w - -3) - -1. Solve o = -3l - 3m - 6, -2l + 4m = 3l - 35 for l. 3 Let c be -10 + 14 + 121. Solve c = -w + 4m, 0 = -w + 4w - 4m + 24 for w. -4 Let k(n) = n*2 - 10n - 20. Let w be k(12). Suppose -m + w = -1. Solve -2g + f = -6, 6 = mg - 5f + 1 for g. 5 Let w(y) = y3 + y - 1. Let j(l) = 3l*3 - 5l*2 - 22l + 3. Let i(a) = j(a) - 2w(a). Let q be i(8). Solve 2t + 2 = -2r + 4, t + 3r = -q for t. 4 Let u = -636 + 647. Solve -5s - 26 = -w, -4s - 6 - u = 3w for w. 1 Let y = 34 + -29. Suppose yd + 6v - 20 = v, 0 = -5d + 3v + 44. Solve 0 = 3t - 6t + 4a + d, -4a + 3 = -t for t. 5 Suppose 0 = 5d - 12 - 8. Let o be (-3)/((-186)/24 + 7). Solve -4i + 17 = -ox - 3, -3x = -di + 19 for i. 4 Suppose 79 = 13c + 1. Solve -2m = -3b + 4, cb - 2b + 5m - 13 = 0 for b. 2 Let m(j) = j*2 + 12j + 2. Let r be m(-13). Let p = -28 + 3. Let g = -18 - p. Solve -15 = -3c - a, c - g + r = 4a for c. 4 Let h = -37 - -10. Let p = -10 - h. Suppose 20 = -5i, 4i - 3 - 1 = -5m. Solve -k + p = 3k - o, mo = -5k - 5 for k. 3 Let x be (-1 - 8)(-6)/18. Suppose xz + 5m - 11 = 0, -2 = -m - 1. Suppose 0 = -v + zv - 17. Solve -k - 8 = 3q, 4k - 5q - v = 19 for k. 4 Suppose -4g - 5f = 8, 2g - f = 4 + 6. Suppose -117 = -5i + 3m, 3i + 4m = 3m + 73. Solve 5j = 3y - 28, -gj + y = -8j - i for j. -5 Let z = -4 - -24. Suppose 5w + 4r = z, -w - 4r = -3 - 17. Let q be 0/41-11. Solve -i - 4 = a - qi, w = -2a + 5i - 1 for a. -3 Suppose 0 = -42y + 38y + 12. Solve 0 = -yt + 3c - 3, -t + 2c = -c + 3 for t. 0 Let h(c) = c*2 - 22c + 22. Let x be h(18). Let s be (-2)/(-5) + (-180)/x. Solve st = t - 4z + 14, t = 4z - 6 for t. 2 Let p(x) = -x3 - 14x*2 - 3x - 40. Let k be p(-14). Let f = 15 + 3. Solve -2s = -2u - f, ku - 4s + 21 = -7 for u. -4 Suppose 6d = 73 - 61. Solve -5w = 5g - w + 9, d = -4g + 2w for g. -1 Suppose -2m = 3d - 57, 3m - 81 = -4d + 2m. Let g(h) = 3h - 61. Let k be g(d). Solve -2 = -2f - kl - 6, 4f + 9 = -5l for f. -1 Let a be 1410/65 - 2/13. Solve 0 = 4g + av - 24, -g - 4v = -5g for g. 4 Let i(j) = 8j + 8 + 5 + 5 + j2 - 15. Let a be i(-8). Solve -ar + 2n = -1 + 6, -3n + 6 = -4r for r. -3 Let n = 70 - 62. Suppose -4u + n = -0u. Solve -8c = -4c - h + 17, 21 = -3c - uh for c. -5 Suppose 2w - 7 + 5 = 0. Suppose 0 = 2q - 10, 0q = -2f + 5q - 17. Solve 0 = 3d - 2g + 6 - 1, w = -5d - fg for d. -1 Let y(q) = -q*2 + 63q - 337. Let j be y(6). Solve -5t = -3l - 12, 2l - 17 = -0l - jt for l. 1 Suppose -5x + 4 = 7p - 5p, 4x - p - 11 = 0. Let b(d) = -5d + 9. Let u be b(-7). Suppose 0 = -5w + u - 14. Solve -5z = -y + 36 - w, -2y = xz for y. 5 Let d = -3 - -4. Let g be 0 + -2 + (d - -6). Suppose 16 = 3m - p, -gp = 6m - m. Solve ms = 3i + 6, 2i - 2s = -4s + 10 for i. 2 Let b(a) = 57a2 - a - 1. Let x be b(-1). Let k = -28 + x. Suppose 0 = 5g - 6 - k. Solve 0 = 4w - 3l + 2, g - 3 = 2l for w. 1 Suppose 0 = 109n - 135n. Solve 0b = 2t + 5b - 15, n = -2b + 2 for t. 5 Let d = -88 - -91. Solve 4q - 3q + dg - 8 = 0, 3q - 12 = -5g for q. -1 Let b be 11 + (-7)/(21/12). Let z(u) = u*3 - 6u*2 - 3u - 8. Let o be z(b). Solve -4f - o = 0, 2t + t - 2f - 1 = 0 for t. -3 Let q be 2/(-8) + 212/16. Let b = 14 - 21. Let y = 9 + b. Solve 2x + 14 = yn, 5n - q = x + 10 for x. -3 Suppose a - 2f - 3 = f, -4a + 12 = 4f. Solve s = -ay, -3y + s + 4 + 2 = 0 for y. 1 Let v be 2 - (1 - (4 - 4)). Let f be 2 - v/((-3)/(-12)2). Solve 3d + t - 15 = -d, f = 4d - 2t - 6 for d. 3 Let s be (-4)/10 - 196/35. Let t be s/8(-23 - -19). Solve 3f - 2f + 3d - 2 = 0, -tf - 3d = 0 for f. -1 Let q(j) = j. Let m be q(9). Let z(i) = i2 - 7i - 1. Let a = 27 + -19. Let p be z(a). Solve -5c + 3 = -pn + 4n, c + m = 3n for c. 3 Let w be 0 + -3 + 15 + (-3 - 7). Solve 2o + 4 = -2i, 5i - 2o + w = -1 for i. -1 Suppose -9q = -45 + 9. Suppose 2i + 5u - 25 = 0, -2i - 29 = -5u - q. Solve i = 4o - g + 3, 6 = -3o + 4g - 6 for o. 0 Let d be 14/3 - 23/(-69). Solve -2o + 0x = 3x + 7, o - 16 = dx for o. 1 Let c = -22 + 25. Suppose 9 + 0 = ck. Solve 10 = -3o - 4h, -h + kh + 2 = -3o for o. 2 Suppose 0 = 5i + c - 91, 0 = -4c + 6c - 2. Let r = -13 + i. Solve 0 = 5z + rm - 20, z + m = -4m for z. 5 Let j be (9/(-12))/((-1)/4). Let h = 7 - j. Suppose -77 - 7 = -4u. Solve -hz = -t + u, -5z - 32 = -4t - 2z for t. 5 Let i(m) = m*3 - 16m*2 - m + 18. Let f be i(16). Solve -2g = 4w + 14, -2w - 1 = -3g + f for g. -1 Suppose -4v - 17 = 3t + v, 2v - 4 = 0. Let g = t + 12. Let a be 2 + -2 - (-1 - g). Solve 0j - j = -ar - 8, 5j - 24 = 4r for j. 4 Suppose 4b - 101 + 89 = 0. Solve -ba - 4 = -a - 2o, 0 = 3o - 6 for a. 0 Let f = 1263 - 1263. Solve -4x + x - 4n - 3 = f, -5x = 5n for x. 3 Let w = 25 - 23. Let x(k) = k*3 + 4k*2 + k + 5. Let j be x(-4). Solve -wt - 4o = -11 + j, -4t - 7 = -o for t. -1 Let x(g) be the second derivative of -g*3/3 - 21g*2 + 21g. Let z be x(-21). Solve -s = 4j + 11, 5s + 0j - 4j + 7 = z for s. -3 Suppose -14z + 10z = -96. Let u be (-11)/(-4)(0 + -4). Let t = 11 + u. Solve -a = w, -z = -5w - ta + a for w. 4 Suppose -d - 4d + 120 = 0. Suppose 21 = -dk + 31k. Solve -2v = 2g - 2, -4g - 2v = kv - 8 for g. -3 Let y be ((-5)/((-30)/9))/((-9)/12). Let c be (-9)/y((-10)/18 + 1). Solve -i + f + 2 = -c, 4i - 22 = -2f for i.	{ "pile_set_name": "DM Mathematics" }
Let g(y) = 39y2. Let l(t) be the first derivative of -t6/360 + 49t*3/3 + 64. Let h(o) be the third derivative of l(o). Give h(g(c)). -1521c*4 Let g(p) = -3p*2. Let k(n) = -19223n*2 + 4385n. Give k(g(w)). -173007w4 - 13155w*2 Let d(v) be the first derivative of 7v*3/3 + 2v - 3680. Let b(f) = -4f + 3f*2 + 4f. Determine d(b(j)). 63j4 + 2 Let j(r) = 4r*2. Let k(y) = 1 - 362y + 110y - 1 - 204y. What is k(j(g))? -1824g2 Let u(y) = y2. Let w(l) = 7 - 55 - 13l - 18 + 9. Let i be w(-6). Let d(h) = 52h - ih - 11h - 14h. Give d(u(p)). 6p2 Let a(b) = -4b2 - 1. Let s(g) be the third derivative of g3/6 + 19g2 - 3. Let j(v) = 4a(v) + 4s(v). Let q(n) = -3n*2. Calculate j(q(y)). -144y*4 Let c(y) = 2712576y. Let u(f) = 207f2. Give c(u(r)). 561503232r*2 Let x(f) = -2001f. Let j(h) = -99h - 16h + 39h + 36h + 37h. Determine x(j(s)). 6003s Let p(s) = s*3 + 6s*2 + 6s + 5. Let u be p(-2). Let i(k) = 5k - uk + 6k - 3k. Let j(b) = -31b2. Calculate j(i(r)). -31r2 Let j(o) be the third derivative of o5/60 + 3409o2. Let g(p) = -4294p*2. Give j(g(z)). 18438436z*4 Let k(h) be the third derivative of -17h*5/20 - 3h2. Let i(g) be the first derivative of g2 - 342. What is i(k(c))? -102c2 Let i(k) = 2k. Suppose 5l + 4s = 130, 0s + 20 = -4s. Let b be (2/2)/(-5) - (-1356)/l. Let z(p) = 82p - bp - 58p. Give i(z(r)). -42r Let w(u) be the third derivative of 61u5/120 - 25u*3/3 + 6u2 + u. Let a(b) be the first derivative of w(b). Let q(k) = k2. Give a(q(z)). 61z2 Let l(q) = -24q. Let s(r) be the third derivative of r*7/2520 + 5r*4 + 39r*2 + 2r. Let m(f) be the second derivative of s(f). Determine l(m(x)). -24x2 Let x(v) be the first derivative of -v4/24 - 17v*2/2 - 4v + 217. Let o(z) be the second derivative of x(z). Let f(a) = 9a2 - 6a. Give f(o(p)). 9p2 + 6p Let o(y) = 20y2 + 85y + 32993. Let l(u) = u*2. What is o(l(a))? 20a*4 + 85a*2 + 32993 Let n(f) = 179f. Let o(w) = 1849w - 65. Determine o(n(c)). 330971c - 65 Let b(z) = -3z + 388092 - 388092. Let r(o) be the first derivative of -21o*2/2 + 16. Calculate b(r(u)). 63u Let p(o) = -22o + 2. Let h(f) = -2956f - 2945f + 5913f. Determine p(h(v)). -264v + 2 Let y(f) = 4f - 4f + 2f. Let r(a) be the first derivative of -4 - 376a + 40 - 384a + 3a2 + 760a. Give r(y(w)). 12w Let z(p) = -9p*2. Let x(b) = -b - 2. Let d be x(-2). Suppose 0 = 15v - 38 - 52. Let m(f) = -vf + 4f + df. Calculate m(z(r)). 18r*2 Let t(k) be the second derivative of -5k*3/6 - 20k. Let a = 28 - 24. Let x(w) = -a + 32w + 4 - 33w. Give t(x(j)). 5j Let q(o) be the third derivative of -o7/2520 - o5/15 + 13o*4/24 + 82o*2. Let b(z) be the third derivative of q(z). Let t(f) = -45f. Give t(b(s)). 90s Let p(b) = 20b*2. Suppose -2a + 188 = -5v, 0 = 2a - a + 4v - 94. Let n(c) = 4c + a - 94. Determine p(n(y)). 320y2 Let q(s) = 3s*2. Let k(r) be the second derivative of 4r6/45 + r3/6 + 2r2 - 38r + 2. Let u(a) be the second derivative of k(a). What is u(q(d))? 288d4 Let n(y) = y2. Let a(o) be the first derivative of 529o*3/3 + 1091. What is n(a(k))? 279841k*4 Let s(x) = -4x + 5x + 3x. Let d(c) = 89c2 - 19c*2 - 25c*2 - 54c*2. Give s(d(u)). -36u*2 Let x(m) = -188m + 2m2 + 37 - 35 - 3m*2 - 2. Let k(l) = 2l*2. Determine x(k(d)). -4d*4 - 376d*2 Let k(q) = -15q*2. Let x = 247 + -245. Let w(l) = 9 - 8 - 1 + 4l*x. Calculate w(k(m)). 900m*4 Suppose -6a - 683 = -731. Let v(o) = -2o - ao + 4o + 8o + o. Let q(h) = -17h. Give q(v(r)). -51r Let m(x) = 347160772x. Let s(z) = z2. Calculate m(s(l)). 347160772l*2 Let u(p) = 11p - 3. Let o(z) = -107z - 6. Let v(t) = -o(t) + 2u(t). Let c(y) = 13y2. Determine v(c(q)). 1677q*2 Let v(f) = -6f*2 - 335f + 156f + 175f. Let g(a) = -2a2. Calculate v(g(b)). -24b*4 + 8b*2 Let k(w) = 5w - 1 + 5 - 14w2 - 3 - 1. Let s(h) = h. What is k(s(v))? -14v*2 + 5v Let y(s) be the first derivative of s*2/2 + 38. Let j(n) be the second derivative of 5n*3/3 + 1283n. What is y(j(p))? 10p Let t(m) = 5m - 2371m2 + 2374m*2 - 2m - 2m. Let k(g) = -g2 + 2. What is k(t(d))? -9d*4 - 6d3 - d2 + 2 Let u(a) = 14a2. Let l be (-40 + 45)/((-5)/(-6)). Let r(n) = ln + n - n + 3n. What is r(u(f))? 126f*2 Let h(b) = 7b2. Let d(p) be the third derivative of p6/12 + 34p3/3 - 2p*2 - 33p. Let y(s) be the first derivative of d(s). Calculate y(h(f)). 1470f4 Let t(x) = -2x + 5x + 0x. Let q(u) = -21u - 24. Let i(r) = -17r - 20. Let m(y) = 6i(y) - 5q(y). Determine m(t(d)). 9d Let y(b) be the second derivative of b4/2 - 2b. Suppose 0 = -m - 2u - 2u + 79, 3u - 3 = 0. Let x(z) = -39z - 32z + mz. What is x(y(p))? 24p2 Let x(n) = 174783n + 18. Let c(r) = r. What is c(x(j))? 174783j + 18 Let v(s) = -115s*2 + 20s - 38s2 + 77s*2 + 77s*2. Let c(o) = 5o. Give c(v(d)). 5d2 + 100d Let j(x) = x*2 - 7. Let m(h) be the third derivative of 23h*5/30 + 54h*2 - 25. What is m(j(s))? 46s*4 - 644s*2 + 2254 Let j(r) = -144163r. Let z(u) = -u*2 - 8. Determine j(z(f)). 144163f*2 + 1153304 Let y(s) = 39s*2. Let o(c) be the first derivative of 3c*2 + 24. Calculate o(y(q)). 234q2 Let a(c) be the third derivative of c5/30 - 241c2. Let w(j) = 1079 + 6j*2 + 1073 - 6j - 2152. Calculate a(w(l)). 72l4 - 144l*3 + 72l*2 Let i(m) = -2m*2. Let d(u) = u + 2. Let y(r) = -62r - 372. Let f(v) = 372d(v) + 2y(v). Calculate i(f(x)). -123008x2 Let b(y) = y2. Let x = 13 - 7. Let w(m) be the first derivative of m3 + 12m - 7685. Let s(d) = d*2 + 2. Let a(z) = xs(z) - w(z). Determine b(a(k)). 9k4 Let i(h) = -2457h. Let b(x) be the second derivative of -x*3/2 + 8428x. Calculate i(b(k)). 7371k Let w(k) = -k - 292425712. Let f(z) = z2. What is w(f(t))? -t2 - 292425712 Let p(s) = 7s - 12. Let u(g) = 205g - 345. Let l(c) = 115p(c) - 4u(c). Let r(q) = 363q. Calculate r(l(o)). -5445o Let o(m) = -266m*2 - 261m*2 + 1052m*2 - 260m*2 - 263m*2. Let v(w) = -2w*2 + 2w + 18. Determine v(o(f)). -8f4 + 4f*2 + 18 Let w = 547 + -551. Let h(l) = -8l + 135. Let g(x) = 7x - 137. Let a(m) = wh(m) - 5g(m). Let s(d) = d2. Give s(a(b)). 9b*2 - 870b + 21025 Let v(d) = -d. Let s(z) = -597 - 1327z2 + 1199 - 202z*2 - 602. Determine v(s(f)). 1529f*2 Let q(i) = -3436i - 720. Let j(g) = 2g. Give q(j(y)). -6872y - 720 Let h(z) = -16z2 + 5z. Let x(w) = 209w2 - 66w. Let a(i) = -66h(i) - 5x(i). Let v = 52 - 50. Let y(p) = p*2 + 0p2 + pv + 0p2. Give y(a(n)). 242n*4 Let x(r) = 15r*2. Let h(c) = -1069c*2 - 28c. Give h(x(y)). -240525y4 - 420y*2 Let j(r) = -55r*2 + 2r - 2. Let d(k) = -13144k. Give j(d(a)). -9502060480a*2 - 26288a - 2 Let w(z) = 22381 - 22381 + 245z + 2z*2. Let f(x) = 2x. Calculate w(f(d)). 8d2 + 490d Let v(t) = 161840t. Let b(s) = -196s*2. Determine v(b(q)). -31720640q*2 Let d(s) = -15s2 - 1. Let r(q) be the first derivative of q3/2 - 87q - 16. Let j(g) be the first derivative of r(g). What is j(d(a))? -45a*2 - 3 Let t(n) = 4n2. Let g(u) be the third derivative of -u5/60 - 31u3/3 + 3u*2 - 212. Give g(t(s)). -16s*4 - 62 Let d(n) = -4n*2. Let j(m) = -1845551m. Give d(j(x)). -13624233974404x2 Let u(s) = -11s + 30. Let p(t) = 8t - 20. Let h(a) = 3p(a) + 2u(a). Let o(k) = k2 + 315k - 1. Determine h(o(z)). 2z2 + 630z - 2 Let s(c) = 217c2 - 1338475c. Let x(h) = -h. Calculate x(s(v)). -217v2 + 1338475v Let h(n) = -167418n. Let o(m) = 45m. Give o(h(q)). -7533810q Let v(y) = -32498y + 2. Let d(c) = -21c - 2. Determine v(d(h)). 682458h + 64998 Let q(h) = 26472784h. Let s(t) = -18t. Give q(s(n)). -476510112n Let d(p) = 2p. Let v(c) = 23920967c. Give d(v(w)). 47841934w Let o(n) = -714n2 + 126n + 252. Let v(q) = -84q2 + 15q + 30. Let r(x) = -5o(x) + 42v(x). Let t(g) = 32g2. Give t(r(y)). 56448y4 Let l(c) = -c2. Let h(r) = -356r + 1039r + 2227r. What is l(h(k))? -8468100k*2 Let b(r) = -r. Let y(l) be the first derivative of 198 + 0l*2 + 0l + 46/3l3. What is y(b(w))? 46w*	{ "pile_set_name": "DM Mathematics" }
- 5 Let g be (-629)/(-153) + 2 + (-34)/(-18) + -2. Let z(f) = -24f3 - 2f*2 + 2. Let b(m) = -23m*3 - 3m*2 + 3. Calculate gz(y) - 4b(y). -52y*3 Let a(z) = 2z*3 + 4z*2 - 12z - 12. Let v(f) = 5f - 3. Let l(m) = 7m - 5. Let y(p) = -2l(p) + 3v(p). Give a(w) + 12y(w). 2w*3 + 4w*2 Let q(t) = -3t*2 + 124t - 359. Let i be q(3). Let w(s) = s - 1. Let x(o) = -28o3 - 14o + 14. Calculate iw(d) - x(d). 28d*3 Let m(d) = -9d - 4. Suppose 4g - 4p = -56, -5g + 28 = -7g - 5p. Let j(t) = -4t - 2. What is gj(b) + 6m(b)? 2b + 4 Let j(y) = 67 - 3y + 20y + 17y + 3y. Let b be j(-3). Let g(t) = t3 + t + 1. Let v(c) = -26c*3 - 22c - 22. Calculate bg(n) - 2v(n). 8n3 Let s(a) = 3a*3 - 2a*2 + 19a + 12. Let l(j) = -8j3 + 7j*2 - 64j - 37. Calculate -2l(k) - 7s(k). -5k3 - 5k - 10 Let o(s) = -1634793s2 - 85239s. Let f(q) = 29020q2 + 1513q. Let r(b) = -451f(b) - 8o(b). Let m(w) = 43w2 + 2w. Calculate 451m(j) + 2r(j). 41j2 Let i be 2/(-6) - 20/(-6). Let o(h) = -7h*2. Let q(r) be the third derivative of 7r*5/5 + 222r*2 + 2r. Calculate iq(y) + 35o(y). 7y2 Let w be (-18 - 1)(-16)/(3 + -1). Let i = -259 + w. Let n = 96 + i. Let b(k) = 17k3 - 13k*2. Let o(z) = -9z*3 + 7z*2. Calculate no(y) - 6b(y). -3y3 + y2 Let y(j) = -2546j3 - 2j*2 + 2j + 10. Let g(c) = 5092c3 + 5c*2 - 4c - 24. Give 2g(x) + 5y(x). -2546x3 + 2x + 2 Let t(c) = 2c2 - 20c + 28. Let k(o) = -4o + 6. Give 14k(u) - 3t(u). -6u*2 + 4u Let s(a) = 8a2 + 5a - 1. Suppose 0 = -541n - 315n + 5136. Let k be 8/(-10)(-5)/2. Let r(t) = 6t + 1 + 9tk - 2 + 0t*2. Calculate ns(w) - 5r(w). 3w2 - 1 Let o(h) be the third derivative of -h4/24 - 5h3/6 - 456h*2. Let y(j) = -2j - 8. Calculate -7o(w) + 5y(w). -3w - 5 Let k(p) = -12p*2 + 204p + 1. Let x be k(17). Let f(l) = -l. Let z(y) = y + 1 + 0y - y - 4y. Give xz(g) - 5f(g). g + 1 Let i(c) = -67c3 - 14c*2 + 5c - 5. Let z(h) = -59h3 - 12h*2 + 6h - 6. Determine 6i(l) - 5z(l). -107l3 - 24l*2 Let f(t) = 2t*3 + 2t*2 - 2. Let v(n) = -99n*3 + 10n*2 - 8. Give -4f(x) + v(x). -107x3 + 2x*2 Let j(h) = -68844h*2 + 45h - 15. Let a(b) = -17211b2 + 12b - 4. Calculate -15a(x) + 4j(x). -17211x2 Let h(j) = -j - 6. Let i(g) = -6676g + 72. Give -12h(c) - i(c). 6688c Let c(d) = 23d2 + 2d. Let m(z) = -93z2 + 7z - 33. Determine 4c(n) + m(n). -n2 + 15n - 33 Let x(o) = 10o3 - 6o*2 + 2285o + 18. Let a(w) = 42w3 - 25w*2 + 9137w + 75. What is -6a(r) + 25x(r)? -2r3 + 2303r Let o(z) = 5z + 1047. Let c(l) = 22l + 4187. What is -2c(g) + 9o(g)? g + 1049 Let u be (12/(-8)1 + 3)2. Let w(v) = 64v3 + 7. Let o(x) = -32x*3 - 3. Determine uw(s) + 7o(s). -32s*3 Let u(v) = -v - 6. Suppose 0 = -3y - 3 - 12. Let b(h) = -h - 3. Let q be 1(26 - (18 - -5)). Calculate qu(j) + yb(j). 2j - 3 Let w(k) = 21k2 + 64k - 26. Let r(d) = 22d2 + 65d - 29. Calculate 8r(c) - 9w(c). -13c2 - 56c + 2 Let o(f) = -f - 1. Let w(l) = -4l - 2. Let h(t) = -4o(t) + 2w(t). Let p(z) = -5z. Suppose 24 = 4b - 5a, -b - 13a = -18a - 36. Determine bp(v) + 6h(v). -4v Let f(b) = -b2 - 1. Let c be 2/(-10) - 3/(-15). Let x be ((-1)/(3 - 7))/((-2)/(-16)). Let j(u) = -5 + c + 1 - 9u*x. What is -6f(n) + j(n)? -3n2 + 2 Let k(v) = 27783v + 108. Let q(h) = -2137h - 8. Calculate -2k(s) - 27q(s). 2133s Let o(m) = 13m3 + 221m2. Let x be (294/(-135) + (-50)/225)/((-10)/25). Let f(r) = -r2. Calculate xo(u) + 1326f(u). 78u3 Let w(j) be the first derivative of j2/2 - 3j + 54. Let z(n) = 4n - 12. Suppose -8 = -418b + 422b. Calculate bz(a) + 9w(a). a - 3 Let j(y) = -y3 + 13y*2 - y + 1. Let t(h) = -4h*3 + 40h*2 - 2h - 31. Give 6j(d) - 2t(d). 2d3 - 2d*2 - 2d + 68 Let v(b) = -2b3 + 14b*2 - 5b - 6. Let z(m) be the second derivative of -m*5/10 + 5m4/4 - m3 - 7m2/2 - 540m - 2. Determine -6v(s) + 5z(s). 2s3 - 9s*2 + 1 Let s(h) = 11h*3 + 8h*2 - 96h - 10. Let i(l) = 9l3 + 7l*2 - 95l - 9. Calculate -6i(t) + 5s(t). t*3 - 2t*2 + 90t + 4 Let y(t) = -5t. Let m(n) be the third derivative of -181n*2 + 1/8n*4 + 0 + 0n + 0n3. Give 10m(s) + 4y(s). 10s Let y be (-1)/(-1 - (-7)/14). Let i(z) = z*3 + 4 - 3 - 1. Let v(f) = -2f*3 - 18f - f*2 - 13f + 30f. What is yv(n) + 5i(n)? n3 - 2n*2 - 2n Let s(q) be the second derivative of -5q3/3 - 7q*2/2 - 2q + 1165. Let n(u) = 21u + 15. What is 6n(l) + 13s(l)? -4l - 1 Let v(f) = 598f3 - 65f*2 + 14f. Let p(n) = 399n3 - 44n*2 + 10n. What is 7p(g) - 5v(g)? -197g3 + 17g*2 Let s(r) = -3r - 5. Let g be -53/(-15)3. Suppose -u + 3u = 10. Let n(o) = -uo - 22o - 3 + 25o. Determine gs(w) - 5n(w). w Let h = -43 + -122. Let u be (33/h)/((-2)/30). Let p = 0 + -4. Let f(d) = 7d2 + 4d. Let c(b) = 6b2 + 3b. What is pc(a) + uf(a)? -3a2 Let l(p) = 11p*3 - 3p*2 + 6p - 5. Let a(z) = 8z3 - 3z*2 + 5z - 3. Determine 5a(u) - 4l(u). -4u3 - 3u*2 + u + 5 Let w(p) = -17p*3 + 9p*2 - 33p - 4. Let i(r) = -r*2 + 19r + 94. Let x be i(23). Let k(b) = 4b3 - 2b*2 + 8b + 1. Determine xw(m) + 9k(m). 2m3 + 6m + 1 Let b(k) = -5k3 - 5k*2 + 3k + 1. Suppose o = -4o + 25. Let j(s) = -27498369s*2 + 27498360s*2 - 1 + 3 + 5s - 10s3. Calculate ob(x) - 3j(x). 5x*3 + 2x*2 - 1 Let r(a) = 95a + 4429. Let q(k) = 21k + 1107. Determine 9q(t) - 2r(t). -t + 1105 Let j(b) = 13b - 4. Let s(h) = 22h - 7. Let z(w) = 5j(w) - 3s(w). Let q(l) = -7l + 2. Let i be (2 + 1)5/15. Give iq(c) - 3z(c). -4c - 1 Let i(b) = -2b - 2. Let k(j) = 32j + 33. What is 6i(a) + k(a)? 20a + 21 Let o(z) = -3z3 + 9z*2. Suppose 4p - 14 - 6 = 0. Let x(f) = 276594f2 - 553183f2 + 1 - 1 + f3 - 3f3 + 276595f*2. Calculate po(r) - 8x(r). r3 - 3r*2 Let w(g) = -121g*3 + 3g*2 + 2g + 14. Let l(r) = 61r3 - 2r*2 - 2r - 8. Calculate 5l(i) + 3w(i). -58i3 - i2 - 4i + 2 Let x(b) = 4b2 - b + 1. Let i(s) = 18s*2 + 1052s + 5. Determine -i(n) + 5x(n). 2n*2 - 1057n Suppose 413 = -7a + 189. Suppose -2h - 14 = -90. Let d = h + a. Let m(q) = 2q3 + 3q - 3. Let r(u) = -u + 1. Determine dr(z) + 2m(z). 4z3 Let d(w) = 82w*3 + 7w - 7. Suppose -2c + 23f = 28f - 6, 0 = -3c + 2f - 29. Let z(r) = -41r*3 - 3r + 3. Determine cz(y) - 3d(y). 41y3 Let c(x) = -2. Let h(d) = d + 427. Calculate -4c(z) + 2h(z). 2z + 862 Let s(a) = a*2 + 6. Suppose 4q - 3q = 5. Let g(u) = -42 + 8 - u2 + 17 + 16. Determine qg(o) + s(o). -4o2 + 1 Let z(r) = -19645186r + 71226. Let t(a) = -6619a + 24. Calculate 11871t(w) - 4z(w). 6595w Let a(k) be the first derivative of -k - 2 + 5/2k2. Let f = 32 - 33. Let j(g) = g. Give fa(h) + 3j(h). -2h + 1 Let o(p) = -14p3 + 2p*2 - 193p - 8. Let j(f) = -12f3 + 2f*2 - 192f - 7. Give -6j(m) + 5o(m). 2m3 - 2m*2 + 187m + 2 Let k(q) = 17q. Let s(u) = 431u - 54. Let p(c) = 41375c - 5175. Let t(g) = 6p(g) - 575s(g). Determine -51k(w) + 2t(w). -17w Let d(s) be the second derivative of -s*2/2 - 3236s. Let n(p) = p + 5. Determine 3d(t) + n(t). t + 2 Let q(w) = 9w + 18. Let r be ((-4)/14)/((-248)/868). Let f(c) = 1. What is rq(b) - 18f(b)? 9b Let g(n) = n3 + n2 - 8n - 1. Let d(y) = -334y3 - y2 + 8y - 12. Give d(c) + g(c). -333c3 - 13 Let j(h) = 23h*2 + 5h - 2. Let x(l) = -35l2 - 8l + 3. Let k(d) = 115d + 123. Let p be k(-1). Give pj(s) + 5x(s). 9s*2 - 1 Let o(c) = -4787c*3 - 3c*2 + 3c. Let p(n) = 71800n3 + 44n*2 - 44n. Calculate -88o(u) - 6p(u). -9544u3 Let w(n) = n3 - 3n*2 + 19n. Let g(r) = 4r3 - 10r*2 + 56r + 2. Determine -2g(a) + 7w(a). -a3 - a2 + 21a - 4 Let a(m) = -m3 + 5m*2 + 3m + 5. Let l be 5 - (-37)/((-259)/28). Let w(h) = 1. What is la(y) - 5w(y)? -y*3 + 5y*2 + 3y Let k(g) = -15g2 - 3g. Let x(y) = -27y + 11 + 56y - 11 - 28y. Give k(h) + 4x(h). -15h2 + h Let w(x) = 21x - 17. Let y(b) = 14b - 19. What is -4w(u) + 5y(u)? -14u - 27 Let h(z) = 2z2 - 4z. Let m(b) = 19b2 + 3b + 18b2 - 70b*2 + 31b**2. Give -	{ "pile_set_name": "DM Mathematics" }
a) = 5399a2 + 18a + 19. Let y(h) = -18g(h) + x(h). Let d(n) = 2n*2. What is d(y(l))? 61449698l*4 + 22172l*2 + 2 Let w(t) = -1 + 1 - 8t + 271t2 - 274t*2. Let d(f) = -19f. Determine w(d(u)). -1083u2 + 152u Let o(u) = 15u2. Let f(d) = 151955d*2. Give f(o(g)). 34189875g*4 Let c(j) = -1096j*2. Let t(i) = 10 + 8i + 2 - 2 - 10. Determine c(t(f)). -70144f2 Let u(b) = -162b*2. Let x(w) = 20w + 35. Let z(k) = -11k - 21. Let h(i) = 6x(i) + 10z(i). Calculate u(h(n)). -16200n*2 Let u(w) be the third derivative of 10069w4/24 - w3/6 - 73w2 - 6w - 2. Let z(l) = -l. Give u(z(t)). -10069t - 1 Let m(p) = -4p. Let n(v) = 698 - 6v + 102v + 63v - 690. Give n(m(s)). -636s + 8 Let b(g) = 30g2 - 24g + 24. Let s(r) = -r*2 + r - 1. Let o(v) = 5b(v) + 120s(v). Suppose -7 - 18 = -5f. Let k(u) = -fu + 2u + 7u. Give o(k(l)). 480l*2 Let q(d) be the first derivative of -2d*3 + 2. Let c(i) = -9i*2 + 5i - 25. Let k(t) = -112t2 + 63t - 315. Let j(p) = -63c(p) + 5k(p). Give j(q(u)). 252u4 Let d(w) = 3022w*2. Let m(s) = -6843s. Calculate m(d(k)). -20679546k2 Let m(g) be the third derivative of -g5/30 + 6g*2 + 4. Let q(p) be the second derivative of -95p*3/6 + p. What is q(m(h))? 190h*2 Let g(m) = -876m. Let f(j) = j + 115. Determine f(g(p)). -876p + 115 Let q(g) = -3g*2 + 12. Let d(k) = -2k*2 + 16. Let y(n) = -2d(n) + 3q(n). Let o(x) = -36x*2. What is o(y(p))? -900p*4 + 1440p*2 - 576 Let o(z) = 46317z*2. Let k(f) = -39f*2. Give o(k(m)). 70448157m4 Let b(h) be the second derivative of -h4/6 + h + 12. Let q(m) = -m3 - m2 - 5m - 5. Let i be q(-4). Let z(g) = -g - 8g - 2g - ig. What is b(z(s))? -10952s2 Let d = 370 - 320. Let b(f) = -46f - df + 97f. Let c(i) = 17i2. Calculate c(b(p)). 17p*2 Let u(j) = j + 29. Let v be u(-27). Let h be (-6 - -10)/(v/1). Let c(b) = 12b*2 - 21b*h + 9b*2 + 12b*2. Let o(t) = -4t*2. Calculate o(c(x)). -576x*4 Let y(z) = 2z. Let u(v) = 18611265v. Give y(u(g)). 37222530g Let s be (4 - (-2 + 1)) + 2. Let a = 1 + s. Let w(q) = 13 - aq2 + 17 - 30. Let i(r) = 2r. Calculate i(w(n)). -16n2 Let d(l) = -3l. Let j(u) = -608u + 6798u*2 + 541u + 67u. Determine d(j(g)). -20394g2 Let t(i) = i3 + 4i2 - 3i + 3. Let y be t(-3). Let j(s) = -21s + ys + 9s2. Let w(p) be the first derivative of -4p*3/3 - 9. What is j(w(l))? 144l*4 Let z(h) be the second derivative of 0 + 0h*3 + 0h*2 - 8h - 1/12h4. Let c(d) = -23d + 0 + 0 - 10d. Calculate z(c(x)). -1089x*2 Let h(o) = 6223o*2 - 441o - 147. Let w(x) = -211x2 + 15x + 5. Let a(b) = -10h(b) - 294w(b). Let z(q) = 3q2. What is z(a(c))? 115248c*4 Let y(x) = 21x*2 - 5x*2 + 21x*2. Let i(a) = 245a - 48a - 49a - 51a - 46a - 53a. What is i(y(w))? -74w*2 Let z(o) = 2o - 6. Let s(u) = 6 - 6 - 1247u2 + 1251u*2. What is z(s(l))? 8l*2 - 6 Let s(p) = -2p2. Let r(x) = x3 + 3x2 + x + 4. Let n be r(-3). Suppose n = -2d + 9. Let u(b) = -db2 + b2 + 7b*2 - 8b*2. Calculate u(s(m)). -16m*4 Let a(p) be the second derivative of 11p*4/24 - 71p*2/2 - 285p. Let h(r) be the first derivative of a(r). Let l(v) = -5 + 5 + 3v2. Calculate l(h(o)). 363o*2 Let i(q) = 43129q - 596. Let h(n) = -2n. Calculate i(h(d)). -86258d - 596 Let x(o) = -254o2 - 244o*2 - 247o*2 + 740o*2. Let z(f) = 24f*2 + 3. Determine z(x(n)). 600n*4 + 3 Let z(r) = 3r - 184. Let l(a) = 210a. Calculate z(l(w)). 630w - 184 Suppose -12f - 20 = -16f. Suppose -fh + h + 2204 = 0. Let q(m) = m2 + 551 - h. Let j(y) = -11y*2. Calculate q(j(l)). 121l*4 Let c(v) = -2v. Let k(y) = -2y3 + y2 + 9y + 8. Let l be k(-1). Let r(o) = -204ol + 344o*2 - 258o*2. What is r(c(d))? -472d*2 Let y(a) = 4a*2. Let u(w) = -1201w*2 + 636w*2 + 536w*2. Give y(u(o)). 3364o*4 Let v(g) = 166g*2. Let b(k) = -26716k. Give b(v(s)). -4434856s2 Let z(v) = 23496371v. Let m(a) = 4a. Give z(m(g)). 93985484g Let g(j) = -28j - 2 - 7 + 3 + 5. Let y be g(-1). Let n(w) = 16w - yw + 19w. Let d(z) = -4z2. Give d(n(k)). -256k*2 Let o(h) = 62h*2 + 2. Let s(n) = -474n + 469n - 4n*2 + 6n*2. What is s(o(u))? 7688u*4 + 186u*2 - 2 Let z(x) = -2x. Let k = -363 - -370. Let p(o) = k - 11 + 4 - 283o. Calculate p(z(i)). 566i Let j(f) = -17f + 6. Let m(i) = 407i - 143. Let a(v) = -143j(v) - 6m(v). Let l(w) = -2 - 26w + 23w + 2. Give l(a(u)). 33u Let q(r) = 3r + 4. Let l be 287((-36)/(-3))/3. Let p(s) = -s - 576 + l - 572. Determine q(p(c)). -3c + 4 Let p(f) = 74f2 + 66f + 808. Let g(v) = -9v2 - 8v - 100. Let i(m) = 33g(m) + 4p(m). Let o(c) = -42c. What is i(o(t))? -1764t*2 - 68 Let d(v) = -2v. Let w(l) = 168759040l2 - 238168l - 119084. Let c(a) = -8503a2 + 12a + 6. Let i(f) = -59542c(f) - 3w(f). Determine i(d(k)). 34024k2 Suppose 44 = 5o + 14. Let k(a) = 187a + oa*2 - 187a. Let u(f) = 8f - 12. Let r(b) = -3b + 5. Let t(w) = 12r(w) + 5u(w). Calculate t(k(v)). 24v2 Let y(b) = b2 + 2b - 2. Let i(u) = 55u2 + 132u - 132. Let s(a) = i(a) - 66y(a). Let k(v) = 75v. What is k(s(z))? -825z2 Let o(l) = -33l - 22. Let r(d) be the second derivative of -d*4/12 + 1407d. Determine o(r(s)). 33s2 - 22 Let s(b) be the third derivative of 0 + 0b*3 - 7b*2 + 0b + 1/12b4. Let i(n) be the first derivative of -11n*2/2 + 450. Calculate s(i(d)). -22d Let b(t) be the second derivative of 889t4/6 - t2/2 - t + 62. Let q(p) = 3p*2. Calculate b(q(y)). 16002y*4 - 1 Let m(u) = -774u - 1. Let y(v) = v*2 + 5. Let z(i) = 12i*2 + 55. Let f(q) = -22y(q) + 2z(q). What is f(m(j))? 1198152j*2 + 3096j + 2 Let r(j) = -3 - 7j + 3. Let w(y) = y2 + 4y + 6. Let a(m) = 18m2 + 50m + 75. Let q(f) = 2a(f) - 25w(f). What is q(r(x))? 539x2 Let u(x) = -16x*2 - 15x*2 - 21x*2 - 19x*2 - 21x*2 + 89x*2. Let f(s) = 5s + 4s - 5s. Calculate u(f(r)). -48r2 Let n(q) = 6q*2 - 175. Let b(k) = 2k - 1677. What is n(b(r))? 24r2 - 40248r + 16873799 Let y(l) = 7l2 + 1940. Let d(w) = 247w*2. What is y(d(k))? 427063k*4 + 1940 Let z(s) = 2s. Let o(c) = -46101173c + 2. What is z(o(f))? -92202346f + 4 Let b(q) = -5q. Let t(k) be the first derivative of -65k*4/24 + 145k*2 + 250. Let l(z) be the second derivative of t(z). Calculate l(b(p)). 325p Let j(g) = -2g. Let s(w) = 20261074w. Give j(s(t)). -40522148t Let c(l) = -4 - 3 + 17 - 9 + 4l. Let j(a) = -3a2 - 17a. Let d(p) = p*2 + 6p. Let h(b) = -17d(b) - 6j(b). Give h(c(z)). 16z2 + 8z + 1 Let o be ((-9)/18)/(-2(-2)/(-24)). Let d(z) = -z2 + 4z*2 + oz*2. Let r(j) = 51j*2. Determine r(d(k)). 1836k4 Let d(p) be the second derivative of p4/3 + p. Let h be (-8)/1 + 130 + -120. Let w(t) = -102t2 + 291t*2 - 100t*2 - 97t*h. What is d(w(r))? 256r*4 Let y(d) = 5d*2. Let i be ((-40)/5 - -5)2 - -8. Let h(j) be the first derivative of 0j + 14 - 4/3j*3 + 0j*i. What is y(h(o))? 80o*4 Let q(v) = -17v*2. Let y(h) = 221h - 29598. What is y(q(l))? -3757l2 - 29598 Let v(j) = -4j - 9. Let u(r) = 8r2 + 2r*2 + 19r*2 - 17r*2 + 9r*2. Calculate v(u(i)). -84i*2 - 9 Let g(t) = 7232t*2. Let n(x) be the first derivative of -2x*2 + 12815. Determine n(g(w)). -28928w*2 Suppose -2o + 3a = -99, 4o - 106 - 122 = -4a. Let f(c) = 61c*2 + oc*2 - 181c*2 + 40c*2. Let g(k) = k. Determine g(f(p)). -26p2 Let z(w) = w2. Let p(g) = -174361161g2. Determine p(z(c)). -174361161c*4 Let r(i) = -10i. Let s(k) be the third derivative of -7k6/360 + 15k*3/2 - 96k*2. Let d(w) be the first derivative of s(w). Determine r(d(b)). 70b2 Let y(j) be the third derivative of -j5/60 - 2j2 - 860. Let n(m) = -1466m*2. Determine y(n(c)). -2149156c*4 Let x(g) = -44g. Let y(m) = -1942m2 + 195m - 3. Calculate y(x(b)). -3759712b2 - 8580b - 3 Let q(z) = -11z2. Let t(c) = 2 + 1139151c*2 - 2 - 1139305c*2 - 3c. Determine t(q(y)). -18634y4 + 33y*2 Let m(p) = -29p*2 - 5p. Let y(x) = 22x - 2. Let w(n) = 54n - 5. Let s(g) = 4w(g) - 10y(g). Calculate m(s(v)). -464v2 + 20v Let m(k) = k*2. Let a(g) = -37g**2 - 14 + 4 + 5 +	{ "pile_set_name": "DM Mathematics" }
osest to 26.08 in -1/1147, -0.4, -0.3, -3? -1/1147 Which is the nearest to -0.07? (a) 1/3 (b) 0.1 (c) -3 (d) -0.05 (e) 0.4 d Which is the nearest to -2.24? (a) -3 (b) 13 (c) 0.097 a Which is the closest to -50/11? (a) 66960 (b) -1 (c) -2 (d) 0.1 c What is the closest to -1 in -0.05, -4, 14061, 0? -0.05 Which is the nearest to 0.2? (a) -44084 (b) 5/3 (c) 0 c Which is the nearest to -2/7? (a) 0.4 (b) 2/19 (c) 32 (d) 0.05 (e) 338 d Which is the nearest to -1/66006? (a) 35 (b) 2/5 (c) 1.5 (d) 0 d What is the nearest to -4/3 in 0.18, -1, 7, 31? -1 What is the nearest to -1/633786 in -3, 3, 0.3? 0.3 What is the closest to -0.2 in 2705, 1.2, 7? 1.2 Which is the nearest to 2? (a) -0.2 (b) 1/92 (c) 4/7 (d) -6 c What is the closest to 1 in -96.6, 1, 138, -2/13? 1 Which is the closest to -1? (a) 0 (b) -20 (c) 87022 a Which is the closest to -1401.7? (a) 2/5 (b) -19 (c) -3/5 (d) -1 (e) -1/4 (f) 0 b What is the closest to -2.1 in -0.041, -0.7835, 0.1? -0.7835 Which is the closest to -3426/11? (a) 67.5 (b) -4/7 (c) -1/3 b Which is the nearest to -2/5? (a) -8 (b) -2 (c) 10 (d) 73 (e) -0.708 e Which is the closest to -2/39567? (a) -3 (b) 9 (c) 0.3 (d) 528 c Which is the nearest to 1? (a) -4 (b) 0.1 (c) -2/7 (d) -5 (e) 17 (f) 3319 b What is the closest to 1 in -30/49, -3, 8.7, 0.2? 0.2 What is the closest to -2 in 2.63, 1153, -5? -5 What is the nearest to 0 in -3, 53/2, 0.1, -1350? 0.1 What is the closest to 1 in -10/143, -16, -1/1032? -1/1032 Which is the nearest to 381? (a) -0.52 (b) 0.05 (c) 5 (d) 3/5 c Which is the closest to 0.2? (a) -3 (b) -1/3 (c) 193/329 (d) -10 (e) 1/2 e Which is the closest to -1? (a) -35891 (b) -0.4 (c) -98/3 (d) -2 b Which is the nearest to 1? (a) 2/11 (b) -0.03 (c) 139 (d) 3 (e) 43 a Which is the closest to 0? (a) -1074 (b) 0.5 (c) -3 (d) 1 (e) -30 b What is the nearest to 0.2 in 26307, -78, -1, 2/17? 2/17 What is the closest to 21 in 0.08, 0, -3, 1, -3.862? 1 Which is the closest to -2? (a) -64 (b) -325 (c) -3.71 c Which is the closest to -1.71? (a) 270 (b) -2 (c) 0.3 (d) -65 b Which is the closest to 2/13? (a) 0.03 (b) 2/9 (c) 25 (d) 1/3 (e) -1/8 b Which is the nearest to 2/213? (a) 4347/10 (b) 6 (c) -3 c What is the nearest to 0 in -4.9, -6482, -0.199? -0.199 What is the nearest to 8/47 in -9, 4/3, 3, 0.3, -5? 0.3 Which is the nearest to 2/11? (a) -4 (b) -93.6 (c) -3 (d) -5 (e) 34 (f) 1/42 f Which is the closest to 3? (a) 1 (b) -0.2 (c) 0 (d) -46 (e) -4 a Which is the closest to -3? (a) 0.8 (b) 13.136 (c) -6 c What is the nearest to -3/2 in -0.4, 4109, -8, -2? -2 What is the nearest to 5 in -17996/15, -3/2, 0.9? 0.9 What is the nearest to 0.1 in -5, -3.5, 7, -0.72? -0.72 What is the closest to -1 in -1/29, 2/3, -57/106? -57/106 What is the nearest to -147.8 in 0.3, -12, -4, 0.5, -1/14? -12 What is the closest to 0 in -0.2, 4/677, -2/55, 2329/4? 4/677 What is the nearest to 0 in 1.72, 3450, -1/4? -1/4 What is the nearest to 239 in -0.3, -3, 0.14, 0.4, -2/121? 0.4 What is the nearest to -0.0914 in 109, -16, -0.1? -0.1 What is the closest to 1 in -15358, 13, 16? 13 What is the closest to 0 in -8.1, 2/15, -0.34, -2862, -3, 1/4? 2/15 Which is the closest to 2/105? (a) -0.5 (b) -416/7 (c) 0 (d) 2/15 c Which is the nearest to 3/2? (a) 26624 (b) 2/7 (c) 3 (d) 4 (e) -1/14 b Which is the nearest to 2/5? (a) 1417 (b) 9/3191 (c) -0.4 b Which is the closest to 27? (a) 0.26 (b) 3.2 (c) -1 b Which is the nearest to -2? (a) -8.6 (b) 8/125 (c) 3 (d) -2 d Which is the closest to -0.06? (a) 122 (b) -26 (c) -110 b What is the nearest to 0.1 in -24297, 0.1, 0.5, 5? 0.1 What is the nearest to 1 in -1/4, -0.4, -3.897, -90, -3/2? -1/4 What is the closest to 2.6 in -2/59, -0.3, -4, -1/7, 47/4? -2/59 What is the nearest to -10 in 0.18, 1, -0.2, -3, -0.3, 0.1? -3 What is the closest to 15 in -5, 13, -156/37? 13 What is the closest to 0.24 in -154, -0.5, 5/4? -0.5 What is the closest to -1/12 in 1/73, -5, 3/7, -0.11, -14? -0.11 What is the nearest to -1723 in 3, 7, -2/33, -0.17, 1? -0.17 What is the closest to -142 in 2, 18.19, 4, -5? -5 Which is the nearest to -0.3? (a) -0.03 (b) -5 (c) 2/3 (d) -3.2 (e) -0.254 (f) 7 e What is the nearest to 1 in -4, -0.94953, -0.1, -3? -0.1 What is the closest to -16/23 in 2/9, -1/3, 85, 5, -0.1? -1/3 Which is the nearest to 0.1? (a) 2/5 (b) 4/23 (c) 3/5 (d) -593/2 b Which is the closest to 2/13? (a) 22 (b) -6 (c) 0.1 (d) 2/17 (e) -9.607 (f) 0.2 d What is the nearest to 0.1 in -266, -0.004, -68, 0.2, 5? 0.2 What is the closest to 1/4 in -0.15, 0, 2027, 3? 0 What is the closest to -374853/2 in -9, -2, 1/3, 2/7, -0.3? -9 Which is the nearest to -3.8? (a) -1/4 (b) 0.104 (c) -1.3 (d) -0.05 c Which is the nearest to -0.25? (a) -4 (b) 2/35 (c) 1/9 (d) -0.01 (e) -0.1 e What is the nearest to -27/14 in 4, 3036, -1, -4, -2/13? -1 What is the nearest to -2/17 in -7, -4.1, 185? -4.1 What is the nearest to 1/17 in 0, -1/6, -14, 2.4, 2? 0 What is the closest to -1 in -0.02, -0.5, 3.7, 3/8, -0.7, -12/11? -12/11 Which is the nearest to -0.2? (a) -0.16 (b) 0.2 (c) -1/6 (d) 3/7 (e) -13 c What is the nearest to 2/3 in 3/10, -15, 4/9, -5, -0.1, 4/217? 4/9 What is the closest to 1/10 in 57, 0.2, -496/7? 0.2 What is the nearest to 0.06 in 4/7, 0.3, -6077, 0.028? 0.028 Which is the closest to -1/2? (a) 3 (b) -15/74 (c) -3 (d) -12 (e) -33/14 b Which is the closest to -0.312? (a) -7 (b) 3 (c) 52 (d) 1/3 (e) 82 (f) 0 f Which is the nearest to -4? (a) -4 (b) -2/3 (c) 3 (d) 45 (e) -2429 a Which is the nearest to 10712.49? (a) -4/7 (b) -0.7 (c) 3 c What is the nearest to -0.7 in 1471, 2, -4, -70, -2, 2/17? 2/17 What is the nearest to 0 in -1, -3.924, 0.5? 0.5 What is the closest to -186.16 in 0, 1, 0.3, 86? 0 Which is the closest to -1? (a) -0.3 (b) -1645.3 (c) -0.2 (d) 1/10 (e) -2/5 e What is the closest to 470/13 in -1/18, -3/4, 0.5, 2/11, 2? 2 Which is the nearest to -0.1? (a) 33292/3 (b) 2 (c) 0.209 (d) -0.5 c Which is the nearest to 10? (a) 1/4 (b) 6 (c) -3399 b Which is the nearest to -1? (a) -9 (b) 7/4 (c) 4 (d) -347 (e) 2/5 e Which is the nearest to -0.05? (a) 13.5 (b) -1 (c) 31 (d) 0.5 (e) 1/4 e Which is the closest to 0.2? (a) 1.5 (b) -3/16 (c) 2 (d) -2 (e) -0.1 (f) -887 e Which is the closest to 0.1? (a) 5 (b) -731 (c) -1 (d) 0.1 (e) 270 d What is the closest to -295.3 in -6, 3/17, -4, -3/5, -2/13? -6 Which is the nearest to 5? (a) -11012 (b) -5/6 (c) -0.6 c Which is the nearest to 181252? (a) -6 (b) -5 (c) -2 (d) 2 d What is the closest to -2 in 1, 0.1, 4, 1.27534? 0.1 Which is the closest to 2/3? (a) -7 (b) 0.5 (c) -729/8 (d) 1 (e) 88 b Which is the nearest to 4/5? (a) -13 (b) 0.3 (c) 2/61153 b Which is the closest to -5900? (a) 0.17 (b) 11 (c) -0.8 (d) 0.2 c What is the nearest to 1 in -7/38, 3/8, -3/187? 3/8 Which is the nearest to 2/5? (a) 2/29 (b) 15.15 (c) 6 a What is the nearest to 854088 in 1/11, 1/6, 5, 0.3? 5 Which is the nearest to -1? (a) 0.04 (b) 0.029 (c) -1/4 (d) 1.674 c Which is the nearest to 18? (a) -73 (b) 2/5 (c) 3311 b Which is the closest to 1/2? (a) 8/129 (b) 1/4 (c) 0.2 (d) -0.3 b What is the nearest to -0.1 in -0.5, 5, 70/1653, -0.18, 4? -0.18 Which is the closest to -3? (a) 50 (b) 0 (c) -7/2 (d) 1 (e) 3746 c What is the closest to -0.1 in 3/43, -1.1, -13, -10? 3/43 Which is the nearest to 38? (a) 4/5 (b) -29 (c) -5 (d) 4/1295 a What is the nearest to -13 in 2, 55/4, -95? 2 Which is the nearest to 0? (a) -1481 (b) 0 (c) 13 (d) 1 (e) 0.2 b What is the closest to 105 in -2, -0.5, 0.1, -63? 0.1 Which is the nearest to -0.185? (a) -0.31 (b) 523 (c) 0 a Which is the nearest to -2? (a) -272 (b) -2/5 (c) -177 (d) 2 (e) 0 b What is the nearest to 421.9 in -1, 0.5, 109, 1, 3/4, 5? 109 Which is the nearest to -1? (a) -3/5 (b) -3 (c) 0.12 (d) 3721 (e) -4 a Which is the closest to -1/3? (a) -66821 (b) -4 (c) 0 (d) -0.3 (e) -5 d What is the closest to 1 in 3, 0.12, -2, -3, 60184, -4? 0.12 What is the nearest to -2 in -2/7, -1.807445, -3/2? -1.807445 Which is the nearest to 0? (a) -2/951 (b) 2.9 (c) 82 (d) -1/4 (e) -1 a What is the closest to 5	{ "pile_set_name": "DM Mathematics" }
form x + gi and give x. 4 Rearrange -8t*2 + 10t*3 + 4t - 8t3 - 5t + 2t to the form lt*3 + s + qt*2 + nt and give l. 2 Express -4k - k3 + 0k*2 - 2k*2 + 0k*2 in the form xk + z + jk3 + tk*2 and give j. -1 Rearrange -3 - 1 + 2 + 4r*3 to the form cr*3 + hr*2 + jr + a and give a. -2 Rearrange (35 - 35 - 14v)(-7v2 + v2 - 2v*2) - 2v3 - v2 + v*2 to rv*3 + fv + n + bv2 and give r. 110 Express 6y*3 + y - 4y*3 + 0 - 1 + 0y*3 in the form iy*3 + fy*2 + zy + w and give z. 1 Express (2m3 - 3m*3 - 5m*3)(3 - 3 + 1)(0 + 2 + 0) - m3 + 3m3 - m3 in the form dm3 + gm + pm2 + w and give d. -11 Rearrange -b2 + 2b3 + b4 + b*2 + 0b*2 + 2 - 12b to the form ub3 + h + zb*4 + jb + xb2 and give j. -12 Rearrange (4 - 2 - 3)(19k + 370 - 371 - k) to n + jk and give n. 1 Rearrange 9q2 + 3q*3 - 9q*2 + 27 - 29 to d + hq + rq3 + nq*2 and give d. -2 Rearrange -17u - 2u2 + 17u + (-2u + 6u - 3u)(u - 3u + u) + 6u*2 - 3u*2 - 2u*2 - 2u + 2u - 2u*2 to the form r + bu + hu2 and give h. -4 Rearrange (1 + p2 - 1)(-2p + 5p + 2 - 2p) to the form wp + gp2 + vp*3 + q and give g. 2 Express -14 + 75j + 29 - 15 in the form k + yj and give k. 0 Rearrange (4 + 1 - 4)(4h - 5h - h + (0 + 0 + h)(5 - 1 - 5) + 3h + h - 5h + 7 - 7 + 8h)(-1 + 0 + 2) to r + wh and give r. 0 Express (0 - 3 + 2u + 2)(12u - 3u - u) in the form wu2 + yu + l and give y. -8 Express 1 - 7p2 + 1 + 22p*3 - 3 + 6p*2 in the form up*3 + h + cp*2 + tp and give c. -1 Express -k - 5k + 2k + k as f + ok and give o. -3 Express 1 - 5d*3 + 7d*3 - 3d*3 + d - 5d2 + d4 in the form xd4 + c + id + od3 + wd2 and give w. -5 Express 14 - 22 + j2 - 10 in the form k + sj2 + nj and give k. -18 Express 188l - 223l + 0 + 1 - 2 in the form g + yl and give g. -1 Rearrange (4 + 4 - 5)(-3h + 0h + h)(-2 - 3 + 1) to f + yh and give y. 24 Rearrange -4 - 2u4 + 0u*2 - 2u + 4u + u2 + 2 to the form fu + wu3 + g + lu*4 + bu*2 and give l. -2 Rearrange (2p + 0p - 3p)(3 - 131p*3 - 145p*3 + 238p*3) to ap*2 + r + mp*4 + tp + wp3 and give m. 38 Express (34 - 74 + 27)(0o + 2o - 3o)(8o - 8o + 2o3) in the form so*3 + co + qo2 + io*4 + x and give i. 26 Rearrange 39m*3 - 36m*3 - 3m*2 - 1 - 1 to the form o + sm*3 + qm*2 + nm and give s. 3 Rearrange -c*2 + 3c*2 - 4c*2 + 11c - 5c - 1 to the form m + jc*2 + lc and give m. -1 Rearrange -68i2 - 2 + 67i*2 - 3 to the form hi*2 + ji + v and give h. -1 Express 3 + 3 - 13 + 3 - 5u2 in the form zu*2 + ju + i and give i. -4 Express ((-3 + 6 - 2)(t + 3 - 3) + 5t + 13t + 10t)(-2t2 - t2 + 6t2) as qt + kt3 + gt*2 + m and give k. 87 Rearrange (4 + 3 - 6)(-2d - 2d*2 + 2d) + (-5d + 2d + 4d)(3 - 3 - 2d) - 7d*2 + 3d - 3d2 + 15d*2 to the form jd*2 + ld + t and give l. 3 Rearrange -16n + 13n - n*2 + 6n + 4 to the form xn2 + on + i and give x. -1 Rearrange 13u3 + u + 4 - 4 to the form h + lu + ju3 + au*2 and give j. 13 Express 4s*3 - 2s*3 + 2 + 2s - 3s3 - 7 as f + qs + ts2 + os*3 and give q. 2 Express h + h + 6h + 3 + h - 3 + (0 - 3 + 0)(-h + h - 2h) as gh + m and give g. 15 Express 18245 + 86d*2 - 18245 as y + wd + ld2 and give l. 86 Express (-1 - t + 1 + 2t + 2t - 5t + (t - 3 + 3)(4 - 6 + 3) + 2t - 4t + 0t)(-4t - 2t + t) as a + jt*2 + ht and give j. 15 Express 1 - f3 - f3 - 5f3 + 5f*3 in the form b + gf*3 + df + wf2 and give d. 0 Express (6l - 1 - 3 + 3)(-4l + l - 4l) as s + cl*2 + bl and give b. 7 Rearrange -2m3 + 0m*4 + 2m2 - 76 + 77 + m4 to the form a + nm + bm*2 + wm*4 + dm*3 and give b. 2 Rearrange (d + 2 - 2)(0 - 3 - 5)(0 + 0 - 2)(-2d + 0 + 0) to the form td*2 + y + fd and give f. 0 Rearrange (0d + d + d + (1 + 1 - 3)(36d + 33d - 40d))(3 - 3 - 2d2) to sd*3 + vd + x + wd2 and give s. 54 Rearrange 16 + b2 - 9 - 8 - 4b*3 to the form s + ab + nb2 + db*3 and give n. 1 Express 2 + 54w*2 + 49w*2 - 6w*2 as rw*2 + p + sw and give p. 2 Express (a + 4a - 4a)(-2a + 3a - 3a)(0a + a - 7a) in the form ya*2 + k + ua*3 + za and give u. 12 Express -20 + 5r + 20 + 3r*2 in the form ar + fr2 + b and give f. 3 Express 5 - 5 - 27b*2 in the form j + gb + mb2 and give m. -27 Express (1 - 2 - 4)(-175o4 + 93o*4 + 102o*4) in the form go*3 + s + zo*2 + ro*4 + jo and give r. -100 Rearrange -5f3 + 4f*3 - 20 - 14f*2 - 2 + 13f*2 to the form r + yf*2 + if*3 + cf and give y. -1 Express 0 - 2 + a - 4 - 13 as r + qa and give q. 1 Rearrange 2d - 2d + 317d*2 - 316d*2 + 10 to gd*2 + md + p and give p. 10 Rearrange (-2t - 3t + 4t)(0t + t + 11t) + (-1 - 3 + 5)(-4 + 4 - t2) to the form b + pt + kt2 and give p. 0 Rearrange (-166 + 70 + 77)(y2 + y2 + 0y2) to the form jy*2 + c + zy and give j. -38 Express (0 + 4 + 0)(-2 + 3 - 2)(-90 + 90 + 7q) as xq + d and give x. -28 Express 4 - 7m2 + 2m - 3m - 3m*2 in the form t + wm + xm2 and give x. -10 Rearrange i3 - 4 + 22i + i*2 - 21i - i3 - i3 to di + wi*3 + pi*2 + x and give w. -1 Rearrange ((3 - 3 + 2)(0 - 1 - 1) + 1 - 5 + 2)(-2 + 2 + 3q)(3q3 - q3 - 4q3) to the form tq + lq3 + sq*2 + jq*4 + x and give j. 36 Rearrange -17n*3 + 8n*3 - 8n*2 + 11n*3 to the form b + mn*2 + un + rn3 and give r. 2 Express -7o*4 + 8o*4 - 1 + 8o + 10o2 - 10o + 14o2 in the form ho + ao2 + c + go*3 + mo*4 and give c. -1 Rearrange (58v*3 + 1 - 8v*3 + 0)(0 + 0 - v) to nv3 + cv*4 + mv + bv2 + y and give m. -1 Express -5 - b - 2b*2 + 8b - 7b as f + mb + cb2 and give f. -5 Rearrange q3 + 6q*2 + 5q*3 - 4q2 - q2 to the form jq + b + rq*2 + kq*3 and give k. 6 Rearrange 0y3 - y3 + 3y3 + (-2y - y*3 + 2y)(-1 + 3 - 4) - 3y*2 - 5y*3 - 8y*3 + y + 8y*3 to the form d + hy*2 + wy + cy3 and give w. 1 Rearrange r2 - 112 + 112 + 2r*3 + 3r*4 to kr + j + ur3 + vr*4 + sr*2 and give s. 1 Express (1 + 0 + 2)(-87 + 87 - 12g) in the form rg + i and give r. -36 Rearrange 13f + 8f*2 + 2f*2 + 2f*3 - 9f*2 to mf*2 + cf + sf3 + i and give m. 1 Express 0x + x*3 + 6x*4 - 1 + 3 - 4x*4 + 2x as dx3 + bx + px2 + h + ox*4 and give b. 2 Rearrange 1 - 3 - z + 9z*2 - 5 + 4 to uz + y + wz2 and give u. -1 Express i - i + i in the form l + ri and give r. 1 Express -5 + 5 + 6w2 + (-1 + w + 1)(3w - 3w - w) in the form ow + v + yw*2 and give y. 5 Express 1530 - 1530 + 89l*2 + 31l*2 in the form jl + cl2 + g and give c. 120 Express 0z*2 + z - 2z - 2z2 - 4 - z3 - 2z*4 + 0z*3 in the form rz*4 + hz + yz3 + u + gz*2 and give u. -4 Express 2m*2 + 4m*2 + 3 - 5 + 6 as gm + r + km2 and give r. 4 Express -2p4 - p3 + 13p - 1 - 1 - 11p as yp4 + sp*3 + fp*2 + g + up and give y. -2 Express (-6l - 3l + 4l)(2 - 2 + l)(-4l*2 - 9l*2 + 2l*2) in the form u + ql*3 + cl*4 + yl*2 + xl and give c. 55 Rearrange 16w2 - 9w*2 + 9w*2 to j + qw*2 + yw and give q. 16 Rearrange (10i2 - 6i*2 + 25i*2)(0i2 + 5i*2 - 3i*2) to x + li*3 + ci*4 + ri + bi2 and give c. 58 Rearrange (-3 + 5 + 1)(-3h4 - 5h*4 + 3h*4) to the form lh + y + dh4 + vh*3 + wh*2 and give d. -15 Rearrange -3p*3 + 14p - 31p + 13p - 2 to q + dp + wp*2 + mp3 and give m. -3 Rearrange -d3 + 0d4 - 2d - 28d2 - 4d*4 + 29d*2 + 2d*4 to the form od*4 + nd*2 + td*3 + i + zd and give o. -2 Express 11p2 + 50p - 50p - 3 in the form qp*2 + m + ip and give m. -3 Express -2s2 + 0s2 - s2 - 3s2 + 2s*2 - 2s*2 + (-2s - s + 5s)(0s - 2s + s) - 5s2 + 2s*2 + 2s*2 as zs + j + ds2 and give d. -9 Express -12 - 14x + 27x - 12x in the form fx + c and give f. 1 Rearrange (v - 3v + 4v)(6 - 2 - 2) - v + 6v - 3v + (v - v + v)(-4 + 2 + 1) - 2v + 3 - 3 + 7v + 3v + 6v to the form z + xv and give z. 0 Rearrange 2t3 - t4 + 9t + 2t*3 -	{ "pile_set_name": "DM Mathematics" }
51702 Multiply 947 and -94. -89018 Product of 150908 and 0.003. 452.724 Calculate 0.2161993. 13018.53 Multiply -7 and 0.42019. -2.94133 Calculate -1.940.1018. -0.197492 Multiply 1.35 and -2328. -3142.8 Calculate -0.087.377. -0.59016 Product of 6 and -282.5. -1695 Work out 3 -0.02979. -0.08937 Product of 291 and 0.321. 93.411 Work out -16.442 * 12. -197.304 -0.1214 * -0.14 0.016996 What is -2180 times 26? -56680 Calculate 6881240.4. 275249.6 Multiply -199257.7 and -5. 996288.5 Work out 22 -1254.87. -27607.14 -1-114889 114889 -2 times -0.274442 0.548884 -21981 0.4 -8792.4 Product of -112 and -1550. 173600 What is 0.4 times 89.6? 35.84 Multiply 366.4 and 0.05. 18.32 Multiply -3447 and 0.46. -1585.62 What is -51 times 43.7? -2228.7 659 * -12 -7908 Product of 3.21 and 2311.8. 7420.878 3 times -1812 -5436 Calculate -494616. -79136 Product of -843683 and 0.5. -421841.5 4 -821122 -3284488 What is the product of 271885 and -0.2? -54377 0.478 * -40 -19.12 0.5 times 6736.8 3368.4 Product of -0.6 and -0.15417. 0.092502 Product of 0.192 and 360.8. 69.2736 What is -0.3 times 0.48517? -0.145551 -44548 times 44 -1960112 Multiply -24 and 3732. -89568 What is 0 times 14865? 0 Multiply -0.155 and 8.56. -1.3268 Calculate 275-798. -219450 What is the product of -0.008 and 571? -4.568 Multiply -0.4 and -5.86799. 2.347196 Multiply 0.716 and -3.9. -2.7924 Multiply -1454 and -0.57. 828.78 What is 13610 times 0? 0 770 -564 -434280 Product of -1925 and 0.24. -462 45042-0.2 -9008.4 What is the product of -14058 and -16? 224928 What is -2.9 times 0.05742? -0.166518 Work out -3 -0.0223363. 0.0670089 Work out 0.6418 * 8.3. 5.32694 Product of -0.00145 and -229. 0.33205 Work out -57 * 0.187. -10.659 Multiply -0.09 and -9956. 896.04 Multiply -4 and -18421. 73684 What is the product of -85863 and -21? 1803123 Product of 581488 and 0.04. 23259.52 Calculate 1825410. 182540 Product of -6119 and 89. -544591 Product of -0.36132 and 0.3. -0.108396 What is the product of 4.5 and 14.2? 63.9 What is the product of -1.777 and -387? 687.699 Calculate -1.7399-2.6. 4.52374 What is 558 times -14? -7812 -295.8-0.27 79.866 What is the product of -3 and -315794? 947382 -300 -0.169 50.7 1365.76 times 5 6828.8 Multiply -181.2 and 1.1. -199.32 Multiply -0.1 and -49959. 4995.9 Work out 391.8 * 1. 391.8 What is the product of 8 and 0.00364? 0.02912 Calculate 22.1550. 12155 What is 1600 times 0.08? 128 -4 -216562 866248 0.042-9.9 -0.4158 Work out -0.079 -16053. 1268.187 Work out 210211 * 0.04. 8408.44 Product of 1593.1 and -4. -6372.4 0.23 * 3149 724.27 Calculate 346.30.4. 138.52 What is -808 times 503? -406424 46.2 times -315 -14553 Work out 0.0453 3703. 167.7459 -12665 times 71 -899215 -49-0.288 14.112 -1154 -1.91 2204.14 Multiply 0.44114 and 3. 1.32342 -3.2 * 92.8 -296.96 2237-0.6 -1342.2 Calculate -64836-0.3. 19450.8 What is the product of -8140 and 5? -40700 Work out 0.012164 * -1.9. -0.0231116 Work out -0.5 * -66005. 33002.5 What is 926 times 0.01? 9.26 0.7 * 6441.3 4508.91 43.33124 13.32496 Calculate 233056. 70288 Product of -100 and -2.93. 293 Work out -1 * 2.7033. -2.7033 Multiply 0.07342 and 9. 0.66078 Calculate -0.0724660. 0 Work out 96 -237.5. -22800 627179 163074 -1569890 times 0 0 Calculate -13334-3. 40002 Multiply -840.66 and 2. -1681.32 What is the product of 520.91 and -0.2? -104.182 Work out 14 * -1968. -27552 -0.3 * -2375 712.5 Work out 0.044956 * -0.1. -0.0044956 What is -150 times -942? 141300 62438 27156 50027 -27 -1350729 -0.110.007676 -0.00084436 Calculate 0.018-0.00554. -0.00009972 -0.6 times 0.05313 -0.031878 What is -1.72 times 4021? -6916.12 Calculate -25-373. 9325 What is -0.4 times -80312? 32124.8 Work out 10 108309. 1083090 Product of 327079 and -0.5. -163539.5 Calculate 6411440. 923040 Work out 1 41.974. 41.974 Work out -2124.4 * 33. -70105.2 -0.1039 * -7 0.7273 15235.97 3539.55 What is the product of 0.1 and -63? -6.3 Multiply -3 and -4986. 14958 -26.667 times -2 53.334 -0.16-127 20.32 Work out -0.3 * -200462. 60138.6 What is the product of 3 and 768906? 2306718 2 * 0.0587674 0.1175348 What is the product of -0.14 and -463.03? 64.8242 5627 times -0.3 -1688.1 1.7399 * -0.3 -0.52197 What is the product of 8.1 and 16.94? 137.214 What is -13.3 times -15? 199.5 0.02283.572 5.67144 What is -4 times -1228665? 4914660 What is -8402 times 6? -50412 Calculate 1137.061. 1137.06 0.345971 13791.3 What is 2 times 1.22685? 2.4537 Multiply 4199 and -0.12. -503.88 What is 301.885 times 4? 1207.54 What is 18.57 times 3.1? 57.567 What is -0.4 times -1668.61? 667.444 What is the product of -14909.7 and 2? -29819.4 Calculate -3197-61. 195017 Multiply 14.878 and 0.4. 5.9512 470 * 240 112800 Product of 4345 and 21. 91245 29 times 6924 200796 111 * 0.871 96.681 Product of -72060 and 14. -1008840 -5573 * 1.96 -10923.08 What is the product of 0.015 and -1283.72? -19.2558 What is 5155 times 2? 10310 818.42 times 4 3273.68 Work out 7287 * 3.4. 24775.8 What is 0.000817 times 0.9? 0.0007353 3547326 1641978 -6 times 25946 -155676 Calculate 30090-0.042. -1263.78 355299 times 0.5 177649.5 -0.1-136.68 13.668 -0.50.33499 -0.167495 Product of -8.1 and -1.152. 9.3312 Calculate 0.30580.15. 0.04587 What is 21300 times 1.35? 28755 Multiply 4.6 and -0.6988. -3.21448 Product of -9 and -0.39872. 3.58848 13231 -0.01 -132.31 -953.5 * -0.2 190.7 What is the product of -3944 and -0.064? 252.416 What is the product of -1560 and -10? 15600 -9.12374 -36.4948 284.47-0.2 -56.894 Multiply -14.929 and 13. -194.077 Multiply -4 and 46. -184 Product of 0.343 and 0. 0 What is the product of 0.1057 and 413? 43.6541 Product of 0.08 and 2.797. 0.22376 What is -0.4 times -133472? 53388.8 What is 7.275 times 0.15? 1.09125 Multiply 514.46 and 3.9. 2006.394 What is -7 times 3458.2? -24207.4 Work out -285498 * 1. -285498 Work out -185.94 * 7. -1301.58 Multiply -0.06 and 5.05. -0.303 What is the product of -553747 and -9? 4983723 What is 158989 times 0? 0 Calculate -0.918581.2. -1.102296 What is the product of 9138 and 0.1? 913.8 Product of 0.065 and 259. 16.835 Product of 0.01716 and 1007. 17.28012 What is -9 times 0.159? -1.431 -0.155 11.13 -1.72515 963 times -659 -634617 Calculate 0.5-0.158284. -0.079142 Calculate 41307039. 5228156 161940 times 0.3 48582 -20.5 -1 What is 1.1 times -1101? -1211.1 Calculate 10.8319. 3445.2 -4 times 303 -1212 What is -3575 times 19? -67925 What is the product of 0.791031 and 0? 0 Multiply 2.2 and -1.93. -4.246 Multiply -13760 and -63. 866880 Product of 26.69 and 15. 400.35 Multiply -0.3 and -522048. 156614.4 What is the product of -0.2 and 0.10397? -0.020794 What is the product of 0.67 and 3255? 2180.85 126-113.1 -14250.6 Work out -15 323.8. -4857 13.73 times 399 5478.27 What is the product of -101287 and 5? -506435 3 times 5760 17280 Product of -3 and 0.8772. -2.6316 Work out -219.36 * 0.17. -37.2912 What is the product of -0.012 and 2702? -32.424 What is the product of 0.01 and 542.52? 5.4252 Multiply -0.04 and -7813. 312.52 What is -0.6 times 0.6426? -0.38556 Product of -0.03 and 22553. -676.59 What is the product of -265964 and 3? -797892 What is -47.385 times 1? -47.385 -0.255752 -11150.4 What is the product of -3.325 and 19.6? -65.17 Multiply -4 and 673.335. -2693.34 0.1 9.81 0.981 -655 * 0.9 -589.5 Work out -6 * 0.5555. -3.333 28 times 12933 362124 What is the product of -0.4 and -62? 24.8 What is the product of -5.4 and -202.886? 1095.5844 Multiply -16618.4 and -4. 66473.6 Product of -1.126 and 5.4. -6.0804 1.85050 9090 What is the product of -75.715 and 2.4? -181.716 -27025.6 -6912 Work out 29 * 0.11281. 3.27149 0.22 * 1876.9 412.918 What is the product of 52.51 and -0.5? -26.255 Work out 175 * -0.202. -35.35 -39 * 159 -6201 3 * -4541 -13623 Work out 0.867 * -43.1. -37.3677 1266990 * 0.1 126699 0.072-126.6 -9.1152 Multiply 2237 and -1.46. -3266.02 Product of -35.843 and -17. 609.331 73.38-0.4 -29.352 Work out -19946 * 0.11. -2194.06 Multiply -287.7 and -4. 1150.8 Multiply -0.067335 and 0.28. -0.0188538 -0.27 * -0.04 0.0108 Work out -4 * 146.8. -587.2 Work out 0.2 * 51.33. 10.266 -1027245 * -2 2054490 Calculate -0.5062230.4. -0.2024892 Work out 0.4 428.64. 171.456 Product of -251 and 16. -4016 -81	{ "pile_set_name": "DM Mathematics" }
out replacement from {v: 2, e: 1, l: 1, i: 13}. Give prob of sequence iiv. 13/170 Two letters picked without replacement from {h: 2, e: 1, q: 14, b: 2}. Give prob of sequence bh. 2/171 What is prob of sequence psc when three letters picked without replacement from {c: 1, p: 2, u: 9, s: 7}? 7/2907 What is prob of sequence xtx when three letters picked without replacement from bdttiwxtxwx? 1/55 Four letters picked without replacement from {b: 4, z: 4, x: 3}. Give prob of sequence xxzz. 1/110 Four letters picked without replacement from ccgfyuqfgcqu. What is prob of sequence qcqu? 1/990 Three letters picked without replacement from {l: 11, g: 5}. What is prob of sequence ggl? 11/168 What is prob of sequence vo when two letters picked without replacement from {o: 1, i: 2, s: 2, j: 1, v: 2, w: 1}? 1/36 Calculate prob of sequence rni when three letters picked without replacement from {f: 1, i: 7, r: 2, n: 4}. 1/39 Three letters picked without replacement from {f: 1, m: 3, r: 3, x: 3, p: 2, b: 1}. What is prob of sequence fpx? 1/286 Two letters picked without replacement from ydhdhyhyyhh. Give prob of sequence hy. 2/11 What is prob of sequence ff when two letters picked without replacement from effm? 1/6 Three letters picked without replacement from vvvfvvvf. What is prob of sequence fvf? 1/28 Calculate prob of sequence cgrc when four letters picked without replacement from {r: 2, c: 2, g: 5}. 5/756 Two letters picked without replacement from oxcuoubeb. What is prob of sequence ox? 1/36 Two letters picked without replacement from {d: 5, l: 5, s: 2, y: 3, f: 4}. Give prob of sequence yf. 2/57 Three letters picked without replacement from nnxn. Give prob of sequence xxn. 0 Three letters picked without replacement from {g: 8, k: 4, x: 5}. What is prob of sequence kxk? 1/68 What is prob of sequence jjjz when four letters picked without replacement from zzjzzjjzzj? 1/35 Calculate prob of sequence cwl when three letters picked without replacement from {w: 6, l: 5, m: 4, c: 1}. 1/112 Three letters picked without replacement from rkk. Give prob of sequence kkr. 1/3 Three letters picked without replacement from {d: 2, r: 2, w: 11, u: 4}. What is prob of sequence dww? 110/2907 Four letters picked without replacement from jikiekjikkqkikui. What is prob of sequence iukk? 5/1456 Three letters picked without replacement from qcqccqcqcccccqcccc. Give prob of sequence qqq. 5/408 Calculate prob of sequence gfm when three letters picked without replacement from {f: 1, m: 3, r: 2, w: 4, g: 1, h: 1}. 1/440 What is prob of sequence ccqc when four letters picked without replacement from cccccccqqcc? 7/55 Three letters picked without replacement from {f: 2, s: 2, e: 4}. What is prob of sequence sfs? 1/84 What is prob of sequence yffc when four letters picked without replacement from {y: 5, r: 10, c: 2, f: 3}? 1/1938 Three letters picked without replacement from {n: 3, d: 7, f: 2}. Give prob of sequence ndn. 7/220 Three letters picked without replacement from czzrrqqx. Give prob of sequence zrr. 1/84 What is prob of sequence ff when two letters picked without replacement from {f: 2, r: 2, m: 11}? 1/105 What is prob of sequence oto when three letters picked without replacement from obtorirt? 1/84 Three letters picked without replacement from gvjvej. Give prob of sequence jvg. 1/30 Calculate prob of sequence ajjc when four letters picked without replacement from {r: 1, j: 2, c: 2, a: 2, v: 1, z: 4}. 1/1485 Three letters picked without replacement from lljlllllljlljll. Give prob of sequence jlj. 12/455 Three letters picked without replacement from wdpalpwopwdwowlppoww. Give prob of sequence ooa. 1/1140 Two letters picked without replacement from iihhhhhhhihhhhhiihi. What is prob of sequence hi? 13/57 Calculate prob of sequence sf when two letters picked without replacement from fssfsff. 2/7 Calculate prob of sequence ss when two letters picked without replacement from qsbssssssqsqqqssss. 22/51 What is prob of sequence nnii when four letters picked without replacement from innnnni? 1/21 Two letters picked without replacement from fmffffnnfnmnf. What is prob of sequence mn? 2/39 Three letters picked without replacement from {d: 1, y: 2, l: 1}. What is prob of sequence ldy? 1/12 Two letters picked without replacement from uuufuxxffftkkhfxk. Give prob of sequence fk. 15/272 Calculate prob of sequence shb when three letters picked without replacement from dhdddbddeswsdd. 1/1092 What is prob of sequence rr when two letters picked without replacement from {r: 16, x: 4}? 12/19 Calculate prob of sequence wc when two letters picked without replacement from {w: 3, u: 3, a: 7, c: 2}. 1/35 What is prob of sequence cnn when three letters picked without replacement from cncncnnnccnnnnnn? 55/336 Two letters picked without replacement from vzuvzd. What is prob of sequence zd? 1/15 Calculate prob of sequence aia when three letters picked without replacement from {i: 1, a: 2, b: 2, z: 1, g: 2}. 1/168 Three letters picked without replacement from ppllllpppplp. What is prob of sequence ppl? 7/44 Four letters picked without replacement from {o: 8, s: 4, n: 3, k: 1, u: 1}. What is prob of sequence oous? 1/255 What is prob of sequence lx when two letters picked without replacement from mwkxkxlskxwx? 1/33 What is prob of sequence ry when two letters picked without replacement from qrqytdt? 1/42 What is prob of sequence bedm when four letters picked without replacement from dbmbeebebmcbdmmbm? 3/952 Two letters picked without replacement from {r: 14, t: 5}. Give prob of sequence tr. 35/171 Two letters picked without replacement from bffhffhfhxxxfhbt. Give prob of sequence xb. 1/40 Two letters picked without replacement from {y: 6}. Give prob of sequence yy. 1 Four letters picked without replacement from nnxxxnxnnnnxnxxnnnn. What is prob of sequence xnnn? 385/3876 Three letters picked without replacement from bnenbbbbeebejeeebee. Give prob of sequence bnb. 14/969 Two letters picked without replacement from {y: 2, k: 2}. What is prob of sequence ky? 1/3 Two letters picked without replacement from pkpppkpppkpkk. What is prob of sequence kk? 5/39 Three letters picked without replacement from {r: 3, j: 1, h: 1}. What is prob of sequence rjh? 1/20 Three letters picked without replacement from fnlddfddfldddfddndfl. What is prob of sequence lnf? 1/228 What is prob of sequence bb when two letters picked without replacement from bbb? 1 Four letters picked without replacement from llmmlll. What is prob of sequence lllm? 1/7 What is prob of sequence do when two letters picked without replacement from {d: 8, y: 1, o: 4, g: 2}? 16/105 Three letters picked without replacement from {z: 2, u: 1, p: 1, m: 4}. Give prob of sequence muz. 1/42 What is prob of sequence kfk when three letters picked without replacement from ifikikkkif? 1/30 What is prob of sequence rk when two letters picked without replacement from {k: 2, e: 1, c: 1, y: 2, r: 1, u: 1}? 1/28 Three letters picked without replacement from {b: 11, x: 5}. What is prob of sequence xxb? 11/168 Two letters picked without replacement from hinfuufj. What is prob of sequence ij? 1/56 Two letters picked without replacement from zuyuecesz. What is prob of sequence ze? 1/18 Calculate prob of sequence qq when two letters picked without replacement from qqrsrqqsysc. 6/55 Two letters picked without replacement from {j: 1, a: 9, r: 1, u: 8}. What is prob of sequence ja? 1/38 Calculate prob of sequence fgf when three letters picked without replacement from {f: 7, g: 6}. 21/143 What is prob of sequence tc when two letters picked without replacement from {c: 1, t: 2, r: 1, a: 1, g: 2, d: 1}? 1/28 Two letters picked without replacement from devrm. What is prob of sequence er? 1/20 What is prob of sequence lol when three letters picked without replacement from lovvslv? 1/105 What is prob of sequence mrrh when four letters picked without replacement from {m: 7, h: 4, r: 2, k: 1}? 1/429 Two letters picked without replacement from {b: 9, y: 11}. What is prob of sequence yb? 99/380 Two letters picked without replacement from {i: 3, y: 2, c: 1, s: 1}. Give prob of sequence ic. 1/14 Two letters picked without replacement from {a: 1, l: 2, b: 4}. Give prob of sequence ll. 1/21 What	{ "pile_set_name": "DM Mathematics" }
alue? (a) t (b) 3 (c) -0.3 c Let l(o) = -o*2 + o + 4. Let s be l(0). Suppose -3 = 5j - 2f, 2j + 2 = -j + f. Let u = 2 + j. Which is the second biggest value? (a) u (b) -2/13 (c) s a Let k = -928 + 932.09. Let z = k + -0.09. Which is the second biggest value? (a) -5 (b) z (c) -0.3 c Let y = -5.14 - -0.14. Which is the fourth biggest value? (a) 4 (b) y (c) -4 (d) 0 b Let b(y) = y + 2. Let c be b(-5). Let z be -1 - 2-1 - -1. Let k be z/c(-1)/(-2). What is the smallest value in k, -0.3, 0.1? k Let f = -0.06 - 0.44. Let z = -1.6 - -2. Let s = 0.3 - z. What is the second smallest value in s, 3, f? s Let z = 1.96 - -0.04. Let j = z + -6.5. Let s = -5 - j. Which is the third smallest value? (a) s (b) 4 (c) -1 b Let f(k) = -1 - k + 0k - 11. Let m be f(-10). What is the biggest value in 3, 4, m? 4 Let p = 0.95 - 1.35. Which is the second biggest value? (a) 23 (b) 0.5 (c) p b Let q = -69 - -68.5. Which is the third biggest value? (a) -1.2 (b) q (c) 1/5 a Let j = -92 - -90. What is the biggest value in -3, j, 0.2? 0.2 Let u = -21.5 + 26.5. Let l = 1 + -3. Which is the third smallest value? (a) u (b) 2 (c) l a Let x = 3 + -8. Let j be 0 - (-60)/(-16) - -4. What is the smallest value in j, x, 1? x Let n = -10 + 9.4. Let q = -0.3 - n. Which is the third biggest value? (a) -2/5 (b) 3/2 (c) q a Suppose -3j + 5f = 17, -3j - 3f = -f + 10. What is the second smallest value in -3, 3, j? -3 Let o be (-5 - -6) + -3 + 11/6. Let s be 1 + (-24)/(-14) - 3. Which is the second smallest value? (a) o (b) 1/3 (c) s a Let p = -0.11 + 0.41. Which is the third biggest value? (a) p (b) -1 (c) -2/3 b Let m be (6/8)/(7 - 1/1). What is the third biggest value in 1, m, -2, -4? -2 Let z = -125 - -623/5. Let g = 11.5 - 11. Which is the smallest value? (a) z (b) -1/5 (c) g a Let g = 0.274 + 0.126. Which is the smallest value? (a) -5 (b) -3/14 (c) g a Suppose -7m = 22 - 57. Let s = -3 + 2.9. Let o = 0.3 + -0.2. Which is the third smallest value? (a) s (b) m (c) o b Let n be ((-21)/(-9))/((-1)/3). Let g(h) = -h - 4. Let q be g(-4). Let s be -2 + q + (0 - n). What is the third biggest value in s, 2, 5/3? 5/3 Let i = -0.08 + -0.32. What is the second biggest value in -1/2, i, 0.5? i Let q = 5 + -3. Suppose 5v - 58 = 562. Let w = 493/4 - v. What is the third biggest value in -2, w, q? -2 Let q = -5 - -5.4. Let w = q + -0.9. What is the second biggest value in -0.3, w, 3? -0.3 Let v = -1 + 1.1. Let q = -3/1258 + 8499/3145. Let h = q - 223/90. What is the third biggest value in 1/3, h, v? v Let m(q) = -5q + 14. Let b be m(4). What is the second smallest value in b, -2/5, -1? -1 Suppose -3u + 12 = u. Suppose u = -d + 5. What is the second smallest value in d, 0, 5? d Let q = 3.38 + 0.12. Let i = q - -0.5. Which is the biggest value? (a) i (b) 0 (c) -0.1 a Let v = -50 + 55. Let q = 16/11 + -85/66. Which is the second biggest value? (a) -5 (b) q (c) v b Let f = 849/77 - 126/11. Let j = -46/3 + 15. Which is the third smallest value? (a) 3 (b) f (c) j a Let m(k) = k3 - 14k*2 + 12k + 18. Let s be m(13). Which is the fourth smallest value? (a) -2 (b) -1/4 (c) s (d) 0 c Let t = 0.15 - -4.15. Let o = t - 0.3. Which is the third biggest value? (a) -3 (b) -4 (c) o b Let p be ((-8)/28)/2(0 - -3). Let x = -7 - -2. What is the biggest value in x, p, -0.2? -0.2 Let x = -0.2 + 0.12. Let j = x - 0.22. Suppose k + 4 = 0, 2l + 3l = -5k - 15. Which is the second smallest value? (a) -3 (b) j (c) l b Let i be (-10)/20 - 5/2. Which is the smallest value? (a) i (b) -0.6 (c) -5 c Let z(o) = o*2 + 11o - 15. Let c be z(-12). What is the third biggest value in -0.5, c, 1? c Let u = -0.2 + 0.1. Suppose 2 - 12 = 5p. Which is the smallest value? (a) u (b) p (c) 5 b Suppose -4t + 3t + 1 = 0. Let z be (-18)/24 + (t - 0). Which is the third smallest value? (a) -0.2 (b) -5/6 (c) z c Let s = 144 - 428/3. Let p = 11 - 7. Let o be (-2)/p4/(-13). What is the second biggest value in 0.1, o, s? o Suppose 0 = -9y + 15y + 6. What is the second smallest value in y, 0.2, 5? 0.2 Let q = 0.3 - 0.1. Suppose 0 = 10u - 8u + 10. What is the second biggest value in q, 1/2, u? q Let h = 0.7 - 1. Let q = -3 + 3.04. Let z = q - 3.04. What is the third smallest value in h, 3, z? 3 Let w = -26.4 - -26. Let m = 7380/17 + -434. Let p = -3 - 2. Which is the third smallest value? (a) p (b) w (c) m c Let f be (9/(-18))/(-4 + (-22)/(-6)). Let u = 0.3 - 1.3. Which is the second smallest value? (a) u (b) 0.2 (c) f b Let n be (3/(-21))/(-2 + 1 + 0). Which is the third biggest value? (a) n (b) -5 (c) -4 (d) -3 c Let c = -41 - -39. What is the biggest value in c, -10, 1/9? 1/9 Suppose -62 = -6r + 4. Let s = -10 + r. What is the second smallest value in -0.3, -3/5, s? -0.3 Let c = -114/301 + 4/43. What is the third biggest value in c, -1, 4? -1 Let x = -9.7 - -0.7. Let k = x - -8. What is the third smallest value in 1/6, k, -0.1? 1/6 Let a = -2.63 + -0.37. Let w be (-2 - 9/(-3))3. What is the second smallest value in w, 4, a? w Let v = -88/9 - -731/72. Let s = -18 + 13. Let f = s + 4. What is the smallest value in v, -2, f? -2 Let i = 15 - 14.76. Let y = i - -0.03. Let m = -0.03 - y. Which is the biggest value? (a) m (b) -0.4 (c) -1 a Let l = -5 - -11. Let y = -10 + l. Suppose 4 - 3 = -3j + 2s, 0 = 2s - 4. Which is the smallest value? (a) -0.4 (b) y (c) j b Let z = 55 - 52.1. Let j = z + 1.1. What is the second smallest value in 2/13, 0.5, j? 0.5 Suppose u + 4u = 20. Suppose -uy + p = -0p - 22, 18 = 2y - 4p. Let v = 59/3 + -21. Which is the third smallest value? (a) v (b) 3 (c) y c Let n = 3.99 - 4. Let w = -0.51 - n. What is the second biggest value in -2/5, w, 0? -2/5 Let h = -303 - -1221/4. What is the biggest value in -6/11, 0.3, 1, h? h Suppose -2x - 5o = -20, -2x + 4x - 18 = -4o. Suppose -6 - 9 = xu. Which is the biggest value? (a) 0.5 (b) -2/3 (c) u a Let i = 2.3 - 2.16. Let x = -0.04 + i. Let j = 76/15 - 17/3. Which is the biggest value? (a) j (b) -0.4 (c) x c Let w = 0.95 - 0.9. Let f = w + 0.35. Which is the third smallest value? (a) f (b) 1 (c) 0 b Let p = 44.5 + -45. Which is the biggest value? (a) p (b) -1/16 (c) -4 (d) 3/4 d Let i be 41/13 + (2 - 5). Which is the smallest value? (a) -1/2 (b) 0.5 (c) i a Let j = -59 + 60. Which is the fourth smallest value? (a) 4 (b) j (c) -0.3 (d) -0.4 a Suppose 2t + 4 = -0. Let j be (-39)/(-105) + t/(-10). Let o = 0.8 + -1. Which is the biggest value? (a) o (b) 5 (c) j b Let s = 60 + -57.3. Let j = 3 - s. What is the third smallest value in -2/5, j, 1? 1 Suppose 3u - w + 1 = 0, -2w = -3w + 4. Let q be (-3)/(-3) + u + -1. Let f be (q/(-2))/((-12)/32). Which is the third biggest value? (a) 1 (b) f (c) 0.3 c Let x = 9 - 5. Let l(d) be the second derivative of d*3/2 - 9d2/2 - d. Let u be l(4). Which is the smallest value? (a) x (b) -2 (c) u b Let r(h) = h2 + 8h + 7. Let i be r(-7). Suppose 5y + x - 4x = -129, i = -5y - x - 117. Let o = y + 51/2. What is the biggest value in o, 4, 0.4? 4 Let h = 8 - 6. Let r = -13 - -8. Let n = -5 - r. What is the smallest value in 1, n, h? n Let f = 10.13 - 0.13. Let n = 6 - f. Which is the third smallest value? (a) -0.5 (b) -3 (c) n a Let i(z) = 2z - 1. Let f be (-2)/(-5) - (-65)/25. Let s be i(f). What is the biggest value in s, 1/3, 0.1? s Let m = -6 - -6.4. Let o(n) = -4n + 5. Let g be o(2). Let b be 4(106/36 + g). What is the third smallest value in b, m, 3? 3 Let m = 3.01 - 0.01. Let q = 3 + -1. Let x = q + -1. What is the second biggest value in -0.3, m, x? x Let q = 13 + -24. Let y be (-2)/q + 35/(-616). Let t = y + -23/56. Which is the third biggest value? (a) -1 (b) -1/2 (c) t a Suppose 0 = 4g + 17 + 7. Let d be (-3)/g + (-38)/60. What is the smallest value in 5, -1/5, d? -1/5 Let b(o) = 7o2 - 18o - 5. Let j(p) = -11p2 + 27p + 8. Let c(k) = -8b(k) - 5j(k). Let w be c(9). What is the third smallest value in w, 1, -4? 1 Let h be (-1 + 0)/(2/10). Let s be h/(-2) - (1 + -1). Let i = 1/2 - 1. What is the biggest value in s, i, 3/8? s Let i(l) = l*3 + 5l*2 + 4l - 1. Let v be i(-3). Let d = 0 + -0.2. What is the smallest value in 5/3, v, d? d Let i = 13 + -93/7. Which is	{ "pile_set_name": "DM Mathematics" }
hat is the third root of 2470 to the nearest integer? 14 What is 166584 to the power of 1/9, to the nearest integer? 4 What is 1736 to the power of 1/5, to the nearest integer? 4 What is 1479 to the power of 1/2, to the nearest integer? 38 What is 289 to the power of 1/7, to the nearest integer? 2 What is the fifth root of 22 to the nearest integer? 2 What is 6596 to the power of 1/2, to the nearest integer? 81 What is the tenth root of 1626 to the nearest integer? 2 What is 647 to the power of 1/3, to the nearest integer? 9 What is the cube root of 31 to the nearest integer? 3 What is 4876 to the power of 1/3, to the nearest integer? 17 What is 6638 to the power of 1/7, to the nearest integer? 4 What is 997 to the power of 1/3, to the nearest integer? 10 What is the fourth root of 132365 to the nearest integer? 19 What is 2692 to the power of 1/2, to the nearest integer? 52 What is 15767 to the power of 1/3, to the nearest integer? 25 What is the ninth root of 26765 to the nearest integer? 3 What is 52980 to the power of 1/2, to the nearest integer? 230 What is the square root of 2121 to the nearest integer? 46 What is the sixth root of 84591 to the nearest integer? 7 What is the ninth root of 35243 to the nearest integer? 3 What is the square root of 1609 to the nearest integer? 40 What is the sixth root of 3722 to the nearest integer? 4 What is the tenth root of 8616 to the nearest integer? 2 What is 17 to the power of 1/4, to the nearest integer? 2 What is the square root of 12410 to the nearest integer? 111 What is the third root of 2947 to the nearest integer? 14 What is the square root of 82801 to the nearest integer? 288 What is 106972 to the power of 1/5, to the nearest integer? 10 What is the tenth root of 1605 to the nearest integer? 2 What is the eighth root of 43678 to the nearest integer? 4 What is the square root of 1271 to the nearest integer? 36 What is 31872 to the power of 1/2, to the nearest integer? 179 What is 1353 to the power of 1/3, to the nearest integer? 11 What is 4128 to the power of 1/8, to the nearest integer? 3 What is the square root of 179206 to the nearest integer? 423 What is 963 to the power of 1/6, to the nearest integer? 3 What is the third root of 9723 to the nearest integer? 21 What is the seventh root of 77004 to the nearest integer? 5 What is 29650 to the power of 1/10, to the nearest integer? 3 What is the fourth root of 38583 to the nearest integer? 14 What is the cube root of 802 to the nearest integer? 9 What is the tenth root of 12674 to the nearest integer? 3 What is the cube root of 1011 to the nearest integer? 10 What is the square root of 14214 to the nearest integer? 119 What is the square root of 1292 to the nearest integer? 36 What is the square root of 12077 to the nearest integer? 110 What is the ninth root of 60843 to the nearest integer? 3 What is 30817 to the power of 1/10, to the nearest integer? 3 What is 2244 to the power of 1/2, to the nearest integer? 47 What is 2918 to the power of 1/7, to the nearest integer? 3 What is 779 to the power of 1/2, to the nearest integer? 28 What is the seventh root of 52054 to the nearest integer? 5 What is the ninth root of 1019 to the nearest integer? 2 What is the tenth root of 688 to the nearest integer? 2 What is the cube root of 124420 to the nearest integer? 50 What is the square root of 812 to the nearest integer? 28 What is the eighth root of 176510 to the nearest integer? 5 What is the square root of 284 to the nearest integer? 17 What is the seventh root of 1736 to the nearest integer? 3 What is the cube root of 1261 to the nearest integer? 11 What is the cube root of 13983 to the nearest integer? 24 What is 4065 to the power of 1/8, to the nearest integer? 3 What is the seventh root of 19050 to the nearest integer? 4 What is 10049 to the power of 1/2, to the nearest integer? 100 What is the cube root of 3776 to the nearest integer? 16 What is 5270 to the power of 1/2, to the nearest integer? 73 What is 927 to the power of 1/5, to the nearest integer? 4 What is 30189 to the power of 1/3, to the nearest integer? 31 What is 28063 to the power of 1/3, to the nearest integer? 30 What is the third root of 21531 to the nearest integer? 28 What is 128 to the power of 1/9, to the nearest integer? 2 What is the eighth root of 3590 to the nearest integer? 3 What is 800 to the power of 1/3, to the nearest integer? 9 What is 23498 to the power of 1/2, to the nearest integer? 153 What is the third root of 469 to the nearest integer? 8 What is 2007 to the power of 1/2, to the nearest integer? 45 What is the square root of 3326 to the nearest integer? 58 What is 491 to the power of 1/4, to the nearest integer? 5 What is the sixth root of 47676 to the nearest integer? 6 What is 50 to the power of 1/5, to the nearest integer? 2 What is the fifth root of 31853 to the nearest integer? 8 What is 29737 to the power of 1/2, to the nearest integer? 172 What is 101654 to the power of 1/4, to the nearest integer? 18 What is the square root of 11940 to the nearest integer? 109 What is the third root of 844 to the nearest integer? 9 What is 1292 to the power of 1/2, to the nearest integer? 36 What is the cube root of 2379 to the nearest integer? 13 What is 2099 to the power of 1/2, to the nearest integer? 46 What is the cube root of 615 to the nearest integer? 9 What is 5128 to the power of 1/2, to the nearest integer? 72 What is 93653 to the power of 1/2, to the nearest integer? 306 What is 20363 to the power of 1/7, to the nearest integer? 4 What is 60677 to the power of 1/9, to the nearest integer? 3 What is the sixth root of 1876 to the nearest integer? 4 What is 2336 to the power of 1/6, to the nearest integer? 4 What is 2953 to the power of 1/9, to the nearest integer? 2 What is 22156 to the power of 1/9, to the nearest integer? 3 What is the square root of 19471 to the nearest integer? 140 What is 914 to the power of 1/3, to the nearest integer? 10 What is the ninth root of 6506 to the nearest integer? 3 What is 11774 to the power of 1/2, to the nearest integer? 109 What is the cube root of 7650 to the nearest integer? 20 What is the cube root of 1567 to the nearest integer? 12 What is the third root of 21335 to the nearest integer? 28 What is 3609 to the power of 1/5, to the nearest integer? 5 What is 3149 to the power of 1/3, to the nearest integer? 15 What is the fifth root of 714 to the nearest integer? 4 What is 2923 to the power of 1/10, to the nearest integer? 2 What is the third root of 137139 to the nearest integer? 52 What is 814 to the power of 1/2, to the nearest integer? 29 What is the third root of 720 to the nearest integer? 9 What is the third root of 42755 to the nearest integer? 35 What is the square root of 8193 to the nearest integer? 91 What is 914 to the power of 1/10, to the nearest integer? 2 What is the third root of 47133 to the nearest integer? 36 What is the cube root of 18724 to the nearest integer? 27 What is 34955 to the power of 1/3, to the nearest integer? 33 What is 30441 to the power of 1/7, to the nearest integer? 4 What is the square root of 169 to the nearest integer? 13 What is 11975 to the power of 1/2, to the nearest integer? 109 What is the cube root of 152940 to the nearest integer? 53 What is the square root of 10004 to the nearest integer? 100 What is 6198 to the power of 1/3, to the nearest integer? 18 What is the cube root of 27465 to the nearest integer? 30 What is the sixth root of 20405 to the nearest integer? 5 What is the cube root of 4268 to the nearest integer? 16 What is 1433 to the power of 1/2, to the nearest integer? 38 What is 6223 to the power of 1/3, to the nearest integer? 18 What is the sixth root of 21013 to the nearest integer? 5 What is 9672 to the power of 1/4, to the nearest integer? 10 What is 3656 to the power of 1/9, to the nearest integer? 2 What is 3760 to the power of 1/2, to the nearest integer? 61 What is the sixth root of 28259 to the nearest integer? 6 What is 26252 to the power of 1/7, to the nearest integer? 4 What is the square root of 98094 to the nearest integer? 313 What is the ninth root of 879 to the nearest integer? 2 What is the cube root of 5811 to the nearest inte	{ "pile_set_name": "DM Mathematics" }
ess 2 + 2r - 2 + (79 + 24 - 43)(-r + 0r + 0r) + 3r - r - r in the form i + sr and give s. -57 Rearrange 3845m + 7234m - 10 - 85 + 95 to j + vm and give v. 11079 Rearrange 4v*3 + 3v3 - v3 + (5v3 - 4v*3 + 22v*3)(-4 + 0 + 9) to the form qv + jv*2 + xv*3 + r and give x. 121 Express 653r - 220r + 1494 - 213r - 221r in the form wr + t and give t. 1494 Express -28b2 + 25b*2 - 259 + 1454b + 257 in the form f + vb + yb*2 and give y. -3 Express -723b - 1340b - 743b in the form ab + f and give f. 0 Express (-5354d*4 + 4307d*4 + 4219d*4)(5 - 5 + 2) in the form ud3 + kd*4 + ad + hd2 + c and give k. 6344 Express -2p*2 - 13p*4 - 5p*2 - 14p*4 + 1 + 5p*3 - 15p*4 + 43p*4 + 2p as ip2 + tp + dp4 + wp*3 + x and give t. 2 Rearrange 3836 + 4w - 6w2 + 0w - w*2 + w - 3852 to the form gw + z + jw2 and give z. -16 Rearrange (4 + 0 - 9)(0q - q + 0q) - 72q - 408 + 408 + 4q - q + 8q + 0q to f + xq and give f. 0 Express -160c*3 + 12 - 13 + 2c*2 - 14c*4 - 2c + 163c3 as gc + lc4 + z + vc*2 + wc*3 and give g. -2 Express -2z*3 - 4152z + 1384z - 178 + 1381z + z*2 + 1389z in the form kz3 + c + qz*2 + tz and give k. -2 Express (w2 + w2 - w*2)(18268 - 54448 + 13808 - 100738) as cw + lw*2 + b and give l. -123110 Rearrange -2w*2 - 1873w*3 - 3w + 1826w3 + 5w + 2w2 to g + uw*2 + pw*3 + aw and give p. -47 Rearrange 0b3 + 19627 + 25b*2 + 9b - 19627 - 76b - 2b*3 to the form d + kb + mb3 + fb*2 and give f. 25 Rearrange (-1361 + 1361 - 24c)(-80 + 88 - 8 + 301c*2) + 3c3 - c3 - c*3 to xc*3 + f + qc*2 + rc and give x. -7223 Rearrange 19 - 336d2 - 54d*3 + 2d*4 - 19 + 22d*3 + 31d*3 - 2d to the form pd4 + hd*2 + wd + r + id3 and give w. -2 Rearrange -8244b + 2382b - 1176b to the form fb + k and give f. -7038 Rearrange 89f - 2f2 + 46 + 90f + 122f - 235f to the form y + pf2 + hf and give p. -2 Rearrange -19a4 + 4a*4 - 18a*3 + 43a*4 - a + 5 - 14a*4 to the form ra*3 + o + ba + ka2 + ia*4 and give i. 14 Express (3 - 5 + 1)(3p - 2p + p) - 3 + 3 + 3p - 11p - 30p + 12p - 32p + 3p + 4p as wp + o and give w. -53 Express 100a2 - 1 + 323a*2 + 850a*2 - 89a*2 + 150a*2 in the form ra*2 + la + m and give m. -1 Rearrange 15826 - 414b3 + 15b*2 - 15826 + 2b4 - b4 to v + tb4 + fb*3 + hb + yb2 and give h. 0 Rearrange 2952x + 3900x - 12152 + 12152 - 1359x to ox + p and give o. 5493 Express 25583s - 169 - 10937s + 169 in the form ys + p and give y. 14646 Express (52 + 8v - 2v - 4v)(282v + 493v - 435v) in the form x + zv*2 + dv and give x. 0 Rearrange -1011t + 2115t - 2393t - 2009t - 1852t to the form n + ht and give h. -5150 Express 21g3 + 3g*2 - 30g*3 + 25g4 - g2 + 12g3 - 3g*2 in the form tg*4 + b + ag*3 + zg*2 + jg and give t. 25 Rearrange -558p + 97 + 559p + 9p3 + 3 + 10p*3 to l + np + ap2 + gp*3 and give n. 1 Rearrange -3c*3 - 109c*3 + 96c*3 - 99 to fc + v + hc2 + rc3 and give v. -99 Rearrange -x4 + 0x + 305x*3 + 7x*2 - 608x*3 + 90 + x + 305x*3 to jx*2 + wx*4 + b + lx + mx3 and give w. -1 Express 1380v*2 + 2v - 16 - 5375v2 + 1735v*2 + 1505v*2 - 3v in the form hv + ov*2 + b and give h. -1 Rearrange -68v*3 + 3v - v + 67v3 - 12v*2 + 2v*4 - 1 - 5v*2 - 10v*2 to the form nv + bv4 + qv*3 + y + pv2 and give n. 2 Rearrange j2 - 1178j - 1244j + j*2 - 1 + 2472j - 7 to aj + oj*2 + w and give w. -8 Rearrange 1063l - 1135l - 683l - 1229l to the form kl + f and give k. -1984 Express ((35j - 6j + 7j)(-j - 4j + 3j) - 1 + 1 + j*2)(-33 + 25 - 31 - 50) as vj2 + w + tj and give v. 6319 Express -2x4 + 1163x*3 - 1 - 5x - 4x2 + 3x - 2300x3 + 1140x*3 as px*4 + zx*2 + yx + vx3 + u and give v. 3 Rearrange (-1 - 2 - 3 + (0 + 1 - 2)(-1 + 3 - 3))(-10 - 23 - 42 - 7)(8 - 8 - 4s) to us + v and give u. -1640 Rearrange -1453p - 1442p + 2865p to kp + b and give k. -30 Express 638j - 232j - 3318j in the form kj + m and give m. 0 Rearrange (-281806 + 514564 - 256405)(3z + z - 3z) to t + cz and give c. -23647 Express -3y2 + 2y*3 + 3y*2 + (133y + 20y - 8y)(-2y + 2 - 2)(-3 + 8 + 4)(-2 - y + 2) in the form my2 + py*3 + i + zy and give p. 2612 Express 13f - 4f*4 - 33 + 10f3 - f4 + 31 + f*4 as q + hf + rf4 + jf*2 + zf*3 and give r. -4 Express (-1 - 3 + 5)(0 + 2u + 0) + 2u + 4 - 4 + 730u + 415u - 146u + 15u in the form b + su and give s. 1018 Rearrange (-11j + 3j + 4j)(28 - 38 + 110)(0j + j - 3j) to the form lj2 + cj + y and give l. 800 Rearrange 290h2 + 476836h + 15 - 476836h to ah*2 + th + v and give a. 290 Express -6q + 3q + q + q + 1 - 1 + (-1 - 2q + 1)(-3 - 1 + 5) - 228 + 54779q + 726 - 250 - 248 in the form iq + o and give o. 0 Rearrange (2d - 2d + 2d)(2 - 2 - 2) - 1050d - 893d + 190d + (-2 - 1 + 4)(6d + 0d - 4d) to wd + z and give w. -1755 Rearrange -3k2 + 0k2 + k2 + (24k - 97k + 48k)(10k + 9k - 7k) to the form sk*2 + fk + g and give s. -302 Express (1124b + 1602b - 418b)(b + 0b - 4b + (1 - b - 1)(2 + 0 - 1) + 3b - b + 0b) in the form fb + s + kb2 and give k. -4616 Express (1 + 3 + a - 3 - 6a*3)((0 - 1 + 0)(2 + 2 - 2) + 7 + 9 + 1 + (-5 + 3 + 4)(-2 + 6 - 3)) in the form ga2 + ta*3 + sa + c and give c. 17 Rearrange (-2h - h + 4h)(2h2 + 0 + 0) + h3 + 0h + 0h - 3h2 - 4 - 4h*3 - 1 - 1 - 338 + 338 + 7h*3 to ih + t + zh2 + ph*3 and give z. -3 Rearrange -2p*3 - 2p + 3p - 330p*2 + 4p + 183 + 330p2 to zp + op3 + np*2 + r and give r. 183 Express -11046t*2 + 22 - 4258t*2 - 38 + 16 in the form qt + l + vt2 and give v. -15304 Rearrange 242n*2 + 14 - 493n*2 + 289n*2 to y + xn*2 + hn and give y. 14 Express (43 - 394 - 299)(-2m + 12 - 12 + 4) as v + pm and give v. -2600 Rearrange h3 - 4 + 4 + (-248183 + 248183 - 797h*2)(-h + 2h - 4h) to s + gh + kh*3 + vh*2 and give k. 2392 Express (5z - 2z + 3z)(3198 - 1599 + 578z*2 - 1599) as gz*2 + x + kz + vz3 and give v. 3468 Rearrange -33972g*2 + 67535g*2 - 33944g*2 + 11 to the form qg + z + vg2 and give z. 11 Express -577 - 1237 - 2v - 140 + 4v in the form uv + x and give u. 2 Rearrange (2t - t + 0t)(-222t*2 + 447t*2 - 223t*2)(622 - 622 - 30t) to yt + g + kt4 + dt*2 + it*3 and give k. -60 Rearrange 25h*2 + 57 - 485 - 10 + 3h*2 to the form ph*2 + a + sh and give p. 28 Express 54m - m4 + 139m*3 - 14m + 1 + m*2 - 39m as xm4 + um*3 + ym*2 + n + rm and give u. 139 Express -4910u + 11602u - 4835u as b + au and give a. 1857 Rearrange -7031w - 7057w + 14089w + 19997w*2 to yw*2 + p + sw and give y. 19997 Rearrange 70 - 20 - 2865y - 50 to the form b + jy and give j. -2865 Express (4r + r3 - 4r)(182 - 242 - 21r + 45) + 7r4 - 2r4 - r4 as pr4 + hr*2 + tr*3 + u + jr and give p. -17 Express 2i3 + i - i3 - 5i + (i + i + 0i)(4i + 4i - 4i)(-3i + i + 4i) + 4i3 - 6i*3 - 27i*3 as gi + qi2 + oi*3 + y and give g. -4 Rearrange (0k*3 - 2k*3 + 0k*3)(4932k - 6338k + 2 - 8725k - 2 - 1638k) to the form a + nk3 + bk*2 + jk*4 + hk and give j. 23538 Express 242541 - 242541 + 33677m as a + sm and give a. 0 Express 119a2 - 19 - 4287701a + 4287701a in the form xa + ka2 + v and give v. -19 Express (-9452 - 1789 + 4548 - 7863 - 12744 - 8746)(-z*2 - 2 + 2) in the form t + pz*2 + vz and give p. 36046 Express -9i2 + 15 + 0 - 11 - 1 in the form di*2 + z + ai and give d. -9 Rearrange (-904 + 50 - 597 - 97)(c2 - c2 - 2c*2)(2 - 5 + 2)(2c + 0c - c) to the form tc + p + ac2 + jc*3 and give t. 0 Rearrange (0x - 5x + 4x)(-283148 + 606486 - 262180) to gx + d and give g. -61158 Rearrange 4l4 - l4 - 8l*2 + 11l*2 + 4l*3 - 26l - 5l4 + 5l to ol2 + t + cl*4 + gl + sl3 and give c. -2 Express (3w - 2w2 - 3w)(-w + w + w) - 159w + 159w + 105w*3 - 2w + 2w - 2w*3 as gw + vw2 + d + cw	{ "pile_set_name": "DM Mathematics" }
7, 3, 1 Put 1, 73, -4, -2, -2/3 in decreasing order. 73, 1, -2/3, -2, -4 Sort -7, 1, 2, 64 in increasing order. -7, 1, 2, 64 Sort -0.7, 0.5, 3/2, -4, 1 in increasing order. -4, -0.7, 0.5, 1, 3/2 Sort -4, -8, 1 in decreasing order. 1, -4, -8 Put -9, -7, -3 in decreasing order. -3, -7, -9 Sort -5, -13, 4, 2 in decreasing order. 4, 2, -5, -13 Sort 2, 4, -0.16, -9 in increasing order. -9, -0.16, 2, 4 Put -0.053, -7, -0.2 in increasing order. -7, -0.2, -0.053 Sort -2/17, -2, 22/7 in descending order. 22/7, -2/17, -2 Put 4, 3, -5, 1, -79 in descending order. 4, 3, 1, -5, -79 Sort -1, 12, -5 in decreasing order. 12, -1, -5 Put 15, -2, 85 in decreasing order. 85, 15, -2 Put -4/3, 2, -2768 in ascending order. -2768, -4/3, 2 Sort 1/2, -1/4, 2/5, 1/3 in descending order. 1/2, 2/5, 1/3, -1/4 Sort 5, -0.5, 240. -0.5, 5, 240 Sort 2, 4, 3 in increasing order. 2, 3, 4 Sort 10, 0, 22 in decreasing order. 22, 10, 0 Put 0.2, 9, 0.5, 106 in descending order. 106, 9, 0.5, 0.2 Sort -3, -5, -14, -24, -2 in increasing order. -24, -14, -5, -3, -2 Sort 0.3, -1/7, 400, -2, 0.5 in increasing order. -2, -1/7, 0.3, 0.5, 400 Sort -3, 39, -3/7, 7 in decreasing order. 39, 7, -3/7, -3 Sort -1, 28, -3 in decreasing order. 28, -1, -3 Sort -4, 0, -9, -1 in descending order. 0, -1, -4, -9 Put 1/2, -2, -2/9, 2 in decreasing order. 2, 1/2, -2/9, -2 Put -4, 72, -0.1 in ascending order. -4, -0.1, 72 Put 1462, -4, -2 in descending order. 1462, -2, -4 Sort -8, 3, -2, 5, -4 in ascending order. -8, -4, -2, 3, 5 Sort -1, 1749, -3/2 in increasing order. -3/2, -1, 1749 Put -2, 5, -28, 3, 4 in ascending order. -28, -2, 3, 4, 5 Sort -3, -21, -5, 3, -1. -21, -5, -3, -1, 3 Sort -2/51, 4/3, 0.05, -3 in descending order. 4/3, 0.05, -2/51, -3 Put -3, -4/13, 1/8, 2/9, 0 in decreasing order. 2/9, 1/8, 0, -4/13, -3 Put -6, 1, -2 in increasing order. -6, -2, 1 Sort -2, -4, -16 in increasing order. -16, -4, -2 Sort 0, -301, -3. -301, -3, 0 Put -0.2, 1, 513 in descending order. 513, 1, -0.2 Put -2, 6, 27 in descending order. 27, 6, -2 Put 2, -10, 4, -4, 29 in descending order. 29, 4, 2, -4, -10 Sort 1, -3/5, -0.4, -5 in increasing order. -5, -3/5, -0.4, 1 Put 1/11, 22, -47, -1 in decreasing order. 22, 1/11, -1, -47 Sort 0, -2, -1, 26 in descending order. 26, 0, -1, -2 Put 0, -4, -53 in ascending order. -53, -4, 0 Put 4, 0.4, 3, -3/4, -18.5 in increasing order. -18.5, -3/4, 0.4, 3, 4 Sort -5, -13/16, -3 in ascending order. -5, -3, -13/16 Sort -5, 4, 610, 7 in ascending order. -5, 4, 7, 610 Put 0, -3, 1, 33, -4 in increasing order. -4, -3, 0, 1, 33 Put 0.3, 0.009, -2/3 in increasing order. -2/3, 0.009, 0.3 Sort 6, 3, 9. 3, 6, 9 Sort 3, -0.1, -5, -1/12 in ascending order. -5, -0.1, -1/12, 3 Sort 1/3, 4, -298 in ascending order. -298, 1/3, 4 Put 0.3, 4, 0, -2/3 in decreasing order. 4, 0.3, 0, -2/3 Put -2/15, -0.4, -0.3, 0.6 in descending order. 0.6, -2/15, -0.3, -0.4 Sort -8, -9, -4, 2, -3. -9, -8, -4, -3, 2 Sort -713, -5, 1 in decreasing order. 1, -5, -713 Sort 0.5, 187, -0.2. -0.2, 0.5, 187 Sort -19, -5, 11, 1 in decreasing order. 11, 1, -5, -19 Sort 0, 55, 10 in decreasing order. 55, 10, 0 Sort 1, 2, 3/7, -5/4 in decreasing order. 2, 1, 3/7, -5/4 Sort -4, -69, -5. -69, -5, -4 Put 3, -1, 21 in descending order. 21, 3, -1 Put 0, 12, 2 in increasing order. 0, 2, 12 Put -0.1, 2/2331, 7 in descending order. 7, 2/2331, -0.1 Sort -5, 0, 16, -38 in descending order. 16, 0, -5, -38 Put -0.4, -2, 4, 3/2, -7 in increasing order. -7, -2, -0.4, 3/2, 4 Put -0.1, 1, -0.05, -1/5 in increasing order. -1/5, -0.1, -0.05, 1 Sort 2, 7, 1. 1, 2, 7 Sort -32, 4/13, 0.4, -0.4 in decreasing order. 0.4, 4/13, -0.4, -32 Sort -5, -2, 0, 5. -5, -2, 0, 5 Put -10, -6, 4 in ascending order. -10, -6, 4 Put -7, 5, -78 in descending order. 5, -7, -78 Put 2, 21, 3 in decreasing order. 21, 3, 2 Put 4, 5, -1/4, -0.08 in increasing order. -1/4, -0.08, 4, 5 Sort 1.1, -3, -0.1, 57 in increasing order. -3, -0.1, 1.1, 57 Sort 0.4, -0.4, 0.69, 2. -0.4, 0.4, 0.69, 2 Sort -4, 11, 17 in decreasing order. 17, 11, -4 Sort -0.06, 5, -4 in descending order. 5, -0.06, -4 Sort -17, -3, -5 in increasing order. -17, -5, -3 Put 1, 4, 2, 12 in descending order. 12, 4, 2, 1 Put 15, -2, 3, 11, 4 in decreasing order. 15, 11, 4, 3, -2 Sort 5, 2, -5, 4 in increasing order. -5, 2, 4, 5 Sort -4, -63, 111 in ascending order. -63, -4, 111 Put -5, -4, 2, -1 in descending order. 2, -1, -4, -5 Put -7/5, -5, 19 in increasing order. -5, -7/5, 19 Sort 0.06, 2/43, 0.2, 0.5 in increasing order. 2/43, 0.06, 0.2, 0.5 Put -4, -8, -7, 5, -3 in ascending order. -8, -7, -4, -3, 5 Sort -847, 5, 2 in descending order. 5, 2, -847 Sort 1, 6, -1 in increasing order. -1, 1, 6 Put 505, 2, -4 in descending order. 505, 2, -4 Sort 357/2, 5, -2/5, 2 in ascending order. -2/5, 2, 5, 357/2 Sort 1/7, -5, -0.01986. -5, -0.01986, 1/7 Put -1, -5, -23/5, 1 in increasing order. -5, -23/5, -1, 1 Sort -1, -18, 5, 6. -18, -1, 5, 6 Put -309, 4, 2 in ascending order. -309, 2, 4 Put 4, 26, 0 in decreasing order. 26, 4, 0 Put 192, -2/13, -5 in decreasing order. 192, -2/13, -5 Put 0.02, -0.8, -5/4, -0.1 in decreasing order. 0.02, -0.1, -0.8, -5/4 Sort 0.2, 2/3, 0, 2 in decreasing order. 2, 2/3, 0.2, 0 Sort -6, -2, 8, 0, 2 in decreasing order. 8, 2, 0, -2, -6 Put -2, 12544, 0.5 in decreasing order. 12544, 0.5, -2 Sort -6/7, 34, 0, 5. -6/7, 0, 5, 34 Sort 5, -0.5, -10, 0.1 in descending order. 5, 0.1, -0.5, -10 Put -2/119, -0.2, -0.11 in decreasing order. -2/119, -0.11, -0.2 Put 169, 3, -6 in increasing order. -6, 3, 169 Sort 1991, 1, -2, 2, -4 in descending order. 1991, 2, 1, -2, -4 Put 1, 2, 33 in decreasing order. 33, 2, 1 Put 31, 4, 6, -2 in ascending order. -2, 4, 6, 31 Sort -2/19, 0.1, 0.3, -2/5, 1/19. -2/5, -2/19, 1/19, 0.1, 0.3 Put 46, 2/5, 1/3, 1 in increasing order. 1/3, 2/5, 1, 46 Sort 0.2, 3/4, -0.03, 1/2, -1 in ascending order. -1, -0.03, 0.2, 1/2, 3/4 Put -445, 0, -5 in decreasing order. 0, -5, -445 Put -15, 3, 4, 2 in ascending order. -15, 2, 3, 4 Sort -12, 9, 1, 0. -12, 0, 1, 9 Put -0.4, 2/3, -13, 2 in ascending order. -13, -0.4, 2/3, 2 Sort 1, -2/11, 5, -770 in increasing order. -770, -2/11, 1, 5 Sort -1.9, 0.49, -4/7, 3. -1.9, -4/7, 0.49, 3 Sort -10, 4, -2 in decreasing order. 4, -2, -10 Sort 1, 1/2, -2, 0.2 in descending order. 1, 1/2, 0.2, -2 Put -5, -11, -12 in increasing order. -12, -11, -5 Put 0.2, -0.2, 161, -0.3, 6 in ascending order. -0.3, -0.2, 0.2, 6, 161 Sort -1, 6, 5 in decreasing order. 6, 5, -1 Sort 2, -342, 3/2. -342, 3/2, 2 Put 1, -2, -9, 0 in decreasing order. 1, 0, -2, -9 Put 0.1, -23, 0 in decreasing order. 0.1, 0, -23 Sort -1, 15, 5, -315, 2 in ascending order. -315, -1, 2, 5, 15 Put 8, -6, 2 in descending order. 8, 2, -6 Sort -58, -5, 7, 2 in decreasing order. 7, 2, -5, -58 Sort 2, -3, 9, 62 in decreasing order. 62, 9, 2, -3 Put 4, 0, -1, -5, 66 in ascending order. -5, -1, 0, 4, 66 Put -0.5, 0.2, 2, 2/179 in decreasing order. 2, 0.2, 2/179, -0.5 Put -3/14, 0.1, -13 in increasing order. -13, -3/14, 0.1 Sort 4, 0.4, -4/15, 2/11 in increasing order. -4/15, 2/11, 0.4, 4 Sort -2/19, -3, -23, -0.5 in increasing order. -23, -3, -0.5, -2/19 Put -2, 3, 2, -14 in ascending order. -14, -2, 2, 3 Put 0, 3, 30, 5 in increasing order. 0, 3, 5, 30 Sort 0.29, -0.5, -2, 0 in increasing order. -2, -0.5, 0, 0.29 Put -8, -11, 1, 3 in descending order. 3, 1, -8, -11 Put -5, 1, 2, 6 in increasing order. -5, 1, 2, 6 Put 0.06, 0.08, -0.009 in descending order. 0.08, 0.06, -0.009 Sort -11, 0.5, 9, 3/5 in decreasing order. 9, 3/5, 0.5, -11 Sort 0, 1, -341, 3 in increasing order. -341, 0, 1, 3 Put -3/44, -1/5, 3 in increasing order. -1/5, -3/44, 3 Sort 1, -4, 6, -9. -9, -4, 1, 6 Sort 1, 94, -0.2 in increasing order. -0.2, 1, 94 Put 0.8, -2/3, 0.03 in descending order. 0.8, 0.03, -2/3 Sort 40, 0, 11. 0, 11, 40 Sort 9, 5, -7, -3 in ascending order. -7, -3, 5, 9 Put 0.5, 3/5, -13 in descending order. 3/5, 0.5, -13 Put 4/11, -0.03, -1/6, 1/4 in descending order. 4/11, 1/4, -0.03, -1/6 Sort 0.03, -6, 1/3, -2/7, -2.4 in decreasing order. 1/3, 0.03, -2/7, -2.4, -6 Sort 12, 4, 0. 0, 4, 12 Put 17, -2, 5, 1 in increasing order. -2, 1, 5, 17 Put -4, 5, 332, -5 in decreasing order. 332, 5, -4, -5 Sort -0.6, -2/11, 2, 1/3 in ascending order. -0.6, -2/11, 1/3, 2 Sort 19, -3, 3, 13. -3, 3, 13, 19 Sort 4, 12183, 1	{ "pile_set_name": "DM Mathematics" }
for n. -3 Let m be ((-50)/(-24) - 2)2 + (-575)/(-150). Solve -3o = 5f + m, 2f - 19 = -17 for o. -3 Let f be (-1 - (-40)/7) + 16/56. Solve 0 = 5m + 3k + 9, 2 = m - fk - 13 for m. 0 Let c(g) = -7g + 172. Let x be c(24). Suppose -4r + 4 = 3z - 9r, 2z - xr - 2 = 0. Solve 5f = -zu - 0u + 14, u + 3f - 6 = 0 for u. 3 Suppose 0 = -v - 2r + 3, -2r = -2v + v + 7. Suppose 4b + b = -d - 18, -3b = vd + 2. Suppose -5g = -dg - 12. Solve 0 = -5l, 0 = c - 3l + g for c. -4 Suppose 0 = -19n + 18n + 4t - 21, -8t = n - 51. Solve l - 3 = a, -10 = 3a - l - n for a. -2 Let y be (-8)/(-10) + (-4378)/(-1990). Solve -4n + 5w + 5 = 0, -126w + 129w + y = 5n for n. 0 Suppose 5n - 3k - 49 = -0k, 2n + 2k = 26. Suppose -nq + 12q = 0. Suppose q = -3o + 6. Solve 0i - o = 3i - 5x, -4i + 8 = 4x for i. 1 Suppose 196w - 198w - 5j = -7, w = -2j + 3. Solve -5d - 2k = w, -3d - 5k - 15 = -3 for d. 1 Suppose 379o - 375o = 4c - 8, c - 2 = 4o. Solve 2i = 3g - 4, i + 0g + 3g - 16 = o for i. 4 Suppose 33m + 34 = 50m. Solve 10 = -ms, 3g + 5s + 20 = 4 for g. 3 Let t(p) = -10965p*3 - 2p*2 - 13p*2 + 6p + 10963p3 - 8. Let l be t(-8). Solve 5v - 4c - 2 + l = 0, -5v - 15 = 5c for v. -2 Suppose -345a + 782 = -299a. Solve -5h - 25 = -3w, 0 = -ah + 16h - 2w + 8 for h. -2 Let w = 17587 - 17584. Solve 4s - 5 = -wb, b - 5s = 29 - 59 for b. -5 Suppose 178 = 2t - 5f, -2t + 174 = f - 4f. Suppose 2u - 92 = -4. Let m = t - u. Solve c = 5g + 6c + m, -17 = 4g + c for g. -3 Suppose -5s - 4 = -3z, 0 = 4z - 5s + 59 - 66. Solve 174 = 5m + 149, -4k - zm + 7 = 0 for k. -2 Let s = -70 - -29. Let y = 73 + s. Let l = -27 + y. Solve -4a - 4u - 8 = 8, -la - 3u - 10 = 0 for a. 1 Let b = 3500 - 3497. Solve -59m = -4k - 54m - 6, -4m = -bk - 4 for k. -4 Let r be ((-30)/55)/((-54)/2673). Solve 4t - 15s - 28 = -13s, 3t - 3s - r = 0 for t. 5 Let m be -9(-5 - (3 + 115/(-15))). Suppose 3k + 3p = 60, 2p + 107 = 4k - mp. Solve -3u + 0u = 2d + k, d - 1 = u for d. -4 Let o be -1227/(-36) + (-32)/8. Solve 15 = -op + 4b, 0 = -4p - b - b - 12 for p. -3 Let h be (1 + (-5)/10)(0 - -22). Suppose 8 = -ha + 15a. Solve -ac - 12 = -5d + 8, 5c = d - 27 for c. -5 Let y(v) = -v3 - 38v*2 - 92v + 457. Let d be y(-35). Solve -di = -3s - 20, 3i - 6i = 4s + 21 for i. 1 Let j be (-400)/225 - (-2)/(-9). Let x be 76/12 + j + 3/(-9). Solve -5r + 6 = -xa - 21, -3r + a + 12 = 0 for r. 3 Let f be (-2)/29 - 6942/(-2262). Solve -9 = -2g + fk, 0 = 22g - 17g - 3k - 9 for g. 0 Suppose -k - 9 = 4z, -4k - 36z + 35z + 9 = 0. Solve -3f = 3n + 30, 0 = 2f + 2n + kn + 35 for f. -5 Let b = 31 + -29. Suppose 2u - 4 = -bu. Let p be -5(-2 - (u - 0))1. Solve -c - 2h = -6c - p, 3h = 5c + 20 for c. -1 Let q be ((-5)/((-105)/(-54)))/((-3)/(-21)). Let f = -14 - q. Suppose 2 = -fr + 5r. Solve rh = h - 4z + 5, -1 = -5h + 4z for h. 1 Suppose -9s + 58 - 4 = 0. Let a be 9/s208/39. Suppose -k + g = -a, -2k + g + 3 + 8 = 0. Solve t = 5h - 14, -3 - 7 = kh + 4t for h. 2 Let d be (-818)/(-34) - (-15)/(-2805)11. Solve 5t - 9 = -4, -d = 4f - 4t for f. -5 Let q = 631 + -601. Let x be (1/((-25)/q))/((-21)/70). Solve 6u + c = 3u - x, 2c = 4u + 22 for u. -3 Suppose 4m - 31 = -5v, 0 = -4v - 9m + 10m + 8. Solve 9d - 5d - 20 = 0, 0 = 4c + vd + 1 for c. -4 Suppose 3376s - 3423s = -141. Solve 7 = 5o + 22h - 20h, 0 = 2o + sh - 5 for o. 1 Suppose -3w - 62 + 146 = 0. Suppose -152 = -wx - 10x. Solve 4v + v + x = 3o, 0 = 2o + 3v - 9 for o. 3 Suppose 3287b = 3280b + 14. Solve 3k + 12 = -n - 1, -4n = -bk - 4 for k. -4 Let d(r) = -r*3 - 9r*2 + 9r + 9. Let k be d(-10). Let a = k - 14. Solve -5l = 5u + 15, al + 7 = -2u + u for u. -2 Suppose 16q - 19q - 74 = 4n, 0 = -2q + 2n - 26. Let k be 1 - 6/q-9 - -6. Solve 16 = -4i, -k = -2j + 6j + 2i for j. 1 Let n be (-2436)/9 - (12/9)/(-2). Let s = 277 + n. Solve -y + 1 = p, -5p + s = 5y - y for y. -2 Let i be -10((-1)/(-1) + 352/(-160)). Solve 0 = -7a + ia + k, -4a = 3k - 11 for a. -1 Suppose u - 52 - 24 = -k, -k + u + 72 = 0. Let h = k - 77. Let y(z) = -z3 - 2z*2 - 6z - 7. Let d be y(h). Solve 5w + 0p + p = -25, -4w = 3p + d for w. -5 Let c be (-14)/(-4)(-848)/(-371). Solve c = -2j + 2r, -j - 55 = -3r - 53 for j. -5 Suppose 19g - 35g = 3 - 3. Solve g = 4t + 12, -t + 12 - 35 = -5y for y. 4 Suppose 0 = -f + 4, -4y - 4f + 84 = f. Suppose k - 5o + 14 = 0, 11o - yo + 16 = k. Solve 2 + k = -5b + 2i, -5b = -i + 4 for b. -1 Let v be 2 + 0 + 0 + 2. Let x(g) = 5g - 40. Let u be x(9). Let z = 32 + -26. Solve -2r = -3t + r - z, vt - r = -u for t. -1 Let h be (3 + -1)7 + -13. Solve x - 4 - h = r, x + 19 = -5r for r. -4 Let i = -34 - -36. Suppose 7l = 4l + 4m - 103, -il = -5m + 71. Let c = l + 38. Solve -cp = -h - 8, p - 3h = -2p + 12 for p. 1 Let z = -16679 - -16682. Solve -2b - 4 = 4v + 4, -zv + 8 = -2b for v. 0 Let b(i) be the first derivative of -i*4/4 - 8i*3/3 + 12i*2 - 5i - 138. Let l be b(2). Solve 21 = -3x + la, -x - 5a + 18 = -5 for x. -2 Suppose y = -15y + 192. Suppose y + 75 = 29b. Solve -bl - l = -g, 2 = 2l for g. 4 Let r = -1749 + 1751. Solve -5f = -3d - r, f - 2f = 2d + 10 for d. -4 Let c(n) = -n2 - 12n + 93. Let g be c(0). Let q be g6/198 + 2/11. Solve 2i + 0i = -4y + 8, -28 = qi - 4y for i. -4 Suppose 0 = -177q + 198q - 147. Let n = -3 + 6. Solve -g - 2f = 0, -ng + 2f + 1 = -q for g. 2 Suppose -2a - 8 = -8. Suppose -14m + 13m + 4 = a. Suppose -z + 2v = mz - 5, 3v = -3z + 24. Solve 2l = 2h, -2l - zl + 4h = 0 for l. 0 Suppose 0 = -407y + 870 + 758. Solve 5b - 21 = yv, -24b + 9 = -v - 22b for v. 1 Suppose 2h + 5 - 18 = -3m, 2m + 3h = 12. Let c = 180 + -176. Solve 3 = -2r - 4x - m, -cr + 4x = 0 for r. -1 Let h = 865695 + -865693. Suppose -4l - l + 48 = 4x, 5x - 5l - 60 = 0. Suppose 2u - 7u = 0. Solve -5v + hy = -2y - x, -2v + 4y = u for v. 4 Let d be ((300/(-18))/5)/(-4 + (-172)/(-48)). Let u = -8 + 13. Solve 0k - 5k - 5 = -un, 4k + d = 5n for n. 4 Suppose -2t - 2l + 10 = 0, 71t + 18 = 75t + 2l. Solve 2 = -3i + td, 4 = 5i + d + 15 for i. -2 Let w = 155 + -142. Let x(k) = 8 - 8 - 8 - 15 + 2k. Let s be x(w). Solve -2 = 2l, sq = -q - 3l - 23 for q. -5 Let n be (-1175)/(-14) + (-1)/(-14). Suppose 49j - 7j = n. Solve -5m - j = -r, 0m - 5m - 2r = -4 for m. 0 Suppose 306 = -12g + 6g. Let u = 54 + g. Solve -15 = -uy - 3j, 4j + 5 = -y + 5j for y. 0 Let o be -8 + 8 + (-40)/(-1). Let h = o - 100. Let r = 64 + h. Solve -3g = 5x + 34, 5x = 2g - r - 15 for g. -3 Suppose -2x = w + 3x - 19, 0 = 2w + 5x - 28. Let o be (-4)/(-3) - (-2)/w3. Suppose -m - 4 = -om. Solve ml = -2a + 2l + 12, 4l = 4a for a. 3 Suppose -12n + 13n = 16. Suppose -nx + 30 = -11x. Solve xl = l - 15, -2k = 3l + 7 for k. 1 Suppose -5g + 7q - 153 = 6q, -3q + 99 = -3g. Let j = g - -40. Let r be 1 - -3 - (-8 + j). Solve -m + 5 = -5b - 0m, 0 = rb + 3m - 15 for b. 0 Suppose -11n = -3a - 14n + 75, 5a - n - 119 = 0. Solve 4w = -5g + 4, 0g = 3g - 3w - a for g. 4 Let n = 3 + 2. Let z = 43 + -5. Let l = -33 + z. Solve -3v = 5q - l, -24 = nv - v - q for v. -5 Let y = 1 + -1. Suppose 436 - 429 = -w, -4o - 5w = -29. Solve 0 = 5z + 3f + 13, y = -2z - 2z - f - o for z. -5 Let r be (-24)/(-28)(-189)/(-18). Suppose -3t - 2q + 41 = 0, rt - 4q - 61 = 4t. Solve v + v - 4i = 22, -4i = v + t for v. 3 Let q be ((-2720)/12)/(-17) + -11 - 2/(-3). Solve 5 = n + qy, 3n - 10 = n + 2y for n. 5 Suppose 0 = -7s + 179 - 116. Let b be (2/s)/(68/612). Solve -1 = 2v + h, -v + 3v = bh + 8 for v. 1 Suppose 7 - 31 = -6u. Suppose 4i - 5 = -5w, -6i + 4w - u = -i. Solve -c + 9 = 4r + 2, i = -c - 5 for r. 3 Suppose -j - 11 = 3f + 15, -2f - j - 18 = 0. Let o be ((-6)/(-3))/(3f/108). Let m be (16 - 0(-3)/o) + 3. Solve 5q - 25 = 5k, -k - 6q + q + m = 0 for k. -1 Suppose 5z - 28 = 3g, -2z + 28g + 7 = 31g. Solve -zp + 23 = -9r, -r - 2p - 5 = -5p for r. -2 Suppose 45c + 7c = 156. Solve q = -q - 5i + 8, ci + 4 = q for q. 4 Let v be 0(1/(-2) + 0). Suppose -529 = -21j - 277. Solve 5b + v	{ "pile_set_name": "DM Mathematics" }
ters picked without replacement from ggggggggggggggo. What is prob of picking 1 o and 2 g? 1/5 Three letters picked without replacement from arrtdrd. Give prob of picking 1 r, 1 t, and 1 d. 6/35 Calculate prob of picking 1 s and 1 u when two letters picked without replacement from {s: 1, c: 2, y: 2, u: 7, g: 2, i: 2}. 7/120 What is prob of picking 2 h when two letters picked without replacement from hhhhhh? 1 What is prob of picking 1 m and 2 o when three letters picked without replacement from ojmmmmyujjuyuooj? 3/140 Three letters picked without replacement from {i: 7, c: 7}. Give prob of picking 1 c and 2 i. 21/52 Calculate prob of picking 1 x and 3 w when four letters picked without replacement from xwxwwx. 1/5 What is prob of picking 1 k and 2 d when three letters picked without replacement from {k: 10, d: 6, s: 2}? 25/136 Four letters picked without replacement from wwwwnnfn. What is prob of picking 2 n and 2 w? 9/35 What is prob of picking 1 p, 1 y, and 2 t when four letters picked without replacement from mgpptmymppppptm? 1/195 Two letters picked without replacement from bbaaxxbaqa. Give prob of picking 1 b and 1 q. 1/15 Calculate prob of picking 1 w, 1 h, and 1 g when three letters picked without replacement from ghghggghlghwhgghg. 27/340 What is prob of picking 1 l and 1 x when two letters picked without replacement from xlxlgggxxxgl? 5/22 What is prob of picking 2 s when two letters picked without replacement from {s: 3, p: 2}? 3/10 What is prob of picking 3 r when three letters picked without replacement from {e: 1, s: 9, t: 3, r: 6}? 20/969 Four letters picked without replacement from {k: 7, a: 3}. What is prob of picking 3 k and 1 a? 1/2 What is prob of picking 1 s, 1 b, and 2 d when four letters picked without replacement from bbddwswsbbwsbsddb? 36/595 Three letters picked without replacement from vvvrvvvvrvvvvrxvv. Give prob of picking 3 r. 1/680 Two letters picked without replacement from {w: 4, e: 2, r: 1}. What is prob of picking 2 w? 2/7 Two letters picked without replacement from {g: 8, r: 4, z: 3, j: 1, i: 2, h: 2}. Give prob of picking 1 h and 1 i. 2/95 Four letters picked without replacement from {f: 17, o: 2}. What is prob of picking 3 f and 1 o? 20/57 Three letters picked without replacement from {p: 5, f: 3}. Give prob of picking 1 f and 2 p. 15/28 Calculate prob of picking 1 e and 2 y when three letters picked without replacement from reyrhhhrehrehhyyr. 9/680 Two letters picked without replacement from {d: 1, g: 1, n: 12}. Give prob of picking 1 g and 1 n. 12/91 Four letters picked without replacement from yywysswsswyyyysyiy. Give prob of picking 3 y and 1 i. 7/255 Two letters picked without replacement from {w: 7, t: 6}. Give prob of picking 2 w. 7/26 Two letters picked without replacement from {b: 3, c: 2, m: 1, l: 4}. What is prob of picking 1 c and 1 b? 2/15 Two letters picked without replacement from nnokikkkknn. What is prob of picking 1 k and 1 i? 1/11 Two letters picked without replacement from jjvjjjjjjzjjzjjjj. Give prob of picking 1 j and 1 v. 7/68 Three letters picked without replacement from wiwiwggw. What is prob of picking 1 i and 2 g? 1/28 Calculate prob of picking 4 j when four letters picked without replacement from {h: 3, j: 4}. 1/35 Two letters picked without replacement from {e: 4, h: 5, c: 7}. Give prob of picking 2 c. 7/40 Four letters picked without replacement from {t: 5, g: 15}. Give prob of picking 4 g. 91/323 Calculate prob of picking 1 d and 2 z when three letters picked without replacement from dzzznnzdddzzd. 75/286 Four letters picked without replacement from {x: 4, u: 4, s: 12}. Give prob of picking 1 u, 2 x, and 1 s. 96/1615 Three letters picked without replacement from kkwbkupuuuuk. Give prob of picking 1 b and 2 u. 1/22 Four letters picked without replacement from vpppvppp. What is prob of picking 4 v? 0 Three letters picked without replacement from xaxaaa. Give prob of picking 3 a. 1/5 Two letters picked without replacement from {s: 2, d: 3, v: 2, r: 5}. Give prob of picking 2 r. 5/33 Three letters picked without replacement from {l: 11, g: 3}. What is prob of picking 3 l? 165/364 Calculate prob of picking 1 e and 2 a when three letters picked without replacement from {e: 7, p: 2, a: 3}. 21/220 Three letters picked without replacement from {g: 12, a: 7}. What is prob of picking 1 a and 2 g? 154/323 Calculate prob of picking 3 c when three letters picked without replacement from cccmcccccamccacaaaa. 55/323 Two letters picked without replacement from {q: 7, x: 6}. Give prob of picking 2 q. 7/26 Two letters picked without replacement from {i: 4, q: 3, n: 2, h: 3, w: 2, d: 1}. What is prob of picking 1 n and 1 d? 2/105 Calculate prob of picking 1 r and 2 u when three letters picked without replacement from uruz. 1/4 Calculate prob of picking 2 m when two letters picked without replacement from {t: 1, x: 4, j: 4, m: 5, k: 4, e: 1}. 10/171 Two letters picked without replacement from {e: 1, y: 2, x: 1, z: 1}. What is prob of picking 1 e and 1 y? 1/5 Two letters picked without replacement from {w: 17, d: 1}. What is prob of picking 2 w? 8/9 Four letters picked without replacement from kotmtjju. What is prob of picking 1 t, 1 o, 1 u, and 1 j? 2/35 Two letters picked without replacement from {o: 5, w: 4, n: 3, m: 4}. Give prob of picking 2 w. 1/20 Two letters picked without replacement from {p: 9, f: 9}. What is prob of picking 2 p? 4/17 What is prob of picking 1 x and 1 u when two letters picked without replacement from rauxauauxruru? 5/39 Four letters picked without replacement from ootjthjhj. Give prob of picking 1 t and 3 o. 0 Two letters picked without replacement from gwwkgwkkkwwkw. Give prob of picking 1 k and 1 w. 5/13 What is prob of picking 1 g and 1 w when two letters picked without replacement from {g: 3, a: 3, h: 2, w: 1, m: 2, v: 4}? 1/35 What is prob of picking 2 g when two letters picked without replacement from {g: 2, d: 2, t: 1, w: 1, c: 1, q: 1}? 1/28 What is prob of picking 1 b and 1 o when two letters picked without replacement from {b: 1, s: 2, h: 1, o: 1}? 1/10 Two letters picked without replacement from ddddqddqqdqddddddddq. Give prob of picking 1 q and 1 d. 15/38 Two letters picked without replacement from {j: 1, e: 2, r: 1, q: 2, m: 1}. What is prob of picking 1 m and 1 q? 2/21 Two letters picked without replacement from {l: 3, c: 1, h: 1, y: 5, m: 10}. What is prob of picking 2 y? 1/19 Calculate prob of picking 2 r, 1 m, and 1 k when four letters picked without replacement from {p: 2, k: 1, m: 1, r: 2}. 1/15 Calculate prob of picking 4 j when four letters picked without replacement from {j: 7, y: 1, f: 3, r: 1}. 7/99 Two letters picked without replacement from pppmppppppppmppm. What is prob of picking 1 p and 1 m? 13/40 Calculate prob of picking 1 x and 1 n when two letters picked without replacement from xnnxxxnnxn. 5/9 What is prob of picking 2 j and 2 n when four letters picked without replacement from {n: 7, j: 9}? 27/65 Two letters picked without replacement from {g: 1, r: 2, o: 1}. What is prob of picking 1 g and 1 r? 1/3 What is prob of picking 1 i and 1 u when two letters picked without replacement from edddhdieeufedhideded? 1/95 What is prob of picking 1 n and 1 w when two letters picked without replacement from {n: 5, z: 2, w: 12}? 20/57 Four letters picked without replacement from frrrrfrfffcffr. Give prob of picking 2 f and 2 r. 45/143 What is prob of picking 1 e and 1 r when two letters picked without replacement from rbrrrrerrrbrrbrrr? 13/136 Two letters picked without replacement from {g: 2, v: 2, w: 1}. What is prob of picking 1 g and 1 w? 1/5 Three letters picked without replacement from rswlrdpl. What is prob of picking 1 p, 1 d, and 1 w? 1/56 Three letters picked without replacement from cfllcclfldcuquulff. What is prob of picking 1 q, 1 l, and 1 d? 5/816 Two letters picked without replacement from {z: 4, k: 7, l: 1, h: 4, j: 3}. What is prob of picking 1 z and 1 j? 4/57 Three letters picked without replacement from {n: 1, w: 2, q: 8, l: 7, x: 2}. Give prob of picking 1 n and 2 q. 7/285 Four letters picked without replacement from brbrrbrrrrrbrrbbrrb. Give prob of picking 4 b. 35/3876 What is prob of picking 1 d and 2 h when three letters pi	{ "pile_set_name": "DM Mathematics" }
-0.1 in increasing order. -5, -3, -2/7, -9/85, -0.1, 0.5 Put 3, -4, 0.1, -1.6, 87, 0 in increasing order. -4, -1.6, 0, 0.1, 3, 87 Sort 4, -89, 5, -5, 4664 in increasing order. -89, -5, 4, 5, 4664 Sort -2, 1, -1140. -1140, -2, 1 Put 1, -1/4, 28471, 4 in descending order. 28471, 4, 1, -1/4 Put 41, -3/2, -4, 1/13 in descending order. 41, 1/13, -3/2, -4 Sort 11, 1, 3, 379, -5, 0. -5, 0, 1, 3, 11, 379 Put -3, 32, -484 in descending order. 32, -3, -484 Sort 3, 24909, -13 in ascending order. -13, 3, 24909 Sort -1, -4, -0.0565, 4, 1, 3. -4, -1, -0.0565, 1, 3, 4 Put -4.8, 0.1, -1, -30/13, -2 in decreasing order. 0.1, -1, -2, -30/13, -4.8 Put 1, 3, 18, -1, 0.069, -0.04 in descending order. 18, 3, 1, 0.069, -0.04, -1 Put 3, -12631, 248 in decreasing order. 248, 3, -12631 Sort -127, -1/6, -148, 2/7 in descending order. 2/7, -1/6, -127, -148 Put -5, -3/649, 156 in descending order. 156, -3/649, -5 Sort -35, 4, -24, 37. -35, -24, 4, 37 Put 3, 26, 1267 in ascending order. 3, 26, 1267 Put -15, -1265, 5, 18 in increasing order. -1265, -15, 5, 18 Sort 244, -5, -3433 in ascending order. -3433, -5, 244 Put -2/245, 0.0355, 2/11 in increasing order. -2/245, 0.0355, 2/11 Sort -5/8, 0.5, -151 in increasing order. -151, -5/8, 0.5 Put -0.2, -425, 3, 67, 0.4 in decreasing order. 67, 3, 0.4, -0.2, -425 Put -98824, 5, -6 in ascending order. -98824, -6, 5 Put 196, 5, -5, -37, -2/3 in descending order. 196, 5, -2/3, -5, -37 Sort 6, -85, -1, 2, -5. -85, -5, -1, 2, 6 Sort 0.2, 0.1, 5277, -11.7 in descending order. 5277, 0.2, 0.1, -11.7 Sort 2/7, -10, -2/95, 9 in increasing order. -10, -2/95, 2/7, 9 Sort -5, -84, -2, -1/9, 2.5 in ascending order. -84, -5, -2, -1/9, 2.5 Sort 100, -4, -2, 4 in ascending order. -4, -2, 4, 100 Sort -4, -3, -6, -1/3 in descending order. -1/3, -3, -4, -6 Sort -0.2, -0.4, -2/41, 1, 3/2, -8 in ascending order. -8, -0.4, -0.2, -2/41, 1, 3/2 Sort -28715, -2, 4, -8. -28715, -8, -2, 4 Put -16, -2, 32.17 in descending order. 32.17, -2, -16 Sort -1/6, 2/31, 0.1, -19 in increasing order. -19, -1/6, 2/31, 0.1 Sort 4, 0.04, -0.5, 93, -56 in ascending order. -56, -0.5, 0.04, 4, 93 Put 1, -1, 3, -2 in descending order. 3, 1, -1, -2 Sort -0.3, -2, 0.1, -4, 1726/3, 0.3 in decreasing order. 1726/3, 0.3, 0.1, -0.3, -2, -4 Sort 3, -2046, 2, 6, -4 in descending order. 6, 3, 2, -4, -2046 Put -14, 14, 4, -3, 2 in ascending order. -14, -3, 2, 4, 14 Put -24241, -6, 4 in descending order. 4, -6, -24241 Put 3, 2141, 22 in ascending order. 3, 22, 2141 Sort 0.11, -3/5, -0.1, -3/2, -319/6 in descending order. 0.11, -0.1, -3/5, -3/2, -319/6 Put -3, -36, 0, 9 in descending order. 9, 0, -3, -36 Put -5, 82, -0.1, -649 in decreasing order. 82, -0.1, -5, -649 Sort 0, 2589, -1, -5. -5, -1, 0, 2589 Put -3, -40, -8, 2, 1 in decreasing order. 2, 1, -3, -8, -40 Sort 23, 1067, -1, -3 in descending order. 1067, 23, -1, -3 Sort -7.961, -29, 3 in increasing order. -29, -7.961, 3 Sort -3, 60, 6, -4, 15 in descending order. 60, 15, 6, -3, -4 Put -0.1, -6021, 3, -1/76, -0.2 in decreasing order. 3, -1/76, -0.1, -0.2, -6021 Sort -0.3, -47/4, -0.2, 55/7, 2 in increasing order. -47/4, -0.3, -0.2, 2, 55/7 Put -514, 3, -0.3, 0.4 in descending order. 3, 0.4, -0.3, -514 Put 2, 940, 1, -9 in increasing order. -9, 1, 2, 940 Sort 96, -6, 54, 5 in ascending order. -6, 5, 54, 96 Put 724, 15, 1 in decreasing order. 724, 15, 1 Sort -70.3, 4/3, -6/5, -2 in increasing order. -70.3, -2, -6/5, 4/3 Sort 21732, -3, 6. -3, 6, 21732 Sort 12, 0, 153 in decreasing order. 153, 12, 0 Sort -3, -30, -2/11, -2.8. -30, -3, -2.8, -2/11 Put -4/13, -18, -4/5, -28 in descending order. -4/13, -4/5, -18, -28 Put 58, -6, -2, -24 in descending order. 58, -2, -6, -24 Put -2/3, -0.5, -1910 in descending order. -0.5, -2/3, -1910 Sort -5, 41, 1, 27 in increasing order. -5, 1, 27, 41 Put -12, 7, -50, 3, -4, -5 in descending order. 7, 3, -4, -5, -12, -50 Put 4/51, -2/7, 0.19, -5 in decreasing order. 0.19, 4/51, -2/7, -5 Put -165, 2105, 3 in increasing order. -165, 3, 2105 Put 2/11, -0.4, 1471.6 in descending order. 1471.6, 2/11, -0.4 Put 0.483, -1.8, 1/3 in ascending order. -1.8, 1/3, 0.483 Put -6, -21, 5/121 in descending order. 5/121, -6, -21 Sort 3, -539, -7/2 in increasing order. -539, -7/2, 3 Sort -251, 6/31, 4 in ascending order. -251, 6/31, 4 Sort 3, 2, 11, 2/7, 8/157. 8/157, 2/7, 2, 3, 11 Sort -205, -1, 6 in increasing order. -205, -1, 6 Put -4, -3, 7, 13, 37, -2 in decreasing order. 37, 13, 7, -2, -3, -4 Put -10, 3, -5, -52, -45, 4 in increasing order. -52, -45, -10, -5, 3, 4 Sort -1, 3, -12, 410, -3 in increasing order. -12, -3, -1, 3, 410 Put 1, -3, 2, -53, 134, 5 in descending order. 134, 5, 2, 1, -3, -53 Put 44, -40, -11 in descending order. 44, -11, -40 Put 36469, -2, 1, 4, 5 in decreasing order. 36469, 5, 4, 1, -2 Sort 1, 192, 0.04, -1, 0.4 in descending order. 192, 1, 0.4, 0.04, -1 Sort 3, -452, -512 in decreasing order. 3, -452, -512 Put -102/31, -2, 3, -0.08, 0.4 in descending order. 3, 0.4, -0.08, -2, -102/31 Sort -2/11, 2/65, -5, -54. -54, -5, -2/11, 2/65 Sort 6430, -1, 39, -3, 0, 4 in descending order. 6430, 39, 4, 0, -1, -3 Put -1, 2, -3, 0.0364, 3/7 in descending order. 2, 3/7, 0.0364, -1, -3 Put 1/4, -7, 2, -82 in ascending order. -82, -7, 1/4, 2 Put -3, -8, -5, -363 in descending order. -3, -5, -8, -363 Put -2, -5, 3/74, 0.3 in decreasing order. 0.3, 3/74, -2, -5 Put -2, -0.041, -385 in descending order. -0.041, -2, -385 Sort 5, -1, 516, -5, -7, -4 in descending order. 516, 5, -1, -4, -5, -7 Put 75, -3, -2, 3, 38, 5 in descending order. 75, 38, 5, 3, -2, -3 Sort -231113, 4, -7. -231113, -7, 4 Sort -2, -1/45, -0.9, -1, -10, -5 in increasing order. -10, -5, -2, -1, -0.9, -1/45 Sort 549, -16, -3, -2 in increasing order. -16, -3, -2, 549 Put -4/51, 5, -1/2, -1, -4 in decreasing order. 5, -4/51, -1/2, -1, -4 Put -0.4, -18768, -5, 15 in ascending order. -18768, -5, -0.4, 15 Sort -15/19, 6, 1/7, -3 in ascending order. -3, -15/19, 1/7, 6 Put 1/6, -180, 0, -6 in descending order. 1/6, 0, -6, -180 Sort 63, 5, -3, 4, -5, -8 in increasing order. -8, -5, -3, 4, 5, 63 Put -1.7, -4, -9.24, 2 in descending order. 2, -1.7, -4, -9.24 Sort 2/31, 0, -1494, -5, -13 in increasing order. -1494, -13, -5, 0, 2/31 Sort -1, -36, 1765, -11 in ascending order. -36, -11, -1, 1765 Put -2/9, -1.3, 25814 in ascending order. -1.3, -2/9, 25814 Put -1/17, 165, 0.038 in decreasing order. 165, 0.038, -1/17 Sort 57172, 3, 5, 7 in decreasing order. 57172, 7, 5, 3 Sort 48, 0.82, 0.022 in decreasing order. 48, 0.82, 0.022 Put 0.02721, 3, 5 in descending order. 5, 3, 0.02721 Sort -4, 93, 3, -50 in descending order. 93, 3, -4, -50 Sort 0, -59, -3, 4, -4, -13 in decreasing order. 4, 0, -3, -4, -13, -59 Sort 2, 5, 11, -8, 4, 15 in ascending order. -8, 2, 4, 5, 11, 15 Sort -0.4, 65708, 2, 3 in decreasing order. 65708, 3, 2, -0.4 Put -10, 3, 1, -6, -23 in decreasing order. 3, 1, -6, -10, -23 Put -1, -76, -99, -2 in descending order. -1, -2, -76, -99 Put -19, -5, -0.05, -2/109, -1/4 in descending order. -2/109, -0.05, -1/4, -5, -19 Put -20/7, 22/17, 1 in increasing order. -20/7, 1, 22/17 Sort 7764, -1/4, 0.03, 0.4 in ascending order. -1/4, 0.03, 0.4, 7764 Sort -0.45, -36, 0. -36, -0.45, 0 Put -5, -1392, -205 in increasing order. -1392, -205, -5 Put 5, -4, -1224, 0, -5 in ascending order. -1224, -5, -4, 0, 5 Put -2, -1/3, -1.09, -4 in ascending order. -4, -2, -1.09, -1/3 Sort 201, 8, 0.4, 0.1, 5 in descending order. 201, 8, 5, 0.4, 0.1 Put -12, -2, 1, -1, -62 in decreasing order. 1, -1, -2, -12, -62 Put -342, 2, 7, 4 in descending order. 7, 4, 2, -342 Sort 257, 1, 1.8, 2/15, -4 in increasing order. -4, 2/15, 1, 1.8, 257 Sort 208, 4, -4, 5, -12, 3. -12, -4, 3, 4, 5, 208 Sort -27, -440, 3 in descending order. 3, -27, -440 Put -5994, 0, 4 in increasing order. -5994, 0, 4 Sort -9, 0, -3, -4324, -5, -0.1. -4324, -9, -5, -3, -0.1, 0 Sort -2276/11, -2, 4/29, -5, 4, 3/2. -2276/11, -5, -2, 4/29, 3/2, 4 Put 5, 1/38, -2/133, 13 in ascending order. -2/133, 1/38, 5, 13 Put -0.06, 5/3, 1/6, 0.3, 82, -6 in descending order. 82, 5/3, 0.3, 1/6, -0.06, -6 Sort -3, 1, -2, -113, 2 in decreasing order. 2, 1, -2, -3, -113 Sort -18, 3, 0.75, -4/7. -18, -4/7, 0.75, 3 Sort 4, -0.1, 2, 5.8, 5. -0.1, 2, 4, 5, 5.8 Sort 0.1, 3, -2/9, 1519, -1/3, 21 in decreasing order. 1519, 21, 3, 0.1,	{ "pile_set_name": "DM Mathematics" }
t(11) Simplify 4(((sqrt(833) + (sqrt(833)-2)*2)2 + sqrt(833) - sqrt(833))1 + (sqrt(833)2-1 + 1)2 + 3). -56sqrt(17) + 40000 Simplify (-12(2sqrt(65) - sqrt(65) - sqrt(65))-4)/(sqrt(30)/sqrt(6)4 + 4sqrt(5)2). 0 Simplify (sqrt(96)/(sqrt(16)/sqrt(4)))/(sqrt(968)2) - (-2 + sqrt(6)/sqrt(2)3 + 1). -65sqrt(3)/22 + 1 Simplify ((-2 + (sqrt(1900) - (sqrt(1900) + 2sqrt(1900)))-6 + 4 + -4 + sqrt(1900) + sqrt(1900)-1)-6-4)2. -276480sqrt(19) + 157595904 Simplify 3 + (4 + (2 + (sqrt(448) + -1 + -5 + 5 - (sqrt(448) - sqrt(448)-1)-4-5))6)*2. -37440sqrt(7) + 24530791 Simplify ((sqrt(1872) + 1)3-2 - (sqrt(468) + (sqrt(468) - 1(2sqrt(468) + sqrt(468))) - 5(-1 + sqrt(468))))2. 792sqrt(13) + 16969 Simplify (-4(sqrt(132) + -1sqrt(132)-2 + (-3sqrt(132)2 - sqrt(132) - sqrt(132))))/(4-4sqrt(1728)-2). 5sqrt(11)/96 Simplify (sqrt(7) + -1sqrt(700) + 4 + -1(sqrt(567)1 - sqrt(567)) - (-6sqrt(28)-4 + -3 + -3))*2. -1140sqrt(7) + 22843 Simplify (-2(sqrt(99) + (sqrt(99) - (sqrt(99)3 + sqrt(99) + sqrt(99))-5))3)/((sqrt(72)2-4)/((sqrt(64)1)/sqrt(8))). 81sqrt(11)/4 Simplify -2(sqrt(1440) + (1-2sqrt(1440) - sqrt(1440)))/((5sqrt(72)6 + sqrt(72))/sqrt(9)). 24sqrt(5)/31 Simplify -5(sqrt(30)/sqrt(40) + 3 + (-1 + sqrt(3))2) + -3(2 + (-1sqrt(432))2 + (sqrt(432) + 0)-2). -1337 + 159sqrt(3)/2 Simplify (1 + ((-5 + sqrt(80) + sqrt(80) - sqrt(80)) + sqrt(5) + 2 + sqrt(80) + 2 + 3)2)-2-1. 72sqrt(5) + 820 Simplify 3((sqrt(231) + (sqrt(231)-2 - sqrt(231)))/sqrt(11))/(5sqrt(300)) + 4. -3sqrt(7)/25 + 4 Simplify (1(4 + sqrt(1300)-1 + sqrt(1300) + sqrt(1300)) + 3 - (-3 + 4 + (2sqrt(832) + sqrt(832) - sqrt(832))6))*2. -1032sqrt(13) + 96184 Simplify 5 + -4 + -5(-2 + sqrt(75)3)*2 + -4 + 3. -3395 + 300sqrt(3) Simplify ((1 + 1 + sqrt(147)-3 + (sqrt(147) + 6-1sqrt(147) - (sqrt(147) + 1 + sqrt(147) + sqrt(147) + 1 + sqrt(147))))-6)*2. 762048 Simplify (-6(-4(sqrt(275) + (sqrt(275)1 - sqrt(275))1 + sqrt(275)) + 1(sqrt(121)-3)/sqrt(11)5))*2. 1197900 Simplify 0 + -1 + ((4sqrt(65) + sqrt(65))3 + sqrt(65))/(sqrt(5) + sqrt(35)/sqrt(7)-6 + sqrt(5))-1. -1 + 4sqrt(13) Simplify ((((sqrt(882) - 2sqrt(882) - sqrt(882)) + sqrt(882))-6 - sqrt(882) - sqrt(882)) + sqrt(882))/(sqrt(54)/(sqrt(9)-2) + sqrt(18)/(sqrt(18)/sqrt(6))). 70sqrt(3) Simplify (-4 + (3 + 1sqrt(363)-5 - (-2 + -1(sqrt(363)-1 + sqrt(363)))))*2 + -2. -110sqrt(3) + 9074 Simplify ((((sqrt(360) - (sqrt(360) - (sqrt(360) - -4sqrt(360)2) - sqrt(360))) + sqrt(360) - sqrt(360)) + 2sqrt(360)-2)/(2sqrt(800)2))*2. 81/80 Simplify (-1sqrt(104)-4 + -1sqrt(104)-3 + sqrt(104))/((-4(sqrt(72) + (sqrt(72) - sqrt(72)-1)) - sqrt(72))/(sqrt(27)/sqrt(3)6)). -48sqrt(13)/13 Simplify -1-5(2(sqrt(252) + (sqrt(252) - 1-1sqrt(252)) + 0 + (sqrt(252) + 0)-2 + -4(sqrt(252) + 0))*2 + -2). 22670 Simplify ((4 + sqrt(252) + 1 - ((sqrt(175) - (3 + sqrt(175) - sqrt(175))) + 0)) + 5)-2. -26 - 2sqrt(7) Simplify ((sqrt(1100) + 5sqrt(1100) + 3 + sqrt(1100))*2 - sqrt(1100))3 + -1sqrt(11) + 5 + sqrt(176) + (sqrt(176) - (sqrt(176)5)*2). 1237sqrt(11) + 157332 Simplify 0 + 5 + (sqrt(34)/(sqrt(4)/sqrt(2)) + 3 + -1 + sqrt(17) - (-4(2 + sqrt(17)) + sqrt(17) + (-1 + (sqrt(17) - sqrt(17)1))*2)) + -5. 9 + 5sqrt(17) Simplify ((-5-2-21sqrt(228))/(-1sqrt(300)6-1))21. 76/9 Simplify (1-4(sqrt(270) + sqrt(270)-2 - sqrt(270)))/(-2sqrt(90)1-4). sqrt(3) Simplify (-6(-1(sqrt(187) - (-2sqrt(187) + sqrt(187) + sqrt(187) - sqrt(187))))/sqrt(11) - ((sqrt(136)4 + sqrt(136))2 - sqrt(136))/sqrt(8)6)*2. 29988 Simplify ((sqrt(102) - -2(sqrt(102)-2 + sqrt(102))) + sqrt(102) - 6sqrt(102)-1)/(-3sqrt(54) + sqrt(54) - sqrt(12)/(sqrt(2)1))4. -24sqrt(17)/7 Simplify -2(-4 + sqrt(704) + 4 + 1 + sqrt(704) + 2 + 1((0 + sqrt(704))-2 - (-1sqrt(704) + 5)2)). -160sqrt(11) + 1452 Simplify (sqrt(22)/sqrt(2) + -2)2 + sqrt(66)/(sqrt(18)/sqrt(3)) + 2 - (-5 + 0 + sqrt(704) + (sqrt(1100) + 0 - sqrt(1100))2 + sqrt(11)). -12sqrt(11) + 22 Simplify (4 + (sqrt(1088) - (sqrt(1088) + 0)) - -5sqrt(1088)-2)2 - (((sqrt(68) + 1 - sqrt(68))2 + -5 - sqrt(68)) + (2sqrt(68)1)2). -638sqrt(17) + 108548 Simplify 4 + (-2((-62sqrt(171) - sqrt(171)) + 1 + 1 + sqrt(171))2)*25. -11520sqrt(19) + 1970244 Simplify (-5 + 3 + -5 + sqrt(1088) + 1 + 31(sqrt(1088) + -3sqrt(1088) - sqrt(1088)) + 5)*2. 128sqrt(17) + 69633 Simplify (3(sqrt(91) + 5(sqrt(91) + 2sqrt(91) + sqrt(91)) + sqrt(91) + sqrt(91) - sqrt(91))-3)/((sqrt(441)/sqrt(9) + sqrt(49))/sqrt(7) - sqrt(175)2). 99sqrt(13)/4 Simplify 4(-4 + sqrt(448) + 0 + (0 + sqrt(448))-3) - (0 + (-1 + sqrt(448) - sqrt(448)) + -4((sqrt(448) + -1)2 + sqrt(448))). -96sqrt(7) + 1781 Simplify (sqrt(612) + -5(sqrt(612) + (sqrt(612) - (sqrt(612) + -2) - sqrt(612)) - sqrt(612))2)-1 - 2sqrt(187)/(-6(sqrt(11)-1 - sqrt(11)) + sqrt(11)). -1640sqrt(17)/13 + 3080 Simplify (sqrt(13) + sqrt(26)/sqrt(2))-6 + sqrt(13) - (4 + sqrt(13) + 1)2 - (sqrt(39)/(sqrt(3)-5 + sqrt(3)) + -5sqrt(52)/sqrt(4))2. -6341/16 - 21sqrt(13) Simplify -6-1(((sqrt(153) + -1 - sqrt(153)) + -4)*2 + 5(3 + sqrt(17) + -4)*2). -60sqrt(17) + 690 Simplify 2 + (sqrt(68)/(sqrt(4) + sqrt(36) + (sqrt(324) - sqrt(36)) + sqrt(4)) + 0)-2 + 4 + -3. -2sqrt(17)/11 + 3 Simplify ((sqrt(55) - -2sqrt(2695)) + (2sqrt(220))/sqrt(4))/(sqrt(180)-52 + sqrt(180))2 + 3. -17sqrt(11)/27 + 3 Simplify (13(-5 + (sqrt(80) - (sqrt(80) + -1)-5 - 6(1 + sqrt(80)))))*2. 2304 Simplify (((sqrt(36) + sqrt(216)/(sqrt(30)/sqrt(5)))/sqrt(12) + 3 + -3 + sqrt(147) + 2 + -2)-3)*2. 2187 Simplify (5((sqrt(567)-2 - sqrt(567))-6 - sqrt(567)) - -4-2sqrt(112))*2-1. -3761023 Simplify -5 + ((sqrt(33) - sqrt(33)25) + (sqrt(33) - ((sqrt(132) - -3sqrt(132)) + sqrt(33)) - sqrt(33)))/(sqrt(48)-5 + sqrt(3) + sqrt(18)/sqrt(6)-5). -5 + 3sqrt(11)/4 Simplify ((1sqrt(2205) - -2sqrt(1125))/((5sqrt(270)/sqrt(5) + sqrt(54) - sqrt(54))/sqrt(6)))2. 289/5 Simplify ((-5 + (-3sqrt(1900) - sqrt(1900)) - (-2sqrt(1900) + sqrt(1900) + 5 + sqrt(1900))) + (-2sqrt(1900)-6 - (sqrt(1900) + 0)2))*2. -1200sqrt(19) + 68500 Simplify ((sqrt(68) + 0 + 2sqrt(68) + sqrt(68) + -5)-4 + -3 - (-2 + ((sqrt(68)2 + sqrt(68) - sqrt(68))4 + 5)-6))2. 6272sqrt(17) + 72033 Simplify (sqrt(56)/sqrt(2))*2 - (sqrt(315)/sqrt(5))/sqrt(9) - ((-2sqrt(168)/sqrt(3))/sqrt(8) + -1). sqrt(7) + 29 Simplify (sqrt(30)/sqrt(10) + 5 - (sqrt(432) + 0 + sqrt(432) + sqrt(3)))*2 - (-3sqrt(225))/sqrt(3)-3. -285sqrt(3) + 1753 Simplify (sqrt(49)/(sqrt(175) + sqrt(175)1))2 + (sqrt(448)3)/sqrt(4) + (1 + ((sqrt(7) - (sqrt(1008) + 1))*2 - sqrt(7))5)4. 432sqrt(7) + 1696407/100 Simplify 4(sqrt(48))2 + -4sqrt(300) + sqrt(3) - ((-5sqrt(33))/sqrt(11) - (-2sqrt(27))/sqrt(9)). -36sqrt(3) + 192 Simplify ((sqrt(95) + sqrt(95)1 + sqrt(95))3)/(5sqrt(20)) - (sqrt(1216)-3-2 + sqrt(1216) + -3)*2. -59593 + 3369sqrt(19)/10 Simplify ((4 + (1 + sqrt(98))-4)6 - (5 + (sqrt(98) - (sqrt(98) + 2)) + sqrt(98) - (4 + sqrt(98) + sqrt(98) + 0)))*26. -1932sqrt(2) + 311058 Simplify (sqrt(162) + (sqrt(162) + sqrt(162)1 + sqrt(162))6 - sqrt(162) - (sqrt(162)-13 - sqrt(162)))/(2-2(sqrt(6) + sqrt(6)-2)) + 1. 1 + 33sqrt(3)/2 Simplify -53(sqrt(448) + (-1 + 1sqrt(448))*2) - (0 + sqrt(847)2-3 + 5). -6740 + 186sqrt(7) Simplify (sqrt(750) - -3sqrt(750)4)/(2sqrt(72)/(sqrt(96)/sqrt(8)))-2. -65sqrt(5) Simplify (sqrt(110) + -2(-1sqrt(110) - sqrt(110)))/sqrt(10) + (sqrt(121)/((-1sqrt(99))/sqrt(9)))*2 + (3sqrt(99) + 0 - (-5 + (sqrt(99)-3)2)). -875 + 14sqrt(11) Simplify ((0 + (sqrt(833)-2 + -1 + 3sqrt(833)1 - (-1sqrt(833)-3 - (-4 + -2sqrt(833)))))-5)2. 7000sqrt(17) + 333825 Simplify 6((5 + sqrt(325)2 + 2)*2 + ((sqrt(130) - (sqrt(130) + (sqrt(130) + 3sqrt(130))-5))/sqrt(10) + 3)2). 1560sqrt(13) + 39348 Simplify (0 + (-3 + ((1 + sqrt(153) + -2)-1 + 5)-5)*2)6. -5940sqrt(17) + 29484 Simplify -5 + ((sqrt(198) - 1sqrt(198))/sqrt(9))/(2sqrt(8)) - (-1 + 4 + (sqrt(99) + -1sqrt(99))*2 + 1). -9 Simplify ((-2sqrt(154)6)/(1sqrt(567)))/(sqrt(539) + sqrt(539) + -3sqrt(539) - 5sqrt(44)/sqrt(4)). sqrt(2)/9 Simplify -1 + (1 + sqrt(2736) + 2sqrt(2736)1 + (-2 + sqrt(2736))*	{ "pile_set_name": "DM Mathematics" }
p - 2 Collect the terms in -7n + 2n + 10n3 + n. 10n*3 - 4n Collect the terms in -i3 + 2 - 4 + 5. -i3 + 3 Collect the terms in -2n3 - 117 + 117 + 3n3. n3 Collect the terms in -81i2 + 29i*2 + 28i*2 + 20i*2. -4i*2 Collect the terms in -5h + 5h + 3h + 49h. 52h Collect the terms in 0 + 8241a2 - 8246a*2 + 0. -5a*2 Collect the terms in -9o + 24o - 3o - 5o - 10o. -3o Collect the terms in -520o + 1046o - 523o. 3o Collect the terms in 2g*3 - 37144 + 37144. 2g*3 Collect the terms in 2d*2 - 71d - d*2 - 6d. d*2 - 77d Collect the terms in 2b2 + 37b*3 - 2b*2 - 2b*3 + 3. 35b*3 + 3 Collect the terms in 64i - 47i3 - 64i. -47i3 Collect the terms in p - 2p + 5p3 - 45p*3 + 2p. -40p3 + p Collect the terms in 4l*2 - 1278 + 1278. 4l*2 Collect the terms in 2134h*2 - 1061h*2 - 1063h*2. 10h*2 Collect the terms in 26 - d + 7 - 42 + 9. -d Collect the terms in h - 8h*2 - h. -8h*2 Collect the terms in -28r + 1 - 1 + 0r. -28r Collect the terms in -205c3 + 26c*3 - 12c*3. -191c*3 Collect the terms in q - 22q - 16q. -37q Collect the terms in 52214u - 52214u - 3u2. -3u*2 Collect the terms in -14c + 32c - 37c. -19c Collect the terms in 1463z3 + z2 - z*2 - 733z*3 - 729z3. z3 Collect the terms in -547v - 559v + 1103v. -3v Collect the terms in -4t3 - 1134t*2 - 1141t*2 + 2275t*2. -4t*3 Collect the terms in -4v + 3v - 64v*3 + v. -64v*3 Collect the terms in 3a - 17a - 9a + 3a. -20a Collect the terms in 55133 - 7t2 - 55133. -7t*2 Collect the terms in 89b*3 - 15b*3 + 0b*2 + 2b*2. 74b*3 + 2b*2 Collect the terms in 30r - 30r - 16r*2 + 20r*2. 4r*2 Collect the terms in -1 - 28q*2 + 119q*2 + 80q*2. 171q*2 - 1 Collect the terms in 38u - 39u + 2u + 4u - 3u. 2u Collect the terms in -257a - 20a2 + 257a. -20a2 Collect the terms in 472 - 244 - 228 + 3h*2. 3h*2 Collect the terms in 281 + 6f - 4f - 4f. -2f + 281 Collect the terms in -315 + 627 - 312 - 4c*3 + 6c*3. 2c*3 Collect the terms in 21l - 166 + 166 - 8l. 13l Collect the terms in -o + 3o - 2o - 45o2. -45o*2 Collect the terms in 30u*2 - 7u*2 - 22u2. u2 Collect the terms in 38h3 + 13h*3 + 75h*3 + 176h*3. 302h*3 Collect the terms in -10f*3 + 4f2 + f2 + f*2. -10f*3 + 6f*2 Collect the terms in -5q - 7q - 9q + 22q. q Collect the terms in 281367z*2 - 3z*3 - 281367z*2. -3z*3 Collect the terms in 1006d*2 + 1011d*2 - 2018d2. -d2 Collect the terms in 22o3 - o2 - 16o*3 + 4o*2. 6o*3 + 3o*2 Collect the terms in -19y - 3 + 6 + 80y + 2. 61y + 5 Collect the terms in -147895t - 11t*2 + 147895t. -11t2 Collect the terms in -l3 - 100 + 100. -l3 Collect the terms in 4985s - 4985s - 15s*2. -15s*2 Collect the terms in 0t*2 + 1277 - 2t*2 - 640 - 637. -2t*2 Collect the terms in 4r - 2r - 11r + 7r. -2r Collect the terms in 2h3 - 1 - 2 + 6h*3. 8h*3 - 3 Collect the terms in 3q + 3305 - 3305. 3q Collect the terms in -p2 - 10p2 - p2. -12p2 Collect the terms in -884j - 296j + 37j. -1143j Collect the terms in -26i*3 + 5i - 3i - 2i + 25i3. -i3 Collect the terms in 0 + 0 + 43c - 44c. -c Collect the terms in 8t*3 + 160t*2 - 255t*2 + 95t*2. 8t*3 Collect the terms in -26u + 127u - 30u - 35u - 34u. 2u Collect the terms in -31v - 7 + 83v - 29v - 25v. -2v - 7 Collect the terms in 76y - 48y - 13y. 15y Collect the terms in 3g3 + 0g*3 - 11g*3 - 12g*3. -20g*3 Collect the terms in 3n*2 + 2n2 + n3 - 5n2. n3 Collect the terms in -p + 3p - p - 4p. -3p Collect the terms in -227q2 - 226q*2 + 449q*2. -4q*2 Collect the terms in -3b - 118b - 72b - 51b. -244b Collect the terms in -5l + 23l*3 + 6l - 3l + 40l*3. 63l*3 - 2l Collect the terms in -3 - 7o3 - 2 - 11 - 1. -7o*3 - 17 Collect the terms in 20t + t*2 - 38t + 6t + 12t. t*2 Collect the terms in -6a + 7 + 10a - 8a. -4a + 7 Collect the terms in 9q + 58q - 20q. 47q Collect the terms in 9 - 9 + 399x*2. 399x*2 Collect the terms in -18f + 30f - 9f + 5 - 5. 3f Collect the terms in 40p - p*3 - 8p*3 - 7p*3 - 38p. -16p3 + 2p Collect the terms in -6w2 - 3w*2 + 15w*2 + 0w*2. 6w*2 Collect the terms in 845m + 546m - 495m. 896m Collect the terms in -r2 + 5r + 97r - 102r. -r*2 Collect the terms in j + 260 - 260. j Collect the terms in -32v*2 - 23v*2 + 63v*2. 8v*2 Collect the terms in -13y*2 - 2y*2 + 2y*2 + 7y*2. -6y*2 Collect the terms in -91p*2 + 45p*2 + 45p2. -p2 Collect the terms in -13m + 2m - m. -12m Collect the terms in -54658 + 54658 + 9x*2. 9x*2 Collect the terms in 0 - 36201i*3 + 36202i3 + 0. i3 Collect the terms in -p - p + 2p + 122p*3. 122p*3 Collect the terms in 10k + 4004 - 4004. 10k Collect the terms in -140n*2 + 277n*2 - 146n*2. -9n*2 Collect the terms in 4 - 4 + 9m*2 - 11m*2. -2m*2 Collect the terms in 82 - 46 - u - 36. -u Collect the terms in 17 - 34 + 32b*2 + 17. 32b*2 Collect the terms in -29o + 56o - 30o. -3o Collect the terms in -4z*3 - 28z*2 + 14z*2 + 14z*2. -4z*3 Collect the terms in 19x*2 - 39x*2 + 12x*2. -8x*2 Collect the terms in 18o*3 - 23o*3 + 10o*3. 5o3 Collect the terms in p2 + 95 - 31 - 30 - 34. p*2 Collect the terms in 3923u - 7847u + 3919u. -5u Collect the terms in 11w - 26w + 40w*3 + 15w. 40w3 Collect the terms in -162248 + 162248 - 5o. -5o Collect the terms in 26m*2 + 11m*2 + 1 + 32m*2 + 10m*2. 79m*2 + 1 Collect the terms in -54w*2 + 54w*2 - 18w*3. -18w*3 Collect the terms in 2n*3 - 113n + 113n - 3n*3 + 2n3. n3 Collect the terms in -2v3 + 19 + 2 - 24 + 3. -2v*3 Collect the terms in 76o + 70o - 139o. 7o Collect the terms in -8a*3 + 20a*3 + 1 + 26a*3. 38a*3 + 1 Collect the terms in 2 + 718z - 2 - 715z. 3z Collect the terms in 7x - 13x - 6x3 + 6x. -6x3 Collect the terms in 4q*2 - 5q*2 - 6q*2. -7q*2 Collect the terms in 9d + 288 - 288. 9d Collect the terms in 3n*2 + 106n + 118n + n2 - 224n. 4n2 Collect the terms in 9 - 33o*3 - 1 - 8. -33o*3 Collect the terms in 6k - 3k + 0k. 3k Collect the terms in 2p*2 + 9660p - 9660p. 2p*2 Collect the terms in 3m + 3m + 7m - 2m. 11m Collect the terms in -2 + 3 + 87q - 1. 87q Collect the terms in 0s2 + 2s*2 - 7s*2. -5s*2 Collect the terms in 0 - 52s*2 - 34s*2 + 84s*2 + 0. -2s*2 Collect the terms in -12z + 12z + 6z. 6z Collect the terms in -150o - 38o3 + 150o + 120o3. 82o*3 Collect the terms in -12r - 2 + 2 + 9r2. 9r*2 - 12r Collect the terms in 156x3 + 21x*3 + 0x*3 + 52x*3. 229x*3 Collect the terms in 858k*2 - 431k*2 - 429k*2. -2k*2 Collect the terms in 16 - 16 - 10n*3. -10n*3 Collect the terms in -2k + 217 - 412 + 195. -2k Collect the terms in 51r*2 - 99r*2 + 51r*2. 3r*2 Collect the terms in 35 - 1622c - 35. -1622c Collect the terms in -2 - 2f*3 + 2 + 97f - 26f. -2f*3 + 71f Collect the terms in 74o3 - 20o*3 + 15o*3. 69o*3 Collect the terms in 14m - 6m + 10m. 18m Collect the terms in -30g + 16g + 16g. 2g Collect the terms in -45 + 0m - 3m2 + 0m. -3m2 - 45 Collect the terms in 504k*2 + 5 - 5. 504k*2 Collect the terms in 1574 - 2u - 1574. -2u Collect the terms in -4 - 6j + 4 - 10j. -16j Collect the terms in -34h2 - 33h*2 + 32h*3 + 67h*2. 32h*3 Collect the terms in 31r*2 - 9r*2 - 24r*2. -2r*2 Collect the terms in 29b - 26b + 10b. 13b Collect the terms in 2m - m*2 - 2m - 2m + 13m*2. 12m*2 - 2m Collect the terms in -29i3 + 43i*3 - 16i*3. -2i*3 Collect the terms in t + 0t - 12t3 - t. -12t*3 Collect the terms in -99515v + 49764v + 49754v. 3v Collect the terms in -39 + 3g*2 + 72 - 33. 3g*2 Collect the terms in 26q - 2q3 + 10q - 36q. -2q*3 Collect the terms in -4 + 5a*2 + 5 + 2 + 5. 5a*2 + 8 Collect the terms in 12x*2 - 10x*2 + 3x*2 - 6x2. -x2 Collect the terms in -5n2 - 5n*2 + 9n2. -n2 Colle	{ "pile_set_name": "DM Mathematics" }
(-490)/(-12) + (-41)/(-246). Let v = x - y. Is v a composite number? False Let d = -21 - -27. Suppose -228 = dh - 1626. Is h a composite number? False Let p = 376 + -247. Suppose 2x - 3f + 129 + p = 0, -124 = x + f. Let r = 739 + x. Is r composite? False Suppose -2b + 16 = 4s + 2b, 0 = -s - 4b + 10. Suppose -2q - sa + 1868 = 0, -a + 20 = 3a. Is q a composite number? False Suppose 3f + 11 = -d, -5d = -2f - 2f + 74. Let u = d - -12. Is (u + 1101/(-6))-2 composite? True Let t(g) = 4g*3 + 7g*2 + 21g + 31. Is t(11) composite? True Let z(m) = 0m2 - m2 + 55m*3 + 251m*3 - 1 + m. Suppose 0d - 5i = d + 24, i = 4d - 9. Is z(d) composite? True Let y(q) = -q*2 + q. Suppose 2h = -3m - 1, 4h + 9 = m - 0m. Let f be y(m). Suppose -395 = -fn - 5n. Is n a prime number? True Let q(v) = -4v + v*3 + 11 - 3v - v*2 - 5v*2. Let k be q(8). Suppose -65 = -4z + k. Is z a composite number? False Let m = 1649 + -922. Is m a composite number? False Let c = 14967 + -7658. Is c a prime number? True Suppose 21j = 15j + 18. Suppose -4i = -2w - 867 + 23, 5i = jw + 1055. Is i prime? True Suppose -5r - 85 = 5o, -o + 3r - 7 = 6. Let a = o - -20. Is 8/(-4)(-102)/a composite? True Let i = 11 + -17. Let r(a) = 4a2 + 6a + 3. Is r(i) prime? False Suppose 6v = 2v, 0 = j - 3v - 4. Let d = -2 + 2. Suppose -b + 1259 = -i, ji - i = d. Is b a prime number? True Let t(l) = 34l2 + 2l - 1. Let u(a) = -4a - 3. Let c(m) = -m. Let x(s) = 5c(s) - u(s). Let k be x(5). Is t(k) composite? False Suppose 0q - 2q = -5b + 3335, 4b + 12 = 0. Let k = 1120 + q. Let g = k - -1096. Is g a prime number? True Suppose j - 912 - 311 = 0. Is j prime? True Let z = 3981 + 6313. Is z composite? True Suppose 0 = 5a - 0 - 0. Suppose -2f + 490 + 508 = a. Is f a prime number? True Let n = 124018 + -83232. Is n a composite number? True Let a(q) = -431q - 339. Is a(-8) a prime number? True Suppose 3x - 3 = 21. Let i(s) = s*3 - 16s*2 + 10s - 6. Let r be i(x). Is r/(-3) - (-1 + 4) a prime number? False Suppose -9c = -17c + 56. Is c a prime number? True Suppose 72473 = 4i - 10t + 13t, 4i - 72475 = -t. Is i prime? True Is -1 + (-5585)/5-4 a prime number? False Let u(d) = 2d - 15. Let i be u(9). Let a(b) = 13b2 + 5b - 19. Is a(i) composite? False Suppose -4 = 7w - 18. Let f = 7 - 2. Suppose -x + 257 = 2t, -ft = -w - 13. Is x prime? True Let v(n) = 144n - 33. Is v(13) a composite number? True Let j(x) = 10x2 - x + 5. Let i = -16 + 11. Let q be j(i). Suppose 0 = 4a + 12 + 8, -3r + q = 5a. Is r a composite number? True Let b(f) = f*2 + 7f + 9. Let n be b(-6). Suppose -4s + c = -3c - 12812, -s + 3187 = nc. Is s a composite number? True Let j(r) = 440r*2 - 4r + 2. Let n(o) = o*3 + 6o*2 + 4o - 3. Let y be n(-5). Let t be j(y). Suppose -7i + 5i + t = 0. Is i prime? True Suppose 29h + 39972 = 168819. Is h prime? False Let j(f) = f3 - 23f*2 + 31f + 53. Is j(29) a prime number? False Suppose 0 = 2f - 4y + 1106, y = -4f - 2y - 2157. Let t = 387 + -679. Let x = t - f. Is x composite? False Is (-25/20)/(1/(-1642)) prime? True Let i(a) = -2a - 1. Let d be i(5). Let j(t) = -17t + 7. Let r be j(d). Suppose p + p = r. Is p composite? False Suppose -4p + 6 = 2t - 0t, -4p = -8. Is 1/t4 + 653 prime? False Is ((-5)/5)/(-4)127004 a prime number? True Let c(o) = 23o*2 + 2o - 2. Let f be 24/9 - (-2)/(-3). Let i be c(f). Is ((-3)/2 + 2)i composite? False Suppose -2k + o + 30 = 4o, 0 = -5k + 5o + 75. Is 6126/k + (-9)/(-15) a prime number? True Let y(d) = -39d + 4. Let o(t) = -39t + 4. Let f(n) = 5o(n) - 4y(n). Suppose 5h = -2q - 25, 3q = -2h + 3h + 5. Is f(h) composite? False Suppose 15 + 1 = 4b. Suppose -bl + 5 = -15. Suppose -4q + 12227 = lk, 3k - q - 9195 + 1869 = 0. Is k a prime number? False Let a(d) = 57d*2 + 2d + 3. Let b be a(-4). Suppose -c - b = -2c. Is c a composite number? False Suppose 0 = -5x + 5g - 4g + 20, 5x + 3g = 0. Suppose xq = -3, -3l = -2l - q - 1338. Is l a prime number? False Let z = 4130 + -1167. Is z a composite number? False Suppose 2q = -3q - m + 6, 18 = 3q - 3m. Suppose -qj + 4 = -2s - 14, 16 = s + 4j. Is (1/s)/(3/(-1524)) a composite number? False Let c(a) = 48a - 7. Let w be c(5). Let f = 103 - w. Is f/(-18) + 10/(-45) prime? True Is ((-4)/(-24))/(7/57162) prime? True Let h(l) = -5l*3 + 12l*2 + 3l + 7. Let m(w) = -3w3 + 6w*2 + 2w + 4. Let q(t) = 4h(t) - 7m(t). Is q(7) prime? False Is 1092456/(-192)(-8)/1 composite? True Let y(h) = 2h3 + h2 - h + 2. Let r(u) = 0u3 - u + 3 + 0 - u + u3. Let o(a) = -3r(a) + 2y(a). Is o(6) a prime number? True Suppose t = -4n + 1735, -2t = -0t - 4n - 3434. Let g = t - 1221. Is g a composite number? True Let n(t) = t3 + 13t*2 + 20t - 16. Let w be n(-11). Suppose wz = 14494 - 3472. Is z composite? True Let n be (7 - 4)1/1. Let k be (-67)/(n + (-106)/35). Suppose 16i - 11i - k = 0. Is i a prime number? False Let f(i) = -3i3 - 7i*2 + 2i + 31. Let j be f(-5). Let g be 168(0 + (-10)/(-3)). Let v = g - j. Is v a composite number? True Let p(t) = -t3 + 18t*2 - t + 17. Let l be p(18). Is (-331)/(-1)(l - 4)/(-5) composite? False Suppose 2n - 5z = 17502, -4z = 4n - 27121 - 7939. Is n a prime number? True Let q(o) = 3o + 9o*2 - 5o + 5 + 0o2 - 5o. Let g be q(12). Let f = -420 + g. Is f a prime number? True Suppose -2887b + 2879b + 30488 = 0. Is b a composite number? True Suppose 5c = 1101 - 196. Suppose 777 - c = 4b. Is b/((-2)/1 + 3) prime? True Let b be (3036/9 - -4)(6 - 0). Let l = 3199 - b. Is l prime? True Let y(q) = q2 + q + 2. Let a be y(-1). Let d be (2 - a) + 3 + -4. Is (7 - 8)(d - 184) prime? False Suppose -27 = -4u - 7. Suppose -3d + ud = 164. Is d composite? True Let n = 101 + -23. Suppose l - 7l = -n. Suppose -8t = -lt + 1015. Is t prime? False Let i(f) = 66f + 3. Let s(w) = -w3 + 4w - 3. Let m be s(2). Let n be i(m). Let k = n + 278. Is k a composite number? False Let z(g) = -g3 + g2 + g + 3. Suppose 5y = -0y. Let h be z(y). Suppose 0 = -5f - 5c + 320, 2f = 4f - hc - 153. Is f composite? True Suppose 0 = 4h - 4m - 28, -2 = 4h + 5m + 6. Let a be (18/2)/(h/15). Is 6/a - (-2113)/15 composite? True Suppose -8m = -3m. Suppose 805 = 6b + b. Suppose g - b - 88 = m. Is g composite? True Suppose s = -s + 14. Let x(n) = n*3 - 8n*2 + 8n - 2. Let i be x(s). Suppose io - 62 = -3y, -y + o = y - 37. Is y a prime number? True Suppose 8275 = -4w + 9w. Suppose i - 6i = -w. Is i a prime number? True Is 2/2 + 1196/1 - -4 a prime number? True Let v(x) = 527x + 113. Is v(4) prime? True Let z = 1 - -4. Suppose 5s = 0, -4w = 4s - zs - 3212. Suppose j + w = 5g + 210, -5j = 3g - 367. Is g prime? False Let x = -15776 - -29355. Is x a prime number? False Let c(j) = -2j + 3. Let a be c(-3). Let g = 69 + -75. Is 332/(-6)a/g a composite number? False Is 3/(-2)100862/(-87) a composite number? True Suppose -4c + 2c - 4362 = -4a, 4c + 12 = 0. Suppose 2z + z = a. Suppose -z = 3w + 2s - 1002, -2w = -3s - 413. Is w composite? False Let n = -31 + 189. Suppose -h = 3d - n, 0 = h - 2d + 4d - 153. Is h a prime number? False Let v(r) = r*3 - 4r*2 - 4r - 3. Let s be (-1 + -4)2/(-2). Let n be v(s). Suppose -40 = -2k - nk - q, -4q = -16. Is k prime? False Suppose 2i = -5j - 1 - 1, 2i = -j - 2. Suppose -l + 87 + 54 = j. Is l composite? True Let w(f) = f3 + 8f*2 - 7f + 12. Let p be w(-9). Let s be p/(-42) + (-68)/(-14). Suppose -3o + 117 = st, -3t = 5o - o - 156. Is o a composite number? True Let v = 924 - -9907. Is v a prime number? True Suppose 0 = -7c + 46832 + 46835. Is c composite? False Let z = -23693 - -88528. Is z a prime number? False Suppose 3b + 5i - 11129 + 3142 = 0, 4b - 10692 = 4i. Is b a composite number? True Let b(j) = 5 + j - j3 + 5j*2 - 4j + 0 + 2j. Let f be b(5). Suppose 0i + 4i - 868 = f. Is i composite? True Is 32839 + (-13 - -13)/(3/(-1)) a composite number? False Suppose 4v - 136 = -0v. Suppose 51y = 55y - 432. Let w = v + y. Is w prime? False Let r be 4(-30)/(-25) + (-4)/5. Suppose w - r = 0, 2b - 5w = -553 + 2127. Is b a prime number? True Suppose 0 = -7*j - 59 - 25	{ "pile_set_name": "DM Mathematics" }
28 + z. Determine p(y). 2 Let i be 3/(-2) - (-11)/(-22). Let g be (-12)/(-3) - 3i. Suppose 0 = 3y - g - 2. Let m(j) = j*3 - 3j*2 - 2j - 1. Calculate m(y). 7 Suppose 23 = 5x + 53. Let z(b) = b3 + 6b*2 - b - 10. What is z(x)? -4 Let z(a) = -4a*2 + 4a - 2. Suppose 2q - 44 = 28. Suppose -5f - q = 124. Let j = 34 + f. Calculate z(j). -10 Let t(r) = r - 2. Let h be (-38)/5 - 10/25. Let s be 66/h - 2/(-8). What is t(s)? -10 Let q = 7 + -8. Let z be (0 + 0)/(-4 + 2). Let i be 1 + q + 1 + z. Let a(x) = -2x + 1. Calculate a(i). -1 Let q = 620 - 621. Let m(f) = 7f - 4. What is m(q)? -11 Let h be 4 + -2 - 02/(-6). Let n be (2 + -1)1 - (2 - h). Let s(o) = 7o + 1. What is s(n)? 8 Let u(c) = 10c - 10. Let d be u(-7). Let q be 6/(-4)d/30. Let t be 6/q24/9. Let b(y) = y. Give b(t). 4 Let h(k) = -4k2 - 10k + 9. Let f(o) = 2o2 + 5o - 5. Let g(d) = -5f(d) - 3h(d). Suppose -5w = 4v + 16, 0 = -5v - 5w - 0 - 20. What is g(v)? 10 Let w(q) be the first derivative of q*4/8 - 2q3/3 + q2 - 11. Let n(y) be the second derivative of w(y). Calculate n(5). 11 Let v(c) = -11c2 - 12c - 3. Let h be (12/(-7))/((-6)/21). Let x(o) = 5o2 + 6o + 2. Let u(b) = hv(b) + 13x(b). Calculate u(7). 1 Let n(b) = 5 - 7 - 5b2 + 4 + 8b. Let c(y) = 4y2 - 7y - 2. Let z(q) = -6c(q) - 5n(q). What is z(-2)? 2 Let b(q) be the second derivative of q4/12 + q3/3 + 2q2 + 2q - 31. What is b(-3)? 7 Let m(a) = a*3 - 2a*2 + 3a - 1. Let t = -25 + 35. Suppose -3c = -2f - t, -c = -2c - 5f + 9. Let d = c + -2. Determine m(d). 5 Let w(s) = 3s3 - 6s*2 + 6s - 2. Let f(x) = 13x3 - 24x*2 + 24x - 8. Let g(k) = 2f(k) - 9w(k). Give g(4). 10 Let t(a) = 2a - 11. Let r(j) = 22j + 11 - 15 - 21j. Let v(g) = 8r(g) - 3t(g). What is v(1)? 3 Let f(k) = 4k + 5. Let o(i) = 9i + 10. Let x(y) = -7f(y) + 3o(y). Give x(-8). 3 Let v(a) = -a2 + 2a*2 + 2a + 5 + 5a. Let g = -656 + 651. Calculate v(g). -5 Let p = 14 + -17. Let j(n) = -n2 + 3. Give j(p). -6 Let q be (2 + -3)(12 + -11). Let t(x) = x. Let c(h) be the second derivative of -h*3/3 - 5h*2/2 - h. Let u(m) = qt(m) - c(m). What is u(-7)? -2 Let y be (-4 - -7)1(2 + 1). Let a = y + -13. Let s(u) = -u*2 - 2u - 4. Calculate s(a). -12 Let t(x) = -3x + 1. Let p(u) = -u - 1. Let z(m) = -4p(m) + 2t(m). Determine z(3). 0 Let g(l) be the first derivative of -1/120l*6 + 0l*3 + 1 + 5/2l*2 + 0l + 1/10l5 + 1/24l*4. Let h(k) be the second derivative of g(k). What is h(6)? 6 Let h(u) = u - 2. Suppose -5b = -5j + 65, 3j + 7b - 4b = 21. What is h(j)? 8 Suppose -r - 2r - 3m + 21 = 0, 2r + 14 = 5m. Let f be (-2)/(-6) + (-7)/r. Let d be (-1 - 4 - f) + 7. Let u(n) = n*3 - 3n*2 - 6n + 6. What is u(d)? -2 Let t(z) = z*2 - 11 - 10 + 11. Determine t(0). -10 Let n(a) = -25a + 3a + 7a - 1 + 3a + 6a - a*2. Determine n(-6). -1 Suppose 2t = 2j + 4, 4j - 3t = -j - 8. Suppose -4i = 6 - 2. Let p(s) = -1. Let k(o) = 4o - 4. Let d(y) = ik(y) + jp(y). Determine d(4). -11 Let u(t) = -2t - 9. Suppose -3x - 4s = 2x - 127, 0 = 4x + 4s - 104. Let p = x + -29. Calculate u(p). 3 Suppose 0 = 695f - 702f - 70. Let i(d) = -2d - 15. Determine i(f). 5 Let c(d) be the second derivative of -d*5/20 + 7d4/12 + d3/2 + 3d2 - 169d - 3. Give c(7). 27 Suppose -v + 4p = 37, 3v - 5p + 245 = -2v. Let h = 59 + v. Let r(y) = -1. Let j(t) = -t + 2. Let n(z) = -j(z) - 2r(z). What is n(h)? 6 Let z(s) be the first derivative of s2 - 8s + 1. Suppose 30 + 12 = 7q. Calculate z(q). 4 Suppose 10 = 294k - 292k. Let l(u) = -12u + 3. Determine l(k). -57 Let m(i) = 7i2 - 3i - 2i2 - 4i2 + i3. Let q be 828/(-299) - (-18)/(-78). What is m(q)? -9 Let v(o) = o*2 + 5o - 22. Let m be v(-9). Let s(h) = -m + 2h - 70h*2 + 71h*2 - 3h. Let z = -1 + 1. Give s(z). -14 Let f be 0/1 + 0/(-21). Suppose -8x + 7x = f. Let l(q) be the second derivative of q3/6 - q2 + 2q. Give l(x). -2 Suppose 10 = r + 4r. Let h(o) = 7o2 - o + 36. Let t(c) = 15c*2 - 2c + 78. Let z(m) = -13h(m) + 6t(m). What is z(r)? -2 Let m(i) = 32i - 7. Let o(b) = 17b - 4. Let p(d) = -6m(d) + 11o(d). Let s be (6 - 0)/(-2 + 0). Calculate p(s). 13 Suppose 12 = 3a + 4v - 3, 3a = v. Let d(u) = -3u*2 - 3u + 4. What is d(a)? -2 Let y(b) = 2b2 - 1. Let d(h) = h2 - 7h - 16. Let s be d(9). Suppose -8n = -3n + 15, 5a + 3 = -n. Let w be (1 - a)(-2)/s. Give y(w). 1 Let s(r) = 6. Let m(i) = 14i - 23. Let c(h) = -m(h) - 4s(h). Calculate c(1). -15 Let o(g) be the first derivative of -g3/6 + g2 - 9g + 10. Let h(v) be the first derivative of o(v). Calculate h(7). -5 Let u(t) = -3t - 4t3 - 3t2 + t3 + t*2 + 7. Let y(s) = 122s + 977. Let n be y(-8). Let m(c) = -c*3 + 1. Let f(i) = nu(i) - 4m(i). Calculate f(3). 3 Let p(s) = 2s - 8. Let n be p(8). Let z = n + -3. Suppose zr = -7 + 2. Let b(q) = 7q*3 - 2q*2 - q. Give b(r). -8 Let b = 3 + 2. Let f(x) = 5x*2 + 8x - 6. Let n(a) = -8a2 - 15a + 11. Let z(o) = -5f(o) - 3n(o). Calculate z(b). -3 Suppose -13 = 7w + 1. Let m(t) = -5t*3 - 4t*2 - 3t - 2. What is m(w)? 28 Let t be -1 - 1/(-4 + 3). Let y(u) = -3u - 1 + tu + 4u + 10. Let q be y(-12). Let g(m) = -m2 - 6m - 2. Determine g(q). 7 Let g(x) = 3 + 0x + x2 - 13x + 3x - 1. What is g(8)? -14 Let s = -654 - -651. Let i(l) = 2l*2 + l + 1. Calculate i(s). 16 Suppose -3q + 2c = -19, -q + 5c = 4q - 25. Suppose -q + 1 = -t. Let z(a) = -4 + 9a*3 - 4a*2 - ta*3 - 2a*2 - 6a + a*2. Calculate z(6). -4 Let y(g) = 31g*3 - 2g2 + g. Let k(j) = -j3 + 8j2 + 5j + 37. Let d be k(9). What is y(d)? 30 Let u(x) = -x*2 - 224854x + 4 + 224855x + 5. Calculate u(-5). -21 Let u be 4/3(-2 - -8). Let b(o) be the third derivative of o*6/120 - 7o*5/60 - 7o4/24 - o3 - 2924o2. Determine b(u). 2 Let h(y) = 172 - 342 + 170 - y. Let i(j) = 18j. Let f(o) = 5h(o) + i(o). Determine f(1). 13 Let a = -20 - -20. Let k(d) = 84 + d3 - 42d + d*2 - 76 + 43d. Give k(a). 8 Let d(c) = -111c2 - 6c - 23. Let j(g) = -51g2 - 3g - 11. Let v(x) = -6d(x) + 13j(x). Calculate v(4). 31 Let q be 3(-3)/(54/120). Suppose 2k - 18 + 2 = 0. Let d be (0 + q/k)2. Let n(r) = -r3 - 5r2 - 1. Calculate n(d). -1 Let f(h) = h3 + 1. Let d(w) = 3w2 - 3w - 6. Let c(n) = -d(n) - 2f(n). Calculate c(-3). 22 Let c(f) be the first derivative of f3/3 - f2 - 3. Let s = 29 + -27. Let x be c(s). Let i(p) = p2 - p + 9. What is i(x)? 9 Let p(b) be the first derivative of -b4/4 - 16b*3/3 - 15b*2/2 + 8b - 495. Determine p(-15). 8 Suppose -3m = -6i + 2i + 13, 4m = 5i - 15. Suppose -4q = 5r + 6, -2r - 5 = 4q + i. Let g(s) = -4s - 2 + s + 7 + rs. Give g(5). 0 Suppose 0 = 5t + 4w - 98, -189t + 194t - 86 = 2w. Let s(k) = k*3 - 18k*2 + 3. What is s(t)? 3 Let j(o) = 2o + 7o + 3o - o*2 - 1 - 10o. What is j(-2)? -9 Let t be 3(-1 - -4 - 2). Let m(z) be the first derivative of z2/2 + 3. Give m(t). 3 Suppose 70 - 90 = -10q. Let l(r) be the first derivative of 1 - 3/2rq + 4/3r*3 - 1/4r*4 - 4r. What is l(3)? -4 Suppose 0 = -4z - 59 + 67. Let y(r) = 6r*2 - 18r*2 - r + 7r2 + z + r3. Give y(5). -3 Let i be 4 - 1/(3/6). Let k be (i/(-6))/((-9)/54). Let b(y) = -4y + 4 - 12 - yk + 2. Give b(-6). -18 Let r(n) = 2n - 1. Let t = 156 - 156. Calculate r(t). -1 Suppose 50l - 39l = -88. Let u(h) = -h*2 - 6h + 9. Calculate u(l). -7 Let w(a) = a + 1. Suppose -q - 32 = 10z - 13z, -q = 5. Calculate w(z). 10 Let t(q) be the third derivative of q5/60 - q4/8 + q*3/2 + 169q*2 + 2q. Give t(2). 1 Let u = 16 - -343. Suppose 0 = -uh + 363h - 8. Let z(o) = -2 + 0o + o - o2 + 0. Calculate z(h). -4 Let g be -3 + (4 - 0/(-2)). Let z(h) = g + 0h - 4h + 3h - 2. Suppose 7f - 4f - 4o = 35, -5o = -2f + 35. Determine z(f). -6 Let w(t) = 9 - 6t*2 - 5t*2 + 12t*2 - 155t + 166t. Give w(-11). 9 Let o(b) = b2 - 2b - 1. Let f(l) = -3l2 + 7l + 2. Let w(h) = -2h2 - 11. Let k be w(0). Let j(q) = ko(q) - 4f(q). Give j(5). -2 Let y(z) = 5z3 - z2 - 2z - 1. Let k be 2/8-6(-18)/(-27). Give y(k). -5 Let p(i) = i + 5. Let h(z) be the third derivative of z6/20 + z5/60 + z4/12 + z3/6 - 2z**2. L	{ "pile_set_name": "DM Mathematics" }
5504? 2, 43 List the prime factors of 6420. 2, 3, 5, 107 What are the prime factors of 1472? 2, 23 List the prime factors of 1266. 2, 3, 211 What are the prime factors of 13750? 2, 5, 11 List the prime factors of 99451. 11, 9041 List the prime factors of 96587. 96587 List the prime factors of 41973. 3, 17, 823 What are the prime factors of 5616? 2, 3, 13 List the prime factors of 29. 29 What are the prime factors of 11350? 2, 5, 227 List the prime factors of 1493. 1493 List the prime factors of 37320. 2, 3, 5, 311 List the prime factors of 3752. 2, 7, 67 What are the prime factors of 3840? 2, 3, 5 List the prime factors of 965. 5, 193 List the prime factors of 5134. 2, 17, 151 List the prime factors of 117. 3, 13 List the prime factors of 117538. 2, 17, 3457 List the prime factors of 75736. 2, 9467 What are the prime factors of 3843? 3, 7, 61 List the prime factors of 47902. 2, 43, 557 List the prime factors of 7532. 2, 7, 269 List the prime factors of 29981. 7, 4283 List the prime factors of 39900. 2, 3, 5, 7, 19 What are the prime factors of 12180? 2, 3, 5, 7, 29 List the prime factors of 3928. 2, 491 What are the prime factors of 472? 2, 59 List the prime factors of 13654. 2, 6827 What are the prime factors of 86781? 3, 28927 List the prime factors of 7014. 2, 3, 7, 167 What are the prime factors of 5458? 2, 2729 What are the prime factors of 3688? 2, 461 List the prime factors of 7033. 13, 541 What are the prime factors of 2224? 2, 139 List the prime factors of 560. 2, 5, 7 List the prime factors of 7706. 2, 3853 List the prime factors of 4533. 3, 1511 What are the prime factors of 12585? 3, 5, 839 What are the prime factors of 3475? 5, 139 What are the prime factors of 7472? 2, 467 What are the prime factors of 7002? 2, 3, 389 List the prime factors of 94128. 2, 3, 37, 53 What are the prime factors of 22603? 7, 3229 List the prime factors of 19805. 5, 17, 233 List the prime factors of 342. 2, 3, 19 What are the prime factors of 1044? 2, 3, 29 What are the prime factors of 53252? 2, 13313 What are the prime factors of 2266? 2, 11, 103 List the prime factors of 1337. 7, 191 What are the prime factors of 3237? 3, 13, 83 List the prime factors of 2846. 2, 1423 List the prime factors of 1248. 2, 3, 13 What are the prime factors of 20666? 2, 10333 What are the prime factors of 40092? 2, 3, 13, 257 What are the prime factors of 10184? 2, 19, 67 List the prime factors of 35489. 23, 1543 List the prime factors of 53. 53 List the prime factors of 790. 2, 5, 79 What are the prime factors of 12343? 12343 What are the prime factors of 7039? 7039 List the prime factors of 352. 2, 11 What are the prime factors of 2349? 3, 29 What are the prime factors of 2773? 47, 59 What are the prime factors of 15480? 2, 3, 5, 43 List the prime factors of 104251. 7, 53, 281 What are the prime factors of 2235? 3, 5, 149 What are the prime factors of 2366? 2, 7, 13 What are the prime factors of 2214? 2, 3, 41 List the prime factors of 416. 2, 13 What are the prime factors of 1670? 2, 5, 167 What are the prime factors of 2974? 2, 1487 List the prime factors of 2578. 2, 1289 List the prime factors of 5438. 2, 2719 What are the prime factors of 5604? 2, 3, 467 What are the prime factors of 33398? 2, 16699 List the prime factors of 492. 2, 3, 41 What are the prime factors of 12922? 2, 7, 13, 71 What are the prime factors of 1457? 31, 47 What are the prime factors of 2547? 3, 283 What are the prime factors of 662? 2, 331 What are the prime factors of 96492? 2, 3, 11, 17, 43 List the prime factors of 32290. 2, 5, 3229 List the prime factors of 2915. 5, 11, 53 What are the prime factors of 77348? 2, 61, 317 List the prime factors of 6391. 7, 11, 83 List the prime factors of 1332. 2, 3, 37 List the prime factors of 13252. 2, 3313 What are the prime factors of 5233? 5233 What are the prime factors of 16685? 5, 47, 71 What are the prime factors of 580? 2, 5, 29 List the prime factors of 23037. 3, 7, 1097 What are the prime factors of 7996? 2, 1999 What are the prime factors of 19924? 2, 17, 293 What are the prime factors of 768? 2, 3 List the prime factors of 14847. 3, 7, 101 What are the prime factors of 618? 2, 3, 103 List the prime factors of 65597. 7, 9371 What are the prime factors of 1289? 1289 List the prime factors of 2538. 2, 3, 47 What are the prime factors of 11048? 2, 1381 What are the prime factors of 417? 3, 139 What are the prime factors of 2973? 3, 991 List the prime factors of 3323. 3323 List the prime factors of 5748. 2, 3, 479 List the prime factors of 152801. 11, 29, 479 List the prime factors of 109788. 2, 3, 7, 1307 What are the prime factors of 3133? 13, 241 What are the prime factors of 2442? 2, 3, 11, 37 What are the prime factors of 770? 2, 5, 7, 11 List the prime factors of 1940. 2, 5, 97 What are the prime factors of 52666? 2, 17, 1549 List the prime factors of 14205. 3, 5, 947 What are the prime factors of 2335? 5, 467 List the prime factors of 3574. 2, 1787 What are the prime factors of 2683? 2683 What are the prime factors of 523? 523 What are the prime factors of 1964? 2, 491 List the prime factors of 122702. 2, 19, 3229 List the prime factors of 485. 5, 97 List the prime factors of 166. 2, 83 What are the prime factors of 2359? 7, 337 What are the prime factors of 6971? 6971 List the prime factors of 43815. 3, 5, 23, 127 List the prime factors of 9524. 2, 2381 What are the prime factors of 78198? 2, 3, 13033 List the prime factors of 9778. 2, 4889 List the prime factors of 479. 479 List the prime factors of 33358. 2, 13, 1283 List the prime factors of 38803. 38803 What are the prime factors of 2772? 2, 3, 7, 11 List the prime factors of 1681. 41 What are the prime factors of 39405? 3, 5, 37, 71 List the prime factors of 1733. 1733 List the prime factors of 892. 2, 223 What are the prime factors of 14577? 3, 43, 113 List the prime factors of 144. 2, 3 List the prime factors of 5410. 2, 5, 541 What are the prime factors of 4585? 5, 7, 131 What are the prime factors of 1544? 2, 193 List the prime factors of 38626. 2, 7, 31, 89 List the prime factors of 3577. 7, 73 What are the prime factors of 692? 2, 173 List the prime factors of 8470. 2, 5, 7, 11 List the prime factors of 1567. 1567 List the prime factors of 38816. 2, 1213 List the prime factors of 7768. 2, 971 What are the prime factors of 23474? 2, 11, 97 List the prime factors of 15181. 17, 19, 47 List the prime factors of 6847. 41, 167 What are the prime factors of 19636? 2, 4909 What are the prime factors of 108081? 3, 4003 What are the prime factors of 40811? 37, 1103 What are the prime factors of 6760? 2, 5, 13 List the prime factors of 1722. 2, 3, 7, 41 List the prime factors of 2486. 2, 11, 113 List the prime factors of 1385. 5, 277 List the prime factors of 8517. 3, 17, 167 List the prime factors of 40431. 3, 13477 What are the prime factors of 10415? 5, 2083 What are the prime factors of 25076? 2, 6269 List the prime factors of 17408. 2, 17 What are the prime factors of 3074? 2, 29, 53 What are the prime factors of 2073? 3, 691 List the prime factors of 23019. 3, 7673 What are the prime factors of 837? 3, 31 What are the prime factors of 86654? 2, 37, 1171 What are the prime factors of 255? 3, 5, 17 List the prime factors of 11685. 3, 5, 19, 41 What are the prime factors of 2150? 2, 5, 43 What are the prime factors of 6928? 2, 433 List the prime factors of 10211. 10211 What are the prime factors of 33926? 2, 16963 What are the prime factors of 526? 2, 263 List the prime factors of 18538. 2, 13, 23, 31 What are the prime factors of 330? 2, 3, 5, 11 List the prime factors of 1961. 37, 53 What are the prime factors of 8897? 7, 31, 41 What are the prime factors of 3369? 3, 1123 List the prime factors of 1296. 2, 3 List the prime factors of 12195. 3, 5, 271 What are the prime factors of 8977? 47, 191 List the prime factors of 8416. 2, 263 What are the prime factors of 94102? 2, 47051 List the prime factors of 24802. 2, 12401 What are the prime factors of 27523? 17, 1619 What are the prime factors of 6533? 47, 139 List the prime factors of 48821. 48821 What are the prime factors of 7920? 2, 3, 5, 11 List the prime factors of 22429. 11, 2039 What are the prime factors of 38568? 2, 3, 1607	{ "pile_set_name": "DM Mathematics" }
. 2/13 Four letters picked without replacement from efnnnkrrrknin. Give prob of picking 2 n, 1 k, and 1 e. 4/143 Two letters picked without replacement from {k: 1, z: 1, e: 2, s: 2, x: 2}. Give prob of picking 1 z and 1 s. 1/14 Calculate prob of picking 1 r and 1 v when two letters picked without replacement from {f: 1, b: 2, v: 4, r: 7}. 4/13 What is prob of picking 1 n and 1 o when two letters picked without replacement from {o: 6, n: 2}? 3/7 Calculate prob of picking 4 p when four letters picked without replacement from ppwwppwpwpww. 1/33 Two letters picked without replacement from mmmkmmmmmmkmmmmmmk. What is prob of picking 2 m? 35/51 Two letters picked without replacement from qhhqpqqqqpqqqqq. What is prob of picking 1 p and 1 h? 4/105 Three letters picked without replacement from {t: 2, x: 1, y: 4}. What is prob of picking 2 t and 1 y? 4/35 Two letters picked without replacement from {s: 3, a: 2}. What is prob of picking 2 s? 3/10 Four letters picked without replacement from {d: 3, g: 1, l: 1, u: 2, h: 3}. Give prob of picking 1 l, 1 u, 1 g, and 1 d. 1/35 Calculate prob of picking 1 b and 2 u when three letters picked without replacement from yyuuuubuyyuybyb. 9/91 Two letters picked without replacement from {v: 3, g: 12}. Give prob of picking 2 g. 22/35 Two letters picked without replacement from {i: 4, d: 2}. Give prob of picking 2 i. 2/5 What is prob of picking 1 d and 3 c when four letters picked without replacement from {c: 7, d: 3}? 1/2 Four letters picked without replacement from {b: 7, d: 1}. Give prob of picking 4 b. 1/2 Two letters picked without replacement from {n: 1, x: 2}. What is prob of picking 1 x and 1 n? 2/3 Three letters picked without replacement from {a: 3, b: 2, w: 3, t: 5}. What is prob of picking 1 t, 1 a, and 1 w? 45/286 Calculate prob of picking 1 r and 1 y when two letters picked without replacement from rfqvqyfvvrvtqrrrrr. 7/153 Two letters picked without replacement from sssbbbbssbesbbmjbsje. Give prob of picking 1 j and 1 e. 2/95 Two letters picked without replacement from {l: 3, v: 4, o: 9, x: 2}. Give prob of picking 2 v. 2/51 Three letters picked without replacement from {z: 10, f: 10}. Give prob of picking 2 z and 1 f. 15/38 Calculate prob of picking 2 r when two letters picked without replacement from zzzrzrzzzzzzzrz. 1/35 What is prob of picking 1 s and 1 b when two letters picked without replacement from nsmntbmttsnbs? 1/13 Two letters picked without replacement from mgmbmgggbmbg. What is prob of picking 2 b? 1/22 Calculate prob of picking 1 y and 1 k when two letters picked without replacement from {y: 4, g: 5, v: 1, e: 4, k: 2}. 1/15 What is prob of picking 4 t when four letters picked without replacement from {z: 4, t: 7}? 7/66 Two letters picked without replacement from {q: 3, a: 2, n: 3, o: 6, i: 4}. What is prob of picking 2 o? 5/51 Calculate prob of picking 2 i and 2 w when four letters picked without replacement from {i: 4, w: 2}. 2/5 What is prob of picking 3 e and 1 h when four letters picked without replacement from heeeehheehhheheheh? 21/85 What is prob of picking 1 g and 1 x when two letters picked without replacement from guxuhhxgugaxhuhhhh? 1/17 Two letters picked without replacement from {f: 5, a: 1, b: 1, l: 4, o: 1, u: 1}. What is prob of picking 1 f and 1 a? 5/78 What is prob of picking 1 o, 1 q, and 1 r when three letters picked without replacement from {q: 3, o: 15, r: 2}? 3/38 Four letters picked without replacement from ssbpsbbpssubs. What is prob of picking 1 u, 1 p, and 2 s? 6/143 Three letters picked without replacement from {x: 1, c: 4, a: 2}. Give prob of picking 1 x and 2 a. 1/35 What is prob of picking 1 y, 2 j, and 1 n when four letters picked without replacement from njzjnjynnnnnjnnj? 9/182 Calculate prob of picking 4 n when four letters picked without replacement from znncznznnz. 1/42 Calculate prob of picking 1 z, 2 o, and 1 t when four letters picked without replacement from {s: 3, y: 2, z: 2, t: 4, o: 2}. 8/715 Two letters picked without replacement from {n: 3, e: 3, z: 1}. Give prob of picking 1 n and 1 z. 1/7 Four letters picked without replacement from tttitttttitittt. Give prob of picking 1 t and 3 i. 4/455 Calculate prob of picking 1 y and 2 u when three letters picked without replacement from {u: 2, y: 5}. 1/7 Four letters picked without replacement from ksllislkllllks. What is prob of picking 2 k and 2 s? 9/1001 Calculate prob of picking 1 x and 3 f when four letters picked without replacement from xfxxxxxxfxxf. 1/55 Two letters picked without replacement from {l: 6, h: 13}. What is prob of picking 2 h? 26/57 Calculate prob of picking 1 x and 1 a when two letters picked without replacement from {a: 4, n: 1, q: 2, x: 7}. 4/13 Two letters picked without replacement from {u: 9, s: 10}. Give prob of picking 1 s and 1 u. 10/19 Three letters picked without replacement from {f: 1, o: 1, r: 1}. What is prob of picking 1 f and 2 o? 0 What is prob of picking 2 b when two letters picked without replacement from kkkbkbkkkk? 1/45 Two letters picked without replacement from {s: 6, d: 11, e: 1}. What is prob of picking 1 e and 1 s? 2/51 What is prob of picking 1 r and 1 w when two letters picked without replacement from {r: 9, g: 1, w: 6, q: 2}? 6/17 Two letters picked without replacement from {r: 1, u: 5, c: 4}. Give prob of picking 2 u. 2/9 What is prob of picking 4 t when four letters picked without replacement from {s: 3, g: 4, t: 4, d: 2, q: 1}? 1/1001 Four letters picked without replacement from qhzzzzzqqpszz. Give prob of picking 2 z, 1 q, and 1 p. 63/715 Four letters picked without replacement from {q: 9, k: 10}. Give prob of picking 3 k and 1 q. 90/323 What is prob of picking 2 t when two letters picked without replacement from {h: 1, b: 6, t: 7}? 3/13 What is prob of picking 1 e and 3 x when four letters picked without replacement from jeexeevexjjexj? 6/1001 What is prob of picking 1 t and 1 j when two letters picked without replacement from ngtgj? 1/10 Two letters picked without replacement from {f: 1, c: 3, t: 6, v: 1, k: 1}. What is prob of picking 1 k and 1 c? 1/22 Three letters picked without replacement from ojljeolllojlloloo. What is prob of picking 2 o and 1 e? 3/136 Three letters picked without replacement from {u: 10, p: 2}. What is prob of picking 2 p and 1 u? 1/22 What is prob of picking 1 g and 2 o when three letters picked without replacement from {g: 1, o: 3, h: 3, f: 2, e: 1}? 1/40 Calculate prob of picking 3 m when three letters picked without replacement from {s: 6, r: 1, c: 1, f: 3, a: 3, m: 5}. 10/969 What is prob of picking 2 z and 2 i when four letters picked without replacement from iiiziiiizii? 6/55 What is prob of picking 2 d when two letters picked without replacement from qqqqqqdqqdqqq? 1/78 Calculate prob of picking 2 u and 1 p when three letters picked without replacement from vggdguuuuvvggggp. 3/280 Two letters picked without replacement from pxxpxspsx. Give prob of picking 2 s. 1/36 Calculate prob of picking 1 p and 1 a when two letters picked without replacement from pnnna. 1/10 Two letters picked without replacement from {l: 5, c: 5, s: 3, y: 1, b: 1}. What is prob of picking 1 b and 1 c? 1/21 What is prob of picking 1 r and 2 p when three letters picked without replacement from ppmryypppyprypppp? 9/68 Two letters picked without replacement from wwkwwwkwkw. Give prob of picking 2 k. 1/15 What is prob of picking 2 g and 2 f when four letters picked without replacement from {g: 7, m: 1, f: 5}? 42/143 Four letters picked without replacement from {g: 1, m: 2, h: 1, y: 1, e: 2, p: 1}. Give prob of picking 1 p, 1 e, 1 y, and 1 g. 1/35 Two letters picked without replacement from {c: 1, f: 4, y: 1, d: 2}. What is prob of picking 2 f? 3/14 What is prob of picking 2 z and 1 h when three letters picked without replacement from {h: 13, z: 5}? 65/408 Three letters picked without replacement from gqqugqguugqqgxqqqq. Give prob of picking 1 q and 2 u. 9/272 Calculate prob of picking 1 c, 1 m, and 1 l when three letters picked without replacement from {l: 1, w: 1, c: 2, a: 1, m: 1, u: 1}. 2/35 What is prob of picking 2 j when two letters picked without replacement from {r: 3, i: 4, q: 7, b: 2, j: 2}? 1/153 What is prob of picking 1 b and 1 d w	{ "pile_set_name": "DM Mathematics" }
wrt a. -2370a + 2 Find the third derivative of -562h*4v - 2h4 + 2h*3v - 10h3 - 7h*2 + 1050v wrt h. -13488hv - 48h + 12v - 60 Differentiate -67f3 - 3f*2 + 194f - 17680. -201f2 - 6f + 194 Find the third derivative of 2499ln*5 - 10ln2 - 2328l + 8n5 wrt n. 149940ln2 + 480n*2 Find the second derivative of -436247u*5 + 2u + 3992. -8724940u3 Find the second derivative of 5688254cdu*2 + 374cdu - 4c + du + 14u wrt u. 11376508cd Find the first derivative of -18x*2 + 231x - 94120 wrt x. -36x + 231 Find the third derivative of 60a*4uz + 2a*4 + 4520a*3uz + a2uz - 14a*2u - auz - 15au + 2uz wrt a. 1440auz + 48a + 27120uz What is the derivative of 1996837m2y*2 + 4186y*2 - 61 wrt m? 3993674my2 What is the second derivative of 8874a*2j*3 - 2a*2j*2 + 3a*2 - 1894a + 368j3 - 2j wrt a? 17748j3 - 4j*2 + 6 What is the derivative of -327g*3 - 113g*2v + 6g2 - 488v - 399 wrt g? -981g2 - 226gv + 12g Find the second derivative of -2262817c2u + 20cu + 51363c wrt c. -4525634u What is the second derivative of -b*4 - 5587b3 + b2 - 47465b + 1 wrt b? -12b*2 - 33522b + 2 What is the first derivative of -12f2mp - 109513f*2p + f*2 - 15814fmp wrt m? -12f2p - 15814fp What is the third derivative of -740111y3 - 317656y2? -4440666 Find the first derivative of r2 + 10902r - 85004. 2r + 10902 What is the third derivative of 2144335x3 - 529x*2 + 2x + 365 wrt x? 12866010 Differentiate 77i2k*3 + 3ik3 + 341i + 2k3 + 150291k*2 + 2 with respect to i. 154ik3 + 3k*3 + 341 Differentiate 1772065l*4 - 4737782 wrt l. 7088260l*3 Find the third derivative of -12a*6 - 3963a*5 + 402088a*2. -1440a*3 - 237780a*2 Find the third derivative of 3010v5 - v4 + 51079v2 wrt v. 180600v*2 - 24v Differentiate 28042i - 36964. 28042 What is the second derivative of 220d*2j + 2d2 + 2dj + 72d + 56j - 2 wrt d? 440j + 4 What is the third derivative of -189b4k - 55b4 + b3k + 7b3 + 611b*2k - 2b2 + 65k - 1 wrt b? -4536bk - 1320b + 6k + 42 What is the derivative of -10l2p + 23l2z + 83l2 - lpz + lz - 174pz + 3p - 14z wrt p? -10l2 - lz - 174z + 3 Find the second derivative of -2042767d*3 - 3059802d. -12256602d Find the third derivative of 230206j*3l*2y + 689j2l*2 - 78j*2y - 2j wrt j. 1381236l*2y Differentiate 3iu*2 - 158i - 42688u3 + 59 with respect to u. 6iu - 128064u*2 What is the third derivative of -3u*3w*3 + 18u*3w*2 + 2u*3w - 23u3 - 3u*2w*3 + 8u*2w + 908uw*3 wrt w? -18u*3 - 18u*2 + 5448u Find the second derivative of -172j3 + 369j*2 + 2031512j. -1032j + 738 What is the first derivative of d2g*2 + 169367d*2 + 30dg2 + 68dg wrt g? 2d*2g + 60dg + 68d Find the third derivative of -22444g*6 + 83285g*2 wrt g. -2693280g*3 Find the second derivative of 847811w*4 - 2w*2 + 5w - 26990. 10173732w2 - 4 What is the third derivative of 11a*3gk + 294a*3g - 6a3k + 110a2k + a*2 + ag - gk wrt a? 66gk + 1764g - 36k What is the derivative of -26451s - 30300? -26451 Find the second derivative of 57290j2 + 289j - 8 wrt j. 114580 What is the third derivative of -164099l4 - 396631l*2? -3938376l What is the second derivative of 1432384g4 + 1991723g? 17188608g2 Differentiate -53d*2i + 92d2 - 44720di + 59d + 3 wrt i. -53d2 - 44720d Find the third derivative of d*3h2 - d3r3 + 4d*3r - 1304d3 + 278d*2hr - 5d*2r*3 + 8dh2 + dr*3 wrt d. 6h*2 - 6r*3 + 24r - 7824 What is the second derivative of 319m5s - 2m4 - 2m*3s - 82ms - m - 58s wrt m? 6380m*3s - 24m2 - 12ms What is the second derivative of -764186g*3 - 1266419g? -4585116g Differentiate 3b*3 - 49891b*2 - 407985 with respect to b. 9b*2 - 99782b Find the third derivative of -240661d3l*2 - 6d*2l - 4331d2 + 2d + 3l2 - 2 wrt d. -1443966l*2 What is the derivative of -1088dyz - dy + 7dz - 11877y + 2z + 2 wrt d? -1088yz - y + 7z Find the second derivative of 600095j2 - 136j + 1094. 1200190 Differentiate 2k2x - 3k2 - 2kx2 + 223k - 92182x2 wrt k. 4kx - 6k - 2x2 + 223 What is the second derivative of -68486bhi*2w*2 - bhi2w + 2bhiw - 2bhi + 3bhw + 4bi*2w*2 - 11bi2w + 5hi*2w + 43w wrt w? -136972bhi*2 + 8bi2 Differentiate -29x*2 + 124x + 23505. -58x + 124 Find the second derivative of 13957b*4 + 22209b wrt b. 167484b2 Find the first derivative of 2f*2 + 43340f + 843674 wrt f. 4f + 43340 What is the third derivative of o4 + 5o*3u + 25o3 + 551o*2 - 14u wrt o? 24o + 30u + 150 What is the third derivative of -13447y4 + 17y*3 + 3896619y*2 + 2y wrt y? -322728y + 102 What is the second derivative of -2fs3 - 2fs + 2f + 4s5 + 236s*3 - 5242s wrt s? -12fs + 80s3 + 1416s Differentiate i*3m - 23956i3 + 2316im - m wrt m. i3 + 2316i - 1 What is the second derivative of 2096lo*3 + lo - 2404l - 2o*4 + 2o*2 - 3 wrt o? 12576lo - 24o*2 + 4 What is the second derivative of -43899f*2 - 439f - 1? -87798 Differentiate -1180772h2 + 272248 with respect to h. -2361544h Find the second derivative of 15r4 + 4r*3 + 187r*2 - 9247r wrt r. 180r2 + 24r + 374 What is the derivative of 100724j2 - 56680? 201448j Find the third derivative of 30628b3l - 26576b2l wrt b. 183768l Find the third derivative of -255766q*2y*3 + 24q*2y*2 + 3330q*2 + 2y3 - y2 wrt y. -1534596q2 + 12 What is the second derivative of 525825u*2vx2 + 3u*2v + u*2x + 2000u2 - 2uvx - vx wrt x? 1051650u*2v Find the third derivative of -232h6 + 5h*4 + 716h*2 + 28. -27840h*3 + 120h Find the third derivative of 12f4g*2 - 5018f*3g*2 - 12f*2 - 7591fg2 wrt f. 288fg2 - 30108g*2 What is the third derivative of fj*4 + 7fj3 + 2fj2v + 2fjv - 5fj + 187j*5v + 89j2v wrt j? 24fj + 42f + 11220j*2v What is the third derivative of 65g3r*5 - 2g*3r*2 + 34752g*3r - 2g2r + 378r6 wrt r? 3900g*3r*2 + 45360r*3 Find the third derivative of 151742v*4 + 227v*2 + 685 wrt v. 3641808v What is the third derivative of -4694v6 - 2v*3 - 52v*2 - 18v? -563280v3 - 12 Differentiate 2k*3 - 4593k*2 - 56k - 557938 with respect to k. 6k2 - 9186k - 56 Find the first derivative of 6196cdx + 5cx + 102c + 2d4 + 26dx + 4x + 1 wrt d. 6196cx + 8d3 + 26x Find the second derivative of 90828d2j*3 + 8dj3 + 18j*2 + 411 wrt d. 181656j3 Find the second derivative of f5 + 776f4 - 2f*3 - 27079f. 20f3 + 9312f*2 - 12f Differentiate 1080926q4 + 4290472 with respect to q. 4323704q*3 What is the second derivative of -1536126u*2 + 2225408u? -3072252 Find the third derivative of 5m5 + 4566m*4 - 126984m*2 - m. 300m*2 + 109584m Find the third derivative of -12m4 + 255m*3 - 123m*2 + 5m + 9 wrt m. -288m + 1530 Find the third derivative of 16286b*6 - 6b*3 - 8910b*2 wrt b. 1954320b*3 - 36 Find the second derivative of 3154y*5 - 7y*2z*3 + yz - 14y - 1582z*3 + 2z wrt y. 63080y3 - 14z*3 What is the second derivative of -86w*5 + 29w*4 - 2w*3 + 3364w? -1720w3 + 348w*2 - 12w Find the third derivative of 44142j5 + 26j*4 + 4451577j*2 wrt j. 2648520j*2 + 624j Find the third derivative of -227250b6 - 2b*3f + b*3 - 21b*2f + 8694f wrt b. -27270000b*3 - 12f + 6 What is the second derivative of -2540513g2 - 684g + 834 wrt g? -5081026 What is the first derivative of -4796i2l - 24i2t + 641il*2t - 2il*2 wrt t? -24i*2 + 641il2 Find the second derivative of -12458g*5 - 6g*4 + 341592g wrt g. -249160g3 - 72g2 Find the first derivative of i4 - 40504i2 - 187681 wrt i. 4i*3 - 81008i Differentiate -5f4 - 110f*3 + 9f - 667800 with respect to f. -20f3 - 330f*2 + 9 What is the third derivative of 90f*5 + 1128f*4 - 402f*2 - 3f - 2?	{ "pile_set_name": "DM Mathematics" }
2)(0t2 - 3t*2 + 5t*2))(-26 + 26 + 10t). 60t*5 Expand ((7c - 2c - 3c)(3 - 3 - 2) + c - c - c)(3c3 - 2c*3 - 3c*3). 10c*4 Expand (3i - 3i - 2i)(-149 + 77 - 282)(2 + 2 - 2)(-1 + 3 - 4) + (-2i + 0i + 0i)(3 + 1 - 2). -2836i Expand (6v + 11v - 4v)(v*3 + 4v*3 - 4v*3)(4 + 2v + 0 - 1). 26v*5 + 39v*4 Expand (-78r - 160 + 160)(r2 + r2 - 3r*2). 78r*3 Expand (148 - 148 + 22z*2)(z + 0z - 2z + (2 - 2z - 2)(3 - 3 + 2)). -110z3 Expand (86h*2 - 174h*2 + 85h*2 - 17 + 2h)(6h*2 - 2h*2 - 2h*2). -6h*4 + 4h*3 - 34h*2 Expand (-t - 2t + t)(t + t + 0t)(635 - 635 + 29t). -116t3 Expand (-37n - 46n + 0 - 2)(-n*2 - 2n3 + n2). 166n4 + 4n*3 Expand 2g*2 - 3g*2 + 2g*2 + (4 + g - 4)(g - 5g + 5g) + 2g2 - g2 + g2. 4g*2 Expand (5 - 1 - 2)(-3 + 2 + 3)(4i - 3i - 3i)(4i*4 + 3i*4 - 3i*4). -32i*5 Expand -g - 3g + 3g + (-10g - 20g - 2g)(0 + 2 + 0). -65g Expand (6b3 + 0b3 + b3)(8 - 51 + 20). -161b*3 Expand 51d*4 + 22d*4 + 22d*4 + (2d - 4d + 4d)(-1 + 1 + 2d3) + d4 + d4 - d4. 100d4 Expand (2 - o - 2 - 2o - 4 + 4 + (-1 - 2 + 4)(-3 + 3 - 3o) + 0 + 2o + 0)(-3 - 2 - 3)(0 - 1 + 0). -32o Expand (-5 - 11 - 4 + (4 - 3 + 1)(4 - 1 - 4))(4 + 5w - 4). -110w Expand (-47 - 23 - 71 - 2)(-3h2 + h2 - h*2). 429h*2 Expand ((1 - 1 - 2)(0 - 4 + 1) + 1 - 4 + 4 - 6 + 1 + 3 - 4 + 3 + 0)(-2i - 1 + 1)(-3 + i - 2i + 2). 8i2 + 8i Expand (2m4 + 2m*2 - 2m*2)(2 - 4 + 0) - 89m3 + 89m*3 + 3m*4 - 10m*4 - 10m*4 + 0m*4. -21m*4 Expand (-3v*2 + 4v*3 + 3v*2)(-3v + 0v + 4v + (0 + 0 - v)(-7 + 4 + 1)) + 0v4 + v4 - 2v*4. 11v*4 Expand 17r*2 - 12r*2 + 9r*2 + (-r + 3r - 3r + (1 - 1 - r)(-3 + 1 + 4))(-3r - r - 2r). 32r*2 Expand (7 - 23 - 10)(-1 - 3a3 + 1). 78a*3 Expand 93 - 39h4 - 93 + (-h3 + h*3 + 3h*3)(h + 8 - 8). -36h4 Expand 52j + 19j + 17j - 18j + (-3 + 1 - 1)(2 - 2 + 2j) - 3j + 4j + 0j. 65j Expand -26q + 4q + 3q + (7 + 5 - 5)(q - 2q + 0q). -26q Expand 3r5 + 15r*5 - 4r*5 - 3r*5 + 0r + 0r + (4r*5 - 4r5 + r5)(-5 + 3 + 0) - r2 + 3r5 + r2. 12r5 Expand (2g + 1 - 1)(-3 - 1 + 1 + (-2 + 2 - 2)(2 + 2 - 3) + (-2 + 1 + 6)(2 + 1 - 4)) + (-2 - 1 + 5)(-g + 2g - 4g). -26g Expand (-20v - 68v + 15v)(-1 + 7 - 1). -365v Expand (-5 + 14 + 16)(4y*2 - 11y*2 - 11y*2). -450y*2 Expand (-5u + 0u + 3u)(14745 - 14745 + 226u). -452u2 Expand 3 - 6n - 6 + 5n + (1 - 2 + 3)(-5n + 0n + n) - 7n + 20 - 20. -16n - 3 Expand ((0 + 0 - 2)(-7p + 11p - 3 - p) - 2p + 3p - 3p)(-10 + 4 + 13) + 0p - 2p + 4p. -54p + 42 Expand (0 + 1 - 5)(-88 + 97 - 88)(4c2 - c5 - 4c2 + (3c*3 + 0c*3 - 2c*3)(-c*2 - 2c + 2c)). -632c*5 Expand (2x - 2 + 2)(x3 + 3 - 3) + (-2x*3 + 3x3 + x3)(-102x + 129x - 216x). -376x4 Expand m + m - 8m + (4 + 4 + 10)(1 - m - 1). -24m Expand 138n2 - 40n*2 - 58n*2 + (-4 + 4 + 2n)(5 - 5 + n) + 2n*2 + 3 - 3. 44n*2 Expand 4r*3 - 11 - 23r*3 + 13 + (1 - 2 - 1)(0r2 - 2r*3 + 0r*2). -15r3 + 2 Expand m5 - 3m2 + 3m2 - 1 + m5 + 1 + (-m - 4m + 9m)(5m*4 - 3m*4 - 4m*4). -6m*5 Expand (-43p + 213p2 + 43p)(1 + 3 - 1)(0 + 3p3 + 0). 1917p*5 Expand (3103 - 3103 - 88f)(f4 + 0f + 0f - f). -88f*5 + 88f*2 Expand 14x*2 + 454x*2 + 16x*2 + (1 - x - 1)(-x - x + 5x). 481x*2 Expand (m - 9 + 11 - 11)(-2 + 2 + m)(0 + 4 - 5). -m2 + 9m Expand -1 + 1 + s*4 + (-4s2 - s2 + 3s2)(-51s2 + 4s - 3s + 24s*2). 55s*4 - 2s*3 Expand (-4 + 4 - 5u)(-6 - 2 + 1)(-2 - 2 + 6). 70u Expand -46 - 6y + 46 + (0 + 0 - y)(2 + 0 - 1) + 8y - 5y - y - 2. -5y - 2 Expand (0 - 4 + 3)(-2q + q + 3q + (-4q + 4q - q)(2 - 2 - 2) - 68q + 2q - 61q). 123q Expand (-t*4 + 6t - 6t)((2t - 1 + 1)(-1 + 1 - 1) + 0t + 4t - 3t + 5t + 54t - 15t). -43t5 Expand -2r + 0 + 0 + 2r - 2 + 2 + (3 - r - 3)(1 - 2 - 1) + 0 + 0 + 2r + (4r + 0r - 6r)(5 - 3 - 4) + (2 - 2 - 2)(r - 3r + r). 10r Expand 3g + g - 3g + (21 - 6 + 26)(-2g + 0g + g). -40g Expand 4v - 2v - 4v + (14v + 10 - 14 + 6)(3 - 3 - 5). -72v - 10 Expand ((3 + 0 - 5)(-5 - 13 + 2) + (2 - 4 + 0)(-4 - 2 + 4))(0m + 0m + m). 36m Expand (0u + u - 7u)(-154u*3 - 164u*3 - 68u*3) + 3u - 3u - u4. 2315u*4 Expand v + 2v - v + (5 - 3 + 0)((5 - 4 + 6)(3 - 3 + 2v) + 0v + 4v - 2v). 34v Expand (d + d + 8d)(0 + 3 - 1)(d*2 - 2d + 2d)(-4d + 6d - 3d). -20d*4 Expand (0 - 1 + 4)(3u3 + 0u3 - u3) - 2u3 - 2u3 + u3 + (-2u2 + 0u + 0u)(0u + 2u + 0u). -u3 Expand 181f*2 - 179f*2 + 8f*4 + 22f*4 + (4 - 3 + 0)(-2f4 - f + f). 28f*4 + 2f*2 Expand (15 - 3 - 5)(-12f + 91 - 91) - 4f - f + 4f. -85f Expand 2v + 2 - 2 + (-2 + 1 + 2)(-3v - 6v + 5v) - 72 + 72 + 20v. 18v Expand (148 + 107 - 23)(0 - 2 + 1)(-4o*2 - 2o*2 + 3o*2). 696o2 Expand m2 - 2m3 - m2 + (-m + 5m + 3m)(-2m2 - 3m*2 + 0m*2). -37m*3 Expand 4 - 6 - s - 2 + (0 - 1 + 0)(0s - 2s + 0s). s - 4 Expand -y + y + y2 + ((y + 2y - 5y)(0 - 2 + 1) - 3y + 0y + 11y)(2y - 3y + 0y + (-1 + 3 + 0)(4y + 2y - 3y)). 51y*2 Expand -4z2 - z2 + 0z2 + (3z - 2z + 0z)(7z + 6z - 7z)(3 + 1 - 2). 7z2 Expand (-q2 + q + 0q + 3q)(-42q - 71q2 + 35q*2 + 38q*2). -2q*4 + 50q*3 - 168q*2 Expand (3z - 18z - 7z)(-1 - 4 + 4)(3z - 4z + 2z). 22z*2 Expand (-4 + 4 + 2u*4)(-u + 3u + 2u) + (-4u + 0u + 5u)(2u4 + 0u4 - u4) + (-2u2 - 5u*2 - 12u*2)(0u3 - u3 + 3u*3). -29u*5 Expand -2x*2 - 4x*2 + 4x*2 + (x - x - x)(0 - x + 0) + (-3x - x + 6x)(-3x - 4x + 10x) + 20 - 4x2 - 20 + 2x*2 - 3 + 3. 3x*2 Expand (-2u*3 + 5u3 - u3)(-u + u + u) - 2u4 + u4 + 2u4 + (0u*2 + 0u*2 - 3u*4)(5 - 4 - 2). 6u4 Expand (0t - 4t + 2t)((4 - 4 + 3)(-4t - 1 + 1) - 3t + 8t + 3t)(t + t - 4t). -16t3 Expand (4r - 11r + 29r - 64r - 53r)(-29r - 4r + 8r). 2375r2 Expand (2z - 3z3 - 2z*3 + 4z*3)(-z*2 + 0z*2 - 3z*2) + (3z + 0z - 2z)(-3 + 3 + 2z*4) + 3z*5 - 3z5 + z5. 7z5 - 8z*3 Expand (-125 - 118 + 160)(-4w + 0w + w). 249w Expand (2 - 5 + 0 - 2 - 3 + 4 + (1 + 0 + 1)(0 + 2 - 3) - 1 + 5 - 1)(3k*4 - 4k4 - k4 + (0 + 0 + k)(-2 + 2 + 2k*3) - 3k + 3k + 8k*4). -24k*4 Expand (-14 + 3 - 47)(-5p + 0p + 4p)(4 - 3 + 13). 812p Expand (-o + 0 + 0)(-4 + 5 - 2)(112o + 519o3 - 82o*3 - 115o). 437o4 - 3o*2 Expand (150h + 3 + 8 - 149h)(6h + 10h - 7h). 9h*2 + 99h Expand (-42 - 2 + 3)(20g*5 - 20g + 20g). -820g*5 Expand (-3 + 3 + 1)(-4 + 4 + 4)(-5l*3 - 4l*3 + 7l*3). -8l*3 Expand 0 + 0 - k + (1 - 1 + 2k)(1 + 1 - 1)(2 + 9 - 3)(4 + 3 + 2). 143k Expand (4 - 2 + 0)(19p - 20p - 19p). -40p Expand (-d - 3 + 3)(1 - 2 + 0)(28d*2 - 18d*2 - 20d*2). -10d*3 Expand -u + u + u + (-3u + 3u + 2u)(-2 - 2 + 6) - 2u + u + 3u + (-2u - 2u + 3u)(-1 - 6 + 2). 12u Expand (304b2 + 3990b - 3990b)(3b - b3 - 3b). -304b5 Expand (c2 - 4c + 4c)(2 - 4c - 2) + 4c*3 - 3c*3 + 5c*3 + (0c*3 + 4c*3 - 2c*3)(-3 + 2 + 0) - 2c3 + c2 - c2 + 4c*3 + 5c*2 - 5c*2. 2c*3 Expand 2x + 2x3 - 2x + (6 - 6 - 14)(15x*3 + 9 - 9). -208x*3 Expand -3m - 2m + 6m + (-2 - 8 + 6)(-m + m - m). 5m Expand (-5x2 + x2 + 3x*2)(0x2 - 4x*2 + 5x2) - x4 - 3x + 3x - 18x3 + 9x3 + x4 + 12x3. -x4 + 3x3 Expand (v3 - 3v3 + 3v*3)(-v + 2v - 1 - 3v)(-238 + 128 + 118)(-2v + 5v - 2v). -16v*5 - 8v4 Expand -y4 - 12y4 + 16y*4 - 23y + 2y2 - y4 - 2y2 + y - y + y4 + (-5y2 + 3y*2 + 0y*2)(2y2 - 3y*2 + 2y2). y4 - 23y Expand (-2 + 2 - 2b)(24b*2 - 8b*2 + 2 - b - 14b*2). -4b*3 + 2b*2 - 4b Expand 243 - 44a2 - 243 + (3a - 4a - 5a)(0a + 4a - 5a) + 1 - 1 - a*2. -39a*2 Expand (0 + 0 + 1)(14h + 9h - 13h)(7 - 6h - 7). -60h*2 Expand (4l - 2l - 3l)(50 + 195 + 50). -295l Expand (-2c + 0c + 15c)(-1 + 7 + 5)	{ "pile_set_name": "DM Mathematics" }
8n - 5 + 7n wrt n? -21 Let k(p) be the third derivative of -5p2 + 0 + 0p*3 + 0p*6 - 1/30p*5 + 2/105p*7 + 0p + 0p4. What is the third derivative of k(w) wrt w? 96w Find the second derivative of 11u - 2u*2 - 6u*2 + 2u*2 wrt u. -12 Let p(y) be the first derivative of 0y*4 + 0y*5 + 0y*2 + 2/3y*3 - 1/2y*6 + 0y + 2. What is the third derivative of p(m) wrt m? -180m2 Let n(v) = -v + 1. Suppose 8 = 2l + 3j, 2l + 2l = -5j + 16. Let b(h) = -h + 1. Let c(u) = lb(u) - 7n(u). Differentiate c(y) wrt y. 3 Let n = 17/26 - 2/13. Let s(f) be the first derivative of 0f5 + 0f + 0f3 - nf*6 + 0f*4 - 4 + 2f*2. What is the second derivative of s(q) wrt q? -60q*3 Let h(k) be the first derivative of 26k*5/5 - 29k - 3. Differentiate h(w) wrt w. 104w3 Let o be ((-1)/1)/(3/(-6)). What is the derivative of -2 + 3y*2 - 3y*o - 4y*3 - 2 wrt y? -12y*2 Let c(m) = 2m - m*2 - 2m. Let g(y) = -3y2 + 7y. Let j(t) = 2c(t) - g(t). Find the second derivative of j(r) wrt r. 2 Let k(c) be the third derivative of -c7/21 - c3/6 - 16c*2. Differentiate k(a) with respect to a. -40a*3 Let g(a) be the third derivative of -1/2a*3 + 0 + 0a*4 + 6a*2 + 1/30a*6 + 0a + 0a5. Differentiate g(m) wrt m. 12m*2 Let w(g) = -13g*5 - 5g3 - g2 + 5g. Let x(q) = 20q*5 + 7q3 + q2 - 7q. Let o(m) = 7w(m) + 5x(m). What is the third derivative of o(s) wrt s? 540s*2 Let v(q) = -33q*2 + 54q - 9. Let x(p) = 17p2 - 27p + 4. Let i(h) = 4v(h) + 9x(h). What is the second derivative of i(a) wrt a? 42 Let b(d) be the second derivative of d6/720 - d5/30 - d*4/6 + d. Let c(q) be the third derivative of b(q). Differentiate c(l) wrt l. 1 Let s(l) be the first derivative of -5l*3 + 8l - 4. Differentiate s(d) with respect to d. -30d Let x(h) be the second derivative of -13h*6/15 + 4h*4/3 - 14h. Find the third derivative of x(i) wrt i. -624i Find the third derivative of 24d*2 - 6d*2 + 14d*6 - 32d*6 wrt d. -2160d*3 What is the third derivative of 55w*2 - 8w5 + w4 - 53w2 - w4 wrt w? -480w*2 Let c = 34 + -28. Let y(h) be the second derivative of 0 + 0h*4 + 0h*5 - 1/10h*c + 0h*2 - 1/6h*3 - h. What is the second derivative of y(l) wrt l? -36l*2 Let r(z) be the first derivative of -5z2/2 - z + 5. Differentiate r(q) wrt q. -5 Let q(x) be the third derivative of -x8/84 + 5x4/12 - 4x*2. Find the second derivative of q(u) wrt u. -80u*3 Let l be 3/(-12) - (-33)/4. What is the second derivative of -6g - 2g3 + lg*3 + 3g*3 wrt g? 54g Let m(p) = p*2 - 2p + 3. Let s be m(3). What is the third derivative of 3b2 - bs + 2b*6 + b - b wrt b? 120b*3 Let k(t) = 3t*2 + 10t. Let w(v) = -2v2 - 13v*2 + 40v + 27v2. Let o(a) = -9k(a) + 2w(a). Find the second derivative of o(d) wrt d. -6 Let z(u) be the first derivative of -u10/840 + u6/120 + 2u*3 + 3. Let p(x) be the third derivative of z(x). Find the third derivative of p(q) wrt q. -720q3 Let f = -7 - -11. Let y(l) = l3 - 2l2 - l - 4. Let r be y(3). Find the second derivative of -2j - j*f - 14j*2 + 14j*r wrt j. -12j*2 Let y(r) = -8r + 16r + 2 + 4. Let d(i) = 7i + 5. Let s(b) = 5d(b) - 4y(b). Differentiate s(p) with respect to p. 3 Let w = -2 - -7. Suppose -3n + wp = -0p - 11, -2n = -3p - 7. What is the third derivative of cn + c2 - c4 + 0c*2 wrt c? -24c Let w(r) = r - 1. Let a be w(4). Find the second derivative of af - 4f*5 + 2f*5 + 0f*5 wrt f. -40f*3 Let t(w) be the second derivative of 13w6/30 - w2/2 - 20w. Differentiate t(n) wrt n. 52n*3 Suppose -2o - 4 = -3o. Find the third derivative of ok - 4k - 3k*3 - 205k*2 + 206k2 wrt k. -18 Let t(y) be the third derivative of y7/70 + 5y4/12 + 8y*2. What is the second derivative of t(f) wrt f? 36f*2 Let d = 7 - 7. Let t(q) be the third derivative of dq*3 + 0 + 0q*5 - 1/60q*6 + 0q + 1/24q4 - q2. Find the second derivative of t(w) wrt w. -12w Let z = -2 + 4. What is the first derivative of 3 - 2n2 + 4n*z + 0n*2 wrt n? 4n Let d(t) = t*2 + t. Let x(y) = -2y - 8. Let c(q) = -2d(q) - x(q). Differentiate c(h) with respect to h. -4h Let c(z) = z*3 - 3z*2 - 3z - 1. Let k be c(4). Suppose 0 = -kr + 15 + 3. What is the second derivative of -2s*4 + rs*2 - 2s - 6s2 + 0s wrt s? -24s2 Differentiate -16 - 14 - 17x + 21 with respect to x. -17 Let c(y) = -y*2 - 6y + 4. Let d be c(-6). Let q = d - 4. Differentiate -3j2 + 0 - 4 + q wrt j. -6j Find the third derivative of 4c2 + 1729c*3 + 26c*2 - 1744c*3 wrt c. -90 Let y(z) = 5z. Let k be y(-1). Let w be 3/1 - (k - -3). Differentiate wm + 2 - 1 - 2m with respect to m. 3 Let v(c) be the first derivative of 3/2c4 + 0c*2 + 0c*3 - 4 - c. Find the first derivative of v(l) wrt l. 18l*2 Let c(r) = -2 - r - 2r*2 + 5r2 + r2 - 2r2. Let p(d) = -d3 + d2 + d - 1. Let w(g) = 3c(g) - 6p(g). What is the second derivative of w(z) wrt z? 36z Let n(x) = x*2 + 8x - 3. Let v be n(-9). Let r = -3 + v. What is the third derivative of -3k3 - k2 + 8k*2 - rk2 wrt k? -18 Let b(t) be the second derivative of t5/10 - 9t4/4 - 49t*3/6 + 5t - 7. Find the second derivative of b(v) wrt v. 12v - 54 Let q(p) = 5p - 9. Let z = 11 + -10. Let g(u) = -1. Let n(y) = zq(y) - g(y). What is the derivative of n(f) wrt f? 5 Let t(c) be the third derivative of c6/60 + 7c*4/24 - 4c*2. Find the second derivative of t(g) wrt g. 12g Let w(t) = 9t2 - 5t + 9. Let j(n) = -n + 1. Let d(k) = 5j(k) - w(k). Differentiate d(v) with respect to v. -18v Let z(o) be the second derivative of o10/1680 - o6/180 + o*3/2 - 2o. Let d(u) be the second derivative of z(u). Find the third derivative of d(t) wrt t. 360t3 Let k be (-10)/(-35) - (-19)/7. What is the second derivative of -3l*k + l + 3l*3 - 2l*3 wrt l? -12l Let p be 4 - (-1 + (-1 + 3)/1). Let n(y) be the second derivative of -y*2 + 4y + 2/3yp + 0. What is the first derivative of n(a) wrt a? 4 Let p be 1/((5/10)/1). Let q(z) = -z2 + 2. Let i be q(0). Find the second derivative of -9u*i + pu + 9u2 + 4u*4 wrt u. 48u2 Let a(f) = -f2. Let j be a(0). Let r(y) be the second derivative of jy3 + 0 - 1/3y*4 + 3/2y*2 - 3y. Differentiate r(c) with respect to c. -8c Let b(z) be the first derivative of z6/72 + z4/6 + 4z*3/3 + 1. Let h(t) be the third derivative of b(t). What is the first derivative of h(g) wrt g? 10g Let w be 6/88/3. What is the second derivative of -7n + 0n + wn - 7n4 + 6n*4 wrt n? -12n*2 Let r(m) = 49m*3 + 27m*2 + 4. Let w(c) = 49c*3 + 26c*2 + 3. Let z(y) = -3r(y) + 4w(y). What is the third derivative of z(k) wrt k? 294 Let f(h) be the first derivative of h6/6 + 29h*3/3 + 24. What is the third derivative of f(g) wrt g? 60g*2 Let s(g) be the third derivative of 0g + 0 + 1/20g5 - 1/24g*6 + 0g*3 + 0g*4 - 2g*2. What is the third derivative of s(f) wrt f? -30 Differentiate 56 + 28 - 30q - 61 wrt q. -30 Let z(f) be the second derivative of 9f5/20 - f4/2 + 7f. What is the third derivative of z(h) wrt h? 54 Find the second derivative of 10i - 4i*3 - 16i + 0i3 wrt i. -24i Let k(j) be the third derivative of 17j5/30 + 13j*4/12 + 18j*2. What is the second derivative of k(g) wrt g? 68 Let f(g) be the first derivative of -13g*4/4 + 5g*2 - 16. What is the second derivative of f(i) wrt i? -78i Let q(t) be the second derivative of t8/6720 + t7/2520 + t4/12 - t. Let h(u) be the third derivative of q(u). What is the third derivative of h(z) wrt z? 6 Let l(u) = -u2 - 8u. Let q be l(-8). Let m be q + (1 + -1)/(-3). Differentiate m - n3 - n3 - 3 wrt n. -6n*2 Let l(j) be the first derivative of 0j + 0j6 - 5/3j*3 + 5/7j*7 + 0j*4 + 0j*2 - 1 + 0j*5. Find the third derivative of l(x) wrt x. 600x*3 Suppose -4g + 4t = -24, -4t = g - 2g + 18. Suppose -j = -5j + 20. What is the second derivative of m - gm - mj - 2m*5 wrt m? -60m*3 Let n(p) be the second derivative of 3p5/10 + p2/2 - 4p. What is the derivative of n(w) wrt w? 18w*2 Find the second derivative of -2n*2 - 3n**2 -	{ "pile_set_name": "DM Mathematics" }
.046 + 0.454. Which is the closest to 0? (a) j (b) 1/5 (c) h b Let h = -0.2 + 0.7. Let v = 70.2 + -76. Let w = v - -7.8. Which is the nearest to -1? (a) h (b) 6/11 (c) w a Let n = -0.1 + -0.9. Suppose 4y + 86 = -34q + 20q, -4y - 11 = -q. Which is the closest to n? (a) y (b) 0.1 (c) -2 c Let a = -1235 - -1380.6. Let g = -146 + a. What is the nearest to 0.2 in g, -2, -0.1? -0.1 Let a = -4.7 + -1.3. Let k = a - -6.2. What is the nearest to -1 in k, -2/3, -3/5? -2/3 Let r(u) = 7u + 205. Let p be r(-29). What is the closest to p in 2, -2/15, -0.4? 2 Let v = -442 - -441.9. Which is the nearest to -0.2? (a) 0.3 (b) 0.5 (c) v (d) 0 c Let o = -1626 - -1621. Let i = 0.1 - -0.4. Let g = 1 - i. Which is the nearest to 1/3? (a) g (b) 0.3 (c) o b Let l = -378/485 - 2/97. Which is the closest to 0.2? (a) 2/5 (b) l (c) 0.2 c Let r = -36 - -36.1. Let u = -5/9 - -11/9. Which is the closest to r? (a) -7 (b) 4 (c) u c Let x be (-4)/6(-27)/18. Which is the closest to x? (a) -1/4 (b) -1/6 (c) 2/5 c Let o = -144.2 + 144. What is the nearest to 0.2 in 0, o, 2? 0 Let i = 87 + -99. Let o be i/40(-4 - (-8 - -2)). Which is the nearest to 0? (a) 22 (b) 3 (c) o c Let d be (0 - 2)/((-12)/18). Suppose -dt = -4l - 3, -t + 40 = 4t + 5l. Which is the nearest to -2/3? (a) 2/13 (b) -0.4 (c) t b Let d be (-80)/(-64)(-2)/10. Which is the nearest to d? (a) -1/7 (b) 0.6 (c) 0.5 a Suppose 3g = 89 - 104. Which is the closest to 0.1? (a) 1/6 (b) g (c) -0.3 (d) -94 a Let u = 1533 - 1532.6. Let z be (-18)/8 + (4 - 2). Which is the nearest to 0? (a) z (b) u (c) -0.1 c Let x = -912 - -911.6. Which is the closest to -1? (a) -1/4 (b) x (c) 87 b Suppose -21 = -4l - 9. Let f = 593 + -593.1. What is the closest to f in 1/5, -3/5, l? 1/5 Let w = -0.881 - 0.119. Let a be ((-1)/3)/(3/(-36)). Let x = a + -2. What is the nearest to w in x, 3/7, -3? 3/7 Let k be (-3 + 7)2/44. Let r = -4.52 + 4.02. Which is the nearest to k? (a) 4 (b) r (c) 2/9 c Let y(h) = 7h + 10. Let u be y(-2). Let g be ((-2)/(-12))/(2/u + 1). What is the nearest to 0 in 1.2, 2, g? g Suppose 3z + 6 = -2h + 26, 8 = 4z - 2h. Suppose r = 4y + 6 + 9, 2y = zr + 10. Which is the closest to -2/7? (a) 2 (b) r (c) 4 a Let k be ((-3787)/819 - -5) + 4/(-26). Which is the nearest to 0? (a) 3/37 (b) 0.1 (c) -0.5 (d) k a Let d = -456 + 1367/3. Which is the nearest to -1/4? (a) d (b) -0.3 (c) 0.1 b Suppose 5x + 48 = x. Let w be x + 3/((-3)/(-3)). Let b be 3/w - (1 - 1). What is the closest to b in -1, 2/13, 0.1? 0.1 Let y = 0.013 + 0.387. Which is the nearest to 2/3? (a) y (b) 0.5 (c) 0.2 (d) 6 b Let h = 0.03 - -0.27. Let z = -0.049 + 0.149. Which is the nearest to z? (a) h (b) 2 (c) -3 a Suppose -3d - 9 = 3w, 3d + d = 2w + 12. Let j = 0.08 - -0.02. What is the nearest to d in j, -1, 2/5? 2/5 Let q = 506/3627 + 4/279. Let k = -10.8 + 11. What is the nearest to -0.1 in k, -0.1, q? -0.1 Let k = -1453.7 + 1456. What is the nearest to k in 4, 0.2, 1/3, -3/2? 4 Let c = -552 + 550. What is the closest to -2 in c, -2/17, 4? c Let g = -3 + 35. Let i = g + -29. Which is the closest to -1/4? (a) 0.09 (b) -0.1 (c) i b Let k be 2/8(-36)/(-27). Suppose -5y + 3 = 4u, 4y - u + 0u = -6. Which is the nearest to y? (a) 11 (b) k (c) -4 b Let y = -1459/3 + 493. Let h = y + -6. Let z be -7 - 3/((-15)/251). Which is the closest to 1? (a) h (b) z (c) 3 a Let r = -10 - -28/3. Let u = -11.11 - -1.41. Let q = u + 10. Which is the closest to -1? (a) q (b) 1/2 (c) r c Let l be -1(-2)/(-14)1. Let j(m) = m*2 - 20m - 24. Let n be j(21). Let u be n(3/45)/1. Which is the closest to 0? (a) l (b) u (c) 1/3 a Let k = -6.4 - -6. Suppose -19 = -56d + 37d. What is the closest to -1 in d, k, 2? k Let g = -788 - -791. What is the closest to -0.1 in -3, g, -5? -3 Let x = -0.6 - -14.6. Let l = 18 - x. What is the nearest to 0 in l, -0.1, 5? -0.1 Suppose 8p - 3p = 35. Suppose -pc = c + 8. What is the nearest to c in 0, -5, -3? 0 Let x be ((-12)/18)/(2/9). Let r be x + -2(-3)/6. Let h be (5/r - -2)0. Which is the nearest to h? (a) 0.3 (b) -3 (c) 0 c Let i = -0.035 + 3.035. Let f = 2 + -6. Let g = f + i. What is the closest to 0.1 in 3, -4, g? g Let z = 0.16 - -8.34. Let y = z - -1.5. Let m = y - 10.1. Which is the closest to m? (a) -5 (b) 2/5 (c) 1/7 c Let q be 16/15 + (-4)/6. Let x be -2 + 4 + (-1 - -2). Suppose xk = 4k - 1. Which is the nearest to k? (a) -2/7 (b) q (c) -0.3 b Let j be 16/(-15) + 72/108. Which is the closest to -0.1? (a) j (b) 2/3 (c) 1/2 a Let m = 8 - -19. Let q = 27.5 - m. Which is the nearest to 0? (a) q (b) -0.4 (c) -1/7 c Let m = 1923/4 - 480. Which is the closest to 3? (a) -0.1 (b) m (c) -3 (d) -2/7 b Let x = -211 + 210.9. Which is the nearest to -0.1? (a) -4 (b) -9 (c) x c Let k = -4.4 - -4. Let j = k - 0. Let z = -3650/3 + 1217. Which is the closest to z? (a) 4 (b) 0.1 (c) j b Let r = -30.008 - -0.008. Let v = 534.3 + -534.4. Which is the nearest to v? (a) r (b) 5 (c) 2 c Let x(w) = w*2 + 8w + 16. Let m be x(-5). Let p be (-115)/92 - (0 - m). Which is the closest to -1? (a) -4 (b) 1/9 (c) p c Let d be (4 - 13)(-2)/24. Let s = -0.27 - 0.03. What is the nearest to 1/3 in s, d, 2/3? 2/3 Suppose 5 = 3g + 2q - 0, 0 = 2q + 10. Let p = 13.74 - 13.64. What is the closest to p in -5, -0.3, g? -0.3 Suppose 0 = f, 0 = i - 3f - 2 - 1. Let w = 2141/26 + -165/2. What is the nearest to -1 in w, i, -0.5? -0.5 Let h = -42 - -42.5. Which is the closest to 3? (a) 5 (b) h (c) -0.34 a Let n = 0.03 + -0.03. Let i be 14/8(-69)/161. What is the closest to n in -1, i, 2/19? 2/19 Let o = -10 + 37. Let x = o - 25. What is the nearest to 2 in 0.5, x, -0.4? x Let q be (20/15)/(342/(-27)). What is the closest to 0 in -0.1, q, -1, -5/3? -0.1 Let b be (-2 - -4) + (-12)/5. What is the nearest to b in 0, -2/9, -1/4? -1/4 Let y = 20.8 + -19.8. Which is the closest to 1? (a) y (b) -0.4 (c) 4 a Let v(q) = 6q + 9. Let p be v(-1). Which is the closest to -11? (a) 0.1 (b) p (c) 1/3 a Suppose -5g + 4s - 6 = 1, 2g - 17 = -5s. Which is the nearest to 1/2? (a) -1 (b) -2/11 (c) 0.3 (d) g c Let q = 17.9 + -18. Let u = 146 - 145.7. What is the closest to q in 2, u, 1/4? 1/4 Let p = -67 - -72. Which is the closest to 2? (a) -5/2 (b) -0.4 (c) -2 (d) p b Let m be ((-4)/3)/((-7)/(-189)-6). Let u be (m/(-5))/(81/540). Suppose -2z = 3z + 15. Which is the nearest to -1? (a) z (b) u (c) 3 a Let n = -241/2 - -120. Which is the nearest to 0? (a) -1/4 (b) n (c) -3 a Let b = 16 - 16.05. Let t = b + 14.05. Let s = t - 13.9. What is the nearest to -1 in s, 1, 0.3? s Let c be ((-7)/(-7))/((-1)/3). Let r = 31 + -30.48. Let q = r + -0.42. What is the nearest to c in -3, q, 5? -3 Let b(m) = m*2 - 16m + 19. Let p be b(14). Let u be 1 + p/(135/6). Let w be (2/(-28))/((-1)/(-6)). What is the closest to 1 in w, u, 1/6? u Let p = 0.82 + -57.82. Let v = p + 57.2. Which is the nearest to -1? (a) v (b) -2/17 (c) 1 b Let g = 168 + -167.7. Which is the closest to -1? (a) 2 (b) g (c) -1 c Let r = -1249/9 + 139. Let b = 14 + -15. What is the nearest to b in -4, 1/2, r? r Let h = -318.9 + 318. Which is the nearest to 0? (a) -3/7 (b) -2/13 (c) h b Let j = 3443 + -265115/77. Let y = j + 18/77. Let h be (5/2)/(1/2). What is the closest to 2 in y, 2/5, h? 2/5 Let p = 25.4 + -25. Let s = 0.3 - 0.9. Which is the closest to -0.2? (a) p (b) -2/3 (c) s c Let g = 0.5 + -0.2. Let i = 6.69 - -0.31. Which is the closest to -1/2? (a) i (b) g (c) -0.4 c Let p(g) = 41g - 33. Let c be p(1). What is the nearest to 3 in c, -5, 0.5? 0.5 Let u = -1.3 + 2.8. Let y = -14.5 - u. Let j = 16 + y. What is the closest to j in 3/7, 1/5, -4? 1/5 Let k(i) = -i3 - 2i*2 + 9i + 13. Let u be k(-4). Let l be -2 + 60/u - 5. Which is the nearest to -1? (a) -0.1 (b) 5 (c) l c Let r = 1.31 - 61.31. Let s = -58 - r. Which is the closest to -2/5? (a) -7/2 (b) s (c) 2/7 c Let i = -8.13 - -1.13. Which is the nearest to i? (a) -0.1 (b) -0.15 (c) 5 (d) -4/7 d Let q = 427 + -429. Let f = -12 - -22. Let a = f - 14. What is the closest to 3 in q, a, 0.1? 0.1 Let z(u) = -11*u - 1. Let o be z(1). Let g be (-3)/o - (-55)/20. Let h be g - (-20)/(-8) - 0. What is	{ "pile_set_name": "DM Mathematics" }
it of n(-11)? 7 Let a(t) = 109t2 + 5t - 1. Let j(s) = s*2 + 2s. Let n(b) = 3a(b) - 3j(b). What is the units digit of n(2)? 1 Let u = -53 + 57. What is the units digit of (245/2)/(u(-1)/(-8))? 5 What is the units digit of 16(-7)/(-35)10030/4? 4 Let q be (-168)/(-20) + 2 + 7/(-5). Suppose qp - 68 = 7p. Suppose -30o - 612 = -po. What is the tens digit of o? 5 Suppose -2q + 1 + 6 = p, 4q = p - 1. Suppose -l + 18 = -2l - 4c, pl + 2c = 0. Suppose 4u + 3v - lv = 384, u = 3v + 109. What is the tens digit of u? 9 Suppose 1811 - 5255 = 14h. Let y = h + 483. What is the hundreds digit of y? 2 Let a(m) = -m - 1. Let t be a(-5). Suppose 3o - 2 = -2j, -6 = -3j + to - 3. Suppose -4k + 320 = l - j, 2l - 89 = -k. What is the tens digit of k? 7 Let k = 212 + -207. Suppose 852 + 258 = kh. What is the hundreds digit of h? 2 Let z be (4 - 10)(-2)/1. What is the units digit of (75/20-13)/(-3)z? 5 Let p(i) = -i*3 + 2i*2 + 13i + 10. Let f be p(5). Suppose 21o - 4093 - 2879 = f. What is the tens digit of o? 3 Let n be (2/3)/((-274)/69 + 4). Let p = 123 + -99. Suppose 0 = -nd + pd - 6. What is the units digit of d? 6 Let b(d) = 5d*2 - 244d + 100. What is the units digit of b(65)? 5 Let i(q) = q*3 - 5q*2 + 3q - 2. Let x be i(4). Let w(s) = -156s3 + 49s*3 + 57s*3 - 3s*2 - 17 + 49s*3 - 2s. What is the tens digit of w(x)? 0 Let g be -6(133/(-6) + (-10)/20). Suppose k + 132 = 5k. Let n = g + k. What is the hundreds digit of n? 1 Suppose 0 = j - 0j - 4. Suppose -ji - 12 = -32. Suppose 0 = -u - ig + 131 - 3, -235 = -2u - 3g. What is the units digit of u? 3 Let h = -51 - -54. What is the tens digit of -3(-2)/h(-283)/(-2)? 8 Let r be 22/8192/(-16). What is the units digit of -300(-7 - r)1? 0 Let l(v) = -61v + 3. Let c(g) = 11g - 11g - 31g + 2. Let u(b) = 7c(b) - 4l(b). What is the tens digit of u(3)? 8 Let g be 240((-60)/(-16) - 3). Suppose -z = 3z. Suppose z = -2m + 3x + 387, 0 = -3m + 4m + 3x - g. What is the units digit of m? 9 Let y(p) = -681p + 6841. What is the tens digit of y(-21)? 4 Let w = 56 - 56. Suppose -t + 0t - 3s - 39 = w, 4t + s = -167. What is the hundreds digit of 21/t + 566/4? 1 Let c(b) = 616b + 161. Let t be c(13). Suppose 9s = 2s + t. What is the hundreds digit of s? 1 Let p = -13546 - -36749. What is the thousands digit of p? 3 Let p(b) = 2b*2 - 17b - 6. Let t be p(9). Suppose tc - 225 = 411. Let l = c - 84. What is the units digit of l? 8 Let b(s) = 7s + 2. Let i be b(0). Suppose i = 12w - 34. Suppose 0 = -4t - 3k + 107 + 401, 5k = -wt + 370. What is the tens digit of t? 3 Let i be (-110)/4 + 14/28. Let o = -31 - i. What is the tens digit of (-2)/o + (-1108)/(-8)? 3 Suppose 4l = -l + 175. Suppose 0 = 6d + d - l. Suppose dh + 5v - 510 = 0, -v + 2v + 5 = 0. What is the tens digit of h? 0 Suppose 0 = 4t + 24, 9j + 5t = 7j + 18540. What is the units digit of j? 5 Let j = 80520 + -56939. What is the ten thousands digit of j? 2 Let f(y) = 86y2 + 5y - 2. Let h = 34 - 36. What is the units digit of f(h)? 2 Let j(w) = -w*3 + 85w*2 - 123w - 565. What is the hundreds digit of j(56)? 4 Let j be (-6)/(-8) + (-148)/(-16) + -7. Suppose 5a - 77 = -p, -4p - 186 = -ja - 494. What is the tens digit of (-436)/(-7) - 22/p? 6 Let k(u) = 50u*2 + 28u + 575. What is the hundreds digit of k(28)? 5 What is the tens digit of (84/(-10))/((-16)/212(-7)/(-910))? 6 Let b(v) = 132v*2 - 8v - 1. Let w(r) = 395r2 - 26r - 2. Let y(z) = 7b(z) - 2w(z). What is the units digit of y(-2)? 1 Suppose -3467 - 7441 = -9s. What is the tens digit of s? 1 Let i be (-240)/144 - (-8)/(-6). Let w(y) = -11y3 - y2 + 17y + 39. What is the tens digit of w(i)? 7 Suppose 5933 + 12292 = 27g. Suppose g = -40h + 41h. What is the tens digit of h? 7 Suppose 0 = -4t + 12. Suppose 0 = 3c + tc - 12. Suppose 3p - cw = 53, 2w - 6w = 5p - 81. What is the tens digit of p? 1 Let i(y) = -40y + 8y - 20y + 3 - 14y. What is the hundreds digit of i(-5)? 3 Let a = 5535 - -1254. What is the units digit of a? 9 Suppose 2j + 5k - 90 = -0j, 5k - 170 = -4j. What is the hundreds digit of 21/(-8) - -3 - (-18145)/j? 4 Let h(v) = 3v + 17. Let o be h(-4). Suppose 9x - ox + 208 = m, 0 = -2m - 5x + 416. What is the hundreds digit of m? 2 What is the ten thousands digit of (2/(-30))/((-168)/58814280)? 2 Let l = 20144 - 11238. What is the tens digit of l? 0 Let r(i) = 3i2 + 11i + 29. Let n = -26 + 29. Suppose t + 2k = -0k + 4, nt + 43 = 5k. What is the units digit of r(t)? 1 Let r(v) = 21v2 + 3v + 119. Let s(l) = -11l2 - 3l - 59. Let w(f) = -2r(f) - 5s(f). What is the hundreds digit of w(-4)? 2 Let q(r) = r*3 - 6r*2 - 9r + 16. Let l be (-32)/(-5) - 45/(-75). Let b be q(l). Suppose -bt = 6t - 488. What is the tens digit of t? 6 Let h(k) = 98k + 1274. What is the hundreds digit of h(-7)? 5 Let s(h) = -1951h - 271. What is the hundreds digit of s(-2)? 6 Let x(b) = -6b + 1712. Let d be x(0). Let u = -984 + d. What is the tens digit of u? 2 Let c = 100 - 90. Suppose -14o = -co - 2752. What is the hundreds digit of o? 6 Let a be (45/(-27))/((-10)/(-12) - 0). Let x(l) = -2l - 7 + 14l2 + 7. What is the tens digit of x(a)? 6 Let q be 8/16(-12 - -2). Suppose 2z - 4p - 632 = q, -2z + 0z + 3p = -632. Suppose 0 = 7b - 5b - z. What is the units digit of b? 8 Suppose -920 = -16u + 200. What is the tens digit of (-4 + (-18)/(-4))u? 3 Let f(n) = -37 + 0n2 - n3 - n3 + 49 - 2n + 2n2. What is the units digit of f(-5)? 2 Suppose -305b - 377266 = -1474615 - 11813911. What is the ten thousands digit of b? 4 Suppose 4t - 2552 = -4b, -17t + 20t - 1912 = -4b. Suppose -q + 37 = 34, -s - 5q = -t. What is the tens digit of s? 2 What is the tens digit of (417 + 118388)(-2)/15(-6)/4? 6 Let h = -1825 - -2925. Suppose -861 = -3s + 3g, -5g + h = 5s - 365. What is the tens digit of s? 9 Suppose 534 = 11h + 435. Suppose -5s - 16 = -hs, -2s = -3j + 1894. What is the tens digit of j? 3 Suppose -12c - 15285 + 148869 = 0. What is the units digit of c? 2 Suppose 2y - y + 34 = -d, -2d = 5y + 56. Let l = 50 - d. What is the units digit of (13/13)/(2/l)? 4 Let h(z) = 5z*2 + 44z - 24. Let x be h(18). Let t = x + -864. What is the thousands digit of t? 1 Suppose 42p - 43p + 10288 = 2o, 5p = 5o + 51425. What is the ten thousands digit of p? 1 Let y(h) = -h. Let m be y(0). Suppose z = 3t + 613, m = 3z - 19t + 15t - 1839. What is the tens digit of z? 1 Let w(z) = 116z - 158. Let h(l) = 10l - 133. Let b be h(14). What is the units digit of w(b)? 4 Suppose -5s + 4 = -4s. Suppose -8p = -11p + 4y + 764, -sp + y = -997. What is the hundreds digit of p? 2 Suppose -2k = 21k - 2944. Suppose 2160 = -126j + kj. What is the units digit of j? 0 Suppose -n + 11 = 5p, -8p + 9 = 2n - 11p. Let x = -3 - n. Let u(o) = o2 - 2o + 7. What is the hundreds digit of u(x)? 1 Let q = -5468 - -10471. What is the tens digit of q? 0 What is the ten thousands digit of 1054(-47)/6300/(-100)? 2 Let f(z) = 219z + 3405. What is the tens digit of f(39)? 4 Let p(n) = 115n*2 - n. Suppose 4v + 27 + 9 = 0. Let f be 0 - 1 - 03/v. What is the units digit of p(f)? 6 Let x = 167 - 181. What is the units digit of (13/(-52) + x/8)-8? 6 Let v(j) = 8j - 7. Let c(t) = -33t + 27. Suppose -4o - 29 = -5p, -3p + o + 14 = -p. Let a(d) = pv(d) + 2c(d). What is the tens digit of a(5)? 2 Let z = 145307 - 101106. What is the units digit of z? 1 Suppose -5b + 3g + 4793 = 0, 35b - 36b - 4g + 977 = 0. Suppose 1223 = 4h - b. What is the hundreds digit of h? 5 Suppose 4m - 36 - 12 = 0. Suppose 2a - m = -2a, -g = -5a - 11. What is the tens digit of g? 2 Suppose -2d - 1167 = 5n, -n - 192 - 2097 = 4d. Let v = d - -957. What is the units digit of v? 6 Let u be 2/126 - (-2 + 1988). Let o = u - -3227. What is the units digit of o? 2 Let o(b) = b3 - 14b*2 + 24b - 14. Let q be o(12). Let a be q/35 + (-86)/10. What is the tens digit of (-219)/a + 2/(-6)? 2 What is the units digit of (-4)/42-3 + ((-78110)/(-35) - 4)? 8 Let k(n) = 2n*3 - 6n*2 - 6n + 1. Let m be k(5). Let z(y) = 3y2 + 5y + 25. Let c be z(-5). Let r = c - m. What is the units d	{ "pile_set_name": "DM Mathematics" }
is the closest to 0 in 20/9, -7/2, -2/13, -6? -2/13 Which is the nearest to 2/3? (a) 1/8 (b) 142/11 (c) -0.1 (d) 4 a What is the closest to 13 in -2/7, 2.1, -44, 2/9, 3/2? 2.1 What is the closest to -2/9 in -5/29, -0.1, 3, 320? -5/29 What is the nearest to -1 in -1/4, -1/32, 1.2, -5/4, -1? -1 Which is the closest to 31616? (a) -2/9 (b) -3 (c) 5 (d) -1 (e) -0.3 c Which is the nearest to -50? (a) -0.5 (b) 2 (c) 2/19 a What is the nearest to -2/3 in -3, -59/6, 0.3, 1? 0.3 What is the nearest to -3 in -292, 4/5, -1/3? -1/3 What is the closest to -2 in -0.1, 0.3, 4, -45, 29? -0.1 What is the closest to -8/3 in -0.1, -592, -3, 0.1, 0.5? -3 Which is the nearest to -7? (a) 76 (b) -11/5 (c) -1 b What is the closest to 25620 in -0.2, 2/5, 0.2? 2/5 What is the nearest to -4 in -3, 3/7, -2/7, 0, 397? -3 Which is the nearest to 1? (a) 2/7 (b) -0.2 (c) 0.2 (d) 38619 a Which is the nearest to -4? (a) 0.1 (b) 2/3 (c) -3 (d) 5 (e) 1718 c What is the closest to -0.1 in 3, 7, -0.1, -5, -10? -0.1 Which is the nearest to -2? (a) -14 (b) -4/69 (c) -4/5 c Which is the closest to -2? (a) -1/8 (b) 13.8 (c) -3 (d) -1285 c Which is the nearest to -1? (a) -1/8 (b) 26/931 (c) -3 a What is the closest to 1/2 in -2/11, 0, -4, 3, -3? 0 Which is the closest to 1? (a) -0.3 (b) -2/13 (c) 0.4 (d) -0.0113 c Which is the closest to 1/4? (a) 6/7 (b) 0.047 (c) 167 b Which is the closest to -0.1? (a) 213 (b) 0.4 (c) -0.1 (d) -10 c Which is the nearest to 0.13? (a) -0.054 (b) 1 (c) 1/6 c What is the closest to 0.1 in 0.4, 2, -0.1, -718, -5/3? -0.1 What is the nearest to 2 in 2, 35, -42, 0.4, 1? 2 What is the closest to 2/5 in -1, 4, 0.13679? 0.13679 Which is the closest to -1? (a) -2/1959 (b) 1 (c) -12 (d) -1 d Which is the nearest to -287? (a) 3 (b) -4 (c) -1 (d) -7 d Which is the closest to 1/2? (a) 61 (b) 0.04 (c) -4 (d) -3/5 b What is the closest to -3 in 1/10, 3/4, -73? 1/10 What is the nearest to -32 in 1, -1, -4/21? -1 What is the closest to 1/96 in -2, 0.5, 3, 2? 0.5 What is the nearest to -3.9 in 3/4, -1, -5, -41/10? -41/10 What is the nearest to 2/5 in -2/7, 2, -2/39, -304, 0.13? 0.13 What is the closest to 0.21 in -2, 2/5, -8, -0.09? 2/5 Which is the closest to 1? (a) 157 (b) -1 (c) 2 c Which is the nearest to 317? (a) -4/3 (b) 1/2 (c) 2 (d) -13/2 c Which is the closest to -5/11? (a) -1182 (b) -0.5 (c) 0.5 b What is the nearest to -2/7 in 2, 4, 723.8? 2 What is the closest to -0.3 in 0, -10403, -0.2? -0.2 Which is the nearest to -1? (a) 20 (b) 0 (c) -0.235 (d) -0.1 (e) -1 e What is the nearest to -0.2 in -2/3, -3, 383, 1/9? 1/9 What is the nearest to 366 in -6, -36/5, -1/7, 2, 2/3? 2 Which is the closest to 0.3? (a) 150 (b) -5.5 (c) -1/2 c Which is the closest to 11.8? (a) -8 (b) 1 (c) 11 c Which is the closest to -19/2? (a) 1/4 (b) 1/2 (c) -109 (d) 3 a Which is the closest to -2/17? (a) 3 (b) 0.07 (c) -0.1 (d) -8 c Which is the closest to 0.1? (a) -56/9 (b) -0.1 (c) -4.2 (d) -5 b What is the closest to 7 in 1641, -0.5, 2, -1/13? 2 What is the closest to -0.1 in 0.5, -32, -4, 0.31, -0.2? -0.2 What is the nearest to -1 in 0, -0.004, 0.9, 1/6, -3? -0.004 What is the nearest to 1 in -1, -1056, 8/125? 8/125 What is the nearest to -1/946 in -1/4, -0.4, -5? -1/4 What is the closest to 8/29 in -1, -1/4, 0.11, 0.4, 1/4? 1/4 Which is the closest to -1? (a) 0.1 (b) -5 (c) -2/15 (d) -47 (e) 0.3 c Which is the nearest to -7/10? (a) 4 (b) 510 (c) 0.1 c Which is the closest to 6? (a) 0.2 (b) 1/13 (c) 1/6 (d) -0.5 a What is the nearest to -1 in 1, 4, 255, -0.8? -0.8 Which is the closest to 0.1? (a) -6 (b) 66 (c) -47 (d) 3/5 d Which is the closest to 2? (a) -41/2 (b) -3 (c) 1 (d) 0.1 c Which is the closest to 2/7? (a) -0.164 (b) 4 (c) -1/4 (d) -224 a What is the nearest to -0.1 in -10.5, 0.2, -2/15, -16? -2/15 What is the nearest to 2/5 in 1, 2/207, 4, -1? 2/207 What is the closest to 397 in 1/4, 3, -2/7? 3 What is the nearest to 0.4 in -229/4, -1.11, -5? -1.11 Which is the nearest to 2/7? (a) -0.1 (b) 5 (c) 0.2 (d) -10111 (e) 4 c Which is the nearest to -38? (a) 1/2 (b) -2/13 (c) 1.41 b Which is the closest to -0.2? (a) -1 (b) -0.02 (c) 1 (d) 0.01 (e) -1126 b What is the nearest to 0 in -1/4, 12, -0.2, -10388, 0? 0 Which is the closest to -2? (a) -0.6 (b) 5 (c) -71 (d) 2.6 (e) 3 a What is the nearest to -2/3 in -0.4, 2, -3/4, 1365? -3/4 What is the nearest to -10 in -1/10, 5, -2/185, 1.2? -1/10 What is the nearest to -0.9 in -0.05626, 0, -5, -0.1? -0.1 What is the closest to -8/3 in -2.5, 0, 0.4? -2.5 What is the nearest to 37/3 in -3, 3, 6, 14? 14 Which is the nearest to -12? (a) -1 (b) 3 (c) 87 (d) -0.6 a Which is the closest to 0? (a) -0.89 (b) -2 (c) 4 (d) 2/35 (e) -3 d Which is the nearest to 1/3? (a) -316 (b) 45 (c) -2/11 (d) 4 c What is the nearest to -0.038 in -10, -0.4, 2.8? -0.4 Which is the closest to 77? (a) -43 (b) 38 (c) -1/3 b What is the nearest to 4 in -60.2, 0, 1/8? 1/8 Which is the closest to 0.2? (a) 1/4 (b) 403 (c) -5 a What is the closest to -6 in 0.1, -1, -56? -1 Which is the closest to -0.1? (a) 1 (b) 61/6 (c) 170 a What is the nearest to -1/68 in -4, 6, 1? 1 What is the nearest to -195 in -2/7, -2/15, 357, -4? -4 What is the nearest to -4 in 86.8, 24, -0.1? -0.1 Which is the nearest to -1/250? (a) 9 (b) 0.04 (c) -0.1 b What is the nearest to -4/5 in -1/7, -2, -3, 0.7, -51? -1/7 What is the closest to -8 in 0.2, 2/9, 2/25, -2/23, 5? -2/23 What is the closest to 12/13 in 0.2, 4, 2, 1/12? 0.2 Which is the nearest to 2/7? (a) 2 (b) -4 (c) 0 (d) -0.2 (e) -81/10 c What is the closest to -3 in -3, 110/17, 0.5? -3 Which is the nearest to 9/41? (a) 1.8 (b) 9/2 (c) -1/6 c What is the closest to -36 in 2, -5002, -0.2? -0.2 Which is the nearest to 6.67? (a) 5 (b) -2/3 (c) -1/3 (d) -4 (e) 2 a What is the closest to -81 in 5, -8, 2/19, -1/65, -0.5? -8 Which is the closest to 10? (a) 11 (b) 0.5 (c) -2/9 (d) 0.19 (e) -0.07 a What is the closest to -0.3 in -57, 0, -11? 0 What is the closest to 27 in -137/8, 0.2, 0, 2, -0.03? 2 Which is the nearest to 2102? (a) -0.09 (b) 1/4 (c) -6/11 b What is the nearest to -1 in -202, -3, 2, 11, 5? -3 What is the nearest to -7.19 in 7, -1, 0.5, -1/3? -1 Which is the closest to 1/2? (a) -1 (b) 2/19 (c) -1.8 (d) -0.5 b What is the closest to -1/2 in 0.3, -4, -125/23, 0.1? 0.1 What is the nearest to 2 in 13187, 0.8, -3? 0.8 Which is the nearest to -8? (a) 2/5557 (b) -0.4 (c) 2/11 b Which is the closest to -1? (a) 4 (b) 80452 (c) -0.1 c What is the closest to -1 in 1/3, 2/9, 3/4, -0.3, -2/341? -0.3 Which is the closest to 0? (a) 0.09 (b) 1531 (c) 2/9 (d) -0.3 a What is the nearest to -188 in -2, -31, 4? -31 Which is the nearest to 2? (a) -202 (b) -2 (c) -2/207 c Which is the closest to 2? (a) 4 (b) 0.3 (c) 28 (d) -0.098 b Which is the nearest to -3? (a) -4 (b) 1/3 (c) -0.8 (d) 55 a What is the nearest to -1 in -3/11, -2, -8, -0.3? -0.3 What is the nearest to 0.069 in -4/5, -8, -2? -4/5 What is the closest to 0 in 136.5, 1, 5, -4? 1 Which is the closest to -176? (a) -5 (b) 0.5 (c) -0.5 (d) 42 a What is the closest to 0 in 0.9, 2/5, -5, -9? 2/5 What is the closest to 3 in -10, 5, 0.4, 20? 5 What is the closest to 155 in -38, -1, -5? -1 What is the nearest to 8.94 in 19, 0.2, 0.1, -1? 0.2 What is the closest to 3 in -6, 18, 1/2, 0.4, 8? 1/2 What is the nearest to 6 in -114, -0.4, 1/2, 2/7? 1/2 Which is the closest to -2/3? (a) -0.054 (b) 0.2 (c) -1035/8 (d) -0.4 d Which is the nearest to -3? (a) -15 (b) -6/23 (c) -0.2 (d) 3.9 (e) -4 e Which is the closest to 0.1? (a) 5 (b) 3 (c) -52 (d) -7/4 d What is the nearest to 0 in -0.3, 2/97, 0, 3/5, 14? 0 What is the nearest to -2 in 7, -2/75, 0.3, -27? -2/75 Which is the closest to -17? (a) -5 (b) 5 (c) -2 (d) -10.758 d What is the closest to -0.1 in -1/8, 0, -2/9, -92, 4? -1/8 Which is the closest to -0.1? (a) 1/6 (b) 4 (c) 0.1 (d) -1/58 (e) 45 d Which is the closest to 1? (a) -2/5 (b) -2/7 (c) -7 (d) 5 (e) 0.7 e What is the closest to 12 in 3, -115, 5? 5 Which is the nearest to -2/53? (a) 5/12 (b) -2/3 (c) 2 a What is the closest to 0.1 in 1/26, -2, 4, 1, -0.79? 1/26	{ "pile_set_name": "DM Mathematics" }
? 0 Which is greater: 2 or -32715? 2 Which is smaller: -774/10261 or 0? -774/10261 Which is smaller: -17424 or -17398? -17424 Does -23747 = -23732? False Which is greater: 2741 or 2738? 2741 Which is greater: 2730 or 2697? 2730 Which is bigger: -228197/6 or -38033? -228197/6 Which is smaller: 0 or -4/380037? -4/380037 Which is smaller: 15951 or 15940? 15940 Which is greater: 136 or -50/13? 136 Which is smaller: 533661/4 or 133414? 133414 Which is greater: 4363 or -6? 4363 Is -64 bigger than -4944/77? True Which is smaller: -3/10294 or 1? -3/10294 Which is smaller: 5383 or 5817? 5383 Which is greater: -5234 or 12? 12 Is -2037/8 at least -18? False Which is bigger: -1 or -1/557375? -1/557375 Which is bigger: -148/807 or 1? 1 Is -3420 at least as big as 3/10? False Is -2113497 > -2113497? False Which is bigger: 37122 or 12/11? 37122 Which is smaller: 0.071 or 165? 0.071 Which is greater: -4561 or 0? 0 Which is greater: 3 or 97/28? 97/28 Is 124474 greater than or equal to 124472? True Which is bigger: 1478 or 159? 1478 Which is bigger: 957 or 852? 957 Is 21369 at least 17? True Which is smaller: 12797 or 447859/35? 447859/35 Which is smaller: -2776 or -2782? -2782 Is 343 bigger than 107? True Which is bigger: -132002 or -5? -5 Is -1 less than -2/1490977? True Is -0.4683648 <= 0? True Is -139 bigger than -317? True Which is smaller: 23177 or -0.01? -0.01 Is 0.635 < -1/76? False Which is smaller: -18 or -504.61? -504.61 Which is greater: -71540 or -3? -3 Which is greater: 56/29291 or 1? 1 Which is bigger: 292 or 277? 292 Are 51572 and 51571 nonequal? True Which is smaller: 0 or 11182/329? 0 Is -13280 != 1? True Is 209 greater than or equal to 457? False Which is bigger: 200 or 11647/58? 11647/58 Which is greater: -1/279 or 0? 0 Is 7782 <= 7796? True Is 3223 smaller than 3455? True Is -306 at least as big as -7030/23? False Do 3337/431 and 9 have the same value? False Which is smaller: 328844 or 328839? 328839 Which is smaller: 2087 or 651? 651 Is -0.5 < 0.51544? True Which is smaller: 7230 or -7/9? -7/9 Which is smaller: 217115 or 868459/4? 868459/4 Which is greater: 1/28 or 95960? 95960 Which is smaller: -113 or -64? -113 Which is smaller: 50626 or 50644? 50626 Which is greater: -0.0737 or 1.76? 1.76 Is 3/22346 at least 0? True Is -2913 not equal to -11655/4? True Which is greater: -22/9109 or 1? 1 Are 64/16733 and 0 nonequal? True Which is smaller: -1 or 2/68687? -1 Is -1.78 smaller than -3054? False Which is smaller: -10886 or 0? -10886 Which is bigger: -16784 or -16783? -16783 Is 370/11 < -6? False Does -7/1283008 = 1? False Is -56/5 greater than or equal to 0.896? False Is 0 less than or equal to 2/24587? True Is 360339 equal to -1/2? False Is -645/3976 < 0? True Are -109/7475 and -1 equal? False Are -417 and -124100/297 non-equal? True Is 1191810 smaller than 0? False Is 20 at least 35? False Which is greater: -22489 or -22483? -22483 Is -65/71766 < 0? True Is 2/47401 less than -1? False Are -23540 and -23562 non-equal? True Is 1/4796 bigger than -11? True Which is bigger: 1/5 or -13595? 1/5 Are 2 and 865/973 non-equal? True Which is bigger: -1 or 12/1195? 12/1195 Do 52/1403 and -1 have the same value? False Is 131 at least as big as 36198? False Which is smaller: 14507/19 or 764? 14507/19 Are 1 and 52/10877 unequal? True Which is bigger: -2/6753467 or -1? -2/6753467 Which is greater: 10977 or 10953? 10977 Which is bigger: -1509 or -1469? -1469 Which is greater: -5162 or 0.5? 0.5 Is 1 greater than 5/1622048? True Is -119 greater than or equal to 0.162? False Which is smaller: -2/53 or -29138? -29138 Which is greater: 1 or -20/30231? 1 Which is bigger: 387238 or 387237? 387238 Which is bigger: -5109 or -5011? -5011 Is 729 at most 10? False Is 11/9 smaller than -166? False Are 1/2808290 and 1 nonequal? True Is 1635148 bigger than 1635149? False Which is smaller: 6305 or 321? 321 Which is smaller: 215/46 or -12? -12 Is -2950/137 equal to -22? False Which is bigger: 0 or 7/100455? 7/100455 Which is smaller: 7 or 1106/155? 7 Is -3340/107 at least -0.2? False Is 122436 greater than or equal to 122438? False Is 0 at least as big as -16/1275? True Is -3/5 >= -31812? True Is -26/4447 less than or equal to 1? True Is -30/102133 greater than 1? False Is 0 at most -417/281? False Is -1330 less than -1284? True Which is smaller: -54/19 or 74? -54/19 Do -69810 and -69809 have the same value? False Is -1/4 >= -1275232? True Which is greater: -4166 or -29170/7? -4166 Is -1755 less than -1727? True Which is smaller: -7/117 or -254? -254 Which is smaller: 1/12 or -199209? -199209 Is -4/3103065 >= 0? False Which is smaller: -104 or -1068? -1068 Which is bigger: -1393030 or 1? 1 Is 0.1 at most -57/2? False Which is smaller: 1590 or 1208? 1208 Is 888 at least as big as -1/66? True Which is greater: 23 or -163349? 23 Which is smaller: -1016 or -1065? -1065 Which is smaller: -138 or -3598? -3598 Is 1/126 greater than -662/7? True Which is greater: 48 or 32728/681? 32728/681 Which is greater: 12512 or -2.9? 12512 Is -11/17136 greater than or equal to -1? True Is -7.6816 smaller than -0.12? True Is 8985 less than or equal to -1/4? False Is 2539 >= 2537? True Are -119/6 and 9 equal? False Which is smaller: 369063 or 369062? 369062 Is 3514514 > 3514514? False Are 0 and 85020 nonequal? True Which is bigger: 2 or 649/1190? 2 Which is smaller: -409 or -28322/69? -28322/69 Which is bigger: -27156 or -27146? -27146 Which is smaller: 48275 or 48274? 48274 Which is greater: -1.1 or 3170? 3170 Is 2020/59 greater than 33? True Which is bigger: 0 or -3/717767? 0 Which is bigger: -68/761 or 0? 0 Are 1/39 and -6.989 equal? False Is 752/5 bigger than -52? True Which is bigger: -3860443 or -3860444? -3860443 Is 931/164 greater than or equal to 6? False Which is smaller: -23723 or -23713? -23723 Which is smaller: -1751 or 3? -1751 Is 1912392 less than 1912392? False Which is smaller: -27789 or -27788? -27789 Is 115206 <= 115206? True Which is smaller: -1374/6325 or -1? -1 Is -21/23512 <= -1/2? False Which is greater: 0 or -3/4497226? 0 Is -71856 > -0.2? False Is -2574 bigger than 2/147? False Is 5744 at most as big as 5751? True Are 1 and 10910881 unequal? True Which is smaller: -5/173 or -1537? -1537 Is -1 smaller than -6/91517? True Are 43212 and 43215 non-equal? True Is 137/239 bigger than 2? False Do -25648 and -25648 have different values? False Is 10632 at most as big as 13? False Which is greater: 0 or -4/91179? 0 Which is bigger: 144 or -71/3? 144 Which is bigger: 326 or -1158? 326 Does -222/1159 = 0? False Which is smaller: -59593 or -59591? -59593 Do 8/62717 and 0 have the same value? False Which is smaller: 6/5179 or 0? 0 Is -12946/3 greater than or equal to -4314? False Which is smaller: 13736 or 13446? 13446 Is 5 greater than or equal to 2220/437? False Are 254 and 18035 equal? False Is 83903 at most as big as 83903? True Which is smaller: -105213 or 0? -105213 Is -101993 at least -101993? True Which is smaller: -1 or -5/1563? -1 Which is smaller: 0 or 4/50167? 0 Is -127/4797 != 1? True Is -3/263057 greater than 0.3? False Which is bigger: -181 or -206? -181 Which is smaller: 2/3 or -1/28909? -1/28909 Is -3687 greater than or equal to -3683? False Are 6/7 and 0.41851 unequal? True Is 1 less than or equal to -13/550? False Is 121/5 equal to 72? False Which is bigger: -116594 or -116596? -116594 Which is greater: 49693 or 447232/9? 49693 Is 2/959841 less than 0? False Which is smaller: 4846405 or -2? -2 Which is bigger: 0.25123 or 3? 3 Is -2213 <= 65? True Which is bigger: -756 or -9818/13? -9818/13 Is 1799 greater than or equal to 1454? True Is -17155 < 0? True Is 1/3 > -4/8041? True Is 1/3 >= -0.87038? True Which is bigger: -11878 or -11881? -11878 Is 16 at most as big as 19634/1193? True Is -3/2 greater than or equal to 13590? False Which is bigger: -2/5849 or -0.25? -2/5849 Which is smaller: -0.2 or -53113? -53113 Which is greater: -2 or -427/129? -2 Which is smaller: -1000 or 2/5? -1000 Which is bigger: 1/2 or 79.63? 79.63 Do 87163/4 and 2 have the same value? False Are -3 and -5038 unequal? True Is -2043/2 != -2/9? True Which is smaller: -5 or -2467? -2467 Which is smaller: 0 or 2/201795? 0 Is -1/4270868 < 0? True Is -28544 greater than or equal to -28539? False	{ "pile_set_name": "DM Mathematics" }
4k - k, -3g + k - 170 = 0. Let i be 906/(-8) + 2/8. Let b = g - i. Is b prime? False Suppose -2t = -5a - 0t - 60, 5t = -4a - 48. Let y be (-64)/a - (-8)/12. Let w(h) = 10h*2 + 2h - 1. Is w(y) prime? False Let t = 118 + -83. Is (-6)/(-21) + 7025/t a composite number? True Let q be (-1 + -192)(-4)/(-2). Is 0 - q/2 - 2 a composite number? False Let g(t) = t3 + 8t*2 + t + 7. Let l be g(-8). Let m(p) = 1207p*2 + p + 1. Is m(l) a prime number? False Suppose 18987 = 4o + 5c, -6c + 4c - 18966 = -4o. Suppose -3z = 6z - o. Is z composite? True Let y = -1904 + 3595. Is y a prime number? False Let x be (-2)/98 - 6/27. Is (62/(-4) - x) + 192 a prime number? True Let j(s) = 2s3 - 7s*2 + 7s + 1. Suppose -2y - 23 = -2p - 3p, 3y + 12 = 3p. Let l be j(p). Suppose 0 = n + 2n - l. Is n composite? False Suppose 5v + 2j - 103513 = 0, -j - 8931 + 91739 = 4v. Is v prime? False Let w = 39034 - 19317. Is w a prime number? True Suppose -y + 13037 = -p, -29p + 20 = -34p. Is y a prime number? True Suppose -2n - 2n + 4 = 0, m + n = 25. Suppose 0g + 4g + m = 0. Let o(h) = -3h*3 - 10h*2 - 5h + 8. Is o(g) composite? True Let c(n) = 1226n2 - 23n - 46. Is c(-3) a prime number? True Suppose 3k = -2s + 17, k + 37 = 4k - 2s. Let o = k - -322. Is o a prime number? True Let w be 17 + (0 - 2/(-2)). Let i be -66((-16)/12 - -2). Let v = w - i. Is v a prime number? False Let c be (40/4)/((-1)/(-2)-2). Suppose -11 - 37 = -4x. Is x/(-20) + (-1316)/c prime? True Let i be 2(-3)/((-6)/25). Suppose -5k - i = -70. Is (-278)/(k/(-3) - -1) a composite number? False Suppose 15p + 1169 = 16p. Suppose -4480 - p = -3x. Is x a prime number? False Let o = -1 + 0. Let l be -1 - (3/o + -3). Suppose -lb = -b - 1324. Is b prime? True Let m = -20 - -36. Suppose 10q = mq - 8346. Is q a prime number? False Suppose 2n = -22 + 12. Let l be ((-1588)/(-10))/(n/(-75)). Suppose -7b + b = -l. Is b composite? False Let w(h) = h2. Let o(s) = -5s*2 - 8s + 10. Let t(y) = -o(y) - 3w(y). Let c be t(-7). Suppose -j - c = -5q + 34, -4q + 48 = 4j. Is q a composite number? False Let v = 193 - -76. Suppose 3x - c + v = c, -x + 5c - 81 = 0. Is (-8)/(-14) - 26793/x composite? True Suppose -y - 2y = -1653. Let q be 4/(-2)(-6)/(-12). Is 2 + y/(q - -2) a prime number? False Let f(h) = -h*3 + 11h*2 - 8h - 12. Let s be f(10). Suppose sw - 15870 = 1402. Is w a prime number? False Let x(c) = 35c*2 - 34c + 13. Is x(10) a composite number? True Suppose -11657 = -3q + 11o - 7o, 2o = 4q - 15556. Is q composite? True Let q(y) = 2y*3 + 1. Let l be q(1). Suppose 65 = 13i + 13. Suppose lx + 2227 = 5v, -2v - 28 = -ix - 930. Is v composite? False Let v = -591 + 1037. Is v composite? True Suppose 2j + 1 = s, 2j - j + 3s - 3 = 0. Suppose -3i + 4m = -14, ji = 4i + 4m. Suppose -3b - 5y = -720 - 1298, iy + 2011 = 3b. Is b composite? True Suppose 71 + 0 = j. Let y = j + 186. Is y a composite number? False Suppose -5k - 10 = 3z, 5z - 4k = k + 10. Suppose i - 269 - 110 = z. Is i composite? False Suppose 48g - 44g - 26492 = 0. Is g prime? False Let h(u) be the second derivative of u5/20 - u4/2 + 2u3/3 - u2 - 4u. Let x be h(5). Let p(i) = -12i + 10. Is p(x) a composite number? True Let h(m) = 42m*2 - 7m - 3. Is h(-4) prime? False Let m(x) = 17x2 + 87x - 1. Is m(-40) a prime number? True Suppose -3p = 4y - 4967, p - 2p + 5y = -1662. Is p prime? True Let q(a) = -a*2 + 20a + 10. Let y be q(13). Suppose -5j - y = -f + 75, -5j = f - 206. Is f a composite number? False Suppose 0 = -o + 4o - 4z - 31, 0 = -2o + z + 14. Let n be 46/(-10) - (-3)/o. Let j(g) = 6g*2 + g - 5. Is j(n) composite? True Let r = 9412 + -4193. Is r prime? False Let l(i) = -i + 1. Let o be l(2). Let k be (0 - o) + (-8)/(-4). Suppose 951 = 5h - 2m, 5h = kh + m + 380. Is h composite? False Let h(v) = 92274v*2 - 17v - 2. Is h(-1) composite? True Suppose 4l - 101671 = 3o, -76256 = -3l - 18o + 23o. Is l composite? True Is -2 + (-4 - -753) + 8/4 a prime number? False Suppose -c = 3j - 6c - 21, 0 = 2j - 3c - 13. Let m(p) = -2p*3 - 2p + 1. Let b be m(j). Let v = 3 - b. Is v a prime number? False Suppose 9j - 32 = 22. Is 1636/j((-105)/(-10))/7 a composite number? False Let c(t) = 489 - 5t2 + 3t*2 + 0t + 0t + t3. Is c(0) a prime number? False Let x(c) = 12 - 25 - 445c + 11. Is x(-1) a composite number? False Is 1378068/30 - (-45)/(-75) composite? True Let u = -35 - 19. Suppose 12f = 9f + 411. Let p = f - u. Is p a prime number? True Suppose -2b = 3u + 11, u = -3b + 5u + 26. Is (-121 - b)1/(-1) a prime number? False Let u(l) = -2l*2 + 3l + 4. Let m(v) = 0v2 - 3v - 5 + 3v2 - v2. Let x(o) = 3m(o) + 2u(o). Is x(8) prime? True Let q(c) be the first derivative of -11c*3/6 + 6c*2 + 11c + 7. Let u(v) be the first derivative of q(v). Is u(-7) a composite number? False Let w = 29 + -28. Let s be (-1)/((-1 - -1) + w). Is 20088/64 + s/(-8) composite? True Is 0 + (51452 - 0 - (6 - 3)) prime? True Suppose -393924 = -19x + 61525. Is x a composite number? False Let r = -94 - 348. Let h = 653 + r. Is h a prime number? True Let v(p) = -p3 + 11p*2 + 15p - 20. Suppose -2m + 4z + 26 = 0, m - 5z + 9z - 7 = 0. Is v(m) a composite number? True Suppose -2l = 3w - 19, -l - 2 = -w + 1. Suppose g - w = -0g, -4b = g - 1197. Is b a composite number? True Suppose 2n + x = 3x + 16830, -5x + 33696 = 4n. Is n prime? True Let o(c) = 6c3 + 7c*2 - 7c + 29. Is o(10) a prime number? True Let p = 1611 - -1186. Is p prime? True Let r = 109 - 49. Suppose -r = 2c - 2180. Suppose k = 4o - 2o - 417, -c = -5o - k. Is o a composite number? False Suppose -f = -6f + 74615. Is f composite? False Suppose -g + 7g - 16734 = 0. Is g prime? True Suppose 0 = f - 2f - 2g - 7, 0 = -4f - 3g - 13. Let t be -2 + f + -2 + 8. Suppose -3j = -tl - 189, -4j + 5l + 125 + 123 = 0. Is j prime? True Let h = -6230 - -12867. Is h a composite number? False Suppose 7z - 12804 - 503 = 0. Is z prime? True Let y(a) be the third derivative of -a5/60 + 11a*4/24 + 5a*3/2 + 2a*2. Let i be y(12). Suppose 5j + 1684 = 3w, 3w - ij - 1121 = w. Is w prime? False Let b(y) = 18y + 91. Is b(3) a prime number? False Suppose -2o = r - 12 + 2, 5o + r - 22 = 0. Suppose 2c - od + 2 = 0, 1 = 4c + d - 4d. Is 1(c-382)/(-2) prime? True Suppose 0 = -32r + 55r - 312731. Is r a composite number? False Let n = -15 + 19. Let h be 58/12 - (-2)/12. Suppose -np = -hc + p + 695, -c = -4p - 130. Is c composite? True Let v be 1/(-2)(-72)/(-3). Let j(o) be the first derivative of -o*4/4 - 8o*3/3 - 19o*2/2 - 13o - 191. Is j(v) a prime number? False Suppose 11c = 7c + 12136. Let r = -1377 + c. Is r composite? False Let r = 18920 - 11317. Is r a composite number? False Let a(b) = 5b + 9. Let h be a(3). Suppose hf = 25f - 511. Is f prime? False Let y(a) = -a2 - 7a - 10. Let b be y(-4). Suppose -3r - br = -1375. Suppose -4f = -3k - 1336, -5k = -f + 42 + r. Is f prime? True Suppose 5v = -2n + 1192, -n - 2384 = -5n - 5v. Suppose 4h = 5m - 758, -4m + 4h - 6h + n = 0. Is (3 - 6) + 2 + m a composite number? False Is (-132465)/12(1 - (-10 + 15)) composite? True Suppose 2o + 2o + 44 = 0. Let s(k) = k2 + 10k - 10. Let t be s(o). Is ((t - -2) + -62)-3 composite? True Let z(c) = -3c - 43c3 + c + 1 + c2 + 117c3. Let g(k) = -k3 - 16k2 + 1. Let y be g(-16). Is z(y) a prime number? False Let l(w) = w2 + w + 1. Let q(z) = -144z*2 + 4z + 5. Let x(d) = 5l(d) - q(d). Let j be x(-1). Suppose -j = h - 5h. Is h a prime number? True Let n = -1239 + 1944. Suppose 0 = w - 4w + n. Is w composite? True Suppose 0 = 8n + 7049 + 6007. Let z = -285 - n. Is z prime? False Suppose -11t - 9877 = -18t. Is t composite? True Let o be (-1)/(2 + 45/(-21)). Suppose -op + 4p + 6 = 0. Suppose 3m + pi - 261 = 0, 335 = 4m + 3i - 12. Is m prime? True Let v = 2757 + 1610. Let k = v - 2969. Suppose -7t = -t - k. Is t composite? False Is (-1 - 0)-4262107/36 prime? True Suppose -6b + 1680 = -11b. Let w = -97 - b. Is w a prime number? True Let w(i) = 1410i*3 + 4i*2 - 2i - 1. Is w(1) a prime number? False Let w	{ "pile_set_name": "DM Mathematics" }
17 Let a(o) = 135o2 - 4. Let m be a(-2). What is the derivative of -80 - 538z*2 + mz*2 + 15z*4 + 3 wrt z? 60z*3 - 4z Let a = 126 - 123. What is the third derivative of 87s2 - 25s*2 + 16s*2 + 88s*a wrt s? 528 What is the third derivative of -95s*2 - 4s*4 + 1118s + 7s3 + 2s*2 + 94s*2 wrt s? -96s + 42 Let y = -134 - -139. What is the second derivative of 30t5 + 20t - 26ty + 62t*5 wrt t? 1320t*3 Let n(b) = 25b*2 - 4b + 1. Let l(k) = -6398k2 - 48k + 2064. Let m(i) = -l(i) + 12n(i). Differentiate m(h) with respect to h. 13396h Let x(t) be the first derivative of 1391t2/2 + 401t + 20. Differentiate x(q) with respect to q. 1391 Let x(f) = f*2 - f + 2. Let m be x(5). Differentiate -14w - 60w + 13 + m with respect to w. -74 Let p be 74/9 - 6/27. Let t be 19/6 - p/48. What is the second derivative of 0c*3 - 25c + 40c - 5c*t wrt c? -30c Let s be (-9)/((-18)/3388) - -2. Find the second derivative of -sb - 4 - 61b*4 - 38b*4 + 1699b wrt b. -1188b2 Differentiate 6855 - 1321 + 723h - 794 + 3447h + 2796 wrt h. 4170 Suppose -a = t + 51, 6a + 4t = 3a - 150. Let m = 58 + a. Differentiate -13l4 + 3 + m - 2l*4 + 0 with respect to l. -60l*3 Let r = -22 - -25. Suppose -4l - r = -23. What is the third derivative of 6zl + 12z*5 + 0z5 + z2 wrt z? 1080z2 Find the second derivative of 11r*3 - 5379r + 8r3 - 2r*4 - 904r + 2r2 - 7r*3 wrt r. -24r*2 + 72r + 4 What is the derivative of -w*4 + 30w*2 + 7130 - 480w*3 - 333w*3 - 2w - 30w2 wrt w? -4w*3 - 2439w*2 - 2 What is the third derivative of -83y*3 - 48y*3 - 100y*3 + 5619y*2 + 859y*2 + 3y*4 wrt y? 72y - 1386 Find the second derivative of -194251 + 194251 + 280t + 138t*2 wrt t. 276 Let o(u) = 4670u*2 - 54u + 2619. Let x(i) = 4669i2 - 72i + 2620. Let z(n) = -4o(n) + 3x(n). Differentiate z(h) wrt h. -9346h Let o(i) be the third derivative of 487i*4/24 - 695i*3/2 - 2091i*2. What is the derivative of o(p) wrt p? 487 Let v = -20049 - -20049. Let f(b) be the second derivative of 0 - 1/12b*4 + 15b + vb3 + 7/5b*5 + 0b*2. What is the third derivative of f(n) wrt n? 168 Let f(j) be the first derivative of -21/10j*5 + 0j*4 - 23 - 14j*2 + 0j*3 - 9j. Let w(h) be the first derivative of f(h). Differentiate w(s) wrt s. -126s2 Let o(y) be the first derivative of -385y - y3 - 2 + y4 - 5 + 318y. What is the derivative of o(x) wrt x? 12x*2 - 6x Let w(v) be the third derivative of 0v4 + 143/120v*6 - 3v*2 + 0 + 118/3v*3 + 0v + 0v5. Find the first derivative of w(p) wrt p. 429p*2 Let v(i) be the third derivative of -5/4i*4 + 19/12i*5 + 0 + 3i*2 + 5i + 0i3. What is the second derivative of v(t) wrt t? 190 Let z(r) be the first derivative of -68r5/5 - r4/4 + 959r2/2 + 1042. What is the second derivative of z(d) wrt d? -816d*2 - 6d Let g(f) = 75f3 + 17f*2 - 3f + 4. Let d(p) = p*3 - 6p*2 - p. Let v(r) = 6d(r) + 2g(r). What is the second derivative of v(t) wrt t? 936t - 4 Let c = 52 + -49. What is the third derivative of 15f4 + 4f*2 + 7f*2 - cf*2 + 4f*2 wrt f? 360f Find the third derivative of -2a2 + 660a*3 - 162a*3 - 456 - 155 + 156a*3 - 82 wrt a. 3924 Let t(x) be the second derivative of 47x*3 + 776x*2 + 908x. Find the first derivative of t(n) wrt n. 282 Let p = -4445 + 4456. Let z(x) be the first derivative of 0x2 + 2 + 0x*3 + px + 13/4x4. Differentiate z(i) with respect to i. 39i*2 Let k = -6 - -9. Suppose 5t + 4 = -q, -kq - 2 = -2q + 4t. Find the third derivative of 3g*2 - 2g2 + g6 + 7gq wrt g. 960g*3 Let k = 247 + -245. What is the second derivative of -45u - 11u - 403u*k + 365u2 wrt u? -76 Let g(h) = h3 + 8h2 + 7h + 3. Let m be g(-6). Suppose 0 = 3x - m - 75. Find the first derivative of -7f*4 - xf + 1 + 19f + 17f wrt f. -28f3 Suppose -1 = o - 2o, 0 = -4r + o + 55. Let m be 52 + r/(-7). Find the first derivative of -5n4 + 18 - 8 - m wrt n. -20n*3 Find the second derivative of 93779q*4 - 30q - 93734q4 - 16 - q3 + 0q*3 wrt q. 540q*2 - 6q Let x(t) = -t*2 + 8t + 9. Let n be x(7). Suppose 4m = 3m + n. Find the third derivative of 56o5 + 6o*2 - 25o*5 - mo*5 wrt o. 900o*2 Let r(p) be the first derivative of -1/4p*4 - 87p + 0p2 + 51 + 0p*3. What is the derivative of r(m) wrt m? -3m*2 Let f(y) = -108y*3 + 291y - 18. Let d(c) = 146c - 5 - 5 + 231c*3 - 285c*3. Let m(w) = -9d(w) + 5f(w). What is the second derivative of m(i) wrt i? -324i Let p be (-26)/3-67/28. Suppose i + 4 = p. Find the third derivative of -13m5 + 3m*2 + 2m*5 - im*2 - 5m*5 wrt m. -960m*2 What is the second derivative of -1355n - 10n3 - 50n*3 + 1099n + 12n5 wrt n? 240n*3 - 360n Suppose -89 = 2y - 95. What is the first derivative of -201j*3 - 1 + 132j*y - 1 wrt j? -207j*2 Let v(f) = -23f + 310. Let a be v(13). Find the second derivative of -9x + 56x*4 + 136x*4 - 4x + ax wrt x. 2304x*2 Differentiate -10545i*4 + 4785i*4 + 455 - 164 + 498 wrt i. -23040i*3 Find the second derivative of 0 + 0 + 34716v*2 + 3047v*3 - 34714v*2 + 3118v wrt v. 18282v + 4 Let b(w) be the second derivative of -w8/8 - 92w*5/5 - 153w*4/4 - 3w + 716. Find the third derivative of b(y) wrt y. -840y3 - 2208 Let z(i) be the first derivative of 707i*4/2 + 3295i*3/3 - 557. Find the third derivative of z(c) wrt c. 8484 Let t(u) = -2 - 7 + 3 - 8u. Let h be t(-14). What is the derivative of hs2 - 2 - 7 - 3s*3 - 106s*2 wrt s? -9s*2 Let u(h) be the second derivative of -1/4h*5 + 0h*3 + 44h - 1 + 17/12h4 - 93/2h*2. Differentiate u(i) with respect to i. -15i*2 + 34i Let u(g) be the third derivative of -1/30g5 + 10g*2 + 0g - 1/40g6 + 1/30g*7 + 0g*4 + 1 - 1/6g*3. What is the third derivative of u(y) wrt y? 168y - 18 Let z = -128 + 1498. Let o(t) = -70t - 416. Let h be o(-6). Differentiate -1370d*2 + 0d*3 + h + zd*2 + 7d*3 with respect to d. 21d*2 Let t(s) = -s + 19. Let p be t(14). Let h(j) be the first derivative of 124j*5 + 5j - 121jp + 14 + 0j. Differentiate h(w) with respect to w. 60w3 What is the second derivative of -852v + 746v5 - 1493v*5 + 44v*4 + 752v*5 wrt v? 100v*3 + 528v*2 Find the third derivative of -8z + 193836z2 - 985z*3 - 3 - 193876z*2 + 3 wrt z. -5910 What is the first derivative of -t - 4t - 44511t2 - 1237 - 2t*4 + 10180 + 43692t*2 wrt t? -8t*3 - 1638t - 5 Let v(o) be the second derivative of 32o4/3 - 3o*3/2 - 301o*2/2 - 1508o. What is the first derivative of v(q) wrt q? 256q - 9 What is the third derivative of -4z*6 + 94z*4 + 54546 - 54546 + 201z*2 wrt z? -480z*3 + 2256z Let u(f) = 1252f2 - 667f + 1. Let j(k) = -1253k2 + 665k - 1. Let i(l) = -7j(l) - 6u(l). Find the second derivative of i(t) wrt t. 2518 Let g(s) be the second derivative of -275s7 + 5053s*4/4 - 7s - 536. What is the third derivative of g(l) wrt l? -693000l2 Let g(z) = 3z*4 + 67z*3 - 6z*2 - 1001z. Let w(v) = -v*4 - 2v3 + v2 - v. Let r(i) = -g(i) - 6w(i). What is the second derivative of r(t) wrt t? 36t*2 - 330t Differentiate 48a2 + 192a*2 + 488 - 55a*2 with respect to a. 370a What is the second derivative of -2i + 139593i*4 + 659i*5 + 0i - 139593i4 + 843 wrt i? 13180i*3 Let s(y) be the third derivative of 1376y*7/105 - 722y*3/3 - 56y*2 + y - 6. What is the derivative of s(o) wrt o? 11008o3 Let j(q) = -q2 + 2. Let b(y) = 3347y2 + y + 1752. Let a(w) = b(w) + 4j(w). What is the second derivative of a(i) wrt i? 6686 Let w(f) = 848f2 + 48f - 1189. Let t(b) = -2544b2 - 132b + 3565. Let j(i) = 4t(i) + 11w(i). Find the first derivative of j(y) wrt y. -1696y What is the third derivative of 2934i*5 + 170i*2 - 4705i*2 + 95i*2 wrt i? 176040i*2 Let s(n) = -3 + n - 2 + 5. Let u be s(3). What is the third derivative of -63v*3 + 121v*3 - 9v*2 - 69vu wrt v? -66 Let v(i) = -i2 - 1. Let r(y) = 44y2 - 42y - 3. Suppose 270 - 240 = 5l. Let b(m) = lv(m) - 2*r(m). Find the second derivative of b(j) wrt j. -188 Let o(	{ "pile_set_name": "DM Mathematics" }
at is the biggest value in 0.1, -1, -27, w? 0.1 Let a = -347.4 + 351. Let b = a + -3.7. What is the third smallest value in -67, b, 1/4? 1/4 Let y(l) = -349l + 2791. Let n be y(8). Suppose 0 = 2j - 5v - 5, 5j + 2v + 3v = -5. Which is the third smallest value? (a) j (b) n (c) -1/7 (d) -2 c Let o be -189/(-30) + 2/(-5). Let u be 128/(-4) + (o - 0). What is the fourth smallest value in u, 0, 0.4, -1/4? 0.4 Let b(c) = -61c - 19. Let y be b(-3). What is the second smallest value in y, -3, -5? -3 Let o be ((-21)/(-28))/((-10)/8). Let s(f) = -f + 7. Let j be s(9). What is the fourth biggest value in -1, o, j, 65? j Let w = -0.3632 - -0.7632. What is the third biggest value in -6, w, 2/3, -2/3? -2/3 Let p = -29405 - -29440. Let z = 849/28 - 123/4. Which is the third biggest value? (a) z (b) p (c) -0.1 a Let p = -134 + 71. Let o = -57 - p. Let k = o - 6.8. Which is the second smallest value? (a) -0.2 (b) k (c) 1 a Let w = -26.954 + -0.046. Let t = 28.1 + w. Let p(i) = 135i + 1081. Let d be p(-8). What is the biggest value in d, -3, t? t Let p = 1436/7535 + -6/685. Which is the third smallest value? (a) p (b) -7 (c) -22 a Let v = -35.49 - -31.49. Suppose -4o = -i + 16, -5o - i - 25 = 4. Let j be 7/o - 6/(-3). Which is the third biggest value? (a) v (b) j (c) 0.08 a Let y = 0.2 + 0.2. Let x = 44945/2 + -22471. Let o = 3.05 + -0.05. Which is the second smallest value? (a) x (b) y (c) o a Let m = -0.021 - -7.921. Let w = -1564 + 1556. Let o = m + w. Which is the biggest value? (a) 0.3 (b) 3 (c) o b Let s = 0.5087 - 0.5087. Which is the fifth smallest value? (a) -1/3 (b) 0.1 (c) 5 (d) s (e) -2 c Suppose 4o - o + 15 = 0. Let f be (504 - 492)/(1 - -2). What is the fourth biggest value in f, o, 0.3, -43? -43 Suppose 77r + 2053 = 590. Which is the fourth smallest value? (a) 2/9 (b) r (c) 0.5 (d) 11 d Let t = 989 - 996.3. What is the smallest value in -8, -0.5, t? -8 Let g = -21099 - -21103. Which is the third smallest value? (a) 2/9 (b) 26 (c) 1 (d) 9 (e) g e Let j = 120 + -106. Let f = j - 18. Which is the second smallest value? (a) 6 (b) -3 (c) -1 (d) f b Let m = -24 - -149.5. Let o = m + -126. Let w = -9 + 9.2. Which is the second biggest value? (a) -3 (b) 3/8 (c) o (d) w d Let o = 425/6 + -71. Let x be (-686)/(-126) + (-8)/18 + 0. Let g = 595/11 - 54. What is the second biggest value in 3, x, g, o? 3 Let z = -7.585 - -3.585. Let t be 3 + -1 - (1 + -1). Let g = 67 - 67.4. Which is the second smallest value? (a) 2/13 (b) t (c) g (d) z c Let v(c) = -c + 4. Let j be v(8). Let q = -1.18 + 0.92. Let a = 1.26 + q. What is the third biggest value in -3/8, j, a, 4? -3/8 Let w = 131 + -40. Let x = 90.98 - w. Which is the second biggest value? (a) x (b) -3/2 (c) 2/3 a Let u = -2522 + 2521.9. What is the third biggest value in 0.4, 10, 4, 3/5, u? 3/5 Let w = 4 + -8. Let m be ((-4)/(-38))/(0 + -1). Let y be (-5610)/(-180) - 32 - 0. What is the second smallest value in w, m, y? y Let n be 1/(15/2) - ((-60)/675 + 0). Let f = 3 + -2.7. What is the third smallest value in -1/3, f, n? f Let o = 4967 - 4971. Which is the second smallest value? (a) o (b) -3 (c) -884 a Let q be ((-1)/17)/(3/6). What is the second biggest value in -4, q, 1/11? q Let k be 0 - 13/7 - -1. Suppose 0 = -12x + 18x - 6. Let y be 0/(x(-4 + 5)). Which is the third biggest value? (a) k (b) 1/4 (c) y a Let k(i) = -3i3 + 186i*2 - 3. Let p be k(62). Which is the fourth biggest value? (a) p (b) 40 (c) 4 (d) 2/7 a Let s = -11322.2 - -11322. What is the third biggest value in s, 4351, 0.3, -1? s Let u = -0.65 - -94.65. Let t = u + -39. Let w = t + -54.7. Which is the second smallest value? (a) -5 (b) w (c) -2/9 (d) 2/7 c Let t = -1475/9 + 5909/36. Which is the fifth smallest value? (a) 3/2 (b) 22 (c) -5 (d) 1/2 (e) t b Let n = -19.091 + 14.091. What is the biggest value in -1/2, 0.5, 3/2, 1/8, n? 3/2 Let j = 2.7 - -29.9. Let o = 0.6 - j. Let m = o - -47. Which is the smallest value? (a) m (b) 3/7 (c) -2/3 c Let h = -0.191 - -0.28. Let w = h - -0.311. Which is the second biggest value? (a) 5 (b) -2 (c) 1/3 (d) w d Let a = 9885.9 - 9886. What is the smallest value in -1/9, 12, -2, a? -2 Let n = 0.15 + -0.2. Let q = 619.0583 + -0.0583. Let y = q - 620. Which is the third smallest value? (a) y (b) 2 (c) n (d) 3 b Let a = -1326 - -1325.5. Let q = -0.136 + 0.036. What is the third biggest value in -0.2, q, a? a Let l be -4 + (-7 - 180/(-27))-11. What is the third smallest value in 0.5, -7/2, 8, l? 0.5 Let w = 9857 + -9857.1. What is the fifth smallest value in -7, 0.9, -11, w, -3? 0.9 Let u = 3910 + -4199. Which is the second smallest value? (a) -1/2 (b) 0.4 (c) 0.3 (d) u (e) -5 e Let s be (-26)/(-247) + (-372)/(-76). Which is the smallest value? (a) 2 (b) 0.04 (c) s (d) -2 (e) -76 e Let j = -28.79 - -32.79. Let r = 52/87 + 2/29. What is the smallest value in 5, j, r, 0.9? r Let x = 0.08 - 12.08. Let u be 2(3 + (-5 - (-45)/10)). Which is the third biggest value? (a) u (b) x (c) -3 (d) 4 c Let r = 5567/506678 - -3/3034. What is the biggest value in 0, 2, r, -2/7, 2/13? 2 Let n be ((-8)/(-14) + 203/(-98))2/9. Which is the third smallest value? (a) -14 (b) n (c) -0.4 (d) 3 (e) -0.04 b Let q = 0.23 + 0.19. Let x = 0.32 - q. Let y = 69 + -81. Which is the smallest value? (a) x (b) y (c) -2 b Let v be (-6)/4(-8)/18. Let x = 0.7 - 0.8. Let i(z) = -z2 - 5z - 8. Let k be i(-4). Which is the second smallest value? (a) k (b) v (c) x (d) -1 d Let c = 25837/2 + -12917. What is the biggest value in c, 3/34, -6? c Let r be (1/10 - 351/585)/(9/6). What is the fourth biggest value in -4567, -0.2, r, -3? -4567 Let w = -549 + 735. Let p = w + -166. What is the third smallest value in 5/6, 0.5, 0, p? 5/6 Let a be (-4)/(-2 + 6/2). Let w = -0.24 - -0.64. Let n be ((-13 + 12)(6/(-4))/(-3))/(-2). What is the second biggest value in n, a, w? n Let w = 117.7 - 118.1. Let z be 2/8 - (-2)/24. Let j = 13 - 8. Which is the smallest value? (a) j (b) w (c) -0.3 (d) z b Let r be 2/(-11) + 31/110. Let c be (-16)/9(14 - 13) + 2. What is the fourth biggest value in -0.2, -1, c, r? -1 Let c = -2424 - -26662/11. What is the third smallest value in 389, -0.3, 2, c? 2 Let n = -2900/9 - -37682/117. What is the biggest value in 11, 0, -0.1, n? 11 Let c = -54.97 + 55. What is the third smallest value in c, -2/7, -2, 0.1? c Let t = 0 - -0.3. Let z = 0.055 + -82.055. Let w = z - -82.5. What is the fourth smallest value in t, w, -0.1, -1/8? w Let z = 15487 + -15487. Which is the fourth biggest value? (a) 4 (b) -3 (c) 997 (d) z b Let u = 19287 - 19291. Which is the third biggest value? (a) -0.9 (b) -378 (c) u (d) -2 (e) -2/7 d Let a be (142 + -125 + 1 + 7)1. What is the second biggest value in -76, -4, a, 0.5? 0.5 Let h = -4.08 + 0.08. Let t be 2/5(-80)/256. Let m = -4.2 - -4.5. Which is the smallest value? (a) h (b) m (c) 2 (d) t a Let t be (7 + -3)2/(-92). Let v = -0.35371 + 0.85371. Let i = -1 + 2. Which is the biggest value? (a) t (b) v (c) 2/9 (d) i d Let n = -49/138 + 16550/69. Let j = 238 - n. What is the third biggest value in j, -3/7, 2? j Let f = -204497/15 - -13633. What is the third smallest value in -0.2, -116, -4/5, f? -0.2 Let g = -17763.93 + 17763. Which is the second biggest value? (a) g (b) -1/20 (c) 3/2 b Let f = -3906 - -19549/5. Which is the fourth smallest value? (a) -1 (b) 1/5 (c) f (d) 5 d Let k(j) = -6 + 21j*2 - 8j*2 + 1 + 53j + 13. Let a be k(-4). What is the biggest value in 0.6, a, 1/3, -0.05? a Let j = -0.2 + 0.14. Let n = 0.08 + j. Let o = 5.055 + -0.055. Which is the third smallest value? (a) o (b) n (c) 2 a Let p = 1011.419 - 1011.019. Let h = 2 - 4. Let v = -2 + h. Which is the third biggest value? (a) v (b) p (c) 13 a Let o = -6977 - -6979. Which is the second biggest value? (a) -25.6 (b) o (c) 0 c Let v = -5/97 - -4982/679. Which is the smallest value? (a) -0.2 (b) v (c) -2/5 c Let v = 0.3617 - -0.1383. Which is the third biggest value? (a) -2 (b) v (c) -36 (d) 5 (e) -1 e Let t be (((-115)/345)/(14/12 + -1))/8. What is the fourth smallest value in 47, -5, t, 1/13? 47 Let a = -384755 + 384751. Let s = 3 - 4. What is the biggest value in 1	{ "pile_set_name": "DM Mathematics" }
6)? -13 What is the value of -2(-1)/104(17002 + -17000)? 1/26 What is the value of ((-1)/(-8))/(2249/104 - 22)21? -7 What is the value of 12/9282/(-1128)3/(-6)-6? -1 Evaluate ((187/51 + 3)/(-4))/((-150)/(-3060)). -34 96-1 - 58995/(-513) 19 What is the value of 59 + ((-5635)/35 - -70)? -32 What is the value of (-252)/(-27)(13 + 231/(-18))/((-1)/2)? -28/9 What is the value of -112 + (-140 - -40) + 285? 73 Calculate ((-41718)/146013)/(330/(-329) + 1). 94 What is (-28)/6(-17820)/2310? 36 What is the value of (-872)/(-2954) + 40434/(-141519)? 2/211 Evaluate 38 + 168/21 + -7 + (-6)/2. 36 What is (-55 - (-3854)/(-47)) + 86? -51 (-6222)/(-48960) - 15/160 1/30 What is ((-70520)/12642)/(-41) - 5/((-315)/(-6))? 2/49 (-4 + 1 + (-745)/15)/((-144)/(-216)) -79 Calculate ((-38)/(-114))/((-18)/(-12)) + (-986)/(-18). 55 7/(-126)82/2 - (-365)/146 2/9 What is ((-221)/2)/(283283/261492)? -102 2225/90 + (-440)/(-1584) 25 730/6 - ((-3422)/1770 + 48/30) 122 Calculate (175936/21992)/((-2)/(2/(-2)) + 36). 4/19 What is (-9)/(-153) + 92610/3570? 26 (-206 + 2818/14)/(3/(-7) + 0) 11 What is the value of ((-3)/45)/(405764/(-23826) - 1-17)? 11/5 Evaluate 2170/1736(-24)/(-190). 3/19 Evaluate (-120)/54 - (-15602)/(-261). -62 Calculate 754/((-416)/(-64)2). 58 16244/(-1572) - (6 + -16) -1/3 What is ((-4)/100)/(4266/2370)? -1/45 (-79)/(-12324)-524/(-10) 2/15 What is ((-31)/806)/((-21)/(-21))? -1/26 Evaluate 16 - ((-9672)/(-702) - -2). 2/9 Evaluate (344/(-19608))/(25/150). -2/19 What is (-12)/(-105) + (-917838)/43470? -21 What is the value of 241/9 + 0 - (-29 + (236985/(-135))/(-61))? 27 What is the value of (-5460)/(-1170) + 825/351 + -3 - (3 - -1)? 2/117 Evaluate 20 + -20 - -18 - 15 - (-13)/(-4). -1/4 What is the value of ((-7)/(-9))/((5076/(-1128))/((-18)/14))? 2/9 Calculate 20/(-75)(-13 + 124549/9558). -2/243 What is (312/(-9))/(-26)15/2 + (-30)/3? 0 Evaluate ((-1)/3(-7284)/3035)/((-6)/(-93)). 62/5 Calculate 16614/3861 - (-9 - 220/(-24))(-112)/(-4). -4/11 Calculate -5 - (258/(-9))/(40/660110). -7/10 What is (13 - 5)/((-38)/(85 - 9))? -16 Calculate (-1 + 13/10)/((47196/15295)/(2/(-7))). -1/36 What is the value of (615/(-164) - -4) + (-3990)/(-40)? 100 What is the value of -22((-689)/(-494) - ((-56)/171 + (-10)/(-45)))? -33 Evaluate ((-55)/(-33))/(46 + 494/156). 2/59 What is (6683/164 + -39)(66/(-14) - -2)? -19/4 (7 - -78129/(-638))/(9/12) -38 What is the value of -1 + 10 + (52 - 70 - (-2642)/294)? -2/147 -48(-14)/1050-20 + (9 - -3) -4/5 Evaluate (-95)/((-6745)/2414) - 37. -3 39680/(-760) - 3(-64)/912 -52 What is the value of 345/12 - 20822/(-2872)? 36 Calculate 6/25(19/((-627)/(-825)) + -26). -6/25 What is the value of (3/42 - 80/(-350))/((-435)/25)? -1/58 What is the value of (18/396)/((-570)/418)? -1/30 Calculate (84 - (-37620)/209)(-2)/12. -44 Evaluate (-253)/345(-308)/2541. 4/45 What is 39/(-2)(14916/18645 - 32/45)? -13 (-237)/(-120) + -3 + (32/(-2) - -17) -1/40 Calculate 60271 + -60273 - 0(((-1)/2)/(-1) - 1). -2 (3/4)/(1739/(-236504)) -102 Evaluate ((-39676)/3052 + -2(-105)/12)/((-9)/96). -48 Evaluate (-123225)/3445 - 78/338. -36 Calculate (-1505)/(-40) - (-894)/2384. 38 Calculate (-73)/(-292)-240 - -26. -34 30/(-4)5/((-5)/32)4278/14260 72 Calculate ((-32)/64 + 6/(-2))/(238/(-3604)). 53 What is (-33 - -1)((-103824)/5184 - -20)? 8/9 Evaluate 2 + -3 - (-7987)/15974(-1 + 198/70). -3/35 Calculate 2/(-9)-6(35 - (-19461)/(-546)). -6/7 Evaluate 1792/(-20088) - 512/(-7936). -2/81 What is the value of (-11 - 1)599/(-59301)? 4/33 Evaluate (-6715)/79 + 98 - 623/7. -76 Evaluate (-1140)/38(-53)/(12190/69). 9 Calculate (-2 - 7263/234) + 102/2652. -33 What is the value of 40((-3 - -7) + -1)253/506? 60 Calculate ((-648)/16)/(1053/(-468)). 18 Evaluate ((-123)/(-164))/(3(-24)/(-9) + 37488/(-4704)). 49/2 Evaluate (5/(-10))/(15/(-45)). 3/2 Evaluate -8 + (29853/(-5208))/(1 - (-14)/(-8)). -5/14 Calculate (10/6)/((-4920)/369(-14)/210). 15/8 Evaluate 4248/(-423) + 10 - (-45577)/799. 57 Calculate 11292/(-2823)((-6)/15 - (-278)/620). -6/31 What is ((102460/141)/218)/((-4)/(-114))? 95 Evaluate ((-3 + 23)/120)/((-7)/294-133). 1/19 Calculate (24/(-62))/((-6545)/(-202895)). -12 What is the value of (-60)/((-130)/(-13)) - (351120/(-288))/133? 19/6 What is 93/((-558)/4)(-2 - 1230/(-588))? -3/49 What is the value of (-27)/6 - (-6 - -208)(-2)/(-8)? -55 Evaluate ((-9)/(-18))/(28 - (-20145)/(-720)). 24 What is (97 + -3)(-41 + 2490/60)? 47 (141/(-4794) - (-49)/(-68)) + 614/8 76 (14/((-182)/(-39)))/(375/20) 4/25 What is the value of (-186)/12(-105)/651264/(-10)? -66 What is the value of ((-235850)/(-320756))/(2/68)? 25 What is (-221)/(-323)(-35 - -54)? 13 What is the value of ((-1722)/5)/(-3) + (1/200)/((-4445)/(-177800))? 115 ((-6)/63)/((-4512)/(-3384)) -1/14 Calculate (233 - 231)7/(35/110). 44 Calculate 8/32(10/234 + 89/801). 1/26 4278/3565 + (-363)/15 -23 Calculate (6 - -248/(-6)) + (-8 - 581/(-21)). 29/3 ((-13)/(-6) - 2)(598/138 - (-3438)/54) 34/3 What is 12627/(-396) - 2848/(-150)? -1/75 Evaluate 1 + (-13 - 0) + 154/1106568632. 1/76 (-50)/35 + 83824/59892 -2/69 6/5(-158875)/7626 -25 Evaluate (-3)/(-40)-12(-180)/(-1944). -1/12 What is ((-186)/12)/(231/6) - ((-608)/(-176) - 4)? 1/7 What is the value of 5 + 560/(-50) - -739/1365? -6 What is ((-25669)/(-570) - 45)(1 - 6/4 - 2)? -1/12 What is 20/160 + (-17070)/3312 + (-2)/2 + 6? -2/69 Evaluate 200/7 - 280/(1 + 9). 4/7 What is ((-1302366)/26052 + 50)/(0 - 3/4)? -2/167 (22/(-28))/((-34914)/77763) 7/4 Calculate -2528/700 - 153/(-150). 1/50 (-27)/18 + 3/(-2) - (-92 - -96) - -19 12 -2(-1)/9 + 16(-68)/1008 -6/7 (90/35)/(11 + (10988/(-938) - (-3)/7)) -9 What is the value of (-27)/(351/(-130))31/(-868)? -5/14 What is the value of (4/90)/(19/15770) - 15(-64)/8640? 37 What is the value of ((-33677)/(-24055))/(((-105)/54)/5)? -18/5 Calculate 4 + -2(20 - -22 - 41). 2 Calculate 4 + (-305)/45 + (-42 - -45) + (-688)/18. -38 Evaluate (-5)/(-234)(-52)/(-65). 2/117 Calculate 57 + (12/(-6))/(((-296)/36)/(-37)). 48 Evaluate (-2)/(-29) - (130 - 2982884/21837). 20/3 What is the value of ((-26)/1833)/(51 - (88 - 39))? -1/141 Evaluate -64 + 721508/2394. -10/9 What is ((-7 + 6)4)/10 + (-3 + 3)/9? -2/5 (14775/(-29550))/((-286)/(-740) + 2/(-15)3) 37 Evaluate (-5 + 53230/10650)/((782/115)/34). -2/213 Calculate (37/6 - (3/6 - 1))1055448/219885. 32 What is (4/(-2 + 34))/((-143)/52)? -1/22 (22/(-16))/(884884/(-7616)) 2/169 What is (-6799)/1729 + 9 + 508/(-2413)? 34/7 Calculate 28 - (-103)/((-7725)/1830). 18/5 What is (-465)/6 - (-35321)/(-5434)? -84 Calculate (-20)/12(-162404)/(-110730). -22/9 Calculate (-73857)/(-2606097)13/42. 1/114 Calculate (21293/1605 + -13)-4(149/32 + -4). -7/10 Evaluate (-64)/(-1520)(58/24 - 3 - (-43)/(-172)). -2/57 Calculate (190808/92)/(-61) + 109. 75 Evaluate (2/(-39) - 28200/522405) + (-84)/(-437). 2/23 Calculate (-953)/25 - 64857/(-540475). -38 Calculate (342/816)/3 - ((-216)/192)/(-3). -4/17 What is (34/(-10) + 4768/4470)/(14/(-8))? 4/3 What is the value of 218/(-3) + 6146/1317? -68 What is 13882/(-1980) - (-3)/((72/336)/(2/4))? -1/90 Calculate (4196/(-420))/(104/20)-9. 42/13 Calculate 720/(-280)5-7(-60)/(-45). 120 What is 24/(-16) + (-5)/(-2) + -8 + 4896/697? 1/41 What is (-207)/(-39) + -4 - (-6)/31212? 20/13 Calculate (12 + (-852)/72)/(312/1638). 7/8 What is (((50/6)/(15/27))/2)/((-9)/(-54))? 45 What is 14837/(-26466) + 3 + 108/(-33)? -5/6 ((-60)/(-14))/(-4 + ((-750)/(-63) - 8)) -45 Calculate 22(-75)/(-3575)((-8)/12)/(-1). 4/13 Calculate 4 + (-5797)/198 + (-25 - -50). -5/18 Calculate (1460/1752)/(5/132). 22 Calculate -42 - -44 - (-180)/(-12) - -100. 87 (391/(-46) - -20 - 12) + (16/(-10) - 0) -21/10 What is the value of 3 - (-270)/(-70) - (-14)/784-5384? -97 Calculate ((-330)/4400-140)/((-14)/(-20)). 15 What is (416/520)/((-2511)/(-5270) - 2/4)? -34 (-58)/522 - ((-45)/(8910/(-572)) - (5 + 1)) 3 What is (366/2013)/(4/(-48))? -24/11 Evaluate (-5430)/300 + (-4 - 0)(-141)/940. -35/2 Evaluate (-1401 - -1396) + (-594)/(-118)1. 2/59 What is the value of 29982/(-11835) + 8/(-10)? -10/3 Evaluate ((-91)/(-35) + (-287556)/104160)((-7)/(-6))/(-1). 3/16 Calculate ((-10)/(-14) - 1)((-1134)/(-144))/((-420)/35). 3/16 What is the value of (30 - 1476/36) + 17? 6 5/((-180)/(-78))	{ "pile_set_name": "DM Mathematics" }
third biggest value in 0.05, 0.1, 2? 0.05 Which is the third biggest value? (a) -3 (b) -2/7 (c) -3/4 a Which is the second smallest value? (a) -0.5 (b) 57 (c) -1 a Which is the smallest value? (a) 17 (b) 5 (c) -4 c What is the third smallest value in 20, -0.1, 0.4, 3/2? 3/2 What is the second smallest value in -5, 6/17, -82? -5 What is the second smallest value in -5/6, -0.01, 1? -0.01 What is the biggest value in 5, -3.7, 0.3? 5 What is the third biggest value in -15, 1/5, 0.104? -15 Which is the second smallest value? (a) -4 (b) 2/11 (c) 1/6 (d) 2/9 (e) -3/4 e What is the second smallest value in 2/43, 0.06, -1, -0.4? -0.4 Which is the second smallest value? (a) -2 (b) -2/15 (c) -0.32 c Which is the second biggest value? (a) -0.08 (b) 4 (c) -3 a What is the third biggest value in -7, 0.3, -19? -19 What is the third smallest value in 0.1, 2/5, 3, 0.3? 2/5 Which is the third smallest value? (a) 0.4 (b) -3 (c) 0.3 (d) 4540 (e) -2/3 c What is the second biggest value in -0.05, -0.1, -1.9, -1/7? -0.1 What is the biggest value in -0.3, 1/4, 29? 29 What is the smallest value in 3/17, 10, 3/8, -0.5, 4? -0.5 What is the smallest value in -0.5, -2/13, 2, 2/27, 4? -0.5 What is the third biggest value in -3/97, -1, -4, 0.4? -1 Which is the biggest value? (a) 2/27 (b) -1 (c) 2/3 c Which is the fourth biggest value? (a) 0.2 (b) -19 (c) -0.7 (d) 4 (e) 1 c Which is the smallest value? (a) 3/7 (b) 2/5 (c) 283 b Which is the second biggest value? (a) 1 (b) -1/14 (c) 0 c What is the third biggest value in -1, -5, -0.1, -10? -5 What is the smallest value in -1, -29, 0.1, 5? -29 Which is the fourth smallest value? (a) 0 (b) 2/5 (c) -653 (d) -5 b Which is the second biggest value? (a) -3 (b) -1 (c) -3/5 (d) -4.4 (e) 21 c Which is the fourth smallest value? (a) -3 (b) 1/2 (c) -5 (d) -1 (e) -61 d Which is the second smallest value? (a) -616 (b) -5 (c) 0.4 (d) -1/4 (e) 5 b What is the third biggest value in -0.03, -1/3, 2? -1/3 Which is the third smallest value? (a) -2/3 (b) -0.16 (c) 5 (d) 0.1 d Which is the second smallest value? (a) -1/48 (b) -3 (c) 2/77 (d) 4 a What is the third biggest value in 1/11, -1, 2.7? -1 Which is the second biggest value? (a) -2/17 (b) -0.4 (c) 13 (d) -2 a What is the second smallest value in -0.11, 2, 17? 2 What is the smallest value in -12, 2/5, -28, -0.4? -28 Which is the fourth biggest value? (a) -3 (b) 2 (c) -0.4 (d) 5 a Which is the fourth biggest value? (a) 0 (b) 4/5 (c) -1/4 (d) 127 (e) 5 a What is the biggest value in -45/16, -0.4, -2, -2/3? -0.4 Which is the third biggest value? (a) -11 (b) -2 (c) 4 (d) 0.14 b Which is the second smallest value? (a) -24 (b) 3 (c) -5 (d) -22 (e) -2 d Which is the third biggest value? (a) 279 (b) 1/5 (c) -4 (d) 1 (e) -2 b What is the second smallest value in 6, -0.1, 239? 6 What is the fourth smallest value in -36, -0.2, 3, 0.05? 3 What is the second biggest value in 0.1, -3, 37? 0.1 What is the fourth biggest value in -28, 3, -1, 1/5, 0.07? -1 Which is the biggest value? (a) 0.4 (b) 21 (c) -0.9 b What is the second biggest value in -2.7, 5, -125? -2.7 Which is the fourth biggest value? (a) -1/4 (b) -1/5 (c) 1 (d) -35/2 (e) -3 e What is the biggest value in 0.1, 5, -4? 5 What is the third smallest value in -1/9, 12/13, 4? 4 Which is the third biggest value? (a) 0.4 (b) 1 (c) -2 c Which is the second biggest value? (a) 31 (b) 0.2 (c) 5 (d) -0.06 c What is the smallest value in -2/3, -1/3, -1/5? -2/3 Which is the second smallest value? (a) -19 (b) -1/5 (c) 5 b What is the smallest value in -2, -20, -60? -60 What is the second smallest value in -0.2, 5, 36.6? 5 Which is the third smallest value? (a) -1 (b) 1 (c) -1/3 b What is the third smallest value in 0.09, -0.11, 0.2? 0.2 Which is the biggest value? (a) -4 (b) -0.04 (c) 2/15 (d) -5/4 c What is the second biggest value in -0.2, -2/5, -84? -2/5 What is the third biggest value in -21, -2, 2/5, -1/2? -2 What is the second biggest value in -1, -3, -0.05, 1/4? -0.05 What is the third biggest value in -39.6, 0.4, -1? -39.6 Which is the third smallest value? (a) 2/7 (b) 5 (c) 2/9 (d) 0.3 (e) -2 a Which is the fourth biggest value? (a) -3 (b) -1 (c) -2/7 (d) -5/4 (e) -2 e What is the second biggest value in 2/11, 0.03, 1/9, 80, 1/4? 1/4 Which is the fourth smallest value? (a) 0 (b) 0.03 (c) 8 (d) 2/5 (e) -4 d What is the second smallest value in -5/53, 2/15, 4? 2/15 What is the smallest value in 42, -1, -0.4? -1 Which is the biggest value? (a) 1/27 (b) -2 (c) 7 c Which is the biggest value? (a) -0.4 (b) 4 (c) 57 c What is the third biggest value in 0.2, -2, 2/21, -4, 41? 2/21 What is the third biggest value in 222, 0.4, 2, 0? 0.4 Which is the second smallest value? (a) 0.3 (b) -8/7 (c) 0.4 (d) 0.1 d What is the third biggest value in 5, 4, 0.1, 35/2? 4 What is the third smallest value in -3, 0.0154, -2? 0.0154 What is the smallest value in 3/8, -1, -481? -481 What is the second biggest value in 2/15, -1/2, -5, 4? 2/15 What is the biggest value in 3.8, -1/3, -0.26? 3.8 Which is the biggest value? (a) -3/7 (b) 2 (c) -0.4 b What is the third biggest value in 1/11, 0.0192, -0.5? -0.5 What is the smallest value in 21, -0.2, -4, 0.2? -4 Which is the smallest value? (a) -3/2 (b) -1/84 (c) 0.1 a Which is the second biggest value? (a) 18/11 (b) 5 (c) -5/2 (d) -0.2 a Which is the smallest value? (a) 30 (b) -3/5 (c) -1 c What is the biggest value in 5, -1, 0.23? 5 Which is the fourth smallest value? (a) -0.4 (b) 5 (c) -3886 (d) 2 b What is the third smallest value in -37, 0, -5/3, 0.1? 0 What is the smallest value in 1/2, -1.8, 2, -0.3? -1.8 Which is the second biggest value? (a) 38 (b) -1 (c) -4 b Which is the third biggest value? (a) -3 (b) -2 (c) 6 (d) 36 b Which is the biggest value? (a) -2 (b) 1/4 (c) 0.5 (d) 0.36 c What is the fourth smallest value in -0.2, -0.1, 2, 7? 7 Which is the third smallest value? (a) 0.2 (b) 5/2 (c) 4/3 b Which is the biggest value? (a) 0.39 (b) 0 (c) -15.1 a What is the third biggest value in 0.2, -0.1, 0.1996? -0.1 Which is the fourth biggest value? (a) -0.3 (b) -3/8 (c) -83 (d) -0.5 (e) 0.2 d Which is the third smallest value? (a) 0.2 (b) 0 (c) -1/7 (d) 1 (e) 4 a What is the third smallest value in 0.5, 1/3, -43? 0.5 What is the biggest value in 4, -2/177, 0.3, 0, 1/6? 4 What is the third smallest value in -8/5, -0.5, -2/23, 5? -2/23 Which is the third biggest value? (a) 1 (b) 6 (c) 4 a What is the third biggest value in -4, 1/3, -0.01, 3? -0.01 Which is the second biggest value? (a) 25 (b) -4 (c) 0.5 c What is the smallest value in 2/13, 5, 0.4? 2/13 Which is the fifth biggest value? (a) -1 (b) 0.3 (c) -1/11 (d) -5 (e) -0.4 d What is the smallest value in -0.3, 0.11, -2, -8/5? -2 What is the third biggest value in -2/627, 1, 0.5? -2/627 Which is the second smallest value? (a) 6.5 (b) -4 (c) 1 c Which is the third smallest value? (a) 7 (b) 0 (c) 5 a What is the second biggest value in 2/3, 0.3, 8, -5? 2/3 What is the second smallest value in 1/2, -3, -72, 0.3, 3/8? -3 What is the second biggest value in 1.9, -2/5, 10, 0? 1.9 What is the fourth biggest value in 2, -0.08, -4/9, -8? -8 Which is the third biggest value? (a) 2 (b) 5/4 (c) 1/5 (d) 3 b Which is the third biggest value? (a) -1 (b) -8 (c) 5 b Which is the second smallest value? (a) -11/3 (b) 23 (c) 0.4 (d) -3/5 d Which is the second biggest value? (a) 5 (b) 4/7 (c) 128 a What is the biggest value in 0.2, 0.4, -2/3, -2/29? 0.4 Which is the fourth biggest value? (a) 84 (b) -0.5 (c) -0.4 (d) 1 (e) -0.1 c What is the second biggest value in -42, 1/4, 0.2? 0.2 Which is the second smallest value? (a) -7 (b) -40 (c) -5 (d) 2/3 a What is the third smallest value in 15, -2/9, 30/19? 15 What is the third biggest value in -0.3, -2, -6/7, -0.4, 0.01? -0.4 Which is the second smallest value? (a) 6 (b) -0.5 (c) -38/5 (d) 3 b Which is the smallest value? (a) 5 (b) 0 (c) -4 (d) -8 d What is the biggest value in 2/5, -5, -2/11, -200? 2/5 Which is the third biggest value? (a) 1/244 (b) 2/5 (c) -4/5 (d) 1/5 (e) -0.13 a Which is the second smallest va	{ "pile_set_name": "DM Mathematics" }
- (q + 1) - -2. Suppose 2j = 1 + h. Solve jm = 4l + 17, -2l - 4m = m + 15 for l. -5 Let v(j) = j + 5. Let y be v(-8). Let m be (13 - -1) + (y - -1). Solve 3 = -s + t + m, -4s - 5t = 0 for s. 5 Suppose 5h = -4i + 40, -i - 2i = 3h - 27. Solve -2v + c = 7, 5c - 9c - h = 0 for v. -4 Suppose -108 + 32 = -4f. Suppose 3 = -2x + f. Solve 0 = 2t - k - x, t + 2k - 2 = -t for t. 3 Suppose 0w + 12 = 4w. Let g = w - 3. Solve -4i + 0j = -2j - 18, g = 2i + 5j - 3 for i. 4 Let x = -15 + -6. Let j be (-120)/(-21) + (-6)/x. Let a(w) = w2 - 5w - 2. Let y be a(j). Solve 3l - yl - 7 = 4r, 0 = -2r - 2 for l. -3 Let q be 1/(10/4 - 2). Solve -h = o, 4o = -3h + q + 1 for h. -3 Suppose 0 = -n + 3w + 6 + 7, 5n - 5w = 35. Suppose no = -4p + 76, 5p = -0p + 2o + 109. Solve -z = -f + 9, -2z = -f + p - 7 for z. -5 Suppose -p = -5p. Suppose p = 5s - 86 - 94. Suppose 11 = -5k + s. Solve r - 10 = -kw, 4r + 2w - 23 = -w for r. 5 Let c be (1(-21 - -1))/(0 - 1). Solve 0r = 4r + 5q + c, 5r - 4q = 16 for r. 0 Suppose 4q - 32 = 2c, 4q + q + 5c - 55 = 0. Let z be (q/6)/(2/4). Solve 4s - 6t + t = -z, -t + 6 = s for s. 3 Let h be 10 + 0 + 1 - 4. Suppose 0 = -4q + h + 9. Solve 0 = -2s + 5w - 13, 2 = 3s - qw + 11 for s. 1 Let a = 20 + -16. Solve -ac = -2f + 18, 0 = -2f + 3f + 5c + 19 for f. 1 Let n = 8 + -6. Solve 4j + 0j - nc + 18 = 0, 3j - 4c + 16 = 0 for j. -4 Suppose 4l - 12 = 0, 91 = 5f - 0l + 2l. Solve 3k + f = g, -3g + 40 = g - 5k for g. 5 Let p be (-30)/(-4) + -1 + (-11)/(-22). Solve y = 3t + 2, y + 0y - p = -2t for y. 5 Suppose 7 = 3n - 29. Solve -5t + 2 = x - n, -4t = -4x - 16 for x. -1 Let c(b) = -b - 10. Let r be c(-11). Let v be (0 + 0)r/(-1). Solve 2d - d - 5y - 9 = v, -17 = -3d + 5y for d. 4 Suppose 2b = 4b + 28. Let q be (b/(-5))/((-4)/(-20)). Suppose 4o = 34 - q. Solve u + u + ox - 21 = 0, -5x = -25 for u. -2 Suppose 2y + 3y = 10. Suppose u = yu - 3, -l = u - 5. Suppose b + 8 = lb. Solve -2o + 0p = -3p + b, 5o = -5p - 20 for o. -4 Let p(q) = -q2 + 7q + 64. Let t be p(12). Solve -2y + 8 = -3u + 1, 9 = y + tu for y. 5 Let w = -6 + 11. Let o(z) be the second derivative of z4/12 - 5z3/6 - z2 - 4z. Let k be o(6). Solve 2 = kq - 5d, -wd + 0d - 18 = 4q for q. -2 Suppose 7m - 26 + 5 = 0. Solve -mn = -5q + 18, 5n - 15 = -5q - 5 for q. 3 Let n(u) = u2 - 5u - 3. Let b be n(6). Solve h - 4h + 6 = 3d, -5h - bd = -10 for h. 2 Let s = -28 - -32. Solve 0b = -2a + 3b - 15, 4a + 24 = sb for a. -3 Let x = 112 - 109. Solve 0 = 5w + xg - 27, -5g + 23 = -3w + 4w for w. 3 Suppose -3d = -3 - 6. Suppose -5k = -0r - 3r + d, -4r + 4 = k. Solve 4f - 12 = k, c - 19 = -7f + 2f for c. 4 Suppose 0 = 4r - 11 - 53. Suppose -2b - b - 30 = 0. Let j = -6 - b. Solve 3m - m + jv - 20 = 0, 4m - r = -2v for m. 2 Suppose -29 = -5q - 9. Suppose 5x + 3g - 21 = qg, 3x = 4g + 16. Let u(c) = c*2 - 5c + 1. Let z be u(5). Solve 4 = -v + 2l, 3v + l + x = -z for v. -2 Let n = -213 - -217. Solve 0 = y - 0y - i, 3i - 3 = ny for y. -3 Let k be 2 + 0 - -22. Let h = k - 2. Let g be 21/6 - 2/h. Solve 2z + 4m - m = 13, gz - 17 = -4m for z. -1 Let x = 8 + -5. Suppose -4u + 44 = -4z, -xu + 28 = -4z - 5. Solve 0f = r + 4f - u, -4r = -4f - 4 for r. 3 Suppose g + 5m = 11, -m - m - 4 = -g. Suppose 0 = -5t + 5p + 60, 2t + g = -5p + 30. Solve h + t = -3h + 5r, 0 = 2h - r for h. 2 Let u = 60 - 59. Solve -d = -5i - u, 8i + 13 = 3i - 2d for i. -1 Let l be (1/2)/((-1)/(-4)). Solve 2o + 0o + 4u + 2 = 0, 0 = lu for o. -1 Suppose 46k = 38k + 16. Solve -6 = -2m, 0 = -kf + 3f + 2m - 2 for f. -4 Let f(g) = 2g + 5. Let m be f(-4). Let x be 6 - ((-4)/2 - m). Solve 2n = n - 5c + 23, 0 = xn - 5c + 35 for n. -2 Let d(a) = -a2 - 6a + 6. Let m(q) = -q*2 + q. Let l be m(3). Let u be d(l). Let p be 456/21 + (-4)/(-14). Solve -3o - 19 = -ui + i, -4i - o = -p for i. 5 Suppose 5j - 1 = b + 44, 0 = 3b + 15. Suppose 4m - 12 = j. Suppose s = i - 4s - 7, -3s + 47 = i. Solve -2v = -0v + 2p, 3v = mp + i for v. 4 Suppose -2j - 3 = 15. Let o = -4 - j. Let d = 7 + o. Solve -5b - 3y + 7y = d, -b - 4y - 12 = 0 for b. -4 Let z = 11 - 12. Let y be 1057/42 - z/(-6). Solve 17 = 4t - 4a - 11, 3t = 4a + y for t. 3 Suppose -10x + 65 - 15 = 0. Solve -5h - 30 = -xu, -4u = -2u - 2 for h. -5 Let s be 15 - 0 - (2 + -2). Let l(b) = b*2 - b - 3. Let g be l(3). Suppose -3w - 6 + 2 = -2v, s = gv. Solve -3t + 0t - 3 = -3a, -4a + wt + 6 = 0 for a. 2 Let i(y) = -y3 - 8y*2 + 2. Let d be i(-8). Solve -df = 2n - 5f, f = n - 1 for n. 3 Let y = 24 + -19. Suppose 5 + 15 = yq. Solve 0 = 4i + 5k + 8, -4 = qi + 4k - 0 for i. 3 Let m(i) = i3 + 7i*2 - 2i - 9. Let t be m(-7). Let n be (-71)/(2 - 3). Let s = 12 - n. Solve -sh = -4d + 21, h - td + 4 = -17 for h. -1 Let f = 4 + -2. Solve 3j - 20 = -2t, 3j - 4t = -6 + f for j. 4 Let i(a) = a*2. Let c be i(0). Let y = 4 + c. Suppose 2d + 2d = 24. Solve -o + t - 5 = 0, 0t + d = 3o + yt for o. -2 Suppose -5p - 5p = -50. Solve -5f = pc - 30, 0c = -c + 5f for c. 5 Let t = 5 + -3. Suppose -tf + 80 = 4z - 0z, 3f = -z + 25. Suppose 0 = 3r - z - 56. Solve 4v - m + r = 0, 0m - m + 10 = -v for v. -5 Let v be (-13)/((-13)/10) + -5. Solve 2s + 6 = 2u - u, -vu = -2s - 6 for u. 0 Let n = -46 - -71. Solve -x + 5w + n = 4x, 0 = -2x - 3w for x. 3 Let s = 4 + 0. Suppose 0 = -v - sy + 14 + 6, -v = 5y - 25. Solve -6m - 20 = -2m - 5p, 3p = v for m. -5 Let w(c) = 2c - 26. Let a be w(14). Solve 0 = -4h + 5h + 3, ar = 2h + 6 for r. 0 Let l be (-6)/(-27) - 21/(-27). Let s be 260/10 + (-3 - l). Solve 0 = 2a + 5q + s, -3q + q - 8 = 0 for a. -1 Let s = 13 + -9. Solve -5g - 4o = -3 + 10, sg + 10 = -o for g. -3 Suppose 5r = i - 4, 2i - 8 = -3r + 7r. Solve -5x - p = 0, -x = 2p + 9 - r for x. 1 Let p(x) = x*2 + 5x - 6. Let v be p(-6). Suppose vo - 168 = -4o. Let u be o/(0 - 2)-1. Solve n = -w + 6n - u, w = -3n + 19 for w. 4 Suppose -2u + 18 = -16. Solve -3c = -0c + 2r + u, 3c - 2r = -1 for c. -3 Suppose -4h + 5u = -49, h - 52 = -3h + 4u. Let l = -1 + h. Suppose -3g + l = -0g. Solve -3q - g = 2q + 3v, -3v = 3q - 3 for q. -4 Let j be (-3)/15 - (130/(-25) + 2). Solve 2f = -3o + 19, f = jo + o - 18 for f. 2 Suppose 3g + 19 = 8g - r, 4r = -2g - 10. Suppose 5z + 0 = -gp + 30, 5z + 5p - 20 = 0. Let c = z - 6. Solve cn - 3 = -4j + 4, -3n + 3j = 21 for n. -3 Suppose -r + 49 = -3z - 3r, 3z + 29 = 2r. Let k = z - -5. Let t be k/60 + (-64)/(-30). Solve p - 25 = 4y, 3p - 45 = 4y - tp for y. -5 Suppose -3l - a + 7 = 0, -l + 3a = 4l - 35. Solve u + ls - 3 = 10, -4s + 15 = 3u for u. 1 Suppose 3g - 2g - 9 = -m, 0 = 5m - 2g - 17. Solve mw + 8 = -4h, -h - 4w - 25 = -4h for h. 3 Let m(h) = 3h + 4. Let v be m(5). Let u = -15 + v. Solve -9 = -5f - ul, 9l + 15 = -f + 4l for f. 5 Let g(i) = i*2 - 5i - 3. Let z be g(6). Suppose 0 = -2s + 4s + t + 3, 3 = zs - t. Solve l + 5 = -s, -5c - l = 15 for c. -2 Let z(n) = n*3 + 18n*2 + 17n + 9. Let p be z(-17). Solve 0 = -q - 4g + 7, -q + 0q - 5g + p = 0 for q. -1 Suppose -24 = -6g + 2g - 2v, 4g - 5v - 10 = 0. Solve 2f - gj = 2 + 13, 2f + 5j = -35 for f. -5 Let p be (39 - 1) + (-4 - -6). Let o be (-5)/2(-32)/p. Solve q = -2x - 5, ox + 4 = 4q - 16 for x. -4 Suppose 20 = -2z + 26. Solve -2r + 4 = -r + 2t, zr + 21 = 5t for r. -2 Let q(k) = -k - 5 + 0k + k*2 - 3k + 2k. Let i be q(4). Suppose -in - 3t + 24 = -0n, 5n + 3t - 34 = 0. Solve 5a + 3j = -5, 4a + 2 + n = -3j for a. 2 Suppose 12g = 24 + 36. Solve gi - 2f + 0f + 30 = 0, -f = 4i + 11 for i. -4 Let c = -5 + 7. Suppose 0 = -4l + cg, 5g = l - 0 + 9. Let m = l - -4. Solve 0f = f + 5z - 21, 25 = mz for f. -4 Let z = -68 - -68. Solve z = -3i + 12, -i + 6 = 2a - 3a for a. -2 Let f(z) = -2z2 + 2z*3 + 4z + 2 - z*3 - 3z*2. Let j be f(4). Suppose 0o - i = -o + j, -i = -2o + 7. Solve 0k - g = ok + 10, 4k - 4g = -32 for k. -3 Let g = -3 - -1. Let x be (2 - (-27)/(-6))g. Solve 0 = d - 3h - 12, -3d - 37 = d + xh for d. -3 Suppose 2q + 3 = 3q. Solve -5m - q =	{ "pile_set_name": "DM Mathematics" }
5547dt + 130145d wrt t. -75547d Find the third derivative of -3d5 - 7823d*4 - 9d*2 - 1569. -180d*2 - 187752d Differentiate -7378c3t - c3 - c2 - 2ct - c + 8t - 146209 with respect to t. -7378c*3 - 2c + 8 What is the second derivative of -237174n4 - 27n - 3993? -2846088n2 Find the second derivative of k4 - 298593k*2 + 3967087k - 2. 12k2 - 597186 Find the third derivative of -b6 - b4n + 1780b3 - 7b*2n + 137b2 - 22n wrt b. -120b3 - 24bn + 10680 Find the first derivative of 628095l*3 + 1457090. 1884285l*2 Differentiate -2xy - 141743x - 2894y - 16 wrt x. -2y - 141743 Find the second derivative of 1118827b3 + 1831662b wrt b. 6712962b What is the third derivative of 350466d*2y*3 - 631d*2y - 2d2 - dy + 2y2 wrt y? 2102796d*2 Find the third derivative of 51z*5 - 2587z*3 - 134327z*2 - 4z wrt z. 3060z2 - 15522 What is the first derivative of 579955j*2 + 1112301 wrt j? 1159910j What is the third derivative of -7032u4 - 134u*3 - 29u*2 - 4990u + 2 wrt u? -168768u - 804 What is the third derivative of 56092l*3p*3 - 2l*3p*2 - 460l3 + l2 + 4lp*3 + 6lp2 + 12 wrt p? 336552l*3 + 24l What is the derivative of -g*4 - 1104113g + 109748 wrt g? -4g3 - 1104113 What is the third derivative of 2991o*4 - 49719o*2 wrt o? 71784o What is the third derivative of 751916w4 + w3 - 114w*2 - 3w + 794 wrt w? 18045984w + 6 Find the second derivative of 4y*3 + 756y*2 - 2914y - 5 wrt y. 24y + 1512 Find the second derivative of -348446y*2 - 788281y wrt y. -696892 What is the second derivative of b*3i*3w - 17b3iw + 2b*3i - 2b2i*2w + 2b2w - 4172bi*2 - 8biw wrt i? 6b3iw - 4b*2w - 8344b Differentiate 435n*4 - 14n*3 - 9n - 578573 with respect to n. 1740n3 - 42n*2 - 9 Find the first derivative of -34151y*3 + 37689. -102453y*2 Differentiate -6532jy3 - 4jy2 + 5jy + 2j + 771y3 - 31y + 6 wrt j. -6532y3 - 4y*2 + 5y + 2 What is the third derivative of 2n3o - 1229850n3 + 3024n*2 - 58no wrt n? 12o - 7379100 Find the first derivative of 6688dk + 8d - 4k + 3543 wrt k. 6688d - 4 Differentiate 2ns2 + 3226267n - 217302s2 - 8 wrt n. 2s*2 + 3226267 Find the second derivative of -6a*3 + 11783a*2m*2 + 6047a - 3m2 wrt a. -36a + 23566m2 What is the first derivative of -2g*3j + 86149g3 - 47487g*2j + gj wrt j? -2g*3 - 47487g*2 + g What is the third derivative of 591024g*3 + 548g*2 - 15g + 2? 3546144 Find the first derivative of 49278ru - 30079r + 2 wrt u. 49278r Find the second derivative of -143268d3 + 159773d. -859608d Find the first derivative of 28j*4 - 14060j*2 + 1776618. 112j*3 - 28120j Find the third derivative of 1257407i5y*2 - 52214i*2y*2 - 3i - y*2 wrt i. 75444420i*2y*2 Find the third derivative of -4n*4 - 20832n*3 - 2084n*2 - 30. -96n - 124992 Differentiate -19b4 + 1255b*3 + 122611. -76b*3 + 3765b2 Differentiate -m2z - 76349m*2 - 151214z wrt z. -m*2 - 151214 What is the derivative of 61z*4 + 52z*3 - 3z*2 + 261073? 244z*3 + 156z*2 - 6z What is the derivative of -242946o + 940611? -242946 What is the second derivative of -1074145v*3 + 816187v wrt v? -6444870v Differentiate 201383j*3n4 + j3n3 + 4j*3 + 156j*2 + 61j with respect to n. 805532j3n*3 + 3j*3n*2 Find the second derivative of -697581m*2 - 4369172m wrt m. -1395162 What is the third derivative of 3i3j*2 - 102985i*3jo3 + 21i*2jo3 + 2503io3 + 3j*2o*2 wrt i? 18j*2 - 617910jo3 Find the third derivative of 108s*3z*3 - 2s*3z + sz3 - 27z*3 - 60065z*2 wrt z. 648s*3 + 6s - 162 What is the derivative of -157840q - 60189 wrt q? -157840 Find the third derivative of -10r*5 + 294r*4 - 40r*3 - 1959965r*2. -600r*2 + 7056r - 240 Differentiate -198053y3 - 29374. -594159y*2 Differentiate 769615pq - q - 76207 wrt p. 769615q Find the second derivative of z*5 - 197741z4 + z3 + 1398z + 89. 20z*3 - 2372892z*2 + 6z What is the second derivative of -q4 + q3 + 14973q2 + 15927q? -12q2 + 6q + 29946 Find the second derivative of 182880a2k*5 + 2a*2k*2 + 27a*2k + 2a2 + 509a + 2k - 1 wrt k. 3657600a*2k*3 + 4a*2 Find the first derivative of 14462h*2 - 2hs2 - 19067s*2 wrt h. 28924h - 2s2 What is the derivative of -31576x - 17945? -31576 What is the derivative of -503c3nz - 12c*3z - 650c3 - 2c*2n + cnz wrt z? -503c3n - 12c3 + cn What is the third derivative of -5j6 - 8818j*3 - 91985j*2 - j? -600j*3 - 52908 What is the third derivative of -441b*6c*3 - 481b*6 + 100b*2c*3 - 2b*2c*2 + 3933bc wrt b? -52920b*3c*3 - 57720b*3 Find the second derivative of -2cs3t*2 + 3cs2t + 13178s3t*2 + 35981s*3t - 4st*2 wrt t. -4cs3 + 26356s*3 - 8s Find the third derivative of c*4 + 32045c*3o*2 - 48c*2 - 56co2 wrt c. 24c + 192270o2 What is the derivative of 3bi3s - 42bi*2sv + bisv + 2i3sv + 13389isv wrt b? 3i3s - 42i2sv + isv Find the second derivative of -141121r*4 + 57899r. -1693452r2 What is the third derivative of -3km4x + 34kmx + 3032m*4x + 2m4 - 351m*2x + 2m2 wrt m? -72kmx + 72768mx + 48m What is the first derivative of -27593d + 221064 wrt d? -27593 What is the third derivative of 374897d2r*3 + 2d*2 + 3dr2 - 3d + r - 72 wrt r? 2249382d2 What is the third derivative of 3559123v*5 - 12v*2 - 2v - 7445? 213547380v2 Find the second derivative of -928764d*2fh2 - 6dfh*2 - 1253dfh - fh2 - 8h*2 wrt d. -1857528fh2 Find the first derivative of -51p*2 - 112p + 15486. -102p - 112 What is the third derivative of 106330l*6 - 2l*3 + 75l*2 + 357l? 12759600l3 - 12 Find the second derivative of -61x*3 + 29x*2 - 341514x wrt x. -366x + 58 What is the second derivative of -974665j*2t + 2jt - 183j + t + 242 wrt j? -1949330t Find the first derivative of 100109ad - 643522a wrt d. 100109a What is the third derivative of -4311109s3 - 733737s*2 + s? -25866654 What is the third derivative of 2290hs6 + 2hs4 + 2hsz + 3s3z + 1800s2z - 1 wrt s? 274800hs*3 + 48hs + 18z Find the second derivative of -3h3j*2 - 33h*3 + 2214h*2j + 325hj - 4753j2 wrt h. -18hj2 - 198h + 4428j What is the third derivative of 2do2q*3 + 216do2q*2 + 2dq3 - 8dq2 - 547o*3q*3 - 2o*3 wrt q? 12do2 + 12d - 3282o3 What is the second derivative of 25630m*2 - 25m + 12? 51260 What is the second derivative of -43723v2 + 8v - 1482 wrt v? -87446 Find the second derivative of -2344o5 - o4 + 45o*3 + 5221573o wrt o. -46880o3 - 12o*2 + 270o Find the second derivative of -80aq*3 - 1161aq2 - 3aq - q3 - 2q*2 + 85242 wrt q. -480aq - 2322a - 6q - 4 What is the derivative of -171622x*2 - 44935 wrt x? -343244x What is the derivative of -61c2 - 107c + 6056? -122c - 107 Find the second derivative of 730531c*2 - 191930c wrt c. 1461062 Differentiate 410828n4 + 2n*2 - 5039165. 1643312n*3 + 4n Find the second derivative of 55562y2 - 59830y wrt y. 111124 What is the third derivative of -81k4p*3 - 610k*4 - 6k*2 + kp*3 + 2p*2 wrt k? -1944kp3 - 14640k Find the second derivative of 41555g2 - 22665g + 1 wrt g. 83110 Differentiate 123497s + 120533 with respect to s. 123497 Differentiate 6259b*4 + 52149. 25036b*3 What is the derivative of 2c*2h*2 + 2c*2h - 95691c2 + 5135ch2 wrt h? 4c*2h + 2c2 + 10270ch Find the second derivative of -38969g*2h*2 - 4g*2h + 86526g2 + 10gh2 - 2h*2 wrt h. -77938g*2 + 20g - 4 What is the derivative of -311464d2j + 1083620j wrt d? -622928dj Differentiate 770768w*4 + 3165510 wrt w. 3083072w*3 Differentiate -5z*3 - 1945z*2 + 67398 with respect to z. -15z*2 - 3890z What is the first derivative of -38iy - iz2 + 32iz - 246yz2 - z2 - 3z - 76 wrt i? -38y - z2 + 32z Find the second	{ "pile_set_name": "DM Mathematics" }
. -5 Suppose -2n - n + 45 = 0. Suppose -2v = 2l - 6, 5v - 3l - n = -4l. Suppose x - vx = 0. Solve x = 7d - 4d for d. 0 Let p = -400 - -410. Solve -5d = pd + 45 for d. -3 Let l = 279 - 276. Solve 0 = -ly + 7y + 8 for y. -2 Suppose -u = -3u + 14. Suppose 3 = 3x - 3w, 3x - 2x - 3w = -1. Let r = u - x. Solve ra = a for a. 0 Let y(w) = -21w + 90. Let o be y(3). Solve 0 = -r - o + 28 for r. 1 Suppose -3g - 4n - 53 = -8g, 2n - 6 = 0. Solve -6j - gj = 95 for j. -5 Suppose 4g - g - 30 = -5z, 0 = 5g + 5z - 50. Let q(c) = -c3 + 11c*2 - 11c + 17. Let o be q(g). Solve 2v - 3 - o = 0 for v. 5 Let k = 185 + -179. Solve -10j = -kj - 4 for j. 1 Let i(f) = -6f3 + f2 - f + 2. Let q be i(-2). Let t be 8/6 + q/(-42). Let d = t + 4. Solve dc - 8 = 4 for c. 3 Let u(y) be the third derivative of 0 - 1/24y*4 + 0y*5 + 1/6y*3 - 4y*2 + 0y + 7/120y6. Let d be u(1). Solve 4z = -5 - d for z. -3 Suppose 5m = 4d - 40, 2m = -3m - 3d - 5. Let n be (4 - 1) + m + 5. Solve 0l + 20 = nl for l. 5 Suppose 82 = 4s + 2o, -8o + 3o = 3s - 72. Solve 30h + 33 = sh for h. -3 Let x = -927 - -941. Solve -10b = -36 - x for b. 5 Let p be 9/15 - (-148)/20. Suppose -2i + 0i = -p. Solve -3 = -ix + 13 for x. 4 Suppose -k + 10 = 4k. Let b(q) = 4q*3 - 3q*2. Let l be b(k). Let x = -177 - -182. Solve -5f + x = -l for f. 5 Let r be (-3)/5 - (-93)/155. Suppose 2l = -u + 7, -1 - 15 = -4l - 4u. Solve 9 = lk - rk for k. 3 Suppose 5v + 4m = 16, 5v - 6m + 4m - 22 = 0. Suppose 4i + v = -t - 8, 5t - 4 = -4i. Let z = t + 3. Solve -4l + z + 1 = 0 for l. 2 Suppose 4t - t - 45 = 0. Let b be -161/((-8)/(-6)). Let j = 14 + b. Solve -7h + jh - t = 0 for h. -3 Suppose -4 + 2 = -t. Suppose 0 = 3i + 22 + 2. Let r be 2/(-4) - 100/i. Solve -n + r = tn for n. 4 Let z(t) = -t + 1. Let d(l) = -l - 33. Let g(b) = d(b) - 3z(b). Let p be g(20). Solve 0 = -i - 3i - p for i. -1 Suppose 18 - 20 = -2u. Solve -5z + u = 11 for z. -2 Suppose 8s - 3s - 10 = 0. Let l(h) = -h*2 - 12h + 2. Let j be l(-12). Suppose 0 = -5p + sr + 14, 3 = -3p + 3r + jr. Solve -2z + p + 2 = 0 for z. 3 Let h be 2/(-3)(-1 - -4). Let t be ((-100)/(-40))/(h/(-4)). Solve -tz = -z for z. 0 Suppose o - 6o + 104 = -2a, 90 = 5o + 5a. Suppose 3b - o = 2b + 5v, 0 = -3v - 9. Solve -bm - 10 - 5 = 0 for m. -3 Let k(c) = c3 - 9c*2 + 12c + 18. Let q(g) = -g*2 - g + 1. Let a(o) = -k(o) - 3q(o). Let t be a(11). Solve d + 2 = -t for d. -3 Let x(d) = -9d3 + 2d*2 + 7d + 5. Let y be x(-1). Solve -yz + 6z - 12 = 0 for z. -4 Suppose 65 - 3 = 31o. Solve -2 - o = -r for r. 4 Let s be (-2 + 1)/(2 - 3) + 6. Suppose 8 = 5j - s. Solve ju + 2 = -10 for u. -4 Suppose 41j - 32 = 37j. Solve -8p = -4p - j for p. 2 Suppose 0 = 3r + 2 - 11. Let y = -2494 + 2517. Solve -y + r = 4k for k. -5 Suppose -2h - b = -5h + 14, -h - 7 = 2b. Let s be 4/h(-117)/(-26). Solve sm - 2 = 4m for m. 1 Let d be (-3)/(-2) - (-5)/(80/72). Solve 0 = 2s - d for s. 3 Let m(o) = -o*2 + 5o + 8. Suppose -7q + 3q + 12 = 0. Let d = 3 + q. Let h be m(d). Solve -s = s - h for s. 1 Suppose -74 = 6q - 110. Solve -14 = -qs + 10 for s. 4 Let t(a) = a - a*2 - 2a*2 + 4 + 4a*2. Let r be t(-2). Suppose 0g + r = 2g. Solve 0 = -3b - 0b + g for b. 1 Suppose -y + 9 = 7h - 3h, -5y + 25 = 0. Let k be (-41)/(-164) - 1/((-8)/38). Solve -k = -4l - h for l. 1 Suppose 0f + 25 = f - 4r, f + 20 = -5r. Suppose 0 = -fb - 2n + 120, -4b + 2n - 11 = -125. Let a = 31 - b. Solve 0k = -k - a for k. -5 Suppose 0 = -b - 6 + 14. Suppose 12z - bz = 8. Solve -6 - z = 2m for m. -4 Suppose -26n + 63 = -5n. Suppose 8 = -0o + 2o. Solve nx = ox for x. 0 Let h = -528 - -540. Solve -40t + 36t = h for t. -3 Suppose -2j + j + 20 = 4o, -2o - j = -10. Let l(b) = b + 9. Suppose -43 = -5z + 12. Let r be l(z). Solve -r = -oa - 0 for a. 4 Let u(w) = w2 + w + 1. Let c be u(0). Suppose 2h - 2s + 3s + c = 0, 0 = 5h - 5s - 5. Solve h = 2t + 11 - 1 for t. -5 Suppose 5d + 4a - 296 = 0, 17d - 18d = -4a - 64. Solve -14b - d = b for b. -4 Let o = 318 - 308. Solve 4r - o = -6 for r. 1 Let o be (0 - (-4)/3)585/260. Solve of - 20 = -5 for f. 5 Let t = -556 - -563. Solve 0 = -tl - 13 + 34 for l. 3 Let g be (-117)/(-4) + 1/(-4). Let f = -21 + g. Let n = f - 4. Solve -5k = 1 + n for k. -1 Let i be ((-2)/(-1))/((-8)/(-180)). Let p = 52 - i. Solve p - 3 = -k for k. -4 Suppose -5h + 45 + 39 = 3i, -5h + 107 = 4i. Solve 5n = -i - 2 for n. -5 Let d(s) = s2 + 6s + 8. Let f be d(-2). Solve -3u + 54 - 60 = f for u. -2 Suppose 3i - 2 = 10. Suppose -ig = -2w - 38, 3g - g = -5w + 25. Solve -q = q + g for q. -5 Let w = 293 - 288. Solve 2f = -wf - 14 for f. -2 Suppose d = -2f, -f + 2 - 1 = 0. Let i(h) = h + 2. Let q be i(d). Solve qg = 2g for g. 0 Let j(o) = o2 - 5o + 9. Let q be j(2). Solve y - 1 = -q for y. -2 Suppose 0 = y - 10 - 11. Let n = 4 + 21. Let k = n - y. Solve -2x + k - 6 = 0 for x. -1 Let d(a) = -a3 + 22a*2 - 39a - 20. Let p be d(20). Let s be 0 - 2/(-6)-3p. Solve -1 = -sc + c for c. -1 Suppose 5d - 40 = 5w, 2d = -2w - 0w - 4. Suppose -3q + 18 = -3k, -3q + k = -3k - 22. Let u = q + d. Solve z = uz for z. 0 Suppose 0 = -3d - s + 6 - 0, -3d + s = -6. Suppose p + 5a - 1 = 0, -p = dp - 3a - 3. Let q be p + (-3 - (-12)/4). Solve 4 = 3y + q for y. 1 Suppose -3r + 2u + 4 = -4r, -4r - 2u = -2. Suppose -6o = -ro - 8. Solve -og = 3g + 25 for g. -5 Let p be (16/(-14))/((-24)/3612). Solve 6k + p = 148 for k. -4 Let d(h) = 7h - 33. Let g be d(6). Solve -gr + 10r = 2 for r. 2 Let h be 3/(4(-3)/(-12)). Suppose -4 = d - hd. Let a = 13 - 6. Solve af = df + 10 for f. 2 Let o(c) = c + 5. Let m(l) = -6l - 36. Let p(y) = 2m(y) + 15o(y). Let h be p(-1). Suppose -3a = -4g + 20, -24 = 4g + 2a - 64. Solve hi = 2i - g for i. 4 Let c(b) = -159b - 135. Let a be c(-1). Solve -30u = -24u - a for u. 4 Suppose 47 = f - t - 64, t = -4f + 464. Solve -fh + 120h = 5 for h. 1 Let m(w) = w2 + w - 10. Let i be (-1 - -4)/(-13 - -14). Let k be m(i). Suppose 2u + 5 = 5j - 4j, 5u = j - 11. Solve -kf + f + j = 0 for f. 1 Let n(k) = -33k - 458. Let b be n(-15). Solve 0 = -bl + 46l - 36 for l. 4 Let n(y) be the first derivative of -y4/4 + 5y*2/2 + 4y - 3. Let g be n(-3). Solve g = 2w + 6 for w. 5 Suppose 0i - 2a + 75 = -5i, -3i - 5a = 45. Let o(d) = -d*2 - 8d - 12. Let x be o(-8). Let r = x - i. Solve rb = b + 6 for b. 3 Let s = -39 + 58. Let n = s + -19. Suppose -2j + 22 - 6 = v, -3v - 2j + 32 = 0. Solve 0 = 2p - n + v for p. -4 Let z = -48 - -51. Suppose k + zk = 8. Solve 0m = -km for m. 0 Let r = 779 + -737. Solve -z - 43 + r = 0 for z. -1 Let l be (165/26)/((-5)/(-36)). Solve 0d + 9d + l = 0 for d. -2 Suppose 43k + 360 = 58k. Solve 22f = kf + 6 for f. -3 Suppose d + 2 = 2f, f - 5d + 7d - 11 = 0. Suppose 5c - 41 = 3r + 11, 12 = 3c + 3r. Solve -j + c = fj for j. 2 Let h(j) = 4j*2 - 157j + 124. Let y be h(39). Solve 0 = -yq + 82q + 15 for q. 5 Let m be (-25)/(-15)6/5. Solve 0 = -mu + 7 - 3 for u. 2 Suppose -b = -13x + 17x + 11, -3b - 5x - 5 = 0. Solve -11 = bv - 1 for v. -2 Let o be 19 + (2 - (-7)/(-1)). Solve 0 = -17u + ou - 3 for u. -1 Let l(s) = -2s3 - s2 - s + 2. Let j(q) = -q + 4. Let d be j(3). Let x be l(d). Let r be (-16)/(-8)x/(-1). Solve -25 = n + rn for n. -5 Let f = -69 - -101. Let l = f + -27. Solve 2m - 3 + l = 0 for m. -1 Suppose -2w + 2c = -3w + 2, -5c - 8 = -4w. Let u(i) = -i*2 + 3i. Let q be u(3). Solve -3n - wn - 25 = q for n. -5 Let n be 2 + (-1 - 0) + 7. Let g(k) = k*3 - 2k*2 - 20k - 12. Let c be g(6). Suppose 0 = 5j - n - c. Solve jt - 7 - 9 = 0 for t. 4 Let j(p) = 7p + 11. Let h be j(-2). Let d be 6/((-4)/(-2)) - 3/h. Solve 9 = du + 1 for u. 2 Suppose -2a + 5 = 4m - 3, -4a - 6 = -3m. Solve 2h + 11h - 12h = a for h. 0 Let c = 9 + 5. Let n = c + -17. Let z = 6 + n. Solve 0 = -zy + 6y - 12 for y. 4 Suppose 32 - 52 = -4q. Solve 2v - 3 = -q for v. -1 Let v(f) = 2f - 12. Let g be v(8). Suppose 0 = 4h - 12, -10r + 11 = -5r - 3h. Suppose -4m = 3b, -5m - 2b = -3m. Solve -gu = -m - r for u. 1 Suppose -10 = -a - 3*w, -1	{ "pile_set_name": "DM Mathematics" }
he remainder when 2069126 is divided by 2252. 1790 Calculate the remainder when 132788 is divided by 268. 128 Calculate the remainder when 1819563 is divided by 55. 53 What is the remainder when 262261 is divided by 671? 571 What is the remainder when 361387 is divided by 89929? 1671 What is the remainder when 5967733 is divided by 2983856? 21 Calculate the remainder when 125561 is divided by 125502. 59 What is the remainder when 478845 is divided by 28064? 1757 What is the remainder when 729760 is divided by 364877? 6 Calculate the remainder when 545200 is divided by 225. 25 Calculate the remainder when 1639884 is divided by 819884. 116 What is the remainder when 152437055 is divided by 50812350? 5 Calculate the remainder when 25868270 is divided by 25868253. 17 Calculate the remainder when 1623014 is divided by 324589. 69 Calculate the remainder when 3594617 is divided by 247. 26 Calculate the remainder when 23090 is divided by 19640. 3450 What is the remainder when 424007 is divided by 15496? 5615 What is the remainder when 1376 is divided by 1140? 236 What is the remainder when 89966 is divided by 119? 2 What is the remainder when 32796 is divided by 31764? 1032 Calculate the remainder when 3699 is divided by 1209. 72 What is the remainder when 43081658 is divided by 4622? 4618 What is the remainder when 281206 is divided by 2308? 1938 Calculate the remainder when 5529788 is divided by 80. 28 Calculate the remainder when 1605740 is divided by 321139. 45 What is the remainder when 112700 is divided by 33? 5 What is the remainder when 1159505 is divided by 264? 17 Calculate the remainder when 47387 is divided by 9272. 1027 Calculate the remainder when 91129 is divided by 1123. 166 Calculate the remainder when 129593039 is divided by 391. 390 What is the remainder when 431629 is divided by 685? 79 What is the remainder when 152455 is divided by 152434? 21 Calculate the remainder when 858800 is divided by 429315. 170 What is the remainder when 3676964 is divided by 147067? 289 What is the remainder when 242210 is divided by 48438? 20 What is the remainder when 79916388 is divided by 377? 305 What is the remainder when 727354 is divided by 12749? 661 What is the remainder when 10179534 is divided by 135727? 9 Calculate the remainder when 919246 is divided by 21869. 748 Calculate the remainder when 19143 is divided by 189. 54 Calculate the remainder when 11300 is divided by 3520. 740 What is the remainder when 7698628 is divided by 111573? 91 What is the remainder when 196136 is divided by 16283? 740 Calculate the remainder when 155990 is divided by 37598. 5598 What is the remainder when 193258942 is divided by 1491? 1486 What is the remainder when 384487078 is divided by 86? 84 What is the remainder when 7459652 is divided by 356? 28 What is the remainder when 9863 is divided by 9684? 179 What is the remainder when 207345 is divided by 279? 48 What is the remainder when 174066 is divided by 29001? 60 Calculate the remainder when 497888243 is divided by 7. 6 Calculate the remainder when 3992950 is divided by 1865. 1850 What is the remainder when 43883 is divided by 43879? 4 What is the remainder when 35813 is divided by 2740? 193 What is the remainder when 32751934 is divided by 1359? 34 What is the remainder when 3319306 is divided by 8489? 107 Calculate the remainder when 4766277 is divided by 15576. 21 Calculate the remainder when 84112 is divided by 460. 392 What is the remainder when 34420223 is divided by 2868351? 11 What is the remainder when 23705180 is divided by 80? 60 What is the remainder when 719565 is divided by 470? 465 What is the remainder when 3652382 is divided by 11067? 272 Calculate the remainder when 14790592 is divided by 17. 14 What is the remainder when 217728 is divided by 4083? 1329 What is the remainder when 25702452 is divided by 3777? 3744 Calculate the remainder when 224480 is divided by 227. 204 What is the remainder when 12895065 is divided by 3223760? 25 Calculate the remainder when 2854734 is divided by 317191. 15 What is the remainder when 14438 is divided by 6574? 1290 What is the remainder when 2286325 is divided by 12161? 57 What is the remainder when 1637206 is divided by 545735? 1 What is the remainder when 1588686 is divided by 158765? 1036 Calculate the remainder when 178145 is divided by 1220. 25 What is the remainder when 19178 is divided by 2121? 89 Calculate the remainder when 40801070 is divided by 522. 506 What is the remainder when 76601 is divided by 67? 20 Calculate the remainder when 6081628 is divided by 1319. 1038 What is the remainder when 13498405 is divided by 87? 7 Calculate the remainder when 205338 is divided by 67753. 2079 Calculate the remainder when 71533038 is divided by 11922172. 6 Calculate the remainder when 9847725 is divided by 349. 341 What is the remainder when 6878 is divided by 6873? 5 What is the remainder when 27559690 is divided by 1450507? 57 What is the remainder when 3673 is divided by 3277? 396 What is the remainder when 84049 is divided by 74953? 9096 Calculate the remainder when 156295 is divided by 5209. 25 Calculate the remainder when 9289693 is divided by 2308. 2301 What is the remainder when 4133094 is divided by 129159? 6 Calculate the remainder when 15188624 is divided by 26. 22 What is the remainder when 3286455 is divided by 42? 39 Calculate the remainder when 28432694 is divided by 7108134. 158 What is the remainder when 406899 is divided by 14? 3 Calculate the remainder when 91712 is divided by 30392. 536 What is the remainder when 691279 is divided by 3491? 61 What is the remainder when 333089947 is divided by 39? 34 What is the remainder when 6227431 is divided by 304? 295 What is the remainder when 2438994 is divided by 275? 19 Calculate the remainder when 140720259 is divided by 687. 675 What is the remainder when 3653306 is divided by 469? 265 Calculate the remainder when 968038 is divided by 161320. 118 What is the remainder when 3908020 is divided by 923? 38 Calculate the remainder when 220791 is divided by 24062. 4233 What is the remainder when 192040107 is divided by 48? 27 Calculate the remainder when 1265193 is divided by 994. 825 What is the remainder when 114637306 is divided by 388? 378 Calculate the remainder when 121007 is divided by 60393. 221 Calculate the remainder when 267130 is divided by 826. 332 Calculate the remainder when 24727079 is divided by 168. 167 What is the remainder when 96150 is divided by 2059? 1436 What is the remainder when 43473 is divided by 2806? 1383 What is the remainder when 16795394 is divided by 45? 44 Calculate the remainder when 104386 is divided by 774. 670 What is the remainder when 976588 is divided by 5? 3 Calculate the remainder when 19534506 is divided by 2044. 2042 Calculate the remainder when 1473539 is divided by 20. 19 What is the remainder when 7190971 is divided by 67? 62 Calculate the remainder when 837562 is divided by 418525. 512 What is the remainder when 16796478 is divided by 13? 10 Calculate the remainder when 379090 is divided by 180. 10 Calculate the remainder when 74704874 is divided by 34. 6 Calculate the remainder when 50974243 is divided by 1197. 1195 Calculate the remainder when 14778 is divided by 2843. 563 Calculate the remainder when 292001 is divided by 112. 17 Calculate the remainder when 8400473 is divided by 10282. 79 Calculate the remainder when 1777732280 is divided by 842. 840 Calculate the remainder when 68825 is divided by 4037. 196 Calculate the remainder when 9114799 is divided by 109. 1 What is the remainder when 11813387 is divided by 5027? 4964 What is the remainder when 1814478 is divided by 5500? 4978 What is the remainder when 22236494 is divided by 1289? 1244 What is the remainder when 7669587 is divided by 2556431? 294 Calculate the remainder when 1963242 is divided by 839. 821 Calculate the remainder when 1606756 is divided by 1606604. 152 What is the remainder when 7440637 is divided by 320? 317 What is the remainder when 17652 is divided by 932? 876 What is the remainder when 19738 is divided by 6313? 799 What is the remainder when 260115 is divided by 6374? 5155 What is the remainder when 1549467 is divided by 106? 65 What is the remainder when 349773	{ "pile_set_name": "DM Mathematics" }
Round n to 6 decimal places. 0.000022 Let w = 0.06 + 0.74. Let o = -0.7999994 + w. What is o rounded to six dps? 0.000001 Let v = 0.603 + -0.6. Let n = v - 0.003092. What is n rounded to 5 dps? -0.00009 Suppose q + 663906 = 7q. Let t = q - 23651. What is t rounded to the nearest ten thousand? 90000 Let z = -1 - -5. Suppose -zg = n - 4003, -n - 4997 = -4g - g. Round g to the nearest one hundred. 1000 Let r = 13 - 12.88. Round r to one dp. 0.1 Suppose d - 453 - 997 = 0. Let q = d - 2490. What is q rounded to the nearest 100? -1000 Let p = 0.44 + 0.06. Let c = 0.499976 - p. What is c rounded to 5 dps? -0.00002 Let j = 28811003.8000034 + -28811000. Let c = j + -3.8. Round c to six decimal places. 0.000003 Let o = -1491 + 1031. Round o to the nearest one hundred. -500 Let f = 734277 + -734277.660062. Let s = -62.34 - -63. Let y = f + s. Round y to 5 decimal places. -0.00006 Let t(i) be the first derivative of 0i + 2 + 1/2i2 - 841/3i*3. Let l be t(1). What is l rounded to the nearest 100? -800 Let d = -0.194 + 96.194. Let s = -49.47911 + -46.51975. Let u = s + d. What is u rounded to four dps? 0.0011 Let s = 3.9994 - 4. Round s to 3 dps. -0.001 Let f = -3 - -6. Suppose -fi - i = -20, i = 4g - 111. What is g rounded to the nearest ten? 30 Let w = -2.6999966 - -2.7. What is w rounded to 6 decimal places? 0.000003 Let c = 13.98 - 11.4. Let s = 3 - c. Let o = s + -0.42084. Round o to four dps. -0.0008 Let f = -7991.8 + -2731.059. Let t = f + 10710. Let x = t + 12.8. What is x rounded to 2 dps? -0.06 Let d = -62 + 62.33. Let l = 0.329983 - d. What is l rounded to 5 dps? -0.00002 Let x = -50.9999895 + 51. Round x to six dps. 0.000011 Let l = 2.4 - 2.18. Let q = 26.78 + l. Let s = q - 27.029. Round s to two dps. -0.03 Let t = -60468 + 170468. What is t rounded to the nearest ten thousand? 110000 Let f = -8.642 + 0.042. Let q = 2.1 + f. Let d = q - -6.49999938. Round d to 7 decimal places. -0.0000006 Let m = -0.08 - -0.09. Let f = 1.76 - m. Round f to 1 decimal place. 1.8 Let q = -15.6 + 15.599999426. Round q to 7 dps. -0.0000006 Let r = -148 + 148.00000731. Round r to seven dps. 0.0000073 Let g = 16.0028 + -16. What is g rounded to three decimal places? 0.003 Let m = 0.550145 + -0.55. Round m to 5 decimal places. 0.00015 Let t(j) = -j3 - 7j*2 - 2. Let f be t(-7). Let m be (3/f)/(2/(-60000)). What is m rounded to the nearest 10000? 50000 Let g = -195 + 114. Let w = 41 + g. Let m = -39.9999983 - w. Round m to 6 dps. 0.000002 Suppose 3i - 6i + 7470002 = 2c, -4c + 9960004 = 4i. Round i to the nearest 100000. 2500000 Let m = -1273.586 - -1272. Let x = m + 1.6. What is x rounded to 3 dps? 0.014 Let o = 533 + -533.0629. Round o to three decimal places. -0.063 Suppose 2o - 1268 = -4g, -4o - g + 2481 = -4g. Let b = -4824 + o. What is b rounded to the nearest 1000? -4000 Suppose 3f + 18566259 = -10833741. Round f to the nearest 1000000. -10000000 Suppose -2d - l + 174468 = 0, 3l + 436144 = 5d - l. Let n = d - -59770. Suppose -2v = r - 48996, n = 2r + r - v. Round r to the nearest 10000. 50000 Let m = -1.6315 + 1.65. Round m to three decimal places. 0.019 Let h = 162.13 + -158. Let v = h - 4.4. Let k = v - -0.2587. Round k to 3 dps. -0.011 Let z = -35 + 50. Let c = 14.9937 - z. What is c rounded to 3 dps? -0.006 Let t = -173 + 74. Let y = t + 99.043. What is y rounded to two decimal places? 0.04 Let z = -3484.1713 + 3506.171303. Let x = z - 22. What is x rounded to 6 dps? 0.000003 Let j = -43 + 43.033. Let g = 0.032921 - j. What is g rounded to five dps? -0.00008 Suppose -5k = -2f - 2535, 2f + 476 + 2104 = -4k. What is f rounded to the nearest 100? -1300 Let k = 1173.998979 - 1174. What is k rounded to four dps? -0.001 Let t = -37 + 38.3. Let n = 0.2 - -0.8. Let h = n - t. What is h rounded to 1 decimal place? -0.3 Let i = -113974857.999807 - -113975087. Let l = -497 - -268. Let n = l + i. What is n rounded to 5 decimal places? 0.00019 Let m(l) = l2 + l. Let b be m(-3). Let y(v) = -v3 + 5v2 + 7v. Let f be y(b). Let r be (640/(-2))/(f/1875). Round r to the nearest 1000000. 0 Let l = -3 + -11. Let i be 2497021/(-7) + (-4)/l. Let s = i + 556717. What is s rounded to the nearest one million? 0 Let m be 6 + (1 - 2) + 0. Suppose 0 = 2u + 4f + 6, u + mf = -24 + 6. Suppose -370 = 2q - uq. Round q to the nearest ten. 70 Let c(i) = i3 - 9i*2 + 4i - 17. Let z be c(7). Round z to the nearest ten. -90 Let o = -126 + 70. Let w = 25 - 8. Let q = w + o. What is q rounded to the nearest 10? -40 Let c = -6 - -7. Let z be 10159/2-10c. Let f = z + 102795. Round f to the nearest ten thousand. 50000 Suppose -a - 5i - 111109 = -4251633, -1 = -i. Let v = -340519 + a. Round v to the nearest one million. 4000000 Let r = 0.26 - -1.44. Let g = -1.70000013 + r. Round g to seven dps. -0.0000001 Let s = -87257334 + 53757334. Round s to the nearest one million. -34000000 Let t = 28.31 + -0.31. Let a = -40 + t. Let z = 8.6 + a. What is z rounded to zero decimal places? -3 Let l = -527.422 + 525. Let x = -0.658 - l. Let y = -1.8 + x. Round y to 2 decimal places. -0.04 Let v(f) = f. Let y(s) = -196s - 7. Let x(w) = -3v(w) + y(w). Let o be x(7). What is o rounded to the nearest one thousand? -1000 Let t = -11 - -10.962. What is t rounded to 2 dps? -0.04 Suppose 0 = 5a - o - 12, o + 0o = 3. Suppose -5w = -aw - 164. Let r = 31 - w. Round r to the nearest 10. -50 Suppose 6t - 2t = 8800000. What is t rounded to the nearest 1000000? 2000000 Let p = 21 + -20.999944. Round p to 5 decimal places. 0.00006 Let q = -214719.0110037 - -214719. Let t = 0.011 + q. What is t rounded to six decimal places? -0.000004 Suppose 0 = 5o + 5, -242005 = 2r + 3o + 2o. Round r to the nearest 10000. -120000 Let h = -3 - -2.96. Let b = -0.0398 - h. Let y = b + 0. Round y to four decimal places. 0.0002 Let q = 650.7 + -12.7. Let o = q - 637.95004. Let s = o + -0.05. Round s to 5 decimal places. -0.00004 Suppose 5w - 2c - 61513 = 0, -3507 = 2w - 2c - 28111. Let q be -3 + (-1 + w - -1). Round q to the nearest 1000. 12000 Let l = 0.2 + -0.19999987. What is l rounded to 7 dps? 0.0000001 Let a = 14 + -5. Let g = 9.00001 - a. What is g rounded to four dps? 0 Let s = 16303 - -25786. Suppose -3u - 8911 - s = 0. Round u to the nearest ten thousand. -20000 Let w = -14.14 - -14. Let b = w + 0.1400015. What is b rounded to six decimal places? 0.000002 Suppose 14 + 92 = 2i. Let v = i - 4. Suppose 0 = z - v - 27. Round z to the nearest 10. 80 Let f = -8 - -7. Let u = f + -4. Let b(t) = -14599t + 5. Let p be b(u). Round p to the nearest 10000. 70000 Let d = 3.22 + -3.9. Round d to 1 dp. -0.7 Let j = -44 - -47. Let f(b) = 4b - 1 + b - 13b*2 - 2b. Let t be f(j). Round t to the nearest 10. -110 Let y = 0.067 + -0.066962. What is y rounded to 4 dps? 0 Suppose 4k = j + k + 6, 18 = -3j - 4k. Let x be 0/(3 - (-2 - j)). Suppose xa - 29000 = -a. Round a to the nearest 10000. 30000 Let f = -5.2 - 0.4. Let s = f - -8.7. Round s to 0 dps. 3 Let t = 9 - 4. Let o be (-2)/1 - -1 - -4. Suppose -ok - 820000 = -tk. Round k to the nearest one hundred thousand. 400000 Let i = -17 - -21. Let w(j) = -2374j3 - 5j*2 + 3j + 4. Let k be w(i). Round k to the nearest 10000. -150000 Let x = -3.01 - -3. Let y = 280582.98999986 + -280583. Let b = x - y. What is b rounded to seven dps? 0.0000001 Let z = 72.00000245 - 72. What is z rounded to seven decimal places? 0.0000025 Let s be (-10)/5 + 6 + -714. Round s to the nearest 100. -700 Let t = -16 + 15.78. Round t to one dp. -0.2 Let x = 57 - 99. Let b = 51822080.000033 + -51822038. Let i = x + b. Round i to 5 dps. 0.00003 Let q = -918 + 923.53. Round q to 1 decimal place. 5.5 Let i = -0.453 + 0.4. Round i to two dps. -0.05 Let w be (-1)/(((-1)/1)/5). Suppose -wb + 0b + 37485 = 2k, 2b - 14973 = -5k. Let s be b - 2/(-2 - 0). Round s to the nearest one thousand. 8000 Let w = 16 - 33. What is w rounded to the nearest integer? -17 Let o = 234 - 234.201. Round o to two dps. -0.2 Let u = -31.67 + -0.33. Let c = -32.56 - u. Round c to one dp. -0.6 Let o(g) = 24g + 9. Let q be o(-6). Let h = q - -242. What is h rounded to the nearest ten? 110 Let b = -62 - -30. Let q = -7.651524 - -39.6515207. Let d = b + q. What is d rounded to 6 dps? -	{ "pile_set_name": "DM Mathematics" }
nutes are there between 11:23 AM and 9:59 PM? 636 What is 691 minutes after 5:50 AM? 5:21 PM What is 690 minutes after 8:36 PM? 8:06 AM What is 589 minutes after 5:57 AM? 3:46 PM What is 14 minutes before 7:29 AM? 7:15 AM What is 605 minutes before 10:57 PM? 12:52 PM What is 304 minutes after 9:46 AM? 2:50 PM How many minutes are there between 11:00 PM and 8:56 AM? 596 How many minutes are there between 7:48 AM and 8:29 AM? 41 How many minutes are there between 3:24 AM and 5:49 AM? 145 How many minutes are there between 3:51 PM and 1:34 AM? 583 What is 154 minutes after 12:04 PM? 2:38 PM What is 355 minutes before 11:12 PM? 5:17 PM How many minutes are there between 11:06 PM and 6:05 AM? 419 How many minutes are there between 9:18 AM and 9:01 PM? 703 How many minutes are there between 5:27 PM and 2:30 AM? 543 How many minutes are there between 9:53 PM and 9:26 AM? 693 How many minutes are there between 12:17 PM and 10:22 PM? 605 How many minutes are there between 7:21 AM and 10:14 AM? 173 How many minutes are there between 2:58 AM and 1:16 PM? 618 How many minutes are there between 7:51 PM and 5:29 AM? 578 How many minutes are there between 5:15 PM and 4:58 AM? 703 How many minutes are there between 5:16 PM and 10:16 PM? 300 How many minutes are there between 12:06 PM and 12:10 PM? 4 What is 302 minutes after 6:51 PM? 11:53 PM What is 560 minutes after 1:00 PM? 10:20 PM What is 423 minutes after 7:41 PM? 2:44 AM How many minutes are there between 10:15 PM and 12:34 AM? 139 What is 543 minutes before 9:46 PM? 12:43 PM What is 709 minutes before 9:28 AM? 9:39 PM What is 89 minutes before 3:20 PM? 1:51 PM What is 107 minutes before 4:26 PM? 2:39 PM What is 703 minutes before 11:32 AM? 11:49 PM How many minutes are there between 4:13 AM and 2:44 PM? 631 What is 661 minutes before 5:05 AM? 6:04 PM How many minutes are there between 3:17 AM and 8:12 AM? 295 What is 625 minutes after 9:31 PM? 7:56 AM How many minutes are there between 4:58 PM and 11:23 PM? 385 What is 62 minutes after 6:04 AM? 7:06 AM What is 443 minutes after 1:00 PM? 8:23 PM What is 89 minutes before 10:59 AM? 9:30 AM What is 605 minutes after 12:02 AM? 10:07 AM What is 360 minutes before 11:51 AM? 5:51 AM What is 115 minutes after 10:49 PM? 12:44 AM How many minutes are there between 4:54 AM and 1:02 PM? 488 How many minutes are there between 5:26 PM and 8:53 PM? 207 How many minutes are there between 8:26 PM and 12:24 AM? 238 How many minutes are there between 2:39 PM and 4:01 PM? 82 What is 617 minutes before 9:59 AM? 11:42 PM How many minutes are there between 5:17 AM and 7:36 AM? 139 What is 490 minutes before 1:41 PM? 5:31 AM How many minutes are there between 7:11 PM and 12:53 AM? 342 What is 685 minutes after 11:04 PM? 10:29 AM How many minutes are there between 1:21 PM and 1:56 PM? 35 What is 553 minutes after 12:02 AM? 9:15 AM How many minutes are there between 8:20 PM and 2:45 AM? 385 How many minutes are there between 2:19 PM and 10:19 PM? 480 What is 135 minutes before 11:27 PM? 9:12 PM How many minutes are there between 4:04 PM and 1:45 AM? 581 How many minutes are there between 1:32 AM and 1:16 PM? 704 How many minutes are there between 8:12 AM and 2:28 PM? 376 How many minutes are there between 7:07 AM and 12:32 PM? 325 What is 293 minutes after 1:52 PM? 6:45 PM What is 573 minutes after 3:02 AM? 12:35 PM How many minutes are there between 7:20 PM and 5:56 AM? 636 How many minutes are there between 6:10 AM and 4:33 PM? 623 What is 468 minutes after 6:34 AM? 2:22 PM What is 25 minutes after 8:10 PM? 8:35 PM How many minutes are there between 5:56 PM and 12:41 AM? 405 What is 472 minutes before 9:51 PM? 1:59 PM How many minutes are there between 1:44 AM and 2:37 AM? 53 What is 289 minutes after 11:19 PM? 4:08 AM What is 207 minutes after 10:25 AM? 1:52 PM What is 302 minutes after 10:41 PM? 3:43 AM What is 549 minutes after 3:06 PM? 12:15 AM What is 630 minutes after 3:29 PM? 1:59 AM How many minutes are there between 8:53 AM and 5:16 PM? 503 What is 391 minutes after 7:11 AM? 1:42 PM How many minutes are there between 6:15 AM and 1:11 PM? 416 What is 672 minutes before 6:26 AM? 7:14 PM What is 373 minutes after 11:25 PM? 5:38 AM What is 40 minutes before 10:43 AM? 10:03 AM What is 155 minutes after 5:05 AM? 7:40 AM How many minutes are there between 12:05 PM and 11:53 PM? 708 How many minutes are there between 3:13 AM and 4:24 AM? 71 How many minutes are there between 10:14 AM and 12:09 PM? 115 How many minutes are there between 4:11 PM and 8:22 PM? 251 What is 627 minutes after 5:33 PM? 4:00 AM What is 345 minutes after 4:33 AM? 10:18 AM How many minutes are there between 6:33 PM and 11:16 PM? 283 How many minutes are there between 11:20 AM and 9:32 PM? 612 How many minutes are there between 8:54 AM and 1:43 PM? 289 What is 524 minutes after 7:36 PM? 4:20 AM How many minutes are there between 4:49 AM and 7:23 AM? 154 What is 148 minutes before 8:16 PM? 5:48 PM What is 660 minutes after 11:25 AM? 10:25 PM How many minutes are there between 10:50 PM and 3:14 AM? 264 How many minutes are there between 12:36 PM and 12:20 AM? 704 How many minutes are there between 6:18 AM and 10:44 AM? 266 How many minutes are there between 6:17 PM and 2:51 AM? 514 How many minutes are there between 3:26 AM and 12:50 PM? 564 How many minutes are there between 8:42 AM and 9:22 AM? 40 How many minutes are there between 8:36 AM and 1:31 PM? 295 What is 474 minutes after 7:14 AM? 3:08 PM How many minutes are there between 8:33 PM and 7:34 AM? 661 How many minutes are there between 11:21 AM and 12:37 PM? 76 How many minutes are there between 2:55 PM and 3:45 PM? 50 How many minutes are there between 9:07 AM and 8:51 PM? 704 How many minutes are there between 8:59 AM and 2:26 PM? 327 What is 416 minutes before 7:15 AM? 12:19 AM How many minutes are there between 12:24 AM and 10:52 AM? 628 How many minutes are there between 12:48 AM and 7:56 AM? 428 What is 264 minutes before 2:05 PM? 9:41 AM What is 719 minutes before 11:12 AM? 11:13 PM What is 304 minutes before 5:29 AM? 12:25 AM What is 488 minutes after 6:54 PM? 3:02 AM What is 107 minutes after 5:45 PM? 7:32 PM How many minutes are there between 2:40 AM and 9:30 AM? 410 How many minutes are there between 11:54 PM and 6:34 AM? 400 What is 137 minutes after 5:50 PM? 8:07 PM What is 691 minutes after 1:22 PM? 12:53 AM What is 283 minutes before 11:04 AM? 6:21 AM How many minutes are there between 10:08 AM and 5:27 PM? 439 What is 44 minutes before 4:05 AM? 3:21 AM How many minutes are there between 9:01 AM and 6:07 PM? 546 How many minutes are there between 2:38 PM and 10:39 PM? 481 What is 462 minutes after 5:46 PM? 1:28 AM How many minutes are there between 12:22 PM and 10:56 PM? 634 What is 367 minutes before 5:47 AM? 11:40 PM How many minutes are there between 9:52 PM and 8:10 AM? 618 How many minutes are there between 3:25 AM and 9:36 AM? 371 How many minutes are there between 7:25 AM and 6:56 PM? 691 What is 444 minutes before 5:58 PM? 10:34 AM What is 573 minutes before 9:54 AM? 12:21 AM What is 429 minutes before 8:04 AM? 12:55 AM What is 463 minutes after 10:55 PM? 6:38 AM What is 291 minutes after 1:37 AM? 6:28 AM What is 197 minutes after 1:18 PM? 4:35 PM How many minutes are there between 11:08 AM and 8:53 PM? 585 How many minutes are there between 2:33 PM and 11:00 PM? 507 How many minutes are there between 12:10 AM and 12:49 AM? 39 How many minutes are there between 4:23 PM and 12:57 AM? 514 What is 699 minutes before 8:37 AM? 8:58 PM What is 35 minutes after 8:31 AM? 9:06 AM What is 159 minutes after 1:51 PM? 4:30 PM How many minutes are there between 3:21 PM and 4:50 PM? 89 How many minutes are there between 1:36 PM and 6:46 PM? 310 How many minutes are there between 11:50 AM and 12:28 PM? 38 How many minutes are there between 7:54 PM and 3:40 AM? 466 How many minutes are there between 3:42 AM and 1:52 PM? 610 What is 612 minutes before 10:31 PM? 12:19 PM What is 51 minutes after 8:09 PM? 9:00 PM How many minutes are there between 8:49 PM and 9:51 PM? 62 How many minutes are there between 5:05 AM and 12:15 PM? 430 How many minutes are there between 6:08 AM and 1:09 PM? 421 What is 139 minutes before 3:54 AM? 1:35 AM What	{ "pile_set_name": "DM Mathematics" }
= t + 0.12. Let i = 0.1 - 0.1. Which is the third biggest value? (a) r (b) 1/10 (c) i c Let a = -64 - -64.3. What is the second smallest value in 13, -0.3, a? a Let l = -88 + 84.3. Let p = 1.3 - l. Let b = -2 + -2. What is the biggest value in b, 0.4, p? p Let x = -0.12 + 2.12. Which is the smallest value? (a) 0.1 (b) x (c) 4 a Let g = 0 - 0.2. Suppose -23 = -3w - 62. Let p = -8 - w. What is the smallest value in p, 2/11, g? g Let d = -6 - -4. Which is the third biggest value? (a) d (b) -5/2 (c) 1/3 b Let h = -0.156 - 12.244. Let w = h - -12. Let q = 1.3 - 0.3. Which is the third smallest value? (a) q (b) w (c) -0.2 a Let d = 13.03 - 13. Let q = -0.13 + d. What is the second smallest value in 0.4, q, -1/9? q Suppose -4u - 18 = o, 2u + 64 = -o - 2o. Let d be (-82)/(-170) - o/187. What is the third smallest value in d, -5, 0? d Let x(c) = -c*2 - 6c - 4. Let k be x(-4). Let h(m) = 3m2 + 4m + 1. Let o be h(-3). Let n be (-3 - -7)/o-1. What is the biggest value in n, k, 0.3? k Let z = 4.1 + -1.1. Let r = z - 2.7. What is the third smallest value in 5/3, r, 0.4? 5/3 Let k be 1/((3/(-21))/(-1)). Let m(i) = -i2 + 4i + 6. Let a be m(k). Let g = 46/3 + a. What is the smallest value in g, -5, 5? -5 Let p = -5.7 - -4.7. Let v = 2621/8 + -327. What is the biggest value in -2, p, v? v Let k = -0.09 + 0.59. Let s = k + -0.8. Which is the third biggest value? (a) 3 (b) s (c) -3/5 c Let c be 3(-2 - -1) + -1. Let i = 25 + -76/3. What is the biggest value in 5, c, i? 5 Let m = 0.07 - -4.93. Let s = m + -5.04. Let h = 0.04 + s. Which is the smallest value? (a) -0.5 (b) -1 (c) h b Suppose z + 4s + 3 = -2, -3s = 2z. Let k be z/(-9) + (-64)/(-84). What is the second biggest value in k, -0.4, -1? -0.4 Let k = -8 - -11. Let c = k - -1. What is the smallest value in -0.1, 2, c? -0.1 Let h = -9.4 - -12. Let o = h + -2. Which is the second smallest value? (a) -5 (b) 1/3 (c) o b Let w = -1.31 - -1.71. What is the fourth biggest value in -0.4, 3, -0.1, w? -0.4 Let o be (-3)/(-15) + (-48)/15. What is the third smallest value in 1/8, -5/6, o? 1/8 Let g = 3.04 - 0.04. Let r = -3.5 + g. Let j = 3/5 + -4/15. Which is the third biggest value? (a) -3 (b) j (c) r a Let f = 32 + -65/2. Which is the second biggest value? (a) f (b) 0.2 (c) 1 b Let s = -28.82 - -23.9. Let q = -0.08 + s. Which is the second biggest value? (a) -2/5 (b) -1 (c) q b Let j = -250 - -3248/13. Which is the smallest value? (a) j (b) -0.02 (c) 0.3 a Let v = -6.5 + 8. Let u = v + -1. Let p = 4 + -1. What is the third smallest value in p, u, -3/7? p Let z = -53 + 53.3. Let x = 1 - 2/3. Which is the third biggest value? (a) z (b) x (c) 2 a Let v = -484/5 + 96. What is the biggest value in v, 0.5, 2? 2 Let k = 1.2 - 2.1. Let j = 0.4 + k. What is the second biggest value in j, -3, 0.4? j Let g be (-155)/(-20) - (2 - 1). Let x = 33/4 - g. Which is the second smallest value? (a) x (b) 3 (c) 1/2 a Suppose d = 0, -7o + 8o - 4d = 5. Let u = -0.9 - -1. Let z = 0.3 - u. Which is the third biggest value? (a) -1/3 (b) o (c) z a Let f(q) = -q3 + 7q*2 + 2q - 8. Let t be f(7). Which is the second biggest value? (a) t (b) -5 (c) -3 c Let i = -56 + 56.08. What is the third smallest value in 0.4, 5, i? 5 Let f be (0 - -6) + (-1 - (-1 - -2)). Which is the second smallest value? (a) -5/2 (b) f (c) 5/6 (d) -0.3 d Let k(q) = -q*2 + 7q - 5. Let i be k(5). Let j = -34 - -37. What is the third smallest value in -2, i, j? i Let v = -1.9 + 2. What is the third smallest value in 2/11, v, 14/5? 14/5 Let o = -64 - -89. Let y = o - 26.6. What is the third smallest value in 4, 0, y? 4 Let z = 0.9 - 0.7. Let w = 0.94 + -0.44. What is the second biggest value in z, -4/7, w? z Suppose n - 4 = 3n. What is the third smallest value in 3, n, 0.2? 3 Let l be 507/26 + 2/4. Let g be 2 - (52/l - 1). Let r = 1.1 - 0.1. Which is the third biggest value? (a) -3/2 (b) g (c) r a Suppose -2h + 2 = -4h. Let f = -11 + 10.75. Let k = 0.15 - f. Which is the third smallest value? (a) h (b) 3 (c) k b Let t = 65 + -65.4. What is the third smallest value in 3/2, t, 2/5, -5? 2/5 Let q be (-435)/9 - (-1)/3. Let j be 3/(-4)q/234. Let m = 2 + -1. What is the second smallest value in m, -2, j? j Let m = 21.3 + -21. Which is the smallest value? (a) 0.1 (b) -0.2 (c) m b Let m = 2 - -4. Suppose mk - k = 5. What is the biggest value in 0.3, k, 5? 5 Let j = 6 + -1. What is the third smallest value in 15, 0.1, j? 15 Let n = -47 - -46. Let d be 2 + (-2)/4 + -1. Which is the third biggest value? (a) 0.2 (b) d (c) n c Let b(l) = l2 + 4l + 6. Let w be b(-3). Suppose -wd + 4p + 4 = 0, 4d + p = -p + 20. What is the second smallest value in d, 2/7, -0.03? 2/7 Suppose -7p = -4p - 36. What is the third biggest value in -0.2, p, 0.5? -0.2 Let y = -0.11 - -5.11. Let c be 2 + (-2)/(-9) + -2. What is the second biggest value in y, 0.5, c? 0.5 Let i = 39 - 38. What is the second biggest value in i, -1/7, -1, -37? -1/7 Let w = -37 - -186/5. Which is the biggest value? (a) 0.23 (b) -1 (c) w a Let w = -1 + 1.2. Let x = 6 + -2. Let g be (7/(14/x))/(-7). Which is the biggest value? (a) g (b) 3 (c) w b Let n be ((-18)/(-24))/((-126)/284). Let r = 4/21 + n. What is the second smallest value in r, 1, -4/3? -4/3 Let t = 40 - 159/4. Let y be ((-2)/(-2))/((-5)/(-10)). Suppose yp = -p + 6. What is the smallest value in p, t, -1? -1 Let s = 0.11 + 0.09. Let n = s + 0.3. Suppose 6 = r + 2. What is the second smallest value in r, n, -4? n Let t = 1.1 - -0.4. Let x = t + 1. Let u = -0.5 + x. Which is the second biggest value? (a) u (b) -4 (c) 0.3 c Let a = -0.96 + 1. Let u = -0.46 - a. What is the smallest value in 0.3, -5, u? -5 Suppose -354 = -4g + 158. Let q = -1150/9 + g. Let d = 0.4 - -0.1. Which is the smallest value? (a) q (b) 4 (c) d a Let t = -0.08 + 0.48. Which is the second biggest value? (a) -0.5 (b) t (c) -1 a Let p = 11 - 10.96. Which is the third smallest value? (a) 0.2 (b) p (c) -0.2 a Let s = 59 - 294/5. What is the second smallest value in -3, 0.9, s? s Let k = 28 + -167/6. Let x = 1.62 + 1.5. Let l = x - 0.12. Which is the third smallest value? (a) l (b) -4/7 (c) k a Let h = -838/11 + 76. Which is the smallest value? (a) -4 (b) h (c) 4 a Let l = 0.09 + -6.09. Let m = -8 - l. Let f be (-2 + 8)/(3/2). What is the second smallest value in f, 0, m? 0 Let u be 4/(-10)5/(-2). Let x be u + 2 + 46/(-14). Let j = -0.32 + -0.08. Which is the smallest value? (a) j (b) 0 (c) x a Let u(o) = o*3 + 4o*2 + 5o + 4. Let g be u(-3). Let p = 3 + g. Let m = 1 + -1.3. Which is the second smallest value? (a) -2 (b) p (c) m c Let m = -15 - -6. Which is the third smallest value? (a) -0.3 (b) 4 (c) m b Suppose 0 = 5o - 2 - 23. Suppose -2s - om = -s - 23, -4s + 2m + 4 = 0. Suppose c + sc = -16. What is the smallest value in -0.04, -1, c? c Let y be ((-20)/45)/(4/(-6)). Which is the fourth biggest value? (a) 0.4 (b) y (c) 3 (d) 0.5 a Let y(q) = q*3 - 8q*2 + 5q + 6. Let t be y(7). What is the third smallest value in t, 2, -2/7? 2 Let y = -1.5 - -1. Let j be (-3)/((30/16)/(-5)). Let v = j + -7. Which is the third smallest value? (a) -2 (b) v (c) y b Suppose -3l + 6l + 9 = 0. What is the smallest value in l, 0.03, 2/19? l Let t = -2.6 - -0.6. What is the second smallest value in -4, 3, t? t Let r = 0.28 + -4.28. Suppose -3d + 16 = d. Which is the third smallest value? (a) d (b) r (c) -4/3 a Suppose 0 = -3j - j - 20. Let r = 2.89 + 0.31. Let m = r - 3.4. Which is the second biggest value? (a) j (b) m (c) 1 b Suppose 2l - 8 = 2i + 4, -3l = -4i - 21. Suppose -10 = -8u + lu. Which is the third smallest value? (a) 0.5 (b) u (c) -0.5 b Let p = -34 - -33.9. What is the smallest value in 1, 0, 4/7, p? p Let x be 15/10*((-4)/3 - 0). Which is the fourth smallest value? (a) -0.1 (b) -0.3 (c) x (d) 3/7 d Let s be (-4 + (-76)/(-16))/((-6)/(-8)). What is the biggest value in s, -1/7, -7/2? s Let t = -0.49 - -0.43. What is the fourth biggest value in -2, 3/2, 0.1, t? -2 Let i = 3.1 - 1.1. Which is the fourth biggest value? (a) 0.2 (b) 1 (c) i (d) -2/11 d Let j = 0.07 - 0.17. Let q = 145 - 2173/15. Which is the second biggest value? (a) -4 (b) j	{ "pile_set_name": "DM Mathematics" }
40307 for y. -5 Solve 0q + 4q - o + 15o - 345 = 19o, 0 = -5q - 22o - 1518 for q. 0 Solve -1145 + 745 = 56x + 2z, 2x + 5z + 34 = 0 for x. -7 Solve 0 = -3858g + 3852g + 4f + 186, -4g + 110 = 2f for g. 29 Solve -f + 57 = 5k, -4f + 5601618k - 5601609k = 91 for f. 2 Solve 5r + 65 = 4k, -37r + 92 = 32r - 71r + 6k for r. -1 Solve -54u + 146u - 89u + 2y + 10 = 0, 24 = -5u + 4y for u. -4 Solve 2l - 4265 + 4236 = -5f, -77l + 73l + f + 25 = 0 for l. 7 Solve 33h + 722 = 2j - 720, -358 = 5h + 5j - 113 for h. -44 Solve 11s + 7s + 5 = 20s + i, -4s - 4i = -8 for s. 3 Solve 2s = -2s + 5k - 271 - 15, 3s + 2k + 243 = 17 for s. -74 Solve 4760m - 4758m + 144 = 3b, m + 5339 = 116b for m. -3 Solve -2n + 2j = -10, -4n - 1960j + 14 = -1963j for n. -1 Solve 12b - m - 64 = 0, 7b - 2b = 78m + 187 - 250 - 531 for b. 6 Solve 4k - 172 = -4v, -4v - 2531k + 9 + 55 = -2554k for v. 39 Solve 3i + 82 = -56a + 54a, -4i = -8a + 56 for a. -5 Solve -102w - 77 = -95w + 12g, 2w - 30 = 8g - 4g for w. 1 Solve -4k + 9r + 125 = 0, 139r = 3k + 145r - 81 for k. 29 Solve -5z + 2z - 27h - 25h + 63 = -49h, -75z = h - 1797 for z. 24 Solve -77x + 6d + 24 = -74x, -3d = 4x - 2d - 68 for x. 16 Solve -3a + 72 = 47970h - 47973h - 0a, 110 = 5h + 5a for h. -1 Solve 3g + 316 = -2u - 7g, 2u + 2604g - 68 = 2606g for u. 2 Solve 3i + 66 = -3q, -13q - 82 = -2i - 8q for i. -4 Solve 17f - 29f = 7n - 10f - 7 + 38, -20f + 40 = 0 for n. -5 Solve -262 = -5v - 2z - 631, 0 = 3v + 7z + 233 for v. -73 Solve j - 1195 = 3y - 1184, -38j + 5y + 23 = 150 for j. -4 Solve 4h = -u - 12, 8h + 0u + 5u - 13 = -37 for h. -3 Solve 702i - 2q = 705i + 38, -3q = 13i + 193 for i. -16 Solve 391l - 405l - 532 = 0, 5l + 210 = -4h for h. -5 Solve 14p - 16p = 4m - 4, 2p = 5m - 96 + 82 for m. 2 Solve 0 = 41f - s - 248, s - 22 = -14f + 46f - 36f for f. 6 Solve 0 = -11v + 3o + 2o + 702 - 618, -5v - 2o + 4 = 0 for v. 4 Solve 281d + 276d = 554d + 4p + 73, -p = 2d + 32 for d. -5 Solve 0r - n = -4r + 1 - 9, 40r + 36 = -n for r. -1 Solve 84d + 5r - 239 = 87d, -5d = 3r - 157 for d. 2 Solve 100j - 5x - 270 = 0, 28j - 20x = 26j - 19x + 18 for j. 2 Solve -260a + 259a = -5g - 14, 4g = -8a + 244 for g. 3 Solve 480t - 1918 = 7c - 8c - c, -4c + c - 15 = -3t for t. 4 Solve -14333n - 29b + 21 = -14337n, 4n + 2b - 4 = 3n for n. 2 Solve -7c + 58 = -5l, -5l + 2l + c - 20 + 22 = -4l for l. -6 Solve -4j + 44 = 0, 263620k + 4j - 76 = 263612k - 0j for k. 4 Solve 17k - 21r + 38r + 70 = 20k, 4k + 15 = r for k. -5 Solve 2k + 4t + 82 = 0, -2k - 3k + 1143t = 1141t - 47 for k. 1 Solve 5d = -3x + 6 - 8, 1277x - 22 = 1259x + 4d for x. 1 Solve 3g + 23b = -27b + 72b - 25b + 345, 0 = -7g + 5b - 515 for g. 5 Solve f + 6 = 4i + 8, -4i - 357 + 289 = -4f - 0i for f. 22 Solve -v + 6283t - 1 = 6286t, 10v = 5t + 25 for v. 2 Solve 0 = -3v - o + 7, -7476 + 3738 = -2v + o - 3725 for v. 4 Solve 3z - 19y + 24y = -30, 2657y = 2661y for z. -10 Solve 3l - 5r + 1 = 0, 10l - 27800r + 27795r = 55 for l. 8 Solve 5w - 10175y = -10171y + 190, 0 = -3y - 135 for w. 2 Solve -k - f - 64 = -5f, -3k - 8252f + 8256f = 72 for k. -4 Solve -3p - 45 = -3i, 10i - 76233p - 140 = -76228p for i. 13 Solve 13i = -10o + 199, -70 = -4o - 77i - 78i - 79i + 232i for o. 16 Solve -14b - 396c - 23772 = -10b, -3b + 3b + 3c + 180 = 0 for b. -3 Solve -2c - 574o = -282o - 288o - 52, -2o - 110 = -3c for c. 34 Solve -4m - 4r = 108 + 72, m - 2r = 15m - 19 + 61 for m. 4 Solve 0g - 5 = -8g + 9g, 0 = 5u - 5g + 313 - 953 for u. 123 Solve v + 5g + 46 = 0, 9v + 4g + 242 + 75 - 108 = 0 for v. -21 Solve -3946h + 1970h - x = -1972h - 76, -6x - 24 = 0 for h. 20 Solve 93s - 95s - 13 = -3t, 17t - 7 = 3s for t. -1 Solve -18 = 4u - f - 32, -6u + 10u - 28 = 8f for u. 3 Solve 4i - 209 + 111 = 3m - 119, m - 13 = 2i for m. -5 Solve 46s = 54s - 26 - 22, -5t - 3s + 3s + 38 + 8 = s for t. 8 Solve 0 = -2i + 3i + 5c + 7, -80i + 2c - 1145 + 135 = 4i for i. -12 Solve -19 = -v - 2u, -4u = v + 13271 - 13314 for v. -5 Solve 5b + 195 = -3a + 2a, 989 - 4577 = 108b - 16b for a. 0 Solve -l = -6k + 25, 3l - 2003 = 3k - 2018 for k. 4 Solve 21347z - 5s - 126 = 21350z, 0 = 2z + 3s + 76 for z. -2 Solve 134r - 4 = 3x + 139r - 5 + 11, -220 = -4x + 40r for x. 5 Solve y + 6f - 469 + 526 = 4f, -y = -5f - 146 for y. 1 Solve -2600 = 20r - 3060, 50 = 4x + 2r for x. 1 Solve -2c + 6 = 0, -237p + 241p + 34 = 21c - 37 for p. -2 Solve -2y - 2j = -4676 + 4698, 0 = y - j - 19 for y. 4 Solve 4q - 1144 = 4w + 1199 - 2259, 0 = -2w - 3q - 37 for w. -20 Solve 0 = -2p - 2, 4202l - 4206l + 3p - 9 = 0 for l. -3 Solve 65q + 9 = -207q - 3s, -4q = 5s + 15 for q. 0 Solve 82y + 391 = -269y + 5n, -5n + 36 = 4y for y. -1 Solve -3c = -161k - 975, -2c - 18k - 15 = -14k + 3 for c. 3 Solve 2274l + 326 = 2i + 2264l, -175 = 5i + 5l for i. -2 Solve 5l + 415 = 53v, -7l + 2v = -0v + 81 + 139 for l. -30 Solve -5i - 1 = 5j - 6, -5i + 6j + 408 = 447 for i. -3 Solve 4s - 6o + 7o = 8s - 8s + 44, -25 = 5o - 5 for s. 12 Solve w + 2r = 39 - 4, 10r + 7r - 22r = 4 + 1 for w. 37 Solve 4g + 257 = 29t + 746, -26t + 26t - 3 = 3g for t. -17 Solve -2a + 3a = -4q + 2, -6496a + 48 = 6q - 6492a for q. -4 Solve -3l + 52 = 4a, -a + 6171 = -5l + 6296 for l. 24 Solve 64l = 4n - 5n - 51, -4n = 419l - 415l - 48 for l. -1 Solve 17k - 2u - 210 = 0, 3 + 4 - 6 - 7 = 3u + 3 for k. 12 Solve 0 = -36u + 130u - z - 50 - 42, -3u + 5z = 7 for u. 1 Solve -5r + n - 29 = 0, 21n - 69 = 2r + 21 + 49 - 45 for r. -5 Solve 0t + 6a - 13a - 8 = -2t - 10a, -a - 4 = 5t - 11 for t. 1 Solve 21 = -3320l + 3318l - c, 30c = l - 874 for l. 4 Solve -2x = -4s + 56, -11x + 191 = 5s + 67 for x. 4 Solve 5u = o + 31, -6o - 62 = -u - 4o for u. 0 Solve 2y + 2y - 300 + 360 = 2p + 6y, 26p - 780 = 4y for p. 30 Solve -188p = 189p - 379p - 7z + 5z - 182, -5p - 365 = 4z for p. -1 Solve -44k = -43k - 3x + 42, 2k + 112 = 8x for k. 0 Solve 2l + 4520z = 4515z - 13, -5l - 120 + 53 = z for l. -14 Solve 7g + 344 = -5b, -3g - 4b - 43 = 110 for g. -47 Solve 21k + 25k - 4393 = 37k - 74k - 3b, 2b = -4k + 208 for k. 53 Solve 10i = 131c + 8i - 907, 2c - 1 = 5i - 12 for c. 7 Solve -7w = 3v - 8, -10w = -12w + 6w + 4v for w. 2 Solve 11q - 132 = 197d, 3224 = 4d + 4q + 3176 for d. 0 Solve -2p + 1058 = 4a + 924, -60p = -4a + 72 for p. 1 Solve -5l + 13f - 17302 + 17560 = 0, -2l + 97 = f for l. 49 Solve 29227 = 2n + 7x + 29255, 3x = -4n - 78 for n. -21 Solve 2t + 97 = 74a - 81a, -56 = t + 4a for t. 4 Solve -40g - 46h - 495 = -15h - 28h, -4h = -51g - 592 for g. -12 Solve -94 = -x - x + 13y, 104y = -5x + 143y - 42y + 22 for x. 8 Solve -3p + 138r - 261 = 0, 3p + 157190 = r + 157203 for p. 5 Solve 6o = 3a - 0o - 363, -528 = 23o + o + 912 for a. 1 Solve -138j + 3z + 9 = -135j, -511j + 3z = -9 for j. 0 Solve -169o = -143o + 4g + 172, -2g = 3o + 86 for o. 0 Solve -2g - 91095d + 91098d = -8, 2d + 12 = 0 for g. -5 Solve -5l - 11r = 7r + 1731 - 1691, 0 = 3r for l. -8 Solve y + 46 = -6x, -4x + 2139y - 2136y - 19 = 19 for x. -8 Solve -18b + 3a - 1577 = -16b - 1696, -3b + 4a = -160 for b. 4 Solve 5t = 4g - 8, 5g = -179993t + 179998t + 10 for g. 2 Solve -13u - 29 = -5z, -13z + 36z - 9z - 5u = 15z + 17 for z. -2 Solve -114f + 78 = -116f + 4a, -f - 229 = 4f - 12a for f. -5 Solve -339f + b - 76 = -334f, 6b = f - 8 for f. -16 Solve -3a + 2s - 71 = a - 11, 87s = 3a + 387 for a. -13 Solve -12 = 4c - 4x, -3534x - 14 = 4c - 3539x for c. -1 Solve -4u = -m - 5u - 17, -4m + 30 = -5u - 17u - 74 - 140 for m. -5 Solve 0 = -492j + 505j + 2d + 34, -3j - 62 = 14d for j. -2 Solve -3z - 5d + 12 + 23 = 0, -198d - 60 = -8z - 404d + 201d for z. 5 Solve -3t + 8l = -t + 9l + 5 + 5, -3t - 10l = 117 for t. 1 Solve -2u + 5 - 93 = u + 5o, 4u - 11o = -82 for u. -26 Solve -8 = -2k - 7t, k - 5180t + 5 = -5179t for k. -3 Solve 4104m - 409	{ "pile_set_name": "DM Mathematics" }
ive o. 2 Rearrange 425k2 + 154 - 77 - 79 to the form vk*2 + zk + h and give h. -2 Express (1 - 1 + b*2)(22b - 12b - 19b) + 2b*3 + 0b*3 + 0b*3 as mb*3 + vb*2 + tb + i and give m. -7 Express (4q - 3q + q)(-3 + 1 + 5) - 2q + 0q - q + (4q - 5q + 2q)(3 - 3 + 1) + (-2q - 3q + 3q)(-6 + 4 + 4) + 36 - 36 + 6q as u + aq and give a. 6 Express (-112n + 163n + 37n)(0n - 2n + n) + n2 - n2 + 3n2 + (0 + 0 + n2)(1 + 2 - 5) + 2 - 3n2 + n2 + 4n2 as yn*2 + f + an and give f. 2 Rearrange -f + 8210f2 - 14f*4 + 47f*4 - 8202f*2 to af*2 + uf*3 + o + nf*4 + sf and give a. 8 Express 27u + 385u - 252u + 230u + 340u as ou + h and give o. 730 Rearrange 18s2 - 2s - 12 + 49 - 38 to vs2 + xs + r and give x. -2 Express -2q2 - 50q - 245q + 36q in the form wq + nq*2 + a and give w. -259 Express -765h*2 - h - 522h*2 + 715h*2 as vh*2 + n + yh and give y. -1 Express (659 - 479z - 659)(1 - 7 + 4)(-z3 + 0z + 0z) as sz*2 + yz*4 + bz + l + oz3 and give y. -958 Express 112f*4 + 2f*3 + 59591f*2 - 3f*3 - 59591f*2 - 2 as rf + uf3 + wf*2 + gf*4 + y and give g. 112 Rearrange -156x - 14 - 6 + 154x + 97 to sx + n and give s. -2 Rearrange (12r - 4r + 33r)(4 - 4 - 9)(0r + 2r - r + (0r + 3r - 2r)(5 - 4 - 3) + 3r - 4r - r) to the form or + a + dr2 and give d. 1107 Rearrange -a - 104 + 3a + 108 + 12a3 to the form j + ua*3 + ha + ia2 and give j. 4 Express -5m*2 - 12m - 289 + 289 in the form am2 + d + nm and give n. -12 Express -o + 24 - 30o2 - 28o*2 + 54o*2 as d + io + uo2 and give u. -4 Express (0 + 0 + 2k)(-3k + 0 + 0) + (25 - 4 + 8)(2k*2 - 2k2 - k2) + 2k2 + 0k*2 - 4k*2 as vk + fk2 + x and give x. 0 Express -26l - 15l - 20l + 81l in the form o + fl and give f. 20 Express (-8c + 8c + 2c)(0c + 0c - c) + (3c - c - 4c)(-2c + 7c - 3c) as l + pc2 + qc and give p. -6 Rearrange (108a - 54a + 32a + 2 + 2a - 2 + (a + 3a - 3a)(1 - 5 + 5))(2a - 2a + 3a) to the form ja + b + pa2 and give p. 267 Rearrange 10q*2 + 546q*2 + 187q*2 + 79q*2 to o + cq*2 + zq and give c. 822 Express (-1 + 0 + 2)(-558 - 520 + 1165)(-2y4 + 4y*4 + 0y*4) in the form ry*3 + wy*2 + h + ty + sy4 and give s. 174 Express 45792 - 2v + 109v3 - 2v*2 - 45792 in the form ov*2 + mv + jv3 + z and give m. -2 Rearrange ((1 - 3 + 3)(-3 + 4 - 5) + (-3 + 0 + 2)(3 - 1 + 0))(65y + 74y - 113y) to ay + x and give a. -156 Express -6b + 3b*4 - 5b*3 - 4b*3 - b + 0b + 0b in the form xb*4 + wb*2 + fb + db3 + r and give x. 3 Express -782n*2 - 162n*2 + 176n*2 + 281n*2 in the form cn*2 + h + un and give h. 0 Rearrange 172f2 + 5 - 52 - 87f*2 - 82f*2 - 2 to the form g + mf*2 + pf and give m. 3 Express (11 - 15 - 8z + 5)(-6 + 4 + 14)(2z + 0z - z) as m + qz*2 + xz and give x. 12 Express -7q - 11 + 7 - 16q + 2 as uq + l and give u. -23 Express 5k - 9k + 1 - 138k*2 + k - 44k*2 + k as bk + uk2 + f and give f. 1 Rearrange (31 + 11 - 46)(0m2 - 2m*2 + 2 + 3m*2) to the form r + gm*2 + cm and give g. -4 Rearrange -d*3 - 1 + 3985d - d*3 - 4058d to nd2 + ud*3 + t + ad and give a. -73 Rearrange 143k + 547k + 411k - 93k + 160k to the form lk + p and give l. 1168 Rearrange -44 + 18 - 2v + 16 to the form fv + q and give f. -2 Express (6z - 11z + z)(1 + 7 + 31 + 13) in the form p + mz and give m. -208 Express -34q2 - 50q*2 + 82q*2 + 4 + 3q*3 in the form gq*3 + bq*2 + p + jq and give b. -2 Rearrange (-23 - 8 - 5)(25 - 7 + 0)(4 + 2d - 1 - 3d) to w + pd and give p. 648 Express 3c - 1 + 1 + 4c + 0c - 5c + 2c + c - c - 3c + c + c + (3 - 2 + 1)(2c - 5 + 5) + 2c + 0c - 4c - 12 + 7c + 12 as mc + p and give p. 0 Rearrange (145 + 273 - 79)(-4 + 4 - 2w + w + 2w - 2w - w + 3w - w + 0w - w - w + (-1 - 1 + 1)(2w + 1 - 1)) to the form i + zw and give z. -1356 Express -3915t*3 - 2t*2 + 4t*2 + t + 3918t*3 - 6 in the form ut*3 + mt*2 + yt + w and give u. 3 Rearrange 10458 - 335o2 + 2o - 20916 + 10460 to vo2 + t + qo and give v. -335 Express (-4 + 4 + 2)(2a + 0a - a) + 2 - 2 - a - 46a - 227a - 52a as i + ha and give h. -324 Rearrange 2r*2 - 3r*4 - 437r*3 + 2 + 436r*3 + 3r*2 to or*4 + ir*2 + z + vr + lr3 and give i. 5 Express -87900o + 87900o - 1 + 465o*2 + 1 as yo + qo2 + b and give q. 465 Rearrange 83 + 253r + 503r - 83 - 3r to fr + d and give f. 753 Express -2392c*2 - 148c + 450c - 153c - 149c in the form j + sc*2 + uc and give s. -2392 Rearrange -74z + 2z*2 + 45z + 5z2 + 0z to kz + o + rz*2 and give k. -29 Express -13t - t - 3t2 + 2t + 7t - 1 as at + ht2 + b and give h. -3 Rearrange -277 + 277 + 78b*2 + (-2b2 - b2 + 4b2)(3 - 3 + 1) + 2b2 + b - b + (-b + 0b + 3b)(4b + 29b - 9b) to pb*2 + h + vb and give p. 129 Rearrange (-2p + 4 - 4)(80 - 89 + 236 + 218) to t + xp and give x. -890 Rearrange (-14 + 14 + 6c*3)(-5 + 7 + 16 - 5)(-1 + 8 + 1) to the form mc*3 + sc + b + uc2 and give m. 624 Rearrange -19d + 0 - 1 + d*2 + 33d + 2d3 - 12d to td3 + ud*2 + rd + j and give r. 2 Express -130c + 130c + c*2 - 189 - 3c*2 in the form xc*2 + r + uc and give x. -2 Rearrange 0 + 4 + q - 6q + (2 - 2 - 4)(-62 - 15q + 62) to the form r + zq and give r. 4 Express (k*2 - 3k2 + k2)(0 + 0 - 4) + 3k*2 - 4k*2 - 4k*2 as ck + dk2 + b and give d. -1 Rearrange (p2 + 2p - 2p)((-4 + 2 + 3)(-4p + p + 2p) + (3 - 7 + 11)(-6p + 0p + p)) to yp2 + c + tp + rp3 and give r. -36 Rearrange (-h2 + h2 - 5h*2 + (0h + 4h - h)(0 + h + 0))(h + h - 4h)(0h + 0h + 2h) to n + dh2 + sh*4 + jh*3 + wh and give s. 8 Express -10s2 + 8s*3 - 49s*3 + 12 + 39s*3 as hs + js2 + ls*3 + q and give l. -2 Rearrange 594 - 609 - 3u*3 + 16u*3 - 3u*2 to xu*3 + pu*2 + wu + v and give x. 13 Express d*3 - 5d*4 + 7d*4 - 6d*2 - 2 + 87d - 88d + 2d*2 in the form zd*3 + jd*4 + f + xd + yd2 and give y. -4 Express 14l*2 - 13 + 8 - 16l*2 - 56 in the form p + nl*2 + bl and give n. -2 Rearrange -1 + 4 - 8f + 14f to the form n + mf and give m. 6 Rearrange -2 + 139w*3 + 335w*3 + 40w*3 to cw*2 + yw + zw3 + a and give z. 514 Rearrange -17y*3 - 22y4 - 4 + y2 + 45y4 + 5 - 21y*4 to the form z + py*2 + wy*4 + iy*3 + jy and give p. 1 Rearrange 2041 - t - 2041 - 153t2 to k + mt + bt2 and give m. -1 Express 4h*3 - 220h*2 + 448h*2 + 24h*3 + 2 - 211h*2 in the form dh + r + gh2 + oh*3 and give r. 2 Rearrange 68w - 11 - 1 + 14 + 2w + 2 - 2 - 1 + w + 1 + (0w - 2w + 0w)(4 - 1 - 4) - w - 4w + 3w to the form p + lw and give p. 2 Rearrange (-4v3 + 0v*3 + 3v*3)(-5 - 2 - 2)(-89 + 134 + 211) to a + fv*3 + qv + lv2 and give f. 2304 Rearrange -3d*2 - 2d - 150771d4 + 150769d*4 - 3d*3 + 8 + 0d*3 to the form id*3 + nd + z + yd2 + td*4 and give y. -3 Rearrange (3b2 - b3 - 3b2)(494 + 17 + 214) + 4b2 - b3 - 4b*2 to the form kb + p + nb2 + qb*3 and give q. -726 Express -280t + 81t - 20 + 20 - 121t in the form z + ct and give z. 0 Rearrange 297 - v2 - 43 - 28 + 123 to bv*2 + t + xv and give b. -1 Rearrange -329f + 164f + 31 + 164f to j + rf and give r. -1 Express -25r4 - 27r3 - r2 - r - 5 + 31r3 + 27r*4 in the form lr + u + wr2 + zr*4 + cr*3 and give w. -1 Express -1389b - 1150b - 334b in the form n + fb and give f. -2873 Rearrange (-o + 3o - 3o)((1 + 3 - 3)(-3 + 0 + 4) - 1 + 2 - 3 + 23 - 9 - 6)(-2o - 4o - 5o) to the form no*2 + a + ro and give n. 77 Express 2 - 3 + 22q2 + 9 + 4 - 3 as cq + iq2 + v and give i. 22 Rearrange -2z*4 - 11 + 16 + 5z4 + z3 - 7 to the form u + tz + nz*4 + sz*2 + dz*3 and give d. 1 Express -73z*3 + 10z*3 - 29z*3 + (-4 + 1 + 4)(3z3 - z3 - z3) + 0z*3 - 2z*3 + 3z*3 in the form vz + p + oz2 + wz*3 and give w. -90 Rearrange (-2r + r - r)(-4r*2 + 16 - 16) + 31r*3 - 11r*3 + 35r*3 to o + ir + u*	{ "pile_set_name": "DM Mathematics" }
olve 5w - 2w = -3h - 24, -2h = 4w + 28 for w. -6 Solve -f = 3t + 17, -t = 783f - 786f - 1 for f. -2 Solve -2m - 3n + 3034 = 3020, -2n = -4 for m. 4 Solve -823y = -827y - 2d + 18, 14 = 2y - 4d for y. 5 Solve -w = -2o + 1, -252 = 3o + 4w - 226 for o. -2 Solve 5x - 2c = -31, -73c = 5x - 78c + 40 for x. -5 Solve 96 = -2w + 22q, -84w = -79w - 3q + 32 for w. -4 Solve -5i = -3w - 4 + 12, -1372i = -5w - 1377i - 40 for w. -4 Solve u = 6p - 33, -6u - 175p = -176p + 23 for u. -3 Solve -5q = 2j + 30, 5q - 2j + 7 = -3 for q. -4 Solve -15g + 21 = -17g + 4p + 31, -4p = -4g + 20 for g. 5 Solve b + 2m - 89 = -75, -4b + 6m = 56 for b. -2 Solve 0 = -3i - 15, -4i = -2u - i + 15 for u. 0 Solve 5i - 3m = 45, 5i - 55 = 552m - 551m for i. 12 Solve 818f = 822f + 12, 0 = 2v + 3f - 19 for v. 14 Solve -100a = -101a + 3c - 11, 3 = -c for a. -20 Solve -6g - 61 = -5f - 81, -f = -2g + 8 for f. 2 Solve -5m + 3b = -95 + 63, -5b = 20 for m. 4 Solve 5o = -3r - 48 + 46, 2r = -2o for r. 1 Solve 5i - 684 + 697 = -a, 5i - 3a = -1 for i. -2 Solve 2 = -p, -160103i - 3p + 0p = -160101i + 16 for i. -5 Solve 4l - 130 + 126 = 4q, 21 = l - 5q for l. -4 Solve 7a = 36o - 32o + 75, 0 = -2o + 4a - 42 for o. -3 Solve 4d - 858 = -p - 855, 5p - 15 = 4d for d. 0 Solve 0 = 2d - 5s + 10, 0 = d + 10939s - 10935s - 8 for d. 0 Solve 2h = -2v + 14, 595v + 4 = 596v - 2h for v. 6 Solve -18b + 5 = -17b - 2z, 0 = b + 2z - 5 for b. 5 Solve 3a + 6v = -24, 4a = -0v + 3v + 12 for a. 0 Solve 0 = -3o + 3, -j = -5o - 172 + 178 for j. -1 Solve 3m = 4l - 28, -844 + 812 = 5m - 3l for m. -4 Solve -3r = 2g - 24, -12g - 14 + 102 = 4r for r. 4 Solve 2x - 4 = x - 3, x = q - 4 for q. 5 Solve -i - f = -7, -58i = -45i - 2f - 61 for i. 5 Solve 0 = z + 1508o - 1505o + 10, 0 = 2z + 10o + 20 for z. -10 Solve 4c - 48 = 0, 0 = -26z + 23z + c - 6c + 69 for z. 3 Solve -195 = h + 3a - 199, 0 = h + 4a - 5 for h. 1 Solve -5s - 5l = -45, -2s - 68l - 12 = -72l for s. 4 Solve 185q = -3p + 189q - 19, -4p = 5q + 15 for p. -5 Solve 0 = 5l + q - 53, -3l + 5q - 3 + 46 = 0 for l. 11 Solve q + 7 = 3f, -501f + 7 = 5q - 502f for q. 2 Solve 0 = -3p - 2s + 5, 4s = -4p - 8 + 12 for p. 3 Solve -4u + 12 = 4f, -554 + 566 = -3u + 4f for u. 0 Solve -z - 12 = -4m, 10m + 4 = 11m for z. 4 Solve 281z - 6 = 283z - 3w, 0 = 4z - 2w + 12 for z. -3 Solve -2f = -11b - 33, -5b + 5 = 3f + 20 for f. 0 Solve 310t + 4a = 311t - 25, -5a = 25 for t. 5 Solve -12 = -4q - 2y, 6q - 22 = 695y - 696y for q. 4 Solve -4j + 0 = -a - 19, 0 = 5a - 5j + 20 for a. 1 Solve 4d = -4k - 20, -177d - 15 = 3k - 179d for k. -5 Solve 0 = -4t - 2m - 166 + 162, 0 = -3t + 85m - 176 for t. -2 Solve 647y - 648y = -4m - 24, 4m + 2y + 36 = 0 for m. -7 Solve 5z + 4 = -3j, 52z + 12 = j + 51z for j. 7 Solve 0 = 10v + 2t - 3866 + 3870, v = 5t + 114 for v. 4 Solve 3t + 7 = 2d, 3t + 18 = -2d + t for d. -4 Solve 0 = -59r + 58r - 4g - 5, -2r - 7g - 10 = 0 for r. -5 Solve 14545u - 14540u + 1 = -4o, 2o = u - 11 for u. 3 Solve 0 = -d - 11 + 14, -d = 3y - 15 for y. 4 Solve -5s - 3q - 23 = 0, 3541q - 3542q - 17 = -3s for s. 2 Solve 0 = -9x + 14x - 4z + 15, -3z = -5x - 20 for x. -7 Solve -2 = a - 5m, 3008a + 2m = 3007a + 5 for a. 3 Solve 5d = -4v + 1438 - 1444, -2v + 4 = -d for d. -2 Solve 28 - 22 = -h + 2l, -15 = -2h - 5l for h. 0 Solve 8q + 12 = 5c, -5q = -28c + 32c + 36 for c. -4 Solve -j = 4u + 95, -10769u + 8 = -10770u + 5j for u. -23 Solve 4q + 20 = 4y, 1729q - 1733q + 1 = 3y for y. 3 Solve -4n - 4b + 6b = 24, -5n + 4b - 33 = 0 for n. -5 Solve -2o + 3o = 3i, -7 = i + 2o for i. -1 Solve -2t - n = -28, 6t - 3n - 357 = -273 for t. 14 Solve 0d - d + 5z = -20, 5d - 3z = 12 for d. 0 Solve -2n - 15 + 26 = -3j, 5j = 5n - 30 for j. 1 Solve 4m + 3x - 7 = 0, x + 1054 = 1051 for m. 4 Solve 5i = -2d + 32, -2030i + 2027i + 4d = 12 for i. 4 Solve 3k + 12 = 3r, 2r - k - 20 = -8 for r. 8 Solve 3h - 936 + 917 = 5y, 2h = 3y + 11 for h. -2 Solve 76 - 65 = -2c - 5u, 3c = -2u - 11 for c. -3 Solve -5k + 3 = -v, -836v + 832v - 12 = 5k for v. -3 Solve 5j - 5w = 75, -15 = 56j - 53j + 2w for j. 3 Solve 7r + 2m = 6r - 15, -9r = 4m + 37 for r. -1 Solve 2g - 48 = 5z - 40, -5g + 4z + 20 = 0 for g. 4 Solve -11 = x + 5z, 684x - 3z = 687x + 9 for x. -1 Solve -a - 4f + 120 = 104, 10a + f = -35 for a. -4 Solve -275 = -2u - 5y - 255, -u + 7 = y for u. 5 Solve -127q + 123q - 2c + 24 = 0, -2c = -2q for q. 4 Solve -724m + 728m + k - 14 = 0, 3m + 4k - 17 = 0 for m. 3 Solve 4f + 864 = -s + 848, -f - 1 = s for s. 4 Solve 63p + 2d = 67p + 8, d = p + 2 for p. -2 Solve -5a + 2y + 30 = 0, 14a = y + 15 - 0 for a. 0 Solve -2t = -3c - 10, -11c - 15 = 4085t - 4088t for t. 5 Solve j - 151 = 2f - 150, f + 4j = 4 for f. 0 Solve 553z + 16 = 559z + 2j, 29 = 4z + 5j for z. 1 Solve 0 = -4x + v - 13, 2v + 1 = 3x + 17 for x. -2 Solve 4z - 8 = -56292m + 56297m, 4z = -4m + 8 for m. 0 Solve 5h = 4w - 4, 1689h = 4w + 1691h - 32 for w. 6 Solve 5f - 2k + 58 = 118, 4k = -5f + 60 for f. 12 Solve 2h - 13 = 5z, -102 = -h + 4z - 94 for h. 4 Solve -2q + a = -0a - 17, -4q - 5a + 27 = 0 for q. 8 Solve 1844o = 1849o - 4g + 16, -3g - 19 = 4o for o. -4 Solve -3a - 4k + 2 = 0, -226k = -3a - 225k + 22 for a. 6 Solve 4d = -44b + 43b + 8, -2d + 2b - 6 = 0 for d. 1 Solve -b = -2, -5c + 108b + 108b + 80 = 221b for c. 14 Solve 11 = q + 5u - 14, 3q = 5u - 5 for q. 5 Solve -3p - 838s = -834s + 11, 0 = 3p - s - 14 for p. 3 Solve b - r - 4 = 0, -r = -172 + 171 for b. 5 Solve -48 = -12q - 4h, -q - 4h + 1816 = 1823 for q. 5 Solve -1702x - 17 = -1703x + 3s, 0 = -x + 4s + 22 for x. 2 Solve 2j + 2 = -5t, -109t + 5 = -5j - 110t for j. -1 Solve -3r + 15 = -3z, -55949r = -55951r - 4z - 26 for r. -1 Solve 4d - 3i + 12 = 0, -29 = d + 248i - 252i for d. 3 Solve -4f = o - 12, 6o + 155 = -f + 135 for o. -4 Solve -1760 = 4y + 4t - 1816, -5y - 110 = -5t for y. -4 Solve f - 2c = -8, 0 = -2f + 42c - 46c + 16 for f. 0 Solve 67f + 556 = 331z - 327z, f - z + 13 = 0 for f. -8 Solve -2i + 6c + 2428 = 2438, -27 = 3i + 3c for i. -8 Solve 357 = 2x + f + 348, 0 = 2x + 4f - 24 for x. 2 Solve -3l + 23 = -11c, -711l - 5c = -710l + 1 for l. 4 Solve 4j = v, -2j = -5v + 2j - 16 for v. -4 Solve -o - 2221q + 2 = -2222q, 18 = -3q for o. -4 Solve -5w - 34 = 6c, 620w - 2c = 618w + 4 for w. -2 Solve 1057x - 1059x = 5s - 18, 5x + 21 = 4s for x. -1 Solve -2u - 354 + 290 = 4c, 0 = 3c + 3u + 51 for c. -15 Solve 95o = 97o - 3d + 38, -3d = -30 for o. -4 Solve -2a + 8 = d - a, -4d + 21 = 3a for d. -3 Solve -122x + 123x - 39 = 4f, -4x + 5f = -74 + 17 for x. 3 Solve 3d + 18 = -22i + 23i, -d = 2i - 1 for i. 3 Solve -5s - 1061 = 2r - 1116, 5r + 11 = 4s for s. 9 Solve 27 = 3l + 3p, 11l + 21 = 15l + p for l. 4 Solve -45 = -5r, 0 = -161p + 158p - 2r + 24 for p. 2 Solve 4p + u = 31 - 28, -2 - 26 = -4u for p. -1 Solve -2o = -4m - 60, -5o - 75 = -195m + 200m for o. 0 Solve -4h - 2b = 24, -5439h + 5438h = -17b - 309 for h. 3 Solve -9k - 46 = -n, 34n + 6 = -k + 35n for k. -5 Solve -2f - 46 = -2w - 3w, 15w - 3w = 3f + 114 for w. 10 Solve 0 = 5c - 4w, 3c - 109w - 22 = -111w for c. 4 Solve -35 + 36 = 3x + a, 3a = 2x - 19 for x. 2 Solve -26 = 3f - 5a, -5f + 91a = 90a + 14 for f. -2 Solve 0 = 3s, -5f + 310s = 305s + 20 for f. -4 Solve 4k = 4v, -5k - 53 = -3v - 51 for k. -1 Solve z - 4m - 84 + 102 = 0, 0 = -3z - 2m - 26 for z. -10 Solve 5a - 6 = -4b, -95b + 101b = -2a - 2 for b. -1 Solve 0 = -4m + 9m + 5, 4b + 19 = -3m for b. -4 Solve 4 = -107r + 105r, -24 = -5d - 3r for d. 6 Solve -15 = p + 2m, -1054p + 1052p = -2m for p. -5 Solve -148n - 22 = -3v - 153n, 4n = 4v - 40 for v. 9 Solve -14h - 16 = -15h + 2r, 3h - 64 = 8r for h. 0 Solve -4z + 3z + 6 = 2f, 0 = 5z - 4f + 12 for z. 0 Solve -2z + 15 = 3y, -2z + y + 119 = 124 for z. 0 Solve 0 = 43j - 42j - 4p + 5, 3j - 1 = -4*p for j. -1 Solve 30	{ "pile_set_name": "DM Mathematics" }
= r. Let m(s) = 6k(s) + p(s). Let t(x) = 8x*2. Let q(l) = 3l*2. Let d(w) = 14q(w) - 5t(w). Determine m(d(o)). -4o2 Let o(r) be the first derivative of -r2 - 7r - 4. Let l(q) = -q2. Calculate l(o(b)). -4b*2 - 28b - 49 Let p(i) = -1. Let r(w) = 2w - 12. Let d(z) = -12p(z) + r(z). Let h(k) = k + 1. Let s(o) = -3o - 2. Let y(c) = 6h(c) + 3s(c). Calculate y(d(u)). -6u Let b(s) = -7s - 6s + 14s + 0s. Let z(w) = -2w - 3w + 6w. Determine b(z(o)). o Let l(x) = 12x. Let u(p) = 7p2. Give u(l(r)). 1008r*2 Let v = 4 + -3. Let z(l) = v - 1 + 4l*2 - 3l*2. Let j(g) = -3g + 6. Let c(y) = 1. Let u(i) = 6c(i) - j(i). Calculate u(z(s)). 3s*2 Let v(n) = 4n*2 + 2n + 2. Let b be v(-2). Let a(u) = 2 - 2 - bu + 9u. Let x(l) = 2l. Give x(a(w)). -10w Let j(u) = 966u2. Let v(i) = 4i. Give j(v(h)). 15456h2 Let h(i) = i2. Let t(q) = 50q*2. Calculate h(t(u)). 2500u*4 Let j(v) = -2v*2. Let k(p) = 15p*2 - 23 - 3p*2 + 23. Give j(k(m)). -288m*4 Suppose 2 = -4l - 2, 0 = -3c - 3l + 12. Let o(a) = 2a - a - ca + a. Let p(v) = 2v. Determine p(o(r)). -6r Let y = 88 + -36. Let u(r) = -2r2 - yr + 52r. Let b(s) = 2s*2. Calculate b(u(l)). 8l*4 Let k(d) = 2d*2 + 21d - 21d. Let m(p) = 8p. What is m(k(w))? 16w2 Let b(o) = 2o + 5. Let z(g) = -g - 3. Let n(d) = 6b(d) + 10z(d). Let v = -4 + 8. Let t(c) = -4c + vc - 2c + c. Determine t(n(r)). -2r Let s(z) be the first derivative of 4z3/3 - 23. Let q(g) = g2. Give q(s(o)). 16o*4 Let z(o) = 4o + 3. Let a(k) = -k - 1. Let q(w) = -3a(w) - z(w). Let t(b) = 5b. Determine q(t(n)). -5n Let m(f) = f2 - 5f - 2. Let y be m(7). Suppose 5v - q - 3 = 6v, -y = -v + 2q. Let i(o) = -o - vo + 2o. Let z(t) = -t. Give z(i(u)). u Let c(r) = 29r. Let y(o) = 11o2. Give y(c(g)). 9251g2 Let l(k) = -k2 - 6k + 10. Let t be l(-7). Suppose 9 = -4b - t, 0 = -4v - b + 9. Let i(j) = 2 - vj*2 - 2. Let o(u) = 2u. Calculate i(o(x)). -12x2 Let h(c) = -c2. Let b(f) = -f2 - 4f + 2. Let k be b(-6). Let r be ((-6)/(-15))/((-2)/k). Let i(j) = 0j - rj + 0j. Determine i(h(y)). 2y2 Let x(b) = -b2. Let f(p) = -6p + 7 + 0 - 4 - 8. What is x(f(q))? -36q*2 - 60q - 25 Let m(r) = r3 - r2 - r + 9. Let k be m(0). Suppose -2i = -3 - 9. Let v(t) = it - kt - t. Let g(d) = -2d. Determine g(v(s)). 8s Let d(y) = -15y. Let q(c) = 174c. Calculate q(d(o)). -2610o Let c(a) = -2a2 + 6a*2 + 5a*2. Let y(i) = -16i + 11. Let t(p) = -3p + 2. Let k(d) = 11t(d) - 2y(d). Determine c(k(q)). 9q*2 Let q(r) = -29r. Let v(b) = 9b - 5b - 2b. Determine v(q(i)). -58i Let w(j) = 2j2 + 2j*2 - 3j*2. Suppose -3a = -3b - 8a + 6, -3b - 3a + 6 = 0. Let k(m) = 2m - mb - 2m. Give k(w(s)). -s*4 Let d(f) = -2f*2 - 3f + 3. Let t(q) = 3q2 + 5q - 5. Suppose -2o + 50 = -7o. Let u(p) = od(p) - 6t(p). Let h(x) = x*2. Give h(u(m)). 4m*4 Suppose 4u - 2l + 2 - 10 = 0, 0 = -5u - 4l + 23. Let r(b) = ub - 2b - 3b. Let g(h) be the first derivative of 5h2/2 - 2. What is g(r(o))? -10o Let j(y) = -228y. Let v(a) = -4a. What is j(v(k))? 912k Let u(f) = -11f2. Let c(z) be the second derivative of z4/12 - 12z. Determine c(u(m)). 121m*4 Let x(q) = 4q*2. Let r(d) = 7855d. Give x(r(w)). 246804100w2 Let v(g) = 6. Let t(f) = -f + 14. Let u(k) = -6t(k) + 14v(k). Let y(b) be the third derivative of b4/24 + 3b*2. Give y(u(x)). 6x Let z(k) be the third derivative of 0k3 + 0k + k*2 + 1/12k*4 + 0. Let p(q) = -3q*2. Give z(p(x)). -6x*2 Let l(b) = -5b*2. Let i(a) = -8a. What is i(l(t))? 40t2 Let h(c) = -6c - 10 - 2c + 0c + 2c. Let a(s) = 2s + 3. Let t(o) = 10a(o) + 3h(o). Let u(n) = 4n2. Calculate t(u(k)). 8k*2 Let k(m) = 6m. Let f(t) = -t. Let z(v) = 3v. Suppose 3i - 3 - 15 = 2j, 3j + 5i = 11. Let l(u) = jz(u) - 7f(u). Give l(k(x)). -12x Let k(i) = -5i. Let z(f) = -14f + 285 - 285. Calculate z(k(v)). 70v Suppose 7 = 5u - 3s, 2u - 4s = -8 + 22. Let h = 1 + u. Let n(b) = -b + hb - b. Let i(f) = -f. Calculate i(n(o)). 2o Let f(t) = -t2. Suppose 2l + 3 + 0 = -5y, 5l = -3y + 40. Let p(x) = -3 + 3 + lx - 10x. What is f(p(z))? -z2 Let s(z) = 2z2. Let y(i) be the first derivative of -i4/4 - 2i + 1. Let b(j) be the first derivative of y(j). What is b(s(h))? -12h*4 Suppose -4a + 0 = -4r - 24, -5a - 3r = 2. Let k(s) = -s + 1 + 1 - a. Let l(t) = t. Give k(l(v)). -v Let m(g) be the first derivative of 0 - g2 + 2 - 3. Let d(i) = 6i + 5. Let c(y) = 9y + 8. Let w(h) = 5c(h) - 8d(h). Give m(w(k)). 6k Let c(y) = 11y2. Let l(o) = -5o. Give l(c(q)). -55q2 Let i(s) = s. Let v(t) be the first derivative of -t3/3 - 4. What is v(i(u))? -u2 Let b(k) = -9k + 3k - 2k + 6k. Let h(y) be the first derivative of 0y + 1/2y2 + 2. Calculate h(b(q)). -2q Let r(m) = 33m2. Let d(a) = 3a. Calculate d(r(l)). 99l2 Let p(r) = -26r*2. Let b(l) = 35l*2. Give p(b(f)). -31850f*4 Let g(c) = 2c + 1 - 1. Let h(r) = -54r2 + 29r*2 + 27r*2. Give h(g(s)). 8s*2 Suppose -c - z - 2z - 9 = 0, 0 = -c - 4z - 13. Let y(k) = -3 - 4k*2 + 3 + ck*2. Let d(b) = -4b*2. Calculate y(d(v)). -16v4 Let y(n) be the first derivative of -n3/3 + 14. Let v(i) = 0 + 0 - i. Give v(y(o)). o2 Let t(w) = -w3 + 3w2 + 6w - 5. Let d be t(4). Let r(j) = 0j + 3j - 2j + dj. Let u(v) = v. Give r(u(m)). 4m Let w(l) = 2l - 8. Let h(u) = 7u2 - 2u + 1. Let z be h(1). Let s be w(z). Let a(o) = -o + so - o. Let m(g) = 3g*2. Calculate m(a(x)). 12x*2 Let h(y) = -2y. Let j(p) be the second derivative of 7p3/3 + 20p. What is j(h(k))? -28k Let b(o) = -o2. Let n(z) = -z. Let v(h) = h. Let w(u) = 30n(u) - 5v(u). What is w(b(l))? 35l*2 Let k = 4 + -4. Suppose 0 = 4p + 4y - 36, 4p - 24 = -kp - y. Let n(o) = p - 2o - 5. Let h(g) = -g*2. Determine n(h(a)). 2a*2 Let d(u) = -3u. Let y(f) = 28f2 + 23f*2 - 38f*2. Calculate y(d(w)). 117w*2 Let l(p) = 4p. Let m be (-4)/(-6)(8 - 5). Let k(b) = 3b*2 - 4 - 2b*m + 4. What is k(l(v))? 16v*2 Let t(x) = 2x. Let q(v) = -4 + 4v2 - 5 + v2. Let b(j) = j2 - 2. Let y(z) = 9b(z) - 2q(z). Determine y(t(o)). -4o2 Let d(t) = -t2. Let r(s) be the third derivative of 0s + 1/12s4 + 0 + s2 + 0s3. Give r(d(u)). -2u2 Let h(f) = -f2 + 4 - 3f - 3 + 1. Let c be h(-3). Let d(s) = s2 + 2s + 6sc - 2s. Let o(m) = 2m2. What is d(o(l))? 28l*4 Let k(x) = 4x. Suppose -1 = 3p - 7. Let i(h) = -4h*2 + 6h*p + 3h2 - h2. Give k(i(j)). 16j2 Let t(r) = r. Let w(p) be the first derivative of 0p*2 - 4/3p*3 + 3 + 0p. Give w(t(b)). -4b2 Let t(w) = -52w*2 + 3w - 2. Let r(u) = -103u2 + 5u - 3. Let c(h) = 3r(h) - 5t(h). Let x(m) = 2m. Calculate x(c(o)). -98o*2 + 2 Let b(i) = 12i*2 + i - 16. Let x(w) = 5w*2. What is b(x(l))? 300l*4 + 5l*2 - 16 Suppose 4b - 19 = 5t + 14, 4t + 5b + 51 = 0. Let d be (-1)/(12/t - -1). Let n(f) = f - df + 0f. Let u(g) = 2g*2. Give u(n(o)). 8o*2 Let p(a) = 2a - 4 + 4. Let z(d) = 2d + 0d + 2 - 2. What is p(z(c))? 4c Let s(b) = 20b + 6. Let y(h) = 5h2. What is y(s(r))? 2000r*2 + 1200r + 180 Let h(v) be the third derivative of -v*4/8 - 4v2. Let p(l) be the third derivative of l4/12 + l*2. Calculate h(p(u)). -6u Let p(i) be the second derivative of i*4/6 - 4i. Let h(x) = 6x. Determine p(h(z)). 72z*2 Let a(y) = 574y*2. Let z(k) = -4k*2. What is a(z(w))? 9184w*4 Let h(w) = 3w. Let m(j) = -j + 1. Let l(o) = -o*2 - 5o + 5. Let i(q) = l(q) - 5m(q). Determine i(h(s)). -9s*2 Let x(w) be the first derivative of -5w*4/12 - 4w - 4. Let h(i) be the first derivative of x(i). Let g(p) = p. What is g(h(l))? -5l2 Let u(z) = 88z*2. Let c(f) = -7f*2. What is c(u(v))? -54208v*4 Let i(q) = -3q. Let g(a) = -2878a. What is g(i(u))? 8634u Let j(b) = 2b. Let f(w) = -69w*2. Determine f(j(l)). -276l2 Let p(u) = -u2 - 5u + 7. Let t be p(-6). Let n(b) = -2b - t + 1. Let l(o) be the second derivative of -o*3/6 - 75o. Give n(l(a)). 2a Let t(p) = p2. Let w(r) = -r - 9. Let b be w(-11). Let c(m) = -mb + 4m*2 + 7m*2. What is c(t(g))? 10g*4 Let p(n) = 37n*2 + 2n. Let	{ "pile_set_name": "DM Mathematics" }
(sqrt(304) + 0 + sqrt(304)))*2 - ((-4sqrt(114))/sqrt(6))*2). 2299 Simplify -5((5sqrt(99)2)/(3sqrt(144)) - ((sqrt(1331) - (-3 + sqrt(1331)) - sqrt(11)) + sqrt(22)/(sqrt(6)/sqrt(3) + sqrt(2)))2). -115sqrt(11)/6 + 235/4 Simplify -5(((sqrt(605) - (1 + sqrt(605) + sqrt(605)2 - sqrt(605))) + -5(2sqrt(605))*2)-1 + -4((sqrt(605) + 2)-2 + 1)). -60565 - 495sqrt(5) Simplify -1((sqrt(648) + sqrt(648)-1)-2)/((-1sqrt(24))/sqrt(4) - -6(sqrt(54) + sqrt(6))). 0 Simplify ((sqrt(45) + (sqrt(1620)-3 - sqrt(45)))5)/(sqrt(441) + -3(sqrt(441) + 2sqrt(441))) + -4. -4 + 45sqrt(5)/28 Simplify (sqrt(847) + (sqrt(847) - (0 + sqrt(847)))-1)*2 + -2 + 5 + 5(sqrt(847) + (-4sqrt(847) - sqrt(847))1)*25. 339650 Simplify -5 + (((sqrt(8)3)/sqrt(4) - ((sqrt(8)-4)/sqrt(4) + sqrt(2))) + 0 + (4-1sqrt(22))/sqrt(11))*2. 3 Simplify 5 + (1 + 4 + sqrt(27) + 4 + sqrt(2187)-2 + 2)*2. -1122sqrt(3) + 7929 Simplify (sqrt(2299) + 5 + sqrt(2299) + -1 - (sqrt(2299)4 + 2) - -1(-3 + (sqrt(2299) + sqrt(2299)2 + sqrt(2299))-1))*2-3. -248295 - 396sqrt(19) Simplify -1((sqrt(700) - (sqrt(700) + 0))1 + -2 + (sqrt(112)6 - (6sqrt(7)2 + sqrt(7))))*22. -1702 + 88sqrt(7) Simplify (((-5(sqrt(343) + 0) - 61sqrt(343)) + -1 + -4)-1)2 + -1. 770sqrt(7) + 41527 Simplify ((-2 + 1 + sqrt(891) + 5 + 2 + -1 + sqrt(891) + sqrt(891) + -2 + -5)*2 + -1)-1. -8022 + 108sqrt(11) Simplify (0 + (4 + sqrt(180)2 - sqrt(180))6 + -1sqrt(180)1 + 2sqrt(180) + -2 + -2)*2. 1680sqrt(5) + 9220 Simplify sqrt(72) + 2 - 1sqrt(162)-5 - (sqrt(200)/(sqrt(10) + sqrt(40)))/(sqrt(80)/(sqrt(16)/sqrt(2))). 2 + 152sqrt(2)/3 Simplify ((2 + sqrt(1053) + 2 - (sqrt(1053) + sqrt(1053)-1 + 3)) + 0 + (0 + -1sqrt(1053) - (-2 + sqrt(1053)1)))*2 + -2. -54sqrt(13) + 1060 Simplify 0 + sqrt(612) + -3 + ((-1sqrt(1700))2 - (sqrt(68) + -1)2) - 56(0 + sqrt(17)3 + sqrt(17) + -2). -110sqrt(17) + 1688 Simplify (-1 + -1(-1 + 2sqrt(125))6 + -4)4. -240sqrt(5) + 4 Simplify ((sqrt(20) + 2)*2-6-6 - (0 + sqrt(320) - sqrt(180)4)*2)-1. -288sqrt(5) + 416 Simplify (sqrt(187) + (sqrt(187) - sqrt(187)-3-5) - ((sqrt(187) - sqrt(187)-34 - sqrt(187)) + sqrt(187)))/(5sqrt(891)-3). 26sqrt(17)/135 Simplify ((sqrt(187) + (sqrt(187) - (sqrt(187) - sqrt(187)1)))1 - 1sqrt(187)-3)/((-3sqrt(1331) - sqrt(1331))3). -5sqrt(17)/132 Simplify ((sqrt(204)-16 + sqrt(204) + sqrt(204))-34)/(-4-4sqrt(96)/sqrt(2)). 3sqrt(17)/2 Simplify 0 + (-1sqrt(272) + (sqrt(612)3)*2 - (-2 + 5 + -5sqrt(425))). 21sqrt(17) + 5505 Simplify -5(2 + (-1sqrt(190)5)/((sqrt(50) + sqrt(450))/sqrt(5)))12. -20 + 25sqrt(19)/2 Simplify -1 + ((sqrt(5)3 + sqrt(5) - sqrt(5))-5 + sqrt(245) + 0 - (6sqrt(245) - (sqrt(5) + -3sqrt(5)6))). -67sqrt(5) - 1 Simplify (2(-6(-3 + 0 + sqrt(684))53 + 2) + 5)2. -1185840sqrt(19) + 22463001 Simplify 1 + sqrt(14)/(-2sqrt(28)) + 1 + (4 + (sqrt(72) + (sqrt(72) - sqrt(72)1 - sqrt(72))4)/sqrt(4))2. -289sqrt(2)/4 + 180 Simplify ((sqrt(1100) + (sqrt(1100) - sqrt(1100)-2))/(61sqrt(4)))2 + (-6sqrt(121)-2)/(1(sqrt(99) - sqrt(11))). 6sqrt(11) + 1100/9 Simplify (-1(-2sqrt(490)-2)/sqrt(10))/(6-3sqrt(7) + (sqrt(847) - -2sqrt(847))). -4sqrt(7)/15 Simplify ((3sqrt(40)2 - sqrt(40))/(sqrt(10)23))/(6(sqrt(3200) + 1sqrt(3200))). sqrt(2)/576 Simplify -2((6(sqrt(475) + sqrt(475)-5) + -2)1 + -1)*2-1. 1440sqrt(19) + 547218 Simplify (sqrt(60)/sqrt(48) + (sqrt(220)/sqrt(44))2)6 + (sqrt(220)/sqrt(196))/(2sqrt(11)-3). 125sqrt(5)/42 + 30 Simplify (-1(-2-3(3 + sqrt(208)) - (sqrt(208) + -3 + sqrt(208) + -5 - sqrt(208))2))2. 1088sqrt(13) + 4484 Simplify 5 + (3(sqrt(187) - sqrt(187)1) + sqrt(187))/sqrt(11) + (3 + (-5(1 + sqrt(17)) - (-2 + sqrt(153))))2. sqrt(17) + 1093 Simplify ((-1-4(sqrt(132) + sqrt(132)1 - sqrt(132))-1)/((sqrt(36)-3)/sqrt(3) - sqrt(120)/sqrt(360)))*2. 6336/361 Simplify (0 + (5 + 2(sqrt(162) + 1) - (-1 + sqrt(162) + 5 + (sqrt(162) - (2sqrt(162) + 0 - sqrt(162))))))2 + 0. 54sqrt(2) + 171 Simplify (((6(sqrt(175) - (sqrt(175) - (sqrt(175) + 3 + sqrt(175))))6 - (0 + (sqrt(175) + 3)4)) + -5)4)*2. 990080sqrt(7) + 13079696 Simplify (0 + ((2 + sqrt(1584))-6 - sqrt(1584) - sqrt(1584)) + -2 + -4(sqrt(1584) + 3) + -5)*2. 8928sqrt(11) + 229057 Simplify -1 + -5 + 3 + 0 + sqrt(891) + (sqrt(891) + -2(sqrt(891) + 1))2 + 1 + (2sqrt(891))*2 + -4 + 2. 45sqrt(11) + 4455 Simplify (-1sqrt(3025))/(sqrt(15)/(sqrt(48) - sqrt(3))) - (-4(-1 + sqrt(180))*2 + sqrt(180) - (-6(1 + sqrt(80)))*2). 201sqrt(5) + 3640 Simplify 2 + (sqrt(104) - 13sqrt(104))/(1(sqrt(8)-3 - sqrt(8))) + -1 + 3. sqrt(13)/2 + 4 Simplify (((sqrt(36)/(sqrt(2)1) - sqrt(18))3)/((sqrt(81)1)/sqrt(9) + -5sqrt(27)/sqrt(3))-6)2. 0 Simplify ((-1sqrt(216)2-2)/((sqrt(3888) + 2sqrt(3888))/((sqrt(100)-1 - sqrt(100) - sqrt(4)) + sqrt(4))))*2. 3200/81 Simplify ((sqrt(56) - 1sqrt(56))5)/(21sqrt(8)) - (sqrt(1008) + -2(sqrt(1008) + 2)*2 - (sqrt(1008)2 + -5)*2). -156sqrt(7) + 6081 Simplify (-3(sqrt(2057) + (sqrt(2057) - 4(sqrt(2057)-4 - sqrt(2057))) + -3 + (1 + -2 + sqrt(2057) - (-1 + -1sqrt(2057))))5)2. -356400sqrt(17) + 266589225 Simplify -3(sqrt(68) - -4sqrt(68)-5)-5 + -3 + (sqrt(68) - (sqrt(68)4-2)*2) + -4. -4359 - 568sqrt(17) Simplify 4 + (4(5 + 2(5sqrt(242) + sqrt(242)) + (4(sqrt(242) + -3sqrt(242)) - sqrt(242))))2 + -3. 5280sqrt(2) + 35249 Simplify (-4 + (-1sqrt(7623))2 + -6(0 + sqrt(252))-4)6. 864sqrt(7) + 45714 Simplify (-4(4 + (sqrt(21) - 1sqrt(21))/sqrt(3)))2-4 + (sqrt(63) - sqrt(3087)3 - sqrt(567)/(sqrt(9) - sqrt(225)))2. 376799/16 Simplify (-1(4(sqrt(78)1 + sqrt(78)) - -5(-1sqrt(78) + sqrt(78)))/((sqrt(864)-2 + sqrt(864))-3) + 3)*2. -4sqrt(13)/3 + 781/81 Simplify (-5(((-4(-2 + sqrt(2057)) - (1 + sqrt(2057) + 1 + sqrt(2057))) + 3)4 + -4))2. -422400sqrt(17) + 29646400 Simplify -51(-3(-1(sqrt(162) - (sqrt(162) + -1)) + (-4 + sqrt(162) + 1 + sqrt(162) - sqrt(162))))*2-6. -19440sqrt(2) + 48060 Simplify (((sqrt(2736) + 0)-4)*2 + ((1sqrt(76) - sqrt(76))-3 - sqrt(76))/sqrt(4))4 + 3. -4sqrt(19) + 175107 Simplify (-4 + 4 + 3-2sqrt(1300) + (-1 + sqrt(1300))21)2. 160sqrt(13) + 20804 Simplify (((4-2(0 + sqrt(448)) + -5)5)2 + 1)-6 + 5 + -2. -4304553 - 96000sqrt(7) Simplify ((sqrt(34) + sqrt(68)/sqrt(2))-6)/(2sqrt(2)-3) - (4 + (2sqrt(68)-3)/(-3sqrt(12)/sqrt(3)))2. -84 - 14sqrt(17) Simplify (4-3(-2 + -1sqrt(432) + 5)-1 + -1)*2. -10080sqrt(3) + 63433 Simplify (3sqrt(209)4 - 3(sqrt(209)-2 - sqrt(209)))/((sqrt(396) + (sqrt(396) - (sqrt(396) + sqrt(396)1)))4 - (sqrt(396) - sqrt(396)3)3). 7sqrt(19)/12 Simplify ((-5(2sqrt(171) + sqrt(171)) + sqrt(171)14)/(5((sqrt(108) - sqrt(108)1)/sqrt(12) + sqrt(81)/(sqrt(36)/sqrt(4)))))2. 2299/25 Simplify (-2sqrt(637) - (-2 + sqrt(1573) - sqrt(1573) - sqrt(1573)) - (-2sqrt(91)-2 - sqrt(91))/(sqrt(7)1-4))*2. -9sqrt(13) + 1117/16 Simplify ((-3sqrt(504)2 - sqrt(504)) + sqrt(504) - 4(sqrt(504) - (sqrt(504) + sqrt(504)-1)))/(sqrt(24)/(sqrt(243) - 3sqrt(243))) + 1. 1 + 540sqrt(7) Simplify -3 + (-3(-1 + (sqrt(1375) + (sqrt(1375) - (sqrt(1375) + 1sqrt(1375)4)) + sqrt(1375))/(5(sqrt(99) + sqrt(99)1))))2. 11 + 6sqrt(5) Simplify ((-3sqrt(96) + sqrt(96))/sqrt(12) - (sqrt(32) - sqrt(192)/sqrt(6)))/((sqrt(60)/sqrt(27))/(sqrt(35)/(sqrt(14)/sqrt(2)))). -6sqrt(2) Simplify (-1 + sqrt(700) + 3 + 1 + sqrt(700))*2 + (-4 + sqrt(252)-1 + sqrt(252) - (sqrt(252)1 + 5))2. 228sqrt(7) + 3142 Simplify (-4(0 + sqrt(240)/sqrt(245) + -4 + 3sqrt(192)/sqrt(4)))*2-6. -2305536/49 + 67584sqrt(3)/7 Simplify -2 + 4(sqrt(68) + -63sqrt(68) + sqrt(68) + sqrt(68) - sqrt(68))/(sqrt(32)/(-4sqrt(8)) - sqrt(4)) + -1. -3 + 256sqrt(17)/5 Simplify 4(sqrt(3) + sqrt(432) - -1(3 + sqrt(3) + sqrt(3)) - (sqrt(192) - (sqrt(192) + -4 + sqrt(192) + -2))-6)2. -10296sqrt(3) + 19152 Simplify -5(1 + 3(-2sqrt(84)-2)/(1sqrt(108)))4. -80sqrt(7) - 20 Simplify 5 + (2sqrt(272)2 + -2 + sqrt(272) + 2 + (sqrt(272) - (-1sqrt(272) + 1)) + sqrt(272)1 + -4 + 0)2. -320sqrt(17) + 17438 Simplify 3 + 5 + (-5 + sqrt(11) + 2 + 4 + (sqrt(110) + (sqrt(110) - 4sqrt(110)) - sqrt(110))/sqrt(10) + -1)2. 52 Simplify (6(	{ "pile_set_name": "DM Mathematics" }
common factor of k and 80. 10 Let q be (8/(-8))/(1/(-26)). Let v = q + -20. What is the greatest common divisor of 48 and v? 6 Let w(h) = -h*3 - 13h*2 + 3h - 9. Let g be w(-13). Let j = g - -126. What is the highest common divisor of 26 and j? 26 Let j = 473 - -58. What is the highest common divisor of 59 and j? 59 Let d = 76 - -34. Suppose -5u = -4u - d. What is the highest common divisor of u and 22? 22 Let l(h) = -h*3 - 11h*2 - 13h + 10. Let x be l(-9). Let f be (2/(-3))/(1/(-6)). Let g be (-15)/x - f/(-7). Calculate the greatest common divisor of g and 5. 1 Suppose -5u - 3 + 23 = 0. Suppose 17n - u = 16n. Suppose 3j + 39 = 5q - 9, 3q - 2j - 28 = 0. What is the highest common factor of n and q? 4 Suppose 0 = -2c - 18 + 36. What is the highest common factor of c and 1? 1 Suppose -2h = -2y - 0y + 364, -5h - 2y = 896. Let v be ((-12)/(-10))/((-24)/h). Let d = -15 - -51. What is the highest common divisor of d and v? 9 Let x(r) = 27r - 112. Let b be x(6). Calculate the greatest common factor of 320 and b. 10 Let o be ((-92)/8)/((-13)/234). What is the highest common factor of 276 and o? 69 Suppose -2n + 873 = -1255. Calculate the greatest common factor of 14 and n. 14 Suppose -3 = -6j + 15. Suppose ji = -3i + 162. What is the greatest common factor of i and 9? 9 Let q(u) = -4u3 - 7u*2 + 13u - 2. Let t be q(-7). What is the highest common factor of t and 117? 117 Suppose 19m + 42m - 77836 = 0. What is the greatest common factor of 88 and m? 44 Let d(q) = -76q - 271. Let j be d(-4). Let m be -5(-2 + (-7)/(-5)). Suppose 0 = -mb - j + 168. What is the highest common factor of b and 30? 15 Let h(d) be the first derivative of d4/2 - 20d*3/3 + 5d*2/2 - 20d - 34. Let u be h(10). What is the greatest common factor of 6 and u? 6 Let m(r) = 2r2 + 34r - 116. Let g be m(-27). Calculate the greatest common factor of 24 and g. 8 Let d = -1458 + 2421. What is the highest common factor of d and 9? 9 Suppose 0 = 2c + 2z - 12, -7c + 3c + 22 = 5z. Calculate the highest common factor of c and 968. 8 Let n be 143 - 2 - (-5 - -2). Let l = 546 - 522. Calculate the highest common divisor of n and l. 24 Let j be (-6)/(-4)16/(-6). Let p = 14 + j. Let n = p + 13. Calculate the highest common factor of n and 253. 23 Suppose 252x - 180 = 246x. Calculate the highest common divisor of x and 282. 6 Let w be 4/14 + 5/7. Let m be 1 - (0 - 2) - (3 - 1). Let f = m + 3. What is the greatest common divisor of f and w? 1 Suppose -14j + 111 + 183 = 0. Suppose -10t - j = -121. What is the greatest common factor of t and 40? 10 Suppose 0 = -q + 1 + 19. Let a(u) = -3u - 7. Let x be a(-5). Calculate the highest common factor of q and x. 4 Let r be (-8 + 10)/(1/2). What is the greatest common divisor of r and 1? 1 Suppose -y - 34 = -o - 3o, 4o - 112 = 4y. Let j = y + 31. Suppose -2l - 5q = -20, -5 = jq + 5. Calculate the greatest common divisor of 105 and l. 15 Let m = 666 + -1194. Let a be (8/(0 + 2))/2. Let f be (a/(-4))/(8/m). What is the highest common divisor of 11 and f? 11 Suppose 4b - 3683 = -695. Suppose 5m - 203 - b = 0. Calculate the highest common divisor of m and 76. 38 Let v(s) = 74s*2 - 3s - 3. Let b = 83 + -84. Let p be v(b). Calculate the greatest common factor of p and 37. 37 Let f(a) = -a*2 + 4. Let i be f(0). Let x be (3/i)/((-3)/(-12)). Let d be 9x/(-9)-4. Calculate the greatest common factor of d and 108. 12 Let h(v) = 3v*2 + v + 10. Let k be h(3). What is the highest common factor of 5 and k? 5 Let q = 924 + -452. Calculate the greatest common divisor of 48 and q. 8 Suppose -4h - 3 + 35 = 0. Let t(q) = 2 + 9q3 + q2 - 2 - q - 2. Let b be t(2). Calculate the greatest common divisor of b and h. 8 Let d = -400 - -457. What is the highest common divisor of 684 and d? 57 Suppose -3i = -i + 2l - 74, -3i = 5l - 115. Let k be (14/i)/(1/100). Suppose 5o - 65 = -8o. What is the highest common factor of k and o? 5 Suppose 463 = 2b - 69. Calculate the greatest common divisor of 38 and b. 38 Suppose -8u + 384 = 4u. What is the greatest common divisor of 32 and u? 32 Let p = -126 - -166. Calculate the highest common factor of p and 24. 8 Suppose -10j = -13j + 30. Let u = 11 - 6. Suppose ux = 89 + 461. What is the highest common divisor of j and x? 10 Let j = 59 - 55. Suppose 0 = -5x - 6m + m + 20, -5m = -jx + 61. What is the greatest common divisor of x and 72? 9 Suppose -42i = -37i. Suppose -4a + 3y + 67 + 32 = i, -2a - 5y = -17. What is the highest common divisor of a and 7? 7 Let n be 360/4527/4. Calculate the highest common factor of 12 and n. 6 Suppose -11s + 79 + 42 = 0. Calculate the greatest common factor of s and 341. 11 Let k = 96 + 29. What is the greatest common divisor of k and 625? 125 Suppose 2x + 67 = 5p, -2p - 3x + 22 = -5x. Let i = p + -9. Let f = i - -2. Calculate the highest common divisor of 64 and f. 8 Suppose 4x - 15q + 13q = 2298, 591 = x + 5q. Calculate the greatest common divisor of x and 9. 9 Let k be (-2)/(-5)5 - 6-2. Calculate the greatest common factor of k and 42. 14 Let n(r) = -7r3 + 84r*2 - 3r + 11. Let f be n(12). Suppose -a + 2 = a. Let g = a - f. Calculate the highest common divisor of 13 and g. 13 Let k be 126/(-315) + 214/10. What is the highest common divisor of 21 and k? 21 Let l(c) = -c*3 - 6c*2 + 8c + 10. Let v be l(-7). Suppose -h - s = 2s - 40, -12 = -vs. What is the greatest common factor of 4 and h? 4 Let p(a) = -19a + 190. Let m be p(-4). Let n(l) = 5l*3 - 2l*2 + 3l. Let g be n(2). What is the greatest common factor of m and g? 38 Let b(g) = 24g3 + 4g*2 - 2g + 4. Let r be b(3). Calculate the highest common divisor of 11 and r. 11 Let j = -129 + 225. Let h = -25 + 27. Suppose -n = -hf + 19, -7n = 4f - 2n - 73. Calculate the greatest common divisor of j and f. 12 Suppose -2 = -2z + 2, -3z + 405 = 3y. What is the greatest common divisor of 76 and y? 19 Let w be 162/(-63)98/(-42). Calculate the highest common factor of 972 and w. 6 Let p = -27 - -21. Let a(r) = r*3 + 7r*2 - 5r + 4. Let t be a(p). Calculate the highest common factor of t and 10. 10 Let a(w) = -w + 3. Suppose -2x = 3x. Let d be a(x). Let i be (44/12 - d)15. What is the highest common factor of 20 and i? 10 Let x = -783 - -800. What is the greatest common factor of 799 and x? 17 Let s(y) = -y3 - 53y*2 - 102y + 28. Let g be s(-51). Calculate the greatest common divisor of 14 and g. 14 Let d = -31 - -36. Suppose dj - 50 = 2i + 20, 4i - 68 = -3j. Let s be 1/4 + (-1533)/(-12). Calculate the highest common factor of j and s. 16 Suppose -3x - 269 = -56. Let a = 190 + x. What is the highest common divisor of a and 34? 17 Let g(q) = q2 + 5q + 9. Let w be g(-4). Suppose 5m = f + 436, 4m - wm + 85 = 2f. Calculate the greatest common factor of 29 and m. 29 Let u be (3 - 3)(0 - 1). Suppose u = p - 0p - 8. Suppose 6r = -4 + 16. Calculate the greatest common factor of p and r. 2 Suppose -4q + 4x = -264 - 288, -2x - 548 = -4q. Calculate the highest common factor of 340 and q. 68 Suppose z - 2t - 8 = 0, 2t + t - 13 = -z. Let w be ((-5)/(-3))/((-10 + 12)/12). What is the greatest common factor of w and z? 10 Let q(u) = 152u + 6. Let v be q(5). Let d = v + -486. What is the highest common factor of d and 35? 35 Let h(l) = -10l - 128. Let i be h(-15). What is the highest common factor of 946 and i? 22 Let n be -6(392/30 - (-14)/(-35)). Let j = 91 + n. Calculate the highest common factor of 5 and j. 5 Let q(y) = -3y2 + 109y - 110. Let j be q(35). Let n(a) = -a3 - a2 - 2a - 5. Let k be n(-5). What is the greatest common factor of j and k? 15 Let d be (-12)/(-8) - (-1644)/8. Let z = -147 + d. Calculate the highest common factor of 10 and z. 10 Let u = -23 + 44. Suppose 4a = -g + 84, 21 = a - 9g + 12g. What is the highest common divisor of a and u? 21 Let s(q) = -q*3 - 13q*2 + 26q - 32. Let d be s(-15). Suppose -2l + 22 = -x, 3l - d = x - 2x. Calculate the greatest common factor of 10 and l. 10 Let c be (-1626)/(-4) - (-4)/8. Suppose 22u = 26u - 148. Calculate the greatest common divisor of u and c. 37 Let c be 8/3(-27)/(-4). Let u = 2838 - 2814. Calculate the greatest common factor of u	{ "pile_set_name": "DM Mathematics" }
In base 8, what is 775425 - -5? 775432 In base 11, what is 111 + 128a? 13a0 In base 8, what is 134 - -5442? 5576 In base 12, what is 5269a + 4? 526a2 In base 2, what is -1010100110011111011 + 10? -1010100110011111001 In base 4, what is -102110313 - 222? -102111201 In base 10, what is -4902905 + 0? -4902905 In base 3, what is -202112021211 + 12? -202112021122 In base 4, what is 2323 - 1211202? -1202213 In base 12, what is -753 + -680? -1213 In base 5, what is -24410301 - 0? -24410301 In base 4, what is -2233 + 200? -2033 In base 14, what is 3a + -16774? -16738 In base 2, what is 101101100001001 - -10001? 101101100011010 In base 11, what is -26 + -9090? -9106 In base 6, what is -5 - -231055? 231050 In base 6, what is -15124 - 15? -15143 In base 14, what is -4d860 - 5? -4d865 In base 7, what is 542 - -1265? 2140 In base 15, what is -5 + 14d3c? 14d37 In base 7, what is 20512 - -36? 20551 In base 4, what is -23 - -13132? 13103 In base 9, what is 177 - -5218? 5406 In base 5, what is -3 + 143032111? 143032103 In base 13, what is -55 + 593? 53b In base 5, what is 243 + 11402? 12200 In base 6, what is -1330444 + 34? -1330410 In base 2, what is -1000010011101 + -1? -1000010011110 In base 14, what is 10d + 109? 218 In base 16, what is 6 - 230a? -2304 In base 4, what is -332 - -21130? 20132 In base 3, what is 111122 - -2202012? 10020211 In base 9, what is 10 + 424134? 424144 In base 5, what is 1012113 + 3? 1012121 In base 13, what is -b05 + -565? -136a In base 7, what is 4002144 + -3? 4002141 In base 4, what is -111320212 + 2? -111320210 In base 14, what is 0 + -31bda? -31bda In base 4, what is 2 - -123022? 123030 In base 14, what is -a8 - -109? 41 In base 13, what is 311 - 2a? 2b4 In base 7, what is -411331 - -2? -411326 In base 14, what is 114 - 4d? a5 In base 13, what is abb1 - -7? abb8 In base 2, what is 10000100101100100011 - 1? 10000100101100100010 In base 14, what is 127d + 37? 12b6 In base 15, what is -2 + -16de0? -16de2 In base 14, what is 1977b + -8? 19773 In base 11, what is 6760a2 - 5? 676098 In base 4, what is -3 - -330021103? 330021100 In base 9, what is -34172 + 3? -34168 In base 12, what is 1596 - 12? 1584 In base 2, what is 1010 + 1010001011000010? 1010001011001100 In base 5, what is 141 - 110412? -110221 In base 6, what is -32 + -30431? -30503 In base 15, what is 5 - 178b? -1786 In base 2, what is -1 - -1110101100110011? 1110101100110010 In base 6, what is 1 - -1403224? 1403225 In base 12, what is 0 - 125581? -125581 In base 8, what is -5552556 - -1? -5552555 In base 2, what is 110 - 10101100000010111010? -10101100000010110100 In base 14, what is -3b - -c9? 8c In base 4, what is -113 + -2220023? -2220202 In base 4, what is -1321013 + -11? -1321030 In base 15, what is -3a8e + 5? -3a89 In base 6, what is 43250 + -3130? 40120 In base 11, what is -92a - -35? -8a5 In base 4, what is -1001200233 + -10? -1001200303 In base 9, what is 51257 - 54? 51203 In base 3, what is 10 - -20002121? 20002201 In base 12, what is -183 - 226? -3a9 In base 16, what is 5 + -69f4? -69ef In base 8, what is -1253600 + 6? -1253572 In base 5, what is 220442 - -11? 221003 In base 14, what is 2b - 371? -344 In base 6, what is 21204 + 1301? 22505 In base 9, what is -36 + -2811? -2847 In base 4, what is 122110203 + 11? 122110220 In base 6, what is 5 - 203400? -203351 In base 9, what is 182 - -17? 210 In base 7, what is -2 - -46342? 46340 In base 13, what is -128c - 245? -1504 In base 2, what is 111011110010 + -100? 111011101110 In base 15, what is -7 - -69aa7? 69aa0 In base 16, what is 29bcd3 - 5? 29bcce In base 14, what is 4 + 6d159? 6d15d In base 5, what is -301313 - 32? -301400 In base 16, what is -9 - 5c9? -5d2 In base 12, what is 41 + 155? 196 In base 15, what is -4 + -4620? -4624 In base 2, what is -11111 - -100011001110010111? 100011001101111000 In base 12, what is 41a8 + 0? 41a8 In base 13, what is -8054 - -13? -8041 In base 11, what is 22a - 3024? -28a5 In base 15, what is 7e + 95? 124 In base 11, what is 10 - -21369? 21379 In base 2, what is -10001000001011111010 + -100? -10001000001011111110 In base 10, what is -11927 + -374? -12301 In base 5, what is 13442020 + 3? 13442023 In base 4, what is 11 - -3313323? 3320000 In base 9, what is 1622 + -340? 1272 In base 6, what is -1252233 + -102? -1252335 In base 13, what is -1 - -3897? 3896 In base 16, what is 2 - 3a166? -3a164 In base 9, what is 28764 - 2? 28762 In base 8, what is 1 + 465035? 465036 In base 14, what is -20 + 330? 310 In base 2, what is -100011111 + 100010? -11111101 In base 5, what is 323400 + 34? 323434 In base 3, what is -1220002 + -2? -1220011 In base 4, what is -312003 - 102? -312111 In base 16, what is -61 - d3c? -d9d In base 10, what is 124 - 24? 100 In base 15, what is -16e - -1ed? 7e In base 10, what is 535 + -1995? -1460 In base 12, what is a7 - 599? -4b2 In base 9, what is 2 - -1104360? 1104362 In base 5, what is -40322401 + -4? -40322410 In base 14, what is -1c + -3aa? -3c8 In base 4, what is 131 + -3320? -3123 In base 2, what is -1101 - 101111101011001? -101111101100110 In base 10, what is -2 + -217843? -217845 In base 12, what is -1859 - -1? -1858 In base 15, what is 7 - -eeb? 1003 In base 11, what is 1568 + -7? 1561 In base 15, what is 2 + 45d1? 45d3 In base 10, what is -3 - -137681? 137678 In base 9, what is -43 - 83? -136 In base 6, what is -152340 - -4? -152332 In base 2, what is -111010110101010 + -100? -111010110101110 In base 6, what is 13 + 324323? 324340 In base 13, what is -13 - 1959? -196c In base 10, what is 11977 - 62? 11915 In base 2, what is -100101110111001 + -1011? -100101111000100 In base 6, what is -231002 + 445? -230113 In base 14, what is 13b - -adc? c39 In base 15, what is c + 88d? 89a In base 2, what is 10011001 - -11010001? 101101010 In base 11, what is -15 - 3aa? -414 In base 8, what is 5 + -116234? -116227 In base 11, what is 7 + -9a9? -9a2 In base 10, what is -5 - -2474? 2469 In base 7, what is 355 + 4300? 4655 In base 6, what is 1031503 - 140? 1031323 In base 13, what is a254 - 20? a234 In base 2, what is -100 + 11000010111000? 11000010110100 In base 12, what is 674 - 3? 671 In base 9, what is -372 - 572? -1054 In base 10, what is 892 - -23? 915 In base 5, what is -1 - 1024230? -1024231 In base 10, what is 108 - -112? 220 In base 7, what is -201226 + 11? -201215 In base 4, what is 13001 - -33332? 112333 In base 8, what is -4222 + -32? -4254 In base 6, what is -224 + 1155? 531 In base 4, what is -322031 + -12? -322103 In base 9, what is -51688 - 4? -51703 In base 2, what is 101001 + 1000111110011? 1001000011100 In base 3, what is 2 - 1111222102101? -1111222102022 In base 13, what is -67 - -41? -26 In base 16, what is 2a229 + -5? 2a224 In base 4, what is -221 - -23112? 22231 In base 10, what is -3 + -144791? -144794 In base 10, what is -2 + -9955? -9957 In base 16, what is 2375 + -9c? 22d9 In base 10, what is -1 - -81748? 81747 In base 12, what is -4 - 4695? -4699 In base 9, what is -4 - 1417827? -1417832 In base 6, what is 4003 - 141? 3422 In base 3, what is -21210101111201 - -12? -21210101111112 In base 16, what is -168e6a - -2? -168e68 In base 12, what is -25 + 23593? 2356a In base 12, what is -32 - -3b21? 3aab In base 6, what is 123 - -125245? 125412 In base 2, what is -111110010 + 101111101? -1110101 In base 3, what is 100212 + 212211? 1020200 In base 15, what is -de0 + 3? -ddc In base 10, what is -2 - 4749? -4751 In base 10, what is -7 + -4166? -4173 In base 3, what is -201200121 + 111? -201200010 In base 10, what is -2890 + 174? -2716 In base 10, what is 6725 - 177? 6548 In base 15, what is ab73a - -3? ab73d In base 9, what is -26 + -15572? -15608 In base 16, what is -a00d + 9? -a004 In base 12, what is -8a8b + -a8? -8b77 In base 9, what is 83 - -536? 630 In base 16, what is 3 + -17a4af? -17a4ac In base 7, what is 121 - -3253? 3404 In base 5, what is 1 - 41203400? -41203344 In base 14, what is 1c - 6b? -4d In base 10, what is 1 - -257402? 257403 In base 5, what is -4141 - 100? -4241 In base 9, what is -65 + -16? -82 In base 11, what is 5 - -39881? 39886 In base 9, what is 130 + 355? 485 In base 12, what is 5a - -72? 110 In base 6, what is -23 + -1005? -1032 In base 3, what is 21212221120 + 11? 21212221201 In base 11, what is 113364 - 4? 113360 In base	{ "pile_set_name": "DM Mathematics" }
2)). -6sqrt(19) Simplify (2 + (-6sqrt(114)-1)/sqrt(216))2. 4sqrt(19) + 23 Simplify -3 + (3 + (5sqrt(45) - (-2sqrt(25))/sqrt(5)))*2. 102sqrt(5) + 1451 Simplify 2 + (4sqrt(256)-2)/sqrt(8) + 1. -32sqrt(2) + 3 Simplify 5((sqrt(612) + 2 + sqrt(612))*2 + 1) + -1. 240sqrt(17) + 12264 Simplify ((sqrt(600)/(sqrt(10)2))/sqrt(6))/((4sqrt(1800))/sqrt(10)). sqrt(2)/48 Simplify ((sqrt(15) + sqrt(165)/sqrt(275))/(sqrt(6)/sqrt(2)-5) + -1)2-6. -966/125 - 72sqrt(5)/25 Simplify sqrt(1900) - ((sqrt(1900) + (sqrt(1900)-4 - sqrt(1900)) - sqrt(1900))*2 + -4) - (1 + sqrt(1900))2. -47498 - 10sqrt(19) Simplify (6(2sqrt(121) - sqrt(121)) + 1-1sqrt(121))/((sqrt(88) - (sqrt(88) + sqrt(88) + (sqrt(88) - 42sqrt(88)) + sqrt(88)))/sqrt(8)). sqrt(11) Simplify ((sqrt(176) + -1 - sqrt(176))-2 + sqrt(176) + (sqrt(176) - (0 + sqrt(176))) + 3)*22 + -2 + 0. 80sqrt(11) + 400 Simplify (0 + 6(0 + -62sqrt(75)))*22. 777600 Simplify (5(sqrt(204) + -2sqrt(204)))/(sqrt(1728)-2). 5sqrt(17)/24 Simplify (sqrt(66) + 6sqrt(66)-1)/(44sqrt(6)). -5sqrt(11)/16 Simplify (sqrt(175) + 3sqrt(175) + 1 + 4)*2 - (3 + (sqrt(175) - -3(-2 + sqrt(175)))). 180sqrt(7) + 2828 Simplify 2 + ((0 + sqrt(2))1 + sqrt(32)4 + (sqrt(10) + -2-2sqrt(10))/sqrt(5))2. 970 Simplify (sqrt(35) - 2sqrt(3500) - sqrt(35)-2-1)/(sqrt(42)/(sqrt(18)/sqrt(3)) - (sqrt(28)6 - sqrt(7))). 21sqrt(5)/10 Simplify (sqrt(19) + (sqrt(19) + (3sqrt(95))/sqrt(5))2)6 + (sqrt(19) - (sqrt(19) + 1 + 0 - sqrt(19) - sqrt(19)) - (-3 + 1sqrt(19)))2. 10sqrt(19) + 1847 Simplify (3 + 5 + -2 + (sqrt(448) - (1 + sqrt(448) + sqrt(448) + -1)) + 4)*2. -160sqrt(7) + 548 Simplify (((1sqrt(1331) + 2)1 + 1)1)2. 66sqrt(11) + 1340 Simplify -1 + 2(sqrt(19)-4)*2 + (sqrt(152) - 3(sqrt(152)4 + sqrt(152) + sqrt(152)))/sqrt(8). -17sqrt(19) + 607 Simplify -2 + -2(((sqrt(75))23 - (sqrt(27))*2-3) + 0). -614 Simplify -5 + -5(5 + (sqrt(720) + (0 + sqrt(720))6)*2). -176430 Simplify 65((sqrt(320) + -1 + sqrt(320))2 + 5)3 + -3. -2880sqrt(5) + 115737 Simplify ((-4(sqrt(88) - (sqrt(88) - (sqrt(88) + -1sqrt(88)-1 + sqrt(88)) - sqrt(88))))/(sqrt(24)/((sqrt(108)/sqrt(4))/sqrt(9))))*2. 2816 Simplify (4 + (1sqrt(700) + 2 - ((sqrt(700) - (sqrt(700) + 1 + sqrt(700) + sqrt(700) + sqrt(700)) - sqrt(700)) + -5))5)5. 220 + 1250sqrt(7) Simplify (-13(sqrt(27) - sqrt(108)/(sqrt(8)/sqrt(2)))/((sqrt(9) - (sqrt(9) + sqrt(9)4))-1))2. 0 Simplify sqrt(176) + (sqrt(176)1 - sqrt(176)) + (-3 + sqrt(1100))*2 + sqrt(44) + -4. -54sqrt(11) + 1105 Simplify (sqrt(120)/(6sqrt(4)-1))/(-4sqrt(160) - (sqrt(10) - sqrt(160)-3)). sqrt(3)/174 Simplify ((sqrt(1008) - (4 + 2sqrt(1008)) - sqrt(1008)-25 - ((-1sqrt(1008) - sqrt(1008)) + -2 + -4))-2)2. 2112sqrt(7) + 487888 Simplify (-3 + (sqrt(1088) - -2sqrt(1088)-3) + sqrt(1088) + (0 + sqrt(1088))5)2 + 2. -48sqrt(17) + 1099 Simplify (sqrt(275)1 - sqrt(275) - sqrt(275))2 + -1 + (3sqrt(275)-2)2 + 5. 10179 Simplify -4(13(sqrt(475) + 2))*2-6 + 0. 4320sqrt(19) + 103464 Simplify (5(sqrt(208)2 + sqrt(208))-6 + 4 + ((2 + sqrt(208))-6 - sqrt(208)))2. 6208sqrt(13) + 1957136 Simplify -2((-2 + sqrt(1053)-2-4)2 + 5). -134802 + 576sqrt(13) Simplify 4 + -6(sqrt(1872) + (sqrt(1872) - (2 + (sqrt(1872) - (sqrt(1872) - sqrt(1872)-1)))) - sqrt(1872))2 + -4. -288sqrt(13) + 24 Simplify ((sqrt(6) + sqrt(12)/(sqrt(8)/sqrt(4)) - (1sqrt(30))/sqrt(5))/((sqrt(336)5)/sqrt(7))-5)2. 1/8 Simplify (sqrt(12)/sqrt(4)-3)*2 + (sqrt(30)1)/sqrt(10) - (3 + sqrt(27) - (sqrt(3) + (sqrt(3) - sqrt(192)))). -8sqrt(3) + 24 Simplify (-1sqrt(76)6 + sqrt(76)1-6 - (4 + -1sqrt(76))-6)2. -1728sqrt(19) + 25200 Simplify -533sqrt(39)/sqrt(3) + 5. -45sqrt(13) + 5 Simplify (-1sqrt(117)5 + (sqrt(65)-2-2)/sqrt(5))*2-2. -3146 Simplify (4sqrt(96))/(sqrt(363)4). 4sqrt(2)/11 Simplify (1 + sqrt(208) + (-1sqrt(208)1 - sqrt(208)) - (-3 + -4(sqrt(117) + -1)))*2. 832 Simplify -43sqrt(14)/sqrt(2) - sqrt(14)/(-1sqrt(72)). -71sqrt(7)/6 Simplify (2sqrt(144)3 - sqrt(144))/(sqrt(72)/(sqrt(900)-1)). -150sqrt(2) Simplify ((-2sqrt(152) - sqrt(152))-6)/sqrt(8) - (-1 + (-2 + sqrt(19) + 0)2). -22 + 22sqrt(19) Simplify -5 + (-41sqrt(432) + sqrt(432) - (sqrt(432) + (sqrt(432) - (sqrt(432) - (-1 + (sqrt(432) + 0)*2))))) + -3 + -2. -441 - 48sqrt(3) Simplify (sqrt(228)-2)/sqrt(12) + 4 - (1 + sqrt(475) + -2)2. -472 + 8sqrt(19) Simplify (2 + sqrt(80) - (sqrt(55)1)/sqrt(11)) + 2. 4 + 3sqrt(5) Simplify 3(sqrt(117) - (sqrt(117) - sqrt(117)-1-3 - sqrt(117)))/((sqrt(90)-4)/sqrt(10) - sqrt(9)). -12sqrt(13)/5 Simplify (4 + (sqrt(2448) + (sqrt(2448) + 0)-2)2 + -1)2. -144sqrt(17) + 9801 Simplify -2(0 + sqrt(17) + sqrt(17)3 + -5 + 2sqrt(17)-1). -4sqrt(17) + 10 Simplify 5 + -2 + ((-5(sqrt(171) - sqrt(171)1))/(sqrt(27)/sqrt(12)))2. 3 Simplify (5 + ((1 + sqrt(704) + sqrt(704))46)2)-6. -9735582 - 110592sqrt(11) Simplify -6(sqrt(21)-2)/sqrt(7) + sqrt(30)/(sqrt(360)/sqrt(9)). 25sqrt(3)/2 Simplify (4(5 + sqrt(180)-2 + -3))*2. -768sqrt(5) + 11584 Simplify (sqrt(187)/(sqrt(11) - sqrt(55)/sqrt(5) - sqrt(11)) + 5 + sqrt(102)/((sqrt(216) + -2sqrt(216) - sqrt(216)) + sqrt(216)) + -2)2. -7sqrt(17) + 1157/36 Simplify ((2 + sqrt(3))-5 - (1 + sqrt(48)))-4. 44 + 36sqrt(3) Simplify (sqrt(68) + 5(sqrt(68) + sqrt(68)-2) - 2sqrt(68)-1)/(6(sqrt(100)2 + sqrt(100))). -sqrt(17)/45 Simplify 4(2sqrt(32)-6 + sqrt(64)/sqrt(2) + 4)1. -176sqrt(2) + 16 Simplify 1((sqrt(60)/sqrt(2))/sqrt(6) + -1sqrt(10)/sqrt(2))-3 + 5. 5 Simplify -4((4sqrt(7623)4)*2 + sqrt(7623) + sqrt(7623) + ((sqrt(7623) + 3)-1 + sqrt(7623))*2 + sqrt(7623)). -7805988 - 396sqrt(7) Simplify (sqrt(9072)1 + sqrt(63) + 2sqrt(252)/sqrt(4))/(4(sqrt(441) + (sqrt(441) - (sqrt(441) + (sqrt(441) + sqrt(441) + -2sqrt(441) - sqrt(441)))))). 15sqrt(7)/56 Simplify (sqrt(2299)-2 + 2)-3 - (-2 + sqrt(2299)-1 + sqrt(2299) + sqrt(2299) + sqrt(2299) + 4 + (1sqrt(2299))2). -2307 + 44sqrt(19) Simplify sqrt(1053) + (5(sqrt(1053) + 2) - sqrt(1053)) + -5(-2 + sqrt(1053)) + 0. 20 Simplify (sqrt(50) - (sqrt(50) + sqrt(100)/sqrt(2)-3))/(21sqrt(10) + sqrt(10))-2. -2sqrt(5) Simplify (sqrt(35)/sqrt(7))2-1-6 + 5(sqrt(5) - sqrt(180)). -25sqrt(5) + 30 Simplify (sqrt(972)4 + sqrt(27))/sqrt(9) - (5 + sqrt(6)/sqrt(2) + -1). -4 + 24sqrt(3) Simplify 4 + (sqrt(704)-2 + sqrt(22)/sqrt(8) - (1 + 1sqrt(99)))2. 37sqrt(11) + 15079/4 Simplify (sqrt(245)/(4sqrt(7)))/((sqrt(50) - (-2sqrt(50) + sqrt(50)))/sqrt(10))-6. -3sqrt(7)/4 Simplify -3((0 + sqrt(2592))1 + 0). -108sqrt(2) Simplify ((-2 + sqrt(176))4 + -4 + -3 + 5 + -3sqrt(11)1 + sqrt(11))*2. -280sqrt(11) + 2256 Simplify (((0 + sqrt(1088))5 + -5)2 + 5)-52. -272300 + 4000sqrt(17) Simplify (-3sqrt(24)3)/sqrt(12) + (-2sqrt(2)-4 - (sqrt(12)-1)/sqrt(6)). 0 Simplify -1 + 1sqrt(1216) + (1sqrt(76)/sqrt(4) + sqrt(19))2 + 5. 8sqrt(19) + 80 Simplify (-4 + sqrt(36)/sqrt(3) + -2)*2 + (sqrt(432)/(sqrt(18)/sqrt(2)))/sqrt(4). -22sqrt(3) + 48 Simplify 5 + ((sqrt(98) + -1)6 - (sqrt(98) - (sqrt(98) + -4 + -5))). -10 + 42sqrt(2) Simplify ((sqrt(637) + (sqrt(637) - -3sqrt(637)))-6)*2 - (sqrt(13) + 2 + -4 - sqrt(208)2). 7sqrt(13) + 573302 Simplify (3((-1 + sqrt(832))4 + sqrt(832)2-2))2. 144 Simplify (-6sqrt(272)-2)2 + ((sqrt(612) + 0)-4)*2 + -4. 48956 Simplify ((sqrt(220)/sqrt(99) - sqrt(140)/(-2sqrt(7)))/((sqrt(192)/sqrt(4))/sqrt(3)))2. 125/144 Simplify ((sqrt(1700) + 2 + 4)2 + (sqrt(1700) + -2sqrt(1700))2 + -5)2-6. -41172 - 1440sqrt(17) Simplify 3(-5 + -2(1sqrt(78)-1)/((sqrt(6) + sqrt(54))6)). -15 + sqrt(13)/4 Simplify (-3(-4 + 61sqrt(405) + (sqrt(405)-1 - sqrt(405))-1))*2. -5184sqrt(5) + 233424 Simplify (((-6(3sqrt(832) - sqrt(832)) - (sqrt(832) - (-1 + sqrt(832))-5)) + -4)1)*2. -288sqrt(13) + 269569 Simplify -4 + ((sqrt(1088) - sqrt(1088)-1-2) + -4(sqrt(1088) - (0 + sqrt(1088))))2 + 5. 1089 Simplify (((sqrt(99) - 2-1sqrt(99))/sqrt(3))/((sqrt(81)/(sqrt(6)/sqrt(2)))/sqrt(9)))2. 99 Simplify (sqrt(55) - (sqrt(55) + sqrt(165)/(sqrt(12)/sqrt(4))))/(sqrt(77)/sqrt(448)). -8sqrt(5) Simplify (sqrt(121) - -5sqrt(121)-1)/(-5*sqrt(66)/sqrt(6)) + -4 + 0. -4 + 4	{ "pile_set_name": "DM Mathematics" }
is greater: -5 or x? -5 Let o = 44 - 44. Is o at most -2? False Let y = -2 + -3. Let t be ((-2)/(-1))/(10/y). Is 4/9 smaller than t? False Let q = -5 - 1. Let w = q - -6.1. Is 0.1 greater than or equal to w? True Suppose -3j = -j + 16. Which is bigger: -7 or j? -7 Let f be (4/(-10))/(4/(-20)). Suppose 6 = 2y + fg, -g = 7y - 2y - 19. Suppose 6h - 4w = 5h - 13, yh - 5w + 8 = 0. Is 3 <= h? True Let d be 10/35 - (-4)/(-14). Let i be (2 - (-2 - -2)) + d. Suppose -iy = 3y - 15. Which is greater: 3/2 or y? y Let a = -20 + 3. Let m = 17.1 + a. Is 5 > m? True Let r = 30 - 31. Is r >= -4/45? False Let z = 72/7 + -213/35. Let j(t) = 2t + 1. Let b be j(2). Do z and b have the same value? False Let p = -27 - -79/3. Which is smaller: 4 or p? p Let z = 27 - 42. Which is smaller: -14 or z? z Suppose 4a - 4q - 8 = 0, 0 = 4a - 4q + 5q + 2. Let m = 1/288 + -5191/2016. Let t = 16/7 + m. Which is greater: a or t? a Suppose 3m - n + 6 = 0, -2m - 3m - n = 10. Is 4 at least m? True Let v = -27 - -23. Which is smaller: v or -6? -6 Let q(t) = t3 + 4t*2 - t - 2. Let b be q(-4). Which is smaller: b or 0? 0 Let w = 121/26 + -9/2. Let n = -1.04 + 0.04. Which is smaller: w or n? n Let g(m) = -10m*2 + m - 1. Let f be g(1). Is -10 != f? False Let m = 0.5 - 0.2. Suppose -5f = -2f - 3. Which is smaller: m or f? m Suppose 120 = -6l + 10l. Does l = 29? False Let a(o) = -o3 + 5o*2 + 3o - 3. Let c be a(5). Let i = c - 9. Suppose 0 = 4b - 7m + im + 4, -2m + 2 = -b. Which is smaller: b or -1? -1 Let d be (-446)/(-40) - (-7 + (-224)/(-35)). Which is greater: d or 11? d Let w be 0/(-12) - 1/(-1). Is w smaller than -1/31? False Suppose 3v - 1 - 83 = 0. Let x = -18 + v. Is 9 greater than x? False Suppose 8g + 45 = 3g + 5c, 4g + 38 = 2c. Let j = -6 - g. Suppose -6q + 3q + 5x = 0, jq = -4x. Is q < 0? False Let r = -6.3 + 5. Let s = -1 - r. Let y = 0.3 + -0.1. Is y less than s? True Suppose -3q = -6q - 9. Let k(h) = -h + 1. Let z be k(q). Suppose -3 = v - z. Is 2/9 < v? True Suppose 0x = 2x + 2. Let g(b) = -b - 8. Let m = -4 + -1. Let v be g(m). Is v not equal to x? True Let x be -1 - (1 - (-8)/(-2)). Let k be (-3 - -1)6/(-4). Is x bigger than k? False Let j = 2 - 0. Suppose -2i = t - 4, -ji - 4t + 11 = 1. Which is smaller: -1/7 or i? -1/7 Let n be 1/(-5) + (-294)/30. Is n >= -10? True Suppose -4a = -0a - 16. Let k = 812/3 - 266. Which is bigger: k or a? k Suppose -5c - 438 - 242 = 0. Let h be (-78)/4c/36. Let w = -73 + h. Does w = 2/5? False Suppose -12 = -2y + 2l - 4, -l - 3 = -2y. Is -20 bigger than y? False Let h = -20.87 - -21. Let x = h + 0.87. Is 9 less than x? False Suppose 0 = 3x + 2x + 30. Let a be (x/(-14))/((-40)/21). Let f = 5/8 + a. Which is greater: f or -0.1? f Let v be 2 + 2116/(-40). Which is bigger: -3 or v? -3 Let x be 1 + (20/(-14) - -1). Suppose o - 4 = -a + 3, 0 = -2a - 5o + 29. Which is greater: x or a? a Suppose 90 = 5h - 45. Is h equal to 26? False Let s(q) = -q*3 - 6q*2 + 3q + 9. Let d = -20 + 14. Let o be s(d). Which is smaller: -8 or o? o Let u = -14 - -13.75. Is 0 at most as big as u? False Let r = -491/776 + 3/388. Is -1 at least as big as r? False Let x = -2/199 + -987/796. Let v(o) = o*3 + 2o*2 - 2o + 1. Let h be v(2). Let t = -15 + h. Which is bigger: t or x? x Let d(k) = 21k3 + k2 + 2k + 1. Let u be d(-1). Which is bigger: u or -19? -19 Suppose 0 = -4b + 1 - 5. Let c = b + 0. Let w be 2/(-10) + 27/(-15). Do c and w have different values? True Suppose -m - 10 = m. Let g be m/(-3) + 2 + -3. Is 2/7 at most g? True Let b(k) = -2k*2 + 4k - 3. Let i(o) = 3o2 - 8o + 5. Let q(m) = -5b(m) - 3i(m). Let f be q(-4). Let y be 2 + (f - -2) + -3. Which is smaller: 1/15 or y? 1/15 Let a(d) = -d*3 - 9d*2 - 14d + 2. Let i be a(-7). Let y be (-15)/(-4) + (-1)/(-4). Let k(x) = 2x - 6. Let o be k(y). Is o > i? False Let x = 6 + -4. Let j be ((-2)/12)/(x/4). Which is bigger: j or -1? j Let k = -1.4 + 2. Let n = k + -0.4. Which is bigger: 2 or n? 2 Suppose 0c = 5c - 15. Let f(a) = -a3 - 7a*2 - 7a. Let k be f(-6). Let p be k/(-2)2/(-3). Which is smaller: p or c? p Let c = -97/600 + 3/25. Let o = 88 - 89. Which is smaller: o or c? o Let m be (-1(3 - 2))/18. Which is greater: 0 or m? 0 Let l be ((-5)/1)/(5 - 4). Let d be l/100 + 1/4. Is d at least -1? True Suppose -3i - a = 0, -3a = -5i - 10 - 4. Let w be 10/25 + 4/(-15). Does w = i? False Let y be (2/6)/(7/168). Let b be 4/1 - (11 - y). Which is bigger: 5/6 or b? b Suppose y = -2 + 1. Let b be 72/203 + 4/(-14). Which is smaller: y or b? y Let o = -72 - -72.07. Is o smaller than -0.04? False Suppose 6 = 5c - 8c. Let y be c + 10/1 + -1. Suppose 5 = g + y. Is -1 at least as big as g? True Suppose -4v + 39 = -13. Let l = 13 - v. Which is bigger: l or -5? l Let d = 1/4 + -69/292. Which is bigger: d or 0? d Suppose 0k + 5k = -5n - 40, 5n + k = -36. Let u be 2/n - (-9)/7. Are u and 1/28 unequal? True Let z = 2 - 3. Suppose -2u = -4c - 0c - 14, 14 = -c - 3u. Is z > c? True Let m be 3027/84 - 4/14. Let h = -36 + m. Which is bigger: 0 or h? 0 Let u = 0.28 + 0.72. Is 1/2 <= u? True Let v = 1 - 4. Let t = -5 + v. Let d = 6 + t. Which is greater: d or -3/5? -3/5 Suppose -x = -2a - 0a + 3, 0 = 2a + 4x + 22. Suppose 0o + o - 4 = 0. Let c = -6 + o. Which is bigger: a or c? a Let a = -214 - -1928/9. Let i be (0 + 0/(-3))/2. Let r = -1 - i. Which is smaller: a or r? r Suppose 0 = 4b + b - 5. Which is greater: -0.04 or b? b Let i = -20377/9 + 2261. Which is greater: i or -4? i Let n = 20 - 14. Suppose -n = m + m. Which is bigger: m or -4? m Let o(j) = 2 - 6 + 2 + j*2 - 2j. Let l be o(3). Let a be 2/12-4l. Which is bigger: a or 0? 0 Let f = -11/20 + 17/60. Let w = 0.8 + -0.8. Which is smaller: f or w? f Let m = -0.9 + -0.1. Let w = 31 - 45. Let y = w + 14. Which is smaller: y or m? m Let m = 10 - 12. Let k be ((-1)/(-4))/((-1)/2). Which is bigger: m or k? k Let z be (-26)/2 + -4 + 1. Is z at most -17? False Let j(u) = -u + 4. Let y be 3/9 + 34/6. Let n be (-1 - -1)/(y/(-2)). Let q be j(n). Is 5 less than q? False Suppose 0 = 2x + 10, -5j = -3j - 3x - 39. Is 14 equal to j? False Let m(k) = -k*3 + 7k*2 - 3k + 11. Let b be m(6). Is 30 != b? True Let r = 10 - 19. Is 2 greater than r? True Let c = -10569 + 42023/4. Suppose 315 = 5h - 5k, -3k - 252 = -4h - 6k. Let x = c + h. Is -3/5 equal to x? False Let h = -8 + 4. Let s = h + 3.4. Let g = 0.4 + s. Which is smaller: -1 or g? -1 Suppose 7 = 5v - 3. Let z = 264 + -785/3. Which is bigger: v or z? z Let f = 0.1 + 0.1. Let a = -0.9 - 0.06. Let l = a + -0.04. Which is bigger: l or f? f Let y be (-175)/441 + (1 - 10/14). Which is smaller: y or 0? y Suppose 3q - 3u - 15 = 0, 0 = q - 4q - 2u + 15. Suppose 4m - 5m = -q. Let v be m-2(-1)/2. Is 4 at least v? False Let p(n) = n*3 + 9n*2 + 7n. Let a be p(-8). Which is greater: a or 11? 11 Let r be 1 + (-654)/550 - (-72)/396. Which is smaller: r or 1? r Let b = -3 + 6. Suppose c + 7 = bk - c, 5k + 5c = -5. Is 1/4 equal to k? False Let w = -0.11 - -5.11. Let a = -4.4 + w. Which is greater: 1/3 or a? a Let w = 2.53 + -2.6. Let u = -105 - -104.07. Let h = w + u. Which is greater: h or 1/4? 1/4 Let b be (6/18)/(-2 + 1). Suppose -3 - 1 = -4n. Which is greater: b or n? n Suppose -26 = -3h + 4j, 0h = 5h - 2j - 20. Let c be (-6)/(-4)(-16)/(-6). Suppose -3t + 4y = 13, -ct = 4y - 5 - 15. Which is smaller: h or t? t Let a = 3.4 + -0.8. Let k = a - 0.6. Is k > 0.3? True Let m = -107/2055 + -2/137. Let w = 23/120 + m. Is -1 less than or equal to w? True Let t = -17039493/31 + 549997. Let k = 336 - t. Do k and -1 have different values? True Suppose -i - 2i - 12 = 0. Is -4 greater than or equal to i? True Let t = -1573/9 + 175. Let q(n) = 2n*2 - n + 2. Let p be q(2). Let r be (-4)/p2/4. Is t != r? True Let d(k) = k*2 - 12k + 8. Let s be d(10). Do s and -11 have different values? True Let m = 0.1272 + 7.9028. Let d = 0.01 + -8.01. Let t = m + d. Which is smaller: 0 or t? 0 Let r = -124 - -125. Let d be (-3)/50(-10)/(-4). Is d greater than or equal to r? False Suppose 2c + 41 = -47. Are c and -44 unequal? False Let g = 34 - 36.9. Let q = 3 + g. Let s = 0 + -0.1. Is q smaller than s? False Let i = 0.1 +	{ "pile_set_name": "DM Mathematics" }
l: 1, b: 1, m: 2, g: 1, s: 1}. Give prob of sequence blwm. 1/420 Four letters picked without replacement from {k: 4, g: 2, i: 1}. What is prob of sequence kgig? 1/105 Three letters picked without replacement from kttkktkk. Give prob of sequence tkt. 5/56 Two letters picked without replacement from {k: 1, n: 3, t: 9, v: 2, e: 4}. Give prob of sequence nv. 1/57 Four letters picked without replacement from wewoie. What is prob of sequence wiwo? 1/180 What is prob of sequence gk when two letters picked without replacement from {g: 9, o: 1, u: 2, k: 1}? 3/52 Calculate prob of sequence zx when two letters picked without replacement from zxxziiixxiixxixxxmix. 1/19 Calculate prob of sequence ccaa when four letters picked without replacement from {g: 3, a: 12, c: 2}. 11/2380 What is prob of sequence sljl when four letters picked without replacement from ljsslllji? 1/63 Four letters picked without replacement from {c: 9, h: 2}. Give prob of sequence cchh. 1/55 Two letters picked without replacement from {w: 2, b: 5, u: 4, t: 2}. Give prob of sequence ut. 2/39 Two letters picked without replacement from {v: 4, e: 3, b: 2, x: 2, g: 1}. Give prob of sequence xg. 1/66 Two letters picked without replacement from lkttktzlztzkzzt. What is prob of sequence zl? 1/21 Three letters picked without replacement from ougdooouuug. What is prob of sequence dou? 8/495 Calculate prob of sequence vzk when three letters picked without replacement from {v: 2, e: 5, k: 8, q: 2, z: 1, r: 2}. 2/855 Calculate prob of sequence ntsv when four letters picked without replacement from {s: 2, a: 7, v: 3, t: 1, d: 4, n: 1}. 1/12240 Four letters picked without replacement from cvmcfm. Give prob of sequence cmfc. 1/90 What is prob of sequence ixo when three letters picked without replacement from exxxqxiqoqqx? 1/264 Calculate prob of sequence yb when two letters picked without replacement from bwiyl. 1/20 Calculate prob of sequence dhdh when four letters picked without replacement from {d: 3, h: 9}. 2/55 Calculate prob of sequence ku when two letters picked without replacement from kunnuuun. 1/14 What is prob of sequence su when two letters picked without replacement from {s: 5, v: 1, x: 5, u: 4}? 2/21 Calculate prob of sequence tayj when four letters picked without replacement from {x: 1, j: 1, n: 2, y: 8, a: 6, t: 2}. 4/4845 Two letters picked without replacement from ihhhmhhiiddhiid. What is prob of sequence hi? 1/7 Calculate prob of sequence xjj when three letters picked without replacement from {m: 3, j: 6, x: 8}. 1/17 Two letters picked without replacement from bffcfcfbcfbffbcb. What is prob of sequence bf? 7/48 What is prob of sequence ssss when four letters picked without replacement from {s: 19, y: 1}? 4/5 Four letters picked without replacement from cnccccoooncnoon. Give prob of sequence ccoo. 5/273 Two letters picked without replacement from ggttttttgtg. Give prob of sequence gg. 6/55 What is prob of sequence fxff when four letters picked without replacement from {q: 1, f: 1, r: 1, x: 10}? 0 Two letters picked without replacement from yyutynhtppt. Give prob of sequence ty. 9/110 Two letters picked without replacement from {b: 6, y: 6}. Give prob of sequence yy. 5/22 Three letters picked without replacement from bggb. What is prob of sequence bgb? 1/6 Calculate prob of sequence jaw when three letters picked without replacement from {j: 1, i: 1, n: 1, a: 1, w: 1}. 1/60 Four letters picked without replacement from tkttkkeetkkkketkee. What is prob of sequence ttke? 5/459 What is prob of sequence qe when two letters picked without replacement from {q: 1, e: 1, y: 3}? 1/20 Calculate prob of sequence rgg when three letters picked without replacement from grrggrgrggggrrrrgr. 9/68 Three letters picked without replacement from ggogooooogo. Give prob of sequence ogo. 28/165 Calculate prob of sequence dv when two letters picked without replacement from {v: 4, m: 2, h: 9, d: 1, z: 1}. 1/68 Three letters picked without replacement from slttrbttbvrttt. Give prob of sequence tls. 1/312 Two letters picked without replacement from ssccstcttccttcl. Give prob of sequence ss. 1/35 Two letters picked without replacement from ttaeetteataaeeazeeee. What is prob of sequence ze? 9/380 What is prob of sequence dfff when four letters picked without replacement from {f: 3, d: 3}? 1/20 Calculate prob of sequence too when three letters picked without replacement from {o: 3, t: 4}. 4/35 Three letters picked without replacement from jnooonojnjwyooynn. Give prob of sequence yow. 1/340 Two letters picked without replacement from {t: 1, y: 1, v: 1, z: 1, f: 1}. What is prob of sequence zf? 1/20 Four letters picked without replacement from pnnppnabnbnbnba. Give prob of sequence pbpa. 2/1365 Two letters picked without replacement from maasasxmom. What is prob of sequence ma? 1/10 Calculate prob of sequence mrr when three letters picked without replacement from {m: 2, z: 2, r: 7}. 14/165 What is prob of sequence ww when two letters picked without replacement from wssssssssw? 1/45 What is prob of sequence ulg when three letters picked without replacement from {o: 1, d: 2, t: 1, l: 2, u: 1, g: 1}? 1/168 What is prob of sequence bbbb when four letters picked without replacement from bbmbbbbbbbbmmbbmbm? 143/612 Calculate prob of sequence mlm when three letters picked without replacement from hhhmhlhhlhmmlmhh. 3/280 What is prob of sequence zzja when four letters picked without replacement from {w: 3, z: 5, a: 3, t: 3, j: 1}? 1/546 Two letters picked without replacement from {a: 1, n: 1, d: 5, i: 4, g: 7, q: 1}. Give prob of sequence qd. 5/342 Calculate prob of sequence seev when four letters picked without replacement from esqqvnqqeqqses. 3/4004 Four letters picked without replacement from {y: 2, k: 2, g: 8, d: 3, z: 2}. What is prob of sequence kgdd? 1/595 Four letters picked without replacement from zuzzuzuuuuuuz. Give prob of sequence zuuz. 28/429 What is prob of sequence csoo when four letters picked without replacement from {c: 4, s: 2, o: 6}? 2/99 What is prob of sequence xh when two letters picked without replacement from xxkxxuxxzxxh? 2/33 Three letters picked without replacement from {r: 3, v: 12, l: 3}. Give prob of sequence vvr. 11/136 Three letters picked without replacement from {i: 3, a: 1, l: 1, p: 10}. Give prob of sequence aii. 1/455 Calculate prob of sequence in when two letters picked without replacement from {i: 1, n: 2}. 1/3 Three letters picked without replacement from {i: 7, k: 7}. Give prob of sequence kik. 7/52 Four letters picked without replacement from {u: 6, z: 1, f: 2, c: 3, m: 2}. What is prob of sequence mccf? 1/1001 Two letters picked without replacement from dppsgigh. What is prob of sequence di? 1/56 Calculate prob of sequence em when two letters picked without replacement from {m: 11, y: 7, e: 2}. 11/190 What is prob of sequence aaz when three letters picked without replacement from aazzaazaaazaaa? 15/91 Two letters picked without replacement from ppcpj. Give prob of sequence cp. 3/20 Four letters picked without replacement from {d: 4, b: 2, n: 7}. Give prob of sequence nnnn. 7/143 What is prob of sequence zq when two letters picked without replacement from {w: 2, z: 2, j: 3, d: 1, q: 3, l: 4}? 1/35 Four letters picked without replacement from {u: 10}. What is prob of sequence uuuu? 1 Calculate prob of sequence dy when two letters picked without replacement from xdyycdy. 1/7 Calculate prob of sequence zzc when three letters picked without replacement from {e: 2, b: 5, c: 1, z: 11}. 55/2907 Two letters picked without replacement from rrwrw. What is prob of sequence wr? 3/10 Two letters picked without replacement from dfytydy. What is prob of sequence dy? 1/7 Calculate prob of sequence yqx when three letters picked without replacement from {a: 1, y: 1, x: 2, i: 1, q: 1, b: 1}. 1/105 What is prob of sequence wss when three letters picked without replacement from {s: 4, m: 5, w: 2}? 4/165 Calculate prob of sequence my when two letters picked without replacement from {e: 2, m: 1, h: 6, y: 3}. 1/44 Four letters picked without replacement from vlvqvvvvlvqvvv. Give prob of sequence lvvl. 15/2002 What is prob of sequence gxx when three letters picked without replacement from xxxwoxogoxoo	{ "pile_set_name": "DM Mathematics" }
- -4-6sqrt(208). -96sqrt(13) + 33 Simplify (-1 + sqrt(76) + 2)2. 4sqrt(19) + 77 Simplify -2 + sqrt(153)/(-3sqrt(9)). -2 - sqrt(17)/3 Simplify sqrt(130)/(-1sqrt(10)) + sqrt(468) + 2. 2 + 5sqrt(13) Simplify 3(-4(sqrt(76)/sqrt(2))/sqrt(2) + -1)2. 24sqrt(19) + 915 Simplify (4(-2 + (sqrt(22) - sqrt(22)-1)/sqrt(11)))*2. -128sqrt(2) + 192 Simplify sqrt(14)/(sqrt(50)-5). -sqrt(7)/25 Simplify (-1 + sqrt(1584) - sqrt(1584)) + 1. 0 Simplify (-1(sqrt(351) + sqrt(39)) + sqrt(39))/(sqrt(24)/(sqrt(24)/sqrt(3))). -3sqrt(13) Simplify (sqrt(18)/(-12sqrt(9)))26. 3 Simplify 1 + (sqrt(68)/sqrt(4)6 - (sqrt(17) + -4 + sqrt(68)))2. 24sqrt(17) + 170 Simplify (-3sqrt(117)-3)2. 9477 Simplify -4 + -4 + 0 + (sqrt(80))2. 72 Simplify (sqrt(20) + 2sqrt(180))/(sqrt(640)2). 7sqrt(2)/16 Simplify sqrt(65)/(2sqrt(405) + sqrt(405)). sqrt(13)/27 Simplify sqrt(343) + (sqrt(343) - ((sqrt(343) - (sqrt(343) + (0 + sqrt(343))*2)) + sqrt(343) + 1)). 7sqrt(7) + 342 Simplify -1 + sqrt(33)/(sqrt(11) + (sqrt(11)1 - sqrt(11))). -1 + sqrt(3) Simplify sqrt(288) - (sqrt(288) + ((0 + sqrt(288))3 - sqrt(288)) + sqrt(288))*2 - (sqrt(288) - (-2 + sqrt(288) - sqrt(288)))5. -4618 - 48sqrt(2) Simplify sqrt(171)/(1sqrt(729)). sqrt(19)/9 Simplify 4 + (sqrt(3) + 1)1 + ((sqrt(3) - sqrt(6)/sqrt(2))1)*2. sqrt(3) + 5 Simplify ((sqrt(16) + (sqrt(16)1 + sqrt(16) - sqrt(16)))-2)/sqrt(8)-4. 16sqrt(2) Simplify 1sqrt(32) - (sqrt(32) + -1)*2. -33 + 12sqrt(2) Simplify -4 + ((1 + (1sqrt(6))/sqrt(3))6)*2. 72sqrt(2) + 104 Simplify (sqrt(2448) + 2)-5 - sqrt(2448). -72sqrt(17) - 10 Simplify -4 + (sqrt(2) + 1 + sqrt(2) + -5)*2. -16sqrt(2) + 20 Simplify sqrt(156)/(sqrt(48)/sqrt(4)-4). -sqrt(13)/4 Simplify (sqrt(304) + -3 + sqrt(304) + -5)23. -384sqrt(19) + 3840 Simplify -4 + sqrt(7) + 3sqrt(21)/sqrt(3). -4 + 4sqrt(7) Simplify -4 + (sqrt(5) - sqrt(30)/sqrt(6))2 - (sqrt(200)/sqrt(5))/sqrt(8). -4 - sqrt(5) Simplify sqrt(896)/sqrt(2) + 3-3sqrt(7). -sqrt(7) Simplify -4 + ((sqrt(132)-2-4 - sqrt(132) - sqrt(132))/(sqrt(12) + -1sqrt(48)))*2. 392 Simplify -2(sqrt(304) - ((sqrt(304) - (sqrt(304) + -3))*2 + 1)). -8sqrt(19) + 20 Simplify sqrt(39)/sqrt(3)5 + (sqrt(637)-2)*2. 5sqrt(13) + 2548 Simplify ((sqrt(208) - (sqrt(208) - (sqrt(208) + -1))) + -4)*2. -40sqrt(13) + 233 Simplify (sqrt(495)/sqrt(9))/sqrt(11) + (sqrt(5) - (sqrt(60) - sqrt(3840))/sqrt(12))2. sqrt(5) + 320 Simplify -4 + sqrt(13) + 1 - (sqrt(1053) + 4)2. -1072 - 71sqrt(13) Simplify (0 + (-2sqrt(77))/sqrt(11))*2. 28 Simplify ((sqrt(16)/(sqrt(24)/sqrt(3)) - sqrt(2)) + 1 + -1sqrt(2))*2. -2sqrt(2) + 3 Simplify ((1 + sqrt(1053) + (sqrt(1053) - (sqrt(1053)-1 - sqrt(1053))))2)*26. 1728sqrt(13) + 404376 Simplify -16(sqrt(833)-6)*2. -179928 Simplify (((sqrt(150)-2)/sqrt(10))/sqrt(3) + 0)*2. 20 Simplify (2sqrt(17)1)2 - (4 + (sqrt(17) - sqrt(17)-2)). -3sqrt(17) + 64 Simplify (3sqrt(275)/sqrt(5))/sqrt(5). 3sqrt(11) Simplify -1(4 + sqrt(832) + sqrt(832)-2). -4 + 8sqrt(13) Simplify (-5sqrt(117) - sqrt(13)) + sqrt(1300)1. -6sqrt(13) Simplify ((-3(sqrt(65) + sqrt(65)-1))/sqrt(5) - (0 + sqrt(1053) + 1 + sqrt(1053)))2. 36sqrt(13) + 4213 Simplify -1 + (3sqrt(204) - sqrt(204))/sqrt(12) + (sqrt(85)/sqrt(5)-5)*2. 2sqrt(17) + 424 Simplify 0 + (4 + 0 + sqrt(200))*2. 80sqrt(2) + 216 Simplify ((1sqrt(660))/sqrt(12))/sqrt(11). sqrt(5) Simplify (sqrt(95)1-4)/((sqrt(35) + sqrt(140))/sqrt(7)). -4sqrt(19)/3 Simplify 1 + sqrt(7) + -4 + 4 + sqrt(847). 1 + 12sqrt(7) Simplify (sqrt(864)/sqrt(4))/(-2sqrt(243)). -sqrt(2)/3 Simplify -5 + sqrt(17)1 + 3 + 5. 3 + sqrt(17) Simplify (((sqrt(121) + (sqrt(121) - -1sqrt(121)) - sqrt(121)) + sqrt(121) + sqrt(121))-5)/(sqrt(66)/(sqrt(12)/sqrt(2) + sqrt(6))). -40sqrt(11) Simplify (0 + sqrt(52) - sqrt(13))*23. 39 Simplify (5(sqrt(190) - sqrt(190)2 - sqrt(190)) - sqrt(190))/(sqrt(200)/sqrt(5)). -11sqrt(19)/2 Simplify (sqrt(170)3 + sqrt(170))/sqrt(10) - (sqrt(17)45)*2. -6800 + 4sqrt(17) Simplify (-4(2sqrt(132) + sqrt(132)))/sqrt(12)2. -24sqrt(11) Simplify (-1sqrt(847) + -4 + sqrt(7) + sqrt(28)/sqrt(4))2. 72sqrt(7) + 583 Simplify ((sqrt(5) - (0 + sqrt(45) + sqrt(5))) + 2 - -5(-1 + sqrt(80)))2. -102sqrt(5) + 1454 Simplify (6(sqrt(162) + -1) + sqrt(162) + -5 + sqrt(162) + -1)2. -1728sqrt(2) + 10512 Simplify 1(sqrt(108) + (1 + sqrt(108))2). 18sqrt(3) + 109 Simplify (-3(sqrt(1300) + sqrt(1300) + -1 + 0))2. -360sqrt(13) + 46809 Simplify (sqrt(1300) + 1 + 1)*2-2. -2608 - 80sqrt(13) Simplify 1(-1 + sqrt(136)/sqrt(8) + 3). 2 + sqrt(17) Simplify ((sqrt(300)2 + sqrt(300))/sqrt(10))/(sqrt(150)3). sqrt(5)/5 Simplify (sqrt(30)/(4-2sqrt(10)))*2 + (sqrt(297) + sqrt(33))/sqrt(11) + 3. 195/64 + 4sqrt(3) Simplify (-21sqrt(128) - sqrt(128))2 + sqrt(128) + (0 + sqrt(128))2 + -5. 8sqrt(2) + 1275 Simplify (2 + sqrt(80))25. 80sqrt(5) + 420 Simplify ((sqrt(90)2)/sqrt(3))/(2sqrt(6)-2). -sqrt(5)/2 Simplify -2 + (sqrt(52) + 2)*2. 8sqrt(13) + 54 Simplify ((sqrt(220)-2)/sqrt(10))/sqrt(11). -2sqrt(2) Simplify (sqrt(252)2)/(sqrt(4) + (sqrt(24)/(sqrt(6) - (sqrt(6) + -1sqrt(6))) - sqrt(4))). 6sqrt(7) Simplify ((sqrt(13) - sqrt(65)/(2sqrt(5)))-3)2. 117/4 Simplify (sqrt(24)/(1sqrt(12)) + sqrt(2) + sqrt(72)1)2. 128 Simplify ((sqrt(432) + 0 + 0)-6)*2. 15552 Simplify (sqrt(17) - sqrt(187)/(sqrt(11) + sqrt(11)1))*2-2. -17/2 Simplify ((sqrt(66)-1 - sqrt(66))-5)/sqrt(6). 10sqrt(11) Simplify (-3 + sqrt(99))2 + sqrt(1331)-6. -84sqrt(11) + 108 Simplify (-3(sqrt(13) + sqrt(13) + 0) - sqrt(117)5)2. 5733 Simplify ((2 + 2sqrt(98))*2 - sqrt(98)) + (sqrt(98) + 2sqrt(98))*2 + -3. 49sqrt(2) + 1275 Simplify (sqrt(720) + 2 + -2)-6. -72sqrt(5) Simplify 1(0 + sqrt(13)) - sqrt(52)/(sqrt(20)/sqrt(5)). 0 Simplify (1sqrt(121)-2)/(sqrt(44)-4). sqrt(11)/4 Simplify (-1sqrt(3388))2. 3388 Simplify (-2sqrt(64))/sqrt(8). -4sqrt(2) Simplify sqrt(45)/sqrt(36) - (1-1sqrt(5))2. -5 + sqrt(5)/2 Simplify (-2(0 + sqrt(288)))*2 + 2. 1154 Simplify ((sqrt(117) - (sqrt(117) + (sqrt(117) - (sqrt(117) + sqrt(117) + sqrt(117)-1 - sqrt(117)))))-2)/(sqrt(9)1-3). -2sqrt(13)/3 Simplify (sqrt(3) - (sqrt(147) - sqrt(3)))*231. 225 Simplify (sqrt(204)/sqrt(300) + 1((sqrt(17) - sqrt(153)) + sqrt(17)))*2. 272/25 Simplify (sqrt(26)/(-2sqrt(242)))*2. 13/484 Simplify (sqrt(40)/(-1sqrt(8)) + sqrt(125) + -1)*2. -8sqrt(5) + 81 Simplify 4(sqrt(44)/sqrt(4))24. 176 Simplify -5 + ((1sqrt(204))/sqrt(12) - (2 + sqrt(1377)))2. 32sqrt(17) + 1087 Simplify (-5-541sqrt(19))*2. 190000 Simplify -2(-3 + sqrt(8)/sqrt(4) + -2 + sqrt(6)/sqrt(3)). -4sqrt(2) + 10 Simplify (51sqrt(22)/sqrt(11))2. 50 Simplify (-5(-3 + -1sqrt(19) + 2))2 + 5. 50sqrt(19) + 505 Simplify ((sqrt(539) - 2sqrt(539)) + -3)2 + -1. 42sqrt(11) + 547 Simplify ((sqrt(20) + 2)*2 + -3 + sqrt(245))-4. -60sqrt(5) - 84 Simplify sqrt(5)1-5 + (sqrt(90)/sqrt(6))/sqrt(3). -4sqrt(5) Simplify sqrt(972) + -4. -4 + 18sqrt(3) Simplify -2 + sqrt(1331) - (((sqrt(11) + -3 + -1)2 - sqrt(11)) + sqrt(11)). -29 + 19sqrt(11) Simplify (0 + -1sqrt(27) + 2sqrt(147))*2. 363 Simplify sqrt(104)/sqrt(288) - ((2sqrt(208) - sqrt(13))*2 + sqrt(13)). -637 - 5sqrt(13)/6 Simplify sqrt(171) - (sqrt(171) + -3)*2-4. -69sqrt(19) + 720 Simplify ((2sqrt(539))/sqrt(11))/(sqrt(35)/(sqrt(20)/sqrt(4)) + sqrt(7))-4. -4sqrt(7) Simplify -2 + sqrt(19) + ((sqrt(228) - sqrt(228)-5)/sqrt(12))2. sqrt(19) + 682 Simplify (sqrt(304) + 5)2 + (-2sqrt(931) + sqrt(19))*2. 40sqrt(19) + 3540 Simplify 11sqrt(2) + 1sqrt(72). 7sqrt(2) Simplify -1 + (sqrt(816)-2)/sqrt(3). -8sqrt(17) - 1 Simplify sqrt(22)/((sqrt(99)/sqrt(9) - sqrt(11) - sqrt(11))-1). sqrt(2) Simplify 6(sqrt(847) + sqrt(847)1)2. 20328 Simplify -5((sqrt(8)/sqrt(4))*2 + 1 - (sqrt(288) + 2sqrt(288))*2). 12945 Simplify 1 + sqrt(12) + -5 + 5. 1 + 2sqrt(3) Simplify (1(sqrt(65) - 3sqrt(65)))/(3sqrt(720)). -sqrt(13)/18 Simplify 4 + (-1 + sqrt(112))2. -8sqrt(7) + 117 Simplify ((sqrt(3400) - (sqrt(3400) - (sqrt(3400) + (-1sqrt(3400) - sqrt(3400)))) - sqrt(3400))/(4sqrt(4)/sqrt(2)))*2. 425 Simplify sqrt(4)/(sqrt(72) + sqrt(72)-1 + sqrt(72)). sqrt(2)/6 Simplify sqrt(1200)/(1*sqr	{ "pile_set_name": "DM Mathematics" }
+ 5n - k = 0, 5m - 1306 = -4n + 664. Is 10 a factor of m? True Let x(d) = -807d + 947. Is 17 a factor of x(-7)? True Suppose 18 = -4s + 34. Suppose 4t = l - t + 2, -2l - 4t = s. Is 4 a factor of (-32)/l + -2 + 2? True Suppose 21k = 22k - 28. Let p = k + -26. Suppose -s = -t + ps + 144, -4t + 546 = 3s. Is 22 a factor of t? False Let y = 52 + -310. Let s = -81 - y. Suppose -39 = -2f + s. Does 27 divide f? True Let q = 33616 - 19183. Does 17 divide q? True Is 6/8 + (-566600)/(-800) a multiple of 12? False Let g(r) = 29r - 147. Is g(37) a multiple of 11? False Let w(f) be the first derivative of -3f*2 - 22f - 1 - 4f + 5 - 10f. Is 8 a factor of w(-14)? True Suppose -121k + 113k + 1088 = 0. Suppose -q - f + k = 22, q = f + 108. Is q a multiple of 19? False Suppose 0 = -173755q + 173758q - 3567. Does 41 divide q? True Let p(x) = x*2 + 39x - 134. Let v be p(-42). Let o(n) = n + 1. Let r(a) = -37a + 18. Let k(h) = -o(h) + r(h). Does 25 divide k(v)? False Suppose 0 = -2a - 2a + 2492. Suppose 4j - a - 321 = 0. Suppose -2z - 4l = -212, -2z + j = -5l + l. Does 14 divide z? True Let j(f) = 7f - 110. Let w be j(-17). Let n = w - -361. Is n a multiple of 4? True Suppose o - 13230 - 408 = -3l + 2o, 0 = -o. Is l a multiple of 2? True Let w = -2950 + 8370. Does 10 divide w? True Let d be 1((-20)/(-25) - (-6)/5). Suppose dj + 23 = 1067. Does 9 divide j? True Suppose 5b - 30976 = q + 5970, 12q + 14848 = 2b. Is b a multiple of 4? True Let j = 49 + -119. Let g = -70 - j. Does 27 divide (-112)/(g - 1) + (4 - 8)? True Suppose -s = 5r - 1710, 5r + 441 - 2166 = -4s. Let o = r + 555. Does 14 divide o? True Let r(h) = h3 + 12h*2 - 12h + 12. Is 5 a factor of r(-6)? True Let s(h) = 1 - 3 + 17h - 5h*3 + 4 - 2h*2 - 16h. Let n be s(-1). Suppose -11 = -3f + 5c, -5c = -f - n + 11. Is f even? True Suppose -64923 = -42i + 67419. Is i a multiple of 137? True Let r(x) = -380x - 2438. Is r(-48) a multiple of 110? False Let d(m) = -2m*2 + 14m - 26. Let v be d(8). Let h be -1 + (2 - 3 - v). Suppose -h = -z + 4w, -4z + z + 104 = 4w. Does 6 divide z? True Let w(r) = -11r - 18r - 45 + 25r - 3. Let l be w(-12). Suppose l = 3v - 12, 0 = h - 2v + 12 - 129. Is 18 a factor of h? False Let b = 106 - 101. Let q(c) = 37c + 31. Is 14 a factor of q(b)? False Suppose x = -4, -p + x + 28532 = -13727. Is p a multiple of 15? True Let a = -261 + 272. Suppose ay + 161 - 1118 = 0. Does 6 divide y? False Let f(t) = 68 - 14t - 13t + 16t. Does 36 divide f(-7)? False Let c(v) be the third derivative of v6/120 + 3v5/10 - v4/24 - 14v3/3 - 13v*2. Let b be c(-18). Does 8 divide (5 + -2)(3 - b)? False Let a(p) = -18p + 55. Let o be a(11). Let r = o - -142. Is 8 a factor of -1 + r - (-47 + -3)? True Suppose 2p = -5d + 2d + 11, -5p - 5d = -40. Suppose pw - 4676 = -w. Is 11 a factor of w? False Suppose -3x + 11370 = -12w, 3w = -3x - 2w + 11251. Does 22 divide x? True Let q = 3829 - 595. Is 98 a factor of q? True Suppose -5u - 1 = -0u + 4c, 3u - 21 = 3c. Suppose i + 4 = ui. Suppose 186 = 3o - 3p, -4o + 275 = o + ip. Is 9 a factor of o? False Suppose 38 - 34 = 2o. Suppose -ou + 18 = -8. Let z(h) = 19h - 17. Does 23 divide z(u)? True Let h(x) = x2 + 13x - 222. Let r be h(-47). Let c = r + -768. Is 79 a factor of c? False Let l(q) be the second derivative of -q*4/12 + 14q*3/3 + 69q*2 + 2q + 2. Does 23 divide l(23)? True Let r(b) = b*3 - 10b*2 + 10b - 4. Let a be r(9). Suppose -4m - aj = -8, -2j + 5j = -5m + 10. Let o(z) = 7z*2 + z + 2. Does 4 divide o(m)? True Suppose -3z - 120 = -z. Let y(n) = -n*2 - 5n - 54. Let o be y(-14). Let b = z - o. Is b a multiple of 24? True Let s be (1 - ((-14)/6 - -3))357. Suppose 515 - s = 2y. Is y a multiple of 22? True Suppose -17 = -0v + v - 4s, 5s - 16 = 3v. Suppose a + v = 2a. Suppose 4d + 3g - 467 - 1 = 0, 364 = ad - g. Is d a multiple of 24? True Let h = 7162 + -5248. Is 58 a factor of h? True Let j be 16/(-72) + (-94)/(-18). Let y(i) = 47i - 26. Is y(j) a multiple of 19? True Let k(r) = 6r*2 + 10r + 12. Let p be k(-4). Is 29 a factor of 18037/p - 15/12? False Let k be (-74)/(-185)(-73 + (-6 - -9)). Let v be 16/(-6)(-33)/(-2). Let w = k - v. Is w a multiple of 16? True Suppose 0 = -4l - 2b + 6904, l - 2b = -l + 3464. Is 3 a factor of l? True Let w(z) = z2 + 7z - 15. Let f be w(0). Is 58 a factor of (-5872)/(-60) - -6 - 2/f? False Let n(w) = 30w2 + 158w - 8. Does 9 divide n(-8)? True Let q(v) = 7v2 + 4v + 6. Let z be q(10). Suppose 63n = 61n + z. Is n a multiple of 16? False Let j(d) = -4d3 + 87d*2 + 6d - 279. Does 12 divide j(21)? False Suppose 6c - 219 - 141 = 0. Let n = 18 - c. Is 1/(-7) - 1965/n4 a multiple of 16? False Let u(g) = -290g3 - 46g*2 - 214g - 62. Is u(-5) a multiple of 36? True Let d(a) = -43a + 14. Let o be d(1). Does 3 divide o/(410/(-45) - -9)? True Let t(y) = -7y3 - y2 - 4y - 4. Let q(c) be the first derivative of c3/3 + 2c*2 + 2c + 12. Let p be q(-2). Is 14 a factor of t(p)? True Let y = 8781 + 2289. Is 30 a factor of y? True Suppose -4q + j + 68162 = 0, -93j + 91j = -2q + 34072. Does 170 divide q? False Suppose -14s = 22s - 1332. Suppose sl + 2070 = 40l. Is 23 a factor of l? True Suppose 65630 = 18q + 9092. Is 23 a factor of q? False Let o(k) = 5k*2 - 12k - 15. Let t be o(-6). Let i = -163 + t. Is i a multiple of 13? False Let i = 74 - -495. Let j = i + -415. Is 22 a factor of j? True Suppose -2z = 3z - 10. Let s(f) = 13f3 - 4f*2 + 2f. Does 4 divide s(z)? True Let c = 117 - 181. Does 28 divide (404/(-8) + 4)c/12? False Let v be 280/((8/148)/1). Let s = v - 812. Is 54 a factor of s/27 - (114/(-27) + 4)? True Let m be 120/(-72) + -325(-376)/6. Suppose m = 17b + 4606. Is b a multiple of 16? False Let c = -5979 + 2198. Is 36 a factor of c/(-7) + 34/(-238)? True Suppose 0 = -4b - g + 340, -4g + 184 = 2b - 0b. Let q = b - 124. Let p = -27 - q. Does 13 divide p? True Suppose -318 = -5t - 4h, 2t - 7h - 116 = -3h. Let v = 312 - 326. Let x = v + t. Does 8 divide x? True Let w(p) = -p*3 - 4p*2 - 14. Let t be w(-7). Suppose -137j + 80 = -tj. Is j a multiple of 2? True Suppose -a + 363 + 1195 = 0. Suppose a - 6038 = -7i. Is 16 a factor of i? True Let t(a) = -a*3 - 9a*2 + 9a - 10. Let b be t(-10). Suppose b = 5g + 5s - 2220, -2g + 3s = -s - 912. Is g a multiple of 16? True Let z(d) = -34d + 632. Let m be z(17). Let f = 4 + -1. Suppose -fu = -2k + m, -2u = -8k + 3k + 135. Is 5 a factor of k? False Is 4 - ((-5450 - 18) + -22) a multiple of 67? True Let b = 32 + -20. Suppose 110m = 112m - b. Does 19 divide 19(6/18 - (-28)/m)? True Let h(b) = b3 - 84b*2 - 901b - 225. Is 93 a factor of h(94)? True Let r(v) be the first derivative of 3v6/8 + v4/12 - v3/3 + 5v*2/2 + 4. Let a(t) be the second derivative of r(t). Is a(1) a multiple of 16? False Let t = -349 - -450. Suppose 0v - t = -v - 5u, -131 = -v + u. Is v a multiple of 18? True Suppose -4c + 120 = -4y, -4y = -y - 4c + 93. Let a = y - -19. Does 5 divide (a/10)/((-2)/30)? False Let u(l) = 34l3 + l2 - 3l + 3. Let v(c) = -c3 - 13c*2 + 11c - 40. Let n be v(-14). Is 27 a factor of u(n)? False Let s(k) = 16k - 38. Let m be s(3). Suppose -mq + 18q = 2320. Does 58 divide q? True Let l(w) = 29w - 4. Let x(j) = -19j + 3. Let n be 2/(6/3)7. Let p(i) = nx(i) + 5l(i). Is 5 a factor of p(2)? True Suppose 42v - 313111 + 157376 = 529705. Does 20 divide v? True Suppose 5t + 11y - 67515 = -17232, -3y = -t + 10041. Is t a multiple of 35? False Let r = 67 + -90. Let q = 26 + r. Suppose 0 = -5g + 2b + 575, -qb = g + b - 93. Is 24 a factor of g? False Let o = 427 + -423. Suppose of = 1989 + 871. Does 13 divide f? True Let v be 5/((-15)/6)-4. Let f be (3/2)/(4/v). Suppose fm + 45 = 4m. Is 9 a factor of m? True Suppose -107z + 104z = -3u - 85692, -57086 = -2z - 4u. Is z a multiple of 77? False Suppose 7l + 26 = 117. Suppose -3f = -l - 14. Is 9 a factor of f? True Let v = -95 + 72. Let c(p) = -p*2 - 23p + 31. Is 10 a factor of c(v)? False Let g(f) = 2f + 33. Let i(j) = 1. Let b(n) = g(n) - 4i(n). Let p be b(-13). Let w(l) = 3l3 - 5l*2 + 2l	{ "pile_set_name": "DM Mathematics" }
erivative of -8vx*4 - 9230vx3 + 14vx - 2x*3 - 3x*2 + 336x wrt x. -192vx - 55380v - 12 What is the derivative of -20412b*4 + 4b*3 + b + 98418? -81648b*3 + 12b*2 + 1 Find the first derivative of 76035q*2 + 79507. 152070q Find the second derivative of 318778d2 - 167684d wrt d. 637556 Find the second derivative of -144d4 + 1066d*2 + 2986691d. -1728d2 + 2132 Find the third derivative of -2qw4 + 51qw3 - 61491qw2 + qw - 147w5 wrt w. -48qw + 306q - 8820w2 Find the first derivative of 36049g*2 + 1011570. 72098g What is the second derivative of 2k5t - 149511k4t - 2140kt - 12k + 6t - 2 wrt k? 40k3t - 1794132k2t What is the second derivative of -7x4 + 2289x*3 - 951x - 2? -84x2 + 13734x What is the second derivative of -7724t2 + 317t - 10 wrt t? -15448 Find the second derivative of -335p3x*5 - 52p*3x*3 + 1591p*3 - 6p*2 - p + x wrt x. -6700p*3x*3 - 312p*3x What is the derivative of 4289478m + 105238 wrt m? 4289478 Differentiate 3hlm + 210hl + 12871m - 341 wrt m. 3hl + 12871 Find the first derivative of 680517g*3m + 745852g3 + 2gm2 wrt m. 680517g*3 + 4gm Differentiate -1502654i*3 - 202539 wrt i. -4507962i*2 What is the second derivative of -7637z*4 - 3z*2 - 346638z? -91644z2 - 6 Find the third derivative of -195i*4 - 2i*3 - 2i*2 - 3818i. -4680i - 12 Find the first derivative of 8i*2 + 5880i + 197114. 16i + 5880 Find the third derivative of -96l*6 - 303l*3 + 100l*2 - 2l - 17. -11520l3 - 1818 Find the third derivative of 13574gs3 + 2638gs2 - 25gs + 2s*3 wrt s. 81444g + 12 What is the first derivative of -42i2w - i*2 - 3iw + 19i - 9w - 665 wrt i? -84iw - 2i - 3w + 19 What is the third derivative of -o4 - 26021o*3 - 37o*2 + 13o + 120 wrt o? -24o - 156126 What is the third derivative of 21230k*3 - 6002k*2? 127380 What is the third derivative of 15737u*6 + 4710u*2 - 3u + 2? 1888440u3 Differentiate 335351j*4 - jy - 1040480y with respect to j. 1341404j*3 - y Find the second derivative of 96763i*2 - 847i + 16 wrt i. 193526 Find the first derivative of -403g3 - 662g*2 - 880275. -1209g*2 - 1324g Find the third derivative of -r*4w + 20r4 + 2592r*3w - 2r2w - r*2 - rw + 259r + 51w wrt r. -24rw + 480r + 15552w What is the third derivative of 12nu*3y + 2nu*3 + 1278nuy - 87n + 9479u*3y + 2u2y - 2y wrt u? 72ny + 12n + 56874y Find the second derivative of -747200t*5 - 77539t. -14944000t3 What is the first derivative of 364125f*3l*4 + 2f*3l - 35f3 - 1318f*2 - 3 wrt l? 1456500f*3l*3 + 2f*3 Find the third derivative of 127147j*3m*2 + 2j*2m*2 - 68819jm2 wrt j. 762882m2 Find the second derivative of -f3m2 - f3m - 2f3 + 15673f*2m*2 + 4f*2 + 52 wrt m. -2f*3 + 31346f*2 What is the second derivative of -870iqz*2 + 20iqz + 2iq - 8iz*2 + 3qz + 126z wrt z? -1740iq - 16i What is the third derivative of 96942u*6 + 425u*2 + 13? 11633040u*3 Differentiate -43y*2 + 8380y - 235824. -86y + 8380 Differentiate -2r*4 + 87r*3 + 2r*2 + 344r - 637968. -8r3 + 261r*2 + 4r + 344 Find the third derivative of 2g2i*4 - 433g*2i*3 + 3g*2 - 14gi2 + 201i wrt i. 48g2i - 2598g2 What is the first derivative of 1286sy2 + 73213s - 4y wrt y? 2572sy - 4 What is the derivative of -140r*4 - 3r*2 + 2r - 3627? -560r3 - 6r + 2 What is the second derivative of -80703f2p*3 - 2f*2 + 6fp3 - 148fp2 - 7fp wrt f? -161406p*3 - 4 What is the third derivative of -631773y*5 - 2y*2 + 23y - 257? -37906380y2 Find the third derivative of 168721q*4 - 127885q*2 wrt q. 4049304q Differentiate 132qr*2t*2 + 32qt2 + 1384r*2t*2 - 2r*2t - 2rt - t*2 wrt q. 132r*2t*2 + 32t*2 Find the third derivative of -11b*3kz - 3511b*3k + b*2kz + 635b*2k + 550b2z wrt b. -66kz - 21066k Find the first derivative of 702652k + 336061. 702652 Differentiate -3c4x + 3645c2x - 15941x with respect to c. -12c*3x + 7290cx Find the third derivative of -18787b3v*4 - 2b*3v + 187b2v*2 - 11bv5 - 19bv + 5b wrt v. -450888b3v - 660bv*2 What is the first derivative of -21996qt + 85633t wrt q? -21996t What is the first derivative of -62756w*4 + 121093? -251024w*3 Differentiate 15169q*3 + 2q + 258499. 45507q2 + 2 What is the first derivative of 149169t*3z*4 + 89533t*3 wrt z? 596676t*3z*3 What is the derivative of 1681bu - 2116b - 168u - 40 wrt u? 1681b - 168 What is the third derivative of 2k6 + 7k*5 + 783k*3 - 213k*2 + 117k + 1 wrt k? 240k3 + 420k*2 + 4698 Find the second derivative of 145s*2tz2 - s2t - 96s2z + 343593sz*2 - tz*2 + 3z*2 wrt s. 290tz2 - 2t - 192z What is the third derivative of -3u*6v + 20210u4v - 5u2 - 7295uv + 3v wrt u? -360u3v + 485040uv Find the second derivative of 7904gk*2 + 2gk - 3g + 4k2 - 14k + 3 wrt k. 15808g + 8 Differentiate -136v*3 - 269v*2 + 3v + 180887 wrt v. -408v2 - 538v + 3 Find the second derivative of 2v2y*3 + 21743v*2y*2 + 2vy3 + 1277vy wrt v. 4y*3 + 43486y*2 Find the first derivative of -92l*3q + 5031994l3 + 1115lq2 wrt q. -92l*3 + 2230lq What is the derivative of -7520446q*2 - 3247815? -15040892q What is the third derivative of -2l5 - 14l*4 + 4699l3 - l2 - 9254 wrt l? -120l2 - 336l + 28194 What is the second derivative of 4k3 - 1167k*2 + 24k + 818 wrt k? 24k - 2334 What is the first derivative of 2brs - 8br + 730bs - 5rs - 9s + 2 wrt b? 2rs - 8r + 730s Find the third derivative of 4530co3 - 2519co - o6 - 26o*4 - 10o*2 + o wrt o. 27180c - 120o3 - 624o Find the second derivative of -2o5 + 263200o*2 - 16295o + 9. -40o3 + 526400 Differentiate -49114u*3 + 2u + 215158 with respect to u. -147342u2 + 2 Differentiate -178215js2 + 3018s*2 - 5s - 5 wrt j. -178215s2 Find the second derivative of -2335uw4 + 74uw2 + uw + 151835w - 3 wrt w. -28020uw2 + 148u Find the second derivative of -3263476n4 - 6220042n wrt n. -39161712n2 What is the third derivative of -fw*5 + 4fw4 + 12fw3 + 26fw - w2 + 23w wrt w? -60fw*2 + 96fw + 72f Differentiate fg2s + 23fg*2 + 2fgs + 7fg - g*2s + 1117g2 + 2gs + 1 wrt f. g2s + 23g2 + 2gs + 7g Find the third derivative of 2p4w + 21p3w - 602p3 + 2p*2w - 15p2 + pw + 100w wrt p. 48pw + 126w - 3612 Differentiate -5ot*2 - 4246o - 214t2 + 44t with respect to o. -5t2 - 4246 Find the third derivative of -187526c*4 - 3c*2 - 292c + 4 wrt c. -4500624c What is the second derivative of 906952nz2 - 3n + 82347z wrt z? 1813904n Find the second derivative of -i*4 + 16833i3 + i2 - 15i + 5351. -12i*2 + 100998i + 2 Find the second derivative of 213108p4 - 1335557p wrt p. 2557296p2 What is the second derivative of -600509s*2z*2 + 3s*2z + s*2 - sz + 4770s + 2z wrt z? -1201018s2 Differentiate b3g*2 + 655774b*3 + 3b*2g*2 + 38b*2g - b wrt g. 2b3g + 6b2g + 38b2 What is the second derivative of -b3pr2 + 16b*3pr - 11b*3p - 12b2r - 16857bpr2 + 4pr wrt r? -2b*3p - 33714bp What is the first derivative of 163112k2 + 27112 wrt k? 326224k Find the second derivative of 409008m3 - 3m + 9815 wrt m. 2454048m Differentiate h4 + 1181h3 + h2 + 7h + 1461120 wrt h. 4h*3 + 3543h*2 + 2h + 7 What is the derivative of -68cy - 598c - 196832y wrt c? -68y - 598 Find the second derivative of 470r*2t*2z*2 + 20r*2t + 118rt*3 + 225rtz*2 - 6t wrt t. 940r2z*2 + 708rt What is the second derivative of 39442g*4 + 76314g + 1 wrt g? 473304g2 Find the third derivative of -172g*4t + 2g4 + g3t - 2g3 + 47g*2t + 225g2 + 2t wrt g. -4128gt + 48g + 6t - 12 Find the third derivative of -2djwz*2 - 4djwz - djz3 - 4djz*2 + 2dj + 5dwz*3 + 238jwz - 319*w	{ "pile_set_name": "DM Mathematics" }
2)/(-48))? 6 What is the value of 5 + 335/(-65) + (-1122)/143 - 14? -22 What is 11 + 1 + 11 + (-2232)/96? -1/4 What is the value of 6/(-9)(-73863)/(-6792)? -29/4 What is (-56)/(-336) - 130/(-12)? 11 What is the value of 285/(-380) - 33/(-12)? 2 Calculate (-8)/(-80) - (17/(-5) + 3). 1/2 What is the value of (-1 + -4)/(14/((-1428)/170))? 3 Evaluate (-25)/(-75) - 328/264. -10/11 Evaluate (0 + -15)9224/5765. -8 What is ((13 + 13)(-3 - -2))/(-12 + 2)? 13/5 Calculate 67 + 70917/(-1078) - (16/7)/2. 1/14 Calculate 2-6 - (-3045)/315 - (-3)/1. 2/3 Evaluate 3((-12)/(-14) + (-10138)/1554). -17 Calculate (-1503)/2004 + (-21)/1. -11/4 What is 434/(-124) + (9150/172)/15? 2/43 Calculate 9 + (5/5)/((-14)/126). 0 What is (-20)/5504(-10)/(-8)1? -2/11 (-4)/3(-2)/(-4) - (-1258)/(-111) -12 What is (-10)/125 + 12/150-49? -4 What is the value of 3990/9823 - (-2)/(-47)? 4/11 (45/(-81))/(270/243) -1/2 (5/15)/(5710/570 - 10) 19 Calculate -55 + 74481/1353 + (-108)/533. -2/13 Evaluate 198/18 - 140/12. -2/3 Calculate (-66)/154875/75. -5 What is 157986/(-5895) - (-1 + (-2)/(-10))? -26 What is ((-45)/12)/(45/3621/70)? -10 Calculate 3(16/10 + 4180/(-1425)). -4 8 - (-1)/(5/(-50)2) 3 Evaluate ((-132)/(-36))/(32/(-208) + (-19)/(-39)). 11 -136/(-48)4 3 What is (16/18)/2 + (-54395)/(-21285)? 3 Evaluate (17697/(-694))/((-6)/4). 17 79/(-5) - (-36)/(-420)14 -17 Calculate ((105/20)/(-7))/((-9)/3)-6. -3/2 What is (-20(-7)/3150)/((-1)/(-10))? 4/9 Calculate (-14 - -13) + 2 + (-12)/1. -11 Evaluate (1428/490)/(-6) - (8 - (-123)/(-15)). -2/7 What is the value of 770/(-720) + 30/48? -4/9 What is (-149 - -141) + -1 + 5104/20? 17 Evaluate (7 - (-10 - 0 - -2))(-7)/189. -5/9 Evaluate (-111)/12 + 2 - 4/(-16). -7 What is the value of (20/(-54))/((-1300)/1950)? 5/9 Evaluate 4 - ((-1)/2 - (-78 - -74)). 1/2 Calculate (45/(-75))/(66/20). -2/11 -12/30 + -630/135 -7/5 What is (-5)/(-41 - -11)-54? -9 (-2 - (-18)/10)(-70425)/(-16902) -5/6 Evaluate ((-13052)/(-208) + -59)(3 - (-1 + 0)). 15 What is the value of 2601/51 + -45 - ((-132)/(-26) + 1)? -1/13 What is 459/(-170)95/(-684)? 3/8 Evaluate (13/3)/(12 + (-260)/25). 5/8 (3/27)/((8/(-3))/(-2))2 1/6 What is (-42)/8262200/(-380975)? 12/7 What is (-2 - 130/(-15))(-18)/(-24)? 5 Calculate -5 - (-78)/13 - 17. -16 Calculate 15/9((-73)/10 - (-7 + 0)). -1/2 What is the value of 315/140(2 + 96/(-45))? -3/10 Evaluate (-100)/(-48) - (116/(-290) - 24/(-10)). 1/12 Evaluate (-12)/14336/(-48). 6 (-143)/26 - (-12)/24 -5 What is -55 - (-44970)/600 - (-1)/20? 20 Evaluate -7((9 - -3) + (-2860)/238). 2/17 Evaluate 3/(-6) + ((-94)/4 - -15). -9 Calculate (-10)/6(-5)/((-350)/(-336)). 8 Evaluate (-16)/7 + 5650/8701. -18/11 Calculate -3 - ((-3776)/(-272) - 17). 2/17 Calculate ((-124)/12710)/((-210)/(-50) + (-4)/1). -2/41 What is the value of 4/(90/45) + -212/(-9)? 14/3 Evaluate (2/6)/(17/561) + -12. -1 What is 12 - 51/5 - 26/20? 1/2 What is 84/(-1421)630/(-270)? 4/29 Calculate (-3 + 5)/((-6)/39) - 6. -19 Evaluate (-2 - -12)(2 + 2)(-223)/(-892). 10 What is the value of -11/6120? -20 Evaluate (4/36)/((-2)/(9 - -21)). -5/3 What is the value of (2/(-5))/(-12(-10 + -6)/32)? -1/15 What is 5/(-20)312/390? -1/5 Calculate 10/(-4) - (1633/46 - 31). -7 What is the value of (-6 + (-318)/(-36))/(67/804)? 34 What is 203/476 - (-45)/(-255)? 1/4 Calculate (720/680)/9 - (-312)/(-51). -6 What is the value of (-591 - -594) + ((-10)/(-6))/((-2)/12)? -7 Evaluate 26/(-5)(-12)/8 - 8. -1/5 (-3)/2((-20)/18 + 16/24) 2/3 What is the value of ((-60)/25)/(93/(-155))? 4 Calculate (-81)/729 + 78/(-27). -3 Calculate (-18)/387 + 1020/(-258) + 6 - 27. -25 Evaluate 211/(35/10). 6 7 - (-91)/13 - 15 - (-73)/71 2/71 Evaluate ((6 - 21/(-6))-1 - -9)/(-11). 1/22 5 - ((-1794)/345)/(-2 - (-14)/10) -11/3 Calculate 9 + -8 + 22 + -26. -3 (3 - 39/24)/(130/1040) 11 (-368)/(-138)(-3 + 0) - 13 -21 What is the value of 2/14(-9912)/(-10384)? 3/22 What is the value of 11970/(-2375) + ((-66)/22)/(6/(-10))? -1/25 What is the value of (3/15 - (-7)/(-35)) + 1/9? 1/9 Calculate ((-4)/2)/(-3 + 3 + -2)0. 0 Calculate 2/((-36)/582) + 146/(-219). -33 Evaluate (3 + -1)/2 + (-7 - -14) + 1. 9 (168/(-40) - (-7)/35) + (-2 - -10) 4 Evaluate 5/(-19)((-8)/(-14))/((-50)/(-35)). -2/19 Evaluate 1(-1 - -6 - 9). -4 Calculate -72 + 81 - (-18)/3. 15 Calculate ((-123)/105 + 1)240/(-192). 3/14 Calculate 1/(-1)-81(133/57)/7. 27 Calculate (0 + 60)((-1944)/90 - -22) - 2. 22 (-1036)/(-296)(-156)/(-21) 26 Calculate (20/(-6))/((-4080)/544). 4/9 Evaluate (3 - -6 - -6)/(258/(-344)). -20 Calculate (-21)/(-6) + 3 - -11(-81)/297. 7/2 Evaluate ((-8)/(-6))/(195/(-18) + (-3)/6). -2/17 What is (-9)/1-1 - 17980/1984? -1/16 Calculate (26/(-312) + 158/(-24))(-2)/(-4). -10/3 What is (-57 - -26) + 264/11? -7 What is the value of -145 + 160 + 514/(-34)? -2/17 What is -2 + 2 - 4 - (-1 + -18 - -26)? -11 What is (((-25)/2)/(65/(-13)))/((-3)/(-3))? 5/2 0/(-6 - 4/225/(-10)) 0 2/(4/(-22)) - (-97)/(26384/3040) 3/17 Calculate -23/12 + 100/(-8). -13 Evaluate 6 + -1 - ((-13)/(-10))/(164/615). 1/8 (-316)/18 + (-14398)/(-939) -20/9 Evaluate (6/(-21))/(28/4342/(-14)). 31 What is the value of 11 - ((-90)/(-15) + 2)? 3 Calculate 32/1288(-828)/(-216). 2/21 1/26 - 72540/(-12168) 6 9 - (-413)/(-42) - (3/2 + -2) -1/3 What is (4/522)/((22 + -40)/(-162))? 2/29 What is (-99)/3993(-330)/45? 2/11 (1 - 24/18)/(-1 + 185/180) -12 What is (((-4329)/(-592))/(-39))/(6/(-8)2)? 1/8 Evaluate (((-27)/30 - 1) + 312/(-195))-6. 21 What is (202/14 - 14/42) + (-4)/42? 14 Calculate (-9(-7 + (-434)/(-63)))/(-1). -1 What is the value of 80/198 + (19/36 - 171/228)? 2/11 18/10 - -17(-12)/102 -1/5 1/9-2 - (58310/(-1575) + 36) 4/5 (-7 + 9 - 24/14)/((-12)/(-7)) 1/6 Evaluate 31/186(-2 - 42/(-9)). 4/9 ((-4)/11)/((-17)/((-4675)/(-1950))) 2/39 What is the value of (3 - (4 + 15/6))(-10 - -16)? -21 What is the value of 13 - 15 - -2 - 11? -11 45441/3519 + 13/(-1) -2/23 Evaluate (-1 - 10/(-16))/(459/68). -1/18 What is the value of (-6)/33((23 - 12) + -6)? -10/11 What is the value of (66/20 + (-108)/(-540))(-120)/70? -6 34((-402)/(-84) + -5) - 4/(-14) -7 (568/78384)/(2/24) 2/23 What is the value of (-4)/14 + ((-18)/9 - (-13)/21)? -5/3 Evaluate (-86 + -128 + 213)-12/(-62). -1/31 What is the value of 10(-1 + 85/70 + 10/35)? 5 Calculate (-108)/9 + 42/2 + 6. 15 What is the value of ((-28)/42)/(46/759)? -11 Evaluate 93660/(-12042) - 10/(-9). -20/3 (50/40)/(24/(-192)) -10 What is ((-1)/8)/(-133 + 132)? 1/8 What is the value of 27 + (2 + -1 - 165/15)? 17 What is ((-28)/8)/(2/(-4)) - (-14 + 11)? 10 Evaluate 4/26(-585)/(-54). 5/3 Calculate -1(22/9 - 2). -4/9 What is 477/53 - -3(-72)/20? -9/5 (-13 - -1) + (6 - 18) + 38 14 Calculate 40/(-6) + -1510/(-25). -2/3 What is the value of (-28)/48 + 4/32(3 - 1)? -1/3 (72/(-12) + (-63)/(-6))(-9 + 5) -18 What is the value of -3 + (357/(-35) - (-144)/(-80))? -15 What is the value of (6320/(-960) + 7)18/(-20)? -3/8 (-1)/7 + (-4)/(-427/(-651)) -9 Calculate (14 + -21)/284/30. -1/30 What is the value of ((-23 - 12) + 30)8/(-70)? 4/7 Calculate 3 + 140/(-40)(-2 + 24/9). 2/3 Calculate -3810/(-48) - (-3 - -11). -1/12 Evaluate (-18)/2 - (27 + 4945/(-138)). -1/6 Evaluate ((-1288)/(-966))/((-184)/6). -1/23 What is (-790)/180 + 189/42? 1/9 What is (((-624)/(-90))/26)/(-1 - (-42)/54)? -6/5 (14/(-4))/(1533/10074) -23 16/6 + -2 - (-3014)/(-2055) -4/5 (7 + 25 + -34)(23/11 + -2) -2/11 What is the value of (0 + -4 - (-32)/5)/(32/(-240))? -18 Calculate (-8)/716/((-4608)/(-24)). -2/21 (9805/(-259) - -38) + 41/7 + 2 8 What is 4/(-6)(-18693)/1742 + (9 - 16)? 2/13 What is 216/(-45)(600/(-16))/15? 12 Calculate (-2 + (-8)/(-7))/(2/(-7)). 3 Calculate (-237)/(-17) - ((-2808)/1224)/39. 14 What is (-119)/(-28) - ((-45)/12 + 2)? 6 What is the value of (60/(-90))/((-24)/(-12)5-1)? 1/15 What is ((-46)/(-64))/((-27)/324) + (3 - -5)? -5/8 Evaluate (-17)/(476/40) + (-408)/(-756). -8/9 Calculate 13/(585/(-20))(-2 - 58/(-32)). 1/12 Evaluate 4(-13)/1040. 0 Evaluate -4(-27 + 17 + (-242)/(-24))93. -31 What is (-60)/(-150) + (408/55 - (-2)/11)? 8 Calculate 493/(-290)2 - 3/5. -4 3/9 - (-18 - (-1430)/429) 5 ((-3)/4 + 110/(-24))/((-235)/(-705)) -16 What is the value of (-2 + 34/(-2) + 89 + -95)-1? 25 1400/120 + -3 + 26/6 13 What is the valu	{ "pile_set_name": "DM Mathematics" }
p. Solve k(r) = 0 for r. -1, 1, 2 Let s(y) be the second derivative of y6/120 - y4/8 - y*3/3 + y. Let g(m) be the second derivative of s(m). Determine u so that g(u) = 0. -1, 1 Let f = 16 - 6. Suppose 2 = -2y + 5k + 1, 3y = k + 5. Suppose fa - 5 + 4 - 3 + 24ay = 0. What is a? -2/3, 1/4 Let w(r) be the second derivative of -r4/4 - r*3 - 8r. Determine x so that w(x) = 0. -2, 0 Let i be 6(-2 + (-4)/(-6)). Let v be (0 - -3)i/(-12). Factor 4s2 - 14s*3 - 3s*5 + 16s*4 + 0s*v - 3s*5. -2s*2(s - 1)*2(3s - 2) Suppose 12 = 7q - 4q. Let w(f) be the second derivative of -4f + 9/50f6 + 0f*2 + 1/5f*3 + 13/20f*q + 0 + 3/5f5. Solve w(p) = 0. -1, -2/9, 0 Let j(h) = -h3 - 10h2 - 10h - 6. Let x be j(-9). Suppose xi = i + 4. Factor 0 - 2/7w - 2/7wi. -2w(w + 1)/7 Factor 2 + 6h + h*3 + 2 - 2 + 4h2 - h. (h + 1)2(h + 2) Let p = 15 - 13. Let b(h) be the second derivative of -ph + 1/45h5 + 0h*4 + 0 + 0h*2 - 1/135h*6 + 0h*3. Let b(l) = 0. What is l? 0, 2 Let u = -69 - -72. Solve 12/7r - 4/7 - 12/7r2 + 4/7ru = 0. 1 Let p(a) be the first derivative of -a7/2520 - a6/540 - a5/360 - 4a3/3 + 5. Let l(x) be the third derivative of p(x). Suppose l(u) = 0. Calculate u. -1, 0 Suppose -i + 2u + 1 = 0, 3u - 3 + 7 = 2i. Let -8/3ti + 2/3t*4 + 0t + 0 + 8/3t3 - 2/3t*2 = 0. Calculate t. -1, 0, 1/4, 1 Let o = -10/107 - -1645/428. Determine d, given that od + 3d2 + 3/4 = 0. -1, -1/4 Let d(h) be the first derivative of -h6/3 + 2h*5 - 5h*4 + 20h*3/3 - 5h*2 + 2h - 10. Factor d(p). -2(p - 1)5 Let m(y) = y2 - 8y + 7. Let w be m(9). Find s, given that 5s - s + 4s + ws3 + 36s*2 = 0. -2, -1/4, 0 Suppose -3k - 4l + 29 = 0, 2 = -3k + 2l + 1. Let -k + 4x*2 - 4x*2 + 3x*2 = 0. Calculate x. -1, 1 Suppose 4v + 4k + 64 = 0, v - 4k - 4 = 2v. Let h be (4/(-10))/(4/v). Solve 14j + j*h - 14j = 0 for j. 0 Let s(n) = -2n2 + 12n + 2. Let r be s(6). Factor 2/3p - rp*2 + 4/3. -2(p - 1)(3p + 2)/3 Let l(p) be the third derivative of 1/48p4 + 1/120p*5 + 0p*3 + 0 + 0p + 3p2. Factor l(s). s(s + 1)/2 Suppose 38 = -3f + 4p, f + 0p - 5p = -31. Let n = f + 8. Suppose 12a + 2a*3 + na - 1 - 5 - 10a2 = 0. What is a? 1, 3 Let o(g) be the third derivative of g8/43680 + g7/3276 + g6/1560 - 3g5/260 - g4/6 + 5g2. Let c(k) be the second derivative of o(k). Factor c(y). 2(y - 1)(y + 3)2/13 Factor -10c + 14/3c2 - 2/3c*3 + 6. -2(c - 3)*2(c - 1)/3 Let k = -779/55 + 158/11. Solve 1/5 + 1/5v - kv*2 - 1/5v*3 = 0 for v. -1, 1 Factor 1/4g + 0g2 + 0 - 1/4g*3. -g(g - 1)(g + 1)/4 Let v be 10(-8)/(-160) - 6/28. What is y in 1/7y3 + 3/7y*2 + vy + 0 = 0? -2, -1, 0 Suppose -3q = -8q. Let u(i) be the third derivative of 0i4 + 1/60i*5 + 0 - 1/120i6 + i2 + 1/336i8 + qi + 0i3 - 1/210i7. Factor u(d). d2(d - 1)2(d + 1) Solve 23s2 - 50s*2 - 12s + 23s2 = 0. -3, 0 Let s(u) be the second derivative of -u5/120 - u4/24 + 9u*2/2 - 2u. Let c(i) be the first derivative of s(i). Factor c(n). -n(n + 2)/2 Let s(w) = -14w*2 + 10w. Let d(q) = 13q2 - 11q. Let h(g) = -4d(g) - 3s(g). What is r in h(r) = 0? 0, 7/5 Let d = -17 + -1. Let t be ((-1)/(-3))/((-2)/d). Factor -3gt - 11 + g + 8g + 5. -3(g - 1)2(g + 2) Let p(y) be the first derivative of 0y2 + 0y*3 - 1 + 0y - 1/9y4 - 7/27y*6 - 2/5y*5. Factor p(u). -2u*3(u + 1)(7u + 2)/9 Let v(c) be the second derivative of c6/150 + c5/25 + c*4/15 + 3c. Solve v(o) = 0. -2, 0 Let x(p) = 2p3 - 38p*2 + 50p - 24. Let i(m) = -m*3 + 13m*2 - 17m + 8. Let q(z) = 10i(z) + 3x(z). Factor q(t). -4(t - 2)(t - 1)*2 Let w(s) be the first derivative of 2s*3/27 - 4s*2/9 + 8s/9 + 17. Find g such that w(g) = 0. 2 Let n(u) be the third derivative of u6/24 - u5/4 - 5u4/6 + 10u*3 - 40u*2. Factor n(o). 5(o - 3)(o - 2)(o + 2) Let a(h) be the second derivative of -h8/6720 + h7/2520 + h6/360 - h4/6 + 3h. Let i(k) be the third derivative of a(k). Factor i(d). -d(d - 2)(d + 1) Let v be 24/132 - 3/(-44). Suppose vu*2 + 4 - 2u = 0. Calculate u. 4 Let c(m) = 3m3 - 3m*2 - 3m - 5. Let l(w) = -w3 + w2 + w + 2. Let d(s) = -3c(s) - 8l(s). Suppose d(j) = 0. Calculate j. -1, 1 Let b(x) = x. Let j(q) = -12q2 - 42q - 33. Let s(r) = 6b(r) + j(r). Let n(p) = -3p*2 - 9p - 8. Let d(f) = 9n(f) - 2s(f). Suppose d(u) = 0. What is u? -2, -1 Determine w, given that -3w + 4w*2 + 7w + w*5 + 82w*4 - 84w*4 - 3w*3 = 0. -1, 0, 2 Let k be ((-12)/27)/(-2 + 0). Suppose -4s = s. Determine n so that -kn2 - 2/9n + s = 0. -1, 0 Determine x, given that -47x + 48 - 30x*3 - 2x*4 - 41x + 5x4 + 99x*2 - 32x = 0. 1, 4 Let p(d) = 4d + 52. Let k be p(-13). Let m(o) be the third derivative of 1/180o*5 + 0 - 1/360o*6 + 0o*4 + 0o*3 + ko + o2. Factor m(i). -i2(i - 1)/3 Let h(o) = -11o*2 - 9o + 11. Let y(z) = -z*2 - z + 1. Let u(m) = -2h(m) + 18y(m). Let u(x) = 0. What is x? -1, 1 Let l(g) = 9g - 63. Let n be l(7). Let -2/7x3 + 0x*2 + 0 + nx = 0. Calculate x. 0 Let r(a) = a - 5. Let t be r(5). Suppose -n - 1 = i, 4 = -n + 4i + 18. Factor -3/2z + 3/2zn + t. 3z(z - 1)/2 Factor -48 - 166l*2 + 76l*2 - 32l + 86l2. -4(l + 2)(l + 6) Let r(m) be the third derivative of m7/3780 + m6/540 + m5/180 + m4/108 - m3/6 + 2m*2. Let a(h) be the first derivative of r(h). Factor a(y). 2(y + 1)*3/9 Let m = -13 + 13. Let l(x) be the first derivative of 0x*3 + 0x*2 + 1/3x*6 + 1 - 1/2x*5 + mx + 1/8x4. Factor l(k). k3(k - 1)(4k - 1)/2 Let b(c) be the first derivative of -4c5/5 + 4c*4 - 4c*3 - 8c*2 + 16c - 65. Suppose b(x) = 0. What is x? -1, 1, 2 Let a(f) be the third derivative of f6/75 - f5/75 - 2f4/15 + 2f*3/5 + 8f*2. Factor a(t). 4(t - 1)*2(2t + 3)/5 Let h be 15/1 - (-3)/(-1). Factor 2 - 4g*3 - 10g - 3g4 + hg + g5 + g5 + 5g4 - 4g*2. 2(g - 1)*2(g + 1)*3 Let b = 324 - 1289/4. Let l(s) be the first derivative of 0s*2 + 7/6s*6 + 4 + 0s + 2/3s3 - bs*4 - 2/5s5. Factor l(t). t2(t - 1)(t + 1)(7t - 2) Solve -2h - 1/4h*3 - 1 - 5/4h*2 = 0. -2, -1 Suppose -9h = h - 40. Let i(l) be the first derivative of hl - 2/3l3 + l2 + 2. Suppose i(j) = 0. What is j? -1, 2 Let z(u) = -7u + 1. Let t be z(-2). What is l in -17l*2 - 54l*4 - 7l + tl5 + 6 + 66l*3 - 7l*2 - 2l = 0? -2/5, 1 Let y(u) be the second derivative of -2u4/3 + 6u*3 + 10u*2 + 16u. Factor y(b). -4(b - 5)(2b + 1) Find o such that 1/4o*2 - 1/2o - 3/4 = 0. -1, 3 Let y(c) be the third derivative of -c*6/40 - 3c*5/4 - 75c*4/8 - 125c*3/2 + 4c2. Find m, given that y(m) = 0. -5 Let t(d) = d2 + 13d + 3. Let z be t(-13). Solve 2/5y - 2/5yz + 0 + 0y*2 = 0. -1, 0, 1 Let a(b) = -7b*3 + 5. Let v(q) = -6q*3 + q. Let c be v(-1). Let w(r) = 4r*3 - 3. Let z(s) = cw(s) + 3a(s). Solve z(n) = 0 for n. 0 Let f = -64 + 68. Let a(o) be the third derivative of 0o - 1/4of + 3o*2 + 1/20o*5 + 0 + 1/2o*3. Suppose a(t) = 0. Calculate t. 1 Let g(t) be the second derivative of -1/36t*4 + t + 0t*3 - 1/60t*5 + 0t*2 + 0. Solve g(h) = 0 for h. -1, 0 Suppose -2q = -0q - 4. Solve 2z*4 - 16z - 25z2 - 7 + 13z*q + 1 = 0 for z. -1, 3 Suppose 11 = 4r + 11. Let b = -4 - -8. Let rl + 1/3l*2 - 1/2l*3 + 0 + 1/6l*b = 0. What is l? 0, 1, 2 Factor 2h - 8/7h3 + 10/7h*2 - 4/7. -2(h - 2)(h + 1)(4h - 1)/7 Suppose 0 = p + 2j - 2, -19p + 35 = -15p - j. Find b such that -14b2 - pb - 8/7 = 0. -2/7 Factor 0j + 0j*2 - 2/5j*4 + 0 - 8/5j*3. -2j*3(j + 4)/5 Factor 10/13o + 2/13o*3 - 4/13 - 8/13o*2. 2(o - 2)(o - 1)2/13 Let r(u) be the second derivative of 2u*7/21 - 2u*6/5 + 2u*5/5 + 2u*4/3 - 2u*3 + 2u*2 - 25u. What is m in r(m) = 0? -1, 1 Let q(k) be the second derivative of 2k + 5/9k*3 - 2/9k*4 + 0 + 1/30k*5 - 2/3k*2. Solve q(c) = 0 for c. 1, 2 Let j(i) be the second derivative of 245i*4/12 - 35i*3/3 + 5i*2/2 - 42i. Factor j(o). 5(7o - 1)2 Let n(l) be the first derivative of l4 - 4l3/3 - 4l*2 + 5. Factor n(c). 4c*(c	{ "pile_set_name": "DM Mathematics" }
1 Suppose -2548 = 15i + 1982. Let b = i + 899. What is the tens digit of b? 9 Let h = 41361 - 29094. What is the hundreds digit of h? 2 Suppose -7u + 99880 = s + 2s, 3u + 66579 = 2s. What is the thousands digit of s? 3 Let d(r) = -2152r + 12955. What is the thousands digit of d(-21)? 8 Let n be (-4)/(-18) + 68(-4)/(-72). Suppose -r = -5 + n, -f - 2r + 207 = 0. What is the units digit of f? 5 Let k = -8820 + 15528. Suppose k = 9n - 7818. What is the tens digit of n? 1 Let k(g) = -g2 + 8g + 12. Let u be k(9). Suppose 4n + 48 = 4j, -2n + 50 = uj + 2n. Suppose j = 5t - 1. What is the units digit of t? 3 What is the units digit of 10/20 + (-92195)/(-10)? 0 Suppose -12z + 16 = -8z. Suppose 4c = -26 - 30. What is the units digit of 89((-7)/(c/z) - 1)? 9 Let v(r) = 10r + 75. Let n be v(-7). Suppose 2219 = na + 2a. What is the hundreds digit of a? 3 Let g = 86 - 125. Let a = -36 - g. Suppose -3j + 3 = 3h, -aj = 4h - 7h - 3. What is the units digit of j? 1 Suppose -62x - 180x = -22022. What is the units digit of x? 1 Suppose -2688 = -11r + 53720. Suppose 55p - r = 47p. What is the units digit of p? 1 Let u(h) = -3h*2 - 57h - 54. Let i be u(-20). Let f = i - -628. What is the tens digit of f? 1 Let h = 15 + -15. Suppose h = 2y - y - 2y. Suppose -z + 28 + 22 = y. What is the units digit of z? 0 Let y(o) = o*3 + 14o*2 - o - 6. Let q be y(-14). Let x be 11/22q1. What is the units digit of (3 + -130 + -4 - x)-1? 5 Let w = -1 - -110. Let m = w + -12. What is the units digit of m? 7 Let c(s) = 114s2 - 10s - 1. Let m be c(2). Suppose 2b - 1009 = m. What is the tens digit of b? 2 Let u(q) = -2104q*3 + 4q*2 + 26q + 32. What is the hundreds digit of u(-2)? 8 Let o be (6/15-2)/((-4)/30). Let r be o/(-8) + (155/20 - 7). Suppose -5c - 23 = 2t - 6, r = -4t + 3c + 31. What is the units digit of t? 4 Let r(o) = 8o*3 + 6o*2 + 14o - 29. What is the tens digit of r(7)? 0 Let o(m) = -m*3 + 10m*2 + 807m - 14. What is the tens digit of o(30)? 9 Suppose -84u - 217875 = -1309455. What is the thousands digit of u? 2 Let v = -302 + 305. What is the tens digit of 2/3 + 10/v - -311? 1 Let m = 895 + -411. Let y be 28/196 - m/7. What is the tens digit of 6/15 + -31y/15? 4 Let j(w) = 707w3 - 1412w*3 + 4 + 692w*3 + 6 + 5w - w*2. What is the hundreds digit of j(-4)? 8 Suppose 3f - 6 = -g - 3, 3g - 4f = 9. Suppose 3r - 2149 = 5x, 13x - 9x = gr - 2144. What is the units digit of r? 8 Let o = 4176 - 2218. What is the hundreds digit of o? 9 Suppose 2k = x + 95279, 21x - 26x = 4k - 190509. What is the ten thousands digit of k? 4 Let j(h) = 2h + 1. Let k = -9 - -7. Let b = 5 + k. What is the units digit of j(b)? 7 What is the hundreds digit of (133/(-57))/(1 + (-6464)/6462)? 5 Suppose 47s - 350 = 12s. What is the units digit of 1/s - (-7)/(-70)-3309? 1 Suppose -2j = -3j + 2t + 13, -5j = -3t - 30. Suppose jy = 5o + 442, 2y + 152 = -2o - 3y. Let h = -34 - o. What is the units digit of h? 2 Let a(p) = -2p*3 - 159p*2 - 483p + 174. What is the thousands digit of a(-77)? 7 What is the hundreds digit of -91787/(-12) - 36/144? 3 Let b be (-2)/(-3) - (-130)/30. Suppose -4c + 172 = a - 16, 4c - ba - 212 = 0. Suppose 0 = 2h + c - 210. What is the tens digit of h? 8 Suppose -3y = 6m - m - 538, 2m = -5y + 922. Let p = y + 148. What is the units digit of p? 4 Let l(a) = -a - 2. Let r be l(-4). Let i be 1900 + 2 - r-1. What is the units digit of i/21 + (-8)/(-6)? 2 Suppose 110720 = -205m + 225m. What is the thousands digit of m? 5 Let f be 5 - -80 - 0/(-1 + -1). Suppose -f = j - 391. What is the units digit of j? 6 Let a = -772 - -764. Let u = 1263 - a. What is the hundreds digit of u? 2 Suppose 5z + k - 504 + 67 = 0, 3z = 5k + 279. Let l be (3/(-2))/((-9)/(-60)). Let n = l + z. What is the tens digit of n? 7 What is the hundreds digit of (-13893)/264-340/15? 4 Suppose 4p - 31446 = -5m, -12576 = -12m + 10m - p. Suppose 42 = -14s + m. What is the units digit of s? 6 Suppose -1269l = -1208l - 891637. What is the units digit of l? 7 Suppose 0 = -758n + 754n + 9640. Suppose -n - 1334 = -12k. What is the hundreds digit of k? 3 What is the units digit of ((6 + 0)(-17)/102)/((-3)/81939)? 3 Suppose -2s + 21026 = -4q, -19s + 42040 = -15s - 5q. What is the hundreds digit of s? 5 Suppose -2777 + 57 = 20z. Let r = z + 952. What is the units digit of r? 6 Let m(d) = 6d2 + 304d + 641. What is the tens digit of m(61)? 1 Suppose -3b + 4j = 143, 5j + 35 = -4b - 135. Let h = b + 47. What is the tens digit of h15 + (-3)/1? 2 Let k = 217 + -225. What is the tens digit of (-273)/6(k + 2 + 0)? 7 Let k(y) = y*3 - 6y*2 - 7y + 36. Let i be k(6). What is the hundreds digit of (2415 - -3)/6 - i? 4 Let g = -7554 - -12815. What is the units digit of g? 1 Let w be (-2)/7 + (-16)/(-7). Suppose -v + 240 = -2u, wu + 240 = -v + 6v. Let j = 100 - u. What is the tens digit of j? 2 What is the thousands digit of 3(-318574)/(-126) - (-32)/(-336)? 7 Suppose -2k = -5s - 15, 11k - 2s = 13k - 8. Suppose 5o + 4595 = kp, 5o - 1130 = -3p + 1643. What is the tens digit of p? 2 Let r = 12029 - 8677. What is the hundreds digit of r? 3 Suppose 6c = -q + 4c + 507, -3q = c - 1511. Suppose q = 5p - 4j, 5j + 400 - 3 = 4p. Let g = p - 51. What is the tens digit of g? 5 Suppose 0 = 3u - b - 13, 2b = -4u + 1 + 3. Suppose -ut - 3o = -2433, 0 = -2t + 5t + 2o - 2437. What is the hundreds digit of t? 8 Suppose 729 = 3i - i + k, 3i + 4k - 1081 = 0. Let t = i - 182. Let a = t + -56. What is the hundreds digit of a? 1 Let r = -84 + 89. Suppose 402 = w + rw. Let i = w + 45. What is the tens digit of i? 1 Suppose 0 = 6w - 17w. Suppose w = -5g - 15 + 10. What is the tens digit of -1 + -4g40? 5 Suppose -23q = -3q - 6700. Suppose 23w - q = 3046. What is the tens digit of w? 4 Suppose 5n - 276412 = -4r + 52600, 3r - n = 246721. What is the tens digit of r? 4 Let w(i) = 51i + 32. Let b be w(8). Suppose -v = -3h + 1320, h - 5v - b = -3v. Suppose 3x = -2x + h. What is the units digit of x? 8 Suppose 50y - 7y - 1590197 = -40y. What is the thousands digit of y? 9 Let z = -306 - -305. What is the tens digit of (20/(-80))/(z/3268)? 1 Let s(v) = 596v + 7876. What is the units digit of s(53)? 4 Suppose 0 = 5o + 5f - 2312 - 26343, 24 = 4f. What is the thousands digit of o? 5 What is the thousands digit of -4 + 128/28 - 78555/(-35)? 2 Let n(d) = -3d2 + 34d + 49. Let z(v) = -17v2 + 171v + 244. Let y(a) = -11n(a) + 2z(a). What is the tens digit of y(-26)? 0 Suppose -20429 = -23q + 120515. What is the units digit of 1/((-8)/q)-2? 2 What is the thousands digit of 18 - (-324)/(-9) - -12340? 2 Suppose -g = -4c - 1928, -5g = -5c + 831 - 3226. Let s = c + 727. What is the tens digit of (s/(-6))/((-6)/27)? 8 Suppose 0 = -0q + 4q + w + 41, -4w = -2q - 34. Let s = q - -3. What is the tens digit of s + 11 + (-234)/(-3)? 8 Let v = 10288 + 7846. What is the units digit of v? 4 Let m be (-152)/(-15) + ((-590)/(-75) - 8). What is the units digit of (-69)/21(-42)/12m? 5 Let x(f) = 86f3 - f2 + 84f - 274. What is the hundreds digit of x(4)? 5 Let w = 8410 - 5066. What is the tens digit of w? 4 Let p(n) = 92n*2 - 233n - 7. What is the thousands digit of p(-5)? 3 Let n(y) = -y*3 - 25y*2 - 15y - 100. Let l(h) = -h*3 - 24h*2 - 15h - 102. Let v(o) = 3l(o) - 4n(o). What is the tens digit of v(-27)? 1 Let i be 20/(-12) - -2 - 80/6. Let o = -133 + i. Let m = -48 - o. What is the units digit of m? 8 Let d = 577 + -484. Let a = d + 174. What is the tens digit of a? 6 Let r be 22/3(1 + 2). Suppose -18 = rc - 34. Suppose -2d = cj - 18, -2d + 4 = j - 8. What is the units digit of j? 2 What is the tens digit of ((-12210)/(-40))/(1/(-40)-2)? 0 Let s be 49/21 + (-4)/(-6). Suppose 8i + 20 = si, i = -z. Suppose -610 = -9q + zq. What is the units digit of q? 2 Suppose f - 6 = 0, 5m - 53f = -52f + 337079. What is the hundreds digit of m? 4 Let p(d) = 4d3 - 3d*2 + d. Let j = 13 + -12. Let h be p(j). What is the tens digit of (-10 + 2)h/((-12)/147)? 9 Let r = -404 + 404. Suppose r = -a - 10 + 15, -4*q - a = -3105. What is the units digit of q? 5 Supp	{ "pile_set_name": "DM Mathematics" }
range 2 - 26o + 2 - 4 to the form j + no and give n. -26 Express -5u2 + 2u - 25 + 25 in the form gu + pu*2 + q and give g. 2 Express (-7d + 2d - 3d)(7d*3 + 0d*3 + 2d*3) in the form ld*3 + hd*2 + j + kd + pd4 and give p. -72 Rearrange (-5t*2 - 10t*2 + 24t*2)(1 + t*2 - 2t - 1) to ut2 + jt*3 + qt*4 + s + dt and give j. -18 Express 0p3 - p3 - 14p*2 + 20p*2 in the form i + sp*2 + gp + rp3 and give r. -1 Express -11 - q3 + 6q*3 + 15 as yq*2 + oq + s + aq3 and give a. 5 Rearrange -4o*2 - 3o*4 + 2o*2 - 2o + 3o3 - o3 to bo*3 + ho + xo2 + y + so*4 and give b. 2 Express 0x*3 - 1 - 2x*2 - 5 - 3x*3 + 0x*2 in the form yx*3 + cx*2 + h + sx and give c. -2 Rearrange 232 + 19u - 232 to the form k + mu and give m. 19 Rearrange 24 + 3w + w2 - 4w - 5w2 + 2w*2 to the form dw + gw2 + s and give d. -1 Rearrange (4y - y - 2y)(1 + 3 - 2) + 0y + 3 - 1 + 8y to s + xy and give x. 10 Rearrange -3 + 4k - 5k + 2k*2 + 26k*3 + 20k*3 - 48k*3 to the form pk*2 + v + ck*3 + lk and give p. 2 Express 3k2 + k4 + 2k3 - k2 + 0k3 + 1 as rk*3 + m + ok*2 + gk*4 + zk and give m. 1 Rearrange (1 + 0 + 1)(-7l*3 + 0l*3 - 2l*3) to the form bl*2 + tl*3 + w + dl and give t. -18 Rearrange 2z3 - 3z - 3z - 2 + 7z to cz + p + gz*3 + kz*2 and give p. -2 Express 26a*2 - 40a*2 + a - a as ka + ba2 + n and give b. -14 Express -17n*2 + 54n*2 - 4 - 18n*2 - 2n - 21n2 as mn + in2 + c and give c. -4 Rearrange -85 - b4 + 2b - b*3 + 2b + 87 + 2b2 to kb + ib4 + zb*2 + wb3 + q and give q. 2 Express n2 - n*2 + 7n*2 + (-8 + 8 + 3n)(0n + 0n - n) in the form qn*2 + b + an and give b. 0 Express -2c + 27 + 4c + 0c3 - 4c*3 - 28 in the form h + nc + lc2 + bc*3 and give h. -1 Express 1105o*3 - 4o*2 + 1 - 13 - 1107o*3 as zo*3 + jo*2 + b + ho and give b. -12 Express t - 1 + 1 + (-1 + 1 + 2t)(-1 + 5 + 10) as dt + s and give d. 29 Express 5f*2 - 4f*4 - 5f*2 + (17 + 8f - 17)(-2f3 - f2 + f*2) in the form xf*2 + hf*4 + v + nf + bf3 and give h. -20 Express 0b*2 - 2b*2 - 2b*4 - 2b + 3b4 + 0b*4 + 3b*3 in the form rb + j + gb2 + fb*4 + wb*3 and give w. 3 Rearrange (5 - 5 + 2n*2)((2n - 2n + n)(-2 + 2 - 1) + 0n - 2n - n) to o + gn*3 + pn*2 + an and give o. 0 Express (4f - f - 5f)(7 - 1 + 3) as of + z and give o. -18 Express 391 - 8w2 - 3w*2 - 391 in the form zw*2 + n + qw and give z. -11 Express (-3 - z + 3)(7 + 14 - 10)(2z + 4z - 2z) in the form gz + kz2 + b and give b. 0 Rearrange 8 + 1 - 2q*2 + 12 to w + cq + bq2 and give w. 21 Rearrange (11m*4 + 0m + 0m)((2 + 0 - 3)(6 - 3 - 2) + 0 + 3 - 2 - 3 - 1 + 5) to the form u + vm + xm2 + rm*3 + sm*4 and give s. 11 Rearrange 43n - 43n + 13n*2 to mn*2 + on + u and give m. 13 Express 11c2 - c3 - 17c*2 - 15c*2 - 2c as sc + dc*2 + qc*3 + w and give d. -21 Express -3g*3 + 21g - 36g + 16g + 20g3 - g2 in the form i + ng*2 + ug + lg3 and give n. -1 Rearrange 6j*3 - 2 + 36j - 36j to the form yj*2 + cj + t + zj3 and give t. -2 Express (n2 - n2 + n2)(-24n + 4n + 4n + (n + 0n + 0n)(-1 + 0 - 1) - 1 + 1 + n) in the form zn2 + f + vn*3 + sn and give z. 0 Express (-3y - 2 + 2)(2y3 + y3 + 4 - 2) as ny*4 + b + my*3 + iy + ly2 and give n. -9 Rearrange (-u + 1 - 1)(u*3 + 7u - 7u + (-9u*2 - 8u*3 + 9u*2)(-2 + 4 - 5)) to mu + au*4 + d + lu*2 + wu*3 and give a. -25 Rearrange 3l + 5 + 2l2 - 3l - 10 to il + yl*2 + p and give p. -5 Express 2c - 13c - 3c - 8c in the form j + oc and give o. -22 Rearrange -g*4 - 12g*2 + 0g - g*3 + 12g*2 - 4g to the form lg3 + bg*4 + dg + w + rg2 and give b. -1 Rearrange -z - 4z*3 - 227 + 223 - 2z*3 to nz + qz2 + yz*3 + m and give m. -4 Rearrange -23 + 9 + 14 - k to the form uk + g and give u. -1 Express (6a2 + a2 - 4a*2)(-3 + 1 + 2a2 + 7a*2) as na*2 + r + xa*3 + wa*4 + ua and give n. -6 Rearrange 12h2 - 2h - 6h2 - 5h*2 - 29h*4 to gh*4 + th*3 + j + ph + bh2 and give p. -2 Express -2s - s*3 + 2s + (-2s + s - s)(0s2 + s2 + s2) as is + hs2 + r + ps*3 and give p. -5 Express (-2r + 2 - 2r + 3r)(-2r + 5r - r + (-1 - 4r + 1)(0 + 2 + 1) - r + 4r - r) as k + cr + nr*2 and give n. 8 Express 2o - 8o2 - 2o - 82o2 in the form n + io*2 + xo and give i. -90 Rearrange (4 - 5 - 1)(-18m*4 - 1 - 2 - 5m + 16m4) to the form pm*2 + km*4 + xm + u + am3 and give u. 6 Express -2 + 3y*3 + 3 + 2y*4 + 34y*2 - 32y*2 - 13y*3 as sy*3 + f + xy + gy2 + oy*4 and give o. 2 Express -6w + 6w + 3w*2 as o + vw*2 + cw and give v. 3 Rearrange (-2j2 - 3 + 3)(-2j + 2j + 2j2) + (-3j*3 + 0j3 + j3)(10j + 6j - 6j) to s + aj4 + yj + cj3 + xj*2 and give a. -24 Express -2s*2 + 24s*2 + 4s*2 + 4s*2 in the form j + as*2 + ps and give a. 30 Rearrange 8j - 10j - 10j + (1 + 0 - 2)(0j + 2j - 3j) to the form hj + g and give h. -11 Rearrange -15g2 - 6g*2 + 4g + 16g2 to yg + xg2 + k and give x. -5 Rearrange -6p + 7p2 - 1 + p3 - 3p*2 - 4p*2 to the form g + lp + wp2 + jp*3 and give l. -6 Rearrange (3c + 0c + 3c)(2 - 4 + 3)(0 + 1 - 3)(2 - 2 - c) to kc + f + wc2 and give w. 12 Rearrange 44v*2 + 12 - 5 + 2v - 7 + 1 to the form c + nv2 + bv and give b. 2 Rearrange 2 + 1 - 4b4 + 3b*4 + (3b*2 - 2b*3 - 3b*2)(3b - 2b - 2b) to the form hb + ob2 + fb*4 + vb*3 + c and give f. 1 Rearrange 61n*2 - 31n*2 - 32n*2 + 17n to k + hn2 + sn and give s. 17 Express 37d + 4d*2 - 37d in the form cd2 + pd + t and give p. 0 Express -4 - b - 1 - 17b3 - 2 + 5 as qb*3 + wb + v + pb2 and give w. -1 Rearrange -3 + 3 + 76i*3 - 78i*3 - 2i*2 to ri*2 + qi*3 + s + ji and give q. -2 Rearrange (2w + 2w - w)((-1 + 2 + 1)(-1 + 1 + 3) - 5 - 2 + 6)(-1 + 1 + 2w) to the form t + rw + mw*2 and give m. 30 Express 10h + 48h + 22h - 16h in the form f + th and give t. 64 Express -c*2 + 3 - 6 + 5 - 2c + 2c4 as q + ac*2 + nc*3 + uc*4 + pc and give q. 2 Rearrange -9t + 4t - t*2 + 7t*3 + 5t to vt + k + nt*3 + at*2 and give n. 7 Rearrange (-9q*3 + 2q*2 - 6q*4 + 9q*3 + 2q)(0 + 0 - 1) to the form yq*4 + oq*3 + dq*2 + u + jq and give j. -2 Rearrange (-12 + 12 + 13f)(-3f + 5f - f)(-1 + f + 1) to v + gf*3 + uf + if2 and give g. 13 Rearrange 75 - 12k - 151 + 76 to ok + p and give o. -12 Express 27q + 28q - 54q + 10q2 as o + wq + pq2 and give w. 1 Express -5 - 3q*2 + 8 - 3 in the form t + lq*2 + fq and give l. -3 Express 59v2 - 29v*2 - 24v*2 - 8 as iv*2 + c + kv and give i. 6 Express 909 + 7i2 - 909 as bi*2 + si + a and give b. 7 Express 0o3 - o3 - 2o*2 + 16o2 - o3 in the form w + po3 + co + lo2 and give l. 14 Rearrange -4u + 7u + 3u + 5u + 0u - 3u + (4 - 1 - 5)(u + u - 4u) to au + s and give a. 12 Express (2 - 5 + 10)(0 + 0 - t)(5t2 - 6t*2 - 8t*2) in the form l + wt*2 + qt + bt3 and give b. 63 Rearrange 9d + 0d + 14d - 6d to the form h + sd and give s. 17 Express -6a + 12 - 12 as ka + i and give k. -6 Express ((-3 - 1 + 5)(-3 - 2 + 4) + 1 - 5 + 1)(-3 + 3 + 2j)(-4 - 4 - 5) in the form sj + n and give s. 104 Rearrange 54w*2 + 50w*2 + 31w*2 to z + ow + iw2 and give i. 135 Rearrange -6 + 6 + 35x + (x + 0 + 0)(1 - 1 - 2) to l + sx and give s. 33 Express -2i - 2i*4 - 7i4 - i3 + i + 5i4 - 1 in the form p + ui*3 + qi*4 + xi*2 + si and give s. -1 Rearrange 19y4 + 1 - 2y*3 - 6y*2 + 0 - 15y*4 + 5y*2 to the form dy*2 + x + gy + sy3 + cy*4 and give s. -2 Express 6v4 - v + v2 - 4v4 + 1 + 0v*2 + 0 in the form u + dv*2 + lv*3 + zv*4 + hv and give d. 1 Rearrange 47q2 + 715q - 715q to hq*2 + a + bq and give h. 47 Express (-4 + 5 - 7)(1 - 2 + 2)(-3s - 4s + 5s) as c + ds and give d. 12 Rearrange (2 - 1 - 2)(7 - 16 - 2h + 6h) to gh +	{ "pile_set_name": "DM Mathematics" }
closest to s? (a) 0.3 (b) j (c) -4 a Let y = -5.3 + 7.3. Let m be ((-56)/24 + 1)21/(-70). Which is the nearest to y? (a) m (b) 0.3 (c) 2 c Let d = -1511 - -1510. Which is the nearest to 66? (a) 2 (b) d (c) 4 c Let g = 589 - 844. Let n = 251 + g. Which is the nearest to 0.8? (a) -2 (b) 2 (c) 3 (d) n b Suppose 4h - 24 = -3d, 2h - 3h - 3d = 3. Let u be (-7 + h)2/(-10). Let q = -143 + 148. Which is the nearest to u? (a) q (b) -1.5 (c) -3 b Let d = 544 + -277. Let u = 255 - d. Which is the closest to -0.1? (a) -0.3 (b) u (c) 5 a Suppose -82 = -11h - 5. Let y be 28/(-40) + h/14. What is the nearest to -1.5 in 5, -2, y? -2 Let y = 193 + -409. Let j = y - -211. What is the closest to 1 in -2, j, 20/13? 20/13 Let r = 352.9 - 353.4. Let q = -2.6 - -3. Let k = q - 1.4. Which is the nearest to k? (a) 1/6 (b) r (c) 3 b Let j = 4 + -4.1. Let r = j - -5.1. Let p = 5.036 + -6.036. What is the closest to p in -4/7, -0.4, r? -4/7 Let z(v) = -v*3 + 76v*2 + 34v + 3308. Let h be z(77). Let f be ((-6)/(-20))/(6/(-8)). Which is the nearest to f? (a) h (b) -2 (c) -1 c Let h = 7936 - 7934. Which is the nearest to h? (a) 22 (b) 2/5 (c) 13/6 c Let q = 244 - 174. Let v = -70 + q. Let d = 122/5 + -25. What is the nearest to v in 4, d, -4/7? -4/7 Let s = 16049 + -16052. What is the nearest to 0.2 in 3/8, 14, 3, s? 3/8 Let m = 12.814 + -16.814. What is the closest to m in -2/3, 1/4, -3/2, -4? -4 Let i = 16589 - 33179/2. What is the closest to -2/3 in 0.02, i, -105, 4? i Let f = -0.46 + 0.538. Let d = 3.078 - f. Let n = -9 + 8.7. Which is the nearest to n? (a) d (b) -2 (c) 0.4 c Let q = -2/27 - 77/54. Let s = -4760 - -4760. What is the closest to s in -2, q, -1? -1 Let r be (2 + (2 - 1))/(51 + 105120/(-64)). Which is the nearest to r? (a) -5 (b) -3/4 (c) 3/7 c Let m = -0.15523 - -0.05523. Which is the nearest to -0.2? (a) 7 (b) m (c) 1/7 (d) -1 b Let w = -227 - -226.94. Let f = -0.96 - w. Which is the nearest to 6? (a) f (b) 2/11 (c) -3 (d) -1/3 b Let g = 7.7 - 8.2. Let w = -1609 - -1609. Let h = 0.31 - 0.17. What is the nearest to w in -0.3, h, g? h Let w = 5.1 + -0.1. Let d = 107.013 - 107. Let y = d - 1.013. Which is the nearest to 0? (a) y (b) -2/11 (c) w b Let d = -50 - -78. Suppose -2g = 2i - 2, 2i - 4i - d = -4g. Let x = 15/56 + -1/8. Which is the closest to 0.1? (a) g (b) x (c) 3 b Let z = -1.9 + -4.1. Let w(r) = r3 - 4r*2 + 8r - 8. Let m be w(4). Suppose 7p - 3 = -m. Which is the closest to z? (a) 4 (b) 0.2 (c) p c Let g = -20 - -18.8. Let v = g - -1.1. Let b = -389 - -370. What is the closest to v in 2, b, -2? -2 Let z = 179.46 + 0.54. Let o = z - 179.5. Which is the nearest to 3? (a) 0 (b) o (c) 1/6 b Let i = -4.11 - 0.89. Let q = -752/215 - -445693/860. Let k = -511 + q. What is the nearest to k in 2/3, 4, i? 4 Let m = -5300.5 - -5300. What is the nearest to 1 in 1/3, 2/5, -4, m? 2/5 Let j = -146.26 + 3.26. Let i = 142 + j. What is the nearest to i in 4/3, 7, -4/9? -4/9 Let o = 38.9 - 38.9. Let h = 17 - 17. Let m = 8 - 12. What is the nearest to h in m, o, 0.3? o Let m = 1 + -0.9. Suppose -2v + 186 = -22v + 51v. What is the closest to m in v, -0.1, 2/3? -0.1 Let l = 1/22 + -15/88. Let k = 1/15 - -1/35. Which is the nearest to -9? (a) k (b) l (c) -2 (d) 2/3 c Let a = -283.4 - -283.3. What is the nearest to a in 2, -1, 87, 2/3? 2/3 Let v = -1458 - -1460. Which is the closest to -2? (a) -2 (b) 0.1 (c) 0.12 (d) v a Let d = 21.01 - 21. Suppose -55l + 51l = -876. Let m = l - 1969/9. Which is the closest to -0.2? (a) d (b) m (c) 4 a Let f = -1162.7 + 1163. What is the closest to -1 in -0.13, -5, -1/9, f? -0.13 Let u = 5.5221 - 1.5221. What is the closest to 1/3 in u, -302, -5? u Let p = -8.309 + 8.009. Which is the closest to -2? (a) 0.09 (b) p (c) -3 (d) -2 d Let v = 1292.5 + -1292. What is the nearest to -0.11 in v, 1, -11, 2/5? 2/5 Suppose 166 - 2679 + 153 = 236i. Let s be (-5)/(-20) - (-2)/(-2). Which is the closest to s? (a) i (b) 3 (c) -2 c Let o = 7 + -8. Let n = 584.4 - 584.9. Let z = 3.1 - 3. Which is the closest to z? (a) 0.3 (b) n (c) o a Suppose -4n - 7n = -5n. Suppose n = -3j - d - 948, 2d - 112 = -j - 433. Let i be (-8)/(-36) + (-20)/j. Which is the nearest to 0.05? (a) 2 (b) 2/3 (c) i c Let j = -0.34832 - -0.24832. Let m = 25/12 - 11/6. Let q = -5.2 - -0.2. What is the closest to -2 in m, j, q? j Suppose -5z + 9u = 6u - 23, 3z - 4u = 16. Let x be (-112)/(-160) + z/(-5). Let j = -563/955 + -2/191. Which is the nearest to 1? (a) j (b) x (c) -2 b Let x = -11.065 - -9.065. What is the closest to x in -0.15, -24, 0? -0.15 Let o = 164 + -163. Let u = -5.04 - -3.04. Which is the nearest to o? (a) 0.3 (b) -3 (c) 2 (d) u a Let m(i) = 1240i + 1642. Let j be m(-1). Which is the nearest to -0.1? (a) j (b) 0.4 (c) -3 b Let t = 7 - 10. Suppose -27w = -30w + 9. Let v = -4.73 - -0.73. What is the nearest to w in 5, t, v? 5 Let z be (-5 - -9)(-6 + 88/16). Let v be (-3)/6 - 18/4. Let k = 0.34 - -0.06. Which is the closest to z? (a) k (b) 4/7 (c) v a Let p = -16363 + 16359. What is the closest to 2 in 1/2, -0.5, -0.3, p? 1/2 Let d be ((-794871)/148)/(-63) - 3/125. What is the closest to -0.06 in 3, -0.1, 4, d? -0.1 Let p = 129.5 + -129.55. Let q = -59/2 - -29. What is the closest to -1 in p, -1, q? -1 Let m = 6/877 + -5629/694584. What is the closest to -2/3 in -2/13, m, -0.4? -0.4 Let z be -1 + 1 - (-183)/36. Let p = 16/3 - z. Let d = -103/3 + 34. Which is the closest to d? (a) p (b) -0.2 (c) -1 b Let n = 0.04927 + -0.14927. Which is the closest to n? (a) -0.49 (b) 3 (c) 5 (d) 4 a Let q = 94 + -93. Suppose 4l - 15y - 17 = -18y, 0 = -4l - 5y + 15. What is the nearest to q in 0.11, l, -1? 0.11 Let w = -7880/3 - -2627. Let a = -2/287 - 267/2870. Let j = -4.97 + -0.03. What is the nearest to w in j, a, -4? a Let y be 7(-1 + (-13)/(-7)). Let s be 20/110 - y/(-88). Let j = -0.9792 + -0.0208. Which is the closest to j? (a) s (b) -3 (c) 2.2 a Let m = -47403 - -47402. Which is the nearest to m? (a) -1 (b) -5 (c) -6/11 a Let p = 897/5 + -180. Let u = 0.46 - 12.36. Let d = 12 + u. What is the closest to -0.07 in p, 0.3, d? d Let i = -26774 - -26777. Which is the nearest to 1142? (a) 0.5 (b) -0.3 (c) i c Let n(s) = -s*2 - 44s - 480. Let h be n(-19). Let i be (-3)/(-1)(-16)/(-42). What is the nearest to -1 in h, i, -0.5? -0.5 Let x = 138394 - 138390. Let g be ((-1)/1)/(3/(-3)). What is the closest to g in 1, 0.3, x? 1 Let m = 5 - 5. Suppose 5k = -3y - my + 157, -3k + 4y = -100. Let f be 3 + ((-228)/k - -4). What is the nearest to -5/6 in 4, 1/3, f? f Let o = -0.9015 + 2.9015. Which is the nearest to -1? (a) 2/17 (b) o (c) -0.08 c Suppose -164 = 3z + 2k - 155, -5z - 4k = 13. Which is the nearest to 14? (a) 1 (b) z (c) -0.13 a Let m(i) = -i*2 + 16i - 53. Let p be m(11). Suppose r - 9y = -5y + 4, py = -2. Which is the closest to r? (a) 5 (b) 0.4 (c) 0.08 c Let h = 919/9 - 102. Let u = 2 + -4. Let i be -2(6 + (-351)/65). Which is the nearest to -1? (a) u (b) h (c) i c Let t(s) be the first derivative of -s*3/3 + 81s + 19. Let q be t(9). Which is the nearest to 71? (a) q (b) 5 (c) -0.1 b Let o = 249.02 + -247. Let f = 0.02 - o. Suppose 29p = -2l + 24p - 78, -l - 63 = 4p. Which is the nearest to l? (a) 0.2 (b) -0.4 (c) f a Let u = -1.96 - 0.04. Let s = -1/233 - -703/932. Let f = 26 + -26. Which is the closest to -3? (a) f (b) u (c) s b Let y = -15 - -10. Suppose 0 = 4t - 4o - 4, 37o = 3t + 42o + 21. Let c = -3.8 + 1.8. What is the nearest to c in t, 0.09, y? t Let p = 0.38 + -0.08. Let b = -0.01509 + 0.11509. What is the nearest to 0.1 in p, 1, b? b Let n = 58 - 54. Let z(v) = -2v + 1. Let r be z(-1). Let g be 8/(5 - 1) + r. Which is the nearest to 0? (a) g (b) -0.01 (c) n b Let y(r) = 70r + 1257. Let m be y(-18). What is the closest to 1 in -5, m, 2, -1/2? 2 Let p = 2/3193 + 6352/54281. What is the nearest to p in -20, -3, -4? -3 Let r be (-8)/48(4 - (-2 - -4)). Which is the nearest to -4? (a) 4 (b) 0.5 (c) 3/11 (d) r d Let i be (-1)/1 + (-7)/(-9). Let o = -0.9 - -1. Let r = -34.4 + 34.7. Which is the nearest to o? (a) -4 (b) r (c) i b Let m = -1.1 + 1. Let l = 0.37 -	{ "pile_set_name": "DM Mathematics" }
nd 1 b when three letters picked without replacement from oibi? 1/4 Calculate prob of picking 1 a and 2 w when three letters picked without replacement from {w: 3, a: 15}. 15/272 Calculate prob of picking 2 m when two letters picked without replacement from {p: 11, m: 9}. 18/95 Three letters picked without replacement from fejjfffjfjfjffj. What is prob of picking 1 e, 1 j, and 1 f? 48/455 What is prob of picking 1 z, 1 h, and 1 n when three letters picked without replacement from {n: 1, b: 1, l: 2, h: 2, z: 2}? 1/14 Two letters picked without replacement from xmimmmmmm. What is prob of picking 1 x and 1 m? 7/36 Calculate prob of picking 1 x, 1 j, and 1 k when three letters picked without replacement from {v: 2, k: 1, x: 6, j: 3}. 9/110 Three letters picked without replacement from zfzzfzfzzzfzszzfz. Give prob of picking 1 s and 2 z. 11/136 Calculate prob of picking 2 q and 1 l when three letters picked without replacement from {t: 4, m: 1, b: 3, l: 2, q: 2, h: 3}. 2/455 What is prob of picking 1 k and 1 f when two letters picked without replacement from {n: 2, k: 5, g: 1, f: 1}? 5/36 Two letters picked without replacement from {s: 1, c: 3, k: 2, h: 1, n: 6}. Give prob of picking 1 h and 1 k. 1/39 Two letters picked without replacement from zzzbkkvkkbzzzvkzzzkz. What is prob of picking 2 b? 1/190 Calculate prob of picking 2 m and 1 x when three letters picked without replacement from wmwxxxxwwwwwxwwmxw. 1/136 Two letters picked without replacement from xxsfffss. What is prob of picking 1 f and 1 s? 9/28 Calculate prob of picking 1 k and 2 f when three letters picked without replacement from {k: 1, f: 3, i: 4}. 3/56 Calculate prob of picking 2 r when two letters picked without replacement from lgilrgiiiirlrrlrii. 10/153 What is prob of picking 1 a, 1 l, and 1 t when three letters picked without replacement from raarradddtaddal? 1/91 What is prob of picking 1 n and 1 e when two letters picked without replacement from enlelle? 1/7 Calculate prob of picking 1 k and 1 o when two letters picked without replacement from {o: 7, k: 6}. 7/13 What is prob of picking 3 o when three letters picked without replacement from {o: 7, e: 3}? 7/24 What is prob of picking 1 d, 1 n, and 1 z when three letters picked without replacement from {n: 8, d: 1, z: 1, t: 3, b: 2, a: 1}? 1/70 Calculate prob of picking 3 z when three letters picked without replacement from {y: 1, o: 3, a: 2, z: 4, l: 1}. 4/165 Four letters picked without replacement from occoooooooooo. Give prob of picking 2 o and 2 c. 1/13 Three letters picked without replacement from {m: 2, j: 7}. What is prob of picking 2 j and 1 m? 1/2 Three letters picked without replacement from mooorprcommcmormpo. What is prob of picking 1 m, 1 p, and 1 c? 5/204 Four letters picked without replacement from {z: 1, b: 6, m: 7, g: 2, j: 1}. What is prob of picking 1 b, 2 m, and 1 z? 9/170 Two letters picked without replacement from jjbjtbjjbvxv. Give prob of picking 2 j. 5/33 Calculate prob of picking 2 p when two letters picked without replacement from uuueupuuuepuu. 1/78 Three letters picked without replacement from {f: 2, q: 2, b: 1, o: 1, e: 1, r: 1}. Give prob of picking 1 o, 1 e, and 1 b. 1/56 What is prob of picking 3 z when three letters picked without replacement from {z: 19, u: 1}? 17/20 Two letters picked without replacement from giggggpwg. What is prob of picking 1 p and 1 w? 1/36 Four letters picked without replacement from {r: 3, u: 5, k: 4, q: 1}. What is prob of picking 1 u, 2 r, and 1 k? 12/143 Two letters picked without replacement from iiqciqyyqqcqpcypoqi. Give prob of picking 1 y and 1 c. 1/19 Two letters picked without replacement from {r: 1, c: 1, e: 1}. What is prob of picking 1 c and 1 e? 1/3 Calculate prob of picking 2 o when two letters picked without replacement from oooooo. 1 What is prob of picking 2 t and 2 i when four letters picked without replacement from {t: 4, b: 1, m: 1, i: 4, o: 3}? 36/715 Calculate prob of picking 1 i, 1 m, and 2 g when four letters picked without replacement from igimg. 2/5 What is prob of picking 1 e, 2 h, and 1 u when four letters picked without replacement from {g: 4, e: 2, u: 1, h: 3, c: 1}? 1/55 Calculate prob of picking 3 f when three letters picked without replacement from {o: 3, u: 7, s: 2, f: 5, z: 1}. 5/408 Three letters picked without replacement from eedmemm. What is prob of picking 3 m? 1/35 Three letters picked without replacement from {e: 3, p: 4}. What is prob of picking 3 e? 1/35 Two letters picked without replacement from {o: 1, n: 1, a: 2, p: 1}. Give prob of picking 1 n and 1 a. 1/5 What is prob of picking 4 j when four letters picked without replacement from ajmjmcammujacajj? 1/364 What is prob of picking 2 v when two letters picked without replacement from {b: 1, j: 3, v: 6, i: 1, q: 3}? 15/91 Three letters picked without replacement from oooososapeoossa. What is prob of picking 1 a and 2 o? 6/65 Calculate prob of picking 1 t and 1 f when two letters picked without replacement from {d: 9, q: 7, t: 1, j: 1, f: 2}. 1/95 Calculate prob of picking 4 k when four letters picked without replacement from kkzkkkkkkkkkk. 9/13 Two letters picked without replacement from {w: 2, k: 8, f: 4}. Give prob of picking 2 w. 1/91 Calculate prob of picking 3 w when three letters picked without replacement from www. 1 Four letters picked without replacement from {a: 1, i: 4, p: 1, f: 3, w: 4, r: 1}. Give prob of picking 3 f and 1 r. 1/1001 Four letters picked without replacement from ydddyiiildlyyydiiij. Give prob of picking 4 d. 5/3876 Three letters picked without replacement from suloqouuuquqsouduus. What is prob of picking 1 u and 2 o? 8/323 What is prob of picking 2 c and 1 n when three letters picked without replacement from fjpcfynjfcffffnjfnf? 1/323 Two letters picked without replacement from {z: 2, x: 2}. What is prob of picking 2 x? 1/6 Two letters picked without replacement from zzrzzznnzzzrzzzznr. Give prob of picking 2 r. 1/51 Calculate prob of picking 1 v and 1 u when two letters picked without replacement from {u: 2, v: 5, e: 8}. 2/21 Two letters picked without replacement from iaaiiiai. Give prob of picking 2 i. 5/14 Three letters picked without replacement from {f: 3, a: 3, q: 2}. What is prob of picking 2 q and 1 a? 3/56 Four letters picked without replacement from {u: 2, l: 4, j: 2}. What is prob of picking 2 u and 2 j? 1/70 Calculate prob of picking 1 j and 1 t when two letters picked without replacement from {j: 2, g: 1, e: 1, t: 2, u: 2}. 1/7 What is prob of picking 2 v and 1 d when three letters picked without replacement from ydvdvy? 1/10 What is prob of picking 1 s and 1 t when two letters picked without replacement from {s: 3, y: 2, t: 3, a: 1, w: 1}? 1/5 Two letters picked without replacement from {f: 4, r: 2, b: 10, s: 4}. What is prob of picking 1 f and 1 s? 8/95 Calculate prob of picking 2 j when two letters picked without replacement from jjjjjryejyypj. 7/26 Calculate prob of picking 1 r and 3 c when four letters picked without replacement from czrckrkrrrrcrq. 1/143 Four letters picked without replacement from bolozohkzhzolzz. Give prob of picking 2 z and 2 h. 2/273 Four letters picked without replacement from {f: 2, o: 3, x: 1, n: 1}. Give prob of picking 2 o, 1 f, and 1 n. 6/35 What is prob of picking 1 n and 1 x when two letters picked without replacement from nnnnnnnnnnxxxnxnxn? 65/153 Three letters picked without replacement from {j: 6, u: 4}. Give prob of picking 1 j and 2 u. 3/10 What is prob of picking 1 r and 1 d when two letters picked without replacement from pdrlpur? 2/21 Calculate prob of picking 1 g and 1 x when two letters picked without replacement from {g: 2, b: 5, r: 3, h: 1, x: 1, u: 1}. 1/39 What is prob of picking 1 n and 1 y when two letters picked without replacement from ypnkddnddddkdknnpydn? 1/19 What is prob of picking 2 z and 1 u when three letters picked without replacement from {z: 6, u: 2}? 15/28 Calculate prob of picking 1 g, 2 z, and 1 w when four letters picked without replacement from {w: 4, u: 4, z: 3, c: 1, g: 2}. 24/1001 What is prob of picking 2 i and 1 j when three letters picked without replacement from {x: 1, i: 2, j: 1, b: 3}? 1/35 Three letters picked without replacement from {e: 2, o: 4, p:	{ "pile_set_name": "DM Mathematics" }
escending order. 8, 3, -89405 Sort 1/4, -0.07, -0.5, -0.08, -5/4 in descending order. 1/4, -0.07, -0.08, -0.5, -5/4 Put -2, 1/6, 6, -0.031, 26 in ascending order. -2, -0.031, 1/6, 6, 26 Put -5, 1453, 1, -2 in decreasing order. 1453, 1, -2, -5 Sort -7, -8/59, 0, -0.3 in increasing order. -7, -0.3, -8/59, 0 Put -38, -9, -2 in decreasing order. -2, -9, -38 Sort 302, 17, -4, 46. -4, 17, 46, 302 Put -0.79119, 2, 3 in increasing order. -0.79119, 2, 3 Sort -434, 10, 1 in descending order. 10, 1, -434 Put 2/19, -5, 1106, -0.3, -5/4 in ascending order. -5, -5/4, -0.3, 2/19, 1106 Put -15, -1, -428, -3, 0 in decreasing order. 0, -1, -3, -15, -428 Sort -1, 2, 522, -133 in descending order. 522, 2, -1, -133 Sort -2/5, 5, -6, -80, 5/3, 0 in ascending order. -80, -6, -2/5, 0, 5/3, 5 Sort -0.5, 5, 4503. -0.5, 5, 4503 Put -2, 1, -18567, -3, -5, 2 in ascending order. -18567, -5, -3, -2, 1, 2 Put -4, -52939, -5 in ascending order. -52939, -5, -4 Sort 24, -3, 2888, 0 in decreasing order. 2888, 24, 0, -3 Put 1, -12, 11, 6, -24, 4 in ascending order. -24, -12, 1, 4, 6, 11 Sort -1.2, 2853, 28 in increasing order. -1.2, 28, 2853 Sort 1/17, -0.25, -0.3 in increasing order. -0.3, -0.25, 1/17 Sort -8, 3/7, -3/11, 2/17 in descending order. 3/7, 2/17, -3/11, -8 Sort 7, 1, -116, 5, -78 in decreasing order. 7, 5, 1, -78, -116 Put -12, 37, -5, 1, -3 in increasing order. -12, -5, -3, 1, 37 Sort 5, 38, -297, 1 in increasing order. -297, 1, 5, 38 Sort -7, 3, -2, -6, -23 in ascending order. -23, -7, -6, -2, 3 Put 15, -4/7, 0.1, 0 in descending order. 15, 0.1, 0, -4/7 Put -3, 5, -8, -2, 732, 3 in descending order. 732, 5, 3, -2, -3, -8 Sort 10, 20, -3, 5, -8, -1. -8, -3, -1, 5, 10, 20 Sort -14, -2, -51, -1, -10. -51, -14, -10, -2, -1 Sort -380, 1/8, 16.4 in decreasing order. 16.4, 1/8, -380 Put -4, -7, 0.1, -2, -28, -5 in increasing order. -28, -7, -5, -4, -2, 0.1 Sort -0.2, -4/7, -869/2, 24, 2/7 in descending order. 24, 2/7, -0.2, -4/7, -869/2 Sort 0, 8, 2, -409 in decreasing order. 8, 2, 0, -409 Put 20, -13.5, -0.2, 2/19 in increasing order. -13.5, -0.2, 2/19, 20 Sort -1, -3, 1, 0.0747, -0.66 in descending order. 1, 0.0747, -0.66, -1, -3 Sort -2, 0.4, -3167, 3, 0.1, 1/2. -3167, -2, 0.1, 0.4, 1/2, 3 Sort 0, -220, -6, 143 in descending order. 143, 0, -6, -220 Sort -5, -68, 3, -3, 5, -2. -68, -5, -3, -2, 3, 5 Sort 2367, 3/7, 4, -42. -42, 3/7, 4, 2367 Sort 0.1, -10, -5/3, 5/6, 3.16 in descending order. 3.16, 5/6, 0.1, -5/3, -10 Sort -2, 7, -1029, 5, 52 in ascending order. -1029, -2, 5, 7, 52 Put 0.035, -2/3, 3 in descending order. 3, 0.035, -2/3 Sort 2, 310, 60 in descending order. 310, 60, 2 Sort -12, 169, 9, 4 in ascending order. -12, 4, 9, 169 Sort 64, -12, 5, -5, 4. -12, -5, 4, 5, 64 Sort -80/27, -2/3, 0, -0.1, 4, 1/4. -80/27, -2/3, -0.1, 0, 1/4, 4 Put 0.2, -50, 0.4, -0.04, 0.01 in ascending order. -50, -0.04, 0.01, 0.2, 0.4 Put -1, -2, 1/10, 0.0875 in descending order. 1/10, 0.0875, -1, -2 Sort -4, 13/62, 4, 4/5, -2, -5/3 in descending order. 4, 4/5, 13/62, -5/3, -2, -4 Sort 11.66, 0.4, 5/4, -1, -5, 0.3. -5, -1, 0.3, 0.4, 5/4, 11.66 Sort 3, -7, -22, -5, -15. -22, -15, -7, -5, 3 Sort -2/7, -3.9, -1762, -3 in increasing order. -1762, -3.9, -3, -2/7 Put -4, -2/11, -2.4, 7.1, 2, 0.3 in decreasing order. 7.1, 2, 0.3, -2/11, -2.4, -4 Put -1, -9, 2, 192 in descending order. 192, 2, -1, -9 Sort 0.5, 1/12, -0.5, -476, -2, -4 in descending order. 0.5, 1/12, -0.5, -2, -4, -476 Sort 4/27, 4, -5, 1/1077, 0.5, 2/9 in decreasing order. 4, 0.5, 2/9, 4/27, 1/1077, -5 Sort 5, -5, -3, 13, 347, 2 in decreasing order. 347, 13, 5, 2, -3, -5 Sort -1, -4, -0.453 in decreasing order. -0.453, -1, -4 Sort 3/4, -2, -1/2, 96, -519/7 in descending order. 96, 3/4, -1/2, -2, -519/7 Put -2, -12467, -5 in decreasing order. -2, -5, -12467 Sort -112, 18, 2, -145. -145, -112, 2, 18 Sort 5, -3445, -3 in ascending order. -3445, -3, 5 Sort 3, 1011, 5. 3, 5, 1011 Put -13/2, -0.0489, -0.5, 6, -4 in ascending order. -13/2, -4, -0.5, -0.0489, 6 Put 1, 13, -1, 2, -4 in increasing order. -4, -1, 1, 2, 13 Sort 0, -69, -13, 5, -3 in ascending order. -69, -13, -3, 0, 5 Sort 24, -100, 11. -100, 11, 24 Sort 4, 26213, 3 in decreasing order. 26213, 4, 3 Sort 238/5, 7, -0.2, -2/3, -1/3 in decreasing order. 238/5, 7, -0.2, -1/3, -2/3 Sort 5, -63207, 1 in decreasing order. 5, 1, -63207 Sort 5, 2, -2, 12, 11082, -4 in descending order. 11082, 12, 5, 2, -2, -4 Put -31, 4, -88, -80 in increasing order. -88, -80, -31, 4 Put 7, -53809, -0.4 in descending order. 7, -0.4, -53809 Sort 2/41, -0.2, -1, 2/5, 0.77. -1, -0.2, 2/41, 2/5, 0.77 Put 2/9, 2/7, -1/10, 4.2, 96, 1 in descending order. 96, 4.2, 1, 2/7, 2/9, -1/10 Put -2, -5, -46914 in decreasing order. -2, -5, -46914 Sort 0.1, 0.047, -0.5, -3. -3, -0.5, 0.047, 0.1 Put -1081, 0, -5, 9, 5 in increasing order. -1081, -5, 0, 5, 9 Sort 591, 3, 51 in descending order. 591, 51, 3 Sort -4, -8, -6365, 0. -6365, -8, -4, 0 Sort 11003, 1, 2. 1, 2, 11003 Put 4, -9, -3, -59, -44 in ascending order. -59, -44, -9, -3, 4 Put -3, 1, 7, -2, 14, -13 in ascending order. -13, -3, -2, 1, 7, 14 Sort -2, 265, 3, 105 in ascending order. -2, 3, 105, 265 Put 133, -27, -2, -1, -10, -5 in decreasing order. 133, -1, -2, -5, -10, -27 Put -1/4, -0.8, 3/4, 14818 in decreasing order. 14818, 3/4, -1/4, -0.8 Sort -1, 11, 5, -5, 3, -4 in decreasing order. 11, 5, 3, -1, -4, -5 Put -3, 67, 5, -140 in decreasing order. 67, 5, -3, -140 Sort 974, -3, -9, 71, 5 in increasing order. -9, -3, 5, 71, 974 Sort 2, 5, -385, -115 in descending order. 5, 2, -115, -385 Sort 10, 4, -3, 1, -7, 86 in descending order. 86, 10, 4, 1, -3, -7 Put -19/12, 259, -1 in descending order. 259, -1, -19/12 Sort -0.2, -3/7, -0.153, -0.1, -11 in descending order. -0.1, -0.153, -0.2, -3/7, -11 Sort -5.7, 2, 1.47 in descending order. 2, 1.47, -5.7 Sort 6, 5, -3, -3595 in decreasing order. 6, 5, -3, -3595 Put -1, 7, 41, -12, 18 in decreasing order. 41, 18, 7, -1, -12 Put 5143, -4, 1, 37 in increasing order. -4, 1, 37, 5143 Sort -5.7, 48, 0.04 in descending order. 48, 0.04, -5.7 Sort -122985, -0.2, -3. -122985, -3, -0.2 Sort 25, 1, 0, -3 in descending order. 25, 1, 0, -3 Put 27, 7, -1/8, 0.5, -3, 0.7 in descending order. 27, 7, 0.7, 0.5, -1/8, -3 Sort -30, -2393, 1. -2393, -30, 1 Put -267, 27, -4, -1, 6 in increasing order. -267, -4, -1, 6, 27 Sort -1, 16, -100 in descending order. 16, -1, -100 Put -24, 0.7, 3, 2/5, -9 in descending order. 3, 0.7, 2/5, -9, -24 Put -0.789, 2, -309 in decreasing order. 2, -0.789, -309 Put -2119444, -1, 4 in increasing order. -2119444, -1, 4 Sort -1.1263, 2, -5, 0.2 in descending order. 2, 0.2, -1.1263, -5 Put 0, 5/3, -295.51, -3 in decreasing order. 5/3, 0, -3, -295.51 Sort 4, 5, -2, -490, 1/5, -31 in ascending order. -490, -31, -2, 1/5, 4, 5 Sort 4, 0, 201943. 0, 4, 201943 Put 365, 5, 0, -6 in increasing order. -6, 0, 5, 365 Sort -0.12, 1/4, 0.11, 10 in descending order. 10, 1/4, 0.11, -0.12 Put 1.7, -5, -2, -2/3, -28, 1/4 in decreasing order. 1.7, 1/4, -2/3, -2, -5, -28 Put -0.5, 1/42, 5/3 in descending order. 5/3, 1/42, -0.5 Sort -2/691, 0.5, 174. -2/691, 0.5, 174 Put 1, -0.7, -1.4, 5 in ascending order. -1.4, -0.7, 1, 5 Sort 3, -14, 55443 in descending order. 55443, 3, -14 Sort 3, 0, -3, -4681 in increasing order. -4681, -3, 0, 3 Sort 10, 6, 2, 4, -5, -1 in increasing order. -5, -1, 2, 4, 6, 10 Sort 6, -18, -2, -1, -9 in decreasing order. 6, -1, -2, -9, -18 Put 0.089, 4, -0.06, -0.4 in increasing order. -0.4, -0.06, 0.089, 4 Sort 7/2, -4.8, -14, -0.5, -0.1 in increasing order. -14, -4.8, -0.5, -0.1, 7/2 Sort -6, 17, 4, 72, 5, -5 in decreasing order. 72, 17, 5, 4, -5, -6 Put 0, -258, 5, 9 in descending order. 9, 5, 0, -258 Sort -29, 0.2, 5, 1/2, 0, 9/59 in ascending order. -29, 0, 9/59, 0.2, 1/2, 5 Sort -1, 10, -4, 5, 7, -3 in increasing order. -4, -3, -1, 5, 7, 10 Sort 5, 4, -2, -1315, -1. -1315, -2, -1, 4, 5 Sort -790, -0.3, 1/19 in descending order. 1/19, -0.3, -790 Put -228, -32, -5 in ascending order. -228, -32, -5 Put 4, 2/7, -2/7, 862, 0 in descending order. 862, 4, 2/7, 0, -2/7 Put 0.2, 23.1, -18, -0.3, -1 in increasing order. -18, -1, -0.3, 0.2, 23.1 Put 2, -5, 1, -7, -3 in descending order. 2, 1, -3, -5, -7 Put 5, 2, -585, -5, 1 in increasing order. -585, -5, 1, 2, 5 Sort 5, 0.3, -6/4691, 4. -6/4691, 0.3, 4, 5	{ "pile_set_name": "DM Mathematics" }
= f*2 - 6f - 3. Is p(r) a prime number? True Suppose 2d = 2k + 2k - 160, -2k - d + 76 = 0. Suppose -5h = -h - 3a - 159, k = h - a. Is ((-3)/(-6))/(1/h) composite? True Let y be (-281)/(-9) - (-14)/(-63). Suppose y = -3x + 133. Is x prime? False Let n(a) = -799a3 - a2 - 3a - 2. Is n(-1) prime? False Let t(r) = 4r*3 - 3r*2 - 5r + 3. Is t(5) prime? False Suppose 0 = -5h + 33 + 37. Suppose 0 = -3l - 4m + h, 3l - 22 - 1 = 5m. Is l a composite number? True Let r = 235 + -116. Is r prime? False Is (51/6 + 1)/(1/26) a prime number? False Let f(s) = 5s. Let i be f(4). Suppose 5b - 75 + i = 0. Suppose 0 = 2q - 79 + b. Is q a prime number? False Suppose 3g - 5s = 1033, -g - 3g - 3s = -1358. Is g prime? False Let v = 21 + -19. Suppose -l - 3d = d - 15, vd - 17 = -l. Is l a prime number? True Let j(t) = -3t - 4. Let x be j(-4). Let l = x + 34. Let n = -27 + l. Is n composite? True Let h(g) = -g2 - 3g*2 - 3 - 3g + g*3 + 5g*2. Let k be h(-2). Is (-1 + k)35/(-10) a prime number? True Let u be (-21)/(-3)10 - 3. Let x = 0 + u. Is x composite? False Let n(f) = -f2 + 5f + 2. Let w be n(5). Let g be 5/(-20) + 2/8. Is (-4)/w - (-9 + g) prime? True Suppose 10455 + 14703 = 6f. Is f a composite number? True Let b(o) be the second derivative of 7o4/12 - o3/2 + o*2 + o. Let p(x) be the first derivative of b(x). Is p(4) a composite number? False Suppose 37 = y + 5x, 2y + 74 = 4y + 2x. Is y a composite number? False Let r = -121 - -171. Let z = r - -8. Suppose 2g - z = -2q + 12, -2g + 101 = 3q. Is q a prime number? True Let d = -53 + 78. Suppose 0q + 182 = q - 5x, d = -5x. Is q a composite number? False Let y(v) = -v*3 + 16v*2 + 5v - 18. Is y(16) a prime number? False Let x(u) = 6u - 4. Let p be 4/((-1)/(-2) - 0). Let f be x(p). Let i = f - -13. Is i prime? False Let x = 4 - 4. Suppose xp + 42 = 2p. Is p a prime number? False Is (1 - -1) + (6 - -371) prime? True Let q = 351 + -169. Let h = 198 - 135. Let b = q - h. Is b a composite number? True Let j = -3 + -2. Let n = 8 + j. Suppose -2t + b = -263, 5b + 174 + 210 = nt. Is t a prime number? False Is 28((-213)/12)/(-1) a prime number? False Suppose 4p + 5s - 2 = -42, -s = -p - 1. Let y(d) = d3 + 5d*2 + 3. Let h be y(p). Suppose -l - 4i = hl - 220, 3i = -12. Is l a prime number? True Suppose 126 = -0d + 3d. Let w = d - 19. Is w composite? False Suppose 13g - 14449 = 3738. Is g a composite number? False Is ((20980/15)/4)/(1/3) a prime number? True Let i = 880 + -471. Is i prime? True Let t(x) be the first derivative of -7x*4/4 - 2x3/3 - x2/2 - x + 3. Is t(-2) a prime number? False Let a = -64 - -299. Is a a prime number? False Suppose 2 - 7 = 3b + 2q, 3q + 8 = -5b. Let w(s) = -51s3 + s2 - 1. Is w(b) a prime number? False Let a(p) = 6p*3 - 5p*2 - 11p - 7. Is a(6) composite? True Let s(u) be the second derivative of 73u4/4 - u2/2 + 3u. Let w be s(-1). Suppose 0y - 2y = -w. Is y a composite number? False Suppose 6q - 4h = 2q + 172, 4h + 129 = 3q. Is q composite? False Let l(k) = 3k*3 - 2k*2 + 2k - 1. Let u be l(1). Let d(i) = 21i3 - i2 - 4i + 3. Is d(u) composite? True Let u(n) = 250n2 - n - 1. Suppose -4o - 2h - 8 = 0, -4o + 0h - 14 = 5h. Let b be u(o). Suppose 2x + 2t = b - 20, 2x - 222 = -4t. Is x prime? False Let u = 8 + -2. Suppose h - uh = -655. Is h composite? False Let f(l) be the first derivative of -l3/3 - 5l*2/2 - 2l + 1. Let q(x) = -x*2. Let n(r) = -f(r) - q(r). Is n(5) a composite number? True Is (-2)/5 - 11133/(-45) a composite number? True Suppose 0 = -t - 3, -5p = t - 3t - 566. Suppose -4k - 3x = 38 + p, -4k + 3x - 162 = 0. Is (-1 - k)/(0 + 2) a composite number? False Suppose 4d = 5 + 15. Suppose 3j = dn + 37, 3j - 6 = 3n + 27. Suppose 2u - 3 = j. Is u a prime number? False Is 6069/28 - (-2)/8 prime? False Let z be 25/(-10)(-28)/10. Suppose 4k = -zf + 4f + 817, -f + 204 = k. Is k a composite number? True Let q be (9/6)/((-1)/(-26)). Let d = q + 55. Is d a prime number? False Let t be 5(2 - (1 - 0)). Let n be 4/t645/(-6). Let k = n + 175. Is k prime? True Suppose 0 = -2z + d + 22, -3z + 4d + 33 = d. Let y(p) = 15p - 14. Let q be y(z). Let c = q + -86. Is c a composite number? True Let m(r) = -r. Let d be m(-4). Suppose dy - 159 = y. Is y prime? True Suppose -3c + 118 = b, -2c = 2b + 3c - 239. Is b a prime number? True Suppose -4b = -23748 + 4304. Is b composite? False Let l be (-70)/2 + 2/1. Let x = l + 88. Is x a composite number? True Let o = 144 - 5. Suppose -b - o = -2b. Is b composite? False Let b(m) = 72m - 1. Let k be b(-1). Suppose 0c + 284 = 2c. Let p = c + k. Is p a composite number? True Let g(y) = 26y + 1. Let l be 8 - (1/(-1))/1. Suppose 0 = 4a + 5f - 3, 3a + f = -2a + l. Is g(a) a composite number? False Suppose -9s + 10489 + 428 = 0. Is s a prime number? True Suppose 33 = -2w + 143. Is w prime? False Let j(m) = 4m2 + 7m - 1. Let z be j(-8). Let b = z - -8. Let y = b - 118. Is y a prime number? True Let y = -257 - -598. Is y composite? True Suppose -8x + 5r - 34 = -4x, 0 = 2r - 4. Is x/21 + 555/7 composite? False Let b(x) = 1303x - 15. Is b(4) a composite number? False Let t = 204 - -155. Is t prime? True Let p(g) = -104g - 29. Is p(-9) a composite number? False Let y = 21 - 34. Let r = -19 - y. Is (147/r)/((-2)/4) a composite number? True Let t = 2 - 0. Suppose 7b - tb - 680 = 0. Suppose 4h - 53 = -u, -5u + 3h = -u - b. Is u composite? False Let z = -76 - -221. Is z a composite number? True Let j = -4 + 10. Is j/(-10)(-148 + 3) composite? True Let q = 307 + -174. Let s = 552 - q. Is s a prime number? True Let d be -2 - 4/(0 + 2). Let n = -2 - d. Is 1 + (6 - n) - -2 a prime number? True Let z = 2 + 1. Suppose 247 = 5k + 2d - zd, -5d = 10. Suppose -4m + 4x = -0x - 128, -2m + 5x = -k. Is m a prime number? True Let a(p) = -p3 - 2p*2 + 2p + 2. Let i be a(-3). Suppose 0 = 5u - 3n + 3, -n = -2u + 4n - i. Suppose uq - q = -3, -y + 70 = q. Is y composite? False Suppose m + 14 = -2q, -q - 10 = m - 3q. Is (-1 + 2)1 - m a prime number? True Let n = 3233 - 1632. Is n a composite number? False Suppose 5u + 3s = 942, -2s + s = -4. Let z = -73 + u. Suppose -5y + z = 18. Is y a prime number? True Suppose q = -0q. Suppose -4p = 4r - 352, -r + 4p = -qr - 83. Is r composite? True Suppose -2d - 21 = -5d. Suppose -2p = -5i + 551, -2i + dp - 3p + 214 = 0. Is i prime? False Let z = 17 + 40. Is z a composite number? True Suppose -4i - 3n + 3596 = 0, -i = -0n - n - 899. Is i composite? True Suppose 4m = -0m + 1028. Let l be (-92)/(-4 + (-56)/(-12)). Let z = m + l. Is z a composite number? True Let i(s) = 10s*3 - 3s*2 + 3s - 3. Is i(2) a composite number? False Suppose 5u = -136 - 194. Let a be (-12)/u + (-123)/11. Let b = 3 - a. Is b prime? False Let w(k) = k3 + 9k*2 + k + 11. Suppose -5r = -2i + 48, 5r + 24 = -i - 3i. Is w(r) composite? False Let k(q) = -q2 + 4q + 7. Let j be k(6). Let m = 9 + j. Suppose 3 = -2c - 5, 0 = ml + c - 52. Is l a prime number? False Let w be (2 + (-36)/15)-1030. Let x = w - 669. Let f = x - -462. Is f a prime number? False Let s(z) = -459z - 2. Is s(-1) composite? False Let r be (0 - 15)2/(-6). Suppose 7 = 4k + rd - 10d, -2d = 2k - 26. Let z = 21 - k. Is z prime? True Let f = -22 - -16. Let v(o) = 2o2 - 5o + 7. Is v(f) prime? True Suppose 3m = 2m. Suppose -5r - 65 + 780 = m. Is r a composite number? True Let r be 4 - 0(-3)/(-6). Suppose -rd + 2681 = -2171. Is d prime? True Suppose -7m + 5y - 132 = -3m, 4y - 72 = 2m. Let i be ((-150)/35)/(2/m). Suppose -3t = -p + 28, 0t + i = 3p + 3t. Is p prime? False Suppose -3g - 7 = -6g - 2n, -5n = -2g - 27. Let p = g + 1. Suppose p = -9d + 4d + 105. Is d a prime number? False Is 765/6 + (-3)/6 composite? False Let d = -7 + 12. Suppose -135 = -2v - da + 23, 368 = 4v - 3a. Suppose -2b + v = -b. Is b prime? True Suppose n = -2c - 3c + 14, 4 = 2c + 2n. Suppose 0m - 171 = -cm. Is m a composite number? True Is 3/9 - (466/(-6) - 1) a prime number? True Suppose -q = -63 - 6. Let o = q - 34. Is o a prime number? False Let h(v) = 282*v - 5. Is h(3) a pri	{ "pile_set_name": "DM Mathematics" }
ber? False Suppose 5m - 5k = -970, -5k - 1232 = 5m - 262. Let a = 339 + m. Is a a prime number? False Is ((-345)/(-25) + 4)/((-4)/(-20)) prime? True Let o(s) = 63s - 2. Let g(x) = -63x + 1. Suppose -4 = 5u - 19. Let d(c) = ug(c) + 4o(c). Is d(8) prime? True Is (-8596)/(-8)-25/(-5) composite? True Suppose 2j + 4n - 2909 + 611 = 0, 0 = -4j - 4n + 4616. Is j a prime number? False Suppose 4r - 22r + 6822 = 0. Is r prime? True Suppose 5p + v - 6355 = 6v, -3p - 2v = -3823. Let n = 1895 - p. Let b = n + -431. Is b a prime number? True Suppose -b + 1609 = 2z, 0 = -7z + 6z - 4b + 787. Is z a prime number? False Suppose -34d + 90 = -29d. Is (1194/d)/(1/15) a prime number? False Let n = -2 + 0. Let m(q) = -47q - 5. Let t be m(n). Suppose -4w + t = i, i = -3w + 4w + 84. Is i prime? False Let f(x) = -71x*3 - 4x*2 - 3x + 31. Is f(-8) composite? False Let y = 85 - 38. Let s = y + 158. Is s composite? True Let b = 1483 + 5296. Is b composite? False Let a(w) be the first derivative of -w*4/4 - 4w*3/3 + 5w*2/2 + 7w + 108. Let u(l) = -l*2 + 2l. Let x be u(-2). Is a(x) composite? False Suppose v - 4v = -x - 3, 4x = -4v + 20. Suppose -5i + v = -4i. Is i prime? True Suppose 2z - 2v - 1848 = 0, 656 - 5276 = -5z + v. Suppose -z = 3k - 6045. Is k a composite number? True Suppose -3d + 7421 = -1090. Is d composite? False Let m(k) = 257k + 33. Is m(10) a prime number? False Let j(u) = 41u*2 + 13u - 185. Is j(-22) a composite number? False Is (-269128)/(-26) + 20/(-260) a composite number? True Let t = 6 - 3. Let i(r) = -2r2 - 8 + 96r*t + 8 + r. Is i(1) composite? True Let i = 44 + -16. Let z be (-24)/i(-42)/9. Suppose zs - 7s = -369. Is s composite? True Suppose -d = -v + 1, v - 7d = -2d - 15. Let z(n) = 27n2 - n + 7. Is z(v) a prime number? True Let p(c) = -2c*3 - 6c*2 - 4c - 3. Let k(a) = -a*3 + 7a*2 - 7a. Let d be k(6). Is p(d) a composite number? True Let a(x) = 15x3 + 6x*2 - 9x + 19. Is a(6) composite? True Suppose 2o = -5p - 0o + 14643, 0 = 4o - 16. Is p a prime number? True Suppose -2t + 6325 = 4h - 85, 4t - h - 12820 = 0. Is t prime? False Let u be -2 - 8/(1 + -3). Let p be -3 + 12 + 3 + u. Suppose -ps + 12s + 106 = 0. Is s a prime number? True Let k(p) = -154p + 7. Suppose 4j + 5 = 21. Suppose -o - a = j - 2, 3a - 3 = 0. Is k(o) composite? True Let x = 0 + 8. Let h = x + -6. Is 0 - h - (-9 - 402) prime? True Let u = -24866 + 42649. Is u a composite number? False Suppose -7k = -3k + 2i + 8, -3k = -4i + 17. Let f be (k1)/((-24)/16). Is 501/f - (-3)/6 composite? False Suppose -r - 11 = 5w + 1, -5r = -3w - 24. Suppose 2u = 5y - 40, 0 = -ry - 0y - u + 24. Suppose 7x + 493 = yx. Is x a composite number? True Let h = 1510 - -147. Is h a composite number? False Is (-6)/(-27) + 23738/18 a prime number? True Let x be 103/305. Suppose -2y + xk + 309 = 0, y + 0y + 4k - 161 = 0. Is y composite? False Let w be (-13 - -12)8(-42)/4. Is 2/12 + (-182)/w + 505 prime? True Let i be (9 - -361)2/4. Let k be 3i1/3. Suppose -q + k - 22 = 0. Is q composite? False Suppose 2t - 6t = -4v - 202460, -3t + 4v = -151847. Is t a composite number? True Let c(x) = -690x - 91. Is c(-6) a composite number? False Let k = -31 + 28. Is ((-1 + -2152)2)/(k + 1) prime? True Let b(h) = -h2 - 5h - 3. Let t be b(-2). Suppose -2a + 238 = -f, -a = a - 2f - 240. Suppose 4g - 3g + tq - a = 0, -5 = 5q. Is g a composite number? True Is 1(5 - 11) - -50627 a composite number? True Let u = -4743 + 7322. Is u a prime number? True Suppose l - 4m - 1955 = 0, -2m + 0 = 6. Is l a prime number? False Suppose -a = 17 - 5. Let o be ((-282)/a)/(4/232). Suppose 2s + 3i - o = 0, 3418 = 5s - 2i - i. Is s a prime number? True Let j(p) = 177p*3 - 2p*2 + p - 1. Let n(z) = z - 2. Let c be n(0). Let q = c + 4. Is j(q) a composite number? False Let l = -47 - -50. Is (-41636)/(-4) - ((-3 - -4) + l) a prime number? False Let n(w) = -3w*2 - 103432. Let m be n(0). Is (m/(-12))/((-4)/(-6)) a composite number? True Let j(l) = 411l*2 - 70l - 885. Is j(-14) prime? True Let b be 461 + 8/(-10) + 4/(-20). Let p = b - -329. Is p composite? True Let n(u) = -6u + 6. Let j be n(-5). Let v = -8 + j. Let c = v + 23. Is c a composite number? True Let j(z) = 1559z + 82. Is j(11) a composite number? False Suppose -10 = 5q, 3w - 2w - 14 = 2q. Let p be w/8(990 + -2). Suppose -2z = -7z + p. Is z a composite number? True Let y be (-3 + (-6)/(-4))/((-3)/4). Suppose 94 = yn + 5h, 8n = 10n - 5h - 54. Is n a composite number? False Let p = 22 + -9. Let o(j) = 3j2 - 2j - 14. Is o(p) composite? False Suppose -20v = -44682 - 16118. Suppose 5o - v = -5w, 2o - 3o - 4w + 599 = 0. Is o a prime number? False Let f(l) be the third derivative of 0l + 0 + 1/12l*5 + 13/6l*3 + 3l*2 + 7/12l*4. Is f(-16) prime? True Let g(s) = 8 - 22s + 14s2 + 9 - 33 + 9 + s3. Is g(-10) composite? False Suppose 0 = 4y + 5g - 29481, 5y = -5g + 11580 + 25270. Is y a composite number? False Is (4 + (-309)/(-3))/(2/146) a composite number? True Let p be -45/(40/(-402)). Suppose -x - p = -4x. Is x prime? True Let q(m) = 8m - 1. Let u be q(1). Suppose -ui = -3i. Suppose it + 76 = 4t. Is t a prime number? True Let i = 0 + 8. Suppose 4g - 6t - 7 = -t, 0 = -2g + 2t + 2. Is (-31)/((-20)/i - g) prime? False Suppose 0 = 2m + o + 28, 3m + 44 = -m + 4o. Let q(d) = -d3 - 12d*2 - 19d - 5. Is q(m) a composite number? True Suppose -21t = -144294 - 80091. Is t a prime number? False Suppose 69 + 1 = 7d. Let h(x) = 2x2 - x2 - 17 + 17x - d. Is h(-20) prime? False Let c = -29 + 49. Is (((-210)/c)/((-3)/1468))/2 prime? False Let h be 17/3 + (-6)/9. Suppose hs = -4r + 271, -3r + 4r - 4s = 94. Let d = -37 + r. Is d a composite number? False Let n be (-6)/9 - 1608/(-9). Let x = -111 + n. Let c = x + 26. Is c composite? True Suppose -8u + 9078 = -2u. Is u prime? False Let f(c) = -1134c + 173. Is f(-20) prime? True Let l(j) = -14j - 2. Let v be l(-1). Is (-4407)/v(17 - 1)/(-4) prime? False Suppose -3 = 2g - 7. Let o(k) = k2 + k - 2. Let f be o(g). Suppose -14 - 38 = -fi. Is i composite? False Let o(b) = -b*2 + 26b - 22. Let r be o(25). Suppose rd = -3u + 942, 3u - 324 = 2d - 3d. Is d a composite number? True Let x be 48/9 - (-3)/(-9). Let k = x - 9. Is k/14 - 2678/(-14) composite? False Let q(f) = 3008f - 69. Is q(1) a composite number? False Suppose -m + 4m = -5f + 783, -2f + 526 = 2m. Suppose -2r = -m - 56. Is r a prime number? False Let z(h) = h3 + 2h*2 - 3h - 2. Let s be z(-3). Let n(o) = -32o3 + o2 + o + 2. Let m be n(s). Let w = 111 + m. Is w a prime number? False Suppose -5r - 33 = 2y, 0 = 4r - 8y + 4y + 32. Let k(z) = -3 - 3z + 7z + 2z2 + 3z. Is k(r) a prime number? False Let v = -3389 + 5467. Is v a composite number? True Suppose -5 = -2o - 7. Is 4536/9 + o/(-1) composite? True Is (-2596950)/(-135) + 10/(-6) composite? True Suppose 2 = 3q + 2. Is -1 + q + 7/(35/1950) composite? False Let o = 14 + -11. Let l be 1 + -1 + (o - 19). Is (-1)/(-2) - 2024/l a composite number? False Let f(t) = 105t2 - 14t + 12. Is f(-5) a prime number? True Let f(d) = 14d + 7. Let k(p) = 14p + 6. Let s = -22 - -27. Let y(u) = sk(u) - 6f(u). Is y(-5) a composite number? True Suppose 0k - 3l = 2k - 59, 33 = k + 5l. Suppose -d + 33 + k = 0. Suppose d = 4w - 3y + 8y, -3w = 5y - 42. Is w a composite number? False Let j(h) = -4h - 21. Suppose -2i - l + 0l - 18 = 0, 32 = -3i + l. Is j(i) a prime number? True Suppose 2z = 4i + i + 449, -5i = 3z - 611. Is (z/8)/((-3)/(-6)) prime? True Let h(n) = 123n + 3. Let m(p) = -123p - 4. Let s be (3 + 15/(-6))-10. Let w(i) = sh(i) - 4m(i). Is w(-4) a composite number? True Let h(i) = i - 6. Let x = 13 - 13. Let w be h(x). Is (-99)/w8/6 a composite number? True Let y = -923 - -1812. Is y prime? False Let m = 14453 - 4146. Is m a prime number? False Let x = -2874 + 8813. Let n = -202 + x. Is n a prime number? True Let l(j) = -j3 + j2 + 1. Let z(c) = 7c*2 - 9c + 8. Let k(h) = l(h) + z(h). Let d be k(7). Is 4/d - (-2676)/20 composite? True Let y(w) = -3*w - 2. Let k be y(4). Let u = k + 12. Is -	{ "pile_set_name": "DM Mathematics" }
-53, -84, -127, -188, -273? -388 What is next in -94, -91, -88, -85, -82, -79? -76 What comes next: -117, -108, -85, -42, 27, 128, 267? 450 What comes next: 197, 394, 591, 788, 985? 1182 What comes next: -163, -196, -227, -256, -283, -308, -331? -352 What comes next: -1, -24, -55, -94, -141, -196? -259 What comes next: -65, -77, -87, -95? -101 What is next in -109, -101, -89, -73, -53, -29? -1 What is the next term in -63, -129, -195, -261? -327 What comes next: 25, 97, 231, 439, 733, 1125, 1627, 2251? 3009 What is next in -99, -381, -851, -1509, -2355, -3389? -4611 What comes next: 47, 102, 147, 176, 183, 162, 107, 12? -129 What comes next: 126, 125, 124, 123, 122, 121? 120 What comes next: 13, 29, 53, 85, 125? 173 What is the next term in -210, -425, -626, -807, -962, -1085? -1170 What is the next term in 10, 11, 8, 1, -10? -25 What is the next term in -200, -413, -626? -839 What is the next term in -51, -86, -121, -156, -191, -226? -261 What is the next term in -3523, -3525, -3527, -3529, -3531? -3533 What is next in -19, -40, -61? -82 What comes next: -616, -1233, -1850, -2467? -3084 What is the next term in 123, 128, 143, 174, 227, 308? 423 What is the next term in -285, -227, -131, 3, 175? 385 What is the next term in 49, 134, 271, 466, 725, 1054? 1459 What is the next term in 426, 418, 406, 390, 370, 346? 318 What is the next term in -103, -102, -101, -100, -99? -98 What is the next term in 366, 357, 338, 303, 246, 161, 42, -117? -322 What is the next term in 876, 866, 844, 804, 740? 646 What comes next: -79, -78, -77? -76 What is the next term in 84, 99, 104, 93, 60? -1 What comes next: -35, -41, -51, -65, -83? -105 What comes next: -1069, -2142, -3217, -4294, -5373, -6454, -7537? -8622 What is next in -9073, -9072, -9071, -9070, -9069, -9068? -9067 What is next in 14, 22, 26, 20, -2, -46? -118 What is next in 774, 777, 780, 783, 786? 789 What comes next: -25, -69, -127, -199, -285, -385, -499? -627 What is next in 14, -26, -86, -166, -266? -386 What is the next term in -37, -245, -813, -1921, -3749? -6477 What comes next: 89, 397, 911, 1631, 2557? 3689 What is next in -4, -17, -38, -67? -104 What is the next term in -48, -77, -92, -87, -56? 7 What comes next: 150, 154, 158, 162? 166 What comes next: -1138, -2261, -3384? -4507 What is next in -383, -1523, -3423, -6083, -9503, -13683, -18623? -24323 What is the next term in 72, 90, 110, 132? 156 What comes next: -42, -73, -106, -141? -178 What is the next term in -102, -103, -90, -57, 2? 93 What comes next: 107, 93, 79? 65 What is the next term in -25, -29, -35, -43, -53? -65 What is next in 221, 418, 613, 806, 997? 1186 What is next in 20, 16, -8, -64, -164, -320, -544, -848? -1244 What comes next: -109, -218, -323, -424? -521 What is next in 104, 147, 190, 233, 276, 319? 362 What is the next term in 5439, 5441, 5443? 5445 What is next in -184, -208, -232? -256 What is next in -711, -705, -699, -693, -687, -681? -675 What is the next term in 160, 158, 154, 148? 140 What comes next: 39, 72, 105, 138? 171 What is the next term in -54, -142, -324, -648, -1162? -1914 What comes next: 122, 142, 188, 272, 406, 602? 872 What is the next term in 7221, 7220, 7219, 7218, 7217, 7216? 7215 What comes next: 122278, 122282, 122288, 122296, 122306, 122318, 122332? 122348 What is the next term in 67, 127, 187, 247, 307? 367 What is the next term in -6, -20, -58, -132, -254, -436, -690? -1028 What is next in 37, 28, 17, 4, -11, -28? -47 What comes next: -362, -359, -354, -347, -338? -327 What is the next term in -320, -326, -336, -350? -368 What is next in -2068, -2064, -2056, -2044, -2028? -2008 What is the next term in 527, 517, 495, 455, 391, 297, 167, -5? -225 What is the next term in -230, -448, -656, -848, -1018? -1160 What comes next: 46, 203, 468, 841, 1322, 1911, 2608? 3413 What is the next term in 12, 17, 32, 63, 116, 197? 312 What is the next term in 606, 624, 662, 726, 822? 956 What is the next term in -2, -4, 4, 28, 74, 148? 256 What is the next term in 131, 120, 95, 50, -21? -124 What is next in -171, -674, -1513, -2688, -4199? -6046 What is next in 396, 397, 398? 399 What is next in 72, 302, 684, 1218, 1904? 2742 What is the next term in 137, 280, 423, 566, 709? 852 What is next in -82, -74, -66, -58, -50? -42 What is next in 86, 133, 178, 221, 262? 301 What comes next: 48, 116, 240, 426, 680, 1008? 1416 What is next in -107, -105, -99, -89, -75? -57 What comes next: -18, -15, -16, -27, -54, -103, -180? -291 What is next in -467, -470, -475, -482, -491? -502 What comes next: 150, 501, 1086, 1905? 2958 What comes next: 149, 591, 1321, 2333, 3621, 5179, 7001? 9081 What comes next: 10, 17, 18, 13, 2? -15 What is next in 7, 22, 39, 58, 79? 102 What is next in -97, -227, -449, -769, -1193, -1727, -2377, -3149? -4049 What comes next: 296, 293, 288, 281, 272? 261 What is the next term in -157, -327, -487, -631, -753, -847, -907, -927? -901 What is next in -6712, -13422, -20132, -26842, -33552? -40262 What comes next: 39, 164, 373, 666? 1043 What is next in 310, 308, 304, 298, 290, 280, 268? 254 What comes next: -133, -261, -387, -511, -633, -753? -871 What is the next term in 30, 48, 68, 90, 114? 140 What is the next term in 6, 10, 6, -12, -50, -114? -210 What is next in -17, -12, 11, 58, 135? 248 What is next in 15, 151, 521, 1239, 2419? 4175 What is the next term in 88, 174, 260? 346 What comes next: -129, -253, -387, -537, -709, -909, -1143, -1417? -1737 What is next in -241, -243, -237, -217, -177, -111, -13? 123 What comes next: 1394, 1399, 1404, 1409, 1414, 1419? 1424 What is the next term in -2, -6, -12, -20, -30, -42? -56 What is the next term in -6354, -6353, -6352, -6351, -6350? -6349 What comes next: 249, 456, 663, 870? 1077 What is the next term in 87, 131, 177, 225? 275 What is the next term in 8, 91, 316, 755, 1480? 2563 What is the next term in -378, -757, -1136, -1515, -1894? -2273 What comes next: 43, 89, 135, 181, 227, 273? 319 What is next in -261, -260, -259, -258, -257, -256? -255 What comes next: 82, 83, 84, 85, 86, 87? 88 What is next in 25920, 25921, 25922, 25923, 25924, 25925? 25926 What comes next: -6713, -6718, -6727, -6740? -6757 What is the next term in 87, 91, 97, 105, 115, 127? 141 What is next in -232, -230, -230, -232, -236, -242, -250? -260 What comes next: 10, 3, -4, -11? -18 What comes next: 29, 59, 89, 119, 149, 179? 209 What is the next term in -379, -1506, -3381, -5998, -9351, -13434? -18241 What is next in -72, -89, -106, -123, -140? -157 What is next in 9, 19, 29? 39 What is next in 7, 7, 13, 31, 67, 127? 217 What is next in 2555, 2553, 2549, 2543, 2535, 2525, 2513? 2499 What is the next term in 1154, 1152, 1148, 1142, 1134? 1124 What is the next term in -21, -25, -31, -39, -49, -61? -75 What is next in -4, -12, -26, -46, -72, -104? -142 What comes next: 32, 40, 36, 8, -56, -168, -340, -584? -912 What is next in -287, -615, -943, -1271, -1599, -1927? -2255 What is next in 79, 95, 121, 151, 179, 199, 205? 191 What is the next term in 196, 392, 588, 784? 980 What is the next term in -1309, -2626, -3941, -5254, -6565? -7874 What is the next term in -50, -127, -224, -335, -454, -575? -692 What comes next: 12960, 12961, 12962, 12963? 12964 What is next in 45, 63, 83, 105? 129 What comes next: 282, 280, 278? 276 What comes next: -9190, -9188, -9186, -9184, -9182? -9180 What comes next: 191, 312, 433? 554 What is next in 12, 32, 58, 90, 128, 172? 222 What comes next: 1076, 1072, 1066, 1058, 1048, 1036? 1022 What is next in -123, -273, -427, -585, -747, -913? -1083 What comes next: 27, 21, 3, -33, -93? -183 What is the next term in 6002, 6003, 6004, 6005? 6006 What comes next: 166, 153, 132, 103? 66 What comes next: 383, 706, 1029, 1352? 1675 What comes next: -44, -148, -322, -566, -880, -1264, -1718? -2242 What is next in 199, 187, 159, 109, 31, -81, -233, -431? -681 What is next in -408, -409, -410, -411? -412 What comes next: -52, -222, -504, -898, -1404? -2022 What is the next term in -105, -388, -861, -1524? -2377 What is next in -27, -44, -71, -108, -155, -212? -279 What comes next: -18, 54, 216, 468, 810, 1242? 1764 What is next in 1, 9, 35, 85, 165, 281, 439? 645 What is the next term in -3082, -6163, -9244, -12325, -15406? -18487 What comes next:	{ "pile_set_name": "DM Mathematics" }
8o + 2o = 0. Let w be (4 - 4)/(1 - o). Solve 2t + 4n = -14, -5t - 2n + w = 11 for t. -1 Suppose 6p = 3p - a + 10, -p + 2 = a. Let v(n) = n - 4n - 7 - 6 - 3n. Let j be v(-3). Solve -pz + 24 = -z - 3x, jx = -3z for z. 5 Let j(r) = r*3 + 14r*2 + 12. Let x be j(-14). Suppose 3k + 81 = xk. Solve 2z - o + k = -0, 1 = -z - 3o for z. -4 Suppose 3a - 15 = 0, -4o - 11 = -a - 2a. Let u be (9/18)/(o/(-8)). Let w be 87/27 - u/(-18). Solve -3q + 9 = -wm, -5m = -m + q + 2 for m. -1 Let t = -422 - -426. Solve s = -4m - 0m + 13, -ts = -20 for m. 2 Suppose 2q + 8 = 18. Suppose qi - 17 = 2m - 5, 0 = i + m - 1. Solve 2w + id = -6, -3w - 5d - 15 + 4 = 0 for w. -2 Let c = 31 + -19. Let b = -13 + c. Let x be 0 + (1 - 1/b). Solve 0 = 3q - a - 1, -2a + x = -4q - 0a for q. 2 Let l = 17 + -17. Suppose l = -5b - 2q, 4b + 4q = 2q. Let g = 11 - b. Solve 3p + u - g = 0, 2p = -2p - 4u + 4 for p. 5 Suppose 2 = z, 5n + 0 = 5z - 120. Let a = n - -42. Solve j + j + 10 = 0, 0 = 2q - 2j - a for q. 5 Let f = 164 - 156. Let p = 0 - 1. Let u be p/(f/10 + -1). Solve 0 = 6s - 2s - j, -2j = us for s. 0 Let y = -58 - -60. Let f(v) = -2v2 + 8v - 3. Let m be f(y). Solve 3g + 11 + 1 = 0, 16 = -mu + g for u. -4 Let r be (-4)/(-22) + 216/22. Suppose -8f - 16 = -rf. Let o = f + -6. Solve -4d + 2 = u, -3d - o = u - 2u for d. 0 Let w(i) = 2i*2 - 59i - 588. Let x be w(-8). Let d be (-1 - (-1 + 0))/(-2). Solve h + 16 = -4t, x = -dt - 3t + 5h for t. -4 Suppose j + 2j = 0. Suppose f + m - 3 = j, 0m = 3m. Let p be ((-1)/(-1))/(f/15). Solve -5y = -5q - 30, -7 + 1 = -q - py for q. -4 Let f = -483 - -488. Solve -3y - fq = -28, -y - 22 - 2 = -5q for y. 1 Let m = -566 + 581. Solve 4f + a = f + m, 0 = -3f - 3a + 21 for f. 4 Let u(w) = -w*3 - 9w*2 + 8w - 8. Let a be u(-10). Let h be 26/6 - (-2)/3. Solve -a = -hf - 4d, 3d + 0 + 6 = 0 for f. 4 Let o = -2 - -5. Suppose -h - 2v = -v + o, h = 5v + 15. Solve f - 2w = -9, 0 = -5f + 5w - 30 - h for f. -3 Let r(z) = z*3 - 3z*2 + z - 2. Let q be r(2). Let j be 3/1 - (-12)/q. Suppose j = -k + 2 + 6. Solve -5g + k = -3p, -3g + 6g = 2p + 4 for p. 4 Let f be (-2926)/(-198) - (-2)/9. Solve f = -5n - k, -27 = 3n - k - 10 for n. -4 Suppose -2n - 3b + 7 = -12, -3b + 3 = 0. Let z = -6 + n. Let s = 7 - z. Solve m - 5r = -m - 20, 0 = sm - 2r + 29 for m. -5 Suppose 0 = 3v - 9, -1 = j - 2v + 3. Solve 2x + 4y = 2, 18 + 1 = -5x + jy for x. -3 Suppose g - 2 = 2u - 1, -2 = 2u - 2g. Suppose u = -4a + 15 + 17. Let n = a + -4. Solve 2d = h + n, -4h + 28 = d + 2d for d. 4 Let b = 12 - 10. Suppose -4n + 0f = 2f - 30, -bf - 15 = -5n. Suppose -nk + 3k = 0. Solve k = 4i + h + 13, -i = i + h + 5 for i. -4 Let j(z) = 2z + 1. Let h be j(-1). Let f be 1/(h/(-9)3). Let o = -13 + 22. Solve -l + o = -fy, -1 = -4y + 5l - 2 for y. -4 Let j(a) = 2a2 + 4a + 3. Let b be j(-2). Suppose -7 - 5 = -bn. Solve -p - 4 = 2t - 2, -t + 6 = np for t. -2 Let u(g) = g - 4. Let k be u(5). Let v be (-3 + 2 + k)1. Suppose -5b + vb = 0. Solve -3l + 12 = y, 5l - 34 = -by + 3y for y. -3 Suppose 17p = 14p - 2t + 10, -5t = 5p - 25. Solve -4k + 3d + 8 = 0, pk - 2 = -k - 2d for k. 2 Let k be ((-2)/3)/(((-36)/(-27))/(-2)). Solve -3b = h - k, h + 3b - 2 = -b for h. -2 Let q(y) = y3 + 13y*2 + 11y - 10. Let r be q(-12). Let z be r/(-11) + 26/22 + -1. Solve -m + 6 = -d + 2d, -m + 5d = z for m. 5 Suppose -4l + 21 = -3n + 1, -5l = -4n - 28. Let f = -9 - n. Solve 5a - 5v - 2 = f, v + 9 = 5a for a. 2 Suppose 7d - 24 = -3. Let a = -2 + 2. Solve al = 4l - 4q + 4, dq + 9 = -l for l. -3 Let k = 84 + -82. Let q be 5 + (-4)/((-6)/(-3)). Suppose n = kn - q. Solve -4m + u = n + 1, -3u + 5 = -5m for m. -1 Suppose 4f + 28 = 11f. Solve -fm - 3v = -13, 0 = -4v + 8 + 4 for m. 1 Let a(z) = 8z - 46. Let n be a(7). Let h be (-1 - -4)4/3. Suppose -159 = -0j - hj - r, -3r - 3 = 0. Solve -4s = -4t + j, -3t + 0t - 5s - n = 0 for t. 5 Suppose -7o + 18 = 2o. Let y be 6/o(3 - (-11)/3). Solve 3n = 4x + y, n = -4x + 3x + 2 for n. 4 Let s = -14 + 22. Let v(o) be the first derivative of o*3/3 - 4o*2 + 2o + 2. Let w be v(s). Solve 0 = a + 2l - 7l + 11, 2 = -a + wl for a. 4 Let w = 2 - -5. Solve 5d = 2g - 15, 0 = 2d - 3g + w - 1 for d. -3 Let z = 10 + -12. Let r be (6/(-18))/(z/(-12)). Let f be (5/4 + r)-4. Solve -fk = -2k + 3, t - 2k = 11 for t. 5 Let f be 6/21 - 4/14. Suppose f = -3p - 9 + 36. Solve l = -2y + 2l + p, -3y = 5l + 19 for y. 2 Let r be (-252)/(-7) - (-1 - 0). Let i = r - 15. Let u = 32 - i. Solve -4m = -f - 2m - 12, 0 = 2m - u for f. -2 Let g(n) = 2n + 34. Let c be g(-17). Solve -3s = -cv + 4v - 5, -v + 1 = s for s. -1 Let a(u) = -u + 4. Let w(n) = 9n + 1. Let v be w(-1). Let r be a(v). Let z = -9 + r. Solve zg + 18 = -5t, 0 = -t + 6t - 4g + 11 for t. -3 Let f = 28 - 28. Let s be (f - 0) + 4/1. Solve -m + 2m - 4z + s = 0, 2z = -3m - 12 for m. -4 Let j = 305 - 300. Solve -5z - m + 3 = -0z, -2m + 1 = jz for z. 1 Let x = 38 + -19. Let v = x - 24. Let b be 2v1/(-2). Solve -l + 8 = -bj + 26, -4j = 4l for l. -3 Let z(q) = q3 + q2 + q - 9. Let h be z(2). Solve -hm + 3k = 20, 5m - 5k - 8 = 7m for m. -4 Let d = -172 - -177. Solve -4b = 2f, 2b + 2f - 7 = db for b. -1 Let b = 2297 + -2297. Solve -5o + 25 = -bo + 5q, 8 = o + 4q for o. 4 Suppose 0 = 3h + 6, -97 - 7 = -4k + 2h. Solve 4i + 20 = 5i + 4t, -5t = 2i - k for i. 0 Suppose 3v = -12, -2v = -3f - v - 11. Let n(g) = -g*2 - 7g - 8. Let k be n(f). Solve -15 = -3c, -ku - c + 1 = -0 for u. -2 Let c be 3 - (8/12)/((-36)/162). Solve 3 = 3s - w - c, 5s - 15 = -w for s. 3 Suppose -4x = -8x. Suppose x = -2u + u + 2. Solve 2k - 7k + uz = -22, -4z = -3k + 16 for k. 4 Let u = 87 + -51. Let q = u - 32. Solve -5b = 3h + h + 4, -qh + b - 4 = 0 for h. -1 Suppose -6y + 2 = -28. Suppose j + 12 = yz, -j - j + 12 = 2z. Let q(m) = m*3 - 6m*2 + 6m. Let u be q(5). Solve ux + j = 4c, -x + 0c + 3 = -2c for x. -3 Suppose 7 = 2i + 3c, -5i - 8c + 7c = -11. Solve 3l - 20 + 2 = -it, 3l = -5t + 27 for l. 4 Suppose 21 = -2u + 27. Solve o - 9 = 4k - 31, 0 = 5k + uo - 19 for k. 5 Suppose 0 = -5w - 5h - 10, -3w - 8 + 26 = -3h. Solve -c = 3v - w, -3c + v - 3 - 1 = 0 for c. -1 Suppose 71 = 72y - 145. Solve -3w - 9 = -yu, 6w - 5w - 1 = 3u for w. -5 Let q = 81 - 77. Let v be (8 + (-19 - -9))/(q/(-10)). Solve 0 = -b - 3o + 8, vb - 5o + 20 = -0b for b. -1 Let g = 15 - -8. Solve 3m - 18 = -3u, -g = -5u - 3m + 5m for u. 5 Suppose 0 = -3z - 6, -16q = -15q + 2z + 2. Solve 1 = -g + qw - 6w, 0 = w for g. -1 Let m(s) be the second derivative of -s*4/12 - 2s*3 + 8s*2 + 16s. Let t be m(-13). Solve ta = -5g - 0a - 11, g - 2a - 3 = 0 for g. -1 Let i be ((-1)/2)/(15/30). Let d be 5 + (i - (2 - 2)). Solve -5b - 4s = -6 + 2, 0 = db + 2s - 2 for b. 0 Let s = -2050 - -2055. Solve 2w + 4y - s = -3, -y + 2 = w for w. 3 Let v(q) = -3q + 135. Let j be v(44). Solve 0 = -2f - 4t + 20, -2 - 4 = -jf + 2t for f. 4 Let j(u) = 12u - 307. Let b be j(26). Let a(k) = k*3 + 2k*2 - 4k. Let l be a(-3). Solve 3h = z - 6, 3z - bh - l = -z for z. -3 Suppose 19m = -31 + 107. Solve 0z - 4p = -z - 14, 3p = mz + 4 for z. 2 Let w = -2144 - -2148. Solve w = 4s - 2p, p = 2s + 6p - 26 for s. 3 Let u(a) = -4a2 - a + 1. Let x be u(2). Suppose 14 + 86 = -5s. Let h = x - s. Solve 2n + 6 = -5q, -n = -2q - q + h for q. 0 Suppose 38 + 3 = -2i - 5c, i - 4c = 12. Let r = i - -24. Solve -6 = -d + 4w - r, 5d - 2w = -14 for d. -2 Suppose -i + o + 10 = 0, o + 16 = 5i - 26. Solve -4f - 4m + i = -0f, 5f - 4m = 19 for f. 3 Let i be 6/(-45)-10 + 2/3. Let y = 3 + i. Solve 1 = b, -13 - y = 4c - 2b for c. -4 Suppose 8z + 4v = 4z, 5v = 6z - 55. Solve -o - 3t - 2t = 25, 0 = -zo + 3t - 13 for o. -5 Let f = 589 + -584. Solve 2v + 3g = -8 - 7, f = -g for v. 0 Let d(n) = -54n + 232. Let b be d(4). Let g(f) = -4f2 + f + 2. Let q be g(-2). Let k = b + q. Solve 4y + 2w - 4 = k, 3w + 1 - 7 = -2y for y. 0 Suppose -3c = -2m + 36, 3m - c + 52 = 5m. Let z = -21 + m. Let t be (-1)/(21/(-34	{ "pile_set_name": "DM Mathematics" }
is divided by 84. 81 Calculate the remainder when 2072 is divided by 257. 16 Calculate the remainder when 122 is divided by 31. 29 What is the remainder when 415 is divided by 291? 124 Calculate the remainder when 425 is divided by 74. 55 What is the remainder when 441 is divided by 140? 21 Calculate the remainder when 512 is divided by 502. 10 What is the remainder when 521 is divided by 25? 21 What is the remainder when 1597 is divided by 13? 11 Calculate the remainder when 20169 is divided by 164. 161 What is the remainder when 330 is divided by 85? 75 Calculate the remainder when 28 is divided by 11. 6 Calculate the remainder when 9449 is divided by 17. 14 What is the remainder when 414 is divided by 26? 24 What is the remainder when 2053 is divided by 172? 161 Calculate the remainder when 255 is divided by 43. 40 Calculate the remainder when 1195 is divided by 40. 35 Calculate the remainder when 2389 is divided by 92. 89 What is the remainder when 1469 is divided by 23? 20 Calculate the remainder when 1883 is divided by 82. 79 Calculate the remainder when 316 is divided by 11. 8 What is the remainder when 571 is divided by 117? 103 What is the remainder when 3864 is divided by 1285? 9 What is the remainder when 840 is divided by 166? 10 Calculate the remainder when 86 is divided by 45. 41 What is the remainder when 1459 is divided by 190? 129 What is the remainder when 3628 is divided by 719? 33 Calculate the remainder when 2417 is divided by 240. 17 What is the remainder when 83 is divided by 28? 27 What is the remainder when 580 is divided by 121? 96 What is the remainder when 2529 is divided by 149? 145 Calculate the remainder when 226 is divided by 55. 6 What is the remainder when 88 is divided by 39? 10 What is the remainder when 415 is divided by 139? 137 Calculate the remainder when 4986 is divided by 58. 56 Calculate the remainder when 2615 is divided by 23. 16 Calculate the remainder when 12208 is divided by 222. 220 Calculate the remainder when 194 is divided by 52. 38 What is the remainder when 376 is divided by 21? 19 Calculate the remainder when 1713 is divided by 49. 47 What is the remainder when 233 is divided by 177? 56 What is the remainder when 266 is divided by 45? 41 Calculate the remainder when 802 is divided by 20. 2 What is the remainder when 492 is divided by 33? 30 Calculate the remainder when 1506 is divided by 753. 0 What is the remainder when 355 is divided by 27? 4 Calculate the remainder when 480 is divided by 62. 46 Calculate the remainder when 7395 is divided by 18. 15 What is the remainder when 100 is divided by 18? 10 Calculate the remainder when 3191 is divided by 53. 11 What is the remainder when 4018 is divided by 12? 10 Calculate the remainder when 44 is divided by 3. 2 Calculate the remainder when 69 is divided by 62. 7 What is the remainder when 226 is divided by 19? 17 What is the remainder when 335 is divided by 24? 23 What is the remainder when 741 is divided by 92? 5 What is the remainder when 3434 is divided by 287? 277 Calculate the remainder when 3833 is divided by 202. 197 What is the remainder when 499 is divided by 231? 37 Calculate the remainder when 710 is divided by 23. 20 Calculate the remainder when 281 is divided by 41. 35 Calculate the remainder when 318 is divided by 10. 8 What is the remainder when 642 is divided by 274? 94 What is the remainder when 884 is divided by 148? 144 Calculate the remainder when 130 is divided by 47. 36 Calculate the remainder when 1299 is divided by 47. 30 What is the remainder when 435 is divided by 96? 51 What is the remainder when 1328 is divided by 46? 40 What is the remainder when 64 is divided by 43? 21 Calculate the remainder when 1663 is divided by 140. 123 What is the remainder when 332 is divided by 38? 28 What is the remainder when 1053 is divided by 524? 5 Calculate the remainder when 139 is divided by 32. 11 What is the remainder when 558 is divided by 509? 49 Calculate the remainder when 847 is divided by 138. 19 Calculate the remainder when 661 is divided by 51. 49 What is the remainder when 443 is divided by 11? 3 Calculate the remainder when 159 is divided by 54. 51 What is the remainder when 1077 is divided by 536? 5 What is the remainder when 293 is divided by 7? 6 What is the remainder when 4407 is divided by 76? 75 What is the remainder when 398 is divided by 21? 20 What is the remainder when 372 is divided by 134? 104 What is the remainder when 1382 is divided by 5? 2 What is the remainder when 21394 is divided by 12? 10 Calculate the remainder when 377 is divided by 64. 57 Calculate the remainder when 3621 is divided by 3615. 6 What is the remainder when 1078 is divided by 349? 31 Calculate the remainder when 151 is divided by 151. 0 Calculate the remainder when 1055 is divided by 156. 119 Calculate the remainder when 417 is divided by 92. 49 What is the remainder when 7749 is divided by 155? 154 What is the remainder when 153 is divided by 59? 35 Calculate the remainder when 639 is divided by 2. 1 Calculate the remainder when 3351 is divided by 99. 84 What is the remainder when 408 is divided by 59? 54 Calculate the remainder when 275 is divided by 69. 68 What is the remainder when 110 is divided by 57? 53 What is the remainder when 560 is divided by 33? 32 Calculate the remainder when 571 is divided by 508. 63 What is the remainder when 854 is divided by 102? 38 Calculate the remainder when 238 is divided by 114. 10 What is the remainder when 677 is divided by 34? 31 Calculate the remainder when 2495 is divided by 226. 9 Calculate the remainder when 25 is divided by 2. 1 What is the remainder when 2084 is divided by 24? 20 What is the remainder when 335 is divided by 24? 23 Calculate the remainder when 2305 is divided by 165. 160 Calculate the remainder when 127 is divided by 6. 1 Calculate the remainder when 802 is divided by 73. 72 What is the remainder when 532 is divided by 67? 63 What is the remainder when 133 is divided by 17? 14 Calculate the remainder when 812 is divided by 34. 30 What is the remainder when 190 is divided by 29? 16 What is the remainder when 269 is divided by 43? 11 Calculate the remainder when 709 is divided by 34. 29 What is the remainder when 161 is divided by 39? 5 What is the remainder when 4073 is divided by 291? 290 Calculate the remainder when 609 is divided by 12. 9 What is the remainder when 309 is divided by 100? 9 What is the remainder when 1156 is divided by 10? 6 Calculate the remainder when 132 is divided by 121. 11 Calculate the remainder when 66 is divided by 18. 12 Calculate the remainder when 244 is divided by 42. 34 What is the remainder when 426 is divided by 33? 30 What is the remainder when 205 is divided by 30? 25 What is the remainder when 425 is divided by 207? 11 Calculate the remainder when 2859 is divided by 44. 43 What is the remainder when 45 is divided by 34? 11 Calculate the remainder when 1133 is divided by 100. 33 Calculate the remainder when 156 is divided by 34. 20 Calculate the remainder when 320 is divided by 105. 5 Calculate the remainder when 1083 is divided by 113. 66 What is the remainder when 4748 is divided by 11? 7 Calculate the remainder when 63 is divided by 2. 1 What is the remainder when 3010 is divided by 298? 30 Calculate the remainder when 527 is divided by 78. 59 What is the remainder when 154 is divided by 39? 37 What is the remainder when 93 is divided by 31? 0 Calculate the remainder when 336 is divided by 34. 30 What is the remainder when 2895 is divided by 18? 15 What is the remainder when 230 is divided by 8? 6 Calculate the remainder when 1527 is divided by 48. 39 Calculate the remainder when 210 is divided by 110. 100 What is the remainder when 7530 is divided by 31? 28 Calculate the remainder when 567 is divided by 30. 27 What is the remainder when 396 is divided by 20? 16 Calculate the remainder when 14616 is divided by 172. 168 What is the remainder when 118 is divided by 31? 25 What is the remainder when 1219 is divided by 49? 43 Calculate the remainder when 68 is divided by 12. 8 What is the remainder when 59 is divided by 17? 8 Calculate the remainder when 81 is divided by 30. 21 Calculate the remainder when 431 is divided by 12. 11	{ "pile_set_name": "DM Mathematics" }
0 Solve -4h - 6q = -q + 41, 2 = -3h + 2q for h. -4 Solve 9x - 10x + 10 = -5m, 5x - 2m - 27 = 0 for x. 5 Solve -3s + z = 0, 4s + 5z + 0z - 19 = 0 for s. 1 Solve 3r - 4f = 8, -4r - 5f - 3 = 7 for r. 0 Solve 2h + 14 = 4k + h, 2k - 2 = -2h for k. 3 Solve 0 = -b + 3u, 2b - 9 + 0 = -3u for b. 3 Solve -k - 14 = 4d, -k + 31 = -3d + 17 for d. -4 Solve s = -5u - 14, -3s = -6s - u - 14 for s. -4 Solve j = 4h - 17 + 5, -3h + 4j + 22 = 0 for h. 2 Solve -33 = 4k + 5c - 4, -16 = -4k + 4c for k. -1 Solve 3o = -j - 2j + 6, 0 = 4o + 3j - 7 for o. 1 Solve -2u + 0w = -w + 2, u = -4w - 1 for u. -1 Solve 5t = 15, -5i - 18 - 17 = -5t for i. -4 Solve 0 = 3h - 2u + 4u, -5u = 4h - 7 for h. -2 Solve 0 = 2s + 5y - 2 - 23, y - 5 = 0 for s. 0 Solve 4s = -5f - 12, -4f + s - 20 = -23 for f. 0 Solve -4s = -4a + 20, -3s + a - 1 = -6s for s. -1 Solve -2r + 2q = 3r - 13, 3r + 5 = -2q for r. 1 Solve 0 = -5x - 2m - 18, 3x + 34m + 9 = 31m for x. -4 Solve l + 3l = -f + 1, 4l = -3f + 11 for f. 5 Solve 2y + 3d + 7 = 0, -6 + 7 = y + 6d for y. -5 Solve 4m + 4f = m - 6, 4f = -4m - 8 for m. -2 Solve 5o - 27 = -m - 3, -3m + 4o - 23 = 0 for m. -1 Solve 11 = s + 3z, 4s - 5 = -90z + 91z for s. 2 Solve 0 = 4r + 2w + 33 - 5, 4r - 2w + 12 = 0 for r. -5 Solve -3b - 14 = -5, -d = 2b + 9 for d. -3 Solve 2o - 5p + 1 = 11, 4p + 16 = 0 for o. -5 Solve f = -3b + 4b, 4f - 12 = b for f. 4 Solve 2u = -8f + 4f - 6, 7 = 2f + 3u for f. -4 Solve 2m + 3w + 6 = 0, -4m + 10w = 12w + 12 for m. -3 Solve 2p - 2c - 4 + 12 = 0, 0 = -2c + 8 for p. 0 Solve -3x - 1 = -2v, x + 99 = 96 for v. -4 Solve -15 = 5x, -3r - 45x - 12 = -41x for r. 0 Solve -4b - r - 25 = -12, -r = b + 1 for b. -4 Solve 0 = -2c + 2t - 130 + 134, -2c = t + 8 for c. -2 Solve 34 = -5h + 3k, -5h = -2h - 3k + 24 for h. -5 Solve -3q - 4 = -o, o - 4 = -q - 8 for o. -2 Solve 3w - 4l = 22, -4l + 16 = -8l for w. 2 Solve -3b = -4p - 6, 2 - 12 = -5b for p. 0 Solve 0 = -2f + 4, -204f = n - 200f - 8 for n. 0 Solve -h = 2r - 2, 1 = 3r - 4h + 20 for r. -1 Solve 199x = 5f + 195x - 34, 3f - x = 19 for f. 6 Solve 7 = 4b - 3b + 2x, -5b - 5x = -25 for b. 3 Solve -1 = 3d + 4a, -2d + a + 15 = 23 for d. -3 Solve -5n = -20, 0 = -x - 8x - 2n + 26 for x. 2 Solve -3y + 2p - 6 = -8y, 4y - 15 = -5p for y. 0 Solve -4v + 8 = 2p, -4p + 3p = -4v + 14 for p. -2 Solve -6 = 3f - u + 8, -u = 2f + 1 for f. -3 Solve 27 = 3v + 4j, -3 = -3v + 4j - 0 for v. 5 Solve -3f + 2s = 12 - 16, 5f + 3s = -6 for f. 0 Solve 5x - 32 = 4g, -x - 4x = 4g - 8 for x. 4 Solve 3o + 9 = -n - 2o, 4o = 4n + 12 for n. -4 Solve 3j - 3f = 6, 3f - 170 = -161 for j. 5 Solve -4g - 4h + 24 = 0, -5g - 2h = -28 + 7 for g. 3 Solve 4k = t - 21, 0 = 2t + 2k - 5k - 17 for t. 1 Solve -m + 4m = 0, 3b + m = 12 for b. 4 Solve 3x = -3u, u + 14 = -4x + 20 for u. -2 Solve 61c = 62c - 3p - 6, 3c - 4p = 8 for c. 0 Solve 27 = -3l - 4i, -5l + 40 = -10l - 5i for l. -5 Solve -n + 4t = 8, -54 = -n + t - 59 for n. -4 Solve -i + 2j - 6 = 0, -4j = -2i - 8j + 20 for i. 2 Solve 2m + o - 13 = -14, -o = -2m - 3 for m. -1 Solve 3l = -2h + 3, -3h + 3 = -105l + 108l for l. 1 Solve 3k - 5d = -6d - 1, -4k - 2d = 0 for k. -1 Solve s + 3k - 70 = -56, -4 = -4s + k for s. 2 Solve 2i = -0p + 5p + 4, -2p - 4 = -2i for i. 2 Solve v = -4a - 4, -2v + 7 - 10 = 3a for v. 0 Solve 0 = -0n - 2n - q + 4, -5q = 3n - 13 for n. 1 Solve -4o - 2 = 2w, 2w - 9o = -8o - 7 for w. -3 Solve 3q + 12 = -2v + 6, -4q + 4v - 8 = 0 for q. -2 Solve -2p - 3w + 7 = -3, p - 2w + 2 = 0 for p. 2 Solve -4g + 5k + 6 = 10, -3g + 5k - 8 = 0 for g. 4 Solve -2l = -5v - 6 + 33, -3v = 4l - 11 for v. 5 Solve -25 = -2j - 4x - 23, 2x = 3j + 29 for j. -7 Solve -9 = -3v, 3v = 12t - 10t + 21 for t. -6 Solve 0 = 5r + 25, y - 8 - 10 = 3r for y. 3 Solve 2u - 6 = -j, 2u - 2 = -28j + 26j for j. -4 Solve 0 = -n - 3y - 19, -n = 33y - 29y + 24 for n. -4 Solve -y = 4r + 11, -51r + y + 1 = -50r for r. -2 Solve o + 3 = 0, 3n - 4o + 6o = -6 for n. 0 Solve p = 5p + 4h - 12, -2 = h for p. 5 Solve r + 6n = 2n - 2, -r + n = 2 for r. -2 Solve -5j - 13k = -14k - 23, 5j + 4k - 33 = 0 for j. 5 Solve 5m = -3r + 14, -10 = -6m + 4m + r for m. 4 Solve -a = 3l - 17, -3l - 4a - 1 = -24 for l. 5 Solve t + 4 = -m, -3 + 19 = -2t - 4m for t. 0 Solve 0 = 5v + 19q - 22q + 1, 0 = 2v + 5q + 19 for v. -2 Solve b + 10 = 2m - 3b, -20 = -5m + 5b for m. 3 Solve 14 = -2l + 2n, 0 = -2l - 3n + 5 + 1 for l. -3 Solve 3o - 3 + 0 = 0, -2c = -2o - 8 for c. 5 Solve 0 = -5l + 2m + 24, 2l - 85m - 2 = -88m for l. 4 Solve -2a - 7 = 3i, -4i + 4a = -22 - 2 for i. 1 Solve -q + 2y = -3, -4q = 6y - y - 25 for q. 5 Solve -5r + 71q - 73q + 17 = 0, -4q = 4r - 28 for r. 1 Solve -3c + 5c = 3r - 7, -4c - 18 = -2r for r. -1 Solve 4w - 4x = 5w + 6, -3w - 3 = -3x for w. -2 Solve -m - 3c - 2 = 0, 4m + 3c = 5c - 22 for m. -5 Solve 4d - 11 = -l, -3d + 21 = -4l + 8 for d. 3 Solve -4j - 3i = 6 - 10, -j - i = -1 for j. 1 Solve 0 = 4i - 2i - 3p - 4, -p = -4i + 18 for i. 5 Solve 4 = -4w + 2b - 4, -3w = -2b + 8 for w. 0 Solve 0 = 5t + 3m + 22 + 5, 0 = 5t - m + 31 for t. -6 Solve 0 = -3r - 6, 5r + 0r = -5p - 20 for p. -2 Solve 0 = -2n - 5y + 21, -2y + 7y - 25 = 0 for n. -2 Solve 5h + 542 = 4m + 574, h = -2m - 2 for m. -3 Solve 117d + 5f = 116d + 20, 5f = -3d + 30 for d. 5 Solve -2 = -j, -4x + 63j = 67j + 8 for x. -4 Solve -c - 20 = -0c - 5o, -2 = -2c - 4o for c. -5 Solve -4y + 5y - 7 = 4n, 0 = -5n - 2y - 12 for n. -2 Solve 3f = -5s + 35, 0 = -2f - 0f - 2s + 18 for f. 5 Solve -4v - c = 18, 33v + 5c = 34v + 15 for v. -5 Solve 2v - 5l = -3l - 20, -15 = 4v + l for v. -5 Solve 0k - 18 = -2a + 5k, -5k = a + 21 for a. -1 Solve -36 = -5i - 3b - 2, 2b - 31 = -5i for i. 5 Solve 5r + 28 = 18, 4r = s - 3 for s. -5 Solve f = -0f + 2p + 5, 4 = 2f + 2p for f. 3 Solve -5m - 3n - 13 = -n, 5n = 4m + 17 for m. -3 Solve 10j + 2v - 2 = 6j, v = 3 for j. -1 Solve 0 = -4h + 2k, 2h = 4h - 4k - 6 for h. -1 Solve 12 = -2z + 4z - 4b, -24 = 4z + 4b for z. -2 Solve 29 = -n + 5h, 4n = -2h - 0h - 6 for n. -4 Solve 2l = 3s - 16, -l = l + 3s - 8 for l. -2 Solve -3l = -f - 1 + 5, -4l - 2 = 2f for f. 1 Solve 4s = -2v + 4, -3s + 15v + 3 = 16v for s. 1 Solve 0x - 1 = b - 4x, 0 = -2b - 3x + 9 for b. 3 Solve 0b + 5b + 1 = 2q, 0 = -4q - 8 for b. -1 Solve 0 = 2u - x - 4, 0 = -2x for u. 2 Solve -t - 5o + 12 = 0, -5t + 4 = -t - 2o for t. 2 Solve 0 = d + b + 2, -3d + b + 109 - 103 = 0 for d. 1 Solve 15 = 3i - 2y, 0i + 10 = 2i - 4y for i. 5 Solve -5g + 5p = -35, -5g - 6p + 33 = -10p for g. 5 Solve s + 0 = -4j + 1, -j - 4s = -19 for j. -1 Solve -f - 2 = 3q, 5q = 6f - 7f - 2 for f. -2 Solve -9 = d + g - 7, g = 5d - 14 for d. 2 Solve -1 = -2q + v, 5q = -5v - 0v + 25 for q. 2 Solve 2j = -25n + 23n - 2, 3j = -5n - 7 for n. -2 Solve -21f + 22f + 3j - 10 = 0, 0 = 5f + 5j - 20 for f. 1 Solve -3p = -3w + w - 16, -3p + 2 = 5w for p. 4 Solve 4b + 4 = 0, 5n + b - 29 + 5 = 0 for n. 5 Solve 5z + f - 9 = -35, 0 = -5z - 4f - 29 for z. -5 Solve -5y = -5u, -u - 3u + 20 = 0 for y. 5 Solve -4g + 18q = 14q + 20, -2q = -4g - 20 for g. -5 Solve -3g - 5 = -2q - 15, 25 = -5q + 5g for q. -5 Solve 0 = 2a + 10s + 34, -a + 3s + 8 - 1 = 0 for a. -2 Solve 4n = -3f - 24 + 21, -2n = -5f + 21 for n. -3 Solve -4a - 12 = -2a - 2x, -4a - 5x = -12 for a. -2 Solve q = x + 6, 0 = q - 2x - 4 - 4 for q. 4 Solve -2w + 4y - 3y - 1 = 0, -5w + 35 = 5y for w. 2 Solve -6b + 4b + 3 = a, -2 = -4a - 3b for a. -1 Solve 6 - 4 = 4q - 2n, -5n = 5q + 35 for q. -2 Solve -5f - 56s + 5 = -61s, -s = 4 for f. -3 Solve 0o + 4y = -5o - 25, -o + y + 4 = 0 for o. -1 Solve -4p + 0 = -5v - 16, v - 2p + 8 = 0 for v. 0 Solve k - 10 = -3j - j, -4k = -5j + 2 for j. 2 Solve 0 = -5p - 15, c - 6 = 5p + 10 for c. 1 Solve b - 10 = -3r, r - 10b + 6b = -1 for r. 3 Solve 4x - 2t = 12, 4t - 41 = -9x + 4x for x. 5 Solve -3b - 2m - 14 = -7	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.