Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
3 What are the prime factors of 496323? 3, 55147 List the prime factors of 63735. 3, 5, 7, 607 List the prime factors of 14774998. 2, 7, 389, 2713 List the prime factors of 135787. 135787 What are the prime factors of 12313960? 2, 5, 211, 1459 What are the prime factors of 11695082? 2, 7, 17, 49139 List the prime factors of 1381618. 2, 7, 29, 41, 83 What are the prime factors of 7967710? 2, 5, 733, 1087 What are the prime factors of 3124758? 2, 3, 7, 13, 59, 97 List the prime factors of 444216. 2, 3, 83, 223 What are the prime factors of 4417687? 853, 5179 What are the prime factors of 179301? 3, 59, 1013 What are the prime factors of 3167635? 5, 233, 2719 What are the prime factors of 14007875? 5, 7, 2287 What are the prime factors of 532012? 2, 13, 787 What are the prime factors of 2915905? 5, 583181 What are the prime factors of 494738? 2, 247369 What are the prime factors of 1630600? 2, 5, 31, 263 List the prime factors of 2245844. 2, 561461 What are the prime factors of 11333433? 3, 37, 102103 List the prime factors of 3094835. 5, 61, 73, 139 What are the prime factors of 214478? 2, 11, 9749 List the prime factors of 5895208. 2, 11, 31, 2161 List the prime factors of 21362966. 2, 29, 368327 What are the prime factors of 748578? 2, 3, 17, 41, 179 List the prime factors of 14437989. 3, 613, 2617 What are the prime factors of 296369? 296369 List the prime factors of 2808619. 11, 255329 List the prime factors of 15884266. 2, 19, 418007 What are the prime factors of 3715970? 2, 5, 31, 11987 List the prime factors of 33595276. 2, 11, 13, 58733 What are the prime factors of 12747808? 2, 398369 What are the prime factors of 9189530? 2, 5, 7, 43, 71 List the prime factors of 1060877. 593, 1789 What are the prime factors of 10307610? 2, 3, 5, 17, 6737 List the prime factors of 496016. 2, 29, 1069 What are the prime factors of 2296665? 3, 5, 7, 23, 317 What are the prime factors of 67656? 2, 3, 2819 List the prime factors of 154214. 2, 83, 929 List the prime factors of 135346. 2, 31, 37, 59 What are the prime factors of 961896? 2, 3, 13, 3083 List the prime factors of 512926. 2, 31, 8273 What are the prime factors of 1239843? 3, 11, 37571 List the prime factors of 969225. 3, 5, 12923 List the prime factors of 15918767. 29, 97, 5659 List the prime factors of 13518638. 2, 7, 17, 79, 719 List the prime factors of 1060347. 3, 571, 619 What are the prime factors of 13716871? 7, 43, 199, 229 What are the prime factors of 561267? 3, 7, 59, 151 List the prime factors of 96716. 2, 24179 List the prime factors of 455070. 2, 3, 5, 7, 11, 197 What are the prime factors of 16078? 2, 8039 List the prime factors of 28952. 2, 7, 11, 47 What are the prime factors of 278? 2, 139 What are the prime factors of 2011840? 2, 5, 6287 What are the prime factors of 1239594? 2, 3, 41, 5039 List the prime factors of 29827530. 2, 3, 5, 19, 17443 List the prime factors of 1410978. 2, 3, 19, 12377 List the prime factors of 1637367. 3, 545789 List the prime factors of 293511. 3, 227, 431 List the prime factors of 536432. 2, 13, 2579 What are the prime factors of 8688268? 2, 2172067 What are the prime factors of 224616? 2, 3, 7, 191 What are the prime factors of 210249? 3, 13, 599 What are the prime factors of 6298916? 2, 13, 29, 4177 What are the prime factors of 4205238? 2, 3, 73, 9601 List the prime factors of 12888609. 3, 59, 72817 List the prime factors of 2124554. 2, 31, 34267 What are the prime factors of 665785? 5, 133157 What are the prime factors of 4828643? 23, 149, 1409 List the prime factors of 342275. 5, 13691 List the prime factors of 85528. 2, 10691 List the prime factors of 51617. 71, 727 What are the prime factors of 233525? 5, 9341 What are the prime factors of 944677? 944677 List the prime factors of 332762. 2, 379, 439 What are the prime factors of 920436? 2, 3, 11, 19, 367 What are the prime factors of 3616776? 2, 3, 191, 263 What are the prime factors of 294105? 3, 5, 7, 2801 List the prime factors of 2438366. 2, 7, 174169 List the prime factors of 51736. 2, 29, 223 List the prime factors of 99450. 2, 3, 5, 13, 17 What are the prime factors of 4319695? 5, 29, 31 What are the prime factors of 6479764? 2, 1619941 List the prime factors of 6969221. 7, 41, 3469 What are the prime factors of 585778? 2, 173, 1693 List the prime factors of 907243. 59, 15377 List the prime factors of 1513639. 809, 1871 What are the prime factors of 847896? 2, 3, 7, 103 What are the prime factors of 914508? 2, 3, 7, 19, 191 What are the prime factors of 4749038? 2, 7, 127, 2671 What are the prime factors of 8326005? 3, 5, 17, 103, 317 What are the prime factors of 144993? 3, 17, 2843 What are the prime factors of 9166419? 3, 257, 1321 List the prime factors of 2640912. 2, 3, 37, 1487 List the prime factors of 4517339. 41, 239, 461 What are the prime factors of 6113265? 3, 5, 109, 3739 List the prime factors of 554914. 2, 17, 19, 859 List the prime factors of 1617667. 569, 2843 List the prime factors of 3202101. 3, 7, 53, 137 What are the prime factors of 251273? 11, 53, 431 List the prime factors of 8043028. 2, 7, 287251 What are the prime factors of 362535? 3, 5, 24169 What are the prime factors of 855441? 3, 59, 179 List the prime factors of 547824. 2, 3, 101, 113 What are the prime factors of 159468? 2, 3, 97, 137 What are the prime factors of 2787690? 2, 3, 5, 43, 2161 What are the prime factors of 20043? 3, 17, 131 List the prime factors of 26732. 2, 41, 163 What are the prime factors of 1260533? 17, 74149 What are the prime factors of 236048? 2, 14753 List the prime factors of 7437317. 1553, 4789 List the prime factors of 1124623. 787, 1429 List the prime factors of 1817701. 1817701 What are the prime factors of 17512799? 31, 79, 7151 What are the prime factors of 4431856? 2, 11, 13, 149 What are the prime factors of 1389129? 3, 7, 29, 2281 What are the prime factors of 217652? 2, 54413 What are the prime factors of 88813? 88813 List the prime factors of 16756848. 2, 3, 79, 491 What are the prime factors of 6050396? 2, 11, 199, 691 List the prime factors of 28982. 2, 43, 337 What are the prime factors of 56790? 2, 3, 5, 631 What are the prime factors of 19384? 2, 2423 What are the prime factors of 9628037? 9628037 List the prime factors of 388506. 2, 3, 73, 887 What are the prime factors of 3436579? 41, 79, 1061 List the prime factors of 3094226. 2, 19, 107, 761 List the prime factors of 391903. 391903 What are the prime factors of 1449391? 23, 29, 41, 53 What are the prime factors of 175635? 3, 5, 1301 What are the prime factors of 7886246? 2, 3943123 What are the prime factors of 423363? 3, 141121 List the prime factors of 6605465. 5, 1321093 List the prime factors of 254733. 3, 19, 41, 109 List the prime factors of 5687882. 2, 2843941 What are the prime factors of 5220167? 5220167 List the prime factors of 599900. 2, 5, 7, 857 What are the prime factors of 29798878? 2, 19, 784181 List the prime factors of 2890770. 2, 3, 5, 167, 577 What are the prime factors of 23358973? 11, 1187, 1789 What are the prime factors of 4625? 5, 37 What are the prime factors of 3618156? 2, 3, 29, 37, 281 List the prime factors of 1691092. 2, 13, 17, 1913 List the prime factors of 648658. 2, 324329 List the prime factors of 245663. 11, 23, 971 List the prime factors of 2242963. 17, 131939 List the prime factors of 25131924. 2, 3, 97, 2399 List the prime factors of 2797613. 7, 13, 71, 433 List the prime factors of 7463434. 2, 11, 339247 List the prime factors of 4186928. 2, 151, 1733 What are the prime factors of 442342? 2, 221171 What are the prime factors of 16215897? 3, 23, 235013 List the prime factors of 12511007. 12511007 List the prime factors of 23200063. 23200063 List the prime factors of 161535. 3, 5, 11, 89 What are the prime factors of 841339? 19, 44281 What are the prime factors of 322238? 2, 7, 23017 What are the prime factors of 522057? 3, 174019 List the prime factors of 1893218. 2, 467, 2027 List the prime factors of 3375644. 2, 843911 List the prime factors of 11255493. 3, 3751831 What are the prime factors of 4507203? 3, 1009, 1489 What are the prime factors of 1597524? 2, 3, 17, 41, 191 List the prime factors of 1104413. 19, 37, 1571 List the prime factors of 1784697. 3, 594	{ "pile_set_name": "DM Mathematics" }
q + aq*2 and give a. -37209 Rearrange 1 - 3 + 60662w*2 + 14w - 20236w2 - 20032w*2 - 20195w*2 to the form n + gw + mw2 and give n. -2 Rearrange 7 - 19 + 1 + 44y - 15 + 11 to jy + q and give j. 44 Express -14x - 19x - 35x + 80 - 77 as mx + k and give k. 3 Express 225r*3 + r - 114r + 3 - 226r3 in the form yr + lr3 + br*2 + u and give y. -113 Express 4743i*2 + 3i*4 - 9481i*2 + 4732i*2 - 32i*3 + 1 + 2i + 0i as fi*4 + qi*2 + gi + ki3 + y and give q. -6 Rearrange -10d + 2d3 - 17d - 100 + 27d - 12d to od + ad*2 + vd*3 + z and give v. 2 Rearrange (-555m - 5625m - 3261m + 598m - 1040m - 1358m)(1 - m - 1) to x + om2 + jm and give o. 11241 Rearrange -30972a - 632255 + 632255 to fa + r and give f. -30972 Rearrange -324 - 111p2 - 2p*3 - 3p + 322 - 8p4 + 113p*2 to the form b + op + rp4 + mp*2 + zp*3 and give b. -2 Rearrange (-470f - 621f - 2031 + 1093f)(2f*3 - 3f*2 + 3f*2) to sf*4 + cf + i + qf3 + lf*2 and give s. 4 Express (-1 + 2r + 1)(-2 + 0 + 3)(-657r3 + 225233 - 225233) as kr*2 + ar + nr3 + g + br*4 and give b. -1314 Express (-2t + 5t + 2t)(-52 - 35 - 5)(3 - 1 - 4) in the form n + xt and give x. 920 Rearrange 2x*2 - 8x2 + x2 + (x - 1 + 1)(3x + x - 2x) + 2x*2 + 12980 - 13x*2 - 12979 to the form ox + u + yx2 and give y. -14 Rearrange 2w*2 - 86 - 568w + 595w + 0w*2 - 88 - 28w*3 + 176 to cw + a + zw3 + ow*2 and give a. 2 Rearrange 184 - 1836 + y - 631 to the form i + jy and give i. -2283 Express -4 - 6f + 0f + 12f - 4f - 6 + 204f2 in the form kf + xf2 + w and give x. 204 Express 3y - 228y3 + 529y*3 - 158y*3 as my*3 + cy*2 + j + xy and give x. 3 Rearrange 606q2 - 606q*2 - 1960q*3 - 20q*3 + (-2q2 - q2 + 2q2)(-9q - 11q + 0q) to the form bq*2 + h + yq*3 + cq and give y. -1960 Express -32 - 9p + 34 - 6p + 3p + (-360p + 25478 - 25478)(-3 + 4 + 0) as tp + f and give t. -372 Rearrange -168 + 36l - 17l - 521 - 20l to il + m and give m. -689 Express 3y + 4276468y*2 - 4276468y*2 - 491y4 - y3 - 1 as r + xy4 + dy*3 + ny + qy2 and give x. -491 Express -1120v*3 + 2 + 1216v*3 + 10v - 12v - 4v*2 in the form a + jv*3 + rv + cv2 and give c. -4 Express (971 - 971 - 749t*3)(3t - 3t + 8t) as dt*4 + kt*3 + i + bt*2 + at and give i. 0 Express -121f2 + 0f*2 - 438f*2 + (1 + f - 1)(-3 + 3 + f) + 2f2 - f2 + 2f*2 in the form qf + xf2 + v and give x. -555 Rearrange 514u - 131u - 132u - 25 - 124u - 129u to gu + o and give o. -25 Rearrange (0p + p - 3p)(-2p + 4p - p) + (1 - 1 - p)(1 - 6 + 3)(-393p - 82p + 33p) - 10p*2 - 16p*2 - 15p*2 to vp*2 + g + qp and give v. -927 Express 3280k2 - 4732k*2 - 2k + 2k - 2k*3 - 20143k*2 as zk + hk3 + nk*2 + a and give h. -2 Rearrange -4q*2 + 45947q - 2 + 2q2 - 45914q to the form rq + u + iq*2 and give r. 33 Express -46625q + 149q2 - 2q*3 - 3 + 2 + 46623q + 5 + 3 in the form vq3 + x + yq + hq2 and give v. -2 Express 5 - 63n*4 - 185n*4 + 27n*4 - 8 + 36n*3 + 2n*2 - 37n*3 in the form gn*3 + o + in*2 + kn + rn4 and give g. -1 Express (-45m2 + m2 + 10m2)(-3m2 + 19m*2 + 31m*2) + (2 - 2 - 2m)(-3 + 5m*3 + 3) as pm*3 + km + n + jm4 + am*2 and give j. -1608 Express 759w - 162w + 4w + (1 - 6 + 3)(4 - 4 + 4w) as b + dw and give d. 593 Express 15q*3 + 14 + 18 - 2q*2 - 7q*3 - 5q*3 - 15q*3 as wq + y + gq3 + jq*2 and give y. 32 Express 3203u*3 - 2u*4 + 3207u*3 - 10u - 6408u3 - 1 + 36u*2 in the form pu*2 + v + ku*3 + lu + bu4 and give l. -10 Express 8 - 4i*3 - 8 + (45i - 22i - 22i)(3i*2 - 6i*2 - 7i2) + i3 - 2i3 - i3 in the form ci*2 + ai*3 + ui + o and give a. -16 Express 30344833 - 30344833 + 25407h in the form x + dh and give d. 25407 Rearrange (674 + 882 + 1226)(2f + 0f - 4f + (2 - 4 + 1)(0 - f + 0)) to w + hf and give h. -2782 Express (0a - 3a + 5a)(0 + 1 + 1) + 209 + 776 + 97a - 49a - 84a in the form c + ta and give c. 985 Rearrange (17d + 3d*2 - 17d)(17d + 14 - 14) + 96d3 + 98d*3 - 136d*3 to the form bd*2 + x + cd + gd3 and give g. 109 Rearrange (-7p*3 + 61 - 61)(-636 + 267p + 636) to yp*2 + wp*3 + k + lp*4 + dp and give l. -1869 Rearrange (-2 + 2 + m)(20552 - 20957 + 17m - 18m) + m2 - m2 - m2 to om + h + sm2 and give o. -405 Rearrange (-1753i*2 - 1358 + 1358)(-2i + 7i*2 - 3i*2 - 2i*2) to ji + a + gi3 + wi*2 + di*4 and give g. 3506 Express -17a*4 + 180a*3 + 645a + 3a2 + 10a*4 - 179a*3 - 3a*2 as wa*4 + ga + ha3 + qa*2 + z and give h. 1 Express (-6b + 4b + 5b)(-79 - 72 + 99)(4b2 - b - 12 + 5 + 9) as ab + ib2 + d + gb*3 and give a. -312 Express 21324900g*4 - 5g*3 + 5g*3 + 4g*2 - 39g - 21324876g4 in the form wg*2 + r + bg + tg3 + lg*4 and give b. -39 Express (0v - 3v - 3v)(-163 + 118 - 197) in the form uv + z and give u. 1452 Express -415w + 1182w + 0 + 1522w + 0 in the form n + lw and give l. 2289 Rearrange -17374d + 7474d - 9163d to i + md and give m. -19063 Rearrange -30n2 - 2n*3 + 3n - 917 - 30n2 + 919 + n2 + n3 to the form sn + rn2 + jn*3 + u and give j. -1 Express 2b - 1 + 101b2 + 23b*3 - 6b*3 + 4 - 2b*3 - 13b*3 in the form ib + a + db2 + yb*3 and give d. 101 Rearrange -34551 + 69102 - 7808z*2 - 34551 to the form wz*2 + gz + b and give w. -7808 Rearrange -5t4 + 1137t*3 + 3t*2 - 886t + 888t - 5 - 1136t*3 to it*3 + yt*4 + ct*2 + dt + a and give d. 2 Express 40p3 - 3p*2 + 4p*2 - 75p*3 + 3p*4 - 2 + 60p*3 as dp*3 + ap*2 + cp + tp4 + g and give t. 3 Express -7597231b*2 + 5734b*3 + 7597231b*2 + (-2 + 2b + 2)(2b*2 + b - b) as rb + jb3 + sb*2 + a and give r. 0 Express (-5v - v + 7v)(-405 + 58 - 302 - 353 - 206 - 292) as av + g and give a. -1500 Rearrange (-165i - 626i - 257i + 2)(-2 + 10 + 8) + i + i - 4i to the form pi + j and give j. 32 Express (-10m + 48 - 48)(17m*2 + 64m*2 - 14m*2 + (7m - 3m - 2m)(5m - 4m - 3m)) as h + qm + im*2 + um*3 and give u. -630 Rearrange -70 - 91 + 2490x + 161 to z + fx and give f. 2490 Rearrange (3l - 2l + l)(-4l2 + l2 + 4l*2) + 4l*3 - 3l*3 + 3l*3 - 180091l - 87l2 + l3 + 180091l to jl + dl*2 + k + ol*3 and give o. 7 Rearrange -540j*3 - 13756 + 13756 - 8j*3 + 2 - 2 + (-5j*2 + 3j*2 + 3j*2)(-3j + 3j - 2j) to k + wj*3 + zj + mj2 and give w. -550 Express -1463h*2 + 1227h*2 + 7 - 2588h*2 - 9 + 1 in the form uh + gh2 + x and give x. -1 Rearrange -s - 8107s*2 - 17669s*2 - 2050s*2 to d + hs + ys2 and give h. -1 Rearrange -4c*3 - 6c + 77425 - 77425 + (5 + 4 - 5)(-4c*3 - 3c*3 + 5c*3) to yc*3 + pc*2 + j + kc and give y. -12 Rearrange (-2v + v - 5v)(v - 2v + 4v) - 2v + 4v + 86 - 44 - 19v*2 to the form h + mv + av2 and give h. 42 Express -14t + 0t2 - 22t + 38t - 27 + t3 + t3 + t2 as lt*2 + dt*3 + vt + o and give v. 2 Rearrange -13 - j + 35 - 12 + 94j4 + j2 + 3j*3 - 9 to zj*2 + qj*4 + pj + w + mj3 and give w. 1 Express (2h - 5h + 4h)(3 - 6 + 1) - 6h + 4h + h + (h - 2 + 2)(2 + 4 - 7) + 17910 - 8969 - 4h - 8792 - 2h + 6h - 2h in the form s + lh and give l. -6 Express 0v + 2v4 + v + 5v + (2v3 + 7v*3 - 4v*3)(-26 + 26 + 54v) in the form sv*4 + kv*2 + yv*3 + zv + j and give z. 6 Rearrange -27f - 52f + 13f + (116f - 242f + 118f)(4 + 0 - 2) to the form j + vf and give j. 0 Express 37h - 6h3 + 7092 - 3515 + h4 - 12h2 - 3578 in the form jh*2 + wh*4 + kh + n + bh3 and give n. -1 Express (16j + 186j + 174j)(-19 - 5 + 2) in the form h + wj and give w. -8272 Express -9g2 - 13g*2 - 7g*2 + 36 - 10g*2 + 26g*2 in the form w + kg*2 + zg and give w. 36 Rearrange b + 2 - 2 + (-169 - 299 - 40)(-2 + 3b + 2) to the form i + jb and give j. -1523 Express -7z + 10z - 68248 + 69397 in the form qz + o and give o. 1149 Rearrange 15512f*2 -	{ "pile_set_name": "DM Mathematics" }
+ 2o. Let p be v(-7). Let n = p - 3062. What is n rounded to the nearest 1000? 2000 Let y = -6.971341 - 22.028657. Let u = 29 + y. What is u rounded to 5 dps? 0 Let g = 2.37 - 4.996. Let k = -2.6 - g. Let n = k - 0.059. What is n rounded to 2 decimal places? -0.03 Let g(t) be the first derivative of 23t*2/2 + 6t - 9. Let r = 2 - 8. Let y be g(r). What is y rounded to the nearest 10? -130 Let l = 4.7 - -1. What is l rounded to the nearest integer? 6 Let g(c) = -c*2 + 12c - 15. Let p be g(11). Let k(m) = -6799m + 4. Let x be k(p). Round x to the nearest one thousand. 27000 Let m(f) = -8571f + 6. Let j be m(-14). Suppose -j = -4r + 2r. Round r to the nearest one hundred thousand. 100000 Let s = -0.033 - -0.0293. Let a = -2.4863 + s. What is a rounded to one dp? -2.5 Let h = 61 + -60.905. Round h to 2 decimal places. 0.1 Suppose 0 = 2t - 5t + 13500000. What is t rounded to the nearest one million? 5000000 Let y = 8.06 - 8. Let v = 0.08 - y. Let m = v - 0.0164. What is m rounded to 3 decimal places? 0.004 Let k(t) = -570991t - 9. Let a be k(1). What is a rounded to the nearest 100000? -600000 Suppose 5v = a - 126603, 0a = 5a + 3v - 633043. Suppose -2f + a = -53392. Round f to the nearest one hundred thousand. 100000 Let o = -1.2 + 1.27. Let j = -0.06 + o. Let t = -0.0100016 + j. Round t to six dps. -0.000002 Let h = 297 - 310.1. Round h to 0 dps. -13 Suppose -y - 3y = 4n + 48, -5y + 4n - 24 = 0. Let c(z) = -206249z2 + 10z + 16. Let g be c(y). What is g rounded to the nearest one million? -13000000 Suppose -51732 = 2b + 10718. Suppose 5o + 377550 = 3o. Let p = o + b. What is p rounded to the nearest one hundred thousand? -200000 Let q = 0.1 - -15.9. Let f = 15.9999996 - q. What is f rounded to seven dps? -0.0000004 Let z = -0.0276 + 0.031. What is z rounded to three dps? 0.003 Let f = -0.284 + 0.28400302. Round f to seven dps. 0.000003 Let u(a) be the first derivative of a3/3 + 5a*2/2 - 6a + 2. Let v be u(-5). Round v to the nearest 10. -10 Let y = -0.05 + -0.03. Let w = y - -0.07999988. What is w rounded to seven decimal places? -0.0000001 Let x = 1.96 - 2. Let t = -0.1 + 0.28. Let y = x - t. Round y to 1 dp. -0.2 Let x = 16.1 + -19. Let c = x + -0.1. Let w = -2.99992 - c. Round w to 5 decimal places. 0.00008 Let l = 56484 + -39688. Suppose -2o = 5j + 8420, -o + j = 3o + l. Round o to the nearest 1000. -4000 Let c = -0.347999522 + 0.348. Round c to 7 decimal places. 0.0000005 Let u = -123418093.5999963 + 123418100. Let j = -73 - -66.6. Let k = u + j. Round k to six decimal places. 0.000004 Let b = 14.744 + -14. What is b rounded to 1 decimal place? 0.7 Suppose 4y + 3v = 2y + 260000, 0 = 3y + 2v - 390000. Round y to the nearest 100000. 100000 Let k = 2 - -2. Let y = 23 + k. Let l = y + -27.0000017. Round l to six decimal places. -0.000002 Let f = -8872940651 + 8872913651.199935. Let a = f - -26997. Let l = a + 2.8. What is l rounded to 5 decimal places? -0.00007 Let j = -0.07865 - -0.08. Round j to four dps. 0.0014 Let k = -5.9 + 6. Let s = 0 - k. Round s to one decimal place. -0.1 Suppose -4k - 180 = k. Let x be -9302 - (-9)/(k/(-8)). Round x to the nearest 1000. -9000 Let p = 202.861 + -203. What is p rounded to 2 dps? -0.14 Let f = 2.6 - 3.1. Let p = 0.123 - -0.3766. Let y = f + p. What is y rounded to 4 decimal places? -0.0004 Let a = 647 + -646.999583. Round a to 4 decimal places. 0.0004 Let k = 4 - 2. Let d = -5 + k. Let m = d - -3.00004. Round m to five decimal places. 0.00004 Let l be 2/4-27994 - 3. What is l rounded to the nearest ten thousand? -10000 Let w be (-10)/2 - -3 - -6. Suppose wp - 1932300 = y + 2767712, -2y - 9399994 = 2p. Round y to the nearest one million. -5000000 Let i = 0.492 + -9.622. Round i to the nearest integer. -9 Let z = 13 - 13.00025. Round z to 4 decimal places. -0.0003 Let d = 2762894906.1660054 - 2762895292. Let m = d - -385.789. Let x = 0.045 + m. What is x rounded to 6 decimal places? 0.000005 Let p = 5 - 2. Suppose pg + 26915 - 118903 = -2f, -f + 46020 = -5g. Round f to the nearest 10000. 50000 Let a = 3.1 - 7.7. Let y = a + 4.59937. What is y rounded to four decimal places? -0.0006 Let u = -730.57 - -736. Let d = 1.27 + u. Round d to 0 dps. 7 Let m = 75.013 - 0.013. Let d = 65.980802333 - -9.019196407. Let s = d - m. What is s rounded to 7 decimal places? -0.0000013 Let q = 986.05 - -39851.95. Let h = -40838.66971 + q. Let c = h + 0.67. Round c to four dps. 0.0003 Let f(t) = 9661t2 - 5t + 2t + 2t + 141735t2. Let i be f(8). Let k = -2489336 + i. What is k rounded to the nearest one million? 7000000 Suppose 3m = -2p - 198012, 1 = -2m - 7. Round p to the nearest ten thousand. -100000 Let b = 2.96 + 0.04. Let a = -3.23 + b. What is a rounded to one decimal place? -0.2 Let b = -6838 + -1562. Round b to the nearest ten thousand. -10000 Let a = -0.3 - -0.2. Let l = -0.5 - a. Let o = l - -0.400022. What is o rounded to 5 decimal places? 0.00002 Let r = 2 - 6.5. Round r to the nearest integer. -5 Let i = -0.025 - -0.024969. What is i rounded to five dps? -0.00003 Let c = 14623585 + -21105616. Let x = 6482047.000045 + c. Let z = -16 + x. What is z rounded to 5 decimal places? 0.00005 Let x = -0.07 + 0.17. Let z = -0.1 + 0.2. Let c = x + z. Round c to one decimal place. 0.2 Let u = 47.13 + -45.3. What is u rounded to 1 dp? 1.8 Let f = 426.4 + -480. Round f to the nearest integer. -54 Suppose 0 = -3i + 57072943 - 15754573. Let f = i - 7572790. Round f to the nearest one million. 6000000 Let k = 0.16 + -0.25. Let y = -0.19 - k. Let o = -0.10000008 - y. Round o to 7 decimal places. -0.0000001 Let y = -1.1000029 - -1.1. Round y to six dps. -0.000003 Let i be 1/(((-3)/6)/(-1)). Let n(b) = 4bi - b3 + 2 + 2b - 3 + b. Let y be n(4). Round y to the nearest 10. 10 Let l = -116.9984 + 117. Round l to three decimal places. 0.002 Let c = -3970413247.00000073 - -3970413118. Let q = -52 + -77. Let z = c - q. Round z to seven dps. -0.0000007 Let q = 11 + 5. Suppose 3v - 117 = 3d, -q = -v + 5d + 7. What is v rounded to the nearest ten? 40 Let o = 12 - 4. Let p be 2 - (-284)/o-4. What is p rounded to the nearest 100? -100 Let s = -4.8 - -4.800086. What is s rounded to 5 dps? 0.00009 Let v = -95 + 37. Let p = -61.15 - v. Let y = 3.1500141 + p. Round y to 6 dps. 0.000014 Suppose -3570 = -5p + 32930. What is p rounded to the nearest one thousand? 7000 Let c = 1374 + -1386.015. Let j = c - -12. What is j rounded to 2 dps? -0.02 Let q = 30164 + -99856. Let r = 69692.0419958 + q. Let m = 0.042 - r. What is m rounded to 6 dps? 0.000004 Let g = -2 + 6. Suppose 3 = r + g. Let j be (r - 52/6)6. What is j rounded to the nearest ten? -60 Let y be 2/5 + (-292)/(-20). Suppose 17000000 = -yi + 13i. Round i to the nearest 1000000. -9000000 Let r = -8 - -8.0215. What is r rounded to 3 dps? 0.022 Let v = -1.1 + 8. What is v rounded to 0 decimal places? 7 Let b(g) = -1247g*2 + 4. Let k be b(-4). Let o = 60052 - k. What is o rounded to the nearest 100000? 100000 Suppose -1728 = -g - 0o - o, -o + 3456 = 2g. Suppose 3i + 3x - g = -0i, 5i - 2908 = 2x. What is i rounded to the nearest one hundred? 600 Let r(n) = -n + 9. Let k be r(-7). Let f = -10 + k. Suppose -2i - 18400 = -fi. Round i to the nearest 1000. 5000 Let n = -26.3283 - -24.832. Let y = 1.5 + n. What is y rounded to three decimal places? 0.004 Let g = 499653 + 730347. What is g rounded to the nearest one hundred thousand? 1200000 Let v = -17 + 27. Suppose c - 2w = -9, 2c = -0w + 2w - v. Let x(t) = 1000000t. Let b be x(c). Round b to the nearest one million. -1000000 Let i = 32 - 73. Let d = 20175.080958 + -20216.081. Let l = d - i. What is l rounded to 5 dps? -0.00004 Suppose -4q - 20020 = -5h, 4h + 3q + 7095 = 23080. What is h rounded to the nearest ten thousand? 0 Let k(r) = r3 + 7r*2 - 10r - 12. Let b(o) = o. Let m be b(-8). Let i be k(m). Let t(f) = -850f. Let g be t(i). Round g to the nearest one thousand. -3000 Let w = 0.25968 - 0.38319. Let x = -0.15 - -0.026. Let o = x - w. What is o rounded to four decimal places? -0.0005 Let s = -15.489939961 + 26350.089937961. Let i = s + -26334.9. Let n = 0.3 + i. Round n to 6 dps. -0.000002 Suppose 0z + z = -4t - 316, 4t - 4*z + 336 = 0. Round t	{ "pile_set_name": "DM Mathematics" }
factors of 6401? 37, 173 What are the prime factors of 2314? 2, 13, 89 What are the prime factors of 9375? 3, 5 What are the prime factors of 5490? 2, 3, 5, 61 What are the prime factors of 1296? 2, 3 List the prime factors of 3517. 3517 List the prime factors of 8336. 2, 521 What are the prime factors of 3379? 31, 109 List the prime factors of 5. 5 List the prime factors of 979. 11, 89 List the prime factors of 2811. 3, 937 List the prime factors of 16100. 2, 5, 7, 23 What are the prime factors of 114368? 2, 1787 What are the prime factors of 15573? 3, 29, 179 List the prime factors of 1808. 2, 113 List the prime factors of 19153. 107, 179 List the prime factors of 3408. 2, 3, 71 List the prime factors of 4398. 2, 3, 733 List the prime factors of 93734. 2, 46867 List the prime factors of 2412. 2, 3, 67 What are the prime factors of 4810? 2, 5, 13, 37 List the prime factors of 914. 2, 457 What are the prime factors of 19387? 19387 What are the prime factors of 1290? 2, 3, 5, 43 List the prime factors of 153327. 3, 51109 What are the prime factors of 104187? 3, 34729 List the prime factors of 8198. 2, 4099 List the prime factors of 34037. 101, 337 List the prime factors of 32575. 5, 1303 What are the prime factors of 7798? 2, 7, 557 List the prime factors of 84664. 2, 19, 557 List the prime factors of 6600. 2, 3, 5, 11 What are the prime factors of 5998? 2, 2999 What are the prime factors of 29786? 2, 53, 281 List the prime factors of 7813. 13, 601 List the prime factors of 38207. 13, 2939 List the prime factors of 893. 19, 47 What are the prime factors of 7185? 3, 5, 479 List the prime factors of 16647. 3, 31, 179 List the prime factors of 1974. 2, 3, 7, 47 What are the prime factors of 420? 2, 3, 5, 7 What are the prime factors of 47350? 2, 5, 947 List the prime factors of 734. 2, 367 What are the prime factors of 4230? 2, 3, 5, 47 What are the prime factors of 1159? 19, 61 List the prime factors of 21855. 3, 5, 31, 47 List the prime factors of 1558. 2, 19, 41 List the prime factors of 33138. 2, 3, 7, 263 What are the prime factors of 4047? 3, 19, 71 List the prime factors of 22613. 22613 List the prime factors of 21056. 2, 7, 47 What are the prime factors of 271? 271 List the prime factors of 190. 2, 5, 19 List the prime factors of 3004. 2, 751 What are the prime factors of 842? 2, 421 List the prime factors of 1376. 2, 43 List the prime factors of 119829. 3, 59, 677 List the prime factors of 2324. 2, 7, 83 List the prime factors of 8619. 3, 13, 17 List the prime factors of 2756. 2, 13, 53 What are the prime factors of 108? 2, 3 List the prime factors of 18901. 41, 461 What are the prime factors of 740? 2, 5, 37 What are the prime factors of 58725? 3, 5, 29 What are the prime factors of 17804? 2, 4451 What are the prime factors of 1560? 2, 3, 5, 13 What are the prime factors of 21183? 3, 23, 307 What are the prime factors of 8633? 89, 97 What are the prime factors of 6843? 3, 2281 List the prime factors of 167640. 2, 3, 5, 11, 127 What are the prime factors of 1579? 1579 What are the prime factors of 29222? 2, 19, 769 List the prime factors of 1312. 2, 41 What are the prime factors of 4217? 4217 What are the prime factors of 5378? 2, 2689 What are the prime factors of 15617? 7, 23, 97 List the prime factors of 8404. 2, 11, 191 What are the prime factors of 4986? 2, 3, 277 List the prime factors of 373. 373 List the prime factors of 21639. 3, 7213 What are the prime factors of 1755? 3, 5, 13 List the prime factors of 1986. 2, 3, 331 List the prime factors of 22112. 2, 691 What are the prime factors of 8462? 2, 4231 List the prime factors of 9973. 9973 List the prime factors of 24031. 7, 3433 List the prime factors of 754. 2, 13, 29 What are the prime factors of 33569? 33569 List the prime factors of 56142. 2, 3, 3119 List the prime factors of 66. 2, 3, 11 List the prime factors of 2672. 2, 167 List the prime factors of 884. 2, 13, 17 List the prime factors of 526. 2, 263 List the prime factors of 60. 2, 3, 5 List the prime factors of 44585. 5, 37, 241 List the prime factors of 16092. 2, 3, 149 List the prime factors of 8052. 2, 3, 11, 61 List the prime factors of 104245. 5, 20849 List the prime factors of 9176. 2, 31, 37 What are the prime factors of 132? 2, 3, 11 What are the prime factors of 566? 2, 283 What are the prime factors of 13142? 2, 6571 List the prime factors of 15766. 2, 7883 List the prime factors of 1857. 3, 619 What are the prime factors of 612? 2, 3, 17 What are the prime factors of 20753? 20753 What are the prime factors of 1384? 2, 173 List the prime factors of 52119. 3, 5791 What are the prime factors of 3104? 2, 97 List the prime factors of 1757. 7, 251 What are the prime factors of 592? 2, 37 What are the prime factors of 3400? 2, 5, 17 What are the prime factors of 23165? 5, 41, 113 List the prime factors of 17997. 3, 7, 857 List the prime factors of 21412. 2, 53, 101 List the prime factors of 2737. 7, 17, 23 List the prime factors of 1956. 2, 3, 163 What are the prime factors of 799? 17, 47 What are the prime factors of 4134? 2, 3, 13, 53 List the prime factors of 759. 3, 11, 23 List the prime factors of 1631. 7, 233 What are the prime factors of 1761? 3, 587 List the prime factors of 1221. 3, 11, 37 List the prime factors of 1473. 3, 491 List the prime factors of 3060. 2, 3, 5, 17 List the prime factors of 287. 7, 41 List the prime factors of 225. 3, 5 List the prime factors of 9899. 19, 521 What are the prime factors of 4092? 2, 3, 11, 31 What are the prime factors of 58? 2, 29 List the prime factors of 10524. 2, 3, 877 What are the prime factors of 2430? 2, 3, 5 List the prime factors of 1568. 2, 7 List the prime factors of 68790. 2, 3, 5, 2293 List the prime factors of 10010. 2, 5, 7, 11, 13 List the prime factors of 79. 79 List the prime factors of 59730. 2, 3, 5, 11, 181 What are the prime factors of 566? 2, 283 List the prime factors of 193. 193 What are the prime factors of 4623? 3, 23, 67 What are the prime factors of 636? 2, 3, 53 List the prime factors of 2034. 2, 3, 113 List the prime factors of 24878. 2, 7, 1777 What are the prime factors of 85? 5, 17 What are the prime factors of 321? 3, 107 What are the prime factors of 1495? 5, 13, 23 What are the prime factors of 5973? 3, 11, 181 List the prime factors of 74339. 79, 941 List the prime factors of 10233. 3, 379 What are the prime factors of 88342? 2, 44171 What are the prime factors of 98979? 3, 32993 List the prime factors of 19318. 2, 13, 743 What are the prime factors of 24548? 2, 17, 19 List the prime factors of 40347. 3, 4483 List the prime factors of 8112. 2, 3, 13 What are the prime factors of 3569? 43, 83 List the prime factors of 36449. 7, 41, 127 What are the prime factors of 46650? 2, 3, 5, 311 What are the prime factors of 91287? 3, 7, 23 What are the prime factors of 55798? 2, 23, 1213 List the prime factors of 1403. 23, 61 What are the prime factors of 1960? 2, 5, 7 What are the prime factors of 125114? 2, 11, 47 List the prime factors of 1429. 1429 What are the prime factors of 39908? 2, 11, 907 List the prime factors of 1469. 13, 113 List the prime factors of 2394. 2, 3, 7, 19 What are the prime factors of 6092? 2, 1523 List the prime factors of 5326. 2, 2663 List the prime factors of 3411. 3, 379 List the prime factors of 6199. 6199 List the prime factors of 4470. 2, 3, 5, 149 List the prime factors of 131700. 2, 3, 5, 439 What are the prime factors of 2732? 2, 683 What are the prime factors of 13142? 2, 6571 List the prime factors of 9748. 2, 2437 What are the prime factors of 10341? 3, 383 What are the prime factors of 1319? 1319 List the prime factors of 3552. 2, 3, 37 What are the prime factors of 14566? 2, 7283 What are the prime factors of 3484? 2, 13, 67 What are the prime factors of 6688? 2, 11, 19 List the prime factors of 1341. 3, 149 What are the prime factors of 1262? 2, 631 What are the prime factors of 4754? 2, 2377 List the prime factors of 30019. 11, 2729 List the prime factors of 1085. 5, 7, 31 List the prime factors of 229. 229 What are the prime factors of 769? 769 List the prime factors of 533. 13, 41 List the prime factors of 5544. 2, 3, 7, 11 What are the prime factors of 1998? 2, 3, 37 What are the prime fac	{ "pile_set_name": "DM Mathematics" }
1466 What is next in 3264, 3244, 3220, 3192? 3160 What comes next: -5056, -10104, -15154, -20206, -25260? -30316 What is next in 23309, 23301, 23287, 23267, 23241, 23209? 23171 What is the next term in 3144, 5970, 8796, 11622? 14448 What comes next: 15260, 30507, 45752, 60995, 76236, 91475? 106712 What comes next: 8, 58, 172, 380, 712? 1198 What is next in 608, 888, 1354, 2006, 2844? 3868 What comes next: 1829, 3652, 5503, 7394, 9337? 11344 What is the next term in -395, -1526, -3393, -6002, -9359, -13470, -18341? -23978 What comes next: -7860, -30695, -68752, -122031, -190532, -274255? -373200 What is the next term in -20, -26, -36, -50, -68? -90 What is the next term in -532, -1196, -1860? -2524 What is next in 3962, 7922, 11882? 15842 What comes next: 60473, 120947, 181417, 241883, 302345, 362803, 423257? 483707 What is next in 125898, 251802, 377706, 503610, 629514? 755418 What is the next term in 396, 1567, 3524, 6273, 9820, 14171? 19332 What comes next: -2067, -2046, -2025, -2004, -1983, -1962? -1941 What is the next term in 2156, 2191, 2226, 2261? 2296 What comes next: 337, 712, 1087? 1462 What comes next: -1658, -3290, -4904, -6494, -8054, -9578? -11060 What is next in 36341, 72739, 109137? 145535 What comes next: 72318, 72347, 72392, 72453, 72530, 72623, 72732? 72857 What comes next: 74, -2, -188, -538, -1106, -1946, -3112? -4658 What is the next term in 33144, 33130, 33116, 33102, 33088, 33074? 33060 What is the next term in 1226, 2456, 3686, 4916? 6146 What is the next term in 58, 74, 6, -188, -550? -1122 What is the next term in 60, 315, 698, 1173, 1704? 2255 What is next in 122, 257, 384, 503, 614? 717 What is next in -124, -577, -1294, -2245, -3400, -4729, -6202? -7789 What is the next term in 852, 1338, 1824, 2310? 2796 What is next in -222, -474, -742, -1020, -1302, -1582, -1854? -2112 What is next in 190, 1432, 4746, 11158, 21694, 37380, 59242, 88306? 125598 What is the next term in -415, -800, -1163, -1504, -1823, -2120, -2395? -2648 What is the next term in -72741, -72745, -72749, -72753? -72757 What is next in -868, -856, -808, -706, -532, -268? 104 What is the next term in 166, 179, 168, 121, 26, -129, -356, -667? -1074 What is next in -7176, -7180, -7184, -7188, -7192? -7196 What is next in -21, -84, -241, -540, -1029, -1756? -2769 What is the next term in -4079, -8155, -12231, -16307, -20383? -24459 What is next in 946, 950, 952, 952, 950, 946? 940 What comes next: -1586, -6303, -14164, -25169, -39318? -56611 What comes next: -8659, -8643, -8629, -8617, -8607, -8599? -8593 What is next in 1232, 2456, 3680, 4904, 6128? 7352 What comes next: 473, 1012, 1625, 2348, 3217, 4268, 5537, 7060? 8873 What is the next term in -51386, -102775, -154164, -205553, -256942? -308331 What comes next: -523, -1008, -1483, -1948, -2403, -2848, -3283? -3708 What comes next: -622, -2487, -5594, -9943, -15534, -22367, -30442? -39759 What comes next: -618056, -618054, -618052? -618050 What comes next: -43753, -87485, -131215, -174943, -218669, -262393, -306115? -349835 What is the next term in -1633, -6563, -14779, -26281, -41069? -59143 What comes next: 1718, 7068, 15992, 28496, 44586, 64268, 87548, 114432? 144926 What is the next term in 2646466, 2646461, 2646454, 2646445? 2646434 What is next in -271856, -271861, -271866, -271871? -271876 What is next in -139443, -139444, -139445, -139446, -139447? -139448 What is next in 606157, 606156, 606155, 606154, 606153? 606152 What is the next term in -2376, -9696, -21900, -38988, -60960? -87816 What comes next: -3988, -3952, -3900, -3838, -3772, -3708, -3652, -3610? -3588 What is next in -2354, -4699, -7028, -9335, -11614, -13859, -16064? -18223 What comes next: 8487, 33886, 76217, 135486, 211699, 304862? 414981 What is the next term in 174892, 174877, 174862, 174847, 174832, 174817? 174802 What is next in -271262, -271261, -271260, -271259, -271258? -271257 What comes next: 10431, 10418, 10381, 10308, 10187, 10006, 9753? 9416 What is the next term in -1948, -1958, -1976, -2002, -2036, -2078, -2128? -2186 What comes next: 77, 108, 117, 104, 69, 12? -67 What comes next: 1413, 2221, 3029, 3837, 4645, 5453? 6261 What is next in 36889, 147562, 332017, 590254, 922273, 1328074? 1807657 What is next in -548, -577, -606, -635? -664 What comes next: 907, 3619, 8137, 14461? 22591 What is the next term in 4680, 4687, 4694, 4701, 4708, 4715? 4722 What is the next term in -670, -970, -1268, -1564, -1858, -2150, -2440? -2728 What is the next term in 53520, 107040, 160560, 214080, 267600, 321120? 374640 What is the next term in -1873, -1844, -1795, -1726? -1637 What comes next: -77, -641, -2167, -5135, -10025, -17317, -27491, -41027? -58405 What comes next: -29, -79, -129, -179? -229 What comes next: 20997, 21018, 21057, 21120, 21213? 21342 What is next in 54089, 54092, 54097, 54104, 54113? 54124 What is the next term in 97, 249, 509, 883, 1377, 1997, 2749? 3639 What comes next: -35010, -35009, -35006, -35001, -34994, -34985, -34974? -34961 What comes next: -559, -3919, -13085, -30961, -60451, -104459? -165889 What is next in 227527, 227528, 227527, 227524? 227519 What is next in 1180, 2373, 3590, 4843, 6144, 7505? 8938 What is the next term in -205, -344, -531, -790, -1145? -1620 What is next in -392, -4194, -14810, -35648, -70116, -121622, -193574? -289380 What is next in 2844, 2847, 2850, 2853, 2856, 2859? 2862 What is next in -4333, -4378, -4437, -4510, -4597, -4698, -4813? -4942 What is next in 214, 209, 184, 127, 26, -131, -356, -661? -1058 What is the next term in -39348, -78696, -118042, -157386? -196728 What is next in -25038, -25079, -25120, -25161, -25202, -25243? -25284 What is the next term in -4804, -4786, -4734, -4630, -4456, -4194, -3826? -3334 What is next in 13502, 27004, 40506, 54008? 67510 What is next in -10924, -10671, -10418, -10165, -9912? -9659 What is next in 434, 1676, 3744, 6638, 10358, 14904, 20276? 26474 What comes next: 7394, 29573, 66544, 118313, 184886, 266269, 362468, 473489? 599338 What is the next term in 829, 808, 783, 754, 721? 684 What comes next: -1568, -3151, -4734, -6317, -7900? -9483 What comes next: 36974, 73949, 110924? 147899 What is next in 1408366, 1408377, 1408386, 1408393? 1408398 What comes next: 739, 1479, 2233, 3007, 3807, 4639? 5509 What is next in 4317, 8644, 13003, 17412, 21889, 26452, 31119? 35908 What comes next: -4526, -4528, -4528, -4526? -4522 What is the next term in -384, -379, -368, -351, -328? -299 What is the next term in 495, 1953, 4435, 7983, 12639? 18445 What is the next term in 3826, 7857, 11878, 15883, 19866, 23821, 27742, 31623? 35458 What is next in -199, -93, 29, 173, 345, 551? 797 What is next in -149, 752, 3659, 9574, 19499, 34436, 55387, 83354? 119339 What is the next term in -4272, -8537, -12796, -17049, -21296, -25537? -29772 What is next in 534942, 1069883, 1604824, 2139765? 2674706 What is next in 47, 124, 275, 536, 943, 1532, 2339? 3400 What comes next: 1069, 8806, 29819, 70744, 138217, 238874? 379351 What comes next: 30934, 61861, 92788? 123715 What is the next term in 1224, 1235, 1252, 1275, 1304? 1339 What is the next term in -2797, -2923, -3067, -3235, -3433, -3667? -3943 What is the next term in -17, 119, 495, 1231, 2447, 4263, 6799? 10175 What is the next term in 29479, 29472, 29465, 29458, 29451? 29444 What is next in -24266, -194106, -655102, -1552832, -3032874? -5240806 What comes next: -14404, -28887, -43370, -57853, -72336? -86819 What is next in -284, -1119, -2516, -4475, -6996? -10079 What is next in 90953, 90951, 90949, 90947? 90945 What comes next: 221, 470, 723, 980, 1241, 1506? 1775 What comes next: 3533, 7076, 10617, 14156, 17693, 21228? 24761 What is the next term in 5949, 11894, 17839, 23784, 29729, 35674? 41619 What comes next: 21240, 21232, 21210, 21168, 21100? 21000 What comes next: -115, -225, -315, -385, -435, -465, -475? -465 What comes next: -1338, -2778, -4206, -5622? -7026 What is next in 148362, 148361, 148360, 148359, 148358? 148357 What is the next term in -1423212, -1423213, -1423214, -1423215, -1423216? -1423217 What is the next term in 8681, 8822, 8973, 9140, 9329, 9546, 9797, 10088? 10425 What is the next term in 12333, 24653, 36963, 49257, 61529, 73773? 85983 What comes next: -2569378, -256937	{ "pile_set_name": "DM Mathematics" }
2/203? (a) -2 (b) -0.2 (c) 1/11 (d) -13 (e) 4 c Which is the nearest to -6/7? (a) 2 (b) 27 (c) 1/2 (d) 26 c Which is the closest to -1? (a) 2/9 (b) -9/8 (c) -475 b Which is the closest to 2? (a) -1/3 (b) 0.09 (c) 110 (d) -0.5 (e) -0.19 b What is the closest to 0 in -0.3, 0.1, -2/7, -200.7, 39? 0.1 What is the nearest to 1 in -308, -4, -2/5, -3/8? -3/8 Which is the nearest to -11/12? (a) -7 (b) 1 (c) 5 (d) -0.3 d Which is the nearest to -2/3? (a) 1/6 (b) 21 (c) -3/28 (d) 3 c Which is the nearest to -2/9? (a) -119 (b) 3 (c) 5 (d) 2 d Which is the nearest to 11? (a) -3 (b) 2/5 (c) 1.7 c Which is the closest to 13.6? (a) 0 (b) 5 (c) -7 b What is the nearest to 0.1 in -39589, 3, 2/3? 2/3 What is the closest to -2/17 in -1, -0.9, -14/3? -0.9 What is the closest to 0.19 in 3/7, -1/5, -0.07045? 3/7 What is the nearest to 0 in -20, -79, -120, 0.4? 0.4 What is the closest to -164 in -0.1, -0.063, -4, 0.1? -4 What is the nearest to 0 in 5, 11/42, 2, -0.12? -0.12 What is the nearest to -1 in -145, -0.5, -2781? -0.5 Which is the closest to 2/3? (a) 245/4 (b) -1 (c) 5 (d) 4 b What is the nearest to 2 in 2/11, -2/9, 345, 0.12? 2/11 Which is the nearest to 0? (a) 0.4 (b) -37/2 (c) -0.3 (d) 1/3 (e) -5 c Which is the closest to 2/27? (a) 2 (b) 10 (c) 1.5 (d) 0.1 d Which is the closest to 49? (a) -2 (b) -3 (c) 1/2 (d) -5/2 (e) 0.4 c Which is the closest to -25? (a) 0.9 (b) 3/17 (c) 3/5 (d) -5/4 (e) -0.1 d What is the nearest to 1/2 in 0.1, -190, 0.5? 0.5 What is the closest to -76 in 5, 3/5, 3/17, 2, -1/2? -1/2 What is the nearest to 1 in -4, -24.331, 0.3? 0.3 Which is the nearest to 1? (a) -2/13 (b) -28 (c) -178 a What is the nearest to 2885 in 0.03, -1/3, 0.2, 8, 5? 8 Which is the nearest to 0? (a) 2/9 (b) 0 (c) 1265 b Which is the nearest to -2? (a) -1 (b) 0.4 (c) -276 a What is the nearest to -9 in 1/5, 0.005, 0.8, 3? 0.005 What is the nearest to -1714 in -0.2, 160, 0.3, -5? -5 What is the nearest to 0.26 in 2, -4, -53/3? 2 What is the nearest to 1 in 3/5, 38/7, 0.4, -453? 3/5 What is the nearest to -0.06 in 415, 0.5, 5/3? 0.5 What is the nearest to 2/17 in -38/13, -1, 1/4? 1/4 What is the nearest to -0.04 in 0.09, 5/2, -0.3, 6, 1? 0.09 Which is the closest to 1/3? (a) 2793 (b) 1 (c) 0 c What is the closest to -1/2 in -1497, 4/9, 2? 4/9 Which is the closest to -1? (a) 4 (b) 1/8 (c) -2 (d) -4.6 (e) 1 c What is the nearest to -1/3 in 0.4, 3, 8, 0.04, -3/4? 0.04 What is the nearest to -2 in -3, 0.5, 211, 1/9, 3/2? -3 What is the closest to -5606 in -2, -0.5, 1/8, -0.1, -4? -4 What is the nearest to 2 in -2, 3/58, 8? 3/58 Which is the nearest to -0.2? (a) -26 (b) -3 (c) 0.039 (d) 4 c What is the closest to -67/10 in 1/4, 7, -4, -1/12, -0.5? -4 Which is the nearest to 0? (a) 118 (b) -2 (c) 0.357 (d) -4 (e) -7 c Which is the nearest to 0.03? (a) -2 (b) 2 (c) -0.3 (d) -119 (e) 4 c What is the closest to -1/3 in -4, -0.09, 2/451? -0.09 What is the closest to 2/7 in -0.7, 1, 3/58, 14? 3/58 What is the nearest to -5/4 in 0.3, -18, -3, -99/10? 0.3 What is the nearest to -0.1 in -140, 5, -3/2, -0.3? -0.3 What is the nearest to 1 in -665, -0.2, -6? -0.2 What is the nearest to -0.2 in -2/65, 10, 0.2, 28? -2/65 What is the closest to 3 in 1/7, 62, 7? 1/7 Which is the nearest to -0.9? (a) -5.31 (b) -2 (c) 0 (d) 5 c What is the nearest to 1/2 in 1/41, 2.6, 2? 1/41 Which is the closest to 0.07? (a) -2 (b) -4/3 (c) -2/11 (d) -1/17 d What is the closest to 4.2 in 5, -5, -10, 123, 4? 4 What is the closest to 1 in 1, 5, 2, -0.10821? 1 Which is the closest to -0.1? (a) 3 (b) 4 (c) -2360 (d) 11 a What is the nearest to 0 in -1/7, 4/5475, 1/2? 4/5475 What is the closest to 0 in -82, -1.7, 0.05? 0.05 Which is the closest to -1? (a) 2 (b) 70/9 (c) 1/4 (d) -9/11 (e) 0.14 d Which is the closest to 0.2? (a) -5 (b) 1517 (c) 5/22 (d) -4 c What is the nearest to 1/3 in -15, -204, 4, -0.1, -1/6? -0.1 Which is the nearest to -2/5? (a) 0.3 (b) -0.18 (c) 44/29 b What is the closest to 0 in -0.3, 16, 241? -0.3 Which is the nearest to -2/23? (a) 0.08 (b) -10 (c) -2 (d) 0.3 (e) 0.5 a Which is the closest to 3? (a) -572 (b) 1/13 (c) -0.1 b Which is the nearest to 1/3? (a) -0.3 (b) -1 (c) -61 (d) 1/5 (e) -3 d Which is the closest to 1/24? (a) 0 (b) -0.2 (c) -77/4 (d) 2/7 a What is the nearest to -4 in -1350, 1/2, -2, -0.3? -2 What is the nearest to -1 in -11, 2/3, -0.03, 0.15? -0.03 Which is the nearest to -12? (a) -0.02 (b) -1/6 (c) 15 (d) -1/7 b What is the closest to 2/7 in 14, 2.63, -0.2? -0.2 Which is the nearest to -0.1? (a) 5 (b) -1.83 (c) -79 b Which is the nearest to -3/4? (a) 2309 (b) -3/2 (c) 0.4 (d) 0.5 b What is the closest to -4.45 in -2/7, 4, -1, -5/8? -1 Which is the closest to -0.1? (a) 1/2 (b) 0.15 (c) -3 (d) 5.2 b Which is the closest to -0.3? (a) -249 (b) -1/2 (c) -49 (d) -0.3 d Which is the nearest to 17? (a) -1.2 (b) -1 (c) 3/2 (d) 6 d What is the nearest to 2 in -4/17, -4/5, -5/7, 2? 2 What is the closest to 80 in -41, 0.2, 2/9? 2/9 What is the closest to 5 in 4421, -1, -2/13, 0.3, -2? 0.3 Which is the closest to -2? (a) -24/11 (b) 2 (c) -0.5 a What is the nearest to 0.5 in 3, -1323, -5/3, -1? -1 What is the closest to -2/5 in -2, -9279, -5, -4? -2 Which is the closest to 1? (a) 0 (b) 408 (c) -2 (d) -0.3 a Which is the nearest to 0.1? (a) -1/5 (b) 129830 (c) -1 a What is the closest to -5/222 in 26.1, -1, -0.1? -0.1 What is the nearest to 1.3 in -1, -0.1, -2/5, -11? -0.1 What is the closest to -4.8 in 10/3, 3, 0, -1/3? -1/3 Which is the nearest to 1? (a) 39.6 (b) -3 (c) 625 b Which is the closest to 26? (a) -4 (b) 14 (c) 5 b Which is the nearest to -2/13? (a) 2/17 (b) 2/23 (c) 0 (d) 2/11 (e) -0.132 e What is the closest to -2 in -1/5, -23, 161, -1, 0.3? -1 Which is the nearest to -13? (a) 5 (b) -0.4 (c) -5 (d) 2/15 (e) 70 c What is the nearest to 0.1 in -0.6, 1/3, -30815? 1/3 Which is the closest to -5/6? (a) 3 (b) 1/135 (c) 0 c What is the nearest to 41/2 in 2/5, -195, 2, -5, -1/2? 2 Which is the nearest to -40? (a) 0.2 (b) 5 (c) 647 a Which is the closest to 3.6? (a) 3 (b) -0.5 (c) 100 (d) -0.2 (e) -3 a Which is the closest to 1095? (a) -12 (b) -1/4 (c) -0.2 c What is the nearest to -1 in -0.3, 30, 8/5, -0.2? -0.3 Which is the nearest to -0.2? (a) -2/73 (b) -2/11 (c) -0.1 (d) 0.046 (e) 3 b What is the closest to 2/265 in -1, 0, 0.1, 0.2, 2/3? 0 What is the closest to -0.296 in -0.02, -5, 7, 0? -0.02 Which is the closest to 4? (a) 0.3 (b) -1 (c) -48/5 (d) -2/7 (e) -1.4 a What is the nearest to 3/8 in -1/8, -0.19, 1/4? 1/4 Which is the closest to -4/35? (a) -48 (b) 2 (c) -0.2 (d) 4 (e) 1 c What is the nearest to -0.093 in -0.3, -0.4, 124, 2/9? -0.3 What is the closest to -0.1 in 5, -0.057, -168? -0.057 Which is the closest to -18? (a) -0.1 (b) -148/3 (c) -5 c What is the closest to 2/9 in -1.1, 0.2, -5, -12? 0.2 Which is the closest to -2? (a) -2 (b) -0.1 (c) -43 a What is the nearest to -8 in 0.1, 28.42, -26? 0.1 What is the nearest to -0.4 in 0, 0.3, -2/13, -124? -2/13 What is the nearest to 0 in 11/2, -7/4, -0.229, 6/5? -0.229 Which is the nearest to 14? (a) -4 (b) -0.3 (c) 3/2 (d) 1/101 c Which is the nearest to 1/2? (a) -0.3 (b) -6 (c) 2/17 (d) 1165 (e) -0.2 c What is the closest to -1 in -1028, -21, -1/50? -1/50 What is the closest to 9/16 in -11, 0.1, -5/3, 0.06? 0.1 Which is the nearest to -4? (a) -1 (b) -0.022 (c) 1/2 (d) 5 (e) 1/6 a Which is the closest to -0.1? (a) 2/3 (b) -280 (c) 3 (d) 6 (e) -6 a What is the nearest to 195 in -4, 3/4, -0.4, 0.1? 3/4 Which is the nearest to -4? (a) -2/7 (b) 3/25 (c) 0.5 (d) 2 (e) -2/11 a What is the nearest to -20 in 1.8, 4.9, -31? -31 What is the closest to 1 in 0.3, -1/80, 2/9, 8? 0.3 What is the nearest to 5/7 in 4/11, -2/3, 2/13? 4/11 What is the closest to -138 in -1, -7/16, 2/7? -1 Which is the nearest to 2? (a) -4 (b) -1 (c) 0.4 (d) 1/52 (e) 0.1 c What is the closest to -1 in -3, -115, 1177, -4/7? -4/7 Which is the closest to -6530? (a) -0.4 (b) -3/50 (c) 4 (d) -0.2 (e) 2 a What is the nearest to -34 in 7/5, -12, 2, -4? -12 What is the nearest to 4 in -3, -222, 1/2? 1/2 Which	{ "pile_set_name": "DM Mathematics" }
itive. i(-24/139) Simplify ((n14/n)/n1)(9/4) assuming n is positive. n27 Simplify l(2/17)l(-8/3) assuming l is positive. l(-130/51) Simplify (ff/(ff(-1/5)f)fff)(-10/7) assuming f is positive. f(-32/7) Simplify (f6/f)(1/4) assuming f is positive. f(5/4) Simplify ((f0)25)35 assuming f is positive. 1 Simplify (f(-1))(-33)(ff(2/5))24 assuming f is positive. f(333/5) Simplify t(2/55)/ttt(-8/5)/t assuming t is positive. t(-141/55) Simplify ((t(3/2)t)/t*(-1))/((tt*(-6)/t)/((tt*6t)/t)) assuming t is positive. t(33/2) Simplify m(-2)mm*(-4/5)mm assuming m is positive. m(1/5) Simplify (q18qq)/(q/(q(-1/4)q)) assuming q is positive. q(79/4) Simplify f4f(9/4)/f(f/f*(-1/3)ff)(14/5) assuming f is positive. f(175/12) Simplify (xx/(x/(x/((x*17x)/xx)x)))/(((xx/(x/(xx*(-8/7))))/xx)/x) assuming x is positive. x*(-104/7) Simplify kk*(-2)k(3/4) assuming k is positive. k(-1/4) Simplify (f(2/11))(2/29) assuming f is positive. f(4/319) Simplify ((n(-29)nn)/n)/(n(-3)/n) assuming n is positive. n(-24) Simplify q*(-4/7)q/(q*(-18)/qq) assuming q is positive. q(129/7) Simplify (w(-9)/(w(w/w7)/w))/(((w/w(3/5))/w)/ww*(-2/9)w) assuming w is positive. w(-98/45) Simplify (p2)*(-3/41)(p/((p/(ppppp/(p/(p*(-1/3)p))pp))/p)pp)/pp(-1/2) assuming p is positive. p(1973/246) Simplify (m(1/7)/m4)(1/64) assuming m is positive. m(-27/448) Simplify g(-2)/g(2/5)g*(1/6)gg(-4) assuming g is positive. g(-157/30) Simplify (q(-7)/q(-2/27))/(qq*(-1/3)q)(-1/14) assuming q is positive. q(-2573/378) Simplify (d*(-27)d)/(d*7/dd) assuming d is positive. d*(-33) Simplify ((ww(-3/2))/w5)/(w/(w/w*(-4))w(-7/5)/w) assuming w is positive. w(9/10) Simplify (p*5/((pp*6pp)/p))13 assuming p is positive. p(-39) Simplify (g/(g/((g5ggg)/g)))/(g/(gg/g(2/11))) assuming g is positive. g(86/11) Simplify y7/y(-4)(y0)(2/3) assuming y is positive. y11 Simplify b(-7)bb(b/(b(-6)/b))/bb(b(-2/3))16 assuming b is positive. b(-23/3) Simplify v(-1/2)/(vv*2v) assuming v is positive. v*(-9/2) Simplify (aa/a(6/11))/a7 assuming a is positive. a*(-61/11) Simplify (ll/l*(-1/2))/(l/(l/(lll2)))(l/l(-2/5))11 assuming l is positive. l(139/10) Simplify (m(-2/23)((m1m)/m)/m)/((m/(mm/(m(-3)/m)m))/m(1/7)) assuming m is positive. m(975/161) Simplify (y*(-2/3)/yy)(-47) assuming y is positive. y(94/3) Simplify (bb/(bb*(-1)b))*(-19)(b*(2/3)bb)(1/15) assuming b is positive. b(-847/45) Simplify ((p/p1)31)(-16) assuming p is positive. 1 Simplify (j4/j(-1/4))/((j/(jjj(-2/7)j))/j)(-30) assuming j is positive. j(-2161/28) Simplify (x*(-3/14)xx(3/4))(-3/4) assuming x is positive. x(-129/112) Simplify ((iii(-4)ii)/(ii(-1/2)))15 assuming i is positive. i*(-15/2) Simplify (zz/(zz/(zz*(-2/3)zz)))(-7/4) assuming z is positive. z(-49/12) Simplify (v(-8/9))(-9) assuming v is positive. v8 Simplify (hh(2/9))(-2/21)h(-7)/((hhhh*(6/7))/hhh) assuming h is positive. h(-2263/189) Simplify (c3)10 assuming c is positive. c30 Simplify (x(3/2)/(x(2/9)x))/(x*(-4/7)x(6/5)) assuming x is positive. x(-221/630) Simplify (m(1/58))(-13) assuming m is positive. m(-13/58) Simplify (b/(b/(b(6/7)b)))(-24/11) assuming b is positive. b(-312/77) Simplify ((h(h(-6)/h)/h)32)(-38) assuming h is positive. h8512 Simplify ss/s(-28)s/(ss/(sss(-1/42)s)) assuming s is positive. s(1343/42) Simplify ((o(-2/3)o)/(o(oo12)/oo))43 assuming o is positive. o(-1763/3) Simplify h(-3/10)/h(-18) assuming h is positive. h(177/10) Simplify (v(-1)/(v(v/((vv/v*(-3/5)v)/v))/v))/(v/v*(-1/3)v/((v*(-4/7)/v)/vv)) assuming v is positive. v*(-347/105) Simplify ((dd(-7))(12/7))(-4) assuming d is positive. d(288/7) Simplify q*(-2/5)qq(-8/3) assuming q is positive. q(-31/15) Simplify ((q/(q/(q(-8)q)))/(q/q9))(36/5) assuming q is positive. q*(36/5) Simplify ((qq(-2/5))(-24))(-15) assuming q is positive. q216 Simplify (u(u/u(-8)u)/uu)/(uu(uu(uu*19)/u)/uu) assuming u is positive. u(-12) Simplify (c/(c/c6))/(((c/(c/(cc(2/3)cc)))/c)/cc)(c(-2/11)c)/(ccc(-6)) assuming c is positive. c(269/33) Simplify (a(4/19)/a)/(a(-31)/a) assuming a is positive. a*(593/19) Simplify ((fff/(f/f(-4/5)))/ff1/f)(-35) assuming f is positive. f*(-7) Simplify (mm*(-3/5)mm(2/3))(-1/6) assuming m is positive. m(-31/90) Simplify i(-5)/iii/(((ii*(-2/5))/i)/i)(i/i*(6/7))/(i(ii/i(-2/5)i)/i) assuming i is positive. i*(-41/7) Simplify (c(c/(cc(2/15))c)/cc(-3/7))/(c0)21 assuming c is positive. c(46/105) Simplify (k/(kkkk*0))/kkk(-1/64) assuming k is positive. k(-129/64) Simplify ((p(-6)/p)/(p(1/3)p))(-2/97) assuming p is positive. p(50/291) Simplify (d/((d/(d/(ddd/(d/d0))))/d))/d7dd*1/dd(-7) assuming d is positive. d(-13) Simplify (vv0)(-2/9)/(v(-2))20 assuming v is positive. v(358/9) Simplify ii*2i25 assuming i is positive. i28 Simplify ss/(s(-32)s)s(18/5)s assuming s is positive. s(188/5) Simplify c/c(-21)cc(-13) assuming c is positive. c10 Simplify (kkk*(-8)k/(kk5kk))21 assuming k is positive. k(-273) Simplify ((((k(-2/13)/k)/k)/k)/kk)28 assuming k is positive. k(-1148/13) Simplify (z(-1))26z(-5)/(z(-3/8)/z) assuming z is positive. z(-237/8) Simplify p(1/2)/(pp*(1/2))((p/(p/p*(-7)))/p)/pp*(6/7)p assuming p is positive. p(-57/7) Simplify (g(-2/3)g)43((gg(-2))/g)/g(3/7) assuming g is positive. g(250/21) Simplify (s(-9)/s)(3/5) assuming s is positive. s(-6) Simplify ((vv*(-5))/(vvv((vv(2/17))/v)/vv))/((v*(-7)v)/(v/(v/v(-1/4)))) assuming v is positive. v(-93/68) Simplify (((f/(ff(-2/7)f))/f)(-13))24 assuming f is positive. f(3744/7) Simplify (o(-1)o)(-2/45)o/o*(2/17)o*(-7)o assuming o is positive. o(-87/17) Simplify (j(-1/3)j)/j(-2/7) assuming j is positive. j(20/21) Simplify (r/r3)(-44)/((rr/((rr(-3/11)/r)/r))/(((r(r/((r/(r*6r))/rrr))/r)/r)/r)) assuming r is positive. r(976/11) Simplify ((z0/z)/z)*(-2/59)/(zz*2z)(4/13) assuming z is positive. z(-892/767) Simplify (z/(zz4z))(-36/7) assuming z is positive. z(180/7) Simplify ((p/(ppp/(pp/(ppp(-3)/pppp))))/p)/(pp/p(1/2))(p3/p)/(p(-6)/p) assuming p is positive. p*(11/2) Simplify ((i/(ii/i*(-3)))/((i(i(i(-7)i)/iii)/iii)/ii))/((ii*8/i)/((ii(2/17)/i)/i)) assuming i is positive. i(-185/17) Simplify ((l/(lll/(((l/(l/l*(-1)))/l)/l)l))(1/7))(-1/25) assuming l is positive. l(6/175) Simplify (h0)*(1/57)hh/h(-2/7)(h/((h*(-5)/h)/hh))/h assuming h is positive. h(58/7) Simplify (o(-3))(-39) assuming o is positive. o117 Simplify (x(x/x(-1))/x)4/(x1)(-1/9) assuming x is positive. x(73/9) Simplify ((f/(f(-4)/f))35)(-8) assuming f is positive. f(-1680) Simplify ww*(9/4)www((www(6/19))/w)/ww assuming w is positive. w*(575/76) Simplify y/(yy*(-3/8))y16/y assuming y is positive. y(123/8) Simplify q/q*(-23)q(3/14) assuming q is positive. q(339/14) Simplify ((j/(j/((j*4/jj)/jj)))/jjjj(-1/9))/(j(2/7)jj(j(1/4)j)/jj) assuming j is positive. j(341/252) Simplify ((p/p3)/((pp*(4/5))/ppp))/(p(-1/3))(1/7) assuming p is positive. p(-499/105) Simplify (vv/(v/(v/v(1/5))))(-20) assuming v is positive. v(-36) Simplify ((h(3/4)/hh)/h((h/(h(-2)/h))/h)/h)(-37) assuming h is positive. h*(-259/4) Simplify ((kk(kk/(k/k*(-3)))/kk)(-3/14))(20/3) assuming k is positive. 1 Simplify ((ww/w(1/2)w)(-20))(-6/11) assuming w is positive. w(300/11) Simplify r8r/r(-17/5) assuming r is positive. r(62/5) Simplify ((l(2/3))8)31 assuming l is positive. l(496/3) Simplify (bb(-1))/b(-2/87) assuming b is positive. b*(2/87) Simplify (yy*(-5/2)y/y*13y)(4/17) assuming y is positive. y(	{ "pile_set_name": "DM Mathematics" }
= 13 - 4. Let k = b - 8.2. What is k rounded to the nearest integer? 1 Let i = -1085572.91966 + 1076641.82. Let z = i - -8929.6. Let n = z + 1.5. What is n rounded to four decimal places? 0.0003 Let f = 79 - 79.0000006. What is f rounded to seven dps? -0.0000006 Let l = 82273.2118 + -82285. Let u = -0.074 + 11.874. Let p = u + l. What is p rounded to 3 dps? 0.012 Let o = -0.01161 + 0.012. What is o rounded to four decimal places? 0.0004 Let v(c) = 17c2 - 87c*2 - 2c*2 - 4 + 11c. Let n be v(-8). Round n to the nearest one thousand. -5000 Suppose 0 = -g - 4q - 1, -3g + 13 = -2g - 3q. Let l = g + -3. Suppose -5 + 51 = -lt + 3m, 3m + 6 = 0. What is t rounded to the nearest 10? -10 Suppose 0j - 4j = 2b - 293144, 0 = b. Suppose -j = 4n + 98714. What is n rounded to the nearest 10000? -40000 Suppose -13902 = -5j + 2q, 5j - 5q - 2046 = 11859. What is j rounded to the nearest 1000? 3000 Let a = -27.97 - -28. Round a to one decimal place. 0 Let q = 24.32 + -25. Let h = q + 0.08. Let a = h - -0.12. What is a rounded to 1 dp? -0.5 Let h = 8.21 + -0.21. Let z = -8.016 + h. What is z rounded to three dps? -0.016 Let d = -46.983 - 0.017. Let f = -53.7 - d. What is f rounded to the nearest integer? -7 Let n(p) = 160p. Let u be n(-10). What is u rounded to the nearest 100? -1600 Let n(p) = -3p + 2p + 2p. Let y be n(4). Suppose -3 - 277 = yu. Round u to the nearest 10. -70 Let b = -0.09 - -0.090064. What is b rounded to 5 decimal places? 0.00006 Let v = -0.1 - -0.12. Let h = 1.586 + -1.6. Let n = v + h. What is n rounded to 3 decimal places? 0.006 Let y = 30.328 + -30. Let s = 0.082 + y. What is s rounded to 1 dp? 0.4 Let q = 6 - 1. Suppose qj - 51999988 = -4u, 0 = -j + 2j - 5u - 10400015. Suppose 0 = 3g - 4g - j. Round g to the nearest 1000000. -10000000 Suppose 0i = -2i - 8. Let w be -2 + (i/(-2))/(-1). Let r be w/(-2) - (-380002)/(-1). Round r to the nearest 100000. -400000 Suppose -4v - m + 7892 = 2m, 5890 = 3v - 5m. Round v to the nearest 100. 2000 Suppose -t - 70804 = -1950789. Suppose 4y - 2i = -7520010, -y + i - t = 4i. What is y rounded to the nearest 100000? -1900000 Let q = 1.098 + -0.719. Round q to one dp. 0.4 Suppose 0 = 3q + 36 - 210. Let p be (-1086207)/((-3)/q - 0). Suppose 0 = -u + 4r + 4200004, -p = -5u + 3r - r. What is u rounded to the nearest one million? 4000000 Let o = 1512740 - 1513164.10016. Let i = o - -424. Let d = -0.1 - i. What is d rounded to 4 dps? 0.0002 Suppose -2b + k = -16, b = 4b + k - 34. Let p(h) = -10h3 - h2 - h + 10. Let f be p(b). Round f to the nearest 1000. -10000 Let m = 712 + -712.00000291. What is m rounded to seven decimal places? -0.0000029 Let u = -20358796 + 2932513. Let m = 9426283 + u. What is m rounded to the nearest 1000000? -8000000 Let w = 38.537 - 38.7. Let g = w - -14.763. Let f = g - 14.600087. Round f to 5 decimal places. -0.00009 Let l = -2.05 - -0.05. Let n = 0.127 - 2.367. Let g = n - l. What is g rounded to 1 dp? -0.2 Let v = 81 - -49. Let d = -129.842 + v. What is d rounded to two decimal places? 0.16 Let a be 1-335/5. What is a rounded to the nearest 10? -30 Let w = 26.02 - 26. Round w to 1 decimal place. 0 Let u = -5 - -8. Suppose -4 = -4z - 4h, -uh - 19 = 2z - 8h. Let l be (-171999)/(-2) - 1/z. What is l rounded to the nearest 10000? 90000 Let a = -23 - -48. Let k = a - 24.9999978. Round k to 6 dps. 0.000002 Suppose 3m + 9016862 = 3h - 1783132, 3h - 10799998 = m. What is h rounded to the nearest one million? 4000000 Let t be ((-117)/(-4))/(54/144). What is t rounded to the nearest ten? 80 Let m = 0.028 - -0.692. Round m to one decimal place. 0.7 Let v = 99136 - 55337. Suppose -4s - v + 13799 = 0. What is s rounded to the nearest one thousand? -8000 Let t = -1.55 - -1.3. Let u = t - -1.04. What is u rounded to one decimal place? 0.8 Let j = -37.1 - -7.1. Let x = -27286.84 - -27256.83922. Let k = x - j. Round k to four dps. -0.0008 Let l = -103856.95039 + 103856. Let u = l + 0.95. Round u to 4 dps. -0.0004 Suppose -188491 = -5k - 3j, j - 37694 = -k - j. Round k to the nearest one thousand. 38000 Let x = 12.11 - 0.11. Let w = x - 12.000014. Round w to 5 dps. -0.00001 Suppose 3d - d = 0, 0 = 5u - 5d + 20000. Let a = 46000 - u. Suppose 6v - v = -a. Round v to the nearest 1000. -10000 Let a = 6.1031 - 6.1. Round a to 3 decimal places. 0.003 Let l(w) = 286w2 + w - 3. Let r be l(-4). Let n = r + -1376. Let a = -13393 + n. What is a rounded to the nearest 1000? -10000 Let o = 898 + -897.999998634. What is o rounded to 7 dps? 0.0000014 Let f = -14 - -13.875. What is f rounded to two decimal places? -0.13 Let r = 2.2 + -2.2000069. What is r rounded to 6 decimal places? -0.000007 Let a = -0.068 + -0.592. Let q = a + -0.08. What is q rounded to 1 dp? -0.7 Let v(u) = u3 + 9u2 + 7u. Let c be v(-6). Suppose -4s - c = 2w, 2w + s + s + 72 = 0. Let n be 4/(24/w)-6. What is n rounded to the nearest ten? 40 Suppose 4s - 2h = -4h - 12, 5h = -5s - 20. Let p be -2 + 2 + (s - 1465). Let d = p + 2127. Round d to the nearest one hundred. 700 Let g = 4893995.544209989823 - -12.455789370177. Let i = g + -4894002. Let l = i - 6. What is l rounded to seven decimal places? -0.0000006 Let h = 1.02637 + -43.01717. Let a = 42.09 - 0.09. Let z = a + h. What is z rounded to 3 decimal places? 0.009 Let x be ((-40)/(-3))/((-3)/(-20025)). What is x rounded to the nearest 10000? 90000 Let y = 13.11 - 13.1098762. Round y to five dps. 0.00012 Let g = 2 - -5.8. Let m = -7.8053 + g. What is m rounded to three decimal places? -0.005 Suppose -2m = -4m + 2680000. Round m to the nearest one hundred thousand. 1300000 Let t = -20480.0003 - -20479. Let j = 3 - 4. Let h = t - j. Round h to four dps. -0.0003 Let h = 538.4 - 498. What is h rounded to 0 dps? 40 Let n(h) = 3h*3 - 6h - 4. Let m(f) = -f3 - f2 - f. Let b(p) = -2m(p) - n(p). Let d be b(-8). What is d rounded to the nearest one hundred? 600 Let m(v) = -9757v + 42. Let p be m(6). What is p rounded to the nearest 10000? -60000 Let c = -4.36 - 0.44. Let q = 5.29 + c. Let i = 0.4861 - q. Round i to 3 dps. -0.004 Let p = 0.8 + 3.2. Let j = p + -3. Let t = 0.992 - j. Round t to two dps. -0.01 Let c = -152 + 368. Let h = -215.99913 + c. What is h rounded to four decimal places? 0.0009 Let y = 98.4 + 13.6. Let m = y + -112.000063. What is m rounded to 5 decimal places? -0.00006 Let s = -9.984 + 10. Round s to two decimal places. 0.02 Let v = 4 + -9. Let i = v + 5.0000007. What is i rounded to seven dps? 0.0000007 Let w = 268.0001015 + -268. What is w rounded to 5 decimal places? 0.0001 Suppose 489 = 5q - 2q. Let o = -217 - q. What is o rounded to the nearest one hundred? -400 Suppose -5z + 0 - 5 = 0, 0 = -3l - z + 5. Suppose 0 = lc + c + 1140000. What is c rounded to the nearest one hundred thousand? -400000 Let c = -99.34 - -79. Let t = c - -21. Round t to one decimal place. 0.7 Let h = 0.45 - 0.4442. Round h to three dps. 0.006 Let a = -13.39999953 + 13.4. What is a rounded to seven decimal places? 0.0000005 Let l(x) = -115x + 2. Let r(s) = 345s - 6. Let q(y) = 8l(y) + 3r(y). Let k be q(-4). Let w = -268 + k. Round w to the nearest 100. -700 Let h = -51 + 75. Let z = h - 24.38. What is z rounded to 1 dp? -0.4 Let h = -4 - -4.0009. What is h rounded to three decimal places? 0.001 Let m = -34.00038 - -34. What is m rounded to 4 decimal places? -0.0004 Let f(i) = -i2 - 207406i*3 - 250i + 6i2 + 252i - 1. Let q be f(-3). Round q to the nearest 1000000. 6000000 Suppose -3702 = -5i - 2w + 1450, 2062 = 2i + 2w. What is i rounded to the nearest one hundred? 1000 Let y = -0.01 - 0.05. What is y rounded to 1 decimal place? -0.1 Let y = -148.00237 - -148. What is y rounded to four decimal places? -0.0024 Let j = 0.64 + -0.64245. What is j rounded to 4 decimal places? -0.0025 Let y = 20 + -20.04. Let w = y - -0.04052. Round w to 4 decimal places. 0.0005 Suppose -3n + 2f - 150004 = 0, -100004 = n + n - 2*f. Round n to the nearest 10000. -50000 Let t = 237 + -236.223. Let g = t - 0.087. What is g rounded to one dp? 0.7 Let h = -4 - -4.03. Let w = h + 0.27. Let j = 0.299992 - w. Round j to five dps. -0.00001 Let n = 1 - 0.97. Let d = -2.17 - n. Let z = 2.2000009 + d. Round z to seve	{ "pile_set_name": "DM Mathematics" }
7b + 22. Solve 13p - 8p + 25 = q, -p - 14 = -bq for p. -4 Let l(y) = 763y - 7621. Let a be l(10). Solve -9 = 3c - 6, a = z - 5c for z. 4 Let x be (7/(-3))/((-2)/24). Let u be 0/2 + (5 - 9)-1. Solve -3m - x = -uw, 3m - m = w - 12 for w. 4 Suppose 4n - 24 = -c - 3c, -5n = 2c - 15. Let d(h) = h2 - 14h + 16. Let v be d(c). Let s = 35 + v. Solve -2o + 14 = -5r, 3o = -0 + s for r. -2 Suppose 37l - 4 = -5o + 36l, -5o + l + 16 = 0. Solve -2m - 2 = t + 5, ot + 9 = m for m. -1 Suppose 6 = f - 7. Suppose 19540 = 68j + 19268. Solve -5 = -3y - jm, 3y - 4m = -0 + f for y. 3 Let l(z) = -z*2 + 85z - 746. Let w be l(10). Solve wh + 24 = 4c, 34c - 6 = 31c for h. -4 Let s(o) = -254o2. Let h be s(0). Solve hz + z - 21 = -5q, q = 5 for z. -4 Suppose -6 = -r, r + 29 = 11x - 6x. Solve -v + 2p = 1, -v + xp + 5 = 2p for v. -5 Let h be 1/(0 - (-3)/(-21))(-333 - -331). Solve 3q = -s + h + 5, -6s = 2q - 34 for s. 4 Let z(f) = 39f + 979. Let d be z(-25). Solve -11t + 13t = -4l, -3l + 5 = dt for t. 2 Suppose -10 = 5i + 3t, 2i - 3t + 5t = -4. Let h be (-282)/(-36) - i/12. Suppose -y + 3y = -h, -2v = 2y. Solve -vs - 5b - 16 = -s, 0 = 3b + 15 for s. 3 Let t = 70 + -116. Let y = 52 + t. Let z = 13 - 11. Solve -2a - 5d - 6 = 0, 6d = 2a + zd + y for a. -3 Suppose -16u - 79 = -335. Let q be (u/(-10))/((-52)/65). Solve 2n + 15 = 3n - 5f, -qf = 6 for n. 0 Let h be 708/72 + (-10)/(-60). Solve -3i - 12 = -3b, 3b = -0i + i + h for b. 3 Suppose 40h - 371 = -171. Solve 4x = 3z + 1 + 8, -15 = -5x + hz for x. 0 Suppose 0 = -2p + 7p + 15, 0 = -3y + 5p + 51. Let z(u) = -u + 14. Let d be z(y). Let q be 0(-1 - (0 + 0)). Solve q = -m + dm - 3f + 9, 2m = f - 8 for m. -3 Suppose -472 = -2h - 3d - 134, 4h - 5d - 676 = 0. Solve 0 = -ho + 165o + 3r - 15, -3r + 15 = o for o. 0 Let b(j) = j*2 + 5j + 4. Let t be b(-5). Suppose 2132 = -6s - 202. Let u = s - -394. Solve 2n - 4a - 26 = 0, 22 = -5n + tn - ua for n. 3 Suppose -9823 = -12w - 9799. Solve -2i - 2m + 2 = -16, m = wi - 3 for i. 4 Suppose 198s + 182 = 182. Solve s = 3j + 2y + 8, -75y + 12 = -4j - 78y for j. 0 Suppose 0 = -5y - 4 - 1. Let f = 480 + -485. Let n = y - f. Solve -3c - 3p + 9 = 0, -5c - 13 = 2p - np for c. -1 Suppose 61 = 3k - 2u, 1916k - 1921k = -2u - 91. Solve 5v = k, 0 = -2c - 4v + 82 - 60 for c. 5 Let j = -11954 - -11958. Solve -jd - 2v = 28, 2v + 3 = -11d + 12d for d. -5 Suppose 117x + 6x = 288 + 204. Solve -3z = -4b + x, 0 = b - 2z + 100 - 106 for b. -2 Let z be 56/20 + 11 - (8/20)/(-2). Solve -19t + zt - b = -2, 0 = -2t - 5b + 10 for t. 0 Suppose -5031x = -5007x. Solve -2k - 18i + 19i = x, k + i + 6 = 0 for k. -2 Let z = 46 + -44. Suppose w + 6y - 58 = -4w, 3w - y = 21. Suppose 0 = -r - 2r + 6, 3f + 2r = 61. Solve 3j = -zc + f, -3c + wc - 3j = 16 for c. 5 Suppose 7i - 14 = -203. Let h be 2/(-6) + -1 + (-144)/i. Solve -2m + 16 = -hq, 4q - 5m + 30 - 2 = 0 for q. -2 Let t be -4 - 1692/(-2 + 8). Let c = t - -288. Solve -2o - n = 3 + 2, 0 = co + 2n for o. -5 Let d(i) = i*2 - 5i - 20. Let h be d(9). Let l = h + -9. Let k(u) = u*3 - 7u*2 - u + 7. Let a be k(l). Solve 5f - r = a, 5f - r + 5 = r for f. 1 Let i be -36(-2 + 16/12). Suppose 108 = 4d + 2q, 4d - 5q = 56 + i. Suppose 21 - d = -c. Solve -8 = -z + 4g + g, z + cg + 1 = 0 for z. 3 Suppose 4v - 2 - 2 = -h, 5h - v - 20 = 0. Suppose 0 = 142t - 2396 + 1686. Solve 0 = -tz - 20, -hw + 12 = -0w + z for w. 4 Let o be 2(-15)/(-18)-3. Let p be ((-45)/75)/(3/o). Solve g = -0g - 5, 2j + g + p = 0 for j. 2 Suppose 0 = -94w + 3546 + 8862. Solve 5t - 139 = -3p - w, 3t + 3p = 9 for t. -1 Let r = -33 - -36. Suppose -3m = b, -rm - 8 = -b - 2. Suppose y = -4x + 7, 2y = bx + x + 2. Solve -1 + y = a - s, -5a + 22 = s for a. 4 Let a be 12/(-18) - 4/(-6)10. Suppose at - 10 = t. Suppose 3d = d. Solve -4x - tk = 6, -2x + dk - 5 = -k for x. -2 Let s be 3/9 - -80(-3)/(-9). Let l(k) = 3k - 77. Let x be l(s). Suppose -g = -2f + 2, 27 = 3g + f + xf. Solve 5t - 4 = -0z - gz, 3t - 4z = 28 for t. 4 Let c be (-5270)/(-150) + (-6)/45. Let i = 83 + -46. Let h = i - c. Solve ho - 13 = -3u, u - 5o = -u - 4 for u. 3 Let y = 1374 + -650. Let j = y - 721. Solve 4b = 5p - 8, 3p = 2p - jb + 13 for p. 4 Suppose -5k = c + 17, 2c + 3c - 2k = 23. Solve -l + j - c = 0, -4j - j - 6 = 2l for l. -3 Let w be (45/(-18))/((-30)/24). Let p be w/((-14)/(-105) - (-16)/30). Suppose -5y + 0y + 10 = 0. Solve -u = -s - 6, -s = -pu + y + 6 for u. 1 Suppose 83l - 1467 + 728 = 755. Solve -n - 13 = 5y, 17n - 7 = 2y + ln for y. -2 Suppose 71 + 105 = -4f. Let a be 2244/(-30) - 2/10. Let j = f - a. Solve 0 = 5k - w + 9 + 16, -3w = -4k - j for k. -4 Suppose n = 2n. Let m(x) = 2459x + 9839. Let d be m(-4). Solve 6 = -dj, n = 4f + j - 6 - 4 for f. 3 Let f = 7385 - 7381. Solve 0 = -5p + fw - 4, -3p + 6p + 8 = w for p. -4 Let p be ((-1)/(121/(-88) + 1))/((-2)/(-3)). Solve 5o = 3y - 11, -py + 0 = -4o - 4 for y. -3 Suppose 0j = 5j + 2s - 62, -3s + 3 = 0. Let w = 47 + -44. Solve -5x = 3f + 28, wf = 3x - 0x + j for f. -1 Suppose -3r - 28 = -7t, -r = -t - 5 + 5. Let u be 4/(-6) + 16/6. Solve -1 = l - 4c + t, -4l - uc = -22 for l. 4 Let j(q) = -2q3 - 36q*2 - 89q + 22. Let t be j(-15). Solve -5s + 3h = t, -4h + 5 = -4s - h for s. -2 Let d be (4/10)/((-3)/(-15)). Suppose y - 2 + 7 = 2x, -3x - dy = -11. Solve 0 = -2b - 3 - 5, 5b + 23 = -xf for f. -1 Suppose 3w = -4h - 251, 2w - 3h = 4w + 167. Let a be w/(-25) + (-9)/(-15). Suppose -a = 3l - 13. Solve -3b - 12 = -lx, -x + 3x = -2b + 4 for x. 3 Let r = -1991 - -1994. Solve 5v - 20 = -5i, 2i - ri - 2 = -v for i. 1 Let s be (10/50 - (-42)/(-10)) + -37. Let c = 41 + s. Solve 5x - 2a + 3a + 25 = c, x = a + 1 for x. -4 Suppose 14 = -2h - 5b, -19h + 5b = -23h - 8. Solve y + y + 2d - 2 = 0, h = 3d for y. 0 Let t(q) be the second derivative of -q*3/3 + 9q*2/2 + 14q. Let a be t(3). Let w be (7 - a) + 0/8. Solve -z = -g + wg - 14, 4g - 37 = -5z for z. 5 Suppose 5w = -2q + 1338 + 1477, 2249 = 4w + q. Suppose 51j - 84j = -w. Solve y = n - 4y - 13, 3y + j = -4n for n. -2 Let u be 8/40(31 - (-8)/(-2) - 2). Solve 0 = r - 5g + 1 - 25, -3r = ug + 28 for r. -1 Let b = 11022 - 11014. Solve 5k - 35 = 5j, 4j + 7k = bk - 19 for j. -4 Suppose -129 = 4y - 5. Let o = 32 + y. Solve -o = 2j + c, -j = -5j - c + 3 for j. 2 Suppose -2k - h + 372 = 0, k = -11h + 7h + 193. Suppose 26a = -11a + k. Solve g + 0g + 2 = w, 0 = -aw - 4g + 28 for w. 4 Let r be 19/(-2)(-8 - 2). Suppose 0 = -91f + rf - 16. Solve fa - 16 = l, 4a + 2l - 7 - 9 = 0 for a. 4 Let d(y) = y2 - 17y - 107. Let l be d(22). Solve -4k + 5t + 11 = 0, -5t + 17 = -0k + lk for k. 4 Suppose -2p - 12 = -3l, -628p + 630p + 3l = 24. Solve -6 = pi - 3g, 10i - 3g = 5i - 4 for i. 1 Let m = 6 - 2. Suppose 6t - 262 = -256. Let a be (-6)/t - 4/(-8)18. Solve -13 = 4k - as, -k + 4 = ms - 7 for k. -1 Suppose -12w = -15w + 15. Suppose -j + 4y + 88 = -3j, -wy = -2j - 61. Let u = 42 + j. Solve 0 = -5d + 2a + 10, -a = 5d - ua - 15 for d. 0 Suppose 41 - 110 - 129 = -99p. Solve -4x = -5x - 2w - 3, -18 = -px + 4w for x. 3 Suppose 34r - 471 = -369. Solve -5p + 68 - 23 = 5o, -ro = 4p - 31 for p. 4 Let h be ((-288)/(-162))/((-4)/(-18)) - 8. Solve 3w + 5j + 16 = h, 0 = w - 7j + 2j - 28 for w. 3 Let x(z) = -10z - 84. Let o be x(-8). Let h be (o - -2) + -6 - -23. Solve 2n - 5i = -1 - h, 5n = -5i - 5 for n. -3 Let g = 27819 + -27815. Solve 0 = gk - 3i - 9, 5k - 23 = 2k - i for k. 6 Let s(f) = 537f - 1609. Let m be s(3). Solve -4u = 5z + 2, -mz + 12u - 13u = -1 for z. 2 Let a = -92 - -188. Let k = a + -92. Suppose -3v = 4j + v + 4, kj = v + 21. Solve -3z + 9 = ji, z = -i - 2z + 9 for i. 0 Suppose 0 = -4h - 2m, 3h - 18 = 2m + m. Solve ho + 10 = -3w, 2w - 7o = -5o for w. -2 Let s = -8307 + 8308. Solve 3c + s = 3v - 5, -5c - 5v + 20 = 0 for c. 1 Let r = 4717 - 4712. Solve -4w - 10 = -ro - 6w, -o - 10 = -2w for o. 0 Suppose 104w - 14w - 540 = 0. Solve 7 = -5z + 2o, -wz +	{ "pile_set_name": "DM Mathematics" }
hat is 25/8 of a kilogram in grams? 3125 How many microseconds are there in 0.4606427 milliseconds? 460.6427 How many micrograms are there in 99468.34 grams? 99468340000 How many decades are there in seven halves of a millennium? 350 How many minutes are there in 4/3 of a hour? 80 What is twenty-seven halves of a milligram in micrograms? 13500 What is 1850.99796 milliseconds in weeks? 0.0000030605125 What is 51/5 of a micrometer in nanometers? 10200 What is 75/8 of a kilometer in meters? 9375 How many micrometers are there in sixty-seven fifths of a millimeter? 13400 How many nanograms are there in 975.1455t? 975145500000000000 Convert 59.2707969 minutes to weeks. 0.005880039375 How many millimeters are there in 3/8 of a meter? 375 What is 5763.896g in nanograms? 5763896000000 Convert 0.7850986um to kilometers. 0.0000000007850986 How many centuries are there in 252787.1 millennia? 2527871 Convert 420.2554 days to nanoseconds. 36310066560000000 What is 1/24 of a week in hours? 7 How many years are there in 49/4 of a century? 1225 Convert 0.6165058ml to litres. 0.0006165058 What is 3/8 of a litre in millilitres? 375 How many months are there in 6.95186 millennia? 83422.32 What is 7078.805kg in milligrams? 7078805000 What is 185063.2ml in litres? 185.0632 What is 0.2096761ng in kilograms? 0.0000000000002096761 What is 0.467095 decades in centuries? 0.0467095 What is fifty-one fifths of a gram in milligrams? 10200 What is 0.025559 days in nanoseconds? 2208297600000 How many centimeters are there in six fifths of a meter? 120 What is five sixths of a century in months? 1000 Convert 142279.2 minutes to nanoseconds. 8536752000000000 How many millilitres are there in seven quarters of a litre? 1750 How many kilometers are there in 5224.634 nanometers? 0.000000005224634 What is 37.03498 millilitres in litres? 0.03703498 What is 0.5034439t in milligrams? 503443900 What is three fifths of a millimeter in micrometers? 600 What is 75/4 of a tonne in kilograms? 18750 What is 27/4 of a kilogram in grams? 6750 How many millilitres are there in one quarter of a litre? 250 What is 3/5 of a meter in millimeters? 600 How many centimeters are there in 1/20 of a meter? 5 What is 3/8 of a litre in millilitres? 375 What is 65/3 of a year in months? 260 What is 18629.62 centimeters in millimeters? 186296.2 How many millilitres are there in 23/8 of a litre? 2875 How many millimeters are there in 80016.38nm? 0.08001638 What is seventy-two sevenths of a week in hours? 1728 Convert 29.4962nm to micrometers. 0.0294962 What is one fifth of a micrometer in nanometers? 200 How many millilitres are there in 12017.56 litres? 12017560 Convert 0.6132779 years to millennia. 0.0006132779 How many seconds are there in 7/4 of a hour? 6300 What is 24715.077 minutes in hours? 411.91795 What is 1/5 of a centimeter in millimeters? 2 How many decades are there in thirty-three fifths of a century? 66 How many millilitres are there in 6/25 of a litre? 240 What is thirty-four fifths of a centimeter in micrometers? 68000 Convert 0.0059626 hours to microseconds. 21465360 What is 1768.781 microseconds in seconds? 0.001768781 How many years are there in five quarters of a millennium? 1250 How many litres are there in 0.1864185ml? 0.0001864185 What is 85805.12 micrograms in nanograms? 85805120 What is 350.3438cm in kilometers? 0.003503438 How many centuries are there in 72/5 of a millennium? 144 Convert 2.381265 nanometers to millimeters. 0.000002381265 What is 116891.7 decades in millennia? 1168.917 How many millilitres are there in twenty-seven quarters of a litre? 6750 What is 793.8207 nanograms in micrograms? 0.7938207 What is four fifteenths of a day in seconds? 23040 How many millilitres are there in one tenth of a litre? 100 What is 20.2375l in millilitres? 20237.5 Convert 2552690.1 months to years. 212724.175 How many months are there in five sixths of a year? 10 How many micrometers are there in seventeen quarters of a centimeter? 42500 What is 21/5 of a milligram in micrograms? 4200 How many nanometers are there in 7577.366 meters? 7577366000000 How many millilitres are there in five eighths of a litre? 625 How many millimeters are there in 77.80753um? 0.07780753 How many millennia are there in 6.896948 years? 0.006896948 Convert 83629.14ng to grams. 0.00008362914 How many micrograms are there in eleven tenths of a milligram? 1100 What is 95.45841 milliseconds in hours? 0.000026516225 What is 94409.16 nanoseconds in milliseconds? 0.09440916 Convert 12998246.31 microseconds to weeks. 0.000021491809375 What is 81/2 of a gram in milligrams? 40500 What is 9/10 of a litre in millilitres? 900 What is 344322.4 millennia in decades? 34432240 How many hours are there in 1563.7506 minutes? 26.06251 How many decades are there in 29/2 of a millennium? 1450 What is seven quarters of a litre in millilitres? 1750 Convert 445310.4t to micrograms. 445310400000000000 How many millilitres are there in 12/25 of a litre? 480 Convert 411.879 days to microseconds. 35586345600000 How many milligrams are there in 42/5 of a gram? 8400 What is seven quarters of a microgram in nanograms? 1750 What is 50188.9mg in nanograms? 50188900000 How many nanoseconds are there in 78.41674s? 78416740000 What is twenty-seven quarters of a kilogram in grams? 6750 What is 65464.03 hours in nanoseconds? 235670508000000000 Convert 50.3218 millennia to decades. 5032.18 What is three eighths of a day in minutes? 540 How many minutes are there in twenty-nine fifths of a hour? 348 How many minutes are there in seven thirds of a week? 23520 Convert 1691.265 centuries to millennia. 169.1265 How many milligrams are there in one tenth of a kilogram? 100000 What is 3/10 of a gram in milligrams? 300 How many kilograms are there in fourty-nine quarters of a tonne? 12250 What is 29/5 of a litre in millilitres? 5800 What is 2/7 of a week in days? 2 How many grams are there in 33745.8 kilograms? 33745800 What is one fifth of a day in minutes? 288 How many centimeters are there in 221260.5km? 22126050000 How many litres are there in 0.5366153 millilitres? 0.0005366153 How many months are there in 34444.35 centuries? 41333220 What is fifty-nine fifths of a millimeter in micrometers? 11800 Convert 545082.8 years to months. 6540993.6 What is thirteen fifths of a millennium in centuries? 26 What is 34/5 of a micrometer in nanometers? 6800 How many nanoseconds are there in 1/16 of a millisecond? 62500 What is 0.8376986cm in nanometers? 8376986 Convert 182.9316ml to litres. 0.1829316 How many millimeters are there in seven halves of a meter? 3500 How many minutes are there in twenty-nine halves of a hour? 870 How many months are there in one fifth of a decade? 24 What is 13/4 of a litre in millilitres? 3250 Convert 50412.9 months to years. 4201.075 What is twenty-five eighths of a litre in millilitres? 3125 Convert 2.469464 grams to tonnes. 0.000002469464 How many nanograms are there in 11/2 of a microgram? 5500 What is 8142.195ml in litres? 8.142195 How many decades are there in 21218.19 months? 176.81825 Convert 214.677 litres to millilitres. 214677 What is 51/4 of a litre in millilitres? 12750 How many hours are there in 17/4 of a week? 714 How many kilograms are there in 6.488103 nanograms? 0.000000000006488103 What is fifteen quarters of a week in hours? 630 What is 31/5 of a centimeter in micrometers? 62000 What is 1/10 of a millennium in decades? 10 What is nineteen quarters of a second in milliseconds? 4750 How many millimeters are there in fourty-three quarters of a meter? 10750 How many months are there in seventeen halves of a century? 10200 What is 0.114349 milligrams in grams? 0.000114349 How many kilograms are there in 13/5 of a tonne? 2600 What is 2/15 of a day in seconds? 11520 What is 574.5102l in millilitres? 574510.2 What is eleven tenths of a millennium in months? 13200 What is 225407.5 litres in millilitres? 225407500 What is 0.7582728 kilograms in micrograms? 758272800 What is 23/3 of a year in months? 92 Convert 92.4032um to millimeters. 0.0924032 How many seconds are there in 2.46015 minutes? 147.609 Convert 864.4871l to millilitres. 864487.1 What is twenty-seven fifths of a decade in months? 648 Convert 47741.36ml to litr	{ "pile_set_name": "DM Mathematics" }
? 24f4 Let n(l) = 14l*2 - 25l*2 + 9l*2. Let s(c) = -5c - 4. Let h be (1/(-3))/(2/(-6)). Let r(u) = u + 1. Let d(z) = hs(z) + 4r(z). Calculate n(d(f)). -2f2 Let c(t) be the second derivative of t4/12 + t2/2 + 5t. Let s(l) = -5. Let y(b) = -5c(b) - s(b). Let j(h) = 2h*2. What is y(j(w))? -20w*4 Let z(p) = -7p + 21p + 4p. Let m(r) = -2r. Calculate z(m(l)). -36l Let i(b) = -348b2. Let k(t) = t. What is i(k(v))? -348v*2 Let t(x) = 12x*2. Let p(g) = -402g*2. Give p(t(d)). -57888d4 Let a(q) = q2. Let t(n) be the third derivative of -n*5/24 + 5n*3/6 - 2n*2. Let p(g) be the first derivative of t(g). Calculate a(p(z)). 25z2 Let v(x) = x2. Let a(t) be the first derivative of t3/3 - 3. What is v(a(o))? o4 Let o(z) = -z. Suppose 5k = 14 + 1. Suppose 2p - 3h - 4 = -1, k = 3h. Let v(f) = 3f - pf + 4f. Calculate v(o(c)). -4c Let h(o) = 4o - 5o + o + 2o. Let s(c) = -2c + 6c2 + 2c. Calculate h(s(y)). 12y2 Let o(p) = -2p*2. Let c(b) = 5b + 39. Give c(o(z)). -10z2 + 39 Let i(x) = -4x - x + 4x. Let b(a) = 9a. Let s(p) = -5p. Let c(r) = 3b(r) + 5s(r). Calculate c(i(f)). -2f Let y(n) be the third derivative of -n5/120 + n3/6 + 3n2. Let i(j) be the first derivative of y(j). Let g(t) = t2. Calculate i(g(l)). -l2 Let f(p) = p2. Let m(d) = -8d - 4. Let y(q) = q + 1. Let v(j) = -m(j) - 4y(j). What is v(f(c))? 4c*2 Let k be (-8)/12 + (-8)/(-12). Let l(g) be the first derivative of kg + 2/3g3 + 1 + 0g*2. Let h(z) = 5z. Determine h(l(d)). 10d2 Let k(b) = -2b. Let g(t) = -6t2 - 2t - 3t2 + 2t. Give g(k(f)). -36f2 Let r(b) = 2b2. Let o(t) be the first derivative of t4/12 + 3t - 1. Let y(h) be the first derivative of o(h). Give r(y(q)). 2q*4 Let c(a) = 2a. Let h(b) = -144b2. Let y(r) = 13r*2. Let n(g) = 3h(g) + 32y(g). Determine n(c(x)). -64x*2 Let o(n) = -2n. Let q(r) = 546r. Calculate q(o(l)). -1092l Let t(l) be the third derivative of -l*4/12 + 17l*2. Let w(z) = -24z*2. Determine t(w(s)). 48s2 Let t(j) = -j2 + 56j. Let p(o) = o + 14. What is t(p(l))? -l2 + 28l + 588 Let g(o) = 2o - 2. Let l be g(2). Let r(y) = 0yl + y2 + y*2. Let a(w) = -2w. Determine r(a(c)). 8c2 Let q(o) = o2 - 66. Let v(h) = -24h. What is v(q(g))? -24g2 + 1584 Let u(z) = -8z. Let q(n) = 8n. Let g(i) = -5q(i) - 6u(i). Let w(t) = -2t*2. Determine g(w(y)). -16y*2 Let d(l) be the first derivative of 0l*2 + 1/3l*3 + 0l + 1. Let i(w) = 2w2. Determine d(i(r)). 4r*4 Let k(u) = -2u*2. Let h(t) = 514t - 2. What is k(h(f))? -528392f2 + 4112f - 8 Let p(y) = y*2. Let g(s) = -3s*2 + 10s*2 - 800 + 800. Give p(g(d)). 49d*4 Let i(a) = 530a. Let j(s) = 31s. Determine j(i(f)). 16430f Let u(r) = -3r - 4r - 3r - 10 - 4r. Let o(j) = -j - 1. Let g(v) = 10o(v) - u(v). Let z(k) = 2k*2. Determine z(g(w)). 32w*2 Let h(i) = 194i*2. Let r(d) = -2d*2. Determine h(r(u)). 776u*4 Let o(d) = -10d - 11. Let l(x) = -5x - 6. Let c(h) = 11l(h) - 6o(h). Let k(t) be the third derivative of -t4/12 - 3t*2. Calculate k(c(m)). -10m Let s(y) be the third derivative of 0 - 3y2 + 0y + 0y3 - 1/24y*4. Let j(n) = -n. What is j(s(p))? p Let w(v) = 2v. Let l(p) = -1. Let b(f) = 8f2 + 20. Let z(r) = -4b(r) - 80l(r). Calculate z(w(m)). -128m*2 Let p(t) = -t. Suppose 3b + 2o = -5 + 6, -4b + 3o + 24 = 0. Let x(c) be the second derivative of 0 + 0c*b + 1/6c*4 + 2c + 0c2. Determine p(x(d)). -2d*2 Let a(k) = 2k. Let t(p) = p*3 + 4p*2 - 8p - 5. Let o be t(-5). Let s be (-24)/(-10) + (-4)/o. Let i(v) = sv + 2v - 2v. Determine i(a(j)). 4j Let b(u) = u*2 - u. Let y(s) = -4s*2 + 6s. Let d(x) = -6b(x) - y(x). Let k(p) be the first derivative of p2/2 - 9. What is d(k(j))? -2j*2 Let n(b) be the second derivative of -4b*4/3 - 7b. Let k(m) = m*2. Determine k(n(c)). 256c*4 Let z(p) = -210p. Let y(t) = 4t. Calculate z(y(n)). -840n Let g(v) = v. Suppose 6 = -2q - z, -5q = 3z - 6z + 15. Let m(r) = -r. Let d(w) = qg(w) - m(w). Let y(l) = -l2. Calculate d(y(n)). 2n*2 Let t be -5(0 + 4/(-10)). Let c = 2 - 0. Let g(y) = -3y2 + 0y*c + 5y*t. Let s(n) = 2n. What is g(s(m))? 8m2 Suppose -6z + 2z = -16. Let h(s) = 5s - zs + 0s. Let t(b) = -5b2 + 6b*2 + 2b*2. Calculate t(h(o)). 3o*2 Let y(n) = 3n*2. Let o = 16 - 8. Suppose 0 = 3c + c - o. Let a(t) = -4 + ct + 4 + 0. What is a(y(b))? 6b*2 Let x(w) = -6w*2. Let i(t) = -131t*2. Give i(x(m)). -4716m*4 Let p(m) = -30m. Let s(i) be the second derivative of i*3/3 - 26i. Determine s(p(h)). -60h Suppose q = -3q. Let b(p) be the third derivative of 0p4 + qp*3 + 1/20p*5 + 0p + 2p2 + 0. Let d(u) = -2u. Determine b(d(j)). 12j2 Let o(y) = y2 - 17. Let g(x) = -18x. Determine o(g(u)). 324u2 - 17 Let z(l) = -l. Let y(b) = 15b. Let u(g) = -4y(g) - 84z(g). Let q(m) = m*2. Give u(q(p)). 24p*2 Let d(c) = -782c*2. Let z(s) = -s. What is z(d(k))? 782k*2 Suppose 3w = 6 - 0. Let b(o) = -w + 2 + 6o - 4o. Let q(j) = -10j. Give q(b(n)). -20n Let z(k) = -3k2. Let o(b) = 16b*2. Let u(i) = 4o(i) + 22z(i). Let l(g) = 7g*2. Calculate l(u(d)). 28d*4 Let b(f) = 2f*2. Let c(o) = -9189o*2. What is b(c(v))? 168875442v*4 Let j(l) = 1. Let h = 3 - 2. Let t(r) = 2r + 1. Let x(b) = ht(b) - j(b). Let q(z) be the second derivative of -z4/12 + 11z. Calculate q(x(w)). -4w2 Let r(g) = g. Let q(s) = 2s - 43. What is r(q(y))? 2y - 43 Let a(y) be the second derivative of -1/3y*3 + 0 - 3y + 0y2. Let o(m) = m2. Give o(a(l)). 4l*2 Let c(d) = d + 6. Let a(f) = -2f. Calculate a(c(k)). -2k - 12 Let v(p) = p3 - 3p*2 + 2p + 2. Let y be v(3). Suppose -2l - 2 = -y. Let o(i) = li - 2i + i. Let q(t) = -3t*2. Determine q(o(j)). -12j*2 Let m(y) = 5y. Let t(u) be the first derivative of u*5/120 + 2u*3/3 - 3. Let z(g) be the third derivative of t(g). What is z(m(v))? 5v Let d(y) = 2y + 83 - 83. Let n(i) = 1 - 1 - i2. Determine n(d(t)). -4t2 Let t(v) be the second derivative of -v4/12 - 3v. Let j(p) = -p2. Give j(t(d)). -d4 Let x(s) be the first derivative of s3 + 2. Let r(m) = m - 9 - 4m + 9. Determine x(r(y)). 27y2 Let s(t) = -8t*2 - 5t - 5. Let z(a) = -20a2 - 12a - 12. Let x(u) = 12s(u) - 5z(u). Let w(j) be the second derivative of -j*4/6 - j. What is w(x(c))? -32c*4 Let f(o) = -4o. Let z(t) = t*2 + 35t. Determine z(f(c)). 16c2 - 140c Let n(r) be the first derivative of r*2 + 40. Let h(g) be the first derivative of 2 + 0g - 2/3g3 + 0g*2. What is h(n(a))? -8a*2 Let c(n) = -5n*2. Let q(k) = -1325k. Determine c(q(d)). -8778125d2 Let t(v) = 9v*2 - 3v. Let w(d) be the first derivative of d*2/2 - 49. What is w(t(m))? 9m*2 - 3m Let k(v) = -2v. Let q(s) = -s3 - 7s*2 - 8s - 9. Let n be q(-6). Let p(u) = nu2 - 4u*2 + 8u*2. Determine p(k(r)). 28r*2 Let u be (-10)/25 + (-2)/(-5). Let n(v) = uv + 2v + 0v + 0v. Let a(l) = -2l*2. Calculate n(a(h)). -4h*2 Let u(h) = 38h*2 - 9. Let a(p) = -2p. Give u(a(v)). 152v2 - 9 Let j(k) = 23k. Let c(v) = 11v2 + 7v + 7. Let b(y) = 6y2 + 4y + 4. Let o(g) = -7b(g) + 4c(g). Determine o(j(r)). 1058r2 Let x(j) = 0j + 7 - 7 + 4j. Let h(i) = 4i. Calculate h(x(z)). 16z Let b(l) = -2130l*2. Let p(a) = 2a. What is p(b(t))? -4260t2 Let h be (-21)/(-70)(-10)/(-24). Let u(m) be the third derivative of 0m3 + 2m*2 + 0 + 0m + hm4. Let r(i) = -2i. Calculate r(u(z)). -6z Let c(t) = 46t*2 - 7. Let h(y) = -3y. Calculate h(c(f)). -138f2 + 21 Let c(q) = -q. Let g(k) = k. Let j(t) = -4c(t) - 5g(t). Let f(i) = 14i*2. Calculate f(j(l)). 14l*2 Let r(c) = 10c*2. Let n(g) = -4g. Let q(l) = -l. Let w(b) = n(b) - 2q(b). Give w(r(y)). -20y2 Let f(b) = -b2. Let o(k) = k*2 - 24k. What is o(f(p))? p*4 + 24p*2 Let r(z) = -z. Let p(d) = 119d*2 + 2d + 9. Determine p(r(w)). 119w2 - 2w + 9 Let s(q) = 7q - 5. Let k(a) = -8a + 6. Let n(x) = 5k(x) + 6s(x). Let f(y) = 8y. Let m(w) = w. Let c(r) = -3f(r) + 28m(r). What is c(n(t))? 8t Let u(c) = 11c2 + 2c - 2. Let o(y) = -56y2 - 11y + 11. Let a(r) = 2o(r) + 11u	{ "pile_set_name": "DM Mathematics" }
(n) = 5n3 + 8n*2 - 16n - 20. What is the thousands digit of z(9)? 4 Let a(o) = 13o2 + 193o*3 - 44 + 45 - 12o*2 - 2o. Let z be a(1). Suppose -237 = -10m + z. What is the tens digit of m? 4 Suppose 3d - 4d + 69 = 0. Let i = -27 + d. Suppose i = 3b - 246. What is the units digit of b? 6 What is the tens digit of 124/186(-40740)/(-2)? 8 Suppose 34o - 587653 - 1448147 = -18o. What is the units digit of o? 0 Let l(w) = 10w*2 + 9w + 3. Let n(t) = -8 - 10t2 + 5 + 0t - 8t + 1. Let z(r) = -4l(r) - 5n(r). What is the units digit of z(-3)? 6 Suppose 2 - 8 = -3i, -5i + 338 = 4u. Suppose -8o + 3o + 140 = 0. Let f = o + u. What is the tens digit of f? 1 Let s = -28 + 42. Let a = -9 + s. What is the units digit of (-3 - -8 - a) + 1? 1 Suppose 15 = 2f + 5. Let y(w) = -2w + 12. Let c be y(f). Suppose -d + ch + 74 = 0, 3h + 400 = 5d + 8h. What is the tens digit of d? 7 Let l = -2581 - -9352. What is the thousands digit of l? 6 Let o = -38 - -19. Let y(w) = -w*2 - 16w + 12. Let k be y(o). Let c = k + 68. What is the tens digit of c? 2 Let p(o) = 82o3 + 10o*2 - 12o + 20. What is the ten thousands digit of p(5)? 1 Suppose 68074 + 7945 = 19l. What is the hundreds digit of l? 0 Suppose 2t = -0t - 4u + 224, -2t - 2u = -222. Let z(r) = -r*2 + 14r - 6. Let w be z(13). Suppose wk - t = 2k - i, 5 = i. What is the units digit of k? 1 Let f = 353 - 356. What is the hundreds digit of (f/(-2))/(3/354)? 1 Suppose 24 = -10r + 13r. Suppose -15 = -rz + 33. What is the units digit of z? 6 Suppose -2 = u - 4. Suppose uj + 2337 - 878 = -q, 5j = -q - 1456. What is the units digit of (-18)/(-27) + q/(-9)? 3 Let a(w) = -w + 10. Let y be a(14). What is the hundreds digit of (y - -2) + (-6 + 9)81? 2 Let y = 32345 + -20588. What is the thousands digit of y? 1 Let h(t) = -t*2 - 2t + 7. Let l be h(-4). Let m be (l - (3 - 7)) + 25. What is the units digit of 8/(-16)(0 + -1)m? 4 Suppose 14p - 23190 = -1294. Let r = -867 + p. What is the tens digit of r? 9 Let r = -147 - -149. Suppose 16 = -4k, rk + 10742 + 2370 = 4a. Suppose c - a = -13c. What is the hundreds digit of c? 2 Let u = -312 - -440. Let h = 283 + u. What is the tens digit of h? 1 Let h(i) = i3 - 26i*2 - 29i + 143. What is the hundreds digit of h(30)? 8 Let f(h) = 710h2 - 915h + 16. What is the units digit of f(9)? 1 Suppose 24p + 8 = 32. Let z(d) = d3 + 3d*2 - 5d - 6. Let r be z(-4). What is the tens digit of p/r + (-664)/(-16)? 4 Let t be 1012/242 + 4/(-22). Suppose 2q - tb = 366, 0 = 2q - 4b + 2b - 356. What is the hundreds digit of q? 1 Let p(d) = -10d - 7. Let m(y) = -9y - 6. Let l = -20 + 15. Let j(a) = lp(a) + 6m(a). What is the tens digit of j(-12)? 4 Suppose q + 2s - 4 = 0, -2s + 5 = q - s. Suppose 9 = y + 2y - 3t, 3t = -q. Suppose 3k = 4k + y, -m - 5k = -47. What is the units digit of m? 2 Let k(w) = 9w3 + w2 - 2w + 1. Let g be k(1). Suppose 0 = -3r + 9, 2b - r = 4b - g. What is the tens digit of (2/b)/(2/222)? 7 Let b = 2003 + 3262. What is the hundreds digit of b? 2 Let s = 19 + -14. Suppose -28m + 25m = -15. Suppose -4d + 12 = sw - 108, mw = d + 95. What is the units digit of w? 0 Suppose 0d - 135 = 5d. Let q = 59 + d. What is the tens digit of (88/q)/((-2)/(-56))? 7 Let v(t) = -40t + 50. Let z be v(6). What is the hundreds digit of (1458/(-135))/(194/z + 1)? 5 Suppose s - 336r - 34904 = -335r, 0 = s + 3r - 34892. What is the units digit of s? 1 Let x = 150 + -152. Let r(h) = -8h*3 - h + 0h - 4h2 + 2 - 2h. What is the tens digit of r(x)? 5 Let x(o) = 2o - 15. Let s(h) = -3h + 30. Let r(w) = -4s(w) - 7x(w). Let y(n) = -n3 + n2 + 4n - 3. Let i be y(3). What is the units digit of r(i)? 3 Suppose 3g - 5x - 76534 = 0, -102048 = -4g - 2401x + 2405x. What is the ten thousands digit of g? 2 Let u = -252 + 226. What is the units digit of (57 + -53)u/(-4)? 6 Let h = 2862 - 1278. Suppose 65t + h = 69t. What is the tens digit of t? 9 Suppose -10 = 5n - 0. What is the units digit of (2/3)/(n/(-2316))? 2 Let x = 9199 - 439. What is the tens digit of x? 6 What is the tens digit of (-114059558)/(-2198) - 36/(-14)? 9 Let g be 5/(-25) + (-72)/(-10). Suppose -gm + 670 + 1451 = 0. What is the hundreds digit of m? 3 Suppose -2645j + 2656j - 223476 = 0. What is the tens digit of j? 1 Suppose 0 = h - 3h + 12. Suppose -38x - 14x + 15336 = 20x. Let a = x - h. What is the units digit of a? 7 Let s be 0/((-4)/(-1) - 2). Let t(u) be the first derivative of -u4/4 + u3/3 + 3u*2/2 + 199u + 161. What is the hundreds digit of t(s)? 1 Let k(m) = 2m2 - 113m + 2003. What is the ten thousands digit of k(106)? 1 Suppose -113g + 1540878 + 2108463 = -473125. What is the tens digit of g? 8 Let t = -455 - -447. What is the tens digit of (-37)/(t + (-30)/(-4))? 7 Let t = -14 + 18. Suppose 0 = 3s - 5n - 1476, 2s + 4n = -101 + 1063. Suppose -s + 103 = -td. What is the tens digit of d? 9 Let w(k) = 112k + 4208. What is the thousands digit of w(0)? 4 Let w(y) = 7y*2 + 19y - 55. Let h be 2 - -1 - (7 + 16/(-2)). What is the hundreds digit of w(h)? 1 Suppose 14u + 1658 = 5102. Suppose -13x - u = -883. What is the units digit of x? 9 Let s(x) = -15x2 + 457x - 3. Let d be s(30). Let t = -413 - -778. Let m = t - d. What is the hundreds digit of m? 1 Suppose -6l - l + 5l = 0. Suppose 4g - 1511 - 1533 = l. What is the units digit of g? 1 Let r(j) = -8j - 92. Let t be r(-11). What is the units digit of (-26400)/(-72) - (t/(-3))/2? 6 Let t = -1238 + 2986. What is the units digit of t? 8 Suppose 22z = 20z - 2, z = 5x - 205896. What is the ten thousands digit of x? 4 Let a = -152 - -100. What is the tens digit of (30/(-4))/(367/a - -7)? 3 What is the tens digit of (-5)/(0 - 1/313)? 6 Suppose 0 = l - 5l - 28. Let u be (-45)/l + (1 - (-10)/(-7)). Suppose 64 = t + u. What is the tens digit of t? 5 Let m = 0 - -4. Let l = 77 + 201. Suppose l = 5n - n + 2s, mn - 313 = 5s. What is the units digit of n? 2 Suppose 46k - 40k = 25k - 27512. What is the tens digit of k? 4 Let d(i) = -42233i + 194. What is the hundreds digit of d(-1)? 4 Let v be 292(5/(30/(-27)))/6. Let x be (-6)/(-4) - v/6. Suppose -36n = -xn + 372. What is the hundreds digit of n? 1 Let x(w) = 26w + 1160. What is the hundreds digit of x(36)? 0 Let f(p) = 1373p2 + 120p + 373. What is the ten thousands digit of f(-3)? 1 Let j be (7/(-14))/(3/(-2802)). Suppose 3p - j = 2p. What is the hundreds digit of p? 4 Suppose -21n - 589 + 12475 = 0. Suppose j - 171 = 3d + n, -4d = 5j - 3590. What is the hundreds digit of j? 7 Let q(p) = -p*2 + 22p - 35. Let u be q(20). Suppose -ul + 5 = -5. What is the tens digit of (l/(-6))/(7/(-231))? 1 Suppose 5f + 422 - 52 = 0. Let q(g) = -13g - 542. Let s be q(-35). Let b = f - s. What is the tens digit of b? 1 Suppose -12 = i + 3i. What is the units digit of 2 + 183 - (3 + i)? 5 What is the units digit of (-660)/30 - (-4 - 59711)? 3 Suppose 98h - 10834 = 12784. What is the hundreds digit of h? 2 Suppose 13i - 8i - 75 = 0. Suppose iu - 10998 = 8997. What is the units digit of u? 3 Suppose -8m = -19m + 55. Suppose -q + 0u + 98 = -2u, 5q - 415 = -mu. What is the tens digit of (q - -1) + 4 + 0? 9 Let s = -15061 + 19765. What is the thousands digit of s? 4 Let a(j) = 7j - 35. Let l(c) = -22c + 104. Let i(d) = 7a(d) + 2l(d). What is the tens digit of i(11)? 1 Let t(o) = 11o + 43. Let k be t(-4). Let m be -129 + 1 + (k - (-1 - -2)). Let a = m + 160. What is the units digit of a? 0 Let w(f) = 138f - 4210. What is the hundreds digit of w(52)? 9 Let o be (-6 - -7 - 46/(-6))3. Suppose om - 27m = -193. What is the units digit of m? 3 Let t = 129631 + -75091. What is the tens digit of t? 4 Let t(k) = -k3 + 20k*2 + 26k - 103. Let r be t(21). Let j = -48 + 85. What is the units digit of j + -9 - r/(-1)? 0 Let k(b) = b*3 + 6b*2 - b - 4. Let r be k(-6). Suppose 4n = a - 397, -ra - 2n = -365 - 479. What is the tens digit of a? 1 Suppose 201 = 8h + 41. Suppose h = 6q + 14. What is the units digit of q? 1 Suppose 64s - 18s - 1056850 = 0. What is the ten thousands digit of s? 2 What is the ten thousands digit of (-170)/(-51) - 2148972/(-63)? 3 Suppose 45*u - 6	{ "pile_set_name": "DM Mathematics" }
5(sqrt(252) + -1))-2)*2 + -4 + 2. -213840sqrt(7) + 9887506 Simplify ((sqrt(504) + -5-2sqrt(504))/(-2sqrt(40)/sqrt(5)))/(-5-1sqrt(81)6). -11sqrt(7)/180 Simplify ((-2sqrt(1000)1 - sqrt(1000))-2)/((-1sqrt(605)-1 + sqrt(605))-2). -15sqrt(2)/11 Simplify 3(2 + (-2sqrt(15)/sqrt(3)5 + -2sqrt(500)-2)2)-6. -81036 Simplify -1 + ((sqrt(704) - -3sqrt(704)) + -1)22 + 5 + -1. -128sqrt(11) + 22533 Simplify -1 + (sqrt(112) + 0)25 + sqrt(196)/((sqrt(84)/sqrt(6))/sqrt(2)). 2sqrt(7) + 559 Simplify (-3 + -5 + (((sqrt(27) + (sqrt(54)/sqrt(2) - sqrt(27)))1)/(sqrt(225)-1 - sqrt(225)) - 1(sqrt(192)-2 + sqrt(12)/sqrt(4)5)))*2. -872sqrt(3)/5 + 42043/100 Simplify (-62(0 + sqrt(242))-4)2 - (sqrt(242) + -4 + sqrt(242) + -1 + sqrt(242) + sqrt(242) + sqrt(242) - sqrt(242) - (4 + 4sqrt(242)))2. 557487 Simplify (1 + sqrt(19) + 3 + 0)2 + -2 - -2((sqrt(209)/(sqrt(44)/sqrt(4)) - sqrt(19)) + -4sqrt(171)). -16sqrt(19) + 33 Simplify -1(-2 + ((sqrt(612) + (3sqrt(612) + sqrt(612) - sqrt(612)) + -4 + sqrt(612) - sqrt(612)) + 1 + 1 + sqrt(612))2)3. -45906 + 360sqrt(17) Simplify (-3(sqrt(2448) + -1 + sqrt(2448)) + 0 + 4 - (-4 + -3 + sqrt(2448) - (sqrt(2448)3 + sqrt(2448))5))*2 + 1. 4368sqrt(17) + 413909 Simplify -1 + (5((-3 + sqrt(325)-1 - sqrt(325)) + -5sqrt(325) + -1))2. 7000sqrt(13) + 398524 Simplify ((-6(sqrt(9) - (sqrt(144) - sqrt(144)3)))/(sqrt(18)/sqrt(6)-6-5) + 1)-4. -4 + 36sqrt(3)/5 Simplify ((sqrt(2880) - (5 + 3 + sqrt(2880)))6 + 5 + (sqrt(2880) - -2(sqrt(2880) + -3 + sqrt(2880))))*2. -11760sqrt(5) + 74401 Simplify -4((-5 + sqrt(1088) + sqrt(1088) + -1 + -1)2 + -2) + 1. -17595 + 896sqrt(17) Simplify -6(-2 + (2 + 5 + sqrt(363) + sqrt(363) + 2 - ((-3 + 2sqrt(363) - sqrt(363)) + 2)))-3. 144 + 198sqrt(3) Simplify 3 + 5(1 + sqrt(5) + 0 - sqrt(50)/(sqrt(10) + sqrt(20)/sqrt(2))) + 0 + 5. 5sqrt(5)/2 + 13 Simplify (1sqrt(700)1 - sqrt(700)-24)/((sqrt(484) + sqrt(484)-2 - sqrt(484) - sqrt(484))2-3). 5sqrt(7)/22 Simplify (((sqrt(187) - (sqrt(187) + sqrt(187)-3))2 + sqrt(187)3-1)/(2((sqrt(66) - (sqrt(66) + sqrt(66)2))2 - sqrt(66))/sqrt(6)))24. 153/25 Simplify 2 + sqrt(14)/(sqrt(288) - sqrt(288)-5 - sqrt(288)) - (sqrt(56)/sqrt(8)-3 - (sqrt(77) + 4sqrt(77))/sqrt(11))2. -446 + sqrt(7)/60 Simplify (sqrt(119)-154)/(sqrt(84)/(sqrt(72)/(sqrt(6) + sqrt(54)/sqrt(9)))) + 4. -10sqrt(17) + 4 Simplify 3 + (sqrt(210)/sqrt(5)3 + 3sqrt(6048))/((sqrt(216) + (sqrt(216) - ((sqrt(216)-1 + sqrt(216))-1 - sqrt(216))))5). 13sqrt(7)/30 + 3 Simplify (sqrt(1400)23 + sqrt(1400)-21)/((-2sqrt(128) + -1sqrt(162))-1). 8sqrt(7)/5 Simplify -3 + -3((sqrt(847)-2-2 - sqrt(847)1-4)*2 + (sqrt(847)22 + sqrt(847)-2 + 3)*2) + 0. -172818 - 396sqrt(7) Simplify (-4 + 4 + ((sqrt(1539) + sqrt(1539) + 2)-5 - (-2sqrt(1539) + -2)) + -5 + -2 + -3 + sqrt(1539))*2. 2268sqrt(19) + 75735 Simplify (((sqrt(475) - -1sqrt(475))3 + sqrt(475))-5 + -1 + 2sqrt(475)4 + -1 + 0)2. 540sqrt(19) + 346279 Simplify (sqrt(180)-2-1 - 52sqrt(180))/(-6-2sqrt(250)) + -4 + -2. -6 - 2sqrt(2)/5 Simplify 1 + ((sqrt(1872) - (2 + sqrt(1872)2))*2 + 2)6 + 1. 288sqrt(13) + 11270 Simplify ((1 + sqrt(272) + sqrt(272) + -1 - (sqrt(272)1 + 0))3-4 + 3)*2. -288sqrt(17) + 39177 Simplify -6(sqrt(128) + (sqrt(128)2 + 1)*2 + 3) + (sqrt(36)/sqrt(3))/sqrt(6) + ((sqrt(168)/sqrt(7))/sqrt(12) - sqrt(2)) + -1. -3097 - 239sqrt(2) Simplify (5 + (sqrt(833) + 2sqrt(833))4 + -5 + (sqrt(85) + -1sqrt(85))/sqrt(5) + 5)2 + -2. 840sqrt(17) + 119975 Simplify (3 + ((sqrt(200) + (-2sqrt(200) - sqrt(200)))/sqrt(5))/(sqrt(18)-4) + 5 + 3)*2. 22sqrt(5)/3 + 1094/9 Simplify -3 + (sqrt(425)-1)2-4 - 4(4 + sqrt(17) + -1 + sqrt(612))2. -5071 - 168sqrt(17) Simplify (-1(((0 + sqrt(2448))4 - (sqrt(2448) + 0 + -4))6-1 + 5)-4)2. 131328sqrt(17) + 12696208 Simplify (-1(4(-2sqrt(8) + 4) - (sqrt(16)/sqrt(72) + sqrt(6)/sqrt(48) + 4)))2-4. -49969/18 + 1592sqrt(2) Simplify ((sqrt(968) - sqrt(968)-1)4)/(sqrt(256) + sqrt(256)2 + sqrt(256) - sqrt(100)1) + -2. -2 + 88sqrt(2)/27 Simplify (2(2 + (-5-1sqrt(300) + sqrt(300) - sqrt(300))) + 5(2 + sqrt(300)) + sqrt(300)-1 + 1)2. 4200sqrt(3) + 59025 Simplify (1 + (-4 + -2sqrt(128) + 4)55-5)*2 + -3. 4000sqrt(2) + 7999998 Simplify -1(5 + (((1 + -1 + sqrt(1008))-3)*2 - ((sqrt(1008) + (-1 + sqrt(1008) - sqrt(1008)))-6 - sqrt(1008)23))4). -36269 - 576sqrt(7) Simplify -5 + ((-6-5sqrt(245) + -5 - 6(-1 + -1 + sqrt(245))) + -3)2. 1344sqrt(5) + 141131 Simplify (1((sqrt(3600) - (-1sqrt(3600) + sqrt(3600) + sqrt(3600)))-3 - sqrt(3600)))/((sqrt(240) - 2sqrt(240))/sqrt(5)-1)2. -10sqrt(3) Simplify (((sqrt(175) - -3(sqrt(175) + 1sqrt(175)))/((sqrt(15)/sqrt(3) + sqrt(5))-6))/(sqrt(1575)-41))*2. 49/103680 Simplify ((-1 + sqrt(468)3 + -1 + 0)*2 + -5 + 5)4. -288sqrt(13) + 16864 Simplify (sqrt(450)545)/(((sqrt(1000) - -3sqrt(1000)-1) + sqrt(1000))-6). 5sqrt(5) Simplify (sqrt(140)/sqrt(5)-2 - (sqrt(28) + sqrt(28) + sqrt(28)-3)5)/((sqrt(484) - -1sqrt(484))-5 - (2sqrt(484)-1 + sqrt(484))). -sqrt(7)/33 Simplify ((-5((-1sqrt(90) + sqrt(90))/sqrt(2))/sqrt(3))/(((sqrt(132)-1)/sqrt(11))/(4sqrt(36))))2. 0 Simplify ((sqrt(175) + 1(sqrt(175) - (-2sqrt(175) - sqrt(175))))/(sqrt(21)/(1sqrt(3))))/(-352sqrt(5)-6). sqrt(5)/36 Simplify 3 + (3 + -3 + sqrt(44)/sqrt(4) + sqrt(11) + (sqrt(11) + -1)3 - ((sqrt(275) + 0)5 - ((sqrt(275) - sqrt(275)-2)2)*2)). -20sqrt(11) + 9900 Simplify ((-5 + sqrt(2592) - sqrt(2592)) + -5 + sqrt(2592))*2 + sqrt(2592) - ((sqrt(32) - (2sqrt(32) + 2))*2 + sqrt(32) + 5). -704sqrt(2) + 2651 Simplify (((-1sqrt(432) + 3 - -1sqrt(432)-5 - 5(-5 + sqrt(432)2)) + -3)1)*2. -9600sqrt(3) + 111217 Simplify (-5 + -2(-1-6(sqrt(275)-4 - (sqrt(11)4 + 4)) + -4))2. 29376sqrt(11) + 914985 Simplify (2-2(-4(-1 + sqrt(3267)) + sqrt(3267) + sqrt(3267)2 + sqrt(3267) + 0) + -3)*2. 361 Simplify (-5 + 6sqrt(133)/sqrt(7)-2)2 - (sqrt(95) + 1sqrt(95)-3 - sqrt(95))/(sqrt(605) - -2sqrt(605)). 1321sqrt(19)/11 + 2761 Simplify 1 + 2 + ((sqrt(72)2 + sqrt(72))/sqrt(9) - (sqrt(32)1 - sqrt(8)))/((sqrt(400) - 2sqrt(400)) + (sqrt(72)/sqrt(2) + sqrt(36) - sqrt(4))). -2sqrt(2)/5 + 3 Simplify 43(sqrt(68) + (sqrt(68) + -6(sqrt(68) - -4sqrt(68)) - sqrt(68)) - ((1 + sqrt(68))-3)*2)1. -7452 - 1128sqrt(17) Simplify (5 + -6(1 + (sqrt(1539) + -1-1sqrt(1539) - -4(sqrt(1539) + -1))) + 3)26. -101088sqrt(19) + 11971320 Simplify -4((-1(-2sqrt(125) + -4))2 - (2 + -2 + sqrt(125) + -5)2). -1464 - 520sqrt(5) Simplify -3-5(3 + (sqrt(425) - (sqrt(425) + (1sqrt(425))*2))-1 + -1). 6405 Simplify ((2(3 + sqrt(1008) + -1 - (1 + sqrt(1008) - sqrt(1008) - sqrt(1008))2)-3 + -3 + -2)-5)*2. 54000sqrt(7) + 8165425 Simplify 5((sqrt(264)/sqrt(294))/(sqrt(4) - (sqrt(36)-2 + sqrt(36))/sqrt(9)) + 0)*2. 55/196 Simplify -2 + 4 + -4(sqrt(1300) + -1) + (-5 + 2sqrt(1300))2 + -1. -240sqrt(13) + 5230 Simplify -5 + 4(1 + (-1(sqrt(18)-1 + sqrt(18)))/((sqrt(9)2 + sqrt(9))4))6. 19 Simplify 3 + (31sqrt(1944)-4)/((sqrt(96) - (sqrt(96) + (sqrt(96) - (sqrt(96) - sqrt(96)1)))4)/(-1sqrt(48)/sqrt(4))). -108sqrt(3)/7 + 3 Simplify -4 + 6(((-1 + sqrt(432) + 4)-6)2 - (-3 + sqrt(432) + sqrt(432)2 + sqrt(432) + -1)). 15264sqrt(3) + 95276 Simplify ((2sqrt(75)1 - 2sqrt(75)5) + -5 + 4sqrt(48) + 3)-1. 2 + 24sqrt(3) Simplify (sqrt(2450)-2 + sqrt(50) + (sqrt(300) + sqrt(300)2)/sqrt(6))/((sqrt(160)2 - sqrt(160))-2-3). -5sqrt(5)/12 Simplify (sqrt(96)3 - ((sqrt(54)4)/sqrt(9) + sqrt(6) + sqrt(6)))/((-1(sqrt(33) - sqrt(528)) + sqrt(33))/(-2sqrt(704))). -24sqrt(2) Simplify (-3 + (4 + sqrt(5) + (sqrt(25)/sqrt(5) + sqrt(5) + 0 - sqrt(5)) - sqrt(1620)4) + 1)*2. -280sqrt(5) + 24504 Simplify ((-4 + (sqrt(225)3 + sqrt(225))/sqrt(5))2 + -1)5-1. -3675 + 480sqrt(5) Simplify (((sqrt(204)-1 - sqrt(204))2 + (sqrt(204) - (sqrt(204) + sqrt(204)2)-5))/(((2sqrt(192))/sqrt(4))/sqrt(4)) + 3)2. 36sqrt(17) + 621 Simplify (((sqrt(84) - -3(sqrt(84) + 1sqrt(84)) - -41sqrt(84))3)/(sqrt(12) + 1sqrt(192) - -3sqrt(12)-5))*26. 22869/50 Simplify ((sqrt(108)-5)/sqrt(9) + ((sqrt(72) - 2sqrt(72)) + sqrt(72)	{ "pile_set_name": "DM Mathematics" }
te the highest common divisor of 1054 and 47855289. 527 Calculate the greatest common divisor of 74753 and 1427741. 413 Calculate the highest common divisor of 286197450 and 7. 7 Calculate the greatest common divisor of 692720 and 4340. 140 What is the highest common divisor of 148678 and 113861? 941 Calculate the highest common factor of 7308 and 21461972. 812 What is the highest common factor of 7462 and 5047510? 1066 Calculate the highest common divisor of 155800175 and 1. 1 Calculate the highest common divisor of 784 and 3593121. 49 Calculate the greatest common divisor of 16271792 and 36. 4 What is the highest common factor of 34402 and 4369221? 167 Calculate the greatest common factor of 30797 and 17469933. 1339 Calculate the highest common divisor of 50 and 37622400. 50 Calculate the highest common divisor of 126766584 and 1455. 291 Calculate the greatest common divisor of 34714 and 973013. 1021 What is the greatest common factor of 931776 and 7174? 422 What is the greatest common divisor of 196 and 1140052? 4 Calculate the greatest common divisor of 423486 and 15876. 126 Calculate the greatest common factor of 4086926 and 838. 838 What is the highest common factor of 2936 and 31672? 8 Calculate the highest common factor of 14875198 and 15340. 1534 Calculate the greatest common divisor of 23480 and 1. 1 Calculate the greatest common divisor of 8907503497 and 1363. 1363 Calculate the highest common factor of 777 and 112454211. 111 What is the highest common divisor of 136854 and 379062? 18 What is the highest common factor of 74495318 and 14? 2 What is the highest common factor of 155504707 and 59? 59 Calculate the greatest common factor of 12 and 6756792. 12 Calculate the highest common divisor of 21749 and 712075. 91 Calculate the highest common divisor of 165088 and 212. 4 What is the greatest common factor of 1408 and 44968? 88 Calculate the greatest common divisor of 74206154 and 1210. 242 What is the highest common factor of 4157 and 133809673? 4157 Calculate the highest common divisor of 1518 and 38159990. 506 Calculate the greatest common divisor of 63602 and 238084. 154 Calculate the greatest common factor of 8432 and 2004181. 527 What is the highest common factor of 18 and 14154306? 6 What is the greatest common factor of 2871 and 24507? 9 What is the greatest common divisor of 4326800 and 2800? 400 Calculate the highest common factor of 57277638 and 2321. 2321 What is the highest common divisor of 536 and 3858865? 67 What is the highest common factor of 28977 and 2685945? 2229 What is the highest common divisor of 344 and 1386269432? 344 What is the greatest common factor of 106725966 and 1734? 1734 Calculate the greatest common factor of 1596 and 9554948. 76 What is the greatest common divisor of 47995103 and 25613? 3659 Calculate the highest common divisor of 1311 and 7181313. 69 Calculate the highest common factor of 2061 and 11553737. 229 Calculate the greatest common divisor of 23013751 and 1994. 997 What is the highest common divisor of 3417300 and 1125? 225 Calculate the greatest common divisor of 4848477 and 3553. 19 Calculate the greatest common factor of 3602916 and 28782. 738 What is the highest common factor of 180 and 9191268? 36 Calculate the highest common factor of 306 and 6883062. 102 Calculate the highest common factor of 5255 and 177685. 5 Calculate the highest common factor of 189 and 67013595. 27 Calculate the greatest common factor of 12195194 and 5830. 1166 What is the greatest common factor of 24 and 9824286? 6 What is the highest common factor of 1084877 and 4158023? 4033 Calculate the greatest common divisor of 1431 and 1827334. 53 What is the highest common divisor of 51785082 and 2984? 746 Calculate the highest common divisor of 94288 and 4524496. 1328 Calculate the highest common divisor of 1107699 and 5369011. 6053 Calculate the greatest common divisor of 167515561 and 229. 229 Calculate the greatest common factor of 2545463082 and 6. 6 What is the highest common factor of 5226805 and 3420? 95 Calculate the greatest common divisor of 31706 and 241042. 382 What is the highest common divisor of 79756955 and 775? 155 Calculate the greatest common factor of 493323515 and 235. 235 What is the greatest common divisor of 59868 and 1877814? 18 Calculate the greatest common divisor of 1573 and 42633019. 1573 Calculate the greatest common factor of 40056660 and 10206. 378 Calculate the highest common divisor of 10701052 and 4705. 941 Calculate the greatest common divisor of 35 and 253202215. 35 Calculate the highest common divisor of 57659207 and 44354. 331 What is the highest common factor of 525037809 and 17? 17 Calculate the highest common factor of 69399 and 156128823. 6309 What is the highest common factor of 105720 and 14328? 24 What is the highest common divisor of 666396 and 672174? 1926 Calculate the highest common factor of 506 and 3939254. 22 What is the highest common factor of 1497144 and 1782? 66 Calculate the highest common divisor of 14682 and 68031494. 4894 What is the greatest common divisor of 543161043 and 2265? 453 Calculate the greatest common factor of 1192786 and 728. 14 Calculate the highest common factor of 6641802 and 345. 69 Calculate the highest common factor of 85463 and 1144717. 203 What is the greatest common factor of 44618640 and 165? 165 What is the greatest common factor of 125374425 and 25? 25 Calculate the greatest common factor of 8021475 and 1852. 463 Calculate the greatest common divisor of 416 and 216465184. 416 Calculate the highest common divisor of 1647 and 28731976. 61 Calculate the highest common factor of 2 and 5069875. 1 What is the greatest common factor of 64 and 3011776? 64 What is the highest common factor of 30637294 and 43018? 314 Calculate the greatest common divisor of 8608 and 40191828. 1076 Calculate the highest common factor of 28267 and 1978. 23 What is the greatest common divisor of 820 and 5902852? 164 Calculate the greatest common factor of 370040706 and 70. 14 What is the greatest common factor of 687142 and 59566? 158 What is the highest common factor of 694813 and 105? 7 What is the highest common factor of 335351 and 85541? 757 Calculate the highest common factor of 231320 and 1880. 40 Calculate the greatest common factor of 149321 and 62725118. 5149 Calculate the greatest common factor of 453755 and 49883. 601 What is the greatest common factor of 566241 and 24531? 39 Calculate the highest common factor of 51241012 and 879. 293 What is the greatest common factor of 72 and 21152? 8 What is the greatest common divisor of 64238848 and 6080? 1216 Calculate the greatest common factor of 7788 and 33249568. 2596 Calculate the highest common divisor of 129 and 1985305098. 129 Calculate the highest common divisor of 5411485 and 1615. 95 Calculate the highest common factor of 12 and 51230532. 12 Calculate the greatest common divisor of 519292 and 109394. 1318 Calculate the greatest common divisor of 2072166 and 754. 58 Calculate the greatest common divisor of 696 and 922622298. 174 Calculate the greatest common factor of 34716 and 1281599. 2893 Calculate the highest common divisor of 105 and 9746660. 35 Calculate the greatest common factor of 16092 and 19452. 12 Calculate the greatest common factor of 10568221 and 8022. 191 Calculate the greatest common factor of 445980750 and 1500. 750 Calculate the greatest common divisor of 244 and 7282546. 122 Calculate the highest common factor of 115 and 29436113. 23 What is the highest common factor of 7099 and 170147? 229 Calculate the greatest common factor of 1465668290 and 163. 163 What is the highest common factor of 14059692 and 209934? 1962 Calculate the greatest common factor of 5092 and 1793752. 76 Calculate the greatest common divisor of 171774 and 88608. 6 What is the highest common factor of 1164878 and 14222? 26 Calculate the greatest common factor of 4899986 and 926718. 2834 Calculate the greatest common divisor of 521208 and 58212. 108 Calculate the highest common divisor of 83410538 and 10278. 1142 Calculate the greatest common divisor of 644 and 2252880. 28 Calculate the greatest common divisor of 675 and 3461130. 135 What is the highest common factor of 152 and 3884227? 19 What is the g	{ "pile_set_name": "DM Mathematics" }
ative of 19v2 - 3v*6 - 8v*2 - 6v*6 - 17v*2 wrt v. -1080v3 Let o(n) be the second derivative of -n5/20 - 5n3/6 + 5n. Find the second derivative of o(r) wrt r. -6r Let z(b) be the first derivative of -23b*7/7 + 5b*3/3 - 6. What is the third derivative of z(s) wrt s? -2760s3 Let f(q) be the first derivative of -q7/7 + 5q3/3 + 9. What is the third derivative of f(c) wrt c? -120c*3 Let p be 18 + (1 + 2 - 5). Suppose -2l + 6l - p = 0. What is the first derivative of -2m*2 - lm*2 + 6m2 - m3 + 4 wrt m? -3m2 Let j(f) be the third derivative of 11f*5/30 - 8f*3/3 - 21f*2. What is the derivative of j(i) wrt i? 44i Let x be 0 - 0 - (-1 - -7). Let l be ((-3)/2)/(x/16). Find the second derivative of z + 0zl + 2z*4 - 2z - z*4 wrt z. 12z*2 Let c(h) be the first derivative of 7h*4/2 + 5h*3/3 - 5. What is the third derivative of c(t) wrt t? 84 Let c(u) be the third derivative of 11u6/120 - u4/3 + 5u2. Find the second derivative of c(w) wrt w. 66w Let s(p) be the second derivative of p5/12 - p4/12 - p*2 - 4p. Let m(w) be the first derivative of s(w). What is the second derivative of m(h) wrt h? 10 Suppose 3a + 5t - 21 = 0, 3a + 2t = 6a. Let z be 4/(-14) - (-46)/14. Differentiate -a + 0 + 0 + 3 - 4p*z with respect to p. -12p2 Find the third derivative of i2 + 3i4 - 7i*2 - 13i2 + i2 + 14i3 wrt i. 72i + 84 Let p(z) be the second derivative of z8/560 - z4/12 + z*3 - 3z. Let y(s) be the second derivative of p(s). What is the first derivative of y(b) wrt b? 12b3 Let s(l) = l2 - l. Let a(v) = 23v*3 + 5v*2 - 5v + 1. Let j(w) = a(w) - 5s(w). Differentiate j(r) wrt r. 69r*2 Suppose -b = v - 7, -3v - 3b + 19 = -v. What is the third derivative of -u2 + u6 + vu*2 + 0u*6 wrt u? 120u*3 Suppose 3f = f + 3n, -4f + 2n = -8. Find the second derivative of 3u*f + u + 31 - 31 wrt u. 18u Let i(m) = m*2 + m + 2. Let j be i(-2). Find the first derivative of -6 + 22u + 6uj - 22u wrt u. 24u3 What is the second derivative of 6f + 13f4 - 3f*4 - 8f*4 wrt f? 24f*2 Let m be (-1)/(1/(-1)) + 1. Suppose 2q - 2 = q. What is the first derivative of 0 - 3dq + 2 + 5d*m wrt d? 4d Let h(u) = 10u2 - 3u. Let x(b) = -39b2 + 13b - 1. Let f(v) = 26h(v) + 6x(v). Find the first derivative of f(o) wrt o. 52o Let u(b) be the first derivative of -b3 + b2/2 - 6b + 8. Let w(r) be the first derivative of u(r). Differentiate w(f) wrt f. -6 Let t(v) = -28v3 - 12v*2 - 2v - 2. Let g(x) = x3 - x2 - x - 1. Let z(y) = -2g(y) + t(y). What is the third derivative of z(u) wrt u? -180 Let a(w) = 7w*5 - 4w*3 + 11w*2. Let c(y) = 20y*5 - 11y*3 + 33y*2. Let l(j) = -11a(j) + 4c(j). What is the third derivative of l(h) wrt h? 180h2 Let l(f) = f3 + f*2 - f. Let a(g) = 5g*3 - 5g*2 + 5g - 21. Let c(d) = -a(d) - 5l(d). Find the first derivative of c(u) wrt u. -30u*2 Let s(q) = 4q*2 + 7q. Let h(r) = 5r2 + 7r. Let p(o) = -2h(o) + 3s(o). Find the second derivative of p(n) wrt n. 4 Let j(v) = -v*3 - 3v*2 - 3v + 8. Let p(f) = 2f2 + 2f - 7. Let l(q) = 4j(q) + 6p(q). Find the first derivative of l(g) wrt g. -12g2 Let r(g) be the second derivative of -g6/3 + 11g*4/12 - 8g. Find the third derivative of r(y) wrt y. -240y Let b(u) be the third derivative of u6/15 - 31u*5/60 + 2u*2 + 24u. Find the third derivative of b(l) wrt l. 48 Let o(j) be the first derivative of -7j4/4 + 2j*3 + 2. What is the third derivative of o(s) wrt s? -42 Let o be 3/(-2)(-8 + 6). Differentiate 1 - 8 - ao + a3 - 3a3 with respect to a. -9a*2 Let v(g) be the first derivative of -3 + 0g*4 + 0g*2 + 0g*3 + 3/5g*5 + g. Differentiate v(w) wrt w. 12w*3 Let u(p) = -7p*3 + 3p*2 + 3p + 2. Let s(d) = -14d3 + 5d*2 + 5d + 5. Let h(c) = 3s(c) - 5u(c). Differentiate h(o) with respect to o. -21o2 Let b(u) be the first derivative of 0u*3 + 0u*4 + 2 - u - 2/5u*5 + 0u*2. Find the first derivative of b(s) wrt s. -8s*3 Let s = 6 - 4. Suppose 4j + 2f = j + 4, -2f = -sj + 6. What is the second derivative of 3k*2 + 3k - 3kj + 3k*2 - k wrt k? 6 Let i(q) = -2q*3 + 5q*2 + 5q + 3. Suppose -h - 2 = h. Let d(t) = t3 - t2 - t. Let l(b) = hi(b) - 5d(b). Find the first derivative of l(a) wrt a. -9a2 What is the third derivative of -11a*3 + 11a*2 + 11a*3 - 28a*2 - 10a*5 wrt a? -600a*2 Let c(m) be the third derivative of 5m8/336 + m4/3 - m*2. What is the second derivative of c(w) wrt w? 100w*3 Let c(s) = -10s*2 + s - 4. Let h be (-4)/6 - 10/3. Let f(q) = 51q*2 - 6q + 21. Let v(k) = hf(k) - 21c(k). What is the second derivative of v(a) wrt a? 12 Let n(c) be the second derivative of 13c7/21 + 2c*3/3 + 7c. Find the second derivative of n(f) wrt f. 520f3 Let p(a) = 16a*5 - 4a*2 + 15a + 4. Let h(x) = -x5 - x2 + x + 1. Let s(c) = -4h(c) + p(c). Find the second derivative of s(l) wrt l. 400l3 Let f(a) = -a4 + a3 - a2 + a. Let s(u) = -2u4 - 6u*3 + 3u*2 - 6u. Let n(c) = 6f(c) + s(c). What is the third derivative of n(w) wrt w? -192w Let p be 0/(-1 + -2) - 0. Suppose -2b + pd + 20 = 4d, 4b = 2d. Find the first derivative of 3 + 3z*3 - bz3 + z3 wrt z. 6z2 Suppose -h + 8 = 3h. Find the third derivative of 0bh + 6b*2 + 0b*6 - 4b*6 wrt b. -480b*3 Let u = -1 - -4. Let c(d) = 4d*2 + d. Let x be c(-1). What is the first derivative of -2 + xp + up - 3p wrt p? 3 Let g(v) be the third derivative of v*5/12 + 3v*3/2 - 8v*2. Differentiate g(m) wrt m. 10m Let f(k) be the third derivative of -3k7/70 - 5k*4/12 + 3k*2. Find the second derivative of f(h) wrt h. -108h*2 Suppose -4 = -2k + 4. What is the derivative of 4c4 - 6ck + 0 + c4 - 3 wrt c? -4c3 Let r = -15 + 23. Let a = r + -6. What is the derivative of -1 - xa - 2 + 2x*2 wrt x? 2x What is the third derivative of -p*3 - 2p*2 + 9 + 1 - 11p*5 + 19p*5 wrt p? 480p2 - 6 Let p(l) = l4 - l3 - l2 - l - 1. Let g(w) = 4w3 - 5w*2 + 4w + 4. Let b(k) = g(k) + 4p(k). What is the third derivative of b(o) wrt o? 96o Let k(i) = -9i4 - 5i*2 - 12i - 5. Let v(u) = -10u4 - 6u*2 - 13u - 6. Let h(p) = -6k(p) + 5v(p). What is the second derivative of h(q) wrt q? 48q2 Let t(h) = 3h*3 - 22h*2 + 7h. Let c(a) = -2a3 + 7a - 7a + 15a*2 - 5a. Let w(g) = -7c(g) - 5t(g). What is the third derivative of w(v) wrt v? -6 Let z(p) be the first derivative of 0p2 - p + 2/5p*5 + 0p*4 + 0p*3 - 5. What is the first derivative of z(x) wrt x? 8x*3 Let b(d) be the first derivative of 11d*2/2 - 11d + 7. Let g(w) = 243w - 243. Let z(k) = 45b(k) - 2g(k). Differentiate z(v) wrt v. 9 Suppose 2 = 4d - 6. Suppose d = 5o + 3v - 20, 3o - 14 = -2v. What is the second derivative of on - n5 - 2n - 2n wrt n? -20n*3 Let l(q) = 12q*4 + 35q*2 + 7q. Let i(z) = 12z4 + 35z*2 + 6z. Let f(w) = 7i(w) - 6l(w). Find the third derivative of f(n) wrt n. 288n Let q(c) = -6c*4 - 3c*3 + 3c*2 + 2. Let x(k) = 0k*4 - 2k2 + 1 - k3 - k*4 + 3k*2. Let s(v) = q(v) - 3x(v). Differentiate s(r) wrt r. -12r3 Let p(q) = q2 + 12q + 14. Let m be p(-11). Find the third derivative of mc4 + c4 + 2c*4 - 3c*2 - 2c*2 wrt c. 144c Suppose 0 = -y - 0y + 5. Differentiate -yg*3 - 2 + 3g3 + g3 with respect to g. -3g2 Let z be -6(16/(-6) - -3). Let b(y) = -9y3 + 5y + 3. Let l(n) = -8n3 + 5n + 2. Let v(i) = zb(i) + 3l(i). Find the second derivative of v(m) wrt m. -36m Find the second derivative of -8h*4 + 6h*4 - 4h - 3h4 wrt h. -60h*2 Let q(o) = 20o*4 + 7o*2 - 32. Let k(p) = 13p*4 + 5p*2 - 21. Let u(g) = 7k(g) - 5q(g). Differentiate u(r) wrt r. -36r*3 Let l(t) be the second derivative of 7t*5/20 - 3t*2/2 - 7t. Differentiate l(a) wrt a. 21a2 Differentiate f3 - 2f*3 + 1206 - 1216 - 32f*4 wrt f. -128f*3 - 3f*2 Let v(x) be the second derivative of 1/15x*6 + 0 + 0x*3 + 0x*5 - 5x + 0x2 - 1/12x*4. What is the third derivative of v(w) wrt w? 48w Let x(v) be the first derivative of 0v4 - v2 - 2 + 0v + 0v*3 - 2	{ "pile_set_name": "DM Mathematics" }
der. -840, -4, -3, 2 Sort -2, 0, 1, -5 in decreasing order. 1, 0, -2, -5 Sort 0.3, 1/5, 2/253. 2/253, 1/5, 0.3 Sort -3, 52, 1, 80 in descending order. 80, 52, 1, -3 Sort -79, 5, 6, 0. -79, 0, 5, 6 Put 100, 6, 5, 2 in descending order. 100, 6, 5, 2 Put 1/11, -1/5, 2/3, -0.5 in decreasing order. 2/3, 1/11, -1/5, -0.5 Sort -0.03, 5, -1/4 in increasing order. -1/4, -0.03, 5 Sort -0.3, -0.1, 2/9, 0.5 in descending order. 0.5, 2/9, -0.1, -0.3 Sort -0.07, 1/3, -1/3, -5, -0.73. -5, -0.73, -1/3, -0.07, 1/3 Put -0.035, 3, 0.04, 0.2 in decreasing order. 3, 0.2, 0.04, -0.035 Sort 4, 3, -12, 5, -7 in decreasing order. 5, 4, 3, -7, -12 Sort -1, -177, 1 in decreasing order. 1, -1, -177 Sort -3, 2, -4, 0. -4, -3, 0, 2 Put 2, -3, -74 in descending order. 2, -3, -74 Put 160, 2, 0.1 in descending order. 160, 2, 0.1 Sort 0, 4, -28, 2. -28, 0, 2, 4 Sort -8, -12, -17, 3/4. -17, -12, -8, 3/4 Sort -1, 4, -5, 0. -5, -1, 0, 4 Sort -3, -9315, 0.5, 4/5, -1/6 in decreasing order. 4/5, 0.5, -1/6, -3, -9315 Sort 1, 0, -1 in decreasing order. 1, 0, -1 Put 1, -1, 15, 12 in decreasing order. 15, 12, 1, -1 Sort 5, -2252, -1/4, -0.4 in ascending order. -2252, -0.4, -1/4, 5 Sort 6, 4, 2, 5 in decreasing order. 6, 5, 4, 2 Sort 8, -4, 10 in descending order. 10, 8, -4 Sort 3, 1, -8394. -8394, 1, 3 Put 3, 2, 5, -0.03 in increasing order. -0.03, 2, 3, 5 Sort -0.2, 4, 1/4, 1704 in descending order. 1704, 4, 1/4, -0.2 Sort 2, 0.0126, 5. 0.0126, 2, 5 Sort 9, 4, -5, 2 in decreasing order. 9, 4, 2, -5 Sort -491, -1, 1, 2, 0. -491, -1, 0, 1, 2 Sort -2, -18, 13.3 in descending order. 13.3, -2, -18 Sort 340.8, 2, -0.3 in descending order. 340.8, 2, -0.3 Sort 1377, -4, 3, 5, -3 in ascending order. -4, -3, 3, 5, 1377 Put -293, 2, 0, -1 in ascending order. -293, -1, 0, 2 Sort 4, 1397, -3/4 in ascending order. -3/4, 4, 1397 Put -1, -24, 0, 2/7 in decreasing order. 2/7, 0, -1, -24 Sort -4, 14, -20 in ascending order. -20, -4, 14 Sort 195, 3, 0 in increasing order. 0, 3, 195 Sort -130, -1, 3, -5 in descending order. 3, -1, -5, -130 Sort -0.1, 7/5, -4, 3, -5 in decreasing order. 3, 7/5, -0.1, -4, -5 Sort -1, -0.4, -22, -12.2 in decreasing order. -0.4, -1, -12.2, -22 Put 14/3, 5, -2/9, 0.06 in descending order. 5, 14/3, 0.06, -2/9 Sort -3, 30, 0 in decreasing order. 30, 0, -3 Put -6, -34, 4 in ascending order. -34, -6, 4 Sort 176, 2, 3. 2, 3, 176 Put -9/14, -6, -3 in ascending order. -6, -3, -9/14 Sort -54, -1/4, -4, 0.4 in descending order. 0.4, -1/4, -4, -54 Sort -1, -5, 0, -6 in descending order. 0, -1, -5, -6 Put 5, -149, 0, 4 in ascending order. -149, 0, 4, 5 Sort 7/3, -6, 2/17, -5, 0. -6, -5, 0, 2/17, 7/3 Sort -4, -5, 3, 2, -34 in increasing order. -34, -5, -4, 2, 3 Sort 4, -2.2, 5/4, -0.4, -5. -5, -2.2, -0.4, 5/4, 4 Sort -0.4, 1/3, -2.1 in decreasing order. 1/3, -0.4, -2.1 Sort 5, -1.99, -6/7 in descending order. 5, -6/7, -1.99 Put 3, -4, -5 in ascending order. -5, -4, 3 Sort 0.2, -0.3, 4, -2 in ascending order. -2, -0.3, 0.2, 4 Sort 0.7, 4, 11 in decreasing order. 11, 4, 0.7 Sort 7, 4, -2, 2/5. -2, 2/5, 4, 7 Put -8/3, -5, 0.08, -4 in increasing order. -5, -4, -8/3, 0.08 Sort 3, 1, 4, 5 in increasing order. 1, 3, 4, 5 Sort -3, -5, 5, 52 in descending order. 52, 5, -3, -5 Put -9, -26, 0, -3 in increasing order. -26, -9, -3, 0 Sort 1, -1, 1/8, 0.1 in descending order. 1, 1/8, 0.1, -1 Sort 4, 3, -161, -5. -161, -5, 3, 4 Sort 2, 5, 1.15. 1.15, 2, 5 Put -2, 1, 3/5, -0.18, -1.3 in descending order. 1, 3/5, -0.18, -1.3, -2 Sort 9, -76, 4/7, 2/3 in decreasing order. 9, 2/3, 4/7, -76 Put -3/5, 0.1, 3, -823 in descending order. 3, 0.1, -3/5, -823 Put -3, 3, 5, -28, -2 in descending order. 5, 3, -2, -3, -28 Put 2/3, 2/9, -6/13, 0.5 in descending order. 2/3, 0.5, 2/9, -6/13 Put 3/2, -11/6, -0.3, 0.4, -0.5 in descending order. 3/2, 0.4, -0.3, -0.5, -11/6 Sort -29, 0.1, -3, 2 in descending order. 2, 0.1, -3, -29 Put -0.04, 0.3, 2/9, 5/3, -1/2 in decreasing order. 5/3, 0.3, 2/9, -0.04, -1/2 Put 2/9, -0.5, -2/15, -1/3 in ascending order. -0.5, -1/3, -2/15, 2/9 Sort -2/33, 0.1, -2, 7. -2, -2/33, 0.1, 7 Sort -17.6, -2/3, -2/107 in descending order. -2/107, -2/3, -17.6 Sort 4, -257, 2/7, 1, 0 in descending order. 4, 1, 2/7, 0, -257 Put 2, -8, 42 in descending order. 42, 2, -8 Sort -5, 3, 21 in descending order. 21, 3, -5 Put 5, 3/7, 1/48 in decreasing order. 5, 3/7, 1/48 Sort 5, -14, -3, -2, -18 in decreasing order. 5, -2, -3, -14, -18 Put -5, 313, 1 in increasing order. -5, 1, 313 Put 4, -2, 11 in decreasing order. 11, 4, -2 Put 0, 5, -2, -71, 3 in decreasing order. 5, 3, 0, -2, -71 Put 3, -4, 13 in decreasing order. 13, 3, -4 Sort -3, -2, -5, -1, 151 in decreasing order. 151, -1, -2, -3, -5 Put 6, 44, -4 in increasing order. -4, 6, 44 Sort -2, -0.6, 0.02, 5, 2. -2, -0.6, 0.02, 2, 5 Put 1, -4/3, -8, 2/5 in decreasing order. 1, 2/5, -4/3, -8 Sort -2, -3, 3. -3, -2, 3 Sort 5, -66, -2 in decreasing order. 5, -2, -66 Sort -0.5, -34, 0.36, 3. -34, -0.5, 0.36, 3 Sort 3, 4, -61, -5. -61, -5, 3, 4 Sort 3, 15, -15, -20 in descending order. 15, 3, -15, -20 Sort -4, -32, -1 in descending order. -1, -4, -32 Sort -2/3, -3/5, -0.2, -1.2 in descending order. -0.2, -3/5, -2/3, -1.2 Sort 238, -5, 1 in decreasing order. 238, 1, -5 Sort -3, 1536, 4 in descending order. 1536, 4, -3 Sort -1, -2, 92, -3 in decreasing order. 92, -1, -2, -3 Sort 24/7, 5, 1/8, 4 in decreasing order. 5, 4, 24/7, 1/8 Sort 5, -9, 2, 3 in descending order. 5, 3, 2, -9 Put 2, 1291, -5 in ascending order. -5, 2, 1291 Put -6, 2, 4, -5 in decreasing order. 4, 2, -5, -6 Sort 18, -2, -5, -1, 3. -5, -2, -1, 3, 18 Sort 27, -3, -2, 5/4, -0.3. -3, -2, -0.3, 5/4, 27 Sort -3, 4, -2, -5, -13 in ascending order. -13, -5, -3, -2, 4 Put -782, -4, 3/2, -2/7 in decreasing order. 3/2, -2/7, -4, -782 Put -4, -15, -11 in increasing order. -15, -11, -4 Sort -1, -5, -3, 63 in increasing order. -5, -3, -1, 63 Put 238, 2, -1 in descending order. 238, 2, -1 Put -0.17, 4, -56, -0.4 in ascending order. -56, -0.4, -0.17, 4 Sort 258, 20, -2 in descending order. 258, 20, -2 Put -3, -6, 3, -5 in decreasing order. 3, -3, -5, -6 Sort -5, -770, -4 in descending order. -4, -5, -770 Put 1/6, 0, 11, -2, 2/19 in descending order. 11, 1/6, 2/19, 0, -2 Sort 4, -0.4, -3/4, -51.7 in descending order. 4, -0.4, -3/4, -51.7 Sort 7.6, 3, 0.5, -0.1 in ascending order. -0.1, 0.5, 3, 7.6 Sort 5, 2, -2, -3, -427. -427, -3, -2, 2, 5 Put 2/21, -7, -9 in descending order. 2/21, -7, -9 Sort 0.1, -2, 1, 36 in ascending order. -2, 0.1, 1, 36 Put 12, 31, -1/3 in decreasing order. 31, 12, -1/3 Sort 90, -33, 2 in ascending order. -33, 2, 90 Put 4, 1, -1/6, 1/2 in decreasing order. 4, 1, 1/2, -1/6 Sort 0, 1, -4, 1/4 in increasing order. -4, 0, 1/4, 1 Put 3, 5, 7 in increasing order. 3, 5, 7 Put 110, -4, 3/5, -3 in ascending order. -4, -3, 3/5, 110 Put 13, -3/2, 0.4 in decreasing order. 13, 0.4, -3/2 Sort 47, 3, -5, -1 in descending order. 47, 3, -1, -5 Sort 4, -5, -1/2, 0.034, 0.4. -5, -1/2, 0.034, 0.4, 4 Sort -2, 2, 4, 63 in descending order. 63, 4, 2, -2 Put 14, 25, 4 in decreasing order. 25, 14, 4 Sort -0.3, 41, -1/2, -1/4, -0.42 in increasing order. -1/2, -0.42, -0.3, -1/4, 41 Put 2/3, 2/7, -0.06, 0.05 in ascending order. -0.06, 0.05, 2/7, 2/3 Sort -370, 12, 4 in descending order. 12, 4, -370 Sort -1/13, 14, 5, 0.5 in ascending order. -1/13, 0.5, 5, 14 Sort -3, -26, -14 in increasing order. -26, -14, -3 Put 2, -32, 1, -6, -4 in decreasing order. 2, 1, -4, -6, -32 Put 2/3617, 0.5, 3, -3/4 in ascending order. -3/4, 2/3617, 0.5, 3 Sort -2, 4, 3, -3, 5 in descending order. 5, 4, 3, -2, -3 Sort -28, -3, 42 in decreasing order. 42, -3, -28 Sort -3, -1, 68 in decreasing order. 68, -1, -3 Sort -5, 2, -2, -51, 5 in decreasing order. 5, 2, -2, -5, -51 Sort 3, 8, -3, -25. -25, -3, 3, 8 Put -2/17, -0.3, 9/11 in increasing order. -0.3, -2/17, 9/11 Put -84, -5, -20, 1, 5 in increasing order. -84, -20, -5, 1, 5 Sort 65, -6, -1, 2/11. -6, -1, 2/11, 65 Sort -0.4, 1, 3, -0.03, 0 in decreasing order. 3, 1, 0, -0.03, -0.4 Put 5, 30, 0.3 in descending order. 30, 5, 0.3 Put 3, 4, 5 in descending order. 5, 4, 3 Sort -7, 5, 0, 1 in decreasing order. 5, 1, 0, -7 Sort 1, -1, 3, -87, -4. -87, -4, -1, 1, 3 Put -1, -0.3, -2/59 in increasing order. -1, -0.3, -2/59 Sort 2/5, -0.18, 2/27. -0.18, 2/27, 2/5 Put -2/7, -0.4, -0.2, 4 in desce	{ "pile_set_name": "DM Mathematics" }
base 2. 111100001110000111011 Convert 371874 (base 14) to base 16. 1cca4e Convert 301132200 (base 4) to base 8. 613640 What is 5333486 (base 9) in base 2? 1010111001011010110000 What is -1100100011001111 (base 2) in base 6? -1033555 -24200152 (base 6) to base 14 -15ba4c 6120729 (base 10) to base 11 350065a 28447 (base 10) to base 15 8667 What is 3011313003 (base 4) in base 10? 810435 Convert 1113250051 (base 6) to base 14. 1897b31 What is -120e27e (base 15) in base 4? -301123120022 Convert -ed950 (base 16) to base 12. -3ab1a8 What is 20503651 (base 7) in base 11? a83702 Convert 214020554 (base 6) to base 9. 7174757 Convert 2b97e6 (base 15) to base 6. 113102143 10c43 (base 15) to base 10 53388 Convert -2303124 (base 6) to base 7. -666046 What is -1010112221222 (base 3) in base 7? -5053226 What is -1200261 (base 8) in base 10? -327857 Convert 4052033 (base 6) to base 4. 233100111 What is -36207 (base 11) in base 4? -30232332 What is -22310112030 (base 4) in base 6? -140440540 What is 522545 (base 6) in base 3? 2010202202 Convert 751811 (base 10) to base 15. ecb5b What is -30014455 (base 6) in base 3? -1120210012122 Convert 66652515 (base 7) to base 9. 11750466 What is -113220223 (base 4) in base 2? -10111101000101011 -1324889 (base 11) to base 16 -22f2d1 -6165011 (base 7) to base 14 -153378 7a72 (base 15) to base 16 657e -ccc1 (base 13) to base 4 -12332011 Convert 27a48 (base 15) to base 3. 20110110212 What is -565412 (base 7) in base 12? -4a0b5 What is -154545440 (base 6) in base 12? -1138280 Convert -111302303 (base 4) to base 8. -256263 What is 13547432 (base 9) in base 2? 11001100100110001101101 -dc31b (base 14) to base 3 -1000002001212 695132 (base 11) to base 4 10031233312 What is -13384 (base 10) in base 15? -3e74 1f722 (base 16) to base 13 4681b What is -1209909 (base 10) in base 12? -4a4219 What is -22100312 (base 5) in base 6? -4030523 Convert 5325321 (base 8) to base 15. 1d0b0a Convert 133202002223 (base 4) to base 11. 4736324 Convert 19895 (base 15) to base 11. 57350 Convert 22112022010011 (base 3) to base 11. 2616796 What is 11111011101000110 (base 2) in base 5? 13110323 What is 28e28 (base 15) in base 9? 220262 What is 1243304 (base 6) in base 14? 1aba0 Convert -1d1d5 (base 14) to base 8. -221347 211776 (base 11) to base 6 11133244 Convert -211303233223 (base 4) to base 7. -150146563 What is -56cd1 (base 14) in base 12? -a219b What is -142414434 (base 6) in base 11? -1719473 Convert -12537732 (base 8) to base 4. -22223333122 Convert 35691 (base 15) to base 8. 514374 Convert -304144421 (base 5) to base 10. -1240611 -135241 (base 6) to base 9 -18547 What is 4102444 (base 5) in base 4? 100013033 11013144120 (base 5) to base 6 1101552410 What is 3307111 (base 8) in base 14? 191a89 Convert -143040025 (base 6) to base 12. -ba0015 Convert 1424351 (base 10) to base 15. 1d206b Convert -42ba9ab (base 12) to base 6. -1131542335 12306113 (base 7) to base 14 20d043 Convert 63065356 (base 7) to base 10. 5310514 1d030 (base 14) to base 7 426060 Convert 1353bb0 (base 13) to base 4. 113033110312 What is -d6608 (base 14) in base 10? -517056 What is -16b585 (base 16) in base 12? -5b9319 What is -3225314 (base 6) in base 5? -20044220 -3905b75 (base 12) to base 10 -11207753 What is -1ab69b9 (base 12) in base 11? -3253192 Convert 34a1b9 (base 12) to base 4. 3032302131 What is 1097c (base 15) in base 10? 52767 2524301 (base 6) to base 12 66691 What is 19a96b9 (base 12) in base 3? 101020212011020 Convert -343135045 (base 6) to base 9. -12778462 What is 45882 (base 12) in base 3? 11201100022 -2066211 (base 7) to base 14 -67b08 Convert -4b9542 (base 15) to base 14. -6a5597 Convert 69a322 (base 12) to base 14. 3227d8 11440410020 (base 5) to base 6 1203350501 What is 100233101 (base 4) in base 12? 33815 Convert 31241132 (base 5) to base 9. 434145 -122001211121 (base 3) to base 9 -561747 What is 396a6 (base 16) in base 10? 235174 What is 20110220100022 (base 3) in base 4? 31020132131 -71321 (base 13) to base 9 -337885 -13890 (base 12) to base 14 -9c96 Convert 354b25 (base 13) to base 12. 511516 Convert -11202112111 (base 3) to base 13. -3385c Convert -30d2c3 (base 16) to base 7. -36124344 What is -20200324 (base 6) in base 10? -575548 -1782350 (base 9) to base 3 -1212202101200 -5ea5 (base 15) to base 16 -4ed4 What is -1740104 (base 8) in base 13? -14a29a Convert 1210113332 (base 5) to base 10. 2816717 1110111000100101 (base 2) to base 16 ee25 What is 3df95 (base 16) in base 4? 331332111 24434 (base 10) to base 11 173a3 98205d (base 14) to base 5 2304401230 What is 26076b (base 12) in base 5? 124420141 What is 12144020 (base 7) in base 9? 2035525 218505 (base 10) to base 9 362653 290566 (base 11) to base 7 3602133 What is -3875a18 (base 11) in base 10? -6713462 What is 1288172 (base 11) in base 14? 41b8c7 ada788 (base 14) to base 7 101130231 What is 1122cda (base 15) in base 6? 1114443241 What is 1912913 (base 10) in base 4? 13103001101 What is a9e3 (base 15) in base 12? 189b0 2a1a02 (base 11) to base 14 c394b -828367 (base 9) to base 4 -1320002002 Convert 1b8aa (base 13) to base 11. 37811 87a97a (base 13) to base 11 1891662 Convert -1100100101001010100011 (base 2) to base 11. -1952891 1010010101101110101011 (base 2) to base 13 73b918 2013303212 (base 4) to base 2 10000111110011100110 What is -1020200120202002 (base 3) in base 2? -1000100010010111011011100 Convert -103030333303 (base 4) to base 5. -2242041341 Convert 10000110100101111110 (base 2) to base 7. 4454162 Convert 664274 (base 13) to base 3. 11112100121222 212320223 (base 4) to base 14 4208b What is 7082964 (base 10) in base 7? 114130020 Convert -6079475 (base 11) to base 16. -a3f24e What is -30d78 (base 15) in base 5? -14424123 5b586b (base 13) to base 15 2d1c77 What is -77b00 (base 12) in base 4? -212301300 356b8 (base 15) to base 2 101001100100100001 What is -10100102012021 (base 3) in base 12? -719a67 Convert -33212344 (base 5) to base 14. -771b4 Convert -5052505 (base 9) to base 16. -291326 What is -40120131 (base 5) in base 13? -b1332 What is -21203133 (base 5) in base 8? -534557 Convert -12015535 (base 6) to base 16. -5bc13 What is 102425 (base 11) in base 4? 220012000 Convert 18070 (base 14) to base 11. 4147a 1323011210 (base 4) to base 10 504164 Convert -30311a (base 11) to base 5. -111043123 What is 5804387 (base 11) in base 14? 14c39c7 Convert -129386 (base 11) to base 12. -99415 Convert -45609 (base 11) to base 6. -1225202 7425 (base 14) to base 4 10320321 1120254 (base 7) to base 8 420203 1302d6 (base 15) to base 12 37b879 Convert 8a339 (base 15) to base 5. 103030404 Convert -5124875 (base 9) to base 7. -32141645 400a5 (base 13) to base 2 11011111011001011 What is 53de7 (base 15) in base 13? 94339 670a7 (base 11) to base 6 2030212 Convert 110111101111000101000 (base 2) to base 15. 261214 What is 5350331 (base 6) in base 7? 2144251 75c5c9 (base 14) to base 2 1111001110010110010101 -2434605 (base 13) to base 9 -23122473 Convert -223047 (base 10) to base 8. -663507 What is 26756a (base 13) in base 6? 31534440 Convert -713581 (base 10) to base 6. -23143341 -2201101200010 (base 3) to base 10 -1444638 Convert 156b75 (base 14) to base 5. 142424002 7227887 (base 10) to base 9 14535715 What is 20112320200 (base 4) in base 12? 897a54 What is -2c6242 (base 14) in base 16? -17b492 What is -3883277 (base 9) in base 12? -86395a What is 4151334 (base 10) in base 9? 7726503 Convert 57aa7 (base 13) to base 7. 1234335 What is 131542 (base 10) in base 16? 201d6 What is 167009 (base 10) in base 15? 3473e -4a880 (base 14) to base 16 -2ca00 What is 3932ab (base 12) in base 13? 26b376 What is -203421010 (base 5) in base 8? -3154425 -637177 (base 9) to base 15 -77571 Convert -1000010032 (base 4) to base 14. -6b8bc 48c42a (base 14) to base 6 125230434 -131032100 (base 4) to base 3 -20002012012 12110021102 (base 3) to base 5 11413423 Convert 3636641 (base 7) to base 15. 92468 -15430433 (base 6) to base 8 -2057025 Convert -2212212012122 (base 3) to base 14. -2bc6d0 Convert -54638 (base 9) to base 16. -8d92 550704 (base 13) to base 4 13220121021 -5931031 (base 10) to base 7 -101261431 What is -1112012021 (base 3) in base 16? -754f Convert -11420031241 (base 5) to base 14. -1adbb35 What is -4a651 (base 13) in ba	{ "pile_set_name": "DM Mathematics" }
(1503/152) Simplify t/t*(2/7)t*17t*(-12)/(t(t/(t/(t*(-5)tt)t)t)/tt) assuming t is positive. t*(54/7) Simplify (((cc*(3/5)c)(-27))(-13/2))11 assuming c is positive. c(50193/10) Simplify ((k/(((kk(-2/19)kk)/k)/k)kk)/(k29/k))/(k(4/9)/kkk/(k(-1/61)k)) assuming k is positive. k*(-274915/10431) Simplify (aa*14)/(aa*(-15))a(-1/3)/a(-3/5) assuming a is positive. a(439/15) Simplify (s3/((ss(1/5)/s)/ss))/(s(-5/6)/((s/s(2/9)ss)/ss)) assuming s is positive. s(577/90) Simplify (p(-3/11)/pp)*(2/129)p(-16)/(p(-2/7)/p) assuming p is positive. p*(-48733/3311) Simplify (vv/(v/(v(2/23)/v)))(-41)/((vv/(v/(vv20)))/v(-2/55)) assuming v is positive. v*(-32386/1265) Simplify (y/((y/(yy*3))/y)y*(2/3)/yyy(-5/3)yy(-5/4))(-38) assuming y is positive. y(-285/2) Simplify (t(-1/2))19(t/t(-2/3))(6/7) assuming t is positive. t(-113/14) Simplify (r10r3)/((r/(r(r*(-1/14)rr)/r))/r(1/13)) assuming r is positive. r(2549/182) Simplify (cc(2/7))(-10/7)cccc*1cc14/c assuming c is positive. c(792/49) Simplify (p/(p(6/13)/pp))/(pp(5/2)/p)p*6/pp(-12)/p assuming p is positive. p(-259/26) Simplify (((rr(-3/4)/rr)/(r/r(1/11)))/(r(-1/3))(-45))18 assuming r is positive. r(-6201/22) Simplify (x3)*(-47)/(xx*(-4)x/x(1/5)) assuming x is positive. x(-694/5) Simplify b*28/(bb*4)((b/b*(1/21))/b)/(bb(-7/4)) assuming b is positive. b(1991/84) Simplify ((k*0k)/(k/(k*13k)))/((kk(-2)kk)/kk(-9/2)) assuming k is positive. k(37/2) Simplify (d*(18/13)/dd((d(1/27)d)/d)/d)40 assuming d is positive. d(5920/351) Simplify (r*(-11)/(rr*(1/3)))/((rr/(r*(-6/7)rrr)rr)/(r*(-2/29)rrr)) assuming r is positive. r*(-6857/609) Simplify (jj/j*(2/11)j)(24/5)/((j/((j/j(3/8)j)/jj))/(((j/(j(j(-1/17)j)/j))/j)/j)) assuming j is positive. j*(91339/7480) Simplify (ppp(-11))/pp*(-6)pp/(p/(p/(p(-8/3)p)))(p(-1)/p)/p assuming p is positive. p(-46/3) Simplify ((v/(v/(v/(vv(-2/7)))))(2/105)/((v/(v/(v*(-2)/v))v)/vv)(-16))(-35) assuming v is positive. v(23516/21) Simplify (((y/(y/(y(-1/10)/y)y))/y)/y*(-5)(((yy(-1/6)yy)/y)/y)(-2/3))44 assuming y is positive. y(2662/45) Simplify ((b/(b(-30)/b)b)/(b/(b*(-1/21)b)))38 assuming b is positive. b(26296/21) Simplify ((w/w*4ww(w/(ww(-1/4)))/w)/((w(2/11)w)/(ww(-4))))(4/25) assuming w is positive. w(-261/275) Simplify (((tttt(2/13))/(t(-1)/t))(4/5))(-46) assuming t is positive. t(-12328/65) Simplify (a/((a(-12)a)/a)a)*16a(2/25)/(a/a15) assuming a is positive. a(5952/25) Simplify ((m/m(1/10)m((m*(-5)m)/m)/mm)/(m/(m/((m/m(-1/9))/mmm)m)m(-3)))(-2/11) assuming m is positive. m(109/495) Simplify (o1)(3/7)/(oo2)(1/7) assuming o is positive. 1 Simplify (g/(g*25/gg)gg/(g/g*(6/7))g)/(g*20/gg/g(-2/17)) assuming g is positive. g(-4910/119) Simplify (((nn/n(-1/9))/n(-3/8))/((n/(n/((n/n(2/7))/n)))/(n/(n/(n/(((n5/n)/nn)/nn))n))))46 assuming n is positive. n(-14237/252) Simplify (v10)35(v/v(2/7))/(v/(vv*(2/15)/vv)) assuming v is positive. v(36839/105) Simplify ((m(-5)mm)/mm)(-1/39)/(mmm(-1))46 assuming m is positive. m(-597/13) Simplify (i/(ii2))(2/19)/(i/i*(-9)i*(6/11)ii) assuming i is positive. i(-2666/209) Simplify (v/(v/(v/v(-1/24))))(-28)(vv(v/v(2/65))/v)/(v/(v/(v/(v4/v))v)) assuming v is positive. v(-9437/390) Simplify (v(-15))12v*(3/10)v/(vv/v21v) assuming v is positive. v(-1607/10) Simplify z20zz*(1/8)/zz(z(7/9)/z)/z18 assuming z is positive. z(209/72) Simplify ((w(-6/11)wwww/(w/(w(-12)w)w))(-3/35))24 assuming w is positive. w(216/11) Simplify (f1ff/f(-1/5))/(f(-7/2)f*12f) assuming f is positive. f(-63/10) Simplify w15ww*9((w*(2/3)w)/w)47 assuming w is positive. w(169/3) Simplify ((kkk*(-2)kk)(-40)k(2/3)/k6)(-2/121) assuming k is positive. k(512/363) Simplify q/(q/q*23)qq12qq(2/21)q(q/(q/q(-12)))/q assuming q is positive. q(527/21) Simplify (u(-2/9))(-32)/((u/(u(-6)/u))/u(-12)) assuming u is positive. u(-116/9) Simplify ((o(-19)ooo*(-10/3)o)(-31))(-2) assuming o is positive. o(-3596/3) Simplify p(-3/4)/p*(3/8)p*11pppp(-1/10)/pp assuming p is positive. p*(511/40) Simplify ((b/(b/(bb*(-3/5)b)))/(bb21/b))/(b(-4/7)/(b(-28)/b)) assuming b is positive. b(-1681/35) Simplify ((b(2/13)b(-3))35)(10/11) assuming b is positive. b(-12950/143) Simplify ((t*(1/28)t)/(t/(t/t(-9/4))))(-26) assuming t is positive. t(-598/7) Simplify i(-3/5)i(2/13)/iii3i3 assuming i is positive. i(361/65) Simplify (((d/d*10)/(ddd/(dd/(d(-2/25)/d))))38)(-47) assuming d is positive. d(398278/25) Simplify (ll/((l/(ll/(ll(-21))))/l)l)/(l*5ll)l(9/2)/l17 assuming l is positive. l(11/2) Simplify (((l/(l7/ll))/ll/((l/((l/l(-5))/l))/l))(1/32))(2/65) assuming l is positive. l(-1/1040) Simplify ((q/((q/(qq/(qqq(q/q*(-1/4))/qq)))/q))/(q*(1/3)qq)(q*(-2/5)q)/q6)25 assuming q is positive. q(-2695/12) Simplify (((c/((c/c(1/2))/c))/(cc(1/2)c))/((c*(-6)c)/c(-2/17)))21 assuming c is positive. c(1386/17) Simplify (l/l(2/25))/((ll6/l)/l)l33/l(-36) assuming l is positive. l(1623/25) Simplify (a(-11))*25/((aa*(-23))/aa13) assuming a is positive. a(-265) Simplify (q(-5))10q(3/2)q(-9) assuming q is positive. q(-115/2) Simplify ((d*(-5)(dd(10/3)d)/d)/(d(-1/5)/d(2/7)))36 assuming d is positive. d(-228/35) Simplify (v/v*(-12)v(v/v(2/9))/vv)/(vvv*21vv7v) assuming v is positive. v*(-155/9) Simplify (mmm(1/8))(-46)(mm(1/7))(3/31) assuming m is positive. m(-84751/868) Simplify k(-4/15)k(k6/kk)/k(kk(-2/89))(-3/23) assuming k is positive. k(172127/30705) Simplify ((y0)*(8/13)(yy(1/10)y)/(y*(-8)y))(-46) assuming y is positive. y(-2093/5) Simplify (t/(tt(4/5)t)(ttt(-2/9)t)/t)/((tt/(tt/t(-1)))/t(-2/3)) assuming t is positive. t*(14/45) Simplify ((xx/(x*0/x)x)/x)/(x*(-12)x)(x/x(-4))(-50) assuming x is positive. x(-236) Simplify r(r/((r*(-4/3)/r)/rr))/rr/((rr*(-2/3)/rr)/r)(rr(4/3))/(r/(r(-3)r)) assuming r is positive. r(13/3) Simplify (qq((q/((q/(q/q(-4)))/q)q)/q)/q)/(q*0q)(q3q)(-3/11) assuming q is positive. q(54/11) Simplify (y/(y/((y*16y)/y)))/yyy*(2/7)((y*(3/7)yy)/y)/y(-1) assuming y is positive. y(131/7) Simplify (g/g(-5))/(g/((g/(g(-3/4)/gg))/ggg))(g/g10)/(gg(-9/5)) assuming g is positive. g(-9/20) Simplify (q(q(q/q*6)/q)/qqq33/q)/(q/q(-2/53)q)(-3/13) assuming q is positive. q(19616/689) Simplify (q/((q/((qq(4/7))/q))/q)q*0)/(qq*(-27)(q*(-6)q)/qq) assuming q is positive. q(228/7) Simplify (r(2/11))(4/3)r*(-13)r/(r/(rr(-1))r) assuming r is positive. r(-454/33) Simplify ((b2b/(b/(b(3/4)bb)))/((bb/b*1b)/b)(14/9))(-19) assuming b is positive. b(-2185/36) Simplify a(2/3)aa((a6a)/aa)/aaa7a(-3) assuming a is positive. a(41/3) Simplify s*(3/7)ss11(s*(-2/7)s)/sss(ss/(ss(4/17)))/s assuming s is positive. s(1655/119) Simplify ((bb13)/(b/b0))/((b/(b/b*(2/27)))/(bb12)) assuming b is positive. b(700/27) Simplify ((y(2/7))(2/41)/(y*(2/11)yyyy4))(-4/23) assuming y is positive. y(90516/72611) Simplify (((yy(-2))11)(-50))50 assuming y is positive. y27500 Simplify b(2/21)/b*16(b/((bb/b(-5)b)/bb)b)(-1/11) assuming b is positive. b(-3548/231) Simplify ((d/d(-31))/(d/((d/d24)/d)d))/(d(-5/2)/(d/d(-1/7))) assuming d is positive. d(135/14) Simplify ((qq*0qqq)*(-10/9)q*2q(-4))(-13) assuming q is positive. q(754/9) Simplify (g(3/7)/(g((g/g(-1/3))/g)/g)g5/g(-4))(-3/14) assuming g is positive. g(-191/98) Simplify i(-9)/(i5i)i*(-1/6)iii/(i/(i(-1/16)/i)) assuming i is positive. i(-683/48) Simplify (d1)(-39)d12d**(-2/39) as	{ "pile_set_name": "DM Mathematics" }
of 13 and c. 13 Let c = 23 - -17. Let m(x) = x*3 - 9x*2 + 10. Let h be m(9). What is the highest common divisor of h and c? 10 Suppose q + 4i - 10 = -2, 3q = 5i - 10. Suppose q = -r + 5r + 12. Let b = r - -8. What is the greatest common divisor of b and 55? 5 Suppose 2a - 2w - 11 = 47, w = 3a - 97. Let p = -18 + a. What is the highest common divisor of p and 8? 8 Let i be 31 - (2 - 3)/1. Let x be i/4010/1. Let u be (4/6)/(1/3). Calculate the greatest common factor of x and u. 2 Let r = -88 + 138. What is the greatest common divisor of r and 20? 10 Let t(b) = -12b + 2b + 8 - 8. Let u be t(-4). Let k = 26 - 18. Calculate the highest common factor of k and u. 8 Suppose -i = -5i + 64. What is the highest common divisor of i and 2? 2 Suppose 2o - 7 = -0o + 5a, o - 6 = 5a. Let i be (3 - o) + -3 - -13. What is the highest common factor of i and 36? 12 Let d = 9 + -5. Suppose -k = dk - 90. What is the highest common divisor of k and 9? 9 Let q(j) be the second derivative of -7j3/3 - j2 + 5j. Let x be q(-7). Calculate the greatest common divisor of x and 12. 12 Let v be 168 + 6(-2)/(-4). Suppose 2u - 5u = -3d - 93, d = 5u - v. Calculate the greatest common divisor of 14 and u. 7 Suppose 2b - 3 - 3 = -4l, 5l - 3b = -9. Suppose s + ls = 1. Let m be (-4 + 3/s)-18. What is the greatest common divisor of m and 6? 6 Suppose -f + 6f = 30. Let r(k) = -k3 + 6k*2 + 3k. Let a be r(f). Calculate the highest common divisor of a and 144. 18 Let f(p) = 2p - 2. Let a be f(2). Let q = 3 + a. What is the highest common divisor of 5 and q? 5 Let h = -42 - -82. Suppose -4u + 267 = -u. Suppose -5v + 5b = -55, -2b + u = 4v + 3b. What is the greatest common divisor of h and v? 8 Suppose -23 + 83 = 2n. Suppose -107 = -5l + 5d - 32, -2d = 3l - 45. Calculate the highest common factor of l and n. 15 Let b(u) = u*3 - 7u*2 - 2u - 25. Let j be b(8). What is the greatest common divisor of 69 and j? 23 Let s(k) = k + 4. Let a be s(6). Suppose 5c + 247 = -4u, -4c = -4u - 220 - 0. Let w = u - -128. What is the highest common divisor of w and a? 10 Let h(x) = -x*2 - 13x - 10. Let p be h(-11). What is the highest common factor of 12 and p? 12 Suppose 5k - 40 = -2r, -3r = -5k - 6r + 40. Suppose -2d = 0, 0 = 4x + d - 4d - k. What is the highest common factor of 2 and x? 2 Let m be (1 - 0 - 0) + -17. Let j be m-3(-3)/(-6). What is the highest common divisor of 36 and j? 12 Suppose -w + 4w - 5 = 4s, 4s = 2w - 2. Suppose -j + 196 = wj. Suppose 0 = 3x - 4 - 17. What is the greatest common factor of x and j? 7 Let u(b) = -b*2 - 11b - 6. Let g be (-3 + 2)1 - 3. Let m be u(g). Let i be 10/55 + (-60)/(-33). Calculate the highest common factor of m and i. 2 Let d be (-21)/(-2)(0 + 2). Let y = 3 - 0. Calculate the greatest common divisor of d and y. 3 Suppose 0 = -g + 5o + 88, 5g - 4o - 412 = 28. Calculate the highest common divisor of 11 and g. 11 Suppose 3m = 8m - 255. What is the greatest common factor of m and 153? 51 Suppose -25 = -3k + 8. What is the greatest common factor of k and 88? 11 Let f = 19 + -9. Calculate the highest common factor of 10 and f. 10 Let i(f) = 3 - f - 3 + 3. Let g be i(-5). Calculate the greatest common divisor of 24 and g. 8 Let p = 0 - -2. Let b be -1 + (-3 - (-50)/p). Suppose -43 - b = -2d. What is the greatest common factor of d and 8? 8 Let z(g) = -83g - 1. Let q be z(-1). What is the highest common divisor of q and 205? 41 Let m be (5/2)/((-6)/(-12)). Suppose -2o + 58 = -3r + r, -3o - mr = -71. What is the greatest common divisor of o and 108? 27 Let v(d) = -d*3 - 8d*2 - 3d - 12. Let w be 75/(-10) - 2/4. Let m be v(w). Suppose -7p = -3p - 16. What is the highest common divisor of m and p? 4 Let s = -177 + 282. Calculate the greatest common divisor of s and 42. 21 Let s = -5 + 2. Let h = 0 - s. Let f be 1/((-1)/(-33 + 0)). Calculate the greatest common factor of f and h. 3 Let q be 245/(-21)-13. Let w = 1 - -4. What is the highest common divisor of q and w? 5 Suppose 5k - 2s - 844 = k, 3s = k - 221. Calculate the highest common divisor of k and 19. 19 Suppose -8x + 6x = -154. Calculate the highest common divisor of x and 7. 7 Suppose 4f + 18 = 2h - f, -5h + 45 = -f. What is the greatest common factor of 9 and h? 9 Let q(g) = -5g - 1. Let k be q(-1). Let w be (0 - k)/(2/(-8)). What is the highest common factor of w and 64? 16 Let o = 344 + 72. Let v be (-4)/(-14) + o/14. What is the greatest common factor of 6 and v? 6 Let t(r) = 2r*3 + 1. Let g be t(1). Let u = -150 + 153. What is the highest common divisor of g and u? 3 Suppose -13y - 12 = -14y. Suppose 0 = 3r - 120 + 48. Calculate the greatest common factor of r and y. 12 Let g(h) = 19h2 - 5h. Let b be g(2). Calculate the greatest common factor of b and 6. 6 Let v be (11/(-2))/(2/(-4)). Suppose -79 - v = -5o. What is the highest common factor of o and 18? 18 Suppose 3k - 3 = 15. Suppose 4 = -5r - 6. Let p be (-4)/r - (-1 - 3). Calculate the highest common factor of k and p. 6 Let m = 29 - 15. Suppose -5k + m = -4v, k - 4k + 10 = -2v. Calculate the highest common factor of 4 and k. 2 Let u = 81 - 18. Calculate the greatest common factor of u and 9. 9 Suppose 2w - 2q - 10 = 0, -1 = q + 2. Suppose -3g + 19 = 3a - a, 5g = 5. What is the highest common factor of w and a? 2 Let j = 21 - 15. What is the highest common factor of j and 15? 3 Let h be (-402)/(-5) - (-9)/15. What is the highest common divisor of h and 27? 27 Let j(q) = -5q - 10. Let w be j(-7). Calculate the highest common divisor of 75 and w. 25 Let p be (-8)/(44/80-2 + 1). What is the highest common divisor of p and 200? 40 Let d be 0/(-1) - (-10)/(-5). Let g(x) = 7x2 + x - 2. Let o be g(d). What is the greatest common factor of 3 and o? 3 Let j be 1 + ((-2)/(-2) - -38). Suppose 9q + 8 = 98. What is the greatest common factor of j and q? 10 Suppose 0 = 3d, -2d + 17 + 28 = -5l. Let p(k) = 3 + 1 + 2k - k - 2k. Let n be p(l). Calculate the greatest common factor of n and 91. 13 Let f = -8 - -11. Let d = 18 - f. Calculate the highest common factor of 45 and d. 15 Let q = 24 - 7. Calculate the highest common factor of 136 and q. 17 Let o be (-324)/(-15) - (-4)/10. What is the highest common divisor of 55 and o? 11 Suppose -3s - 2g + 12 = -4, -4g = -s + 24. Calculate the greatest common factor of 32 and s. 8 Suppose 0 = -3a + 29 + 25. Let o = 182 + -128. What is the highest common factor of a and o? 18 Let i = -104 + 108. Calculate the highest common divisor of 12 and i. 4 Let z(m) = m3 - 12m*2 + 4m - 21. Let q be z(12). What is the greatest common divisor of q and 9? 9 Let f(z) = -25z + 2. Let y(c) = -1. Let t(d) = f(d) - 2y(d). Let x be t(-6). Calculate the highest common divisor of x and 14. 14 Let z(k) = -k*2 - 9k - 10. Let n be z(-7). Suppose -3b + nb = 36. Let s be (-1 + -1)/(1/(-2)). What is the highest common factor of s and b? 4 Let z = 3 - 1. Let y be 1/(-2) - 3/(-2). Let w be y/2-2 - -3. What is the highest common divisor of z and w? 2 Let k = 10 - -8. Suppose -3v + 5g = -41, -2v + v + 5g + 17 = 0. Suppose 3i + v = 4i. Calculate the greatest common factor of i and k. 6 Let l = -63 - -72. What is the highest common divisor of 1 and l? 1 Let j(k) = -15k*3 + k. Let p be j(-1). Suppose 5u = 2t + 18, -2u - 5 = 2t - 1. Let b = u + 12. What is the highest common factor of b and p? 14 Let t be (8 - 3)/(2/16). Suppose -o - 3o - 5s + 25 = 0, 4o + 3s - 31 = 0. Calculate the highest common divisor of t and o. 10 Suppose -2g + 4m = -4g + 8, 0 = -3g + 3m + 48. Let b be (-2)/(-9) - 318/(-27). What is the greatest common factor of g and b? 12 Let m(z) = -4z3 - 2z - 1. Let t be m(-1). Let k = t - 2. Let c be k/((5/9)/5). What is the highest common factor of 18 and c? 9 Let p(f) = 2f2 - 9f - 9. Let g be p(7). Let s be (10/3 + (-4)/12)13. What is the greatest common factor of g and s? 13 Let a(z) = 85z*2 + z - 1. Let x be a(1). Let m(b) = -b - 10. Let h be m(-14). Suppose -155 = -ho - 19. What is the highest common factor of o and x? 17 Suppose -5*m + 50 = 5. What is the greatest common factor of m and 81? 9 Let p be 0/2 - (-11 - 2). Let w = -89 + 219. Calculate the highest	{ "pile_set_name": "DM Mathematics" }
16 Convert 6 (base 15) to base 4. 12 34 (base 11) to base 12 31 Convert 1d (base 14) to base 16. 1b What is -44 (base 9) in base 11? -37 3 (base 15) to base 16 3 Convert -221 (base 4) to base 8. -51 -180 (base 10) to base 14 -cc What is 3a (base 14) in base 5? 202 Convert 7 (base 9) to base 8. 7 -2 (base 7) to base 13 -2 Convert -1 (base 15) to base 14. -1 What is -31 (base 4) in base 8? -15 What is -d (base 15) in base 14? -d What is -4 (base 9) in base 5? -4 Convert 320 (base 5) to base 2. 1010101 2210 (base 3) to base 11 69 Convert 3 (base 13) to base 4. 3 -15 (base 8) to base 9 -14 0 (base 10) to base 8 0 -35 (base 10) to base 11 -32 Convert 25c (base 13) to base 4. 12133 3 (base 12) to base 14 3 What is 2 (base 8) in base 4? 2 Convert 14 (base 13) to base 5. 32 Convert 62 (base 14) to base 9. 105 Convert -2 (base 4) to base 13. -2 -112 (base 12) to base 4 -2132 What is 0 (base 9) in base 2? 0 17 (base 13) to base 14 16 -11 (base 4) to base 3 -12 What is -8 (base 16) in base 12? -8 What is 11 (base 7) in base 13? 8 Convert 3 (base 5) to base 13. 3 What is -21 (base 14) in base 2? -11101 14 (base 6) to base 5 20 What is 13 (base 7) in base 9? 11 Convert -11 (base 4) to base 11. -5 Convert 1 (base 5) to base 13. 1 What is 12 (base 5) in base 6? 11 -1 (base 9) to base 5 -1 -11 (base 6) to base 14 -7 4a (base 12) to base 6 134 -2 (base 13) to base 5 -2 Convert 1 (base 3) to base 4. 1 What is 14 (base 15) in base 11? 18 -2 (base 4) to base 12 -2 -39 (base 15) to base 9 -60 What is -2 (base 8) in base 15? -2 What is -2c (base 13) in base 3? -1102 Convert 32 (base 15) to base 12. 3b What is 1011 (base 2) in base 3? 102 267 (base 10) to base 9 326 What is 0 (base 8) in base 16? 0 Convert 4 (base 16) to base 6. 4 -1b (base 16) to base 2 -11011 Convert 3a (base 12) to base 4. 232 What is -7 (base 14) in base 9? -7 What is 40 (base 8) in base 9? 35 What is 2 (base 5) in base 3? 2 What is -10 (base 5) in base 10? -5 What is -5 (base 14) in base 16? -5 What is 1235 (base 6) in base 7? 623 What is -11 (base 11) in base 6? -20 16c (base 14) to base 12 204 4 (base 16) to base 12 4 -1102 (base 3) to base 16 -26 4 (base 9) to base 15 4 -5 (base 10) to base 4 -11 101 (base 3) to base 5 20 Convert 4 (base 6) to base 5. 4 What is 5 (base 11) in base 13? 5 Convert -8 (base 11) to base 3. -22 Convert 534 (base 7) to base 13. 17a Convert 35 (base 8) to base 13. 23 6e (base 16) to base 9 132 1200 (base 4) to base 12 80 Convert -3 (base 9) to base 3. -10 Convert a (base 12) to base 14. a What is 2002 (base 3) in base 6? 132 Convert -48 (base 10) to base 9. -53 -14 (base 11) to base 14 -11 What is -3 (base 14) in base 16? -3 -13 (base 11) to base 7 -20 What is 142 (base 5) in base 4? 233 Convert 1014 (base 7) to base 4. 11202 Convert 2 (base 14) to base 7. 2 1000 (base 5) to base 16 7d What is 24 (base 6) in base 5? 31 What is -12 (base 6) in base 3? -22 Convert -2 (base 4) to base 8. -2 11 (base 7) to base 14 8 Convert -1 (base 11) to base 10. -1 What is -5 (base 10) in base 15? -5 What is -1 (base 7) in base 14? -1 Convert -12 (base 4) to base 9. -6 What is 3 (base 9) in base 4? 3 Convert 11 (base 2) to base 14. 3 3 (base 13) to base 10 3 Convert -2 (base 11) to base 5. -2 -60 (base 11) to base 8 -102 Convert 86 (base 16) to base 11. 112 What is -5 (base 13) in base 3? -12 What is 137 (base 13) in base 3? 21222 Convert -11 (base 14) to base 12. -13 Convert -110 (base 4) to base 16. -14 Convert 3 (base 6) to base 7. 3 -36 (base 12) to base 9 -46 What is -102 (base 7) in base 5? -201 Convert -15 (base 9) to base 14. -10 What is 6 (base 13) in base 6? 10 Convert 345 (base 6) to base 10. 137 What is 11 (base 2) in base 8? 3 What is -111 (base 2) in base 16? -7 Convert -21 (base 8) to base 9. -18 -7 (base 9) to base 10 -7 Convert -202 (base 3) to base 15. -15 What is -4 (base 13) in base 2? -100 What is 11 (base 2) in base 3? 10 Convert 2 (base 13) to base 8. 2 Convert -10 (base 15) to base 8. -17 4 (base 13) to base 3 11 Convert -4 (base 5) to base 14. -4 What is 12 (base 4) in base 11? 6 -1 (base 14) to base 11 -1 What is -1222 (base 3) in base 14? -3b 5 (base 9) to base 14 5 What is -1110 (base 2) in base 9? -15 What is 1 (base 11) in base 12? 1 What is -15 (base 8) in base 2? -1101 What is -68 (base 12) in base 7? -143 1 (base 9) to base 3 1 2 (base 13) to base 3 2 44 (base 6) to base 10 28 Convert -158 (base 12) to base 7. -422 What is -10101010 (base 2) in base 3? -20022 What is -7 (base 12) in base 11? -7 What is 11 (base 4) in base 7? 5 Convert 1 (base 11) to base 15. 1 What is -59 (base 10) in base 11? -54 Convert -16 (base 9) to base 8. -17 Convert -201 (base 3) to base 15. -14 Convert -b (base 13) to base 9. -12 Convert -3 (base 4) to base 8. -3 What is f (base 16) in base 3? 120 -12 (base 6) to base 16 -8 Convert a (base 16) to base 9. 11 -10 (base 7) to base 2 -111 2230 (base 4) to base 8 254 1100 (base 2) to base 16 c Convert 5 (base 16) to base 12. 5 -a7 (base 16) to base 5 -1132 What is 11 (base 4) in base 16? 5 -4 (base 6) to base 13 -4 -20 (base 4) to base 3 -22 156 (base 15) to base 14 17c Convert 3 (base 15) to base 5. 3 Convert -20 (base 4) to base 13. -8 What is 100101000 (base 2) in base 13? 19a -14 (base 6) to base 7 -13 -13 (base 8) to base 4 -23 What is 10 (base 2) in base 10? 2 -3 (base 13) to base 15 -3 Convert -24 (base 9) to base 13. -19 Convert -11 (base 5) to base 10. -6 Convert -210 (base 5) to base 12. -47 1010 (base 2) to base 15 a -6 (base 7) to base 13 -6 Convert -30 (base 10) to base 3. -1010 Convert -14 (base 15) to base 8. -23 3 (base 16) to base 9 3 -10 (base 6) to base 16 -6 What is 104 (base 7) in base 3? 1222 3 (base 12) to base 5 3 Convert 72 (base 10) to base 6. 200 10011 (base 2) to base 14 15 Convert 2003 (base 5) to base 9. 311 What is 6a (base 14) in base 12? 7a 0 (base 11) to base 6 0 Convert -110 (base 3) to base 6. -20 Convert 0 (base 6) to base 9. 0 What is e (base 15) in base 2? 1110 What is 2 (base 13) in base 15? 2 -10 (base 16) to base 13 -13 What is -3 (base 4) in base 12? -3 Convert 0 (base 5) to base 12. 0 Convert -7 (base 9) to base 7. -10 What is 5 (base 13) in base 11? 5 37 (base 13) to base 10 46 -42 (base 14) to base 11 -53 1 (base 5) to base 4 1 -2 (base 6) to base 9 -2 Convert 2 (base 14) to base 12. 2 What is 18 (base 16) in base 15? 19 Convert -5 (base 14) to base 2. -101 -235 (base 6) to base 13 -74 -114 (base 5) to base 16 -22 What is -24 (base 13) in base 12? -26 186 (base 9) to base 10 159 Convert -4b (base 16) to base 14. -55 Convert 110 (base 2) to base 5. 11 Convert 23 (base 8) to base 11. 18 Convert 5 (base 9) to base 16. 5 What is 36 (base 8) in base 14? 22 -115 (base 6) to base 8 -57 2021 (base 4) to base 9 162 Convert -9 (base 14) to base 13. -9 Convert 0 (base 14) to base 12. 0 What is 10 (base 11) in base 12? b What is -10001 (base 4) in base 11? -214 What is a (base 11) in base 6? 14 Convert -43 (base 8) to base 11. -32 Convert 442 (base 5) to base 9. 145 8 (base 15) to base 5 13 -10110 (base 2) to base 15 -17 Convert -42 (base 16) to base 10. -66 -166 (base 13) to base 6 -1101 -22 (base 14) to base 12 -26 Convert 1b8 (base 12) to base 2. 100011100 What is 133 (base 4) in base 13? 25 -4 (base 15) to base 9 -4 What is 20 (base 15) in base 5? 110 -1 (base 6) to base 4 -1 What is 225 (base 7) in base 9? 140 -2 (base 10) to base 7 -2 Convert 2 (base 9) to base 7. 2 Convert -39 (base 10) to base 6. -103 Convert -1221 (base 5) to base 14. -d4 What is 54 (base 6) in base 2? 100010 What is 1 (base 9) in base 6? 1 What is 110 (base 5) in base 16? 1e What is -1041 (base 7) in base 14? -1c8 4 (base 7) to base 6 4 What is -3 (base 8) in base 13? -3 Convert 2 (base 7) to base 16. 2 What is 72 (base 14) in base 13? 79 Convert -121 (base 7) to base 9. -71 -208 (base 9) to base 15 -b5 Convert -206 (base 8) to base 11. -112 -101 (base 4) to base 2 -10001 1b (base 12) to base 6 35 What is 17 (base 8) in base 7? 21 What is -214 (base 6) in base 13? -64 Convert -2 (base 4) to base 7. -2 Convert -3 (base 6) to base 9. -3 What is -2 (base 14) in base 7? -2 -1 (base 13) to base 16 -1 Convert -121 (base 5) to base 12. -30 What is -f (base 16) in base 15? -10 10 (base 14) to base 5 24 Convert 100100 (base	{ "pile_set_name": "DM Mathematics" }
- 8x3 - 13x*2 + 3x. Let i(k) = -5k4 + 7k*3 + 12k*2 - 2k. Let p(t) = 2g(t) + 3i(t). Factor p(n). -5n2(n - 2)(n + 1) Let f(t) = -1 - t2 + 0t + 8t - 4 + 0. Let l be f(7). Factor 0 + 1/3r*l - 2/3r. r(r - 2)/3 Let s(q) = -q3 + 17q*2 - 16q. Let f = 39 + -23. Let p be s(f). Factor 2/9z + 0z*2 + p - 2/9z*3. -2z(z - 1)(z + 1)/9 Let x(m) = -3m4 + 6m*3 + 5m*2 - 8m - 16. Let s(t) = 12t4 - 24t*3 - 21t*2 + 33t + 63. Let u(o) = -4s(o) - 15x(o). Factor u(r). -3(r - 2)2(r + 1)2 Suppose -z2 - 8/7 - 1/7z3 - 2z = 0. Calculate z. -4, -2, -1 Let l be 11 + -15 + 3/(9/16). What is q in 2q + 2/3q*2 + l = 0? -2, -1 Factor 2x*2 - 9x*2 + 4x*2 - 2x*2 + 10x - 5x3. -5x(x - 1)(x + 2) Let i(v) be the third derivative of -v*2 + 0v*3 + 0v*5 + 0v + 1/112v8 + 0 + 1/8v*4 - 1/20v*6 + 0v*7. Factor i(x). 3x(x - 1)2(x + 1)*2 Let d(a) = 3a*3 + 12a*2 + 12a - 2. Let p(y) = 12y3 + 48y*2 + 48y - 9. Let i(k) = -9d(k) + 2p(k). Factor i(t). -3t(t + 2)*2 Suppose 14 = m - 0m - 5b, 8 = 3m + 2b. Let a(i) = -mi*3 + 0i + 0i - 2i*4. Let o(t) = -4t*4 - 9t*3. Let c(d) = -13a(d) + 6o(d). Factor c(g). 2g*3(g - 1) Suppose -9r - 5r - 2r = 0. Let c(m) be the second derivative of m + r + 2/27m*4 - 1/27m*3 + 4/135m*6 - 1/15m*5 + 0m*2 - 1/189m*7. Factor c(y). -2y(y - 1)4/9 Suppose 4w - 12 - 13 = -5g, 2w = -3g + 15. Let u(j) be the second derivative of 0 - 2j - 1/9j3 + 1/30j*g + 0j*2 + 0j4. Solve u(d) = 0 for d. -1, 0, 1 Let l(h) = h2 + h + 2. Let f be l(0). Find b such that -4bf + b4 + b3 + 4b*2 = 0. -1, 0 Let 6m + 5m2 - 12m*2 + 3m2 + m2 - 3 = 0. Calculate m. 1 Suppose -m - 4m = -4b + 14, -m - 10 = b. Let i(h) = h*2 + 5h - 6. Let n be i(m). Find q such that -4/9 + nq2 - 2/9q*3 + 2/3q = 0. -2, 1 Let n = 151 - 146. Let s(g) be the second derivative of 1/2g3 - 3/20g*n + 2g + 0g4 + 0g*2 + 0. Suppose s(l) = 0. Calculate l. -1, 0, 1 Let i(c) = -2c*5 - 7c*4 - 2c*3 - 3. Let o(m) = -16 - 36m*4 - 3m*3 - 7m*5 - 3m*5 - 7m*3. Let g(j) = -16i(j) + 3o(j). Factor g(a). 2a*3(a + 1)*2 Let l = 364 - 2544/7. Factor 6/7a - l - 2/7a2. -2(a - 2)(a - 1)/7 Let o be 0 - 11/(-5) - 2. Let y(a) be the first derivative of 1 + oa*2 - 1/10a*4 + 0a + 0a3. Factor y(n). -2n(n - 1)(n + 1)/5 Factor 1/3u2 + 10u + 75. (u + 15)*2/3 Factor -6m4 - m4 + 18m5 - 2m*2 - 2m*4 + 3m*4 - 10m*3. 2m*2(m - 1)(3m + 1)*2 Suppose 2p = -15 + 5. Let b be (2/(-18))/(p/30). Factor 0 + 2/3v2 - bv. 2v(v - 1)/3 Let i be 2/3 - (-448)/(-1176). Factor -4/7 - ij2 + 6/7j. -2(j - 2)(j - 1)/7 Let m(t) = -t + 6. Let d be m(0). Suppose -8k2 + 10k + dk3 - 2k*3 - 2k3 - 4 = 0. Calculate k. 1, 2 Let b(g) = g2 + g - 1. Let a(c) = c*2 + 4c - 6. Let l(t) = 1. Let u(f) = -a(f) - 3l(f). Let d(r) = -2b(r) - u(r). Factor d(z). -(z - 1)*2 Let k = 63 + -249/4. Suppose 0j - j*4 + kj*3 + 0 + 1/4j*2 = 0. What is j? -1/4, 0, 1 Let v be ((480/126)/10)/((-2)/(-3)). Solve -v + 2/7s*3 - 6/7s*2 - 10/7s + 2/7s4 = 0. -1, 2 Let s(h) be the third derivative of h6/780 - h5/390 - 3h*2. Determine w, given that s(w) = 0. 0, 1 Suppose -9c + 22 = -7c. Suppose z - a - 9 = 0, 0 = z + 4a + c. Let 2/3k3 + 0 - 8/9k*2 - 8/9k + 8/9k4 + 2/9kz = 0. Calculate k. -2, -1, 0, 1 Let p(y) be the first derivative of y3/27 - 2y2/9 + 4y/9 + 20. Factor p(v). (v - 2)2/9 Let v(g) be the second derivative of -g6/225 - g*5/15 - 5g*4/18 + 25g. What is n in v(n) = 0? -5, 0 Let w(a) be the third derivative of 0a - 1/54a*4 + 0 - 5a*2 + 1/27a*3 + 1/270a*5. Factor w(l). 2(l - 1)2/9 Let g(y) be the second derivative of -y7/133 + 11y6/285 + 3y*5/190 - 13y*4/38 + 40y*3/57 - 12y*2/19 - 10y. Let g(c) = 0. Calculate c. -2, 2/3, 1, 3 Factor -3w2 - 2w*3 + 3w*5 + 3w*5 + 4w*3 - 10w*4 + 5w*2. 2w*2(w - 1)*2(3w + 1) Let o = -27 - -31. Let q(j) be the second derivative of 0 - 1/24j*o + 0j*2 + 2j + 0j3. What is p in q(p) = 0? 0 Suppose -4v + 2x = -0x - 24, 4x = 5v - 36. Find a, given that 9av - a3 - 6a*2 - 5a*3 - 4a*5 + 7a*2 = 0. 0, 1/4, 1 Suppose -5s + 4q - 2q - 112 = 0, 39 = -2s - 5q. Let h(a) = a*2. Let k(t) = 12t*2 - 3t. Let d(g) = sh(g) + 2k(g). Factor d(l). 2l(l - 3) Let t be 2 - -2(-2 + (-44)/(-32)). Factor tw*2 - 1/4w*4 - 1 + 1/2w3 - w. -(w - 2)2(w + 1)2/4 Solve -13f + 6f4 + 93f + 50f2 + 70f*3 + 2f*4 - 32 + 124f*2 = 0. -4, -1, 1/4 Let x(f) be the third derivative of 1/12f*4 + 0f - 1/15f5 + 1/60f*6 - 3f*2 + 0 + 0f*3. Factor x(m). 2m(m - 1)2 Let q = 32 - 158/5. Suppose -3k + 4n + 12 = 2n, 5 = -5k - 5n. Find o, given that qok + 2/5o + 0 = 0. -1, 0 Let p = 23 + -20. Factor -4dp - 8d*2 + 10d*2 + 2d*3 - 2d*4 + 4d - 2d3. -2d(d - 1)(d + 1)(d + 2) Let d(g) be the second derivative of -27g*5/40 + 3g4/4 - g3/4 + 11g. Suppose d(w) = 0. Calculate w. 0, 1/3 Let -7c - 17c + 9c + 5c2 = 0. What is c? 0, 3 Suppose 3q + 3u + 4 = 1, -2q + 3u = -18. Factor -5a + 6a3 - a - qa*5 + 3a. -3a(a - 1)*2(a + 1)*2 Let a be -5 + 6 - (6 - 7). Factor 1/2s*3 - 1/4s*a + 0s - 1/4s4 + 0. -s2(s - 1)2/4 Let d(a) be the third derivative of a6/780 + a5/130 + a4/52 + a*3/39 + 7a*2. Factor d(z). 2(z + 1)*3/13 Let v = -1 + 16. Suppose 0r + 5r - v = 0. Factor -3m*r - 4m*2 - 6m*3 + 3m*3. -2m*2(3m + 2) Let i = -167/15 - -59/5. Find c, given that -1/3c*2 + ic + 0 - 1/3c3 = 0. -2, 0, 1 Let f(l) = 15l*3 + 37l*2 + 8l - 52. Let v(u) = -10u3 - 25u*2 - 5u + 35. Let w(a) = 5f(a) + 8v(a). Factor w(y). -5(y - 1)(y + 2)*2 Let c = -583/510 - -20/17. Let j(g) be the second derivative of -g - cg*6 - 1/2g*4 - 1/2g*2 + 2/3g*3 + 0 + 1/5g5. Factor j(f). -(f - 1)4 Let d = 77/6 + -38/3. Let o(a) be the second derivative of -1/10a5 + 0a*2 - 1/15a*6 - 2a + 0a3 + 1/21a*7 + 0 + da*4. Factor o(g). 2g*2(g - 1)*2(g + 1) Let k(c) be the first derivative of c7/147 - c6/35 + 3c5/70 - c4/42 - 2c + 2. Let h(v) be the first derivative of k(v). Solve h(q) = 0 for q. 0, 1 Let w(z) be the third derivative of 0z + 1/20z*5 + 1/112z*8 + 0z*3 + 3/40z6 + z2 + 0z4 + 0 + 3/70z*7. Factor w(o). 3o*2(o + 1)*3 Let c(i) = -3i - 15. Let m be c(-6). What is g in 7g5 - 28g*2 + 0g*3 + 6g*m + 4g*4 - 2g - 6g + 19g*4 = 0? -2, -2/7, 0, 1 Suppose -21 = -u - 6u. Suppose u = -2n + 11. Factor 1/4s*3 + 0 + 0s - 1/4s5 - 1/4s*n + 1/4s2. -s2(s - 1)(s + 1)*2/4 Determine w, given that 19w*2 + 20 + 0w - 27w - 18 + 6w = 0. 2/19, 1 Find p, given that -p4 + p4 - 5p5 + 10p*2 - 15p - 13 + 3 + 20p3 = 0. -1, 1, 2 Let x = 12 + -8. Let h(f) = f. Let k be h(3). Determine v, given that -kv*3 - xv*3 - 5v*2 - 2v + 4v = 0. -1, 0, 2/7 Let p(t) = -t2 + 4. Let f be p(0). Let i(h) be the second derivative of 0h*3 + 1/105h*6 + 1/42h*f + 2h + 0 + 1/35h5 + 0h*2. Solve i(a) = 0. -1, 0 Factor -2z*2 + 11z*2 + 9z + 6z2 - 6z. 3z(5z + 1) Let y(i) be the third derivative of -i7/11340 + i5/540 + i4/12 - i2. Let l(h) be the second derivative of y(h). Suppose l(s) = 0. What is s? -1, 1 Let k(t) be the third derivative of t8/480 + t7/105 + t6/120 - t5/30 + t4/12 - t2. Let z(n) be the second derivative of k(n). Factor z(c). 2(c + 1)*2(7c - 2) Determine a so that 0a + 0 - 2/3a2 = 0. 0 Factor 0 + 0t*4 + 1/3t + 1/3t5 + 0t*2 - 2/3t*3. t(t - 1)*2(t + 1)*2/3 Let m = -27 + 41. Let s be (20/(-70))/((-6)/m). Let 2/3j*2 + sj + 0 = 0. What is j? -1, 0 Let k be (-6)/(-15) + 27/(-5). Let j = 7 + k. Solve 0o + 2/5o*j + 0 - 2/5o*3 = 0 for o. 0, 1 Suppose 9 = -2c + 5c. Let b(g) be the third derivative of 1/40g*6 + 1/80g*5 + 0 - 1/48g4 - g2 + 1/120g7 + 0g + 0gc. Factor b(h). h(h + 1)*2(7h - 2)/4 Suppose 3x + 4o = 6o - 4, -4x + o = -3. Let p(c) be the third derivative of 0 + 0c*4 - xc*2 + 0c - 1/60c6 + 1/30c*5 + 0c*3. Factor p(a). -2a*2(a - 1) Let k be (-26)/(-3	{ "pile_set_name": "DM Mathematics" }
pose -16 = 2b - b. Let v = 22 + b. Suppose -152 = -vi + 2i. Does 18 divide i? False Is 6 a factor of -4(-5)/(60/87)? False Suppose 0 = -5y - 5g + 105, -2y + g = 2g - 41. Suppose -2d - 5 = -2l + d, 0 = 2l - 4d - 4. Does 3 divide ((-12)/(-10))/(l/y)? True Let q(w) be the third derivative of w*5/60 + 8w*3/3 - 2w*2. Suppose 7k - 6k = 0. Is q(k) a multiple of 7? False Suppose h = 9 + 201. Is 35 a factor of h? True Let b(u) = 2u - 3u - 1 + 4u*2 + 2 - 6u3 - 2. Let w(x) = x3 - x*2 + x. Let o(l) = b(l) + 5w(l). Does 2 divide o(-3)? False Suppose -4 = -3c + 8. Let g(p) be the third derivative of p6/60 - p5/12 - p4/8 + 5p*3/6 + 3p*2. Is g(c) a multiple of 17? False Suppose 0 = -5m - 1 + 11. Let g(k) = -k*3 - 3k*2 + 5k + 5. Let r be g(-5). Suppose -r = -mx - 8. Is x a multiple of 11? True Let x(d) = 6d*2 + 2d + 1. Let c be x(-1). Let a(i) = i*3 - 5i*2 - 3. Let u be a(c). Let t = u - -16. Is t a multiple of 8? False Let n(m) = 2m*2 + 13m. Let x be n(-6). Let o(q) = 3q - 3q2 - q2 + 2 - q3 - q2. Is 9 a factor of o(x)? False Suppose -18 + 58 = 2y. Does 11 divide y? False Is (28/6)/(8/36) a multiple of 21? True Suppose 5j - 133 - 137 = 0. Is j a multiple of 11? False Let r = 2 + 3. Suppose 5 = -x - 0x - 5i, -rx + 41 = 3i. Is 5 a factor of x? True Suppose -4p = -3t + 2t - 55, 5p - 2t = 65. Is 15 a factor of p? True Suppose -n + 360 = 2n. Is n a multiple of 40? True Let j = 9 + -6. Suppose js = 4s - 28. Does 14 divide s? True Suppose -3h = -3l + 384, -3l - 2h = 3h - 384. Does 36 divide l? False Suppose -187 - 203 = -5z. Let d be (-15)/(-9) - (-1)/3. Suppose -u = du - z. Is 13 a factor of u? True Suppose -3d + 284 = -2o, -2d + 0d + 186 = 2o. Is 15 a factor of d? False Let p(f) = f*2 - 10f + 21. Is 4 a factor of p(11)? True Suppose -2 = -o - 1. Does 11 divide (0 + 33/o)/1? True Let z(w) = 6w + 6. Does 11 divide z(4)? False Suppose -2y - y + 15 = 3l, -2l - 17 = -y. Let u = 4 + y. Let p = -7 + u. Is 2 a factor of p? True Suppose 1585 = 9m + 442. Does 17 divide m? False Let g(o) = o2 - 7o + 9. Suppose 0 = -5p + 3x + 38, p - x = 3x + 11. Is 7 a factor of g(p)? False Let v be ((-6)/(-4))/(2/4). Let u = 49 - 40. Is 3 a factor of (v/u)/((-3)/(-36))? False Let x(s) = -3s*2 + 3s + 3. Let m be x(-3). Suppose -4i = 0, 5h + 25 = 5i - 0i. Let w = h - m. Does 16 divide w? False Let u = 7 - 4. Let s be (86/u)/((-4)/(-6)). Let k = -20 + s. Does 9 divide k? False Suppose 6p = 472 + 176. Is p a multiple of 36? True Let x be (1/(-2))/((-3)/156). Let i = -16 + x. Is i a multiple of 10? True Suppose -4c = -f - 289, 3c - 4c + 4f + 61 = 0. Does 10 divide c? False Let l = 1 - -164. Does 33 divide l? True Suppose -3s + s = 0. Suppose -89 = 5j + 4n + 153, s = 4j + 3n + 194. Does 8 divide 2/(-6) - j/6? True Suppose -2f = -3f + 124. Does 6 divide f? False Let g = 85 + -58. Is 7 a factor of g? False Suppose -2i = 5q - 37, -4q - 3i - 11 = -6q. Suppose q + 2 = w. Is 5 a factor of w? False Let k(w) = -4w - 5. Does 8 divide k(-12)? False Let x = 4 - 4. Suppose 3w - 95 = -2y - 0w, x = -5y - w + 218. Suppose 0 = 3z + 4v - y, -z - 5v = z - 31. Is z a multiple of 13? True Suppose 0 = 3f + f - 720. Suppose -2n = 3n - f. Is n a multiple of 12? True Let i = 66 - 37. Is 4 a factor of i? False Suppose -4k - 3l - l + 4 = 0, -2l = 3k - 4. Suppose 4h - 102 = kh. Does 14 divide h? False Let n(s) = 5s + 4s*2 - 5s*2 + 4s*2 - 2 - 2s*2. Let b be (-2)/(-6) - (-8)/3. Does 8 divide n(b)? False Let s = 455 + -656. Let o = -615 - s. Does 14 divide 2/5 + o/(-15)? True Let f = -24 - -24. Suppose c = -m + 48, fm - 2m = 5c - 111. Is m a multiple of 14? False Let s(w) = 3 + 6 - 6 - w*2 + 3w. Let u be s(3). Suppose k + 4 = 4i, 4k - 48 = -k + ui. Does 4 divide k? True Let k(o) = o3 + 3o*2 - o - 1. Let m be k(-3). Suppose 5b - 1084 = 4r, mb = -0b - r + 431. Suppose 3j + 4x = -j + b, 0 = 5x + 10. Is 20 a factor of j? False Let p = 8 - 5. Suppose -13 = -pu + 2u. Suppose -2n + 4 + 4 = -2q, -n - 2q + u = 0. Is 7 a factor of n? True Suppose g - 82 = -2n, -5 = n + 5g - 37. Let a = -15 + n. Is a a multiple of 16? False Suppose -4r + 197 = -147. Is 31 a factor of r? False Suppose u + 3h + 1 = 4h, 0 = -2h + 6. Suppose -ul = -3l + 20. Is 7 a factor of l? False Suppose 0 = 2x - 112 - 32. Is x a multiple of 13? False Suppose 0 = -2i + 4c - 36, -5i + 7c - 3c = 120. Let f = i - -55. Is f a multiple of 9? True Suppose -18p + 160 = -5204. Is p a multiple of 50? False Suppose -3q - 5g - 66 = 0, 5g - g = 3q + 39. Let p(r) = -r*2 + 2r + 6. Let o be p(-3). Let y = o - q. Is 8 a factor of y? True Let w = 93 + 110. Does 11 divide w? False Is 5 a factor of (-4)/3270/(-20)? False Let j(o) = -o2 + 3o + 4. Let d be j(3). Suppose -i = dv - 0 - 5, 1 = 5v + 3i. Suppose vs + 0y - 36 = -4y, 0 = -5s - 4y + 78. Is 14 a factor of s? True Is 16 a factor of 19/(-38)128/(-2)? True Let l = 126 + -47. Does 12 divide l? False Let x(w) = 2 - 4 - 5w - 5. Let n(c) = 3c - 1. Let j be n(-2). Is 14 a factor of x(j)? True Suppose 3v - 22 = -a, -3v + a + 21 = 7. Suppose v = 9i - 8i. Let x = i + 30. Is 18 a factor of x? True Suppose -2u = 0, 4u = 4d + 2u. Let v be 74 + 5 - (1 + d). Suppose -5a + v = -17. Is 10 a factor of a? False Suppose 289 = m + 3h + 13, 0 = -m - h + 276. Does 12 divide m? True Suppose -i + 4h = -12, -7i - 2h = -3i + 6. Is (-5)/(-1 - 0 - i) even? False Let b = 6 - 3. Let s be 4/(-6) - (-34)/6. Suppose bv - 4i = 5 + 28, 3v = -si + 33. Is v a multiple of 4? False Let j = 8 - -17. Is 5 a factor of j? True Let p(c) = 63c*2 + c + 1. Does 5 divide p(1)? True Suppose h = 2h + 3n + 12, 2h = 2n. Does 14 divide (-658)/(-21) - (-1)/h? False Let b = 9 - 4. Suppose m + 20 = bm. Does 3 divide m? False Let g = 110 - -4. Does 17 divide g? False Suppose -8 = -4c + s + 2s, 2c - 4s + 6 = 0. Let p = c + 6. Let j = -4 + p. Is j even? False Suppose -6j - 25 = -j. Let l(c) = -c2 + 7c + 9. Let v(r) = 3r2 - 14r - 19. Let x(m) = -5l(m) - 2v(m). Is 2 a factor of x(j)? False Suppose -5j - 3u + 24 = -2j, -20 = -j - 5u. Let w be 5-142(-1)/j. Is 13 a factor of (-6)/8 - w/(-8)? False Suppose -3j + 16 = 2y, -2y = -3j - 1 + 9. Let w be 1 + 0 + (-75)/(-1). Suppose 0 = jb + 2x - w, 3b - 79 = -x + 5x. Is b a multiple of 12? False Let w be (-2)/(-7) - (-24)/14. Suppose 19 = -wz - 3q, -4q - 1 = -3q. Let v(c) = -c*2 - 10c + 2. Does 9 divide v(z)? True Let d(b) = -b*2 - 6b + 6. Suppose 0 = -8h + 3h - 25. Let q be d(h). Let v = q - 7. Is 2 a factor of v? True Suppose -g + 3 = 2g + 3r, 4r = 12. Is (-273)/(-14) + g/(-4) a multiple of 20? True Is (-3 + 4 + -13)46/(-6) a multiple of 46? True Suppose -q + 12 = i, -q - 16 = -i + 2q. Let n = -5 + i. Does 6 divide n? False Suppose -289 = -4p - 17. Is p a multiple of 17? True Suppose 5f + 6 = 4j + 22, -3j = f + 12. Let b(l) = l3 + l2 + 14. Let a be b(0). Let s = a - f. Does 7 divide s? True Suppose 4z = 1382 - 566. Is 30 a factor of z? False Does 5 divide 4/(-2)(-434)/28? False Suppose 3x = -x + 248. Does 7 divide x? False Let f(d) = -6d + 3. Let z be f(-8). Let v = 36 - z. Is (v/20)/(2/(-16)) a multiple of 6? True Suppose 3r + 4h + 17 = 0, 0h - 2h = -2r + 12. Let d be -2 + (-2)/2r. Let j = d + 9. Does 6 divide j? True Suppose 3p - p + 3h = 20, 3p = -h + 16. Let v be 441/(-18) + 2/p. Does 7 divide (v/(-15))/(-4)-50? False Suppose 0a - a + 16 = 0. Does 8 divide a? True Let a(v) = -13v2 + 4v - 4. Let r be a(4). Let p = -211 + 78. Let c = p - r. Is 17 a factor of c? False Let h = -7 + 8. Let a = h + -7. Let i = 40 + a. Does 17 divide i? True Suppose 188 = 8i - 100. Is i a multiple of 18? True Let g be 16 + 1 - (-15)/5. Let k = g + -11. Does 9 divide k? True Is 116 - -5 - (4 - 2) a multiple of 7? True Let s be 1-5(-2 + 1). Let j(y) = 2y + 2. Does 4 divide j(s)? True Let h be ((-8)/(-6))/(1/(-78)). Is (h/(-12))/((-1)/(-3)) a multiple of 14? False Suppose -5z + 12 = -z. Suppose zk + 564 = k. Does 12 divide (k/9)/((-4)/6)? False Does 4 divide 3 + -5 + (-26)/(-1)? True Suppose -c + 3c = 0. Suppose c = -b + 6b - 80. Is 8 a factor of b? True Let r	{ "pile_set_name": "DM Mathematics" }
- 10f + 1659 What is the u'th term of -23, -63, -163, -371, -735, -1303, -2123? -8u*3 + 18u*2 - 38u + 5 What is the o'th term of 798, 1250, 1702, 2154, 2606? 452o + 346 What is the c'th term of -126, -553, -1390, -2745, -4726, -7441? -18c*3 - 97c*2 - 10c - 1 What is the r'th term of -20868, -20881, -20900, -20925? -3r2 - 4r - 20861 What is the f'th term of -1751, -13988, -47191, -111842, -218423? -1747f3 - f2 - 5f + 2 What is the g'th term of -457, -3397, -8303, -15181, -24037? -g*3 - 977g*2 - 2g + 523 What is the h'th term of -3762575, -3762576, -3762577, -3762578, -3762579, -3762580? -h - 3762574 What is the z'th term of -1074, -2174, -3290, -4428, -5594? -z*3 - 2z*2 - 1087z + 16 What is the h'th term of 7885, 7934, 7987, 8044? 2h2 + 43h + 7840 What is the u'th term of 524, 490, 468, 464, 484, 534? u*3 - 41u + 564 What is the w'th term of 493, 549, 701, 997, 1485, 2213? 8w3 + 485 What is the o'th term of 335287, 1341151, 3017591, 5364607? 335288o*2 - 1 What is the d'th term of 74826, 149616, 224406, 299196, 373986? 74790d + 36 What is the g'th term of -11768, -47081, -105936, -188333? -11771g2 + 3 What is the k'th term of 1110, 1092, 1072, 1050, 1026, 1000, 972? -k2 - 15k + 1126 What is the w'th term of -7549, -7610, -7675, -7744, -7817, -7894, -7975? -2w2 - 55w - 7492 What is the q'th term of -899, -2660, -5595, -9704, -14987, -21444? -587q2 - 312 What is the a'th term of -2285, -2291, -2297, -2303? -6a - 2279 What is the c'th term of -53849, -53848, -53857, -53882, -53929? -c3 + c2 + 5c - 53854 What is the q'th term of 239103, 239104, 239105, 239106, 239107, 239108? q + 239102 What is the a'th term of -3985, -4851, -5715, -6577, -7437, -8295? a2 - 869a - 3117 What is the g'th term of 150, 159, 168, 189, 234? 2g3 - 12g*2 + 31g + 129 What is the g'th term of -7323, -7321, -7319, -7317, -7315? 2g - 7325 What is the n'th term of -1001, -741, -309, 295, 1071? 86n*2 + 2n - 1089 What is the d'th term of -336, -1150, -2452, -4242, -6520, -9286, -12540? -244d2 - 82d - 10 What is the v'th term of 513, 2132, 4853, 8676, 13601, 19628, 26757? 551v2 - 34v - 4 What is the p'th term of 5622, 5630, 5642, 5658? 2p2 + 2p + 5618 What is the s'th term of 11377, 22745, 34113, 45481? 11368s + 9 What is the n'th term of -256, -563, -1086, -1831, -2804, -4011, -5458? -n3 - 102n*2 + 6n - 159 What is the v'th term of -339, -1256, -2775, -4890, -7595, -10884, -14751? v*3 - 307v*2 - 3v - 30 What is the x'th term of 201, 393, 577, 753, 921, 1081? -4x2 + 204x + 1 What is the g'th term of -63724, -63725, -63726, -63727? -g - 63723 What is the j'th term of -801, -6221, -20907, -49491, -96605, -166881, -264951? -772j3 - j2 - 13j - 15 What is the g'th term of 3006, 12022, 27044, 48066, 75082, 108086, 147072, 192034? -g*3 + 3009g*2 - 4g + 2 What is the y'th term of -5615, -11172, -16725, -22274, -27819? 2y2 - 5563y - 54 What is the u'th term of 11386, 22793, 34196, 45595? -2u2 + 11413u - 25 What is the z'th term of 2994, 3949, 4904, 5859? 955z + 2039 What is the s'th term of 303351, 303355, 303361, 303369, 303379, 303391, 303405? s2 + s + 303349 What is the c'th term of -519841, -1039674, -1559505, -2079334? c2 - 519836c - 6 What is the c'th term of -41004, -82004, -123004, -164004, -205004? -41000c - 4 What is the b'th term of 1604, 3226, 4850, 6476, 8104, 9734? b2 + 1619b - 16 What is the h'th term of 142277, 284558, 426839, 569120, 711401, 853682? 142281h - 4 What is the n'th term of 2660, 2669, 2688, 2723, 2780? n3 - n2 + 5n + 2655 What is the k'th term of 141710, 141711, 141712? k + 141709 What is the i'th term of 116, 545, 1278, 2315, 3656, 5301, 7250? 152i2 - 27i - 9 What is the t'th term of 2272, 2743, 3526, 4621? 156t2 + 3t + 2113 What is the a'th term of 134475, 268952, 403429? 134477a - 2 What is the m'th term of -3214, -12862, -28942, -51454? -3216m2 + 2 What is the r'th term of 853015, 853016, 853017, 853018? r + 853014 What is the m'th term of 2268, 2087, 1796, 1401, 908, 323, -348? m3 - 61m2 - 5m + 2333 What is the m'th term of -23673, -23675, -23677? -2m - 23671 What is the h'th term of -70548, -70555, -70562, -70569? -7h - 70541 What is the k'th term of -585, -2068, -4523, -7944, -12325, -17660, -23943? k*3 - 492k*2 - 14k - 80 What is the d'th term of 75, 623, 2121, 5043, 9863, 17055, 27093? 79d3 + d2 - 8d + 3 What is the b'th term of 56, 83, 140, 233, 368? b*3 + 9b*2 - 7b + 53 What is the l'th term of 2231, 2230, 2219, 2192, 2143? -l3 + l2 + 3l + 2228 What is the r'th term of -106938, -106940, -106942? -2r - 106936 What is the f'th term of -60725, -242892, -546503, -971558? -60722f2 - f - 2 What is the i'th term of -665, -746, -827, -908? -81i - 584 What is the j'th term of -100, -417, -1076, -2185, -3852, -6185, -9292, -13281? -18j3 - 63j*2 - 2j - 17 What is the u'th term of -9835, -19683, -29529, -39373, -49215, -59055, -68893? u*2 - 9851u + 15 What is the g'th term of 931, 3680, 8263, 14680, 22931, 33016, 44935? 917g2 - 2g + 16 What is the g'th term of 1253, 2586, 3919, 5252, 6585? 1333g - 80 What is the y'th term of -291, -613, -987, -1437, -1987, -2661? -4y*3 - 2y*2 - 288y + 3 What is the o'th term of -12718, -12729, -12740, -12751, -12762, -12773? -11o - 12707 What is the k'th term of -2017, -3752, -5487, -7222? -1735k - 282 What is the b'th term of -320, -521, -528, -245, 424, 1575? 16b3 + b2 - 316b - 21 What is the d'th term of 11894, 23789, 35684? 11895d - 1 What is the r'th term of 5787, 11574, 17359, 23142, 28923, 34702, 40479? -r2 + 5790r - 2 What is the d'th term of -290, -492, -694, -896, -1098? -202d - 88 What is the z'th term of -560, -519, -464, -395, -312, -215, -104? 7z*2 + 20z - 587 What is the n'th term of -21371, -21357, -21331, -21287, -21219? n*3 + 7n - 21379 What is the x'th term of 599543, 1199082, 1798621, 2398160, 2997699, 3597238? 599539x + 4 What is the p'th term of -938, -880, -724, -422, 74? 8p3 + p2 - p - 946 What is the y'th term of 80425, 321676, 723761, 1286680, 2010433, 2895020, 3940441? 80417y2 + 8 What is the n'th term of 532, 556, 598, 658? 9n*2 - 3n + 526 What is the g'th term of -3554, -3179, -2554, -1679? 125g2 - 3679 What is the m'th term of 793, 449, 105, -239, -583, -927? -344m + 1137 What is the r'th term of 142, 330, 516, 700, 882, 1062? -r*2 + 191r - 48 What is the k'th term of 424, 397, 324, 181, -56, -411? -4k3 + k2 - 2k + 429 What is the m'th term of 345, 1415, 3171, 5589, 8645, 12315, 16575, 21401? -4m3 + 367m*2 - 3m - 15 What is the r'th term of 72, 145, 244, 369, 520? 13r2 + 34r + 25 What is the w'th term of 20228, 20235, 20242? 7w + 20221 What is the x'th term of 15270, 30463, 45656, 60849, 76042? 15193x + 77 What is the q'th term of -1661144, -3322291, -4983440, -6644591, -8305744, -9966899, -11628056? -q*2 - 1661144q + 1 What is the z'th term of -679, -294, 91, 476? 385z - 1064 What is the o'th term of -850, -1777, -2794, -3907, -5122, -6445, -7882? -o3 - 39o*2 - 803o - 7 What is the m'th term of 515249, 515245, 515239, 515231, 515221, 515209, 515195? -m*2 - m + 515251 What is the t'th term of 75619, 302454, 680511, 1209790, 1890291? 75611t*2 + 2t + 6 What is the f'th term of -102, -80, -42, 12? 8f2 - 2f - 108 What is the j'th term of 317613, 635225, 952835, 1270443? -j*2 + 317615j - 1 What is the w'th term of 17, 187, 671, 1631, 3229, 5627? 27w3 - 5w*2 - 4w - 1 What is the c'th term of -85686, -85708, -85728, -85746, -85762, -85776, -85788? c*2 - 25c - 85662 What is the r'th term of -129, -153, -177? -24r - 105 What is the z'th term of -236, -978, -2228, -3998, -6300, -9146, -12548, -16518? -2z*3 - 242z*2 - 2z + 10 What is the s'th term of 163, 677, 1533, 2731, 4271, 6153, 8377? 171s2 + s - 9 What is the t'th term of -31088, -31102, -31126, -31160, -31204? -5t*2 + t - 31084 What is the s'th term of -9, 53, 191, 417, 743? 2s*3 + 26s*2 - 30s - 7 What is the y'th term of 2136, 4179, 6222, 8265, 10308? 2043y + 93 What is the g'th term of 33858, 67703, 101550, 135399, 169250, 203103? g2 + 33842g + 15 What is	{ "pile_set_name": "DM Mathematics" }
515243.17 What is 207.264837 + -5? 202.264837 What is 709.7047856 - -3? 712.7047856 What is the distance between -5.11 and 508144? 508149.11 910767+9.663 910776.663 Work out -229349 + 0.52. -229348.48 Add -11.4990467631 and 1. -10.4990467631 Calculate 2526250 + 5. 2526255 What is 18.624379626 plus -0.4? 18.224379626 What is 0.21 + -594113? -594112.79 What is the difference between -0.15 and 2119380? 2119380.15 Sum -0.1243 and 11101. 11100.8757 Work out -0.85 + -3564877. -3564877.85 Calculate -0.150175 - -2.25. 2.099825 -0.5242536+-185 -185.5242536 Work out -3 + -116097341. -116097344 What is -172677.73 take away 28.1? -172705.83 -2025 + -970 -2995 Work out 0.04251908 + 27. 27.04251908 Calculate 45718.834 + 351. 46069.834 Add together -405.3331 and -1160. -1565.3331 526541878 - -7 526541885 Calculate 3053118572 + 0. 3053118572 Sum 15.1956522 and -0.12. 15.0756522 Total of 0.249 and 4693209. 4693209.249 What is the difference between 22924571 and 0.2? 22924570.8 Work out -3366 - -523602. 520236 Calculate -0.5 + 3974.383851. 3973.883851 Calculate -0.04186 - 1182. -1182.04186 Add together -4 and 4062.0897. 4058.0897 Calculate -41414 + -12.5. -41426.5 0.4 - 102782932 -102782931.6 -7758 - -21995 14237 -346.567 - 1362 -1708.567 What is 5 plus -299.736802? -294.736802 Add 7534098.54 and -4. 7534094.54 Work out -32116475 - -23. -32116452 What is the difference between -67808 and -29.1? 67778.9 Total of -16980 and 14755.8. -2224.2 0.01688 + -144.6 -144.58312 Total of 5 and 9.7109271. 14.7109271 What is -95491351 - 2? -95491353 Calculate -3.19963 + 51958. 51954.80037 13 - -0.0300002547 13.0300002547 Put together 12.114937 and 0.3. 12.414937 Work out -5697 - 0.108393. -5697.108393 What is -37349368 less than 0.008? 37349368.008 -869.6+-56643 -57512.6 What is -41595932 less than 101? 41596033 Sum 328.094 and -24. 304.094 What is -1 + -0.895087? -1.895087 26.2457 - 1908 -1881.7543 Calculate -255.5862 + -13. -268.5862 What is -364833391 + 5? -364833386 Total of 0.4 and -0.239272646. 0.160727354 Work out 0 + -228268. -228268 Add 728419 and 588.16. 729007.16 What is the difference between 1.837 and -15744.91? 15746.747 Work out 181964.3505 - -0.2. 181964.5505 Subtract 268040.42 from -0.758. -268041.178 -20 + 0.551664 -19.448336 Add 0.23 and 5548947457. 5548947457.23 Put together 296793 and 62392. 359185 What is 0.05 + -413754073? -413754072.95 What is -0.2546 minus -8318? 8317.7454 What is 34 minus 1646076? -1646042 Put together 40.989 and -119325. -119284.011 Put together -33338 and -660. -33998 -515177.06 + -0.41 -515177.47 Total of -0.0535384 and -4225. -4225.0535384 Calculate 3337363633 - -3. 3337363636 What is the difference between 26811 and 155? 26656 What is the distance between 1.8 and 0.090299864? 1.709700136 What is the difference between -486.84 and -30.7317? 456.1083 -9 + 917.775 908.775 What is the difference between 1374.767 and 1063? 311.767 What is -31.9338 minus 8.9? -40.8338 What is 74.99354389 minus 1? 73.99354389 Subtract 0.2 from -124611390. -124611390.2 What is the difference between 0.815 and -126875090? 126875090.815 What is 10.9 - 34743? -34732.1 What is -5837.513 plus 0.03? -5837.483 Work out -5.305 - 1231787. -1231792.305 What is -1279 - -1741890? 1740611 Sum -0.146 and 218364. 218363.854 Sum 6 and -2172.69051. -2166.69051 What is the distance between -1109922 and 13? 1109935 Calculate -6171.025 + -0.15. -6171.175 What is the distance between -996 and -273273? 272277 Put together 0.902368585 and 0.1. 1.002368585 What is -14835.2 + 50782? 35946.8 Add together -14730 and 29.62179. -14700.37821 What is -2419543 plus -311? -2419854 Add 2104.09 and 0.099392. 2104.189392 Calculate -0.4026 - 19857. -19857.4026 Add -74909.5 and -0.03. -74909.53 What is -0.3 take away 10.518336? -10.818336 Calculate 3 + -250946007. -250946004 Work out 8.98665 - 440.5. -431.51335 Add -41.094 and -45.71. -86.804 What is 267126104 + 1? 267126105 What is 0.494609 less than 0.1362? -0.358409 What is 2601491 less than -25.25? -2601516.25 Total of 36.5 and 47549629. 47549665.5 What is 0.1 minus 214646.1099? -214646.0099 What is 0.195559 take away -60331? 60331.195559 Add -1.52566 and -1.3. -2.82566 Work out -0.0725 - -589.467. 589.3945 What is -7692397805 plus 0.2? -7692397804.8 What is the distance between -9009498538 and 1? 9009498539 8286139713 - -0.2 8286139713.2 What is 770.3 take away -2283? 3053.3 Subtract -5 from 246020.889. 246025.889 Work out 1393544.36 - 251. 1393293.36 What is 2 take away 1148971428? -1148971426 What is -95822 minus 139? -95961 What is 0.177 less than 0.06725? -0.10975 Total of -488725 and 5.041. -488719.959 What is 2196 less than -11800? -13996 Put together 2 and 537686121. 537686123 Total of 0.07 and -405.1511. -405.0811 What is the distance between -3778993.6 and 4? 3778997.6 Put together -3 and -21.59545. -24.59545 Work out 3.9144797 - 129. -125.0855203 What is -404796.965 less than 5? 404801.965 What is -16 less than -193.0384173? -177.0384173 Sum 159 and -616564. -616405 Work out 0.7 + -2059298. -2059297.3 What is -0.7 take away 287076158.2? -287076158.9 Work out 17950609.1 - -0.3. 17950609.4 -32 + -682.041 -714.041 Subtract 12292049115 from -0.4. -12292049115.4 -53.8 + 52719349 52719295.2 Subtract -41.17 from 4563. 4604.17 Work out -17571282053 + 0.1. -17571282052.9 What is 374.231 plus -15606? -15231.769 Work out -1414.32 - 3. -1417.32 Calculate 2.4194464 + -0.054. 2.3654464 Sum 13418736 and -1.3. 13418734.7 What is -3 minus 15883674663? -15883674666 Calculate -2.001 - -475. 472.999 What is 0.06863 - -7294545? 7294545.06863 Put together 2234 and -345.9. 1888.1 What is 226 + -25.807897? 200.192103 What is the difference between -7391 and -11197191? 11189800 What is -92.2319 take away -0.031? -92.2009 What is the distance between 13 and 0.47051852? 12.52948148 What is 26 less than -10611168? -10611194 51060034 - 0 51060034 What is 0.3 minus -1179191622? 1179191622.3 What is the distance between -5 and -15.2465? 10.2465 What is 33689769 minus 0.77? 33689768.23 Work out 44.5822 - 134.8. -90.2178 What is the difference between -16044 and -0.178? 16043.822 What is -2 minus -3.0419213? 1.0419213 Subtract 3908620 from 1. -3908619 93 - 2.01466 90.98534 What is 181.284 minus 0.219? 181.065 What is 58080 less than -0.2? -58080.2 Work out -165794 - -154.9. -165639.1 Work out -2 + 27322804. 27322802 Subtract -96483 from 13.5629. 96496.5629 What is -2846 - -7.148? -2838.852 What is -108.9 - 0.503497? -109.403497 0.4 + 0.340197562 0.740197562 Work out -6481174369.9 + -2. -6481174371.9 What is -0.0144 - -97365? 97364.9856 Calculate 2.5697 + -271. -268.4303 What is the distance between -980.01 and 229? 1209.01 Add -0.33815 and -13. -13.33815 -0.3 - 32.328913 -32.628913 Work out 0.1543 - 55161. -55160.8457 Put together 0.2 and -1573079.02. -1573078.82 Put together -24 and -471.56. -495.56 Total of -8547 and 530746. 522199 -0.3 + 4097165671 4097165670.7 What is 51200663 - 0.278? 51200662.722 What is the difference between 115.481 and -0.062? 115.543 What is -8447616 minus 2? -8447618 Calculate -9.1 - 120708. -120717.1 What is -65681865448 + -1? -65681865449 Work out -7308928 - 28. -7308956 What is 0.012 plus 235.9486? 235.9606 Work out -642.781 - 449. -1091.781 What is -4239976716 less than -0.01? 4239976715.99 What is the distance between 40597836 and -2? 40597838 Calculate 2 + -0.325557335. 1.674442665 Add together -415 and 8378. 7963 What is 22727 - 313240? -290513 What is the difference between 1055.05 and 34.222? 1020.828 Calculate 428699 + -15200. 413499 Work out -20.1 + -55530675. -55530695.1 What is the difference between -47 and -0.07527? 46.92473 Subtract -7 from -28748017. -28748010 What is 2 - 31422231? -31422229 Calculate 2.8 + 1241371. 1241373.8 Subtract 8 from -4403332466. -4403332474 What is the distance between 571.8885 and 1854.5? 1282.6115 What is 0.2 less than 7836034.54? 7836034.34 Calculate 9 + -566699211. -566699202 Sum 1.05 and -296599. -296597.95 What is -7983 take away -628? -7355 What is the distance between -17121 and 36683? 53804 What is 11057542 less than -5? -11057547 What is the distance between 0.3 and 54141874.773? 54141874.473 -52.8956 - 11.6 -64.4956 What is the distance between -9999414 and -0.5? 9999413.5	{ "pile_set_name": "DM Mathematics" }
(h(hh*(3/4)/h)/hh))/h))/h))) assuming h is positive. h*(-1117/28) Simplify ((q/(qqq/(qqq(-3))qq))39)8 assuming q is positive. q(-1560) Simplify (v(-2))(-47)/(v(-2))(-30) assuming v is positive. v34 Simplify (o(-1/20)/oo)/oo/((o(3/4)/o)/oo) assuming o is positive. o(1/5) Simplify ((r(1/4))26)(32/7) assuming r is positive. r(208/7) Simplify n(3/17)nnnn22 assuming n is positive. n(428/17) Simplify (s1)(-5/2)/(s/s*(-2/3)s(1/5)) assuming s is positive. s(-131/30) Simplify ((o(-2/3)/o)/o)/o(-1) assuming o is positive. o(-5/3) Simplify ((a(-1/4)a)/a(2/3))/(aa(aa(a/(a1a))/aa)/aaa)10 assuming a is positive. a(-479/12) Simplify (((xxx(1/4)/xxx)/x)(-35))(-2/57) assuming x is positive. x(105/38) Simplify (i(2/15)/i)/((i(-1/8)/i)/ii)i2i(7/5) assuming i is positive. i(439/120) Simplify (hhh*(-4/9))/h((((hhh*(-6/13))/h)/h)/hh)/h assuming h is positive. h(-106/117) Simplify w(-4)/(w/(ww/w(-1/2)w)) assuming w is positive. w*(-3/2) Simplify (nn*22)/nn22 assuming n is positive. n44 Simplify (f/(f/(ff(-1)ff)fff)f)(6/23)f(1/7)/f1 assuming f is positive. f(-6/7) Simplify (d/(d/((d(-1)d)/d))d)*(-3/19)d*7dd/d(1/6) assuming d is positive. d(53/6) Simplify o(2/17)o/(ooooo(-7)) assuming o is positive. o(70/17) Simplify (f*(-1)f)/f(-3) assuming f is positive. f3 Simplify (aaaaa*(2/11)a)*(-5)/(aa/(a*(-1/3)aa)a)(-22/5) assuming a is positive. a(-3307/165) Simplify (v7)37 assuming v is positive. v*259 Simplify ((zz*(1/3)/zz)/z(1/4))/(z2z(-1/2)) assuming z is positive. z(-5/12) Simplify k0kkk*(-1)k*3kk(-2/17) assuming k is positive. k(83/17) Simplify bb*(-33)bb(2/21) assuming b is positive. b(-649/21) Simplify (o/o(-7/5))/oooo(-15) assuming o is positive. o(-58/5) Simplify (o/(o*(1/2)/o)o)12/((o/o(-2/17)oo)/(o/o(-1/6))) assuming o is positive. o(2861/102) Simplify ((vvv*(-2)v)(-22))(-6/19) assuming v is positive. v*(132/19) Simplify ((ii(-1))/i)38/(i/(i/(ii(4/3)i))i5) assuming i is positive. i(-139/3) Simplify ((ss/(s/(s*(-8/3)/s)))/(ss*6s))/(s0/((s/s3s)/s)) assuming s is positive. s(-38/3) Simplify ((j(-4)/j)/jjj(1/8)/j)/(j/j(-9)jj(-2/19)) assuming j is positive. j(-2549/152) Simplify (f0f)*(-13)/((ff9/f)/f(3/5)) assuming f is positive. f(-107/5) Simplify (h(-2/21)/(h(-5)/h))37 assuming h is positive. h*(4588/21) Simplify ii*(-7/5)i(ii/(ii(-12)))/i assuming i is positive. i(63/5) Simplify (q(1/4)q*(-5)q)/(q*(-3)((q(3/7)/q)/q)/q) assuming q is positive. q(51/28) Simplify (k(-3))(17/5) assuming k is positive. k(-51/5) Simplify (a(1/23)/(a/a(-2/3)))(2/37) assuming a is positive. a*(-224/2553) Simplify ((oo*(20/9))/oo)23 assuming o is positive. o(667/9) Simplify iii*5/iiii(-3)/i assuming i is positive. i4 Simplify (ww/(w/(w/w(-3/5)))w)/(ww(1/6)) assuming w is positive. w(73/30) Simplify s(-15)s(2/5) assuming s is positive. s(-73/5) Simplify t(-2/15)/t(-1/6) assuming t is positive. t(1/30) Simplify ((h/h(-3))/((h(3/5)/h)/h))/(h(-1/4))1 assuming h is positive. h(113/20) Simplify x*31x/((x/(x/(x*17xx)x))/x) assuming x is positive. x15 Simplify (t23t)(-3) assuming t is positive. t(-72) Simplify (((ww4/w)/w)/(w/(w(-4)w)))/((w/(w(-3)ww))/((w(-1/7)/w)/w)) assuming w is positive. w(-36/7) Simplify ((v(-3/7)/v)/vv7)(4/7) assuming v is positive. v(128/49) Simplify (m(2/11)/(m/m(-5)))(-12/7) assuming m is positive. m(768/77) Simplify k/k(-20)k8 assuming k is positive. k29 Simplify (qq*14q)/qq(-48) assuming q is positive. q(-33) Simplify (lll(2/3))(-31) assuming l is positive. l(-248/3) Simplify ((w/(w/w(-1/2)))/w)(-15)/(w(2/13)/(w(-1/5)w)) assuming w is positive. w(3009/130) Simplify (t/t(-2)t/(tt*3t))/((t*4t)/(t8/t)) assuming t is positive. t Simplify (n(-2/3)/nnn*(-2))/(nn*3n(-1)) assuming n is positive. n(-17/3) Simplify ((n/(nn(-1)nn))(-1/2))(-24) assuming n is positive. n(-12) Simplify (ii/i*(1/8)i)/(i/i*(-2/7))iii(ii/(iii*4ii))/iii/(((ii*(-3)i)/ii)/i) assuming i is positive. i(89/56) Simplify (w(-1/10))41 assuming w is positive. w(-41/10) Simplify (((m/(m/m(2/3)))/m)/m)(-16/9)/((mm(-1))/m)(-6) assuming m is positive. m*(-98/27) Simplify (((yyy2yyyy)/y)/(y/(yy/(yy(((y/y(8/7))/y)/y)/y))))(35/4) assuming y is positive. y80 Simplify (t(-2/9)t)(13/7) assuming t is positive. t(13/9) Simplify (z12)(-3/20) assuming z is positive. z(-9/5) Simplify dd*(-1/9)/dd37 assuming d is positive. d(332/9) Simplify p/(p/(p/(p/p*(-8)))p)p(((((p/(p/(p*(4/3)/p))p)/p)/pp)/pp)/p)/pp(-1/5)/(p(ppp/p(-8))/p) assuming p is positive. p(-313/15) Simplify (h*(2/5)h)/h(-20) assuming h is positive. h(107/5) Simplify y/(y/y*2yy)y*(-3)y/(y(y/(y/(y/(yy*(-4/3))y)))/y)y/((yy(1/4))/y) assuming y is positive. y(-43/12) Simplify ((gg/(gg*(-3)/g)g)/g)(12/19) assuming g is positive. g(60/19) Simplify (b(-1/41))(-27) assuming b is positive. b(27/41) Simplify (z(-1/4))*10/(z/(zz*(-2))zz(-2)) assuming z is positive. z(-7/2) Simplify (p(1/2)p)/(p/(pp(2/3)p))(pp/(p/(p/p*(2/11))p)pp)/(p/p3) assuming p is positive. p(527/66) Simplify (w(-23/5))22 assuming w is positive. w*(-506/5) Simplify (s/(ss/(ss(-1/2))))(-10/11)s*(4/9)(ss4)/ss assuming s is positive. s*(584/99) Simplify ((yyyy/y*(2/5)y)(-3/22))(-43) assuming y is positive. y(2967/110) Simplify u(-1/3)/(u/(uuu*1/uuu)uuu) assuming u is positive. u*(-1/3) Simplify (zz/(z/(zz(-2/3)/zz))z/z4)44 assuming z is positive. z(-220/3) Simplify (d(dd(-2/3)dd)/d)10/(d(-2)d(dd/((ddd/d*0ddd)/d)dd)/d) assuming d is positive. d(79/3) Simplify t(-2)t23 assuming t is positive. t21 Simplify w(-2/21)/(ww/(w2/w)) assuming w is positive. w(-23/21) Simplify (i/((i*(-2/9)/i)/iii)ii)/ii*(-1/3)/i(ii/(i/(i/(i/(i/(i/i(-2)))))))/i(1/2) assuming i is positive. i(-11/18) Simplify (cc*(-2/3)cc)/c(-1/2) assuming c is positive. c(17/6) Simplify (tt(3/8))/(t/(t(-23)t)) assuming t is positive. t(-173/8) Simplify (o(1/14)o)/((o*(3/20)o)/o) assuming o is positive. o(129/140) Simplify d(-2/43)d/(d11d)d assuming d is positive. d(-432/43) Simplify (u/u(2/71))/u(-1) assuming u is positive. u(140/71) Simplify s/(((ss*(11/5)s)/s)/s)s(6/11) assuming s is positive. s(-36/55) Simplify (((rr/r(-2/7))/r)/r(-2/11))/((r*(2/13)r)/r(-3)) assuming r is positive. r(-2689/1001) Simplify (((k*(-2/7)/k)/kk)(1/9))(-15/7) assuming k is positive. k(15/49) Simplify c3/((c(c/((c/(c/c(-1)))/c))/c)/cc)(cc*(3/8))/(cc/c*(-9)c) assuming c is positive. c(-85/8) Simplify t2/t*(-2/11)tttt(2/17)t*(-2/15)t assuming t is positive. t(17296/2805) Simplify (k(-1)/k)(-27/2)/(k(-6)/kk6) assuming k is positive. k28 Simplify (g/g(-19)g)/g(-2) assuming g is positive. g23 Simplify v(2/17)/((v/v(1/6))/v) assuming v is positive. v*(29/102) Simplify cc/(ccc*4/c)c*2(c*(2/7)/cc)/(c/(((((cc(-1/5))/c)/c)/cc)/c)) assuming c is positive. c(-137/35) Simplify (c(-1/3)ccc(-8))/(c2/c)(-27) assuming c is positive. c(62/3) Simplify w(-3/4)w(13/4)/w assuming w is positive. w(3/2) Simplify ((k(-2/5))(1/22))(3/22) assuming k is positive. k(-3/1210) Simplify (z(z(-19/3)/z)/z)/(z/(zz(zz/(z*(-2/19)/z)z)/z)) assuming z is positive. z(-184/57) Simplify (t/t0tt(2/21))/(t(-5)t(5/6)/t) assuming t is positive. t(305/42) Simplify (i/(i/(ii(3/14))))/(i(2/13)i) assuming i is positive. i(11/182) Simplify (iii(i/(i*(-6)/i))/iii/i(2/9))(-2/27) assuming i is positive. i(-212/243) Simplify (l6l*(-1/8))/(ll*(-1)l4) assuming l is positive. l(15/8) Simplify t*(8/7)t(-4) assuming t is positive. t(-20/7) Sim	{ "pile_set_name": "DM Mathematics" }
ed without replacement from {j: 1, a: 3, s: 2, c: 1}. What is prob of sequence ajcs? 1/140 Calculate prob of sequence fdv when three letters picked without replacement from {s: 1, v: 2, f: 3, d: 1}. 1/35 Two letters picked without replacement from hcy. What is prob of sequence hy? 1/6 Two letters picked without replacement from {c: 2, v: 5, o: 1, m: 3, n: 5, p: 4}. What is prob of sequence nc? 1/38 Four letters picked without replacement from {o: 1, k: 2, v: 5, x: 2, t: 3, r: 6}. Give prob of sequence rrxt. 5/2584 Calculate prob of sequence bw when two letters picked without replacement from uwrbiwiirwi. 3/110 Two letters picked without replacement from bknwwn. What is prob of sequence kb? 1/30 Calculate prob of sequence fclh when four letters picked without replacement from hhhfchllccfc. 8/1485 What is prob of sequence nrnj when four letters picked without replacement from {n: 3, j: 1, r: 5}? 5/504 Calculate prob of sequence tss when three letters picked without replacement from teeesseqeeeq. 1/660 Three letters picked without replacement from {k: 9, e: 5}. Give prob of sequence kke. 15/91 What is prob of sequence hhnh when four letters picked without replacement from {h: 13, j: 1, n: 1}? 11/210 Four letters picked without replacement from kqyhqkkkhyhkk. Give prob of sequence kkkh. 3/143 Three letters picked without replacement from {p: 5, g: 4, z: 6}. What is prob of sequence pzg? 4/91 Three letters picked without replacement from mxzxmbmzbxgmzmzmmzgx. Give prob of sequence ggx. 1/855 Three letters picked without replacement from gglllvlvvl. What is prob of sequence llv? 1/12 Calculate prob of sequence tt when two letters picked without replacement from {w: 4, t: 10, m: 2}. 3/8 Calculate prob of sequence plap when four letters picked without replacement from {p: 6, l: 1, a: 4}. 1/66 Two letters picked without replacement from {e: 16, r: 3, a: 1}. What is prob of sequence ee? 12/19 Calculate prob of sequence nmb when three letters picked without replacement from mpbbanmbxbaaxxmp. 1/280 Four letters picked without replacement from ashwswshwssha. What is prob of sequence aahw? 3/2860 What is prob of sequence uu when two letters picked without replacement from uuuuuuuuuuuuuugugu? 40/51 Three letters picked without replacement from {b: 2, y: 2, h: 1}. What is prob of sequence ybh? 1/15 Two letters picked without replacement from {m: 15, v: 3, y: 2}. What is prob of sequence vm? 9/76 Two letters picked without replacement from cqcsszfiq. Give prob of sequence qf. 1/36 Three letters picked without replacement from {m: 1, i: 14}. Give prob of sequence mii. 1/15 Calculate prob of sequence ll when two letters picked without replacement from lllmmllllll. 36/55 Calculate prob of sequence gun when three letters picked without replacement from ncnzbczcznnzgu. 1/546 Calculate prob of sequence opj when three letters picked without replacement from ojjonpnqonpjojjnq. 1/102 Calculate prob of sequence uieu when four letters picked without replacement from {u: 3, b: 1, i: 1, e: 2, a: 3}. 1/420 Four letters picked without replacement from {q: 6, x: 10, e: 1}. Give prob of sequence exxq. 9/952 Two letters picked without replacement from {d: 4, v: 1, u: 2, r: 5, p: 4, n: 4}. Give prob of sequence uu. 1/190 Calculate prob of sequence owxx when four letters picked without replacement from {o: 2, w: 7, x: 2}. 7/1980 Calculate prob of sequence loz when three letters picked without replacement from ovtpzlo. 1/105 Three letters picked without replacement from {q: 2, f: 3}. Give prob of sequence qfq. 1/10 What is prob of sequence vijj when four letters picked without replacement from vsuijijuujjjujiv? 3/728 Three letters picked without replacement from nvqenvdnvnoeqddqv. Give prob of sequence qno. 1/340 Calculate prob of sequence zu when two letters picked without replacement from inmzzimmuzsnum. 3/91 Four letters picked without replacement from jbjbjjjj. What is prob of sequence jjbb? 1/28 Calculate prob of sequence ji when two letters picked without replacement from {o: 1, j: 16, i: 3}. 12/95 Two letters picked without replacement from {u: 2, j: 2, n: 1, s: 1, y: 6}. What is prob of sequence ns? 1/132 Two letters picked without replacement from ddhddhh. Give prob of sequence hh. 1/7 Two letters picked without replacement from {c: 2, r: 2, u: 1, f: 1}. Give prob of sequence cc. 1/15 What is prob of sequence ssi when three letters picked without replacement from isssssssssss? 1/12 Two letters picked without replacement from {t: 1, d: 2, m: 3, x: 3, v: 1}. Give prob of sequence vt. 1/90 Three letters picked without replacement from {n: 1, k: 2, c: 3, r: 1, v: 2, d: 3}. Give prob of sequence kck. 1/220 Calculate prob of sequence tp when two letters picked without replacement from {p: 9, t: 5}. 45/182 Four letters picked without replacement from ononeeeonnonynonon. What is prob of sequence enny? 7/3060 Three letters picked without replacement from xrrrxxxxxxr. What is prob of sequence rrr? 4/165 What is prob of sequence usu when three letters picked without replacement from {l: 2, m: 1, r: 4, s: 7, u: 3, a: 1}? 7/816 Three letters picked without replacement from {k: 8, n: 3}. Give prob of sequence knk. 28/165 Four letters picked without replacement from nyxnnrvrnryxnn. Give prob of sequence ynnv. 5/2002 Two letters picked without replacement from pppapfaafpckananp. What is prob of sequence nc? 1/136 Two letters picked without replacement from eeeehemwlhermehhwele. Give prob of sequence mw. 1/95 Two letters picked without replacement from nffuxfp. What is prob of sequence xu? 1/42 Three letters picked without replacement from lhlhlh. Give prob of sequence hlh. 3/20 Three letters picked without replacement from {d: 2, m: 4, j: 2, g: 5}. Give prob of sequence mgd. 10/429 Calculate prob of sequence yhhy when four letters picked without replacement from {y: 5, h: 2}. 1/21 Three letters picked without replacement from {s: 1, n: 1, m: 1, u: 1, x: 2, d: 1}. Give prob of sequence mds. 1/210 Calculate prob of sequence xo when two letters picked without replacement from {x: 1, o: 18}. 1/19 Three letters picked without replacement from {n: 7, h: 2, r: 5}. Give prob of sequence hrr. 5/273 Three letters picked without replacement from {e: 7, c: 2}. Give prob of sequence eec. 1/6 Four letters picked without replacement from {w: 5, p: 9}. Give prob of sequence wwpw. 45/2002 Four letters picked without replacement from lidrliuuilnn. What is prob of sequence ndun? 1/2970 Two letters picked without replacement from gbbmbbmgjbbb. What is prob of sequence bm? 7/66 Three letters picked without replacement from zjjmj. What is prob of sequence jjm? 1/10 Three letters picked without replacement from spsz. What is prob of sequence szp? 1/12 What is prob of sequence yyh when three letters picked without replacement from fyfyofhhfooffhf? 1/455 Three letters picked without replacement from dladaaaaalad. What is prob of sequence aad? 21/220 What is prob of sequence vvcl when four letters picked without replacement from cnvunfflvulnvff? 1/2730 What is prob of sequence uu when two letters picked without replacement from uug? 1/3 What is prob of sequence wll when three letters picked without replacement from {k: 4, l: 2, w: 8}? 2/273 Two letters picked without replacement from fffbffbfffbfffff. What is prob of sequence fb? 13/80 Calculate prob of sequence ao when two letters picked without replacement from dabbouddawua. 1/44 Three letters picked without replacement from {e: 9, u: 5}. Give prob of sequence ueu. 15/182 Four letters picked without replacement from {s: 1, d: 11, k: 2}. Give prob of sequence dkks. 1/1092 Three letters picked without replacement from lfhwttt. Give prob of sequence lft. 1/70 Two letters picked without replacement from {q: 1, m: 1, e: 1, w: 1, t: 1}. What is prob of sequence mq? 1/20 Two letters picked without replacement from {j: 1, z: 2, c: 4}. Give prob of sequence cj. 2/21 Three letters picked without replacement from {n: 17, d: 2}. What is prob of sequence dnd? 1/171 Calculate prob of sequence eez when three letters picked without replacement from efzzzzfzzezzzfzzze. 1/68 Calculate prob of sequence tvs when three letters picked without replacement from {c: 1, s: 1, v: 4,	{ "pile_set_name": "DM Mathematics" }
alse Is 26581695697 a composite number? False Is 78821196581 composite? True Is 60833387038 a prime number? False Is 74764421 composite? True Is 951482237 a prime number? False Is 159202427 a prime number? True Is 6048805457 composite? False Is 12349447738 a composite number? True Is 3096066491 prime? False Is 9717899 composite? False Is 35749782883 composite? True Is 9051485071 a composite number? True Is 727397927 prime? True Is 170318876303 a prime number? True Is 33203109746 a composite number? True Is 5230796699 composite? False Is 51529017731 composite? False Is 61706581847 a prime number? True Is 675128171 prime? False Is 11868289967 a prime number? False Is 67750886051 a composite number? True Is 6708275738 a prime number? False Is 1025415011 prime? False Is 17956912877 composite? True Is 8155139177 a composite number? False Is 9246191369 a composite number? True Is 566387251 a prime number? True Is 443666099 a composite number? True Is 21909103771 a composite number? True Is 122540713 a composite number? False Is 89164697005 a prime number? False Is 10694699563 a prime number? True Is 4575925891 a prime number? False Is 6423210539 a prime number? False Is 24821537339 a composite number? False Is 14564043367 a prime number? True Is 2919560573 a prime number? True Is 4168299539 composite? False Is 2864610299 a composite number? True Is 813713933 a prime number? True Is 3380131247 a prime number? True Is 389670779 composite? False Is 463445287 a composite number? False Is 26779436653 composite? False Is 3457806277 prime? True Is 3661875397 a prime number? False Is 5047710821 prime? True Is 20054023 prime? False Is 45728068501 a composite number? False Is 17679945557 prime? False Is 7815321497 a prime number? True Is 1277559043 a prime number? False Is 7554492707 prime? True Is 2562837721 a composite number? True Is 2167565041 prime? True Is 12067569923 prime? False Is 12417249067 a prime number? False Is 23874475489 a composite number? True Is 4889856311 composite? True Is 1966933213 a prime number? False Is 38255938649 a prime number? True Is 86393336173 a prime number? True Is 2730588013 a composite number? False Is 283448141 composite? False Is 23155199749 prime? False Is 3027391151 a prime number? True Is 16665924731 composite? True Is 22101567181 a prime number? True Is 38045849 composite? False Is 202518367 a prime number? False Is 1391985763 composite? True Is 610081267 composite? True Is 1847901493 composite? False Is 18084510907 a composite number? True Is 170186447 a composite number? False Is 2629111307 prime? True Is 42536327 prime? False Is 15485958197 a prime number? True Is 363988837 prime? True Is 3720229439 prime? True Is 40938924631 composite? True Is 32551712527 prime? False Is 17223353261 prime? True Is 1035666139 prime? True Is 4297404887 prime? False Is 627473123 composite? True Is 4851920369 a prime number? False Is 5871876743 prime? False Is 10915690693 prime? False Is 118002336463 a prime number? False Is 34643729807 a composite number? True Is 25306977 a prime number? False Is 18379702973 prime? False Is 34398812473 a composite number? True Is 48432376659 a prime number? False Is 1318125793 composite? False Is 30938190827 composite? True Is 799698659 a prime number? True Is 7873048159 a composite number? False Is 7933020611 composite? False Is 10194430661 a prime number? False Is 34426681 composite? False Is 4393471759 a composite number? False Is 3652733327 prime? False Is 15148588129 a prime number? False Is 242523517 composite? False Is 1179289619 prime? False Is 12246300887 composite? False Is 121961942057 composite? True Is 83691613 composite? False Is 181612363 composite? True Is 395317771 prime? True Is 4763501753 prime? True Is 3666749279 prime? True Is 15569469143 a prime number? False Is 689028391 a composite number? False Is 72563791 a composite number? True Is 31599408287 a composite number? False Is 818478013 composite? True Is 1178568077 a composite number? True Is 33191771 composite? True Is 3315485245 composite? True Is 208569265 a composite number? True Is 30002390497 composite? True Is 823414538 composite? True Is 432111599 a prime number? True Is 5244065171 a composite number? True Is 3921053249 prime? False Is 9488515921 a prime number? True Is 79109215247 prime? False Is 42562607 a prime number? True Is 30549136762 a prime number? False Is 55298076959 composite? False Is 180871961 prime? True Is 38604352307 a composite number? True Is 14541135437 a composite number? True Is 36048129539 a composite number? False Is 1834126339 a composite number? False Is 6621721973 a composite number? False Is 86269977017 prime? False Is 350377751 prime? True Is 43403362033 composite? False Is 14704354891 prime? False Is 126234599 a composite number? False Is 1055830691 a prime number? True Is 23340034567 prime? True Is 28064721559 a prime number? False Is 121290968329 a prime number? True Is 1270632449 prime? True Is 22671598793 a composite number? False Is 1281710587 prime? True Is 698848877 a prime number? True Is 32901386273 prime? False Is 292414642873 a composite number? False Is 491215409 a composite number? True Is 1802905019 a prime number? True Is 3400184399 a composite number? True Is 1564422601 a prime number? False Is 134805929 composite? False Is 1498649437 composite? False Is 39711706813 a prime number? True Is 16626903603 a prime number? False Is 82212773 composite? False Is 76044798419 prime? False Is 134738707447 a prime number? True Is 1795849457 composite? False Is 61951137995 prime? False Is 19241878661 prime? True Is 13133790289 composite? True Is 100376872289 a composite number? False Is 986437471 a composite number? False Is 132299533 a prime number? False Is 14318278063 composite? False Is 23297888723 a prime number? False Is 17504565889 a composite number? False Is 2977313099 composite? False Is 94684027 composite? False Is 197521023471 a prime number? False Is 4713390821 a composite number? False Is 1753535611 a prime number? True Is 1578091241 a prime number? True Is 2774813861 a composite number? False Is 34253001421 composite? True Is 8142557149 prime? True Is 272764823 composite? False Is 15577675049 a prime number? True Is 24433592851 prime? True Is 1014738629 prime? False Is 4487763289 composite? True Is 139098779 a prime number? False Is 910592035 a prime number? False Is 9084173731 prime? True Is 936245671 a prime number? False Is 6564348541 prime? True Is 1663412327 prime? True Is 48810029 prime? False Is 451788037 prime? True Is 3001169207 a prime number? True Is 25356329121 composite? True Is 5163100553 composite? True Is 1433273665 prime? False Is 474338563 prime? True Is 50360932957 a prime number? False Is 159222839 composite? False Is 613441561 prime? True Is 2636702527 a prime number? False Is 3441443479 a composite number? False Is 1064505997 a prime number? True Is 836040371 a composite number? True Is 284165465939 composite? False Is 48083790817 composite? True Is 932470457 composite? True Is 28601461 composite? True Is 170215794011 composite? False Is 68951693 a composite number? False Is 197547671 composite? True Is 5261517934 prime? False Is 2438219911 prime? True Is 846057851 composite? False Is 745786913 a composite number? False Is 3038324581 a prime number? True Is 4046283677 a composite number? True Is 2771669 prime? True Is 4821100939 a prime number? False Is 51594653203 prime? True Is 4649434105 a prime number? False Is 2526307193 composite? False Is 30010070527 a composite number? False Is 142930537 a composite number? True Is 524286799 composite? True Is 5893949497 a composite number? False Is 600040417 composite? False Is 87967669697 composite? True Is 41073462109 prime? True Is 31059213769 prime? True Is 7882403 composite? True Is 142194878909 a prime number? True Is 12194938157 a composite number? False Is 1740609223 composite? True Is 4112656817 prime? True Is 19581613639 a composite number? True Is 5501935661 a prime number? True Is 282954767 composite? True Is 746311409 prime? True Is 61885788197 prime? True Is 1422416647 prime? False Is 1233180077 a composite number? False Is 63777059 composite? False Is 3485297329 prime? True Is 536903054	{ "pile_set_name": "DM Mathematics" }
ltiple of 27? True Let a be ((-33)/6)/((-1)/2). Let f = a - 9. Suppose 5o + 4g = 171 - 43, -2o + 50 = fg. Is 19 a factor of o? False Let o = -218 + 61. Let d = -99 - o. Does 16 divide d? False Suppose 3n + 696 = -2q + 3q, 0 = -5q + 2n + 3454. Suppose q = 2s + 3s. Does 12 divide s? False Let w(v) be the first derivative of -5v*2/2 + 13v + 3. Let q be w(13). Let t = 87 + q. Is t a multiple of 17? False Suppose -2c - 94 = -4d, -5d - 2c + 88 + 25 = 0. Let p(w) = 3w + 8 - d + 6. Does 9 divide p(9)? True Suppose -135n + 132n - 3k + 2505 = 0, k = 2n - 1685. Does 20 divide n? True Let j be 0/((-1)/(-2 + 3)). Suppose j = 7x - 5x - 2. Is 5 a factor of 70/14 + (x - -1)? False Let s be (6 + -3 - 13)48. Suppose 2a + 9 - 1 = 4w, -2w = a + 8. Is 20 a factor of a/(-4)s/(-9)? True Let g(h) be the first derivative of -61h4/4 - 2h3/3 - h2 - h - 27. Is 30 a factor of g(-1)? True Let l = 9 - 2. Let u be (0 - -1)/(l/35). Suppose -5z - 18 - 58 = -2y, -z + 190 = uy. Does 8 divide y? False Let h(l) = -l3 - 6l*2 - 6l + 11. Suppose 5p = -2p - 42. Is h(p) a multiple of 6? False Suppose 5c + z = -0z + 7, 3z = -9. Suppose -2h + 8 = c. Does 2 divide h? False Suppose -96976 = 7w - 83w. Is 29 a factor of w? True Let h(y) = y*3 + 13. Let l be h(0). Is l(3 + -2) - 3 a multiple of 10? True Suppose 3y - 510 - 1167 = s, 4y - 2234 = 2s. Does 20 divide y? True Let y = -1726 - -2689. Does 52 divide y? False Suppose 94 - 84 = 5u. Let p(o) = o + 3. Let g be p(-5). Is 35 a factor of 149/((-2)/u - g)? False Let w(r) = -r*2 - r + 1. Let k(s) = 7s*2 + 6s - 5. Let t(c) = 2k(c) + 10w(c). Let a be t(-3). Suppose -2x + 2 = -a. Is x a multiple of 6? False Is 68 a factor of (-4 - -853) + -4 + 4 + 0? False Let r(c) be the third derivative of c5/60 - 13c*4/24 - 10c3/3 - c2. Suppose 3t = 2v - 26, 3v + v = -5t + 74. Is 15 a factor of r(v)? False Let d = -11 - -1. Is ((-1)/(d/186))/((-18)/(-90)) a multiple of 36? False Let j be (-3)/(-7) + (-108)/(-42). Suppose m - 31 = -r + 6m, 0 = jr - 2m - 54. Is r a multiple of 12? False Let s(r) = -r3 - 11r*2 + 3. Let u be s(-11). Let p be 36/15 + 3/5. Suppose 0 = -4k + x + 20 + p, 4x + 14 = uk. Does 3 divide k? True Suppose c + 97 = 2c - 5i, -601 = -5c - 4i. Let t = c - -3. Is t a multiple of 20? True Suppose -19t - 14381 = -33723. Does 10 divide t? False Let x(s) = s3 + 15s*2 - 16s + 8. Let k be x(-16). Let p = 59 + k. Suppose 9 = i - p. Does 38 divide i? True Suppose -3z + 52 = -0z + 4b, z + 2b - 14 = 0. Suppose 63 = -zv + 27v. Is v a multiple of 7? True Let t = 10 + -10. Suppose t = -j + 23 + 18. Suppose 0 = 2f + 3l - j, 15 = -5f - 5l + 125. Does 6 divide f? False Suppose 3037 = 5b - 3893. Does 18 divide b? True Suppose 0 = 5t + a - 33, -5a + 24 = 3t - 3a. Is t/(-3)70/(-4) a multiple of 10? False Does 13 divide (8/20)/(1/1465)? False Let y = 1947 + -981. Is 25 a factor of y? False Let a(g) = 91g + 50. Does 8 divide a(5)? False Is 89 a factor of 2945 + (-8 + 12 - (4 + 8))? True Is 47 a factor of (31 + 1)(52 + (-13 - -8))? True Suppose 3k = -2m + 344 + 598, 5k + 2m = 1574. Does 42 divide k? False Suppose -4b = -8b + 12. Suppose 7a = ba. Does 2 divide 1 - (-1 + (a - 0))? True Let l be 1/(-2) + 225/18. Let d = l - 6. Let x = 5 + d. Is x a multiple of 3? False Let y(t) = -17t + 3 - 5t*2 + 8t + 7t - t3. Does 5 divide y(-5)? False Suppose 30w + 1983 - 12693 = 0. Is w a multiple of 51? True Suppose 0 = i - 1 + 6, -c + 3i = -2522. Does 15 divide c? False Suppose 0 = t - 5n + 11 + 1, 5t + 40 = 5n. Let d(l) = -l*2 + 14l - 38. Let o be d(13). Let f = t - o. Does 6 divide f? True Suppose 4 = 4q - 8. Does 25 divide 241(16/4 - q)1? False Suppose 0 = 3f + 28 - 100. Does 12 divide f? True Let p = 1007 - -393. Does 28 divide p? True Let i(p) = p + 17. Suppose q - 18 = 3q + 2w, -4w = 2q + 24. Is 11 a factor of i(q)? True Suppose 3i - 464 - 1264 = 0. Is i a multiple of 36? True Let p(m) = -7m - 17. Let i be p(-5). Suppose -368 = 14w - iw. Does 41 divide w? False Let p be (-2 + -1)-1 - (-21 + 20). Suppose -k = -pk + 3x + 171, 5x + 120 = 2k. Does 30 divide k? False Let b(l) = 4l*3 - 14l*2 - 23l + 24. Does 54 divide b(12)? True Let w(a) = -a - 9. Let b be w(-7). Let n(l) = l2 - 1. Let v be n(b). Is (v/(-2))/((-5)/80) a multiple of 15? False Let i(z) = z2 - 19z + 51. Does 29 divide i(21)? False Let g = -3 - 12. Let f(h) = -h3 - 14h*2 - 2h + 25. Is 56 a factor of f(g)? True Let o(f) = 4f2 - 6. Suppose 2h - 4 = 0, -q + h = 4q - 13. Is 3 a factor of o(q)? True Let c(s) = s3 + 0s*3 - 479 + 487 - 20s2 + s. Does 7 divide c(20)? True Let i(n) = -n2. Let u(r) = -r*3 + 10r*2 - 13r + 29. Let y(s) = 4i(s) - u(s). Is 23 a factor of y(14)? False Suppose 5q = -3a + 10q + 1994, -1342 = -2a - 3q. Is 18 a factor of a? False Suppose -n + 21 = -0n. Suppose -4h - 5d + 39 = 0, h - n + 3 = -4d. Suppose -3w = 3x + h - 27, 4w - 7 = -x. Is x a multiple of 2? False Let f(n) = -n2 + 3n + 2. Let b = 8 + -6. Let x be f(b). Suppose 480 = 9a - xa. Does 32 divide a? True Let y = 3 + -1. Suppose z = -3, -5f + yf + 459 = -4z. Does 22 divide f? False Let f(o) = -22o - 28. Let r be f(-8). Suppose 152j - 120 = rj. Is 5 a factor of j? True Is 5/(4(-3)/(-480)) a multiple of 25? True Let y = -208 - -468. Does 65 divide y? True Let v(p) = p3 + 3p*2 + 2p. Let f be v(-3). Let w(a) = a*2 + 7a + 7. Let k be w(f). Is 12 a factor of 1 + k - (3 - 35)? False Let d = 427 - 207. Is d a multiple of 55? True Let q(i) = -18i + 16. Let w be q(-4). Suppose 4s = u - 4u + 92, 4s + 4u = w. Is s a multiple of 13? True Let d = 22 - 18. Is (-118)/(2 - d) - 2 a multiple of 7? False Let c = 2814 - 1227. Is 23 a factor of c? True Let m(w) = 2w*2 - 6w + 5. Let x be 16 - -2 - (5 + -3). Suppose 0j + x = 4j. Does 13 divide m(j)? True Let x be (2/3)/((-4)/(-36)). Suppose -2i - 2r = x, -5i + 0r + 25 = -3r. Suppose -is + 16 + 12 = 0. Is 7 a factor of s? True Let i = 111 + 4. Let j = i - 81. Is j a multiple of 6? False Suppose 149 = g - 3o, -427 = -4g - 2o + 197. Suppose -5i - 5f + g = 0, 0 = -i + 3i + f - 64. Let j = -15 + i. Is j a multiple of 6? True Is 3 a factor of (92/8 - 3)4? False Let a(p) = 5p + 20. Let g be a(-16). Is 4 a factor of (-88)/(-15) + (-8)/g? False Let n(s) = -2s2 + 9s + 1. Let y be n(8). Let m = -31 - y. Is 12 a factor of m? True Let l(u) = 33u + 12. Let w(a) = -8a - 3. Let g(m) = -2l(m) - 9w(m). Let i = 42 - 39. Does 10 divide g(i)? False Let f = -6 + 10. Suppose -55 = fw + 9. Does 19 divide 3 - (-64)/(w/(-4))? True Does 21 divide (((-8)/6)/(-2))/((-5)/(-2715))? False Suppose 2p + 4229 - 864 = -b, -p + 5b = 1655. Is (-6)/4p/36 a multiple of 10? True Let x = -1 - -5. Suppose p + 6 = -2a - 0a, -xa - 12 = 0. Does 6 divide 241/(1 - p)? True Suppose 5 = d - 8. Let n = d + -8. Let b(q) = -q*2 + 14q - 8. Is b(n) a multiple of 9? False Let p(v) = 5v + 6. Let s(z) = 14z + 19. Let r(i) = -17p(i) + 6s(i). Suppose -27g = -8g - 95. Does 2 divide r(g)? False Let s(a) = a*2 - 9a + 10. Let d be s(8). Suppose -do = -2y - y - 56, 4o + y - 126 = 0. Suppose 0 = 3j + 1 - o. Does 4 divide j? False Let z be (1 + 1)(-4)/(-8). Let i(r) = -13 + 9r + 3 - 2r + z. Is i(6) a multiple of 11? True Suppose 0 = -5i + 5a + 1460, 3i + 6a - 3a = 864. Does 29 divide i? True Let u(h) be the second derivative of h*3/6 - 7h*2/2 + h. Let w be u(3). Is (-42)/(0 + (w - -3)) a multiple of 12? False Let c(k) = k + 3. Let u be c(-5). Let l(y) = -6y - 3. Let b be l(u). Suppose 0 = 4a - ba + 40. Does 8 divide a? True Suppose 3c - 70 = 4i, c + 4i + 2 = 52. Let o = -64 - c. Let f = -65 - o. Is 6 a factor of f? False Suppose -3 = 2q - 13. Suppose -5z + n + 517 = 0, z + 0z - 119 = -qn. Is z a multiple of 26? True Suppose y = -4y + 75. Suppose -2o - y = -7o. Suppose 3w - 2d - 31 = 0, 0 = -ow + w - 2d + 34. Does 13 divide w? True Let n = 754 - -182. Does 109 divide n? False Suppose 3c + 6 = -3d, -2d + c = -c - 16. Suppose 4w - a = -2a + 525, da = -5w + 651. Does 12 divide w? True Suppose 5p = -u + 37, -33 = -u - p - 8. Let c = -3 + u. Is 9 a factor of c? False Let h = 543 -	{ "pile_set_name": "DM Mathematics" }
. 85320 What is the common denominator of 35/6479 and -48/220627? 4191913 What is the smallest common multiple of 150977 and 5644? 603908 What is the smallest common multiple of 498760 and 32? 1995040 Calculate the common denominator of 1/33340 and -89/130. 433420 Find the common denominator of 8/5241 and -119/18. 31446 What is the common denominator of -25/2088738 and -59/812287? 14621166 Calculate the least common multiple of 86858 and 20. 868580 Calculate the lowest common multiple of 2784 and 909. 843552 What is the common denominator of -89/72 and -23/33440? 300960 What is the common denominator of -83/168 and -115/5478? 153384 What is the common denominator of -89/9920 and -123/84320? 168640 Calculate the common denominator of 61/81 and 16/11. 891 Find the common denominator of 10/543 and 10/3. 543 Find the common denominator of 37/1017 and -53/206564. 1859076 What is the lowest common multiple of 48 and 51764? 621168 Find the common denominator of -65/72063 and -86/88077. 792693 Find the common denominator of 4/62991 and -8/81. 188973 What is the common denominator of -133/90 and 5/111927? 3357810 Calculate the common denominator of -31/40552 and -101/8. 40552 What is the lowest common multiple of 126756 and 380268? 380268 What is the smallest common multiple of 7152 and 44700? 178800 Calculate the least common multiple of 1059 and 1140. 402420 What is the least common multiple of 1836 and 1076? 493884 Find the common denominator of 43/286 and -53/4950. 64350 Calculate the common denominator of 10/369 and 65/13284. 13284 Calculate the least common multiple of 37888 and 6. 113664 Calculate the common denominator of -121/40 and 1/79920. 79920 Calculate the common denominator of -163/990 and -44/321. 105930 What is the lowest common multiple of 30 and 1232880? 1232880 Calculate the lowest common multiple of 3 and 72263. 216789 Calculate the least common multiple of 3540 and 23010. 46020 What is the common denominator of -155/7518 and -61/12530? 37590 Calculate the least common multiple of 82209 and 274030. 822090 Calculate the common denominator of 33/19160 and -131/100590. 402360 What is the lowest common multiple of 20538 and 2421? 5524722 Find the common denominator of 22/43 and 61/10148. 10148 What is the smallest common multiple of 1532 and 31023? 124092 What is the smallest common multiple of 1430220 and 726? 1430220 Find the common denominator of 97/178540 and -57/790. 178540 Find the common denominator of -119/24 and -139/84396. 168792 Calculate the lowest common multiple of 93750 and 150. 93750 What is the common denominator of 7/12 and -17/9219? 36876 Calculate the common denominator of -58/3425 and 93/200. 27400 Calculate the least common multiple of 3818 and 27556. 633788 Calculate the common denominator of -109/626178 and -13/60. 6261780 Calculate the lowest common multiple of 116824 and 20. 584120 Find the common denominator of -95/3108 and 161/540. 139860 Calculate the smallest common multiple of 3955 and 131080. 917560 Calculate the common denominator of -59/87802 and -99/31928. 351208 Calculate the smallest common multiple of 374912 and 82012. 2624384 Calculate the smallest common multiple of 20164 and 639. 181476 Find the common denominator of -97/540 and -32/729. 14580 Find the common denominator of 131/52938 and -7/18. 52938 What is the smallest common multiple of 816 and 16128? 274176 Find the common denominator of 45/444316 and 59/1582. 3110212 What is the smallest common multiple of 170703 and 312? 1365624 Find the common denominator of 55/14 and -1/2572. 18004 What is the common denominator of 13/4475 and -71/537? 13425 Find the common denominator of -45/19768 and 73/2824. 19768 What is the lowest common multiple of 221 and 37180? 632060 Calculate the least common multiple of 60 and 26763. 535260 Find the common denominator of 48/7 and -37/256264. 1793848 Find the common denominator of 41/630 and 109/126. 630 Find the common denominator of -87/8 and 7/1868942. 7475768 What is the common denominator of -7/968 and 79/4? 968 Calculate the common denominator of -15/140414 and 95/14. 982898 Calculate the common denominator of 62/11499 and -5/145654. 436962 Calculate the common denominator of 43/520194 and -9/958. 520194 Find the common denominator of 93/40 and 27/14416. 72080 What is the lowest common multiple of 636 and 60844? 182532 Calculate the common denominator of 9/102560 and 79/19230. 307680 Calculate the least common multiple of 215050 and 2300. 430100 What is the lowest common multiple of 80 and 267696? 1338480 What is the lowest common multiple of 6000 and 16000? 48000 Calculate the common denominator of 22/27 and -23/9618. 86562 Find the common denominator of 43/1323 and -52/81. 3969 Calculate the smallest common multiple of 43668 and 126. 305676 Calculate the smallest common multiple of 39320 and 4915. 39320 Find the common denominator of -97/390 and -73/7326. 476190 What is the smallest common multiple of 5 and 232000? 232000 Calculate the smallest common multiple of 2665 and 3. 7995 What is the common denominator of -64/20655 and -83/36? 82620 Calculate the common denominator of 52/4401 and -71/10269. 30807 Calculate the common denominator of 81/1480 and 41/6040. 223480 What is the lowest common multiple of 10 and 37330? 37330 What is the least common multiple of 260 and 13300? 172900 Calculate the common denominator of -73/807 and -133/6. 1614 Find the common denominator of 79/7988 and 9/40. 79880 Calculate the common denominator of 74/129789 and 53/143. 1687257 What is the lowest common multiple of 48 and 2640? 2640 Calculate the least common multiple of 25 and 11820. 59100 Find the common denominator of -55/50862 and -37/101724. 101724 Calculate the common denominator of -97/51160 and -91/110. 562760 Calculate the least common multiple of 6146 and 840. 368760 Calculate the smallest common multiple of 65483 and 35718. 392898 What is the least common multiple of 16272 and 345? 1871280 Calculate the common denominator of -83/108 and 77/212844. 1915596 Calculate the least common multiple of 651 and 20448. 4437216 What is the least common multiple of 72 and 13968? 13968 What is the smallest common multiple of 119 and 805? 13685 Calculate the common denominator of -71/3577959 and 103/1626345. 17889795 What is the common denominator of 85/29488 and -35/5092? 1975696 Calculate the smallest common multiple of 85578 and 816. 684624 What is the common denominator of 64/177 and -41/1467? 86553 What is the least common multiple of 126 and 197511? 8295462 Calculate the common denominator of -7/336222 and -55/74716. 672444 Calculate the lowest common multiple of 136880 and 547520. 547520 Calculate the common denominator of -155/528 and 173/14520. 29040 Find the common denominator of 5/364 and 37/24570. 49140 What is the smallest common multiple of 744 and 2184? 67704 What is the common denominator of -40/219 and 50/4161? 4161 Calculate the least common multiple of 49 and 93156. 652092 What is the smallest common multiple of 106212 and 584166? 1168332 Calculate the common denominator of -87/214 and 17/32. 3424 What is the common denominator of -37/50 and 38/4725? 9450 What is the common denominator of -103/34176 and -67/144? 102528 Calculate the least common multiple of 15 and 82539. 412695 Calculate the lowest common multiple of 83259 and 29. 83259 What is the smallest common multiple of 105456 and 105456? 105456 Calculate the common denominator of 47/3526984 and 35/32. 14107936 What is the least common multiple of 4064 and 1524? 12192 What is the smallest common multiple of 106909 and 33? 320727 Calculate the lowest common multiple of 31848 and 488. 1942728 Find the common denominator of 37/20 and 13/2484. 12420 Calculate the common denominator of 101/466340 and 139/350. 2331700 What is the smallest common multiple of 322336 and 483504? 967008 Find the common denominator of 25/22 and 41/4854. 53394 Calculate the smallest common multiple of 18 and 2916. 2916 What is the least common multiple of 155064 and 4004? 1705704 What is the smallest common multiple of 192745 and 5? 192745 Find the common denominator of 81/210260 and -71/16. 841040 What is the smallest common multiple of 1783618 and 6? 5350854 What is the l	{ "pile_set_name": "DM Mathematics" }
ms in -143d2 + 71d*2 + 70d*2. -2d*2 Collect the terms in 4p*3 - 5p*3 - 5p3 + p2. -6p3 + p2 Collect the terms in 40i + 4i2 - 3i*2 - 122i. i*2 - 82i Collect the terms in 2r3 - 709449r*2 + 709449r*2. 2r*3 Collect the terms in 19u*3 - 8u*3 - 15u*3. -4u*3 Collect the terms in -o - 19736o*2 + 19736o*2 + o - 29o*3. -29o*3 Collect the terms in 608i - 314i - 305i. -11i Collect the terms in -5z*3 + 3z*3 + 7z*3. 5z*3 Collect the terms in -61v + 3v2 + 134v - 9v - 64v. 3v2 Collect the terms in -16i*2 - 26i*2 + 17i*2 + 19i*2. -6i*2 Collect the terms in -415x + 170x + 209x. -36x Collect the terms in 310j*3 - 3j + 3j - 315j*3. -5j*3 Collect the terms in 1052s - 2100s - s2 + 1048s. -s*2 Collect the terms in 60659 - 60659 + 2p*2. 2p*2 Collect the terms in -31 + 0x + 128 + 2x. 2x + 97 Collect the terms in 0o2 + 6o*2 + 0o*2. 6o*2 Collect the terms in 84z*2 + 125z*2 + 26z - 26z. 209z*2 Collect the terms in 6b - b - 3b. 2b Collect the terms in 20y - 12y - 5y. 3y Collect the terms in -512 + 512 - 224u2. -224u*2 Collect the terms in 2405a - 2391a - 2 + 2. 14a Collect the terms in 44056s + 1 - 1 - 44056s - 2s3. -2s*3 Collect the terms in 76b*2 + 43b*2 + 22b*2 + 2b. 141b2 + 2b Collect the terms in 2q + 0q*2 + 0q*2 - 32q*3 + 2q*3. -30q*3 + 2q Collect the terms in 454h2 - 6h*3 + 7h*3 - 454h2. h3 Collect the terms in 9y3 - 30y*3 + 13y*3 + 12y*3. 4y*3 Collect the terms in -2v*2 + 43v*2 + 35v*2. 76v*2 Collect the terms in -33g + 33g + g2 - 1. g2 - 1 Collect the terms in -12a + 0a + 5a + a. -6a Collect the terms in 142w*3 - 289w*3 + 135w*3. -12w*3 Collect the terms in -64m*2 + 30m*2 + 22m*2. -12m*2 Collect the terms in 12c - 22c - 10c. -20c Collect the terms in 22g*2 + 19g*2 + 6g*2. 47g*2 Collect the terms in -73 + 73 - 4d*2. -4d*2 Collect the terms in -2w*3 + 6w3 - w3 + 0w3. 3w*3 Collect the terms in 3z*2 - 11226z + 5612z + 5614z. 3z2 Collect the terms in -2x*2 - 32x*2 - 2x + 3x. -34x*2 + x Collect the terms in -6b2 + b2 + 6b2. b2 Collect the terms in -57j*2 - 61j*2 + 121j*2. 3j*2 Collect the terms in -3i*2 - 12 + 5 + 7. -3i*2 Collect the terms in 84t*3 - 11t*3 + 46t*3. 119t*3 Collect the terms in -25d - 13d - 15d + 54d. d Collect the terms in 94o*2 - 159o*2 + 66o2. o2 Collect the terms in 42c2 + 28c*2 - 68c*2. 2c*2 Collect the terms in 8p - 4p - 40p. -36p Collect the terms in -4 + 4 + 70k. 70k Collect the terms in -2 - 49029s + 2s2 + 2 + 49029s. 2s2 Collect the terms in 25h + h - 19h - 6h - 3h. -2h Collect the terms in -40l3 - 28l*3 - 5l + 5l - 2l. -68l3 - 2l Collect the terms in -140k + 1 + 144k - 1. 4k Collect the terms in 63 + 1 - 61 - 3 - 2t*3. -2t*3 Collect the terms in 12o + 4o2 - 4 - 12o. 4o2 - 4 Collect the terms in 111n + 10n3 + 11n*3 - 113n. 21n3 - 2n Collect the terms in -2 + 0 + 3 + 13z2 - 4. 13z*2 - 3 Collect the terms in 22n*2 + 2n*2 - 67n*2 + 2n + 15n2. -28n*2 + 2n Collect the terms in 8 - 8 - 18s2 + 19s2. s2 Collect the terms in -11v2 - v2 - 3v*2 - 7v*2. -22v*2 Collect the terms in -4p3 - p3 + 7p3 + p3. 3p*3 Collect the terms in -6g*3 + 5486g*2 - 5486g*2 + 0g*3. -6g*3 Collect the terms in 16z - 3z + 9z*3 - 4z*3. 5z*3 + 13z Collect the terms in -8 + 0n2 + 7 + 12n*2. 12n*2 - 1 Collect the terms in -95 + 0v*2 + 196 - 101 + 4v*2. 4v*2 Collect the terms in -m + 23 + 5m - 6m. -2m + 23 Collect the terms in -38 - 36 + 74 - 5c. -5c Collect the terms in 4 - 5 + 10x - 167x + 3. -157x + 2 Collect the terms in -19n*2 + 0n*2 + 20n2. n2 Collect the terms in 20t3 + 11t*3 + 35t*3. 66t*3 Collect the terms in -61f - 65f - 63f + 187f. -2f Collect the terms in -14k - k - k + 15k - 4k. -5k Collect the terms in -11n3 - 12n*2 + 12n*2. -11n*3 Collect the terms in 5v*2 - 1905v + 1905v. 5v*2 Collect the terms in 51s*2 - 3s + 2s - 2s + 4s. 51s*2 + s Collect the terms in -79y + 65y + y2 - 2y*2 - 156y. -y*2 - 170y Collect the terms in 523v3 + 377v*3 - 2 + 2. 900v*3 Collect the terms in -2u + 0u + 14u*3 + 2u. 14u3 Collect the terms in 9s - 9s - 11s*3 - 2s*3. -13s*3 Collect the terms in 419b - 2 + 2. 419b Collect the terms in 23117 - 23117 - q2. -q2 Collect the terms in 0r + 0r + 44r*3 - 41r*3. 3r*3 Collect the terms in 3o*3 - 20120o + 20120o. 3o*3 Collect the terms in 18s + 11s2 - 18s. 11s2 Collect the terms in 8z*2 - 8z*2 - 8z*2 - 9z*2. -17z*2 Collect the terms in 0 + 13h + 3h + 0 - 13h. 3h Collect the terms in 11l*2 - 14l*2 + 3l*2 - 10l*3. -10l*3 Collect the terms in 5a + 11a + 8a. 24a Collect the terms in 11m2 - m2 + 4m2. 14m2 Collect the terms in c2 + 34c3 - 35c3 - c2 + 0c2. -c3 Collect the terms in 1708j - 1708j - 38j*3. -38j*3 Collect the terms in -38s*3 + 13s*3 + 6s*3 + 14s*3. -5s*3 Collect the terms in 12 + 2l2 - l2 + 42 - 54. l*2 Collect the terms in -6n - 101 + 6n + 4n + 119. 4n + 18 Collect the terms in -j2 + 11 + 3j2 + 192 + j3. j*3 + 2j*2 + 203 Collect the terms in 99t - t*3 - 29t - 70t. -t3 Collect the terms in -233b + 143b + 94b. 4b Collect the terms in 127 - 127 - 6z*2. -6z2 Collect the terms in -r3 + r*3 - 22r*3. -22r*3 Collect the terms in 17w*3 + 3w3 - w3. 19w3 Collect the terms in -29t + 6 - 1 - 5. -29t Collect the terms in x + 7x + 4x + 2x. 14x Collect the terms in 5c*2 - 15c*2 - 2c*2. -12c*2 Collect the terms in -10z - 4z + 14z + 19z2. 19z*2 Collect the terms in -13n*2 - 2n*2 - 12n*2 + 23n*2. -4n*2 Collect the terms in 106q - 230q - q2 - 92q. -q*2 - 216q Collect the terms in -17u2 + 9 + 20u*2 + 3. 3u*2 + 12 Collect the terms in -19 + 6l*2 + 19 + 6l*2 - 10l*2. 2l*2 Collect the terms in -3 - 8 + 11 - 2y*2. -2y*2 Collect the terms in -32u*3 + 4u*3 - 321 + 27u3 + 321. -u3 Collect the terms in s*3 - 16s*3 + 9s*3 + 2s*3. -4s*3 Collect the terms in 5 + 3 - 2j*3 - 2. -2j*3 + 6 Collect the terms in -1457d*2 + 488d*2 + 485d*2 + 482d*2. -2d2 Collect the terms in -s3 - 4s3 - 8 + 3s*3 - 30. -2s*3 - 38 Collect the terms in 75n - 20n - 27n - 14n - 30n. -16n Collect the terms in -309y*2 + 3 + 2 + 298y*2 - 5. -11y*2 Collect the terms in -8z*3 - 11z*3 + 29z*3 - 9z*3 - 8z*3. -7z*3 Collect the terms in 2j - 6j2 + 2j*2 + 3j2. -j2 + 2j Collect the terms in -196 + 31o - 9o + 196. 22o Collect the terms in 4u - 12u + u. -7u Collect the terms in -1281z + 16z3 + 1281z. 16z3 Collect the terms in -177g + g*2 + 177g. g2 Collect the terms in v2 - v2 + v2 + 5v2. 6v2 Collect the terms in -o3 - o*3 + 4o*3. 2o*3 Collect the terms in 23m + 10m2 + 29m - 52m. 10m*2 Collect the terms in 21m*2 - 5m*2 + 23m*2 - 8m*2. 31m*2 Collect the terms in 14b + 21b - 1 - 1 + 5b. 40b - 2 Collect the terms in -54q - 1 + 6 - 3. -54q + 2 Collect the terms in -6 - 2762o*3 + 6. -2762o*3 Collect the terms in 2c - 7 + 2 - 3 - 5. 2c - 13 Collect the terms in -1 + 1 + 80b*3. 80b*3 Collect the terms in -94y*3 - 38y*3 + 46y*3 - 34y*3. -120y*3 Collect the terms in 20t*3 + 4t*2 - 7t*2 + t + 3t*2. 20t*3 + t Collect the terms in -1256 + u + 626 + 630. u Collect the terms in y + 13y*3 - y + 4y*3. 17y*3 Collect the terms in -30h + 33h + 6h + 9h. 18h Collect the terms in 28y + 6y - 17y + 39y. 56y Collect the terms in 252 + 15b - 5b - 252. 10b Collect the terms in -74q3 - 71q*3 - 81q*3 + 302q*3 - 72q*3. 4q*3 Collect the terms in -5o + 0o - 3o + o. -7o Collect the terms in -140b*3 + 71b*3 + 67b*3. -2b*3 Collect the terms in -75f*2 - 31f*2 + 10f*2. -96f*2 Collect the terms in 10w*2 + 10w*2 - 23w*2. -3w*2 Collect the terms in -12701p - 12709p + 25412p. 2*p	{ "pile_set_name": "DM Mathematics" }
-5). Let w = -0.6 + -2.4. What is the closest to 1 in j, w, 2/9? j Let f = 0 - -2. Let p = f - -1. Let n be (2/1)/(16/2). Which is the nearest to 2/7? (a) n (b) 2 (c) p a Let a = 0.12 + 0.08. Let l = 0.9 + -0.6. What is the nearest to -0.3 in a, l, -2? a Let v = -0.17 + 0.17. Let z be (1 - 1/(-3))/10. Which is the closest to v? (a) -5 (b) -0.4 (c) z c Let n be 4 + -1 - 2-1. Suppose 20 = -0q + nq. Let i = -26 + 26.3. What is the nearest to i in q, -1/5, 1? -1/5 Suppose -o = 0, -2h - 2o = h + 15. What is the closest to -2/5 in h, -2/9, 0? -2/9 Suppose -9 = 2l - 1. Let q = 4.4 + -4. What is the closest to 2 in -0.5, q, l? q Let t = 0.359 - 0.059. Let z = -4.99 - 0.01. Which is the nearest to -3/2? (a) t (b) z (c) 0 c Let p = 11 - 6. Let h = -1.5 - -1.52. Which is the nearest to h? (a) p (b) -2 (c) 1/2 c Let q = 0 + -0.3. Let t(g) be the third derivative of g5/60 - g4/6 - g*3 - 4g2. Let w be t(5). Which is the nearest to 0? (a) q (b) 3 (c) w a Let y(u) = u3 + 2u2 - 3u - 1. Let t be y(-3). Let x = -14 - -11.5. Let b = -1.5 + x. What is the nearest to 1 in 4, b, t? t Let f = 0 + 0. Let s = 153/62 - -1/31. Which is the closest to f? (a) s (b) -2/9 (c) 0.4 b Let v(d) = -4d - 44. Let m be v(-13). What is the closest to 0.1 in 3, m, -1/3? -1/3 Suppose -3b + 5i = -6b - 14, 0 = 2b - 4i - 20. Let r = 0.2 - -1.1. Let q = -0.3 + r. What is the nearest to -0.1 in q, -5, b? q Let q be ((-8)/(-42))/(2/(-6)). Let k = -0.01 - -0.01. Let a = k + 1. What is the nearest to -2/7 in q, 0.2, a? q Let t = 6.2 - 7. Let v = t - -0.8. Which is the closest to v? (a) 0 (b) 1 (c) -2/3 a Let d = 8 + -5. Suppose w - dw = 8. Let n(l) = -14l - 61. Let f be n(-4). Which is the closest to -1/2? (a) -3/4 (b) f (c) w a Let d = 0.164 - -0.036. Which is the closest to 1/5? (a) -1 (b) d (c) -0.3 b Let f = -6 - -21. Let h = 11 - f. What is the nearest to 1 in -0.4, 1, h? 1 Let t be 30/75 - (-2)/(-5). What is the closest to 1 in t, 4, 1/4? 1/4 Let q(o) = -2o3 - 2o*2 - 4o - 4. Let d be q(-2). Let g = d - 16. Which is the nearest to -1/4? (a) -2 (b) g (c) -1/6 c Let u = -0.8 + 0.7. Let m = -1 - -1.2. Let z = -2.2 - 0.8. What is the closest to u in m, z, 2/9? m Let o = 2.1 - 2.2. Which is the closest to 0? (a) -4 (b) o (c) 0.6 b Let h = 10 - 16. Let s = -11 - h. Let y = 10 + s. What is the closest to -2/3 in 0.4, y, -0.1? -0.1 Let m = 1.3 - 1.1. What is the nearest to 5 in m, -3, 2/9? 2/9 Let r = -2.1 - -0.1. Let z = 0.03 + -1.03. Let l = 7/4 + -9/4. Which is the nearest to z? (a) l (b) r (c) 2 a Let z = 31.22 - 13.31. Let a = 18 - z. Let h = -0.19 + a. What is the closest to h in 0, -2/17, -1? -2/17 Let l = 0 - 2/3. Which is the nearest to 3? (a) l (b) 2/9 (c) -4 b Let q be ((-2)/(-8) - 1)/(-3). Let x be ((-8)/6)/((-4)/6). Suppose 0 = -xj + 2 - 10. Which is the nearest to q? (a) 4 (b) -0.3 (c) j b Let s = -0.45 + 0.53. Which is the nearest to 0.1? (a) s (b) -1/3 (c) 4 a Let o = -3 + 2. Let d = 1 + o. Let j = d - -1. What is the nearest to -1 in -5, -1/11, j? -1/11 Let j = 2.6 - -2.6. Let k = -1.2 + j. Which is the closest to 0.1? (a) k (b) 1/4 (c) 1/2 b Let r = 28 - 23. What is the closest to -0.3 in 0.4, -4, r? 0.4 Let q = 409/300 + -3/100. What is the closest to 0 in -0.2, 0.07, q? 0.07 Let a = 45/2 - 24. What is the nearest to 0 in 3/4, 0, a? 0 Let c(n) be the second derivative of -n5/20 + 5n*4/12 + 5n*3/6 + 4n*2 - 5n. Let y be c(6). What is the closest to -0.3 in 0.4, y, 5? 0.4 Let t = -8 - -3. Which is the nearest to 2? (a) -4 (b) 2 (c) t b Let l = -300/7 - -43. Which is the nearest to 0? (a) -0.4 (b) l (c) 2/21 c Let d = -0.06 + 2.06. Let c be 22/(-56) + (4 - 81/21). What is the closest to c in 0.1, -3, d? 0.1 Let q = -1.39 - -1.29. Let j = 4.94 + 0.06. Which is the closest to q? (a) 3 (b) j (c) -1 c Let y = -2159/7 + 309. What is the closest to -2/5 in -0.5, -0.02, y? -0.5 Let q = -4.9 - 1. Let h = -6 - q. Which is the closest to -2/3? (a) h (b) -4 (c) -2 a Let w be 6/(-5)(-200)/(-12). Let f = -21 - w. Which is the closest to 0? (a) -1/4 (b) f (c) -2/9 c Let z = -79 + 78.5. What is the nearest to 10 in 2, -3, z? 2 Suppose 3u + 5 + 17 = 5l, 0 = -5u - 4l + 25. Which is the nearest to u? (a) -5 (b) 2/3 (c) -0.2 b Let r = -18/55 - -8/11. Suppose -5k + 3w = 0, -w - 6 = k + 2. Suppose -11 = -5d - 36. Which is the nearest to r? (a) d (b) k (c) -0.1 c Suppose 2y - 10 = -3n + 3y, -5n + 5y + 20 = 0. Let g = -0.71 - -1.71. What is the nearest to g in 2/3, 4, n? 2/3 Let a = 7.29 + -1.39. Let n = a + -6. What is the nearest to n in 5, -4, 3? 3 Let o = 1646/35 - -2824/35. Let m = o - 128. Which is the closest to m? (a) -4/3 (b) -4 (c) -0.1 c Let v(c) = c + 4. Let r(n) be the second derivative of -n3/6 + 5n*2 + 4n. Let x be r(12). Let g be v(x). What is the nearest to -0.1 in g, 0.4, 0.1? 0.1 Let r = 0.6 - 0.67. Let t = 0.17 + r. What is the nearest to t in 0.4, 0.2, -5? 0.2 Let g be (-8)/14(-56)/16. Let m be 4/(-36) + g/(-9). What is the closest to 1 in -0.4, m, -1/6? -1/6 Let d = 8 + -9. Suppose -g - 4g = p + 4, 2g = 5p + 20. Let y(m) = -m - 1. Let j be y(p). Which is the closest to 0? (a) j (b) 1/2 (c) d b Let p = 59/133 - 3/19. What is the closest to -2/5 in 0.1, 0.03, p? 0.03 Let i = 16 + -16.1. Let u = -0.1 - -0.1. What is the nearest to i in -3, 1/2, u? u Let q(u) = u3 - u2 + u + 2. Let d be q(0). Which is the closest to 1/4? (a) -0.1 (b) -0.5 (c) d a Suppose m = -5q, -5m - 18 - 5 = 2q. Let j = 3.1 - 3. Let p = j - 0.2. Which is the nearest to p? (a) m (b) -1 (c) 1/4 c Let z = 0.1 - 0.1. Let c = -14 + 18. What is the closest to z in 2/19, -0.2, c? 2/19 Let h = 124 - 121. Let d = -233 - -1403/6. What is the closest to -1 in h, d, -3? d Let o = -21 + 21.2. Let g = -0.3 + o. What is the nearest to 0.1 in 1, -4, g? g Let s = -0.6 + 3.6. Let h = -2.2 - -1.2. Which is the nearest to 0? (a) s (b) 7 (c) h c Suppose 3m - 3 = -4j - 2, -m = -3. Which is the nearest to -0.2? (a) 1/4 (b) 4 (c) j a Let q = -16 - -15.3. Let u = q + 1. What is the closest to -0.1 in 0, -2/3, u? 0 Let g = 0.03 + -0.03. Let u = g + -0.1. What is the closest to u in 3, 1/2, 5? 1/2 Let g be 2(2 + (-18)/10). Let d = -253 + 758/3. What is the closest to d in g, 6, 3? g Let t = -0.2 + 0. Let s = 1.8 - -0.2. Let b = 2.2 - s. What is the nearest to 3 in b, 1, t? 1 Let y = 36 + -31. What is the closest to -2 in 6, y, 1? 1 Let k = -443/4 + 110. Which is the nearest to -2? (a) -5 (b) k (c) -0.3 b Let w = 1/5 - 27/85. Which is the nearest to 1? (a) -5 (b) -16 (c) w c Let z = 6 + -6.1. Let o = 1.1 + z. What is the nearest to -0.1 in 5, o, -0.5? -0.5 Let r = -0.6 + 1. Let g = r + -0.5. Let s = 11 + -12. What is the closest to 0 in g, 5, s? g Let p(i) = -10i - 2. Let w be p(5). Let h = 12/37 + -3761/74. Let c = w - h. What is the nearest to -2/5 in -5, 0.4, c? 0.4 Let h(t) = t3 + 2t*2 + 2t + 1. Let f be h(-2). What is the closest to 1/3 in -2/17, 3, f? -2/17 Let u be 2 + (572/24)/(-11). Let k = 0 + 0.1. Which is the closest to k? (a) -2 (b) 4 (c) u c Let q = 1/31 - -28/93. What is the nearest to q in -0.1, -0.2, 5? -0.1 Let l = 5.72 + 0.48. Let s = l - 6. Let q = 6 + -2. What is the closest to s in 2, q, -0.2? -0.2 Let w = 0.141 + 0.059. Let n = -6 + 6.4. Let s = -0.1 - n. Which is the closest to -1/3? (a) w (b) s (c) -2 b Let h = -79 - -77. What is the closest to -2/7 in 0.2, 17, h? 0.2 Let k(h) = -2h2 + 2. Let a be k(2). Let b = a - -7. What is the closest to 0.1 in -0.1, b, 2/9? 2/9 Let n = 323/6 + -54. Which is the closest to n? (a) -5 (b) -6/5 (c) 1 b Let x = -0.21 + -0.09. Which is the closest to 0.1? (a) 4 (b) x (c) 3 b Let h(p) = p2 - 6p - 3. Let y be h(6). Let k = 74 + -69. What is the nearest to 0 in -1/6, k, y? -1/6 Let j = -80 + 73. Which is the closest to j? (a) 2 (b) 4 (c) 2/17 c Let t = 22.3 - 22. Let x = 7 + -11. Let v = -6 - x. Which is the closest to 0.1? (a) v (b) t (c) 5 b Suppose -21 = -3h - 3f - 6, -3f + 15 = -2h. Which is the closest to -2/9? (a) 4 (b) h (c) -5 b Let s = -8 - -4. Let o = -2.5 + 3. What is the closest to 2 in 2, o, s? 2 Let y = 0.05 - 0.03. Let n = y + 0. Let k = n + 2.98. What is the closest t	{ "pile_set_name": "DM Mathematics" }
25929 or 1? -125929 Are 7241 and 7240 equal? False Which is bigger: 3 or 204/89? 3 Which is greater: 1089 or -31/11? 1089 Which is smaller: 143 or -181? -181 Which is smaller: -54040 or -54059? -54059 Which is smaller: -312/1733 or 1? -312/1733 Is 47/114401 at least as big as 1? False Which is greater: -17/8 or 5.81? 5.81 Which is smaller: 4 or 5170/1101? 4 Which is greater: 0.076 or 1267? 1267 Is 7406 bigger than 7406? False Is 1 less than or equal to -361/2327? False Which is greater: 2643634 or 2643635? 2643635 Which is smaller: 347288 or 1041860/3? 1041860/3 Is 5366 greater than or equal to -216? True Which is smaller: -1007975 or -1007974? -1007975 Are -1380 and -64 nonequal? True Is -54472 less than -217889/4? False Is 42 smaller than 10642/253? True Which is smaller: 107 or -8415? -8415 Do 3/663809 and -0.1 have different values? True Which is smaller: -1 or 3/5223412? -1 Which is greater: -1883/277 or 2/3? 2/3 Which is smaller: 60456 or -0.3? -0.3 Is 1 < -274/1545? False Which is greater: 407 or 0.228? 407 Are -79/338 and 1 equal? False Is -71 greater than or equal to -13455? True Which is smaller: 13704 or 2? 2 Do 70/35437 and 1 have the same value? False Do -193 and 98 have different values? True Is -659122 at least -659121? False Which is smaller: 219 or 3716/17? 3716/17 Which is greater: 12398/17 or 729? 12398/17 Do -16 and -0.595 have different values? True Is -2/2538633 at most 0? True Which is bigger: -45309/5 or -9061? -9061 Is 749431 greater than or equal to 0? True Which is bigger: -3/71681 or 0? 0 Which is greater: 1610 or 26/7? 1610 Are -1 and -106/15857 nonequal? True Is 2648 at most 2880? True Which is bigger: 18496 or 18464? 18496 Which is smaller: 1 or 5/389164? 5/389164 Which is smaller: 296222/7 or 42318? 296222/7 Which is smaller: 4/177 or -9/4? -9/4 Which is greater: -9917 or -9913? -9913 Is 1693676 at most 1693676? True Which is smaller: 100971/4 or 25243? 100971/4 Which is smaller: 1518 or 327? 327 Is -44181 greater than or equal to -44181? True Is 9994 not equal to 10121? True Is -54039 less than or equal to -54097? False Which is smaller: -3 or -305400? -305400 Is 2985 at least as big as 2920? True Which is smaller: 164 or -99/10? -99/10 Is 2/99 at most 1/14121? False Which is smaller: 1305 or 0.165? 0.165 Which is greater: -0.031 or -698? -0.031 Which is smaller: 18922/9 or -1? -1 Which is bigger: -425 or -2977/7? -425 Which is smaller: -1368/2383 or -2? -2 Which is smaller: 545630 or 545636? 545630 Which is bigger: 0.021 or -4149/8? 0.021 Is 26/59247 != 1? True Which is smaller: -13843 or -83051/6? -13843 Does 386 = -735? False Is -6 at most as big as -841/159? True Which is smaller: 1825 or 1812? 1812 Which is smaller: -65585 or -65583? -65585 Is 86 not equal to -80358? True Is 1 equal to -292/24509? False Which is smaller: 14 or -3588? -3588 Which is smaller: 12/7 or -3/7261? -3/7261 Are 22020 and 22019 equal? False Which is greater: 77 or 1731? 1731 Is 12144 < 12337? True Which is bigger: -2923121/5 or -584624? -584624 Which is smaller: -68/263 or 1? -68/263 Is 1/6091 greater than 0.25? False Is -251/131 <= 9? True Which is greater: 2183 or 2161? 2183 Do -23/636 and 1 have the same value? False Which is bigger: 1553095/7 or 221872? 221872 Which is bigger: 185/479 or -1? 185/479 Which is smaller: -9604 or -9600? -9604 Is -137/404 > 0.1? False Is 2859 at most as big as 2824? False Is 7 less than or equal to 1180/143? True Is -3154/3 at least as big as -1050? False Is 1/386258 > -1? True Is 954/95 less than 9? False Does -33102 = -33104? False Which is bigger: 1 or 2/456501? 1 Is 986/53 less than or equal to -0.1? False Which is smaller: 8/707271 or -1? -1 Which is smaller: -4146 or 0.1? -4146 Do 3/872474 and 1 have the same value? False Which is smaller: -7/8 or 5117? -7/8 Which is greater: 1279/340 or 5? 5 Is 0 at least 1/31596? False Which is bigger: 6/13771 or 2/5? 2/5 Do 22/438961 and 1 have the same value? False Is 17602 greater than or equal to 17600? True Are 1399487 and 1399489 nonequal? True Which is smaller: -0.1134 or -1244? -1244 Which is bigger: -2 or -181/185? -181/185 Is 0 less than or equal to 3/8429? True Which is smaller: 11612 or 69677/6? 11612 Which is bigger: -2095/16 or -130? -130 Which is bigger: 6788 or 6804? 6804 Is 1/16733445 at least as big as 1? False Which is greater: -126/829 or 1? 1 Which is bigger: -63 or -22685/352? -63 Which is greater: 111 or 3640? 3640 Which is smaller: 204505 or 204504? 204504 Does 24593/7 = 3512? False Do 496983 and 496983 have different values? False Which is smaller: 157.9 or -0.504? -0.504 Is 1 greater than or equal to -197/41217? True Is -2369 smaller than -6? True Which is smaller: 2146 or 2145? 2145 Which is bigger: 9690 or 9695? 9695 Is 0.215 smaller than -2? False Is 3447 equal to 3200? False Is -244 less than -849? False Is 920 greater than 1/6? True Is 2.03 greater than or equal to -0.04? True Which is smaller: 2 or -0.030516? -0.030516 Which is bigger: 250 or 13826/55? 13826/55 Do 5/24213 and 0 have different values? True Which is smaller: 1 or 6/58901? 6/58901 Which is smaller: 487329 or 487331? 487329 Is -0.3 equal to -80893? False Is -2518 > -2413? False Which is smaller: 9212946 or 9212947? 9212946 Is -1/1081006 less than -1? False Is 643598 less than 643596? False Which is smaller: 22374 or 67? 67 Which is smaller: -514107 or -2? -514107 Is 34/2015 <= 0? False Which is greater: -3763 or -3616? -3616 Which is smaller: 154910 or -1? -1 Is -720 at least -811? True Is -587 less than or equal to -193? True Which is greater: 85867 or 85866? 85867 Which is smaller: 2862429 or -1? -1 Which is smaller: 7496 or 7492? 7492 Is 0.74 smaller than -0.0953? False Is -73 not equal to 1209? True Is -64507 greater than -64507? False Is -21031 smaller than -114? True Is -2/5 greater than or equal to 3304500? False Which is greater: -7385 or 1/301? 1/301 Is -1 at most as big as 2395? True Is -1 greater than or equal to -245/29889? False Is 180883 bigger than 180889? False Which is smaller: -84 or -109? -109 Which is smaller: 3895 or 3888? 3888 Are 598939 and 598939 unequal? False Which is smaller: -49/1788 or 1? -49/1788 Which is bigger: -71391 or -71393? -71391 Which is smaller: -4413 or 39? -4413 Which is smaller: -1064/647 or -0.2? -1064/647 Which is smaller: -37.354 or 1? -37.354 Which is smaller: -767/6 or 270? -767/6 Does -8/81221 = -1? False Is 1319 equal to 18/7? False Do 0.1 and -0.5122 have the same value? False Is -1/117765 >= 3/2? False Is -24 bigger than -7897? True Which is smaller: 3359 or 1698? 1698 Which is smaller: -120430/7 or -17204? -120430/7 Is 2/5 at most as big as 29611/32? True Which is greater: 59 or 117? 117 Are -155/938 and -2/11 non-equal? True Is -3/8052589 at most 0? True Which is greater: -450 or -405? -405 Which is greater: 1 or -2/20791? 1 Which is smaller: 62 or -0.199? -0.199 Is 3941 > 51228/13? True Which is smaller: -0.06 or -5324/7? -5324/7 Is -0.2 bigger than 927585? False Is 12939 equal to 12681? False Does -1464590 = -2? False Which is greater: 2/1455 or 1? 1 Which is bigger: 393/425 or 0? 393/425 Which is greater: -64623 or -6? -6 Is -1 smaller than -7/456063? True Are -32169 and -32167 equal? False Which is bigger: 2/396537 or -1? 2/396537 Is -3419 at most as big as 1337? True Which is smaller: -3562 or -127? -3562 Is -80538 equal to -80504? False Which is greater: -120/33953 or 1? 1 Which is greater: -81/5 or 130/11? 130/11 Which is smaller: 46 or 7894/173? 7894/173 Which is bigger: -0.055 or 2040? 2040 Which is smaller: 5638 or 5593? 5593 Is 0 at least as big as 2667/2033? False Which is bigger: -22 or -117? -22 Is 106 greater than 4736/45? True Do 130160/11 and 11832 have the same value? False Is -1174/10255 greater than or equal to 0? False Which is smaller: 27557/11 or 2504? 2504 Which is greater: 604 or 3/494? 604 Do -344289 and -344288 have the same value? False Which is bigger: 259/656 or 0? 259/656 Is 1/48096 at most as big as 0? False Is 184/7 < -102? False Does 46 = -1299? False Which is bigger: 7/1872114 or 1? 1 Which is smaller: -2/5 or 25/41877? -2/5 Is 0 smaller than -40/121211? False Which is smaller: 304896 or -1/4? -1/4 Are -5 and 357 equal? False Which is greater: -208306/5 or -41661? -41661 I	{ "pile_set_name": "DM Mathematics" }
+ 1 + 41 = r, 4s = cr - 27. Is f at most s? True Let q = 17112/5 + -3396. Which is bigger: q or 25? q Let u = 772.9 - 773. Does -150 = u? False Let w(h) = -h*3 + 7h*2 - 5h - 4. Suppose -2v + 14 = -2k + 2, -16 = -5v - 2k. Let l be w(v). Suppose 4j - 7j = l. Do j and -9 have the same value? False Let k be 11/(231/(-69)) + 3. Let f = 4.1 - 0.1. Let s = 6 - f. Which is greater: s or k? s Let r = 18 + -19.9. Let m be -5 + -5 + 12 + (1 - 4). Is m greater than r? True Let p = 867/26 + -414/13. Let o be 4/4-2 - -3. Which is greater: p or o? p Suppose 4k = -k. Let g be (-1641)/575/105. Let x = g + 234. Which is bigger: x or k? k Let y(b) = -b3 + 4b*2 + b + 16. Let g be y(5). Suppose 0 = -2k + 4k - 8. Suppose -kp + 5 = 17. Which is smaller: p or g? g Let w be 946/316 + (-12)/4. Which is greater: 0 or w? 0 Let g = -10/33 + 23/66. Let s = -25.23 + 24.93. Which is bigger: g or s? g Let p(j) = 5j + 3j - 10 + 0j - 1 + j2. Let g be p(-8). Suppose 0 = 2a - 4a - 20. Is g != a? True Let s = 3513 - 77309/22. Which is bigger: s or -2? s Let q be 7/1 - (697/119 - 2/(-14)). Let k = -38761/57 - -680. Is k at least as big as q? False Let n(y) = -4y - 22. Let h be n(-6). Let p be (-429)/(-962) + h/(-4). Is p greater than 0? False Let v = -19 - -16.8. Let t = v + 2.5. Which is smaller: -6 or t? -6 Let v(x) = x*2 + 27x - 56. Let m be v(-28). Which is bigger: -35 or m? m Suppose -765 + 2582 = 23a. Which is smaller: 157/2 or a? 157/2 Let s = -26 + 27. Let y be (324/(-45))/(s/(-10)). Suppose -y = 5j - 17. Which is greater: j or -13? j Let d = 1493 - 1477. Is 6 < d? True Let u(w) be the third derivative of -w*4/12 - 7w*3/3 - 4w*2. Let l be u(-7). Do 0 and l have different values? False Let l be (-180)/(-1620)((-30)/(-28))/5. Let v be (2/62)/(-2). Is l less than or equal to v? False Let k be 35/(-4) - 3/12. Suppose 60 = z + z. Suppose 5w = -2p - z, -22 = 2p - 0w + w. Do p and k have different values? True Suppose -2g = c - 4, 0c = 2c + 5g - 10. Suppose 2x - 3y = 11, cy - 14 = -5x + 3y. Which is bigger: 14/9 or x? 14/9 Suppose -232h = -237h - 10. Let m be ((-5)/(-10)h)/((-2)/2). Which is greater: m or -2? m Let l = -45 + 223/5. Let c be (-8)/12(-5 + -1). Suppose 1 = r + 3k + 2k, 4r = 2k + c. Do l and r have the same value? False Suppose -591o + 4668 = -587o. Is 1168 bigger than o? True Let u = 101 - 183. Let f = u + 81.59. Let c = 0.09 - f. Is -0.1 bigger than c? False Let k = -99 - -183. Let l = -59 + k. Let o = -24 + l. Which is bigger: o or 3/14? o Let t be 48/(-36)(-6)/(-4). Let o be (-5)/t70/25. Is o less than 8? True Let z be (-4)/13/(-6)9. Let l = 14 - z. Suppose -3j + o - 9 = 0, 0 = -0o - o + 3. Is l less than j? True Let w = -26 - -14. Is -37/3 greater than w? False Let c be (-396)/(-720) + 0 + (-4)/5. Is 136 equal to c? False Suppose 10v + 40 = 5v. Let n be 16/(v + 4) - -2. Let i be n/(-7) - 4/112. Which is greater: i or -12? i Let z = 215 + -219. Let c(t) = -t*2 + t - 4. Let x be c(0). Let l = z - x. Which is greater: l or -2/19? l Let b = 1.9 + -18.9. Let f = b + 18.5. Is f equal to 1? False Let j be 4/10 - (-26)/10. Let n(w) = -14 + j + 0w*2 - 13w + 0w2 + w2. Let u be n(14). Is u >= 2? True Suppose -5a = 5f - 2a - 14, -2a = -f - 5. Let q be ((-3)/51)/(-17). Which is bigger: f or q? f Let d = -1/9789 - 28303/10415496. Are d and 0 non-equal? True Suppose 7c + 112 = 56. Which is smaller: -5/9 or c? c Let x = -430 - -430.056. Which is bigger: 0.1 or x? 0.1 Let h = 71/126 + -5/18. Suppose -1 = -3m + 2. Let a be (-2 - (1 - 2))m. Which is bigger: a or h? h Suppose 0 = -2t - 34 + 30. Let b = -216/185 + -6/185. Which is smaller: t or b? t Suppose 2s - 4c + 8 = -2s, 0 = 5s + 5c. Is -11 not equal to s? True Suppose -42 = -4u + 22. Let r = -12 + u. Suppose 5v = -4h + 2v - 19, 0 = -2h + rv + 18. Does -4 = h? False Let w = -95 + 90. Which is smaller: -83/23 or w? w Suppose y - 5a = 14, -y - a - 2a = 2. Suppose 17g + 280 = 21g. Let t be (14/42)/(2 + g/(-36)). Which is bigger: t or y? t Let o = 47.74 + -6.2. Let g = 41 - o. Which is smaller: 0 or g? g Suppose 5 = -5y - 0y. Let g be 1/(3/y(31 - 7)). Which is smaller: -1 or g? -1 Let l = -1.1 + 1.136. Which is smaller: -2 or l? -2 Suppose 0 = -2i - 2n + 114, -i - 22n = -27n - 87. Is i != 440/7? True Let w = -61 + 60. Let j = -2/4211 + 358039/218972. Let p = -18/13 + j. Is w bigger than p? False Let g = -3 + 4. Let c be (28/36 - g)3. Let j(q) = 2q + 4. Let f be j(-3). Which is bigger: c or f? c Let h be (1 + -16)20/(-25). Suppose -2r + h = f - 5r, -r - 4 = 2f. Is f <= -1/58? False Suppose 2g + 2g = 4o + 36, -o - 19 = -3g. Let w be o - (-26)/7 - (-111)/315. Do 0 and w have the same value? False Let x(r) = r - 2. Let v be x(-3). Let b = 1307 - 1312. Is b bigger than v? False Suppose 0 = 5c + 2z + z + 692, 3c - z = -404. Let q = 126 + c. Is q != -43/5? True Let y = -331 + 333. Which is greater: y or 234? 234 Suppose 4p = -f - 45, -p - f - 4f - 35 = 0. Is p > -9? False Let b = -1.1 + -0.4. Let g = -1.2 - b. Suppose 14 = -12u - 10. Are u and g unequal? True Let o = 0.288 + -0.488. Is 143 at most as big as o? False Let t(p) = p*3 + 8p*2 + 8p + 7. Let x be t(-7). Suppose x = -9o - 0o - 243. Is o greater than -27? False Let o = 66 - 41. Let j = 218 - 196. Let s = o - j. Are 0.6 and s equal? False Suppose 0 = -7t + 9t + 2. Let j be 2 + 32/1818/(-15). Which is smaller: t or j? t Suppose 11 + 8 = 19s. Which is bigger: s or 1/445? s Let b(g) = 37g - 1. Let p(h) = 2h + 1. Let k be p(0). Let r be b(k). Let y be (-30)/r1/5. Which is greater: 0 or y? 0 Let g be (-4)/18 + (-654)/(-27). Let s be 7/(-42) - 2/g. Is -1 greater than s? False Suppose 4a + d = -45 + 13, -2a + 2d = 16. Let z be ((-1)/(-6))/((-1)/3a). Is z not equal to 0? True Let t be (2/8)/(33/(-220)-5). Is t <= 17? True Let j = -6911/2 - -13289/4. Which is greater: -132 or j? -132 Let i = -521 + 525. Are 0 and i nonequal? True Let c = 56 + -55.79. Which is smaller: -1 or c? -1 Let p(c) = -c - 13. Let o = -15 + 4. Let g be p(o). Suppose 4b - 3w = -7, -3b + 3w = -4b + 2. Which is bigger: g or b? b Let f(y) = -50y + 451. Let g be f(9). Which is bigger: 55/23 or g? 55/23 Let c be (-2498)/(-625) - 28/7. Let k = c - -6887/3750. Which is greater: 2 or k? 2 Suppose 3n = -n + 5q + 15, 2q = -5n + 60. Suppose -n = 4p + 2. Let i be p-2(-1)/(-2). Which is bigger: -1 or i? i Let c(w) = -2w*3 - 6w*2 - 29w - 91. Let q be c(-3). Let o(y) = -y*3 + 10y*2 - 11y + 13. Let a be o(9). Does a = q? False Let w be (-2)/6 - 23/3. Let j = w + 6. Let x(i) = -4i - 43. Let q be x(-10). Which is smaller: j or q? q Let p(c) = 41c - 365. Let k be p(13). Is 170 > k? True Let l = 4232.21 - 4276. Let g = l + 44. Let n = 1 + -1. Is n >= g? False Let i be (-3)/((-117)/(-75)) - -3. Suppose 0 = 4t + 3y - 5y, -4y = -t. Are t and i nonequal? True Let y = -4 + 4.3. Let d = y - -0.7. Which is smaller: d or -11? -11 Let y be 4/(((-64)/(-48))/((-4)/458)). Which is smaller: y or 0? y Suppose -10 = 2m - 7m. Let l be 5068/(-6090) - m/(-3). Let n = l + -1/29. Which is smaller: 0 or n? n Let x(d) = -137d + 1097. Let g be x(8). Do 3/35 and g have the same value? False Let w = 168 + -164. Which is smaller: w or -7/5? -7/5 Let d = -80 + 80. Let o be 3/3 - (-27)/(-21). Is d < o? False Let r(o) = -o2 + 12o - 12. Let v be r(11). Let l be 3 + 424/(-420) - 2. Let j = -13/15 - l. Is j at least v? True Let t(p) = p*2 - 4p. Let k be t(0). Let f be 8/(1(-1)/(-4)). Let c be f/11 + (-2)/1. Which is bigger: k or c? c Suppose 4x - 2x = -3l + 19, l + 5x - 28 = 0. Suppose 13 = 3w - 2, -16 = i - lw. Let t = -1354/11 + 123. Which is smaller: i or t? i Let r(c) = -c2 - 4c - 4. Let t be r(-3). Let o be 0/(t/(-1)-2). Let v = -76 + 759/10. Are v and o nonequal? True Let s = -65.54 - -65. Is s greater than or equal to -1? True Suppose -4m - 6p - 9 = -3p, -5p - 7 = 4m. Is -16 bigger than m? False Let b be (3 - 76/28)14. Suppose bj + 24 = -0j. Let r = j + -8. Which is greater: r or 0.2? 0.2 Let n = 5211/2 + -2601. Suppose 2u = -2z + 6z + 22, 0 = -4z - 5u - 29. Let t = z - -10. Is t > n? False Let x be (2715/(-45) + (-2)/3)/(-1). Which is bigger: x or 302/5?	{ "pile_set_name": "DM Mathematics" }
46/35)/(4/20)? 4 Evaluate (-62)/(-186)2/(-2). -1/3 What is the value of (-1(-5)/(-5))/((-175)/25)? 1/7 Calculate ((-16)/68-17)/(-44/72). -18 (-4)/(-10)12/216-30 -2/3 What is (56/18)/(102/108(-62)/(-527))? 28 Calculate (-88)/12(-109)/436. 11/6 What is the value of ((-108)/(-24))/(99/110)? 5 What is the value of (56/12)/(94/282)? 14 What is (-38)/4(-178)/(-89)? -19 What is (96/(-20))/(6(-1)/15)? 12 What is the value of (20/(-14))/(395/(-237))? 6/7 Calculate (-5)/(-300)-44-15. 11 What is the value of ((-45)/(-10)8/6)/(118/236)? 12 ((30100/(-75))/43)/(26) -7/9 What is the value of (120/(-21))/4(-1386)/(-99)? -20 Evaluate (56/(-294)-42)/(4/(-5)). -10 What is the value of ((16/(-90))/4)/(-1741/(-3485))? -2/9 What is (-30(-73)/4015)/((-15)/(-22))? 4/5 8/65409/(-60100) -3/25 Evaluate (5/(-15))/((14/((-56)/12))/9). 1 What is ((-54)/(-64))/(27/36)2408/301? 9 Evaluate (21/(-66))/((-616)/352). 2/11 What is 51/(-153)12/(-11)? 4/11 What is the value of (-6)/(-3)(-1800)/240? -15 Evaluate (1/82)/(139/36). 1/13 Evaluate (4/2)/((-13)/(-585)-5). -18 What is (-264)/84(-14)/4-2? -22 ((-12)/10)/(333/(-555)) 2 Evaluate (30(-32)/2160)/(3/27). -4 What is the value of ((-16)/1000)/((-3)/15)20? 8/5 -11(-8)/924-14(-2)/20 2/15 What is the value of ((-47)/((-11280)/(-384)))/((-1)/(-15))? -24 What is ((-27)/(-63)-7)/(14/(-4))? 6/7 528/(-6)(-8)/64 11 What is (-9)/(-30)(242/(-99))/(-11)? 1/15 What is the value of ((-8)/6)/272/16? -3 Calculate 1/2-485/(-1620). 2/27 15470/(-390)(-6)/(-14) -17 Evaluate (9/(252/(-8))12)/(2/(-7)). 12 What is the value of (31/37)/(72/(-336)7)? -2/37 Evaluate (-63)/(-28)1104/(-207). -12 (17/(-85))/((-42)/(-45))4 -6/7 Calculate (20/((-30)/6))/(-2620/(-650)). -5 Calculate 10/((22/4)/((-616)/(-224))1). 5 Evaluate (2/(-3))/(90/81(-18)/(-330)). -11 Calculate ((-3444)/41)/(-28)(-2)/(-2). 3 Evaluate 679/48510/(-4). -7/2 What is the value of ((-6)/4)/(69/7774-13)? 13 What is (-20)/4-1-2? -10 Calculate (((-2856)/70)/34)/((-2)/(-25)). -15 Evaluate 10(-20)/(900/27). -6 83/84010 2/7 Calculate 14/9812(-25)/(-20). 15/7 Calculate 4/616/784417/(-139). -2/49 1/(((-1)/(-36))/((-77)/154)) -18 What is ((-2511)/45)/(-3)145/(-87)? -31 Evaluate (-15)/30(-3)/4. 3/8 Calculate (42/35)/((-15)/100)8/(-64). 1 (-30)/(-25)(-1)/((-2)/(-15)) -9 What is (-24)/(-10)250/(-150)2/38? -4/19 Evaluate (23/444)/(20/((-4240)/53)). -2/37 What is the value of (-10)/(25/5)1211/924? -2/7 Evaluate ((-6)/9)/(98/355/9). -3/7 (9/136)/(864/2304) 3/17 6/(-8)20/(-30) 1/2 What is the value of (23/3)/(99/297)? 23 What is the value of (-2)/((-44)/(-66))5/(-3)? 5 Calculate 72/(-12)-7(-45)/70. -27 (19(-12)/(-1596))/(-1) -1/7 Evaluate 25/(-330)32/(-16). 2/33 What is (1/1)/1(-79)/1582? -1 ((2992/(-22))/31552)/((-12)/8) 1/58 What is the value of 5/(45/(-522))(-7)/(-14)? -29 What is the value of (670/536)/(70/4)? 1/14 What is -161(165/88)/(-15)? 2 (4/8)/(11/330-3) -5 Evaluate (32/(-40))/(39/(-351)9/(-10)). -8 What is ((-1)/13)/((-540)/1170)? 1/6 Evaluate ((-24)/114)/((-302)/31559). 22 Evaluate ((-2)/5)/(((-2584)/3230)/(4/74)). 1/37 Calculate ((-6)/(-5))/((456/(-150))/38). -15 What is the value of ((-12)/(-6))/(286/1001)? 7 Calculate (1/((-51)/(-34)))/((-28)/1470). -35 Evaluate (-42(-136)/714)/(5/(-20)). -32 150/(-12)144/(-900) 2 What is the value of ((-8)/75)/((8448/165)/64)? -2/15 Calculate 30/(-60)30/35. -3/7 Evaluate (-84)/210(-2)/(-3)39/26. -2/5 ((-8)/(-84))/(9/(-10)(-22)/(-231)) -10/9 Evaluate (-44)/3(-2232)/992. 33 (((-36)/8)/9)/(1/22) -11 Calculate -1((-1)/2)/(-26/456). -19 What is (2/((-12)/11))/((-4)/(-216)-9)? 11 Evaluate (-1200)/(-128)132/55(-15)/(-27). 25/2 Evaluate (-21)/((-378)/12)12/(-40). -1/5 What is the value of 54/((-35640)/231)(-8)/2? 7/5 What is (0/(-2)-1)/(8(-16)/64)? 0 Calculate ((-80)/(-28))/(26/273-3). -10 Calculate (-1035/(-42))/53/1. 5 Calculate (-3)/(-4518/(-90)). -1/3 Calculate (12/4-10)/(2/(-2)-2). -15 Calculate (67/((-536)/96))/((-6)/(-4)). -8 What is the value of (13/((-3432)/8))/(2/(-6))? 1/11 (6/(-10))/(168/(-70))4-31 -31 What is (-36)/30(-350)/(-30)? -14 (66/42)/((330/(-12))/(-5)) 2/7 Evaluate ((-225)/100)/(3/(-8))-1. -6 Calculate (37/(-74))/(286/176). -4/13 What is (-1056)/(-528)4/(-4)? -2 Calculate ((-54)/(-135))/(((-7)/1)/210). -12 Evaluate (2/(-7))/(14976/8736). -1/6 What is ((-49)/(-7))/63(-63)/(-28)? 1/4 Calculate 28/(-10)65/13. -14 Evaluate 27/(-4)(-648)/126. 18 What is the value of 10/(2/(-2))(3135/50)/(-19)? 33 ((-680)/(-24))/(70/(-42)) -17 Calculate (144/(-2208))/(((-45)/(-12))/(-5)). 2/23 Evaluate (-10)/5(-184)/92. 4 (-63)/84(-304)/(-12) -19 (-280)/3080(6/45)/(-1)-3 -2/55 Evaluate ((-1)/19)/((-7)/((-301)/43)). -1/19 Calculate (-113)/((-13899)/(-82))(-18)/4. 3 Evaluate ((-2)/(-12))/((-15)/30)-33. 11 Calculate (-10)/191216/(-64). 10 What is the value of (-25)/601526/545? -7/6 Calculate (-9)/(-1872)-82. -1/13 Evaluate -3(80/8)/(-10). 3 What is the value of 785/(-3297)(-12)/(-10)(-154)/(-16)? -11/4 What is the value of (((-1)/(-2))/(47/94))/(6/(-15))? -5/2 Evaluate -1(-42)/20230/805. 3/5 What is the value of -513/(-5)540/(-2340)? -3 What is 5/(-1933/627)? -5 Calculate 4510/25(-275)/330. -15 ((-1)/(1/12))/(639/142) -8/3 Calculate (-130)/4680(-5)/(-3)12. -5/9 (55/156/(-4))/((-107)/214) 11 What is (-27)/(729/6)6? -4/3 (19(-4)/(-1140))/(2/4) 2/15 Evaluate ((-72)/(-15))/((-130)/(-325)). 12 Evaluate (63/(4851/(-110)))/((-1)/(-7)). -10 What is 11/(484/8)330/(36/6)? 10 What is ((-737)/4422)/((-9)/24)? 4/9 Evaluate (-10)/(-4)(-28896)/3010. -24 ((-286)/13)/11(-1)/(-13) -2/13 Calculate ((-3)/444)/(2/(-16)2/1). 1/37 Evaluate -63(-14)/2521/(-14)-92. 23 What is the value of ((-2)/8)/(((-39)/32)/(660/440))? 4/13 Calculate (((-64)/6)/16)/(-5). 2/15 Evaluate (-15)/50-5(-8)/1. -12 What is 2/120912/96(-128)/304? -1/15 Evaluate ((-574)/28)/410. 0 Evaluate 72/(-7344)-34(-6)/22. -1/11 Evaluate (17/340)/((-15)/(-75)). 1/4 What is the value of 6/(((-412)/(-618))/((-1)/3))? -3 Evaluate (-11032/(-80))/(-2). -22 Evaluate (2050/205(-3)/(-2))/(-1). -15 Calculate (9/6)/(-1315/(-520)). 4 3/6((-28)/(-49))/(-4)6 -3/7 Evaluate (-328)/533(-39)/186. 4/31 What is ((-847)/(-462))/(2/6)? 11/2 What is the value of (-30)/(-135)288/(-1408)? -1/22 Calculate (-183)/4881/(-3). 1/8 What is the value of ((-88)/(-77))/(572/(-182))? -4/11 Calculate (-7)/6(-67)/469. 1/6 Calculate ((-27)/(648/128))/(2/(-3)). 8 What is the value of (-121)/(-11)-23/12? -11/2 (-522/(-825))/(4/(-40)) -4/3 What is the value of ((-1)/(-1))/1(-2575)/3605? -5/7 Calculate (-33)/18159/904. -11 What is ((-782)/(-221))/((-86)/(-559))? 23 (-3)/(-10)107/321 1/10 Calculate (-10(-78)/520)/(3/((-36)/(-2))). 9 4/2030/(-1)(-1)/(-9) -2/3 (-80)/808/(-72) 1/9 Calculate ((-24)/306)/((-216)/5508). 2 Evaluate 128191/76. 32 What is the value of ((2100/1386)/(15/66))/((-2)/9)? -30 What is ((-102)/(-10))/((-42)/210)(-5)/15? 17 What is ((-8)/(-6))/(((-1)/(-4))/(9/(-8)))? -6 What is the value of (-876)/73(-1)/32? 3/8 What is the value of 36/3(27/28)/9? 9/7 ((-8)/(192/198))/((-60)/80) 11 What is (-4)/(8/3)(-250)/(-75)1? -5 What is the value of (2/(350/(-90)))/((-18)/(-20))? -4/3 ((-6213)/(-1308))/(2/8-1) -19 Evaluate (-98)/1543/((-147)/14). 2/11 Evaluate ((-22)/(-33))/((-12)/378). -21 What is the value of (8/(-8))/(((-14)/63)/(6/(-3)))? -9 ((-4)/(-7))/((-420)/42)60/12 -2/7 Calculate 19(13/(-26)2)/1-1. 19 What is (588/(-245))/((-1863)/(-90))(-3)/(-4)? -2/23 ((-22)/26412)/(1/13) -13 Calculate ((9/(-12))/(42/32))/((-2624)/224). 2/41 What is the value of (1/(-1))/(1/(-8))1692/2256? 6 (-6)/114((-6)/(-5))/(110/(-275)) 3/19 What is the value of (-19)/19(-10)/(-150)18? -6/5 ((56/(-3))/(-14))/((-12)/162) -18 What is the value of (-1)/15(-159)/(-53)? -1/5 What is ((-30)/33)/((-1)/666)? 10 Evaluate ((-3828)/2552)/((-42)/(-4)). -1/7 (15/(300/8))/(4/(-120)) -12 What is (31/((-6727)/(-496)))/(2/14)? 16 (1(-3)/(-1))/(1728/(-448)1) -7/9 (10/10)/((-168)/282/3) -1/4 Evaluate 2/(8/2)(-6930)/231. -15 What is 6(-187)/918-18? 22 ((-65)/13)/(50/4) -2/5 2448/(-144)4/4 -17 Evaluate 58/212/(-180)15. -29 What is ((-4)/(-3)-3)/(1413/1456)? -32 What is the value of 1/(-3)*(645/(-86))/	{ "pile_set_name": "DM Mathematics" }
igit of 690805? 0 What is the tens digit of 642179? 7 What is the ten thousands digit of 3465975? 6 What is the tens digit of 2198116? 1 What is the hundred thousands digit of 234613? 2 What is the hundred thousands digit of 1394419? 3 What is the ten thousands digit of 3268683? 6 What is the hundred thousands digit of 5299058? 2 What is the tens digit of 389193? 9 What is the tens digit of 819874? 7 What is the ten thousands digit of 111517? 1 What is the units digit of 321502? 2 What is the ten thousands digit of 499597? 9 What is the hundred thousands digit of 980825? 9 What is the thousands digit of 1128507? 8 What is the hundreds digit of 112600? 6 What is the thousands digit of 294416? 4 What is the thousands digit of 15700? 5 What is the thousands digit of 253069? 3 What is the hundred thousands digit of 249570? 2 What is the hundreds digit of 225538? 5 What is the thousands digit of 18031074? 1 What is the ten thousands digit of 135908? 3 What is the tens digit of 17600998? 9 What is the units digit of 10169217? 7 What is the thousands digit of 5010035? 0 What is the tens digit of 529247? 4 What is the ten thousands digit of 215045? 1 What is the hundreds digit of 2656571? 5 What is the hundred thousands digit of 1954636? 9 What is the hundred thousands digit of 950923? 9 What is the hundred thousands digit of 4815908? 8 What is the units digit of 1675587? 7 What is the thousands digit of 365877? 5 What is the units digit of 2114860? 0 What is the hundred thousands digit of 760369? 7 What is the hundreds digit of 2931435? 4 What is the hundred thousands digit of 1756852? 7 What is the thousands digit of 3349088? 9 What is the units digit of 29113292? 2 What is the tens digit of 245332? 3 What is the tens digit of 456462? 6 What is the units digit of 48739? 9 What is the hundreds digit of 170406? 4 What is the thousands digit of 850905? 0 What is the tens digit of 242796? 9 What is the units digit of 57366? 6 What is the hundred thousands digit of 2051493? 0 What is the ten thousands digit of 423971? 2 What is the ten thousands digit of 885593? 8 What is the thousands digit of 302970? 2 What is the tens digit of 100841? 4 What is the units digit of 755446? 6 What is the hundreds digit of 7887012? 0 What is the ten thousands digit of 116677? 1 What is the millions digit of 1211192? 1 What is the units digit of 2000802? 2 What is the units digit of 3956289? 9 What is the hundreds digit of 192963? 9 What is the millions digit of 12105709? 2 What is the thousands digit of 65016? 5 What is the hundred thousands digit of 21772224? 7 What is the ten thousands digit of 3699546? 9 What is the ten thousands digit of 7188745? 8 What is the tens digit of 1396019? 1 What is the tens digit of 3803413? 1 What is the units digit of 751528? 8 What is the ten thousands digit of 1382140? 8 What is the units digit of 641998? 8 What is the ten millions digit of 16543260? 1 What is the hundreds digit of 154914? 9 What is the ten thousands digit of 65235? 6 What is the millions digit of 1105181? 1 What is the hundreds digit of 4225317? 3 What is the hundreds digit of 15604240? 2 What is the units digit of 21770397? 7 What is the units digit of 3097902? 2 What is the millions digit of 5781469? 5 What is the hundreds digit of 4202004? 0 What is the thousands digit of 470080? 0 What is the hundreds digit of 26960056? 0 What is the thousands digit of 1435085? 5 What is the tens digit of 6078567? 6 What is the ten thousands digit of 276340? 7 What is the hundreds digit of 2521341? 3 What is the hundreds digit of 1766309? 3 What is the ten thousands digit of 672456? 7 What is the tens digit of 519183? 8 What is the thousands digit of 327441? 7 What is the units digit of 383477? 7 What is the hundred thousands digit of 898524? 8 What is the hundred thousands digit of 222372? 2 What is the tens digit of 3846513? 1 What is the units digit of 16732372? 2 What is the tens digit of 242537? 3 What is the ten thousands digit of 339179? 3 What is the thousands digit of 72722? 2 What is the millions digit of 2649459? 2 What is the units digit of 6020762? 2 What is the hundreds digit of 31486489? 4 What is the ten thousands digit of 585736? 8 What is the units digit of 165296? 6 What is the ten thousands digit of 9623630? 2 What is the tens digit of 149043? 4 What is the tens digit of 790485? 8 What is the hundreds digit of 599208? 2 What is the hundreds digit of 420471? 4 What is the tens digit of 4056756? 5 What is the thousands digit of 312230? 2 What is the tens digit of 140155? 5 What is the millions digit of 11728815? 1 What is the thousands digit of 1407691? 7 What is the ten thousands digit of 96785? 9 What is the hundreds digit of 1999720? 7 What is the units digit of 96119? 9 What is the units digit of 595720? 0 What is the units digit of 2748043? 3 What is the thousands digit of 766994? 6 What is the ten thousands digit of 194620? 9 What is the tens digit of 1809938? 3 What is the hundreds digit of 3344397? 3 What is the thousands digit of 962326? 2 What is the ten millions digit of 15730028? 1 What is the ten thousands digit of 24885828? 8 What is the tens digit of 86894? 9 What is the units digit of 241061? 1 What is the hundreds digit of 5941799? 7 What is the units digit of 36584302? 2 What is the hundred thousands digit of 101914? 1 What is the thousands digit of 1225902? 5 What is the thousands digit of 15632251? 2 What is the units digit of 1857774? 4 What is the thousands digit of 200092? 0 What is the units digit of 471771? 1 What is the hundred thousands digit of 21380721? 3 What is the hundreds digit of 1146913? 9 What is the ten thousands digit of 192485? 9 What is the ten millions digit of 17950407? 1 What is the units digit of 1236375? 5 What is the units digit of 1628936? 6 What is the thousands digit of 331117? 1 What is the ten thousands digit of 2096312? 9 What is the ten thousands digit of 153500? 5 What is the ten thousands digit of 4317974? 1 What is the thousands digit of 55572? 5 What is the millions digit of 1265906? 1 What is the tens digit of 504696? 9 What is the tens digit of 3224262? 6 What is the hundred thousands digit of 12977087? 9 What is the thousands digit of 8527372? 7 What is the units digit of 89557? 7 What is the units digit of 229019? 9 What is the hundreds digit of 591? 5 What is the thousands digit of 1092068? 2 What is the tens digit of 21404022? 2 What is the thousands digit of 4284669? 4 What is the ten millions digit of 13060012? 1 What is the hundreds digit of 1920879? 8 What is the hundreds digit of 257863? 8 What is the thousands digit of 50413? 0 What is the ten thousands digit of 936108? 3 What is the tens digit of 2948067? 6 What is the millions digit of 14697480? 4 What is the ten thousands digit of 5216249? 1 What is the tens digit of 8176317? 1 What is the tens digit of 482128? 2 What is the units digit of 16044769? 9 What is the millions digit of 6819697? 6 What is the hundreds digit of 26613468? 4 What is the tens digit of 1587294? 9 What is the thousands digit of 3514594? 4 What is the thousands digit of 9445467? 5 What is the tens digit of 1074254? 5 What is the tens digit of 20873? 7 What is the ten thousands digit of 8564574? 6 What is the hundreds digit of 3478982? 9 What is the thousands digit of 7341914? 1 What is the ten thousands digit of 1777950? 7 What is the millions digit of 4392884? 4 What is the hundred thousands digit of 1175770? 1 What is the ten thousands digit of 264656? 6 What is the hundred thousands digit of 1396072? 3 What is the units digit of 36141? 1 What is the ten thousands digit of 2048176? 4 What is the tens digit of 712613? 1 What is the units digit of 16424687? 7 What is the thousands digit of 739534? 9 What is the units digit of 298872? 2 What is the units digit of 95551? 1 What is the millions digit of 5059729? 5 What is the units digit of 1298445? 5 What is the thousands digit of 789626? 9 What is the ten thousands digit of 2476097? 7 What is the ten thousands digit of 121493? 2 What is the thousands digit of 273850? 3 What is the ten thousands digit of 1912554? 1 What is the thousands digit of 9827969? 7 What is the tens digit of 19173091? 9 What is the thousands digi	{ "pile_set_name": "DM Mathematics" }
+ 4k(f). What is g(4)? 12 Let w be 22/(4/3). Suppose -wx - 3 = -12. Let h(d) = -4d*3 + 3d*2 - 8d - 2. Let b(c) = -3c3 + 2c*2 - 7c - 1. Let n(u) = 5b(u) - 4h(u). Give n(x). 3 Let y(z) = 213z - 29z + 9 - 186z. Suppose -14 = -2h - 0h. What is y(h)? -5 Let l(b) = 5b - b - b*2 + 5b - 4. Let x(o) = -9o + 23. Let j be x(2). What is l(j)? 16 Let l(g) be the third derivative of -g4/6 + 6g*3 - 925g2. Calculate l(8). 4 Let f(z) = z3 - 6z2 + 5z + 12. Let o be f(5). Let s be o + (-1 - (-12)/(-6)). Let b(y) = -2y + 13. Calculate b(s). -5 Let s(t) = t - 5. Let f(p) = -p3 + 12p2 + p - 7. Let a be f(12). Suppose v + a = 10. Give s(v). 0 Let z(g) = -g3 - 22 + 28g + 7 - 20g - 8g2. Calculate z(-9). -6 Let h(p) = -7p - 3. Let n be (-90)/(-15) + -8 + -1. What is h(n)? 18 Let d(u) = u*2 - 5u - 4. Let p be d(5). Suppose 0 = -5o + 16o + 66. Let n = o - p. Let q(t) = -t3 - t2 + t + 1. Calculate q(n). 3 Let d(j) = j*3 + 15j*2 - 5j - 18. Let x(r) = r*2 - r - 1. Let v(g) = d(g) - 5x(g). Determine v(-10). -13 Suppose 15c - 20 = 19c. Let a = c - -2. Let m(v) = v*3 + 2v*2 - 4v - 1. Calculate m(a). 2 Let x be 2/(-4)(-5 - 5). Suppose -4 - 11 = -xq. Let i(f) = 3f2 + 3 + 2f*2 - 3f*2 + 3f - 3f2. Determine i(q). 3 Let f(n) = 31n*2 - 9n + 28. Let s(u) = 15u2 - 4u + 13. Let h(v) = 6f(v) - 13s(v). What is h(-1)? -8 Let a(r) = -r*2 + 7r + 2. Let n(s) = s*2 - 6s - 1. Let t(u) = -4a(u) - 3n(u). Determine t(6). -29 Let b be (6/9)/((-4)/12). Let t be -2 + -1 + (-25)/(-5). Let f(x) = 1 + 0 + 0 - xt + 1. Give f(b). -2 Let z(c) = c3 + 4c2 + 2c + 2. Suppose 5w = -2u + 21, -5u - 6w + 30 = -w. Suppose -5n - u = 17. What is z(n)? -6 Let b(c) = -c2 + 7c - 4. Let h be b(7). Let l be ((-6)/h)/((-21)/(-364)). Suppose l = -5t - 9. Let p(u) = u2 + 7u + 1. Give p(t). 1 Let m(q) = -2q3 + 11q*2 - 5q + 1. Let u be m(5). Let l(h) = 27h + 5. Let d(n) = -9n - 2. Let o = 12 + -20. Let g(f) = od(f) - 3l(f). What is g(u)? -8 Let n = -74 - -77. Let l(p) = np3 + 6p*2 + 3p*3 - 3p*3 - 2p - 4p3. Calculate l(6). -12 Suppose 3 = -2z - 3. Let p = 13 - 10. Let f(i) = 2i + 3 - p - 4 + 1. Calculate f(z). -9 Let j(y) be the first derivative of 5y*2/2 + y + 97. What is j(-2)? -9 Let i = -37 - -43. Let g be (3 - -9 - 1) + -3. Let l(x) = -gx + 4 + x*2 - 4 + 9 + x. Determine l(i). 3 Let u = -721 - -728. Let f(n) = -6n + 41. Calculate f(u). -1 Let h(a) be the first derivative of 2a2 + 325. Determine h(-3). -12 Suppose 7 = -2o - 3. Let c(p) be the third derivative of -p*4/12 - 7p*3/6 + 4p*2 + 104. Determine c(o). 3 Let n be 90/(-21) + 6/21. Let i(v) = 3v*2 + 2v + 1. Let k(o) = 2o2 + 3o. Let p(j) = nk(j) + 3i(j). Let h = -7 - -13. Calculate p(h). 3 Suppose n - 4g - 18 = 0, 7n = 2n - g + 6. Let w(q) = 3 + 4q*2 - 2qn - q2 + 3 - 7q. Give w(6). 0 Let w(i) = -i2 + 3i - 1. Suppose 3j - 24 = -j. Let t be (j/(-10))/((-4)/20). Determine w(t). -1 Let z(d) = 2d*3 - 3d. Let b be z(-4). Let i = b + 116. Let v(p) = -3p + p + p + p2. Give v(i). 0 Let v(c) = 17c + 11c2 + 4c + 0 + 4c3 + 10c - 16. Let a(r) = -3r3 - 7r*2 - 21r + 11. Let n(k) = 7a(k) + 5v(k). Give n(7). 4 Let v(c) = 5 - 8 + 11c + 11 - 7c + 2. Give v(-5). -10 Let s(b) = -8b3 - b2. Suppose -w + 15 = 4a, -3a + 5a = 8. Calculate s(w). 7 Let n(x) = -x*2 - 3x + 2. Suppose -a + 3b = -20, -4a + 48 = 2b - 6b. Let w be a/10 - (-19)/(-5). Let k be (0 + w)/(1/1). Calculate n(k). 2 Let f(p) = 0 + 3p + 2 - 2p2 + p2 - 3. Suppose -2z + n - 2 = -27, 3z = -2n + 20. Suppose -4 = 9l - zl. Determine f(l). -5 Let z(n) be the third derivative of n5/60 + 7n*4/12 + 5n*3/6 + 139n*2. Determine z(-14). 5 Let o(d) = 17d*2 + 32d + 7. Let p(t) = -2t2 - 3t. Let j(u) = -o(u) - 8p(u). Suppose -v - 5 = 1. What is j(v)? 5 Let g(h) = -h3 + 10h*2 + 14h - 14. Let y be g(11). Let n = -12 + y. Let j(l) = l*3 - 7l*2 - 2l + 10. Calculate j(n). -4 Let r(l) = 3l3 - l2 - l. Suppose 3 + 5 = -4p. Let t be (-2)/(-12)-8 + p/(-6). Calculate r(t). -3 Let i(t) = -5t*2 - 3t + 4. Let b(c) = -2c2 + c + 1. Let n(u) = 2b(u) - i(u). Determine n(-4). -6 Let m(j) = -j3 - j2 - 3j + 2. Let w be m(3). Let z = -71 - w. Let o be 8/z + 2/7. Let a(d) = d2 + d - 4. Calculate a(o). -4 Suppose -54 = -3p - 0. Suppose 4 + p = 2c. Let a(z) = -2z2 + z2 - 2 + c. Calculate a(0). 9 Let f(u) = u + u + 2u2 + 0u*2 - 6u*2 + 7u*2 - 4u3 + 2. What is f(-2)? 42 Let z(g) be the third derivative of -g5/30 - g*4/2 + 11g*3/6 + 309g*2 - 3g. Give z(-9). -43 Let c(w) = 3w3 - 5w*2 - 3w - 1. Let s(k) = 7k3 - 10k*2 - 7k - 1. Let d(t) = -5c(t) + 2s(t). Determine d(5). 8 Let f = -18 + 27. Suppose fc + 11 + 7 = 0. Let u(t) = t3 - 3t*2 - 2t + 1. Calculate u(c). -15 Let y(p) = -p*3 - 3p2 + p - 3. Let o(m) = m3 - m*2 - m + 62. Let h be o(0). Let b = -65 + h. Calculate y(b). -6 Let i(j) = -10j + 170. Let v be i(17). Let o(f) = -3f - 4. Let h(r) = -r - 1. Let l(t) = -2h(t) + o(t). Give l(v). -2 Let t(o) be the first derivative of -2o2 - 5o - 140. Give t(-9). 31 Let u = -16 - -19. Let c be 1/1(-2 - u). Let i(w) = -3w - 4. Calculate i(c). 11 Let r(s) = -1 + 15 + 2s + 1 + 0s + 9. Give r(-10). 4 Let z(d) be the third derivative of -3d4/8 + 2d*3/3 - 7d*2 - d. Give z(1). -5 Suppose -2s - 2f - 2f + 132 = 0, 4s + 5f = 255. Let x be 4/(-30) - (-1)/(s/368). Let p(o) = o*3 - 5o*2 - 9o + 8. Give p(x). -10 Let d(l) = -l*3 - 6l*2 - l - 2. Suppose -294 = 18u + 31u. Calculate d(u). 4 Let s(w) = -50w2. Let o be -12 + 66/(54/9). Determine s(o). -50 Let b(z) = z3 + 3z2 - 5z + 1. Let q(i) = -i*3 - 2i*2 + 4i + 4. Let p = -11 - 14. Let g = -27 - p. Let o be q(g). Give b(o). 5 Let p(i) be the second derivative of i*4/8 - 4i*2 + 8i. Let b(w) be the first derivative of p(w). Determine b(-1). -3 Let m = -195 + 304. Let o = m - 109. Let k(i) = -i - 11. What is k(o)? -11 Suppose -g + 6g - 15 = 0. Let k(q) = -q + gq - q. Let s(p) = 4p2 + 13p + 5. Let y be s(-3). Determine k(y). 2 Let i = -48 + 50. Suppose -x = 2f - 3f - 7, 4x - 16 = if. Let d(v) = 3v + 8. Give d(f). -10 Let c(l) = 6l + 3. Let v be (-6)/9((-95)/10 + 2). Determine c(v). 33 Let b(u) = 3 + 4u2 + u2 - u*3 - 6u + 0u2. Let h = -101 + 105. Suppose hr - 8r = -16. Give b(r). -5 Let q(a) = 0a + 14 - 3 - 10 + a*2 - 8a - 9. Let f(m) = 7m2 + 4m - 3. Let w be f(1). Calculate q(w). -8 Let f = -7 - -7. Let l(u) = -u3 + u2 + 16. Give l(f). 16 Let u(r) = r*2 + 8r + 4. Let a(w) = -9w3 + 3w*2 + w - 2. Let m be a(1). Give u(m). -3 Let g(p) = -p - 9. Suppose 2m = -5s + 5m - 55, 0 = -m. Determine g(s). 2 Let j(f) = -f2 - f. Let k(o) = o3 + 5o2 + 6o + 1. Let m(h) = 11j(h) + 2k(h). Calculate m(-2). -20 Let o(y) be the third derivative of y4/24 - y2 + 81. Calculate o(-2). -2 Let a(c) = c. Suppose 0h = 5z - 3h + 97, z = 3h - 29. Let n = -9 - z. Let x(f) = -f*2 + 8f + 3. Let k be x(n). Determine a(k). 3 Let a(p) = p*2 + 5p + 1. Let k(x) = -2x2 - x2 - 4 - 14x - x. Let t(b) = -11a(b) - 4k(b). Let r be 43/(-9) + (-2)/9. Calculate t(r). 5 Let s = -44 + 45. Let y(o) = -15 - s - o*2 - 9o + 5. What is y(-8)? -3 Let f(s) = 4s - 7. Let x(k) = -1. Let y(g) = -f(g) + 4x(g). Suppose -2j + 5j + 31 = 4c, 0 = -2c - 4j - 12. Give y(c). -13 Let i(h) = 4h - 1. Let t be -6 - (22/88)/((-2)/(-24)). Let r(o) = 0o3 + 7o*2 + 3o2 + o3 + 10 + 10o. Let g be r(t). Give i(g). 3 Let r = -22 - -27. Let b(a) = -a + 4 + 4a + ra - 7a. Calculate b(-4). 0 Suppose 4 = -5h - 4x, -2x + 2 = 4. Let s(g) = 6g - 4 + g*2 + 4g - 4g + hg*2. Determine s(-6). -4 Suppose 5o = p - 21, 4o + 15 = -o - 5p. Let i(w) = -4w2 - w - w3 - 4 + w - w. What is i(o)? 0 Let o(u) = 5u - 16 + 2 + 8 - 3u. Let h be 7 - 47/2. Calculate o(h). -20 Let w(g) be the first derivative of 11g3/3 + g + 59. Give w(1). 12 Let p(a) = 4a*2 + 9a. Let q(w) = w*2 - 68w + 370. Let y be q(6). Determine p(y). -2 Let u(h) = h*2 + 10h + 16. Let b be (40/14)/(26/(-91)) - -3. Calculate u(b). -5 Suppose l + 6 = 4y, -2y + 5*l = 11 - 5. Let p(k) be the third	{ "pile_set_name": "DM Mathematics" }
k) = -2k - 1. Let t(b) = 2b. Let y(g) = 3j(g) + 4t(g). Suppose 0 = s + 4s - 10. Determine y(s). 1 Let h(f) be the third derivative of -f6/120 - f5/30 + 19f*2. Give h(-3). 9 Let n(j) = -4j3 - j2 - j - 1. Let k(g) = g*2 + 5g + 5. Let x be k(-2). Calculate n(x). 3 Let m(y) = -y*3 + 7y*2 - 5y - 3. Let a be m(6). Suppose -3x - 4z = -0 - 4, -3z + 3 = ax. Let v(w) = -w + 8. Give v(x). 8 Let v(f) = -2f + 2. Let n(k) = -2k + 3. Suppose 4 + 2 = -z. Let w(s) = zv(s) + 5n(s). What is w(-5)? -7 Let q(j) be the second derivative of j5/20 + j4/4 - 2j3/3 - j2 - 3j. Let v(s) = -3s + 2. Let m be v(2). Give q(m). -2 Let z(s) = s3 + s2 + 1. Let y(c) = -3c*3 - 7c*2 - 4. Let q(x) = -y(x) - 4z(x). What is q(3)? 0 Let c be 2(2 - (-2)/(-4)). Let p = -2 + c. Let z(o) = -3o*3 + 5o*2 - 5o + 6. Let v(b) = b3 - b2 + b - 1. Let g(s) = 5v(s) + z(s). Give g(p). 3 Let a(w) = 8w*2 - w - 8. Let i(p) = -7p*2 + p + 7. Let l(r) = -5a(r) - 6i(r). Suppose 2h - 2j = 2, -13 = 2h + j + 2j. What is l(h)? 8 Suppose 5s = -0 - 5. Let i(f) = -5f3 - 1. Determine i(s). 4 Suppose -m = -4q - 22, 3q + 5m + 15 = -2q. Let w(v) = 2v - 16. Let p(b) = b - 7. Let c(a) = 7p(a) - 3w(a). Determine c(q). -6 Let a = -129/2 - -65. Let t(w) be the third derivative of -w*2 + 1/24w*4 + 0 + 0w + aw3. Give t(-5). -2 Let k(u) = u. Let a = -5 + 2. Determine k(a). -3 Let c(a) be the second derivative of a4/12 - 7a*3/6 - 3a*2/2 - 15a. Give c(6). -9 Let k(r) = -r - 8. Let m be k(-6). Let l(c) = c*2 + 2c + 1. Calculate l(m). 1 Suppose 2g + 4g = -6. Let c(n) = 8n2 - 1. Give c(g). 7 Suppose 1 = 10a - 19. Let g(n) = n*3 - 3n*2 - 3n + 2. Give g(a). -8 Let a(c) = -c*3 + 6c*2 - c - 4. Suppose -4s + 0s + 20 = 2f, -34 = -4f - 5s. What is a(f)? -10 Let x(t) = 2 - 3t - 4t + 0t + 10t. Let z be 0 - (-2)/(-2)-3. What is x(z)? 11 Let g(f) = -f3 - 9f*2 - 6f + 11. Let c = 106 - 114. What is g(c)? -5 Let x(j) = j*3 - 5j*2 - 5j - 13. Let f be x(6). Let z(b) = -3b2 + 2b - 3. Let p(w) = -4w2 + 3w - 4. Let t(c) = fz(c) + 5p(c). Determine t(-1). 1 Let x(t) = t*2 + 6t + 2. Let s = 91 + -99. Give x(s). 18 Let j be -2((-14)/(-4) - 1). Let p(v) be the first derivative of v4/4 + 2v*3 + 5v*2/2 + 4v - 2. Determine p(j). 4 Let w(n) = -n*2 - n - 1. Let h(r) = -6r*2 - 8r - 8. Let p(k) = h(k) - 5w(k). What is p(-3)? -3 Suppose -12 = 3s - 5i + 17, s = -i + 1. Let m(c) = -c2 - c - 1. Give m(s). -7 Let s(k) = 15k - 27. Let d(c) = 2c - 4. Let p(x) = 27d(x) - 4s(x). Suppose 10h = 8h + 12. Let n be (-2)/(-5) + h/10. What is p(n)? -6 Suppose m - 15 = -2m. Let v(h) = 2h - 1 - 4 - h3 - 1 + 5h2. Let d be v(m). Let q(p) = -p3 + 4p2 - 5. Calculate q(d). -5 Let j(x) = 2x*2 + 3x - 4. Let q be -1 - ((-12)/(-2) - 4). Determine j(q). 5 Let o(b) = -7b2 - b + 6. Let c(k) = 6k*2 + k - 7. Let d(g) = 5c(g) + 6o(g). What is d(1)? -12 Let q(n) = n2 - n + 1. Let t = 10 + -13. Give q(t). 13 Let s(p) be the second derivative of p5/20 - 5p*4/12 - 7p3/6 + p2/2 + 6p. Give s(6). -5 Let c(t) = 9t*2 + 2t - 7. Let o(z) = -9z2 - 3z + 9. Let k(q) = 4c(q) + 3o(q). What is k(-1)? 9 Let t(l) be the second derivative of 0 - 1/2l3 - 4l - 3l2 - 1/12l*4. Determine t(-4). -10 Let k = -4 - -14. Let i = 13 - k. Let l(a) = -5a + 3. Determine l(i). -12 Let i be (50/6)/(-5)-3. Let d(a) = a - 6. Let p(k) = -k + 5. Let o(y) = ip(y) + 4d(y). Suppose -4c - 1 = 7. What is o(c)? 3 Let l be (2/(-2))/(1 + 0). Let t(x) = x2. Let f be t(l). Suppose 5 = -y - f. Let k(s) = s3 + 7s2 + 6s + 5. Give k(y). 5 Let m(s) be the first derivative of -s6/180 - s5/120 + s*4/24 - 8s*3/3 - 3. Let l(r) be the third derivative of m(r). Let a = 1 + 0. Calculate l(a). -2 Let a(s) = 2s*2 + 5s - 1. Let b(z) = z*2 + 3z. Let u(f) = 3a(f) - 5b(f). What is u(-3)? 6 Let a(p) be the second derivative of -p5/20 - p4/2 - p*3/3 + 17p. What is a(-6)? 12 Let o(l) = 2l - 3. Let a(w) = 2w - 2. Suppose g = -4g + 3r + 34, -4g = -3r - 29. Let z(b) = ga(b) - 4o(b). Determine z(-2). -2 Let h(x) = -3. Let f(z) = -z. Let j(a) = -3f(a) - h(a). Let q(u) = -u3 + 3u*2 + 2u - 3. Let s be q(3). Give j(s). 12 Let j(o) = -o - 2. Let f be j(-5). Suppose 0 - 9 = -fu. Let z(w) = 4 + 4w2 - w3 - 3wu - 5w*2 + 3w*3. Give z(0). 4 Let q(x) = -2x - 7. Let l(w) = -w - 3. Let b(u) = -u*3 + 11u*2 - 11u + 1. Let h be b(10). Let o(m) = hl(m) + 4q(m). Calculate o(5). 4 Let f(z) = -9z2 + 6z*2 + 2z*2 - 3z + 7 - z. Determine f(-6). -5 Suppose 1 = p - 2p. Let h(m) = 7m*2 + 6m + 7. Let t(g) = 20g2 + 17g + 20. Let i(s) = 17h(s) - 6t(s). Give i(p). -2 Let y(d) be the first derivative of d*3/3 - 7d*2/2 - d - 36. Calculate y(7). -1 Suppose 0 = -5b + f - 5, -5b - 4f - 4 = -24. Let a(v) be the third derivative of b + v*3 + 0v - 2v2 - 1/24v*4. Give a(5). 1 Let c(m) = -12m - 14m + 19m. Calculate c(-3). 21 Let f(i) = -12i3 + i2 + 2i + 2. Let t(d) = -d. Let j(g) = -g*3 + 5g + 1. Let v(u) = j(u) + 4t(u). Let c(x) = f(x) - 3v(x). Calculate c(-1). 10 Let m(s) = 5s2 + 5s + 6. Let r(q) = 9q2 + 10q + 11. Let l(x) = -11m(x) + 6r(x). Calculate l(5). 0 Let r(s) = -2s3 + 0s*2 - 159s + 2s2 + 160s. Determine r(-1). 3 Let u(f) = -f*2 - 9f - 6. Let t(n) = 2n - 9. Let h(o) = -o + 4. Let y(p) = -7h(p) - 3t(p). Let q(k) = -u(k) - 2y(k). What is q(-6)? 2 Let x(s) = -2s2 + 2s + 2. Let t = -1 - 1. Determine x(t). -10 Let w(z) = -z*2 - 2z + 6. Let t be 31 - (-32 - -3). Let f be 40/t(-3 + -1). What is w(f)? -9 Let t(q) = -q*3 + 5q*2 + q. Let y be t(5). Suppose yr - r = -8. Let x be r - ((-9)/3)/3. Let f(v) = -2v3 - v2 + 1. Determine f(x). 2 Let b be (24/(-14))/(3/(-21)). Let m = -6 + b. Let g(q) = q3 - 6q*2 + 2q - 9. Determine g(m). 3 Let i(p) be the third derivative of -p*5/60 + 5p*4/12 - 3p*3/2 - 7p*2. Give i(8). 7 Let v = -12 - -16. Suppose -vg - c + 0 = -4, 4c = 4g + 16. Let o(h) = h*2 + h - 5. Give o(g). -5 Suppose 3z = 2 + 4. Let q(o) = -o - 8o2 - 4o*2 + 7oz - 3 + o3. Suppose -4a + 12 = 0, -j - 4j + 19 = -2a. Determine q(j). -8 Let q(t) = -t3 + 6t*2 - 3t - 5. Let w be q(5). Let k(l) be the third derivative of l*5/60 - 5l*4/24 + 7l3/6 - l2. What is k(w)? 7 Let y(g) = 2 + 3g + 0g2 - 6 + g2. Let o be 30/(9 - 14) + -1 + 2. What is y(o)? 6 Let c(a) = 9a - 1. Suppose -m + 6m + 3w = 55, 3m + 2w = 33. Let k be (34/10 + -3)15. Let l(u) = -17u + 2. Let j(v) = kl(v) + mc(v). What is j(-1)? 4 Suppose 6b - 8b + 10 = 4t, 35 = 5t - 5b. Let w(g) = g*3 - 4g*2 + 6g - 1. What is w(t)? 23 Let p = -4 + 4. Suppose p = -2r - r. Let o(l) = l - 6. Calculate o(r). -6 Suppose 8 = w + w. Let l(f) = -2f - f*3 + 5f - 2f2 - f - 3f*2 + w. Calculate l(-5). -6 Suppose 2f = -5j + f - 8, 0 = 3j + 3f. Let x(h) be the first derivative of -2h*3/3 - 3h*2/2 - 3h + 1. Determine x(j). -5 Let j(g) be the second derivative of g*5/20 - 5g4/12 + g3/3 + 25g. Give j(4). -8 Let d be (2/(-3))/((-18)/(-675)). Let x = d + 24. Let g(j) = 14j2 - j - 1. Calculate g(x). 14 Let l(q) be the first derivative of q4/4 - 7q3/3 - q2/2 + 7q - 9. Give l(7). 0 Let s = -5 - -7. Let r(o) = -4 - 3o + 5 + os + 1 + 1. Determine r(4). 7 Let v(k) = -2k*2 + 12k - 6. Let q(t) = t*2 - 6t + 3. Let s(n) = -9q(n) - 4v(n). Calculate s(6). -3 Let n(x) = -x + 4. Let p be n(0). Let v(g) = -9g2 - 15g + 1. Let y(m) = -5m2 - 8m + 1. Let s(j) = pv(j) - 7y(j). Give s(-5). -8 Let v(z) be the first derivative of -z + 17. Let t(r) = -r - 5 + 2 - 2. Let w(c) = t(c) - 5v(c). Determine w(1). -1 Let d(b) = b2 - 10. Let y(r) = -2r*3 - 3r*2 - 2r - 2. Let z be y(-2). Suppose 3m - 2l + zl = -21, -3l = m + 12. Let n be 0/(3 + 12/m). What is d(n)? -10 Let j(k) = k*2 + k - 1. Let l(z) = 2z*2 + 2z - 2. Let v(g) = 7j(g) - 3l(g). Let x = 0 + 0. Suppose xr = -r - 3. Calculate v(r). 5 Let t(b) be the second derivative of b3/6 + b2 - 3b. Let q(x) = -x - 1. Let u(d) = 7q(d) + 3t(d). Calculate u(-1). 3 Let q(z) = 8z - 8 + 0 + 341z*2 - 340z*2. Calculate q(-8). -8 Suppose 3 = 2k + g, 0*g - 20 =	{ "pile_set_name": "DM Mathematics" }
)? 131 Let z(j) = -j*3 + j + 34. Let x be z(0). Let c be 1/((-2 - 0)/(-4)). Suppose 0d = -cd + x. List the prime factors of d. 17 Let u be 24/16(227 + -1 + 2). Let v = u + -113. List the prime factors of v. 229 Let p be 1/3 - (-8)/3. Suppose -pi = 5v - 232, v - 156 = -3v + 5i. What are the prime factors of v? 2, 11 Suppose 0 = 158b - 150b - 1104. What are the prime factors of b? 2, 3, 23 Let z be (-4)/(6/155). Let o be (z/(-8)0)/(-1). Suppose ou = -7u + 49. List the prime factors of u. 7 List the prime factors of 31 - (-12 - (-833)/(-1)). 2, 53 Suppose 5v + 14 = -6, 5v + 1700 = 5j. What are the prime factors of j? 2, 3, 7 Suppose 0 = -2c + c + 3b, -3c - 2b = 0. Let u be (c/((-16)/(-4)))/1. Suppose -10 + u = -k. What are the prime factors of k? 2, 5 Suppose n = -3n - 3t + 12, 4n - 12 = -2t. Suppose -5u + r + 0 = -12, nu - 3r = 12. Suppose 5a = 3x + 147, -8 = -ux + 4x. List the prime factors of a. 3 Suppose -5c = a - 36, 0c + 28 = 3c - a. Suppose g = -k + c + 20, 0 = 5g + k - 148. List the prime factors of g. 2, 3, 5 Let d = 44 + -34. Let x = -8 + d. What are the prime factors of x? 2 List the prime factors of ((-1)/(-2))/((-46645)/(-5830) - 8). 11, 53 Suppose 6o - 10o - c + 2408 = 0, -20 = 5c. What are the prime factors of o? 3, 67 List the prime factors of (-546)/(-8)4 - 3. 2, 3, 5 Let j(s) = 89s*2 + 4s + 5. Let p be j(-1). Let o = p - 50. List the prime factors of o. 2, 5 Let p = -285 + 958. List the prime factors of p. 673 Let w(f) = -4f2 - 13f + 12. Let u be w(8). Let j = -229 - u. List the prime factors of j. 7, 17 Let n = 19 - 31. Let o(y) = 2y3 - 12y*2 + 3y - 19. Let w(i) = 3i3 - 24i*2 + 6i - 37. Let z(c) = 5o(c) - 3w(c). List the prime factors of z(n). 2, 13 Let k(u) = u*3 + 8u*2 + 2u - 7. Let y(r) = -r*2 - 4r. Let w be y(-7). Let n = w - -14. What are the prime factors of k(n)? 2, 7 Suppose 4j - 920 = 32. List the prime factors of j. 2, 7, 17 Suppose -3a - 4d = -3 + 1, 5a = -5d + 5. Suppose 8 = -5z - a, -4k + 430 = 3z. Suppose -4x = -5p + k, 2x - 8 = -0x. List the prime factors of p. 5 Let t be (4/4)/(2/10). Let p = -8 + t. What are the prime factors of (-138)/24(p - 1)? 23 Suppose 9w - 6 - 30 = 0. Suppose wc - 234 - 42 = -5s, 5 = -5c. What are the prime factors of s? 2, 7 Let f(n) = -43n - 91. List the prime factors of f(-5). 2, 31 List the prime factors of 6/(-26) - (-125946)/234. 2, 269 Suppose 6t - 8 = 2t. Suppose tu - 34 - 76 = 0. List the prime factors of u. 5, 11 Suppose -633o - 8535 = -638o. List the prime factors of o. 3, 569 Let l(d) = 15d - 22d + 46 - 2 + 12d + d*2. What are the prime factors of l(6)? 2, 5, 11 Suppose 102600 = 31x + 7x. List the prime factors of x. 2, 3, 5 Suppose -29 = -4d + 7. Suppose -7a + 2a = -95. Suppose -z = -a - d. List the prime factors of z. 2, 7 Let l(q) = 3q + 49. Suppose 2y = -5h - 8, -3h = h + 5y + 20. What are the prime factors of l(h)? 7 Suppose i + 5i = 114. Suppose 5p + 2w = i + 24, -5 = -3p + 4w. Suppose 0g - p = -g - 3t, -2t = -3g + 21. What are the prime factors of g? 7 Suppose -20 = 4d - 52. Suppose 0 = l - 5l + d. Suppose lx - 8 = 0, -3a + 0a = x - 13. List the prime factors of a. 3 Suppose 4s - 2612 - 1638 = p, 0 = s + 4p - 1071. List the prime factors of s. 1063 Let t = -107 - -737. What are the prime factors of t? 2, 3, 5, 7 Let p be 9(-3)/(-45) - (-324)/10. Let b = 103 + p. List the prime factors of b. 2, 17 Suppose 3i = -5i + 5640. List the prime factors of i. 3, 5, 47 Let i be (-6)/27 + (-562)/(-18). Suppose -3b - 4h = -40, -5h - i = -3b + 27. Suppose -b = -11n + 7n. What are the prime factors of n? 2 Let x(j) = j*2 - 5j - 29. Suppose 3f - 31 = -l + 10, 50 = 5f - 2l. List the prime factors of x(f). 5, 11 Let j(a) = -22a - 5. Let d be j(-2). Suppose 2v - 3v = -d. What are the prime factors of v? 3, 13 Suppose c = -3c + 12. Suppose -a = 2a - 5o - 122, -74 = -2a - 4o. Suppose -y + a = cy - l, 2y - 2l - 24 = 0. What are the prime factors of y? 3 Let v = -10 - 1. Let k(i) = i*2 + 11i - 1. Let a be k(v). Let o = 12 - a. List the prime factors of o. 13 Suppose -b - 3h + 444 = -573, 0 = 4b - 5h - 4085. What are the prime factors of b? 2, 3, 5, 17 Let m be 2/(-6) - 220/(-3). Suppose -13 = l + o, 4l + o + m = 6. List the prime factors of (-10)/(-3)l/(-12). 5 Let b be (-1 - 1) + 4 + 1. Suppose 408 + 66 = by. Suppose 3r = -4i + 2r + 159, 2r - y = -4i. List the prime factors of i. 2, 5 Let p be -1 - (0/4)/(-2). Let i = p + 15. Let c = i - -15. What are the prime factors of c? 29 Suppose 3q - 12 = 2q - 5g, 0 = -q - g + 4. Suppose -1 = -qv + 3. Suppose -4w + 42 = -vl - 90, 0 = 3l. List the prime factors of w. 3, 11 Suppose 5j - 25 = 0, 5u + 3j = j - 100. Let x = u + 27. Suppose 0p + 159 = 2p - xh, -2h - 244 = -3p. What are the prime factors of p? 2, 41 Let h(l) = 118l + 2. Let o be h(2). Suppose -51 = 3j + 4x + o, 3x = -2j - 193. Let t = 141 + j. List the prime factors of t. 2, 23 Let s(f) = -f2 - 4f + 4. Let u be s(-5). Let m be -1 - (u - 1) - -3. Suppose -3o = -4y + 6, -3o + 2o - m = -2y. List the prime factors of o. 2 Suppose -32i = -29i. Suppose i = 3x - 11 - 13. What are the prime factors of x? 2 Let p be 69/21 - (-4)/(-14). Suppose -11i + 9i + 24 = 4l, -27 = -3i + 3l. Suppose -pm = 2m - i, -3m - 11 = -c. What are the prime factors of c? 17 Let f(y) = -y*3 - 13y*2 - 30y - 11. Let z be f(-12). List the prime factors of 1 + z/153. 2, 3, 7 What are the prime factors of (25008/(-96))/(3/(-12)2)? 521 Let d = -1403 - -2084. List the prime factors of d. 3, 227 Let y = 10 - 7. Suppose g + 221 = yc, -c + 115 = g + 44. What are the prime factors of c? 73 Let j be ((-9)/(-27))/((-5)/(-6) - 1). List the prime factors of 1(-3 + j) - -315. 2, 5, 31 Suppose -1 = -r - 0. Let k be 3/(-1) - (3 - r). List the prime factors of 23 + k + (1 - 1). 2, 3 Suppose -2v + 6v - 4o - 432 = 0, -4o = -3v + 323. List the prime factors of v. 109 Let h be (-1 - 0)3(-1)/1. Suppose 0 = hr + 4x - 283 + 54, -3x = -12. List the prime factors of r. 71 Let n = 41 - 26. Let z be (-10)/n + 46/6. Suppose 0 = -k - 2j + z, -k + 3j + 22 = 4k. List the prime factors of k. 5 Let p(m) = 2m*2 - 54m + 294. List the prime factors of p(6). 2, 3, 7 Let q(u) = 2u2 + 2u - 24. Let d = 24 + -32. What are the prime factors of q(d)? 2, 11 Let j(i) be the second derivative of i4/12 + i3/6 - 3i2 - 9i. Let c be j(-10). Suppose 4p - 2p = c. List the prime factors of p. 2, 3, 7 What are the prime factors of (-15 - 1242)/((-6)/4)? 2, 419 Suppose -106u + 34u + 4896 = 0. List the prime factors of u. 2, 17 Let c be ((-14)/1)/(24/60). What are the prime factors of 63(3 + 75/c)? 2, 3 Let p = -11 + 31. Suppose p = 5i - 85. List the prime factors of i. 3, 7 List the prime factors of (-1032)/(-28) - (-1)/7 - 0. 37 Let b = 67 - 67. Suppose b = -3z + 30 + 39. List the prime factors of z. 23 Suppose -4c - 4l + 972 = 0, 16c - 19c + 721 = -5l. What are the prime factors of c? 2, 11 Suppose 4u + 10 = -3a, -2u + u + 2 = 3a. List the prime factors of 24/16 - (-149)/a. 2, 19 Let o(a) = -a*3 - 5a*2 + 10a + 30. Let c be o(-6). Suppose 1375 = 11f - cf. List the prime factors of f. 5, 11 Let q = 13 - 15. Let c(v) = -4v3 - 2v + 1. Let a be c(q). Suppose 0 = -m + 2m, n - a = -4m. List the prime factors of n. 37 Let x = 45 + -43. Suppose 8h - 364 = 3h - xn, 0 = -3h + 2n + 212. List the prime factors of h. 2, 3 Let y = 4635 + -2302. What are the prime factors of y? 2333 Let p = 1481 + -1344. List the prime factors of p. 137 Suppose 70941 = 65q - 26q. What are the prime factors of q? 17, 107 Let c = 274 + 38. List the prime factors of ((-2)/(-6) - 0)/(2/c). 2, 13 Let s be (-2)/8 - 1611/(-12). Suppose 5y + 5w = -56 - s, 3y + 111 = -2w. What are the prime factors of 344/10 - (-14)/y? 2, 17 Suppose 287 = 4i - 17. Suppose -i = -3n + 101. What are the prime factors of n? 59 Suppose 3g + 28 = 4w, 4w - g - 24 = -w. Suppose wu = 6u. Suppose uv = -5x + 2v + 45, -2x = -5*v + 3. What are the prime factors of x? 11 Let h(x) = x + 13. Let d be (-627)/(-44) + (-1)/4. Let n be (-280)/49 + (-4)/d. List the prime fa	{ "pile_set_name": "DM Mathematics" }
+ 2a - 3 Let a(y) be the second derivative of -y5/4 - y4/2 + y3/6 - 7y*2/2 - 3y. Let m(d) = d3 + d2 + 1. What is a(c) + 6m(c)? c3 + c - 1 Let s(g) = -2g*3 + 2g*2 + 3. Suppose 0 = 17j - 14 - 37. Let y(q) be the first derivative of -3q4/4 + q3 + 5q + 2. Give jy(c) - 5s(c). c3 - c2 Let o(k) = k*2 + 7k + 2. Suppose h + 4 = 9. Let y(i) = 3 - 686i2 + 687i*2 + 10i + 0i. Give hy(m) - 7o(m). -2m*2 + m + 1 Let u(l) = 1. Let c(d) = -d - 10. Let b(j) = -c(j) - 5u(j). Let v(z) = 0 - 4 - 7 - 2z. Suppose 0 = 4o - 2 - 14. Determine ov(x) + 9b(x). x + 1 Let f(n) = 4. Let p(l) = 7. Let u(d) = -5f(d) + 3p(d). Let o(i) = i*2 - 5. Determine -o(w) - 5u(w). -w2 Let o(f) be the third derivative of f3/6 - 10f2. Suppose 2 + 2 = -4y. Let p(g) = 2g - 5. Give yp(d) - 4o(d). -2d + 1 Let f(c) = -c*2 - 1. Let h(x) = 2x*2 + 6. Suppose -3z = -4s - 9, 4z + 23 = -3s - 15. Give sf(a) - h(a). 4a2 Let a(v) = v - 1. Let w(f) = 2f*2 - 7f + 6. Suppose 0 = 5n - 0 - 5. Let d be (n/3)/((-3)/(-9)). Give dw(u) + 6a(u). 2u2 - u Let j(t) = -t + 1. Let v be j(3). Let i(k) = k2 - k - 11. Let r be i(5). Let b(l) = -2l - 3. Let x(z) = -8z - 13. Give rb(p) + vx(p). -2p - 1 Let d(s) = 10s*2 - 7s. Let u(x) = -9x2 + 6x. Calculate 4d(m) + 5u(m). -5m2 + 2m Let p(o) = -21o + 11. Let j(g) = -5g + 3. Let s(f) = 9j(f) - 2p(f). Let t(x) = -7x + 11. What is -13s(k) + 6t(k)? -3k + 1 Let h(j) = -7j2 + 7j - 11. Let w(d) = -3d2 + 3d - 5. Give -2h(q) + 5w(q). -q2 + q - 3 Let q(k) be the third derivative of -k4/24 - k*3/6 - 3k*2. Let j(h) = h + 1. Let s = 19 - 24. What is sj(z) - 7q(z)? 2z + 2 Let z(f) = -7f3 - 8f*2 - 5f + 2. Let b(w) = w3 + w2 + w. Calculate 5b(g) + z(g). -2g*3 - 3g*2 + 2 Let l(m) = 9m*2 - m + 5. Let u(i) = -22i*2 + 2i - 12. Suppose 6c - w - 59 = c, -w - 11 = -c. Determine cl(s) + 5u(s). -2s*2 - 2s Let n(k) be the first derivative of k*2/2 + 8k + 2. Let b(j) = 3j + 23. Calculate -6b(f) + 17n(f). -f - 2 Let m(q) = 8q*2 - 9q - 9. Suppose -34c = -36c - 4. Let d(a) = -2a2 + 2a + 2. Determine cm(b) - 9d(b). 2b2 Let r(j) = j2 + j - 1. Let t(m) be the first derivative of -8m*3/3 - 3m*2 + 5m - 5. Give 6r(h) + t(h). -2h*2 - 1 Let y(z) = -2z*2 - 41z. Let d(h) = -h*2 - 14h. What is 8d(t) - 3y(t)? -2t2 + 11t Let m(p) = -p3 + p2. Let z(t) = -t*3 - 4t*2 - 2 - 6t*3 + 19t*3 - 7t*3. Determine 6m(j) + z(j). -j*3 + 2j2 - 2 Let n(m) = -m3 + 6m2 - 5m + 13. Let v(h) = h*2 - h + 1. What is n(r) - 6v(r)? -r*3 + r + 7 Let a(v) = 5v*2 - 8v. Let g = -3 - -6. Let s = -47 - -32. Let j = 7 + s. Let r(c) = 2c2 - 3c. Calculate ga(k) + jr(k). -k*2 Suppose 2x - 30 = -4k, 4x - 1 = -k + 3. Let y(z) = 3z3 + 3z*2 - 8z - 8. Let c(q) = q3 + q2 - 3q - 3. Calculate kc(u) - 3y(u). -u3 - u2 Let l(o) = -o + 60o2 + o3 - 60o2. Let y(w) = -3w3 + w2 + 6w. Determine 4l(a) + y(a). a3 + a2 + 2a Suppose 2j = o + 6j - 1, -17 = -4o - 3j. Let k(q) = -q - 2. Let s(n) = 2n + 8. Let f(x) = 1. Let h(b) = 3f(b) - s(b). Give ok(a) - 2h(a). -a Let h(n) = 4n*2 - 5n + 5. Let w(u) = -u*2 - 12u + 8 + 4u2 + 4 + 7u*2. Suppose 5q + 15 = 75. Calculate qh(m) - 5w(m). -2m2 Let a(o) = o3 - 7o*2 + 6o - 2. Let c(n) = 3n3 - 20n*2 + 17n - 6. Determine 17a(d) - 6c(d). -d3 + d2 + 2 Let r(o) = -5o2 - 21o - 8. Let z(n) = -2n2 - 7n - 3. Determine -3r(b) + 8z(b). -b*2 + 7b Let w be (2 + -1)48/6. Suppose 9 = 3v, f + 4v = -w + 24. Let z(m) = m3 + 2m*2 - 4. Let c(r) = -1. Determine fc(g) - z(g). -g*3 - 2g*2 Let s(f) = 19f*2 - 3f + 2. Let p(v) = v*2 - v + 1. What is -2p(g) + s(g)? 17g2 - g Let a(i) = -2i*2 - 4i + 4. Let f(c) = -c*2 - 2c + 2. Calculate -3a(r) + 7f(r). -r*2 - 2r + 2 Let b(v) = 3v + 3. Let n(p) = -8p - 1. Let t be n(-1). Let l(w) = 5w + 6. Calculate tb(f) - 4l(f). f - 3 Let r(h) = 4h*3 + 5h*2 + 9h + 3. Let a(v) = -6v3 - 7v*2 - 13v - 4. Calculate 5a(c) + 7r(c). -2c3 - 2c + 1 Let i(j) = -2j + 5. Let k(p) = 2p - 4p - 2p + 11. Suppose -3x = -4w - 12, -2w - 5x - 27 - 5 = 0. Give wk(t) + 13i(t). -2t - 1 Let b(z) = 9z*3 - 6z - 2. Let l(g) = -10g3 + 5g + 1. Give 3b(v) + 4l(v). -13v3 + 2v - 2 Let o(t) = -2t - 7. Let w be o(-5). Let l(v) = 0v*2 - 3v*2 - 3v - v*2 + wv*2. Let n(r) = r. Give -l(z) - 3n(z). z2 Let b(j) = -j2. Let m(g) = g3 + g2 + 1. Let r(t) = -7t3 - 9t*2 - 4. Let q(s) = -6m(s) - r(s). Let d be 46/14 + (-2)/7. What is db(f) + q(f)? f3 - 2 Let k(o) = 3o*2 + o - 8. Let l(u) = -10u*2 - 3u + 24. Calculate -7k(p) - 2l(p). -p*2 - p + 8 Let m(j) = 15j*3 + 11j*2 + 3j - 17. Let s(u) = 10u3 + 7u*2 + 2u - 11. Give 5m(t) - 8s(t). -5t3 - t2 - t + 3 Suppose -v + 11 = 2. Let x(p) = 8p - 7p - 14p - v - 4. Let j(d) = -6d - 6. Determine -9j(u) + 4x(u). 2u + 2 Suppose -5f = 38 - 8. Let j(m) = m3 - m2 + 1. Let n(z) = 7z*3 - 6z*2 - z + 6. What is fj(u) + n(u)? u*3 - u Let a(s) = 2s*2 + 4s - 2. Let c(k) = k - 1. Suppose -4j - 2l = -2, -j = -2l - 5 - 3. Give jc(r) - a(r). -2r2 - 2r Let j(m) = -m*2 - 3m + 60. Let c be j(-9). Let d(x) = -3x3 - 17x + 23. Let n be 1(17 - 0)-1. Let y(t) = -t*3 - 6t + 8. Calculate cd(v) + ny(v). -v3 + 2 Let y(k) = -k2 - 4. Let h(u) = 13 + 3u2 + 0 - 2. Let l(d) = d3 + 3d*2 + 3d + 5. Let p be l(-3). Calculate ph(w) - 11y(w). -w*2 Let d(z) be the second derivative of -3/4z*4 - z + 7/2z*2 + 1/3z*3 + 0. Let h(c) = -8c*2 + 2c + 6. Give 6d(j) - 7h(j). 2j2 - 2j Let o(m) = -6m2 - 7m - 4. Let i(x) = x*2 + x + 1. What is -5i(z) - o(z)? z*2 + 2z - 1 Let q(s) = 56s2 - 11. Let f(x) = -11x*2 + 2. Calculate 11f(h) + 2q(h). -9h*2 Let w = 23 + -21. Let d(r) = 4r*2 + 4r - 1. Let i(g) = g - 13g2 - 6g + 3 - 8g. What is wi(o) + 7d(o)? 2o*2 + 2o - 1 Let j = 69 - 68. Let t(a) = 3a2 - 5a - 1. Let r(d) = -d. Determine jt(i) - 4r(i). 3i2 - i - 1 Let s(d) be the second derivative of -d3/6 + d2/2 - 2d. Let k(a) = -3a2 + 15a + 1. Let p be k(5). Let x(m) = -8m + 5. Determine px(n) - 6s(n). -2n - 1 Let d(k) = -2k2 + 6k. Let v be d(5). Let n(p) = p. Let t(h) = -4h2 + 20h. What is vn(m) + t(m)? -4m*2 Let d(f) = 2f - 2. Let q(p) = 2p - 2. Suppose 2m - 6 = -m. Suppose ms - 5s - 9 = 0. What is sd(c) + 2q(c)? -2c + 2 Let u(p) = 4p*3 + 7p*2 - 9p + 2. Let f be (4 + -5)/((-3)/21). Let s(z) = 2z3 + 4z*2 - 5z + 1. Give fs(w) - 4u(w). -2w3 + w - 1 Let j(c) = -c2 - 3c - 1. Let g(m) = -2m2 - 4m - 2. Determine -2g(t) + 3j(t). t*2 - t + 1 Let i(h) = 8h*2 - 3h + 5. Let c(x) = 4x2 - 2x + 3. Determine 5c(d) - 3i(d). -4d2 - d Let x(c) = 6c + 5. Suppose 7s = 5s - 12. Let m(l) = 9l + 6. Let k(y) = -28y - 18. Let o(q) = -2k(q) - 7m(q). What is sx(d) - 5o(d)? -d Let a(r) = -r*3 - 4r*2 + 6r + 2. Let k(v) = 2v3 + 9v*2 - 13v - 4. Suppose 5j = 2l - 10, 0 = 5l + 1 + 24. What is jk(w) - 9a(w)? w3 - 2w - 2 Let n(i) = -17i3 + 9i*2 - 15i. Let g(k) = -8k3 + 4k*2 - 7k. Suppose 8b = 23b - 195. Calculate bg(c) - 6n(c). -2c3 - 2c*2 - c Let i(z) = -5z - 5. Suppose -n - 2s + 0s = -1, 8 = 3n + s. Let j(q) = -4q - 4. Give ni(f) - 4j(f). f + 1 Let x(b) be the second derivative of -b4/12 + b3/6 + 29b. Suppose -l + 4 = 3. Let k(t) = -7t*2 + 5t. Give lk(m) - 5x(m). -2m2 Let u(t) = 5t + 0 + 1 - 4t. Let c(w) be the first derivative of w2/2 + 2w - 3. Determine 2c(h) - 3u(h). -h + 1 Let q(n) = 11n2 + 11n + 3. Let a(s) = -6s2 - 6s - 1. What is 7a(o) + 4q(o)? 2o2 + 2o + 5 Suppose 5f = 8 + 2. Let k(a) = 3a - 2a - af - a2 - 3a*2 - 3. Let h(z) = -6z*2 + z - 4. What is -3h(b) + 4k(b)? -2b2 + b Let y(v) = -v2 - 5v + 10. Let h(c) = c - 2. Let f be (-4)/6 + (-6)/(-9). Suppose a + 4a = f. Suppose -p + 1 - 3 = a. What is py(s) - 11h(s)? 2s2 - s + 2 Let c(u) = 2u*3 + 3u*2 + 2u. Let q(x) = -9x3 + 356x*2 + x - 10x - 369x2. Let r(h) = -6h*2 - h. Let z be r(2). What is zc(w) - 6q(w)? 2w*3 + 2	{ "pile_set_name": "DM Mathematics" }
x (b) v (c) -10 a Let w = -3954.4 - -3963.5. Which is the third biggest value? (a) w (b) 3/4 (c) -6 (d) -9 c Let b(h) = h*3 + 9h*2 + 8h + 1. Let k be b(-1). What is the fourth smallest value in -0.5, k, 0.5, 8/39? k Let s = -7607 - -190184/25. Which is the third smallest value? (a) 4 (b) -3 (c) s (d) 1/4 (e) -1 d Let k be (-24)/(-192) - 1/(-8). Let m = 54 - 53. What is the third biggest value in 3/8, m, -1/22, k? k Let o be 2(2/1)/(-20). Let t = -27090 - -27090.4. What is the fourth smallest value in 0.3, o, -0.031, t? t Let f = -123 + 128.28. Let m = f - -0.32. Which is the fourth smallest value? (a) m (b) 4/7 (c) 3 (d) 2 a Let l = 0.01 + 0.89. Suppose k - 5w + 15 = 0, -3w + 8 + 14 = 2k. Let h = 89 - 88.7. Which is the second biggest value? (a) l (b) h (c) k a Let t = 8225 - 74119/9. Let l = -631/63 - t. What is the third smallest value in 6/11, l, -16? 6/11 Let t = 4757 - 4742. What is the smallest value in -4/3, t, 0.2, -1, -4/7? -4/3 Suppose -5h - 553 = 107. Let o be (-64)/h + (-8)/12. Let s = 0 + 0. Which is the second biggest value? (a) s (b) o (c) 1 (d) -0.06 a Let i = -2/119 - 192/2737. Let n = -8235692/63 + 130720. Let j = n + 50/9. What is the fourth biggest value in 1, j, -3, i? -3 Let z be 165/195 + -7 + 6. What is the third biggest value in z, -2, 88, -2/5? -2/5 Let t be 10/(-5)(-3)/14. Let n = -11731 + 11731.7. What is the second biggest value in n, -7, t? t Let m = 39632/5 - 7732. Let l = m + -195. Let r be (-40)/(-60)-13. What is the second biggest value in r, 12/7, -1/2, l? -1/2 Let n be ((-1672)/(-16))/111 - 9. What is the third biggest value in -0.04, -4/7, n, -37? -4/7 Let m = -5.7 + -41.3. Let w = m - -46.958. Let b = w + 0.202. What is the second biggest value in -2/11, 0.2, b? b Let w be (36/40 + 3)/(252/30). Let y = 179/84 - w. Which is the third biggest value? (a) 2 (b) y (c) 0.06 c Let m = 22450.908 - 22496. Let t = 0.092 + m. Let k = 49 + t. What is the second smallest value in 41, k, 2/15? k Let m = -2691 + 2696. What is the smallest value in 0, m, -18.6, -1/4? -18.6 Suppose 11 = 4t + 5m, -2t - 7m + 1 = -6m. Let k = -117 - -114. Let x be ((-2)/3)/(0 + -3). Which is the smallest value? (a) k (b) 0.5 (c) x (d) t a Let l = 25 + -24.3. Let i = 1.7 + -0.9. Let m = i - l. What is the fourth biggest value in m, -3, -2/19, 6? -3 Let t = 48 - 36. Suppose 24 - t = -2w. Let o be (3/(-11))/((-9)/w + 0). Which is the fourth biggest value? (a) o (b) 1 (c) -0.1 (d) 5 a Let w = -30 + 35. Let l be ((-2)/3)/(-2 + (-44)/(-24)). What is the smallest value in l, w, -3? -3 Let h(f) = -f2 + 14f - 48. Let n be h(7). Which is the second biggest value? (a) 4 (b) 0 (c) -209 (d) n d Let j = -381 - -1139/3. Let h = 33 - 85. Let q = h - -55. What is the third smallest value in j, q, -1.4? q Let y(q) = q*3 - 5q*2 + 3q + 2. Let z be y(4). Let p = 96672 + -96675. Which is the third smallest value? (a) -3/5 (b) 8 (c) z (d) p a Let d = -365 - -596. Let w = d - 227. Which is the biggest value? (a) -72 (b) 2 (c) w c Let w = 364 + -665. Let i = w + 301.4. Which is the biggest value? (a) 0.007 (b) 3/2 (c) i b Let c = -325592/15 - -21706. What is the second smallest value in c, -2, 4.7? c Let x = -0.404 - 0.106. Let r = -61.51 - x. Let n = r + 57. Which is the second biggest value? (a) 0 (b) -13 (c) n c Let f = 1949 - 1946. Let o = 0 - 7. What is the third smallest value in f, -4, o, 3/5? 3/5 Let v = 244.4 + -246. Let o = -2.6 - v. Which is the second smallest value? (a) o (b) -25/2 (c) -0.4 a Let p = -344 + 593. Let k = p + -238. Let z = -28/9 - -149/45. What is the second biggest value in k, -5, z? z Let z = -8443.43 + 8443. Which is the third smallest value? (a) z (b) -31 (c) 0.5 c Let z = -2 + 1.5. Let s be (-24)/(1 - -5)(-9)/14. Let y = s - 68/21. Which is the second biggest value? (a) z (b) y (c) -1/4 a Suppose v - 3 + 11 = 0. Let t = -57519 - -57519.3. Which is the third smallest value? (a) t (b) 1 (c) -0.1 (d) v a Suppose 5k + 11 = 2i, 1 = -4i + k + 32. Suppose il = 22l - 14. Which is the smallest value? (a) -2/17 (b) 5 (c) l (d) -3/5 d Let w = -50.71 + 34.81. Which is the third smallest value? (a) 6 (b) w (c) 4 a Let x = -5755 + 5754. What is the fourth smallest value in -5, x, -3, -19, -1/9? x Let l = -39.8 + 379.4. Let i = 340 - l. What is the biggest value in 9, i, 2/11, 0.2? 9 Let n = 0.2 - 1.14. Let a = n - -77.94. Let k = -77.2 + a. What is the smallest value in 5, 10, -0.3, k? -0.3 Let f = 5584 + -5583. Suppose 3 = -k - 7. Which is the second smallest value? (a) k (b) f (c) -0.1 c Let o = -1711 + 1729. What is the second biggest value in -4, 0.56, o? 0.56 Let k = 6569 - 6572. What is the fifth biggest value in 4, 0.5, 92/5, 5, k? k Let v = -8329.061 + 8324. Let t = v - -0.061. Which is the fourth smallest value? (a) t (b) -1 (c) -1/3 (d) 5 d Let z be 1 - 7 - 1445/(-255). Which is the third biggest value? (a) z (b) -0.1 (c) -7 (d) -0.8 d Let w be (-34)/9 - (92 + -96). Let g = -433 + 437. What is the smallest value in w, -6, g, -2? -6 Let t = -95/9 - -1886/171. Let q = t + 11/57. Which is the third biggest value? (a) 0.2 (b) 3 (c) q (d) -5 a Suppose 0 = -3f + 29 + 10. Suppose -fz - 76 = -15z. Let p = z + -191/5. Which is the second smallest value? (a) 5/2 (b) p (c) 1/10 c Let r = -51999/7 - -7429. What is the third biggest value in 0.2, r, 6, -2/43? 0.2 Let j = 1 - -2. Suppose -1545r = -8379 + 164424. Which is the second smallest value? (a) 0 (b) r (c) j a Let r = -34.3 - -40.7. Let v = 9.4 - r. Which is the second biggest value? (a) 0.029 (b) v (c) 4 b Let z = -1657629 + 1657624. Let b be (18/10)/1 + -1. What is the third smallest value in z, -9, b, 0.3? 0.3 Let t = -10403/132 + 866/11. Which is the fourth biggest value? (a) t (b) 1 (c) 0 (d) -0.8 d Let a = 0.27 - 29.87. Let u = a + 30. What is the second biggest value in 0.3, u, 1? u Let g be ((-7)/(-2) + -1)2. Let m = -48 + 143. Let f = 92 - m. What is the second smallest value in g, -0.5, f? -0.5 Let t = -14328 + 14328.2. Let w = 3 + -3.2. Let j = w - -0.3. Which is the third smallest value? (a) t (b) 0.01 (c) j a Let l = 81/61 - 1661/1159. Which is the smallest value? (a) l (b) 9 (c) -34 (d) -1/2 c Let v be 0/(-8) + 1 + 5 + (-207)/27. What is the second biggest value in -4, -3, v, 0.2, 0.005? 0.005 Let g = 16991 - 1138402/67. What is the fourth smallest value in g, 2, -5, 0? 2 Let t = -25 - -24.42. Let y = 0.29 + t. Let q = y - 5.71. What is the fourth smallest value in 2/7, q, -5, -3/5? 2/7 Let l = -8281/3 + 2735. Let f = 26 + l. Suppose 6x + 2b = 10x + 2, 19 = 2x + 3b. What is the biggest value in x, -3/4, f? x Let x(i) = i*3 + 7i*2 - 15i + 24. Let p be x(-9). Let b = 24 - 20. Let q = 0.3 - 8.3. What is the second smallest value in b, q, p, -1/2? p Let f(r) = -4r2 + 16r + 17. Let i be f(8). Let w be (-4)/18 + i(-1)/(-108). Which is the biggest value? (a) -2 (b) -3/4 (c) w (d) 0 d Let f(b) = -b + 28. Let n be f(-8). Let h be (-35)/84(4 + n/(-10)). What is the third biggest value in h, -0.1, -1/5? -1/5 Suppose 0 = 5g + 3f - 13, 0 = -5g + 4f - 0f + 6. Let k be (2 - 21/14)g/(-12). Let t = 0.7 - -0.3. Which is the second biggest value? (a) 0 (b) k (c) t a Let f = 4 - 4.2. Suppose 2y + 1 = -h, -30h = -4y - 29h + 1. What is the biggest value in 3, f, y? 3 Let l = -2 + 2. Let p = l + -3. Let r = -11948 - -11947.7. Which is the second biggest value? (a) r (b) p (c) 0 (d) 2/7 c Let s be 604/(-30) + -398 + 418. What is the smallest value in -33, 3, -4, -3, s? -33 Let t = 4291 + -4200. What is the biggest value in 2/9, t, -2? t Let h be 2 - (-9)/15 - 3. Let o be (-24)/9 + 3 - 2130/(-9). Let g be 16/88 - o/33 - 2. Which is the second biggest value? (a) 3 (b) g (c) h (d) -1/2 c Let g = -187.5 - -186.6. What is the second biggest value in 0.4, g, -4, 1, -0.08? 0.4 Let x = 37.99 - 37.811. What is the third biggest value in 0.2, x, 0.12? 0.12 Let q be -1 + (-6)/(-12)3. Let n = -5.9 + 6.9. Which is the biggest value? (a) q (b) -5 (c) n c Let n be (((22/12)/11)/1)/(10/(-75)). What is the third smallest value in -3/10, 0.3, -2/7, n? -2/7 Let s = 3.197 - 4.197. Suppose 0 = -2q + 2u - 14, -2q + 3*u - 14 - 3 = 0. Le	{ "pile_set_name": "DM Mathematics" }
. Let l = m - -18. Suppose 2w = -2t + l, -2w + w = -t - 73. What is the tens digit of w? 7 Let x(p) = 2p*2 + 10p + 8. Let q be x(-9). Suppose -181 = -4i - 153. Suppose 0 = if - q - 11. What is the tens digit of f? 1 Let j be ((-210)/(-6) - -5) + -1. Let x(b) = -b*2 + 48b - 239. What is the hundreds digit of x(j)? 1 Let z = 103 + -127. Let n = -24 - z. What is the tens digit of n/(-11 - -6) - (-127 + -2)? 2 Let l be 4(-4)/(-16)5. Let r be (36/33)/(128/(-22) - -6). Suppose 0 = -2q - r, q + 821 = lh - q. What is the units digit of h? 3 Let k(c) = 2c2 + 40c - 13. What is the units digit of k(-80)? 7 Suppose -3l = -9, 84l - 17900 = -4k + 88l. What is the tens digit of k? 7 Let t(n) = 3n2 - 51n + 70. Let s(v) = 4v2 - 76v + 105. Let c(d) = -5s(d) + 7t(d). Let j be c(-17). Let r = j + 195. What is the units digit of r? 8 Let i(b) = -b*2 - 3b + 75. Let y be i(7). Suppose -d = -4v + 1470 - 416, yv = d + 1317. What is the hundreds digit of v? 2 Suppose -4u + 0r = -3r - 868, u - 217 = -4r. Suppose t - u = -7. Suppose -3c + a = -t, -5a = -0a. What is the units digit of c? 0 Let m be (123/(-36)-153)/(3/8). Suppose -4r = -50f + 47f + 4177, f - r = m. What is the tens digit of f? 9 Let t(r) = -r2 - 6r - 6. Let a be t(-4). Suppose -k = 4p - 280 + 7, 576 = ak + 2p. What is the hundreds digit of k? 2 Let p = 1571 - 2214. Let d = 569 - p. What is the thousands digit of d? 1 Let j = -4598 - -21562. What is the thousands digit of j? 6 Let y(r) = 104r - 79. Let a be y(17). Suppose 0 = 4f - 2w - 6812, -10f = -11f - 3w + a. What is the units digit of f? 1 Let g = -587 + 6517. What is the tens digit of g? 3 Let v(r) = -63 + 0r + 14r + 2r + 2r. What is the tens digit of v(18)? 6 Suppose -132907 = -6m + 4415. What is the hundreds digit of m? 8 Let c(s) = 743s2 + 95s + 348. What is the thousands digit of c(-4)? 1 Suppose -3h = 5h - 16. Suppose hp - 2u - 60 = 0, -p - u = p - 72. What is the units digit of p? 4 Let h(t) = 2t3 - 34t*2 - 60t + 32. Let s be h(17). Let q = -533 - s. What is the units digit of q? 5 Suppose 33 = b - 1. Suppose 0 = 4c + b - 474. What is the hundreds digit of c? 1 Let i(f) be the third derivative of -f6/40 - f5/10 - 7f*4/24 - 5f*3/3 - 10f*2 + 8f. What is the units digit of i(-3)? 8 Let a(r) = 71r3 - 8r*2 - 17r - 38. Let y be a(9). What is the tens digit of y/100 - 2/10? 0 Suppose -104830w + 104812w + 205758 = 0. What is the thousands digit of w? 1 Suppose -5w + 97026 = x, 3w - 4827 = -5x + 53415. What is the thousands digit of w? 9 Let b = 26658 - -11890. What is the thousands digit of b? 8 Suppose 2h + 14y = 13y + 13423, -13438 = -2h + 4y. What is the tens digit of h? 1 Suppose -58k + 665457 = -967881. What is the ten thousands digit of k? 2 Let x = 14761 - 8668. What is the thousands digit of x? 6 Suppose 0o + 20 = 3o - 2h, 20 = o - 4h. Suppose -2m = oc - 130, 3c - 198 = 48m - 51m. What is the units digit of m? 7 Suppose 0 = -7v + 5o + 397434, 4o = -8v + 10v - 113550. What is the tens digit of v? 7 Let u = 5093 - -16967. What is the units digit of u? 0 Let u be -295/20(2 + 0). Let q = u - 4. Let w = q - -40. What is the tens digit of w? 1 Let z(x) = 19x*2 + 55x - 1278. What is the tens digit of z(23)? 3 Suppose 31675 = j - 16817. What is the units digit of j? 2 Let k(o) = 645o2 + 68o - 6. What is the thousands digit of k(5)? 6 Suppose -19i = -23i - 80. What is the tens digit of 6/15 - 4172/i? 0 Suppose 302h - 307h = -730. Suppose -d + 82 = 3n, 5n - 3d = -14 + h. What is the units digit of n? 7 Let x(b) be the third derivative of 325b*4/24 - 4b*3/3 - 15b*2. What is the units digit of x(1)? 7 Suppose 0 = 25h + 10h - 162120. Let g = h + -3107. What is the tens digit of g? 2 Let d(h) = h3 - 6h*2 + 4. Suppose -5i + 35 = 5a, -2i - 4a + 12 + 4 = 0. Let p be d(i). Suppose pn = 105 + 151. What is the units digit of n? 4 Suppose -2r = 10, 2x + 4r - 16800 = -0r. What is the thousands digit of x? 8 Let t = 16 - 33. Let k(b) = 5b - 31. Let w be k(t). Let z = -64 - w. What is the units digit of z? 2 Let g = 12252 - 159. What is the units digit of g? 3 Let z be (0 - -1 - -208)1. Suppose 5c + 695 = -5n, n = -0n + 2c - 136. Let r = n + z. What is the units digit of r? 1 Suppose -5v - 11 = -3p - 21, -5 = -p. Let k(r) = -19r - 93. Let o(x) = -10x - 47. Let s(f) = 4k(f) - 9o(f). What is the tens digit of s(v)? 2 Let k be (-14)/(-3) - 2/(-6) - 5. What is the hundreds digit of (-13)/(143/55)(-169 - k)? 8 Let g(x) = -1004x + 63. Let z be g(-9). Suppose -18p = 2169 - z. What is the units digit of p? 5 Let w = 277 + -268. Let j = 426 - 174. Suppose -j = -wm + 5m. What is the units digit of m? 3 Let z = -592 - -5043. What is the tens digit of z? 5 What is the thousands digit of (-6 + 2 - 2) + 7 - -5422? 5 What is the ten thousands digit of ((-12158)/5)/((-132)/(-90) + 125/(-75))? 1 Let l = -482 - -6924. What is the tens digit of l? 4 Let u(r) = r3 - 7r*2 - 19r + 11. Let x be u(9). Suppose 0d + 384 = xd + 4v, -3d - 4v + 586 = 0. What is the units digit of d? 2 Let j = -5 + 5. Suppose -8p + p + 336 = j. Suppose -312 - p = -4s. What is the tens digit of s? 9 Suppose 0 = -20a + 15a + 30. Suppose -19 + 1 = -ah. Suppose -hj - 86 = -4j. What is the units digit of j? 6 Let t(g) = -9g + 2. Let o be t(-1). What is the tens digit of 53(3 + -8 + o)? 1 Let h = -80 + 30. Let y = h - -60. What is the units digit of 188/6 - y/30? 1 Suppose -6b - 180 = -b. Let a = b - -79. Suppose n = 2m + 41, m + a = n + 2. What is the tens digit of n? 4 Let y be ((-2)/(-3))/(341902/42735 - 8). Let g = y - 444. What is the tens digit of g? 5 Let t = -11526 - -22235. What is the hundreds digit of t? 7 What is the units digit of 21/(-8)6(65 + 3)-1? 1 Let o = -67 - -118. Let t = o + 211. Suppose 2j = 4a + t, -452 - 52 = -4j + 4a. What is the hundreds digit of j? 1 Suppose 31z + 6 = 33z. Let x(w) = 21w - 12w - 16 - z + 45w. What is the tens digit of x(3)? 4 Suppose -5c = -3346 - 45360 - 16719. What is the tens digit of c? 8 What is the thousands digit of (-13145)/10-8 + -14? 0 Suppose -10v + 37464 + 24771 = -26755. What is the tens digit of v? 9 Let z(v) = -8v*2 + 5v - 13. Let r be z(3). Let i = 42 - r. What is the units digit of i? 2 Let m be 378/36(-2)/(-3). Suppose 0 = -33s + ms + 15470. What is the tens digit of s? 9 Let w be (-6 - -2)((-105)/(-12) + -2). Let p be (14/(-3))/(1/w). Suppose -10v + 9v = -p. What is the hundreds digit of v? 1 Let d(w) = 34w3 - 2w*2 - 2w + 4. Suppose -3 = -n, -3n = -2s - 3s - 4. What is the tens digit of d(s)? 3 Suppose -3x = 2k - 7960, 4k + 4539 = -4x + 15151. What is the units digit of x? 4 Let y = 17 + -17. Suppose y = -6l + 190 + 206. What is the tens digit of l? 6 Let s(c) = -2c3 + 5c - 3. Let r be s(3). What is the tens digit of (664/(-6) - -2)/(14/r)? 2 Let v = 1543 + 7161. What is the thousands digit of v? 8 Let i(w) = -47w2 + 6w - 3. Let o be i(-3). Let k = o - -624. What is the units digit of k? 0 Suppose 0 = -18d + 94439 + 98287. What is the hundreds digit of d? 7 Let s(v) = 2v*2 - 21v. Let k be -3(14/6)/716. Let z be s(k). Suppose 0 = -2c + p - 6p + 396, 4c - z = 4p. What is the tens digit of c? 0 Let w(q) = -17q + 66. Let l be w(-13). Suppose a = 6a + 3h - 10, 0 = -2a + 5h + 35. Suppose 2c + ac = l. What is the units digit of c? 1 Suppose 0o = o + 3j + 11, -3o - 5j - 17 = 0. Let v be (-4)/(o + -2)(-35)/(-28). Suppose 3p + 348 = vp. What is the tens digit of p? 7 Let v = 12195 + -6629. What is the hundreds digit of v? 5 Let c = -5547 + 5865. What is the tens digit of c? 1 What is the hundreds digit of (-178473)/(-30) - 40/400? 9 Let v(i) = 6 - 6i2 - 28i - 3847i3 - 2i*2 + 3846i*3 - 4i*2. What is the units digit of v(-10)? 6 Let p(l) = -2l + 13. Let t(s) = -4s + 26. Let d(h) = 13p(h) - 6t(h). Let c(a) = a3 - 6a*2 - 55a + 5. Let q be c(11). What is the units digit of d(q)? 3 Suppose 0 = 4r - 11 - 53. Suppose -rj + 32 = -12j. Suppose 2y = -2x + 32, jy = -3x + 4y + 49. What is the units digit of x? 5 What is the thousands digit of (765269/(-2038))/((-21)/20 + 1)? 7 Let u =	{ "pile_set_name": "DM Mathematics" }
-6)/(-15). Solve t = -7a + 3a + 16 for a. 4 Let m(a) = a - 5. Let p be m(5). Suppose -2n + 3n = p. Solve 4h - 5h = n for h. 0 Suppose 4y + 2t - 86 = 0, 3y - 5t - 25 = y. Suppose 5 = 3l - 1. Suppose 0 = -ln + 4 + 2. Solve d + y = -nd for d. -5 Suppose -s - 4x + 8 = 2, 3x = -4s + 11. Suppose -sb - 26 = -5u, u + 2b = 7b + 19. Solve -uw = -2w - 8 for w. 4 Let v be 9 + -3 + -4 - -1. Solve -3g - 6 = v for g. -3 Suppose -5d - 8 + 2 = -4b, -5 = -b + 3d. Let r be (1/1)/(b/(-2)). Solve -rv - 4 = -0 for v. -2 Let l be (-9)/624/(-9). Let k be 50/(-4)4/(-5). Solve -ln + k = -10 for n. 5 Suppose -4 = -2i + 2. Suppose im - 2m = -3. Let t be (2/4)/(m/(-6)). Solve t + 7 = -4u for u. -2 Suppose -2n = -3x + 2 + 8, -x + 8 = -3n. Let w = -1 + x. Solve -4o = w + 3 for o. -1 Let a(z) = z*2 + 6z - 1. Let n be a(-9). Suppose 2i - 5 - 5 = 0. Suppose 3 = -4o - 5k - 3, io = 3k + 11. Solve n = 5l + o for l. 5 Suppose 5w = 5k - 15, 0 = 5k - w + 2w - 9. Solve -7 + k = -b for b. 5 Suppose 3a - 5y = 5, -5a - y - 3y - 4 = 0. Solve v + av - 2 = 0 for v. 2 Let z(b) = 6b + 5. Let m(t) = 12t + 9. Let r(f) = 3m(f) - 5z(f). Let a(l) = 5l + 2. Let o(v) = -4a(v) + 3r(v). Let s be o(-4). Solve 2i - 4 = s for i. 5 Let f(a) = -a3 - a2 + 2a - 1. Let o be f(1). Let p = o + 3. Let n = 18 - p. Solve 3u + u = -n for u. -4 Let f(d) = -2d*3 - 3d*2 + d + 2. Let p be f(-2). Solve 0 = 7h - ph for h. 0 Let x = -82 + 87. Solve -xi = -0 + 5 for i. -1 Let y = 0 + 2. Let j = -4 - -5. Let q = y + j. Solve 0o = qo for o. 0 Let c(y) = -y*3 - 4y*2 - 4y - 1. Let t = -11 - -7. Let n be c(t). Suppose -5k + n = b - 6b, 0 = k + 4b - 8. Solve kz - z = -3 for z. -1 Let b(z) be the second derivative of z*2 - 1/6z*3 - 2z + 0. Let u be b(-3). Solve 0 = ug - 1 - 14 for g. 3 Let p(r) be the first derivative of -r4/4 + 8r*3/3 - 7r*2/2 + 5r + 2. Let d be p(7). Suppose 0 = 7s + 3 - 24. Solve -su + d + 10 = 0 for u. 5 Suppose 2j + 2 = 5t - 0, 0 = -4j - 2t + 20. Solve ja - 2a + 10 = 0 for a. -5 Let g(l) = l - 8. Let h be g(6). Let p be (-6)/h + -1 + -12. Let q = 10 + p. Solve i = -qi for i. 0 Let i(l) = -l3 - 3l*2 + 2l - 4. Let s be -4 + 01/2. Let w be i(s). Let v(g) = -2g - 12. Let u be v(-6). Solve -o + w + u = 0 for o. 4 Let s = -1 - -1. Suppose -4d + 3j + 61 + 51 = s, 0 = 2d + 3j - 38. Solve 0a = 5a - d for a. 5 Suppose -4v - 6 = 3i - 17, 4i - 6 = -v. Suppose -b + 1 = -0. Solve f = b + i for f. 2 Suppose -2l = 3l + 10. Let n be 6/(l + 4) + -2. Solve -n = 5f + 19 for f. -4 Suppose 0 = 2f - 14 - 6. Solve -m = -6m - f for m. -2 Suppose 0r + 4r = -80. Let x be (-2)/(-5) - (-8)/r. Let z = x - -1. Solve 2o = 3o + z for o. -1 Suppose -3a + 12 = 3o, -o - 8 = -2o - 3a. Let i be 0/(-2)o/(-2). Solve -3f - f = i for f. 0 Suppose -2s - 2 = 2g - 4s, 0 = -2g - 4s + 28. Let f be 13/4 + (-1)/g. Let d = -6 - -6. Solve dy - 12 = fy for y. -4 Suppose -3w + 15 = -3g, -4w + 17 = w - g. Solve -wb - 9 = 6 for b. -5 Suppose 0 = 4v - o + 3 - 1, 0 = 5v - 3o + 6. Solve v = -8n + 4n for n. 0 Suppose -3l + 4x = -31, 2l + 4x + 0 = -6. Suppose -2s + 19 = 2u + 3s, -ls + 15 = 0. Solve -ug - 7 = -1 for g. -3 Let j be (-3)/((-2)/(-2)) + 3. Solve j = -t + 6t for t. 0 Suppose -x - 8 = -4u - 5x, -2x - 2 = 5u. Let w(t) be the first derivative of -t4/4 - t3/3 - t - 12. Let h be w(u). Solve 0 = hf - f - 2 for f. 1 Suppose -24 + 3 = -3n. Solve -2g - n = 1 for g. -4 Let c(a) = -a2 + 6a + 7. Let d(i) = -i*2 - 8i - 5. Let h be d(-6). Let n be c(h). Suppose 3x - 2x = 1. Solve v + n + x = 0 for v. -1 Let i(y) be the second derivative of y*5/20 + 5y*4/12 - 5y*3/6 + 3y*2 - 3y. Let n be i(-6). Solve n = 5o - 10o + 5 for o. 1 Suppose 0p - 25 = -5p. Suppose 5u = -h + 1, -pu - 4 + 3 = -h. Suppose -d = -5 + h. Solve 0 = 8r - dr - 4 for r. 1 Suppose 4q + 3b - 36 = 0, -4b + 3b = 0. Suppose q = -o + 25. Solve 2c - o = -2c for c. 4 Suppose 4y + 0 = -5g + 35, -y + 21 = 3g. Suppose -43 = 2j - 5r, j - 2r = -2j - 81. Let z = j + 49. Solve 2a = ga + z for a. -4 Let j(n) = n3 - 15n*2 + 17n - 5. Let c be j(14). Let a = c - 17. Solve -2u - 3u = -a for u. 4 Let z(i) = i3 - i2 - i - 1. Let d be z(-1). Let l(k) = -k. Let b be l(d). Let r be (18/4)/(4 - 207/54). Solve 5o - b = -r for o. -5 Suppose -6i = -11i + 15. Solve -io = -4o - 2 for o. -2 Let a be 132/2 - (-4 + 4). Suppose 48 = 2v - 3k, -2k = -4v + 22 + a. Solve 3t = -v + 6 for t. -5 Suppose 0 = -4d - 8, -3 = g - d - 11. Solve 5 = m - gm for m. -1 Let k = 107 + -99. Solve -5r + 2 = -k for r. 2 Let y be (6/8)/(51/(-238))-2. Solve 2u - yu = -15 for u. 3 Let j be 2 - 2/((-4)/2). Solve 0l = jl - 15 for l. 5 Let m be 0/(-6 + (-12)/(-3)). Suppose 2d + mh + 4 = h, -3d - 5h = -20. Solve -2o - 4 - 4 = d for o. -4 Suppose 2k - 7 = -5a - 0k, a - 5k = -4. Suppose 2 = -3y - a. Let w be (4 - -29)y/(-3). Solve 4 = -5x - w for x. -3 Let b be -2 + (1 + -5 - -3). Let w be 0/b + -3 + 5. Solve 5y + 3 = -w for y. -1 Let d = 0 - 0. Suppose dr - 2r = 4x - 10, 4r - 3x - 75 = 0. Let g = 10 - 7. Solve 0n + gn = r for n. 5 Let b be 0/2-11. Let x = b - 10. Let f be (-6)/15 - 4/x. Solve -7o + 3o + 12 = f for o. 3 Suppose -5a - 2l + 17 = 0, 0 = -3l - 12. Suppose m - 2g + 2 = -4, -10 = -am + 2g. Suppose -y + 10 = my. Solve -n - y - 2 = 0 for n. -4 Let z be -1 + (-16)/(-56) + 5/7. Solve 2d = -zd for d. 0 Let p(l) = -l2 + 2. Let s be p(2). Let h be s/(-12) - (-29)/6. Solve -13 = -2j - h for j. 4 Suppose 5p - 7 = 4c + 1, 0 = 5c + 10. Solve 2n + pn = 0 for n. 0 Let l = -8 + 1. Let h = l + 8. Solve 0 = n - 0n - h for n. 1 Suppose 3 + 3 = 2a. Suppose 1 = -2z - a. Let s be 58/3 - z/3. Solve 3p + p = -s for p. -5 Suppose -5a - 3t + 20 = -0, t = -3a + 16. Let z = a + -5. Solve -zg = -7g for g. 0 Let j be 5(1 + 0/(-1)). Suppose 5m + j = 30. Solve 4y + m = 13 for y. 2 Let v(i) = i + 8. Let x be v(-6). Suppose -4g - 13 = -21. Solve xj - 4 = -gj for j. 1 Suppose -3r + r + 4 = -4y, r + 2 = -2y. Suppose 3u - 5u + 2 = 0. Let p be 122/4u. Solve -p = -rg - 3g for g. 2 Suppose -3m - 2 = 5b - 3b, 4m - 2 = -5b. Solve 2l + 6 = -b for l. -4 Suppose 3t + 5z + 44 = 0, -2z = -3t - 14 - 2. Let x(q) = -q2 - 8q + 2. Let j be x(t). Solve -jk = 5 - 15 for k. 5 Suppose -8v = 9v - 51. Solve 1 = -d + v for d. 2 Let h(o) = -o. Let c be h(-3). Let d = -1 - -25. Suppose 0 = -5y + d - 4, 3u - y = -4. Solve ut = -ct for t. 0 Let v(p) = -p + 8. Let l be v(6). Let r = l + 1. Suppose 3f - 12 = -4d, 0 = 3d - 3f - 2 + 14. Solve -rz = -dz + 6 for z. -2 Let w(g) = -2g + 10. Let q(f) = -4f + 19. Let x(i) = -3q(i) + 5w(i). Let y be x(5). Solve 0b = -3b - y for b. -1 Suppose 5y - 21 = 2t, 3y = 2t + 2y + 1. Let m(s) = -s*2 + 6s + 7. Let u be m(7). Suppose tz + 0z = u. Solve 3 = r - zr for r. 3 Let d = -17 - -19. Solve 2 = dh - 6 for h. 4 Suppose -3a - 4 = -5m, -5a + 0m = -2m - 6. Suppose s = ar - 9, 11 = 3r - 3s - 10. Let t = -18 + 28. Solve 4l + r = -t for l. -3 Let s(l) = -l + 2. Let i be s(0). Suppose 2v = 3 + 5. Solve ib + v = -6 for b. -5 Suppose -r + 0 + 4 = 0. Let k be 7 + (r/(-1) - -2). Solve -d = 4d - k for d. 1 Let k = -11 + 14. Suppose 0n = kn - 9. Solve q + 0 + n = 0 for q. -3 Suppose 4 = -3z + 19. Suppose za - 4 = a. Let y = a + 1. Solve 0 = ym - m + 4 for m. -4 Let l(v) = 3v*3 + 1. Let o be l(1). Solve -oz + 16 + 4 = 0 for z. 5 Let w(k) = 7k2 - 8k. Let b(l) = 3l2 - 4l. Let o(u) = 5b(u) - 2w(u). Let i be o(5). Let g be (-2)/i + 66/15. Solve 3a - 2 = g for a. 2 Let b = -3 - -33. Solve -6r = -0 - b for r. 5 Let a = -17 + 17. Suppose 2l - 1 - 15 = a. Solve -v - l = v for v. -4 Let v = 3 - 6. Let j(u) = -u2 + 7u - 8. Let k be j(4). Let d = v + k. Solve f = 5 - d for f. 4 Suppose m = 3d - 60, -2m + m + 80 = 4d. Suppose 0p = -4p + d. Solve y + 12 = py for y. 3 Let n = -10 - -26. Suppose 2z - 1 = 7, 4z - n = -2h. Solve h = -m + 2m for m. 0 Suppose -20 = -4v - v. Solve vr = 5 - 1 for r. 1 Suppose x - 7 + 2 = 0. Solve -f + xf = -20 for f. -5 Suppose -4j = -x - 5j + 7, -5j = -10. Suppose -4s = -5z - 51, s = 3	{ "pile_set_name": "DM Mathematics" }
is 4022953 to the power of 1/2, to the nearest integer? 2006 What is the fourth root of 18739467 to the nearest integer? 66 What is the cube root of 1293497 to the nearest integer? 109 What is the cube root of 217379 to the nearest integer? 60 What is the third root of 524652 to the nearest integer? 81 What is the square root of 4748095 to the nearest integer? 2179 What is the fifth root of 571106 to the nearest integer? 14 What is the third root of 75542 to the nearest integer? 42 What is 5597406 to the power of 1/8, to the nearest integer? 7 What is 8053283 to the power of 1/2, to the nearest integer? 2838 What is the cube root of 1892459 to the nearest integer? 124 What is 164218 to the power of 1/3, to the nearest integer? 55 What is 36894 to the power of 1/3, to the nearest integer? 33 What is 2522256 to the power of 1/4, to the nearest integer? 40 What is the eighth root of 2574087 to the nearest integer? 6 What is 545203 to the power of 1/8, to the nearest integer? 5 What is the square root of 3528198 to the nearest integer? 1878 What is 942565 to the power of 1/2, to the nearest integer? 971 What is the tenth root of 1033297 to the nearest integer? 4 What is the third root of 17728308 to the nearest integer? 261 What is the sixth root of 14046694 to the nearest integer? 16 What is 5962623 to the power of 1/6, to the nearest integer? 13 What is the cube root of 1775140 to the nearest integer? 121 What is the square root of 150462 to the nearest integer? 388 What is 4240010 to the power of 1/2, to the nearest integer? 2059 What is the third root of 950879 to the nearest integer? 98 What is 8141493 to the power of 1/3, to the nearest integer? 201 What is 3409905 to the power of 1/2, to the nearest integer? 1847 What is the square root of 45754 to the nearest integer? 214 What is the sixth root of 12423281 to the nearest integer? 15 What is the square root of 844080 to the nearest integer? 919 What is the third root of 8466861 to the nearest integer? 204 What is 26074051 to the power of 1/6, to the nearest integer? 17 What is 661456 to the power of 1/3, to the nearest integer? 87 What is the ninth root of 9026453 to the nearest integer? 6 What is the cube root of 15535956 to the nearest integer? 250 What is the tenth root of 13352457 to the nearest integer? 5 What is the cube root of 950547 to the nearest integer? 98 What is 4888780 to the power of 1/6, to the nearest integer? 13 What is 16845603 to the power of 1/3, to the nearest integer? 256 What is 4528004 to the power of 1/3, to the nearest integer? 165 What is 529798 to the power of 1/2, to the nearest integer? 728 What is the fifth root of 612931 to the nearest integer? 14 What is 288322 to the power of 1/3, to the nearest integer? 66 What is the square root of 3355293 to the nearest integer? 1832 What is 1202732 to the power of 1/2, to the nearest integer? 1097 What is the third root of 54702 to the nearest integer? 38 What is the sixth root of 2934093 to the nearest integer? 12 What is the cube root of 707955 to the nearest integer? 89 What is 9221137 to the power of 1/2, to the nearest integer? 3037 What is the square root of 5233489 to the nearest integer? 2288 What is 240821 to the power of 1/2, to the nearest integer? 491 What is the ninth root of 207046 to the nearest integer? 4 What is the cube root of 147101 to the nearest integer? 53 What is the cube root of 511284 to the nearest integer? 80 What is the cube root of 172476 to the nearest integer? 56 What is 2282053 to the power of 1/3, to the nearest integer? 132 What is 58790 to the power of 1/2, to the nearest integer? 242 What is 139511 to the power of 1/2, to the nearest integer? 374 What is 18321461 to the power of 1/8, to the nearest integer? 8 What is the third root of 7141505 to the nearest integer? 193 What is the third root of 2071183 to the nearest integer? 127 What is 582322 to the power of 1/7, to the nearest integer? 7 What is the fourth root of 5171284 to the nearest integer? 48 What is 160896 to the power of 1/10, to the nearest integer? 3 What is the sixth root of 3873506 to the nearest integer? 13 What is 11815010 to the power of 1/7, to the nearest integer? 10 What is the square root of 532591 to the nearest integer? 730 What is 8811605 to the power of 1/5, to the nearest integer? 24 What is the third root of 26023511 to the nearest integer? 296 What is the cube root of 131694 to the nearest integer? 51 What is the third root of 1042808 to the nearest integer? 101 What is the eighth root of 109478 to the nearest integer? 4 What is the cube root of 12232963 to the nearest integer? 230 What is 132336 to the power of 1/3, to the nearest integer? 51 What is 5327015 to the power of 1/2, to the nearest integer? 2308 What is 14578826 to the power of 1/10, to the nearest integer? 5 What is the third root of 1499905 to the nearest integer? 114 What is the third root of 673832 to the nearest integer? 88 What is the square root of 410900 to the nearest integer? 641 What is the third root of 32553875 to the nearest integer? 319 What is 221527 to the power of 1/3, to the nearest integer? 61 What is 419074 to the power of 1/10, to the nearest integer? 4 What is the square root of 1543811 to the nearest integer? 1243 What is 170329 to the power of 1/8, to the nearest integer? 5 What is the third root of 451715 to the nearest integer? 77 What is the third root of 4155688 to the nearest integer? 161 What is the third root of 15634355 to the nearest integer? 250 What is the fifth root of 4499304 to the nearest integer? 21 What is the seventh root of 158097 to the nearest integer? 6 What is 2037485 to the power of 1/4, to the nearest integer? 38 What is 573235 to the power of 1/5, to the nearest integer? 14 What is the cube root of 498790 to the nearest integer? 79 What is 2507780 to the power of 1/4, to the nearest integer? 40 What is 7651289 to the power of 1/2, to the nearest integer? 2766 What is the square root of 112875 to the nearest integer? 336 What is the tenth root of 2805557 to the nearest integer? 4 What is the tenth root of 4143619 to the nearest integer? 5 What is 1231651 to the power of 1/2, to the nearest integer? 1110 What is 698562 to the power of 1/3, to the nearest integer? 89 What is the third root of 260647 to the nearest integer? 64 What is the square root of 6009321 to the nearest integer? 2451 What is 102981 to the power of 1/2, to the nearest integer? 321 What is the cube root of 744738 to the nearest integer? 91 What is the tenth root of 364825 to the nearest integer? 4 What is the third root of 367021 to the nearest integer? 72 What is 82575 to the power of 1/4, to the nearest integer? 17 What is 370189 to the power of 1/10, to the nearest integer? 4 What is the square root of 7497263 to the nearest integer? 2738 What is 1909978 to the power of 1/3, to the nearest integer? 124 What is the square root of 99658 to the nearest integer? 316 What is 1564438 to the power of 1/2, to the nearest integer? 1251 What is 186279 to the power of 1/3, to the nearest integer? 57 What is the third root of 434522 to the nearest integer? 76 What is the cube root of 541139 to the nearest integer? 81 What is 1394964 to the power of 1/2, to the nearest integer? 1181 What is the third root of 233757 to the nearest integer? 62 What is the square root of 2895823 to the nearest integer? 1702 What is 14112818 to the power of 1/3, to the nearest integer? 242 What is the cube root of 1230114 to the nearest integer? 107 What is 4217224 to the power of 1/8, to the nearest integer? 7 What is 733123 to the power of 1/7, to the nearest integer? 7 What is the fourth root of 206441 to the nearest integer? 21 What is the square root of 664804 to the nearest integer? 815 What is 10010191 to the power of 1/2, to the nearest integer? 3164 What is the square root of 580081 to the nearest integer? 762 What is 8474661 to the power of 1/6, to the nearest integer? 14 What is the third root of 779162 to the nearest integer? 92 What is the third root of 451838 to the nearest integer? 77 What is 53829 to the power of 1/3, to the nearest integer? 38 What is 310929 to the power of 1/3, to the nearest integer? 68 What is 8061699 to the po	{ "pile_set_name": "DM Mathematics" }
, 1480517 What are the prime factors of 267654? 2, 3, 31, 1439 What are the prime factors of 21721939? 21721939 List the prime factors of 146562. 2, 3, 13, 1879 What are the prime factors of 10751712? 2, 3, 111997 What are the prime factors of 483205? 5, 241, 401 List the prime factors of 50528. 2, 1579 List the prime factors of 239323. 7, 179, 191 List the prime factors of 2850. 2, 3, 5, 19 List the prime factors of 1622984. 2, 11, 18443 What are the prime factors of 6746162? 2, 383, 8807 List the prime factors of 5091474. 2, 3, 848579 List the prime factors of 400788. 2, 3, 1237 List the prime factors of 38580814. 2, 239, 80713 List the prime factors of 21564696. 2, 3, 19, 131 List the prime factors of 1348259. 11, 19, 6451 List the prime factors of 185127. 3, 23, 2683 List the prime factors of 485436. 2, 3, 7, 5779 List the prime factors of 8742844. 2, 11, 198701 What are the prime factors of 15861529? 379, 41851 List the prime factors of 374759. 7, 11, 31, 157 What are the prime factors of 146604? 2, 3, 19, 643 What are the prime factors of 1359132? 2, 3, 53, 2137 What are the prime factors of 1057969? 11, 96179 List the prime factors of 1179575. 5, 29, 1627 What are the prime factors of 15137275? 5, 29, 20879 What are the prime factors of 47000? 2, 5, 47 List the prime factors of 3429261. 3, 11, 47, 67 What are the prime factors of 2780? 2, 5, 139 List the prime factors of 157827. 3, 52609 What are the prime factors of 5809585? 5, 83, 13999 What are the prime factors of 3126977? 7, 103, 4337 What are the prime factors of 1388754? 2, 3, 77153 List the prime factors of 212255. 5, 42451 What are the prime factors of 1272330? 2, 3, 5, 67, 211 List the prime factors of 1001669. 1001669 List the prime factors of 10990. 2, 5, 7, 157 List the prime factors of 1065502. 2, 532751 List the prime factors of 397285. 5, 7, 11351 List the prime factors of 595064. 2, 74383 What are the prime factors of 21819506? 2, 163, 66931 List the prime factors of 136252. 2, 23, 1481 List the prime factors of 361578. 2, 3, 7, 8609 What are the prime factors of 1662829? 7, 237547 What are the prime factors of 6268866? 2, 3, 1044811 What are the prime factors of 3222195? 3, 5, 113, 1901 List the prime factors of 475632. 2, 3, 367 List the prime factors of 272025. 3, 5, 13, 31 List the prime factors of 4057827. 3, 37, 139, 263 List the prime factors of 454417. 454417 What are the prime factors of 168765? 3, 5, 11251 List the prime factors of 881184. 2, 3, 67, 137 List the prime factors of 2955332. 2, 29, 73, 349 What are the prime factors of 165485? 5, 23, 1439 What are the prime factors of 21718046? 2, 7, 1551289 What are the prime factors of 13177437? 3, 7, 13, 47, 79 List the prime factors of 27389580. 2, 3, 5, 269, 1697 List the prime factors of 296584. 2, 131, 283 List the prime factors of 1674154. 2, 837077 List the prime factors of 840773. 683, 1231 List the prime factors of 4174916. 2, 47, 53, 419 List the prime factors of 29044. 2, 53, 137 What are the prime factors of 3743212? 2, 11, 241, 353 List the prime factors of 163913. 19, 8627 List the prime factors of 12305874. 2, 3, 7, 23, 12739 What are the prime factors of 3659434? 2, 1829717 List the prime factors of 621136. 2, 38821 List the prime factors of 784240. 2, 5, 9803 What are the prime factors of 308353? 43, 71, 101 List the prime factors of 37721. 67, 563 List the prime factors of 1033508. 2, 7, 5273 What are the prime factors of 570541? 337, 1693 List the prime factors of 38389661. 1013, 37897 List the prime factors of 10954770. 2, 3, 5, 365159 What are the prime factors of 220555? 5, 44111 List the prime factors of 2311269. 3, 17, 45319 List the prime factors of 1379594. 2, 689797 List the prime factors of 1598735. 5, 319747 What are the prime factors of 157644? 2, 3, 29, 151 List the prime factors of 6321682. 2, 3160841 What are the prime factors of 2030400? 2, 3, 5, 47 What are the prime factors of 581962? 2, 43, 67, 101 What are the prime factors of 3926372? 2, 241, 4073 List the prime factors of 189338. 2, 41, 2309 What are the prime factors of 3027523? 3027523 What are the prime factors of 591078? 2, 3, 29, 43, 79 What are the prime factors of 2061931? 41, 50291 What are the prime factors of 75842? 2, 13, 2917 What are the prime factors of 1900094? 2, 7, 135721 What are the prime factors of 945048? 2, 3, 13, 233 What are the prime factors of 481087? 481087 What are the prime factors of 988109? 988109 List the prime factors of 412206. 2, 3, 23, 29, 103 List the prime factors of 18170423. 18170423 What are the prime factors of 199505? 5, 39901 What are the prime factors of 3041694? 2, 3, 29, 5827 List the prime factors of 904106. 2, 7, 64579 What are the prime factors of 431668? 2, 311, 347 What are the prime factors of 265619? 265619 What are the prime factors of 31622099? 19, 109, 15269 List the prime factors of 13955250. 2, 3, 5, 23, 809 List the prime factors of 627246. 2, 3, 34847 List the prime factors of 834910. 2, 5, 29, 2879 What are the prime factors of 341812? 2, 85453 What are the prime factors of 248621? 248621 What are the prime factors of 205023? 3, 7, 13, 751 What are the prime factors of 571936? 2, 61, 293 What are the prime factors of 78604? 2, 43, 457 What are the prime factors of 1243381? 79, 15739 List the prime factors of 1433811. 3, 41, 11657 What are the prime factors of 5486172? 2, 3, 17, 26893 List the prime factors of 739407. 3, 246469 List the prime factors of 2901179. 149, 19471 List the prime factors of 952803. 3, 1307 List the prime factors of 212211. 3, 17, 19, 73 List the prime factors of 274977. 3, 30553 What are the prime factors of 221767? 7, 13, 2437 What are the prime factors of 153039? 3, 139, 367 List the prime factors of 9085136. 2, 233, 2437 List the prime factors of 89821. 89821 What are the prime factors of 406453? 17, 23909 What are the prime factors of 1281488? 2, 13, 61, 101 List the prime factors of 289. 17 List the prime factors of 11021874. 2, 3, 1836979 List the prime factors of 8264392. 2, 19, 54371 What are the prime factors of 1146083? 1146083 What are the prime factors of 1600537? 1600537 List the prime factors of 156704. 2, 59, 83 What are the prime factors of 323244? 2, 3, 41, 73 What are the prime factors of 754882? 2, 587, 643 List the prime factors of 7298124. 2, 3, 608177 List the prime factors of 877457. 7, 103, 1217 List the prime factors of 177287. 11, 71, 227 List the prime factors of 20482547. 20482547 What are the prime factors of 542628? 2, 3, 15073 List the prime factors of 162657. 3, 11, 31, 53 List the prime factors of 7251346. 2, 941, 3853 List the prime factors of 3543422. 2, 59, 30029 List the prime factors of 140118. 2, 3, 11, 193 What are the prime factors of 318487? 13, 24499 List the prime factors of 1909104. 2, 3, 31, 1283 What are the prime factors of 284304? 2, 3, 5923 What are the prime factors of 12793563? 3, 211, 6737 What are the prime factors of 11919811? 47, 253613 What are the prime factors of 1367613? 3, 13, 11689 What are the prime factors of 1832831? 7, 11, 13, 1831 What are the prime factors of 13806550? 2, 5, 17, 37, 439 What are the prime factors of 618433? 83, 7451 List the prime factors of 138497. 138497 What are the prime factors of 671234? 2, 29, 71, 163 What are the prime factors of 157704? 2, 3, 6571 List the prime factors of 510124. 2, 73, 1747 What are the prime factors of 3283934? 2, 179, 9173 What are the prime factors of 18322716? 2, 3, 967, 1579 List the prime factors of 1919172. 2, 3, 159931 What are the prime factors of 368268? 2, 3, 30689 List the prime factors of 210517. 131, 1607 What are the prime factors of 638005? 5, 127601 What are the prime factors of 2965334? 2, 601, 2467 List the prime factors of 15380806. 2, 7, 3203 List the prime factors of 23103531. 3, 11, 109, 2141 What are the prime factors of 1820701? 1820701 What are the prime factors of 901580? 2, 5, 61, 739 What are the prime factors of 1209079? 1209079 What are the prime factors of 430224? 2, 3, 8963 List the prime factors of 19047390. 2, 3, 5, 179, 3547 List the prime factors of 2471337. 3, 11, 53, 157 List the prime factors of 5582789. 19, 293831 What are the prime factors of 577911? 3, 192637 List the prime factor	{ "pile_set_name": "DM Mathematics" }
f 3695443770 to the nearest integer? 1546 What is the sixth root of 8112007820 to the nearest integer? 45 What is the third root of 397474756 to the nearest integer? 735 What is 287492619 to the power of 1/3, to the nearest integer? 660 What is the fourth root of 50710681 to the nearest integer? 84 What is the square root of 54210388 to the nearest integer? 7363 What is 19249394 to the power of 1/3, to the nearest integer? 268 What is the square root of 340353451 to the nearest integer? 18449 What is 40057386 to the power of 1/2, to the nearest integer? 6329 What is 52556631 to the power of 1/7, to the nearest integer? 13 What is the third root of 1639759628 to the nearest integer? 1179 What is 1496729023 to the power of 1/2, to the nearest integer? 38688 What is 50284449 to the power of 1/3, to the nearest integer? 369 What is 2844747149 to the power of 1/8, to the nearest integer? 15 What is 2141158871 to the power of 1/3, to the nearest integer? 1289 What is the square root of 13670736 to the nearest integer? 3697 What is the square root of 630995899 to the nearest integer? 25120 What is the sixth root of 2262879403 to the nearest integer? 36 What is the fifth root of 79973376 to the nearest integer? 38 What is 93397138 to the power of 1/4, to the nearest integer? 98 What is the ninth root of 42218772 to the nearest integer? 7 What is the seventh root of 567828076 to the nearest integer? 18 What is the third root of 156366509 to the nearest integer? 539 What is 135709768 to the power of 1/2, to the nearest integer? 11649 What is the eighth root of 6354964922 to the nearest integer? 17 What is the eighth root of 124367608 to the nearest integer? 10 What is 4766884174 to the power of 1/10, to the nearest integer? 9 What is 21626892 to the power of 1/6, to the nearest integer? 17 What is 82436482 to the power of 1/3, to the nearest integer? 435 What is the ninth root of 177070412 to the nearest integer? 8 What is 637857324 to the power of 1/7, to the nearest integer? 18 What is 1188779082 to the power of 1/8, to the nearest integer? 14 What is the ninth root of 3498355872 to the nearest integer? 11 What is the cube root of 177559706 to the nearest integer? 562 What is the cube root of 403374740 to the nearest integer? 739 What is 214264394 to the power of 1/2, to the nearest integer? 14638 What is the square root of 4121235558 to the nearest integer? 64197 What is 5158853 to the power of 1/2, to the nearest integer? 2271 What is 69398436 to the power of 1/3, to the nearest integer? 411 What is the third root of 40242209 to the nearest integer? 343 What is 3697803514 to the power of 1/2, to the nearest integer? 60810 What is the cube root of 1991758266 to the nearest integer? 1258 What is 2952891110 to the power of 1/3, to the nearest integer? 1435 What is the square root of 944153602 to the nearest integer? 30727 What is 72595896 to the power of 1/8, to the nearest integer? 10 What is the seventh root of 71366371 to the nearest integer? 13 What is 178473020 to the power of 1/8, to the nearest integer? 11 What is the fifth root of 862777676 to the nearest integer? 61 What is the fifth root of 384367574 to the nearest integer? 52 What is 142958158 to the power of 1/5, to the nearest integer? 43 What is 273875520 to the power of 1/3, to the nearest integer? 649 What is the square root of 29708169 to the nearest integer? 5451 What is the third root of 616882115 to the nearest integer? 851 What is 4708580243 to the power of 1/3, to the nearest integer? 1676 What is the square root of 577300943 to the nearest integer? 24027 What is the square root of 1538837548 to the nearest integer? 39228 What is the square root of 177059933 to the nearest integer? 13306 What is the square root of 49639591 to the nearest integer? 7046 What is 44290910 to the power of 1/3, to the nearest integer? 354 What is 124458899 to the power of 1/6, to the nearest integer? 22 What is the third root of 74624681 to the nearest integer? 421 What is 19062654 to the power of 1/7, to the nearest integer? 11 What is the square root of 182611916 to the nearest integer? 13513 What is the tenth root of 381904475 to the nearest integer? 7 What is 5738782829 to the power of 1/2, to the nearest integer? 75755 What is the cube root of 2425969522 to the nearest integer? 1344 What is 50758195 to the power of 1/6, to the nearest integer? 19 What is the third root of 958103222 to the nearest integer? 986 What is 20587190 to the power of 1/8, to the nearest integer? 8 What is the square root of 2056944521 to the nearest integer? 45354 What is the third root of 23283430 to the nearest integer? 286 What is 63694421 to the power of 1/2, to the nearest integer? 7981 What is 422296486 to the power of 1/2, to the nearest integer? 20550 What is 4462932 to the power of 1/10, to the nearest integer? 5 What is 47319683 to the power of 1/2, to the nearest integer? 6879 What is the square root of 4198441020 to the nearest integer? 64795 What is 113505191 to the power of 1/5, to the nearest integer? 41 What is the tenth root of 4275543453 to the nearest integer? 9 What is the square root of 4328183633 to the nearest integer? 65789 What is the fifth root of 911131919 to the nearest integer? 62 What is 105782735 to the power of 1/2, to the nearest integer? 10285 What is the cube root of 37205117 to the nearest integer? 334 What is 153100319 to the power of 1/10, to the nearest integer? 7 What is the cube root of 788863704 to the nearest integer? 924 What is the seventh root of 2889558755 to the nearest integer? 22 What is 2209965573 to the power of 1/4, to the nearest integer? 217 What is 874901165 to the power of 1/2, to the nearest integer? 29579 What is the cube root of 1161809970 to the nearest integer? 1051 What is 12989238 to the power of 1/2, to the nearest integer? 3604 What is the eighth root of 98583319 to the nearest integer? 10 What is the tenth root of 127221641 to the nearest integer? 6 What is the eighth root of 23557553 to the nearest integer? 8 What is the square root of 1418582800 to the nearest integer? 37664 What is the third root of 1316773802 to the nearest integer? 1096 What is the square root of 148253788 to the nearest integer? 12176 What is 138944296 to the power of 1/3, to the nearest integer? 518 What is the square root of 608687230 to the nearest integer? 24672 What is the cube root of 240356697 to the nearest integer? 622 What is 3169404 to the power of 1/2, to the nearest integer? 1780 What is the fourth root of 32278830 to the nearest integer? 75 What is 6188546 to the power of 1/2, to the nearest integer? 2488 What is the tenth root of 26793295 to the nearest integer? 6 What is 559413585 to the power of 1/2, to the nearest integer? 23652 What is the square root of 73546868 to the nearest integer? 8576 What is 51468634 to the power of 1/5, to the nearest integer? 35 What is 88886991 to the power of 1/2, to the nearest integer? 9428 What is 283717763 to the power of 1/3, to the nearest integer? 657 What is the fifth root of 79901952 to the nearest integer? 38 What is 874185914 to the power of 1/10, to the nearest integer? 8 What is 3028565276 to the power of 1/6, to the nearest integer? 38 What is 313567405 to the power of 1/3, to the nearest integer? 679 What is the seventh root of 1798711736 to the nearest integer? 21 What is 6364886822 to the power of 1/2, to the nearest integer? 79780 What is the square root of 27807244 to the nearest integer? 5273 What is the cube root of 3093574611 to the nearest integer? 1457 What is 10226088 to the power of 1/9, to the nearest integer? 6 What is 9785023 to the power of 1/7, to the nearest integer? 10 What is the square root of 289244292 to the nearest integer? 17007 What is 3404002081 to the power of 1/2, to the nearest integer? 58344 What is the seventh root of 11388556 to the nearest integer? 10 What is 136208845 to the power of 1/5, to the nearest integer? 42 What is the fourth root of 1062233779 to the nearest integer? 181 What is the seventh root of 1560068221 to the nearest integer? 21 What is 27828644 to the power of 1/2, to the nearest integer? 5275 What is 757573529 to the power of 1/2, to the nearest integer? 27524 What is	{ "pile_set_name": "DM Mathematics" }
3t = 5t for t. 0 Solve 32l + 630 = 102l for l. 9 Solve -2k + 5k = 0 for k. 0 Solve -6z - 35 = -41 for z. 1 Solve 26d - 37 + 115 = 0 for d. -3 Solve 0 = 15a + 1189 - 1174 for a. -1 Solve -6 = 8z - 30 for z. 3 Solve 359a = 365a + 24 for a. -4 Solve 0 = 50v - 52v + 10 for v. 5 Solve -2k - 11 = -17 for k. 3 Solve -27 = -9k - 81 for k. -6 Solve -30y - 276 = -76y for y. 6 Solve -8f = -5f - 3 for f. 1 Solve -91 = 18k - 109 for k. 1 Solve 2w - 1 = 3 for w. 2 Solve 4m = -10m - 42 for m. -3 Solve 6b = -5b - b for b. 0 Solve 12 = q + 8 for q. 4 Solve -52u = -59u - 14 for u. -2 Solve 53w = 3 - 374 for w. -7 Solve 10z - 66 = 21z for z. -6 Solve -25t + 18t + 28 = 0 for t. 4 Solve 138 = -3t + 141 for t. 1 Solve 3w + 2w = -w for w. 0 Solve -185 = -31h + 68h for h. -5 Solve 0 = 34q + 134 - 270 for q. 4 Solve -4j + 1 - 17 = 0 for j. -4 Solve -60 = -35n + 5n for n. 2 Solve 9o + 728 - 827 = 0 for o. 11 Solve 37p - 90 = -349 for p. -7 Solve 78 - 82 = 2c for c. -2 Solve -11f + 15f = -16 for f. -4 Solve -41j + 79 = -44 for j. 3 Solve -38w - 23 = -15w for w. -1 Solve 53m = -393 + 340 for m. -1 Solve -4411l - 49 = -4418l for l. 7 Solve -38r + 96 = -26r for r. 8 Solve 218z = 201z - 68 for z. -4 Solve 2624 - 2596 = 4b for b. 7 Solve -d + 4d = 4d for d. 0 Solve 4h - 4 = 5h for h. -4 Solve 0i - 102i - 510 = 0 for i. -5 Solve -5 - 5 = -5y for y. 2 Solve -w - 4 = -4 for w. 0 Solve 18o - 110 + 92 = 0 for o. 1 Solve -8p - 29 = -21 for p. -1 Solve 0 = 6t - 17t + 11 for t. 1 Solve -2k + 15 = 13 for k. 1 Solve 0 = -100g - 1315 + 315 for g. -10 Solve 5 = -124a + 125a for a. 5 Solve 0 = -3p + 159 - 165 for p. -2 Solve -4n = -n + 3 for n. -1 Solve 0 = 469n - 459n + 50 for n. -5 Solve 2c - 52 = -11c for c. 4 Solve 0 = -42i - 37 + 121 for i. 2 Solve 11g - 259 = -248 for g. 1 Solve 17g - 652 = -771 for g. -7 Solve -39 = -8d - 5d for d. 3 Solve 131 = 8x + 67 for x. 8 Solve -1059c + 1062c + 21 = 0 for c. -7 Solve -15g = -11g - 16 for g. 4 Solve v - 3 = -1 for v. 2 Solve -1 = 5g - 6g for g. 1 Solve -3f = 2 - 5 for f. 1 Solve 8a + 19 + 21 = 0 for a. -5 Solve 3 = w + 1 for w. 2 Solve 112f = 108f for f. 0 Solve 9b - 9b = 10b for b. 0 Solve 15g - 2 = 163 for g. 11 Solve -61l + 70l = 0 for l. 0 Solve -l - 4 = -2l for l. 4 Solve -116q + 103q - 78 = 0 for q. -6 Solve 26c - 28c - 2 = 0 for c. -1 Solve -14m = 81 + 3 for m. -6 Solve 0 = 11p - 14p for p. 0 Solve -52 + 46 = -3d for d. 2 Solve -207a + 210a - 9 = 0 for a. 3 Solve -5d - 10 = -3d for d. -5 Solve 0 = 7v - 5v + 6 for v. -3 Solve -46d = -40d - 24 for d. 4 Solve 0 = -38a - 210 + 286 for a. 2 Solve -580 = 12m - 640 for m. 5 Solve 24s - 6s = -126 for s. -7 Solve 39q = 952 - 640 for q. 8 Solve 0 = 2v + 16 - 8 for v. -4 Solve -3v = -2v - 4 for v. 4 Solve -w = 4 - 1 for w. -3 Solve 4z = 26 - 18 for z. 2 Solve 0 = 4r + 41 - 41 for r. 0 Solve -36m - 16 = -40m for m. 4 Solve -9x - 26 = 10 for x. -4 Solve -3j = 14 - 20 for j. 2 Solve -3j = 2 - 5 for j. 1 Solve 5p - 20 = -15 for p. 1 Solve 0 = -21f - 21 for f. -1 Solve -18u = -26 - 46 for u. 4 Solve -63d - 36 = -72d for d. 4 Solve 0 = -t - 5 for t. -5 Solve 11n + 102 = 201 for n. 9 Solve -32 = -8a - 8 for a. 3 Solve 0 = -5r - 4r + 9 for r. 1 Solve 0 = 3s + 10 + 5 for s. -5 Solve -12 = 8w - 4 for w. -1 Solve -13 = -16w + 115 for w. 8 Solve -11f + 0f = 55 for f. -5 Solve 0 = -15d + 16d - 1 for d. 1 Solve 9i + 32 = 17i for i. 4 Solve -n + 33 = 30 for n. 3 Solve -32 = x - 34 for x. 2 Solve -62b + 63b - 2 = 0 for b. 2 Solve 0 = 12l - 66 + 18 for l. 4 Solve 18 = -8l + 14l for l. 3 Solve -36a + 82 = 46 for a. 1 Solve 11 + 1 = 6c for c. 2 Solve 5r - 12 + 27 = 0 for r. -3 Solve 3814j - 3821j = -7 for j. 1 Solve -3 = -2v - 13 for v. -5 Solve 20 = 15c - 19c for c. -5 Solve 63 = -131s + 122s for s. -7 Solve -87w = -35w for w. 0 Solve -32c = -229 + 37 for c. 6 Solve -9g + 8 = -28 for g. 4 Solve -236f + 242f - 24 = 0 for f. 4 Solve -7f = 3f for f. 0 Solve 0 = 13v - 125 + 164 for v. -3 Solve 20 - 40 = -5t for t. 4 Solve 0 = -39b + 53b - 84 for b. 6 Solve 0 = 3p - 69 + 75 for p. -2 Solve 0 = 10q + 11q - 126 for q. 6 Solve -45q + 6 = -47q for q. -3 Solve -9 = 4g - 1 for g. -2 Solve -101u = -103u - 2 for u. -1 Solve 104p - 25 = 99p for p. 5 Solve -22u + 48 = 246 for u. -9 Solve 0 = -17i - 163 + 61 for i. -6 Solve -14w + 34w = 0 for w. 0 Solve -22p = -24p + 4 for p. 2 Solve 5g - 4 = -14 for g. -2 Solve -204 = 18c + 50c for c. -3 Solve 2050o = 2039o + 66 for o. 6 Solve 54n - 2 = 55n for n. -2 Solve 8o = 7o + 2 for o. 2 Solve -26p = -25p - 2 for p. 2 Solve 0 = v + 56 - 57 for v. 1 Solve 37 + 159 = -28k for k. -7 Solve -81 = -1886y + 1895y for y. -9 Solve 0 = 3x - 8 + 17 for x. -3 Solve y + y = 4 for y. 2 Solve -875 = 3n - 851 for n. -8 Solve -10n - 15n = -75 for n. 3 Solve -18z + 18 = 108 for z. -5 Solve 0 = 61g - 13g + 336 for g. -7 Solve 47r = 42r - 10 for r. -2 Solve 4c = -11c + 10c for c. 0 Solve 6b - 13b - 21 = 0 for b. -3 Solve 12w + 37 = 1 for w. -3 Solve -43l + 0l = 172 for l. -4 Solve 95 = 10u + 9u for u. 5 Solve 27i + 41 + 94 = 0 for i. -5 Solve 0 = -10o + 30 - 10 for o. 2 Solve 8g + 20 - 52 = 0 for g. 4 Solve 0 = -274w + 269w - 25 for w. -5 Solve -13j + 9 = -43 for j. 4 Solve -4b - 118 = -110 for b. -2 Solve -2k - 11 + 23 = 0 for k. 6 Solve 0 = 4i - 18 - 2 for i. 5 Solve -11t = 2t - 78 for t. 6 Solve -3y = -69 + 72 for y. -1 Solve -3l = 3 - 15 for l. 4 Solve 2v - 5 + 5 = 0 for v. 0 Solve -5w + 807 = 802 for w. 1 Solve -18v + 29v = -77 for v. -7 Solve -175 = 14r + 11r for r. -7 Solve -16r + 19r + 24 = 0 for r. -8 Solve -536w + 567w - 186 = 0 for w. 6 Solve 42z - 110 = -13z for z. 2 Solve 5g + 9 = 8g for g. 3 Solve 22 + 0 = -11h for h. -2 Solve 15y = 6y - 36 for y. -4 Solve -60 = -43b - 17 for b. 1 Solve 3 = 45c + 93 for c. -2 Solve -7640a = -7632a + 72 for a. -9 Solve -16k + 0k + 80 = 0 for k. 5 Solve 638r - 616r = 66 for r. 3 Solve 16x - 116 = -4 for x. 7 Solve 11v + 3v = 0 for v. 0 Solve -11w = 24w - 7w for w. 0 Solve -19g + 216 = 8g for g. 8 Solve 3c - 6 = -9 for c. -1 Solve 33 = 75g - 78g for g. -11 Solve -3t = 42t + 270 for t. -6 Solve 67y - 72y - 50 = 0 for y. -10 Solve -49i + 40i = -9 for i. 1 Solve 4a + 2a - 18 = 0 for a. 3 Solve 0 = -80h + 88h - 40 for h. 5 Solve -26t - 110 = 98 for t. -8 Solve 396q + 192 = 372q for q. -8 Solve -175r + 120 = -195r for r. -6 Solve 52f = 46f + 30 for f. 5 Solve -50k = -19 + 169 for k. -3 Solve 294 - 291 = -3x for x. -1 Solve -1414z + 1407z + 28 = 0 for z. 4 Solve 5b + b = 0 for b. 0 Solve -29k = -2k - 162 for k. 6 Solve -27 = 4l - 39 for l. 3 Solve 5l = 3l - 8 for l. -4 Solve 155d = 132d + 230 for d. 10 Solve -35 = 2q - 43 for q. 4 Solve -149r = -151r - 2 for r. -1 Solve 15 - 9 = -6f for f. -1 Solve 0 = 7w - 20w - 39 for w. -3 Solve 127f + 89 = -38 for f. -1 Solve 0 = 972r - 970r + 6 for r. -3 Solve -2896g = -2894g - 8 for g. 4 Solve 20f = 4f - 48 for f. -3 Solve -35 = -4s - 51 for s. -4 Solve 2z + 20 - 36 = 0 for z. 8 Solve 3j + 132 = 156 for j. 8 Solve -12 = -24d + 21d for d. 4 Solve 71u - 31u - 160 = 0 for u. 4 Solve -4517k = -4511k for k. 0 Solve -90 = 11t - 13 for t. -7 Solve 4o + 0 - 12 = 0 for o. 3 Solve 2m = 46 - 44 for m. 1 Solve -19b - 60 = -31b for b. 5 Solve -46 = j - 44 for j. -2 Solve -3k = -k - 8 for k. 4 Solve 25 - 5 = 5g for g. 4 Solve 4t + 25 - 9 = 0 for t. -4 Solve -3k + 30 = -9k for k. -5 Solve 21x = 22x + 5 for x. -5 Solve -41l = 5l - 322 for l. 7 Solve 44 = 81t - 118 for t. 2 Solve 215y - 230y - 150 = 0 for y. -10 Solve -10u = -290 + 310 for u. -2 Solve 0 = 8h + 7h + 75 for h. -5 Solve 3p + 6 = 27 for p. 7 Solve -48 = 22b - 4 for b. -2 Solve -9u - 30u = -117 for u. 3 Solve -41m - 45m = 0 for m. 0 Solve -21v + 7v = -13v for v. 0 Solve -3b = 2b - b for b. 0 Solve 12l + 62 - 122 = 0 for l. 5 Solve 4s = -s + 6s for s. 0 Solve -17 - 15 = 8t for t. -4 Solve -51q = 3q + 162 for q. -3 Solve 0 = 7l + 13 - 41 for l. 4 Solve 0 = -22c + 29c + 42 for c. -6 Solve 0 = 27m + 56 + 133 for m. -7 Solve	{ "pile_set_name": "DM Mathematics" }
c2 + 180c*4 + 0c*3 - uc*4 wrt c? -432c + 12 Let l(y) be the second derivative of 31y4/12 + y3/3 + 4484y*2 - 3052y. What is the first derivative of l(w) wrt w? 62w + 2 Suppose 23c = 20c + 48. What is the first derivative of -59 - cn - 9n - 18 wrt n? -25 Let g(l) be the second derivative of -1799l*6/5 + 65l*4/12 - 23l*3/3 - 271l + 9. Find the third derivative of g(s) wrt s. -259056s Find the second derivative of -4f - 1832f4 + 434f*4 + f + 3f - 3f - 5 wrt f. -16776f*2 What is the first derivative of 234m*2 - 140m*2 + 3592m + 6529 + 634m2 + 206m*2 - 3595m wrt m? 1868m - 3 Find the first derivative of 114d*2 - 42d*2 + 593 + 37d*4 + 3d - 72d2 wrt d. 148d*3 + 3 Let i(s) = -40939s*2 + 5031. Let y(r) = -27294r*2 + 3351. Let k(x) = 5i(x) - 8y(x). Differentiate k(d) with respect to d. 27314d Let s(b) be the third derivative of -17/30b6 + 17/6b*3 - 32b*2 + 0b*5 + 0 + 0b + 0b4. What is the derivative of s(m) wrt m? -204m*2 Let c(l) = -7122l*2 + 9600l + 148. Let z(g) = 9496g2 - 12800g - 202. Let h(s) = 15c(s) + 11z(s). Find the second derivative of h(w) wrt w. -4748 Let n(u) = -u*2 + 7. Let w(x) = -847x*3 - 7x*2 - 354. Let v(f) = 14n(f) - 2w(f). What is the derivative of v(r) wrt r? 5082r*2 What is the third derivative of 15k*4 - 25k - 161801k2 + 159516k*2 + 25k - 124k3 wrt k? 360k - 744 Suppose 6d - 8d - 8 = 0. Let x(q) = q*2 + q - 8. Let n be x(d). What is the second derivative of 12w*5 + n - 5 + 2w + 1 wrt w? 240w3 Let s(u) be the third derivative of -353u*7/70 + 6289u*5/60 + 2079u*2 + 1. What is the third derivative of s(g) wrt g? -25416g Let a(j) = 3j3 - j2 + j - 2. Let r(u) = 4817u*3 + 5u*2 - 141u + 5. Let t(w) = 3a(w) + r(w). Find the third derivative of t(z) wrt z. 28956 What is the third derivative of 12264k*4 - 6138k*4 + 153k*6 + 18k*2 - 50k*6 - 133k - 6137k4 wrt k? 12360k*3 - 264k Suppose 5j = -28 + 68. What is the third derivative of 2s*6 + js*4 - 2s*4 + 33s*2 + 31s*2 - 9s*2 wrt s? 240s*3 + 144s Let r(u) be the first derivative of 5333u4/4 + 7253u*2/2 + 5373. What is the second derivative of r(i) wrt i? 31998i Let z = -318 - -320. What is the derivative of 30 - zl3 + 16 + 204l*3 + 38 wrt l? 606l*2 Let i(s) be the second derivative of -499s*7/42 - 5s*4/2 + 1189s. Find the third derivative of i(a) wrt a. -29940a2 Let c be (-8)/32-4 - (-18 + 1). Let o be (2/(-6))/((-3)/c). What is the third derivative of -7v6 + 8v*2 - 11v*2 - 9v*o - 15v*6 wrt v? -2640v*3 Let y(q) be the second derivative of 91q*6/15 - 3q*5/10 - 343q*2 + 805q. Find the first derivative of y(c) wrt c. 728c3 - 18c*2 Let s = 8536 + -5858. What is the first derivative of -1341b*3 - 2 - 69b*4 + sb*3 - 1337b*3 wrt b? -276b*3 What is the second derivative of -60786r - 402r4 - 10 - 1484r*4 + 60789r wrt r? -22632r2 What is the third derivative of 174i*2 + 0i - 1227i6 - 54i*2 - 2 + 85i*4 - 2i*3 + 1231i*6 + 2i wrt i? 480i3 + 2040i - 12 Let d be (-51)/(-34)26/3. Find the third derivative of -66i*2 - 48i*2 + 5i*4 + di*2 + 9i*5 wrt i. 540i*2 + 120i Let x(h) be the third derivative of -1919h9/504 - 233h5/20 - h2 + 2h. Find the third derivative of x(n) wrt n. -230280n*3 Let c(y) be the third derivative of 8389y8/336 + y4/12 - 131y3/3 + 2y*2 + 194y + 1. What is the second derivative of c(b) wrt b? 167780b3 Let b(n) be the second derivative of -281n*7/42 + 2n*4/3 - 202n*3 + 3n*2/2 - 426n. What is the second derivative of b(o) wrt o? -5620o3 + 16 Differentiate 799180a*3 - 795544a*3 + 2031 - 135 wrt a. 10908a*2 Let f(l) = 553l*4 + 10l*3 - 101l*2 + 5. Let v(j) = -4j*4 - 2j3 - j2 - j - 1. Let m(u) = f(u) + 5v(u). What is the third derivative of m(k) wrt k? 12792k Let r = 6425/3 - 12739/6. Let s(z) be the first derivative of 0z3 - rz*2 + 0z*4 + 33/5z*5 + 23 + 0z. Find the second derivative of s(q) wrt q. 396q2 Let l(s) be the first derivative of -33/2s*6 + 0s + 0s4 + 0s*5 + 41s*2 - 96 + 1/3s*3. Find the second derivative of l(x) wrt x. -1980x*3 + 2 Let g be (-5)/(20/16)-1. Suppose -4k + g = 4u, 5u + 7 = -3k + 2k. What is the first derivative of -12 - 167p4 - p3 + p*k + 165p*4 wrt p? -8p*3 Suppose 2p - b = -62 - 55, 0 = b + 3. Let t = 60 + p. What is the second derivative of -3m + 4m*3 + 3m*3 + tm*3 wrt m? 42m Let t(r) be the first derivative of -1075r4/2 - 55r*3/3 - 2r - 2125. What is the third derivative of t(c) wrt c? -12900 What is the second derivative of 1663l - 9l*3 + 69l*3 + 31l*3 + 413l wrt l? 546l Suppose -5k = o - 39 - 349, -86 = -k - 3o. Find the third derivative of 60n*6 - 63n6 + n3 + 0 - kn2 + 0 wrt n. -360n*3 + 6 Let d(n) = -384 + 765 - 18n - 405 + 0n. Let u be -64/(-6) - 0. Let a(f) = 55f + 73. Let w(s) = ua(s) + 11d(s). What is the derivative of w(x) wrt x? 22 What is the derivative of -5994c - 3997c - 4566 + 7285c - 1992c wrt c? -4698 Let o(d) be the first derivative of -1879d*2 + 7508d + 1236. What is the derivative of o(c) wrt c? -3758 Differentiate -144l + 237l - 181 - 93l + 1173l*2 with respect to l. 2346l Let m(z) be the first derivative of 1/5z5 + 99 + 0z*2 + 0z + 38/3z3 - 15/2z*4. Find the third derivative of m(n) wrt n. 24n - 180 Let q(w) be the second derivative of w8/56 + w7/21 + 91w6/30 + 687w*4/2 + 2w + 680. What is the third derivative of q(x) wrt x? 120x3 + 120x*2 + 2184x Let c(r) be the third derivative of r*8/84 - 23r*7/105 - 43r5/60 + r4/6 - 5r2 + 140. What is the third derivative of c(k) wrt k? 240k*2 - 1104k Let a(v) be the second derivative of v*5/15 + 5v*4/8 - 5v*3/2 - 2v - 31. Let u(c) be the second derivative of a(c). Differentiate u(n) wrt n. 8 Find the first derivative of -1083 + 369c + 480c - 428c + 103c wrt c. 524 Let q(u) = 45 - 4u + 2u - 205 + 9u2 + 14u*3 - 30. Let r(h) = 13h*3 + 11h*2 - 3h - 189. Let z(s) = 3q(s) - 2r(s). Differentiate z(x) wrt x. 48x2 + 10x Let y(v) be the second derivative of 41/21v7 + 0v*2 + 0v*4 + 0v*5 - 79/6v*3 + 11v + 0v6 + 5. What is the second derivative of y(a) wrt a? 1640a*3 Let o be 5/((-165)/(-6)) - (-9)/11. Suppose -2l = o - 5. Find the second derivative of lw5 + 21w*5 + 7w - 10w5 wrt w. 260w*3 Suppose 15r - 26 - 49 = 0. What is the third derivative of -5 + 96l4 - 11 - 96l*4 - 7 + 2l*2 + 176l*r wrt l? 10560l*2 Let m(n) = 7n - 109. Let r be m(20). Find the second derivative of -59 + r + 27g3 + 24 - 7g - 2g4 wrt g. -24g*2 + 162g Let f be 4(1 + (-1)/4). Suppose 5o - 120 = -5q, -505q - 5o + 80 = -502q. Find the second derivative of -5i - i3 - qi + 9if + 0i*3 wrt i. 48i Let q(o) be the third derivative of -o*8/64 + 221o*6/720 - 41o*5/12 - 100o*2. Let z(r) be the third derivative of q(r). Differentiate z(n) wrt n. -630n Find the second derivative of 205 + 822i - 3i*2 - 722i*3 + 774i*3 - 818i wrt i. 312i - 6 Suppose -2b = 112 - 52. Let a be b(-3 - 28/(-12)). Differentiate a - 64t + 13t + 26 wrt t. -51 Let f(h) be the second derivative of 17h7/21 - h6/30 + 2h5/5 - 11h*3/2 - 13h*2/2 - 1437h. Find the second derivative of f(o) wrt o. 680o3 - 12o*2 + 48o Let j = 804 - 796. Find the third derivative of -3f3 - 104f*2 - 94f*2 - jf*4 + 40f*4 + 32f*4 wrt f. 1536f - 18 Let z(m) be the first derivative of 699m5/5 - 133m - 368. Differentiate z(b) wrt b. 2796b3 What is the second derivative of -34 - 595c + 2c2 + 6c*3 - 9c*4 + 3c*4 + 590c + 124 wrt c? -72c2 + 36c + 4 Find the second derivative of 622o - 159o + 651o + 390o - 566o2 wrt o. -1132 Suppose 0 = -4w - h + 11, 2h + 33 = 4w + 19. What is the third derivative of 83p2 + 22p - 9p - 306p*3 - 13p + 93pw wrt p? -1278 Let j be (-299)/(-91) - ((-12)/7 - -2). Suppose -jr = r + r. Find the second derivative of y + 55y3 - 87y*3 + ry wrt y. -192y Let k be (-9)/(((-2)/(-6))/(-1)). Let h be k/12(-8)/(-6). Differentiate hp3 - 7 + 2	{ "pile_set_name": "DM Mathematics" }
r when 10866385 is divided by 478? 11 What is the remainder when 271679 is divided by 484? 155 Calculate the remainder when 729551 is divided by 364552. 447 Calculate the remainder when 6661985 is divided by 350630. 15 What is the remainder when 64261025 is divided by 71? 61 What is the remainder when 415666 is divided by 510? 16 What is the remainder when 492507324 is divided by 246253656? 12 What is the remainder when 4556 is divided by 619? 223 What is the remainder when 1772519 is divided by 16? 7 What is the remainder when 11085556 is divided by 1072? 4 What is the remainder when 99409 is divided by 99257? 152 What is the remainder when 176731727 is divided by 266? 263 Calculate the remainder when 2657669 is divided by 2892. 2813 Calculate the remainder when 829575 is divided by 251. 20 Calculate the remainder when 44267 is divided by 3103. 825 Calculate the remainder when 3558793 is divided by 70. 63 What is the remainder when 2908586 is divided by 15? 11 What is the remainder when 536316 is divided by 267616? 1084 Calculate the remainder when 393248 is divided by 18553. 3635 What is the remainder when 4255549 is divided by 335? 44 Calculate the remainder when 702573 is divided by 1495. 1418 Calculate the remainder when 37958566 is divided by 5422649. 23 Calculate the remainder when 1023737 is divided by 234. 221 What is the remainder when 30641609 is divided by 401? 397 What is the remainder when 133515 is divided by 25? 15 Calculate the remainder when 2582193 is divided by 2534. 47 Calculate the remainder when 28305644 is divided by 16. 12 What is the remainder when 228729 is divided by 113222? 2285 Calculate the remainder when 15232029 is divided by 1298. 1297 Calculate the remainder when 387597 is divided by 32. 13 What is the remainder when 27118 is divided by 6658? 486 Calculate the remainder when 4703249 is divided by 940636. 69 Calculate the remainder when 684905995 is divided by 300. 295 What is the remainder when 17427 is divided by 6547? 4333 Calculate the remainder when 238955 is divided by 2096. 11 What is the remainder when 2076584 is divided by 21? 20 What is the remainder when 1693476 is divided by 25657? 114 What is the remainder when 151320 is divided by 15540? 11460 Calculate the remainder when 1342846 is divided by 1076. 1074 Calculate the remainder when 97289313 is divided by 14145. 3 Calculate the remainder when 496692 is divided by 248175. 342 What is the remainder when 3754921 is divided by 348? 1 Calculate the remainder when 31928 is divided by 7895. 348 What is the remainder when 232754 is divided by 347? 264 Calculate the remainder when 72454 is divided by 3771. 805 Calculate the remainder when 84784 is divided by 3840. 304 What is the remainder when 8043 is divided by 1606? 13 What is the remainder when 207822 is divided by 1856? 1806 Calculate the remainder when 189195 is divided by 8336. 5803 What is the remainder when 19974898 is divided by 2798? 2774 Calculate the remainder when 100321 is divided by 683. 603 Calculate the remainder when 157535581 is divided by 93. 91 What is the remainder when 5464078 is divided by 2732035? 8 Calculate the remainder when 43678580 is divided by 7309. 7305 What is the remainder when 41351 is divided by 565? 106 What is the remainder when 267445 is divided by 12734? 31 Calculate the remainder when 181094 is divided by 1161. 1139 Calculate the remainder when 5289648 is divided by 27407. 97 Calculate the remainder when 7841455 is divided by 3920725. 5 What is the remainder when 869908 is divided by 5211? 4882 What is the remainder when 4194760 is divided by 104869? 0 Calculate the remainder when 29733 is divided by 1582. 1257 Calculate the remainder when 44707941 is divided by 4470792. 21 What is the remainder when 153053 is divided by 2051? 1279 Calculate the remainder when 6644 is divided by 574. 330 What is the remainder when 330108445 is divided by 136? 133 Calculate the remainder when 102311 is divided by 51106. 99 What is the remainder when 12618 is divided by 960? 138 Calculate the remainder when 215576 is divided by 832. 88 What is the remainder when 736689 is divided by 66969? 30 What is the remainder when 3775071 is divided by 28? 27 What is the remainder when 306943 is divided by 305554? 1389 What is the remainder when 7492932 is divided by 1498550? 182 Calculate the remainder when 54033 is divided by 53732. 301 Calculate the remainder when 118764441 is divided by 2038. 2029 Calculate the remainder when 21319 is divided by 2824. 1551 What is the remainder when 1064887 is divided by 395? 362 Calculate the remainder when 518066 is divided by 869. 142 Calculate the remainder when 110322 is divided by 2464. 1906 What is the remainder when 301381 is divided by 120? 61 What is the remainder when 213133 is divided by 1580? 1413 What is the remainder when 4585655 is divided by 11? 8 Calculate the remainder when 1489376 is divided by 51355. 81 Calculate the remainder when 9473 is divided by 4721. 31 Calculate the remainder when 18908 is divided by 180. 8 Calculate the remainder when 1167191 is divided by 194530. 11 Calculate the remainder when 470224 is divided by 231. 139 Calculate the remainder when 2486201 is divided by 7443. 239 Calculate the remainder when 4456935 is divided by 5357. 5268 Calculate the remainder when 265934038 is divided by 88644677. 7 Calculate the remainder when 54211 is divided by 27076. 59 What is the remainder when 29063 is divided by 3378? 2039 What is the remainder when 2657 is divided by 455? 382 Calculate the remainder when 153775646 is divided by 4795. 4791 What is the remainder when 1255309 is divided by 73811? 522 Calculate the remainder when 273722 is divided by 203. 78 Calculate the remainder when 787451 is divided by 78739. 61 What is the remainder when 4741866 is divided by 790311? 0 What is the remainder when 2919916 is divided by 535? 421 Calculate the remainder when 3085500 is divided by 771345. 120 Calculate the remainder when 15900780 is divided by 52. 12 What is the remainder when 957482 is divided by 632? 2 What is the remainder when 554673 is divided by 9563? 19 What is the remainder when 1047844 is divided by 4616? 12 Calculate the remainder when 82507 is divided by 627. 370 What is the remainder when 67506 is divided by 1946? 1342 What is the remainder when 1143487 is divided by 228695? 12 What is the remainder when 27375859 is divided by 2588? 2583 Calculate the remainder when 182088 is divided by 203. 200 Calculate the remainder when 166307 is divided by 168. 155 Calculate the remainder when 546700 is divided by 17635. 15 Calculate the remainder when 97152 is divided by 4522. 2190 Calculate the remainder when 80963 is divided by 1588. 1563 Calculate the remainder when 20540240 is divided by 256753. 0 Calculate the remainder when 2694405 is divided by 46455. 15 Calculate the remainder when 307681 is divided by 50919. 2167 What is the remainder when 42983 is divided by 2700? 2483 Calculate the remainder when 217443 is divided by 2861. 7 What is the remainder when 427170 is divided by 1060? 1050 Calculate the remainder when 209791 is divided by 14984. 15 What is the remainder when 1706959200 is divided by 247? 245 Calculate the remainder when 600920 is divided by 38. 26 What is the remainder when 35298197 is divided by 103? 97 What is the remainder when 1557726957 is divided by 20? 17 What is the remainder when 3040092 is divided by 146? 80 Calculate the remainder when 51131029 is divided by 865. 14 What is the remainder when 1682677 is divided by 280427? 115 What is the remainder when 31303474 is divided by 957? 4 What is the remainder when 31269827 is divided by 229925? 27 Calculate the remainder when 3268970 is divided by 3268932. 38 What is the remainder when 87588159 is divided by 1689? 1686 Calculate the remainder when 95616 is divided by 31619. 759 Calculate the remainder when 9999727 is divided by 344818. 5 Calculate the remainder when 598197 is divided by 1221. 1128 Calculate the remainder when 804016 is divided by 9241. 49 What is the remainder when 459157 is divided by 10201? 112 What is the remainder when 201779 is divided by 6114? 17 Calculate the remainder when 398624265 is divided by 79724853. 0 What is the re	{ "pile_set_name": "DM Mathematics" }
-1/2 in -1/4, -37/2, d? -1/4 Let i = 0.6094 - 3.6094. Which is the nearest to -2? (a) -0.1 (b) 8.16 (c) i c Suppose 0 = 2m + 5m + 35. Let n = 0.04 - 0.04. Let b = 61/15 - 22/5. What is the closest to b in m, n, 1? n Let f be (-14342)/19312 - 2/(-17). Which is the closest to -0.1? (a) f (b) 0.2 (c) -5 b Let x = -0.05293 + -0.14107. Which is the closest to -1? (a) -5 (b) 2/5 (c) 0.5 (d) x d Let r(f) = f*3 + 32f*2 + 2f + 18. Let q be r(-32). Let t be 4/q + (-36)/4347. Which is the nearest to -0.2? (a) t (b) -4 (c) 9 a Let j = 259.841 - 260. Let f = -0.059 - j. Let r = 43/42 + -5/14. What is the closest to f in r, 4, -5? r Let o(w) = w*2 - 12w + 13. Suppose 2r - 4l - 40 = 0, -11 = -3r + 3l + 34. Let v be o(r). Which is the closest to -2/5? (a) -3 (b) v (c) 1/5 c Let r = -93336 + 93335.7. Let v = -0.3 - -0.5. Let k be 4 - ((-2)/(-2) - 0). Which is the nearest to v? (a) r (b) 2 (c) k a Let w = -17635 - -158411/9. Suppose -3r + 0f - 127 = 5f, r + 14 = 4f. Let j = r - w. Which is the nearest to 0? (a) 2/3 (b) j (c) 1.5 b Let k = -61.5 + 61.2. Which is the closest to 0? (a) -1/11 (b) k (c) 3 (d) -16 a Let m be -7(-2)/40-10-4. Which is the nearest to 0.2? (a) m (b) -2/19 (c) -2/3 (d) -1/6 b Let h(q) = 2q + 33. Let y be h(-14). Suppose ys - 17 = -4d, -4s + 5d - 2 = 9. Which is the closest to s? (a) -0.5 (b) 9.5 (c) 1/3 c Let i = 125584/9 + -13954. Let w = -0.5 - 0. What is the nearest to -0.1 in -7, i, w, 0.1? i Let y = 195.1 - 194.8. What is the nearest to 249 in y, 2/17, 1/4? y Let o = 22.9 + -133.9. Let i = -108 - o. Which is the closest to 2/3? (a) -0.2 (b) i (c) -0.3 (d) -2 a Let q be (-4)/(-18) - (-3120)/(-7722). Let k = 63 + -64. Suppose -p + 0p = -2. What is the nearest to k in -0.4, p, q? -0.4 Let a(g) be the second derivative of g5/20 + g4/6 - g3 - 3g*2 - 40g. Let x be a(-3). Let w = -1 + 3. What is the closest to w in 0.15, -0.4, x? x Let n = -0.27 + 8.35. Let t = n - 11.08. What is the closest to -3 in -0.3, t, -6/11, 1/3? t Let f = -122905 - -122855.013. Let d = -0.013 + f. Let m = 49.9 + d. Which is the nearest to m? (a) 2 (b) 0.4 (c) -2/7 c Let o be 665/5(-1)/403. Let h = -15/31 - o. Suppose -149d = -122d. Which is the closest to d? (a) 0 (b) 2 (c) h a Let i = 0.09515 + 1.00485. Which is the closest to i? (a) 6 (b) -2 (c) -1/7 (d) -5 c Let l = -13117/5 + 2657. Let k = l - 33. Which is the nearest to -1/2? (a) 4 (b) -4 (c) k c Let r = 179 + -178.98. Let x = r - -0.02. Let v = 13 + -27/2. Which is the nearest to x? (a) v (b) -2/15 (c) -1/4 b Let k = -147 + 591/4. Let b = 29192 + -145959/5. What is the nearest to k in b, -8, 0.4? 0.4 Let o = 269 + -260. Let x = o + -4. What is the nearest to 2 in x, -2/15, 0.4? 0.4 Let g = -408.2 + 408. Let w(l) = -l2 - 9l - 14. Let p be w(-6). What is the closest to -2/21 in 0.1, g, p? g Let l(b) = b*2 + 6b - 5. Let h be l(-7). Let x be h/6 + 4/3. Let v = 1.2431 + -1.2431. What is the nearest to v in 0, 0.07, x? 0 Let m = 16.62 - 16.82. Which is the closest to 0? (a) 2/7 (b) m (c) -2 (d) -1 b Let k = -248/381 - 2/127. Suppose -4u = 140 - 572. Let v be (u/240)/(18/15). Which is the nearest to 0? (a) -3 (b) v (c) k b Let c = 0.172 - -16.628. Let f = c - 17. Let g = -331 + 319. What is the closest to 1 in g, f, -4? f Let l = 9267 - 9266.94. What is the closest to 1/2 in 3/5, l, 1? 3/5 Let d = 161 - 160.29. Let h = -0.21 + d. Let l = 3.88 + 0.12. Which is the closest to -1? (a) -2 (b) h (c) l a Let y = 3221 - 3221.1. Which is the nearest to -41? (a) y (b) -0.04 (c) 0.4 (d) 1 a Let s = -28922/3 + 9641. Which is the nearest to s? (a) 2/7 (b) 3 (c) 132 a Let c be 1-3 - (-77)/28. Let m = -17.7 - -16. Let j = m + 2.1. What is the nearest to c in -1, -2, j? j Let q = 357 + -355. Let x = 25/24 + -11/8. Which is the closest to -1? (a) -7/3 (b) q (c) -2/7 (d) x d Suppose -4t + 8 = 32. Let o be t + ((-300)/16)/(-3). What is the closest to o in 2/9, 8, 0? 2/9 Let m be 3 - (1 - (-16)/(-4) - -3). Let v = m + -5/2. What is the nearest to -3 in 0.4, v, 1/4, -1/7? -1/7 Let g = -69 - -65. Let k be 7 + (-60)/(15/3). What is the closest to -3 in 0, k, -0.1, g? g Let i = -8.494 - -13.494. What is the closest to 1 in -1/17, i, 0.14, -0.1? 0.14 Let d = 1793585757/271861280 - 7/1998980. Let x = d - 221/32. Let s = 1/17 + x. What is the nearest to s in 1, -1/3, -1/2? -1/3 Let p(n) = -n3 + 14n*2 - 17n + 18. Let r be p(13). Let m be 174/r - -35/3. Let x = 5 - 4.7. Which is the closest to -0.07? (a) 0 (b) m (c) x b Let v = -9.926 - -10. Let i = 62.926 + v. Let u = i - 62.6. What is the closest to -2/9 in -0.5, 4, u? -0.5 Let f = -1811/9 - -201. Suppose 5m - 9 = -4l - 10, -l = -5m - 6. Which is the nearest to m? (a) 3/5 (b) -5/6 (c) f (d) 6 b Let h = -89/12 - -23/3. What is the closest to 0 in 1, 2/9, h? 2/9 Let r = -371.507 + 372. Let k = -0.007 - r. Let s = -0.01 - -0.03. What is the closest to -2 in k, s, -5? k Suppose 4734l + 8 = 4730l. Which is the closest to l? (a) 3/7 (b) 3 (c) -0.5 (d) 0.38 c Let i = 12854/7 - 1836. What is the nearest to -1/2 in -6, 0.4, -12, i? i Let k = -39.9 + 38.9. Let d = -6 + -6. Let t = d + 8. What is the closest to k in t, 5, 2/9? 2/9 Let y = -3.097 + 2.83. Let l = y + 0.667. Let r = 0.7 - -3.3. Which is the nearest to -0.1? (a) 1/5 (b) r (c) l a Let d = 0.008 - -2.432. Let x = -1.74 + d. Which is the closest to x? (a) 2 (b) -4 (c) -4/5 a Let o = -4948 - -4953. Which is the nearest to 0.15? (a) -0.039 (b) -1/4 (c) o (d) -5 a Let r = 43.7 + -8.7. Let j = 39.74 + -4.74. Let v = r - j. Which is the closest to v? (a) -5 (b) 3 (c) 4 b Let m = -12.408 + 11.408. Which is the nearest to -0.045? (a) m (b) -30 (c) 5 a Let o be 4/84 + 4/(-12). Let v = -0.193 + 0.193. What is the closest to o in 3, -0.2, v? -0.2 Let s = 764.63 - 769. Let d = 4.67 + s. Let v = -0.2 + 0.6. Which is the nearest to 1? (a) 0.2 (b) v (c) d b Let x be (-4)/(-8)1 + 799/(-1222). Which is the nearest to 3? (a) -4 (b) -5 (c) 2 (d) x c Let b = 0.5 + -0.1. Let f = -0.3 + b. Let g = 4767.5 + -4767. What is the nearest to f in -1, g, 3/2? g Let r be -921/70 - 30/100. What is the closest to 0.1 in 4, r, 102/5? r Suppose 4f = 71h - 68h - 44, 2h + 4f = -4. Let v be (-339)/904 - 3/h. Which is the closest to 1? (a) -1/3 (b) 0.38 (c) v b Let t be (-28)/20(-10)/35. Let y be 1848/392 - (4 - -1). What is the nearest to -0.1 in 0.8, -2/5, y, t? y Let l = -31909 + 31901. Which is the nearest to 0.09? (a) -2/19 (b) l (c) 5/6 a Let p = -70.018 + 0.018. Let u = -37 - p. Let m = u + -32.5. What is the nearest to 6 in -5, 1, m? 1 Suppose 78g - 64g = 0. Let y = -0.15 + -0.14. Let n = y + 0.3. What is the closest to -0.1 in n, g, 2/3? g Let k = -5727 + 5731. Which is the nearest to 0.2? (a) -0.5 (b) k (c) -1/7 (d) -0.1 d Let i be -1 + -39(-68)/2664. Let d = 145/666 - i. What is the closest to -70 in d, 5, -1/3? -1/3 Let p = 579 - 536.1. Let v = p + -43. What is the nearest to 2 in 4, -3, v? 4 Suppose -3w + 3d + 6 + 6 = 0, 4w - 7 = -5d. Let x be 24 + -22 + 4 - 5. Let h = 0.58 - 0.48. What is the closest to h in w, -1/5, x? -1/5 Let u = 8 + -7.9. Let p = -9477 + 9467. Which is the closest to 2? (a) p (b) -4 (c) u c Let k = -2 - -2. Let n = 0.7377 - 0.3377. Which is the closest to k? (a) -1/15 (b) -3 (c) n a Let s = 473.03 + -498.059. Let g = -25 - s. Let o = g + -0.129. Which is the nearest to o? (a) 2/11 (b) 0.4 (c) -1/2 a Let p be (3 - 0)/(7/7). Let z be (p/10)/(12/(-10)). Suppose 4q = -m - 5, 3q = -3m + 3 - 9. What is the closest to m in 1, z, 5? z Let k = -0.39 + 0.39. Let v(b) = 2b - 15. Let h(z) = -z + 8. Let m(q) = 10h(q) + 6v(q). Let y be m(5). What is the closest to y in -6/5, k, -0.5? k Suppose 6d + 56 = 152. Let a = d + -95/6. What is the nearest to 0.5 in -0.1, -1, a? a Let y be ((-4)/(-2))/((-10)/(-275)). Let x = -12243 - -12246. What is the nearest to y in x, -1/4, -0.1? x Suppose 69w - 62w - 3332 = 0. Let c = -471 + w. Suppose 0 = 4s - s + 9. What is the nearest to 2 in c, s, -0.05? -0.05 Let i(p) = 2p*2 + 2p + 1. Let s be i(-1). Let y = -109 + 99. Let j be 1*(-3)/6 - y/(-4). Which is the nearest to s? (a) 2/11 (b) j (c) 0.4 c Let o = 8.7	{ "pile_set_name": "DM Mathematics" }
8 + 1275q2. 1275q*2 Collect the terms in 4t - 18996 + 4t + 6329 + 6334 + 6334. 8t + 1 Collect the terms in 11p3 + 118862p*2 - 59986p*2 - 58876p*2. 11p*3 Collect the terms in 2245v + 1842v - 3411v. 676v Collect the terms in -598977h*2 - 775628h*2 - h + h. -1374605h*2 Collect the terms in 19h*3 + 29770969h*2 - 29770969h*2 - 2. 19h*3 - 2 Collect the terms in -1728 + 1728 + 482j*3. 482j*3 Collect the terms in -13s + 4s - 38s - 65s - 35s - 12s. -159s Collect the terms in 549n - 2016n + 927n + 544n. 4n Collect the terms in -1959549c - 1660256c - 647800c + 861371c. -3406234c Collect the terms in -392c3 + 73c*3 - 320c*3 + 56c*3. -583c*3 Collect the terms in -9 - 5177315h + 11 + 5177315h - 542h*2. -542h*2 + 2 Collect the terms in -2310b - 693b - 1330b. -4333b Collect the terms in -89778s*2 + 179249s*2 - 89496s*2. -25s*2 Collect the terms in -38k*2 - 10k*2 - 56k*2 - 10k*2 + 152k*2 - 3k*2. 35k*2 Collect the terms in -2s*3 + 17237s + 3s3 - 9845s + 15326s. s3 + 22718s Collect the terms in -18 + 34 - 6101r - 16. -6101r Collect the terms in 8418i - 31 + 35 - 4 - 8798i. -380i Collect the terms in 202p*2 - 16864p*3 - 202p*2 + 1 - 5221p*3. -22085p*3 + 1 Collect the terms in 282r + 115r - 9r*3 + 128r + 109r - 634r. -9r3 Collect the terms in 1069s - 266s - 279s - 265s - 260s. -s Collect the terms in -291 + 7582d + 10553d + 291. 18135d Collect the terms in -31x*2 + 10736x - 35x2 + 9030x - 4x2. -70x*2 + 19766x Collect the terms in -81q3 - 111q*3 - 236q*3 + 44q*3 - 2q*2. -384q*3 - 2q*2 Collect the terms in 142o*3 - 3o*2 + 3o*2 + 2o*2 + 57 - 78o*3 + 0o*2. 64o*3 + 2o*2 + 57 Collect the terms in 180d + 182d + 191d + 181d + 190d - 1120d + 174d. -22d Collect the terms in 4267 - 10i + 4277 + 4262 - 12807. -10i - 1 Collect the terms in -7975j + 3 - 6470j - 5058j + 181j. -19322j + 3 Collect the terms in 1037h - 520h + 44410639 - 516h - 44410639. h Collect the terms in -q - q + 2q - 152925q2 + 154708q*2. 1783q*2 Collect the terms in -565832m + 1134290m + m2 - 5m*2 - 568458m. -4m2 Collect the terms in -27918a*2 + 13962a*2 + 13956a*2 - 1494a*3. -1494a*3 Collect the terms in -4s*2 - 15s*2 + 10s*2 + 8s*2 + 91 + 26s*2 + 3s*2 - 90. 28s*2 + 1 Collect the terms in -5486 + 21936 - 5488 + 2t - 5482 - 5481. 2t - 1 Collect the terms in -1706 + 2561 - 2254q + 1127q - 855 + 1129q. 2q Collect the terms in y3 + 104y*2 - 2 + 138y*2 + 2 + 217y2. y3 + 459y2 Collect the terms in 17 - 17 + 43069l*3. 43069l*3 Collect the terms in 14q*2 + 4q*2 - 106 + 61. 18q*2 - 45 Collect the terms in 46g*2 - 919651 + 919651 + 7g*2. 53g*2 Collect the terms in -384 - 372 + 249098c + 756. 249098c Collect the terms in -12x*3 - 764x*2 - 136x*3 - 15x*3 + 764x*2. -163x*3 Collect the terms in -1164a*2 + 2200a*2 - 1148a*2 - 5. -112a*2 - 5 Collect the terms in -146 - 2014260h - 2h3 + 146. -2h*3 - 2014260h Collect the terms in -52q3 + 15q*3 + 47q*3 - 4q*3. 6q*3 Collect the terms in 17482b + 128278b + 196107b. 341867b Collect the terms in -5 - 170 + 282a + 6059a. 6341a - 175 Collect the terms in -10n2 + 2526n + 29n2 - 3679n + 8n3 - 19n*2. 8n*3 - 1153n Collect the terms in 21 - 2254c - 30 + 2255c - 53 + 33. c - 29 Collect the terms in -1703v3 + 21v + 16v2 - 54v + 1705v3. 2v*3 + 16v*2 - 33v Collect the terms in -37o3 - 13o*3 - 12100o*2 + 12171o*2 + 2. -50o*3 + 71o*2 + 2 Collect the terms in -22207 + 77g + 45394 - 96g - 23187. -19g Collect the terms in -386x2 - 5186x*2 - 2760x*2 - 6x*3. -6x*3 - 8332x*2 Collect the terms in -260 + 78 + 82 - 113 + 6c + 9c - 222. 15c - 435 Collect the terms in -752g + 250g + 246g + 256g + 108g3. 108g*3 Collect the terms in -20w - 93 + 72w + 89 - 14w - 10w - 24w. 4w - 4 Collect the terms in -181 - 94 - 9008x + 9011x. 3x - 275 Collect the terms in 631 + 26n + 23n - 1455 - 48n + 743. n - 81 Collect the terms in 799p*3 + 399p + 802p3 - 1610p*3. -9p*3 + 399p Collect the terms in 36x2 + 87x - 22x2 + 87x - 174x + 0x*2. 14x*2 Collect the terms in -9i*2 - 3i*2 - 6i*2 - 12i*2 - 13i*2 + 59i*2. 16i*2 Collect the terms in 23c*2 + 173037c*3 - 172937c*3 - 3c*2. 100c*3 + 20c*2 Collect the terms in 21t - 27 - 41 - 32 + 97 - 51t. -30t - 3 Collect the terms in 7 - 7 + 523285538390t3 - 523285538388t*3. 2t*3 Collect the terms in -1762n*3 - 3554n*3 + 2074 - 4138 + 2064. -5316n*3 Collect the terms in -923 - 2i + 16i2 + 112 + 108 + 703. 16i*2 - 2i Collect the terms in -4w2 + 198w*3 + 8w*2 - 4w*2 - 384w*3 + 181w*3. -5w*3 Collect the terms in 2 - 4 + 2 - 1 + 1175067m. 1175067m - 1 Collect the terms in -29014x*2 - 29020x2 - x3 - 29004x2 + 87024x2. -x3 - 14x2 Collect the terms in 0 - 58241r*2 + 29117r*2 + 29124r*2 + 15r*3 + 0. 15r*3 Collect the terms in -32242a*3 + 8059a3 + a2 - a*2 + 8064a*3 + 8047a*3 + 8040a*3. -32a*3 Collect the terms in -2 - 510l + 270l + 2 - 367l. -607l Collect the terms in 11v - 923v3 - 7 - 11v + 7 + 900v3. -23v*3 Collect the terms in 46240 + 46254 - 239o - 92491 - 108o. -347o + 3 Collect the terms in 109s - 40s - 37s - 62s + 26s. -4s Collect the terms in -178v + 859v*3 + 78v*2 - 78v*2 - 878v*3. -19v*3 - 178v Collect the terms in -30044104z - 15 - 28z*2 + 30044104z. -28z2 - 15 Collect the terms in -1068 - 107775l*2 + 534 + 534. -107775l*2 Collect the terms in -2 - 1659k*2 + 2289k*2 - 632k*2 + 1 + 1. -2k*2 Collect the terms in 5u*3 + 2u*3 + 7 - 104u*3 - 80u*3. -177u*3 + 7 Collect the terms in 4746 + 46x*3 - 4746 - 5x*3 + 321x. 41x3 + 321x Collect the terms in -160w2 - 2003 - 80w + 80w. -160w*2 - 2003 Collect the terms in -89m - 4m2 + 3m*2 + 180m - 91m + 22m*2. 21m*2 Collect the terms in -768655t*2 + 1537308t*2 - 768652t2. t2 Collect the terms in -4a - 8a*2 + 425 + 2a - 152 + 29 + 4a2. -4a*2 - 2a + 302 Collect the terms in -5 + 8 + 5391u - 7551u - 3. -2160u Collect the terms in -1398k + 222 + 157 + 225 + 223 - 827. -1398k Collect the terms in 35011q*2 - 113 + 113 - 35437q*2. -426q*2 Collect the terms in -160k - 112k - 21k - 131k + 157 + 21. -424k + 178 Collect the terms in -211y - 264y + 528y. 53y Collect the terms in 18419f + 26646f - 21339f + 21059f. 44785f Collect the terms in -5101z*3 - 5244z*3 - 5081z*3 + 4278z*3. -11148z*3 Collect the terms in -83r*2 - 36r + 88r - 189r*2 - 51r. -272r2 + r Collect the terms in 6291h*3 - 3h - 3545h3 + 3h. 2746h3 Collect the terms in 180o - 1 + 35o - 59o - 5 + 101o. 257o - 6 Collect the terms in -39937m - 125m*2 + 19971m - 1 + 19967m. -125m*2 + m - 1 Collect the terms in 1062628z - 498352z + 1043140z. 1607416z Collect the terms in -19m*3 + 0m*3 - 125m*3 + 157m*3. 13m*3 Collect the terms in 698i + 698i + 691i + 510i - 3295i + 696i. -2i Collect the terms in 487o - 1427 + 494o - 1465o + 489o. 5o - 1427 Collect the terms in -22k*2 - 116887 + 38967 + 38936 + 38984. -22k*2 Collect the terms in -10f*2 - 14115 + 15f*2 + 14118 - 16f*2. -11f*2 + 3 Collect the terms in 95v*3 - 3488299291 + 3488299291. 95v*3 Collect the terms in -134523 + 134488 - u - u. -2u - 35 Collect the terms in -25r3 + 69r - 131r + 52r*3 + 62r - 38r3. -11r*3 Collect the terms in 10o + 0o3 - 239o*2 - 10o - 238o2 + 458o2 + o3. o*3 - 19o*2 Collect the terms in 43979952 + 5s - 43979952. 5s Collect the terms in 262778c + 262779c + 262779c + 262775c - 1313886c + 262775c + 20c*3. 20c*3 Collect the terms in -6522s + 4 + 3328s + 3312s. 118s + 4 Collect the terms in -761812 - 15489z + 761812. -15489z Collect the terms in 12 - 1 + 139 + 8t + 2t - 150 - 4t. 6t Collect the terms in -267d*2 - 18227 + 18227 + 142d*2. -125d*2 Collect the terms in -36b + 132b - 302 + 302 - 94b + 134b2. 134b**2	{ "pile_set_name": "DM Mathematics" }
at is prob of sequence yh when two letters picked without replacement from {h: 11, y: 1, v: 6}? 11/306 Four letters picked without replacement from cccbbcccccc. What is prob of sequence ccbc? 7/55 Three letters picked without replacement from vvvvnvevvvvevvnnve. What is prob of sequence vvv? 55/204 What is prob of sequence xs when two letters picked without replacement from {u: 1, x: 1, s: 3}? 3/20 Four letters picked without replacement from {t: 4, m: 8, h: 2}. Give prob of sequence tmtt. 8/1001 Three letters picked without replacement from {l: 1, w: 5, d: 12}. Give prob of sequence dlw. 5/408 Three letters picked without replacement from {r: 7, o: 3, c: 1, y: 7, b: 2}. What is prob of sequence obo? 1/570 Four letters picked without replacement from tzzz. What is prob of sequence tttz? 0 Two letters picked without replacement from vcvrrvccvccv. Give prob of sequence rv. 5/66 Three letters picked without replacement from {d: 1, p: 2, e: 1, z: 2, w: 1, j: 2}. Give prob of sequence wed. 1/504 Two letters picked without replacement from gcgggzttczgxfgg. What is prob of sequence zc? 2/105 What is prob of sequence yh when two letters picked without replacement from {h: 4, v: 2, y: 2, f: 1, p: 6}? 4/105 Four letters picked without replacement from ryrp. Give prob of sequence pryr. 1/12 Two letters picked without replacement from {r: 3, s: 4}. Give prob of sequence rr. 1/7 Two letters picked without replacement from hxvvxxxxxxxixqvhxx. Give prob of sequence vi. 1/102 What is prob of sequence gjj when three letters picked without replacement from {g: 3, j: 3}? 3/20 Four letters picked without replacement from {q: 2, o: 1, i: 6, g: 5, s: 5}. What is prob of sequence ssss? 5/3876 Four letters picked without replacement from hkjjojjjkwjo. What is prob of sequence owko? 1/2970 Four letters picked without replacement from {f: 1, k: 2, c: 2}. Give prob of sequence fcck. 1/30 What is prob of sequence hhh when three letters picked without replacement from hhhhuuhu? 5/28 Three letters picked without replacement from vszojxvs. Give prob of sequence ovj. 1/168 Three letters picked without replacement from {n: 3, r: 3}. What is prob of sequence nrr? 3/20 Four letters picked without replacement from omoccmommcocooocommm. What is prob of sequence mmoc? 14/969 Three letters picked without replacement from tottaautyutuottuttut. Give prob of sequence uot. 5/342 Calculate prob of sequence glcd when four letters picked without replacement from gcgldzzcczi. 1/1320 Three letters picked without replacement from nniggnnnifnfiiiiiing. What is prob of sequence igg? 2/285 Two letters picked without replacement from kuuululllluluukkuuk. What is prob of sequence kl? 4/57 What is prob of sequence wbb when three letters picked without replacement from {b: 1, w: 2, q: 3, u: 3, h: 6}? 0 Three letters picked without replacement from {e: 2, u: 6}. Give prob of sequence uuu. 5/14 Four letters picked without replacement from {r: 4, k: 2, v: 3, f: 1, i: 4}. Give prob of sequence vkki. 1/1001 Three letters picked without replacement from kdvdvkkkvvvkkvkkvvk. Give prob of sequence kkk. 28/323 What is prob of sequence luba when four letters picked without replacement from alalxaumbaaxu? 1/858 What is prob of sequence xl when two letters picked without replacement from {l: 11, x: 1}? 1/12 Calculate prob of sequence zkr when three letters picked without replacement from {k: 9, w: 1, z: 1, r: 3}. 9/728 Calculate prob of sequence cx when two letters picked without replacement from {g: 5, c: 3, i: 1, m: 2, x: 6}. 9/136 Calculate prob of sequence zaz when three letters picked without replacement from xzzxzzxaazx. 4/99 Two letters picked without replacement from {z: 3, r: 11}. Give prob of sequence zr. 33/182 Calculate prob of sequence mva when three letters picked without replacement from zdaydymav. 1/252 Three letters picked without replacement from dcdqhddddvvdhvqdd. Give prob of sequence vvd. 9/680 Two letters picked without replacement from uusnwukwuwuusuuuwkk. What is prob of sequence kn? 1/114 Three letters picked without replacement from {c: 1, o: 2, r: 1, n: 1, v: 1, k: 1}. What is prob of sequence nnk? 0 What is prob of sequence cdcc when four letters picked without replacement from {d: 3, e: 1, c: 5}? 5/84 Three letters picked without replacement from tuulddetuuduuwddwd. Give prob of sequence udt. 1/68 Four letters picked without replacement from bbxbbxyx. Give prob of sequence byyx. 0 Three letters picked without replacement from upelulezeeuuuuuuu. Give prob of sequence lle. 1/510 Two letters picked without replacement from gnllnvnwn. What is prob of sequence nn? 1/6 What is prob of sequence jcmi when four letters picked without replacement from {i: 2, z: 2, c: 3, s: 4, j: 3, m: 2}? 3/3640 Three letters picked without replacement from bmebywt. What is prob of sequence bwe? 1/105 Two letters picked without replacement from {j: 1, o: 2, c: 1, a: 4, f: 6, w: 1}. What is prob of sequence cw? 1/210 Calculate prob of sequence uuot when four letters picked without replacement from {q: 2, t: 5, u: 4, o: 1, y: 2}. 5/2002 What is prob of sequence xf when two letters picked without replacement from {f: 1, x: 1, a: 1, l: 1, s: 1}? 1/20 What is prob of sequence ee when two letters picked without replacement from {g: 1, e: 4, o: 1, b: 2, h: 2}? 2/15 Calculate prob of sequence rr when two letters picked without replacement from {o: 3, r: 3}. 1/5 What is prob of sequence knm when three letters picked without replacement from {k: 4, p: 2, m: 1, n: 1}? 1/84 Two letters picked without replacement from {n: 3, f: 2, b: 2, y: 1, u: 3, h: 4}. Give prob of sequence hf. 4/105 Three letters picked without replacement from axqyn. What is prob of sequence axy? 1/60 What is prob of sequence dqq when three letters picked without replacement from ddaqqddddadaddddadda? 13/3420 Two letters picked without replacement from kakakakkka. What is prob of sequence kk? 1/3 What is prob of sequence ou when two letters picked without replacement from {u: 2, d: 6, w: 2, j: 1, m: 1, o: 5}? 5/136 Three letters picked without replacement from {a: 4, j: 3}. Give prob of sequence ajj. 4/35 Calculate prob of sequence gm when two letters picked without replacement from {m: 1, p: 1, g: 2, h: 1}. 1/10 Calculate prob of sequence vaaa when four letters picked without replacement from abbbabavaba. 1/132 What is prob of sequence vud when three letters picked without replacement from {v: 1, d: 1, w: 4, u: 2}? 1/168 Three letters picked without replacement from hddzpqhbqbhqzh. What is prob of sequence dbd? 1/546 Calculate prob of sequence oodp when four letters picked without replacement from {o: 2, d: 11, p: 2}. 11/8190 What is prob of sequence soo when three letters picked without replacement from hooomoihoomshohooo? 5/272 Calculate prob of sequence wd when two letters picked without replacement from {w: 4, g: 1, d: 9, c: 1, p: 3}. 2/17 Three letters picked without replacement from {l: 6, p: 2, v: 1, z: 3, y: 2}. Give prob of sequence vlz. 3/364 Calculate prob of sequence uafu when four letters picked without replacement from {f: 1, i: 2, n: 2, u: 4, c: 2, a: 1}. 1/990 What is prob of sequence dg when two letters picked without replacement from {d: 1, g: 2, e: 1}? 1/6 Four letters picked without replacement from besqgei. What is prob of sequence sqig? 1/840 What is prob of sequence zpf when three letters picked without replacement from zfp? 1/6 Four letters picked without replacement from vvhdd. What is prob of sequence hvdd? 1/30 Calculate prob of sequence fk when two letters picked without replacement from {e: 7, f: 1, u: 1, k: 10}. 5/171 Four letters picked without replacement from {q: 3, b: 1, c: 2, u: 1, g: 3, w: 3}. What is prob of sequence wwqc? 3/1430 Calculate prob of sequence pp when two letters picked without replacement from pkkykkikikkpk. 1/78 What is prob of sequence qif when three letters picked without replacement from tsiqtfftcctct? 1/858 Four letters picked without replacement from {u: 5, v: 2, a: 1, h: 8, k: 3}. What is prob of sequence vhkv? 1/1938 Calculate prob of sequence tonn when four letters picked without replacement from {t: 1, n: 2, p: 1, o: 1}. 1/60 Three letters picked without replacement from {a: 11, q: 3	{ "pile_set_name": "DM Mathematics" }
))? -456225l - 1077 Let y(i) = -10i + 28. Let p(g) = 3g - 7. Let l(r) = -4p(r) - y(r). Let u(a) = -1396a. What is u(l(m))? 2792m Let a(o) be the second derivative of -5o4/12 + 42o*2 + 3o + 570. Let b(y) = 16y. What is a(b(t))? -1280t*2 + 84 Let v(r) = 11r + 117. Let g(j) = -12j - 130. Let l(q) = 9g(q) + 10v(q). Let d(f) = 2568f*2. Determine l(d(m)). 5136m*2 Let u(y) be the second derivative of 2y + 0 - 1/6y3 + 0y*2. Let h(k) = -12k. Let b(x) = -14x - 2. Let t(v) = 7b(v) - 8h(v). What is u(t(w))? 2w + 14 Let v(k) = -454k2 + 9230. Let l(o) = 3o*2. Give v(l(y)). -4086y*4 + 9230 Let k(o) = -2o*2. Suppose -3z + 0 = -3h + 6, 4h - 3z = 9. Suppose hs - 24 = -5m + 6, 0 = -4m. Let w(j) = -6j + 11j + j + sj. Calculate k(w(y)). -512y*2 Let j(k) = -825k*2. Let d(r) be the first derivative of 5r*2/2 - 2758. Calculate j(d(f)). -20625f*2 Let u(g) = -6g. Let m(q) be the first derivative of -343q3/3 + 1600. Calculate u(m(l)). 2058l*2 Let d(i) = 2i*2. Let w(b) = 2b*3 - 53b*2 - 24b - 9. Let y be w(27). Let x(t) = -y - 23t + 72 + 6t. What is d(x(c))? 578c2 Let s(b) = -15b - 3b + 18b + 2b2. Let u(v) = 495v - 973v - 5 + 503v. Determine s(u(k)). 1250k2 - 500k + 50 Let t(b) = 405b + 30. Let n(o) = -41o - 3. Let s(c) = -21n(c) - 2t(c). Let x(g) = 2g. Give s(x(l)). 102l + 3 Let a(v) = -194v2. Let q(z) be the first derivative of -3z*2 + 1023. What is a(q(b))? -6984b*2 Let x(v) = 2v. Let t(f) be the third derivative of -63/8f4 + 0f*3 + 5f*2 - 3f + 0. Give x(t(w)). -378w Let u(p) = -100p*2. Let z(n) = -324n*2 + 129n*2 + 207n*2. Calculate u(z(i)). -14400i*4 Let q(o) = -24o*2 - 46o*2 + 77o*2. Suppose 3k - 11 = -2. Let p(v) = -v + kv - 3v. Calculate q(p(y)). 7y2 Let j(s) = -3s - 430. Let f(l) = -16l + 46. Calculate j(f(p)). 48p - 568 Let c(y) = 25y - 47. Let a(f) = -38f + 48. Let o(z) = 2a(z) + 3c(z). Let p(t) = -19t2. Give p(o(b)). -19b*2 - 1710b - 38475 Let y(r) = -3r. Let o = -166 + 217. Let m(b) = 9 + 52b - 106b + ob + 6. What is m(y(a))? 9a + 15 Let n(s) = 3s*2 - 5s*2 + 3s*2. Suppose -f + t = 2t - 6, 0 = f + 2t - 10. Let w(h) = 15 + 14751h + fh2 - 14751h. Give w(n(r)). 2r4 + 15 Let q(h) = h. Let j(s) = 615 + 37465s + 1395 + 2224 + 1481. Let t(a) = -131a - 20. Let c(f) = -4j(f) - 1143t(f). Give q(c(z)). -127z Let n(h) = h. Let r(f) be the second derivative of 3f7/280 - 15f*4/2 - 92f. Let b(s) be the third derivative of r(s). Calculate n(b(k)). 27k2 Let a(b) be the second derivative of 2b*3/3 + 3b - 1. Let j(g) = 3g - 3g + 509g2 - 490g*2. Determine a(j(k)). 76k*2 Let i = -92/3 - -94/3. Let a(b) be the first derivative of 0b*2 + ib*3 - 32 + 0b. Let u(v) = -2v2. Calculate a(u(m)). 8m*4 Let j(p) = -103p. Let v(t) be the first derivative of -24t2 + 424. What is v(j(s))? 4944s Let k(r) = -2r. Let y(z) = -5z*2 - 5042 + 4509 + 3z*2. Calculate y(k(m)). -8m*2 - 533 Let c(n) = 81335287n. Let u(x) = -2x. Determine c(u(j)). -162670574j Let j(f) = -2f2. Let u(t) = -4969 + 2486 + 2483 - 1631t*2 - 1170t*2. Calculate u(j(k)). -11204k*4 Let y(z) = -1015z*2. Let c(p) = -4567p. Give c(y(v)). 4635505v2 Let v(j) be the first derivative of 354j*3 - j + 3921. Let l(d) = -2d*2. What is v(l(m))? 4248m*4 - 1 Let s(g) = 7g*2 + 4g. Let a(r) = -r. Let i(x) = 4a(x) + s(x). Let o(v) be the first derivative of 2v*3/3 + 7121. Determine i(o(b)). 28b*4 Let k(j) be the second derivative of -1033j*4/3 - 1753j + 1. Let a(h) = h. What is a(k(g))? -4132g2 Let p(d) = 1970d + 1998d - 4050d. Let k(v) = 33v. Calculate p(k(o)). -2706o Let w(y) be the first derivative of 4y2 - 2y*2 - 3y*2 + 4y*2 - 57. Let m(f) = -12f. What is w(m(z))? -72z Let c(q) be the first derivative of 1/2q*2 + 0q - 161. Let f(b) = 2b - 2b - b. Give f(c(u)). -u Let d(y) = -14109y. Let b(c) = -2c*2 - 350. Give d(b(x)). 28218x*2 + 4938150 Let s(u) = -16u. Suppose -3p + 0l = 3l - 291, -2p + 3l + 189 = 0. Let z = -73 + p. Let v(j) = -10j + zj - 12j. Give s(v(a)). -16a Let v(n) = -7n2. Let i(q) be the third derivative of -q4/4 - 2q3 - 7653q*2. Determine v(i(k)). -252k*2 - 1008k - 1008 Let r(y) = 275247486y2. Let f(x) = 6x. Calculate r(f(l)). 9908909496l2 Let p(s) = -2100958s*2. Let c(g) = 6g*2. What is c(p(n))? 26484147106584n*4 Let v(k) = -242k - 99872. Let i(c) = c. Calculate i(v(x)). -242x - 99872 Let q(c) = 271c - 2. Let m(j) = -5j2 - j - 3. Let z(a) = 23a*2 + 5a + 15. Let h(u) = -5m(u) - z(u). Give q(h(y)). 542y*2 - 2 Let a(f) = -37f*2. Let d(k) = -9381425k*2. What is a(d(b))? -3256411996133125b*4 Let z = -461 - -463. Let t(l) = -54l*z + 11l*2 + 35l*2. Let o(i) = -8i*2. Give o(t(g)). -512g*4 Let x(k) = -93k*2 + 168k + 42. Let w(s) = -44s2 + 80s + 20. Let n(t) = -21w(t) + 10x(t). Suppose v - 2 = 2. Let o(a) = -va - a + a. Determine o(n(m)). 24m*2 Let z(m) = -6m + 4. Let a(l) = 52l2 + 32l - 352. Let x(d) = -8d2 - 5d + 55. Let n(b) = 5a(b) + 32x(b). Give n(z(y)). 144y2 - 192y + 64 Let n(a) = 3a2 - 49. Let z(k) be the first derivative of -8k*3/3 + 3809. Determine z(n(i)). -72i*4 + 2352i*2 - 19208 Let d(k) = -23k*2 - 18k + 9. Let p(f) = -13f2 - 10f + 5. Let g(t) = -5d(t) + 9p(t). Let h(q) = 2681q. Determine h(g(a)). -5362a*2 Let f(l) = 4l*2 - 12l - 12. Let r(k) = 4k2 - 10k - 10. Let u(y) = 5f(y) - 6r(y). Let z(d) = 4 - 2 + 8d2 - 2. Calculate u(z(b)). -256b*4 Let q(l) = 6l - 30l + 9l + 16l. Let i(n) = -114n - 4. What is i(q(m))? -114m - 4 Let a(p) = -2493p - 782p + 1260p. Let g(v) = -3v2. What is a(g(s))? 6045s*2 Let y(t) = 2t*2. Let p(d) = -719196d*2 + 6568d - 16420. Let l(o) = 3284o2 - 30o + 75. Let z(g) = -3284l(g) - 15p(g). Determine y(z(v)). 21569312v4 Let d(j) be the third derivative of 63j*4/8 - 2049j*2. Let t(s) = 5s*2. What is d(t(b))? 945b*2 Let p(c) = -5c3 - c2 + 11. Let j be p(-4). Let y(n) = jn - 622n + 306n. Let u(r) = -53r*2. Calculate u(y(l)). -53l*2 Let j(m) = -1493232m*2. Let q(a) = 16a*2. What is j(q(y))? -382267392y*4 Let v(a) be the first derivative of -2a*3/3 - 1682. Let q(r) = 15r + 131. Give v(q(p)). -450p2 - 7860p - 34322 Let z(b) = 17 - 9b2 - b2 + 12b2 + 238. Let j(a) = a2. Determine j(z(q)). 4q4 + 1020q*2 + 65025 Let y(h) = 26300h - 25. Let a(t) = -9t. Calculate y(a(g)). -236700g - 25 Let x(q) = -308q + 2. Let c(o) = -969685 + 969685 + o2. What is x(c(t))? -308t*2 + 2 Let m(n) = -147n. Let g(y) = 356391y2. Calculate m(g(b)). -52389477b*2 Let w(i) = 3176i. Let a(b) = -118b2 + 35b*2 + 31b*2 + 28b*2 + 26b*2. Give a(w(l)). 20173952l*2 Let m(w) = -3007115 + 3007115 - 59w2. Let k(l) = -l2. Calculate k(m(j)). -3481j4 Let v(o) = 13913o. Let n(d) = -d*2 + 1043. Determine v(n(l)). -13913l2 + 14511259 Let j(l) = -l2 + l + 1. Let a(c) = 70c2 - 3c - 4. Let k(g) = a(g) + 4j(g). Let v(z) be the second derivative of z3/3 + 14z. Calculate v(k(w)). 132w2 + 2w Let i(v) = -1671v + 6v*2 + 1671v - 5v2. Let h(j) be the first derivative of -14j*2 + 35. Determine h(i(s)). -28s*2 Let g = -385 + 570. Let b(t) = -gt*2 + 0 + 0 + 186t*2. Let v(s) = -5s + 18s - 87s. Give b(v(o)). 5476o2 Let i(l) = -167l. Let v(d) = 3200d. Let s(o) = -115i(o) - 6v(o). Let u(t) = 135t. Give u(s(r)). 675r Suppose 2o = 4r - 528, o = -3r + 3o + 394. Let f = r + -66. Let k(x) = 69x*2 - 5x + 5x - fx*2. Let q(j) = 3j*2. What is k(q(p))? 9p*4 Let s(y) = y. Let k(h) be the third derivative of 0h*4 + 0h + 0h3 - h2 + 7 - 7/30h*5. Determine k(s(x)). -14x*2 Let u(f) = -6340 - 6313 + 12653 - 320f. Let y(m) = -19m2. Give u(y(i)). 6080i*2 Let i(o) = 23809664o + 1. Let k(f) = -6f2. What is i(k(v))? -142857984v*2 + 1 Let r(x) = -2x. Let i(g) = 1495g - 105. Let m(o) = 4482o - 280. Let s(q) = -24i(q) + 9m(q). Determine s(r(c)). -8916c Let v(q) = -33q - 22q + 2 - 2q. Let x(j) = -114j + 5. Let o(k) = 5v(k) - 2x(k). Let r(c) = 3c. Calculate o(r(b)). -171*b Let z(d) = -d + 8. Let k(w)	{ "pile_set_name": "DM Mathematics" }
when two letters picked without replacement from {g: 2, e: 3}? 3/10 Two letters picked without replacement from mmddmmmmdjmmjmmjid. Give prob of sequence im. 5/153 Calculate prob of sequence bb when two letters picked without replacement from {t: 3, b: 4, i: 2}. 1/6 Calculate prob of sequence cafa when four letters picked without replacement from acacfwc. 1/140 What is prob of sequence ar when two letters picked without replacement from {r: 4, a: 3, t: 1, s: 2, g: 1}? 6/55 Calculate prob of sequence krk when three letters picked without replacement from iiiiiniiikikkrk. 2/455 Two letters picked without replacement from eefehesseeeesssfhs. What is prob of sequence sf? 2/51 Calculate prob of sequence jj when two letters picked without replacement from sjjxgie. 1/21 Calculate prob of sequence jcj when three letters picked without replacement from {c: 8, j: 3, n: 7}. 1/102 Three letters picked without replacement from rkkkkkkrkr. What is prob of sequence rkr? 7/120 Three letters picked without replacement from bxbbbbbbbxbxybxxxyb. What is prob of sequence yxb? 22/969 Calculate prob of sequence ohc when three letters picked without replacement from hmmcoko. 1/105 What is prob of sequence fwf when three letters picked without replacement from {f: 3, w: 7}? 7/120 What is prob of sequence ffj when three letters picked without replacement from {f: 13, j: 6}? 52/323 Calculate prob of sequence jyk when three letters picked without replacement from xtkjy. 1/60 Three letters picked without replacement from {u: 2, j: 9}. Give prob of sequence uju. 1/55 Three letters picked without replacement from {u: 1, p: 1, m: 1, q: 1, j: 1}. Give prob of sequence pqm. 1/60 Two letters picked without replacement from ueukekkkkhkkkh. What is prob of sequence uk? 8/91 Three letters picked without replacement from iib. What is prob of sequence ibi? 1/3 Three letters picked without replacement from xieixxxe. Give prob of sequence iee. 1/84 What is prob of sequence mjqi when four letters picked without replacement from {j: 2, d: 6, q: 2, i: 3, m: 1}? 1/2002 What is prob of sequence tg when two letters picked without replacement from {i: 1, g: 2, q: 1, x: 2, k: 2, t: 1}? 1/36 Calculate prob of sequence ccp when three letters picked without replacement from cpcc. 1/4 What is prob of sequence fhha when four letters picked without replacement from aahfffhfh? 1/63 Calculate prob of sequence lkx when three letters picked without replacement from xkwlnnolnlw. 1/330 What is prob of sequence tr when two letters picked without replacement from trgutttguktrgt? 6/91 Calculate prob of sequence btt when three letters picked without replacement from tttaaatttabttattat. 55/2448 Three letters picked without replacement from {p: 3, k: 1}. What is prob of sequence kpp? 1/4 What is prob of sequence uwuw when four letters picked without replacement from wuuuuuwwuwwuw? 21/286 Two letters picked without replacement from wdtdwddtb. What is prob of sequence bd? 1/18 Three letters picked without replacement from {c: 1, f: 2, p: 3, d: 5, w: 8}. Give prob of sequence ddp. 10/969 Calculate prob of sequence qq when two letters picked without replacement from {d: 3, q: 1, f: 1, v: 1, i: 5}. 0 Calculate prob of sequence jjj when three letters picked without replacement from jjjtjjtt. 5/28 Three letters picked without replacement from {a: 4, s: 1, m: 2, o: 3, c: 6, x: 2}. Give prob of sequence xox. 1/816 Four letters picked without replacement from {l: 7, z: 2}. Give prob of sequence lzlz. 1/36 Three letters picked without replacement from {t: 10, d: 2, x: 4, a: 4}. What is prob of sequence tax? 4/171 Two letters picked without replacement from oooo. Give prob of sequence oo. 1 What is prob of sequence hcv when three letters picked without replacement from {l: 2, w: 2, c: 2, h: 5, v: 2}? 5/429 What is prob of sequence rrx when three letters picked without replacement from {x: 15, r: 3}? 5/272 Two letters picked without replacement from ttttttt. What is prob of sequence tt? 1 What is prob of sequence dded when four letters picked without replacement from dddddddddddvdddddde? 5/114 What is prob of sequence ma when two letters picked without replacement from {h: 1, z: 5, m: 1, a: 3}? 1/30 What is prob of sequence tgb when three letters picked without replacement from {t: 3, b: 4, d: 1, g: 3}? 2/55 Three letters picked without replacement from {j: 1, n: 4, w: 3, x: 2, q: 2}. What is prob of sequence xwx? 1/220 Calculate prob of sequence oor when three letters picked without replacement from ororrrrorrrorroorr. 5/68 Calculate prob of sequence hshq when four letters picked without replacement from thtgsqhm. 1/840 What is prob of sequence rrrr when four letters picked without replacement from rrddrrddrrdrrrrrrr? 143/612 Calculate prob of sequence xm when two letters picked without replacement from xxumujjmxxxqmxm. 4/35 Two letters picked without replacement from lauhhluuuuuu. What is prob of sequence au? 7/132 Two letters picked without replacement from {z: 4, a: 2}. Give prob of sequence az. 4/15 What is prob of sequence frp when three letters picked without replacement from {f: 4, r: 2, p: 3, m: 2, d: 1}? 1/55 What is prob of sequence ezo when three letters picked without replacement from eopfezv? 1/105 Calculate prob of sequence bpn when three letters picked without replacement from nbbhhhhphhhwhn. 1/546 Calculate prob of sequence iyz when three letters picked without replacement from yzzzzzzyizyzzyzzy. 11/816 Three letters picked without replacement from iyy. Give prob of sequence yyi. 1/3 What is prob of sequence nnx when three letters picked without replacement from xnxnxx? 1/15 What is prob of sequence ttvq when four letters picked without replacement from {k: 2, q: 1, v: 4, t: 8}? 4/585 Four letters picked without replacement from drdrrrrrr. What is prob of sequence rrrr? 5/18 Calculate prob of sequence hmh when three letters picked without replacement from qdmhmqmrhmmmqhh. 12/455 Three letters picked without replacement from {t: 7, z: 3, c: 1, p: 1, v: 2}. Give prob of sequence pvv. 1/1092 What is prob of sequence np when two letters picked without replacement from dgoplnggpggogg? 1/91 Calculate prob of sequence vvv when three letters picked without replacement from wvvvyyswvvwy. 1/22 What is prob of sequence ycy when three letters picked without replacement from {c: 2, b: 1, y: 4}? 4/35 Calculate prob of sequence iiid when four letters picked without replacement from {d: 2, i: 3}. 1/10 Calculate prob of sequence oocu when four letters picked without replacement from {o: 2, c: 1, w: 1, u: 1}. 1/60 Calculate prob of sequence sk when two letters picked without replacement from {a: 4, s: 1, k: 1, n: 6, z: 4}. 1/240 Calculate prob of sequence dxxx when four letters picked without replacement from dxdssbd. 0 Three letters picked without replacement from {x: 1, c: 2, u: 2, m: 14}. Give prob of sequence mmc. 182/2907 What is prob of sequence vn when two letters picked without replacement from nvn? 1/3 Three letters picked without replacement from kmkzmmmkkmzkkzkzm. Give prob of sequence zkk. 7/170 Four letters picked without replacement from scskkccykccckcycbcc. Give prob of sequence scbs. 5/23256 Calculate prob of sequence fwmf when four letters picked without replacement from {m: 6, f: 7, h: 1, w: 1}. 1/130 What is prob of sequence fx when two letters picked without replacement from {v: 3, f: 6, x: 9, l: 1}? 3/19 Three letters picked without replacement from {j: 3, y: 1, b: 2, w: 3, k: 3, t: 2}. Give prob of sequence bkb. 1/364 Three letters picked without replacement from {n: 1, x: 1, w: 1}. What is prob of sequence wwx? 0 Two letters picked without replacement from {f: 4, b: 2, u: 1, p: 2}. What is prob of sequence bp? 1/18 Three letters picked without replacement from lfltllhtshltthffthzz. Give prob of sequence thf. 1/114 Three letters picked without replacement from swasaca. Give prob of sequence sac. 1/35 What is prob of sequence qa when two letters picked without replacement from ttttqttatqqttqqqqt? 7/306 Two letters picked without replacement from {z: 5, h: 1, g: 1, b: 2, a: 3, k: 1}. Give prob of sequence zh. 5/156 Two letters picked without replacement from {e: 4, y: 2, w: 3, x: 4, h: 3}. What is	{ "pile_set_name": "DM Mathematics" }
.9089 minus 27866? -27880.9089 What is 685402578 minus 14? 685402564 What is -0.05 plus -0.46904023? -0.51904023 Work out 7 - 68315972. -68315965 What is -721269 minus -9038? -712231 Total of -5010.5 and -118306. -123316.5 Calculate 31 - -0.0200627. 31.0200627 -0.056 - 393882886 -393882886.056 What is 45 less than -192374373? -192374418 Total of 18068662 and -0.04. 18068661.96 What is -5 plus 139064358? 139064353 What is -0.4 take away 87.378408? -87.778408 Work out 66821.27 + 56.6. 66877.87 Sum 34142 and -6052. 28090 What is -142.304071 less than -0.362? 141.942071 Work out -12.055 + 301.0459. 288.9909 Work out -0.00199 - 49676. -49676.00199 -109744209 + -2.4 -109744211.4 What is -98 - -1687318? 1687220 What is 1531877069 less than -87? -1531877156 What is -0.49741096 - 13? -13.49741096 Calculate -140 + 12721174. 12721034 Add 2554.3 and -750.8. 1803.5 What is the difference between 21111043 and -1? 21111044 What is -9254171 take away 20? -9254191 Total of -4035417 and -13.24. -4035430.24 What is -1071102274 minus -8? -1071102266 What is 35.927 less than -120? -155.927 What is 30608 minus 140726? -110118 What is the difference between -13.224 and 32877.7? 32890.924 Add together -0.05 and -2191027. -2191027.05 What is 87781 - -91111? 178892 What is 0.12068 take away -3720.373? 3720.49368 Total of -56 and 380452.1. 380396.1 -5657+0.21191 -5656.78809 -2033764383 - -29 -2033764354 -1721962+-2 -1721964 Calculate -3195.083 - -8. -3187.083 Sum -931528 and -522. -932050 Work out -12989 - -65. -12924 141007+-8543 132464 Subtract 0.385049 from 12164.9. 12164.514951 What is -183 less than -610.52? -427.52 0.2 - 0.01026631 0.18973369 Work out -11420 - -0.2164. -11419.7836 Calculate -176 + -0.46426. -176.46426 Add together 0.5 and -1730.90057. -1730.40057 Put together -1239444 and 13.6. -1239430.4 Subtract 4821085552 from 0.1. -4821085551.9 What is the difference between -59.0236 and 1099? 1158.0236 What is -5 - 2165500530? -2165500535 -487638 - 770 -488408 Calculate 7489873530 - 0.1. 7489873529.9 -738279537+-0.1 -738279537.1 What is 11935.058 take away 0.3? 11934.758 0.064 + -110246 -110245.936 Calculate 7 - -18338304. 18338311 Add 3912 and 13996. 17908 Subtract 0.21 from 460991.454. 460991.244 Work out 368066 - 5076. 362990 -20.9363 + -18 -38.9363 What is the distance between -57930.12 and -61? 57869.12 Work out -0.45 - 0.118056458. -0.568056458 What is -0.228157129 plus -0.08? -0.308157129 4 + 159467.56454 159471.56454 Work out 7970.2 - 12429. -4458.8 Work out 434 - 7.8804. 426.1196 -1+-360.1342343 -361.1342343 Work out -23 - -1115937120. 1115937097 What is -35 minus 412.7? -447.7 Work out 1261 + 72938. 74199 Work out 0.1742 + 213708. 213708.1742 What is 896509124 less than 37? -896509087 What is -1.1799 take away 4438? -4439.1799 Add together 15 and -6702131. -6702116 What is -854.6 take away 544083? -544937.6 -927036.5 + -21 -927057.5 What is 10 + -1.330319? 8.669681 2383 - 219911 -217528 What is 36.4 take away 336567? -336530.6 What is the difference between -0.231 and 981676? 981676.231 What is 5610164 less than 2.22? -5610161.78 Put together -1817847 and 1.05. -1817845.95 What is the distance between -182457 and 11589? 194046 795+-16.91037 778.08963 Put together -0.744 and -29118. -29118.744 415029 - 401 414628 What is 4 take away 6625.0841? -6621.0841 Total of 105098 and -107456. -2358 0.5 + 19.62089038 20.12089038 Add 10783 and 1106.84. 11889.84 367.75255 + 2 369.75255 Calculate -12 - -1832849168. 1832849156 0.2+-0.2532078 -0.0532078 Work out 87026 + -164912. -77886 Subtract 785877.81 from 0.058. -785877.752 What is -4320728813 plus 0.3? -4320728812.7 Total of 35399 and -478. 34921 Put together 0.3 and 1615721037. 1615721037.3 Sum 389 and 5.10032. 394.10032 What is -0.1576 + 6.257? 6.0994 What is the difference between -0.4 and -44379.81? 44379.41 Work out 134407 + -511.58. 133895.42 What is 0.71973 - -3.8? 4.51973 Put together 4888807 and -35. 4888772 Sum -2.2 and -10438733. -10438735.2 What is -134.48 take away 508886? -509020.48 -4176 + 3006.93 -1169.07 What is 1082 - 27238? -26156 Sum -9 and -5.98870401. -14.98870401 What is -6512 + -1600647? -1607159 Work out -120844702 - -5. -120844697 What is 2.422 minus -7564? 7566.422 Calculate 19.1798688 - 0. 19.1798688 -10581018 + 0.13 -10581017.87 Calculate 5032345 + -0.1. 5032344.9 Calculate -95469572.8 + -0.5. -95469573.3 0.088+-5887029 -5887028.912 Work out -0.9 - 0.160708799. -1.060708799 Work out 1277.4395 - -4.7. 1282.1395 What is the difference between -1.703 and -87? 85.297 Put together 11665.0904 and -0.3. 11664.7904 Put together -22.7 and -187165. -187187.7 Total of -894 and 3.713653. -890.286347 What is -545774444 - 4? -545774448 What is -214257 less than -87? 214170 127+91726015 91726142 Put together -0.68969 and -5966. -5966.68969 Work out 354.913696 + -0.5. 354.413696 What is 581 minus 1.603337? 579.396663 Add together -0.03 and 2.249878. 2.219878 Calculate -0.08971 - 0.1023. -0.19201 What is 1.5 minus 1138268396? -1138268394.5 24063.7396+-28 24035.7396 Subtract -17 from -14660348. -14660331 Calculate 25131.866 + 2.27. 25134.136 What is -3478220 - -4? -3478216 What is the distance between 1.54947 and 12562? 12560.45053 23775.7 + 4.8 23780.5 What is 259548 minus 22.71? 259525.29 Put together 8 and 6717.63. 6725.63 -1.1 + 10215752 10215750.9 Calculate 2.9 + -582442. -582439.1 -251253.005 - -5 -251248.005 1999+-102205.62 -100206.62 What is -297541 - 9? -297550 Calculate 50576980 + -5. 50576975 What is -7230528 take away 2? -7230530 What is 58178620 take away 47? 58178573 Sum 36771071 and 120. 36771191 Calculate -428 - 322544. -322972 Calculate -9400909 - -959. -9399950 Add together 30216447591 and -0.3. 30216447590.7 What is the distance between -0.17632 and -36.527? 36.35068 What is the distance between -21381568.8 and 11? 21381579.8 What is -0.0676 less than -855.1? -855.0324 Sum 4 and 0.5262174. 4.5262174 What is 1794 plus -1932088? -1930294 Subtract -0.01 from -30206646. -30206645.99 Subtract 0.14 from -7643446.55. -7643446.69 What is 4 plus 809528322? 809528326 What is 1 + 14201950? 14201951 What is -22975942840 plus 0.2? -22975942839.8 What is the distance between -16 and 0.102598937? 16.102598937 -1118957130+-0.5 -1118957130.5 Total of 35693.1 and 139. 35832.1 Calculate -109149592.2 - 2.1. -109149594.3 Add 16942460 and 160. 16942620 What is the distance between 1685533 and 13? 1685520 What is -3 + 148988546.9? 148988543.9 -25940 - 234793 -260733 Put together -76.8 and -605.2439. -682.0439 What is -853592 - 0.0379? -853592.0379 -0.19923 - 139136 -139136.19923 Put together -2728555 and 203.75. -2728351.25 Work out -4420816 - -3962. -4416854 What is -146415.03 take away -92? -146323.03 Add together 0 and -0.257706957. -0.257706957 Calculate -2756539 - 4. -2756543 Put together -7558 and -11501. -19059 Calculate 0.5 - 1251.20319. -1250.70319 -0.168+-397599 -397599.168 Work out -57695.73 + -8. -57703.73 What is -190798.89 - -0.015? -190798.875 What is -3591.7 + 240.9? -3350.8 Total of -8 and -1352.547735. -1360.547735 What is 8935 less than 0.989? -8934.011 -200.0823+0 -200.0823 Calculate -89478.2 - -165. -89313.2 What is -13 plus 54998248? 54998235 What is -0.2 - 160.3833? -160.5833 Calculate 237406 - 92. 237314 Work out -1152863 + 16852. -1136011 Work out 7.5062 + 142234. 142241.5062 What is the difference between -0.2 and 54.1826352? 54.3826352 Work out -5 - 773.2026. -778.2026 What is -237.6 minus 11841.99? -12079.59 Subtract -57346 from -1134. 56212 Calculate -17287279024 + -0.8. -17287279024.8 3200 + 229.6 3429.6 Put together 0.5 and 183586.38. 183586.88 Sum -77.67 and 4.204. -73.466 What is -72516 + -0.044879? -72516.044879 What is the distance between 34420.6 and 36? 34384.6 What is the distance between -6.85 and 4160? 4166.85 What is 832 take away 0.465235? 831.534765 Add together -1265205.4 and 24. -1265181.4 What is -4.4 take away 39812298? -39812302.4 What is the difference between -2078 and -84.8? 1993.2 What is -7.727 less than -0.04605? 7.68095 Sum -6473 and -105.5. -6578.5 Calculate 11424 - -5.59. 11429.59 What is -7509.24 take away -0.022? -7509.218 What is the distance between -1662927 and -0.07? 1662926.93 Work out -0.72 + 200914878. 200914877.28 What is -2 plus 152	{ "pile_set_name": "DM Mathematics" }
is the closest to 2 in 1/4, d, 0? 1/4 Let c = -106 - -106.1. Let t = 0.4 - -0.1. What is the closest to c in t, 0.1, 2? 0.1 Suppose 3v + 21 = o, 2o - 4v + 3v - 27 = 0. Let q be (2/(-18))/((-4)/o). What is the closest to -1 in -2, -0.3, q? -0.3 Let i = 0.18 + -5.18. What is the nearest to -0.1 in -0.1, i, 2/3? -0.1 Let b be 4/(5/3 - 1). Let h = 10 - 5. Suppose -2t = -hr - bt + 7, 2r + 3t = 7. What is the closest to 0 in r, 0.5, 0? 0 Let t = -0.1 - -0.1. Let r be (-391)/(-85) + (-4)/1. What is the nearest to t in r, 0, 5/2? 0 Let i = -0.2 - 0.3. Let s(j) = j - 6. Let f be s(6). Let p = -4/13 + 62/117. Which is the closest to f? (a) 3 (b) i (c) p c Let m = -13 - -12. What is the nearest to -3 in m, 0.2, 0.5? m Let t be ((-8)/(-50))/(2/5). What is the closest to 0.1 in 1, 2, t? t Let r = -1.003 + 0.003. Suppose -p = 2q - 3 - 0, 5p = 3q - 37. Which is the nearest to 2/11? (a) -1/9 (b) r (c) q a Let m be 2/(-12) + 1/6. What is the nearest to m in -0.1, -4/3, 5? -0.1 Let f(h) = -h*3 - 5h*2 + 2. Let b be f(-5). Let g(n) = -3n*b + 3n - 4n3 + n2 - 4n. Let x be g(-1). What is the nearest to -2/5 in -1/6, x, -1/5? -1/5 Let s = -6 - -11/2. Let r be (-9)/(-18) - 11/14. Which is the nearest to 0.2? (a) -2 (b) r (c) s b Let u = 3/338 - -601/8450. Let o = 0.8 + 0.2. Let x be (1 + 3 + -5)/3. Which is the closest to o? (a) x (b) -2 (c) u c Suppose -4p + 7 = -5. Suppose -3 = pf + 6. What is the closest to -1 in f, 2/9, -1/2? -1/2 Suppose -3q = z - 7, 3q = -z - z + 8. Suppose 0 = -4r + 4h + 12 - 4, 2r - h = 1. Let o = -3 + r. What is the closest to 1/2 in -5, z, o? z Let d = -13/10 + 9/5. Let i = -2.4 - -2. What is the closest to 0 in i, d, -0.3? -0.3 Let m(x) = 2x - 23. Let s be m(14). What is the nearest to -1/3 in -5, s, -3? -3 Let u = -3.018 - -0.018. Let n = 0 + -1. Which is the nearest to -1? (a) -2 (b) n (c) u b Let r(h) = -h + 2. Let c = -3 + 3. Let o be r(c). Let j = -10 - -9.9. What is the nearest to o in j, -2/11, 0.1? 0.1 Let d(i) = -i - 2. Let f be d(2). Let x = -2.9 + 3. Let a be 51/84 - (-9)/(-12). What is the nearest to x in f, -3, a? a Let u = -6.92 - -4. Let o = u + -0.08. What is the closest to 1 in -1, o, 0? 0 Let l be (-7)/(-4) + (3 - 4). What is the nearest to -0.1 in -1/3, l, 0.3? -1/3 Let i(o) = -o*2 - 5o + 9. Let u be i(-6). Which is the nearest to -6? (a) 0.5 (b) -2/7 (c) u b Let r be (-26)/10 - (-2 + 0). Let x = 30 - 35. Let h be 2/(-8) + 30/(-8). Which is the nearest to -1? (a) x (b) r (c) h b Let k = -0.6 - -3.6. Let c = 33/4 - 157/20. Let j = 0.2 + -0.1. What is the nearest to j in k, 4, c? c Let x = -4.5 - 0.5. What is the nearest to -2/3 in 4, -3, x? -3 Let y be (4/1)/(-5 - -6). Which is the closest to -2? (a) y (b) 0.5 (c) 2/7 c Let p = 4.9 - 0.9. Let a = p - 3. What is the nearest to a in 4, -0.1, -1? -0.1 Let o = 3 + -3.2. Let r = 18 + -18.19. Let i = r - -0.09. What is the closest to i in o, -3, -1/3? o Let t = 70.1 + -70. What is the closest to -2 in -21, -2/7, t? -2/7 Let r = 11.4 + -11. Let d = 8 + -7.9. What is the nearest to -0.1 in d, r, -1? d Let o = 0.433 - -0.067. What is the closest to -0.1 in -2/7, 2, o? -2/7 Let v = 1.01 - 1. Let t = v + -1.01. What is the closest to t in 4, -3, 2/15? 2/15 Let t = 0.3 + -0.2. Let z = t - 0.2. Let g = 27.8 + -28. What is the nearest to z in 4, 2/5, g? g Let i = -0.9 + -0.1. Let y = 3.9 + -4. Let z = -3.2 + 0.2. Which is the closest to i? (a) y (b) z (c) 3 a Suppose -5s = 5y - s - 28, -3y + 4 = -4s. Suppose 15 = -w - 2w - 2g, 2w = 2g. Which is the nearest to -0.01? (a) y (b) 3/7 (c) w b Let b = -0.06 - -0.26. Let w = 2/125217 - 91213/347825. Let r = -1/25 - w. What is the nearest to b in r, -0.3, 0? r Suppose 2f + 1 = -5. Let o = -15 - -15. Let h = 0.6 - -0.4. Which is the nearest to o? (a) h (b) f (c) -0.1 c Let p = -45 - -44. Which is the closest to p? (a) -0.5 (b) 1 (c) -1/6 a Let f = 1.7 + -4. Let m = f - -2. Which is the closest to 0? (a) m (b) 3 (c) -1 a Suppose 4h - 14 = s + 4, 5s - 4h + 10 = 0. What is the nearest to s in -0.4, 0.4, -5? 0.4 Let g = 0.247 + 21.553. Let q = g + -18. Let d = q + -4. Which is the closest to d? (a) 1 (b) 0.1 (c) -3 b Let g = -4 + 8. Let k = -253/3 - -85. What is the nearest to -0.1 in k, 0, g? 0 Let m = -2053/42 - -146/3. Let r = m - 1/14. What is the nearest to r in -0.3, 2/5, -3? -0.3 Let j = 5 - 0. Let t = 10 - j. Let k = t + -5. Which is the nearest to k? (a) -1/7 (b) 0 (c) 0.5 b Let n = 0 + -2. Let s = 3.3 + 0.7. Let j = -694/7 + 99. Which is the nearest to 2/5? (a) s (b) n (c) j c Let r = -6 - -5. Let s = 1.1 + -0.1. Let m = 3.2 - -0.8. What is the nearest to r in m, s, -0.3? -0.3 Let a = 9 - 14. Let t = -4 - a. Let u be 0 + (-3)/(-2) - 0. What is the closest to t in -5, 1, u? 1 Let d = 3 - 3. Let g(z) = -2z2 - 6z - 2. Let x be g(-6). Let o = x + 115/3. Which is the closest to d? (a) o (b) 3/4 (c) -0.1 c Let u = -2.2 - -15.2. Let s = u - 13. Which is the nearest to s? (a) -4 (b) -3/4 (c) -1/13 c Let l be (-10)/4(-24)/510. Which is the nearest to 0.1? (a) 1/2 (b) 1/3 (c) l c Let u = 974/3 + -326. Let f = 1 - 0. What is the closest to f in 5, u, 0.5? 0.5 Suppose -2y - 3y - 35 = 0. Let g(l) = 2l + 16. Let o be g(y). Which is the nearest to 0? (a) 0 (b) 4/5 (c) o a Suppose -5 = -0x - 5x. Let g = -4 + 6. Let h = g + 2. Which is the nearest to x? (a) -4 (b) h (c) 0.1 c Let m = 0.413 - -0.087. Let v = 2.2 + -2. Let l = v + -0.3. What is the closest to l in 2/13, 1, m? 2/13 Let c = 558/5 + -112. What is the closest to c in -2/5, 3, -2? -2/5 Let n = 0.19 - 0.49. What is the nearest to 0.4 in 3, -3, n? n Let i = -5 - -10. Suppose 0v = 3v - p - 5, -25 = iv + 5p. Which is the nearest to 0.3? (a) v (b) 1/4 (c) 2/5 b Let s be 32/(-28) + (0 - (-3)/3). What is the closest to 0 in 3, s, 5? s Let g(o) = o*2 + 8o - 5. Let k be g(-8). What is the nearest to k in 2/5, 0, 1/8? 0 Let b = 51 + -51. What is the closest to b in 3, -4, 1/2? 1/2 Let f = -95 - -1043/11. What is the nearest to -1/6 in f, -2/5, 1? f Suppose -3l = 2l. Let o = 13.3 - 14. Let u = 0.3 - o. What is the closest to l in u, 1/8, 2/7? 1/8 Let n = 2.2 - 0.2. Let i(l) = -2l2 - 16l - 14. Let v be i(-7). Which is the nearest to 0.1? (a) n (b) 1 (c) v c Let f = 0.3 + -1.3. Let m = -2 - 0. Let i = -804/7 + 114. What is the nearest to f in 1, m, i? i Let u = 13 + -146/11. Which is the nearest to 2/7? (a) -1/7 (b) -3 (c) u a Let r be (-8)/128-8 + (-3)/14. What is the nearest to r in -11, 2/5, -0.2? 2/5 Let j = 2.7 - -1.3. Let h = 3690/13 + -284. What is the closest to 2 in j, -4, h? j Let t(m) = 16m*2 + m. Let a be t(-1). Let z = a - 61. Let u be -1 - (z/14 + 2). What is the closest to u in -3, -3/8, 1? -3/8 Let l = 43 - 38.8. Let f = 4 - l. Which is the closest to f? (a) 1/5 (b) 3/5 (c) -2 a Let d = 0.5 - 0.54. Let w = d + 0.07. Let q = w - -2.97. What is the nearest to 1 in q, -0.1, 2/15? 2/15 Let p = 0.77 - 16.87. Let u = p - -19. Let g = u + -3. Which is the closest to g? (a) -1 (b) 1/7 (c) -1/5 c Let h = -5.07 - -0.07. Let d = 5.2 + h. Which is the closest to 0? (a) d (b) 5 (c) 2/5 a Let n be (-11)/22(-4)/5. What is the closest to n in -30, 3, -0.3? -0.3 Let s = -19 + 20. Which is the closest to 0? (a) -0.5 (b) s (c) -0.1 c Let v(f) = f*2 - 3f + 1. Suppose -2s = -s + 5o - 3, -2s + 6 = 3o. Let p be v(s). Let b be (p/8)/(4/24). What is the closest to 0.1 in -0.2, 2, b? -0.2 Let j = 2 - 2. Which is the closest to j? (a) -3 (b) 0.5 (c) -1 b Let y = 5.7 + -5.7. Which is the closest to -3? (a) -4 (b) y (c) 0.2 a Suppose -23t + 6 = -21t. Which is the nearest to 1/5? (a) t (b) -2/3 (c) 1/10 c Let r = 171 - 170.9. Which is the closest to r? (a) 1 (b) -2/3 (c) -1 b Let j(x) = -2x - 3. Let s be j(-4). Let h be s(-2 + 18/15). Let r = -2/33 - -41/132. Which is the closest to r? (a) -1/2 (b) 4 (c) h a Let q = 0.3 - 0.4. Let k = 0.1 + q. Let y be -102/(-11) - 2. What is the nearest to k in -3, -1, y? y Suppose l + 29 = -5g, 0g - 18 = 2g + 2*l. Let r = 4 + -2. Which is the nearest to 2/5? (a) r (b) g (c) 0 c Let i = 0.1 - 0.1. Let r = 0 - -6. Let s = r + -6.3. Which is the closest to 1? (a) s (b) i (c) -0.5 b Let l = -267 + 2	{ "pile_set_name": "DM Mathematics" }
22 = -4, -c = -3s + 11 for s. 4 Solve -3x - 9 = 4z + z, 4z - x + 14 = 0 for z. -3 Solve 4b + 4g + 8 = 0, 96b + 13 = 92b - 5g for b. 3 Solve -39q + 5m - 8 = -36q, 2q = m - 3 for q. -1 Solve 0 = 3s - 9, 12s - 8s = -2w + 16 for w. 2 Solve 3a + 5r - 25 = 0, -5a - 13 + 60 = 11r for a. 5 Solve 2c = 5j + 6, -521c = 3j - 517c - 12 for j. 0 Solve 2j = -12, 5j + 39 - 13 = -k for k. 4 Solve 4j + 2 = -2f, -4f = 3j - 1 - 10 for j. -3 Solve -z + 10 = -47v + 43v, 32 = -4z - 2v for z. -6 Solve -2o - 2s = -6o + 6, -3 = 4o + s for o. 0 Solve 21g - 19g = -5d - 31, 3d = 2g - 9 for d. -5 Solve 0 = 4f + 8, 2t + 2f + 6 = -4 for t. -3 Solve v - 5y = -30, 10v - 8v + 3y - 5 = 0 for v. -5 Solve 10l - 7l = -c - 6, l = -5c - 2 for l. -2 Solve -4f - 2b - 4 = b, 5b = -5f for f. -4 Solve -4y - 3l - 7 = -0, -4y + 28 = -4l for y. 2 Solve 3t - 5q - 115 + 112 = 0, 4t = -q + 4 for t. 1 Solve -3t = -2b + 2, 5t = 3b - 3 - 2 for t. -4 Solve -5s - 5j = -10, 3s - 6 = 2j - 5 for s. 1 Solve t = -3u + 11, 5u = -t + 10u - 5 for t. 5 Solve -7 = 16j - 15j + 5w, -4w - 23 = -5j for j. 3 Solve 18 = -s - 4n, 3s - 5n - 14 + 0 = 0 for s. -2 Solve k + 27v - 30v - 11 = 0, k = -2v - 14 for k. -4 Solve 3 = -3r - 2c + 4, 0 = 5c - 10 for r. -1 Solve -4x - 35t = -31t - 12, -4x + 5t - 6 = 0 for x. 1 Solve 0 = 2s + f + 7, -4s - 23 = -3f - 4 for s. -4 Solve -5t = 5r, -5r - 2t = 176 - 167 for r. -3 Solve 5m = 0, 5x - 13 + 38 = -3m for x. -5 Solve 2 = 2b + 3b + h, 5b + 4h + 7 = 0 for b. 1 Solve 3h = 4x - 7, -2h + 1 - 7 = -2x for h. -5 Solve y - 3b - 10 = -26, 4b = -y + 19 for y. -1 Solve 5l - 3d + 21 = 0, -l + 3 = d + 2d for l. -3 Solve -l = 97w - 99w - 2, 0 = l - w + 1 for l. -4 Solve -5b - 3v - 36 = 0, 0 = -11b + 16b - 5v + 20 for b. -6 Solve -n = -41c + 40c - 5, n + c = 5 for n. 5 Solve -3g = -4c - 6 + 17, 21 = -c - 4g for c. -1 Solve 4a - 6k + 7k = -25, -k + 10 = -3a for a. -5 Solve 14q - 11q = 9, 0 = 5m - 4q + 12 for m. 0 Solve -x = 3u + 5 + 3, -x - 7 = 2u for u. -1 Solve 24 = -5m + 2x, -5x = -0m + 2m - 2 for m. -4 Solve -4o + 6a - 11 = 7a, -o + 13 = -5a for o. -2 Solve -4x + 17 = -v, -25v = -23v + 3x - 10 for v. -1 Solve -4i = -4t - 4, -2t + 3i = -21 + 24 for t. 0 Solve 0 = 10g - 13g + 2k + 1, -3 = g + k for g. -1 Solve -3t = 4f - 20, -2t = -4t + 4f for t. 4 Solve 4t = -h + 8, -32t - 9 = -3h - 29t for h. 4 Solve 4 = -2j, -5w - 31 + 11 = 5j for w. -2 Solve 3a - 5o + 0 + 12 = 0, 0 = -5a - 3o + 14 for a. 1 Solve -276t + 277t = -2n, -2n + 3t = -8 for n. 1 Solve k = -3l + 14, -6l - 2k = -2l - 20 for l. 4 Solve -10 = -4z + 3p, 6p + 0 + 13 = z for z. 1 Solve -i - z = -6, -23z = -27z + 16 for i. 2 Solve -r - 3a - 19 = -6r, a = -r - 1 for r. 2 Solve 4 = -2i - 3z, -4i + 3 = i + z for i. 1 Solve 0 = 2a - 4o + 28, -2a + 0o - 33 = -5o for a. -4 Solve -b = -4z - 28, -15 = -b - 11 for z. -6 Solve -4o - 1 = -3u, 9u - 12u - 15 = 0 for o. -4 Solve 2q + 18 = 7b - 11b, -3b = 3q + 12 for b. -5 Solve 3t = 4d + 24, 4d = 5d - 2t + 11 for d. -3 Solve -r + 1 = 4, a - 4r - 14 = 0 for a. 2 Solve 4n - 2a + 3a = 3, -3n + 3a = -6 for n. 1 Solve 2k - 4b = -16, -201b + 204b = 6 for k. -4 Solve 5o = -4j - 0j - 9, 4o + 1 = 3j for o. -1 Solve -8q + 7q + 4b = 25, -4q - 40 = -4b for q. -5 Solve -5j + 7 = 3c, -4c = -3c + 4j for c. 4 Solve 1 = 4v + f + 13, 2v - 5f = -6 for v. -3 Solve 3k + 5 = -2r + 18, -k + 5r = -10 for k. 5 Solve 0 = 4k + 5h + 7, 5k + 5h - h = -2 for k. 2 Solve 4g - 4s = 24, 4g - 12 = 3g + 3s for g. 3 Solve 5s + 7 = 2y + 3, -5s - 10 = 0 for y. -3 Solve -5 = -3y + 2o, -4o = 80y - 75y - 45 for y. 5 Solve 3n + 6 = 3j, n = 4j - 7j - 2 for j. 0 Solve 2q = -o + 5 - 3, 2o - 3q = 18 for o. 6 Solve 8 = 417b - 422b - 2i, i + 4 = 5b for b. 0 Solve 0 = 14u - 9u - 3j + 7, -3u - 1 = -j for u. 1 Solve 4s + 11 = 7s - b, -2b = 2s - 2 for s. 3 Solve b - 5 = -3j, 6j + 4b = 3j + 2 for j. 2 Solve b = -3n - 8, -n - n - 3b - 10 = 0 for n. -2 Solve 5s + 10 + 10 = -5m, 2s - m = 7 for s. 1 Solve 12 - 8 = 5h - 4b, -5h = 5b - 40 for h. 4 Solve 0 = -t + 4i - 14, -17t + 13t + 2i = 0 for t. 2 Solve 16c = 20c - 5a + 12, -5c - 2a - 15 = 0 for c. -3 Solve 34 - 28 = 2o + 2c, c - 19 = -5o for o. 4 Solve -5h = -5f - 10, 3h + 19f - 15f = 6 for h. 2 Solve 0 = -3i + 5m - 1, 37m - 39m = i + 4 for i. -2 Solve 0 = y + y + 4k + 12, y - 3k = 19 for y. 4 Solve -h - 8 = 5o, -8h + 5h = -4o + 5 for o. -1 Solve u = h + 4, -2h - 5 = -34u + 35u for u. 1 Solve -2g = -5d + 33 - 12, 5g + 6 = -3d for d. 3 Solve -3f - 2 = 2b, -5b = -4f + 19 + 9 for f. 2 Solve -5q - 30 = -5y, -22q = -17q + y + 12 for q. -3 Solve 3y + 2c + 8 = -14, 0 = -2y + 5c + 36 for y. -2 Solve -12k + 15k - 12 = -3o, 0 = -3k - 5o + 10 for k. 5 Solve -8j + 6j = -4u, -4j = -4u - 4 for u. 1 Solve n = -3x - 7 + 2, 0 = -3x + n + 5 for x. 0 Solve d + 5 = 3x - 4, 0 = -5d - x + 3 for d. 0 Solve -2r - h = -0r + 11, -3r = h + 16 for r. -5 Solve 3d - 8 = 4y + 3, 3d - 3 = 0 for y. -2 Solve -m - 38z + 40z = -7, -2z - 22 = -4m for m. 5 Solve -p + 4p - 12 = -3d, 4d - 2p = 22 for d. 5 Solve d - 38 - 4 = -5x, -d - 22 = -3x for d. 2 Solve -3b = -0k + 3k - 3, 4b + 3k = 0 for b. -3 Solve -7z - 4g = -5z + 10, 0 = 5z + 3g + 25 for z. -5 Solve -2z + 1 + 3 = -2a, -4z = 12 for a. -5 Solve o + 20 = -4h, -15h = -11h - o + 20 for h. -5 Solve 0 = -76b + 73b + q - 4, 5q - 10 = 5b for b. -1 Solve 4a - 5m = 4, 3a + 0a + 3m = -24 for a. -4 Solve -5x + 15 = 5c, 0x - 10 = 2c - 2x for c. -1 Solve -5j + 3b = -10j + 7, 0 = -3j - 2b + 4 for j. 2 Solve 5y - 33 = -2c, -12y = -8y - 5c for y. 5 Solve 2l + 8v - 13v = 7, 1 = 4l + 3v for l. 1 Solve 3p - 2 = 5y - 4y, 5p + 4y = 9 for p. 1 Solve -2f + k - 16 = -17, -4 = -2f + 2k for f. -1 Solve 4t - 8 + 0 = o, 8 = 4t + 5o for t. 2 Solve -b - 3p - 17 = 0, 3b - 4p + 2p + 7 = 0 for b. -5 Solve -5n + 11 - 1 = r, -r = 2r for n. 2 Solve -5l - 5y + 40 = 0, 2l + y + 7 = 20 for l. 5 Solve 3k + q - 5 = 0, 0 = -12k + 13k + 4q - 20 for k. 0 Solve -2u + 5 = -d, 1 - 20 = -u - 5d for u. 4 Solve 4t = -2a + 93 - 69, 2a = -2t + 16 for t. 4 Solve 2n - 4b = -24, 4n + b = -0b - 12 for n. -4 Solve 2y + 21 = 5l, -3y + 98 = -l + 97 for y. 2 Solve 3 = -c + d, d = 26 - 25 for c. -2 Solve -4i = 5h - 12, 5h + 3i = 10h + 9 for h. 0 Solve 3i + 4q = 1, 2i + 3q = -q + 6 for i. -5 Solve 2n + 3t + 11 = 0, -t - 3 = -4 for n. -7 Solve -b + 2w + 2 = -w, 3b - w = -2 for b. -1 Solve -x + 3o + 25 = -3x, 2o + 30 = -4x for x. -5 Solve -20 - 10 = 5m + 4t, t + 3 = m for m. -2 Solve 5j - 4n + 2n = -18, 4j + 13 = 3n for j. -4 Solve -2y - o + 6o = 29, 5o = 25 for y. -2 Solve -19 = -4w - l, -10l = -2w - 8l + 2 for w. 4 Solve 38r + 7 = t + 36r, 3r + 3 = 0 for t. 5 Solve -15i + 18i - 12 = -3q, 0 = -4q + 16 for i. 0 Solve 3l + 1 = b, -5b - 2l + 26 - 21 = 0 for b. 1 Solve -12a + 11a + 4 = 4i, 2i = 3a - 12 for a. 4 Solve -a = l - 3, 0a + a - 4l - 13 = 0 for a. 5 Solve 8q - 3q - 12 = 2v, -4v + 24 = 2q for v. 4 Solve 0 = -2u - 4c - 12, 8c - 6 = 2u + 6c for u. -4 Solve 2d - 2v - 10 = 0, 72v + 8 = 70v for d. 1 Solve 0 = 14n - 10n + 4u + 32, -5u = -3n for n. -5 Solve c = -4x + 15, 4c - 4x = -x - 16 for c. -1 Solve 0 = 3s + 21, -2s - 104 = -2x - 86 for x. 2 Solve -4y + 6 = 3r - 3y, 5y = -15 for r. 3 Solve -5w = -5l + 15, 2l + 4w - 10 = 2 for l. 4 Solve 0 = r - m - 3 - 0, 5m + 15 = 0 for r. 0 Solve 0 = -3b + f + 7, -5b + 4f - 2 = -16 for b. 2 Solve 3l + h = l - 9, -4l = 4h + 24 for l. -3 Solve -2d + 11 = -o, 7o - 11o = -2d + 26 for d. 3 Solve 5m + 10 = 0, 3w - 10m + 17 = -8m for w. -7 Solve 2b - 6b + 11 = -5o, 15 = -4o - 3b for o. -3 Solve -6 = 2o - 10i + 12i, 0 = 4i + 8 for o. -1 Solve -12o - 35 = 3r - 59, 0 = -2r + 8 for o. 1 Solve 3t + 19 = -23s + 27s, -8 = -s + 4t for s. 4 Solve 2i - 2s + 2 = 0, -3s + 2 = -2i - 2s for i. -1 Solve 3y = 6, -22k + 20k = -y + 8 for k. -3 Solve 0 = 4h + c - 9, 5h =	{ "pile_set_name": "DM Mathematics" }
s are there between 4:02 AM and 5:52 AM? 110 What is 195 minutes before 5:07 AM? 1:52 AM What is 322 minutes before 1:05 PM? 7:43 AM How many minutes are there between 4:46 PM and 6:16 PM? 90 What is 152 minutes before 1:04 PM? 10:32 AM How many minutes are there between 8:30 AM and 12:28 PM? 238 What is 298 minutes after 2:53 PM? 7:51 PM What is 353 minutes before 2:02 AM? 8:09 PM How many minutes are there between 1:40 AM and 12:57 PM? 677 What is 165 minutes before 2:46 PM? 12:01 PM What is 48 minutes before 7:40 AM? 6:52 AM What is 231 minutes after 11:57 AM? 3:48 PM How many minutes are there between 8:19 PM and 10:00 PM? 101 How many minutes are there between 12:28 AM and 5:53 AM? 325 How many minutes are there between 3:25 AM and 10:49 AM? 444 How many minutes are there between 10:47 PM and 6:37 AM? 470 How many minutes are there between 2:41 PM and 10:27 PM? 466 How many minutes are there between 2:17 AM and 7:45 AM? 328 How many minutes are there between 11:15 PM and 12:26 AM? 71 What is 236 minutes before 9:22 AM? 5:26 AM What is 20 minutes before 7:52 AM? 7:32 AM How many minutes are there between 12:13 AM and 5:18 AM? 305 How many minutes are there between 4:28 AM and 6:23 AM? 115 How many minutes are there between 4:53 PM and 5:03 PM? 10 What is 680 minutes before 8:10 AM? 8:50 PM What is 56 minutes after 6:58 AM? 7:54 AM How many minutes are there between 3:33 PM and 3:47 PM? 14 What is 317 minutes before 11:57 AM? 6:40 AM What is 359 minutes before 1:05 AM? 7:06 PM How many minutes are there between 4:13 PM and 9:41 PM? 328 How many minutes are there between 2:48 AM and 7:13 AM? 265 How many minutes are there between 11:05 PM and 6:03 AM? 418 How many minutes are there between 11:35 PM and 9:13 AM? 578 How many minutes are there between 8:43 AM and 11:05 AM? 142 How many minutes are there between 5:15 AM and 3:43 PM? 628 How many minutes are there between 12:32 PM and 8:56 PM? 504 What is 595 minutes after 7:17 PM? 5:12 AM What is 195 minutes after 2:23 PM? 5:38 PM What is 341 minutes before 7:54 PM? 2:13 PM What is 82 minutes after 11:26 PM? 12:48 AM What is 410 minutes after 9:35 AM? 4:25 PM What is 44 minutes after 7:55 PM? 8:39 PM How many minutes are there between 11:44 PM and 3:50 AM? 246 What is 235 minutes before 1:49 PM? 9:54 AM What is 463 minutes after 6:14 AM? 1:57 PM How many minutes are there between 4:46 AM and 12:20 PM? 454 What is 599 minutes after 4:39 AM? 2:38 PM How many minutes are there between 10:23 PM and 5:59 AM? 456 How many minutes are there between 3:31 PM and 3:00 AM? 689 How many minutes are there between 11:41 PM and 1:51 AM? 130 What is 443 minutes before 10:36 AM? 3:13 AM How many minutes are there between 11:12 PM and 11:56 PM? 44 How many minutes are there between 1:19 PM and 12:36 AM? 677 How many minutes are there between 10:07 PM and 3:29 AM? 322 How many minutes are there between 1:12 PM and 8:00 PM? 408 How many minutes are there between 10:18 PM and 8:07 AM? 589 What is 167 minutes before 3:41 AM? 12:54 AM What is 707 minutes after 8:38 PM? 8:25 AM How many minutes are there between 9:15 AM and 2:30 PM? 315 What is 121 minutes after 10:53 PM? 12:54 AM How many minutes are there between 8:38 PM and 9:29 PM? 51 What is 171 minutes after 9:53 PM? 12:44 AM How many minutes are there between 7:23 AM and 11:43 AM? 260 How many minutes are there between 7:32 AM and 4:06 PM? 514 How many minutes are there between 12:09 AM and 9:52 AM? 583 What is 48 minutes after 7:40 AM? 8:28 AM How many minutes are there between 3:41 AM and 6:37 AM? 176 How many minutes are there between 12:03 AM and 7:46 AM? 463 How many minutes are there between 2:00 AM and 11:16 AM? 556 How many minutes are there between 5:16 PM and 6:15 PM? 59 What is 341 minutes before 10:28 AM? 4:47 AM How many minutes are there between 10:10 PM and 1:37 AM? 207 What is 655 minutes before 3:35 AM? 4:40 PM What is 705 minutes before 2:10 AM? 2:25 PM What is 394 minutes before 1:59 PM? 7:25 AM How many minutes are there between 10:50 AM and 4:14 PM? 324 How many minutes are there between 2:16 PM and 5:59 PM? 223 How many minutes are there between 7:45 PM and 10:50 PM? 185 How many minutes are there between 3:43 PM and 6:08 PM? 145 How many minutes are there between 2:45 PM and 9:41 PM? 416 How many minutes are there between 7:54 PM and 5:26 AM? 572 What is 9 minutes before 2:41 AM? 2:32 AM How many minutes are there between 4:31 AM and 3:23 PM? 652 What is 525 minutes after 6:03 AM? 2:48 PM What is 707 minutes before 3:25 PM? 3:38 AM How many minutes are there between 5:06 PM and 4:55 AM? 709 How many minutes are there between 6:43 AM and 4:35 PM? 592 How many minutes are there between 1:30 AM and 12:52 PM? 682 What is 423 minutes before 4:46 PM? 9:43 AM What is 660 minutes before 8:47 AM? 9:47 PM What is 243 minutes after 12:09 AM? 4:12 AM What is 401 minutes after 10:58 AM? 5:39 PM How many minutes are there between 1:57 AM and 3:33 AM? 96 What is 660 minutes after 8:41 PM? 7:41 AM How many minutes are there between 7:45 PM and 7:28 AM? 703 What is 77 minutes before 2:18 AM? 1:01 AM How many minutes are there between 1:46 AM and 6:39 AM? 293 How many minutes are there between 12:26 AM and 6:20 AM? 354 How many minutes are there between 4:32 PM and 2:04 AM? 572 What is 482 minutes before 9:28 PM? 1:26 PM What is 92 minutes before 11:35 AM? 10:03 AM How many minutes are there between 5:41 AM and 9:39 AM? 238 What is 373 minutes before 6:41 AM? 12:28 AM How many minutes are there between 7:17 AM and 5:03 PM? 586 What is 321 minutes after 3:00 AM? 8:21 AM How many minutes are there between 9:34 PM and 4:33 AM? 419 How many minutes are there between 1:58 AM and 6:51 AM? 293 What is 526 minutes before 10:23 AM? 1:37 AM How many minutes are there between 1:40 PM and 2:36 PM? 56 What is 317 minutes before 12:28 PM? 7:11 AM How many minutes are there between 1:20 AM and 11:51 AM? 631 How many minutes are there between 7:32 AM and 1:59 PM? 387 What is 391 minutes after 5:51 AM? 12:22 PM What is 612 minutes after 5:33 PM? 3:45 AM How many minutes are there between 5:31 AM and 8:24 AM? 173 How many minutes are there between 4:52 AM and 10:16 AM? 324 What is 624 minutes before 8:16 AM? 9:52 PM How many minutes are there between 3:29 AM and 2:54 PM? 685 What is 158 minutes before 7:01 PM? 4:23 PM How many minutes are there between 9:18 PM and 6:59 AM? 581 How many minutes are there between 1:37 PM and 4:13 PM? 156 What is 289 minutes before 10:43 AM? 5:54 AM What is 491 minutes after 5:11 AM? 1:22 PM How many minutes are there between 5:40 PM and 11:04 PM? 324 How many minutes are there between 10:01 PM and 11:44 PM? 103 What is 618 minutes before 1:30 PM? 3:12 AM What is 660 minutes after 1:43 PM? 12:43 AM How many minutes are there between 8:23 PM and 3:17 AM? 414 What is 101 minutes before 3:00 AM? 1:19 AM How many minutes are there between 1:55 PM and 8:35 PM? 400 How many minutes are there between 5:06 PM and 2:49 AM? 583 What is 153 minutes after 10:34 AM? 1:07 PM What is 295 minutes before 4:39 AM? 11:44 PM What is 96 minutes after 11:26 PM? 1:02 AM What is 156 minutes after 4:41 PM? 7:17 PM How many minutes are there between 10:34 PM and 9:44 AM? 670 What is 252 minutes before 12:17 PM? 8:05 AM How many minutes are there between 9:37 PM and 12:22 AM? 165 How many minutes are there between 10:57 PM and 4:12 AM? 315 What is 20 minutes after 1:39 AM? 1:59 AM What is 557 minutes after 10:32 AM? 7:49 PM What is 628 minutes after 1:44 AM? 12:12 PM What is 44 minutes after 11:34 PM? 12:18 AM What is 331 minutes after 5:37 AM? 11:08 AM What is 402 minutes after 6:56 PM? 1:38 AM How many minutes are there between 4:00 PM and 9:23 PM? 323 How many minutes are there between 9:15 PM and 9:40 PM? 25 How many minutes are there between 9:11 AM and 5:39 PM? 508 What is 2 minutes after 9:31 AM? 9:33 AM What is 360 minutes before 3:38 AM? 9:38 PM How many minutes are there between 1:40 AM and 1:10 PM? 690 How many minutes are there between 12:01 PM and 11:32 PM? 691 What is 703 minutes before 6:27 PM? 6:44 AM How many minutes are there between 8:27 PM and 7:32 AM? 665 How many minutes are there between 12:53 PM and 7:18 PM? 385 How many minutes are there be	{ "pile_set_name": "DM Mathematics" }
ve of -2fo*2 + fo - 74f + 88o*2 + o wrt o? -4f + 176 What is the first derivative of 2cdpy + 24cdp - 2cp + 13cy + 3dpy - d wrt y? 2cdp + 13c + 3dp Differentiate -2805y + 4263. -2805 What is the second derivative of 139s*5 + 230s? 2780s3 Find the second derivative of -269l*2 + 170l. -538 Find the second derivative of 480a4r*3 + 6a*4r - 5854ar*3 wrt a. 5760a*2r*3 + 72a*2r What is the first derivative of -2ag*2t*3 + 2555ao2t*3 - 2g*2o*2 + go + o*2t - ot3 + 1 wrt a? -2g*2t*3 + 2555o*2t*3 Differentiate gl + 409gx*3 + 560lx2 - x3 with respect to g. l + 409x3 What is the third derivative of -o5 + 182o4 - 279o*2 - 2 wrt o? -60o*2 + 4368o What is the derivative of 1751l4 - 2456? 7004l*3 What is the third derivative of 215j3 - j2 + 117j - 7 wrt j? 1290 Find the second derivative of 2k*2s*3 + 745k*2s*2 - 518k*2s - ks wrt s. 12k*2s + 1490k2 Differentiate -1484d*4 - 2258 wrt d. -5936d*3 Find the third derivative of 846a*3w2 - a2w - 6a - 6w2 wrt a. 5076w*2 What is the first derivative of -15v*4 - 13v - 220 wrt v? -60v3 - 13 What is the second derivative of 186ao5t + ao3t + 8ao - 13at + 2t wrt o? 3720ao3t + 6aot What is the second derivative of 2bn2 - 47bn - 3b + 1818n5 + 2n wrt n? 4b + 36360n*3 Find the second derivative of -36m*4 + 8m*3o*3v + 2mo*2v + 40mov - o3 + 3o*2v wrt m. -432m2 + 48mo3v What is the second derivative of -v*3 - 64v*2 - 4v + 16 wrt v? -6v - 128 Find the third derivative of 14f*4 + 96f*3 - 2077f*2 - 2. 336f + 576 What is the third derivative of 689m5 + 409m*2? 41340m*2 What is the third derivative of -ko*4 + 2456ko - 503o4 - o2 wrt o? -24ko - 12072o Find the second derivative of -dm*2s + dms - 2d - 2m*4 - 12m*3 + 3m*2s - 157ms wrt m. -2ds - 24m2 - 72m + 6s Find the second derivative of 4g*2q*2x + 11g2q2 - g2qx - 3g2 + 2gqx - q*2x - 3 wrt q. 8g2x + 22g2 - 2x Find the second derivative of 83f5s + 22f5 + 2f + 16s wrt f. 1660f*3s + 440f3 Find the third derivative of -16273y*3 + 860y*2 + 6 wrt y. -97638 Find the second derivative of -54w*2z2 - w2 - wz + 97w - z*4 + 2z*3 + 7 wrt z. -108w*2 - 12z*2 + 12z What is the first derivative of cf3 - 4cf2s*4 + 179cf - 104f*3s*2 wrt s? -16cf2s*3 - 208f*3s Find the third derivative of -4di*3r*3 - di*3r + di3 - 3dir*3 - 18i*3r*2 + 4ir2 - 4r*3 wrt r. -24di3 - 18di - 24 What is the third derivative of 651u*5 - 3u*2 + 277 wrt u? 39060u*2 What is the derivative of 372w*3 - 163 wrt w? 1116w*2 Differentiate -1696z*2 + 1626. -3392z Find the second derivative of 9dn*3 + 22dn + d - 38n*3 + 2n*2 + 78 wrt n. 54dn - 228n + 4 What is the second derivative of p*3s - 90p3 - 2p*2s - ps + 50s + 1 wrt p? 6ps - 540p - 4s Find the third derivative of -408l4 - 168l*2 - 3. -9792l What is the third derivative of 39bg*4 - 7bg + 8g*4 + 85g*2 - 2 wrt g? 936bg + 192g Find the first derivative of -187j + 955. -187 What is the third derivative of -5i*6 - 6i*3 - 282i*2? -600i*3 - 36 What is the derivative of 3182y*2 + 2273 wrt y? 6364y What is the first derivative of -ij3 + 3ij - 1112i - 5j3 - 2 wrt j? -3ij2 + 3i - 15j2 What is the first derivative of 6ns2 - 17804n - 1101s3 wrt s? 12ns - 3303s*2 Find the second derivative of -55w*3 + 6w*2 + 665w. -330w + 12 What is the second derivative of 854a*2k*3 - ak - 3k3 - 36k wrt a? 1708k3 Differentiate -55h*2l - h*2 + 7hlx*2 + 100h - 2x2 + 2 with respect to l. -55h*2 + 7hx2 Differentiate 38l*4y*2 + 3l*3y*2 + 2079y*2 with respect to l. 152l*3y*2 + 9l*2y*2 Find the first derivative of 5126z*3 + 11 wrt z. 15378z*2 Find the first derivative of -gkmw + gkm - gkw + 7gw - 2mw wrt m. -gkw + gk - 2w What is the second derivative of 2p3u*2 + 36p*2u*2 - 1429pu2 - 2p wrt p? 12pu*2 + 72u*2 What is the third derivative of -6d*3s4 + d3s2 + 13d*2s*6 + 160d*2s*2 wrt s? -144d*3s + 1560d2s*3 What is the second derivative of -7816f*4 - 1258f + 1? -93792f2 Differentiate 1390z*3 + 1101 wrt z. 4170z*2 Differentiate -3f*3m*3 - 284f*3 + 581f*2m*3 - 4f with respect to m. -9f3m*2 + 1743f*2m*2 Find the third derivative of -4h*4u - h*4 + 23h*3u3 + h2u3 + 11h*2u*2 - 21h*2u wrt h. -96hu - 24h + 138u3 Find the third derivative of f4y + 2f*4 - 82f*3y - 3f2 - 47f - 2y wrt f. 24fy + 48f - 492y What is the derivative of 195z*3 + 404 wrt z? 585z*2 What is the third derivative of 17k*6 - 13k*3 - 400k*2 wrt k? 2040k*3 - 78 Find the third derivative of 31i*4 - 243i*3 + 209i*2 - 11i + 1. 744i - 1458 Find the first derivative of -69b*2q*3 - 5bi3q*2 + 16i*3q*3 - 2i*3q wrt b. -138bq*3 - 5i*3q*2 What is the third derivative of 349l6 + l5t3 + l2t*3 - 3369l*2t*2 + 1 wrt l? 41880l*3 + 60l*2t*3 Differentiate -151jl3 + 30085j - 51l wrt l. -453jl2 - 51 Differentiate 122g + 313. 122 Find the first derivative of 294z2 + 217. 588z What is the third derivative of -4365b3z*3 - 24b*2z*2 + 4z*3 wrt b? -26190z*3 Find the third derivative of 2883a*2y*3 - 2a*2 - 5ay2 - 18y*2 wrt y. 17298a*2 Find the second derivative of -976f*3k*2 - 55fk2 + 4f wrt f. -5856fk*2 What is the third derivative of 600k6 - k3n3 + 3k*3n - 2k2n*3 + 20k*2n - 8kn wrt k? 72000k3 - 6n*3 + 18n What is the derivative of -112prsu - 2psu - 2ps + 4rsu - 7rs + 5u wrt p? -112rsu - 2su - 2s What is the first derivative of 23m*3 - 6m*2 - 170? 69m*2 - 12m What is the derivative of a*2h*2 + 5969a*2 + 1621h*4 - 2h*3 wrt h? 2a*2h + 6484h3 - 6h*2 What is the second derivative of 403f*5 + 93f - 20 wrt f? 8060f3 What is the second derivative of 12439o*3q*2v - o*3qv - o3 + 1192oqv - ov wrt q? 24878o*3v What is the second derivative of -8265b2 + 11051b wrt b? -16530 What is the third derivative of 6583k3 - 16k*2 + 273k wrt k? 39498 Find the first derivative of 112jq + 17q wrt j. 112q Find the second derivative of -1081w5 - 18w - 122 wrt w. -21620w3 Find the third derivative of -137f*5 - 232f*2. -8220f*2 Find the third derivative of 140o*4 + 362o*2. 3360o Differentiate -8k2su - k2s + 4k2u + 15ksu2 - 106ku2 wrt s. -8k*2u - k*2 + 15ku2 Find the second derivative of a2r*3 - 269a*2r*2 - 2ar3 - 4ar2 - 2r*3 wrt a. 2r*3 - 538r*2 Differentiate -2j*2lq + 2j*2l - jlq*2 + 157lq2 with respect to j. -4jlq + 4jl - lq2 What is the first derivative of -3f*2ijq + 2f2i - 10f2jq + ijq + ij - jq + 17q wrt f? -6fijq + 4fi - 20fjq What is the third derivative of 202b*3f2 - b2f2 + 9bf2 wrt b? 1212f*2 What is the derivative of 3a*2d2 - a2d - 31ad3 + 757d*3 wrt a? 6ad2 - 2ad - 31d3 Find the third derivative of d5 + 1645d4 + 20d*2 - 163d wrt d. 60d2 + 39480d What is the third derivative of -2g5l*2 + 84g*5 + 408g*2l*2 - 2l*2 wrt g? -120g*2l*2 + 5040g*2 Find the second derivative of 2mu4 + 15mu3 + 3mu - 2m - 16u4 wrt u. 24mu2 + 90mu - 192u*2 What is the third derivative of 475q5 + q4 + 4q2 + 21q? 28500q2 + 24q Differentiate 624r2z*3 + 2z*3 - 76 with respect to r. 1248rz3 Find the second derivative of s5 + 69s*3 - 23s*2t + 2s2 - 214st + 4s + t wrt s. 20s3 + 414s - 46t + 4 Find the third derivative of 4i*6 - 11i*5 - 195i*2. 480i*3 - 660i*2 Find the third derivative of -11s*3x*2y - 84s3y + 85s2x*2 - 7sx2y - sx2 + 2y wrt s. -66x2y - 504y What is the third derivative of 4941c*3 + 4349c*2? 29646 What is the second derivative of 5080t*2v**	{ "pile_set_name": "DM Mathematics" }
(g) and 83/8. 8 Let f = -231 - 4700. Let a = f - -29701/6. Calculate the common denominator of a and 16/5. 30 Calculate the common denominator of -27/5 and (-18)/(-1 - 172/28). 25 Let d = 3 - -11. Let u = 10 - -10. Calculate the smallest common multiple of u and d. 140 Calculate the common denominator of -45/2 and (708/72)/(3/1). 18 Let d(h) be the second derivative of -h*5/20 - 5h4/12 + h3 + 4h2 - h. Let f = -5 - 1. What is the smallest common multiple of 6 and d(f)? 24 Let k(j) = 6j*3 - 2j*2 - j - 3. Let y be k(3). Calculate the common denominator of y/45 - (-2)/6 and 149/6. 30 Suppose -16s = -18s + 42. What is the smallest common multiple of s and 9? 63 Let v(x) = -x3 + 1. Let m be v(0). Let t = -23 - m. What is the common denominator of 2 + (-2)/(t/118) and 50/9? 18 Suppose 2y + 2y = 4w + 16, 2w + 5y = 6. Calculate the smallest common multiple of 22 and (2 - -16)w/(-6). 66 Let a = 8630 - 189823/22. Calculate the common denominator of a and 41/12. 132 Let b be 114/(-22) + (-12)/(-66). Let t = -3 - b. What is the smallest common multiple of t and (-3)/(-2) - (-1)/2? 2 Let g = 3/1469 + -72017/17628. Calculate the common denominator of (-130)/246/4 and g. 24 Let j = 1025 - 10203/10. What is the common denominator of j and 4/2 - 134/44? 110 Let i = -11/45764 + 1679058333/228820. Let h = i - 7347. Let x = -7/39 - 28/13. Find the common denominator of x and h. 30 Let x(m) = m + 16. Let y be x(-11). Let s(a) = a*2 - 6a + 1. Let d be s(y). What is the least common multiple of 5 and d/8 + (-26)/(-4)? 30 What is the lowest common multiple of -3 + 3119/27 and 22? 88 Suppose -543 - 301 = 4g + 5s, 224 = -g + 2s. Calculate the least common multiple of 3/(-7) + g/(-63) and 11. 33 Let u = -5505/344 + 414/43. What is the common denominator of -17/16 and u? 16 Let n = -60749477517/14627408528 + -40/3642283. Let p = n - 40/251. Find the common denominator of (-2660)/(-48)2/21 and p. 144 Let u(j) = j + 25 + 2 - 5. Let a = -18 - -18. Calculate the smallest common multiple of 10 and u(a). 110 Let s(a) = -a*3 + 5a2 - a - 3. Let g be 10/(-15) + (-22)/(-6). Calculate the least common multiple of 0 + (4 - (-1 + 3)) and s(g). 12 Find the common denominator of 296/12 - 6/18 and 119/12. 12 Calculate the common denominator of 31/6 and 15/(-16) - 4/(-16). 48 Let w(x) = -x2 + 16x + 3. Let a be w(13). Suppose -10 = -3i - 5h, 3i + a = 6i - 3h. Calculate the lowest common multiple of 9 and i. 90 Suppose -3r + 18 = -9. Suppose t = 5q - 37, t - r = -3q + 6t. Calculate the least common multiple of q and 8. 8 Suppose -5o + 2r = r - 141, -135 = -5o - 5r. Find the common denominator of 103/10 and 125/o-2 - -1. 70 Let r(f) = 4f - 3. Suppose 0 = 5y + 4l + 24, 7 = -2y - 2l - 3. Let u be r(y). Let s = u + 31. What is the least common multiple of 16 and s? 48 Suppose 2s - 6s = 80. Suppose 0 = z + 14 - 34. What is the smallest common multiple of ((-35)/s)/(2/16) and z? 140 Let z = -35 - -45. Calculate the lowest common multiple of z and 11. 110 Suppose 2t - 19 = -3s + 12, -s + 57 = 3t. Calculate the least common multiple of 18 and t. 180 Suppose -22 = -4y - 2i, i + 7 = 4y - 0. Suppose -2z - yf + f + 12 = 0, -1 = 4z - f. What is the common denominator of -1 + (133/20)/z and 63/4? 20 Let p = 13403 - 442235/33. What is the common denominator of p and -73/33? 33 Suppose 7l = 4l + 18. Suppose 12 = i - l. Calculate the least common multiple of i and 20. 180 Find the common denominator of (388/240)/(1/(-3)) and 21/((-12)/109). 60 Let b(c) = -c*2 - 5c - 2. Let t be b(-2). Suppose 0 = -0u - u + 3x + t, u = 5x + 4. Calculate the lowest common multiple of 1 and u. 4 Calculate the lowest common multiple of 10 and 1 + 3 + (-13)/(-1). 170 Let l = 1002527 - 9005729/9. Let q = 1894 - l. Find the common denominator of -2 + 1 + (-375)/10 and q. 18 Suppose x = -x - 164. Calculate the common denominator of 46/(x/(-10) + -1) and 39/14. 126 Suppose -7c = -2c + 10. Let f(y) = -4y - 1. What is the smallest common multiple of 10 and f(c)? 70 Let p be 1249827/108 + (-1)/(-4). Let b = p - 11565. Calculate the common denominator of b and (-2)/(-6) + (-1492)/120. 90 Suppose -2y - 5c = 324, 2y + 4c + 672 = -2y. Calculate the common denominator of 29/5 and y/(-6)(-1)/6. 45 Let l be 2/(-3) + (-320)/(-12). Let n = l + -15. What is the lowest common multiple of 2 and n? 22 Suppose 3b = -4 - 2. Let z(u) = 8u + 2. What is the lowest common multiple of (-17)/b + 3/(-6) and z(2)? 72 Suppose 0p - 56 = -4p. Calculate the smallest common multiple of p and 22. 154 Let o be 4/(-14) + 430/35. What is the least common multiple of -38/(-36)o and 4? 8 Calculate the lowest common multiple of ((-30)/(-5))/(0 - -2) and 461/8. 3 Suppose 2z + 0l + 2l + 14 = 0, -3z - l - 31 = 0. Calculate the common denominator of 2190/(-504) - z/(-21) and -133/24. 24 Suppose -3c - 2890 = 4184. Let d = c + 14225/6. What is the common denominator of -91/20 and d? 60 Suppose 3u - 25 + 7 = 0. Calculate the lowest common multiple of u and 20. 60 Let l = -3642 - -2570. Let x = -31 - -17. Calculate the common denominator of l/(-126) - (-4)/x and -4/3. 9 Let m(l) = -l*3 + 10l2 - l + 12. Calculate the lowest common multiple of 8 and m(10). 8 Let j = 3287/8 + -406. Let v = 1000 + -18017/18. Calculate the common denominator of v and j. 72 Suppose 0 = x + x - 12. Calculate the least common multiple of x and 4. 12 Let v(k) = -k3 + 6k2 + 3k - 8. Let f be v(6). Suppose 5u = -f - 0. What is the common denominator of (260/22)/u - -1 and 12? 11 Suppose 5n = 2v - 32, 3n = n - 4. Suppose 54 = 4h - 5w, 3w + 4 = w. What is the lowest common multiple of v and h? 11 Let q = -7 - -11. Suppose 7s - 4s = o + 15, 5s - 8 = -qo. Calculate the lowest common multiple of 12 and s. 12 Let w = -17770 - -497443/28. What is the common denominator of 27/40 and w? 280 Let g(z) = -z + 8. Let q = 0 - -5. What is the lowest common multiple of g(6) and q? 10 Calculate the smallest common multiple of 9 and (-1)/2 - (-255)/10. 225 Let n = -1593 - -6319/4. Calculate the common denominator of -79/6 and n. 12 Let p(t) = 10t*2 - t - 1. Let m be p(2). Let l = m - 19. Calculate the least common multiple of l and -56/5-1. 18 Let f = -486821/18 - -27039. Let t = 119143/16 + -7449. Calculate the common denominator of f and t. 144 Let l be (-4)/(-18) - (-183)/27. Suppose 0 = -i + 3n - 8, -3i + ln = 3n + 4. Calculate the least common multiple of 14 and i. 28 Let p(g) = g3 - 7g*2 - 6g - 11. Let f be p(8). Suppose -40 = -10h + fh. What is the smallest common multiple of 7 and h? 56 Let g be (-19)/3(-201)/58. Let c be 2 + ((-1264)/58)/4. Let o = c + g. What is the common denominator of 25 and o? 2 Let g = 9/44 - -425/396. Suppose -4p - 5356 = -4q, 0p - 5p - 6691 = -4q. Let l = -5429/4 - p. What is the common denominator of g and l? 36 Suppose 16 + 11 = 3m. Calculate the least common multiple of m and 4/12 + 60/9. 63 What is the common denominator of 5/(-50) + 701/60 and -73/6? 12 What is the common denominator of (-3)/(-1) + (-531)/72 and (-5)/4 + 1 - -8? 8 Suppose -2o = -5f - o - 263, 3o - 9 = 0. Let k = -32 - f. Calculate the smallest common multiple of k and 20. 20 Calculate the common denominator of -41/55 and 176/(-40)(2 - 14/4). 55 Find the common denominator of 146/12 + 12/6 and -91/8. 24 Calculate the least common multiple of ((-33)/4)/(30/(-40)) and 6. 66 Let r = 1 - -5. Suppose -2m = m. Suppose m = -4y + 31 + 41. Calculate the lowest common multiple of y and r. 18 Let j = -22 - -27. What is the smallest common multiple of 11 and j? 55 Suppose 4o = 385 + 1883. Calculate the common denominator of o/180 - (-6)/(-10) and -137/6. 60 Let l be (-37)/(-5) + (-12)/(-20). Suppose -3k + 30 = 3b, 3b - l = -2. Calculate the lowest common multiple of (1 - -27)4/k and 12. 84 Let i = 11 - 8. Let f = 55 + -83. Calculate the common denominator of (-1645)/(-42)i/20 and f. 8 Let p be -5 + 2 - -2 - 7. Let s be 1(-2)/(-4)-2. What is the common denominator of 47/6 and (1s)/(p/332)? 6 Let f(i) = -i*3 - 16i*2 + 15i - 1. Let o be f(-17). Let j = o + -23. What is the least common multiple of 2 and j? 10 Let r(h) = 2*h - 12. What is the lowest common multiple of 20	{ "pile_set_name": "DM Mathematics" }
-0.08. Let k = 45.45 + -45. Let n = k + -0.75. What is the smallest value in o, n, -0.5? -0.5 Let w = -2169.4 + 2169. Which is the biggest value? (a) 1/107 (b) -5 (c) w a Let s(g) = 2g2 + 11g + 11. Let z be s(-5). Let i = -3.6 - -4. Which is the second smallest value? (a) z (b) 2/3 (c) i b Let k = -0.7 + -2.3. Let i = 23/39 + 1/13. Which is the third smallest value? (a) 4/5 (b) i (c) k a Let w = 16699 - 83503/5. Let c = -0.03 - -3.03. Let i = c + -2.6. What is the biggest value in i, w, -0.3? i Let l = 1/1054 - -523/4216. Which is the fourth biggest value? (a) -30 (b) l (c) 3 (d) 0 a Let b(q) = -q*2 - 9q + 103. Let i be b(7). What is the biggest value in 3, i, 2/19? 3 Let k be (-66)/12 + 0 - -7. What is the second biggest value in k, -0.08, -4/5? -0.08 Let f = -0.19 - -0.08. Let g = f + -0.09. Which is the biggest value? (a) 0.04 (b) g (c) 4 c Let z = -604 - -604.3. Which is the smallest value? (a) -4 (b) -21 (c) z b Let z = -28 + 28.08. Let m = z + 0.02. What is the biggest value in 0.7, 2/11, m? 0.7 Let n = -94/209 - -12/19. Let h = -0.319 - -0.119. Which is the second smallest value? (a) n (b) h (c) -1 (d) -10 c Let p = 555 + -559. Let x = 136 - 677/5. Suppose -n = 4n. Which is the second biggest value? (a) p (b) x (c) n c Let l be (-3 + (-320)/(-108))/(10/30). Which is the third smallest value? (a) -6.39 (b) 1/3 (c) l b Suppose 3822 = 40y - 1138. What is the fourth biggest value in 0.1, -5, y, -2? -5 Suppose q - 57 = g, -12 = 5q - 9q. What is the second smallest value in -0.1, g, 3, -3/4? -3/4 Let h(w) = w*3 + 8w*2 + 6w - 5. Let d be h(-7). Let s = -1.05 + 1. Let j = s - -5.05. Which is the third smallest value? (a) -1 (b) d (c) j c Let u be (230/(-437))/(-5) + (-56)/171. Suppose 3j + 14 = 5. Let l be -42/(-60)j. Which is the third smallest value? (a) l (b) 5 (c) u b Let b = 226.6 - 227. What is the smallest value in b, -6, -4, -0.1? -6 Let w = -1898 + 1670. Which is the second biggest value? (a) 0.2 (b) -0.4 (c) w b Let f = 0.04 - 0.14. Let i(c) = -c + 11. Let u be i(9). Let a be 272/504 + (-6)/14. What is the third smallest value in u, f, a? u Let v = -261.474 + 261. Let w = v - 0.026. Which is the third smallest value? (a) -0.2 (b) 1 (c) 2 (d) w b Let w = -22 - -22.2. Let m be 0/(2(-1 + 0)). Which is the biggest value? (a) w (b) m (c) -16 a Let a = -74 - -69. What is the third smallest value in 1/2, 0.02, -0.3, a? 0.02 Suppose 0s - 8 = -2s. Let q be (16/24)/(11/((-66)/16)). Which is the third biggest value? (a) s (b) 2/5 (c) q c Suppose 0 = -5k + 3d + 2, k - 14 = 3d + d. Let j = -3 - -2.5. What is the third smallest value in -2/17, k, j? -2/17 Let x = 0 + 5. Suppose 4n - 2d = -d + 15, 0 = 3n - xd - 7. Let k be ((-24)/56)/((-18)/n). Which is the second biggest value? (a) k (b) 2/13 (c) -0.2 a Let n be ((-12)/(1 + -7))/71. Which is the biggest value? (a) 4 (b) n (c) 3/8 a Let x = 2 + 3. Let g = -5.5 + x. Let v(n) = n2 + 2n + 1. Let d be v(-1). What is the smallest value in -8, d, g? -8 Let y = 131 + -133.29. Let f = -0.71 + y. Let a be (-4)/10 + 24/10. What is the second biggest value in 0.3, f, a? 0.3 Suppose 8j - 4j - 140 = -2i, -4i = 2j - 82. Suppose j = -3z + 21. Which is the second biggest value? (a) 5 (b) z (c) -1 (d) 6 a Let l be (-611)/((-1)/(-1)). Let m = l - -65. Suppose 2k + 7u - 2u = -11, -3u - 9 = 0. Which is the third smallest value? (a) m (b) -0.3 (c) k a Let m = -28 - -30.3. Let v = m - -13.7. Let u = 16 - v. Which is the second smallest value? (a) u (b) -0.3 (c) -6 b Let l = 3 - 2.4. Let i = l + -0.3. Let m = -92.3 + 91.3. Which is the biggest value? (a) m (b) -3/4 (c) i c Let a = 7 + -6.7. Let d = -193 + 198. What is the biggest value in d, 4, a? d Let g be 5 + -1 + (-6 - 120/(-55)). Let h = -742/3 - -245. Which is the second biggest value? (a) 1/5 (b) h (c) g c Let p = 3.1299 - -0.0001. Let z = -3 + p. Let i = 0.23 - z. What is the third smallest value in -0.3, -2, i? i Let l = -561.8 + 562. What is the fourth smallest value in -0.2, -4, 45/2, l? 45/2 Let t = -171.2 - -171. Which is the second biggest value? (a) 3/8 (b) 0.4 (c) t (d) -8 a Let h = 0.75 - -0.25. Let b = h + -0.6. What is the second biggest value in 1, b, 0.5? 0.5 Suppose 0 = 2b - 7b. Let t = -0.1 - 0.06. Let z = -0.14 + t. What is the second biggest value in -0.1, z, b? -0.1 Let s = 2/1431 - 2872/7155. What is the third biggest value in s, -5, 101? -5 Let z = -922.6 + 923. Let p = 18 + -11. Let m = p + -12. Which is the smallest value? (a) 2/17 (b) m (c) z b Let y = -217 - -328. Let l = y - 106. What is the biggest value in -2/9, -9, 0.4, l? l Let s = 279 - 278.8. Which is the fourth smallest value? (a) -2/3 (b) -2 (c) s (d) -1 c Let i = 247.7 - 247.5. Let r = 6 + -2. Which is the third biggest value? (a) -1 (b) -0.1 (c) i (d) r b Let n = 12.43 - 12.979. Let i = n - -0.149. Let o be (16/(-7))/(-1) + -2. What is the second biggest value in i, -0.3, o? -0.3 Let o = 0.21 - 0.01. Let v = -136 + 139. What is the third biggest value in v, o, -2, -0.2? -0.2 Let p be 44(-1 - 2/(-1)). Let s be (1/3)/(p/12). Let g = -1/3 + 7/12. What is the third smallest value in s, g, 0.5? 0.5 Suppose 37x = -22 - 15. Which is the second biggest value? (a) 4 (b) x (c) -0.2 (d) -21 c Let y = -365 + 375. Which is the smallest value? (a) 2/9 (b) 3 (c) -23 (d) y c Suppose -w = 3w - 20. Let j be (-2 - 1 - 2)2/65. Which is the second smallest value? (a) -1 (b) w (c) j c Let a = 395/3 - 133. Let s = 2 - 1.5. What is the second biggest value in a, 0.1, s? 0.1 Let o = 14.3 - 0.3. Let w = -3 + o. Let v = 10.92 - w. Which is the smallest value? (a) -0.5 (b) v (c) 4 a Let x = -1258 + 1256. Suppose q + 4w = 6q + 35, -q + 3w - 18 = 0. Which is the smallest value? (a) -2/7 (b) x (c) q (d) 2/19 c Let g = 25.42 + -0.42. Let f = -26 + g. Which is the second biggest value? (a) f (b) -2/21 (c) -2 a Let l = 97/8 - 12. Let k = -24 - -25.5. Which is the second biggest value? (a) k (b) 0.4 (c) 2 (d) l a Let l = 2.48 + -2.46. Which is the third biggest value? (a) l (b) -2/3 (c) -6/7 c Let s = -0.272 + 140.272. Let g = 140.61 - s. Let i = g - 0.21. What is the third smallest value in i, 2, 1? 2 Let t = 71.8 + -72.2. What is the smallest value in 1/6, -5/2, t? -5/2 Suppose 24j + 36 = 33j. Which is the third smallest value? (a) 2.5 (b) -4 (c) j c Suppose 172i - 170i + 96 = 0. What is the second biggest value in 5, i, -5, 3? 3 Let z = 279 + -281. What is the third smallest value in -1/2, -3/16, -0.2, z? -0.2 Let k = -218 - -194. Which is the second biggest value? (a) -0.02 (b) -5 (c) -4 (d) k c Let y = -144.4 - -121. Let b = 6.4 + y. What is the third biggest value in b, -0.4, 2/11? b Let f = 1.12 - 1.12. Which is the smallest value? (a) f (b) -0.3 (c) 2/11 b Let c(w) = w + 4. Let j be c(-3). Let m = 37.7 + 11.3. Let u = m - 54. What is the smallest value in u, 0.1, j? u Let o be (9/54)/(1/628). Let z = o - 104. Let j = -36/17 + 248/85. Which is the second biggest value? (a) z (b) -3/5 (c) j a Let p = -351.6 + 352. What is the fourth smallest value in p, -4/9, 3, -0.3? 3 Let w = -0.4 + 0.12. Let o = w + -0.02. Let g be 0 + ((-58)/18 - (9 - 12)). Which is the second smallest value? (a) o (b) g (c) 5 b Let d = -2.7 - -3. Let p(o) = -o - 15. Let n(x) = -x*2 + 6x. Let z be n(8). Let r be p(z). Which is the third biggest value? (a) d (b) r (c) -0.5 c Let f = 4856/4055 - -2/811. What is the smallest value in -90, -0.1, f? -90 Let s = 4 - 7. Let t = -2 - s. What is the biggest value in t, -13, -1/2? t Let s = 69.3 - 69. Let o = 4.5 + -5. Let b = 1 + -0.6. What is the second smallest value in o, s, b? s Let q = -5.7 + 6. Let g = 0 - -44. Let l = g + -49. Which is the biggest value? (a) q (b) l (c) 3 c Let u be (-1)/(-10) - (-484)/(-40). What is the smallest value in 1/3, -0.4, u? u Let y(s) = 2s2 + 2s. Let d be y(-3). Let p = d - 6. Suppose 0 = i - 2, -i = 4*j + i. What is the third smallest value in 4, j, p? p Let j = 154.9 - 145. Let y = j + -10. Let o = 213 - 2341/11. Which is the second biggest value? (a) o (b) 1 (c) y a Let y be (16/(-54))/((-2)/3). Let k = 37 - 52. Let n be (2/6)/(5/k). What is the third biggest	{ "pile_set_name": "DM Mathematics" }
osest to 2/5? (a) -1/3 (b) p (c) l c Let v = 1.059 + -1.859. Which is the nearest to -3? (a) v (b) 3 (c) -0.5 a Let c = 33.54 - 33.6. What is the closest to 1 in 3, 0.1, c? 0.1 Let t = -18.7 + 17.7. Which is the closest to 2/5? (a) -0.1 (b) -1/12 (c) t b Let n = -14.9 + 14. Let m = n + 43.9. Which is the closest to 1/2? (a) m (b) 4 (c) 1 c Let k = 22 - 1. Let m = -20.7 + k. Which is the closest to 1/4? (a) -2 (b) 0 (c) m c Suppose 6k = 11 + 13. Suppose -3r + 2r + 7 = -2x, kx = -5r + 21. Which is the nearest to x? (a) -2/11 (b) -1/5 (c) 0.4 b Let n = 867 + -894. Let r = 52.7 + -25.3. Let s = n + r. Which is the closest to -1/2? (a) -0.2 (b) s (c) 1/5 a Suppose 0 = -3h - 5y + 3y + 336, 0 = -2h + 3y + 237. Let x = 112 - h. Let p be (-4)/14 + (-16)/(-7). Which is the closest to -0.1? (a) p (b) -4 (c) x c Let x = 1.4 - 1.31. Let m = -5.09 + x. Which is the nearest to 2? (a) -0.8 (b) m (c) -5/2 a Suppose 2 = -9c + 56. Suppose -3g + c = -5g, -g = w - 2. What is the closest to 2/3 in 0, w, -5? 0 Let o = 92 - 649/7. Let i = 83.9 - 84. Which is the nearest to i? (a) 0.2 (b) 2 (c) o a Let z = 3.91 + 0.09. Let u = 0.01 - -0.49. Let k = -3 - -4. Which is the closest to k? (a) u (b) z (c) -2/3 a Suppose w - 11 = 7. Let a = -15 + w. Suppose -2c + a - 9 = 0. What is the closest to 1/3 in -4, c, -1/5? -1/5 Let t = -130 + 135. Which is the closest to -11? (a) 1 (b) -4 (c) -5 (d) t c Let x = -15/16 - -17/16. What is the nearest to 11 in -5, -0.4, x? x Let g = 56.2 - 56. What is the nearest to 0.1 in g, -3, 5, -16? g Let m = -3 - -4. Let j = -0.133 + -73.867. Let y = -74.5 - j. Which is the closest to -0.1? (a) y (b) m (c) -1 a Let f = -24 - -8.7. Let l = f - -15. What is the closest to 2 in 2, -2, l? 2 Let t = 0.335 - 0.035. Which is the nearest to 1? (a) t (b) 0 (c) 4 (d) 1 d Let j(r) = -2r*2 - 2r - 8. Let b be j(-4). Let f = 30 + b. What is the closest to f in 0.2, 4, 2/11? 2/11 Let s = 126 - 130. Let h be 3 + ((-2)/8 - 26/8). Which is the closest to h? (a) 0.4 (b) 4/5 (c) s a Let v = 3 - 1. Let x = 0.21 + 20.79. Let j = x - 17. Which is the nearest to 0? (a) v (b) 3 (c) j a Let u = 30 + -18. Let x = u + -12. What is the nearest to -0.1 in 5, x, -3/2? x Let b = 192 + -190.6. What is the nearest to -1/3 in -0.3, 0.4, b? -0.3 Let v = 27.4 - 22. Let p = 0.2 - v. Let y = p - -5. Which is the closest to 0.4? (a) y (b) -2/7 (c) -2 a Let x = -6.3 - -6. Let t be 3/(-8) + 190/80. Which is the closest to 1? (a) t (b) 2/3 (c) x b Let x = 87 + -49. Let s = -42 + x. Let h = 0.2 + 0.3. What is the nearest to -0.1 in -3/2, s, h? h Let t = -11.5 - -11.4. Suppose -4 - 20 = 3v. Let d = v + 10. What is the closest to d in t, -0.4, -3? t Let q = -102653/15 + 6851. Let a = 39/5 - q. What is the nearest to -2 in -1/4, a, -0.2? -1/4 Let z = -64.2 - -66.2. Let j = -42 - -169/4. What is the nearest to z in -3/5, j, -1? j Let l = -202 - -200. What is the nearest to 1 in -1/7, 12, l, 3/7? 3/7 Let g = -167 + 179. Let q = 10 - g. Let i = 1.96 + -2. Which is the nearest to i? (a) 0 (b) q (c) 0.5 a Let n = -14.2 - -14.4. Which is the nearest to -1? (a) 2/5 (b) -21 (c) n c Suppose -3601d + 3598d = 0. Let a be (-3)/(-9) - (-22)/(-30). What is the closest to 0.1 in -1/4, a, d? d Let d(g) = g3 + 14g*2 - 16g - 20. Let p be 50/(-20)(8 - 2). Let v be d(p). Which is the nearest to 1? (a) 0 (b) v (c) 0.1 c Let z = -949.5 - -949. Which is the nearest to 0? (a) -4 (b) z (c) 6 (d) -3/7 d Let o = 0.1 - -0.4. Suppose -19v = -6v - 39. Which is the closest to 0.1? (a) -0.04 (b) v (c) o a Let z(x) = x2 - 7x. Suppose -28 = -t - 3t. Let n be z(t). Let i be (-4)/(-12)3 + 3. Which is the closest to n? (a) i (b) -3 (c) 6 b Let x = 0.4 + -1.6. Let i = 0.2 + x. Let v = -9 - -8.5. Which is the nearest to 0? (a) i (b) 4/7 (c) v c Let k = -0.717 + 0.317. Which is the nearest to -2? (a) -1/10 (b) k (c) -6/11 c Let l = -55.7 - -57.7. Which is the nearest to -1? (a) l (b) -0.14 (c) 0.1 (d) 1 b Let p = 3.9 + -4. Let k be -3 - (160/(-5) - 3). Let d = 36 - k. What is the nearest to p in -5, -3/7, d? -3/7 Let s be 5/3(-693)/110. Let y = s - -11. Let i = -3 + 4. Which is the closest to i? (a) -2/17 (b) -4 (c) y c Let q be 94/2820 - 1/(-6). Which is the nearest to -12? (a) q (b) -0.2 (c) -1/2 (d) 5 c Let u be (13/(-65))/((-8)/30). Which is the nearest to -4? (a) u (b) -4 (c) 0 b Let g be 14(-3 + 4/((-8)/(-4))). Let d be (-3)/(-2) - 1/2. Let v be d + 3 + g/3. What is the nearest to v in 1, 0, 0.1? 0 Suppose 2j = -0j + 10. Let t be (75/9 - 5) + -3. Which is the closest to -3? (a) 4 (b) j (c) t c Let q = -3 - -3.3. Let n = 323 - 321. What is the closest to q in 0, n, 7? 0 Suppose -25k - 11k - 72 = 0. Which is the nearest to 3? (a) -2/3 (b) k (c) 2/5 c Let u = 21 - 41. Let l be 1 + 8/u - 1. Let m be (0 + 1)/((-5)/(-2)). Which is the nearest to m? (a) l (b) -1/6 (c) 5 b Let q = 24 - 25. Let t be (3/5)/q + 6/35. Which is the closest to -1/4? (a) 0 (b) 4 (c) t c Suppose 5g = -w - 7, w + 2w + 4 = 2g. Let c = 3759 - 3758. What is the nearest to c in 0.2, w, 0.5? 0.5 Let w = -1714 + 1700. Which is the nearest to -0.2? (a) w (b) 5 (c) 2 c Let r = -7 - -9. Let i = r - 2.03. Let y be 16 - 15 - 2/4. What is the closest to y in 0.4, -4, i? 0.4 Suppose -2z = l - 3, -z + 6z - 18 = l. Which is the closest to 0.1? (a) l (b) 8 (c) 2/15 c Let s = 778 + -723. What is the nearest to s in -0.2, -3, -1/8? -1/8 Let p = -0.03 + -0.29. Let h = p - 0.68. What is the closest to h in -0.1, -1/2, 1? -1/2 Let s = 230.04 - 230. What is the closest to -1 in s, 5, 0.03? 0.03 Let k be -10 - (1 + -4)1. Let j be (-2)/k - (-6)/(-21). Let n be (-20)/8(-1)/(-5). What is the nearest to -1 in -0.2, j, n? n Let p = -3.329 - -0.029. Let l = p - -4.8. Which is the nearest to -0.2? (a) 0.4 (b) -4 (c) l a Let x = -1.9 + 1.6. Let l be 152/(-238) + (-2)/(-7). Which is the closest to l? (a) -0.5 (b) -2/3 (c) x c Let s(y) = 5y + 38. Let f be s(-9). Let x = -1.6 - -0.6. What is the nearest to x in 4, 2/5, f? 2/5 Let j = 59 - 58. Which is the closest to j? (a) 0 (b) -4 (c) -0.05 a Let k be (0 - 1) + (-3)/(-9). Let h be 39/15 + 4/(-40). Which is the closest to 1/2? (a) h (b) k (c) 0 c Let r = 505 - 503. Which is the nearest to 3? (a) r (b) -0.11 (c) 0.5 a Let i = 405 - 464. Which is the nearest to -2/3? (a) 0 (b) -4 (c) i a Let t = -14.18 + 0.18. Let y = -13.9 - t. Let u = -2 + 0. Which is the closest to u? (a) -1/2 (b) -2/7 (c) y a Suppose -3c + 2c + 18 = -5h, 0 = h + 5c - 12. Let d(g) = g*2 + 8g + 14. Let m be d(-3). Let n = 21 - 21. What is the nearest to n in 0.2, m, h? 0.2 Let n = -9.2 + 0.2. Let x be (-2165)/63 + (-8)/(-36). Let k = x - -34. Which is the closest to n? (a) -0.4 (b) -4 (c) k b Let i = -114.3 - -114. What is the closest to -1 in -36, i, -1? -1 Let t = -0.023 - -0.023. Let w = -5.1 - -5. Let y = -0.1 - w. Which is the closest to y? (a) t (b) -2/11 (c) 0.4 a Let h = -172.9 + 168.9. Which is the nearest to 0? (a) -0.5 (b) 1/5 (c) h (d) 2/9 b Let f be ((-9)/(-2) + -3)/6. Let t = -24 - -11. Let m = t - -41/3. Which is the closest to m? (a) f (b) -2 (c) -4 a Let l = -0.369 - 0.631. Let d = -2 - -2. Which is the closest to 1? (a) l (b) d (c) -2/9 b Suppose -55 = 22d - 33d. What is the closest to 1 in 3, 125, d? 3 Let d = -0.1142 + -1.9198. Let f = d + 0.034. What is the nearest to 1 in 2/17, -1/20, f? 2/17 Let z = 7.76 - 8. Let q = z - 0.06. Let n = -41/180 - -1/36. What is the closest to q in n, 0.3, -4? n Suppose -q + 2 = -n, -4q = -q + 2n - 1. Suppose -7z + 11 = -24. Suppose 3l - 1 = -4, s = -z*l - 9. Which is the closest to q? (a) s (b) -0.4 (c) 2/13 c Let j = 51 - 51. Let v be 2 + 3/(-3 + 2). Which is the nearest to j? (a) v (b) 3/2 (c) -2/5 c Let h = -0.3 + 0. Let d = -1.8 - -1.5. Let k = d + -2.7. Which is the nearest to 2/5? (a) k (b) -0.1 (c) h b Let k = -702 - -699. What is the nearest to 2/3 in 0, 3/5, k, -4? 3/5 Let v = -38.2 + 38.6. Which is the nearest to 4? (a) -2/17 (b) v (c) 5 (d) 0 c Let q = -733 + 3663/5. What is the nearest to q in -5/3, -5, -0.3, 0? -0.3 Let k be (36/54 - (-94)/(-15)) + 6. Which is the closest to 0.2? (a)	{ "pile_set_name": "DM Mathematics" }
l(-15). Suppose 2z - 7 = -z + pj, -1 = j. Which is the closest to -0.1? (a) z (b) -2/9 (c) -0.06 c Let n = -643 - -642.6. Which is the nearest to -0.23? (a) n (b) 0.2 (c) 1 (d) 5 a Let v = 1/24 + 1/8. Suppose 2h + 74 = -2y, 2h = -2y - 2y - 76. Let o be (h/(-8) - 5)6. Which is the closest to 0.1? (a) v (b) 0.5 (c) o a Let r = -0.06 + 2.06. Let o = 5735/4 - 1433. Which is the closest to 1? (a) r (b) o (c) -3 b Let w = 3 + -6. Let n = -2.9 - w. Let l = 1.013 - 0.013. Which is the closest to l? (a) n (b) 3 (c) 1/6 c Let u = 1.1 + -1. Let d = -9 + 5.02. Let q = -0.02 + d. What is the nearest to u in q, -3, -0.1? -0.1 Let o = 3.08 - 6.08. What is the nearest to -483 in -0.4, -5, -1, o? -5 Let d be 148/20 + -4 + (-4)/10. What is the nearest to 0 in -45, d, -4/7? -4/7 Let a = 75.9 + -81.27. Let j = -0.37 - a. Let i = -0.43 - 0.07. What is the closest to j in 0.2, i, -5? 0.2 Let w = 0.3 - 0.3. Let q = 166/333 - 2/37. Which is the nearest to w? (a) q (b) -3 (c) 1/7 c Suppose 5z - 30 + 80 = -y, 30 = -3z - y. Let q be ((-2)/z)/((-9)/15). Suppose 4h + 10 = 2h. Which is the closest to q? (a) 2/7 (b) -2/11 (c) h b Let s = 15/4 - 61/20. Let c = 13/10 - s. Let f = 393.2 + -391.2. What is the closest to c in f, -5, 2/7? 2/7 Let j = -24.9 + 24.84. Which is the closest to -0.4? (a) j (b) -0.1 (c) -5 b Let p = -280 + 3642/13. Which is the closest to 2/7? (a) p (b) -3/5 (c) -3/7 a Let f = -13.968 - -14. Let q = f + -0.132. Which is the nearest to q? (a) 0.2 (b) 2/5 (c) 0 c Let n = -0.00812 - 0.99188. Let g = -3.2 + 3. Let s = g + 0.1. What is the closest to n in -3/2, 7, s? -3/2 Let d = 7.91 - -0.09. Let o = d + -8. Let w = 4.6 + -5.1. Which is the closest to o? (a) w (b) 0.1 (c) 0.4 b Let t = -1.051 + 0.051. Let f = 2 - 2. Let l = -0.1 + 0.5. Which is the closest to t? (a) l (b) 3 (c) f c Let p = 637.13 - 637. What is the nearest to -2/13 in p, 2, 5, 4? p Let s = -0.9041 - 0.0439. Let u = s + -0.052. Let r = 13 + -18. Which is the nearest to -2/3? (a) -4 (b) r (c) u c Let r be 8/(-20)21. Suppose -2v = -y + 20, 2v + 6 = 2y - 26. Let n be ((-8)/y)/(16/(-12)). Which is the closest to n? (a) r (b) 0 (c) 0.5 c Let p = -1.604 - -2.804. Let z = -3.91 + -0.09. Which is the closest to p? (a) 0.4 (b) z (c) -0.3 a Let v = 0.03 - 3.03. Let y be ((-4)/((-168)/10))/4. Let d = 3/28 + y. Which is the closest to d? (a) 3 (b) 2/7 (c) v b Let v = -78.7 + 79. What is the nearest to -2 in -5, v, -6? v Let j = -0.1 - 0.9. Let a = 5.58 + -6. Let q = 0.82 + a. What is the closest to j in q, 3, -2? -2 Let n = -1.2 - -1.7. Let x = 9.152 - 0.152. Which is the closest to -0.1? (a) -0.3 (b) x (c) n a Let o = 4105.02 - 4105. Let w(z) = z - 3. Let i be w(3). Which is the closest to -1? (a) 5 (b) i (c) o b Let s = 0.8 + 2.2. Let g = 38 - 38.1. What is the nearest to g in -0.4, -1/7, s? -1/7 Let t = -233 + 233.3. Let m = 0.1 - -1.9. Let h = 3 - m. Which is the nearest to 0? (a) 1/8 (b) t (c) h a Let h = 20 - 22. Let d = -1.95 - h. Let q = -0.05 + d. Which is the closest to -2/11? (a) 2/11 (b) -5 (c) q c Let y = -21 - 125. Let g = y - -141. What is the nearest to 5/6 in g, -3, 2/7? 2/7 Let h = 1100 - 1099.8. Suppose 0 = -q - 2q + 12. Which is the nearest to 1? (a) h (b) q (c) -0.35 a Let p = -0.93 + 1.13. Let b = 1 + -0.9. Let z = -1.1 + b. What is the closest to p in z, -4, 0.4? 0.4 Let p = 2/203 - -8/29. What is the closest to p in 0.04, 0.1, 2? 0.1 Let h = 27.8 + -28. Let z = h + 0. What is the closest to -2/5 in z, -2, 0.3? z Suppose 4s - 4t = -116 + 24, -5s = -3t + 111. Let v = s + 27. Suppose o + 5 = vo. Which is the nearest to -0.2? (a) 5 (b) o (c) -3 b Suppose 2k - k = 0. Let m = -1 - k. Let t = 60 + -59.6. What is the nearest to 2 in m, -0.1, t? t Let t(k) = k. Let n be t(-1). Which is the closest to n? (a) -4 (b) 0.1 (c) -2/11 c Let n(y) = 8y - 22. Let h be n(4). Let k = 11 - h. Let v = -7 - -3. Which is the nearest to k? (a) 1/8 (b) v (c) -5 a Let g be (-50)/(-182) + 17 + 3942/(-234). Which is the nearest to 1? (a) 3 (b) g (c) -2 (d) -2/5 b Let l = 30.3 - 30.3. Which is the closest to l? (a) 2/7 (b) -2/23 (c) 0.4 b Let k = 0.07 + -0.07. Let p = k + 0.3. Let x = 37 - 35. What is the nearest to 2/3 in -1/4, p, x? p Let r = -1509 + 1485. What is the closest to r in -0.3, 0.2, 0.03? -0.3 Let n = 0.75 + -0.55. Let r = -0.1 + -2.9. Let h = r + -1. What is the nearest to -1 in h, n, -1? -1 Let z = 403 - 399. Which is the nearest to 1? (a) 1/6 (b) -4 (c) z (d) -1 a Let z be -2 - 5/(70/(-24)). Let y = -6.26 + 2.1. Let h = 0.16 + y. Which is the closest to -1? (a) h (b) 1 (c) z c Let p = 1.98 - 6.98. Which is the nearest to -1/2? (a) 1/17 (b) p (c) 1/3 a Suppose 2f - 3 = -7. Let v be (-3)/(1 - (f + 4)). Let o(t) = -t*2 - 11t - 1. Let p be o(-11). Which is the nearest to -1? (a) 2 (b) v (c) p c Let g be (-6)/(-15)-11 - -4. Which is the nearest to g? (a) -22 (b) 0.06 (c) -4 b Let x = 0.263 - -3.737. What is the closest to x in 2/11, 5, -0.4? 5 Suppose 3q = -2q - 2m + 18, -q = -4m + 14. Which is the nearest to 1? (a) -0.2 (b) 0.3 (c) q b Let m = 5 - 2. Let f be 2/5 + 0/(-2). Let l(s) = 3s*3 + 10s*2 + 7s + 10. Let x be l(-3). Which is the closest to f? (a) -1 (b) x (c) m a Let r = -7 - -14. Let i(f) = 4f - 23. Let u be i(r). What is the nearest to 0 in u, -2/11, 3? -2/11 Let r = 30.8 + -33.8. What is the closest to 2/3 in r, 2/5, -2, 17? 2/5 Suppose 9i + 10i - 19 = 0. What is the nearest to 2 in -0.1, -0.05, i? i Let x be (4 - (-328)/(-84))3. Let j = 10.3 - 10.7. Which is the closest to 1? (a) j (b) x (c) -2 b Let r = -11 - -7. Let k = -20849/6 + 3475. What is the nearest to 0 in k, -2, r? k Let d = 4 - 9. Let a(u) = -u + 11. Let y be a(7). Suppose -2o = -6f + 5f - 3, 12 = yo - 4f. What is the nearest to o in d, -3, 2/11? 2/11 Let y = -1677 - -1674. Let f = 0 + 0. Which is the closest to y? (a) 3 (b) f (c) -2/17 c Let o = -587 + 585. Which is the closest to -6? (a) 3 (b) o (c) -1 b Let j = -202 - -205. Let h = 5 - 5. What is the nearest to h in 1, 2, j? 1 Let y = -6.7 - 34.3. Let z = y + 41.2. Which is the nearest to -1? (a) -5 (b) 0.5 (c) z c Let w = 5 + -5.4. Let s = 119/6 + -39/2. Let y = 6 - 7. What is the nearest to y in s, -0.2, w? w Suppose -3t = -5d + 3, 3d - 69 = -2t - 90. Let h = -1 + 3. Which is the nearest to t? (a) h (b) 3 (c) -0.3 c Let k = 13.82 - 14. Let o = -0.72 + k. Let v = o - -0.8. Which is the nearest to -1/3? (a) v (b) -0.2 (c) -0.5 b Let w = -0.7 + -5.3. Suppose 0 = -5t + 69 + 31. Let x be 6/8 + (-5)/t. Which is the nearest to -2/3? (a) w (b) x (c) -0.1 c Let v be ((-19)/(-5))/((-2)/(-10)). Let h = 59/3 - v. Which is the closest to 2? (a) h (b) 5 (c) -0.2 a Let u = 111.2 + -111. Which is the closest to u? (a) -0.4 (b) -9 (c) 0.5 c Let w = -29.1 + 29.2. Let g = 8 + -8.5. What is the closest to 1/3 in -2, g, w? w Let h = -5 + -6. Let l = h + 15. Let z = -3830 - -3830.3. Which is the closest to z? (a) 5 (b) 1 (c) l b Let u = -89/42 + 11/6. Suppose 0 = 4g + 2p + 2, -2g + 4p + 19 - 15 = 0. Which is the nearest to -2? (a) u (b) 0.4 (c) g a Let k(d) = 5d + 169. Let f be k(-33). Which is the closest to -0.3? (a) -0.3 (b) 3 (c) f a Let x(n) = -n + 3. Suppose 10 = -j + 4g - 2, -5g = -5j - 15. Let y be x(j). Suppose -3 - y = 2p. Which is the nearest to -1? (a) -5/4 (b) -0.2 (c) p a Let k = -0.341 + 0.041. What is the nearest to -6/5 in k, -1, 0.1, -2/5? -1 Let v = -3.06 + 0.06. Let l = v - -7. Let q = -34.6 - -34.5. Which is the closest to q? (a) l (b) -1 (c) -1/4 c Let z = -12.1 - -12. Let t = z + 0.4. Let j = -31/161 + 11/23. Which is the closest to j? (a) t (b) -0.4 (c) 5 a Suppose 1 = 5u - 9. Suppose 0 = -6*h + 24. Let s be 4 - h - u/(-5). What is the nearest to 1/3 in s, -3, -0.1? s Let j = -2383 - -50045/21. Which is the closest to 1? (a) 26/3 (b) -2/21 (c) -4 (d) j d Let z be (-1 - -1)/(-1) + -3. Let j = -119 + 134. Let t = j - 17. What is the nearest to 0 in t, 0.1, z? 0.1 Let l = 576 - 574. What is the closest to l in -1/15, 0.5, 1? 1 Let f = 75 + -74.8. What is the closest to 0.06 in -4/7, f, -0.2? f Let s be (6/9)/((-4)/(-30)). Let z = 0.021 + 0.079. What is the	{ "pile_set_name": "DM Mathematics" }
4/3 What is the value of ((-14)/3)/(1842/(-2763))? 7 What is the value of (172/(-688))/(6/(-16))-181? -12 Evaluate ((-20)/10)/(((-11718)/9)/(-21)). -1/31 Calculate (242/605)/((-6)/15)-15. 15 Calculate (-33)/(-55)(-120)/(-8). 9 14/4(-16)/565 -5 What is the value of ((-6)/48)/((-1)/(-4))14? -7 ((-2)/32)/(-4)(-15)/(-140) 1/28 What is the value of (-3808)/(-408)(-18)/12? -14 What is the value of ((-952)/(-714))/((-3)/(-9))? 4 Evaluate 180/(-216)(-6)/(-4). -5/4 What is the value of 1/(-1)(-105)/(-21)? -5 Evaluate ((-1)/12)/(((-48)/(-12))/60). -5/4 Calculate 038/(-456)6. 0 Calculate -3(148/(-1110))/((-3)/20). -8/3 Calculate (56/(-70)1)/(182/35). -2/13 ((-49)/14)/((-27)/108) 14 What is (21/(-28))/(36/336)? -7 What is the value of (1218/5684)/(3/12-3)? -2/7 Evaluate (-3)/(-84)((-2)/(-3))/((-19)/(-38)). 1/21 Evaluate ((-448)/8)/(49/(-14)). 16 What is the value of 6/(-4)50/((-125)/(-5))? -3 Evaluate -59/(-4)13/(780/(-32)). -6 What is (-24)/(-114)16/(-64)? -1/19 What is 95/1786(-88)/110? -2/47 What is (-6)/7(147/280)/((-72)/(-60))? -3/8 What is -231(-86)/27093? 22 Calculate (24/(-15))/((1173/170)/(-69)). 16 What is the value of (754/(-87))/((-10)/4148/555)? 13 What is (-9405)/5016(-4)/(-20)? -3/8 (-72)/(-126)7-1 -4 Calculate ((-2)/6)/(40/400). -10/3 Evaluate 1000/(-100)3/5. -6 What is the value of (2/2)/(-5)12705/(-231)? 11 What is ((-1)/2)/(-5(-13)/1690)? -13 What is (-36)/(-16)(-7)/7(-16)/(-4)? -9 What is (-54)/(-162)11/(22/(-72))? -12 Calculate ((70/8)/35)/((-11)/(-16)). 4/11 Evaluate -4((-13)/26)/(((-48)/8)/(-24)). 8 ((-9)/1)/((-63)/9524) 34 Evaluate 1393/9952/7. 2/5 ((-6)/4(-208)/117)/((-2)/(-3)) 4 Evaluate ((-2)/(-2))/((-348)/10788). -31 What is the value of 21721/(-3103)(-22)/42? 11/3 What is the value of 54/792(-8)/(-3)? 2/11 What is (7/((-42)/4))/((26/33)/13)? -11 Calculate ((-36)/36)/(-12/2). 1 Calculate 4/((-16)/30)-7(-32)/(-1008). 5/3 Calculate (170/510)/(1(-1)/12). -4 (10/4)/((-37)/(58608/(-1260))) 22/7 What is the value of (16/(-10))/(3118/2790)? -8 What is the value of (27/(-72))/(40/(-32))30/(-5)? -9/5 (((-2)/1)/((-6)/(-3)))/((-5)/(-15)) -3 What is ((-10)/(-45))/(91/117)? 2/7 Calculate (1417/(-8092))/(2/(-4)). 1/17 Evaluate 10560/627019/2. 16 336/44819-4 -27 ((12/(-8))/((-3)/(-2)))/(78/(-13)) 1/6 Evaluate (9/4)/(((-11312)/64)/101). -9/7 What is the value of 2/16-4(-12)/(-30)? -1/5 Evaluate ((-24)/30)/((-17)/((-1020)/(-36))). 4/3 Calculate ((-6)/(-2)292/1606)/(1/22). 12 What is the value of ((-1354)/23695)/(4/14)? -1/5 What is the value of ((-1)/(-1))/(107/(25466/(-68)))? -7/2 Evaluate (942/(-2355))/(((-1)/(-35))/((-1)/(-1))). -14 Calculate (-245)/(-4900)(-12)/(-2)(-3)/(-9). 1/10 What is the value of ((-6)/((-408)/323))/(((-36)/6)/24)? -19 168/(-2380)((-100)/30)/2 2/17 What is the value of (-2)/(-12)(-9)/(-2)? 3/4 Calculate ((-2)/1)/((-1034/85)/(-38)). -19 What is (9010/2703)/((-16)/(-108)6/4)? 15 Calculate (2/2)/((198/(-18))/(-44)). 4 What is the value of (-310/175)/((-54)/(-18))? -2/35 Evaluate ((-14)/(-7))/(-3(-6)/(-36)). -4 Calculate 327/21808/2. 3/5 What is (328/3075)/((-16)/(-20))? 2/15 Calculate (-3)/(-27)-1(-9558)/19647. 2/37 (16/112)/(((-30)/(-42))/5) 1 What is the value of (4/40)/(88/16(-12)/33)? -1/20 (1372/392)/(42/(-96)) -8 What is the value of 62/21742/(-78)? -2/13 What is the value of ((-50)/25)/1812/(-2)? 2/3 Evaluate (28/6)/(16/3214/(-21)). -14 What is the value of (-2)/((-4)/330/220)? 11 Evaluate 16/(-6)(1520/(-50))/(-1). -16 Evaluate -3518/240-8. 9 Evaluate (3/5)/((-11628)/(-1140)). 1/17 What is the value of (-20)/300(-16)/(-16)? -1/15 What is the value of (12/(-22))/(205/(-410))? 12/11 (-5)/(-5)4/(-40)-5 1/2 Evaluate (-2)/(-12)(-10)/(-35)(-77)/(-44). 1/12 Evaluate (-12(-1)/24)/(403/(-52)). -2/31 What is (2808/(-5616))/((-34)/(-8))? -2/17 What is (4/6)/((-542)/813)? -1 Evaluate (-321)/(-2996)(-64)/(-12). 4/7 What is the value of (-263/(-4))/(69/92)? 26 What is 3/(3/(-3))-6(-725)/(-450)? 29 Calculate 33/264-203/(-20). 3/8 What is (12/(-9))/((3/9)/((-13)/(-3094)))? -2/119 Calculate 50/12(-49632)/10340. -20 What is ((-369)/18)/41(-12)/(1-2)? -3 What is the value of ((-4)/(24/6)-24)/((-4)/(-4))? 24 What is (1/2)/1(-1120)/((-980)/(-49))? -28 What is the value of 45/195-39(-6)/36? 3/2 What is the value of (-2(-15)/(-1050))/(2/(-28))? 2/5 What is ((-3)/4)/(630/420)? -1/2 What is the value of (4/(-2))/((-810)/45)(-6)/(-2)? 1/3 Calculate 172/2584/(64/6). 1/4 What is -1211/(-1386)3? 2/7 What is 90/25(-2650)/(-636)? 15 Calculate (-19)/570180/40. -3/20 Evaluate (99/(44/(-4)))/((-5)/5). 9 What is the value of ((-170)/6)/(((-3200)/(-120))/(-16))? 17 What is the value of ((-11)/(693/14))/((224/12)/8)? -2/21 (-10)/4((-84)/63)/(-2) -5/3 Evaluate ((-4)/(-2))/(20/70(-784)/64). -4/7 Evaluate (-9)/6-8516/120. 17 What is the value of (9/27)/(10/420)? 14 What is the value of 1136/85230/(-8)? -5 Calculate ((-1296)/(-136))/(-9)108/486. -4/17 What is ((-183)/4026)/((-2)/(-4))? -1/11 Evaluate 39110/600642/(-2). -15 What is the value of (-7)/(-14)(1-2)/((-99)/(-66))? -2/3 What is (30/140)/((-12)/((-2)/(24/(-126))))? -3/16 2-7((-6)/42)/(16/(-28)) -7/2 Calculate 28/70-5((-3)/(-20))/(-3). 1/10 What is 30/(-2)(-432)/1080? 6 What is the value of (9678/3226)/((-4)/3)? -9/4 What is ((-10060)/(-4527))/((-3)/27)? -20 What is the value of (104/884)/((-4)/(-442))? 13 What is the value of (6/(-5))/(3/10)22/(-8)? 11 226/((8/(-3))/(30/45)) -13 What is the value of (30/(-9))/(12/(-16)(-8)/18)? -10 Evaluate ((-4)/42)/((-6)/(-27)). -9 Evaluate (-4)/7(-532)/76. 4 Calculate (60/32)/((-50)/400). -15 Evaluate ((-22)/22)/((-1)/(-13)). -13 Calculate ((-156)/21)/((-5)/(-20)160/(-140)). 26 What is the value of (-222)/1998(24/2)/1? -4/3 What is the value of ((-5)/5)/(-1)18/(-6)3? -9 Calculate ((-17)/17(0/(-9))/3)/(-1). 0 What is (403/(-8060))/(2/(-8))? 1/5 Calculate ((-5)/35)/(-996/2268). 3/8 What is the value of (-2)/672/120? -1/5 What is the value of (3(-5)/8)/((-53)/((-1696)/(-72)))? 5/6 What is the value of (((-638)/(-22))/(-58))/(-212/32)? 2/3 What is the value of ((81/18)/(-9))/((-5)/(-170))? -17 Calculate ((-18)/(-9))/((-40)/(-5)). 1/4 (-83/6)/(14/5) -10/7 What is 3/103/(-8)(-6160)/38115? 1/55 6/(-4)2/6322/(-7) 23 What is ((-27)/15)/9(-55)/(-2)-2? 11 What is the value of (6/(-15))/(127/90)? -4/3 ((20/(-35))/(-1))/(((-480)/56)/(-4)) 4/15 (833/(-44))/26 -3/13 What is the value of (16/(-12))/((-160)/903)? 1/4 Evaluate 8/(((-192)/(-18))/16). 12 What is (-26520)/(-7956)(-70)/(-8)(-6)/(-5)? 35 What is the value of (-27)/(-6)39/(-18)(-1400)/650? 21 Calculate 54/(-468)12/9. -2/13 What is the value of 4(3280/(-192))/41? -5/3 What is ((-3)/(-5))/((-1)/10(-472)/708)? 9 Evaluate (12/(-10))/(54/(-360)-1). -8 26/169300/50 12/13 What is the value of (-10)/60-1818/(2/1)? 27 Evaluate 15/(-2730)47. -2/13 Evaluate (-282)/(-376)(-464)/(-12)-1. -29 ((-1)/(1/10))/(306/51) -5/3 928/348(-18)/56 -6/7 Calculate ((120/10)/6)/(30/(-3)). -1/5 What is (-2002)/2852/(-169)? 22 Calculate (-14)/462673/2673. -21 What is the value of 1/(-5)(-435)/(-232)? -3/8 What is the value of (9/39)/(1016/9906)? 9/4 Evaluate ((-11)/11)/((4121/44)/(-3)). 3/11 What is the value of -3(450/27)/5? -10 What is the value of ((-498)/3237)/((-24)/(-26))? -1/6 Evaluate (((-1)/10)/((-2)/12))/((-2)/10). -3 What is the value of ((-7)/(-21))/((-27)/(-1215))? 15 What is (-2)/(76/(-2))(-8208)/(-1728)? 1/4 Evaluate (24/(-224))/((-1)/252). 27 What is (2/(-16)10)/(251/(-8))? 2/5 What is 2/(((-112)/(-36))/(-14))? -9 What is the value of 20/(36300/9)(-30)/9? -2/121 (11/((-627)/6))/(-5(-13)/(-65)) 2/19 (33/12)/((-4)/(-32)6/(-3)) -11 72/(-3)(-45)/(-30) -7 What is 7/(-70)966/69? -7/5 Calculate 1960/(-70)(-1)/(-8). -7/2 (35/(-2))/(((-5805)/86)/(-135)) -35 What is ((-3)/(-1))/(((-1251)/695)/(42/(-10)))? 7 What is ((-7560)/1350)/((-4)/(-10))? -14 Calculate (1131/(-58))/390/(-1). 0 Evaluate 5/1(4/(-5))/(112/(-28)). 1 What is -10((-833)/147)/(10/3)? 17 168/(-9)(-3)/(-60)(-4056)/(-2704) -7/5 Evaluate (986/(-153))/29(18/(-22))/(-3). -2/33 Evaluate ((1813/(-42))/37)/((-7)/3). 1/2 Calculate (56/(-798))/((28/70)/((-27)/15)). 6/19 What is (12/(-8))/(3*(-24)/(-16))? -	{ "pile_set_name": "DM Mathematics" }
and 3. 1.2 What is the product of -0.14 and -13.5? 1.89 Product of -163 and -0.06. 9.78 83.24 332.8 Product of 21.68 and 13. 281.84 Work out 0.4 -22. -8.8 -10.51 -10.5 -3 times 681 -2043 Multiply -534 and -6. 3204 Multiply -45 and -0.9. 40.5 Work out -0.1321 -4. 0.5284 Work out -33 * -5. 165 Work out -0.4 * 350. -140 What is the product of 6 and -0.19? -1.14 Calculate -0.14-22.8. 3.192 Multiply -0.24 and -1.39. 0.3336 Product of 0.193 and -0.3. -0.0579 Calculate 0.128. 2.8 Multiply -105 and 1. -105 Product of -147 and 0.1. -14.7 What is -0.05 times 0? 0 Calculate 2717. 1434 Calculate -4840.2. -96.8 4 times 736 2944 Calculate -10.506. -0.506 Product of -3031 and -0.03. 90.93 0.204 times -0.01 -0.00204 What is the product of 1 and 740? 740 2 times -145.3 -290.6 What is 159.07 times 0.5? 79.535 -237 2 -474 -1.878 * -3 5.634 -0.1-0.58 0.058 -0.1869-0.2 0.03738 What is 5 times -0.0123? -0.0615 0.04435 0.2215 4.8 times -5 -24 Work out 3 -1770. -5310 Work out -2619 * 0.2. -523.8 Work out 529 * -5.7. -3015.3 Multiply -2.2 and 0.034. -0.0748 -215 times -0.5 107.5 Multiply -61 and -0.04. 2.44 Multiply -0.1 and -4.9. 0.49 What is 31 times 0.041? 1.271 -5-7.4 37 3901 times 0 0 0.2 614 122.8 Work out -323 * 3.9. -1259.7 Multiply 0 and 1.4. 0 What is -68 times -0.03? 2.04 What is 1.34 times 2? 2.68 Calculate -5-45. 225 -0.2 times 79 -15.8 Calculate 0.033-6. -0.198 Multiply -0.9 and 13.24. -11.916 984-32 -31488 Multiply -0.5 and -5.6. 2.8 Calculate 0.420.2. 8.08 Work out 15 * 11. 165 What is 3 times -203? -609 Product of -1 and 3522. -3522 Work out -1.2 * -64.5. 77.4 Calculate 55.05. 25.25 Calculate -11267. -1267 Product of 3 and 617. 1851 Multiply 0.55 and 6. 3.3 What is the product of 0.4 and 0.002? 0.0008 297-0.02 -5.94 -0.46-0.08 0.0368 What is -0.5 times -8.2? 4.1 Multiply 2.9 and -6. -17.4 Calculate 382.7. 102.6 Product of -1 and -40. 40 What is 0.127 times 5? 0.635 Work out 3835 0.1. 383.5 Product of -0.008 and -0.21. 0.00168 What is the product of 89 and 3? 267 -0.134 * 0 0 Calculate 5-1.28. -6.4 Product of -0.08 and -138. 11.04 -80-0.09 7.2 What is 151.6 times 0.7? 106.12 Calculate -40.57. -2.28 Work out 0.065 0.17. 0.01105 11 times 0.07 0.77 Work out -386 * -0.5. 193 What is -71 times -46? 3266 4 times 0.06 0.24 Multiply -103 and 0.3. -30.9 What is the product of 5 and -2222? -11110 What is the product of -0.1 and -10? 1 What is the product of -0.0444 and -0.1? 0.00444 Multiply 0.3 and -0.07. -0.021 -525-1 525 What is 9 times -201? -1809 -4-13 52 Calculate -82-13. 1066 Calculate -5-0.23. 1.15 Work out 1.92 * -4. -7.68 Work out 0.2 * 130. 26 -106-1 106 -0.4 times 0.44 -0.176 -0.784 -0.3 0.2352 -0.36-0.17 0.0612 Product of 0.3 and -19. -5.7 -16 -0.6 9.6 What is 0.05 times 27? 1.35 95 * 82 7790 Multiply -7 and -163. 1141 What is 0.7 times -82? -57.4 Product of 0.05 and 1073. 53.65 0.3862 0.772 Multiply -0.8 and 1.7. -1.36 Work out -17 -1. 17 0.04310 0.43 Calculate 0.324. 7.2 153-66 -10098 1190-7 -8330 Calculate -17.6-0.6. 10.56 What is the product of -26 and 0.05? -1.3 Work out -5 -2908. 14540 What is the product of 0.5 and 75? 37.5 What is the product of -0.1 and 0.254? -0.0254 What is -0.4 times -533? 213.2 Work out -3 * 384. -1152 -1.7 * -17 28.9 What is 47 times -0.5? -23.5 What is -167 times -6.9? 1152.3 Work out 120 * -0.2. -24 Work out -3507 * -0.5. 1753.5 What is the product of 229 and -0.5? -114.5 What is the product of -5 and -34? 170 0.09 * 0.4 0.036 What is -0.5 times 0.205? -0.1025 Calculate 2259. 518 Calculate -630.2. -12.6 Multiply -0.06 and 12. -0.72 -4.1 * 0.03 -0.123 -0.36 times 3 -1.08 -0.07 times 11 -0.77 -89-0.3 26.7 Work out 0.9 4. 3.6 Calculate -0.22688. -537.6 What is 0 times 215? 0 What is the product of -0.3 and -0.1? 0.03 Work out -2 -5.5. 11 What is -4 times 59? -236 Calculate 82.7-0.2. -16.54 What is 1946 times 0.1? 194.6 What is the product of -0.4 and 26.05? -10.42 Work out 3 0.04. 0.12 Multiply 37.23 and 4. 148.92 Calculate -1.290.2. -0.258 Work out 3 -77. -231 What is -0.86 times -14.1? 12.126 What is -2040 times 4? -8160 Calculate -4330.4. -173.2 3-1 -3 0 times -8579 0 Work out 151 * 4. 604 What is 1.6228 times -0.2? -0.32456 What is the product of 0.4 and 8.2? 3.28 Product of 777 and 0.2. 155.4 Work out 5 * 116. 580 Calculate -0.10.083. -0.0083 0.5 -1758 -879 0.1 times 12 1.2 Multiply 7 and -4.65. -32.55 Product of 183 and -5. -915 -0.6 times 0.4 -0.24 2 times 811 1622 -41 times 12 -492 Calculate -23299-4. 93196 -1 times 12 -12 3.9160 0 What is 0.8 times 82? 65.6 Multiply 1264 and -4. -5056 What is -2 times -0.976? 1.952 0.30.00312 0.000936 1-5.392 -5.392 Calculate -0.182.1. -8.21 -4 times -7.8 31.2 5.5 times -7 -38.5 0-50 0 What is the product of 4 and -1.7? -6.8 Calculate 1030-0.2. -206 Work out -55 -102. 5610 Work out 202 * -9. -1818 Calculate -0.6382-0.5. 0.3191 Calculate 0.0417-0.2. -0.00834 Calculate -3347. -1041 4 40 160 Work out -7.2 * -0.5. 3.6 Work out -0.7 * -0.026. 0.0182 Work out 49 * 0.82. 40.18 19968 * 0.5 9984 Calculate 1161. 671 0.058 times -0.201 -0.011658 Work out -7866 -3. 23598 74.3 * 5 371.5 -0.1-10 1 123161 12316 Calculate -7177-0.3. 2153.1 What is -585 times 0.2? -117 Work out 0.2564 -3. -0.7692 What is the product of 0.04 and -18? -0.72 Product of 1.2 and 0.0004. 0.00048 4448 * 2 8896 Multiply 0.1299 and -3. -0.3897 Multiply 1.5 and -0.23. -0.345 -0.1013 times -0.1 0.01013 What is the product of -4 and 1.01? -4.04 What is -2 times 0.73? -1.46 Work out 0.023 * -22. -0.506 Work out -0.15 * 36. -5.4 -83-0.32 26.56 Calculate -72-2. 144 20.0477 0.0954 What is -0.6 times -0.1? 0.06 What is -0.086 times 2? -0.172 -55.087 -25.435 What is -2 times -47? 94 Multiply -0.8 and -24. 19.2 Calculate -2120.4. -84.8 -0.05 times 0.5 -0.025 -0.4 0.02896 -0.011584 216 32 0.21816 3.488 12 * -3.6 -43.2 Product of 171 and 0.14. 23.94 What is 0.2 times -0.083? -0.0166 What is -1531 times -0.3? 459.3 Work out 6 * 0.655. 3.93 -4 * 0.92 -3.68 What is 16.56 times -0.3? -4.968 8.218 147.6 -460.03 -1.38 What is 0.9 times 0.038? 0.0342 Work out 5 * -0.0355. -0.1775 What is 0.24 times 70? 16.8 Multiply 15.326 and 0.5. 7.663 What is 0.0533 times -0.7? -0.03731 Product of -9 and 53. -477 0.15-113 -16.95 Product of 0.5 and 25. 12.5 -41 times -0.07 2.87 Product of 163 and -0.057. -9.291 Calculate -8301.7. -1411 Product of 60 and -5. -300 -0.4 * 2.37 -0.948 -8.3 times -1.3 10.79 Multiply -0.1 and -15.9. 1.59 Multiply 42 and -2. -84 Calculate -0.0537-0.2. 0.01074 -0.01 times 99 -0.99 40.22 0.88 What is -15 times -0.79? 11.85 What is -0.02 times 0? 0 Calculate -598. -490 -0.15943 -3 0.47829 0.2 times 1166 233.2 Calculate 0.2976. 195.2 What is the product of 0.5 and 28.8? 14.4 0.5 times 64 32 1 -0.499 -0.499 Calculate -277. -154 Calculate -0.34021. -1206.3 What is the product of -246.1 and -0.5? 123.05 Multiply -0.51 and 32. -16.32 Multiply -1120 and -8. 8960 -0.02 * 67 -1.34 0.5 times 10.8 5.4 Calculate 0.3463. 138.9 Work out 0.6 -15. -9 Product of -1.57 and -3. 4.71 Calculate 6215. 930 Work out 3 27. 81 What is the product of 0.06 and -0.6076? -0.036456 -0.088 times 1.7 -0.1496 Work out 0.4 * 4382. 1752.8 40.123 0.492 9556 -0.3 -2866.8 0.82 times 0 0 3 * 17 51 What is -13 times 0.0849? -1.1037 What is the product of -0.07 and -16? 1.12 -380.3 -11.4 Calculate 4-0.057. -0.228 -0.5 * 3235 -1617.5 What is the product of 113 and -0.1? -11.3 Product of 9 and -0.067. -0.603 What is the product of 0.4 and 1155? 462 Multiply -340 and 0.5. -170 What is the product of -0.05 and 30? -1.5 Multiply -9992 and -0.1. 999.2 Product of -0.4 and 37. -14.8 -2 * 0.39 -0.78 1123 times 0.3 336.9 What is the product of 21000 and -0.3? -6300 Product of -0.003 and 0.5. -0.0015 Calculate -0.2-1686. 337.2 Work out -1 -1775. 1775 Product of -0.01 and -0.003. 0.00003 Calculate -0.4-0.011. 0.0044 Multiply 23 and -0.5. -11.5 -8 -13 104 -0.3 * 61 -18.3 -1-0.06532 0.06532 Product of 0.4 and -387. -154.8 22.6 times -0.5 -11.3 Work out 1 386. 386 Multiply -2692 and -0.5. 1346 -226 times -5 1130 Calculate -0.1822. -0.364 Multiply -21.4 and -5. 107 Calculate -223-4. 892 Product of -0.238 and -3. 0.714 -42 * 2.5 -105 Produc	{ "pile_set_name": "DM Mathematics" }
usands digit of 3312? 3 What is the units digit of 2392? 2 What is the units digit of 7916? 6 What is the units digit of 23991? 1 What is the tens digit of 480? 8 What is the units digit of 3456? 6 What is the units digit of 3850? 0 What is the hundreds digit of 2805? 8 What is the thousands digit of 12085? 2 What is the units digit of 9247? 7 What is the tens digit of 43973? 7 What is the hundreds digit of 21802? 8 What is the thousands digit of 143620? 3 What is the units digit of 774? 4 What is the units digit of 751? 1 What is the tens digit of 170? 7 What is the units digit of 2349? 9 What is the thousands digit of 3965? 3 What is the units digit of 4348? 8 What is the units digit of 24291? 1 What is the hundreds digit of 2612? 6 What is the units digit of 3496? 6 What is the thousands digit of 119587? 9 What is the thousands digit of 1942? 1 What is the tens digit of 7363? 6 What is the ten thousands digit of 11471? 1 What is the tens digit of 3631? 3 What is the units digit of 1343? 3 What is the hundreds digit of 749? 7 What is the hundreds digit of 11368? 3 What is the tens digit of 118123? 2 What is the thousands digit of 1532? 1 What is the units digit of 108476? 6 What is the units digit of 425? 5 What is the hundreds digit of 3241? 2 What is the units digit of 1862? 2 What is the units digit of 3465? 5 What is the units digit of 94? 4 What is the tens digit of 4838? 3 What is the hundreds digit of 1256? 2 What is the hundreds digit of 7909? 9 What is the hundreds digit of 1364? 3 What is the hundreds digit of 146? 1 What is the tens digit of 4141? 4 What is the hundreds digit of 663? 6 What is the units digit of 1008? 8 What is the units digit of 406? 6 What is the hundreds digit of 15272? 2 What is the thousands digit of 38385? 8 What is the tens digit of 8050? 5 What is the tens digit of 1688? 8 What is the tens digit of 1551? 5 What is the hundreds digit of 501? 5 What is the hundreds digit of 70550? 5 What is the thousands digit of 7492? 7 What is the units digit of 116? 6 What is the units digit of 844? 4 What is the units digit of 5470? 0 What is the ten thousands digit of 60439? 6 What is the units digit of 590? 0 What is the tens digit of 12625? 2 What is the units digit of 15652? 2 What is the thousands digit of 33505? 3 What is the ten thousands digit of 94004? 9 What is the tens digit of 1458? 5 What is the units digit of 212? 2 What is the ten thousands digit of 20352? 2 What is the tens digit of 7197? 9 What is the units digit of 784? 4 What is the tens digit of 16656? 5 What is the tens digit of 2140? 4 What is the hundred thousands digit of 142784? 1 What is the ten thousands digit of 127470? 2 What is the units digit of 13405? 5 What is the hundreds digit of 137709? 7 What is the tens digit of 62907? 0 What is the thousands digit of 162445? 2 What is the tens digit of 3680? 8 What is the units digit of 7247? 7 What is the tens digit of 3316? 1 What is the tens digit of 1381? 8 What is the units digit of 302? 2 What is the units digit of 577? 7 What is the hundreds digit of 23268? 2 What is the hundreds digit of 12139? 1 What is the units digit of 2121? 1 What is the units digit of 2192? 2 What is the units digit of 910? 0 What is the thousands digit of 18389? 8 What is the hundreds digit of 6754? 7 What is the thousands digit of 7287? 7 What is the thousands digit of 103884? 3 What is the hundreds digit of 41178? 1 What is the units digit of 16105? 5 What is the thousands digit of 1094? 1 What is the units digit of 23624? 4 What is the tens digit of 2490? 9 What is the units digit of 10475? 5 What is the units digit of 590? 0 What is the hundreds digit of 1690? 6 What is the units digit of 214? 4 What is the ten thousands digit of 35690? 3 What is the units digit of 40331? 1 What is the units digit of 670? 0 What is the ten thousands digit of 19440? 1 What is the tens digit of 8322? 2 What is the units digit of 17234? 4 What is the thousands digit of 4046? 4 What is the units digit of 332? 2 What is the thousands digit of 4103? 4 What is the hundreds digit of 1580? 5 What is the thousands digit of 31526? 1 What is the tens digit of 2870? 7 What is the hundreds digit of 518? 5 What is the hundreds digit of 12543? 5 What is the units digit of 565? 5 What is the thousands digit of 2437? 2 What is the thousands digit of 27483? 7 What is the tens digit of 16978? 7 What is the tens digit of 205? 0 What is the thousands digit of 145750? 5 What is the tens digit of 9388? 8 What is the tens digit of 659? 5 What is the tens digit of 2552? 5 What is the hundreds digit of 16065? 0 What is the units digit of 13310? 0 What is the thousands digit of 67050? 7 What is the thousands digit of 21579? 1 What is the ten thousands digit of 20201? 2 What is the tens digit of 108835? 3 What is the thousands digit of 5218? 5 What is the tens digit of 4179? 7 What is the tens digit of 355? 5 What is the thousands digit of 2032? 2 What is the units digit of 2079? 9 What is the tens digit of 8177? 7 What is the thousands digit of 2149? 2 What is the thousands digit of 2289? 2 What is the hundreds digit of 234? 2 What is the thousands digit of 3259? 3 What is the tens digit of 24? 2 What is the thousands digit of 145748? 5 What is the units digit of 25? 5 What is the hundreds digit of 960? 9 What is the units digit of 70712? 2 What is the tens digit of 17729? 2 What is the hundreds digit of 829? 8 What is the tens digit of 6656? 5 What is the units digit of 75? 5 What is the tens digit of 300? 0 What is the hundreds digit of 4292? 2 What is the thousands digit of 8037? 8 What is the units digit of 1364? 4 What is the thousands digit of 11754? 1 What is the thousands digit of 45662? 5 What is the ten thousands digit of 26138? 2 What is the thousands digit of 93881? 3 What is the units digit of 3178? 8 What is the ten thousands digit of 83332? 8 What is the tens digit of 1093? 9 What is the units digit of 20432? 2 What is the thousands digit of 1075? 1 What is the tens digit of 90359? 5 What is the tens digit of 14013? 1 What is the hundreds digit of 20402? 4 What is the thousands digit of 11159? 1 What is the hundreds digit of 1547? 5 What is the hundreds digit of 57638? 6 What is the units digit of 549? 9 What is the tens digit of 1042? 4 What is the thousands digit of 19312? 9 What is the hundreds digit of 1006? 0 What is the hundreds digit of 787? 7 What is the tens digit of 4765? 6 What is the tens digit of 1835? 3 What is the units digit of 1841? 1 What is the hundreds digit of 29892? 8 What is the ten thousands digit of 65260? 6 What is the thousands digit of 98150? 8 What is the hundreds digit of 293? 2 What is the ten thousands digit of 19537? 1 What is the tens digit of 1239? 3 What is the thousands digit of 52311? 2 What is the thousands digit of 1924? 1 What is the units digit of 126394? 4 What is the units digit of 239? 9 What is the units digit of 34552? 2 What is the hundreds digit of 4295? 2 What is the hundreds digit of 1791? 7 What is the units digit of 8067? 7 What is the hundreds digit of 47879? 8 What is the thousands digit of 1548? 1 What is the units digit of 426? 6 What is the hundreds digit of 11873? 8 What is the tens digit of 25479? 7 What is the hundreds digit of 33643? 6 What is the ten thousands digit of 12740? 1 What is the hundreds digit of 751? 7 What is the units digit of 947? 7 What is the hundreds digit of 4452? 4 What is the ten thousands digit of 53457? 5 What is the tens digit of 5584? 8 What is the units digit of 6219? 9 What is the hundreds digit of 12233? 2 What is the tens digit of 84? 8 What is the hundreds digit of 1516? 5 What is the ten thousands digit of 117183? 1 What is the hundreds digit of 7277? 2 What is the ten thousands digit of 45334? 4 What is the tens digit of 3526? 2 What is the tens digit of 105? 0 What is the tens digit of 53018? 1 What is the units digit of 784? 4 What is the hundreds digit of 1036? 0 What is the thousands digit of 23197? 3 What is the units digit of 3386? 6 What is the units digit of 6551? 1 What is the ten thousands digit of 38606? 3 What is the tens digit of 4736? 3 What is the ten thousands digit of 37973? 3 What is the thousands digit of 1333? 1 What is the t	{ "pile_set_name": "DM Mathematics" }
d - d - r = 0 for d. -1 Let l be 4 + 0 + 2 - -2. Let o = l - 8. Suppose 35 = 5f + 5a, -3a - 11 = -of - f. Solve 0 = -b - 3b + f for b. 2 Suppose g + l = 2, -3g - 2l + 4l = -6. Suppose 4n + 4k - 8 = gk, -3k - 8 = -4n. Suppose -4w + 18 + 6 = 0. Solve ns = ws for s. 0 Suppose -3y - 4d = -10 - 8, -3d + 30 = 5y. Solve -yc + 4c = -6 for c. 3 Let w(q) = q*3 + 5q*2 + 5q. Let v be w(-3). Suppose 3d = -v + 6. Solve u + 0 = -d for u. -1 Let q(k) = k3 - k2 - 3k - 9. Let c be q(3). Solve c = 19d - 14d + 20 for d. -4 Let i = 500 - 462. Solve 5d = -i + 33 for d. -1 Let h(n) = -6n - 13 - 4n + 11n - 3n. Let f be h(-11). Solve 3g + f = -0g for g. -3 Let p = -18 - -52. Let k = p - 32. Solve -ks - 5 = -1 for s. -2 Let u be (-8)/(-3)(-12)/(-8). Let y be 4 - u/105. Solve 3g + yg = 10 for g. 2 Let b(i) = -i*2 - 12i + 163. Let a be b(-19). Solve -20 = -ax + 35x for x. -4 Let c = 6 - 12. Let k = -3 - c. Let u = k - 3. Solve u = 3g - 3 for g. 1 Suppose c + 40 + 27 = 5x, 0 = 4x + 5c - 42. Solve 13 = -t + x for t. 0 Let n = 683 - 639. Solve -6g + n = 32 for g. 2 Let d(v) = -3v + v*3 + 8v*2 - 11v + 4v - 2v*2 - 3. Let b be d(-7). Suppose -3a = -78 + b. Solve -2o = -7o - a for o. -4 Suppose j - 4j = -5j. Solve j = 3d + 3d - 30 for d. 5 Let t(h) = 3h2 - 17h - 2. Let x be t(6). Solve 9 = -k + xk for k. 3 Let l be ((-36)/8 - 3)/((-1)/(-2)). Suppose -4c + 13 = -m, 0 = 5m - 2c - 0c + 65. Let u = m - l. Solve -uf = 1 + 7 for f. -4 Suppose -4k = -9k - 10. Let b = k - -6. Solve -5y = -6 - b for y. 2 Suppose 14y - 4w = 13y + 2, -w = -y + 2. Solve z - 1 - y = 0 for z. 3 Suppose 0 = 5h - 4h. Let x = 55 - 53. Solve h = -p - 2 - x for p. -4 Suppose -3 - 7 = -2g. Solve -gz + 6 = 31 for z. -5 Suppose 6b = 3h + 2b + 4, -3h + 2b - 2 = 0. Suppose hw - 3w = -15. Solve -wr = -8 - 2 for r. 2 Suppose -4y + 4o - 11 = -91, 4 = o. Solve y = 16r + 40 for r. -1 Let y = -240 - -249. Solve -yk + 6k = 15 for k. -5 Let r(u) = 6u*2 + u. Let j be r(-2). Suppose -4o = -a - 1 + j, -4o - 41 = -5a. Let l = o - -4. Solve -d - d + 10 = l for d. 5 Suppose -20 = -4a - 2n, -4a - n + 31 - 9 = 0. Suppose 28 = -au + 4. Let w = u + 4. Solve -4t = -wt for t. 0 Let c = 478 - 476. Let w(g) = -g + 24. Let l be w(0). Suppose 5o - o = l. Solve -oq - 20 = -cq for q. -5 Suppose -d = 13 - 15, 5m = d + 38. Solve 2t = 10t + m for t. -1 Suppose 0 = -5s + x + 23, -4s + 23 - 7 = -2x. Suppose -22g = -23g + s. Solve -a = -6a + g for a. 1 Let g(o) = o*3 + 2o*2 - o - 2. Let q be g(-3). Let r = -9 + 11. Let m be (12/(-16))/(r/q). Solve h = mh + 10 for h. -5 Let n(v) = v. Let i be n(-8). Let s be 610/40 + 2/i. Suppose -11j = -sj + 8. Solve -m + jm + 3 = 0 for m. -3 Suppose 0 = 2a + a - 15. Suppose b = ab. Suppose 0 = -v - bv. Solve 6m - m = v for m. 0 Let q(h) = h3 + 11h*2 - 19h + 8. Let a be q(-12). Solve -ab = -90b for b. 0 Suppose -5412 = -32y - 1508. Solve -7a - y + 157 = 0 for a. 5 Let v(h) = -h - 18. Let k(y) = -1. Let f(z) = 3k(z) - v(z). Let j be f(-11). Solve 4n + j = 2n for n. -2 Let n(l) = 7l + 40. Let q be n(-17). Let d = q + 82. Solve 3k = d + 3 for k. 2 Let t = 119 + -116. Suppose 0 = 2n + ty - 19, -4n + 0y + 23 = y. Solve -5a = -n - 5 for a. 2 Suppose 4u + o - 14 = -72, -5u - 71 = 2o. Let i = 22 + u. Solve -2p + ip = 5 for p. 1 Suppose 2h - 2q = -15 + 33, -4q - 11 = h. Solve 6n - hn = 5 for n. 5 Suppose -887 = -20b + 1173. Solve ba - 5 = 98a for a. 1 Suppose 5g = -5b - 15, 23 = b + 2b - 5g. Solve -f = 3 - b for f. -2 Let g(r) = r2 - 10r - 5. Let i be g(11). Suppose p - a - 10 = 0, -19 = -2p + 5a + 1. Solve h - ih = -p for h. 2 Let a(f) = 5f + f*2 + 10 - 3f - 4f - 7f. Let w be a(8). Solve k - 2k = w for k. -2 Let z = 180 - 180. Solve z = -5o + 5 + 20 for o. 5 Suppose -81j = -77j - 24. Suppose 0 = 5r - jr. Solve rp + p = -5 for p. -5 Suppose 0 = 4u - 0u. Suppose 18z - 1109 + 965 = 0. Let r be (-1)/(-1(-1)/(-3)). Solve u = rl - 7l + z for l. 2 Let t be (48/20)/(-4)-145. Let l = -82 + t. Solve -lk + 15 = -0k for k. 3 Let r(m) = 4m + 54. Let q be r(-10). Suppose i - q = -i. Solve 4g - 5 - i = 0 for g. 3 Suppose 52 - 14 = -5d - n, -4d - 24 = 4n. Let l(x) = -12 + 14 + x + 11. Let g be l(d). Solve 0 = go + 10 for o. -2 Let s(x) = x*2 - x - 1. Let q be s(0). Let y be -3(-2 + 0 - q). Solve yw - 2w = 4 for w. 4 Suppose 3c - 15 = -0c. Suppose a = c - 3. Suppose aj + 3j = 10. Solve -10 = -4i - j for i. 2 Let v = 82 - 84. Let k(w) = -6w - 7. Let z be k(v). Solve -z = 5a + 5 for a. -2 Let y(j) be the first derivative of j3/3 + j2 - 5j + 5. Let p be y(-4). Solve 0 = pf - 3 for f. 1 Suppose -234w - 140 = -254w. Solve w + 1 = -8t for t. -1 Suppose 4j - 4 = -0. Let c be 90/40 - (5/4 - j). Solve a = -ca - 15 for a. -5 Suppose -2b + t + 26 = 7, b + 3t = 27. Suppose 0 = -o - o + b. Suppose -ov = -9v + 6. Solve 6 = -2s - v for s. -4 Let y be (8/60-10)/((-2)/15). Solve a - y = -a for a. 5 Suppose 13 = 2j + 3c - 0c, 4j = -c + 21. Let n = 34 + -22. Suppose -3 = -jr + n. Solve -rm = m + 4 for m. -1 Let u = -96 + 98. Let l = -27 - -29. Solve -t + ut = -l for t. -2 Let d be (-35)/(-42)(-12)/(-2). Suppose 3j - 4 - d = 0. Suppose jg = g. Solve g = -0k - 4k for k. 0 Suppose h = -4z, -h - 2h - 3z = 9. Let p be (-5 - -5) + (h - -1). Let f be p/(-1 + 4 - 4). Solve 0 = fd - 8d - 5 for d. -1 Let y(c) = -c3 + 25c*2 + c + 4. Let t be y(25). Solve -5l + 29 = t for l. 0 Let u(s) = s*2 + 8s + 8. Let c be u(-7). Let t(w) = -w*3 + 2w*2 - 1. Let z be t(c). Let f be -1(-1 - 1) - z. Solve 0 = fm + 2 - 12 for m. 5 Let h be ((-44)/8)/(1/2). Let p(y) = -y2 - 11y + 9. Let v be p(h). Let m = 13 - v. Solve w = -w + m for w. 2 Let b(w) = -4w2 - 4w - 4. Let x be b(-4). Let k(j) = j*3 + 15j*2 - 15j - 8. Let t be k(-16). Let h be (-3)/(t/x)-2. Solve -4d + h + 3 = 0 for d. 4 Let q be 1/(-4) - (-21)/4. Suppose 5u - 3u - 4m = 0, -2m + 18 = 2u. Suppose 28 = uy + 10. Solve -q = yj - 2j for j. -5 Let d(i) = i*2 + 1. Let v be d(2). Let j be 49 - 44 - (3 - 0). Solve -vz = 3 + j for z. -1 Let d be -1 + 3 - ((2 - 1) + -3). Suppose -dq = -4w + 32, -q - 18 + 0 = -2w. Solve -3v - w + 1 = 0 for v. -3 Suppose -4g + 24 = p, p - 28 = -2p - g. Suppose ph = 79 + 81. Let o = 8 + -6. Solve ol = -2l + h for l. 5 Let k be (3 - 6/42)-1. Let g(j) = j - 1. Suppose 2w - 18 = -6. Let h be g(w). Solve t = -h - k for t. -5 Let m = 201 + -198. Let x be 2/(-3) - 28/(-6). Suppose 4y - 6 = 4v + 2, 2v + x = my. Solve ys + s = 0 for s. 0 Let v = 557 + -554. Solve vj + 5 = 8j for j. 1 Suppose 81 + 204 = 95h. Solve -16a + ha = -39 for a. 3 Let a(u) = 3u + 1. Let i be a(-4). Let o = i + 12. Solve -5r + o = -4 for r. 1 Let y = -69 - -120. Let i = 53 - y. Solve 2 = iu - 4 for u. 3 Let m be (40/(-12))/((-2)/6). Suppose 0r = -5r + m. Let p(v) = -v2 + 8v - 12. Let n be p(6). Solve -2x - r + 0 = n for x. -1 Suppose 5w + 5h = 15, -2 = -31w + 30w - 2h. Let g be 1(-2 + 2)/1. Solve -v - v + w = g for v. 2 Suppose 0 = 9j - 3j - 18. Solve 4 = jn + 19 for n. -5 Suppose 4y - 136 = 4b, 3y - 102 = 40b - 45b. Solve -yj + 6 = -32j for j. 3 Let y be 11/22 - (-42)/4. Solve -yp + 13p + 2 = 0 for p. -1 Let q(l) be the second derivative of l3/6 - l2 + 3l. Let w be q(4). Solve -wb = -b - 1 for b. 1 Let y(s) = -18s - 19. Let k be y(-7). Let w = k + -102. Suppose 0 = -3g + 5g. Solve gi = -wi - 15 for i. -3 Let j be (91/14)/(3/6). Let i(b) = b*3 - 12b*2 - 12b - 11. Let k be i(j). Solve 12 = ko - 6o for o. -3 Let v be 47 + (0 - (-1 + 3)). Let w be 174/v + (-6)/(-45). Solve 0 = wn - 0n for n. 0 Let d(x) = 15x2 - 2 - 10x*2 + 1. Let h be d(1). Suppose 4p - 28 = -t - t, 16 = hp - t. Solve 0 + 5 = pn for n. 1 Suppose 0 = -3l - 3n + 3, 2l + 3l = -3n + 9. Suppose 3p = 4a - l, p = 4a - 4 - 5. Solve -pw - w - 20 = 0 for w. -5 Let p(r) = 17r - 49. Let t be p(6). Let u = 57 - t. Solve 8 = 4z - u for z. 3 Suppose -2z + a + 2 + 24 = 0, 2z + 3a - 34 = 0. Let d = z - 10. Let r be -1 + (-4)/2 - (-1 - 5). Solve rw = dw for w. 0 Let p = 3 + 0. Let o be (-3)/p3 + 10. Suppose 0 = -4q + 5	{ "pile_set_name": "DM Mathematics" }
= 0. Let h(s) = jr(s) - 3y(s). Let d(a) = 11a + 2. Give d(u) - 6h(u). 5u + 2 Let t(o) = o3 + o - 1. Let q(s) = s3 + 4s*2 + s - 1. Let j(v) = 13v*3 + 12v*2 + 7v - 7. Let d(k) = -2j(k) + 6q(k). Give -d(i) - 8t(i). 12i*3 Let f(a) = -15a + 138. Let g(m) = m - 2. Calculate -f(q) - 18g(q). -3q - 102 Let x(j) = -9j + 1. Let p(n) = -4n - 19. Determine p(i) + 3x(i). -31i - 16 Let o(m) = -323960m3 + 117m*2 - 117. Let z(c) = -11171c*3 + 4c*2 - 4. Give -4o(h) + 117z(h). -11167h*3 Let a(d) = -2d + 3. Let j(l) = -2l2 - 21l + 31. What is -6a(z) - j(z)? 2z*2 + 33z - 49 Let z(r) = 3051r3 + 6r + 9. Let g(f) = 33564f3 + 68f + 102. Calculate -6g(a) + 68z(a). 6084a3 Let a(c) = 2570c*2 - 6c - 503. Let y(u) = 2570u2 - 5u - 402. Give 4a(n) - 5y(n). -2570n2 + n - 2 Let p = 30 - 21. Let x(g) = 5g*2 + 2g - 6. Let q(u) = u - 10u2 - 13 + 4u + 21u2. Suppose -56z - 124z + 812 = -383z. What is px(s) + zq(s)? s*2 - 2s - 2 Let z(k) be the third derivative of -3k4/4 - k3/2 - 1780k*2 - 2k. Let i(p) = -35p - 7. Determine -3i(g) + 7z(g). -21g Let m(n) = -44n3 + 3n*2 + 26n - 2. Let v(k) = 23k3 - 2k*2 - 15k + 1. Determine 3m(j) + 5v(j). -17j3 - j2 + 3j - 1 Let h(k) = 3k3 - 7k*2 + 124k - 7. Let x(v) = -803v3 - 1030v*3 + 2v*2 - 41v + 2 + 1832v3. Calculate 2h(p) + 7x(p). -p3 - 39p Let f(q) = 7q - 2. Suppose -74w = -84 - 138. Let b(k) = 13k - 3. What is wb(j) - 5f(j)? 4j + 1 Let f(k) = 3k2 - 2k*2 + 509898k*3 + k - 509897k*3. Let p(c) = -4c*3 - 3c*2 - 6c. What is -6f(l) - p(l)? -2l*3 - 3l2 Let p(x) be the second derivative of -x4/6 + 5x2/2 + 6x - 18. Let h(i) = -i*3 + 3i*2 - 4. Determine -3h(v) - 4p(v). 3v3 - v2 - 8 Let n(k) = 133k2 - 37k - 3. Let r(s) = -67s2 + 22s + 2. Determine -3n(d) - 5r(d). -64d2 + d - 1 Let u(p) = 1 + 85p*3 + 7101p - 86p3 - 7102p. Let r(a) = 8a3 + a - 1. Let c be (-1 - -2) + 3 - 3. What is cr(i) + u(i)? 7i3 Let o(w) = -4w + 6951. Let m(a) = 2a - 3459. Give 13m(y) + 6o(y). 2y - 3261 Let c(a) = 4a2 + 15a - 121. Let s(f) = 10f2 + 30f - 260. Calculate 7c(k) - 3s(k). -2k2 + 15k - 67 Let m(z) = 2z2 - 2z + 2. Suppose x = -1, 3x = -2w + 7x + 22. Suppose -7n - 4 = -wn. Let g(y) = -10y*2 + 11y - 11. Give ng(t) + 11m(t). 2t2 Let g(x) = -x3 - 4x*2 - 2x. Let v(s) = -16s3 + 6s*2 + s. What is 2g(i) + v(i)? -18i3 - 2i*2 - 3i Let y(t) = -12t - 4. Let k(r) = -1. Suppose 4m - 10c = 50, -5c = 14 + 21. Give mk(l) + y(l). -12l + 1 Let t(n) = 2952n3 + 6n*2 - 3n - 9. Let s(m) = -7737193m3 - 15728m*2 + 7864m + 23592. Calculate -3s(a) - 7864t(a). -2949a3 Let h(c) be the third derivative of c4/24 + c3/3 + 616c*2. Let k(r) = 2r + 3. Calculate 4h(a) - 3k(a). -2a - 1 Let x(g) = 38g*3 - 8g*2 - 4g + 11. Let t(h) = h*2 + h - 3. What is -5t(u) - x(u)? -38u3 + 3u*2 - u + 4 Let w(p) = -1. Let u(h) = 14h + 17h2 - 41h*3 + 91h*3 + 25 - 4h*2 - 49h*3. Let s be u(-12). Let q(y) = 2y - 4. Calculate sq(t) - 5w(t). 2t + 1 Let c(d) = 348d*2 + 36. Let n(b) = 5b*2 + 2. Calculate c(l) - 18n(l). 258l2 Let i(a) = 7a*2 + 5a - 1538. Let b(h) = -6h2 - 4h + 1534. Calculate -5b(l) - 4i(l). 2l2 - 1518 Let z(t) = 14t*2 - 25 + 5t*2 + 7t*2 - 23t*2 - 68t. Let n be z(23). Let b(w) = 39w. Let k(u) = -3u. Determine nb(m) - 27k(m). 3m Let k(g) = -g - 1. Let z = 2496 + -2498. Let l(r) = 4r. Determine zk(f) - l(f). -2f + 2 Let d(t) = 5t2 - 2t + 2. Let r be (3/(-2))/(3/(-90)-3). Let n = r + 17. Let l(x) = -7 - xn + 8 + 3x2 - x2 - x. Calculate -d(c) + 2l(c). -3c*2 Let l(j) = 44j*2 + 3134j*3 - 41j*2 - 3146j*3 - 3j. Let u(y) = 35y3 - 8y*2 + 8y. Calculate 8l(s) + 3u(s). 9s3 Let n(p) = -10p*2 + 1. Let h(f) = -9f*2 + f - 7. Calculate -h(s) - 4n(s). 49s2 - s + 3 Let a(o) = 2o*2 + 3o + 1. Let s(l) = -177l2 - 3l + 1. Give a(g) + s(g). -175g2 + 2 Let t(a) = -3447141a - 10013. Let v(k) = -13107k - 38. Give 2t(p) - 527v(p). 13107p Let o(i) = -33i - 4. Let b(m) = 17m + 2. Let t = -5971 + 5969. Calculate to(x) - 5b(x). -19x - 2 Let o(j) = 5j + 1. Let m(i) = -18i - 1825. Give -m(v) - 4o(v). -2v + 1821 Suppose 29 = x + 26. Let l = 3005 + -3010. Let k(m) = -m3 - 3m - 2. Let u(v) = -2v3 - 6v - 4. Determine lk(g) + xu(g). -g*3 - 3g - 2 Let x(m) = -m*3 + 3m - 1. Let s be x(0). Let a(b) = -b. Let p(t) = 2t2 + 2t - 2. Give sp(o) - 6a(o). -2o2 + 4o + 2 Let c(r) = 106r2 + 21032r + 33. Let j(u) = 29u2 + 5258u + 9. Give 3c(l) - 11j(l). -l*2 + 5258l Let p(w) = -2006w - 48. Let b(l) = -3344l - 79. Calculate 8b(i) - 13p(i). -674i - 8 Let o(t) = 4t - 264. Let q(u) = -3u + 6. What is -2o(g) - 2q(g)? -2g + 516 Let r(m) = m*2 + 3m + 2. Let y(q) = -287q2 - 35q - 4. Calculate -12r(b) - y(b). 275b*2 - b - 20 Let r(w) = -3w3 - w2 - 9w + 4. Let y(i) = -6i*3 - 2i*2 - 19i + 9. Let s = -7311 - -7316. Give sr(x) - 2y(x). -3x3 - x2 - 7x + 2 Let r(g) = 8g2 - 3g - 3. Let k(z) = 24z2 - 8z - 8. Let j be (-84)/189 - (-608)/72. Calculate jr(b) - 3k(b). -8b2 Suppose 0 = -3p + 2g - 881, -5p + 6g = 7g + 1464. Let f = -289 - p. Let y(s) = -6s2 + 12s. Let o(l) = -11l2 + 23l. Give fo(v) - 7y(v). -2v2 + 8v Let x(a) be the second derivative of a4/3 - a3/6 - a*2 - 168a. Let y(r) = 5r2 + 2r - 4r2 - 88 - 3r + 88. Calculate x(l) - 3y(l). l2 + 2l - 2 Let b(g) = -15g2 - 13g + 6. Let w(q) = -13q2 - 18q + 7. Calculate -4b(o) + 3w(o). 21o2 - 2o - 3 Let t(n) = 11. Let z(s) = -600s + 84. Give 7t(k) - z(k). 600k - 7 Let z(a) be the second derivative of 4a3/3 + a2 + 83a + 2. Let v(p) = -4p - 1. Suppose 7s + s - 32 = 0. What is sz(b) + 9v(b)? -4b - 1 Let a(w) = -w + 1. Let d(h) = -30h - 13 + 26h + 6 + h*2. Let g be d(-2). Suppose 0 = -gm, z - 5m + 6 = 4z. Let j(f) = 4f - 1. What is zj(q) + 4a(q)? 4q + 2 Let p(q) = -59q - 496. Let f(w) = -35w - 331. What is -8f(l) + 5p(l)? -15l + 168 Let v(a) = a2 - 1. Let c(w) = w3 - 2w*2 + 4w + 4. Let k be 14/(-5)630/(-441). What is kv(i) + c(i)? i*3 + 2i*2 + 4i Let y(w) = -w - 18. Let i(l) = 138 - l + 148 + 138 - 425. Determine -2i(n) + y(n). n - 16 Let q(b) = 15b*2 - b - 6. Let z(o) = -34o*2 - 501o + 7. Let a(t) = -11t2 - 188t + 2. Let p(f) = -8a(f) + 3z(f). What is -6p(s) - 5q(s)? 9s2 - s Let g(w) = w3 + 6w*2 - 2w + 8. Let b be g(-6). Let k = -18 + b. Let c(x) = x - x + 1 - x - x + x. Let a(r) = -r. Give kc(l) - a(l). -l + 2 Let u be (-2)/2 - (0 - 0). Let v = 21020 + -21017. Let w(l) = -l. Let s(z) = -6z + 2. Determine us(o) + vw(o). 3o - 2 Let h(j) = -22j*2 - 2. Let x(d) = -68d*2 - 82d - 7. Give -6h(o) + 2x(o). -4o2 - 164o - 2 Let p = -204 + 206. Let b(k) = pk2 - 6k - 2k2 - 2k*3 - 6662 + 6656. Let v(z) = -2z*3 - 5z - 5. What is 5b(u) - 6v(u)? 2u3 Let j(o) = -77 + 19 + 15o + 16 + 29 + 30. Let t(v) = -7v - 9. Determine -6j(z) - 13t(z). z + 15 Let p(d) = 21d - 3. Let j(b) = -104b + 16. Let o(r) = -13r + 1068. Let h be o(82). Calculate hj(n) + 11p(n). 23n - 1 Let q(v) = 91v*2 - 1. Let y(r) = 91r*2 - 2r - 2. Determine -3q(j) + 2y(j). -91j2 - 4j - 1 Let x(j) = -4j2 + 5j + 7. Let a(o) = -2o2 + 3o + 4. Let c(b) = 5a(b) - 2x(b). Let r(z) = z*2 - z - 1. What is -c(u) - 4r(u)? -2u2 - u - 2 Let f(r) = -3r*2 + 7r. Let t(k) be the first derivative of -2k3/3 + 3k*2/2 + 1151. Give 3f(i) - 7t(i). 5i2 Let w(j) = -j3 + 1. Let r(i) = -12i3 + 3. Let k be (3 - -1)(4/(-14))/(24/42). What is kr(b) + 6w(b)? 18b3 Let j = -4 + 1. Let p(l) = -l3 - 4l*2 + 2l + 17. Let b be p(j). Let y(a) = -3a - 3. Let g(s) = -4s - 2. What is by(i) - 3g(i)? 6i Let p(m) be the second derivative of -m5 - m4/3 - 124m. Let t(g) = -41g3 - 7g*2. Determine 5p(d) - 3t(d). 23d3 + d2 Let j(h) = -2h3 + 8h - 2. Let c(n) = -6n3 + 16n - 5. Give -2c(w) + 5j(w). 2w3 + 8w Let o(u) = 5u2 - 9u + 13. Let r(n) = 1. Let a(y) = -2y2 + 4y - 10. Let s = -66 - -70.	{ "pile_set_name": "DM Mathematics" }
71 + i. Which is the closest to d? (a) 4 (b) 5 (c) 8/5 c Let m = 17356.888 + -17473. Let p = -116 - m. Let s = 0.512 - p. Which is the nearest to s? (a) -0.2 (b) 5 (c) -1 a Let o = -466522609/143 - -3262376. Let t = o + 216/11. What is the nearest to 3 in -3, 4, t? 4 Let z = 6/905 - -1672/20815. What is the nearest to -0.1 in -2/11, 0.3, 0.09, z? -2/11 Let m = -151 - -153. Let d be (-150)/(-180)m/10. Which is the nearest to d? (a) -0.6 (b) 1 (c) -5 a Let x be 2/12/4. Let q = 0.373 - 0.273. Suppose 44t + 152 = 25t. What is the closest to q in 1/3, t, x? 1/3 Suppose 0 = -5d - 74r + 77r + 949, 5d + 5r = 925. Let n be (3 - d/91) + (-48)/56. Which is the closest to 1? (a) -2/9 (b) -0.4 (c) n c Let t(y) = -2y*2 + 39y + 628. Let g be t(30). Let w = 1.3 + -1. Suppose 14 = 15u - 17u. What is the nearest to u in g, w, 0.2? g Let j = 30.6 + -30.4. Let k = 182 - 1640/9. Which is the closest to -0.2? (a) j (b) k (c) 1/6 b Let u = 143.24 - 9.24. Let p = u + -133.6. Let q = -6 + 3. What is the nearest to -0.13 in q, 1, p? p Let b = 4.5 + -1.5. Let u = -1691.7 - -1692. What is the nearest to -1/20 in -4, b, u? u Let h = 0.4 + -0.4. Suppose -23 + 33 = -10c. Suppose 0 = -o - 3o - 16. What is the nearest to h in c, 3/2, o? c Let d = -0.86 + -0.14. Let k = -0.28114 + 0.10114. Which is the nearest to d? (a) -5 (b) k (c) -2 b Let p be (4 + 63/(-18))/((-7)/(-6794)). Let z = 485 - p. Which is the nearest to 0? (a) 0 (b) z (c) 2 (d) 1 a Let u = 38635 - 347717/9. Let h = -1.1 + 1. Let d = h - -0.1. Which is the closest to u? (a) -1/5 (b) 1/9 (c) d a Let r = 11.579 + -9.579. What is the nearest to -9 in r, 5/2, -1.4, 4? -1.4 Let j(o) = -o*3 + 35o*2 - 79o + 430. Let q be j(33). What is the nearest to -2 in q, -1, 1.35? -1 Let x = 5 - 11. Let d = 0.272 + 1.728. Which is the nearest to d? (a) 2 (b) 0.2 (c) x a Let y = 21132.8 + -21133. What is the nearest to 1 in 1/5, 3, 18, y? 1/5 Let n be (1 + 3)/(25/(300/168)). Which is the closest to n? (a) -0.1 (b) 5.64 (c) 2/5 (d) 2/7 d Let n be 3790(-20)/(-200) + -6 + 1. What is the closest to 2/5 in 1/2, 1/3, n? 1/3 Let u = 2745 + -2740. Which is the closest to -7? (a) 1 (b) -3/2 (c) -3/4 (d) u b Let p = -163 - -168. Let b(t) = -t3 + 9t*2 + 9t + 5. Suppose j - 9 = 1. Let s be b(j). What is the closest to -1 in p, -4/3, s? -4/3 Let o be 0 - 114/42 - 2/7. Which is the closest to -0.1? (a) -0.11 (b) o (c) -0.5 a Let q = 1.33 + 1.4. Let f = 2.53 - q. What is the closest to f in 2/19, 0.4, 1? 2/19 Let p = 15427/63 - 245. Let l = -2/21 + p. Which is the nearest to -9? (a) -1 (b) l (c) -0.5 a Let u = -5345 - -90867/17. Let h(f) = f*3 - 3f*2 + 2f - 1. Let p be h(2). Let q = 1 - p. Which is the closest to 0.1? (a) u (b) q (c) -1/6 a Let z = 0.4 - -2.6. Let g = z - 3. Suppose -3067m + 4 = -3066m, -2y = -2m + 2. What is the nearest to g in 2/7, y, -4/7? 2/7 Let d = 4198.6 + -4199. What is the closest to 56 in 0.5, -0.6, 1/5, d? 0.5 Let g = -4.956 + -0.044. Suppose -3y - 5x = -7y - 29, 11 = 4y + 3x. Let d = 0.3 - 0.5. Which is the nearest to -0.1? (a) y (b) g (c) d c Suppose 8p + 8p = -p. Let j = -6.7 - -7. Let s = -547/10 + 111/2. Which is the closest to p? (a) -9 (b) j (c) s b Let h be -6(-5)/(-35)-182. Let x = -1405/9 + h. What is the closest to 2 in -1/5, 2/5, x? 2/5 Suppose 11 = -g + 3l, -2g + 11 = 4l + 3. Let j = 150 + -150. What is the closest to j in g, -1, -0.4? -0.4 Let j be 0/1 - (-180)/(-630). What is the closest to -0.2 in j, -1, -4, 0.5? j Suppose -287 = 3i + 5k - 251, 2k + 16 = -2i. What is the nearest to i in -0.4, 0.13, 69? -0.4 Let o = -759 - -761. What is the nearest to 668 in 0.2, o, -0.1? o Let v be (140/150)/(2/10) - (-12)/(-3). What is the nearest to 2/3 in 7, 1, -0.4, v? v Suppose 85b + 25 = 90b + 5k, 0 = -4b + k + 5. What is the nearest to -0.3 in b, 4, -526, -4? b Let q = -142 + 145. Let j = -14135/21 - -673. What is the nearest to -0.1 in j, q, -6? j Let j = 6.0094 - 19.0094. Let w = -1.94 + -0.06. Which is the closest to j? (a) w (b) 1/6 (c) 0 a Suppose 773 = -28q + 661. What is the nearest to 0.04 in q, 0.5, -0.5? 0.5 Let o = -0.0337 - -6.0337. Let r = 0.49 - 0.79. What is the closest to o in 2/7, -2, 4, r? 4 Let m = 0 + 2. Let n be 3/9(2 + 1/(-1)). Which is the closest to n? (a) m (b) 2/5 (c) 0.2 b Let k be 2 + -1 - 1 - (-37 + 38). Let m be (65/(-4))/5 + 4. Which is the closest to 1/3? (a) k (b) 2/7 (c) -36 (d) m b Let a be (-47 + -1)/6 + (-25)/(-5). What is the nearest to -0.026 in a, 0.3, 2, 5? 0.3 Let o = 581 + -997. Let j = o + 363. Which is the nearest to 0.1? (a) -2/9 (b) j (c) 0.4 (d) -2 c Let r = -1.025 + 1.225. Let f be 22/5 - (-1 + (6 - 1)). Which is the closest to -125? (a) -3 (b) f (c) r a Let t = -166 - -500/3. Let h = 215/126 - 27/14. Which is the nearest to t? (a) h (b) 2 (c) -0.3 (d) -2/11 d Let t = 111.07405 - 0.07405. Let y = 114.1 - 1.1. Let r = y - t. What is the nearest to 0.18 in -2/7, 3, r? -2/7 Let m = 71 + -391. Let f = m - -959/3. What is the closest to f in -4/3, 3, -0.8? -0.8 Let i = 1.9 - -0.1. Suppose -253q = 666 - 223 - 190. Which is the nearest to -0.4? (a) q (b) 1/11 (c) i b Let k = 0.2822 - 0.0822. Which is the nearest to -2? (a) -247 (b) 2/17 (c) k (d) -1 d Let n(i) = -2i*3 + 68i*2 + 75i - 177. Let w be n(35). Which is the nearest to 40? (a) -2/3 (b) w (c) 39 c Let c = -309 + 306.5. Let s = -1.45 - 0.05. Let q = c - s. What is the closest to -6 in q, -2/9, 0? q Let q = 4.8 + -0.8. Let y = 13555 + -13550. Which is the nearest to -0.1? (a) q (b) 0.5 (c) y b Let p = 681 - 609. Suppose -86 = -7f - p. What is the nearest to 0.2 in f, 4, -3/2? -3/2 Let z = -30 + 6. Let p be ((-3)/10)/(z/(-32)). Which is the closest to -0.1? (a) 7/4 (b) p (c) -0.2 c Let o = 515 - -215. Let n = 711 - o. What is the closest to n in 0, -2/7, 2, 0.4? -2/7 Let r = -5828/40845 - 1/5835. Which is the closest to r? (a) -4/3 (b) 4 (c) -5 (d) 0.2 d Let y = -3/20173 + -40325/141211. What is the nearest to 1 in 2, y, -0.0201, -5? 2 Let k be 4(4/(-14) - (-13)/70). Let m = 743 - 742. What is the nearest to k in 11, -4, m? m Let g = -133/9 + 275/18. Which is the nearest to 629? (a) 0.1 (b) 2/5 (c) g c Suppose 3p - 22 - 17 = 0. Let i = -4.93 - -4.6. Let q = i - -0.03. Which is the closest to p? (a) 3 (b) q (c) -2/5 a Let m = -11257 - -168857/15. Which is the closest to 0? (a) -4 (b) m (c) 0.4 (d) 5 b Suppose 0 = -j + 3l - l + 1225, 0 = 4j + 3l - 4845. Let z be 378/j + 1/(-9). What is the closest to 2 in 0.4, 2/21, z? 0.4 Let f be (-1)/((-16)/15 - (-8)/12). Which is the nearest to -3.35? (a) 0.4 (b) f (c) -0.2 c Let c = 10 - 3. Suppose 150 - 171 = -ca. What is the nearest to 0.1 in -0.3, 3/4, a? -0.3 Let k = -0.3 - -0.2. Let d be (-292)/(-29) - 10/145. Suppose -2g + 3m = 4, 0g - 4g - 3m = -d. Which is the closest to g? (a) -2/11 (b) k (c) -6 b Let w = 0.149 + -130.749. Let f = w + 131. Which is the closest to -0.1? (a) 3 (b) f (c) -2.4 b Let u = -90.9642 - -90.8642. Let h be (-2)/8 + 0/1. Which is the closest to u? (a) 1 (b) h (c) 1/4 b Let i = -287/1116 + 2/279. What is the nearest to i in -1/4, -29, 0? -1/4 Let t = 1142 + -1142.5. What is the nearest to -2/5 in 0.5, t, 802? t Let k = -671532 - -671537. Let w = 0 - 0. Let u be (w + -1)/(0 + 1). What is the closest to 0.1 in 1, k, u? 1 Let h be (-5 - (-3 + -1))-16. Let w(p) = 2p*2 - 33p + 17. Let r be w(h). Let l = 6 + -21. Which is the nearest to r? (a) l (b) 1/5 (c) 4 b Suppose -4b + 4c = 8, -b = b + 2c + 4. Let w = -0.3 - -1.63. Let t = -2.23 + w. What is the nearest to b in t, 0.1, 5? t Let w = -3.932 + 3.932. Let h be -3 - 2/(28/(-46)). Which is the closest to -1? (a) h (b) w (c) 30 b Let p = -12.56 - -12.36. Which is the nearest to -0.1? (a) 418 (b) p (c) 4 b Let j = -7670 + 7672. Which is the nearest to -13? (a) 5 (b) -5 (c) j (d) 0.5 b Let p(l) = -179l*3 - 4l - 3. Let o be p(-1). Let i be o/105 - (1 - (-2 + 1)). What is the nearest to i in 0.2, 0, -15? 0 Let v = -4097.3 + 4097. Which is the nearest to 0.1? (a) 0.86 (b) -0.06 (c) -3/4 (d) v b Let z = 3.2 - -0.2. Let s = 213960.5 - 213960. Which is the nearest to -1/2? (a) 3 (b) s (c) 1 (d) z b	{ "pile_set_name": "DM Mathematics" }
olve 0d = -x - 4d - 14, 0 = -6x - 6x + d - 2d - 27 for x. -2 Solve -4v - 5y = -61, -2v - 33 = 4y - 9y + 3y - 41 for v. 9 Solve -f = 5w + 70, 0 = -6w + 10w - 6w + 5f - 28 for w. -14 Solve -2v + 7d + 28 = 0, -19459v + 19457v - 2d - 8 = 0 for v. 0 Solve -12 = 4c, 2c = 4i - 25 + 19 - 52 for i. 13 Solve 23f + 4t - 21 = 29f + t, -61 - 7 = -4t for f. 5 Solve 5z + 22 = -l, -2l = -z - 4l - 550 + 506 for z. 0 Solve -604p + g = -616p - 59, -3p + 3g + 21 = 0 for p. -4 Solve -7u - 13u - 109 = 2p + 11, -2p - 10u - 120 = 2p for p. -20 Solve 0 = -x + 4y + 84, 668 = -3x + 404y - 438y for x. 4 Solve 14q + 36 = 1017s - 1012s, -s - s + 589 = 4q + 565 for s. 10 Solve s + b - 25 = -0b - 16, 11b - 99 = -s for s. 0 Solve -2u - 83w - 106 = 110w - 189w, -2w - 33 = -3u for u. -5 Solve -3k - 3x - 412 + 409 = 0, 3k + 3 = 3x for k. -1 Solve 0 = 2y + 24681i - 24685i + 10, -y + 9 = 5i for y. -1 Solve -c - 33 = 3u, -4c + 1721u - 132 = 1718u for c. -33 Solve 24u - 15w - 32 = 25u - 17 + 68, -u = 2w + 18 for u. -8 Solve 3m - a - 25 + 2 = 0, -9a + 0a + 3a + 16 = 4m for m. 7 Solve 501w - 3p - 54 = 498w, 16 = -3w + 5w + 2p for w. 13 Solve 66 = -2s - 12q, -56s - 75 = -52s + 5q for s. -15 Solve -90 = a, 2r - 91 + 62 - 321 = 4r + 4a for r. 5 Solve 0 = 2a + 5h - 44, -h + 18 = 458a - 453a for a. 2 Solve 0 = 5z - 3738394 + 3738374, 7h = 6z - 115 for h. -13 Solve -g + 5g + 3v + 20328 = 20337, -2g = v - 3 for g. 0 Solve 3c - 5x = 2, -728x + 22 = -4c - 709x for c. 4 Solve -4k + q = k - 14, 328k - 161k - 163k - 28 = -2q for k. 4 Solve -4813 = m - 5o - 4759, 4m + o = -111 for m. -29 Solve -39b + 38b - 54 = -5d, 49d - 490 = -5b + 5b for b. -4 Solve 10u + 4 = 3k - 107, 70k = 73k + u - 78 for k. 27 Solve 0 = 15b + 2n + 3n + 60, -4054n + 4050n + 15 = 3b for b. -7 Solve -3r = -s + 4, 2037s - 899 = -2r + 2218s for r. -3 Solve -43k + 36k + 2s = 97, s - 6 - 50 = 11k for k. -1 Solve -4p = -4i - 32, 4p + 40014i = 40015i - 7 for p. -5 Solve 5z + 0u - 2u = -45, -12z = -17z + 5u - 105 for z. -1 Solve -8v - 1050 = l + 3l - 1054, 6v = 3v - 4l + 14 for v. -2 Solve 3z = 6g + 228, 2g = 5z - 9863 + 9803 for z. -4 Solve 3v - 3772 = 5g + 3744 - 7536, 0 = 5v + 5g - 20 for v. 0 Solve -2f - 5t - 47 = 0, -70f + 60f = -3t + 93 + 2 for f. -11 Solve -3s + 5t + 195 = 0, 0 = 5s + 731t - 736t - 195 for s. 0 Solve 112r = 419y - 421y - 308, 26 = -2r - 2r + y for r. -3 Solve 508 = -5l - 17z - 293, -4l - 3z = 158 - 26 for l. 3 Solve -2m + 2 + 2 = 17f + 17f + 27f, 8 = 4m for f. 0 Solve 14n - 31n + 19n + 172 = -6s, -21n - 29 = -3s - 5 for n. -5 Solve 163v + 31 = t + 164v, 0 = -4t - v + 43 for t. 4 Solve -217 + 35 - 35 = -5p + 4f + 142, 5p + 217 = -2f for p. -5 Solve -60 = 3u - 3i, -5u - 70 = 2003889i - 2003888i for u. -15 Solve -1532b + 1526b = 8m - 198, -5m + 85 = -4b for b. 5 Solve 11j - 668914 = -668958, 6j + 28 = -2i for i. -2 Solve 3g = -5w + 8, -31g + 83 = -5w - 291 + 8 for g. 11 Solve -616405a + 25 = -d - 616401a, -20 = -4a for d. -5 Solve -193 = -4w - 11u - 280, 5w + 3 = -2u for w. 3 Solve 887j - 21 = 886j + 4c, -5c - 24 = j for j. 1 Solve 5u + 41g - 348 = 0, g = 4u - 299 + 291 for u. 4 Solve 18f = x - 65, 31f - x = 4f + 6f - 74 for f. -3 Solve -3i - 54 = 6y, -3y = i - 482 + 507 for y. -7 Solve -4i = i + 5d + 57 - 12, -d - 668 - 293 = 137i for i. -7 Solve 4u + 4 + 12 = 4p, 2u = -9p - 82 + 140 for p. 6 Solve 0 = 5n - 10f - 105, 38n - 33n + 44f + 381 = 0 for n. 3 Solve -257y - 2h - 5 = -262y - 1, -5y + 4h - 20 = -8 for y. 4 Solve c + 59 = -3x + 24, -78977c + 78972c = -2x + 5 for c. -5 Solve 7f - 3f = -32, 6t + 12 = 6f - 9f for t. 2 Solve 322h - 662h - 4r + 4 = -338h, -4r = -6h - 36 for h. -4 Solve 120628y - 120625y + 24 = -3t, 13t + 4y = -140 for t. -12 Solve -5y - 40 = -5i, 25784i - 25795i + 3y + 46 = -0y - 74 for i. 12 Solve 2v - 5m - 65 = 0, 4v - 5m + 1743038 - 1743153 = 0 for v. 25 Solve -2v = -2l + 3v - 95, 189l - v = 374l - 190l + 3 + 1 for l. 5 Solve 5o + 4 + 53 = -7c, 40o - 32o - 9o + 21 = -4c for c. -6 Solve 7l = 5l + 4c + 80, 11l - 6l = 3c - c + 40 for l. 0 Solve 0 = -4u + 12s + 104, 7611s - 16 = -u + 7612s for u. 11 Solve -465s + 4w - 818 = 4742, 5w = -5s + 3s - 49 for s. -12 Solve -3v = -32b + 55, -6b + 3b - 28 = -7b - 32 for v. -29 Solve -2j + 0j + 74d - 78d + 11 = -0j - 5, 3d = 12 for j. 0 Solve 0v - 3 = -v, 33w - 192 = -249w + 4v + 360 for w. 2 Solve -3r = j - 5r, 2j + 3r = 3j + 10330 - 10333 for j. -6 Solve 37j = 39j - 5c - 5 - 12 - 60, 0c = c + 15 for j. 1 Solve -25 = 2c + 9s, 334c - 336c + 4s = -14 for c. 1 Solve -2t - 785131r - 24 = -785129r, -t = -8r - 69 for t. -3 Solve 11s - y + 2533 - 1256 = 1356, 0 = 2s - 5y - 24 for s. 7 Solve -266 = 69541y - 69537y + 3r, -4y - 4r - 264 = 0 for y. -68 Solve 4693j + 5f + 101 = 4697j, -3j + 18 = -f for j. -1 Solve -3l - 2x = 216 - 220, -9l - 5x = -13 for l. 2 Solve 2a + 218 - 264 = 4g, -33a + 201 = -4g for g. -9 Solve -3b - 3h + 7h + 68 = 0, -316h = -17h - 200 + 6180 for b. -4 Solve -5j + 4j = -6d + 32, -5d + 9 = -j - 18 for d. 5 Solve 4f - 4d = 2f + 22, 685d - 684d + 16 = 2f for f. 7 Solve 10u - 136 = 5m - 18u, 0 = 3m - 2u - 0u + 52 for m. -16 Solve p - 3w - 25 = 0, -3w + 3w + 27 + 1 = 10p + w - 5 for p. 4 Solve -14l - 57l - 99l - 590 - 8 = -2f, 0 = 2l + 2l + 8 for f. 129 Solve -19y - 13y + 9a = -28y + 4a + 26, -3a + 6 = 0 for y. -4 Solve 5c = 4u + 135, 0 = 8c - 184u + 180u - 216 for c. 27 Solve 49 = -16i + 19c - 22c, -2i + 0i + 4c = -42 for i. -1 Solve -4j = -5v + 81, 0 = -5v + 220999j - 220998j + 84 for v. 17 Solve 4v = 15i + 190, 4v - 81 + 143 = -3i for v. -5 Solve -218 = 3d - 4c - 367, 4d = 32c + 172 for d. 51 Solve 62z = -8w + 56z + 144, 72 = 4w + 5z for w. 18 Solve 3a + 81 = -b - b - 2a + 204, 0 = -4b - 22a + 14a + 200 for b. 4 Solve -2x + 17 = -34571h + 34574h, h + 4x = 9 for h. 5 Solve -3g - 4p + 5 = p, 0 = -7g + 20p - 23p + 29 for g. 5 Solve -3m - 32p + 33 = 0, 1391p - 1396p + 44 = 4m for m. 11 Solve b - 75 = s - 3b + 38, -5s + 2b - 43 = 0 for s. 3 Solve 3y - 6b - 256 = -2b - 156, -5y = -2b - 162 for y. 32 Solve -5i + 15511 = -5p + 15421, i - 2p - 23 = 0 for i. 13 Solve 6f - 687 = -5v + 2f - 662, 0 = 37v - 3f - 348 for v. 9 Solve 740c - 19 = 356c + 373c - 2v, 0c + 69 = -2c + 3c + 17v for c. 1 Solve -59b + 96b - 4z - 931 + 1004 = 0, b - 28 = 2b - 3z for b. -1 Solve -2f + 6f = 4f + 4f + 73u - 3508, -5u + 241 = f for f. 1 Solve -i - 3c - 31 = -28 - 31, 4i = 4c + 112 for i. 28 Solve 0 = -3h + 48 + 35 - 26, -14h + 272 = -0n + 3n - 5h + 5h for n. 2 Solve -12z - 68 = 29z - 39z - 4b, -5z - 15b + 305 = 0 for z. 4 Solve 4b = 4u - 425 + 329, 2u = -b + 42 for u. 22 Solve -9n + 54 = -2l + 121, -2n + 4l - 69 = 3n for n. -5 Solve 3h + 297 = -8x + 223, -4x = 5h + 86 for h. -14 Solve 3g + 2s - 107 = 7g - 3g, 0 = -5g + 34s - 1855 for g. 3 Solve 32b = 64c + 24c - 92c + 368, 2b - 30 = -2c for c. 4 Solve -3s = -10w + 334, 2s - 3w + 503 - 405 = 0 for s. 2 Solve 3f + 1 - 22 = 3z + 9, -43f + 184 + 246 = -2z - z for z. 0 Solve 3t - 61347 = -35u - 60886, -2u + 2t = -22 for u. 13 Solve -1086486x + 1086494x = 3k + 44, -x + 20 = -4k for k. -4 Solve -2w = 12a - 383 + 301, -2a = 4w - 32 for a. 6 Solve 2p - 7j - 14 = 0, -5j - 8 + 13 = -15p + 15 for p. 0 Solve 3y - 213o - 89 = -218o, o = 4y + 4 for y. 3 Solve -66 = 122k - 61k - 55k, -15m - 3k + 12 = 0 for m. 3 Solve -4q + 4722 = -2o + 4734, 21 = 7q for o. 12 Solve 0z + 72 = -12z - 4c, -4z - 4c = -5z + 20 for z. -4 Solve 4t = -4r - 144, -40r + 30r = -4t + 346 for r. -35 Solve -j = 4g - 23, 610g = 581g + 4j - 317 for g. -5 Solve -2h + t - 1053870 = -1053896, 4t = -2h + 16 for h. 12 Solve 11g = 10y - 5y - 2g - 85, -4y - 14 = 6g for y. 4 Solve -11p = -2s - 10 - 34, -123p + s = -115p + 5s - 32 for p. 4 Solve 0 = -6o - 6, -16s - 1 = -14s + 5o - 6 for s. 5 Solv	{ "pile_set_name": "DM Mathematics" }
Let i = q - t. What is the second biggest value in -0.1, 2, i? i Let o(f) = f*3 - 7f*2 + 2f - 13. Let n be o(7). Which is the biggest value? (a) n (b) 0.3 (c) -3/7 a Let s = -92 + 88.4. Let w = -5.6 + 1. Let l = w - s. Which is the smallest value? (a) 0.2 (b) -0.6 (c) l c Suppose -4n + 5 - 1 = -2o, 2n - 4o = 8. Let d = -9 + 9.5. What is the fourth biggest value in 4, 13, n, d? n Let q = 1102 + -1101.6. Let t(j) = 2j - 7. Let k be t(6). Which is the second biggest value? (a) 0.5 (b) k (c) q a Let n = -255/2 - -129. Which is the smallest value? (a) -4 (b) n (c) 2 a Let w = 0.2 + -0.3. Let i = 31.2 + -27.2. What is the third smallest value in w, 0.3, i? i Let k = -1466 + 1463. What is the third smallest value in -8.1, -1, k? -1 Let p = 0.055 - -0.445. Which is the third smallest value? (a) 2/7 (b) -5/4 (c) p (d) -3 a Let p = -0.058 + 0.458. Let j be ((-8)/28)/(22/(-7)). What is the third biggest value in -3, 3, p, j? j Let j = 5.4 - 5.7. Let v = 4/79 + -250/1817. What is the biggest value in j, v, -0.44? v Let l = -0.0978 + -0.2022. Let t = -2.97 - 0.03. What is the biggest value in l, t, -0.2? -0.2 Let h(v) = -2v - 2. Let o be h(-2). Suppose op + 18 = -5j - 2, 3p = j - 64. Let i be ((-3)/(-10))/((-24)/p). What is the second biggest value in 4, i, -2/5? i Let f = -0.144 + 0.044. What is the second biggest value in 0.1, -1, f, 12? 0.1 Let g = -0.24 + 2.04. Let l = g - 5.8. Which is the biggest value? (a) l (b) -0.2 (c) 4 c Let f = -9.8 + 3.8. Which is the fourth biggest value? (a) 4 (b) -1/47 (c) 2 (d) f d Let d be -4120/416 + 1. Suppose 2a - 2 - 4 = 0. Let s = 7/16 + -9/16. What is the biggest value in d, s, a? a Suppose -117 = -6w - 81. Which is the biggest value? (a) 2/9 (b) 3 (c) w (d) -4 c Let f = 883/2 + -2645/6. Let s = 8.3 - 8. Let u = -0.1 - -0.1. Which is the third smallest value? (a) s (b) u (c) f c Let t = 17.5 + -0.5. Let q = -14 + t. Let i = q + -2.8. What is the biggest value in -3, -3/2, i? i Let g = -36.35 - -42. Let t = 2.35 + g. Let n = -0.3 + 0.5. What is the smallest value in t, 1/3, n? n Let v be 4/(-5)265/(-159). What is the biggest value in v, 45, -3, 9? 45 Let h be (8/20)/((-28)/(-12)). Let w = -88/105 + h. Which is the smallest value? (a) 4 (b) w (c) 2/9 b Let u be (35/20)/((-6)/16). Let m = -0.0156 + -2.9844. Which is the smallest value? (a) m (b) 2 (c) 0 (d) u d Suppose -5u = 6 + 19. Let o = -6 - -4. Let f = -4 - o. Which is the biggest value? (a) u (b) f (c) 0.3 c Let n = 13 - 13. Let z be (-3)/(-1) - (-772)/(-5). Let i = z + 152. What is the second smallest value in n, i, -2/13? n Let i = -0.02 - 4.98. Let h = 5.1 + i. Let q = 670 - 672. What is the third smallest value in h, q, -5? h Let p be (-2)/(-19) - (-46043)/(-779). What is the second biggest value in p, 4/7, 0.4, -0.3? 0.4 Suppose 2g = -g - 12. Let q be 23/7 - g/(-14). Which is the third biggest value? (a) 2/11 (b) q (c) 2 a Let g = 10 - 11. Suppose 0 = -28d + 27d + 4. Suppose 4k + 6 = 3x, -3k = 3x - dx + 7. Which is the second biggest value? (a) 6 (b) k (c) g c Let t = 2.304 + -1.804. Which is the third smallest value? (a) -5 (b) t (c) 25.5 c Suppose 0 = -23o - 18o - 41. What is the smallest value in 2/3, 3, 1/4, o? o Suppose 2h + h + 3 = 0, -4o = -3h - 107. Let r be (8 - 5) + (-82)/o. Which is the second biggest value? (a) r (b) -1/5 (c) 1 a Let w = -8 - -7. Let v = 4 - -3. Let u = 2 - v. What is the third biggest value in w, 3/7, u? u Let f = 21 - 24.6. Let s = f + 3.5. Which is the second smallest value? (a) 7 (b) -1 (c) s c Suppose -2y = -5r + 2y - 40, 5r - y + 25 = 0. Which is the smallest value? (a) r (b) 2/13 (c) -0.05 (d) -5 d Let x = 181.5 + -130. Let d = x - 51. What is the smallest value in 7, d, -0.2, -3? -3 Let x = 995/2 + -497. Let d(i) = 2i*2 - 6i + 7. Let w be d(5). Let k be w/(-15) + 2 + 0. Which is the smallest value? (a) 4 (b) k (c) x b Suppose -2t - 7 = -4u + u, 3t + 2u = 22. Suppose -l + 6 = 4f - 2, -tl - f + 17 = 0. What is the third biggest value in l, -0.4, 5? -0.4 Let t be 6/(-8) + (-6)/(-40). Suppose w = 3w. Let f = -0.003 + -0.297. What is the biggest value in f, w, t? w Let r = 583 + -586. What is the third biggest value in 9.3, -2, r, 0.4? -2 Suppose x + 7 = -2b - 2x, 5b - 2x = 11. Let m be (-2b/(-2))/((-8)/(-12)). What is the third biggest value in 2/9, m, -1? -1 Let f = 0.3 + -3.3. Let l = -161/1425 + -2/285. Let m = 2/25 - l. What is the third biggest value in f, -1/2, m? f Let m = -1759 - -1758.5. Which is the third biggest value? (a) m (b) -0.4 (c) -0.71 c Let w(l) = -14l + 25. Let s be w(9). Let x = 710/7 + s. Which is the fourth biggest value? (a) 7 (b) -0.2 (c) x (d) -5 d Let m = 70 - 67. Let o be (-1)/6 + (-25)/(-60). Which is the biggest value? (a) o (b) m (c) 1 b Let o = -243/2 - -731/6. Which is the second smallest value? (a) -0.3 (b) 6 (c) o (d) -0.5 a Let r be 5 - (11 + (-2)/1). Let t be 8/(-8) + (-4)/14r. Which is the third smallest value? (a) -5 (b) 2/13 (c) 2 (d) t b Let s = 6826.5 + -6827. Let b = -3 + 2.7. What is the smallest value in 4/5, b, s? s Suppose -4v = 5o + 31, -v - 4o - o - 19 = 0. Let l = -2.48 - 7.62. Let t = l + -1.9. Which is the biggest value? (a) 0 (b) t (c) v a Let c = -0.81 - 0.19. What is the smallest value in 0.1, -12, c, 3? -12 Let q = 363 - 392.6. Let f = 33.3 + -4.3. Let k = q + f. Which is the third biggest value? (a) k (b) -5 (c) 1/4 b Let p = -0.9 + 0.4. Let g = -82.7 - -78.7. Which is the third biggest value? (a) 2 (b) g (c) p (d) 5/3 c Let g = 7 + 14. Let w = 21.52 + -0.02. Let o = g - w. Which is the second smallest value? (a) o (b) 2/9 (c) -3/7 c Let f = -35.9812 - -0.0812. Let h = -36 - f. What is the biggest value in 5, h, 0.2? 5 Let u = -934 + 939. Let c = -1.6 - 0.4. Let g = c + 1. What is the third biggest value in g, -4, u? -4 Let u = -1.6 + 0.686. Let k = u + -0.086. Let z be 2/(-8) + 2 + -2. Which is the smallest value? (a) z (b) k (c) 2 b Let m = -31.6 + 2.6. Let j = 29.1 + m. Which is the third biggest value? (a) 5 (b) -4 (c) j (d) 8 c Suppose b = -10b - 66. Let r be ((-4)/b)/((-10)/6). What is the biggest value in -0.5, -5, r? r Let m = 2/295 - 319/3540. Let p = 0.06 + 0.07. Suppose 4s = -4s - 16. Which is the third smallest value? (a) m (b) p (c) s b Let s = 1260/7051 + 2/641. Let o = 3 + -1. Let i = -0.001 - 2.999. What is the smallest value in o, i, s? i Let o be 1/(7/62). Let h be 4 - (1 - 5)/(-4). Which is the biggest value? (a) h (b) -6 (c) o a Let h = 47 - 45. Suppose -4r - u = 96 - 19, 2u = -hr - 40. Which is the biggest value? (a) r (b) 0.2 (c) 0 b Let g = -8 - 6. Let a = -24 - g. Let j be (-9)/a - (-4)/(-10). What is the third smallest value in -0.2, -4/5, j? j Let n = 1931 + -1929. Which is the biggest value? (a) -122 (b) n (c) -2 b Let s = 301/5 + -60. Let h be 0(-1 + 2) + 42/(-7). What is the smallest value in s, -4, h, 5/3? h Let n be ((-12)/(-90))/(2/(-3)). Let l = 0.3 + -0.5. Let y = l + 0.4. What is the third biggest value in n, y, 3/4? n Let x = -2.09 - -24.99. Let t = 25 - x. Let s = 0.9 + t. Which is the biggest value? (a) 2/17 (b) -2/9 (c) s c Let g = 222 + -1558/7. Let r = -0.1 - 0. Let h be 6 - 45/(-117)-16. What is the third smallest value in h, g, r? r Let w = -3378 - -3381. Let l = 5 + 4. Let d be (12/6)/(-3). What is the second biggest value in w, d, l? w Let p = 61 + -60.9. Let o = -1.5 + 1.8. What is the third smallest value in p, o, 11? 11 Suppose -5u + 5 = 0, -4i - 13 = 3u - 0u. Let k be 3/((32 + i)/(-4)). Let m = -0.1 + 0.2. What is the third smallest value in -5/2, m, k? m Suppose -7u = -4u + 6. Let v = u - 2. Let r be (-7)/(-12) + v/12. Which is the second biggest value? (a) -2 (b) 1/3 (c) r c Let f = -1 + 6. Let v(y) = -y2 - 7y. Let q be v(-7). Suppose fd - 3s = 2 + 3, -2d - 3s + 23 = q. What is the smallest value in 2, -2/13, d? -2/13 Let p = 1761 + -1766. Let k = 5 + -2. Which is the biggest value? (a) 0.4 (b) -2 (c) k (d) p c Let n = -113/4 + 343/12. Let l = -4 - -7. What is the smallest value in -5, n, 0.5, l? -5 Let f = 6 + 23. Let s = f - 25. Which is the smallest value? (a) s (b) -6 (c) 1 b Suppose -33b - 259b = 457 + 127.	{ "pile_set_name": "DM Mathematics" }
-73)/(-5). Let a be l(r). Suppose -13s + as = 115. What is the units digit of s? 3 Let d(c) = -3c - 2c2 - c3 - 8c2 - 13c + 4c2 - 37. What is the hundreds digit of d(-8)? 2 Suppose 12u + 210 = 1590. Let l(v) = v*3 + 5v*2 - 2v + 8. Let g be l(-7). Let i = u + g. What is the tens digit of i? 3 Let g be ((-4)/(-5))/(30/75). Suppose -gm + 192 = c, 0m = c - 4m - 186. What is the hundreds digit of c? 1 Suppose -12w - 35w + 1430320 = 105w. What is the units digit of w? 0 Let m = -38 - 166. Let h = 161 - m. What is the tens digit of h? 6 Let w(y) be the first derivative of 53y3/3 + y2/2 - 10y - 44. What is the hundreds digit of w(3)? 4 Let x(w) = w*3 - 7w*2 + 10w - 15. Suppose -3k + 23 = 4d, -5d = 2k + k - 25. Suppose 5m = -25, -2m = db + 2b - 14. What is the units digit of x(b)? 9 Let q(y) = 84y - 12. Suppose 0 = -7j - 3 + 31. What is the tens digit of q(j)? 2 Let d = 368 - 319. Suppose 4708 = dl - 45l. What is the units digit of l? 7 Let m(r) be the third derivative of r4/24 + r3/3 + 18r2. Let a be m(-3). Let u(l) = 23l*2 - 4l. What is the units digit of u(a)? 7 Let f(a) = -47a - 229. Let z be f(-5). Let v = 3 + -3. Suppose v = -zt + 5t + 94. What is the units digit of t? 4 Let f(c) = -3c - 16. Let u(n) = -16n - 80. Let a(p) = -11f(p) + 2u(p). Let k be a(-15). What is the tens digit of (-5 - -2)/(3/(-26)) - k? 2 Let l(t) = t2 + t + 1. Let c be l(-1). Suppose -23 = 5x + 6v - 8, 0 = 3x - v - 14. What is the units digit of (1 - x)c - -31? 9 Suppose -3u - 368 + 1684 = 2c, -4c - 3u = -2632. Suppose -15t + c = -t. What is the tens digit of t? 4 Suppose 106 = -29l - 97. What is the tens digit of l7/(-49) + 222? 2 Suppose -1073 = 42z - 31355. What is the units digit of z? 1 Let p(a) = -26a - 4. Let z be p(7). Let o be z/(-9) + 10/(-15). Suppose -3c - 241 + 9 = -5d, -o = 5c. What is the tens digit of d? 4 Let g(b) = -19b*3 + 3b*2 + 18b + 303. What is the hundreds digit of g(-12)? 3 What is the units digit of 135(-13)/(156/(-352))? 0 Let c be ((-244)/(-8))/(-3 - (-21)/6). Suppose 2q - 327 = -2z + c, -380 = -2q - 4z. What is the tens digit of q? 9 Let c(r) = 41r*2 + 15r - 263. What is the hundreds digit of c(13)? 8 Suppose w + 9 = 4n, 3n + 4 + 18 = -5w. Let j be n/(3(-1)/(-6)). Suppose -2u - 4l + 50 = 0, 3l = 2u - jl - 23. What is the units digit of u? 9 Suppose 0 = -10r + 9r + 4383. What is the tens digit of r/12(-4)/(-9)6? 7 Suppose 76683 = 4b + o, 2b + 12o - 38359 = 9o. What is the thousands digit of b? 9 Let b(w) = -145w + 801. What is the thousands digit of b(-31)? 5 Suppose -6y - 552 = -4164. Suppose -3i = -4i + 5c + 632, -i + y = c. What is the units digit of i? 7 Suppose 8 = r - 5r. What is the units digit of (2(r + 694))/(2 - 0)? 2 Suppose -18 = -2k + 4. Let f(n) = 127 + kn + 3n - 100. What is the units digit of f(14)? 3 Suppose 853s - 871s + 910332 = 0. What is the thousands digit of s? 0 Suppose 2f = 3c + 43614 - 239669, 4c = -5f + 261353. What is the units digit of c? 7 Let t(q) = 29q - 1. Let k(v) = 115v - 4. Let j(l) = -4k(l) + 18t(l). Suppose 0 = y - 3y - 2m + 6, 8 = -2y + 5m. What is the units digit of j(y)? 0 What is the thousands digit of (-3748)/(-14 + (-7776)/(-558))? 8 Let r(g) = -17394g*3 + 6g*2 - g - 3. What is the units digit of r(-1)? 8 Suppose -28747 + 8357 = -5k. What is the tens digit of k? 7 Let n = 98 + -51. Suppose 5l - 50 = -3r, -r + 2l = -n + 12. Suppose -r + 4 = -3v + 4t, -3 = -5v - 4t. What is the units digit of v? 3 What is the units digit of 11720/2 + 27/(-9)? 7 Let m(s) = 2s*3 - 4s - 3. Let l be m(-2). Let i be (6/9)/(68/(-2142)). What is the tens digit of l/4(i + 1)? 5 Let p(t) = -2t2 + t2 + 5t2 + t - 256 - 3t*2 - 18. What is the tens digit of p(-43)? 3 Suppose 5f + 3j = 55188, -2j - 181 = -f + 10854. What is the ten thousands digit of f? 1 Suppose -i + 47 = p, -4p + 27 + 167 = i. What is the hundreds digit of 5 + 7/(p/2590)? 3 Suppose s = 4k + 7284, 4s + 19k = 14k + 29052. What is the thousands digit of s? 7 Suppose -2x + 3j + 266 = 0, 381 + 246 = 5x + 2j. Suppose r - 170 - x = 0. What is the units digit of r? 7 Let k(b) = 5b*3 + 4b*2 - 13b + 23. What is the units digit of k(6)? 9 Let o = 23770 + -14397. What is the hundreds digit of o? 3 Let l = -811 + 1503. Suppose 5u - 2j = 697, -5u - 6j + l = -3j. Suppose -2b = 3z - 306, -4z + 2z = -b + u. What is the tens digit of b? 4 Let p = 125 - 96. Suppose 6206 + 2668 = pu. What is the units digit of u? 6 Let n(c) = -c*3 + 39c*2 + 53c - 1058. What is the hundreds digit of n(26)? 1 Let s = -16851 - -24411. Suppose -13z + 3z = -s. Suppose -z = -2m - 3m + w, -4m + 4w + 608 = 0. What is the tens digit of m? 5 Let a = -128 - -130. Suppose -ax + 1285 + 533 = 0. What is the tens digit of x? 0 Let t = -3748 - -6453. What is the units digit of t? 5 Suppose 5x + 169 = 24. Suppose -10l = -0l - 570. Let r = l + x. What is the units digit of r? 8 Let q(o) = 9o2 + 0o*2 - 8o*2 - 5 + 9o. Let j be q(-10). Suppose 0 = jn - 2 - 408. What is the tens digit of n? 8 Let g(f) = 29f*2 + 42f + 141. What is the hundreds digit of g(20)? 5 Let y = -14085 + 18205. What is the units digit of y? 0 Let y(s) = -102s3 - 2s*2 + 14s - 10. What is the hundreds digit of y(-6)? 8 Let y(f) = -f. Let o be y(-4). Suppose 0 = -2d + 10, d = ok - d + 14. What is the units digit of 3/(k + (0 - -2))? 3 Suppose 2p - 5l - 10 = 0, -5l = 1 - 11. Let w(u) = 116u*2 - 5u - u*3 + 123u*2 + 14 - 355u*2 + 127u*2. What is the units digit of w(p)? 4 Suppose 3y + 0y + 108 = 0. Let f be (-6)/(-1)(-16)/y-3. What is the units digit of f/48 - 110/(-12)? 9 Suppose -110i + 111i + 1 = 0. Let l(h) = -602h*2 + 4h + 11. Let c(b) = 301b2 - 2b - 6. Let y(k) = -5c(k) - 3l(k). What is the units digit of y(i)? 0 Let l = -124 - -117. Let v(h) = -20h - 41. What is the tens digit of v(l)? 9 What is the tens digit of ((-187)/(-34))/(((-2)/(-16))/((-66168)/(-48)))? 5 Let o(i) = -2i*3 - 12i*2 - 10i - 23. Suppose 3m = 9, 5 = -3d - 2m - 19. What is the tens digit of o(d)? 7 Suppose t - 80 = -0g - 3g, g + 2t - 20 = 0. What is the units digit of ((-21)/g-106)/(6/44)? 3 Let x(p) = -p3 - 13p*2 - 16p - 1. Let j be 101 + 5/(10/(-6)). Let c = 86 - j. What is the tens digit of x(c)? 4 Let j = -2620 + 11684. What is the tens digit of j? 6 Let r(i) = 1107i2 + 5i - 6. Let q be r(1). Let n = q - 546. What is the hundreds digit of n? 5 What is the units digit of -221/(-4) + -10 - 21647/(-2)? 4 Let s be 2/(-12) + 4/(-24)587. Let b = 28 - 4. What is the units digit of (b/14)/(-6 - 589/s)? 8 Let v = 332 + -217. Suppose 15 = 5u - 0u. Let m = v - u. What is the hundreds digit of m? 1 Let t(v) = -18v3 - 3v*2 - 3v + 5. Let s be t(3). Let a = -283 - s. What is the units digit of a? 4 Let n = -5 + 7. Suppose 2o + n = -2k, -3o - 8 = 4k + 2o. Suppose 5q + 3c - 453 = 0, -c + 267 = kq - 4c. What is the units digit of q? 0 Suppose 3j = -2d + 369, 3d - 259 = 3j + 272. Let r(i) = i2 + 6i + 3. Let b be r(-6). Suppose -w + d = bw. What is the tens digit of w? 4 Let n = -131 - -133. Suppose ny - s - 7 = 203, 0 = 2y + 2s - 210. What is the hundreds digit of y? 1 Suppose 17n = 152713 + 192630 + 415917. What is the units digit of n? 0 Let r(m) = -m + 3m*2 + 3m + 5m + 122 - 5m. What is the hundreds digit of r(0)? 1 Suppose -2h - 2h + 1484 = 0. Suppose t + 2t - 5f - 6 = 0, -3f = -t + 2. Suppose -y = 5v + 2y - h, tv - 164 = 4y. What is the units digit of v? 6 Suppose -24033 = 8y - 54193. What is the tens digit of y? 7 Let q(k) = -7k + 6. Let y be q(20). Let p = y + 133. Let f(w) = -230w*3 + w + 2. What is the tens digit of f(p)? 3 Let k(v) = -6v + 49. Let o be (0 - -2)/(0 - 2/21). What is the hundreds digit of k(o)? 1 Let f(k) = -21k + 1. Let r(h) = h2 + 14h + 15. Let b be r(-13). Suppose -bw + t = 1, -2t = -7w + 4w. What is the units digit of f(w)? 3 Let l(c) = 232c2 - 19c + 44. What is the tens digit of l(6)? 8 Let p = 212 - 196. What is the hundreds digit of ((-1828)/p + 6)-4? 4 Let a be 7(-3)/6 + (-51)/(-34). Let t(j) = -142*j + 26. What is the tens digit of	{ "pile_set_name": "DM Mathematics" }
the power of 1/8, to the nearest integer? 3 What is 131 to the power of 1/2, to the nearest integer? 11 What is 16184 to the power of 1/2, to the nearest integer? 127 What is the tenth root of 596 to the nearest integer? 2 What is the third root of 6132 to the nearest integer? 18 What is 21183 to the power of 1/2, to the nearest integer? 146 What is the fourth root of 4053 to the nearest integer? 8 What is the cube root of 60 to the nearest integer? 4 What is the sixth root of 16494 to the nearest integer? 5 What is the third root of 1104 to the nearest integer? 10 What is 1024 to the power of 1/7, to the nearest integer? 3 What is 722 to the power of 1/5, to the nearest integer? 4 What is the fourth root of 2063 to the nearest integer? 7 What is 73517 to the power of 1/2, to the nearest integer? 271 What is 73580 to the power of 1/2, to the nearest integer? 271 What is the fourth root of 4535 to the nearest integer? 8 What is the square root of 9752 to the nearest integer? 99 What is 57365 to the power of 1/2, to the nearest integer? 240 What is the ninth root of 1252 to the nearest integer? 2 What is the cube root of 96264 to the nearest integer? 46 What is 2509 to the power of 1/8, to the nearest integer? 3 What is 15802 to the power of 1/9, to the nearest integer? 3 What is 48939 to the power of 1/5, to the nearest integer? 9 What is the square root of 2950 to the nearest integer? 54 What is the third root of 1078 to the nearest integer? 10 What is the third root of 18917 to the nearest integer? 27 What is the sixth root of 25265 to the nearest integer? 5 What is 1854 to the power of 1/4, to the nearest integer? 7 What is the square root of 128178 to the nearest integer? 358 What is 2224 to the power of 1/10, to the nearest integer? 2 What is 539 to the power of 1/8, to the nearest integer? 2 What is the square root of 128090 to the nearest integer? 358 What is the cube root of 6111 to the nearest integer? 18 What is 1408 to the power of 1/2, to the nearest integer? 38 What is the square root of 61861 to the nearest integer? 249 What is 569 to the power of 1/3, to the nearest integer? 8 What is 834 to the power of 1/3, to the nearest integer? 9 What is 42356 to the power of 1/3, to the nearest integer? 35 What is the third root of 20929 to the nearest integer? 28 What is 1467 to the power of 1/6, to the nearest integer? 3 What is 3426 to the power of 1/9, to the nearest integer? 2 What is the third root of 11661 to the nearest integer? 23 What is 1118 to the power of 1/4, to the nearest integer? 6 What is the tenth root of 854 to the nearest integer? 2 What is 10224 to the power of 1/3, to the nearest integer? 22 What is the third root of 2438 to the nearest integer? 13 What is 451 to the power of 1/2, to the nearest integer? 21 What is the cube root of 105108 to the nearest integer? 47 What is 26597 to the power of 1/6, to the nearest integer? 5 What is the cube root of 1907 to the nearest integer? 12 What is the fourth root of 716 to the nearest integer? 5 What is the ninth root of 20996 to the nearest integer? 3 What is 978 to the power of 1/10, to the nearest integer? 2 What is the third root of 13423 to the nearest integer? 24 What is the seventh root of 916 to the nearest integer? 3 What is 45859 to the power of 1/3, to the nearest integer? 36 What is 6557 to the power of 1/6, to the nearest integer? 4 What is 539 to the power of 1/2, to the nearest integer? 23 What is the sixth root of 1215 to the nearest integer? 3 What is 58260 to the power of 1/3, to the nearest integer? 39 What is the third root of 1117 to the nearest integer? 10 What is the square root of 6450 to the nearest integer? 80 What is 25510 to the power of 1/2, to the nearest integer? 160 What is the square root of 30487 to the nearest integer? 175 What is the third root of 3640 to the nearest integer? 15 What is 3889 to the power of 1/2, to the nearest integer? 62 What is the ninth root of 957 to the nearest integer? 2 What is the square root of 51395 to the nearest integer? 227 What is the square root of 58211 to the nearest integer? 241 What is the square root of 14718 to the nearest integer? 121 What is 22663 to the power of 1/2, to the nearest integer? 151 What is 3510 to the power of 1/5, to the nearest integer? 5 What is 51890 to the power of 1/2, to the nearest integer? 228 What is the cube root of 185115 to the nearest integer? 57 What is the cube root of 4317 to the nearest integer? 16 What is the seventh root of 32070 to the nearest integer? 4 What is the square root of 2831 to the nearest integer? 53 What is the square root of 1061 to the nearest integer? 33 What is the cube root of 35050 to the nearest integer? 33 What is the square root of 30904 to the nearest integer? 176 What is the cube root of 1329 to the nearest integer? 11 What is 54125 to the power of 1/3, to the nearest integer? 38 What is the ninth root of 1877 to the nearest integer? 2 What is the third root of 105 to the nearest integer? 5 What is the cube root of 49619 to the nearest integer? 37 What is 788 to the power of 1/3, to the nearest integer? 9 What is the third root of 1197 to the nearest integer? 11 What is 58726 to the power of 1/10, to the nearest integer? 3 What is the third root of 135760 to the nearest integer? 51 What is the sixth root of 68555 to the nearest integer? 6 What is the square root of 14581 to the nearest integer? 121 What is 23280 to the power of 1/2, to the nearest integer? 153 What is 3994 to the power of 1/7, to the nearest integer? 3 What is 1144 to the power of 1/2, to the nearest integer? 34 What is 157 to the power of 1/8, to the nearest integer? 2 What is 1608 to the power of 1/9, to the nearest integer? 2 What is the seventh root of 9618 to the nearest integer? 4 What is the sixth root of 1744 to the nearest integer? 3 What is the square root of 13585 to the nearest integer? 117 What is the square root of 15589 to the nearest integer? 125 What is the cube root of 31831 to the nearest integer? 32 What is the third root of 666 to the nearest integer? 9 What is 3464 to the power of 1/2, to the nearest integer? 59 What is 1986 to the power of 1/2, to the nearest integer? 45 What is 868 to the power of 1/2, to the nearest integer? 29 What is the ninth root of 68029 to the nearest integer? 3 What is 85066 to the power of 1/7, to the nearest integer? 5 What is 781 to the power of 1/4, to the nearest integer? 5 What is the seventh root of 26018 to the nearest integer? 4 What is the tenth root of 26162 to the nearest integer? 3 What is 4859 to the power of 1/3, to the nearest integer? 17 What is the ninth root of 43318 to the nearest integer? 3 What is the fourth root of 3212 to the nearest integer? 8 What is 11077 to the power of 1/2, to the nearest integer? 105 What is 944 to the power of 1/8, to the nearest integer? 2 What is 396 to the power of 1/2, to the nearest integer? 20 What is the eighth root of 1411 to the nearest integer? 2 What is the fifth root of 21283 to the nearest integer? 7 What is the cube root of 1160 to the nearest integer? 11 What is 30007 to the power of 1/2, to the nearest integer? 173 What is the ninth root of 1418 to the nearest integer? 2 What is the fifth root of 2001 to the nearest integer? 5 What is the square root of 12121 to the nearest integer? 110 What is the fourth root of 11841 to the nearest integer? 10 What is the cube root of 435 to the nearest integer? 8 What is the seventh root of 16264 to the nearest integer? 4 What is 4347 to the power of 1/9, to the nearest integer? 3 What is the sixth root of 504 to the nearest integer? 3 What is the fifth root of 34596 to the nearest integer? 8 What is 17 to the power of 1/6, to the nearest integer? 2 What is the square root of 1682 to the nearest integer? 41 What is 85069 to the power of 1/5, to the nearest integer? 10 What is the eighth root of 1034 to the nearest integer? 2 What is the cube root of 28852 to the nearest integer? 31 What is the cube root of 15491 to the nearest integer? 25 What is 8260 to the power of 1/3, to the nearest integer? 20 What is the third root of 3497 to the nearest integer? 15 What is the third root of 880 to the nearest integer? 10 What is 51950	{ "pile_set_name": "DM Mathematics" }
-0.2 c What is the fifth smallest value in -36260, -2/19, 0.1, -3/5, -4/5, 4? 0.1 Which is the third smallest value? (a) 2359 (b) -2/13 (c) 227/8 a What is the smallest value in 0.5, -5, -0.5, -3, 29, 6, 7/5? -5 Which is the third smallest value? (a) 0.1 (b) -6 (c) 0.2 (d) -0.04 (e) -21 (f) -4 f Which is the sixth smallest value? (a) 0.3 (b) 3 (c) 9/4 (d) -0.2 (e) 73/5 (f) 12/13 e Which is the smallest value? (a) 0.1 (b) -356 (c) -164 (d) -3/10 (e) 0.2 b What is the third smallest value in -1383.46, -1, -0.3, -1.2? -1 What is the fourth biggest value in -4, -38, -52/7, 13.37? -38 Which is the biggest value? (a) -3/5 (b) 0 (c) -89/6 (d) 0.3 (e) -359 (f) -31 d Which is the third biggest value? (a) -59/4 (b) -4 (c) 0.9 (d) -1.4 (e) -48 (f) 1 d What is the smallest value in 2/7, -2/7, 547300, 2/9, -4, 5, 3? -4 What is the fourth biggest value in 6, -6, -5717, 1? -5717 Which is the third smallest value? (a) 322 (b) -5 (c) -7133 a What is the fifth smallest value in 14, 5, -2, 2, 0.3, -15206, -5? 2 Which is the sixth biggest value? (a) -8/19 (b) -0.9573 (c) 1/6 (d) -1/4 (e) 0 (f) -3 f Which is the smallest value? (a) -1/6 (b) -8 (c) -6134492 c What is the fourth smallest value in 2, -113/28127, -3, -0.4, 4/7? 4/7 What is the fourth smallest value in 5, 3, 2.7, -1, -5, 149, 1/5? 2.7 Which is the third smallest value? (a) 685149 (b) 2.3 (c) -1 a Which is the fourth biggest value? (a) 0.1 (b) -0.3 (c) 6809 (d) -7 (e) -1 (f) 1/3 b Which is the third smallest value? (a) 3 (b) 0.18 (c) 8.86 (d) 0 (e) -1 (f) -5 d What is the fourth smallest value in 5, 8.38, 1/33, 21? 21 Which is the third smallest value? (a) -3.36 (b) -85 (c) 2/3 (d) -5 (e) -160 d What is the fourth smallest value in 4, -0.1, 5, 41.5? 41.5 What is the biggest value in 0.2, 0, 9975/8, -1/6? 9975/8 Which is the fifth smallest value? (a) 3 (b) 0.5 (c) 0.2 (d) -1482 (e) -0.78 (f) -0.5 b What is the smallest value in -34, 2493, 9, 1/7? -34 What is the smallest value in 5, 2, 8090, 12, -6? -6 Which is the third biggest value? (a) 2/3 (b) -2 (c) 0.089 (d) 17.5 (e) -0.23 c Which is the fourth smallest value? (a) -71/50 (b) 2/13 (c) -0.2 (d) -52 (e) 2/43 (f) -5 c Which is the smallest value? (a) 2.6 (b) 2.1 (c) 3/7 (d) 46187 c What is the fifth smallest value in -28, 22, -1/3, 640, 37? 640 Which is the fifth smallest value? (a) 3 (b) 32 (c) -1793 (d) 1/10 (e) -374 b Which is the sixth smallest value? (a) 2/7 (b) 0.5 (c) 0.1 (d) -2/5 (e) -105 (f) 1 (g) 8 f Which is the smallest value? (a) -0.2 (b) 1/6 (c) -3.66 (d) -27.75 d What is the second smallest value in -2927.5, 27.7, 5, -6? -6 What is the third biggest value in 4, -0.3, 157/5, 1, -0.06, 333? 4 Which is the biggest value? (a) -190 (b) 4/3 (c) 0 (d) 6/5 (e) 1 (f) -5 (g) 4 g What is the second smallest value in -292, 18.529, 0.41? 0.41 What is the second smallest value in 3/2, 0.06, 0.5, -165/106? 0.06 What is the fifth biggest value in 2/25, -70, 2, -2, 0.5, 2/19, 1? 2/25 Which is the third biggest value? (a) -41/5 (b) 3 (c) 1/8 (d) -57/5 (e) 0 e Which is the third biggest value? (a) -3 (b) -2/3 (c) -0.3 (d) -2/25 (e) -3/7 (f) -315 (g) -4 e What is the second biggest value in -931, -1/4, -1.94, -0.18? -1/4 Which is the smallest value? (a) -2/11 (b) 5430 (c) -3/8 c Which is the second smallest value? (a) 0.006 (b) -37 (c) -2.542 (d) 5 (e) 2 (f) 3/7 c Which is the second biggest value? (a) -3/1333 (b) 3 (c) -2/13 (d) 1/22 d What is the fourth smallest value in 14, -0.4, -0.043, 8, 17, 4, -4.9? 4 Which is the third biggest value? (a) -12/5 (b) -4 (c) 0.1 (d) -5 (e) -1/57914 a Which is the second biggest value? (a) -0.04 (b) -2 (c) -9.1722 (d) -0.3 (e) -7 d What is the fourth smallest value in -12, -5, 1, 0.67, -0.15, 1/4? 1/4 What is the biggest value in -907150, 2/5, -11, 2? 2 What is the fourth smallest value in 15, -2/47, -0.087, 0.998? 15 What is the fifth smallest value in 631, 1, 7, 5, 5/6, -2/7, 385? 7 Which is the fifth smallest value? (a) 4 (b) 1 (c) 3 (d) 10196 (e) 15/2 d What is the third smallest value in -0.023, -940, 2/17? 2/17 Which is the biggest value? (a) -128 (b) 47435 (c) -1/3 b What is the fourth smallest value in 10, -1, -0.01116, 1, 3, 5? 3 Which is the fifth smallest value? (a) 0.063 (b) -4/3 (c) 0.602 (d) 0 (e) -2 c Which is the third biggest value? (a) -2/5 (b) 0 (c) -0.2 (d) -2 (e) 7575993 c Which is the second smallest value? (a) -19 (b) 3/10 (c) 2126 b Which is the fourth smallest value? (a) -23 (b) 0.2 (c) 3/10 (d) -2/5 (e) 9/5 (f) -26/35 b What is the smallest value in -1/5, 15/59, -2/3, 2.9? -2/3 What is the sixth smallest value in -27, 0.05, -2/7, 5, 0, 1/7, 1.3? 1.3 Which is the smallest value? (a) 4 (b) -1 (c) 24 (d) -1/2 (e) 818 b What is the third biggest value in -396.57, -5, 6/11? -396.57 Which is the third smallest value? (a) -88 (b) 73 (c) 1/3 (d) -11 c Which is the biggest value? (a) -0.44 (b) 1/3 (c) 0.07 (d) 0 (e) -809 b Which is the biggest value? (a) 5/4514 (b) -2/3 (c) -2 (d) 2/899 d What is the fourth biggest value in 10, -1/4, -5, -3/7, 0.021, 711, 2? 0.021 What is the biggest value in -4, -2, -13165, 3, -4/3? 3 Which is the fourth smallest value? (a) -6 (b) -0.3 (c) -3 (d) 3/5 (e) -10 (f) 142 (g) -2 g Which is the sixth smallest value? (a) -1/2 (b) 0.3 (c) 50 (d) -0.4 (e) -4 (f) 4.5 c Which is the second smallest value? (a) 2/37 (b) -3224 (c) 3/2 a What is the smallest value in -29, -7, -0.04, -3/55? -29 Which is the smallest value? (a) 1 (b) 8788.84 (c) 3/23 c What is the third biggest value in 8.9, -0.04, -54274/5? -54274/5 What is the second smallest value in -1/8, -5, -4469, 4, 167? -5 What is the biggest value in -0.1, -3, 1/2, -527, 14? 14 Which is the third biggest value? (a) 1/461 (b) 0.1 (c) 3 (d) -1 (e) 13 b Which is the fourth biggest value? (a) -144 (b) -116/23 (c) 1/9 (d) 1/17 a What is the third smallest value in -0.05, -0.222667, -2, -3? -0.222667 Which is the third smallest value? (a) -1 (b) 93 (c) -28 (d) 4/3 (e) 2/3 (f) -3 (g) -4 f What is the fifth biggest value in -1/29, -4/157, -1/7, -0.2, 1/10? -0.2 What is the seventh biggest value in 0.1, 3/5, -3, 116, -28, 0.3, 21? -28 Which is the second biggest value? (a) 4/52789 (b) 5 (c) 126 b Which is the third biggest value? (a) 1.87 (b) -32.4 (c) 1/9 (d) -2/7 (e) -7/2 d Which is the second smallest value? (a) -5 (b) 5 (c) -17376/11 (d) 2 (e) 0.4 a What is the third biggest value in -29, -2/5, -3/7, 3, -2/3, 0.04807? -2/5 What is the third biggest value in -157, 2.1, -0.3, 5, -4? -0.3 Which is the biggest value? (a) -0.05 (b) 7 (c) -5/4 (d) -3 (e) 8 (f) -0.047 (g) 3/5 e What is the biggest value in -8, -3/8, -360661? -3/8 What is the biggest value in 1/3, 221, 21/4, 5? 221 Which is the second biggest value? (a) 2/13 (b) -336076 (c) -2/3 (d) 1 a What is the fourth smallest value in -0.17, -19, -10/27, 1/13? 1/13 Which is the fourth smallest value? (a) 5 (b) -35 (c) 1/7 (d) 0.5 (e) 23071 a What is the second biggest value in 202.221, 2/5, -0.1, 2? 2 Which is the biggest value? (a) 4 (b) 0.3 (c) 2 (d) -31 (e) -1 (f) 134 f What is the third biggest value in -3/5, -0.3442377, -3? -3 Which is the third smallest value? (a) 0.12 (b) 250099.1 (c) -2/13 (d) -2 a Which is the second smallest value? (a) -2 (b) -1 (c) -142 (d) -97 (e) 24 (f) -5/3 d What is the biggest value in 0.9, -4, 0.07, -0.227374? 0.9 Which is the second smallest value? (a) 1/4 (b) -3 (c) -6 (d) -1/15 (e) 3 (f) 3/16 b Which is the fourth smallest value? (a) -4 (b) -0.6 (c) -1 (d) -91892 b Which is the fourth smallest value? (a) -3 (b) 5 (c) -13 (d) 4 (e) -2494 d What is the fourth biggest value in -8, -0.09, 4, -5, -0.2, -2/7, -8/7? -2/7 What is the smallest value in -9/122, -4, 376, 1/5, -0.4, -2/9? -4 Which is the fourth biggest value? (a) 0.4 (b) 3/4 (c) 0 (d) 3092 (e) -3.7 (f) -5 (g) -3/4 c What is the second biggest value in 4/101, -33183, -0.08? -0.08 Which is the fourth smallest value? (a) 0.4 (b) -1 (c) -1.44 (d) 22200 d Which is the smallest value? (a) -0.4 (b) 0 (c) -	{ "pile_set_name": "DM Mathematics" }
ctor 12c3 - 10c*3 - 5c*3 - 3c*r. -3c*2(c + 1) Let f(q) be the second derivative of q*4/90 - 17q*3/9 + 82q*2/5 + 9q + 14. Factor f(x). 2(x - 82)(x - 3)/15 Let l(x) be the second derivative of -x*5/60 + 125x*4/6 - 31250x*3/3 + 7812500x*2/3 + 7x - 19. Determine k so that l(k) = 0. 250 Let o(k) = 19k2 + 6k. Suppose -i - 4n = 0, -6n - 12 = -2n. Let r(t) = t. Let z(m) = ir(m) - 3o(m). Factor z(f). -3f(19f + 2) Let d = -396521 + 566889. Find b, given that 412b2 - 148b*2 + 0b*3 - 2b*3 + 4b*3 + 13179b + d - 1563b = 0. -44 Suppose -7o + 5c = -2o, 0 = 2o + 3c. Suppose o = -4s + 8s - 128. Let -st2 - 20t - 5t3 - 11t*2 + 68t*2 = 0. What is t? 0, 1, 4 Suppose 0 = 3m, 3x - 209 = -3m + 298. Suppose 93 + 50 = 3h + p, -x = -4h + 3p. Suppose 7u - hu2 + 2 + 48u*2 - 3u = 0. What is u? -1 Suppose 3w + 4x = -748, -3x = w + w + 497. Let p = -106 - w. Determine f, given that -38f*2 + 3f*2 - 21 + pf - 19 = 0. 2/7, 4 Factor 562429509125/2o + 2246405o*3 + 1/2o*5 + 1296673925o*2 + 3461/2o*4 + 559840650625/2. (o + 1)(o + 865)*4/2 Let y = 108057 + -108052. Factor 13/11v - 7/11v4 + 18/11v*3 - 2v*2 + 1/11v*y - 3/11. (v - 3)(v - 1)4/11 Let h(x) be the first derivative of -x3 - 69x2/2 - 378x + 902. Factor h(a). -3(a + 9)(a + 14) Let j(a) be the second derivative of a*4/4 - 22a*3 + 430a. Let j(c) = 0. Calculate c. 0, 44 Let k(q) be the third derivative of -q7/3150 - q6/150 - q*5/30 - 5q*4/24 - 11q*3/6 - 58q*2. Let o(z) be the second derivative of k(z). Factor o(p). -4(p + 1)(p + 5)/5 Factor 57p*3 - 3140 - 3271 + 1167p + 6273 + 1362p2. 3(p + 1)(p + 23)(19p - 2) Let k be (-8 - 1)/(-3) - -642. Let b = 645 - k. Factor bw - 2/5w2 + 0 + 3/5w3 + w4. w*2(w + 1)(5w - 2)/5 Let p(k) = -19k3 - 376k*2 - 36872k - 72200. Let g(w) = 3w3 - w2 + 2w. Let f(n) = 6g(n) + p(n). Solve f(u) = 0 for u. -190, -2 Let j be ((-14)/42)/((-2)/1218). Find a such that -8a*2 + ja*3 + 162a*4 + 53a*2 - 53a*3 - 37a*4 = 0. -3/5, 0 Suppose -4w - 3l = -291 + 264, -4w = 4l - 32. Factor 4g*2 - 1/2g*w - 10g + 8. -(g - 4)(g - 2)2/2 Let i(n) be the third derivative of -1/126n*7 + 0n*3 + 0n*4 + 0 - 50n*2 + 1/15n*5 + 0n - 1/1008n8 + 1/45n*6. Determine a so that i(a) = 0. -6, -1, 0, 2 Let o be (-2)/(-3) + ((-1624)/87 - -34 - 14). Factor -4/3 - ov*2 - 10/3v + 2/3v4 + 2/3v*3. 2(v - 2)(v + 1)3/3 Solve 1952/5v + 2/5v2 + 476288/5 = 0. -488 Suppose -9f + 2f = -70. Let l be (-6)/15 + 164/f. Determine m so that 13m*3 - 30m*3 - m - 2m*2 + lm*3 = 0. -1, 0 Suppose 6k = 11k - 20. Factor -6y*2 - 4y*k - 64y*3 - 2y*4 + 84y*3. -2y*2(y - 3)(3y - 1) Let l(p) be the first derivative of -2p6/3 - 48p*5/5 - 29p*4 + 136p*3/3 + 144p*2 - 256p - 957. Let l(n) = 0. What is n? -8, -4, -2, 1 Determine k, given that k*5 - 13k*4 + 122k*3 + 80 + 39k4 + k5 - 176k + 254k*2 + 456k - 44k = 0. -5, -4, -2, -1 Suppose 326h - 164h = 156h + 24. Let f(u) be the third derivative of 0u + 1/48u*3 + 1/48u*h + 0 + 15u*2 + 1/160u5. Let f(j) = 0. What is j? -1, -1/3 Let i(j) be the third derivative of -j6/16 + 19j5/20 - 51j*4/16 + 9j*3/2 - 4j*2 + 69. Factor i(o). -3(o - 6)(o - 1)(5o - 3)/2 Let v be 92/(-6) + 19 - (-64)/12. Factor 15/2p*2 + vp*3 + 3/2p*4 + 0p + 0. 3p2(p + 1)(p + 5)/2 Suppose 0 = 19i + 8i - 135. Suppose -2g + ir = -0g - 24, 2g - 16 = 3r. Determine t, given that 4/5t + 0 - 6/5t*3 + 2/5t*5 + 2/5t*g - 2/5t*4 = 0. -1, 0, 1, 2 Solve 894k + 37k2 - 137k*2 - 910k = 0. -4/25, 0 Factor -2/3x3 + 956/3 + 482/3x - 476/3x2. -2(x - 2)(x + 1)(x + 239)/3 Let u = 985 + -982. Let t = 9 - 7. Solve 4mt + 7 + 2m - 2m4 - 5 - 3m*5 - 4 + 5m*5 - 4m*u = 0. -1, 1 Let l(t) be the third derivative of 1/300t*5 + 0 - 10t*2 + 24/5t*3 + 0t + 1/5t4. Solve l(y) = 0. -12 Let a(s) = 28s*2 + 1888s - 412. Let n(o) = 30o2 + 1882o - 413. Let r(c) = -3a(c) + 4n(c). Factor r(x). 4(x + 52)(9x - 2) Let j = 20830 - 20826. Let u(a) be the third derivative of 0a*3 + 0a*5 + 0a + 1/40a6 - 19a*2 + 0a*j + 0. Factor u(b). 3b3 Let x(w) be the first derivative of w4/2 + 4w3/9 - 7w*2/3 + 4w/3 + 2875. Factor x(r). 2(r - 1)(r + 2)(3r - 1)/3 Factor -98757 + 735v2 + 99537 + 11v*3 - 2240v - 36v3. -5(v - 26)(v - 3)(5v - 2) Let -2/3n*3 - 44/3n*2 + 218/3n + 260/3 = 0. What is n? -26, -1, 5 Let r = 70 + -76. Let i be (-96)/(-18)r(-3)/8. Factor -9c2 + 6 - 22c*3 + ic*3 + 7c*3 + 3c*4 + 3c. 3(c - 2)(c - 1)(c + 1)2 Let f(y) be the first derivative of 2y*3/3 - 917y*2 - 1836y + 6547. Factor f(u). 2(u - 918)(u + 1) Let n(m) = 67m2 + 4783m + 1251. Let f(q) = 32q2 + 2392q + 630. Let u(j) = -13f(j) + 6n(j). Suppose u(l) = 0. Calculate l. -171, -2/7 Let k(t) be the second derivative of -4t - 1/60t*4 + 7/10t*2 + 1/5t*3 + 13. What is b in k(b) = 0? -1, 7 Let b = -759 - -769. Let r be b - 4 - (-4 - 192/(-20)). Determine k, given that 28/5k*2 - 22/5k + rk5 - 12/5k*3 + 6/5 - 2/5k4 = 0. -3, 1 Let c(i) be the third derivative of i8/1344 + 23i7/840 + 131i*6/480 - 23i*5/240 - 11i*4/8 + 5521i*2. Let c(x) = 0. What is x? -12, -11, -1, 0, 1 Let b be (8/5)/(26/195). Let k be (-95)/(-2)(-25 + 27). Factor 2t2 - bt*2 + 5t + 10t4 + kt*5 - 100t*5. -5t(t - 1)3(t + 1) Let c(w) be the third derivative of -w*7/525 + 14w*6/15 - 9659w*5/75 - 658w*4 - 6627w3/5 - w2 - 54w + 11. Factor c(k). -2(k - 141)*2(k + 1)*2/5 Let q = 7759 - 7757. Let l(n) be the second derivative of 0 - 1/2n*6 - 15/4n*4 - 5/3n*3 - 5/2n*5 + 16n + 0nq. Factor l(w). -5w(w + 1)(w + 2)(3w + 1) Let s(y) be the third derivative of 1/5y4 + 44y*2 - 1/150y*6 + 1/25y*5 + 0y - 16/15y3 + 0. Solve s(u) = 0. -2, 1, 4 Let k(g) = 11316500g*2 - 13456g + 24. Let o(w) = 11316499w2 - 13456w + 19. Let t(z) = -3k(z) + 4o(z). What is c in t(c) = 0? 1/1682 Let z be 4(9/(-24) - (-500)/1280). Let r(h) be the third derivative of -1/80h*5 + 0 - zh*4 - 20h*2 + 0h + 3/8h3. Factor r(f). -3(f - 1)(f + 3)/4 Let k(i) be the third derivative of 0i - 1/24i6 + 1/42i*7 - 1/6i*5 + 0i*4 + 0i*3 + 0 - 21i*2. Factor k(p). 5p*2(p - 2)(p + 1) Determine s so that 0 - 108s - 1/4s2 = 0. -432, 0 Let u = -769 + 780. Let q(m) be the second derivative of -1/2m*6 + 3/10m*5 + 0m*4 + 0m*2 + 0 + 0m*3 + 3/14m*7 + um. Suppose q(w) = 0. Calculate w. 0, 2/3, 1 Suppose 0 = 89c - 30c - 35c - 29c. Let x(w) be the third derivative of 4w3 - w4 + cw - 1/160w6 + 20w*2 + 0 + 1/8w*5. Factor x(m). -3(m - 4)*2(m - 2)/4 Let i(h) be the second derivative of -h*5/20 + 13h*4/2 - 338h*3 - 111h*2/2 - 50h. Let r(g) be the first derivative of i(g). Factor r(m). -3(m - 26)2 Solve 0 + 4/5t + 36t2 = 0. -1/45, 0 Let f(z) be the third derivative of z8/1512 + 2z7/315 + z6/270 - 8z5/135 - z4/36 + 10z*3/27 + 1065z*2. Solve f(n) = 0. -5, -2, -1, 1 Suppose 4p = 2p + w + 6, 2w = -3p + 23. Let n(v) be the second derivative of 0v*2 + 0 - 9v - 4/9v3 + 1/6v*4 + 1/30v*p. Factor n(k). 2k(k - 1)(k + 4)/3 Let t(f) = f*2 + 13f - 230. Let l be t(10). Let x(m) be the second derivative of 3/10m5 - 7/6m*4 + l + 10m + 5/3m3 - m2. Let x(u) = 0. Calculate u. 1/3, 1 Let a(t) be the first derivative of 15t + 1/2t5 + 35/2t*3 + 95/4t*2 + 45/8t*4 - 192. Factor a(h). 5(h + 1)*3(h + 6)/2 Let s(k) be the first derivative of -k*3/3 - 205k*2/2 - 606k - 3586. Factor s(y). -(y + 3)(y + 202) Let c(v) be the second derivative of -v5/70 + 73v*4/14 + 74v*3/7 - 440v*2/7 + 2504v. Solve c(z) = 0. -2, 1, 220 Let x be (1920/(-1344))/(5/(-42)) - 192/44. Factor 2352/11i + 1/11i*3 + 21952/11 + xi2. (i + 28)3/11 Factor 3/2z4 + 5/2z - 23/6z3 - 17/6z*2 + 0. z(z - 3)(z + 1)(9z - 5)/6 Let u(t) be the first derivative of 2t*6/3 + 16t*5/5 + 5t*4 + 8t*3/3 + 1984. Factor u(a). 4a*2(a + 1)*2(a + 2) Let o(i) be the third derivative of i*7/315 + 17i*6/270 - 38i**5	{ "pile_set_name": "DM Mathematics" }
52)/160 -3/16 Evaluate ((-128)/(-10))/(2868/(-3585)). -16 Calculate (1/((-49)/6))/(126/3528). -24/7 What is the value of (448/21)/(-16)(-34)/((-243100)/165)? -2/65 What is (-64)/3328 + 48/468? 1/12 Calculate (6 + ((-77614)/30069 - 8/26))18. 56 What is 1 - -49 - (-4862440)/(-101772)? 20/9 504/(-1876)-67 - 26 -8 Evaluate ((-24)/(-21))/((-126)/4851). -44 Calculate ((-1845)/21 - -4) + (4 + -9 - 82/(-14)). -83 What is 9/(-72)(-230)/1840? 1/64 Evaluate (-28820)/8646(-4)/5. 8/3 Evaluate 2/4239((-4851)/(-28))/(-33). -39/4 Calculate 2 - 1152/584 - (-52650)/(-882570). -1/31 What is (-205)/(-5)(-3120)/(-89544)? 10/7 Evaluate 1196529/8487 - 138 - 62/4. -2/123 (1 + 2 + -2 + 1215/(-1290))(-474)/395 -3/43 Calculate ((1/(-9))/((-1)/(-50)))/(3401/(-30609)). 50 What is ((-18912)/118238/(-24))/(21/(-3))? -38 Calculate (-9671)/374115 - 4/98. -1/15 Calculate (13707/(-6092))/((-6)/(-40)). -15 Evaluate (16155/(-7539))/(1(-3)/7). 5 (-129)/(-11) - (28/(-2) + 32 + (-8 - -2)) -3/11 What is the value of (-20 + (-1064)/(-42))72/(-48)? -8 (-14)/(-3)(-4200)/(-490) 40 What is the value of (-190)/570 + (-2108)/(-51)? 41 (3610/(-6498))/(7/63) -5 Evaluate (44/3)/((-10)/30)(586 - 587). 44 What is the value of (824/5128)/(85/(-680))? -103 Evaluate 13/(13728/432)(-32)/12. -12/11 Evaluate 0 + 0 + (-14)/4-32(-39)/(-624). 7 What is ((-66)/(-11)(-8)/66)/(84/(-44))? 8/21 Evaluate (11/(-297))/(-1)-1-12108. 48 Calculate -9 + 607/12747((-2 - -3) + 284). 32/7 Calculate (-40 - (-22 - 35)) + -52. -35 (-5730/3990)/((-9)/12 + (-34)/(-8)) -6/49 Calculate (20 + (-19 - (-56)/(-49)))/((-2)/(-98)). -7 Calculate 270/(-8) + 133/((-798)/(-108)). -63/4 What is (184/10)/(441/(-189)-3 - (-132)/(-20))? 46 Calculate 1326/204 - ((-393)/(-6) - 6). -53 Evaluate (-2352)/48 + 26/1. -23 (82586/(-8883894))/((-2)/(-6) - -2) -1/251 What is ((-30)/36)/(230/(-69))332? 83 What is the value of 64404/(-8945) + 214/(-5)? -50 Calculate ((-28)/36(-3)/2)/((-35)/625-25). 5/6 Calculate (-318)/141638/(-702). 53 (2366/39 + -61)/(-81/30) 5/4 What is the value of 11466/1044 + 11 - 66/3? -1/58 Calculate (-3 + 18 - (-161)/((-184)/8)) + -38. -30 What is the value of -19 - 1 - (127072/(-6405) - 1670/(-152805))? -6/35 1((14(-8)/8 - -1) + (-132)/(-3)) 31 What is the value of ((-93)/10 + 8/(-40))5/(-50)5? 19/4 Evaluate (-710)/1035 + (3281/(-153) - -22). -3/23 What is the value of ((-105391)/1089 + 94)(2 - (-15)/6)? -25/2 What is the value of 2/(-18)3 - (-29 - 21289/(-732))? -5/12 Evaluate (-238800)/(-5970) + -46 + -1. -7 Calculate (1104/264)/46 + 162/33. 5 Evaluate (1845/82)/(5/(-8)). -36 ((-6)/56)/3 - 2852442/(-50904) 56 What is 30/(28 + 4816/(-168))? -45 What is the value of 34/(-3) - ((-87 - -136) + -61)? 2/3 Calculate (-316634)/32085 + 10/(-115) + (-4 + 2 - -12). 2/45 Evaluate 18/2766/4 - (621016/12936 + -37). -1/147 Calculate -43 + (-48520)/(-1080) - (17 - 15). -2/27 20 - (480/72)/5129/(-4) 63 Evaluate (-18)/(-42) - ((-22458)/798 - (-4 + 190/35)). 30 What is the value of (-9 - -8) + 5/722/(-528)-24? -2/7 Evaluate (-4617)/675 + 1-7(-124 + 123). 4/25 Calculate (-116)/16 + 69972/7056. 8/3 What is the value of (-11)/(-11)3/(-10)((-121360)/96)/37? 41/4 What is (((-15428)/(-95))/14)/(1/2312/195)? 29/2 What is (79/(-474))/((-120)/(-160))? -2/9 Calculate (-18677)/(-93385)(-515)/1. -103 Calculate (-2 - -1)(-2 + -1)((-7488)/(-1976))/72. 3/19 (118/((-109858)/37191) - (-1)/(-19)) + -20 -60 What is the value of 7 + (-32)/5 - (-12)/(1440/10968)? 92 (-8448)/(-88)(16/129)/2 + -19 + 13 -2/43 Calculate ((-10)/(-3230))/((-196)/1862). -1/34 Calculate (-186418)/10107 + 8/181. -18 What is (-11)/66 - 24548/34656? -7/8 Calculate (-15)/((-750)/(-40)) - -214/(-120). -3/2 Calculate (920/84 + (-4)/14)/(463/(-2778)). -64 What is the value of (128/48960-170)/(((-100)/(-198))/(-5))? 22/5 Calculate (286/22 + (-105 - 3))/((-55)/22). 38 Evaluate ((-1023)/(-186) - (-1)/(-2))/(9/(-81)). -45 Evaluate 8/(-5)(-27675)/(-7380) - (14 + (0 - 2)). -18 What is the value of 4 + -2 + (4/65)/(368/(-17480))? -12/13 ((56 - 46)/10)/(-5 + 126/4) 2/53 Calculate 651/(-600) + 6201/5512. 1/25 Evaluate 54 - (5280/242 + 30). 24/11 What is 12/(-40)-8 - 3149651/697190? 5/26 ((-8)/14)/(((-2148)/(-7))/(-4))(-69)/(-46) 2/179 What is 6/(312/(-20))(-23 + (-4537)/(-195))? -4/39 What is (-354)/(-2301)3/(-2)? -3/13 What is the value of 10 - 1/1 - (-12 + -8 - (-121 - -98))? 6 What is ((-81)/5)/((24/130)/(1208/1963))? -54 What is the value of 12 + ((-435)/18)/((-20 - -12) + 10)? -1/12 What is 40 + 38450/(-442) + 47? 2/221 What is the value of -6 + ((-2300)/(-56) - -4) + (-160)/2240? 39 What is the value of (((-1904)/98)/(-17))/(4/14) - (-1 + -56)? 61 What is 1828766/192840 - 39/4? -4/15 Evaluate 486/(-36)2-1 - -10. 37 What is 27/(-2)190/(-9025)((-30)/(-18))/1? 9/19 What is the value of (16 - (815/(-2282))/(4/(-182)))/((-2)/4)? 1/2 What is (-9500)/(-2375) - (14 + (-4 + 3 - -1))? -10 (-12)/2244/(-16) 3/2 What is the value of ((-1524)/(-5334))/(8/140)? 5 Evaluate (-80)/32(-24)/(-60)54. -54 Calculate 5/9(-7344)/122400. -1/30 What is (-2365)/110 - (-6318)/297? -5/22 What is the value of (8 - 232/24) + (-8536)/(-132)? 63 Evaluate 24 + (-786)/30 - 122/(-110). -12/11 What is the value of 119/97581558 - (-61)/(-2)? -23/2 Evaluate (714/(-9) - -81)/((-10)/252). -42 What is the value of 37 - 41/(2173/1696)? 5 What is ((-2)/10 + -30371/(-15900))/(1/(-1))? -1/2 (2/(-35) - 9/(-45))/((-38)/83677) -2/49 Evaluate ((2/(-10))/((-4)/(-480)))/(-3 - (-534)/6). -12/43 (-4452)/21200(-50)/(-70) -3/20 What is the value of 840/550 - (-1140)/(-418)? -6/5 Calculate (8/112-7)/(160/(-128)) - 13. -63/5 Evaluate 825/22572/6996. 2/53 Calculate ((-36)/(-42))/(3/77)13/(-26). -11 58/(-580)(-600)/(-855) -4/57 Calculate (-5 - (-14 + (-372)/8))/((45/20)/(-3)). -74 Calculate -2 - (-68)/24 - 33/126. 4/7 316/(-5688) + (-829)/(-18) 46 What is ((-9)/(-39))/((-90)/110 + 24/(-132))? -3/13 What is (15 - (-6024)/(-420)) + (0 - (-36)/(-45))? -1/7 4/22 + (-4)/(-99) - 81125/(-2475) - 7 26 (-1749 - -1684)((-12)/5 - -2) 26 What is ((-324)/(-648))/(-2230/153/(-120))? 15/23 Evaluate ((-6)/(-20))/(135/(-24) - (-24 - (-4914)/208)). -2/35 What is 116/(-110) + 246 + (-34790)/142? -3/55 Calculate (6/(-16))/(6/(-384)42). 4/7 Evaluate ((-1927)/(-41) - -15) + -43. 19 (-856)/(-642)975/(-20) -65 Evaluate (-9)/(-30)((-8856)/162 - -53). -1/2 What is the value of 1((-1848)/429)/(-28)? 2/13 Calculate 2310/(-1350) + (-1344)/(-432). 7/5 7/((-28)/128) + -1005 + 1008 -29 Calculate ((-13928)/3179066)/(2/11). -2/83 (-12)/(-126) + 123/((-392196)/3388) -3/29 What is 39 + 1100/(-20) - ((-1440)/(-6))/4? -76 ((-3)/(-9))/(54808/15912) 3/31 What is (0 - (-10)/50)1? 1/5 What is (42/15)/((-1)/(-5) - 1764/7840)? -112 Calculate (39/(-9)-2)/((-27)/162). -52 Evaluate (37 + -38)/(18444/232(-4)/6). 1/53 What is the value of (12 + 704/33-1)/((-22)/3 - 0)? 14/11 What is ((-8750)/40)/25(-12)/7? 15 Evaluate 5/3 - 16297/(-1137). 16 Evaluate 90/(-108)-218/5 - -13. 19 What is 30((-1067)/(-99) - 11)(-18)/15? 8 What is 806/62465 + 624/23715? 2/51 (-60)/2580 - ((-10714)/(-1548) + -7) 1/18 ((-5)/22)/(114/912) -20/11 What is the value of 3026/272 + -54 - 3/24? -43 What is the value of 4/8 - (187/(-2) + -70186/868)? 109 154836/(-10821316)(-185)/3 15/17 Calculate (-32536)/859881/(-14). 1/37 What is the value of ((-14308)/141036)/((-14)/(-4))? -2/69 Evaluate 782/(-68)(-2)/4694. 47 What is 33 + 4557/(-63) + 10 + 2? -82/3 What is the value of (58/174)/(10/(-42))? -7/5 33530/(-1440) + 19 - 138/(-2208) -38/9 3(((-43)/(-473))/(1 + -2))/1 -3/11 What is -1((-29488)/2109 - -31) + 117? -2/111 Evaluate -2458 + 2470 - (2222/33)/(1 - 15/(-9)). -53/4 Evaluate 56/(-70)8645/(-266). 26 Evaluate ((-254)/(-8) + -13)/((-1776)/11840). -125 What is the value of (-6 - 1)/(12691/(-67081))? 37 What is (2/32)/(263/(-3682))? -7/8 Evaluate (-88)/(-336)(-129)/(-473). 1/14 What is 6 + -2 - (-163)/((-978)/72)? -8 Calculate 8 + (4(-3)/24)/((-359)/28002). 47 What is (-135)/12 + (-1325)/(-1060) - 2/((-6)/153)? 41 What is the value of (-1)/(-52)(-89)/142416? -1/52 Calculate -9(-52)/(-273)(-1449)/(-552). -9/2 What is 746/(-374) - (-179 - (-656640)/3672)? -20/11 Evaluate (-1)/(-7)*((38 - (31 + 8)) + (-55)/(-41)). 2/41 What is the	{ "pile_set_name": "DM Mathematics" }
k = -9. Calculate the greatest common factor of 45 and k. 9 Let a(n) be the third derivative of -n4/24 + n3/2 + 8n2. Let d be a(-4). What is the highest common divisor of d and 21? 7 Let g(r) = 11r*2 + 3r - 3. Let n be g(3). What is the highest common divisor of n and 42? 21 Suppose -4z - 3q + 414 = 0, 3z + 3q + 0q = 309. What is the highest common divisor of 21 and z? 21 Let a(n) = -n - 2. Let b be a(-8). Suppose -p = 4o - 29, -5p + 4 = -3o - 3. Calculate the highest common factor of b and o. 6 Let n(m) = m*3 - 5m*2 + 2m + 3. Let b be n(4). Let i = -3 - b. Let o be 1 + 1 - i-34. Calculate the highest common divisor of o and 10. 10 Let m(o) = o3 - 5o*2 - 5o - 5. Let j be (3 - 1) + 3 + 1. Let z be m(j). Let x be z622 + 2. What is the greatest common factor of x and 14? 14 Suppose 2 - 5 = -3c, 4c + 42 = -2l. Let q = l - -58. Let u = 21 + -7. What is the greatest common divisor of u and q? 7 Suppose -3g + 99 = -2g. What is the highest common divisor of g and 9? 9 Let x(j) = j3 - 7j2 + 8. Let n be x(7). Let t(h) = h2 - 3h - 8. Let s be t(7). Calculate the greatest common factor of n and s. 4 Let b(v) = v3 + 2v*2 - 2v - 2. Let u be b(2). Calculate the highest common divisor of 90 and u. 10 Let q(u) = 3u2 - u - 1 - 4 + u3 + 4u*2 + 0u*3. Let w be q(-7). Calculate the greatest common divisor of w and 3. 1 Suppose -w + k - 130 = -6w, -70 = -2w - 4k. Let r be 10 + -4 - 1 - (-1 - -1). Calculate the greatest common factor of w and r. 5 Let b be ((2 - 3) + 2)-3. Let m be 20/30 - 493/b. Calculate the greatest common divisor of m and 15. 15 Let r = 5 - 5. Suppose r = 5t - 2t + 6. Let i be (1/t)/((-1)/8). What is the highest common divisor of 16 and i? 4 Let y = 52 - 31. Calculate the greatest common divisor of 147 and y. 21 Let z be (-1)/(-1)(13 + -3). Let m = z - 6. Suppose -4d = 3 - 67. What is the highest common factor of d and m? 4 Let m = -23 + 175. What is the greatest common factor of m and 19? 19 Let q = -3 - -5. Let l(v) = v3 + 8v*2 + 7v - 7. Let p be l(-7). Let x be (2 - 6)/q - p. What is the greatest common divisor of 15 and x? 5 Let c(z) = 5z2. Let i be c(-3). Let b(m) = -3m - m + 13 + 3m. Let w be b(4). What is the highest common factor of i and w? 9 Let a = 13 - 25. Let l be ((-2)/6)/((-4)/a). Let c(y) = -25y3 - y2. Let j be c(l). What is the highest common divisor of j and 36? 12 Suppose 2m - 5 - 15 = 0. Let u(z) = 3z*2 - 4z + 6. Let a be u(6). What is the greatest common factor of a and m? 10 Let v(w) = 3w2 - 11w + 7. Let r be v(7). Suppose -d = -4h + 8h - 15, -3d = 5h - 31. What is the greatest common factor of d and r? 7 Let h(y) = y*3 - 8y*2 + 9y - 10. Let x be h(7). Suppose -xr = -11 - 41. What is the greatest common divisor of r and 13? 13 Suppose 0 = -0r + r - 5t - 38, -2r + t + 94 = 0. What is the highest common factor of 120 and r? 24 Suppose -5q = -q - 24. Let j(t) = t3 - t2 + 67. Let o be j(0). Suppose -2f + 108 = -3k, -f - 3k = 13 - o. What is the greatest common factor of q and f? 6 Suppose 0 = -4u + 4, a + u = 2u + 44. What is the highest common factor of 45 and a? 45 Let p be (2 - 0)(-539)/(-22). Suppose -3a - o = -18, -a + 17 = -3o + 1. What is the greatest common divisor of a and p? 7 Suppose 0k - 3k + 2o = -249, -5k + 2o + 411 = 0. Suppose 25 = -5b + 155. Let l = b + -17. What is the highest common divisor of l and k? 9 Suppose -9p = -3p - 48. Let k = 44 + 40. Suppose 2l - 2j = k, j - 54 + 16 = -l. Calculate the greatest common divisor of p and l. 8 Suppose 3b - 38 = 10. Let t be -3 - (2 - (-1)/(-1)). Let l = t - -6. Calculate the highest common divisor of l and b. 2 Let b = 17 + -15. Suppose 47 = bd - f, -d + 3f = -5 - 6. Calculate the greatest common factor of 13 and d. 13 Let b(x) = 2x2 + 2x + 1. Let j be b(-2). Let z(g) = g*3 - 6g*2 + 5g + 3. Let q be z(j). What is the greatest common factor of 15 and q? 3 Let f be (140/6)/((-4)/(-18)). What is the greatest common divisor of 35 and f? 35 Let f be (15/2)/((-3)/(-8)). Suppose 4w = 4 + 16. Calculate the highest common divisor of f and w. 5 Let r = 6 - 5. What is the greatest common factor of r and 4? 1 Suppose 3o + 19 = 151. Let f = -106 + 216. What is the highest common factor of f and o? 22 Let v = 78 - 132. Let q = 99 + v. What is the highest common divisor of q and 30? 15 Let m be 1/4 - (-28)/16. Suppose n - 22 = -5i - 1, -3i - 16 = -mn. Calculate the greatest common factor of 11 and n. 11 Let p(j) = 7j*2 - j - 3. Suppose 4w - 6 = 7w. Let q be p(w). What is the highest common divisor of 9 and q? 9 Suppose 0 = 3b - 5k - 4, 0 = -4b + b - 3k + 36. Calculate the highest common divisor of b and 64. 8 Let b be (4/2 + -3)-30. What is the greatest common factor of 150 and b? 30 Suppose 2k - 42 = -k + 3t, 3k + 5t - 2 = 0. Let j(r) = r*3 + 8r*2 - r + 3. Let q be j(-6). What is the greatest common divisor of k and q? 9 Let a be (-320)/(-6) - 2/(-3). Suppose y + a = 4y. What is the highest common factor of 9 and y? 9 Suppose -6 - 2 = -4r. Calculate the highest common divisor of 6 and r. 2 Let l(s) = 5s*2 + 5s - 7. Let a be l(5). What is the highest common factor of a and 13? 13 Let u(z) = z*3 + z - 4. Let f be u(2). Let s be (2 + (-2)/1)-1. Suppose si = 5i - 300. Calculate the greatest common factor of f and i. 6 Suppose 0 = -4a + 61 + 31. Let u = a - 16. Calculate the highest common factor of u and 77. 7 Suppose -2z - 5o = 3, 4z - 3z + 3o = -4. Suppose -49 = 2h + 51. Let q = -28 - h. What is the greatest common divisor of q and z? 11 Suppose -5 = 3z - 14. Suppose -4j = j + 5o - 45, 0 = 2o - 6. Suppose -3f + 0 + j = 0. What is the highest common factor of f and z? 1 Suppose -11p + 8p = -144. Let f(d) = 4d + 8. Let g be f(6). Calculate the highest common factor of p and g. 16 Suppose -3 = -g + 4. Let x = 7 + g. Suppose -6q + 160 = 5t - q, t = 4q + 12. Calculate the highest common factor of t and x. 14 Let n be -2 - 12/(-1 - 2). What is the greatest common factor of 22 and n? 2 Suppose -5t = 3j - 2068, 4j - 1 = 3. Suppose -4y + 4z = -y - 428, 3y - t = z. What is the highest common factor of y and 17? 17 Suppose -f + 86 - 11 = g, 3g - 3f = 255. Calculate the greatest common divisor of g and 10. 10 Let a = -43 + 55. What is the greatest common factor of a and 96? 12 Suppose -36 = 4b - 4h, -3b - 43 = b + 3h. Let a be (-544)/b - (-10)/(-25). What is the highest common factor of 36 and a? 18 Let r = -5 + 8. Suppose -rw = -2w - 13. Let k = -155 - -272. Calculate the greatest common factor of w and k. 13 Suppose -4h + 395 + 50 = -s, 3 = s. Calculate the highest common factor of h and 28. 28 Let z(a) = 15a. Let s be z(10). What is the greatest common factor of s and 15? 15 Let q(i) = 28i2 + 2i + 3. Let f be q(-2). What is the greatest common factor of f and 74? 37 Suppose 4x = 3z - 6z + 23, 3z = 2x + 11. Calculate the greatest common factor of x and 6. 2 Let x = -25 + 35. Let r(b) = -b2 - 11b + 15. Let a be r(-11). Let l(m) = m + 5. Let i be l(a). What is the greatest common divisor of i and x? 10 Suppose -3t + 4g = -41, -g - 26 = -t - 2t. What is the highest common factor of t and 63? 7 Let x(r) = r + 56. Let i be x(0). Let d(j) = -4j - 41. Let n be d(-12). What is the greatest common divisor of i and n? 7 Let w = 69 + -47. What is the greatest common divisor of 2 and w? 2 Let g = 11 + -18. Let v be 2 + g/(-2)14. What is the greatest common factor of v and 17? 17 Suppose -j = 12 - 128. Suppose 137 = 3h + u, -5h + u + j = -107. Calculate the highest common divisor of 5 and h. 5 Suppose 3k - 66 + 219 = 0. Let j = -33 - k. Calculate the greatest common factor of 12 and j. 6 Let z(p) be the second derivative of p3/3 - p2/2 - 4p. Let v be z(3). Let o = 35 + 5. What is the greatest common factor of v and o? 5 Let o = -116 - -172. Let g(r) = -8r*3 + 2r*2 - 2r + 1. Let d be g(1). Let b = d + 15. What is the highest common divisor of b and o? 8 Let n(z) = 29z3 - z. Let t be n(1). Suppose 3f - 42 = -3c - f, 5f - 28 = -2c. Calculate the greatest common factor of t and c. 14 Suppose 4 = 5v - 16. Let f = -12 - -32. Calculate the highest common factor of v and f. 4 Let	{ "pile_set_name": "DM Mathematics" }
j*2 - 2j + 3. Let p be x(2). Suppose -26i - 4 = -pi. Solve r + 4l - 6 = 0, -l - l - i = -3r for r. 2 Let k(j) = -j*3 + 5j*2 - 4j - 3. Let s be k(4). Let p(m) = m + 3. Let t be p(s). Suppose 65 = 5l - tl. Solve 0 = -3v - 4o - 27, o + l = -5v - 15 for v. -5 Let y(i) = i2 - i - 2. Suppose -4 = -7c + 6c. Let o be y(c). Suppose -2b - 3b = -o. Solve -5k + 1 = 3p, bk + 17 = -3p + 6k for p. -3 Let n = 395 + -392. Solve -3r + 6 - 1 = -l, -nr - 3l + 21 = 0 for r. 3 Suppose 3t - 14t = -198. Solve 2c - 2 = -f - 2f, 5f = 2c - t for f. -2 Let p = 857 - 853. Solve 2v + 6j = 3j + 11, pj - 16 = -4v for v. 1 Suppose 0 = -2v + 3v - 22. Let z = -10270 + 10278. Solve -2y = -3h - z, y = -h - 4h - v for y. -2 Suppose -2d = -4u + 18, 3d - 4u = u - 30. Let f = d + 15. Solve 3s - 15 = f, k = 2k + 4s - 24 for k. 4 Let q = 224 + -205. Solve 0 = -0j + 2j - 2, 4j - q = 5k for k. -3 Suppose 5 = 2w + 5r + 1, -4w + 3r + 8 = 0. Solve -wi + b = 4b + 4, 2b = 4i + 24 for i. -5 Suppose 89 = 10m + 59. Solve d + mb = -b - 7, -5d = 2b - 1 for d. 1 Let b = -7 - -7. Let u(x) = -x + bx + 2x + x + 9. Let c be u(8). Solve -4o - 20 = -k - 0k, 3k + 5o + c = 0 for k. 0 Suppose -5 = -a, -t - 2a - 24 = -39. Solve 0 = g - tk - 27, -2g + 3g = k + 7 for g. 2 Suppose -2 = 3j - 11. Suppose -4n = -3d - 75, 70 = jn + 2n + d. Suppose 0 = 4l - 4u, 2u = -2l + l + n. Solve 15 = 5o + li, -2 = -3o - i + 5i for o. 2 Let h be (4/8)/(20/200). Solve 4f - hf + 2t = 5, -3f = 2t - 17 for f. 3 Suppose 7c - 81 = -2c. Suppose 28 = cg - 17. Solve 2n = -n - gt + 34, 5t = 3n + 16 for n. 3 Let a be (0 + -1)-111. Suppose 3m = -2 + a. Solve -3x = -5y - 28, -3y + y = -mx + 13 for x. 1 Let q = 1190 - 1178. Solve -2z - x = 2, 2x = -5z - 18 + q for z. -2 Let i = -388 - -388. Solve -4t + 0x + 5x = -8, i = 5t - 4x - 1 for t. -3 Suppose 11h = h + 20. Solve 0 = g - r, 2g - r + h = -0g for g. -2 Suppose 3l + 4g - 229 = 0, l + l - 146 = 4g. Let j = 77 - l. Solve -5 - 6 = -jd + 3b, b = -2d - 9 for d. -2 Let s = -9 - -39. Let q = 1 - -9. Suppose 2k - 12 = -3t - k, -t + 5k + q = 0. Solve -4y = -3l - y - s, t = y for l. -5 Suppose -w - 51 = -4x, 2x + 5w = 4x - 3. Suppose 19j = xj + 20. Solve 5z = -4o - 9, 3z - jo + 1 = -2o for z. -1 Suppose -w + 102s = 101s, -21 = -4w - 3s. Solve -4x - wj + 16 = -6j, 2x + 2 = -j for x. 1 Suppose 25g - 27g = -4o + 36, -4g + 16 = 0. Solve -3l + 24 = 3s, -4s + l + 1 = -o for s. 4 Let h = 27 - 43. Let r(b) = b*2 + 15b - 13. Let z be r(h). Solve -u + 2 = -5q - 3, -3u + z = -3q for u. 0 Let g(n) = -n2 + 6n + 7. Let s be g(7). Suppose s = 4q - 3q - 6. Suppose -qf + 18 = -6. Solve -4 = fl - 5y, -2y - 2 = 5l + 3 for l. -1 Suppose 5v - 2v - 9 = 0. Let c = -28 - -30. Suppose i - 4 = -c. Solve 3t - i = -z - v, -t = 2 for z. 5 Suppose 7b = 42 - 0. Suppose -bq - q = -35. Solve 0 = 3m + 3n - 6, 5m = 4m - 2n + q for m. -1 Let o = 0 - 0. Suppose 0r - 3r + 6 = o. Solve u - 4c = -4, 3u - rc + 12 = 2c for u. -4 Let l(f) = f3 - 3f*2. Let s be l(4). Let r be s/72 + 68/18. Suppose rt = 2t + 14. Solve -g - t = -3n, n + 3 = -0n - g for n. 1 Suppose -19i = -284 + 227. Solve -4r = 12, -r = -2j + 14 - i for j. 4 Let i(z) = -z*3 + 7z*2 + 2z - 12. Let r(s) = s*3 + 17s*2 - 20s - 29. Let g be r(-18). Let j be i(g). Solve j = -4f - 3v + 9, 3 = 3v for f. 1 Let v(n) = n3 + 20n*2 + 18n - 1. Let d be v(-19). Let x = d - 16. Solve -z + 6 = xb + 2z, 5b = 5z - 10 for b. 0 Let n(s) = 6s - 20. Let j be n(4). Suppose 0 = -o + 5o - j. Solve 0 = 5g - v - 29 - o, 4v = -g - 15 for g. 5 Suppose -2a - 5k + 30 = 0, -5k = -3a - 2a + 5. Solve -49 = -am + 2x - 18, -14 = -m + 3x for m. 5 Suppose b + 9 = 4b. Let o = -3 + b. Let n be (0 - (o - 3)) + 1. Solve -c + n + 7 = -4q, 0 = -c - 1 for q. -3 Let m be 11 - 5-6(-23)/138. Solve g = -2d + 1 + m, d + 5g - 8 = 0 for d. 3 Suppose 0 = -0k - 3k. Suppose -4q + q - 18 = k. Let x be (-8)/515/q. Solve 0 = xl - 4p - 24, 0 = 5l + 5p for l. 3 Let p(a) = a*2 + 3a + 4. Let y be p(0). Suppose 79 = 3d - l, 2d = -yl - l + 30. Let f = -7 - -12. Solve 0 = -5r - 0q - q + 9, -fq + d = 5r for r. 1 Let n(r) = -6r + 121. Let v be n(17). Suppose -5c + 23 = -2. Solve -6 - 11 = l + 4m, v = l - cm for l. -1 Suppose -5x = -4p + 13, 2p - 5x + 7 - 6 = 0. Let h = 4 - -2. Solve -i + p = -c, 2c + h = 3i - 5i for c. -5 Suppose 26u - 4 = 24u. Solve -ux - 4h = -4x + 10, -2x - 4 = 3h for x. 1 Suppose s - r + 3r - 8 = 0, -5r = 5s - 30. Solve -sk + 9k = -2p - 15, 0 = -5p - 3k - 9 for p. 0 Let l(t) = 2t - 58. Let u be l(34). Solve 5k - 3n + 15 = 0, -5n = 4k - 3n - u for k. 0 Suppose -2q + 50 = 40. Solve 2 = qr + 5o - 28, -14 = -5r + 3o for r. 4 Let s be ((-1)/2)/((-1)/40). Let b be -21 + s - 1-4. Solve 13 = -bf - l, f = 2f - 4l for f. -4 Let l(c) = c*2 + 4c + 9. Let b be l(-3). Solve -15 = -2y - bo + o, -o + 3 = -2y for y. 0 Suppose -7 = s + 1. Let y be -2(6 - s)2/(-8). Solve -5a = 3k - 24, 3k = yk + 5a - 27 for k. 3 Let z = -43 - -26. Let o = z + 20. Suppose -2u + ou = 0. Solve 3b = -2f - 7, 3f - 5b = -uf + 18 for f. 1 Let r = 3 + 0. Let o = -157 - -168. Solve rj - o = -a, -5j + 2a + 6 = -4j for j. 4 Let j(q) be the third derivative of -q5/60 - q4/12 + q3/3 - 38q*2. Let c be j(-2). Solve cu = a, -a - 2u = 4a + 12 for a. -2 Let i be 738/12(-10)/(-15). Let b = 49 - i. Solve -5h + 6 = 3o - 0o, 5h - 4o = -b for h. 0 Let o = 8 + -6. Suppose 4b + 8 = 2k, 20 = 3k + 2k + 5b. Solve 0 = -ky - 16, 0y + y = -om - 8 for m. -2 Suppose 13t = 9t + 8. Suppose -2h = -t - 2. Let x(y) = y3 - 3y*2 + 2y + 1. Let l be x(h). Solve z = -4n - l, -3n + z = 3z - 3 for n. -1 Let i = -201 - -217. Suppose 3o - 2o = -5q + 30, 4q - 10 = 2o. Let x be 0/(-5) + (0 - -5 - 2). Solve 5n + 13 - x = 0, -qs = 2n - i for s. 4 Let q(f) = f2 + 5f + 6. Let j be q(-4). Suppose 0 = -4r + 5x + j, -r + 5x - 4x = 0. Let y = r + 8. Solve 5p - 7 = -4v, -p - 3v - y = -3 for p. 3 Let c be 4/6 + 67/3. Suppose 0 = 18z - cz. Solve u - 2o - 11 = z, -2o - 38 = -4u - 12 for u. 5 Suppose -3r - 24 = 3r. Let t be ((-69)/3)/(r + 3). Let n = t - 18. Solve 2b - 21 = 3k, -5b + 3b + 31 = -nk for b. 3 Let c(w) = 7w - 240. Let i be c(35). Solve 0 = ij - 3h + 6, -3j + j + 4 = 2h for j. 0 Let v = -2 - -6. Let d = v - -2. Let k be 3/(4/(24/9)). Solve -5f = -w + dw + 30, kf = w + 3 for f. -1 Let z = 1456 + -1452. Let u = 14 + -9. Solve 1 = -zc - 2t - u, -2c - 13 = -t for c. -4 Let z = -92 - -34. Let u = z - -80. Solve -5g - u = 3h, -h - g = 4h for h. 1 Let m(o) = 11o + 48. Let d(f) = 2f + 8. Let z(h) = -34d(h) + 6m(h). Let n be z(6). Solve 5a + x - nx - 9 = 0, 4a = 4x + 4 for a. 3 Let s(o) = o + 19. Let b(q) = q + 10. Let r(j) = -5b(j) + 2s(j). Let h be r(-8). Solve 7c = -2z + 4c + 3, -z + 3c = h for z. -3 Suppose -5t + 5p = 8 - 13, 4p - 8 = -2t. Solve -z + 6 = tu, -3u + u + 6 = 4z for u. 3 Suppose 15t = -25t + 160. Solve z = -3, -ta - 16 = a - 3z for a. -5 Suppose -3j + 12 = -4m, -3j + 4m + 12 = j. Suppose 0 = 3s - js - 9. Let q = -2 + s. Solve f - 5u + 20 = 0, 5u = q + 19 for f. 0 Suppose -u + 4b + 3 = 0, -4b + 18 - 9 = 3u. Let x = 7 + -5. Solve ul = -0j + 4j - 11, j = -xl - 11 for j. -1 Let b be (-15)/(-12) - (-9)/12. Let a = 6 - b. Let u(q) = 2q3 - q2 - 4q + 1. Let k be u(2). Solve af = -0f + m - 20, -f - 4m = k for f. -5 Suppose 0 = m + 2x + 2x - 22, -56 = -5m - 2x. Let w be (-10)/(-2) + m + -7. Solve 10r = 5r - 4n - 12, r = 2n - w for r. -4 Let i be 2/(-1) + 15/3. Suppose 5v - 2t = 6, i = t + 1. Solve -8 = -3w - r, w = vw + 3r for w. 3 Let f be ((-900)/360)/((-2)/(-4) - 1). Let m be ((-4)/6)/(2/(-15)). Solve 33 = -mq - 4j, -fq + 10q + 29 = -2j for q. -5 Suppose -2s + 2h + 17 = 3s, -4s + 28 = 2h. Solve 2z - 3y + s = 4z, -40 = 3z - 5y for z. -5 Let h(s) = 11s2 - 2s - 1. Let d be h(1). Suppose -45l + 46l - d = 0. Let k be 3 + -1(0 + 1). Solve -3q + kq + l = -3o, -3q - 5o - 32 = 0 for q. -4 Let j be 144/(-45)*(-100)/16. Let o = -4 -	{ "pile_set_name": "DM Mathematics" }
g - 265. What is the highest common factor of 10 and o? 10 Suppose -2 = 4f + 3x + 18, 4x - 48 = 4f. Let z be f14/(-8). Suppose -d + 2 = -2, -208 = -5w + 3d. Calculate the greatest common factor of w and z. 4 Let d be (3 + 132/(-20))-5. Calculate the highest common factor of d and 12. 6 Suppose -5f - 100 + 380 = 0. Suppose 0 = 4l - 0l - f. Calculate the highest common divisor of l and 56. 14 Let y = -2 - -5. Suppose -yx - 31 - 5 = 0. Let c be (162/x)/((-6)/8). What is the highest common divisor of 72 and c? 18 Let y be 0 - (1 - (-2 - -31)). Suppose y = 3z - 3j - 2, -4j - 8 = 0. Let c be (-2)/(-10) + 837/15. Calculate the highest common divisor of z and c. 8 Suppose -8g + 273 = 5g. Calculate the highest common divisor of 63 and g. 21 Let p(k) = -9k + 1. Let g = 2 - 5. Let z be p(g). What is the highest common factor of 7 and z? 7 Let h = 38 - 22. What is the highest common factor of h and 144? 16 Suppose -4w + w + 24 = 0. Calculate the greatest common factor of 8 and w. 8 Let z(m) = -m2 + 6m - 5. Let i be z(4). Suppose -p + 5o = ip - 45, -2o = -5p + 69. What is the highest common divisor of 30 and p? 15 Let p(c) = -c + 5. Let r be p(3). Let n(t) = t*3 - 4t*2 + 4t - 2. Let i be n(3). Calculate the highest common factor of r and i. 1 Let a = -6 + 8. Suppose aq - 384 = -q. Let p = 37 + -21. What is the highest common factor of q and p? 16 Let j(h) = h3 + 5h*2 - 2. Let q be j(-5). Suppose -11 = 3r + 4. Let u be 1308/20 - q/r. Calculate the greatest common divisor of u and 26. 13 Let k be 2((-9)/3 - -4). Let o be k/2(7 + 53). What is the highest common divisor of o and 12? 12 Suppose 0 = 19z - 3z - 320. What is the greatest common divisor of z and 60? 20 Suppose p + 0 = -4r + 2, 5r = 3p - 40. What is the greatest common divisor of p and 50? 10 Suppose 4w = 2d - 0 + 2, -d + 14 = 3w. Let n(x) = x*2 - x + 4. Let j be n(w). Calculate the greatest common factor of 70 and j. 10 Suppose 3q - f = -4f + 3, -4q = -f - 29. Calculate the highest common factor of q and 48. 6 Let n = 13 - 9. What is the highest common factor of 44 and n? 4 Suppose -2t + 3t = 1. Suppose 3a - 8 = -20, -6 = 3n + 3a. What is the greatest common divisor of n and t? 1 Suppose -3r + 20 = -r. Let b(q) = q*2 + 4q + 13. Let z be b(-10). Let d = z + 37. What is the highest common factor of r and d? 10 Suppose 0u + u + 5l = -7, -5l - 59 = -3u. Calculate the highest common factor of u and 39. 13 Let s(f) = f*3 + 8f*2 + 2f - 7. Let h be s(-3). Let b be 46/6 - 1/(-3). Calculate the greatest common factor of h and b. 8 Suppose 0 = -p + 3q - 171, 3q = -0q. Let d = -86 - p. Let i be 9(-5)/3068/(-6). Calculate the greatest common factor of d and i. 17 Let p(j) = -8j - 32. Let x be p(-23). Calculate the highest common factor of 19 and x. 19 Suppose r - 4 = x, -r + 0r - 8 = 5x. What is the highest common factor of r and 2? 2 Suppose -633 = -3r + 312. What is the greatest common divisor of 35 and r? 35 Suppose 0 = 2w + 5w - 672. Calculate the greatest common factor of 12 and w. 12 Let i be (-606)/(-5) - (-4)/(-20). What is the greatest common divisor of i and 11? 11 Let w be 15 + -15 + (19 - 1). Let p = w - 10. What is the highest common factor of p and 8? 8 Let p = 282 + -192. Suppose 324 - 234 = 3o. Calculate the highest common divisor of p and o. 30 Let z = 292 + -136. Let p = z + -43. Let l = -61 + p. What is the highest common divisor of l and 13? 13 Let l(t) = 4t + 4. Let p be l(7). Let d = p + -2. Calculate the highest common factor of 20 and d. 10 Let b be 3892/70 - 10/(-25). Suppose -4k + 2x - x + 34 = 0, 4k = -4x + 24. What is the greatest common factor of b and k? 8 Suppose -k + 2k - 8 = 0. Let v(l) = 5l. Let p be v(-4). Let d be ((-8)/p)/((-2)/(-80)). Calculate the greatest common factor of d and k. 8 Let h be ((-77)/(-14))/((-2)/(-44)). Calculate the highest common divisor of h and 11. 11 Let i(y) = -y3 - 6y*2 - 5y + 3. Let d be i(-4). Let j(m) = -m*3 - 8m*2 + 8m + 1. Let q be j(d). Calculate the highest common factor of 80 and q. 10 Let l = 12 - -3. Let j(t) = -t*3 + 12t*2 - 9t - 5. Let m be j(10). Calculate the highest common divisor of l and m. 15 Let a be (-1925)/(-44) - (-1)/4. Calculate the highest common divisor of a and 11. 11 Let h(w) = w - 2. Let b be h(22). What is the highest common divisor of b and 100? 20 Let b = -5 + 14. Suppose -26 = -5j - p, 0 = 4j - 7j + p + 14. Suppose -jd + b = -2d. What is the highest common divisor of d and 15? 3 Let f(u) = -5u + 44. Let x be f(7). Calculate the greatest common divisor of x and 1. 1 Let p = -92 - -130. What is the highest common divisor of p and 57? 19 Suppose 3z - 196 - 8 = 0. Let s = 113 - z. Let k(m) = -m3 - 2m - 3. Let o be k(-3). Calculate the highest common factor of o and s. 15 Let f(p) = 5p - 9. Let i = 9 + -3. Let o be f(i). What is the highest common factor of 7 and o? 7 Let w be (-22)/(-8) + 2/8. Let n = -27 + 72. Suppose -4h = 5q - 41, 2q + wq = -5h + n. What is the greatest common factor of q and 15? 5 Let m be (39/(-9))/(2/6). Let f be -3 + (2 + -4 - m). Suppose 4 = s - 4i, 0 = -2i + 2. What is the highest common divisor of s and f? 8 Let f = 57 - 41. Calculate the greatest common factor of f and 2. 2 Let z = -84 - -254. Let d(y) = 2y + 7. Let p be d(5). Calculate the highest common divisor of p and z. 17 Let g = -20 + 65. What is the greatest common divisor of 30 and g? 15 Suppose 0 = 5r - 3p - 2p - 580, 2r - 248 = -2p. What is the highest common divisor of 24 and r? 24 Suppose g - 9 = -r, 5r - 29 = -4g + 8. Suppose -n + 2 = -3n. Let q = n - -9. Calculate the greatest common factor of q and g. 8 Let c = -7 + 7. Suppose 4k - 84 = -ck. Suppose -13 = -2q + h, q - 3h = -7 + k. Calculate the highest common factor of q and 25. 5 Let w be -2 - 0 - 5-4. Let s be 14(-3)/6-3. Suppose 3 = -2p + s. Calculate the greatest common factor of p and w. 9 Suppose 0 = -4x + 27 - 7. Suppose -4j + 29 = -51. Suppose -4k = c - 136, 4k - 3c = 132 + j. What is the highest common factor of k and x? 5 Suppose -2a + 7a - 65 = 0. Suppose -5c + 4d + a = -17, -4d - 22 = -c. Suppose cn = 4 - 0. What is the greatest common factor of 6 and n? 2 Let y(c) = -c - 10. Let m be y(-6). Let u(z) = -z*2 - 3z + 1. Let s be u(-3). Let d be s/m + (-159)/(-12). What is the highest common factor of d and 104? 13 Let q = -4 + 6. Suppose -3d + 8 = q. Suppose dp - 17 = 27. Calculate the highest common divisor of 2 and p. 2 Let q = -6 - -10. Let s(k) = k*2 + k - 4. Let r be s(3). Let w be r/6 - 4/(-6). Calculate the greatest common factor of w and q. 2 Let v(n) = -2n*3 + n. Let r be v(-1). Let f be r - 4 - 2-3. What is the highest common factor of f and 12? 3 Let k be 0 + 0 + 1 + -1. Suppose 4m - 19 - 17 = k. Calculate the greatest common divisor of m and 3. 3 Suppose -3s + 5a - 11 = 3, 5s + 5a - 30 = 0. Let j be (s - 1/1) + 38. Calculate the greatest common factor of j and 26. 13 Suppose -15 - 5 = w. Let d = 47 + w. Calculate the highest common divisor of d and 9. 9 Suppose 4 + 2 = -3n, 2u - n = 46. Let z be 38 - -320/(-12). Calculate the greatest common factor of z and u. 11 Let u = -29 - -35. What is the highest common divisor of u and 4? 2 Suppose -5a = -86 - 114. Let h = -4 + 6. Suppose hi = -0i + 20. Calculate the greatest common factor of a and i. 10 Suppose 7 - 11 = -4k. What is the highest common divisor of k and 5? 1 Let n(o) = -o*2 + 11o + 1. Let q be n(6). Let k = q - 10. What is the highest common factor of k and 7? 7 Let k = -33 + 45. Calculate the greatest common divisor of k and 18. 6 Let k(a) = 2a3. Let b be k(1). Let m = -5 - b. Let t be 1(2 + 1) - m. What is the greatest common factor of t and 30? 10 Let r(n) = -n*2 - 9n + 2. Suppose -b = -4b - 27. Let o be r(b). What is the highest common divisor of o and 18? 2 Suppose 2s - b + 1 = 0, -5b = -s - 8b + 10. Let r be 1-2 + (10 - s). Let g(j) = j - 6. Let a be g(r). Calculate the highest common divisor of 9 and a. 1 Suppose -b + 1 = -1. Let f be (b-2)/(-1 + 2). Let l be ((-2)/(-3))/(f/(-102)). What is the highest common divisor of 17 and l? 17 Let b be (18/4)/((-9)/(-60)). What is the highest common divisor of 6 and b? 6 Sup	{ "pile_set_name": "DM Mathematics" }
base 15) in base 16? 5 Convert -202 (base 5) to base 3. -1221 What is -13 (base 4) in base 14? -7 e (base 16) to base 10 14 What is 5 (base 15) in base 12? 5 -2 (base 4) to base 9 -2 313 (base 5) to base 10 83 What is -b (base 14) in base 8? -13 What is -101020 (base 3) in base 4? -10110 What is -2 (base 15) in base 16? -2 Convert 21012 (base 3) to base 6. 522 -206 (base 11) to base 4 -3320 What is -7a (base 16) in base 8? -172 Convert 311 (base 4) to base 6. 125 What is -254 (base 8) in base 4? -2230 Convert -1 (base 9) to base 12. -1 What is -4 (base 11) in base 6? -4 Convert -5 (base 13) to base 12. -5 Convert -104 (base 6) to base 15. -2a What is 83 (base 9) in base 13? 5a -13 (base 5) to base 13 -8 What is 97 (base 13) in base 8? 174 What is -1111 (base 2) in base 5? -30 Convert bb (base 12) to base 16. 8f Convert 22 (base 6) to base 15. e Convert 27 (base 14) to base 8. 43 What is 103 (base 13) in base 15? b7 Convert 5 (base 16) to base 6. 5 1 (base 13) to base 15 1 What is 113 (base 7) in base 10? 59 Convert 1 (base 9) to base 16. 1 Convert 28 (base 15) to base 2. 100110 Convert -151 (base 11) to base 13. -108 What is -11011 (base 2) in base 4? -123 -6 (base 9) to base 7 -6 -1 (base 16) to base 15 -1 Convert 4 (base 6) to base 13. 4 Convert 200 (base 3) to base 5. 33 Convert 51 (base 6) to base 11. 29 What is -73 (base 9) in base 15? -46 b2 (base 13) to base 7 265 214 (base 11) to base 12 195 What is 310 (base 8) in base 16? c8 1 (base 15) to base 13 1 -313 (base 8) to base 11 -175 Convert -1 (base 3) to base 10. -1 15 (base 7) to base 2 1100 What is 52 (base 12) in base 13? 4a 11000 (base 2) to base 9 26 Convert -4 (base 13) to base 4. -10 What is 14 (base 16) in base 5? 40 Convert 9 (base 14) to base 9. 10 What is 80 (base 15) in base 4? 1320 What is -201 (base 13) in base 4? -11103 What is 12 (base 10) in base 13? c What is 5d (base 15) in base 2? 1011000 -1100 (base 2) to base 8 -14 -29 (base 10) to base 11 -27 8 (base 13) to base 10 8 What is -4 (base 11) in base 6? -4 -10 (base 4) to base 3 -11 Convert 9 (base 11) to base 5. 14 23 (base 6) to base 14 11 What is 111 (base 2) in base 4? 13 Convert -1 (base 12) to base 16. -1 What is 9 (base 14) in base 7? 12 6 (base 16) to base 10 6 What is -c (base 14) in base 16? -c 6 (base 12) to base 6 10 Convert 2 (base 11) to base 8. 2 -11 (base 2) to base 6 -3 What is -133 (base 6) in base 3? -2010 Convert 0 (base 15) to base 11. 0 Convert 126 (base 8) to base 3. 10012 What is -6 (base 8) in base 16? -6 Convert 0 (base 13) to base 2. 0 6 (base 16) to base 10 6 What is 8 (base 16) in base 4? 20 What is 1 (base 10) in base 9? 1 Convert -1 (base 16) to base 14. -1 1a (base 12) to base 10 22 What is -c (base 13) in base 12? -10 What is -3 (base 10) in base 2? -11 What is -a (base 11) in base 6? -14 Convert -3 (base 10) to base 15. -3 What is -64 (base 13) in base 10? -82 Convert 38 (base 14) to base 11. 46 Convert -52 (base 13) to base 14. -4b -1a1 (base 12) to base 8 -411 24 (base 14) to base 12 28 -11 (base 4) to base 14 -5 -181 (base 9) to base 8 -232 -10 (base 8) to base 5 -13 -9f (base 16) to base 15 -a9 2 (base 11) to base 5 2 Convert -4 (base 9) to base 11. -4 Convert -514 (base 6) to base 15. -ca Convert -29 (base 15) to base 14. -2b What is 3 (base 8) in base 15? 3 What is 2 (base 9) in base 15? 2 -2 (base 12) to base 13 -2 1 (base 9) to base 8 1 What is 123 (base 4) in base 6? 43 What is 7 (base 14) in base 11? 7 What is 0 (base 11) in base 7? 0 What is -111 (base 5) in base 4? -133 Convert 52 (base 6) to base 13. 26 Convert -54 (base 6) to base 12. -2a -3 (base 4) to base 7 -3 What is 10010101 (base 2) in base 6? 405 -1 (base 5) to base 4 -1 Convert -1 (base 6) to base 5. -1 What is 4 (base 13) in base 8? 4 Convert -233 (base 7) to base 14. -8a -d5 (base 14) to base 5 -1222 29 (base 14) to base 12 31 What is -13 (base 7) in base 10? -10 214 (base 5) to base 9 65 -1b (base 12) to base 11 -21 -1 (base 16) to base 12 -1 -102 (base 5) to base 8 -33 What is 189 (base 14) in base 15? 162 -1c (base 16) to base 7 -40 What is -16 (base 9) in base 14? -11 26 (base 14) to base 9 37 What is -41 (base 13) in base 8? -65 What is -1111101 (base 2) in base 12? -a5 7 (base 14) to base 8 7 What is -100101 (base 3) in base 9? -311 Convert 134 (base 5) to base 8. 54 Convert 0 (base 8) to base 9. 0 3 (base 12) to base 5 3 -241 (base 5) to base 14 -51 Convert 265 (base 7) to base 12. 101 What is 2 (base 12) in base 2? 10 Convert -42 (base 12) to base 13. -3b -110111 (base 2) to base 3 -2001 10 (base 10) to base 14 a Convert -213 (base 5) to base 12. -4a Convert -252 (base 6) to base 2. -1101000 Convert 2 (base 10) to base 6. 2 Convert 100000 (base 2) to base 9. 35 What is -106 (base 8) in base 2? -1000110 Convert 0 (base 6) to base 3. 0 What is 0 (base 12) in base 13? 0 Convert d (base 14) to base 7. 16 -120 (base 8) to base 12 -68 87 (base 15) to base 8 177 -197 (base 12) to base 14 -147 Convert -44 (base 5) to base 12. -20 What is 13 (base 7) in base 15? a What is 2d (base 16) in base 2? 101101 What is 0 (base 15) in base 11? 0 Convert 10010110 (base 2) to base 4. 2112 What is 29 (base 15) in base 8? 47 -1 (base 11) to base 8 -1 Convert 1a (base 12) to base 15. 17 Convert 1 (base 6) to base 11. 1 25 (base 11) to base 13 21 What is -5 (base 7) in base 9? -5 What is -13 (base 16) in base 7? -25 Convert -14 (base 5) to base 12. -9 1 (base 10) to base 8 1 What is 11202 (base 4) in base 14? 1b4 What is -8 (base 12) in base 7? -11 Convert 3 (base 15) to base 10. 3 Convert -30 (base 12) to base 6. -100 What is 2 (base 15) in base 11? 2 What is -2 (base 7) in base 9? -2 What is 2110 (base 3) in base 12? 56 What is 10120 (base 3) in base 8? 140 Convert -110 (base 4) to base 16. -14 -3022 (base 4) to base 3 -21111 Convert 1252 (base 6) to base 8. 500 -c (base 15) to base 10 -12 -120 (base 9) to base 7 -201 20 (base 6) to base 11 11 What is 2 (base 11) in base 3? 2 Convert -37 (base 8) to base 12. -27 -23 (base 6) to base 4 -33 -2 (base 4) to base 13 -2 What is 6a (base 16) in base 7? 211 -a (base 16) to base 12 -a Convert 0 (base 5) to base 8. 0 Convert 0 (base 13) to base 15. 0 What is -47 (base 15) in base 4? -1003 Convert 170 (base 16) to base 4. 11300 What is 66 (base 12) in base 6? 210 Convert 54 (base 8) to base 10. 44 What is 0 (base 9) in base 15? 0 Convert -11a (base 11) to base 8. -216 Convert 1202 (base 3) to base 11. 43 What is -3 (base 9) in base 13? -3 Convert 2 (base 14) to base 16. 2 What is -102 (base 3) in base 6? -15 Convert 142 (base 5) to base 13. 38 24 (base 9) to base 13 19 What is 21 (base 3) in base 6? 11 Convert 2212 (base 3) to base 13. 5c -101 (base 3) to base 7 -13 What is -21 (base 6) in base 7? -16 Convert 37 (base 9) to base 5. 114 What is -2 (base 3) in base 7? -2 Convert -21 (base 5) to base 14. -b What is 3 (base 14) in base 13? 3 -25 (base 8) to base 14 -17 Convert -313 (base 5) to base 2. -1010011 What is -4 (base 12) in base 3? -11 What is 2 (base 15) in base 9? 2 What is -10 (base 16) in base 12? -14 22 (base 10) to base 6 34 What is 34 (base 6) in base 15? 17 Convert 10 (base 4) to base 3. 11 Convert -15 (base 6) to base 2. -1011 What is -33 (base 5) in base 12? -16 Convert -2 (base 7) to base 10. -2 What is -1 (base 9) in base 10? -1 -10 (base 7) to base 4 -13 What is -102 (base 4) in base 12? -16 32 (base 14) to base 10 44 What is -a8 (base 11) in base 16? -76 What is 11 (base 2) in base 15? 3 What is -2 (base 4) in base 2? -10 Convert -1131 (base 4) to base 13. -72 Convert 1111101 (base 2) to base 10. 125 8 (base 12) to base 13 8 Convert -3 (base 10) to base 8. -3 What is 107 (base 8) in base 10? 71 Convert -11 (base 7) to base 2. -1000 What is 4 (base 12) in base 7? 4 Convert -3 (base 9) to base 11. -3 What is 0 (base 9) in base 10? 0 b (base 14) to base 13 b Convert 4 (base 12) to base 16. 4 Convert -1010 (base 3) to base 6. -50 100 (base 2) to base 16 4 What is -10 (base 16) in base 2? -10000 Convert 2 (base 13) to base 11. 2 What is -1133 (base 5) in base 8? -250 13 (base 14) to base 7 23 -8 (base 13) to base 16 -8 Convert -1 (base 9) to base 13. -1 What is -2 (base 12) in base 2? -10 -3 (base 12) to base 13 -3 Convert 453 (base 6) to base 12. 129 What is -6 (base	{ "pile_set_name": "DM Mathematics" }
earest one hundred thousand? 10900000 Let c = -1.0921 + 0.62826. Round c to two dps. -0.46 Suppose -4160980 = -98o + 103o + 4i, -1664415 = 2o - 3i. Round o to the nearest ten thousand. -830000 Let o = -1141 + 1175. Let u = -1378483 + 1378448.99937. Let v = o + u. Round v to 3 dps. -0.001 Suppose 2o - 4s - 1915806 = -16817942, -4o = 3s + 29804283. Let t = 21931070 + o. What is t rounded to the nearest 1000000? 14000000 Let t = 400574087806.99998981 - 400574086068. Let c = 1739 - t. Round c to 6 decimal places. 0.00001 Let y = -2128 + 2262.9. Let q = y + 443.1. Let r = q - 575.69. Round r to 1 decimal place. 2.3 Let p = -974533326 - -974532391.99998336. Let k = -934 - p. What is k rounded to six decimal places? 0.000017 Let o = 2.361 - 1.418. Let y = -0.944106 + o. What is y rounded to four dps? -0.0011 Let m = 290.9778 + 0.0222. Let o = m + -291.000246. Round o to five dps. -0.00025 Let w = -26 + -4. Let j = w - -32.4. Let q = 10 - j. Round q to the nearest integer. 8 Let r = -0.719 + 0.009. Let s = -1.605 + 14.515. Let n = r + s. What is n rounded to zero dps? 12 Let v = -3672.0916 - 2.2084. Let b = 3964 + v. Round b to the nearest 10. 290 Let y = 12078 + -12077.99995556. Round y to five decimal places. 0.00004 Suppose -4p + 2p = f + 46, 3p - 71 = 2f. Let z = 50 + f. Suppose 3r - 1320010 = 2r - 5j, 5j - z = 0. Round r to the nearest 1000000. 1000000 Let x = -70 + 74. Let c be x/(-2) + (0/4 - -710). Suppose 0 = 2a - 852 - c. Round a to the nearest 100. 800 Let s(w) = -w*3 + 2w2 + w - 20484016. Let b be s(0). Let x = -10854016 - b. What is x rounded to the nearest one million? 10000000 Let z = 874.858754 - 808.15634. Let r = z + 0.316086. Let a = -67 + r. Round a to 3 dps. 0.019 Let y(k) = k2 - 5k - 8. Let w be y(6). Let a be (110704/48)/(w2/(-12)). Suppose -8d - 24519 + a = 0. Round d to the nearest one thousand. -2000 Suppose -q - 44119980 = 4b, -2b + 220600010 = 14q - 19q. Round q to the nearest 1000000. -44000000 Suppose 2d - 8324 = 2p, 0 = d + 4p - 3p - 4168. Suppose 4j = 2f + 5j - 8341, f - d = 5j. Round f to the nearest one hundred. 4200 Let j = -3.45 + -36.5. Let d = j - -42.4. What is d rounded to 1 decimal place? 2.5 Let r = 1113 - 207. Let x = r + -906.0001251. What is x rounded to six decimal places? -0.000125 Let i = 183.84 + -144.6. Let m = 39.3 - 0.3. Let j = m - i. Round j to 1 decimal place. -0.2 Let t = -4419 + 4418.999992616. Round t to 6 dps. -0.000007 Let l = -39365.0000077685 + 39365. Round l to 6 dps. -0.000008 Let b = -0.79 + 0.790011429. What is b rounded to 6 decimal places? 0.000011 Let x = 29.017884 - 29.03. What is x rounded to three dps? -0.012 Let q = 69713452 - 69661755.441. Let p = q - 51649.559161. Let u = -47 + p. What is u rounded to 5 dps? -0.00016 Let o = 114840 - 115009.0128. Let n = -169 - o. Round n to 3 decimal places. 0.013 Let q = 7231.28 - 6991. Let c = -247 + q. What is c rounded to zero decimal places? -7 Let g = -0.14267 - -6.08967. Let o = -6 + g. Let i = o + 0.563. What is i rounded to the nearest integer? 1 Let v = 633.7 + -633.710713. Round v to three dps. -0.011 Let o = -6 + 6. Let j = o - -7. Let k = j + 2.4. Round k to zero dps. 9 Let t = 0.046 - 0.038. Let i = -813.792 + 810. Let w = t - i. What is w rounded to the nearest 10? 0 Let k = -52.7 - -2.7. Let z = -49.776 - k. Let m = z + -0.21. What is m rounded to three decimal places? 0.014 Let i = -2787.728 + -45.372. Round i to the nearest 1000. -3000 Let b = -11542.7 + 15533. What is b rounded to the nearest 10? 3990 Let q = 8102.4 - 7775.81. Let a = -28.79 + q. Round a to the nearest ten. 300 Let p = -4.35 - 3.81. Let o = p + 8.156755. Round o to 4 decimal places. -0.0032 Let t be (-8)/10 + (-1566)/(-45). Suppose -50990 = -th + 21770. What is h rounded to the nearest 1000? 2000 Suppose 17 = -n + 29. Let r be ((-16808)/n)/((-2)/(-12)). Let m be (-18)/(-27) - r/(-6). Round m to the nearest 1000. -1000 Suppose -2f - 132687 = -4s + 3811693, -3f = 4s + 5916620. Round f to the nearest ten thousand. -1970000 Let g = 50002.4731 + -50005. What is g rounded to two dps? -2.53 Let d(p) be the third derivative of 2501p5/30 - 11p4/24 - p3 - 16p2. Let v be d(6). Suppose 5l + 4l = -v. Round l to the nearest 10000. -20000 Suppose 3c - 5c - 6 = 0, -i + 21812 = -4c. Let k be ((-3)/3 - -11)/(10/i). Round k to the nearest 10000. 20000 Let h = 112783.388 + -112713.887071. Let s = 69.5 - h. Round s to five decimal places. -0.00093 Let z = 80 - 59. Suppose 0 = j - 4v - z, 0 = j - 3j + 2v + 24. Suppose 2368090 + 331910 = jp. Round p to the nearest 1000000. 0 Let w = 0.08921 + -0.0998871. Round w to 3 dps. -0.011 Let o = -2274.41 - -2274. Let z = -6.34 + 7.4. Let d = o + z. Round d to 1 decimal place. 0.7 Let b(i) = -883i2 + 27i + 28. Let z = 264 - 287. Let u be b(z). Round u to the nearest ten thousand. -470000 Let z be (68125/2)/(154/616). Round z to the nearest one thousand. 136000 Let n = -875.23 + 794. Let o = n - -82. Let h = o - 0.76969. Round h to four decimal places. 0.0003 Suppose -6x + 4k = -4x - 10, 5k + 15 = 3x. Suppose -xy - 10920000 = -7y. What is y rounded to the nearest 100000? 5500000 Let s = -3.18051 + -192.83049. Let w = s + 196. Round w to three decimal places. -0.011 Let c = 41.042 - 2.429. What is c rounded to 0 decimal places? 39 Let d(x) = -17963x3 + x2 + 16x + 8. Let q be d(-8). Round q to the nearest one hundred thousand. 9200000 Let v = 70259 - 70258.9999971749. What is v rounded to 7 dps? 0.0000028 Let v be 3/(36/10) + 3227279915/102. Suppose -215x - v = -207x. Round x to the nearest 100000. -4000000 Let c be 4 + -2 + -1 - 124899-1. Let b = 197878 + c. Suppose 0 = -3k - 12, v - 4k = 98794 - b. What is v rounded to the nearest 10000? -220000 Let o(a) = 947a2 + 373a - 737. Let s be o(2). What is s rounded to the nearest one hundred? 3800 Let a = -47.115 + -0.285. Let r = a + -6.6. Let t = r - -53.999945. What is t rounded to 5 decimal places? -0.00006 Let r be ((-4)/(-14))/(15/105). Let u(p) = -p - 4099p2 - 1162p*2 - 1025p*r + 0 + 7. Let j be u(-7). Round j to the nearest ten thousand. -310000 Let t = -133.3 - -61.9. Let o = 71.5121 + t. Round o to 1 decimal place. 0.1 Let v = -0.2376 + -0.0194. Let i = 0.1965 + v. Round i to 2 dps. -0.06 Let d = -2492.99999465 + 2493. What is d rounded to 6 dps? 0.000005 Let z = 1987 - -3426. Let t = z - -5807. What is t rounded to the nearest one thousand? 11000 Let v = -48 + 94. Let m = -484.65 + 438.928. Let d = m + v. What is d rounded to 2 dps? 0.28 Let o = -2.39 - -17.39. Let u = o - 15.00000263. Round u to 7 dps. -0.0000026 Suppose -141927779 = 18p - 16772392 + 8942813. Round p to the nearest one million. -7000000 Let d be ((-4)/(16/(-18)))/(6/(-324)). Let g be (-3)/1(-1055)/(-5). Let b = g - d. What is b rounded to the nearest one hundred? -400 Let a = 0.06 + -678.06. Let z = 678.0000522 + a. Round z to 6 decimal places. 0.000052 Suppose 3s + 5429409 = 3v, 2s + 4462169 = -3v + 842578. What is s rounded to the nearest ten thousand? -1810000 Let h = -74338384 - -157546028. Suppose -4z - 93992356 - h = 0. What is z rounded to the nearest one million? -44000000 Let r = -20.85 + 30.68. Let u = r + -9.9. Let v = -3.12 - u. What is v rounded to one dp? -3.1 Let s = -6180.706 - -6189. Let l = s - -1.536. What is l rounded to the nearest integer? 10 Let l = -0.79 - -0.96. Let y = l - 0.1355. Let u = -5.4955 - y. What is u rounded to the nearest integer? -6 Let q = -1.3045 - -1.3065943. What is q rounded to 4 decimal places? 0.0021 Let s = -3681 - -3680.999998198. Round s to 6 decimal places. -0.000002 Let d = 9864 + -9863.99985878. What is d rounded to five dps? 0.00014 Suppose 70791987 = -4s + 3v + 224126622, -s + 5v + 38333646 = 0. Suppose -5k + 25666339 = -s. What is k rounded to the nearest one million? 13000000 Let g = 2.2892 - 18.0782. Round g to 0 decimal places. -16 Let c = -2.92 - -7.8. Let u = 4.87998937 - c. What is u rounded to 6 decimal places? -0.000011 Let h = -174868422 - -84150344. Let c = h + 90718128.699683. Let d = c + -50.7. Round d to 5 decimal places. -0.00032 Let n = 644.3622 - -1.4078. Let q = n - 651. Round q to the nearest integer. -5 Let t = -693.23 + 0.23. Let d = 6	{ "pile_set_name": "DM Mathematics" }
0 Calculate the lowest common multiple of 3804 and 79884. 79884 What is the smallest common multiple of 21 and 634683? 634683 What is the common denominator of 143/4824 and -11/6030? 24120 Calculate the smallest common multiple of 5269 and 46942. 516362 What is the common denominator of -107/636 and -151/366? 38796 Calculate the lowest common multiple of 4570 and 2. 4570 Find the common denominator of 65/2556 and -3/482. 615996 Find the common denominator of -35/99 and -59/99. 99 What is the lowest common multiple of 31167 and 18? 62334 What is the common denominator of -113/6054 and -97/84? 84756 Find the common denominator of -91/8 and 77/560284. 1120568 Calculate the lowest common multiple of 72 and 28352. 255168 Find the common denominator of -11/9930 and 51/2648. 39720 Calculate the lowest common multiple of 68600 and 140. 68600 What is the lowest common multiple of 406738 and 17308? 813476 What is the lowest common multiple of 11 and 14388? 14388 Calculate the lowest common multiple of 162 and 300. 8100 Find the common denominator of 58/147 and -61/10549. 221529 Find the common denominator of -23/6 and -9/2349092. 7047276 Calculate the smallest common multiple of 444 and 13912. 41736 Calculate the lowest common multiple of 37976 and 56964. 113928 Find the common denominator of 123/214540 and -43/12. 643620 Calculate the common denominator of 87/28832 and 105/416. 374816 Calculate the lowest common multiple of 2904 and 976. 354288 Calculate the common denominator of 145/24 and 125/11064. 11064 What is the lowest common multiple of 72620 and 184? 3340520 What is the lowest common multiple of 445 and 652? 290140 Calculate the common denominator of 151/18228 and 143/48. 72912 Calculate the common denominator of 19/13825 and 103/1106. 27650 What is the least common multiple of 56 and 40324? 564536 Calculate the least common multiple of 60 and 8118. 81180 What is the lowest common multiple of 424 and 496133? 3969064 What is the common denominator of 101/152 and 61/30381? 243048 Calculate the smallest common multiple of 35948 and 3268. 35948 Calculate the common denominator of -91/22 and -27/310. 3410 What is the common denominator of -57/60794 and 73/22? 668734 Calculate the common denominator of -57/2420 and -1/151800. 1669800 What is the least common multiple of 63 and 41769? 41769 Calculate the smallest common multiple of 13770 and 345. 316710 Find the common denominator of 51/110572 and -97/8616. 663432 What is the common denominator of -109/1210 and 30/2057? 20570 Find the common denominator of -167/19800 and -149/60. 19800 Calculate the common denominator of 77/20 and -69/335848. 1679240 What is the least common multiple of 35 and 24157? 120785 Calculate the lowest common multiple of 197676 and 19380. 988380 What is the smallest common multiple of 395 and 67500? 5332500 What is the lowest common multiple of 1792626 and 10? 8963130 Find the common denominator of -64/1413 and -29/447. 210537 What is the lowest common multiple of 7294 and 60436? 423052 Find the common denominator of -143/6 and 81/18146. 54438 Calculate the common denominator of -71/704 and 17/6336. 6336 Find the common denominator of 25/344147 and -25/6. 2064882 Calculate the common denominator of 79/7496 and 131/12. 22488 What is the lowest common multiple of 50852 and 924? 11746812 Find the common denominator of 1/352 and -109/468468. 3747744 What is the common denominator of -23/3279 and 41/20767? 62301 Calculate the common denominator of -5/472 and -37/40710. 162840 Calculate the least common multiple of 6966 and 4. 13932 What is the common denominator of 43/364 and 131/770? 20020 What is the smallest common multiple of 1224 and 1037? 74664 Calculate the least common multiple of 2376 and 1188. 2376 Calculate the least common multiple of 348 and 40952. 3562824 Calculate the common denominator of -15/7 and 69/16400. 114800 What is the least common multiple of 1183962 and 45890? 5919810 Find the common denominator of 97/1352 and -85/1898. 98696 What is the smallest common multiple of 24 and 64584? 64584 Calculate the lowest common multiple of 530 and 8692. 43460 Find the common denominator of 179/7224 and -55/172. 7224 Find the common denominator of -82/45 and 131/227232. 1136160 Calculate the common denominator of 47/354 and -57/37498. 6637146 Calculate the smallest common multiple of 15111 and 1314. 30222 Calculate the smallest common multiple of 864 and 648. 2592 What is the common denominator of -18/32291 and -2/7? 32291 Calculate the smallest common multiple of 1254477 and 77. 13799247 Calculate the smallest common multiple of 19392 and 12120. 96960 What is the smallest common multiple of 2025 and 3726? 93150 Find the common denominator of -149/14406 and 67/21609. 43218 Calculate the common denominator of -133/18 and -31/11934. 11934 Calculate the common denominator of -55/5184 and -23/48384. 145152 Calculate the common denominator of 37/854678 and -25/2932. 1709356 Calculate the common denominator of 30/3647 and -8/8857. 61999 What is the lowest common multiple of 97845 and 45? 293535 Calculate the least common multiple of 552 and 432. 9936 Calculate the lowest common multiple of 37099 and 1. 37099 Calculate the least common multiple of 4815 and 1284. 19260 What is the lowest common multiple of 10810 and 940? 21620 Find the common denominator of -1/18 and 17/325377. 650754 Find the common denominator of -91/590 and 8/45489. 454890 What is the common denominator of 41/18 and 89/15282? 15282 What is the common denominator of -63/1240 and 81/27652? 276520 Find the common denominator of 27/124 and 33/2806. 173972 Calculate the common denominator of -187/52374 and -97/37410. 261870 Calculate the lowest common multiple of 18388 and 45970. 91940 Calculate the smallest common multiple of 37408 and 106880. 748160 Calculate the least common multiple of 47 and 12084. 567948 What is the smallest common multiple of 2728 and 44330? 177320 Calculate the smallest common multiple of 207100 and 1242600. 1242600 Find the common denominator of 56/341 and 179/330. 10230 Calculate the common denominator of 1/13800 and 7/1058. 317400 Find the common denominator of 23/436 and 43/4796. 4796 What is the smallest common multiple of 100400 and 1088? 6827200 Calculate the common denominator of 109/23532 and 83/23532. 23532 Calculate the smallest common multiple of 4799176 and 22. 52790936 What is the common denominator of -77/3268 and -2/15? 49020 Calculate the common denominator of 74/21 and 49/177096. 1239672 What is the common denominator of -64/76557 and -56/5? 382785 Find the common denominator of -91/14130 and -86/7065. 14130 Find the common denominator of 143/510648 and 64/21. 3574536 What is the smallest common multiple of 750 and 7500? 7500 What is the least common multiple of 8213 and 65704? 65704 Calculate the least common multiple of 24 and 200679. 1605432 What is the smallest common multiple of 34596 and 3844? 34596 What is the common denominator of 67/900 and -80/38997? 3899700 Calculate the smallest common multiple of 16478 and 497. 1169938 Calculate the lowest common multiple of 355158 and 1026. 6748002 What is the common denominator of 117/50380 and -19/6? 151140 Find the common denominator of 23/10382 and -49/57101. 114202 Calculate the common denominator of 62/777 and 109/11100. 77700 What is the least common multiple of 2 and 221090? 221090 Calculate the common denominator of 49/3098 and 23/20. 30980 Calculate the common denominator of -73/2436 and 99/2030. 12180 What is the common denominator of -47/1010508 and 69/1347344? 4042032 What is the lowest common multiple of 1904 and 2086? 283696 What is the common denominator of -179/9576 and 67/3105? 3303720 Calculate the common denominator of 5/7 and 7/18631. 130417 What is the common denominator of 1/26741 and 42/73931? 1256827 Calculate the common denominator of 47/194817 and -121/42. 389634 Find the common denominator of 32/51 and -137/1388376. 23602392 What is the common denominator of 40/3621 and 55/16? 57936 Calculate the common denominator of -32/64575 and -4/33. 710325 Calculate the common denominator of 93/8 and -113/59210. 236840 Find the common denominator of -93/32660 and -59/35. 228620 What is the smallest comm	{ "pile_set_name": "DM Mathematics" }
of 5267? False Is 931 a factor of 759664448? False Does 2 divide 3337883? False Is 11 a factor of 1416904698? True Is 63 a factor of 194439546? True Is 159314593 even? False Is 3 a factor of 917575142? False Does 95 divide 1000344172? False Is 17 a factor of 325725100? True Is 5310 a factor of 2464859520? True Is 82 a factor of 13481102? False Does 805 divide 1563826005? True Is 120 a factor of 4879920? True Is 100 a factor of 38787977? False Is 218 a factor of 58133580? False Is 182 a factor of 26808385? False Is 9 a factor of 51968466? True Is 14 a factor of 23783802? True Is 333 a factor of 120410136? True Is 17135638 a multiple of 484? False Is 1495489171 a multiple of 11? True Does 10102 divide 3743003142? True Is 163125040 a multiple of 10? True Is 64820733 a multiple of 49? False Is 17452688 a multiple of 44? True Is 1250 a factor of 1358618859? False Is 572918702 a multiple of 1231? False Is 760 a factor of 13816040? True Does 366 divide 22688572? False Is 83999194 a multiple of 569? True Is 645 a factor of 96529633? False Is 438 a factor of 352836594? True Is 53695678 a multiple of 106? True Is 28 a factor of 212905168? True Does 51 divide 9000273? False Is 133648800 a multiple of 40? True Is 3666460 a multiple of 14? True Is 112478653 a multiple of 25? False Is 13 a factor of 234162470? False Is 2810705961 a multiple of 21? True Is 49003649 a multiple of 82? False Does 492 divide 21883176? True Does 10 divide 15898610? True Is 658 a factor of 843495265? False Does 17 divide 28455331? True Is 116490280 a multiple of 92? False Does 155 divide 36013010? True Is 604740541 a multiple of 391? True Is 260 a factor of 895684345? False Is 352317225 a multiple of 195? True Is 3745 a factor of 407815542? False Is 27 a factor of 490580253? True Is 1387 a factor of 310409522? False Does 2155 divide 615004195? False Is 1107 a factor of 53098362? True Does 1760 divide 274433726? False Is 742 a factor of 37798025? False Is 31 a factor of 517372421? False Is 22 a factor of 72057590? True Does 39 divide 3626438166? True Is 18051262 a multiple of 1682? False Does 62 divide 19994503? False Is 6355725171 a multiple of 23? True Is 187272 a multiple of 34? True Does 92 divide 52627220? True Does 513 divide 51551538? False Is 577 a factor of 1394153170? True Does 2638 divide 971865175? False Does 4 divide 725415582? False Is 311 a factor of 11779747? True Is 11 a factor of 142710216? True Does 29 divide 96821372? True Is 165 a factor of 21225200? False Is 862436 even? True Is 30 a factor of 552780? True Is 10 a factor of 422731983? False Does 4 divide 7575460? True Is 23532174 a multiple of 27? True Does 250 divide 120068032? False Is 292 a factor of 57369824? True Is 183 a factor of 32730131? False Does 155 divide 1098175? True Is 107662199 a multiple of 71? True Is 128 a factor of 2105041280? True Is 308325239 a multiple of 526? False Is 26 a factor of 608643620? True Is 1070 a factor of 268114686? False Does 44 divide 40984415? False Is 4893078 a multiple of 139? True Does 4305 divide 646697100? True Is 2227 a factor of 1107739984? False Is 21388482 a multiple of 3? True Is 43403545 a multiple of 424? False Does 30 divide 1176629040? True Is 195 a factor of 304810740? True Is 2792854610 a multiple of 3710? True Is 137 a factor of 38324711? False Does 1383 divide 187706292? True Is 247162140 a multiple of 5520? False Is 1009 a factor of 43692800? False Is 695 a factor of 161643230? False Is 10 a factor of 314006784? False Is 13 a factor of 73534831? False Does 476 divide 705210917? False Does 403 divide 19688968? True Is 78719452 a multiple of 17? True Is 7 a factor of 39686999? False Is 33 a factor of 162980770? False Does 39 divide 1015618611? False Is 372 a factor of 6293035? False Is 357367020 a multiple of 678? True Is 158 a factor of 28231756? True Does 12 divide 36350231? False Is 12 a factor of 287443452? True Is 382938138 a multiple of 726? True Does 68 divide 390394732? True Is 28793925 a multiple of 45? True Is 1360371463 a multiple of 2404? False Is 34661615 a multiple of 36? False Does 1498 divide 5128283160? True Is 51 a factor of 15664262? False Is 586130389 a multiple of 189? False Is 263453440 a multiple of 64? True Does 131 divide 1398058601? False Does 519 divide 30549790? False Is 21 a factor of 66099033? True Does 191 divide 368361836? True Does 16 divide 245772416? True Is 5420404 even? True Is 139538457 a multiple of 27? True Does 19 divide 6383867? True Is 36673914 a multiple of 2698? True Does 13 divide 392897973? True Is 3233312 a multiple of 384? False Is 61 a factor of 167778932? False Is 98023524 a multiple of 6? True Is 624 a factor of 52383936? False Is 352615492 a multiple of 879? False Is 453262412 a multiple of 118? False Is 1576431 a multiple of 321? True Is 84724182 a multiple of 15? False Does 14 divide 30181878? False Does 1139 divide 8402786? False Is 5087 a factor of 1618296788? True Is 14 a factor of 4816168? True Is 1348 a factor of 23429588? True Is 40973760 a multiple of 347? True Is 263838641 a multiple of 464? False Is 921619306 a multiple of 712? False Is 8397812 a multiple of 24? False Is 129 a factor of 7116620787? True Does 21 divide 44240217? True Is 502992562 a multiple of 677? False Is 4 a factor of 4080644? True Is 17 a factor of 2398853? True Is 101892361 a multiple of 4075? False Is 76035911 a multiple of 841? False Does 12 divide 11560503? False Is 88575390 a multiple of 27? True Is 38 a factor of 192728324? True Is 58945590 a multiple of 55? True Does 3422 divide 684242588? True Is 3475226 a multiple of 30? False Is 1238 a factor of 41568515? False Does 7 divide 90027378? True Does 806 divide 20692438? True Is 2369210 a multiple of 8? False Does 8 divide 3655520693? False Is 24324207 a multiple of 523? True Is 96495639 a multiple of 49? False Is 16 a factor of 50694878? False Is 161 a factor of 109375350? True Does 157 divide 1120269? False Does 2 divide 1920505? False Does 112 divide 111462288? True Does 170 divide 162746440? True Is 652 a factor of 35795452? True Does 657 divide 197971839? True Is 525142145 a multiple of 1969? True Is 1659246743 a multiple of 3517? True Is 22623189 a multiple of 311? False Is 2 a factor of 23647592? True Is 573460508 a multiple of 76? True Is 86952129 a multiple of 223? False Does 42 divide 248194145? False Is 20 a factor of 22303118? False Does 53 divide 108033239? True Is 74 a factor of 57687884? True Is 32 a factor of 342356417? False Is 8 a factor of 223194801? False Does 2716 divide 117055272? False Is 5 a factor of 30948344? False Does 2347 divide 908005013? True Is 36 a factor of 74933100? True Is 3318 a factor of 3573741119? False Is 1234 a factor of 2226660450? True Is 6479 a factor of 1337537718? True Does 387 divide 792481185? True Is 885 a factor of 452966010? True Is 46276608 a multiple of 16? True Does 17 divide 922966023? True Is 1690824238 a multiple of 696? False Is 28 a factor of 17935344? True Is 39213252 a multiple of 23? True Is 2016 a factor of 56397600? True Is 196 a factor of 303361017? False Is 52 a factor of 28839876? True Is 168169266 a multiple of 114? True Is 21988764 a multiple of 69? False Does 2856 divide 7762476624? True Does 3562 divide 47909634? False Is 417176300 a multiple of 5? True Is 648679640 a multiple of 56? True Does 49 divide 7516012? True Is 4194816 a multiple of 8? True Is 631 a factor of 60125656? False Does 101 divide 405602567? True Is 4577430 a multiple of 286? True Is 6348291 a multiple of 23? False Is 1490376303 a multiple of 13? True Does 3030 divide 451121550? True Does 591 divide 98479531? False Is 347440761 a multiple of 991? False Is 204 a factor of 211904796? True Is 24 a factor of 10465427? False Is 8106252 a multiple of 33? True Is 7 a factor of 26785579? False Does 49 divide 181956279? False Does 664 divide 101214281? False Is 17 a factor of 7583815? False Does 7791 divide 2112233592? True Is 18268614 a multiple of 2143? False Does 29 divide 509890692? False Is 37 a factor of 48753733? False Is 144 a factor of 1221183989? False Is 334 a factor of 395997448? False Does 1246 divide 923666030? True Does 73 divide 5559983? False Does 1877 divide 5685925? False Is 319 a factor of 422596526? True Is 161	{ "pile_set_name": "DM Mathematics" }
t l. 120l2 + 11352lm3 - 18 What is the derivative of 5c*4 - 3c + 177? 20c3 - 3 What is the derivative of -d2 + 1038d + 936 wrt d? -2d + 1038 What is the derivative of -221n*2 + 151? -442n What is the third derivative of -18t4z*3 + 35t*4 - 2t*2z*2 - 603tz3 wrt t? -432tz3 + 840t Find the second derivative of 7b2r*2v + 2b2rv - 2b*2 + 4br2 + 8brv + 2bv + 2v wrt b. 14r*2v + 4rv - 4 Find the third derivative of 4m2t5 + m2t2 - 13m*2 + 3t*5 - 3t*2 wrt t. 240m*2t*2 + 180t*2 Find the second derivative of -2st4 + 28st2 - 14st - 5s + t*5 wrt t. -24st2 + 56s + 20t3 Differentiate 29bsu + 2bs - 2b - 3su + 3u with respect to s. 29bu + 2b - 3u What is the derivative of -b4 + b3 + 412b2 + 5832? -4b*3 + 3b*2 + 824b What is the second derivative of -7b4 + 9b*3n*2 + bn*2 + bn + 9n2 wrt b? -84b*2 + 54bn2 What is the third derivative of -p6 - 180p*4 + 1139p*2 + 5p wrt p? -120p3 - 4320p What is the second derivative of 4i2o*3q - 9i2o*3 - 2i*2oq - 239io3q + io2q + o*3q wrt i? 8o3q - 18o3 - 4oq Find the third derivative of 183a*6f + 3a5 + a3f + 35a2f + 29a2 - 2a wrt a. 21960a3f + 180a2 + 6f Find the second derivative of -1137z2 + 1409z wrt z. -2274 Find the first derivative of -146wx*2z*2 + 6wx2z + 2wx*2 - 17614x*2 wrt z. -292wx2z + 6wx*2 What is the second derivative of -27wz4 - 2wz2 - 2w + z + 4 wrt z? -324wz*2 - 4w Differentiate 4q3z*2 - 269q*3 - 23q*2z*2 + 5z*2 wrt z. 8q*3z - 46q2z + 10z What is the first derivative of 8p*2x*2 - 2p*2 + 14px3 - 172p - x*3 - 2 wrt x? 16p*2x + 42px*2 - 3x*2 What is the second derivative of 16k*5 - 101k*3 - 1620k? 320k3 - 606k What is the second derivative of -1483t2 - 26t - 86 wrt t? -2966 What is the third derivative of 630h3j2 + h3 - 191h2j + hj2 wrt h? 3780j*2 + 6 What is the second derivative of 39l*3r*2s + l*3 - 3l*2r*2s*2 - 2rs2 - 25r wrt r? 78l3s - 6l2s*2 Find the third derivative of 183c*3x*2 - 6c*2 - 3c - x*2 wrt c. 1098x*2 Find the second derivative of 13267l*2 + 5510l + 1 wrt l. 26534 Differentiate acf*2 - 24acfp + 17ac - 13cf2p - 2cf + 24cp with respect to a. cf2 - 24cfp + 17c What is the third derivative of -4407y*5 - 171y*2 - y - 5 wrt y? -264420y*2 What is the third derivative of -5q*6 + 4q*3v + q*2v - 2q2 + 8q wrt q? -600q3 + 24v What is the second derivative of go2t*2 - go*2 - 7got + o*2t3 - o2 - 2o - 34t*4 wrt t? 2go2 + 6o*2t - 408t2 Find the third derivative of 140s*3 + 125s2 wrt s. 840 What is the third derivative of s6 + 175s4 + 386s*2 + s? 120s*3 + 4200s What is the second derivative of 3d4 + 46d*2t - dt + 6d - 7t wrt d? 36d*2 + 92t What is the second derivative of -12p3 - 5p*2 - 212p + 3 wrt p? -72p - 10 Differentiate 5101r*3 + 142 wrt r. 15303r*2 What is the third derivative of -916r*6 - 2109r*2? -109920r*3 What is the third derivative of -qr*3x*3 - 2qr3x + 2qr*3 + 17qr2 + 938qx3 - 3qx2 + 2r*2x*3 - 4rx2 wrt x? -6qr3 + 5628q + 12r2 Find the third derivative of 363p*5 - 616p*2 wrt p. 21780p*2 Differentiate 8h*3y*3 + 2h*3y - 174h3 - y with respect to y. 24h*3y*2 + 2h*3 - 1 What is the second derivative of 833a*2l + 5al - 97 wrt a? 1666l Find the third derivative of 56i*3y*3z + 2i3yz - 3i*2y*3z - 8i2y*3 + 3i*2y*2z wrt i. 336y3z + 12yz Find the second derivative of 33o2q + 2o2r*3 - 14or3 + 2qr3 wrt o. 66q + 4r3 Find the second derivative of -3615o*2 - 394o + 8. -7230 Find the first derivative of -44g4l + 3gl + 20l + 2 wrt g. -176g*3l + 3l Differentiate 480bx2 + 2x*2 - 662 with respect to b. 480x*2 What is the first derivative of -371iy3 + 744y*3 wrt i? -371y*3 What is the first derivative of 367b*3g + 5b3 - g - 14 wrt g? 367b*3 - 1 Find the second derivative of -524b*2 + 308b. -1048 What is the third derivative of 3l6 - 2l*5 + 33l*4 - 5l*2 + 250l wrt l? 360l3 - 120l*2 + 792l Find the third derivative of -291f3x*6 + 12f*3x*3 - 5f3 - f2x + 2f*2 + 18x*2 wrt x. -34920f*3x*3 + 72f*3 Find the first derivative of -2j3 + j2t - 2j*2v - jtv - 9tv - 16v wrt j. -6j*2 + 2jt - 4jv - tv What is the second derivative of -9443v5 - v4 + v - 358? -188860v*3 - 12v*2 What is the third derivative of 5b*5 - 16b*4j - 3b4q*2 + 7b*2jq2 + 5b*2jq + 2q*2 wrt b? 300b*2 - 384bj - 72bq2 Find the third derivative of 1008j*3p3 + j3pu - 6j2p*3u + 23j2p*3 - 4jp wrt j. 6048p*3 + 6pu Find the third derivative of -j5 + j4 - 1968j*3 - 10j*2 - 2j wrt j. -60j2 + 24j - 11808 Differentiate 470mp*2w - 706mp*2 + 2mw2 + 2w*4 + 1 wrt w. 470mp2 + 4mw + 8w*3 What is the third derivative of 245g*4 - 2672g*2? 5880g What is the derivative of -41d3 - 530? -123d*2 What is the third derivative of 876kq3 - 8kq2 - 60kq wrt q? 5256k Differentiate 324o2 - 216 wrt o. 648o What is the second derivative of 261f3l*2 + 3f*3l + 2f2l - 1 wrt l? 522f3 Find the first derivative of -187g*2 + 57. -374g What is the second derivative of -230cp*2 - cp - 13c + 5p*2 - p wrt p? -460c + 10 What is the second derivative of d*2in3 + 3d*2in + di + 64dn + 2n3 wrt d? 2in3 + 6in Differentiate -6mnq - 157mn - 651nq + 2q with respect to m. -6nq - 157n Find the first derivative of -226dj*3 - 2dj2 + dj + 2j3 - 456 wrt d. -226j*3 - 2j*2 + j Differentiate 1927q*4s*2 + 2q*4 - 243s*2 wrt q. 7708q*3s*2 + 8q3 Find the third derivative of -i6n2 - 298i*4n*3 - 2i*2n - 23n3 - 6n*2 wrt i. -120i*3n*2 - 7152in3 What is the third derivative of 5350t*4 - 45t*2 + 4t + 1? 128400t What is the second derivative of 9i*3u*2 + 3i*3 - 30i*2u2 - i2u - 19u*2 + 884u wrt u? 18i3 - 60i*2 - 38 What is the third derivative of -190m*2p*3 - 2m*2 - 189mp2 + 2 wrt p? -1140m*2 Find the second derivative of -2u*4 + 1841u*2 - 868u wrt u. -24u2 + 3682 Differentiate -5l*3su + l3sx + lsu + 6lsx + 2sux with respect to u. -5l*3s + ls + 2sx What is the derivative of h3 + 3025h*2 - h - 9268 wrt h? 3h*2 + 6050h - 1 Find the third derivative of 10s6 + s5 - 34s*3 - 2s*2 + 3s + 5 wrt s. 1200s3 + 60s*2 - 204 What is the derivative of 588b*3 - 4b + 1688? 1764b2 - 4 What is the third derivative of -2150mo3 + 17m - 34o2 wrt o? -12900m What is the third derivative of -1939c3n - 2c2n - 138c2 - 2n wrt c? -11634n Find the second derivative of -3w*4 + 164w*3 + 7w + 86. -36w2 + 984w What is the second derivative of -2o2p*3 - 955o*2p + 421p3 + 2p wrt p? -12o2p + 2526p What is the third derivative of -1376d*3l2 + d2 - 196dl*2 - l wrt d? -8256l2 What is the third derivative of -i5 - 94i3 + 4i*2 + 26 wrt i? -60i*2 - 564 What is the second derivative of 2760c*3 + 2c - 3106 wrt c? 16560c What is the third derivative of -4187u*3 + 4196u*2? -25122 Find the third derivative of 126hq3 - 2454h - 3q6 + 2q*2 wrt q. 756h - 360q3 What is the second derivative of -9d*3vw3 + 5d*3w + 14d2w - 141dvw3 - dvw - vw*2 + vw wrt d? -54dvw3 + 30dw + 28w What is the first derivative of -111v3w*2 - 2v*3 - 2v*2 - 230w*2 wrt v? -333v*2w*2 - 6v*2 - 4v Find the second derivative of -n*3qy2 - 2n*3qy - 21n*3y + 2150n2qy2 + 51n*2q - 2n2 - qy*2 wrt y. -2n*3q + 4300n2q - 2q Find the second derivative of 316u*2 - 26u - 3 wrt u. 632 What is the second derivative of 651o5 - 1055o wrt o? 13020o3 Find the second derivative of -43ov2w*3 + ov + 2ow*2 - vw**3 - v wrt v. -86	{ "pile_set_name": "DM Mathematics" }
rime? True Is 4121 prime? False Is 14731 composite? False Is 1847 a composite number? False Is 2051993 a composite number? True Is 187 a composite number? True Is 194561 composite? True Is 14761 prime? False Is 6353 composite? False Is 543923 composite? True Is 136463 a composite number? False Is 19831 a prime number? False Is 3320651 a composite number? False Is 18805 a prime number? False Is 11381 composite? True Is 15149 composite? False Is 38039 a composite number? False Is 104603 a composite number? True Is 57593 a prime number? True Is 156307 prime? True Is 5807 a composite number? False Is 2005418 a prime number? False Is 110119 composite? False Is 1472501 composite? False Is 66349 prime? False Is 2779 a composite number? True Is 6046 prime? False Is 2077 composite? True Is 606929 prime? False Is 207883 composite? True Is 100679 composite? True Is 186607 a composite number? True Is 76379 prime? True Is 26029 a composite number? False Is 12953 prime? True Is 8006 prime? False Is 1281407 a prime number? True Is 10007 a prime number? True Is 203083 prime? False Is 25013 composite? False Is 253333 composite? True Is 203339 a composite number? False Is 571629 prime? False Is 3989 a prime number? True Is 51321 prime? False Is 9047 a prime number? False Is 9060743 prime? True Is 220327 a prime number? True Is 42899 a prime number? True Is 520471 prime? False Is 104659 prime? True Is 800729 a prime number? True Is 22583 composite? True Is 33071 a prime number? True Is 1502 a composite number? True Is 12469 a prime number? False Is 179363 a composite number? True Is 82387 a prime number? True Is 177 prime? False Is 6421 a composite number? False Is 56858 a composite number? True Is 83573 a prime number? False Is 2140657 prime? False Is 14569 a prime number? False Is 174281 prime? True Is 3655759 a prime number? True Is 287201 composite? True Is 220553 composite? False Is 2819 a prime number? True Is 17233 a prime number? False Is 61211 composite? False Is 2807879 a prime number? True Is 664643 a prime number? False Is 446869 a prime number? False Is 18457 a composite number? False Is 383329 composite? True Is 212161 a composite number? False Is 2153 composite? False Is 2831813 prime? False Is 1883939 a prime number? True Is 54118 a composite number? True Is 7753 a prime number? True Is 4271 a prime number? True Is 39499 a composite number? False Is 32251 composite? False Is 4765 composite? True Is 277157 a composite number? False Is 452627 a composite number? True Is 2839 a composite number? True Is 34189 prime? False Is 41903 prime? True Is 22937 a composite number? False Is 570602 a composite number? True Is 2498513 composite? True Is 519077 a composite number? True Is 22429 a composite number? True Is 3221 a composite number? False Is 8443 a composite number? False Is 224491 a composite number? False Is 4513 a prime number? True Is 29917 prime? True Is 13297 prime? True Is 2217 a prime number? False Is 167885 a prime number? False Is 12071 prime? True Is 24793 composite? False Is 682265 prime? False Is 149237 composite? True Is 341561 a prime number? False Is 288527 composite? False Is 100907 a prime number? True Is 50989 composite? False Is 1277803 composite? False Is 814387 a composite number? True Is 182701 a prime number? True Is 544105 a prime number? False Is 1823 composite? False Is 53479 prime? True Is 1827647 a prime number? True Is 76569 prime? False Is 141433 a prime number? False Is 36947 prime? True Is 516151 prime? True Is 43261 prime? True Is 1517695 composite? True Is 11983 prime? False Is 19181 prime? True Is 140977 a prime number? True Is 318367 composite? True Is 275021 a composite number? True Is 6839 prime? False Is 11203 composite? True Is 7393 a prime number? True Is 1001911 a prime number? True Is 95507 a prime number? True Is 95063 composite? False Is 250301 composite? False Is 7043 a composite number? False Is 35729 prime? True Is 8443 a prime number? True Is 306491 composite? False Is 4637 a composite number? False Is 613337 a prime number? True Is 12601 a prime number? True Is 679511 composite? True Is 1932559 a composite number? True Is 2777 a prime number? True Is 306121 a composite number? False Is 142685 composite? True Is 533 a prime number? False Is 805463 a composite number? False Is 185 a prime number? False Is 253201 composite? True Is 23267 a prime number? False Is 12219 composite? True Is 212447 a composite number? False Is 52961 composite? True Is 6427349 composite? False Is 26309 composite? False Is 184045 a prime number? False Is 138643 a prime number? False Is 9469 a composite number? True Is 4143 a composite number? True Is 239369 prime? False Is 8803 a composite number? False Is 234683 a prime number? True Is 22426 composite? True Is 23327 prime? True Is 10 a prime number? False Is 91909 prime? True Is 641 prime? True Is 289789 a composite number? False Is 30467 composite? False Is 21139 a prime number? True Is 38783 composite? False Is 65161 composite? True Is 49103 a composite number? False Is 245107 composite? False Is 950149 prime? True Is 11351 composite? False Is 1847 composite? False Is 38859 a prime number? False Is 1637 a composite number? False Is 30055 a prime number? False Is 39469 composite? True Is 328243 composite? False Is 16273 composite? False Is 11901 a composite number? True Is 2179 prime? True Is 2100913 prime? True Is 5354 prime? False Is 791 a composite number? True Is 123719 composite? False Is 1727063 prime? False Is 2530235 a prime number? False Is 717863 a composite number? True Is 3455 a composite number? True Is 149585 a composite number? True Is 397603 a prime number? False Is 11401 a prime number? False Is 10673 a composite number? True Is 406093 a composite number? False Is 7411 composite? False Is 32993 a prime number? True Is 92431 composite? False Is 738499 composite? False Is 233 prime? True Is 8779 a composite number? False Is 1299583 composite? False Is 122933 a prime number? False Is 34421 a composite number? False Is 27127 a composite number? False Is 21763 prime? False Is 1633 prime? False Is 21263 a prime number? False Is 761261 prime? True Is 3269963 a composite number? False Is 386203 a composite number? True Is 197711 a prime number? True Is 239831 a prime number? True Is 607613 composite? True Is 285251 prime? True Is 1136942 composite? True Is 182773 prime? True Is 11507 a prime number? False Is 156007 a prime number? True Is 320179 composite? False Is 105707 prime? False Is 707131 prime? True Is 9127 a composite number? False Is 916585 a prime number? False Is 1171433 a composite number? True Is 88069 a prime number? True Is 2357 a composite number? False Is 5227889 a prime number? True Is 41863 a prime number? True Is 962723 a composite number? True Is 67843 a composite number? False Is 677 a prime number? True Is 310423 prime? True Is 183373 a prime number? True Is 78959 a prime number? False Is 103289 a composite number? False Is 9609 prime? False Is 1309589 a prime number? True Is 39101 a prime number? False Is 518467 composite? False Is 992777 a composite number? False Is 5989 composite? True Is 2929 a composite number? True Is 1270193 prime? True Is 908711 a composite number? False Is 172619 a prime number? True Is 18181 composite? False Is 19001 a composite number? False Is 1949 a composite number? False Is 7817 a prime number? True Is 85679 a composite number? True Is 499 a prime number? True Is 9647 composite? True Is 17933 composite? True Is 240059 prime? True Is 3221 prime? True Is 134753 composite? False Is 77135 a prime number? False Is 110119 a composite number? False Is 241547 a composite number? True Is 73417 a prime number? True Is 87719 a composite number? False Is 224579 a composite number? False Is 73591 composite? True Is 8353 a composite number? False Is 1428389 composite? False Is 36965 composite? True Is 48463 a prime number? True Is 276851 composite? True Is 15131 a composite number? False Is 9803 a composite number? False Is 10907 composite? True Is 32811 prime? False Is 2142409 composite? True Is 457367 composite? False Is 73751 prime? True Is 46533 a prime number? False Is 911 composite? False Is 232129 prime? True Is	{ "pile_set_name": "DM Mathematics" }
1/30 Calculate prob of picking 4 p when four letters picked without replacement from pppkpppkkpkkk. 7/143 Three letters picked without replacement from njtntnjjjjt. Give prob of picking 1 t, 1 n, and 1 j. 3/11 Three letters picked without replacement from {x: 11, v: 1}. Give prob of picking 3 x. 3/4 Four letters picked without replacement from {r: 4, o: 7, z: 3}. Give prob of picking 4 o. 5/143 What is prob of picking 1 i and 1 t when two letters picked without replacement from fzfxtzizxzf? 1/55 Three letters picked without replacement from {v: 3, r: 12, e: 1}. Give prob of picking 1 v and 2 r. 99/280 Calculate prob of picking 1 s and 1 g when two letters picked without replacement from {x: 1, y: 2, s: 2, t: 1, g: 2}. 1/7 Three letters picked without replacement from nkrtrkr. What is prob of picking 1 n, 1 t, and 1 k? 2/35 Four letters picked without replacement from {d: 3, q: 6, o: 2, s: 1}. Give prob of picking 1 q, 1 s, and 2 d. 2/55 Calculate prob of picking 1 c and 1 q when two letters picked without replacement from {h: 3, q: 1, y: 1, p: 1, c: 2, e: 4}. 1/33 Two letters picked without replacement from {d: 8, j: 2, p: 8}. Give prob of picking 1 j and 1 d. 16/153 What is prob of picking 4 k when four letters picked without replacement from kkkkkkkkk? 1 Two letters picked without replacement from mjmmmjmmm. Give prob of picking 2 j. 1/36 Two letters picked without replacement from eeeegeeeeeeggegeegg. What is prob of picking 2 g? 5/57 Calculate prob of picking 2 k, 1 a, and 1 y when four letters picked without replacement from {y: 1, k: 3, a: 3, m: 5, z: 3}. 3/455 Three letters picked without replacement from cmmcjyhmmcjhhmhjmmc. Give prob of picking 3 h. 4/969 Calculate prob of picking 4 j when four letters picked without replacement from fjfjfjfjjjfjfjfjfff. 21/646 Two letters picked without replacement from stngu. Give prob of picking 1 t and 1 n. 1/10 Two letters picked without replacement from vssvslsssbsbslvsbsss. Give prob of picking 2 v. 3/190 What is prob of picking 1 t and 1 m when two letters picked without replacement from lidvtmi? 1/21 Four letters picked without replacement from xhbfxffbxfxbhbffhff. Give prob of picking 1 h and 3 x. 1/323 What is prob of picking 1 b and 1 q when two letters picked without replacement from {b: 5, s: 4, q: 10}? 50/171 Four letters picked without replacement from {z: 4, l: 1, o: 1, v: 6, k: 1, b: 3}. What is prob of picking 1 o, 1 k, 1 v, and 1 b? 9/910 Two letters picked without replacement from cvvfvfcccvffovv. Give prob of picking 1 c and 1 f. 16/105 Two letters picked without replacement from {p: 7, r: 12}. Give prob of picking 1 p and 1 r. 28/57 Calculate prob of picking 2 a when two letters picked without replacement from {q: 2, a: 7}. 7/12 Calculate prob of picking 3 o when three letters picked without replacement from swoiiwoowiiioi. 1/91 Two letters picked without replacement from {g: 3, i: 5, r: 2, f: 3}. Give prob of picking 1 r and 1 f. 1/13 Calculate prob of picking 2 n when two letters picked without replacement from mpvnooo. 0 Two letters picked without replacement from zggzzggzggzgazk. What is prob of picking 1 g and 1 z? 2/5 Calculate prob of picking 1 j and 1 e when two letters picked without replacement from {p: 1, j: 4, l: 1, d: 1, e: 2}. 2/9 What is prob of picking 1 n, 1 t, and 1 b when three letters picked without replacement from nbbnnnnnbnnnntnnt? 9/85 Two letters picked without replacement from qqgwwwwgrqgwaqqaxqgg. Give prob of picking 1 r and 1 a. 1/95 Four letters picked without replacement from swsdrwwrrrdw. What is prob of picking 2 s and 2 d? 1/495 Four letters picked without replacement from jjjppjyejjyyyjyjyyj. What is prob of picking 1 y, 1 j, and 2 p? 21/1292 Two letters picked without replacement from eggcnqf. What is prob of picking 1 q and 1 f? 1/21 Two letters picked without replacement from rkkkyybkryrk. Give prob of picking 1 k and 1 y. 5/22 What is prob of picking 1 j, 1 l, and 1 v when three letters picked without replacement from {e: 4, j: 4, v: 2, l: 2}? 4/55 Three letters picked without replacement from ktttktktttk. Give prob of picking 2 k and 1 t. 14/55 Four letters picked without replacement from {i: 7, o: 4}. What is prob of picking 1 o and 3 i? 14/33 What is prob of picking 1 s and 1 h when two letters picked without replacement from {v: 1, s: 1, h: 3}? 3/10 Calculate prob of picking 2 u, 1 s, and 1 l when four letters picked without replacement from {j: 5, l: 4, h: 1, u: 6, s: 4}. 16/323 Calculate prob of picking 2 q when two letters picked without replacement from {q: 3}. 1 Calculate prob of picking 3 z and 1 h when four letters picked without replacement from {o: 1, z: 8, d: 1, h: 1, f: 4}. 8/195 Two letters picked without replacement from qlljdlqndqdnnkdldd. What is prob of picking 1 n and 1 j? 1/51 What is prob of picking 2 k when two letters picked without replacement from kkhkkhhhkkhkkkkhkhk? 22/57 Two letters picked without replacement from jajawwaaajjajjjwajaw. Give prob of picking 1 w and 1 a. 16/95 Calculate prob of picking 2 m when two letters picked without replacement from {y: 11, m: 9}. 18/95 What is prob of picking 1 r and 1 u when two letters picked without replacement from {d: 1, u: 1, r: 2}? 1/3 Calculate prob of picking 2 w when two letters picked without replacement from wwkkwwkkkwc. 2/11 What is prob of picking 1 w, 1 y, and 1 s when three letters picked without replacement from {s: 1, w: 1, y: 2}? 1/2 Four letters picked without replacement from {k: 2, w: 2}. Give prob of picking 4 k. 0 Two letters picked without replacement from mfmvqqdqdvdeedv. Give prob of picking 2 e. 1/105 Two letters picked without replacement from yhm. Give prob of picking 1 h and 1 y. 1/3 Calculate prob of picking 1 l and 1 y when two letters picked without replacement from srsrsxysl. 1/36 Calculate prob of picking 2 z and 1 s when three letters picked without replacement from hzhshhzhhihhh. 1/286 Calculate prob of picking 3 u when three letters picked without replacement from kknkakuuhhakuhauuna. 10/969 Three letters picked without replacement from wmmtcfwktmmtttt. Give prob of picking 1 m and 2 t. 12/91 Four letters picked without replacement from ffcfcfcccfff. Give prob of picking 4 f. 7/99 Calculate prob of picking 1 u and 1 o when two letters picked without replacement from {r: 12, o: 1, u: 5}. 5/153 Calculate prob of picking 1 i and 1 x when two letters picked without replacement from ixvhg. 1/10 What is prob of picking 2 c and 2 r when four letters picked without replacement from {r: 2, c: 11}? 1/13 Two letters picked without replacement from iyniiyyii. Give prob of picking 2 y. 1/12 What is prob of picking 1 m and 1 f when two letters picked without replacement from {v: 1, q: 1, f: 2, i: 2, m: 1}? 2/21 What is prob of picking 1 v and 2 n when three letters picked without replacement from nvnnnnnnnvvnvvvnvvv? 135/323 What is prob of picking 3 n when three letters picked without replacement from nnnn? 1 What is prob of picking 4 h when four letters picked without replacement from hhhhhhhhhhhhu? 9/13 Two letters picked without replacement from {k: 4, q: 3, x: 1}. What is prob of picking 2 k? 3/14 What is prob of picking 1 o and 3 d when four letters picked without replacement from ooddd? 2/5 Two letters picked without replacement from {v: 2, h: 3}. What is prob of picking 2 h? 3/10 What is prob of picking 4 x when four letters picked without replacement from {x: 6}? 1 Three letters picked without replacement from {h: 1, a: 1, g: 5, x: 9}. Give prob of picking 2 g and 1 x. 9/56 Four letters picked without replacement from {f: 7, m: 2, r: 9}. What is prob of picking 2 r and 2 m? 1/85 Calculate prob of picking 1 h and 2 a when three letters picked without replacement from {h: 8, i: 1, j: 1, a: 9}. 96/323 What is prob of picking 1 r and 1 w when two letters picked without replacement from {r: 5, h: 1, w: 4, j: 5, m: 1}? 1/6 Two letters picked without replacement from bnbiibnviynibnq. What is prob of picking 1 y and 1 q? 1/105 Calculate prob of picking 4 u when four letters picked without replacement from {u: 5}. 1 Calculate prob of picking 1 s and 1 q when two letters picked without replacement from utqtqsl. 2/21 What is prob of picking 1 i a	{ "pile_set_name": "DM Mathematics" }
r. 4 Let w be (-18)/(-14) + 26436/84. Solve -wi + 318i + 4 = 0 for i. -2 Let f be 0/(-1) - (5 + -1). Suppose 4i - 104 = x, -3i - 442 = 4x - 102. Let y be -20(x/20 - f). Solve -y = -7p + 3p for p. 2 Let z be (-3 - 4925/(-15)) + 2/3. Let t = z - 314. Solve -9v = -3v - t for v. 2 Suppose 162 = 13h - 5t, h + 4t + 40 = 5h. Solve -o = 14 - h for o. 0 Suppose 30i - 36i = -264. Let y be 9/(-2)(-8 - i/(-6)). Suppose -l - 5d - 6 = l, 5l - 5d - 20 = 0. Solve -lt = -yt for t. 0 Let b be 10/2 - (13 + -10). Let n be b + (-177)/5 + 4/10. Let f = n - -35. Solve fm = 6m + 12 for m. -3 Suppose 0 = o - 9 - 1. Let y be -1 + 25/o58. Let s = -144 + y. Solve s = h - 0 + 4 for h. -4 Let p(t) = 4t*2 + 5t - 4. Let u be p(1). Suppose 3x - 2 = -2o - 14, uo + 4 = -x. Solve 2l - 2 = -o for l. 1 Suppose 0 = l - 3f - 7, l + 17 = -8f + 3f. Let w(v) = -v - 5. Let i(g) = g + 2. Let b(s) = -7i(s) - 3w(s). Let d be b(l). Solve x = 4x - d for x. 3 Suppose 0 = 3n, 0b - b - 4n = -7. Let m(v) = -v3 + 29v*2 - 21v - 294. Let f be m(27). Let d = f - 597. Solve d = -5y + by - 10 for y. 5 Let o = -168 - -153. Let v be (o/(-6))/(17/68). Solve b + b = v for b. 5 Let x = 18528 + -18516. Solve -xm = 725 - 689 for m. -3 Let d = -101 + 96. Let l(m) = m2 + 4m + 1. Let u be l(d). Let r = -25 - -56. Solve -5n - r = -u for n. -5 Suppose -w + 1 = -0. Suppose h = -w - 4. Let m(q) = 2q*2 + 3q - 10. Let v be m(h). Solve 4b + b = v for b. 5 Let g be (-792)/(-1872)(-52)/(-2). Suppose 3d = -3y - 0y + 21, -4d + 28 = -3y. Solve g = -6n - d for n. -3 Let i(d) be the third derivative of 0d + 19d2 - d3 + 0 + 1/4d4. Let j be i(1). Solve c + 4 = -j for c. -4 Let k(q) = 8q + 3. Let s be k(1). Let o = s - 8. Suppose 4 = oz - 2. Solve -za = -0a + 8 for a. -4 Suppose -3n - k = -1 - 13, 0 = -4n + 2k + 32. Suppose 12 = 10v - nv. Suppose -d - 5b = 13, vd + 6 = -4b - 0. Solve -dm = -0m for m. 0 Let u(t) = -t3 - 8t*2 - 7t - 2. Let m be u(-7). Let f(y) = -y*2 - 5y - 4. Let n be f(m). Let z be n/6 - 24/(-9). Solve 0 = zg - 0g for g. 0 Let v(y) = 546y + 5460. Let j be v(-10). Solve j = -p + 20 - 26 for p. -6 Let b(c) = -2c*2 + 214. Let d be b(-10). Solve dy = 16y + 2 for y. -1 Let n be 2 - (-3)/3 - 3. Suppose nm - 10 = -2m. Suppose mo - o = 16. Solve -9 = ob + 11 for b. -5 Let u(g) = -g2 - 6g - 6. Let k(l) = -l + 7. Let c be k(10). Let d be u(c). Solve 4j - 2 = dj for j. 2 Suppose -4j + 161 = -5m, 0 = 3j - m - 39 - 79. Suppose -4w - 21 = j. Let t = w + 30. Solve 0 = -4i - i - t for i. -3 Let c = -1163 + 1271. Solve 82z = 64z - c for z. -6 Let b(t) = 966t + 1107. Let c be b(-1). Solve 25g = -84 - c for g. -9 Let w(f) = -67f + 2479. Let y be w(37). Solve 50s + 22 + 28 = y for s. -1 Let b(u) = 4u*3 + 5u*2 - 4u - 12. Let x be b(-2). Let l be x/(-20)(-55)/(-22). Solve 0 = 6j - lj + 4 for j. -1 Let y(i) = -i2 - 219 - 9i*3 + 220 + 3i - 2i2 + 4i2. Let b(w) = w2 - 2w - 1. Let n be b(2). Let m be y(n). Solve 4g - m = 8 for g. 4 Suppose 304 = 4r + 2f, -f - 307 = -5r + 66. Solve -25l - 150 = r for l. -9 Let a(h) = 11h3 + 1. Let p = 0 + 1. Let w be a(p). Suppose -4z = -2u - 6 - 16, -2u - w = -2z. Solve 0r = zr + 10 for r. -2 Suppose 0 = -q - g - 104, 4g - 417 = 3q - 140. Let b be 18/q + 780/55. Solve 3l - 68 = -bl for l. 4 Suppose 5x + 23t = 22t + 71, x - 5t - 35 = 0. Solve -xo = -10o - 15 for o. 3 Let y be ((6 + (-1 - 4))3)/1. Let j be 1/(-4) - (-1)/(-4 - -8). Solve 3u + ju + y = 0 for u. -1 Let i(l) = l*3 + 2l*2 - 5l - 12. Let c be i(-2). Let x be 14/35 - c/(-5). Solve x = 7b - 4b + 12 for b. -4 Let h be 116/14 - 3/(42/4). Let i(u) = -u*3 + 3u*2 + 7u - 11. Let f be i(h). Let k be (-1)/((-2)/(-11) - (-105)/f). Solve 0 = -3l + k + 1 for l. 2 Let h(c) be the second derivative of c5/10 - 9c*4/4 + 13c*3/6 + 5c*2/2 - 66c. Let z be h(13). Solve -7w + zw + 6 = 0 for w. 3 Let x be 1155/148/5. Suppose 137p - 200 = xp. Suppose 0 = pu - 37u. Solve 4h = -uh + 8 for h. 2 Suppose 9v + 8v - 2680 - 3576 = 0. Solve -111q + 157q = -v for q. -8 Let c(o) = o - 23. Let v be c(26). Suppose -vy - 21 = -3z, 0z - y - 16 = -4z. Suppose r + 2b - 5 - 1 = 0, -4r - b + 31 = 0. Solve -r = -zq + 1 for q. 3 Suppose -56 = -12c - 8. Let l(o) = -c + 2 - 7o + 4 + o*2. Let x be l(7). Solve 2n = -xn - 12 for n. -3 Let a = -90 + 98. Solve ax - 9x = 1 for x. -1 Let m = 283 + -283. Suppose -2t + 2p + 29 = 3p, -t + 4p - 8 = m. Solve -2o - t = o for o. -4 Let h(u) = -u*2 + 7u + 2. Let w be h(7). Suppose 4i - b - 19 = -5, 3b + 2 = wi. Solve -i + 20 = -4l for l. -4 Let w = 15 - -86. Let f = w - 99. Suppose c - 5o = -6, 4c + 2o - o - 18 = 0. Solve -2r - c = fr for r. -1 Let b = 92 + -197. Let g = -97 - b. Suppose -57 = -4t + 5f, 0 = t - 2t - 5f + g. Solve 5o - 7 = t for o. 4 Let h = 23 + -65. Let r = 44 + h. Suppose 18 = 3g + f, f = rf. Solve 2 = 2x - g for x. 4 Let j = 5061 - 5048. Solve 40 = -js + 118 for s. 6 Let v be 6/(1(4 - 5)). Let i = v - -8. Let w = i + 3. Solve 2x - 3 = wx for x. -1 Let z be 20/((-440)/(-50) + -9 + (-18)/(-40)). Solve 2t = 42t + z for t. -2 Let g be 4 + 510/(-130) - (-362)/26. Let n(h) = -h3 + 8h*2 + 2h - 10. Let l be n(8). Let x = -3 - -5. Solve -xt + g = l for t. 4 Let g(v) = -v3 + 11v*2 + 24v - 242. Let f be g(11). Solve 0 = -32p + 43p + f for p. -2 Let j be ((-260)/325)/((-2)/(-1180)). Let g = j - -480. Solve 6w - 38 = -g for w. 5 Suppose -3y = -4 - 2. Let g be (-14)/(-35) - (-4)/(-10) - y. Let h be (26/5 - -1) + g/10. Solve 5r - h = -1 for r. 1 Let q(s) be the third derivative of -5s*4/6 + 175s3/6 - s2 + 37s. Let k be q(8). Solve -c = -14 + k for c. -1 Suppose n - 34 = 5z + 7, -4n + 72 = 3z. Suppose -h = 3t - n, t - 5 = -h + 20. Let i = h - 23. Solve ig + 1 - 13 = 0 for g. 3 Suppose -15u + 19u - 44 = 0. Solve -53 = 7k - u for k. -6 Suppose -2535p - 2331 = -2646p. Solve 60w - 162 = -pw for w. 2 Suppose -68 = 31l - 33l - 38. Solve lv + 78 = 153 for v. 5 Suppose -64c + 62c - 7473 = -161c. Solve d + c = 50 for d. 3 Let m(j) be the second derivative of -11j*3/6 - 51j*2/2 - 49j. Let p be m(-6). Solve 4q - p = -q for q. 3 Suppose -18s - 1066 = -1066. Solve 9m - 130 + 67 = s for m. 7 Let u(d) = -d2 + 10d + 11. Let i be u(10). Let k = i - 9. Let y(w) = w - 2. Let j be y(k). Solve j = -v - 2v for v. 0 Suppose -2 = -10u + 18. Suppose 2j + p + 1 = j, -18 = -uj + 2p. Suppose 5d - 4m + 10 = 0, jd - 2m - m = -7. Solve -df + 3 = -f for f. 3 Suppose 0 + 5 - 5 = 37y. Solve 24z - 26z = y for z. 0 Let x = -1 - 24. Let f = x - -27. Suppose ft = 4v + 16, t + 2v + 4 + 4 = 0. Solve t = 3c - 6c + 12 for c. 4 Suppose 5p - 160 - 930 = 0. Let y = 218 - p. Solve y = -0z + z for z. 0 Let y(j) = -71j2 + j - 1. Let s be y(1). Let h = -71 - s. Suppose v - 14 = 5o, -o - 3o = -4v + 24. Solve h = vu - 1 - 3 for u. 1 Suppose 0 = -75a + 76a + 57. Let h = 65 + a. Let k(q) = -q2 - 7q + 5. Let o be k(-7). Solve -oy - 12 = h for y. -4 Let w(s) = -34s + 222. Let t be w(6). Let y be 18/15 + t/(-90). Solve 0 = -4a + 5a + y for a. -1 Suppose 5z + 2 = -2p - 8, 3p = z + 2. Let j be 4 + (z - -3)/((-1)/4). Solve j = 8c - 9c - 3 for c. -3 Let j = 13558 + -13527. Solve 0 = jy - 92y for y. 0 Suppose 5w + 6 - 21 = 0. Suppose 1211j + 30 = 5r + 1210j, 4j = -5r - 20. Solve 10 = wz + r for z. 2 Suppose -18i + 6109 - 1245 = 14i. Solve -167x - 45 = -ix for x. -3 Let k = 84 - 75. Suppose ki - 70 = -26i. Solve -ip - 4 = 4 for p. -4 Suppose 0 = -t + 4c + 11, 0t + 2t - 14 = 4c. Suppose 0 = -4a + ta + 19. Suppose 4m - s - a = 0, 0m + 2s + 2 = -m. Solve -h = -0 - m for h. 4 Suppose 3t - 4u = -11 + 116, 0 = 5u - 15. Suppose -3y + v - 18 = 4v, 4y + v + t = 0. Let d(g) = -3g - 30. Let m be d(y). Solve 2 = n + m for n. -1 Suppose 1136u = 1142u - 378. Solve -ua + 29 = -286 for a. 5 Suppose i = 2k + 2k + 25, 3k = -2i - 5. Suppose ih + 11 = 21. Suppose -6 = -5n + 3a, -n - 6a + 3a = 6. Solve nm - hm + 10 = 0 for m. 5 Let a(w) be the second derivative of -5w*3/6 + 15w*2/2 + 15w + 1. Let n be a(3). Solve nj = -3j for j. 0 Let m(d) =	{ "pile_set_name": "DM Mathematics" }
059. Let z = 2.97 - -0.03. What is the closest to 0 in z, -2/3, l, 6? -2/3 Let m be 88/(-144) + 256/(-288). Which is the nearest to -0.1? (a) -14 (b) -71 (c) m c Let u = -0.3 + 1.3. Let p = 9612 - 9610. Which is the closest to u? (a) p (b) 0.1 (c) -4 b Let u(x) = x*3 + 5x*2 + 9x + 9. Let l be u(-2). Let g = -11 - -10.6. What is the closest to -3/7 in g, l, 0.5? g Let l be (27/216)/((-1)/(-1)). What is the nearest to -1 in l, 0.2, 40? l Let w = 3/6883 - -6856/61947. Which is the nearest to -0.1? (a) -0.7 (b) w (c) 5 b Let z = -0.3 + 0.1. Let i be ((-8)/5)/(4/(-10)). Let y = 369 + -369.5. Which is the nearest to 1/4? (a) y (b) z (c) i b Let r be 5 + (-22)/9 + -2 + -3. Let u = 19/9 + r. What is the closest to 3 in -0.5, u, 0.3? 0.3 Let u = -101 + 146. Let c = 137/3 - u. What is the nearest to c in -2, -0.1, 0.4? 0.4 Let m be 3002/266 + (-8)/28. What is the nearest to m in -1/2, -0.1, 0.1, -4/7? 0.1 Let l = -1140 - -1153. What is the nearest to -0.1 in 1/5, 1, l? 1/5 Let k = -4.7 + -0.3. Let y = -0.04 - 0.26. Suppose -7613 = -467v - 404v + 15033. Which is the nearest to v? (a) y (b) 2/9 (c) k b Let r = -359 + 363. Let d = 17 + -16.85. Let w = -2.15 + d. What is the closest to -1/2 in r, w, 5? w Let c = 114564 - 343693/3. Suppose -3s + 4l = -21, -2s + 5s - 2l = 15. What is the nearest to c in s, -7, 5? s Let y = -2.521 - -1.521. Let o = 22.2 - 22. Let t = -0.1 - o. Which is the nearest to y? (a) -3 (b) t (c) -1/4 b Let q = -0.329 - -1.129. Which is the closest to 0.1? (a) q (b) 0.3 (c) 1/109 c Let s = 2/515 - -511/1030. What is the nearest to s in -1/4, 0.01, -110? 0.01 Let m = 0.11621 + 1.88379. Which is the closest to -3? (a) m (b) 3/13 (c) -4 (d) 0.5 c Let p = -8.957 - -9.157. Which is the closest to 0.11? (a) p (b) 2 (c) 1 a Let c = 8.43 - 8.53. What is the nearest to c in -25, -4, 3/4, -3? 3/4 Let h(n) = 7n*2 + 77n - 330. Let z be h(4). What is the nearest to -2 in 16, z, 1? 1 Let s = -130 + 383. Let v = 169 - s. Let d = 87 + v. What is the closest to 1 in d, 1/7, 8/3? 1/7 Let k = 173697/5 + -34740. Let t = 0 + 0. Which is the nearest to 3? (a) t (b) k (c) 1 c Let x = -166 + 167. Let h = -25.1 + 3.1. Let n = 21.6 + h. What is the nearest to x in n, -0.1, 2/21? 2/21 Suppose -2o - 3y = 15, -y - 7 - 8 = 4o. Which is the nearest to 5? (a) o (b) 1/3 (c) 2/7 (d) 4 d Let r = -300 + 507. Let n = -207.1 + r. Which is the closest to 13? (a) n (b) 5 (c) -0.3 b Let l = 3548.8 + -3549. What is the closest to l in 0.1, -5/3, 0.17, -0.4? -0.4 Let f = 217.35 - 4.35. Let x = f - 214. Which is the nearest to x? (a) -2 (b) 81 (c) 1 a Let w = 6 - 6.4. Let d(j) = j3 - 10j*2 - 41j + 28. Let m be d(13). Which is the closest to 1? (a) w (b) -0.1 (c) m c Suppose 11k - 8k = 3r - 24, -5k = 3r + 32. What is the nearest to 1 in 0, 4, -6, r? r Let t = 282 + -285. Let b = -19.7 - -20. What is the nearest to 1/4 in b, t, 0.1? b Let f = -5/39 - -172/429. Let d = 113.1 - 113. Let k = -1/5 - -11/105. Which is the nearest to d? (a) k (b) -3 (c) f c Let p = 15 - -9. Let y = p + -25. Let s = -219 - -207. What is the closest to 0 in -2, y, s? y Let l = -2928 + 2893. Which is the nearest to 0.2? (a) -18 (b) -2/9 (c) -5 (d) l b Let g(p) = -4p*2 - 106p - 32. Let k be g(-26). Suppose 7s + 1 + k = 0. Which is the nearest to -1/2? (a) -0.2 (b) s (c) -4.1 a Let v = -305.4 + 387. Let a = 81.643 - -0.357. Let k = a - v. What is the nearest to 0.1 in k, -1/10, 3? -1/10 Let q = 12 + -7. Let k = -0.015 - 11.685. Let t = 11.3 + k. Which is the closest to 1? (a) q (b) 2 (c) t b Let k = 0.30989 - 0.00989. Which is the closest to 62/7? (a) k (b) 3/2 (c) 1 (d) 0.4 b Let y = 2369033/5 + -473807. Let p be (-1)/3 - 58/(-138). Which is the closest to 5? (a) -1/5 (b) y (c) p c Let n = 155 + -154.5. What is the closest to 0.04 in 0.4, 77/10, n? 0.4 Let i = -28051 + 28050.6. Let k = -4.9 + 0.9. Which is the closest to k? (a) i (b) 1/10 (c) -6/5 c Let m = -0.72461 - -0.32461. What is the nearest to -1 in -6, m, 6, 49? m Suppose 0 = 19f - f + 9f + 3105. What is the nearest to -1 in f, -1/7, 0? -1/7 Suppose -28 = 4i + 20. Let g = -91/55 - -893/440. What is the closest to 2/5 in 2/9, g, i? g Let y be ((543/(-20))/(-3))/((-1350)/(-60)). Let t = y + -9/50. Which is the nearest to t? (a) 0.5 (b) 1/12 (c) 5/2 b Let q(u) = 63u + 1287. Let r be q(-20). What is the closest to -145 in -5, r, -1/2? -5 Let y = -97/5 + 383/20. Let o = 9/80 + -349/1680. What is the nearest to 0 in -6, y, -3, o? o Let n = 6.741 + -7.241. Which is the closest to -0.1? (a) n (b) 8 (c) 1/5 c Let n = 421 + -422. Let k be (-10)/(-12)(-6)/(-50). What is the nearest to 0.3 in 0.8, k, n? k Let s = -4068 - -4666. Which is the nearest to -1/2? (a) s (b) 2/5 (c) 0.5 b Let z = -391.7 + 389.2. Which is the nearest to 0.1? (a) z (b) -1/8 (c) 0.5 b Let i = -995 + 6967/7. Which is the nearest to i? (a) 1/3 (b) -0.2 (c) -17 a Let d = 1412.98 + -1413. Suppose -2j + 7j - 5 = 0. What is the nearest to d in j, -1, -2/9? -2/9 Let q = 2.777 + 0.073. Let n = -2.87 + q. Let x = -3 - -8. Which is the closest to -0.1? (a) -1/3 (b) x (c) n c Let v = 15064 + -15078. What is the nearest to v in -0.5, 0.1, -2/5, -1? -1 Let s = 27055/3 + -8143339/903. Let o = s - -2/43. Let i = -0.047 - -1.047. Which is the nearest to o? (a) -0.4 (b) 3 (c) i a Let a = 486 - 494. Let o be (16/a)/(48/18). Let s = -0.2 + 0.3. What is the closest to -3 in 2/13, o, s? o Let n be (12/(-42))/(25/7 + -4). Which is the closest to 3? (a) 0 (b) -0.9 (c) n c Let h = 67 - 71. Let i = -4506.961 - -4504. Let c = 0.039 - i. What is the closest to -0.03 in c, 3/5, h? 3/5 Suppose -3c - 19 = -4m, 0 = 5m - 4c - 2 - 22. What is the nearest to -0.2 in -1/5, 2/9, m, 3/4? -1/5 Let s = -2521 - -2523. Which is the nearest to 1? (a) -1 (b) s (c) -5 (d) -2/5 b Let l = 1.45 + -2.65. Let u = -1.6 - l. Which is the nearest to 0.5? (a) 1/8 (b) u (c) 0.3 c Let j be (-1048)/(-52) - 4/26. Let y(p) = -p + 19. Let c be y(j). Let r be 2/4 + (-15)/(-6). What is the nearest to c in r, -1/6, 2? -1/6 Let v(x) = -3 - 2 + 5 + 5x2 + 3x + 3408x3 - 3407x*3. Let b be v(-1). What is the nearest to -3/4 in -2/3, b, 74? -2/3 Let o = 59.95 - 56.95. Which is the nearest to 2/5? (a) 1/6 (b) 0.0749 (c) o (d) 0.4 d Let y = -992 + 992.1. Let g = -27 + 27. Which is the nearest to y? (a) 0.5 (b) -37 (c) g (d) 5 c Let f = -0.38 + -0.02. Let b = -193.095 - -193. Let r = b - -2.095. What is the closest to 0.2 in 1/4, f, r? 1/4 Let z = -4.95 - 0.05. Let i be 650/7 + (-20)/(-15) + -1. Let m = i - 280/3. What is the nearest to m in 2, 1/4, z? 1/4 Let v = -204.76 - -204.66. Let t = 0.09 - 1.59. Let y = -0.5 - t. What is the closest to -0.1 in y, -26/5, v? v Let r = -82659/23 + 3594. Which is the nearest to 1/5? (a) -0.3 (b) 5/4 (c) -12 (d) r d Suppose -3h = -4j - 8, -5h - 2j - 2j = -24. Let g = -1495.03 - -1495. What is the closest to g in h, -5, -3? -3 Let g = 6360 + -31801/5. What is the closest to g in -1, 2, 47, 3? -1 Suppose 73n = 253n - 806 - 454. What is the nearest to n in -0.1, -14, 5, -5? 5 Let q = 54 - 49. Suppose 12l - 8 = 8l. Let o be (3 - (4 + -2)) + l. What is the closest to 2 in o, q, 0.4? o Let g = -8100 + 8101. Which is the closest to 0.01? (a) -3 (b) -3/2 (c) g (d) -0.2 d Let f = -350.71 + 360. Let p = f + 1.11. Let l = p - 10.3. What is the nearest to -0.1 in 2/13, 0.2, l? l Let r = 770.244 + -774. Let f = -0.244 + r. Which is the nearest to -0.11? (a) 0 (b) f (c) 2/11 (d) -0.4 a Let v = 0.55 + -1.05. Let p = -2.052 + -0.208. Let z = p - -0.26. Which is the closest to 1? (a) v (b) 1 (c) z b Let m = -3839 + 3839.3482. Let n = m + 0.0518. Which is the nearest to -2? (a) n (b) 2/19 (c) -0.1 c Let z be ((-504)/(-385) - 5/(-55))-1. Let i = -1.911 - 0.089. What is the closest to 6 in i, z, 4/7? 4/7 Let i be 4524/351 - 2/(-18). Suppose 2f - 5w + i + 0 = 0, 0 = 5f - 4w + 7. What is the nearest to f in -0.4, 22, -0.3? -0.3 Suppose -6 + 71 = -13w. Let b be ((-18)/22)/(24/16). What is the nearest to -2/7 in -2/15, b, w? -2/15 Let k = -3 - -3.1. Let x = 665 + -665. Which is the nearest to x? (a) k (b) -0.9 (c) -2/11 a Suppose -8 = -3*z - 50. Let w =	{ "pile_set_name": "DM Mathematics" }
m of 205615, 205574, 205505, 205408, 205283? -14k2 + k + 205628 What is the k'th term of 442069, 442096, 442155, 442258, 442417, 442644? 2k*3 + 4k*2 + k + 442062 What is the g'th term of -3211850, -6423704, -9635562, -12847424, -16059290, -19271160? -2g*2 - 3211848g What is the v'th term of 32533, 31278, 30023, 28768? -1255v + 33788 What is the k'th term of 261965, 261908, 261813, 261680, 261509? -19k*2 + 261984 What is the c'th term of -332559, -332855, -333151, -333447, -333743? -296c - 332263 What is the t'th term of 255275, 255565, 256049, 256727, 257599? 97t2 - t + 255179 What is the z'th term of 4651285, 4651286, 4651289, 4651294, 4651301? z2 - 2z + 4651286 What is the x'th term of 2126, 1653, 824, -355, -1878, -3739, -5932? x*3 - 184x*2 + 72x + 2237 What is the z'th term of 313806, 313735, 313664? -71z + 313877 What is the b'th term of 207155, 207272, 207473, 207764, 208151, 208640, 209237, 209948? b3 + 36b*2 + 2b + 207116 What is the j'th term of -8401381, -16802758, -25204135? -8401377j - 4 What is the j'th term of -19270927, -19270894, -19270861, -19270828, -19270795, -19270762? 33j - 19270960 What is the b'th term of 69594, 139222, 208896, 278640, 348478? 4b3 - b2 + 69603b - 12 What is the u'th term of 100336, 200671, 300996, 401305, 501592? -u3 + u2 + 100339u - 3 What is the g'th term of 74764, 74753, 74732, 74701, 74660? -5g*2 + 4g + 74765 What is the h'th term of 1948, 15756, 53386, 126796, 247944? 1993h3 - 47h*2 - 2h + 4 What is the q'th term of -8606, -34352, -77262, -137336, -214574? -8582q2 - 24 What is the y'th term of -20902022, -41804048, -62706074? -20902026y + 4 What is the r'th term of 2805, 2770, 2771, 2820, 2929, 3110? 2r3 + 6r*2 - 67r + 2864 What is the v'th term of -1367321, -5469322, -12305983, -21877298, -34183261? v*3 - 1367336v*2 + 14 What is the t'th term of -6942, -13398, -19854, -26310? -6456t - 486 What is the w'th term of 11514, 24966, 38418, 51870? 13452w - 1938 What is the a'th term of 2305322, 4610652, 6915984, 9221318, 11526654, 13831992? a2 + 2305327a - 6 What is the x'th term of -9495962, -18991934, -28487908, -37983884, -47479862, -56975842, -66471824? -x*2 - 9495969x + 8 What is the c'th term of -373970961, -373970960, -373970959? c - 373970962 What is the a'th term of 48382, 48326, 48266, 48202, 48134? -2a2 - 50a + 48434 What is the l'th term of 95141, 95095, 94993, 94835? -28l2 + 38l + 95131 What is the m'th term of 1471861, 1471855, 1471845, 1471831, 1471813, 1471791, 1471765? -2m2 + 1471863 What is the k'th term of -1568750, -3137496, -4706242? -1568746k - 4 What is the d'th term of -72442, -144820, -217198, -289576, -361954, -434332? -72378d - 64 What is the n'th term of -712, -6198, -21516, -51718, -101856, -176982, -282148? -842n*3 + 136n*2 - 6 What is the s'th term of -348, -230, -84, 90, 292, 522, 780? 14s*2 + 76s - 438 What is the z'th term of -3298, -6759, -10186, -13561, -16866, -20083, -23194, -26181? 3z3 - z2 - 3479z + 179 What is the b'th term of 1034226857, 1034226856, 1034226855, 1034226854, 1034226853? -b + 1034226858 What is the c'th term of -26, -753, -2118, -4121? -319c2 + 230c + 63 What is the i'th term of 13086, 23298, 33510, 43722, 53934, 64146? 10212i + 2874 What is the r'th term of -2006, -2886, -4342, -6368, -8958? r3 - 294r*2 - 5r - 1708 What is the u'th term of 107, 2715, 7061, 13145? 869u2 + u - 763 What is the q'th term of 4375365, 8750732, 13126099, 17501466? 4375367q - 2 What is the o'th term of 6557, 66496, 229197, 546044, 1068421, 1847712, 2935301, 4382572? 8564o3 - 3o*2 - 2004 What is the o'th term of 4610, 36297, 122306, 289799, 565938, 977885, 1552802, 2317851? 4527o3 - o2 + o + 83 What is the s'th term of -2240070, -8960274, -20160612, -35841084, -56001690, -80642430, -109763304? -2240067s2 - 3s What is the f'th term of 4153, 4145, 4125, 4087, 4025? -f3 - f + 4155 What is the b'th term of 12709, 12810, 12909, 13006, 13101, 13194? -b2 + 104b + 12606 What is the x'th term of -41521, -41548, -41625, -41776, -42025? -4x3 - x2 + 4x - 41520 What is the l'th term of -53766, -107459, -161068, -214599, -268058, -321451? -l3 + 48l*2 - 53830l + 17 What is the u'th term of 8570, 16905, 25242, 33581, 41922, 50265, 58610? u*2 + 8332u + 237 What is the v'th term of -16546, -33027, -49446, -65803? 31v2 - 16574v - 3 What is the d'th term of -6456150, -6456196, -6456242, -6456288? -46d - 6456104 What is the h'th term of -8081, -16333, -24711, -33215, -41845, -50601, -59483? -63h*2 - 8063h + 45 What is the l'th term of 21989581, 43979163, 65968747, 87958333, 109947921? l*2 + 21989579l + 1 What is the b'th term of 355539, 711069, 1066599, 1422129, 1777659? 355530b + 9 What is the v'th term of 84, 300, 736, 1488, 2652, 4324, 6600? 16v*3 + 14v*2 + 62v - 8 What is the s'th term of 838, -4946, -20652, -51242, -101678, -176922? -827s3 + s2 + 2s + 1662 What is the d'th term of -6520747, -13041496, -19562245, -26082994? -6520749d + 2 What is the q'th term of -1456463, -1456440, -1456417, -1456394, -1456371, -1456348? 23q - 1456486 What is the i'th term of 64835, 64761, 64687, 64613, 64539? -74i + 64909 What is the a'th term of 54247, 108456, 162625, 216754, 270843? -20a*2 + 54269a - 2 What is the s'th term of -240071, -239991, -239911, -239831? 80s - 240151 What is the p'th term of -78378, -76308, -74238? 2070p - 80448 What is the i'th term of -13867, -12761, -11651, -10537, -9419, -8297, -7171? 2i2 + 1100i - 14969 What is the g'th term of -5222, -10786, -16346, -21902, -27454? 2g2 - 5570g + 346 What is the p'th term of -22770734, -22770735, -22770736? -p - 22770733 What is the v'th term of 692534, 692525, 692522, 692525? 3v2 - 18v + 692549 What is the w'th term of -90472, -180944, -271418, -361894, -452372? -w*2 - 90469w - 2 What is the v'th term of 1875700, 1875727, 1875754, 1875781? 27v + 1875673 What is the b'th term of -24264125, -24264124, -24264123? b - 24264126 What is the s'th term of 79, 172, 315, 496, 703, 924, 1147, 1360? -2s*3 + 37s*2 - 4s + 48 What is the r'th term of -8465, -33869, -76239, -135599, -211973? -4r3 - 8459r*2 + r - 3 What is the a'th term of -3153, -12605, -28349, -50385? -3146a*2 - 14a + 7 What is the j'th term of 5396, 43010, 145108, 343934, 671732, 1160746, 1843220, 2751398? 5374j3 - 2j*2 + 2j + 22 What is the o'th term of 17373, 17868, 18363, 18858, 19353, 19848? 495o + 16878 What is the z'th term of 1508810, 1509201, 1509594, 1509989, 1510386, 1510785, 1511186? z2 + 388z + 1508421 What is the l'th term of -303352111, -303352108, -303352105? 3l - 303352114 What is the y'th term of -5909, -23771, -53541, -95219? -5954y*2 + 45 What is the h'th term of 1489, 5891, 13067, 22885, 35213? -22h*3 + 1519h2 - h - 7 What is the l'th term of -282315, -281194, -280071, -278946, -277819, -276690, -275559? l2 + 1118l - 283434 What is the p'th term of 2566, 5255, 7942, 10627, 13310, 15991, 18670? -p2 + 2692p - 125 What is the a'th term of -8407813, -8407815, -8407817, -8407819, -8407821, -8407823? -2a - 8407811 What is the m'th term of -4776, -18686, -41856, -74286, -115976? -4630m*2 - 20m - 126 What is the k'th term of 1098, 9168, 31400, 74976, 147078, 254888, 405588? 1197k3 - 101k*2 - 6k + 8 What is the c'th term of -8006527, -16013057, -24019587? -8006530c + 3 What is the o'th term of -151, -1049, -2565, -4699, -7451? -309o*2 + 29o + 129 What is the d'th term of -818, -6994, -23874, -56804, -111130, -192198, -305354, -455944? -891d3 - 6d*2 + 79d What is the d'th term of -133650, -267277, -400908, -534543, -668182, -801825? -2d2 - 133621d - 27 What is the d'th term of -73435514, -293742055, -660919624, -1174968221, -1835887846? -73435514d2 + d - 1 What is the y'th term of -754, -3537, -9094, -18175, -31530? -125y*3 - 637y*2 + 3y + 5 What is the x'th term of -1201, -4821, -10721, -18793, -28929? 18x3 - 1248x*2 - 2x + 31 What is the m'th term of 1049879, 2099770, 3149661, 4199552, 5249443, 6299334? 1049891m - 12 What is the x'th term of -28286883, -28286880, -28286877, -28286874, -28286871, -28286868? 3x -	{ "pile_set_name": "DM Mathematics" }
)-25)*2 + sqrt(1377)-2 + 1)-2. -333239 + 36sqrt(17) Simplify (5-2(sqrt(1700) - (sqrt(1700) + -3)2)-3)*2. -108000sqrt(17) + 1562400 Simplify (-2 + ((-3-3sqrt(88) + sqrt(88))/sqrt(8))*2)-3. -3294 Simplify (sqrt(588)/(sqrt(12)-2) - (sqrt(784) + (sqrt(784) - (sqrt(784) + 1sqrt(784)) - sqrt(784)) - sqrt(784)))/(42sqrt(567)). 5sqrt(7)/48 Simplify -2 + (4sqrt(130)-2)/(-1sqrt(360))-1. -4sqrt(13)/3 - 2 Simplify (2 + 0 + sqrt(128)1-6 + sqrt(128))*2 + 3. -160sqrt(2) + 3207 Simplify ((4(sqrt(540) - (sqrt(540) + sqrt(540) + sqrt(540)2)))/(1sqrt(12)-6))*2. 180 Simplify (4 + -3 + sqrt(612)-1)*2 - (-2 + 1sqrt(612) + -2)*2. -15 + 36sqrt(17) Simplify (sqrt(162)3-5)/(-2(sqrt(66)1)/sqrt(11)). 45sqrt(3)/2 Simplify 3 + (4 + 1sqrt(396))*2 + (-52sqrt(396) + 4)2. -432sqrt(11) + 40031 Simplify (-4((-1sqrt(156) + sqrt(156) - sqrt(156))/sqrt(12) - (2 + sqrt(39)/sqrt(3))))*2. 128sqrt(13) + 896 Simplify (sqrt(255)/(sqrt(5) + sqrt(720)-3))/(sqrt(432) - (sqrt(432)3-2 + sqrt(432) - sqrt(432))). -sqrt(17)/2940 Simplify (-4(0 + sqrt(162)))*2 - ((2 + sqrt(2))6 + sqrt(2)1 + 5 + sqrt(2)). -8sqrt(2) + 2575 Simplify (4 + 3 + 1 + 1sqrt(42)/sqrt(6))2. 16sqrt(7) + 71 Simplify 3((5 + sqrt(304) + -4 + (sqrt(304) - (2 + sqrt(304))) + -2)6)*2. -2592sqrt(19) + 33804 Simplify ((sqrt(1872) + sqrt(1872) + 1 + 0)-3 + 3)2. 67392 Simplify 3 + (sqrt(175) + -1)2 + (sqrt(7) - (-1 + sqrt(7) + 0)2 - sqrt(567)/sqrt(9)). -10sqrt(7) + 171 Simplify (-25(sqrt(832) + 0 + sqrt(832) + 3 - (0 + 2sqrt(832) - sqrt(832))))2. 4800sqrt(13) + 84100 Simplify -2(sqrt(209)/(sqrt(33)/sqrt(3)) + -4)2 + -5 + 5. -70 + 16sqrt(19) Simplify (sqrt(11) - (sqrt(176))*2-1 - (1(sqrt(44)/sqrt(4) - sqrt(11)))2)4. 4sqrt(11) + 704 Simplify (3 + -2(sqrt(17) - sqrt(612)))*2 - 22sqrt(1700). 20sqrt(17) + 1709 Simplify (-1 + sqrt(320) + -1 - (-3 + sqrt(320) + 0)) + (2sqrt(320))2 + -5 + (-1 + 0 + sqrt(320) + sqrt(320))2. -32sqrt(5) + 2557 Simplify ((sqrt(110) - (5sqrt(110)-5 - sqrt(110))) + sqrt(110))/(sqrt(1000)5). 14sqrt(11)/25 Simplify 5(4(sqrt(1300) + sqrt(1300) + -2 + 2sqrt(1300) + sqrt(1300) + sqrt(1300)))2. -19200sqrt(13) + 3744320 Simplify (1 + sqrt(5)1)-3 + 1 + 0 + sqrt(20). -sqrt(5) - 2 Simplify (sqrt(108) - -2-2sqrt(108))/(sqrt(27)/sqrt(3)1). -6sqrt(3) Simplify 3-3-1sqrt(288) + (5(1 + sqrt(288)) + -1)*2. 588sqrt(2) + 7216 Simplify 4 + sqrt(5) + -5 + 5 - ((sqrt(20)/sqrt(4) + sqrt(5))-2 - (sqrt(5) + sqrt(5) + -2 + 2)). 4 + 7sqrt(5) Simplify (3-3sqrt(55))/(sqrt(11) + sqrt(275)3) + 5. -9sqrt(5)/16 + 5 Simplify (6(-5((sqrt(48)1 - sqrt(48)) + 1 - sqrt(48) - sqrt(48)) + (-1 + sqrt(2352))6))*2. -164736sqrt(3) + 4676868 Simplify (-2(-1 + sqrt(425) + (sqrt(425) - (0 + sqrt(425))) + -2 - (-1 + sqrt(425) + -4 + 1)))2. 4 Simplify -4 + 4 + sqrt(10)/(sqrt(30)/(sqrt(24)/sqrt(4))) + -4. -4 + sqrt(2) Simplify (sqrt(56)/sqrt(4)3)/((sqrt(567) - 2sqrt(567)) + sqrt(7)) + 3. -3sqrt(2)/8 + 3 Simplify (sqrt(96)-6 + sqrt(18)/(sqrt(75) - sqrt(3)) + sqrt(6))/(sqrt(3) + sqrt(12)/sqrt(4)2 + sqrt(3) - sqrt(30)/(sqrt(20)/sqrt(2))). -91sqrt(2)/12 Simplify (-4 + -3(-5 + 1sqrt(72)) + (sqrt(72) + 1 + -5)-1)*2. -720sqrt(2) + 1377 Simplify (sqrt(60)/(sqrt(15)/sqrt(3))4)/((sqrt(3872) + sqrt(3872)1)/sqrt(8)). 2sqrt(3)/11 Simplify ((2sqrt(125)4 + (2sqrt(125) + -2 - sqrt(125)))-2)2. -720sqrt(5) + 40516 Simplify (-1 + (sqrt(125) - (sqrt(125) + 0 + -3)))*2 + ((sqrt(125) + sqrt(125) + 1 + 5)4)*2 + 3. 1920sqrt(5) + 8583 Simplify ((sqrt(80)1)/sqrt(8))/(sqrt(350)/sqrt(7)). sqrt(5)/5 Simplify 5((-2sqrt(130) + sqrt(130) + sqrt(130))6 - sqrt(130) - (4sqrt(130)-2 + sqrt(130)))/(((2sqrt(60))/sqrt(3))/sqrt(2)). 15sqrt(13) Simplify (-1 + (1sqrt(1900) - sqrt(1900)) - ((-1 + sqrt(76)2)*2 - sqrt(76))) + 5. -301 + 10sqrt(19) Simplify sqrt(36)/(sqrt(588)-1)-53. 15sqrt(3)/7 Simplify (-1((sqrt(572)2)/sqrt(11))/(sqrt(576)-3 - sqrt(576)))2. 13/576 Simplify (sqrt(352) + -2sqrt(352)-1)/(6sqrt(8)1) + 2 + 4. sqrt(11) + 6 Simplify -6(-4 + 2sqrt(208) + 3)2. -4998 + 96sqrt(13) Simplify -4 + (1sqrt(1377))2 + 0 + 3. 1376 Simplify (-2(-4 + -5 + sqrt(72) + -2))*2. -528sqrt(2) + 772 Simplify (((sqrt(18) + sqrt(162)/sqrt(9))/sqrt(3))/(sqrt(243)1 - sqrt(3))3)*26. 27/4 Simplify sqrt(99) - (sqrt(99) - ((sqrt(99)-1 - sqrt(99))3 - sqrt(99)))*2 - (sqrt(99) + 4 + sqrt(99) + -4). -6336 - 3sqrt(11) Simplify (((-3-1sqrt(99))/sqrt(3))/(12sqrt(396)))*2. 3/16 Simplify ((sqrt(125) + (sqrt(125)-3-3 - sqrt(125)))45)2. 4050000 Simplify -3(sqrt(19) + -1sqrt(475)) + (sqrt(190)/(sqrt(640)-1))*2. 19/64 + 12sqrt(19) Simplify -5((-22sqrt(66))/((sqrt(42) + sqrt(168))/sqrt(7)))2. -880/9 Simplify (2((sqrt(1331)-2 + 4 - (2sqrt(792))/sqrt(2)) + -4))*2. 50864 Simplify (2sqrt(513))/((sqrt(240)/sqrt(10))/sqrt(8)). 6sqrt(19) Simplify 4(sqrt(72) - ((sqrt(72) - (-2 + sqrt(72))) + -2)*2)3 + -2. -2 + 72sqrt(2) Simplify ((sqrt(180) - (sqrt(180) + -2sqrt(180)-3))/sqrt(5))/(sqrt(768) + (-2sqrt(768) - sqrt(768)) - -5sqrt(108)). 6sqrt(3) Simplify (sqrt(1900) + (sqrt(1900) - (sqrt(1900) - (-4 + 1sqrt(1900)))2 - sqrt(1900)) + sqrt(1900) + sqrt(1900) - (2sqrt(1900))*2-1) + 1. 30sqrt(19) + 7585 Simplify (((sqrt(6000) - sqrt(6000)1)6)/(sqrt(120)/(4sqrt(90)/sqrt(9))))*2. 0 Simplify ((sqrt(720) - sqrt(720)-1)6 - (sqrt(720) + 1 + -2) - (sqrt(720) + -2(-1 + sqrt(720)) - (sqrt(720) - (sqrt(720) - (-2 + sqrt(720))5))))2. -4488sqrt(5) + 208201 Simplify 5 + ((sqrt(216)2)/sqrt(12) + sqrt(18) - 4(sqrt(18) - sqrt(36)/sqrt(2))). 5 + 9sqrt(2) Simplify (-6-1sqrt(612) + sqrt(612) - (2sqrt(612) + -1) - -6(3(sqrt(612) + -1 - sqrt(612)) + sqrt(612)))*2. -2244sqrt(17) + 74341 Simplify (6(sqrt(143)-1)/sqrt(11) + ((sqrt(156) + (sqrt(156)2 - sqrt(156)) + sqrt(156))-5)/sqrt(12))*2. 5733 Simplify ((sqrt(684)-5 + 1 + (sqrt(684) + 2)6 + -2)-1)*2. 132sqrt(19) + 805 Simplify -3 + -4(-6(2sqrt(539) + sqrt(539) + -5))24. -2808579 + 120960sqrt(11) Simplify 6(sqrt(95)/(sqrt(20)1) - sqrt(133)/(sqrt(7) - sqrt(21)/sqrt(3)-6 - sqrt(7)))*2-5. -190/3 Simplify (((sqrt(550) - ((sqrt(550)1 + sqrt(550) - sqrt(550)) + sqrt(550) + sqrt(550))) + sqrt(550) - -1sqrt(88))/((sqrt(22)1)/sqrt(11) - 1sqrt(8))3)2. 891 Simplify 53((sqrt(196)2)/(sqrt(28)/(sqrt(36) + sqrt(4))) + 3). 45 + 240sqrt(7) Simplify -5 + -2sqrt(9)/sqrt(3) + sqrt(27)/sqrt(36) + 1 + 4. -3sqrt(3)/2 Simplify -6(-1 + (-1sqrt(76))2 - (2 + (sqrt(76)-1)*2 - sqrt(76)))-1. -18 + 12sqrt(19) Simplify (5(-5sqrt(156) - sqrt(156)) - sqrt(156))/(sqrt(12) + sqrt(300)1). -31sqrt(13)/6 Simplify (-3 + 6(-4 + sqrt(567) + 0 + (sqrt(567) - -32sqrt(567)) + sqrt(567)))*2. -26244sqrt(7) + 1654101 Simplify (sqrt(110) - sqrt(110)-26 - 5(sqrt(110)2 + sqrt(110)))/((sqrt(1000) - sqrt(1000)-1)-4). sqrt(11)/40 Simplify 6(sqrt(130)/(sqrt(40)/sqrt(4)) + sqrt(13) + (sqrt(1573) + -4)2). -516sqrt(13) + 9534 Simplify 2 + (3 + sqrt(1872) + 0 + sqrt(1872) - (sqrt(1872) + (sqrt(1872) - sqrt(1872)-3) + sqrt(1872) + -3))2-6. -179926 + 3456sqrt(13) Simplify ((-3sqrt(168))/sqrt(7) + sqrt(24))/(sqrt(120)/(sqrt(10) + (sqrt(10) - sqrt(10)-1)))-3. 18sqrt(2) Simplify 4 + 0 + 1 + sqrt(20) + sqrt(20) + 3 + sqrt(20) + (sqrt(180) - sqrt(20)) + sqrt(80) + 0. 8 + 14sqrt(5) Simplify -1((1 + (1sqrt(11) - sqrt(11)) - (sqrt(11)-2 + -5))-2)*2 + 2. -96sqrt(11) - 318 Simplify ((sqrt(154)1)/sqrt(7))/(-1sqrt(11)6 - sqrt(11))-5. 5sqrt(2)/7 Simplify (-1 + (sqrt(2) - 1sqrt(128)) + sqrt(6)/(-2(sqrt(3) - sqrt(12))))2. 13sqrt(2) + 171/2 Simplify (-3 + -4 + (1 + sqrt(637) + (sqrt(637) + -1)1)2)-6. -15246 Simplify (sqrt(637)2)2 + -5 - (1 + (sqrt(13) - (1 + sqrt(13))2)). sqrt(13) + 2544 Simplify (sqrt(6)/sqrt(3)-4)2 + (1sqrt(14))/sqrt(7) + 4 - ((sqrt(40)/sqrt(5) - sqrt(8)) + 1(sqrt(2) + (sqrt(2) - sqrt(72))))2. sqrt(2) + 4 Simplify -2 + 6(sqrt(605)-3 + -4). -198sqrt(5) - 26 Simplify -4(1 + sqrt(363) + 0 + (sqrt(363) - (sqrt(363) - (sqrt(363) + (sqrt(363)1 + 1 - sqrt(363)) - sqrt(363)))))*26. -8808 - 1056sqrt(3) Simplify sqrt(684) + -2(sqrt(684) + sqrt(684)5)2 + sqrt(684) + -1 + ((sqrt(684)-5 + sqrt(684) - sqrt(684	{ "pile_set_name": "DM Mathematics" }
*2(d + 6)/3 Let k(w) be the second derivative of w*5/40 - 43w*4/8 - 87w*3/4 - 131w*2/4 - 1407w. Factor k(q). (q - 131)(q + 1)2/2 Let h(i) be the third derivative of 0i + 0i3 + i4 + 170i*2 + 0 + 1/40i*6 - 3/10i*5. Factor h(x). 3x(x - 4)(x - 2) Let w(q) = -5744q - 63182. Let j be w(-11). Find g such that -34/15 - 12/5g - 2/15gj = 0. -17, -1 Let a(g) = g3 + 163g*2 - 490g + 1328. Let t be a(-166). Determine z, given that -35/2z + 5/2z*3 + tz*2 + 15 = 0. -3, 1, 2 Suppose 12 + 3 = 5o. Solve -2f2 - 4f*o - 45 + 2f*2 + 5f3 + f2 - 21f = 0 for f. -3, 5 Let p(b) = -3b*2 - 5b - 6. Let s be p(7). Let i be s/(-20) + -8 + -1. Factor -8/5 - 8/5o - io*2. -2(o + 2)*2/5 Suppose -294n - 2 = -295n. Factor 3z + 30z3 + 3z*5 - 32z*n - 15z*4 - 5 + 2z*2 + 12z + 2. 3(z - 1)5 Let g(i) be the third derivative of i7/350 + 61i6/200 - i5/100 - 61i4/40 - 5969i*2. Factor g(l). 3l(l - 1)(l + 1)(l + 61)/5 Let y(r) be the first derivative of r6/720 - 7r*5/240 + 62r*3/3 + 42. Let k(t) be the third derivative of y(t). Factor k(g). g(g - 7)/2 Factor 6/11y3 + 0 + 36/11y*2 + 0y - 8/11y4 - 2/11y*5. -2y*2(y - 2)(y + 3)2/11 Let s(k) be the first derivative of 7/6k*3 - 9/16k*4 + 9/16k*6 + 0k + 79 - 27/40k5 - 1/2k*2. Let s(j) = 0. What is j? -1, 0, 2/3 Let c(h) be the first derivative of -13 - 3h - 1/6h3 + 5/4h*2. Find m, given that c(m) = 0. 2, 3 Let g = -162/59 + 2548/885. Let q(z) be the first derivative of 0z + 1/3z2 - 1/6z*4 - 5 - 2/9z*3 + gz5. Suppose q(w) = 0. Calculate w. -1, 0, 1 Let a(j) be the third derivative of j6/420 - 173j5/70 + 3219j*4/4 - 9583j*3/3 + 1030j*2. Factor a(l). 2(l - 259)*2(l - 1)/7 Solve -5987i2 + 3480i2 - i5 - 7i5 + 234 + 759i + 90i3 - 114i4 - i5 + 3227i2 = 0. -13, -1, -2/3, 3 Let x(r) = -2r*2 + r - 11. Let y(o) = 33o*2 - 1203o + 1386. Let i(f) = 18x(f) + y(f). Let i(p) = 0. Calculate p. -396, 1 Let g(n) = -n - 7. Let y be g(-12). Suppose 0b - 4j = -2b - 16, -b - 23 = -yj. Factor -19c*b - 10 + 9c*2 + 18c*2 + 5c + 22c2. 5(2c - 1)(3c + 2) Factor -3c*2 - 48 - 219c + 20 + 28. -3c(c + 73) Let l(j) be the third derivative of -j*7/840 + 71j*6/480 + 29j*5/48 + 73j*4/96 + 1701j*2. Factor l(y). -y(y - 73)(y + 1)2/4 Let v(y) be the second derivative of y5/75 - y4/12 - y3/5 - 151y*2/2 + 29y + 2. Let j(n) be the first derivative of v(n). Factor j(p). 2(p - 3)(2p + 1)/5 What is h in 678/5h*4 + 1992/5h*3 + 2188/5h*2 + 126/5 + 972/5h + 28/5h5 = 0? -21, -1, -3/14 Suppose -196 - 47 = -3s - 5q, -3s = q - 231. Suppose -72r = -sr. Find d such that rd + 1/3d*3 + 1/3d*4 - 1/3d*2 + 0 - 1/3d*5 = 0. -1, 0, 1 Let x(z) = -5z*2 + 1310z + 219115. Let h(l) = -2l2 + 656l + 109558. Let t(k) = 7h(k) - 3x(k). Determine d, given that t(d) = 0. -331 Suppose -292n - 1 = 2x - 291n, 5x = 2n + 29. Factor 0 - 6/7s*x - 4/7s - 2s2. -2s(s + 2)(3s + 1)/7 Let a(f) be the second derivative of -f7/42 - f6/6 + 39f*5/10 - 6f*4 - 273f + 2. Determine l so that a(l) = 0. -12, 0, 1, 6 Let i(w) = 2w3 - w2 + 8w - 1. Let z(u) = -3u4 - 48u*3 - 405u*2 - 834u - 6. Let a(d) = -6i(d) + z(d). Let a(f) = 0. What is f? -7, -6, 0 Let w(t) be the second derivative of -27t*7/56 - 51t*6/40 + 317t*5/80 + 101t*4/48 - 17t*3/3 - 6t*2 + 51t - 16. Suppose w(v) = 0. What is v? -3, -4/9, 1 Factor 39q - 219q - 477q + 81q - 3q2 - 27648. -3(q + 96)2 Let m(v) be the third derivative of -v5/12 + 55v4/12 - 100v*3 - 995v*2. Factor m(j). -5(j - 12)(j - 10) Let b(c) be the second derivative of 1/66c*4 + 16/33c*3 + 0 + 15/11c*2 + 70c. Let b(p) = 0. What is p? -15, -1 Let o(z) = 7z2 + 358z - 338. Let n(v) = -5v2 - 359v + 346. Let k(r) = 3n(r) + 2o(r). Factor k(i). -(i - 1)(i + 362) Suppose -20/3 + 14/3z - 8/3z4 + 28/3z*2 - 16/3z*3 + 2/3z5 = 0. Calculate z. -2, -1, 1, 5 Let i be 612/99 + (-4)/22. Let s(r) = r2 - 11r + 30. Let w be s(i). Factor 0t*4 + w + 0t*2 + 1/2t + 1/2t5 - t3. t(t - 1)*2(t + 1)*2/2 Let v(i) be the first derivative of -2i*3/3 - 812i*2 - 329672i + 1038. Factor v(a). -2(a + 406)2 Let f(t) = -t2. Let x(k) = 6k*2 - k - 2. Let b = 32 + -2. Suppose 0q + b = 2q. Let o(y) = qf(y) + 3x(y). Factor o(c). 3(c - 2)(c + 1) Let p(g) be the second derivative of -g5/80 - 25g*4/48 - 119g*3/24 - 95g*2/8 - 4265g. Solve p(j) = 0 for j. -19, -5, -1 Let m(d) = -2. Let q(s) = -3s2 - 45s - 24. Let v(l) = 3l2 + 43l + 23. Let k(w) = -5q(w) - 6v(w). Let z(h) = k(h) + 6m(h). Factor z(u). -3(u + 1)(u + 10) Let u(r) be the second derivative of -10r*6/3 - 91r*5 - 74r*4/3 + 568r*3/3 - 144r*2 + 132r. Suppose u(o) = 0. What is o? -18, -1, 2/5 Let y be 243 + -248 + ((-242)/(-48) - -1). Let u(j) be the second derivative of 3j + 0 + 1/4j*2 + yj*4 + 5/6j*3. Factor u(f). (5f + 1)2/2 Let t(f) = -f2 + 9657f - 132. Let s(l) = -1932l + 24. Let q(a) = 11s(a) + 2t(a). Factor q(k). -2k(k + 969) Let f(u) be the first derivative of 45u4 - 30u + 33 + 108u5 + 245/2u*2 + 45/2u*6 - 590/3u*3. Factor f(c). 5(c + 2)(c + 3)(3c - 1)3 Factor -140o*2 - 235o*3 - 96o*3 - 238o*2 + 744o - 38o3 + 3o*4. 3o(o - 124)(o - 1)(o + 2) Let i(m) be the first derivative of -m3/9 + 49m/3 - 352. Factor i(s). -(s - 7)(s + 7)/3 Let q(k) be the second derivative of 1/3k*4 - 10k*3 + 1 + 8k + 28k2. Determine b so that q(b) = 0. 1, 14 Solve -108q*2 + 49/3q*5 + 802/3q*3 - 189q*4 + 40/3q + 0 = 0 for q. 0, 2/7, 1, 10 Suppose 0 - 17/3a3 - 2/3a*4 - 4a - 32/3a2 = 0. What is a? -6, -2, -1/2, 0 Factor 0 + 2/3c*3 - 245/6c*2 + 61/6c. c(c - 61)(4c - 1)/6 Suppose 702 = 16p + 62p. Suppose -40 = -g - pg. Determine a, given that 1/4a - 3/8a*2 + 1/8a*g + 0 + 0a*3 = 0. -2, 0, 1 Let u(q) be the first derivative of 0q + 1/6q3 - 1/2q*2 - 152. What is d in u(d) = 0? 0, 2 Factor 155g - 327g2 - 4g*4 - 22756 + 7g*4 - 153g*3 + 22756 + 322g. 3g(g - 53)(g - 1)(g + 3) Find r, given that 0 - 308/5r2 + 0r + 3/5r4 + 92r*3 = 0. -154, 0, 2/3 Let c(f) be the first derivative of 2f*3/39 - 20f*2/13 + 14f - 1408. What is n in c(n) = 0? 7, 13 Let m(w) = w*2 + 37w - 2. Let k(t) = -3t2 - 147t + 9. Let l = 542 - 533. Let f(y) = lm(y) + 2k(y). Factor f(c). 3c(c + 13) Let o(j) be the second derivative of -5j4/12 - 5j*3/2 + 135j*2 - 857j. Factor o(c). -5(c - 6)(c + 9) Suppose -179i = -201i + 110. Let u(f) be the second derivative of 0 - 1/15f6 + 0f3 - fi - 25/6f4 + 0f*2 + 8f. Factor u(r). -2r2(r + 5)*2 Let x be (12/(-9))/(58/(-24273)). Let z = x - 558. Determine h so that -8/5h*3 + 2h*2 + 2/5h*4 + z - 4/5h = 0. 0, 1, 2 Let x(o) = -o*3 - 11o*2 - 19o - 31. Let z be 1(66/6)/1. Let j(r) = -r3 - 6r*2 - 9r - 16. Let w(u) = zj(u) - 6x(u). Solve w(h) = 0. -1, 2 Let b(h) = -h*3 + h + 44. Suppose -4q + 15 = 3r, 0q - 5r + 25 = -5q. Let n be b(q). Factor 3l5 - nl - 3l3 + 44l. 3l3(l - 1)(l + 1) Let s(y) be the second derivative of y5/5 - 1565y*4/6 + 781y*3/3 + 782y*2 - y - 420. Factor s(v). 2(v - 782)(v - 1)(2v + 1) Suppose 0 = 3h - 4j + 166 + 43, 0 = -2h + 2j - 142. Let k be 0/(-2)(76 + h). Factor 1/4f2 - 1/4f*4 - 1/4f*5 + 1/4f*3 + 0 + kf. -f*2(f - 1)(f + 1)2/4 Let r(h) be the second derivative of 5h7/84 + h6/4 + h*5/4 - 5h*4/12 - 5h*3/4 - 5h*2/4 - 2931h. Factor r(p). 5(p - 1)(p + 1)*4/2 Let c(y) be the third derivative of 1/210y*7 + 0 - 1/60y*6 + 1/60y*5 + 0y*3 + 0y - 82y2 + 0y4. Find x such that c(x) = 0. 0, 1 Let w(m) be the first derivative of -m5/10 + 5m4/8 - 5m*3/6 - 5m*2/4 + 3m + 1234. Solve w(k) = 0. -1, 1, 2, 3 Let z(m) = 3m - 13. Let r be z(-7). Let i = r - -38. Factor -i - 40h*2 - 28h + 15h2 - 24h*2. -(7h + 2)*2 Let m(x) = 2x4 - x3 - x*2 - x + 1. Let p(w) = -21w*4 - 7w*3 - 6w*2 + 27w - 9. Let d(n) = 18m(n) + 2p(n). Factor d(l). -2l(l + 3)*2(3l - 2) Let g(i) be the second derivative of i4/48 + 173	{ "pile_set_name": "DM Mathematics" }
+ 19n - 27. What is t(18)? -9 Let n(f) = f3 + 5f*2 - 13f + 2. Give n(-7). -5 Let x(v) = -v*2 - 16v + 6. What is x(-6)? 66 Let d(g) = 23g - 812. Calculate d(35). -7 Let m(q) = -6q - 13. Determine m(-2). -1 Let l(b) = -12b2 - 2b - 1. Determine l(-1). -11 Let b(o) = -o*3 + 2o*2 + 15o - 15. Determine b(5). -15 Let l(d) = 4d + 27. Give l(-5). 7 Let w(p) = 229p + 7. What is w(-1)? -222 Let g(c) = -c*2 + 16c - 13. Calculate g(10). 47 Let i(w) = -11w + 10. What is i(2)? -12 Let h(c) = 2c*3 - 5c*2 + 5c - 2. Determine h(2). 4 Let w(f) = -8f - 7. Calculate w(5). -47 Let q(n) = -6n - 80. Give q(-13). -2 Let f(y) = -y*3 - 12y*2 - 8y + 37. Determine f(-11). 4 Let f(p) = p. Determine f(-1). -1 Let h(m) = -m*3 - 6m*2 + m + 8. Calculate h(-6). 2 Let w(z) = -2z*2 - 3z + 9. Calculate w(8). -143 Let h(v) = -v*2 + 19v - 59. What is h(11)? 29 Let w(t) = t*2 + 2t. Determine w(10). 120 Let z(n) = -2n2 - 9n + 5. Give z(-5). 0 Let c(x) = -x*2 + 20x - 30. Determine c(18). 6 Let k(w) = 21w + 9. What is k(-5)? -96 Let i(m) = -m - 2. Calculate i(4). -6 Let b(a) = -2a + 41. Determine b(9). 23 Let z(n) = -n + 9. Calculate z(-9). 18 Let o(q) = q*2 - 24q - 51. What is o(26)? 1 Let j(p) = -p*2 - 7p - 13. Determine j(-5). -3 Let w(h) = 2h2 + 2h + 1. Determine w(-4). 25 Let h(k) = k*2 - 7k + 2. What is h(7)? 2 Let r(w) = -w*3 - 15w*2 - 15w - 8. Determine r(-14). 6 Let i(w) = 3w2 - w - 57. What is i(-4)? -5 Let o(l) = 14l - 4. Calculate o(-5). -74 Let d(q) = -10q + 5. Calculate d(3). -25 Let c(h) = -h3 + 5h*2 - 4h - 2. Give c(4). -2 Let r(a) = a - 13. Calculate r(3). -10 Let r(n) = -29n - 337. What is r(-11)? -18 Let i(v) = -v + 17. What is i(7)? 10 Let l(h) = -34h - 535. Give l(-16). 9 Let m(o) = 4o + 7. Determine m(1). 11 Let t(d) = -18d*2 - 2d - 1. What is t(1)? -21 Let v(l) = -8l2 + l + 1. Determine v(-2). -33 Let l(d) = -d2 + 11d - 35. Give l(9). -17 Let p(s) = -s*2 + 22s - 132. Calculate p(11). -11 Let r(t) = 12t - 34. What is r(4)? 14 Let l(f) = f2 + 34f + 42. Give l(-32). -22 Let d(w) = 4w2 - 9w + 12. Give d(4). 40 Let g(u) = -u2 - 24. Give g(0). -24 Let r(f) = -f2 - 103f - 753. Give r(-8). 7 Let w(z) = z2 - 9z + 11. Determine w(8). 3 Let l(u) = 7u2 - 2u - 1. Calculate l(3). 56 Let h(s) = -s*3 + 3s*2 - 4s - 1. Determine h(3). -13 Let v(y) = 3y - 7. What is v(7)? 14 Let x(d) = 48d2 + d + 1. Determine x(-1). 48 Let f(u) = -u2 - 23. Give f(0). -23 Let h(r) = -r*2 - 38r - 321. Give h(-25). 4 Let z(i) = -i*2 - i + 4. What is z(3)? -8 Let v(s) = 2s*2 - 19s + 33. What is v(8)? 9 Let d(k) = -k*2 + 23k - 77. What is d(21)? -35 Let v(u) = -13u - 5. What is v(2)? -31 Let v(h) = -h3 + 3h*2 + h - 5. Calculate v(3). -2 Let m(q) = 21q - 56. Determine m(3). 7 Let s(v) = v - 6. Calculate s(11). 5 Let x(p) = -p*3 + p + 4. Determine x(2). -2 Let p(t) = -4t + 50. Calculate p(7). 22 Let l(u) = u*2 + 11u + 20. What is l(-7)? -8 Let x(j) = j*3 - 19j*2 + 19j + 17. What is x(18)? 35 Let f(s) = s*3 + 8s*2 + 2s + 15. Give f(-8). -1 Let s(t) = -2t2 - 7t - 5. Calculate s(-2). 1 Let i(p) = -3p + 49. Calculate i(20). -11 Let l(a) = -57a + 6. Determine l(0). 6 Let x(p) = -3p + 40. Give x(11). 7 Let w(k) = -3k + 25. Determine w(8). 1 Let s(f) = 2f3 + 2f2 - 4. Give s(-2). -12 Let u(y) = -y2 - 21y + 95. What is u(4)? -5 Let b(g) = -2g*2 + 6g - 6. What is b(5)? -26 Let s(n) = -n*2 + 9n - 14. What is s(10)? -24 Let k(v) = -v*3 - 2v*2 + 5v. Determine k(-3). -6 Let b(o) = 2o2 - 4o - 2. Calculate b(-3). 28 Let j(r) = -2r2 + 2r + 13. Determine j(0). 13 Let h(t) = -t*2 - 8t + 5. Give h(-9). -4 Let g(y) = 5y - 49. Determine g(10). 1 Let x(b) = 3b + 13. Calculate x(-12). -23 Let z(j) = -j + 20. What is z(14)? 6 Let p(d) = -d*3 + 5d*2 + 8d - 8. Determine p(6). 4 Let w(s) = -12s2 - 23s - 48. Determine w(-2). -50 Let b(r) = -r*2 + 5r + 2. Determine b(6). -4 Let r(u) = u*3 + 3u*2 + u - 7. Determine r(-3). -10 Let o(b) = 7b + 60. Determine o(-13). -31 Let u(y) = 79y3. Determine u(-1). -79 Let p(a) = -a3 - 4a*2 + 2a. Give p(-5). 15 Let b(o) = 11o + 17. Determine b(-3). -16 Let p(l) = -5l. What is p(3)? -15 Let b(d) = -d*2 + 4d - 36. What is b(0)? -36 Let p(m) = m*3 + 12m*2 + 26m + 25. Calculate p(-10). -35 Let h(x) = 45x3 - x2 + 7x - 7. Determine h(1). 44 Let f(w) = 2w2 - 20w + 8. Determine f(10). 8 Let v(u) = -4u + 61. Give v(24). -35 Let y(l) = -11l + 336. Calculate y(31). -5 Let m(s) = -s*2 + 8s + 7. What is m(8)? 7 Let i(y) = -15y. What is i(-1)? 15 Let q(i) = -i3 + 8i*2 + 5i + 29. Determine q(9). -7 Let r(v) = v - 3. Determine r(-6). -9 Let o(i) = 2i3 + 2i*2 - 2i - 1. Give o(-2). -5 Let w(c) = 5c3 - 3c*2 - c + 2. Determine w(-2). -48 Let m(k) = -4k + 8. Calculate m(4). -8 Let n(p) = p*3 + 3p*2 - 2p + 3. Give n(-3). 9 Let y(k) = k*2 - 22k - 37. Calculate y(24). 11 Let q(c) = -c*3 + 5c*2 + 8c - 11. What is q(5)? 29 Let k(l) = 3l2 + 23l - 18. Calculate k(-9). 18 Let r(o) = -o*2 - 6o + 3. Determine r(-7). -4 Let d(u) = u*3 + 10u*2 - 12u + 3. Give d(-11). 14 Let m(w) = 5w - 1. What is m(-1)? -6 Let v(t) = -31t + 22. Determine v(1). -9 Let o(f) = -3f3 + 29f*2 + 15f - 19. Determine o(10). 31 Let f(x) = x + 11. Calculate f(-10). 1 Let g(l) = l*3 - 21l*2 - 19l - 6. Give g(22). 60 Let n(y) = -y*3 - 4y*2 - 7y - 43. Determine n(-5). 17 Let v(c) = -c*3 + 3c*2 + 4c - 2. What is v(5)? -32 Let m(b) = 4b3 - 3b*2 + b + 1. What is m(3)? 85 Let k(m) = -6m + 6. Calculate k(4). -18 Let p(v) = v*3 + 5v*2 + 2v + 2. Give p(-5). -8 Let r(o) = -o*2 - 18. Determine r(-7). -67 Let v(g) = -16g + 13. Give v(1). -3 Let a(q) = q*3 - 12q*2 - 13q - 19. Give a(13). -19 Let i(t) = -7t + 180. Give i(28). -16 Let l(m) = m3 + 17m*2 + 35m - 95. Give l(-14). 3 Let g(q) = -2q3 - 13q*2 - 12q - 22. Determine g(-6). 14 Let w(d) = d*3 - 8d*2 + 6d + 2. What is w(7)? -5 Let b(x) = -x*3 - 9x2 + x + 10. What is b(-9)? 1 Let a(c) = -c3 - 8c2 - 4c - 18. Determine a(-8). 14 Let c(z) = -2z3 + 9z*2 + 18z - 3. Determine c(6). -3 Let n(j) = 2j2 + 5j + 11. Determine n(-9). 128 Let y(p) = p*2 - 31p + 77. What is y(28)? -7 Let s(w) = w*2 - 18w + 27. Calculate s(16). -5 Let a(h) = -h*3 - 10h2 - 8. What is a(-10)? -8 Let z(b) = -b3 - 19b2 + 22b + 46. Calculate z(-20). 6 Let s(t) = -2t - 10. What is s(-19)? 28 Let t(h) = -h3 + 7h*2 + 7h + 16. Calculate t(8). 8 Let p(w) = -5w - 50. Determine p(-9). -5 Let u(w) = -w - 35. What is u(-20)? -15 Let b(d) = 9d - 1. Give b(-2). -19 Let i(k) = 2k2 - 8k - 9. Determine i(-4). 55 Let b(n) = -2n2 - 24n - 1. Determine b(-12). -1 Let f(m) = m*3 + 4m*2 + m - 6. Give f(-3). 0 Let k(a) = a + 5. Determine k(-8). -3 Let h(m) = -10m + 28. What is h(8)? -52 Let q(j) = j*2 + 2j - 87. Give q(8). -7 Let p(g) = g2 - 1. Give p(-2). 3 Let q(o) = -o2 + 93. What is q(-7)? 44 Let h(p) = p - 17. What is h(7)? -10 Let a(d) = d - 60. What is a(21)? -39 Let c(q) = 6q2 + 24q - 7. Determine c(-4). -7 Let k(o) = -o + 13. Determine k(11). 2 Let x(l) = l*3 - 20l*2 + 40l - 74. Determine x(18). -2 Let x(u) = 8u3 + 5u*2 + 6u + 2. Give x(-1). -7 Let g(v) = v + 22. Calculate g(-9). 13 Let g(u) = 2u2 + 62u - 5. Give g(-31). -5 Let l(o) = o*2 - 10o + 16. Calculate l(7). -5 Let k(f) = -8f - 1. Determine k(-2). 15 Let o(l) = -l2 + l + 1. Give o(-1). -1 Let d(u) = u2 + u - 6. Calculate d(0). -6 Let i(u) = u3 + 8u*2 - 10u - 5. Give i(-8). 75 Let m(u) = 24u2 + 2u - 1. Calculate m(1). 25 Let y(s) = -2s2 - 49s + 51. Give y(-25). 26 Let k(w) = -w*3 - 12w*2 - 15w - 4. What is k(-10)? -54 Let m(j) = 2j2 + 3j + 4. Give m(-3). 13 Let x(m) = m*2 - 8m + 10. What is x(6)? -2 Let f(a) = -a + 23. Determine f(17). 6 Let w(r) = -r - 6. Calculate w(7). -13 Let v(r) = -r + 15. Determine v(-10). 25 Let d(f) = -25f - 314. Give d(-12). -14 Let a(h) = -h3 + 14h*2 + 5. Give a(14). 5 Let k(r) = 2r*3 + 2r2 - 1. Calculate k(-1). -1 Let v(t) = -t2 + 2t - 41. What is v(0)? -41 Let k(x) = -x3 - x2 - 3x - 1. What is k(-1)? 2 Let h(w) = w*2 + 9w - 12. Calculate h(-9)	{ "pile_set_name": "DM Mathematics" }
2 - (2 + 5 + (-84 - -76)). -21 What is 21 + -63 + (-7 - -122)? 73 What is -21 + (11 - 6) + (11 - 5) + -7? -17 What is the value of 12 - (-43 + -16 + 36)? 35 What is the value of 53 + -2 + 2 + 1915 + -1910? 58 What is -112 - ((62 - 145) + 63)? -92 What is 3 + (-1 + (-10 - -19) - -3) + -7? 7 What is the value of 55 - -67 - (175 - 159)? 106 What is the value of 32 + (-10 - -15 - -10) + -13 - -9? 43 34 + 0 + -77 + 5 - -79 41 Evaluate -115 - -55 - -19 - -31. -10 Evaluate -1 + (13 - -48) + (7 - (11 - -9)). 47 What is the value of 4 + -5 + (185 - 194)? -10 Evaluate (5 - -70) + 74 + -111. 38 Evaluate 152 + -148 + (-1 - 9) - -9 - -38. 41 168 + -139 - (-4 + 7 + 2 + (0 - -2)) 22 Evaluate -2 - 0 - -11 - (29 + 7) - -4 - 0. -23 Calculate (-1 + -8 + 26 - 9) + -9 + 1 - 0. 0 What is the value of (1 + -3 - -15) + (-13 - 11 - 5) + 75? 59 -28 - 104 - (16 + 1 + -2 + -6 + 3) -144 What is the value of 24 - ((-26 - -20) + 13 - -28)? -11 What is -251 + 258 - (-12 + -2) - 84? -63 What is -302 - -278 - (-17 + (-1 - -6))? -12 Calculate -1 + 0 + -65 + (-3 + -66 + 10 - -69). -56 What is 90 + -83 - (-17 + (-4 - (-2 + 5) - -6))? 25 What is the value of -2 + (1 - 3) + (226 - 171 - 33)? 18 Calculate -27 + (21 - (-13 + 33 - 34)). 8 Calculate (32 - (-11 - -11) - -12) + -5 + 3 + -7. 35 (13 - (19 - 8)) + (6 - -3) - 33 -22 Evaluate 60 + -59 + 110 + -63. 48 What is the value of 22 + -19 + 9 + (4 - 6 - -14)? 24 Evaluate (86 - 0) + (-865 - -820). 41 (56 - (7 + 14)) + (5 - 1) 39 Calculate 34 - (-50 - -25 - -49) - (-3 + -46). 59 (5 - ((-16 - 66) + 35)) + (-15 - 0) 37 Evaluate -13 + 19 + -29 + (6 - (48 + 9 + -9)). -65 What is the value of 16 - ((-35 - -14) + (14 - -7))? 16 Evaluate -4790 + 4846 + (1 - -2). 59 -43 + 64 + (-17 - (71 + 5)) -72 50 + 43 + -36 - 17 40 Evaluate (-11 - 1) + (5 - 32 - -15). -24 Calculate 18 + 45 - 16 - (-37 - -74). 10 Calculate -10 - (-9 - (-1 + (-16 - -3))) - -69. 54 (3 - 60) + 172 - 53 62 What is 302 + -224 + (-6 - 1)? 71 Calculate -2311 + 2315 + -56 + 1. -51 What is the value of -118 + -1 + 247 + 217 + -434? -89 Evaluate (10 - (6 + -7) - -7 - -50) + -13. 55 What is the value of (-56 - -8) + 15 + (-6 - 1)? -40 -147 + 145 - (23 - 2) - 79 -102 (-52 - -14 - -57) + (-1 - 23) -5 What is the value of -96 + 339 + -123 - 102? 18 -61 + (-10 - 3) + -18 + 6 + -17 + 12 -91 Evaluate 0 - -21 - (0 + 15 + (-714 - -688)). 32 Calculate -38 - (-2 + -7 + -3 - (72 + -76)). -30 What is the value of -10 + (0 - 36) + (-728 - -765) + (-116 - 1)? -126 What is the value of (10 - 3 - (-43 + 46)) + -2 + (-11 - -22)? 13 What is 38 + -58 - (34 + 40) - (-1 + 5)? -98 1510 + -1492 + 1 + -4 + 2 + 0 17 What is 11 - -1 - (38 - 34) - (-33 + -19 + -9)? 69 Calculate 108 - 21 - (5 + -7 + 6 + (-18 - -5)). 96 10 - (9 - (-25 - -69)) 45 Calculate -2 + (-1 - -16) + (76 - 42) - (1 - 8). 54 Evaluate -26 + (0 - 3 - -26). -3 What is 35 - 11 - (-39 - -33 - -6)? 24 (16 + -23 - (-8 + -22)) + 39 62 What is the value of 5 + -28 + (0 - -13) + 5? -5 Evaluate 36 + (-11 - 13) + -2 + -21. -11 -18 + (6 + -36 - -12) + 19 + 11 + 0 -6 Calculate -7 - (-12 + 5 + 72 + 0 - (29 + -23)). -66 -5 + 69 + 1 + -34 - (0 + -21) 52 Evaluate 25 + -105 + 61 - 10. -29 What is -2 + (8 - 16) - (1 - (-2 + -4) - -108)? -125 What is the value of (301 - 78 - 85) + (-20 - (-2 + 3))? 117 What is 121 + (-83 - -16) + -36? 18 Evaluate 1 + 2 + -13 + (-38 - (9 - (27 - -9))). -21 1 - 3 - (0 + 9 + -29 + 25 + 10) -17 What is -17 - -6 - ((-30 - -31) + 14)? -26 Calculate (37 - 16) + -21 - (-27 + 31 - (1 - 32)). -35 28 - ((1 - 5 - (-240 + 248)) + 29) 11 Calculate (0 + 0 - 4) + (-46 - -42) + 382 + -320. 54 What is 8 + 5 + (-29 - (4 + -28))? 8 What is -93 + 39 + 39 - (-70 + 4)? 51 What is the value of (-148 - -27) + 51 + 157? 87 What is the value of -24 + 22 + -29 + -20 - -29? -22 (-51 - -94 - 60) + 121 104 What is the value of -78 + (15 - 8) - (-2 - 23)? -46 What is the value of (-2 - 5) + -14 - (51 - 28 - 11)? -33 Calculate -827 - -799 - (10 - 0). -38 Calculate (-94 - (54 + -98)) + 22. -28 Calculate 80 - (93 - 67) - 79. -25 (1 - -28) + (2237 - 2255) 11 Calculate -14 + 2 + -14 + (29 - (-21 - -48)). -24 What is the value of (-8 - -45) + (80 - 106)? 11 What is the value of (-70 - -63 - (0 - -8) - (15 - 24)) + -16? -22 10 + -2 + (2 - (45 + 5 + -4)) -36 Calculate (9 - 14) + 20 + -3 + 17 + -13 + 4. 20 (-26 - (-68 + 28)) + 30 44 Calculate 33 + -15 - 30 - (42 - 25). -29 -33 - -2 - (104 + (-3 - 83)) -49 What is (-46 - 18 - -51) + (-33 - 0)? -46 -5 - (-222 + 208 + (-2 - -9)) 2 58 - (-9 - (148 + -94)) 121 What is 10 + (4 - -17) + -130 + 115? 16 Calculate -7 + 33 + 8 + 14 + -9. 39 What is (9 - 1) + (-646 - -674) - (2 + 12)? 22 What is (-60 + 59 + -31 - 80) + 41? -71 What is 11 + 37 + -21 - (-4 - -16)? 15 What is (-3 - (-34 - -2)) + (0 - 33 - -20)? 16 Calculate 1 + 2 + (-78 + 98 - (-4 + 45) - -5). -13 275 - 273 - (6 - -4) -8 -19 - 16 - (4 + 8 + (-20 - 0)) -27 Evaluate -70 - (-99 + (-48 - -90)). -13 What is -15 + 54 + -40 + 27? 26 Calculate -14 + 63 + -104 + 37. -18 10 + 22 + 17 + (-23 - 12) - 37 -23 What is the value of (1 - 36 - -13 - -80) + -2 + 0 - 3? 53 Calculate -35 - -9 - (-21 + -1 + 6 + 11). -21 108 - (105 + -92 - (-28 + 0)) 67 -62 - (-76 - (-40 - -98)) 72 What is the value of 1 + -8 - (77 + (22 - 38 - (-6 - 3)))? -77 What is the value of 43 + -89 + (-2 - (-2 + 3))? -49 Calculate (0 - 85 - -38) + 61. 14 Evaluate -55 - 22 - (35 + -86). -26 What is -11 - ((12 + -9 - -2) + -17 + 73)? -72 -7 + 8 + (21 - (12 - 1)) 11 What is the value of -14 + (53 - (79 + -18))? -22 Evaluate 2 - (-13 - -9) - (3 + -35). 38 What is (-5 - -6 - 8) + (-33 + 34 - -45)? 39 What is the value of -29 + (-1 + 2 - 11 - (0 - (-22 + 34)))? -27 What is the value of -111 + 100 + 54 - (22 + -2)? 23 Calculate (-1 - (-4 - 0)) + -82 - (-9378 - -9395). -96 What is -94 + -1 + (-19 - ((-6 - 18) + 16)) + 6? -100 Evaluate (15 - (0 + 0 + -2) - 1) + (1172 - 1165). 23 (-5 - -17) + -28 + 9 + -16 -23 Evaluate 25 + (24 - 47) - (4 + (-2 - 47)). 47 Calculate 391 + -327 + -12 + -45. 7 Evaluate (-5 + 2 - 1 - -6) + (20 - 49). -27 What is ((-12 - 7) + 35 - -13) + (4 - (2 - -14))? 17 Calculate ((-34 - -27) + -10 - 114) + -1 + 12 - 0. -120 What is the value of -21 + 51 - (20 + -5 + (3 - 6))? 18 What is (-5 - (0 + 5 - -7) - 26) + 17? -26 Calculate -357 + 345 - (1 + 24). -37 Calculate (20 - -22 - (-1 + -15 + 8)) + (-2 - 10). 38 What is the value of 2 + (-12 - (19 - (21 + -14) - 5))? -17 What is the value of 1 - (15 + -26 - (3 + -8)) - (26 + -24)? 5 What is the value of (-9 - 28 - -2) + (-367 - -369)? -33 What is the value of 10 - ((-3 - -4 - -16) + 83 + -92) - 46? -44 What is -7 + (27 - (14 - -3) - 17)? -14 What is the value of -27 + (355 - 356 - (-2 + -5))? -21 Calculate 3 - (-43 + 41 - 55). 60 Calculate -7 + -9 + 10 + -4 + 14 + 32. 36 What is the value of (96 + -153 - 52) + 147? 38 What is 4 + (10 + -30 + 15 - 19) + -91? -111 (-7 + -2 - (113 + -109)) + 52 39 Calculate -93 + (70 - (57 + -62)). -18 -66 - (-14 - -10 - -37 - (19 - 1)) -81 What is 40 + -2 + -2 + 4 + -1 - (3720 + -3729)? 48 Evaluate -1 + 38 - (-10 + 14) - (-14 + -23 + 27). 43 What is 42 + -70 - (-12 + (9 - 12))? -13 -7 + (80 - 0 - (-3 - (0 - -25) - -27)) 74 What is -1 + (75 - (-2 + 4)) + (-30 - -7)? 49 What is the value of (-41 - -69) + (-12 - 1) + -47? -32 Calculate 35 + 11 - (-28 + 37 + 10). 27 Calculate (19 - -1) + 0 + (-40 - (-14 + (1 - 13))). 6 Evaluate -7 - (-29 + 15 + 4 + 6 + -2). -1 What is the value of 162 + 87 + -160 + -57? 32 -6 + 23 + (4 + -24 - -12) 9 What is the value of 19 - (-14 + 8 + 6 - -28) - -105? 96 What is 20 + -31 + 162 - (-12 - (1 + -36))? 128 (0 - 57) + 2473 + -2461 -45 Calculate -27 - 15 - -24 - 1. -19 What is the value of -33 - (-15 - (-12 + (-33 - -13 - -9)))? -41 What is -2071 + 2086 + -35 + 2 + 0? -18 -20 + 13 + -19 + 6 - (-5 - (1 - -2)) -12 What is the value of -34 + 10 + -1 + -9 + (11 + -3 - 18)? -44 (86 - -13 - 137) + 54 16 -9 + ((-6 - -6) + 0 - -5 - (-61 - 0)) 57 Evaluate -31 + 73 - 16 - 38. -12 2 + (-8 - -2) - (12106 + -12047) -63 Evaluate (-38 - -154 - (31 + -2)) + 5. 92 What is the value of (-37 - -1) + -75 + (22 - -40)? -49 Evaluate 56 - (97 + -2) - 18. -57 What is the value of (-7 - 109) + (-105 - -148)? -73 -14 + -23 + (40 - 16) + 33 20 What is 118 - (115 - 11) - 3? 11 Evaluate -1 + (10 + -20 + (0 - (-22 - -13)) - -88).	{ "pile_set_name": "DM Mathematics" }
4? 1 What is the remainder when 195 is divided by 25? 20 Calculate the remainder when 94 is divided by 26. 16 Calculate the remainder when 91 is divided by 19. 15 What is the remainder when 787 is divided by 390? 7 Calculate the remainder when 3119 is divided by 26. 25 Calculate the remainder when 204 is divided by 19. 14 Calculate the remainder when 796 is divided by 169. 120 Calculate the remainder when 2176 is divided by 1084. 8 Calculate the remainder when 58 is divided by 18. 4 Calculate the remainder when 76 is divided by 24. 4 What is the remainder when 167 is divided by 90? 77 What is the remainder when 905 is divided by 15? 5 Calculate the remainder when 693 is divided by 339. 15 What is the remainder when 2258 is divided by 31? 26 What is the remainder when 1936 is divided by 194? 190 Calculate the remainder when 262 is divided by 33. 31 What is the remainder when 59 is divided by 22? 15 What is the remainder when 1432 is divided by 72? 64 What is the remainder when 1389 is divided by 5? 4 Calculate the remainder when 218 is divided by 8. 2 What is the remainder when 243 is divided by 44? 23 Calculate the remainder when 314 is divided by 99. 17 Calculate the remainder when 977 is divided by 140. 137 What is the remainder when 282 is divided by 63? 30 Calculate the remainder when 1614 is divided by 538. 0 What is the remainder when 472 is divided by 155? 7 What is the remainder when 11 is divided by 6? 5 Calculate the remainder when 12694 is divided by 167. 2 What is the remainder when 59 is divided by 12? 11 Calculate the remainder when 139 is divided by 18. 13 Calculate the remainder when 2067 is divided by 23. 20 What is the remainder when 1955 is divided by 637? 44 Calculate the remainder when 6424 is divided by 6. 4 What is the remainder when 2905 is divided by 242? 1 What is the remainder when 624 is divided by 283? 58 Calculate the remainder when 82 is divided by 76. 6 What is the remainder when 257 is divided by 53? 45 Calculate the remainder when 1001 is divided by 213. 149 Calculate the remainder when 4091 is divided by 22. 21 Calculate the remainder when 58 is divided by 13. 6 What is the remainder when 20 is divided by 8? 4 Calculate the remainder when 394 is divided by 57. 52 What is the remainder when 80 is divided by 71? 9 Calculate the remainder when 504 is divided by 23. 21 What is the remainder when 1869 is divided by 10? 9 Calculate the remainder when 2307 is divided by 21. 18 What is the remainder when 642 is divided by 109? 97 Calculate the remainder when 88 is divided by 27. 7 What is the remainder when 2437 is divided by 106? 105 What is the remainder when 862 is divided by 56? 22 Calculate the remainder when 1719 is divided by 85. 19 What is the remainder when 1145 is divided by 571? 3 Calculate the remainder when 115 is divided by 101. 14 Calculate the remainder when 587 is divided by 68. 43 Calculate the remainder when 6981 is divided by 97. 94 What is the remainder when 108 is divided by 8? 4 Calculate the remainder when 109 is divided by 13. 5 Calculate the remainder when 484 is divided by 321. 163 Calculate the remainder when 1524 is divided by 5. 4 Calculate the remainder when 535 is divided by 145. 100 Calculate the remainder when 16166 is divided by 330. 326 Calculate the remainder when 94 is divided by 8. 6 Calculate the remainder when 1055 is divided by 83. 59 Calculate the remainder when 54 is divided by 15. 9 Calculate the remainder when 1101 is divided by 46. 43 Calculate the remainder when 418 is divided by 42. 40 What is the remainder when 80 is divided by 28? 24 What is the remainder when 353 is divided by 116? 5 What is the remainder when 154 is divided by 83? 71 What is the remainder when 399 is divided by 5? 4 What is the remainder when 637 is divided by 35? 7 Calculate the remainder when 1957 is divided by 70. 67 What is the remainder when 249 is divided by 110? 29 Calculate the remainder when 556 is divided by 79. 3 What is the remainder when 1935 is divided by 34? 31 Calculate the remainder when 204 is divided by 2. 0 What is the remainder when 776 is divided by 29? 22 What is the remainder when 2666 is divided by 665? 6 Calculate the remainder when 104 is divided by 28. 20 What is the remainder when 3969 is divided by 142? 135 Calculate the remainder when 26 is divided by 18. 8 Calculate the remainder when 155 is divided by 56. 43 What is the remainder when 1059 is divided by 10? 9 What is the remainder when 11491 is divided by 34? 33 Calculate the remainder when 429 is divided by 79. 34 What is the remainder when 1018 is divided by 331? 25 What is the remainder when 376 is divided by 161? 54 Calculate the remainder when 161 is divided by 55. 51 Calculate the remainder when 16 is divided by 4. 0 What is the remainder when 54 is divided by 15? 9 What is the remainder when 181 is divided by 14? 13 Calculate the remainder when 1166 is divided by 34. 10 What is the remainder when 1488 is divided by 108? 84 What is the remainder when 164 is divided by 19? 12 What is the remainder when 91 is divided by 21? 7 Calculate the remainder when 3674 is divided by 1223. 5 What is the remainder when 102 is divided by 24? 6 Calculate the remainder when 1935 is divided by 13. 11 What is the remainder when 2989 is divided by 66? 19 What is the remainder when 330 is divided by 54? 6 What is the remainder when 13430 is divided by 11? 10 What is the remainder when 786 is divided by 22? 16 Calculate the remainder when 325 is divided by 22. 17 Calculate the remainder when 769 is divided by 157. 141 What is the remainder when 415 is divided by 119? 58 Calculate the remainder when 469 is divided by 44. 29 Calculate the remainder when 135 is divided by 8. 7 What is the remainder when 30 is divided by 8? 6 What is the remainder when 1627 is divided by 43? 36 What is the remainder when 1324 is divided by 186? 22 What is the remainder when 1797 is divided by 22? 15 What is the remainder when 815 is divided by 812? 3 Calculate the remainder when 2267 is divided by 40. 27 What is the remainder when 1447 is divided by 4? 3 What is the remainder when 448 is divided by 161? 126 What is the remainder when 284 is divided by 19? 18 Calculate the remainder when 866 is divided by 7. 5 What is the remainder when 4011 is divided by 34? 33 What is the remainder when 1897 is divided by 73? 72 What is the remainder when 308 is divided by 32? 20 What is the remainder when 3931 is divided by 1957? 17 What is the remainder when 200 is divided by 55? 35 What is the remainder when 220 is divided by 58? 46 What is the remainder when 758 is divided by 40? 38 Calculate the remainder when 23 is divided by 6. 5 What is the remainder when 316 is divided by 34? 10 Calculate the remainder when 88 is divided by 18. 16 What is the remainder when 4301 is divided by 13? 11 What is the remainder when 383 is divided by 199? 184 Calculate the remainder when 29 is divided by 4. 1 What is the remainder when 2681 is divided by 665? 21 What is the remainder when 46 is divided by 26? 20 What is the remainder when 13255 is divided by 221? 216 What is the remainder when 321 is divided by 36? 33 What is the remainder when 139 is divided by 7? 6 Calculate the remainder when 256 is divided by 66. 58 Calculate the remainder when 86 is divided by 23. 17 What is the remainder when 4286 is divided by 29? 23 What is the remainder when 34 is divided by 20? 14 What is the remainder when 407 is divided by 139? 129 What is the remainder when 24523 is divided by 15? 13 Calculate the remainder when 117 is divided by 61. 56 What is the remainder when 438 is divided by 17? 13 Calculate the remainder when 3383 is divided by 6. 5 What is the remainder when 176 is divided by 59? 58 Calculate the remainder when 187 is divided by 17. 0 What is the remainder when 430 is divided by 36? 34 Calculate the remainder when 428 is divided by 210. 8 Calculate the remainder when 31039 is divided by 320. 319 Calculate the remainder when 192 is divided by 39. 36 What is the remainder when 4327 is divided by 13? 11 What is the remainder when 34 is divided by 12? 10 Calculate the remainder when 131 is divided by 54. 23 What is the remainder when 131 is divided by 53? 25 Calculate the rema	{ "pile_set_name": "DM Mathematics" }
077v + 1. Calculate g(d(r)). -2319858r*2 - 4308r - 2 Let b(i) = 23i2. Suppose -4o + 9 = -o. Let v(h) = -2h2 - 3h + 3. Let r(l) = -4l2 - 5l + 5. Let w(t) = or(t) - 5v(t). Calculate b(w(m)). 92m4 Let u(c) be the first derivative of -5c*3/3 - 106. Let q(z) = 25z. What is u(q(p))? -3125p2 Let r(m) = -37m2. Let q(s) be the third derivative of s4/8 - 190s2. Give r(q(v)). -333v*2 Let r(y) = -52y. Let z(v) = 19v2 + 25. Calculate r(z(f)). -988f2 - 1300 Let c(v) be the third derivative of -v5/30 + v*2. Let r(s) = s + 3. Let m(n) = 3n + 2. Let k(i) = 3m(i) - 2r(i). What is c(k(z))? -98z2 Let m be 25/75 - -3(-2)/20. Let w(r) be the third derivative of 0r4 - 6r*2 + mr*5 + 0r*3 + 0r + 0. Let x(v) = 5v2. Determine w(x(u)). 50u*4 Let x(b) = 13b*2. Let s(d) = -8d - 5d + d. Give x(s(r)). 1872r*2 Let v(s) = 3s. Suppose -3f + 16 + 14 = 3l, -4f + 8 = 0. Let p(d) = ld - 5d + 0d. What is p(v(c))? 9c Let v(n) = -2n + 2003491 + 0n + 0n - 2003486. Let l(o) = 3o2 - 5o*2 + 0o*2. Give v(l(q)). 4q2 + 5 Let t(r) = r2. Let n = 3 + 2. Let k(s) = 1159s2 - 152. Let a(l) = 38l*2 - 5. Let p(i) = nk(i) - 152a(i). Give t(p(o)). 361o*4 Let g(p) = 2p*2 - 72. Let y(n) = 50n*2 + 24. What is g(y(j))? 5000j*4 + 4800j2 + 1080 Let s(i) be the third derivative of -i6/240 + i*4/4 + 2i*2. Let m(b) be the second derivative of s(b). Let o(f) = 4f - f - 3f + f2. Determine m(o(w)). -3w2 Let i(x) be the third derivative of -x5/30 - 12x2 + 5. Let d(j) = 13 - 14j - 13. Give d(i(s)). 28s2 Let u(b) = 0 - 18b2 + 0. Let i(v) be the third derivative of v6/720 - 7v4/6 + 27v*2. Let x(o) be the second derivative of i(o). What is x(u(d))? -18d*2 Let g(i) = -258i*2 + 15. Let u(m) = -37m*2 + 2. Let w be (15 - 12) + (-2 - -1). Let y(p) = wg(p) - 15u(p). Let z(q) = -q2. Calculate y(z(v)). 39v*4 Let f(w) be the first derivative of -5/2w*2 - 1 + 0w. Let p(n) = -2n2. Give f(p(j)). 10j2 Let r(m) be the third derivative of m5/30 + m*2. Let k = -84 + 120. Let i(h) = -kh*2 - 35h*2 + 74h*2. Determine r(i(f)). 18f*4 Let s(k) = 23314227 + k - 23314227. Let z(t) be the second derivative of 1/12t*4 + 0 + 0t*2 + 0t3 - t. What is z(s(q))? q2 Let x(k) = 7k. Let o(h) = -3h*2 + 2h - 968. What is x(o(g))? -21g2 + 14g - 6776 Let r be 0/(-21) - 2(-9)/6. Let p(b) be the first derivative of 0b + 0b2 + 5/3br + 5. Let g(i) = -i2. Give p(g(o)). 5o4 Let g(t) = 8t*2. Let a be -1(-2)/(3(-4)/(-12)). Let u(o) = -7o*2 + 9o*2 + 2o*a. What is u(g(p))? 256p4 Let s(y) = -y2. Let m(c) = -4465c2. Give m(s(a)). -4465a*4 Let x(t) = -t. Let l(z) be the third derivative of -17/60z*5 + 0z*3 + 0z*4 - 19z*2 + 0 + 0z. Determine x(l(b)). 17b2 Let w = 2 + 0. Let y(i) = -2i*2 - wi + 2i. Let o(d) be the third derivative of -d5/60 - 17d*2. Determine o(y(h)). -4h*4 Let v(j) = 58j*2. Let o(x) = -186x*2. Give v(o(z)). 2006568z*4 Let p(y) = 22y + 1203. Let n(m) = -m*2. What is n(p(v))? -484v*2 - 52932v - 1447209 Let n(i) = -112i. Let v(l) = -6l2 + 7. Let d(f) = -f2 + 1. Let h(o) = 14d(o) - 2v(o). Calculate n(h(y)). 224y2 Let w(k) = -5k*2 + 2. Let z(l) = 10l*2 - 4l + 6. Let x(u) = -20u2 + 10u - 15. Let t(g) = -2x(g) - 5z(g). What is t(w(m))? -250m4 + 200m*2 - 40 Let c(s) = 3s*2 + 2. Suppose -54 = -11f + 20f. Let w(t) = 12 + 21t*2 + 16 - 13. Let a(d) = fw(d) + 45c(d). Let y(v) = -v. Give y(a(o)). -9o*2 Let m(w) = 28w2. Let g(l) = -l2 - 142. Give g(m(z)). -784z4 - 142 Let r(b) = 2b*2. Suppose 5t = -n + 2n + 20, -2n = 5t - 5. Let z(y) be the third derivative of 0y + 6y2 + 0 + 0y*t - 7/24y*4. What is z(r(a))? -14a*2 Let i(y) = -2y. Let f(p) = 45466p2. Give i(f(u)). -90932u*2 Let m(h) = -20h2. Let o(t) be the second derivative of t4/2 - 81t. What is o(m(c))? 2400c*4 Let m(b) = -2b*2. Let o(s) = 11s + 20. Let r(l) = -9l - 19. Let j(f) = -2o(f) - 3r(f). Determine j(m(a)). -10a*2 + 17 Let j(i) = 175i - 175i - 6i*2. Let n(s) = -15s*2. Let r(t) = 16t*2. Let u(x) = -6n(x) - 5r(x). What is u(j(l))? 360l*4 Let c(d) = -2d2 + 2. Let t(m) = m2 - m*2 - 4m*2 + 5. Let j(r) = -5c(r) + 2t(r). Let k(g) = 9g. What is j(k(z))? 162z2 Let i(q) = 2q + 33. Let l(w) = -4w - 68. Let b(p) = 5i(p) + 2l(p). Let o(n) = -3n*2. What is b(o(c))? -6c*2 + 29 Let d(v) be the second derivative of 23 + 0v*2 + 0v*3 - v + 11/6v*4. Let j(o) = -o. What is d(j(m))? 22m*2 Let w(l) = 2l - 1175. Let q(k) = -4k2. Calculate w(q(i)). -8i*2 - 1175 Let t(d) be the second derivative of 0d*2 + 0 + 0d*3 + 16d - 7/12d4. Let i(j) = -2j. What is t(i(z))? -28z2 Let v(a) be the third derivative of -5a*4/12 + 9a*2. Let r(f) be the first derivative of -6 + 1/3f*3 + 0f + 0f2. Determine r(v(b)). 100b*2 Let w = -15 + 20. Let t(d) = -d + 9d - d - wd. Let j(o) = 4o2 - o2 + 5o2 - 4o*2. What is j(t(y))? 16y*2 Let n(g) = -3g. Let u(q) = -43q - 2. Let z(p) = 65p + 3. Let c(j) = -7u(j) - 5z(j). Determine n(c(s)). 72s + 3 Let h(l) = 532l. Let x(s) = 3s2 + 5s + 25. Let c(u) = 2u2 + 4u + 20. Let z(q) = -5c(q) + 4x(q). Calculate z(h(o)). 566048o2 Let w(r) = -6r + 4r - 3r. Let t(a) = 2a + 10. Let g(f) = 30f + 140. Let x(v) = -g(v) + 14t(v). Give w(x(c)). 10c Let g(u) = 15u2. Let r(x) = 9 - 7 + 3 - 11x + 3. Let t(w) = 7w - 5. Let i(y) = -5r(y) - 8t(y). What is g(i(b))? 15b*2 Let y(v) = -4v + 0v + 3v. Let o(h) = -3h + 4. Let u be -2 + -5 + 10 - (-2)/2. Let i(s) = -2s + 3. Let w(z) = ui(z) - 3o(z). Give y(w(c)). -c Let x(z) = 14z2. Let p(h) = 10952h*2. What is p(x(j))? 2146592j*4 Let b(x) = -31x. Let g(a) = -231a2 - 3. Calculate b(g(o)). 7161o*2 + 93 Let m = 4 - 4. Let f be (0 + m/(-3))/(-2). Let n(l) = fl + l - l - l. Let x(p) = -2p2. Calculate n(x(i)). 2i*2 Let f(q) = 44 - 14 - 13 + 5 + 2q - 2. Let h(p) = 11p2. Give f(h(x)). 22x2 + 20 Let n(t) = -t. Let k(s) = -s3 + 10s2 - s + 10. Let c be k(10). Let j(m) = c + 3 - 3 + 2m. Determine n(j(o)). -2o Let z(j) = 4j. Let p(q) = 2q2 - 4q + 4. Let k(l) be the first derivative of -9l - 2 - 5/3l*3 + 9/2l*2. Let t(m) = 4k(m) + 9p(m). What is t(z(b))? -32b*2 Let k(f) = 1419418f*2. Let i(o) = -o. Determine k(i(d)). 1419418d*2 Let m(x) = -4x*2. Let q(t) = 461391t. What is q(m(v))? -1845564v2 Let l(o) = -2o + 1. Let p(j) = j*2 + 6j - 3. Let w(q) = -3l(q) - p(q). Let x(u) = 201u. Give w(x(d)). -40401d2 Let t(i) = -23i. Let g(s) = -37399s. What is g(t(j))? 860177j Let w(p) = 2p + 37. Let c(u) = -4u*2 + 5. Let j(v) = -3v*2 + 4. Let x(d) = 4c(d) - 5j(d). Determine x(w(m)). -4m*2 - 148m - 1369 Let j(g) = 2014g + 133. Let f(h) = 76h + 5. Let r(a) = 133f(a) - 5j(a). Let v(s) = 41s + 7s*2 - 41s + 0s2 - 4s*2. Give r(v(b)). 114b*2 Let s(q) = 774q*2. Let z(r) = -133r. Determine s(z(h)). 13691286h2 Let i(k) = 4k. Let s(y) = 591y2 - 2. What is i(s(g))? 2364g*2 - 8 Let m(a) = 6a*2 - 284377. Let p(f) = -2f. Calculate p(m(k)). -12k2 + 568754 Let i(z) = 5z + 1. Let o(c) = 20c + 5. Let b(j) = 5i(j) - o(j). Let m(q) = 101q2 - q. Calculate m(b(k)). 2525k*2 - 5k Let b(c) = 513c. Let l(d) = 140 - 140 + 2d. Calculate b(l(k)). 1026k Let o(z) = 113z + 26. Let g(r) = -52r - 12. Let y(p) = 13g(p) + 6o(p). Let w(a) = -739a. Give w(y(m)). -1478m Let b(r) = -r + 22. Let g(n) = -n - 11. Let p(k) = -b(k) - 2g(k). Let f(t) be the third derivative of t4/6 - t2. Calculate f(p(z)). 12z Let l(f) = -2f*2. Let g = 12 - 6. Let z(m) = g + 1 - 2 - 7m - 17m. Let u(b) = 348b - 72. Let j(p) = -5u(p) - 72z(p). Calculate j(l(h)). 24h2 Let c(u) = -2u. Let j(w) be the first derivative of 0w + 0w*2 - 4/3w*3 - 5. What is c(j(t))? 8t*2 Let q(i) = 18i*2 - 5i. Let b(k) be the second derivative of k*4/12 - 37k. What is q(b(j))? 18j4 - 5j*2 Let x = -8 - 4. Let r be -3(0 + 8/x). Let u(g) = -r + 12g2 + 2 - 4g*2. Let f(w) = -2w*2. What is u(f(q))? 32q4 Let n(h) = -h + 1. Let l(q) = -q2 - 2q + 4. Let u(x) = 2l(x) - 4*n(x). Le	{ "pile_set_name": "DM Mathematics" }
-4 = 10d + 36. Let m(f) = -2f*2 + 4f - 3. Determine db(i) + 11m(i). 2i2 + 3 Let j(f) = 70. Let d(v) = -v + 72. What is -2d(i) + 3j(i)? 2i + 66 Let z(n) = 8n3 - 6n + 3. Let x(d) = d3 - d. Let q(o) = o3 + 3o2 - 2o - 2. Let f be q(1). Suppose 5v - 32 = l, 0 = l + 2 - f. Give vx(a) - z(a). -2a3 - 3 Let a(u) = -u2 - u - 1. Suppose -2i - 5b = 22, 5i + 2b = 3b - 1. Let j(d) be the first derivative of d + 49 + 1/2d2. Give ij(f) - a(f). f*2 Suppose -4f = 3p + p - 96, 0 = 5p. Let x = f - 13. Let d(a) = -13a. Let i(s) = -7s. Let o(q) = q - 21. Let c be o(15). Determine cd(b) + xi(b). b Let z(q) = 5q + 2. Let t(g) = -13g + 30. Let s be t(5). Let u(m) = -85m - 35. What is sz(n) - 2u(n)? -5n Let d(v) = -v + 1. Let u(n) = -7n + 6. Suppose -6 = -i - i. Let p be i + (1 - 7)/(-3). Determine pd(t) - u(t). 2t - 1 Let o(w) = -7w*2. Let f(t) = 17t*2 + 8t - 5. Let q(y) = 26y2 + 13y - 8. Let r(v) = -8f(v) + 5q(v). Calculate -3o(j) + 2r(j). 9j2 + 2j Let r be -2 + (14 - -2) + -6. Let k(n) = 4n3 - n2 - 3n. Let h(q) = 11q3 - 3q*2 - 8q. Calculate rk(c) - 3h(c). -c3 + c2 Let h(q) = 5q3 + 3q. Let s(w) = -9w3 - 6w - 1. Let t be (4/(-12))/((-2)/(-18)). Calculate ts(r) - 5h(r). 2r3 + 3r + 3 Let c(x) = -5x2 - 4x - 8. Let m(q) = -6q2 - q - 5 - 4 - 4q. Suppose 4o + 14 = -5t, 153 - 123 = -4o + 3t. Give om(l) + 7c(l). l*2 + 2l - 2 Let c(o) = 9o2 - 4. Let g(d) = -22d*2 - 56139 + 30d*2 + 56136. Suppose -4x = -x - 12. Calculate xg(n) - 3c(n). 5n2 Let g(v) = -4v*3 + 3v*2 - 19v + 3. Let u(m) = 9m3 - 6m*2 + 39m - 7. Give 7g(k) + 3u(k). -k*3 + 3k*2 - 16k Let t(k) = k*2 - 3k - 9. Let l(n) = -n - 2. Let a(j) = 4l(j) - t(j). Let r(c) = -4c*2 - 7c + 3. Determine 3a(u) - r(u). u2 + 4u Suppose 6h - 11h = -25. Let u(s) = -s + 1. Let i(o) = 12o - 19o + 10o - 6. What is hu(n) + i(n)? -2n - 1 Let k(r) = -16r + 11. Let a(u) = 87u - 8. Let d(x) = -14x + 1. Let m(s) = a(s) + 6d(s). Let i = 7 + -5. Suppose p = ip - 33. Calculate pm(y) + 6k(y). 3y Let n = 88 + -84. Suppose 3d + np + 56 = 0, -2p - 25 = 3p. Let u(x) = 5 + 7 + 6x - 3x2 + 6x. Let t(k) = -k - 1. Calculate dt(l) - u(l). 3l*2 Let d(l) = -3l*2 - 11l + 1. Let z(o) = -2o2 - 7o + 1. What is 5d(q) - 8z(q)? q2 + q - 3 Let b(u) = -u2 - 12u - 1. Let w be b(-9). Let t = -32 + w. Let k(y) be the third derivative of y5/60 - y2. Let m(q) = 7q*2. Calculate tk(d) + m(d). d2 Let r = -187 - -191. Let j(b) = -b2 - 5b - 15. Let t(n) = -n2 - 4n - 14. Determine rj(z) - 5t(z). z*2 + 10 Let w(r) = r. Let s(o) = -4o - 1. Suppose 0 = 3y - 8y - 50. Let c = 4 - y. Let j be c/(-12) - 7/(-42). Give js(h) - 2w(h). 2h + 1 Let s(z) = -3z2. Let r(q) = q2 + q + 2. Let x(i) = 4i2 + 6i + 10. Let w(p) = 5r(p) - x(p). Determine -2s(t) - 4w(t). 2t*2 + 4t Let r be (-12)/(-3)2175/(-100). Let f(b) = 5b + 5. Let d(a) = -24a - 24. Calculate rf(c) - 3d(c). 2c + 2 Let n = 735 - 739. Let o(j) = -2j*3 - 2j*2 - 4j - 2. Let d(c) = -7c3 - 5c*2 - 11c - 5. Give nd(y) + 11o(y). 6y3 - 2y*2 - 2 Let x(c) = -7c*3 + 2c + 2. Let u(p) = 43p3 - 13p - 12. What is -6u(g) - 39x(g)? 15g3 - 6 Suppose n - 9u - 30 = -4u, 10 = -3n - 5u. Suppose 3m + 4 = nm. Let c(i) = -14 + 26i + mi - 5i. Let z(y) = 8y - 5. What is -6c(o) + 17z(o)? -2o - 1 Let a(m) = -m2 + m + 3. Let w(z) = -1 - z2 + z - z. Let n(v) = 211v + 2953. Let l be n(-14). Give la(y) - 2w(y). 3y*2 - y - 1 Let o(y) = 7y2 + 1. Let g(u) = u2 - 2u. What is g(i) + o(i)? 8i*2 - 2i + 1 Let k(x) = 2x3 + x2 - x. Let f(p) = -43p*3 - 3p*2 + 4p. Determine f(q) + 4k(q). -35q3 + q2 Let z(g) = 4g + 7. Let c be 7(4/(-4))/1 + 3. Let q(t) = t + 2. Determine cz(n) + 14q(n). -2n Let g(i) = 5i*3 + 220i - 451i - 6i*2 + 2 + 229i. Let j(k) = k3 - k2 - k + 1. What is -g(c) + 2j(c)? -3c*3 + 4c*2 Suppose -5h - 29 - 6 = 0. Let f(l) = 10l3 + 7l - 7. Let k(m) = 3m3 + 2m - 2. Let j be 1 + -2 + 1 + 2/1. What is hk(v) + jf(v)? -v*3 Let w(d) = 2d + 3. Suppose 0 = t - 6t - 5f - 15, 0 = -3f + 15. Let u = t - -3. Let b(m) = -1. Calculate ub(y) - w(y). -2y + 2 Let g(i) = 195i*2 + 3. Let o(x) = 779x*2 + 13. Determine 9g(j) - 2o(j). 197j2 + 1 Let n(m) = -m2 - m - 3. Let a(l) be the second derivative of -l3/6 - l2/2 + 83l. Calculate -4a(i) + 2n(i). -2i*2 + 2i - 2 Let i(f) = -13f - 3. Let r(q) = -16q - 3. What is -7i(c) + 6r(c)? -5c + 3 Let b(q) be the first derivative of -4q*3/3 + 7q2/2 + 2. Let v(g) = g3 + g*2 - g - 2. Let t be v(-2). Let f(i) = -3i*2 + 6i. Give tb(r) + 5f(r). r*2 + 2r Let a = 2 - 7. Let y(c) = 7c2. Suppose 0 = -2w - l - 11, -1 = 4w - l + 6. Let t(r) = -4r*2. Give at(k) + wy(k). -k2 Let i(g) = g + 1. Let c(a) = 50 - 137 + 43 + 43. Let u = 7 - 4. Calculate ui(m) + 2c(m). 3m + 1 Let x(j) = j*3 + 5j*2 + 5j + 4. Let r = 41 + -32. Let n(u) = -ru3 + 5 + 5u + 10u3 + u + 6u*2. Give -5n(a) + 6x(a). a3 - 1 Let u be 20/(-55) - 28/44. Let l(a) = 5a + 3. Let d(g) = -4g - 2. Let x(q) = -4d(q) - 3l(q). Let v(f) = -2f*3 + 2f - 2. Give uv(h) + 2x(h). 2h3 Let a(q) = q3 - 3q*2 - 1. Let p(i) = -13i*3 + 8i*2 - 4. Give -3a(s) - p(s). 10s3 + s2 + 7 Let d(l) = -10l + 119. Let b(s) = -28s + 357. Determine 4b(y) - 11d(y). -2y + 119 Let b(a) = -a + 3. Let l = -240 + 147. Let n be ((-3)/5)/(6 + l/15). Let c(h) = -3h + 8. Calculate nc(x) - 8b(x). -x Let r(x) = 3x + 22. Let k(p) = -3p - 15. Calculate -5k(n) - 4r(n). 3n - 13 Suppose -2t - 3t + y = -21, -4y + 26 = 2t. Let a(b) = -4b3 - 6b. Let l(o) = 4o3 + 5o. Calculate ta(c) + 6l(c). 4c3 Let m(o) = o - 2. Let y(b) = -5b + 82. What is 4m(h) + y(h)? -h + 74 Let p(v) = -v3 - 5v*2 - 2v - 4. Suppose 527k - 512k = 75. Let o(h) = -3h3 - 11h*2 - 5h - 9. Give kp(n) - 2o(n). n*3 - 3n*2 - 2 Let h(w) = -2w - 7. Let p be h(-6). Let k(m) = -10m - 12. Let o(s) = 17s + 28. Let x(i) = -2i - 4. Let u(g) = -o(g) - 5x(g). Determine pk(j) - 7u(j). -j - 4 Let y(i) = -i. Let n(h) = -2h - 1. Let j be (-4)/22 - (-2)/11. Suppose 18 = -5q - 5r + 3r, -q - r - 6 = j. What is qy(z) + 2n(z)? -2z - 2 Let g(f) = -8f - 7. Let t(m) = 7m + 7. Let z(y) = -5g(y) - 6t(y). Let u(r) be the first derivative of r2/2 + 4r - 4. Give -5u(k) - 3z(k). k + 1 Let r(p) = p3 + p2 - p + 1. Suppose 3s - 16 + 28 = 0. Let k(a) = -4a*3 - 5a*2 + 5a - 5. Determine sk(w) - 20r(w). -4w3 Let x(u) = -13u - 8. Let n be ((-15)/(-12))/(19/(-76)). Let f(k) = 9k + 5. What is nx(g) - 7f(g)? 2g + 5 Let u(x) = 29x2 + 4. Let v(b) = 3b*2 - 1. What is -u(g) - 6v(g)? -47g2 + 2 Let l = 164 + -165. Let n(g) = -4g*2 - 8g + 8. Let h(i) = -i*2 - i + 1. Determine ln(u) + 8h(u). -4u*2 Let h(c) = -45c*2 + 128c*2 - 13c - 54c2 - 13. Let t(n) = -14n*2 + 6n + 6. Calculate 6h(m) + 13t(m). -8m2 Let n(y) = -7y + 10. Let a(h) = -7h + 10. Determine 7a(o) - 6n(o). -7o + 10 Let k(l) = 214l - 3. Let r(f) = 428f - 4. Calculate -5k(x) + 3r(x). 214x + 3 Let g be (-2)/(-3) + 111/9. Let v = g + -14. Let y(p) be the second derivative of p4/12 + p3 + 7p*2/2 - 6p. Let i(h) = -h - 1. Calculate vy(r) - 6i(r). -r*2 - 1 Let u(q) = -32q*3 - 9q*2 + 4q - 2. Let l(g) = 31g3 + 8g*2 - 6g + 3. Give -2l(o) - 3u(o). 34o3 + 11o*2 Let p(y) = 15 - 14 - 3y + 4y. Let g(k) = 7k + 9. Let u(q) = -3q - 4. Let v(c) = 2g(c) + 5u(c). Give -7p(w) - 4v(w). -3w + 1 Let n(j) = -36j + 16. Let v(u) = -21u + 8. Calculate 6n(f) - 13v(f). 57f - 8 Let j(i) = 40i*2 + 32i - 32. Let u(o) = -o*2 - o + 1. Let d(a) = -19a - 82. Let q be d(-6). Give qu(h) + j(h). 8h*2 Let d(v) = -2v*2 - 7v - 5. Let j(s) = -3s2 - 10s - 7. Let c = -272 + 267. Determine cj(t) + 7d(t). t*2 + t Let d(a) = -15a*3 + 10a*2 + 9a - 11. Let p(v) = -2v2 - v + 2. What is d(x) + 5p(x)? -15x3 + 4x - 1 Let y(z) = -6z3 - 5z*2 - 3. Suppose 269j = 271j + 4. Let n(x) = x3 + x2 + 1. What is jy(q) - 10n(q)? 2q*3 - 4 Let n(p) = -p - 18 + 21 + 0p - p**3. Let	{ "pile_set_name": "DM Mathematics" }
0 for t. 12 Solve 51z - 819 = -66z for z. 7 Solve -23q - 80 = -13q for q. -8 Solve 5838 = -749v - 18879 for v. -33 Solve 0 = -484d + 497d - 35 + 113 for d. -6 Solve -268 = -158o + 44o - 20o for o. 2 Solve -547n = 7332 + 4702 for n. -22 Solve -1425 = -258t + 59t - 276t for t. 3 Solve -17a + 38 = -81 for a. 7 Solve -71 - 99 = 36985d - 37019d for d. 5 Solve -149l - 331 = -4950 for l. 31 Solve 79 = -16b + 110 - 159 for b. -8 Solve 15a = 126a + 145a for a. 0 Solve 26i - 13335 + 13699 = 0 for i. -14 Solve -386i - 6015 + 997 = 0 for i. -13 Solve -2493t = -2480t + 130 for t. -10 Solve -43m + 19m + 115m = 182 for m. 2 Solve -766 - 1057 = -121c + 597 for c. 20 Solve 0 = -h + 10h + 53h + 1364 for h. -22 Solve -3l = -89 + 71 for l. 6 Solve -133i - 1305 = 110i + 192i for i. -3 Solve -61a + 207 = 18a + 49 for a. 2 Solve -388x = -995x - 3642 for x. -6 Solve 55o - 272 = 38o for o. 16 Solve 25p - 172 = 3 for p. 7 Solve 108q = -q - 105q + 2140 for q. 10 Solve 30 = 885m - 895m - 0 for m. -3 Solve -5s + 15s + 22 = -s for s. -2 Solve -34q - 125q - 667 + 31 = 0 for q. -4 Solve -4x = 104x - 2376 for x. 22 Solve 47 = -15u + 107 for u. 4 Solve 2k - 387 = 5k - 46k for k. 9 Solve 70n - 420 = 56n for n. 30 Solve -378 + 193 - 480 = -35i for i. 19 Solve -122q + 696 = -64q for q. 12 Solve -363c + 372c = 117 for c. 13 Solve 49m + 70 - 3 = 18 for m. -1 Solve 47086 = -3b + 47056 for b. -10 Solve 8370z = 8395z + 650 for z. -26 Solve 216w - 166 - 914 = 0 for w. 5 Solve 0d + 34d + 10d = 0 for d. 0 Solve 112 = 108w - 92w for w. 7 Solve 0 = 63q - 77q for q. 0 Solve -61n + 27n = 44n - 390 for n. 5 Solve -1055 - 592 = 57q + 4q for q. -27 Solve 136h - 1763 = 685 for h. 18 Solve 90i - 14i + 45i = 1815 for i. 15 Solve -329 + 479 = 25s for s. 6 Solve 125x - 2218 - 1398 = 12x for x. 32 Solve -1088 + 125 = -321u for u. 3 Solve -1307 = 999n + 5973 - 287 for n. -7 Solve 232y + 22 = 243y for y. 2 Solve -155g - 1483 = 532 for g. -13 Solve 361 = -89534i + 89515i for i. -19 Solve -51j + 293 - 167 = -333 for j. 9 Solve -206t = 4464 - 138 for t. -21 Solve 2d - 320 = 42d for d. -8 Solve 237d = 41d - 1165 - 599 for d. -9 Solve -268587a - 208 = -268603a for a. 13 Solve 5s = 71s - 5470 + 6064 for s. -9 Solve -751 = 7p + 2p - 787 for p. 4 Solve 40 = -11b - 17 - 9 for b. -6 Solve -34x + 650 = 16x - 0x for x. 13 Solve -352 = 24c - 44c - 24c for c. 8 Solve -66459h + 66430h = 522 for h. -18 Solve 0 = -11z + 31z for z. 0 Solve -69m - 3168 = -149m - 96m for m. 18 Solve -1366t + 1337t = 232 for t. -8 Solve -53q - 3927 = -4775 for q. 16 Solve 47p - 55p = 78p - 774 for p. 9 Solve 1199 = -337y - 2845 for y. -12 Solve 307 = -105y + 595y - 183 for y. 1 Solve 312b - 21912 = -684b for b. 22 Solve 298j + 7189 = -255j for j. -13 Solve 1078 = 144b - 218 for b. 9 Solve -79g + 404 = -149 for g. 7 Solve -97d + 111d - 70 = 0 for d. 5 Solve -57 - 47 = -223s + 215s for s. 13 Solve 5343t = 5333t - 200 for t. -20 Solve 215x - 198x = 153 for x. 9 Solve 6q - 7q + 240 = 39q for q. 6 Solve 17g - 9070 = -8849 for g. 13 Solve 0 = -0y - 7y - 308 + 357 for y. 7 Solve -39263r + 39229r = -612 for r. 18 Solve -32o + 36 = -41o for o. -4 Solve 418s + 2624 + 1481 + 75 = 0 for s. -10 Solve 49 = 76l - 863 for l. 12 Solve -330 = -6o - 30o - 114 for o. 6 Solve -23d - 103 = -77d - 427 for d. -6 Solve -12q - 6q - 264 = 15q for q. -8 Solve 19a = 16a + 12 - 48 for a. -12 Solve 0 = -44v - 43v - 32v + 357 for v. 3 Solve 331d - 2473 = 506 for d. 9 Solve 0 = 36g - 19g - 21g + 24 for g. 6 Solve 2a - 86 + 174 = 82 for a. -3 Solve 0 = -19j - 25544 + 25392 for j. -8 Solve 0n + 40n = -4n + 484 for n. 11 Solve 198w - 476w + 227w - 1173 = 0 for w. -23 Solve -26796j + 26807j + 374 = 0 for j. -34 Solve 189w - 343w = -294w - 4200 for w. -30 Solve 0 = 25u + 630 - 580 for u. -2 Solve 289u = -905 - 2852 for u. -13 Solve -141g = -3032 + 635 for g. 17 Solve 0 = -196n - 122n + 6678 for n. 21 Solve -697g = -712g - 45 for g. -3 Solve -2n = 51 - 61 for n. 5 Solve -17310v = -17278v + 160 for v. -5 Solve 23y + 11y = -21 - 47 for y. -2 Solve -468 + 1195 = 19c + 480 for c. 13 Solve 189o + 402 = 1992 + 489 for o. 11 Solve -105n - 904 + 1009 = 0 for n. 1 Solve 38 = -216z + 4142 for z. 19 Solve 133p + 60 = -131p + 276p for p. 5 Solve 550 = -87q - 13q + 1650 for q. 11 Solve -549 = -27m - 900 for m. -13 Solve 6000 = 498p + 2p for p. 12 Solve -55 + 747 = 99d + 98 for d. 6 Solve -6w + 3w = 5w + 56 for w. -7 Solve 0 = -6p + 36p + 10p - 360 for p. 9 Solve 0 = -44293l + 44332l - 741 for l. 19 Solve 299f - 290f - 9 = 0 for f. 1 Solve 1881v = 1401v + 10080 for v. 21 Solve 294c = 74c - 6600 for c. -30 Solve -14d - 374 = -417 + 281 for d. -17 Solve 1639y + 1189 = 1680y for y. 29 Solve 15x + 132 - 420 - 147 = 0 for x. 29 Solve 11i - 3 = 31 - 12 for i. 2 Solve 49r = 99r - 11 - 39 for r. 1 Solve -46t = -66t - 220 for t. -11 Solve -119p - 288 - 1496 = -237 for p. -13 Solve 139y - 107y = 64 for y. 2 Solve 0 = 625v - 2099 - 7226 + 1825 for v. 12 Solve -18608b + 18580b - 280 = 0 for b. -10 Solve 306j - 750 = 101j + 80j for j. 6 Solve -13 = 102c + 166 + 433 for c. -6 Solve -2l - 654 - 197 = 35l for l. -23 Solve -455s = -508s - 954 for s. -18 Solve 6g + 32 = -9g - 43 for g. -5 Solve 1386 = -225k - 864 for k. -10 Solve 546 = -1036h + 1127h for h. 6 Solve -14198r - 476 = -14215r for r. 28 Solve 137m + 824 = -592 - 776 for m. -16 Solve -15n + 898 - 763 = 0 for n. 9 Solve 88d + 990 = 155d - 133d for d. -15 Solve 1111 = 143q - 42q for q. 11 Solve 0 = 1066t - 1250t + 3496 for t. 19 Solve 158y + 418 = 15 - 71 for y. -3 Solve 0 = -19r - 49r + 340 for r. 5 Solve 12381 = 119i + 14404 for i. -17 Solve -109q - 5368 = -2534 for q. -26 Solve -118 = -27y + 141 + 11 for y. 10 Solve -104 + 173 = -107x - 787 for x. -8 Solve 0 = -9u - 9u - 16u - 12u for u. 0 Solve 29u + 145 = 8u - 44 for u. -9 Solve -1319b + 12897 = 31363 for b. -14 Solve 869 = -254w + 361 for w. -2 Solve -628 = -9b - 81b + 92 for b. 8 Solve 367v - 810 = 1860 + 5771 for v. 23 Solve -8n = 1474 - 1642 for n. 21 Solve 0 = -345b + 188b - 1727 for b. -11 Solve -269x - 543 = 40 + 224 for x. -3 Solve 140u + 322 + 1188 = 110 for u. -10 Solve -359s + 602s + 517s - 19760 = 0 for s. 26 Solve 79x - 237 = 316x for x. -1 Solve 246 + 145 = 26i - 49i for i. -17 Solve 88a + 250 = 301a + 37a for a. 1 Solve 0 = -31y - 408 + 842 for y. 14 Solve 21i + 20i = 50i + 18 for i. -2 Solve -811 = 166q + 2509 for q. -20 Solve -14g + 197 = 43 for g. 11 Solve -262s + 65s + 4156 + 1163 = 0 for s. 27 Solve 177b + 7 = 44b - 1057 for b. -8 Solve 59q - 197 = -12q + 797 for q. 14 Solve -74g - 354 = -58 for g. -4 Solve 6n - 38 - 24 = -14 for n. 8 Solve -18872 + 18477 = -79z for z. 5 Solve 252v + 372 = 42v - 678 for v. -5 Solve 1082 + 332 = 144f - 458 for f. 13 Solve -17296 = -48z - 17248 for z. 1 Solve 74 = 43s - 30s - 43 for s. 9 Solve -16v + 104v = 24v for v. 0 Solve 1337g = 1363g + 312 for g. -12 Solve 38z + 34z + 69z + 1410 = 0 for z. -10 Solve 0 = 32t - 9503 + 8511 for t. 31 Solve -40m + 180 + 6 = -14 for m. 5 Solve 17075 + 13042 = 708k + 9585 for k. 29 Solve 0 = -1425i + 1067i + 5728 for i. 16 Solve 4718 = -57p + 3008 for p. -30 Solve 15j - j - 40j = 182 for j. -7 Solve -5i + 17 = -0i - 23 for i. 8 Solve 4k + 13k - 122k = 105 for k. -1 Solve -342f + 382f + 320 = 0 for f. -8 Solve -141o = -149o + 24 for o. 3 Solve -154u - 14252 = -663u for u. 28 Solve 6959v - 280 = 13923v - 6950v for v. -20 Solve 21v - 30v = 63v - 648 for v. 9 Solve 71c = 206c - 54c + 1620 for c. -20 Solve -41j + 755 + 674 = 1060 for j. 9 Solve 3904 - 7547 + 3841 = -18d for d. -11 Solve 373 + 654 = 1290d - 263 for d. 1 Solve -15h - 1681 + 1411 = 0 for h. -18 Solve -528i + 331i - 394 = 0 for i. -2 Solve -22379 = 703y + 4140 - 1211 for y. -36 Solve 0 = 78d - 221d - 557d + 7000 for d. 10 Solve 101l - 498 = -94 for l. 4 Solve 10446 - 3246 = -288y for y. -25 Solve 43473 = -109t + 44890 for t. 13 Solve -35t + 201t - 2158 = 0 for t. 13 Solve -737*u + 556 =	{ "pile_set_name": "DM Mathematics" }
composite number? True Is 10582492331 a prime number? True Is 1357740119 composite? True Is 916658291 composite? False Is 38046501907 a prime number? False Is 340543283 a composite number? True Is 5834726389 a composite number? True Is 16899305767 prime? True Is 6923327693 prime? True Is 770758349 prime? True Is 30024478049 a prime number? True Is 9456393263 a prime number? True Is 188968337 a prime number? True Is 8167151 a composite number? False Is 40051085603 a prime number? True Is 10695428867 a prime number? True Is 13463644213 composite? False Is 37763128187 a prime number? False Is 7212770843 a prime number? True Is 2954900867 a prime number? False Is 1221560887 a composite number? False Is 3545692999 prime? False Is 1984326397 prime? True Is 2605627286 a prime number? False Is 152764411 a prime number? True Is 22090401467 prime? True Is 14379808103 a prime number? True Is 1447502921 composite? False Is 1794563119 a composite number? False Is 979775881 composite? True Is 24419353613 composite? True Is 11078373793 a composite number? False Is 4781011259 a prime number? False Is 15834726463 composite? False Is 642332147 a prime number? True Is 56925863 composite? False Is 568385333 prime? True Is 11991400549 composite? False Is 5070355219 composite? True Is 33819907 prime? False Is 1407351133 prime? True Is 1196166373 prime? False Is 1212454519 composite? True Is 11416068221 a prime number? False Is 7899878639 prime? False Is 16708710001 prime? True Is 38872601731 prime? True Is 1014940501 composite? False Is 29233265011 prime? True Is 5256302803 composite? False Is 7980474589 a prime number? False Is 233939438141 a prime number? False Is 723640913 a prime number? True Is 2410119317 a prime number? True Is 12840004841 prime? True Is 245017867 prime? False Is 5922170389 a prime number? False Is 1338527891 a prime number? False Is 130297820153 composite? False Is 815726843 a composite number? False Is 1585293569 a prime number? True Is 3424512562 a prime number? False Is 5193243655 prime? False Is 1799548213 prime? False Is 3788947439 prime? True Is 5919793441 a prime number? True Is 298545319 prime? True Is 398616415 a composite number? True Is 68510305907 prime? True Is 1788076613 a prime number? True Is 53557354833 a composite number? True Is 1005946427 a prime number? True Is 965984167 prime? False Is 53607179 prime? False Is 807982874 composite? True Is 22604789803 composite? False Is 238893989 prime? False Is 34161879431 composite? False Is 42949883 prime? True Is 2542140073 a prime number? False Is 554941609 prime? False Is 205539913 composite? False Is 104099076811 prime? True Is 119335419381 a prime number? False Is 77279368559 a prime number? True Is 155436626 composite? True Is 13484615783 a prime number? True Is 469079909 prime? True Is 5492450239 a composite number? True Is 23816378887 a composite number? True Is 6053512307 a composite number? False Is 24740520589 a composite number? True Is 371469151 composite? False Is 3382147 prime? True Is 266780593 prime? False Is 27510083677 prime? False Is 7611646529 a prime number? False Is 55373765803 a prime number? True Is 7511785067 a prime number? True Is 937927843 a composite number? False Is 36528749851 prime? False Is 1771045699 prime? True Is 196276607 a composite number? False Is 589315157 prime? True Is 10573247 a prime number? False Is 18620921393 a prime number? True Is 57855227 prime? True Is 14388945349 prime? True Is 1148927933 composite? False Is 311169011 a prime number? True Is 4687202743 prime? True Is 16725925571 composite? True Is 876437371 a composite number? True Is 3244437791 a composite number? True Is 2328431693 composite? True Is 300021747271 composite? False Is 7635605363 prime? True Is 1602614581 a prime number? False Is 10501245523 a prime number? True Is 6242394863 composite? True Is 7578310897 prime? True Is 28050518737 composite? False Is 520772053 composite? True Is 14012105559 a prime number? False Is 123553635407 composite? False Is 51227767229 a prime number? True Is 4415978971 prime? False Is 4501551701 a prime number? True Is 211715411 a composite number? True Is 12936033427 a composite number? False Is 7957557401 composite? True Is 96682307965 a composite number? True Is 6494240231 prime? True Is 2872488313 composite? True Is 10179544651 a prime number? False Is 115833394643 a prime number? True Is 3557441281 a composite number? True Is 110520350131 a composite number? True Is 3564743431 prime? False Is 31365127397 a prime number? True Is 668600171 composite? False Is 2898993703 a prime number? False Is 19075603 composite? False Is 23408553283 a composite number? True Is 65269290109 composite? True Is 2991381767 a prime number? False Is 18886279631 composite? True Is 518250181 prime? True Is 3890533813 composite? False Is 2372808793 prime? True Is 336229163 prime? False Is 524489759 composite? False Is 9617295673 a prime number? False Is 975575593 prime? True Is 377292719 prime? True Is 27446633 composite? True Is 257556809 a composite number? True Is 2337864761 a composite number? False Is 664953283 prime? False Is 6039318319 composite? False Is 6903224047 a composite number? False Is 12664161578 prime? False Is 50245244341 a prime number? True Is 203449090613 a prime number? False Is 4435034297 a prime number? True Is 124152209 prime? True Is 1456680521 composite? False Is 2004466033 a prime number? False Is 976728217 composite? True Is 582894239 a composite number? False Is 1272739511 prime? True Is 6838876049 a composite number? False Is 4378074163 a composite number? False Is 5517382174 prime? False Is 160287587 prime? False Is 806527019 prime? False Is 2175227207 a prime number? True Is 2148797759 a composite number? True Is 1627645727 a prime number? True Is 4283915621 prime? False Is 215376838077 a prime number? False Is 11320559807 prime? True Is 33695657647 a composite number? False Is 1398377294 a prime number? False Is 2076664643 a prime number? True Is 2748591893 prime? False Is 17256594981 prime? False Is 15372117673 composite? True Is 13167214721 composite? True Is 631465417 a prime number? False Is 535117967 a prime number? True Is 189176557 a composite number? True Is 122616498569 prime? True Is 41673876529 a prime number? False Is 1914690341 a composite number? False Is 5058443053 prime? False Is 20286457027 a prime number? True Is 2101644401 prime? False Is 26778442487 prime? True Is 35000341391 composite? False Is 1502244949 prime? True Is 9447022183 prime? True Is 338738987 a composite number? False Is 26312344777 a composite number? False Is 298171771 a composite number? False Is 28232407817 a composite number? True Is 235144909 a composite number? False Is 35101437659 a composite number? False Is 21942549439 prime? True Is 6308709151 prime? True Is 2658078377 a composite number? True Is 105902521 prime? True Is 153641129 a composite number? True Is 567866981 a composite number? True Is 130063181 composite? False Is 391182859 a composite number? True Is 557470502 a composite number? True Is 56946289195 composite? True Is 55250444251 composite? True Is 29737664759 a prime number? False Is 16960824983 a prime number? False Is 2346787769 composite? False Is 866267921 prime? False Is 53726162057 a prime number? False Is 1670186191 prime? False Is 8386662857 composite? True Is 980139257 a prime number? True Is 3756754853 a composite number? False Is 90726900037 composite? False Is 9106365865 a composite number? True Is 518528623 a prime number? True Is 1822611187 prime? True Is 9794359567 composite? True Is 5384278541 prime? False Is 1311170261 a prime number? True Is 704862479 a composite number? False Is 6391338539 prime? True Is 332507759 composite? False Is 89213934197 a prime number? False Is 385603541 prime? True Is 225793711261 prime? True Is 1976759459 prime? True Is 12293797603 composite? True Is 32499211847 composite? False Is 121294247 a prime number? False Is 77712487 prime? False Is 9232316059 a composite number? True Is 25789232659 a composite number? True Is 2342005931 composite? False Is 2039549839 a prime number? False Is 771678038 a composite number? True Is 180065705153 prime? False Is 3501992051 a prime	{ "pile_set_name": "DM Mathematics" }
o the nearest integer? 12 What is the fifth root of 527 to the nearest integer? 4 What is the square root of 10720 to the nearest integer? 104 What is 305 to the power of 1/2, to the nearest integer? 17 What is the tenth root of 1060 to the nearest integer? 2 What is 1736 to the power of 1/2, to the nearest integer? 42 What is the cube root of 5756 to the nearest integer? 18 What is the seventh root of 9382 to the nearest integer? 4 What is the third root of 34008 to the nearest integer? 32 What is 21872 to the power of 1/2, to the nearest integer? 148 What is 1306 to the power of 1/9, to the nearest integer? 2 What is the fifth root of 25736 to the nearest integer? 8 What is the cube root of 84 to the nearest integer? 4 What is 2757 to the power of 1/5, to the nearest integer? 5 What is 1619 to the power of 1/2, to the nearest integer? 40 What is the tenth root of 29951 to the nearest integer? 3 What is the ninth root of 2600 to the nearest integer? 2 What is 1426 to the power of 1/3, to the nearest integer? 11 What is the cube root of 207 to the nearest integer? 6 What is the sixth root of 2705 to the nearest integer? 4 What is the third root of 731 to the nearest integer? 9 What is 3155 to the power of 1/7, to the nearest integer? 3 What is 37317 to the power of 1/3, to the nearest integer? 33 What is the third root of 23939 to the nearest integer? 29 What is the tenth root of 36784 to the nearest integer? 3 What is the third root of 21479 to the nearest integer? 28 What is 1003 to the power of 1/2, to the nearest integer? 32 What is 2935 to the power of 1/5, to the nearest integer? 5 What is the fifth root of 15423 to the nearest integer? 7 What is 3151 to the power of 1/9, to the nearest integer? 2 What is 1343 to the power of 1/3, to the nearest integer? 11 What is 962 to the power of 1/2, to the nearest integer? 31 What is the cube root of 26347 to the nearest integer? 30 What is the third root of 3892 to the nearest integer? 16 What is the fifth root of 80802 to the nearest integer? 10 What is the third root of 282 to the nearest integer? 7 What is 18767 to the power of 1/2, to the nearest integer? 137 What is the square root of 10226 to the nearest integer? 101 What is the third root of 5604 to the nearest integer? 18 What is 101465 to the power of 1/3, to the nearest integer? 47 What is 3167 to the power of 1/4, to the nearest integer? 8 What is the square root of 137 to the nearest integer? 12 What is the cube root of 1639 to the nearest integer? 12 What is 57720 to the power of 1/8, to the nearest integer? 4 What is the ninth root of 418 to the nearest integer? 2 What is the fourth root of 86038 to the nearest integer? 17 What is 396 to the power of 1/3, to the nearest integer? 7 What is the cube root of 5878 to the nearest integer? 18 What is 22061 to the power of 1/2, to the nearest integer? 149 What is 6623 to the power of 1/2, to the nearest integer? 81 What is 125952 to the power of 1/10, to the nearest integer? 3 What is 7126 to the power of 1/4, to the nearest integer? 9 What is the cube root of 2697 to the nearest integer? 14 What is the square root of 52312 to the nearest integer? 229 What is 530 to the power of 1/5, to the nearest integer? 4 What is the third root of 6198 to the nearest integer? 18 What is 27455 to the power of 1/8, to the nearest integer? 4 What is 3244 to the power of 1/3, to the nearest integer? 15 What is 3175 to the power of 1/9, to the nearest integer? 2 What is 202 to the power of 1/7, to the nearest integer? 2 What is 543 to the power of 1/2, to the nearest integer? 23 What is 3487 to the power of 1/8, to the nearest integer? 3 What is 41494 to the power of 1/8, to the nearest integer? 4 What is the square root of 65586 to the nearest integer? 256 What is 24897 to the power of 1/4, to the nearest integer? 13 What is the tenth root of 3148 to the nearest integer? 2 What is the sixth root of 76519 to the nearest integer? 7 What is the square root of 624 to the nearest integer? 25 What is 24409 to the power of 1/3, to the nearest integer? 29 What is 599 to the power of 1/7, to the nearest integer? 2 What is the square root of 36744 to the nearest integer? 192 What is 50574 to the power of 1/2, to the nearest integer? 225 What is 82 to the power of 1/2, to the nearest integer? 9 What is the third root of 960 to the nearest integer? 10 What is the cube root of 10996 to the nearest integer? 22 What is 19052 to the power of 1/3, to the nearest integer? 27 What is the fifth root of 4035 to the nearest integer? 5 What is the cube root of 59701 to the nearest integer? 39 What is the third root of 419 to the nearest integer? 7 What is 934 to the power of 1/3, to the nearest integer? 10 What is 350 to the power of 1/9, to the nearest integer? 2 What is 31607 to the power of 1/3, to the nearest integer? 32 What is the third root of 114780 to the nearest integer? 49 What is 12942 to the power of 1/4, to the nearest integer? 11 What is 4461 to the power of 1/3, to the nearest integer? 16 What is 15793 to the power of 1/3, to the nearest integer? 25 What is 14795 to the power of 1/2, to the nearest integer? 122 What is the square root of 932 to the nearest integer? 31 What is the square root of 6111 to the nearest integer? 78 What is the fifth root of 11125 to the nearest integer? 6 What is the cube root of 18398 to the nearest integer? 26 What is 2580 to the power of 1/3, to the nearest integer? 14 What is the square root of 14683 to the nearest integer? 121 What is 688 to the power of 1/5, to the nearest integer? 4 What is 2274 to the power of 1/2, to the nearest integer? 48 What is 1537 to the power of 1/7, to the nearest integer? 3 What is 108095 to the power of 1/2, to the nearest integer? 329 What is 2548 to the power of 1/2, to the nearest integer? 50 What is 7295 to the power of 1/2, to the nearest integer? 85 What is 4092 to the power of 1/3, to the nearest integer? 16 What is the square root of 12489 to the nearest integer? 112 What is the third root of 747 to the nearest integer? 9 What is the fifth root of 225 to the nearest integer? 3 What is 12065 to the power of 1/6, to the nearest integer? 5 What is 1497 to the power of 1/3, to the nearest integer? 11 What is the third root of 104074 to the nearest integer? 47 What is the seventh root of 2620 to the nearest integer? 3 What is the third root of 1701 to the nearest integer? 12 What is the square root of 450 to the nearest integer? 21 What is 18802 to the power of 1/2, to the nearest integer? 137 What is 4234 to the power of 1/2, to the nearest integer? 65 What is the cube root of 881 to the nearest integer? 10 What is the fifth root of 5300 to the nearest integer? 6 What is 2307 to the power of 1/3, to the nearest integer? 13 What is 14288 to the power of 1/2, to the nearest integer? 120 What is the square root of 27564 to the nearest integer? 166 What is 2157 to the power of 1/2, to the nearest integer? 46 What is the cube root of 413 to the nearest integer? 7 What is the ninth root of 476 to the nearest integer? 2 What is the third root of 2341 to the nearest integer? 13 What is 18303 to the power of 1/3, to the nearest integer? 26 What is 17175 to the power of 1/4, to the nearest integer? 11 What is the cube root of 28389 to the nearest integer? 31 What is the fourth root of 4097 to the nearest integer? 8 What is 41962 to the power of 1/9, to the nearest integer? 3 What is the square root of 1131 to the nearest integer? 34 What is the fifth root of 2858 to the nearest integer? 5 What is 2033 to the power of 1/2, to the nearest integer? 45 What is the cube root of 790 to the nearest integer? 9 What is 67 to the power of 1/2, to the nearest integer? 8 What is 57926 to the power of 1/8, to the nearest integer? 4 What is 1024 to the power of 1/6, to the nearest integer? 3 What is the ninth root of 584 to the nearest integer? 2 What is the square root of 469 to the nearest integer? 22 What is the eighth root of 236 to the nearest integer? 2 What is 943 to the power of 1/10, to the nearest integer? 2 What is the tenth root of 1289 to the nearest integer? 2 What is the sixth root of 18169 to the nearest integer? 5 What is the third root of 14630 to	{ "pile_set_name": "DM Mathematics" }
3. Let a be d(z). Calculate x(a). -6 Let d(f) = -21 + 21 + 6f2 - f3 - 3f. Suppose 2c + 3y - 20 = -y, 2y + 20 = 4c. Determine d(c). -18 Let h(y) = -y*3 + 2y - 2. Let z(g) = -g3 + g2 + g - 2. Suppose -7b + 3b + 56 = 0. Let l = 16 - b. Let a(n) = lh(n) - 3z(n). Determine a(3). 5 Let h(j) = 6j3 - 2j + 1. Suppose -34 + 9 = 5t. Let v(m) = -m2 - 6m. Let p be v(t). Let r be p/(-20) + 5/4. What is h(r)? 5 Let o(m) = -m*2 + 5m + 5. Let f(p) = -2p + 11. Let u be f(6). Let w(i) = -8i*3 - 2i*2 + 1. Let v be w(u). What is o(v)? -9 Let f(d) = 3d2 - d2 - 4d2 + 2 - 18 + 99d - 77d. Calculate f(10). 4 Let o be (7 - 1)(-128)/96. Let a(c) = -5c + 10. Give a(o). 50 Let a(k) = k2 + 2k - 2k2 + k3 + k3. Let c be (-2 + 5)/(-3) - (-6 + 3). Give a(c). 16 Let h(w) = 3w - 6. Let d be (-2 - 2)(-25)/20. Suppose -x - 5p + 10 = x, dx - 5p = -45. Let b = 9 + x. Give h(b). 6 Let i(l) = -l - 3. Let w be (3 + -24)(2/(-6))/(-1). Give i(w). 4 Let x(n) = -n3 + n2. Let i be (-60)/540 + (-26)/9 + 1. Give x(i). 12 Let y(r) = r2 + 15r + 20. Suppose 0 = 9v - 7v - 2d + 12, v + 4d + 21 = 0. Give y(v). -34 Let v(z) = -3 - 5z + 262z*2 - 134z*2 - 127z*2. Let u(k) = k + 2. Let n(i) = -2u(i) - v(i). Suppose 0c = 5c - 20. Determine n(c). -5 Let d = 291 + -289. Let a(j) be the second derivative of -1/2j2 - 1/12j*4 + dj + 0 + 2/3j3. Determine a(4). -1 Let o(s) = 2s*2 + 2s + 4. Let d be o(-2). Suppose 3f + 15 = df. Suppose -4c + 4k = -4, -fk + 3 = -2c + 1. Let m(x) = x + 2. What is m(c)? 7 Let w(c) = 2c2 - 16c - 36. Let z be w(10). Let k(q) be the second derivative of q*3/6 - 2q. Determine k(z). 4 Let j(o) be the first derivative of -o*2/2 + 3o + 188. Give j(-2). 5 Let h(o) be the third derivative of -o*5/60 - 7o*4/24 - 5o3/6 + o2. Let v be ((-28)/12)/((-8)/216-9). Calculate h(v). -5 Let q(a) = a3 + a2 - 2a + 1. Suppose 12s - 108 = -0s. Suppose 14 = 4c + 2. Suppose cd = -0 - s. What is q(d)? -11 Suppose 0 = -3r + r + 6. Let i(f) = 5f - 5f2 + 0f*3 + 2f3 - fr. Let m be 34/8 + (-2 - 14/(-8)). Give i(m). 4 Let u(r) = 3r2 - 2r - 2. Let l(c) = -2c. Let x be l(0). Suppose 7s - s - 12 = x. Give u(s). 6 Suppose -2y + 5z - 6 = -0, 0 = -y + z. Let q(j) = 4j - 5 + 2 - 5j*2 + 4j*y. Let n be ((-4)/(-2))/(10/25). What is q(n)? -8 Suppose 2x - 4 = 0, -x - 2 = 4d - 2x. Let f(k) be the third derivative of 5k2 + 0k + d - 1/6k4 + 1/6k3. Calculate f(3). -11 Let n(f) = -f3 - 12f2 + 13f - 2. Suppose -4d - 5c - 62 = 0, 4d - 5c = -9c - 60. Give n(d). -2 Let o(k) = -154k + 79k + 74k + 2. Give o(7). -5 Suppose 0 = 4o - 2y, -2o - 4y + 11 + 9 = 0. Let m(j) = -o + 6 - 5 + 5j. Determine m(-2). -11 Let d(p) = -p - 5. Suppose 4h - 75 = -11h. Determine d(h). -10 Suppose -2w - y - 6 = -1, -8 = 4w + 4y. Suppose 15p = 16p. Let z(d) = 7 + p - 4 + 4d. Calculate z(w). -9 Let a(m) = -m2 - 16 + 3m + 16. Let z(s) = s*3 + 7s*2 - s - 3. Let y be z(-7). Suppose -2c = -4 - y. Determine a(c). -4 Let n be ((-6)/9 - -1) + (-11)/33. Let y(g) = g3 - g2 + 10. Give y(n). 10 Let i be (-3)/(532/106 + -5). Let l = i + 161. Let v(h) = 2h3 - 4h*2 + 2h + 1. What is v(l)? 5 Suppose b + 5f - 21 = 5b, b = 3f - 7. Let k(q) = -q2 - q + 5. Give k(b). -7 Suppose -4v + v = 12. Let t(i) = i*2 - 3i - 47i + 54i. What is t(v)? 0 Let v(k) = 4k2 + 3k. Let g(r) = 7r2 + 8r + 9. Let w(x) = g(x) - v(x). Calculate w(-2). 11 Let m(v) = -v*3 - 2v*2 + 53 - 23 - 32 - 2v. Give m(-1). -1 Let t(g) be the second derivative of g6/120 - g5/12 + g4/8 + g3/6 + 5g2/2 + g. Let x(u) be the first derivative of t(u). What is x(3)? -8 Let u be (-10)/55 - 870/(-66). Let s(t) = -t2 + 15t - 19. What is s(u)? 7 Let t(z) be the second derivative of -1/15z5 + 1/12z*4 + 0 + 1/120z*6 - 2z*2 - z - 1/3z*3. Let m(h) be the first derivative of t(h). Determine m(4). 6 Let p(l) = -10l - 1. Let j(y) = 2y. Let k(g) = 11j(g) + 2p(g). What is k(-2)? -6 Let t(c) = -4 + 2 + 1 - 7 + 5 + c. What is t(12)? 9 Let n(g) = -g + 11. Let x(y) = y - 12. Let u(p) = 3n(p) + 2x(p). Suppose 0 = -8l + 6l. Suppose l = -4z + h - 1 + 3, -2z - 3h - 6 = 0. Give u(z). 9 Let i(a) be the third derivative of -1/20a5 - 16a*2 + 0a + 0 + 1/24a4 - 1/3a*3 + 1/60a*6. Determine i(2). 4 Let u(f) = 7f*2 + 5f + 1. Let j(o) = o*2 - 1. Let k(s) = -6j(s) + u(s). Let z = -10 - -5. Calculate k(z). 7 Let i(s) be the third derivative of -1/6s4 + 0 - 5/6s*3 + 0s + 27s2. What is i(-6)? 19 Let w(b) = -b + 7. Suppose 0u = 7u - 56. Suppose 30 = -3z + uz. Give w(z). 1 Let b be 28/7020/(-8). Let j(i) = -8i2 + 2. Calculate j(b). -6 Let x(t) = -18t + 67t - 24t - 17t + 5 - 12t. Calculate x(-6). 29 Let a(n) = 5n - 16. Let m(u) = 14u - 48. Let q(b) = -11a(b) + 4m(b). Suppose 5s + 6g - 32 = 4g, 5s = 4g + 56. Calculate q(s). -8 Let u(l) be the first derivative of l4/4 - 5l*3/3 + 3l*2/2 + 3l + 209. Give u(4). -1 Let l(a) = a*2 - 2a + 3. Suppose 0 = -9s + 7s + 16. Let h be (s/(-36))/(2/(-18)). Give l(h). 3 Let c(v) = v*2 + 6v + 1. Let j be -3 - -1 - (-2)/((-8)/(-108)). Let s = 20 - j. Give c(s). -4 Let k(w) = w*3 - w - 6 - 7w + 2w - 1 + 4w*2. Let h(b) = 2b*2 - 2b - 45. Let r be h(-4). What is k(r)? -2 Let i(s) be the third derivative of -1/60s5 + 1/3s*4 + 0s*3 + 0 - 7s*2 + 0s. What is i(9)? -9 Let x(o) be the first derivative of -o3/3 + o2/2 + 23. Determine x(-3). -12 Let n(l) = -5l3 + l2 + 2l + 1. Let p be n(-1). Suppose -pa + 3 = -5q + 8, -q - a + 7 = 0. Let o(c) = q + 2c2 - 2 + 0 - 4c + 2c2. What is o(2)? 10 Let j(y) = -2y*3 + 2y + 1. Let m be -25(-8)/40. Calculate j(m). -11 Let k(g) = -g*2 + 7g - 15. Suppose 7o - 2 = -2v + 11o, 5o = -v + 15. Calculate k(v). -5 Let y = 14 - 10. Let z(v) = -11 + 5v - 7 - yv. Determine z(0). -18 Suppose -j = 5c + 16, -45j - 4c + 16 = -49j. Let l(x) = -3x + 18. Calculate l(j). 36 Let a(h) = 5 - 13h - 17h2 - 6 + 13h. Calculate a(1). -18 Let x(r) = r*2 + 15r - 1. Let s(m) = 2m2 + 29m - 3. Let w(b) = -4s(b) + 7x(b). What is w(-9)? 23 Let i(a) = a*3 - 7a*2 + 4a + 7. Suppose -968 = 4m - 364. Let f = m - -247. Let x be f/15 - 2/5. Give i(x). -5 Suppose 9w + 213 = 132. Let p(k) = k + 1. Give p(w). -8 Let x(a) = -3a2 - 3a + 11. Let i = -2 + -2. Let h(w) = w*2 + w - 4. Let y(u) = ix(u) - 11h(u). Let m = -6 + 4. Calculate y(m). 2 Suppose 2s = -2a + 16, 0 = -3s - s - 2a + 26. Let i(y) = sy*2 - 6y + 4 + 4y + 3y + y*3 - 2y*2. What is i(-3)? 1 Let n(q) be the second derivative of -3q3/2 + q2/2 - 124q. Determine n(1). -8 Let z = 53 + -42. Suppose 0 = 3g + 4 + z. Let i(b) = 6b2 - 11b + 14. Let x(u) = -5u2 + 10u - 13. Let s(n) = -6i(n) - 7x(n). Calculate s(g). 2 Let l be (3/(-3))/((-176)/60 + 3). Let v(x) = x*2 + 16x + 14. Calculate v(l). -1 Let s(b) = 9b2 + 39. Let u(m) = -4m*2 - 19. Suppose 5d - 29 = -2k, 3d + 3k - 8 = 4. Let x(z) = du(z) + 3s(z). What is x(0)? -16 Let d(b) = -4b*3 + 10b*2 - 5b - 1. Let n(k) = 3k3 - 9k*2 + 5k + 1. Let r(g) = -4d(g) - 5n(g). Give r(-6). -7 Suppose -t = -2 - 0. Let l be ((24/(-15))/4)/((-4)/20). Let f(o) = -4 + 2o - lo - o*2 + to + 0o2. Determine f(3). -7 Let v(u) be the third derivative of -u5/30 - 5u4/24 - u3/3 + 2u2. Let c be v(-2). Let o(y) = c + 8 + 5y + 3y2 - 6. What is o(-3)? 14 Let n(w) = -122 + w2 + 44 + 44 + 37 + w. Calculate n(-3). 9 Let g(v) = 2v*2 - 4v*3 - 70v - 82v + 154v. Give g(2). -20 Let v = 8 - 6. Let d(p) = 771p2 + 2p - p*3 - 3 - 1543p*2 + 770p*2. What is d(v)? -15 Let y(t) = -18t + 5. Let x(g) = -63g + 18. Let f(s) = -5x(s) + 18y(s). Calculate f(-1). 9 Let y(v) = -v2 + 2v + 4. Suppose 0t - 36 = -12t. Suppose w + 5z = 28, -w - 6 = 2w - tz. What is y(w)? 1 Let r(j) be the third derivative of 11j*4/24 - 2j*3/3 + 37j*2 - 1. Give r(6). 62 Let y(k) = 15k2 - 4 + k3 + 5793k - 2962k - 2907k. Determine y(-19). -4 Let h be (-2)/(-8) - 8/32. Let w(q) = -q3 + h + 1 + 0q*3. Let t be 2/8-4 - (2 + -4). What is w(t)? 0 Let y(u) = -2*u - 7. Let a be y(-5). Let t(n) be the first derivati	{ "pile_set_name": "DM Mathematics" }
for f. 4 Solve -2q = 3j + 28, 3q + 116j = 112j - 39 for q. -5 Solve 5x + 7r - 10 = x, 5x - 3 = -4r for x. -1 Solve w = 5p - 10, -265 = 2w - 5p - 250 for w. -5 Solve 2x - 25 = 5c, -35c = x - 36c - 8 for x. 5 Solve -c + 4t + 2 = 0, -c + 3c - 2t - 4 = 0 for c. 2 Solve -4l + 2 = w, -4w + 16185l - 16183l + 8 = 0 for w. 2 Solve 2c - 44 = -20u, 231u - 4c = 233u - 12 for u. 2 Solve -x + 9 = 0, -32x + 17x + 17x - 12 = 3d for d. 2 Solve s = 5c - 10, 7796s - 7797s - 9 = -4c for c. 1 Solve 3t = 3p + 988 - 931, -p - 3t + 37 = 0 for p. -5 Solve -2g = 5c + 18, c + 816 = -2g + 814 for c. -4 Solve 3k = -2t - 40, 5k + 19 + 57 = -t for k. -16 Solve -4c - 115 = -5l - 92, 6c + 38 = 4l for c. -7 Solve 0 = 3x - 2v - 5, -10v = 4x - 9v - 14 for x. 3 Solve -2q = 3v, -1349v = -1354v + 2q - 32 for v. -4 Solve 20 = -5t, -5f - 23t = -27t + 9 for f. -5 Solve -8 = 599a - 601a + 3p, 16 = 24a + 4p for a. 1 Solve 0 = -2b + 10, -2c + 56b = 54b + 12 for c. -1 Solve 5a = 3d - 14, -3302a = 2d - 3305a - 9 for d. 3 Solve -4h - 5x + 3225 - 3256 = 0, 0 = -h - 23x - 73 for h. -4 Solve -4m = -5l + 3, -217l = -218l - 2m - 5 for l. -1 Solve -t + d = -4, -6t - 24 + 45 = -3d for t. 3 Solve 0 = 5j - 3y - 24, 5j - 7y - 754 = -718 for j. 3 Solve -3y + 36 = 4t, t + 11123y + 10 = 11127y for t. 6 Solve 80 = -2x + 4z + 22, 1431 - 1479 = -3z for x. 3 Solve 17 = l - 4t, 349l + 20 = 349l - 4t for l. -3 Solve -4j - 5q - 26 + 18 = 0, j - 2q = -2 for j. -2 Solve -39w - 5p = -37w - 2, w - 1 = 3p for w. 1 Solve -2b + 87 = 11o + 67, 4b = 5o - 14 for b. -1 Solve 4k - 785 = -4w - 809, 6k - 4w + 76 = 0 for k. -10 Solve 15y = 13y + 5m + 28, 0 = -3y - 2m + 23 for y. 9 Solve -2o = -5n + 24, 2n - 129 = 5o - 111 for o. -2 Solve 1 = -j + o + 2, 4j + 8o = -20 for j. -1 Solve 5y - 5z + 25 = 0, -30y + 3z = -26y + 18 for y. -3 Solve q - 11 = 2z, 3q - 5z = -116 + 146 for q. 5 Solve -5r = 2d + 34, 29r = 28r + 2d - 2 for r. -6 Solve -3s = 18p - 12p - 75, 2p - 28 = -4s for s. 1 Solve 2b = 8n, 463 - 447 = 4b for n. 1 Solve 2j = b - 3, -2j = 127b - 129b + 6 for b. 3 Solve 5s - 3l = -16, 58 - 42 = -2s - 2l for s. -5 Solve 0 = 2w - 5n + 3, 264w - n - 5 = 265w for w. -4 Solve -3x = -3s - 27, -3355x + 3359x = -3s + 22 for s. -2 Solve 0 = -2i - 2r + 2, 0 = -8i + 6i + 2r - 18 for i. -4 Solve -3153u = -6p - 3157u + 12, 4p = 5u - 15 for p. 0 Solve -4f = -2w - 10, 70w - 80w + 3f + 1 = 0 for w. 1 Solve 2i + 61818 = 4v + 61868, 0 = 11v - 5i + 128 for v. -3 Solve p - 4r + 20 = 0, 5p = 8r - 10r + 10 for p. 0 Solve 5 = 4b - 5h, 270b = 272b + 4h - 22 for b. 5 Solve -48x + 46x + 2p = -15 + 3, -2p = 20 for x. -4 Solve -3u = -4l - 19, 77 = 16u - 4l - 7 for u. 5 Solve -64h = -r - 67h, -4r = 2h for r. 0 Solve 34w - 36w - 67 = -23f, -4w + 10 = 2f for w. 1 Solve 2t - 7k = -70, 9t + 30 = 8t + 3k for t. 0 Solve -2s + 1 = w, -149 + 130 = 5w + 4s for w. -7 Solve 5r = -4l - 10, 34r - 10 = 39r for l. 0 Solve 57 = -4n - 15i + 18i, -3n - 29 = -5i for n. -18 Solve 0 = -p + 5h + 14, 2p - 12h - 50h = 184 for p. -1 Solve 1 = -n + a, a = 2n + 52 - 48 for n. -3 Solve 0 = 2m + 3l + 20, 6l = -2m - 26 - 6 for m. -4 Solve -2i = -2l + 18, 0 = -3494i + 3495i + 2l - 9 for i. -3 Solve 70g - 58g + 63 = -3l, 17 = -5l + 2g for l. -5 Solve -3r - 6l + 3l = 6, -5l = -5r - 30 for r. -4 Solve 4a + 1776h + 39 = 1771h, 3a + 4h + 30 = 0 for a. -6 Solve -c + 4n + 73 = 0, -4c + 485 = 4n + 553 for c. 1 Solve 3g = 5g - t - 4, -38g + 140 = -3t for g. 4 Solve 3y + r = 2r + 24, 4y + 4r = 16 for y. 7 Solve 4w + 1097 = 3y + 1091, -3y + 21 = w for y. 6 Solve -12 = -y + 15r, 204y = 200y + r - 11 for y. -3 Solve 10n + 3c + 10 - 65 = 0, 5n - c = 15 for n. 4 Solve -3r + 241w - 244w = -42, -115 = -5r + 4w for r. 19 Solve 5y - 5z = 0, 0 = 3y + 172z - 170z + 10 for y. -2 Solve 4g = -2d - 8, -37g - 3d = -40g + 30 for g. 2 Solve -3q + 14u + 26 = 18u, 3q + u - 11 = 0 for q. 2 Solve -4j + 50 = 6b, 34 = 219j - 222j + 2b for j. -4 Solve s - 24z = -23z - 12, -3s = -5z + 42 for s. -9 Solve 25i - 21i - c = 12, 2c - 8 = 0 for i. 4 Solve -44 = -4n - 4l, n - 9993l = -9998l + 75 for n. -5 Solve -21j + 7a = -20j + 5, -3j + 4a + 2 = 0 for j. 2 Solve 2g - 11 = -9b, 6g - 6 = 5g - 5b for g. 1 Solve -41 = 5q + 2m, -9q = -5q - 2m + 22 for q. -7 Solve 0 = -4m + 4a + 36, m - 235a + 46 = -245a for m. 4 Solve y + 11 - 36 = -5d, 5 = d - 3y for d. 5 Solve 2b - 8 = 0, 5c - 3b + 0b + 9 = -c - 9 for c. -1 Solve -5r = -656s + 659s - 16, 3r + 4s = 25 for r. -1 Solve 20s - 27 = m + 18s, 0 = -2m + 5s - 65 for m. -5 Solve 50m = 2c + 49m, -4m = 4c - 60 for c. 5 Solve -k + 134y - 133y = 0, -5y = -3k + 8 for k. -4 Solve -2q - 3r = 23, 77q - 74q = 2r + 24 for q. 2 Solve 89 = a - 4r + 79, -2a - r + 2 = 0 for a. 2 Solve 163o = 168o + 4x + 15, 3x = -4o - 13 for o. -7 Solve -428d = 4x - 423d + 45, 0 = -5x + 3d - 10 for x. -5 Solve 4h = -2o + 157 - 137, 2o - 5h = 20 for o. 10 Solve 4l + 34 = -622j + 633j, 5l + 23 = 4j for j. 2 Solve 66r = 2z + 62r - 0 - 28, -z + 3r = -18 for z. 6 Solve 3u + 2x = -16, -5x + 0 = 3u + 22 for u. -4 Solve -3n = 4d + 5, 178n = 4d + 173n + 13 for d. -2 Solve 0 = 2s + 3w - 17, -20s + 17s - 2w = -23 for s. 7 Solve -139d + 144d + 4c - 6 = 0, -4d + 9 = -c for d. 2 Solve -2a = p + 9, -2p = -20a + 17a + 4 for a. -2 Solve 0g + 5g + 46 = 8x, -2g = x + 10 for g. -6 Solve -19r = -2u - 8r - 14r - 24, -15r + 60 = 0 for u. -18 Solve i = 7x - 9, -699x + 703x - 2 = -i for i. -2 Solve -28 = 2v + 71m - 75m, 3v + 32 = 4m for v. -4 Solve 1212d = 3w + 1213d, -5d = -5w + 20 for w. 1 Solve -3t + 33t + h + 29 = 0, -4h = -4 for t. -1 Solve -10q - 5y - 30 = 0, -2y + 1 = -0y - 3 for q. -4 Solve 12v + 27 = 13v - 4a, 84 = 2v - 18a for v. 15 Solve -5t + 7t + 170 = 43n, 5t + 5n - 25 = 0 for t. 1 Solve t + 606j - 602j = -3, 5j = 3t + 9 for t. -3 Solve -5v + a = 24, 5v + 269a + 21 = 273a for v. -5 Solve 245266g + 70 = -2h + 245260g, 5h + 4g + 54 = 0 for h. -2 Solve 3q = -6, -405a + 410a + 5q + 30 = 0 for a. -4 Solve 3r - a = 23, -4r + 7r = -2a + 35 for r. 9 Solve -20 = 5a - 40, 15 = -z - 4099a + 4102a for z. -3 Solve -3v = 4y + 59 - 29, 3v - 4y = -6 for v. -6 Solve -n = -g + 1, 2n - 7g - 88 = -23g for n. 4 Solve 2i = 2d + 152 - 154, i - 5d = 11 for i. -4 Solve -4u + 4 = 5o, -2o - 4 = -404u + 400u for u. 1 Solve -1449x - 67 = 7d - 1447x, -2d + 3x = 12 for d. -9 Solve -4d - 5y + 791 - 804 = 0, -5y = 3d + 16 for d. 3 Solve 2y + 9 = -3c, -15c + y = -12c for c. -1 Solve 3h + 3r - 604 = -592, 4 = h - r for h. 4 Solve 5d = -o - 9, -3o + 64d = 69d - 13 for o. 11 Solve -102q = -95q + 2b - 20, 4q + 2b - 8 = 0 for q. 4 Solve 5u + 7s = -1, 0 = u + 2s - 1001 + 1000 for u. -3 Solve 4v + 5u - 25 = 0, 335v - 333v + 5 = u for v. 0 Solve -4u + 5910q = 5908q + 34, -2q + 4 = -3u - 29 for u. -1 Solve -4h + 3d = 3, 0 = -7h - 2d - 7106 + 7137 for h. 3 Solve -5d - 5l + 25 = -0l, -33566d - 3l - 27 = -33569d for d. 7 Solve 1783b - 1784b = -3n + 12, 5b + 98 = -4n for n. -2 Solve -4n - 1310 + 1416 = 2b, 4n - 2b = 94 for n. 25 Solve p = 5f - 15, -f + 3 = -33p + 38p for p. 0 Solve 4c - 5w - 21 = 0, -3c - 523w + 518w = -7 for c. 4 Solve -948 = -5s + 3f - 992, 4s + 2f + 22 = 0 for s. -7 Solve -3m + 3n + 12 = 0, -13m = -8m + n - 8 for m. 2 Solve -4r = 3b - 9, 0r + 47b - 42b - 35 = -10r for r. 6 Solve 7q + 95i - 47 = 98i, q + 3i - 17 = 0 for q. 8 Solve 574o + 26 = -4q + 571o, -5q + 8o - 9 = 0 for q. -5 Solve 15 = -59z + 61z - 5k, k - 20 = 5z for z. -5 Solve -3p + 8p = 3c + 95, 5p - 1174 + 1169 = 0 for c. -30 Solve 3j + o = -15, 2j - 7 = 2o - 9 for j. -4 Solve -2c = -37w + 35w + 10, -3c + 6w - 21 = 0 for c. -3 Solve -3i + 26w = 27w - 13, 0 = 4i + 5w - 10 for i. 5 Solve -2s = 2d + 2, 17s = -0d - 2d - 92 for d. 5 Solve -a - 2 = -b, -1411b + 2a = -1415b - 16 for b. -2 Solve -4*k - 442 =	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.