Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
6. Let g = 731/88 - z. Calculate the common denominator of 59/3 and g. 24 Let d = 278 - 268. Calculate the least common multiple of d and (4/5)/((-4)/(-10)). 10 Suppose n = -2y + 7, -3y = -4n - 0y + 17. Calculate the least common multiple of n and 8. 40 Let o be 404229/(-36) - (-2)/(-4). Let q = o - -11238. Let j = -303/148 - 9/592. What is the common denominator of q and j? 48 Let i = -1831/3 - -601. Calculate the common denominator of i and 73/33. 33 Let v = -3/88 - -961/440. Let s = -764 - -3021/4. Calculate the common denominator of s and v. 20 Calculate the common denominator of 1/30 and 232/78 - (-9 - (-91)/7). 390 Suppose -4f = -1 - 23. Suppose 6r - 40 = 4r. What is the smallest common multiple of r and f? 60 Let q(w) = -w - 3. Let b(t) = -32t*3 - t + 3. Let d be b(3). Let j = d + 6923/8. Find the common denominator of j and q(6). 8 Suppose 21j - 28 = 14j. Calculate the least common multiple of j and 15. 60 Let i be (-2)/(-4)(-12)/(-3). Suppose -3f = p - 11, 4f - 5 - 13 = -ip. What is the common denominator of 53/7 and 2/f + (-57)/12? 28 Let b = 12 - 2. Let s(t) = -t3 + 9t*2 + 10t + 4. What is the smallest common multiple of 6 and s(b)? 12 Suppose 2n - p = 3n - 21, 0 = -4n - 5p + 85. Suppose -4i = -n - 24. What is the smallest common multiple of i and 5? 55 Calculate the least common multiple of 33 and (18/(-4) + 0)/(2/(-12)). 297 Let c = -2866/45 - -299/5. Find the common denominator of ((-1)/1)/(9/(-177)) and c. 9 Let l = -8375/3546 - 16/591. Calculate the common denominator of 25/72 and l. 72 Let f be (7/(-14))/(23/(-4)). Let c = 290/161 - f. Calculate the common denominator of -32/9 and c. 63 Let w(p) = -p3 + 5p*2 + 7p + 3. Calculate the least common multiple of 3 and w(6). 9 Let a = -341/232 - 48/29. Suppose 4z = 12, -z - 4z + 171 = 4y. Find the common denominator of a and y + 3 + 2/(-2). 8 Let q = -23 + 37. Calculate the least common multiple of q and 4. 28 Calculate the common denominator of -139/6 and ((-1)/(-5))/(18/342). 30 Let q(v) = -v2 - 17v + 12. Calculate the lowest common multiple of q(-17) and 14. 84 Let g = 572 + -5713/10. Find the common denominator of g and -39. 10 Let t(h) = -h + 12. Let c(i) = -8i - 1. Let v be c(-1). What is the least common multiple of t(v) and 11? 55 Let n be (-695)/(-4)8/6. Let f = n - 10973/48. Calculate the common denominator of (-2)/(1 + 110/(-102)) and f. 16 Let y(a) = -a2 + a - 1. Let j(x) = x3 - 6x2 - 8x + 10. Let d be j(7). Let p be y(d). Calculate the smallest common multiple of 2/7 - 26/p and 6. 12 Calculate the common denominator of (404/(-50))/(16/(-20)) and 81/4. 20 Suppose 2y + 4i - 10 = 0, 5y - 6 - 11 = -2i. Suppose 3c + 141 = yk - k, -3k + 217 = c. Calculate the common denominator of -111/22 and 2/k(2 + -120). 198 Let j(a) = a*2 - 8a + 23. Calculate the lowest common multiple of 18 and j(9). 288 Let a = 13/70 - 1601/140. Calculate the common denominator of a and ((-1)/(-2))/((-5)/69). 20 Let y = 5 + -2. Suppose 12 = yf, -m - f + 2 = -5. Calculate the common denominator of m1/(-14) + -1 and -83/20. 140 Let i be 1(-2 - -2)1. Suppose i = 3r + 4m - 64, 0m = m + 2. Suppose 4b = -0 + r. What is the lowest common multiple of 10 and b? 30 Suppose 0j + 15 = 5j, -2g - 5j = -43. Calculate the lowest common multiple of g and (-16)/(-10) - (-8)/20. 14 Let v be 1/2 - 42/(-4). Let l = 21 - v. Calculate the lowest common multiple of l and 14. 70 Suppose 4d = -17 + 33. Calculate the smallest common multiple of 6 and d. 12 Suppose 5d + 4p - 8 = 0, -3d + 2 = 4p - 6. Suppose 4n - 12 + 0 = d. What is the smallest common multiple of n and 10? 30 Find the common denominator of 145/12 and ((-14)/360)/(56/60). 180 Suppose 4g + 402 = 2a, -4a + 3a = -g - 101. Let q = -497/5 - g. Calculate the common denominator of q and 53/5. 5 Suppose 0 = -5u + u + 584. Calculate the common denominator of ((-66)/(-8))/((-18)/20) and u/(-24)12/16. 48 Let y = 1 + -2. Let p(s) be the third derivative of -5s4/12 + s3/6 + 5s2. What is the lowest common multiple of 4 and p(y)? 44 Let h be -22(-1)/2. Let o = 1521/10 - 152. Find the common denominator of o and h/(-24)(-189)/(-5). 20 Let n(h) = -7h + 2. Let i be n(-3). Let b = 61/37 - 2911/666. What is the common denominator of i/18 + (-1)/(-3) and b? 18 Suppose 5g - 55 - 15 = 0. Calculate the lowest common multiple of 8 and g. 56 Suppose 11 = -4u + 27. What is the lowest common multiple of 4 and u? 4 Let z = -14 - -10. Let q(x) be the first derivative of -x3/3 - 2x*2 + 4x + 1. Calculate the least common multiple of q(z) and 7. 28 Let h(l) = -l*2 + 33l - 252. Suppose 5z = 4 + 6. Calculate the least common multiple of z and h(16). 20 Let l = -2509/72 + 335/9. Calculate the common denominator of l and 9/16. 16 Let w = -33 - -25. Let m = w + 19. Suppose 21 = 5y - 14. What is the smallest common multiple of m and y? 77 Suppose 17o - 14o - 117 = 0. Calculate the lowest common multiple of o and 12. 156 Let o(x) = -720x + 1. Let u be o(-1). Suppose u = -2v + 223. What is the common denominator of 83/6 and 1 - (v/36 - 1)? 12 Let h = -2910/13 - -30257/130. Calculate the common denominator of -85/4 and h. 20 Let s = 1/191 + -403/4011. What is the common denominator of -1/30 and s? 210 Let y = 8 - -18. Let j be -8 - 2-1 - 2. Let c = j + y. Calculate the lowest common multiple of 22 and c. 198 Let x be (2 + 4)(-4)/(-6). What is the common denominator of -127/12 and (1 - x) + (-154)/(-24)? 12 Let a(f) = f*3 - 6f*2 + 6f + 5. Suppose -3l - z = -8, -4z + 2z + 4 = 0. What is the lowest common multiple of a(5) and l? 10 Let d = -2 + -3. Let h be (2 - d) + 0 + -2. Let j = h + -1. What is the least common multiple of 10 and j? 20 Suppose o + 5q = 24, -q + 26 - 6 = 4o. Calculate the least common multiple of (-2)/o + 23/2 and 1. 11 Let w = 3/22 + 549/88. What is the common denominator of w and -85/16? 16 Let i = -1935/5438 - 353426179/54380. Let x = i + 6498. What is the common denominator of x and -55/18? 180 Let x = 55653/28504 + -1/12216. Calculate the common denominator of -43/3 and x. 21 Find the common denominator of -2/3 and 2 - 4/((-36)/(-111)). 3 Let o be 172028/(-14). Let l = o + 3001/3. What is the common denominator of -79/10 and l? 30 Suppose 2r = -0r - 2. What is the lowest common multiple of 8 and (-1 - -3)/(r/(-2))? 8 Suppose 2b = -2l + 19 - 5, 0 = 3l - 15. Calculate the lowest common multiple of b and (-4)/((-60)/141) - (-27)/45. 10 Let x be 2/(-1198)(0 + 1). Let w = -14381/2995 - x. Find the common denominator of w and 69/4. 20 Find the common denominator of ((-44)/(-42))/((-18)/27) and 69/2. 14 Let q(g) = g3 + 17g*2 - 39g - 18. What is the lowest common multiple of q(-19) and 78? 78 Let h be (-1)/3 - (-44)/6. Suppose 3i = 2i + h. Calculate the smallest common multiple of 6 and i. 42 Let l(s) = -s*3 + 4s*2 + s - 4. Let f be l(4). Suppose f = i - 2h - 14 + 2, h = 2i - 15. Let a = -9 - -19. What is the lowest common multiple of i and a? 30 Let u be 1 - ((-1064540 - -2) + 0). Let p = 93681123/88 - u. Let b = p - 232/11. Calculate the common denominator of b and -28/3. 24 Let u be ((-10)/8)/((-6)/48). Let d(m) = m - 6. Calculate the lowest common multiple of d(u) and 10. 20 Calculate the least common multiple of 44 and (216/48)/((-1)/((-8)/3)). 132 Let p be 12/54 - 7/(-9). Suppose r + p + 1 = 0. Calculate the common denominator of -9/11 and r - 0 - (-110)/(-4). 22 Let y = 336 + -159. Let q = 85 + y. Find the common denominator of (-2)/(-8) - q/(-24) and 111/22. 66 Let k(j) = j3 + 7j*2 - 2j + 4. Suppose 5n = -0n - 35. Suppose -3c = u - 33, -6c = -4u - 4c + 62. What is the lowest common multiple of k(n) and u? 18 Suppose 2l + 2l - 40 = 0. Suppose -3t + n = 5n - 73, -t - 5n = -28. What is the lowest common multiple of t and l? 230 Calculate the common denominator of -41/7 and 1332/(-32) - -2. 56 Let g = -3303 - -5179. Let i = 22423/12 - g. What is the common denominator of -85/22 and i? 132 Let q = 0 + 1. Let o(v) = 8v3 + v2. Let z be o(q). Let w = -7 + z. What is the least common multiple of 8 and w? 8 Let c(f) = f2 + 11f + 14. What is the common denominator of c(-4) and 1 - 1 - 17/(-3)? 3 Let w = -2082 - -16685/8. Let c = -	{ "pile_set_name": "DM Mathematics" }
6) -3 Evaluate -9 + -1 + (2 - (8 - 21)). 5 Calculate 25 + 18 + -44 + 19. 18 What is the value of 3 - (-3 + 13 - 35)? 28 4 + (-1 - 2) + -12 - (2 - 5) -8 What is the value of (3 + -1 - -3) + 5 + -19 + -3? -12 What is the value of 11 + -2 + 6 - 1? 14 Calculate (38 - (-21 + 8)) + -37. 14 What is -20 + (-19 - (-53 + 17))? -3 24 + -38 + (15 - (-3 + -1)) 5 Evaluate 10 + -6 + (20 - (-5 + -7 + 3)). 33 -17 - (18 - (16 + -6)) -25 Calculate -5 - (-7 - (-1 + (-13 - -14))). 2 What is the value of -26 - -24 - (-4 + -8)? 10 Evaluate -23 + 3 + (17 + -4 - (9 + 1)). -17 What is the value of (-1 - -11) + 4 + (1 + 1 - 3)? 13 Calculate -4 + 14 + (11 - 19) - (12 - -3). -13 (21 - 15) + -5 + -4 + 1 - 13 -15 What is the value of (-4 + 9 - (-5 - -4)) + 0 - 3? 3 Evaluate -42 - (20 - 0 - 29). -33 Evaluate 0 + -2 + (-12 + 3 - (8 - 5)). -14 Evaluate (0 - -7) + (2 - -12) + -11. 10 What is 0 + 14 + (-39 - -12)? -13 What is 10 + 0 - (-18 + (2 - -10)) - 8? 8 What is the value of -37 + 41 + -9 + -6 - -33? 22 What is the value of -26 + 8 + 3 + 7? -8 -30 + 8 + (-4 - 1) + (-3 - 2) -32 Evaluate 0 - ((17 - 18) + -11 + 3 + 0). 9 What is the value of -4 - (2 + -14 + (4 - -3))? 1 (-10 - (-30 + 4)) + -30 -14 -2 - 6 - (-50 - -70) -28 What is 3 - (-10 + 0 + 7 + -15 - 8)? 29 Calculate -17 - (29 + -18 + -25). -3 (-56 - -41) + (1 - -15) 1 Calculate (10 + -7 - -4 - -1) + -12. -4 What is -2 - ((2 - (-16 - -11)) + 0 + -1)? -8 (-7 - (3 + -12 + 7)) + 10 + -3 2 30 - 24 - (-27 - -42) -9 Evaluate (-23 - -15 - 5) + -5. -18 What is -20 - (-47 + 60 - (2 - -24))? -7 Evaluate (-5 - (-5 - -18)) + 7. -11 -5 + 3 + (-4 - -1) + -1 + 18 12 40 + (17 - 22 - 17) 18 What is the value of -20 + 12 - -11 - (2 - -4)? -3 What is -19 - (-1 - (29 - 10))? 1 Evaluate -43 - (-6 - 45 - -41). -33 Evaluate -6 + -10 - 9 - -11. -14 Calculate 1 + -4 - (7 + (35 - 32)). -13 Calculate (15 + -17 - 5) + 38 - 8. 23 What is the value of -6 + (-3 - -9) - (-4 - 3)? 7 What is 13 + 16 + (17 - 31)? 15 Evaluate (-1 + 6 - 4) + 19 + -25 + 15. 10 What is -16 + 24 + -2 - (-2 - -2)? 6 Evaluate -1 + 1 + 954 + -937. 17 Evaluate (7 - 0) + (4 + -21 - 7). -17 Calculate (-3 - -2) + (-43 - -29) - -15. 0 Calculate (5 - -8) + (-7 - (-8 - -7) - -2). 9 Evaluate (1 - 9) + (17 + -32 - -14). -9 What is 0 - -6 - ((6 - (10 + -6)) + -8)? 12 (7 - (-2 + 3)) + 4 + -7 3 Evaluate (31 - 14) + 4 + -3. 18 (5 - 15 - (-2 + 3)) + -5 -16 Calculate (-7 - 0) + (10 + 9 - -2) + -7. 7 Evaluate -317 + 324 - (-1 - -6). 2 Calculate 6 + (3 - (-1 + 3)) + 2 - 0. 9 What is (-2 - (-20 - -1 - -7)) + 15? 25 Evaluate (-10 - -1) + (20 - 15 - 7) + 8. -3 What is the value of -11 + (9 - 0) + -1 + 1? -2 6 - (4 + 1 - 1 - -18) -16 Evaluate (-1 + -12 - -14) + -1 + -1. -1 (32 - -7) + -5 - 15 19 Calculate -13 - (-3 - ((7 - 9) + -3 + 0)). -15 What is 17 + 1 + 0 - (-104 + 112)? 10 20 + (34 + (8 - 18) - 7) 37 12 - (2 + 13 + -32 + 5) 24 What is the value of 2 + 5 + (104 - 101)? 10 What is the value of -3 + (-3 - -15) + -2 - (18 + -19)? 8 Calculate (-1 - 9) + 279 + -254. 15 Calculate (-1 - (-3 - 0)) + (97 - 96). 3 Evaluate -3 + -32 + 10 + 48. 23 Evaluate -6 - 10 - (23 - 14). -25 Calculate 1 - 7 - -8 - (12 - (2 - 1)). -9 26 - 33 - ((9 - 6) + -20) 10 23 - 3 - (26 - 15) 9 Evaluate (2 - 20) + -3 + (23 - 12). -10 (-32 - -122 - 86) + (0 - -1) + -4 1 Calculate 0 + -9 + 6 + (-12 - -6) + -16. -25 What is -5 + (9 - (3 + -1 + -5))? 7 Evaluate 0 + -2 - (-16 - -26) - -9. -3 Calculate -5 + -3 + -1 + 24 + (-11 - -7). 11 What is 30 + -8 + 8 + -15? 15 Calculate 42 + -13 + 13 + -3 + 0 + 1. 40 Calculate (3 - -8) + (-2 - (13 - 16)). 12 Evaluate -19 - 26 - (-3 + -6). -36 What is the value of (9 + -19 - -22) + -2? 10 Evaluate 62 + -81 - (3 + -3 + 0). -19 -35 + 31 + -2 + -11 -17 What is -16 - (1 + 6 + -15 + (-6 - -14))? -16 Evaluate 5 - (7 - 5) - (-14 + 0 - -31). -14 Evaluate (2 - (-16 - -18) - (1 - 1)) + -5. -5 Calculate 21 - 0 - (8 + (-13 - -14)). 12 What is the value of -9 + (4 + -7 - -4) + 6? -2 What is (-25 - -47) + (-5 - (1 - -3))? 13 What is (0 - (-2 - 2)) + (11 - (13 + 1))? 1 (-75 - -74) + -2 + -4 + -1 -8 1 - -2 - (7 + (1 + -7 - -12)) -10 What is the value of -62 + 5 - (107 + -138)? -26 Calculate -51 + 29 + (-4 - -20). -6 What is (-41 - -17) + (-1 - 9) + 9? -25 23 - ((-5 - -3) + 1) - (57 + -50) 17 What is -2 + (3 - -14 - 3) + 1? 13 What is 6 - (22 - (-6 + 5 + 6))? -11 What is the value of (9 - (11 + -4)) + 2 + -4 + 16? 16 What is 4 - (-1 - -1) - (33 - 36) - -18? 25 What is the value of 16 + -12 + 0 + -3 - -18? 19 Calculate (-14 - -4) + 13 - (-1 + 8 + 1). -5 What is the value of 11 - (9 - -16) - -8 - (-14 - 1)? 9 What is 2 - -3 - (-3 + -3)? 11 What is the value of 14 + (-9 - 2) + (1 + -6 - -1)? -1 (-7 - (0 - (7 - 2))) + 3 + -8 -7 -13 - -2 - (-151 + 152) -12 (12 - (34 - 35)) + (-4 - (2 + -2)) 9 -13 - 1 - (4 + 1 - 4 - 1) -14 Evaluate -15 - (17 - (51 - 28)). -9 What is the value of 11 + (8 - 2) + -39? -22 7 - ((17 - 9) + -7 + -1) 7 What is the value of 52 - (-40 - (-113 + 37))? 16 Calculate -17 + 8 + (-1 - -1 - (-25 + 18)). -2 What is the value of (-16 - -39) + -14 - 34? -25 (6 - 8) + 8 + -41 + 50 15 What is the value of (15 - 26) + 2 + (1 - -3)? -5 What is -21 + 19 + -4 + -19 + 18? -7 Evaluate -15 - (123 + -134 + (17 - 0)). -21 (8 - (9 + 8 + -6)) + -4 -7 What is the value of 5 + 1 + (-60 - -63)? 9 Calculate 16 + -26 + 13 + 0. 3 Calculate 8 + 1 + -7 + 6 + -4 + 11. 15 What is 9 - -22 - (8 - (1 + -6))? 18 What is (-14 - -1) + 17 - 12? -8 Calculate (-12 - (-33 - -11)) + -7. 3 Evaluate 4 + -11 + (17 - 8) + 0 + 6. 8 Evaluate 7 + (-2 - -1) - 7 - -21. 20 What is the value of (42 - 32) + -1 + 5? 14 What is -5 - (1 + 28 + -46)? 12 What is the value of 5 + -8 + 1 - (-31 - -10)? 19 What is the value of (-1 - 1 - 7) + 43 + (35 - 66)? 3 What is 30 + -7 + -15 + 4? 12 What is 7 - 14 - -22 - (-3 + 5)? 13 Calculate 46 + -51 - (-2 + 1 + -11 + -1). 8 Calculate 70 - 85 - (-11 + -2). -2 Evaluate -24 + 12 + 8 - 2. -6 What is the value of 5 - ((2 + -2 - 1) + 34)? -28 What is 3 + (-10 - (-2 - 2))? -3 Evaluate -7 + 14 + -9 + 5 + -4. -1 Evaluate 26 + -17 - -4 - 21. -8 Evaluate 14 + (-14 + 4 - 3). 1 Evaluate -3 + (11 - 23 - -12) + 3. 0 What is the value of 5 + (5 - 19 - -36) - 5? 22 Evaluate -14 - (-71 - -14) - 10. 33 What is (-8 - -15) + -12 + -4? -9 Calculate -5 - 0 - (-12 + 24 - -2). -19 (31 - 52) + 34 + (-12 - 1) 0 Calculate 17 + (22 + -48 - -4). -5 What is -1 + -5 - (14 + 21 - 40)? -1 Calculate 4 + (0 - 0) + (-8 - 13 - -15). -2 What is the value of -13 - (-11 - -10) - -17? 5 What is the value of 1 - 3 - (5 - (18 + 0 + 2))? 13 Calculate -10 + (-1 - -1) - -15. 5 Evaluate -13 + 13 + (10 - 11). -1 Evaluate -42 + 83 + (-23 - 9). 9 Calculate 9 + (8 - (1 + -1 - (51 - 55))). 13 What is -10 + 2 + 0 + (41 - (-7 - -12))? 28 (-30 + 34 - 6) + -7 + (0 - 1) -10 What is -7 - -11 - (-45 - -49) - 30? -30 22 + -1 + (24 - 43) 2 Calculate 27 + -28 + -2 + -9 - -34. 22 What is 9 + (-18 - -15) - 12? -6 Calculate -7 - (10 + 24) - -1. -40 16 - (-19 + -25 + 45) 15 What is -3 + (-3 - -5) + (4 - -9)? 12 1 - ((-1 - 0) + 16 + (-205 - -212)) -21 What is 3 - (10 + -5 + -1)? -1 Evaluate (51 - 46) + (-4 - 1) - (4 + 5). -9 Evaluate -31 + 2 + 7 - 1 - (2 - 11). -14 What is the value of 15 + -1 + -1 - (36 + -13 - 15)? 5 What is the value of -1114 + 1090 - (2 + -1 + 2 - 0)? -27 What is the value of 39 - 4 - 0 - (12 + -3)? 26 What is 4 - 1 - (11 + (-28 + 2 - -11))? 7 What is -2 - (-13 + 0 + (-16 - (-18 + 0)))? 9 Evaluate -3 + (11 - 13) + (-1 - -1). -5 Evaluate -88 - -92 - (-11 - -25). -10 Calculate (48 + -51 - (-6 + 0)) + -5 + -3. -5 What is 15 - ((8 - 19 - -37) + 14)? -25 What is the value of 9 + -22 + 13 + 8? 8 What is the value of -22 - (-7 - (-10 - ((-3 - -6) + -6)))? -22 -2 + 28 + -53 + 23 -4 Calculate 82 - 81 - (-2 + 5 - (0 + 1)). -1 What is the value of (-9 + 3 - (0 + 1)) + 10? 3 Evaluate 13 - 5 - 7 - 11. -10 Calculate 0 - -7 - ((-4 + -6 - -5) + -3). 15 What is the value of (15 - 0) + (1470 - 1482)? 3 What is 11 + 8 + (-9 - (-7 + -5))? 22 What is 1 + 32 + (-11 - (-8 - (-8 + 6)))? 28 Calculate -3 + (15 - (48 - 33)). -3 What is the value of 13 + (5 - 14) - (-3 + 2)? 5 What is (10 + 1 - (2 - -5) - 10) + 17? 11 Evaluate 19 - (-3 - 1) - 13. 10 -7 + (5 - -6) - (24 - 8) -12 Calculate -7 + 1 + (0 - 3 - (-10 + 2)). -1 Calculate 23 + (4 - (8 + 25)). -6 Evaluate -6 - (-5 + 3) - (-2 - (5	{ "pile_set_name": "DM Mathematics" }
1.5 + -1342. What is the nearest to 4 in -422, -1, v? v Let f = -3570.156 + 3558. Let r = -0.156 - f. What is the closest to -1/3 in -7, 5, r? 5 Let k = 35068 - 35067. Let x be 96/140 - 4/14. Which is the nearest to x? (a) k (b) -0.5 (c) -1 a Let h = -0.23 - 0.77. Let k = -4 - h. Let s be 6/14 - 6/63. What is the nearest to 2/5 in s, k, -2/5? s Let p = 319 - 208. Let f = 110.9 - p. Let k = 0.4 + 0. What is the nearest to f in k, 4, -5? k Let v = 133 - 178. Let a = -45.2 - v. What is the nearest to 4 in -1, a, 0, -4? 0 Suppose -17 = -5a + 3l, -l = 5a - 8 - 13. Suppose -as + m = 2m - 58, -2 = -m. Suppose s - 12 = 2k. What is the closest to 2/7 in k, 1/3, 5? 1/3 Let x = -376.1 + 375.5. Which is the nearest to x? (a) 4 (b) -6/11 (c) 1 b Let k = 0.315 + 1.165. Let n = k - 6.48. What is the nearest to 1/7 in n, 4, 2? 2 Let o = -99.9 + 97.9. What is the nearest to 0.005 in o, 0.6, 3? 0.6 Let s = 9.9 - 5.9. Let y = 384 + -383.7. What is the nearest to 0.2 in y, -4, s, 7? y Let x = 10894 + -10827. What is the nearest to -0.06 in x, 0.3, 3/8, -0.4? -0.4 Let u = 48.03 + -47.03. What is the nearest to -1 in 2/9, u, -18/35? -18/35 Let l = 85.915 + -86. Let g = -4.085 - l. Which is the nearest to -0.1? (a) 11 (b) g (c) 4/7 c Let d = 2.2 - 2.2. Suppose -3 = u - 27. Let p = u - 239/10. What is the nearest to -0.1 in -0.6, p, d? d Let u = 1280.6 + -1284.6. Let l = -1 + -1. Which is the nearest to 1? (a) u (b) 7 (c) l c Suppose 136n + 4p = 137n + 27, -4n - 7p = -53. Let t = 1 + -2. What is the nearest to t in 1/3, n, 4/9? 1/3 Let l = 72311/2 + -36156. Which is the closest to -8? (a) -1/35 (b) 0.3 (c) l c Let r be (1 - 8/10)2. Let n be (-3)/(14/4(-3)/(-7)). Let g be (4 - n)(-4)/56. Which is the nearest to r? (a) g (b) -2/5 (c) 1 c Let q = -24 + -36. Let s = 67 + q. Suppose sg - 8g = 3. Which is the closest to 1? (a) 0.3 (b) -5 (c) g a Suppose -18t - 76 - 32 = 0. Let d be ((-4)/(-21))/((-80)/12 - t). What is the closest to d in 2, -5/6, -1/3? -1/3 Let s = -3 + -1. Let i = 138205 - 138204.9. Which is the closest to i? (a) 4 (b) s (c) 3 (d) 0.1 d Let t = 1 + -5. Suppose -3p + 31k - 25k = -6, 4k = -8 - 0. Which is the nearest to p? (a) 6 (b) -1 (c) t b Let m = 1711/6 + -286. Suppose -2s - 65 + 49 = 0. Let b = 3 + s. What is the closest to -0.1 in m, 3, b? m Suppose -2l + 5f - 17 = 0, 0 = -f + 3 + 2. Let n = 15/4 - l. Let o be 2/(-18) - (-319)/1089. Which is the closest to n? (a) 0 (b) o (c) 7 a Let f = -4.3 + 2.3. Let y = 0.9 + -1. What is the nearest to 0 in y, f, -3/7? y Let f be (2/5)/(1(-9)/15). Let p = -43 + 38.8. Let v = p + 2.2. Which is the nearest to v? (a) f (b) 0 (c) -0.4 a Let y = 64769/11 - 5888. Which is the closest to 0? (a) 1/5 (b) -1 (c) y (d) 5 c Let x = 0.07 + -0.37. Let y = 538.9 - 564. Let f = 25 + y. Which is the nearest to f? (a) -5 (b) x (c) -1/4 c Let t be (-2)/(-7) - (-20)/(-119). Let l = 7.7532 + -2.7532. What is the nearest to -3/10 in l, -2, t? t Let t be ((-24)/80)/((-18)/(-15)). Let c = -3.5 - 0.5. What is the closest to t in -0.1, 0.2, c? -0.1 Let k = -1343 + 1342.5. Let y be 16/(-18) - (3 - 4). Let v = y + -4/9. What is the closest to 0 in v, -2, k? v Let t = -5 + 10. Let i = 139668.1 + -139668. What is the closest to i in -85, t, -3? -3 Suppose 10w + 1224 = 1194. Let y be (-28)/(-40)-2 - -1. Let j = -327/5 - -65. What is the nearest to y in -2/9, w, j? j Let n = 839611/2964 + -26872/95. Let q = 2/161 - 473/25116. Let t = q + n. What is the closest to 2 in 0.2, t, 0? t Let r = 37 - 19. Suppose 23a = ra. Suppose -45b + 46b = 6. What is the nearest to a in 5, -0.3, b? -0.3 Let m be -106/755. Let i be 191/9(4 - (-1535)/(-385)). Let y = i - -1/99. Which is the nearest to y? (a) m (b) -3/2 (c) -1/3 c Let z = 187.2 + -186.8. Which is the nearest to 2/17? (a) -0.5 (b) 12 (c) z c Let z be 0 - (-703)/18 - 1164/(-2619). Let k = 559/14 - z. What is the closest to 0 in k, -5, 2/7, -1/2? 2/7 Let n be 4/((-4 + -6)/(-1)). Let h = -1619 + 1625. Which is the nearest to n? (a) -1 (b) h (c) -2/7 c Let o = 8348/1955 - 72/17. Let m = 103/345 + o. Which is the nearest to 2/5? (a) 0.4 (b) 1/4 (c) m a Let i = 26783.7 - 26784. Let v = 7 - 3. Which is the closest to 3? (a) v (b) i (c) 0.2 a Let a be (1/(-2))/(-2(99/18 - 5)). What is the nearest to a in 47, 0.3, 3/5, -3/2? 3/5 Let c = 6440 + -6437. Let a = -3/92 + 223/1196. Let f = 20/39 + a. What is the nearest to 2 in -4, c, f? c Let z = 0.788 - 1.188. Let q = -0.05 - 1.95. Which is the closest to 0.2? (a) 1 (b) z (c) q b Let a be (-1)/(-3) + 32/(-9). Let z = -0.4471 + 0.2471. What is the nearest to 51 in a, 0.3, z? 0.3 Let h = 42 - 29. Let m = h + -18. Let o = -0.84 + 0.64. What is the closest to -0.1 in m, o, -2/3? o Let g(z) be the third derivative of -z*6/120 + 19z5/60 + z4/8 - 26z3/3 - 3z*2 + 2. Let x be g(19). What is the nearest to -1/3 in x, 1/8, -1? 1/8 Suppose 0 = -f - 2w + 14, -775f + 776f = 3w - 11. Which is the nearest to -2? (a) 0.5 (b) f (c) 5 (d) -2 d Let p = -2.04143 + 0.04143. What is the closest to 0 in 0.8, p, -27? 0.8 Let o = 530 - 233. Let q = -338 + o. Which is the closest to q? (a) 5 (b) -4 (c) 2 b Let o = -10179 - -10183. Which is the closest to 1/2? (a) o (b) -1/4 (c) 0.02 (d) 3 c Let x = 7 + -5. Let q = -0.116 + 289.116. Let v = q - 286. What is the nearest to 2/7 in x, -1/4, v? -1/4 Let p = -2779 - -2778. Which is the nearest to 4? (a) 12 (b) -5 (c) p c Let o be (-12)/(-10)(-53 + 18/6). Which is the closest to o? (a) -5 (b) 0.2 (c) -1 a Let f be (1 + -10)(-8)/(-36) + 6. Let h = -228 + 228.2. What is the nearest to f in h, -0.3, -4, -0.4? h Let g be 6223/(-819) + 7/1. Let m = g + 4/9. Which is the nearest to -1/2? (a) 0.4 (b) 4 (c) m (d) -0.1 c Let r = -0.04 + -0.06. Let g = -0.096 + 24.096. Let p = g + -29. Which is the closest to r? (a) 3 (b) -3 (c) p b Let h = 413.973 + -414. Let v = 0.727 + h. What is the nearest to 2/11 in -5, 9, 3, v? v Suppose 1420 = 4k + 3832. Let n = k + 603. What is the closest to n in -4/5, -0.5, -1? -0.5 Let j = 24665/4 + -6166. Which is the closest to j? (a) -9/4 (b) 4 (c) -338 a Let s = 2586 - 2585.9. What is the nearest to -4 in 3/4, s, 62? s Let a = 1.576 + -1.4394. Let i = a - 0.0366. What is the closest to 0.05 in 4, -2, i, 1? i Let d = -0.328 + 112.328. Let k = d + -112. What is the closest to k in 1, 5, 1/2? 1/2 Let z = 2.286 - -0.014. Let o be (-23)/1794 + 309/(-234). Which is the nearest to z? (a) 3 (b) o (c) 0.1 a Let u(i) = -115i + 1263. Let c be u(11). Let o = -0.7 - 0.3. Let t be 2/(-7) + 40/238. What is the closest to c in t, 2/9, o? o Let i be 72/135 + (-2)/(-15). Let m = 459.9 + -460. What is the nearest to m in i, -5, -2/13? -2/13 Let l = -5727.2 - -5727. Which is the nearest to 0.3? (a) -11/5 (b) 1.5 (c) l c Let h = -0.62554 + -0.37446. Which is the nearest to h? (a) 1 (b) 147 (c) 0.1 (d) 2/7 c Let m = 0.0219 - -7.9781. Let v = -51 + 50.8. What is the closest to -2 in m, 0, v? v Let o = 3885 + -3885. Which is the closest to o? (a) -2/7 (b) -0.3 (c) -2 (d) 3 a Let o = -2 + -1. Let r = 12641 - 12641.08. Which is the closest to o? (a) r (b) 4 (c) -3 (d) -1 c Let y = -108/7 - -986/63. Which is the closest to y? (a) -1/6 (b) -47 (c) -2 a Let f be ((-112)/(-16) - 16) + 12 + -4. Let s = 68/7 - 10. Let j = -13/4 - -3. Which is the closest to f? (a) -0.1 (b) s (c) j b Suppose 14j - 18j = -12. Suppose 2r + 142 = 7v - 2v, -jv + 110 = 5r. Let m = 11.8 + -16.8. Which is the nearest to v? (a) m (b) 1/5 (c) -4 b Let m(t) = 143t + 2428. Let a be m(-17). What is the nearest to 183 in -5, 3, a? 3 Let i = 157.01 + 2.99. Let v = i + -160.4. Let y = -1 + 1.1. Which is the closest to 1? (a) v (b) y (c) 0.3 c Let m = -16595 + 16595. Let s = 41 + -122/3. What is the closest to s in -3, 5, m? m Let r = -1 + 1.5. Let d = 1.5 + r. Let f = -1747.1 - -1747. What is the nearest to d in f, 0.3, -3/2? 0.3 Let i = 210611 + -210611. Let w be 3/(-18)4/7. What is the nearest to 0.1 in w, i, 0.08, -0.5? 0.08 Let j = 0.86 + -0.92. Which is the closest to 0? (a) 1 (b) -6/11 (c) j c Let y = -294 - -145. Let p = -148.9 - y. Let x = -6 + 3. What is the nearest to x in -3/7, 4/5, p? -3/7 Let	{ "pile_set_name": "DM Mathematics" }
). -6 Let l(c) = -2c + 1 - 2c*2 + 2c + 3c2 + c. Let o = -8 + 5. Let q(d) = d2 + 4d + 2. Let z be q(o). What is l(z)? 1 Let b(c) = 6c. Let u(o) = -5o. Let q be 6/(-2)(-8)/6. Let f(t) = qu(t) + 3b(t). Calculate f(-2). 4 Let v be (-3)/(-2)(-28)/288-4. Let c(s) be the second derivative of -2s*2 - vs4 - s3 - 5s + 0 - 1/20s*5. Give c(-6). -4 Let l(c) = 4c*2 + 2c. Suppose -3j - 3k - 15 = -0j, -3j = -5k - 9. Give l(j). 12 Suppose -3w - 9 = -3h, 0h - 2w - 2 = -4h. Let z(m) be the third derivative of m*4/12 + 2m2. What is z(h)? -4 Let i(j) = -j3 - 5j2 + j - 3. Suppose -16 = 2g + 2g. Let v be 44/(-8) + (-2)/g. Give i(v). -8 Suppose -5p + 39 = -2p. Suppose -h - p = 3b, -2b - 3h = -5h + 14. Let v(y) = -2y - 1. Calculate v(b). 9 Suppose 2u - 5 + 1 = 0. Let b(k) = 25k - 21k + u + 1 - 4. Let y(v) = -v3 - 4v*2 - 4v - 2. Let w be y(-3). Calculate b(w). 3 Suppose -2j = 3j. Let k be (-2)/(-7) - (-16)/(-7). Let h be (0/1)/(j + k). Let x(p) = p*2 + 4. Give x(h). 4 Let r = 8 - 4. Let b = r - 6. Let s be (0 + b)(-2)/4. Let f(z) = -z3 - z2 + 1. Determine f(s). -1 Let y(p) = -6p2 - p + 1. Suppose 1 = 5u - 9. Suppose -h = -uh + 1. Determine y(h). -6 Let d(y) = 2y - 9. Let m(u) = u - 4. Let h(k) = -6d(k) + 13m(k). Give h(-6). -4 Let x(d) = 4 - 2d + 6 + d. Let n be x(8). Let r(q) = 0q + nq + 2 + 0. What is r(-2)? -2 Suppose 0 = 4d + 10 + 14. Let b(g) = -g - 8. Determine b(d). -2 Suppose 1 - 3 = -k. Let l(n) = n - 1. Let m(i) = 4. Suppose 5y + 7 = -18. Let r(g) = yl(g) - m(g). What is r(k)? -9 Let d(w) = -w - 1. Let k(j) = -j + 9. Suppose -3a - 9 = -g, 2a = 4a. Let y be k(g). Suppose y = z - o - 5, 0 = 2z - 3z + 4o + 14. Give d(z). -3 Let l(w) = 4w2 - 2w*2 + 26w*3 + 44 - 22w3 - 45. Determine l(-1). -3 Let t(z) = -z3 + 5z2 - 2. Suppose 0 = 5v - j - 2, j + 3j + 8 = -3v. Suppose vf = 2f - 32. Suppose 3u + a - 18 = 0, u = -5a + 4 + f. Determine t(u). -2 Let r = -22 - -12. Let t be (-12)/r - 2/10. Let s(j) = j + t - 3 - 2j2 - 6j. Calculate s(-3). -5 Suppose -l + 3 = -2l. Let y(j) = -24 + 14 - j3 - 2j - 3j2 + 7. Give y(l). 3 Let i(a) = a3 + 8a*2 + 3a + 1. Let h(x) = x + 1. Let n(j) = -3h(j) + i(j). What is n(-8)? -2 Suppose -5u = -3a + 14 + 12, 3a + 14 = -5u. Let s(i) = -7i + 5. Let j(k) = 3k - 3. Let r(c) = us(c) - 9j(c). Let z = 0 - 0. What is r(z)? 7 Let k = -60 - -66. Let q(u) = u - 5. Give q(k). 1 Let x(w) = w3 - 4w*2 - 3w - 3. Let s = 6 + 0. Let r = -1 + s. Give x(r). 7 Let w(z) = -z*2 - 4z + 8. Let i(o) = -o*3 - 2o*2 - 3o - 3. Let j be i(-2). Suppose -10 = jm + 8. Calculate w(m). -4 Let i(x) = x2 + 10x + 6. Suppose 32 = b - 5b. Calculate i(b). -10 Let f = 10 + -2. Suppose f = 3k + 2. Let m(a) be the second derivative of -a*3/2 - 2a. Determine m(k). -6 Let l(h) = h*3 + 2h*2 + h + 4. Let u be (2 - 0/1) + 0. Suppose 2k + ub = 6b + 24, -3k - 4 = 4b. Suppose -a = -k + 7. Determine l(a). -8 Let v(x) = -5x2 + 5 + x + x + 0 - x3 + 4x. What is v(-6)? 5 Suppose 0 = 68x - 69x + 2. Let n(g) = 3g2 - 2g - 2. What is n(x)? 6 Suppose 0g - 4g + 12 = 0. Suppose 2d - g = 1. Let c(z) = z2 + 3z - 1. Give c(d). 9 Let r(s) = -1 - 2s + 9 + 3s + 6. Let h(d) = 3. Let l(t) = 12h(t) - 3r(t). Let m be (1/(-2))/((-1)/(-10)). Give l(m). 9 Suppose -5b + 2 = -13. Let y(q) be the second derivative of -q6/720 - q5/40 + q4/12 - q. Let m(l) be the third derivative of y(l). What is m(b)? -6 Let j(q) be the first derivative of -q3/3 + 2q*2 + 5q - 25. Let f be 1/(-1)(-4 + -1). Give j(f). 0 Let p(t) = -t2 - 2t - 4. Let r(m) = m. Let x(o) = p(o) - 4r(o). Calculate x(-6). -4 Let v(m) = -m2 + 5. Let j(i) = i3 - 4i*2 - 4i - 2. Let k be j(5). Suppose 4q - ky - 1 = -4, 1 = y. Determine v(q). 5 Let c(h) = -5h3 - h2 + h. Suppose 0y - 2y = -4p - 2, -4p - 4 = -4y. What is c(y)? -5 Suppose 5f - 20 = -2x + 7x, 2f = -4x + 2. Let a(y) = 2y + y - 2y - fy*2 + 4y - y3. Give a(-4). -4 Let j(l) be the second derivative of l3/3 + l*2 - 13l. Calculate j(-6). -10 Let n(s) = s + 1. Let p(r) = -r - 2. Let v(o) = -4n(o) - 5p(o). Let j be v(-6). Let f(d) = d3 - d2 - 6. Determine f(j). -6 Let l(y) = -2y - 1. Let h(b) = 9b + 4. Let a(f) = -h(f) - 6l(f). Determine a(-2). -4 Let n = -7 - -13. Let d(j) = j3 - 5j*2 - 4j - 3. Determine d(n). 9 Let t(z) = -z*2 + 2. Let j(y) = -3y + 2. Let v be j(-4). Suppose -v + 2 = -4m. Let w be m/(1 + 10/(-4)). Give t(w). -2 Let n(u) = 3u + 3. Let l(i) = 4i + 2. Let y be l(-1). What is n(y)? -3 Let f(c) be the second derivative of 0 - 1/2c*2 + 1/6c*3 - 3c. Give f(5). 4 Let s(w) = -w*3 + 5w*2 + w - 2. Let z = -24 + 29. Give s(z). 3 Let u(p) be the first derivative of -2p3/3 - p2/2 - p - 1. Let j be 3 - ((0 - 1) + 2). Suppose 0g - 2g = j. Give u(g). -2 Let z(x) = 3x2 - 5x + 5. Let m(g) = 2g2 - 2g + 3. Let h(k) = -5m(k) + 3z(k). Determine h(-5). 0 Let z(i) = 3i - 4. Let f be (-1)/(10/(-3) - -3). Calculate z(f). 5 Suppose -9 = -0f - 3f. Suppose 0 = fk + 10 + 2. Let g(z) be the first derivative of -z4/4 - z3 + 3z2/2 - z - 1. What is g(k)? 3 Let i(f) be the first derivative of -f3/3 + 2f*2 - 4f + 4. Let j(c) = c*3 - 5c*2 + 2c - 6. Let s be j(5). Determine i(s). -4 Let y(t) = -20t + 2. Let q = -2 + 19. Let z(x) = -7x + 1. Let h(a) = qz(a) - 6y(a). Determine h(-5). 0 Let x(q) = -3q2 + 1. Suppose 3g - 5j = 32, -2j - 3 - 1 = g. Let o(b) = -b*2 + 3b + 4. Let d be o(g). Suppose -2 = -2p - dp. Calculate x(p). -2 Let j(n) be the third derivative of n5/60 + n4/6 + 2n3/3 - 8n2. Calculate j(-3). 1 Let n(h) = -h2 + h - 14. Suppose 0 = 4b - 3b + 4b. Determine n(b). -14 Let k(g) = 2g + 2. Let z be k(1). Let f(y) = z - 3 - 5 - y - 3. What is f(-5)? -2 Let c(i) = -3i2 - 2i + 2. Let y(h) = 6h + 8h - 4h - 5h - 4 + 7h2. Let r(b) = -5c(b) - 2y(b). Give r(0). -2 Let s = 5 + -2. Let c(o) = 0o2 - os + 2 - o*2 - 1. What is c(-1)? 1 Suppose 6 = w - 0n - 4n, n = 5w - 11. Let p(i) = 4i - wi - 5 - i. Determine p(6). 1 Let f(a) = a*2 + 1. Let l(i) = -6i*2 - 6i - 11. Let y(n) = -5f(n) - l(n). Determine y(-6). 6 Let l(d) = -4d - 8. Let c(g) = -g + 1. Let u be c(7). Determine l(u). 16 Let p(f) = 1 - 2 + 3. Let c(q) = 1. Let j(o) = 3c(o) - p(o). Let r(w) = w3 + 5w*2 + 4w + 1. Let g(h) = 4j(h) - r(h). Calculate g(-4). 3 Let c(x) = 5x + 1. Let b = 12 + -9. Suppose 3 = -bv - 0. Calculate c(v). -4 Let z(v) = v3 - 3v*2 - v - 1. Let x = -16 + 19. Calculate z(x). -4 Let p(v) = 2v*2 - v. Let d be p(1). Let m(x) = x + 1. Let k(y) = -3y - 6. Let i(a) = dk(a) + 4m(a). Let c = 46 - 51. Determine i(c). -7 Suppose 8b + 8 = 4b. Suppose 0 = 3i - i - 2. Let u(o) = i - 3 + 0 - 2o - 3o2. What is u(b)? -10 Let x(o) = -o3 + 5o*2 - 4o + 1. Let i be -9(4 + 52/(-12)). Determine x(i). 7 Let x(q) = 2q*3 - 4q*2 + 4q - 3. Suppose -2 = -b - 0. Give x(b). 5 Let h = -35 + 39. Let w(b) be the first derivative of 0b3 + 0b*2 + b - 2 - 7/4b*h. What is w(1)? -6 Let d(u) = -3u + 9. Let b(o) = -6o + 18. Let c(x) = 2b(x) - 5d(x). Determine c(6). 9 Suppose 5p - 12 = 4a, 4p = 3p + 2a. Let m be p3(-3)/(-36). Suppose -l - m = -6. Let d(o) = o*3 - 4o*2 - 5o + 4. What is d(l)? 4 Suppose 6 + 18 = -4u - 2w, 16 = -5u + w. Let g(o) = o2 + 4o - 5. Give g(u). -5 Let a(v) = 29v2 + v3 - 1 - 87v*2 - 3v + 26v2 + 33v*2. What is a(-2)? 1 Suppose -3g = -111 + 18. Let u(f) = 32 - g - f*2 - 3f*3 + 0f2. Let j be 5/(-3) - (-6)/9. Determine u(j). 3 Let u(t) be the first derivative of t3/3 + 2t2 + 1. Let n be (-12)/(-9) + (-4)/(-6). Suppose 4w - n = -22. What is u(w)? 5 Let t(j) = -2j - 5 - j3 + 11j - 8j. Determine t(0). -5 Let k(l) = -l2 + 5l - 5. Let n = 18 + -14. What is k(n)? -1 Let p be (-3 - 0)((-320)/12)/(-8). Let q(l) = -l3 - 9l*2 + 8l - 13. Calculate q(p). 7 Let x(t) = 2t - 1. Let h(m) = -m + 2. Let n be h(1). Suppose 5d = 6 - n. Let f be 1/(2/8)d. What is x(f)? 7 Let x(c) = -2c*2 + 2c + 1. Let s be x(0). Let r(y) be the first derivative of 9y2/2 + y + 1. What is r(s)? 10 Suppose 3h + 2h = -20. Let c(k) = -11k. Let p(s) = -	{ "pile_set_name": "DM Mathematics" }
o + p + ko*3 and give p. 0 Rearrange (-2k - k + k)(-1 + 5 + 8)(-2 + k + 2)(-2k + 1 + k + 3) to the form j + lk3 + xk*2 + fk and give j. 0 Express 4u4 - 141u + 141u - 3 - u3 - 3u*2 as au*2 + pu*4 + ku*3 + qu + r and give r. -3 Rearrange 144m - 24 + 47m + 24 to tm + z and give t. 191 Express 4s*2 - 3s + s*2 - 7s2 - s2 - 14s3 + s2 as ms*3 + r + ls*2 + ws and give w. -3 Express 15w + 316w*2 - 38w + 23w in the form tw*2 + zw + f and give t. 316 Rearrange -p*3 - 2p*3 + 2p*3 + (0p - 3p3 + 0p)(0 - 1 + 0) - 17p*3 + 73p*3 + 33p*3 to the form d + yp + fp3 + vp*2 and give f. 91 Rearrange -150h + 129h + 84h to j + oh and give o. 63 Express 82b*2 - 22b*2 + 148b*2 + 182b*2 + 283b*2 as vb*2 + d + zb and give v. 673 Rearrange -78432c + 39196c - 9 + 39157c to oc + t and give t. -9 Rearrange (4 - 4 + 2)(-u + 4u - 2u) - 97 - u + 141 - 82 to the form b + lu and give l. 1 Express -4o3 + 5o*3 + 0o*3 + (2529o*2 - 1258o*2 - 1212o*2)(o - 2o - o) in the form m + ko + ho3 + do*2 and give h. -117 Rearrange 258 + 2x*3 - 255 + 17x - 3x2 - 13x to ux2 + mx + px3 + y and give y. 3 Rearrange 8o*2 - 8o*2 - 2 - 5o*2 + 3o + 6o2 + 8o4 - o4 to the form vo2 + mo*3 + h + ro + wo4 and give w. 7 Express (0g*3 + 6g*3 - 5g*3)(18 + 116 + 84 - 3 + 2 + 2 + (1 - 1 + 1)(3 - 1 + 0) - 1 - 3 + 2) as hg + xg2 + a + og*3 and give o. 219 Express 490t + 914 - 914 in the form zt + a and give a. 0 Express -166 - 30 - 197 - 2a*2 in the form ca*2 + za + h and give c. -2 Rearrange 729d - 889d + 1253d + 1555d to the form xd + c and give c. 0 Express 67o - 77o - 155o as jo + c and give j. -165 Rearrange (1 - 1 - 4a)(466 - 116 - 149)(-4a - 2a + 3a) to c + va*2 + ba and give v. 2412 Rearrange (-257w + 94 + 95 - 189)(-3 - 1 + 3) to x + tw and give t. 257 Express p3 - 3p*3 - 20p*3 + (-2p2 - p2 + 2p2)(3p - p - 4p) as hp2 + v + lp*3 + xp and give l. -20 Rearrange ((4 - 6 - 1)(-3 + 2 - 1) + (2 + 2 - 3)(-2 - 4 + 4) + 2 - 2 - 2)(30q + 2q + 4q) to the form hq + n and give h. 72 Rearrange (3f - 4f + 3f)(-21f + 934f2 - 6f - 932f2) to mf*2 + cf + l + if3 and give l. 0 Rearrange 0x + 73 - 9x + 67 - 129 - x to w + sx and give w. 11 Rearrange z*4 + 42z*2 - 37z*2 - 2z*4 - 2z*3 - 2 - 2z + 0z to the form sz*3 + fz + oz4 + p + cz*2 and give c. 5 Rearrange -10t*2 - 3t2 + t - 66 - t2 + 9t2 - 3t to the form lt + v + rt*2 and give r. -5 Rearrange (-3 - 1 + 0)(j - j - 2j) - 2j - 11j + 5j + (4 - 2 - 4)(-5j + 2j + 2j) to m + lj and give l. 2 Rearrange (-12q + 19q - 159q)(1 + 4 - 3)(1 + 2 + 0) to x + kq and give k. -912 Rearrange -1720 + 8x*3 + 1720 + 3x*2 + (-3x*2 + 5x*2 - 3x*2)(-2x - x - 2x) to v + yx2 + dx + zx3 and give z. 13 Rearrange 8 - 2m - 29 + 19 + 6 to the form g + ym and give y. -2 Rearrange (3s*2 + 10s*2 - 2s*2)(98 + 27s - 98) to the form t + ls*3 + ws + ds2 and give l. 297 Express 3c + 2 - c - 10c3 + 7c*3 - 2c4 - c3 as tc3 + nc*2 + hc + gc4 + s and give g. -2 Rearrange 1249226 - 1249226 - 1652f to the form o + vf and give v. -1652 Express (t - 3t + 3t)(0t3 + 4t*3 - 3t*3) + 29 - 29 - 26t*4 as zt + y + wt4 + xt*3 + ut*2 and give w. -25 Rearrange 16 - 82n*2 - 16 - 4n*2 to an + in2 + s and give i. -86 Express -3 + 3 - 2s*3 - 7s*3 + 2s*3 + 2s*3 + (-s - 3s + 3s)(11s2 - 7s*2 - 2s*2) in the form qs + c + ns2 + js*3 and give j. -7 Express -2u*2 + 316u*4 + 14 - 2 - 326u*4 as cu*3 + vu*4 + du + qu2 + p and give p. 12 Rearrange (0p - p + 0p - 2p + 2p + p + (2 - 2 + 2)(-p + 3 - 3) + 0p + p + 3p)(-9p + p + 5p) to the form mp*2 + h + xp and give m. -6 Rearrange 74v2 + 71v*2 - 59v*2 + 81v*2 - 2 to i + bv + qv2 and give q. 167 Rearrange -29h*2 - 155h*2 - 584h*2 - 90h*2 - h to wh*2 + l + nh and give w. -858 Rearrange 3 + 3c + 12c*2 - 173c*3 - 13c*2 + 181c*3 to the form l + hc + ac3 + qc2 and give h. 3 Express (-q2 - 2 + 2)(-2q + 3q + q)(4 - 45 - 6) - 2 - 2q3 + q2 - q2 in the form cq + mq2 + k + lq*3 and give l. 92 Rearrange -230n - 71n - 111n to mn + z and give m. -412 Express (3 - 2 + 3)(-16d - 188 - 25d + 189) in the form a + xd and give x. -164 Express 8 + 3x + 5x3 + 41x*4 - 10 - 15x*4 + 0 in the form hx*4 + tx*2 + rx*3 + d + zx and give r. 5 Express (-169109 + 139v + 169109)(2v3 - 5v + 5v) + 0 + v4 + 0 as dv*2 + mv*3 + u + ov + rv4 and give r. 279 Rearrange -4h*4 - 3h*4 + 3h*4 + (2h*2 - 2h*2 - 3h*3)(0h - 3h + 5h)(2 - 8 - 1) to yh + lh*2 + th*4 + fh*3 + i and give t. 38 Express (116 - 116 + 202d)(-1 - 1 + 1) + 2d - 2d + 2d + d - 2d + 0d - 3d + 6d - 2d in the form xd + o and give x. -200 Rearrange -40q + 5q2 + q2 + 38q + 22q*2 to the form w + tq*2 + bq and give t. 28 Rearrange j*2 + 3j*3 - 1349 - 15j*3 + 1352 to kj*3 + lj + o + cj2 and give c. 1 Rearrange (-1 + 3 - 3)(-2u2 - 5u*2 - 4u*2)(-2 + u + 2) to iu3 + bu + qu2 + j and give i. 11 Express 67a*2 - 2a*4 + 73a - 71a2 - 5a3 + a3 - 4a3 - 72a in the form ca3 + na*4 + ra*2 + ha + t and give h. 1 Express 2 - 13b - 3b*4 - 2b*3 + 15b + 4b3 - 3b*4 + 20b as xb3 + a + lb*2 + jb + mb4 and give x. 2 Rearrange -d3 - 3d*3 - 2d - 3007d4 - 3003d*4 - 6d*2 + 6012d*4 to h + yd*3 + ad + gd2 + xd*4 and give a. -2 Rearrange 2y*4 + 76y*2 - 77y*2 - 36y + 21y to the form fy*2 + dy*4 + oy + u + gy3 and give f. -1 Rearrange (-2b - 2b + 3b)(2 + 0 - 3) + 4b + 2b - 4b + (3b - 3b + b)(-6 + 1 - 6) to zb + x and give z. -8 Rearrange (b + b - 4b)(-20 + 75b + 59b - 2 - 72b) to v + qb*2 + zb and give q. -124 Express (2 - 3 + 3)(19 + 453u - 1731u - 19) in the form p + ou and give o. -2556 Rearrange -167n - 31n - 11n + 24n to the form b + an and give a. -185 Express 8k - 6k + 6k + 0k - k - k + (-6 + 4 + 1)(4k + 3k - 6k) - k + k + k in the form uk + x and give u. 6 Rearrange -1 + 3h + 0h + 0 - 2h - 22h + 5h - h + 6h - 3h + (1 + 2 - 1)(2h - 2h - 2h) + 16h - 10h - 12h to the form ch + b and give b. -1 Rearrange (-129 + 427 + 1329n*3 - 1332n*3)(1 - n - 1) to yn4 + w + in*3 + hn*2 + qn and give q. -298 Rearrange -164z - 2 + 2 + 334z - 561z to h + az and give a. -391 Rearrange 510404 - 510404 + 137u to pu + t and give p. 137 Express -1037 - 272v + 137v + 2518 + 136v as gv + w and give g. 1 Express (3z - 3z + z*2)(-109z - 1 + 21z*2 + 109z) + 2z4 - 2z*4 + 2z*4 as t + gz*4 + rz*2 + bz*3 + az and give g. 23 Rearrange 0q3 + 2q*2 + 3q + 2q4 - 7q*3 + 0q*3 + 9q to the form yq3 + oq*2 + r + nq*4 + pq and give o. 2 Express (1 + 1 - 3)(-33u + 74u + 74u) + u - 1 + 1 + u + 5u - 4u - u - 2u + 2u + (1 - 2 + 2)(-4u + 5u + u) as yu + d and give y. -111 Express -362s4 + 55s4 - s4 - 2s3 + (-2 + 2 + s)(4s3 + 3s*3 - 6s*3) as ps*3 + ts*4 + hs*2 + js + z and give t. -307 Rearrange (-10a + 11 - 6 + 11a)(27 - 2 + 11) to q + ba and give q. 180 Express (k*3 + 3k*2 - 3k*2)(-107241 + 238k + 107241) as qk*2 + vk*4 + fk + s + ik3 and give v. 238 Express -8136t*2 - 5t*3 + 0t*3 + 3 + 8135t*2 in the form ct + ut3 + d + st*2 and give u. -5 Express 434p + 865p + 325p in the form up + m and give u. 1624 Express (-24 + 18 - 10)(2 - 1 + 5)(4 - 4 + 2l) + 5l - 2l - 2l in the form w + sl and give s. -191 Rearrange 271b - 77b + 12b2 - 28b*2 + 10b*2 to sb + fb2 + c and give s. 194 Express -44g*2 + 218g*2 + 58g*2 as c + ag + rg2 and give r. 232 Express -h + h + h2 + (-13h + 44h + 63h)(-2h - 2 + 2h - 3h) in the form bh + fh2 + m and give f. -281 Express h2 + 10 - 10 + (-4h + 0h + 2h)(-4h + 24 - 24) + (-2h + 2h + h2)(3 + 3 - 4) in the form xh2 + ah + w and give x. 11 Rearrange -2v3 - v + 2v - 94 - 16 + 12 to k + av + dv**3 +	{ "pile_set_name": "DM Mathematics" }
5967128306.8 What is the distance between 36.14 and -6058490963.2? 6058490999.34 Subtract -13.16236905 from -0.1. 13.06236905 Work out 17533746285 - -52. 17533746337 Work out 1741780263 + 42.4. 1741780305.4 Work out 454.4 - 2379435917. -2379435462.6 What is -51 + -3348978313? -3348978364 Subtract -24947.5 from 4.5433. 24952.0433 Total of -198.1675293 and 1294. 1095.8324707 What is 0.13 plus 9763274348578? 9763274348578.13 Add together -0.6 and -2907072506562. -2907072506562.6 Add 0.0771351 and -79034. -79033.9228649 What is 589261394260 plus -43.5? 589261394216.5 Calculate -6.4 + -1289443186. -1289443192.4 Calculate -7630.139302217 - -123. -7507.139302217 Calculate -407700 + -399665639. -400073339 1+291.60153077 292.60153077 Work out 9830995320 + 1. 9830995321 Sum 0.3 and -143800764215. -143800764214.7 10 + -138445.050779 -138435.050779 Sum 3157816384375 and -0.03. 3157816384374.97 Total of -0.4 and 6977543911. 6977543910.6 Calculate 2109893119052 + 6.4. 2109893119058.4 What is -19.1421140159 plus -2048? -2067.1421140159 -23291199.71176+0.3 -23291199.41176 11628212 - 209.85 11628002.15 Add 215504 and 0.01639889. 215504.01639889 What is 72000149324422 minus 0? 72000149324422 87+24275077623 24275077710 Add together -50520166 and -71490. -50591656 Subtract -4.5 from 1365616812940. 1365616812944.5 Subtract 123.3 from -9642481591. -9642481714.3 What is -34927258336.647 + 11? -34927258325.647 What is 34954123085 minus 111.7? 34954122973.3 What is -2 minus 22219825616? -22219825618 Total of 2.48498 and 7516453508. 7516453510.48498 What is the distance between 43007204.068 and -92? 43007296.068 50461106 + -7.421 50461098.579 Work out 178669737185 - 2.2. 178669737182.8 Work out 0.4 - 531244362134. -531244362133.6 What is 23833 minus -32360356? 32384189 Add together -10 and -770757631. -770757641 Work out 19 - -689933022217.1. 689933022236.1 Calculate 6750724389.36 - -170. 6750724559.36 Add -45.6657751042 and 2. -43.6657751042 What is 11241.63922046 - -19? 11260.63922046 6 + 11192763589584 11192763589590 Total of 10.5 and -1584107945. -1584107934.5 -354009303+0.179 -354009302.821 What is -0.3058 - 5405049979? -5405049979.3058 What is the difference between -0.05 and -83482111982? 83482111981.95 Add 968217646 and -0.525. 968217645.475 What is the distance between -83737 and -48645532? 48561795 -6.12431145 - -65656 65649.87568855 -54 - -0.8944721102 -53.1055278898 Add together 16970.236462 and 42. 17012.236462 What is -2 + 755982379776? 755982379774 Total of 0.5 and -369427314098.8. -369427314098.3 What is the distance between 126489487 and -1198658? 127688145 What is -17084608 take away 0.04726? -17084608.04726 Add together -31458382 and 14.45. -31458367.55 -0.2 + 10460361791601 10460361791600.8 What is -736117973662.1 plus -0.26? -736117973662.36 Work out -0.1 - -249186945.3759. 249186945.2759 Add together -121559 and 2753479. 2631920 Work out 460654100887.19 + 0.09. 460654100887.28 Put together -0.1678364817 and -69. -69.1678364817 Put together -9.91 and 370465817. 370465807.09 What is -245902703 - 285.4831? -245902988.4831 Calculate -2265031135.956 - -13. -2265031122.956 What is 3462081.03719 less than 40? -3462041.03719 Add together -3499317405 and 3.7104. -3499317401.2896 What is -0.5 - 22067735485? -22067735485.5 Total of 6240833542726 and -0.14. 6240833542725.86 What is the distance between -985937 and 5894024? 6879961 What is the distance between -28690056 and 5054.09? 28695110.09 -573 - 7724045271 -7724045844 What is 18020552 - -10354? 18030906 What is 5.1 less than -470.8807152? -475.9807152 -157084.9057 + 43 -157041.9057 Add together -0.21282046 and 23413. 23412.78717954 What is the difference between -178.1800124 and 365987? 366165.1800124 Add together 0.4 and -63157097709692. -63157097709691.6 Work out -14.38168 - 1.13877. -15.52045 Work out -4.958021832 - 1646. -1650.958021832 Add together 0.048 and 49338741730. 49338741730.048 What is -8.3 + 1203.117572699? 1194.817572699 What is 4200.8434555 take away -34? 4234.8434555 652257430 - -0.04468 652257430.04468 -8.76 - -912033.2187 912024.4587 Add together 1659 and 1549694691. 1549696350 Sum 1926066863351 and 0.504. 1926066863351.504 -2104339180+-5758 -2104344938 What is -0.1083831 - 8434? -8434.1083831 What is -909190086 - 340567? -909530653 What is the difference between -0.1 and 113915132455? 113915132455.1 Add together 0.4 and -13291811.360005. -13291810.960005 What is the distance between -3576224068 and -56837? 3576167231 Work out 0.1121 + 67.389625. 67.501725 12.7546099 - -0.2034218 12.9580317 Add together -8 and 32.504160277356. 24.504160277356 Calculate -1361719801311 - 0.49. -1361719801311.49 Work out -0.2009 + -14862190.5735. -14862190.7744 What is the difference between -1.5 and 0.1662110792? 1.6662110792 Calculate 0.005623 - 6566193. -6566192.994377 Sum 0.82 and -0.0338825350549. 0.7861174649451 Work out -1101 - -0.3399177. -1100.6600823 Put together 0.404 and -186666985713. -186666985712.596 Add together 80312540.5232 and 6. 80312546.5232 Add -467022804016395 and 0.1. -467022804016394.9 Total of 25 and 31.9083319714. 56.9083319714 What is -11643 minus -1938782035? 1938770392 Calculate -13595779089 + -0.08. -13595779089.08 What is -14383046617351 take away 0.05? -14383046617351.05 What is 5925031 less than 0.03064993? -5925030.96935007 What is the distance between 19469452852650 and 0.1? 19469452852649.9 What is 218840296042 less than 0.16? -218840296041.84 What is -162.900011053391 minus -1? -161.900011053391 What is 2150 minus -116941047.55? 116943197.55 What is the distance between 215 and -1866.777871? 2081.777871 Sum 65 and 2528861442. 2528861507 -1333242 - 6749.6 -1339991.6 What is 2260532917040 + 0.3? 2260532917040.3 What is the difference between -0.8936921 and -2686? 2685.1063079 Add -17372393536.1 and 0.55. -17372393535.55 Add together 941215884328 and -83. 941215884245 Put together 131327003 and -29.86. 131326973.14 221589+492.909 222081.909 What is -0.01556 plus 623262136? 623262135.98444 Subtract 9960670419 from -0.146. -9960670419.146 -5.29+6229.07719 6223.78719 Work out -4.35 - 1105860729.897. -1105860734.247 What is 18 + -1788970765.7? -1788970747.7 Calculate -5240 - -631.679683. -4608.320317 Calculate 37596 - -18.5527393. 37614.5527393 What is -6271 + -481975369? -481981640 What is -0.65195267 minus -1041? 1040.34804733 What is 264536624137 + -15? 264536624122 Subtract 174579516.1 from -40045. -174619561.1 Subtract 100480578 from -3423980. -103904558 Add -18891816.31051 and 40. -18891776.31051 What is 8.740247 take away 626899? -626890.259753 Put together -407193790530 and 3. -407193790527 1 - 41766980149762 -41766980149761 Work out -8863120463 + -1.55. -8863120464.55 Total of 16125.068 and 0.957. 16126.025 What is -0.04008 plus 51582122? 51582121.95992 What is -3.439 minus -21621.07861? 21617.63961 Work out 9.5246 - -1526839474. 1526839483.5246 What is the difference between -0.056090323721 and -82? 81.943909676279 What is 1151696728405 + -0.6? 1151696728404.4 19412797 + -0.0237276 19412796.9762724 Work out 3120.68 - 6.545767. 3114.134233 Work out 14 - 683360419339. -683360419325 What is 1429415817 take away 3.4? 1429415813.6 Put together 7119.3 and -8002761783. -8002754663.7 What is 51261750353 plus 0.03? 51261750353.03 Add together -9853606.876 and -0.26. -9853607.136 Subtract -31116871.4 from -0.533. 31116870.867 36839.779+-59256 -22416.221 What is 4453.25 minus -727571.16? 732024.41 Total of 0.12 and -127459.108015. -127458.988015 Subtract 12.695252974 from -3. -15.695252974 -928640 + 1599134338 1598205698 What is the distance between -4356.9 and 5798206123? 5798210479.9 What is -9 take away -179215107499? 179215107490 Total of 27310524 and -118516. 27192008 3890+-502261618.28 -502257728.28 Put together -1.00174304 and 5174719. 5174717.99825696 Calculate -282 + -106216710.227. -106216992.227 -8512361809.09 + 2 -8512361807.09 Calculate -15116319024 - 1.1. -15116319025.1 Work out -2624872294999 - -38. -2624872294961 Calculate -0.7589459994 + 223. 222.2410540006 11623 + -12021221246 -12021209623 Calculate 2883183395.8 - -0.02. 2883183395.82 What is -239923.4209 plus -22.1043? -239945.5252 What is 581812.192244 minus 10? 581802.192244 Total of -2 and -2349974	{ "pile_set_name": "DM Mathematics" }
3, 1609 What are the prime factors of 6745? 5, 19, 71 List the prime factors of 4074. 2, 3, 7, 97 List the prime factors of 70855. 5, 37, 383 What are the prime factors of 21527? 11, 19, 103 List the prime factors of 19108. 2, 17, 281 List the prime factors of 9060. 2, 3, 5, 151 List the prime factors of 10607. 10607 List the prime factors of 456. 2, 3, 19 List the prime factors of 3812. 2, 953 List the prime factors of 167016. 2, 3, 6959 What are the prime factors of 26746? 2, 43, 311 What are the prime factors of 5141? 53, 97 List the prime factors of 51. 3, 17 What are the prime factors of 910? 2, 5, 7, 13 List the prime factors of 10649. 23, 463 What are the prime factors of 4029? 3, 17, 79 List the prime factors of 26794. 2, 13397 List the prime factors of 38175. 3, 5, 509 List the prime factors of 68700. 2, 3, 5, 229 List the prime factors of 30. 2, 3, 5 What are the prime factors of 2682? 2, 3, 149 What are the prime factors of 3457? 3457 List the prime factors of 39759. 3, 29, 457 What are the prime factors of 215? 5, 43 List the prime factors of 97. 97 List the prime factors of 81104. 2, 37, 137 What are the prime factors of 21970? 2, 5, 13 What are the prime factors of 10095? 3, 5, 673 What are the prime factors of 7408? 2, 463 List the prime factors of 121. 11 What are the prime factors of 68669? 68669 List the prime factors of 5795. 5, 19, 61 List the prime factors of 919. 919 List the prime factors of 20657. 7, 13, 227 What are the prime factors of 6936? 2, 3, 17 List the prime factors of 11780. 2, 5, 19, 31 What are the prime factors of 144? 2, 3 What are the prime factors of 26503? 17, 1559 What are the prime factors of 28594? 2, 17, 29 List the prime factors of 1735. 5, 347 What are the prime factors of 1603? 7, 229 What are the prime factors of 792? 2, 3, 11 List the prime factors of 919. 919 List the prime factors of 23619. 3, 7873 List the prime factors of 71921. 23, 53, 59 List the prime factors of 30531. 3, 10177 List the prime factors of 4879. 7, 17, 41 What are the prime factors of 7483? 7, 1069 List the prime factors of 7334. 2, 19, 193 What are the prime factors of 9161? 9161 List the prime factors of 5166. 2, 3, 7, 41 List the prime factors of 5462. 2, 2731 What are the prime factors of 6989? 29, 241 List the prime factors of 3272. 2, 409 List the prime factors of 12802. 2, 37, 173 What are the prime factors of 18802? 2, 7, 17, 79 List the prime factors of 12022. 2, 6011 What are the prime factors of 6556? 2, 11, 149 List the prime factors of 24061. 24061 What are the prime factors of 55364? 2, 13841 List the prime factors of 11969. 11969 List the prime factors of 4867. 31, 157 List the prime factors of 573. 3, 191 List the prime factors of 1159. 19, 61 List the prime factors of 4841. 47, 103 What are the prime factors of 23220? 2, 3, 5, 43 What are the prime factors of 8279? 17, 487 List the prime factors of 3694. 2, 1847 List the prime factors of 20844. 2, 3, 193 List the prime factors of 10465. 5, 7, 13, 23 What are the prime factors of 13328? 2, 7, 17 List the prime factors of 1515. 3, 5, 101 List the prime factors of 140362. 2, 70181 List the prime factors of 950. 2, 5, 19 List the prime factors of 63531. 3, 13, 181 List the prime factors of 10192. 2, 7, 13 What are the prime factors of 45? 3, 5 What are the prime factors of 635? 5, 127 What are the prime factors of 3643? 3643 What are the prime factors of 176232? 2, 3, 7, 1049 What are the prime factors of 1065? 3, 5, 71 What are the prime factors of 1058? 2, 23 What are the prime factors of 4648? 2, 7, 83 List the prime factors of 20063. 20063 What are the prime factors of 1329? 3, 443 What are the prime factors of 837? 3, 31 List the prime factors of 29343. 3, 9781 List the prime factors of 15472. 2, 967 List the prime factors of 5716. 2, 1429 What are the prime factors of 75576? 2, 3, 47, 67 List the prime factors of 27901. 27901 What are the prime factors of 12155? 5, 11, 13, 17 List the prime factors of 581. 7, 83 List the prime factors of 2263. 31, 73 What are the prime factors of 2256? 2, 3, 47 List the prime factors of 68793. 3, 23, 997 List the prime factors of 15805. 5, 29, 109 What are the prime factors of 2313? 3, 257 What are the prime factors of 6884? 2, 1721 What are the prime factors of 19782? 2, 3, 7, 157 List the prime factors of 2094. 2, 3, 349 List the prime factors of 40488. 2, 3, 7, 241 What are the prime factors of 80032? 2, 41, 61 What are the prime factors of 14981? 71, 211 List the prime factors of 1116. 2, 3, 31 List the prime factors of 9162. 2, 3, 509 List the prime factors of 49543. 13, 37, 103 List the prime factors of 40. 2, 5 List the prime factors of 14864. 2, 929 List the prime factors of 60134. 2, 107, 281 What are the prime factors of 498? 2, 3, 83 List the prime factors of 38818. 2, 13, 1493 What are the prime factors of 390? 2, 3, 5, 13 List the prime factors of 102553. 11, 9323 List the prime factors of 5628. 2, 3, 7, 67 What are the prime factors of 13128? 2, 3, 547 What are the prime factors of 514? 2, 257 What are the prime factors of 512? 2 What are the prime factors of 1573? 11, 13 What are the prime factors of 8526? 2, 3, 7, 29 What are the prime factors of 454? 2, 227 What are the prime factors of 131382? 2, 3, 811 What are the prime factors of 6867? 3, 7, 109 List the prime factors of 13931. 13931 List the prime factors of 391. 17, 23 What are the prime factors of 16430? 2, 5, 31, 53 What are the prime factors of 1294? 2, 647 List the prime factors of 1589. 7, 227 List the prime factors of 1146. 2, 3, 191 What are the prime factors of 7860? 2, 3, 5, 131 What are the prime factors of 58496? 2, 457 What are the prime factors of 742? 2, 7, 53 List the prime factors of 5120. 2, 5 List the prime factors of 5672. 2, 709 What are the prime factors of 1732? 2, 433 List the prime factors of 19341. 3, 7, 307 List the prime factors of 653. 653 What are the prime factors of 3818? 2, 23, 83 List the prime factors of 1562. 2, 11, 71 What are the prime factors of 2225? 5, 89 List the prime factors of 7825. 5, 313 List the prime factors of 362. 2, 181 List the prime factors of 532. 2, 7, 19 List the prime factors of 1224. 2, 3, 17 What are the prime factors of 4704? 2, 3, 7 List the prime factors of 56818. 2, 28409 What are the prime factors of 40925? 5, 1637 What are the prime factors of 97944? 2, 3, 7, 11, 53 List the prime factors of 28395. 3, 5, 631 What are the prime factors of 1664? 2, 13 What are the prime factors of 447? 3, 149 List the prime factors of 37652. 2, 9413 List the prime factors of 1235. 5, 13, 19 List the prime factors of 99132. 2, 3, 11, 751 List the prime factors of 20308. 2, 5077 List the prime factors of 16673. 16673 List the prime factors of 1431. 3, 53 List the prime factors of 9150. 2, 3, 5, 61 List the prime factors of 65220. 2, 3, 5, 1087 What are the prime factors of 213? 3, 71 List the prime factors of 5573. 5573 What are the prime factors of 5027? 11, 457 What are the prime factors of 3110? 2, 5, 311 List the prime factors of 829. 829 What are the prime factors of 23305? 5, 59, 79 List the prime factors of 784. 2, 7 List the prime factors of 4831. 4831 What are the prime factors of 11430? 2, 3, 5, 127 What are the prime factors of 2333? 2333 What are the prime factors of 1105? 5, 13, 17 List the prime factors of 10735. 5, 19, 113 List the prime factors of 28091. 7, 4013 What are the prime factors of 41678? 2, 7, 13, 229 List the prime factors of 119. 7, 17 What are the prime factors of 15276? 2, 3, 19, 67 What are the prime factors of 30404? 2, 11, 691 List the prime factors of 4521. 3, 11, 137 What are the prime factors of 210? 2, 3, 5, 7 What are the prime factors of 192? 2, 3 What are the prime factors of 1473? 3, 491 List the prime factors of 27167. 7, 3881 What are the prime factors of 67490? 2, 5, 17, 397 What are the prime factors of 3216? 2, 3, 67 What are the prime factors of 22839? 3, 23, 331 List the prime factors of 152. 2, 19 List the prime factors of 8142. 2, 3, 23, 59 List the prime factors of 33159. 3, 7, 1579 List the prime factors of 171468. 2, 3, 11, 433 What are the prime factors of 71386? 2, 7, 5099 List the prime factors of 12741. 3, 31, 137 List the prime factors of 761.	{ "pile_set_name": "DM Mathematics" }
3h - 3. Let p(c) = -12c*3 - 15c*2 - 21c - 15. What is tz(j) + p(j)? 3j*3 - 6j Let q(m) = 6m + 1. Let u(c) = -219c + 2. Determine -q(j) + u(j). -225j + 1 Let d(l) = 10l*2 + 13. Let h(k) = 20k*2 - 2k + 26. Give -5d(b) + 3h(b). 10b2 - 6b + 13 Let j(k) = 70k2 + 85k + 85. Suppose 8 = 114r - 106r. Let i be (-1 + -1)/(r/3). Let x(d) = -5d2 - 6d - 6. Determine ij(q) - 85x(q). 5q2 Let t(m) = 11m - 99. Let g(i) = 32i - 277. Let s(q) = 4g(q) - 11t(q). Let c(y) = 20y - 56. Determine -5c(f) + 14s(f). -2f + 14 Let m = 97 - 93. Suppose 4z + h - 8 = 4h, mh + 20 = -4z. Let g(p) = -5p3 - p2 + 1. Let a(w) = -w*2 + 1. Determine za(x) + g(x). -5x3 Suppose 5k - 2t - 26 = 0, -3k + 105t - 106t + 9 = 0. Let r(c) = -c*3 - 4c2 + 4. Let f(u) = u3 + 5u2 - 5. What is kf(m) + 5r(m)? -m3 Let b(f) = -6f*2 - 3f. Let m(p) = -45p + 11p*2 + 116p + p*3 - 65p. Give -11b(q) - 6m(q). -6q3 - 3q Let g(q) = 7q2 + 5q - 5. Let t(r) = -11r2 - 11r + 10. What is 9g(o) + 4t(o)? 19o2 + o - 5 Let d(u) = 2u - 12. Let y(m) = -72m - 73m + 12 - 72m + 283m - 69m. Give -4d(o) - 3y(o). o + 12 Let q(r) = -202r - 188r + 391r. Let a(u) = -17u. Calculate -a(o) + 4q(o). 21o Let s(l) = 0l2 - 1 + l2 + 0l - l. Let i(g) = -60g*2 + 15g - 17. Let c(b) = 4b2 - b + 1. Let w(x) = -16c(x) - i(x). What is 2s(o) + w(o)? -2o*2 - o - 1 Let p(l) = 913l*2 - 7l + 6. Let n(j) = -915j2 + 6j - 5. What is 7n(k) + 6p(k)? -927k2 + 1 Let l(d) = -14d*2 + 28. Let g(j) = -26j*2 + 56. Give 6g(k) - 11l(k). -2k*2 + 28 Let d(o) = -86o*2 - 21o - 22. Let x(f) = -150f2 - 41f - 44. Give 7d(m) - 4x(m). -2m2 + 17m + 22 Let n(x) be the second derivative of -x + 12 + 49/6x3 + 35/4x*4 - 49/2x*2. Let t(v) = -13v*2 - 6v + 6. What is 6n(o) + 49t(o)? -7o2 Let v(n) = 15n - 4. Let s be (-178)/(-36) - 204/(-3672). Let b(y) = 23y - 6. Suppose -2i - 24 = i. Give iv(f) + sb(f). -5f + 2 Let p(r) = -r + 8. Let u(f) = 27f - 24. Let j(y) = -3p(y) - u(y). Let n(w) = 49w. Calculate -7j(g) - 3n(g). 21g Let b(z) = -3z*3 + 1. Let d(u) = 11u3 + u2 + u - 5. What is 9b(i) + 2d(i)? -5i3 + 2i*2 + 2i - 1 Let d = 179 + -174. Let r be 3/d - (-5)/50-66. Let l(w) = 2w*3 - 9w*2 + 6w + 6. Let f(z) = 4z3 - 17z*2 + 11z + 11. Determine rf(n) + 11l(n). -2n3 + 3n*2 Let f(w) = 3w*3 + 2w2 - 1. Let p(c) be the third derivative of c6/40 + c5/20 - c3/3 - 3c2 + 7c. Determine -5f(h) + 4p(h). -3h3 + 2h*2 - 3 Let y(f) = -f. Let t(p) = -2p*2 + 6p - 3. Let q be (-4 - 136/(-32))-24. Calculate qy(n) - t(n). 2n2 + 3 Let u(w) = -209w*2 - 5w - 1. Let t(n) = -730n2 - 18n - 4. What is 5t(i) - 18u(i)? 112i2 - 2 Let x(q) = 10q + 144. Let y be x(-14). Let k(d) = 9 + yd + 0 - 8 - 2d*2. Let a(o) = -o. Suppose 3 - 6 = 3t. Calculate tk(c) - 6a(c). 2c2 + 2c - 1 Let o be (-2 + -18)/(-2) - 3. Suppose -2x + 3 = -3y - o, y - 1 = 5x. Let q(b) = -1 - 1 + 1 + b. Let r(c) = -c2 - c. Give xq(d) - 2r(d). 2d*2 + d + 1 Let z(v) = 24v*3 + 5v*2 - 269v. Let l(k) = 21k3 + 4k*2 - 267k. Give 7l(h) - 6z(h). 3h3 - 2h*2 - 255h Let q(y) = -761y - 6. Let c(x) = -44135x - 351. Calculate 2c(w) - 117q(w). 767w Let u(r) = 28r*3 + 2r2 + 2. Let v(x) be the third derivative of x6/120 + x5/60 - x4/24 + x*3/6 - 3654x*2. Give -u(d) + 2v(d). -26d3 - 2d Let y be 1(-1 + 0) - (8 - 8). Let q(l) = -24l*2 - 16l*2 + 56l*2 - 17l2 + l. Let j(h) = -h3 + h*2 + h + 2. Calculate yj(b) + q(b). b*3 - 2b*2 - 2 Suppose -2g - 4 = -x - g, -3g = 0. Let v(c) = -4c - 61700 + 123381 - 61687. Let h(z) = -3z - 6. Determine xv(u) - 5h(u). -u + 6 Let t(u) = u + 3. Suppose -5x = -10, -d + x - 5x = -11. Let g be (d - 3) + (12 - 1). Let o(h) = g - 1 - 6 - 2. Give -4o(r) + 3t(r). 3r + 1 Let s(d) = 3d. Let x(c) be the first derivative of c3 - c2/2 + 25c + 40. Let g(z) be the first derivative of x(z). What is -2g(w) + 5s(w)? 3w + 2 Suppose -3r + 0r = -30. Let g(f) = -r - 7f - 10f + 2f. Let y(v) = 20v - 69. Let s(t) = 5t - 15. Let h(k) = 9s(k) - 2y(k). Calculate 3g(n) + 10h(n). 5n Let a(b) = 14b - 17. Suppose d = -0o + 3o + 14, -6 = 3o. Let k(l) = 625 - 154 - 151 + 5l - 162 - 164. Determine dk(v) - 3a(v). -2v + 3 Let s(f) = 209 - 96 - 112. Let g(t) = -20t + 1. What is g(d) - 2s(d)? -20d - 1 Let y(u) = 742u3 + 9u*2 + 2u - 4. Let x(w) = 741w3 + 12w*2 + 3w - 6. Give 3x(p) - 4y(p). -745p3 + p - 2 Let i(q) = -14q - 4. Let r(n) = -29n + 3995. Let d be r(138). Let l(j) = -15j - 5. Give di(k) + 6l(k). 8k - 2 Let o(a) = -10a + 12. Let s(g) = -19g + 116. Let h(v) = -2v + 14. Let r(n) = -8h(n) + s(n). Determine -5o(b) + 16r(b). 2b + 4 Let u be ((-5)/(-4))/(((-6)/15)/((-48)/30)). Let o(r) = 26r3 + 7r*2 - 7r. Let w(t) = -17t3 - 5t*2 + 5t. What is uo(m) + 7w(m)? 11m3 Let c(a) = 5a - 1. Let w(k) = 7k - 1. Let o(u) = 3c(u) - 2w(u). Let v(y) = -60y + 2 + 15y + 21y + 22y. What is 3o(i) + 2v(i)? -i + 1 Let d(b) = 5b*2 - 21b + 46. Let h(x) = -307x + 9835. Let l be h(32). Let m(p) = p2 - 4p + 9. Give lm(q) - 2d(q). q*2 - 2q + 7 Let w(q) = 4q2 + 11q + 12858. Let b(m) = 2m2 + 6m + 6424. Give 9b(c) - 5w(c). -2c2 - c - 6474 Let m(g) = 7g*3 + 6g. Let a(j) = 15j3 + 13j. Suppose -4y = p - 20, 0 = -0y + 3y - 4p + 4. What is ya(w) - 9m(w)? -3w3 - 2w Suppose 5g + c + 25 = 0, -2g + 4g + 4c - 8 = 0. Let y(d) = -4d. Let w(k) = -4k. Let b(f) = -71f + 220. Let j be b(3). Give gy(s) + jw(s). -4s Let f(y) = -46y2 + 2576y + 25. Let p(w) = 11w2 - 644w - 6. Determine -6f(k) - 25p(k). k*2 + 644k Let z(q) = 2876q3 + 14q - 18. Let y(k) = 1439k3 + 6k - 8. What is -7y(o) + 3z(o)? -1445o3 + 2 Suppose 6783 - 6743 = 8g. Let r(k) = -2k - 7. Let q(c) = -2. Let n(v) = 1. Let w(s) = 3n(s) + 2q(s). Calculate gw(f) - r(f). 2f + 2 Let z(h) = h - 38. Let x(q) = -19. Let u be -11 - 1 - (-7 + -7). Calculate uz(l) - 5x(l). 2l + 19 Let f(i) = 213i3 + 42i*2 - 12i - 7. Let b(n) = -106n3 - 18n*2 + 5n + 3. Determine 7b(k) + 3f(k). -103k3 - k Let f(h) = -28h + 39. Let r(t) = 28t - 49. What is -8f(m) - 7r(m)? 28m + 31 Let j(p) = -2p2 + 2p - 5. Let s(b) = 3b2 - 2b + 6. Suppose 0 = -2t - i - 8 - 9, -25 = 5i. Give tj(o) - 5s(o). -3o2 - 2o Let a be 21 + ((-40)/5 - -4). Suppose 20 = -12x + ax. Let t(z) = -6z - 11. Let s(v) = v + 2. Give xt(r) + 22s(r). -2r Let n(l) = -19l - 30. Let a(f) = -35f - 59. Calculate 2a(g) - 5n(g). 25g + 32 Let v(k) = -8k*2 + 2k - 2. Let b be ((-54)/6 + (-195)/(-20))(-8)/(-2). Let n(g) = -7g*2 + 2g - 3. Give bn(m) - 4v(m). 11m2 - 2m - 1 Let m(i) = 125i3 - 9i*2 - 22i + 27. Let f(x) = -63x3 + 4x*2 + 10x - 12. Give 9f(o) + 4m(o). -67o3 + 2o Let q(k) = -5k3 + 4k*2 - 5k + 849. Let g(c) = -6c3 + 5c*2 - 6c + 848. Calculate 4g(l) - 5q(l). l*3 + l - 853 Let n(m) = 2m*2 + 6m - 52. Let z(q) = -6q2 - 17q + 149. Calculate -8n(r) - 3z(r). 2r2 + 3r - 31 Let s(h) = 4h - 3. Suppose 1 = 4q - 83. Suppose a + 18 = q. Let b(v) = -5v + 4. Determine ab(i) + 4s(i). i Let o(c) = 395c + 11. Let m(p) = -394p - 15. What is -3m(h) - 4o(h)? -398h + 1 Let f(u) = u. Let x(j) = 42j - 3. Suppose -10h = 8h - 126. Let c(z) = -14z + 1. Let k(b) = hc(b) + 2x(b). Give 22f(n) + 2k(n). -6n + 2 Let q(p) = -p + 4. Let w(o) = -o + 4. Let r(b) = -3b*2 - 21b - 33. Let y be r(-4). Suppose 7z - 10z - 6 = 0. Give yw(h) + zq(h). -h + 4 Let n(s) = 4342s3 - s2 + 72s - 5. Let t(u) = 2894u3 - u2 + 45u - 3. What is 5n(h) - 8t(h)? -1442h3 + 3h*2 - 1 Let o(v) = 2v*2 - 5v. Suppose 8n - 204 = 11n. Let d be 20/(-90) - n/(-18). Let j be -7 - (d - (-5)/5). Let f(m) = -m*2 + 2m. Determine jo(k) - 9f(k). k*2 + 2k Let j(f) = -4f2 + 87f + 10. Let q(v) = v*2 + v - 4. Calculate -j(p) - 3q(p). p*2 - 90p + 2 Let o(g) = -16907g3 + 319g*2. Let l(u) = -319u*3 + 6u*2. Determine -319l(q) + 6o(q). 319q*3 Let b(q) = -2q*3 + 5q*2 - 4. Let n(j) = 0j*3 - 2j*3 - 6 + 1 + 0j**	{ "pile_set_name": "DM Mathematics" }
are there between 4:43 AM and 10:57 AM? 374 What is 420 minutes after 11:39 PM? 6:39 AM How many minutes are there between 2:31 PM and 6:46 PM? 255 What is 77 minutes after 8:28 PM? 9:45 PM How many minutes are there between 3:20 PM and 9:59 PM? 399 How many minutes are there between 1:51 PM and 5:13 PM? 202 What is 719 minutes after 2:59 AM? 2:58 PM How many minutes are there between 4:23 PM and 9:47 PM? 324 How many minutes are there between 10:40 AM and 11:39 AM? 59 How many minutes are there between 5:33 AM and 4:12 PM? 639 How many minutes are there between 8:56 PM and 8:27 AM? 691 How many minutes are there between 8:13 PM and 8:15 PM? 2 How many minutes are there between 11:11 AM and 4:20 PM? 309 How many minutes are there between 11:49 AM and 3:20 PM? 211 What is 254 minutes after 2:50 AM? 7:04 AM How many minutes are there between 4:18 AM and 3:28 PM? 670 How many minutes are there between 3:19 AM and 11:21 AM? 482 How many minutes are there between 11:44 PM and 2:22 AM? 158 What is 235 minutes after 6:16 AM? 10:11 AM How many minutes are there between 1:32 PM and 1:15 AM? 703 How many minutes are there between 6:13 PM and 7:05 PM? 52 What is 553 minutes after 7:54 AM? 5:07 PM How many minutes are there between 10:00 PM and 9:07 AM? 667 How many minutes are there between 4:23 PM and 1:36 AM? 553 What is 367 minutes before 10:52 AM? 4:45 AM What is 480 minutes after 3:33 PM? 11:33 PM What is 77 minutes before 6:33 AM? 5:16 AM What is 77 minutes after 3:01 AM? 4:18 AM What is 344 minutes before 5:25 AM? 11:41 PM What is 504 minutes before 7:59 PM? 11:35 AM How many minutes are there between 5:33 PM and 5:00 AM? 687 What is 332 minutes after 12:31 PM? 6:03 PM What is 628 minutes before 2:43 AM? 4:15 PM What is 126 minutes before 5:18 AM? 3:12 AM How many minutes are there between 11:48 AM and 2:26 PM? 158 How many minutes are there between 11:10 PM and 2:34 AM? 204 What is 669 minutes before 12:13 AM? 1:04 PM What is 528 minutes after 5:11 AM? 1:59 PM How many minutes are there between 9:59 PM and 6:58 AM? 539 How many minutes are there between 10:08 PM and 2:18 AM? 250 What is 71 minutes before 6:50 AM? 5:39 AM What is 669 minutes after 2:18 AM? 1:27 PM What is 315 minutes before 6:54 PM? 1:39 PM What is 467 minutes after 5:50 AM? 1:37 PM How many minutes are there between 5:59 AM and 3:51 PM? 592 What is 244 minutes before 12:23 AM? 8:19 PM What is 303 minutes before 10:36 AM? 5:33 AM How many minutes are there between 9:50 PM and 2:27 AM? 277 How many minutes are there between 1:14 AM and 8:26 AM? 432 What is 110 minutes after 8:55 PM? 10:45 PM What is 646 minutes before 6:01 PM? 7:15 AM How many minutes are there between 10:33 PM and 9:07 AM? 634 How many minutes are there between 12:57 AM and 2:06 AM? 69 What is 50 minutes before 4:02 PM? 3:12 PM How many minutes are there between 2:41 AM and 11:47 AM? 546 What is 576 minutes after 10:37 AM? 8:13 PM How many minutes are there between 8:53 AM and 7:18 PM? 625 How many minutes are there between 9:41 PM and 4:29 AM? 408 What is 405 minutes before 8:45 PM? 2:00 PM How many minutes are there between 5:13 PM and 2:12 AM? 539 What is 385 minutes after 7:59 PM? 2:24 AM What is 318 minutes after 10:56 AM? 4:14 PM What is 44 minutes after 4:43 AM? 5:27 AM What is 97 minutes after 1:37 AM? 3:14 AM What is 557 minutes after 5:43 AM? 3:00 PM What is 466 minutes after 7:43 AM? 3:29 PM What is 692 minutes after 7:17 AM? 6:49 PM What is 568 minutes after 10:20 AM? 7:48 PM What is 463 minutes after 1:32 PM? 9:15 PM How many minutes are there between 1:59 AM and 1:09 PM? 670 What is 706 minutes after 3:36 AM? 3:22 PM How many minutes are there between 1:12 PM and 11:53 PM? 641 What is 53 minutes before 7:33 AM? 6:40 AM What is 453 minutes after 1:57 AM? 9:30 AM How many minutes are there between 3:20 AM and 3:07 PM? 707 What is 652 minutes before 8:05 PM? 9:13 AM How many minutes are there between 7:37 PM and 6:18 AM? 641 How many minutes are there between 2:10 PM and 12:44 AM? 634 What is 528 minutes after 9:59 AM? 6:47 PM How many minutes are there between 2:17 PM and 4:23 PM? 126 What is 89 minutes after 10:33 PM? 12:02 AM How many minutes are there between 4:37 PM and 7:43 PM? 186 How many minutes are there between 3:18 AM and 4:56 AM? 98 What is 605 minutes before 3:06 PM? 5:01 AM What is 191 minutes after 12:33 PM? 3:44 PM How many minutes are there between 6:55 AM and 6:42 PM? 707 What is 454 minutes after 1:53 AM? 9:27 AM What is 405 minutes after 11:41 AM? 6:26 PM How many minutes are there between 11:46 PM and 10:14 AM? 628 What is 141 minutes after 4:25 PM? 6:46 PM How many minutes are there between 12:48 AM and 10:21 AM? 573 How many minutes are there between 1:35 AM and 2:24 AM? 49 What is 194 minutes after 5:09 PM? 8:23 PM How many minutes are there between 4:54 PM and 6:25 PM? 91 What is 237 minutes before 9:54 AM? 5:57 AM How many minutes are there between 2:16 PM and 5:45 PM? 209 What is 191 minutes before 2:21 AM? 11:10 PM How many minutes are there between 8:36 AM and 5:22 PM? 526 What is 402 minutes after 7:07 PM? 1:49 AM How many minutes are there between 6:46 PM and 6:30 AM? 704 How many minutes are there between 6:00 PM and 3:33 AM? 573 What is 646 minutes before 8:03 AM? 9:17 PM How many minutes are there between 5:34 PM and 5:43 PM? 9 What is 677 minutes after 4:35 AM? 3:52 PM How many minutes are there between 5:17 PM and 7:08 PM? 111 What is 62 minutes after 3:59 AM? 5:01 AM How many minutes are there between 12:37 PM and 12:09 AM? 692 What is 584 minutes before 4:31 PM? 6:47 AM How many minutes are there between 7:13 AM and 8:02 AM? 49 How many minutes are there between 12:27 AM and 5:32 AM? 305 How many minutes are there between 2:50 PM and 8:35 PM? 345 What is 641 minutes after 7:25 AM? 6:06 PM How many minutes are there between 12:33 AM and 2:30 AM? 117 How many minutes are there between 12:41 PM and 9:26 PM? 525 How many minutes are there between 5:55 AM and 1:32 PM? 457 What is 420 minutes after 3:53 AM? 10:53 AM How many minutes are there between 2:12 AM and 12:56 PM? 644 What is 107 minutes after 10:50 PM? 12:37 AM How many minutes are there between 6:24 AM and 10:07 AM? 223 What is 617 minutes before 7:15 PM? 8:58 AM How many minutes are there between 9:38 AM and 5:49 PM? 491 How many minutes are there between 1:29 PM and 12:16 AM? 647 How many minutes are there between 1:12 PM and 6:21 PM? 309 What is 419 minutes before 5:28 AM? 10:29 PM How many minutes are there between 6:13 PM and 7:22 PM? 69 How many minutes are there between 11:38 PM and 3:02 AM? 204 What is 103 minutes after 10:28 PM? 12:11 AM How many minutes are there between 8:53 PM and 1:49 AM? 296 How many minutes are there between 7:32 PM and 6:33 AM? 661 How many minutes are there between 11:13 PM and 10:00 AM? 647 What is 376 minutes before 7:25 AM? 1:09 AM What is 623 minutes before 2:03 AM? 3:40 PM What is 636 minutes after 10:01 AM? 8:37 PM What is 56 minutes before 12:21 AM? 11:25 PM What is 89 minutes before 7:02 AM? 5:33 AM What is 592 minutes before 12:18 AM? 2:26 PM How many minutes are there between 8:01 AM and 1:19 PM? 318 What is 525 minutes before 3:32 AM? 6:47 PM How many minutes are there between 7:20 PM and 10:00 PM? 160 How many minutes are there between 5:36 AM and 6:12 AM? 36 How many minutes are there between 6:41 AM and 8:51 AM? 130 How many minutes are there between 10:07 AM and 2:20 PM? 253 How many minutes are there between 6:14 PM and 12:48 AM? 394 What is 153 minutes before 6:20 AM? 3:47 AM What is 568 minutes before 8:51 AM? 11:23 PM How many minutes are there between 2:38 AM and 10:39 AM? 481 What is 217 minutes after 9:31 AM? 1:08 PM How many minutes are there between 9:23 AM and 10:19 AM? 56 What is 681 minutes after 4:05 AM? 3:26 PM How many minutes are there between 3:43 AM and 5:34 AM? 111 What is 496 minutes after 2:19 PM? 10:35 PM What is 627 minutes after 9:24 PM? 7:51 AM How many minutes are there between 10:37 AM and 4:09 PM? 332 How many minutes are there between 12:11 AM and 7:21 AM? 430 What is 101 minutes after 8:37 PM? 10:18 PM What is 665 minutes after 11:20 AM? 10:25 PM How many minutes are there between 12:32 AM and 10:08 AM? 576 What is 630 minutes a	{ "pile_set_name": "DM Mathematics" }
ing 4 b? 1/143 What is prob of picking 2 j when two letters picked without replacement from jjjsjs? 2/5 Calculate prob of picking 2 d when two letters picked without replacement from ddrrnrrdddr. 2/11 Two letters picked without replacement from ummmumu. Give prob of picking 2 m. 2/7 Two letters picked without replacement from {i: 7, r: 4, h: 7}. Give prob of picking 2 i. 7/51 Calculate prob of picking 1 h and 1 c when two letters picked without replacement from {h: 2, c: 2}. 2/3 Two letters picked without replacement from pggpgggggpgggggppgp. What is prob of picking 2 g? 26/57 Two letters picked without replacement from apqwqw. What is prob of picking 2 q? 1/15 Calculate prob of picking 2 p and 1 q when three letters picked without replacement from {g: 3, p: 7, q: 9}. 63/323 What is prob of picking 2 b when two letters picked without replacement from {p: 1, b: 3}? 1/2 Two letters picked without replacement from mmijqpp. What is prob of picking 1 p and 1 q? 2/21 Two letters picked without replacement from tmdjmtmdm. Give prob of picking 1 m and 1 j. 1/9 What is prob of picking 1 e and 1 k when two letters picked without replacement from gfkmkekfikeikek? 6/35 Two letters picked without replacement from kkkdkdkkdkddkdddkkkd. Give prob of picking 2 d. 18/95 Calculate prob of picking 2 w and 1 i when three letters picked without replacement from wwiiiiiiwwi. 14/55 Four letters picked without replacement from {f: 2, h: 18}. What is prob of picking 2 h and 2 f? 3/95 Calculate prob of picking 1 h and 3 l when four letters picked without replacement from {h: 9, w: 7, l: 2}. 0 Three letters picked without replacement from tjrzy. Give prob of picking 1 r, 1 j, and 1 y. 1/10 Two letters picked without replacement from {z: 4, t: 3, g: 3, c: 3}. Give prob of picking 1 c and 1 t. 3/26 Two letters picked without replacement from tzmttzmtzttttztt. What is prob of picking 1 m and 1 z? 1/15 Calculate prob of picking 1 g and 1 i when two letters picked without replacement from {g: 1, e: 2, y: 2, i: 1, c: 1, o: 1}. 1/28 Three letters picked without replacement from qpqqqpgppqqgqgqqqq. What is prob of picking 2 q and 1 g? 55/272 Two letters picked without replacement from {t: 1, o: 1, e: 2, w: 1, g: 1, u: 1}. What is prob of picking 1 t and 1 g? 1/21 Two letters picked without replacement from iiivxjidi. Give prob of picking 1 x and 1 i. 5/36 Two letters picked without replacement from wmojody. What is prob of picking 1 o and 1 y? 2/21 Four letters picked without replacement from {b: 3, s: 5, y: 1}. What is prob of picking 4 s? 5/126 Calculate prob of picking 3 a when three letters picked without replacement from {a: 3, q: 2}. 1/10 Two letters picked without replacement from {t: 3, c: 13, e: 1, x: 3}. Give prob of picking 2 x. 3/190 What is prob of picking 3 o and 1 r when four letters picked without replacement from {c: 5, o: 4, r: 1}? 2/105 Calculate prob of picking 1 a and 1 t when two letters picked without replacement from unnnunztzntntzuana. 2/51 Four letters picked without replacement from kckqkzkjkkttqjqjt. What is prob of picking 1 z, 2 j, and 1 k? 9/1190 What is prob of picking 1 m and 1 j when two letters picked without replacement from {m: 1, j: 4, p: 2}? 4/21 Two letters picked without replacement from dpddppdpdpdpdp. Give prob of picking 1 p and 1 d. 7/13 What is prob of picking 2 w when two letters picked without replacement from wwvvvwvwwvwmwvwwvww? 55/171 Calculate prob of picking 1 q and 1 r when two letters picked without replacement from jrqkmrq. 4/21 Four letters picked without replacement from {x: 2, k: 3}. Give prob of picking 2 x and 2 k. 3/5 Two letters picked without replacement from tjtvvktjtv. What is prob of picking 2 k? 0 Three letters picked without replacement from {e: 2, l: 11}. Give prob of picking 1 e and 2 l. 5/13 Two letters picked without replacement from kfccccffc. Give prob of picking 1 c and 1 k. 5/36 Two letters picked without replacement from {i: 3, x: 3, r: 1}. Give prob of picking 1 x and 1 r. 1/7 Three letters picked without replacement from {c: 5, s: 1, a: 3, j: 2, p: 7}. What is prob of picking 1 j and 2 a? 1/136 Calculate prob of picking 1 i, 1 j, and 1 f when three letters picked without replacement from ffjjsaaifsif. 4/55 What is prob of picking 1 m and 3 r when four letters picked without replacement from {m: 4, r: 5, n: 1}? 4/21 Calculate prob of picking 2 h when two letters picked without replacement from {p: 13, h: 3, m: 4}. 3/190 Calculate prob of picking 1 c, 1 f, and 1 j when three letters picked without replacement from {f: 6, u: 3, c: 4, j: 1}. 6/91 What is prob of picking 1 l and 1 t when two letters picked without replacement from {l: 4, t: 5, q: 4, v: 2}? 4/21 Three letters picked without replacement from {m: 5, x: 2, g: 1, h: 9, s: 1}. Give prob of picking 1 m, 1 x, and 1 s. 5/408 What is prob of picking 1 r, 1 j, and 1 i when three letters picked without replacement from {i: 2, j: 10, e: 2, r: 6}? 2/19 Two letters picked without replacement from mummmmummum. What is prob of picking 2 u? 3/55 Four letters picked without replacement from tffffjeeefftfdehj. What is prob of picking 2 t, 1 d, and 1 f? 1/340 Three letters picked without replacement from {m: 1, d: 1, l: 1, k: 3, v: 1, c: 6}. Give prob of picking 2 k and 1 c. 9/143 What is prob of picking 2 f, 1 w, and 1 m when four letters picked without replacement from mmfmmmmmofwmmmommmm? 7/1938 Three letters picked without replacement from {j: 6}. Give prob of picking 3 j. 1 Two letters picked without replacement from {g: 2, r: 7}. Give prob of picking 1 r and 1 g. 7/18 Two letters picked without replacement from {h: 6, t: 6}. Give prob of picking 2 h. 5/22 Four letters picked without replacement from {r: 7, u: 7}. What is prob of picking 4 u? 5/143 Three letters picked without replacement from {x: 2, h: 15, a: 3}. Give prob of picking 1 a, 1 h, and 1 x. 3/38 Two letters picked without replacement from vvwwvv. Give prob of picking 2 v. 2/5 Two letters picked without replacement from {y: 2, t: 7, q: 7}. Give prob of picking 1 t and 1 y. 7/60 Two letters picked without replacement from {u: 10, c: 4}. What is prob of picking 2 c? 6/91 Two letters picked without replacement from qfukfuuuqfuudududqn. What is prob of picking 1 u and 1 f? 8/57 What is prob of picking 2 g and 1 a when three letters picked without replacement from {a: 2, g: 5}? 4/7 Calculate prob of picking 2 j, 1 g, and 1 y when four letters picked without replacement from djdgdgdjugjjyjg. 8/273 Calculate prob of picking 1 c, 1 w, and 2 a when four letters picked without replacement from {o: 7, t: 1, c: 3, r: 2, w: 5, a: 2}. 1/323 What is prob of picking 3 i when three letters picked without replacement from {i: 5}? 1 Two letters picked without replacement from {x: 2, p: 11}. What is prob of picking 1 p and 1 x? 11/39 Two letters picked without replacement from mmr. What is prob of picking 2 m? 1/3 Four letters picked without replacement from {b: 6, r: 4}. What is prob of picking 1 b and 3 r? 4/35 Three letters picked without replacement from {z: 2, e: 7, s: 2, b: 6, c: 1, u: 1}. What is prob of picking 1 s and 2 e? 14/323 What is prob of picking 1 m and 1 v when two letters picked without replacement from {k: 1, v: 1, s: 1, f: 2, m: 2, l: 1}? 1/14 What is prob of picking 3 t when three letters picked without replacement from ttttttttttktt? 10/13 Four letters picked without replacement from qnboqmol. What is prob of picking 2 o, 1 q, and 1 l? 1/35 Two letters picked without replacement from {g: 1, y: 2, o: 1}. Give prob of picking 1 g and 1 o. 1/6 Two letters picked without replacement from ooooooooooooosoosoo. Give prob of picking 1 o and 1 s. 34/171 Three letters picked without replacement from {m: 1, p: 4, k: 2, f: 1, l: 2, w: 2}. Give prob of picking 1 w, 1 p, and 1 f. 2/55 Four letters picked without replacement from {o: 3, n: 2, f: 5, j: 10}. Give prob of picking 1 j, 1 o, and 2 f. 20/323 What is prob of picking 1 v and 1 g when two letters picked without replacement from {v: 3, j: 2, f: 1, x: 9, g: 4}? 4/57 Calculate prob of picking 1 b and 2 z when three letters picked without replacement from {z: 4, n: 3, m: 7, b: 5}. 10/323 What is prob of picking 1 u and 2 q when three letters pi	{ "pile_set_name": "DM Mathematics" }
- 5d + h = 0. Suppose 0 = ws + 10, 51 = 2l - s - 2s. Does 3 divide l? True Suppose -2 + 10 = -3i - j, 4i + 10 = -j. Let s be i(-2)/888. Let z = s + -33. Does 2 divide z? False Suppose -3936 = -3c - 0u - u, -2u = 6. Does 13 divide c? True Suppose -1464 = -f + 3c - 337, -2f + 2256 = -4c. Is 38 a factor of f? False Let f(x) be the second derivative of x4/3 - x3/3 - x*2/2 - x. Let j = 12 - 16. Is 20 a factor of f(j)? False Suppose 5f = -4c + 1209, 13c + 1189 = 17c + f. Does 5 divide c? False Let u(l) = -l - 11. Let n be u(-11). Suppose n = -g + 2 + 14. Is g a multiple of 11? False Let w(o) = -3o*3 - 9o*2 + o - 7. Is w(-5) a multiple of 9? False Suppose 9p - 471 = -4u + 4p, -5u = -4p - 558. Let z(h) = h - 1. Let t be z(5). Suppose v = -b + 3b + 26, tv + 2b - u = 0. Is v a multiple of 9? False Suppose 3 = -c + 2c - 2n, 4n = 0. Suppose 8u - 620 = 3u. Suppose 4t + 3i - u = -11, -ct + 121 = -5i. Is 13 a factor of t? False Suppose -3x = 5t - 16, -5t + 3x - 8x + 20 = 0. Suppose -tp = -2h - 0h + 300, 0 = h - 2p - 153. Is 7 a factor of h? True Is (120/14)/((-116)/(-12586)) a multiple of 15? True Let n(z) be the second derivative of -z5/20 + 5z*4/6 - 7z3/6 + z2/2 + 30z. Suppose 0 = 4p - 11 - 25. Does 19 divide n(p)? True Let j = -1036 + 1630. Is j a multiple of 5? False Let u = -1611 - -2579. Suppose -3k + u = 8k. Does 11 divide k? True Is 0 + (8 - (-1267 + 3)) a multiple of 12? True Let q be ((-16)/12)/(2/9). Is 20 a factor of (2/q)/(6/(4248/(-4)))? False Let k(s) = 4s + 9. Let g be k(-6). Let u(l) = l2 - 26l + 43. Let m be u(23). Let o = g - m. Is 10 a factor of o? False Let n = -1932 + 2216. Is 4 a factor of n? True Suppose -v + 12 = 2v. Suppose -24 + v = -4t. Is (-20)/6(-18)/t a multiple of 4? True Let g = 433 - 382. Is g a multiple of 23? False Let t be 30(4 + (1 - -1)). Suppose 0 = -33x + 36x - t. Does 20 divide x? True Suppose -3356 = -5z + 1264. Does 66 divide z? True Suppose -3q - 18 = -w, -3w - w + 17 = -q. Suppose -wn = 3m - 105, -2m - 6n = -2n - 62. Does 13 divide m? True Let n(g) = 17g3 + 1 + 2g*2 + 10g*2 + 3g - 20g2. Is 9 a factor of n(2)? False Let x(t) be the third derivative of t5/30 - 5t*4/12 - 19t*3/6 - 9t*2. Is x(10) a multiple of 13? False Let b(l) be the third derivative of -11l*4/24 - 17l*3/3 - 17l*2. Is b(-18) a multiple of 8? False Is 31 a factor of ((-744)/(-9))/((-98)/(-21) + -4)? True Let j be (4 - -6)(5 - 0). Let c = -33 + j. Is c a multiple of 2? False Let r(h) = 9h + 3. Let k(g) = -g3 + 4g*2 + 4g + 4. Let s be k(4). Suppose t + 4t = s. Does 26 divide r(t)? False Let y = -45 + 13. Let a = y - -84. Is a a multiple of 13? True Let l(c) = 3c*2 - 3c + 4. Suppose k - 2h - 2 = 2, 3k + h = -9. Let a(i) = 3i2 - 3i + 4. Let y(q) = ka(q) + 3l(q). Does 26 divide y(4)? False Let h(j) = -j*3 + 11j*2 + 4j + 1. Let p = -78 + 88. Is h(p) a multiple of 41? False Is 70 a factor of 5/((-4786)/532 + 9)? True Let u(m) = m*3 + 2m*2 - 20m - 15. Does 26 divide u(7)? True Let w(x) = -x - 4 - 7 - 9x. Let r be w(-8). Is (r/2)/((-6)/(-8)) a multiple of 12? False Suppose 2t = 3g - 2t - 2413, 5t + 2408 = 3g. Suppose 5h - 3014 = g. Is h/(-30)2/(-1) a multiple of 17? True Let l(p) = -p*3 + 15p*2 - 14p + 35. Let c be l(14). Suppose 0 = 5u - 5g - 140, 5u - 175 + c = -2g. Does 28 divide u? True Let t(r) = -10r - 13r - 3r2 - 16r - 42. Let a(c) = -c*2 - 13c - 14. Let w(q) = 7a(q) - 2t(q). Is 4 a factor of w(-11)? True Suppose -y + 374 = -348. Does 29 divide y? False Let h(y) = 8y3 - 3y*2 + 2y + 4. Suppose -q - 8 = -5q. Is 4 a factor of h(q)? True Let r be 9/640/12. Suppose rl = -4v + 304, 0v + 3l + 76 = v. Is 7 a factor of v? False Let w = 5 - 11. Let x = 6 - 5. Is w/(x/(-61)) a multiple of 18? True Suppose -66j + 783 = -63j. Does 29 divide j? True Let y(d) = d2 + 24. Let l be y(0). Suppose 2r = 5r - l. Is r even? True Suppose -4y + 380 = -816. Is 13 a factor of y? True Suppose -55 = -4m + 153. Suppose t - 4h - m = -3t, -t - 3h = -1. Is t - -52/(-5) a multiple of 2? True Let r(j) be the second derivative of -j5/20 + 7j*4/4 - 3j*3 + 3j*2/2 + 12j. Does 9 divide r(20)? False Let c(n) = n + 4. Let r be c(19). Suppose 5k - 353 = -r. Is 11 a factor of k? True Suppose 9j = 8j + 12. Suppose 0 = -5x, -2f + 2x + j = -46. Is f a multiple of 29? True Let b = -3 - -8. Suppose -ba + 43 = -4o, 39 = 5a + o - 3o. Suppose -3m + 14 = 4i, 2m + 7 = 2i - a. Is 2 a factor of i? False Let j(m) = 2m2 + 3m - 24. Is j(11) a multiple of 8? False Let q be (-621)/(-108) + 2/(81). Suppose 0 = -ql + 4l + 540. Is l a multiple of 47? False Let n be 2/(-8) - 5013/(-8). Suppose -6c - n + 1251 = 0. Is 31 a factor of c? False Suppose 2z = -3z + 105. Suppose l - z = 4q, -3l - 6q + 4q + 91 = 0. Is 6 a factor of l? False Let k be 3 - -84/(-8). Is 7/(0/15 + k/(-10)) a multiple of 10? True Let n(f) = -23f + 1. Let a be (-144)/78 + 8/(-52). Is n(a) a multiple of 17? False Let p(y) = -y - 1. Let m be p(-3). Suppose -16 = -g - 3n, 2n - 22 = -4g + 2. Does 5 divide (-14 - g/m)-1? False Suppose 5f - 5h = -5, 3h + 2h = 15. Suppose -29 = -fv + 29. Does 13 divide v + (-9)/(4 + -1)? True Let p(m) = 2m2 - 132m - 4. Does 11 divide p(-19)? False Let v(s) = -s*3 + 20s*2 - 23s - 38. Does 14 divide v(18)? True Let l(q) = q*2 - 9q + 61. Is l(-8) a multiple of 11? False Suppose 2t = t - 4g - 5, 15 = -5g. Suppose -c - 10 - t = 0. Let l = 7 - c. Is 8 a factor of l? True Suppose -q + 348 = 2h - 1442, -3h - 8963 = -5q. Does 8 divide q? True Let o be (-48)/9180/16. Is (42/(-15))/(2/o) a multiple of 14? True Let a = 51 + -51. Suppose a = -5o + 391 + 959. Is 15 a factor of o? True Suppose 2h - v = 55 + 19, 0 = -3h + 3v + 114. Let q = h - 22. Does 14 divide q? True Suppose -17v + 4v = -1638. Let f = 288 - v. Does 23 divide f? False Suppose 0c - 3c + 5 = -2s, 3s - 3c = -9. Is (-13)/52 - 85/s a multiple of 21? True Suppose 25 = 2l - 123. Is 33 a factor of l? False Let x(p) = -p2 - 12p - 10. Let q be x(-16). Let c = q - -115. Is c a multiple of 9? False Suppose 0y = 11y - 121. Let o = 107 - y. Is 12 a factor of o? True Let y(s) = 23s2 - 5s - 4. Is y(-1) a multiple of 12? True Let m = 142 - -234. Let i = -228 + m. Is 11 a factor of i? False Let k(c) = 4c + 29. Let d(b) = b + 15. Let g(v) = 5d(v) - 2k(v). Is g(-4) a multiple of 4? False Suppose 0 = 3n - 3u - 36, 10u - 52 = -3n + 5u. Let v(h) = 7h + 16. Let d be v(n). Suppose -5o = -d - 21. Is 9 a factor of o? True Does 5 divide ((-672)/(-504))/(1 - (-1939)/(-1941))? False Let a(i) be the third derivative of i5/30 + i4/24 + 13i3/6 - 48i*2. Does 20 divide a(4)? False Suppose 7t + 4z = 3t + 976, -3t = -5z - 724. Is 23 a factor of t? False Let i = 2674 - 1565. Does 18 divide i? False Suppose -f - 102 = 5f. Let d = 19 + f. Is 5 a factor of ((-30)/(-24))/(d/48)? True Suppose 3p = y + 4, -4y = 4p - 0p - 16. Let o be 1 + (-4 + y - -6). Suppose -x - n = -0 - 3, 2x + on = 0. Is x even? False Let v(s) be the first derivative of -23s*2/2 + s + 8. Does 20 divide v(-6)? False Suppose 0 = -3x + 2t + 6 + 13, 0 = 5t - 5. Suppose xg = 14g - 518. Is 10 a factor of g? False Suppose -4i + 0i = 2c - 138, c - 2i = 89. Let a = -39 + c. Does 7 divide a? False Suppose 21 = -6t + 3t. Suppose -4v = -0v - 40. Let a = t + v. Is 2 a factor of a? False Suppose 350 + 1886 = 13c. Is 7 a factor of c? False Let v(y) = 4y*2 - 17y + 59. Is v(7) a multiple of 4? True Suppose 321r - 314r = 4158. Is r a multiple of 49? False Suppose 0 = k - 3h - 346, 0h - 345 = -k + 4h. Suppose 3c - 107 = -x + 237, 3c - k = 4x. Does 32 divide c? False Suppose 1400 = 5i - 2g, 7g - 12g + 531 = 2i. Is 30 a factor of i? False Suppose 0 = -t + 2t. Suppose t = -r - 1, 8u = 4u + 3r + 159. Let h = u + -19. Is h a multiple of 5? True Let h(c) = -15 + 27 + 2c + 3c2 + 2c*2 - 20. Does 18 divide h(-4)? False Let j(f) = -50f + 47. Does 16 divide j(-7)? False Let b = 2845 + -1107. Is 8 a factor of b? False Let b be (2 + -7 - -3)/(4/8). Let r(k) = -3k3 - 7k*2 - 5k - 8. Is r(b) a multiple of 18? False Is 4 -	{ "pile_set_name": "DM Mathematics" }
j*2 - 155j + 1475. Calculate p(145). 25 Let x(p) = -54p2 + 643p - 136. Calculate x(12). -196 Let f(v) = 12v3 + 24v*2 - 62v - 83. Give f(4). 821 Let p(g) = 339g2 + 1738g + 2165. Give p(-3). 2 Let x(c) = 53c - 1481. Give x(37). 480 Let l(p) = 3p*3 - 4p*2 + 1060p - 7525. What is l(7)? 728 Let k(c) = -2058c + 373442. What is k(182)? -1114 Let i(b) = -4b*2 - 2970b + 22185. Give i(-750). -315 Let b(q) = 77774q + 77767. Determine b(-1). -7 Let l(z) = 73771z - 2877076. Calculate l(39). -7 Let u(p) = -p*3 + 70p*2 - 303p - 408. Calculate u(66). -2982 Let z(j) = 89656j + 9413930. Determine z(-105). 50 Let v(k) = 541k - 5523. Calculate v(10). -113 Let s(m) = -541m - 2672. What is s(-4)? -508 Let h(d) = 4d*2 + 1733d + 171659. Determine h(-280). 19 Let f(q) = -190q - 2844. Give f(-15). 6 Let k(r) = 10r*2 - 853r + 8792. Give k(12). -4 Let y(h) = h*2 - 42161h + 3744402. Determine y(89). -6 Let g(m) = -19198m - 1420364. What is g(-74)? 288 Let v(n) = -1916n - 70889. Calculate v(-37). 3 Let s(g) = -g*3 + 322g*2 + 8673g + 717. Determine s(347). 23 Let b(z) = 17z2 + 2472z - 1156. What is b(-146)? 304 Let s(c) = c*3 - 133c*2 + 884c - 240. Give s(126). 12 Let a(l) = -l*3 + 32l*2 - 255l + 114. What is a(21)? -390 Let o(s) = -2036s + 26605. Determine o(13). 137 Let y(x) = 41x*2 + 359x - 2999. What is y(-14)? 11 Let m(r) = -34r2 + 248r + 2142. Give m(-9). -2844 Let k(b) = -b*3 - 32b*2 - 458b - 13248. Calculate k(-31). -11 Let w(v) = -4v2 + 608v + 65713. What is w(225)? 13 Let f(r) = -47r3 + 7004r*2 - 150r + 614. Determine f(149). 465 Let y(v) = 7200v + 2822399. What is y(-392)? -1 Let l(v) = -244493v - 978156. Give l(-4). -184 Let v(m) = 34m3 - 8498m*2 - 508m + 2021. Determine v(250). 21 Let b(n) = -16n2 + 526n + 7. What is b(33)? -59 Let s(h) = 2h3 - 94h*2 - 1280h - 44. What is s(-11)? 0 Let p(f) = 7f2 - 5051f + 429888. Calculate p(623). 18 Let w(m) = 2m3 - 11m*2 - 20m + 91. Calculate w(2). 23 Let u(i) = -4076i + 57075. What is u(14)? 11 Let o(v) = v2 - 9862v - 78978. Calculate o(-8). -18 Let f(v) = 2v3 - 12v*2 + 241v - 4474. Give f(16). 4502 Let h(v) = v*3 + 264v*2 + 2815v - 2509. Determine h(-12). -1 Let n(q) = q*3 + 3q*2 - 66q + 31. Determine n(20). 7911 Let q(m) = -m*2 + 60230m - 602415. Calculate q(10). -215 Let b(f) = f*3 - 241f*2 - 505f + 4634. Give b(243). 17 Let w(l) = 7129l + 92587. Determine w(-13). -90 Let q(j) = -2j*2 + 592j - 24194. What is q(49)? 12 Let s(y) = -6y3 - 171y*2 - 278y - 5397. Calculate s(-28). 35 Let m(n) = 19n2 + 226n + 53. Give m(-11). -134 Let o(m) = -207m - 3614. What is o(-18)? 112 Let n(b) = 2b*2 - 359b + 1436. Determine n(4). 32 Let b(n) = 3n2 - 6432n - 189053. What is b(-29)? -2 Let t(z) = -10z2 + 1502z - 14894. Calculate t(10). -874 Let a(k) = -2k3 + 97k*2 + 139k - 276. What is a(50)? -826 Let g(u) = 8u3 + 4u*2 - 812u - 2445. What is g(-3)? -189 Let b(c) = -c*2 - 181c + 3283. Give b(-201). -737 Let c(s) = -384s - 10683. Calculate c(-29). 453 Let d(o) = 35698o - 5925858. Give d(166). 10 Let k(w) = -433w2 + 1684w - 27. Give k(4). -219 Let n(o) = -o*3 + 23o*2 - 80o + 25. Calculate n(4). 9 Let z(j) = -2506j - 12521. Determine z(-5). 9 Let v(l) = -417l*2 + 1079l + 4. What is v(3)? -512 Let u(p) = p*3 + 112p*2 + 611p + 55490. Determine u(-111). -10 Let a(d) = 14d3 + 126d*2 + 14d - 85. Determine a(-11). -3627 Let r(s) = 5s3 - 213s*2 + 1098s + 102. Calculate r(5). 892 Let a(w) = 22421w2 + 336308w - 112. Calculate a(-15). -7 Let n(b) = b*3 - 170b*2 + 4818b + 278. Calculate n(36). 62 Let u(n) = -n*3 + 828n*2 + 29291n - 612. Give u(-34). -34 Let x(a) = 543254a - 543309. What is x(1)? -55 Let x(f) = -7329f - 791540. Determine x(-108). -8 Let d(p) = -2p3 + 17p*2 - 15p + 516. Determine d(10). 66 Let h(g) = 1300g2 + 27293g - 9. Give h(-21). 138 Let r(o) = -o*3 + 99o*2 - 900o + 1232. Determine r(89). 342 Let b(v) = 2v2 + 67344v - 5671004. Calculate b(84). 4 Let n(b) = -b*3 - 49b*2 - 606b - 129. What is n(-25)? 21 Let p(f) = 1178f + 151984. Determine p(-129). 22 Let d(j) = -2j*3 + 121j*2 + 691j + 264. What is d(66)? -2046 Let z(i) = i*3 + 5i*2 + 23i. What is z(-7)? -259 Let h(o) = 4o3 + 88o*2 - 4760o - 4. Calculate h(-47). 2816 Let k(z) = 12z2 + 139z + 369. What is k(-6)? -33 Let h(i) = 10195i - 71380. What is h(7)? -15 Let k(r) = r3 - 198r*2 + 5945r + 436. What is k(37)? -8 Let n(l) = 1504l - 735327. Give n(489). 129 Let h(u) = -13u*2 + 17253u + 314783. What is h(-18)? 17 Let k(c) = -9c3 - 134c*2 + 12c - 76. Give k(-15). -31 Let c(n) = -n*3 + 66n*2 - 1036n - 59. Calculate c(26). 45 Let l(d) = -d*3 - 22d*2 + 140d + 143. Give l(-27). 8 Let l(m) = 365m2 - 235m - 488. What is l(-2)? 1442 Let d(g) = -544g2 + 11g + 57. Determine d(2). -2097 Let m(l) = -l*2 - 3146l + 108145. Determine m(34). 25 Let v(n) = n*2 - 46582n + 1815171. Give v(39). -6 Let a(k) = 989k - 30546. Calculate a(31). 113 Let q(b) = 10b*2 + 721b - 354. Determine q(-72). -426 Let t(u) = 85u2 - 1354u - 80. Calculate t(16). 16 Let h(v) = -5v2 + 225v - 353. Give h(43). 77 Let g(m) = -3m3 - 57m*2 - 73m + 74. Calculate g(-17). -419 Let i(z) = -6z2 + 3242z + 169426. Give i(-48). -14 Let z(r) = 55r3 + 2216r*2 + 641r + 19. What is z(-40)? -21 Let z(t) = 144718t - 723555. Determine z(5). 35 Let t(n) = -78n*3 + 57n*2 + 142n - 26. Calculate t(-3). 2167 Let f(w) = -30w2 + 792w + 353. Determine f(26). 665 Let a(r) = 1428r + 363300. What is a(-254)? 588 Let a(p) = -138p*3 - 3p*2 + 1889p - 1886. Calculate a(1). -138 Let l(m) = -162m - 70707. Give l(-435). -237 Let c(l) = -18084l - 72458. Determine c(-4). -122 Let a(z) = -3814z + 131395. Calculate a(34). 1719 Let g(h) = 181h + 4250. What is g(-23)? 87 Let h(p) = 17550p + 192687. What is h(-11)? -363 Let t(i) = 176471i - 705889. Give t(4). -5 Let y(w) = -649w3 - 5w*2 + 7w + 3. Determine y(1). -644 Let d(z) = -2z3 + 468z*2 + 465z + 1661. Give d(235). 486 Let w(b) = -7b2 - 482b + 2844. Determine w(6). -300 Let c(q) = -1563q - 6365. What is c(-4)? -113 Let u(k) = -2k*3 + 851k*2 + 42863k - 937. Calculate u(471). 5 Let f(d) = -d*3 - 819d*2 - 19075d + 97. What is f(-24)? -23 Let u(q) = q3 + q2 + 1097q - 6790. Calculate u(6). 44 Let y(x) = 5584x + 5552. Give y(-1). -32 Let u(m) = m*3 - 162m*2 - 837m + 296. Calculate u(167). -38 Let u(v) = -2091v + 113093. Give u(54). 179 Let s(x) = -12095x + 1294213. Calculate s(107). 48 Let i(y) = 648994y - 1297999. Give i(2). -11 Let i(b) = 4367b + 48165. Calculate i(-11). 128 Let n(r) = r*2 + 85r + 1652. Calculate n(-62). 226 Let c(q) = 48q2 + 1816q - 20236. Give c(9). -4 Let n(h) = -605h2 - 14529h - 165. Give n(-24). 51 Let z(k) = 4k3 - 791k*2 - 22276k - 23. Give z(-25). 2 Let j(g) = -9g3 - 214g*2 - 692g - 318. Give j(-20). -78 Let y(d) = 2d3 - 21d*2 - 1073d + 2946. Calculate y(-20). 6 Let u(z) = -96z + 7685. Determine u(80). 5 Let q(p) = -633258p - 633245. Calculate q(-1). 13 Let j(a) = a*3 + 35a*2 - 204a - 3886. Determine j(-38). -466 Let a(s) = s*2 - 2482s - 629630. Give a(-232). 18 Let d(z) = -166z + 9614. Determine d(55). 484 Let h(n) = n2 + 461n - 8561. Give h(18). 61 Let n(d) = 3d3 - 16d*2 - 2047d - 157. Give n(29). 191 Let m(y) = -1192y2 - 2405y - 36. What is m(-2)? 6 Let a(y) = -272y - 48937. Calculate a(-182). 567 Let w(g) = 126g*2 + 575g + 372. Give w(-4). 88 Let s(m) = -6204124m + 43428876. What is s(7)? 8 Let d(o) = 2542o*2 - 27958o - 33. Calculate d(11). 11 Let s(w) = 2324w - 2368186. Give s(1019). -30 Let l(z) = -3755z - 127654. Give l(-34). 16 Let m(i) = 68i2 + 732i - 41. Calculate m(-12). 967 Let h(a) = -22a2 - 118a + 400. Determine h(-5). 440 Let o(g) = -g*3 - 61g*2 - 216g - 9110. What is o(-60)? 250 Let o(h) = -6h2 + 90h - 334. Give o(7). 2 Let x(q) = -109q2 + 25q + 60. Determine x(-3). -996 Let v(b) = -106b + 3865. Calculate v(44). -799 Let m(x) = 3x*2 + 4044x - 462367. What is m(106)? 5 Let s(n) = n*2 + 63878n - 7423291. Calculate s(	{ "pile_set_name": "DM Mathematics" }
er? 4 What is the cube root of 113811 to the nearest integer? 48 What is the square root of 219528 to the nearest integer? 469 What is the cube root of 14327484 to the nearest integer? 243 What is the square root of 1871741 to the nearest integer? 1368 What is the square root of 2205193 to the nearest integer? 1485 What is the square root of 7157449 to the nearest integer? 2675 What is 3454633 to the power of 1/4, to the nearest integer? 43 What is the cube root of 465203 to the nearest integer? 77 What is the fourth root of 211705 to the nearest integer? 21 What is 235386 to the power of 1/3, to the nearest integer? 62 What is 3585472 to the power of 1/3, to the nearest integer? 153 What is the square root of 672906 to the nearest integer? 820 What is the square root of 826442 to the nearest integer? 909 What is the sixth root of 213874 to the nearest integer? 8 What is the eighth root of 73328 to the nearest integer? 4 What is the eighth root of 8674176 to the nearest integer? 7 What is the fourth root of 8325501 to the nearest integer? 54 What is 405272 to the power of 1/8, to the nearest integer? 5 What is 1322145 to the power of 1/3, to the nearest integer? 110 What is the third root of 420276 to the nearest integer? 75 What is 3315763 to the power of 1/2, to the nearest integer? 1821 What is 62489 to the power of 1/2, to the nearest integer? 250 What is 1205311 to the power of 1/2, to the nearest integer? 1098 What is the ninth root of 1174268 to the nearest integer? 5 What is the cube root of 465626 to the nearest integer? 78 What is the square root of 82820 to the nearest integer? 288 What is 3374673 to the power of 1/3, to the nearest integer? 150 What is 4293058 to the power of 1/4, to the nearest integer? 46 What is 22280680 to the power of 1/2, to the nearest integer? 4720 What is the eighth root of 1652301 to the nearest integer? 6 What is 5700550 to the power of 1/3, to the nearest integer? 179 What is 251700 to the power of 1/3, to the nearest integer? 63 What is 2580362 to the power of 1/5, to the nearest integer? 19 What is 387935 to the power of 1/6, to the nearest integer? 9 What is 333283 to the power of 1/3, to the nearest integer? 69 What is the tenth root of 5043959 to the nearest integer? 5 What is 1195668 to the power of 1/2, to the nearest integer? 1093 What is the square root of 1365489 to the nearest integer? 1169 What is 971649 to the power of 1/7, to the nearest integer? 7 What is the fourth root of 705620 to the nearest integer? 29 What is 1961377 to the power of 1/4, to the nearest integer? 37 What is 1394548 to the power of 1/2, to the nearest integer? 1181 What is 9199543 to the power of 1/9, to the nearest integer? 6 What is the square root of 11634562 to the nearest integer? 3411 What is the third root of 2119709 to the nearest integer? 128 What is the square root of 3216382 to the nearest integer? 1793 What is the tenth root of 1013596 to the nearest integer? 4 What is the square root of 3361051 to the nearest integer? 1833 What is 153097 to the power of 1/3, to the nearest integer? 53 What is 18578609 to the power of 1/7, to the nearest integer? 11 What is 2427823 to the power of 1/2, to the nearest integer? 1558 What is 9209053 to the power of 1/3, to the nearest integer? 210 What is the cube root of 240761 to the nearest integer? 62 What is the third root of 7231258 to the nearest integer? 193 What is the third root of 4433291 to the nearest integer? 164 What is the square root of 8448328 to the nearest integer? 2907 What is 837697 to the power of 1/2, to the nearest integer? 915 What is the eighth root of 855515 to the nearest integer? 6 What is the third root of 3458938 to the nearest integer? 151 What is 32590016 to the power of 1/5, to the nearest integer? 32 What is the ninth root of 731408 to the nearest integer? 4 What is the sixth root of 3690584 to the nearest integer? 12 What is the third root of 14979813 to the nearest integer? 247 What is 26969590 to the power of 1/2, to the nearest integer? 5193 What is the third root of 664898 to the nearest integer? 87 What is the cube root of 12001953 to the nearest integer? 229 What is 841606 to the power of 1/6, to the nearest integer? 10 What is 2438822 to the power of 1/2, to the nearest integer? 1562 What is the third root of 10593852 to the nearest integer? 220 What is 26190 to the power of 1/2, to the nearest integer? 162 What is 16511277 to the power of 1/3, to the nearest integer? 255 What is 139575 to the power of 1/8, to the nearest integer? 4 What is 377075 to the power of 1/2, to the nearest integer? 614 What is the seventh root of 861376 to the nearest integer? 7 What is the square root of 5572110 to the nearest integer? 2361 What is 27605574 to the power of 1/5, to the nearest integer? 31 What is 161588 to the power of 1/3, to the nearest integer? 54 What is the third root of 8967085 to the nearest integer? 208 What is 7349713 to the power of 1/9, to the nearest integer? 6 What is 5331015 to the power of 1/2, to the nearest integer? 2309 What is the cube root of 18944807 to the nearest integer? 267 What is the square root of 2594469 to the nearest integer? 1611 What is 688601 to the power of 1/3, to the nearest integer? 88 What is the square root of 727568 to the nearest integer? 853 What is the sixth root of 261725 to the nearest integer? 8 What is the square root of 152244 to the nearest integer? 390 What is 227902 to the power of 1/2, to the nearest integer? 477 What is 119191 to the power of 1/3, to the nearest integer? 49 What is 457768 to the power of 1/2, to the nearest integer? 677 What is the ninth root of 11315973 to the nearest integer? 6 What is 562612 to the power of 1/10, to the nearest integer? 4 What is 4953349 to the power of 1/3, to the nearest integer? 170 What is 550888 to the power of 1/3, to the nearest integer? 82 What is the tenth root of 750181 to the nearest integer? 4 What is the tenth root of 4438263 to the nearest integer? 5 What is 1683057 to the power of 1/3, to the nearest integer? 119 What is the square root of 275247 to the nearest integer? 525 What is 177501 to the power of 1/3, to the nearest integer? 56 What is the third root of 4191019 to the nearest integer? 161 What is 4207258 to the power of 1/5, to the nearest integer? 21 What is the square root of 790163 to the nearest integer? 889 What is the square root of 1831509 to the nearest integer? 1353 What is the cube root of 9122767 to the nearest integer? 209 What is 2009360 to the power of 1/2, to the nearest integer? 1418 What is the third root of 14542126 to the nearest integer? 244 What is the square root of 10172448 to the nearest integer? 3189 What is the eighth root of 6078864 to the nearest integer? 7 What is 926001 to the power of 1/7, to the nearest integer? 7 What is the cube root of 4671353 to the nearest integer? 167 What is 69555 to the power of 1/2, to the nearest integer? 264 What is 6844816 to the power of 1/3, to the nearest integer? 190 What is 9902110 to the power of 1/2, to the nearest integer? 3147 What is the square root of 82583 to the nearest integer? 287 What is the square root of 1680676 to the nearest integer? 1296 What is 11594925 to the power of 1/2, to the nearest integer? 3405 What is the square root of 2774381 to the nearest integer? 1666 What is 19589 to the power of 1/10, to the nearest integer? 3 What is 246720 to the power of 1/2, to the nearest integer? 497 What is 2639531 to the power of 1/6, to the nearest integer? 12 What is 4669785 to the power of 1/2, to the nearest integer? 2161 What is the square root of 5309338 to the nearest integer? 2304 What is the ninth root of 10460104 to the nearest integer? 6 What is 3156351 to the power of 1/6, to the nearest integer? 12 What is 441827 to the power of 1/5, to the nearest integer? 13 What is 1182285 to the power of 1/6, to the nearest integer? 10 What is 6924821 to the power of 1/3, to the nearest integer? 191 What is the cube root of 405585 to the nearest integer? 74 What is the third root of 754075 to the nearest integer? 91 What is 4211936 to the power of 1/3, to the nearest integer? 161 What is the third root of 19873174 to the nearest integer? 271 What is th	{ "pile_set_name": "DM Mathematics" }
9u - 639u - 15372u in the form iu + b and give i. -25461 Rearrange -14x + 56x*3 - 53x*3 - 59 + 39x - 21x - 2x*2 to the form dx*2 + r + yx*3 + tx and give d. -2 Express (1534 + 11459 + 607)(2m - 3m + 3m) in the form o + xm and give x. 27200 Express (-44 - 2p - 58 + 120)(-23p*2 - 33p*2 - 7p*2) as w + fp + kp3 + np*2 and give n. -1134 Express 626712y + 12y2 - 14 - 2y*2 - 626714y + 2y3 in the form jy + ny2 + h + by*3 and give b. 2 Express 27c3 + 13 - c3 + 32 + 21c3 + 38c*3 as xc*3 + ac + b + dc2 and give x. 85 Express 28m + m*2 - 13 + 4m + 16m - 3m in the form um2 + nm + v and give u. 1 Express 51f - 6f*3 - 2 - 52f + 37 - 2f4 - 60 - 5f*4 as vf*3 + pf*2 + q + uf*4 + wf and give u. -7 Express 1357z + 1242z - 3303z + 1356z as i + nz and give n. 652 Rearrange 43 + 4v*3 - 6v*2 + 6v*2 + 2v*2 - 45v + 2v + 35v to the form gv + nv*2 + t + uv*3 and give u. 4 Express 0 - 102o - 121o - 5o*3 + 222o - o*2 + 0 in the form v + yo*2 + po + qo3 and give p. -1 Rearrange -m2 - m2 + m2 + (-1 + m + 1)(14m + 15m - 34m + 0 + 0 - 2m + (-3m + 3m - m)(0 - 3 + 4)) to lm*2 + zm + a and give l. -9 Express -10z4 + 4z + 3z2 - 4506 - 3z*3 + 4507 + 12z*4 as l + nz*3 + bz + qz4 + sz*2 and give l. 1 Express -19b + 15b - 21b - 309 + 15b as v + wb and give v. -309 Express 14 - 69 + 14 + 3056y + 41 in the form sy + g and give s. 3056 Express (-467 - 372 - 508)(-7o - 5 + 5)(-1 + 3 - 4)(-5 + 3 + 0) as ro + m and give r. 37716 Rearrange -1870d*2 + 1867d*2 - 446d*3 + 298d*3 - 839d*3 + (-5d*2 + 2 - 2)(d + 0d + 2d) to md + q + ud*2 + od*3 and give u. -3 Express 1 - 10u - 18u3 + u4 + 0 + 83491u*2 - 83492u*2 as m + qu*4 + ou*2 + au + du3 and give d. -18 Rearrange (-s + 7s - 3s)(-30s + 16s - 7s)(-6 + 1 + 2 + (1 + 2 - 1)(-8 + 12 + 12)) to the form js*2 + vs + o and give j. -1827 Rearrange (-2 - 1 + 1 - 4 - 1 + 3 + (3 - 4 + 3)(0 + 1 + 2))(-45v - 395v + 11v)(-3 - 1 + 6) + 2v - v + 4v to fv + y and give f. -1711 Rearrange -29d*2 - 44d*2 - 31d*2 - 36d*2 + 5781d + 143d2 to u + vd*2 + jd and give v. 3 Express -1678n2 - 621n*2 + 783 - 783 + (-6n + 2n + 3n)(0n - n + 0n) as vn*2 + m + tn and give v. -2298 Express (53r + r2 - 71r + 41r)(-59r2 + 87r*2 + 291r*2) in the form mr + ur2 + a + vr*4 + jr*3 and give m. 0 Rearrange 819w + 14w - 15w - 172w to a + rw and give r. 646 Express -4000t - 177871 + 177871 + (4 + 1 - 4)(-4t + 4t + 2t) as s + kt and give k. -3998 Rearrange (-8x + 5x - 5x)((-4 - 3 + 0)(0 + 2 - 4) + 2 + 1 + 0) + (1 + 0 + 1)(-17 + 4x + 17)(-1 - 1 + 1) to the form w + gx and give g. -144 Express (0 + u + 0 + (-2u - u + 5u)(5 - 2 - 1) + 0 + u + 0)(6813u*3 + 2732u*3 + 2274u*3) in the form mu + yu2 + bu*3 + xu*4 + w and give x. 70914 Rearrange 47f*2 - 17f*2 + 0f*2 + 2f*3 - 2 - 2 - 2f + 11 to the form u + hf2 + vf*3 + zf and give u. 7 Express 7710 - 16268 + g + g + 0g in the form x + bg and give x. -8558 Express -431v2 - 465v*2 + 83 + 891v*2 in the form dv*2 + o + tv and give d. -5 Rearrange 2m3 + 12 - 25m - 8m2 - 9 + 46m - 32m to sm*2 + gm*3 + qm + p and give g. 2 Rearrange 7 - 27q + 32 + 33 to the form vq + m and give m. 72 Express c*4 + 82c*3 + 4742c - 4743c - 75c*3 + 57c*2 in the form mc + z + ic4 + wc*3 + uc*2 and give w. 7 Express -4f*2 + 4f*4 + 0f*2 - 2f*4 - 8f - 30f3 + 2 + 5f2 + f2 in the form nf2 + bf*4 + jf*3 + a + of and give j. -30 Express 2w4 - 5w*4 + 0w*4 + (3w*2 - 2w*2 + 6w*2)(9 - 9 + 2w2)(-14 + 12 - 28) as qw4 + xw + c + hw2 + lw*3 and give q. -423 Express -2091f*3 + 19f*2 + 1051f*3 + 1043f*3 in the form wf*2 + k + rf*3 + uf and give w. 19 Rearrange -22r2 + 26r*2 + 2 - 3 - 106r*2 - 71r*2 - 62r*2 + (-2r - r + r)(r - 2r + 3r) + 3r*2 - 5r2 + r2 to br2 + v + or and give v. -1 Express (3o - o - 4o)(0 + 25 - 4)(-8 + 5 + 1) as ro + b and give r. 84 Express (m + 0m + 0m)(-284776 + 569543 - 284770 + 8595m) as n + cm*2 + xm and give c. 8595 Rearrange 563s + 630s - 686s - 2280s - 1495s to bs + l and give b. -3268 Express -724j + j4 - 70j2 - j3 + 1378j - 655j - 25 as t + vj2 + kj*4 + gj + aj3 and give a. -1 Rearrange -82105g*4 - 2g + g*2 + 32g*3 - 29g*3 + 82118g*4 to the form l + sg*2 + wg*4 + kg*3 + ag and give k. 3 Express (64 + 179 - 82)(-1 - 5 + 4)(2 - 1 - 2)(-x + 3x - x) as s + kx and give k. 322 Rearrange -2178s + 0 + 10 - 34 + 20 + 0 to is + h and give i. -2178 Express -73u*4 + 997u*3 - 999u*3 - 2u*2 + 22u*4 in the form xu + k + bu3 + ou*2 + wu*4 and give o. -2 Rearrange (-7 - 3v + 7)(-2745v*3 + 4493v - 4493v) to the form jv*2 + gv*3 + n + av*4 + bv and give a. 8235 Express l - 43 + 231l3 + 2l*2 - 98l*3 + 0l4 - l4 - 129l3 as hl*4 + bl + f + cl3 + sl*2 and give b. 1 Rearrange (8 + 6 + 10)(1133y - 561y - 1 - 566y) + (0 + 3 - 4)(-2y + 3y - 3y) to the form a + sy and give a. -24 Rearrange 78k4 - 20k*3 + 11k - 2 - 11k - 79k*4 to the form c + vk*4 + uk*3 + hk*2 + tk and give v. -1 Express -191o3 - 6039o*2 - o + 60o*3 + 63o*3 + 70o*3 as zo + co2 + io*3 + y and give c. -6039 Express (558j + 649j - 269j + 814j)(-2j2 - 2j*3 + 2j*2) in the form mj*3 + cj*4 + lj + uj2 + g and give c. -3504 Express -4740x*2 - 761x*2 - 397x*3 + 400x*3 as qx*3 + ix*2 + z + hx and give q. 3 Express -196o + 319 - 165 - 55o - 160 in the form fo + w and give w. -6 Rearrange 143a*3 + 3a + 15a2 - a4 - 8a*2 - 6a*2 - 2a*2 - 2a*2 to n + va*3 + ca*2 + ha*4 + ja and give h. -1 Express (-36 + 41 - 17 - 3 + 0 + 2 + (1 + 2 - 1)(-3 + 0 + 2) + 0 + 4 - 2)(-3y + y + 0y) in the form hy + l and give h. 26 Rearrange -1404x - 655x - 691x to y + px and give p. -2750 Express 29 + 37 - 104 + a2 + 173a2 + 36 - a4 in the form ia + b + da*4 + ha*3 + pa*2 and give d. -1 Express 57x*2 - 2 - 27x*2 - 23x + 39x2 + 73x*2 as cx + s + ax2 and give a. 142 Rearrange 15n2 + n2 - 11n2 + 5 - 1 + 24n*2 to v + pn*2 + kn and give v. 4 Express 12 - 23p4 + 44p*4 + 10p*3 - 18p*4 as vp*3 + sp + gp2 + up*4 + l and give l. 12 Rearrange 653 + 661 - 8z - 1188 to the form v + lz and give v. 126 Rearrange 1105 + 559 + 347 + 19h + 301 - 16h to the form v + lh and give v. 2312 Express -615 + 73o + 3o2 - o2 + 2o2 - 72o + 41 in the form wo2 + s + mo and give w. 4 Express (-2028y3 + 1660y*3 + 1688y*3 + (2 + y - 2)(2y2 - 4y2 + y2))(-5 + 5 + 3y) in the form my + ty*3 + d + ly*4 + ay*2 and give l. 3957 Rearrange -1960x*2 + 2100x*2 - 2166x*2 to the form o + hx + px2 and give o. 0 Express -8 + 8 + 3h + (-3h + 5h - h + (-h + 6h - 3h)(0 + 1 + 0))(700 + 989 + 635 + 171) in the form b + xh and give x. 7488 Express 2 + 3w - 4w - 3w - 1488w2 + 1484w*2 in the form yw + q + hw2 and give h. -4 Rearrange -7q - 668q2 + 8269q*2 + 7q + 3596q2 to the form j + kq*2 + vq and give k. 11197 Rearrange (6c2 - 11534c + 5773c + 5783c - 1)(c2 + 125 - 5c*2 + 2c*2) to vc*4 + nc + mc3 + s + pc*2 and give s. -125 Rearrange -3r*2 - 11r + 604 - 70 + 4 + 8r + 4r to the form yr + cr*2 + d and give c. -3 Rearrange (-3130 - 435 + 3 - 16 + (2 - 2 + 2)(3 - 4 + 0) - 5 + 2 - 1)(4q + 3q - 5q) to n + jq and give n. 0 Express 2w*2 - 442w*4 - 38w*2 + 7w*2 - 1 - 26w*2 + 441w*4 as rw*4 + g + uw*3 + qw*2 + ow and give r. -1 Rearrange (-1465 - 122c + 3218 - 2c*2 - 1750)(-c*2 - 5c*2 + 4c*2) to bc*3 + qc*2 + n + dc*4 + lc and give d. 4 Express -2k4 + 3713k*2 + 2 - k - 3713k*2 + k - 2k*3 as wk + ck3 + i + nk*4 + pk*2 and give n. -2 Express ((-3 + 5 - 3)(0 + 3 - 2) + (-3 - 3 + 7)(-3642 - 9005 + 3909))(2 - 3j - 1 + 4j)(2 + 1 + 0) as aj + f and give a. -26217 Express 42 + 44 - 1235u + 48 - 134 as xu + y and g	{ "pile_set_name": "DM Mathematics" }
)/(2/6). Find y such that -gy3 - 8/17y + 16/17y2 + 0 = 0. 0, 2/3, 2 Let p(d) be the second derivative of 3d*5/8 + 37d*4/8 + 14d*3 - 36d*2 + 2459d. Find t such that p(t) = 0. -4, 3/5 Suppose -35c + 30c + 55 = 0. Find v, given that 8v3 + 5v*4 + 26v*5 - 14v*5 - cv*5 + 4v4 = 0. -8, -1, 0 Let t(p) = p2 - 17p - 8. Let s(n) = -n - 1. Let h(i) = 6s(i) - t(i). Let f be h(11). Suppose -j*2 + 0j*2 - 6j*f + 2j*2 + 5 = 0. Calculate j. -1, 1 Let u(k) be the first derivative of -32/17k*2 - 6 + 512/17k + 2/51k3. Factor u(l). 2(l - 16)*2/17 Suppose 7s = -9s + 80. Let -49c*2 + 19c + 56c3 - 59c - 16cs + 12 + c2 + 36c4 = 0. Calculate c. -1, 1/4, 1, 3 Let x(u) = -u2 + 4u + 20. Let s be x(-10). Let i be ((-18)/s)/((-2)/(-24)). Suppose 9/5d*3 + 6/5d*2 - 6/5 - id = 0. What is d? -1, -2/3, 1 Let b = 4864/33 + -250/11. Let a = b + -721/6. What is f in af3 + 3/4f*4 + 9f + 39/4f2 + 3 = 0? -2, -1 Let s be (-20 - -25) + -2 + 2. Find o, given that -10o*3 - 4o*2 - 8o*s + 16o*2 - 8o*2 - 6o*2 - 16o4 = 0. -1, -1/2, 0 Let d(g) be the third derivative of g6/120 - g5/15 - g4/6 + 8g3/3 - g2 + 217. Find r such that d(r) = 0. -2, 2, 4 Factor -4n*2 + 8n - 24n + 4n - 6n - 14n. -4n(n + 8) Let r = -2/35677 + 35691/249739. Factor ri2 + 2i + 7. (i + 7)*2/7 Let b be 6 + (4 - 13) + 4628. Factor -20a*2 - 16a*3 - ba + 4633a + 7a*4 + 5a*4. 4a(a - 2)(a + 1)(3a - 1) Let r(b) = -10b2 - 132b - 18. Let y be r(-13). Let i be (6/y)/(72/32015). Determine t, given that it*5 + 16/9t - 40/9t2 + 4t*3 - 14/9t*4 + 0 = 0. 0, 1, 2 Let g be 14/(-1)-3. Suppose 41 = 5w + 4l + 9, 0 = 4w - 3l - 7. Determine t so that wt*3 - 8t*2 + 65 - 65 - gt = 0. -1, 0, 3 Solve 186 + 1/2b2 + 127/2b = 0. -124, -3 Let h(r) = -2r2 - 34r - 9. Let u(w) = -w*2 - 16w - 4. Suppose 0 = -0z - z - 9. Let v(n) = zu(n) + 4h(n). Factor v(x). x(x + 8) Let k = -169235/9066 - -1/3022. Let q = 19 + k. Factor -1/6w + 1/3w*2 + 1/6w*3 - q. (w - 1)(w + 1)(w + 2)/6 Let m(i) be the third derivative of -i8/26880 + i7/672 - 7i*6/320 + 19i5/60 - i4/12 + 80i2. Let f(d) be the third derivative of m(d). Factor f(w). -3(w - 7)(w - 3)/4 Factor -213/2z + 0 - 219/4z2 - 3/4z*3. -3z(z + 2)(z + 71)/4 Let i(y) be the first derivative of 3y5/40 + 63y*4/32 + 39y*3/8 + 57y*2/16 + 1855. Factor i(h). 3h(h + 1)2(h + 19)/8 Let y(h) = -5h2 + 8h + 11. Let s(v) = 6v2 - 8v - 11. Let d be 1/(-2)1(6 - 10). Let g(b) = ds(b) + 3y(b). Factor g(n). -(n + 1)(3n - 11) Solve -25806y - 128018/5 - 66037/10y*2 - 1/10y*4 - 51y*3 = 0 for y. -253, -2 Let b be (-1)/16(-40)/24. Let 14x*2 + 10x*2 - 40x*2 - 5x*4 + bx*2 + 11x2 = 0. Calculate x. -1, 0, 1 Let k(z) be the third derivative of z5/60 - 8209z2. Let h(c) = 10c*2 + 10c. Let y = 1 - -4. Let w(u) = yk(u) - h(u). Factor w(l). -5l(l + 2) Let u(l) = -7l*2 - 3l - 21. Let f(b) = 3b2 + b + 11. Let n(r) = -9f(r) - 4u(r). Let w be n(-6). Factor 19q*3 - 10q*3 - 5q*4 - 14q*w. -5q*3(q + 1) Let t(p) be the third derivative of 77/120p4 - 49/15p*3 + 0 + 1/600p*6 - 89p*2 + 0p - 4/75p5. Suppose t(c) = 0. What is c? 2, 7 Let t = -41721540 - -176732444491/4236. Let u = 2/1059 + t. Let 5/4c*2 - 1/2c + uc4 - c3 + 0 = 0. What is c? 0, 1, 2 Let u(z) be the third derivative of z6/96 - 143z*5/48 + 1415z*4/96 - 235z*3/8 - 3470z*2. Factor u(d). 5(d - 141)(d - 1)2/4 Let f = -63 - -81. Let j(y) = y3 - 17y*2 - 18y + 8. Let s be j(f). Solve 51t2 - 97t*2 + 72t - 332 + 42t2 + s = 0. 9 Let t(z) be the third derivative of -z5/20 - 13z*4/2 - 138z*3 + 184z*2 - z + 11. Factor t(o). -3(o + 6)(o + 46) Let v(i) be the second derivative of i5/120 + 133i*4/72 + 173i*3/12 + 129i*2/4 + 5582i. Determine y so that v(y) = 0. -129, -3, -1 Let p be 118800/166050 + (-2)/41(-2 + 3). Factor -1/3q*2 + 1 + pq. -(q - 3)(q + 1)/3 Let m(q) be the third derivative of q6/360 + 107q*5/180 + 2915q*4/72 + 2809q*3/18 - 7157q*2. Suppose m(v) = 0. What is v? -53, -1 Let s(i) be the first derivative of -4i*3/3 - 2088i*2 - 1089936i + 93. Factor s(w). -4(w + 522)2 Let n(i) be the first derivative of 135i*3 + 315i*2 + 245i - 6042. Determine q so that n(q) = 0. -7/9 Let p(q) be the first derivative of -5q6/6 + 308q*5/5 + 111q*4 - 182q*3/3 - 439q*2/2 - 126q + 1783. Determine u so that p(u) = 0. -1, -2/5, 1, 63 Let m = 3759 + -112769/30. Let g(t) be the first derivative of -1/18t3 + 0t + 0t2 - 1/24t*4 + 1/36t*6 + 13 + mt5. Factor g(j). j2(j - 1)(j + 1)2/6 Let r(w) be the third derivative of -w5/360 + 25w4/144 + 7w*3/3 + 1158w*2 + 2w. Factor r(g). -(g - 28)(g + 3)/6 Let -1224/5f*2 + 4136/5f + 58/5f3 + 2/5f*4 - 3872/5 = 0. What is f? -44, 2, 11 Let u(v) be the third derivative of -1/448v*8 + 6v + 0v3 - 27/32v*6 + 243/80v*5 + 0 + 0v*4 - 10v*2 + 3/40v*7. Factor u(g). -3g*2(g - 9)*2(g - 3)/4 Let s(m) be the first derivative of m7/2940 + m6/140 - m*5/20 + 11m*4/84 - 12m*3 + 46. Let w(k) be the third derivative of s(k). Factor w(i). 2(i - 1)*2(i + 11)/7 Let h(l) be the second derivative of -l*6/15 + 18l*5/5 - 17l*4/3 - 12l*3 + 35l*2 - l - 4734. Factor h(w). -2(w - 35)(w - 1)2(w + 1) Suppose 58 + 74 = 11p. Factor -26i*4 - 135 - 108i + 108i3 + 17i*4 + 969i*2 + pi*4 - 837. 3(i - 1)(i + 1)(i + 18)*2 Factor -47a*3 - 8a*4 - 17a*5 + 20a*4 + 15a*3 + 19a*5. 2a*3(a - 2)(a + 8) Let b(l) be the first derivative of -5l*4/4 - 25l*3/3 - 15l*2 - 1047. Factor b(k). -5k(k + 2)(k + 3) Let g(s) be the second derivative of 3s5/35 + 20s*4/21 + 32s*3/21 - 128s*2/7 + 1352s. Factor g(k). 4(k + 4)2(3k - 4)/7 Let l(q) be the second derivative of q6/6 + 9q*5/4 + 5q*4/2 - 40q*3/3 + 134q + 1. Factor l(s). 5s(s - 1)(s + 2)(s + 8) Let p(m) be the first derivative of -m*3/3 - 15m*2/2 + 36m + 214. Let b be p(2). Solve 15/2sb + 0s - 10/3 + 5/3s3 - 5/2s4 = 0 for s. -1, 2/3, 2 Let m(f) be the second derivative of f7/273 - 22f6/195 - 27f*5/26 - 10f*4/39 + 524f*3/39 + 432f*2/13 - 11276f. Determine h, given that m(h) = 0. -4, -2, -1, 2, 27 Let b(k) be the first derivative of -k*5/80 - 5k*4/32 + 3k*3/4 - 19k*2/2 - 3k + 248. Let c(s) be the second derivative of b(s). Factor c(n). -3(n - 1)(n + 6)/4 Let m(i) be the second derivative of 1/48i4 + 0i*3 + 18i + 0 - 1/80i5 + 0i*2. Find u such that m(u) = 0. 0, 1 Let o(j) be the third derivative of 3/20j*4 + 2j*2 + 0 + 0j*3 - 1/300j*6 - 3j - 3/50j5 + 1/525j*7. Let o(h) = 0. Calculate h. -3, 0, 1, 3 Let h be (-25)/216/20. Let m be (-4)/(-10) - (2 - (-46)/h). Let -12tm + 2t*4 - 4t2 + t5 + 11t5 + 2t4 = 0. Calculate t. -1, -1/3, 0, 1 Let c(t) be the second derivative of -t5/20 + 2t4/3 - 7t*3/3 - 3t*2/2 + 383t. Let z be c(3). Factor 3/2y2 + z - 7y*3 + y. -y(2y - 1)(7y + 2)/2 Let s(q) be the third derivative of -q6/120 + 11q*5/30 + 23q*4/24 - 494q*2. Factor s(c). -c(c - 23)(c + 1) Let u(c) be the second derivative of c5/20 - 17c*4/12 - 5c*3/2 - 25c*2 + 370c. Let w be u(18). Factor 34/7b3 - 18/7b - 6b2 + 0 - 6/7b*w. -2b(b - 3)2(3b + 1)/7 Let k(p) be the first derivative of -109p*3/6 + 50p*2/3 + 2p + 6578. Factor k(f). -(3f - 2)(109f + 6)/6 Let q = -7275 - -7278. Let l(c) = 8c - 6. Let d be l(4). Solve do2 + 4 + 8o*q + 110o - 88o + 0o*2 = 0 for o. -2, -1, -1/4 Let d be -6 + 17 - (-86)/2. Suppose 159p = 186p - d. Factor 4w*4 + 0 - 9w*3 + 27/2w - 1/2w5 + 0w*p. -w(w - 3)*3(w + 1)/2 Let j(f) be the second derivative of f*4/48 + 5f*3/2 + 675f*2/8 + 73f - 3. Factor j(u). (u + 15)(u + 45)/4 Let t(p) = 66p*3 - 470p*2 + 1296p - 1238. Let d(g) = g*4 + 133g*3 - 941g*2 + 2592g - 2474. Let q(u) = -2d(u) + 5t(u). Factor q(h). -2(h - 23)(h - 3)*3 Solve -2m*2 + 1 - 120m - 72m - 20m - 1 = 0. -106, 0 Let r(h) be the second derivative of 5h7/42 + 5h*6/2 + 17h*5/2 - 15h*4 - 380h*3/3 - 240h**2	{ "pile_set_name": "DM Mathematics" }
)3). -2sqrt(3)/3 Simplify 0 + -1sqrt(7) - (-1 + sqrt(7) + -2)2. -16 + 5sqrt(7) Simplify (sqrt(343) + 2 + -4 + -3 + -3)*2. -112sqrt(7) + 407 Simplify 5sqrt(6)/sqrt(3)1 + sqrt(16)/(2sqrt(1152)). 121sqrt(2)/24 Simplify (-3(5 + sqrt(6)/sqrt(2)))2 + (1(sqrt(147) - sqrt(147)2))2. 90sqrt(3) + 399 Simplify (-1sqrt(39)3)/((sqrt(135)/sqrt(5) - sqrt(27) - sqrt(27))/sqrt(9)). 3sqrt(13) Simplify 1 + (0 + sqrt(3))2 + sqrt(18)/sqrt(150). sqrt(3)/5 + 4 Simplify -5 + (sqrt(686) + sqrt(686) + 2sqrt(686) - sqrt(14))/sqrt(2). -5 + 27sqrt(7) Simplify 3sqrt(48) + sqrt(3) - ((sqrt(3) - (sqrt(3) + -3sqrt(3)))5 - sqrt(3)). -sqrt(3) Simplify (-4 + sqrt(272) + sqrt(17) - (1 + sqrt(68)/sqrt(4))) + 5. 4sqrt(17) Simplify (5(-5 + (sqrt(10)/(sqrt(5)2 - sqrt(5)) - (sqrt(24)/(sqrt(12) + sqrt(192)) + sqrt(2)))))2. 50sqrt(2) + 627 Simplify (sqrt(104)/sqrt(4)3)/(sqrt(288)1). sqrt(13)/4 Simplify (-4sqrt(8)-2)/(-3sqrt(64) + sqrt(4)). -8sqrt(2)/11 Simplify (1 + sqrt(180) - sqrt(180))*22 - (-1 + -1 + sqrt(180)). -6sqrt(5) + 4 Simplify (5sqrt(72)/(1sqrt(9)))2. 200 Simplify sqrt(2904)/sqrt(12) + sqrt(12)/sqrt(6)2. 13sqrt(2) Simplify sqrt(24)/(sqrt(12) + 1(sqrt(12) - sqrt(12)-1)). sqrt(2)/3 Simplify ((-1sqrt(96))/sqrt(4))/sqrt(12). -sqrt(2) Simplify ((sqrt(3) + 1)2)2 - sqrt(363)1. -3sqrt(3) + 16 Simplify (sqrt(156)/(2sqrt(12)-6))2. 13/144 Simplify 1sqrt(7) + 5 - (sqrt(63)/sqrt(9) + 2)*2. -3sqrt(7) - 6 Simplify (sqrt(114) - 5-2sqrt(114))/sqrt(6). 11sqrt(19) Simplify 3 + (-5(sqrt(3) + (sqrt(3) - sqrt(48))))*2. 303 Simplify ((sqrt(22) - sqrt(66)/sqrt(3))-5 + sqrt(22))/(sqrt(8)/sqrt(4)-2). -sqrt(11)/2 Simplify -2sqrt(432) - (6sqrt(12))2. -432 - 24sqrt(3) Simplify (1 + sqrt(99))*2 + 2 + 0 + sqrt(11) - -5sqrt(121)/(sqrt(33)/sqrt(3)). 12sqrt(11) + 102 Simplify -2(-5 + (sqrt(7) - sqrt(7)2)). 2sqrt(7) + 10 Simplify sqrt(136)/(sqrt(80)/sqrt(10)) + -2 + sqrt(17) + sqrt(17)4. -2 + 6sqrt(17) Simplify ((sqrt(45) - sqrt(5)) + -1 - (sqrt(80) + -3) - (sqrt(45)-25)/sqrt(9))*2. 32sqrt(5) + 324 Simplify (sqrt(432) + 0 + sqrt(432))2-4. -192sqrt(3) Simplify sqrt(100)/(sqrt(4)/sqrt(2)). 5sqrt(2) Simplify (-4(sqrt(204) - sqrt(204)1 - sqrt(204)) - sqrt(204))/(2sqrt(1200))-4. -3sqrt(17)/5 Simplify (-5(sqrt(1584) + 1) + -1)*2. 720sqrt(11) + 39636 Simplify (sqrt(2736) + 0 + -4)-4. -48sqrt(19) + 16 Simplify (sqrt(30) - -5-4sqrt(30))/sqrt(10). -19sqrt(3) Simplify (sqrt(2) - (sqrt(18) + 1)) + sqrt(2) + -1 + 2sqrt(2). -2 + sqrt(2) Simplify (-5(sqrt(468) - (sqrt(468) - ((sqrt(468) - (sqrt(468) - (sqrt(468) + 0 + sqrt(468) + sqrt(468)))) + 4 - sqrt(468)))))2. 2400sqrt(13) + 47200 Simplify -3((sqrt(8) - (5 + sqrt(24)/sqrt(3))) + -5)2. -300 Simplify 5(sqrt(1008)-1-1)*2. 5040 Simplify (sqrt(30)/(sqrt(40)/sqrt(4)) - 6(sqrt(3) + 0))*2. 75 Simplify (-3 + (sqrt(19)-3)*2)2 + 4. 340 Simplify sqrt(425) + -5(sqrt(425) + sqrt(425) + 1)2 + -2 + 0. -8507 - 95sqrt(17) Simplify (sqrt(130) + -2(sqrt(130)-2 + sqrt(130)))/(sqrt(100)/(1sqrt(10))). 3sqrt(13) Simplify (sqrt(108)-23 - sqrt(108))*2 - ((sqrt(108) - sqrt(108)2) + -2). 6sqrt(3) + 5294 Simplify (-1sqrt(320) + sqrt(320))*2 + 1. 1 Simplify 6(0 + sqrt(33)/(sqrt(75) + sqrt(3))). sqrt(11) Simplify 0 + -3 + (sqrt(13) - sqrt(117)) + 1(sqrt(13) + 3) + sqrt(13). 0 Simplify 2 + sqrt(5)2 + 2. 4 + 2sqrt(5) Simplify sqrt(26)/sqrt(2) + sqrt(13) + 4 + sqrt(13)1 + -2. 2 + 3sqrt(13) Simplify (sqrt(170)/sqrt(20))/(sqrt(22)/(sqrt(44)/sqrt(4))). sqrt(17)/2 Simplify (sqrt(475)-1 - sqrt(475) - sqrt(190)/(sqrt(10)-4))2. 28899/16 Simplify (1sqrt(13) + sqrt(13))-6 + 1 + sqrt(13) + sqrt(13) + 3. -10sqrt(13) + 4 Simplify -5 + (sqrt(324)/sqrt(108))/((sqrt(81)2)/sqrt(9)). -5 + sqrt(3)/6 Simplify (-5(-3sqrt(1331) + sqrt(11)))2. 281600 Simplify (sqrt(200)/(sqrt(4) - sqrt(36)5))*2. 25/98 Simplify -4 + (-1sqrt(18)-2)2 + 0. 68 Simplify (sqrt(68) - (2sqrt(68) + 2) - sqrt(68) - (2 + (1 + sqrt(68) - sqrt(68))))*2 + 5. 40sqrt(17) + 302 Simplify 0 + (5 + sqrt(11) + 5)*2. 20sqrt(11) + 111 Simplify ((-5sqrt(114) + sqrt(114))/sqrt(6))2-2. -608 Simplify sqrt(5) + -3sqrt(500) + (sqrt(80)/sqrt(4))2. -29sqrt(5) + 20 Simplify 0 + ((-2 + 2sqrt(1331) - sqrt(1331)) + sqrt(1331))2 + sqrt(1331). -77sqrt(11) + 5328 Simplify 5 + ((1 + sqrt(28)/sqrt(4))3 + -4)2. -6sqrt(7) + 69 Simplify ((3sqrt(504))/sqrt(12))/(sqrt(216) - 2sqrt(216) - sqrt(216)). -sqrt(7)/4 Simplify (sqrt(1331)-3)21. 11979 Simplify sqrt(48) - (sqrt(48) + 2 + sqrt(96)/sqrt(2)) - sqrt(48) - sqrt(27)/((sqrt(90)/sqrt(2))/sqrt(5)). -9sqrt(3) - 2 Simplify 1sqrt(14)/((1sqrt(18))/sqrt(9)). sqrt(7) Simplify -2 + (sqrt(432) + (sqrt(432) - (sqrt(432) + 0)) - sqrt(3)). -2 + 11sqrt(3) Simplify (sqrt(750)-2)/(sqrt(100)/(sqrt(10)-2)). 20sqrt(3) Simplify (sqrt(1408) - 2sqrt(1408))/(sqrt(12)/(sqrt(6)-2) + sqrt(2)). -16sqrt(11) Simplify (-4sqrt(20)1 - (-1 + sqrt(125))3)2. -138sqrt(5) + 2654 Simplify (1sqrt(1539)-1)*2. 1539 Simplify (31sqrt(75) + sqrt(75) - (sqrt(75) + -1 + 2 - sqrt(75)))2. -40sqrt(3) + 1201 Simplify (sqrt(242)4 - sqrt(2))2 + sqrt(8)/sqrt(36). sqrt(2)/3 + 3698 Simplify 2sqrt(9)/sqrt(3) + -5. -5 + 2sqrt(3) Simplify sqrt(38)/(sqrt(150)/sqrt(3))-4. -4sqrt(19)/5 Simplify (sqrt(637)2 - sqrt(637))*2 + 5 + sqrt(637). 7sqrt(13) + 642 Simplify ((-31sqrt(70))/sqrt(10))*2. 63 Simplify (sqrt(133)11)/(sqrt(7) + sqrt(7) + sqrt(56)/(sqrt(8)-1) + sqrt(7)). sqrt(19)/2 Simplify (-5(-3 + sqrt(76)/sqrt(4) - ((2sqrt(19) - sqrt(19)) + 2)))*2. 625 Simplify 22sqrt(171) + sqrt(171) - (sqrt(171) + (sqrt(171) + sqrt(171)3-3 - sqrt(171))). 39sqrt(19) Simplify ((sqrt(1300) + sqrt(1300) + -1)-5)2. -1000sqrt(13) + 130025 Simplify sqrt(28)5 - (sqrt(84)1)/sqrt(12). 9sqrt(7) Simplify sqrt(5) + (sqrt(5) - sqrt(2205)/sqrt(9)) - -4(sqrt(5) + 2). -sqrt(5) + 8 Simplify (-1 + 1 + sqrt(539) + -3)*2-1. -548 + 42sqrt(11) Simplify 3 + -6(sqrt(13) - (sqrt(117)/sqrt(9))*22). -6sqrt(13) + 159 Simplify ((1 + sqrt(176))-5)*2-5. -22125 - 1000sqrt(11) Simplify (5(-1 + sqrt(72)))*2 + -4. -300sqrt(2) + 1821 Simplify 5(sqrt(700) + -2 + sqrt(7) + -5)2 + 0. -770sqrt(7) + 4480 Simplify (1(sqrt(224)/sqrt(4) + sqrt(56)))/(sqrt(32)/sqrt(4)5). 2sqrt(7)/5 Simplify (sqrt(100)/(2sqrt(5)))/(-1sqrt(4)-4). sqrt(5)/8 Simplify 2 + 2sqrt(51)/(sqrt(30)/sqrt(10)). 2 + 2sqrt(17) Simplify (-3 + sqrt(9)/sqrt(3) + sqrt(3) + (sqrt(3) + -1)3)2. -60sqrt(3) + 111 Simplify 1(2 + sqrt(3)-1) + -1. -sqrt(3) + 1 Simplify ((sqrt(300) - (4sqrt(300) + sqrt(300)))/sqrt(6))2. 800 Simplify ((sqrt(1862) - (sqrt(1862) + 1sqrt(1862) - sqrt(1862))) + sqrt(1862))/sqrt(2). 7sqrt(19) Simplify -5 + (1sqrt(19) - sqrt(19) - sqrt(19))*2 + 4. 18 Simplify ((sqrt(104)-2 + sqrt(104))-5)/(2sqrt(648) - sqrt(648) - sqrt(8)). 5sqrt(13)/8 Simplify 5(sqrt(1872)2)2 + 5. 37445 Simplify sqrt(52)/(sqrt(16)/sqrt(4)1). sqrt(13) Simplify sqrt(130)/(3sqrt(10)) - (sqrt(832) + 0). -23sqrt(13)/3 Simplify 4(sqrt(1331) - (-1sqrt(1331) - sqrt(1331))*2). -21296 + 44sqrt(11) Simplify (sqrt(756)/(sqrt(24)/sqrt(2)))/((-2sqrt(108) + sqrt(108))/sqrt(12)). -sqrt(7) Simplify 1(-1 + (sqrt(44)/sqrt(4))2 - (sqrt(11) + 4 + (sqrt(11) - (sqrt(44)/sqrt(4))2 - sqrt(11)) + sqrt(11))). -2sqrt(11) + 17 Simplify ((-3 + sqrt(1331) + -4)-2)*2. -616sqrt(11) + 5520 Simplify (sqrt(9)/(sqrt(12)/sqrt(4)))2 - (0 + sqrt(300))2. -297 Simplify sqrt(110)/(sqrt(30)/sqrt(3)) + (2sqrt(11)-6)*2. sqrt(11) + 1584 Simplify (1sqrt(7) + 3)2 - (sqrt(7) + (sqrt(112) + -1 - sqrt(7)))2. -97 + 14sqrt(7) Simplify (3(sqrt(6) - sqrt(18)/sqrt(3))/sqrt(2))*2. 0 Simplify (sqrt(88) + -5-1sqrt(88))/(sqrt(88)/(sqrt(33)/sqrt(3)) + sqrt(8)). 3sqrt(11) Simplify -52sqrt(425)6. -300sqrt(17) Simplify 5 + (sqrt(33)/sqrt(3) - sqrt(11)) + 3. 8 Simplify (3 + (sqrt(135)/sqrt(5))/sqrt(9) + 1 + 5)*2. 18sqrt(3) + 84 Simplify (((sqrt(220)/sqrt(5) - sqrt(44))-3)/((-3sqrt(48))/sqrt(12)))2. 0 Simplify -2 + (sqrt(35)/sqrt(5))2 + -5. 0 Simplify (-2(-1 + sqrt(720)))2. -96sqrt(5) + 2884 Simplify 2 + 0 + sqrt(1250). 2 + 25sqrt(2) Simplify (sqrt(567) - (sqrt(567)1)*22) + -4. -1138 + 9sqrt(7) Simplify (sqrt(275)4 + -1)*25	{ "pile_set_name": "DM Mathematics" }
an v? True Suppose 3s - 159 = -66. Let f(q) = 22q - 62. Let p be f(4). Suppose 5v = -p + s. Which is greater: 2/87 or v? v Suppose -t - 3p - 12 = 0, -5 + 2 = 3t - 2p. Let m(q) = -q*2 - 15q - 35. Let i be m(t). Which is bigger: i or 3/44? i Let q(j) = -302j + 142j - 13j2 + 151j + 8. Let g be q(1). Let o(k) = k + 26. Let n be o(g). Which is greater: 11 or n? n Let x = 382.9953 + -383. Let w = x + -1.9953. Let z = 2/97 - 208/679. Which is smaller: w or z? w Let h = 8844.08 + -9260. Let c = h - -405. Let o = c + -0.08. Are -2 and o unequal? True Let m = -417 + 155. Let d = m + 264. Which is smaller: d or 51? d Let x = 473 + -551. Which is greater: -0.8 or x? -0.8 Let q = 0.01275 - 101.94475. Let l = q + 102. Let g = l + 0.132. Do -34 and g have the same value? False Let p = -0.097 + -12.503. Let v = p - -12.695. Is v less than 1/4? True Let u = 283 + -17. Let r = u - 182. Let v be 7/28 - 129/r. Which is smaller: -2/7 or v? v Suppose -5544 = -686l + 684l + 3t, -4t - 5536 = -2l. Are 2783 and l non-equal? True Let h = -5044 + 5044.14. Is h > 0.015? True Let z be (-17 + 32)/((16/(-12))/(-4)). Let w = z - 45. Let k be -1 - 6/(-57)8. Which is bigger: w or k? w Let o(d) = d*2 - 9d + 23. Let c be o(4). Let r = -0.54 + 26.54. Let x = r - 53. Is x greater than c? False Let j(n) = -2n3 - 1. Let m be j(-1). Let y = 422 + -257. Let u = 167 - y. Which is smaller: m or u? m Suppose -4v - 15736 = 4q, -v - 9871 + 1998 = 2q. Is -3939 > q? False Let c(b) = b + 11. Let a(u) = -10. Let i(p) = -2a(p) - 3c(p). Let j be i(-7). Suppose 7 = -k + j. Which is bigger: 36/19 or k? 36/19 Let t be -94 + 2/2 + 26 + -33. Let z = 155472/5 + -31195. Do z and t have the same value? False Let n(q) = q*2 + 45q + 349. Let g be n(-10). Is g at most as big as -3/146? True Let a = -72 - -83. Let o(x) = -x*2 + 7x + 35. Let r be o(a). Let y be 3/r + 176/60 + -3. Which is smaller: 23 or y? y Suppose -2n - 2q - 34 = 0, 0 = -3n + q + 8 - 59. Let l = n - -27. Suppose 0 = -4h + 8v - 9v + 6, -3v - 10 = -2h. Which is greater: l or h? l Let v(b) = -12b - 65. Let a be v(0). Suppose 3r + 270 = 6r. Let s = -155 + r. Is a greater than s? False Let b = -53 + 38. Let m be ((-8)/10)/(6/b). Let x = m + -7/3. Which is smaller: x or 0.1? x Let z(a) = a2 - 15a - 30. Let x be z(17). Suppose 0 + 3 = 2d - l, 24 = xd + 4l. Which is smaller: d or 1? 1 Let y = 782/95 + -124/15. Let a(c) = -c3 - 11c*2 + 27c + 32. Let t be a(-13). Suppose 0 = -3l + 6l - 4b + t, -l - 21 = -5b. Is y >= l? True Suppose 5w = -3607 - 5153. Is -1/4 not equal to w? True Let m(g) = 358g + 1237. Let h be m(-17). Is h not equal to -4848? True Suppose 2l + 3n - 23 = 0, -4n = -0l - 5l. Let z be l(-4)/32 + (-10)/(-12). Let j = -80 + 80.2. Which is smaller: z or j? j Suppose 0 = -4z + 756 - 44. Let s = 327/2 - z. Is s < -16? False Let o = 10 + -6. Let s = 4765/8 - 595. Which is smaller: o or s? s Let q = -45227 - -632859/14. Let i be 215/7 + (-15)/35. Let j = q + i. Are j and 7 nonequal? True Let w = -0.5 - -121.9. Let c = w - -7.6. Which is smaller: c or 1? 1 Let v = -0.2601 + -0.7399. Which is bigger: -468 or v? v Let o = -9788 - -9727. Are 18 and o equal? False Let g be (58/(-12) - -5) + (-2)/12. Let q be g/((-21)/(-3))1. Which is smaller: 1/448 or q? q Let f(y) = -y*2 + 10y - 11. Let r be f(5). Suppose 2q + 3q = a - 16, 2a - r = q. Let n = a - -3. Is n at least as big as 10? False Let a = 0.15 - 0.18. Let r = 5768 + -17293/3. Is r at least as big as a? True Let b = 0.7 + -2.4. Let o = -0.3 + b. Let y = 34579 + -242059/7. Which is smaller: o or y? o Suppose 998 = d + x, -x = 5d - 1277 - 3737. Which is greater: d or 4015/4? d Let l = 2/3205 + 5388/1637755. Suppose -4r - 19 = b, -20 = -5b + 2r + r. Which is bigger: l or b? b Let y = 1434.0296 - 1434. Which is smaller: y or 2/9? y Suppose -29 = -4i - 5j - 90, 3j = -27. Let p = 176/29 + -2251/261. Which is greater: i or p? p Let w be 105/(-2226)(-8)/(-65). Which is smaller: w or 1? w Let o = 15/1421 + -222/7105. Is 2.5 at most as big as o? False Let i be 88/4790/(-869). Is 10 at least as big as i? True Let i be (0 - -1) + ((-2)/(-1) - 2). Let t be -12 + (-2 - (-3249)/231). Are t and i non-equal? True Let h = 1120 + -1136.1. Which is smaller: h or 61? h Let j = 5 + -8. Let c be (j(-6)/63)/(-3). Suppose s = -5y + 7, -2s - 3s = y - 11. Which is greater: c or y? y Let x(j) = -9j - 12. Let q be x(2). Suppose -3w + 65 = 23. Let m be (8/q)/(w/1 - 4). Is -1 smaller than m? True Suppose 0 = 2y - 27 + 23. Suppose 0 = 5k - yk - 45. Let i be (-3)/((-12)/20)4/k. Is i at most 0? False Let l(r) = r*3 + 4r*2 - 11r - 2. Let h be l(2). Which is bigger: h or -1/1744? h Suppose -3d + 27 = 4y - 6d, -y - 5d - 22 = 0. Suppose -c + 10 = h, 4h - 43 = -yc - 3. Suppose 7i - 78 = hi. Is 0.2 > i? True Let d be (9 + -37 + 38)/(-15). Suppose 0 = -4y - 5h + 12, 2y + 3h = 2h. Which is bigger: y or d? d Let c be 5/((-105)/2) + (17 - 13370/588). Which is greater: -42 or c? c Let c = 155 - -199. Suppose -648 = -cm + 360m. Is -109 less than or equal to m? True Suppose 5x - 13 + 62 = -2w, -6x - 3w = 57. Which is smaller: x or -1/8? x Suppose 3v + 2i + 109 + 5 = 0, -154 = 4v + 2i. Let q be 3/(-15) - v/75. Suppose 0 = -n + 3n - 2. Does n = q? False Let h = -302630/801 - 946/89. Let v = -2541574/6543 - h. Are 1 and v non-equal? True Suppose 10008q - 34245 = 9993q. Is q greater than or equal to 2286? False Let h = -28 + 46. Let k = -649.839 - -650. Let f = -0.061 + k. Which is smaller: h or f? f Let m = -16/585 + -1/90. Let z = -89/52 + m. Let d = z + 5/4. Which is smaller: d or -1.7? -1.7 Let d be (-4)/18 + 21235/99324. Which is smaller: d or 1? d Suppose y + 401 = -2p + 1478, 4y - 1618 = -3p. Let n = -543 + p. Which is smaller: n or -55/9? -55/9 Let o be (256/(-96) + 9 + 1)/((-4)/222). Do -407 and o have the same value? True Suppose 3f = 2o, 5f - 4o = -2 - 0. Let c(k) = -k - kf - 4k + 21k - 14. Let q be c(15). Are q and -2/121 nonequal? True Let l(u) = 6u - 42. Let y be l(7). Suppose ya + 3a - 4 = -2p, 0 = a - 3p - 16. Which is bigger: -5 or a? a Suppose 474t + h + 135 = 477t, 3t = -4h + 150. Which is bigger: t or -5/3? t Let g = 3788 - 4690. Which is bigger: g or -897? -897 Let m = 2/863 + 2293/127724. Suppose -11c + 4n = -14c + 21, -2c = -4n + 26. Is m <= c? False Let i be 6/39 - (96/(-52) - -3). Let f = 300533/37 - 8123. Is i <= f? True Let n = -72 + 124.3. Let u = -36 + n. Let o = 3.7 + u. Is -0.1 smaller than o? True Let h be (1 + -1)/(-7 + 5). Let g be -1 + h - (-1)/28. Suppose -2o + 1 = -3. Are g and o non-equal? True Let r = 2 - 3. Let q = 71614821/721 + -297982/3. Let w = q + 7/103. Is r < w? True Let n = -676/2519 + -1/229. Let j(v) be the second derivative of -v4/3 - 41v*3/6 - 11v*2/2 + v - 8. Let y be j(-10). Which is smaller: y or n? y Let n = -2 + 1.69. Let z = n - -1.31. Let s = -3 + 4. Is s smaller than z? False Suppose -329i = -322i - 607 - 3558. Is i smaller than 595? False Suppose 4a = 4, 85x = 83x + 5a + 5. Let k(i) = -i2 - 6i - 3. Let c be k(-2). Suppose 2y - 3y + c = 0. Is y at most x? True Suppose 4a - 8z = -10z - 460, 8 = 4z. Is -103 smaller than a? False Let h(j) = -129j2 - 62. Let s be h(11). Let i = -109941/7 - s. Is i equal to -36? False Let q = -181.9961 - 0.0039. Let y = q + 176. Is y != -12? True Let a = -0.3 - -1.3. Let i = 1079 + -1081. Let c = a - i. Which is bigger: c or 7? 7 Suppose 0 = g - 4, -4g - g = 4p + 68. Let a = p - -22. Let m = 0 + -2/25. Is m not equal to a? True Let v be ((-1)/(-3))/((-75)/(-2145)-11). Which is smaller: v or 7? v Let v = 49 - 42. Suppose -5m + vm = -6. Let q = -21 + 14. Which is bigger: q or m? m Let r = 915/23 + -20225/69. Which is smaller: r or -253? r Let w = -5.233 + 1.233. Which is smaller: w or 1075? w Suppose -3u + 6l - 2l = -9446, -2u + 2l = -6302. Which is greater: 3159 or u? 3159 Let l = 0.09516 + -0.12016. Which is greater: l or -0.55? l Suppose -264y = -267y + 1086. Let s = 3607/10 - y. Is 0 < s? False Let l be 228 + -223 - (514/(-6) - 1/3). Which is smaller: 97 or l? l Suppose 0 = -16p - 0*p - 672. Let o be (-4)/14 + (-9 - 376/p). Let u = 0.8 - -0.2. Which is smaller: o or	{ "pile_set_name": "DM Mathematics" }
. Suppose -wy + 97 = -113. Calculate the greatest common factor of 10 and y. 10 Let s = 431 - 414. Calculate the highest common divisor of s and 17. 17 Let u = 8 - -1. Suppose q = 2r - 52, 0 = 4q + 7 + u. Calculate the greatest common divisor of r and 3. 3 Let q = -89 + 289. What is the highest common factor of 25 and q? 25 Suppose -3r + h = -115, 5h = 5r - 227 + 52. Let m(p) = -30p - 250. Let a be m(-9). Calculate the greatest common divisor of r and a. 20 Suppose 371r - 362r = 243. Calculate the greatest common divisor of r and 351. 27 Let o(n) = 5n + 169. Let d be o(46). What is the highest common factor of 63 and d? 21 Suppose -g - 2g = -48. Let m = -83 - -131. Calculate the greatest common divisor of m and g. 16 Let x = 0 + 174. Suppose 5b + 5h - 340 = -0h, -3b + 3h = -x. Suppose g + 1 = -4w, -g - 2w = -3g + 18. Calculate the greatest common divisor of g and b. 7 Suppose 0 = 5x - 4v + 8v - 868, 3x - 2v = 512. What is the highest common divisor of 215 and x? 43 Suppose -219x + 770 = -208x. What is the greatest common divisor of 56 and x? 14 Suppose 85n - 62n - 25254 = 0. Calculate the greatest common factor of n and 54. 18 Let q = -527 - -1052. Calculate the highest common divisor of q and 50. 25 Let b = -19 + 41. Let s = 36 + -20. Suppose -2l + b = -s. Calculate the highest common factor of l and 19. 19 Let w(b) = -3b*3 - 2b*2 - 3b - 1. Let x be w(-2). Let f be (-1 - 1)/(36/126). Let v = x + f. Calculate the greatest common divisor of v and 70. 14 Let u(d) = -d*3 + 20d*2 - 16d + 32. Let z be u(8). Calculate the greatest common factor of 21 and z. 21 Let f be 3/2112/42. Suppose 4x - 164 = -3q, fq - x - 125 - 62 = 0. What is the greatest common divisor of 12 and q? 12 Let b(r) = 41r - 2r*2 + 7r*2 - 37r - 3r2 - 7. Let w be b(-4). Calculate the greatest common factor of 3 and w. 3 Let l(h) = -2h*2 - 10h - 2. Let y be l(-5). Let x(a) = -18a3 + 3a*2 - 3. Let c be x(y). What is the greatest common divisor of 17 and c? 17 Suppose -5a = -9a - 36. Let j be 103 - (a/3 - -2). Let c be (4/6)/((-2)/(-39)). Calculate the highest common divisor of j and c. 13 Let f = 78 - 36. Suppose 5p - 3n - 8 = 16, 3p - 22 = -2n. Calculate the greatest common divisor of f and p. 6 Let v(d) = 4d - 5. Let g be v(20). What is the highest common factor of g and 120? 15 Let w(q) = q*3 + 4q*2 - 12q - 13. Let r be w(-5). What is the highest common divisor of r and 594? 22 Let v be 0 + 1 + (13 + -6 - 3). Suppose 8 = 3w - vn - 31, w - 3n = 9. What is the highest common divisor of 6 and w? 6 Suppose i - 3w - 15 = 0, -2i + i - 5w + 23 = 0. Let m = i + -7. Suppose 3h - 162 = -3j, h + 4j = 5j + 56. What is the highest common factor of m and h? 11 Let y = 6 + 4. Let s(m) = -2m2 + 21m - 4. Let c be s(y). Suppose -3h = 2p - 19, -p - 1 = 3h - 5h. What is the highest common divisor of c and h? 3 Let d(v) = v*3 - 20v*2 + 51v + 29. Let g be d(17). What is the highest common factor of g and 174? 29 Suppose -22 + 64 = 6s. Calculate the greatest common factor of 63 and s. 7 Suppose 10r - 7r - 1436 = -5s, -r - 1159 = -4s. Calculate the greatest common factor of s and 102. 17 Suppose g + 0w - 48 = -3w, 2g - 96 = -5w. Suppose n = b + 28, -2n + 10b + 72 = 12b. Calculate the highest common divisor of n and g. 16 Let v = 581 + -331. What is the greatest common divisor of v and 20? 10 Suppose -4k = -6k + 10, c + 5k = 31. Let w be 0 + 62/c. Let z be w/((-1)/15-2). Calculate the highest common divisor of 135 and z. 15 Let k = 127 - -33. Calculate the greatest common divisor of k and 10. 10 Let t be 9/108 - (-1259)/12. Calculate the highest common divisor of 135 and t. 15 Let f be (-7)/((-7)/30)(-1157)/(-178). Calculate the greatest common divisor of 30 and f. 15 Suppose d + 4g = 31, -3d + 5g + 11 = 3. Let m = d + -8. Let k = 3 - -12. Calculate the greatest common divisor of m and k. 3 Let o be (-1 - (7 - 7))/(2/(-22)). Calculate the greatest common factor of o and 297. 11 Let m = -2214 + 2316. What is the highest common divisor of 66 and m? 6 Let h(d) = d2 + 28d - 128. Let x be h(17). What is the highest common divisor of 91 and x? 91 Let p(m) = -m*3 - 3m*2 + 18m - 2. Let z be p(-8). What is the highest common divisor of z and 9? 3 Suppose 564 = 39b - 1620. Let v be (-26)/(-8) - (-1)/(-4). Suppose 0 = 2f - 4c - 20, -6f + vf = -5c - 32. Calculate the highest common factor of f and b. 14 Let s be -8(-2)/4-1. Let v be (s - -3)/(2/(-72)). Let k = 19 - 7. Calculate the greatest common divisor of k and v. 12 Let l be (-1)/4 - 21/12. Let h(g) = g*3 + 3g*2 - 2. Let j be h(l). Let a be (8 - (-220)/(-30))/(2/6). What is the greatest common factor of a and j? 2 Let f = -2545 + 2575. What is the greatest common divisor of f and 1515? 15 Suppose 19a = 21a - 2. Let n(u) = 13u3 - u2 - u + 1. Let m be n(a). Calculate the greatest common factor of m and 8. 4 Suppose 3z - 6y = -3y + 21, 4z = y + 43. Let v(t) = 148 - 153 + 0t - 4t + t*2. Let u be v(-7). What is the highest common divisor of z and u? 12 Suppose 0 = 4d - 4 - 4. Let l be d3 - (-4)/(-1). Suppose -4p + 90 = -lp. Calculate the greatest common divisor of p and 18. 9 Suppose 4k - 592 = 4c, -c + 586 = 4k + c. Suppose -4p - 13 = -97. Calculate the highest common divisor of k and p. 21 Let s(y) = 124y*2. Let n be s(-1). Let x be -4-61/8. Let g be ((-62)/x)/(8/(-12)). Calculate the highest common divisor of n and g. 31 Suppose -a - 5 = -10. Suppose 2m + 2850 = -5f, -5m = -af - 789 - 2026. Let g = -392 - f. What is the greatest common factor of g and 16? 16 Let c be (-8)/1422540/(-184). What is the greatest common divisor of c and 2275? 35 Suppose -5t + 4o = -63, 5t + 5o - 2 = 43. Let h be 119/3 - (-2)/(-3). Let b = -17 + h. Calculate the greatest common divisor of b and t. 11 Suppose 35m + 2m = 1332. What is the highest common divisor of 156 and m? 12 Suppose -2t = -7t - 375. Let k = 207 + t. Calculate the highest common factor of k and 12. 12 Suppose -22 = 3o - 19. Let v(z) = 63z*2 - z - 2. Let a be v(o). Let g be 618/4 + (-6)/(-12). Calculate the greatest common factor of a and g. 31 Let b = 42 - 40. Let j(a) = 2a*3 - 3a*2 - 2a + 1. Let c be j(3). What is the greatest common factor of c and b? 2 Let b be (0 + -5)/(2 + 156/(-76)). Calculate the greatest common factor of 57 and b. 19 Suppose -2g = 3b - 8, 4b - g = -2g + 4. Let w be b - -1(-160)/(-4). Let o = w + -23. What is the greatest common factor of 136 and o? 17 Let f = -322 - -474. Suppose -148r + fr - 40 = 0. Calculate the highest common factor of r and 5. 5 Let g be (-7 - (2 + 5))-64. Calculate the highest common divisor of g and 28. 28 Let u be (6576/(-16))/(-2 - (1 + -2)). What is the greatest common factor of 3 and u? 3 Suppose 2v = 4i + i + 1264, 3v + 3i = 1917. What is the greatest common divisor of 26 and v? 13 Suppose -17064 = -24n - 2280. What is the highest common divisor of n and 110? 22 Let k(m) = 17m - 29. Let w be k(6). Let h = w - 19. What is the highest common factor of h and 27? 27 Let p(z) = -z*3 + 2z*2 + 7z + 9. Let u be p(-8). Let r = -307 + u. What is the greatest common divisor of 26 and r? 26 Let r be -4 + (11 - -855)/(-1 - -3). Calculate the highest common factor of r and 11. 11 Let a = 37 + -33. Suppose al - 92 = 4h, 4l - h - 90 = 4h. Calculate the highest common factor of 250 and l. 25 Suppose -8g + 169 = -247. What is the highest common divisor of g and 130? 26 Suppose 4h - 2f - 6 = 0, -h + 2h = 2f. What is the highest common divisor of h and 6? 2 Let b(h) = h2 + h + 35. Let k be b(0). Suppose 0 = 10o - k - 115. Calculate the highest common divisor of o and 105. 15 Let o = 111 - 1. What is the highest common divisor of o and 44? 22 Let n = 53 + -35. Suppose -2r = 16 + 10. Let w = n + r. What is the highest common divisor of 45 and w? 5 Let k(y) = 3y*3 + 25y*2 - 14y - 10. Let x be k(-8). Calculate the greatest common divisor of x and 415. 83 Let l = 101 - 46. What is the highest common factor of l and 605? 55 Suppose -8 = -5q + 7. Suppose b + b + qu = 247, 3b - 372 = -4u. Let p(l) = -14*l + 2. Let g be p(-1). What is the highest common factor of g and b? 16 Sup	{ "pile_set_name": "DM Mathematics" }
ut replacement from {r: 1, k: 1, w: 1, s: 3, a: 1, c: 5}. What is prob of sequence wcc? 1/66 Two letters picked without replacement from {m: 5, y: 1, t: 14}. Give prob of sequence my. 1/76 Two letters picked without replacement from dfavdavudvuuddvu. Give prob of sequence dv. 1/12 Two letters picked without replacement from {q: 3, j: 2, d: 3, s: 12}. What is prob of sequence qq? 3/190 What is prob of sequence mmmm when four letters picked without replacement from ammaammammmmaaaamaaa? 42/1615 Calculate prob of sequence vn when two letters picked without replacement from vnsqgqb. 1/42 Two letters picked without replacement from zabglgbzd. Give prob of sequence bz. 1/18 What is prob of sequence twa when three letters picked without replacement from twkaa? 1/30 Calculate prob of sequence mmx when three letters picked without replacement from {x: 4, m: 14}. 91/612 Calculate prob of sequence ux when two letters picked without replacement from nuxx. 1/6 Two letters picked without replacement from {v: 5, f: 1, u: 11}. What is prob of sequence fu? 11/272 Calculate prob of sequence uucw when four letters picked without replacement from sbuwbbcubuubb. 1/1430 What is prob of sequence nn when two letters picked without replacement from {n: 4, w: 2, t: 6}? 1/11 Three letters picked without replacement from xwwwwwkfxs. What is prob of sequence xfx? 1/360 Two letters picked without replacement from nvnvnnnvnnv. What is prob of sequence vn? 14/55 Two letters picked without replacement from ixxaxax. Give prob of sequence xa. 4/21 Two letters picked without replacement from hzzhzwhwhzhwhw. What is prob of sequence hz? 12/91 Three letters picked without replacement from dfqqqve. Give prob of sequence vfe. 1/210 Three letters picked without replacement from rrryoor. Give prob of sequence rrr. 4/35 Two letters picked without replacement from syauayqyaauqyqayy. What is prob of sequence yq? 9/136 Two letters picked without replacement from kkko. What is prob of sequence kk? 1/2 Three letters picked without replacement from vyvcccycrcccccgcggc. What is prob of sequence yvr? 2/2907 What is prob of sequence xx when two letters picked without replacement from exeeexebbeeiebeiiib? 1/171 Calculate prob of sequence rd when two letters picked without replacement from {r: 1, s: 5, k: 1, d: 2}. 1/36 Four letters picked without replacement from etskkzwwzstzskz. What is prob of sequence zwte? 2/4095 Four letters picked without replacement from nqnpnpunpmmunumrmnr. What is prob of sequence mmnq? 1/1292 Four letters picked without replacement from jrremdyjyyrerre. What is prob of sequence yemd? 1/3640 Four letters picked without replacement from ccrcrcccccccc. Give prob of sequence ccrr. 1/78 Calculate prob of sequence iiu when three letters picked without replacement from {u: 1, i: 2}. 1/3 What is prob of sequence rrnr when four letters picked without replacement from rrjjnxrjnnj? 1/440 Calculate prob of sequence cs when two letters picked without replacement from cbcxbssbjsss. 5/66 What is prob of sequence jxk when three letters picked without replacement from jvivjxxvmjjjxxmvxkv? 25/5814 Calculate prob of sequence xxi when three letters picked without replacement from xkxki. 1/30 Calculate prob of sequence jr when two letters picked without replacement from wrjqqzqwjqjwwjw. 2/105 Four letters picked without replacement from {g: 4, j: 7, m: 1, l: 4, q: 1, i: 3}. Give prob of sequence ilmq. 1/9690 Two letters picked without replacement from {o: 1, s: 1, h: 2, c: 1, v: 2, q: 1}. Give prob of sequence hq. 1/28 Calculate prob of sequence nb when two letters picked without replacement from nnxmunb. 1/14 Two letters picked without replacement from ssuutsutsstsuuutwww. What is prob of sequence uu? 5/57 Two letters picked without replacement from eeefeeeef. What is prob of sequence ff? 1/36 Two letters picked without replacement from lylokliiklilylylyi. What is prob of sequence yy? 2/51 Three letters picked without replacement from {r: 2, d: 2, b: 2, l: 3, y: 1, j: 4}. What is prob of sequence ybd? 1/546 Calculate prob of sequence lb when two letters picked without replacement from {s: 1, l: 3, b: 1, n: 2}. 1/14 Two letters picked without replacement from {l: 8, i: 2, z: 1, v: 2, u: 1, f: 3}. What is prob of sequence il? 1/17 Calculate prob of sequence nu when two letters picked without replacement from {u: 1, i: 12, q: 1, b: 2, n: 3}. 1/114 Two letters picked without replacement from {i: 2, u: 2, p: 1, b: 2, t: 1, e: 1}. Give prob of sequence tu. 1/36 Four letters picked without replacement from ieiiiigeiiig. What is prob of sequence giii? 28/495 What is prob of sequence auau when four letters picked without replacement from {a: 2, u: 2}? 1/6 What is prob of sequence aaim when four letters picked without replacement from iuamiiuaiuiui? 1/1430 Calculate prob of sequence ld when two letters picked without replacement from kdkkdlk. 1/21 Calculate prob of sequence ol when two letters picked without replacement from {n: 1, o: 10, l: 1, y: 3}. 1/21 Three letters picked without replacement from {i: 1, z: 2, x: 2, f: 1, c: 1, u: 2}. Give prob of sequence zcx. 1/126 Two letters picked without replacement from {j: 9, x: 5}. What is prob of sequence jj? 36/91 What is prob of sequence nl when two letters picked without replacement from {n: 2, l: 1}? 1/3 Four letters picked without replacement from {o: 1, p: 1, i: 2, j: 1}. What is prob of sequence opii? 1/60 Three letters picked without replacement from jljljlqqjl. Give prob of sequence qjq. 1/90 Calculate prob of sequence xx when two letters picked without replacement from xsxdsxxxdxxxx. 6/13 Four letters picked without replacement from mjyryryy. Give prob of sequence rmyr. 1/210 Four letters picked without replacement from {j: 4, v: 2, l: 3, d: 1}. Give prob of sequence ddvd. 0 What is prob of sequence kkk when three letters picked without replacement from mymymmmkmkmmm? 0 Two letters picked without replacement from {q: 4, j: 1, e: 2, z: 4, w: 6}. What is prob of sequence ww? 15/136 Calculate prob of sequence aah when three letters picked without replacement from {h: 1, j: 1, s: 1, b: 1, a: 2, r: 2}. 1/168 Calculate prob of sequence yny when three letters picked without replacement from {n: 9, y: 9}. 9/68 Two letters picked without replacement from {p: 2, k: 1, q: 1, i: 5}. Give prob of sequence kp. 1/36 What is prob of sequence tiz when three letters picked without replacement from uiithzzihhh? 1/165 Calculate prob of sequence vmo when three letters picked without replacement from mzmmommozovmz. 3/286 Calculate prob of sequence kakh when four letters picked without replacement from dbdabbddhhkdbkbbbbkh. 1/6460 Calculate prob of sequence xm when two letters picked without replacement from {o: 1, g: 2, p: 1, x: 1, d: 1, m: 1}. 1/42 Three letters picked without replacement from vvyyvvyvyvvyvv. Give prob of sequence vvy. 15/91 Two letters picked without replacement from zqxqzzqz. What is prob of sequence qq? 3/28 Three letters picked without replacement from {y: 2, v: 1, k: 2, i: 1}. Give prob of sequence yky. 1/30 Two letters picked without replacement from zmzcczzzjmzmzmjz. What is prob of sequence cz? 1/15 Three letters picked without replacement from {g: 3, r: 2}. What is prob of sequence rgr? 1/10 What is prob of sequence oho when three letters picked without replacement from {o: 2, z: 2, g: 5, h: 8, t: 1}? 1/306 What is prob of sequence yfn when three letters picked without replacement from {n: 2, x: 4, r: 3, y: 3, f: 2, s: 1}? 2/455 What is prob of sequence gftf when four letters picked without replacement from {g: 5, f: 2, t: 1, v: 3, q: 1}? 1/1188 Two letters picked without replacement from vvvvvvv. What is prob of sequence vv? 1 Calculate prob of sequence ajj when three letters picked without replacement from jajbujb. 1/35 Four letters picked without replacement from ggtoggottoo. What is prob of sequence toog? 1/55 Calculate prob of sequence vkkk when four letters picked without replacement from vbkakvkvvk. 2/105 What is prob of sequence ox when two letters picked without replacement from {q: 3, l: 3, x: 9, o: 2}? 9/136 Two letters picked without replacement from {c: 2, s: 1, r: 1, d: 5}. Give prob of sequence rd. 5/72 What is prob	{ "pile_set_name": "DM Mathematics" }
q. Is f a prime number? False Let p = 37 - 37. Suppose 0 = 4y + g - 3251, -3y + 4g - 2g + 2452 = p. Suppose 4n - 2z - y = 0, -561 - 49 = -3n + z. Is n a prime number? False Let f = -2601 - -12790. Is f a composite number? True Let o(z) be the third derivative of -z4/24 + z3/3 - 2z*2. Let h be o(0). Suppose m - 1503 = -hf, 2f - 2m - 800 - 712 = 0. Is f prime? False Suppose -108 = -50f + 68f. Let r(v) = 9v2 - 4v - 17. Is r(f) prime? True Let t(d) = -d*3 + 5d*2 + 6d + 54. Let h be t(7). Is (7/(35/(-28850)))/h prime? False Let l(y) = -25y3 - 18y*2 + 417y + 77. Is l(-24) composite? False Let j(p) = 25p3 - 14p*2 + 18p - 48. Let z be j(7). Suppose 0 = 92g - 93g + z. Is g a composite number? True Let o = 10 + -5. Let z = -2023 + 4653. Suppose z = -ok + 7k. Is k a composite number? True Suppose 2j = 3b + 2, -4j = 7b - 4b - 22. Is 3 + (3325 - 13) + b1 prime? False Suppose -4090 = -8k + 9k. Let z = k - -6024. Suppose -4877 = -5b + 2q, 4b = 6b - 5q - z. Is b a prime number? True Let r = 43723 + 729248. Is r a composite number? True Suppose -258 = -9v + 354. Let l = 68 - v. Suppose lr + r = 1055. Is r a composite number? True Suppose 0 = 5d - 4r - 438607, -11d + 14d - 2r = 263163. Is d a prime number? True Let d(g) = -g*3 - 3g*2 + 4g + 702. Let a be d(0). Is -20 + 18 + a356/8 a composite number? False Let a be 2 - (-2 - 28102)/2. Suppose 4w = -5v + 17552, 8v - 4v - 3w = a. Suppose 5k - v = -3k. Is k a composite number? False Let b = 200483 - 73788. Is b prime? False Let p(o) = -421o2 + 37o + 5. Let j(v) = 420v2 - 37v - 7. Let f(d) = -5j(d) - 6p(d). Is f(4) prime? True Let h(l) = 14l3 - 18l*2 - 27l - 36. Is h(13) a prime number? True Let x(d) = d*2 + 8d + 12. Let j = 47 - 52. Let s be x(j). Let v(y) = -403y + 4. Is v(s) a composite number? False Let p(c) be the third derivative of c6/120 - c5/10 + 5c*4/8 + 13c*3/6 + 41c*2. Let b = -5 - -15. Is p(b) composite? False Let t(y) = -12y*3 - 5y*2 + 105y + 899. Is t(-18) a composite number? True Suppose 193 = -5r - 1502. Let w = r - -904. Is w a composite number? True Let x = 918 - 1491. Let b(y) = 50y - 117. Let f be b(4). Is x/(-12)(9 + f) a prime number? False Suppose 3d + 391 = 10. Is -3 - (d - 0)/(9/18) a prime number? True Let z be (-66)/12/4. Let b = -1384 + 1448. Let g = z + b. Is g composite? False Let y(l) = 40l*2 - 22l + 305. Let u be y(12). Let b = -3342 + u. Is b a composite number? False Suppose 5g - 2z - 205 = 2g, -4z = 3g - 175. Let p = -993 + 495. Let q = g - p. Is q a composite number? False Suppose -4w = 8, -3w - 4 = -i + 4. Is i/10 + (-369552)/(-40) a prime number? True Suppose -4k + 3 = -9. Suppose 2f - kf = -3. Suppose 4w + 469 = -fx + 14980, -3x = -w - 14511. Is x composite? True Suppose 0 = 4u - q - 227071, -19q + 283836 = 5u - 23q. Let c = u - 34999. Is c prime? False Let r be 18((-20)/(-9) - 2). Suppose 2a - ra = -10, -3m + 2a + 9071 = 0. Is m prime? False Let w(d) be the third derivative of d8/2880 - d7/168 - d6/120 - d5/10 - d*2. Let x(r) be the third derivative of w(r). Is x(7) prime? True Suppose -r + 2r = 1, 5n + 3r - 44968 = 0. Suppose -2177 = 4c - 4k - n, -c - k = -1708. Is c prime? False Let g(w) = 2w3 + w2 + w + 1. Let l be g(-1). Suppose 507 - 531 = -12n. Is (650/8 - l) + n/(-8) composite? True Suppose 58078121 - 9029196 = 25c. Is c a composite number? False Let r(c) = -c3 + 20c*2 - 18c - 28. Let g be r(19). Let t(a) = -394a + 61. Let q(b) = -131b + 20. Let k(j) = -17q(j) + 6t(j). Is k(g) composite? False Let q be 6/(-4)16/12 + -13. Is q/3 + 8/1 - -4438 composite? False Let j(v) = -4v + 3v3 - 67v*2 + 61v*2 - 21v*2 - 3 + 0v*3 - 6. Is j(11) prime? True Suppose 7 = -k, -5z + 7z = 4k + 184946. Is z a prime number? True Let j(b) = 546b2 + 31b. Let o = 218 + -221. Is j(o) a prime number? False Let b = 93 - 66. Let d = b - 25. Suppose dp = 412 + 240. Is p a composite number? True Suppose -228j + 231j = 36. Is -639(44/j - 4) a composite number? True Suppose 0 = 2r - 3l - 1, 0 = 5r + 10l - 11l - 35. Is r/36 + 367465/63 a composite number? True Let g(x) = x2 - 20x + 16. Let i be g(19). Let l be 2809 - (i/(-4) + 24/(-32)). Is 22/(-77) + l/7 composite? False Let s = -7 + 4. Let v(i) be the second derivative of -i5/5 - i4/12 + i*3/3 - 3i*2 - 5i + 7. Is v(s) a prime number? False Let m(u) = -41 + 12u2 - 4u*2 - u - 4u - 13. Let p be (-132)/44 - (-8 + 0)/(-2). Is m(p) composite? False Let h(v) = 10v2 + 655 - 320 - 319 + 15v. Is h(-21) composite? False Let f(v) = -9v + 52. Let k be f(6). Is (-1441 - k/1)/(-1) composite? False Let j be (-1)/(3/64447) + (-13)/(-39). Let o = j - -32751. Is o a composite number? True Suppose -490h = -504h + 492478. Is h composite? True Let x(a) be the first derivative of -129a*2/2 - 20a + 20. Let v(o) = 258o + 41. Let q(d) = -3v(d) - 7x(d). Is q(8) prime? True Suppose -2p = -5a - 27 - 48, 0 = -3p - a + 70. Suppose 2c - 2s = 42330, -pc - 5s = -21c - 84642. Is c a prime number? True Let d be 44/6(-12393)/18. Let p = 13712 + d. Is p a prime number? True Let p be (-52)/3(-186)/4. Let i = -214 + -355. Let j = i + p. Is j prime? False Suppose 36c + 70c = 6076874. Is c prime? True Suppose 5339465 = 40z - 3584015. Is z a composite number? False Let c = 3470 + 3525. Is c a prime number? False Suppose -24 = 706z - 712z. Suppose 0m - 3m + 27291 = zu, -4u - 9113 = -m. Is m a prime number? False Let y be ((-64)/(-10))/4 - 14/(-35). Let l(g) = -3g - 4 + 16g*3 + 5g + 3g2 - 3g. Is l(y) a composite number? True Let f be ((-1)/10)/((-2)/4)25. Suppose -r + 2r = f, o + 2r - 2255 = 0. Is o prime? False Let v(l) be the second derivative of -l5/20 + l4/12 + 5l*3/6 + 11l*2 - 68l. Is v(-7) a composite number? False Suppose 101471 = 3r - 2s, -13 = -3s - 16. Is r a prime number? False Let r(t) = -5t - 2. Let i(v) = -11v - 4. Let f(p) = 3i(p) - 7r(p). Let x be f(1). Let a(y) = 34y - 18. Is a(x) a prime number? False Let r be ((-3)/(-12))/(3/181416). Is (r/(-6))/((-1)/3) a prime number? True Suppose 76381 = 3d + 2x, -x = -4d + 158414 - 56580. Is d composite? True Suppose 153 = 3l + 144. Suppose lw - 8784 - 9579 = 0. Is w a composite number? False Let x be (40 - 18)/(1/(-4)). Is (2199/4 - -1)/((-22)/x) composite? False Suppose -l + 100 = -3n, -5n = 2l - 148 - 8. Let x = 78 - l. Is (2/6-1)/(x/15060) composite? True Suppose 25900 = 2v - s, 5v - 21s + 20s = 64753. Let a = v + 20612. Is a a composite number? False Let m(r) = 314r*3 - 3r*2 - 4r - 15. Is m(4) a prime number? False Is ((-4)/(-20)-18295)/(-1) composite? False Suppose 16t - 202774 = -x + 11t, 2x - 3t - 405613 = 0. Is x a prime number? True Suppose -18m - 2m = -46m + 517114. Is m a composite number? False Is 1648155/3 - 912/(-57) a prime number? False Let l(y) be the third derivative of -11y6/120 + y5/30 - y3/6 + 17y*2. Let g be l(1). Is g/(-40)3236 + -12 a prime number? False Let m(o) = 3o + 6. Let f be m(23). Suppose 3x - f = -63. Suppose c + 1023 = xc. Is c prime? False Suppose 9k - 4k = -5v - 4040, 0 = 2v + 2. Suppose -n = 2r - 2878, 2r - 2902 = -0r + 5n. Let w = k + r. Is w prime? False Let g(d) = d*2 - 13d + 14. Let a be g(12). Suppose am - 502 + 0 = 0. Is m prime? True Let k(r) = 672r*3 - 1429r*3 + 609r*3 + 6r + 11 + r*2. Is k(-2) composite? False Suppose 4l = -3c - 6796, 2313 = 2c - 3l + 6838. Let i = c + 3682. Is i a prime number? False Suppose -5p + 67 = 42. Let a be 4 - p/(5/2). Suppose -ag + 3 = 5, -7353 = -5h - 2g. Is h composite? False Let m(q) = -6q*3 - 43q*2 + 163q + 145. Is m(-28) a composite number? False Let t(o) = 13 - 18 + 8o2 - 22 + 11o. Is t(8) composite? True Let o = -162 + 659. Suppose 6j + o = 2573. Suppose 3w - j - 1007 = 0. Is w composite? True Suppose 0 = -7d + 6d + 11. Let u(t) = -t*3 + 11t*2. Let c be u(d). Suppose -2i + cv + 4v = -304, -3i + 5v + 459 = 0. Is i composite? True Let x be (198/(-110))/(6/(-20)). Let n be (-3 - -3)/(-4 + x). Is n - -1 - -2 - -82 prime? False Suppose 0 = -10v + 348239 + 56291. Is v composite? True Suppose -15a = -39520	{ "pile_set_name": "DM Mathematics" }
ine b, given that h(b) = 0. -1, 2/5, 4 Let v be 2/12 + (-4)/(-14)1127/966. Find t such that -4t + 9/2 - vt2 = 0. -9, 1 Let x(r) be the third derivative of -r6/40 + 3r*5/10 + 85r*4/8 + 39r3 - r2 - 2651. Let x(c) = 0. What is c? -6, -1, 13 Let i(d) be the first derivative of -4d5/15 - 5d*4/3 + 52d*3/9 - 14d*2/3 + 1041. Let i(c) = 0. What is c? -7, 0, 1 Let r = -12763 + 23471/2. Let z = r + 1052. Find k such that -28k*2 + 8k + 0 + zk3 = 0. 0, 4/7 Let j = -11662/5 + 2334. Let m(i) be the first derivative of -ji - 36/5i2 - 54/5i*3 - 10. Suppose m(g) = 0. Calculate g. -2/9 Suppose 3z + 39 = 5m, -111m = -116m - 3z - 9. Factor 8/15f + 2/15f*m + 0 + 2/3f*2. 2f(f + 1)(f + 4)/15 Let p(n) = 334n + 807 + 3n*3 - 59n*2 + 5n2 + n3 - 417. Let j(q) = q*3 - q - 1. Let f(o) = 2j(o) - p(o). Find g, given that f(g) = 0. -1, 14 Let t be 8 + 5/((-10)/6). Suppose 3v = -w + 58, -85 - 3 = -3v + tw. Let -vx3 - x4 - 20x3 + 4x + 38x3 = 0. Calculate x. -2, 0, 1 Let p be (52/(-20))/((-2)/230). Let q(x) = -6x - 10 - px2 + 303x*2 - 8x. Let t(m) = 16m2 - 56m - 41. Let l(v) = -18q(v) + 4t(v). Factor l(d). -4(d - 4)(2d + 1) Let k be 252/135380/266. Factor kz3 - 20/3 - 58/3z*2 + 94/3z. 2(z - 5)(z - 2)(4z - 1)/3 Let a be 35 - (-4)/((-16)/4). Suppose -115 + a = -9r. Factor 14 - s2 - 2s*2 - rs - 2. -3(s - 1)(s + 4) Let i(h) = -33h5 + 72h*4 + 63h*3 - 12. Let o(v) = -27v*5 + 72v*4 + 64v*3 - 10. Let d(r) = 5i(r) - 6o(r). Solve d(u) = 0. -23, -1, 0 Let w = 454541 + -3181785/7. Solve -32/7 - 64/7v + wv2 + 4/7v*3 = 0. -4, -1/2, 4 Let t(n) be the second derivative of 9n - 4 + 1/30n4 - 7/30n*3 - 2/5n*2. Factor t(a). (a - 4)(2a + 1)/5 Let w(y) = 5y*2 - 3y + 3. Let z(i) be the third derivative of 11i5/60 - 7i*4/24 + 7i*3/6 + 72i*2. Let m(u) = -14w(u) + 6z(u). Solve m(a) = 0. 0 Let -3110018/5 - 2/5q*2 - 4988/5q = 0. What is q? -1247 Solve -68/9n3 - 2/9n*4 - 1912/9n - 634/9n2 - 448/3 = 0. -21, -8, -4, -1 Let r(d) = -24d*2 + 27d. Let b(o) = 11o2 - 14o. Let i(a) = -9b(a) - 4r(a). Determine z so that i(z) = 0. 0, 6 Let o(j) be the third derivative of j*8/1344 - 11j*7/840 + 43j*6/480 - 73j*5/240 + 7j*4/12 - 2j*3/3 + 191j*2. What is p in o(p) = 0? 1, 4 Let t = 14 - 12. Suppose -10 = -4z - tp, -3z = -z + 2p. Determine k so that 2k*3 + 4k*4 + 1 + 6k*3 - 8k - z = 0. -1, 1 What is c in -25 + 11c + 20 + 81 - c2 - 16 = 0? -4, 15 Suppose 0 = -881g + 884g + 1323. Let p = g - -443. Find q, given that -3q - 21/8 - 3/8qp = 0. -7, -1 Let z(n) be the third derivative of n5/36 - 115n*4/24 - 355n*3/9 - 1588n*2. Factor z(a). 5(a - 71)(a + 2)/3 Let w(s) be the third derivative of s5/60 - 19s*4/24 - 7s*3 - 75s*2 + 12s. Let w(j) = 0. What is j? -2, 21 Let k(b) be the third derivative of -37b5/48 + 47b4/24 - b3/8 - 374b2. Factor k(o). -(o - 1)(185o - 3)/4 Let f = -36 - -50. Let q = -12 + f. Factor 1 + 0i - 3iq - 12i*2 - i - i. -(3i + 1)(5i - 1) Let t(c) be the third derivative of 22831c6/300 - 799c*5/25 + 3c*4 + 8c*3/15 - 369c*2 - c. Factor t(v). 2(17v - 2)2(79v + 2)/5 Let o(j) be the third derivative of 5/8j*5 + 46j*2 + 1 - 13/16j*4 - 11/80j*6 + 0j*3 + 0j - 1/140j7. Solve o(t) = 0 for t. -13, 0, 1 Let y(l) be the second derivative of -l4/3 - 52l*3 - 2320l*2 - 92l - 74. Factor y(j). -4(j + 20)(j + 58) Let m be 7/14 + (934/(-4))/(-1). Determine w so that 235w2 + 3w*4 - 4w*4 - mw*2 = 0. -1, 0, 1 Let s(k) be the first derivative of -21k + 5k2 - 151 - 1/3k*3. Factor s(j). -(j - 7)(j - 3) Let c = -159 + 367. Let y = c + -204. Factor -1/3 - 2b2 - 4/3b - 1/3by - 4/3b3. -(b + 1)4/3 Let q(s) = -66s2 + 93s + 252. Let x(r) = 15r2 - 23r - 62. Let d(z) = -2q(z) - 9x(z). Solve d(f) = 0. -2, 9 Factor -216 - 41/6i3 - 1/6i*4 - 294i - 254/3i2. -(i + 1)(i + 4)(i + 18)2/6 Let j(v) be the third derivative of -25v*8/168 + 39v*7/14 - 29v*6/4 - 1043v*5/12 - 245v*4/4 + 486v*2 + v. Suppose j(b) = 0. Calculate b. -2, -3/10, 0, 7 Let s = 51 - 29. Let v = s + -16. Factor 2y*2 - 40 + 18 + 8 + v + 6y. 2(y - 1)(y + 4) Suppose w - 5 = -5r, -14r + 4 = -17r - 2w. Let v(b) be the third derivative of 0 + 0b + 13b*2 - rb*3 - 1/20b*5 + 1/2b*4. Factor v(h). -3(h - 2)*2 Let -2/23w*2 + 840/23 + 202/23w = 0. Calculate w. -4, 105 Let z = 2/26681 + -31323500/80043. Let y = 392 + z. Factor -4/3q2 + yq + 2/3q3 + 0. 2q(q - 1)2/3 Factor 2/5g*2 + 408/5 - 208/5g. 2(g - 102)(g - 2)/5 Let s = -2526 + 4475. Let k = 5848/3 - s. Factor j + 0 - kj2. -j(j - 3)/3 Factor -44s2 - 9s*2 + 4s*3 - 90s*2 + 765s - 7s2 + 5780 + s3. 5(s - 17)*2(s + 4) Let h(d) = -46d - 594. Let g(k) = -93k - 1184. Let a(n) = 3g(n) - 7h(n). Let f be a(-14). Factor 0q + 2/7q*f + 2/7q*5 - 2/7q*3 + 0 - 2/7q*2. 2q*2(q - 1)(q + 1)2/7 Factor 200/7m*2 + 614/7m - 2/7m3 + 412/7. -2(m - 103)(m + 1)(m + 2)/7 Suppose -4i = -8j + 4j - 40, -j = 5i - 20. Let v(w) = 3w2 + 14w - 3. Let f be v(j). Solve -1/7a + 0 - 1/7a*f = 0 for a. -1, 0 Factor 1/2r*5 + 0 + 9/2r*4 + 0r + 15/2r3 + 7/2r2. r2(r + 1)2(r + 7)/2 Let f(y) be the first derivative of -20y2 + 55 + 60y + 5/3y3. Factor f(n). 5(n - 6)(n - 2) Let i = -201 - -201. Suppose -350d + 353d - 6 = i. Find v, given that 2/3 - 2/3v + 2/3v3 - 2/3v*d = 0. -1, 1 Let f be (-54)/(-70)(1636/12 + -5). Let s = 518/5 - f. Factor -2/7r2 + sr + 0. -2r(r - 8)/7 Let r = -166 - -144. Let b(l) = -7l4 - 31l*3 - 3l*2 + 69l - 107. Let k(m) = 2m4 + 8m3 + m2 - 17m + 27. Let n(p) = rk(p) - 6b(p). Factor n(i). -2(i - 3)(i - 2)2(i + 2) Suppose 141 - 135 = -6j. Let b be -2 - (-2 + -2 + j). Find r, given that 23/2r + 3 + 17/2rb + 31/2r*2 + 3/2r*4 = 0. -3, -1, -2/3 Suppose -39 = -4f + 13. Let q = f + -9. Let -x*2 - 7x*5 - 18x*q - 9x*2 + 2x*5 - 25x*3 - 2x*4 = 0. What is x? -2, -1, 0 Let y = 5694 + -22713/4. Let f(n) be the first derivative of yn*2 + 11 + 5n*3 - 9/10n*5 + 1/4n*6 - 9/4n*4 + 27/2n. Factor f(c). 3(c - 3)2(c + 1)*3/2 Let z be 2/18 + (-133)/63. Let o be z - (2 + 2 - 15). Factor -3q*3 + oq*2 + 4 - 11q2 + q5 - 4. q*2(q - 2)(q + 1)2 Determine x so that 528x + 84x2 - 52 + 3x*4 - 228x*2 - 332 + 339x*3 - 342x3 = 0. -8, 1, 4 Let c(v) be the first derivative of -v3/3 + 31v2/2 + 410v - 3795. Factor c(b). -(b - 41)(b + 10) Let j(v) be the first derivative of -v4/120 - 11v*3/60 + 19v - 40. Let b(z) be the first derivative of j(z). Let b(r) = 0. Calculate r. -11, 0 Let u = 148784/301 - 21132/43. Find a such that -2/7a2 + u - 6/7a = 0. -5, 2 Let f(r) be the second derivative of r*5/20 - 4r*4/3 - 22r*3 - 8153r. Find b such that f(b) = 0. -6, 0, 22 Let x(u) = -2u2 + 687u - 20493. Let r be x(33). Factor -3/2s + r - 2s*2. -s(4s + 3)/2 Let 1/2j*3 - 27/2j*2 + 0 + 0j = 0. What is j? 0, 27 Let k be 3 + (-87)/27 + (-472)/(-180). Let f be ((-8)/6)/(1 - 64/24). Factor -fs3 + 0s + 16/5 - ks2. -4(s - 1)(s + 2)2/5 Let m be -4 + -6 + (6 - -9). Let r(t) be the third derivative of -1/105t*m - 5/42t*4 + 4/7t*3 + 0t + 0 - 7t2. Factor r(n). -4(n - 1)(n + 6)/7 Let l be (53 - 52)17/34. Solve 1 - 3/2z2 + lz*3 - 1/2z + 1/2z4 = 0. -2, -1, 1 Suppose -47 = -24g - 47. Suppose 9x - 10x = g. Determine u so that x - 1/2u2 - 2u = 0. -4, 0 Suppose -12 = 7h - 54. Let f(z) = 5z*2 + 4z - 6. Let p(g) = 0g + 4g + 10g2 - 6g*2 - 6. Let q(y) = hp(y) - 4f(y). Suppose q(w) = 0. Calculate w. -3, 1 Let a(h) be the third derivative of -2/5h*5 + 0 + h - 3/4h*4 + 0h*3 - 42h*2 + 1/30h*6 - 1/168h*8 + 4/105h*7. Suppose a(t) = 0. Calculate t. -1, 0, 3 Let h = 8341/2177 + 8/311. Let -18/7 - ha*2 - 87/7a = 0. What is a? -3, -2/9 Let u(q) = q*2 - 144q - 1125. Let a be (1 - -6) + (-7 - (-15)/3). Let z(j) = -145j - 1125. Let o(x) = au(x) - 6z(x). Solve o(t) = 0 for t. -15 Let r(n) be the first derivative of 2/15n*6 + 0n*3 + 9 - 6n + 0n5 - 2/3n*4 + 2n**2. Let g(t)	{ "pile_set_name": "DM Mathematics" }
Let g(b) be the first derivative of i(b). Factor g(w). -4w(w + 1)(4w + 1) Let u(k) = -39k2 - 23k + 5. Let d(v) = 1 - 3 + 5 - 12v - 20v*2. Let m(s) = -7d(s) + 4u(s). Factor m(t). -(4t + 1)2 Let m(s) be the first derivative of -s5/2 - 13s4/8 + 11s*3/6 + 13s*2/4 - 3s - 5. Let m(a) = 0. What is a? -3, -1, 2/5, 1 Let n(v) be the first derivative of 2v3/3 - 8v*2/9 - 2v/9 - 29. Determine p so that n(p) = 0. -1/9, 1 Let w(k) be the first derivative of 0k4 + 0k + 1/4k6 - 2 + 0k*2 + 0k*3 - 3/10k*5. Determine g so that w(g) = 0. 0, 1 Let r(m) be the third derivative of 1/480m*6 + 0m + 0 + 1/1344m8 + 0m*4 + 0m*3 + 0m*5 + 5m*2 - 1/420m7. Factor r(b). b3(b - 1)2/4 Let x be (1/1)/(1/4). Suppose 20 = 3r + 2. Suppose -m*4 + rm*3 + 3m*4 + xm - 2m + 6m*2 = 0. What is m? -1, 0 Suppose -4n + 3 = -3n. Factor 0j*2 + 3j*2 + 3j + 0j2 - nj*3 + 0j*2 - 3j*4. -3j(j - 1)(j + 1)*2 Suppose 0 - 6/13b - 24/13b3 - 12/13b*4 - 20/13b*2 - 2/13b*5 = 0. What is b? -3, -1, 0 Let f(k) = 2k*2 + 3k. Let u be f(-2). Factor -50m2 + 52m*u + 3m + 2 + m. 2(m + 1)2 Suppose 14 = 2k + 4m, -m + 5m + 21 = 3k. Suppose -ki + 30 = -3i - 5p, 2 = 2i + 4p. Factor 0f2 - 4/3f*i + 0f - 2/3f3 + 0 - 2f*4. -2f*3(f + 1)(2f + 1)/3 Let n(u) be the second derivative of u9/3780 + u8/2240 - u7/504 - u6/240 + u5/120 - u4/4 - u. Let y(r) be the third derivative of n(r). Factor y(d). (d - 1)(d + 1)2(4d - 1) Let -2/5t - 8/15 + 2/15t2 = 0. Calculate t. -1, 4 Let r(c) = -3c*2 - 4c. Let z(g) be the second derivative of -g4/6 - g3/2 - 3g. Let x(t) = 3r(t) - 4z(t). Factor x(f). -f2 Let l(i) be the first derivative of -3/5i*3 - 3/10i*2 + 3 + 0i - 3/25i5 - 9/20i*4. Solve l(u) = 0 for u. -1, 0 Let o = 1 + 0. Suppose 4m + m = -3l + o, 3m + 5l + 9 = 0. What is j in -4/3j + 1/3jm + 4/3 = 0? 2 Let p(q) be the third derivative of -q5/240 + q4/32 - q3/12 + 7q*2. Factor p(d). -(d - 2)(d - 1)/4 Let a = 539/306 - 7/34. Let x(s) be the second derivative of 49/36s4 + as*3 + 2s + 2/3s2 + 0. Factor x(m). (7m + 2)*2/3 Let c(j) be the first derivative of -2/33j*3 - 1/44j*4 + 0j - 3 - 1/2j2 - 1/330j*5. Let n(k) be the second derivative of c(k). Factor n(o). -2(o + 1)(o + 2)/11 Let c(k) = -k3 - 6k*2 + 6k - 5. Let b be c(-7). Suppose 7a - ba = 10. Factor -3o + 3o + 2o3 - 4o*a. 2o*2(o - 2) Suppose -2z2 + 1 + 108z - 5 - 102z = 0. What is z? 1, 2 Let b(d) be the first derivative of 5 + 1/3d*6 + 0d*3 - 2/5d*5 + 0d*2 + 0d*4 + 0d. Suppose b(o) = 0. Calculate o. 0, 1 Let o be ((-5)/(-2))/(3/2). Factor ot3 + 0 + 0t - 4/3t4 - 1/3t2. -t2(t - 1)(4t - 1)/3 Let q be (-40)/(-8) - (-6)/(-2). Factor -2/3 - 2/3k*q - 4/3k. -2(k + 1)2/3 Let r(n) be the third derivative of 2n*7/105 + 8n*6/105 + 11n5/105 + n4/21 - 35n2. Determine s, given that r(s) = 0. -1, -2/7, 0 Let n be 14/(-4)7/(-49). Let d(h) be the first derivative of 1/2h6 - nh*2 + 4/5h*5 + 0h - 1/2h4 - 1 - 4/3h3. Determine y, given that d(y) = 0. -1, -1/3, 0, 1 Let k(s) be the third derivative of -s6/40 - s*5/5 - 5s4/8 - s3 - 12s2. Find o, given that k(o) = 0. -2, -1 Suppose 2 + 2 = n. Factor -6l*3 + nl*4 - 1 - 5l*3 - l + 16l*2 - 7l2. (l - 1)3(4l + 1) Let s be (19 - 2) + -8 + 4/(-1). Let k(h) be the third derivative of -1/9h3 + 5/72h*4 + 4h*2 + 0 + 1/360h*6 - 1/45h*s + 0h. Factor k(f). (f - 2)(f - 1)2/3 Let w(k) = -k + 2k*2 + 0k*2 + 8k + k - 13. Let t(s) = -9s2 - 32s + 51. Let b(a) = 6t(a) + 26w(a). Factor b(y). -2(y - 4)2 Let v = 55 + -52. Let g(n) be the first derivative of n2 + 2/3n*v + 0n + 1. Solve g(j) = 0 for j. -1, 0 Factor -16r2 + 97r*2 - 20r + 59r2 - 20r - 150r3 + 45r*4. 5r(r - 2)(3r - 2)2 Let h(y) = -6y*2 - 12y - 12. Let u(b) = -b*2 - 1. Let d(j) = -h(j) + 3u(j). Determine r so that d(r) = 0. -3, -1 Let r(b) be the first derivative of -b*3/5 - 3b*2/5 + 9b/5 - 2. Factor r(i). -3(i - 1)(i + 3)/5 Let b(s) be the third derivative of -s*8/144 - 8s*7/315 - 11s6/360 - s5/90 + 14s2. Suppose b(p) = 0. What is p? -1, -2/7, 0 Determine l, given that 5l*2 - 51 - 2l*2 + 63 + 12l = 0. -2 Factor -3m + 2 + 21m*2 - 2 - 18m*2 + 3m*3 - 3m*4. -3m(m - 1)2(m + 1) Let d(o) = -o4 + o3. Let p(j) = -2j4 + 2j*3. Let l = 15 - 20. Let i(x) = lp(x) + 6d(x). Factor i(a). 4a*3(a - 1) Solve 9/4i3 - 5/4i*4 + 1/4i*5 - 7/4i*2 + 1/2i + 0 = 0. 0, 1, 2 Suppose 0 = -q + 4n - 6, 2q - 3q - 6 = 5n. Let a = q + 10. Determine o so that -1/4 - 3/2o - 9/4o*a - 7/2o*2 - 4o*3 - 1/2o*5 = 0. -1, -1/2 Let f(g) be the first derivative of 0g*2 + 0g - 3/14g4 - 6/35g*5 - 1/21g*6 - 2/21g*3 + 3. Factor f(q). -2q*2(q + 1)*3/7 Suppose -2g + 7g - 21 = -c, g - 4c = 0. Let d be 3 - 10g/16. Factor 1/4o*2 + d + 3/4o. (o + 1)(o + 2)/4 Determine q, given that 0 + 1/2q*4 + 9q + 21/2q2 + 4q*3 = 0. -3, -2, 0 Let q(v) be the second derivative of -2v*6/135 + 23v*5/180 - 7v*4/18 + 10v*3/27 + 4v*2/9 - 15v. Factor q(w). -(w - 2)*3(4w + 1)/9 Let b(w) be the third derivative of -w6/360 - w5/180 - 12w2. Factor b(v). -v2(v + 1)/3 Let g(w) = 5w3 - w2 + 2w - 1. Let p be g(1). Find a such that 16a*p - 5a + a*3 - 15a*5 + 5a - 2a4 = 0. 0, 1 Let g(h) = -h2 - 18h - 29. Let f be g(-16). Let n = -3 + 3. Factor -1/4q + n + 1/2q*2 - 1/4q*f. -q(q - 1)2/4 Let s(i) be the second derivative of -i8/6720 - i7/1260 - i4/12 - 3i. Let v(l) be the third derivative of s(l). Determine u, given that v(u) = 0. -2, 0 Let k = 19/60 - -1/60. Solve -v + v2 + k - 1/3v*3 = 0 for v. 1 Suppose -5r = 6r - 22. Factor 0h - 2/9hr + 0. -2h*2/9 Let i be (324/(-25))/(3/10). Let c = i - -1964/45. Determine b so that -14/9b + 14/3b2 + 230/9b*3 + 40/3b*5 + 298/9b4 - c = 0. -1, -2/5, -1/3, 1/4 Let k(o) = -o3 + 8o2 + 9o + 12. Let q be k(9). Factor 12d4 + 12 + 0d*3 - 9d*2 - 9d*4 - 6d*3 + qd. 3(d - 2)2(d + 1)*2 Suppose -3n = -4 + 1. Let r = n + 1. Factor s*2 + rs + 2s2 - s2. 2s(s + 1) Let w(k) be the third derivative of k5/36 - 7k4/72 + k3/9 + 10k2. Factor w(a). (a - 1)(5a - 2)/3 Factor -10k*2 + 2k*2 + 7k*2 + k. -k(k - 1) Let g = 157/4 - 39. What is s in -g - 1/4s2 - 1/2s = 0? -1 Let g(h) be the second derivative of -h5/60 - h4/36 + 2h3/9 + 2h*2/3 + 6h. Factor g(f). -(f - 2)(f + 1)(f + 2)/3 What is w in 2/3w2 - 5/6w + 1/3 - 1/6w3 = 0? 1, 2 Factor 2/5o*2 + 0 - 4/5o + 2/5o3. 2o(o - 1)(o + 2)/5 Let x be 13 + -2 + -3 + -5. Find u such that -1/5u4 - 3/5u2 + ux - 9/5u + 0 = 0. -1, 0, 3 Find n such that -108n - 146n2 - 12 - 5n*2 - 92n2 = 0. -2/9 Let n(h) = h3 - h*2 - 2h + 2. Let v = -8 + 6. Let z(i) = -4i3 + 3i*2 + 7i - 7. Let l(s) = vz(s) - 7n(s). Factor l(t). t*2(t + 1) Let d(b) be the third derivative of -b5/60 + b4/12 - b*3/6 - 5b2. Factor d(n). -(n - 1)2 Let h(y) be the second derivative of 4/5y3 + 1/50y*5 - 5y + 8/5y2 + 0 + 1/5y*4. Solve h(c) = 0 for c. -2 Let l(k) = -6k*2 + k + 1. Suppose p - 1 = 2p. Let z(q) = q*2 - q - 1. Let u(j) = pl(j) - 5z(j). Let u(n) = 0. What is n? -2 Let s(i) = -8i*5 - 3i*4 + 4i3 - i2 - 8i - 4. Let z(g) = g5 + g2 + 2g + 1. Let j(t) = -s(t) - 4z(t). Factor j(c). c2(c - 1)(c + 1)(4c + 3) Let t(h) = h4 + h3 - h2 + h - 1. Let q(g) = -5g*4 + 11g*3 + 45g*2 - 13g - 39. Let v(s) = -q(s) - t(s). Find d such that v(d) = 0. -2, -1, 1, 5 Let z be (3 - 8) + -1 + 0. Let y be (-35)/(-15) + (-4)/z. Factor -6s3 - 2s*5 + 4s4 + sy + 3s3. -2s*3(s - 1)*2 Find l such that 1/3l + 2/3 - 1/3l2 = 0. -1, 2 Let f(k) be the first derivative of 2/3k*3 + 6k*2 + 3 + 18k. Factor f(o). 2(o + 3)2 Let j(p) be the first derivative of -4p*3/3 + 2p*2 + 8p - 13. Determine s, given that j(s) = 0. -1, 2 Let u be 4/(-6) + (-20)/15. Let q be (u - 0)/(4/(-6)). Factor 2y3 - yq + y5 - 2y5. -y3(y - 1)(y + 1) Let l(v) be the first derivative o	{ "pile_set_name": "DM Mathematics" }
(d) -0.4 (e) 108 b What is the second biggest value in -5, 2, 466188? 2 What is the fourth biggest value in -216, 0.384, -1/2, 1/3? -216 What is the fourth biggest value in -17, 7, 0.2, -65? -65 What is the fourth smallest value in -0.102, -5, -0.5, -0.01, -32? -0.102 Which is the third biggest value? (a) 1/3 (b) -11 (c) 20.9 b Which is the third smallest value? (a) 2/5 (b) 0.109 (c) 55.4 c Which is the third smallest value? (a) 5 (b) 2/7 (c) 2088 (d) 1 a Which is the fourth biggest value? (a) 4 (b) -9 (c) 2/5 (d) -2/15 (e) -2 (f) 0.3 d Which is the biggest value? (a) -5 (b) 0.1 (c) 35794 c What is the biggest value in 73, -0.09, 4/5? 73 What is the second biggest value in -3, -6/13, -5, 6? -6/13 Which is the third biggest value? (a) -5 (b) 3 (c) 4/7 (d) 2/3 (e) -3.6 (f) 2 d What is the smallest value in 0.5, 2/15, 0.2, -57? -57 Which is the smallest value? (a) -0.11 (b) 1 (c) 483 (d) 4 a What is the biggest value in -0.3, 1/121, -4/7, 3/4, 6, -0.1? 6 Which is the third biggest value? (a) 13/2 (b) -50 (c) 2/5 b Which is the second biggest value? (a) 18/11 (b) 0 (c) -2/3 (d) -0.062 b Which is the third smallest value? (a) -10 (b) 0 (c) -2/17 (d) 8 (e) 5.6 b What is the second biggest value in -0.3, 39/20, -2, 2/29, -0.4? 2/29 What is the smallest value in 5/2, 1.9, -0.2, 3/8, 0.5, 1/20? -0.2 What is the second biggest value in -646, 5, -1? -1 What is the second biggest value in 3, 1/336, -5, -2/7, -2, 1/2? 1/2 Which is the second smallest value? (a) -231 (b) 2/11 (c) -1/11 (d) -0.1 (e) -2/61 (f) 1/6 d Which is the fourth biggest value? (a) -16/9 (b) -5 (c) -0.062 (d) 0.05 b Which is the third biggest value? (a) 0.71 (b) -44 (c) 1/7 b Which is the smallest value? (a) -0.5 (b) 5 (c) -11869 (d) -1 c Which is the fifth smallest value? (a) 8/3 (b) -0.2 (c) 8/7 (d) 3/2 (e) -0.1 a Which is the smallest value? (a) -2 (b) -0.093 (c) 56 a What is the smallest value in -4, 1, -84/5? -84/5 What is the third smallest value in -1, 114.6, -5, -1/2? -1/2 What is the smallest value in 0.0773, -0.4, -11, -4, 3, -5? -11 What is the fifth smallest value in -4/3, 35, -3, 4/5, -121, 0? 4/5 Which is the second smallest value? (a) -1390/23 (b) -2/3 (c) 4 (d) -3 (e) 0.1 d What is the second biggest value in -12, -0.5, 7, -5? -0.5 What is the third biggest value in 28, -0.3, 0.12, -4, 8? 0.12 What is the fourth biggest value in 0, 49409, 4, -4? -4 Which is the third smallest value? (a) -2/185 (b) 0.2 (c) 0.331 c What is the biggest value in 0.1, 0.06, 464? 464 What is the third biggest value in -3, 116, -2, -0.5, -17, 1/5? -0.5 Which is the biggest value? (a) 7/5 (b) -1/2 (c) 3/5 (d) 5 (e) 1/47 d What is the second smallest value in 0.3, -2, -163, 0.1, -1? -2 What is the third biggest value in 7, 3, -3/10106, -0.4? -3/10106 What is the biggest value in -1.8, -62, -0.43? -0.43 Which is the smallest value? (a) -2.5 (b) -0.5 (c) 165/16 a What is the fourth smallest value in 2/77, -1, -2, -109/5, -4, 1? -1 What is the biggest value in -6/49, -0.27, -5? -6/49 What is the fifth biggest value in 4/3, 300, 31, 9, 1? 1 Which is the fourth biggest value? (a) 4 (b) -0.04 (c) -15 (d) 3 c Which is the smallest value? (a) -540/13 (b) -2/11 (c) 0.03 a What is the third biggest value in -1, 8741, -2/5? -1 What is the second smallest value in 3, -1/2, -8, 0.13, -28, 58? -8 Which is the second biggest value? (a) -4 (b) 0.2 (c) 5 (d) 0.4 (e) 153 (f) -0.4 c What is the biggest value in -111, -125, -1/3, -6? -1/3 What is the second biggest value in 2/11, -16, -72628? -16 Which is the biggest value? (a) 2/13 (b) -0.2 (c) -4 (d) 1 (e) 4 (f) -5 e What is the fourth smallest value in -0.3, 21, -1/16, -0.01, -28? -0.01 What is the third biggest value in 3, -3, -2/15, -4, 11/4? -2/15 What is the biggest value in 2, 9/17, 0.06, 1/8, 0.5, 2/11? 2 Which is the sixth biggest value? (a) 1/5 (b) 0.4 (c) 2 (d) 2/3 (e) 278 (f) 0 f What is the third smallest value in -11, 412, 0.4? 412 Which is the third smallest value? (a) -5 (b) -29 (c) 257 (d) -0.2 (e) 2/13 (f) -2.5 f Which is the third biggest value? (a) -5/3 (b) -5 (c) -876/89 c Which is the biggest value? (a) 0 (b) -6/25 (c) 0.0255 c What is the third smallest value in -174, -1/7, 5? 5 Which is the third biggest value? (a) -218 (b) 3/88 (c) 2 (d) 2/11 b Which is the second biggest value? (a) -5.1 (b) -2685 (c) 3 (d) -0.4 d Which is the second biggest value? (a) 0.94 (b) -4 (c) 2/3 (d) 0.07 (e) -0.09 (f) 5 a Which is the third biggest value? (a) -4 (b) 1/116 (c) 6 (d) -0.05 (e) 1/6 (f) -8 b What is the third smallest value in 1/2, 0, 150, 0.1, 1/60? 0.1 Which is the fifth smallest value? (a) 5 (b) 0.2 (c) -2/21 (d) -8 (e) -0.46 a Which is the biggest value? (a) -5 (b) -68674 (c) 9 c Which is the fourth biggest value? (a) -18.4 (b) 1 (c) -0.2 (d) -3/2 a Which is the third smallest value? (a) -10/9 (b) 273/2 (c) -6 b Which is the fifth smallest value? (a) -5 (b) 1 (c) -3 (d) 314 (e) -9 d Which is the fourth biggest value? (a) 1/4 (b) -1/3 (c) -3/5 (d) -2/15 (e) -380/11 c Which is the fourth smallest value? (a) 4/7 (b) -0.6 (c) 0 (d) 1/2 (e) 984 a What is the second smallest value in 4, 0.0817305, 0.5? 0.5 Which is the smallest value? (a) 0.28 (b) -19 (c) -0.3 (d) 0.03 b Which is the third biggest value? (a) 41 (b) -48/23 (c) 0.5 b What is the third biggest value in -2, 2349, -2/17, 2? -2/17 What is the sixth biggest value in -0.5, -19, 0.06, -3, -5, 3? -19 Which is the third biggest value? (a) -2/7 (b) 0 (c) 5 (d) -4 (e) -171/7 (f) 0.03 b Which is the biggest value? (a) -2 (b) 3/4 (c) -13210 b Which is the smallest value? (a) 8 (b) -2/7 (c) 59 (d) 2 b Which is the sixth biggest value? (a) -0.08 (b) 2/11 (c) -2/9 (d) 1.42 (e) -3/4 (f) 2 e What is the third smallest value in 27, 0.031, -1/33, -2? 0.031 Which is the second biggest value? (a) -43 (b) -0.5 (c) 1 (d) 4 (e) -5/2 c What is the second biggest value in 5/4, 1/3, -55/26, -1/2? 1/3 What is the fourth smallest value in -7, -3/19, 1/5, 0.5, 0? 1/5 What is the fifth biggest value in 14.53, 2/5, 1/3, -2, 0.1, -2/13? -2/13 What is the fourth smallest value in 2, 0, 2/7, -108, 1/4, 28? 2/7 What is the third biggest value in 17963, -2/11, -3/13? -3/13 Which is the second biggest value? (a) 51/80 (b) 0 (c) 6/11 c What is the smallest value in -1.77, 5, -1.7, -4/3? -1.77 Which is the third biggest value? (a) 3.5 (b) 2 (c) -4 (d) 6 (e) 0.4 b What is the third smallest value in 0.6, 35.1, 6? 35.1 What is the fourth biggest value in -14/11, -3/5, 1/280, -2/3? -14/11 What is the biggest value in 1339, 4, -51, -2/7? 1339 What is the fourth biggest value in -3, -334, -0.2, 0, 1/9, -2/3? -2/3 Which is the fifth biggest value? (a) -2/13 (b) -0.3 (c) 1 (d) -3/4 (e) -127 (f) 0.5 d What is the biggest value in 1198, -6/11, 1/7, 0? 1198 Which is the biggest value? (a) -4/7 (b) -307 (c) -227 a What is the smallest value in 111, -1, 2/29, 2/5, 122? -1 What is the third smallest value in -2/5, 0.2, 0.044, 1/17, 2? 1/17 Which is the fourth smallest value? (a) 0.2 (b) 0.3 (c) 70 (d) 0 (e) -0.3 (f) 1 b What is the biggest value in 25, 2/719, 2/5? 25 Which is the third smallest value? (a) 0 (b) 230024 (c) -11 b What is the smallest value in 4, 0.35, 0.6, 1/7, -0.38? -0.38 What is the third smallest value in -2, 4, -2/15, -1/763, 3? -1/763 Which is the third smallest value? (a) 3 (b) 231 (c) -2/15 (d) 4 (e) -3/4 (f) 1.8 f What is the second smallest value in 3/4, 2, -4.48, 42? 3/4 What is the biggest value in 0.6672, 4/3, -0.3? 4/3 Which is the smallest value? (a) -2/9 (b) -2/7 (c) 2/5327 (d) 2/5 (e) 2 b What is the second biggest value in 4, 0.03, -17/5? 0.03 What is the second biggest value in 5, -2/11, 11/17, -1, 3? 3 Which is the fourth smallest value? (a) -0.2 (b) -4 (c) 2/11 (d) 1078/9 (e) -2/11 c Which is the second smallest value? (a) -29/3 (b) 1 (c) -208 a What is the second biggest value in -4, -6772, -5, 0, 4, 3? 3 What is the biggest value in 0.5, -0.4, 2/9, 372087? 372087 What is the biggest value in -0.3, -29, 0.12, -2/11, 17? 17 Which is the third smallest value?	{ "pile_set_name": "DM Mathematics" }
25. Is c(6) a prime number? False Let b(g) = 97g3 - 5g*2 + 3g - 19. Is b(4) a composite number? False Let c be -5(144/(-5))/(-6). Let v = 19 + c. Let r(o) = -3o3 + o2 - 3o - 2. Is r(v) composite? True Let i(a) be the second derivative of 3a*5/20 - 7a*4/6 + 7a*3/6 + 35a*2/2 + 15a + 1. Is i(9) a prime number? True Let n(s) = s + 4 - 5 - 1. Let w be n(-2). Let x(m) = -10m - 3. Is x(w) prime? True Suppose 21 = -g - 5r + 258, 4g + 4r - 884 = 0. Suppose 5o - 5d - 1657 = -g, d = -o + 298. Is o a composite number? False Let h = 9 + -6. Suppose -3n = 3o - 174, -o + 35 = hn - 33. Is o prime? True Let j = 217 - -8910. Is j composite? False Let o be ((-6)/4)/(5/(-10)). Suppose -ot - 24 = -135. Suppose s - 2s + t = 0. Is s composite? False Is 165/10 + 3399 a prime number? True Suppose -g = -k + 13, 3k + 2k = g + 49. Let u(f) = -7f + 10f + k - 8f. Is u(-10) prime? True Suppose 10t = 12t - 22. Let h(v) = v2 - 4v + 6. Is h(t) prime? True Let b(i) = -i3 - i2 + i + 46. Let h be -3 + 6 + 3 + -1. Suppose -3l + 20 = -hm, -2l - l = m + 4. Is b(l) composite? True Is ((-26690)/(-30))/((-1)/(-6)2) a composite number? True Suppose 4b + 21 = 5y - 12, -4b + 4y = 28. Let m be 12/8 - (-13)/b. Let x(r) = -2r3 - 5r*2 - 4r + 4. Is x(m) prime? True Suppose 6799 = 5y - 3226. Is y prime? False Let u(p) = -p + 20. Let m be u(14). Is 61 - (6 - m - -21) prime? True Let n(l) be the third derivative of -l*5/30 + 233l*3/3 + 7l*2. Is n(0) prime? False Suppose 3b = 6b - 3a + 273, 0 = 3b + 4a + 301. Let g = b - -286. Is g prime? True Suppose 0 = v + 3j - 17215, 31j = 5v + 33j - 86023. Is v a prime number? True Let r = -454 + 4247. Is r prime? True Is (-236)/6(-29064)/112 a composite number? True Suppose -14 = -5t - 2v, t = 5t - 4v - 28. Suppose 12242 = 4n + tu - 3u, -3u = 6. Is n prime? True Let d = 25251 + 3220. Is d composite? True Let r = 4 - -4. Let x(s) = 25s + 23. Is x(r) composite? False Let z(f) = 3f2 - 4f - 29. Let t be z(-6). Let n = 0 - 0. Suppose -2l + w = -11 - t, n = -3l - w + 176. Is l a prime number? False Suppose 5y + 51 = -p + 5p, 6 = -2y. Suppose pd - 5d - 2804 = 0. Is d a composite number? False Is 15/3 + (9 - -2393) prime? False Let r(s) = 17s*3 - 3s*2 + 7s - 1. Let z be r(3). Let o = z + -201. Is o composite? False Is 217224/90 - 6 - (-3)/(-5) prime? False Suppose 4i - 12 = -0. Suppose -iz - 12 = 0, d + 596 = -d - z. Is d/20(-10)/4 composite? False Suppose 61o = 60o + 191. Suppose -4k = -5k + o. Is k a prime number? True Suppose -2z + 224 = 2d, 5d + 4z + 49 = 606. Let u = -42 + d. Is u a composite number? False Let m be (5 + -2)/((-6)/4). Let t be m/7 - (-172)/14. Suppose 2968 = tc - 4c. Is c a prime number? False Let m(l) = 102l*2 - 29. Is m(-15) composite? False Let y be (3283/14)/(2/4). Suppose -461 = -3t - 2f, 5t = 2t - 4f + y. Is (-2)/(-6)(-4 + t) composite? True Let u = 18422 + -11361. Is u composite? True Let i(a) = 1392a + 1. Let f be i(3). Suppose 12821 - f = 4j. Is j prime? True Let t be -2231 + (-2 - -1)3. Let q(b) = b*2 - 8b + 2. Let p be q(6). Is t/(-10) - (-4)/p a prime number? True Let j = 3932 + 6035. Is j prime? True Let v be 226400/(-144) - (-2)/9. Let b = -113 - v. Is b prime? True Let s(i) = 377i2 - 11i - 59. Is s(-9) a composite number? False Let g = 1526 + -820. Suppose -5s = -4y + 1412, y = -y - 4s + g. Is y a prime number? True Let a = 2078 + 434. Suppose 0 = 2j + 5n - 1282, -3n + 0n = -4j + a. Is j prime? True Suppose 0 = 3x + x + 2m - 222, -210 = -4x + 2m. Let b be 150/x + 2/9. Suppose 0d - 61 = -4u - 3d, 0 = bu - 5d - 24. Is u a prime number? True Suppose 0 = 3x + 677 + 523. Let a(v) = -v*2 - 3v - 3. Let u be a(-3). Is 3(u - x/12) composite? True Suppose -4r + 196 = -200. Suppose -r - 1592 = -x. Suppose 4v = 3j - 1237, 2v = -4j - v + x. Is j prime? True Let p be 1(0 - 26/2). Let y = 22 + p. Is y composite? True Is (-2)/6(25 - 13) - -4205 prime? True Let y(q) = 26q3 + 5q*2 - 4q + 2. Is y(3) composite? True Let q = -67 - 38. Suppose -4b - 1 = 3, -3b - 247 = h. Let t = q - h. Is t prime? True Let v(s) = 23s2 - 12s + 50. Is v(11) a composite number? True Let s = 2393 + -1310. Let t = s - 602. Is t a composite number? True Is (-8)/(-14) + 10489/7 a prime number? True Let y(x) be the third derivative of 1193x4/24 - 17x*3/6 + 3x*2. Is y(2) a prime number? False Let w = -14 - -5. Let s be (w/12)/((-1)/2296). Suppose -2u - 4x = -s, 0u - 2x - 1728 = -2u. Is u composite? False Suppose -5c = 1 - 31. Let h = c - 1. Suppose -l = -h - 82. Is l a prime number? False Suppose 0 = -4t + 3h - 357, -3t + 2h - 222 = 45. Let i = 766 - t. Is i a composite number? False Let d = 81 - 84. Is ((-1)/d)/((-1)/(-4863)) composite? False Suppose r + 5l = 1151, l + 0l - 5707 = -5r. Is (-8)/2 + r + 4 composite? True Let y(v) = -4v2 - 18v + 16. Let b be y(-18). Is 1 - (10/5 + b) a composite number? True Suppose 0 = 4n - 2n + 3o - 19, 50 = 4n + 2o. Let c be 0(-2)/6 + n. Let r(u) = u*3 - 12u*2 + 15. Is r(c) composite? True Let z(g) = 79g - 10. Let o be z(6). Let c = o - 27. Is c composite? True Suppose -3k - 708 = j, 3j = -0k - 4k - 2109. Let y = 1748 + j. Is y a composite number? False Suppose -2757 - 58889 = -2c. Is c composite? True Let a(y) be the first derivative of 3y*2/2 - 3y + 6. Let z be a(5). Is (-1)/4 - (-927)/z a composite number? True Let k(n) = -n*2 + 6n - 8. Let s be k(7). Is (18 + s)25/3 a composite number? True Let x = -2430 - -16007. Is x composite? False Let u(w) = -2w*2 - 8w - 7. Let q be u(-3). Let o(r) = -809r3 + 2r + 2. Let l be o(q). Suppose 0f + 473 = 3j - 5f, 0 = 5j + 2f - l. Is j prime? False Let n = 2664 - 1007. Is n a composite number? False Suppose -5p + 13663 = -y, 4p + 5y - 4y = 10925. Let q = p + -1843. Is q prime? False Let q(h) = -3 + 8 - 32h + 8h. Let m(j) = 1. Let x(i) = -3m(i) + q(i). Is x(-3) a prime number? False Let t = 58 + -59. Let k(w) = 1087w2 - w - 1. Is k(t) composite? False Let r = -48 + 89. Let t = r - 26. Is t a prime number? False Let d be (0 + 6/(-15))-15. Suppose 5m - 12 = a + 3a, 0 = -2a - m + 8. Suppose ak + 1004 = dk. Is k prime? True Let z(w) be the third derivative of 0 - 1/24w*4 + 2w*2 + 0w + 7/6w3. Is z(-7) prime? False Suppose 63u = 71u - 5192. Is u composite? True Let w be (-214)/4 - -4. Is w + 2 - -4 - 1 - -53 a composite number? True Suppose -2c + 11 = -5. Let n be 18 + -3 - (-5 + c). Suppose y - 61 + n = 0. Is y a composite number? True Suppose 36h - 233103 = 28293. Is h a composite number? True Let j = 295 + -117. Let n(f) = 17f2 + 6f. Let p be n(5). Suppose -j - p = -3x. Is x composite? False Let r(i) = -i3 + 9i*2 + 2i + 11. Suppose 2h = -4d + 14, -3d = -d - 2h + 8. Let m = 7 + d. Is r(m) a prime number? False Suppose -5l = 10, -2f + 6f - 14 = -3l. Suppose -fw + 1741 = -4119. Suppose 0c - w = -4c. Is c a composite number? False Suppose 3q = q - x + 3219, 2q - 3214 = 4x. Suppose -456 = -5b + q. Is b a prime number? False Is 0 + (4292 - -9) + 2/1 a prime number? False Suppose -5b = -b - 508. Suppose 6t - 841 = -b. Is t a prime number? False Let v be (0 - 3/(-2))(-13 + 15). Suppose -2t + vt = 1423. Is t composite? False Let w(m) be the second derivative of -m*4/12 + 5m*3/2 + 3m*2 - 4m. Let v(g) be the first derivative of w(g). Is v(-12) prime? False Suppose 0 = -3x + 12, 15 - 3 = -2b + 5x. Is 13 + b - (0 - -4) a prime number? True Let u(y) = 5y*3 - 22y*2 + 12y + 2. Let i(k) = -4k3 + 21k*2 - 11k - 3. Let t(a) = 6i(a) + 5u(a). Is t(-15) composite? False Let f(l) = 64l2 + 131l - 13. Is f(-22) composite? False Let h(o) = -2o3 - 4o*2 - 4o - 3. Let j be h(-5). Suppose -j = -4a - 799. Let d = a - -285. Is d a prime number? True Let v = -28 - -42. Let b = -10 + v. Suppose -2q + 3g + 123 = 0, -q - 25 + 74 = -bg. Is q a prime number? False Suppose -x - 707 = 6x. Suppose -4z = 134 - 2294. Let g = z - x. Is g a prime number? True Suppose 0 = -5w + 9 + 6. Suppose wx - 8 = 5x. Is x - -3 - -2101 a prime number? False Let r be 7/(-35) + 8/(-10). Is (2 + (-4 - -3))/(r/(-1049)) prime? True Suppose 66	{ "pile_set_name": "DM Mathematics" }
pose -sq + m = q. List the prime factors of q. 2 Suppose y - 10 = -0y. Suppose -7p + 5p = -y. List the prime factors of p. 5 Suppose -3g - 2g + 345 = 4f, 3f - 285 = 5g. What are the prime factors of f? 2, 3, 5 Suppose x - 3x = -350. List the prime factors of x. 5, 7 Let r(t) = -t - 8. Let j = 9 + -16. Let f be r(j). What are the prime factors of ((-2)/4)/(f/18)? 3 Let i(f) = -f*3 - 4f*2 - 3f - 2. Suppose 0 = 2t - h + 7, 0 = -3t + 2h - 3 - 7. What are the prime factors of i(t)? 2, 5 Let y(u) = -u3 + 11u*2 - 9u + 9. What are the prime factors of y(9)? 2, 3, 5 Suppose 0 = z + 6a - 2a - 28, 0 = z - a - 28. What are the prime factors of z? 2, 7 Let g be (-1 - 0)(-6 + 4). Let k(j) = 10j + 2. List the prime factors of k(g). 2, 11 Let z(g) = -g*3 - 4g*2 - 2g - 3. Let j be z(-4). Suppose 2r - 55 = -jb, 2b - 4r - 44 = -2b. List the prime factors of b. 11 Let p be 57 + 7/((-7)/(-4)). Let a = -41 + p. What are the prime factors of a? 2, 5 Let p = 44 + -24. List the prime factors of p. 2, 5 Suppose 3t = 5y + 4 - 1, -5y + 45 = 5t. Let u(n) be the first derivative of 2n*2 - 7n + 3. What are the prime factors of u(t)? 17 Let i(j) = 49j3 + j - 1. Let p = 7 + -6. List the prime factors of i(p). 7 Suppose -w + 5h = -5w - 5, -4w + 3h = -3. Suppose -j + 3c + 1 = w, j + 5c = -4j + 85. List the prime factors of j. 13 Suppose -4f + 25 = 3i, -4 = -2f + f. Let a(m) = -m3 + 4m*2 + 5m + 1. Let z be a(5). Suppose -z - i = -h. List the prime factors of h. 2 Let a(l) be the second derivative of -l*4/12 - 4l*3/3 - 2l*2 - l. List the prime factors of a(-7). 3 Let v = -31 + 54. Let p = -10 + v. List the prime factors of p. 13 Suppose -f = 4f + 2c + 49, 0 = -2f - 2c - 16. Let t = f + 21. What are the prime factors of t? 2, 5 Suppose -2s + s = -9. Suppose -21 = -3c - 3r, s + 1 = -5r. Let n = 15 - c. List the prime factors of n. 2, 3 Let i be 43/9 - (-6)/27. Suppose -y + b - 19 = ib, 2y - 3b = -38. List the prime factors of (-2)/(-7) - y/7. 3 Let o(p) = 2 + 7p2 + p3 - 2p + 6p + 2p. Suppose -22 + 1 = 2c + 3t, -t = -c - 3. List the prime factors of o(c). 2 Let k(u) = u - 5. Let g be k(5). Suppose -2c - c + m - 39 = g, 2m = 0. Let l = -6 - c. List the prime factors of l. 7 Let v be 77/(6 + -2 - 3). Suppose 48 = 5k - v. What are the prime factors of k? 5 Suppose -18v - 78 = -20v. What are the prime factors of v? 3, 13 Suppose -2i + 6i = 2x + 196, 208 = 4i - 5x. List the prime factors of i. 47 Suppose 3h - 2m + 12 = 0, -4h + 2h - 19 = -5m. List the prime factors of (-12)/(4/h) + 2. 2 Let h = 6 + 11. What are the prime factors of h? 17 Let m(j) = j2 + 7j + 10. Let x be m(-7). Suppose 2c + x = -3c, -2c = -2d + 40. What are the prime factors of d? 2, 3 Let w = 14 + -32. What are the prime factors of (-2)/4 + (-675)/w? 37 Let y = -27 - -62. List the prime factors of y. 5, 7 Let a be (-24)/(-15) - 2/(-5). Suppose an = n + 1. Suppose 0 = -t - 3g + 17 + n, 5g = -t + 24. List the prime factors of t. 3 Suppose -5i = -5w + 780, -7 = -3w - i + 445. What are the prime factors of w? 2, 19 Suppose 5x + 210 = 5g - 55, -4x = 16. What are the prime factors of g? 7 Let g = -9 + 18. Let w = g + -3. What are the prime factors of w? 2, 3 Let r = 60 - 31. What are the prime factors of r? 29 Let k = -6 + 9. Suppose -kd = -2 - 4. Suppose 3w - 49 = -dz, 9z = 4z + 25. List the prime factors of w. 13 Suppose -3y + 113 = -241. List the prime factors of y. 2, 59 Let r(g) = -3g*3 - 2g*2 - 4g - 2. List the prime factors of r(-2). 2, 11 Let q(h) = -12h - 4. What are the prime factors of q(-6)? 2, 17 Suppose 4l + 0 - 76 = 0. Suppose -3h - 37 = 2r, -2h + 2r + 17 - 45 = 0. Let c = l + h. What are the prime factors of c? 2, 3 Let h be (-4)/(-10) + 24/15. Let u be (1 + h)20/(-12). What are the prime factors of ((-50)/u)/((-1)/(-1))? 2, 5 Let u = -9 + 1. Let f = 5 - u. What are the prime factors of f? 13 Suppose k = 258 - 45. List the prime factors of k. 3, 71 Let b(n) be the first derivative of n4/4 + 8n3/3 - n2 - 4n + 1. Suppose -4h = -c + 8, 3c = -4h - 24 - 16. List the prime factors of b(c). 2, 3 Let p(v) = -5v + 10. List the prime factors of p(-8). 2, 5 List the prime factors of 1/(-4) - 843/(-12). 2, 5, 7 Let i = 29 + -3. Suppose -m - 4j + i = 0, -2m - 4j = m - 46. List the prime factors of m. 2, 5 List the prime factors of -18(0 + 12/(-4)). 2, 3 Let g = 3 - 1. Let x(s) = s3 - 6s*2 + 4s + 3. Let l be x(5). List the prime factors of l(-9)/g - 0. 3 Let g = 15 - 8. Suppose -3w - 5r + r - g = 0, -2w - 3r - 6 = 0. Let f = 5 - w. What are the prime factors of f? 2 Suppose 5y - y - 364 = -3p, 4y + 5p = 364. List the prime factors of y. 7, 13 Let p(f) = 10f2 - f - 9. What are the prime factors of p(-4)? 5, 31 Let p = 17 - 17. Let w(x) = -x3 + 3. List the prime factors of w(p). 3 Let f = 10 - 7. Let a(y) = -2y + 3. Let o be a(-3). Suppose 4d - o = f. What are the prime factors of d? 3 Let v = -83 - -120. List the prime factors of v. 37 Let r(b) = b + 37. List the prime factors of r(0). 37 Let n = -501 - -705. What are the prime factors of n? 2, 3, 17 Let d be ((-12)/(-5))/((-4)/(-30)). Suppose 4j + d + 22 = 0. Let g = j - -16. What are the prime factors of g? 2, 3 Let y(j) = 4j + 9. Let v be y(10). Suppose 2m - v = 4r + 47, 5m + 4r - 268 = 0. What are the prime factors of m? 2, 13 Let b(x) = 2x + 3. Let y(i) = i + 1. Let f(t) = 4b(t) - 9y(t). List the prime factors of f(0). 3 Let u(y) = -y2 - 3. Let c be u(0). Let l(x) = -2x*2 - 5x - 4. Let s be l(c). Let r = 16 + s. What are the prime factors of r? 3 Suppose 5z = 36 - 131. Suppose 0 = s + m + 15, 2s = 2m - 9 - 1. Let o = s - z. What are the prime factors of o? 3 List the prime factors of 36/2149/2. 2, 3, 7 List the prime factors of 839 + 3 + 2. 317 Let g be (-356)/(-28) - (-4)/14. Suppose 0a = a - g. What are the prime factors of a? 13 Let y(u) = -2u2 + 7u - 11. Let d(v) = -v*2 + 3v - 5. Let o(w) = -5d(w) + 3y(w). Let k be o(6). Let g = 20 + k. List the prime factors of g. 2, 3 Let m be (-37 + 7)2/(-4). Suppose m = -t + 4t. Suppose ta = 2v - 13, 0v + 7 = v - 2a. List the prime factors of v. 3 Let y(s) = -s*2 - 23s - 20. What are the prime factors of y(-18)? 2, 5, 7 Suppose 0 = 4m - 34 - 14. Let v = m - 7. What are the prime factors of v? 5 What are the prime factors of -3 - -1 - (-18 - 0)? 2 Let m(f) be the second derivative of -f3/3 - 3f*2/2 + f. Suppose b = h + 1, 5b + 0b + 10 = 2h. What are the prime factors of m(b)? 5 Let a be (2/(-4))/((-2)/24). Let j be a/21 - (-66)/14. Suppose -4 - 6 = -jc. What are the prime factors of c? 2 Let a be (-1)/6 - (-575)/30. Suppose -l + 49 = o, o - a - 118 = -3l. Suppose -56 = -5b + l. What are the prime factors of b? 2, 5 What are the prime factors of ((-1)/1 - 0) + 49? 2, 3 Suppose -3n = -3, -2b - 2n - 2n + 94 = 0. What are the prime factors of b? 3, 5 Let n(c) = 2 - 2c - 11 + c*2 + 10c. List the prime factors of n(-10). 11 Let n(u) = 2u2 + 14u + 16. What are the prime factors of n(-9)? 2, 13 Suppose 10 = -2s + 12. Let b(c) be the third derivative of c4/8 - c3/6 + c2. What are the prime factors of b(s)? 2 Suppose -2j + 49 = 5. Let w = -8 + j. What are the prime factors of w? 2, 7 Let c be (-3)/(-4) + (-1)/(-4). Let k(q) = 20q - 1. List the prime factors of k(c). 19 Suppose 4n - 182 = -2l, 0 = n - 3n - 5l + 95. Suppose -4b - b - n = -3u, 0 = -4b - 2u - 14. Let j = b + 16. List the prime factors of j. 2, 5 List the prime factors of 1(-151)/(-3)3. 151 Suppose 0 = 4g + g - 180. What are the prime factors of g? 2, 3 Let c(r) = 3r2 + 5r - 9. List the prime factors of c(-5). 41 Let c = 10 - 5. Suppose 3o + 55 = co - l, 5o - 151 = -2l. List the prime factors of o. 29 Let n(u) = -2u. Let w be n(-5). Suppose 4z - w = 50. What are the prime factors of z? 3, 5 Let o(x) = -5x + 5. Let i be o(5). Let q = i + 30. Suppose -3b + q = -d, -5b + 24 = 2d - 0d. List the prime factors of b. 2 Suppose -114 - 116 = -5b. List the prime factors of b. 2, 23 Let b = -2 - -6. Suppose b = r - 5. What are the prime factors of r? 3 Suppose -y = -5v + 144, 5v + 3*y + 50 = 178. What are the prime facto	{ "pile_set_name": "DM Mathematics" }
13f as af*4 + vf*3 + xf + lf2 + s and give l. 4 Express (5r - 5r + 2r)(18r + 56r - 17r)(-2r + 0r + 3r) as or3 + y + fr + pr2 and give o. 114 Express -3 - 71v*2 - 100v + 4 - 98v + 300v - 101v in the form sv*2 + uv + q and give u. 1 Rearrange (1 + 3y - 1)(4 + 2 - 5)(4 + 4 - 47) to w + oy and give w. 0 Rearrange -66a2 + 55a + 32a2 + 31a*2 to oa*2 + i + ua and give u. 55 Express (2u - u + 0u)(u + u + 0u)(0 + 8194u - 8167u - 1) in the form y + iu*2 + qu + hu3 and give i. -2 Express (0 - 12 + 4)(-2278w + 2 - 2 + 2354w) as q + rw and give r. -608 Rearrange 157 - 23i*2 + 28i*2 - 5i*2 - 2i*3 to the form bi*2 + xi*3 + ui + s and give s. 157 Express 231f - 822 + 822 + 0f + 0f + 2f + (0 + 2 - 3)(3f + f - 2f) - f + 4f - 2f + 2f - 2 + 2 in the form h + tf and give t. 234 Express -v2 + 8v*2 - 3v*2 + 2v - 11 + v*3 - 3v - v*2 in the form gv*2 + a + rv*3 + nv and give g. 3 Express -10h3 - 15h*3 + 21h*3 - 2h + 0h in the form b + lh*2 + sh + th3 and give t. -4 Express 7t - 52 - 6t2 + 54 - t2 + 2t*2 as ot + j + kt2 and give k. -5 Express (2 + 9 + 0)(i - 4i + 5i)(1 - 4 + 1)(-50i2 + 0i*2 + 7i*2 + (0 + 1 + 1)(-i*2 - 2i + 2i)) in the form ti*3 + ri + hi2 + l and give t. 1980 Express (-11 - 2 + 108u - 106u + 3u*2)(4u2 + 16 - 16) as fu*4 + ou*2 + hu*3 + vu + p and give h. 8 Express (-y - y - y)(2y + 2y - 2y)(-6y*2 + 8y*2 + 54y*2) in the form dy*2 + g + wy*4 + hy + py3 and give w. -336 Express (-5 + 3 - 7 - 9)(-947k + 947k - 24k3) as ak + wk3 + yk*2 + t and give w. 432 Express 6k + 3k2 - 2k2 + k2 - 7k + 50 in the form rk + jk2 + o and give r. -1 Express 0h + 4h2 + h3 + 8h*3 - h - 2h*2 + 7h*3 as v + zh + jh2 + kh*3 and give z. -1 Express (2 + 1 - 5)(-1 - 3 - 1)(-205g*3 + 20g*3 + 28g*3) as jg + o + wg3 + zg*2 and give w. -1570 Rearrange -505k*2 + 477k*2 - 16k + 17k to lk*2 + ok + y and give o. 1 Express -4x3 - 4 - 26x + 12x - 3x + 3x3 as ux*3 + dx*2 + q + cx and give c. -17 Express -4h4 + 24h*3 - 24h3 + (-h3 + 0h3 - 4h*3)(5h + 3h - 5h) in the form sh + jh3 + rh*4 + bh*2 + k and give r. -19 Express -294d*2 + 48d*2 - 256d*2 - 76d*2 - 119d*2 as rd*2 + hd + f and give r. -697 Express (92k - 52k - 67k)(1 + 1 - 6k - k) as dk*2 + wk + c and give d. 189 Express -12l + 2 - 61l - 12l + l as q + vl and give q. 2 Express 0s + 34s*2 - 31s*2 + 0s - 35 as ks2 + js + y and give y. -35 Express (2 - 2 - x*2)(-681x2 + 1098x - 1098x) as nx*2 + q + tx + bx3 + fx*4 and give f. 681 Rearrange 2k*4 + 229k*3 - 63k3 - k2 + k*4 + 2k + 219k3 - k4 to the form ck*4 + dk + x + ok3 + vk*2 and give x. 0 Express (0 + 2 - 4)(-13 + 11 - 8d + 51d)(1 + 3 - 2)(-1 + d + 1) in the form l + yd + md2 and give y. 8 Express -19 - w2 + 16 + 3w2 + (w - 1 + 1)(2 + w - 2) + 2w2 + 0w*2 + 4w*2 as tw + u + ow2 and give o. 9 Rearrange 56h - 47h + 277h to m + rh and give r. 286 Express 66 + 0r*3 - 7r2 + r3 + 6 - 80 in the form jr2 + ur + qr3 + z and give j. -7 Rearrange (-8u + 3u - 20u)(0 - u3 + 5u - 13u2 + 11u*2 - 2) to the form tu*3 + wu + n + bu2 + ju*4 and give b. -125 Express -4y - 1013y2 + 969y*2 + 9y in the form d + qy + fy2 and give f. -44 Express 60 + 74 + 35 - n - 10 - n2 + 1 in the form qn + jn*2 + t and give t. 160 Express (4p - 8 + 8)(-6 + 1 + 2)(2 - 5 + 5)(4 - 2 - 11) in the form ap + i and give a. 216 Rearrange (4b - b - 2b)(0 + 4 - 3)(-76 + 148 + 73) to y + wb and give w. 145 Rearrange 18210 - 18223 + 102b*3 - 2b*2 + 0b*2 + 0b*2 to the form sb*2 + gb + cb3 + y and give c. 102 Express 5o - 3o + o - 12o*2 - 37o*2 in the form ho*2 + y + ko and give k. 3 Express (-3 + 1 + 1)((1 - 3 + 0)(4 - 4 + 2u) + u + 4u - 2u + 12u - 6u + 2u) as mu + p and give m. -7 Express 0i*2 + 24i*2 + 29i*2 - 29i*2 + 1 as z + hi*2 + yi and give h. 24 Rearrange -16 - 8o - o2 + 13 + 6o + 8o2 to the form g + wo + do2 and give w. -2 Rearrange -3n*3 + 1 - 1 + (-4n + 2n + n)(-3n2 + n2 + n2) - 445n + 445n + 26n*3 to the form zn*3 + jn + i + vn2 and give z. 24 Rearrange -8w + 14w - 30w - 11w - 39w to bw + h and give b. -74 Rearrange (p4 - 3p + 0p4 + p4)(1 - 3 - 3) + 392p + 15p*4 - 392p to the form mp2 + o + fp + lp3 + kp4 and give k. 5 Rearrange -i3 + 5 - i*3 - 78i - 4 + 1 + 80i + 19i*4 to the form bi*2 + ki + q + pi3 + ti*4 and give k. 2 Rearrange -d + 172 + 239 - 561 to p + xd and give x. -1 Express -247 - 84u - 65 + 85u in the form x + pu and give x. -312 Express (t - 3t + 5t)(-30 - 80 + 28) in the form it + f and give i. -246 Rearrange (1 - 1 + 2)(-3v3 - 2v*3 + 3v*3) + 43v*3 + 63v*3 + 44v*3 to jv*2 + i + yv + gv3 and give g. 146 Rearrange (-1 - 42672f + 42672f + 2170f*4)(2 - 3 + 3) to zf4 + uf*2 + x + hf + qf3 and give z. 4340 Express -4k*2 - 35k + 18k - 22 + 17k + k*2 as pk + f + sk2 and give f. -22 Express 0f + 31f2 + 0f - 4f + f in the form j + vf*2 + pf and give v. 31 Express 206j + 1170 + 1170 - 2338 in the form ij + m and give m. 2 Express 4 + 3q2 + 5q*2 - 11q2 + q2 - q - 6 - 18q4 in the form vq*3 + kq + p + mq4 + xq*2 and give x. -2 Rearrange 1 + 2 - 148h - 2h3 + 149h + h*3 to j + lh*3 + yh*2 + sh and give j. 3 Express -2b4 - 2b*4 - 2b*4 - 9b*4 - 22b*4 + 3b*4 + (0b + 2b + 0b)(-2b*3 + 2b*3 - 2b*3) as rb*4 + a + vb*2 + cb*3 + nb and give r. -38 Rearrange 88 - 44k + 2k*3 + 97k - 55k to dk + vk2 + h + bk*3 and give h. 88 Rearrange (3 - 4 + 2)(-2v + 0v + v) - 4v + 5v - 2v - 732v - 227v + 252v - 137v to the form q + fv and give f. -846 Express 133092l4 + 2l*3 + 0l*3 - 1 - 133095l*4 + 102l + (-2l2 + 2l2 + l3)(l + 0l - 2l) as d + yl*2 + ql*4 + rl*3 + hl and give q. -4 Rearrange 0j3 + 6j*3 - 3j*3 + (-2j*2 + 5j*2 + 6j*2)(-2j - 4j + 3j) to sj + t + uj2 + aj*3 and give a. -24 Express 10i*3 - 700 + 0i*2 + 700 + 3i - i*2 as hi + li2 + ki*3 + w and give h. 3 Express -193p + 72p - 348p as xp + m and give x. -469 Rearrange 245o - 1306 + 1306 to jo + d and give j. 245 Express 2094936j - 22j2 - 2094936j in the form gj2 + z + pj and give g. -22 Express 5533o + 37 - 5533o + 6o2 in the form ro*2 + zo + m and give m. 37 Rearrange (-12a + 2a - 5a + 7a - 13a)(190a2 - 71a*2 - 94a*2) to the form qa*3 + n + oa + za2 and give q. -525 Express -2 + 5s3 + s4 + 83s2 - 2s*4 - 84s*2 in the form ks*4 + cs*3 + ds + p + hs2 and give p. -2 Rearrange 182w + 525w + 683w + 81w + 92w to f + qw and give q. 1563 Rearrange x + 177x*3 + 184x*3 - 2x*2 - 355x*3 - 2 to the form ox*2 + d + bx*3 + fx and give d. -2 Rearrange -5d4 + 2d*3 + 3d + 4d4 - 1 + 2d*2 + 7d*4 - 4d to the form w + yd4 + nd*2 + od*3 + jd and give y. 6 Express -3m3 - 42m*2 + 2m*4 + 0m*4 + 3m*4 + 7m*3 + 43m*2 - 2 as lm*2 + h + um*3 + nm + km4 and give l. 1 Express 143c + 117c - 66c in the form o + tc and give t. 194 Express 34r*3 - 3 + 7 + 9r*3 + 25r*3 - 9r*3 as l + br*2 + cr + wr3 and give l. 4 Express 6 - 7 + 559u*2 - 2 - 433u*2 as yu + i + gu2 and give i. -3 Express ((1 - 1 - 2)(-3 + 1 + 1) + (-1 + 1 + 2)(3 - 2 + 0))(1 - 1 + 4)(-6j - j + 5j) in the form y + aj and give a. -32 Express (3 - 2 - 3)(2p - 4p + p)(3p2 + 3p*2 + 7p - 6p + (2p*2 - 4p*2 - 2p*2)(3 - 1 + 0)) as op2 + lp*3 + tp + i and give l. -4 Rearrange -2g2 - 2g*3 - 6g*4 + 4g4 - g4 + 6g2 to ag + m + fg3 + og*2 + yg*4 and give y. -3 Rearrange (-11 + 10 - 19)(2679q - 2679q - 30q3) to uq*2 + xq + f + kq3 and give k. 600 Express 7 - 16 - 145r*2 + 7 - 3r + 3r in the form ur*2 + o + ar and give u. -145 Express (-2 - 3 + 8)(-23g + 20g - 43g)*(-3 + 3 + 4) in t	{ "pile_set_name": "DM Mathematics" }
-41/290647 < -1? False Is 30160807 > 2/9? True Is -47 less than or equal to -753.35? False Which is bigger: 8/273752579 or 0? 8/273752579 Is 206584154 greater than or equal to 206584154? True Which is greater: 17612 or 20060? 20060 Is 437102 at least as big as 437092? True Is -780 greater than -3492? True Is -5.4584 greater than or equal to -483? True Which is greater: 4 or -74642577? 4 Is 89662 < 1165598/13? False Which is smaller: -3329199 or -88? -3329199 Which is bigger: -16452/1303 or -14? -16452/1303 Does -275/411 = -0.06? False Which is greater: 136424656 or 136424657? 136424657 Which is smaller: -29219 or -5386? -29219 Is 1169 less than 1477462/1263? True Is -107989124 >= -107989126? True Is 67/41010 at least 1? False Is 1 not equal to -901/33262? True Which is bigger: 0 or -10/278143351? 0 Is -4504908 < 2/9? True Is -2/3 greater than or equal to -30987005? True Which is smaller: 2463410 or 7? 7 Is -11054905 not equal to -11054883? True Is -1 equal to 4/47792613? False Is -226671 not equal to 1383? True Which is bigger: 17323 or 17565? 17565 Is 495 smaller than 362048/733? False Is -500562/299 at least as big as -1673? False Which is smaller: 0 or 3488467? 0 Which is smaller: 157010 or 10/7? 10/7 Is 23/39 not equal to -3/52? True Which is greater: -8967838 or -8967824? -8967824 Are 2992629 and 1.2 unequal? True Which is bigger: 2331458 or -1.4? 2331458 Is 13917 bigger than 565? True Which is smaller: 28 or 2/80121? 2/80121 Which is greater: 46895501 or 46895504? 46895504 Which is smaller: 74444 or 372227/5? 74444 Which is bigger: 1051547 or 53628926/51? 53628926/51 Does 1635418 = 1635431? False Which is smaller: 2/8335 or -5/4? -5/4 Is -22598059 >= -22598057? False Is -2146 >= -23619/11? True Do 2074 and 1409/3 have the same value? False Is 3472618 at most 3472574? False Which is smaller: -266279 or -266448? -266448 Which is greater: -111110/3617 or -30? -30 Is 115 greater than or equal to -40763? True Which is smaller: 111/109181 or 0? 0 Which is greater: -39994 or -39969? -39969 Is -254/26857 greater than or equal to 0? False Is 54 <= 40.044? False Is 11041812 bigger than -35? True Is -35 bigger than 904589/2? False Which is smaller: -3870 or -4104? -4104 Which is greater: -13 or -635.6993? -13 Is -3910823 >= -6/19? False Is 0 at least as big as -29.767791? True Which is bigger: 155536349 or 155536350? 155536350 Which is smaller: 3796695 or 26576866/7? 3796695 Do -7521876 and -7521876 have different values? False Which is greater: 0.1 or 402550315? 402550315 Are 5 and 1013295 non-equal? True Is 122023590 bigger than 122023590? False Is 62/3 greater than or equal to -1260552? True Which is bigger: 706654 or 706671? 706671 Which is greater: -17376/35 or -0.063? -0.063 Is 880 equal to -245228? False Which is bigger: -28049 or -27911? -27911 Is -6287 at most as big as -6625? False Which is smaller: 3 or 42397470/17? 3 Which is smaller: -26658/1835 or -14? -26658/1835 Which is bigger: -9508 or -9431? -9431 Do 2805704 and 2805707 have the same value? False Which is bigger: -123 or -1/131171? -1/131171 Which is greater: -4/5 or -196632.2? -4/5 Which is smaller: -6851 or -6210? -6851 Which is greater: -203415 or 6/13? 6/13 Which is greater: 15562871 or 15562873? 15562873 Is 2 at least as big as -8904821? True Which is bigger: 14299/22525 or 2? 2 Which is smaller: -210572 or -209982? -210572 Are -2 and 5294360 nonequal? True Which is smaller: -26206/373 or -71? -71 Are -15196 and -15694 nonequal? True Is 287810 >= -1680? True Is -16327864 at most as big as -16327864? True Which is smaller: 47450441 or 47450449? 47450441 Is 0.1 less than -165068973? False Which is greater: 360 or 34310? 34310 Which is bigger: -1015613 or -3.6? -3.6 Which is bigger: 3155/58292 or -1? 3155/58292 Which is greater: -4.9 or -37.4801? -4.9 Which is smaller: -153016 or 60? -153016 Which is bigger: -2/25569323 or 0? 0 Is 169/4040 bigger than 0? True Which is smaller: 4198 or 0.7512? 0.7512 Which is smaller: 0 or -8646/72625? -8646/72625 Is -75568 at least as big as -70355? False Which is bigger: 2 or 19667/9344? 19667/9344 Is 905227740 bigger than 905227739? True Is -5446125 at least as big as -5446123? False Is -361/101795 at least as big as 0? False Which is greater: -1 or 35727.387? 35727.387 Which is greater: 105/8 or -198578? 105/8 Is -2121376005 > -2121376005? False Which is greater: 2057659/10 or 205765? 2057659/10 Is -350987 > -351152? True Which is bigger: -22393548 or -22393551? -22393548 Which is greater: -2/115995707 or 0? 0 Is -606067 at most as big as -606002? True Is -326629348/11 greater than -29693578? True Are -19156 and -19690 non-equal? True Which is greater: 0 or -1133/682569? 0 Does 37694 = 37794? False Which is greater: 6727794 or 6727800? 6727800 Which is greater: -124 or 83777? 83777 Is 3652748 >= 3652746? True Is -1/2 bigger than -107469? True Which is bigger: -53748/1025 or -1/8? -1/8 Are -305 and 142908 non-equal? True Which is smaller: 2/11472335 or 1? 2/11472335 Is 25306 greater than 733846/29? True Is -2229 less than 26.97? True Is -131.3 >= 3456? False Is 1062449594 bigger than 1062449593? True Which is smaller: -477113 or -477154? -477154 Are -64866 and -64850 nonequal? True Are 143995 and -27 unequal? True Is -2/11 not equal to 6460527? True Which is greater: 96501/1207 or 80? 80 Is 255392 at most as big as 255344? False Which is smaller: 31963 or 0.883? 0.883 Which is greater: -3760 or -3897? -3760 Is -83.58 smaller than -5536? False Which is greater: 559625 or -3/338? 559625 Is -357/984853 <= 1? True Is -26756975 less than -2/13? True Which is smaller: 109017 or 109028? 109017 Which is bigger: 465 or 104/61? 465 Are 40/106273 and 37 non-equal? True Do 0.0839 and -10512 have the same value? False Which is greater: -447 or -6326? -447 Is 1 at least as big as -17/23967312? True Is -582361.64 at most -0.01? True Which is smaller: 0.5438 or -61.7? -61.7 Is 1727167 greater than or equal to 1727195? False Which is smaller: -475731 or -476004? -476004 Is 1428 bigger than 73? True Which is smaller: 0 or 21/640207? 0 Is 0 equal to 2/448878805? False Which is smaller: 2419873 or 2419870? 2419870 Are 204.6421 and -36/13 nonequal? True Which is smaller: -25325902 or -25325900? -25325902 Which is smaller: -1 or 5/652884? -1 Which is greater: -3242056 or -0.084? -0.084 Which is bigger: -58899043 or -58899044? -58899043 Which is bigger: -170479/4 or -42619? -42619 Is 707038380 at least as big as 707038382? False Which is smaller: -70/73459413 or 1? -70/73459413 Which is greater: 49 or -256.7676? 49 Is 5275648 at least 5275650? False Which is smaller: -4/3 or 5983159? -4/3 Which is smaller: 706688 or 706677? 706677 Which is smaller: -17112738 or -17112718? -17112738 Which is smaller: 1402967 or 90? 90 Is -15268 smaller than -7749? True Is -7043201/204 at most as big as -34524? True Which is smaller: 75929 or 75918? 75918 Which is smaller: 3821 or 6809? 3821 Is -7/1484426 at least as big as -1? True Which is smaller: -77 or 818283? -77 Is 24229378 bigger than 121146887/5? True Which is bigger: 332310 or -3? 332310 Does 1/703330537 = -1? False Are -2838 and -2842 non-equal? True Which is greater: -27622 or -70/23? -70/23 Which is bigger: 1 or 870/748363? 1 Which is smaller: -5549/347 or -16? -16 Which is smaller: -950424/11 or -0.01? -950424/11 Which is bigger: -0.2355 or -8306? -0.2355 Is 0 > 1/232939139? False Which is bigger: 1 or -2/17003899? 1 Does -2980.33 = 53? False Is 9658772 equal to 9658772? True Is -3789017 < -3789018? False Is 15 smaller than -30169690? False Which is greater: 977/18962 or 1? 1 Is 134 smaller than 83774/621? True Which is bigger: 4 or -299180765? 4 Are -0.1 and -10321241 equal? False Is -19 <= 3.00209? True Is 0 smaller than 387/1274618? True Is -28164046 < -3/4? True Is 0 smaller than -795/180722? False Is 287438 greater than or equal to 287235? True Is 14002979 greater than 14002979? False Which is smaller: 5 or 51824304? 5 Is 3 at least as big as 9656/2727? False Is -229624 at least as big as -122? False Which is bigger: 423/809222 or -1? 423/809222 Is 4.4 < -794743? False Which is smaller: -1559332/19 or -82071? -82071 Is 332 at least -17/647? True Is 430498 at most as big as 27.92? False Is 1 bigger than -2/6756	{ "pile_set_name": "DM Mathematics" }
- 76261r. -187428r Collect the terms in -1671r2 - 1691r*2 - 3r - 1676r2 + 3r + 30 - 1650r2 + 6687r2. -r2 + 30 Collect the terms in 85c2 - 2240c*3 - 44c*2 + 2255c*3 - 41c*2. 15c*3 Collect the terms in 8w*3 + 6w*3 + 5825w - 5825w - 5w*3 - 2w*3. 7w*3 Collect the terms in -1923s + 1923s + 362726s*2 - 362789s*2. -63s*2 Collect the terms in -34r*2 + 19r*2 - 6r*2 - 12r*2 - 18r*2 - 31r*2. -82r*2 Collect the terms in 20176c + 23150c + 28010c. 71336c Collect the terms in -14574c - 14528c - 14577c + 43736c. 57c Collect the terms in -1 + 3244d3 - 23d + 23d - 3123d*3. 121d*3 - 1 Collect the terms in -22m + 25m - 43 + m + 12 + 29. 4m - 2 Collect the terms in 1324o + 1296 + 522o - 3887 + 1297 + 1294. 1846o Collect the terms in -521x*2 + 2734x*3 - 1365x*3 - 1355x*3. 14x*3 - 521x*2 Collect the terms in 258o - 4o3 - o3 + 141o - 318o. -5o*3 + 81o Collect the terms in -185i3 - 42 + 11 + 2 + 16 + 14. -185i*3 + 1 Collect the terms in -32 + 2285r - 57 - 54. 2285r - 143 Collect the terms in -4t*2 + 156023t*3 + 155495t*3 + 4t*2. 311518t*3 Collect the terms in 96 - 45462b*2 + 45458b*2 - 68. -4b*2 + 28 Collect the terms in 53q*2 - 28 - 12q - 22 - 38 - q + 90. 53q2 - 13q + 2 Collect the terms in 282578a - 141346a - 15a3 - 141232a. -15a3 Collect the terms in -182f*2 - f + 16f - 15f + 23. -182f*2 + 23 Collect the terms in 112 + 105 - 19 + v + 34 - 55. v + 177 Collect the terms in -156 + 256s*3 + 160 - 538s*3 + 268s*3 - 4. -14s*3 Collect the terms in -10 + 8 + 3c - 1770c2 + 1876c*2 - 3163c*2. -3057c*2 + 3c - 2 Collect the terms in 224u3 + 1 - 152u*3 + 20u*3 + 0u + 2u. 92u*3 + 2u + 1 Collect the terms in 44w3 + 64w*3 + 13w*2 - 4w*2 - 9w*2 + 2w*2. 108w*3 + 2w*2 Collect the terms in -50c*3 + 44816303206 - 44816303206. -50c*3 Collect the terms in -181p - 8p2 - 20p*2 + 457p. -28p2 + 276p Collect the terms in -103a2 + 1488 + 52a*2 + 1488 - 4468 + 1492 + 67a*2. 16a*2 Collect the terms in 4176 - 4176 - 9737p*2 - 10437p*2. -20174p*2 Collect the terms in 1020r - 522r + 701r + 131r + 982r. 2312r Collect the terms in -3f*2 + 4f*2 - 19563 - 19566 + 39145 - 5f*2. -4f*2 + 16 Collect the terms in -2451n*3 - 1883n*3 + 3861n*3. -473n*3 Collect the terms in 7t - 81952 + 81954 + 16t. 23t + 2 Collect the terms in -13247 + y*2 - 1347y + 13247. y*2 - 1347y Collect the terms in -673789418 + 193t + 673789418. 193t Collect the terms in 3l2 - 417959l - 418551l + 836510l. 3l2 Collect the terms in 2259m*3 + 42m + 40m - 82m. 2259m3 Collect the terms in 2040d - 6904d + 2356d + 2116d. -392d Collect the terms in -45 - 52 + 217 - 77 - 46 + 752v. 752v - 3 Collect the terms in -3l3 + 1105161671859l - 1105161671859l + 7l*3. 4l*3 Collect the terms in -103277s*2 - 12537s*2 + 3011 - 3011. -115814s*2 Collect the terms in -645d*2 - 81d + 24d2 - 119d - 114d + 314d. -621d2 Collect the terms in 962y - 441y + 974 - 972 - 470y. 51y + 2 Collect the terms in -6t*3 + 1484t*2 - 404t*2 - 361t*2 - 368t*2 - 409t*2. -6t*3 - 58t*2 Collect the terms in 1671l + 2225l - 4l. 3892l Collect the terms in -1200 + 208 + 29i*3 - 27i*3 - 1038. 2i*3 - 2030 Collect the terms in 3635458d - 3635458d + 306d*2. 306d*2 Collect the terms in -93v - 114v - 120v - 110v + 539v - 121v. -19v Collect the terms in -266781j + 266781j - 656j3. -656j*3 Collect the terms in -i - 39i*2 - 13i*2 - 28i*2 - 37i*2 + 8i*2 + 33i*2 - 56i*2. -132i*2 - i Collect the terms in -89099 - 89098 + 445479 - 89091 - 8k - 89095 - 89096. -8k Collect the terms in -1955 + 1955 + 138263o. 138263o Collect the terms in 93a - 78876a2 - 13698a*2 - 91a. -92574a2 + 2a Collect the terms in -124986380i + 62493189i + 62493185i. -6i Collect the terms in 13492040149h3 + 3h*2 - 3h*2 - 13492040148h3. h3 Collect the terms in 18764218s - 37528069s + 18763867s. 16s Collect the terms in 110j - 530j + 100j + 108j + 103j + 101j. -8j Collect the terms in 132718z*2 - 66343z*2 - 15z - 66375z2 + 2z*3. 2z*3 - 15z Collect the terms in 10i2 - 59 - 58 - 42 + 191 - 62. 10i*2 - 30 Collect the terms in -246347k*2 - 162116k*2 + 3k - 3k. -408463k*2 Collect the terms in 1222 - 408 - 6076q - 406 - 408. -6076q Collect the terms in -396604j + 1255078j + 1130833j - 420906j. 1568401j Collect the terms in -525061j + 262757j + 262309j. 5j Collect the terms in -2k3 + 11 + 941k*2 + 200k*2 + 4k + 0k3 - k. -2k*3 + 1141k*2 + 3k + 11 Collect the terms in -15a2 - 4802782307a - 9a2 + 7a*2 + 4802782307a. -17a2 Collect the terms in 1687066259 - 38g + 16g - 1687066259. -22g Collect the terms in 84527j2 - 2859j2 + j3 + 0 - j - 1. j*3 + 81668j*2 - j - 1 Collect the terms in 237z - 115z + 199z - 6z + 2. 315z + 2 Collect the terms in -53760 + 107527 - 8048n3 + 8020n*3 - 53767. -28n*3 Collect the terms in -49m*2 - 89m - 246m2 + 177m - 89m. -295m*2 - m Collect the terms in 2733390p*3 + 1581289p*3 + 505032p*3 - 377709p*3. 4442002p*3 Collect the terms in -46265r - 3783r + 17487r - 59295r. -91856r Collect the terms in -30 - 82 - 42 + 158 + 97q. 97q + 4 Collect the terms in 882506 - 441253 - 441253 - 2445n. -2445n Collect the terms in -9967m3 + 48m*2 - 31m*2 - 17m*2 - 12950m*3. -22917m*3 Collect the terms in -89 - m - 331 + 728 - 357 - 3m. -4m - 49 Collect the terms in 186988l + 133381 - 133381. 186988l Collect the terms in 1039968 - 2079924 + 1039956 - l3 - 23l*3. -24l*3 Collect the terms in 2578939 - 1444q*2 - 922q*2 - 2578939. -2366q*2 Collect the terms in 7 + 311l - 9 + 46l2 - 28l*2. 18l*2 + 311l - 2 Collect the terms in 21c2 - 1217116391c + 1217116391c. 21c*2 Collect the terms in -4n*2 + 1651869n + 1651876n - 3303745n + 5n2. n2 Collect the terms in -m3 + 9m*2 + 924418m - 2m2 + m2 - 924455m. -m*3 + 8m*2 - 37m Collect the terms in -5174f2 - 4900f*2 - 760f*2. -10834f*2 Collect the terms in 84 - 268 + 91 - 21p*2 - 47p*2 + 93. -68p*2 Collect the terms in -25503y*3 - 25508y*3 - 25518y*3 + 102045y*3 - 25511y*3. 5y*3 Collect the terms in 4515i - 1500i - 1491i - 2 - 1522i. 2i - 2 Collect the terms in 30 - 65 + t + 13 + 14 + 2t. 3t - 8 Collect the terms in 146 + 148 + 79c3 - 29c*3 - 29c*3 - 294. 21c*3 Collect the terms in 3077584 - 2r + 0r - 3077584 - r. -3r Collect the terms in 19o2 + 75282o + 69852o - 145137o. 19o2 - 3o Collect the terms in -326203s2 - 107415s*2 + 138364s*2 - 234885s*2. -530139s*2 Collect the terms in -52y - 105y + 26y - 507 + 1013 - 501. -131y + 5 Collect the terms in -59b*2 + 56 + 8b*3 - 8b*3 - 6b*3. -6b*3 - 59b*2 + 56 Collect the terms in -710387 + 710387 - 10r + 6r. -4r Collect the terms in 396f2 - 713f*2 + 3 - 6 - 30 + 315f*2. -2f*2 - 33 Collect the terms in 29r + 52r - 40r + 43 - 40. 41r + 3 Collect the terms in 714799o*2 + 937748o*2 + 23o + 19o - 43o. 1652547o2 - o Collect the terms in 7180r*3 - 60r - 687r3 + 60r. 6493r3 Collect the terms in -8 - 2476k*2 - 641k*2 - 38. -3117k*2 - 46 Collect the terms in -566001a - 37671a + 603673a. a Collect the terms in 2 - 1 + 19i + 16 + 1 + 1. 19i + 19 Collect the terms in 131499o + 380376o + 194675o. 706550o Collect the terms in 1354c + 1359c + 1360c + 1360c + 169c3 - 5433c. 169c3 Collect the terms in 9n + 2868609165n3 - 2868609164n*3 - 9n. n*3 Collect the terms in -7n*2 - 5n + 8n2 - 16n*2 + 6n - 14n + 13n. -15n2 Collect the terms in 600 - 21 - 22 - 557 - 10p. -10p Collect the terms in 3208s + 2942s - 11999s + 2944s + 2909s. 4s Collect the terms in 61i + 100i + 263i + 93i - 514i. 3i Collect the terms in 284746 + 284752 - 854252 + 284750 + 2j*3. 2j*3 - 4 Collect the terms in 7450h*2 + 6860h*2 + 13477h*2. 27787h*2 Collect the terms in -17 - 1107k - 968k + 1 - 814k. -2889*k - 16 Colle	{ "pile_set_name": "DM Mathematics" }
9, 0.1, -105. -105, -1, 0.1, 5/9, 2 Put -137, 5, 0.1, 4 in ascending order. -137, 0.1, 4, 5 Sort 0, 3, -20, 1, -57, -4. -57, -20, -4, 0, 1, 3 Sort 4, -249, 1, -4 in decreasing order. 4, 1, -4, -249 Sort -5, 4972, -3. -5, -3, 4972 Sort 0.09, 1/8, -175, -1, 1/5 in descending order. 1/5, 1/8, 0.09, -1, -175 Put 0, 7, 211 in ascending order. 0, 7, 211 Put 5/3, 94, -8 in decreasing order. 94, 5/3, -8 Put -21, 16, -5, -82 in decreasing order. 16, -5, -21, -82 Sort 3, 483346, -4. -4, 3, 483346 Sort 4, -1/114, -1/7, 3, -9. -9, -1/7, -1/114, 3, 4 Sort 10214, -4, -3 in decreasing order. 10214, -3, -4 Sort 0, 1, 2, -2, 33, -5 in descending order. 33, 2, 1, 0, -2, -5 Put -13, -0.2, -12, -1/30 in decreasing order. -1/30, -0.2, -12, -13 Sort -22, 2, -3, 52 in decreasing order. 52, 2, -3, -22 Sort 3, -2, -0.09, 2281. -2, -0.09, 3, 2281 Sort -139, 13, 62. -139, 13, 62 Sort -2586, 3, -3 in ascending order. -2586, -3, 3 Put 25, 5821, 1 in decreasing order. 5821, 25, 1 Sort -25, 8, 57, 4, -2. -25, -2, 4, 8, 57 Sort -7, -13, -5, 12, 3. -13, -7, -5, 3, 12 Put 4, -3, -13/3, -5/21 in ascending order. -13/3, -3, -5/21, 4 Put -4/5, -1, 2, -28413.9, 5 in decreasing order. 5, 2, -4/5, -1, -28413.9 Sort -24, 1, -4, 0, 5, -26 in decreasing order. 5, 1, 0, -4, -24, -26 Sort -2, 13, 3, 4, -118, -5 in descending order. 13, 4, 3, -2, -5, -118 Put 0.56, 5, 0, -0.5, 3/7 in decreasing order. 5, 0.56, 3/7, 0, -0.5 Sort -4, 1815, 5, 2, -6 in ascending order. -6, -4, 2, 5, 1815 Put 5, 0.06, 2.34, 38, -2, -0.1 in increasing order. -2, -0.1, 0.06, 2.34, 5, 38 Sort -1290, 3, 4, 7, -5 in descending order. 7, 4, 3, -5, -1290 Sort -9386, -3, 69 in increasing order. -9386, -3, 69 Put -2/5, -127084, -0.3 in decreasing order. -0.3, -2/5, -127084 Put 5, -1, 13, -5, -78, 4 in descending order. 13, 5, 4, -1, -5, -78 Sort 19911, -5, -9 in decreasing order. 19911, -5, -9 Put -397, 111, -0.3, -3/2, -4 in increasing order. -397, -4, -3/2, -0.3, 111 Put -4306, 4, -84 in decreasing order. 4, -84, -4306 Sort -0.3, -0.044, -2/17 in ascending order. -0.3, -2/17, -0.044 Put -13.6, -3/8, -0.1, -1, 2/7 in ascending order. -13.6, -1, -3/8, -0.1, 2/7 Sort 0, 123, 5/3, -0.5, 1, -13 in descending order. 123, 5/3, 1, 0, -0.5, -13 Sort 357, 4, 3, -1 in increasing order. -1, 3, 4, 357 Put -1/3, 353, 5, 0.1, -39 in decreasing order. 353, 5, 0.1, -1/3, -39 Sort -13, -6590, -3 in increasing order. -6590, -13, -3 Sort 1/16, -2, -0.07, 0, 0.4, 1/2 in descending order. 1/2, 0.4, 1/16, 0, -0.07, -2 Put 3, -1553342, 1 in increasing order. -1553342, 1, 3 Put -1/3, -0.113, -2348 in descending order. -0.113, -1/3, -2348 Put 90, 2, -3, 1, 11 in descending order. 90, 11, 2, 1, -3 Sort -7, 34, -24. -24, -7, 34 Put 63, 0, -0.6, -2 in decreasing order. 63, 0, -0.6, -2 Put -2, -1, -4, -2041974 in ascending order. -2041974, -4, -2, -1 Sort 246, 4, -51 in ascending order. -51, 4, 246 Put 76/9, -16, 0.3, 0.5 in decreasing order. 76/9, 0.5, 0.3, -16 Sort -1125, 0, 5, 3, 2 in descending order. 5, 3, 2, 0, -1125 Put -13258, 0, -3 in increasing order. -13258, -3, 0 Put 7, -0.2, -3, -28, -0.5, -27 in descending order. 7, -0.2, -0.5, -3, -27, -28 Put -1, -7/6, -0.163, 24 in ascending order. -7/6, -1, -0.163, 24 Sort 5, -2, 0, 4, 58 in descending order. 58, 5, 4, 0, -2 Put -3, 10, 6, -2, -6 in descending order. 10, 6, -2, -3, -6 Sort 7/61850, 1/4, -2/13 in decreasing order. 1/4, 7/61850, -2/13 Sort -12, 14, 426 in descending order. 426, 14, -12 Put -5, 2.38, 6, -3/7, 1 in increasing order. -5, -3/7, 1, 2.38, 6 Put -0.4, -6, 5, 1, -150/7, 2 in descending order. 5, 2, 1, -0.4, -6, -150/7 Sort -1/8, 41, 322 in decreasing order. 322, 41, -1/8 Put 2, -3/2, 1.1, 3/7, -3/4, 0.64 in decreasing order. 2, 1.1, 0.64, 3/7, -3/4, -3/2 Put 4, -9, -5, -48, 0, -4 in descending order. 4, 0, -4, -5, -9, -48 Put 0, 2.8, 0.4 in descending order. 2.8, 0.4, 0 Sort 262, 6/7, -1/3 in descending order. 262, 6/7, -1/3 Put -5, 1, -57, -14, 2, 5 in decreasing order. 5, 2, 1, -5, -14, -57 Put -24, 86, 3, -26 in increasing order. -26, -24, 3, 86 Sort -2, -5, -3, -1, -0.07 in ascending order. -5, -3, -2, -1, -0.07 Sort -1, -0.04, -5, 9, 2/11, 1 in increasing order. -5, -1, -0.04, 2/11, 1, 9 Put 4, -7084, 6 in increasing order. -7084, 4, 6 Put 1, -5, -0.2, 5, -80, 8 in increasing order. -80, -5, -0.2, 1, 5, 8 Sort 1, -2, 6, -10, -1 in increasing order. -10, -2, -1, 1, 6 Put 0.4, -1, 3, -0.33847 in decreasing order. 3, 0.4, -0.33847, -1 Sort 309, 0.3, -2/17, -4 in descending order. 309, 0.3, -2/17, -4 Sort -0.2, -2/2927, 1/41 in increasing order. -0.2, -2/2927, 1/41 Sort -5, 4/9, -1.5, 46, 5 in descending order. 46, 5, 4/9, -1.5, -5 Sort -5, -4, 642, -11 in ascending order. -11, -5, -4, 642 Sort 25, 5, 24, -2, 6 in ascending order. -2, 5, 6, 24, 25 Sort 1, 22, -19, -5, -3. -19, -5, -3, 1, 22 Put 1/4, -0.1, -12, -4, -75 in decreasing order. 1/4, -0.1, -4, -12, -75 Sort -2/5, 4, 3/2, 0.07, -0.288 in increasing order. -2/5, -0.288, 0.07, 3/2, 4 Sort 4, -5, 7, -1, 90. -5, -1, 4, 7, 90 Sort 113, 4, -2, -3, 3 in ascending order. -3, -2, 3, 4, 113 Sort 1, 4, -2104, -5 in descending order. 4, 1, -5, -2104 Sort -76/17, 0, -5, 10, 4. -5, -76/17, 0, 4, 10 Sort 1/148, -0.116, -2 in increasing order. -2, -0.116, 1/148 Sort 0.5, 695, 0.4, 0.6. 0.4, 0.5, 0.6, 695 Sort -5, 1, 17, -344 in descending order. 17, 1, -5, -344 Put -2, 4/7, 0.0204 in decreasing order. 4/7, 0.0204, -2 Sort -14, 4, -1, 28 in decreasing order. 28, 4, -1, -14 Sort -490, -2, -3.9, -0.1. -490, -3.9, -2, -0.1 Sort 5, 246, -1, -3, -66. -66, -3, -1, 5, 246 Sort 1, -6, 5600, 5. -6, 1, 5, 5600 Put 0, 3/2, -2, 0.686, 4/7 in increasing order. -2, 0, 4/7, 0.686, 3/2 Put -66, -1, 2/7, 4, -1.76 in decreasing order. 4, 2/7, -1, -1.76, -66 Sort -3, -4, 3220, 0.4. -4, -3, 0.4, 3220 Put 10, 2, -30, 3, 0 in decreasing order. 10, 3, 2, 0, -30 Sort 2/3, 1/4, -2, 19, 0.01 in increasing order. -2, 0.01, 1/4, 2/3, 19 Sort 0.5, -0.58, 79.6, -2 in ascending order. -2, -0.58, 0.5, 79.6 Put 5, 1, -39, 19 in decreasing order. 19, 5, 1, -39 Put -0.2, 0.5, -2/7, -32, 2 in decreasing order. 2, 0.5, -0.2, -2/7, -32 Sort 3/2, -4, 7/24, -16/11, 1. -4, -16/11, 7/24, 1, 3/2 Sort -1, 0, -2, 4, 5, 31 in increasing order. -2, -1, 0, 4, 5, 31 Put -2, -3, -5, 24, -6, 1 in descending order. 24, 1, -2, -3, -5, -6 Put 2, 5, 1/14, 1/3, 0.85 in descending order. 5, 2, 0.85, 1/3, 1/14 Put -32, -58, -4, -8 in decreasing order. -4, -8, -32, -58 Sort 2, 38, -27, -1, 0, -2 in descending order. 38, 2, 0, -1, -2, -27 Sort 64316, 6, 8. 6, 8, 64316 Sort -5, -905, -1, 4, 9 in decreasing order. 9, 4, -1, -5, -905 Sort 3, 27/8, -0.4, 0. -0.4, 0, 3, 27/8 Sort 1, -1/2, -3, 6, 3, -0.76 in increasing order. -3, -0.76, -1/2, 1, 3, 6 Put -0.6, 1362, -0.4, 2/15 in decreasing order. 1362, 2/15, -0.4, -0.6 Sort 0, 54.45, 3/2 in ascending order. 0, 3/2, 54.45 Sort 664, -5, 4, -2, 19 in decreasing order. 664, 19, 4, -2, -5 Sort 15.48, 2, -4, 1, 0.4 in decreasing order. 15.48, 2, 1, 0.4, -4 Put -1, -4, -1695804 in decreasing order. -1, -4, -1695804 Put -1, -0.5, 0.1, 1/3, 0.08 in decreasing order. 1/3, 0.1, 0.08, -0.5, -1 Sort 1, -127, -4, -1, 14 in descending order. 14, 1, -1, -4, -127 Sort -4, -152, 32, 0, 2 in increasing order. -152, -4, 0, 2, 32 Sort -5, 3, 4, 7, 9, -4 in decreasing order. 9, 7, 4, 3, -4, -5 Put 1, -9, 0, -0.037 in decreasing order. 1, 0, -0.037, -9 Put 0, 1, -288, -8, -1 in increasing order. -288, -8, -1, 0, 1 Sort -5, -17286, 0 in decreasing order. 0, -5, -17286 Sort 27, 2.0097, 0.3 in decreasing order. 27, 2.0097, 0.3 Sort -2/11, -0.6, 1, -0.19 in descending order. 1, -2/11, -0.19, -0.6 Put 1, 2, -0.4, 0.03, -2/101 in increasing order. -0.4, -2/101, 0.03, 1, 2 Sort 6, 3, -13, -3, -4 in descending order. 6, 3, -3, -4, -13 Put 30, -5, 2, -3 in decreasing order. 30, 2, -3, -5 Put 41, -2, -1, -10 in ascending order. -10, -2, -1, 41 Sort -19, 993.6, 4 in decreasing order. 993.6, 4, -19 Put 1, 0.6, -3/7, -0.13, -2, 1/6 in decreasing order. 1, 0.6, 1/6, -0.13, -3/7, -2 Sort -7, 0, 2, -18, 783 in decreasing order. 783, 2, 0, -7, -18 Put -5/3, -5, -34, 10/21, -1 in descending order. 10/21, -1, -5/3, -5, -34 Put -3, 1, -64301 in descending order. 1, -3, -64301 Sort -2/15, -1/3, 319, 2, -4. -4, -1/3, -2/15, 2, 319 Put 2, 31, -130 in ascending order. -130, 2, 31 So	{ "pile_set_name": "DM Mathematics" }
)u)/u(-6))(-31) assuming u is positive. u(-496) Simplify (c0/(c4/ccc)c(c3/c)/cc(-6))(-22) assuming c is positive. c198 Simplify ((p3/p)/p)*(-3/8)p/p*(5/11)p(-2/9)/p assuming p is positive. p(-833/792) Simplify (b/(b*12/b)bbb(b/(b/(b/b(-1/25)b)))/bb)/(b/b(-3))(1/16) assuming b is positive. b(-521/100) Simplify (s/((s(-22)/s)/s)(ss/(ss*(-7/6))s)/s)(-44) assuming s is positive. s(-3586/3) Simplify (s(-8)/s(5/4))/(s(-17)/s11) assuming s is positive. s*(75/4) Simplify ((y(yyy*(-1/10)yy)/y)/y(-11))/(y(yy/y0)/yyy/(yyy7)) assuming y is positive. y(199/10) Simplify (o9)(2/9)o*(-27)o15 assuming o is positive. o(-10) Simplify ((v*(-21)v/(vv/v(14/3))v)(-13/4))(-3) assuming v is positive. v(-637/4) Simplify (x(4/5)xx*(-17/4)/xx)/((xx(4/7)x)/(x/x(3/8))) assuming x is positive. x(-1231/280) Simplify (((u/(u/u(-2)))/(u(-1/6)/u))/(u0)17)33 assuming u is positive. u(-55/2) Simplify ((d*13d)/d)*49/(dd*(-5/2)dd)(-1/42) assuming d is positive. d(53509/84) Simplify (y(-2/75)y(2/63))/(y(8/5)/(y(yyy15)/y)) assuming y is positive. y(24263/1575) Simplify (b(-35)b*29b)/(b*12b)(-43) assuming b is positive. b554 Simplify ff/((ff*(-2)ff)/f)fffff/f*(-3)f*5f*(-18)ff assuming f is positive. 1/f Simplify (p(-1/4)/p)(-11)/(p(10/11)pppp17) assuming p is positive. p(-315/44) Simplify (v(-2/11)/v(-3)(v*(-1/5)v)(-20))(-3/14) assuming v is positive. v(435/154) Simplify (s(-2/63)s)/((s(-1/5)/s)/s)(ss/((s(8/7)ss)/s))(5/12) assuming s is positive. s(3917/1260) Simplify (ccc(-20)ccc36)/(c38/(c/(cc/((c(-1/12)/c)/cc)))) assuming c is positive. c*(-241/12) Simplify ((uu/u(-25))/(u(2/23)u))/(u/u(2/5)uu(-1)) assuming u is positive. u(2911/115) Simplify (((t/((t/(t((t/(tt(-2/9)/t))/tt)/t)t)/t))/tt/(t/(t*(-2/9)tt)))(3/13))(1/25) assuming t is positive. t(6/325) Simplify ((((f(f/f*(-7/3))/f)/f)/((f/(f/((ff*17/f)/ff)))/f))(1/41))(-8) assuming f is positive. f(8/3) Simplify (s(5/2)/((s*(-3)s)/s))/((s/s*(1/3)s)/(ss(3/7)s)) assuming s is positive. s(263/42) Simplify (x(1/4)/(((x/x*(8/5))/xxx)/x))/(xx(-5/3))(-44) assuming x is positive. x(-1709/60) Simplify ((y9/yyy)/y*(-6/5))/(yyyy(3/5))(-9/2) assuming y is positive. y(137/5) Simplify (u(-5/4)(u28/u)/u)/(uu*25uu)48 assuming u is positive. u(-5277/4) Simplify ((((l/((l/(ll*(-5)ll))/l))/ll)/(l/l*(3/2)))/((l(ll(-9)l)/l)/(ll/l(-1/3))))(-13) assuming l is positive. l(-689/6) Simplify ((j/((j/(j/(jj*(4/5)))jj)/j))/j)(9/2)/((jj*(-10/7)j)/j(1/27)) assuming j is positive. j(-12412/945) Simplify (c(-2/9))(-17)/(cc(-1/3)/c)(1/3) assuming c is positive. c(35/9) Simplify (a/a(-25/2))/((aa/(aaaa/((a/a19)/a)))/a)a(-1/32)/(a(-3/5)/a) assuming a is positive. a(5931/160) Simplify (g/g(2/11))49/(g(-2/59)g(5/4)) assuming g is positive. g(100919/2596) Simplify ((r/((r/(r/((r/(r/(rr*(-7))))/r)r))/rr)r/(rrr*(-4/3)))/((r/(rrr(-2/11))r)/rr(-2/5)/r))(-1/23) assuming r is positive. r(-1906/3795) Simplify ((p(2/3))(-50)/(p(p*1p)/pp)(-8/11))47 assuming p is positive. p(-48316/33) Simplify ((z(z*18z)/z)37)34 assuming z is positive. z23902 Simplify (((k(-4/15))(-20))36)(6/5) assuming k is positive. k(1152/5) Simplify ((x(8/7)/x)/(x(-4/9)/x))/(x*(-8)xx/((x/x(-8/9))/x)) assuming x is positive. x(178/21) Simplify (g/g(2/3))(-5/2)g/(g*(4/19)/g)gg(-8)g assuming g is positive. g*(-575/114) Simplify (ii*(1/6)/iiii*(6/7)i(ii(1/4)/i)(-42))(-30) assuming i is positive. i(1360/7) Simplify f*(-3/5)/f(ff35)/ff(f14)50 assuming f is positive. f(3672/5) Simplify (z13/(z/(z/((zz(-2/9))/z))))/(z/z(1/5)zz(-7)) assuming z is positive. z(829/45) Simplify h(-29)/(h/h(-11))h/h(1/14)h/h13 assuming h is positive. h(-729/14) Simplify g*(-10)/(gg*(-11))(g/(g*(-3)g))/((gg(-4/3))/g) assuming g is positive. g(13/3) Simplify (((m/(m(6/7)m))/(m/(mm/((m(-10/7)m)/m))))(-29))49 assuming m is positive. m(-2233) Simplify (v(3/8)/(v(-10)/v))(12/11) assuming v is positive. v(273/22) Simplify (u/(u(-9)u))(1/6)/(uu*(-9)((uu/(u/((u(-2/25)u)/u)))/u)/u) assuming u is positive. u*(529/50) Simplify (((www1)(9/8))23)(5/12) assuming w is positive. w(1035/32) Simplify y(-9)/(y/y4)y/(yy/y(-10)yy)((y(-1/19)/y)/y)/y assuming y is positive. y(-419/19) Simplify (c/((cc1)/cc)c(-1/27))/(c(-5/3)cc/(c/(((c(c/(c(7/4)/c))/c)/c)/c))) assuming c is positive. c(149/108) Simplify ((hh/(hh/(hh4h)))/h)(-5/6)/(h13h/(hh/(h*(-1/3)/h))hh) assuming h is positive. h(-101/6) Simplify ((jjj(-1/2)j/((j/(jj/(jjj(-5))))/j))(-2/129))(-15/2) assuming j is positive. j(75/86) Simplify (l(-2/7)l)*(4/31)l*(-7)l(-5) assuming l is positive. l(-2584/217) Simplify ((((u/(u/(u/u*(-4))))/u)/(uu(-3)))(-37))(-12/13) assuming u is positive. u(2664/13) Simplify ((dd0)23)(-5) assuming d is positive. d(-115) Simplify (q11/q)(-29/2)q*9q*16q assuming q is positive. q*(-119) Simplify (f/(fff/(ff*(2/21)f))f)26/(f6/((ff*(-2/73)/fff)/f)) assuming f is positive. f(35947/1533) Simplify (x(-1)/x)(1/67)x*(4/7)/(x/(xxxx/(xx(-6))x)) assuming x is positive. x(4475/469) Simplify (i12iii(-10))/(i5/((iii7/iii)/i)) assuming i is positive. i8 Simplify z(-4)z/z*(-7)(z*4z)(-30) assuming z is positive. z(-146) Simplify ((p*(-1/8)pp/p(1/2))/((p/p6)/(p(2/5)/p)))(3/2) assuming p is positive. p(693/80) Simplify ((((jjj/(j/(j0/j))jj)/j)/j)(-49)/(j(-2/11)j*(-1/4)j))23 assuming j is positive. j(-50163/44) Simplify (tttt(-11)ttt/(t/(tt(-6/5)/tt)))/(t(-4/11)/t19) assuming t is positive. t(724/55) Simplify ((((u/(u(2/5)u))/u)/u)/u(-18))/(((uu*(-1/7))/u)/u(uu4)/u) assuming u is positive. u(446/35) Simplify (p(-13))33/((p/p22)/p25) assuming p is positive. p(-383) Simplify (v(1/7)/v)(-5/17)/(v/((v/v4v)/v)v5/vv) assuming v is positive. v(-1041/119) Simplify ((h(-5/2)h/h0)/((h/h(-2/21))/(((hhh(-4))/hhhh)/h)))46 assuming h is positive. h(-3473/21) Simplify ((m/(m/(m/m*(2/17))))/mm*(-11)mm)/(m2)22 assuming m is positive. m(-903/17) Simplify (w/w(-2/13)w*29w)(-22) assuming w is positive. w(-8910/13) Simplify d*0dd(-2/3)(ddd*(-3/5)dd)(-43) assuming d is positive. d(-2188/15) Simplify ((w(-4/7)w/(w(-3/7)/w))/(w0)(-3/14))(1/72) assuming w is positive. w(13/504) Simplify (o(-2/33)/o)/o*(-1/3)oo(3/25)o/((o/(o/((o/o*24)/o)))/oo) assuming o is positive. o*(6983/275) Simplify (((j/(((j/(jj(-1/3)))/j)/j))(-48))(-20))(10/7) assuming j is positive. j*(25600/7) Simplify ((ff*(-16)f)/f(-15/4))(3/38) assuming f is positive. f(-123/152) Simplify ((a(-3)/a)/(aaa*(-7)a)a(-2/15)a/(a/((a/(aa(-1/3)a))/a)))(-48) assuming a is positive. a(432/5) Simplify (((kkkk14k)/k)/kkkk/(k/k(-9)))/(k/(kk*6/k)k)(1/16) assuming k is positive. k(37/4) Simplify ((k*13k)/((kk(kk11)/k)/k))/(k1k)(1/15) assuming k is positive. k(28/15) Simplify (s(3/4))(-11/5)((s8/s)/s)/s(-2) assuming s is positive. s(127/20) Simplify (n(-1)nn)/(n/n(-6))(n/(n(-2/11)/n))28 assuming n is positive. n(606/11) Simplify (((s(-3)/s)(-34))(-1/15))(-50) assuming s is positive. s(1360/3) Simplify (m*22m/(m/((mm3)/m))m)4 assuming m is positive. m104 Simplify ((b/b(1/9))/(b/(b(5/2)b)b))/(b(-4))(-3/4) assuming b is positive. b(-11/18) Simplify t(-1/3)t(-4/17)t*(-13/6)/((tt*(1/24)/tt)/t) assuming t is positive. t(-1133/408) Simplify m33m/(m/(m(-2/61)/m))mm(m*(-1/51)/m)/(m/(mm/(mm/m(-35)))) assuming m is positive. m(-9496/3111) Simplify l(-2/19)l*2ll(-14/3)l/(l/l(-18)) assuming l is positive. l(-1127/57) Simplify	{ "pile_set_name": "DM Mathematics" }
t3)(2t - 5t + t) + (-3t3 + 3t*3 + 2t*4)(3 - 2 + 1) + 34t4 - 14t*4 + 20t*4. 48t*4 Expand -758k + 758k + 25k*2 + (-2k + 0k + 0k)(-2k + 3k + 0k) + 2 + 3k2 - 2. 26k*2 Expand (-2 - 2 + 1)(d - 2d - d). 6d Expand (-3 + 3 - y)(-13 - 12 + 26) + 6y - 3y + y + (0 - 3 + 2)(0 + y + 0) - y + 5y - y. 5y Expand (158m + 16 - 16 + 5 - 5)(-1 - 1 - 1). -474m Expand (2 + 17002a - 7022a - 3 - 6953a)(1 + 0 - 2). -3027a + 1 Expand (-2n - 5 + 5)(37n2 - 10n*2 - 52631 + 52636). -54n*3 - 10n Expand (-5 + 1 + 2)(351b*2 - 223b*2 - 260b*2) + (-2 - 3 + 3)(-2b2 + b2 - 4b*2). 274b*2 Expand (-557d*2 + 138857 - 138857)(-2 + 2 - 3d) + 2 - d3 - 2. 1670d*3 Expand (-j + 6j + j + 9j + 12 - 12 + (-2 + j + 2)(-1 + 4 - 2) + 2 - 2j - 2)(-1 + 1 - 2). -28j Expand (1312q*2 + 453q*2 - 1884q + 3768q - 1882q)(-q + 6q - 4q). 1765q*3 + 2q*2 Expand (-3c + 10 - 10)(2 + 5 - 5)(2 - 2 - 2c). 12c*2 Expand (67 - 4 + 15)(2x4 + 0x*2 + 0x*2) + 21x*2 - 21x*2 + 3x*4. 159x*4 Expand 0r - r + 232 - 259 + (-1 - 1 + 0)(-r - 2r + 2r). r - 27 Expand -2y - 4 + 8 + 0 + 5y + 5 - 5 + (2y + 0 + 0)(-3 - 4 + 0) + 2y - y - 2y. -12y + 4 Expand (2z - 1 + 1)(185z2 - 102z*2 - 105z*2 + 1 + (2z + 2z - 2z)(-z + 0z + 0z) + 1 - 2z*2 - 1). -52z*3 + 2z Expand (-64 - 137 + 99 - 268)(-3l - l + 3l). 370l Expand p + 2p - 2p + 4p - 3p - 3p + (0 + 0 + 2p)(0 - 3 + 1) - 2p + 3p - 3p + (-2 + 3 + 1)(-81p - 140p - 379p) - 2p - 2p + 2p. -1209p Expand (-p - 3p + 0p)(-15 + 20 + 30). -140p Expand (4v2 - 4v*2 + 2v*2)(-v*2 + 3v*2 + 0v*2) + 68v*2 + 46v - 68v2 - v4. 3v*4 + 46v Expand (0 + 0 - 1)(2i*3 + 0i + 0i) - 7i*3 + 12i*3 + 2i*3 + (1 - 3 + 4)(i*3 + 0i3 + i3) + (-i - 4i + 7i)(i2 - 46i + 46i)(2 - 3 + 3). 13i3 Expand -2q*5 - 2 + 2 + (-6 + 3q + 16 + 8)(0q - 2q + 0q)(q3 + q3 + q3). -20q*5 - 108q*4 Expand (-4 + 24 + 123 + 172)(-3p - 2p + 4p). -315p Expand (2 - 1 + 1)((4l - 5l - l)(2l - 22l + 8l) + 0l - 2l2 + 0l). 44l2 Expand (4 - 3 + 0)(2 - 1 - 2)(-96x + 38x + 29x - 3 + 3 + 2x + 2x - x - 2x + (-4x + x + 2x)(3 - 4 - 1) - x + 2 - 2). 27x Expand (2 + 1 - 2)(33k2 - 35k*2 - 4k*5 + 2k*5) - 1400 - 48k*5 + 1400 + (2k - 2k + 2k*5)(1 + 3 - 2). -46k5 - 2k*2 Expand (-3o2 - o2 - 2o2)(1 + 4 - 1 + (-5 + 2 + 2)(-3 + 5 - 1) + 3 + 1 - 3) + (-2o + 3o - 2o)(2o + o - 2o) + o2 - 3o2 - o2. -28o2 Expand (14z*2 + 44z*2 + 42z*2)(-4z3 + 33z - 33z). -400z*5 Expand (5 - 5 + 2c)(-1 + 1 - 1) + ((4 - 1 - 7)(-2 + 0 - 2) + 2 - 2 - 2)(-4c + 0c + 3c). -16c Expand a + 6a - a + (2 + 4 - 4)(-5a + 11a - 5a) + 4 - 4 - 2a. 6a Expand 4s2 - 6s + 6s + (-2s - 2s + 14s)(0s - 3s + 0s). -26s2 Expand -101h + 49h - 7h*2 + 52h + 22h3 + 0h3 - h3 + 2h3 + (-1 + 1 + 2)(0h + 0h - h*3). 21h*3 - 7h2 Expand -5 + 5 + h4 - 3h4 - 2h*4 + 3h*4 + 3h*4 - 4h*4 + 2h*4 + (4h*2 + 0h*2 - 2h*2)(-2h2 - h2 + h2) - 4h*4 - 5h*4 + 4h*4. -9h*4 Expand -4y*2 + 0y + 0y + (-6y - y + 4y)(-y - y + 4y)(3 - 3 - 2)(-4 - 2 + 4). -28y*2 Expand (-4u + 0u + 2u + (3u + 0u - 5u)(-3 + 3 - 1) - u + 0u + 2u)(2 + u - 2) + (-10u + u - u)(0u - 5u + 4u). 11u2 Expand (23s - 23s - 4s*5)(1 - 4 - 1). 16s5 Expand 3 - d5 - 3 + (2d*2 - 2d*2 - 2d*2)(-d*3 + 2d*3 - 3d3) + d5 - d + d + 2d2 + d5 - 2d*2 + 7d*5 - 10d*5 - 27d*5. -25d*5 Expand (-3y + 3y + y)(81 - 16 + 55 - 16). 104y Expand (2g - 3g - g)(2 + 0 - 1)(-14g - 78g + 19g). 146g2 Expand (u - 4u + 2u)(-2 + u2 + 2) + u3 - u*3 - 2u*3 + 220u*2 - 220u*2 + 23u*3 + (-2u - 2u3 + 2u)(-2 + 5 - 1). 16u*3 Expand (3 - 4s - 2 + 1)(-5s - 5s + 4s). 24s2 - 12s Expand 421f - 845f + 423f + 1 + (3 - 4 + 0)((4 - 2 - 3)(5f - f - 3f) + f + 8f + 2f). -11f + 1 Expand -4818f4 + 4818f*4 + 24f5 + (f4 + 2f4 - f4)(3f + 0f - f). 28f5 Expand -3 + 3 - v4 + (2v + v - v)(3v3 + v3 - 2v3) + v4 + v4 + v4 + 2v*4 - 9v*4 - 5v*4. -6v*4 Expand (-2y*2 + 3y*2 - 2y*2)(-65y + 12y - 33y)(0 + 0 - 2). -172y3 Expand -30q*4 - 79 + 79 + (0q*2 - 7q*4 + 0q*2)(0 - 1 + 2). -37q4 Expand (-9d*3 + 3d - 3d)(-23d + 1 - 22d + 32d). 117d*4 - 9d*3 Expand (-20q*5 - 9q*2 + 2q*2 + 12q*5)(-3 - 1 + 8). -32q5 - 28q*2 Expand (-8k*4 - 13k*4 + 5k*4)(3k - k - 3k) - 2k5 + 3k*3 - 3k*3 + (-3k*2 + 4k2 + k2)(2k*2 - 2k2 - k3). 12k5 Expand (-2v - v + 2v)(50v2 + 2105v - 2105v). -50v*3 Expand (2 + 1 - 5)(-3x + 3x + x) + 8x + x + 8x - 20x + 6 - 14x - 6. -19x Expand (2 - 4n*3 - 2 + (2n - 2n + n)(-n*2 - 4n2 + n2))(-6n*2 + 6n*2 + 5n*2)(1 + 5 - 1). -200n5 Expand 1018v + 8 + 452v - 8 + (3 - 3 - 2v)(2 + 3 - 3). 1466v Expand (-a + 5a - 5a)(242 - 5 + 48). -285a Expand (-n3 - n3 + 5n3)(-2n2 - 4n*2 + 14n*2). 24n*5 Expand (r + 3r + 2r)(0 + 2 - 1) - 15r + 29r + 7r. 27r Expand (-1 + 2 + 0)(-4 + 3r*4 + 4) - 7r*4 - 8r*4 + 3r4 + (-r3 + 2r3 + 0r*3)(r - 3 + 3). -8r4 Expand (-4y + 3y + 3y)(31 - 43 + 29) + 4y + y - 4y. 35y Expand -537j4 + 468j*4 + 477j*4 + (0 + 0 - j)(4j3 - j3 - j3). 406j*4 Expand (-r + 0r - r + (-6 + 2 + 3)(0r + 5r - 3r) + r - 4r + r - 5r + 2r + r - 5r - 4r + 0r)(r4 + 3r4 - r4). -51r5 Expand (4b - 8b - 11b)(-2b - 3 + 3)(-3b + b - 2b)(2 + 1 - 1). -240b3 Expand (m - 3m - 2m)(-62m3 + 9m*3 + 9m*3) - 2m*4 + 0 + 0. 174m4 Expand (q2 + q3 - q2)((5 - 3 - 7)(-q - 2q + 2q) + 2q + 8 - 8). 7q*4 Expand (-3 + 3 - 3v + (-1 + 1 + v)(-2 + 0 + 0))(-9v2 - v2 - 4v*2). 70v*3 Expand (4c - c - 2c)(17 + 21 - 40)(0 - 7 + 2). 10c Expand -5f + f + 5f + (-f + 0f + 0f)(-1 + 0 + 3 - 2 - 3 + 6 + (0 - 1 + 3)(1 - 4 + 5) + (0 - 1 - 4)(-2 + 0 + 3)) + 3f - 2f + 2f. 2f Expand (z + 1 - 1)(1 - 5 - 3)(236z - 241z + 0 - 5). 35z*2 + 35z Expand (2t - 3t + 3t)(-18t2 + 667 - 667). -36t*3 Expand (-1 + 2v + 1 + (-v + 3v - v)(-1 - 2 + 5) + 2v - 9v - 2v)(-1 + 1 - v + (-v + v + 2v)(1 - 2 - 1)). 25v2 Expand (2k3 + k2 - k*2 + (k - 2k + 2k)(4k2 - k2 - 2k*2) - 2k*3 + 10 - 10)(16k - 11k + 11k). 16k*4 Expand -30u*5 - 143u*4 + 143u*4 + 2u*5 - 3u*3 + 3u3 + 2 - 2 - u5 + (-2u - 2u + 2u)(2u4 - 3u4 - u4) - 9u2 + 15u*5 + 9u*2. -10u*5 Expand -4s2 + s5 + 2 + 4s2 + (-5 + 3 + 7)(3s5 + s5 - 3s*5) + (1 - 6 + 3)(6 - 6 - s*5). 8s*5 + 2 Expand (-2 + 2 + 4)(b2 + b2 - 3b2) + (-1 + 1 - 2b)(4b + 8b - 4b)(0 - 4 + 3). 12b*2 Expand ((2p - 3p - 2p)(-p - p + 3p + (-2 + 0 + 0)(-2p + 0p + p)) - 5p*2 - 3p*2 + 3p*2)(0p2 + 2p*2 + 0p*2). -28p*4 Expand (-15i + 0i + 2579 - 2579)(3i4 + 4i - 4i). -45i*5 Expand (-116 + 77 + 72)(-4l3 - 2l*3 + 4l*3) + 4l*3 + 3l*3 - 5l*3. -64l*3 Expand (-3n*2 + 2n*2 + 3n*2 + (2 - 3 - 1)(6n2 + 15n*2 + 10n*2))(n - 4n + n). 120n*3 Expand (-2j + 2j2 - 4j*2 + 0j*2)(-4j + 3j + 0j + (-1 - 2 + 2)(0 - j + 0) + 3j + 2j - 4j - j + 3j + 0j + j - 2j + 2j + 12j - 3j + 0j). -26j3 - 26j2 Expand (y5 + 0 + 0)(0 - 4 + 2) + ((3 - 1 + 0)(3 - 2 + 1) + 0 + 0 + 1 + 1 + 5 - 4 + (-3 + 5 - 1)(-2 - 1 + 1) - 1 + 2 - 2)(0y2 + y5 + 0y*2). 2y*5 Expand (6d + 0d - d)(19 - 105d + 40 - 60 - d). -530d*2 - 5d Expand (117 + 46g - 116 - 43g)(-2g + 2g3 + 2g). 6g4 + 2g*3 Expand (47h*2 - 97h*2 - 73h + 48h2)(3h - 2h + h + (0h - 4h + 6h)(2 - 6 - 5)). 32h3 + 1168h*2 Expand (-2m - 4m3 + 2m)(-923m + 464m + 24 + 460m). -4m4 - 96m*3 Expand (3 - 5 - 11)(2c - 3 + 3)(3 - 3 - 2c). 52c*2 Expand (-2m + 2m + 2m)(-17 - 7 - 27). -102m Expand ((-2d + 2d - 2d)(4d - 4d + d) + 3d - 2d*2 - 3d)(-33d - 90d3 + 21d + d*2 + 13d). 360d5 - 4d*4 - 4d*3 Expand (-2 + 2 + 2j*2)(8j + 43j + 5j). 112j**	{ "pile_set_name": "DM Mathematics" }
decimal place? -0.2 Let t be (-3 + 15003)/((-9)/1860). Round t to the nearest one million. -3000000 Let k(g) = -4g + 3g*2 + 3 - 19g*3 + 3g - 1 - 2g2. Let n be k(-2). Round n to the nearest one hundred. 200 Let q = 38 - 72. Let j = q - -33.41. Round j to one dp. -0.6 Suppose z - 6z + 20 = 0. Suppose -zt + t + 336000 = 0. What is t rounded to the nearest ten thousand? 110000 Let m = 20 + -14. Suppose m = 3i - i. Let v be (1 + 45997/i)15. Round v to the nearest 100000. 200000 Let h(w) = w3 - 3w*2 - 7w + 2. Let k be h(6). Let x = 31 - k. Round x to the nearest 10. -40 Let s = -62 - 108. What is s rounded to the nearest one hundred? -200 Let v = -1380 - -1372.215. Let b = v - 0.015. Round b to zero decimal places. -8 Let a = 0.73 + 68.27. Let b = a + -71.98. What is b rounded to one dp? -3 Let q = -34.5 - -34.4847. What is q rounded to 3 decimal places? -0.015 Let l = -26 - -31.5. What is l rounded to 0 decimal places? 6 Let w = -10.999994 - -11. Round w to 6 decimal places. 0.000006 Let s = -25163446.4000031 - -25163450. Let z = -26 - -29.6. Let i = z - s. What is i rounded to 6 dps? 0.000003 Let p = 381.55 + -350. Let c = 0.55 - p. Let f = c - -31.00000038. Round f to seven dps. 0.0000004 Let y(o) = -o*3 - 5o*2 + 5o + 5. Let h be y(-6). Let t(z) = -64z2 + 4z. Let b be t(h). What is b rounded to the nearest one thousand? -8000 Let x be 4/14 - 38/(-14). Suppose -xk + 83766 = 839757. Let f be k/(-9) - 2/(-6). Round f to the nearest ten thousand. 30000 Suppose -d = 3b - 16012, -4d - d - 3b = -80012. What is d rounded to the nearest one thousand? 16000 Suppose -8 = -4z - 0. What is z rounded to the nearest 10? 0 Let a = -576.99999557 - -577. Round a to seven dps. 0.0000044 Let m = -2 - -1. Let l be ((-5)/(-2))/(m/(-452)). Round l to the nearest one hundred. 1100 Let p = 277 - -1043. Round p to the nearest 100. 1300 Let o = -493.3943 + 474.103. Let l = 19.3 + o. What is l rounded to three decimal places? 0.009 Let r = 11 - 9. Suppose -j - 4d + 324 = -696, 4d = -rj + 2020. What is j rounded to the nearest one thousand? 1000 Let v(h) = -3h3 + 3h*2 - 2. Let m be v(2). Let p be 90(m/3 - -3). Round p to the nearest 100. -200 Let o = -0.133 + 0.133119. Round o to five decimal places. 0.00012 Let o = -19.4 - -18. Let m = o - -1.33. Let j = -0.07000012 - m. Round j to seven dps. -0.0000001 Let d = 20.447 + 0.153. Let p = 18 - d. Round p to zero decimal places. -3 Let a = 44784 - 44783.970003. Let d = 0.97 + -1. Let t = a + d. Round t to five dps. 0 Let n be -3 + 1 - -86697. What is n rounded to the nearest ten thousand? 80000 Let m(r) = 18002r + 10. Let p = -2 - 3. Let i be m(p). Round i to the nearest 10000. -90000 Let l(x) = -x + 1. Let m be l(1). Suppose 0 = -0i + i - 2u - 85998, 3i - 3u - 257997 = m. What is i rounded to the nearest ten thousand? 90000 Suppose 0 = 5m - 4i - 6, 2m - 3i + 4 = 5. Suppose -mw - 757 = 5843. Round w to the nearest 1000. -3000 Let n = -1.24238 - -1.24. Round n to three dps. -0.002 Let t = -36.999974 - -37. Round t to 5 decimal places. 0.00003 Suppose 154987 = -5v + 3x - 990022, x = 3. What is v rounded to the nearest ten thousand? -230000 Let g = -0.08 + 0.08000028. What is g rounded to seven dps? 0.0000003 Let h = 222 - 222.266. What is h rounded to two decimal places? -0.27 Let b = -4118905 + 6438900. Suppose -2g + b = -7g. Let p be g/(-4) + (-1)/(-4). What is p rounded to the nearest 10000? 120000 Let f = -8 - 0. Let d = f + 36. Let i = 28.0000065 - d. Round i to six dps. 0.000007 Let j = -15.04 - -0.04. Let a = j + 14.99999944. What is a rounded to seven dps? -0.0000006 Let c = 0.01984865 + 2614607.98015135. Let l = c - 2614606.899943. Let d = 1.1 - l. Round d to five dps. -0.00006 Let a = -7.574 - -6.6. What is a rounded to one dp? -1 Let u = -300.81 + 304. Let a = -0.01 - u. What is a rounded to zero decimal places? -3 Let k = -0.301 - -1.571. What is k rounded to 1 dp? 1.3 Suppose -4351 - 5649 = -2s. Round s to the nearest one thousand. 5000 Let c = -1.06 + 0.16. Let y = -0.89985 - c. Round y to 4 decimal places. 0.0002 Let m = 5.6 + -7. Let g = 18.4 + m. Let k = g + -16.86. What is k rounded to one dp? 0.1 Let x = -52 - -52.0000084. Round x to 6 dps. 0.000008 Suppose -3q = q, y = -4q + 24. Let j be 3419998/6 + 8/y. Round j to the nearest 100000. 600000 Let p = 263479 + -101474. Suppose k + 2k - p = -5j, 215999 = 4k - j. Round k to the nearest 10000. 50000 Let u(v) = 166994v - 60. Let n be u(-10). Round n to the nearest one hundred thousand. -1700000 Suppose 4k + k + 30500 = 0. What is k rounded to the nearest one thousand? -6000 Let i = 2461 - 1734. What is i rounded to the nearest 100? 700 Let a = -14.4 - -14.39919. Round a to four dps. -0.0008 Let z = -0.82000019 - -0.82. What is z rounded to seven decimal places? -0.0000002 Let j = 22.555 - 27.7. Let f = 0.045 + j. What is f rounded to zero dps? -5 Let j = -0.02286 + 0.022. Round j to 4 dps. -0.0009 Let j = -4.8 + 4.7999933. Round j to 6 decimal places. -0.000007 Let v = 22015.424941604 + -0.021841604. Let t = -22085.4 + v. Let r = t + 70. What is r rounded to three dps? 0.003 Let j = 8 + -34. Let y = 26.0000132 + j. What is y rounded to 6 decimal places? 0.000013 Let c = 22 - 22.077. What is c rounded to 2 decimal places? -0.08 Let x = -3 - -5. Let i = -1.99999904 + x. Round i to seven dps. 0.000001 Let q(r) be the second derivative of 1875r5/2 - r4/12 - r3/6 + r2 + 4r. Let d be q(-2). Round d to the nearest one hundred thousand. -200000 Let p = -577088.291478 + 1.291478. Let l = p + 577086.739989. Let b = l - -0.26. Round b to 5 dps. -0.00001 Let u = 1694852.60000002 + -1694857.6. Let q = -0.1 - 4.9. Let t = q - u. What is t rounded to 7 decimal places? 0 Let o = 4.9 - 5.48. Let t = o + 0.85. Let f = 0.22 + t. What is f rounded to 1 dp? 0.5 Let q = 1.62 + 0.08. Let x = -0.32 + q. Let f = x + -1.463. Round f to two dps. -0.08 Let s = 9.6 + -9.60083. Round s to 4 dps. -0.0008 Let t = -0.06256286779 + -77.53333720221. Let m = t - 10.40410363. Let w = m + 88. What is w rounded to 6 dps? -0.000004 Let z(q) = q3 + q2 + 2q - 7. Let d be z(8). Suppose -435 = f + d. Round f to the nearest one hundred. -1000 Let m = -21 - -21.27. Round m to one dp. 0.3 Let h(y) = 43201y2 + 6y + 5. Let l be h(-5). What is l rounded to the nearest 100000? 1100000 Let x = -66740 - -173739. Suppose -h = -2h - 5d - 106995, -d = h + x. Round h to the nearest ten thousand. -110000 Let h(w) = -w*3 + 9w*2 + w - 6. Let p be h(9). Suppose s + p + 93 = 0. Round s to the nearest 10. -100 Let v(k) = -43k*3 + 23k*2 + 20k. Let l be v(-15). What is l rounded to the nearest one hundred thousand? 200000 Let r = -21 - -21.0016. Round r to 3 decimal places. 0.002 Let r = -4.11 + 0.11. Let p = r + 3.99999995. What is p rounded to 7 decimal places? -0.0000001 Let a = -3329.8393 + 3330. Let k = a + -0.16. Round k to 3 dps. 0.001 Let u = -1956397.99991 - -1956407. Let m = -9 + u. What is m rounded to 5 decimal places? 0.00009 Let w = 11.014 - 11. Let x = w - 0.014027. What is x rounded to five dps? -0.00003 Let q = 13.6 - 15. What is q rounded to the nearest integer? -1 Let a = -3 - -8.9. What is a rounded to the nearest integer? 6 Let h = -34.99824 - -35. Round h to 4 decimal places. 0.0018 Let g(t) = -51t - 4. Let s(q) = q. Let n(i) = g(i) - 6s(i). Let f be n(8). Round f to the nearest 100. -500 Let s = -10.5 + 10.644. What is s rounded to 2 dps? 0.14 Let k = 118221926 + -171034388. Let s = k + 52812344.000119. Let q = s - -118. Round q to 5 decimal places. 0.00012 Suppose 3t - 5m = 326083, -82138 = -t + 2m + 26556. Let l = -1028696 + t. Round l to the nearest 100000. -900000 Let s = -1143 + 1142.7052. Let n = s - -0.3. What is n rounded to 3 decimal places? 0.005 Let x = 16255.954 - 16265.853953. Let g = x + 9.9. What is g rounded to five dps? 0.00005 Let u = 11.47 - 12.2. Let r = -8.5725921 - -9.302589. Let i = r + u. What is i rounded to six decimal places? -0.000003 Let t = -0.1 + -0.86. Let g = -0.1149231 + 1.0749661. Let k = g + t. Round k to five dps. 0.00004 Suppose -p + 4p = -l + 28800, 5p + 3l - 48000 = 0. Let w be ((-225)/(-4))/((-6)/p). What is w rounded to the nearest 10000? -90000 Let q(d) = 71d*	{ "pile_set_name": "DM Mathematics" }
or of 4/10 + (-279)/p and -23. 2 Find the common denominator of -93/10 and (5/(-20))/(8/110). 80 Suppose 0 = 4h - 4b + 4, 4b = -2h - 2h + 12. Find the common denominator of 9/4 and h/(-8)(-1 - -39). 4 Let o = 3/21722 + 1314151/217220. What is the common denominator of (-5 - 44)(-2)/(-4) and o? 20 Let h = -367/38 - -186/95. Let n = 30 - 18. Calculate the common denominator of h and (-9)/225/n. 40 Suppose -5m - 5 = -10m, 3i + 5m = 14. Suppose it - 16 = 2. Calculate the least common multiple of 6 and t. 6 Suppose 2o - 24 = -6. Let u be 10/1(o + -4). What is the common denominator of (-55)/u + 1 + -3 and 53/12? 60 Let w = 5858/9 - 654. Let s = -592036 - -5320906/9. Let d = s + 827. Find the common denominator of d and w. 9 Suppose 3n - 2j + 7j + 15987 = 0, 0 = -n - j - 5327. Let q = n + 74651/14. Calculate the common denominator of 49/8 and q. 56 What is the common denominator of 41/(-4) - (-3)/(-18)4 and -11/6? 12 Suppose g + 4k = 2, 5k - 1 = g - 2g. Find the common denominator of -61/4 and g/2 + (-41)/2. 4 What is the lowest common multiple of 5 + (-1 - (-4 + 5)) and 16? 48 Suppose 3q + 17 = -4h + 67, -4h = 4q - 64. What is the least common multiple of q and 6? 42 Suppose 3j + 96 = -j. What is the common denominator of 17/14 and (6/44)/(j/(-328))? 154 Let f = -7191/20 + 1749/5. Let w(t) = t3 - 5t*2 + 4t + 2. Let a be w(4). Find the common denominator of f and a/(1/((-38)/(-6))). 12 Let g = -3424744 + 37632996/11. Let f = g + 3560. Find the common denominator of -23/5 and f. 55 Let n(b) = -b - 2. Suppose 0 = 2q + 2q - 32. What is the smallest common multiple of q and n(-3)? 8 Suppose -4v - 30 = v. Calculate the common denominator of 9/(-6)79/v and -121/10. 20 Suppose 19 = -a + g - 6g, -2g - 34 = -4a. Let r = a - 2. Calculate the smallest common multiple of r and 0 + 2 + (-2)/(-1). 4 Let g = 8 + -8. Suppose 4j - 4z = z + 26, 3j - 5z - 22 = g. What is the least common multiple of 14 and j? 28 What is the least common multiple of 288/30 - 6/10 and 27? 27 Suppose 5s - 40 = 50. What is the lowest common multiple of 10 and s? 90 Let k be (-2)/(-4) + (-12738)/(-4). Let t = k - 25441/8. Calculate the common denominator of t and (3 - 0)(-1274)/840. 40 Suppose 3o - 2o + 4 = 0, 29 = 5x + 4o. Let w = x - 0. Let a = 19 - w. Calculate the smallest common multiple of a and 3. 30 Let q(x) be the second derivative of 3x4/4 - x3/6 - 5x. Calculate the smallest common multiple of 22 and q(1). 88 Let y = -265 + 1019/4. Suppose 3o + 2 = 2o, -2o + 4 = -2t. What is the common denominator of y and 6 + t + (-57)/11? 44 Let v(r) = r2 - 3. Let z be 4/(-14) + (-6)/(-21). Let q be v(z). Let f(x) = 2x*2 + 4x + 4. What is the smallest common multiple of 3 and f(q)? 30 Let t = 563858/576765 - -2/12817. Find the common denominator of t and -23/12. 180 Let j = 94 - 64. Suppose 0i + j = 3i. What is the lowest common multiple of 11 and i? 110 Suppose t - 336935004 = -25976621. Let j = 3417121705192/10989 - t. Let s = j + 11/1998. Find the common denominator of -143/12 and s. 132 Let l(s) = 3s - 10. Let n(o) = o3 - 2o*2 - 3o + 4. Let u be n(3). What is the least common multiple of 3 and l(u)? 6 Let m be (13/2)/(-1)-2. Calculate the common denominator of -411/m - -1 and -3/10. 130 Suppose -16 = -7f + 3f. Suppose -3o + 25 = s, -fo + s + 36 = 5s. Calculate the least common multiple of 20 and o. 40 Calculate the common denominator of 0 + 2 - 150/(-27) and 11/(-22) - (-29)/10. 45 Suppose 3a = 2a + 20. Let j = a + -35. Let b = j + -22. Find the common denominator of b and 25/3. 3 Let p = -22 - -24. What is the common denominator of (-6)/p + 9/(-4) and -2/11? 44 Suppose -q + 5u = 4u - 1, 0 = 3u + 6. What is the common denominator of 46/(-48)(1 - q) and 47/16? 48 Suppose -3 = 5z - 18. Suppose -o + 3p = 18, -23 = 4o + p - z. Calculate the common denominator of (o/15)/(4/(-395)) and 52/3. 6 What is the common denominator of -49/12 and (-2)/3 - (2 - (-57)/(-6))? 12 Let u = 5 - 3. Calculate the least common multiple of 16 and 5 + 3/(u + 1). 48 Suppose -a + 23 = -g, -3g + 21 + 57 = 4a. Calculate the smallest common multiple of a and 9. 63 Let d(s) = 1. Let i(p) = -4p + 24. Let l(c) = -24d(c) + i(c). What is the smallest common multiple of 6 and l(-3)? 12 Suppose -2t = 3j - 27, 2t - 1 + 2 = j. Calculate the lowest common multiple of j and 4. 28 Let a = 40 - 7. What is the lowest common multiple of 22 and (-8)/44 + 666/a? 220 Let r = -6 + 4. Calculate the common denominator of 35/12 and -1 + (-285)/12r. 12 Let k = -2 + 3. Let s = k + 0. Let w = 1 + s. What is the least common multiple of 2 and w? 2 Suppose -5a - 15 = 4j + 2, 3j + 14 = -4a. What is the least common multiple of 10 and j? 10 Let y(n) = 5n - 6. What is the smallest common multiple of y(4) and 16? 112 Calculate the common denominator of -133/6 and (-6)/3 - (-54)/5. 30 What is the common denominator of -2/5 and 1556/168 - (-3)/(-7)? 30 Let i = -61 - -1219/20. Find the common denominator of i and 121/18. 180 Suppose 3x - 20 = -2x. Suppose -i + 23 = -2b - b, xi - b - 59 = 0. What is the least common multiple of i and 8? 56 Let p = -269/20 - -91/4. What is the common denominator of -15/8 and p? 40 Find the common denominator of 67/8 and (6/14)/(12/128). 56 Let t = -574 - -50. Let k = -139995 + 1115839/8. Let o = k - t. Calculate the common denominator of o and 47/22. 88 Let h(c) = c - 8. Let v be h(6). Calculate the least common multiple of (-13)/v + (-9)/(-6) and 10. 40 Let q(m) = -m + 1. Let b(c) = -c2. Let f(w) = -b(w) + 5q(w). Let i be f(4). Find the common denominator of -79/6 and 156/27 + i - 0. 18 Let g(z) = z - 7. Let t(f) = 7. Let h(a) = -3g(a) - 2t(a). Let u be h(8). What is the common denominator of (-1)/((-7)/u) + 0 and 8/7? 7 Suppose -5u + 19 = 3g - 26, 5u - 2g = 20. What is the least common multiple of 9 and u? 18 Suppose 35 = 29f - 28f. What is the lowest common multiple of f and 6? 210 Let i be (-7)/14 - (-1)/2. Suppose ij - 68 = -5s + 2j, 0 = 3j + 12. Calculate the lowest common multiple of 5 and s. 60 Let q be (96/56)/(2/7). What is the lowest common multiple of 12(28/q + -4) and 7? 56 Let b = 0 + 8. Suppose -3t - 4i = 2, 0t - t + 2i + 16 = 0. Calculate the smallest common multiple of 2/(-8) - (-34)/b and t. 12 Let k be 1/87075(-4382763)/(-2). Let r = k + 2/29025. Calculate the common denominator of ((-4)/(60/(-87)))/(-1) and r. 30 Let c = -191/9 - -1216/45. Let i = -4308 + 17319/4. Calculate the common denominator of i and c. 20 Let j = -3/1321 + 196847/7926. Let y(d) = -3d + 1. Let x be y(-1). Suppose 2p = -0p + 3u - 71, xu - 174 = 5p. What is the common denominator of p and j? 6 Let o be 41(-2)/8. Let t = 8 + o. What is the lowest common multiple of 6 and t? 42 Let d be 5/(-2)2/1. Calculate the common denominator of (4/(-10))/(3/60) and (76/10)/(7/d). 7 Let v be (-2)/(-6) - 23/(-3). Suppose v = o - 0o. What is the least common multiple of 0 + ((-24)/(-1))/3 and o? 8 Suppose -3m + 2s = 6s - 5, s - 11 = -4m. What is the lowest common multiple of 9 and m? 9 What is the common denominator of -67/10 and 6/20 - (-7)/(-28)? 20 Let q = -15185/4 + 3776. Find the common denominator of q and -35/32. 32 Let l = -1277 + 488. Let b be (12 + 106)/((-5)/33). Let p = b - l. Calculate the common denominator of -91/2 and p. 10 Let r be (217/(-126))/(2/(-3)). Let u = r + -11/4. What is the common denominator of -49/3 and u? 6 Let i = 116425/12 - 9709. Let f = i + 178/15. Find the common denominator of -51/14 and f. 140 Let s be (2 + 1)/1 - 16. Let a = s - -15. Calculate the smallest common multiple of a and 8. 8 Suppose -4y = -2s - 2, y - 2y + 11 = 3s. Let r = -16375/16 - -1024. Find the common denominator of 2 + 101s/54 and r. 144 Suppose -5x + 103 = 3u, -72 = -2u - 2x - 2x. Suppose -2k + n + 13 = 0, 3k - 4n = 8k - u. What is the smallest common multiple of 12 and k? 12 Suppose 0 = o - 3o. Suppose o = -5m + 4m - 3. What is the common denominator of 3 + 201/m and -46/7? 21 Suppose 3y = 4u - 206, 5u - u = 8. Let c = 511/8 + y. Calculate the common denominator of 85/14 and c. 56 Let g be ((-26)/4)/(4/(-8)). Suppose -3 = -4u + g. What is the least common multiple of 12 and u? 12	{ "pile_set_name": "DM Mathematics" }
e (4/6)/((-22)/(-132)). Let t(x) = x3 - x2 + 3x - 5. Is 11 a factor of t(c)? True Let f be 1/2 - 45/(-6). Suppose fz - 243 = 5z. Is z a multiple of 27? True Let b = -274 + 321. Does 4 divide b? False Let x(j) = 6j + 72. Is 6 a factor of x(0)? True Let i(t) = 2t - 4. Let a = 10 + -13. Let f be i(a). Is 17 a factor of ((-15)/f)/(2/68)? True Let q = -1 + 55. Let k = 92 - 130. Let h = k + q. Is h a multiple of 14? False Let h(q) = 23q + 3q - 3 - 8. Let x be h(-5). Let g = x + 231. Does 30 divide g? True Let b be (-16)/(-3) + 20/30. Let y(s) = 3s*3 + 2s*2 - s - 4. Let g be y(2). Let z = g + b. Is 28 a factor of z? False Let x(j) = -88j*3 - 4j*2 - 5j. Is x(-1) a multiple of 5? False Let f(x) = -7x2 + 15x*2 + 7 + 12x - 9x2. Let r be f(9). Suppose 0 = -q - q + r. Is q a multiple of 13? False Let p(g) = -g3 + g2 - 4g + 90. Does 45 divide p(0)? True Suppose -25k + 17159 = -7641. Is 31 a factor of k? True Let h be 46/(-8 + 4 - -3). Let n = h - -134. Is 11 a factor of n? True Suppose -8v - 90 = -5f - 4v, -f + 18 = -5v. Let s = f + 20. Is 6 a factor of s? False Let b be (-18)/(-63) + 402/14 + 0. Does 3 divide b/(2 + 2 + -3)? False Let y = 22 - 22. Let p = 0 - y. Suppose -1 - 3 = 2c, o + 2c - 1 = p. Is o even? False Suppose -30331 = -17d - 5256. Does 25 divide d? True Suppose 4m = -2f + 26, f + 15 + 0 = 5m. Let i(g) = -3g*2 + fg - 2g3 + g3 - g3 - 1. Is i(-4) a multiple of 22? False Suppose f + 7x - 3x + 16 = 0, 5f = -4x. Suppose -y - 2 = 0, -fa = 2y + y + 22. Is 5 a factor of ((-340)/119)/(a/14)? True Let g(i) = -25i*2 + 2. Let y be g(1). Let v = y + 29. Is 2 a factor of v? True Suppose 16w - 17w - 4 = 0. Does 5 divide 2 + -2 + 4 - w? False Suppose 16r - 15257 = -3r. Is r a multiple of 73? True Suppose -4n - 3z + 1 = -2, -9 = -5n - 2z. Suppose p = ny - 26, 2p - 5 + 1 = -2y. Is 5 a factor of y? False Let j(i) = -i*3 + 21i*2 - 20i + 139. Does 33 divide j(19)? False Does 4 divide 92/207 - (-18676)/18? False Let q be (-32 + 1)/((-5)/25). Let f = -89 + q. Is f a multiple of 4? False Let z = -11 + 293. Suppose z = s + 2s. Is 38 a factor of s? False Suppose -21t + b = -16t - 487, -b + 3 = 0. Does 14 divide t? True Suppose 4p = -61 + 357. Suppose 5r - p = 106. Is r a multiple of 17? False Let j(x) = -x3 - 9x*2 + 13x - 25. Let k be j(-11). Suppose -45 = -3n + u, -2n = 3n - 2u - k. Is n a multiple of 16? True Suppose 3p - 5y = 987, 31p + 4y + 1632 = 36p. Does 7 divide p? False Suppose 2h = 5x, 6x - 4h = 3x - 14. Suppose t + 2i - 31 = 0, xt - 72 = 2i - i. Is 10 a factor of t? False Suppose -19u + 10u = -11718. Does 20 divide u? False Let h(q) = q3 - 17q*2 + 74q + 7. Does 11 divide h(14)? False Let i = 126 + 160. Is 22 a factor of i? True Suppose -4g + a + 1073 - 69 = 0, 4a + 1016 = 4g. Does 5 divide g? True Let j(r) = 3r - 7. Let w be j(3). Suppose -wp = 4c, -1 = -c + 2c. Suppose -n + pn - 19 = 0. Is 13 a factor of n? False Let v be (73 + -3 + 6)3. Let t = v - 158. Suppose -p + 5f = -t, 2f - 408 = -5p - 2f. Does 20 divide p? True Let w = 1 + 3. Suppose 0 = 4h, -15 = -3g - 9h + wh. Suppose 130 = gv + 25. Is v a multiple of 21? True Let j(r) = -r*2 + 8r + 35. Let h be j(11). Let w be -502/((-4)/1). Suppose 3s - h + 77 = 5x, -5s - w = 0. Is 9 a factor of x? False Suppose y + q - 658 = -y, -5q = y - 338. Is 41 a factor of 6/1(y/6)/4? True Let z(k) = -130 - 127 + 241 - 8k. Is 11 a factor of z(-13)? True Let n(p) = 32p + 173. Is n(0) a multiple of 40? False Let k be (6/(-10))/(6/(-30)). Suppose 45 = g + k. Is g a multiple of 9? False Let l(c) = 19c. Let s be l(-1). Let h = 22 - s. Let r = h - 11. Is r a multiple of 24? False Let w be 3 + -2 + 2 + 2. Let f = 27 + w. Let p = f + -8. Is 14 a factor of p? False Suppose 0 = b + 3p + 11 - 43, 5b + 2p - 95 = 0. Let i(f) = 7f - 82. Does 30 divide i(b)? False Does 92 divide (-9)/63 - 75357/(-63)? True Let d = -241 + 1342. Does 11 divide d? False Let n(x) = 2x - 11. Does 17 divide n(14)? True Let s(k) = -36k - k2 - 14k + 32k + 23. Is s(-16) a multiple of 11? True Let x(u) = -u3 - 8u*2 - 7u - 12. Let y(z) = -z*2 - z + 1. Let r(d) = x(d) - 2y(d). Is 16 a factor of r(-6)? True Let t(k) be the first derivative of -9k2/2 - 11k + 5. Does 17 divide t(-5)? True Let a(b) = b3 - b2 - b. Let g(k) = -3k3 + 15k*2 + 5k - 6. Let h(q) = 2a(q) + g(q). Suppose 2p = 3j + 29, p = 4p - j - 40. Is 11 a factor of h(p)? True Suppose 0 = -z - s + 295, 2068 = 6z - 5s + 243. Is z a multiple of 8? False Suppose 302 = 2h - x, 2x = -2x. Does 18 divide h? False Suppose -5w - i + 1313 = 0, -w + 6w - 1323 = 4i. Does 15 divide w? False Is 5 a factor of -2 - -7 - (24 - 160)? False Suppose 0 = 4x + 5n - 5692, -4 = -3n - 16. Is x a multiple of 42? True Let p = 914 + -594. Is p a multiple of 10? True Let j = -36 - -20. Let g = j - -11. Is 12 a factor of (0 - -57) + 8 + g? True Let n be 16/(-48) + 28/3. Suppose 4u - nu = -730. Does 17 divide u? False Suppose 211 + 59 = 3w. Does 9 divide w? True Let b = 2263 - -698. Is 21 a factor of b? True Suppose 3a = -3k + 1176, 43k - 42k = a + 402. Is 49 a factor of k? False Suppose 7a - 2904 + 888 = 0. Suppose 0 = 5b + 4q - 606 - a, 0 = b - 4q - 174. Does 13 divide b? False Is 1 - 1665/(-5) - -6 a multiple of 20? True Suppose b - 1160 = 4m + 5b, -3m = -2b + 865. Let u = m - -497. Suppose -2s = 2s - u. Is s a multiple of 9? False Suppose 6 = 4x - 14. Suppose -30 = xm + 5. Is 15 a factor of 10/35 + (-103)/m? True Let x be 21 + 31 - -15. Let n = x + -46. Is 4 a factor of n? False Let v be (5 - (1 - -2)) + 7. Let q(n) = n3 - 8n*2 - 10n + 13. Let u be q(v). Suppose -9 = s - us. Is s even? False Let m = 287 - 167. Is m a multiple of 6? True Suppose 2r + 15r = 4r. Is -4 + r + 70 + 10 a multiple of 17? False Let q be 1 - 2 - (-2 + 1). Let r(h) = h + 22. Is r(q) a multiple of 22? True Suppose 2r - r = -30. Let a = r + 34. Is a a multiple of 2? True Does 5 divide (-67)/670 - (-3982)/20? False Let s(y) = -224y + 4. Let c be s(-2). Is 28 a factor of c/3 - 8/(-24)? False Let n = 449 + -149. Suppose 0l = 4l - n. Is l a multiple of 15? True Let u = -365 + 996. Suppose 5r - u = -61. Does 29 divide r? False Let r(w) = 137w - 140. Is 2 a factor of r(4)? True Let z(n) = -n*2 + 8n - 21. Let l be z(13). Let a = 558 + -375. Let k = l + a. Is k a multiple of 21? False Let r(m) = m*2 + 4m - 28. Let k be r(3). Let n(d) = -2d + 18. Is n(k) a multiple of 4? True Let g(l) = -l2 + 10l + 9. Let x be g(7). Let y = 93 - x. Is 7 a factor of y? True Suppose 0 = 5u - 21 - 4, -157 = -3q + u. Suppose 0f = 2f + q. Is -22/4 - f a multiple of 21? False Let l(y) = 53y + 1. Let u be l(-1). Let a = -505 + 594. Let b = a + u. Is b a multiple of 9? False Let u = -12 - -14. Suppose 4i + 16 = -4d, -2i + 0i = 5d + u. Is 97 - 1i/(-3) a multiple of 19? True Suppose 0 = 2c - 6c + 8. Suppose -4l = -cl - 370. Suppose -4a + 247 = -l. Does 27 divide a? True Let q = -1482 - -1786. Does 10 divide q? False Suppose -11p + 2967 = -18142. Does 9 divide p? False Let k = -17 + 17. Suppose 3b = -15, ky - b + 1 = 3y. Suppose 0 = -u - yu + 267. Is 22 a factor of u? False Let o be ((-2)/3)/(5/(-60)). Let p = -9 + o. Let j(f) = -28f3 + f2 + 2f + 1. Is j(p) a multiple of 7? True Let g(p) = -3p - 23. Suppose -2 + 6 = 2t. Suppose -4m - 62 = 2k, 22 = -tm - 3k - k. Is g(m) a multiple of 12? False Suppose 15r = 2940 + 1065. Is r a multiple of 5? False Let c(n) = 10n*3 + 2n*2 - 3n - 1. Let r be c(2). Suppose 3l = 3d + 99, 2l + d - r = -2d. Is 9 a factor of l? True Suppose -5m + 15 = 0, -3j + 5841 = -4m + 9m. Does 116 divide j? False Let o be 7 + -4 + (-6)/(-3). Suppose ot - 382 = 3m, t = -4t - m + 366. Is 31 a factor of t? False Suppose -4p + 921 = -2u - u, 918 = 4p - 2u. Let q = p + -116. Is 28 a factor of q? True Suppose -90 = -3u - j + 79, -3j + 177 = 3u. Suppose -57 = -4r + u. Does 17 divide r? False Let r = 23 - 51. Is (-119)/r - ((-3)/(-12) + -1) a multiple of 2? False Let a be (-1134)/(-36)24/14. Let n(t) = t + 4. Let w be n(6). Let z = w + a. Is 13 a factor of z? False Suppose 10k = 5k + 150. Let i = 70 - k.	{ "pile_set_name": "DM Mathematics" }
686. 2, 3, 6781 List the prime factors of 73819. 73819 List the prime factors of 17064. 2, 3, 79 List the prime factors of 159845. 5, 7, 4567 What are the prime factors of 1313? 13, 101 List the prime factors of 72. 2, 3 List the prime factors of 3294. 2, 3, 61 List the prime factors of 3375. 3, 5 List the prime factors of 414. 2, 3, 23 List the prime factors of 31827. 3, 103 List the prime factors of 4254. 2, 3, 709 List the prime factors of 15851. 11, 131 What are the prime factors of 579? 3, 193 What are the prime factors of 3816? 2, 3, 53 List the prime factors of 61260. 2, 3, 5, 1021 List the prime factors of 10775. 5, 431 What are the prime factors of 5804? 2, 1451 List the prime factors of 2287. 2287 What are the prime factors of 6051? 3, 2017 What are the prime factors of 1798? 2, 29, 31 What are the prime factors of 5149? 19, 271 List the prime factors of 3541. 3541 What are the prime factors of 28313? 23, 1231 List the prime factors of 127222. 2, 63611 List the prime factors of 2317. 7, 331 What are the prime factors of 23730? 2, 3, 5, 7, 113 What are the prime factors of 175583? 71, 2473 List the prime factors of 377. 13, 29 List the prime factors of 63358. 2, 79, 401 List the prime factors of 674. 2, 337 What are the prime factors of 2045? 5, 409 List the prime factors of 24375. 3, 5, 13 What are the prime factors of 3165? 3, 5, 211 What are the prime factors of 340? 2, 5, 17 What are the prime factors of 6024? 2, 3, 251 What are the prime factors of 650? 2, 5, 13 List the prime factors of 1160. 2, 5, 29 List the prime factors of 56868. 2, 3, 7, 677 List the prime factors of 331. 331 What are the prime factors of 2691? 3, 13, 23 What are the prime factors of 49727? 49727 List the prime factors of 21019. 21019 What are the prime factors of 1499? 1499 What are the prime factors of 2061? 3, 229 What are the prime factors of 18011? 7, 31, 83 List the prime factors of 28957. 23, 1259 What are the prime factors of 3016? 2, 13, 29 List the prime factors of 1243. 11, 113 What are the prime factors of 2422? 2, 7, 173 List the prime factors of 56050. 2, 5, 19, 59 What are the prime factors of 975? 3, 5, 13 What are the prime factors of 13634? 2, 17, 401 What are the prime factors of 3046? 2, 1523 List the prime factors of 9610. 2, 5, 31 List the prime factors of 1188. 2, 3, 11 List the prime factors of 4341. 3, 1447 List the prime factors of 3971. 11, 19 What are the prime factors of 2070? 2, 3, 5, 23 What are the prime factors of 3702? 2, 3, 617 What are the prime factors of 80358? 2, 3, 59, 227 List the prime factors of 60118. 2, 30059 List the prime factors of 315. 3, 5, 7 List the prime factors of 2976. 2, 3, 31 What are the prime factors of 20409? 3, 6803 What are the prime factors of 357? 3, 7, 17 What are the prime factors of 6835? 5, 1367 List the prime factors of 14926. 2, 17, 439 List the prime factors of 899. 29, 31 List the prime factors of 37984. 2, 1187 What are the prime factors of 662? 2, 331 List the prime factors of 1483. 1483 What are the prime factors of 9297? 3, 1033 What are the prime factors of 39243? 3, 103, 127 List the prime factors of 9024. 2, 3, 47 What are the prime factors of 11659? 89, 131 List the prime factors of 8459. 11, 769 List the prime factors of 1217. 1217 List the prime factors of 88218. 2, 3, 13, 29 List the prime factors of 3676. 2, 919 What are the prime factors of 1535? 5, 307 What are the prime factors of 134894? 2, 67447 What are the prime factors of 121? 11 List the prime factors of 1155. 3, 5, 7, 11 What are the prime factors of 761? 761 List the prime factors of 20249. 20249 List the prime factors of 60781. 7, 19, 457 What are the prime factors of 1108? 2, 277 List the prime factors of 3163. 3163 What are the prime factors of 484? 2, 11 List the prime factors of 254. 2, 127 List the prime factors of 9651. 3, 3217 List the prime factors of 1307. 1307 What are the prime factors of 9239? 9239 List the prime factors of 12181. 13, 937 What are the prime factors of 1175? 5, 47 List the prime factors of 5659. 5659 List the prime factors of 29927. 29927 What are the prime factors of 2072? 2, 7, 37 List the prime factors of 7682. 2, 23, 167 What are the prime factors of 11151? 3, 7, 59 What are the prime factors of 10898? 2, 5449 List the prime factors of 4272. 2, 3, 89 List the prime factors of 3140. 2, 5, 157 List the prime factors of 8124. 2, 3, 677 List the prime factors of 3312. 2, 3, 23 What are the prime factors of 564? 2, 3, 47 List the prime factors of 1117. 1117 What are the prime factors of 332? 2, 83 List the prime factors of 11366. 2, 5683 What are the prime factors of 5542? 2, 17, 163 List the prime factors of 18749. 18749 What are the prime factors of 110826? 2, 3, 47, 131 What are the prime factors of 5750? 2, 5, 23 List the prime factors of 4674. 2, 3, 19, 41 What are the prime factors of 5076? 2, 3, 47 What are the prime factors of 884? 2, 13, 17 What are the prime factors of 3839? 11, 349 List the prime factors of 7685. 5, 29, 53 What are the prime factors of 5020? 2, 5, 251 What are the prime factors of 571? 571 What are the prime factors of 134848? 2, 7, 43 List the prime factors of 17076. 2, 3, 1423 What are the prime factors of 42983? 53, 811 List the prime factors of 77. 7, 11 List the prime factors of 6688. 2, 11, 19 List the prime factors of 1596. 2, 3, 7, 19 What are the prime factors of 55150? 2, 5, 1103 What are the prime factors of 58392? 2, 3, 811 What are the prime factors of 12992? 2, 7, 29 List the prime factors of 13384. 2, 7, 239 List the prime factors of 104078. 2, 13, 4003 What are the prime factors of 275? 5, 11 List the prime factors of 6301. 6301 List the prime factors of 1733. 1733 List the prime factors of 102687. 3, 13, 2633 List the prime factors of 34660. 2, 5, 1733 List the prime factors of 783. 3, 29 List the prime factors of 2157. 3, 719 What are the prime factors of 1031? 1031 List the prime factors of 1770. 2, 3, 5, 59 What are the prime factors of 4557? 3, 7, 31 List the prime factors of 3684. 2, 3, 307 List the prime factors of 57932. 2, 7, 2069 List the prime factors of 24510. 2, 3, 5, 19, 43 List the prime factors of 16873. 47, 359 List the prime factors of 3194. 2, 1597 What are the prime factors of 5329? 73 List the prime factors of 2334. 2, 3, 389 What are the prime factors of 2503? 2503 What are the prime factors of 30038? 2, 23, 653 List the prime factors of 8901. 3, 23, 43 What are the prime factors of 4460? 2, 5, 223 What are the prime factors of 3273? 3, 1091 List the prime factors of 1016. 2, 127 List the prime factors of 6468. 2, 3, 7, 11 List the prime factors of 1903. 11, 173 List the prime factors of 814. 2, 11, 37 List the prime factors of 5086. 2, 2543 What are the prime factors of 1240? 2, 5, 31 List the prime factors of 79. 79 List the prime factors of 51511. 51511 List the prime factors of 1661. 11, 151 List the prime factors of 31032. 2, 3, 431 List the prime factors of 1779. 3, 593 List the prime factors of 9684. 2, 3, 269 What are the prime factors of 40509? 3, 7, 643 List the prime factors of 904. 2, 113 List the prime factors of 1136. 2, 71 List the prime factors of 11721. 3, 3907 List the prime factors of 100107. 3, 7, 227 What are the prime factors of 7712? 2, 241 List the prime factors of 30902. 2, 15451 List the prime factors of 8746. 2, 4373 What are the prime factors of 694? 2, 347 What are the prime factors of 355? 5, 71 List the prime factors of 25896. 2, 3, 13, 83 List the prime factors of 5158. 2, 2579 What are the prime factors of 1583? 1583 List the prime factors of 69529. 23, 3023 What are the prime factors of 2323? 23, 101 What are the prime factors of 1214? 2, 607 List the prime factors of 2122. 2, 1061 List the prime factors of 7109. 7109 What are the prime factors of 2303? 7, 47 List the prime factors of 15977. 13, 1229 What are the prime factors of 308? 2, 7, 11 List the prime factors of 160250. 2, 5, 641 What are the prime factors of 41366? 2, 13, 37, 43 List the prime factors of 52959. 3, 127, 139 What are the prime factors of 32665? 5, 47, 139 List the prime factors of 24604. 2, 6151 What are the prime factors of 6988? 2, 1747 What are the prime factors of 6995? 5, 1399 What are the prime factors of	{ "pile_set_name": "DM Mathematics" }
y*2. What is the third derivative of j(n) wrt n? 3480n*3 Suppose 7 = -3g + 2g - a, -2a = -4g - 22. Let n be -63/g1. Differentiate 0m*3 + 2m*3 + 4 - 4m*n - 2m*3 wrt m. -12m*2 Let m = -296/3 + 101. Let h(q) be the first derivative of -mq*3 + 7/2q*2 + 0q + 6. Find the second derivative of h(j) wrt j. -14 Let b(i) = -2i2 - i + 1. Let y(a) = -3a*2 + 6a - 66. Let o(g) = 3b(g) + y(g). What is the first derivative of o(d) wrt d? -18d + 3 Let d(p) = -3p - 8. Let n be d(-5). Suppose 5c = nc - 8. Find the third derivative of 5g*5 - 3g*5 + 8g*2 - 3g*5 + cg*5 wrt g. 180g*2 Let i = -2 - -4. Let a = 4 - i. What is the derivative of 10n + an + 4n*2 - 12n - 5 wrt n? 8n Let x(w) be the third derivative of 51w*5/20 + 161w*4/24 - 89w*2 + 1. Find the second derivative of x(h) wrt h. 306 Let s(y) be the first derivative of 5y*4/12 + 6y*2 - 25y + 5. Let m(p) be the first derivative of s(p). Find the first derivative of m(u) wrt u. 10u Let o(w) = 45w2 - 6. Let a(z) = -z3 + 44z2 - 5. Suppose 0k - 12 = -2k. Let x(y) = ka(y) - 5o(y). What is the third derivative of x(j) wrt j? -36 Let l(z) be the first derivative of 0z - 1/5z5 + 0z*4 + 0z3 - z2 + 3. Find the second derivative of l(s) wrt s. -12s2 Let i(d) be the second derivative of 0d*2 + 0 + 2d*3 - 11/12d*4 + 17d. What is the second derivative of i(j) wrt j? -22 Suppose 4f - 3f = 8. Differentiate -37o4 + 66o*4 - 42o*4 + f wrt o. -52o*3 Let y = 69 + -66. Find the third derivative of -21o*2 - 7o*y - 132o + 132o wrt o. -42 Let v(q) = 2 + 3 - 4 + 4q. Let t(z) = 9z + 2. Suppose h - 67 = -64. Let u(p) = ht(p) - 7v(p). Differentiate u(f) with respect to f. -1 Let f(t) = t2 + 2. Let s = -1 - 0. Let w(x) be the third derivative of x5/60 + 2x*2. Let o(i) = sf(i) + 4w(i). Differentiate o(v) wrt v. 6v Let y(v) be the second derivative of 53v7/42 + v3/6 + 5v + 1. Find the second derivative of y(a) wrt a. 1060a3 Let k(x) = x3 + 2x*2 - 5x - 4. Suppose 7c + 15 = 2c. Let z be k(c). What is the second derivative of 7u + 0 + 2 - z + 7u*4 wrt u? 84u*2 Suppose 5i = g + 22, 5g - 2i + 3i - 20 = 0. Let y = 50 + -47. What is the third derivative of 54 + 2q*y - 6q*2 + 3q*g - 54 wrt q? 30 Let n(r) be the third derivative of 0r*3 + 0r*5 - 23/24r*4 + 0r*7 + 0r + 0r6 - 11/168r*8 + 0 - 25r*2. Find the second derivative of n(m) wrt m. -440m*3 Let t(w) = -1. Let g(b) = -13b + 1. Let z(i) = 14i. Let d(o) = 3g(o) + 2z(o). Let c(s) = d(s) - 2t(s). Differentiate c(h) with respect to h. -11 Let k(n) = -n3 + n2 - n + 2. Let p(g) = 100g3 - 32g*2 + 18g - 36. Let v(u) = -36k(u) - 2p(u). Find the third derivative of v(b) wrt b. -984 Let a(s) be the first derivative of 63s4/2 - 175s3/3 + 82. What is the third derivative of a(f) wrt f? 756 Let g(u) be the third derivative of -u6/40 + 16u5/15 + 145u*4/8 - 378u*2. Find the second derivative of g(o) wrt o. -18o + 128 Let u(f) = 19f3 - 5f*2 + f - 180. Let i(x) = -10x*3 + 3x*2 + 90. Let s(w) = -5i(w) - 3u(w). What is the derivative of s(k) wrt k? -21k2 - 3 Let u(r) be the first derivative of -r8/336 - r*5/5 + 3r*2 + 7. Let z(s) be the second derivative of u(s). Find the third derivative of z(v) wrt v. -60v*2 Let j(n) be the first derivative of 31n*4 - 66n + 91. What is the first derivative of j(i) wrt i? 372i2 Let j(r) = 3r*2 - 6r + 8. Let b be j(5). What is the derivative of -4 - bu - 22 + 16u wrt u? -37 Let p(a) = 68a3 + 295a*2 - 2a. Let s(m) = -342m3 - 1474m*2 + 11m. Let n(q) = -11p(q) - 2s(q). Find the third derivative of n(g) wrt g. -384 Find the second derivative of 15 - 31i - 6 + 397i*5 + 12i + 4i wrt i. 7940i*3 Let w(m) = 17m*3 - 3m*2 + 11m. Let g(u) = -u*3 + 2u*3 + 9u + 0u - 8u. Let y(j) = 22g(j) - 2w(j). What is the third derivative of y(p) wrt p? -72 Let s be ((-4)/10)/(9/(-180)). Let k be s/(-6)(-3)/2. What is the third derivative of -4f*k + 4f*4 + 3f*4 - 4f*4 + 4f*4 wrt f? 168f Let v(z) be the second derivative of 8z6/3 + z2/2 - 81z. Differentiate v(p) wrt p. 320p3 Let l(y) be the third derivative of 25y*6/12 + 347y*5/60 + 97y*2. Find the third derivative of l(w) wrt w. 1500 Suppose -f = -y, 3y - 32 = -y - 4f. Find the second derivative of -12r*4 - 35r*5 + 12r*y + 15r*5 + 10r wrt r. -400r3 Let x be 40/18 - (-4)/(-18). Differentiate x - 2883s*3 + 2883s*3 - 23s*4 wrt s. -92s3 Let x(l) be the second derivative of l7/42 - l*6/10 + 7l*3/2 - 5l*2/2 - 133l. What is the second derivative of x(v) wrt v? 20v3 - 36v*2 Let c(p) be the first derivative of 87p4/4 - p2 + 631p - 835. What is the derivative of c(v) wrt v? 261v*2 - 2 Let s(u) be the second derivative of 13u*9/7560 + 3u*5/40 - 11u*4/12 + 29u. Let v(x) be the third derivative of s(x). Differentiate v(h) wrt h. 104h3 Let m(v) be the first derivative of 4v*7/7 - 9v*6 + 646v*3/3 + 594. Find the third derivative of m(c) wrt c. 480c*3 - 3240c*2 Let z(x) be the second derivative of -3x5/10 + x4/3 + 17x3/6 - x2 + 90x. Find the second derivative of z(s) wrt s. -36s + 8 Let s(w) be the third derivative of 113w*5/60 + 15w4/8 + w3/3 - 97w2 - 1. What is the second derivative of s(t) wrt t? 226 Suppose -2v + 2 = -2. Suppose 0t = t + 2w - 6, 0 = 5t + 5w - 25. Find the third derivative of 0kv - 4k2 + k4 + 7k2 - 3k*t wrt k. -48k Let r be 2109/444 + (-2)/(-8). Let b(n) be the first derivative of 0n2 + 0n*3 + 0n*4 - 8n + 8/5n5 - r. Differentiate b(s) wrt s. 32s*3 Suppose 5b = t + 11, 1 = -2b + 5t + 10. Let u(h) = h*3 - 6h*2 - 6h - 5. Let z be u(7). Find the second derivative of -zm + bm + 4m5 + 7m - m wrt m. 80m3 Suppose 5h = v + 55, -3h + 7h + 2v = 58. Find the second derivative of -10q - hq + 6q + 23q4 wrt q. 276q*2 Let b(g) = 4g*2 - 61g + 18. Let v be b(15). Let i(y) be the first derivative of vy - 1 + 0y*2 - 5/3y*3. Find the first derivative of i(k) wrt k. -10k Suppose 0 = 4y + 3q - 150, -2y - 2y + 164 = -4q. Find the second derivative of 10t + 8t + 20t - yt3 wrt t. -234t Find the second derivative of -12d2 + 0d*5 + 8d*5 - 4 - 6d*5 + 2 - 16d*2 - 55d wrt d. 40d3 - 56 Suppose -2n = 5c - 1 - 0, 3c + 7 = -5n. Differentiate 0 - 8 - 9 + 8y*3 + c with respect to y. 24y*2 Let q(p) be the second derivative of -2 + 2p + 0p5 + 19/30p*6 + 7/2p*3 + 0p*4 - 1/2p*2. What is the second derivative of q(a) wrt a? 228a*2 Let g(j) be the first derivative of 12j + 13/3j3 + 3/2j*2 + 38. What is the second derivative of g(l) wrt l? 26 Let i(c) be the second derivative of 5/28c*8 - 4c + 0 + 0c3 + 0c*2 + 0c*5 + 0c*6 + 7/12c*4 + 0c*7. Find the third derivative of i(n) wrt n. 1200n*3 Let g(i) be the third derivative of 2i7/105 + i6/40 + 38i5/15 - 218i*2. Find the third derivative of g(m) wrt m. 96m + 18 Let c(o) = -o*3 + 3o*2 + 3o + 3. Let d = 6 - 8. Let t be c(d). What is the third derivative of -7z2 + 4z*4 + tz*2 - 4z*2 wrt z? 96z Suppose 5j - 3j + 5t - 101 = 0, 4t = 4j - 132. Differentiate 74v + 23 + jv4 - 74v wrt v. 152v3 Let l(i) = 66i*3 + 4i - 60. Let b(x) = -725x3 - 45x + 660. Let g(w) = 4b(w) + 45l(w). What is the derivative of g(m) wrt m? 210m2 Let d(b) = -b3 + 8b*2 - 9b + 15. Let u be d(6). Let c = -30 + u. Find the third derivative of 11w2 + 15w*3 + 10w*3 - 30w*c wrt w. -30 Let y(o) be the third derivative of 11o*2 + 0o*6 + 0 + 0o*3 + 0o*4 + 11/60o*5 + 2/105o*7 + 0o. What is the third derivative of y(b) wrt b? 96b Suppose 6o = -5d + 2o, 3d - 7 = -o. Find the second derivative of -6q + q*d + 0q*4 + 5q5 - q4 wrt q. 100q3 Let h(q) = -q2 + q - 2. Let t(w) = -8w*2 + 3w - 10. Let o(c) = 5h(c) - t(c). Find the second derivative of o(a) wrt a. 6 Let j be 2/7 + 76/28. Find the third derivative of -11o*j - 2o*3 + 3o*3 + 16o*2 - 2o*2 wrt o. -60 Find the third derivative of 2o*4 + 40o*3 + 5o - 3o - 2o*2 - 135o*3 + 45o*3 + 55o*3 wrt o. 48o + 30 Let v(k	{ "pile_set_name": "DM Mathematics" }
8/8. Calculate the highest common divisor of u and f. 15 Let a be ((-32)/10)/((-1)/5). Suppose 5k - 30 = 2n + 36, 6 = -2n. Suppose -k = -2x - 4x. What is the greatest common factor of x and a? 2 Let x be (2 + -1)25. Let i(q) = -q - q2 + 2 + q + 4q. Let k be i(3). What is the greatest common divisor of x and k? 5 Suppose -2q = 2p, 4p - 4 = -5q - 0. Suppose qb - 281 = -81. What is the highest common divisor of b and 5? 5 Suppose -5o = 3 - 18. Suppose r + 10 = or. Calculate the highest common divisor of 5 and r. 5 Let z be (-1725)/(-195) - 4/(-26). What is the greatest common factor of z and 81? 9 Let k be -3-1(-3)/9. Let n be k + (2 - -282) - 3. Suppose -v + n = 5. Calculate the highest common divisor of 25 and v. 25 Suppose -3r + 120 - 45 = 0. Suppose 2f + r = 7f. Calculate the highest common divisor of f and 40. 5 Suppose -4f - 3 = 17. Let c = -1 - f. Let q be (-2)/(-2) - (-4)/c. What is the greatest common divisor of q and 18? 2 Let q = -71 - -103. Suppose -q = -5t + k, -t + 0k - k + 10 = 0. Suppose -3g + 2g + t = 0. Calculate the highest common factor of g and 63. 7 Let k = -119 - -227. Suppose -2s + 33 = -3g, 3 = -g - 0. What is the highest common factor of s and k? 12 Let x(z) = 7z*2 - 1. Let l be x(-1). Let w(i) = 7i + 8. Let c be w(l). What is the highest common divisor of 10 and c? 10 Let m be (-232)/(-13) - ((-36)/(-39))/(-6). What is the highest common factor of 198 and m? 18 Suppose -3n - 60 = -4n. Let v(i) = i*2 - i - i - 3i. Let o be v(8). What is the greatest common divisor of n and o? 12 Let o = -1 - -5. Let p be 87/6 + 2/o. Calculate the highest common factor of 135 and p. 15 Let m = -81 + 123. Let f = -8 - 0. Let h = 36 + f. What is the greatest common divisor of h and m? 14 Suppose x - 4 = 0, 2x = 2w + x - 8. Suppose 0 = -4c + 4t + 80, t - 6 = -c + w. Calculate the highest common divisor of c and 40. 8 Let p = 14 - 10. Suppose r + 3y = -r - 33, -py - 48 = 3r. Let z = -10 - r. Calculate the greatest common factor of z and 14. 2 Suppose 2z - 8 = -4x, 5x - 7z = -4z - 12. Suppose xg - 10 = -g. Suppose -126 + 46 = -4w. Calculate the highest common divisor of g and w. 10 Suppose 253u - 255u = -104. What is the highest common divisor of u and 13? 13 Let c be -2 - (-5)/22. Suppose -33 = cq - 87. Calculate the highest common divisor of 27 and q. 9 Suppose -2b + 26 = 3p, 2b - 5 = -3. What is the highest common factor of 28 and p? 4 Let o = 3 + 1. Let p be (-6)/(-4)(o - 2). Suppose -pr + 2r = -10. Calculate the greatest common divisor of 10 and r. 10 Suppose -4a + 7a = 12. Suppose ab = -0b + 36. What is the greatest common divisor of 18 and b? 9 Let m be ((-56)/5)/(-4)70. Calculate the greatest common divisor of 28 and m. 28 Let n = -11 - -14. Suppose 0 = -5p - w + 78, -p + 10 = -0p + nw. Calculate the greatest common divisor of p and 48. 16 Suppose 3y + 4k - 79 = 0, 2y - 5y + 51 = -3k. What is the greatest common divisor of 231 and y? 21 Let w = -8 - -12. Let m be 24/5100/15. Calculate the greatest common divisor of m and w. 4 Suppose -8 = -8r - 0r. Calculate the greatest common factor of 7 and r. 1 Suppose -4i = -5 - 3. Suppose 0t + it = 0. Let y be (t + 2 - 0)1. What is the greatest common divisor of y and 3? 1 Suppose -8v + 3v + 3f = 0, 10 = -5v + 5f. Suppose 3b - n + 9 = 7b, 0 = 5b - vn - 24. Let y = 1 + b. What is the highest common divisor of 36 and y? 4 Suppose 2b = -b. Let d be (-6)/(-4) - 3/(-6). Suppose -dv + 0v + 10 = b. Calculate the highest common factor of 45 and v. 5 Suppose 116m - 315 = 109m. Suppose 2c - 4c + 30 = 0. Calculate the greatest common divisor of c and m. 15 Suppose w + 5 = 2w. What is the greatest common divisor of w and 40? 5 Suppose -2 = -5v + 4v. Suppose -3h + 2h = -3m, 2m = -h. Suppose -w + vw - 40 = h. Calculate the highest common factor of w and 20. 20 Suppose -2s + 60 = -0s. Let c(b) = -b*3 + 3b*2 - b. Let f be c(1). Let i be (-19 - f)/(-1 + 0). Calculate the highest common divisor of i and s. 10 Suppose 2c - 18 = 22. Suppose 0 = -2s + y + 4, -2s - 2y = -s + 3. Let z be (s + -21)(1 + -2). What is the greatest common divisor of c and z? 20 Suppose 4o = 5a + 697, -o + 153 = 2a + a. Let x be 1 - (-24 + 1)1. Calculate the highest common divisor of o and x. 24 Suppose 4d + 28 = -4y, 7 = 3d + 19. Let k = 6 + y. Suppose 2l - 5 = -p + 4l, kl = -4p + 20. What is the highest common divisor of 45 and p? 5 Let u be 4/(-3) - 148/(-12). Suppose -2y + 198 = -0y. Calculate the greatest common divisor of u and y. 11 Suppose 4 = 2a - 5y, a - 5y - 6 = -2a. Suppose 3p + 9 = 4p. Let z = -8 + p. What is the greatest common factor of a and z? 1 Let a = -135 + 141. Calculate the greatest common divisor of a and 36. 6 Let f be (-34)/(-8) - 2/8. Let l(o) = o2 - 2o. Let p be l(f). What is the highest common divisor of p and 2? 2 Suppose 0i - 8 = -i. Let l be ((-10)/3)/(2/(-3)). Suppose -lv + 21 = -139. What is the greatest common factor of v and i? 8 Let v = 3 + -7. Let r = v - -20. What is the highest common divisor of 64 and r? 16 Let n(q) = -q + 12. Let g be n(-10). Let t = 40 - -15. What is the greatest common factor of t and g? 11 Suppose q - 6 = -2b - q, 3b - 5q + 15 = 0. Suppose bd = 3d - 33. Calculate the highest common divisor of d and 44. 11 Suppose 0 = -0y - 4y + 468. Calculate the highest common factor of 13 and y. 13 Let b be ((-2)/(-5))/((-2)/(-440)). Let r be ((-12)/(-8))/(3/b). What is the greatest common divisor of r and 4? 4 Let a be (0 + 10)3/2. Let k(y) = -y*2 + 8y + 4. Let p be k(6). Suppose 3u = -b + p, u - 2u + 3 = -2b. Calculate the highest common divisor of a and u. 5 Suppose 5r - 76 = q, r + 5q - 25 = -r. Let z = 549 - 175. Let b = z + -209. What is the greatest common divisor of b and r? 15 Let x = 119 + 21. Calculate the greatest common factor of x and 20. 20 Let v(f) = -f3 - 2f*2 + 5. Let w be v(-7). What is the greatest common divisor of w and 25? 25 Let p(m) = 5m - 7. Let o(a) = 2a + 1. Let x be o(1). Let k be p(x). Calculate the greatest common divisor of k and 32. 8 Suppose -2n - 21 = -5n. Let m = -112 - -66. Let r = -18 - m. Calculate the greatest common divisor of r and n. 7 Let r = -22 + 25. Suppose -2 = rs + 4, -5s + 60 = u. What is the highest common divisor of u and 14? 14 Let o be (-213)/(-21) - 1/7. Let y be (-3)/((3/(-4))/1). Let m be 32(2 - 3/y). What is the greatest common factor of o and m? 10 Suppose 3c + 12 - 18 = 0. Calculate the highest common divisor of 22 and c. 2 Suppose 3 = -3v + 15. Let j be v(-2)/(-4) + 15. Let u = j + 19. What is the highest common divisor of u and 12? 12 Let q be 1(21/3 - 1). Suppose q = 2l - 12. What is the greatest common factor of l and 72? 9 Suppose -5o + 23 = 4h, 17 + 0 = h + 5o. Suppose -q + 26 = -h. Suppose -f = -3f + q. Calculate the greatest common divisor of f and 42. 14 Suppose -2y + 0y - 2q + 40 = 0, 0 = -5y - 4q + 95. Suppose -2t - 18 = -4m, -2 = -m - 3t - 8. What is the highest common factor of y and m? 3 Suppose 0 = -w + r + 4, 3r - 5 = -2. Calculate the highest common factor of 20 and w. 5 Let u(v) = 2v - v + 8v - v2 + 3. Let n be u(8). Let s = 58 + 8. What is the greatest common divisor of n and s? 11 Let m(p) = p3 - 8p2 + 3p + 9. Let d be 4 + (1 - 2/1). Let k be (48/(-9))/((-2)/d). Let q be m(k). What is the greatest common divisor of 3 and q? 3 Suppose -10u + 136 + 4 = 0. What is the greatest common divisor of u and 119? 7 Let s = 148 + -144. Calculate the highest common factor of 4 and s. 4 Suppose -5u + 12 = -u. Suppose 0 = ug + g - 48. Calculate the greatest common divisor of g and 108. 12 Let q be ((-3)/(-6))/((-1)/(-2)). Let m be (-4)/(-4)(q + 3). Let j(b) = 2b + 2. Let h be j(3). What is the greatest common factor of m and h? 4 Let z be 1-41/(-4). What is the greatest common divisor of z and 4? 1 Let r be (-3)/6 + (-18)/4. Let p be 2/r - (-3132)/30. Calculate the highest common factor of 13 and p. 13 Suppose 5b + 5j = 60, 3b - 5j - 2 = 2. Suppose 0 = -3z, y = 4z - b - 12. Let v = 75 + y. What is the highest common factor of 11 and v? 11 Let r be (-2)/(-5)2*10. Let p = -3 + -1. Let i = 5 + p. Calculate the greatest common di	{ "pile_set_name": "DM Mathematics" }
vt - 6v + v*3 + 6v*2 + 6. What is y(f)? -3 Suppose -2c = -3z + 25, 0 = 3c - z + 5z - 5. Let t = -5 - -5. Let s(g) = -g3 - 2g + 1 - 5g2 + 3g + tg. Calculate s(c). -4 Let j(c) = -4c + 4 + 2c2 - 7 - 3c*2 - 3. Suppose 4o = -o + 2h - 30, -3o - 2 = 2h. Determine j(o). -6 Let y(j) be the second derivative of j4/12 + j3/6 - 2j*2 + 3j - 6. Suppose -2l = -3l. Give y(l). -4 Let z(q) = -18q + q2 - 10 + 17q + 8q. Let k(s) = -7s*2 - 1. Let j be k(1). Determine z(j). -2 Let q be (4/(-5) - -1) + 424/530. Let j(o) be the second derivative of 11o4/12 - o3/6 + o*2/2 + 4o. Calculate j(q). 11 Let f(g) = -3g - 8. Let h(l) = -5l - 14. Let k(o) = 7f(o) - 4h(o). Determine k(-6). 6 Let t(o) be the third derivative of 1/2o3 - 1/24o*4 - 4o*2 + 0 + 0o - 1/60o5. Let h be t(0). Let r(f) = f2 - 2f. Give r(h). 3 Let t be 11/3 - (-10)/(-15). Let k(b) = -b*3 + 8b + 2. Let i(f) = f*2 + f - 1. Let s(o) = ti(o) - k(o). Determine s(-4). -1 Let a(q) = q*2 - 4q + 2. Let t be (-3)/120 - -2. Suppose tf - 7 = -3. Calculate a(f). -2 Let q(m) = -m*3 - 15m*2 - 20m. Let f(k) = 3k3 + 8k*2 - 25k - 80. Let z be f(-3). Calculate q(z). 84 Let r(z) = -8z - 4z*2 - 5z - 5z + 0z*2 + 24z - 5. What is r(3)? -23 Let t(f) = 5f2 - 4f - 3. Let m(u) = -14u2 + 11u + 9. Let j(d) = 4m(d) + 11t(d). Let l be -13 + 23 + 20/(-2). Determine j(l). 3 Let x(m) = 2m - 3. Let q be x(5). Let n(i) = -i - 2. Let y be n(q). Let u = y - -4. Let k(a) = a3 + 4a*2 - 5a - 6. Give k(u). -6 Let m(n) = 3n3 + n2 - 1. Suppose -7g + 6g = -5y + 6, -4 = 4g. What is m(y)? 3 Let j(l) = -2l*3 - 39l*2 + 18l - 27. Let u be j(-20). Let m(n) = -n*3 + 13n*2 - n - 1. Determine m(u). -14 Suppose -19c - 12 - 64 = 0. Suppose -2v - 24 = v. Let t be v3/(-16)c. Let y(z) = z + 8. What is y(t)? 2 Let d(l) be the first derivative of -3l*2/2 + 28l - 8. Let o be d(8). Let j(f) be the second derivative of -f*4/12 + 5f*3/6 + 2f. What is j(o)? 4 Let x(i) be the second derivative of -17/6i3 - 1/2i*2 + 0 + 16i. Calculate x(1). -18 Let f = -568 + 17041/30. Let a(c) be the third derivative of 0 - fc5 + 0c - 1/2c3 - 7c*2 + 5/24c*4. Calculate a(3). -6 Suppose 5r + 4u - 25 = -6, 3r - 11 = -2u. Let n(t) = 4t*r - 19t - 5 + 4 + 12t + 8t. Calculate n(1). 4 Let s be 1434/(-15) - (3 + (-13)/5). Let n be s/(-30) + -3 - (-31)/(-5). Let q(b) = -b*2 - 6b + 5. Give q(n). 5 Let j be 6(-6)/(-9) - 0. Suppose -3a + s + 1 = -2a, 0 = a + js - 16. Let m(b) = b + 12 - b + b - 14. Determine m(a). 2 Let s(o) be the second derivative of o*3/6 - 7o*2/2 - 2o. Suppose 26 = 2z - 2n, -5n + 10 = 25. Let x = z - 10. Give s(x). -7 Let f(u) = -u3 - 17u*2 - 17u - 4. Let s be f(-16). Let w = -18 + s. Let m(q) = q*2 + 3q - 6. Calculate m(w). 12 Suppose -20 = 5k, 0 = -2h - k + 4 - 2. Suppose 5g + h - 26 = 4m, 6 = 4g + 3m. Let n(z) = gz + 5z + 3z2 - 7z + z3. Give n(-2). 2 Let q(j) be the third derivative of j6/360 - 7j5/120 + j4/24 + 2j*3 - 3j*2. Let d(t) be the first derivative of q(t). Calculate d(5). -9 Let l(k) = -2k + 4. Suppose 12w - 54 = 6w. Let j(f) = 4f - 33. Let b be j(w). Calculate l(b). -2 Let w(j) = j2 - 4j - 2. Let d(m) = -m*3 + 4m*2 + 7m - 7. Let s(q) = -q*2 + 6q + 5. Let a be s(6). Let k be d(a). Give w(k). -5 Let f(w) be the second derivative of -w*4/12 + 3w*3/2 - 2w*2 + 186w. Determine f(6). 14 Let x(r) = -44r - 11r*3 - 1 + 5r*2 - 6r*2 + 46r. Determine x(1). -11 Let v(b) be the second derivative of -b*4/24 - 2b*3/3 + 5b*2 - 22b. Let i(l) be the first derivative of v(l). What is i(-5)? 1 Let x(o) = -29 + 225o + 32 - 226o. Calculate x(2). 1 Let b(p) = -2p3 + 2p*2 - 12p - 5. Let n(j) = j3 + j2 + j. Let i(c) = -b(c) - 3n(c). Calculate i(-6). -13 Let w(f) be the third derivative of -f5/60 - 7f*4/12 - 7f*3/3 + 372f*2. Determine w(-11). 19 Let d(k) = -3 + 0k*2 + 4k*2 - 3k*2 - 4k*2 + 6 + k. What is d(2)? -7 Let r = 35 + -32. Let h(k) = 6 - 2k*2 - 10k + 3k2 + 2k + r. What is h(6)? -3 Suppose -162s + 164s - 10 = 0. Let q(p) = 4p + 4. What is q(s)? 24 Let b(s) = s2 + 5s + 6. Let t(g) = 25 - g - 9 - 6. Let h be t(7). Let y be (-4)/(-3) + (-19)/h. Determine b(y). 6 Let p = -110 + 104. Let g(b) = -b*3 - 5b*2 + 7b - 2. Determine g(p). -8 Suppose 0n = n - 3. Let d be (3/(-9))/(n/27). Let x(u) = 4u - 3. Determine x(d). -15 Let x be -3(4 + 80/(-24)). Let u(b) = b3 + 2b*2 - 5b - 3. Determine u(x). 7 Let i be (1 - (0 + 0))/(-1). Suppose -2d + 40 = -0d - 2s, -d + 10 = s. Let m(r) = -14 - r2 + d - 3r3 - r3. Determine m(i). 4 Let v(o) = -o3 + o2 - o - 4. Let j be ((-57)/9 + (-2 - -8))0. What is v(j)? -4 Let s = 19 + -10. Suppose -14g = -sg. Let p(r) = r2 + r - 12. What is p(g)? -12 Let j(y) = 0y - 5 + y - 2y. Let b = 831 + -836. Determine j(b). 0 Let x(z) = -5z + 52. Let g be x(11). Let p(n) = -7n - 10. Give p(g). 11 Let h(s) be the second derivative of s5/20 + s4/6 - s3/2 - s2 + 167s. Determine h(-3). -2 Let l = 15 + -15. Let z(c) = 0c + lc + 2 + 4c - 3c. Give z(-6). -4 Let a be (-1)/82-8. Suppose -3s - 26 = -5i - 0s, -as - 4 = 0. Let c be i/6 + 90/27. Let r(b) = -2b + 2. What is r(c)? -6 Let f(m) = 0m2 - m2 + 3m - 4m. Suppose 2o = -3z - 7, 0z + 11 = -4z - 3o. Let a be f(z). Let s(l) = -l3 - 2l*2 - 2l - 3. What is s(a)? 1 Let n = -4 - -7. Let x be 3 + 0 + 3/(-3). Let j(y) = 1 + 3 + n - y*x - 4y - 2y. Determine j(-6). 7 Let x(c) = -c2 + 3. Let i = 103 + -99. Suppose -j - j - 2 = -w, -2j - 2 = -iw. Calculate x(w). 3 Let d(m) = 2m*2 - 2m - 9. Let n be d(4). Suppose -6 - n = -7q. Let s(v) = -v3 + 4v*2 - v - 2. What is s(q)? 4 Let f(h) = 12h - 1. Let p(o) = -o*2 - 15o + 2. Let w(b) = -4f(b) - 3p(b). Give w(-3). 34 Let h be (6/(-9))/(2/12). Let m(a) be the first derivative of 3/2a2 + 1/3a*3 + 28 - 5a. Calculate m(h). -1 Let t(m) be the second derivative of -1/20m5 - 7/6m*3 + 0 + 1/2m*4 + 7/2m*2 + 2m. Let b(z) = z*3 - 86z*2 + 4z - 339. Let q be b(86). What is t(q)? -3 Let v(d) = -27d + 31. Let l be v(2). Let m(z) = z3 + 23z*2 + z + 17. Determine m(l). -6 Let w(b) = -32 - 2b*2 - 8 + 62 - 25 + 3b*2. Let f be (2/(-3))/(4/(-6)). Suppose 11 = 3j - f. Give w(j). 13 Let h(q) = -q - 5. Suppose 9r - 4r = -30. Determine h(r). 1 Let d = -562 + 569. Let r(q) = 2q2 - 16q + 2. Determine r(d). -12 Let z(l) be the third derivative of -1/4l4 + 0l*3 + 0l - 5l2 + 0. Let d(p) = p2 + 5p - 2. Let n be d(-5). What is z(n)? 12 Let r(o) = -2o - o2 + 3o2 - 430 + o3 + 434. Calculate r(-3). 1 Suppose -3u - 14 = -3h + 1, -2u + h = 10. Let y(l) = l3 + 8l*2 + 12l - 12. What is y(u)? 3 Let r(a) be the second derivative of a4/6 + a3/6 + 7a. Suppose 2b = 2j, 5j - 12 = -2b + 9. Suppose 5q = -bs - 0q + 14, 0 = 2q - 8. Calculate r(s). 6 Let x(m) = 4m*3 + 8m*2 - 17m - 2. Let j(y) = 7y3 + 15y*2 - 29y - 3. Let l(b) = 3j(b) - 5x(b). What is l(-5)? 11 Let c = -13808 + 13815. Let y(w) = 1 + 7 + 0w + w. Give y(c). 15 Let l(f) = f2 + f + 1. Suppose 12 = 4y - 0. Let w(j) = -3 + y + 8j + j2 - 4j. Let r(z) = -2l(z) + w(z). Calculate r(2). -2 Let j(r) = -11r*2 - 4r. Let n(x) be the first derivative of 7x3/3 + 3x*2/2 - 7. Let d(o) = 5j(o) + 8n(o). What is d(-3)? -3 Let v(f) = f2 + 4f. Let i be v(-4). Let k be i + 9/(-6)-2. Let p(r) = -kr - 3 - 2r2 + 8r*2 - 10r*2. Give p(-2). -13 Let p(r) = r + 8. Let g(k) = 4k*2 + 44k. Let x be g(-11). Give p(x). 8 Let y(l) = 5l3 - 9l*2 - 8l + 13. Let h(j) = 3j3 - j2 - j + 2. Let k(u) = -2h(u) + y(u). Give k(-6). 9 Let l(v) be the third derivative of v6/120 + v5/15 - 5v4/24 - 7v*3/6 - 11v*2. Suppose -5z + 2f = 7 + 12, -4z = 3f + 29. Give l(z). -7 Let w(g) = g2 + 17g + 17. Let v be w(-16). Let n be (2/(1/v))/((-2)/(-6)). Let a(k) = k*2 - 7k + 8. Calculate a(n). 2 Suppose -5 = -v, -2h = -9v + 4v + 11. Suppose -3f + hf = -8. Let y be f + 2 + 0 + 4. Let c(r) = r - 2. Calculate c(y). 2 Let o(l) = -1 + 11l - 4l - l - 2l. What is o(1)? 3 Let m(j) = -j*2 - 6j - 3. Suppose -1 = -2*t + 1. Let h be	{ "pile_set_name": "DM Mathematics" }
= -3.1 - -6.08. Let d = 0.02 + r. Let u = -4 + 8. Which is the closest to 0? (a) u (b) 0 (c) d b Let c be -2 + (1/(-4))/((-1)/4). Let r = -0.02 - 0.38. What is the nearest to 1 in c, 1, r? 1 Let n = -1.2 - 3.8. Let r = 4 + n. Let o = 5.2 - 5. Which is the nearest to r? (a) 4 (b) o (c) 1 b Let c be -3 + (24/15 - -2). Let v = 12 - 25/2. Let a = -61/2 - -31. What is the nearest to v in -1, c, a? -1 Let d be 12/13 + 0. Let g = -0.8 - -0.9. Let y = 0.4 - 0.2. Which is the closest to g? (a) d (b) -2/19 (c) y a Let k be 4/(-14) + (-2)/14. What is the nearest to -1/2 in 0.2, k, -2? k Let t = 614/7 + -88. Let n = 0.08 - 5.08. Which is the closest to t? (a) 4 (b) n (c) -1/4 c Suppose -2u - 4 = -6u. Let r be (-8)/63/u. Let t = 119/66 - 18/11. Which is the closest to -1? (a) r (b) 4 (c) t c Let k(p) = -1 - p - 1 + 0p3 - p3 + 3p*2. Let o = 7 + -4. Let g be k(o). Which is the closest to 1/2? (a) -2 (b) g (c) 0 c Let i = 2 + -3. What is the closest to 0.05 in 5, i, -0.4? -0.4 Suppose -10 = 2i, 0i + 30 = 2y - 4i. Let h = 21.7 + -18.7. Which is the closest to 0? (a) -3/5 (b) y (c) h a Let d(n) = 4n + 1. Let w(p) = 3p. Let g(b) = 4d(b) - 5w(b). Let q be g(0). What is the closest to 1 in -0.2, q, 3? -0.2 Let r be 2/44-26 - -1. Let i = 147142 - 1617079/11. Let h = 135 - i. What is the closest to 1 in 5, r, h? h Let v = 0.2 + -0.2. Let u = 0.5 - v. Let z(p) = 4p - 14. Let i be z(4). Which is the nearest to i? (a) -2/3 (b) -2 (c) u c Suppose -2s + 15 + 2 = -5p, 4s - 4 = 0. Let i be 3/10(-4)/p. Which is the closest to -1? (a) -4 (b) -1 (c) i b Let j = 46 - 51. Which is the nearest to -0.2? (a) 5 (b) j (c) -0.4 c Let c = -1.29 - 12.51. Let g = c - -14. What is the closest to 1/3 in g, -5, 0.4? 0.4 Let f = 0.3 - 0.5. Let i = f - -0.4. What is the closest to 0 in -4, 3, i? i Let z be 68/(-32) - (-2)/1. Which is the nearest to 0.1? (a) 2 (b) z (c) -2/5 b Let a = 4 - 6. Let p = a + 2.1. What is the closest to 0 in -4, p, -0.5? p Let c(o) = -o3 + 16o*2 - 26o - 29. Let f be c(14). Let x = 0.1 - -1.9. What is the nearest to 0.2 in x, f, -5? f Let t = 521702/45 - 11592. Let j = t + -7/9. Let i = 0 + 2. Which is the nearest to i? (a) 2/7 (b) -1/2 (c) j c Let l = 101 + -105. What is the nearest to -0.1 in -11, l, -3/4? -3/4 Let p = 5.97 + 0.03. Let g = -6 + p. Let m be 2(-2)/(-4)5. Which is the nearest to -1/3? (a) 1 (b) m (c) g c Let d = -1.06 + 0.76. What is the closest to -15 in -2, d, 2/11? -2 Let j = 0.08 + 0.12. Let r = -1.2 - -1. Let v = r - 0. Which is the nearest to -0.1? (a) 4/7 (b) v (c) j b Let n = -3.06 - -0.06. Let j = n - -2.6. Let t = j + 0.4. Which is the nearest to t? (a) -1 (b) 0.1 (c) 0.5 b Let k = -1.17 + 0.07. Let z = k + 0.6. Let q = -3 + 3.1. Which is the closest to -2? (a) z (b) q (c) 0.5 a Let n be 0 - (-1 - 0/(-2)). Let u = -104/147 + 2/49. Suppose 0 = -8y + 3y + 2t - 19, 0 = -3y + 5t - 19. Which is the nearest to n? (a) u (b) y (c) -0.3 c Let z = -19 - -21. Which is the nearest to z? (a) 5 (b) 1 (c) 1/3 b Let p be (-2)/(-8) - 121/132. Let u = 4 + 0. What is the nearest to 0.1 in u, p, 1? p Let c be 4 + (-28)/203. What is the closest to c in -3, -0.1, 0.5? -0.1 Let r be (-4)/10 - (-38)/70. Let f = 365.1 + -365. Which is the closest to f? (a) r (b) -5 (c) -0.3 a Let n = 0.1 + 3.9. Let t be ((-3)/(-9))/(1/(-3)). What is the nearest to 0 in t, n, 5? t Let o = 0.2 + -0.1. Let q = 17 - 17. Which is the closest to o? (a) q (b) 5 (c) -4 a Suppose -2u = 3u - 15. Let l = 5.2 - -1.8. Let t = 12 - l. What is the closest to 1/4 in t, u, -0.3? -0.3 Let x = 0.066 - 0.266. Which is the closest to 0? (a) -2 (b) x (c) -4 b Suppose -120l - 5 = -119l. Let k = 0.2 - 0.4. Let f = k + 0. Which is the closest to 1? (a) l (b) -3 (c) f c Let i = -47 - -46.9. Let f = 3 - 2.9. What is the nearest to i in -1/5, 5, f? -1/5 Let s = -0.17 + 1.17. Let b = -1 + 4. Let q = -70/3 - -24. What is the nearest to -1 in q, s, b? q Let l = 77745/2 + -37650. Let q = l + -1196. Let j = -26 + q. Which is the nearest to -0.1? (a) 2 (b) j (c) 2/15 c Let o = -0.42 + 0.02. Let s be 21 - (-11)/(-5). Let n be (-3)/(-9)9/(-6). Which is the closest to -1/2? (a) o (b) n (c) s b Let n = -6 - -2. Which is the nearest to -0.1? (a) n (b) 1 (c) 0 c Suppose -7m + 14 = -5m + 4o, 4m - 8 = -3o. Which is the closest to -1/8? (a) -2 (b) -4 (c) m c Let d be ((-4)/(-42))/(9/2439). What is the nearest to -0.1 in d, -0.1, 0.3? -0.1 Suppose -5q = -4q + o - 6, -2q + 17 = 3o. What is the closest to q in -2, 6, 5? -2 Let y = 0.3 - -0.2. Let k be (-27)/4 + 18/24. Let z be (-4)/k - (-6)/(-9). Which is the closest to z? (a) 1 (b) 0 (c) y b Suppose -10b = -5b + 10. Let v(i) = i*2 - 2i + 1. Let h be v(1). What is the nearest to 1/3 in h, b, -0.5? h Let d = 4/59 - -98/295. Let i = 3 + -2.6. Which is the closest to d? (a) -4 (b) i (c) -0.5 b Let z = 229 + -1606/7. Which is the nearest to -2/9? (a) z (b) -3 (c) 0 a Let s = -17.6 - -18. What is the closest to 0.1 in s, -1/7, -2/31? -2/31 Suppose -2 = -5c + h, -4c - 2h = -9 - 1. What is the nearest to 1 in -0.2, c, 4? c Suppose 4 = f - 2f. Let i = -7 - -7.2. Which is the closest to 1? (a) f (b) i (c) -2 b Let d = -0.73 + -0.27. Which is the nearest to 0.1? (a) -2/7 (b) 2/11 (c) d b Let d = -2 + 2. Let v = 1.014 - 0.014. Which is the closest to d? (a) -0.5 (b) 5 (c) v a Let n be (-2)/25(4 - 3). What is the closest to 0.2 in -2/9, -4/9, n? -2/9 Let o = -0.5 - -0.4. Let l = -2 - -3. What is the closest to l in -0.3, 0.1, o? 0.1 Let l = 0.14 + -5.14. Let w be 1 + -1 + 6/21. Which is the nearest to w? (a) 1/3 (b) l (c) -2/5 a Let z = 262 + -262. Let c = -0.1 - 0.3. Suppose 2l = 6l + 12. What is the nearest to z in -5, c, l? c Let d be (2/(-8))/((-21)/(-28)). What is the closest to 1/4 in 0, d, -4? 0 Let z be (44/8 + -6)/((-11)/2). Which is the nearest to 2/7? (a) 1 (b) z (c) 2/5 c Let t be (-12)/7 + 4/(-14). Let d = -1.3 - -0.3. Let o = d - -1.5. What is the nearest to t in o, 3, 0.1? 0.1 Suppose -3s - g + 4 = -15, -3s + 5g = 5. Suppose 4 = -3y + 2q, 3 = -3y - sq - 8. Which is the nearest to -1/4? (a) y (b) 2/11 (c) -3 b Let x = 8 - 7. Let k = -323/5 - -65. Which is the closest to x? (a) 0.2 (b) k (c) 2 b Suppose -5 = 2n + 3. Suppose -d - 3d = 12. Which is the nearest to -0.1? (a) d (b) 4 (c) n a Let f = -15.5 + 15. Which is the nearest to -0.1? (a) f (b) 0 (c) -3/7 b Let l = 6.5 + -7. Let u(f) = -2f*3 - 2f*2 + 1. Let k be u(-1). Which is the nearest to k? (a) l (b) -0.3 (c) 2/3 c Let k = 0.03 + -1.03. Let p = -2.9 - -2.7. Which is the nearest to k? (a) p (b) 0.5 (c) 5 a Let j = 2.9 - 3. Let l = -37 + 36.5. Which is the nearest to j? (a) l (b) 1/4 (c) 2 b Suppose -5o = 9 + 1. Let y be (3/o)/((-63)/(-1036)). Let m = 24 + y. Which is the nearest to m? (a) 1/4 (b) -1/4 (c) 4 b Let k = -5 + 9. Suppose 0 = -2j + j - 8. Let d be (-2)/42 - j/(-28). What is the nearest to d in k, -2, -3? -2 Let t = 41.4 - 47. Let n = -0.6 - t. Let x be (-14)/60 + (-2)/(-5). What is the closest to -0.2 in -1/5, x, n? -1/5 Let d be 1-2 - (-135)/35. Let b = -12/7 + d. Let i be (-1)/20/(-2). What is the nearest to -2 in b, i, 3? i Let h = -0.3315 + 10.3035. Let j = -0.072 + h. Let f = j + -10. What is the closest to f in -0.5, 3/5, 5? -0.5 Let v = -217 - -1518/7. Let h = -631 - -437. Let y = 1744/9 + h. Which is the nearest to 0.1? (a) v (b) y (c) 2 a Let o = 8 + -1. Let u = o + -7. Let g = 0.03 + 0.37. What is the closest to 3 in -0.2, u, g? g Let w = -11.9 - -12. Which is the nearest to 1/4? (a) w (b) 0.2 (c) -0.2 b Let l = 31 + -33. Which is the closest to -0.2? (a) -0.3 (b) 2 (c) l a Let u = -1.3 + 1.7. Let o = 4 + -5. What is the closest to u in o, 1, 3? 1 Let x = -0.201 - -0.101. Which is the nearest to x? (a) -4 (b) -19/5 (c) -3/4 c Suppose 2s = -0s. Let n = -1 + 1. Let f be ((-8)/6)/(-6 - n). Which is the closest to s? (a) 0 (b) 1 (c) f a Let s(z) = -6z - 6. Let r be s(0). Which is the nearest to r? (a) -4 (b) 4 (c) 2/15 a Let p = 1 + 0. Suppose -3j - 2j = 0. Which is the nearest to j? (a) 5 (b) p (c) 0.3 c Let x be (-4)/(-22) - 160/275. Let a be 3/(-14) + 2/4. Let j = 1	{ "pile_set_name": "DM Mathematics" }
ose 204 = -12l - 324. Let x = -45 - l. What is h(x)? 6 Suppose -3q + 15 = 0, -14y + 15y + 2q - 166 = 0. Let n(t) = -yt + 89t + 19 + 66t. What is n(17)? 2 Let r(h) = -h*2 - 13h - 8. Let w be r(-9). Let a be -6 + w + 21. Suppose a = -u + 5u. Let t(d) = -d*2 + 6d - 2. Give t(u). -2 Suppose s - 107 + 142 = 4a, 0 = 4s - 5a + 74. Let q(p) = 4p + 4. What is q(s)? -40 Suppose -g = 8 - 10. Suppose 2p + g - 8 = 0. Suppose -5o = -pw + 12, 3o + 4w + 6 = 22. Let d(b) = b + 16. Calculate d(o). 16 Let q(i) = i - 16. Let g(l) = -9 - 13 + 26 - 3. Let p(h) = -6g(h) - 2q(h). Give p(12). 2 Let x(d) = -6d - 15. Let m(z) = 17 + 20 + 3z + 7z - 14. Let v(y) = 5m(y) + 8x(y). Let k(t) = -t*3 - 8t*2 - 2t - 11. Let n be k(-8). Determine v(n). 5 Let i(z) be the third derivative of z5/60 + z4/24 + z*3/6 + 1511z2 + 2. Give i(4). 21 Let j(q) be the third derivative of -q5/60 - 11q4/24 + 3q*3/2 - 643q2. Calculate j(-12). -3 Let q = -19 + 25. Let y(z) = -z2 + 2z + 4z + qz - 8z. Suppose -2k = 2u - 4, -19u + 21u = 3k - 21. Determine y(u). -21 Let l(m) = -13 - 8 - 7 + 13m*2 + m - 10m*3 + 9m*3 + 10. Give l(13). -5 Suppose 4 = -35h + 39h. Let q(a) = -h + 0a3 - a3 - 7 + 6 - a*2. Let x be (-12 - -16)2/(-4). Determine q(x). 2 Suppose d - 26 = -26u + 23u, 4u + 2d = 34. Let q(s) = -2s + 10. What is q(u)? -8 Let o(y) = y3 + 5y*2 - 7 + 3y*2 - 9y - y2 - y2. Suppose 0 = -b + 4h - 19, -2b + 34h = 38h + 2. Calculate o(b). 7 Let p be -5 - ((-8)/(-24) + (-95)/15). Let k(i) = -2i2 - p + 5i*2 + 2i + 2i2 - 6i*2 + 4i2. What is k(-2)? 7 Let z be 5 + 0 + -1 + -2. Let h be -2 + z - (-5)/1. Let n(s) be the second derivative of s4/12 - s*3/3 + 7s*2/2 - 28s + 15. Determine n(h). 22 Let u(v) = -7v + 42370v*2 + 42369v*2 - 84747v2 - 7. Give u(-3). -58 Let g(k) = k3 + 4k2 - 6k - 13. Suppose -2p - 34b + 35b = 5, p - 5b = 20. Calculate g(p). -8 Suppose -2q - 25 = 3q. Let k(b) = -4b3 - 50b*2 - 45b - 3. Let n(t) = -t*3 - 12t*2 - 11t - 1. Let a(i) = 3k(i) - 13n(i). What is a(q)? -11 Let i(l) = -62l - 2. Let y = -4625 - -4624. What is i(y)? 60 Let q = 69 + 54. Let i(x) = 2x + 5 - qx2 + 70x*2 + 48x2 - x3. Calculate i(-6). 29 Let r(y) = -15y3 + 3y*2 + 7y + 5. Let c be r(-1). Let o be 5/2 - (-4)/(c/6). Let b(p) = -p*3 + 5p*2 - 4p - 1. What is b(o)? -1 Let f(d) = 2d - 11. Let p be f(8). Suppose px = 9 + 21. Let z(g) be the third derivative of g6/120 - g5/10 + g*4/8 - 4g*3/3 - 782g2. Calculate z(x). 10 Let d(r) = -r3 - 8r2 - 8r + 2. Let k be 10/15(0 - 12). Let f be 2 - 2 - -8 - 72/18. Let a be (-3 + k + f)/1. Give d(a). 9 Let k(a) = -a3 + 4a - 5. Let f(y) = 11 + 8 + 43y + 15 + 11. Let q be f(-1). Give k(q). -5 Let q(y) = -23y + 0y2 + 28y + y*2. Suppose -2w = p - 33 + 13, 3p + 4w - 50 = 0. Let s(g) = g - 15. Let h be s(p). Calculate q(h). 0 Let a(l) be the first derivative of l4/4 + l3 - 2l2 - 10l - 2617. Calculate a(-2). 2 Let k(s) = -2s + 19. Let g be 2 + (72/14 - 8/56). What is k(g)? 5 Let h(f) = -f2 + 8f - 3. Let a be -14 + (14 - 2)/(-12). Let u be (-4 - a)/(4/24). Determine h(u). 9 Let n(z) = -z2 - 9z - 2. Let a be n(-9). Let d be a/(3 - 4)1. Let h(b) = -b3 + 1 - 14b*2 + 6b*d + 4b*2 - b. Determine h(-4). 5 Let s(r) = 9r*2 - 64r + 1. Let t(g) = 8g2 - 52g + 1. Let l(c) = -5s(c) + 6t(c). Calculate l(4). 81 Let f(s) be the first derivative of 1/2s2 + 6 - s. Give f(-8). -9 Let y(z) = -13z - 13z - z2 + 30z. Let l(n) = n*2 - 14n + 3. Let r be l(14). What is y(r)? 3 Let d(b) = -44b - 14. Let s(f) = -34f - 8. Let h(m) = -2d(m) + 3s(m). Calculate h(-2). 32 Let f(s) = -s*3 + 33s*2 - 63s + 30. Let q be ((-124)/(-6))/(760/(-285))-4. What is f(q)? -1 Let c(q) = -q3 + 3q*2 - q + 2. Suppose x + 5w = -x + 99, 5w + 149 = 2x. Let n = 66 - x. Give c(n). -18 Let i(q) be the third derivative of 0q4 + 0 + 1/2q*3 + 0q - 1/30q5 - 195q2. Give i(3). -15 Let m(z) be the third derivative of z5/60 + 13z4/24 + 13z*3/3 - 96z*2. Calculate m(-3). -4 Let a(h) = 6h*2 - 3h + 1. Let b be a(1). Suppose 5y - 97 = by. Let z = 95 - y. Let m(f) = -2f3 + 2f*2 + 2f + 3. Give m(z). 23 Let o(z) = -3z + 10. Let g(h) = -h2 - 5h + 22. Let v be g(-7). Let a(d) = 7d - 28. Let s(x) = vo(x) + 3a(x). What is s(-3)? 5 Let d be 151(-7 + 8). Suppose -3j - 2j = -5t - 25, -3j = t - d. Let u(m) = 2m - 9. Give u(j). 1 Let d(w) be the second derivative of -11/2w2 + 8w + 0 + 1/3w3. Suppose 5z = 5j + 40, -5z + j + 50 = 6j. Determine d(z). 7 Suppose -13q + 32 = -20. Suppose 2s - 2 = qs. Let z(j) = -14j + 1. What is z(s)? 15 Let v(f) = f3 - 10f2 + 7. Let p(x) = x2 + 4x + 15. Let s be p(-5). Let b be (-4)/(-3 - 5)s. What is v(b)? 7 Let q(s) = -30s2 + 48s - 93. Let r(h) = -17h2 + 24h - 48. Let k(i) = -4q(i) + 7r(i). Determine k(22). -8 Let f(s) = 13s2 + 6s + 2. Let y(a) = 3a2 - a - 5. Let o(p) = -f(p) + 4y(p). Calculate o(-7). -1 Let d(y) = y3 + y2 + y. Let a = -97 - -79. Let b = 17 + a. Let v be d(b). Let h(m) = -4m + 1. Give h(v). 5 Let p = -364 + 116. Let s = p + 242. Let f(z) = z2 + 2. What is f(s)? 38 Let h = -632 - -632. Let f(n) = n - n2 - 3n + hn - 34 + 18 + 21. Give f(-3). 2 Let k(o) = -7o*2 + 4o - 3. Let n be -113/66 - (-10)/4. What is k(n)? -23 Let h = 8 + -3. Let c(x) = x3 + 5x*2 + 5x + 2. Let d be c(-3). Let o(i) = -hi2 + 6 - 4i - d + 5i + i2. What is o(-1)? -4 Let a = 2807 + -2803. Let p = 18 + -12. Let d(g) = 4g2 - g3 - 2 + pg - 6g. Give d(a). -2 Suppose 69t = 58t + 22. Let v(b) = -68b2 - b - 2b*t + 69b*2. What is v(3)? -12 Suppose -16 = 2h - 4h. Suppose f - u = -f + h, 4f - 8 = 4u. Let y(b) = 7 + b3 + 3b*2 - fb + 6b2 - 14b*2. Determine y(6). 7 Suppose 4c - 7 = y - 8, -y = -3c + 1. Let b(z) = 2z - 11. Let q(i) = -i - 3 + 2 + 12. Let d(t) = -2b(t) - 3q(t). Give d(y). -4 Let o(p) be the second derivative of 6p4 - p3/6 - p2/2 - 2479p. Give o(-1). 72 Suppose -3w - 7h + 30 = -5h, 66 = 3w - 4h. Let n(c) = c2 - 14c - 6. Calculate n(w). -6 Let j(v) = 11v3 - 21v*2 + 8v - 23. Let y(r) = 5r3 - 10r*2 + 4r - 11. Let a(n) = 4j(n) - 9y(n). Let w = 4182 - 4177. Calculate a(w). 12 Suppose -4z = -3 + 11. Let h(p) = -5p*3 + 7p*2 - 2p. Let g(d) = 9d3 - 12d*2 + 4d. Let t(i) = -4g(i) - 7h(i). Calculate t(z). 8 Let w(s) be the first derivative of -5s2 - 19s + 5827. Give w(-6). 41 Let i(u) = -10u + 22. Suppose -88z - 77z = -797 - 358. What is i(z)? -48 Let m(h) = 5h + 27. Suppose 0 = 4j - 3u - 59, -u = -j + 15 - 0. Suppose 4v - 2s + j = -0, 4v + 4 = 4s. Give m(v). -3 Let i(h) be the third derivative of 1/12h4 - 82h*2 + 0h + 0 + 11/6h3. Give i(-7). -3 Let w(u) = -u3 - 19u*2 - 34u + 6. Let l = -583 - -211. Let s = l + 355. Calculate w(s). 6 Let q be (-4295)/(6/(-3)1/2). Let l(y) = 4297 + 6y - 2y - q. Determine l(-3). -10 Let m(n) = n3 - 5n*2 + 2n - 11. Let r = 1653 + -1648. Give m(r). -1 Let i(y) = -y*2 - 3y - 2. Let t = 479 - 479. Suppose -18b + 34b + 32 = t. What is i(b)? 0 Let t = -17 + 79. Suppose -tq = -66q - 60. Let p(a) = -a*3 - 15a*2 - a - 12. Calculate p(q). 3 Let b be (-5 + 1)/(-4) - 8. Let z(x) = 12x + 12. Let h be z(b). Let y = h - -70. Let t(a) = 5a + 2. Calculate t(y). -8 Let h be -2(-4)/((-16)/(-6)). Let l(y) = 904 - 459 + 5y - 2y*2 - 449. Determine l(h). -7 Let c(g) = -5g*2 + 10g + 46. Let k be c(4). Let w(l) = -l*3 + 6l*2 + 5l - 8. Determine w(k). 22 Let f(i) be the first derivative of 3i2 - 19i + 1. Suppose -8p - 6p - 126 = 7p - 189. Calculate f(p). -1 Let t = -18 - -12. Let s(z) = -z2 - 5z + 12. Let v be s(t). Let h(x) = -3x + 10x - 6x - v. Give h(6). 0 Let q(r) be the first derivative of -2r*3/3 + 3r*2 - 9r + 96. Let c be q(2). Let m(o) = o - 2. Give m(c). -7 Let r(g) be the first derivative of 13g2/2 - 150g - 2825. Determine r(11). -7 Let k(z) be the third derivative of z6/60 + z5/10 + z*4/6 + 5z*3/3 + 1168z2. Give k(-4). -38 Let n(p) be the third derivative of p5/60 + p4/4 + p3/2 + p*2. Let o(u) = 38u + 36u - 106u + 36*	{ "pile_set_name": "DM Mathematics" }
- zc6 + c6 wrt c? -720c*3 Let o(c) be the third derivative of 3c*6/10 + 59c5/60 - c4/12 + 6c2 - 4c. Find the third derivative of o(l) wrt l. 216 Let o(b) = 78b2 - 6b + 43. Let j(d) = 157d2 - 11d + 85. Let n(x) = -6j(x) + 11o(x). Differentiate n(g) with respect to g. -168g What is the second derivative of 377 + 164b*4 - 59b*4 - 463b - 376 wrt b? 1260b2 Let n(u) = 1360u + 664. Let z(y) = -272y - 133. Let k(t) = 3n(t) + 16z(t). What is the first derivative of k(g) wrt g? -272 Find the third derivative of -11l*3 + 112l*3 - 19l*3 - 48l2 wrt l. 492 Let f(s) = -s2 + 3s + 1. Let l(t) = -199t*2 + 11t - 3. Let q(o) = 4f(o) - l(o). What is the second derivative of q(i) wrt i? 390 What is the third derivative of -10801 - 2s*2 + 10801 - 83s*4 + 20s wrt s? -1992s Let o = 149 - 145. Let m(c) be the third derivative of 0c*5 - 3c*2 + 0c - 1/8co + 0c*3 + 1/30c*6 + 0. What is the second derivative of m(f) wrt f? 24f Let x(s) = -3s3 - 2s*2 - 24s - 2. Let d(a) = 7a3 + 7a*2 + 70a + 6. Let t(b) = -3d(b) - 8x(b). Find the second derivative of t(o) wrt o. 18o - 10 Let c(s) be the second derivative of 83s*3/6 + 135s*2/2 - 2s - 140. Differentiate c(g) with respect to g. 83 Let x(h) = -15h3 - 2. Let m(l) be the first derivative of 15l*4/4 + 2l + 15. Let a(k) = -6m(k) - 5x(k). Differentiate a(w) with respect to w. -45w2 Let c be ((-24)/(-9))/((-5)/45-6). What is the second derivative of 0o - 4o + 71o4 - 43o*5 - 71o*c wrt o? -860o*3 Let b = 17 + -15. What is the third derivative of 11k*2 + 16k - bk2 - 16k + 6k6 wrt k? 720k3 Let j(d) = d2 - 4d + 1. Let o be j(6). Let w = o - 8. Find the second derivative of 4z*2 - wz - 4z2 + z4 + 0z*4 wrt z. 12z*2 Let s be 1/((2/4)/((-18)/(-4))). Find the third derivative of 5r*2 + 10r*4 - 9r*4 - sr*4 - 12r*4 wrt r. -480r Let i(b) be the third derivative of b5/60 - b4/6 + 5b3/6 + 6b*2. Let n be i(5). Find the second derivative of -nq - 2q + 3q - q2 wrt q. -2 Let p(a) be the second derivative of -a7/21 + 5a3/3 - 9a*2/2 - 8a. Let v(z) be the first derivative of p(z). Differentiate v(n) wrt n. -40n3 Let c be (-3)/1(1 - 2). Let y = -1029 - -1033. What is the third derivative of m*2 + 13m*c + 3m*2 - 9m*3 + ym*2 wrt m? 24 Find the third derivative of 608b - 110b5 + 413b - 101b5 - 1263b + b*2 wrt b. -12660b2 Let r(y) = y2 + 9y + 2. Let w be r(-9). Suppose -4d - 4 = -3d - wk, -5d + 3k + 8 = 0. What is the derivative of 1 - 2u - du - 5 wrt u? -6 Let k(f) be the third derivative of 11f6/15 - 3f4/8 - f3/6 + 29f2 - 1. Find the second derivative of k(j) wrt j. 528j Let c(u) be the first derivative of 0u - 31 - 2u*3 + 0u*4 + 0u*2 - 1/5u*5. Find the third derivative of c(a) wrt a. -24a Find the first derivative of 209j3 + 93j*3 - 104j*3 + 2j + 134j3 + 181j*3 + 651 wrt j. 1539j*2 + 2 Let q(f) = 27f*4 - 3f*3 + 232f*2 + 3f. Let o(k) = -k4 - k3 + k*2 + k. Let l(b) = -3o(b) + q(b). Find the third derivative of l(p) wrt p. 720p Suppose 0 = -17c + 25c - 16. What is the third derivative of -28k*2 - 10k*c - 33k*6 - 2k + 17k2 wrt k? -3960k*3 Let j(a) be the third derivative of 0a*5 + 0a*4 + 0a + 0a6 - 3a*3 + 0 - 29/210a*7 + 20a*2. Differentiate j(f) wrt f. -116f*3 Let y(p) be the second derivative of 245p*4/12 + 571p*2/2 - 576p. Differentiate y(t) wrt t. 490t Let i(k) be the third derivative of -445k8/336 + k4/12 + 7k3/2 - 651k*2. What is the second derivative of i(y) wrt y? -8900y3 Let b(z) be the third derivative of -z4/24 - 2z3/3 - 5z*2. Let d be b(-6). What is the derivative of -du3 + u3 + 2 - 1 wrt u? -3u2 What is the second derivative of b3 - 205b - 51b - 16b*4 + 4b*3 + 41b + 0b3 wrt b? -192b*2 + 30b Let q(d) be the first derivative of 58d3 - 177d + 153. What is the first derivative of q(y) wrt y? 348y Let m = 699/2 - 349. Let g(o) be the first derivative of 0o*4 + 0o*5 + 0o*3 + 0o + o*2 - 6 - mo*6. Find the second derivative of g(p) wrt p. -60p*3 Suppose 3i + 93 = 5d, -5i + 43 = 4d - 24. What is the third derivative of -2645o - 15o5 - 2o*2 - d + 2645o wrt o? -900o2 Suppose 2 + 3 = 5w - 5r, 3w = -3r + 9. What is the third derivative of 67q*w - 5q + 5q - 85q*2 - 12q*4 wrt q? -288q Suppose -u + 4 - 2 = 0. Suppose w - 3 = -uw. What is the third derivative of 5s*4 + 105s*2 - 98s*2 - 1 + w wrt s? 120s Let l(f) be the third derivative of 7/8f4 - 7/20f*5 + 0f + 0f3 + 0 + 24f2. Find the second derivative of l(r) wrt r. -42 Let s(t) be the third derivative of t6/720 - t*5/40 + 5t*4/12 + 16t*2. Let z(n) be the second derivative of s(n). Differentiate z(k) with respect to k. 1 What is the derivative of 88 - 108l - 317 - 63l - 74 wrt l? -171 Let l(w) be the second derivative of -8w6/5 - w5/10 - 11w4/12 + 2w*3/3 + 100w. Find the third derivative of l(q) wrt q. -1152q - 12 Let n(v) = -385v*4 - 17v*3 + 17v*2 - 1438. Let q(a) = 64a*4 + 3a*3 - 3a*2 + 240. Let z(r) = 6n(r) + 34q(r). Differentiate z(p) wrt p. -536p*3 What is the second derivative of -24s*2 + 4s*2 + 20s*2 - 410s + 618s3 wrt s? 3708s Let a(q) = -q5 - q4 + q*2 - q - 1. Let w(y) = 70y*5 + 5y*4 - 6y*2 + 157y + 5. Let m(n) = 5a(n) + w(n). Find the second derivative of m(g) wrt g. 1300g*3 - 2 Let q(a) be the second derivative of 6a*3 - 11/2a*2 + 0 - 13a. Differentiate q(g) with respect to g. 36 Let u(j) be the second derivative of 227j4/12 - 229j*3/6 + 188j + 2. Find the second derivative of u(q) wrt q. 454 Let r = 78 + -75. What is the second derivative of 486m3 - m4 - 11m*4 + 25m - 486mr wrt m? -144m*2 Let o = 119 + -98. Find the second derivative of 29k + 12k - 2k + ok4 - 10k wrt k. 252k2 Let a(v) be the first derivative of v9/378 - v5/40 + 8v*3/3 - 5. Let j(u) be the third derivative of a(u). Find the second derivative of j(l) wrt l. 160l*3 Let a(s) = -11s*3 - 3s*2 - 3s - 29. Let j = 50 + -46. Let w(v) = -12v3 - 4v*2 - 4v - 29. Let d(o) = ja(o) - 3w(o). Differentiate d(z) wrt z. -24z2 Let m(t) be the second derivative of 31/2t*2 + 0 + 11/2t*3 + 21t. Differentiate m(b) with respect to b. 33 Find the first derivative of 50 + 21s + 66s - 10 + 60 wrt s. 87 Let j(t) be the first derivative of -t*4/12 - 2t*3/3 + 5t + 15. Let x(r) be the first derivative of j(r). What is the second derivative of x(z) wrt z? -2 Let t(s) be the third derivative of -117s4/8 + 201s*3/2 - 689s2. Differentiate t(u) wrt u. -351 Let x(z) be the first derivative of z9/168 - z*5/4 + 17z*2/2 - 13. Let o(d) be the second derivative of x(d). Find the third derivative of o(l) wrt l. 360l*3 Let r(w) = -24w - 96. Let x be r(-4). Let t(n) be the second derivative of 2n + xn*3 + 0 + 0n*4 - 1/10n*5 + 3n*2. Differentiate t(a) wrt a. -6a*2 Let t be ((-6)/12)/((-1)/2). Differentiate -12b*4 + 12 + 10b*4 - t with respect to b. -8b*3 What is the third derivative of 9j*2 - 40j*2 - 1 - 52j*4 + 2j*4 - 11j*4 wrt j? -1464j Let q(n) be the second derivative of n*6/5 + 7n*3/6 - 91n*2/2 - 101n. Differentiate q(a) wrt a. 24a3 + 7 Let n(c) = c3 + 5c*2 + 3c. Let o(l) = l*2. Suppose -4z - 83 = -23. Let q(a) = zo(a) + 3n(a). What is the second derivative of q(m) wrt m? 18m Let m(l) be the first derivative of -5l*4/4 + 17l*2/2 + 511l - 566. Differentiate m(g) with respect to g. -15g2 + 17 Suppose 20 = 37o - 32o. Let v(n) be the second derivative of 2n + 0no + 0 + 3/20n*5 + 0n*3 - 2n*2. What is the first derivative of v(a) wrt a? 9a*2 Let y(r) be the third derivative of -5r*4/6 - 151r*3/6 - 439r2. What is the derivative of y(q) wrt q? -20 Let q(v) be the second derivative of -v6/15 - 3v5/10 - 14v*3/3 - 3v*2/2 - 103v. What is the second derivative of q(o) wrt o? -24o2 - 36o Find the third derivative of -103462v5 + 103462v*5 - 67v*2 - 148v*6 wrt v. -17760v*3 Find the first derivative of -117q3 + q2 + q - 3635 - q + 3959 -	{ "pile_set_name": "DM Mathematics" }
64t + 1573391556. 4(t + 19833)2 Suppose -z4/7 + 15z3/7 + 2939z*2/7 - 76479z/7 - 79402/7 = 0. Calculate z. -58, -1, 37 Factor -4p3 - 28327p*2 - 247546p + 63657. -(p + 9)(p + 7073)(4p - 1) Solve -21y*3 - 11943y*2 - 1696200y + 485604 = 0 for y. -287, -282, 2/7 Find u, given that 20u2 - 5349745u + 1337435 = 0. 1/4, 267487 Factor i*2/6 - 4443i/2. i(i - 13329)/6 Find w such that -2w*2/5 + 903544w/5 - 102048969992/5 = 0. 225886 Let -54w4/5 + 1866w*3/5 + 2792w*2/5 + 584w/5 - 288/5 = 0. Calculate w. -1, -2/3, 2/9, 36 What is h in 250h2 + 7508h + 240 = 0? -30, -4/125 Find v, given that -2v2 + 284880v - 10144576800 = 0. 71220 Factor 4y3 - 3056y*2 - 79116y + 170424. 4(y - 789)(y - 2)(y + 27) What is x in 3x*3 - 15708x*2 + 31395x + 47106 = 0? -1, 3, 5234 Suppose 4o4/5 + 2024o*3/5 + 15936o*2/5 = 0. Calculate o. -498, -8, 0 Find d, given that 9d*4/4 + 3225d*3/4 + 3453d*2 + 525d - 2124 = 0. -354, -4, -1, 2/3 Factor 115g3 + 18065g*2 + 19510g + 1560. 5(g + 1)(g + 156)(23g + 2) Suppose -2x5 + 2502x*4 - 9972x*3 - 5012x*2 + 29910x + 22446 = 0. Calculate x. -1, 3, 1247 Suppose 26l4/5 - 3696l*3/5 - 167002l*2/5 + 197016l/5 - 26344/5 = 0. Calculate l. -37, 2/13, 1, 178 Let -2i4/7 + 9650i*3/7 + 193728i*2/7 + 348840i/7 = 0. What is i? -18, -2, 0, 4845 Determine k so that -k*2 - 742k + 1488 = 0. -744, 2 Determine h, given that -55h4/3 + 223h*3/3 + 43h*2/3 - 223h/3 + 4 = 0. -1, 3/55, 1, 4 Factor -12q3 + 4q*2 + 80q + 48. -4(q - 3)(q + 2)(3q + 2) What is i in -2i5/5 - 2472i*4/5 - 768774i*3/5 - 608608i*2 - 2276736i/5 = 0? -616, -3, -1, 0 Factor -3s4 + 60s*3 - 375s*2 + 750s. -3s(s - 10)(s - 5)2 Determine r, given that -2r*2/3 + 124340r/3 - 1932554450/3 = 0. 31085 Determine b, given that -b*4/3 + 71b*3 - 7873b*2/3 + 24265b + 178802/3 = 0. -2, 23, 169 Suppose 3h5 - 81h*4 + 99h*3 + 7905h*2 - 15606h = 0. What is h? -9, 0, 2, 17 Determine h so that -3h3 - 11616h*2 + 3h + 11616 = 0. -3872, -1, 1 Factor 100h2 - 15428h + 19584. 4(h - 153)(25h - 32) Factor 5x*3 + 21830x*2 + 23607645x - 480924900. 5(x - 20)(x + 2193)2 Find s, given that -s2/2 - 2693s + 5387/2 = 0. -5387, 1 Solve 5m*2 - 16980m - 16985 = 0. -1, 3397 Find u, given that 3u4/5 + 3993u*3/5 + 349110u*2 + 47749500u - 1038825000 = 0. -450, 19 Factor -3u2 + 291u - 6726. -3(u - 59)(u - 38) Solve -3u4/7 - 393u*3/7 - 17616u*2/7 - 311040u/7 - 1880064/7 = 0 for u. -51, -48, -16 Factor -d*3/2 + 293d*2 - 6325d/2. -d(d - 575)(d - 11)/2 Determine d so that d*3/7 + 139d*2/7 - 430d/7 - 568/7 = 0. -142, -1, 4 Factor g*2 - 50416g - 50417. (g - 50417)(g + 1) Find d, given that -2d*5/3 + 50d*4/9 + 986d*3/9 + 1214d*2/9 - 1036d/3 + 96 = 0. -8, -3, 1/3, 1, 18 Find l, given that l*3/4 + 140499l*2/4 + 4935062499l/4 + 4934922001/4 = 0. -70249, -1 Factor -867r2/7 - 177480r/7 - 9082800/7. -3(17r + 1740)*2/7 Determine q so that 5q*2/3 - 275840q/3 + 3804385280/3 = 0. 27584 Factor -2g2 + 134780g - 2270706050. -2(g - 33695)2 Factor 5t*3/3 - 520t*2/3 - 1100t/3 + 4240/3. 5(t - 106)(t - 2)(t + 4)/3 Determine c so that c2/5 - 57201c/5 - 171612/5 = 0. -3, 57204 Factor -2d2 - 47678d. -2d(d + 23839) Factor -23q4 + 23806q*3 - 8237424q*2 + 961124992q - 2849530880. -(q - 344)*3(23q - 70) Suppose -3w*2 + 10272w + 20556 = 0. Calculate w. -2, 3426 Factor -5v3 - 75v*2 + 365v - 285. -5(v - 3)(v - 1)(v + 19) Factor -y3/3 + y2 + 92y + 532/3. -(y - 19)(y + 2)(y + 14)/3 Find g, given that -15g3 + 1045g*2 + 27660g - 18900 = 0. -21, 2/3, 90 Factor 4k4 + 11120k*3. 4k*3(k + 2780) Factor 3m2/5 - 423m/5 + 13524/5. 3(m - 92)(m - 49)/5 What is o in 3o3 + 42906o*2 + 153410403o = 0? -7151, 0 Solve 3p2/5 + 1371p/5 + 85026/5 = 0. -383, -74 Suppose -x*2/7 + 46392x/7 - 538054416/7 = 0. What is x? 23196 Solve -2o2 - 122724o - 1882647522 = 0 for o. -30681 Factor -2v3 - 14598v*2 + 14600v. -2v(v - 1)(v + 7300) Factor -2j*2/5 - 2372j/5 - 53050. -2(j + 125)(j + 1061)/5 Factor -2u3 + 54u*2 + 8u - 216. -2(u - 27)(u - 2)(u + 2) Suppose 20p*4 + 49384p*3 + 256256p*2 = 0. What is p? -2464, -26/5, 0 Let -2z*4/5 - 66z*3 - 7056z*2/5 - 40608z/5 = 0. Calculate z. -141, -12, 0 Let 415f2 - 92950f - 2240 = 0. What is f? -2/83, 224 Let 3s5 - 57s*4 - 33s*3 + 3273s*2 + 4134s - 20280 = 0. Calculate s. -5, -4, 2, 13 Factor -2p4 - 333886p*3 + 1001670p*2 - 1001674p + 333892. -2(p - 1)3(p + 166946) Factor 2b3/5 + 1062b*2/5 + 28272b/5 + 52312/5. 2(b + 2)(b + 26)(b + 503)/5 Factor -10r*3/7 + 1244r*2 - 1899210r/7 + 1513800/7. -2(r - 435)2(5r - 4)/7 Find v, given that -4v*5/7 - 6173v*4/7 - 340781v*3 - 2961409v*2/7 + 4164171v/7 + 1188882/7 = 0. -771, -2, -1/4, 1 Determine d so that -3d2/2 - 636d + 22491/2 = 0. -441, 17 Find n, given that -3n5/4 - 595n*4/2 + 5657n*3/2 - 5496n*2 - 24335n/4 + 5075/2 = 0. -406, -1, 1/3, 5 Determine y, given that -30y5/7 - 327y*4/7 + 1524y*3/7 + 2505y*2/7 - 8712y/7 - 540 = 0. -14, -5/2, -2/5, 3 Factor 952v2/3 + 32371v/3 + 34. (v + 34)(952v + 3)/3 Factor 2t4/5 + 1162t*3/5 + 6820t*2. 2t*2(t + 31)(t + 550)/5 Solve 4v*3 - 3272v*2 - 236368v - 4096864 = 0 for v. -34, 886 Solve 5i2 - 4550i - 175195 = 0. -37, 947 Find a, given that -2a3 - 414a*2 - 820a = 0. -205, -2, 0 Solve 3o3 - 46782o*2 + 182893140o - 4001038536 = 0 for o. 22, 7786 Determine y so that y*2 + 217y + 11532 = 0. -124, -93 Solve -140a5 - 8815a*4 + 465a*3 + 9445a*2 - 325a - 630 = 0. -63, -1, -1/4, 2/7, 1 Let w*2 - 1056w + 5255 = 0. Calculate w. 5, 1051 Factor a*2 + 6646a + 6645. (a + 1)(a + 6645) What is a in -2a*5/7 - 908a*4/7 - 7968a*3/7 + 18668a*2/7 - 9790a/7 = 0? -445, -11, 0, 1 Solve 2n4/3 + 43666n*3/3 - 14556n*2 = 0 for n. -21834, 0, 1 Factor 5d*3 + 330d*2 - 39045d - 39370. 5(d - 62)(d + 1)(d + 127) Determine t so that -2t*3/3 + 352t*2/3 - 3480t + 16800 = 0. 6, 30, 140 Let -8z4 - 14764z*3 + 2810004z*2 - 126784772z - 64096732 = 0. Calculate z. -2023, -1/2, 89 Factor 3i4 + 2889i*3 - 106596i*2 + 1289520i - 5178816. 3(i - 12)3(i + 999) Factor i*2/4 - 931i/4 - 4755. (i - 951)(i + 20)/4 Factor -5n*4 + 784260n*3 - 30753187380n*2. -5n*2(n - 78426)*2 Determine h so that 4h*4 + 296h*3 - 4236h*2 - 9344h - 4816 = 0. -86, -1, 14 Solve 3s5 - 294s*4 + 2952s*3 - 7014s*2 - 2955s + 7308 = 0 for s. -1, 1, 4, 7, 87 What is h in -3h3 - 1062h*2 - 1041h + 6354 = 0? -353, -3, 2 Find h, given that h*3 - 549h*2 - 550h = 0. -1, 0, 550 Solve -2v5 + 18464v*4/5 + 66576v*3/5 + 44416v*2/5 - 5920v = 0. -2, 0, 2/5, 1850 Determine y, given that 2y4 - 1028y*3 + 4058y*2 + 11208y + 6120 = 0. -1, 6, 510 Suppose -t*3/7 - 3210t*2/7 - 381375t - 21262500 = 0. Calculate t. -1575, -60 Suppose -g5/5 - g4/5 + 23g3/5 - 39g*2/5 + 18g/5 = 0. What is g? -6, 0, 1, 3 Determine r, given that 2r4 - 1757r*3/3 + 164443r*2/3 - 1657864r - 277836 = 0. -1/6, 78, 137 Let -3k5/4 + 45k*4/2 + 399k*3/4 + 153k*2/2 = 0. Calculate k. -3, -1, 0, 34 Factor -3i*3 - 26691i*2 + 133512i - 160236. -3(i - 3)(i - 2)(i + 8902) Suppose -n5/2 + 59n*4/2 + 39n*3 - 12952n*2 - 144064n - 440832 = 0. What is n? -8, 41, 42 Determine c so that -2c3 + 92c*2 + 802c - 3180 = 0. -10, 3, 53 Find j such that j*3 - 5070j*2 + 55659j - 50590 = 0. 1, 10, 5059 Solve -r*5/5 + 467r*4/5 - 919r*3/5 - 5127r*2/5 + 5544r/5 + 3348 = 0. -2, 3, 465 Factor -5a4 - 51150a*3 - 130764965a*2 + 261683400a - 130867280. -5(a - 1)2(a + 5116)*2 Suppose 21f*3 - 145164f*2 + 580620f/7 - 82944/7 = 0. What is f? 2/7, 6912 Factor -2h2/3 - 10h/3 + 113752/3. -2(h - 236)(h + 241)/3 Let 5f2 + 11605f - 424260 = 0. Calculate f. -2357, 36 Factor 3h3/4 - 87h*2 - 30105h/4 - 14877/2. 3(h - 174)(h + 1)(h + 57)/4 Factor -2g*3 - 1046g*2 + 83088g - 1542240. -2(g - 36)2(g + 595) Solve -v*2/3 + 157v/3 + 106 = 0. -2, 159 Suppose 4y*4	{ "pile_set_name": "DM Mathematics" }
+ 0n. Let b(m) = -2m*2. Calculate b(w(k)). -8k*2 Let d(m) = -34m - 3. Let r(y) = 1665y + 148. Let i(z) = -148d(z) - 3r(z). Let k(j) = -j2. Calculate k(i(f)). -1369f2 Let j(b) be the third derivative of -b4/6 - b*2. Let k be (-9)/4(-8)/3. Let m(s) = s + 3 + 3 - k. Give m(j(q)). -4q Let l(i) = -5i*2. Let f(n) = -n. Give f(l(t)). 5t*2 Let i(z) = 15z. Let h(t) be the second derivative of -t*3/2 + 8t - 1. What is i(h(a))? -45a Let p(s) = -2s*2. Let n(m) = 488m*2 - 2m. Calculate n(p(v)). 1952v4 + 4v*2 Let t(s) = -s. Let i(r) be the second derivative of -7r*4/12 + 3r. Calculate i(t(j)). -7j2 Let f(c) = -19c. Let d(p) = 42 - p*2 - 42. Give d(f(a)). -361a*2 Let q(o) = 5o*2 + 111o. Let t(j) = j. Calculate q(t(b)). 5b2 + 111b Let y(m) = -3m. Let o(l) = -2l - 202. Give y(o(h)). 6h + 606 Let t(c) = -74c*2. Let f(i) = -6i. Calculate f(t(q)). 444q2 Let k(t) = -t2 - 9t. Let z(y) = -2y. Let d(i) = 2k(i) - 9z(i). Let j(c) = 15c*2. Give d(j(m)). -450m4 Let w(o) = -o2. Let p(h) = h2. Let n(t) = -5 + 1 + 4 - t2. Let m be 23/5 - 2/(-5). Let v(f) = mn(f) + 4p(f). Give v(w(g)). -g*4 Let w(t) = -530t. Let l(n) = n. Calculate w(l(s)). -530s Let x(l) = 2l2. Let n(r) be the second derivative of -r5/120 - r*3/3 + 2r. Let c(z) be the second derivative of n(z). What is c(x(s))? -2s2 Let a(m) be the second derivative of 0m*2 + 0 - m - 1/3m*3. Let k(f) = -4f*2 + 6f*2 - 3f*2. Calculate a(k(w)). 2w*2 Let z(q) = 6475q. Let d(y) = -y. Determine d(z(w)). -6475w Let j(v) = -3v*2. Let h(s) be the second derivative of 5s*4/12 + 3s. Determine h(j(i)). 45i4 Suppose -k + 3k - 4 = 0. Let z(x) = -4xk + 5x2 + x2. Let f(d) = d*2. Calculate z(f(h)). 2h4 Let z(i) = -i2. Let d(n) = 31n - 198. Give z(d(f)). -961f*2 + 12276f - 39204 Let p(c) = -c. Let d(w) = -13w + 9. Let v(k) = 3k - 2. Let u(o) = -2d(o) - 9v(o). Calculate p(u(m)). m Let p(w) be the second derivative of -w*3/3 - w. Let u(c) = -1. Let s(m) = -2m - 5. Let i(g) = 2s(g) - 10u(g). Calculate i(p(n)). 8n Let a(p) = -5p. Let x(z) be the second derivative of -z*3/2 + 23z + 2. Determine a(x(f)). 15f Let y(x) be the second derivative of 0x*3 - 3x + 0x2 + 1/12x*4 + 0. Let r(p) be the first derivative of 5p*3/3 - 1. Calculate r(y(j)). 5j4 Let t be 0/((-1)/(-1) - 0). Let z(r) = r2 + tr2 - 3r2. Let c(a) = a2. Determine z(c(o)). -2o4 Let a(g) = 2g. Let j(o) be the first derivative of -121o2/2 + 36. Calculate j(a(b)). -242b Let z(l) = 3l - 9. Let s(r) be the first derivative of r2/2 - 2r - 4. Let i(k) = 9s(k) - 2z(k). Let d(a) = -a*2. Give d(i(f)). -9f*2 Let f(v) be the third derivative of -13v*5/60 + 3v2. Let x(h) = h2. What is f(x(a))? -13a4 Let m(w) = w2. Let f(u) be the first derivative of -2u*2 + 12. What is m(f(n))? 16n2 Let f(y) be the third derivative of -y5/30 - 21y2. Let m(h) = -3h + 3. Calculate f(m(z)). -18z2 + 36z - 18 Let q(u) = 5u. Let z(p) be the third derivative of -p6/720 + p4/6 - 4p*2. Let b(w) be the second derivative of z(w). What is q(b(n))? -5n Let m(c) = -5c2. Let i(w) = 2w + 0w - 4w - w. Determine i(m(r)). 15r2 Let s(p) = -2 - 4p + 9p + 2. Let c(g) = -g. Determine s(c(m)). -5m Let l(s) = -s + 33. Let r(w) = -w2. Determine r(l(h)). -h2 + 66h - 1089 Let o(s) = 18s. Let k(w) be the second derivative of w*3/6 + 11w. What is k(o(x))? 18x Let q(m) be the third derivative of m4/24 + 3m*2. Let w(h) = 13h*2. Calculate w(q(i)). 13i*2 Let p(s) = 2s*2. Let r(c) = 174c. Determine p(r(x)). 60552x2 Let w(z) = 2z*2 + 2z. Let h(p) = -2p2 - 3p. Let d(f) = -2h(f) - 3w(f). Let t(b) be the first derivative of 0b - 1/2b*2 + 1. What is d(t(a))? -2a*2 Let u(z) = -3902z*2. Let n(o) = -o. Give n(u(r)). 3902r*2 Let l(j) = 4j + 2. Let m(z) = 9z + 5. Let i(w) = 5l(w) - 2m(w). Let p(o) = -11o + 3. Determine p(i(r)). -22r + 3 Let o(w) = -14w. Let i(y) = 2y. Let d(s) = s. Let j(n) = -5d(n) + 2i(n). What is j(o(m))? 14m Let i(c) = 4c - 4. Let q(j) = -15j*2. What is i(q(d))? -60d*2 - 4 Let g be (-104)/(-14) - (-36)/63. Let x(t) = 15 - g + t - 7. Let f(h) = 4h*2 - 3 + 3. Give f(x(r)). 4r2 Let y(i) be the first derivative of -i3/3 + 7. Let r(k) = k. Calculate r(y(j)). -j*2 Let x(a) = a. Let s(i) = i + 5. Let c be s(0). Let t(o) = 2o + 5. Let m(d) = -d - 3. Let n(w) = cm(w) + 3t(w). Determine x(n(y)). y Let n(w) = 2w. Let f(g) = -35451g. Determine f(n(u)). -70902u Let i(y) = 7 - y2 + 2y2 - 7. Let u(p) = -p2. Give i(u(s)). s*4 Let l(d) = 15d*2 - 11 + 11. Let v(s) = 2s. Give v(l(i)). 30i2 Let w be (4 - 1)4/(-6). Let z be 31w/(-6). Let x(o) = -1 + z - 3o. Let c(b) = -b2. Determine x(c(y)). 3y*2 Let d(v) = -v. Let f be (-1 - -1 - 0) + 4. Suppose 2n - 38 = -5j, -2j + 5j = 2n + 10. Let z(w) = jw - fw - w. Calculate z(d(b)). -b Let w(l) = -l*2. Let g(c) = 13213c. Calculate w(g(s)). -174583369s2 Let u(p) = -2p*2. Let a(m) = -5141m. What is a(u(r))? 10282r2 Suppose 0 = -i - i + 8. Let h(c) be the second derivative of 0 + c + 0c*2 + 1/12c*i + 0c*3. Let f(g) = -2g. What is h(f(n))? 4n2 Let s(q) = -q. Let d(b) = -b3 + b + 1. Let k be d(-1). Suppose -6 + k = -5z. Let u(m) = -1 + 0m2 - m2 + z. Determine u(s(y)). -y2 Let i(m) = 8m + 3m - 11m - 3m2. Let w(y) = 3y*2. Determine i(w(j)). -27j*4 Let d(s) = -2s*2. Let h(t) = 70t. Let f(w) = -10w. Let n(z) = 20f(z) + 3h(z). Give d(n(p)). -200p2 Let g(w) = w2. Let u(k) be the second derivative of k*4/4 + 9k. Determine g(u(f)). 9f4 Let d(g) = 3g*2 + g - g. Let x(c) = -11c*2 + 18c + 18. Let l(q) = -5q2 + 8q + 8. Let a(m) = -9l(m) + 4x(m). Give d(a(b)). 3b4 Let n(t) = -t. Let x(f) = 212f. Give x(n(u)). -212u Let t(f) = 6f + 3. Let j(y) = 14y. Determine t(j(g)). 84g + 3 Let f(p) be the second derivative of p6/90 + p3/6 - p. Let x(r) be the second derivative of f(r). Let m(i) = 14i + 22i + 20i - 55i. Calculate m(x(j)). 4j2 Let h(i) = -29i + 335. Let l(q) = -2q2. What is l(h(w))? -1682w*2 + 38860w - 224450 Let i(o) = -2o + 10o*2 + 2o. Let v(t) be the first derivative of -t*2 - 42. What is v(i(l))? -20l*2 Let w be (-78)/(-21) + 2/7. Let x(u) = -2u - 4. Let q(a) = 3a + 5. Let d(n) = wq(n) + 5x(n). Let p(o) = o2. Determine d(p(s)). 2s2 Let v(k) = -4 + 5 - 1 - k2. Let r(h) = -7h2. Give r(v(i)). -7i4 Let t(r) be the second derivative of -r3/3 + 2r. Let x(v) be the first derivative of v2 - 5. Determine x(t(i)). -4i Let s = 3 + -2. Let n(f) = s - 1 + f. Let y(j) be the first derivative of -j*2 + 22. Determine n(y(d)). -2d Let r = 3621/20 + -181. Let n(g) be the third derivative of 0g4 + g2 + 0g*3 + 0g + 0 + rg5. Let a(l) = 2l. Determine a(n(m)). 6m2 Let s(o) = 2o2. Let m(j) be the first derivative of -j6/180 - 2j3/3 - 4. Let x(i) be the third derivative of m(i). Calculate x(s(r)). -8r4 Let k(l) be the second derivative of l4/12 + 2l. Let y(w) = -2126 + 2126 + 4w. Calculate y(k(t)). 4t2 Let i(j) = 3j2. Let k(d) = d2 + 2d. Let a(p) = 7p + 6. Let u(s) = s + 1. Let r(g) = a(g) - 6u(g). Let b(v) = -k(v) + 2r(v). Give i(b(y)). 3y4 Let c(j) = 8j*2 - 2j + 1. Let h(t) = 2t - 1. Let r(n) = -c(n) - h(n). Let v(p) = -p. Give r(v(s)). -8s*2 Let f(v) = -1. Let s(c) = 8c + 9. Let i(g) = -18f(g) - 2s(g). Let x(k) = k*2. What is x(i(a))? 256a*2 Let t(v) = v - 6v + 7v. Let w(j) = 4j. Calculate t(w(u)). 8u Let k(w) = -17w. Let l(i) = 7i2 - 9. Give l(k(b)). 2023b2 - 9 Let i(z) be the second derivative of z2/2 - 4z. Let f(g) = 2g + 6. Let s(q) = f(q) - 6i(q). Let w(c) = 8c. Determine s(w(m)). 16m Let v(i) = 2i*2. Let g(q) = -4006q. Calculate g(v(j)). -8012j2 Let c(f) be the third derivative of -f5/60 + 12f*2. Let a(j) = -3j. What is a(c(n))? 3n2 Let r(f) = 4f*2 + 5f*2 - 3f*2 - 4f*2. Let a = 1 - 1. Let w(v) = a + 0 + 5v*2. Determine r(w(h)). 50h*4 Suppose 0 = -c - c + 4. Let a(i) = -2i2 + ic - 24 + 24. Let l(z) = 2z. What is a(l(o))? -4o2 Let b(d) be the second derivative of d3/3 + d. Let t(m) =	{ "pile_set_name": "DM Mathematics" }
+ 5 - 3m. Let a(c) = -4c3 + c2 - 2c + 6. Let l(z) = -5a(z) + 3b(z). What is l(-2)? 1 Suppose 0 = -c - 5o - 48, -3c + 2o = 272 - 43. Let m = c - -69. Let g(d) = -d + 6. What is g(m)? 10 Let c(i) = 9i2 - 5i + 1. Let t = -10457 + 10461. What is c(t)? 125 Let i(k) = 3k2 - 6k + 3. Suppose 4 = 2m - h + 3h, 3h = m - 18. Let c(t) = -4t*2 + 7t - 3. Let r(n) = mc(n) + 7i(n). Determine r(-3). -24 Let x(h) = 13h3 + 5. Let f(n) = -n3 + 10n*2 + 169n - 16. Let t be f(-9). Calculate x(t). 109 Let o(n) = n + 1. Let w(h) = -2h + 4. Let t(l) = -6l + 8. Let c(z) = -4t(z) + 9w(z). Let b(s) = c(s) - 3o(s). Determine b(1). 4 Let w(s) = -2s - 48. Let x = 1596 + -1617. Calculate w(x). -6 Let y(u) = 13. Let k(c) = -22. Let s(f) = 3k(f) + 5y(f). Let n(t) = 7t - 42t*2 - 5 + 7 + 11 + 43t*2. Let a(z) = n(z) + 6s(z). Calculate a(-6). 1 Let d(z) = -243z - 734. Let g be d(-3). Let c(l) = 19l + 95. Calculate c(g). 0 Let k(x) = 64 - 40 + 36337x3 - 4x - 36336x3 + 19x*2. Give k(-19). 100 Let m be (1 + 1)(-3)/(-1 + -2). Let z(r) = 37 - r + 6rm - 80 + 44. Give z(1). 6 Let k(m) be the first derivative of m6/360 - m5/40 - m4/24 + 4m3/3 - m2 + 93. Let b(s) be the third derivative of k(s). Give b(5). 9 Let w(m) = -2m3 + 3m*2 + 5m - 3. Let a(k) = -2k3 + 3k*2 + 3k - 2. Let b(j) = -3a(j) + 2w(j). Suppose -x + 2 = -0x. Give b(x). 6 Let l(o) = 11o - 87. Let k = 9216 + -9207. What is l(k)? 12 Let h = 10964 - 10947. Let c(v) = v*3 - 16v*2 - 18v + 19. Calculate c(h). 2 Suppose 3z = 2m + 6z - 12, -3m + 4z + 1 = 0. Let u(s) = -ms*2 + 13 - 51 + 17 + 19 - 4s - s*3. Calculate u(-3). 10 Let y(k) = -63k - 1. Let p(s) = -242s - 2. Let x(b) = p(b) - 4y(b). Calculate x(1). 12 Suppose -48 = 5c - 2q - 36, -6 = -4c - q. Let u(f) = -10f*2 + 4f + 3. Let a(h) = 7h2 - 3h - 2. Let k(d) = -7a(d) - 5u(d). What is k(c)? -1 Let y(q) = -5q + 2. Let g(f) = -3f + 52. Let p be g(-12). Let d = -93 + p. Give y(d). 27 Let k(g) = g - 269 + 86 + 83 + 85 + g. Let z(a) be the third derivative of a*4/24 - 7a*3/6 + 5a*2. Let p(i) = -3k(i) + 7z(i). What is p(6)? 2 Let t(h) = -h3 + 12h*2 + 7h - 67. Let j be 170/14 + 725/(-5075). Determine t(j). 17 Let z(m) = 43m - 2. Let h(n) = -193n + 6. Let c(x) = -2h(x) - 9z(x). Determine c(-8). 14 Let z(m) = 2m2 - 3m + 7. Let c(v) = v*2 - 2v + 8. Let h(t) = 5c(t) - 3z(t). Give h(11). -113 Let v(o) be the third derivative of 1/12o4 + 9 - 5o*2 + 0o - 4/3o3. Give v(-9). -26 Let w be (-74)/(-185) + (-253)/(-55). Let l(o) be the second derivative of 0 + 1/2o*2 - 11o - 1/3o4 + 1/6o*3 + 1/20o*w. Calculate l(4). 5 Let g(b) = 4b - 167. Let h(c) = -3c + 168. Let m(s) = -7g(s) - 6h(s). Calculate m(17). -9 Let m(r) = -2r. Let o = 59 + -55. Suppose u - 2x + 1 = 0, -3u - 5 = -x - ox. Determine m(u). 10 Let z(b) = -3b - 48. Suppose 0 = -3y - 2i - 20, -4y + 2i = 3i + 35. Determine z(y). -18 Let t(v) = -3v + 33. Suppose 6 + 46 = 10h - 48. What is t(h)? 3 Let o be ((-20)/12)/(1/(-3)). Let y(k) = -k3 + 1 - k - k2 + 0k - o. Let r be (-1)/32 + (-691)/(-22112). Calculate y(r). -4 Let q(p) = -15p3 + 23p*2 - 23p - 21. Let u(z) = 7z3 - 11z*2 + 10z + 10. Let o(s) = -6q(s) - 13u(s). Give o(7). -46 Let y(g) be the first derivative of -g*4/4 + 20g3/3 - g2 + 28g - 1488. What is y(20)? -12 Suppose 91u + 699 = -1212. Let w(n) = n*2 + 18n - 52. Give w(u). 11 Let u(h) = -14 - 12h - 17h + 14h + 17h. Calculate u(5). -4 Let y(q) = -20 + 2 + 65q2 - 29q*2 - 5 - 35q*2 + 5q. Determine y(-11). 43 Let o(u) = -3546u - 3542u - 3544u - 3542u + u*2 + 14178u - 1. Let l be (2 - 22/8)4. Determine o(l). -4 Let r(f) = -2f*2 - 44f - 382. Let v(n) = -n*2 - 7n - 4. Let l(p) = -r(p) + 3v(p). Determine l(34). -4 Suppose 4b + 477 = 177. Let h = 173 - 102. Let p = h + b. Let a(r) = r*2 - r - 4. Calculate a(p). 16 Suppose -671 = 97y + 8. Let m(j) = j*3 + 6j*2 - 10j - 25. What is m(y)? -4 Let a(q) = 19 + 17 + 15q - 22q - 10 + 8q. Suppose -5s = -4d - 0s + 20, -20 = -d + 5s. Calculate a(d). 26 Let r = -115 - -125. Suppose -263x + 265x + r = 0. Let k(u) = -4u + 5u + u2 + 6u + u2 + 5. Give k(x). 20 Let r(j) = -j3 - 7j2 + 2j + 8. Let x(p) = -p*3 - 8p*2 - p - 15. Suppose 174v - 172v + 16 = 0. Let q be x(v). Calculate r(q). -6 Let s(y) be the second derivative of -y4/12 + 4y*3/3 - 3y*2 - 7y - 3. Let o(w) = -w*2 + 30w - 72. Let k be o(27). Calculate s(k). -15 Let j be -2(-10 + 3 + 12). Let i(h) = -h2 + 2h. Let r(x) = -15x2 + 20x. Let p(a) = ji(a) + r(a). Give p(2). -20 Let l(d) = 2d*2 - 145d + 343. Let o be l(70). Let p(v) = -v - 3v + 9 + v. Let g(a) = 2a - 5. Let q(b) = og(b) - 4p(b). Give q(2). -5 Let g(c) be the third derivative of 5c4/24 - 13c*3/3 + 2c*2 - 184. Let z(v) = 3v - 27. Let r be z(11). Determine g(r). 4 Let i(c) = c - 40. Let g(j) = -15j + 636. Let o(s) = -g(s) - 16i(s). Suppose -5y = -12 - 13. Give o(y). -1 Let i = 203 - 192. Suppose y + 2g = 7, 2y = -6g + 7g - i. Let x(c) = 5c - 2. Determine x(y). -17 Let n(t) = -2t2 + 8t*2 + 2t + 3t + 2t*2 - 7t*2 - 3t. Let x be 4/36/(-4). Determine n(x). 0 Suppose 10p - 31p - 3549 = 0. Let l = 165 + p. Let v(u) = u + 4. Let t(h) = 3h + 13. Let k(f) = 2t(f) - 7v(f). Determine k(l). 2 Let p(x) = -3x - 10. Let h be p(-4). Suppose -5c - hn = 33, 17 = -3c + c + 3n. Let v(b) = -b - 16. Give v(c). -9 Let j = 276 + -196. Let i = j + -117. Let d = -36 - i. Let y(p) = -p2 - 1. Determine y(d). -2 Let r = -7024 - -7042. Let g(b) = -3b + 43. Calculate g(r). -11 Let h(r) = -6r - 1. Let w(b) be the second derivative of 1/12b*4 - 39/2b*2 + 1/2b*3 + 37b + 0. Let o be w(-8). Give h(o). -7 Let k(r) = -252r - 2516. Let s be k(-10). Let v(y) be the third derivative of 7/24y*s + 0 + 0y + 5/6y3 + 1/120y*6 + 2/15y*5 + 17y2. Give v(-7). 5 Let t(v) = v3 - 6v + 1. Let d(h) = -h + 1. Let w(u) = 6d(u) - t(u). Suppose -158 + 158 = -25l. Determine w(l). 5 Let c be ((-1 + 1)/(-4))/(2 - 3). Let d(l) = 4l*3 + 3l*2 - 7l - 36. Let f(b) = 5b3 + 4b*2 - 9b - 55. Let x(y) = -4d(y) + 3f(y). Determine x(c). -21 Let w be ((-20)/(-8) + -3)-6. Suppose -5n = -i + 24, 9 = i + wn + 1. Let p(j) = 8 + j - 4 - 4 + ij*2. Give p(-1). 13 Let h be 3(13 + 352/(-24)). Let n(b) be the second derivative of b*3/6 + 11b*2/2 - 4b. What is n(h)? 6 Let g(i) = i*2 + 5i + 9. Let v be (6/(-8))/((-6)/336-7). Give g(v). 15 Let t(o) = o2 - 29o. Let n be t(29). Let l be n + (-2)/8 + (-33)/12. Let c(k) = -12k - 2. Give c(l). 34 Let x = -17786 + 17785. Let z(w) = -6w*2 + 5w + 5. Calculate z(x). -6 Let o be (-82)/(-16) - (9 - (-497)/(-56)). Let m(q) = 3q - 6. Give m(o). 9 Suppose 42 - 186 = 36p. Let r(z) = -2z2 - 6z - 16. What is r(p)? -24 Let h = 16773 - 16784. Let i(a) = -2a2 - 15a - 26. Determine i(h). -103 Let u(b) = 6b + 60. Let k = -3478 - -3470. Calculate u(k). 12 Let g(l) = -l - 5. Suppose 35 = 342s - 335s. Suppose 0n + 5y = 5n + 30, -sy = -3n - 8. What is g(n)? 6 Let j be 12 - 11 - (2 - (-2 + 9)). Let d(w) = -jw2 + 512w*3 - 1 - 1022w*3 + 509w*3 - 7w. Give d(-5). 9 Let o(d) = 94d + 4900. Let v be o(-52). Let t(f) = f + 20. What is t(v)? 32 Let l(v) be the second derivative of v4/12 - v3/3 - 3v*2/2 + v. Suppose -3s = -20 + 62. Let t be (20/(-5))/(-4) + 42/s. Give l(t). 5 Let b(i) = -24i3 + 11i*2 + 4i + 58. Let k(v) = -17v3 + 7v*2 + 3v + 40. Let z(t) = -5b(t) + 7k(t). Determine z(5). -30 Let d(o) be the second derivative of 0 - 1/12o4 - 1/3o3 - o2 + 72o. What is d(-5)? -17 Suppose 0 = -32a + 27a + j + 6, 5a - 14 = -j. Let i(p) = 5p3 + 2 - 8p + 20p + 6p*a - 10p - 6p3. Determine i(6). 14 Let n(m) = -m2 + 4m + 13. Let o be n(6). Let z(c) be the first derivative of -5c2 + 815. Give z(o). -10 Let k(q) = -8q*3 - 2q*2 + 2q - 1. Let b be 0-32/6. Let r be 9/((-72)/(-16)) + 0 + b. Suppose -3a + 2a = -2l + 2, 2 = rl + 5a. Calculate k(l). -9 Let v(x) = x3 + 17x*2 + 17x + 19. Let h be v(-16). Let a be 4/(-12)3-1. Let t = a + h. Let y(r) = -r*2 + 4r - 1. Determine y(t). -1 Let w(p) = -1033 + 2042	{ "pile_set_name": "DM Mathematics" }
et s be ((-7)/210)/((-1)/4). Sort s, -7, x. -7, s, x Let o be (36/(-24))/(2/(-4)). Suppose f = -3j - 2, j + 4f = -j + 2. Put j, o, 2 in decreasing order. o, 2, j Let n = -15 - -7. Let q = -12 - n. Sort q, -1, -5. -5, q, -1 Suppose -2t + 5 - 9 = 0. Suppose 3h = s + 1, h - 2s + 7 = 2s. Let q be (-3)/(-6)2/(-1). Sort t, q, h in ascending order. t, q, h Let i be 2/(-7) + 936/140. Let h = 234/35 - i. Sort -5, 0.4, h in decreasing order. 0.4, h, -5 Let p = -71 + 64.8. Let f = 6 + p. Put 0.5, f, 5 in increasing order. f, 0.5, 5 Let w = -2 + 2.5. Sort -1/6, w, -4 in descending order. w, -1/6, -4 Let g be (-1 - 0) + (-30)/6. Let z(x) = x + 10. Let h be z(g). Sort -1, 3, h in ascending order. -1, 3, h Let z = -8.5 + 3.5. Sort -2/55, z, 1/4. z, -2/55, 1/4 Let n(c) = -11c + 28. Let d be n(3). Let q(y) = -y + 3. Let x be q(6). Put 2, x, d in ascending order. d, x, 2 Let g(b) = -b*2 - 7b + 8. Let w be g(-6). Let h = -18 + w. Put 0, h, -3 in increasing order. h, -3, 0 Suppose -2z + 2 = -2. Let k be 1 - (2 + -3)z. Suppose 0 = -3o - 4d - 27, -4d - 3 - 9 = 0. Sort 2, o, k in decreasing order. k, 2, o Let o = 118/3 + -39. Let r = 2.9 - 0.1. Let b = r - 7.8. Put o, b, -2 in increasing order. b, -2, o Suppose 0 = -k + 4k - 12. Suppose -4y + 20 = -2s, y + s + 1 + 0 = 0. Sort y, k, 1. 1, y, k Let v = -127.3 + 116. Let b = 11 + v. Sort b, -3/4, -3 in ascending order. -3, -3/4, b Let x = 0.1 + -0.3. Let s = 60 + -57. Put 1, s, x in decreasing order. s, 1, x Let k = 110 - 112. Put -17/4, -0.4, k in decreasing order. -0.4, k, -17/4 Let p be (-4)/30(5 - 0). Suppose 20 = -v - 2. Let l be -2(1 - (-20)/v). Sort -1, p, l in decreasing order. l, p, -1 Suppose 16 = -4p - 24. Sort -2, p, 0, -5 in ascending order. p, -5, -2, 0 Let f = 125 + -124.7. Let x = 3 - 5. Sort x, f, 5/2 in increasing order. x, f, 5/2 Let x(d) = -3d + 2. Suppose 3b + 6 = b. Let w be x(b). Let l = w + -7. Sort -3, 2, l. -3, 2, l Suppose 0 = w + 4v - v + 8, 0 = 3v + 3. Let k(n) = n + 6. Let q be k(w). Sort -2, 3/7, q in increasing order. -2, 3/7, q Suppose -6u = -2u + 8. Let f be 3/((-3)/(-2)) - 0. Let p be f + u/(-11)-10. Put 1, p, 3 in decreasing order. 3, 1, p Let j = 11 + -10.93. Let t = -0.07 + j. Put -1/5, -0.3, t in increasing order. -0.3, -1/5, t Let z = -17 + 16.5. Put z, 4, 0 in decreasing order. 4, 0, z Let h be (-15)/(-10)4 - (0 + 1). Sort 0, h, 13. 0, h, 13 Suppose -2p - 3t - 1 = 4, 4p - 3t + 19 = 0. Let g = -8.9 + 11. Let i = g - 0.1. Put -2/9, i, p in descending order. i, -2/9, p Let h = -223/13 + 17. Put -2/7, h, -0.1 in decreasing order. -0.1, h, -2/7 Suppose 2x = -4, -k + 2x - 2 = -6. Let h be (-2)/(-8) - 60/(-16). Suppose -4n + 9 + 3 = 0. Put h, k, n in decreasing order. h, n, k Suppose -2u - 4y = 14, -y - 2 = 3. Suppose ux - x = -8. Put 0, -3, x in increasing order. x, -3, 0 Let c(r) = r3 - 4r*2 + 2r + 2. Let v be c(3). Suppose -11h + 10h = 3. Sort 1, h, v in ascending order. h, v, 1 Let a(y) = 5y - 30. Let z be a(6). Put z, -3, -1, 5 in descending order. 5, z, -1, -3 Let x = -3 + 9. Let l be (x/15)/(28/10). Sort l, 1/2, 2. l, 1/2, 2 Let d be 34/4891. Let f = d - 57/8. Sort f, 3, 1. f, 1, 3 Let m(d) = d3 - 2d - 1. Let l(a) = a3 - a2 + a + 2. Let r be l(0). Let c be m(r). Sort -5, 5, c in increasing order. -5, c, 5 Let l = -3 - -2. Let z = -1 - 3. Let t be (-6)/(-15) + (-34)/10. Put l, t, z in ascending order. z, t, l Let h = -0.045 + -0.065. Sort 0, h, -2 in descending order. 0, h, -2 Let q = 0.12 - 5.12. Let g = 3 + q. Put -0.2, g, 2/9 in ascending order. g, -0.2, 2/9 Suppose -10 = 7p - 38. Sort p, 1, -32. -32, 1, p Let h(u) = u2 - 1. Let s be h(0). Let z = s + 5. Let i = 2 - z. Put i, 1, 5 in decreasing order. 5, 1, i Let t(r) = r3 + 3r*2 + 2. Let s be t(-3). Let g = -19 + 7. Let w = 17 + g. Put 0, s, w in descending order. w, s, 0 Let b = 24 + -23. Suppose b + 4 = -5v - 3q, -2q + 18 = -2v. Put 0, v, 1 in descending order. 1, 0, v Suppose 44 = 4j - 4i, 3j - 5j + 3i = -22. Suppose jf = 10f. Sort f, 4, -2. -2, f, 4 Suppose -26 = 3v - 5x, 2v - 3x - 12 = -7x. Let u be ((-1)/v)/(15/(-4)). Let d(r) = -14r*2 + 41r + 6. Let n be d(3). Sort u, 1/7, n in increasing order. u, 1/7, n Let j = -0.15 + -2.85. Put -5, j, 2/9 in increasing order. -5, j, 2/9 Let n(g) be the second derivative of -g*4/12 + 4g*3/3 - 7g*2/2 + g. Suppose 4k - 30 = -k. Let a be n(k). Sort -3, 4, a in descending order. a, 4, -3 Suppose -o + 0h - h - 5 = 0, 4h = -16. Let m = 7 - o. Let x be 0/(-10) - (-6)/m. Sort x, 3, -3. -3, x, 3 Let w = -0.04 + -1.96. Let f(g) = -g*3 - 5g*2 + 6g + 9. Let m be f(-6). Suppose -4l - m = -l. Sort l, w, 1/3 in decreasing order. 1/3, w, l Let l(m) = -7m + 85. Let n be l(13). Sort n, 1, -2, 4 in descending order. 4, 1, -2, n Suppose -4x + x = -6. Suppose xt = t + 4. Sort -9, -2, t in descending order. t, -2, -9 Let j be 6/2 - (0 + -1). Suppose 1 = 5i + 2v + 12, -3i - jv - 1 = 0. Let s(d) = d*3 - 8d*2 + 6d + 10. Let y be s(7). Put y, 1, i in ascending order. i, 1, y Suppose -t + 48 = 3t. Let z = -25/2 + t. Put -2/11, z, -3 in ascending order. -3, z, -2/11 Let c(f) = -f2 - 7f. Let o(m) = m*2 + 6m - 2. Let a be o(-5). Let y be c(a). Put 2, y, -3 in decreasing order. 2, y, -3 Let y = -81 + 86. Put -16, 0.1, y in decreasing order. y, 0.1, -16 Let h = 0.56 + -0.7. Let t = h + -0.76. Let x = t + -4.1. Put x, 0, -2 in decreasing order. 0, -2, x Suppose 0 = -3y - 2y + 10. Sort y, -1, -5 in descending order. y, -1, -5 Suppose 3y = -2y + 30. Let m = -4 - -6. Suppose -2p + y - m = 0. Put p, 4, -5 in descending order. 4, p, -5 Let n be 0/(-1 - (-1)/(-1)). Let r be -9 + (-1)/((-2)/(-4)). Let a = 7 + r. Sort a, n, 5 in descending order. 5, n, a Let p = -2/133 - -40/133. Let z = -6.1 + 6. Sort z, p, 1 in ascending order. z, p, 1 Let l = -5 - -6. Let p = l + -0.7. Put 5, -2, p in decreasing order. 5, p, -2 Suppose -v = 2k + 13, -2v = k + k + 18. Suppose 7 = 2w + x, 5w + 0 - 28 = x. Suppose 0 = 5q + 2q - 14. Sort v, w, q in ascending order. v, q, w Suppose 4o - 9 = 4i + 3, -i - 15 = -5o. Sort 1, 6, i, 4 in decreasing order. 6, 4, 1, i Let c = 86.8 + -87. Sort -3, -4, c. -4, -3, c Suppose r + 1 = s, 0 = s + 4s - 15. Suppose -2a + 27 = 5q, 3q - q = 4a + 6. Sort r, a, -5. -5, a, r Let s = 108.8 - 119. Let x = 10 + s. Sort -3, x, -2/7 in ascending order. -3, -2/7, x Suppose -9 = 5n + 6. Suppose -7o + 2o + 14 = -m, o = -4m + 7. Sort n, m, -6 in descending order. m, n, -6 Let b = 0.01 - 4.01. Let w = -4.198 - 0.002. Let r = w - b. Put -2/11, 3, r in increasing order. r, -2/11, 3 Let y = -4 + 4. Let o be -5 - (2 + -3) - -2. Sort o, -4, y. -4, o, y Let c(h) = -h3 + h2 + h - 1. Let r(f) = -f3 + 7f*2 + 7f - 4. Let w(x) = 5c(x) - r(x). Let n be w(-1). Put 0, 4, n in ascending order. 0, n, 4 Let b = 0.4 - 0.6. Let d = -0.3 - b. Sort -2/5, 3/7, d in increasing order. -2/5, d, 3/7 Let h be 4/(-12)14. Sort 6, h, -3/8. h, -3/8, 6 Let v = 6 - 1. Suppose o = -0o + v. Suppose 0 = -0y + 5y + 5l - 20, -4y + ol - 11 = 0. Sort 0, y, -5 in decreasing order. y, 0, -5 Let y be 3/(-2)48/18. Put 2, -10, y in ascending order. -10, y, 2 Let n(a) = a + 18 - 6a + 6a + 0a. Let f be n(-14). Put -0.1, 2/3, f in descending order. f, 2/3, -0.1 Suppose -2y = 3y + 20. Let b = y - 0. Sort b, 1, 4. b, 1, 4 Let n(y) = y3 - 6y*2 + 6y - 6. Let h be n(5). Let u(p) = 5p2 + 2p + 1. Let x be u(h). Suppose xi - 6 = 2. Sort 5, 1, i in ascending order. 1, i, 5 Let l = -1 + -1. Let d = 39/95 + -4/19. Let y = 4.58 - -0.42. Sort l, y, d. l, d, y Let a = -5.3 - -4.3. Let b be -1(3 + 0 + -1). Put b, 1, a in decreasing order. 1, a, b Let o be 2 + 18/(-10) + 0. Let c = 2 - 3. Let m = 10 - 7. Put o, m, c in ascending order. c, o, m Let n be ((-48)/5)/(-4)-5. Let c = -9 - n. Let k = -4 + 3. Sort -2, k, c in descending order. c, k, -2 Let p = -0.216 + -2.784. Sort 1, -0.3, -1, p in increasing order. p, -1, -0.3, 1 Let r = -14 + 21. Let s = r + -6.8. Sort -1, s, -4 in descending order. s, -1, -4 Suppose 2s - 12 = -h - 4h, 5h - 20 = 0. Let i(a) = -a - 8. Let b be i(-6). Sort s, 1, b in increasing order. s, b, 1 Let m be 6/(-13)*(-3)/(-9). Sort m, -2/7, -3/5 in increasing order. -3/5, -2/7, m Let b = -8	{ "pile_set_name": "DM Mathematics" }
3 Differentiate 37k3 + 146641k*2 + 21725755 wrt k. 111k*2 + 293282k What is the derivative of -1269125v2 + 265v - 444017352? -2538250v + 265 Find the first derivative of 49405401s - 63807102. 49405401 What is the second derivative of 272150201m2 + 211460563m wrt m? 544300402 What is the third derivative of 70g4i + 669174g3i + 122g2i - i + 19402 wrt g? 1680gi + 4015044i Differentiate 7712i*2q - 6i2 + 38i - 578q + 4281 with respect to q. 7712i2 - 578 What is the second derivative of a4 - 1295785a3 - 2a*2 + 35099a + 29 wrt a? 12a2 - 7774710a - 4 Find the second derivative of 36159203s2 + 29728829s. 72318406 Find the first derivative of -124677034d4 - 85501999. -498708136d*3 What is the third derivative of -54j*2s*3y - j*2s*2y - j*2s - 2j2y - 4j2 - 17733js3y + 1765s2y + 2y wrt s? -324j*2y - 106398jy Find the second derivative of u*3 - 174768640u*2 + 625320349u. 6u - 349537280 What is the second derivative of -178221161r*4 - 93433802r - 1? -2138653932r2 What is the third derivative of -38094195y*4 - 43654387y*2 wrt y? -914260680y What is the second derivative of -838no*3 + 17no + 4n + 18047o3 - 5076o wrt o? -5028no + 108282o What is the second derivative of -627269838r*5 - 82516773r wrt r? -12545396760r3 Find the third derivative of 1600g*4 + 1602g*3 + 6329830g*2. 38400g + 9612 Differentiate 14379934q - 73076951. 14379934 Differentiate x2y + 8249769xy - 2108y + 33942 with respect to x. 2xy + 8249769y Differentiate -2mx*3 + 277mx2 + 202mx + 4m + 3x3 + 4x*2 - 71x + 7 wrt m. -2x3 + 277x*2 + 202x + 4 What is the derivative of 378j3z - 9862jz + 132376z wrt j? 1134j*2z - 9862z Find the first derivative of -11138298h4 - h2j2 - 1391j*2 + 313j wrt h. -44553192h3 - 2hj2 Differentiate -u3 - 16u*2 - 9617u - 7807669 wrt u. -3u2 - 32u - 9617 What is the third derivative of 281920q4 + 4q*3 - 7253275q*2? 6766080q + 24 What is the third derivative of 3777066p3 + 4076763p*2 + 1 wrt p? 22662396 Find the third derivative of -191046h*6 + 8434095h*2 wrt h. -22925520h*3 What is the third derivative of 50426310s*5 - 4s*2 - 588451 wrt s? 3025578600s*2 What is the derivative of 138255706t*2 - 55500233 wrt t? 276511412t What is the third derivative of 41917740x4 - 59x*2 + 5x - 14532? 1006025760x What is the third derivative of 38604898k*3 + 145461759k*2 wrt k? 231629388 What is the first derivative of -2j*4 + 2772319j*3k*3 + 9704k*3 + 8k*2 - 1 wrt j? -8j*3 + 8316957j*2k*3 Differentiate -27976445y - 80240815 wrt y. -27976445 What is the second derivative of -166690g5 + 4g*4 - 22084962g? -3333800g3 + 48g*2 Find the third derivative of -371882657h*3z*3 + 5h*3 + 17h*2z*2 + 23172h wrt z. -2231295942h3 Find the second derivative of 192w*3 + 72715w*2 - 4766893w. 1152w + 145430 What is the third derivative of 175511268y*5 - 36203496y*2? 10530676080y*2 What is the third derivative of 8y*6 + 15832790y*3 + 308986807y*2? 960y*3 + 94996740 What is the second derivative of -40b*3s - 2468970b3 + 10bs - 9742182b wrt b? -240bs - 14813820b What is the second derivative of -14710801q*2y*2 - 2q*2y + 1198340qy wrt y? -29421602q2 Find the third derivative of 192j*6 + 42170j*3 + 3j*2 + 13424153j wrt j. 23040j3 + 253020 Find the third derivative of 4860186q*3 + 43899091q*2 wrt q. 29161116 What is the third derivative of -172613995m*3s - 10m2 + 22ms + 4s + 22796 wrt m? -1035683970s What is the second derivative of 294p*2x*2 + 1522p*2x + 2p2 - 2372px2 - 3p + 469x2 wrt p? 588x*2 + 3044x + 4 What is the first derivative of -h3 - h2 + 1340221h - 50746407? -3h*2 - 2h + 1340221 What is the first derivative of -353608126g + 86163317? -353608126 What is the derivative of -29j*3 - 5413j*2q + 111jo - 3015o - 33218q wrt j? -87j2 - 10826jq + 111o Differentiate au2 - 983921a - 10545980u2 - 1 with respect to u. 2au - 21091960u Differentiate 1281563214y + 811996369. 1281563214 What is the derivative of -8s*4 + 103s*3 + 15s*2 - 3s - 5980278? -32s3 + 309s*2 + 30s - 3 Find the second derivative of 21301k5 - 12k*4 - 7k*2 - 968214k. 426020k3 - 144k*2 - 14 Find the second derivative of 112503d*3f*2 - 4225d*3 + 59d*2f*2 - 2392df wrt f. 225006d*3 + 118d*2 Differentiate 9908108r*2 + r + 5169472 wrt r. 19816216r + 1 What is the third derivative of -827072v5 + 1733879v*2 - 1? -49624320v*2 What is the second derivative of -6i*4 + 10i*3 + 11913i*2 + 81848652i wrt i? -72i2 + 60i + 23826 What is the second derivative of -1411o4 - 1648o*2 - 5o + 665967 wrt o? -16932o2 - 3296 Find the second derivative of 417lmy*2 - 280lmy - 2lm + 3ly*2 + ly + 2my*2 - 138my - 3m - 17128y2 - 2 wrt y. 834lm + 6l + 4m - 34256 Differentiate -153906h*3 - 8306997 with respect to h. -461718h*2 Find the first derivative of 15560g*2 + 546g + 14197964 wrt g. 31120g + 546 Find the second derivative of -24x*4 + 8466x*3 + 22x*2 + 1111619x - 25. -288x2 + 50796x + 44 Find the second derivative of 3752y3 - 1433y*2 + 38578y + 85. 22512y - 2866 Find the third derivative of 170301151k*4 + 122k*2 - 10k - 3342. 4087227624k Differentiate 111359928d*4 + 219158841 wrt d. 445439712d*3 What is the first derivative of 627f*4 + 4468f*3 + 3f*2 + 135477601 wrt f? 2508f*3 + 13404f*2 + 6f Differentiate 144h3 - 190586h + 93242343 wrt h. 432h2 - 190586 What is the third derivative of 17725634q*3 + 13q*2 + 1227169 wrt q? 106353804 Differentiate -65181r*3 + 2r*2 + 36r + 22338314. -195543r2 + 4r + 36 Find the second derivative of 4n3 + 226099n*2 + 255n + 7203. 24n + 452198 Find the first derivative of 182nw3 - 89nw + 991n - 821662811w3 wrt n. 182w*3 - 89w + 991 What is the third derivative of -11675990p5 + p3 - 28589937p*2 + 2p - 2? -700559400p2 + 6 Find the second derivative of 37p*3q*2 - 28p*3 - 1343p*2q*2 + 22p*2 - 4pq3 + 19896q wrt q. 74p3 - 2686p*2 - 24pq What is the third derivative of 2009941m*3v*2 - 2m*3 - 5681m*2v*2 + 167m*2v + 2m2 wrt m? 12059646v*2 - 12 Find the first derivative of 7i*2q*2 - 8i*2q - 2884iq + q*2 + 2025031q - 1 wrt i. 14iq*2 - 16iq - 2884q Find the first derivative of -1746b2w + 2b2x + 21177b2 + 16774139bwx wrt x. 2b2 + 16774139bw Find the third derivative of -36d*6 - 43011d*4 - 7d*2 + 235645d. -4320d3 - 1032264d Find the second derivative of 298187027u3 + 6692747u + 3 wrt u. 1789122162u Find the second derivative of 507q*2ty + 33831q*2u + qtuy - 4551qtu + 5qty + quy + qu - 10qy + uy wrt q. 1014ty + 67662u What is the third derivative of -13117750f5 - 3f*2 - 3f + 2754582? -787065000f2 Differentiate -737934620b - 143139694 with respect to b. -737934620 Find the second derivative of -12033791bt*2 - 338309bt - 253t wrt t. -24067582b Find the third derivative of 319597304j*5 + 3j3 - j2 + 66508807. 19175838240j2 + 18 What is the first derivative of 344792592o*3 + 86927437? 1034377776o*2 What is the derivative of 8385k*2 - 8289k + 53389871? 16770k - 8289 What is the derivative of 10916185bf3 - 843f3 + f2 + 1213f wrt b? 10916185f*3 Find the second derivative of -6071h*2w*3 + 2h*2w*2 - 108h*2w + 349973h + 4w*3 wrt h. -12142w*3 + 4w*2 - 216w Find the second derivative of 2544679g3 - 59918016g wrt g. 15268074g Find the third derivative of -3f*5 + 10374619f4 + f3 + 349f2 - 2f - 32409. -180f2 + 248990856f + 6 Find the second derivative of 24337d3n3 - d3n - 109d*2n*4 + 2d*2 + 15d + n - 18494 wrt n. 146022d3n - 1308d2n*2 What is the first derivative of -357k*2m - k*2 - 4989km - 12558351k wrt m? -357k2 - 4989k Find the second derivative of 10789531r3 + r2 + 25922688r wrt r. 64737186r + 2 Find the second derivative of 117x**	{ "pile_set_name": "DM Mathematics" }
3) - (sqrt(343)-2 + 4)2))-4 + -3. -588sqrt(7) + 57 Simplify (((sqrt(475) - (sqrt(475) + -1 + 0)) + 3)6)*2. 576 Simplify -6(-4 + sqrt(605) + 0 - (1 + sqrt(405) + sqrt(5) + -1))*2. -126 + 48sqrt(5) Simplify ((sqrt(550) + (sqrt(550) - (sqrt(550) - (sqrt(550)5 + sqrt(550)))))/sqrt(11))/(sqrt(50)/sqrt(5)2). 7sqrt(5)/2 Simplify ((-3(-3sqrt(8) + sqrt(8)))/(sqrt(4) + 2sqrt(100) - sqrt(4))-6)2. 648/25 Simplify (sqrt(187) - -1sqrt(187)-2)/(sqrt(11) + (sqrt(11) - sqrt(2156)/sqrt(4))). sqrt(17)/5 Simplify (-2 + 3((sqrt(1008) + -1 - sqrt(1008)) + sqrt(1008) + 5 + 1))*2. 936sqrt(7) + 9241 Simplify -2(-5(sqrt(891) - (-5(-2sqrt(891) + sqrt(891)) - sqrt(891))))*2-5. 2004750 Simplify 2(sqrt(120)3)/(sqrt(60)/sqrt(640)) + 3. 3 + 96sqrt(5) Simplify (1(5(sqrt(21)-2 - sqrt(21)) - sqrt(21)))/(sqrt(49)/(-4sqrt(14)/sqrt(2)))-2. -128sqrt(3) Simplify (sqrt(117)-2-1 - (1 + sqrt(117) + 2 + sqrt(117)) - (-4sqrt(117)-2 + 3))2 + -5. 288sqrt(13) + 7519 Simplify (((sqrt(112)1)/sqrt(4) - sqrt(28))-1)/(sqrt(4)1-3 + 3sqrt(16)). 0 Simplify -3 + (1 + (sqrt(117)-2 + sqrt(117))/sqrt(9)4)2 + -2. -8sqrt(13) + 204 Simplify (0 + sqrt(396)-6 - (sqrt(396) - -6(3 + sqrt(396) + sqrt(396))))*2. 4104sqrt(11) + 143280 Simplify (2sqrt(576) - 3(sqrt(36) + -2sqrt(36)))/((-1sqrt(192)/sqrt(4))/sqrt(4)). -11sqrt(3) Simplify -4 + 2 + sqrt(57)/sqrt(3) + 4 + -4 + (22sqrt(931))2. sqrt(19) + 14894 Simplify -46(((sqrt(119)1)/sqrt(7) - sqrt(17)) + sqrt(34)/sqrt(2) + -4)6. -144sqrt(17) + 576 Simplify ((sqrt(756)2 - sqrt(756)) + sqrt(756) + sqrt(21))/(-5(sqrt(33)/sqrt(11) - sqrt(3)) + sqrt(3)). 13sqrt(7) Simplify (sqrt(16) - (sqrt(16) - (2sqrt(1600) + sqrt(16) - sqrt(16))) - (sqrt(16) - (5(sqrt(16)2 - sqrt(16)) + sqrt(16))))/(-61sqrt(1152)). -25sqrt(2)/72 Simplify ((1sqrt(110)-5 - sqrt(110))/sqrt(10) - (4sqrt(704)1)2)1. -11264 - 6sqrt(11) Simplify -5((3(2 + sqrt(567)) + sqrt(567))2 - ((sqrt(567) - (-5 + sqrt(567) + sqrt(567) + 3 + sqrt(567))) + sqrt(567))). -45530 - 2205sqrt(7) Simplify sqrt(36)/((sqrt(180)/sqrt(5))/sqrt(3)) - (sqrt(3) - (-2sqrt(147) - sqrt(147)))24. -5808 + sqrt(3) Simplify -3 + (5 + (0 + sqrt(684))-2)2 + (sqrt(684) + sqrt(684) + 0)-6 + 4. -192sqrt(19) + 2762 Simplify sqrt(24)/sqrt(1200) + -1 + (sqrt(8)-2 - sqrt(8))*2. sqrt(2)/10 + 71 Simplify 1 + 5((sqrt(156) + (sqrt(156) - sqrt(156)-16 - sqrt(156)))/((sqrt(120) - (sqrt(120) - ((2sqrt(120) - sqrt(120)) + sqrt(120))))/sqrt(10)) + -1). -4 + 35sqrt(13)/2 Simplify -1 + ((sqrt(72) - (sqrt(72) - (3sqrt(72) + sqrt(72) - sqrt(72)) - sqrt(72) - sqrt(72) - sqrt(72))-4)/sqrt(9))*2. 2887 Simplify (sqrt(110)/(-5sqrt(250)) + sqrt(44)-6-6)*2. 35600411/625 Simplify (((sqrt(84)2 - sqrt(84))-2-6)/((2sqrt(972) + sqrt(972))5))*2. 112/2025 Simplify -4((0 + sqrt(931) + sqrt(931))1)2 + -2 + -2sqrt(931) + -1sqrt(931) + 0. -14898 - 21sqrt(19) Simplify (4-2(1 + sqrt(832)) - (2sqrt(832)1 - (sqrt(832) + -1 + 2)))*22. 2016sqrt(13) + 134882 Simplify (sqrt(15) - (-2sqrt(15)6 - sqrt(15)))/(2(sqrt(5) - (sqrt(20)/sqrt(4) + sqrt(5) + sqrt(5) + sqrt(5)))) + 0. -7sqrt(3)/3 Simplify ((sqrt(50)/sqrt(10)-6 - (sqrt(35) - -4sqrt(35))/sqrt(7)) + -5)2. 110sqrt(5) + 630 Simplify -3 + (sqrt(180) - (sqrt(180) + -2sqrt(180))-4)-2. -3 + 36sqrt(5) Simplify (5sqrt(847) + -3 - 4(sqrt(700) + sqrt(700)-4))2. -1050sqrt(7) + 214384 Simplify (((sqrt(931) + -3 - sqrt(931))4 - sqrt(931))-4)*2 + 3 + -1. 2688sqrt(19) + 17202 Simplify ((-6sqrt(30)/(sqrt(9)/sqrt(3)))/(62sqrt(2) + (sqrt(72) - 2sqrt(72)))-5)2. 125 Simplify 2-3sqrt(343) - (-2 + sqrt(21)/(sqrt(12)/sqrt(4))). -43sqrt(7) + 2 Simplify (-1(2sqrt(165) - sqrt(165))/sqrt(11))/(sqrt(3) + sqrt(15)/sqrt(20) + (sqrt(66)/sqrt(2) + sqrt(33) + sqrt(33) + sqrt(33))/sqrt(11)). -2sqrt(5)/11 Simplify ((sqrt(252)2)/sqrt(4) - (2sqrt(63) + sqrt(63))5)/(-6sqrt(576)-3). -13sqrt(7)/144 Simplify -3(sqrt(2) + 2)4 - ((sqrt(18))2 + -2 + 5). -45 - 12sqrt(2) Simplify (sqrt(96)2-4)/((sqrt(4) + sqrt(324)2)/sqrt(2)). -32sqrt(3)/19 Simplify 4((-4 + sqrt(51)/sqrt(3) - 4sqrt(272)) + 5 + sqrt(68)/sqrt(4) + sqrt(17) + -4)*2. 312sqrt(17) + 11528 Simplify (sqrt(4608) + -2 + 2 + -5(1 + sqrt(2592) - sqrt(2592)))2. -480sqrt(2) + 4633 Simplify sqrt(6)/((3sqrt(20))/sqrt(10)) + ((1sqrt(324))/sqrt(12))*2. sqrt(3)/3 + 27 Simplify -1(sqrt(27)/(-4sqrt(324)) - (sqrt(363) + 3 + 3)). 6 + 265sqrt(3)/24 Simplify -1(5 + sqrt(176) + 3sqrt(176) - (-1 + -1sqrt(176) + sqrt(176)))2. -2852 - 192sqrt(11) Simplify (sqrt(1617) + (sqrt(1617) - ((sqrt(1617) - 2sqrt(1617)) + sqrt(1617))) + sqrt(1617))/(1sqrt(891)) + 1 + 4. 7sqrt(3)/3 + 5 Simplify ((-1(sqrt(100) + sqrt(100) + sqrt(100)2 - sqrt(100) - sqrt(100)))/sqrt(10))/(sqrt(35)/(5sqrt(7)1 - sqrt(7) - sqrt(7))). -6sqrt(2) Simplify (sqrt(490) - 4(sqrt(490)-1 + sqrt(490)))/(sqrt(40)/(sqrt(288)-3 - sqrt(8))). -133sqrt(2) Simplify ((sqrt(187) - sqrt(187)-2)-2 + -2sqrt(187)-2)/((64sqrt(44))/sqrt(4)). -sqrt(17)/12 Simplify -6(1(-1 + sqrt(2187) + 2 + -5))*2. -13218 + 1296sqrt(3) Simplify -5 + (-2sqrt(432) + sqrt(432) + (-2sqrt(147) - sqrt(147)) + sqrt(30)/sqrt(160) + sqrt(300) + 0)*2. 24763/16 Simplify ((sqrt(57) - sqrt(114)/sqrt(2))2-3)/(-4sqrt(192)-1)3. 0 Simplify (sqrt(140)/(1sqrt(700)))/(2sqrt(30)/sqrt(12)). sqrt(2)/10 Simplify (1 + ((sqrt(288)-2-6)*2 - (sqrt(288) + -2 + 5)))6. -72sqrt(2) + 248820 Simplify 0 + ((sqrt(1331) - (5 + sqrt(1331)1))5 + 1)2. 576 Simplify sqrt(243)42 + (-2 + (sqrt(243) - (2 + sqrt(243))))2. 16 + 72sqrt(3) Simplify 4 + (sqrt(833) + -2sqrt(833)-1 + -2)*2 + -3. -84sqrt(17) + 7502 Simplify ((-4 + (-4sqrt(147)6 - sqrt(147)))-2)2 + -1. 5600sqrt(3) + 367563 Simplify ((1sqrt(170)-14)/(sqrt(50)/((sqrt(5) - sqrt(20))3 + sqrt(5))))*2. 1088 Simplify sqrt(175) + -1 + -4 - (sqrt(77)/sqrt(44)2)*2. -12 + 5sqrt(7) Simplify (-5(1 + sqrt(243)) + -3 + -3 + sqrt(243)1 + (sqrt(243) - (2 + 1 + sqrt(243))))*2. 1008sqrt(3) + 4084 Simplify -4 + 3 + sqrt(8) - ((4sqrt(48) - sqrt(48))/sqrt(6) + sqrt(8))/sqrt(4). -2sqrt(2) - 1 Simplify 5 + sqrt(20)-2-4 + -3 + sqrt(120)/(sqrt(6) - 6sqrt(54)). 2 + 270sqrt(5)/17 Simplify (6(((sqrt(2299) - (-1 + sqrt(2299)))-6 - sqrt(2299)) + (0 + sqrt(2299) - sqrt(2299))-2)6)*21. 171072sqrt(19) + 3026160 Simplify 5(sqrt(2352) + (sqrt(2352) - ((sqrt(2352) - (sqrt(2352) + 2)) + sqrt(2352))*2)) + 0. -11780 + 840sqrt(3) Simplify (sqrt(34) + (sqrt(34) - (sqrt(34) - (sqrt(408)3)/sqrt(12))))/(sqrt(18)/(sqrt(9) + sqrt(81))). 16sqrt(17) Simplify (2(-1(sqrt(567) + 1 + sqrt(567)) + 3 + sqrt(567) + -2sqrt(567)))2. -432sqrt(7) + 20428 Simplify 6(sqrt(17) - (sqrt(272) + 4)) - (-3(sqrt(17) - sqrt(68)))*2-2. -18sqrt(17) + 282 Simplify -2(sqrt(44) + sqrt(44) + (sqrt(396)2)/sqrt(9) + (sqrt(1100) - sqrt(1100)2)). 4sqrt(11) Simplify (sqrt(84)1-6-5)/(1sqrt(300) - sqrt(300) - 5sqrt(24)/sqrt(2)). -6sqrt(7) Simplify 3 + (sqrt(17) - sqrt(833)1) - 5(sqrt(425))26. -12747 - 6sqrt(17) Simplify (sqrt(133)-122)/(sqrt(70)/(sqrt(40)-2)). 16sqrt(19) Simplify 4 + 4(-5((-1sqrt(448))2 - sqrt(448)) + sqrt(448) + (sqrt(448)3 - sqrt(448) - sqrt(448)) + 4). -8940 + 224sqrt(7) Simplify sqrt(102)/((sqrt(6) - (sqrt(726) - -1sqrt(726))) + sqrt(6) - sqrt(6) - sqrt(6)) + (3(sqrt(153) + sqrt(153)1 + sqrt(153)))/sqrt(9). 197sqrt(17)/22 Simplify 5 + sqrt(7) + 1 - (sqrt(21)/sqrt(3) + -2) - -6(sqrt(7) + -2 + (sqrt(21)/sqrt(3))*2). 6sqrt(7) + 38 Simplify 4(4 + -2(sqrt(11) + 1) + (-51sqrt(99))*2 + -1). -8sqrt(11) + 9904 Simplify -6(sqrt(1331) + sqrt(1331)2 + 0 + 4) + 4. -198sqrt(11) - 20 Simplify sqrt(180)41 + (sqrt(180) + 1)2 + -1 + -1. 36sqrt(5) + 179 Simplify ((sqrt(90)/(-2sqrt(10)) - (sqrt(441) + (sqrt(441)2 - sqrt(441))))/(sqrt(588)5))2. 2523/19600 Simplify -3(6(sqrt(567) + 4) - (-1sqrt(70)-3)/sqrt(10)). -153sqrt(7) - 72 Simplify (sqrt(27) + sqrt(243)/(sqrt(9)1) - (sqrt(2700)-2 + sqrt(27) - sqrt(27)))/(4sqrt(27)/sqrt(3) + 1sqrt(81)). 22sqrt(3)/7 Simplify ((sqrt(40)/sqrt(4)2 - sqrt(10))/((sqrt(20)/sqrt(4) - sqrt(5))-6 - sqrt(5)) + -4)2. 8sqrt(2) + 18 Simplify sqrt(208) + -5(sqrt(208) - sqrt(208)-1)**2 - (	{ "pile_set_name": "DM Mathematics" }
Let z = 336 - 324. Let v be g(z). Give n(v). 6 Let q(z) = 7 - 4z - 11 - 4z + 5. Let l(f) = -9f + 1. Let s(a) = 3l(a) - 4q(a). Calculate s(9). 44 Let v(u) = 672u + 673u + 18 + 674u - 1 - 9 - 2027u. Suppose -4z - k - 3 = 4k, 0 = 2z + 4k + 6. Give v(z). -16 Let x(m) = m2 + 2m + 3. Let p(q) = -5q2 - 2q - 17. Let i(y) = y - 1. Let a(k) = 4i(k) - p(k). Let v(c) = -2a(c) + 9x(c). Give v(6). 1 Let i(v) be the third derivative of -v5/60 - v4/12 - v3/2 + 2v2. Let h = -193492 - -193489. Calculate i(h). -6 Let y(b) = -b3 + 2b2 + 1. Let c(z) be the first derivative of z3/3 + 3z*2/2 + 4z - 100. Let s be c(-2). Determine y(s). 1 Let v(f) be the second derivative of f4/12 - f3 - 7f2/2 + 4f. Let o = 221 - 191. Suppose -18r + 13r + o = 0. Determine v(r). -7 Let q(v) be the first derivative of v*4/4 - 4v*3 + 15v*2 - 16v + 2655. What is q(8)? -32 Let t(k) = 7k - 7. Let v(y) = 8y - 8. Let f(z) = -7t(z) + 6v(z). Suppose 5a - 7 = 8. Suppose -4p - 5m - 5 = 0, 2m = -ap + 30 - 32. What is f(p)? 1 Let r(l) = -4l + 145. Let w be r(38). Let k(v) = -v*2 - 12v - 23. Give k(w). 12 Let c(b) = -795 + 3b - 8b*2 - 3b3 + b3 + 798. Let q be c(-4). Let w(n) = 5 + 3n2 - 2n*2 + 7 - 1 + 11n. What is w(q)? -7 Let b(q) be the first derivative of -q7/420 - q6/360 - q5/60 + q4/24 - 2q3/3 + 2q - 45. Let h(s) be the third derivative of b(s). Determine h(2). -23 Let w be (5 - (16 - 10))/((-2)/(-6)). Let v(l) = -7l2 + 7l + 6. Let o(f) = 13f2 - 13f - 12. Let r(x) = -6o(x) - 11v(x). What is r(w)? -6 Let g(x) = -506x - 4551. Let t be g(-9). Let n(z) = -3z*2 + 5z + 3 - 3z - 5z. Determine n(t). -33 Let c(a) = -a*2 + 3a - 4. Let n = 22 - 18. Let d be 2/((-3 + n)/23). Let z = d + -43. Calculate c(z). -4 Suppose -5y + 5v = 4v + 162, -51 = 2y - 5v. Let n be y/(-12) + (-3)/4. Let c(i) = 39 - ni*2 + 7i + 0i2 + i2 - 32. Determine c(7). 7 Let x(n) = -5n - 2. Let f(b) = -b*2 - 29b - 123. Let r be f(-24). Let g(a) = -2a + 1. Let h(i) = rg(i) - x(i). Calculate h(-2). -23 Let q(l) be the second derivative of l6/720 - l5/120 - l*4/12 - 3l*2/2 - 5l + 5. Let j(t) be the third derivative of q(t). Determine j(10). 9 Let z(v) = 37 - 11238v2 + 11237v*2 + 1 + 21 + 9v. Give z(-6). -31 Let u(z) = -z*2 + 11z - 14. Let b be u(2). Let y(v) = -6v - 1. Let s(d) = 5d. Let a(h) = 4s(h) + 5y(h). Calculate a(b). -45 Suppose -7 = -2z - 3. Suppose -24 = -4r + 4f, 4r = zf - f + 15. Suppose -4l - 28 = -4v, 13 = 5v - rl - 22. Let u(s) = -s2 + 6s + 8. Calculate u(v). 1 Let a(u) be the third derivative of u6/120 + u5/20 + u*4/24 + 2u*3/3 - 172u*2. Let j(p) = 3p*2 + p. Let w(r) = -a(r) - j(r). Calculate w(-6). 8 Let u be 15(-4)/822/33. Let k(z) = 4z*3 + 4z*2 - 9z. Let v(i) = -5i3 - 4i*2 + 10i - 1. Let f(y) = -4k(y) - 3v(y). What is f(u)? -2 Let k(w) be the third derivative of 1/8w4 - 39w*2 - 2 + 0w - 3/2w3. Suppose -21 = 4a - 5, 3q + a - 14 = 0. Calculate k(q). 9 Let p = -1782 - -1788. Let u(h) = h - 3. Give u(p). 3 Let c(a) = 5a + a*3 - 21a - 11a2 + a + 15. Calculate c(12). -21 Let p be 2/5 + (-132)/(-20). Let k(t) = -23t*2 + 9t - 5. Let l(s) = -165s2 + 66s - 36. Let x(w) = 43k(w) - 6l(w). Determine x(p). -13 Let u(o) = -2o2 - o - 1. Suppose 7g - 42 + 28 = 0. Calculate u(g). -11 Let n(c) = 3c + 4. Let p(r) = -5r + 12r + 7r + 35 + 7r + 4r. Let v(f) = -51n(f) + 6p(f). What is v(2)? 0 Let q(f) = -110f2 - 33f + 15. Let y(i) = -52i2 - 16i + 7. Let g(m) = -6q(m) + 13y(m). What is g(-1)? -5 Let n(j) = j*3 - 145j*2 - 597j - 6. Let z be n(-4). Let t(u) = -3u3 - 2u2 - 4. Give t(z). 12 Let d(u) = u3 + 4u2 - 6u - 7. Let c(y) = -4y3 - y. Let g be c(-1). Suppose -21s + 140 = 56. Suppose 2l = -gr - 33, -sr - 12 = -l - l. Give d(r). -2 Let g be 4966/12415((-2)/(8/50))/(-1). Let d(r) = 4 + r - r - 2r. Calculate d(g). -6 Let u(s) = -s2 - 7s. Let n be (-39)/(-26) + (4 - 31/2). Give u(n). -30 Let o(w) be the first derivative of -w*3/3 - 9w*2/2 - 6w - 55. Let d(m) = m*2 + 8m + 5. Let z(j) = 5d(j) + 4o(j). Determine z(-2). -3 Let y(j) be the second derivative of j3/3 - j2 + 2j. Let f(k) = -k3 - 30k*2 - 30k + 44. Let t be f(-29). Suppose -8n - 57 = -t. Calculate y(n). 2 Let y(m) = m - 2. Suppose f = 3f - 26. Let z be (1/3)/(5/45). Suppose 1 = -zi + f. Calculate y(i). 2 Let j(a) = -4 - 6a + 5a - a. Let u be j(-3). Let n(f) be the second derivative of f5/20 - f4/12 - f3/6 - f2 - 18f. Give n(u). 0 Suppose 12k = 97 - 49. Suppose -kl + 6l = 5s - 47, 0 = 5s + 3l - 67. Let r(n) = -n*3 + 11n2 - n + 5. Give r(s). -6 Let x(h) be the second derivative of -h6/720 + 7h5/120 - 23h4/12 + h3/2 - 3h + 9. Let a(p) be the third derivative of x(p). What is a(-6)? 13 Let r(x) = -x - 6x - 8 + 4x. Let g be -16 + 0 + (-13 - (-5 - 14)). What is r(g)? 22 Let y(o) = -o3 - 4o*2 - 3o - 13. Let z be y(-7). Let n = 150 - z. Let l(d) = d + 4d - 6d. Determine l(n). 5 Let j(c) be the third derivative of -3/8c4 + 2c*3 - 1/120c*6 + 0 + 0c + 7/60c5 - 90c*2. What is j(6)? -6 Let o(h) = 14h*2 + 996 - 6h - 10h + h3 - 1966 + 4h + 1024. Determine o(-15). 9 Let h(j) be the third derivative of -j*4/24 - 5j*3/6 + 5j*2. Suppose -48v + 96 = -56v. Let f be (-52)/65 - v/15. What is h(f)? -5 Let i be (-19)/76 + 74/8. Let o be i(4/12 + -1). Let d(t) be the third derivative of t*5/60 + 3t*4/8 + 4t*3/3 + 8t*2 - 2. Determine d(o). -10 Let y(a) = -2a*3 + 24a*2 + 53a + 44. Let p be y(14). Let w(r) = r*2 - 5. What is w(p)? -1 Let a(l) = -246 + 2l*2 + 123 - 5l - l*2 + 112. Let p(k) = -k + 2. Let i be p(-5). Let o be a(i). Let f(c) = c + 1. Calculate f(o). 4 Let q(v) = 299v*2 + 2v - 17. Let c(i) = -50i2 - i + 2. Let o(y) = 6c(y) + q(y). Suppose 0 = -5x - 45 + 15. Give o(x). -17 Let u = 4 - 0. Let s(p) = up + 786 - 260 - 261 - 259. Determine s(5). 26 Let w(x) = -2 - x*3 - 44x - 2x2 - 3x*2 + 41x. Let t = 260 + -264. Determine w(t). -6 Let m(z) = -11 + 66z + 339z*2 - 670z*2 + 326z*2 + 2. What is m(13)? 4 Let s(b) be the second derivative of -2b*3/3 + 2b2 - b. Let m = -3132 - -3134. What is s(m)? -4 Let c(b) = -b3 - 10b2 - 25b - 20. Let s = 5798 + -5804. What is c(s)? -14 Let s = 71 + -108. Let m = s - -39. Let a(z) = mz + 3z - 4z + 3 - 4z. What is a(-4)? 15 Let z(i) = -17i + 271 + 78 + 4i + 27i - 63i. Give z(7). 6 Let b(x) be the third derivative of 11x5/60 - x4/12 - 2x*3/3 - 608x*2. What is b(3)? 89 Let z(p) = -21p + 41. Let v(m) = 5m - 10. Let g(l) = 9v(l) + 2z(l). Let u = -361 + 366. What is g(u)? 7 Let w(c) be the second derivative of 3c*5/20 - 19c*4/12 - 2c*3/3 + 33c*2 + 14c + 290. What is w(6)? 6 Suppose -3v + 11 = -2k + 1, -k - 12 = -5v. Let m be 0/((5 - (4 + v)) + -3). Let o(u) = -2u + 23. Give o(m). 23 Let o(j) be the second derivative of 1/2j2 + 55j - 1/3j3 + 0. Give o(-2). 5 Let z(o) be the first derivative of -8o - 1/2o2 - 120. Suppose -b - 8 = -2y + 3, -4y = -3b - 27. What is z(b)? -3 Suppose 4b - 3t + 53 = 0, t + 7 = 5b + 76. Let f(v) = 18v + 247. Let k be f(b). Let c(y) = 5y - 2y - y + 3. Determine c(k). -7 Suppose b + 29 - 30 = -5x, -18 = 2x + 5b. Let h(i) = 10i*2 - i. What is h(x)? 9 Let l(n) be the first derivative of 9/2n*2 + 2n*3 - 251 - 1/4n*4 - 16n. What is l(7)? -2 Suppose -k - 3s = -22, -5k - 8s = 56 - 166. Let v(t) be the first derivative of -k - 1/4t4 + t2 + 2t3 + 0t. Calculate v(6). 12 Let m(x) = -2 + 13x + 18x*2 - 167x*3 + 73x*3 + 96x3. Calculate m(-8). 22 Let f(k) = -k2 - 3k. Let t be f(-4). Let z(s) = 4 - 3 + 0 - 20s - 2s2 - 3s + 19s. Determine z(t). -15 Let c(m) = 2m*2 - 15m + 10. Suppose 2l - 7 = -5d, 161 = -3l - 4d + 175. Give c(l). -8 Let u(n) = 11n2 + 22n*2 + 7n - 3 - 9 - 49n2 + 15n2. Calculate u(11). -56 Let i(q) = -q2 + 13q - 28. Suppose -7j + 3j - 2x = -36, -3j + 17 = 4x. Give i(j). -6 Let h(o) = o*3 + 8o*2 - 10o + 22. Let f be h(-9). Let i = -25 + f. Suppose -3m - i = -0. Let j(l) = -l2 - 2l - 3. What is j(m)? -3 Let y(l) = -9l3 - 5l**2 - 1	{ "pile_set_name": "DM Mathematics" }
the nearest ten thousand? -190000 Let y = -0.004995042 + -166.994838958. Let j = -283 + 116. Let d = j - y. Round d to five dps. -0.00017 Let c = 65723318 + -65727857.5499. Let u = 4337.564 + c. Let j = -202 - u. Round j to 3 dps. -0.014 Let j = -0.18854 - -0.18274. What is j rounded to 2 decimal places? -0.01 Let f = -38.498724 + 38.5. What is f rounded to 4 dps? 0.0013 Let c = -720.4 + -566.8. What is c rounded to the nearest one hundred? -1300 Let a = 50931.856 - 50690. Let q = -241 + a. Round q to 1 dp. 0.9 Let q = 0.271 + 35.529. Let c = q - 36. Let v = c - -0.20052. What is v rounded to four dps? 0.0005 Suppose -3h = -4s + h - 270120004, 0 = 3s + h + 202589999. What is s rounded to the nearest 1000000? -68000000 Let c = 9.05 - 0.05. Let b = 38388.00064 - 38397. Let f = c + b. Round f to four dps. 0.0006 Let o = -935.861 - -921.26226. Let b = -11.817 + -2.783. Let t = b - o. What is t rounded to three decimal places? -0.001 Suppose -14 = -n - 0b + b, -42 = -3n - 2b. Suppose -2o - o = -3x + 30, 0 = -5x - 4o + n. Suppose 13m - xm = -39200000. Round m to the nearest 1000000. -6000000 Let m(y) = 13y2 + 50y + 8569. Let s be m(-117). Round s to the nearest 10000. 180000 Let s(k) = -k3 + k2 - 3k + 23. Let n = 247 - 256. Let i be s(n). Round i to the nearest one thousand. 1000 Let x = 1.4 + -1.371. Let m = x - 0.029928. Round m to 4 decimal places. -0.0009 Let r be 402/((-4)/2)14/(-3). Let v(b) = 19 + 5 - rb - 253b + 168b. Let d be v(-12). What is d rounded to the nearest ten thousand? 10000 Let q(j) = -9j - 2j + 14 - 73j*2 - 3j - 12j. Let x be q(6). Round x to the nearest one hundred. -2800 Let f = -20.937123 + 20.8442. Let n = 0.0942 + f. Round n to four dps. 0.0013 Let h = 2583910.07500606 + -2583910. Let p = h - 0.075. What is p rounded to six decimal places? 0.000006 Suppose 3d = 2d - d. Suppose d = -j - 3c - 32854, -3j + 2j = 5c + 32852. Let w = j - -12957. Round w to the nearest 1000. -20000 Let g = -2981 + -71041. Suppose 63631 = s - 92347. Let k = s - g. Round k to the nearest one hundred thousand. 200000 Let z = -2256238.80300976 + 2256239. Let r = z - 0.197. What is r rounded to six dps? -0.00001 Let r be (-57)/95 + (-83)/(-5). Suppose ri + 1914840450 = 337240450. What is i rounded to the nearest one million? -99000000 Let y = 4596 + -4595.999995184. What is y rounded to six dps? 0.000005 Let k = 547.3824 + 7.5276. Let z = -551 + k. Round z to the nearest integer. 4 Let g = -6.8403 - -5.899. What is g rounded to one decimal place? -0.9 Let k = 3960 - 5488.2. Round k to the nearest 1000. -2000 Let o be -2 + (-2 - 0)/(-2). Let w be 5 - 1 - 0o/(-4). Let z(c) = -213125c*2 + 2c - 8. Let y be z(w). Round y to the nearest one hundred thousand. -3400000 Let g = 4.5 + -7.6. Let c = g - -4.5. Let q = c - 7.5. Round q to 0 decimal places. -6 Let n = 0.82 + -0.06. Let i = 91868056.23999969 + -91868057. Let v = n + i. What is v rounded to seven dps? -0.0000003 Let j = -1.028 - -1.578. Let y = 1.9715 + -2.52. Let s = y + j. Round s to three decimal places. 0.002 Suppose -3v + 4v - 129217 = 2m, 0 = 2v + 3m - 258469. Let h = v - 46552. Suppose 6u + 352675 = h. Round u to the nearest 10000. -50000 Let y = 359540101.9516402804826152 + 0.0484567195173848. Let i = 359540337 - y. Let s = i - 235. Round s to five dps. -0.0001 Let x = 772.52187 - 772.6. Round x to 3 decimal places. -0.078 Let j be (348/(-30))/(14/(-630000)). Round j to the nearest one million. 1000000 Let k = 6000.3894 + -6000. Round k to one decimal place. 0.4 Let p = 802.026 + -801. Let y = -0.09 - -0.074. Let n = y + p. What is n rounded to 1 dp? 1 Let h = -23.5 + 23.50005515. What is h rounded to five decimal places? 0.00006 Let i = 12 + -6. Suppose -ik - 18 = 6. Let l be 1 - (k - (-2 + 8697)). Round l to the nearest 1000. 9000 Suppose 22 = 2d - 2s, -4d + 2s - s = -38. Suppose du = -4u + 3010488. Let z = 95576 - u. Round z to the nearest ten thousand. -140000 Let u = 700.65 - -51.85. Round u to the nearest 10. 750 Let r = -1553.0002641 + 1553. What is r rounded to four decimal places? -0.0003 Let q(k) = 2502k*2 + 18k + 16. Let f(g) = -g*3 - 4g*2 + 2g + 7. Let t be f(-3). Let i be q(t). Let y be i21/(-14)25. Round y to the nearest 100000. -2400000 Let o = -417 + 417.0065. Let i = -0.00650317 + o. Round i to six dps. -0.000003 Let z(o) = -6504o*3 + 13o*2 + 51o + 210. Let w be z(-10). What is w rounded to the nearest one hundred thousand? 6500000 Suppose 0 = -27w - 5w + 179264. Let u be w - (3 - (-3)/(-3)). Round u to the nearest 1000. 6000 Let n = -1619.65611 - 0.24389. Round n to the nearest 100. -1600 Let q = 0.81782 + 128.29918. Let a = 0.117 - q. Let k = a + 129.00000239. Round k to 7 dps. 0.0000024 Let h(t) = -195t2 - 141t + 1010. Let a be h(45). What is a rounded to the nearest ten thousand? -400000 Let k = -291223.884247 - -444043.820256. Let z = k - 152820. Let p = z - -0.064. Round p to 5 decimal places. 0.00001 Let g = 8460 + -11979. Suppose 28602 = -4n + 3r - 23622, 5r + 20 = 0. Let f = g - n. Round f to the nearest 1000. 10000 Let f = -22 + 35. Let c(o) = -588o + 19. Let j(g) = 589g - 17. Let y(a) = 4c(a) + 5j(a). Let z be y(f). What is z rounded to the nearest one thousand? 8000 Let g(a) = -2800a*3 - 2a*2 + 12a + 12. Let o be g(-2). Suppose 0 = -21q + 19q - 5v - 8921, -o = 5q - 3v. Round q to the nearest 100. -4500 Suppose -51469405 - 32293715 = -35m. Suppose 11k + 1383068 = -m. What is k rounded to the nearest ten thousand? -340000 Let g = 0.078502032 - 0.07852. What is g rounded to 6 dps? -0.000018 Let t be 1 - (-3232011)/(-1)(-140)/60. Let u = 55458640 + t. What is u rounded to the nearest one million? 63000000 Let m = -0.369399105 + 0.3694. What is m rounded to seven decimal places? 0.0000009 Let k = -1496203436389 - -1496203769233.8760077. Let b = k + -332845. Let m = b - -0.124. Round m to six dps. 0.000008 Let n = 4076 + -39479. Round n to the nearest 100. -35400 Let m(y) be the second derivative of -y*3/3 - 6y*2 - 9y. Let f be m(-7). Suppose -3z = -fn + 1048, -5z - 1628 - 114 = -n. Round z to the nearest 10. -350 Let s = 4 - -74. Let a = 67 - s. Let u = -10.999676 - a. Round u to four dps. 0.0003 Let v = 3715679 + -3715638.00009. Let w = v - 41. What is w rounded to three dps? 0 Let a be -2284963 + 1 + (8 - 0 - (120 + -104)). What is a rounded to the nearest one hundred thousand? -2300000 Let p = -325.88 - -447.38. What is p rounded to the nearest 100? 100 Let c(o) be the third derivative of -o6/120 + 17o*5/60 - 2o*4/3 - 8o*3/3 - 39o*2 + 2. Let i be c(16). What is i rounded to the nearest ten? -20 Let t = 658442928893 + -658449552949.800287. Let s = t - -6624066. Let g = s + -9.2. What is g rounded to 4 decimal places? -0.0003 Let g = 3496 - 3177.7. Let f = -287 + g. What is f rounded to zero dps? 31 Let w = 238.57 - 238.5699961624. Round w to 7 dps. 0.0000038 Let v = -443.4 - -443.102. Let q = -33.81 + 34. Let c = v + q. Round c to 2 decimal places. -0.11 Suppose -81736 = 57x + 61904. Round x to the nearest 1000. -3000 Let y = -1373 - -641. Let q = y - -728.474. Let i = -3.5 - q. What is i rounded to two dps? 0.03 Let g = -54961551022.74399836 - -54961545290. Let s = -5732.882 - g. Let y = s - -0.138. What is y rounded to seven dps? -0.0000016 Let n be (8 + 2131760/5)/(32/150). Round n to the nearest 100000. 10700000 Let z = -244.278 + 18.148. Round z to the nearest 10. -230 Let o = 3.64 - 0.41. Let w = 3.23000383 - o. What is w rounded to 6 decimal places? 0.000004 Let r = -143.12247 - -143.166470585. Let b = 0.044 - r. Round b to seven decimal places. -0.0000006 Let m = 0.5623 - -569.2877. Round m to 0 dps. 570 Suppose -177615226 = -52y - 1189743226. Round y to the nearest 1000000. -19000000 Let y = -2.0168 - -2.0167983626. What is y rounded to seven decimal places? -0.0000016 Let o = -0.08 + 0.32. Let m = -2390 - -2389.26. Let z = o + m. What is z rounded to one dp? -0.5 Let p = -7622 + 7622.005069. Round p to four dps. 0.0051 Let s(o) = 23150107o - 526. Let p(y) = 11575055y - 262. Let n(u) = 7p(u) - 3s(u). Let t be n(4). Round t to the nearest 1000000. 46000000 Let p = 1393385 - 13973384. Let m be 1/2 + (p/(-2) - 0). What is m rounded to the	{ "pile_set_name": "DM Mathematics" }
? True Is -1/62 at least as big as -10.68? True Is 9/4567 less than 0? False Which is greater: 3081/2722 or 0? 3081/2722 Is 11/34435 at most -1? False Is 1843 bigger than -26? True Which is smaller: 1064 or 31? 31 Do 1 and 31/29369 have the same value? False Which is bigger: 110709 or -6? 110709 Which is smaller: -2 or -234236.9? -234236.9 Which is greater: 42593 or 42615? 42615 Do 0 and -1/602742 have the same value? False Which is greater: -95476 or -3? -3 Is -28/481863 < 0? True Is 1/4162192 bigger than 1? False Is -52274 less than -993202/19? True Which is greater: -10964 or -10956? -10956 Which is smaller: -59163/7 or -8453? -8453 Which is smaller: 165.4 or -47/9? -47/9 Which is greater: -144765 or -289529/2? -289529/2 Which is greater: 2/5 or -354752? 2/5 Is 15 equal to 3612? False Which is bigger: 2/19 or 12293? 12293 Which is smaller: 31738 or 444345/14? 31738 Is -3/73594 at least -16? True Which is smaller: 0 or -13/3118? -13/3118 Which is greater: 55025 or 55027? 55027 Which is smaller: -0.0714 or 22? -0.0714 Is 2457560/9 > 273061? True Is -148/589 < -1? False Which is smaller: 100291 or 100287? 100287 Are -647 and -1315 unequal? True Is -447653 > -447651? False Is 122118 less than or equal to 122123? True Which is smaller: -7/3 or -5701/2? -5701/2 Is 55/76039 < 1? True Is -29303/3 > -9769? True Is 881 at least 989? False Which is smaller: -352029 or -1760148/5? -1760148/5 Are 3847 and 42313/11 unequal? True Which is bigger: 17 or -1638? 17 Which is smaller: -86 or -301? -301 Are 13/12780 and 1 nonequal? True Which is smaller: -1/4559121 or 0? -1/4559121 Is -6921/31 smaller than 5? True Which is smaller: 2443 or 9773/4? 2443 Which is smaller: 0 or 8/467615? 0 Which is smaller: -2/9 or -422366? -422366 Which is bigger: 45.157 or 5? 45.157 Which is greater: -96165 or -96169? -96165 Which is smaller: -14 or -1157/85? -14 Which is smaller: 1 or -25/215596? -25/215596 Which is bigger: -316783 or -316787? -316783 Do 6.77 and -11936 have the same value? False Is -1 bigger than -110/1477? False Is -1/3 less than 386.1? True Is 2/7 bigger than -1272505? True Is -103302 less than -103302? False Is -2416 bigger than 4? False Is -62 greater than -2/71117? False Which is smaller: 381.3 or 0.1? 0.1 Which is smaller: 91/152 or 0? 0 Which is smaller: 10943 or 39? 39 Is -492 < 302? True Is 18 <= 0.1288? False Which is bigger: 10.451 or 2? 10.451 Which is greater: -51921 or 21? 21 Is -1/4 less than or equal to 33/17? True Is -21028 not equal to -21027? True Which is bigger: 8851 or 8853? 8853 Which is smaller: 280 or 2359? 280 Which is smaller: -196.973 or 12? -196.973 Which is bigger: -1 or -938/533? -1 Is -327 smaller than -4569/14? True Is -15155 greater than -15122? False Which is bigger: 2670 or 143? 2670 Is 51970 less than 0.1? False Is 970726 at least 970723? True Which is smaller: -2650584 or -2650583? -2650584 Is 3/139918 bigger than 0? True Is -1719 less than -1719? False Which is smaller: -3446 or -3484? -3484 Which is smaller: 332/237 or 0? 0 Is 89/1309 at least as big as 0? True Is 115 >= 0.0202? True Which is bigger: 312727 or 312730? 312730 Which is greater: -8611 or -8602? -8602 Is -1 less than or equal to 3/7195? True Which is smaller: -31/4334 or 0? -31/4334 Which is smaller: 0 or 15/15613? 0 Is -1278 less than or equal to -47265/37? True Which is bigger: -2848 or -7/61? -7/61 Is -4574/33 <= -139? False Which is smaller: 282360 or 282358? 282358 Which is bigger: 252 or 16213/64? 16213/64 Which is smaller: -4573 or 1742? -4573 Which is smaller: -623.67 or 0? -623.67 Are -176 and -5436/31 unequal? True Which is smaller: 0.0659 or 241? 0.0659 Is 11/37355 at most -2/5? False Is 2782176 < 2782176? False Is 417818 at most as big as 417818? True Do -213965 and -213967 have the same value? False Which is smaller: -1 or 888942? -1 Is -1 less than -43/176? True Which is smaller: -2014/167 or -12? -2014/167 Which is greater: -631/5 or -36? -36 Which is smaller: 3/52342 or 0? 0 Which is greater: -240019 or -240020? -240019 Is -211358 equal to -211363? False Is 82480 greater than 82482? False Which is smaller: -2/539 or 2/69? -2/539 Are 23 and 0.017219 unequal? True Which is smaller: 285 or 0.59? 0.59 Which is smaller: 17/13458 or -1? -1 Is -2/287839 equal to -1? False Are 266838 and 266839 equal? False Which is greater: -2 or -5/36238? -5/36238 Which is bigger: 51/8 or -1196? 51/8 Which is smaller: -0.9 or -1548? -1548 Is 1276 at most 779? False Is -306/239 > -2? True Is 219 at least as big as 49? True Which is smaller: -1 or -35/182474? -1 Which is smaller: -5158 or -5166? -5166 Is -450 greater than or equal to -12/25? False Is -39/7 greater than -229? True Which is smaller: 955 or 329? 329 Are 809 and 816 nonequal? True Is 0 at most as big as -12/417749? False Is 1 smaller than -161/2154? False Which is smaller: -1 or 3/227873? -1 Is -1 not equal to -12/10615? True Which is smaller: 0 or 21/61651? 0 Are 55072 and 220291/4 unequal? True Which is smaller: -53/3 or -1/83? -53/3 Do -1.3 and -106 have the same value? False Are -0.06 and -2580 nonequal? True Which is smaller: 42 or 23366/543? 42 Which is bigger: -59566 or -1/3? -1/3 Which is bigger: 819823 or 819817? 819823 Which is smaller: 83716 or -1? -1 Which is smaller: 411/5 or -196? -196 Which is bigger: -63361 or -126721/2? -126721/2 Which is bigger: -0.15 or 1009? 1009 Is 85151 > 85150? True Is 1911 not equal to 1891? True Is 162338 at least as big as 162341? False Which is bigger: -1/22 or 14320? 14320 Is 30212/9 at most as big as 3356? False Is -8789/6 != -1465? True Which is bigger: 1252160 or 1252158? 1252160 Which is smaller: -182/11 or -18? -18 Is -3 less than 92460? True Which is bigger: 1721/172 or 9? 1721/172 Which is greater: -53508 or -5? -5 Which is greater: -4612 or -4561? -4561 Is 521/26 <= 21? True Which is smaller: -110001 or -110020? -110020 Is 525904/37 less than 14214? True Which is smaller: -22 or 0.8405? -22 Is -115 less than -158? False Which is smaller: -37/10 or -0.825? -37/10 Which is smaller: -2/3 or 55293? -2/3 Which is bigger: -58899 or -294501/5? -58899 Which is bigger: -282113 or -282107? -282107 Is -4 not equal to -2469? True Is 40541/24 greater than 1689? True Which is smaller: -1 or -1/288211? -1 Is 1667 equal to 1537? False Which is smaller: 4306/177 or 23? 23 Is 266380 smaller than 266386? True Do 1585772 and 1585771 have the same value? False Is 25/9 equal to 12/491? False Do -1 and -42/1549 have the same value? False Which is bigger: -59858 or -59872? -59858 Is 137586 > 687937/5? False Which is smaller: 17701 or 17729? 17701 Is 36 at least as big as 244.8? False Is -17378 > 2.11? False Is 72865 less than 5? False Is -427145 bigger than 2? False Which is greater: 21887 or 21889? 21889 Is 102/1927 equal to 1? False Which is smaller: -1 or 4/301159? -1 Which is smaller: 0.2 or 792398? 0.2 Do 3601 and 104402/29 have the same value? False Which is bigger: -6987 or 2/5? 2/5 Which is smaller: -143711/7 or -20531? -20531 Do 0.14322 and 3 have the same value? False Is 0 at least as big as 3/169001? False Which is bigger: 6.37 or -127? 6.37 Is 4455 less than 4756? True Which is smaller: -4016340 or 2/7? -4016340 Which is greater: 19586 or 19582? 19586 Which is greater: 1/1213544 or 1? 1 Which is smaller: -0.2 or -21929? -21929 Is 3044 less than 2824? False Which is smaller: 1 or -6/2827? -6/2827 Does -0.18671 = -2/225? False Is -1 less than or equal to -1/247759? True Is -568580 smaller than -568578? True Is -38138 greater than or equal to -38138? True Which is greater: 19003 or 18977? 19003 Which is bigger: 2.28777 or 2/7? 2.28777 Which is bigger: -5 or -114905.4? -5 Which is smaller: -18/31207 or -1? -1 Which is bigger: -312.84 or 56? 56 Do 1 and -2/988033 have different values? True Which is greater: 357 or 7/3? 357 Is 0 smaller than -8/293369? False Is -1443017/2 less than or equal to -721508? True Which is smaller: -34162 or -34155? -34162 Is 0 <= -179/15737? False Which is smaller: 1434075 or 1434076? 1434075 Is 42530 at most 42526? False Which is bigger: 4964 or 4952? 4964 Which is smaller: 0 or 1/309881? 0 Which is bigger: 23574 or -19/2? 23574 Do -3817 and -3805 have the same value? False Is -1 > -354/7451? False Which is bigger: 33905 or 33906? 3390	{ "pile_set_name": "DM Mathematics" }
7i3)(0 + 3 - 1) as si2 + fi + ci3 + d and give c. -82 Rearrange -2 - 10 - 136b + b*3 + 136b to the form rb3 + k + ib + cb2 and give r. 1 Rearrange -1 + 6p*2 - 9p*2 - 18p2 + p2 to the form j + sp + fp*2 and give j. -1 Rearrange -3n + n - 6n + 2n to in + j and give i. -6 Rearrange -2 - 1 + b2 + 3 + 15b*3 + 2 to yb + sb3 + w + fb*2 and give s. 15 Express -1 - 3c*3 - 2c*3 + 3c*2 + 4c3 - c3 in the form hc3 + a + pc + mc2 and give a. -1 Express -q2 - 16q4 + q2 + 14q4 + (q + 3q - 3q)(-5q3 + 3q*3 + 0q*3) in the form cq*4 + j + fq*3 + aq + pq2 and give c. -4 Rearrange (-3x + 4x - 5x)(1 - 3 + 3)(x*2 + 1 - 1) to rx + ax2 + wx3 + p and give w. -4 Rearrange -i4 - 2i3 + 4i - 6i2 + 11i*2 - 5i*2 to oi*3 + ai*2 + si + z + ti4 and give t. -1 Rearrange (-28s - 31s + 61s)(5 + 3s - 5) to os2 + v + ks and give o. 6 Express (1 - 4 + 1)(d + 0d + d)(4d*2 + 3d - 3d + (-2d*2 + 2d - 2d)(2 - 6 + 2)) in the form c + pd + vd*3 + ld*2 and give v. -32 Express (1 + i - 2i - 2)(161i - 76i - 30i*2 - 83i) as ri + qi*3 + u + ai*2 and give u. 0 Rearrange 12l*2 + l + 4l - 5l to the form vl*2 + cl + y and give v. 12 Rearrange (2w2 + 3w*2 - 4w*2)(-8 + 6 - 255w2 - 15w + 13w) to the form qw*3 + uw + mw4 + kw*2 + a and give k. -2 Express 4k - 2k2 - 4k + (9k2 - 4k*2 - 2k*2)(-3 - 3 + 4) as yk + s + ok*2 and give o. -8 Express (25s - 25s - 38s*3)(2 + 1 - 1) as ds2 + fs + cs3 + n and give c. -76 Rearrange -7d*2 - 12d*4 + d - 2d + 10d4 to yd*3 + ud + p + cd2 + md*4 and give u. -1 Rearrange (g + g + 0g)(4g + 0g - 3g) - g2 - g2 - g*2 + 5g*2 - 6g*2 + 6g*2 to ig + k + zg2 and give z. 4 Express -9u*2 + 6u2 - u3 - u*3 + 2 in the form ou*2 + cu*3 + su + h and give o. -3 Rearrange 3 - 6 + 3 - 3c + 5c*2 to the form oc*2 + v + ac and give a. -3 Rearrange 11b + 3b*2 - 2b2 - b2 + 2b2 to z + qb*2 + cb and give q. 2 Rearrange -50m - 199 + 199 to nm + s and give n. -50 Express -18 + 5 - 17 - 3d2 in the form bd + xd2 + c and give c. -30 Rearrange -4 - 5 + 7 - 30l + 0 to p + rl and give p. -2 Rearrange 27w - 20w + 33w to g + nw and give g. 0 Rearrange (-1 + 3 + 0)((2v - 4v - v)(4v - v - 2v) + 6v*2 - 4v*2 + 2v*2) to the form z + cv*2 + sv and give s. 0 Express -b + 7b - 1 - 10b in the form rb + k and give r. -4 Express (3 + 0 - 4)(2 - w - 2) - w + 0w + 2w - 4w + 21w + 38w in the form l + aw and give a. 57 Express (-3x2 - x2 + 3x*2 + (3x + x - 5x)(2 - 2 + x))(1 + x - 1) in the form tx*2 + nx + wx3 + z and give w. -2 Express 6p2 - p4 - 3p2 + 2p*2 + p - 4p*4 in the form yp*3 + op*4 + u + cp*2 + dp and give d. 1 Rearrange (-4r + 2 - 2)(13 - 13 - 16r3) to nr*2 + pr + cr3 + or*4 + g and give o. 64 Rearrange 2 - 2p + 2p2 + 5p*4 + 8p*4 - 12p*4 to the form b + fp*3 + mp*4 + xp + gp2 and give m. 1 Rearrange -2t - t + 2t + (2t + 0t - t)(5 + 5 - 4) to ct + z and give c. 5 Express (2m + 5 - 5)((5m + m - m)(-1 - m + 1) - 3m*2 + 0m + 0m) as tm + sm3 + q + km*2 and give q. 0 Rearrange -3u4 + u4 + 3u4 + (-11u + 8u2 + 11u)(3u*2 + 2u*2 - 3u*2) to xu*2 + iu*3 + hu + l + tu4 and give t. 17 Express -1605 + 6r + 1605 in the form a + cr and give c. 6 Rearrange -11q2 - q2 + 210q2 + 2q2 - 1 + 1 + 2 - 2 + q2 + (4q - 5q - q)(-1 + 1 + 2q) - 2 + 2q2 + 2 to kq + l + jq2 and give l. 0 Rearrange (4t + 2t2 + 5t*2 - 6t*2)(0 + 0 - 2t2) to wt*3 + zt*2 + ot + r + it4 and give i. -2 Express 7 + 1 + 3s2 - 6 - s4 - 2s2 + s3 as j + as + fs3 + gs*2 + ps*4 and give f. 1 Rearrange (-4u2 + u2 + 4u2)(0u2 - 3u*2 + 8u*2)(0 - 1 - 4) to the form au + yu*4 + vu*3 + d + mu*2 and give y. -25 Rearrange (-30 + 28 - 26)(y*2 - 3y + 3y + (4y - 2y + y)(2y + 0y + 0y)) to the form ly*2 + py + g and give l. -196 Express o2 + o2 - 3o2 + 0o*2 - 3o*2 + 2o*2 + (1 + 2o - 1)(0 - 5o + 0) + 2o2 + 2o - 2o as d + fo*2 + bo and give b. 0 Rearrange 0y3 - 1 - 8y*2 + 30y - 27y - 2y*3 to the form uy*3 + q + cy*2 + jy and give q. -1 Rearrange (5 - 6 - 3t3 + 2t*3)(14t + 416 - 416) to kt + i + zt4 + jt*3 + ct*2 and give k. -14 Express (a + a - a)(-43 + 4a + 43) as ya*2 + ga + c and give y. 4 Rearrange (0 + 1 - 3 - 3 + 2 + 0 - 1 - 5 + 4 + (1 - 4 + 1)(5 - 4 + 0))(5i - i - 2i) to the form r + si and give s. -14 Rearrange (-6h*2 + 2h - 2h)(-3h - 2h + 6h) + (h - 2h + 2h)(0h2 - 4h2 + h2) to the form ch2 + rh + vh3 + n and give v. -9 Express 3q - 2q + 0q + (3q + 0q - 2q)(41 - 65 + 37) as p + nq and give n. 14 Rearrange -c3 + 2 - 2 + (3c*2 - 2 + 2)(3c + 0c + 0c) to dc*3 + uc*2 + f + ic and give d. 8 Express y*4 + 5y*2 - 9y - 8y2 + 2 + 5y*2 - 3y*2 as my*3 + ay*2 + zy + dy4 + j and give z. -9 Rearrange -8z4 + 1 - 1 - z2 + 7z4 + z3 + 3 to kz*3 + i + fz*4 + rz*2 + dz and give k. 1 Express 3p4 + 2p*4 - 11p*4 + (-2p - 1 + 1)(4 - 4 + 2p*3) - p + p - 2p*4 in the form np + q + ip4 + jp*3 + dp*2 and give i. -12 Rearrange (-108u + 10 + 223u - 112u)(-2 + 5u*2 + 2) to the form cu + g + xu3 + wu*2 and give x. 15 Express -78p*2 + 93p*2 - 59p*2 in the form f + zp*2 + kp and give z. -44 Express (33u - 8u - 9u)(-5u + 2u + u*2 + 0u*2) as tu*2 + yu + nu3 + k and give n. 16 Rearrange 2 - 2 - l2 + (-l2 - 6l*2 + 4l*2)(-2 + 4 - 1) to the form c + ql + rl*2 and give r. -4 Rearrange 21 - 14 - 11 + 6j to the form dj + c and give c. -4 Rearrange 3c + c - 3c + (4 - 3 + 0)(c + 2c - 4c) - 4 - c + 4 + 19c - 750 + 750 to s + wc and give s. 0 Rearrange -3 - 23m - m + 3 to rm + b and give r. -24 Express (2i3 + 3i*3 - 3i*3)(3i - i - i)(4 - 7 + 16) in the form ri4 + u + mi*3 + hi + ki2 and give r. 26 Rearrange x2 - 2 + 4 + 6 - 2 to the form vx*2 + m + hx and give m. 6 Rearrange (-11g - 15g*2 + 11g)(-4g*2 + 5g*2 - 3g*2) to the form ug*4 + mg*2 + vg*3 + ig + q and give v. 0 Express (-21 + 15z + 23 - 6z)(6 - 4 + 0) as kz + d and give d. 4 Express 6p + 3p*2 - 6p + (3p + 2p - p)(2 + p - 2) in the form q + bp*2 + zp and give b. 7 Rearrange 3x2 + 7x*3 - 3x*3 - 5x*4 + 0x*2 + 3x*4 to the form o + ax + vx2 + ux*3 + bx*4 and give v. 3 Express (-1 + 5c + 1)(c - 2 + 2 + 26c) in the form wc2 + u + oc and give u. 0 Rearrange -3o - 4o - 6o + 2o to v + fo and give f. -11 Rearrange 1739 + 62g - 868 - 871 to b + mg and give m. 62 Rearrange 6 - 6 - 13p to the form i + cp and give c. -13 Rearrange 0b*2 + 25b - 8b3 + 0b*2 - 23b to the form nb + u + tb*3 + ob*2 and give n. 2 Express 47p*3 - 2p*2 + 0 + 3p*4 + 2p - 46p3 - 1 in the form mp*4 + np + q + hp3 + tp2 and give h. 1 Express (-w4 - 1 + 1)(3 + 0 - 4) + 5w*4 - 2w*4 + 0w*4 - 3w*4 + 4w*3 + 5w*4 + 5w*3 as u + tw*2 + vw + jw4 + kw*3 and give j. 6 Rearrange (1 - 6 + 4)(0l + 0l + 2 - l) to the form d + vl and give d. -2 Express (3d + 0d - 4d)(1 - 1 + 2) + (-d - 2d + d)(-4 + 1 - 1) as u + kd and give k. 6 Express (2 + 1 - 2)(-8 + 2 - 49)(2r - r + 0r + (3r + 2r - 6r)(-2 - 1 + 2)) as hr + f and give h. -110 Express -7q - 11q + 10q as xq + v and give v. 0 Rearrange -26 + 2y*4 - 2y3 + y3 + 30 - 3y2 - 4y*4 to u + by + gy2 + ty*3 + iy*4 and give t. -1 Express (0h - 2h + 0h)(5 + 0 - 6) - 10 - 2 - 2 + h + (-2 + 4 - 4)(-2h + 0h + h) in the form mh + s and give s. -14 Express 13j - j*4 + 0j*4 - 201j*3 + 2 + 200j*3 as kj + h + bj2 + xj*3 + wj*4 and give h. 2 Express (-3 + 3u + 3)(20 + 27 - 11)(-5u3 + 2u3 + u3) as ru4 + mu*2 + xu*3 + l + ju and give r. -216 Rearrange 22 + 6z4 - 23 + 4z*4 + 2z*2 + 7z*4 to the form qz*2 + jz*3 + rz*4 + sz + x and give r. 17 Rearrange (-91p + 191p - 99p + (2 - 2 + p)(4 - 2 -	{ "pile_set_name": "DM Mathematics" }
divided by g. 11 Calculate the remainder when 0 + 61 - 20/(-10) is divided by 32. 31 Suppose 0 = -7l + 9l - 248. What is the remainder when l is divided by 18? 16 Let t = 48 + -24. Let s = -14 + t. What is the remainder when 17 is divided by (1 - 1) + s - 1? 8 Suppose 2x + 5x - 161 = 0. Calculate the remainder when x is divided by 8. 7 Suppose -2y = -7y + 3m + 257, -m = -4y + 207. What is the remainder when y is divided by 14? 10 Suppose -2s = -3i - 20, -s + i - 1 = -10. What is the remainder when 45 is divided by s? 3 Suppose 6s - 281 = -5r + 3s, s - 287 = -5r. Let u = -7 - -22. What is the remainder when r is divided by u? 13 Let w = 18 - -39. Calculate the remainder when w is divided by 20. 17 Let k = 18 + -11. Suppose 3c - kc = -16. Calculate the remainder when 14 is divided by c. 2 Suppose -14 = -3r - 5. Suppose 175 = rk - 2. What is the remainder when k is divided by 20? 19 Suppose -a + 21 = -5m, -a + 6a - 126 = 4m. Suppose -5i - 3g + 0 = -79, -2i + 16 = -4g. What is the remainder when a is divided by i? 12 Let u = -366 + 657. What is the remainder when u is divided by 49? 46 Suppose 5a = 2q - 3, 2q + 0a - 4a - 4 = 0. Suppose 0 = 5u + 3o - 20, u + qu = o. What is the remainder when u is divided by 1? 0 Let l(q) = q + 15. What is the remainder when 40 is divided by l(6)? 19 Calculate the remainder when 23 is divided by ((-3)/(-3))/(-3 - 37/(-12)). 11 Let i be 11/1-7. Let n(a) be the third derivative of -5a4/24 - a3/3 + 3a2. Calculate the remainder when n(i) is divided by 9. 6 Suppose -m + 2 + 2 = 0. Suppose -v = -2v - p - m, 4v + p = -10. Let w(a) = -9a + 2. Calculate the remainder when 59 is divided by w(v). 19 Suppose -2a - 4v + 74 + 34 = 0, -5a + 4v = -242. Suppose 0 = -0l - 5l + a. Let f = -14 + 42. Calculate the remainder when f is divided by l. 8 Let l = -16 + 37. Calculate the remainder when 103 is divided by l. 19 Let v be (-6 + 1)6/5. Let d = v + 17. Calculate the remainder when d is divided by 4. 3 Let r(m) = -2m - 9. Let k(w) be the third derivative of -w6/120 + w5/20 + w*4/4 - 5w*3/6 + 2w*2. What is the remainder when r(-6) is divided by k(4)? 0 Suppose -4s + 0s = -44. Calculate the remainder when 64 is divided by s. 9 Suppose -4r + 5z = -10, -3r - z = -0z - 17. Calculate the remainder when 11 is divided by r. 1 Let k = 64 + -46. What is the remainder when k is divided by 5? 3 Let k(l) = l3 + 3l*2 - 7l. What is the remainder when 95 is divided by k(-4)? 11 Let g = -53 - -75. Suppose 4v - 122 + 49 = -3x, -2x + 44 = 5v. Suppose -x = -2c - 11. Calculate the remainder when g is divided by c. 6 Let s be 12 - (0 + 3)1. Suppose -110 = -sf + 4f. Suppose -4w = -47 - 1. What is the remainder when f is divided by w? 10 Suppose 0 = 3d + 2d - 65. Let i be (-1 - 98/2)-3. Suppose 40 = 5u - i. Calculate the remainder when u is divided by d. 12 Let g(p) = 42p*2 + p - 2. Let h be g(1). Suppose 2j = -2a - 9 + h, -5j + 56 = -3a. Calculate the remainder when j is divided by 8. 5 Suppose 3d - 79 = -4r, 4r = 3d + 12 + 61. Suppose 5c - 64 = 3c. Suppose -4u + 4f + c = 0, 3f = 7 - 1. Calculate the remainder when r is divided by u. 9 Let c(t) = 10t - 6. Let o be (5/10)/((-2)/(-24)). What is the remainder when c(o) is divided by 19? 16 Let l(h) = h3 + 11h*2 + 10h - 3. Let b be l(-10). Calculate the remainder when 15 is divided by 3/(-2)16/b. 7 Let f(s) = -6s + 13. Let y(l) = 2l + 5. Calculate the remainder when f(-6) is divided by y(6). 15 Let v = 49 - 187. Calculate the remainder when v/(-18)6/2 is divided by 13. 10 Suppose d = 4n + 5, 4n = -6d + 3d + 95. Let g(k) = k + 4. Calculate the remainder when d is divided by g(5). 7 Let i = 68 - 34. What is the remainder when i is divided by 12? 10 Let y(o) = -o*2 + 7o - 4. Let b be y(6). Calculate the remainder when 13 is divided by (7/(-2))/((-1)/b). 6 Let i = 0 + 1. Suppose d - 6 = j + 2j, -4d + 13 = -j. Calculate the remainder when d is divided by i. 0 Let f(z) = 24z2 - 3z + 1. What is the remainder when f(2) is divided by 31? 29 Let h(b) = -2b + 2. Let u be h(-7). Suppose 4l + 24 = 5r, 3r + 5l = 28 + u. What is the remainder when 29 is divided by r? 5 Let h(v) = 2v*2 - 2v + 7. Suppose 867 = 34o - 187. What is the remainder when h(-6) is divided by o? 29 Let j(q) = -q. Let g be j(1). Let p(z) = -z3 + 8z*2 - 7z + 8. What is the remainder when g/((1-2)/30) is divided by p(7)? 7 Let j(c) be the third derivative of 0c - c*3 - 3c*2 - 1/4c*4 + 0 + 1/60c*5. What is the remainder when 28 is divided by j(8)? 8 Let j = 42 - 28. Calculate the remainder when 25 is divided by j. 11 Suppose -d - 5t = -1, -d - t = -3t - 1. Let b be d/244/(-1). Let j = 32 + b. What is the remainder when 18 is divided by j? 8 Let h = -40 + 61. Let n = 15 - h. Calculate the remainder when (-456)/(-18) + 2/n is divided by 14. 11 Suppose 2h = -h + 174. Calculate the remainder when h is divided by 20. 18 Let a(f) = -87f - 1. Let p be a(-1). Calculate the remainder when (4 - p)(-2)/4 is divided by 14. 13 Suppose 12s - 9s - 18 = 0. Calculate the remainder when s is divided by 4. 2 Let d = -23 + 29. Suppose -4f - 1 = 5w, -2w + 4f + 0 = 6. Calculate the remainder when 2 + w + 52 is divided by d. 5 Let p(d) = 8d2 - 4d + d3 + 1 - d3 - d3. Calculate the remainder when p(6) is divided by 17. 15 Let m(u) be the third derivative of -u5/60 + 5u4/24 - u3/2 + 2u*2. Calculate the remainder when 1/6 + 10/12 is divided by m(4). 0 Let p = 32 + -50. Let g = p - -35. Suppose -n + 4t = 10, -5n + 22 = -3t + t. Calculate the remainder when g is divided by n. 5 Let d(l) = -l + 9. Let x(q) = q*3 + 6q*2 + 6q + 7. Let f be x(-5). Suppose -fy - 27 = -5y. Calculate the remainder when d(-7) is divided by y. 7 Let b = 17 + -10. Calculate the remainder when 11 is divided by b. 4 Calculate the remainder when 14 - (-8 + 4 - -1) is divided by 5. 2 Suppose 21 = 18o - 11o. Let b = 11 - 2. Calculate the remainder when b is divided by o. 0 Let t(p) = -p*3 - 15p*2 - 12p + 18. Let n be t(-14). Let j = 63 + n. What is the remainder when j is divided by 14? 11 Suppose 0 = -3i + 2q + 52, 3i + 4q - 59 - 17 = 0. Suppose 9 = 4d + 1. Suppose u = -du + 21. What is the remainder when i is divided by u? 6 Let g = -3 + -32. Let c = -21 - g. Suppose 0f - 2f - 12 = -3b, 3f = -4b + 16. What is the remainder when c is divided by b? 2 Suppose a - 4a = -4c - 87, 116 = 4a - 5c. What is the remainder when a is divided by 11? 7 Let n(x) be the third derivative of x5/60 - x4/6 - 5x3/3 + x2. Calculate the remainder when 19 is divided by n(7). 8 Let m(g) = 12g2. Let f be m(-1). What is the remainder when 202/f + (-3)/(-18) is divided by 10? 7 Calculate the remainder when 64 is divided by ((-99)/45)/((-2)/10). 9 Let z be 4/(-6)(-6)/(-4). Let q(s) = 21s2 - s. Let i be q(z). Let v = -13 + i. What is the remainder when 17 is divided by v? 8 Let u = 5 - 0. Let o(i) = -i3 + 4i*2 + 7i. Let l be o(u). Suppose z + 5 = l. What is the remainder when z is divided by 2? 1 Suppose 0 = -n + 3p + 2p - 7, -2p = -8. Calculate the remainder when n is divided by 8. 5 Let v = 66 + -51. What is the remainder when v is divided by 8? 7 Let k = -20 + 33. Let r be (50 - 0)/((-2)/(-1)). Suppose -11 = 2m - r. What is the remainder when k is divided by m? 6 Let t(u) = u*2 + 11u + 13. What is the remainder when 48 is divided by t(-11)? 9 Suppose -4n + 21 = 3s - 59, 4s - 3n = 115. Suppose -s = -5d + d. What is the remainder when 25 is divided by d? 4 What is the remainder when 28 is divided by (-2 + 0)(-195)/26? 13 Let y = 344 + -246. What is the remainder when y is divided by 26? 20 Suppose -1 = k - 5. Suppose k = -m + 37. Suppose -20 = -4f, 2q - q - 4f = -11. What is the remainder when m is divided by q? 6 Suppose x = -x + 10. Suppose -xh + 113 = 3. What is the remainder when 84 is divided by h? 18 Let r(v) = -v*2 + 2v - 8 - 5v - 5v. Let j be r(-6). Suppose -35 = -2w - 5b, jb = -2w + 5b + 17. What is the remainder when 28 is divided by w? 8 Let g be ((-28)/16)/((-2)/264). Suppose 139 = 3q - i + 3i, 0 = -5q - 4*i + g. What is the remainder when q is divided by 12? 11 Suppose f	{ "pile_set_name": "DM Mathematics" }
hout replacement from rxmtrcj? 2/21 Three letters picked without replacement from {i: 2, d: 3, y: 1, a: 1, k: 1, e: 4}. What is prob of picking 1 d, 1 i, and 1 k? 3/110 Two letters picked without replacement from hhh. Give prob of picking 2 h. 1 What is prob of picking 2 o when two letters picked without replacement from ooo? 1 Calculate prob of picking 1 q, 1 w, and 1 d when three letters picked without replacement from qdvwydqvp. 1/21 What is prob of picking 3 i and 1 d when four letters picked without replacement from iiidiiddiddii? 56/143 What is prob of picking 1 v and 1 u when two letters picked without replacement from vuqvkvk? 1/7 Calculate prob of picking 2 v when two letters picked without replacement from {f: 6, v: 7}. 7/26 Two letters picked without replacement from iisjvvjkiojjiis. Give prob of picking 1 v and 1 s. 4/105 Two letters picked without replacement from {d: 2, n: 1, y: 2, i: 1, s: 2}. Give prob of picking 1 d and 1 y. 1/7 Two letters picked without replacement from vllivivv. Give prob of picking 2 i. 1/28 Three letters picked without replacement from {b: 14, h: 4}. Give prob of picking 2 h and 1 b. 7/68 Three letters picked without replacement from nngnngngnnggngnnnnn. Give prob of picking 3 n. 286/969 What is prob of picking 2 s when two letters picked without replacement from muhssusumpmsmshm? 1/12 Four letters picked without replacement from {e: 2, u: 2, v: 2, b: 2}. Give prob of picking 2 b and 2 e. 1/70 What is prob of picking 1 c, 1 i, and 1 b when three letters picked without replacement from {o: 4, b: 4, c: 1, i: 2}? 8/165 What is prob of picking 2 e when two letters picked without replacement from {v: 2, e: 2, x: 2}? 1/15 Calculate prob of picking 1 a and 3 g when four letters picked without replacement from ggdyagl. 1/35 Calculate prob of picking 1 e, 1 h, and 2 m when four letters picked without replacement from {e: 1, u: 4, v: 2, m: 8, h: 2, g: 2}. 14/969 Three letters picked without replacement from hhhkukphhuhrhhhrkhk. Give prob of picking 1 u, 1 h, and 1 p. 20/969 What is prob of picking 1 t and 3 g when four letters picked without replacement from {t: 1, g: 3}? 1 Two letters picked without replacement from {s: 1, e: 2, l: 9, b: 1}. What is prob of picking 1 e and 1 b? 1/39 Two letters picked without replacement from hkdddhddhphddkkg. What is prob of picking 2 p? 0 Two letters picked without replacement from {y: 2, k: 1, m: 1}. What is prob of picking 1 y and 1 k? 1/3 Four letters picked without replacement from xxooccccxcccccccrcc. Give prob of picking 1 o, 1 c, 1 r, and 1 x. 13/646 Four letters picked without replacement from awogowabagwagbbboow. Give prob of picking 2 o and 2 b. 3/323 What is prob of picking 1 s and 2 a when three letters picked without replacement from {u: 2, s: 1, f: 3, a: 12, v: 2}? 11/190 Calculate prob of picking 3 z when three letters picked without replacement from zzzzzzzzz. 1 Four letters picked without replacement from {t: 1, j: 1, g: 2, x: 1}. What is prob of picking 1 x, 1 t, and 2 j? 0 Calculate prob of picking 1 q and 1 x when two letters picked without replacement from hqluyxy. 1/21 What is prob of picking 1 j and 1 u when two letters picked without replacement from {l: 3, u: 1, n: 1, j: 2}? 2/21 Calculate prob of picking 1 b and 1 x when two letters picked without replacement from {l: 5, a: 9, x: 1, b: 1}. 1/120 Four letters picked without replacement from {z: 1, g: 1, p: 4, t: 3, h: 6}. What is prob of picking 1 p, 1 t, 1 g, and 1 h? 24/455 Three letters picked without replacement from aaapalaffapauaalaaa. Give prob of picking 2 l and 1 f. 2/969 What is prob of picking 2 j, 1 u, and 1 s when four letters picked without replacement from {w: 1, y: 3, u: 6, s: 2, j: 5}? 6/119 Four letters picked without replacement from zkbvkbbbvvkvvbhk. What is prob of picking 1 v and 3 k? 1/91 Calculate prob of picking 4 r when four letters picked without replacement from rrrrfrrrrrrrrrrrrrr. 15/19 Calculate prob of picking 3 f and 1 l when four letters picked without replacement from {f: 4, c: 1, h: 4, l: 1}. 2/105 What is prob of picking 3 h when three letters picked without replacement from {z: 2, h: 3, t: 3}? 1/56 Three letters picked without replacement from {u: 1, d: 5, m: 2, e: 1, q: 1}. What is prob of picking 1 m, 1 e, and 1 q? 1/60 Three letters picked without replacement from iiiiiii. What is prob of picking 3 i? 1 What is prob of picking 1 r and 1 z when two letters picked without replacement from eerrrrrzerelrelr? 1/15 What is prob of picking 1 j and 2 f when three letters picked without replacement from fjjffffejefjee? 15/91 Three letters picked without replacement from umcmmmucm. What is prob of picking 2 m and 1 c? 5/21 What is prob of picking 1 s, 1 r, and 1 o when three letters picked without replacement from {r: 5, o: 7, s: 1, y: 6}? 35/969 Two letters picked without replacement from {q: 2, f: 1, j: 1, n: 1}. What is prob of picking 1 n and 1 f? 1/10 Two letters picked without replacement from {o: 3, l: 1, h: 4}. Give prob of picking 1 o and 1 l. 3/28 What is prob of picking 4 q when four letters picked without replacement from {q: 9}? 1 Two letters picked without replacement from dssssddsdlsls. What is prob of picking 2 l? 1/78 Two letters picked without replacement from {q: 2, n: 4}. Give prob of picking 1 q and 1 n. 8/15 Calculate prob of picking 2 j when two letters picked without replacement from djdjcjoj. 3/14 What is prob of picking 1 k and 1 v when two letters picked without replacement from vkv? 2/3 What is prob of picking 1 c and 1 r when two letters picked without replacement from {c: 3, r: 5, i: 3, a: 9}? 3/38 Two letters picked without replacement from eoccccccececceeec. Give prob of picking 2 c. 45/136 What is prob of picking 2 x and 1 m when three letters picked without replacement from mmqqnqqqnxmqx? 3/286 Two letters picked without replacement from {n: 1, q: 1, a: 2, e: 3, j: 3, d: 2}. Give prob of picking 1 j and 1 d. 1/11 What is prob of picking 1 u, 2 h, and 1 n when four letters picked without replacement from {h: 2, n: 1, u: 4}? 4/35 Two letters picked without replacement from {q: 3, t: 2}. Give prob of picking 2 q. 3/10 Calculate prob of picking 2 k when two letters picked without replacement from ywykkkykkgxxxkkx. 7/40 Four letters picked without replacement from {h: 5, d: 1, l: 2, z: 3, v: 1, b: 1}. Give prob of picking 1 d, 1 v, 1 l, and 1 z. 6/715 What is prob of picking 3 v and 1 f when four letters picked without replacement from vvvvvvfffvvff? 56/143 Two letters picked without replacement from {n: 2, c: 4, v: 5, k: 2}. Give prob of picking 2 k. 1/78 Four letters picked without replacement from rwrxcyccxwqc. Give prob of picking 1 q, 1 y, 1 w, and 1 x. 4/495 What is prob of picking 2 e when two letters picked without replacement from hhheeeeehehee? 14/39 Four letters picked without replacement from bmbjbjrbbbjbbjrbb. Give prob of picking 2 r, 1 j, and 1 b. 2/119 What is prob of picking 4 g when four letters picked without replacement from gfffgggagagg? 7/99 Calculate prob of picking 2 n when two letters picked without replacement from xnzxzzxxznxnxxnxx. 3/68 What is prob of picking 1 p and 1 b when two letters picked without replacement from {q: 1, b: 1, p: 1}? 1/3 Calculate prob of picking 1 k and 3 u when four letters picked without replacement from uknnutukun. 4/105 Three letters picked without replacement from illliliilrr. Give prob of picking 1 l, 1 r, and 1 i. 8/33 What is prob of picking 1 n and 1 e when two letters picked without replacement from nefnffzfffnenfnnnn? 16/153 Three letters picked without replacement from {j: 1, h: 1, z: 1, f: 1, k: 1, w: 2}. What is prob of picking 1 j, 1 z, and 1 f? 1/35 Four letters picked without replacement from yyhvhyhyyd. Give prob of picking 1 h, 1 v, 1 y, and 1 d. 1/14 Three letters picked without replacement from {w: 6, x: 3, r: 4}. What is prob of picking 3 w? 10/143 What is prob of picking 1 w and 1 k when two letters picked without replacement from {k: 2, w: 1, x: 2, b: 1}? 2/15 Calculate prob of picking 1 t, 1 s, and 1 e when three letters picked without replacement from {q: 2, t: 1, o: 1, d: 1, e: 1, s: 2}. 1/28 Two letters picked without replacement from bscasc. What is prob of pic	{ "pile_set_name": "DM Mathematics" }
Expand (0r - r + 2r)(160 + 525 - 128) + r + 4r - 2r. 560r Expand (2d + 3 - 3)(2 + 1 + 0)(-40d*2 + 23d*2 + 14d + 18d2 + 2). 6d*3 + 84d*2 + 12d Expand -11y - 2y - 3y + (-4y + 0y + y)(2 - 2 - 2) - 3y + 3y + 2y. -8y Expand (2 - 2 - 2h)(-1 - 2 + 1) - 4h - 5h + 0h + 0h - 3h + 5h - h - h + h. -4h Expand (-4y + 3y2 + 4y)(-2y*2 + 2y2 - y3) + 6y - 6y - 2y5 - 264y*5 + 40y5 + y4 + 8y5. -221y5 + y4 Expand (0f2 - 5f2 + f2)(8 - 8 + 2f*2 + 2f). -8f4 - 8f*3 Expand (7k + 2k - 4k)(51k + 52 - 52)(2 - 1 + 2). 765k*2 Expand -2r*2 - 5r2 - r2 + (-4r + r + 0r)(-2r + 0r + 7r). -23r2 Expand -6h + 0h + 25h + (0h + 4h - 3h)(1 - 2 + 6) + (-2h + 1 - 1)(-2 - 3 + 4). 26h Expand (0h*5 + 4h*5 + 12h*5)(15 + 0 - 4). 176h5 Expand (5 - 5 - 6s)(-927 + s + 493 + 491). -6s*2 - 342s Expand -226t4 - 76t*4 + 74t*4 + (3t*3 - 5t*3 + 3t*3)(-2 + 2 - t) + (0 + 0 - 1)(-t4 + 3t*3 - 3t*3). -228t*4 Expand (-4v*2 - 7 + 7)(-2 + 10 + 6)(0 - 1 - v + 0). 56v*3 + 56v*2 Expand -4 + 0f + 2 - f + 2f + 2 - 2 + (-2 + 3 - 2)(-f + 2f - 2f). 2f - 2 Expand 18o*4 - 3o*4 - 9o*4 + (-o + 0o + 3o)(-4o3 + 4o*3 + 2o*3) - 9o*4 - 7o + 7o. o4 Expand s3 - 2s + 2s + (s2 + 0s + 0s)(-4s + 3 - 3) + 34s*2 - 9s*3 - 34s*2. -12s*3 Expand (0f*2 - 2f2 + f2)(1 - 1 + f) - 3350f*3 + 7f - 3340f3 + 6684f*3. -7f*3 + 7f Expand 6v2 + 2v*2 - 2v*2 + (3 - 4 + 3)(2v2 + 2v*2 - 5v*2) + 5v*2 + 8v*2 - 6v*2. 11v*2 Expand (-7 + 8 + 7 + (-1 + 2 + 2)(0 + 4 - 2))(-2i*2 + 12i*2 + 3i*2). 182i*2 Expand (-6k3 + k3 + 3k3)(998 - 376 + 996 + 1143 - 409). -4704k3 Expand 37h*2 + 24h*2 - 18h*2 + (-h - h + 5h)(-7h + 9h + 6h). 67h2 Expand (2i - 3i + 0i + 3)(40 - 40 + 10i*2). -10i*3 + 30i*2 Expand (k - k + 2k*5)(1 + 0 - 2) + (k*5 - 2k*5 + 0k*5)(105 + 66 - 29) + 2k2 - 2k*2 + 2k*5. -142k*5 Expand (-d + 3d + d)(54d - 26d + 32d). 180d2 Expand (-2r + 0r + r)(-7 - 6 + 4)(-12r3 + r3 + 2r3). -81r*4 Expand (-4i - 2i + 0i)(17i*2 - 86i + 84i + 1 + 1 + (0i*2 - 6i*2 + 4i*2)(-2 + 3 + 1)). -78i3 + 12i*2 - 12i Expand 2q3 + q2 - q2 + (-3 + 3 - 1)(0q3 + 3q*3 - 2q*3) + 9q*3 - 21 + 21 + 31q*2 - 31q*2 + 2q*3 - 2q. 12q3 - 2q Expand 0m + 0m - m4 + (-m2 + 17m2 + 0m*2)(-m2 - m2 + 4m2) - 11m*4 - 83m*3 + 83m*3. 20m*4 Expand -2h*4 + 2h - 2h - 4 + h4 + 4 + (-3h*3 - 2h*3 + 6h*3)(-4h + h + 4h) + (1 - 1 + 2h3)(183h + 59h + 15h). 514h*4 Expand (-4t - 4t + 3t)(-171 + 37 + 0)(-3 + 6 - 2). 670t Expand (0 - 2 + 0 + i)(i*4 + 4i - 4i - i4 - i3 + i3 - 6i4 + i4 + 3i4 + (1 - 2i - 1)(-i + i - 2i*3) + 4i*4 + 3i4 - i4). 8i5 - 16i*4 Expand 4 - 12n*3 - 4 - 3n*3 - 4 + 4 + (-2n*2 - n + n)(0n + 0n + 2n) + n3 - 3n*3 + 0n*3 - 2n*3 + 2n*3 + 2n*3. -19n*3 Expand 313d*2 - 155d*2 - 163d*2 - 5d2 + d2 + 3d2 + d2 - 4d*2 + 4d*2 + (0d - d - d)(1 - d - 1) + d2 + 0d*2 + 0d*2. -2d*2 Expand (21u*3 - 21u*3 - 17u*5 + (-4u2 - u3 + 4u2)(-2u2 + 1 - 1))(0 - 2 - 3)(-7 + 3 - 7). -825u*5 Expand -793t*3 + 34t*5 + 2t + 793t3 + (-3t5 - t5 + 0t5)(0 + 3 - 1) - t*5 + 2t5 + t5. 28t5 + 2t Expand (-2 + 2 + r)(0r + 0r - 2r) + 39r - 39r - 2 - 14r2 + 2r*2 + 1 - 1 + (1 - 1 - r)(0r + 4r - 3r). -15r*2 - 2 Expand (-z + 1 - 1)(0z2 + 4z*2 - 3z*2) - 1 - 12z*3 + 1 + 0z + 0z - 2z*3 - 2z*3 + 7z*3 + 4z*3. -6z*3 Expand 1 + 2u*2 - 7u*3 + 3u*3 + 6u*3 + (6u + 0u - 4u)(u2 - 4u*2 + 0u*2). -4u*3 + 2u*2 + 1 Expand (4m - m - m + (6 - 2 - 2)(2 - 2 - 3m))((-5m - m + 3m)(-4 + 1 + 2) - 4m + 5 - 5). 4m*2 Expand (-5r + 2r + r)(-221r - 1 + 179r + 144r). -204r*2 + 2r Expand -3z + 6z - 9z + 0z + 2z + 0z + (-1 - 2 + 1)(-z - z + 4z) + 6 - 6 - 3z. -11z Expand (0v - v + 0v)(170 - 30 + 27). -167v Expand (-2a + 2a - 3a)(172 - 358a2 - 172). 1074a*3 Expand (2h + 0h - 3h)(0 + 0 + 2)(-2h2 + 4h*2 - 3h*2)(12 + 9h2 - 12). 18h*5 Expand (-2i*2 + 4i*2 - 4i*2)(-5i + 3i - 3i)(1 + 5i - 1). 50i*4 Expand 5 - 5 + 2y*3 + 2y*3 - 2 + 2 + (0y - y + 4y)(y2 - y2 + y*2) + (4 + 0 - 5)(-2y3 + 0y*3 + 4y*3) + 4y*2 - 4y2 + y3. 6y3 Expand (-x3 + 0 + 0 + (-6x + 6 - 6)(x2 + 2x2 - x2))(-6x*2 + 26x*2 + 29x*2). -637x*5 Expand (13x + 2x - 5x + 1 - 8x)(19x - 8x - x). 20x2 + 10x Expand (-13 + 42 + 13)(d2 - 14d*3 + 6d*3 + 6d*3). -84d*3 + 42d*2 Expand (1 + 3 - 7)(4i - 7i + 24i)(-i + i - i). 63i2 Expand 49z*5 - 33z*5 + 124z*5 + 4z + 2z5 - 4z + (-z*4 - 4z*4 + 4z*4)(-2z + 1 - 1) - 2z*5 + 2z*5 + 2z*5. 146z*5 Expand (2 - 1 - 2)(-3g4 + 2g*4 + 3g*4) + 3g*2 - 1060g*4 + 2116g*4 - 1067g4 + g3. -13g4 + g3 + 3g*2 Expand (-5 + 0 + 4)(-2k + 4 - 4)(-k3 - k3 + 5k3) - 10k*2 - 8k*2 - 13k*4 + 19k*4. 12k*4 - 18k*2 Expand -5p*5 + 3p*4 - 3p*4 + 2p5 + p5 + 0p5 + (-2p*2 + 4p2 - p2)(-4p3 + p3 - 4p3). -9p*5 Expand 4i*5 - 4i*5 - 2i*5 + (-4 + 3 - 1)(-5i5 + 3i*5 + 3i5) - i5 - 2i5 + i5 + 182798i*4 + 3 - 182792i*4 - 3i*5 - 7. -9i*5 + 6i*4 - 4 Expand (-9 - 2y*2 + 9)(-1 - 47 - 27). 150y2 Expand (-5o + 5o - 2o)(-6o*2 + 24 - 24) + 44o - 44o - 3o*3. 9o*3 Expand (17m + m*4 - 22m + 12m)(47 - 47 - 11m). -11m*5 - 77m*2 Expand -3d*2 - 6 + 6 + (-3d + 4d - 3d)(-2 - 2d + 2) - 5d2 + 11d*2 + 30d*2. 37d*2 Expand (5l + 0l - 3l)(2 + 6 + 2)(22l - 10l + 60l). 1440l*2 Expand (0 + 1 - 3)(-118z - 6z2 + z2 + 111z). 10z*2 + 14z Expand 13t + 95t - 19289 + 10t + 19284 + (1 - 5 + 2)(-t - 3t + 2t). 122t - 5 Expand (-1 - 2 + 2)(2 - 2 + 2)(0s - s + 0s + (2s + 2 - 2)(3 - 4 - 1) - 69 + 4s + 69). 2s Expand (4 + 0 - 3)(173p + 202p - 118p + (-4 + 2 + 0)(-2p + 3p - 3p) - p - 2p + 2p). 260p Expand (2p - 3p + 0p)(-4p + 0p + 3p) + 4 + 2p2 - 4 - p2 - p*2 + 3p*2 + (-3p + 0p + 0p)(-2p + p - 11p). 40p*2 Expand (-2x - 1 + 1)(3491 - 46x*3 - 3491) - 2x4 + x - x + 0 + x4 + 0 + (-2x2 - x2 + x2)(3x + x2 - 3x). 89x4 Expand (20q + 0q + q)(2 - 8 + 1)(4q + 6q - q). -945q*2 Expand (2a3 + a3 + a*3 + (-2a*2 + 0a*2 + 0a*2)(-a - a - a))(-3a*2 - 4a*2 + 3a*2). -40a*5 Expand ((-5 + 2 + 1)(-5 + 2 + 2) - 8 + 7 + 16)(2a - 7a + 4a). -17a Expand -3 + 3 + 2n + (-4 + 4 - 6)(0n + 3n - 5n) - 4n + 4n - 2n + (-5 + 5 + 3n)(-3 + 0 + 1). 6n Expand ((2o2 + 3o*2 - 3o*2)(-2 + o + o + 6) + 2o3 - 3o*3 + 3o*3)(9o - 3o*2 - 9o). -18o5 - 24o*4 Expand (-1 + 2s*2 + 1)(-276s3 + 6s - 127s3 - 6s). -806s5 Expand 5f - 3f + 6f*4 - 7f*4 + 3f*3 - 75f*3 + 75f*3 + 51f4 + (-f3 - 2f3 + 2f*3)(-4 + 4 + 2f). 48f*4 + 3f*3 + 2f Expand (-3o2 + 3o2 + o2 + o*2 + 0o*2 + 0o*2 + (-o + 0o - o)(3o + 0o + 0o))(-6 - 3 + 1). 32o*2 Expand (0k - 3k + k)(-2 - 1 + 2)(-29k - 4k2 + 29k) - 6k3 - 3k + 3k. -14k*3 Expand -3j*2 - 9j*4 + 14j*2 + 2j*3 + 7j*4 + (-7j + 2j + 3j)(3j3 + j3 - 2j3). -6j*4 + 2j*3 + 11j*2 Expand (-6g + 2g + 2g)(-g + 5g - 2g)(-233765 + 1150g + 233765). -4600g*3 Expand (-u - 5 + 13 - 3u)(-5 + 3 + 6). -16u + 32 Expand -m - 4m + 4m - 78 + 78 - 12m + (-1 + 2m + 1)(2 - 3 - 2) - 2m + 4 - 4 + 148m - 59m - 32m. 36m Expand -3j4 - 3j*4 - 4j*4 + (-3 + 3 - 1)(-5 + 2j4 + 5) - j4 + j4 + j4. -11j*4 Expand (2z*3 - 2z*2 + 2z*2)(14218z + 17z*2 - 14218z) + (2z2 - 1 + 1)(-z*3 - 3 + 3). 32z*5 Expand -3c2 + c2 + c*2 + (4c + c*2 - 4c)(1 - 1 + 1) - 3c*2 + 0c*2 + 4c*2 + ((3c - 3c - 2c)(0c + 6c + 6c) - 2 + 2 - 2c2)(7 - 3 - 3). -25c2 Expand (-2 + 5 - 1)(-33 + 70 + 24)(-p4 + 0p4 - p4). -244p4 Expand (0y + 2y - y)(-116y + 32 - 32)(-y**2	{ "pile_set_name": "DM Mathematics" }
d))/d)/d)/d)/d))(-1/10))8 assuming d is positive. d(-2188/1155) Simplify (k/k(2/7))43/(k/k(-3))46 assuming k is positive. k(-1073/7) Simplify ((((xx/(xxx(-2)x))/xx)/x)/x(1/4))/(x/((x/(x/(xx/x*(-1/5))))/x)x*(2/31)x) assuming x is positive. x(-691/620) Simplify ((m/(m/m(-16)))20)(-6/23) assuming m is positive. m*(1920/23) Simplify (((uu(2/29))/u(2/11))(-8/5))(-11/2) assuming u is positive. u(1132/145) Simplify ((m14m(4/19))(-21))(11/3) assuming m is positive. m(-20790/19) Simplify (((bb*3b)/(b/(b*(-1/4)b)b))/(bb*6/bb*5b))(-35) assuming b is positive. b(1155/4) Simplify (mm(1/18)mmm)/m(m/(m/(mm*13/m)))/mmm/(m/(m/(mm*(5/2)m)))mmm/m16m assuming m is positive. m(5/9) Simplify d(-4/3)d(-22)d17/(d/d(-9)) assuming d is positive. d*(-49/3) Simplify ((jj*34)/(jj(-2/37)))(11/4) assuming j is positive. j*(3465/37) Simplify (jjj/(jj*(9/7))j)*(-4/21)(j*(-2/13)jj)/j(-2) assuming j is positive. j(2242/637) Simplify v(-26)v/v*(-3/10)(v*6/vvvvv)(1/8) assuming v is positive. v(-943/40) Simplify (c(-8)cc(2/25)/c)/(c(11/5)/cccc*0c) assuming c is positive. c*(-303/25) Simplify (mm*10)/mmm(-12)mm(-4)m/(mm(1/3)) assuming m is positive. m(-13/3) Simplify (v(6/7))24/(v(-10)vv(-4/21)) assuming v is positive. v(625/21) Simplify j(7/6)j/(j*(-1/12)/j)(j(6/11))42 assuming j is positive. j(1151/44) Simplify (((u(-7)u)/u)(1/48))19 assuming u is positive. u(-133/48) Simplify (j(2/3)/(jj(-6)))/(j(1/2)((j/j(-2/27))/j)/j) assuming j is positive. j(329/54) Simplify v(-8)v*(-16)v/(v*(1/28)/v)v/(v*(18/5)v) assuming v is positive. v*(-3589/140) Simplify (((((((n((n/(((n/n*(-1/3)nn)/n)/n))/n)/nnn)/n)/nnn)/n)/n)/n)/(nn*(-7))n*(-2/7)/nnnnn3n)(1/22) assuming n is positive. n(197/462) Simplify ((a*(2/31)a)/aaaa(-8)a)/((((a/a(9/4))/a)/a)/(a(-3/8)a)) assuming a is positive. a(-263/248) Simplify h(3/5)h*(-8/9)(h/(h*(2/61)h))/(h/h20) assuming h is positive. h(51272/2745) Simplify (j3)14/(j*(-13)/(jj(-4/15))) assuming j is positive. j(836/15) Simplify ff1f/(ff5)f(f(-2/9))(3/8) assuming f is positive. f(-25/12) Simplify ((v(v/v*(2/31))/v)/(vv*(-4)vvv))/(vv(1/5)/v)(1/3) assuming v is positive. v(404/465) Simplify (m9)46m/(mm(-2/25)m)m/(m((m*(2/7)/m)/m)/mm)m assuming m is positive. m(72764/175) Simplify ((ii/(i(ii/i(-3/26))/i))/i(-34))/(i(-4)/(i/(i(-7/2)/i)i)) assuming i is positive. i(577/13) Simplify (a/(a(aa(-1/8))/aa))/(aaa/(((a*(-2/9)a)/a)/a)a)(aa/(aa*(-3))aaa)(-30) assuming a is positive. a(-15559/72) Simplify ((g*(-25)g)/(g/(g/g*(2/11)g)))(-3/11) assuming g is positive. g(765/121) Simplify (p(7/4)/((p13p)/p))/((p/(p(p/(p5/p))/p))/p)(-1/29) assuming p is positive. p(-1293/116) Simplify (p/p(-15)p/(ppp(pp/(pp/(p*(-14)p)p))/p)pp)/(p/((p/p(-12))/p)(p/((p/(p/(pp(-15/7))pp))/p))/p) assuming p is positive. p(265/7) Simplify (ww(1/11))/w22w6www*5wwww assuming w is positive. w(-43/11) Simplify (aa/a(-7))(-49)(a(a/a*(-3/2))/a)/(aa/(aa20)) assuming a is positive. a(-839/2) Simplify (((k/k(1/2))(-2/27))25)(-3/5) assuming k is positive. k(5/9) Simplify ((pp/p*(-8/3)p)/(pp(-4)))/(p19p(1/17)) assuming p is positive. p(-530/51) Simplify (c/c*(-11)c)7/((c(4/7)/c)/c9) assuming c is positive. c(703/7) Simplify (y*(-1/4)y/(yy(-14)))/(y(-6/11))(-48) assuming y is positive. y(-547/44) Simplify (((i/i(-8))/i)/i(-8/7))/(i(3/5))(2/37) assuming i is positive. i(11798/1295) Simplify (k(-40)k)/(k(kk*(-28))/k)k*12kkk*(-35)k assuming k is positive. k(-32) Simplify (i16/iii*(-9)ii)/((i/i(-17))/((i/i(-16))/i)) assuming i is positive. i7 Simplify rr/(((rr(-10)/rr)/r)/r)rr*(-18)r*(-4)(r/r*18r)/r assuming r is positive. r*(-25) Simplify (mm(-2/11))/m(6/7)(mmm22m)/mmmm(4/19)m assuming m is positive. m*(39752/1463) Simplify (j/(jjj(-10))jj(-2/11)j)/(j*(2/13)j)(-15) assuming j is positive. j(4022/143) Simplify ((y(y/(yy(1/3)))/y)(-17)y/(y13y)y/y(-6)y)(-1/44) assuming y is positive. y(-1/66) Simplify (nn(-1/3)n/(n/n(5/7)))(-48) assuming n is positive. n(-464/7) Simplify ((f15ff)/f*(1/21))/(f/((f(ff(-4/7))/f)/ff))(-7/6) assuming f is positive. f(370/21) Simplify (z(7/3))(-3/34)/(zz(-16)z)(2/73) assuming z is positive. z(441/2482) Simplify o/((o/(oo(-2/7)o))/o)ooooo/(o(-4/3)oo)o(o(2/7)o)(-28) assuming o is positive. o(-587/21) Simplify (c/(c/(((c/(cc(-5)/c))/cc)/c)))*(-1/21)(c20)(3/10) assuming c is positive. c*(121/21) Simplify (f/(ff*(1/3))(f/(ff(-11/5))f)/f)/(f(-3)/f)(-2) assuming f is positive. f(-92/15) Simplify r(-9/4)rr*(-12)rrr*(1/4)/rrrr(-8) assuming r is positive. r(-18) Simplify (x(1/4)/x)(8/15)(x(-1/2)x)(-1/4) assuming x is positive. x(-21/40) Simplify (((l/(l/((l/((llll(1/5))/ll))/l))l)/l)/ll(-27/5))27 assuming l is positive. l(-1296/5) Simplify ((m/(m(3/5)m))/(mm/(mm(2/17))))/(m(-3/7)m)22 assuming m is positive. m(-8362/595) Simplify (v/(v*(-15)vv)vvv/(vv(-12)v)v)/(v/(v/((vv*(2/13))/v))vv(-1/3)) assuming v is positive. v(1060/39) Simplify (ss(1/4)/s)(-7/6)ss*(2/3)s(1/8) assuming s is positive. s(3/2) Simplify o/(o/((o/o*(-23))/o))oooo/o(20/7)(o(7/4)/o)(-47) assuming o is positive. o(-311/28) Simplify (x(-2/17)x(-1/18))/(x(2/3)x)(-23) assuming x is positive. x(11677/306) Simplify u/(u*10/u)uu/(((u/(u/u(-5)))/u)/u)uu(uuu/u4)(-2/45) assuming u is positive. u(137/45) Simplify ((i/i17i)/(i/(i(-3/10)/ii)))/(ii(-3/5)i(-13)) assuming i is positive. i(-37/10) Simplify (((mm/(m/(((mm/(mm(-8/13)/m))/m)/m)))/mmm)/(m/(m(-10/7)m)))/(m*(-6)mm(-1/5)m) assuming m is positive. m(2451/455) Simplify k(1/4)/(kk/(k/(k/(k12k)))kk)k(2/3)k/(kk/k(-28)k) assuming k is positive. k(-241/12) Simplify (r/r1)*44(r/((rr(-4/9))/r)r)/rr/r(-7) assuming r is positive. r(85/9) Simplify (l6)(-49)ll(-1/15)l/(l*(-10)/l)ll assuming l is positive. l(-4186/15) Simplify ((i/(ii/((i/((i/i*(-13))/i))/i)ii))(-6/13))(1/23) assuming i is positive. i(96/299) Simplify (((g/(g1g)g)(-2/5))44)46 assuming g is positive. 1 Simplify (g(2/19)g(g/(gg*(-12))g)/g)/(g0)(-44) assuming g is positive. g(249/19) Simplify (m(4/11)/(mm11m))/(mm(m(m(-9)m)/m)/mm(mm/(m/(m/m(4/5))))/m) assuming m is positive. m(-376/55) Simplify ((yy*(-7)y/(((y*(-1/4)y)/y)/y))/(((yy5)/y)/(y(6/7)y)))42 assuming y is positive. y(-579/2) Simplify (tt(-2))(3/7)t*(-12)t(4/3) assuming t is positive. t(-233/21) Simplify (xx/x(-4))(7/5)x(-2/7)/x(-1/7) assuming x is positive. x*(289/35) Simplify ss*(-4/5)ss/s31ss(-15)s/s(5/2) assuming s is positive. s(-443/10) Simplify (((bbb*(2/5))/bb)/b)*(-2/63)bb(-2/17)b(-1/7) assuming b is positive. b(3722/5355) Simplify (zz(1/2)zz/(z/z(-5)z))/(z*(1/2)/zz(3/11)) assuming z is positive. z(-36/11) Simplify (((x*(-13/6)x)/x)/x3)/(x(2/3)/x)(5/8) assuming x is positive. x(-119/24) Simplify (w(-4))(-7/9)(ww/(w*(11/4)/w)w)/w(-1/16) assuming w is positive. w(637/144) Simplify ((uu(3/5))/uu(-1/27))/((u/(u/u15))/uuu/(u*23u)) assuming u is positive. u(1156/135) Simplify (i(-3/11)/(ii12))(-50) assuming i is positive. i(7300/11) Simplify (k/k(1/6))/(kk*(-3/4)k)((k/(kkk(-14)/k))/k)/k6 assuming k is positive. k(79/12) Simplify l/(l/(ll*(-8)l))l/l0(l(-3/2))36 assuming l is positive. l*(-59) Simplify aa(a(2/5)a)/aaaa(a*7/aa)/aa(-17)a1 assuming a is positive. a(-23/5) Simplify (((bbb(-2))(2/49))(-7))(-1/17) assuming b is positive. 1 Simplify d/d*(-6/7)d*(-2/11)(((d/d18)/d)/d)/(d(-13)*d) assu	{ "pile_set_name": "DM Mathematics" }
+ 4. 63sqrt(11) + 55935 Simplify ((-1(-4 + sqrt(833)) + sqrt(833) + sqrt(833) - 1(-2 + sqrt(833) - sqrt(833) - sqrt(833)))-1)*2-2. -6736 - 336sqrt(17) Simplify (-3 + -5 + -5 + (1 + -4(-2sqrt(108) + sqrt(108))2)-3)2. 4608sqrt(3) + 62464 Simplify (1 + (1-4(sqrt(117) - (1 + sqrt(117) + 3 + sqrt(117) - sqrt(117))))*2 + -3)-5. -1270 Simplify 1 + 2(sqrt(12) + sqrt(12)11) + (sqrt(12) + -1 + sqrt(12) + -2 + sqrt(12) + 1)2. -16sqrt(3) + 113 Simplify (-2sqrt(153) + 0)2 + (-3sqrt(153)-3)2 + 0 + -1-5(sqrt(153) + 0). 15sqrt(17) + 13005 Simplify (-1(3sqrt(11)3 - -3sqrt(22)/sqrt(2)) + -4 + (sqrt(11) - sqrt(275)1 - (sqrt(11) + 0 + 2)) + 5)2. 34sqrt(11) + 3180 Simplify (4sqrt(1470)-4)/(-3sqrt(6534) - sqrt(54)). 56sqrt(5)/51 Simplify 0 + (-21sqrt(1008)-3 - (0 + sqrt(1008) + -4)6). 24 Simplify 0 + (4(sqrt(65) - (sqrt(65) - 1sqrt(65))) - (6(sqrt(65) + 2sqrt(65)) - sqrt(65)))/(sqrt(45)/(sqrt(9)1) + sqrt(5) + sqrt(720)). -13sqrt(13)/14 Simplify ((sqrt(156) - (sqrt(156) + sqrt(156)-1-5)) + sqrt(156) + 1sqrt(156)5)/(sqrt(300)-2 - -4sqrt(27)). -sqrt(13)/4 Simplify (sqrt(7623) + 6(sqrt(7623)2 - sqrt(7623)) + sqrt(7623) + -3sqrt(7623)2)/((6sqrt(144)/sqrt(4))/(sqrt(44)/(sqrt(176) + sqrt(11)) - sqrt(4))). -44sqrt(7)/15 Simplify 2((sqrt(320) + sqrt(320) + sqrt(320) + -2)2 + -1) + ((sqrt(320) + sqrt(320) + 3 + 0)*2 - (5 + (sqrt(320) + 1 - sqrt(320)))). 192sqrt(5) + 1273 Simplify -2((sqrt(1440)2 - sqrt(10))/(4sqrt(20)/sqrt(4)) + ((sqrt(96)1 - sqrt(96))/sqrt(12) - sqrt(8))*2-2)6. -69sqrt(2) + 192 Simplify ((4(sqrt(108)/sqrt(3) - sqrt(36)))/(sqrt(216)2))/(3sqrt(6)/sqrt(3)15). 0 Simplify (((sqrt(832) + 1)-6 - (3 + 2sqrt(832)))2 + (sqrt(156) + 3-2sqrt(156) + sqrt(156) + sqrt(156))/(sqrt(432)2))-2. -106658 - 4607sqrt(13)/2 Simplify (sqrt(55) - sqrt(1375)-1)/(sqrt(50)/(sqrt(10) + sqrt(70)/sqrt(7))) + (1(-1-2sqrt(704) + sqrt(704)) + 4)*2. 204sqrt(11) + 6352 Simplify (-1sqrt(648)-5 - (5(sqrt(648) + sqrt(648)-1 - sqrt(648)) + sqrt(648)))/(-2sqrt(1089) - sqrt(27)/sqrt(3)-6). -27sqrt(2)/8 Simplify (-5 + -5-6(sqrt(325)16-2)*2)1. 1403995 Simplify ((21sqrt(165))/(5sqrt(22)/sqrt(2)))/(-4(sqrt(320)2 + sqrt(320)) + (-1sqrt(320)-4 - sqrt(320) - sqrt(320)) + sqrt(320)). -sqrt(3)/180 Simplify (2 + sqrt(13) + -3)1 + 1 - (3sqrt(13)-3 - -6sqrt(832)). -38sqrt(13) Simplify 3 + 5(-3 + 1 + sqrt(1700) + -5 + (0 + sqrt(1700))6 + sqrt(1700))*21. -5600sqrt(17) + 544248 Simplify ((sqrt(288) + (sqrt(288) - -1sqrt(288))-1)4)/(-2sqrt(72)/(sqrt(40)/(sqrt(10)/sqrt(2)))). 8sqrt(2) Simplify -4 + ((-2 + sqrt(396))6 + 1 + -6(sqrt(396)-2 + -2))2. 216sqrt(11) + 128301 Simplify (1-2(-2sqrt(625) + sqrt(625)))/(-1sqrt(180)-24). 5sqrt(5)/24 Simplify (sqrt(55) - sqrt(605)/(sqrt(11)1))/(sqrt(11) - sqrt(77)/sqrt(343)) + -6(3 + (4 + (sqrt(10)/(sqrt(2)-1) + sqrt(5) - sqrt(5)))*2). -144 + 48sqrt(5) Simplify ((sqrt(14)-1-4)/(4sqrt(16)/sqrt(8) + sqrt(2)) + 2(-5 + 3 + -1sqrt(7)3))*2. 208sqrt(7)/5 + 5132/25 Simplify (-4 + 3 + sqrt(125) + ((sqrt(125) + 3)6 - sqrt(125)) + 3(sqrt(125) - sqrt(125)-2)44)2. 25500sqrt(5) + 2812789 Simplify -2((1 + (3 + sqrt(833)4 - (sqrt(833) - ((0 + sqrt(833))5 - sqrt(833)))))6)*2. -2939976 - 28224sqrt(17) Simplify (4sqrt(98)6 + sqrt(98)-4 + 1 - (4 + 4(sqrt(98) - (3 + sqrt(98))) + 0))*2. 2520sqrt(2) + 39281 Simplify (6(-2sqrt(5700) - sqrt(171)/sqrt(3)4))/((-4sqrt(75) - sqrt(3)) + sqrt(375)/sqrt(5)). 9sqrt(19) Simplify (2(sqrt(484) + -2sqrt(484) + sqrt(484)) - sqrt(484) - -1sqrt(484)3)/((-1sqrt(4)1)/(sqrt(2) + (sqrt(10)/(-3sqrt(5)) - sqrt(2)))). 22sqrt(2)/3 Simplify (4sqrt(475))*2 + (-3sqrt(95))/sqrt(5) - -1(0 + (sqrt(2736) - (sqrt(2736) + 1 + sqrt(2736))2)). -3345 - 39sqrt(19) Simplify (-6(-4(sqrt(152) + (sqrt(152) - ((sqrt(152) - sqrt(152)2) + sqrt(152)))) + sqrt(152) - sqrt(152)))/(((sqrt(80)2)/sqrt(5))/(sqrt(72)2)). 288sqrt(19) Simplify (6(5 + (((-2sqrt(420) - sqrt(420))/sqrt(7))/sqrt(12) - 2(sqrt(400) - sqrt(25))/sqrt(5)))-5)*2. -81000sqrt(5) + 387000 Simplify (((sqrt(192) - -2sqrt(192)) + sqrt(192))-6)/(-5sqrt(1536) + sqrt(1536))-1. -3sqrt(2)/2 Simplify (-3(-1(sqrt(847) + 0) + (sqrt(847) - sqrt(847)-2 - sqrt(847))4 + -1 - (-5(sqrt(847) + -1)-4 + 5)))2. -36036sqrt(7) + 1290051 Simplify (2 + sqrt(33)/(sqrt(3) + sqrt(24)/sqrt(8))1 - (-5 + (sqrt(275) - (sqrt(275) + 0)) - sqrt(275) - (1sqrt(275) + -2 - sqrt(275))))*2 + -4. 55sqrt(11) + 1415/4 Simplify ((sqrt(1008) + sqrt(1008) + sqrt(1008)5 + sqrt(1008) + 4 + -5 - (-2 + 3sqrt(1008) + 4 + sqrt(1008))) + -3 + -4)*2. -960sqrt(7) + 16228 Simplify 1 + ((-5(-1 + sqrt(128) - sqrt(128)) + sqrt(128)-3-3)2 - (-2(2sqrt(128) + 3) + 0)). 752sqrt(2) + 10400 Simplify ((sqrt(448)1-1 + 4 + 3)*2 - ((1(sqrt(448) - 1sqrt(448)))2 + 3)5)2. -224sqrt(7) + 964 Simplify 5(-1 + (sqrt(2448) + 5 + sqrt(2448) + 3 + sqrt(2448))-3 + sqrt(2448) + 3 + sqrt(2448)-5 + 2)2. 31200sqrt(17) + 2070560 Simplify ((sqrt(28)/sqrt(4)-1 - (sqrt(7) + 0 + 3)) + -1 - (sqrt(700) + 5sqrt(700)-2 + -3))2 + 1. -176sqrt(7) + 54210 Simplify ((sqrt(88) - (sqrt(88) + (sqrt(88) - (sqrt(88) + sqrt(88) + -2sqrt(88) + sqrt(88)))5))-6-3)/(((-1sqrt(64) - sqrt(64))1)/(22sqrt(8))). 0 Simplify (5 + -6(sqrt(432) + (sqrt(432) + 1 - sqrt(432))4)-5 + -5)2. 86400sqrt(3) + 403200 Simplify ((-4(sqrt(260) - (2sqrt(260) + sqrt(260) + sqrt(260))) + -4(sqrt(260) + -1sqrt(260)))/(sqrt(245) - sqrt(245)-1 - -1sqrt(5)-3) + -3)2. -144sqrt(13)/11 + 8577/121 Simplify ((-3sqrt(576))/(sqrt(99)/(sqrt(11) - sqrt(99))))/(sqrt(128)/(-6(sqrt(324) - sqrt(4)) + sqrt(4))). -282sqrt(2) Simplify ((-2((4((1 + sqrt(108) + sqrt(108) - sqrt(108)) + sqrt(108)) + sqrt(108))-3 + -2sqrt(108)-5-6))2 + -5)4. 200448sqrt(3) + 13081516 Simplify (sqrt(63) + -5 + sqrt(252) + (sqrt(252) + -1 - sqrt(252)) + (5 + (sqrt(112) - (sqrt(112) + -1 + sqrt(112)-1 + sqrt(112))))*2)-1. -30 - 9sqrt(7) Simplify 1(-4(sqrt(2057) + -1))2 + -2 + (((sqrt(2057) - -5(sqrt(2057) + 1sqrt(2057))) + sqrt(2057) + sqrt(2057) + 3(1 + sqrt(2057)))4)2. 16544sqrt(17) + 8458542 Simplify -2 + (6(-1 + sqrt(147))2 - (2(-1sqrt(147) + sqrt(147)))2 - ((-5 + -2sqrt(147))1)2). -224sqrt(3) + 273 Simplify 1((-4 + 3(sqrt(72) + -2) + -3)-1 + 3). -18sqrt(2) + 16 Simplify (0 + sqrt(500) + -1 + (sqrt(500)-1 + sqrt(500))4 + -3 + 1(-1 + -2sqrt(500) - (sqrt(500) - (3 + -2sqrt(500)) - sqrt(500))))2. 120sqrt(5) + 4504 Simplify 2 + -4(sqrt(567) + sqrt(7))6 + -4(sqrt(175) + (sqrt(175) + 1 - sqrt(175))2) + -2. -260sqrt(7) - 4 Simplify -4 + (3 + (sqrt(891) + -2)1 + -5)2-6 + -5. -5451 + 432sqrt(11) Simplify ((3 + -2 + -1(sqrt(704) + 0)-5)4)*26. 7680sqrt(11) + 1689696 Simplify (5 + 2 + ((-1 + sqrt(13))6 - sqrt(13))-1 - (1sqrt(832) + -6(2 + sqrt(13) - sqrt(13)))6)*2. -9010sqrt(13) + 43742 Simplify ((-2(sqrt(198) + sqrt(198)1))/sqrt(6)-4)/((5sqrt(108))/(sqrt(64)-1)) + -2. -64sqrt(11)/15 - 2 Simplify (((sqrt(110) + (sqrt(110) - (sqrt(110)-1 + sqrt(110)))1)/sqrt(10))*2 - ((sqrt(1584) - (sqrt(1584) - -1sqrt(1584))) + 4))-4. -160 - 48sqrt(11) Simplify ((-2sqrt(136)6 + sqrt(136) + 3sqrt(136)-1)/(sqrt(2) + sqrt(2) + sqrt(20)/(sqrt(10)1 + sqrt(10) + sqrt(10)) - -2sqrt(242)))*2 + -4. 98636/5329 Simplify (-2 + -4 + (11sqrt(44))/(sqrt(20)/sqrt(5)-1))6. -36 - 6sqrt(11) Simplify (4(sqrt(13) - (2 + sqrt(832)) - 6sqrt(117) - ((-1sqrt(91))/sqrt(7) + (sqrt(260)/sqrt(5))/sqrt(4))))2. 1600sqrt(13) + 130064 Simplify (sqrt(18)/((sqrt(66)1)/sqrt(11) + sqrt(6)) + -1)6 - (sqrt(15)/(-1sqrt(500))-4 + -5). -1 + 13sqrt(3)/5 Simplify ((sqrt(1620)4)/((sqrt(108)3)/sqrt(12)))2 - (-5(sqrt(245) + -3 + sqrt(245) + 0 + -5))*2. -25780 + 5600sqrt(5) Simplify -3 + ((sqrt(3) - (sqrt(144) - sqrt(36))/sqrt(12)) + -1sqrt(3) + 3)2 + 0 + ((sqrt(21) - 1sqrt(21))/sqrt(7) + -4)*2. -6sqrt(3) + 25 Simplify (((1sqrt(2048))/(sqrt(64)/(sqrt(8) + sqrt(8)2)))/(1sqrt(8)/sqrt(4)-65))2. 32/25 Simplify (2 + sqrt(11) + 3 - (sqrt(176) + -1))-4 + (-3(0 + sqrt(275) + 0))2. 12sqrt(11) + 2451 Simplify (1 + -3(-35sqrt(128)2 + (22sqrt(128) + sqrt(128) + sqrt(	{ "pile_set_name": "DM Mathematics" }
there between 9:33 PM and 5:33 AM? 480 What is 130 minutes after 5:18 PM? 7:28 PM What is 690 minutes before 8:49 PM? 9:19 AM How many minutes are there between 3:41 AM and 12:27 PM? 526 What is 366 minutes after 11:50 PM? 5:56 AM What is 175 minutes after 10:05 AM? 1:00 PM How many minutes are there between 11:07 AM and 11:56 AM? 49 How many minutes are there between 4:18 PM and 8:28 PM? 250 How many minutes are there between 7:24 AM and 1:24 PM? 360 How many minutes are there between 3:34 PM and 7:58 PM? 264 How many minutes are there between 12:16 PM and 9:02 PM? 526 How many minutes are there between 8:31 PM and 8:03 AM? 692 How many minutes are there between 4:57 PM and 1:13 AM? 496 What is 609 minutes before 10:39 AM? 12:30 AM How many minutes are there between 5:16 AM and 4:20 PM? 664 What is 298 minutes before 11:31 AM? 6:33 AM What is 697 minutes after 2:25 AM? 2:02 PM How many minutes are there between 8:14 PM and 2:53 AM? 399 What is 97 minutes after 10:41 AM? 12:18 PM What is 310 minutes before 9:10 PM? 4:00 PM What is 453 minutes after 4:55 PM? 12:28 AM How many minutes are there between 10:33 PM and 9:38 AM? 665 What is 414 minutes after 6:09 AM? 1:03 PM How many minutes are there between 4:34 PM and 7:40 PM? 186 What is 584 minutes before 6:45 AM? 9:01 PM What is 423 minutes after 4:29 PM? 11:32 PM What is 137 minutes before 6:29 AM? 4:12 AM How many minutes are there between 8:15 PM and 4:15 AM? 480 What is 607 minutes after 10:04 AM? 8:11 PM How many minutes are there between 8:34 AM and 5:37 PM? 543 How many minutes are there between 5:13 AM and 3:47 PM? 634 What is 453 minutes before 9:02 PM? 1:29 PM How many minutes are there between 11:39 PM and 12:48 AM? 69 How many minutes are there between 9:14 AM and 3:21 PM? 367 How many minutes are there between 1:15 PM and 6:32 PM? 317 How many minutes are there between 9:15 AM and 11:44 AM? 149 What is 103 minutes before 10:15 PM? 8:32 PM How many minutes are there between 9:31 PM and 1:35 AM? 244 How many minutes are there between 12:47 AM and 10:36 AM? 589 How many minutes are there between 5:55 AM and 4:29 PM? 634 What is 236 minutes after 10:37 AM? 2:33 PM How many minutes are there between 5:03 AM and 2:59 PM? 596 What is 641 minutes before 12:15 PM? 1:34 AM What is 586 minutes after 8:46 PM? 6:32 AM How many minutes are there between 7:56 AM and 11:07 AM? 191 How many minutes are there between 4:18 PM and 10:57 PM? 399 How many minutes are there between 9:43 PM and 12:28 AM? 165 What is 570 minutes before 12:24 PM? 2:54 AM What is 318 minutes before 4:16 AM? 10:58 PM How many minutes are there between 7:50 PM and 9:47 PM? 117 What is 588 minutes before 3:24 PM? 5:36 AM How many minutes are there between 9:45 PM and 3:58 AM? 373 How many minutes are there between 1:46 AM and 4:52 AM? 186 What is 371 minutes before 12:47 PM? 6:36 AM How many minutes are there between 10:48 AM and 2:46 PM? 238 How many minutes are there between 5:08 AM and 10:01 AM? 293 What is 298 minutes after 12:58 AM? 5:56 AM What is 9 minutes before 11:11 AM? 11:02 AM How many minutes are there between 11:19 PM and 6:00 AM? 401 What is 709 minutes after 7:46 AM? 7:35 PM What is 11 minutes after 2:50 AM? 3:01 AM What is 323 minutes after 6:15 AM? 11:38 AM What is 423 minutes before 3:10 PM? 8:07 AM How many minutes are there between 4:03 PM and 1:48 AM? 585 What is 317 minutes after 4:08 PM? 9:25 PM What is 96 minutes after 10:56 PM? 12:32 AM What is 132 minutes before 12:46 AM? 10:34 PM How many minutes are there between 3:41 PM and 3:03 AM? 682 What is 295 minutes before 4:43 PM? 11:48 AM How many minutes are there between 8:31 PM and 6:49 AM? 618 How many minutes are there between 11:16 AM and 9:34 PM? 618 What is 679 minutes before 12:31 PM? 1:12 AM What is 611 minutes after 9:03 AM? 7:14 PM What is 166 minutes before 1:29 PM? 10:43 AM What is 71 minutes after 11:07 AM? 12:18 PM How many minutes are there between 12:25 PM and 9:28 PM? 543 What is 646 minutes before 12:29 AM? 1:43 PM What is 454 minutes before 12:14 AM? 4:40 PM How many minutes are there between 12:13 PM and 6:29 PM? 376 How many minutes are there between 3:01 PM and 6:16 PM? 195 What is 714 minutes before 9:46 AM? 9:52 PM What is 394 minutes after 5:51 AM? 12:25 PM What is 553 minutes before 3:24 PM? 6:11 AM What is 6 minutes after 2:55 AM? 3:01 AM How many minutes are there between 10:02 AM and 5:36 PM? 454 What is 353 minutes before 2:07 AM? 8:14 PM What is 430 minutes before 6:03 AM? 10:53 PM How many minutes are there between 9:05 PM and 4:15 AM? 430 How many minutes are there between 7:21 AM and 4:11 PM? 530 How many minutes are there between 4:36 PM and 1:39 AM? 543 What is 685 minutes before 7:01 PM? 7:36 AM What is 194 minutes after 9:58 PM? 1:12 AM How many minutes are there between 4:37 AM and 7:29 AM? 172 What is 158 minutes after 5:50 PM? 8:28 PM How many minutes are there between 7:27 AM and 3:17 PM? 470 How many minutes are there between 4:05 PM and 1:37 AM? 572 How many minutes are there between 1:31 AM and 5:57 AM? 266 How many minutes are there between 6:01 AM and 8:18 AM? 137 How many minutes are there between 1:45 PM and 9:21 PM? 456 What is 265 minutes after 1:53 AM? 6:18 AM How many minutes are there between 4:33 PM and 1:51 AM? 558 What is 126 minutes before 6:15 PM? 4:09 PM How many minutes are there between 6:10 PM and 9:14 PM? 184 How many minutes are there between 5:32 AM and 6:49 AM? 77 How many minutes are there between 2:21 PM and 9:25 PM? 424 What is 517 minutes after 1:50 PM? 10:27 PM What is 669 minutes after 8:13 AM? 7:22 PM What is 251 minutes before 12:54 PM? 8:43 AM How many minutes are there between 1:27 PM and 9:15 PM? 468 What is 35 minutes after 12:15 AM? 12:50 AM What is 9 minutes after 1:12 AM? 1:21 AM What is 416 minutes before 8:26 PM? 1:30 PM How many minutes are there between 9:23 PM and 12:24 AM? 181 What is 50 minutes before 11:44 PM? 10:54 PM How many minutes are there between 9:18 PM and 3:12 AM? 354 How many minutes are there between 8:14 AM and 5:42 PM? 568 How many minutes are there between 1:12 AM and 3:46 AM? 154 What is 293 minutes after 12:46 AM? 5:39 AM How many minutes are there between 12:32 PM and 11:08 PM? 636 How many minutes are there between 6:18 AM and 3:27 PM? 549 What is 155 minutes before 8:05 PM? 5:30 PM How many minutes are there between 7:01 AM and 7:49 AM? 48 What is 38 minutes before 12:02 PM? 11:24 AM What is 493 minutes after 9:37 AM? 5:50 PM How many minutes are there between 11:17 PM and 2:48 AM? 211 How many minutes are there between 10:11 AM and 10:06 PM? 715 How many minutes are there between 4:10 PM and 12:12 AM? 482 What is 401 minutes after 11:10 PM? 5:51 AM How many minutes are there between 8:07 PM and 7:35 AM? 688 What is 246 minutes before 5:38 AM? 1:32 AM How many minutes are there between 6:30 PM and 11:16 PM? 286 What is 184 minutes after 9:17 PM? 12:21 AM What is 40 minutes after 4:34 PM? 5:14 PM How many minutes are there between 2:18 AM and 4:00 AM? 102 What is 505 minutes after 2:10 AM? 10:35 AM What is 19 minutes before 12:39 AM? 12:20 AM What is 538 minutes before 2:32 AM? 5:34 PM What is 388 minutes before 8:20 AM? 1:52 AM How many minutes are there between 8:05 PM and 2:55 AM? 410 How many minutes are there between 7:48 AM and 9:29 AM? 101 What is 36 minutes before 5:51 PM? 5:15 PM What is 236 minutes before 6:51 AM? 2:55 AM What is 360 minutes after 4:27 AM? 10:27 AM How many minutes are there between 6:36 AM and 12:00 PM? 324 How many minutes are there between 7:24 AM and 6:53 PM? 689 How many minutes are there between 1:30 PM and 2:09 PM? 39 What is 446 minutes before 3:54 AM? 8:28 PM What is 543 minutes after 11:06 AM? 8:09 PM What is 605 minutes after 4:30 AM? 2:35 PM How many minutes are there between 5:12 AM and 10:15 AM? 303 What is 660 minutes after 1:12 AM? 12:12 PM How many minutes are there between 11:04 AM and 9:21 PM? 617 What is 96 minutes after 3:50 PM? 5:26 PM What is 251 minutes before 12:25 PM? 8:14 AM What is 386 minutes before 7:34 AM? 1:08 AM How many minutes are there between 9:59 PM and 7:54 AM? 595 How many minutes are there between 1:29 PM and 5:20 PM? 231 How many minutes are there between 1:08 AM and 7:52 A	{ "pile_set_name": "DM Mathematics" }
478d3 - 6d. Is v(-1) a composite number? False Let x be (-52)/(3/(-477)2). Is ((-1)/2)/((-13)/x) a prime number? False Let o = 89013 - 52573. Suppose -19u + o = -11u. Is u a composite number? True Is 38442/36-2(-2 - 1) prime? False Suppose 1 = -4r + o, 0 = -3r + 4o - 4 - 0. Let g be 4 - r/((-12)/(-4)). Is 14970/24 + (-3)/g a composite number? True Suppose 96951 = 4n + 5q, -7n + 10n - 72712 = -5q. Is n a composite number? False Let n(b) = -b2 + 0b*2 - 3b*2 - 2b*2 - 5b - 1. Let y be n(-6). Let h = -134 - y. Is h prime? True Let s be 2(6/3)/1. Let i(l) = -l3 + 5l*2 - 3l + 1. Let y be i(s). Suppose 2z + 117 = yz. Is z prime? False Let m = 2490 - -3711. Let z = -4402 + m. Is z a composite number? True Let y(s) = -392 + 389 + 55s - 17s. Is y(7) a prime number? True Suppose 2x - 150 = 5d, 5 = -d - 2x - 13. Let v = d - -65. Is v prime? True Let g be (6/15)/((-2)/(-15)). Suppose 3j = s + 159, 0s + 265 = 5j - gs. Is j a prime number? True Let o = 665 - -3532. Is o prime? False Suppose 228565 = 6s - 37541. Is s a prime number? True Let z = -1045 - -1830. Let j be 32/(-8) - 1z. Is j((-6)/2)/9 composite? False Let i(x) = -x*3 - x + 3x - 3x + 6x*2 + 5. Let z be i(5). Let r = z + -14. Is r prime? True Let f = -29 - 2485. Let l = 4733 + f. Is l prime? False Suppose -17s - 98222 + 466476 = 0. Is s prime? False Let m(u) = -4u3 - 5u*2 + 7u - 2. Let v(x) = -4x3 - 6x*2 + 6x - 3. Let j(b) = -3m(b) + 2v(b). Let a be j(4). Let r = a + 145. Is r prime? False Let k = -17 - -19. Suppose -3b - kc = 3c, 2c = b. Suppose b = 3a + 6, -3r + 4a = -612 - 50. Is r prime? False Let s(r) be the first derivative of 51r*2 - 39r - 13. Is s(6) a composite number? True Suppose -h - 16 = -5d, d - 5h = 8 - 0. Suppose 2472 = dj + 999. Is j a prime number? True Suppose -j + 4w - 6719 = -40406, 0 = 2j + 5w - 67348. Is j a prime number? True Suppose -l + 96 = 2l - 5w, -4l - 5w + 93 = 0. Let y = l + 238. Is y a composite number? True Suppose -818v + 803v = -1435515. Is v prime? True Suppose -11m = 10m - 3159933. Is m composite? False Let p(y) be the second derivative of -y*4/8 + 13y*3/6 + 5y*2/2 + y. Let u(o) be the first derivative of p(o). Is u(-12) composite? True Let q be ((-84)/2)/((-2)/18). Let d = 1437 - q. Let l = d + -724. Is l composite? True Let a(w) = -107598w - 181. Is a(-2) prime? False Let i(m) = 340m + 221. Is i(29) a composite number? True Let f(z) be the third derivative of 79z5/12 - z4/24 + z3/6 + z2 - 5. Is f(-1) a composite number? False Let w be (-2 + -2)-1 + 61. Let b be 42341/w - 4/10. Suppose -3l + b = -1038. Is l composite? False Suppose 2m + 179 = 3q - 0m, -16 = 4m. Is q prime? False Suppose 2x - 5u = 3x - 542, -5x - 3u = -2798. Is x prime? False Let h(o) be the second derivative of 15o*3/2 - 19o*2/2 + o. Is h(6) a composite number? False Let f be 15/6 - 1/(-2). Suppose l = fl - 4. Let w(d) = 89d - 1. Is w(l) a composite number? True Suppose -d + 0 = -9. Let w(f) = f - 5. Let s be w(d). Suppose -4a = 2i + a - 311, 557 = si - 3a. Is i composite? True Let w = -29 - -102. Suppose -125 = m + w. Let a = 283 + m. Is a a composite number? True Let w = -109 - -113. Let r(u) = 10u*3 - 7u*2 + 7u + 1. Is r(w) a composite number? False Suppose 169 - 696 = g. Let a = g - -2410. Is a composite? True Suppose 0 = -2q + 8 + 32. Suppose 4v = -0v + 5t + q, 20 = -5t. Suppose -5y + 7 = -4g - 56, v = -y - 3g + 5. Is y composite? False Suppose -9p = -16237 + 2638. Is p composite? False Let x(q) = -430q - 5. Let i(f) = -f*3 - 6f*2 - 4f + 2. Let c be i(-5). Is x(c) a prime number? False Let p = 108388 + -72629. Is p prime? True Let c be (1(-1 + -1))/(24/48). Is (982/4 - c)/((-1)/(-2)) composite? False Let d(g) = -g3 - 33g*2 + 73g + 79. Is d(-42) a prime number? True Let n = -16 - -39. Is n(-478)/(-18) - (-12)/54 composite? True Let x = -1854 - -4028. Is x prime? False Suppose 16p - 24 = 8p. Let n(j) be the second derivative of j4/2 - j3/6 + j2 + 3j. Is n(p) a composite number? False Let k(z) = -4z3 + z2 + 3z - 2. Let m = -11 + 7. Let n be k(m). Suppose 0 = -2x - 2w + n, 4x + x - 637 = -w. Is x a prime number? True Suppose 5k - 108290 = 4z, -28k + 26k = -z - 43319. Is k a composite number? True Suppose 8q = 41454 + 11434. Is q a prime number? False Let p(a) = a*2 - 11. Suppose 0 = -7g + 2g + 40. Is p(g) composite? False Is (21007/28)/((-9)/(-180)) a prime number? False Suppose d + 1106 = -2d - 4w, 374 = -d + 4w. Let f = d - -1271. Is f a composite number? True Let b(r) = -r*2 - 2r + 8. Let w be b(-4). Suppose w = -5f + 5648 + 637. Is f composite? True Let u(p) = p3 - 11p + 7p2 + p2 - 3 - 3. Let n be u(-7). Suppose 0 = -2d - v + n + 257, -2v = d - 181. Is d a composite number? False Suppose 5c = 5o + 12315, 2o = -1 - 7. Is c composite? False Let q = -421 - -1148. Suppose -5c + q = 3l, l - 2l = -c - 237. Is l a prime number? True Suppose -m + 560 = -3b - 3m, 2b - 4m = -384. Let y = 484 - 105. Let c = b + y. Is c composite? False Suppose 4i = -5m - 105, -2i = m + 3i + 21. Is 2588(m/12)/(-7) a composite number? False Suppose 499 = -0b + 3b - 2v, -2b + 4v + 330 = 0. Is b a prime number? True Let l(q) = -2q*3 + 7q*2 - 4q + 6. Let x be l(3). Suppose -5t - 4f + 1356 = -xt, -5t = -2f - 3366. Is t composite? True Suppose 2540 + 4652 = 8n. Is n prime? False Let k be 2 + -5 + (-24)/(-4). Suppose -4u + ku = -184. Let m = u - 43. Is m composite? True Let x = -1638 + 2638. Suppose -11g + x + 1101 = 0. Is g composite? False Let f(p) = 4p - 7. Let l be f(3). Suppose -lt - 10 = -5d, -t + 0t - 2d = 2. Is (0 + t + 225)/1 prime? True Suppose 0 = -l + 2w + 242, 0 = -2l - 2l - 3w + 1012. Suppose 2z = -j + l, 4z - 260 = 2j + 256. Is z composite? False Let d be ((-64)/4)/(0 - 1). Suppose l - 851 = -0l + 3q, -4q - d = 0. Is l composite? False Suppose 12l - 17471 - 12973 = 0. Is l a composite number? True Let h(f) = 151f*2 - 9f - 23. Let q be h(-4). Suppose -10z + 3z = -q. Is z a prime number? True Let t(d) = -4d2 - 4d*2 + 15d*3 - 16d*3 + 4. Let h = 12 + -21. Is t(h) a composite number? True Suppose 0 = -68v - 7570 + 36062. Is v composite? False Suppose 1129 + 3943 = 4s - 4a, 3s + 3a = 3816. Suppose 2u = -4f + s, 2f + u = -2u + 641. Suppose 0 = 3j - 7j + f. Is j a composite number? False Suppose 3t + 268 - 3439 = 0. Let c = t - -202. Is c prime? True Let c(o) = -o2 + 8 + 8o + 2o2 + 1. Let v be c(-7). Suppose -2a = -4x + va + 356, 263 = 3x - 4a. Is x composite? True Let m(j) = -j*3 + 8j*2 + 11j - 15. Let x be m(9). Suppose -xp = -6p + 27. Let z = p + 310. Is z composite? True Suppose -22d = -27d + 19925. Is d composite? True Let m(z) = -z - 12. Let k be m(-17). Suppose t + 3x = -10 + 35, 0 = -t - kx + 15. Let c = t - -91. Is c composite? False Suppose -9b + 31883 = -8b + 2v, 0 = -3v. Is b composite? False Suppose 0 = -r - 5, 2v = -3v - 3r. Suppose 1988 = 4c + 2w, -vc = 2c - 2w - 2503. Is c a composite number? False Let t(p) = 203p - 9. Is t(20) a prime number? True Let f(a) = -2a*3 - 11a*2 + 9a + 9. Let v be f(-8). Suppose v = 2c - 857. Is c a composite number? False Let s = -102 - -104. Suppose 1235 = 3d + sp, 2p = -4d + 8d - 1656. Is d prime? False Suppose 36l - 37l = -3028. Suppose -7m - l = -14501. Is m composite? True Suppose 0 = 59v + 21v - 765200. Is v a prime number? False Let i = -1041 - -1754. Is i prime? False Let u = -10858 - -16119. Is u prime? True Suppose 5f + 34 = -61. Let r = f - -39. Suppose 0 = 4o + r, -5c + 0o + 1560 = -5o. Is c a composite number? False Suppose 4v = -5d + 6, d + 2 = -0d. Is -4 + 1114 + 1 + v composite? True Let y = 182177 + -468. Is y composite? True Let g = -83 - -100. Let i(o) = -o3 + 25o*2 + 23o - 34. Is i(g) a composite number? True Suppose f = 5, -4w + 19566 = -2f - 111876. Is w a composite number? True Suppose 4q = -g + 35, -4g + 25 = q - 175. Let z = 82 + g. Is z a composite number? True Let y(g) = g*3 + 5g*2 + g - 1. Let r be y(-4). Suppose -15z + rz = -7572. Is z a composite number? True Let d(f) = -12f*3 + 22f**2 + 33. Is d(-1	{ "pile_set_name": "DM Mathematics" }
Let n = 775 + j. Which is the fourth smallest value? (a) -0.4 (b) 0.41 (c) 1/3 (d) n b Let i = 0.0787 + 0.2213. Which is the fourth biggest value? (a) 2/7 (b) i (c) -1.2 (d) -0.03 (e) -0.12 e Let x = 3.1 + -2.7. Let f = 0.6 - x. Which is the smallest value? (a) 2/11 (b) 0 (c) -11 (d) f c Let g be 8 - (19 + -18)(-127)/(-16). Which is the third smallest value? (a) -0.5 (b) -0.2 (c) 0.4 (d) g d Let f = 2 - 37. Let m = -29.97 - 1.03. Let h = m - f. Which is the third biggest value? (a) h (b) 2/7 (c) 5 b Let j = 1.612 - -66.488. Let s = -66 + j. Which is the second biggest value? (a) -0.2 (b) 1 (c) s b Let n = -14 + 14. Let k = -54367 - -54371. Which is the smallest value? (a) k (b) n (c) -0.4 (d) 1 c Let w = -40497 - -40504. Which is the second smallest value? (a) 5 (b) w (c) -1.98 a Let g = 98/79 - -63/395. Which is the second smallest value? (a) 5 (b) -4 (c) g (d) 4/9 d Let o = -1 - 25.5. Let j = -27 - o. Let k = 203/3 - 68. What is the second biggest value in k, 0.3, j, 0.06? 0.06 Let c = -21.5627 + -0.4373. What is the third biggest value in -3, c, -0.1? c Let o = 673.6 + -669.6. Which is the second smallest value? (a) -75 (b) o (c) -3 c Let r = 691/20 - 174/5. Let f = -22 + 3. Let j be (2 + f/9)-2. What is the second smallest value in r, -4, j? r Suppose 317u - 49 = 318u. Let n = u + 38. Which is the smallest value? (a) 3 (b) -1/5 (c) n c Suppose -z - 6 = -0z. Let l = 12.2 - 14.72. Let n = l - -2.02. What is the second smallest value in z, n, 0? n Let m = 315 - 486. Let r = m + 181. Suppose -2o - 5u = 16, 0u - 2u + 2 = 5o. Which is the second biggest value? (a) -5 (b) r (c) o c Let t = -0.1 - 0.9. Let s(k) = 13k2 - 2k + 4. Let h be s(-3). Let q = -132 + h. What is the second smallest value in q, -2/7, t? t Let o = -661 - -556. Let g be o/(-14)(-3)/(-9). Which is the third biggest value? (a) g (b) 2 (c) 2.7 b Let k = 6 - 6.4. Suppose -l = -s - 40, 2l + 0s - 87 = -5s. Suppose 23 - l = -3i. What is the smallest value in 0.4, i, k? k Let w = 23745/2 - 11872. What is the biggest value in -3, 4/5, w, -1.96? 4/5 Let o be 212/13515 - (45/51 + -1). What is the fourth biggest value in 6, o, 0, 28/3? 0 Suppose -129i - 1291i = -23 + 23. Let n = -0.99 + 1. What is the second smallest value in 2, n, i? n Let z = -3508 + 3505. Which is the biggest value? (a) z (b) 1 (c) 21 (d) 3 (e) 4 c Let j = 16742 + -16747. Let g = 3 - 3. Which is the third biggest value? (a) g (b) j (c) 15 b Let k = 1636 + -1642. Let x = -9.9 + 10.4. Which is the fourth smallest value? (a) 1/6 (b) -3 (c) x (d) k c Let k = 167.1 + 51.9. Let w = -219.4 + k. What is the second biggest value in w, 5, -0.5? w Let n = -2 + 10. Suppose 16 + 32 = 12x. Suppose -28 = xs - n. What is the second biggest value in s, -0.07, 4? -0.07 Suppose j - 4m - 3 = 0, 0 = j + 20m - 21m - 12. Which is the third smallest value? (a) 4 (b) -2 (c) -1/3 (d) j (e) -5 c Let f = 14386.0578 + -14386. What is the biggest value in 0.5, f, -2? 0.5 Let o be (-1)/26/(-9). Let h = 14829 + -14848. Which is the fourth smallest value? (a) h (b) -2/9 (c) 2/7 (d) o d Let n be -5 - 12/60(1 - 23). Suppose 3i = 4i - 1. What is the third biggest value in n, i, -0.3, 2/15? -0.3 Let k = -15528 + 15525. Which is the third smallest value? (a) -6 (b) 0.019 (c) 3/8 (d) k (e) 2 b Let l(q) = -7q2 - 17q - 11. Let a be l(-2). Let h be (-294)/390 + 2/13. What is the biggest value in a, 1/4, -0.5, h? 1/4 Let d = -9922/7 - -1434. Which is the third biggest value? (a) 4 (b) d (c) 1 c Let r be 17/26 - (-2)/(-4). Let h be (2 - (-5)/(-3))228/(-152). Which is the third biggest value? (a) -7 (b) r (c) h a Let z be 10 + ((-6)/4 - 9). Which is the smallest value? (a) z (b) 0.2 (c) -160 c Let c = -44 + 45. Let n be (-622)/(-24) - (3/c + -1). Let z = n - 24. What is the second biggest value in 0.1, z, -3? z Let f = -5687.7 + 5686. Suppose 10 = -2l + n, -l - 4n - 4 = 2l. Which is the fourth biggest value? (a) 3 (b) -0.5 (c) f (d) l d Let x = 7.861 + -7.861. What is the fourth biggest value in x, -5, -1, -17? -17 Let y = 1173 + -1172. What is the smallest value in y, 5, 2/23, -1/10? -1/10 Let v = 18.394 - -0.306. Let l = v + -16.7. Which is the biggest value? (a) 3 (b) l (c) 4/7 a Let j = -7/1005 - -1019/2010. Which is the third biggest value? (a) 1/3 (b) j (c) 48 a Let k = 6.097 - 6.497. What is the third biggest value in k, -4, 2, 273/4? k Let q = 550 + -549. Let w be -12q/(-2) + -10 + 7. Which is the second biggest value? (a) 1 (b) -3/7 (c) w a Let b = -11990 - -11994. Let s = -1.3 + 6.3. What is the biggest value in b, 2/7, 0, s? s Let j = 0 + -0.3. Suppose -30u + 1012 = -19u. Suppose 94o = 71o + u. Which is the third biggest value? (a) j (b) -0.09 (c) o a Let f = 0.6 - -2.7. Suppose y - 4t = -10, 11 + 1 = -4y + 2t. What is the third biggest value in 5, f, y? y Let l = 27469 + -27465. Which is the biggest value? (a) -10 (b) l (c) 0.5 (d) -0.5 (e) -4/7 b Let z = -10 + -170. Let q = z - -183. What is the smallest value in -1/3, 1/2, 0.38, q? -1/3 Let h = 19337/8 - 2417. What is the fourth biggest value in 0.1, h, -0.07, 26/3? -0.07 Let j be 71/39 - 45/27. Which is the fourth biggest value? (a) j (b) 0 (c) -421 (d) 0.5 c Let n = 5 + -8. Let w = -11.3 - -6.3. Let z = 0.26 + 0.04. Which is the smallest value? (a) z (b) w (c) n b Suppose -14w + 24 = -18w. Let r be (w/5)/(833/70 - 11). Let j = 4 - 6. Which is the second biggest value? (a) j (b) -0.1 (c) 2 (d) r b Let z = -238 - -242. Let s be (1027/16)/(1 - (-116)/(-112)). Let p = s - -1811. What is the biggest value in z, p, -2? p Let n be 225/(-100)1-4. Let q be -1n2/81. What is the biggest value in q, -1.5, 4, 1/6? 4 Let r = -39 + 35. Let y = 327/70 - 32/7. Which is the biggest value? (a) y (b) r (c) 1 (d) 3 d Suppose 4w + 52o = 55o + 140, 3o - 35 = -w. Which is the second smallest value? (a) -3/4 (b) 0.4 (c) w b Let k = -18234 - -18238. What is the fourth smallest value in -0.7, 0.4, -21, k? k Let t = 0.2 - -0.3. Let n = 86.1 + -85.357. Let g = n + -0.603. What is the third biggest value in -0.4, t, g? -0.4 Let w be 7/5 + 2/(-1). Let c = 64381/5 + -12877. What is the third smallest value in 2/13, c, -5, w? w Let w = -2439 - -2436. Which is the fourth biggest value? (a) w (b) -35 (c) 2/5 (d) 1 (e) 2/13 a Let m = 2.451 - 2.351. What is the fourth biggest value in m, -56, 3, -0.1? -56 Let h = -0.16 - -0.09. Let t = 0.15 + h. Let w = -194 + 194. What is the smallest value in w, t, 3? w Let g = 3.923 - 3.9. Let z = 0.082 - 0.045. Let j = g + z. Which is the third smallest value? (a) 1/2 (b) -2 (c) j a Suppose -4l + 230p - 24 = 232p, 4l + 12 = -5p. Which is the fifth biggest value? (a) 3/7 (b) 5 (c) l (d) -32 (e) 1 d Let o(t) = 1210t + 16940. Let j be o(-14). What is the biggest value in -3, 1.3, -0.21, j? 1.3 Let a = 107 + -168. Let z = a + 60.6. Let s = 65/2 - 33. What is the third smallest value in s, -7, -5, z? s Let l = -135.904 + -0.096. Let i = -139 - l. Which is the second biggest value? (a) 1/6 (b) 4 (c) i a Suppose 4c + 3 = 5k - 10k, -5k = 5c. Let i = 107 + -123.9. Let h = -15.9 - i. What is the smallest value in 4, h, k? k Let f = -475.086 + 0.086. Let x = f - -475.5. What is the third biggest value in 1/7, -3, 2/5, x? 1/7 Suppose -16d + 66 + 11 = 13. What is the fourth smallest value in -1, -0.5, d, -41? d Let h = -25.1 + 25. Let q = 14/3 + -4. What is the third smallest value in h, -2/7, q? q Let m = -3.45 + -0.25. Let f = m - -3.1. Let a = -0.1 - f. What is the third smallest value in -8, a, 0.4? a Let w(b) = b*2 - 17b - 2097. Let i be w(55). What is the third biggest value in -2/23, i, 2, -1, -0.4? -0.4 Let k = -264 - -303. Let g = k + -43. Which is the second smallest value? (a) 4/3 (b) g (c) 3 a Let r(h) = -951h - 950. Let a be r(-1). Let u = -0.4 - -2.4. What is the biggest value in u, 5, a, -1/3? 5 Let t(z) = 8z + 27. Let d be t(5). Let h = -470/7 + d. Let y = 3/28 - h. Which is the third biggest value? (a) 0.2 (b) 3/5 (c) y a Suppose 5b = b + 20. Suppose -bv - 4p + 1 = 7, 2p = -2*v - 4. Let s be (18/16)/(3/v). What is the second smallest value in -1/5, 9, s? s Let q = 822 - 822	{ "pile_set_name": "DM Mathematics" }
the terms in j*2 + 13j*2 + 12j*2 - 8j*2. 18j2 Collect the terms in b3 - 37938957b2 + 37938957b2. b3 Collect the terms in 3405c - 1703c - 1699c. 3c Collect the terms in -4b3 - 6b*3 - 4b*3. -14b*3 Collect the terms in -12t*3 + 4t - t - 3t. -12t*3 Collect the terms in -80o + 41o + 39o + 67o3. 67o*3 Collect the terms in 0d - 15d + 2d*2 + 11d + 4d. 2d*2 Collect the terms in -2 - 31641p + 2 + 31643p. 2p Collect the terms in 4n2 - n - 4n*2 + 199n*3 - 111n*3. 88n*3 - n Collect the terms in 16s*3 + 9s*3 - 7s*3. 18s*3 Collect the terms in 2z - 3z + 2 + 5 + 3. -z + 10 Collect the terms in -57l*2 + 9l*3 + 57l*2. 9l*3 Collect the terms in -17l2 - l2 + 20l2. 2l*2 Collect the terms in -56 + 301 - 245 - 3n*2. -3n*2 Collect the terms in 6s*3 - 3709s*2 - 2 + 3709s*2. 6s*3 - 2 Collect the terms in 39x - 65x - 20x - 26x. -72x Collect the terms in 5o3 - 6o*3 + 58o + 59o + 57o. -o*3 + 174o Collect the terms in -7l + 106l*2 - 4l + 11l. 106l*2 Collect the terms in -32 + 3t*3 + 32. 3t*3 Collect the terms in 4338c*2 - 2175c*2 - 2166c*2. -3c*2 Collect the terms in -651 + 28t*2 + 651. 28t*2 Collect the terms in 661 - 2b - 661. -2b Collect the terms in 4f*3 + 3f*3 + 11f*3 + 3f*3. 21f*3 Collect the terms in -4z*2 + 3z2 - z2 + 4z2. 2z*2 Collect the terms in 18r*2 - 6r*2 - 5r*2 - 11r*2. -4r*2 Collect the terms in -9 - 3 - 3 - 3 + 3v. 3v - 18 Collect the terms in -84w*3 + 297w*3 + 5 - 5. 213w*3 Collect the terms in 72 + 2o*3 + 0o*3 - 33 + 29. 2o*3 + 68 Collect the terms in -16u - 20u2 + 16u. -20u2 Collect the terms in -23s*2 + 27s*2 + 34s*2. 38s2 Collect the terms in u3 + 2u2 - 2u*2 + 0u2. u3 Collect the terms in -4m2 - 3m*2 + 10m*2 + 13m*2. 16m*2 Collect the terms in 9j - j + 2 - 7j. j + 2 Collect the terms in -95c*2 + 50c*2 + 47c*2. 2c*2 Collect the terms in 577 - 577 + 21j. 21j Collect the terms in 5o*2 - 12o2 - o2 - 2o2. -10o*2 Collect the terms in -10a*3 + 5a*3 + 2a*3. -3a*3 Collect the terms in 4w*3 + 12w*3 - 9w*3. 7w*3 Collect the terms in 169 + 2z*3 - 85 - 84. 2z*3 Collect the terms in r - 5 + 5 - 9. r - 9 Collect the terms in -3 + 6t*2 + 4t*2 + 12. 10t*2 + 9 Collect the terms in -5u*3 + 5653 - 5653. -5u*3 Collect the terms in 1 + 5 + 3 + 1 + 3a. 3a + 10 Collect the terms in 4d*2 - 6d*2 - 9d*2. -11d*2 Collect the terms in 12237 - 13m*2 - 12237. -13m*2 Collect the terms in -20l + 25 - 21 - 4 + 19l. -l Collect the terms in -2 + 2 - 8b*2 + 0b*2. -8b*2 Collect the terms in 4 - 17w - 3 - 1. -17w Collect the terms in 81k - 31k - 37k. 13k Collect the terms in 2c*2 - 41400c + 41400c. 2c*2 Collect the terms in 322d*3 + 681 - 681. 322d*3 Collect the terms in 3o - 8o - 2 + 2. -5o Collect the terms in -2g - 4g + 5g. -g Collect the terms in -622w*2 + 211w*2 + 206w*2 + 201w*2. -4w*2 Collect the terms in -53 - 4b - 43 + 96. -4b Collect the terms in 16x*2 + 15x*2 + 8x*2 + 4x*2. 43x*2 Collect the terms in -9z*3 + 211z*3 - 14z*3. 188z*3 Collect the terms in 0a + 17a - 15a. 2a Collect the terms in 3x2 - x2 + 8x3 + x2 + 2x*3. 10x*3 + 3x2 Collect the terms in 105 - 51 - 54 + l. l Collect the terms in -w2 - 6w2 - 6w*2 + 2w*2. -11w*2 Collect the terms in 0s - 10s3 + 13s3 - s2 + 0s. 3s3 - s2 Collect the terms in -3y2 + 3y*2 + 2y*3 - 3. 2y*3 - 3 Collect the terms in -2 + 6 - 4 - 3040n*2. -3040n*2 Collect the terms in -199s + 133s - 259s. -325s Collect the terms in -179 + 179 + 20d*3. 20d*3 Collect the terms in 7b*3 + 12b*2 - 4b*3 + 4b*2. 3b*3 + 16b*2 Collect the terms in -3x*3 + 428x + 6x3 - 428x. 3x3 Collect the terms in -153 - 151 + 304 + 2i*3. 2i*3 Collect the terms in 11n - 3n - 20n + 1. -12n + 1 Collect the terms in -2 + 32j + 5 - 3. 32j Collect the terms in -6 + 9b - 22b + 66b. 53b - 6 Collect the terms in 9w*3 - 16w*2 - 11w*3 + 28w*2 - 12w*2. -2w*3 Collect the terms in 17g*2 + 2 - 2 + 6g*2. 23g*2 Collect the terms in -3i - 60i3 + 57i*3 + 3i. -3i3 Collect the terms in -7 - 6b*3 + 7. -6b*3 Collect the terms in -2z*2 + 41 - 10z*2 - 41. -12z*2 Collect the terms in 86t*2 - 152t*2 + 66t*2 - 6t*3. -6t*3 Collect the terms in -5l*2 + 2l*2 + 0l*2 - 6l*2. -9l*2 Collect the terms in -14d + 10d + 2d. -2d Collect the terms in -18c*2 - 8c*2 + 27c2. c2 Collect the terms in 0k + 11k*2 + 4k - 3k. 11k*2 + k Collect the terms in -10v*2 - 54v*2 - 52v*2 + 18v*2. -98v*2 Collect the terms in 5m*3 - 203 + 407 - 204. 5m*3 Collect the terms in -5f + 20433f2 + 5f - 20435f2. -2f*2 Collect the terms in 0m + 9m - 10m + 10m. 9m Collect the terms in 6l2 - 3l*2 + 2l*2 - 3l*2. 2l*2 Collect the terms in -6y2 - y2 + 10y2 - 4y2. -y2 Collect the terms in -5t2 + 13t*2 - 7t*2 + 0t*2 + 0t2. t2 Collect the terms in 11 - m + 5 - 16. -m Collect the terms in 5c2 - 8c*2 + 21c*2. 18c*2 Collect the terms in 8s - s + s. 8s Collect the terms in -2r*2 - 10r*2 + 3r*2 + 0r*2. -9r*2 Collect the terms in 121u*2 + 1 - 1 + 41u*2. 162u*2 Collect the terms in -1058 - 3b + 1058. -3b Collect the terms in -3g - 519g2 + 517g*2 + 2g + g. -2g2 Collect the terms in -8a*2 + 40a*2 - 40a*2. -8a*2 Collect the terms in 113s - 38s - 34s - 38s. 3s Collect the terms in -8g2 + g2 + 8g*2 - 2g2. -g2 Collect the terms in 18 + 44k2 + 60k*2 - 11k*2 + 40k*2. 133k2 + 18 Collect the terms in o3 - 8o3 - 4o*3. -11o*3 Collect the terms in 5c*2 + 77c + 58c - 135c. 5c2 Collect the terms in 5 + 53b*3 - 4 + 21b*3. 74b*3 + 1 Collect the terms in -4t*2 + 89t*3 - 85t*3 + 4t*2. 4t*3 Collect the terms in -42 + 23 - 9 - 2c. -2c - 28 Collect the terms in 7v + 4v3 - 5v*3 - 7v. -v*3 Collect the terms in w + 0w + 0w + 21 + 0w. w + 21 Collect the terms in 1 - 3b2 + 32b - 1 - 25b. -3b*2 + 7b Collect the terms in 4o2 + 17o*3 - 4o*2 - 62o*3. -45o*3 Collect the terms in 157z - 157z - 11z*2. -11z*2 Collect the terms in -149i*2 + 308i*2 - 151i*2. 8i*2 Collect the terms in 10 - 6u - 10 + 8u. 2u Collect the terms in -139o2 - 41o*2 + 30o*2. -150o*2 Collect the terms in -11r + 40r - 15r - 3r. 11r Collect the terms in -9d - 38 + 79 - 41. -9d Collect the terms in -230h2 + 694h*2 - 229h*2 - 237h*2. -2h*2 Collect the terms in 55 - 37i*3 + 38i3 - 55. i3 Collect the terms in -p*2 + 14p*2 - 9p*2 + 2p*2. 6p*2 Collect the terms in 1 - 2d - 4d + 9d + 0. 3d + 1 Collect the terms in 12w3 + 134 - 71 + w3 - 63. 13w3 Collect the terms in -4z*2 - 9z*2 + 0z*2. -13z*2 Collect the terms in -8v - 65 + 33 + 32. -8v Collect the terms in -y2 - 6y*2 - 3y*2 + 13y*2. 3y*2 Collect the terms in 27k*2 - 68k*2 + 33k*2. -8k*2 Collect the terms in 172h*2 - 333h*2 + 169h*2. 8h*2 Collect the terms in 7f2 - f2 + 4f2 - 3f*2 - 4f*2. 3f*2 Collect the terms in 6w*3 - 193w + 399w - 206w. 6w3 Collect the terms in -10 + 10 + 88v*2. 88v*2 Collect the terms in 1 - 4 - 109i + 103i. -6i - 3 Collect the terms in -36c + c2 + 3c*2 - 5c. 4c2 - 41c Collect the terms in -25z - 1 + 1 + 38z - 3z. 10z Collect the terms in -40z - 23z + 84z - 25z. -4z Collect the terms in -12f*3 - 8f*3 + 6f*3. -14f*3 Collect the terms in 32 + 30 - 62 + 22i. 22i Collect the terms in 1 - 90y + 87y + 2. -3y + 3 Collect the terms in -15m - 13m + 52m - 17m. 7m Collect the terms in -9w*2 + 7w*2 + 24w*2 - 10w*2 - 10w*2. 2w*2 Collect the terms in 7b*2 - 6b*2 + 4b*2. 5b*2 Collect the terms in 9z*2 + 7z*2 + 5z*2. 21z*2 Collect the terms in 28y*3 + 10y*2 - 10y*2. 28y*3 Collect the terms in 8 - 1 - 4 - 3 - 4x*2. -4x*2 Collect the terms in 4 + 1265804z - 1265812z - 4. -8z Collect the terms in 96u - 9u*3 - 96u. -9u*3 C	{ "pile_set_name": "DM Mathematics" }
ve. y(-79/11) Simplify (u(-17)uu)(-3/8) assuming u is positive. u(45/8) Simplify (ooo*3oo)/((o(-2)o)/o)o(-6)oo(o/(oo(3/7))o)/oo assuming o is positive. o(39/7) Simplify (ff1/f)(10/11)f6/f(-2) assuming f is positive. f(98/11) Simplify (f(2/7)ff(3/5)ff)/((ff/(f/(f*2ff)))/f)(-34) assuming f is positive. f(4896/35) Simplify m(-4/15)mm(-5/2)m assuming m is positive. m(-23/30) Simplify j(6/7)j(-1/6)/jj((j(-2/3)/jj)/j)(-32) assuming j is positive. j(2269/42) Simplify cc(-9)c*(-7/3)(c(2/7))(-1) assuming c is positive. c(-223/21) Simplify (y/y4)(-14) assuming y is positive. y42 Simplify (z*(-13/2)z)/(zzzz(-10/13)z) assuming z is positive. z*(-227/26) Simplify (jjjjjj/j*(-11/3))/(jj(-2/21)) assuming j is positive. j(184/21) Simplify r/r*10(r/r(2/125))/r assuming r is positive. r(-1127/125) Simplify (kkk(-1/2))(-42)k4k((kk((k/(kkk6k))/k)/k)/kk)/k assuming k is positive. k(-67) Simplify (((mm*(-1))/m)/(mm(1/9)/m))/(m/m2m)(-7) assuming m is positive. m(-10/9) Simplify b(2/3)/(b/b7) assuming b is positive. b(20/3) Simplify (oo/(oo(-2/5)/o))(-35)/(o(-6)/(o/o(2/9))) assuming o is positive. o(-695/9) Simplify (k/(k/(kk*(2/17)/k))kk/(k/k4))/(k1)(-47) assuming k is positive. k(886/17) Simplify (t(-2/5)/t)(1/24)t*6/(ttt(-1/4)t) assuming t is positive. t(383/120) Simplify (m/(m(2/9)/m))*(1/8)(mmmmm*(1/6)mm)/(m/m6) assuming m is positive. m(205/18) Simplify ((yy/(y*(2/13)y))/yy)/y3(y*(3/5)y)/(y/y0) assuming y is positive. y(-101/65) Simplify (qqq*(1/4)qq)47(q/(q*1q))(3/8) assuming q is positive. q(1595/8) Simplify (bbb/(bb(-28)b)b)/b1 assuming b is positive. b29 Simplify (s9s(2/7))(-3) assuming s is positive. s(-195/7) Simplify (d(-2/3))23/(d(-1)/d)(-33) assuming d is positive. d(-244/3) Simplify (((((z/(z/z*(2/7))z)/zzz)/z)/z)(-41))(-31/4) assuming z is positive. z*(1271/14) Simplify (rr/(r(r/(r/(((r/r(1/2))/r)/r)))/rr))*(2/25)(rr/r2rr)/((rr(-2/5))/r) assuming r is positive. r(13/5) Simplify (m/m24)(-3/7) assuming m is positive. m(69/7) Simplify (c6/c(2/29))38 assuming c is positive. c*(6536/29) Simplify (bb*12bbb)/((bb22)/bb) assuming b is positive. b(-7) Simplify (t(-9)/((t*(2/5)t)/t))(-40) assuming t is positive. t376 Simplify p*(5/9)/(pp(pp*(4/11))/ppp) assuming p is positive. p(-377/99) Simplify (t(-30))(-2/35) assuming t is positive. t(12/7) Simplify (o/(o(-7)/o)oooo8o)(-13/3) assuming o is positive. o(-91) Simplify (t*(-2/13)tt6)25 assuming t is positive. t(2225/13) Simplify (b1/b)(-26)((bbbbb*(2/9)bb)/b)/(b(b/(b/(b*(-2/13)b)))/b) assuming b is positive. b(512/117) Simplify (a(3/5)(aa(-3))/a)/((a(-1/2)/a)/a)(-26) assuming a is positive. a(-337/5) Simplify (r*(-13/4)/r)/((r/(rr(-2/39)))/r) assuming r is positive. r(-515/156) Simplify t(-20)/t(-11) assuming t is positive. t(-9) Simplify l23lll/l(-5/6)ll assuming l is positive. l(173/6) Simplify c16/cc(-5/2) assuming c is positive. c(25/2) Simplify ((c(2/5))(-29))(5/16) assuming c is positive. c(-29/8) Simplify (y/(((yy/(y(2/3)/y)yy)/y)/y))(-37)/((y3/y)/(yy/(y/(yy(-1)/y)))) assuming y is positive. y(142/3) Simplify c(7/2)/cc(-1/14) assuming c is positive. c(17/7) Simplify (c/c(2/7))50c(c*(2/11)c)/ccc(c0/c)/c assuming c is positive. c(2841/77) Simplify (ww/w*(-1/7)w/(ww1w))/(w(2/5))9 assuming w is positive. w(-121/35) Simplify n(-5)nn(-17) assuming n is positive. n(-21) Simplify (i/(ii(-5)i)ii)(-2/7) assuming i is positive. i(-12/7) Simplify g(1/34)/g(1/3) assuming g is positive. g(-31/102) Simplify (((w6w)/www)/(w(2/5)w))47 assuming w is positive. w(1551/5) Simplify (j/(j*(-7)j))(38/5) assuming j is positive. j(266/5) Simplify (j/j(-1/4))(-16/3) assuming j is positive. j(-20/3) Simplify (i0(i/(i(-3/8)i))/i)/(ii(-1))(-12/5) assuming i is positive. i(-5/8) Simplify (o(4/21)o)/(o/o*(2/21)oo) assuming o is positive. o(-12/7) Simplify (((uuu/(uuu(2/3))uu)/u)/(uu*(-1)u))/(u*6uuu*(-4/5)u) assuming u is positive. u(-118/15) Simplify (l(-2/3))*(-1/27)l/(ll(2/5)ll)l(1/5) assuming l is positive. l(-881/405) Simplify ((hh/(hh*(-3))h)/(h*6h))(-19) assuming h is positive. h38 Simplify (((p/p(8/13))/p)/p)/(((p(21/5)/p)/p)/p) assuming p is positive. p*(-183/65) Simplify ttt(-1/23)t9 assuming t is positive. t(252/23) Simplify ((i8/i)/i)44 assuming i is positive. i*264 Simplify ((q(q(q(-2/25)/q)/q)/qq)/qq/(q1qq))/(q(2/7))(20/11) assuming q is positive. q(-6929/1925) Simplify ((y/(yy*0yyy))(-4/7))(-7/6) assuming y is positive. y*(-2) Simplify ss/(((s/s*(-9/11))/s)/s)sss(8/7) assuming s is positive. s(410/77) Simplify (aa(2/5))(-6)(a/a(2/7))/a(-5) assuming a is positive. a(-94/35) Simplify (c(2/23)/cccc(-2/7)/c)/(c4cc(2/15)) assuming c is positive. c(-12877/2415) Simplify i10ii(-5)/i assuming i is positive. i5 Simplify (c/c11c9)31 assuming c is positive. c*(-31) Simplify (((t/(t/(t/(t(tt(2/5)t)/t)))t)/t)(35/4))45 assuming t is positive. t(-2205/4) Simplify (f/f0)(-1/15)f*(-2/9)/((ff/f(-1/8))/f) assuming f is positive. f(-509/360) Simplify ((i(ii*(-3/7)/ii)/i)/i(-1))24 assuming i is positive. i*(264/7) Simplify (ooo(-8))/(o/(ooo(-2/55)o)o) assuming o is positive. o(-277/55) Simplify (d5(((ddd*2d)/d)/d)/d)/(d(2/5))(-8/9) assuming d is positive. d*(331/45) Simplify ((z/(z(zz/z7)/z))/(zz7))/(z(-1))50 assuming z is positive. z48 Simplify ((rr/r17)/r)/r10 assuming r is positive. r(-26) Simplify (nn/(n/(n24/n)))(-11) assuming n is positive. n*(-264) Simplify (w((w/(ww/(w/(w(((ww/(ww*6w)w)/ww)/w)/w)))w)/w)/ww/((www(-5/6))/w))/(w(7/5)w(-7)/w) assuming w is positive. w(403/30) Simplify (g(-6)/g6)(2/19) assuming g is positive. g(-24/19) Simplify (l/((((l/(ll*(-2/3)))/l)/lll)/l))38/(l(-4/9)/ll/l(2/3)) assuming l is positive. l(466/9) Simplify (p(pp/p*(-5))/ppp(-2/7))/(p0p8) assuming p is positive. p(-2/7) Simplify (uu(2/25)u(-2))/(((u(-3)u)/u)/u)(1/7) assuming u is positive. u(-61/175) Simplify ((r3/r)/rr)/r*0r*(-5)r/((rr0)/r)r assuming r is positive. 1/r Simplify ((rr2)/r)33 assuming r is positive. r66 Simplify (i(-1/3)/i)(-21/5)/(i(-1/7)i/(ii/i1)) assuming i is positive. i(201/35) Simplify (d9d)(3/13) assuming d is positive. d(30/13) Simplify ((dd(-2))27)(4/23) assuming d is positive. d(-108/23) Simplify (t(-2/21)t)/t(-6) assuming t is positive. t(145/21) Simplify r(-26)/((r/(r(3/19)/r))/rr) assuming r is positive. r(-529/19) Simplify (f(-1/5))(4/7)f/(f/f*(-9)f)ff(-3/2) assuming f is positive. f(-743/70) Simplify (dd21/d)(3/11) assuming d is positive. d(63/11) Simplify m(-2/3)/(mm(-6/13)) assuming m is positive. m(-47/39) Simplify (bb/b(-2/7)bb(2/27)b)/(b*(-11)/bb(1/5)) assuming b is positive. b(15271/945) Simplify (qq(-1)q)*(1/23)(q(-5/4)/q)/((q(-2/23)q)/q) assuming q is positive. q(-195/92) Simplify (k(1/3)/kk3)/(k(-5/2)/(k/k(-8))) assuming k is positive. k(83/6) Simplify (((w/w*(4/5))/w)/ww(-2/19)/w)41 assuming w is positive. w(-11316/95) Simplify (d(-2/25)/dd)40 assuming d is positive. d(-16/5) Simplify (v4/v)/(v/(v(-1/3)v))v(-6)v/(vv((v(v/((vv*6v)/v))/v)/v)/vvv) assuming v is positive. v(5/3) Simplify d(-4)/(d/d*(4/5))d4/((d(-4/5)d)/d) assuming d is positive. d(3/5) Simplify (d/d1)(-26)((d/(d(-1/2)/d))/d)(10/13) assuming d is positive. d(15/13) Simplify (h/h(1/7))(3/5) assuming h is positive. h(18/35) Simplify (fffff1/f)/(f0/ff)(ff(-2/9)/f)(2/11) assuming f is positive. f(392/99) Simplify ((yy/(y/(	{ "pile_set_name": "DM Mathematics" }
of -17x4/24 + 14x*3 + 117x*2. Let v be f(5). Which is greater: 3/62 or v? 3/62 Let m = -230 - -229.93. Let d = 61 - 60. Is m <= d? True Suppose -y + 5 = -52m + 51m, 5y - 5 = 0. Let v be (31/(-3))/((-8)/(-3)). Which is smaller: v or m? m Let m = 11.93 + 0.07. Suppose -8u = -0u - 24. Suppose -un + 3 = -3. Is n less than or equal to m? True Let d be (4/(-6))/(420/69300). Which is smaller: d or -97? d Let l be -25 - 5(-6409)/145. Suppose u - 78 - 118 = 0. Is l smaller than u? False Let g(l) = l*2 + 8l - 26. Let i be g(-11). Suppose -i = h + 17. Let k = h - -33. Is 8 not equal to k? True Let a(x) = -x*3 - 34x*2 + 48x + 12. Let r be a(-35). Do 1/3 and r have the same value? False Suppose -2u + 325 - 319 = 0, -4v = -3u - 67. Which is smaller: v or 15? 15 Let s be 98/2 - (2 - 1). Suppose -81x + 143x = 16x + 2300. Which is smaller: x or s? s Let r = -38702 - -194488/5. Let w = 192 - r. Suppose 0 = 3o + 17 - 5. Is o at least as big as w? False Let o be 2/(-6)-13. Let y be 72/(-30) - (-4)/10. Let q be 2/(y - 0) - (12 - 16). Which is smaller: o or q? o Let q = -10084.38 + 10227. Let j = 0.38 + q. Which is bigger: 2/5 or j? j Suppose -3t + 6t = -69. Let p be t/(-3) + (-16)/24. Let s(c) = -2c + 11. Let u be s(p). Is u less than -4/7? True Let r be 1(-72)/15(-110)/33. Let j be (-387)/((-18)/r - (-3)/24). Is 388 greater than or equal to j? True Suppose 4y + 3n - 52 = 4n, 34 = y + 5n. Suppose 2b + 5p = -13, 0p - 3p = -5b + y. Let f = 206603/3 + -68867. Which is smaller: b or f? f Let s(q) = -3q*2 + 16q - 307. Let y be s(22). Is y >= -1407? True Suppose -m - m - 24 = 5u, 2u + 2 = 3m. Let y be (66/(-55))/(m/(-545)). Let d = -10793/33 - y. Is 0 smaller than d? False Suppose 0 = -5a - 5z + 10z + 140, -3a - 5z + 52 = 0. Let j be (9 + 2)(112/a)/(-7). Is j at least as big as -0.2? False Suppose 95h - 92h = -141. Which is bigger: h or -335/7? h Suppose 768w = 280w - 2928. Which is smaller: w or 613? w Let g = -63581/15 - -4231. Let a be (1633/355)/(3/(-5)). Let s = a - g. Is 1 != s? True Let o = 11/78 - 569/5694. Are o and 10 equal? False Let j be -35 - -36 - 763/769. Which is smaller: 0 or j? 0 Suppose 0y = -2y - 4c + 22, 4y - 3c - 22 = 0. Let p(k) = -k*2 + 6k + 16. Let o be p(8). Suppose a - 1 - 3 = -3v, -2a + 4v + 8 = o. Is y bigger than a? True Suppose 2g + 0a = -4a + 16, 0 = g + 3a - 11. Suppose 3s - 6s = -12. Does s = g? False Suppose -15n + 112 = -8n. Suppose 6 = k + i - 3, 4i = n. Suppose 4 = 3a - w, -9a + ka - w - 4 = 0. Is 3/38 at most as big as a? False Let c = -260401/56610 + -1/11322. Are -2/11 and c unequal? True Let s(l) = 2l*3 - 9l*2 + 8l - 21. Let i be s(6). Suppose -p - 2v - i = 0, 3p - 3v - 2v = -350. Is p at most -127? False Let a be -13 + (-2080)/2064-9. Is a equal to -5? False Let n = 4 + 14. Let k = -815 + 814.651. Let b = 0.149 + k. Which is bigger: b or n? n Let l = 136/35 - 18/5. Let g = 194 + -232. Let c be ((-162)/6)/(-9) + g/6. Which is smaller: c or l? c Suppose -7x + 189 = 343. Let i be 1(75/(-7) + (-6)/21). Are i and x nonequal? True Suppose k + 10718 = g, -k = 4g + 13687 - 56564. Let w = 106509/10 - g. Let h = w + 68. Is -1 != h? True Let m(t) = 4t3 - 12t*2 + 5t - 8. Let v be m(3). Is 175 not equal to v? True Let t = -6229 - -1102535/177. Is -1 >= t? False Let c(h) = -4h + 13. Let x be c(3). Let s be ((-1)/x)/(18/(-120)). Suppose y - 52 = 2a, -3a - 53 - s = -4y. Are a and -28 non-equal? False Let c = -307 - -314. Let a be (-3)/12 + ((-756)/32)/c. Is a < -3? True Let r = 18894 + -207489/11. Is r equal to 31? False Let x(n) = n2 + n - 1. Let v(a) = 3a*2 + 16a - 5. Let z(m) = -v(m) + 4x(m). Let f be z(12). Let l be 0/(-2) + (-9)/162. Is f at least as big as l? True Let c = 0 + 3. Let n(z) = z - 17 + 16 - c. Let r be n(3). Which is smaller: r or -4/35? r Suppose 12x = 13x. Suppose -3p + 5 = 5z - 0z, -2p + 5z + 45 = x. Suppose -9 - p = -l. Which is greater: l or 17? l Let g(l) = 327l2 + 2l + 1. Let d be g(1). Let r = d - 479. Which is smaller: r or -150? -150 Let r be 44(2 + 28/(-16)). Let u(i) = 9i - 39. Let m be u(r). Is m < 1? True Let p(m) = m2 - 12m + 7. Suppose -1 = -v - 2l - 0, 0 = 5l + 10. Let d be p(v). Let r be 4/((4/30)/(d/35)). Is -22 <= r? False Let n be ((-96)/(-224))/(13/(-7) - -2). Suppose c = 5q + 271, -5q + nq + 3c = 98. Is -55 less than q? False Suppose -w + 46 = -3f + 214, 0 = 4w + 2f + 490. Let h = -155 + 27. Are w and h nonequal? True Let y be (6 + 273/(-98))(24/25)/6. Let h be 15/6 - (-1)/(-2). Is h greater than or equal to y? True Let l = 3.76 + -3.8114. Let g = 0.1514 + l. Which is smaller: g or -6.9? -6.9 Let k = -2/78157 - 133492118/1484983. Let g = k + 90. Which is bigger: g or -0.4? g Let r = -2 + 7. Let j be 0 + (-16)/4 + (-26)/(-6). Is r bigger than j? True Let f = 11390 + -11388. Is f < -50/21? False Suppose -3d - 97 = h + 912, 3h = -d - 3067. Does -1029 = h? False Let w be (-116)/(-87)36/(-168). Suppose -9 = -2t + 3t. Let y = 35/4 + t. Is w smaller than y? True Suppose 27s + 1749 = 38s. Let r be s/(-285) + ((-132)/(-20))/11. Which is bigger: -1 or r? r Let k = -38385/7 - -5499. Let f = k + -467/28. Let h(d) = 2d*2 + 68d - 2. Let l be h(-34). Which is smaller: f or l? l Let u = 224.2 + -208.2. Is 1/15 not equal to u? True Let x = -2597 + 2642. Do x and 44 have different values? True Let u be (-10)/(-30) - 38/(-3) - -1. Let g be -1 + 45/15 + u/(-8). Is 2.3 at least g? True Suppose 3r - 9 = 0, -4f - 3r = 10 + 5. Let n = 120 - 106. Let j be n/6(6 - (f - -4)). Is 18 greater than or equal to j? False Let b be 346/(-42) + 1/(-3) + -2. Suppose 18m - 16m - 22 = 0. Suppose 15u = mu - 48. Is u < b? True Let x = -503/38 - -1268215/95798. Is -1 at most as big as x? True Let p be -2((-27)/2)/(-9). Let x be 145/(-140) + (p - 30/(-8)). Is -159 != x? True Let x = 0.019 - 4.919. Let n = -96.9 - x. Let c = -96 - n. Which is smaller: c or 1? c Let i = -150 - -30. Let b = i + 119.9. Which is greater: b or -1/3? b Let m be (-6)/248(-13)/(-195)35. Is m at most 1? True Suppose 0o + 2 = o. Let h = -2531 - -2531. Which is smaller: o or h? h Let b(d) = d*2 - 9d - 6. Suppose -6c = -c - 40. Let o be b(c). Suppose 239 = -86l - 793. Does l = o? False Let z(k) = -20k - 232. Let w be z(-20). Is w > 166? True Let d = 1125 - 1313. Let g = 136 + -324. Is g > d? False Let x = -68.04 - -67.8. Which is smaller: x or 9/7? x Let i be -26 + 255 + (4 - -1) + -1. Suppose 0 = -6q - 247 - i. Let j be (7 - q/(-12)) + (-40)/6. Which is bigger: j or -5? -5 Let r be 1 + 1/(6 + -5). Suppose -rj = 10, -3c = 4j + 19 - 2. Which is bigger: -29 or c? c Let l = -83.75 - -0.75. Let p = l + 82.9. Is p smaller than -13/14? False Let f = -4351.19 - -4344.19. Let m = 0.2 - 0.3. Let q = m + 0.2. Which is greater: f or q? q Suppose 2k - 4k = 3b - 16, 3k = 15. Let t be b/((-12)/586) + (-6)/18. Let r = t + 683/7. Which is bigger: 1 or r? 1 Let w(i) = 30i*2 + 10i + 66. Let v be w(-9). Suppose 1314 = -30g - v. Does -123 = g? False Let z be (-127 - -129)((0 - 3) + 0). Let f be 4/(-6) - 88/3. Let j be 2/z + 20/f. Is j smaller than -2/3? True Suppose -27o = -29o + 120o - 4838. Let a be 0/2 + 61. Suppose t = 2g + o, -ag - 2 = -4g. Is t != 40? True Let a be 0/(-1) - (-2 - -2). Let g be 12/(-46) + 8526/6762. Which is smaller: a or g? a Suppose -2d + 59 = -5y, -26 + 72 = 5d + 2y. Is 84 smaller than d? False Let d = -476 + 523. Let x = d + -49. Which is bigger: -89 or x? x Let i(k) = k2 - 24k + 17. Let f be i(24). Let t = 3923/7 + -544. Is t > f? False Let z = -2699 - -1300. Is -1399 at least as big as z? True Let z = -953/60 + 71/4. Suppose q - 2k = 12, 13q - 17q + k = -13. Is q != z? True Let b = -37/23 + 6609/4094. Which is smaller: 1 or b? b Suppose 3p = 4p - 3. Suppose t = -2a + a + 3, 3a = -t + 5. Suppose -v - 3s = 2s - 3, v + ts = 3. Is v at least as big as p? True Let q(n) = -n*2 + 124n - 596. Let r be q(119). Which is bigger: r or -57/116? -57/116 Let s = 530 + -535.25. Let z = s + 5.15. Is 0.073 smaller than z? False Let v be (13806/8)/(873/3492). Which is smaller: v or 6899? 6899 Let d(v) = -12*v - 136. Let q be d(-15). Let x = q - 566/13. Are x and 0 nonequal? True	{ "pile_set_name": "DM Mathematics" }
(4)). 5sqrt(17)/2 Simplify (-1sqrt(22)-2 - (1sqrt(1782) + sqrt(1782)))/(sqrt(44)/sqrt(144) - sqrt(110)/(sqrt(40) - sqrt(10))). 96sqrt(2)/5 Simplify (63((sqrt(162) + 0 - sqrt(162))-4 + sqrt(162)))2 - (-3 + 2 + (sqrt(100)/sqrt(2) + -5)2). 50sqrt(2) + 52414 Simplify 3 + (((-1sqrt(256) + sqrt(16))4-6)/((sqrt(576)/(sqrt(12) - sqrt(48)))/(sqrt(18)/sqrt(3)-6)))2. 373251 Simplify -3(-4(sqrt(20)/(sqrt(10)-1) - sqrt(8)/sqrt(4)5) - 5(-3 + (sqrt(2) - (-3 + (sqrt(8))*2)))). -120 - 57sqrt(2) Simplify ((sqrt(12) - (sqrt(1452) + -2sqrt(1452))) + -2-1sqrt(243) - (3sqrt(3)2 + -5 - (1 + sqrt(12) + sqrt(9)/sqrt(3) + -1)))2. 390sqrt(3) + 4588 Simplify ((((sqrt(187) - (sqrt(187) - sqrt(187)3))4 - sqrt(187))-3)/(-3(sqrt(176) - (2sqrt(176) + sqrt(176) - sqrt(176)))))2. 2057/16 Simplify 54(sqrt(300)-4)*2 - (((sqrt(147) - (sqrt(147) + 1)) + 2 - sqrt(147))6)*2. 504sqrt(3) + 90672 Simplify ((1((sqrt(2736) + 1)-6 - (sqrt(2736) + -3-1sqrt(2736))) + -3)*2-1 + -4)1. -273685 - 2160sqrt(19) Simplify -3(4 + (5 + (sqrt(832)-2 + -3)-3 + -4)2)-6. 17280sqrt(13) + 541008 Simplify (4(sqrt(77) + (sqrt(77) + (5sqrt(77) - sqrt(77)) + sqrt(77) - sqrt(77))5)-4)/(-6(5sqrt(175) - sqrt(175))3). 52sqrt(11)/45 Simplify 0 + ((sqrt(95) - 21sqrt(95)) + sqrt(95) - sqrt(95) - (sqrt(95) - sqrt(95)-1)5)/((sqrt(405) - -1sqrt(405)) + sqrt(245)-1 + sqrt(245)). -11sqrt(19)/18 Simplify (2sqrt(68)3)/((sqrt(16)2)/sqrt(4)) + (sqrt(204)-1)/sqrt(3) + (-1 + 1 + sqrt(1377) + sqrt(1377))*2. sqrt(17) + 5508 Simplify (-4(-2 + (3 + 0 + sqrt(243))-3)-35)2. 2138400sqrt(3) + 8308800 Simplify (sqrt(576) - (2sqrt(576)-4 + sqrt(576)))/(-1sqrt(12)-1) - (0 + (4-2sqrt(147) - -2(sqrt(147) - (0 + sqrt(147)))2)). 88sqrt(3) Simplify -1(4 + (-4 + 2 + -5 + (sqrt(405) + -1)-25)2). -40513 + 540sqrt(5) Simplify sqrt(110)/(sqrt(70)/sqrt(7) + sqrt(10)) - (sqrt(275)-3 + sqrt(11)) - (-5sqrt(66)/(sqrt(294)6))2. -275/1764 + 29sqrt(11)/2 Simplify (-1 + (-5 + sqrt(539)1)4 - (-1-4(sqrt(11) + sqrt(11)-1 + 5 + sqrt(11)))22)6. -7038 - 1752sqrt(11) Simplify (3 + -2(sqrt(720) + 2) + ((sqrt(125) - sqrt(5))-2 + 1)6)2 + 1. -720sqrt(5) + 25946 Simplify ((-3 + -2 + 4(sqrt(700) - (sqrt(700) + -1)) + 5 + -1 + sqrt(700) + -4)-4)*2. -320sqrt(7) + 11216 Simplify (-5 + (sqrt(275)-2 + -2 + 3 + (sqrt(275) + 4-1sqrt(275) - sqrt(275)) + ((-1 + sqrt(275))1 + sqrt(275) - sqrt(275)) + sqrt(275))-2-3)*2. 1200sqrt(11) + 158425 Simplify ((sqrt(95)/sqrt(5) - sqrt(19)) + 4 + sqrt(19) + 0 + 3)*21-36 + -5. -1229 - 252sqrt(19) Simplify (sqrt(17) - (sqrt(136)3)/sqrt(8)) + 2sqrt(17)-3 - (-2(0 + sqrt(2057) + 1 - sqrt(2057)))2. -8sqrt(17) - 4 Simplify (2(sqrt(405) + -1)-4 + -1 + sqrt(180) + 2 + sqrt(1620))*2. -864sqrt(5) + 11601 Simplify (((2sqrt(168) - sqrt(168))-6)/(-1sqrt(16)/sqrt(4)))/(((-2sqrt(252))/sqrt(6))/(sqrt(567)-1)). 27sqrt(7) Simplify ((sqrt(95) + (sqrt(95) + 4sqrt(95) + sqrt(95))-5 + sqrt(95) + sqrt(95) + (sqrt(95)-2-3 - sqrt(95)))/(sqrt(360)/sqrt(8) + sqrt(720)-3))2. 76/9 Simplify 5((5(sqrt(325) - (sqrt(325) + 1))1 - 3(sqrt(325) + 1)2) + -1)*2. 3600sqrt(13) + 59220 Simplify 6(41sqrt(77) + -2sqrt(77)-1)/(4(sqrt(567) - sqrt(567)-1)). sqrt(11)/2 Simplify (2(-21(-3 + -3sqrt(1584) + -3)-6 + -2))*2. 255744sqrt(11) + 8233360 Simplify -4 + 54(sqrt(304))*21 - ((sqrt(266)1)/sqrt(7))/(sqrt(98) - (sqrt(98)-2 - sqrt(98))). -sqrt(19)/28 + 6076 Simplify 6(6-2sqrt(5) - (sqrt(45)1 - sqrt(45)))*2 - ((2sqrt(405)6)2 + 3). -54003 Simplify 2(2sqrt(720)-1 + 5 - (5 + sqrt(720) + 3 + sqrt(720) + 2 + sqrt(720)))*2. 1200sqrt(5) + 36050 Simplify -1(-1(0 + 4 + (sqrt(1008) - (2 + 3sqrt(1008))) + sqrt(1008) + sqrt(1008) + (-6sqrt(1008)2 - sqrt(1008))))2. -170356 + 624sqrt(7) Simplify 2((3sqrt(637)-1)2 - sqrt(143)/(sqrt(11) - sqrt(11)2-5)). -2sqrt(13)/11 + 11466 Simplify -4 + (-1sqrt(686)1 + sqrt(686))/(-3sqrt(98)1). -4 Simplify 6(-4sqrt(88)/(sqrt(1584) + sqrt(11)))/(-3(sqrt(4) - sqrt(100)) + (sqrt(48)/sqrt(3) - sqrt(16)))-6. 12sqrt(2)/13 Simplify ((0 + sqrt(2736))5 - ((0 + sqrt(2736)-3 - sqrt(2736)) + sqrt(2736)) - (0 + (3 + sqrt(2736)-2 - -2sqrt(2736)-3)))*2. -1152sqrt(19) + 700425 Simplify (sqrt(19) + (sqrt(19) - (sqrt(76)/sqrt(4) + -3)*2) - 4(sqrt(19) + 0) - (sqrt(2736) + 1 - (sqrt(1216) + 0))*2)6-3. 72sqrt(19) + 5994 Simplify (sqrt(567) + 1)*2 - (sqrt(14)/sqrt(2) + sqrt(7))2 - (2sqrt(847) + -1) - (sqrt(21)/(sqrt(33)/(sqrt(44)/sqrt(4)) + sqrt(3)) + 0 + sqrt(700) + 0). -37sqrt(7)/2 + 569 Simplify (sqrt(3)2-2 + -1 + sqrt(147) + 1 + 0 + -4 + sqrt(27)-5)2. 96sqrt(3) + 448 Simplify (-5((sqrt(130) - (-5sqrt(130) + sqrt(130))) + sqrt(130) + sqrt(130) - sqrt(130)) - -4sqrt(130)-1)/(-5sqrt(810)4-4). -17sqrt(13)/360 Simplify -4 + -4 + 4 + ((sqrt(130)-1-1)/(sqrt(120)/(2sqrt(12))))2 + -4. 44 Simplify -1-6(((-2sqrt(1539) - sqrt(1539))-4 - (3 + 3sqrt(1539) - sqrt(1539))) + 2)*2-1. -923406 + 1080sqrt(19) Simplify (-6-4(sqrt(1100) + (sqrt(1100) - -1sqrt(1100)) + -2 + 6(sqrt(1100) + -1) - (sqrt(1100)-2 + 1)-6))2. 69120sqrt(11) + 5704704 Simplify -4(((sqrt(288) + -2)-5 - (sqrt(288) - 5sqrt(288)-1)) + 5 + 1). -64 + 528sqrt(2) Simplify (sqrt(68) + -1 + sqrt(68) + -5 + 1 - (((sqrt(204) + (sqrt(204)1 - sqrt(204)))-4 + sqrt(204))/(sqrt(48)5))*2)5. -653/20 + 20sqrt(17) Simplify ((sqrt(153) + sqrt(153) + sqrt(153)2-1 + sqrt(153))/(sqrt(108)/(sqrt(12)-2 + sqrt(12))) + 1(5 + sqrt(1377)2 + 3 + 2sqrt(1377)))2. 560sqrt(17) + 20889 Simplify ((1sqrt(960))/(2sqrt(80) + sqrt(80) + sqrt(80)) - 4sqrt(6)/(sqrt(2)-4)6)3. 39sqrt(3)/2 Simplify (-3(sqrt(2106) + sqrt(2106) + sqrt(2106) + sqrt(2106) + 6(sqrt(2106) + sqrt(2106)2)))/(-1sqrt(72)11). 99sqrt(13) Simplify -1 + -2 + (-3 + (sqrt(200) - (2 + sqrt(200)))*2 + sqrt(200) - sqrt(200)) + (sqrt(8) + -4sqrt(8)3)/(sqrt(36)/(sqrt(9) + sqrt(144))). -55sqrt(2) - 2 Simplify 3(-5(sqrt(325) + 1 + sqrt(325)1 - sqrt(325) - (sqrt(208) + -1 + sqrt(208) + 0)))2. -900sqrt(13) + 9075 Simplify (1 + -4(sqrt(567)-2 + -5)*2 - ((sqrt(567) + 3)-1 + -3 + (sqrt(567) + -1 - sqrt(567)) + sqrt(567) + sqrt(567))*2)-1. 594sqrt(7) + 9787 Simplify 4 + (((sqrt(24) - sqrt(96))/sqrt(12))2 + 0 + sqrt(2) + 1)-3 - (((1sqrt(162))2 + sqrt(162))1 - (0 + sqrt(288) + 1)). -166 Simplify (3 + -2 + 1 + 5 + sqrt(175) + ((0 + sqrt(175))6 - sqrt(175)25))2. -210sqrt(7) + 1624 Simplify 2(-1 + sqrt(684)) + -4 + sqrt(19) + -2 + -2 + (sqrt(114)-2 + sqrt(114))/sqrt(6). -10 + 12sqrt(19) Simplify (((6sqrt(88)-3 + sqrt(88) - sqrt(88))-2)/(52sqrt(1331) + sqrt(1331))1)2. 10368/14641 Simplify ((-2(sqrt(204) + (-1sqrt(204)-4 + sqrt(204) - sqrt(204)) + sqrt(204))1)/(-4sqrt(972) + sqrt(972) - sqrt(24)/sqrt(72)))*23. 264384/26569 Simplify 2(sqrt(133) - (sqrt(133) - (sqrt(133) + sqrt(133) + sqrt(133) + -2sqrt(133)-2)))/sqrt(7) - ((-3 + sqrt(2736))-4 + -1). -11 + 62sqrt(19) Simplify ((2 + 6sqrt(98) + 1)2 + -4 + (sqrt(98) - sqrt(98)-5) + -5-3sqrt(98))*2. 924sqrt(2) + 106726 Simplify (1 + sqrt(1331) + -5 + -1 + sqrt(1331) + sqrt(1331) + (sqrt(1331) + 1 - sqrt(1331)) + sqrt(1331) + 4 + 4(sqrt(1331) - -5-2sqrt(1331)) + 0 + -4)2. 2816sqrt(11) + 1362960 Simplify (sqrt(1920)-2 - sqrt(30))/(sqrt(6) - (sqrt(6) - sqrt(1350)/sqrt(9))) - (1sqrt(1215) + sqrt(15))/(-1sqrt(432))1. -77sqrt(5)/30 Simplify (-1 + -4(-1 + sqrt(720))6 - -5(0 + (0 + sqrt(720) - sqrt(720))-3))2-1. -415249 + 13248sqrt(5) Simplify ((-2-4sqrt(108) + sqrt(363) + (sqrt(363) - (2sqrt(363) + sqrt(363)))-2)5)*2. 795675 Simplify (-3 + ((sqrt(684) + sqrt(684)5)-2 - (-1 + -3 + sqrt(684))) + 2)2. -468sqrt(19) + 115605 Simplify 5 + ((-5-2sqrt(325) + sqrt(325))-1 - ((sqrt(325) + 2)-3 + -5))*2. -880sqrt(13) + 20926 Simplify (6(sqrt(2) + -1) - (sqrt(2) + -3 + sqrt(2))2) + ((-1 + sqrt(200) + sqrt(200))*2 - -1sqrt(98)) + -4. -31sqrt(2) + 797 Simplify 3(-4 + (sqrt(76)/sqrt(4) - sqrt(19))-6 + -3 - (sqrt(152)/sqrt(128) - -5(sqrt(114)/sqrt(6))*2)). -306 - 3sqrt(19)/4 Simplify 0 + ((sqrt(17) + sqrt(102)/(sqrt(12)/sqrt(2)) + sqrt(833) + 2 + sqrt(17))*2 + ((sqrt(4114)1)/(sqrt(8)*-5	{ "pile_set_name": "DM Mathematics" }
s b Let i(s) = s*3 + 10s*2 + 8s - 10. Let m be i(-9). What is the nearest to m in -5, -0.2, -2/13? -0.2 Let h = -0.8 + 0.75. Let y = h - 1.95. Let t = -2585/21 - -123. What is the closest to -5 in t, y, -1? y Let i = 0.01 - -0.09. Let z = -13/28 + -3/28. Let y = -38 - -39. What is the closest to i in z, -3/5, y? z Let j = 0.7 + 3.3. Let p = j - -1. What is the closest to 0.1 in -1/6, p, 0.1? 0.1 Suppose -6n - 30 + 0 = 0. What is the nearest to -4/19 in n, 0.3, 5? 0.3 Suppose 0 = 10j + 9 + 21. Let z be ((-2)/(-2051))/((-2)/(-865)). Let q = -2/293 - z. Which is the nearest to -2/3? (a) 2 (b) j (c) q c Let g = -3.1057 - -0.0357. Let q = -0.07 - g. Which is the nearest to 1/3? (a) -2 (b) q (c) 0.3 c Let s(m) = -m*2 + 11m - 6. Let w be s(11). Let f be ((-2)/12)/(w/12). Which is the closest to f? (a) 4 (b) -1 (c) 2 b Let v = -72.07 + 72. Which is the closest to v? (a) -1 (b) -3 (c) 7 a Let y = -0.13 + -0.87. What is the closest to 5 in 2, y, -1/3? 2 Let u be (-2)/(-5)((-64)/(-28) + -3). Which is the nearest to 0.1? (a) -1/4 (b) -3 (c) u a Let d = 136 - 135.85. Which is the closest to d? (a) 0.3 (b) -2 (c) 2 a Let g = -0.01 - -1.95. Let d = 0.08 + -0.02. Let t = d + g. What is the nearest to 1/4 in 3/2, 1/2, t? 1/2 Suppose 0 = 17x + 29 + 56. Which is the nearest to -1/2? (a) 1 (b) -3/8 (c) x b Let t = 0.01 + 0.39. Let n = 3.58 + 0.42. What is the nearest to -0.1 in 0.2, t, n? 0.2 Suppose j - 4 = 3. Suppose -4y + j = -4o - 21, 5o + 17 = -y. Which is the nearest to -0.1? (a) o (b) -1 (c) 0.5 c Let z(f) = -5f*2 + 13f - 7. Let j(a) = -3a2 + 6a - 3. Let v(i) = -7j(i) + 3z(i). Let h be v(2). What is the closest to h in 0.1, 0.2, -4? 0.2 Let l = 4.13 - 0.43. Let i = -1.3 - l. Which is the closest to 2/5? (a) -4 (b) i (c) 0.5 c Suppose 0r = -2r + 4. What is the nearest to r in 0.2, -1/3, 0? 0.2 Suppose 4v - 3 = -11. Let d = -16.5 + 17. What is the closest to 0.1 in d, v, 4? d Let o be 14/(-1 - -2). Which is the nearest to 12? (a) 0 (b) -5 (c) o c Suppose 0 = -5r + 3v - 5, -3v - 6 = 4r - 5v. Let j = -0.2 - 8.8. Let g = -8.6 - j. Which is the closest to 2? (a) r (b) -0.2 (c) g c Let v be 1(4 - 60/18). What is the nearest to -1/2 in v, -3, 3? v Let h be ((-1)/(-2))/((-9)/6). Let f = -1 + 4. Let y be 6/16f/(-9). Which is the nearest to h? (a) 2/17 (b) -5 (c) y c Let p = 12 + -10.1. Let x = p + -2. Let r = 5/7 - 8/21. Which is the nearest to r? (a) x (b) 2/3 (c) 5 b Let z be 6/(-20) - (-23)/46. Which is the closest to -1? (a) -3 (b) -2/9 (c) z b Let p = 0.2 + -0.3. Let d = -4 + 3.6. Let o = -45.1 - -45. Which is the closest to o? (a) -4 (b) p (c) d b Let z(g) = g2 - 20g + 18. Let j be z(19). What is the closest to 0.07 in -3, 4, j? j Suppose -5m = -m + 8. Let t = -3 + 3. Let g = t - m. Which is the nearest to g? (a) 2/15 (b) 5 (c) 1 c Let s = 30 - 30.1. Which is the nearest to -0.1? (a) -1 (b) s (c) 0.1 b Let s = 10 - 6. Which is the nearest to 1/3? (a) 1/3 (b) s (c) -3/7 a Let d(m) = -m2 + 20m + 4. Let z be d(20). Which is the closest to 8? (a) -2 (b) 3 (c) z c Let r(a) = a*2 + a - 3. Let t be r(-3). Let f = -1.1 - -0.1. Let h = 0.3 - -0.7. What is the nearest to f in h, 2, t? h Let z = 152 - 152.4. Which is the nearest to -0.2? (a) 0.1 (b) 0.2 (c) z c Suppose -3w = 2k, -k + 6k - 11 = -2w. What is the closest to 4 in k, -1, 0? k Suppose -9 + 3 = -3z. Which is the nearest to z? (a) -5 (b) -3 (c) -2/5 c Let h = 0.24 + -0.34. Let n be (6/4)/(6/16). Which is the closest to h? (a) 3 (b) n (c) 2/11 c Let f = 1.03 - 0.03. Let o = 24 + -70/3. Which is the closest to o? (a) -0.5 (b) f (c) 0.2 b Let k = -126 - -127. Let q = -8 + 4. Let u = -0.8 - -0.4. Which is the closest to -1/3? (a) q (b) k (c) u c Let o = 7 + -11. Let m = -3 - -1. What is the nearest to 0.1 in o, 0, m? 0 Let x = 19/189 - -5/27. What is the closest to x in 4, 0.2, 1? 0.2 Suppose 0 = 4d + 3n - 20, -d + 3n + 15 = 2d. Let s be (-20)/7 - d/35. Let q be -1(0 - (-3)/(-12)). Which is the closest to -1/4? (a) q (b) -5 (c) s a Let n = -0.42 - -1.42. Let g be 1 + ((-32)/18 - -1). Which is the nearest to -2/5? (a) n (b) 4 (c) g c Let x = -19/3 + 6. Let a(q) = -2q + 5q + 7 - 2q. Let b be a(-7). What is the closest to b in x, 4, -0.5? x Let k be 1/(((-3)/(-2))/3). Let f = -3 - -3. Which is the closest to f? (a) 0.5 (b) k (c) -5 a Let y be (-10 + 10)/((-4)/(-2)). Which is the closest to y? (a) 2/15 (b) 0.04 (c) -0.3 b Let p be 1(-6)/(-10)5. Let b = p + -3. Suppose 0 = -t - 2t + 12. What is the nearest to b in -4/7, t, 0? 0 Let c = -52/5 - -10. Let a = -0.74 + 0.34. What is the closest to c in a, 1/4, 2? a Let a = -18 + 18.59. Let w = -0.09 + a. Let r = 615/4 + -153. What is the nearest to r in 3, w, 2/3? 2/3 Let u = -2 - 0. What is the closest to 4/5 in 1, -1/6, u? 1 Let t = 19/55 - 6/11. Let p = 0.01 - 0.11. What is the nearest to p in 1/4, -3, t? t Let o = -36 + 34. What is the nearest to o in 0, -0.1, 3/2? -0.1 Let x = -1.8 + 2.8. Let y = -681/4 + 169. Which is the closest to -1? (a) 0.2 (b) x (c) y c Suppose 5s - 7 = 3. Which is the closest to s? (a) 0.1 (b) -3 (c) 0.2 c Let y be (2/1)/((-7 - -1)/3). Which is the nearest to y? (a) -2/19 (b) 1/4 (c) 1 a Let n = -0.2 - -0.6. Suppose -2z + 1 = 13. Let f be (-9)/z(-12)/9. Which is the nearest to 1? (a) f (b) n (c) -4 b Let l = 2.9 + -3. Let h = 0 + -1. Let u = h + 0.5. What is the nearest to 2/7 in u, l, 1? l Let z = -19.4 - -19. Let r = -0.8 - z. Which is the closest to 1? (a) r (b) -0.02 (c) -2/9 b Let r = 11 + -10.56. Let k = r - 0.04. Which is the nearest to 0.4? (a) -4 (b) k (c) 0.2 b Let f = -1.6 + -0.4. Let t = 24 + -28. What is the nearest to -1 in 2/7, t, f? f Suppose 26 = -2s - 5i, -s - s + 5i + 14 = 0. Which is the nearest to -2? (a) s (b) -5 (c) 0.09 a Let f = -2327/19836 + 25/228. Let v = f + 793/1305. What is the closest to 1 in -2/7, v, -1/16? v Let h = -54 + 266/5. Let j = 2 - 3/2. Which is the nearest to -0.1? (a) 4 (b) j (c) h b Let d = -3.9 + 3.6. Which is the nearest to -0.1? (a) d (b) 1/18 (c) 0.2 b Let g(s) = 4s*2 + 2s - 2. Let t be g(-2). Suppose -5u = -3x - 25, 2u = -0u - 4x + t. Which is the closest to 0.1? (a) -0.5 (b) u (c) 2/5 c Let f = -1 + 0.93. Let x = f + -0.23. Which is the nearest to x? (a) 0 (b) 0.5 (c) -5 a Let h = 75 - 13. Let z = 309/5 - h. What is the closest to -1/4 in -5, z, -3? z Suppose 4z + 2 - 6 = 0. Let w = -0.2 - -0.1. Let v = -31 - -94/3. Which is the closest to w? (a) z (b) v (c) 0.1 c Let v(x) = x*3 - 10x2 + 7. Let u be v(10). Let i be 2/u + (-111)/168. Let p = -2 - -2.1. Which is the closest to 2/5? (a) -4/5 (b) i (c) p c Let i = 0 + -0.2. Let j be 4 - (4 - (0 - -1)). What is the closest to -1/4 in i, j, 5? i Let t be (-12)/(-26) - 10/20. Which is the nearest to -2/3? (a) 5/6 (b) t (c) -1 c Let y = -11 - -3. Let o = 5 + y. What is the closest to -3 in 5, o, -2/3? o Let n = -125 + 622/5. Which is the nearest to n? (a) -2/17 (b) 0.4 (c) 0 a Let r = -18 + 11. Let w = r + 7.5. Let f = 0.8 + -0.5. Which is the closest to 1? (a) f (b) 2 (c) w c Let w = 7 + -7. Let z be (2/(-4))/(1/6). Which is the nearest to w? (a) z (b) -0.5 (c) -4 b Let l = -23/5 - -171/35. Which is the closest to -2? (a) -0.5 (b) -5 (c) l a Let n = -2 - -2.08. Let c = -0.18 + n. What is the closest to c in 2, 0.4, 0? 0 Let y = 0.1 - -0.9. Let u(l) = -l2 + 5l + 4. Let m be u(4). Let q = m - 9. What is the nearest to y in 1/5, q, 4/7? 4/7 Let w = 6.9 - 7. Let k = 310/3 + -102. Suppose 12 = z + 2z. What is the nearest to w in 3, z, k? k Let i = -53 + 62.4. Let j = i + -9. Let s = 0.5 + 0. Which is the nearest to 0.1? (a) j (b) -5 (c) s a Let y = 0.019 - 1.019. Which is the nearest to 0.1? (a) 0.2 (b) 2 (c) y a Let k = 1 + -3. Let t = -0.04 - 0.16. Which is the closest to t? (a) 3/5 (b) 3 (c) k a Let v = 1.21 + -0.21. Which is the closest to 4/13? (a) -5 (b) v (c) -0.1 c Let v(q) = 2*q. Let j be v(-1). Which is the closest to -1? (a) 5 (b) 0.1 (c) j c Let i = -0.36 - 3.64. What is the nearest to 0 in -1, 3, i? -1 Let y be -3 + (3/9 - -2). Let l = 10/9 - 4/3. Let f = 0.4 + 0. What is the closest to y in -0.3, l, f? -0.3 Sup	{ "pile_set_name": "DM Mathematics" }
e -8 = lx + 2 for x. -5 Suppose -5c + 27 + 8 = 0. Solve 4f + 9 = -c for f. -4 Let n = 11 + -10. Suppose s + n = 6. Solve -sl + 2l = 9 for l. -3 Suppose -9 = -0q + 2q - 3t, 0 = 5q + 4t - 35. Suppose 3v + q - 2 = -2g, 4v = -3g. Solve -2j + 2 - g = 0 for j. -1 Let q = -14 + 19. Solve -4z - 1 = -qz for z. 1 Let g = 41 - 25. Suppose -4z - 3o + 16 = 0, 3o = 3z + z - g. Solve y - z = -0y for y. 4 Suppose 0n + 2n = 8. Suppose -nw = -0w. Solve w = 3d + d - 12 for d. 3 Suppose 0 = 2p + 2c - 2 - 34, -4p + 42 = -2c. Solve 4b + 7 = -p for b. -5 Let x be (60/(-21))/(6/(-21)). Let s be x/7 + 6/(-14). Solve 3w + 7 - s = 0 for w. -2 Suppose -r = -3 + 7. Let w be (151)/((-4)/r). Solve 0 = -m - 4m + w for m. 3 Suppose -5y + c + 64 = 0, 0 = 2y + 4c - 0 - 8. Solve -3l = l + y for l. -3 Let n = -59 + 64. Solve 7 = 4x - n for x. 3 Let r be (-12)/(-66) - (-4)/(-22). Suppose rm + 2m = 14. Solve m = 5u - 8 for u. 3 Let x(i) = i2 + 6i - 11. Let d be x(-8). Let z(v) = 4v - 1. Let t be z(1). Solve dy = ty - 4 for y. -2 Suppose 6 = -4h - 2. Let p be (-12)/8h + 0. Solve -pn + 3 = 9 for n. -2 Let v(i) = -i - 10. Let o be v(-6). Let j be ((-5)/(-3))/(o/(-12)). Solve -r + 0 = j for r. -5 Let h = -28 - -38. Solve hp - 5p + 10 = 0 for p. -2 Let q be -10((-22)/(-5) - 2). Let r = -12 - q. Suppose -r = -2f + 2m, -m + 8 = 5f - 10. Solve 0 = 5c - f - 16 for c. 4 Suppose 0 = -5s - g + 5, 8g - 25 = 3s + 3g. Solve s = 4u - 15 + 7 for u. 2 Let z = -12 + 12. Solve 0 = -zs - 2s - 10 for s. -5 Let u be (-2 - -2) + (-5 - -27). Let h be (2/2)/(2/u). Solve 4s - h = 9 for s. 5 Suppose 0 = 6n - 3n - 36. Let d = n + -9. Let p = 6 + -6. Solve -dz + 6 = -pz for z. 2 Let c be ((-8)/12 - -1)/(1/21). Solve -2o + 15 - c = 0 for o. 4 Let d be ((1 - 1)/5)/1. Solve 0 = -2b - 2 - d for b. -1 Let p be 6/(-8)32/(-24). Solve p = l + 4 for l. -3 Let r = 0 + 3. Suppose -7 = -2o - 3. Let v = 4 - o. Solve vs + r = s for s. -3 Let t(d) = d*2 + 8d + 9. Let y be t(-7). Solve yb = 2 - 0 for b. 1 Let l = 33 - 28. Solve -7m + 6m - l = 0 for m. -5 Let v be (-4)/(-6) + 28/12. Suppose 5h = -4n + 30, -2h + n = -h + v. Suppose h = 4u - 2u. Solve 4y - u = -21 for y. -5 Let h(p) = -p3 + 2p*2 + 2p - 2. Let d be h(2). Let x = 8 - d. Solve -q - x = 2q for q. -2 Let d(s) = s2 + 3s - 7. Let r be d(2). Solve 0y = ry for y. 0 Let m = -1 - 7. Let i(k) = -k*2 - 10k - 10. Let s be i(m). Solve 2r - sr = 16 for r. -4 Let v(i) = i + 4. Let u be v(-4). Suppose ud - 6 = -2d. Solve dx + 4 = -x for x. -1 Suppose d = 3b + 6d - 43, 2d = -b + 16. Let l be (-6)/(-4)8/6. Solve -bv = -lv for v. 0 Suppose 3a + 65 = -2a. Let x = 4 + -12. Let r = x - a. Solve -ri + 0 = -10 for i. 2 Let c = -11 + 20. Suppose 6 = 5v - c. Solve h = -vh for h. 0 Let p(u) = -u + 9. Let o be p(5). Solve -om - 7 = 5 for m. -3 Suppose 0 = -0g - 3g + 3k - 90, 45 = -2g - k. Let u = 82 - 117. Let q = g - u. Solve 2v + q = 7v for v. 2 Let d(u) be the second derivative of -u4/12 + 5u3/3 + u2 + 2u. Let r be d(10). Solve -3l = -4 - r for l. 2 Let n be -32/6 + 8. Let f be (0/1)/(1-1). Solve 3u + n - 1 = f for u. -2 Suppose 4n - 16 = -2t, -n = -3n. Let l = 2 - -3. Let p(c) = c + 4. Let m be p(-4). Solve li + t + 12 = m for i. -4 Let w = -107 + 107. Solve m + 2m - 3 = w for m. 1 Suppose 3r + 2r - 5 = g, -2g - 5r = -5. Solve 0 = -gp - 2p + 4 for p. 2 Suppose -5g + 0g + 5 = 0. Suppose -d = g + 5. Let h = d + 10. Solve 0 = -hq + 5q for q. 0 Let d(o) = o3 + o2 - 6o - 3. Let l be d(5). Suppose 0 = -5b + 27 - l. Let k be (-32)/b + (-2)/(-9). Solve 0 = kt + 8 for t. -4 Suppose 50 = -3t + 4g - 60, -3g = 2t + 96. Let k be 1/(t/(-10) - 4). Solve kv - 7v - 2 = 0 for v. -1 Let u(o) = -6o + 3. Let q(g) = -17g + 9. Let i(c) = -4q(c) + 11u(c). Let j be i(3). Suppose 0 = m - jz, 0 = 3m + z - 4z. Solve 0 = 4v - m - 12 for v. 3 Suppose -2q = -4q. Let d(n) = n3 + 5n*2 - 8n - 8. Let y be d(-6). Solve y = -qb + b for b. 4 Let o = -2 + 2. Suppose o = 2k - 4s - 4, -5k + 2s + 5 = -3s. Let j(i) = 7i - 1. Let g be j(3). Solve -5f + k + g = 0 for f. 4 Suppose q + 3q - 28 = 0. Suppose f - q = -5d, -2f + 4f = -3d. Solve -2s - ds = 4 for s. -1 Suppose 3v - 10 = -2v. Suppose -3g = 2w + 3 + 16, -vw = -3g - 11. Let c(n) = 2n*2 + 3n + 3. Let i be c(w). Solve 2t + 3t + i = 0 for t. -1 Suppose -4l = 3w + 13, 2l = 4w + l - 8. Solve 3z = 4z - w for z. 1 Suppose -2s - 33 = -5s. Solve -4l - s = 5 for l. -4 Let q(n) = -n + 5. Let c be q(4). Let h(l) = 3l3 + l2 - 1. Let i be h(c). Solve -ig + 0g = -15 for g. 5 Let q(p) = p*3 - 10p*2 - 12p + 13. Let c = 24 - 13. Let j be q(c). Solve -ju - 2 = -4 for u. 1 Suppose y - 2 = 1. Suppose -2g = yg - 25. Suppose -g + 1 = -2s. Solve 0 = sm + 5 + 5 for m. -5 Let i be (-40)/(-12) + (-3)/9. Solve -i = -4x + 1 for x. 1 Let h(y) be the first derivative of 4 - y - 3/2y2 + 1/3y*3. Let v be h(4). Solve -2s - vs = 0 for s. 0 Suppose -14 - 38 = -s. Suppose m + 6d = 2d + 2, d + s = 5m. Solve -p + m = 4p for p. 2 Suppose i + 6 = 4i. Suppose -12 = -5t - i. Let x be t/6 + 102/18. Solve -x = -5r - 16 for r. -2 Suppose 3y + 32 = 7y. Let t = 4 - -3. Let g = y - t. Solve r - 4 = g for r. 5 Let g be 2/((-2)/(-2 - 2)). Let n(b) = -b*3 + 4b*2 + 4b + 4. Let s be n(g). Suppose -v - 4c + 46 = 4v, s = 2v + 2c. Solve 3p + 18 = v for p. -4 Let l(r) = 9 - 28r - r*2 + 3r*2 - 3r*2 + 20r. Let k be l(-9). Solve k = -b - 1 + 3 for b. 2 Suppose -3w - 10 + 4 = -4n, -4 = n + 2w. Solve nj = -j - 3 for j. -3 Suppose 0r = 4n - r - 155, 0 = 3n - 4r - 126. Let c = n - 2. Suppose -5f - 2s = -s - c, 3f - 40 = 4s. Solve -5l = 2 + f for l. -2 Suppose -4t - 2d - 29 = -169, 0 = -5d + 20. Let j = t - 17. Let s be (0 - 1/(-2))6. Solve j = -sh + 1 for h. -5 Let d = 217 + -211. Solve d - 5 = -s for s. -1 Let g = 0 + 2. Let w be 0 + 2 - 0 - (-7)/1. Solve w = u + gu for u. 3 Suppose 5b = g - 12 - 7, -3g = -b - 15. Let k(f) = -f + 6. Let v be k(g). Let y = 7 - v. Solve yq = 2q for q. 0 Suppose 0 = -o + 7o - 132. Let d be (3/2)/(2/4). Solve o = -5t - d for t. -5 Let o(m) = 2m - 1. Let x be o(-2). Let f = 4 + x. Let j = f - -2. Solve -3z + j + 2 = 0 for z. 1 Suppose 3b - 16 = 11. Solve 11 = -4u - b for u. -5 Let l(k) = 2k - 10. Let p be l(7). Suppose -p = -2h - 0. Solve -hw = w for w. 0 Suppose 6w - 20 = w. Suppose 0r - 3p = -wr + 3, -3r + 2p = -3. Let h be (r/(-9))/((-3)/27). Solve -hx - 6 = -x for x. -3 Let c(x) = x3 - 9x*2 + 7x + 10. Let g be c(8). Suppose gv - 18 = -2d - 0, 0 = -3d + 12. Solve -2p + vp = 6 for p. 2 Let d = -8 - -12. Solve 0h + h = -d for h. -4 Let q be (-2)/5(6 - 1). Let n be (q/(-4))/((-1)/(-2)). Let a be n/(-2)(1 + -1). Solve 3m - 5m = a for m. 0 Suppose -r - 29 = 2i, 3r + 5i + 88 = -0i. Let g = 46 + r. Solve 4m = m + g for m. 5 Let p(d) = 7d - 1. Let f(q) = 3q. Let o(c) = 5f(c) - 2p(c). Let z be o(2). Solve z + 0 = 2w for w. 2 Suppose -3j + 2m + 21 = 0, j + j - 4m = 6. Suppose 4q + 3n = q - j, -10 = 2n. Solve ql + l + 12 = 0 for l. -4 Let z(s) = -s2 - 10s - 5. Let m be z(-9). Suppose -2q - 30 = -mq. Solve 3d = -0d + q for d. 5 Let t(p) = -5p3 - p2 - 2p - 1. Let z be t(-1). Suppose 3h + 13 = -z. Let k be h/9 - (-47)/3. Solve 0 = -b + 4b + k for b. -5 Let v be (1/3)/((-3)/(-27)). Suppose -vr - 5 = -2b, -5b + 2r - 2 = 2. Let y(h) = -h3 - h2 + h + 1. Let j be y(b). Solve 0 + 3 = js for s. 1 Let s(v) = 42v + 1. Let r be s(1). Let l be r - ((-1 - 0) + 2). Suppose -3m + 23 = -5z, -3m + 11 = z - l. Solve -g + 5g = -m for g. -4 Let c = -4 - -9. Let u be (c - -4)(-2)/(-6). Solve 2v + 4 = uv for v. 4 Let b be 2/10 + (-9)/(-5). Suppose -bn - n = -15. Suppose -5l + 5i = -40, -nl - 3i = -l - 11. Solve -y = -ly for y. 0 Suppose 78 = 2q + 2q - 2j, 0 = 3q + 4j - 64. Suppose 2b - q = -2b. Solve 0p = -5p + b for p. 1 Let i(n) = n*2 - 6n + 8. Let o = 8 - 2. Let f be i(o). Solve 0 = 2d - f for d. 4 Let m = 2 - 1. Suppose 3 - 9 = -2l. Suppose lc + w = -m, 2c - 1 = 5w + 21. Solve 3 = -j + c for j. -2 Let r(l) = l3 + l2 + 2l + 22. Let c be r(0). Solve -	{ "pile_set_name": "DM Mathematics" }
What is the v'th term of 3399, 6800, 10189, 13560, 16907? -v*3 + 3408v - 8 What is the p'th term of -151, -590, -1319, -2338? -145p2 - 4p - 2 What is the y'th term of -38, -50, -66, -86, -110? -2y2 - 6y - 30 What is the k'th term of 57, 96, 135? 39k + 18 What is the r'th term of 115, 517, 1207, 2185, 3451, 5005? 144r*2 - 30r + 1 What is the v'th term of 600, 578, 558, 540, 524, 510, 498? v*2 - 25v + 624 What is the k'th term of 41, 208, 511, 962, 1573, 2356, 3323? 2k3 + 56k*2 - 15k - 2 What is the i'th term of 47, 41, 35, 29? -6i + 53 What is the z'th term of 1567, 1572, 1581, 1594, 1611? 2z*2 - z + 1566 What is the q'th term of -229, -439, -649, -859, -1069, -1279? -210q - 19 What is the k'th term of 68, 86, 112, 146, 188, 238? 4k2 + 6k + 58 What is the p'th term of 71, 140, 209, 278, 347, 416? 69p + 2 What is the c'th term of 67, 305, 709, 1285, 2039, 2977? c3 + 77c2 - 11 What is the g'th term of 3, 3, 5, 9, 15, 23, 33? g2 - 3g + 5 What is the c'th term of -3, 5, 13, 21, 29, 37? 8c - 11 What is the f'th term of 910, 933, 972, 1027? 8f2 - f + 903 What is the w'th term of 23, 30, 37, 44? 7w + 16 What is the l'th term of 10, -38, -170, -428, -854, -1490, -2378? -7l3 + l + 16 What is the j'th term of -2, -2, -4, -8, -14? -j2 + 3j - 4 What is the d'th term of -68, -132, -196? -64d - 4 What is the s'th term of 18110, 18111, 18112, 18113, 18114? s + 18109 What is the m'th term of 214, 250, 286, 322, 358, 394? 36m + 178 What is the y'th term of -10, -23, -36, -49? -13y + 3 What is the d'th term of 70, 33, -4, -41, -78? -37d + 107 What is the p'th term of 147, 1072, 3581, 8466, 16519, 28532, 45297? 132p3 + p + 14 What is the g'th term of -3, -24, -61, -114, -183, -268, -369? -8g*2 + 3g + 2 What is the t'th term of 71, 126, 181, 236, 291, 346? 55t + 16 What is the d'th term of 83, 158, 231, 302, 371, 438? -d2 + 78d + 6 What is the h'th term of 1, 12, 39, 88, 165? h*3 + 2h*2 - 2h What is the x'th term of -9, 15, 41, 69, 99, 131? x*2 + 21x - 31 What is the m'th term of 15, -24, -99, -216, -381, -600, -879, -1224? -m*3 - 12m*2 + 4m + 24 What is the b'th term of 479, 938, 1397? 459b + 20 What is the g'th term of 445, 446, 447, 448, 449? g + 444 What is the m'th term of 16, 11, 4, -5? -m2 - 2m + 19 What is the f'th term of -31, -45, -105, -235, -459, -801, -1285, -1935? -4f3 + f2 + 11f - 39 What is the p'th term of -772, -750, -714, -664, -600? 7p2 + p - 780 What is the j'th term of -115, -183, -251, -319, -387? -68j - 47 What is the f'th term of -17, -27, -23, 7, 75, 193, 373? 2f3 - 5f*2 - 9f - 5 What is the s'th term of 14, 17, 4, -31, -94, -191, -328? -s*3 - 2s*2 + 16s + 1 What is the c'th term of 36, -54, -298, -774, -1560, -2734, -4374? -13c3 + c2 - 2c + 50 What is the y'th term of -112, -120, -128, -136? -8y - 104 What is the h'th term of 217, 425, 635, 847, 1061? h2 + 205h + 11 What is the a'th term of -291, -292, -293, -294, -295, -296? -a - 290 What is the j'th term of -47, -53, -55, -53, -47? 2j2 - 12j - 37 What is the i'th term of -66, -117, -180, -261, -366, -501? -i*3 - 44i - 21 What is the l'th term of 34, 57, 80, 103, 126, 149? 23l + 11 What is the b'th term of -2504, -5019, -7546, -10091, -12660, -15259, -17894, -20571? -b3 - 2508b + 5 What is the s'th term of 93, 200, 309, 420, 533? s*2 + 104s - 12 What is the n'th term of -73, -131, -189, -247? -58n - 15 What is the b'th term of 2015, 4049, 6093, 8153, 10235? b3 - b2 + 2030b - 15 What is the z'th term of -433, -421, -403, -379, -349, -313? 3z2 + 3z - 439 What is the n'th term of -51, -52, -53, -54? -n - 50 What is the k'th term of 481, 479, 475, 469, 461? -k*2 + k + 481 What is the g'th term of -14, -40, -66, -92, -118? -26g + 12 What is the g'th term of -27, -71, -153, -279, -455? -g*3 - 13g*2 + 2g - 15 What is the l'th term of 946, 944, 942, 940? -2l + 948 What is the k'th term of -44, -75, -106, -131, -144, -139? k3 - 6k*2 - 20k - 19 What is the x'th term of -108, -218, -328, -438, -548? -110x + 2 What is the x'th term of 3, 96, 257, 492, 807, 1208? x3 + 28x*2 + 2x - 28 What is the a'th term of 29, 57, 85, 113, 141, 169? 28a + 1 What is the i'th term of 16, 19, 18, 13, 4, -9? -2i*2 + 9i + 9 What is the x'th term of 5, 3, -5, -19? -3x2 + 7x + 1 What is the x'th term of 3561, 7118, 10675, 14232, 17789? 3557x + 4 What is the s'th term of 1159, 1164, 1181, 1216, 1275, 1364? s3 - 2s + 1160 What is the w'th term of 108, 465, 1066, 1917, 3024, 4393, 6030? w*3 + 116w*2 + 2w - 11 What is the z'th term of 366, 1463, 3292, 5853, 9146, 13171? 366z2 - z + 1 What is the c'th term of -340, -350, -374, -418, -488, -590? -c3 - c2 - 338 What is the r'th term of -151, -160, -169, -178, -187? -9r - 142 What is the u'th term of 3, 1, 5, 15, 31, 53? 3u2 - 11u + 11 What is the r'th term of -278, -553, -830, -1109, -1390, -1673? -r*2 - 272r - 5 What is the n'th term of -23, 8, 39, 70, 101, 132? 31n - 54 What is the m'th term of 6, 21, 50, 99, 174, 281? m3 + m2 + 5m - 1 What is the t'th term of 23, 48, 75, 104, 135? t*2 + 22t What is the j'th term of 174, 175, 176, 177, 178? j + 173 What is the a'th term of -6, -12, -14, -6, 18, 64, 138? a*3 - 4a*2 - a - 2 What is the m'th term of 174, 351, 528, 705? 177m - 3 What is the a'th term of 314, 328, 356, 404, 478? a3 + a2 + 4a + 308 What is the u'th term of 110, 134, 172, 230, 314, 430? u3 + u2 + 14u + 94 What is the k'th term of 1196, 1208, 1244, 1316, 1436, 1616? 2k3 - 2k + 1196 What is the t'th term of 343, 348, 355, 364, 375? t*2 + 2t + 340 What is the c'th term of -16, -34, -62, -100, -148, -206, -274? -5c2 - 3c - 8 What is the j'th term of -4, 19, 56, 101, 148, 191, 224? -j*3 + 13j*2 - 9j - 7 What is the w'th term of 3498, 3496, 3494, 3492? -2w + 3500 What is the c'th term of -25, -16, -1, 20, 47, 80? 3c2 - 28 What is the i'th term of -27, -60, -105, -156, -207, -252? i3 - 12i2 - 4i - 12 What is the u'th term of -15, -5, 13, 39? 4u2 - 2u - 17 What is the b'th term of -626, -608, -576, -524, -446, -336, -188? b3 + b2 + 8b - 636 What is the x'th term of -862, -1724, -2586, -3448, -4310? -862x What is the p'th term of 4, -18, -30, -26, 0, 54, 142, 270? p3 - p2 - 26p + 30 What is the b'th term of -282, -553, -824, -1095, -1366, -1637? -271b - 11 What is the f'th term of -79, -138, -197, -256, -315, -374? -59f - 20 What is the n'th term of -1, -10, -33, -76, -145, -246? -n3 - n2 + n What is the j'th term of -30, -86, -246, -564, -1094, -1890, -3006? -9j*3 + 2j2 + j - 24 What is the v'th term of 370, 343, 292, 211, 94, -65, -272? -v3 - 6v2 - 2v + 379 What is the y'th term of 18, 28, 36, 36, 22? -y*3 + 5y*2 + 2y + 12 What is the x'th term of -19, -30, -41? -11x - 8 What is the x'th term of 1487, 5944, 13371, 23768? 1485x*2 + 2x What is the z'th term of -5, -13, -25, -41? -2z2 - 2z - 1 What is the h'th term of -33, -57, -77, -93? 2h2 - 30h - 5 What is the i'th term of 184, 740, 1666, 2962, 4628? 185i2 + i - 2 What is the a'th term of 64, 68, 84, 118, 176, 264? a3 - 3a + 66 What is the b'th term of -44, -64, -112, -200, -340, -544? -2b3 - 2b*2 - 40 What is the l'th term of 890, 1777, 2664, 3551, 4438? 887l + 3 What is the y'th term of 31, 45, 49, 43, 27? -5y2 + 29y + 7 What is the l'th term of 885, 884, 883? -l + 886 What is the c'th term of 419, 423, 437, 467, 519, 599, 713, 867? c3 - c2 + 419 What is the p'th term of 8534, 8533, 8530, 8525, 8518? -p*2 + 2p + 8533 What is the u'th term of 1286, 1294, 1314, 1352, 1414, 1506, 1634? u*3 + u + 1284 What is the x'th term of 7, 1, -31, -101, -221, -403, -659, -1001? -2x3 - x2 + 11x - 1 What is the p'th term of -669, -661, -653, -645, -637, -629? 8p - 677 What is the t'th term of -82, -203, -420, -781, -1334, -2127, -3208? -8t3 - 65t - 9 What is the z'th term of -3240, -3242, -3246, -3252, -3260, -3270? -z*2 + z - 3240 What is the g'th term of -229, -456, -683, -910, -1137, -1364? -227g - 2 What is the y'th term of 2, 4, 18, 50, 106, 192, 314, 478? y*3 - 5y + 6 What is the l'th term of -52, -107, -190, -295, -416?	{ "pile_set_name": "DM Mathematics" }
2 Collect the terms in -26k + 10k + 7k + 12k. 3k Collect the terms in 4a + a - 3a. 2a Collect the terms in 548m*2 - 4m + 4m - 550m*2. -2m*2 Collect the terms in -3h + 16 - 9 - 7. -3h Collect the terms in -14y - 17 - 15y + 17. -29y Collect the terms in 368q - 185q - 182q. q Collect the terms in -7t + 125 + 118 - 243. -7t Collect the terms in 45s*2 + 111 - 111 - 101s*2. -56s*2 Collect the terms in 3u*3 + 3 - 30u + 0 - 3. 3u3 - 30u Collect the terms in -525 + 0p2 + 525 - 5p*2. -5p*2 Collect the terms in -21 - 21 + 42 + 4b*3. 4b*3 Collect the terms in 8w - 132 + 131 + 3w + 3w. 14w - 1 Collect the terms in 54y*2 - 70y*2 - 140y*2. -156y*2 Collect the terms in 104t - 36t2 - 104t. -36t2 Collect the terms in b3 + 33b + 33b + 31b - 97b. b3 Collect the terms in 7 - 156h*3 + 2317h*3 - 7. 2161h3 Collect the terms in y3 - 3y3 + 8y*3 + 0y*3. 6y*3 Collect the terms in 3 - 5 - 8u + 2. -8u Collect the terms in 20 + 0u - u - 20. -u Collect the terms in -2 - 104s3 + 34s*3 + 2. -70s*3 Collect the terms in 76a*2 + 8a - 8a. 76a*2 Collect the terms in -233n*2 + 115n*2 + 114n*2. -4n*2 Collect the terms in 13477u + 2u3 - 13477u. 2u3 Collect the terms in -9r*2 - 17r*2 + 21r*2. -5r*2 Collect the terms in -4o + 7326 - 7326. -4o Collect the terms in -123 + 123 + o3 + 2o*3. 3o*3 Collect the terms in -564 + 271 + 0v + 293 + v. v Collect the terms in -27 - 9a2 + 35 - 8. -9a*2 Collect the terms in -27m + 72 - 72 + 26m. -m Collect the terms in 17d - 14d - 8d. -5d Collect the terms in -42n*2 - 44n*2 + 85n2. -n2 Collect the terms in 127j3 - 141j*3 + 11j*3. -3j*3 Collect the terms in 70d*2 - 79d*2 + 3d - 3d. -9d*2 Collect the terms in 287n + 47n + 15n. 349n Collect the terms in 4b - 23b + 15b. -4b Collect the terms in 5k*3 - 1207240k + 1207240k. 5k*3 Collect the terms in -1 + 1 + 41z - 49z. -8z Collect the terms in -3k2 - 7k + 7k - k2. -4k*2 Collect the terms in 2197o*2 - 12o*3 - 2197o*2. -12o*3 Collect the terms in -30v - 1 + 28v + 1. -2v Collect the terms in -621h3 + 0 + 0. -621h*3 Collect the terms in u - 5u + 4u - 10u*2. -10u*2 Collect the terms in -478 + 2p*3 - 12p*3 + 474. -10p*3 - 4 Collect the terms in -50j*2 - 15j*3 + 50j*2 + 2j*3. -13j*3 Collect the terms in 13 - 129j*2 - 13. -129j*2 Collect the terms in 42531l - 85064l + 42537l. 4l Collect the terms in -29y + 6y - 17y + 4y. -36y Collect the terms in -5j + 23j - 16j. 2j Collect the terms in 0u3 - 12u*3 - 10u*3. -22u*3 Collect the terms in 140o*3 - 68o*3 - 76o*3. -4o*3 Collect the terms in l + 21l*2 + 5 - 5. 21l*2 + l Collect the terms in -249a*2 - 2 + 2 - 302a*2. -551a*2 Collect the terms in 413k - 824k + 410k. -k Collect the terms in -85i + 30i + 21i. -34i Collect the terms in -4b3 + 2b*3 - 4471b + 4444b. -2b*3 - 27b Collect the terms in -10 - 12 + 24 - 11c. -11c + 2 Collect the terms in -4s3 + 5s*3 - 2s3. -s3 Collect the terms in 115 + 2g2 + 0g*2 - 115. 2g*2 Collect the terms in 3 - 3 - t. -t Collect the terms in -5s + 12s - 343s*2 - 7s. -343s2 Collect the terms in -9c*2 - 8c*2 - 7c*2. -24c*2 Collect the terms in 2t*2 + 123395t*3 - 123396t*3 - 2t2. -t3 Collect the terms in 0n + 625n*3 + 3n - 3n. 625n*3 Collect the terms in 32a - 18a - 15a. -a Collect the terms in -1 + 1 - 1 - 13318v. -13318v - 1 Collect the terms in 74 + 4l2 - 45 - 29 - 3l2. l2 Collect the terms in 66f3 + 63f*3 - 268f*3 + 72f*3 + 71f*3. 4f*3 Collect the terms in 3s*2 - 18s*2 - 3s*2 - 8s*2. -26s*2 Collect the terms in 35t - 12t - 13t + 4t2 - 10t. 4t2 Collect the terms in 2s*2 + 0s*2 + 0s*2. 2s2 Collect the terms in -u3 - 244426 + 244426. -u*3 Collect the terms in -2391j*2 + 3j*3 + 2391j*2. 3j*3 Collect the terms in -121 + 246 - 125 + 5d. 5d Collect the terms in 0z - z*2 - 3z - 12z + z. -z2 - 14z Collect the terms in 8s - 26s - 10s. -28s Collect the terms in -48 + 48 - 382o. -382o Collect the terms in -52o2 - 27o*2 - 4 + 4. -79o*2 Collect the terms in 5 + 5d*2 - 30d*2 - 5. -25d*2 Collect the terms in p + 0p*3 - p + 3p*3. 3p*3 Collect the terms in 629 - 14r + 645 - 1274. -14r Collect the terms in -122u - 70u - 43u + u. -234u Collect the terms in 14k3 - k2 + 23k3 + k2. 37k*3 Collect the terms in 8b*2 + 13b*2 - 13b*2 + 14b*2. 22b*2 Collect the terms in 15l*2 + 2l*2 + 16l*2. 33l*2 Collect the terms in -16 + 0 - 29f - 9 + 31f. 2f - 25 Collect the terms in -6d + 2d + 7d. 3d Collect the terms in -4p - 3p + 12p. 5p Collect the terms in 2o + 3o - 2o2 - 5o. -2o2 Collect the terms in 5f*3 - 2892 - 3f*3 + 2892 - 3f3. -f3 Collect the terms in 9l2 + 10l*2 + 40l*2 - 29l*2. 30l*2 Collect the terms in 2w*2 + 114w + 1 - 1 - 119w. 2w*2 - 5w Collect the terms in -17a3 - 6353a + 6353a. -17a*3 Collect the terms in -2210f + 2210f + 5f*2. 5f*2 Collect the terms in 4x*3 - 4x*3 + 6x*3. 6x*3 Collect the terms in -14g*2 - 3g - 2g + 21g*2 + 15g*2. 22g*2 - 5g Collect the terms in 4q3 - 5q3 - 884 + 1771 - 887. -q3 Collect the terms in -1582i2 + 1581i*2 + 24i - 24i. -i2 Collect the terms in -32j*3 - 25j*3 + 61j*3. 4j*3 Collect the terms in 4 - 26r*3 - 18 + 14 - 22r*3. -48r*3 Collect the terms in 18q + 16 - 24 + 15. 18q + 7 Collect the terms in -50z*2 + 17z*2 + 33z*2 - 9z*3. -9z*3 Collect the terms in 5y - 15y + 2y + 10y. 2y Collect the terms in 2l3 - 8l*3 + 2l*3 + 7l*3. 3l*3 Collect the terms in 8q*2 + 93 - 93. 8q*2 Collect the terms in 1 + 2 - 3 + 38c*2. 38c2 Collect the terms in v2 - 6v2 - 5v*2 + 15v*2. 5v*2 Collect the terms in -9 - 27j + 9 + 12j. -15j Collect the terms in l*2 - 14l*2 - 6l*2 - 20l2 - l3. -l*3 - 39l*2 Collect the terms in 16m*3 - 39m*3 - 26m*3 - 8m*3. -57m*3 Collect the terms in 3w + 10w + 4w. 17w Collect the terms in -10152i*2 - 2i + 2i + 10153i2. i2 Collect the terms in 24k2 - 31k*3 - 43k*2 + 19k*2. -31k*3 Collect the terms in -2i*2 - 11i*2 - 5i2 - i2. -19i2 Collect the terms in 2 - 19y*2 - 2y*2 - 2. -21y*2 Collect the terms in 13g*2 + 7g*2 - 5g*2. 15g*2 Collect the terms in -33q*2 - 21q*2 - 17q*2 - 6q*2. -77q*2 Collect the terms in -f - 6f + 13f - f. 5f Collect the terms in -8r3 + 18r*3 + 3r*2 - 3r*2. 10r*3 Collect the terms in 272j - 139j - 133j + 15j2. 15j*2 Collect the terms in 39u + 16u - 52u. 3u Collect the terms in 1 + 4 + 2304n - 2303n - 5. n Collect the terms in g - 15g + 11g. -3g Collect the terms in 2 - 493u + 529u - 2. 36u Collect the terms in -2p*3 + 5 + 8 - 13. -2p*3 Collect the terms in -4s*3 + 9398 - 9398 + 5s3. s3 Collect the terms in -1985 + 1985 + 9i. 9i Collect the terms in 0d + 4d - 3d + 0d. d Collect the terms in 9b3 - 4b*3 + 552b + 545b - 1097b. 5b3 Collect the terms in -3a*2 + 7a*2 - 5a*2 + 7a*2. 6a*2 Collect the terms in 9s - 16s + 9s. 2s Collect the terms in -i3 + 6i*3 - 6i3. -i3 Collect the terms in 3822s - 1 + 3761s - 605s. 6978s - 1 Collect the terms in w*3 + 309 + 12w*2 - 12w2. w3 + 309 Collect the terms in -646l + 0 - 2 + 661l. 15l - 2 Collect the terms in 9y + 3y - 10y. 2y Collect the terms in -5w - 10w - 3w - w. -19w Collect the terms in -1 + 6z*2 + 1 - 222z + 222z. 6z*2 Collect the terms in -64y*3 - 54y*3 + 113y*3. -5y*3 Collect the terms in -158z + 3489z + 453z. 3784z Collect the terms in 199 - 3f*3 - 385 + 186. -3f*3 Collect the terms in -4w - 4w + w. -7w Collect the terms in w3 - 261 + 261. w3 Collect the terms in 7 + 0 + 0 - 5j3 - 3. -5j*3 + 4 Collect the terms in 8 - 5 + 3 - k. -k + 6 Collect the terms in -4f*3 + 14f*3 + 0f*3 + 5f*3. 15f*3 Collect the terms in -525722d - 2d2 + 525722d. -2d2 Collect the terms in -7n*2 - 13n*2 + 23n**2	{ "pile_set_name": "DM Mathematics" }
biggest value in -0.01, 0.3, -2/5, -2/3, 89? 0.3 Which is the third smallest value? (a) -3/7 (b) 1/191 (c) 3/4 (d) 0.3 (e) 0.15 e What is the biggest value in 26, 1, 51? 51 What is the second smallest value in 1, -99, -2, 5, -2/9, -33? -33 Which is the fourth biggest value? (a) 779 (b) 0.1 (c) 6 (d) -2/17 d What is the second biggest value in 2, 1/4, 100, 9, -1/20, -0.5? 9 Which is the third smallest value? (a) -2/7 (b) 0 (c) 6 (d) 0.01 d Which is the third biggest value? (a) 3510 (b) -2/33 (c) -0.2 c Which is the smallest value? (a) -4 (b) 5/2 (c) -0.93 (d) 0.4 a What is the second biggest value in -1/4, -820, 4, 5, -0.1? 4 What is the third smallest value in -3, -1/26, -25/39? -1/26 What is the third biggest value in -46, -0.1, -0.5, 2/3? -0.5 Which is the biggest value? (a) 4 (b) -2/3 (c) -1 (d) -1247 a What is the biggest value in 2, -238, -3, 2/17, 0, 0.4? 2 Which is the second biggest value? (a) 2/3 (b) -8 (c) -0.4 (d) -0.5 (e) -12.313 c What is the second biggest value in -0.17962, -2, -9? -2 What is the third biggest value in -0.02, 171, 3546? -0.02 Which is the third smallest value? (a) 3/8 (b) 2 (c) -10 (d) -46 (e) -2/7 (f) 1/3 e What is the second smallest value in 2027, 0, -4? 0 What is the fourth biggest value in 8, -367, -2/3, -0.2, 2/7, -6? -2/3 What is the second biggest value in 5, 2, -1, -4/301, 1.4? 2 Which is the smallest value? (a) -303 (b) -3 (c) -96 (d) 0 (e) -0.3 a What is the biggest value in -14, -0.09, -1, 1.2? 1.2 Which is the fourth biggest value? (a) 0.3 (b) 4/3 (c) -1956/7 (d) 0.08 c Which is the third smallest value? (a) 0 (b) -406 (c) -3 (d) -43 (e) -0.4 c What is the second smallest value in 4, 20, -35.1, -0.3, -1? -1 What is the fourth smallest value in 7/3, 2, 33/8, 0.04, -0.4? 7/3 Which is the smallest value? (a) -461 (b) 5 (c) 18 a Which is the second smallest value? (a) 62 (b) 101 (c) 13 a What is the smallest value in 0.19, 0.17, -4, -7? -7 What is the fourth smallest value in 0.1, 0.2, -2, -14, 3? 0.2 What is the third biggest value in -0.16, 7/10, 5/2, -2, 11, -1/2? 7/10 What is the second biggest value in -1, -879/4, 10? -1 Which is the fourth biggest value? (a) 0 (b) 5 (c) 4 (d) -2/5 (e) -0.2 e What is the biggest value in -5/2, 0.6, 0.15, 3? 3 Which is the fourth biggest value? (a) -12/7 (b) -5/4 (c) -3/155 (d) -4 (e) -5 d Which is the second biggest value? (a) 0.4 (b) -2/13 (c) 2 (d) 0.116 (e) -158 a What is the smallest value in 2/9, -10, 87, -16, -2/5, 1/26? -16 Which is the second smallest value? (a) -0.2 (b) -2/7541 (c) -5 a What is the fourth biggest value in -2/11, 0.7, 5, -1/8, -17? -2/11 Which is the second smallest value? (a) -22/5 (b) 1/7 (c) 0 (d) 2292/17 c Which is the fourth biggest value? (a) -546 (b) 1/7 (c) -5 (d) -5/8 a Which is the biggest value? (a) -0.02 (b) -7/4 (c) -3 (d) 0.4 d What is the fourth smallest value in 2/17, -5, -12, 68, -0.4? 2/17 Which is the smallest value? (a) -948 (b) 1/4 (c) 2.47 a Which is the smallest value? (a) -0.16 (b) -2 (c) -1/29 b Which is the third smallest value? (a) 32.3 (b) -1/19 (c) 7 a Which is the third biggest value? (a) -2/3 (b) 44 (c) 14 (d) 3/8 d What is the third biggest value in 0.3, -299/9, -2? -299/9 What is the second smallest value in -4/9, 0.5, 0.2, 12? 0.2 Which is the second smallest value? (a) -1.601 (b) -30 (c) 0.3 a Which is the fourth smallest value? (a) -0.4 (b) -5 (c) 8 (d) 20 (e) 0.02 (f) 12/7 f What is the third biggest value in 0.1, -3/2, 0.4, -0.1, -0.082? -0.082 What is the second smallest value in 8, 15, -1/4, 2/21? 2/21 What is the biggest value in -3, 540/13, 29? 540/13 What is the second smallest value in -5, -0.1, -3, 24, -4.46? -4.46 Which is the smallest value? (a) -1211 (b) 6 (c) -3 (d) -4 (e) -2/13 a What is the fifth biggest value in -402, -0.3, 2, 3, 6.5? -402 What is the second smallest value in -3, 92, 6/11, 8? 6/11 What is the third smallest value in 0.1, -20, -0.3, -0.7, 27, -3? -0.7 Which is the third biggest value? (a) 24 (b) 252 (c) -0.03 c What is the smallest value in 0, -274, 4, 3/4? -274 What is the biggest value in -11/56, 39, 4? 39 Which is the third smallest value? (a) 5 (b) 3/4 (c) -3 (d) -549 b What is the biggest value in 2/119, 2, -0.03? 2 What is the smallest value in 2.3, 13, 3, 4? 2.3 Which is the fourth biggest value? (a) -1/24 (b) -4/9 (c) 3 (d) -3/4 (e) 13/3 b Which is the biggest value? (a) -1 (b) -4.31 (c) 2/9 (d) 3 (e) -2/9 (f) -9.4 d What is the second biggest value in 0.08, 0.5, 456, 1, -1/4? 1 What is the second smallest value in 2, -49/6, -3/5, 61, 3, 12? -3/5 What is the third smallest value in -5/4, 7, -4? 7 Which is the third smallest value? (a) 4/5 (b) 17981 (c) -0.5 b What is the third biggest value in -0.2, 1646, -5, 3/5? -0.2 What is the fourth biggest value in 5, 0, -26/9, -1/11, 55? -1/11 What is the second biggest value in 1/3, -2/9, -11, 5/7, -16? 1/3 Which is the third smallest value? (a) -19 (b) -2 (c) -0.717 (d) -0.5 (e) 1/9 c What is the fourth biggest value in -3, 3/5, 2/5, 1/7, -0.04596, -5? -0.04596 Which is the second biggest value? (a) -21576/5 (b) 0 (c) 17 b Which is the smallest value? (a) 0.4 (b) 0 (c) -1 (d) 3 (e) 4 (f) 498 c Which is the fourth smallest value? (a) -2/7 (b) 0.1 (c) 3/7 (d) 38 (e) -0.5 (f) 390 c Which is the third smallest value? (a) -1 (b) 0.2 (c) 17/10 c Which is the second smallest value? (a) -0.35 (b) -84 (c) 0.06 (d) -2/23 a What is the third smallest value in -13/101, 0.05, 1/3? 1/3 Which is the smallest value? (a) -8 (b) -19 (c) 0 (d) 59 b Which is the third smallest value? (a) 1 (b) -5 (c) -2/373 (d) -1/4 (e) 6 (f) -2/5 d What is the second smallest value in 2/9007, 14, 8? 8 Which is the biggest value? (a) 1 (b) -0.02 (c) 34 (d) 5 c What is the third smallest value in 5, 0, -3/5, 0.1196, 0.3? 0.1196 What is the third smallest value in 5, -13901, 6? 6 Which is the second biggest value? (a) 0.028 (b) 1 (c) 3 (d) 2/5 (e) -42 (f) 1/4 b What is the second smallest value in 199, 4, 151? 151 Which is the smallest value? (a) -1/8 (b) 1500 (c) 2 a Which is the second smallest value? (a) 5 (b) 0 (c) 1/35 (d) 1169 c Which is the second smallest value? (a) -4 (b) -2 (c) 2.3 (d) 121 (e) -2/9 b Which is the second smallest value? (a) 5805 (b) 0.2 (c) -4 b Which is the third biggest value? (a) 0.5 (b) -142 (c) 11/14 (d) 4/3 a Which is the fifth biggest value? (a) 3/5 (b) 0.02 (c) 3/2 (d) 25 (e) -1/3 (f) -2 e Which is the smallest value? (a) -0.3 (b) 5 (c) -1034 c What is the second biggest value in -62/315, 6, -5? -62/315 What is the fifth biggest value in -3, 0, 48, 227, 14/9? -3 What is the biggest value in -0.4, 1/3, -0.2, 0.4, 10/79, 0.5? 0.5 What is the fifth smallest value in 3/4, 4, -2/9, 276/5, -23? 276/5 Which is the smallest value? (a) 0.3 (b) 1 (c) 573.4 a Which is the sixth biggest value? (a) 0.1 (b) -11 (c) 4/7 (d) 0.4 (e) 2.94 (f) -0.3 b Which is the second smallest value? (a) -8/47 (b) -21 (c) 27 a What is the biggest value in 4/9, -112, -5, -1/31? 4/9 What is the third smallest value in -4, 0.09, 487/5, -3? 0.09 Which is the fourth biggest value? (a) 46.182 (b) 5 (c) 3 (d) 0 d What is the biggest value in -1/16, 3/5, -2/45, -1/2, -2, -2/3? 3/5 What is the third biggest value in 10.17, -1/3, 1, 0.2? 0.2 Which is the second smallest value? (a) 13 (b) -2/9 (c) 307 (d) -5 (e) 15 (f) -0.5 f Which is the third smallest value? (a) -3 (b) 43 (c) 25.583 b Which is the third smallest value? (a) -0.2 (b) 110 (c) 3 (d) -0.019 (e) 1.1 e Which is the fourth biggest value? (a) -1 (b) -106.1 (c) -0.07 (d) 1 (e) 0 a Which is the fifth smallest value? (a) -119 (b) 4/5 (c) 10 (d) 0.2 (e) 0 (f) 3/8 b What is the smallest value in -1/25, -3, 4, -0.1, -4? -4 What is the third biggest value in 2, -3, 22, 0.45, -55? 0.45 Which is the third biggest value? (a) 22/5 (b) 24 (c) -3/133 c Which is the third biggest value? (a) -0.5 (b) 2 (c) -4 (d) -2/13 (e) 0.5 d Which is the biggest value? (a) 20/19 (b) 0.03 (c) -1/3 a Which is the second smallest value? (a) 11892 (b) 5 (c) 1 b Which is the bigges	{ "pile_set_name": "DM Mathematics" }
-n4 + 1 - 1) + n4 + n*4 - 3n*4 - 2n*2 + 6n*4 - 8n*4 + 48 - 42 + 5n*3. -3n*4 + 5n*3 - 2n*2 + 6 Expand (-1 + 1 + 2k)(-176k*2 - 18k*3 + 176k*2) + 4k*4 - 2k*4 - 6k*4 + 5k*4 + 0k*3 + 0k*3. -35k*4 Expand (215s - 82s + 55s)(-2s*3 + 2s*4 + 4s*3 + 0s*4). 376s*5 + 376s*4 Expand (0j2 - j2 + 0j2)(0 + 0 - 2) + (2j + j - 2j)(-j - 1 + 1). j2 Expand (0 + 4 - 3 + (4 + 0 - 2)(6 - 1 - 1))(2 + 0 + 1)(3o2 + 0o2 - o2)(-5o*3 + 4o*3 + 0o*3). -54o*5 Expand -96h*5 + 185 - 185 - 4h*5 + 2h5 - h5 + (3h - h2 - 3h)(0h2 - h3 + 0h2). -98h*5 Expand (-2c*3 + 0c*3 + 3c*3)(2c + 2 - 2)(-422 + 96 + 1 - 415). -1480c4 Expand (16 + 39b - 16)(16 + 4 - 8). 468b Expand (2r + 0r - 4r)(83r4 + 0r*4 + 86r*4). -338r*5 Expand (-10h2 + h2 + h*2)(-43h + 43h + 3h2) - 2h*4 + 4h*4 + 0h*4. -22h*4 Expand ((0 - 3 + 1)(0 + 0 + x) - 200x + 21x - 33x)(-x2 + x2 + 2x3). -428x*4 Expand (3n + 13 - n - 6)(5 - 23n - 5). -46n2 - 161n Expand (-7x + 0 + 0)(3x - x + x) + (-x + 3x - 4x)(6x - 5x + 4x). -31x*2 Expand (-4r + 11r + 2r)(-9r + 24r - 12r) + 1 + 6r2 + 0r*2 - 5r2 + r2 + 4r2 - 3r*2 + 2r*2 + 2r*2 - 5r*2 + (0 + r + 0)(-r - 2r + r). 27r*2 + 1 Expand (-s - 1 + 1)(19 - 59 - 35) - 1 - s + 1. 74s Expand (63i*4 - 32i*4 + 16i*4)(1 + i - 4i + 5i). 94i5 + 47i*4 Expand (2k - 3k - k)(-41 - 16 + 3)(0k*3 + 3k*3 - 2k*3). 108k*4 Expand (-5d2 + 1 + d2 - d*2)(-5d2 + 13d*2 + 7d*2). -75d*4 + 15d*2 Expand -3v*3 + 3v*3 - 2v*4 + (-7v*3 + 6v*3 + 13v*3)(1 + 38v + 12v - 27v). 274v*4 + 12v*3 Expand -32c*5 - 22c*5 - 2c*5 + (c - 3c - 4 - c)(0c + 0c - 2c*4). -50c*5 + 8c*4 Expand (-206u + 97u + 92u)((-1 - 1 + 1)(3 - 3 + u) - 4u + 5 - 5). 85u*2 Expand (10n*2 - 22n + 22n)(0n - 3n - 5n) + (-n2 - n + n)(4 - 4 + n) - 4n + n3 + 4n. -80n3 Expand (o2 + o2 - 5o*2)(0 + 3o2 + 0) - 7o4 + o4 + 16o4. o4 Expand (-37 - 156 - 16)(-2o + 0 + 0) + 0o + 2o - 4o. 416o Expand -5j*2 + 5j2 - j4 - j*4 + 2j*4 - 4j*4 + (0j + 0j + 2j)(1 - 2j*3 - 1) - 5 + 5 + 2j*4. -6j*4 Expand -5d*3 + 6d3 + d3 - 6d2 + (0 + d2 + 0)(-2 + 5d + 2) + 2d*3 + 2d3 + d2 - 3d3. 8d*3 - 5d*2 Expand 3a*4 + 4 - 4 + (-4a + 0a + 3a)(3a3 - a3 + 0a3) - 639a*2 + 76a*4 + 639a*2. 77a*4 Expand (2j - 5j - 2j)(-5j + 3j + 0j)(129j*2 + 102j*2 - 48j*2). 1830j*4 Expand (41 + 8h - 41)(-1 - 3 + 3)(-2 + 5 + 0)(2 + 0 + 0 - 2 - 2 + 6 + (3 + 4 - 5)(2 - 4 + 1) + 1 + 5 - 4). -96h Expand (-2 + 2 + 1)(-12w + 2w*2 - 8w + 5 - 8w). 2w*2 - 28w + 5 Expand (-916 - 4l2 + 829 + 3l*2)(-4 + 5 + 1) + (-3l + l + l)(-2l - l + 0l). l2 - 174 Expand (-v2 + v2 - v2 + v - v + 2v2 + (2v - 5v - v)(0 + v + 0) - v*2 + v - v)(3v + 2 - 2) - 2v*3 + 2v*3 + 3v*3. -9v*3 Expand -1 - 20v + 25v + 5v + 0v - v + 4v + (2 + 0 + 0)(-v - 2 + 2) + 0v + v + 0v - 2v + v + 3v - v - 2 + 2. 13v - 1 Expand -74 + 80 + 102n - 114n + (-2 + 2 + n)(-2 - 3 + 4) + 0n + n - 3n. -15n + 6 Expand -2t3 + 7t*3 + 21t*3 + 0t + 0t + t3 + (-2t*3 - 4t*3 + 4t*3)(-2 + 3 - 4). 33t3 Expand 49g*5 - 107g*5 - 75g*5 + (0g + 2g2 + 0g)(-3g + g*3 + 3g) + 0g5 - 4g*5 + 3g*5 - 3g*4 + 3g4 + g5 - 4g - 3g5 - g4 + 4g. -134g5 - g4 Expand (-1 - 4 - 5)(3i - 6i - 22 + 2i). 10i + 220 Expand (0 - 5 + 1)(-f*3 - 3f*3 - 27f*3). 124f*3 Expand 2 - 11p - 2 + (0p + 10p - 3p)(-1 + 4 - 4) + 1 - 1 - p. -19p Expand ((2c + c - 2c)(2 - 3 - 1) - 3c + 1 - 1)(-5 + 3 + 0)(29c + 12c + 0c)(-3c + 5c - c). 410c*3 Expand (f + 1 - 1)(3f3 + f3 + f3) - 9f*4 - 15f*4 + 20f4. f4 Expand (1 + 0 - 7)(2i - i + i)(12 - 3 + 4)(-1 + 2i + 1). -312i*2 Expand (f + 0f - 2f + 2)(-f - 3 + 3)(-3f + f + f)(-50f - 52f - 58f). 160f4 - 320f*3 Expand (3g2 + g2 - g*2)(-7 - 45g + 43g - 8). -6g3 - 45g*2 Expand 0g*2 + 2g*2 + 0g*2 + ((1 + 0 - 3)(1 + 3 + 5) + (-3 + 3 + 3)(-4 + 3 + 2))(0g2 + 2g*2 + 0g*2) + 0g*2 + 5g2 - g2. -24g2 Expand (-5r*2 + 0r + 0r)(6 - 15 + 4 + 2r). -10r*3 + 25r*2 Expand (2k3 - k + 0 + 0 + k3 + k - k + (-3k + 12 - 12)(-k + k - k*2))(6k2 + 2k*2 - 3k*2). 30k*5 - 5k*3 Expand (3v + 0v - 2v)(7 + 221v + 204v - 412v). 13v2 + 7v Expand (-y + 8y + 2y)(4y*2 - 2y*2 + 0y*2)(-3y2 + 0y2 - y2). -72y5 Expand (0w*2 - 41 + 2w*2 + 43)((2w - 1 + 1)(5 - 1 - 1) - 4w + 3w + 2w + 2w + 2w - 3w). 16w3 + 16w Expand (2 + 0 - 1)(-45 + 62m - 123m + 62m). m - 45 Expand 0n + 4n - 2n + 4n + n - 7n + n - n - 2n + (-1 + 1 + 1)(0n - 3n + 2n) + 2n + n - 4n + (-2 + 5 - 2 - 7n)(-5 + 1 + 3). 3n - 1 Expand -8y*3 - 7y*4 + 8y*3 + (3y - 3y - y3)(-8y + 2y + 4y). -5y*4 Expand 0m2 + m2 + 2 - 3 + (-1 + 3 + 2)(274 - 274 - 7m*2). -27m*2 - 1 Expand (24t + 13t - 4t)(2 - 1 + 1) - 3 + 3 - t + (-t + t - t)(1 - 1 - 2) - 4t + t + 4t + 0t + 3t - t - 62 + 62 - 7t + (0 - 2t + 0)(-2 + 2 - 1). 65t Expand (-126c2 + 112452c - 97c2 - 112454c)(-5 + 1 + 1). 669c*2 + 6c Expand (-2c2 + 4c*2 - 3c*2)(5c + 171c + 212c). -388c*3 Expand (0j + 4j - 2j)(2j*3 - j + j) - 6 - 3j4 + 6 + (j2 - 2 + 2)(11j*2 - 4j*2 + 5j*2) - 2j*4 + 2j*4 + 3j*4. 16j*4 Expand (0t*2 + 6t*2 - 2t*2)(15 + 11 + 7)(t + 0t2 + t3 + 0t2). 132t*5 + 132t3 Expand (-z4 + z*4 + 3z*4 + (0z*4 + 0z*4 + 3z*4)(-1 - 4 + 3))(-13 + 13 - 35z). 105z5 Expand (-2 - 7 + 13)(0 - 3s4 + 0) + (-2s*3 + 0s3 + s3)(1 - 2s - 1) - 98s + 98s - 2s3 + 2s*4 + 2s*2. -8s*4 - 2s*3 + 2s*2 Expand (4 - 4 - 2)(y + 8y - 7y)(y + 0 + 0) + 0y2 - y2 - y*2. -6y*2 Expand (5q*4 - 3q*4 - 3q*4)(-2 - 2q + 2 + (-12q - 44q - 47q)(2 + 2 - 1))(5 - 4 + 1). 622q5 Expand (45 - 69 - 174 - 53)(0a5 + 2a5 - a5). -251a5 Expand ((-4 + 1 + 5)(-3b - 2b + 6b) + b + b + 6b + (-b + 3 - 3)(1 - 3 + 1))(-3b + 4b + 0b). 11b*2 Expand (-5w*2 + 3w*2 + 3w*2)(1 - 1 - 2w)(-10w - 3w - 7w) - 2w*4 + 2w*4 + 3w*4 - 3w*2 + 3w*2 + 2w*4. 45w*4 Expand (18 - 32 - 17)(3 - 3 + k + 3). -31k - 93 Expand (-796d + 796d - 36d*2)(-2d2 + 7d*3 - 2d*3 - 2d*3 - d). -108d*5 + 72d*4 + 36d*3 Expand (-1 + 2 + 0)(0g + 4g - g)((1 + g2 - 1)(g - g + 2g2) - g4 - 4g*3 + 4g*3). 3g*5 Expand 284 - 561 - 113y*2 - 2y + 279 + (1 - 3 + 1)(-3 + 3 + 2y*2). -115y*2 - 2y + 2 Expand (45 - 113 - 117)(3p - 5p + 3 + 3p). -185p - 555 Expand (-4m + 3m + 2m)(4m - 5m - m) - 3m*2 + 3m2 - m2 + 2m + 2m*2 - 2m + (-3 + 6 + 1)(-2m + 2m + 2m*2) - 2m2 - m2 - 2m2. 2m*2 Expand (-6z + 6 - 3 + 112)(-z2 + 5z*2 - 2z*2). -12z*3 + 230z*2 Expand (7 + 3 - 15s*3 - 9)(4 - 4 + 2)(-2s - s + 6s). -90s*4 + 6s Expand (2325k3 + 30k*4 - 2325k*3)(0k - 2k + 4k). 60k*5 Expand (0p - 4p + 2p)(p2 + p2 - 4p2) - p3 + 0p3 + 3p3 - p3 + p3 + p3 + (2p + 0p + 0p)(p - p*2 - p) + 4p*2 - 4p*2 + 6p*3. 11p*3 Expand (4 - 4 + 2)(-2 + 0 + 1)(2x + 0x + 0x)(-287 + 911 - 465). -636x Expand -5u3 + 477u*2 - 477u*2 + 5u*4 + (0 + 5 - 2)(-u*4 + 2u*4 - 2u*4) + (4u + u*2 - 4u)(5u*2 - 2u*2 - 2u*2). 3u*4 - 5u*3 Expand (-4 + 0 + 3)(1 - 1 + 2j)(0 + 0 - 3). 6j Expand (1 - 1 - 1)(2 + 0 - 1)(2i + 5i - 45i). 38i Expand (0 - 2 - 3)(-3m5 - 135m*4 + 267m*4 - 145m*4). 15m*5 + 65m*4 Expand (-2o + 35o + 24o)(-5o - 3o + 4o + (-3 + 3 + 2)(-o + o - 2o)). -456o2 Expand (1 + 3n - 6n - 2)(-n - n + 3n)(-179 - 121 + 419). -357n2 - 119n Expand 1 - 1 + 6v + (1 + 1 - 1)(-v - 2v - 2v). v Expand 2o + 0 + 0 + (0 - 3 + 1)(13o - 179o - 61o). 456o Expand (o + o + 0o)(-5 - 3 + 2o + 12)(-3o - 2o + 3o) + (-2o*2 + 6o2 - o2)(-4o - o + 4o). -11o*3 - 16o*2 Expand -230g*4 + 445g*4 - 275g**4	{ "pile_set_name": "DM Mathematics" }
ive s(w(j)). 212063070j Let a(o) = -4o*2. Let c(t) = 22t - 613. Let m be c(28). Let x(r) be the second derivative of 0rm + 0r*2 + 3/4r*4 + 0 - 16r. Give x(a(d)). 144d4 Let s(n) = -n2 + n - 119. Let i(a) = 352a - 8. Give i(s(d)). -352d2 + 352d - 41896 Let a(m) = -25m. Let k(b) = -b + 47790. Give k(a(t)). 25t + 47790 Let j(r) = 8951r2 - 7r + 167. Let q(w) = -w. Calculate j(q(h)). 8951h2 + 7h + 167 Let p(g) = 1342g. Let c(x) = 78647x. What is c(p(y))? 105544274y Let k(s) = 20s - 11. Let c(y) = -73 - 14 + 87 - 2y. Give k(c(p)). -40p - 11 Let x(p) = -7p. Let v(m) = -4m*2 - 31m*2 + 3m - 24m2 - 3m. Determine x(v(g)). 413g2 Let d(i) = -i. Let o(c) = 2. Let a(y) = y - 1. Let g = 15 + -16. Let k = -47 + 45. Let n(f) = go(f) + ka(f). What is n(d(b))? 2b Let r(t) = -4t. Let a(l) = -3l*2 + 170l - 419. Let f be a(54). Let q(o) be the first derivative of f + 5/2o2 + 0o. Determine q(r(p)). -20p Let h(z) = -5z + 9. Let m(p) = 2p - 13. Let o(n) = -7h(n) - 5m(n). Let w(g) = -37g*2. What is w(o(d))? -23125d*2 - 3700d - 148 Let t(i) = 3i - 522. Let v(b) = b2 + 15b + 67. Calculate t(v(u)). 3u2 + 45u - 321 Let w(j) = -9j - 4 + 4 + 4j. Let a(h) be the first derivative of -5h2 - 11 + 2h*3 - 3h*2 + 8h*2. Give w(a(f)). -30f*2 Let t(w) = -703w*2 + 2w + 209. Let f(g) = -14g2. What is t(f(b))? -137788b*4 - 28b*2 + 209 Let d(h) = -9h - 1. Let g(s) = 134s - 7. Let u(j) = 6d(j) - g(j). Let m(v) = -7v. Determine m(u(n)). 1316n - 7 Let f(i) = 2i2 + 3 - 3. Let o(c) be the third derivative of -4c*5/15 - 2c*2 - 3c - 1101. Determine f(o(y)). 512y4 Let a(f) = -12f. Let y(o) = -160o - 70o*2 + 117o + 43o. What is y(a(v))? -10080v*2 Let r(q) = -52q + 28. Let y(i) = 15i - 8. Let k(w) = 4r(w) + 14y(w). Let g(u) = -11755u. Calculate k(g(n)). -23510n Let i(p) = 18p*2 + 18p + 71. Let y(h) = 186h. Calculate i(y(x)). 622728x*2 + 3348x + 71 Let u(g) = -2g + 2g + 2g2. Let l = 311 + -307. Let c(x) = -22x + l - 6 + 2. Give u(c(f)). 968f2 Let b(k) = -3k. Let g(q) be the first derivative of 2q5/15 + q3/3 + 4q*2 - 16. Let o(s) be the third derivative of g(s). What is b(o(t))? -48t Let k(l) = -44l + 132. Let b(i) = -1 - 2 + 2. Let d(u) = 132b(u) + k(u). Let a(j) be the second derivative of -j*4/12 - 107j. Calculate d(a(w)). 44w2 Let k(m) = 74m. Let s(a) = -18817 - 6a2 + 18817. Calculate s(k(u)). -32856u*2 Let o(j) = 40j. Let s(l) be the first derivative of 93l2/2 - 1041. Determine o(s(t)). 3720t Let f(j) = -29j - 30j + 97j - 40j. Let a(l) = 321l2. What is a(f(q))? 1284q*2 Let n(b) = -2b*2. Suppose c + 9x = 7x, 3c - 11 = 5x. Let s(o) be the first derivative of 0o - 1/3o3 - 21 - 5/2o*c. What is n(s(m))? -2m*4 - 20m*3 - 50m2 Let c(w) be the third derivative of w6/360 - 104w3/3 + 79w*2. Let m(x) be the first derivative of c(x). Let r(l) = -21l*2. Determine m(r(i)). 441i*4 Let k(v) = 10v. Let y(o) = o*2 - 695o + 28. Determine y(k(c)). 100c2 - 6950c + 28 Let u(b) = 14b2. Let c(f) = -228854f. Determine c(u(t)). -3203956t2 Let s(a) = -1279a*2 - 468a*2 - 689a*2. Let j(l) = 6l*2. Calculate j(s(z)). 35604576z*4 Let j(w) = -4 + 8567w*2 - 8565w*2 + 896w + 279w. Let p(l) = l. What is p(j(m))? 2m*2 + 1175m - 4 Let v(j) = 12494j2. Let k(g) = 7423g. Calculate k(v(l)). 92742962l2 Let a(c) = -6c*2 - 2. Let w(f) = 114f*2 - 944. Determine w(a(t)). 4104t*4 + 2736t*2 - 488 Let b(a) = -86a*2. Suppose -5n - 666633 = 6x - 10x, -666651 = -4x - n. Let c(t) = -t - 166662 + x. Determine b(c(o)). -86o*2 Let s(l) = 847826l. Let x(c) = c*2. What is x(s(o))? 718808926276o*2 Let y(o) = 2o - 68. Let n(d) = -d*2 - 29d - 51. What is y(n(l))? -2l2 - 58l - 170 Let u(s) = 67079s. Let v(j) = 5j - 9. Calculate v(u(q)). 335395q - 9 Let w(c) = 5c2. Let m(j) be the third derivative of -j7/315 + 47j5/60 - 32j*2. Let b(t) be the third derivative of m(t). What is b(w(z))? -80z*2 Let k(u) = 38u + 2658 - 2694 + 12u. Let n(g) = 2g*2. Give k(n(d)). 100d*2 - 36 Let c(p) = -2p*2 + 2 + 17p - 35p - 2p*2 + 16p. Let x(g) = -23g2 - 11g + 11. Let i(k) = -11c(k) + 2x(k). Let h(m) = -6m2 - m. Give i(h(v)). -72v*4 - 24v*3 - 2v2 Let d(q) be the third derivative of -q4/12 - 2q2. Let m(s) = -5 - s + 0s - 3s + 3. Give m(d(t)). 8t - 2 Let i(s) = -169s2 + 2s. Let g(c) = -49c + 3. Let o(d) = 31d - 2. Let z(f) = -2g(f) - 3o(f). Determine z(i(j)). -845j2 + 10j Let c(h) = -43h - 1. Let g(r) = 13r - 3. Let i be (-108)/(-63) - (-3 + 19/7). Let t(w) = -8w + 2. Let l(m) = ig(m) + 3t(m). Calculate c(l(z)). -86z - 1 Let k(j) be the second derivative of -j*3/6 - 34j. Let a(l) be the first derivative of 8l3/3 + 17l*2/2 - 1371. What is a(k(r))? 8r*2 - 17r Let r(w) = -98w. Suppose -7v + 5v = -4. Let i(s) = -2s*2 + 16s*v + 0s*2 - 13s*2. Give i(r(n)). 9604n*2 Let y(v) = 24955v. Let j(c) = -377c2 + 12. Determine y(j(w)). -9408035w*2 + 299460 Let z(b) = 9586167b. Let j(p) = p. Determine z(j(f)). 9586167f Let g(c) = -c + 379. Let k(y) = -116011y. What is g(k(m))? 116011m + 379 Let h(b) = b2 - 8b - 8. Let r(d) = -5d2 + 24d + 24. Let t(u) = -3h(u) - r(u). Let y(j) = 3597j*2. What is y(t(a))? 14388a*4 Let i(v) = -118v + 2. Let n(t) = -4t - 41219. Calculate n(i(a)). 472a - 41227 Let d(t) be the first derivative of -5t2/2 + 1602. Let f(v) = -4v - 12. Give d(f(o)). 20o + 60 Let r(q) = -q - 13. Let s be r(-15). Let g(d) = -68d*2 + 3 - 41d*s - 3. Let j(v) = -2v. Calculate j(g(a)). 218a2 Let d(z) = 1 - z + z - 64z*2. Let n(q) = 22059488 - 11029745 + q - 11029743. Determine d(n(j)). -64j*2 + 1 Let f(x) = -5x. Let c(z) = -11029287z2. What is f(c(s))? 55146435s*2 Let i(m) be the third derivative of 29m*4/6 + 7m2. Let o(y) = -y2. Give i(o(g)). -116g2 Let u(f) = -437f*2. Let z(w) = 94347w. Calculate z(u(o)). -41229639o2 Let o(k) be the second derivative of k4/12 - 5k - 98. Let u(s) = -4s2 - 44. What is u(o(a))? -4a*4 - 44 Let w(z) = z - 3. Let h(c) = -c + 5. Let q(m) = -6h(m) - 10w(m). Let l be (-117)/(-26)(-26)/(-9). Let p(x) = 8x2 - lx2 + x2 - 7x2. Give p(q(u)). -176u2 Let r(g) be the first derivative of -g2 + 170. Let u(t) = -45t - 228. Let v(s) = -19s - 91. Let a(f) = -5u(f) + 12v(f). Determine a(r(n)). 6n + 48 Let v(q) be the first derivative of 4q*2 - 78. Let t(l) = l. Let h(j) = -6t(j) + v(j). Let s(a) = -3a2 - 5a. Calculate h(s(y)). -6y2 - 10y Let k(x) = -65x2 - 422x + 24. Let s(a) = -2a2 - 3. What is k(s(r))? -260r*4 + 64r*2 + 705 Let c(r) be the third derivative of 13r*5/12 - 103r*2. Let x(h) = 12h. Calculate c(x(u)). 9360u2 Let x(p) = -3024p*2. Let a(j) = -54118j. Determine x(a(t)). -8856563962176t2 Let t(f) be the second derivative of -5/4f*4 + 0f*2 - 4f + 0f3 + 0. Let r(l) = l - 8l + l + 4l. Give t(r(y)). -60y*2 Let p(j) be the third derivative of -27/8j*4 - 59j*2 - j + 0 + 0j*3. Let a(k) = -k. Give a(p(d)). 81d Let u(g) be the first derivative of -3g2 + 1. Let f(z) = -z2 + 456z. Let x(a) = -114a. Let s(v) = f(v) + 4x(v). Give u(s(h)). 6h2 Let s(b) = 2b - 699. Let j(q) = -1436q. Determine j(s(d)). -2872d + 1003764 Let k(j) = -173j. Let q(g) = -1 + 1 - 160g + 319g - 168g. Determine q(k(h)). 1557h Let k(p) = -p2. Let i(q) = -10q*2. Let g(z) = -2i(z) + 22k(z). Let t(h) be the second derivative of 0h*2 + 0 + 4h + 25/3h3. What is t(g(v))? -100v*2 Let o(z) = -14516999z*2 - 11. Let t(k) = 2k. Determine o(t(y)). -58067996y2 - 11 Let m(h) = -6h2 + 3 + h2 - 3. Let a(w) = -6w2 - 6w - 78. Let l(n) = -5n2 - 7n - 91. Let q(i) = 7a(i) - 6l(i). What is q(m(v))? -300v4 Let j(h) = -15 + 15 - h. Let m(p) = -52p*2 - 7p - 21. Let r(x) = 2x2 - x - 3. Let w(l) = -m(l) + 7r(l). What is j(w(k))? -66k2 Let w(n) = 30n + 35. Let u(p) = -13p - 15. Let d(i) = 7u(i) + 3w(i). Let l(g) = -1111g*2 - 1. Determine d(l(c)). 1111c2 + 1 Let t(p) be the third derivative of -p5/60 - 311p2. Let f(g) = -24 + g2 - 2g**2 + 3. Giv	{ "pile_set_name": "DM Mathematics" }
99j - 38) to aj + w + kj2 and give k. 54 Rearrange (-553f - 140f - 1071f)(-6f*2 - 4f*2 + 36f*2) to the form vf*3 + o + if*2 + lf and give v. -45864 Express (23 + 9 - 3)(72u + 433 - 433)(-3u + u - 2 + u) as o + nu + ju2 and give j. -2088 Express -37 - u2 + 1067u - 1112u + 0u2 as bu + xu2 + n and give x. -1 Rearrange (8p + 2p - 9p)(69 + 51 - 9) to ip + t and give i. 111 Rearrange (-24f2 - 234f + 234f)((-2f - 2f + f)(4f - 4f + 3f) + 2f2 + f - f) to vf*4 + l + qf*2 + af*3 + pf and give v. 168 Rearrange -1005x2 - 22 + 4825x - 2488x - 2337x + (-x + 4 - 4)(-x + 3x + 0x) to the form tx + wx2 + b and give w. -1007 Express (-5u + 0u + 3u)(-2 - 2u + 2) + u2 - u2 - 2u2 + (275 - 11u - 275)(-u + u + u) + 4 - 7u*2 - 4 as j + ou + qu2 and give o. 0 Express (57 + 5c - 54 - 2c)((2c - 2c - 2c)(-c - 10c + c) + 192c - 192c - 86c*2) in the form nc*3 + h + kc + dc2 and give n. -198 Express 9159m*2 + 12352m*2 - 2464m*2 as dm + s + km2 and give k. 19047 Express (24 + 42 - 6)(7q + 16q + 21q + (0 - 3 + 1)(-1 + 1 + q) + (-q - q + 0q)(2 + 1 - 2) + 2q - 3q + 2q) as x + iq and give i. 2460 Express (-20p + 18p - 28p)(6 + 9 - 9p3 - 13) as i + zp*2 + dp*3 + op + tp4 and give t. 270 Rearrange (-46u - 9u + 695 - 699)(-13 + 1 - 4)((-6 + 1 + 3)(3 - 3u - 3) + u + 4 - 4) to the form f + zu + ru2 and give r. 6160 Express (-71 + 71 - 290x)(27 - 27 + 29x) as j + yx + qx*2 and give q. -8410 Rearrange ((5 - 2 - 1)(3x + 1158 - 2616 + 1272) - 2 + 2 + 4x)(-3x*2 + 3x*2 - 2x*2) to the form jx*3 + lx + sx2 + z and give j. -20 Rearrange (-170618j - 154895j - 56861j + 54633j + 46551j)(4 - 5 + 2) to the form q + gj and give g. -281190 Rearrange (-10 + 0 - 6)(2q*2 + 0q + 0q)(0q2 - 24q*2 - 2q*2) to kq*3 + sq*4 + tq + f + bq2 and give k. 0 Express 279l - 7l3 - 164434 - 2l*4 - 6l*3 + 164432 + 218l in the form cl2 + zl*3 + ul*4 + yl + r and give r. -2 Express (5 + 29 - 10)(8p*2 - 22 + 22) + (5p - p - 5p)(-3p - 3p + 4p) as jp*2 + r + wp and give j. 194 Rearrange 41 - 937x4 + 3x*2 - 32 - 1974x4 + x - x3 - 11 to the form yx2 + l + nx*4 + ux + jx3 and give n. -2911 Express -1223p - 2p4 + 50p*3 + 1224p - 308p3 + 4p*2 as xp + w + mp2 + up*3 + yp*4 and give m. 4 Express 509b*2 + 8b*3 + 2 - 758b*2 - 15b*2 + 472b*2 + 2b as xb + y + ob*3 + ib*2 and give i. 208 Rearrange 40064a - 80818a + 44392a to va + k and give v. 3638 Express (-o - 3o + 2o)(4o - o - o)(-211 - 165 + 345 - 672) in the form uo + r + jo*2 and give j. 2812 Express (-4z + 23z + 25z)(5 - 3 + 4) + z + z + z + (-2 + 1 - 1)(-z + 0z + 3z) - 7z + 0z + 5z in the form yz + o and give y. 261 Rearrange (-5u3 + 4u*3 + 4u*3)(3 - 3 + u) - 1083u4 - 1579u*4 - 1641u*4 to the form zu + wu4 + ou*3 + p + vu*2 and give o. 0 Express -1137b + 163 - 1044b + 2146b as d + hb and give d. 163 Rearrange -2 + 2 + 2535891q - 2546349q to the form s + vq and give v. -10458 Rearrange -2868 + 336x2 + 2868 - 12x to tx2 + lx + f and give t. 336 Express ((5 - 5 - 3j)(j2 - j2 + j*2) + 0j*2 + 2j*3 + 0j*2)(449 + 13j + 25j - 448) in the form pj2 + ij*4 + wj*3 + b + oj and give w. -1 Express (-2 + 0 + 1)(-751 - 747 + 22899k + 1498) in the form mk + r and give m. -22899 Express 3970i - 54i - 60i + 232i as fi + m and give f. 4088 Rearrange 28 + 107x3 - 106x*3 + 10x*2 + 17 + 8x*2 to c + ux + tx2 + nx*3 and give n. 1 Express 3331826t*2 - 3331881t*2 + 12 + 39 in the form ot + nt2 + j and give j. 51 Express -7y*2 - 24063y + 24060y + 47 + 263 in the form hy + c + ky2 and give c. 310 Express 10388b + 7755b - 2728b - 1559b in the form q + rb and give r. 13856 Rearrange (-1 - 30 - 19)((-4 + 2 + 0)(109 - 15p - 109) + 0p - 3p + 4p + 0p - 2p + 0p) to the form m + rp and give r. -1450 Express -i - 22i + 10i - 5i3 - 6i*3 - 4i3 + i3 + (-1 - 6i + 1)(i*2 - 6i*2 + 3i*2) in the form gi*2 + di + pi3 + c and give p. -2 Express -114227276w + 20265w2 + 114227276w + (-w + 2w + 0w)(4w + 2w - 4w) in the form jw2 + r + qw and give j. 20267 Express (-2329 + 1162 + 1167 - 6247f - 16420f)(0f*3 + 3f3 - f3) in the form jf3 + m + vf*2 + yf*4 + tf and give y. -45334 Rearrange 20p + 2750p + 2358p - 859p - 39p2 + 38p*2 to the form l + dp + np2 and give n. -1 Express 6616t*2 + 630206321 - 630206321 + 4t in the form rt2 + h + xt and give x. 4 Express 3 + v - 3 + (-4v + 4v - 2v)(-5550 - 4679 - 935) as ov + q and give o. 22329 Rearrange (24g - 14g + 16g)(2g + g - 5g) + 28g - 8g2 - 28g to the form qg2 + kg + w and give q. -60 Rearrange (24 - 84 + 28)(2s + 0s - 4s)((2 + 0 + 0)(s*2 + 2s*2 - 4s*2) - 6s + 13s + s2 - 6s) to js3 + cs*2 + ds + v and give v. 0 Express -x*4 + 22x*3 - 9x*2 - 6 - 32x*3 - 1 - 4x*2 + 14 as px*3 + ox*2 + m + ax + gx4 and give o. -13 Express 23 - 10 - 8228t - 13 + 596t in the form dt + s and give d. -7632 Rearrange d*3 - 80d*4 + 3d*2 - 1 - 4d*2 - 2d - 5d3 + 2d*3 to the form kd + pd4 + g + yd*2 + bd*3 and give g. -1 Express -13599x + 19171x - x2 - 13486x in the form w + px2 + dx and give d. -7914 Rearrange -64514 + 32261 + 3925d + 32253 to y + cd and give y. 0 Express 680t + 454t - 4t - 4 + 5 + 425t as kt + o and give o. 1 Rearrange (-2k - 16k + 5k)(-375 - 346 - 193 + 275)(k*3 - 3k*3 - 6k*3) to the form rk + xk3 + m + dk*4 + pk*2 and give d. -66456 Express 22c + 146c + 67c + 811 - 400 - 407 in the form f + oc and give f. 4 Express 2936v + 9580v + 2510v - 856v as l + wv and give w. 14170 Rearrange -136v2 + 791v*2 + 465v*2 + (-2v + 4v - 4v)(-v - 2v + 2v) + 9v*2 - 3 + 3 to a + mv + lv2 and give l. 1131 Express 44 + 104 - 4v*2 - 207 + 2v + 48 + 2v2 - 2v*4 in the form hv*3 + dv + yv4 + xv*2 + q and give y. -2 Express ((3 - 2 + 0)(14 - 14 + 7p) - 2 - 2p + 2 + p + 0p + 2p)(-113p - 74p - 28p) as s + tp2 + lp and give t. -1720 Rearrange (l - l - l*3)(-3l + 4l - 3l) + (-2884427l*2 + 2884427l*2 - 1901l*3)(2l - 4 + 4) to t + nl*4 + gl*2 + ol + rl3 and give n. -3800 Rearrange (4u - 125u + 227u)(-4 + 4 + u)(3u - 3u + u) to lu3 + vu*2 + mu + n and give l. 106 Rearrange ((89k + 23k + 34k)(3k - 2 + 2) + 5k2 + k2 - 4k2)(-2k + 3k + 0k - 1) to j + dk*3 + pk + nk2 and give n. -440 Rearrange 5o - 26 - 36 - 10o + 12 to t + zo and give t. -50 Rearrange ((2 + 1 - 2)(-1 - 1 + 3) - 12 - 9 - 61)(12k - 7k + 14k) to the form q + jk and give q. 0 Rearrange (r - 6r - 7r)(1 + 4r*2 - 1) - 3r*3 - 3r*3 + 4r*3 + (-4r*2 + 4r*2 - 4r*2)(4r - 3r - 3r) to br + c + kr3 + pr*2 and give k. -42 Express 2 - 2t*3 - 373t + 136t2 - 384t + 758t in the form rt + bt2 + ot*3 + k and give k. 2 Rearrange (-2 + 0 + 4)(-313 - 307 - 1374s + 620) + 3s - 11s - 5s to the form i + ls and give l. -2761 Express -2538m + 480m + 105m in the form sm + n and give s. -1953 Rearrange (1 - 1 + 2)(2w + w - w)(-60w2 - 124w - 58 + 58 + 123w) to yw + bw2 + r + gw*3 and give b. -4 Rearrange 6095m - 1566834 + 1566834 to hm + l and give l. 0 Express (0 + 2 - 3)(206 - 140 + 173 + 154)(-1 + 1 + z) in the form h + nz and give n. -393 Rearrange 3483w3 - 102 - 1698w*3 - 1745w*3 to the form fw + m + nw2 + jw*3 and give j. 40 Rearrange -5j*2 - 2j2 + j2 + (3j + j - 6j)(-3j - 2j + 6j) - 24j2 - 2 - 92j*2 + 2 to cj + o + gj2 and give g. -124 Rearrange 450n*3 - 1510n*3 + 3711n*3 + (-1 + 1 - 2n)(-4 + 4 + 2n*2) - 4n*3 + 3n*3 + 0n*3 to h + xn*2 + bn + fn3 and give f. 2646 Express (-629 + 4741488d*2 - 4741496d*2 - 980)(-d - 2d + 2d) as cd2 + k + qd*3 + zd and give z. 1609 Express (2f2 + 2f*2 - 3f*2)(4 + 1 - 7) + 42 - 42 - f*2 + (0 + f + 0)(-206 + 5f + 206) as zf + of*2 + u and give o. 2 Express (0 + 8 + 361418	{ "pile_set_name": "DM Mathematics" }
i - ma + 4002, -a - 2404 = 12i - 15i. What is the tens digit of i? 0 Suppose 4c + 14 = -5n, n - 4c + 3 = -5c. What is the tens digit of n - -802(-5)/(-10)? 9 What is the tens digit of ((-420393)/(-68))/(5/(40/3))? 8 Let b(m) = -m3 + 3m*2 - 3m + 2. Let c be b(1). What is the units digit of -764c((-147)/(-28) - 6)? 3 Suppose -v = -10v + 99. Suppose -5u + 26 = v. Suppose 2q - u = -7, 2n + 4q = 202. What is the hundreds digit of n? 1 Let t = -2487 + 5281. What is the tens digit of t? 9 Suppose -98v + 831763 = 2095. What is the hundreds digit of v? 4 Let v be 6/18(1 - -8). Suppose 8 = 3o - 2m, -vo - 3m + 22 = 2m. Suppose -10g + 5g = ou - 611, -2u - g = -307. What is the hundreds digit of u? 1 Let v(q) = -q*3 + 32q*2 + 31q + 64. Let u be v(33). Let h(r) = 171r2 - 9r - 4. What is the hundreds digit of h(u)? 6 Let c(y) = 170y2 + 57y + 245. What is the units digit of c(-6)? 3 Let m(u) = 229u2 - 30u - 1514. What is the thousands digit of m(-18)? 3 Let h be (-292)/(-18) - 16/72. Let l = -38 + h. What is the units digit of l/(-55) - 18/(-5)? 4 Suppose -5z + 3r + 11 = 0, -z + 3 = -6z - 4r. Let u be (9 - (z - 1))1/3. Suppose -5 = 3t - 3a - 176, -3a - u = 0. What is the units digit of t? 6 Suppose 10d - 89392 - 58763 = -41d. What is the thousands digit of d? 2 Let d(t) = 5t - 17. Let l be d(-5). What is the units digit of (l/18)/((-9)/54)? 4 Let b(d) = 8d*3 - 4d*2 - 2. Suppose 2y + 2u - 17 = -3y, 3y + 3u - 3 = 0. What is the hundreds digit of b(y)? 8 Suppose 3z + 0n + 77 = -2n, 2z = n - 49. What is the hundreds digit of (-1)/10z182? 4 Let y = 596 - 616. What is the tens digit of 51860/45 - (y/36 - -1)? 5 Let n be (5 + -10 - -5) + 28. Let m = n + 35. What is the units digit of m? 3 What is the thousands digit of (2 - 0) + (1671 - (-90)/(-9)) + 0? 1 Suppose 89x - 982173 = 1870010. What is the ten thousands digit of x? 3 What is the units digit of (-20)/190 - (-2515725)/285? 7 Let h = 1033 - 604. Suppose 137 - h = -4z. Let r = z - 41. What is the tens digit of r? 3 What is the units digit of -3 - 43/(344/(-486048))? 3 Suppose 38x - 17x - 206943 = 6606. What is the thousands digit of x? 0 Let w(t) = -3474t + 820. What is the tens digit of w(-23)? 2 Let s = -86 - -92. Let g be 124/3s/(-4). Let u = 21 - g. What is the units digit of u? 3 Let b(u) = -19u2 - 1. Let o be b(0). What is the units digit of ((-1564)/(-16))/(6/(-8) - o)? 1 Let q(b) = b2 - 6b - 8. Let z be q(6). What is the hundreds digit of 24/(-192) + 0 + (-937)/z? 1 Let y = 1520 - 1466. Suppose 5 = -l, -4a - 120 = -5l + 23. Let m = y + a. What is the tens digit of m? 1 Let k(o) = -o*3 + 5o*2 + o + 30. Let l be k(6). Suppose 1721 = 3j + 2b, -4b = 4j - lj - 2292. What is the hundreds digit of j? 5 Suppose 0 = 10s + 5s - 235525 - 22460. What is the hundreds digit of s? 1 Let k(b) = 2b + b2 + 2b - 5b + 2b + 3. Let t be k(0). What is the units digit of t(106/6 + (-2)/1)? 7 Let g(m) = -m2 - 15m - 40. Let y be g(-15). What is the tens digit of 754/1 + (y - -45)? 5 Let i(o) = 4o2 + 108o + 267. What is the ten thousands digit of i(-111)? 3 Suppose 21f + 2s = 16f + 340386, 4f + s - 272307 = 0. What is the units digit of f? 6 Let s(j) = -j*2 + 10j - 21. Let u be s(6). Suppose 3w - 1935 = -uq, 647 = q + w - 2w. What is the tens digit of q? 4 Suppose -5w = -0m + 4m - 12, 2m + 5w = 6. Suppose -l - 1099 = -mt - 2t, -5t = -3l - 1097. Suppose 5q = -0q + t. What is the units digit of q? 4 Suppose -8g = -67973 + 50989. What is the thousands digit of g? 2 Let q(v) = -v3 - 4v*2 - 3v - 1. Let j be q(-4). Let u(s) = 3s2 - 28s - 4. Let f be u(j). What is the units digit of (-5)/5 + 0 + f? 0 Let z = -24 + 26. Let y(s) = -1 + 18sz - 2 - 2 + 2 - 2s. What is the units digit of y(-2)? 3 Suppose 59s - 65s = -6000. What is the hundreds digit of s + 2 + -2 + -12 + 16? 0 What is the thousands digit of (39/117 - (-9314)/30)135? 0 Suppose 148 = 11f + 38. Suppose 5s + f = 0, -4d + 181 = -d + 4s. What is the units digit of d? 3 Suppose -3h - 5m + 7 + 25 = 0, 0 = 3h + 3m - 24. Let l(v) = hv - 2v + 4v2 + 4 - 6v. What is the units digit of l(1)? 4 Let k(i) = -2i2 + 44i - 25. Let f be k(21). Let m(s) = s*3 - 16s*2 + 3s - 18. What is the units digit of m(f)? 2 Let f = 1589 + 11239. What is the hundreds digit of f? 8 Let i = 52 - 50. Let q(p) = 14p2 + 4p - 1. Let h be q(i). Suppose 5j + h - 518 = 0. What is the units digit of j? 1 Suppose 2q + 1722 = 5o, 3o - 573 = 3q + 462. What is the tens digit of (2 - o/6)(-12)/8? 8 Suppose -3k + 4l = 17, 4k + 4l - 4 = -8. What is the tens digit of 28/(-7) + (767 - k)? 6 Let w = 72728 - 47526. What is the thousands digit of w? 5 What is the thousands digit of 1968/(-2460) - (1 - (-67048)/(-10))? 6 Suppose 258q = 2w + 262q - 2140, -4308 = -4w - q. What is the units digit of w? 8 Suppose -6 = 3r, -r + 5 = -4c + 39. Suppose -4b = -2d - 2368, -1776 = -11b + cb - 5d. What is the units digit of b? 2 Suppose -384 = 12f - 1392. Suppose 364 = -4i - f. Let v = i + 161. What is the units digit of v? 9 Let l be -612(-8)/((-96)/(-9)). Suppose -2p + 3u + 680 = 0, 4p = u + 911 + l. What is the tens digit of p? 4 Let o be (-2320)/(-1276) - (-6)/33. Let w(x) be the third derivative of x6/60 - x5/30 + 5x*4/24 - 5x3/6 + x2. What is the tens digit of w(o)? 1 Let p(l) = -2l + 10. Suppose 2c - 8c + 18 = 0. Let o be p(c). What is the units digit of 15 - 1 - (-3 + o)-2? 6 Let o(y) = 27y2 - 84y - 168. What is the hundreds digit of o(38)? 6 Let y(x) = 2x2 - 4x. Let g(k) = k*2 + 13k - 10. Let n be g(-14). Let r be y(n). Let p = 31 + r. What is the tens digit of p? 4 Let b = 2326 + -801. What is the units digit of b? 5 Suppose 85 = 9i - 8i. Suppose -7b - 1 = -i. What is the tens digit of b? 1 Suppose 8 = 6c + 50. Let z(q) = -4q3 + 8q*2 + 2q + 1. What is the tens digit of z(c)? 5 What is the thousands digit of 27328291/1645 - 8/(-140)? 6 What is the units digit of 157 - (6/(-18) + 4/(-6))? 8 Suppose 6k + 525 = 9k. Suppose k = -6w + w. Let i = 104 - w. What is the units digit of i? 9 Let t be 17 - 11 - -2769. Suppose 0 = 913b - 920b + t. What is the tens digit of b? 6 Suppose -8u + 9585 = -1399. Let j(q) = -22q*3 - 6q*2 + 3q - 1. Let t be j(-3). Suppose -t = -11k + u. What is the units digit of k? 3 Suppose -2d - 37v + 5738 = -32v, -5730 = -2d - v. What is the tens digit of d? 6 Suppose -2i + 8 = 0, 4i = -211c + 214c - 54299. What is the hundreds digit of c? 1 Suppose 297p = 295p - 678. Let f = 228 - p. What is the hundreds digit of f? 5 Let f(i) = -i. Let b(x) = -192x + 95x - 1 + 91x - 53. Let j(c) = -b(c) + 3f(c). What is the units digit of j(-16)? 6 Let g(o) = 2o*3 - 99o*2 - 92o + 1280. What is the thousands digit of g(58)? 3 What is the hundreds digit of (39/26)/(6/48-6) + 49147? 1 Suppose -32286y + 32280y + 1602 = 0. What is the hundreds digit of y? 2 Let k(p) = -p2 + 51p - 87. Let i be 0/1 - 714/(-21). What is the units digit of k(i)? 1 Suppose 85r - 18 = 84r. What is the units digit of 10 + 4r/24? 3 Suppose -3q + 7 = 10. Let k be (3 + -8)/(-5) - q. What is the units digit of (2 - 381/(-6))k/1? 1 Suppose -5306 = 359w - 93945 - 158712. What is the tens digit of w? 8 Suppose m = -3c - 37 + 1286, 1253 = m - c. Let z = m + -862. What is the tens digit of z? 9 Suppose n + 69 = 4f + 12, -3f = -n - 42. Let l(d) = d2 - 12d + 23. What is the tens digit of l(f)? 6 Let a be (-6)/(-16)2 + (-527)/(-124). Suppose 0 = k + x - 95, 2k + ax - 57 = 142. What is the units digit of k? 2 Suppose 6 = 3l - 3. Let g be 1((-2)/l)/((-8)/36). Suppose 3r - 183 = -3s, s + 208 - 17 = gr. What is the units digit of r? 3 Let s = -1 - 19. Let n = s + 149. Let q = n + -39. What is the tens digit of q? 9 Suppose 0 = t - 1 + 7. Let d be ((-40)/(-12))/(t/(-9)). Suppose dx - 114 = 4x. What is the tens digit of x? 1 Suppose 0 = -5i + 3v + 7191, 5v + 10465 = 5i + 3280. What is the hundreds digit of i? 4 Let j = -11369 + 15554. What is the units digit of j? 5 What is the ten thousands digit of (-814)/(-6)((-7 - -437) + (5 - 3))? 5 Let g(p) be the second derivative of p*	{ "pile_set_name": "DM Mathematics" }
vative of k*5/24 - 3k*4/8 - 7k*3/3 - 8. Let c(t) be the third derivative of a(t). Find the first derivative of c(l) wrt l. 5 Suppose -98 = -34n - 30. Let b(g) be the third derivative of 7/24g4 - 7g*n + 0 - 1/6g*3 + 0g. Differentiate b(r) with respect to r. 7 Let f(i) = -4i - 35. Let s be f(-14). Find the second derivative of 5n*2 - sn + 2n + 10n*2 - 3n*2 wrt n. 24 Let p(y) be the first derivative of -4 - 5y*2 - 5y + 0y3 + 1/2y*4. Let c(h) be the first derivative of p(h). Differentiate c(l) wrt l. 12l Let s(u) = 5u - 1. Let l be s(-1). Let b be (l/1)/(33/(-22)). What is the derivative of -1 - 3 + b + 4 - 10m*3 wrt m? -30m*2 Find the second derivative of 36 + 4 - 26m + 23m - 44m2 wrt m. -88 Let t(s) be the first derivative of s7/7 + 37s4/4 + 43s*3/3 + 2s*2 - 181. Find the third derivative of t(i) wrt i. 120i*3 + 222 Let b = -37 + 41. Find the third derivative of -20w*4 + 39w*4 - 38w*2 - 23w*b wrt w. -96w Let t be (-747)/(-1512) + (-69)/21 + 3. Let f(x) be the third derivative of 1/6x3 + tx*4 + 0x - 5x2 + 0. Differentiate f(r) with respect to r. 5 Find the third derivative of -429n + 89n5 + 429n + 8n2 - 4n*3 + 4 wrt n. 5340n2 - 24 Let g(l) = l5 + l*4 + 2l*3 - 1. Let t(b) = -24b*5 + 3b*4 - 6b*3 + 95b*2 + 3. Let f(k) = -3g(k) - t(k). Find the third derivative of f(d) wrt d. 1260d2 - 144d What is the second derivative of 8i - 7 + 152i*2 + 111i*2 - 9i wrt i? 526 Let t(l) be the first derivative of 120l6 - 57l*2/2 - 246. What is the second derivative of t(q) wrt q? 14400q*3 Let s = 14 - 12. Suppose -3x = s - 11. What is the second derivative of 3t - 2t*x - 5t + 0t3 + 4t wrt t? -12t Find the third derivative of -213q*2 + 341q*2 - 816q*4 + 882q*4 + 364q*2 wrt q. 1584q Let z(b) = 2b5 - 2b*4 + 2b*3 - 99b + 2. Let t(s) = -s4 - s3 + s + 1. Let y(c) = -2t(c) + z(c). Find the second derivative of y(u) wrt u. 40u*3 + 24u Let p(t) = -t*2 + 13t + 21. Let g be p(13). Find the first derivative of -9 + 62 + 6x4 - 12 - gx*4 wrt x. -60x*3 Let k(h) = 4h*3 + 2h*2 + 1. Let c(x) = -16x*3 + 7x*2 + 483. Let j(f) = c(f) + 6k(f). Find the first derivative of j(w) wrt w. 24w2 + 38w What is the second derivative of -78 + 3a + 96a*2 + 56a*2 - a + 285a*2 + 14a2 wrt a? 902 Let n(v) be the third derivative of v7/21 - 7v6/120 + 14v*5/15 + 6v*2 - 5v. What is the third derivative of n(x) wrt x? 240x - 42 Suppose -2q = -0q + 5t + 15, 0 = -q + 5t + 30. Suppose -h + 18 = qb, b = -3b + 12. What is the second derivative of -hw - 58w2 + 58w2 + w3 wrt w? 6w Let u = -7 - -3. Let p(f) = -9f - 4. Let o(h) be the first derivative of -19h2/2 - 8h + 2. Let i(q) = uo(q) + 9p(q). Differentiate i(j) wrt j. -5 Let o(c) = -17c3 + 4c*2 - 7c - 99. Let h(m) = 15m3 - 4m*2 + 6m + 100. Let y(b) = -7h(b) - 6o(b). What is the derivative of y(l) wrt l? -9l2 + 8l Let a(u) be the third derivative of -42u2 - 19/60u*5 + 0 + 23/6u*3 + 0u - 1/24u4. What is the derivative of a(t) wrt t? -38t - 1 What is the third derivative of -42k - 126k*6 + 42k + 29k6 + 86k*2 wrt k? -11640k*3 Let x(j) be the first derivative of 22j*5/5 + 4j*3/3 + 66j*2 - 56. What is the second derivative of x(u) wrt u? 264u*2 + 8 Let y(i) = i + 29. Let j be y(-12). Find the second derivative of 127q - 2 - 109q + 2 + jq*5 wrt q. 340q*3 Let p be 14/8 - (-11)/44. What is the second derivative of 17 - 10l + 17l + 49l*p - 6l wrt l? 98 Let v(y) be the first derivative of 4y6/15 + y3 + 2y + 4. Let l(z) be the first derivative of v(z). Find the second derivative of l(j) wrt j. 96j2 Let w = 56 - 53. Let n(l) be the third derivative of 0 - l2 + 1/6l*4 + 0l - l*w. What is the first derivative of n(r) wrt r? 4 Let z be (-39)/(1 + -4) + 2. Let d = z - 9. Differentiate d - 6p - p - p + 1 with respect to p. -8 What is the second derivative of -3l3 + 4l*3 + 5l5 - l3 + 23l + 188l*5 wrt l? 3860l*3 Let y(n) = -5n - 30. Let l be y(-6). Let t(q) be the first derivative of q + 3 + lq3 + 7/4q*4 + 0q*2. Differentiate t(k) with respect to k. 21k*2 Let c(z) = -115z + 115. Let l(y) = -172y + 173. Let a(x) = 8c(x) - 5l(x). Find the first derivative of a(w) wrt w. -60 Find the second derivative of -13d - 18d4 + 0d - 3d - 14d wrt d. -216d2 Let y(z) be the third derivative of 107z6/15 - z4/3 + z*3/6 - 607z*2. What is the second derivative of y(j) wrt j? 5136j Suppose 0 = 4c - 0c. Suppose c = 3p - 2p. Find the second derivative of -m + pm2 + 0m*2 - 3m*4 + 2m*4 wrt m. -12m*2 Suppose 7h - 4h - 12 = 0. Find the first derivative of -5c*h - 11 + 0c*4 - 12c*4 + 2c*4 wrt c. -60c*3 Find the second derivative of -2c*2 + 57c*5 + 365 - 730 + 365 + 19c wrt c. 1140c3 - 4 Suppose 5g - 10g = -15. Find the third derivative of -7b*g + 7b*3 + 44b + 3b3 + b2 wrt b. 18 Find the second derivative of 237m - 40m2 + 130m + 170m + 64m*2 + 93m*2 wrt m. 234 Let n(v) be the second derivative of -44v*4/3 - 10v*3/3 - 3v*2/2 - 197v. Find the second derivative of n(d) wrt d. -352 Let m(g) = -46g4 + 4g*3 + 577g - 8. Let c(t) = -46t4 + 3t*3 + 578t - 6. Let f(j) = -4c(j) + 3m(j). Find the second derivative of f(u) wrt u. 552u2 Suppose 3u + 0h + 6 = -3h, -6 = u + 3h. Let l(t) = t2 + 5t + 8. Let y be l(-7). What is the first derivative of u + 17m2 - ym*2 - 3 wrt m? -10m Suppose 4p + 5 = 17. Let i be 3 + (-6)/(-5 + p). Find the third derivative of 8v*2 - iv*6 - 9v*2 - 7v*2 wrt v. -720v*3 Let n(z) be the second derivative of -9z*2 + 26/3z*3 + z + 2. Differentiate n(m) wrt m. 52 Let y(i) be the third derivative of 11i7/105 + i5/6 + i*3/2 - 17i*2 + 1. What is the third derivative of y(b) wrt b? 528b What is the first derivative of 13 + 61l4 - 16l*4 + 49 wrt l? 180l*3 Let t(h) be the second derivative of 3h5/20 - h4/12 - 69h3/2 - 312h. What is the second derivative of t(j) wrt j? 18j - 2 Let z(f) be the third derivative of -211f8/336 + f5/60 - f*4/24 + 59f*3/3 - 174f*2. Find the second derivative of z(c) wrt c. -4220c3 + 2 Let x(z) = -z4 + z3 + z2 - z + 4. Let g(v) = -761v4 - 3v*3 - 21v*2 + 3v + 1. Let h(u) = g(u) + 3x(u). Find the third derivative of h(j) wrt j. -18336j Let m(o) be the third derivative of -53o6/40 + 3o5/20 - o4/24 - 75o2 + 2. What is the third derivative of m(w) wrt w? -954 Let u(a) = 2a*2 + 2a - 1. Let x(r) = -33r2 - 10r - 43. Let z(h) = 6u(h) + x(h). Find the first derivative of z(g) wrt g. -42g + 2 Let r(g) = 50g + 0 + 4 - 51g - 3. Let q(m) = 10m3 - 17m*2 + 4m - 4. Let s(j) = q(j) + 4r(j). What is the third derivative of s(b) wrt b? 60 Suppose 5l = -2h + 43, -8 = -2h + 3l - l. Find the third derivative of 4n*2 + hn2 - n2 + 14n5 wrt n. 840n*2 What is the third derivative of 205r*5 + 304r - 8r2 + 135r*5 + 9r*2 wrt r? 20400r*2 Let p(g) be the third derivative of 0g*4 + 0g*6 + 0g*3 - 2/15g*5 + 0g - 11/210g7 + 26g*2 + 0. What is the third derivative of p(y) wrt y? -264y What is the third derivative of 5814o - 3o*3 + 6o*2 + 10o*4 - 30o*3 - 5781o wrt o? 240o - 198 Differentiate 30312s*4 - 4s*2 + 178 - 29932s*4 + 4s*2 with respect to s. 1520s*3 Let s = 21 - -2. Find the second derivative of -4c - 41c3 + sc - 9c - 6c wrt c. -246c Suppose -j + 12 = 2j, -3b + 2j = 26. Let f be (4/b)/(14/(-84)). Find the first derivative of -6 - 4mf - 4m*4 + 4 wrt m. -32m*3 Let n(d) be the second derivative of 0d*3 - 5/2d*2 + 0 + 0d*4 + d - 1/4d*5. Find the first derivative of n(c) wrt c. -15c*2 Let s(h) = 146h*3 + 12h*2 - 319h + 3. Let i(d) = -145d3 - 16d*2 + 318d - 4. Let p(r) = 3i(r) + 4s(r). What is the second derivative of p(g) wrt g? 894g Suppose 0 = 2d + 4b + 2, -2 + 6 = -b. Find the second derivative of -dp3 + p3 + 2p + 3p*3 + 2p*3 wrt p. -6p Let w(c) = 200c3 - 4c*2 + 3c - 647. Let i(s) = -195s3 + 6s*2 - 4s + 646. Let z(r) = 2i(r) + 3w(r). What is the derivativ	{ "pile_set_name": "DM Mathematics" }
the fourth biggest value? (a) -3 (b) 5 (c) 3 (d) -2 (e) -128 a What is the third smallest value in 12/2639, 5, 1, -4, 0.1, -0.3? 12/2639 Which is the fourth biggest value? (a) -5 (b) 5 (c) -2/19 (d) -1770/49 d Which is the third smallest value? (a) 3031 (b) 2/11 (c) 1 a Which is the fifth smallest value? (a) -5 (b) 1 (c) -0.1 (d) -4 (e) 1307 e What is the third smallest value in -79, 1, 97.25? 97.25 What is the fifth biggest value in -4599, 0.5, -5, -0.1, -2? -4599 Which is the fourth smallest value? (a) -0.4 (b) 0.0892 (c) 0.3 (d) -0.02 c What is the smallest value in -0.3, 306.19, -2/5? -2/5 Which is the biggest value? (a) -1 (b) 0.09 (c) 1/6 (d) 1 (e) 3 e What is the fourth smallest value in -5, -2, 35, 74, -5/2? 35 Which is the biggest value? (a) -28 (b) -94 (c) 4 c What is the third smallest value in -8/61, -4, -3/5, 4/3, 6, 0.3? -8/61 What is the sixth biggest value in 1/2, 4, 2/7, -1, -170, 23? -170 Which is the fourth smallest value? (a) -1.5 (b) -0.15 (c) 0.3 (d) 4 d Which is the third biggest value? (a) -1/10 (b) -948 (c) 1/3 b Which is the biggest value? (a) 5 (b) 0.5 (c) -0.2 (d) 0.7 (e) 134/7 e Which is the biggest value? (a) -0.06 (b) 26/17 (c) -4 (d) 4 (e) 3/17 d Which is the fourth smallest value? (a) 0 (b) -2/3 (c) 12 (d) -6 (e) 0.04 e Which is the biggest value? (a) -30 (b) 20 (c) 2 (d) -7 (e) 5 (f) -3 b Which is the second smallest value? (a) -0.4 (b) 0.4 (c) -0.17 (d) -112 a What is the fifth smallest value in -1, 2/7, -25.4, -4, 2.3, 0.2? 2/7 What is the third smallest value in -17.7, -2, 1/243? 1/243 What is the fifth biggest value in -9, -2, 0.4, 0.2, 1/11? -9 Which is the third biggest value? (a) 0.1194 (b) -0.2 (c) 1/7 (d) 1/2 a What is the third smallest value in -2/5, -4, 0.4, 6, -2/17? -2/17 What is the second biggest value in 1, -0.4, -927, -2, 0.07? 0.07 What is the fourth smallest value in -3, 19425, 0.2, 1, 5? 5 What is the second biggest value in -5, 3, 68686, 0.5? 3 What is the fourth smallest value in 0.3, -0.47, -25.2, -0.3? 0.3 What is the second smallest value in -5, -4, 2.57, 17? -4 What is the fourth biggest value in 66, 2/11, 2/3, 15, 0? 2/11 Which is the sixth smallest value? (a) 3 (b) -3 (c) 9/2 (d) -121 (e) 4/7 (f) -10 c Which is the smallest value? (a) -1/196 (b) -3 (c) -1 (d) 0.12 (e) -1/6 b What is the biggest value in -1/9, 0.04, -10, -0.3? 0.04 Which is the fourth smallest value? (a) 10/11 (b) -5 (c) -32 (d) -3/23 (e) -0.5 d Which is the third biggest value? (a) -5 (b) -0.3 (c) -152.15 (d) 0.8 a Which is the fourth biggest value? (a) 1 (b) -32 (c) 45 (d) -7.6 b What is the fourth biggest value in 1, 0, -0.034, 9, -0.1? -0.034 Which is the fourth smallest value? (a) 7949 (b) 4 (c) 0 (d) 6.7 a What is the second biggest value in 14764, 1/2, -1, 0.9? 0.9 Which is the second smallest value? (a) -0.1 (b) -104649 (c) -21 c What is the fourth smallest value in -16, -10, 4, 2, -0.3, -25? -0.3 Which is the smallest value? (a) -0.05 (b) -190.5 (c) -4 (d) 4/7 b What is the second smallest value in 5, -0.3, -0.04, 4969? -0.04 What is the second smallest value in -53, 0.4, 1/39, 4/7, -5? -5 Which is the second biggest value? (a) -0.04 (b) -2/7 (c) 0.3 (d) 1139 c Which is the second biggest value? (a) 5 (b) -68/7 (c) -1 (d) 0.2 (e) 7 (f) 1.2 a Which is the second biggest value? (a) 7 (b) -4 (c) 9736 (d) -0.1 (e) -5 a Which is the biggest value? (a) -3/437 (b) 2 (c) 0.64 b Which is the smallest value? (a) 76 (b) 0.3 (c) 11.14 b What is the second smallest value in -0.8, -5/2, 0.1, -2, 1/5, -4? -5/2 What is the third smallest value in -5, 1/3, -12, 0.92, 2/7? 2/7 Which is the second biggest value? (a) 3/2 (b) -175 (c) 2 (d) -0.7 a What is the biggest value in 4/5, 31, -2/15909? 31 What is the second smallest value in 0.5, 6/31, -8? 6/31 What is the fifth smallest value in 29, 0.5, 0, -2/15, -2/13, 9/2? 9/2 Which is the second smallest value? (a) -29 (b) -1 (c) -1/4 (d) -2 (e) 31 (f) -4 f Which is the fourth smallest value? (a) -17 (b) 1/13 (c) -10 (d) 1/2 d What is the fourth smallest value in 2/21, 5, 0.4, 3, -71? 3 Which is the smallest value? (a) -0.4 (b) 0.048 (c) 43/3 (d) -2/7 (e) 0.5 a What is the fourth biggest value in 0, 3, -691, -1? -691 What is the biggest value in -0.06, 158, -1? 158 What is the fourth biggest value in -9, -1959, -1, -1/4? -1959 What is the third biggest value in -2/15, -0.2, -3, 7/443? -0.2 Which is the second biggest value? (a) 23/12 (b) 3 (c) -2/67 (d) -4 a Which is the biggest value? (a) 4 (b) 0.1 (c) 0 (d) -0.4 (e) 1071/16 e Which is the third smallest value? (a) 2.34 (b) 5 (c) 76 c Which is the smallest value? (a) 1.35 (b) -1/2 (c) -0.1 (d) 0.735 b Which is the smallest value? (a) 0.75 (b) 250.5 (c) 2/5 c What is the third biggest value in -8, 1, 0.5, 189/8, -0.18, -2/5? 0.5 Which is the second smallest value? (a) -3 (b) 4/21 (c) 0.3 (d) -0.2 (e) 33 d What is the second smallest value in -1005, 0.1, -0.08, -1, -9, -2? -9 What is the fourth biggest value in 6, 0, -0.5, -7/69? -0.5 What is the fifth biggest value in 5, 4, -4, -123, -0.3? -123 Which is the third smallest value? (a) -0.35 (b) 6/11 (c) -326 b Which is the fourth smallest value? (a) -42 (b) -5/6 (c) 3 (d) 1/3 c What is the fifth smallest value in -0.3, 0.4, -1/4, -4, -1971? 0.4 Which is the fifth smallest value? (a) -1684 (b) 0.2 (c) 5 (d) -5 (e) -1 c Which is the third biggest value? (a) 50930 (b) -1 (c) -0.3 b Which is the smallest value? (a) 220 (b) 0.4 (c) 0.2 (d) -4 d What is the biggest value in -1/8, -1.55, 0.2, 0.5? 0.5 Which is the fourth smallest value? (a) -85 (b) -2/3 (c) -3 (d) 0.037 (e) 2 (f) 3/4 d What is the second biggest value in 22/9, 1/5, 359? 22/9 What is the smallest value in 141, -24/7, -4? -4 What is the third biggest value in 4, -8, -1, -17.294? -8 What is the smallest value in -2, -5/6, 2/13, 3/4, -2/35461? -2 Which is the smallest value? (a) 5 (b) -0.4 (c) -2 (d) -0.06 (e) 2 c What is the fourth biggest value in 3, -0.09, -2, 2.4, -3/49? -0.09 Which is the biggest value? (a) 326 (b) 1/2 (c) -5 (d) 2 (e) -1/5 a What is the third biggest value in 2, -4, -5.176, 2/5? -4 Which is the third smallest value? (a) -15 (b) 22 (c) 0.3 (d) 5 d What is the biggest value in 14812, 4, 0.3? 14812 Which is the second biggest value? (a) 4/9 (b) 2 (c) -350442 a Which is the third smallest value? (a) -5.6 (b) 310 (c) 1 b What is the smallest value in -0.076, 7.8, -4, -2? -4 What is the third biggest value in 0.1, -0.5, 2, 0.5, 8/7? 0.5 Which is the second biggest value? (a) 2/3 (b) -5 (c) -3 (d) 0.4 (e) 66 a What is the second biggest value in -2/11, -2/13, 2/5, -46, 122, -3? 2/5 What is the third biggest value in -345, 0.08, 4, 5? 0.08 Which is the second smallest value? (a) 5/4 (b) 78.56 (c) -0.02 a What is the fourth smallest value in -7/16, -0.1, -1/13, -73? -1/13 What is the sixth biggest value in -1/605, -4, 2, -0.39, -0.2, 1/3? -4 What is the biggest value in 262, 0.1176, 0.4? 262 Which is the second biggest value? (a) 4 (b) -2/9 (c) -156 (d) -0.6 b Which is the smallest value? (a) 0 (b) -129 (c) -1/6 (d) -2/5 (e) 7 b What is the smallest value in -244, 102.1, 0? -244 Which is the third smallest value? (a) -48/931 (b) 2 (c) 4/3 b Which is the third smallest value? (a) -0.05 (b) 0.722 (c) 8 c Which is the biggest value? (a) 2/1229 (b) -2/9 (c) 26 c What is the fifth smallest value in -1, -15/2, 2/13, -2/5, -0.3, -0.5? -0.3 Which is the fourth smallest value? (a) 1/5 (b) 2 (c) -3 (d) 23 (e) -4 (f) -38/7 a Which is the fourth biggest value? (a) -3/7 (b) 14.4 (c) 2/7 (d) 2 (e) 14 c What is the smallest value in 9, 4, -0.5, 0, -0.06? -0.5 Which is the biggest value? (a) 56 (b) -2/11 (c) -11 (d) 2 (e) -2 a Which is the biggest value? (a) -0.3 (b) 49.5 (c) -4 (d) 6 b What is the second smallest value in 3/4, 3/2, 595.07, 0.5? 3/4 What is the third biggest value in 487/7, 19, 4, -8? 4 Which is the biggest value? (a) 262 (b) 3 (c) -1 a What is the fifth smallest value in 0.3, -0.31, -0.3, 3, -0.1, 1? 1 Which is the sixth biggest value? (a) 2/203 (b) 1	{ "pile_set_name": "DM Mathematics" }
-222258.7. -222260.7 Sum -42935 and 0.4. -42934.6 What is -1011.21 less than -34? 977.21 Work out -7 - 0.0464. -7.0464 What is -5381709 minus 0.4? -5381709.4 What is -0.04 + 74389? 74388.96 -27 - -770 743 Add 0.4 and -359.419. -359.019 Calculate -1.05 + 671. 669.95 What is the difference between 0.08 and -995.78? 995.86 Add -1242 and 0.5. -1241.5 Work out 0.1 - -0.0106. 0.1106 Put together -0.14 and -312.65. -312.79 Calculate -1772 + -2326. -4098 What is -9505 take away 7? -9512 0.067844+2.5 2.567844 Sum 61 and 53. 114 Add together -0.4 and 57121. 57120.6 What is the distance between 0.07 and -382? 382.07 What is -19865 take away -0.02? -19864.98 Total of 60578 and 5. 60583 -0.31681 - 0.4 -0.71681 -460928 - 0.2 -460928.2 -277.636 - 7 -284.636 Calculate 1482.127 - -0.3. 1482.427 Put together 1 and 118203. 118204 What is -0.5 less than -0.08555? 0.41445 Calculate 0.06 + -28543. -28542.94 Calculate 3506 + 108. 3614 0.3 + -266 -265.7 What is the distance between -0.046 and -0.05? 0.004 Add together 2181 and -0.2. 2180.8 Calculate 2 - 3.52. -1.52 Work out -204919 + 0. -204919 Sum 4 and 4756. 4760 What is 7 take away -0.976? 7.976 Subtract 212 from -25. -237 Calculate 534.8 + -2.7. 532.1 Work out 43 - -15.46. 58.46 What is -851 less than 11.08? 862.08 -0.601 - 0.5 -1.101 What is 4 less than -9122? -9126 Subtract -4 from 5800654. 5800658 Add 3 and -1.23018. 1.76982 Calculate 0.4 - -5858. 5858.4 What is 0.02248894 + -0.2? -0.17751106 Subtract 4460 from 0.3. -4459.7 What is -0.053 - 0.0125? -0.0655 What is the difference between -75.73 and 0.3? 76.03 -14.3 - -9.4286 -4.8714 What is the distance between 0.635 and -0.05? 0.685 Add together 0.1 and 1.0934. 1.1934 Work out -83 - 44. -127 What is -63.7 plus 0? -63.7 What is the difference between -4.7 and 0.1109? 4.8109 Subtract 12940 from -0.02. -12940.02 What is the distance between 4.00164 and 0? 4.00164 Total of -1182 and 0.92. -1181.08 What is 0.0122 + 76? 76.0122 What is -0.5 take away 17.441? -17.941 Work out 0.049 - 1534. -1533.951 Calculate -117 + -29.704. -146.704 What is 2.281 plus 0.2? 2.481 Subtract -42.067 from 2. 44.067 Work out 9 + -0.04657. 8.95343 What is 71.8 minus -2.78? 74.58 Calculate -2595 + -0.09. -2595.09 What is -44 minus -34254? 34210 Put together -0.5 and 11338. 11337.5 Total of 1 and 402.43. 403.43 What is the distance between -51 and -0.38? 50.62 18.2+-13 5.2 Work out -0.01 + 0.723. 0.713 -158.624 - -0.5 -158.124 Sum -1.04 and -0.11. -1.15 67269+3 67272 -0.3 - -4600 4599.7 What is the distance between 0.108 and 107054? 107053.892 What is 0 plus -737? -737 Work out 1.62 - 1.35. 0.27 What is the difference between 19.77 and -5? 24.77 -1+-0.050136 -1.050136 Subtract -0.5 from -79.14. -78.64 What is -1.548 less than -0.484? 1.064 Work out 132 - 6564. -6432 -12 - 14975 -14987 Work out -1 - 4.833. -5.833 Add together -11.666 and 51. 39.334 Add together 1266 and -4.22. 1261.78 Add -320 and 120. -200 What is 4 less than 0.214? -3.786 Add together -5 and 32384. 32379 What is -65 plus 3? -62 -5 - 0.1648 -5.1648 -0.2312+0.046 -0.1852 Put together 2.622259 and 0.1. 2.722259 What is -1.324 - 0.6? -1.924 What is 1 - 0.04888? 0.95112 Put together -8.55 and -11. -19.55 1668+-0.074 1667.926 What is the difference between 0.2 and 46035? 46034.8 0.108+-5496 -5495.892 29 - -4.3718 33.3718 Sum 2 and 2020.48. 2022.48 What is the difference between -23899 and 0.03? 23899.03 2.51 + 0.8 3.31 What is -569.5 - -1.4? -568.1 Work out -61 - -9. -52 What is 0.1787 minus -3698? 3698.1787 What is -714.13 take away 0.1? -714.23 Work out -0.0386 - 0.05254. -0.09114 -0.5+-0.0427 -0.5427 Sum 9 and 1.479. 10.479 0 + -0.43 -0.43 Sum 0.0656182 and 0.3. 0.3656182 What is -3 take away -4338.2? 4335.2 Add 19592 and -2. 19590 Total of -0.5 and -0.02. -0.52 Sum 325036 and 0.01. 325036.01 Sum 0.014 and -5.46. -5.446 Work out 25 - -0.046504. 25.046504 What is the difference between -0.1 and 11.63? 11.73 What is -29 take away -276.8? 247.8 Work out -9.2 - -1.11. -8.09 2251 + -0.092 2250.908 What is -322 take away 5302? -5624 Subtract 1.91 from -25. -26.91 Put together -148 and 0.5. -147.5 What is 223 - -0.05? 223.05 Add together -361548 and -10. -361558 What is the difference between 11700 and 481? 11219 What is 2769131 plus -3? 2769128 Work out 25 - 1487. -1462 Total of 0.068 and -75725. -75724.932 Calculate 100273 - -0.5. 100273.5 What is -19.973 minus -299? 279.027 What is -0.5 less than -1.594? -1.094 -5 - -0.0479 -4.9521 Add together 0.1 and 2413. 2413.1 Calculate 0.3 - 4765. -4764.7 Calculate -6.98472 - -0.4. -6.58472 5 + 0.642482 5.642482 1.24928 + 20 21.24928 Subtract 1239 from 5. -1234 Sum -0.3 and -18.80771. -19.10771 What is 0.01 minus -39.42? 39.43 What is -76.687 - -8.5? -68.187 Work out 1 + 0.24. 1.24 What is -3.17533 plus -3? -6.17533 Subtract -0.1 from 952. 952.1 -0.416 - -0.15 -0.266 What is the distance between -20 and 3.412? 23.412 Calculate 8 + -2016.94. -2008.94 What is 2.1 minus 3.1? -1 Sum -4 and -35.9. -39.9 What is -23 minus -0.1101? -22.8899 Work out -46 - -6118. 6072 What is -5.451 less than -44.5? -39.049 What is the distance between -244283 and 0? 244283 Total of -8426 and 38. -8388 Work out 5 + -11.0881. -6.0881 -29+13 -16 Put together 0.0977932 and -15. -14.9022068 What is 20 plus -123? -103 What is -2149 take away -0.04? -2148.96 What is 3833.1 plus -0.4? 3832.7 Subtract 0.07 from 11272. 11271.93 What is 1 take away -3273096? 3273097 Add -0.01 and -1782. -1782.01 What is 45 take away 54.091? -9.091 What is the difference between -30 and 64.69? 94.69 What is the difference between 2 and 87865? 87863 Subtract 0.0479 from 106.4. 106.3521 Work out 997 + -2. 995 Work out -0.07 - 893. -893.07 -0.825 - 0.1 -0.925 What is -7.4 + 30? 22.6 What is 8.0894 less than -0.3? -8.3894 0.329+47 47.329 Work out -4 + 429. 425 What is the difference between 0 and 2694? 2694 What is 8071 less than -142? -8213 1+-0.106 0.894 Add -4 and -4.009. -8.009 Sum -0.05 and -9422. -9422.05 43 + -56 -13 Work out -1277 - 0.03. -1277.03 Add -67.7 and 195. 127.3 Calculate -0.03 - -0.3. 0.27 -0.2692 + -3258 -3258.2692 -0.4 + -0.12737 -0.52737 Sum 1 and 20.6. 21.6 What is -0.5 - -42.24? 41.74 Sum 2.56 and 223. 225.56 What is 2696 - -3.01? 2699.01 Subtract 492 from -2. -494 Sum -43 and 20455. 20412 -0.2+-1661480 -1661480.2 Subtract 0.555 from 0.0605. -0.4945 What is 10.6 less than 0.08? -10.52 Calculate -0.5 - 0.92536. -1.42536 Work out 0.0213 + -0.375. -0.3537 What is -6659 - -0.18? -6658.82 Work out 400 - -209. 609 Calculate -25 + -1.7. -26.7 Add -29 and -0.022. -29.022 -15.7+-0.661 -16.361 What is -0.103165 minus 0.5? -0.603165 What is the difference between 0.868 and -3? 3.868 What is 5.4 plus 0.231? 5.631 What is -0.6 less than -189.2? -188.6 What is 1726.2 minus -0.12? 1726.32 Add -0.18 and 973. 972.82 Subtract 10298 from 0.2. -10297.8 Work out 0.3842 - 0.1. 0.2842 Work out -21 + 40. 19 0.053 - 2.1 -2.047 Calculate 119 + -2.5. 116.5 Total of -337 and -19.99. -356.99 What is 0.3 - -55941? 55941.3 What is -575 plus 2.8? -572.2 Work out -0.298 - 19. -19.298 What is 0.079 - 97191? -97190.921 Add -2.3 and -564. -566.3 Sum -354 and 1. -353 What is -0.4 + -0.03912? -0.43912 Sum -154 and 0.04. -153.96 Add together -0.3 and 0.4925. 0.1925 Subtract -0.1 from 1610. 1610.1 What is 0.127 minus -123? 123.127 Calculate 14.785 - 5.2. 9.585 Add together -14 and 25.4872. 11.4872 1384.9 + 3.4 1388.3 Subtract 1.3 from -85. -86.3 What is -0.0062 + -0.4? -0.4062 What is 2 take away -919? 921 Total of 0.2 and 0.316. 0.516 What is 16 + 29970? 29986 Add together 0.063773 and 0.1. 0.163773 Sum -22186 and -0.26. -22186.26 21363+0 21363 What is the distance between -67 and -0.035? 66.965 Put together 0.008 and 0.0405. 0.0485 What is the distance between -997015 and 0.5? 997015.5 Work out 3.17 - 93. -89.83 Subtract 564 from 0.4. -563.6 Add together 10911 and 1.02. 10912.02 What is -22 - 326.9? -348.9 Subtract -15637 from 18.6. 15655.6 Total of -0.4 and 122900. 122899.6 Subtract 895.9 from -9. -904.9 What is -0.16816 + 25.5? 25.33184 What is -20 - -0.117? -19.883 What is the distance between -0.4 and -17246.95? 17246.55 What is -0.32 + 30.3? 29.98 Calculate -1.483 + -809. -810.483 Work out -74.903 + 46. -28.903 What is 0.00306925 minus 0? 0.00306925 S	{ "pile_set_name": "DM Mathematics" }
205 + -205. Solve t = 3d + 8 - 17 for d. 3 Let a be 12(-3 - 30/(-12)). Let h be -4 - (a - -1) - 0. Solve -h = v + 4 for v. -5 Let q(t) = 12t2 + 8t - 8. Let r be q(1). Solve -4i - r = -0i for i. -3 Let m(w) = w*2 - 7w - 8. Let d be m(8). Let k(o) = -2o - 18. Let p(j) = -j2 + 5j + 3. Let z be p(7). Let r be k(z). Solve d = f - rf for f. 0 Suppose -47 + 3 = 4a. Let s = 14 + a. Solve sp = 2p + 5 for p. 5 Let i(x) = -x*3 + 19x*2 - 23x + 90. Let v be i(18). Solve o - 5 = -vo for o. 5 Suppose 114 - 38 = 4h. Let g = h - 4. Solve -n - g = 2n for n. -5 Suppose 12 = -2d - 0d. Let q = d - -12. Let c(a) = a - 4. Let t be c(q). Solve 0 = -0f - tf for f. 0 Suppose 0 = -v + 15 - 13. Suppose -f - vj + 11 = -9, j = 4f - 35. Solve 0 = -3d - 2d - f for d. -2 Let k be 3 + -1 - (-3 - -5). Suppose -3f - 2f = k. Suppose 5 = 87a - 82a. Solve -n - a + 0 = f for n. -1 Let v = 482 + -480. Solve 0 = 6y - 8 + v for y. 1 Let m = -66 + -14. Let v = m + 85. Solve -va - 8 = 2 for a. -2 Suppose -z + 19j = 18j - 12, 4 = -z - 3j. Solve -za + 2a - 6 = 0 for a. -1 Let k be (-3 - -2)/((6 + 2)/(-56)). Solve kb + 30 = -5 for b. -5 Suppose 0 + 4 = 2w. Suppose -6j + 140 = 92. Solve -2r - wr = -j for r. 2 Suppose -4l + 2a + 2a - 4 = 0, 2l - 4a = -8. Solve 0o - lo = -8o for o. 0 Suppose 0 = -5z + 3 + 12. Let m = z + -1. Suppose m = o - 1. Solve 0 = -0u - ou - 6 for u. -2 Let w(c) = c*2 - 4. Suppose 0v + 3x = -2v - 6, 2v - 3x = -6. Let y be w(v). Let s(k) = -k*2 - 13k - 12. Let t be s(-11). Solve t = yb + 30 for b. -4 Suppose f = -b - 81, 3f - 25 = b + 56. Let s = b + 81. Solve -3k + 9 + 6 = s for k. 5 Let d = -1661 + 1692. Solve -d = 3k - 19 for k. -4 Let x(c) = 4c - 5. Let u be x(5). Suppose 0 = l + k + 3, -k = -4l - 2 + 15. Solve 0 = li + i - u for i. 5 Let t(l) = 144l - 109. Let q be t(1). Solve -24z + q = -17z for z. 5 Suppose -66t - 131 = -659. Solve -tf - 10 = -3f for f. -2 Suppose 3f - r - 1 = 0, 4r + 3 = -2f + r. Let n = 42 - 38. Solve v + f = n for v. 4 Suppose -2l + 0l + 3u + 6 = 0, 2u = -5l - 4. Solve -3r - 3 = -lr for r. -1 Let k = 81 + -78. Solve 18 = -kv + 6 for v. -4 Suppose -5c + 2 + 6 = -n, 2n - 10 = -3c. Let v = c + -10. Let w be (-7)/(-2) + (-12)/v. Solve -wd = 2 - 17 for d. 3 Let r(y) = -y*2 + 15y + 54. Let k be r(18). Suppose -4a - 27 = -4i + 1, k = -3a + 6. Solve 4s - 15 = is for s. -3 Let b = 77 + -133. Let w = b + 61. Solve 0z = -5z - w for z. -1 Let b be -2 - -23 - (-2)/((-12)/(-18)). Solve 4w - b = -32 for w. -2 Suppose 3r - 2 = -2f, -r + 32 = 4f - 2r. Solve 0 = -fp + 11p + 4 for p. -1 Let x(n) = -n*3 - 6n*2 + 73n + 460. Let b be x(-6). Solve -10 - b = 8s for s. -4 Let k be (-1 + 3)/(4 - 2). Let n = 4 - k. Let g(c) = -c + 35. Let b be g(15). Solve 0 = no - 8o - b for o. -4 Let w be (-132)/(-16)-6-2. Let g be (-16)/(-9) + 22/w. Solve 2q = -gq - 20 for q. -5 Suppose 3i + 4n - 19 = 0, -2n = -4n + 2. Solve i = -4s - 15 for s. -5 Let t be 14/4 - (-1)/(-2). Let s be ((-3)/4)/(21/(-56)). Let q be 1(7 + 3 - s). Solve -tm + 5m = -q for m. -4 Let p = 127 - 122. Solve -pn = -8n - 9 for n. -3 Let o(l) = -229l + 942. Let u be o(4). Solve 13a - u = 26 for a. 4 Suppose -4m + 4o = -16, -12 = -6m + 2m + 2o. Let d be (-2 + 1)(-4)/m. Suppose -3u - 3 = -3p, -84u - 18 = -3p - 86u. Solve -2x = dx - p for x. 1 Let y = -27 - -52. Let t be ((-18)/(-3) + -8)5/(-2). Solve -tp - y = -0p for p. -5 Let r be (-2)/2 + (15 - 2). Let m(g) = g2 + 43g + 193. Let u be m(-38). Solve 3y + u = -r for y. -5 Suppose -4o + 28 = -2o. Solve -17v = -ov + 9 for v. -3 Let i(h) = -h2 - 6h - 4. Let a be i(-2). Let p be (-12)/(-20) - (-427)/5. Suppose -6w = -a - p. Solve -w = -3b - 0b for b. 5 Let g(f) = f2 - 3f + 2. Let z be g(5). Solve 4r + z + 8 = 0 for r. -5 Suppose 4j - 3l = 32, 2j - 3l - 2 = 8. Suppose p - 14 + j = 0. Solve -v - 16 = pv for v. -4 Let q be (-1)/3-1114. Solve 0 = 3s - q + 35 for s. 1 Suppose 109y - 380 = 114y. Let q = -67 - y. Solve -qw = -5w - 8 for w. 2 Let d(o) = -o3 - 18o*2 - 49o - 45. Let r be d(-16). Solve 233p - 24 = rp for p. 4 Suppose 7h - 8h + 2 = 0. Let r(s) = -2s - 40. Let i be r(-20). Suppose -hl - 4 = -3b + 2, i = -2b - 2l - 6. Solve b = -2u - u - 6 for u. -2 Let h be ((-2)/(-3))/(4/42). Suppose -hc + 3c + 8 = -2j, -j = -c. Let u = 1 + -1. Solve ux - 20 = -cx for x. 5 Let w(l) = l2 + 6l + 7. Let b be w(-6). Let k = -7 + b. Suppose k = 31u - 29u - 4. Solve 0c - c - u = 0 for c. -2 Let g = 2 + 3. Let f = g + -1. Suppose 3 - 9 = -3l. Solve -c = -lc + f for c. 4 Suppose 127m - 136 = 123m. Solve -ms + 35s = -3 for s. -3 Let b = 277 + -273. Solve 0g - b = 2g for g. -2 Suppose 2j = -5u + 210, -32u + 30u - 4 = 0. Solve 0 = -16m + j - 30 for m. 5 Suppose 0 = -3y + 5l - 0 + 10, y + 5l = -10. Suppose 0 = 4i - 2i + 26. Let w = -9 - i. Solve -w = -yo + 2o for o. -2 Let w(m) = 3m + m*2 + m + 0 - 2. Let b be w(-6). Suppose 0 = 26x - 350 + 90. Solve -5n = -x - b for n. 4 Let p be (-4)/(-2) + 14 - (0 + -4). Suppose r = 5q - p, 2r + 4q - 40 = -2r. Solve 8a = 3a - r for a. -1 Suppose -2u + u - 4i + 2 = 0, -4u - 4i - 4 = 0. Let n be (14/(-28))/(u/(-32)-2). Solve -10 = nx + 6 for x. -4 Let n be -4 - (-9)/648/18. Solve -2o = -no for o. 0 Suppose -4q + 4o = -20, 4q + o - 16 = 3o. Let z = 60 - 10. Suppose -3i + z = 2i. Solve -qu - i = -u for u. -5 Let n(l) = 34l + 47. Let s be n(-1). Solve 0 = sf - 16f + 6 for f. 2 Suppose 2i + 6 = 2r, -184r = -179r - 4i - 12. Solve r = 5l - 4 - 11 for l. 3 Let z be 2/(5/((-220)/(-8))). Suppose z = 3o - 16. Suppose 0 = -2a - k + o, 4a + k = -0 + 15. Solve 0 = -as + 3 - 9 for s. -2 Let g be 44/(-6)(-15)/10. Let h be -84-52/(-60)-4. Let x = h - 47. Solve x = -4n - g for n. -5 Suppose -93t - 45 = -98t. Solve 6r = 27 - t for r. 3 Let b be -19(-1120)/315. Solve -20f = -12f + b for f. -4 Let v = -106 - -130. Solve 21s = vs + 12 for s. -4 Suppose k - 2 = 3p, 28k - 26k - 7 = 3p. Let o(n) = -n*3 + 6n*2 - 6n. Let u be o(5). Let x = 8 + u. Solve -w - k = -x for w. -2 Suppose -4 = 2j, 3q + 0q + 8 = -4j. Let h(d) = -3d + 6. Let r be h(5). Let x = q - r. Solve 1 = -4v + x for v. 2 Let h(l) be the third derivative of l*4/24 + 3l*3/2 + 9l*2. Let g be h(-8). Suppose 5i = 4i + g. Solve 4k - i = 3 for k. 1 Let j(m) = -6m - 74. Let n be j(-13). Solve nl = -6l + 20 for l. 2 Let u = 775 - 769. Solve -1 = 5l - u for l. 1 Let i be (-6 - -2) + 68/17. Solve i = -3b - 3b + 24 for b. 4 Suppose -5h + 0h = 0. Suppose h = -3v + 5v + 8. Let l be v/(-6) - 320/(-24). Solve -l + 39 = -5p for p. -5 Suppose -5b - 15 = -2y, 4y = -b - 0 - 3. Let i be (-42)/126 + (-39)/(-9). Solve -iv = -yv - 20 for v. 5 Let z = 1204 - 1198. Solve zm - 39 = -9 for m. 5 Let w(n) = n2 + n - 18. Let t be w(4). Solve ta = -3a + 15 for a. 3 Let a be (-776)/26 - (-6)/(-39). Let f = a - -32. Solve -fc - 3c - 20 = 0 for c. -4 Suppose 0 = t - 1, p + t = 2p. Let r(k) = k*2 - k - 54. Let l be r(-7). Solve -p = -d + l for d. 3 Let q be (-3)/(-9)(-6)/1. Let w be 240/10 + q + 3. Solve -4v - v = -w for v. 5 Suppose -2w - w = 0. Let q be (-3 + 2)(-3 - w). Suppose 5b = -x - 10, -4x = 5b - q - 2. Solve xy = 4y + 2 for y. 2 Let r(d) be the first derivative of d*2/2 + 9d - 1. Let b = -64 - -59. Let a be r(b). Solve at - 11 = 1 for t. 3 Let x(y) = y3 - 8y*2 + 2y - 11. Let n be x(8). Suppose -nb = -5 - 20. Suppose -32 = -bk - 12. Solve kj + 19 - 3 = 0 for j. -4 Suppose 42 + 30 = 5p - w, -w - 30 = -2p. Suppose -4r + 11r - 35 = 0. Solve -rd - 6 = p for d. -4 Let c = 18 - 92. Let n = -71 - c. Solve 0 = 5z - nz for z. 0 Let u(i) = i*3 - 6i*2 + 2i - 9. Suppose 0 = 2b + 3b - 30. Let c be u(b). Let g be (c - 0) + 24/2. Solve l - g = 6l for l. -3 Let t be 2/5 - 169/(-65). Let o = 21 + -18. Solve 0 = -4j + oj - t for j. -3 Let r be (-140)/(-18) - (0 - (-2)/(-9)). Suppose -2w = f - 21 + r, 5w + 2f = 31. Solve 1 = -2t + w for t. 2 Let y be (14/3)/(2/9). Suppose 0 = -0a - 7a + y. Solve -5 = -at - 11 for t. -2 Suppose -5u + 0j = j - 15, 29 = 2u + 5j. Suppose 0 = n + 5m + 6, 5n - 4 = u*	{ "pile_set_name": "DM Mathematics" }
= 0 for r. -2 Suppose 10v - 15v + 15 = 0. Solve 17 = -vg + 23 for g. 2 Let k(f) = -f3 - 7f*2 + f + 9. Suppose -2p + 21 = -3t, -t = -0p + 5p + 7. Let c be k(t). Solve cz + 1 = 7 for z. 3 Suppose 0 = -2d - 4, 26d = -2k + 22d - 6. Let n = 21 - 12. Solve n + k = -2u for u. -5 Let i = -981 - -981. Solve 2u + 6u = i for u. 0 Suppose 0 = -3l + h + 39, -h - 145 = -5l - 80. Solve 7z = lz - 24 for z. 4 Suppose j + 3c + 21 = 0, 4j + 78 = -c - 61. Let h = j - -50. Let d = h + -12. Solve -4p + d = -2p for p. 1 Let r be 6 + (1 - -1) + -2. Suppose 0 = -2j + 608a - 611a + 61, -j - 3a + 41 = 0. Solve j = t - rt for t. -4 Suppose -81c - 36 = -84c. Solve 7a - c = 23 for a. 5 Let r be 2 + 2/44. Let w be 7(1 - (-12)/(-28)). Suppose wu - 30 = -6u. Solve ua - r = 5a for a. -2 Let g(v) be the second derivative of -v3/6 - 6v*2 + 5v. Let b be g(-14). Suppose 10 = bd + 2w, 2 + 3 = -d + 4w. Solve -1 = -dn + 8 for n. 3 Let a(l) = l*2 + 4l - 4. Let w be a(2). Suppose -8 + w = 3n. Solve f + 0f = n for f. 0 Let w(i) = i3 + i2 - i + 4. Let s be w(0). Suppose x - 11 = -4b, -3b = -sx - 3 + 9. Solve -5r = -br - 12 for r. 4 Let q(j) = -2j*3 - 13j*2 + 5j - 12. Let d be q(-7). Solve 3b + d = 2b for b. -2 Let c = -31 + 33. Suppose q = 0, -5o + 45 + 30 = cq. Solve 2k + o = -k for k. -5 Let v be 9 - 14 - ((-3 - 0) + -2). Solve v = -7w + 2w + 20 for w. 4 Let f = 3 - 0. Suppose 0 = -3x + o + 13, 4o = -x + o - 9. Suppose -3c - 11 + 5 = -3z, 8 = 5z - xc. Solve 0 = -w - z + f for w. 2 Let z(o) = -o3 + 6o*2 + 9o + 10. Let l be z(7). Let g = 27 - l. Suppose -2 = 2q - gq. Solve -qw = -5w for w. 0 Let y(j) = -j*2 + 19j + 3. Let b(d) = d*2 + 8d - 14. Let l be b(-11). Let z be y(l). Solve 0 = -zh + 4h - 1 for h. 1 Suppose -96 = -5n + t, -n - 3t + 21 = 5. Solve 0 = 23c - n - 4 for c. 1 Let x be (-20)/(-5)-1 + -17. Let a = 26 + x. Solve 3n - 8n = -a for n. 1 Let r be 3 - -2 - 112/(-28). Solve -rc = -7c + 8 for c. -4 Suppose -3o = -3, -4z + 4o = -2z - 6. Suppose 3j + zq = 2q + 12, 8 = 2j + 5q. Solve -4d + j = -5d for d. -4 Suppose 5o - 33 = 2a - 8, 0 = -4a. Solve -o = 2g - 3g for g. 5 Suppose 0 = k + 5d - 27, -3d = 2k - k - 17. Suppose 2w - 6 = -0w. Suppose 0h + 12 = 4c - h, 0 = -c - 5h + w. Solve -g - kg + c = 0 for g. 1 Let o(k) = k3 + 17k*2 - 6k - 98. Let n be o(-17). Solve nj - 7j = 6 for j. -2 Let g(h) = h*3 - 3h*2 + 7h - 72. Let x be g(5). Solve -3d = -1 + x for d. -4 Suppose -6n + 10n = 0. Suppose 6 = -nh + 3h. Suppose -4b - 2d + 1 = -15, b - d + h = 0. Solve b = 4o - 10 for o. 3 Let m be (-6)/(-8) - 2/(-8). Suppose 5z + 4 = 5a - m, 20 = 4a. Solve 0 = 3q - zq + 2 for q. 2 Let g = 7 - 7. Let p(q) = -q2 + 27q + 468. Let j be p(39). Solve jz - 4z + 16 = g for z. 4 Let g = 15 + -9. Let p = 140 - 8. Let h = p - 132. Solve -2r + h = g for r. -3 Suppose 3z = -0z + 39. Suppose 3h - 32 = 5o, 22o = -4h + 21o + 12. Solve 0 = ht + z + 7 for t. -5 Let l = 362 - 342. Solve -lx = -19x - 1 for x. 1 Let j(r) = -r2 + 6r + 7. Let q be j(5). Suppose qu - 24 = 9u. Solve -p - u = 3p for p. -2 Suppose -4q = 10q - 490. Solve 28 = 28j - qj for j. -4 Let d(f) = f2 - 6f - 7. Let t be (1/(-2))/((-9)/108). Let l be d(t). Let j = 11 + l. Solve 2m = m + j for m. 4 Let h(c) = c2 - 3c - 2. Let q be h(5). Suppose 3y + 20 + q = 4m, 2m + 2y = 0. Suppose -mt - 3n + 5 = 0, 5n = -3t - 4 + 5. Solve -a + t = -0 for a. 2 Suppose 109 = l + 5. Let w = 106 - l. Solve j + w = 1 for j. -1 Let c(h) = h*3 - 7h*2 + 9h - 12. Let f be c(6). Let a(b) = -b + 9. Let x be a(f). Solve -xd + 0d + 6 = 0 for d. 2 Let h be (-4 + -3)(-24)/14. Suppose 4l + 99 = i, 4l = 3l - 4i - 29. Let s = 27 + l. Solve -sv = v + h for v. -4 Let g(l) = 0 + 1 - 9 + l. Let h be g(8). Suppose 3 = -m - hm, 2v - 34 = -2m. Solve -p - v = 4p for p. -4 Let s(x) = -6x + 136. Let c be s(22). Solve 0h = -2h - c for h. -2 Let x be -2 + (-1)/(5/(-30)). Suppose 0 = 6f - x - 14. Solve 0 = -u - f for u. -3 Let k be (-9)/(0 + (-3)/6). Solve 4 = ks - 19s for s. -4 Let d be (-7)/(-5) - (-15)/25. Suppose -di - 3 = -3i. Solve r = -0 + i for r. 3 Let n be (-16)/20(-15)/6. Solve 25 = nh - 7h for h. -5 Suppose 45w = 42w. Solve 4u + u + 15 = w for u. -3 Let b be (-2)/(((-42)/6)/77). Solve -58 = -9y - b for y. 4 Let p be (8/6)/(56/126). Solve pa - 8 = -23 for a. -5 Let h(r) = -1 + 2r - r3 + 9r*2 + 2r - 3r. Let w be (-8)/4 + 7 + 4. Let a be h(w). Solve m = -m + a for m. 4 Suppose 61g = -174 + 2004. Solve g = 26m - 20m for m. 5 Suppose -2f = -4f + 16. Let s(x) = 3 - 4x2 - fx + x*2 + 4x*2 - 2x*2. Let q be s(-8). Solve 7 = -2y - q for y. -5 Let w be 2/((-4)/40-5). Suppose x = -wd + 16, -4x + 5d - 3 = -4. Solve 0 = -xr + 20 - 0 for r. 5 Let z be 1248/72 + 2/(-6). Solve 15g - zg = 0 for g. 0 Suppose -3g + 44k - 41k = -240, 236 = 3g - 5k. Solve -102 + g = 5l for l. -4 Let r(q) = q3 + 6q*2 + 2q + 9. Let k be r(-6). Let y(p) = 2p2 + 4p - 1. Let t be y(k). Let w be (-300)/(-8)(-2)/(-5). Solve -tg = -2g - w for g. 5 Let s(j) = 3j + 2. Let b be s(8). Suppose 5h = -3m - 28, -6h - m - b = -h. Let i = -5 - h. Solve i = 5p - 2p + 6 for p. -2 Suppose 4h = 2h + g - 42, 0 = 2h + 4g + 22. Let i = -54 + 32. Let z = h - i. Solve 2 = n - z for n. 5 Let f = -44 + 47. Let d = -3 + 7. Suppose -10 = -dk + 30. Solve 2t = -ft - k for t. -2 Let m(g) = -g + 10. Let f be m(-14). Let w be 9/(-12) + (-246)/f. Let z(x) = x*3 + 11x2. Let y be z(w). Solve -i = -y - 3 for i. 3 Let r(w) = w2 - 6w + 6. Let q be r(4). Let m be (q - -1)/(6 + -7). Let t = 4 - m. Solve 6 = -tu + 5u for u. 3 Suppose i = -2 + 5. Let g be (72/18)/((-4)/(-20)). Solve 2w + g = -iw for w. -4 Suppose -28u = -24u - g - 8, -2u + 4g = -4. Solve -y + 3 = u for y. 1 Suppose 18 = -0a + 3a. Suppose -5i + 2m = -3m, -4i = 3m - 28. Suppose -31 = -z - iz - 4t, 2z + 5t - 26 = 0. Solve 0 = -5o + zo + a for o. 3 Let a(m) = -m*3 - 6m*2 - 15m - 50. Let q be a(-5). Solve q = 2p + 1 - 9 for p. 4 Let g(d) = -2d + 18. Suppose -r - 1 = -14. Let s be g(r). Let j be s(-4 + 15/4). Solve -j = -3c - 8 for c. -2 Let w be (-16 + 1)7/21. Let x = 10 + w. Suppose 0 = -2u - 4j, -4u + 5j = -x - 21. Solve uc - 7 - 1 = 0 for c. 2 Let w(m) = 25m + 2. Let y be w(1). Let t be ((-4)/12)/((-1)/y). Suppose -8f - 2 = -tf. Solve -fj - 3j = -5 for j. 1 Let o be 10 + 16/4 - 2. Suppose -o = -9w + 5w. Solve 3 = -2t - w for t. -3 Suppose -b - 1 = -x, -b - 2 = 5x - 1. Solve -12 = -4y - x for y. 3 Let i(w) = 4w - 2. Let c be i(2). Suppose 5t = 2a + 12 + 7, 3t + 3a - 24 = 0. Let k be 298/14 - 4/14. Solve -tn + k = c for n. 3 Let k = -700 - -720. Solve 57 = -m + km for m. 3 Suppose -w - 3w + 5d + 1111 = 0, -3w = 4d - 841. Let p be (-8)/18 - w/(-81). Solve 0 = ps + 4 + 2 for s. -2 Suppose -3v = -40v + 222. Solve 0 = -9j - v - 12 for j. -2 Suppose 95 = 5n - h, 0 = 14n - 15n + 4h. Solve -4q - n = -24 for q. 1 Suppose 10v - 8v - 30 = 0. Let m(o) = -4o - 6. Let t be m(-4). Let x = v - t. Solve -2k + 1 = -x for k. 3 Let h be 4/8 + 9/2. Suppose 93 = -4z + h. Let g = 25 + z. Solve 0 = y - g + 8 for y. -5 Let a(l) = 3l*2 + 7l - 3. Let q be a(-3). Solve 0 = -3m + 3 + q for m. 2 Suppose 38 + 22 = 5n. Let p be 16(-1)/(-7) + n/(-42). Solve -1 + 7 = -pm for m. -3 Let k = 12 + -8. Suppose 34 = -3p + kv, -3v - 49 = 4p - 12. Let t(l) = l*3 + 9l*2 - 10l. Let j be t(p). Solve j = -0o - 2o + 2 for o. 1 Let z = -509 + 511. Solve zp + 8 = 2 for p. -3 Let o be 6/14 - 99/(-63). Suppose 0 = 3a + 3, c - 3a = oa + 7. Solve ch = -3h - 20 for h. -4 Let y(g) = -2g2 + g + 6. Let d be y(2). Suppose -2m + dm = -9m. Solve m = -3w - 3 - 3 for w. -2 Let r(o) = -o2 + 30o + 220. Let i be r(-6). Solve 0 = -2l - 0 - i for l. -2 Let x(d) = 0d*2 - 11d + 23 - 2d2 + 3d*2 - 13. Let w be x(10). Solve -g - 4 + 3 = w for g. -1 Let t = -1743 + 1745. Solve ts = 1 + 5 for s. 3 Suppose 6q - 2q + 5b - 62 = 0, -4q + 2b + 48 = 0. Suppose 18c = qc. Solve cg = -5g for g. 0 Suppose -15w + 15 = -10w. Suppose 44 = -wn - 4u, -3n - u = -6*n - 64. Let q be	{ "pile_set_name": "DM Mathematics" }
484r = -498r + 287280. What are the prime factors of r? 2, 3, 5, 19 Let t(g) = 63g + 215. Let d be t(-17). Let s = 860 + d. List the prime factors of s. 2 Let d = 351 + -327. List the prime factors of (-1300)/39d/(-10). 2, 5 Suppose 164833 = 26r + 118386 - 768289. List the prime factors of r. 2, 3917 Suppose -5h - 2845 = -5g, 0 = 2h - h. Suppose 9x - 367 = g. List the prime factors of x. 2, 13 Let g = -52 - -65. Let c = 150 - g. Let n = c - 70. What are the prime factors of n? 67 Suppose 0 = -5z - 3i - 13518, 7z + 4i + 10816 = 3z. Let n = z + 3874. What are the prime factors of n? 1171 Let g = -44521 - -111156. List the prime factors of g. 5, 13327 Suppose 0 = d + 35 - 33. Let v be (-1)/((-1 + 5)/4) + d. What are the prime factors of -384(v/(-6))/(-1)? 2, 3 Let t(m) = -7m - 102. Let k be t(-19). Suppose kd - 37d = -642. List the prime factors of d. 107 Suppose -3 - 485 = -4i. Let a = 150 - i. What are the prime factors of a? 2, 7 Suppose -5w + 54o = 53o - 43230, -43210 = -5w - 3o. List the prime factors of w. 5, 7, 13, 19 Suppose 9 = 49l - 40l. List the prime factors of -8 + l/((-6)/(-1182)). 3, 7 Let k = 26 + -24. Let f(g) = -g - 9 + 2gk + 2g + 5g + 10. What are the prime factors of f(7)? 3, 47 Let x = 131 - 157. Let z(s) = -s3 - 27s*2 - 42s - 17. List the prime factors of z(x). 3, 7, 19 Let g = -11825 - -20605. Suppose 19v - 22760 = g. List the prime factors of v. 2, 5, 83 Let p be (8/(-3) - -3) + 3/(-9). Suppose p = 30m - 15m - 15555. What are the prime factors of m? 17, 61 Suppose 701n + 5624 = 703n. Suppose 82c - 78c = n. List the prime factors of c. 19, 37 Let x = 8118 - 6087. What are the prime factors of x? 3, 677 Suppose -4h + 2s + 11371 = 5s, 5s - 8542 = -3h. Let b = 1739 - h. List the prime factors of ((-2)/4)/(22/b). 5 Let q = -5135 + 10389. List the prime factors of q. 2, 37, 71 Let g be 115(56/30)/(26/(-39)). Let x = -303 - g. What are the prime factors of x? 19 List the prime factors of (4/(-10))/(987090/3455550 + (-6)/21). 2, 3, 1097 Let x(a) = -5a + 29. Let u(z) = -z + 10. Let l be u(4). Let v be x(l). List the prime factors of (18/(-2))/(v/13). 3, 13 Let i(d) = -7d2 + 2d + 14. Let f(y) = -6y2 + 3y + 15. Let k be 66/14 + 8/28. Let t(o) = ki(o) - 6f(o). List the prime factors of t(12). 2, 7 Suppose -5u = 3u - 144. Let b = u - -182. List the prime factors of 1 + (-2b)/(-4). 101 Let u be 232/31922/4. Suppose 0 = 2t - uj - 684, -341 = -t + j - 0j. What are the prime factors of t? 2, 5, 17 Suppose 26g - 121325 = 1172739 + 378932. List the prime factors of g. 2, 32173 Suppose 31m + 4458 = -4687. Let l = 301 + m. What are the prime factors of l? 2, 3 Let c be -2(2 - 0) - (-150 + -2). Let a = 118 + c. What are the prime factors of a? 2, 7, 19 Suppose -58y = -2526060 + 902292. What are the prime factors of y? 2, 3, 2333 Suppose -3l + g + 37 = 0, 14 + 3 = 3l - 5g. Let d be 6/l + (-15)/35. Suppose d = -3b + 150 + 39. What are the prime factors of b? 3, 7 Let s(m) = 15m*2 + 10m + 15. Let c be s(-9). Suppose -c = -10o + 5o. List the prime factors of o. 2, 3, 19 Suppose -19 + 10 = -3p, -3c + p = -21303. List the prime factors of c. 2, 53, 67 Let z(c) = -2c2 - 19c - 35. Let u be z(-5). Let b(i) = -i*3 + 11i*2 + 10i - 16. List the prime factors of b(u). 2, 23 Let g(v) be the second derivative of 23v3 + 14v*2 - 113v. What are the prime factors of g(2)? 2, 19 Suppose 50 = -2l - 3l. Let z be (25/l)/((3 + 0)/(-78)). List the prime factors of ((-52)/20 + 3)z. 2, 13 Suppose 0 = 17h + 15h + 2880. Suppose -2j - 314 = -2s, 344 - 44 = -2j - 5s. Let a = h - j. List the prime factors of a. 5, 13 Suppose -19j - 3461 + 1443 = -36541. List the prime factors of j. 23, 79 Let y be 1 + (1 + 2)-1. Let m(c) = 22c + 302. Let v be m(-14). List the prime factors of 152 - ((-4)/v)/(y/6). 2, 7, 11 Let k(q) = -3q3 - 16q*2 + 110q - 16. List the prime factors of k(-20). 2, 3, 641 Suppose i + 8 = p, 22 = -2i - p + 6p. Let w(o) = 19 + 0o2 - 5o - 35 + o*2. List the prime factors of w(i). 2, 5 Let c(r) = -r - 18. Let l be c(10). Let b = 44 + 41. Let q = l + b. What are the prime factors of q? 3, 19 Let w(k) = 4k*3 + 3k*2 - k - 5. Let z be w(3). Let c = -94 + 39. Let g = c + z. List the prime factors of g. 2, 3 Let l(m) be the first derivative of 14m*3/3 + 8m*2 - 35m + 68. What are the prime factors of l(-11)? 1483 Let a(b) = -64 - 28b + 8 - 36. What are the prime factors of a(-24)? 2, 5, 29 Let z = 308 + -308. Suppose -795 = -5o + 2p - 135, z = 3o - 2p - 396. What are the prime factors of o? 2, 3, 11 Let h(r) = -6r*3 - 4r*2 + 6r + 2. Let f(b) = -5b3 - 3b*2 + 5b + 3. Let i(q) = 5f(q) - 4h(q). What are the prime factors of i(-5)? 2, 19 Let h(r) = 2 - 6r + 2 + 3r. Suppose 23 + 12 = -7k. List the prime factors of h(k). 19 Let m(v) = v3 + 11v*2 + 3. Let t be ((-176)/24)/(4/6). Let w be m(t). Suppose 83 = wh - 7. What are the prime factors of h? 2, 3, 5 Let o = -856 - -868. Suppose 3z - 176 = -2h, -h + z - 2z + 88 = 0. What are the prime factors of (h10/o)/((-8)/(-24))? 2, 5, 11 Let l = 213897 - 138938. What are the prime factors of l? 74959 Let t = 100 + -98. Suppose 5p = -5f + 77 + 8, 0 = -4p + 4f + 36. Suppose o = 3m + p, 4o + tm - 150 = -o. List the prime factors of o. 2, 7 Suppose -23580 + 82446 = 3w. List the prime factors of w. 2, 9811 Suppose q + 36 = f, -4f = -0f - 3q - 147. Let z = 556 + -541. Suppose -3v = -f - z. What are the prime factors of v? 2, 3 List the prime factors of 19/(-266)8 - 191006/(-7). 2, 7, 1949 Let o(s) = 36s*2 - 15s + 8. Let d(a) = -a*3 + 8a*2 + 2a - 12. Let c be d(8). What are the prime factors of o(c)? 2, 131 Let q(n) = -11n3 + 2n*2 + 2n + 1. Let v be q(-1). Let a = 2406 - 2286. Suppose -10z - a = -vz. List the prime factors of z. 2, 3, 5 Let s(h) = 2h3 - 68h*2 - 56h - 189. List the prime factors of s(35). 7, 43 Let f be 4(-111)/(-12)(-1 - 0). Let w(t) = -33t - 270. What are the prime factors of w(f)? 3, 317 Suppose -5r + 4m + 8010 = -2199, r - 2097 = -13m. List the prime factors of r. 5, 409 Let a = 130 + -132. Let s = 194 + a. What are the prime factors of s? 2, 3 Let r = -15066 + 25084. List the prime factors of r. 2, 5009 Suppose 2615 = 21d - 1102. Let g = 1535 - d. What are the prime factors of g? 2, 7, 97 Suppose 3u = -5p + 588 + 1592, -1717 = -4p + 3u. What are the prime factors of p? 433 Let a(m) = 7m*2 + m - 5. Let w(c) = 3c*3 + 3c*2 - 4c + 1. Let k be w(1). List the prime factors of a(k). 61 Let q be 8/36 - (-20)/454. Suppose 4p = -5j + 89 + 1829, 0 = -qp - 6. What are the prime factors of j? 2, 193 Suppose 2102050 = -51486r + 51511r. List the prime factors of r. 2, 17, 2473 Let v be 3288 - (20/(-10) - -4). Suppose -2d = 5p - v, -5d + d + p = -1724. What are the prime factors of d? 431 Suppose -5i + 25 = 0, 5r - 2i + 778 = r. Let q = -77 - r. List the prime factors of q. 5, 23 Let s be (0 - (-3 - 4/(-2))) + 3. List the prime factors of 174/s(-48)/(-36). 2, 29 List the prime factors of (22/(-44))/(8/(-125456)). 7841 Let z(d) = -2783d - 3820. What are the prime factors of z(-9)? 21227 Let k = -50862 - -110681. What are the prime factors of k? 41, 1459 Let b(g) = 3577g + 2 - 3567g + 21 + g2. What are the prime factors of b(9)? 2, 97 Suppose -f + 1648 = 3d, -223d + 219d - 3326 = -2f. What are the prime factors of f? 1657 What are the prime factors of (-334/(-154) - 100757/7)/(-1)? 37, 389 Let w be (29/(-2))/((-7)/(5 - -9)). List the prime factors of w-3(0 + 50/(-15)). 2, 5, 29 Let o(k) = -2k3 + 19k*2 + 14k - 6. Let y be o(10). Suppose p + b - 8 = 0, 4b + 0b + 10 = 3p. Let n = y + p. List the prime factors of n. 2, 5 Let l(t) = 470t*2 - 184t + 1129. List the prime factors of l(6). 5, 3389 Suppose -6f + 3s = -7f + 2673, 2677 = f + 5s. List the prime factors of f/28 + (-10)/8. 2, 47 Let h = 71 - 85. Let v(y) = -y*3 - 12y*2 - 23y + 25. What are the prime factors of v(h)? 739 Let q(s) = 1126s - 121. List the prime factors of q(5). 7, 787 Let r be (-2)/(-2) - ((-9 - 777) + 4). Suppose 14j = r + 239. List the prime factors of j. 73 Let a be ((-22)/(-4))/((-1)/(-4)). Suppose ac - 10 = 24	{ "pile_set_name": "DM Mathematics" }
+ (3 + sqrt(17))-6))2. 720sqrt(17) + 2996 Simplify ((sqrt(14) + sqrt(28)/sqrt(98))/(sqrt(2) + (sqrt(16)/sqrt(2))/sqrt(4)))*2. 16/7 Simplify -1 + sqrt(11) + sqrt(539)2. -1 + 15sqrt(11) Simplify ((sqrt(441)/sqrt(7)-3)/sqrt(9))*22. 126 Simplify 3(-2sqrt(1331))*2-5. -79860 Simplify sqrt(539)2 + 3. 3 + 14sqrt(11) Simplify (sqrt(27)/(-2sqrt(1089)))2. 3/484 Simplify (sqrt(98) + (sqrt(98) - 1sqrt(98)) + sqrt(2) + 4 + 0)*2. 64sqrt(2) + 144 Simplify sqrt(1575)-6 + -5. -90sqrt(7) - 5 Simplify ((sqrt(77) - 1sqrt(77))5)/sqrt(1584). 0 Simplify 5(sqrt(245) + -2 + sqrt(245)). -10 + 70sqrt(5) Simplify (-1(sqrt(209) - (sqrt(209) + -1sqrt(209) + sqrt(209))))/(sqrt(11) - ((sqrt(704) - (-2sqrt(704) + sqrt(704))) + sqrt(704) + sqrt(704) - sqrt(11))). 0 Simplify (sqrt(70)/sqrt(250) - (-5(sqrt(7) - (sqrt(7) - sqrt(14)/sqrt(2))) + sqrt(7)))*2. 3087/25 Simplify (1sqrt(2793))/(6sqrt(48)). 7sqrt(19)/24 Simplify ((-2sqrt(260) - sqrt(260))/sqrt(10))/sqrt(2). -3sqrt(13) Simplify 3 + (3sqrt(77)1)/(sqrt(28)/sqrt(16)). 3 + 6sqrt(11) Simplify sqrt(60)/(sqrt(48)/sqrt(4)) - (sqrt(55)/sqrt(275))2. -1/5 + sqrt(5) Simplify ((4 + sqrt(52) + 2)6)*2. 864sqrt(13) + 3168 Simplify (((sqrt(108) + (sqrt(108) - -2sqrt(108)) - sqrt(108))/sqrt(6))/(sqrt(36)/sqrt(96)))2. 432 Simplify -22sqrt(7)3. -12sqrt(7) Simplify 3sqrt(208) - (sqrt(52) + -2 + 5). -3 + 10sqrt(13) Simplify -2 + -5 + sqrt(68)/sqrt(4). -7 + sqrt(17) Simplify (1(1 + 1sqrt(243) + sqrt(243)))2. 36sqrt(3) + 973 Simplify (sqrt(2057) + (sqrt(2057) - (sqrt(2057) - (sqrt(2057) + -1)) - sqrt(2057))-2)2. 44sqrt(17) + 2061 Simplify sqrt(175) + 2sqrt(175)-6 + sqrt(175) - (-3 + (sqrt(175) - (-1 + sqrt(175)))*2). -50sqrt(7) + 2 Simplify sqrt(28)/(sqrt(324) + (sqrt(324) - (sqrt(324) + sqrt(324)-2))). sqrt(7)/27 Simplify -2(sqrt(7) + sqrt(252)/sqrt(4) + ((-2sqrt(77) + sqrt(77))/sqrt(11))2). -8sqrt(7) - 14 Simplify sqrt(24)/(2sqrt(972))-5. -5sqrt(2)/18 Simplify ((sqrt(612) - (sqrt(612) + -2))2)*2. 16 Simplify -3 + sqrt(35)/sqrt(5) + sqrt(7) - (sqrt(56)/sqrt(2))/sqrt(4). -3 + sqrt(7) Simplify (6sqrt(50)3)2. 16200 Simplify 4(sqrt(3) + (sqrt(3) + sqrt(192))*2) + 5. 4sqrt(3) + 977 Simplify (-1sqrt(726))/(1sqrt(4)/sqrt(2)). -11sqrt(3) Simplify (sqrt(88)/(-2sqrt(1152)))*2 + 3. 1739/576 Simplify 4 + (sqrt(192) - (-1 + sqrt(192) + sqrt(192))-3) + -2. -1 + 56sqrt(3) Simplify (sqrt(72)/sqrt(18))/(sqrt(84)/(sqrt(7)2)). 2sqrt(3)/3 Simplify ((sqrt(100)/sqrt(5))2 - sqrt(5))4. -4sqrt(5) + 80 Simplify (sqrt(91)4)/sqrt(7)-3. -12sqrt(13) Simplify (sqrt(42)-1-1)/(sqrt(192)/sqrt(8)). sqrt(7)/2 Simplify ((5 + sqrt(3))*2 + 2)-4. -120 - 40sqrt(3) Simplify -2 + sqrt(475) - (-2 + sqrt(2299))2. -2305 + 49sqrt(19) Simplify -1 + (sqrt(76)/sqrt(64) + ((1 + sqrt(19) - sqrt(19))-5 - sqrt(19)))2. 15sqrt(19)/2 + 555/16 Simplify (sqrt(24) + (-2sqrt(192) - sqrt(192))/sqrt(8))/(sqrt(64)/(1sqrt(8))). -2sqrt(3) Simplify 5 + sqrt(19)1 - (-1sqrt(304))2. -299 + sqrt(19) Simplify ((((sqrt(13) + sqrt(26)/sqrt(2) - sqrt(13) - sqrt(13)) + sqrt(13) + sqrt(13))1 - (sqrt(13) + 0 + sqrt(13))1)-1)*2. 0 Simplify (-2sqrt(200) + 5 - sqrt(200) - sqrt(200))*2. -400sqrt(2) + 3225 Simplify ((sqrt(204) - 1(sqrt(204) + 1sqrt(204) - sqrt(204)))/(sqrt(12) - sqrt(24)/sqrt(2)6))2. 0 Simplify ((sqrt(11) + sqrt(11) + sqrt(539) - sqrt(11))5 + sqrt(11))*2-5 + -1. -92456 Simplify sqrt(7) + sqrt(7) + -1 + 0 + 5. 4 + 2sqrt(7) Simplify 2 + sqrt(180)-2 - (0 + sqrt(180) + -1). -18sqrt(5) + 3 Simplify -3(3 + sqrt(396) + 0 + sqrt(396)). -36sqrt(11) - 9 Simplify (1sqrt(480))/(sqrt(60)/(sqrt(30)/sqrt(3))). 4sqrt(5) Simplify ((2 + sqrt(3))2 + 5)5. 20sqrt(3) + 60 Simplify (-3(sqrt(162) + (sqrt(162) - (-1 + sqrt(162)))))*2. 162sqrt(2) + 1467 Simplify (sqrt(95) + 2sqrt(95)-6)/(-2sqrt(720)). 11sqrt(19)/24 Simplify sqrt(85)/(sqrt(125)1). sqrt(17)/5 Simplify ((sqrt(51)/sqrt(3)-4 - 1sqrt(2448))6)*2. 156672 Simplify sqrt(12) + sqrt(12) + (sqrt(12) - (sqrt(12) + sqrt(12) + (-1sqrt(108))/sqrt(9))). 4sqrt(3) Simplify ((sqrt(70) - (sqrt(70) - ((sqrt(70) - 3sqrt(70) - sqrt(70)) + sqrt(70))))/sqrt(10) + (sqrt(28)2 - sqrt(7)))2. 7 Simplify -5(sqrt(77) + sqrt(77) + -2sqrt(77) + sqrt(77))/sqrt(11). -5sqrt(7) Simplify 4(-5sqrt(5)-2 - sqrt(5)). 36sqrt(5) Simplify (-2 + 3 + -2sqrt(13) + -5)2. 16sqrt(13) + 68 Simplify 0 + 62sqrt(208) + 4. 4 + 48sqrt(13) Simplify -2sqrt(27)2 + 4. -12sqrt(3) + 4 Simplify (sqrt(153)-2 - sqrt(153))/sqrt(9) - (5 + sqrt(17)1). -4sqrt(17) - 5 Simplify sqrt(96)/sqrt(3)-1. -4sqrt(2) Simplify (sqrt(13)-2 + 4 - (sqrt(13) + sqrt(208)2))2. -88sqrt(13) + 1589 Simplify 5(3 + (4 + sqrt(288) - sqrt(288))). 35 Simplify sqrt(6)/sqrt(2)-3-5. 15sqrt(3) Simplify 4 + (-1 + sqrt(28) + 2)*23. 12sqrt(7) + 91 Simplify 5((-1 + sqrt(17))-1 - (3sqrt(68))/sqrt(4)). -20sqrt(17) + 5 Simplify (sqrt(960)-1)/(sqrt(3) - -1sqrt(432)). -8sqrt(5)/13 Simplify 1 + (sqrt(1300)2 - sqrt(1300))2 + 1 + sqrt(468). 6sqrt(13) + 1302 Simplify (-1sqrt(975))/(sqrt(3) - -4(sqrt(3) - ((sqrt(3)-1 - sqrt(3)) + sqrt(3)))). -5sqrt(13)/9 Simplify -1 + (sqrt(1053)-2 - sqrt(13))21-6. -28159 Simplify 0 + sqrt(12)/((sqrt(60)/sqrt(5))/sqrt(2)). sqrt(2) Simplify -2 + (sqrt(5) - (sqrt(405) + -2) - sqrt(5)). -9sqrt(5) Simplify (-5(-3 + sqrt(50)) + 2)2. -850sqrt(2) + 1539 Simplify (sqrt(136)36)/sqrt(8). 18sqrt(17) Simplify ((sqrt(99) + 0 + -5)2)*2. -120sqrt(11) + 496 Simplify 2(5sqrt(26)/sqrt(2) + (4 + 0 + sqrt(13))*2). 58 + 26sqrt(13) Simplify -5((sqrt(81)/sqrt(3))/sqrt(9))2. -15 Simplify ((sqrt(432) + -1)5 - (sqrt(432) - (sqrt(432) + sqrt(432) + (sqrt(432)-3 - sqrt(432)) + 5)))2. 1728 Simplify 6(1 + sqrt(612)). 6 + 36sqrt(17) Simplify -5(1sqrt(128) + sqrt(128)) + -2. -80sqrt(2) - 2 Simplify sqrt(19)-25 + 0 + sqrt(475). -5sqrt(19) Simplify (-1 + -3 + -1sqrt(720))-1. 4 + 12sqrt(5) Simplify sqrt(228)/sqrt(192)-3. -3sqrt(19)/4 Simplify 2sqrt(50)/(sqrt(120)/(sqrt(96)/sqrt(8))). 2sqrt(5) Simplify -2sqrt(17) + -5 - (-3sqrt(1700))*2. -15305 - 2sqrt(17) Simplify ((sqrt(567) - (-3 + sqrt(567) + -2)) + 3 + sqrt(567) + sqrt(567) + -2 + sqrt(567))*2. 324sqrt(7) + 5139 Simplify (sqrt(6)/sqrt(27) + 1)*2. 2sqrt(2)/3 + 11/9 Simplify (0 + ((sqrt(45)/sqrt(5))/sqrt(3))*2)3. 9 Simplify -5 + sqrt(45) - -4sqrt(20)/sqrt(4). -5 + 7sqrt(5) Simplify (2sqrt(72))2. 288 Simplify -3 + (sqrt(630)/sqrt(160) - sqrt(63))/sqrt(9). -3 - 3sqrt(7)/4 Simplify (4(sqrt(605)-1 + -5 - sqrt(605)))*2. 3520sqrt(5) + 39120 Simplify -2 + sqrt(6)/(sqrt(6)/sqrt(2)). -2 + sqrt(2) Simplify (-5 + sqrt(21)/sqrt(3)2)2. -20sqrt(7) + 53 Simplify 0 + sqrt(17) + ((sqrt(187)1 - sqrt(187) - sqrt(187)) + sqrt(187))/sqrt(11). sqrt(17) Simplify (-11sqrt(363) - 2(sqrt(363) + (sqrt(363) + 0 - sqrt(363))))*2. 3267 Simplify (sqrt(72)/(sqrt(8)/sqrt(2)) - (sqrt(180)-2)/sqrt(10))*2. 162 Simplify (((sqrt(120)-2)/sqrt(5))/(sqrt(12)21))*2. 2 Simplify 2 + sqrt(252) - (sqrt(252)3 - sqrt(7)). -11sqrt(7) + 2 Simplify (sqrt(36)/(sqrt(81) - sqrt(9)))/(-2-1sqrt(2) + sqrt(2)). sqrt(2)/6 Simplify (-2sqrt(832) + sqrt(832) + -5 - sqrt(832) - sqrt(832)) + (-2 + (sqrt(832) - (sqrt(832) + (2sqrt(832))2 + sqrt(832))) - sqrt(832)). -3335 - 40sqrt(13) Simplify (sqrt(55)/(sqrt(11)-4) + sqrt(20)/sqrt(4)1 + sqrt(5))*2. 245/16 Simplify -1(sqrt(30)/(sqrt(360) + sqrt(10)) + sqrt(3)). -8sqrt(3)/7 Simplify (1(sqrt(20)-3 - sqrt(20)))/(sqrt(50)/(-1sqrt(5))). 4sqrt(2) Simplify (sqrt(11) + sqrt(176) + 1 + sqrt(704)/sqrt(4))2. 18sqrt(11) + 892 Simplify (4sqrt(352)/sqrt(8))2. 704 Simplify (4(sqrt(18)-4 + sqrt(2)-12))2. 6272 Simplify 5(22sqrt(1539))2. 123120 Simplify ((sqrt(140)/sqrt(4))/sqrt(5) - sqrt(56)/sqrt(2))2 + 1 + sqrt(7) + -1 + (sqrt(112))*2. sqrt(7) + 119 Simplify (-2 + (sqrt(252) - -6(sqrt(252) + 1 + sqrt(252))*2) + sqrt(252))4. 624sqrt(7) + 24208 Simplify 1 + sqrt(2) + sqrt(8)/(sqrt(16)/sqrt(4)) + -5. -4 + 2sqrt(2) Simplify (sqrt(88) + (sqrt(88) - sqrt(88)12))/(sqrt(8)2-2). 0 Simplify ((sqrt(11) + 1 + sqrt(539))*2 + sqrt(121)/(sqrt(44)/sqrt(4)))-2. -1410 - 34*sqrt(11) Simplify ((sqrt(175) - (-2 + sqrt(175) + -1 + sqrt(175) + sqr	{ "pile_set_name": "DM Mathematics" }
/30j4 + 0j*2 + 4j. Factor o(c). -2c(c - 3)/5 Let j(y) be the first derivative of 5y6/6 + 2y*5 - 10y*3/3 - 5y*2/2 + 15. Factor j(g). 5g(g - 1)(g + 1)*3 Determine q, given that 2/9q*3 + 4/3q*2 + 2q + 8/9 = 0. -4, -1 Let g(f) = 7f2 - 19f + 3. Let v(x) be the second derivative of -5x4/3 + 28x*3/3 - 4x*2 + 7x. Let m(p) = 8g(p) + 3v(p). Find w such that m(w) = 0. 0, 4 Let x(l) = l*2 + l. Let p(a) = 16a*2 + 12a. Let o(r) = -p(r) + 12x(r). Factor o(b). -4b*2 Suppose 42 - 52 = -2l. Let h(u) be the third derivative of 3u2 - 1/3u*3 + 0u - 1/120u6 + 0 - 5/24u*4 - 1/15u*l. Determine z, given that h(z) = 0. -2, -1 Find f, given that 0 + 12/7f*3 + 8/7f - 20/7f2 - 4/7f*5 + 4/7f*4 = 0. -2, 0, 1 Factor -10/17k*3 - 8/17k - 16/17k2 - 2/17k*4 + 0. -2k(k + 1)(k + 2)*2/17 Suppose 0 = 2f - 2g - 22, 10 = -3g + 4. Suppose 2y - 3 = j, -j - f = -5y + 2j. Factor -2m*4 + ym*2 + 18/7m*5 + 0 + 0m - 4/7m3. 2m*3(m - 1)(9m + 2)/7 Let t(x) be the first derivative of -7/2x2 - x3 + 1 + 6x. Let t(v) = 0. What is v? -3, 2/3 Let j = -2 + 5. Let q be 2 + (2 - j/3). Determine y, given that 2/5y + 1/5 - 4/5y*q + 4/5y*4 - 3/5y*2 = 0. -1/2, 1 Let k(i) be the first derivative of 7i*4/8 - 2i*3 + 3i*2/4 + i - 5. Solve k(b) = 0. -2/7, 1 Suppose -5 - 1 = -2y. Let q(v) = -v - 2. Let p be q(-5). What is h in -2 - 3h - 2h*2 - 2h*y - ph - 4h2 = 0? -1 Factor w3 - w3 + 2w*3 + 2w*2. 2w*2(w + 1) Let r(p) be the third derivative of 9p7/245 - 9p*6/70 - 27p5/70 - p4/21 + 4p3/7 + 4p*2. Let r(n) = 0. What is n? -2/3, 1/3, 3 Suppose 6 = n + 12a - 13a, 0 = -3n - 5a - 6. Factor -8/15p*n + 0 + 2/15p*2 - 2/5p*4 + 4/15p. -2p(p + 1)*2(3p - 2)/15 Let f = 2/29 - -17/174. Let g(b) be the second derivative of 3/10b*5 + 1/3b*4 + 0 + 2/15b*6 + 0b*2 + 3b + 1/42b7 + fb*3. Factor g(h). h(h + 1)4 Let z(p) = -p3 + 4p2 + 7p + 2. Let i(y) = 6y3 - 19y*2 - 34y - 9. Let u(f) = -4i(f) - 22z(f). Factor u(m). -2(m + 1)2(m + 4) Let p = 332 + -2984/9. Let g(u) be the first derivative of -8/9u - 2/27u*3 + 2 + pu*2. Determine s so that g(s) = 0. 2 Determine w, given that -846w + 4w2 + 12 + 834w - w*2 = 0. 2 Factor -32/3x*3 - 576 - 384x - 4/9x4 - 96x*2. -4(x + 6)4/9 Let q(c) be the third derivative of -c5/150 + c*3/15 + 15c*2. Determine i so that q(i) = 0. -1, 1 Find k such that 16/7k*4 + 0 + 0k + 20/7k3 + 8/7k*2 + 4/7k*5 = 0. -2, -1, 0 Let m(g) be the third derivative of -1/12g*4 - 3g*2 + 0 + 0g - 1/60g5 + 0g*3. Determine l, given that m(l) = 0. -2, 0 Let k(f) = 13f + 6. Let s(n) = -2n2 + 53n + 24. Let p(u) = -9k(u) + 2s(u). Determine m so that p(m) = 0. -2, -3/4 Let f(i) be the first derivative of -i*7/105 - 2i6/75 + i4/15 + i*3/15 - 4i - 2. Let j(b) be the first derivative of f(b). Solve j(v) = 0. -1, 0, 1 Let b(u) = -u*2 - 10u + 12. Let j be b(-12). Let g be (-2)/(-3) + j/(-9). Find d, given that -1 + 0 + 3d3 + 3 + 9d*g + 1 + 9d = 0. -1 Let j = 1 - -1. Determine t, given that 3t2 + 3t*5 - 2t*2 - 3t*4 + jt*2 - 3t3 = 0. -1, 0, 1 Factor -x2 + 3 - 1 - 2x2 - 2x*2 - 3x. -(x + 1)(5x - 2) Let d(i) = -i*2 + 7i - 6. Let a be d(6). What is o in -1/4o2 + a + 0o + 1/4o3 = 0? 0, 1 Let c = -24 + 29. Suppose 5v - c = 10. Find w, given that 0w + 2/9w*4 + 0 - 4/9w*v + 2/9w*2 = 0. 0, 1 Let u be 22/(-77)7/(-3). Factor 8/9s - 2/9 - us*2. -2(s - 1)(3s - 1)/9 Suppose -4d - d = 0. Suppose -5w + 20 = -d. Let -2 + 4a2 - 5a2 - a2 - wa = 0. Calculate a. -1 Let n = 9 - 6. What is x in xn + x3 + x2 - 3x*3 = 0? 0, 1 Suppose 0 = -4n + 8 + 4. Factor 0k + 0k + 8kn - 6k*3. 2k3 Let z(v) be the third derivative of -v8/1176 - 2v7/735 + v5/105 + v4/84 + 33v2. Suppose z(j) = 0. What is j? -1, 0, 1 Let b(c) be the first derivative of -c6/540 - c5/180 - c3 + 4. Let t(w) be the third derivative of b(w). Factor t(p). -2p(p + 1)/3 Let f(k) be the first derivative of -4k5/5 - k4 + 4k*3 + 10k*2 + 8k + 3. Let f(d) = 0. What is d? -1, 2 Factor -8/7h - 8/7h*2 + 0 - 2/7h*3. -2h(h + 2)2/7 Let u be 66/15 - 1 - (-3)/5. Let v(i) be the first derivative of 0i*2 + 1/15i*6 - 3 + 2/15i*3 + 0i - 2/25i5 - 1/10i*u. Determine b so that v(b) = 0. -1, 0, 1 Let s = 245/6 + -1213/30. Factor sh*2 + 2/5h + 0. 2h(h + 1)/5 Let f = -10513 - -94718/9. Let t = f - 11. Factor 2/9u - 2/9u*3 + 0 + tu*4 - 2/9u*2. 2u(u - 1)2(u + 1)/9 Let w be 10/85/((-10)/(-8)). Let f(j) be the second derivative of -3j + 1/5jw - 1/21j*7 - 1/15j*6 + 0 + 0j*2 + 0j*3 + 0j*4. Solve f(y) = 0. -2, 0, 1 Let h = -4 - -4. Suppose 6c - 4c - 5y + 11 = h, 0 = -y + 3. Factor 0q - 2/5q*3 + 0 - 2/5q*c. -2q*2(q + 1)/5 What is f in 240/7f2 + 54/7f + 4/7 + 352/7f3 = 0? -1/4, -2/11 Let x(m) be the first derivative of -m7/280 + m6/120 + m5/40 - m4/8 + 2m*3/3 + 3. Let g(b) be the third derivative of x(b). Factor g(k). -3(k - 1)*2(k + 1) Let k(j) be the first derivative of -j*6/21 - 6j*5/35 - 3j*4/14 - 2j3/21 - 3. What is o in k(o) = 0? -1, 0 Let n(d) = d3 - d*2 - 3d + 4. Let a be n(2). Factor -q*2 - 3q*a - q - 2 + 5q*2. (q - 2)(q + 1) Let x(u) = -5u2 - 4. Let v = 5 - 2. Let t(n) = 4n*2 + 3. Let d(i) = vx(i) + 4t(i). Factor d(o). o2 Let n(a) be the second derivative of a4/12 - a3/3 + 3a*2/2 - 9a. Let t be n(2). Factor 0 - 1/2ut + 1/2u + 0u2. -u(u - 1)(u + 1)/2 Let h(i) be the third derivative of -2i*2 - 3/20i*5 + 1/20i*6 + 0 + 0i + 0i3 - 1/4i*4. Find t, given that h(t) = 0. -1/2, 0, 2 Let g(p) be the first derivative of 22p*3/45 - 3p*2/5 - 4p/15 - 42. Let g(w) = 0. Calculate w. -2/11, 1 Let w be 9/21 - (-11)/7. Factor 12 + wi + i4 + 5i*2 + 4i*3 - 12. i(i + 1)*2(i + 2) Suppose 0 = 2v + 4v - 24. Determine b so that 3 + 4 + 9bv + 3b - 15b3 - 7 + 3b2 = 0. -1/3, 0, 1 Let d(f) = -f2 - 6f - 5. Let b be d(-5). Let k be -1 + (b - 2-1). Factor -3a2 + 7a*2 - k - 1 - 2a*4. -2(a - 1)*2(a + 1)*2 Let p(l) = -4 - 5l*2 - 4l3 + l2 - 5l + 3l*3. Let h be p(-3). Solve 2f + 3 + 3 - 2 - 4f - 2f*h = 0 for f. -2, 1 Let x be 1/((5/(-2))/(-5)). Suppose 5 = -3j + k, -4 = -xj + 5k - 29. Factor jp2 + p + 0p + p*2. p(p + 1) Let h be ((-14)/(-4))/(9/18). Suppose -6 = -hf + 4f. Determine v so that 0 + 1/4v3 - 1/4v - 1/4v4 + 1/4v*f = 0. -1, 0, 1 Solve 0p*3 - 3p*3 - 11p - 15p2 - 3 - p - 3p*3 = 0 for p. -1, -1/2 Let q(h) be the third derivative of 1/1260h*6 + 0h + 4h2 + 1/84h*4 + 0 - 1/210h*5 + 1/3h*3. Let a(d) be the first derivative of q(d). Factor a(n). 2(n - 1)*2/7 Suppose -5s + 15 = 0, -5a - 3s + 22 + 7 = 0. Factor -8o5 - 30o*2 + 32o*2 - o + o - 4o*3 - 14o*a. -2o*2(o + 1)*2(4o - 1) Let a(c) be the second derivative of c6/12 - 3c*5/8 + 5c*4/8 - 5c*3/12 - 6c. Factor a(d). 5d(d - 1)3/2 Let r(s) be the first derivative of -s6/33 + 6s5/55 - 3s*4/22 + 2s*3/33 + 1. Factor r(b). -2b*2(b - 1)*3/11 Let o(a) = 7a*2 - 3a - 4. Let r be o(-2). Let l be (r/(-75))/((-6)/10). Suppose -lb2 - 8/3b - 8/3 = 0. What is b? -2 Let i be 93/35 + -1 - 236/295. Factor io3 + 0 - 1/7o + 3/7o5 + 0o*2 + 8/7o*4. o(o + 1)*3(3o - 1)/7 Let r(i) be the first derivative of i3 - 9i*2/2 - 7i - 2. Let s(o) = -14o + 0o*2 + 5o*2 - 9 - 2. Let n(a) = 8r(a) - 5s(a). Factor n(w). -(w + 1)2 Let w(a) be the second derivative of -a4/102 - 2a*3/51 + 3a*2/17 + 13a. Suppose w(f) = 0. Calculate f. -3, 1 Let s(y) be the third derivative of y*5/60 - 11y*4/24 - 2y*3 + 17y*2 + 2y. Factor s(r). (r - 12)(r + 1) Determine z, given that 0z - 2/17z2 + 0 = 0. 0 Factor 3g*3 - 48g*2 - 25g - 32 + 13g3 - 2g*4 + 89g. -2(g - 2)4 Let t = 34 - 16. Let n be (-4)/t + (-114)/(-27). Factor n - 2 + 0p*2 + 0 - 2p*2. -2(p - 1)(p + 1) Let a(g) = g2 + 3g. Let s(t) = 4t2 + 16t. Let y(o) = 16a(o) - 3s(o). What is w in y(w) = 0? 0 Let a = -14819/78 - -190. Let p = a - -58/39. Suppose 9/4y2 + py + 1/4 = 0. Wha	{ "pile_set_name": "DM Mathematics" }
the remainder when 597 is divided by 296. 5 What is the remainder when 27 is divided by 6? 3 What is the remainder when 1618 is divided by 1614? 4 What is the remainder when 232 is divided by 9? 7 Calculate the remainder when 1544 is divided by 17. 14 Calculate the remainder when 31 is divided by 23. 8 What is the remainder when 103 is divided by 5? 3 Calculate the remainder when 234 is divided by 40. 34 What is the remainder when 127 is divided by 34? 25 What is the remainder when 45 is divided by 23? 22 Calculate the remainder when 913 is divided by 115. 108 Calculate the remainder when 49 is divided by 27. 22 Calculate the remainder when 208 is divided by 45. 28 Calculate the remainder when 174 is divided by 20. 14 Calculate the remainder when 823 is divided by 38. 25 What is the remainder when 582 is divided by 65? 62 What is the remainder when 20 is divided by 16? 4 Calculate the remainder when 461 is divided by 71. 35 What is the remainder when 247 is divided by 127? 120 Calculate the remainder when 454 is divided by 375. 79 Calculate the remainder when 6802 is divided by 126. 124 What is the remainder when 592 is divided by 7? 4 Calculate the remainder when 305 is divided by 4. 1 What is the remainder when 582 is divided by 93? 24 What is the remainder when 1609 is divided by 10? 9 What is the remainder when 13299 is divided by 266? 265 What is the remainder when 2674 is divided by 64? 50 Calculate the remainder when 20299 is divided by 116. 115 Calculate the remainder when 1021 is divided by 33. 31 Calculate the remainder when 132 is divided by 37. 21 What is the remainder when 52 is divided by 8? 4 Calculate the remainder when 344 is divided by 40. 24 Calculate the remainder when 8351 is divided by 36. 35 Calculate the remainder when 1487 is divided by 93. 92 What is the remainder when 21353 is divided by 6? 5 What is the remainder when 2847 is divided by 4? 3 Calculate the remainder when 444 is divided by 64. 60 Calculate the remainder when 5979 is divided by 1992. 3 What is the remainder when 57 is divided by 34? 23 Calculate the remainder when 174 is divided by 43. 2 What is the remainder when 14187 is divided by 7? 5 Calculate the remainder when 2503 is divided by 276. 19 What is the remainder when 8507 is divided by 10? 7 What is the remainder when 620 is divided by 125? 120 Calculate the remainder when 81 is divided by 19. 5 What is the remainder when 184 is divided by 31? 29 What is the remainder when 546 is divided by 322? 224 Calculate the remainder when 170 is divided by 79. 12 What is the remainder when 1022 is divided by 33? 32 Calculate the remainder when 921 is divided by 21. 18 What is the remainder when 329 is divided by 10? 9 Calculate the remainder when 7083 is divided by 50. 33 Calculate the remainder when 389 is divided by 23. 21 Calculate the remainder when 259 is divided by 17. 4 What is the remainder when 1734 is divided by 62? 60 What is the remainder when 57 is divided by 41? 16 What is the remainder when 1312 is divided by 28? 24 Calculate the remainder when 21 is divided by 10. 1 Calculate the remainder when 192 is divided by 100. 92 What is the remainder when 307 is divided by 16? 3 What is the remainder when 653 is divided by 334? 319 What is the remainder when 143 is divided by 75? 68 Calculate the remainder when 1070 is divided by 406. 258 What is the remainder when 1212 is divided by 94? 84 Calculate the remainder when 67 is divided by 14. 11 Calculate the remainder when 1000 is divided by 17. 14 Calculate the remainder when 508 is divided by 16. 12 What is the remainder when 507 is divided by 45? 12 Calculate the remainder when 91 is divided by 23. 22 Calculate the remainder when 6424 is divided by 21. 19 What is the remainder when 156 is divided by 37? 8 What is the remainder when 15897 is divided by 12? 9 What is the remainder when 431 is divided by 24? 23 What is the remainder when 30 is divided by 8? 6 What is the remainder when 2175 is divided by 90? 15 What is the remainder when 525 is divided by 183? 159 Calculate the remainder when 1688 is divided by 13. 11 Calculate the remainder when 976 is divided by 29. 19 What is the remainder when 794 is divided by 265? 264 What is the remainder when 290 is divided by 19? 5 Calculate the remainder when 1840 is divided by 84. 76 What is the remainder when 840 is divided by 145? 115 Calculate the remainder when 51 is divided by 9. 6 Calculate the remainder when 1583 is divided by 4. 3 Calculate the remainder when 798 is divided by 115. 108 Calculate the remainder when 166 is divided by 129. 37 Calculate the remainder when 3153 is divided by 240. 33 What is the remainder when 555 is divided by 62? 59 What is the remainder when 571 is divided by 13? 12 Calculate the remainder when 590 is divided by 419. 171 Calculate the remainder when 109 is divided by 49. 11 What is the remainder when 77 is divided by 22? 11 Calculate the remainder when 1184 is divided by 44. 40 Calculate the remainder when 480 is divided by 44. 40 Calculate the remainder when 1241 is divided by 11. 9 What is the remainder when 183 is divided by 177? 6 Calculate the remainder when 984 is divided by 21. 18 What is the remainder when 962 is divided by 318? 8 Calculate the remainder when 37 is divided by 36. 1 Calculate the remainder when 482 is divided by 226. 30 What is the remainder when 87 is divided by 22? 21 Calculate the remainder when 79 is divided by 19. 3 What is the remainder when 611 is divided by 151? 7 What is the remainder when 47 is divided by 6? 5 Calculate the remainder when 370 is divided by 95. 85 What is the remainder when 6343 is divided by 8? 7 What is the remainder when 59 is divided by 46? 13 What is the remainder when 803 is divided by 374? 55 What is the remainder when 697 is divided by 228? 13 What is the remainder when 904 is divided by 175? 29 Calculate the remainder when 20239 is divided by 58. 55 What is the remainder when 248 is divided by 9? 5 Calculate the remainder when 53 is divided by 25. 3 What is the remainder when 975 is divided by 46? 9 What is the remainder when 55 is divided by 31? 24 Calculate the remainder when 465 is divided by 26. 23 What is the remainder when 253 is divided by 81? 10 What is the remainder when 4253 is divided by 115? 113 Calculate the remainder when 330 is divided by 314. 16 What is the remainder when 4128 is divided by 118? 116 What is the remainder when 573 is divided by 12? 9 Calculate the remainder when 143 is divided by 10. 3 Calculate the remainder when 404 is divided by 9. 8 Calculate the remainder when 132 is divided by 31. 8 Calculate the remainder when 60 is divided by 18. 6 What is the remainder when 7 is divided by 4? 3 What is the remainder when 43 is divided by 12? 7 What is the remainder when 611 is divided by 12? 11 What is the remainder when 615 is divided by 39? 30 What is the remainder when 317 is divided by 152? 13 What is the remainder when 2711 is divided by 1332? 47 What is the remainder when 1339 is divided by 49? 16 What is the remainder when 22 is divided by 8? 6 Calculate the remainder when 454 is divided by 8. 6 What is the remainder when 447 is divided by 175? 97 Calculate the remainder when 95 is divided by 33. 29 Calculate the remainder when 515 is divided by 129. 128 Calculate the remainder when 263 is divided by 1. 0 Calculate the remainder when 7379 is divided by 12. 11 Calculate the remainder when 4933 is divided by 105. 103 What is the remainder when 629 is divided by 73? 45 Calculate the remainder when 68 is divided by 49. 19 Calculate the remainder when 70 is divided by 6. 4 Calculate the remainder when 834 is divided by 11. 9 What is the remainder when 281 is divided by 128? 25 What is the remainder when 38 is divided by 9? 2 Calculate the remainder when 1477 is divided by 657. 163 What is the remainder when 86006 is divided by 104? 102 What is the remainder when 691 is divided by 24? 19 Calculate the remainder when 88 is divided by 81. 7 What is the remainder when 605 is divided by 76? 73 Calculate the remainder when 277 is divided by 33. 13 Calculate the remainder when 1585 is divided by 8. 1 Calculate the remainder when 834 is divided by 15. 9 Calculate the remainder when 350 is div	{ "pile_set_name": "DM Mathematics" }
*2 + p - 3. Let o be d(m). Suppose os = 337 - 99. What are the prime factors of s? 2, 17 Suppose -5o = -o - 20. Suppose 0 = 2j - 5j + 5z + 150, -250 = -5j - oz. Let s = j - 34. What are the prime factors of s? 2 What are the prime factors of 196 + -4 + (-1 - 6 - -14)? 199 Suppose -9t + 4458 = 2d - 6t, 2243 = d + 5t. List the prime factors of d. 3, 13, 19 What are the prime factors of 286/(4/(-8)(-2 + 0))? 2, 11, 13 What are the prime factors of 6 + (6 - 2786/(-7))? 2, 5, 41 What are the prime factors of 1156/(4 - 84/24)? 2, 17 Let m(h) = 4h*2 - 3h + 6. Let t be m(3). Suppose 5z - t - 52 = 0. What are the prime factors of z? 17 Let t = 1440 - 2672. What are the prime factors of 2/6 + t/(-48)? 2, 13 Suppose 5r - 2k = -305, -2k - 173 = 3r + 26. Let m = -37 - r. Suppose 0 = -2x - 8, -5h = -x + m - 115. List the prime factors of h. 17 Suppose 3f - 36 = 15. Suppose 0 = 20g - fg - 45. What are the prime factors of g? 3, 5 Let r = -1 - -1. Let u(j) = -2j2 + j - 1. Let c(x) = -x3 + 13x*2 - 7x - 59. Let k(n) = -c(n) - 6u(n). What are the prime factors of k(r)? 5, 13 Suppose 6t - 2 - 10 = 0. Suppose -21 = -ti + 13. List the prime factors of i. 17 Suppose 0 = -z - z - 60. Let l = 51 + z. What are the prime factors of l? 3, 7 Let m(w) = 143w*2 + 3w - 1. Let k be (4/(-16))/((-1)/4). Let u be m(k). Suppose -4i - 43 = 2v - 161, -2v = 5i - u. What are the prime factors of i? 3 Let j(z) = -z*2 - 10z + 2. Let q be 3 + 2(4 + -3). Suppose 0 = i + 1, -12 = f + qi - 0. What are the prime factors of j(f)? 23 Let o(g) = 2986g2 + 17g + 18. List the prime factors of o(-1). 29, 103 Suppose -8c - 104 = -1240. Suppose -5k - c = -1077. List the prime factors of k. 11, 17 Suppose 6b - 2b = 4u - 56, -3u = -b - 36. Let p(g) = g*2 - 14g + 8. Let t be p(u). Let n = t + 39. What are the prime factors of n? 2, 7 Let r be 1(-6)/93. Let s be r/9 - 174/(-54). What are the prime factors of (-3 + 5)(-1 + s)? 2 Suppose 17o - 1250 = 22o. Let u = o + 435. List the prime factors of u. 5, 37 Let s(v) = 400v + 3. List the prime factors of s(3). 3, 401 Let c = 14 - 14. Suppose -5z - 26 + 11 = 0, 4r + 4z - 332 = c. What are the prime factors of r? 2, 43 Let s be 23/((-4)/(-12) - (-1)/(-6)). Let a be 3/(12/332)-1. Let n = s + a. What are the prime factors of n? 5, 11 Let u = 9 - 14. Let f(t) = -t*3 - 3t*2 + 6t + 3. What are the prime factors of f(u)? 23 What are the prime factors of ((-6393)/(-6) - -3)/(5/10)? 2137 Let x = 36 + 21. Suppose -m = -2r + x, -7r + 2r + 170 = -3m. Let g = -31 - m. What are the prime factors of g? 2, 3 Let j(d) = d*3 - 4d*2 - d + 8. Let y = 30 - 23. List the prime factors of j(y). 2, 37 Suppose -24271 = -5r - 3j, -8 + 2 = -3j. What are the prime factors of r? 23, 211 Let y(l) = -3l - 18 + 1 + 19l - 3l - l2. Suppose -5v = -17 - 18. List the prime factors of y(v). 5 Let u(q) = 4q - 4. Let j(s) = s3 - 2s*2 - 3s + 2. Let d be j(3). What are the prime factors of u(d)? 2 Let l(m) = -16m - 6 - 3 - 23m*2 + 20m*2. Let w be l(-11). What are the prime factors of w/(-9) - 2/(-9)? 2, 11 Let o be (301)/1 + 1. Let c = o + -29. Suppose 0w - 84 = -cw. What are the prime factors of w? 2, 3, 7 Let s(a) = a*2 + 2a + 3. Let u be s(-2). Suppose -273 + 9 = -uh. What are the prime factors of h? 2, 11 Let m be 8/12(-2 + -1). Let g be (-18)/(m/(-2)-1). List the prime factors of 318/g + 2/(-3). 17 Let y = -910 + 1402. List the prime factors of y. 2, 3, 41 Suppose -l = -2p + 48, 0p - 96 = 2l - 5p. What are the prime factors of (l + 7)/(24/9 - 3)? 3, 41 Suppose -7y + 5y + 4 = 0. Suppose -2i = -2u - 42, i + yu - 26 = -2u. What are the prime factors of i? 2, 11 Suppose -88o - 14443 = -101o. List the prime factors of o. 11, 101 Let b(d) be the third derivative of -d5/60 - 11d*4/24 - 3d*3 - 5d*2. List the prime factors of b(-6). 2, 3 Suppose j + 11 = 22. Suppose 3i + j = 38. What are the prime factors of i? 3 Let y = -463 - -734. Let v = 406 - y. List the prime factors of v. 3, 5 Let g = 79 - 31. Suppose -11l + g = -9l. What are the prime factors of l? 2, 3 Let x be ((-4)/4-2 + -7)/(-1). Suppose 44 = -xw + 559. What are the prime factors of w? 103 Let z = 185 + -547. Let f = -213 - z. What are the prime factors of f? 149 Suppose -11o + 779 = -6074. List the prime factors of o. 7, 89 What are the prime factors of 8/(-36) + (3 - 20744/(-36))? 3, 193 Let a = 141 - 97. Suppose -a = -0x - 2x. List the prime factors of x. 2, 11 Let h = 3901 - -99. What are the prime factors of h? 2, 5 Suppose -5b = 5x - 30, -2x + 3x + 3b = 8. Suppose -5k + 15 = 0, xn - 2n - 3k = -36. List the prime factors of (n/(18/112))/(-1). 2, 7 Let w be 15/(-5 - -8) + 58. Suppose -4x = 4n - 252, -x + w = 3n - 6n. List the prime factors of x. 3, 7 Let v = 20 - 17. Suppose 0 = -u + v + 1. Suppose 5b - f - 43 = -5f, -f = -ub + 26. List the prime factors of b. 7 Let n = -15 + 12. Let b = 19 - n. Suppose bm = 25m - 135. List the prime factors of m. 3, 5 List the prime factors of (13692/(-9))/((-14)/21). 2, 7, 163 Let m = 177 - 85. Suppose -2z - m = -2s, 0 = -s + 5z + 17 + 37. What are the prime factors of s? 2, 11 What are the prime factors of ((-26)/8)/(129/(-65532))? 13, 127 Suppose 13o - 88 = 9o. List the prime factors of o. 2, 11 Suppose -3s - 156 = j + j, -s + 2j = 52. Let d be (-8)/s + (-1215)/39. Let r = d + 70. What are the prime factors of r? 3, 13 Suppose m - 3 = 0, 5z = -3m - m + 2452. Suppose -6w = -z - 442. What are the prime factors of w? 5, 31 Suppose 0f + 23f = 6187. What are the prime factors of f? 269 Let c(a) = -9a2. Let b be c(-1). Let n = b + 4. List the prime factors of (8/n)/(6/(-75)). 2, 5 Let c be 2 - (2/(-2))/1. Let f(x) = -x3 + 18x2 - 11x - 65. Let o be f(17). Suppose 4 = -w, -w + o = 2z - c. What are the prime factors of z? 2, 11 Let w(o) = 9o*2 - o - 2. Let p be w(-2). Suppose 3t + p = t + 2d, 75 = -5t + 2d. Let r = t + 21. What are the prime factors of r? 2 Suppose -4f + 1591 = -x, 1595 = 6f - 2f + 3x. List the prime factors of f. 2, 199 What are the prime factors of 480 + (28 - 28 - (-1 - 1))? 2, 241 Let a = -142 - -410. Suppose -a = 14t - 16t. Suppose -x - 4x = 3w - 296, -t = -2x + 4w. List the prime factors of x. 61 Let n(v) = 3v*2 + 5v - 3. Let m be (-105)/20 + 2 + (-21)/12. List the prime factors of n(m). 47 Let n = 249 + 645. Suppose -n = 2r - 5r. What are the prime factors of r/5 + (-4)/(-10)? 2, 3, 5 List the prime factors of (4 + (-4396)/8)/((-1)/2). 1091 Suppose 2k - 47 - 33 = 3l, 0 = -2k + 8. Let r = l - -19. Let q = r - -30. What are the prime factors of q? 5 Suppose g - 3t - 484 = 25, 3g - 1503 = t. List the prime factors of g. 2, 5 Suppose -2b + b = 2. Let u = b + 21. Suppose -5h + u = 2f, -h = -2f - 0h + 1. What are the prime factors of f? 2 Let k = 5141 + -1611. List the prime factors of k. 2, 5, 353 Let r be 3((-14)/6)/7 - 0. What are the prime factors of (-3 - (323 - 4))r? 2, 7, 23 Let v(x) be the second derivative of x5/20 + x4/12 + x*3/6 + 22x*2 + 14x. List the prime factors of v(0). 2, 11 Suppose 0 = -5d + 8d - 651. What are the prime factors of d? 7, 31 Suppose o + 3 - 4449 = 0. List the prime factors of o. 2, 3, 13, 19 Let r(i) = -3i3 - 16i*2 + 13i + 27. What are the prime factors of r(-9)? 3, 89 Suppose 2x + 6 = -2. Let s(y) = 2y*2 + 6y + 8. List the prime factors of s(x). 2 What are the prime factors of (1 + (-45)/6)874/(-23)? 13, 19 Let a be (-114)/6(-3)/3. Suppose a = 2y - 3x, y - 25 = -y + x. List the prime factors of y. 2, 7 Let a be ((-4)/5)/(14/105). List the prime factors of (-2)/(-4)(15 + a + 37). 23 Suppose -5d + 1158 = 2k, -2k - 2d + 1954 = 790. List the prime factors of k. 2, 73 Suppose -n + 0i = i + 3, -15 = 2n + 5i. Let c = n + 30. What are the prime factors of c? 2, 3, 5 Suppose -8i + 1291 + 1597 = 0. List the prime factors of i. 19 Suppose 10 = 5g - 20. Let a(k) = k + 18 - 16 - gk. What are the prime factors of a(-10)? 2, 13 Suppose w = -1 - 4. Let o be (6/w)/((-10)/50). Let j = o + -3. What are the prime factors of j? 3 Let r be 55/13/5. Suppose -4u + 4v + 96 = 0, -u - v + r = v. Let h = u - 17. What are the prime factors	{ "pile_set_name": "DM Mathematics" }
+ 4y - 56 for t. -4 Solve -2x = 4v - 26, 69x + 5v = 204 + 161 for x. 5 Solve 38x - 41x = -2h + 46, -4h = 8x - 36 for h. 17 Solve -3t + 5z + 28 = 0, -2z - 240 + 244 = -5t for t. -4 Solve -5c + 128 - 139 = -y, 5c + 15 = 0 for y. -4 Solve 10 = n + c, -336c - 22 = -4n - 334c for n. 7 Solve -3w - 72v - 39 = -77v, -3w - 13v = 39 for w. -13 Solve 0 = k + 1140f - 1137f - 16, -3k + 33 = 4f for k. 7 Solve 4x = -5q + 4, 59 - 55 = x + 2q for x. -4 Solve 59 - 9 = -2q - 12m, 0 = -4q + m for q. -1 Solve -24 = 672944p - 672940p + 4w, -p + 4p + 14 = -2w for p. -2 Solve -s - x = 12, 0 = -4s - 19148x + 19153x + 33 for s. -3 Solve v - 13 = 3x, 5x + 6 = 3x - 2v - 0v for x. -4 Solve 3v - 9 = 3t, -344v + 341v + 16 = 4t for t. 1 Solve 1104 - 1102 = t - c, -4t + c + 8 = 0 for t. 2 Solve 5t + 6p - 701 + 720 = 0, -4p = -4 for t. -5 Solve 2d = -5s - 42, -3d = 45s - 47s + 44 for s. -2 Solve -4a = -2u + 6, 0 = a - 1894u + 1895u + 6 for a. -3 Solve 1320g + 3b = 1324g + 39, 7 = 3g + 5b for g. -6 Solve 4m = -3r - 22, 11r - 14r - m - 10 = 0 for r. -2 Solve -2i - 18 = 2n, 2i + 3n + 3844 = 3817 for i. 0 Solve -25 = -5x + 5s, 3x + 2s - 556 = -531 for x. 7 Solve -4q - 6 = -2l, 16q + 6l - 2l = 17q - 9 for q. -3 Solve 2m + 11 = -3235w + 3230w, 5w + 7 = -4m for m. 2 Solve -2i + 5u = 23, -2i + 1573u + 7 = 1578u for i. -4 Solve -55t - 64 - 52 = -3v, t = 6t - 5v + 20 for t. -2 Solve 2t - 4c = -10, -6t - c - 16 = -12 for t. -1 Solve 2z - 10 = -4t, 47t - 48t = -z + 5 for z. 5 Solve 0 = -110h + 114h - 2n + 6, -3n = 5h + 35 for h. -4 Solve 5x + 52 = 4s, -4x + 2 = 5s + 19 for s. 3 Solve -j = -4w - 51, 31343j - 31345j = -4w - 46 for j. -5 Solve 12t - 13t - 3 = 4i, 3i - 5t + 31 = 0 for i. -2 Solve -21 - 21 = -2k - 7m, 5m = 2k + 6 for k. 7 Solve 2g + f = 48, -1035f - 67 = -3g - 1039f for g. 25 Solve 20s - q = -10, 0 = -2118s + 2115s + 2q - 20 for s. 0 Solve -u + 3t = -7, -5u + 35 = 8t - 6t for u. 7 Solve 0 = 2l - 5d + 3, 5l - 2d = -6 + 9 for l. 1 Solve -4y - 22m + 18m = 0, 363m - 20 = -y + 366m for y. 5 Solve 6482z = 6479z - 2q - 11, 0 = 4z + q + 18 for z. -5 Solve 5995w - 5998w = 5y + 10, -5y - 30 = -w for y. -5 Solve -7 = 5j - l + 19, l - 16 = 3j for j. -5 Solve -3h = -3s - 330 + 327, 2h - 10 = 0 for s. 4 Solve 5f = -3s - 49, -2f + 14 = 171s - 174s for s. -8 Solve -4l + 36q - 41q - 4 = 0, -5q = l + 16 for l. 4 Solve 295t - 3c = 290t - 31, t - 3c = -47 for t. 4 Solve 2773 = 2t + 2771, -4z = 3t + 13 for z. -4 Solve 4h - 12b + 9b = 54, 4h - b = 10 for h. -3 Solve -8f + 13f + 155 = -28v, -8f = -3f - 3v for f. -3 Solve 3x = -n + 7, -5n - 3x = -29 + 30 for n. -2 Solve 135w - 138w - 14 = -4b, b = w + 5 for b. -1 Solve 3i = -178 + 169, 11 = 5x - 7i for x. -2 Solve -52 = 23g - 10l + 12l, 4g - 2l = -2 for g. -2 Solve w - 3 = -n, 4w = -n - 97 + 94 for n. 5 Solve -6q = 3o - 21, -8q + 13q + 2o - 18 = 0 for q. 4 Solve 42c - 30c = 3l - 42, 4l - 26 = c for l. 6 Solve -4 = 4u, -15 = 2y + 6u - u for y. -5 Solve 4u + 4t = -8, 70t = 5u + 71t + 2 for u. 0 Solve -q = 2q - 15, 0d - 13 - 15 = -d - 5q for d. 3 Solve -2l + 952f + 15 = 949f, 0 = l + 3f + 15 for l. 0 Solve -3j - 44 = -5x, -2j + 19x + 1546 = 1544 for j. -18 Solve 4r = -5q - 30, 2q + 7321r - 7320r + 9 = 0 for q. -2 Solve -t + 2s - 5 = 0, 4 = -334t + 338t + 4s for t. -1 Solve -2t - 61 = a - 51, t + 4a = 5t + 20 for t. -5 Solve 3b - 5g = -9, 4b + 6g = -141 + 129 for b. -3 Solve a = 2o + 22, a - 264o + 267o = -28 for a. 2 Solve 41j - 40j - 2l = 3, -15 = -5j - 2l for j. 3 Solve 4u + 5o = -34, 4 + 23 = 5o + 77 for u. 4 Solve -b = 133m - 140m - 32, -m + 5b - 24 = 0 for m. -4 Solve 5d + 44 = v - 10v + 5v, 6d = -2v - 50 for v. -1 Solve j + 3844q - 36 = 3848q, -4q - 28 = -3j for j. -4 Solve 2u = -3p + 66, 62 = u + 3p - 4 for u. 0 Solve 5u + 4g = -35, 14u - 12u = -8g - 78 for u. 1 Solve 4j + 39r = 44r - 7, 9 = -2j - 3r for j. -3 Solve 5b - 6 = -c, 68 = -2b - 3c + 73 for b. 1 Solve 4m = 4p - 4, 0 = 40p + 93m - 90m + 175 for p. -4 Solve l + 3p + 9 = 0, 2l = 27p - 32p - 14 for l. 3 Solve -4g + 18 = 5f, f + 5g - 12 = -21 for f. 6 Solve 132s - 133s = -2t - 8, s - 2 = 0 for t. -3 Solve -13z + 10z = 4n + 20, -15 = 3n + 2z for n. -5 Solve 5f - q = 5, -4f - 5q + 114 = 110 for f. 1 Solve 10 = -2q + s, 4s + 437 = -3q + 422 for q. -5 Solve 5b + 10 = -5k, 0 = 46k - 41k - 5b for k. -1 Solve -3i - 3b - 51 = 0, 57i + 38 = 55i + 2b for i. -18 Solve -3n + 30 = 0, -4z + 17n - 18 = 16n for z. -2 Solve 3t - 118 = 4p - 95, -5p = -3t + 25 for t. 5 Solve 0 = -c + 17m + 223, -28c - 3m = -32c + 47 for c. 2 Solve -3w + 58 - 94 = -6s, 0 = 18s + 5w - 52 for s. 4 Solve 5d = 2l - 14, 5l - 35 = -26 + 26 for d. 0 Solve q + 2u - 14 = 0, 5q - 5 - 37 = -6u for q. 0 Solve 9r + 3b = -0b + 48, -37 - 5 = -6r + 3b for r. 6 Solve 4a = u - 12, -3a - 62u + 66u = 35 for a. -1 Solve -5y + 1 = -3j, 0 = 1062j - 1058j - 3y - 6 for j. 3 Solve 4a - 12 = d, -8 = -51d + 49d for a. 4 Solve -65p + 69p - 3t = 43, -t - 40 = -5p for p. 7 Solve -5q + 4u + 13 = 0, 23q + 5u = 45q - 95 for q. 5 Solve -8a + i - 10 = -9a, -4i = 2a - 28 for a. 6 Solve 2i - 18 = 2c, i - 960c + 958c - 11 = 4 for i. 3 Solve 556 = -20y - 2f, -232y + 227y + 4f - 148 = 0 for y. -28 Solve -z + v + 8 - 6 = 0, -4 = -4z - 31v + 34v for z. -2 Solve -2p = 3p + c, 0 = -5p + 331c - 333c + 5 for p. -1 Solve -236x + 241x + 5g + 110 = 0, 4g + 52 = 5x for x. -4 Solve -3n = -j + 28, 2n - 5j = -16 - 7 for n. -9 Solve -5s = 90p - 92p + 23, 3s - 2p + 13 = 0 for s. -5 Solve -26o + 3 = -j - 21o, 0 = -26o + 20o for j. -3 Solve 4s + 79g = 74g, 0 = -3g + 5g for s. 0 Solve 0 = -2o - 5b + 42, -7 = -o - 50b + 51b for o. 11 Solve -65 = 3u - 8n, -4u = 42n - 45n + 33 for u. -3 Solve -3w + 5j + 16 = 0, 10j - 8j = -5w + 6 for w. 2 Solve u = 2a - 3, 2a - 21 = 9u - 2u for a. 0 Solve 0 = -3j + 2b + 16, 4b = -5j - 7 + 19 for j. 4 Solve 82z - 2i - 9 = 85z, 3i = -3z - 6 for z. -5 Solve 4q + 4y = -12, -4q - 140y + 138y - 4 = 0 for q. 1 Solve 3v + 16 = 10k, -6v - 3k = -52 - 8 for v. 8 Solve 5x = -32p - 8 + 50, -3 = 125p - 128p for x. 2 Solve -297x = -4q - 294x - 10, 12 = -2q - 2x for q. -4 Solve -3p = -3k - 6, 2p = 120978k - 120981k + 4 for p. 2 Solve -16f - 4 = -17f, 89 = -21x - 4f for x. -5 Solve -74 = -20n + z + 107, -3n = -z - 28 for n. 9 Solve 0 = -h - 4h + 7h + 2p - 22, -12 = -2p for h. 5 Solve 6 = -32o + 27o + u, -4o = -4u - 24 for o. -3 Solve -4z + 2t + 32 = 0, -4z - 29t + 28t + 14 = 0 for z. 5 Solve -2y + 4 = 1774l - 1776l, -5l = -y + 2 for l. 0 Solve -54 = 4j - 5m, j + 4m - 47 + 8 = 0 for j. -1 Solve p + 3j - 2 = 0, 60p - 56p = -7j + 3 for p. -1 Solve -4j = -5z - 36, 0j + 7z + 16 = -3j for j. 4 Solve -2m + 14 = 2y, 42 = 26m - 30m + 3y for m. -3 Solve -2f + 17 = 5v, -3f + 13 = -3v + 8v for v. 5 Solve -3p - 29 = 8w, -9 + 2 = 3w + 5p for w. -4 Solve 0 = -1963d + 1960d - 5h + 16, 4d - 13 = -5h for d. -3 Solve -h - 52b + 50b = 13, -4b - 16 = 0 for h. -5 Solve 4t = 3f + 28, 74 = 26t + 2f - 194 for t. 10 Solve 0 = -4y - 2v - 20, 2y - 4v - 1097 = -1087 for y. -3 Solve -3y + 12 = 3r, -2y + 7r - 11r + 8 = 0 for y. 4 Solve -3d - 60 = -3y, 5y + 83d = 81d + 121 for y. 23 Solve 11f = 14f - 3r - 18, -2f - 3r + 7 = 0 for f. 5 Solve -4q - 4s + 53 = -7q, -2q + 5s - 47 = 0 for q. -11 Solve 187 = 2x - 14q + 51q, -3x = -2q + 7 for x. 1 Solve -21 = -3r - p, 0p + 4p = -r - 4 for r. 8 Solve 12k - 3d = 12, 1404k - 2d + 4 = 1400k for k. 3 Solve -2t + 3q = -24 - 5, 0 = -5t - 4q - 31 for t. 1 Solve j + 5y = 35, y = 50 - 44 for j. 5 Solve -6 = 3o + 5p, -10 = 5o - 76p + 74p for o. -2 Solve -4t - q + 1 = 0, 3q + 32301 = 3t + 32364 for t. -4 Solve -10t - 10 = -14t - 2w, -5t - 5w = 0 for t. 5 Solve -5q = 5d - 55, -316d = 2q - 320d - 28 for q. 12 Solve -4k = -4c - 20, 2c + 3k = 155 - 170 for c. -6 Solve 3z = -4i + 30, 5z -	{ "pile_set_name": "DM Mathematics" }
+ 121 - 13. Put -6, -1, f in increasing order. -6, -1, f Let y(v) = v + 1. Let o be y(5). Suppose 2l - ol = 0. Let a(w) = -27w + 77. Let n be a(3). Sort -2, n, l in increasing order. n, -2, l Suppose 3i + 5m - 6 = 9, 5i + 9 = 3m. Suppose -5g + 3g - 10 = i. Put 2, g, 5 in descending order. 5, 2, g Let t = 17 - 9. Let b = t - 9. Let u = 19 - 22. Sort 1/2, u, b in increasing order. u, b, 1/2 Let b = 267.39 + -293.6. Let x = -26 - b. Let h = x - 0.01. Put 1, h, 2 in descending order. 2, 1, h Let o(n) = -n2 + 3n - 3. Let x be o(2). Let p be x/(4/(-3)) + 4/16. Let d = -1 + 4. Sort d, p, 4. p, d, 4 Let b = -1.6 - -1.7. Put -0.2, b, -4, -54 in decreasing order. b, -0.2, -4, -54 Let l = -38.2 + 33.2. Put l, -0.5, 0.01 in descending order. 0.01, -0.5, l Let x be (3/2)/((-2)/4). Suppose 483k + 16 = 475k. Put k, -4, x, -5 in descending order. k, x, -4, -5 Suppose -11y = -7y + 21y. Let p be (1/(-3))/(2/(-9)). Put 0.4, -2, p, y in increasing order. -2, y, 0.4, p Let v = 293 + -292.603. Let n = v - -0.003. Sort 2/7, -2, 5, n in decreasing order. 5, n, 2/7, -2 Let m(g) = -g3 - 5g*2 - 3g. Let r be m(-4). Let i be 10/(((-342)/(-285))/(6/(-10))). Sort -2, r, i in ascending order. i, r, -2 Suppose -u - u - 10 = 0. Let r = -7 - -10. Let g be 2 - (r - 2)2. Sort u, 4, g in decreasing order. 4, g, u Let u be 2(-1 + (-30)/(-12)). Put u, -3, 0, -4 in descending order. u, 0, -3, -4 Let v = -731 - -734. Put -2/3, 7, v, 1.6 in decreasing order. 7, v, 1.6, -2/3 Let r be ((-50)/44 - -1)/(10/20). Put r, 2/3, 0.2, -4 in decreasing order. 2/3, 0.2, r, -4 Let i = -374 + 371. Let s be (-2)/(-4)26/91. Sort s, -2/99, 0.2, i in descending order. 0.2, s, -2/99, i Suppose -5j = 0, -v = -j + 6 - 3. Let r = -0.16 - 0.04. Let f = -0.19 - -0.09. Put v, r, f in decreasing order. f, r, v Let k = 228 + -227. Sort 8, -12, k in descending order. 8, k, -12 Let b(d) = -d*3 - 10d*2 + d + 10. Let g be b(-10). Suppose g = -4t + 9t - 20. Let a = 11 - 16. Put -2, a, t in decreasing order. t, -2, a Suppose -2p - 3t + t - 102 = 0, -2p - 5t - 96 = 0. Let j = 53 + p. Put 3, -17, j, -2 in decreasing order. 3, j, -2, -17 Let z = 1.52 - 2.12. Suppose -4o = 16 + 80. Let b be ((-1)/(-5))/(12/o). Sort z, -3/4, b. -3/4, z, b Suppose 2i + 3z - 359562 = 0, -3z + 599802 = 5i - 299085. Let m = i + -19775109/110. Let a = m - 11/10. Sort -5, 3, a in decreasing order. 3, a, -5 Let c = -1.275 - -0.065. Let x = c - -0.91. Sort 0.1, -0.2, x in descending order. 0.1, -0.2, x Let y = -2407.051 - -2411. Let q = y + 0.051. Let n = 3.01 - 0.01. Put q, 1/2, n in decreasing order. q, n, 1/2 Let z = -3 - 1. Suppose 2v + 2s - 2 = s, 5v = -s + 8. Suppose -9 = -j - vj. Sort j, 8, z. z, j, 8 Suppose 0 = -b + 6b - 5. Suppose 3j + d + b = 0, j + 2d + 4 = -2d. Suppose -4q + 4 = 20. Sort q, j, 5 in descending order. 5, j, q Let r = -0.1 - 3.7. Let v = r + 4. Let m = 350 - 351. Put m, -2/9, v in descending order. v, -2/9, m Let k = -47/6 - -137/18. Put 0, 2, k, -9 in decreasing order. 2, 0, k, -9 Suppose 2d - 4y + 6 = -10, 5d = -5y - 40. Sort 5, -14, 0, d in ascending order. -14, d, 0, 5 Let j = 0.11 + -0.01. Let q = 1000 - 1055.3. Let l = -55 - q. Put l, j, 4 in ascending order. j, l, 4 Let j = -959 - -959. Put -8, -2, j, -3 in ascending order. -8, -3, -2, j Let h be (2/(-6) - 3)(-84)/(-70). Put h, 10, 1 in decreasing order. 10, 1, h Let i(v) = 13v + 585. Let m be i(-45). Put -1, -6, -5, m in decreasing order. m, -1, -5, -6 Let q = 766 - 761. Sort -49, 4, -1, q in increasing order. -49, -1, 4, q Let v(q) = -q3 - 6q*2 + 2q - 6. Let d be v(-6). Let n = d + 6. Let i = n + 16. Put i, 0, -1 in ascending order. -1, 0, i Suppose -6n + 6 = -5n. Suppose ni = i - 25. Let l be 2/(i - (1 - 1)). Put -5, -0.6, l in descending order. l, -0.6, -5 Suppose 12 = -2x - 3g, 2 = 4x - 5g + 4. Suppose 0 = 9m - 4m + c - 4, -3m + 5c = 20. Put x, -6, -2, m in ascending order. -6, x, -2, m Let y = -8.7 + 6.7. Suppose -g - 13 = 3k, 33 = -5k + 4g - 0g. Put -0.4, y, k in ascending order. k, y, -0.4 Let n be (0 - 0) + (-2 - 0). Let u(m) = 8m - 47. Let c be u(-23). Let d be 10/(-8) - c/28. Sort -5, n, d in increasing order. -5, n, d Let n be -15((-25)/(-15))/(-5). Put -9, -2, 1, n in increasing order. -9, -2, 1, n Let d = 82/15 - 373/60. Let a = -1 - -6. Sort 3, d, a in descending order. a, 3, d Let s = -4 - -1. Let z = -6.1 + 5.8. Sort -2/13, s, z, 0 in ascending order. s, z, -2/13, 0 Let z(r) = -r3 + 10r*2 - 7r - 18. Let q be 14 + -17 - -26. Let k be z(q). Sort 0.5, 0.2, k in ascending order. k, 0.2, 0.5 Suppose 16 = -4y, -2y = 5m + 1 - 3. Sort -5, -4, 16, m. -5, -4, m, 16 Let j = 1.006 - 0.906. Put 4, j, 0.4, -1/5 in decreasing order. 4, 0.4, j, -1/5 Let q be (-2 - 1)142/(-6). Let d = -139/2 + q. Let w = 9797 - 9802. Sort w, d, 3. w, d, 3 Suppose 3u = -2f + 31, 0 = 4f - 9u + 4u - 117. Let i = 18 - f. Sort i, 12, 1 in decreasing order. 12, 1, i Suppose -5g - 2 = -2u, 0u = -u + 5g + 1. Suppose 10s - 6s = 0. Let k be s(-2)/(-1 + 5). Put 8, k, u in ascending order. k, u, 8 Suppose 4o + 5s = -21, -3s = -0 + 3. Sort -3, o, -2, 0.5. o, -3, -2, 0.5 Let a = 614 + -610. Sort -3.6, a, 3 in descending order. a, 3, -3.6 Let l = 275 + -288. Sort l, 4, -1/4, -48. -48, l, -1/4, 4 Let m = 138.6 + -20.6. Let i = 116 - m. Sort 2, -0.01, i in decreasing order. 2, -0.01, i Let q be (1/3)/(6/(-54)). Let o = 44 - 39. Let y be (-4)/510/(-4). Put o, y, q in descending order. o, y, q Suppose 13 = 4x - t, -3t - 3 = 3x + 6. Suppose -3n + 35 = -4p + 12, -3p + 4n - 19 = 0. Let s be 1 + -3 - 21. Put s, x, p in descending order. x, s, p Let x = -607 - -612. Put -11, -3, -14, x in increasing order. -14, -11, -3, x Let d be 12/(0 - -3) - -35. Let v = d + -196/5. Put -0.4, v, 4 in descending order. 4, v, -0.4 Suppose -15w + 20w = 30. Let j(k) = k2 - 1. Let q(u) = -4u*2 - u + 5. Let b(n) = 5j(n) + q(n). Let m be b(1). Put w, m, -2 in decreasing order. w, m, -2 Let k = 447 + -443. Sort 0.1, k, -1/9. -1/9, 0.1, k Let x(w) = -w*2 + 12w + 10. Let z(i) = i*2 + 9i + 13. Let h be z(-9). Let s be x(h). Sort -16, 0, s in ascending order. -16, s, 0 Let z be (-350)/(-40) - (-2)/8. Suppose z = 5m + n - 0n, -2m = -n + 2. Sort m, -5, 0. -5, 0, m Let u = 17 + -16. Let n be (-2u)/(9/(-18)). Sort -3, 5, n. -3, n, 5 Suppose -156 = -1728q + 1767q. Suppose 12 = 3h, 4s + 2h - 168 = -0h. Let d be 2/8 - 2/s. Sort 0.9, d, q in decreasing order. 0.9, d, q Let v = 1508 - 1508.8. Sort -3, v, -1 in decreasing order. v, -1, -3 Let n(j) = -6j - 3. Suppose 0z - z = 2. Let m be n(z). Let i = 18 - m. Sort i, 1, 3 in ascending order. 1, 3, i Let k(g) = -g*2 - 14g - 52. Let m be k(-8). Sort 0, -8, m, -2 in descending order. 0, -2, m, -8 Let a be (3 + 0)(3 - 7). Let u = 32 - 31. Let v be 4/u + a/6. Sort 5, v, -4. -4, v, 5 Suppose 5t - 9 = s + 9, 3s - 26 = -5t. Suppose 7 = -tw + 15. Suppose wx = -2x - 24. Sort 3, x, -5 in increasing order. x, -5, 3 Let u = 369/8 + -46. Let c = u - 21/232. Let n = 185/3 - 61. Put c, 1/3, n in ascending order. c, 1/3, n Suppose 5 = -48v + 43v. Suppose 3h - 5a - 9 - 5 = 0, -2h + 3a + 8 = 0. Put 2, v, h, 3 in decreasing order. 3, 2, v, h Suppose d = -d - 3d. Suppose -u = 1 - 0. Sort -2, d, 4, u in descending order. 4, d, u, -2 Suppose 9m + 0m - 45 = 0. Sort -1, m, -7. -7, -1, m Let f = 112 + -107. Sort -27, f, -3. -27, -3, f Let b = -3.1 - 15.9. Let r = b - -15. Let h = r + 2. Put h, -0.5, 4/3 in decreasing order. 4/3, -0.5, h Let p(g) = g*3 + 3g*2 - 2g + 6. Let b be p(-4). Let k be -4 + (b - -3 - -2). Let i be -4(-2)/(-4) + k. Sort 5, i, 0 in increasing order. i, 0, 5 Let w = -2.55 + 9.55. Put 9, w, 5 in decreasing order. 9, w, 5 Let i = -2.3 + 0.3. Sort 2, i, -2/5, 0.3 in decreasing order. 2, 0.3, -2/5, i Let y = 2.1 - 20.4. Let u = y - -18. Put -4, 1/5, u in increasing order. -4, u, 1/5 Let d = -3.81 - -3.81. Sort 1/2, d, -0.8, 0.3 in ascending order. -0.8, d, 0.3, 1/2 Let t be -10 + ((-473)/(-33) - 5). Let k be -3 - (-1)/(-9)-25. Put k, 2/3, t, -1.1 in decreasing order. 2/3, k, t, -1.1 Let i = -14 - -7. Let o = 0.34 - 0.74. Put i, -1, o in decreasing order. o, -1, i Let b(h) = -h*3 - 16h*2 + 16h - 15. Let z be b(-17). Put 5, -31, z, -5 in	{ "pile_set_name": "DM Mathematics" }
9:16 PM? 4:37 PM How many minutes are there between 4:51 PM and 5:16 PM? 25 What is 419 minutes before 4:18 AM? 9:19 PM What is 719 minutes before 5:09 PM? 5:10 AM What is 69 minutes before 1:41 AM? 12:32 AM What is 195 minutes before 2:34 AM? 11:19 PM How many minutes are there between 10:25 PM and 3:48 AM? 323 What is 692 minutes before 11:29 PM? 11:57 AM What is 310 minutes after 10:19 AM? 3:29 PM How many minutes are there between 5:01 PM and 10:10 PM? 309 How many minutes are there between 12:24 PM and 4:38 PM? 254 How many minutes are there between 6:40 PM and 3:30 AM? 530 How many minutes are there between 3:32 PM and 10:20 PM? 408 How many minutes are there between 8:25 PM and 6:14 AM? 589 What is 145 minutes after 12:07 PM? 2:32 PM What is 63 minutes after 11:43 AM? 12:46 PM How many minutes are there between 9:28 AM and 9:16 PM? 708 How many minutes are there between 11:56 AM and 2:12 PM? 136 How many minutes are there between 10:26 PM and 10:45 PM? 19 How many minutes are there between 5:04 AM and 10:48 AM? 344 What is 372 minutes after 10:07 AM? 4:19 PM How many minutes are there between 6:11 PM and 6:01 AM? 710 How many minutes are there between 9:23 AM and 4:07 PM? 404 What is 11 minutes after 8:46 PM? 8:57 PM How many minutes are there between 9:58 AM and 6:38 PM? 520 What is 715 minutes after 3:59 AM? 3:54 PM What is 107 minutes before 11:17 PM? 9:30 PM How many minutes are there between 11:06 PM and 6:18 AM? 432 What is 237 minutes before 6:24 PM? 2:27 PM How many minutes are there between 1:35 AM and 11:07 AM? 572 What is 652 minutes before 5:32 PM? 6:40 AM What is 2 minutes before 8:01 PM? 7:59 PM What is 123 minutes after 5:25 PM? 7:28 PM How many minutes are there between 5:34 PM and 12:43 AM? 429 How many minutes are there between 8:42 AM and 5:30 PM? 528 What is 428 minutes after 2:50 AM? 9:58 AM What is 655 minutes after 9:45 AM? 8:40 PM How many minutes are there between 1:28 AM and 3:15 AM? 107 What is 41 minutes before 8:52 AM? 8:11 AM How many minutes are there between 3:33 PM and 10:27 PM? 414 What is 532 minutes after 10:05 PM? 6:57 AM What is 492 minutes before 6:54 PM? 10:42 AM What is 432 minutes after 7:50 PM? 3:02 AM How many minutes are there between 2:14 AM and 5:01 AM? 167 How many minutes are there between 3:44 AM and 5:21 AM? 97 What is 581 minutes after 10:43 AM? 8:24 PM What is 586 minutes before 10:05 AM? 12:19 AM How many minutes are there between 8:09 PM and 5:41 AM? 572 What is 300 minutes before 1:17 AM? 8:17 PM How many minutes are there between 6:05 PM and 9:00 PM? 175 How many minutes are there between 2:42 PM and 7:34 PM? 292 How many minutes are there between 8:13 PM and 1:34 AM? 321 What is 663 minutes before 7:32 AM? 8:29 PM What is 663 minutes before 6:00 AM? 6:57 PM How many minutes are there between 7:14 AM and 7:03 PM? 709 What is 419 minutes after 3:22 AM? 10:21 AM How many minutes are there between 10:12 AM and 11:01 AM? 49 How many minutes are there between 3:37 AM and 12:32 PM? 535 What is 250 minutes after 6:05 AM? 10:15 AM How many minutes are there between 10:08 AM and 8:49 PM? 641 What is 627 minutes before 6:23 PM? 7:56 AM What is 62 minutes after 11:52 PM? 12:54 AM What is 53 minutes after 4:43 PM? 5:36 PM How many minutes are there between 11:37 AM and 11:25 PM? 708 How many minutes are there between 11:26 PM and 1:59 AM? 153 What is 628 minutes before 4:19 PM? 5:51 AM How many minutes are there between 8:47 AM and 11:20 AM? 153 What is 679 minutes after 4:48 PM? 4:07 AM What is 690 minutes after 9:22 PM? 8:52 AM What is 322 minutes after 11:19 PM? 4:41 AM How many minutes are there between 11:38 AM and 8:26 PM? 528 How many minutes are there between 7:27 AM and 3:38 PM? 491 What is 142 minutes after 2:33 PM? 4:55 PM How many minutes are there between 10:45 AM and 7:30 PM? 525 What is 305 minutes before 11:18 AM? 6:13 AM How many minutes are there between 8:13 PM and 4:24 AM? 491 How many minutes are there between 1:38 AM and 2:40 AM? 62 How many minutes are there between 11:23 AM and 12:39 PM? 76 How many minutes are there between 6:31 AM and 4:15 PM? 584 How many minutes are there between 8:44 AM and 4:27 PM? 463 What is 71 minutes before 5:39 PM? 4:28 PM How many minutes are there between 11:37 AM and 6:37 PM? 420 What is 419 minutes before 10:11 PM? 3:12 PM How many minutes are there between 12:17 PM and 2:41 PM? 144 How many minutes are there between 12:36 AM and 3:26 AM? 170 How many minutes are there between 8:12 PM and 7:43 AM? 691 How many minutes are there between 1:39 PM and 2:12 PM? 33 How many minutes are there between 1:56 AM and 9:39 AM? 463 What is 408 minutes after 7:23 AM? 2:11 PM What is 137 minutes before 12:19 PM? 10:02 AM What is 341 minutes after 8:01 AM? 1:42 PM What is 553 minutes before 1:43 AM? 4:30 PM What is 123 minutes before 3:24 AM? 1:21 AM How many minutes are there between 1:56 PM and 2:40 PM? 44 How many minutes are there between 8:14 AM and 3:24 PM? 430 How many minutes are there between 1:16 PM and 12:26 AM? 670 What is 171 minutes after 4:38 PM? 7:29 PM How many minutes are there between 5:51 AM and 5:12 PM? 681 What is 573 minutes after 8:52 AM? 6:25 PM What is 148 minutes before 4:38 PM? 2:10 PM How many minutes are there between 3:46 PM and 3:17 AM? 691 What is 104 minutes before 1:31 AM? 11:47 PM How many minutes are there between 4:31 PM and 3:56 AM? 685 How many minutes are there between 1:11 PM and 3:57 PM? 166 How many minutes are there between 2:35 PM and 5:07 PM? 152 What is 532 minutes before 5:53 PM? 9:01 AM How many minutes are there between 5:41 PM and 11:35 PM? 354 How many minutes are there between 5:04 AM and 10:14 AM? 310 What is 453 minutes after 1:40 PM? 9:13 PM How many minutes are there between 12:19 PM and 8:44 PM? 505 How many minutes are there between 10:07 AM and 2:11 PM? 244 What is 514 minutes after 7:17 PM? 3:51 AM What is 289 minutes before 5:23 AM? 12:34 AM What is 304 minutes before 11:14 PM? 6:10 PM How many minutes are there between 7:48 PM and 12:34 AM? 286 How many minutes are there between 7:46 PM and 4:31 AM? 525 How many minutes are there between 7:18 PM and 3:10 AM? 472 How many minutes are there between 5:54 AM and 5:06 PM? 672 What is 160 minutes after 1:23 AM? 4:03 AM How many minutes are there between 4:08 AM and 12:54 PM? 526 How many minutes are there between 1:50 AM and 4:40 AM? 170 How many minutes are there between 11:19 PM and 9:18 AM? 599 How many minutes are there between 1:55 AM and 5:32 AM? 217 What is 418 minutes after 12:35 PM? 7:33 PM What is 251 minutes after 10:09 PM? 2:20 AM How many minutes are there between 11:20 PM and 7:14 AM? 474 How many minutes are there between 1:42 AM and 10:59 AM? 557 What is 286 minutes before 11:06 AM? 6:20 AM What is 111 minutes after 2:02 PM? 3:53 PM What is 524 minutes after 3:51 AM? 12:35 PM What is 627 minutes before 8:44 AM? 10:17 PM How many minutes are there between 11:20 PM and 2:43 AM? 203 What is 359 minutes after 12:27 PM? 6:26 PM What is 670 minutes after 2:33 AM? 1:43 PM How many minutes are there between 12:25 AM and 8:36 AM? 491 What is 589 minutes before 9:19 AM? 11:30 PM What is 195 minutes before 7:14 PM? 3:59 PM What is 568 minutes after 9:59 PM? 7:27 AM What is 402 minutes before 10:23 PM? 3:41 PM What is 488 minutes before 4:12 PM? 8:04 AM How many minutes are there between 1:59 AM and 8:24 AM? 385 What is 345 minutes after 6:54 AM? 12:39 PM What is 558 minutes before 5:13 PM? 7:55 AM What is 591 minutes before 6:18 PM? 8:27 AM What is 520 minutes after 3:40 AM? 12:20 PM What is 421 minutes before 1:41 PM? 6:40 AM How many minutes are there between 10:45 PM and 2:56 AM? 251 How many minutes are there between 7:18 PM and 3:45 AM? 507 What is 677 minutes after 4:28 AM? 3:45 PM How many minutes are there between 4:21 AM and 1:57 PM? 576 What is 332 minutes after 6:53 AM? 12:25 PM How many minutes are there between 10:34 PM and 11:18 PM? 44 What is 71 minutes before 5:16 PM? 4:05 PM How many minutes are there between 12:49 AM and 1:31 AM? 42 How many minutes are there between 4:19 AM and 1:14 PM? 535 What is 538 minutes after 3:31 AM? 12:29 PM What is 502 minutes after 11:27 AM? 7:49 PM How many minutes are there between 4:46 A	{ "pile_set_name": "DM Mathematics" }
1920n3z + 24nz Differentiate -2kq*3z - 2kq*2 - 1114kz2 - q3z*2 + 12617q*3z wrt k. -2q3z - 2q2 - 1114z*2 What is the second derivative of 31p*3 - 2p*2 - 299p wrt p? 186p - 4 Find the second derivative of 5lq2 + lqr2 + lqr + 2lr2 + 12q*2r2 + q2 - 45qr*2 wrt q. 10l + 24r2 + 2 Find the second derivative of -160lns*3 - lns2 + 133lns - ln + 2ls + 2ns wrt s. -960lns - 2ln Differentiate -5363ct*3 - 9t*3 + 75t*2 wrt c. -5363t3 Find the second derivative of b2dx*3 + 3b*2d + b*2x*2 - 3bd - 2b - 6dx*3 - 4dx2 wrt b. 2dx3 + 6d + 2x2 Find the second derivative of -161m*2 + 3m - 52. -322 Find the first derivative of -h4 - h3ty - 63hty + 2t - 445y wrt h. -4h*3 - 3h*2ty - 63ty Find the third derivative of 138g*4x*2 + 2g*3x*2 - 188g*2x*2 wrt g. 3312gx2 + 12x*2 What is the second derivative of -23r*5z - 2r3z*2 - rz - 4r - 8z*2 wrt r? -460r*3z - 12rz*2 What is the third derivative of 108l*3 - 9l*2 - 11? 648 What is the third derivative of 3l*6 + 25l*3 + 1735l*2 wrt l? 360l*3 + 150 What is the second derivative of 27320r*3 + 438r + 2 wrt r? 163920r What is the derivative of -8h*2lz2 + 14h*2lz - 7h*2l + 2h2 - 2z wrt z? -16h2lz + 14h*2l - 2 What is the derivative of -131y2 + 4y - 1081? -262y + 4 What is the second derivative of 388t*3 + 271t? 2328t Find the second derivative of -2v*4 - 181v*3 + 3v - 25 wrt v. -24v2 - 1086v Differentiate -650o3 + 987 wrt o. -1950o*2 What is the third derivative of -43lm2y + 4lmy4 + 45lmy + 9m2y*4 - 17y4 - y2 wrt y? 96lmy + 216m*2y - 408y What is the third derivative of -4rs3t*3 - 2rs3t*2 - 8rst*3 - 2s*3t*2 - 125st2 wrt t? -24rs3 - 48rs Find the first derivative of -9487d*2v + 21242v wrt d. -18974dv What is the first derivative of -dz*2 + 22dz + 2d - 2z3 - 8z*2 - 1221 wrt z? -2dz + 22d - 6z2 - 16z What is the first derivative of 1107z3 + 1798 wrt z? 3321z*2 Find the first derivative of -2k*2o*2 - 119k*2 + 2ko2 + 6o*2 wrt o. -4k*2o + 4ko + 12o What is the second derivative of 24c*4 - 41c*3 + 5799c wrt c? 288c2 - 246c What is the second derivative of f*4 - 1121f*3 - f - 500? 12f*2 - 6726f Find the second derivative of 1117h2r*2 - 11hr2 - 2hr + 37h wrt h. 2234r2 Differentiate -85t - 176 with respect to t. -85 What is the derivative of 312n2 + 440 wrt n? 624n What is the third derivative of -w*6 - 3w*5 - 463w*4 - 4753w*2? -120w*3 - 180w*2 - 11112w Differentiate 75ijn2r*2 - 2ijr - jn2r2 - n2r - 2nr2 - 29n with respect to i. 75jn*2r*2 - 2jr What is the second derivative of -2i*3w*2 - 3i*3w - 2i3 + 36iw2 wrt w? -4i*3 + 72i Find the third derivative of 6adm3 - ay - 2d2m*3y + d*2m + 34dmy2 - 2m*3y2 - m2 + m wrt m. 36ad - 12d2y - 12y2 Differentiate 2b*2s*2v - 64b2s2 + s2v + 3s*2 - 112v wrt v. 2b2s2 + s2 - 112 Differentiate -bx3 + 2bx2 - 50b + 335x3 + 3 wrt x. -3bx2 + 4bx + 1005x*2 Differentiate 7m*4u*2 - 88m*3u*2 - 4u*2 + 8u wrt m. 28m3u*2 - 264m*2u*2 Find the second derivative of -5h*5t - 5h3t - 3h2t + 4ht - 39h - 15 wrt h. -100h*3t - 30ht - 6t What is the third derivative of -323q4 - q2 + 31q? -7752q Find the third derivative of f*6 + 78f*5 + 25f*2 - 4 wrt f. 120f*3 + 4680f*2 What is the second derivative of -4i*5 + 602i*4 + 2686i - 3 wrt i? -80i3 + 7224i*2 Find the second derivative of 6jn2 + 2j + 15n - 1 wrt n. 12j Differentiate b*4x*2 - 3b*2k + 3b2x*3 - kx*3 + 8kx2 - 67x*3 wrt b. 4b*3x*2 - 6bk + 6bx3 Find the first derivative of 4y*4 + 198y + 4716. 16y3 + 198 Differentiate -4b*3m*2 - 62b*3 + 2bm3 + 31b - 45m wrt m. -8b*3m + 6bm*2 - 45 What is the second derivative of -156hs2w + hsw - 3hw*3 - 2hw2 + 2h - s*2w3 + s2w + 34w*2 wrt w? -18hw - 4h - 6s2w + 68 Find the third derivative of 365i6 + 898i*2 wrt i. 43800i*3 Differentiate -41q*4y*3 - 2q*2y*3 - 1213y*3 wrt q. -164q*3y*3 - 4qy3 Find the third derivative of -2h*3i*3 - 2h*3i2 - h3i + 8h*2i*3 + 4hi4 + 49hi2 wrt i. -12h*3 + 48h*2 + 96hi What is the third derivative of -266j*4mq + 3j*3m + j*3q*2 + 6j*2mq2 + j2 - 7jm wrt j? -6384jmq + 18m + 6q*2 What is the first derivative of -2g*3jp + 4g*3j - g*3p - 30g2jp + 2911g*2p wrt j? -2g3p + 4g3 - 30g*2p What is the second derivative of 5611d5 + 3d*2 + 3d + 2138? 112220d3 + 6 What is the second derivative of 188c*2r2 + c2r + 3cr2 + 695 wrt r? 376c*2 + 6c Find the third derivative of -63f5 + 2f*3 - 2f*2 + 151f. -3780f2 + 12 What is the second derivative of -546j*2 + 573j? -1092 What is the third derivative of 2c4w - 861c4 - 3c*2w - 2cw + 2537 wrt c? 48cw - 20664c What is the derivative of 1063h*2r + 1077h2 - 11hr wrt r? 1063h*2 - 11h What is the third derivative of 239f4 + 6f*2 + 4f? 5736f Differentiate -202jl4 + 264j + 9l4 + 7 wrt l. -808jl3 + 36l*3 What is the second derivative of -736r*2 - 2424r wrt r? -1472 Find the third derivative of -695q5 - 3q*4 + 8006q*2 wrt q. -41700q*2 - 72q Differentiate 2u4 - 4u*2 + u + 11103 with respect to u. 8u*3 - 8u + 1 What is the second derivative of 80n3 + 16n - 2 wrt n? 480n What is the derivative of -53h - 919 wrt h? -53 What is the second derivative of 385z5 - 236z + 1? 7700z3 Find the second derivative of 10929ku2 + ku + 6734k wrt u. 21858k What is the second derivative of -1056f4 + 2f*3 + 2f*2 + 145f - 1? -12672f2 + 12f + 4 Find the first derivative of -d*2 + 5d + 602. -2d + 5 Find the third derivative of -97w*4 - 4509w*2 wrt w. -2328w Find the second derivative of 10sy*4 - 2s + 14y5 + 161y wrt y. 120sy*2 + 280y*3 Find the second derivative of 28l*5 + 13l*4 + 3l*2 + 1745l - 1 wrt l. 560l3 + 156l*2 + 6 What is the third derivative of -5111a*3r*2 + 151a*2r*2 - 6a*2r wrt a? -30666r2 Find the second derivative of 105p*4 + 11p*3 - 14p + 33 wrt p. 1260p2 + 66p What is the derivative of -1916p3 - 2p + 314 wrt p? -5748p2 - 2 Find the first derivative of -116bq3 - 2bq2 + 1609b - 3q wrt q. -348bq2 - 4bq - 3 Find the third derivative of 303c*4m*2 - 5c*4 + 94c*2m*2 + cm*2 + 3 wrt c. 7272cm2 - 120c Find the first derivative of -141r2 - 7r - 7658. -282r - 7 Differentiate -i3 - 208i*2 - 481 wrt i. -3i*2 - 416i What is the third derivative of -105p3 + 150p*2 wrt p? -630 Find the third derivative of -250q*5 - 1031q*2 - 2 wrt q. -15000q*2 Find the third derivative of uv*4 - 7uv3 + 165uv2 - 33v*4 wrt v. 24uv - 42u - 792v Differentiate -b3u*4 - 14b*3u*3 - 3b*3 - 41 wrt u. -4b*3u*3 - 42b*3u*2 Differentiate -8q*2y*3 + 80q*2 wrt y. -24q*2y*2 Differentiate 5902o*3v + 6703o3 - 2v with respect to v. 5902o3 - 2 What is the second derivative of -1874p*3 - 556p wrt p? -11244p What is the derivative of 2z*4 + 13z*3 + 23z - 5673? 8z3 + 39z*2 + 23 Find the first derivative of 105c*4l - 24l - 3 wrt c. 420c*3l What is the first derivative of -6280z - 6425 wrt z? -6280 What is the first derivative of -10mn3 - 20m - 30n3 - 7n wrt m? -10n3 - 20 Find the second derivative of -6071mt3 + 2mt + 2m - t*2 - 3t + 38 wrt t. -36426mt - 2 Find the third derivative of 2j6 - 9j*3u*3 + 2j*3u - 19j2u*2 + 8ju3 wrt j. 240j*3 - 54u*3 + 12u Differentiate 102p3y + 37p3 with respect to y. 102p*3 What is the derivative of -27042u - 29923 wrt u? -27042 Differentiate -2058f3 + 3213 wrt f. -6174f*2 Differentiate 6d*2u - d*2 + 12du + 1696u with respect to d. 12du - 2d + 12u What is the first	{ "pile_set_name": "DM Mathematics" }
1463? 3, 19, 3359 List the prime factors of 4482162. 2, 3, 83003 List the prime factors of 2598286. 2, 1299143 List the prime factors of 759423. 3, 7, 29, 43 List the prime factors of 269395. 5, 7, 43, 179 List the prime factors of 10064662. 2, 23, 218797 List the prime factors of 5726570. 2, 5, 572657 List the prime factors of 406230. 2, 3, 5, 11, 1231 What are the prime factors of 452171? 452171 What are the prime factors of 499361? 499361 What are the prime factors of 264533? 113, 2341 List the prime factors of 254446. 2, 29, 41, 107 What are the prime factors of 644386? 2, 322193 What are the prime factors of 146508? 2, 3, 29, 421 List the prime factors of 3354660. 2, 3, 5, 18637 List the prime factors of 1226598. 2, 3, 89, 2297 List the prime factors of 313552. 2, 19597 What are the prime factors of 147792? 2, 3, 3079 List the prime factors of 594853. 7, 84979 List the prime factors of 1502899. 907, 1657 List the prime factors of 1220733. 3, 135637 What are the prime factors of 460528? 2, 107, 269 List the prime factors of 521913. 3, 7, 29, 857 List the prime factors of 212163. 3, 7, 10103 What are the prime factors of 17305070? 2, 5, 1730507 What are the prime factors of 8331804? 2, 3, 13, 19, 937 List the prime factors of 11428184. 2, 233, 6131 What are the prime factors of 494248? 2, 61781 List the prime factors of 1283560. 2, 5, 32089 What are the prime factors of 1434303? 3, 13, 23, 41 List the prime factors of 11149008. 2, 3, 13, 17, 1051 List the prime factors of 82393. 82393 What are the prime factors of 642407? 642407 List the prime factors of 3763243. 11, 29, 47, 251 List the prime factors of 2064449. 2064449 List the prime factors of 398666. 2, 53, 3761 List the prime factors of 1731149. 7, 223, 1109 What are the prime factors of 13021887? 3, 23, 41, 4603 List the prime factors of 423094. 2, 7, 47, 643 List the prime factors of 3528371. 7, 11, 45823 What are the prime factors of 8525402? 2, 4262701 What are the prime factors of 311247? 3, 34583 List the prime factors of 531619. 11, 31, 1559 What are the prime factors of 707661? 3, 61, 1289 What are the prime factors of 144301? 113, 1277 List the prime factors of 1020570. 2, 3, 5, 34019 What are the prime factors of 1740942? 2, 3, 7, 41, 337 What are the prime factors of 23346? 2, 3, 1297 What are the prime factors of 2021583? 3, 71, 9491 List the prime factors of 21549744. 2, 3, 17, 8803 What are the prime factors of 486851? 439, 1109 What are the prime factors of 428089? 19, 22531 List the prime factors of 1078969. 197, 5477 What are the prime factors of 193936? 2, 17, 23, 31 What are the prime factors of 17689932? 2, 3, 13, 37799 What are the prime factors of 1060383? 3, 37, 41, 233 What are the prime factors of 2803? 2803 What are the prime factors of 239794? 2, 47, 2551 What are the prime factors of 283320? 2, 3, 5, 787 What are the prime factors of 360472? 2, 7, 41, 157 What are the prime factors of 531972? 2, 3, 7, 2111 What are the prime factors of 2050888? 2, 7, 53, 691 List the prime factors of 4765163. 13, 23, 15937 List the prime factors of 1475214. 2, 3, 13, 18913 List the prime factors of 1097582. 2, 548791 What are the prime factors of 9467491? 11, 19, 97, 467 What are the prime factors of 14790386? 2, 13, 619, 919 List the prime factors of 277968. 2, 3, 5791 List the prime factors of 131253. 3, 67, 653 List the prime factors of 195693. 3, 37, 41, 43 What are the prime factors of 3088538? 2, 37, 41737 What are the prime factors of 201207? 3, 47, 1427 List the prime factors of 1365041. 37, 79, 467 List the prime factors of 1116464. 2, 69779 List the prime factors of 6350588. 2, 17, 61, 1531 What are the prime factors of 259387? 259387 List the prime factors of 4174677. 3, 13, 31, 1151 List the prime factors of 636330. 2, 3, 5, 21211 List the prime factors of 379735. 5, 173, 439 What are the prime factors of 26525113? 151, 175663 What are the prime factors of 62928? 2, 3, 19, 23 List the prime factors of 10360593. 3, 1151177 List the prime factors of 240936. 2, 3, 10039 List the prime factors of 1904197. 223, 8539 List the prime factors of 10283795. 5, 2056759 What are the prime factors of 139017? 3, 149, 311 List the prime factors of 19653775. 5, 786151 What are the prime factors of 32607? 3, 3623 List the prime factors of 422077. 422077 List the prime factors of 47496. 2, 3, 1979 List the prime factors of 351984. 2, 3, 7333 What are the prime factors of 10553080? 2, 5, 263827 List the prime factors of 147579. 3, 49193 List the prime factors of 3905003. 3905003 List the prime factors of 960061. 43, 83, 269 What are the prime factors of 24172? 2, 6043 What are the prime factors of 437438? 2, 218719 What are the prime factors of 15623580? 2, 3, 5, 7, 37199 List the prime factors of 8134760. 2, 5, 47, 4327 List the prime factors of 17659476. 2, 3, 490541 List the prime factors of 9184733. 19, 483407 What are the prime factors of 4929794? 2, 2464897 List the prime factors of 739695. 3, 5, 11, 4483 List the prime factors of 20133926. 2, 10066963 List the prime factors of 16428716. 2, 23, 283, 631 List the prime factors of 238679. 7, 4871 List the prime factors of 2188488. 2, 3, 67, 1361 List the prime factors of 30206731. 30206731 What are the prime factors of 84362? 2, 42181 List the prime factors of 9435829. 13, 71, 10223 What are the prime factors of 2739290? 2, 5, 273929 List the prime factors of 82684. 2, 7, 2953 What are the prime factors of 186666? 2, 3, 53, 587 What are the prime factors of 51142? 2, 7, 13, 281 List the prime factors of 211154. 2, 71, 1487 What are the prime factors of 11194815? 3, 5, 523, 1427 What are the prime factors of 15902? 2, 7951 What are the prime factors of 4894266? 2, 3, 13, 17, 3691 What are the prime factors of 39021906? 2, 3, 7, 11, 84463 List the prime factors of 1951966. 2, 293, 3331 List the prime factors of 211678. 2, 109, 971 List the prime factors of 105455. 5, 7, 23, 131 List the prime factors of 4028580. 2, 3, 5, 22381 What are the prime factors of 1452970? 2, 5, 31, 43, 109 What are the prime factors of 5750558? 2, 11, 261389 What are the prime factors of 8904600? 2, 3, 5, 17, 97 What are the prime factors of 748548? 2, 3, 29, 239 List the prime factors of 18082. 2, 9041 What are the prime factors of 5845? 5, 7, 167 List the prime factors of 8990276. 2, 2247569 List the prime factors of 1698669. 3, 7, 59, 457 What are the prime factors of 12410439? 3, 19, 217727 What are the prime factors of 2653206? 2, 3, 442201 What are the prime factors of 4921414? 2, 2460707 List the prime factors of 947392. 2, 113, 131 List the prime factors of 607534. 2, 303767 What are the prime factors of 26842267? 283, 94849 List the prime factors of 1742627. 337, 5171 List the prime factors of 2433499. 17, 43, 3329 List the prime factors of 15208000. 2, 5, 1901 What are the prime factors of 274556? 2, 68639 What are the prime factors of 469069? 469069 List the prime factors of 477866. 2, 337, 709 List the prime factors of 14700693. 3, 7, 467, 1499 What are the prime factors of 4712898? 2, 3, 785483 List the prime factors of 104574. 2, 3, 29, 601 List the prime factors of 229585. 5, 17, 37, 73 List the prime factors of 278080. 2, 5, 11, 79 List the prime factors of 8181397. 7, 1168771 What are the prime factors of 228965? 5, 11, 23, 181 What are the prime factors of 3844497? 3, 643, 1993 List the prime factors of 11991032. 2, 157, 9547 What are the prime factors of 11290981? 13, 868537 List the prime factors of 5421642. 2, 3, 903607 What are the prime factors of 9276290? 2, 5, 927629 What are the prime factors of 10332174? 2, 3, 1722029 What are the prime factors of 967529? 967529 List the prime factors of 1069288. 2, 11, 29, 419 What are the prime factors of 9190928? 2, 574433 What are the prime factors of 17892826? 2, 7, 29, 44071 What are the prime factors of 3850593? 3, 701, 1831 What are the prime factors of 11419939? 29, 37, 367 What are the prime factors of 1563664? 2, 97729 List the prime factors of 94735. 5, 18947 List the prime factors of 214583. 59, 3637 What are the prime factors of 142649? 13, 10973 List the prime factors of 1264087. 11, 31, 337 What are the prime factors of 594694? 2, 17, 17491 What are the prime factors of 225	{ "pile_set_name": "DM Mathematics" }
-48162389? 4 Calculate 42345687 divided by -10. -42345687/10 Calculate 76500 divided by -1700. -45 -46232 divided by 34 -23116/17 Divide -2802 by -7535. 2802/7535 Divide -44452 by -3223. 44452/3223 What is 8594151 divided by -3? -2864717 100 divided by 3645505 20/729101 -42388120 divided by -6 21194060/3 Divide 5230380 by 1743460. 3 What is -1607497 divided by -18? 1607497/18 47 divided by -2368427 -47/2368427 What is 1124401205 divided by -5? -224880241 -50 divided by -263984 25/131992 Calculate -23934273 divided by -16867. 1419 What is -184664 divided by -8? 23083 What is -30274056 divided by 13786? -2196 What is 16 divided by 665191? 16/665191 What is 902 divided by -10688? -451/5344 What is 35 divided by 17774? 35/17774 What is -21112020 divided by -4222404? 5 Calculate -226626500 divided by 11331325. -20 Divide -292919088 by -42526. 6888 Divide 21655 by 15455. 4331/3091 Calculate 11599 divided by 36756. 11599/36756 What is 5 divided by 623667? 5/623667 4428 divided by -6178 -2214/3089 What is 447 divided by -29048? -447/29048 Calculate 309 divided by -1831. -309/1831 -102819825 divided by -51 2016075 What is -60430944 divided by -6? 10071824 What is 277 divided by -320899? -277/320899 Calculate 1797653120 divided by -1. -1797653120 Divide -42 by 1442883. -14/480961 Divide 56437 by 6. 56437/6 Divide 16347590 by -8053. -2030 Calculate 2241764 divided by 59. 37996 Divide -5449210 by -16315. 334 Divide 9833 by -73617. -9833/73617 Divide -355414 by -916. 177707/458 Divide 246239370 by 13679965. 18 What is -1214480 divided by -10? 121448 What is -5668805 divided by -3? 5668805/3 -29966 divided by -26 14983/13 31837060 divided by -335 -95036 Calculate -4751960 divided by 593995. -8 5 divided by -538934 -5/538934 10161382 divided by 11 923762 What is -7003988 divided by -137? 51124 Divide -3 by 582289. -3/582289 1 divided by -71924126 -1/71924126 What is -4 divided by -406367? 4/406367 Calculate 17845155 divided by -3569031. -5 -543688 divided by -3 543688/3 Divide 1133 by -63886. -1133/63886 What is -35 divided by -9795039? 35/9795039 Divide -104836732 by 52366. -2002 Divide 79 by 68759. 79/68759 Divide 90706 by 1235. 4774/65 Divide -227255570 by 1177490. -193 Calculate 5414434 divided by -14957. -362 What is 3428900 divided by 170? 20170 Calculate 704215325 divided by -5. -140843065 Divide -10253188 by -5126594. 2 Calculate -13 divided by 86634750. -13/86634750 What is 2788 divided by 9692? 697/2423 Divide -294637666 by 698. -422117 152235400 divided by 5 30447080 Divide 160830840 by 10722056. 15 -342749900 divided by -71705 4780 Calculate -8 divided by 917550. -4/458775 Divide -10802427 by 3600809. -3 What is -1565586 divided by 99? -15814 -67647868 divided by -82 824974 Divide 6436297 by -919471. -7 What is 22111804 divided by 17732? 1247 6086094 divided by -434721 -14 What is -1 divided by 1632835? -1/1632835 -16679459 divided by -1 16679459 -2 divided by 100265303 -2/100265303 Calculate -4764951 divided by 9549. -499 What is -2 divided by 65129288? -1/32564644 Calculate -15422211 divided by -147. 104913 Divide 305371 by 40. 305371/40 What is -32342424 divided by 6? -5390404 Divide 13277284 by 15. 13277284/15 -356005 divided by 39 -27385/3 2128 divided by 4640 133/290 What is -184564170 divided by -9030? 20439 What is 67389 divided by 22? 67389/22 Divide -47 by -66392. 47/66392 Calculate -3728848 divided by -932212. 4 What is -68000352 divided by -4306? 15792 What is -2235747 divided by 3? -745249 18938990 divided by 3 18938990/3 What is -787115640 divided by 46300920? -17 1260 divided by -200 -63/10 -163798264 divided by 3451 -47464 What is -1240188 divided by 1240188? -1 -65 divided by 544391 -65/544391 -99907383 divided by -2125689 47 What is -1 divided by -33845? 1/33845 Divide 24649406 by 647. 38098 What is -23 divided by 419893? -23/419893 What is 129699320 divided by 29048? 4465 Calculate -1487331 divided by -531. 2801 Divide -13638717 by 6. -4546239/2 Calculate -51 divided by 51800. -51/51800 20049660 divided by 20049660 1 3221 divided by -561 -3221/561 Divide -138612655 by -27722531. 5 What is 14844366 divided by 291066? 51 What is -5914480 divided by -3146? 1880 Divide 212085 by -6. -70695/2 Calculate 331 divided by 29454. 331/29454 8972060 divided by -9385 -956 -26395764 divided by -33036 799 -13797189 divided by -53271 259 Divide 18 by 2711607. 6/903869 What is -398611 divided by 12? -398611/12 224 divided by 410195 224/410195 Divide -119 by 940560. -119/940560 What is 10109 divided by 3416? 10109/3416 Divide 17951895 by -112905. -159 8223072 divided by -1797 -4576 -55 divided by 264094 -55/264094 Divide -8027 by -6571. 8027/6571 -10739005 divided by -5 2147801 Calculate 5963 divided by 11340. 5963/11340 Calculate -71660373 divided by 1761. -40693 Divide 134 by -17202. -67/8601 What is -528420082 divided by -2615941? 202 Divide -41364323 by -961. 43043 Calculate 1275 divided by 289. 75/17 -7523944 divided by 794 -9476 Divide 148143920 by -10. -14814392 Divide -3134330 by 17. -3134330/17 Calculate -26891904 divided by 384. -70031 What is 871139 divided by 871139? 1 Divide 764610 by -11. -69510 Divide -448392024 by -49821336. 9 2403 divided by 8873 2403/8873 Divide -641270 by -165. 128254/33 What is -175658784 divided by -112? 1568382 Calculate -4 divided by -3628080. 1/907020 Divide 10295360 by 1. 10295360 What is 71287832 divided by -7? -10183976 Calculate 0 divided by -4563399. 0 229083174 divided by 69 3320046 Divide -31895800 by -2. 15947900 Divide 5035874 by 19. 265046 What is -5 divided by -13460425? 1/2692085 Calculate 677160 divided by -2090. -324 -31626944 divided by -7906736 4 Calculate -161520 divided by -1744. 10095/109 Calculate 52277508 divided by 54. 968102 Divide 238 by -117677. -34/16811 Calculate -16 divided by 2320513. -16/2320513 -484 divided by -96662 242/48331 Calculate -49102800 divided by -200. 245514 1917084170 divided by 223 8596790 Divide 1519 by 24864. 217/3552 What is 18 divided by 1219? 18/1219 Divide 84840584 by 10207. 8312 Calculate -156894 divided by 2496. -26149/416 What is -9 divided by 3956388? -3/1318796 -1143 divided by -903 381/301 Divide -2683136 by 4. -670784 Divide -1325 by -1541. 1325/1541 Divide 44566 by -2972. -22283/1486 Divide -33355566 by 3503. -9522 Calculate -321829 divided by 321829. -1 -57135850 divided by -2285434 25 Divide -4480426 by 194. -2240213/97 What is -49 divided by 192148? -49/192148 What is 40351458 divided by -42? -960749 What is 40059532 divided by -326? -122882 Divide -3169768 by -19688. 161 Calculate -2906746 divided by 542. -5363 Divide 4138903 by -31. -133513 Calculate 7066 divided by 14310. 3533/7155 Calculate 402852 divided by -59. -6828 11978660 divided by -1 -11978660 Divide 11311655 by -2262331. -5 Calculate 0 divided by -9944516. 0 Divide -4514244 by 1128561. -4 107955 divided by 90 2399/2 Calculate -15591213 divided by -309. 50457 Calculate -148170558 divided by 2389. -62022 -297501919 divided by -13 22884763 What is 14923580 divided by 740? 20167 -707256 divided by 8037 -88 Divide -17439280 by 1. -17439280 What is 0 divided by 1566521? 0 Calculate -8701827 divided by -100021. 87 Calculate 87 divided by 1317466. 87/1317466 Divide 3674853 by -406. -524979/58 -3 divided by 243500 -3/243500 Divide -602984718 by 86140674. -7 What is 22 divided by -69217? -22/69217 Divide 854 by -7861. -122/1123 What is -1514 divided by -31737? 1514/31737 -3269 divided by 2955 -3269/2955 What is -97767986 divided by -19499? 5014 Calculate -5 divided by 3417818. -5/3417818 Calculate 123768120 divided by 85064. 1455 Divide -1980447 by 2. -1980447/2 Divide 3429 by -247. -3429/247 Calculate 245441 divided by 20. 245441/20 -554699420 divided by -110939884 5 Divide -169471011 by -3. 56490337 What is -10 divided by 764308? -5/382154 What is -10363 divided by -1165? 10363/1165 What is -3 divided by -1566489? 1/522163 219161 divided by 140 219161/140 What is 4 divided by 88861? 4/88861 Calculate -34048 divided by -394. 17024/197 What is 116937716 divided by -371? -315196 1757 divided by 327334 251/46762 Divide -56849197 by 17. -56849197/17 Calculate 10920 divided by -2730. -4 -18827030 divided by -10 1882703 Calculate -286 divided by 158681. -286/158681 23978 divided by -60 -11989	{ "pile_set_name": "DM Mathematics" }
px2 - 3x. -(x + 1)*2(4x + 1)/2 Let u(v) be the third derivative of -v8/12600 + v7/3780 - v6/5400 - v4/8 + 3v*2. Let a(o) be the second derivative of u(o). Factor a(l). -2l(l - 1)(4l - 1)/15 Let i(c) be the first derivative of -16 - 17/19c*2 - 10/57c*3 - 12/19c. Factor i(z). -2(z + 3)(5z + 2)/19 Let i(j) be the second derivative of 14j*6/75 - 53j*5/100 + 11j4/30 + j3/10 - 586j. What is z in i(z) = 0? -3/28, 0, 1 Suppose 4i + 230 = 3k, 304 = 4k - 5i + i. Solve 5z - z - 4z3 - 94 + 20z2 + k = 0. -1, 1, 5 Let u(n) be the second derivative of n5 + 0 + 5/42n7 - 2/3n*6 + 5n*2 - 25/6n*3 + 2n + 5/6n4. Factor u(g). 5(g - 2)(g - 1)3(g + 1) Let u(n) be the first derivative of 5n3/3 + 465n*2 + 43245n + 683. Find b, given that u(b) = 0. -93 Factor 2/17o3 + 0 + 16/17o + 2/17o4 - 20/17o*2. 2o(o - 2)(o - 1)(o + 4)/17 Let i(g) = -g2 - 14g + 12. Let k(t) be the second derivative of -t*4/12 + 2t. Let p(n) = 2i(n) - 6k(n). Factor p(q). 4(q - 6)(q - 1) Let v = -94 - -62. Let h be ((-9)/(-12))/(44/v + 4). Determine w, given that 2/7w - 2/7w*3 - 2/7w*2 + h = 0. -1, 1 Suppose 4g - 16 + 8 = 2k, -5g = -5k - 20. Suppose -2 - 13 = -5m. Solve 2/3qm + gq*2 + 0 - 2/3q = 0 for q. -1, 0, 1 Let l(v) be the third derivative of -v*6/720 - 31v*5/360 - 35v*4/18 - 49v3/3 - v2 + 44. Factor l(r). -(r + 3)(r + 14)2/6 Find q such that 7/6 + 4/3q + 1/6q2 = 0. -7, -1 Let v = 18 - 18. Let b be v/((-12)/(-4)) - -3. Suppose -5y + by - 3y*2 + 2y + 3y = 0. Calculate y. 0, 1 Factor 10/3d - 1/3d2 + 11/3. -(d - 11)(d + 1)/3 Let r = 9381 + -37523/4. Factor rf2 + f + 1. (f + 2)2/4 Let k = 22 + -21. Factor -15a + 2a2 - a2 + a3 + 14a - k. (a - 1)(a + 1)2 Let b(t) be the third derivative of t8/7560 - t7/3780 - t6/810 - t3 + 13t*2. Let x(k) be the first derivative of b(k). Find u such that x(u) = 0. -1, 0, 2 Let h(o) = -5o*4 - 5o*3 - 2o2 + 12. Let j(p) = -p4 + p*2 - p + 1. Let y(a) = -h(a) + 4j(a). What is z in y(z) = 0? -2, 1 Let c(d) = -4d4 - 12d*3 - 20d*2 + 4d - 8. Let y(v) be the first derivative of v3/3 - v2/2 + v + 1. Let n(l) = c(l) + 8y(l). Factor n(w). -4w(w + 1)3 Let o(f) be the second derivative of 11/2f*5 - 4f*6 + 5/6f*3 + 9f + 15/14f7 - 10/3f*4 + 0 + 0f*2. Determine d, given that o(d) = 0. 0, 1/3, 1 Let u(p) be the first derivative of -32/15p*3 + 20 - 4/5p*4 - 2/25p*5 + 0p + 0p2. Factor u(i). -2i*2(i + 4)2/5 Let l(q) be the first derivative of -q6/40 - q5/20 + q4/8 + q*3/2 + 27q*2/2 - 29. Let i(p) be the second derivative of l(p). Factor i(b). -3(b - 1)(b + 1)2 Solve -155b + 19b - 4206b*3 + 4210b*3 - 16b - 148b2 = 0. -1, 0, 38 Let n be (-1)/2 - (-385)/630. Let i(p) be the third derivative of 1/360p*5 + 0 - 5/144p*4 - 3p*2 + np*3 + 0p. Factor i(d). (d - 4)(d - 1)/6 Factor 38g + 6 + 110/3g2 - 242/3g*3. -2(g - 1)(11g + 3)*2/3 Let t(c) be the third derivative of 0c*3 - 1/12c*4 + 0 + 0c + 1/15c6 + 1/60c5 - c2 + 1/42c7. Let t(g) = 0. Calculate g. -1, 0, 2/5 Let o = -66 - -168. Let a be (o/(-136))/(6/8 - 1). Factor 0p*2 - 6/5p*4 + 0 + 0p - 4/5pa - 2/5p*5. -2p*3(p + 1)(p + 2)/5 Suppose -2r - 5i = 3r - 15, 4r + i - 15 = 0. Let o(k) be the first derivative of 0k + r + 2/27k3 + 1/9k*2. Factor o(l). 2l(l + 1)/9 Suppose -36 = 5u - 2q, 4u + u + 27 = -q. Let r(l) = 2l4 + 10l*3 - 6l*2. Let g(z) = 3z*4 + 11z*3 - 7z*2. Let c(a) = ug(a) + 7r(a). Factor c(n). -4n*3(n - 1) Let d(j) be the first derivative of j*3 - 21j*2 - 15. Factor d(k). 3k(k - 14) Let r(k) = -1. Let t(s) = -s2 + s - 1. Let n(w) = -w2 - w + 5. Let c be n(-3). Let u(b) = cr(b) + t(b). Find x such that u(x) = 0. 0, 1 Suppose 10n - 27 - 13 = 0. Let 5f*2 - 2f*2 + 6f*4 + 7f*4 - 16fn = 0. Calculate f. -1, 0, 1 Let l(t) be the first derivative of t5/20 - 9t4/16 + 29t*3/12 - 39t*2/8 + 9t/2 - 84. Let l(b) = 0. What is b? 1, 2, 3 Suppose 476 - 3x2 - x2 + 2494x - 2966x = 0. What is x? -119, 1 Let p be (-154)/56 + (0 - -2) + 1. Let b = 3/62 - -25/124. Suppose -pj*3 + 0 + 0j - bj2 = 0. What is j? -1, 0 Let s(k) be the third derivative of 0k - 1/105k5 - 4/21k*3 + 1/14k*4 + 0 + 10k*2. What is g in s(g) = 0? 1, 2 Let l(b) = 3b*2 + 15b - 54. Let t(f) = f - 3. Let z(q) = -l(q) + 18t(q). Factor z(m). -3m(m - 1) Let f(c) be the second derivative of c5/50 + 7c*4/30 - 7c*3/5 - 27c2/5 - c - 14. Suppose f(d) = 0. What is d? -9, -1, 3 Let m(c) be the second derivative of c4/15 + 26c3/15 + 24c*2/5 + 2c - 30. Determine h so that m(h) = 0. -12, -1 Let c(v) be the third derivative of v*6/30 + 22v*5/15 + 16v*4 - 192v*3 - 184v*2 + v. Factor c(p). 4(p - 2)(p + 12)2 Let o(z) be the third derivative of -1/300z5 + z2 + 0z + 0 + 0z*3 + 1/120z*4. Factor o(l). -l(l - 1)/5 Suppose -198 = -x - 2p, x - 3x = 2p - 400. Let q = 1014/5 - x. Factor 0 + 2/5i*2 + 2/5i*4 + qi*3 + 0i. 2i2(i + 1)*2/5 Let a(q) be the third derivative of 1/20q*5 - 16q*2 - 19/1080q*6 + 0q - 1/27q4 - 2/27q*3 + 2/945q7 + 0. Factor a(l). (l - 2)2(l - 1)(4l + 1)/9 Let m = 41 - 39. Suppose -29s - 5 - s*m + 20s + 15s = 0. Calculate s. 1, 5 Let x(b) be the second derivative of -b5/160 - 67b*4/96 - 3b + 22. Factor x(s). -s*2(s + 67)/8 Let w(v) be the second derivative of -3v5/10 - 3v*4 - 5v*3/3 - 20v. Let h(n) = n3 + n2. Let u(g) = 2h(g) - 2w(g). What is s in u(s) = 0? -5, -2/7, 0 Let t be ((-483)/((-28)/(-4)))/(6/4). Let o = t + 48. Factor 2/9f3 - 2/9f + 2/9f4 + 0 - 2/9f*o. 2f(f - 1)(f + 1)2/9 Let k(x) be the second derivative of x8/3360 - x7/2520 - x6/2160 + x*3 - 14x. Let c(j) be the second derivative of k(j). Determine y so that c(y) = 0. -1/3, 0, 1 Let c = -315 - -318. Let b(x) be the second derivative of 4x - 1/2x*2 - 1/4x*c + 5/24x*4 + 0. Factor b(j). (j - 1)(5j + 2)/2 Let x be 5/10(1 + 1). Factor -25i + i2 + x + 16i + 11i. (i + 1)2 Let d(p) = -28p*2 + 43p - 2. Let m(t) = 9t2 - 14t. Let j(a) = 6d(a) + 21m(a). Determine z, given that j(z) = 0. -2/7, 2 Let m be (-4)/22(-21 + 49). Let c = -359/77 - m. Determine u so that 6/7 + 6/7u*4 - 6/7u*3 + cu*5 + 3/7u - 12/7u2 = 0. -2, -1, 1 Let v(a) be the first derivative of a5/15 + 9a*4/4 + 56a*3/3 - 98a2/3 + 146. Let v(x) = 0. Calculate x. -14, 0, 1 Let p(n) be the second derivative of -n7/105 + n*6/75 + 17n*5/50 - 17n*4/30 - 16n*3/15 + 16n*2/5 + n + 46. What is f in p(f) = 0? -4, -1, 1, 4 Let n be (-936)/(-1092) + 9/(-35). Suppose 0 - 3/5q*2 + nq*4 + 6/5q - 6/5q3 = 0. Calculate q. -1, 0, 1, 2 Suppose -185f + 190f - 30 = 4g, 0 = -3f + 3g + 21. Find w, given that 0 + 1/2w + 0w*f - 1/2w3 = 0. -1, 0, 1 Let y(j) be the third derivative of -j6/60 - j5/30 + j4/12 + j*3/3 + 33j*2. Factor y(l). -2(l - 1)(l + 1)2 Let i = -61 - -82. Suppose -5r + 4 = -i. Factor 3/4o3 - 3/4o*4 + 0 - 1/4o*2 + 1/4o*r + 0o. o*2(o - 1)*3/4 Factor 20/7i - 2/7i2 - 2/7i*3 - 16/7. -2(i - 2)(i - 1)(i + 4)/7 Let y = 27 - 23. Suppose 2o + y - 6 = 4g, -3o - 5g = -14. Find l, given that 2l3 - ol*3 - 2l*5 + 5l*4 + 0l*3 - 2l*4 = 0. 0, 1/2, 1 Factor -2/3j*3 - 14/9j*2 + 4j - 16/9. -2(j - 1)(j + 4)(3j - 2)/9 Suppose -60 = -13w - 7w. Let 1/2kw - 5/6k*4 + 0k + 1/3k2 + 0 = 0. Calculate k. -2/5, 0, 1 Let h(f) = -63f*3 + 151f*2 - 92f + 25. Let v(j) = -42j3 + 101j*2 - 61j + 17. Suppose 0 = 3y - 2 - 19. Let u(m) = yv(m) - 5h(m). Factor u(n). 3(n - 1)*2(7n - 2) Let b(z) be the second derivative of z9/10080 + z8/448 + 5z*7/336 + 5z*4/3 - 14z. Let f(g) be the third derivative of b(g). Factor f(x). 3x2(x + 5)2/2 Factor j5 - 11j2 + 67j*4 + 24j - 34j4 + 20 - 3j*3 - 30j*4 - 10j3. (j - 2)2(j + 1)2(j + 5) Let l(b) = b*2 - 7b + 9. Let u(f) = f*2 - 7f + 8. Suppose -16m - 12 = -12m. Let v(g) = mu(g) + 2l(g). What is p in v(p) = 0? 1, 6 Let b(m) = 2m4 - 4m*3 - 9m2 + m + 24. Let k(y) = -y4 + 2y3 + 5y**2 -	{ "pile_set_name": "DM Mathematics" }
2 - 9s + 5. Let r = 509 - 507. Let n(m) = m*2 - 4m + 2. Calculate rt(v) - 5n(v). -3v2 + 2v Let v(p) = 12p3 - 8p*2 + 17p + 14. Let b(c) = -4c3 + 3c*2 - 6c - 5. Determine 8b(d) + 3v(d). 4d3 + 3d + 2 Let n(i) = 5i2 + 4i. Let d(q) = -5q2 - 5q. Calculate -6d(p) - 5n(p). 5p2 + 10p Let t(g) = 3g2 + g - 3. Let s be t(-3). Let y(h) = 2h - 12 + 40 - s. Let m(w) = -3w - 11. Calculate -5m(z) - 8y(z). -z - 1 Let n(i) = -7i*2 - 5i - 74. Let j(t) = -13t2 - 9t - 143. Give -6j(d) + 11n(d). d*2 - d + 44 Let b(p) = -4p*2 + 3p - 2. Let j(n) = 6n2 - 3n + 1. Give -4b(i) - 3j(i). -2i2 - 3i + 5 Let h(k) = -10k - 5. Let s(b) = -8b - 5. Let z(c) = 2h(c) - 3s(c). Let q(a) = 5a + 5. Calculate 2q(r) - 3z(r). -2r - 5 Let x(d) be the first derivative of -d4/4 - d3/3 + d*2/2 + d - 70. Let m(j) = -3j*3 - 9j*2 + 9j + 9. Give -4m(k) + 36x(k). -24k3 Suppose -f + 3f + 3s - 5 = 0, -5s + 20 = f. Let g(u) = 5u + 4. Let v = -247 + 244. Let r(l) = -9l - 7. Determine fg(c) + vr(c). 2c + 1 Let g(h) = 2h*3 + 3h*2. Let f(a) = -a. Calculate -5f(b) + g(b). 2b3 + 3b*2 + 5b Let n(q) = q2 + 9. Let l(r) be the second derivative of r2 + 4r - 4. Calculate 18l(a) - 4n(a). -4a*2 Let p(x) = x + 57. Let z(u) = u + 1. Determine p(j) - 2z(j). -j + 55 Let g(b) = 2b2 + 6b2 + b2 + 17b3 - 9b. Let p(d) = 4d3 + 2d*2 - 2d. Let s be (-90)/4(-307 + 313)/(30/(-4)). Determine sp(a) - 4g(a). 4a*3 Let d(g) = -7g*2 + 2g. Suppose 0 = -0b - 2b + 6, 3b = 4a - 83. Let i = a - 17. Let f(k) = 4k2 - k. What is id(c) + 11f(c)? 2c*2 + c Let b be (-3)/(-21) + (-1065)/105. Let t(g) = -18g - 10. Let h(j) = 6j + 3. What is bh(i) - 3t(i)? -6i Let r(h) = 61h - 1215. Let a be r(20). Let p(t) = -2 - 2 + 2. Let w(k) = -k + 5. Give ap(x) + 2w(x). -2x Let j(m) = -4m2 - 2. Let x(a) = -6a*3 + 2a*2 + 2a - 4. Let w be x(2). Let o = 39 + w. Let d(n) = n*2 + n. Give oj(h) - 3d(h). h2 - 3h + 2 Let k(h) = -6h2 - 5h. Let a(t) be the first derivative of 5t3/3 + 2t*2 + 1201. Suppose r - 20 = 5r. Calculate ra(q) - 4k(q). -q*2 Suppose -q = 16 + 17. Let i(m) be the first derivative of -3m*2/2 - 119. Let r(b) = -16b. Determine qi(y) + 6r(y). 3y Suppose -20 = -n - 14. Let i(k) = 7k*2 + 6k - 5. Let x(j) = -j + 1. What is nx(m) + i(m)? 7m*2 + 1 Let z(t) = 4t*3 + 3 - 6t - 909t2 + 912t*2 + 8 - t. Let r(b) = 2b3 + b2 - 4b + 6. What is -11r(m) + 6z(m)? 2m*3 + 7m*2 + 2m Let x(k) = -8. Let s(p) = 15. Let m(v) = 3s(v) + 5x(v). Let w(f) = f - 9. Determine -5m(z) - 3w(z). -3z + 2 Let o(b) = -6b + 103. Let u be o(16). Let k(v) = -5v3 + 6v - 5. Let l(n) = -6n3 + 7n - 5. Calculate uk(h) - 6l(h). h*3 - 5 Let r(k) = 886k + 59. Let c(n) = -177n - 11. Determine 11c(j) + 2r(j). -175j - 3 Let x(d) = 2. Let l(n) = n*2 + 1. Let q(f) = -2l(f) + 3x(f). Let w(s) = s - 1. Suppose 12 = 3j + 9. Let c be (1/2)/(4/16). Give cw(h) + jq(h). -2h2 + 2h + 2 Let b(q) = 13q3 + 7q*2 + 6q + 1. Let g(a) = 13a3 + 6a*2 + 4a. What is 2b(o) - 3g(o)? -13o3 - 4o*2 + 2 Let b(r) = 9r*3 - 2r*2 + 2r - 2. Let a(j) = 117j3 - 27j*2 + 27j - 27. Suppose 0 = -t - 5q - 23, -3t - 3q - 9 = -0t. What is ta(g) - 27b(g)? -9g3 Let t = -320 - -299. Let a(v) = 14v + 21. Let h(q) = -3q - 4. Determine th(f) - 4a(f). 7f Let g(j) = -441j3 + 6j*2 + 6j + 12. Let m(s) = -46746s3 + 637s*2 + 637s + 1274. Determine 637g(t) - 6m(t). -441t3 Let o = -19 - -14. Let f be o/20 + 10/8. Let d(r) = -f + 4r + 0r - 5r. Let h(j) = j + 2. Calculate -4d(a) - 2h(a). 2a Let w(s) = 2s*3 + 9s*2. Suppose 4v - 9 = 7. Let p = 18 + -15. Suppose py + 12 = 0, 0u + 5y - 7 = 3u. Let o(b) = b*3 + 4b*2. What is uo(j) + vw(j)? -j3 Let d(f) = 3f - 4. Suppose z = 5x + 17, 5x = -z - 17 - 6. Let i(c) = -c - 1. Give xi(r) + d(r). 7r Let d(j) = 2j - 2. Let n(k) = 3111k - 2562. Give -2562d(z) + 2n(z). 1098z Let w(p) = -11p + p*2 + 14p - 4p. Let u(j) = -2j*2 + 2. Calculate u(o) - 2w(o). -4o2 + 2o + 2 Let a = 68 - 28. Suppose -2p - a + 58 = 0. Let x(k) = k2 - 1. Let t(w) = -6w*2 + 9. Give px(n) + t(n). 3n2 Let b(o) = -13o*2 - 13o + 16. Let y(x) = 1905 + 9x + 0x*2 - 1916 + 9x*2. Give -5b(l) - 7y(l). 2l*2 + 2l - 3 Let d(b) = 2b3 - 3b*2 - 5b - 8. Suppose 0 = -56c - 154 + 434. Let j(q) = q2 + q + 1. What is cj(m) + d(m)? 2m3 + 2m*2 - 3 Let s(r) = -49r - 13. Let q(l) = -38l - 12. Calculate 4q(w) - 3s(w). -5w - 9 Let q(y) = 4y2 + 11y*3 - 10y*3 - y + 1 - 3y*2 - 2. Let w(x) = 43 - 19 + 4x*3 + 5x*2 - 5x - 28. Suppose 0s = -5s - 10. What is sw(f) + 10q(f)? 2f3 - 2 Let y(g) = 10g*3 - 3g*2 - 3g. Let o(i) = -20i3 + 5i*2 + 5i. Suppose 4c - 30 = -10, 0 = 2x - 2c. Give xy(b) + 3o(b). -10b*3 Let k = 1 + 1. Let c(r) = -2r + 4. Let u be c(k). Let q(x) = 5x + 2 + ux - 5x + 7x. Let h(y) = -y. Calculate 5h(p) + q(p). 2p + 2 Let c(n) = 7n3 + n2 - 4n + 5. Let f(w) be the third derivative of -w6/30 - w5/60 + w4/12 - w3/2 + w*2 - 21w. What is -3c(u) - 5f(u)? -u*3 + 2u*2 + 2u Let c = 5 - -1. Suppose 24 = cs - 2s. Let n(j) be the second derivative of 2j3/3 - 5j*2/2 + 2j. Let q(l) = l - 1. What is sq(a) - n(a)? 2a - 1 Let x(t) = 1252t + 3t*3 - 2513t + 1252t - 9. Let i(n) = -n3 + 4n + 4. Let b(s) = 2s2 + 7s + 5. Let y be b(-4). Determine yi(l) + 4x(l). 3l3 Let m(s) = -s3 - 2s*2 - 2s. Let h(g) be the third derivative of -g*4/24 + 4g*2. Let f be h(2). Let b(n) = 3n*2 + 3n. Calculate fb(x) - 3m(x). 3x3 Suppose 3i - 8 = -7s + 8s, 0 = -4s + 5i - 4. Let t(c) = 2c. Let b(m) be the second derivative of m3/3 - m. What is sb(h) - 3t(h)? 2h Let t(d) = 46d3 - 19d*2 - 37. Let o(b) = 10b*3 - 5b*2 - 9. Let a(r) = 9o(r) - 2t(r). Let m(p) = -3p*3 - 13p*2 - 13. Calculate -11a(f) + 6m(f). 4f3 - f2 - 1 Let v = -28 - -33. Suppose 0 = -2w + 8, g + vw = 8 + 6. Let r(c) = 14c - 17. Let q(u) = -5u + 6. Give gr(b) - 17q(b). b Let b(c) = -6c3 - 13c2 - 6. Let m(o) = o3 + o*2. What is b(x) + 5m(x)? -x*3 - 8x*2 - 6 Suppose 0 = 4b - 5n - 32, 0n = -2b - n + 30. Let d(z) = -2z3 - z2 + 6z - 7. Let h(q) = -4q*3 - 3q*2 + 13q - 15. Give bd(t) - 6h(t). -2t3 + 5t*2 - 1 Let r = -22 + 23. Let p be ((-4)/(-16)-2)/r2. Let j(a) = a + 1. Let q(c) = 6c - 8 + 2c2 - 14c - 3c2. Give pq(v) - 6j(v). v2 + 2v + 2 Let h(s) = 3s - 1. Let q(n) = -7n + 2. Suppose x + 2v - 7 = 0, 0v - 19 = -4x - 5v. Let w be (-5)/50-54. Suppose 5 = -wj + x. What is jq(f) - 5h(f)? -f + 1 Let b(t) = -5t*2 + 6t - 4. Let g(v) = 2v2 - 3v - 1. What is -b(y) - 2g(y)? y2 + 6 Let b(t) = t + 1. Let x(n) = 5n + 3. Let i be 23 - -4(-2 + (-5)/(-4)). Suppose 2q = -4s - 0s - i, q = -s - 6. Calculate qx(h) + 9b(h). -h + 3 Let f(r) be the third derivative of 2r5/15 - 11r4/24 - r3/3 - 155r2. Let i(y) = -3y*2 + 4y + 1. What is 4f(s) + 11i(s)? -s*2 + 3 Let k(n) = -n + 3. Let m(y) = -y + 1. Let c be 2(-1)/(3/6-1). Suppose ci + 9 - 4 = f, -3i - 6 = -3f. Give ik(g) + 2m(g). -g - 1 Let w(x) = 26x2 + 1 + 5x - 5 - 17x2 - 1 - 7x2. Let z(s) = s2 + 3s - 3. Calculate -3w(l) + 5z(l). -l2 Let d(l) = l + 1. Let q(b) = -14b + 70. What is -12d(k) - q(k)? 2k - 82 Let w(h) = -2h + 51. Let d(t) = 3t - 53. What is -4d(m) - 5w(m)? -2m - 43 Let j(t) = -t2 + 2t - 1. Let b(s) = -36s2 + 24s - 9. Calculate b(x) - 9j(x). -27x*2 + 6x Let o(q) = -1. Let i(n) = 17n - 12. What is -i(m) - 6o(m)? -17m + 18 Let v(x) = -5x*2 + 5x - 6. Let i(o) = -4o2 + 6o - 7. Give -3i(c) + 4v(c). -8c2 + 2c - 3 Let k(d) = -6d. Let z(o) = -441o + 213o + 1 - 1 + 216o. Calculate -5k(b) + 3z(b). -6b Let z(t) = 13t*2 - 5. Suppose -7 = 3p - 1. Let s be 2/(-3)(4 - p). Let w be s/14 - (-122)/(-14). Let i(d) = 3d*2 - 1. Calculate wi(v) + 2z(v). -v2 - 1 Let m be ((-2)/(-5))/((-3)/(-15)). Let w(v) = -8v*2 + 2v - 2. Let j(p) = -41p2 + 11p - 11. Suppose 0 = 6i + 1205 - 1139. Give iw(o) + mj(o). 6o*2 Let v(s) = 16s.	{ "pile_set_name": "DM Mathematics" }
ppose -44308 = -90f + 86012. What is the remainder when f is divided by 28? 20 Calculate the remainder when 1 + -18(-78)/12 is divided by 7. 6 Suppose 0 = 12l - 6l - 780. Let o = -136 + l. What is the remainder when 82 is divided by (o/(-18) - 40/(-6)) + 0? 5 Let d(q) = 3q2 - 412q + 2934. What is the remainder when 245 is divided by d(7)? 48 Let k(v) = v*3 + 146v*2 + 1233v + 208. Let w(p) = -7p - 5. Calculate the remainder when k(-137) is divided by w(-6). 23 Suppose -2r - 2k = 3r + 395, -5r = -4k + 425. Let a = r - -79. What is the remainder when (-50 + -3)/((3 + a)/(-1)) is divided by 14? 11 Let b(g) = 2g2 + 7g - 8. Suppose 8h - 3h - 24 = -p, 0 = -4h - 5p + 36. Suppose hy - 29 = 19. What is the remainder when b(3) is divided by y? 7 Suppose -16 = -5c - 2j + 76, 0 = 3j + 12. What is the remainder when c is divided by 3/2 - 4807/(-874)? 6 Suppose -9z = 6z + 529 - 1669. Calculate the remainder when 1055 is divided by z. 67 Suppose 0 = 3h + 2u - 63, 9h + 2u = 5h + 86. What is the remainder when 193 is divided by h? 9 Let s = -3975 + 4194. What is the remainder when s is divided by 44? 43 Suppose 22800 = -61k + 175k. Calculate the remainder when 3998 is divided by k. 198 Suppose -55h + 51h - 600 = 0. Let c = h + 399. Calculate the remainder when c is divided by 86. 77 Calculate the remainder when 1896 is divided by ((-275680)/96488)/(4/63/(-7)). 6 Suppose 20a - 42a + 17534 = 0. Suppose -791t - 228 = -at. Calculate the remainder when t is divided by 23. 15 Let d be (-2)/(-3) + (-48824)/(-204). Let i = d - -84. What is the remainder when i is divided by 13? 12 Let b(p) = -p*2 - 9p + 51. Suppose 0 = 46r - 39r - 154. What is the remainder when b(-10) is divided by r? 19 Suppose -3p = 5q - 15, -2q - 2 + 8 = -3p. Let j be 2/(q/((-24)/(-4))). Suppose -3t + jt = 14. What is the remainder when t is divided by 8? 6 Suppose -6 = 7w - 34. Suppose 2y - w = -2r, 0y + 3y + 4r - 9 = 0. Let x = y + 58. What is the remainder when x is divided by 15? 12 Let g be 6/39 - -66618/156. Suppose 0 = -2q + g + 145. What is the remainder when q is divided by 7? 6 Suppose 111q = 110q + 8. Suppose -5m - 63 = -qm. Let v(u) = 10u2 - 3u. Calculate the remainder when v(2) is divided by m. 13 Suppose 66j = 35j + 50j - 3116. Calculate the remainder when 5081 is divided by j. 161 Suppose 7j + t = 8j - 76, 3t = 9. Calculate the remainder when 386 + -4((-65)/10 + 5) is divided by j. 76 Suppose -126n + 9332 + 222920 = -21260. What is the remainder when n is divided by 59? 6 Let g = -146 + 208. Calculate the remainder when g is divided by 17. 11 Let m(l) = l*3 - 13l*2 - 200l - 10. What is the remainder when 3691 is divided by m(-9)? 3 Suppose 5k - 5p + 100 = 0, -p - 12 = k + 16. Let z be (-3(-28)/k)/((-2)/12). Let f = 15 + z. What is the remainder when 251 is divided by f? 35 Let y(u) = -u3 + u2 - 16u - 8. Let v(z) = 7z + 4. Let f(r) = -5v(r) - 2y(r). Let j be 5 - (18/3)/3. What is the remainder when f(j) is divided by 9? 5 Suppose 0 = -2r + r + 20r - 342. Calculate the remainder when 28780 is divided by r. 16 Let h = 29 + -1. Suppose 0 = -5v + 114 + 221. Suppose 0 = b - 3x - v, 4x - 430 = -7b + 2b. Calculate the remainder when b is divided by h. 26 Calculate the remainder when 12744/(7 + 11) + 21 is divided by 153. 117 Let j(r) = 4r2 - 5r - 6. Let g be j(-1). Suppose 0 = -4l - gn + 163, 0 = -3l + 3n + 48 + 48. Calculate the remainder when l is divided by 20. 17 Let y = -2084 + 2208. Calculate the remainder when y is divided by 114/5 - (-2 + 18/10). 9 Let g(k) = -k + 10. Suppose 2h - 137 = -5o, 4o = h + 5o - 70. Let c = h - 55. What is the remainder when c is divided by g(0)? 6 Suppose -5p = -5, -3r + 2p = -31 - 195. What is the remainder when 699 is divided by r? 15 Calculate the remainder when 691815/2295 + 4/(-9) is divided by 34. 29 Suppose 169z + 31512 = 101647. Calculate the remainder when z is divided by 378. 37 Let d = -71 - -75. Calculate the remainder when (((-10)/5)/4)/(2/(-24)) is divided by d. 2 Let a(f) = 13f2 - 25f + 10. What is the remainder when 504 is divided by a(4)? 32 Let y(x) = -3x3 + 49x*2 - 71x + 9. Calculate the remainder when y(13) is divided by 147. 41 Let b(q) = 318q3 - 4q*2 - 5q + 30. Calculate the remainder when b(2) is divided by 506. 18 Suppose -61 = -5w + 29. Calculate the remainder when 8 + -12 + -2 + (3 - -69) is divided by w. 12 Suppose 0 = 36f - 24f - 1524. Let x = f - 119. Suppose 0 = 3h + 2h - 150. Calculate the remainder when h is divided by x. 6 Let m = -2415 - -2552. Let i = 10 + 18. What is the remainder when m is divided by i? 25 Let k = 1750 - 1734. Suppose -z + 17 = -4g - 10, 3g = -12. Suppose 0 = -v + 5r + 10, 2v - 5v - 4r + z = 0. What is the remainder when k is divided by v? 1 Let m = -10678 + 10687. What is the remainder when 2103 is divided by m? 6 Let r(v) be the first derivative of -v2/2 + 14v - 6. Let f be r(11). Suppose -fi - 18 = -102. What is the remainder when 108 is divided by i? 24 Suppose -2l = -v - 304, -v - 2l - 944 = 2v. Calculate the remainder when 114 is divided by (-41)/(-123) + (v/(-9) - 0). 9 Suppose -175d + 411d - 212d - 888 = 0. What is the remainder when 3366 is divided by d? 36 Let i(b) = 4b*2 + 12b. Let q be 6 - -1 - (3 + 15/(-3)). Let y(x) = -x*2 + 11x + 11. What is the remainder when y(q) is divided by i(-4)? 13 Let b be ((-8)/6)/((-276)/6003). Suppose 4q + 20 = 0, -4a - 71q = -72q - b. Calculate the remainder when 82 is divided by a. 4 Suppose -35q = -6q - 24012. Calculate the remainder when q is divided by 13. 9 Suppose 18 = 2m + 3o - 12, 5m + 1 = 2o. Calculate the remainder when 984 is divided by m. 0 Let v = -344 - -171. Let y = v - -256. What is the remainder when y is divided by (-127)/(-3) - (-4)/6? 40 Let x(g) = 42g2 + g + 4. Let c be x(2). Let k = 217 - c. What is the remainder when 99 is divided by k? 13 Suppose 4n - 114 = 2m, 13 = n - 5m - 29. What is the remainder when (-1452)/(-14) - (-5 + 66/14) is divided by n? 23 Calculate the remainder when (-2 + 3 - -5) + (204 - -1069) is divided by 32. 31 Let a be (-3)/(-6) - 9/2. Let p(h) = h*2 + 2h + 2. Let u(q) = -q*2 + q - 6. Let z(c) = 3p(c) - u(c). Calculate the remainder when z(a) is divided by 15. 11 Let f(y) = -y*2 - 8y - 2. Let z be f(-7). Suppose -2p + zb = 24, 0p = -p + 5b - 22. Calculate the remainder when (p(63/(-6) - -1))/1 is divided by 5. 4 Suppose -5t = -0 - 10. Suppose -27 = -tx + 23. Let n(j) = -j3 + 9j*2 - 13j + 2. What is the remainder when x is divided by n(7)? 7 Suppose 0 = 2k + 6, -8z = -3z - 5k - 230. Calculate the remainder when 391 is divided by z. 4 Suppose -3g + 15a - 14a - 28 = 0, 0 = 5g + 2a + 54. Calculate the remainder when (((-18)/45)/((-2)/g))/(-2) is divided by 1. 0 Let o(r) = -2r + 4. Let h be o(4). Let s(j) = 5 + 26054j - 19 - 26059j. Calculate the remainder when s(h) is divided by 5. 1 Suppose 21l - 1954 - 1598 + 528 = 0. Calculate the remainder when l is divided by 9. 0 Let q(s) = -4s - 8. Let k(y) = 17y + 13. Let i be k(6). Let b = 155 - i. Calculate the remainder when b is divided by q(-6). 8 Suppose -9i + 106 + 686 = 0. What is the remainder when 609 is divided by i? 81 Let b(k) = 6k + 1. Suppose 0 = -5i - 167 - 5893. Let w = i - -1263. What is the remainder when w is divided by b(2)? 12 Suppose -198 = -2z - 63k + 67k, 69 = z + 4k. What is the remainder when 527 is divided by z? 82 Suppose -6 = 2w - 174. Calculate the remainder when w - 11/(88/(-64)) is divided by 34. 24 Suppose -35v + 31v + 864 = 0. Calculate the remainder when 4533 is divided by v. 213 Suppose -o + 2 = z, -168z + 164z - 17 = -o. What is the remainder when 272 is divided by o? 2 Suppose 4 = 18f - 17f. Suppose -3y = -y - fk - 100, -3y = 3k - 114. What is the remainder when y is divided by 4? 2 Let t be 3/(3/(-1)) - 1. Let k(f) = 4f - 33. Let g be k(7). Calculate the remainder when 22/(-2 + g/t) is divided by 24. 20 Let n = 56 - 9. Calculate the remainder when n is divided by ((7 - -4)/(-11))/(7/(-21)). 2 Let k(d) = 2d2 + 20d + 3. Suppose -32 = 4c + 3p + 4, -3*c - 27 = p. Let w be k(c). Let q = 19 - w. What is the re	{ "pile_set_name": "DM Mathematics" }
. 1716 Let s = -1514 + 21215/14. Let g = 1584 - 22119/14. Calculate the common denominator of g and s. 14 Let q = -34397/2064 + -1/688. Calculate the common denominator of q and 888/88 - (5 - 0). 33 Let w be -6((-898)/(-18) - -3). Let b = w + 320. Calculate the common denominator of 29/33 and b. 33 What is the common denominator of ((-2)/(-6))/(406/366) and 39/4? 812 Suppose 2h = -5i + 17, 4i - 9 = 3h - 0h. What is the common denominator of 0 - 47i/(-6) and -79/40? 40 Let b(u) = -u3 - u2 - 8u + 2. Let c be b(-5). Find the common denominator of c/176 - (-2)/(-11) and (-1)/(-2) - (-142)/(-18). 72 Let k = -141287/12 - -11763. Let x = 45391/4590 - -5/459. What is the common denominator of x and k? 60 Suppose -9j + 8j + 1 = 0. Let g = -5 - j. What is the lowest common multiple of ((-1)/2)/(g/216) and 12? 36 Suppose -40l = -1788 - 1092. What is the least common multiple of 2 and l? 72 Let n = -1729493/3315 + 7828/15. Find the common denominator of n and 28/85. 1105 Let o(a) = -6a - 5. Let f be o(-6). Let h = 53 - f. What is the smallest common multiple of (-1 - 1)1 + 8 + -2 and h? 44 Let d = -80 + 91. What is the smallest common multiple of ((-270)/(-72))/((-6)/(-16)) and d? 110 Let v be (-20)/(-8)(-32)/(-10). Suppose -vt + 10 = -3t. Let s(u) = 10u2. What is the smallest common multiple of t and s(-1)? 10 Suppose -2c - 3d = 68, -40 = -c + 2c + 3d. Find the common denominator of (-308)/18((-15)/(-4))/(-5) and c/6(-66)/(-32). 24 Let t(m) be the second derivative of m4/6 + m3 + m2/2 + 4m. Suppose 3l - 2 = 2k, 2k + l + 6 = -4. What is the smallest common multiple of 7 and t(k)? 63 Let n = -362 - -378. Let a(s) = -9s3 + s2. What is the lowest common multiple of a(-1) and n? 80 Let k = 1711/3 - 63268/111. Let i = 2765/814 - k. Find the common denominator of -49/16 and i. 176 Let d = 3987175/106 - 37614. Calculate the common denominator of 83/4 and d. 212 Let m be (6 - 249/9) + (-4)/(-6). Calculate the common denominator of 14/15 and (-278)/(-60) - (24 + m). 30 Let o = 1 - -1. Suppose ol - 48 = -2f - 2f, -6 = f - 4l. What is the smallest common multiple of 3 + 2 + -1 - 3 and f? 10 Suppose 5h + 2a = 142, -5h = -4a - 121 - 15. Calculate the lowest common multiple of 20 and h. 140 Let l = -80833/13328 + 2/833. Find the common denominator of l and 3/15 - 227/110. 176 Let q(r) = r*2 + 2r. Let s be q(-2). Suppose 2p + 6 = s, -f + 43 = 3f - p. Calculate the lowest common multiple of 11 and f. 110 Let p(z) be the first derivative of -3z2/2 - 7z - 7. What is the lowest common multiple of p(-7) and 18? 126 Let a be (-2)/(-15) + (-153)/135. Calculate the common denominator of 25/14 and (-5 + (a - -1))/((-384)/160). 84 Let u = -2543/4149045 + -2/10095. Let o = -231491749/26217279 + 222558/21263. Let q = u + o. Calculate the common denominator of q and 139/6. 66 Let u = -964/141 - -165289/23688. Find the common denominator of u and -55/144. 1008 Suppose -12g = -17g - 50. Let o(i) be the second derivative of -i*4/12 - 5i3/3 + i2 - 3i. What is the lowest common multiple of 8 and o(g)? 8 What is the least common multiple of 45 and 120(49/(-14) - -4)? 180 Let r be 1/51 - (-13546)/(-130). Let j = r + 106. Calculate the lowest common multiple of (-4 + 1)/((-6)/4) and j. 2 Suppose 43 = s - 4f, -226 = -4s - f - f. Calculate the least common multiple of s and 135. 1485 Let l = 189 - 139. What is the least common multiple of l and 50? 50 Let s = 4321 - 30188/7. What is the common denominator of s and 41/7? 7 Find the common denominator of ((-93)/32)/(((-21)/(-4))/(-7)) and 83/16. 16 Let a be (0 - (-4)/8)0. Suppose a = 3s - p - 7, -1 = s - 3p + 2. Calculate the common denominator of 67/10 and s/(-3) + 150/(-4). 10 Let m = -54679/8 + 6826. What is the common denominator of m and -65/24? 24 Let l = -311/14 + 29. Let g be 329817/(-549708) + 0 - (0 - 2). Let v = -19/2411 - g. Find the common denominator of l and v. 532 What is the common denominator of (-6)/(-16) - (8 + 1) and 37/24? 24 Let q be 88/6(3 + -6). Find the common denominator of ((-2)/10-118)/(-4) and ((-1331)/q)/((-10)/4). 10 Let h = -8/155 - 5246/465. Suppose -g - 5z + 3778 = 0, -6z = -5g - z + 19040. Let j = g - 41872/11. Calculate the common denominator of j and h. 33 Let j(b) = 30b - 171. What is the smallest common multiple of 17 and j(6)? 153 Let n = -25349/13632 - -304/213. Find the common denominator of n and 73/18. 576 Let z(g) = g*2 - 6g + 8. Let y be z(7). Let n(f) = -3f + 33. Let r be n(y). Calculate the common denominator of 95/22 and 87/r - 10/(-5). 44 Let v = 55 - 33. Let i = 39 - 34. Suppose 64 = -t + it. What is the least common multiple of v and t? 176 Let y = 71569/30 - 2386. What is the common denominator of y and 56/3? 30 Find the common denominator of 6 + -11 + 5 + 154/(-12) and -37/27. 54 Let y(h) = 60h2 - 9h. Calculate the lowest common multiple of y(-2) and 22. 2838 Let o(q) = -q*3 - 14q*2 - 12q - 15. Let p be o(-13). What is the common denominator of 38/21 and (-51)/12p/(-12)? 84 What is the common denominator of 123/230 and 770/(-100) - (-9)/(45/(-10))? 230 Let h = 29891/120 + -755/3. What is the common denominator of h and 7/32? 160 What is the least common multiple of 9 and (0 - -16 - (2 - 4)) + -3? 45 What is the common denominator of ((-14)/7)/(21(-44)/78) and 113/66? 462 What is the common denominator of (-273)/75 + ((-84)/7 - -15) and -64/175? 175 Let h = -76/27 + 15671/4752. Let o = 1335/176 - h. Let m = o + -357/22. Calculate the common denominator of -59/2 and m. 8 Let w = 91 + -81. Suppose 4o - 22 = w. What is the lowest common multiple of 12 and o? 24 Suppose 3f = 2w + 446, -735 = -5f + 4w + w. Suppose -f = -3r + r. Calculate the lowest common multiple of 10 and r. 380 Let k = -181144291/46964 - -172/35223. Let b = -3864 - k. Let p = -1263/1034 - 3/517. Find the common denominator of p and b. 132 Let r(n) = -n*3 - 3n*2 + n + 4. Let y be r(-3). Suppose -y + 4 = 3d. What is the lowest common multiple of d and 2? 2 Let f = 31 - 26. What is the least common multiple of 4 - (f - 2) - -13 and 4? 28 Suppose -26 = -5m + 39. Suppose mw - 133 = 101. What is the lowest common multiple of 158 and w? 1422 Suppose -2m - 3v = -8, 5 = m + 2v + 3. Let h = 355 - 350. What is the lowest common multiple of h and m? 10 Suppose -x + 0 = -5. Let i = x + 8. Find the common denominator of 1/(-11)(-1 - -36) and i. 11 Let l = 88 - 84. Find the common denominator of 87/64 and (-6061)/(-770) + l/(-5). 448 Suppose -4v + 5v = 4. What is the common denominator of (-1)/v - (-73)/(-44) and 97/8? 88 Let z(d) = -d + d + d + 2 + 8. Let v be z(-10). Suppose v = -o - 0o + 22. Calculate the least common multiple of o and 10. 110 Let x(n) = -n2 - n - 1. Let h be x(-2). Let i = -84 + 90. What is the smallest common multiple of 10/6 - 1/h and i? 6 Suppose 0h - 3h + 31 = 5f, -2h - 1 = -f. Suppose b + hb = 36. Let j(r) = r*3 - 10r*2 - 22r - 8. What is the lowest common multiple of j(12) and b? 48 Let d(c) = 3c3 - 3c*2 - 5c + 4. Let f be d(3). Let p = f - 214/5. Find the common denominator of -41/5 and p. 5 Let f be (2488 - 1)34/(-72). Let h = -1170 - f. Let c = -17/76 - 5003/228. Find the common denominator of h and c. 12 Let m(v) = 2v*2 - 11v - 2. Suppose -3s - 3 = -3b, 0 = b + 3s - 7s + 14. Calculate the smallest common multiple of m(b) and 10. 20 Let o(m) be the second derivative of -m5/20 + m4 - m*3/3 + 7m*2 - 4m. Let p be o(12). What is the smallest common multiple of 24/14(-3 - p) and 2? 12 Let w be (-4)/(-18) - (-1490)/8551. Let m = w + 3269/570. What is the common denominator of -10 and m? 10 Let h(f) = f*3 - 4f*2 + 3f - 6. Suppose -5c + 5w + 25 = 0, 0 = -w - 1 - 0. Let o(l) = -l + 51. What is the smallest common multiple of h(c) and o(49)? 6 Let s = -4331/8 - -108599/200. What is the common denominator of (4592/320 - -3) + -12 and s? 100 Let h = -630881/120 - -5257. Calculate the common denominator of -89/88 and h. 1320 Suppose -4k - 2 = -42. Suppose -kc = -3 + 3. Find the common denominator of c and -49. 1 Let p(a) = a - 12. Let s be p(16). Let b be s + -2 + 1 + -129. Calculate the common denominator of 14 + -17 - b/(-16) and -69/10. 40 Let p(o) = o - 2. Let	{ "pile_set_name": "DM Mathematics" }
multiple of d and x? 72 Let h = 43654459/3288 + -106215/8. What is the common denominator of 37/20 and h? 8220 Suppose -3g = -8 - 1. Suppose 0 = -103n + 100n + 9. Suppose -gq + 2u + 141 = 3u, 2q - 83 = nu. Calculate the lowest common multiple of 1 and q. 46 Suppose f = -2c - 2c + 24, 5c - 21 = f. Suppose 3p + 3x = 111, 4p = 97x - 92x + 211. What is the smallest common multiple of p and f? 44 Find the common denominator of -3/88 and ((-393)/(-46))/(-21 - 78). 6072 Let y = -70021/18 - -3887. Let i be (-15)/6 + 2 + 513734/60. Let g = i + -8567. What is the common denominator of g and y? 90 Calculate the common denominator of 149/12 and (16/20448)/(36/(-249)). 15336 Suppose 4z = 5r - 8r + 948, -3r = 5z - 945. Calculate the least common multiple of r and 480. 960 What is the least common multiple of 102 and (5/(-8 - 2))/(9 + 323144/(-35904))? 2244 Let u be (5 - 1 - 7) + -131. Let b = u - -142. What is the least common multiple of 10 and b? 40 Let x(r) = r2 - 2r + 2. Suppose 2b + 400 = 386, -2c = -b - 17. Calculate the lowest common multiple of x(3) and c. 5 Let x = 55082 - 6059127/110. Find the common denominator of 35/46 and x. 2530 Let l(n) = -83n + 902. What is the smallest common multiple of l(10) and 264? 792 Let y be 236/(-66) + (-1 + 9 - 11). Let d = 98/11 + y. Find the common denominator of d and -9/16. 48 Let t = 35642980839385/292784934 + 1750/3753653. Let y = t - 121736. What is the common denominator of y and 71/33? 858 Suppose 2p + 0 = 8. Suppose -5i + 6 = -a - 2a, 2i - pa + 6 = 0. What is the least common multiple of 5 and i + (3 - -1 - -4)? 55 Let y = 3594239/42 + -85573. Let d = -8322/35 + 239. Calculate the common denominator of d and y. 210 Let b be (1957/(-2) + -1)112/7568. Let i = 2/473 - b. Let k = -75/4 + 21/2. What is the common denominator of i and k? 4 Let c(k) = k + 16. Suppose -4v = -t + 10, -2v - 5 = -v. Let d = -2 + t. Calculate the smallest common multiple of 4 and c(d). 4 Let i = -82819/29688 + -5/2474. What is the common denominator of i and -139/1608? 1608 Let m(i) = 3i + 18. Let g be m(-3). Suppose -gt + 40 = -4t. Calculate the least common multiple of ((-45)/(-180))/(1/((-172)/(-1))) and t. 344 Let l(i) = -11 + 7i2 + 19 - 2i3 + 14 + i3 - 2i. Calculate the least common multiple of l(7) and 26. 104 Let h = -37/6 - 1/12. Let k = 2369 - 9507/4. Calculate the common denominator of k and h. 4 Let i be 6 + 3/(3322872/(-6219437)). Let z = 3/2776 + i. Find the common denominator of 19/9 and z. 171 Let k = -223639043/465 - -480944. Calculate the common denominator of k and 86/45. 1395 What is the common denominator of (7 - 24) + 44/(-12) and -35/3383? 10149 What is the least common multiple of 220 and (-9)/(-396)-11 - (-5361)/82? 14740 Let h be 18102/(-136438498)(-2)/(12/(-7353)). Let p = 1/59789 + h. What is the common denominator of p and 43/14? 2282 Let c = -272 + 274. Find the common denominator of -16/11 and (c/12)/(140/4242). 220 Let t = 66 + 69. Let i = -87 - -83. What is the common denominator of 95/8 and ((-51)/t)/(((-8)/(-25))/i)? 72 Suppose 335 - 276 = 9f + 2y, 2f - 3y - 20 = 0. Calculate the least common multiple of f and 1752. 12264 Suppose 107q - 186 = 28. Suppose 5c = 6c - 24. Suppose 2v = 56 + c. Calculate the least common multiple of v and q. 40 Let c = -172 - -105. Let b = 107 + c. Suppose -4x = 4x - b. Calculate the smallest common multiple of x and 4. 20 Let q be (-4 + 1 - 1) + (-4395230)/336. Let f = q - -13091. Calculate the common denominator of f and -21/22. 264 Suppose 0 = -33a + 46a - 234. Calculate the lowest common multiple of 1/((-242)/(-1008) - a/81) and 14. 56 Suppose -2w - 8 = -3h, 0 = 12h - 14h - 4w. Calculate the least common multiple of 1508 and h. 1508 Let i = -27138 + 27194. Calculate the lowest common multiple of 4 and i. 56 Calculate the common denominator of (-216)/270420/(-488) and -54/17. 1037 Let p = -469/2 - -1133/5. Calculate the common denominator of -55/2037 and p. 20370 Let m(c) = 3c2 - 24c*3 - 22 + 55c*3 - 15c + 0 - 30c3. Suppose -3n = 2g - 5g + 24, -2n + 2 = g. What is the least common multiple of g and m(-4)? 66 Let o = 45785/112 - 2834/7. Suppose 0l + 2r - 10 = -3l, -3r + 12 = 3l. What is the common denominator of o and -39 + 15 + 1/l + -2? 16 Suppose 0 = -6g - 61 + 1597. Calculate the common denominator of 9/88 and 80/g(13/30 + 3). 1056 Let p = 179 - 153. Suppose 5x = -16 + p. What is the least common multiple of x and 102? 102 Let j(w) = 6w*2 - 7w + 7. Let y be j(-5). Calculate the common denominator of 53/48 and (2214/y)/3 + (-4 - -2). 96 Suppose 0 = -5p + 10, -2q - 2p = -7p + 8. Find the common denominator of -51/40 and 1/4q/(-25)-115. 40 Let x = -173 - -78. What is the common denominator of x/(-627)159/45 and -65/77? 693 What is the least common multiple of ((-36)/(-486)501)/(0 - 1/(-9)) and 3? 1002 What is the common denominator of (-137)/(-72) + -2 + -1 and (-3)/8429/117? 72 Let b be 1/(-1)18(-15)/6. Let k be 3/(b/215) + 1/(-3). What is the lowest common multiple of 16 and (4/k - 2)70/(-20)? 48 Suppose -19f + 184 = 4f. Find the common denominator of ((-103)/(-24))/((-28)/f + 3) and 49/8. 24 Let d = 56/123 - 1331/492. Calculate the common denominator of d and -139/2592. 2592 Suppose -19 = -d - 4b, -5d + 3 = -2b - 4. Suppose 300 - 1182 = g. Find the common denominator of -8/11 and (-2)/d + g/297. 11 Let i(p) = -1. Let g(z) = -3z + 23. Let m(v) = -g(v) - 2i(v). Let t be m(-7). Let f = t - -64. Calculate the smallest common multiple of 20 and f. 220 Let j = 293 - 286. Let p be (-72)/(-21)(0 - -7). Suppose 0 = -3n - 3n + p. What is the least common multiple of n and j? 28 Let a be (1203498/24)/((-5)/(-20)). Let m = -60174971/300 + a. Find the common denominator of 119/24 and m. 600 Calculate the common denominator of 4 - (2 + ((-127452)/2560)/13) - 6 and -11/40. 640 Let x = -18210 - -3441623/189. Calculate the common denominator of x and -41/378. 378 Let m(p) = -4p + 20. Let x be m(8). What is the common denominator of ((-22)/5)/(48/(-105)) and -10(1 + 33/x)? 8 Find the common denominator of 111/10 and ((-55)/3 - 1)(-855)/(-302100). 530 Suppose 9o = 11o - 280. Calculate the smallest common multiple of o and 160. 1120 Let h(d) = -d2 - 4d - 7. Let u be (-2)/(-4) + (1 - 27/6). Let i be h(u). Calculate the common denominator of -107/38 and 2/i(-27)/(-5). 190 Calculate the common denominator of -103/90 and (-124)/(-272) + (-15)/180. 1530 What is the lowest common multiple of ((-63)/18 + 2)(1 + -7) and 3? 9 Let z(d) = 0d + d + 7 - 11d + 8d. Let l be z(5). Calculate the common denominator of 284/(-24) + l + 2 and -95/18. 18 Let n = -1673 + 1682. Suppose -i + 63 - 8 = 2o, -80 = -2o + 4i. What is the smallest common multiple of o and n? 90 Let r = 100449/10712 - 3/1339. What is the common denominator of -52/235 and r? 1880 Calculate the common denominator of ((-1735)/(-480) - 8) + 2 + 3 and 13/1088. 3264 Let c = -28933143/305319700 + 2/1308513. Find the common denominator of c and -103/126. 6300 Let a(x) = 138x3 - 5x*2 + 51x - 106. Calculate the smallest common multiple of 330 and a(2). 11880 Let n be ((-21)/7)/3 + 28248832/(-126). Let u = n - -224203. Let h = 36/7 - u. Find the common denominator of h and -73/6. 18 Let k be 6999204971/(-1732500) - (1 - -3). Let o = 191/39375 - k. Let q = -4042 + o. Find the common denominator of 97/4 and q. 20 Let v = 95 - 15. What is the common denominator of -23/42 and 56/v40/(-24)? 42 What is the common denominator of -1(-135)/(-3080) + (-10)/35 and -107/152? 1672 Let i = 2820 + -1854. What is the lowest common multiple of 552 and i? 3864 Suppose -98 + 20 = -3u + 3o, 2o = u - 31. Calculate the common denominator of (-711)/2414/u and (-2)/5 + (-117)/(-40)-2. 4 Let f(p) be the second derivative of -p5/20 - 7p*4/4 + 16p*3/3 + 14p*2 + 62p. What is the lowest common multiple of 22 and f(-23)? 3850 Let y = 107 - 85. Suppose 4n + 0n + 2t - y = 0, 3t = -4n + 23. Suppose s - 4 = -2. What is the lowest common multiple of s and n? 10 Suppose 0 = -2s - 13s + 30. Suppose -c - s = -10. What is the least common multiple of 44 and c? 88 Let r = -244 + 258. Suppose ra - 211 = -43. Calculate the	{ "pile_set_name": "DM Mathematics" }
r. 3, 2, p Let v = 22 - 25. Sort -3/7, 0, v in descending order. 0, -3/7, v Let y be -2 + 4 + 0/1. Let p(j) = 2jy + 4j + 1 - j*2 + 3. Let b be p(-4). Sort -2, b, 3 in decreasing order. b, 3, -2 Let u = -17 + 12. Let a(r) = -r - 1. Let z be ((-9)/(-6))/(1/(-2)). Let l be a(z). Put -2, u, l in decreasing order. l, -2, u Suppose q + 2 = -4o - 3, 0 = 4q + o - 10. Suppose -5f - 28 = 3r, 2r = -3r - 5. Sort 1/6, f, q in increasing order. f, 1/6, q Let r be -102/4-1. Sort 2, -16, r in decreasing order. r, 2, -16 Suppose -15j - 29 = 16. Suppose w = -2w. Put j, 5, w in decreasing order. 5, w, j Let b = -11 + 45/4. Put -12, 0.1, b in descending order. b, 0.1, -12 Let h = -9.11 + -18.85. Let y = h - -28. Put 2/9, y, 4 in decreasing order. 4, 2/9, y Let g be 21 - 21 - (-6)/4. Let z be (-118 + 0)(-1)/3. Let c = z - 38. Sort g, 0.5, c in descending order. g, c, 0.5 Let g = 1.5 - 0.5. Let m = g + -1. Let z = -7 + 12. Put m, z, 2/13 in increasing order. m, 2/13, z Let l = 36 - 7. Suppose v + l = -5a, 4a - 4 = 2v - 16. Put a, 1, 2 in increasing order. a, 1, 2 Let c = 7 - 12. Sort c, -0.1, 1, 0 in decreasing order. 1, 0, -0.1, c Let z be ((-4)/5)/(3/15). Sort z, 0, 2, 4 in descending order. 4, 2, 0, z Let c = 0.039 + -0.039. Sort -0.4, 4, c in descending order. 4, c, -0.4 Let g be 4/(-6) + (-20)/6. Let j(w) = w3 + 8w*2 + 7w + 3. Let o be j(-7). Put 2, o, g in decreasing order. o, 2, g Suppose 4y - 16 = -4. Put -1, y, 5 in ascending order. -1, y, 5 Let x(m) = 3m*3 + 8m*2 - 10m - 8. Let b(h) = 7h3 + 16h*2 - 21h - 16. Let n(l) = -4b(l) + 9x(l). Let g be n(7). Sort g, 3, 4 in descending order. 4, 3, g Let j be (6/9 + (-6)/9)/(-2). Let o(x) = 2x - 4. Let b be o(4). Put b, j, 5 in decreasing order. 5, b, j Let y = 29/2 - 15. Let h = 0.03 + 0.27. Let p = -0.2 + h. Sort y, 2/7, p in descending order. 2/7, p, y Let i = 33.3 - 33.8. Let d = -5 + 5. Let j = 0.2 - 4.2. Sort i, d, j in increasing order. j, i, d Suppose -3o + n = -0n - 65, 4n + 53 = 3o. Suppose s + 15 = 4s, k - o = -5s. Let h(t) = t2 - 5. Let u be h(0). Sort u, k, 5 in descending order. 5, k, u Let k = 152 + -1068/7. Sort 11, 1/3, k in decreasing order. 11, 1/3, k Suppose 2b - 5 = -1. Suppose -bp + p + 25 = -2y, -4p - 20 = 0. Let v be y/(-9) - 4/2. Sort -0.4, 0.5, v in ascending order. -0.4, v, 0.5 Let m = 0.09 - 0.59. Let t = m + 0.5. Let r = -0.5 + t. Sort 4/3, r, 0.5. r, 0.5, 4/3 Let j = 577/5 - 115. Sort 2, 5, j in increasing order. j, 2, 5 Let m be (1/(-1) + 0)1. Let t = m - -3. Let x = 0 + 0.5. Sort t, x, 4. x, t, 4 Suppose -3o = -2o - 3. Suppose -ou = -w + 6, w + 5u = 5w - 10. Let x = 1 + 0. Put 5, x, w in descending order. 5, x, w Suppose -2o + 3o = 3. Suppose -4d + f = -f + 16, -5d = -2f + 18. Sort o, 0, d in ascending order. d, 0, o Let y be ((-3)/4)/(6/(-4)). Put y, -2/11, -1 in increasing order. -1, -2/11, y Let y be -3(1 - (-1 + 3)). Sort 2, 1, y in ascending order. 1, 2, y Suppose 0 = -0q - 5q - 15. Suppose 3o = 2k + 12, 3k + 10 - 1 = 0. Suppose 3c = od - 4 + 2, -5d - 4c + 5 = 0. Sort q, 4, d in descending order. 4, d, q Suppose 4d - 12 = -4c, 5d - 2 - 1 = -2c. Let w(o) = o*3 + 13o*2 - 2. Let j be w(-13). Sort j, -4, d in decreasing order. d, j, -4 Let p = -20 + 19. Put 0, p, 9, -3 in increasing order. -3, p, 0, 9 Suppose 0 = 4w + 3 + 13. Put w, -10, 0 in ascending order. -10, w, 0 Let l be 16/3 + -5 - (-20)/3. Sort -3, -2, l, -1 in descending order. l, -1, -2, -3 Let a = 19 - 19.4. Sort 1/7, -0.3, a. a, -0.3, 1/7 Let n(t) = t*2 + 6t - 4. Let q be n(-6). Sort -2, 3, q, -5. -5, q, -2, 3 Let l(j) = 3j - 9. Let m be l(0). Let w be (-12)/m + (-2)/1. Put 0.3, w, -3 in decreasing order. 0.3, w, -3 Let v = 2.78 - 3. Let k = v - -0.2. Let t = -2 + 9/2. Sort k, t, -5 in ascending order. -5, k, t Let n(t) be the first derivative of t2/2 - 4t - 1. Let k be n(5). Sort k, 5, -2 in increasing order. -2, k, 5 Let y be 4 - (8/(-4) - -4). Let q = y + -5. Sort 3, q, 4. q, 3, 4 Let r = -0.63 - -0.23. Put r, -5, 3 in increasing order. -5, r, 3 Let x = -0.8 + 1.1. Let c = 4 - -1. Sort c, -4, x in decreasing order. c, x, -4 Suppose f - 3u + 10 = 2f, 0 = 4f - 5u + 45. Sort f, 2, -51 in decreasing order. 2, f, -51 Let t = -68 - -63. Let b = 0 - 2. Put t, 2, b in descending order. 2, b, t Let t = -1.7 - -1.1. Sort t, 4, -2/7 in descending order. 4, -2/7, t Let s = -6.93 + 7. Let z = s - -2.93. Let p = z - 3. Sort p, -2/11, -3 in decreasing order. p, -2/11, -3 Let b be -3(42/(-9))/7. Put b, 10, -1 in descending order. 10, b, -1 Suppose -4p + 2w + 3w = 36, -40 = 5p - 5w. Let y = 17 - 15. Sort p, 5, y. p, y, 5 Let r = -2.6 - -0.6. Sort r, -5, -0.3, 1/3 in ascending order. -5, r, -0.3, 1/3 Let r = 1.99 - 2. Let s(l) = 5l + 40. Let z be s(-8). Sort r, -5, z. -5, r, z Let s = 3 - 3. Suppose 0 = -b - n + 5 + 5, -2b = -4n + 4. Suppose 3c + b = -s. Sort c, 2, 5. c, 2, 5 Let l be (-4)/(-10) + 23/5. Suppose 5z - 5n = 25, 4z - 7 = -z - n. Let v = 1 - 1. Sort l, v, z in decreasing order. l, z, v Let g be 54/(-63)(2 + (-7)/3). Suppose 4 + 1 = -5i. Sort i, g, -0.3 in ascending order. i, -0.3, g Let k be ((-12)/(-54))/((-4)/(-6)). Put k, -2/13, 2 in decreasing order. 2, k, -2/13 Let r = -29.7 - -30. Sort 3, 12, r in decreasing order. 12, 3, r Let m = 29 - 29.2. Put 1, -4, m in decreasing order. 1, m, -4 Let z = 1.1 + -0.7. Sort z, -1, -4 in ascending order. -4, -1, z Let a(h) = -h3 - 7h*2 + 3. Let z = 5 + -12. Let g be a(z). Suppose 0 = -n + 4n. Put -4, g, n in descending order. g, n, -4 Let l = 0.09 - -3.91. Suppose n + 6 = 4. Sort n, l, -0.1. n, -0.1, l Let o be (122/(-94))/(138/10). Let w = o + 1/141. Put -1/3, w, -0.1 in ascending order. -1/3, -0.1, w Let h = -3 + 3. Suppose -3w = -2w + 3. Let o = -8 - w. Put h, 5, o in descending order. 5, h, o Let b(o) = -o*2 + 6o - 5. Let h be b(6). Let k(d) = -d*2 + 5d - 6. Let v be k(4). Put -4, v, h in descending order. v, -4, h Let o(c) = -5c. Let q be o(2). Let r be -5 - (-3 - -4)/((-1)/2). Sort r, q, -4 in decreasing order. r, -4, q Let o = -5.8 + 6. Let b = -5.11 + 0.11. Let g = b + 4.8. Put g, o, -5 in increasing order. -5, g, o Let k(a) = -a + 1. Let q be k(-2). Suppose -d + 0d = -3m + 14, 0 = 4d + 5m - 29. Suppose 3o = d - 10. Sort o, 0, q in ascending order. o, 0, q Suppose -2y = -d - 11, 18 = -5d - y - 4. Sort -3, 20, d in increasing order. d, -3, 20 Suppose -3d = 3w + 15 - 6, 5d = 2w - 15. Put 3, 2, d in ascending order. d, 2, 3 Let v(u) = u*3 + 6u*2 + 4u. Let w be v(-5). Suppose -5n - 67 + 47 = 0. Let o(s) = s2 + 8s + 9. Let h be o(-6). Sort n, w, h in increasing order. n, h, w Suppose 3y = 9 - 3. Suppose -3l - l = b - 5, 0 = 3l + 2b. Let r be (-20)/21/l. Sort -3, y, r in descending order. y, -3, r Let n(q) = -14q*2 - q + 1. Let z be n(1). Let s = z - -19. Put 2, 3, s in descending order. s, 3, 2 Let i = -38 + 37. Sort -1.3, i, -2. -2, -1.3, i Let q(z) = 7z - 16. Let p be q(0). Put p, 1, -0.5 in decreasing order. 1, -0.5, p Let x = -27 - -25. Let c be -214/16 + 2. Sort c, 0.3, x in increasing order. x, c, 0.3 Let i = -104 - -104.1. Sort 1/11, -3/7, i, -0.1. -3/7, -0.1, 1/11, i Suppose -9 = 7o - 2. Put o, 2, -2, 1 in descending order. 2, 1, o, -2 Let m = 29 - 29. Put 4, m, 13 in descending order. 13, 4, m Let m = 0.8 + 0.2. Let p(v) = -v*2 - v. Let u be p(-1). Sort u, m, 4 in increasing order. u, m, 4 Let n be (3 + -4)(-1 + 4). Suppose 2 = -4v - 6. Let j = v - n. Sort 0, -5, j. -5, 0, j Let z = -0.5 - -1. Let p = 3.9 - -0.1. Let i = -4.5 + p. Sort z, -0.2, i. i, -0.2, z Let z(d) = d - 5. Suppose 3o + o = 0. Let u be z(o). Sort u, -3, 5. u, -3, 5 Let q(k) = -2k + 5k - 2k2 - 7 + 3k*2. Let z be q(-4). Sort z, 5, -1 in ascending order. z, -1, 5 Let i(y) = 3y. Let c be i(-1). Suppose -g = 4m - 22, -2g - 2m = g - 16. Sort g, 3, c. c, g, 3 Let t = -40 + 75/2. Let f = -11 - -10.8. Sort f, -4, t in descending order. f, t, -4 Let x = 94/65 - 24/13. Suppose -7 = -4g + 5c, 0 = 8g - 3g - 2c - 13. Suppose 6y - gy + 9 = 0. Put x, 0.3, y in decreasing order. 0.3, x, y Suppose 3q + 7 = 22, 5g = -4*q + 5. Let v = -6 - g. Sort 3, 5, v in increasing order. v, 3, 5 Let l = -7.02 + 0.02. Put -5/3, l, -1/7 in descending order. -1/7,	{ "pile_set_name": "DM Mathematics" }
874 What is -2317561.18 + 0.3? -2317560.88 What is 0.174 minus 9.2488734? -9.0748734 -1.922 - -0.6698 -1.2522 What is the distance between -157.07 and 37? 194.07 Calculate 21302538.6 - -1. 21302539.6 What is 222130013 + 2? 222130015 What is -32795536 minus 0.48? -32795536.48 Work out 5725936.2 - 0.3. 5725935.9 Subtract -0.03 from -105922179. -105922178.97 Add 83468 and -5. 83463 Subtract 33 from -86088486. -86088519 Put together -1556.164 and 43225. 41668.836 -90 + 80890 80800 Work out 14822 + 4008575. 4023397 -5 + 833134.5 833129.5 What is 0.3 minus -1606945? 1606945.3 Add together -0.1 and 4752.04558. 4751.94558 What is 59 + -2421837? -2421778 Add -21 and -46261117. -46261138 Add together -49671954 and -0.18. -49671954.18 What is the difference between 13.4392 and -249? 262.4392 What is 11993 - 0.07542? 11992.92458 Work out -6 + 0.18785781. -5.81214219 20.7879 + -35736 -35715.2121 3512.33 + 2.035 3514.365 Work out 5.0562203 - -2.9. 7.9562203 -41 - 44635 -44676 3.37435616+-0.004 3.37035616 Add 14 and 0.00872984646. 14.00872984646 Work out 0.5 + -134759.62. -134759.12 Work out -0.07 + 0.0811689065. 0.0111689065 -2986.502 - 66 -3052.502 Work out -127 + 561274. 561147 Calculate 0.0405 - 11.24584. -11.20534 0.4 - 4.061372 -3.661372 What is -588.31 take away 12433? -13021.31 What is 10.0182 take away 15? -4.9818 What is -34735 + 6.0353? -34728.9647 Put together 4990.3336 and 7. 4997.3336 What is 0.021 + -379717? -379716.979 What is the difference between -127567487 and 1.19? 127567488.19 Work out -0.7188 - 1318.128. -1318.8468 What is the distance between 75587 and 0.3? 75586.7 Work out -792193.1 + -0.139. -792193.239 Calculate -57 + -192598317. -192598374 What is 0.1111 less than 81.27141? 81.16031 -58.311618+-0.1 -58.411618 Calculate -2742936212 + -0.5. -2742936212.5 Subtract 27339 from 5.9632. -27333.0368 Calculate 0.3687 + 106302.1. 106302.4687 87672808 - -96 87672904 Put together 0.11 and 5035981940. 5035981940.11 Add 110343129 and -0.05. 110343128.95 -373 - -55809.42 55436.42 What is -0.04 take away 1700240449? -1700240449.04 Add together -4699 and 77165. 72466 Total of -9 and 323704.43. 323695.43 Sum 0.0351118 and 1063.5. 1063.5351118 What is 49659.51277 minus 0.4? 49659.11277 Add together 3965 and -37536. -33571 What is 0.37795 plus 0.082? 0.45995 What is the difference between 10.6575 and -13215? 13225.6575 Work out 45178 + -428.05. 44749.95 -0.3 + -337664669 -337664669.3 Subtract 138334.95 from 100. -138234.95 Put together -0.3 and 109.29915. 108.99915 Sum 19463429180 and -3. 19463429177 -5267 + 2.62 -5264.38 Sum -1739 and -17.21469. -1756.21469 Calculate 131714 + 16. 131730 Work out -0.0618 - 604.42. -604.4818 Calculate 0.55 - 5506308. -5506307.45 -0.5 + -4229785486 -4229785486.5 What is -4 take away -15465.1347? 15461.1347 What is 0.000593 - -0.0127? 0.013293 Add together -3.8 and -1232950. -1232953.8 What is 239928 + -123.91? 239804.09 Add together -0.4 and -2956755842. -2956755842.4 What is the distance between 87.7869 and 0.0874? 87.6995 What is -2 - 3715114871? -3715114873 Work out -13.748 + -0.515125. -14.263125 Work out -11 - -2331933. 2331922 What is -5704619 - 0.3? -5704619.3 What is -84.17039 - 1406? -1490.17039 What is the distance between -0.18 and 2393366? 2393366.18 Work out -0.015 - -150065. 150064.985 Put together 0.0276613 and 110. 110.0276613 Add 0 and -57928602. -57928602 What is -1309.528 minus 95? -1404.528 0.5+13.496842 13.996842 What is 7532578.19 - 0.5? 7532577.69 What is the difference between -1 and 1594.235871? 1595.235871 What is 190167724 minus 2? 190167722 What is 0.1255784 plus 0? 0.1255784 What is 635345423 + -0.6? 635345422.4 What is -1.9 less than -68.9958024? -67.0958024 Calculate 769487 - -3. 769490 Put together -1444 and 1.87382. -1442.12618 Work out -210.1 - 77.3164. -287.4164 Put together -617587 and 3844. -613743 1+1809330 1809331 What is 23746 plus -334089? -310343 Sum 3 and -36849.2061. -36846.2061 What is 0.2 + -4503874345? -4503874344.8 Calculate 0.1142031645 - 3. -2.8857968355 What is -5.9 take away 37016724? -37016729.9 Calculate -0.683 + 8665. 8664.317 -1.276839939 - 25 -26.276839939 -0.11+-15849914.4 -15849914.51 What is the distance between 0.223 and 2273.462? 2273.239 What is the distance between 199361 and 6? 199355 Work out -611922821.21 - -0.5. -611922820.71 Work out -4.74 - 31682. -31686.74 Subtract -313636 from 0.98. 313636.98 Work out -0.56156 + 476857. 476856.43844 Sum -0.4 and 1541916237. 1541916236.6 What is 86272 less than -18.447? -86290.447 What is the difference between -13.17008 and -0.114? 13.05608 What is 0.068 take away -573382? 573382.068 Calculate -6680 + 105. -6575 What is -5 - -663978330? 663978325 Work out 205.3362 - -561. 766.3362 What is -396 take away -0.1015984? -395.8984016 What is -15748 take away 0.1534? -15748.1534 Sum -36 and -211.3157. -247.3157 Add 281973 and 291. 282264 Sum -20965 and -344532. -365497 What is the distance between -86421145 and -0.4? 86421144.6 Add together -190.9 and 449. 258.1 What is the distance between 165066 and 121880? 43186 What is -15 less than -1611155225? -1611155210 -0.0089298 - -9271 9270.9910702 What is 454 - -934966? 935420 What is the difference between 2.9 and -0.87594891? 3.77594891 Add 1 and 41339286. 41339287 Add together -13 and -1605. -1618 Total of 234560092 and -0.1. 234560091.9 Total of -0.02 and 1879724. 1879723.98 -77242+-1286 -78528 Add together -0.62 and -0.0197284. -0.6397284 What is the difference between -0.5 and -10.736239? 10.236239 0.16+-13.504078 -13.344078 Add together 1.000289678 and -0.4. 0.600289678 Add 4699025 and -0.08. 4699024.92 Work out -18545 - 0.0716. -18545.0716 What is the difference between -0.114038 and 681? 681.114038 What is 2418 minus 4902854? -4900436 What is 0.17780034 + 0.0078? 0.18560034 Put together 1.415686993 and 0. 1.415686993 Work out 175.0466 + 0.9. 175.9466 Work out 11 + 1084409. 1084420 What is 85230 - 0.0574? 85229.9426 Work out 15 + 31144.8968. 31159.8968 What is -2503 + 174787? 172284 Sum 0.1 and 440.9531204. 441.0531204 -0.1 - -38666542 38666541.9 Calculate 642.23 - -2776. 3418.23 What is 92522.4245 less than 0.118? -92522.3065 Work out -184 - 10.7824. -194.7824 Work out 222576 - -625. 223201 Subtract 123243.71 from -0.2. -123243.91 Work out 3 - 1469687. -1469684 Sum -0.59 and -8.522059. -9.112059 What is 750 less than 12093670? 12092920 What is 140081 take away -269? 140350 Subtract 2442 from -6.2118. -2448.2118 What is 1 take away 7.5397145? -6.5397145 What is 26 - 3623172010? -3623171984 Work out -5.898 - -0.1642. -5.7338 What is the difference between 14408.603 and 0.06? 14408.543 Work out -0.11 - 193012.3. -193012.41 -3441994.1 + -119 -3442113.1 10843+8.26683 10851.26683 What is -242 less than 0.008856? 242.008856 What is 1052620 + -22.1? 1052597.9 Add -0.1 and -9.215947. -9.315947 -48020281.9 + 3 -48020278.9 Calculate -3070117 + 0.8647. -3070116.1353 What is -160.56 - -654? 493.44 What is -3.78686260537 - 0.4? -4.18686260537 What is 6774052.283 - -1? 6774053.283 -0.24+-1008643 -1008643.24 What is 1 + -69.09022? -68.09022 What is 9765.23 plus 456? 10221.23 2311+11106259 11108570 Calculate 136.977 + 6969.75. 7106.727 What is -187.06276426 minus -4? -183.06276426 Work out -9 - 35.1578. -44.1578 Total of 1.9002 and 1029. 1030.9002 251914+-0.0097 251913.9903 Add together 14 and 541399524. 541399538 Calculate 0.3 + 12415910. 12415910.3 Add together 0.2 and 2389894244. 2389894244.2 Calculate 43 - -26666.856. 26709.856 Total of -2.58 and 2.21607. -0.36393 What is the distance between 350 and -37434? 37784 What is -0.3 take away -1369.74902? 1369.44902 Put together 5.9141474 and 7. 12.9141474 Subtract -0.04113 from -6669. -6668.95887 Put together -0.0051 and -675119. -675119.0051 Add 11 and -154724434. -154724423 What is -124791 take away 1153? -125944 Add together -193561 and 352. -193209 -0.2 - 5430997056 -5430997056.2 -2 + 37.4613977 35.4613977 Calculate -0.00764 + -172686. -172686.00764 Total of 2628946654 and 0.4. 2628946654.4 Work out -1296114 + 0.06181. -1296113.93819 Work out -1042715 - -198. -1042517 Add -0.0694821 and -0.01. -0.0794821 Calculate 2744600957 + 5. 2744600962 What is the difference between -188083328 and -18? 188083310 Work out -203857 + 201702.	{ "pile_set_name": "DM Mathematics" }
Let c = b - 4. Sort x, 0.3, c. c, x, 0.3 Let n(t) = -t*3 - 8t*2 - 6t + 2. Let u be n(-7). Let i be (-705)/(-225) - 4/30. Suppose 5c - ic = 2. Put c, u, 2 in decreasing order. 2, c, u Let g = 3.9 + -3.9. Sort -2/11, g, 3, -1. -1, -2/11, g, 3 Let k(x) = x*2 - 7. Let q be k(3). Sort -4, -3, q in decreasing order. q, -3, -4 Let p be 1(1 + ((-3)/3 - 3)). Put p, 1, -4, 4 in decreasing order. 4, 1, p, -4 Let z = 18 - 20. Suppose -3y = c + 20, -20 = y - 6y. Let u = -65/2 - c. Put z, 0.3, u in increasing order. z, u, 0.3 Let g = -0.2 + -5.8. Let u = 0 - -5. Sort g, 3, u in ascending order. g, 3, u Suppose 5a = 2a. Suppose 4r - u + 20 = a, 3r - 5u = r - 10. Put -3, r, 0.3 in decreasing order. 0.3, -3, r Let k = 4 + -4.3. Let x(c) = c + 2. Let z be x(3). Put k, 3, z in decreasing order. z, 3, k Let x = 7 + -6.8. Put 5, 4/3, x in ascending order. x, 4/3, 5 Let p(g) = g3 - g2 - 4g + 3. Let y be p(2). Let t be 2/6(-6)/4. Let d = -106 + 106. Put d, t, y in decreasing order. d, t, y Let h be 0 + ((-2)/(-3))/2. Let m(o) = -6o3 - o2 + o + 1. Let x be m(1). Sort x, 4, h. x, h, 4 Suppose i - 6 = 3f, i = 5f + 9 - 1. Put f, -3, -6 in ascending order. -6, -3, f Let i(f) = -f*2 + 5f + 2. Let v be i(6). Let k = v + 5. Sort k, -5, 5 in ascending order. -5, k, 5 Suppose 9 + 3 = 4w. Let v = -8 - -11. Let m be (-4 + v)/(1/2). Put 0, m, w in ascending order. m, 0, w Suppose 0 = 3d - 3 - 9. Let l be 5/(-20) + (-21)/(-4). Suppose 4j = 2j - 2. Sort d, l, j in increasing order. j, d, l Suppose -2s - 6 = -0. Sort -7, -2, s, 0 in descending order. 0, -2, s, -7 Let w(i) be the first derivative of 1/3i*3 + 2i + 1/4i4 + 1 + 0i2. Let d be w(0). Sort -4, 1, d in increasing order. -4, 1, d Let r(t) = t2 - 3t + 1. Let c be r(2). Put -3, -4, c in descending order. c, -3, -4 Let y = 7 - 11. Let f be 6/(-8) - 10/(-8). Put y, -5, f in increasing order. -5, y, f Let i be 22/5 - (-4)/(-10). Suppose d + 2a - 2 = 3a, 2d + ia = 4. Suppose -4c - 28 = dr, r = 5c - 0r + 21. Put -0.4, -4/7, c in decreasing order. -0.4, -4/7, c Let r = -18 - -13. Suppose -8 = -s - x - x, 16 = 3s + 4x. Put r, s, -3 in decreasing order. s, -3, r Let y(h) = h. Let o be y(5). Let f = o + -7. Sort 5, -5, f in descending order. 5, f, -5 Let w = -0.0388 + -3.0712. Let i = w - -0.11. Put 5, 0.4, i in ascending order. i, 0.4, 5 Suppose a = 2b + 6 - 0, -b = 1. Sort a, 2, -3, 0. -3, 0, 2, a Let u = -4.1 + -0.9. Let o = -3.2 - -3. Let h = -0.3 + o. Sort h, -2, u. u, -2, h Let u = 56 - 282/5. Put -2, 0.5, 2, u in increasing order. -2, u, 0.5, 2 Let w be 2/(-20)-22. Let d = 136 - 135.5. Put d, -3/2, w in increasing order. -3/2, w, d Let k be ((-5)/(-15))/((-7)/6). Put 0.3, -0.06, k in ascending order. k, -0.06, 0.3 Let o = -2 + 2. Suppose -5 = 2m - 3m. Suppose 10 = 5h, -ma - h = 3h + 7. Sort o, 5, a in increasing order. a, o, 5 Let i = 857/6 + -143. Sort -6, -0.1, i. -6, i, -0.1 Let a(k) = -k2 - 4k + 29. Let r be a(-8). Sort 2, 0.5, r, -2 in ascending order. r, -2, 0.5, 2 Let u = 6 - 5. Let x = -5/7 + u. Sort -3, x, -3/7 in decreasing order. x, -3/7, -3 Let m = 0.06 + -0.06. Let n = -8 - -11. Sort m, n, -5 in descending order. n, m, -5 Let r be (2 + 4/(-2))/(-1). Sort -4, -3, r in decreasing order. r, -3, -4 Let t(x) = -x + 2. Let b be t(2). Let a(c) = c*2 + 3c - 3. Let m be a(-3). Sort m, -2, b in decreasing order. b, -2, m Suppose -5 = a + 4a. Put -2, 0, a in decreasing order. 0, a, -2 Let u = 10.1 + -11. Let l = 0.1 - u. Put l, -0.2, -1/9 in decreasing order. l, -1/9, -0.2 Let c = 3.03 + -0.03. Let v = 1 + 14. Suppose 4f - f = v. Sort c, f, 4 in increasing order. c, 4, f Let n be (-4 + 14/4)10. Sort -12, n, 2, -4 in descending order. 2, -4, n, -12 Let m = 108 + -110. Sort 1/3, m, -7 in ascending order. -7, m, 1/3 Let t = 10 - 8. Let g be -6 + (t - 3)-3. Suppose v - k = -6k + 27, -5k + 15 = -5v. Sort g, v, 0 in decreasing order. v, 0, g Let s = 0.65 + -0.85. Let i = -1 + 1. Put 5, i, s in decreasing order. 5, i, s Let h be -103/(-9)-3. Let d = 6 + h. Sort 2, 1, d. d, 1, 2 Suppose -4h + 0 = 4. Let y(k) = 7k - 1. Let d be y(1). Let c(g) = -g3 + 5g*2 + 4g + 7. Let z be c(d). Put 4, z, h in descending order. 4, h, z Let l(r) be the second derivative of -r4/12 + r3 + r*2/2 - r. Let j be l(6). Sort j, -5, 2 in descending order. 2, j, -5 Let p = -0.1 - -1.1. Let l = 13 - 29. Let o be 5(-2)/l-2. Put p, -0.4, o in increasing order. o, -0.4, p Let f = -69 - -69.2. Sort 4/3, f, -7 in ascending order. -7, f, 4/3 Let u(n) = -2n*2 + 7n - 4. Let o be u(4). Let l be (-15)/44 + (-2)/o. Let f = -76/111 - -2/111. Put l, f, 0 in decreasing order. 0, l, f Let n be 5/((-30)/(-3))12/14. Sort n, -4, 0.3 in decreasing order. n, 0.3, -4 Suppose -3o + 0o + 2q - 10 = 0, -25 = o - 5q. Let p = -43/33 + 18/11. Sort o, -4, p in decreasing order. p, o, -4 Let k = -2.83 - 0.07. Let n = -3.3 - k. Put 0.5, n, -2/13 in increasing order. n, -2/13, 0.5 Suppose -35 = 2u - 29. Put 3, 1, u in decreasing order. 3, 1, u Let j be (12/21)/(12/14). Let g = -0.6 + 5.6. Put j, g, 4 in increasing order. j, 4, g Let i = 19/3 - 6. Let x be 95/50 + 6/(-4). Sort i, x, -2/11. -2/11, i, x Let v = -11 + 6. Let z = v + 11. Let x = -2 + z. Sort x, 0, -4 in increasing order. -4, 0, x Let y = -6 - -17. Suppose o = -3d - 17, -3o + 4d + y + 3 = 0. Let u be (o/(-2))/(-1 + 0). Put 4, 3, u in increasing order. u, 3, 4 Let l = -175 - -176. Sort 3, -0.4, 2/9, l in descending order. 3, l, 2/9, -0.4 Let j = -0.38 - 0.02. Let h = 1.28 - 0.28. Sort h, -3, j in decreasing order. h, j, -3 Let i = -9 + 14. Let w(q) = -2q. Let l be w(2). Suppose -3d - v = 14 + 4, 3v = 4d + 11. Put l, i, d in descending order. i, l, d Suppose -8 = -3q + q. Suppose 0 = -5r - q - 16. Let y = 0.172 - 0.182. Sort y, 3, r in ascending order. r, y, 3 Let x = 10 - 7. Sort -3/4, x, 4/7 in descending order. x, 4/7, -3/4 Let b = -44 + 131/3. Let x = -0.3 + 9.3. Let o = -4 + x. Put b, o, 2 in descending order. o, 2, b Let k be ((-76)/72 + 1)-8. Sort k, -2/13, -1 in increasing order. -1, -2/13, k Let a(h) be the third derivative of h4/24 + h3/6 + 2h2. Let p be a(-5). Sort p, 3, -5 in descending order. 3, p, -5 Let z = 29 + -25. Put -0.5, z, -0.7 in descending order. z, -0.5, -0.7 Suppose 6q - 25 = q. Let l(j) = -2j + 11. Let u be l(q). Let w = -6.4 + 6. Put w, u, -0.3 in descending order. u, -0.3, w Let j = -80 + 85. Sort j, -1, 2 in decreasing order. j, 2, -1 Let x = -7 + 7. Suppose -2r - 3d + 5 = 0, -3r + 0d + 2d - 12 = 0. Let j be 2/(-14) + 0 + 0. Sort x, j, r. r, j, x Suppose -3s = 4s + 14. Sort 4, -1, 0, s. s, -1, 0, 4 Suppose -2q - c + 14 = -32, 4q - 100 = 2c. Put -1, q, -3 in ascending order. -3, -1, q Let f = -53 - -58. Let m = 2/47 - -39/188. Put m, f, 1 in descending order. f, 1, m Let h be (3/(-195))/(4/(-6070)). Let g be (1/5)/((-2)/(-235)). Let t = h - g. Sort 1, -1/3, t in increasing order. -1/3, t, 1 Let h be (4 + (-76)/16)/(31). Put 3, -1, -2, h in increasing order. -2, -1, h, 3 Suppose -5l - 21 = -3w, 3l - 2w + 1 + 12 = 0. Suppose -1 - 3 = 2i. Put -1, i, l in decreasing order. -1, i, l Let c = -1.7 - -0.7. Let l = 0.8 + c. Sort l, -0.4, 1/2. -0.4, l, 1/2 Let i be -5((-26)/30 + 1). Let v be 5/10(0 + 2). Let m be (-1)/v - (-13 + 10). Put 0.4, m, i in increasing order. i, 0.4, m Let q = 0.284 + 0.216. Let o = 7 - 6.4. Put o, 4/3, q in descending order. 4/3, o, q Let a be 8/((-80)/15) - (-3)/(-2). Sort -2, a, 9, -1 in descending order. 9, -1, -2, a Let r = 0.6 + 0.3. Sort 4, r, 2/7, 1 in ascending order. 2/7, r, 1, 4 Let k = 0.5 + -0.5. Let q = -11 + 12. Sort -0.1, k, q in descending order. q, k, -0.1 Let p(x) = 2 - 3 + 0x*2 - 4x*2. Let m be p(1). Let y be 1 + (-2 - 6) + 1 + 3. Sort y, m, 2 in descending order. 2, y, m Let w be (-11)/(2 + (-3)/3). Let b = w + 8. Put -2, b, -5 in descending order. -2, b, -5 Let m = 76 - 74. Let i = -0.1 - -0.1. Let k = i + m. Sort -1/4, k, 2/5 in decreasing order. k, 2/5, -1/4 Let r = -17 - -16. Let t be 1/6 - r/(-6). Sort -4, 3, t in descending order. 3, t, -4 Let c = 0.2 - 4.2. Let g = 3.9 + c. Sort -0.2, 2/3, g in increasing order. -0.2, g, 2/3 Let l(r) = r - 2. Let g be l(2). Suppose -i + 5o + 2 - 1 = g, i - 11 = -5*o. Suppose 0 = -n +	{ "pile_set_name": "DM Mathematics" }
s - u for s. 1 Let m(f) = -5f - 9. Let a(y) = 2y + 1. Let o(j) = -6a(j) - 2m(j). Let g be o(3). Solve 2b - gn = -3n, 2n + 8 = 4b for b. 3 Suppose 3l + 3501 = 3i, i + 444 = 5l + 1623. Let w = i - 1159. Let u be 7 + -2 - (1 + -1). Solve -wn - 40 = 4c, -un - 8 = 12 for c. -5 Suppose -158 - 813 - 394 = -273b. Solve 12l = -d + 13l + 8, 0 = -bl - 20 for d. 4 Let b be 2/6 - 29/(-3). Suppose 4u + u = b. Let i = -251786 - -251789. Solve x = -ix + uq + 10, 4q = x - 20 for x. 0 Suppose z + 453n + 6 = 454n, -4z - 5n = -48. Solve -3p - zo = -9, -o = -2p - 3o + 8 for p. 1 Let h be 98/21 + (-26)/39. Solve hr + 5q = 13, 0 = r - 3q - 2 + 3 for r. 2 Let s = 4254 + -4250. Solve m + sl = -21, 18 = 2m - l - 3l for m. -1 Let b = -85394 - -85408. Let l be (-17)/(-4) + (-1)/4. Solve b = 2n + 2n - 2g, lg = -12 for n. 2 Suppose 11q - 4q = 105. Let x(z) = -2z + 2. Let a be x(-1). Suppose w + 0w = -5y + 26, ay - 3w - 17 = 0. Solve 5b = -i + q, -yi - 4b + 16 = 4 for i. 0 Let i be ((-8)/14)/(340/35 + -10). Suppose -iy + 4y = -12y. Solve -4g + ys = -2s - 8, -5g - 3s = -10 for g. 2 Let o(v) = 4v2 - v2 - v2 + 3v*2 - 4 - 2v. Let c be o(2). Suppose cr = 11r + 1. Solve 2z - 3g = -5g - 6, r = g for z. -4 Let y(s) = -s3 - 40s*2 - 74s + 88. Suppose 448c - 446c + 76 = 0. Let a be y(c). Solve 0 = -3x + l - a, 3x + 2l + l = 0 for x. -3 Suppose 0 = 8f + 41f - 515 - 1935. Solve 2y + 4u + 10 = 0, 62y - 5u = 57y + f for y. 5 Suppose -4n + 3 = -n. Suppose 0 = -6j - 7350 + 636. Let u = j + 1123. Solve 3m - u = -2c + n, 3c - m = -20 for c. -5 Let o(q) = -2q*2 + 17q + 200. Let d be o(15). Solve 0 = 5x - 9x + da - 3, -2x = -2a for x. 3 Let f = -1084 - -1089. Suppose 4b + 0 - 4 = 0. Suppose -4k = -b - 7. Solve 3t + 2a = -9, 3t - kt - 10 = -fa for t. -5 Let t(u) = 11 - 110u + 17 + 96u. Let w be t(2). Solve -28 = -5j - 4b, -16 = -5j + 2b - wb for j. 4 Suppose 2c + c - 210 = w, -w = -2c + 209. Let z = 210 + w. Solve 2j = 4i - 28, 3j + zi - 35 = 8j for j. -4 Suppose -2f + 6b = 4b - 68, 5f = -4b + 179. Suppose -4m - 9 + 24 = 5n, 0 = n + 5m - 3. Solve 0 = 5l - 5k - 10, nl - f = -l - 5k for l. 5 Let n be (1 + 24/(-18))/((-1)/21). Suppose nq = 3q + 12. Suppose qa = 39 - 15. Solve 2t = x + a, t - 5 = 2t + 4x for t. 3 Suppose -9q + 107 = -199. Suppose q = 16k + k. Solve 0t = -kc - 4t, -4c + 18 = -t for c. 4 Suppose -40u - 36 + 36 = 0. Solve 3j - 68 = -3s - 44, u = 2j - 6 for s. 5 Suppose 80g - 77g = 627. Suppose 0 = u + 205 - g. Solve 5s + 5j = 2 + 33, s = uj - 18 for s. 2 Suppose -2n = 3x - 455, 0x + 3x = -3n + 681. Let s = n - 219. Solve 0 = d + 3f - 16, -sf + 32 = 4d - 3f for d. 4 Suppose -2j + 10 = -24. Suppose -2 = 3p - j. Suppose 3 = -m + 1, 4m - 12 = -ph. Solve -g = 3g - s + 19, -hg - 5s - 1 = 0 for g. -4 Suppose 0 = r - 2a - 54 + 37, 0 = r + a - 23. Solve -5v + 18j + 19 = rj, 0 = 2j - 6 for v. 2 Let s(a) = 9a3 - 35a*2 - 2a - 5. Let j be s(4). Let o = 14 - 12. Solve -jn + 10 = on, -5 = -5c - 5n for c. -1 Let a(i) = 2i2 - 15i - 42. Let q be a(11). Solve 2r + 20 = 3c, 2r = 5c + 7 - q for r. -4 Let n(k) be the first derivative of 10k2 + 82k + 285. Let t be n(-4). Solve 0o = -o - 2g - 4, -to = -2g + 8 for o. -4 Let v(k) = -k*3 + 22k + 20. Let a be v(5). Suppose -ay = -5t, 9 = -2y - 3t + 24. Solve -4z = s - 24, 2s + yz + 12 = 7z for s. 4 Let v = 56 - 53. Suppose 3l - 13l = -vl. Suppose -r + 8r - 28 = l. Solve -4c - 1 = -3g, -36 = c + 3c + rg for c. -4 Let k = 16 + -16. Suppose 0 = -kb + b - 5. Suppose 3q + 76 = 4p, 57 = 3p + 2q + 17. Solve 4r = -2z + p, bz = 3r - 0 + 1 for r. 3 Let f = 64 - 60. Suppose 0 = fv, 0o + 6 = 2o - 5v. Let z be -3(-1 + 2 + (-5)/o). Solve 6y - y = 3t - z, -12 = -t - 4y for t. 4 Let w be 6/4 - (319/22 + -13). Solve w = -10v + 12v + 4l + 2, 4v + 3l + 9 = 0 for v. -3 Let q = -6 - -6. Let o = -61 - -68. Suppose -oa = -2a - 10. Solve -af = f - 4l - 1, -2f - l - 14 = q for f. -5 Suppose 0 = -2156a + 2173a - 204. Solve 5x + 3y - 7 = 0, -5x + 15y = 13y - a for x. 2 Suppose 99q = 4y + 103q + 12, 2q + 18 = 4y. Solve 4a - 2w - w = 19, 0 = a - yw - 11 for a. 1 Let z be (15 - 17)/(6/1)-15. Solve 9o - 4o + zh = -30, o + 5h + 26 = 0 for o. -1 Let m be 6/(10/20-5 + 4). Solve w = 0, 4w = -4q + 20 - m for q. 4 Suppose 0 = -4t + 3a - 88, 0a - 5a + 20 = 0. Suppose -20w + 12w - 184 = 0. Let b = t - w. Solve -3q + h - 8 = -h, bh - 4 = 0 for q. -2 Let z be (-80)/120 + (-2 - 38/(-3)). Suppose -zh + 26 = 3h. Solve -hi + 4 = 2l, -i + 0i = -5l + 4 for l. 1 Let u be (-1)/(3 - (-3)/((-9)/10)). Let z(w) = 2w - 4. Let t be z(u). Suppose -tg - 16 + 20 = 0. Solve -3k - 9 = -2y, k + 2y - g = 3 for k. -1 Let a be 80/(-32)(-108)/(-15)-1. Solve -a = -3h - 2p + p, 5h - 2p - 19 = 0 for h. 5 Let g be (-520)/(-26) - 68/4. Solve gi - 21 = -3l, 0 = i - 4l + 27 - 14 for i. 3 Suppose 6 = 2y + 3t, 3y = 2t - 8 + 4. Suppose y = -2a + 69 - 59. Solve 3c = 3b - 15, 2b + 11 = ac + 36 for c. -5 Suppose -103h + 35 = -102h. Suppose -80 = -2g + 40c - hc, 0 = 3g - 5c - 115. Solve -5n = 2d - g, -n - 7 = 4d - 32 for n. 5 Let t(x) = -10x + 20. Let m be t(2). Solve m = 3p - 3i + 18, 0 = 44i - 39i - 5 for p. -5 Suppose -8p + 1401 + 1143 = 0. Let d = p + -314. Solve -m + 3m + 15 = 5k, -3k - dm = -9 for k. 3 Let h(a) = -a3 - 13a*2 + 14a + 4. Let g be h(-14). Suppose -f = 4f - 25. Let k = -3 - -14. Solve -w + gi - k = -0w, 3w + 12 = fi for w. 1 Suppose f = -4u + 8, f - 10 = u - 4u. Suppose -12 = fk - 60. Solve 2s + 0 = -q + 11, 2q + ks - 19 = 0 for q. 5 Suppose -2k + 11858 = 11852. Solve -3n + 34 = 5c, kn - 4 = -14c + 15c for n. 3 Suppose -190 - 165 = -10j - 61j. Solve jh = 4x - 13 - 21, 3h = 3x - 24 for h. -2 Let v(n) = 29n + 597. Let c(x) = -6x - 119. Let s(b) = -11c(b) - 2v(b). Let p be s(-14). Solve py - 5 = 2t + 1, -y - 2t + 10 = 0 for y. 4 Let x(r) = 5r2 - 9r - 16. Let y be 4 + -6 + 9 - 9. Let d be x(y). Solve 5b - 19 = t, -2b + 2t = -2t - d for b. 3 Let t(c) be the second derivative of c*4/6 - 20c*3/3 - 4c*2 - 5c. Let m be t(17). Let u = m - -115. Solve -up + 3r = 40, -2p - 3p = -4r + 45 for p. -5 Let d = 1042 + -1001. Suppose 339 + 686 = dg. Suppose -7 - 13 = -4a. Solve -5r = 3w + 9, 0 = -r - 4r + aw - g for r. -3 Let d(r) = r3 + 83r*2 + 387r - 7. Let c be d(-5). Solve 5o - c = u, -3o + 2 = -3u - 10 for u. -3 Suppose 8r + 171 = 123. Let m be (12/(-10))/((-160)/25 - r). Suppose 4z - v - 8 = v, 4v + 2 = z. Solve -zq = -k + m, 7 = 2q - 0q + k for q. 1 Let n be (-6)/1 + (-9 - (-104)/13). Let v be 8/28 - 19/n. Solve o - v = m, -5m - o - 4o + 25 = 0 for m. 1 Let p(d) = d + 2. Let k be p(7). Let b = k - 4. Suppose 3i - 5q + 8 + 11 = 0, -18 = -4i - 2q. Solve -20 = 5x, b = -c - ix + 1 for c. 4 Let f = -5775 - -5779. Solve 3z = i - 3, -5i - 27z + 23z = f for i. 0 Let f = -506 + 508. Let n be (2 + 0)/(10 - 3 - 6). Solve nu + x - 7 = u, fx = 5u - 14 for u. 4 Suppose 0 = -5k + f + 59 - 31, 0 = -k - f + 2. Solve -3p = ks + 13 + 6, 0 = -5p + 2s - 11 for p. -3 Suppose 0 = -31v + 37v - 48. Suppose 9w + v - 53 = 0. Solve -4h + 8 = 0, -wo - 8 + 1 = 4h for o. -3 Suppose -o = 39 + 41 - 84. Solve 6g = oq - 32, 10g = 3q + 6g - 23 for q. 5 Suppose 16l - 19l = -3. Suppose 3m - i + 1 = m, -i + l = 4m. Solve mc + 4 = -k + 2c, 4k + 2c + 16 = 0 for k. -4 Let j = -13809 - -13811. Solve -4b - 14 = 2q, -jq - 18 = -5b - 31 for q. -1 Let s = 1206 - 494. Let w be (9/4 - 2)/(89/s). Solve d + 2d = y + 2, wy - 5d + 3 = 0 for y. 1 Let s be -10 - 6(-28)/12. Solve 15f + 9 = -3z + 13f, -4f = -sz - 32 for z. -5 Let s(f) = -227f*3 + 2f*2 + 4f + 3. Suppose -6n + 5 = 11. Let p be s(n). Suppose -p + 78 = -5d. Solve 0 = 5b + j + d, -5b + 6j - j = 0 for b. -5 Let y = -50 - -69. Solve -13z + 10z + 2l = y, 4z + 5l = 13 for z. -3 Suppose -3 = g + 5c + 4, 3c = -15. Let p(u) = u*3 - 20u*2 + 33u + 56. Let h be p(g). Solve -6 = hz + 3y, 0 = -4z - 2y - 0 - 4 for z. 0 Suppose -3a + c = 740, 2c + 8 = -a - 241. L	{ "pile_set_name": "DM Mathematics" }
is the second biggest value? (a) -0.2 (b) 0.4 (c) -960.6 (d) -2/5 (e) 4 b Which is the second smallest value? (a) 11.4 (b) 0.3 (c) 51 a Which is the third smallest value? (a) -3.2 (b) 10 (c) 263 c What is the fourth biggest value in 1/4, -30, -4, -0.203, -0.5, -3? -3 Which is the fourth smallest value? (a) 23 (b) -2 (c) 0.3 (d) -15/94 a Which is the smallest value? (a) 11 (b) 26404 (c) -10 c What is the second smallest value in -2, 7168, -0.3, 4? -0.3 Which is the fourth smallest value? (a) 7 (b) 5 (c) 1 (d) -11/6 a What is the second biggest value in -1/6, -2, 2/11, 2/99? 2/99 Which is the second biggest value? (a) 1/2 (b) -0.1 (c) 13 (d) -37 (e) 3/14 a Which is the third smallest value? (a) 4/3 (b) -3/5 (c) 0.04 (d) -6 (e) -107 b Which is the second biggest value? (a) 5/6 (b) 1/5 (c) -1/8 (d) -26/3 (e) 5 a Which is the fourth smallest value? (a) 2/13 (b) -0.18 (c) 0.03 (d) 0.035 (e) -5 d Which is the fourth biggest value? (a) 0.2 (b) -1/10 (c) -3 (d) 2239 c Which is the second smallest value? (a) 4 (b) 0.09 (c) -12 (d) 1 (e) 23 b What is the smallest value in -2/3, 0, -20, 0.4, -6/11? -20 What is the biggest value in -57, 4, 1966, -5, 2/5? 1966 What is the second biggest value in 401/6, -20, -0.4, 3/5? 3/5 What is the third biggest value in 7456, 3, 0.012? 0.012 Which is the fourth smallest value? (a) 2 (b) 1/78 (c) 1 (d) -1 (e) 1/18 (f) -1.2 e Which is the fourth smallest value? (a) -5 (b) 2/19 (c) -40 (d) -23 b Which is the second biggest value? (a) 5 (b) 146 (c) -10/3 a Which is the smallest value? (a) 5 (b) -0.2 (c) 0.1 (d) -3 (e) 15/22 d Which is the fifth biggest value? (a) 4 (b) 5 (c) -461.5 (d) 0.4 (e) 3/4 (f) -3/4 f What is the third smallest value in -5, 0.2, 1/24, 0.13? 0.13 What is the fifth smallest value in -17/3, -1, 4, 0.2, -347? 4 Which is the smallest value? (a) 2/45 (b) 0.13 (c) 31 (d) 3 (e) -19 e Which is the biggest value? (a) 1 (b) -3 (c) 56 (d) -2 (e) -0.5 (f) 2/7 c What is the third biggest value in -0.2, -3, -2/7, -21, -4, -2/201? -2/7 What is the fifth smallest value in -0.4, -2/9, -5/136, -1/6, 1/5? 1/5 What is the third biggest value in 0.1, -2158.8, 0.05? -2158.8 What is the third biggest value in -2, 0.2, -1/2122, -3/8? -3/8 Which is the fourth smallest value? (a) -29 (b) -3/7 (c) -7 (d) -5 (e) -31 d What is the fourth smallest value in 0.3, 3/4, -3, 18, -33, -2/13? 0.3 What is the third biggest value in 0.3, -2429, 102? -2429 Which is the biggest value? (a) 218 (b) 970 (c) -5 b What is the biggest value in -146, 198, -2/9, 1/6? 198 What is the smallest value in -1/3, -5, -0.1, -251, 200? -251 What is the third biggest value in 0.4, 0, 0.2, 129? 0.2 What is the fourth smallest value in 0, -0.033, -9013, -1/4? 0 What is the fourth smallest value in 0, -3/2, 0.13, -3, 2/9? 0.13 Which is the second biggest value? (a) -16 (b) 3 (c) 614 (d) -3 b What is the third biggest value in -0.1, -0.5, 6802? -0.5 What is the second smallest value in 1.1, -3, -5, -2/9, -0.8? -3 Which is the biggest value? (a) -9511 (b) -0.5 (c) -3/7 (d) 8 d Which is the third biggest value? (a) -1.168 (b) -2/17 (c) 1 (d) 2 b What is the fifth smallest value in 2, 1/3, -5, -0.8, -324, -0.5? 1/3 What is the second smallest value in -122, 0.2, -1, -0.1, 8, 1.2? -1 Which is the fourth smallest value? (a) -677 (b) -0.03 (c) -13 (d) 1/6 d What is the second biggest value in 1, 0.336, -0.3, -1.7? 0.336 What is the fourth smallest value in -0.1, -9, 0.3, 16, -1/9, -0.195? -0.1 What is the second biggest value in 1516, 0.5, 5, 3? 5 Which is the third smallest value? (a) 14 (b) -2/9 (c) 6/65 a Which is the third biggest value? (a) 0.5 (b) -0.051 (c) -0.2 (d) -17 (e) 1 b Which is the fifth biggest value? (a) 3/5 (b) -0.12 (c) -13 (d) 0.2 (e) -1.9 (f) 0.5 e What is the second smallest value in -5/4, 2, 0.1, -0.1, 0.2, -209? -5/4 What is the third smallest value in -0.4, -0.2, -10, -73, 16, 3? -0.4 Which is the fifth smallest value? (a) -32 (b) -3 (c) 2/9 (d) -1 (e) -5 (f) 5 c What is the third biggest value in 560, 2/3, 2/11, -1, -0.2? 2/11 Which is the third smallest value? (a) 5 (b) 0.32 (c) -0.1 (d) 1/7 (e) 4 (f) 8 b Which is the fourth biggest value? (a) -5 (b) 21 (c) -1/5 (d) -11 (e) -4 a What is the fourth smallest value in -1/2, 561, -0.1, 0.11, -5? 0.11 What is the fourth smallest value in 0, -7, -3, 5, 1.3? 1.3 What is the second smallest value in -2/7, 2, -6, 0.019, -7? -6 What is the second biggest value in -19, -102/5, -5, 2/5? -5 What is the second biggest value in 19/4, -0.4, -39? -0.4 Which is the fourth biggest value? (a) 3 (b) 1 (c) 0 (d) -481 (e) 4 c What is the fourth biggest value in -51, -46, 1/4, -3/10, 3/2, 5? -3/10 Which is the third smallest value? (a) 0.2 (b) -629 (c) 5 (d) 2 d What is the fifth smallest value in 3, 1/3, 120/13, -5, 9? 120/13 Which is the smallest value? (a) 10 (b) 1/8 (c) 0.111 c Which is the fourth smallest value? (a) 3 (b) 2 (c) 90/67 (d) -2/11 a What is the third smallest value in 45, -0.5, 3, 1, 18/11, -2? 1 Which is the fifth smallest value? (a) -0.5 (b) 0 (c) -340 (d) 4 (e) -2/17 (f) -2 b What is the second biggest value in 0, 319, 5/7? 5/7 Which is the sixth biggest value? (a) -90 (b) -1 (c) 2/13 (d) 0.1 (e) 1/4 (f) 2/5 a Which is the second biggest value? (a) 0.1 (b) -0.05 (c) -1.02 (d) 1/5 a What is the third biggest value in -3/35, 7/50, 0.3, -2, -3? -3/35 What is the fifth smallest value in -1/6, 2/7, 5, 0.079, 23, 0.5? 5 What is the biggest value in 82, 0.5, 1/4, -2.9, -5? 82 What is the second smallest value in 5, 2, 21, -1638, 0.3? 0.3 What is the smallest value in 1.3, -11/2, -8/37? -11/2 What is the biggest value in -0.2, -24, -1527? -0.2 What is the smallest value in -1, -0.37, -409, 3? -409 Which is the fifth biggest value? (a) 0 (b) -0.1 (c) -15 (d) -0.07 (e) 0.0599 c What is the second biggest value in 5, -100/9, -13, -0.4, 4/21, 1? 1 Which is the smallest value? (a) 2/13 (b) -3/4 (c) 142 (d) -197 (e) 2/5 (f) 2 d Which is the third biggest value? (a) -7/2 (b) 2/5 (c) 19 (d) -8.74 a Which is the third biggest value? (a) 11587 (b) 1/9 (c) -3/2 c Which is the biggest value? (a) -0.06 (b) -37.96 (c) -28 a What is the second biggest value in 5, -6, -2, 842? 5 What is the second biggest value in -32, -4, 16, 0.13? 0.13 Which is the third biggest value? (a) -3/8 (b) 4151/6 (c) 14 a What is the third biggest value in 4, 2/33, -1.54, -4.2? -1.54 What is the second biggest value in 5/2, -4, 5, 0.0818, -13? 5/2 Which is the third biggest value? (a) -8 (b) 52 (c) -1 (d) 0.3 c What is the third smallest value in -4, -16, -1/3831? -1/3831 What is the second smallest value in -12, 4, -1, 1/27, -0.5? -1 Which is the third smallest value? (a) 1 (b) -29 (c) -0.08 (d) -1 (e) 2 c What is the smallest value in -3, -1/2, 27902? -3 What is the biggest value in 5, 3/5, 0.21, -1/4, 2/9, -18? 5 Which is the third smallest value? (a) 0.3 (b) 12426 (c) -13 b What is the second smallest value in -19, -2/5, 385, 1? -2/5 What is the second biggest value in 23, 0.008, -60? 0.008 What is the third biggest value in 0.5, -1885, 5, -5? -5 Which is the smallest value? (a) -2/15 (b) -0.176 (c) -3 (d) 4 c What is the biggest value in -3/7, -0.11, 3, 7, 32? 32 Which is the smallest value? (a) 4/9 (b) 9 (c) 31 (d) -6 (e) -1 d Which is the third smallest value? (a) 2/3 (b) -12 (c) 4 (d) 17 c Which is the second smallest value? (a) -0.4 (b) 39/86 (c) 0.4 (d) -25 (e) -4 (f) -2/7 e What is the third smallest value in -0.4, 0.1, -2/9, -20, 3? -2/9 What is the biggest value in -0.5, 3, 0.04, -231.5, 5? 5 What is the smallest value in 1, -60, 92/29? -60 What is the second smallest value in -1/3, 2/3, -2/3, -3, -11/14, 65/9? -11/14 What is the biggest value in -1/4, 99/7, -0.2, -76, 4? 99/7 What is the second biggest value in 0.17, 3, -0.5, -65/3, 2, -3? 2 Which is the sixth biggest value? (a) -2/9 (b) 177 (c) -0.3 (d) 3/5 (e) -0.5 (f) -4/5 f Which is the second smallest value? (a) -9530 (b) -4 (c) 2/5 b Which is the third smallest value? (a) 1/7 (b) -1 (c) -126 (d) -9 b What is the third smallest va	{ "pile_set_name": "DM Mathematics" }
, 87800, 156127? 9762i2 - 7i - 37 What is the s'th term of -31241, -30897, -30553, -30209? 344s - 31585 What is the f'th term of -140418, -561304, -1262662, -2244492, -3506794? -140236f*2 - 178f - 4 What is the k'th term of -7037, -58691, -198895, -471923, -922049, -1593547, -2530691, -3777755? -7379k3 - k2 + 2k + 341 What is the i'th term of 4635, 4316, 3447, 1752, -1045, -5220? -46i3 + i2 + 4680 What is the q'th term of -410, 5408, 21222, 52036, 102854, 178680, 284518? 834q*3 - 6q*2 - 2q - 1236 What is the z'th term of 264, 1010, 2264, 4026? 254z2 - 16z + 26 What is the z'th term of 227, 1071, 2479, 4451, 6987, 10087, 13751? 282z2 - 2z - 53 What is the g'th term of -13616653, -13616649, -13616643, -13616635, -13616625? g*2 + g - 13616655 What is the q'th term of -38066, -38673, -40322, -43535, -48834, -56741, -67778? -87q3 + q2 - q - 37979 What is the n'th term of 13274, 12888, 12312, 11546, 10590, 9444? -95n2 - 101n + 13470 What is the x'th term of 13477, 13355, 13159, 12895, 12569, 12187, 11755? x*3 - 43x*2 + 13519 What is the z'th term of -673558, -1347111, -2020664? -673553z - 5 What is the i'th term of 314501, 628983, 943465? 314482i + 19 What is the j'th term of -445, -777, -1623, -3223, -5817, -9645? -40j*3 - 17j*2 - j - 387 What is the i'th term of 54600, 54481, 54370, 54267, 54172? 4i*2 - 131i + 54727 What is the f'th term of -9442, -9597, -9846, -10183, -10602, -11097? f*3 - 53f*2 - 3f - 9387 What is the r'th term of 3207266, 3207262, 3207258, 3207254, 3207250? -4r + 3207270 What is the k'th term of 21335187, 21335123, 21335059, 21334995, 21334931? -64k + 21335251 What is the v'th term of -3902210, -7804419, -11706630, -15608843, -19511058, -23413275? -v*2 - 3902206v - 3 What is the m'th term of 1570, 1484, 1324, 1078, 734, 280? -2m3 - 25m*2 + 3m + 1594 What is the h'th term of -1646545, -3293077, -4939609? -1646532h - 13 What is the o'th term of -103465, -103456, -103445, -103432, -103417? o2 + 6o - 103472 What is the f'th term of -3219571, -6439161, -9658755, -12878353? -2f2 - 3219584f + 15 What is the i'th term of 9586985, 9587018, 9587049, 9587078, 9587105? -i*2 + 36i + 9586950 What is the g'th term of 967, 5164, 14419, 30580, 55495, 91012, 138979, 201244? 308g3 + 681g*2 - 2g - 20 What is the v'th term of -52904, -105829, -158754, -211679? -52925v + 21 What is the t'th term of -8126, -16509, -25136, -34007, -43122, -52481? -122t*2 - 8017t + 13 What is the o'th term of -1604069, -3208192, -4812315, -6416438? -1604123o + 54 What is the o'th term of -206510, -206667, -206824, -206981? -157o - 206353 What is the v'th term of 347004, 1388031, 3123078, 5552145, 8675232, 12492339? 347010v2 - 3v - 3 What is the i'th term of -1727, -1573, -1277, -839, -259? 71i2 - 59i - 1739 What is the p'th term of 444184, 888582, 1332980, 1777378, 2221776? 444398p - 214 What is the j'th term of -523210, -523910, -524610, -525310, -526010? -700j - 522510 What is the w'th term of 81097357, 81097359, 81097361? 2w + 81097355 What is the n'th term of -5441, -5695, -5949, -6203, -6457? -254n - 5187 What is the c'th term of 3214, 7191, 11168, 15145, 19122, 23099? 3977c - 763 What is the q'th term of -1723, -6975, -15725, -27973, -43719, -62963? -1749q*2 - 5q + 31 What is the a'th term of -2157, -2234, -2271, -2268, -2225, -2142, -2019? 20a2 - 137a - 2040 What is the x'th term of 30193166, 120772659, 271738482, 483090635, 754829118, 1086953931, 1479465074? 30193165x2 - 2x + 3 What is the j'th term of -50, -223, -534, -983, -1570, -2295? -69j2 + 34j - 15 What is the m'th term of -30, 59, 554, 1737, 3890, 7295, 12234, 18989? 47m3 - 79m*2 - 3m + 5 What is the g'th term of -53444, -106336, -159228? -52892g - 552 What is the q'th term of 4111552, 32892402, 111011844, 263139172, 513943680, 888094662, 1410261412, 2105113224? 4111549q*3 + 2q*2 + q What is the t'th term of 33007, 65971, 98949, 131941? 7t*2 + 32943t + 57 What is the k'th term of 2463, 13615, 43885, 102831, 200011, 344983? 1593k3 + k2 - 2k + 871 What is the y'th term of 2492709, 4985386, 7478063, 9970740, 12463417? 2492677y + 32 What is the z'th term of -65, 75, 287, 571, 927, 1355? 36z*2 + 32z - 133 What is the t'th term of 898292, 1796600, 2694908, 3593216, 4491524, 5389832? 898308t - 16 What is the q'th term of 2971700, 2971695, 2971690, 2971685? -5q + 2971705 What is the v'th term of 343835, 1375346, 3094535, 5501408, 8595971, 12378230, 16848191? v*3 + 343833v*2 + 5v - 4 What is the v'th term of -535642, -1071385, -1607128, -2142871? -535743v + 101 What is the r'th term of 14149, 56669, 127563, 226849, 354545, 510669? 3r*3 + 14169r*2 - 8r - 15 What is the b'th term of -5697268, -11394537, -17091806, -22789075, -28486344? -5697269b + 1 What is the s'th term of -117699, -468673, -1053629, -1872567, -2925487? -116991s*2 - s - 707 What is the q'th term of 193626, 387256, 580882, 774504? -2q*2 + 193636q - 8 What is the k'th term of 23801, 23784, 23767, 23750, 23733? -17k + 23818 What is the j'th term of 128030, 128074, 128118, 128162, 128206, 128250? 44j + 127986 What is the x'th term of -22224, -22161, -22086, -21993, -21876, -21729, -21546, -21321? x*3 + 56x - 22281 What is the j'th term of -318, -2886, -9976, -23886, -46914, -81358, -129516? -383j3 + 37j*2 + 2j + 26 What is the n'th term of 230720710, 230720713, 230720716, 230720719, 230720722? 3n + 230720707 What is the r'th term of 52035, 208012, 467983, 831948, 1299907? 51997r*2 - 14r + 52 What is the a'th term of -12212, -49274, -111182, -197936, -309536, -445982? -12423a2 + 207a + 4 What is the s'th term of -348239, -348237, -348219, -348179, -348111, -348009, -347867, -347679? s*3 + 2s*2 - 11s - 348231 What is the d'th term of -320164, -640646, -961128, -1281610? -320482d + 318 What is the z'th term of -1175107940, -1175107931, -1175107908, -1175107865, -1175107796, -1175107695, -1175107556, -1175107373? z3 + z2 - z - 1175107941 What is the u'th term of -537708, -1075369, -1613016, -2150643, -2688244, -3225813, -3763344, -4300831? u3 + u2 - 537671u - 39 What is the c'th term of 20, -383, -1464, -3559, -7004, -12135? -56c3 - 3c*2 - 2c + 81 What is the v'th term of 16156259, 16156265, 16156279, 16156301? 4v2 - 6v + 16156261 What is the j'th term of -8130494, -16260988, -24391482, -32521976? -8130494j What is the p'th term of -5833943, -11667843, -17501741, -23335637, -29169531, -35003423, -40837313? p2 - 5833903p - 41 What is the k'th term of 30291, 30213, 29991, 29553, 28827? -12k3 + 6k + 30297 What is the s'th term of 30, 1175, 4504, 11109, 22082, 38515, 61500? 182s3 - 129s - 23 What is the h'th term of -1000, -3331, -7040, -12127, -18592, -26435? -689h2 - 264h - 47 What is the c'th term of 260461, 260539, 260617, 260695, 260773, 260851? 78c + 260383 What is the v'th term of -959217, -958848, -958479, -958110, -957741? 369v - 959586 What is the z'th term of -15412, -33010, -50606, -68200, -85792? z*2 - 17601z + 2188 What is the s'th term of -65998, -65972, -65898, -65752, -65510, -65148, -64642? 4s3 - 2s - 66000 What is the l'th term of -1109876, -1109885, -1109910, -1109957, -1110032? -l*3 - 2l*2 + 4l - 1109877 What is the f'th term of -126, -4019, -14080, -33393, -65042? -514f3 - 295f + 683 What is the f'th term of 765020, 765041, 765062? 21f + 764999 What is the l'th term of -114, 1792, 4966, 9408, 15118, 22096? 634l*2 + 4l - 752 What is the m'th term of -7960, -16326, -24692, -33058, -41424, -49790? -8366m + 406 What is the r'th term of 1763457, 3526911, 5290365, 7053819, 8817273? 1763454r + 3 What is the m'th term of 492907, 492917, 492927, 492937, 492947? 10m + 492897 What is the j'th term of 523, 3410, 6295, 9178? -j2 + 2890j - 2366 What is the n'th term of -10357, -45062, -104117, -187522? -12175n2 + 1820n - 2 What is the s'th term of -549851, -1099568, -1649285, -2199002, -2748719? -549717s - 134 What is the i'th term of 990, 2001, 3002, 3945, 4782? -8i*3 + 43i*2 + 938i + 17 What is the p'th term of -65575541, -65575540, -65575539, -65575538, -65575537? p - 65575542 What is the f'th	{ "pile_set_name": "DM Mathematics" }
-0.13 times 0.04? -0.0052 -30.5 -1.5 Calculate 370. 0 293 * -0.4 -117.2 Product of 3 and 0.018. 0.054 20463 6138 Calculate -0.210.16. -2.032 What is the product of -0.1 and 0.286? -0.0286 0.7 times -20 -14 Work out 0.1 * 6. 0.6 Calculate 1333-15. -19995 -1.57 -10.5 Multiply -0.1 and 0.1. -0.01 0.1 times 116 11.6 Calculate 0.4530.4. 0.1812 Multiply -820 and 5. -4100 What is the product of -0.4 and 2.703? -1.0812 Multiply 2 and 213. 426 What is -51 times -2.6? 132.6 Calculate -2.45. -12 What is 3.5 times 28? 98 Work out 1.3 * -0.15. -0.195 What is 2 times 18? 36 -0.8 * -55 44 Calculate -185-0.07. 12.95 Calculate -57360.2. -1147.2 Calculate 0.352.4. 15.72 What is 0.038 times 0.4? 0.0152 -1.4 -14.7 20.58 15732 5732 Calculate 24. 8 Multiply 1 and 0.023. 0.023 0.01 * 64 0.64 Calculate 0.10480.01. 0.001048 Multiply -2699 and -5. 13495 -75 times 0.06 -4.5 What is 567 times 0.17? 96.39 Work out 0.2 0.015. 0.003 Product of 0 and 0.152. 0 Calculate -10.028. -0.028 -0.0513 0.4 -0.02052 Product of 0.398 and -1. -0.398 -4 * -31.2 124.8 -5.6 times 0.3 -1.68 Product of -0.068 and 0.03. -0.00204 0.08 times 0.077 0.00616 -0.0477 times -0.3 0.01431 Product of 3.55 and 1. 3.55 24.92 49.8 Work out -2.1 39. -81.9 Product of -3 and 0.2. -0.6 Multiply -930 and -8. 7440 What is 118 times 2.8? 330.4 50.2664 1.332 Multiply 0.032 and -0.175. -0.0056 Product of -0.4 and 73. -29.2 What is 1 times 0.0255? 0.0255 -4-161 644 What is the product of -0.167 and 3? -0.501 What is the product of 3 and -0.047? -0.141 0.1 times 7.6 0.76 Work out 306 * 0.5. 153 -1 * -1.3 1.3 -0.3 times -7.82 2.346 Calculate -10943-4. 43772 What is 38 times -0.21? -7.98 -0.050.04 -0.002 What is 0 times 18? 0 Work out -0.07 * -1. 0.07 -5 times -16 80 22 * 0.15 3.3 -2 * -2 4 Multiply -2 and -549. 1098 Product of -0.02 and 95. -1.9 Multiply -4 and -210. 840 Calculate 0.4-58. -23.2 -12.53 times -7 87.71 What is the product of 0 and 41? 0 What is 0.09 times -0.06? -0.0054 201.6 0.07 14.112 3 times -75 -225 Multiply 1.01 and -12. -12.12 0.082 * -17 -1.394 What is -3776 times -0.5? 1888 0.3 * -178 -53.4 What is the product of -605 and 5? -3025 -0.14 * -324 45.36 What is the product of -0.38 and -1? 0.38 215-2 -430 What is the product of 1 and -0.04111? -0.04111 -4.61-2 9.22 What is -210 times 0.5? -105 Calculate 83. 24 What is the product of -1 and -0.111? 0.111 What is the product of -1 and 554? -554 244 -0.3 -73.2 What is -5 times -17? 85 What is -3.31 times -11? 36.41 -12.3 times -5 61.5 50 * -14 -700 1 * 3282 3282 75.7 * 0.2 15.14 What is the product of 14 and 1? 14 What is 0.3 times -384? -115.2 Product of 0.09 and 3.4. 0.306 -3.3 * 1.1 -3.63 -1394 * 0.5 -697 0.131.7 0.221 Multiply -0.1 and 0.304. -0.0304 -98-0.6 58.8 -15 times -1 15 Multiply 502 and 2. 1004 0.03 * -504 -15.12 Multiply -0.13 and 13. -1.69 Work out -5 * 9. -45 Multiply 17 and -0.1. -1.7 Calculate 1.90. 0 What is -0.13 times 7? -0.91 Multiply -179 and 5. -895 -0.4-2 0.8 Work out -62 * -80. 4960 Work out -45 * -0.5. 22.5 Calculate -750. -350 Calculate -0.7497. -5.243 Work out -4 * -536. 2144 Product of -3 and -41. 123 Product of -5 and -0.0479. 0.2395 What is the product of 0.03 and -2? -0.06 What is the product of 1.781 and 5? 8.905 -11 times -9.7 106.7 Calculate 25490.3. 764.7 0.9 0.52 0.468 -0.07-80 5.6 What is the product of 33 and -0.21? -6.93 -3 -2.83 8.49 What is the product of -1.2 and 5? -6 Work out -2 * 57. -114 Work out 0.5 * 72. 36 Product of -90 and 1.6. -144 110 times -1.5 -165 What is the product of -0.1 and -0.326? 0.0326 0.1 times -18.59 -1.859 15023 4506 What is the product of 9.9 and 0.03? 0.297 Work out -128 -51. 6528 Multiply 5 and -3326. -16630 -1 times 8.15 -8.15 Product of 0.504 and 5. 2.52 Multiply 36 and -37. -1332 -0.057-0.3 0.0171 Calculate 23.115. 346.5 Multiply -0.13 and -23. 2.99 -0.5 * 0.141 -0.0705 What is -0.06 times -0.41? 0.0246 Product of -2.1 and 15. -31.5 Multiply 0.4 and 0.088. 0.0352 Multiply -0.2 and -294. 58.8 Multiply -3.2 and -175. 560 7.28 times 0.5 3.64 What is the product of -6.82 and -2? 13.64 0.4 times 0.97 0.388 558 * -4 -2232 -0.13-2.49 0.3237 What is the product of 0.5 and -1932? -966 Product of -4 and 0.61. -2.44 Multiply 454 and 0.1. 45.4 11 12 132 123-5 -615 Multiply -5320 and -2. 10640 -2.7 13 -35.1 What is 52 times -0.2? -10.4 -3.3770 -2541 Multiply -0.23 and -66. 15.18 What is 0.077 times -237? -18.249 What is the product of -71.96 and 0.4? -28.784 0.2 -7.4 -1.48 -0.71708 -1195.6 Work out -4 12.7. -50.8 690 times -2.3 -1587 What is the product of -516 and 4? -2064 Multiply 0.61 and 3. 1.83 -3498-0.1 349.8 What is the product of 5819 and -5? -29095 Work out -0.015 -2. 0.03 Multiply 171 and 0.2. 34.2 What is 0.4 times 138? 55.2 Multiply -2 and 1117. -2234 Multiply -418.7 and 4. -1674.8 Multiply -30 and 0.04. -1.2 -4 times -0.56 2.24 50 times -0.116 -5.8 0.281 * 0.08 0.02248 What is the product of 46 and 11? 506 Work out 0.4 * -184. -73.6 What is the product of 218 and -5? -1090 -0.03689 * 3 -0.11067 What is the product of 0 and 0.09? 0 Work out -0.1 * 419. -41.9 -0.004 * -1 0.004 Calculate 1.5919. 30.21 Calculate -2.13. -6.3 0.09-14 -1.26 Calculate 01.06. 0 What is -0.3 times -17? 5.1 What is 0.77 times 0.4? 0.308 What is -0.4 times 238? -95.2 Product of 2.7 and -0.27. -0.729 -0.8 * -12 9.6 Multiply -4 and 1.57. -6.28 -380 -240 Multiply 0.5 and 27. 13.5 Work out -0.3 14. -4.2 What is the product of 5 and -2319? -11595 Calculate 0.040.6. 0.024 Multiply 0.3 and 0.03509. 0.010527 Product of 226 and -0.2. -45.2 Multiply 492 and 2. 984 Multiply -3 and -0.36. 1.08 Work out -0.38 -23. 8.74 Multiply 778 and 0. 0 Product of -3 and -0.035. 0.105 What is 0.48 times 9? 4.32 Product of -0.2 and -0.0627. 0.01254 What is the product of 0.06 and -4.2? -0.252 0.3 * 2 0.6 What is the product of -0.4 and 0.013? -0.0052 Work out 0.3 * -47.9. -14.37 What is the product of -5 and -0.005? 0.025 12000.07 84 980 -3 -2940 0.4 * 776 310.4 Product of -0.075 and -0.1. 0.0075 Product of 1 and -4700. -4700 Product of 2 and 0.114. 0.228 0.4 times -0.006 -0.0024 Work out 0.9672 * -0.4. -0.38688 Product of 106.4 and 0. 0 0.3 * 1260 378 -10 * -93 930 What is the product of 0.5 and -413? -206.5 -0.0820 0 Multiply 0.5 and -89. -44.5 Calculate -0.2983. -0.894 Multiply -1.5 and 2.7. -4.05 219 * 0.4 87.6 Work out 0.3 * 54. 16.2 Work out -2.8 * -272. 761.6 What is the product of -49.9 and -2? 99.8 What is the product of 71 and -0.2? -14.2 What is the product of -0.09 and -0.03? 0.0027 What is -24 times 9? -216 -0.4 * 66 -26.4 Product of 0.2 and -55. -11 What is 0.74 times 53? 39.22 Calculate -0.11.1. -0.11 Calculate -0.415. -6 What is the product of 0.1 and -49? -4.9 -0.179 * -0.04 0.00716 Multiply -0.1 and 0.0154. -0.00154 What is -20.49 times -3? 61.47 Calculate 1760.3. 52.8 What is the product of -0.2 and 0.0588? -0.01176 0.3 times 0.018 0.0054 Work out -5 8.45. -42.25 Multiply 0.038 and 7. 0.266 Work out 0.03 * -0.14. -0.0042 Product of -4 and 95. -380 -151 times 32 -4832 25.54 102 -2-9 18 What is the product of -5 and 3462? -17310 -11047 -1047 Product of 6 and -122. -732 -360 times -14 5040 What is the product of -0.0054 and 0.05? -0.00027 -869 0.12 -104.28 Multiply -6 and 1.73. -10.38 Work out -0.079 * -9. 0.711 51 times -4.5 -229.5 -144 times -0.5 72 0.0234-0.2 -0.00468 Product of -5 and 58. -290 What is -0.4 times -223? 89.2 0.3 times -4 -1.2 Calculate 102-12. -1224 Product of 22 and -2. -44 Calculate -3433. -1299 Work out -14 0.1. -1.4 -0.7554 times -0.1 0.07554 Calculate 0.240.117. 0.02808 Product of 0.4 and 0.0584. 0.02336 148 times 0.56 82.88 Calculate 6389-0.3. -1916.7 221 times -0.22 -48.62 160-29 -4640 Multiply 0.4 and -698. -279.2 0.235 -1 -0.235 -7 times -883 6181 What is 33 times 793? 26169 Multiply -0.153 and 36. -5.508 Multiply -18 and -0.04. 0.72 What is 0.5 times 0.852? 0.426 What is -3 times -455? 1365 Calculate -3040.5. -152 Calculate -0.77-1.5. 1.155 Multiply -0.0195 and 2. -0.039 What is 8.3 times -0.06? -0.498 Multiply -0.1 and -341. 34.1 -94 times -0.4 37.6 145.4 * 0.1 14.54 Multiply 200.5 and 2. 401 -56 * -0.8 44.8 -0.4 times -472 188.8 What is the product of -0.4 and 0.21? -0.084 Calcul	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.