Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
25 - j. Calculate the remainder when 23 is divided by c. 7 Suppose 0 = -4k + 35 + 9. Suppose -kc = -3c - 648. Calculate the remainder when c is divided by 14. 11 Let v(n) = 2n*3 - 6n*2 - 4n + 24. What is the remainder when v(6) is divided by 56? 48 Suppose -2x + 43z - 42z = -190, 2z = 3x - 287. What is the remainder when 369 is divided by x? 90 Let q be 148 + (-4)/(-4) + (-1)/1. Calculate the remainder when 117 is divided by q/5 + (-2)/(-5). 27 Let m = 9 - -7. Let x = 415 - 361. What is the remainder when x is divided by m? 6 Let z = 561 + -509. Calculate the remainder when 565 is divided by z. 45 Suppose 3c - 2c + 3q = 16, c = 2q + 11. Let l = 30 - -7. Calculate the remainder when l is divided by c. 11 Suppose -5x + 100 = 5h, -3x + 33 = 30. What is the remainder when 126 is divided by h? 12 Suppose 0 = -3f + 1 + 5. Let s(k) = -47k + 288. What is the remainder when s(6) is divided by f? 0 Let d = 289 - -116. Calculate the remainder when d is divided by 24. 21 Let s = -172 - -215. What is the remainder when s is divided by 15? 13 Suppose 10a - 7a - 1759 = -5r, -a - 347 = -r. Calculate the remainder when r is divided by 9. 8 Let o = 1920 - 1784. What is the remainder when o is divided by 42? 10 Suppose -5n - 6 = 4, -39 = -x - n. What is the remainder when 118 is divided by x? 36 Let c(n) = 13n + 6. Let g(b) = 2b3 - b2 + b + 1. Let p be g(2). Let k = p + -3. What is the remainder when c(2) is divided by k? 8 Suppose l - 3w = 540, 4l - 3w + 1035 = 6l. Calculate the remainder when l is divided by 48. 45 Suppose 0 = -4q - 96 - 360. Let u = q - -128. What is the remainder when u is divided by 4? 2 Suppose -2u + 2 = 3n, 0u + 2 = -2u - 2n. Calculate the remainder when u/(-30)176 is divided by 9. 8 Suppose 78d - 19845 = 29d. Calculate the remainder when d is divided by 17. 14 Let k be 32/(-5) + 6 + (-36)/10. Calculate the remainder when (k/3)/(-1 - 95/(-105)) is divided by 9. 5 Let n = -208 - -222. Let z(h) = h*2 + 3h - 2. Let l be z(6). Suppose -4o + 48 = -l. Calculate the remainder when o is divided by n. 11 Let p(z) = z3 - 9z*2 - 23z + 15. Let b be p(11). Suppose -bl = -41 + 5. Calculate the remainder when 29 is divided by l. 2 Let d = -108 - -151. Suppose 1 = 5x - 44. Calculate the remainder when d is divided by x. 7 Suppose -111 = -h + 3o, -153 = -5h + 2o + 441. What is the remainder when 330 is divided by h? 90 Suppose -3f + 1105 = 10f. What is the remainder when f is divided by -1 - (-31 + (-1)/(-1))? 27 Suppose 2n + 79 = t, -2n + 7n - 44 = -t. Suppose -15q - 79 + 529 = 0. Let r = q + -20. What is the remainder when t is divided by r? 9 Let j(r) = r2 - 7r - 11. Let p be j(9). Suppose -pq + 2q = -25. What is the remainder when 7 is divided by q? 2 Suppose -12k = -42 + 6. Calculate the remainder when 69 is divided by (6/(-4))/((k/(-26))/3). 30 Let s(v) = -6v + 4. Let j be s(3). Let r(k) = -2k3 - k2 + 2. Let w be r(-2). Calculate the remainder when 22 is divided by 2/j - (-170)/w. 10 Let p(r) be the first derivative of -r2/2 - 6r - 2. Calculate the remainder when 2 is divided by p(-8). 0 Let c(s) = 2s2 + 2s + 10. Calculate the remainder when 130 is divided by c(5). 60 Let m = -11 - -11. Suppose 3c - c = m. Let t(u) = -u3 + 2u*2 + 82. Calculate the remainder when t(c) is divided by 17. 14 Calculate the remainder when 3 - 0 - (-43 - -51) - -580 is divided by 17. 14 Let h = -30 - -37. Suppose -3m + 8 = -h. Let i(j) = 2j2 - 5j + 4. What is the remainder when i(3) is divided by m? 2 Suppose 1143 = 4i - 369. Suppose 24h = 17h + i. What is the remainder when 268 is divided by h? 52 Let u(c) = -c. Let t(w) = -5w - 11. Let n(q) = -t(q) + 6u(q). Let l be n(9). Suppose -23 = -5o + l. Calculate the remainder when 10 is divided by o. 0 Let j = 1662 - 1636. What is the remainder when 414 is divided by j? 24 Let g(q) = 1 + 9q - 5q2 + q3 - 3q2 - 16 - 4q. Let o = 15 + -1. What is the remainder when g(8) is divided by o? 11 Let k(y) be the second derivative of y5/20 + y4/3 - 2y3/3 + 5y*2 - 5y. What is the remainder when 17 is divided by k(-5)? 2 Let b(c) = -c*3 - 8c*2 - 4c + 1. What is the remainder when 125 is divided by b(-8)? 26 Let f(i) = 67i - 2846. Suppose -5p - 80 = -200. What is the remainder when f(43) is divided by p? 11 Calculate the remainder when 1054 is divided by 6/(((-30)/80)/(-3)). 46 Let r = 3 + -3. Suppose r = b - j - 14, 3b - j = -4j + 12. What is the remainder when 18 + (-7 - -1 - (-48)/12) is divided by b? 7 Let s(q) = q*3 + 8q*2 - 4q - 9. Let r be (-99)/11 + 1/1. Calculate the remainder when s(r) is divided by 9. 5 Let v be ((3 - -3) + -4)102. Calculate the remainder when 66 is divided by (v/30)/(6/15). 15 Let s(u) = -19u - 5. Let t be s(-4). Suppose 6p - 37 = t. Suppose -4 = -2i + 6. What is the remainder when p is divided by i? 3 Let h = 51 - 43. Let g be -3(-15)/124. Suppose d + 4d - g = 0. Calculate the remainder when h is divided by d. 2 Let u = -148 - -178. What is the remainder when 89 is divided by u? 29 Let q = 1347 - 1280. Calculate the remainder when 867 is divided by q. 63 Let o(f) = 5f - 32. Let y be (-1)/4 + (4 - (-58)/8). What is the remainder when o(y) is divided by 5? 3 Let s(t) = -t*3 + 6t*2 - 4t - 5. Let x be s(5). Suppose 3n = -xn + 57. Calculate the remainder when 94 is divided by n. 18 Let z(s) = s*2 + 1. Suppose 5h = -4p + 37, 4p - 52 = -3h - 33. What is the remainder when h is divided by z(2)? 4 What is the remainder when (-4)/(-6) - 151/(-3) is divided by 183/10 - 102/340? 15 Suppose -27o + 246 = -21o. Calculate the remainder when o is divided by 14. 13 Let n(g) = g + 10. Let p = -9 + 3. Suppose 29 = 5q - w, 0 = -5q - 2w - 14 + 31. Calculate the remainder when q is divided by n(p). 1 Suppose 113j - 16 = 112j. Calculate the remainder when 505 is divided by j. 9 Suppose 3x - 7 = 32. Suppose -7 - x = -4u, -28 = -4a - 4u. Suppose 2r = -ap + 18, -p = -4p - 12. Calculate the remainder when 24 is divided by r. 11 Let w(t) = t2 + 5t + 4. Let y(v) = -v*3 + 3 + 3 - 2v2 - 3 + v2 + 2v. Calculate the remainder when w(-5) is divided by y(-2). 1 What is the remainder when 57 is divided by -10(-10 - (7 + -15))? 17 Let x = 60 - 28. Suppose -2i + 2r = -244, 0r - 4r + 637 = 5i. What is the remainder when i is divided by x? 29 Suppose 5h = -3v - 22, h = -5v + 6h - 50. Let z be 372/5 - v/15. Suppose -5a + z = -50. What is the remainder when a is divided by 13? 12 Suppose -313x + 317x = 120. What is the remainder when 147 is divided by x? 27 What is the remainder when 34 is divided by 1 + 715/35? 2 Let s(u) = -u + 23. Suppose -6 = 4t - x - 39, 5x - 27 = -4t. Calculate the remainder when s(0) is divided by t. 7 Let a(l) = 2l - 11. Let o be a(10). Let c = -6 + o. What is the remainder when 9 is divided by c - 1 - (0 + -4)? 3 Suppose 3o + 30 = -v - 64, 2o + v = -61. Let g = o - -11. Let s = g + 23. What is the remainder when 1 is divided by s? 0 Let g = 32 - 4. Let r(n) = n2 - 46n + 82. Calculate the remainder when r(0) is divided by g. 26 Let o = 172 - -164. Suppose -4w + o = 4w. What is the remainder when 167 is divided by w? 41 What is the remainder when (-4 - 52/(-16))-908 is divided by 19? 16 Let k(q) = 102q*2 - 3. What is the remainder when k(-1) is divided by 68? 31 Let t(h) be the first derivative of 3h*4/4 - 7h*3/3 - 3h + 20. Calculate the remainder when t(3) is divided by -3((-7)/3 + 1). 3 Let a(i) = 20i*2 + 2i - 1. Let u be a(-2). Suppose 0 = -4l - l + u. Let h = 172 - 114. What is the remainder when h is divided by l? 13 What is the remainder when 113 is divided by (-147)/(-42)48/14? 5 Let w(g) = -15g. Let l be w(1). What is the remainder when (0 + 8)/(l/(-90)) is divided by 7? 6 Let z(m) = -m3 + 9m*2 - 9m + 7. Let f(w) = -w*2 - 8w - 3. Let n be f(-7). What is the remainder when z(n) is divided by 13? 12 Let q = -108 + 173. Calculate the remainder when q is divided by 20. 5 Suppose 77 = 4x - 3f, 0 = 3f - 6 + 3. Calculate the remainder when 439 is divided by x. 19 Let a(i) = -1 + 3 + 4 - 30 + 2i. What is the remainder when 69 is divided by a(21)? 15 Suppose 0 = m - 2u - 57, 2m - 167 = -m + 4*u. Let b = 3	{ "pile_set_name": "DM Mathematics" }
, -3, 33, 4, -5 in increasing order. -6, -5, -3, 4, 33 Put 316, 4, -6/11, -0.3, -8 in descending order. 316, 4, -0.3, -6/11, -8 Sort -67, 1, -6 in increasing order. -67, -6, 1 Sort 1, 123, -2 in ascending order. -2, 1, 123 Put 0, -1, 19 in ascending order. -1, 0, 19 Sort 0, -2, 9, -6, 18. -6, -2, 0, 9, 18 Sort 3, 18, 2. 2, 3, 18 Sort 13, 2, 28 in ascending order. 2, 13, 28 Sort -3, 1, -0.02, 0. -3, -0.02, 0, 1 Sort -4/7, 1, -2, -9/8, -1 in decreasing order. 1, -4/7, -1, -9/8, -2 Sort -41, 2, -2, -5 in decreasing order. 2, -2, -5, -41 Sort 1, -8, -3, -5. -8, -5, -3, 1 Put 2/11, 2/67, -0.01, 2/3 in increasing order. -0.01, 2/67, 2/11, 2/3 Put 1/2, 0, -2/11 in decreasing order. 1/2, 0, -2/11 Sort 3, 0, 5, -4, 23 in increasing order. -4, 0, 3, 5, 23 Sort 1, 5, 2/9 in decreasing order. 5, 1, 2/9 Sort -3/7, 0.1, 0.044 in descending order. 0.1, 0.044, -3/7 Put 1, 15860, -2 in descending order. 15860, 1, -2 Put 0.09, 1/6, -2/71 in ascending order. -2/71, 0.09, 1/6 Put 6, 0, 2, -17 in descending order. 6, 2, 0, -17 Sort -8/15, -2/5, -1/39. -8/15, -2/5, -1/39 Sort 0, -30, -5, 9 in descending order. 9, 0, -5, -30 Sort 9, -4, 2, 5. -4, 2, 5, 9 Sort -2/23, -42, 1, -19, -2 in decreasing order. 1, -2/23, -2, -19, -42 Put 2, 9, -10 in descending order. 9, 2, -10 Sort 15.9, 3/4, -2, -0.1 in decreasing order. 15.9, 3/4, -0.1, -2 Sort 2, 190, -1 in decreasing order. 190, 2, -1 Put 3, -20, -48 in ascending order. -48, -20, 3 Put -2, 2, -8, 1, 13 in descending order. 13, 2, 1, -2, -8 Sort 28/3, 0.3, 1, -4, -0.1 in decreasing order. 28/3, 1, 0.3, -0.1, -4 Sort 4, 1, 15, 2 in descending order. 15, 4, 2, 1 Sort -15, 2, -4, -6, 4 in ascending order. -15, -6, -4, 2, 4 Sort 4, 15, -0.4 in ascending order. -0.4, 4, 15 Sort -2, 3, -10, 7, 15. -10, -2, 3, 7, 15 Put -5/18, 3, 0, -3 in increasing order. -3, -5/18, 0, 3 Put 5, 36, -36 in descending order. 36, 5, -36 Sort 0.3, -2, -0.2, 239 in decreasing order. 239, 0.3, -0.2, -2 Put 1, -4, -95 in decreasing order. 1, -4, -95 Sort 0.04, 0.055, -1/3 in decreasing order. 0.055, 0.04, -1/3 Sort 2/21, 6, 0.2, 2/7. 2/21, 0.2, 2/7, 6 Sort 1, 5, -151. -151, 1, 5 Sort -5, -1, -24 in decreasing order. -1, -5, -24 Sort -1/3, 9, 2/7, 1, 4 in decreasing order. 9, 4, 1, 2/7, -1/3 Put 10, 2/5, 1/3, -1/3, 0.318 in decreasing order. 10, 2/5, 1/3, 0.318, -1/3 Put 1/2, -2/19, -0.3, -2 in descending order. 1/2, -2/19, -0.3, -2 Sort -4, 5, -179, 0.1, 0 in increasing order. -179, -4, 0, 0.1, 5 Sort 16, 2, 5, -5, 1 in decreasing order. 16, 5, 2, 1, -5 Put 3, -1, -5, 3/22, 5 in descending order. 5, 3, 3/22, -1, -5 Put 102, -2, 38 in increasing order. -2, 38, 102 Put 5, 29, 3, -4 in ascending order. -4, 3, 5, 29 Put 9, -3/8, 2, -4, 0.156 in increasing order. -4, -3/8, 0.156, 2, 9 Sort 2/67, -5, 3/5, -0.3, 1 in ascending order. -5, -0.3, 2/67, 3/5, 1 Put 10, 6, -9, 8 in ascending order. -9, 6, 8, 10 Sort 973, 1, 3, 2. 1, 2, 3, 973 Sort -4, -6, 3, 1, 5 in increasing order. -6, -4, 1, 3, 5 Put -33, 2, 3, 1 in increasing order. -33, 1, 2, 3 Sort 5, -0.4, -1/2, -91. -91, -1/2, -0.4, 5 Put 45, -4, -5 in increasing order. -5, -4, 45 Sort -0.3, -5/2, 10 in decreasing order. 10, -0.3, -5/2 Put 0.5, 20/13, -0.2 in decreasing order. 20/13, 0.5, -0.2 Put -319, 3, 2 in descending order. 3, 2, -319 Sort -25, 2, 7. -25, 2, 7 Put -1/3, 4838, 0 in increasing order. -1/3, 0, 4838 Sort -0.03, 1/8, -5, -7/3 in ascending order. -5, -7/3, -0.03, 1/8 Put 1, 43, -3 in decreasing order. 43, 1, -3 Sort -5, -1, 1, -15 in descending order. 1, -1, -5, -15 Put -649, 5, 1 in descending order. 5, 1, -649 Put 3, -17, -5, 1, 4 in ascending order. -17, -5, 1, 3, 4 Sort -75, 1/9, 2/15 in decreasing order. 2/15, 1/9, -75 Sort 1/5, -1/5, 5/3, 260 in increasing order. -1/5, 1/5, 5/3, 260 Put -4, 1/7, -3/20, -5, 4 in decreasing order. 4, 1/7, -3/20, -4, -5 Put 88, 3, 0.3 in ascending order. 0.3, 3, 88 Put 4, 1, -3, 1.08 in ascending order. -3, 1, 1.08, 4 Sort 0.2, 2, 42 in decreasing order. 42, 2, 0.2 Put 1, 15, 6 in decreasing order. 15, 6, 1 Put -0.3, -1/242, -2/13 in decreasing order. -1/242, -2/13, -0.3 Put -2/11, 5, -0.2, 3 in increasing order. -0.2, -2/11, 3, 5 Put 175, -6, 0 in descending order. 175, 0, -6 Sort 4, 2645, -3, -2, -5 in decreasing order. 2645, 4, -2, -3, -5 Put 0.1, -2/11, 3, 1, -2/9 in descending order. 3, 1, 0.1, -2/11, -2/9 Put 1, 6, -25 in increasing order. -25, 1, 6 Sort -4, 6/11, 2/9, -0.2. -4, -0.2, 2/9, 6/11 Sort -1, 2, 5, 4 in descending order. 5, 4, 2, -1 Sort -5, 1, 4, -1. -5, -1, 1, 4 Put 0.2, 2.4, 13 in decreasing order. 13, 2.4, 0.2 Put 77, -2, 4 in descending order. 77, 4, -2 Put -28, 1, -4 in decreasing order. 1, -4, -28 Sort -7, 5, -10. -10, -7, 5 Sort 3, -5, -3, -22. -22, -5, -3, 3 Sort 0, 4/7, -0.43, 4 in descending order. 4, 4/7, 0, -0.43 Put -4, 3, -10, -80 in ascending order. -80, -10, -4, 3 Put -2/11, 548, -1/7 in decreasing order. 548, -1/7, -2/11 Put -5, -9, 20 in ascending order. -9, -5, 20 Put 2, 34, 4 in increasing order. 2, 4, 34 Put -1/16, -7, -3 in decreasing order. -1/16, -3, -7 Sort -2, 0, 14. -2, 0, 14 Put 24, -2, 2, -5 in ascending order. -5, -2, 2, 24 Sort -10, 2, -4, -3, 20 in descending order. 20, 2, -3, -4, -10 Sort 5, -3, -920 in decreasing order. 5, -3, -920 Put -20, -8, -31 in increasing order. -31, -20, -8 Sort -14, -20, 5. -20, -14, 5 Sort 176, -5, 3, 28, -3. -5, -3, 3, 28, 176 Put 5, 4/3, 0.5, 6 in ascending order. 0.5, 4/3, 5, 6 Sort 5, 7, 2, 3 in increasing order. 2, 3, 5, 7 Put -0.2, 1, -72, -2 in descending order. 1, -0.2, -2, -72 Sort 2, -1, 5, -17 in descending order. 5, 2, -1, -17 Put -0.2, 1/2, -3 in decreasing order. 1/2, -0.2, -3 Sort -2/17, -1, -4/3, -0.1, 0.2 in ascending order. -4/3, -1, -2/17, -0.1, 0.2 Put -1, -1/4, -0.1, 2/29, 0 in ascending order. -1, -1/4, -0.1, 0, 2/29 Put 1/5, -4, 2/13, -1/4 in ascending order. -4, -1/4, 2/13, 1/5 Sort -1, 3, 193, -4 in decreasing order. 193, 3, -1, -4 Put -1/9, -2, 0.1, 0, 1 in decreasing order. 1, 0.1, 0, -1/9, -2 Sort 5, -316, -1 in ascending order. -316, -1, 5 Put 3, -5, 4, 10 in descending order. 10, 4, 3, -5 Sort -4, -1041, 2. -1041, -4, 2 Put -1, -8, 3, -2 in ascending order. -8, -2, -1, 3 Put 5, -5, -3, 15 in descending order. 15, 5, -3, -5 Sort 5, -0.2, -13 in ascending order. -13, -0.2, 5 Put 1, -11, 4, 0, 5 in descending order. 5, 4, 1, 0, -11 Put 0, -4, 25 in decreasing order. 25, 0, -4 Put 2, 5, 3/2, -16, -11 in ascending order. -16, -11, 3/2, 2, 5 Sort -786, 3, -5, -3 in decreasing order. 3, -3, -5, -786 Put 4, -0.5, -0.6, -198 in decreasing order. 4, -0.5, -0.6, -198 Sort -3, 0.2, 0.4, 5, 2/7. -3, 0.2, 2/7, 0.4, 5 Sort -0.5, -0.05, 1/16, -2 in ascending order. -2, -0.5, -0.05, 1/16 Sort 59, -0.5, 5 in descending order. 59, 5, -0.5 Sort -5/6, -10, -8 in increasing order. -10, -8, -5/6 Sort 2, -6, 5, 0, -3 in descending order. 5, 2, 0, -3, -6 Put 2, 25, 34 in descending order. 34, 25, 2 Put -20, 0.4, -3, -7, 1/9 in descending order. 0.4, 1/9, -3, -7, -20 Put -12, 3, 19 in ascending order. -12, 3, 19 Sort 2, -3, -17, 6 in decreasing order. 6, 2, -3, -17 Sort -6/7, -171, -14 in ascending order. -171, -14, -6/7 Put 0, 142, 4, -3, -4 in descending order. 142, 4, 0, -3, -4 Put 4, 17, 2, -4 in decreasing order. 17, 4, 2, -4 Sort 5, -4, -5. -5, -4, 5 Put -9, -0.2, 1/4, 0.1, -2 in decreasing order. 1/4, 0.1, -0.2, -2, -9 Put 2/7, -2/9, 3/2, 2/5 in descending order. 3/2, 2/5, 2/7, -2/9 Sort 1, 4, 8 in decreasing order. 8, 4, 1 Put 1, 4, -1, -10839 in descending order. 4, 1, -1, -10839 Put -10, 3.5, 4, 5 in ascending order. -10, 3.5, 4, 5 Sort -1, 512, 2, 5, 3. -1, 2, 3, 5, 512 Sort 1, 0.1, 2/3, -1, -0.045 in descending order. 1, 2/3, 0.1, -0.045, -1 Sort -12, 4, 5, 2 in increasing order. -12, 2, 4, 5 Put 0.1, 0, -49/5 in increasing order. -49/5, 0, 0.1 Sort 0.35, 1, -0.4 in increasing order. -0.4, 0.35, 1 Sort 9, -7, 0, 5 in increasing order. -7, 0, 5, 9 Sort -1, 3, 197, -5, -3 in ascending order. -5, -3, -1, 3, 197 Put -5, -1/6, 14, 3/5 in increasing order. -5, -1/6, 3/5, 14 Sort -2, 11, 1 in increasing order. -2, 1, 11 Sort -65, 2, 1, -5, 4. -65, -5, 1, 2, 4 Put 3, 9, 2, -4, 1 in decreasing order. 9, 3, 2, 1, -4 Sort -2, 1, -5. -5, -2, 1 Sort 5, -7/113, 0.3. -7/113, 0.3, 5 Sort -4, 0, 81 in decreasing order. 81, 0, -4 Put -0.26, -5, -3 in decreasing order. -0.2	{ "pile_set_name": "DM Mathematics" }
j2 - 3j + 6. Is l(m) composite? True Let b = -187 - -524. Is b composite? False Suppose -y - 3 = -w, -y - 4w + 2w = -6. Let r be -167 + (y - (0 - 2)). Let b = -118 - r. Is b a composite number? False Suppose -o - 3 = -5f + 2, 3f + 25 = -5o. Let p(t) = -t + ft*2 + 4t*2 - 1 + 3t. Is p(-4) a composite number? True Suppose -3d + 72 = -51. Let o = 105 + -69. Let z = o + d. Is z prime? False Is 2052 - (6 + -3)/(-3) a prime number? True Suppose 2975 + 19192 = 9j. Is j composite? True Suppose 0 = 3s - 7s + 3764. Is s composite? False Let m(a) be the first derivative of -a*3/3 + 7a*2/2 + a + 19. Let l be 1 - (1 + -2) - -3. Is m(l) a composite number? False Let s(j) = -6j - j*3 - 5j*3 - 13 - 8j*2 + 7j*3. Is s(10) a composite number? False Suppose 3t = -t + 3c + 51, -3t + 47 = -4c. Suppose -2u = -5u + t. Suppose 0 = -ui + 3 + 9. Is i a prime number? False Suppose x = -2c + 507, 4c = 2x + 206 + 788. Is c composite? False Let j = 18 + -24. Is 2286/14 + j/21 prime? True Let w be (85 + -2)1/(-1). Let d(t) = 3t2 - 5t + 8. Let f be d(7). Let z = w + f. Is z a prime number? True Let b = 8 + -7. Is 47/4(3 + b) prime? True Let t = 1687 - 886. Suppose 4q - t = -277. Is q a composite number? False Let j be 242/8 + 2/(-8). Suppose -j = -5q + 35. Is q composite? False Let i = 5 - 4. Let c be (0 + i)(-6)/(-2). Suppose -5d - z - 2z = -101, 6 = cz. Is d a prime number? True Suppose 4 = 5u - 4u. Suppose -2d - i - i + 40 = 0, -i + 77 = ud. Is d composite? False Let z(m) = -320m + 3. Is z(-5) a prime number? False Let o be 222(6/4)/3. Suppose 4u - 3w = -176, 4u - 5w = -111 - 65. Let j = u + o. Is j a prime number? True Let i = 12 - 59. Let r = -22 - i. Is 0 + r + -6 + 3 a composite number? True Let u = 14 - 7. Let a = 4 - u. Is -9((-2)/a)/(-1) a prime number? False Let i(v) = -v*2 - v + 2. Let w be i(0). Suppose j - wj = 0. Suppose 3r + 27 - 228 = j. Is r a composite number? False Suppose -3l = 4u + 22 + 19, 5l = 5. Suppose 99 = 4c + 27. Let h = u + c. Is h a prime number? True Let m = -102 - -428. Let j = -199 + m. Is j composite? False Is ((-11)/2)/(13/(-208)) + 3 a prime number? False Let o = -8 - -4. Let x be (-6)/o10/3. Suppose 0 = -xz + z + 28. Is z composite? False Let h be 2/(-2)2 + -8. Let k(s) be the first derivative of s*4/4 + 10s*3/3 - 5s*2 + 13s + 4. Is k(h) a prime number? True Suppose 4h - 2y - 19 + 5 = 0, -5h - 2y + 13 = 0. Suppose 0 = -4w + hx + 7 + 26, -5x = 4w - 9. Is (-2)/w - 472/(-12) a composite number? True Let y = 2 + 1. Let x(m) = 35m2 - 1. Let k be x(1). Suppose -yp + 415 = k. Is p a prime number? True Let n(d) = -2d + 4. Let h be n(4). Let t = h - -6. Suppose 15 = k + 3z, 3z + 7 = -tk + 43. Is k a prime number? False Suppose -t + 990 = -699. Is t a prime number? False Let q(t) = -t3 - t2 + 121. Let v be q(0). Let d = 178 - v. Is d a composite number? True Suppose x = t - 775, x + 3x + 3121 = -3t. Let h = -545 - x. Is h composite? False Suppose -5x + 16 = 1. Suppose 0 = -4f - u - 12, 3u - x = -2f - 9. Is 3/f - (-6 - 2) composite? False Suppose -394 = -2a + 4u, -2a = -3a + u + 194. Is a a prime number? True Suppose -66 = -5u + 6u - 3h, 222 = -4u - 2h. Let c = 39 + u. Let z = 37 + c. Is z composite? False Is 1 + -2 + (1057 - 1) prime? False Let p be 109 + (-2)/2 + 0. Suppose -272 = -5n + 83. Let l = p - n. Is l a composite number? False Let j = 8 - 1. Let s(w) = -10w + 0 - 3w*3 - 2 + jw*2 - 3 + 4w*3. Is s(-7) a composite number? True Is ((-53316)/60)/(13/(-15)) a composite number? True Let n(d) = -5d. Let q be n(1). Let k(u) be the third derivative of u5/60 + u4/24 + 5u3/6 - u2. Is k(q) composite? True Suppose 5f = 4x + 3f - 840, 3f - 1061 = -5x. Is x a prime number? True Suppose 0p + 4p - 1628 = 0. Is p composite? True Let n be 0/((-6)/(2 - 5)). Suppose -3v + 4v + 2 = n. Is (381/(-6))/(v/4) a composite number? False Let x(u) = 9u*2 - 2u + 3. Is x(2) prime? False Let n be (-3)/6 - (-54)/4. Let c(b) = 6b + 9. Is c(n) prime? False Let g(v) = -5v - 2. Let w be g(-2). Let q = w + -6. Let h(x) = 6x2 - x + 1. Is h(q) a composite number? False Let p(r) = r + 9. Let y be p(-4). Suppose 150 = -0s + s + 4x, 382 = 3s - yx. Is s composite? True Let t(u) = -28u + 5. Let j(r) = -83r + 14. Let m(h) = 3j(h) - 8t(h). Is m(-3) prime? False Let t(f) = 4f + 5. Let v(m) = -16m - 20. Let q = 10 - 19. Let c(p) = qt(p) - 2v(p). Is c(-4) a prime number? True Suppose 16 + 15 = j. Is j prime? True Let a(r) = r2 + 2r - 1. Suppose 0 = u + 5. Is a(u) a prime number? False Let b = -1 + 3. Suppose -26 = -bo + 114. Suppose 3l + i = o, -3l + i + 3i + 65 = 0. Is l composite? False Let j = -3982 - -5847. Is j prime? False Let a = -35 + 129. Suppose 2c = 6c - 140. Let l = c + a. Is l prime? False Let v(t) = -t*2 + t + 55. Suppose q - 5c + 5 = 6q, -5c = -5q - 5. Is v(q) prime? False Let t = -3 - -152. Is t a composite number? False Suppose 0p - p + 5 = 0. Suppose 10 + 50 = pz. Let f = z - -9. Is f a prime number? False Is (11/(-2) - -5)(-143 + 1) a composite number? False Let y be -3 + 6 + 8 + -2. Let k(r) = -r*3 + 9r*2 - 4r + 0r - 8 + 7r. Is k(y) prime? True Suppose 4u - 31 - 25 = 0. Let s be 66/u + 2/7. Suppose 0 = sa - p - 576, -5a = -4p - 0p - 579. Is a prime? False Let j = -5 - -7. Let q = j - 1. Is q/4 + 27/4 a prime number? True Suppose 4k + 1553 = -0h + 5h, 4h = -2k + 1232. Is h a composite number? True Let p(r) = 1630r3 + r2 + 2r - 2. Is p(1) a composite number? True Suppose 4p + 2b = 1526, -3p = -7b + 4b - 1122. Is p a prime number? True Let a be (1 - 3)/(4/34). Suppose 5q + 5g - 6g = 280, -224 = -4q + g. Let i = q + a. Is i a prime number? False Let x be (-10)/15 - (-544)/6. Let f = -38 + x. Suppose j + j = f. Is j composite? True Suppose -4d - 439 = -5m, -d = -m - 4d + 103. Is m a composite number? True Let q(c) = -26c - 8. Let n be 1/(10/11 + -1). Is q(n) a prime number? False Suppose 4r + t - 5 = 0, -3r + 5t - 2 = -0t. Is 3 + 0 - (-110)/r a composite number? False Let q be -61 + 2/((-2)/2). Let i = q - -97. Is i prime? False Suppose i = 2i + 4q - 70, -q = -4i + 297. Is i a prime number? False Let j(f) = -188f2 - 3f - 5. Let y be j(-2). Let g = -444 - y. Is g a prime number? True Is (2/(-12)-3)/(6/3108) composite? True Is (-2)/(-10) - (-5136)/20 a composite number? False Let d(i) = -40i*3 + 2i*2 + 1. Is d(-2) prime? False Let j = 7 + -4. Suppose ju - 10 - 59 = 0. Is u prime? True Suppose 62 + 220 = -4y - m, 0 = -4y - 4m - 288. Let s = y - -170. Let r = s - 65. Is r composite? True Suppose -5s - f = -1146, -480 = -2s + 2f + 3f. Suppose -a + s = a. Is a composite? True Let p = 14 - 0. Is (-48)/56p/(-4) composite? False Let l = 1999 + -1122. Is l prime? True Let n = 4 - 7. Let m be 6/(-4)2/n. Is m + -2 + 1 + 35 a prime number? False Suppose 3n + 2w + 16 + 4 = 0, 0 = -2n + 4w + 8. Let x = n - -7. Suppose -xt + 94 = -t. Is t composite? False Suppose 2g - 27 = h - 4h, -4g = -3h + 27. Suppose -108 = -3d - h. Is d a prime number? False Let m(s) = s3 - 11s*2 + 4s - 13. Suppose -5r = -23 - 32. Is m(r) a composite number? False Let j(s) = -3150s. Let o be j(1). Is o/(-8) - (-8)/32 a composite number? True Suppose -2s + 5o = 3, 4s + 5o - 5 = 4. Let j be s + 4 + -2 - 2. Suppose -2b + k = -j - 36, b - 16 = k. Is b composite? True Suppose -14y + 10y + 5132 = 0. Is y a prime number? True Let z be (-10)/(-25) + 126/10. Suppose c + 4v - 257 = 0, c + 3v - 244 = z. Is c composite? False Suppose t = -3z + 5z - 44, -5z = t - 117. Is z composite? False Suppose -3o = 2t + 863, 0o + t = 3o + 869. Let b = o - -408. Let i = b + -60. Is i a composite number? False Let x = 1870 - 873. Is x a prime number? True Let f = 13 + -6. Suppose -19 - f = 2n. Let r = -2 - n. Is r a composite number? False Suppose -4p = -3x + 1811, -5x = 9p - 13p - 3005. Is x a composite number? True Suppose 3u + s = -0u + 620, -3u + 600 = -3s. Is u a composite number? True Suppose -9s + 11s - 374 = 0. Is s prime? False Let n = 7 - 4. Is -2 - (18/(-3) - n) a composite number? False Suppose 171 = -4l - 5o, -2l - 2o + 59 = -3*l. Let c = -24 - l.	{ "pile_set_name": "DM Mathematics" }
qy(f) - 2p(f). 2f + 2 Let x(u) = -9u + 2. Let y(g) be the second derivative of -2g3/3 + g2/2 - g. What is -2x(z) + 5y(z)? -2z + 1 Let k(u) be the second derivative of -u4/12 - u3/6 - 2u - 13. Let p(g) = -5g. Determine 5k(a) - p(a). -5a*2 Let k(p) = -4p*3 + 2p*2 - 9 - 13p + 18 + 15p2. Let g(o) = -o3 + 4o*2 - 3o + 2. What is -9g(h) + 2k(h)? h*3 - 2h*2 + h Let i(s) = 2s - 3s - 1 + 4s. Let f(w) = -4w + 2. Let q(c) = 2c - 3. Let g be q(3). Calculate gi(z) + 2f(z). z + 1 Let g(t) = -7t2 - 3t - 3. Let n(s) = 11s2 + 5s + 5. Let z = -13 + 5. What is zg(a) - 5n(a)? a*2 - a - 1 Let i(w) = 3w + 7. Let b(f) = -8f + 16. Let l(g) = -g + 1. Let x(n) = b(n) - 10l(n). Determine -6i(a) + 7x(a). -4a Let r(k) be the third derivative of k4/24 - k3/3 - k2. Let v(i) = i3 - i2 - 3i + 7. Let q be (2/(-5))/(6(-7)/(-210)). What is qv(j) - 7r(j)? -2j*3 + 2j*2 - j Let h(c) = -3c*3 + 2c*2 - 2c. Let b = -69 - -65. Let m(q) = 8q3 - 6q*2 + 6q. Determine bm(p) - 11h(p). p*3 + 2p*2 - 2p Let l(n) = 3n - 6. Let d(h) = -6h + 5. Let w(y) = -y. Let r(v) = d(v) - 4w(v). Give 5l(m) + 6r(m). 3m Let b(p) = 3p3 + 2p*2 - 4. Let o(d) = -6d*2 - 5 + 8d2 + d2 + 4d3. Calculate -3b(x) + 2o(x). -x3 + 2 Let d(a) be the third derivative of -a5/10 - 2a*3/3 + 4a*2. Let s(l) = 5l*2 + 3. What is -3d(u) - 4s(u)? -2u*2 Let f = -3 - 3. Let s(p) be the first derivative of -7/2p*2 - 4p + 4. Let j(k) = 8k + 5. What is fs(r) - 5j(r)? 2r - 1 Let f(n) = 53n + 9. Let j(a) = -13a - 2. Calculate -2f(k) - 9j(k). 11k Let b(p) = 11p. Let a be b(-1). Suppose -2u + 4u + 4 = 0. Let h(c) = c*2 + 16c + 10. Let o(l) = -3l - 2. Calculate ao(n) + uh(n). -2n*2 + n + 2 Suppose 39 = -3g + 6g + 3w, -2w = -2g + 6. Let x be (-2)/(-8)2-10. Let a(l) = l*2 + 5. Let i(j) = 14 - 2j*2 + 4j*2 - 6. Determine ga(k) + xi(k). -2k*2 Let q(z) = 2z*2 + 2z + 1. Let g be ((-88)/(-132))/(2/(-3) + 0). Let l(c) = -c*2 - c + 1. Give gl(s) - q(s). -s*2 - s - 2 Let f(c) = 16c + 9. Let a(d) = 8d + 4. Determine 5a(m) - 2f(m). 8m + 2 Let l = -22 + 22. Let o(n) = 1 + 4n - 2 + l. Let f(m) = m. Calculate -6f(z) + o(z). -2z - 1 Suppose -5c + 135 = 185. Let z(v) = 7v2 - 4. Let t(r) = r2 - 1. Calculate ct(s) + 2z(s). 4s*2 + 2 Let d(k) = 10k*2 - 6k - 3. Let t(q) = -9q2 + 5q + 3. Determine 6d(z) + 7t(z). -3z2 - z + 3 Let h(n) = 6n*2 - 3n. Let p(w) = 7w2 - 4w. Determine 4h(y) - 3p(y). 3y2 Let c(k) = -11k*3 + 2k + 1. Let m(u) = 34u3 - u2 - 7u - 4. What is 7c(o) + 2m(o)? -9o3 - 2o*2 - 1 Let d = -1 - -7. Let a = -21 + 11. Let v = a - d. Let g(r) = -6r*3 + 22r*2 + 16r - 16. Let i(n) = -2n3 + 7n*2 + 5n - 5. Give vi(p) + 5g(p). 2p3 - 2p2 Let d(g) be the first derivative of g2/2 + 4g - 1. Let z(t) = 2t + 5. Determine 5d(v) - 4z(v). -3v Let h(c) = -c2. Let a(s) = -s3 - 11s*2 - 17s + 10. Let k be a(-9). Let y(w) = 7w2 + w. Give ky(p) + 4h(p). 3p*2 + p Let f(w) = -2w - 5. Let q(s) = -s - 3. Calculate -6f(g) + 13q(g). -g - 9 Let m(o) = 2o2 - 3o + 3. Let i(c) = c - 1. Give -3i(d) - m(d). -2d*2 Let p(w) = -24w*2 - 1 + w + 25w2 + 0 - w3. Let v(f) = f2 + f - 1. Calculate p(o) - v(o). -o3 Let w(m) = -5m + 3. Let b(l) = -l - 1. Give -6b(i) + w(i). i + 9 Let z(k) = k + 7. Let n(t) = 1. Suppose 3l + 3 = 4l. Let x(g) = 0 - 1 - g + l + 8. Let m be x(9). Give mz(v) - 5n(v). v + 2 Let w(x) = 1 + 0x + 0x - x. Suppose 4 = -y - 2. Let o(p) = -4p - 9. Let b(h) = 11h + 26. Let j(l) = yb(l) - 17o(l). Determine -3j(m) - 7w(m). m + 2 Let o(a) = 35 - a - 6a - 31. Let h(v) = 3 - 1 - 3. Let p(l) = 3h(l) - o(l). Let t(k) = -4k + 4. What is -6p(r) - 10t(r)? -2r + 2 Let c(m) = m - 2. Let j be c(-5). Let k(t) = 4t - 1. Let d(w) = -20w + 6. Let o(g) = -2d(g) - 11k(g). Let h(b) = 13b + 2. Give jo(n) - 2h(n). 2n + 3 Let c be (-8)/(-12)-3 + 2. Let t(g) = c + 3 + 13g - 2 - 6g. Let r(z) = -z. Give 5r(o) + t(o). 2o + 1 Let x be -1 + 0 + 6 + -1. Let l(d) = -2d*3 - 4. Let q(m) = 49 + 0m3 + m3 - 46. What is xq(g) + 3l(g)? -2g3 Let o(x) be the second derivative of -x4/12 - 3x*3/2 + 9x*2/2 + 3x. Let k be ((-8)/6)/((-4)/(-54)). Let b(j) = -j + 1. Calculate kb(m) + 2o(m). -2m2 Let c(q) = -7q*2 + 5q - 5. Let g(f) be the first derivative of f3 - f2 + 2f - 10. Calculate 6c(t) + 15g(t). 3t*2 Let i(t) = t - 1. Let a(f) = -37f. Calculate a(x) - 2i(x). -39x + 2 Let w(j) = -j + 0 + 0. Let f(u) = -u*3 - 10u*2 - 20u + 8. Let a be f(-7). Let h(x) = x*2 - 4x. Determine ah(c) - 4w(c). c*2 Let y(v) = -14v - 4 + 0 + 36v - 16v. Let n(p) = 5p - 3. Calculate -5n(o) + 4y(o). -o - 1 Let b(c) = 3c*3 - 20c*2 + 2. Let t(g) = -4g + 13. Let q be t(4). Let f(j) = -j*3 + 7j*2 - 1. Calculate qb(y) - 8f(y). -y3 + 4y*2 + 2 Let a(z) = -4z + 5. Let r(n) be the third derivative of -5n4/24 + n3 - n2. Suppose -f - 4d - 15 = -5, -15 = 2f + 3d. Calculate fa(q) + 5r(q). -q Let t(d) = d2. Let g(w) = w3 + 2w2 + 3w - 4. Let u(s) = g(s) - 2t(s). Let a(l) = 3l*3 + 8l - 11. Give -3a(p) + 8u(p). -p*3 + 1 Let r(w) = -11583w*2 - 363w. Let z(b) = 64b2 + 2b. Give -2r(v) - 363z(v). -66v2 Let z(h) = 21h + 21. Let w(t) = -5t - 5. Let q(s) = -9w(s) - 2z(s). Let o(j) = -j. Let l be 20/12 + (-66)/18. Calculate lo(k) - q(k). -k - 3 Let t(j) = -j*2. Let y(u) = 4u*2 + 3u + 9. Determine 3t(h) + y(h). h2 + 3h + 9 Let i(f) = f + 1. Let s(a) = -2a - 1. Let z be s(0). Let o(v) = 3v + 3. Determine zo(n) + 4i(n). n + 1 Let h(w) = -18w + 12. Let t(q) = -7q + 5. Give 5h(f) - 12t(f). -6f Let n(u) = 2u. Let m(i) = 2i - 1. Let j(s) = 3m(s) - 2n(s). Let p(k) = -4k + 2k + 0k + 1 + k. Give -j(l) - 4p(l). 2l - 1 Let h be (3 + 0)/(-1 - -2). Suppose 5j - 56 = 54. Suppose 5m = -j - h. Let g(x) = x. Let s(v) = v. Calculate ms(z) + 4g(z). -z Let j(x) = x*3 + 6x*2 + 11x - 6. Let o(k) = 0k2 - 121k - 1 + k*2 + 123k. Give 2j(s) - 11o(s). 2s3 + s2 - 1 Let p(q) = -9q*3 - 3q*2 - 4q + 5. Let g(h) = -5h3 - 2h*2 - 2h + 3. Give 5g(a) - 3p(a). 2a3 - a2 + 2a Suppose 4s = -12, 0w = -2w + 5s + 25. Let j(l) = 3l3 + 5l - 5. Let t(g) be the first derivative of g4/4 + g2 - 2g + 1. What is wt(a) - 2j(a)? -a3 Let s(b) = -4b*3 - 3b*2 + 5b - 7. Let w(c) = -5c3 - 4c*2 + 6c - 6. Determine 4s(u) - 3w(u). -u*3 + 2u - 10 Let j(t) = -t - 2. Suppose -30 = -7v + v. Suppose -vs - 8 = -s. Let l(o) = o. Give sl(r) - j(r). -r + 2 Let g(w) = -w2. Let x(d) = 2d*2 - 2. Give -2g(c) + x(c). 4c2 - 2 Let d(y) = 4y - 3. Let l(n) = -n. Determine -d(p) - 6l(p). 2p + 3 Let f(r) = 3r - 7. Let y(h) = 3h - 7. Give 5f(k) - 6y(k). -3k + 7 Let t(j) = 7j*2 + 3j - 6. Let f(l) = -7l - 24l*2 + 11l*2 - 2l*2 + 13. Determine 4f(n) + 9t(n). 3n*2 - n - 2 Let g(b) = 2b3 + 3. Let j(z) = -z3 - 2. Let y(o) = -2o3 - 4. Let m(v) = 9j(v) - 4y(v). What is -2g(w) - 3m(w)? -w3 Let h(w) = -2w + 8. Let b(u) = u - 5. Let o(i) be the second derivative of i*4/12 - 3i*2 - i. Let y be o(5). Let q = y - 11. Determine qb(a) + 5h(a). -2a Let l(c) = c*2. Let x be 10/(-35)1 - (-16)/7. Let w(s) = -s*2. Calculate xl(k) - 2w(k). 4k2 Let k(r) = r2 + r + 1. Let z(w) = 3w3 - 4w*2 - 4w - 4. Calculate 4k(f) + z(f). 3f*3 Let o(j) = -10j - 6. Let d(z) = -21z - 12. Give -3d(s) + 7o(s). -7s - 6 Let b(n) = 1. Let m(r) = -r - 1. Let g(l) = 6b(l) + m(l). Let i(c) = -c + 6. Let p be (2/(-5))/(20/(-350)). What is pg(h) - 6i(h)? -h - 1 Let d(x) = -51x*3 - 7x*2 - 11x + 7. Let u(m) = -26m3 - 3m*2 - 5m + 3. Calculate 3d(z) - 7u(z). 29z3 + 2z Suppose 4b + 2f - f - 16 = 0, -4b + 8 = -f. Let g(y) = 5y*3 - 4y*2 - 3y. Let x(p) = -p*3 + p. What is bx(t) + g(t)? 2t3 - 4t*2 Let g(i) = 5i*2 - 26i + 16. Let x(u) = -u*2 + 5u - 3. What is -2g(y) - 11x(y)? y*2 - 3y + 1 Let f(t) = -111t2 + 21t - 21. Let a(l) = 11l2 - 2l + 2. Calculate 42a(j) + 4f(j). 18j2 Let u(k) = -2k*2 + k + 2. Suppose 2h - j = 3, -j - 5 = -h + 3*j. Let s = -2 + h. L	{ "pile_set_name": "DM Mathematics" }
1y - 13. Is l(-2) a multiple of 6? False Suppose 4k - 70 = -k. Suppose 9z = kz - 2820. Suppose -j + 5j - z = 0. Does 9 divide j? False Suppose 0 = 12f - 30f + 72. Suppose fl = -5g - 0l + 696, 5g = 3l + 668. Is 17 a factor of g? True Let s(x) be the second derivative of 0 - 5/2x2 - 6x - 7/3x3. Is 4 a factor of s(-5)? False Let v = -339 - -550. Let l = v + 9. Is 4 a factor of l? True Suppose 251t = -248t + 514t - 867600. Is t a multiple of 120? True Suppose -5b + 110 = 100. Suppose bj + 2 = 6. Suppose -j - 80 = -2i. Does 6 divide i? False Suppose -16k + 2k + 335580 = 37k. Does 28 divide k? True Let r = 346 - 575. Let t = 243 + r. Is 7 a factor of t? True Let g = -3300 - -20562. Is 18 a factor of g? True Let y = -181 + 2127. Is 28 a factor of y? False Let s = -2273 - -3526. Suppose l + s = 3p - 1556, 3 = -3l. Is 72 a factor of p? True Suppose 3j + 13x - 88106 = 8x, -4j = -3x - 117407. Is j a multiple of 5? False Let t = -1 + -2. Let o be (-6 - t)/(-1)1. Suppose -y - 3y + 4w + 100 = 0, ow = -3y + 75. Is y a multiple of 5? True Is (-19 - -16)1 - (3 + 0)-1846 a multiple of 6? False Let y(u) = -4u - 1 + 100 + 3u - 18. Is y(16) a multiple of 5? True Suppose -2u - 12b + 13b = -6962, 3u = 3b + 10446. Does 30 divide u? True Let d = 314 - 79. Let n = d + -218. Does 11 divide n? False Let r(v) = -3v - 7. Let l be r(-5). Let g(i) = -60i + 21. Let k(c) = -20c + 7. Let f(b) = -3g(b) + 8k(b). Does 26 divide f(l)? False Suppose 0 = -u + 6, -f - 2u = -688 + 91. Is 117 a factor of f? True Suppose -5q - 10 = 0, -m + q + 16 - 2 = 0. Suppose mv - 1740 = 2v. Is 14 a factor of v? False Let j(g) = 785g3 + 19g*2 - 28g + 25. Does 149 divide j(3)? True Is 24276/14 + 14/(-98) a multiple of 16? True Let n(w) = -2w. Let f be n(5). Let j(b) = -b*2 - 11b - 7. Let c be j(f). Suppose 2l + 4d = 72, -cl - d = 4d - 106. Is l a multiple of 7? False Let i(k) = -k*2 - 48k + 16. Suppose -6w + 17w + 286 = 0. Does 6 divide i(w)? True Suppose -2r + s = -s - 2, 0 = -2s - 2. Suppose -4w + 10w - 792 = r. Is 7 a factor of w? False Suppose -2i + 7452 = 2t, 5t = 5i + 2039 + 16561. Does 142 divide t? False Let y(r) be the first derivative of 3r4/4 - 4r*3/3 - 2r*2 - 5r - 767. Let d(w) = -2w. Let p be d(-2). Is y(p) a multiple of 29? False Let u(t) = t2 - t. Let z be u(2). Suppose d - q - 147 = 0, zd + 5q - 313 - 2 = 0. Is 3 a factor of d? True Let d be 280/45 + (-2)/9. Let j(g) = -6g - 14. Let r(f) = -f*2 - 1. Let l(x) = j(x) - 6r(x). Is 43 a factor of l(d)? True Let l(z) = 2z2 - 10z + 10. Let x be l(10). Suppose -22 = 3i - 4, 0 = 4t - 5i + 382. Let c = x + t. Is 5 a factor of c? False Let r be 0(-7 - 0 - (-35 - -29)). Suppose r = -3u + 2f + 1543, 4u - 1766 = 4f + 294. Is u a multiple of 57? True Let q be (4/(-6))/((6/1)/(-36)). Suppose h - 1325 = qz + 558, 0 = -5h - 3z + 9530. Is h a multiple of 12? False Let j = -13680 - -25944. Is 14 a factor of j? True Let x = 7394 - 4956. Suppose -10g + 4782 = -x. Does 38 divide g? True Is (-14 + (-16340)/50)-5 a multiple of 36? False Let p be 452 + 2 + 0/(0 + 1). Suppose -f = 4 - p. Is 18 a factor of f? True Let w = 139 + -141. Is (8 - 52)/(1/w) a multiple of 22? True Suppose d - 29760 = -253z + 258z, 3d = -2z + 89365. Is d a multiple of 35? True Let l be (-33)/(-21)190 + (-6)/(-14). Let y be 6/(1 - (-2)/4). Suppose yb - l = 1. Is 15 a factor of b? True Let s = 1024 + -1020. Suppose 20 = -5p, -102 + 21 = -3d + 3p. Suppose -4m = -4, 4m - 133 - d = -sb. Is 19 a factor of b? True Let s(z) = 14z*2 + 9z + 12. Let v be s(-8). Suppose 0 = 10u - v - 204. Does 6 divide u? False Let q(u) = u3 - 6u*2 + 10u - 27. Let i be q(5). Let t be (i/5)/1 + 39314/110. Let k = -209 + t. Is k a multiple of 16? False Suppose u - 1722l + 1718l - 792 = 0, u - l - 786 = 0. Does 4 divide u? True Is ((-81)/18 - -4)/((-4)/(-422))-16 a multiple of 52? False Let r = 150 + -3. Suppose 3b = 4j - r, 2j + 2b - 122 = -2j. Is 2 a factor of j? False Let b(d) = 9d2 + 6d - 1. Let l = -11 + 12. Let z be b(l). Suppose 340 = zu + 60. Is u a multiple of 13? False Let x(r) = -3r*2 + r - 6 + 5r*2 + 2r*2. Let a be x(3). Suppose -4w - a + 181 = 0. Does 17 divide w? False Suppose 26m - 39m = -32m + 51129. Does 9 divide m? True Let r(k) = -8k*3 - 2k*2 - 17k - 38. Let l be r(-6). Suppose 2w + 2w + 8 = 0, -3g + l = w. Is g a multiple of 41? True Suppose 0 = 5p - 9p + 3484. Suppose -14335 + p = -24o. Is 14 a factor of o? False Let a be 9/(-3)-1 + (-16)/(-4). Suppose h - 4h + 912 = 0. Suppose -3w - h = -aw. Does 7 divide w? False Let q(r) = 2r + 3. Let n(d) = 2. Let o(w) = -5n(w) - q(w). Suppose p + 6 = -9. Does 13 divide o(p)? False Let b(z) = z - 35. Let o be b(9). Let u = -14 - o. Suppose -16g + 240 = -ug. Does 10 divide g? True Let i be (10/6)/(8/24010). Suppose -ij + 290 + 80 = -5g, 0 = -2j - 4g + 142. Does 7 divide j? False Let s be (-3)/15 - -111/5. Suppose -sv - 5j - 463 = 0, 3v + 5j + 617 = -65. Let k = v - -409. Is k a multiple of 10? True Let o(z) = -287z - 14. Suppose 0 = 3h - 4h, 5n - 2h + 20 = 0. Does 10 divide o(n)? False Let c(g) = g3 + 16g*2 + 26g + 2. Let n = -204 + 190. Does 15 divide c(n)? True Is 76 a factor of -1 - ((-2)/10 - 4274544/380)? True Suppose 76s - 80s + 412 = 0. Let t = -65 + s. Is t a multiple of 18? False Let a be (5 + 99/(-15))/(2/(-5)). Suppose -7o + ao + 900 = 0. Suppose -h - 231 = -6m + 2m, 5m = 5h + o. Is m a multiple of 20? False Let c = -11642 + 15862. Is c a multiple of 32? False Let t = 11 + -3. Let h be (-14)/t-1 - 1/(-4). Suppose -hb - 4g - g + 48 = 0, 5b = g + 147. Is 4 a factor of b? False Is (75/12 - 0)7128/27 a multiple of 150? True Let y(w) = 1170w*2 - 11w + 22. Does 90 divide y(2)? True Suppose 48q - 292992 = -8q. Is q a multiple of 16? True Let o(i) = 360i + 312i - 765i + 23. Is 19 a factor of o(-2)? True Let u(l) be the third derivative of -2l*4/3 - 10l*3/3 - 54l*2 - 1. Does 50 divide u(-20)? True Let n(s) = 95s*2 + 1150s - 57. Does 11 divide n(-17)? False Suppose -11j + 130489 - 17431 = 0. Does 19 divide j? False Let i(a) = 7a*2 - 85a - 710. Is 5 a factor of i(-9)? False Let t(r) = 23 - 20r + 10r - 19r - 21r. Let g be t(-11). Let u = -395 + g. Does 26 divide u? False Let g(h) be the second derivative of 85h3/3 - 166h. Is 30 a factor of g(6)? True Suppose -2p - p - 5q + 905 = 0, 606 = 2p + 4q. Suppose -8d + p = -7d. Does 23 divide -20 + d + 0 + 1 + 0? True Suppose 5o - 1260 = -3n, 4n + 3o - 465 = 1237. Is 30 a factor of n? False Let p(v) = -565v + 2082. Is 38 a factor of p(-6)? True Let r = 3645 + -3631. Is 2 a factor of r? True Let v = 489 - 479. Suppose -6 = -z + 4q, v = 2z - 2q - 8. Does 4 divide z? False Let s(f) = f. Suppose -30 = 4k - 34. Let w(d) = 3. Let l(o) = kw(o) - 4s(o). Does 5 divide l(-10)? False Let v(m) = 10m3 - m2 + m. Let o be (-2 - 24/(-10)) + (-16)/(-10). Let u be v(o). Let l = u - 38. Does 8 divide l? True Let g = 34948 + -3667. Is 71 a factor of g? False Let n(f) = -6f + 60. Let x be n(-10). Does 5 divide (-8 + 14)x/9? True Let l = 164 - 164. Suppose -8p - 6p + 1260 = l. Does 18 divide p? True Suppose -277 = 2v + 3n, 215v - 3n - 670 = 220v. Let z be 394(1/(-2) + 1). Let j = z + v. Does 26 divide j? False Let q = 270 + -268. Does 18 divide (-255 + -1 + 4)(-3)/q? True Suppose 0v - 196 = 2v. Let c = -66 - v. Suppose 4f + p - c = 229, -5f + 5p + 345 = 0. Is 22 a factor of f? True Let o = -6707 - -9502. Is o a multiple of 13? True Suppose 0 = l - 2n - 3, -4l + 12 = -n + 2n. Suppose -5g = -lg + 6. Is g - (-4 - 11/1) a multiple of 4? True Let q be (-7)/((-7)/6) + -2. Let a be 0 + q/(-14) - 282/42. Let u(o) = -4o + 8. Does 9 divide u(a)? True Let j(f) = f*2 - 4f + 3. Let k be j(3). Suppose 5r = -kq + 2q + 8, 5q = -20. Suppose p + ri - i = 172, -4i = 3p - 516. Does 43 divide p? True Suppose -80 = -31g + 27g. Is 13 a factor of (-4)/(-3)15/g + 77? True Suppose 0 = 63q - 182818 - 80963. Is q a multiple of 79? True Suppose 0 = -f, 79w - 78w + f - 291 = 0. Is 97 a factor of w? True Does 116 divide (-185600)/(-12)3/2? True Let q be 1 + 2 - 164/41. Let	{ "pile_set_name": "DM Mathematics" }
097 Subtract 3 from -228520633211. -228520633214 What is -236659403 + -2402? -236661805 What is 4 less than -1662.7376041132? -1666.7376041132 Subtract 54067853649 from 3955. -54067849694 Subtract 19.964 from -1850954761. -1850954780.964 What is -1.32182233 minus 3539345? -3539346.32182233 What is the difference between -10222.77547 and 1.255? 10224.03047 Subtract 6865511.8 from 8818. -6856693.8 Work out -467179565.48 - -0.05. -467179565.43 What is -0.3 - -45205533.03679? 45205532.73679 What is 75 less than -3436925706187? -3436925706262 Add together 0.1131134 and 1024.685139. 1024.7982524 What is the distance between 2297 and 370676061? 370673764 Sum -11.6002 and 26837400. 26837388.3998 What is the distance between 411.22409 and 4.458523? 406.765567 Calculate -409360005 - -30. -409359975 Subtract 142580 from -55.790931. -142635.790931 0.827613057+2040 2040.827613057 Total of -0.17 and 636747340940. 636747340939.83 Add together 85254.69 and -29439. 55815.69 Sum -8 and -1224073116728. -1224073116736 What is -178504.282943 + -0.4? -178504.682943 Add -429739517082495 and -0.5. -429739517082495.5 What is -2225446492492 plus -0.0259? -2225446492492.0259 What is 8.4 plus -7.186230612? 1.213769388 What is the difference between -24676218 and -394.944? 24675823.056 What is 371.29 - 16.89053433? 354.39946567 Total of -12835 and -1.4557257. -12836.4557257 Work out -85488531307 - 0.2. -85488531307.2 Add together -12392.6 and 2562. -9830.6 Work out 39797243.861352 - 0.1. 39797243.761352 What is 2 take away -917041.53284? 917043.53284 What is -7298096 plus -4123039? -11421135 Work out -8270637 + 0.0733173. -8270636.9266827 What is 3.6 minus 13477614110? -13477614106.4 -0.1701199+-199640 -199640.1701199 Add -2148125 and -43066. -2191191 What is 1 less than -3654734877292? -3654734877293 Work out -764603326 + 5.2. -764603320.8 Put together 85867.66 and -0.166476. 85867.493524 What is the difference between -1203926843 and 4204? 1203931047 What is -0.2 less than -432733807.08846? -432733806.88846 What is 0.32 plus -2.742138289? -2.422138289 Calculate -17.3188784 - 75553.6. -75570.9188784 Subtract 42.3416683389 from -202. -244.3416683389 Subtract -28318342 from 2378. 28320720 What is 64651 + 139499496.8? 139564147.8 Work out -47116 - -18613255. 18566139 Sum 7228.6426 and 2289.14. 9517.7826 What is -2.5 - -0.8628300431458? -1.6371699568542 13500501444 - 2830 13500498614 Put together -96 and -115.3262817202. -211.3262817202 Put together 143134884813 and -0.3. 143134884812.7 What is 8038.77546 take away 0.2642? 8038.51126 Calculate 306275550.5 + 1.36393. 306275551.86393 Calculate 18339821 - -0.0281. 18339821.0281 What is 8478483.89094 less than 0.2? -8478483.69094 What is the difference between -1187989064 and -0.160576? 1187989063.839424 Add together -4 and -193316784246. -193316784250 Add 86.2603272025 and 0.01. 86.2703272025 What is -507637857069 - -12? -507637857057 1210.7999126 + -0.596 1210.2039126 Calculate -155326.847842 + 3. -155323.847842 What is the difference between -0.42850232525 and 9? 9.42850232525 Calculate -158924166242 + 4197. -158924162045 Calculate -0.694 - 195385153792. -195385153792.694 Add 1978800551.96 and 410. 1978800961.96 Put together -0.5 and -7868522436132. -7868522436132.5 Calculate -822.099 + -66.33568. -888.43468 What is -18264442224996 take away 0.4? -18264442224996.4 Calculate -2139628795 - 1483.24. -2139630278.24 What is -11461 less than 89218560? 89230021 What is -232789657 take away -0.09534? -232789656.90466 Work out 8.8 - 49817.5562. -49808.7562 -15076932 - -153.9 -15076778.1 Subtract 2392404 from 397800. -1994604 What is 252676.2 - -0.00441? 252676.20441 0.3417+-1194771831 -1194771830.6583 What is -12379693235 minus 1.799? -12379693236.799 Work out -3070 + -80453.037632. -83523.037632 What is -111.001556 take away 0.24? -111.241556 Calculate -2498103 - -16416. -2481687 What is 9 minus 29923818779? -29923818770 Add 3 and -4052895446497. -4052895446494 Total of 674640.4069 and 11.4686. 674651.8755 What is 202463687715 take away 3? 202463687712 -154675497+-16.05 -154675513.05 What is -16256431604 plus -14953? -16256446557 Calculate 397 + -1702255.6573. -1701858.6573 What is 31 less than 3.38242988? -27.61757012 What is 2 take away -5.259546934405? 7.259546934405 What is -418340630702 less than 0.5? 418340630702.5 What is the distance between -1388.95718 and -0.0426? 1388.91458 1998951846415 + -301 1998951846114 Put together 5 and -107051346090. -107051346085 What is 1268314236344 take away -0.4? 1268314236344.4 Add together 2069250.2864545 and 0.4. 2069250.6864545 Work out 5943438601 - 0.07. 5943438600.93 Total of 3.19050364 and -28.427. -25.23649636 188367050278+0.1 188367050278.1 -5.29642+-0.055044 -5.351464 Calculate 0.049 - 336280171232. -336280171231.951 What is 6501326004 - -5772? 6501331776 What is the distance between 1.26 and -3086511.96? 3086513.22 Add 225.6675 and -14.716268. 210.951232 Add together -5 and 0.04769468645828. -4.95230531354172 Put together 9.8 and -9225.158417. -9215.358417 Total of 2173483581.8 and -2.0214. 2173483579.7786 Calculate -519362416577 + 0.205. -519362416576.795 Put together 0.008 and 2958184.972. 2958184.98 What is -0.2 plus 6445979260280? 6445979260279.8 What is 0.3 + 1.61819121678405? 1.91819121678405 Total of -0.3 and 89627648.87. 89627648.57 What is -66162.163019 less than 4.3? 66166.463019 Total of 723375220004 and 5. 723375220009 What is the difference between 2.0149 and 18070610? 18070607.9851 What is the distance between 50 and -8049289674? 8049289724 What is -1176.92341 less than -501753? -500576.07659 Total of 314.1 and 0.46600538077. 314.56600538077 Put together 19955959 and 7. 19955966 79888 - 107214.7259 -27326.7259 Calculate 0.0483 - -2.4244168. 2.4727168 Work out 5 + -56216177687536. -56216177687531 -3938517.4 - 1.181 -3938518.581 -2959241 - -1118334 -1840907 What is the distance between 743236 and -60197591? 60940827 What is 0.99 minus 7.07646914671? -6.08646914671 Calculate 177521.217 + -1.1536. 177520.0634 What is the difference between -291429058 and 24009? 291453067 What is 60881.33 - 82260804? -82199922.67 Sum -0.076 and -1626071325. -1626071325.076 -4 - -14982751837179 14982751837175 Add together -1891212139433.39 and -0.1. -1891212139433.49 38.3156 - -27.744789 66.060389 What is the distance between 0.061944 and 21696215? 21696214.938056 What is the distance between -0.049 and -510663.184? 510663.135 What is -2 less than -135450697743.6? -135450697741.6 Sum -1.1595209572 and -24816. -24817.1595209572 Add together -16 and -0.67698650228. -16.67698650228 What is 3.016241024301 plus -2? 1.016241024301 Calculate -36860944 - -0.657206. -36860943.342794 Work out 17 - -0.03881999473. 17.03881999473 What is the distance between 3.109935 and 900057? 900053.890065 What is 0.1525 + 122510549? 122510549.1525 80.5185+-2.77572 77.74278 Sum -39492806888203 and 6. -39492806888197 What is -8160683076 take away -3? -8160683073 Put together 42 and 57892124721. 57892124763 What is -0.162841996 minus -347.73? 347.567158004 Work out -26.9787 + -0.000315. -26.979015 Calculate -1288.9 - -23029286943. 23029285654.1 What is -33543 - 1934.4752? -35477.4752 What is -0.5 less than 4.5755998251927? 5.0755998251927 What is -9780.87 take away 1093.559? -10874.429 Calculate 5497651962047 + -0.2. 5497651962046.8 What is -2069208856 plus 12143? -2069196713 -0.012+191211937.1 191211937.088 What is 31109 + 48465662? 48496771 What is -149.307538517 plus 116? -33.307538517 What is the difference between 0.1 and -56603053895? 56603053895.1 Work out 4818 - 0.190855085. 4817.809144915 What is -1 minus 23426920195404? -23426920195405 Total of -0.3 and 57656839516. 57656839515.7 What is -0.4 - -2987424475.56? 2987424475.16 What is -16400761.278 less than -0.13701? 16400761.14099 1232547 + -0.2344825 1232546.7655175 -1185.96911 - -0.0119 -1185.95721 Sum -13034.4 and -20001458. -20014492.4 What is the difference between 51947232 and 8470.558? 51938761.442 What is the distance between 645011 and -1020403? 1665414 Calculate 673268147 - -85. 673268232 What is -83.37 + 58448293.9? 58448210.53 What is -3206016 less than 0.149327? 3206016.149327 Put together 43454 and 95403.422. 138857.422 Subtract 5 from -9198	{ "pile_set_name": "DM Mathematics" }
+ 5s Collect the terms in -12 + 52o*2 + 12 - 140o*2 + 39o*2 + 33o*2. -16o*2 Collect the terms in -1423z - 690z + 479z. -1634z Collect the terms in -1817792f*2 + 912557f*2 + 905249f*2. 14f*2 Collect the terms in 424o*2 - 927o*2 + 493 + 303o*2 + 0o + 2o - 493. -200o*2 + 2o Collect the terms in -20670r + 10204r + 485r2 + 10466r. 485r2 Collect the terms in -462r + 474r - 235r - 709r - 410r - 1033r. -2375r Collect the terms in -864q3 + 256q*3 + 328q*3 + 323q*3. 43q*3 Collect the terms in -46839j*3 - 2888j*3 - 904j*3. -50631j3 Collect the terms in z2 - 106363z3 + z2 - 2z*2 - 97763z*3. -204126z*3 Collect the terms in -2124k*3 + 8562k*3 - 6436k*3. 2k*3 Collect the terms in -463 - 940j*3 - 479 + 4j*2 + 942 - 4j*2. -940j*3 Collect the terms in -1599l*2 - 648257249 + 648257249. -1599l*2 Collect the terms in 81u*3 - 10005 + 20045 - 10043 - 4u*2. 81u*3 - 4u*2 - 3 Collect the terms in -1672w*3 - w + 0w - 19w2 - 19w*2 + 40w*2. -1672w*3 + 2w*2 - w Collect the terms in -36f*3 + 18f*3 - 537f + 1599f - 538f + 19f3 - 524f. f*3 Collect the terms in 500724p - 15 + 17 - 500706p. 18p + 2 Collect the terms in 672238 - 672238 + 40x2. 40x2 Collect the terms in -m2 - m*2 - 133 + 134 + 11224m. -2m2 + 11224m + 1 Collect the terms in -3533j2 - 1995j*2 + 5551j*2. 23j*2 Collect the terms in 531i*3 + 40216i - 40216i - 535i*3 - 20. -4i*3 - 20 Collect the terms in 6713j*2 - j - 3122j*2 - 3279j*2. 312j*2 - j Collect the terms in -11550i*2 + 19i - 11540i2 + 23081i*2. -9i*2 + 19i Collect the terms in -1923d2 + 1923d*2 + 1037d*3 - 669d*3 - 537d*3. -169d*3 Collect the terms in 435f + 30 - 11 + 665f + 9. 1100f + 28 Collect the terms in -29926f3 - 5510f*3 - 14350f*3 + 707f*3. -49079f*3 Collect the terms in -803d - 803d - 4 - 810d + 3726d - 1308d. 2d - 4 Collect the terms in 11f*3 + 35f - 12f3 - 4f*3 + 3f*3 + 41f - 16f. -2f*3 + 60f Collect the terms in 4707y - 14377y + 4654y + 4564y. -452y Collect the terms in -68949 + 34515 - j3 + 34434. -j3 Collect the terms in 6z*3 - 52954 - 5z*3 - 52953 + 12z*3 + 105907. 13z*3 Collect the terms in -154027v*2 - 52292v*2 + 55618v*2. -150701v*2 Collect the terms in 2111z + 8030 - 8030. 2111z Collect the terms in -20550645k + k*2 - 20550651k + 41101296k. k2 Collect the terms in 157921 - 157921 + 22417a. 22417a Collect the terms in -12816m + 18616m - 28610m - 34896m. -57706m Collect the terms in -467i + 167i + 300i + 5328i*3. 5328i*3 Collect the terms in -267709h + 74363h - 181838h - 5402h. -380586h Collect the terms in -4644y3 + 7y + 9318y3 - 38 + 38 - 4664y*3. 10y*3 + 7y Collect the terms in 25859369412 - 25859369412 - 19w3. -19w*3 Collect the terms in -80 + 27152y*2 - 27153y2 + 85. -y2 + 5 Collect the terms in 447 + 91 + 553q - 12. 553q + 526 Collect the terms in -471214y3 + 31036y*2 - 471217y*3 + 942426y*3 - 31036y*2. -5y3 Collect the terms in 2 - x2 + 40989x3 - 19x*2 - 41010x*3. -21x*3 - 20x*2 + 2 Collect the terms in -24 + 31x*3 + 49 - 26 + 1. 31x*3 Collect the terms in -d + 5444353845813 - 5444353845813. -d Collect the terms in g - 231 - 171 + 2g - 2g + 43g*2. 43g*2 + g - 402 Collect the terms in 55 - 55 - 3914785a. -3914785a Collect the terms in 367081u - 734172u + 367105u. 14u Collect the terms in 3 - 50n - 6 - 1975n2 + 0 + 4. -1975n*2 - 50n + 1 Collect the terms in -1 - 45o - 32o + 92o. 15o - 1 Collect the terms in 652 - 5i3 + 2815 - 3469. -5i*3 - 2 Collect the terms in 16m*2 - 721m + 569m + 152m - 12m2. 4m*2 Collect the terms in -61 + 93w*3 - 178w*3 - 22 - w + 84w + 86w3. w3 + 83w - 83 Collect the terms in 2j2 - 71459691918943j + 71459691918943j. 2j*2 Collect the terms in 6123g*2 - 3080g*2 - 3048g*2 + 1 + 5. -5g*2 + 6 Collect the terms in 4z - 176507 - 10z + 1621251 + 4z. -2z + 1444744 Collect the terms in -2961308n + 2961308n - 124n*2. -124n*2 Collect the terms in -2 - 13145570a + 26291146a - 13145574a. 2a - 2 Collect the terms in -70407t*3 + 3036t - 1518t - 1518t. -70407t3 Collect the terms in -967482w*3 + 484929w*3 + 485264w*3. 2711w*3 Collect the terms in 26281 + 25348p - 26281. 25348p Collect the terms in 88t + 7 - 74t2 + 238t*2 - 78t*2 - 78t*2. 8t*2 + 88t + 7 Collect the terms in -43k3 - 42635003 - 47k*3 + 0k*2 + 42635003 + 0k*2. -90k*3 Collect the terms in -6k*2 - 2122k*3 + 19k*2 + 56k - 13k2. -2122k*3 + 56k Collect the terms in -4083r + 1812r - 3026r - 235r. -5532r Collect the terms in 293668b*2 + 109895b*2 + 927414b*2 + 323287b*2. 1654264b*2 Collect the terms in 25249w*2 - 25232w*2 - 8 + 10. 17w*2 + 2 Collect the terms in -81 + n + 48 + 34 + 22n*3 - n - 62n*3. -40n*3 + 1 Collect the terms in 367229q*2 + 367235q*2 - 734464q*2 + 22q*3. 22q*3 Collect the terms in 363900b - 182093b - 182057b. -250b Collect the terms in -126o*2 - 66o - 1027 + 66o + 1025 + 51o*2. -75o*2 - 2 Collect the terms in -7h + 15h - 662h*2 - 132h*2 - 401h*2 - 5h. -1195h2 + 3h Collect the terms in -930x - 930x + 369 + 1859x. -x + 369 Collect the terms in 407i + 259i - 1544i + 214i + 258i. -406i Collect the terms in -1036 + 462 + 289 + 285 - 69d. -69d Collect the terms in 442g - 8822 + 4321 + 4501 - 446g. -4g Collect the terms in 68 - 210 + 70 + 73 + 22g - 20g. 2g + 1 Collect the terms in 27615495894w - 27615495894w + 27w*3. 27w*3 Collect the terms in -1149z + 6876z - 1141z - 1145z - 1147z - 1148z - 1142z. 4z Collect the terms in 175r - 306r + 90r + 79r. 38r Collect the terms in -133q3 + 15q*3 - 213q*3 + 3 - 26q*3 + 31q*3 - 125q*3. -451q*3 + 3 Collect the terms in -3443g - 1534 + 491g + 1534. -2952g Collect the terms in 2 - 3 - 120294d + 120390d. 96d - 1 Collect the terms in -124r*2 + 162 + 116 + 15r*2 - 759r*2 - 278. -868r*2 Collect the terms in -4493s - 4497s - 4488s - 4498s + 22494s - 4502s. 16s Collect the terms in -354r - 352r + 1083r - 288r - 25r3 - r2. -25r3 - r2 + 89r Collect the terms in 28p*3 - 29647p + 59310p - 29663p. 28p3 Collect the terms in -5k*3 + 4k*3 + 2 + 471k*2 - 5k - 4 + 2259k2. -k3 + 2730k*2 - 5k - 2 Collect the terms in -93703m - 7m*2 + 188903m - 95200m. -7m*2 Collect the terms in 41 - 231o*3 + 35 - 5o*2 - 77 + 0o*2. -231o*3 - 5o*2 - 1 Collect the terms in 3481597 - 1740800 - 1740797 + 403r*2. 403r*2 Collect the terms in -4353l*2 - 249920463 + 249920463. -4353l*2 Collect the terms in 0o - 286643o2 + 30 + 0o. -286643o2 + 30 Collect the terms in -8883a + 4a2 - 5a*2 - 9 + 8885a + 8 + 1. -a*2 + 2a Collect the terms in -166172c - 28561c - 62633c. -257366c Collect the terms in 9a - 102a*3 - 323a*3 + 7a + 97a3. -328a*3 + 16a Collect the terms in 4558263 + 524j - 4558263. 524j Collect the terms in -3163c3 - 3319c*3 + 6727c*3. 245c*3 Collect the terms in 53872m*2 - 19006m*2 + 5388m*2 + 40311m*2. 80565m*2 Collect the terms in 2098s*3 + 12733s - 12729s - 2107s*3. -9s*3 + 4s Collect the terms in -32876l3 - 2921l*3 - 3318l*3. -39115l*3 Collect the terms in -175q*2 + 936q*2 + 63q*3 + 26 - 761q*2 - 25. 63q*3 + 1 Collect the terms in -1467u*3 - 7925u*3 + 1646u*3 - 5509u*3. -13255u*3 Collect the terms in -4s*3 + 0s*3 - 425s*2 + 428s*2 - 12s*3 - 6s*3 - 3s*3. -25s*3 + 3s*2 Collect the terms in 184518q*3 + 1696714q*3 + 272 - 272. 1881232q*3 Collect the terms in -24973n*2 + 2 + 14422n + 49950n2 - 24978n2. -n2 + 14422n + 2 Collect the terms in -3156x*2 - 13712x*2 - 22221x*2 + 4660x*2. -34429x*2 Collect the terms in -19d - 7d + 142d - 96d - 16d. 4d Collect the terms in -321780 - 31890 - 6t + 5t. -t - 353670 Collect the terms in -2 + 522j + 531j + 477j - 1598j - 1. -68j - 3 Collect the terms in -229d + 7 - 8505d*2 + 78d + 72d - 5 + 78d. -8505d*	{ "pile_set_name": "DM Mathematics" }
c + 471c - 58c + 1476c as g + kc and give k. 2366 Express -11w2 + 24w*2 + w - 3 - 19w*2 + 8 as ow + t + uw2 and give t. 5 Rearrange -5 - h + 4 - 5 - h to the form qh + f and give q. -2 Express (-1335p + 1335p + 127p3)(2p - 5p - 2 + 9) in the form vp3 + mp + j + bp4 + wp*2 and give j. 0 Express (0p + 6p - 4p)(-p2 - 86 + 86) + (-7 - 1 + 3)(-1 + 1 + 2p3) as y + up*2 + rp*3 + kp and give y. 0 Rearrange 6y + 15y*2 - 4y + 5y2 + 4 to the form z + vy + jy2 and give j. 20 Express (-55c + 189c - 51c)(-2c2 - c2 + c*2 + (-3c - c + 2c)(-c - c + 4c) + 2c*2 - 2c*2 + 2c*2) as pc*2 + xc*3 + y + gc and give x. -332 Rearrange (-4 + 3 + 3)(-2v + 3v - 3v) + (-44 - 16v + 44)(-4 - 4 + 5) - 4v + 2v + 4v to nv + x and give n. 46 Rearrange -23 + 8 + 5q3 + q4 - 5q*2 + 12 to the form mq + kq2 + wq*3 + c + xq*4 and give c. -3 Express (11u - 1 + 13 - 6)(8u + u + 25u) in the form ju*2 + b + zu and give z. 204 Express 2d2 + 29d*3 + 4d - 1 - 27d3 - 9d*4 + 11d*4 in the form td*4 + fd*3 + ad + y + sd2 and give a. 4 Express 4 + 1463l*2 - 3l*3 + 6l*4 - 1463l*2 as nl*2 + y + kl*4 + zl + ql3 and give q. -3 Rearrange -13x*3 + 6x*3 + 5x*2 - 5x + 3x + 4x to the form wx2 + cx + n + jx3 and give c. 2 Rearrange (-26o*2 - 75o*2 + 197o*2)(-65 - 32 - 10 - 69) to the form k + do2 + qo and give q. 0 Rearrange -2 - 3h2 + 4h*2 - 182h + 2 + 78h to q + th + uh2 and give t. -104 Express -108z*4 + 3 - 1 + 4 + 127z4 + z2 + 3 in the form sz3 + hz*2 + vz*4 + d + mz and give d. 9 Express 306j3 + 21j + 6j - 29j in the form kj3 + gj*2 + n + wj and give w. -2 Express 143d + 149d + 4 - 27d3 - d2 - 4 - 293d in the form z + bd3 + ad + yd2 and give b. -27 Rearrange (5x*2 + 0x*2 - 3x*2)(4x - x - 4x) - 2038x3 + 6310x*3 - 981x*3 to the form qx*3 + m + nx*2 + gx and give q. 3289 Rearrange -1702 - 83h4 + 1702 + h4 + 3h*4 - 3h*4 + (-2 + 2 + 2h*2)(-2 - 2h2 + 2) to x + oh*3 + th*4 + kh*2 + bh and give t. -86 Rearrange -522o + 958o + 1046o to the form zo + c and give z. 1482 Express 99w2 - 3 - 74w*2 + 2 - 61w*2 - 107w*2 as k + ow + sw2 and give k. -1 Rearrange 7j*2 - 9 + 17j - 17j - j2 to k + zj*2 + nj and give z. 6 Express 12l2 - 19l*2 + 3l*2 + l + 16l*2 + 5l in the form ml + il*2 + p and give m. 6 Express (4 - 1 - 4)(-2 + 5 + 5)(-2x + 8x + 0x + 5x - 3x - 3x + (0x + x - 3x)(3 - 3 + 1) - 2 + 2 - x) as a + px and give p. -16 Rearrange (4 + 1 - 6)(3 + 2 - 1 + 7)(-k - 2k + 9k) to xk + y and give x. -66 Express (14l2 - 19l*2 + 15l*2)(8l2 + 2l - 2 - 7l2 + 0l*2) as tl*3 + jl + al2 + ol*4 + f and give a. -20 Express -3723 + 3723 + 54o as xo + w and give x. 54 Rearrange 0 - 15g*2 - 1 + 8 - 26 - 6 to the form wg + t + bg2 and give b. -15 Rearrange 24 - 24 - 667y - 12y2 + 13y*2 to l + xy + ay2 and give a. 1 Express -j - 3 - 2j*4 - 4 - 491j*3 + 11 - 4 as oj*3 + w + hj*2 + bj*4 + uj and give o. -491 Express 56o3 + 101o*3 + 2o + 71o3 + 111o*3 as l + ko*3 + vo*2 + to and give t. 2 Express (-8a3 - 85 + 85)(0 - 2 + 4) + a*3 + 0a + 0a as h + ia*2 + ya*3 + ca and give y. -15 Rearrange (g - 1 + 1)(0 + g + 0) + (-7 + 7 - 7g)(-3 + 0 + 0)(-g - 2g - 2g) to ug2 + og + t and give t. 0 Express 755c2 - 753c*2 + 7c*3 + 3c + c*3 as s + lc*3 + tc*2 + qc and give q. 3 Express (3 + 3 - 2)(-2 + 2 + 2)(2q - 24q - 9q)(2 - 6 + 1) as jq + x and give x. 0 Rearrange (-7 + 19 + 24)(4 - 5 - 2)(-4z + z + 4z)(-3 - 4 + 2)(-2 - 1 + 2) to mz + c and give m. -540 Express (-3t - 15 + 15)(1 + 3 - 3)(4t - t - 4t)(-6 - 4 + 0)(13 - 13 + 17t) in the form st + r + ct*2 + xt*3 and give x. -510 Express 479d2 + d3 + 5d4 - 23 - 475d2 - d4 - 3d4 as ad*4 + zd*2 + hd*3 + md + c and give h. 1 Rearrange (z + 4z - 3z)(-12 + 13 - 44) + 0 + 2z + 0 + (-2 - 1 + 1)(-z + z + 2z) + 0 + 0 + z - z + 0z + 2z to the form y + fz and give f. -86 Rearrange -264p3 + p4 + 0p2 - 379p + 266p3 + 2p*2 to the form i + up*3 + op*4 + sp + ap2 and give o. 1 Rearrange -3 - 27y - 2 + 59y - 30y to ry + n and give r. 2 Express -69n*4 - 66n4 - n2 - n*3 + 111n*4 as xn + h + tn2 + dn*4 + yn*3 and give d. -24 Express (-1008q - 325q - 113q + 68q)(2q2 + q2 - 4q*2) in the form aq*3 + kq*2 + o + rq and give a. 1378 Rearrange -2s2 - 18s - s*2 + 14s to bs2 + d + qs and give q. -4 Express 463w3 - 4 + 364w*3 - 617w*3 in the form tw*3 + l + mw*2 + dw and give l. -4 Rearrange (1 - 2c3 - 1)(5 - 3 + 1) + 56 + 9c3 - 56 to a + zc*3 + tc + kc2 and give z. 3 Express (13 - 13 - 8w)(-13w - 52w + 19w) as x + jw + qw*2 and give q. 368 Rearrange -9237q + 9237q - 1210q*3 + (-3q + 0q + q)(5q - 5q + q*2) to aq*3 + m + iq + cq2 and give a. -1212 Express -8g - 14 - 7g + 22g as s + hg and give s. -14 Rearrange -82s*2 + 0s - 9s + 9s to cs + ps*2 + f and give p. -82 Rearrange 27c*4 + 25c*4 - 49c*4 - 3c - 2c2 + c2 to l + hc + ic3 + jc*2 + qc*4 and give h. -3 Rearrange (-1 - 1 - 2)(4910 - 4910 - 808h2) to jh + sh2 + q and give s. 3232 Express -142d + 25d - 129d + 15d - 280d as i + qd and give q. -511 Express -f4 + 6f4 - f4 - 53f4 + 31f*3 - 31f*3 + (-1 + 2f + 1)(1 - 1 - f3) as rf + l + of4 + gf*3 + qf*2 and give o. -51 Express 17f*3 + 0 + 61f - 16f3 - 2 + 60f as rf + yf*3 + j + tf*2 and give r. 121 Rearrange 0c2 - c4 + 0c2 + (-32 + 49c + 32)(7c - 4c + 0c + 2c2 + c3) to the form tc*2 + ic*3 + kc + sc4 + r and give i. 98 Express 7637l - 7637l + 1951l*2 as n + bl + al2 and give a. 1951 Express (0s + 2s + 2s)(2 - 1 - 2)(2 - 4 + 4)(46s + 174 - 174) as cs2 + vs + o and give c. -368 Rearrange 51 + 4u - 5u + 4u to g + tu and give t. 3 Express (-2 + 0 + 4)(-8y*2 - 3y*3 + 6y*2 + 4y*3) - 10y*2 + 10y*2 + 6y*3 as ly*2 + jy + w + ny3 and give l. -4 Express -5b*2 + 5b*2 - 2b - b*2 + (-4 + 2b + 4)(90 - 90 + 25b) as ub + l + ib*2 and give i. 49 Express -3644 - 744a + 3644 - 3a in the form ia + w and give i. -747 Rearrange -13p2 + 66p*2 - 134p*2 + (0p + 3p - p)(0 - 2p + 0) + 0p2 + p2 + 0p2 to the form o + bp + vp2 and give v. -84 Express -2i - 3 + 3 + (-27i - 10i + 17i)(-1 - 1 + 1) + 3i + 2i + 0i as vi + s and give v. 23 Rearrange 213x + 92 - 92 + 1166x to qx + r and give q. 1379 Express (-y3 - 3y*3 + 2y*3)(1 + 0 - 2) - y*3 - 2 + 2 + (-6y + y*3 + 6y)(0 - 1 - 2) as v + ky*3 + ty*2 + ny and give k. -2 Express -2y4 + 16y*2 + 17y*2 - 24y*2 - 3 - 2y - 2y3 + y4 in the form ry + cy2 + by*3 + m + ny*4 and give n. -1 Rearrange 5 - 3a - 7 + 25a2 + 0 - 15a*2 to the form u + ia*2 + da and give u. -2 Rearrange 2i3 - 21i*2 - 2 - 435i + 434i - 1 to the form fi*3 + y + ti + oi2 and give o. -21 Rearrange 4592t - 2290t + 2t*2 + 33t*4 + 5t*3 + 2 - 2300t to the form j + lt3 + qt*4 + bt + nt2 and give l. 5 Express -5f*3 + 6f*2 - 1447 + 0f*2 - 4f*4 + 1445 as q + zf*2 + rf*4 + nf + xf3 and give x. -5 Express -535y*2 + 944y*2 - 480y*2 as j + ny*2 + ky and give n. -71 Rearrange (7 - 9 + 1 + (7 - 2 - 3)(0 + 4 - 3))(2s3 - s3 + 3s + 2s) to the form m + ts + bs2 + ls*3 and give l. 1 Rearrange ((1 + 3 - 3)(j + 3j - 3j) + 42j - 11j - 2j)(-3 + 0 + 4) to aj + w and give a. 30 Express 2367q*2 + 0q - 802 - 2365q2 + 0q in the form m + dq2 + kq and give m. -802 Rearrange (34a + 27a + 228a)(-1 + 2 + 0) to the form i + ua and give u. 289 Rearrange -433z - 348z + 5z*2 - 6z*2 to the form oz + u + qz2 and give o. -781 Rearrange r2 + r2 + r2 + (-r + 0 + 0)(2r - 2r - r) + (3 + 4 + 2)(-r2 + 2r*2 + 0r*2) to u + yr + gr2 and give g. 13 Express (-3 - 2 + 3)(-2j + 0j + j) - 3j - 2j + 4j + (-1 + 1 - 2)(-6j + j - 5j) + j	{ "pile_set_name": "DM Mathematics" }
e the smallest common multiple of 121 and o(15). 605 Suppose -r - 194 = -4v + 865, 3r = 5v - 3149. Let t = r - -1077. What is the smallest common multiple of t and 51? 102 Suppose -2w = p - 83, 33 = 3w - 4p - 97. Let k = 713 + -635. What is the smallest common multiple of w and k? 546 Let k = 5486 + -87735/16. Suppose q + 339 = 4a, -2q - 5a + 63 = 780. Find the common denominator of k and 78/q - (-43)/72. 16 Suppose 5n - 484 = -4h, 1138n = 1134n - 2h + 386. What is the lowest common multiple of n and 1760? 5280 Suppose 0p + 53 = -3p - q, -4p - 89 = 5q. What is the common denominator of 4/22284/p and (-4)/(-474)210/(-40)? 1738 Calculate the common denominator of (-8)/3 - (-55637)/21525 and 141/350. 1050 Let k be (-2)/(-3(-4)/6). Find the common denominator of (k/((-5)/(-2)))/((-48)/(-140)) and 149/66. 66 Let p(c) = c3 + 3c*2 - 2c + 5. Let y be p(5). What is the common denominator of y/(-6) - 2/1 and -2 - 170/(-24)-1 - 330/1980? 4 Let a = 609 - 597. Calculate the common denominator of -77/142 and ((-285)/(-27) + 3)a/8. 426 Suppose -5k + 3603 = d, 3k + 137d - 2157 = 138d. Calculate the least common multiple of k and 260. 9360 Let z = -39 - 491. Find the common denominator of (-3 - z/15)(-9)/84 and -41/28. 28 Let d be (-3)/6(-2 + -412). Suppose 6v = d + 753. Calculate the least common multiple of 7 and v. 1120 Suppose -81s - 17s + 2352 = 0. Suppose 0 = 6y - y - 240. What is the least common multiple of y and s? 48 Find the common denominator of 1/1410 and 60/1505/(-6) - 274/420. 9870 Let f(k) = 2k + 8. Suppose 0 = 2n + n - 12. Let z(u) = u + 9. Let m(l) = nf(l) - 5z(l). What is the least common multiple of m(8) and 11? 11 Let n = 5536222129/700 + -7908891. Let r = n - 1/175. Calculate the common denominator of r and -121/18. 36 Let x = -8 - 1. Let r = -4 - x. Suppose rq = -65 + 120. What is the lowest common multiple of 1 and q? 11 Suppose -3s + 4o = -704, -68 = -s + 3o + 160. Suppose -s = -22p + 6p. Calculate the lowest common multiple of 30 and p. 30 Let q be (-5131)/(-98) + 13 - (1 + 1). Let u be 765/35 + 1 + 0. Let s = u - q. Calculate the common denominator of -5/8 and s. 8 Suppose 3y - 2 = 7. Suppose yz = -0z + 18. Suppose -5d = -102 - 298. Calculate the least common multiple of z and d. 240 Let d be (-15678)/(-938) + (-2)/(-7). Suppose -3b = -2v + 4, 5b - 5 = -2v - 1. Suppose -65 = -vm - d. Calculate the smallest common multiple of 3 and m. 24 Suppose -3o - 624 = 4g - 3g, -5o - 1044 = 3g. Let s = 350 + o. What is the lowest common multiple of s and 130? 1430 Let w = 209 - 207. Find the common denominator of -121/340 and (1736/128 - 3) + (-3 - w). 1360 Calculate the smallest common multiple of (-5 + 0)230/(-25) and 161. 322 Suppose 31v - 360 = 26v. Let d be 1217734/v + 4/(-16). Let z = d + -16917. Find the common denominator of z and -83/40. 360 Let y(q) = q*3 - 13q*2 - 33q + 25. Let n be y(15). Suppose 110 = -p + 6p. Let s = p + n. Calculate the least common multiple of 16 and s. 16 What is the smallest common multiple of 124/(-155) - (51633/(-35) - (-87)/203) and 2? 1474 Let m = -30 - -34. What is the common denominator of (86/m)/(77/(-14)) and (6/(-5))/((-165)/(-50))? 11 Let f be ((-4606)/235)/(4/(-1370)). Let w be (-885470)/(-132) + (-4)/(-6). Let a = w - f. Calculate the common denominator of a and -25/11. 22 Suppose -4s - 5 = -2t - 19, 3t + 2s = 35. Calculate the least common multiple of 5111 and t. 35777 Let v be (8/(-14))/(4/(-350)). Suppose -49w + vw - 12 = 0. What is the lowest common multiple of 138 and w? 276 Let n = 15 - 35. Let i(y) = -16y + 2. Calculate the lowest common multiple of i(n) and 20. 3220 Let f = -35195 - -5701591/162. Calculate the common denominator of f and 89/108. 324 Let h be (86/56 - 6/21)-8. Let z be 40/h4/22. Let n = z - -513/55. Find the common denominator of n and -71/28. 140 Let o = -522331/68 + 7680. Find the common denominator of o and 18/(-16)(-23)/(621/(-153)). 136 Let s = -4360 + 6862. Let g = 55059/22 - s. Find the common denominator of g and -12 - ((-156)/2028 - (-32590)/(-2548)). 1078 Suppose -3t + 4f - 91 = -119, 4t + 3f - 29 = 0. Calculate the smallest common multiple of t and 374. 1496 Let b be (-2)/(-5) - 2793/15. Let n = -41071/220 - b. Let v = -360211/22 + 16377. Find the common denominator of v and n. 44 Let q(c) = 2c*2 + 3c + 9. Let u(l) = -2l2 - 11l + 11. Let m be u(-8). Let f = -32 - m. Calculate the least common multiple of 4 and q(f). 36 Let j = 135 - 117. Calculate the lowest common multiple of 30 and 2((-20007)/j)/(-13). 1710 Let t(d) = -24d*3 + 4d*2 + 3d - 2. Let v be t(-2). Let x = v - 170. What is the least common multiple of 6 and x? 30 Let k be (0/(-2))/(-13 - -15). Calculate the common denominator of -119/12 and (179/76)/1 + -3 + k. 228 Let d(q) = 2q - 4. Let g be d(7). Let i = 28 + g. Let k(f) = -4f - 12. What is the lowest common multiple of i and k(-6)? 228 Suppose f - 2k - 168 = 0, -152 = -f - 9k + 7k. Calculate the common denominator of 7/(-18)(-4560)/f and -7/30. 60 Let c(n) = -n*2 - 31n + 78. Let o be c(-30). Find the common denominator of -89/152 and (-214)/24 + 81/o. 456 Let y = 3465341/70 - 49503. Find the common denominator of ((-7)/(-294)1)/(6/26) and y. 630 Let l be ((-1130)/7)/(-5) - (-4)/(-14). Suppose -5p = l + 148. What is the common denominator of (-27)/p - 17/6 and -101/2? 12 Let w = 41 - 49. What is the lowest common multiple of (-228)/(-9) - (w/(-6) + -2) and 16? 208 Let x(m) = m*3 - 4m*2 - 5m + 10. Let k be x(5). Let u(j) = 44j - 22j - k - 20j. What is the lowest common multiple of 11 and u(8)? 66 Let m(y) = 7y*2 + 9y - 13. Let s be m(2). Let n(a) = a*2 - 35a + 78. Calculate the smallest common multiple of n(s) and 147. 588 Suppose -3s - 5 = -6s - 2x, -s + 5 = 4x. Find the common denominator of -115/28 and s/(20/85-1). 28 Let j = -1695/2 + 25447/30. Calculate the common denominator of -17/645 and j. 645 Suppose -13w = -7w + 106128. Let i = 1025805/58 + w. What is the common denominator of i and -42/11? 638 Find the common denominator of -129(-15)/1134 + 40/180 and -109/2288. 16016 Let v be 6/(-3) + 359/44. Let j = v - 21/4. What is the common denominator of j and 152030/(-5288)(-1)/((-6)/(-4))? 66 Calculate the common denominator of (-11883)/(-13860) - (-156)/(-286) and -169/714. 7140 What is the common denominator of 77/102 and (1/51)/((-54)/(-72) + 82/(-24))? 408 Let d = 9741/5 - 14251078/7315. Let f = d - -40753/2926. Let h = f - 1937/126. Calculate the common denominator of 65/12 and h. 36 Let u be (12/(-1))/3(-433 - 0). Let k = 41587/24 - u. Let w = -146/19 - -4661/342. Calculate the common denominator of k and w. 72 What is the least common multiple of 7773 and 143/29 + (-30)/(-435) + 1 + 4? 77730 Let o(r) = 8r. Let w be o(0). Suppose w = -4j - b + 101 + 8, 0 = -5j - 2b + 137. Calculate the least common multiple of j and 6. 54 Suppose -5g - 25 = 0, -3u - u = -2g - 94. Suppose -84 = 17o - uo. Let m = o + -15. Calculate the least common multiple of 3 and m. 6 Let d(q) be the first derivative of q3/3 + 4q*2 + 14q - 8. Find the common denominator of (131/4 - -7)/(66/(-4)) and d(-10). 22 Suppose -8o = -29o + 10080. Suppose 31k = 43k - o. What is the smallest common multiple of k and 100? 200 Let n be (-216)/32/(-4). Let o be (6/2 - 2)((-17 - 10) + 26). What is the common denominator of 61/33 and (-4)/n(3 + o - -42)? 99 Find the common denominator of 75/90 - ((-1000)/1086 - -2) and 27/10. 1810 Let p(a) = -4a + 27. Let j be p(6). Suppose 5u - jv = 4u + 133, u + 5v - 173 = 0. What is the least common multiple of 11 and u? 1628 Let k = 251 + -254. Calculate the least common multiple of 4 - (1 + 2) - (k + -1) and 8. 40 Let l be ((-32)/20)/(3 + (-58)/20). Let c(j) = -j*3 - 16j*2 - 2j - 22. Calculate the least common multiple of c(l) and 52. 260 Let z(b) = -201 + 111 - 23b - b2 + 144. Calculate the smallest common multiple of 60 and z(-25). 60 Let y = -1 + -2. Suppose 0 = 3i - 3, -2o - 40 = -2i - 42. Calculate the lowest common multiple of y/6 - 42/(-4) and o. 10 Let g(o) = -451*o - 511. Calculate the least common multiple of g(-41) and 14. 125860 Calculate the lowest common multiple of -15 -	{ "pile_set_name": "DM Mathematics" }
-6d3 - 119. Let q(b) = -4b*3 - 79. Calculate 5l(j) - 7q(j). -2j*3 - 42 Let r(i) = 5i*3 - 5i*2 - 21i + 11. Let s(l) = l3 - l2 - 4l + 2. Give -2r(t) + 11s(t). t3 - t2 - 2t Let i(f) = -3f2 + 11f + 21. Let y(h) = 2h2 - 6h - 11. Determine -6i(l) - 11y(l). -4l2 - 5 Let b(x) = -5x + 8. Let o(l) = l - 1. Calculate 5b(q) + 40o(q). 15q Let w(q) = -3q + 35. Let y(l) = -2l + 35. Give -3w(o) + 4y(o). o + 35 Let q(z) be the first derivative of 5/4z*4 + 1/2z*2 - 5/3z*3 + 6z - 1. Let i(k) = -9k3 + 9k*2 - 2k - 11. Determine -6i(h) - 11q(h). -h3 + h2 + h Let b(o) = -10o2 - 10. Let i be (-36)/8(-2)/(-3). Let l(v) = -2v2 - 2. What is ib(c) + 14l(c)? 2c*2 + 2 Let a(q) = -75q - 11. Let x(r) = -15r - 2. Calculate 4a(m) - 22x(m). 30m Let f(c) be the second derivative of 7c4/6 - 11c3/6 - c2 - c. Let j be (2 - -10)/(-4) - 1 - 1. Let h(p) = -9p2 + 7p + 1. What is jf(a) - 8h(a)? 2a2 - a + 2 Let h be 6/(-18) - 14/(-6). Let b(c) = 5c*3 + 9c*2 - 13c - 1. Let r(i) = i*3 + 2i*2 - 3i. Determine hb(n) - 9r(n). n*3 + n - 2 Suppose 5t + 33 = 3o, 2t + 2o = -o - 9. Let i(p) = 4 - 10 + 2 + 5. Let l(a) = 2a*2 + 6. Calculate ti(v) + l(v). 2v2 Let m(o) = -3o*2 + 4o - 4. Let v(x) = 9x2 - 13x + 12. Calculate 7m(u) + 2v(u). -3u2 + 2u - 4 Suppose -3i = 4s + 34, 0s - 42 = 5i + 3s. Let j(y) = 1 - 1 + 1. Suppose 0 = -r - 3r + 4. Let b(k) = 2k3 + 2k*2 + 4. Give ij(f) + rb(f). 2f*3 + 2f*2 - 2 Let u(f) = -5f*2 + 3f. Let y(k) = -k + 1. Let g be y(4). Let n(j) = -j*2 + j. Suppose 5b - m + 0 = 1, 4m = -3b + 19. Give bu(d) + gn(d). -2d2 Let h(v) = -29v - 4. Let k(t) = 59t + 9. Give 7h(p) + 3k(p). -26p - 1 Let i(g) = -9g3 + 3g*2 - 5. Let l(c) be the first derivative of -5c*4/4 + 2c*3/3 - 3c + 1. What is 3i(o) - 5l(o)? -2o3 - o2 Let z(l) = -5l*2 + 5l - 26. Let q(s) = -s*2 + s - 5. What is -11q(i) + 2z(i)? i2 - i + 3 Let n(s) = -s2 + 2s + 2. Let k(v) = 2v - 2v - v + 2v. Calculate 2k(i) - n(i). i*2 - 2 Let y(k) = -2k*2 + k + 1. Suppose 5f - 36 - 89 = 0. Suppose -3a - f = -8a. Suppose 0c + ac + 10 = 0. Let j(d) = d*2 - d - 1. Determine cj(t) - 2y(t). 2t*2 Let h(j) = 14j*2 - 2j - 2. Let b(g) = -15g2 + 3g + 3. Determine 2b(l) + 3h(l). 12l2 Let p(h) = 22h2 + 18. Let b(t) = t2 + 1. Let a(k) = -12b(k) + p(k). Let i(m) = -m2 - 1. Give -a(q) - 6i(q). -4q2 Let i(t) = 2t + 2. Let h(f) = -f. Let o(c) = h(c) + i(c). Let y(m) = m - 1. Let k be (-15)/6(-10)/25. Give ko(j) + 2y(j). 3j Let m(n) = -n*2. Let s be m(1). Let t(k) = -k. Let v(y) = -2y*2 - 4y. Calculate sv(l) + 5t(l). 2l2 - l Let y(v) = 4v*3 - 4. Let p be -1 + -4 + 6 - 4. Let i(s) = -9s*3 + 9. What is pi(d) - 7y(d)? -d3 + 1 Let n = 3 + -2. Let u(x) = -1. Let a(o) = -o + 1. Let p(j) = 2j - 5. Let l(s) = -4a(s) - p(s). Calculate nl(t) + 2u(t). 2t - 1 Let r(v) = -v - 1. Let g(h) = 6h + 4. Let q(i) = -i2 - i. Let c(u) = -g(u) - 4q(u). What is -c(s) + 4r(s)? -4s*2 - 2s Let b(w) = -5w2 + 9. Let c(d) be the third derivative of d5/30 - 2d3/3 - d2. What is -4b(v) - 9c(v)? 2v2 Let d(y) = y2 + y + 1. Let k(j) = j. Determine -2d(c) + 4k(c). -2c*2 + 2c - 2 Let y(f) = f3 + 2. Let i(u) = -u3 - u - 3. Let r be (-59 - 1)(-5)/15. Let a be (-4)/20 - (-44)/r. Calculate ai(w) + 3y(w). w3 - 2w Let o(b) = -21b + 6. Let v(t) = -64t + 17. Give -17o(i) + 6v(i). -27i Let q(h) = h - 3. Let t(s) = -2s + 7. Calculate 5q(m) + 2t(m). m - 1 Let j(y) = 11y + 1. Let z(c) = -56c - 4. What is 14j(k) + 3z(k)? -14k + 2 Let q(m) be the first derivative of -2 - 7m + m*2 + 1/3m*3. Let g(v) = -1. Determine 5g(t) - q(t). -t*2 - 2t + 2 Let q = -77 + 55. Let k = 4 + q. Let x(y) = 3y3 + 3y - 2. Let s(b) = -13b3 - 13b + 9. Determine kx(i) - 4s(i). -2i3 - 2i Let p(m) = 4m3 + 2. Let s(j) = j3. Determine -p(l) + 3s(l). -l*3 - 2 Let w(l) be the third derivative of 7l6/120 - l5/60 - 2l3/3 - 3l*2. Let z(y) = -20y*3 + 3y*2 + 11. Calculate 17w(t) + 6z(t). -t3 + t2 - 2 Suppose -g = 22 - 17. Let u(w) = -w3 - 4w + 3. Let c(p) = 2p - 1. Give gc(k) - 2u(k). 2k*3 - 2k - 1 Let u(k) = 9k2 + 5k + 5. Let b(c) = -4c2 - 2c - 2. What is -5b(t) - 2u(t)? 2t2 Let o be 1/(2(-1)/10). Let l(v) = 3v2 - 3v - 3. Let y(t) = -t - 1 - t*2 + 2t*2 + 0t. What is oy(m) + 2l(m)? m2 - m - 1 Let i(s) = -s2 - s + 1. Let h(f) = -8f2 - 5f + 5. Let o(p) = -17p2 - 11p + 10. Let c(k) = -5h(k) + 2o(k). What is c(v) + 4i(v)? 2v2 - v - 1 Let y(q) be the first derivative of -q4/4 + 2q3 - 2q*2 - 4q + 7. Let u(r) = 2r3 - 13r*2 + 9r + 9. What is 4u(p) + 9y(p)? -p*3 + 2p*2 Let p(j) = -5j*3 + 8j*2 - 10j - 6. Let o(d) = -6d3 + 9d*2 - 10d - 7. Determine -6o(x) + 7p(x). x*3 + 2x*2 - 10x Let u(m) = -63m2 - 5m - 5. Let h(b) = -32b2 - 2b - 2. What is -5h(x) + 2u(x)? 34x2 Let g(f) = f2 - 2f. Let h(r) = r + 1. Let w be h(-3). Let c = w + 0. Let u(y) = -2y2 + 4y + 1. Determine cu(d) - 5g(d). -d*2 + 2d - 2 Let g be (4/(-6))/(2/3). Let v = 6 + -5. Let p(i) = -v + 2 + 6i + 5 + i. Let r(y) = -y - 1. Determine gp(n) - 5r(n). -2n - 1 Let g(x) = 2x2 - 2x - 3. Let m(c) = -c*2 + c + 2. Suppose f + 5l + 19 = -f, -f = l + 8. Determine fm(d) - 4g(d). -d2 + d - 2 Let k(d) = 1. Let h(w) = -w2 + 2w + 2. Give -h(c) + 2k(c). c*2 - 2c Let c(y) = 9y. Let i(q) = 5q. Give -4c(t) + 9i(t). 9t Let w(t) = -t2 + t + 1. Let u be w(1). Let s be u + 0 + -1 + -2. Let m(x) = 2x2 + 2. Let o(g) = -g3 + g*2 + 1. Give so(n) + 2m(n). 2n*3 + 2n2 + 2 Let n(g) = g2 - 2g - 7. Let x(j) = j2 - 2j - 7. Give -5n(v) + 4x(v). -v*2 + 2v + 7 Let l(o) = o*2 + 3o*3 - 29o + 20o + 7o. Let g be -1(0 - 1 - 1). Let v(q) = -7q*3 - 2q*2 + 4q. Give gv(i) + 5l(i). i3 + i2 - 2i Let n(f) = f + 1. Let y(s) = -2 + s2 + s + 2s*2 - 2s + 1. Give -n(z) - y(z). -3z2 Let n(m) = m + 5. Let t = -25 - -36. Let u(j) = 2j + 9. Give tn(y) - 6u(y). -y + 1 Let j = 6 + -6. Suppose -5o - 3a + 3 = j, 3a + 4 = 2a. Let w(s) = 0s + 2s - os - 2. Let g(p) = -4p - 9. Determine -4g(n) + 18w(n). -2n Suppose -5k - 76 = -k. Let b = 26 + k. Let q(j) = 6j3 + 3j. Let g(s) = 13s3 + 7s. What is bq(v) - 3g(v)? 3v3 Let n(v) = 6v*3 - 4v. Let f(d) = 7d3 - 5d. Let j = -7 + 12. Let t = -7 - -5. Let i be 12/t + j + -4. What is in(l) + 4f(l)? -2l3 Suppose d = -l - 11, 3l = -2l + 4d - 10. Let a(k) = -5k + 6. Let p(c) = -c + 1. What is lp(m) + a(m)? m Suppose -2s - 9 = 9. Let v(p) = 2p*3 - 4p - 4p2 + 2 + 2p*2 + 2p*2 - 3p*2. Let d(r) = -4r*3 + 7r*2 + 9r - 5. Determine sv(a) - 4d(a). -2a3 - a2 + 2 Let j(v) = -5v + 1. Let t(f) = -10f - 6f + 20f. Let p = 0 - 2. Determine pj(o) - 3t(o). -2o - 2 Let m(y) = -y*2 - 3y - 5. Let v be m(0). Let x(i) = 6i2 - 3. Let n(c) be the third derivative of -11c*5/60 + 5c*3/6 + 2c*2. What is vx(l) - 3n(l)? 3l*2 Let n(g) = -9g*3 - 34g*2 + 11g. Let p(r) = 5r3 + 17r*2 - 6r. Give -6n(x) - 11p(x). -x*3 + 17x*2 Let z(s) = 7s - 4. Let r(l) = -6l + 3. Suppose 4m = -5c + 23, c + 9 = 6c - 3m. Calculate cz(g) + 4r(g). -3g Suppose 9m = -73 + 28. Let s(a) = 2a + 6. Let d(j) = j + 5. What is ms(c) + 6d(c)? -4c Let z(a) = 11a*2 - 10a - 3. Let w(o) = 9o2 - 9o - 3. Determine 6w(u) - 5z(u). -u*2 - 4u - 3 Let t(m) = -6 + 11 - 1 + 5m - 4m2 - 7. Let a(d) = -d2 + d - 1. Determine -3a(q) + t(q). -q2 + 2q Let m(o) = 14o - 20. Let q(s) = 57s - 5 - 52s - 2. Calculate -6m(p) + 17q(p). p + 1 Let j(c) = -10c*2 - 4c + 4. Let y(l) be the first derivative of -11l3/3 - 5l*2/2 + 5l + 11. Calculate -5j(h) + 4y(h). 6h2 Let x = 1 + -2. Let o be (1/2)/(x/(-8)). Let n(j) = 14j + 8. Let u(g) = -5g - 3. Suppose 5k - 2b = 51, 6b - 2b - 8 = 0. Determine ku(v) + on(v). v - 1 Let w(s) = -s. Let d(r) = -r + 11. Let h(x) = x - 9. Let k(o) = 4d(o) + 5h(o). Calculate k(j) + 3w(j). -2j - 1 Let l(y) = y + 1. Let w(o) = o + 2. Determine -6l(m) + 4w(m). -2m + 2 Let h(z) = 5*	{ "pile_set_name": "DM Mathematics" }
ing order. -9301, 4, 4358 Sort -1/106, 2/11, 41/3, -4, 4/3 in increasing order. -4, -1/106, 2/11, 4/3, 41/3 Sort -0.2, 3, 348, 6, 12, 4. -0.2, 3, 4, 6, 12, 348 Sort 625, 3, 2, -5, 1, 5377 in ascending order. -5, 1, 2, 3, 625, 5377 Put -521, 3, 9182 in increasing order. -521, 3, 9182 Put 2/5, -13/1980, 1.2, 3 in ascending order. -13/1980, 2/5, 1.2, 3 Sort -3, -6, 4, -5473 in increasing order. -5473, -6, -3, 4 Sort 391, -4105, -2, 4 in ascending order. -4105, -2, 4, 391 Sort -2.97, 5, -6752 in ascending order. -6752, -2.97, 5 Sort -183, -89, -70, -5, -8. -183, -89, -70, -8, -5 Put -4, -2/17, 2/33, 4/19, 1/2, 72 in descending order. 72, 1/2, 4/19, 2/33, -2/17, -4 Sort -36, 2689, -0.3, 1 in decreasing order. 2689, 1, -0.3, -36 Put -3, -1/2, -5, -2/97, 449/27 in decreasing order. 449/27, -2/97, -1/2, -3, -5 Sort 1238, 1/2, -3.65. -3.65, 1/2, 1238 Sort 410, -6/17, -8, -118 in decreasing order. 410, -6/17, -8, -118 Put 6690315, -3, -4 in decreasing order. 6690315, -3, -4 Put 2/2187, -459/2, 0.2 in ascending order. -459/2, 2/2187, 0.2 Put 6, 57, 0, 16, 1, -160 in ascending order. -160, 0, 1, 6, 16, 57 Sort 422, 2, -169, 41, 5 in decreasing order. 422, 41, 5, 2, -169 Sort 1, 4, 37, -12, -86, 6 in decreasing order. 37, 6, 4, 1, -12, -86 Sort -6, -1/67, -4.514 in ascending order. -6, -4.514, -1/67 Put -8, -8350, 4, -6 in descending order. 4, -6, -8, -8350 Sort 0.2, 0.05, 1, 5/4, 5/6, 1413 in increasing order. 0.05, 0.2, 5/6, 1, 5/4, 1413 Sort 300967, -2, -17 in ascending order. -17, -2, 300967 Put -592, 2, -1, -11, 4, 211 in increasing order. -592, -11, -1, 2, 4, 211 Put 1, -0.8, -1, -24, -0.3, -580.2 in increasing order. -580.2, -24, -1, -0.8, -0.3, 1 Sort -4, 5, -23, -15, 2, -5, 3 in decreasing order. 5, 3, 2, -4, -5, -15, -23 Put 324, 20226, -3 in descending order. 20226, 324, -3 Put 3, 165, 0, -2, -9, -8, -0.8 in descending order. 165, 3, 0, -0.8, -2, -8, -9 Put -1798, 12, -2, 7 in decreasing order. 12, 7, -2, -1798 Put -62.2, 6, -243 in ascending order. -243, -62.2, 6 Put 0, 5, -16, -18180, 1 in descending order. 5, 1, 0, -16, -18180 Put -2, -3, 1, -42, 4, 2, -44 in descending order. 4, 2, 1, -2, -3, -42, -44 Sort 0.66, -1/4, 8193, -2/7 in decreasing order. 8193, 0.66, -1/4, -2/7 Put 19, 4, 284391 in descending order. 284391, 19, 4 Put 146, 41485, -6 in descending order. 41485, 146, -6 Put 11, 1623, 200, -6, 3 in descending order. 1623, 200, 11, 3, -6 Put -29, 51, 6, 57 in descending order. 57, 51, 6, -29 Sort -4, -2, -16, -6387, 5 in descending order. 5, -2, -4, -16, -6387 Put -2/5, 0.199, -37124 in descending order. 0.199, -2/5, -37124 Put -103111118, 5, -0.3 in descending order. 5, -0.3, -103111118 Put 447, 6, -145, 0.4, -5 in increasing order. -145, -5, 0.4, 6, 447 Put -26, -2, 3780 in ascending order. -26, -2, 3780 Sort 2/5, -1, 844866, 2 in decreasing order. 844866, 2, 2/5, -1 Sort -12, 10949, 283 in increasing order. -12, 283, 10949 Sort -5, -2.6171, -1/2, -58/5 in decreasing order. -1/2, -2.6171, -5, -58/5 Put 3, -3, -4, 1330, -1, 103 in ascending order. -4, -3, -1, 3, 103, 1330 Sort -5, -2, -606, 18891 in increasing order. -606, -5, -2, 18891 Sort 211, 13611, 2, 1 in decreasing order. 13611, 211, 2, 1 Sort 3/2, 0.3, 0.07, -3858. -3858, 0.07, 0.3, 3/2 Put 2, -1.755, -2/7, 1 in decreasing order. 2, 1, -2/7, -1.755 Sort -0.2, -9581, 1/9, -41. -9581, -41, -0.2, 1/9 Put 454, 2, -2, -3, -4 in decreasing order. 454, 2, -2, -3, -4 Put -42, 5, 3, -14786 in increasing order. -14786, -42, 3, 5 Sort 1, 3, -54, 345, 9 in descending order. 345, 9, 3, 1, -54 Put -0.8, 23, 0.02, -0.13, -0.001 in descending order. 23, 0.02, -0.001, -0.13, -0.8 Sort 3, -1, -146, -12, -5, 1. -146, -12, -5, -1, 1, 3 Put 3/8, -553, -2909/7 in ascending order. -553, -2909/7, 3/8 Sort -2/9, 2, -554, -20.954, 0.3. -554, -20.954, -2/9, 0.3, 2 Put -23, 9, -314, 4, -18 in descending order. 9, 4, -18, -23, -314 Put -500, -113, -5 in increasing order. -500, -113, -5 Put 58, 1, -21020 in descending order. 58, 1, -21020 Put -3/7, -4/5, -8.757945 in descending order. -3/7, -4/5, -8.757945 Put -5, -49.711784, -2 in ascending order. -49.711784, -5, -2 Sort 22604, 3/17, 2/23, -3. -3, 2/23, 3/17, 22604 Sort 231, -0.4, -3/5, 490. -3/5, -0.4, 231, 490 Sort 1095, -5, 1.2, 12/13. -5, 12/13, 1.2, 1095 Sort 2, -3/5, -4.4, 0, 1/84 in descending order. 2, 1/84, 0, -3/5, -4.4 Sort 144, -1, -315, 4, 3 in decreasing order. 144, 4, 3, -1, -315 Sort -42, -4, 4, 181, -12, 7 in decreasing order. 181, 7, 4, -4, -12, -42 Sort -3, -4, 18, 3, 4, -31, 1 in decreasing order. 18, 4, 3, 1, -3, -4, -31 Sort 3/3953, -12, -0.036, -0.3, 2 in descending order. 2, 3/3953, -0.036, -0.3, -12 Sort -21, 116, 73, 2, 6, 0 in ascending order. -21, 0, 2, 6, 73, 116 Sort 284, 5, 1/22, 17/2 in descending order. 284, 17/2, 5, 1/22 Sort -25/3, 0, 1877 in ascending order. -25/3, 0, 1877 Put -779, -207, 3, -4, 1 in decreasing order. 3, 1, -4, -207, -779 Sort -1, 4, 7708276, 1. -1, 1, 4, 7708276 Sort -2, 240, 1, 604. -2, 1, 240, 604 Sort 435, -3, 294324. -3, 435, 294324 Put -3, 2, 5, -1444, 0.0132 in descending order. 5, 2, 0.0132, -3, -1444 Sort 3, 17, -634, -5, -14, -3. -634, -14, -5, -3, 3, 17 Sort -3/2, 0, 5, -0.26, -135, -46 in increasing order. -135, -46, -3/2, -0.26, 0, 5 Put 28, 5, -3, 11, -5, -4, 168 in decreasing order. 168, 28, 11, 5, -3, -4, -5 Sort -25, -6/11, -4, -0.0998, -0.4 in descending order. -0.0998, -0.4, -6/11, -4, -25 Sort -37, -2, -9050, -1 in increasing order. -9050, -37, -2, -1 Put 13, -150, 922, 2, -2, -4, 3 in descending order. 922, 13, 3, 2, -2, -4, -150 Sort 4, 58, 118, 5, 3 in decreasing order. 118, 58, 5, 4, 3 Sort -1508, -9, 14, 0. -1508, -9, 0, 14 Sort 2, 5, -22, 3, 10, -4, 23 in increasing order. -22, -4, 2, 3, 5, 10, 23 Sort 14, -3, 18253/5, -2/7 in increasing order. -3, -2/7, 14, 18253/5 Put 73463, 88, 5 in ascending order. 5, 88, 73463 Sort 78, 7, -12, 1, 6, -1 in increasing order. -12, -1, 1, 6, 7, 78 Put -1, 5, 0, -4, 70, -253, -3 in ascending order. -253, -4, -3, -1, 0, 5, 70 Sort 1, 0, -121/3, 3/5, 12912, 2/9 in ascending order. -121/3, 0, 2/9, 3/5, 1, 12912 Sort -278024, -14, -4, 3 in ascending order. -278024, -14, -4, 3 Put -1, -8, 4, -3, 273885 in descending order. 273885, 4, -1, -3, -8 Sort -1.3, -51.8, -0.05, -0.14, -11 in decreasing order. -0.05, -0.14, -1.3, -11, -51.8 Sort -27, -28905, 7 in decreasing order. 7, -27, -28905 Put 10, -17728, -232 in decreasing order. 10, -232, -17728 Put 2, -152, 34, 32 in descending order. 34, 32, 2, -152 Sort -4070171, -17, 1 in decreasing order. 1, -17, -4070171 Sort 17/5, 23015, 0.02. 0.02, 17/5, 23015 Put 4, -1, -1723, -5, 3, -21 in increasing order. -1723, -21, -5, -1, 3, 4 Put 11, 7, -128, 4 in ascending order. -128, 4, 7, 11 Put 4, 10, -13484, 0, -8, -4 in decreasing order. 10, 4, 0, -4, -8, -13484 Put 2, -1802, -92, -76 in decreasing order. 2, -76, -92, -1802 Sort 804794, -1, -44 in descending order. 804794, -1, -44 Sort 0, -17, -4, 1, -55, 4 in increasing order. -55, -17, -4, 0, 1, 4 Put -68, -9, 563 in decreasing order. 563, -9, -68 Put 3, 1/4, 13, -7, 20/17, -19 in descending order. 13, 3, 20/17, 1/4, -7, -19 Sort -3/5, 0, -1/6, -5, 0.024, -190 in descending order. 0.024, 0, -1/6, -3/5, -5, -190 Put 0, 10, 39, -31, -5, 2 in decreasing order. 39, 10, 2, 0, -5, -31 Put -10, 3, -9, -32, -127, 5 in decreasing order. 5, 3, -9, -10, -32, -127 Sort 3, -42, -30, -2, 2, -1, -5 in descending order. 3, 2, -1, -2, -5, -30, -42 Sort -0.4, -1/5, 637/75, -0.091 in decreasing order. 637/75, -0.091, -1/5, -0.4 Sort 5, 96, 2, -0.3, -9, 6.1, 0.3 in increasing order. -9, -0.3, 0.3, 2, 5, 6.1, 96 Put 0.9, 4, -8, -185, 5, 58 in ascending order. -185, -8, 0.9, 4, 5, 58 Sort -6, 24, 7, 424, 1, 5, -3 in descending order. 424, 24, 7, 5, 1, -3, -6 Sort -49, -7, -736, -5, -1, -4, -2 in decreasing order. -1, -2, -4, -5, -7, -49, -736 Put 23, -4, 3, -15, 2, 59 in increasing order. -15, -4, 2, 3, 23, 59 Sort -6, 3, -24575, 5, -3 in descending order. 5, 3, -3, -6, -24575 Put 2, 149209, 3, -171 in decreasing order. 149209, 3, 2, -171 Put -4, 2, -5, -1, 0, -117032 in descending order. 2, 0, -1, -4, -5, -117032 Sort 213784, -7, 5 in decreasing order. 213784, 5, -7 Put -1103, -1, -2140, -8 in descending order. -1, -8, -1103, -2140 Sort -5, 0.2, -2, -255/301, -3. -5, -3, -2,	{ "pile_set_name": "DM Mathematics" }
d derivative of -b*6w + 3807992b5w + 1685b2 - 387w wrt b? -120b3w + 228479520b2w Find the first derivative of -2958c3g + 15c3 + 780560c*2 - 28182g wrt g. -2958c3 - 28182 Find the second derivative of -499k*4 - 3759k*3 + 6810075k wrt k. -5988k2 - 22554k Differentiate 328418963u3 - 258564072 with respect to u. 985256889u*2 What is the second derivative of -356993y*5 + 7y*3 + 1102y + 386 wrt y? -7139860y3 + 42y What is the second derivative of 14815d4 - 29d*3 - 404d*2 + 748969421d wrt d? 177780d2 - 174d - 808 What is the first derivative of -197378206n4 - 180058766? -789512824n*3 What is the second derivative of -2953278m*2u*2 - 2mu2 - 90mu - m - u - 267 wrt m? -5906556u*2 Find the first derivative of 29185b*3z*2 + 33409916b*3 + 3b*2z*3 wrt z. 58370b*3z + 9b2z*2 Find the third derivative of 1959s*5 - 983s*4 + 11s*3 + 309495329s*2 - 2s wrt s. 117540s2 - 23592s + 66 What is the first derivative of -12672361a2 + 3487911? -25344722a What is the third derivative of 13798048l2s*2u3 + l2u3 - 2l*2u + 1940108ls*2u*2 + su*2 wrt u? 82788288l*2s*2 + 6l*2 What is the third derivative of 747237k*3m + k3 + k2m + 27k*2 - 2km + k + 7394m wrt k? 4483422m + 6 Find the second derivative of -127470p*2w*4 + 6p*2w - 6p2 + 26pw + 23w*5 + 191w + 2 wrt w. -1529640p2w*2 + 460w*3 What is the third derivative of -8028588q*3x*3 - 458q*2x - q*2 - 13qx3 + 2qx2 - 3qx wrt q? -48171528x*3 What is the second derivative of -1045h*2i*3 + 268927h*2i - 98612hi*4 + 343i wrt i? -6270h2i - 1183344hi*2 What is the second derivative of 20d*3h*2 + 8d*3h - 9829d3 + 18d*2h*2 - 5dh2 - h2 - 4h wrt h? 40d3 + 36d*2 - 10d - 2 What is the first derivative of -10381i3l - 206515i3 - 46i + 12111l wrt l? -10381i*3 + 12111 What is the second derivative of 2b*3v - 732b2uv + 453b*2u + buv - 13572bu + 148u wrt b? 12bv - 1464uv + 906u Differentiate -105m4 - 90221m*3 + 2m - 105866608 with respect to m. -420m3 - 270663m*2 + 2 Find the second derivative of -16824001x*3 + 11995667x wrt x. -100944006x What is the second derivative of 96837dk2 + 69dk - 41d + 7k3 - 10k*2 + 2k + 25 wrt k? 193674d + 42k - 20 What is the second derivative of 244a5n + 16442a3 - 14126an - 2a + 2n + 26 wrt a? 4880a*3n + 98652a What is the third derivative of 136166328g*4 - 112682278g*2 wrt g? 3267991872g What is the derivative of 12981q2 - 31846q - 774548197? 25962q - 31846 What is the derivative of 4kn - 326kw - 70592463nw + 422593w wrt n? 4k - 70592463w Differentiate -4196ci - 13241689c + 2166i*3 - 2 wrt i. -4196c + 6498i2 What is the third derivative of 1635782c*3i*3 + 61c*3i*2 + 16369ci2 + 1 wrt i? 9814692c*3 Find the second derivative of 111535195j3 + j2 - 524963089j. 669211170j + 2 What is the derivative of -14188774z2 + 2z - 12026168? -28377548z + 2 What is the third derivative of 1053s*6 - 1689s*3 + 2296s*2 - 1450s wrt s? 126360s3 - 10134 Find the third derivative of 23ay3 - 5ay2 + 2ay + 23a + 679y4 + 2y*3 - 13y*2 - 2y wrt y. 138a + 16296y + 12 Find the third derivative of 5x6 - 2307x*4 - 22x*3 - 209500818x*2. 600x*3 - 55368x - 132 Find the third derivative of 5552234a4 - 8245a*2 - 252a wrt a. 133253616a Find the third derivative of 6885c*6 - 107c*4 - 6c*3 - 278396c*2 - 54c wrt c. 826200c3 - 2568c - 36 Find the third derivative of -5o4 + 29343986o*3x*3 + 37279o*2x2 + o2x + 656ox3 wrt o. -120o + 176063916x3 What is the first derivative of 13067r*4 - 336r*2 - 18786098? 52268r*3 - 672r What is the third derivative of 22126731fm*3 + 39497fm2 - 131f + m3 + m2 wrt m? 132760386f + 6 Differentiate -4750052z*4 - 2355160 wrt z. -19000208z*3 Find the third derivative of -313k*3y + 7687k3 - 335386k*2y - 8ky wrt k. -1878y + 46122 Find the third derivative of -1300h*4 - 7054h*3v - 128853h2v + 235hv wrt h. -31200h - 42324v Find the third derivative of -13599710j4t - 266j2 - 1042t wrt j. -326393040jt Differentiate -1133072j3 + 21350153. -3399216j*2 What is the second derivative of 312480738v*3 + 36491v - 5437 wrt v? 1874884428v Find the second derivative of 18511562p*5 - 190p + 22479. 370231240p3 Find the third derivative of -830b*2d*5 - 55b*2d - 6359bd*2 + 1846d*5 wrt d. -49800b*2d*2 + 110760d*2 Find the second derivative of 819823c*3q*5 - 851c*3 + 3c*2q + 6c2 - 2cq5 - 3c + 2q wrt q. 16396460c*3q*3 - 40cq3 What is the second derivative of -18173v*3 + 1145v*2 - 642217v - 359? -109038v + 2290 Differentiate -63151774d + 182037543. -63151774 Differentiate 622149275o4 - 1009554714 with respect to o. 2488597100o*3 Find the second derivative of -3r*3v - 4749872r3 - r2v + 3r2 - 10rv - 2351972 wrt r. -18rv - 28499232r - 2v + 6 What is the second derivative of 27005361x*5 + 47x - 48320 wrt x? 540107220x3 What is the third derivative of -2103710z*4 - 4z*3 + 662289z*2 - 8z? -50489040z - 24 Find the first derivative of 25434212j*3y + j*3 - 7799790 wrt y. 25434212j*3 Differentiate 43238711ny2 - 24575493n + y*2 with respect to y. 86477422ny + 2y Find the third derivative of -137484561k3 + 12604k*2 - 806k - 2 wrt k. -824907366 Differentiate 2231298ah*2 - 52h*2 - 1907703h + 1 with respect to a. 2231298h2 What is the derivative of 119681752q - 13002009? 119681752 Find the first derivative of 4562a4 - 323a*3 - 8884345. 18248a*3 - 969a*2 What is the third derivative of -3t*4v - 2750186t3 + 3t*2 + 1914t + 136v wrt t? -72tv - 16501116 Find the third derivative of -425005344t*3y + 56254t2y - 2t2 + 182ty - 2t + 1 wrt t. -2550032064y What is the third derivative of 9d*5j + 873d4j - 470d3 + d2j + 14d2 - 9dj - 2d - 50j + 140 wrt d? 540d*2j + 20952dj - 2820 Find the first derivative of -2471745c2 + 2c - 57776590 wrt c. -4943490c + 2 Differentiate -9539753bn + b - 37948982n wrt b. -9539753n + 1 What is the first derivative of 14534228t*4 - 73283687? 58136912t*3 What is the second derivative of -4q*3 + 44763302q*2 - 194576170q? -24q + 89526604 What is the derivative of -7677130w*4 + 28398084? -30708520w*3 What is the third derivative of -1984280di3 - 4di2 + 695di - 34i wrt i? -11905680d What is the derivative of 3d*2q - 4431852dq*2 - 2776165q*2 wrt d? 6dq - 4431852q*2 What is the third derivative of 50865028g*3 + 176200g*2? 305190168 Find the third derivative of -6190771b*5 - 406b*2 - 2b - 4443 wrt b. -371446260b2 Find the first derivative of 368795906aq + 10153q - 7943 wrt a. 368795906q Find the first derivative of 228k*3l - k*2 - 1869kl + 9476631l wrt k. 684k2l - 2k - 1869l Find the third derivative of 2065532f2i*3 - 19f*2i + 19fi*3 + 3fi2 - 550fi + 2i*2 + 6i wrt i. 12393192f2 + 114f What is the derivative of 2456cn - 3ct*2 + 476c - 2nt*2 - 3nt + 44n + 36t2 - t - 6 wrt c? 2456n - 3t2 + 476 Differentiate -8509y*4 + 22y*3 + 4y - 28883793 wrt y. -34036y3 + 66y*2 + 4 What is the second derivative of 89j*2ms2 - 93106j*2m + 2j2 + 44900jms*2 - 31jm - js + 2ms + 2 wrt s? 178j2m + 89800jm What is the second derivative of 2557855h4 - 34484h - 4? 30694260h2 Find the second derivative of -1225c*2f*2 + 106345c*2fz - c2 - 5cz + 920f*2z wrt f. -2450c2 + 1840z What is the derivative of 565552195m - 303349950 wrt m? 565552195 What is the third derivative of 220162703c*4 - 2c*2 - 116c + 381067 wrt c? 5283904872c What is the second derivative of 6431350s*3 + 6s*2 - 13130s - 731 wrt s? 38588100s + 12 Differentiate 1594565o*3 - 49o*2 - 643343723. 4783695o*2 - 98o What is the third derivative of 14490390r3 - 8031174r*2? 86942340 What is the derivative of 45w*4 - 228335w**2 + 116	{ "pile_set_name": "DM Mathematics" }
.99999964. Round q to 7 dps. -0.0000004 Let l = -468961.847 - -469218. Let q = l - 256. What is q rounded to two dps? 0.15 Suppose 2b - 3b = 0. Suppose -2i - n = -bn + 1040000, -i - 5n = 520000. Round i to the nearest 100000. -500000 Let z = 6586 - 3749. What is z rounded to the nearest 1000? 3000 Suppose -4 + 8 = -4b + a, 8 = 3b + 2a. Suppose -c - 4t - 23999988 = b, 3c - t + 71999988 = -5t. What is c rounded to the nearest one million? -24000000 Let k = 0.4956 + -0.305. Round k to two dps. 0.19 Let l = -648.8 + 753. Round l to the nearest ten. 100 Let l = 15252.83239 - 15255.5. Let i = l + 2.67. What is i rounded to four decimal places? 0.0024 Let q = -10548916.29000312 + 10548958.29. Let k = 42 - q. What is k rounded to 7 dps? 0.0000031 Let l = -2.3848 - -2.36. What is l rounded to 3 dps? -0.025 Let g = 2.80000167 + -2.8. Round g to seven dps. 0.0000017 Let y = 36.9737 + -37.61. Let s = 0.697 + y. Let r = s - 0.06. Round r to 4 decimal places. 0.0007 Let t(k) = -146667k*2 + 3k. Let j be t(-3). Let n be (j/1)/(-3) - 4. Round n to the nearest 100000. 400000 Let q = -16104329 - -28260788. Suppose 0l + l + 856465 = 3t, 0 = -4l + 4t - 3425844. Let v = q + l. What is v rounded to the nearest one million? 11000000 Let z = -9315 - -20168. Let p = z - 10859.0898. Let x = p - -6.1. Round x to 3 dps. 0.01 Suppose 2p = -0p + 3g + 55544847, 27772443 = p + 5g. Let w = -16006841 + p. Let s = -4465587 + w. What is s rounded to the nearest one million? 7000000 Let l = -27.09 + 27.0900009762. What is l rounded to 7 dps? 0.000001 Let a = 4023759 + -4023543.9837. Let c = a + -0.0163. Let y = -214.9851 + c. What is y rounded to three decimal places? 0.015 Let z(o) = -191o2. Let c be z(-1). Let h = c + -3249. What is h rounded to the nearest one hundred? -3400 Suppose q + 5b - 3b = 10999998, 0 = 3q + 3b - 32999979. Suppose -5k = 5r - 2038015 - 8962000, 5k = 4r + q. Round k to the nearest one million. 2000000 Let t = -295.0246 - -295. What is t rounded to 3 dps? -0.025 Let q(k) = -57304k - 4. Let v be q(-1). Round v to the nearest 1000. 57000 Let z = 0.03 + -0.75. Let d = z - -0.72066. What is d rounded to four dps? 0.0007 Let d = 59 - 52. Let b = 6.99999972 - d. What is b rounded to seven dps? -0.0000003 Suppose 0 = -3c + 3q + 5301, -5q + 5325 = 8c - 5c. Round c to the nearest one thousand. 2000 Let d = 885.404 + -882. What is d rounded to one dp? 3.4 Let s = 0.049 + -2.749. Let h = -2.699936 - s. What is h rounded to five decimal places? 0.00006 Suppose 5i = 9i - 71388. Suppose a - i - 22161 = -2n, -3a + 5n + 119980 = 0. Round a to the nearest ten thousand. 40000 Let l = 808.8 + -972. Round l to the nearest 10. -160 Let v = -2.6202478 + 2.62. Round v to 5 decimal places. -0.00025 Let g = 122.999995907 + -123. What is g rounded to 6 decimal places? -0.000004 Suppose 0 = -2c - 3v - 417, 4c = 6c + v + 411. Let g be c/(-8)-10-20. What is g rounded to the nearest one thousand? 5000 Let n = 4074 + -11937. Let l = n - -174863. Round l to the nearest 10000. 170000 Let g = 1 + 9. Let c = 16 - g. Suppose 2r - 2u = -36008, cr - u + 90004 = r. Round r to the nearest ten thousand. -20000 Let x(h) = h3 - 37h*2 + 38h + 6. Let k be x(36). Round k to 0 decimal places. 78 Let j = -5 - 0. Let t = j + 64. Let w = -59.0184 + t. Round w to 3 decimal places. -0.018 Let s = 46 + -44.2. Let b = -1.777 + s. What is b rounded to 2 dps? 0.02 Let x = -0.76 - -0.873. Let s = -0.11299913 + x. Round s to 7 decimal places. 0.0000009 Let r = -7.52 - -7.52000763. What is r rounded to seven dps? 0.0000076 Let m = 0.07 + 2.93. Let l = 6 + m. Let z = l - 9.00000007. What is z rounded to seven decimal places? -0.0000001 Suppose q - 3l + 5117408 = -4l, -4l - 15352225 = 3q. Let o = -1736264 - q. Let j = -6381143 + o. Round j to the nearest one million. -3000000 Suppose -4 = c - 0. Let k(w) = w*3 + 3w*2 - 4w. Let a be k(c). Let g be 0 + a + 780/4. What is g rounded to the nearest 10? 200 Let g = 758.033 - 759. What is g rounded to one dp? -1 Suppose 10l + 14523984 = -2p + 6l, 3l - 29048012 = 4p. Round p to the nearest 100000. -7300000 Let n(z) = z2 - 2z. Let i be n(2). Suppose i = -3g + 906 + 2010. Suppose -3m = m - g. What is m rounded to the nearest 10? 240 Let j(b) = 23360b3 + 2b*2 - 24b + 104. Let a be j(14). Round a to the nearest 1000000. 64000000 Let u(s) = -2938s - 5. Let n(g) = -2939g - 5. Let c(f) = -3n(f) + 2u(f). Let l = -152 + 147. Let y be c(l). Round y to the nearest 1000. -15000 Let d = -6051 - -6050.93921. Round d to 2 dps. -0.06 Let t = -7.16 - -17.48. What is t rounded to 1 dp? 10.3 Let w = -1.186 + -0.034. Let k = w - -0.71. What is k rounded to 1 decimal place? -0.5 Let h = 63.6 + -232.2. Let q = h - -187. Round q to 0 decimal places. 18 Let h = 0.0412 + -9.2212. What is h rounded to 1 dp? -9.2 Let z be 96/(-40)35/2. Let d = -14 - z. What is d rounded to the nearest 10? 30 Let y = 87.7 + -88. Let b = 0.3000148 + y. What is b rounded to 5 dps? 0.00001 Let z = -38.944 - 0.056. Let l = z + 39.00022. Round l to four dps. 0.0002 Let v = 27.2 + 34.85. Round v to zero decimal places. 62 Let l = 10 + -10.8. Let i = -0.365857 - 0.434158. Let n = i - l. What is n rounded to five decimal places? -0.00002 Let u = 62 + 56. Let p = u - 117.9999954. Round p to six decimal places. 0.000005 Let r = 5.9 + -1.45. What is r rounded to zero decimal places? 4 Let w = 1.90000182 - 1.9. Round w to 7 dps. 0.0000018 Let w(z) = 47z3 + z2 - 15z - 8. Let g = -15 - -23. Let v be w(g). What is v rounded to the nearest 10000? 20000 Let p = 16.05 + -21. Let s = p + -0.35. Round s to the nearest integer. -5 Let m = -0.068 - -0.06798947. Round m to 7 decimal places. -0.0000105 Suppose -5k - 41600 = -6k. Suppose -9d = -5d + k. Round d to the nearest 1000. -10000 Let r = -409 + 507.6. Round r to the nearest 10. 100 Let n = 11394.342 + -11405. Let w = n + 149.6453. Let j = w + -139. What is j rounded to 3 decimal places? -0.013 Let p = -638080 + 1297083. Suppose 3140997 + p = 2q. What is q rounded to the nearest 1000000? 2000000 Let k = 44.12 + 0.88. Let x = k + 91. Let l = x + -136.000067. What is l rounded to five decimal places? -0.00007 Let b = -746344455 + 2101275569. Let n = b + -1354930427.999717. Let y = n + -686. Round y to 5 decimal places. 0.00028 Suppose -37i = 19i + 700560. What is i rounded to the nearest 1000? -13000 Suppose 0g = 2g - 10. Suppose 0 = gi + 2x - 38996, 2x = i - 9253 + 1449. What is i rounded to the nearest 1000? 8000 Let x = 149 + -148.999999655. Round x to seven decimal places. 0.0000003 Let c = -690 - -713.7. What is c rounded to 0 decimal places? 24 Let v(o) = -o - 2 - 2 + 2 + o3 + 4o*2. Let z be v(-4). Suppose -2310 = x + zx. Round x to the nearest one hundred. -800 Suppose -494 - 321 = 2d + 3j, 0 = -d - j - 410. Let m = d - -168. Round m to the nearest ten. -250 Let n(b) = 222445b + 5. Let v be n(-9). Round v to the nearest one hundred thousand. -2000000 Let l = 6.2 + 1.5. Let z = l + 1.1. Let d = z - 8.8000071. What is d rounded to six dps? -0.000007 Suppose -61 = -6s + 23. Suppose 3r = z - 2, 0z = -3r - 2z - s. Let v be (-21999994)/r + 2 + 1. What is v rounded to the nearest one million? 11000000 Let g = -1449251.91639586 + -1374.68263414. Let p = g + 1450636. Let u = -9.4 + p. Round u to four dps. 0.001 Let j = -2.41 + 2.63. Round j to zero dps. 0 Let f = -0.0078868 - -0.0079. What is f rounded to six decimal places? 0.000013 Let t be 2/(-10)(-3 - 12). Suppose tz + 2z = 21000000. Round z to the nearest 1000000. 4000000 Let z = 1.89 + -1.890000279. What is z rounded to seven decimal places? -0.0000003 Let p = -25.11 + 25. Let h = p - -0.114. Let m = h + 0.0076. Round m to three decimal places. 0.012 Let a = -10.4 - -2.4. Let b = -8.000222 - a. What is b rounded to five decimal places? -0.00022 Let z = 90581 + -1250581. Round z to the nearest one million. -1000000 Let q = 0.37 - -0.07. Let d = q + 18.56. Let j = -18.9952 + d. What is j rounded to three dps? 0.005 Suppose 5n - 21 = 3m, -3n - 3m = -n. Suppose -nb = -276 + 1155. Let a = b - -623. Round a to the nearest 100. 300 Suppose -o = -3o - 3o. Suppose o = 2n - 3n - 11500. What is n rounded to the n	{ "pile_set_name": "DM Mathematics" }
z(s). 3s2 + 5s - 9 Let c(o) = 0o + 1 + 2o - 5. Let j = 23 + -27. Let x(a) = -2 - 3 + 2a + 2 - 2. Determine jx(n) + 5c(n). 2n Let p(f) = -9f + 8f + 30 - 30 + 9f2. Let d(q) = -q2. Calculate 5d(y) + p(y). 4y2 - y Let c(u) = 4 + 2u + 2u - 3u - 5. Let t(m) = m + 1. Let g = 43 - 42. What is gt(v) - 3c(v)? -2v + 4 Let t(d) = 6d*2 + 7d - 1. Let a(n) = n2 + n. Let q(b) = -b2 + 7. Let i be q(2). Suppose -h = 5j - ij - 6, 0 = -2j + h + 10. Determine ja(z) - t(z). -2z2 - 3z + 1 Let l(m) = m*2 - 2m - 2. Let t(d) = -4d2 - 78d - 3. What is l(v) - t(v)? 5v2 + 76v + 1 Let j(d) be the first derivative of d*2 + 11d - 69. Let m(v) = v + 4. Let t(s) = s*2 + 13s - 4. Let k be t(-13). Give kj(n) + 11m(n). 3n Let f(i) = -i2 - i + 1. Let y(m) = 12m*2 + 36m + 4. Let u(w) = -35w2 - 102w - 11. Let g(t) = 6u(t) + 17y(t). Give f(n) - g(n). 5n2 - n - 1 Let k(w) = -2w*3 + 3w*2 - w - 1. Let o be (10 + -8)(1 + -2). Let v(y) = y*3 - 2y*2 + y. What is ok(r) - 3v(r)? r3 - r + 2 Let y(g) = -8g*2 + 6g - 6. Let a(u) = -u*2 + u - 1. Suppose -9d = -5d - 4. Calculate dy(r) - 6a(r). -2r*2 Let x(f) = 2f + 1254f3 + 6f - 1243f3 + f. Let s(a) = -17a*3 - 14a. What is 5s(q) + 8x(q)? 3q3 + 2q Let d(c) = -651c + 77. Let k(n) = -59n + 7. Give 5d(x) - 56k(x). 49x - 7 Suppose 3j - 3r = 15, -5j + 21 = 4r - 7r. Suppose 0 = -x - j, 2o - 27 = -o + 3x. Let i(l) = 3l - 14. Let p(b) = -b + 5. Give oi(y) + 17p(y). y + 1 Let u(v) = 111v + 3. Let s(r) = -37r - 1. Determine -17s(q) - 6u(q). -37q - 1 Let y(f) = 6f - 1 + 4f*2 - 2f*2 - 2. Let d(h) = 2h*2 + 5h - 2. Let k(c) = c*3 - 26c*2 - 24c - 78. Let t be k(27). Calculate ty(l) - 4d(l). -2l2 - 2l - 1 Let v(u) be the first derivative of u*3 - 4u - 31. Let s(b) = 7b2 - 7. Give 4s(g) - 7v(g). 7g*2 Let c(u) = -185u*3 - 8u*2 + 8u + 8. Let n(g) = 62g3 + 3g*2 - 3g - 3. Calculate 3c(h) + 8n(h). -59h3 Let b(z) = 210z*3 + 3z*2 + 6z - 4. Let k(w) = -w*2 - 2w + 1. Determine b(n) + 3k(n). 210n*3 - 1 Let f be (15/6)/((-2)/(-4)). Suppose u + w = -w, u = -fw. Suppose -3g = -21 - u. Let m(c) = -4c - 4. Let i(o) = 13o + 13. Determine gm(z) + 2i(z). -2z - 2 Let i(u) be the first derivative of u*2/2 + u + 4. Let j(t) = -t. Let q = 22 + -19. Give qj(b) + i(b). -2b + 1 Let w(i) = -i - 47. Let r(h) = -h - 47. Calculate -5r(v) + 6w(v). -v - 47 Let i(d) = 9d*2 + 3d + 5. Let w(k) = -4k2 - k - 2. Suppose 2h - 3u = -h - 24, 3h = -u - 4. Let g be 22/(-10) + (h - 48/(-15)). What is gi(p) - 5w(p)? 2p2 - p Let s(v) = -3v + 3. Let w be 2/3(-18 - (-99)/6). Let x(m) = 6 - 4 + 0 - 3. What is ws(b) - 3x(b)? 3b Let s(o) = -2o2 - 17o + 14. Let w(d) = 2d2 + 18d - 16. Give 7s(b) + 6w(b). -2b2 - 11b + 2 Let f(s) = s + 1. Let l(h) = h*3 - 2h*2 - 7. Calculate -2f(u) - l(u). -u*3 + 2u*2 - 2u + 5 Let m(c) = -c. Let i(l) = -2l - 1. Suppose -5 = -3o + 7. Let r be 12o/(-8). Let g(j) = -2j2 + 1. Let q be g(r). Give qi(x) + m(x). x + 1 Let c(o) = o - 1. Let k(t) = -5t + 3. Let v(d) = d3 - 3d*2 + 2d. Let x be v(3). Calculate xc(b) + k(b). b - 3 Let h(s) = -6s*3 - 5s*2 + 17s - 17. Let q(v) = -v*3 - 2v*2 + 6v - 6. What is -6h(i) + 17q(i)? 19i3 - 4i*2 Let j(n) = -14n*2 + 3n + 16. Let h(r) = -5r2 + r + 6. What is 11h(o) - 4j(o)? o2 - o + 2 Let s(q) = -9q*3 + 2q*2 - 4q - 7. Suppose 48 = -12j - 0. Let a(u) = -5u3 + u2 - 2u - 4. Give js(k) + 7a(k). k3 - k2 + 2k Let b(g) = -g + 1. Let c(d) = -d - 9. Let y be c(-12). Suppose yh - 19 = -4. Let z(t) = 2t*2 + 4t - 4. Give hb(j) + z(j). 2j*2 - j + 1 Let h(k) = 373k3 + k2 - 8k. Let r(b) = -b3 + 2b. Determine -h(j) - 4r(j). -369j3 - j2 Let d(o) = -638069o - 25828. Let j(v) = 593v + 24. Give 6d(s) + 6457j(s). 587s Let i(x) = 4 - 3 - 5x - 5. Let s(n) be the first derivative of 2n2 + 3n - 1049. Determine -6i(v) - 7s(v). 2v + 3 Let n(p) = -4p - 3. Let r(q) = 28q + 589. Let b be r(-21). Let h = -3 - 0. Let o(z) = -z - 1. What is bn(f) + ho(f)? -f Let a(b) = 2b - 22. Let c(p) = p - 1. Give -a(z) + 5c(z). 3z + 17 Let x(l) = 71l2 + 5. Let a(b) = 72b*2 + 7. Calculate -2a(k) + 3x(k). 69k*2 + 1 Let r(k) = 404k + 3. Let o(w) = 406w + 4. What is 3o(l) - 4r(l)? -398l Suppose 6i - 2i - 4 = 0. Let z(r) = 3r2 - 1 + 0r*2 - 7r + i. Let w(q) = q*2 - 2q. Determine -14w(s) + 4z(s). -2s2 Let f(m) = 208m - 18. Let v(k) = -104k + 7. Give 4f(c) + 10v(c). -208c - 2 Let a(l) be the first derivative of l3/3 - l2/2 + 1. Let b be a(2). Let w(i) = -4 + 3 - i*b + 0. Let z(v) = -2v*3 + 4v*2 + 3. Give 5w(n) + z(n). -2n3 - n2 - 2 Let l(v) = -2. Let c(d) = 14d - 25. Let z(g) = -5g + 8. Let t(n) = -4c(n) - 11z(n). Calculate -14l(p) - 2t(p). 2p + 4 Suppose 4p - 88 = -3a + 2a, 0 = 3p + 4a - 53. Let g = 17 - p. Let f(k) = -9k + 5. Let l(r) = -5r + 3. Give gf(d) + 11l(d). -d + 3 Let g(d) = 1. Let x(b) = -13b*3 - 12b - 19. Let s(u) = 25u3 + 22u + 34. Let h(v) = -6s(v) - 11x(v). Determine -5g(f) + h(f). -7f*3 Let g(w) = 4w*3 - 3w*2 - 3w - 2. Let h(m) = m3 - m2 - m. What is g(v) - 3h(v)? v3 - 2 Suppose -10 = -3b - 4. Let r(h) = 1 + 5h3 + h2 + 0h2 + hb - 3. Let j(w) = -6w3 - 3w*2 + 3. Give -2j(q) - 3r(q). -3q*3 Let g(q) = -4q + 3q + 0q - q*2 - 1. Let x(t) = 3t*2 + 5t + 21. Let v(s) = -3s2 - 5s - 18. Let w(f) = -5v(f) - 4x(f). Calculate -5g(n) - w(n). 2n*2 - 1 Let l(r) = 58r*2 + 4r + 4. Let j(i) = -58i2 - 7i - 5. Give -2j(a) - 3l(a). -58a2 + 2a - 2 Let p(q) be the second derivative of -7q3/6 + 2q*2 + 203q. Let m(s) = 6s - 3. What is 5m(y) + 4p(y)? 2y + 1 Let n(k) = -k*3 - 1. Let i(d) = -8 - 5d + 9d + 3 - 6d. Calculate i(z) - 3n(z). 3z*3 - 2z - 2 Let x = 272 + -275. Let r(g) be the third derivative of -g*4/24 - 2g3/3 + g2. Let l(z) = z + 5. What is xr(s) - 2l(s)? s + 2 Suppose g = -3n + 25, 2n + 3g - 15 = 11. Let b(c) = 2c - 8 - n + 15. Let p(l) = -5l - 9 + 9. Calculate -8b(t) - 3p(t). -t Let z(p) = -p2 - 4. Let o(d) = 201d*2 - 8. Give 2o(i) - 4z(i). 406i*2 Let m(u) = 15u - 16. Let p(d) = -7d + 7. Determine -4m(r) - 10p(r). 10r - 6 Let t(d) = 5d - 317. Let z(j) = -3j + 159. What is -4t(u) - 7z(u)? u + 155 Let c(o) = 24o3 + 11o + 11. Let p(j) = 5j - 3j - 3j2 - j2 + 5j*3 + 2 + 4j*2. Give 2c(k) - 11p(k). -7k*3 Let c(s) = -s + 4. Let j(b) = -324 + 175 + 154. Give 5c(u) - 4j(u). -5u Let u(h) = 84h - 2. Let w(s) = 3s. What is u(b) + 3w(b)? 93b - 2 Let v(l) = 7l + 12. Let y(r) = r + 1. Give v(b) - 3y(b). 4b + 9 Let p(l) = 13269l*2 - 13270l*2 - 14l + 20 + 1. Let v(d) = -3d + 4. Give -2p(s) + 11v(s). 2s*2 - 5s + 2 Let a(c) = 6c3 - 5c*2 - c + 4. Let s(i) = 13i*3 - 11i*2 - 2i + 9. Let q(d) = -9a(d) + 4s(d). Let o(w) = -2w3. Determine -3o(t) + 2q(t). 2t*3 + 2t*2 + 2t Let z(s) = 2s3 + 10s*2 - 14s - 595. Let y(d) = -d*3 - 6d*2 + 8d + 298. Give 7y(r) + 4z(r). r*3 - 2r*2 - 294 Let h(x) = 2x3 + x2 + x - 9. Let j(q) = q*3 - 5. Calculate -3h(u) + 5j(u). -u3 - 3u*2 - 3u + 2 Let b(x) = -2x2 + 12. Let v(n) = -n2 + 5. Suppose 0o - 3o = 2q - 176, -q = -3o + 182. Suppose 40a - o = 45a. What is av(r) + 5b(r)? 2r*2 Let v(y) be the third derivative of 1/24y4 - y2 - 1/6y3 + 0y + 0. Let i(r) = 2r - 4. Suppose -51n = -57n - 36. What is nv(g) + 2i(g)? -2g - 2 Let o(i) = i*3 + 2. Let d be o(0). Let u(h) = 2 + 19h - 5h - 5h - 5 - 8h. Let w(k) = -1. What is du(b) - 4w(b)? 2b - 2 Let x(z) = -7z + 5. Suppose -3w = 4h - 25 + 10, 3h = -5w + 25. Let y(g) = -2 + g - 1 - 25g + 27g. Calculate wy(v) + 3x(v). -6v Let s(i) = -34i - 14. Let y(t) = -5t + 1. Let r(g) = -s(g) + 6y(g). Let h(x) = 1. Determine 20h(q) - r(q). -4q Let l(m) = -1. Let v(i) = i + 3. Suppose -3z + 70 + 2 = 0. Suppose -6g - z = -2g. Let n be (-4)/(-4)(-6)/3. Give gl(b) + nv(b). -2b Let r(w) = -13w2 - 23w + 2. Let a(z) = 14z2 + 21z - 3. What is -2a(u) - 3r(u)? 11u2 + 27u Let m(f) be the third derivative of f**5/60	{ "pile_set_name": "DM Mathematics" }
- 93v + 5867. Determine r(-91). -2232 Let y(t) = -822t - 135636. Determine y(-165). -6 Let o(w) = -74w2 + 1462w - 1073. Calculate o(19). -9 Let r(f) = -9f2 - 45f + 170. What is r(4)? -154 Let z(o) = -o*2 - 215o - 9476. What is z(-64)? 188 Let w(x) = -x*3 - 50x*2 - x + 206. Give w(-50). 256 Let j(i) = 2i*2 - 132i - 1142. Calculate j(68). -870 Let z(k) = k*3 + 60k*2 + 19k + 1111. What is z(-60)? -29 Let u(r) = -r*2 + 96r - 1965. What is u(29)? -22 Let y(f) = -21f2 - 182f + 1854. Give y(6). 6 Let d(n) = n*3 + 11n*2 - 79n + 143. Determine d(2). 37 Let c(p) = -24p2 - 71p - 59. Determine c(-2). -13 Let h(u) = -u*2 - 7u + 22843. What is h(145)? 803 Let l(y) = y*3 - 6y*2 - 139y + 112. Calculate l(15). 52 Let j(o) = 3406o + 95384. Calculate j(-28). 16 Let m(k) = -k3 - 15k*2 + 76k - 30. What is m(4)? -30 Let i(c) = -c*2 + 1635c + 1226432. What is i(-559)? -14 Let x(f) = -f*3 + 31f*2 - 179f - 76. Calculate x(23). 39 Let o(f) = 473f + 19839. Determine o(-40). 919 Let l(f) = -358f*2 - 4286f + 65. Determine l(-12). -55 Let p(w) = 6220w - 18258. What is p(3)? 402 Let z(p) = -17p*2 - 11444p - 24769. What is z(-671)? 58 Let k(p) = -40p2 - 8170p - 26128. Determine k(-201). 2 Let b(q) = q*3 + 12q*2 - 4q + 34. Determine b(-5). 229 Let t(a) = 2a3 - 48a*2 - 156a + 48. Determine t(27). 210 Let c(p) = 11p3 + 176p*2 - 23p - 370. Give c(-16). -2 Let v(c) = 99c2 + 9616c + 1253. Give v(-97). -8 Let i(p) = 34p2 + 584p - 400. Determine i(-20). 1520 Let v(k) = -2k2 - 266k - 2024. Calculate v(-125). -24 Let y(d) = 4689d + 32784. What is y(-7)? -39 Let p(v) = -2v*2 + 274v - 4249. Calculate p(119). 35 Let k(a) = -510a2 - 44610a - 20886. Determine k(-87). -6 Let o(q) = 35q2 + 7480q - 1713. Calculate o(-214). 427 Let d(l) = 58l2 + 823l - 11. Give d(-12). -1535 Let r(l) = -l*3 - 13l*2 - 183l + 1416. Give r(7). -845 Let p(l) = 347l - 83289. Give p(233). -2438 Let s(q) = -q3 + 76q*2 + 22270q + 322. Give s(192). -62 Let d(y) = -150y2 - 6167y + 19076. Give d(-44). 24 Let c(y) = -30y3 - y2 - 60y - 59. What is c(-1)? 30 Let i(v) = -v*3 + 97v*2 + 1641v - 2629. Determine i(-16). 43 Let v(w) = 551w - 50540. Determine v(91). -399 Let a(v) = 84v*2 + 6387v + 67. Determine a(-76). -161 Let r(s) = -2328s2 - 2307046s + 1983. What is r(-991)? 1 Let a(c) = -50c2 - 34c + 2925. Give a(-8). -3 Let y(i) = 2i3 + 507i*2 - 11523i - 123. Give y(21). 3 Let n(h) = -45487h + 409421. What is n(9)? 38 Let m(o) = 93o*2 + 52480o + 15786. Calculate m(-564). -6 Let w(d) = -2d2 - 1700d - 18572. What is w(-11)? -114 Let s(r) = -r*3 - 30r*2 - 213r + 54. What is s(-14)? -100 Let x(k) = -21123k - 316836. Determine x(-15). 9 Let f(n) = -66n*2 - 714n - 532. What is f(-10)? 8 Let l(j) = 13902j - 180727. Determine l(13). -1 Let j(d) = -2806d - 168363. Give j(-60). -3 Let a(o) = 74o - 2702. Calculate a(46). 702 Let r(d) = 1901d - 26621. Determine r(14). -7 Let o(g) = -62g2 + 70817g - 70819. Calculate o(1). -64 Let s(u) = -u*3 + 26u*2 + 89u - 460. Determine s(28). 464 Let b(k) = 4660k + 610474. Give b(-131). 14 Let n(j) = 295j + 6063. Calculate n(-20). 163 Let h(i) = -4593i2 - 41633i - 2662. Determine h(-9). 2 Let d(f) = 59f + 844. Give d(-16). -100 Let i(z) = 7z*2 + 4098z - 8171. Give i(2). 53 Let x(l) = -l*2 - 3l + 3480. Give x(55). 290 Let n(g) = 8273g + 446712. What is n(-54)? -30 Let j(r) = -25r - 895. What is j(-29)? -170 Let p(t) = 1705t + 10264. Calculate p(-6). 34 Let d(p) = -2754p - 380073. Determine d(-138). -21 Let v(n) = -n*3 + 118n*2 - 142n + 2685. Determine v(117). -240 Let j(i) = 19969i + 239733. Determine j(-12). 105 Let m(o) = 53o*3 - 2226o*2 + o + 26. What is m(42)? 68 Let y(n) = 6040n - 132537. Determine y(22). 343 Let u(c) = -22c3 + 376c*2 - 689c + 24. Determine u(15). 39 Let l(d) = -40d - 639. Determine l(-34). 721 Let x(m) = 1254m + 35055. Give x(-28). -57 Let q(x) = 423x + 2904. What is q(-8)? -480 Let j(u) = 900147u - 8101317. Calculate j(9). 6 Let a(l) = -7l2 - 706l + 5587. Determine a(8). -509 Let u(v) = -5v2 - 770v - 3746. Give u(-150). -746 Let f(z) = -11z2 + 4609z + 56903. What is f(-12)? 11 Let z(i) = 97i2 + 2370i + 375. Determine z(-25). 1750 Let m(k) = -163k - 2299. Give m(-14). -17 Let c(k) = -k3 - 56k*2 + 563k - 856. Calculate c(7). -2 Let x(p) = -5918p - 88769. Determine x(-15). 1 Let c(j) = -2169j - 10807. Determine c(-5). 38 Let q(z) = -z*2 - 2014z - 521240. Calculate q(-305). 5 Let v(f) = -f*3 + 27f*2 - 127f - 195. What is v(23)? -1000 Let o(z) = 3z3 + 123z*2 - 93z + 109. Give o(-42). -1277 Let d(f) = f*2 + 61f - 5701. Give d(-102). -1519 Let o(m) = 63924m - 255730. Determine o(4). -34 Let s(i) = 4i*3 + 857i*2 + 195i - 4095. Calculate s(-214). -29 Let z(l) = -4l2 + 19l - 53. Determine z(17). -886 Let k(j) = -j*2 - 852j - 133077. Calculate k(-206). -1 Let j(n) = n*3 - 706n*2 + 109967n + 470. What is j(474)? -4 Let a(n) = -n*3 + 23n*2 + 23n + 44. Calculate a(12). 1904 Let w(k) = -84k2 + 678k - 1523. Give w(4). -155 Let t(q) = 572440q - 4007090. Give t(7). -10 Let p(r) = 295r*2 + 2995r - 2994. Calculate p(1). 296 Let w(r) = 602r + 132021. Calculate w(-219). 183 Let w(z) = z3 + 41z*2 + 285z + 1504. Determine w(-34). -94 Let z(o) = -238o - 26797. Calculate z(-112). -141 Let w(j) = 191j*3 - 7j - 16. Calculate w(-2). -1530 Let l(v) = 58v2 + 347v - 116. What is l(-7)? 297 Let f(y) = -y*2 - 170530y - 1364223. Calculate f(-8). -47 Let r(x) = 387x - 2347. Determine r(5). -412 Let y(d) = -8910d - 62378. Determine y(-7). -8 Let r(q) = q*2 - 104q - 6754. Calculate r(151). 343 Let n(d) = -d*3 + 212d*2 - 874d + 163. Determine n(4). -5 Let f(v) = v*3 + 180v*2 + 177v - 273. Determine f(-179). 85 Let n(o) = -16o2 - 697o - 5723. What is n(-11)? 8 Let k(f) = 27f2 - 166f - 701. Give k(-4). 395 Let d(t) = -1873t - 247236. Give d(-132). 0 Let x(y) = -7y*2 + 44y - 1563. What is x(22)? -3983 Let i(z) = -11z3 - 278z*2 - 171z - 2639. Give i(-25). -239 Let q(f) = f*3 - 126f*2 + 623f - 2056. What is q(121)? 122 Let x(t) = -t*2 + 651t + 66759. Calculate x(-90). 69 Let o(l) = l*2 - 264l + 6603. Determine o(236). -5 Let o(r) = r*3 + 17r*2 - 60r + 317. What is o(-21)? -187 Let p(z) = 13352z + 1602231. Determine p(-120). -9 Let i(u) = -2790u + 203527. Calculate i(73). -143 Let u(m) = 1795m - 25130. Give u(14). 0 Let q(v) = -200v + 26682. Determine q(136). -518 Let z(a) = -9528a + 190554. Calculate z(20). -6 Let g(h) = h3 + 263h*2 + 3247h - 17. What is g(-13)? 22 Let i(c) = 2c2 - 259c + 6479. Determine i(97). 174 Let g(s) = -2606s - 638464. Give g(-245). 6 Let q(t) = -1255t - 12391. What is q(-10)? 159 Let u(l) = 159l - 5541. Determine u(38). 501 Let b(j) = j3 - 10j*2 + 154j - 2005. What is b(12)? 131 Let f(o) = 390o + 7448. Give f(-19). 38 Let s(g) = 2g*3 + 269g*2 + 8568g - 632. Calculate s(-52). -8 Let n(h) = -2h3 + 83h*2 - 2223h + 95144. Determine n(42). 14 Let v(w) = -2w3 - 77w*2 + 35w - 167. Give v(-39). -11 Let r(p) = p*3 + 64p*2 + 405p + 696. Calculate r(-57). 354 Let c(t) = -6885t2 + 55059t + 11. What is c(8)? -157 Let s(d) = 3005d + 5583263. Give s(-1858). -27 Let c(h) = 10h*3 - 193h*2 + 297h - 1137. Give c(18). -3 Let z(a) = 3a3 - 2a*2 - 1358a - 4058. What is z(-3)? -83 Let q(z) = 431z - 27459. Calculate q(64). 125 Let l(a) = -2613a*2 - 13027a + 3. Determine l(-5). -187 Let w(u) = 23u2 - 27u - 229. What is w(-7)? 1087 Let w(p) = 26p3 - 394p*2 + 55p + 35. Determine w(15). -40 Let g(f) = 3233f + 17657. Determine g(-5). 1492 Let l(h) = -8778h - 182035. Calculate l(-21). 2303 Let k(d) = 46671d + 373355. What is k(-8)? -13 Let j(d) = 2216d - 29959. What is j(13)? -1151 Let x(i) = 65i - 46468. What is x(715)? 7 Let p(q) = 2q*3 + 211q*2 + 290q + 19436. Determine p(-105). 11 Let f(q) = 758809q - 6070485. What is f(8)? -13 Let x(r) = 3r*2 + 486r + 1402. Calculate x(-159). -29 Let d(n) = -15n2 - 1868n + 208. Calculate d(-125). -667 Let n(m) = -296m2 - 2598m + 19. Calculate n(-9). -575 Let	{ "pile_set_name": "DM Mathematics" }
.21. Let p = -186 + 190. Let q be ((-24)/90)/(-2) - 1/(-5). What is the third biggest value in p, q, -3/4, a? -3/4 Let y = -4103.4 + 4103. What is the smallest value in y, 10, -0.017? y Let v = -1352 + 901. Let t = 459 + v. Which is the second biggest value? (a) t (b) 1 (c) 1/5 (d) -4 b Let v = 710.678 - 1.678. Let u = -710.9 + v. What is the smallest value in u, 0.1, 0? u Let w = -1.75 - 72.15. Let i = w + 77. Which is the third smallest value? (a) 5/6 (b) i (c) -1 b Let i = 69/1640 - -17/205. Which is the smallest value? (a) 9.3 (b) 1 (c) i c Let z = -1703 - -1699.852. Let d = z + 0.148. What is the smallest value in 5, -0.1, d, 7? d Let i = 131 - 128. What is the third biggest value in 1, 46, i? 1 Let j(z) = z*2 + 129z + 4125. Let q be j(-69). What is the third smallest value in 5, -1/5, q? 5 Let f(q) = -q*3 + 2q*2 + 3q - 1. Let u be f(3). Let v = 53266 - 53270. What is the biggest value in -0.7, v, u? -0.7 Suppose -4s - s - 4j + 41 = 0, -j = -4s + 37. Let t = s - 21/2. Which is the smallest value? (a) -10 (b) -9 (c) t a Let z = 8.75102 + 0.21198. Let p = 0.037 + z. Let r = p + -12. Which is the second biggest value? (a) -2 (b) r (c) -3/7 (d) 0 c Let u = -20832 + 20806. What is the second smallest value in u, -1, 104? -1 Let t = 8.98 + -5.98. Let m be (-92)/(-23) + 76/(-18). Which is the third smallest value? (a) -2/23 (b) -5 (c) t (d) m a Suppose 4c - 7 = 3d, -586c + 582c - d = 13. Let f = 1.4 + -1.05. Let b = -0.05 - f. What is the third biggest value in b, c, 0.2? c Let x = -0.0279 + 392.0279. Let d = 392.2 - x. Let l be (0 - -2)(-3)/(-18). What is the third smallest value in 0, -1, l, d? d Let o = 204 - 204.194. Let x = -4.194 - o. What is the smallest value in 0.2, -0.5, x, 2/5? x Let p be (-7)/24282/(-21) + -4. What is the fourth biggest value in 0.2, p, -2, -27? -27 Let j = -3521 + 3747. What is the biggest value in -0.2, 0.01, j? j Let l = -1.89 + 2.89. Let h = -74 - -52. Let r = -24 - h. Which is the second smallest value? (a) -1.7 (b) -1/9 (c) l (d) r a Let j = -34.3 + 34. Let c = -70 + 63. Let p = -6.5 - c. What is the third biggest value in j, 0.3, -12, p? j Let w = 0 - 0.5. Let b = -72.8 - 255.2. Let n = b + 328.6. What is the second smallest value in w, n, 2? n Let j = 1544.97 + -1545. Let r = 40.04 + -41. Let s = r + -0.04. What is the third biggest value in s, j, -3? -3 Let k be -2(-2)/(-30) - 33408/2295. What is the third biggest value in 12, 4/3, 2/5, k? 2/5 Let j = -739 + 741. Which is the fifth biggest value? (a) j (b) 0.2 (c) -197 (d) -2/5 (e) -4 c Let r be 21/(-3) - (-7 + (-2732)/14784). Let o = r + -1/336. Let w = 0.1 - 0. What is the fourth biggest value in w, 4, -1/4, o? -1/4 Let y(d) = d2 + 3d. Let h be y(-3). Suppose -o + 35 = -2o + 4k, -o + 5k - 37 = h. Which is the smallest value? (a) o (b) -2/5 (c) 4/3 a Let z = -5486 - -109721/20. What is the fifth smallest value in 3, 1/7, 1, -1, z? 3 Let f = -20 + -56. Let m = -85 - f. Which is the biggest value? (a) m (b) -4 (c) 0.09 c Let s = -14362.001 + 14362. Which is the third biggest value? (a) 0.4 (b) -0.2 (c) s b Let v = -674.1 - -674.4. Let y(f) = -f3 + f2 + 5. Let o be y(0). Which is the second smallest value? (a) o (b) -4/3 (c) 2/5 (d) v d Let l = -2 + -1. Let w be 560/245 + 4/(-2). What is the second biggest value in w, 2, l, 35? 2 Let h = 26.2 + -25.7. Let v = 309 - 310. Which is the fourth smallest value? (a) h (b) v (c) -0.5 (d) 0.6 d Let b = 22220 + -22220. Let w = -1.4 - -0.4. What is the fourth biggest value in 4, b, -4, w? -4 Let a = -1317.5 - -1317. Let l be (2/(-8))/((-132)/(-16)). What is the fourth smallest value in 3, a, -12, l? 3 Let u = -5080/287 + 714/41. What is the smallest value in 4, -2, -3, u? -3 Let x = 9.8 - -55.2. What is the second biggest value in 2, -20, x? 2 Let i = -27324.6 - -27325. Which is the second smallest value? (a) 1.4 (b) i (c) -0.4 (d) 1.16 (e) -1/4 e Let r = 3258 + -3271. Which is the fourth biggest value? (a) r (b) 3 (c) 0.2 (d) -0.1 (e) -5 e Let j(v) = v2 + 40v + 72. Let n be j(-38). Let l = -291.49 - -290. Which is the second biggest value? (a) l (b) n (c) 4 a Let x = 150.79 - 151.09. What is the third biggest value in -0.07, 0.06, x, -73? x Suppose -45q - 71 = 199. Let u be -9q/(-432)6. What is the second biggest value in 9, -14/3, u? u Let z(c) = 27c*3 + 2c + 1. Let l be z(-1). Let w be l - -24 - (-4)/2. Let o be 1/(4/6 - -1). What is the smallest value in o, 1/3, w, 1? w Let h = -0.2 + 0.4. Let t be -26 + 1368/38 + -14. What is the third smallest value in h, -0.03, t, -2/7? -0.03 Let t = -11 - -10.961. Let z = t - 0.261. Let u = 60 - 65. Which is the second smallest value? (a) u (b) 1/7 (c) z c Let s = -612.6 + 684. Let j = s - 1.4. Let x = j - 68. What is the second biggest value in -2/21, -0.4, -1/2, x? -2/21 Let n = 25 - 28. Let o(d) = -d*3 - 5d*2 - 5d - 3. Let t be o(n). Let i be t/4 - (-2 + 0). What is the third smallest value in 0.1, -4, i? i Suppose -10r + 4n - 8 = -9r, -2n - 26 = 2r. Which is the third biggest value? (a) 4 (b) r (c) 16 b Suppose -3g + 74 - 65 = -3w, -2g = 4w + 6. Which is the second biggest value? (a) 81.9 (b) 4 (c) g (d) -0.2 b Let l = -1/562 + 851/4496. Which is the second smallest value? (a) -2 (b) -2/201 (c) l b Let i = -0.8669 + 0.7669. Suppose 0 = -5s + 2s + 6. Let t be 1/(1/s1). Which is the third biggest value? (a) t (b) i (c) -3/5 c Let f be 69/(460/20) - 21/9. Which is the biggest value? (a) f (b) -4 (c) -0.2 (d) -0.4 (e) -457 a Let o = -94 + 44. Let h be o/1512/(-10). Suppose 0 = 5w + 5i - 30, hw = -0w - 2i + 22. What is the second biggest value in w, -3, 2/7, 0.1? 2/7 Let c be (-3)/(2 + -11)-9(-9)/(-54). What is the biggest value in 7, c, 0.202, -1/8? 7 Let y be 25766/(-156)14/(-21). Suppose 145 = b + 35. Let l = y - b. What is the third smallest value in -2, 0.3, l? 0.3 Let g = -15781.6 - -15783.2. Let t = 217/5 - 44. Which is the biggest value? (a) t (b) -4 (c) g c Let w = 3225 + -3196. What is the second biggest value in 0.5, 13, w? 13 Let t(q) = 2q*3 - 23q*2 - 38q + 41. Let u be t(13). Let m = 326 - 1957/6. Which is the smallest value? (a) m (b) u (c) 5 a Let m = 24727/2 - 12364. Which is the second biggest value? (a) 0.2 (b) -3/2 (c) m (d) -0.9 c Let q = -9 + 12. Let s = -145 - -82. Let n be (5/(-7) + 1)/((-72)/s). What is the third biggest value in q, n, 1/2, -2/11? n Let h(w) = w*3 - 78w*2 - 167w + 563. Let o be h(80). What is the second smallest value in o, -2/13, -0.2, 0.5? -2/13 Let u = 3023 - 3031. Which is the third smallest value? (a) 0.3 (b) 3/7 (c) 0.2 (d) u a Let x = -35 + 24. Let p be 4 + 42/x + 108/(-110). Let a = -2.9 + -0.1. What is the smallest value in 0, 4/7, p, a? a Let t = -14822/13 + 1140. Which is the biggest value? (a) 2/9 (b) t (c) -568 (d) -1/4 a Let w = 0.2 + -0.16. Let p = 0.207325 - 0.607325. Which is the smallest value? (a) 1 (b) w (c) 2 (d) p d Suppose l - 6 = 3t, l + 5t - 4t - 6 = 0. Suppose 4p + 5s = 8s - l, 2p + 4s = -14. Which is the second biggest value? (a) 3/5 (b) -11 (c) p c Let f = -92689/6 + 15658. Let y = f + -210. What is the third smallest value in -3, y, -0.5, -5? -0.5 Let d = 778.1 + -778. What is the third smallest value in -1/108, 0.15, d? 0.15 Let q = 5524 + -5560. What is the third smallest value in 2, q, 99? 99 Let r = 23.9 + -139.9. Let o = -107 - r. What is the biggest value in o, -2, -1, -2/7? o Let p = 1975 + -1976.5. Which is the biggest value? (a) 0.4 (b) -1 (c) p a Suppose 171z = 2t + 169z - 7456, z = -t + 3730. Which is the second smallest value? (a) -1 (b) t (c) 1/3 c Let o = -23650 - -23651. What is the second biggest value in o, 2/9157, -2? 2/9157 Let q = -31.1 - -31. Let v = -6.4 - 61.6. Let h = v - -66. What is the second smallest value in -2/5, h, q? -2/5 Let p = -15 - -31/2. Let k = -0.0477 - -0.6217. Let f = k + -0.474. What is the smallest value in 4, 3/4, p, f? f Suppose -5q = 2o + 5, 9o = 14o + 5q + 5. Which is the biggest value? (a) -0.2 (b) -0.3 (c) o (d) 0.5 d Let y = 3337 - 3333. Which is the fourth smallest value? (a) 2/5 (b) -1/4 (c) 8 (d) 2/3 (e) y e Let j = 11 + -11.5. Suppose 0 = w - 5*w - 47	{ "pile_set_name": "DM Mathematics" }
= 2p - p2 + 2 + 2p*2 - 4. Let h be 4/(-4)(-3)/1. What is hl(v) + 2u(v)? -v*2 Let z(u) = -2u - 10. Let a(x) = 1. Let h = 2 - 1. Calculate hz(c) + 10a(c). -2c Let o(f) = 2f*2 - 3f - 4. Let i(a) = -2a2 + 4a + 5. Let m(r) = 2r2 - 12r + 5. Let g be m(6). What is gi(c) + 6o(c)? 2c2 + 2c + 1 Let i(n) = 5n2 + n + 2. Let s(t) = 2t - 8 + 6 + 0t - 4t*2 - 3t. Calculate -2i(v) - 3s(v). 2v2 + v + 2 Let f(k) = 48k*3 - 2k + 6. Let n(u) = -145u3 + 6u - 17. Determine 17f(j) + 6n(j). -54j3 + 2j Let i be 5 + -1 + (-85)/17. Let y(p) = 2p2 + 3p + 6. Let k(a) = -a - 1. Determine iy(h) - 5k(h). -2h2 + 2h - 1 Let x(l) = l*3 - 15l*2 + 16l - 22. Let u be x(14). Let y(r) = -3r2. Let o(q) = -2q*2. Give uo(s) - 5y(s). 3s*2 Let y(j) = 5j*2 + 3j + 4. Let f(p) = 14p2 + 8p + 11. Let k(c) = -4f(c) + 11y(c). Let l(m) = -m*2 + m. Determine k(h) - 3l(h). 2h2 - 2h Let b(j) = j + 4. Let u(d) = d + 5. Let y(m) = -4b(m) + 3u(m). Let l(r) = 13r - 9. Let o(f) = 7f - 5. Let q(k) = -6l(k) + 11o(k). Give -4q(w) + 5y(w). -w - 1 Let d(v) be the second derivative of -v*5/20 + 3v*4/4 + 7v*3/6 + 5v2/2 + v. Let o(h) = h3 - 13h2 - 10h - 7. Give 7d(j) + 5o(j). -2j3 - 2j*2 - j Let m(r) = 15r + 21. Let p(v) = -8v - 11. What is -6m(g) - 11p(g)? -2g - 5 Let k(b) = 15b2 - 10b - 110. Let z(a) = -23a2 + 14a + 165. Let p(i) = -7k(i) - 5z(i). Let h(d) = d*2 - 6. Determine 55h(t) - 6p(t). -5t2 Let v(u) = u3 - 2u + 1. Let m(l) = l3 - 3l + 1. Let f(d) = 2d - 2. Let a be f(-1). Calculate am(o) + 6v(o). 2o*3 + 2 Suppose -3g + 21 + 5 = x, 4x = 3g + 29. Let b = 11 - 7. Let d(v) = -6v2 - 11v. Let j(q) = 2q2 + 4q. What is bd(k) + xj(k)? -2k2 Let l(d) = 3d + 2. Let h(c) be the second derivative of c*3/6 + 10c. What is -2h(f) + l(f)? f + 2 Let k(h) = -55h*3 + 65h*2 - 65h. Let y(s) = 5s3 - 6s*2 + 6s. What is 6k(w) + 65y(w)? -5w3 Let i(b) = -7b*3 + 5b - 10. Let z(p) = -p*3 + p. Calculate -i(h) + 5z(h). 2h3 + 10 Let b = -3 - -5. Let a(o) = 5o - 2o - bo - 6. Let g(w) = w - 7. Calculate -7a(m) + 6g(m). -m Let l(p) = -p3 + p2 + 1. Let j(b) = -7b3 - 4b*2 - 4. What is -j(m) - 4l(m)? 11m3 Let k = 2 - 0. Let j = k + 8. Suppose g + j = -g. Let y(c) = 10c + 7. Let p(v) = -7v - 5. Determine gy(u) - 7p(u). -u Let k(j) = -j2 + 1. Let u be (20/18)/5 - 212/(-18). Let v(a) = -2a*3 + 10a*2 - 12. Determine uk(x) + v(x). -2x3 - 2x*2 Let r(f) be the second derivative of 2f + f*2 + 2/3f*3 + 0. Suppose -2p = -0p + 12. Let s(k) = 7k + 3. What is ps(n) + 10r(n)? -2n + 2 Let x(o) = -o. Let r(a) be the first derivative of -3a*2/2 + 3a - 11. What is -r(b) + x(b)? 2b - 3 Let c(a) = -7a*2 - 4a. Let f(s) = 6s2 + 5s. Calculate -5c(j) - 4f(j). 11j2 Suppose -6l = -l. Suppose 4x + 14 = -3h, -3x + 5h + 12 = -4x. Let g be -3 - (l + x)1. Let r(i) = -i - 2. Let d(j) = j. What is gr(q) + d(q)? 2q + 2 Let x(p) = -p*3 + 6p*2 + 14p - 19. Let d be x(8). Let m(z) = 50z2 + 35z - 35. Let b(i) = 3i2 + 2i - 2. Give db(u) + 2m(u). -5u2 Let y(m) = -m3 - 13m*2 - 13m - 13. Let a be y(-12). Let q(r) = r + 1. Let n(x) = -x - 5. Calculate an(z) - 3q(z). -2z + 2 Let n(l) = 6119l - 145. Let d(y) = -85y + 2. Calculate 145d(a) + 2n(a). -87a Let b(r) = -7r + 30r - 2 - 1. Suppose -4i + 20 = -0i. Let k(c) = i - 2c - 2 - 2 - 6c. What is -6b(z) - 17k(z)? -2z + 1 Let o(x) = -2x*2 + x - 1. Let p be 12/10 - (-2)/(-10). Let n = -4 - -6. Let c(f) = 0f - f*3 + f + nf3 - f2. What is po(l) - 2c(l)? -2l3 - l - 1 Let o(k) = 2k*3 + 3. Let m = 17 + -1. Let v(f) = -10f*3 - 16. Calculate mo(b) + 3v(b). 2b3 Let u(l) be the third derivative of l5/60 - l4/24 - l3/6 - 18l2. Let c(f) = -3f - 3. What is c(i) - 3u(i)? -3i*2 Let g(d) = -2d*2 + 8d. Let h(t) = t*2 - 3t. Let w be -18 - (-1 - 5 - -3). Let m be ((-10)/w)/((-3)/36). Suppose 0 = b + 2 + 1. Calculate bg(f) + mh(f). -2f2 Let w(m) be the third derivative of m4/4 + m3/2 + m2. Let l be (8/6)/(2/(-6)). Let s(k) = 4 + 1 - 7 - 5k. Give lw(a) - 5s(a). a - 2 Suppose -2d - 8 = 2m, 3m = 2m + 3d + 16. Let a(k) = -4 - m + 6 - k. Suppose -16 = -4r, -f + r - 9 = -6f. Let b(t) = t - 3. Calculate fb(v) + 3a(v). -2v Let u(l) = -3l3 - 4l2 - l. Let q(a) = -a2. Determine 3q(o) - u(o). 3o3 + o2 + o Let d(r) = 5r3 - 11r*2 - 13. Let b(n) = -3n*3 + 6n*2 + 7. Determine 11b(h) + 6d(h). -3h3 - 1 Let r(o) be the second derivative of o3/6 - o*2/2 - 3o. Let k(n) be the third derivative of n*5/60 + 5n*4/24 - 5n3/6 + n2. Determine k(z) - 5r(z). z2 Let l(i) = -5i + i - 2i2 + 3i + 5. Let j(g) = -4g2 - 2g + 11. Let y(c) = -3c - 2. Let s be (4/(-10))/(1/5). Let n be y(s). Determine nj(p) - 9l(p). 2p2 + p - 1 Let a(q) = -q. Let b(k) = k3 - 25k2 + 24k - 1. Let h be b(24). Let y(f) = -3f. Suppose -5t = 5 - 25. Determine hy(r) + ta(r). -r Let l(g) = 1. Let i be 9/(0 - 1/1). Let z(f) = f*2 + 8f - 4. Let t be z(i). Let h(c) = -2c + 5. Determine tl(n) - h(n). 2n Let l(c) = -6c + 2. Let p(a) = 5a - 2. Determine 3l(u) + 2p(u). -8u + 2 Let h(r) = 7r + 1. Let i(x) = 6x + 2. What is 3h(o) - 2i(o)? 9o - 1 Suppose 5v - 4 = 6. Let q(w) = 0w - 6w + 0w2 + 4w*v + 0w + 6. Let m(p) = -8 - 2p2 - 3 - 5p*2 + 11p. What is 6m(f) + 11q(f)? 2f2 Let h(v) = -2v*3 - 2v + 5. Suppose 0 = w - 4j - 4, -2 = -3w - 5j - 7. Let m(z) = -1 + 2z + 0 + wz3 - z + z3. Calculate -h(o) - 3m(o). -o*3 - o - 2 Let i(y) = -6y - 2. Let m = -37 - -33. Let s(k) = 17k + 5. Determine ms(l) - 11i(l). -2l + 2 Let r(k) = k*2 + 8. Suppose 7h = -148 + 50. Let n(x) = -1. What is hn(m) - 2r(m)? -2m2 - 2 Let b(a) = -a2 + a + 1. Let o(i) = 2i*2 - 3i - 1. What is -5b(l) - 2o(l)? l*2 + l - 3 Let b(r) be the first derivative of 1/2r*2 - 3 + 3r - 2/3r3. Let j(p) = 5p*2 - 2p - 7. Determine 7b(a) + 3j(a). a2 + a Let v(m) = -m + 1. Let j(s) = s2 + 2s + 1. Determine j(c) + v(c). c2 + c + 2 Let j be (-6)/(-5)((-270)/(-4))/9. Let y(u) = 7u - 7. Let w(a) = -3a + 3. Determine jw(k) + 4y(k). k - 1 Let j be ((-3)/(-3))/((-1)/5). Let o(h) be the third derivative of -h4/12 - h3/3 - 3h2. Let v(b) = 0 - 2 - 2b + 0. Calculate jo(a) + 6v(a). -2a - 2 Let u(p) = p + 1. Let n(x) = 13x + 14. Let m(o) = 2n(o) - 22u(o). Let w(q) = 3q + 5. Give 4m(c) - 5w(c). c - 1 Let k(b) = b + 1. Let n(i) = 2i3 + i2 - 4i - 6. Calculate -4k(w) - n(w). -2w3 - w2 + 2 Let y(s) = -s2. Let q(r) = 7r*2 - 3r. Determine -q(w) - 6y(w). -w2 + 3w Let h(r) = -31r + 8r + 13r + 1 + 11r. Let i(o) = -4o - 2. Suppose -m + 3m - 8 = 3b, -9 = -3m + 3b. What is mi(d) + 3h(d)? -d + 1 Let x(h) = 57h*2 - 27h2 - 26 + 1. Let z(l) = l2 - 1. Determine x(v) - 25z(v). 5v*2 Let y(r) = r + 1. Let k(b) = 16b + 16. What is -k(d) + 12y(d)? -4d - 4 Let g(f) = 2f + 3. Let s(t) = -4t - 7. Let n(k) = 5g(k) + 2s(k). Let p(u) = 4u + 2. Determine -9n(h) + 4p(h). -2h - 1 Let b(u) = -u3 - u2 - u - 1. Let q(x) = -2x2 + 13x - 2. Calculate -2b(s) + q(s). 2s*3 + 15s Suppose 0 = -6n + 2n + 16. Let t = -3 - -9. Suppose -tu + 3u + 9 = 0. Let f(i) = -5i. Let x(l) = 6l. What is nf(a) + ux(a)? -2a Let k(d) = -4d*3 - 6d*2 - 2d - 7. Let y(t) = t2 - 7. Let o be y(3). Let i(x) = x3 + 2x2 + x + 2. What is ok(q) + 7i(q)? -q3 + 2q*2 + 3q Let b(y) = -9y + 4. Let l = -60 - -59. Let a(f) = -f + 1. Calculate lb(m) + 5a(m). 4m + 1 Let j(l) = -2l2 - 5l*3 + 10 + 12l*2 + 7l*3 + 2l3. Let q(r) = -r3 - 3r2 - 3. Determine -6j(o) - 20q(o). -4o3 Let h(k) = k2 - 4k + 4. Let o(y) = -11y + 3. Let s(u) = -7u + 2. Let z(m) = -5o(m) + 8s(m). What is h(q) - 5z(q)? q*2 + q - 1 Let k(o) = 6o*2 - 5o - 2. Suppose 3s = -2t + 14, -4s = -3 - 5. Let m(g) = 3g - 5g + 5g + 3g - 7g*2 + 2. What is tm(i) + 5k(i)? 2i*2 - i - 2 Let j(s) = -4s*2 - 3s + 10. Let y(i) = -i*2 - i + 1. Give j(d) - 2y(d). -2d2 - d + 8 Let i be ((-36)/6)/(-6) - (-4)/(-2). Let t(u) = 2u*3 - 3u*2 - 4u + 4. L	{ "pile_set_name": "DM Mathematics" }
reatest common divisor of 2912604 and 5111562. 5802 Calculate the highest common factor of 61971618 and 38379. 3489 Calculate the highest common divisor of 348 and 88156868. 116 Calculate the greatest common divisor of 27987354 and 72. 18 Calculate the highest common factor of 5357592 and 8352. 72 Calculate the highest common divisor of 609808 and 8208. 16 What is the highest common factor of 2950287347 and 3199? 3199 Calculate the highest common factor of 84 and 1552923260. 28 Calculate the highest common divisor of 59595 and 686370. 2055 What is the greatest common factor of 29388 and 2010288? 372 Calculate the highest common divisor of 216 and 24049710. 54 Calculate the highest common factor of 25220442 and 1092. 78 What is the greatest common factor of 36110 and 2761610? 230 What is the highest common factor of 2663334 and 744? 186 Calculate the greatest common factor of 361176 and 91188. 1788 Calculate the greatest common divisor of 1472277 and 48117. 129 Calculate the highest common divisor of 155674 and 45982. 554 What is the highest common divisor of 35168600 and 4300? 100 Calculate the highest common factor of 11913 and 1803461. 209 Calculate the greatest common factor of 16272 and 26181. 9 Calculate the greatest common divisor of 953150 and 71053. 1733 Calculate the highest common factor of 43708 and 256466. 98 Calculate the greatest common factor of 29330392 and 5369. 91 Calculate the greatest common factor of 995907 and 622017. 3399 What is the greatest common factor of 78977030 and 528? 22 What is the greatest common divisor of 10871 and 133? 7 Calculate the highest common divisor of 37502 and 10370. 34 Calculate the greatest common factor of 167552 and 201960. 1496 Calculate the greatest common divisor of 507465 and 2854845. 2835 Calculate the highest common factor of 445 and 258310. 5 Calculate the highest common factor of 64 and 11489744. 16 Calculate the greatest common factor of 25021692 and 936. 36 Calculate the highest common factor of 23180 and 3627252. 76 Calculate the highest common divisor of 417 and 10607507. 139 Calculate the greatest common factor of 263902836 and 488. 244 What is the highest common factor of 347 and 24387507? 347 Calculate the greatest common factor of 14529151 and 152425. 6097 What is the highest common divisor of 517693 and 349257? 2477 Calculate the highest common factor of 1589 and 12982357. 227 What is the highest common factor of 46756995 and 75? 15 Calculate the highest common divisor of 247821 and 77. 7 Calculate the greatest common factor of 9894 and 139332. 102 What is the greatest common factor of 663052 and 31980? 2132 Calculate the greatest common divisor of 9315 and 2483540. 115 Calculate the highest common factor of 38052 and 389127. 453 Calculate the highest common factor of 146800227 and 196. 49 Calculate the highest common divisor of 8150365 and 6200. 155 What is the greatest common divisor of 28012602 and 120? 6 What is the greatest common factor of 26485 and 12612157? 5297 What is the greatest common divisor of 37164 and 75212? 4 What is the highest common factor of 20 and 261925860? 20 Calculate the greatest common divisor of 57036 and 40446. 42 What is the highest common factor of 106176879 and 81? 27 Calculate the highest common divisor of 1362 and 22648471. 227 Calculate the greatest common factor of 1379667 and 26865. 597 What is the greatest common factor of 4510335 and 303711? 4533 What is the highest common divisor of 211667408 and 8? 8 What is the highest common divisor of 1970534688 and 912? 912 What is the greatest common divisor of 882 and 110439? 63 Calculate the highest common divisor of 85714760 and 60. 20 What is the highest common divisor of 17117964 and 423? 423 Calculate the highest common divisor of 396421300 and 2900. 2900 Calculate the greatest common factor of 194370783 and 1371. 1371 Calculate the greatest common factor of 20099782 and 1016. 254 What is the greatest common divisor of 3737 and 560143? 37 Calculate the highest common factor of 60085410 and 1036. 518 Calculate the highest common factor of 1178 and 225810510. 62 What is the highest common divisor of 103014 and 5319? 9 Calculate the greatest common factor of 308 and 3107468. 28 What is the greatest common factor of 711 and 1513603818? 711 Calculate the highest common factor of 83079380 and 9920. 620 What is the greatest common divisor of 352432854 and 126? 18 Calculate the highest common factor of 30475 and 35250300. 1325 What is the highest common factor of 41785589 and 89? 89 Calculate the greatest common divisor of 991632 and 1908552. 6792 Calculate the highest common factor of 1037 and 182720437. 1037 What is the greatest common factor of 350076777 and 87? 87 Calculate the greatest common divisor of 89223440 and 46. 46 What is the greatest common divisor of 2153598 and 14442? 174 What is the highest common divisor of 230116 and 1828? 4 What is the greatest common factor of 36 and 54802161? 9 What is the greatest common factor of 2709 and 2607993? 387 Calculate the highest common divisor of 73442499 and 52. 13 Calculate the greatest common divisor of 347903347 and 33. 11 Calculate the greatest common factor of 16218 and 374238. 306 What is the greatest common divisor of 55081 and 109385068? 2899 What is the highest common factor of 58464 and 74242? 14 Calculate the greatest common factor of 504 and 48485654. 14 Calculate the highest common divisor of 3589 and 16199. 97 Calculate the greatest common divisor of 15221474 and 10809. 1201 Calculate the greatest common factor of 55753179 and 3399. 309 Calculate the greatest common factor of 16986 and 6544080. 894 Calculate the highest common factor of 5088257 and 2489. 19 What is the greatest common factor of 624 and 62057073? 39 What is the greatest common divisor of 735 and 3853899? 147 Calculate the greatest common factor of 32144 and 2256968. 2296 Calculate the highest common divisor of 7826 and 248794. 182 What is the highest common factor of 3452779 and 1012? 11 Calculate the highest common factor of 3394160 and 16940. 1540 What is the highest common divisor of 5974 and 20523677? 2987 What is the highest common factor of 1414 and 9223118? 202 Calculate the greatest common divisor of 44858023 and 4681. 4681 What is the greatest common divisor of 69257384 and 3976? 56 What is the highest common factor of 6008683 and 59677? 719 What is the highest common divisor of 540 and 455505390? 270 Calculate the greatest common factor of 3393008 and 294026. 2602 Calculate the greatest common factor of 885 and 2736630. 15 Calculate the greatest common divisor of 286192 and 372. 124 What is the highest common divisor of 18834 and 130935? 129 Calculate the highest common factor of 608992 and 10. 2 Calculate the highest common divisor of 69666 and 14265138. 4098 What is the greatest common divisor of 2820180 and 2376? 132 Calculate the greatest common divisor of 84444 and 534. 6 What is the highest common divisor of 22771908 and 34? 34 What is the greatest common divisor of 789 and 206180691? 789 What is the highest common factor of 4725708 and 20917? 13 What is the highest common divisor of 109995479 and 2761? 2761 What is the highest common divisor of 30722649 and 804? 201 Calculate the greatest common factor of 11861070 and 11310. 390 What is the greatest common factor of 184900770 and 8136? 2034 What is the highest common factor of 98 and 27290? 2 What is the highest common divisor of 49268 and 1093052? 436 What is the greatest common factor of 3244795 and 2373? 113 Calculate the highest common divisor of 27 and 6046792452. 27 What is the greatest common factor of 129766 and 181286? 322 What is the highest common factor of 34049106 and 2786? 14 What is the greatest common divisor of 25745123 and 6? 1 Calculate the greatest common factor of 348777 and 683462. 3523 What is the highest common divisor of 106714 and 181826? 458 Calculate the greatest common divisor of 9213 and 1401621. 249 What is the greatest common divisor of 294 and 2008498044? 294 What is the highest common divisor of 4678012 and 17404? 916 Calculate the highest common divisor of 7419820 and 1727. 157 Calculate the greatest common divisor of 780 and 325472030. 130 Calculate the highes	{ "pile_set_name": "DM Mathematics" }
1863? 81 What is the highest common divisor of 5 and 1255? 5 Calculate the greatest common factor of 112 and 392. 56 Calculate the greatest common factor of 697 and 1025. 41 What is the highest common divisor of 285 and 1520? 95 What is the highest common divisor of 114 and 18? 6 What is the greatest common divisor of 119 and 21? 7 Calculate the highest common factor of 5 and 10. 5 What is the highest common divisor of 288 and 9? 9 What is the greatest common factor of 30 and 5286? 6 Calculate the highest common factor of 637 and 52. 13 What is the highest common factor of 3484 and 156? 52 What is the highest common factor of 750 and 30? 30 What is the greatest common factor of 11968 and 170? 34 What is the highest common factor of 112 and 42? 14 What is the highest common factor of 192 and 416? 32 What is the highest common divisor of 100 and 1050? 50 Calculate the greatest common factor of 90 and 570. 30 Calculate the greatest common divisor of 406 and 196. 14 What is the highest common factor of 326 and 163? 163 What is the greatest common divisor of 154 and 868? 14 What is the highest common factor of 759 and 2760? 69 What is the greatest common factor of 473 and 301? 43 What is the highest common divisor of 121 and 11? 11 What is the greatest common factor of 2252 and 4? 4 What is the highest common divisor of 74 and 2590? 74 What is the highest common factor of 1717 and 238? 17 What is the greatest common factor of 192 and 1424? 16 What is the greatest common divisor of 689 and 260? 13 What is the greatest common factor of 810 and 45? 45 What is the greatest common factor of 267 and 9? 3 Calculate the highest common factor of 1001 and 99. 11 Calculate the highest common divisor of 42 and 4431. 21 Calculate the highest common factor of 720 and 450. 90 What is the greatest common divisor of 152 and 874? 38 What is the highest common factor of 24 and 138? 6 What is the greatest common factor of 55 and 1375? 55 Calculate the highest common factor of 144 and 16. 16 Calculate the greatest common divisor of 300 and 36. 12 What is the greatest common factor of 13 and 481? 13 Calculate the greatest common divisor of 117 and 18. 9 Calculate the highest common divisor of 12 and 36492. 12 What is the highest common divisor of 3653 and 117? 13 What is the greatest common factor of 6004 and 152? 76 What is the greatest common divisor of 465 and 5394? 93 What is the greatest common factor of 24310 and 561? 187 What is the greatest common factor of 69 and 621? 69 Calculate the greatest common divisor of 23978 and 38. 38 Calculate the greatest common divisor of 114 and 15. 3 What is the greatest common divisor of 2466 and 90? 18 What is the highest common factor of 12 and 1464? 12 Calculate the greatest common divisor of 189 and 7. 7 What is the greatest common factor of 336 and 8112? 48 Calculate the highest common divisor of 384 and 1116. 12 Calculate the highest common factor of 442 and 51. 17 What is the greatest common factor of 4 and 772? 4 Calculate the greatest common factor of 59 and 4012. 59 What is the greatest common divisor of 138 and 1863? 69 Calculate the greatest common divisor of 75 and 700. 25 Calculate the greatest common divisor of 66 and 231. 33 What is the highest common factor of 1793 and 33? 11 Calculate the highest common divisor of 492 and 41. 41 What is the highest common factor of 713 and 31? 31 Calculate the greatest common factor of 561 and 714. 51 Calculate the greatest common divisor of 1376 and 256. 32 Calculate the greatest common factor of 31 and 4. 1 What is the highest common factor of 494 and 338? 26 What is the greatest common factor of 290 and 1170? 10 Calculate the greatest common divisor of 890 and 8544. 178 Calculate the highest common factor of 28 and 308. 28 Calculate the greatest common factor of 94 and 2021. 47 Calculate the greatest common factor of 36 and 225. 9 What is the greatest common divisor of 90 and 4842? 18 What is the highest common factor of 84 and 348? 12 What is the highest common divisor of 385 and 1617? 77 What is the greatest common divisor of 10 and 166? 2 What is the greatest common divisor of 14 and 24094? 14 What is the highest common divisor of 18 and 774? 18 What is the highest common divisor of 42 and 60? 6 Calculate the greatest common factor of 2700 and 648. 108 What is the highest common divisor of 767 and 1003? 59 Calculate the greatest common divisor of 7 and 511. 7 Calculate the greatest common factor of 14 and 196. 14 What is the greatest common factor of 14 and 378? 14 What is the greatest common divisor of 17 and 4760? 17 What is the highest common divisor of 407 and 296? 37 Calculate the greatest common factor of 3724 and 1216. 76 What is the greatest common divisor of 42 and 162? 6 Calculate the highest common divisor of 18512 and 89. 89 What is the highest common divisor of 289 and 493? 17 Calculate the greatest common factor of 2488 and 96. 8 Calculate the highest common divisor of 10 and 530. 10 Calculate the highest common factor of 7 and 1036. 7 What is the greatest common divisor of 10 and 670? 10 What is the highest common factor of 11 and 3? 1 What is the greatest common divisor of 2 and 227? 1 Calculate the greatest common factor of 115 and 207. 23 What is the greatest common divisor of 162 and 90? 18 What is the greatest common factor of 4065 and 15? 15 Calculate the highest common factor of 368 and 64. 16 Calculate the highest common divisor of 7442 and 488. 122 Calculate the highest common factor of 40 and 116. 4 What is the highest common divisor of 20 and 148? 4 What is the greatest common divisor of 33 and 561? 33 What is the highest common factor of 2418 and 31? 31 What is the highest common factor of 208 and 5642? 26 Calculate the highest common factor of 1782 and 132. 66 Calculate the greatest common factor of 27 and 53676. 27 What is the highest common divisor of 320 and 192? 64 Calculate the greatest common factor of 1806 and 129. 129 What is the highest common divisor of 684 and 570? 114 What is the highest common factor of 19 and 171? 19 What is the greatest common factor of 15 and 59835? 15 Calculate the highest common factor of 790 and 1422. 158 Calculate the highest common factor of 42 and 56. 14 What is the greatest common factor of 190 and 6? 2 What is the greatest common divisor of 784 and 112? 112 Calculate the greatest common factor of 209 and 11. 11 What is the highest common divisor of 1010 and 5858? 202 Calculate the greatest common factor of 1035 and 46. 23 Calculate the greatest common divisor of 15659 and 7. 7 What is the greatest common factor of 108 and 1080? 108 What is the greatest common divisor of 105 and 540? 15 What is the highest common divisor of 235 and 5? 5 Calculate the greatest common factor of 175 and 805. 35 Calculate the greatest common factor of 483 and 1554. 21 What is the greatest common factor of 779 and 133? 19 What is the highest common factor of 3478 and 851? 37 Calculate the highest common divisor of 102 and 12. 6 Calculate the highest common divisor of 212 and 583. 53 What is the highest common factor of 49 and 84? 7 Calculate the highest common factor of 16677 and 153. 153 What is the highest common divisor of 286 and 33? 11 Calculate the highest common divisor of 272 and 918. 34 Calculate the highest common factor of 1044 and 108. 36 What is the greatest common factor of 74 and 666? 74 What is the highest common divisor of 62 and 2? 2 Calculate the greatest common factor of 30864 and 48. 48 Calculate the highest common factor of 5202 and 18. 18 Calculate the highest common divisor of 522 and 72. 18 What is the highest common divisor of 376 and 799? 47 Calculate the highest common factor of 16 and 24. 8 Calculate the greatest common factor of 30 and 4890. 30 Calculate the highest common factor of 243 and 1. 1 What is the greatest common divisor of 4 and 4? 4 What is the greatest common divisor of 179 and 88963? 179 Calculate the greatest common divisor of 559 and 65. 13 What is the highest common factor of 55 and 3520? 55 What is the highest common factor of 15 and 35? 5 Calculate the highest common factor of 2224 and 272. 16 What is the greatest common divisor of 12025 and 39? 13 Calculate the greatest co	{ "pile_set_name": "DM Mathematics" }
is positive. k(305/84) Simplify ((q(-4)/q*(-3)(q0)(-8/15))14)(-2/29) assuming q is positive. q*(28/29) Simplify (oo(((o(10/3)/o)/o)/o)/oo*(13/2)o/(o*(-2/13)o)o2)43 assuming o is positive. o(33497/78) Simplify ((((q/q(-20)q)/q(-30))(-34))(36/11))(-50) assuming q is positive. q(3182400/11) Simplify ((j(-2)j(-6))/((jj*(1/4)j)/j(2/5)))/(j(-3)/(j/j(-3/2)))(2/27) assuming j is positive. j*(-5099/540) Simplify ((q(qq/(qq(-2/5)))/q)(1/37)q/(qq/q*8)qq3q)(-4/13) assuming q is positive. q(-8908/2405) Simplify ((((c*(-2/3)c)/c)/c)/cc(-2)c*(-3)cc1)/(c(1/3)/c0(c/c4)/((c3c)/c)) assuming c is positive. 1 Simplify d(1/5)/((d(-1)/d)/d)(d(1/2))46((dd(-2/5))/(((d/d(-1/6))/d)/d))/(d*0d/((d/d*(-2/19))/d)d) assuming d is positive. d*(14671/570) Simplify ((qqqq*(-34)q)/q)*(2/13)/(q/((qq*(-9/8)q)/qq)qq(-9/4)q) assuming q is positive. q(-483/104) Simplify (((v(-5/2))(-46))(-37))(-4/39) assuming v is positive. v(17020/39) Simplify (t(-1)/(t(2/9)/t))(-1/14)/((t/(t/t(-1/3)))*16(((t/(t/(t*(2/3)/t)))/tt)/t)1) assuming t is positive. t(421/63) Simplify (h*(3/4)/(h/(hh/(h(h/(hh*(-3/4)))/hh))))/(h*0/((hh*2)/h))h/h*(-2/7)hh(-2/5)(h/(hhh(1/2)/h))32 assuming h is positive. h(-424/35) Simplify (p(-1/4)/pp/((pp*4)/p)(p(2/7)/p)(-4))/(p/(pp(2/11))p*(-1/3)/pp/p*(-2/9)p(-1/5)) assuming p is positive. p(-12473/13860) Simplify yy/y(-4/5)yyy*0y(y(-2)y)/y*(-7)(((y/(y/y*(-1/3)))/y)/y)/yy*7/y(y(1/3)/y)(1/2) assuming y is positive. y(212/15) Simplify ((o5oo)*33/(oo*7oo(-1/19)))(13/6) assuming o is positive. o(54847/114) Simplify i(2/11)/((i/((i/(i(1/11)/i))/i))/i)(ii/((ii/i(-2/9))/i))(1/4)((i(i*(3/2)i)/i)26)38 assuming i is positive. i(978629/396) Simplify (((k(-7)/k)/k)/kkk*(-3/5)(kk(-1/4)k)(-30))/((k(2/3)/(k(-2/15)/k))/(k/k1)(-2/27)) assuming k is positive. k(-639/10) Simplify ((w*4/(((ww18)/w)/w))/(w7w)(-1/81))(-40) assuming w is positive. w(41800/81) Simplify (q/q(-1/3)q)(-37)/(q3q(-7/5))((q/q*(-2/7))/qq)22/(q/q1)(-22) assuming q is positive. q(-6263/105) Simplify (aaa(aa/(a/(a(-6/13)/a)))/a)/a(-8)(a(-7))(2/9) assuming a is positive. a(934/117) Simplify j(-4)jjjj/(j/(j/j(1/6)))j/((jjj*(-7)/j)/j)(jj/j(-4/7))/j((j*(2/5)j)/(jj/j9jj))/(jj(1/3))(-27) assuming j is positive. j(10879/210) Simplify (y(5/7))(-39)/(y(-13/3)((y/((y(-43)y)/y))/y)/y) assuming y is positive. y(-1376/21) Simplify ((q(-4)q)10)(-1/31)/((q(qqq/q*5)/qq0)/(q(-4)q/q(-9))) assuming q is positive. q(278/31) Simplify ((rr*(-1)r)(-43)/(r1)(-2/81))/(((r/r(-1))/rr3r)/(rr0)(-24)) assuming r is positive. r(-5830/81) Simplify ((uuu(uu(-10))/u)/u(-2)u((u/u2)/u)/uuu(-2/9)/u)(-10) assuming u is positive. u(650/9) Simplify ((z(-5)/(z/z(-15)))/((z/(zz10))/(z/(z(5/7)/z))))(-13) assuming z is positive. z(884/7) Simplify q(1/7)/q(-5/13)(q(-21))(-2/103) assuming q is positive. q(8766/9373) Simplify (((r(rr(2/13)r)/rr)/r)(-2/31)(r*(-3/5)r)(-13/4))(-31) assuming r is positive. r(5799/130) Simplify (d/(d/d0))*(-47)(dd/(dd*1))/((dd*(-7))/d)(d*(-2/13)d(d(-3)/d)/d)/(d/d(-6)d*(-2/5)dd) assuming d is positive. d(-374/65) Simplify (v/v(2/5))/vv*4((vv1/v)/vv)*(13/6)(v*7((vv/(vvv(v/(v/((v*(-6)v)/vv)vv))/vv))/v)/v)/(v1)(-43) assuming v is positive. v(1793/30) Simplify ((x(1/2)/(x*(-5)/x))/((xx*(-2))/((x/((xx3/x)/x))/x)))/((x/x(-1/3))(-37)/(x/x(-4)x/((x/(x/x(2/19)x))/x))) assuming x is positive. x(7151/114) Simplify ((f2/f)*(-4/31)((f/(f/(ff(-8/5)ff)))/f)/f((f/f4)/f)/f)(-42) assuming f is positive. f(37296/155) Simplify (x9x(6/11)x/(x/x*(-1/4))xx/(x(-4)x))/((xx((xxx(x/(xx*(-4/3))x)/x)/x)/x)(1/49))(-2/81) assuming x is positive. x*(7490647/523908) Simplify (((((b/(bbb(-1)b))/b)(-21))(2/161))34)(2/5) assuming b is positive. b(816/115) Simplify (q6q(-4/5))(-1/18)/((q(-1))45/(q(-2/11)q(2/17))) assuming q is positive. q(375704/8415) Simplify ((t/(tt/(t7ttt)))*(-40)t*(-8/5)/((t/(t(t/(t(7/3)/t))/t))/t))(-18/7) assuming t is positive. t(32574/35) Simplify (((q(-14)q)/qq)/(qq(-37)/q)q(3/4)/(q(-3/4)/q))49 assuming q is positive. q(2597/2) Simplify ((hhh(1/5))/h(4/3))*(-3/23)(hh/h(-2/7)hhhh(-2/9)h)/(h0)32 assuming h is positive. h*(43111/7245) Simplify ((kk(6/5))/(k3/kkk)(kkkk*11k)/k(-8))(-3/25) assuming k is positive. k(-318/125) Simplify (s(-1/14)/sss(sss23s)/ssss((s*(2/9)s)/s)(-34))(1/3) assuming s is positive. s(2693/378) Simplify (j(12/11))*(-8)(j(2/35))(-37) assuming j is positive. j*(-4174/385) Simplify ((((tt(-7))(-1/46))(-12))(-39/5))28 assuming t is positive. t(39312/115) Simplify ((o(-15))(-3/16)(o8/o)/ooo/(o/((oo*(-34))/o)o)o)17 assuming o is positive. o(-6579/16) Simplify (((q4/q)/q)(-49))(-33)(q10/q(-2/15))(-1) assuming q is positive. q(48358/15) Simplify (aa(-4/19)aa16)/(a/a(-28)aa)(-18) assuming a is positive. a(10940/19) Simplify (l/(lll0))/(l(3/2)/l)ll/l(-1/2)l(-34) assuming l is positive. l(-33) Simplify ((i(1/2))22/(i(1/3))(-11))(-1/58) assuming i is positive. i(-22/87) Simplify (gg(-3)g*(-3)g/g*(-3/7)gg(1/3))/((g6/g)/(gg(-3)))(-10/9) assuming g is positive. g(349/63) Simplify (h(-2/3)/(h(-3/4)/h))/(h(-8)/h*(2/35))((h/(h/(h/h*1)h))/h)*46((hh(4/3))/hh)/h(7/2) assuming h is positive. h(-35291/420) Simplify (a*(-2/7)aa3)(-5)/(a(-2/9)/(a/(a((a((a/a3)/a)/a)/a)/a))(aa(2/7))(1/20)) assuming a is positive. a(-16901/1260) Simplify ((h/h(-6))/(h(1/2)/h))(-3/26)h*(-1/2)h*(-1/4)((hh(-2))/hh)(-3/11) assuming h is positive. h(-192/143) Simplify ((d/d(-2))(1/6))*(-34)((d(1/9)/d)/d7)(-21/2) assuming d is positive. d(395/6) Simplify ((nn3n(2/5))/((n/n(-1))/n*(-4)))/((nn(-3))/(n/n(-3/4)))(-9/11) assuming n is positive. n(-1027/220) Simplify (((c(4/3)/(c(-3/4)/c))/(c/(ccc*2c))0)(-2/9))(-42) assuming c is positive. c(259/9) Simplify (s*4/(ss(-4)))/(s(-5/6)/(s/s*(-2/9)))(s(-1))(6/13)/(s*(-6)ss/(s(-2/7)s)) assuming s is positive. s(21799/1638) Simplify (((g/g3)/g4)/((g(-3)g)/g(-5)))/((ggg(-1)ggg)(12/7)/(g(-4)ggg7/g)) assuming g is positive. g(-83/7) Simplify (((((ii*(2/9))/i)/i)/(i((ii(-3))/i)/ii))/(ii0)(-4/5))/(((i(-3/5)i)/(ii(6/7)))/(i3i/((ii(-1)ii)/i))) assuming i is positive. i(2041/315) Simplify (l(-1/4)/(l(-5/4)/l))/((l(-5)/l)/l(-5))((lll*(-1)/ll)/lll*(-2/3)/ll)/(l(-1/2))(-22) assuming l is positive. l(-23/3) Simplify ((((x/(x/(x(-1)/x)))/((x(x/(xx*(-4/11)))/xx)/x))/((x*2x)/(xxxx/(xx/(x*(-9)/xx))x)))6)(-4/13) assuming x is positive. x(3000/143) Simplify (((qq*(2/11))/q)/q)/(qq*(-2/9))(q/(q*(-10)q))/(q/(q/q39)) assuming q is positive. q(-3029/99) Simplify ((o*(-6)/o)/(oo*(-2/5)/ooo))/((o/(o/o7))/o(-2/7))o(-3)/o(2/7)(oo(-1))(-5/4) assuming o is positive. o*(-671/35) Simplify (((u(u/u*(1/3))/uu)/(uu/u(1/6)))/((((u((u*(-4)u)/u)/uu)/uuu)/u)/uu(-4)))/(u6uu4)(17/6) assuming u is positive. u(-70/3) Simplify (p(-5/6)/(p5/p))/(p(1/4)/(pp(-6)))((p/p(-1/3))/p)(-29)p5/p(-1/4) assuming p is positive. p(-29/2) Simplify (h(-8)hh/h2)/(h(18/7)h27) assuming h is positive. h(-263/7) Simplify (y*5y*(-10)y*(3/4)y/y(-1/6))(-30) assuming y is positive. y(185/2) Simplify (((r/(r/r(-1)))/(r/(rr(-1/6)r)))/((r/r*(3/5))/(rrr3)))/((rrrr*(1/4)rr)(-38)r*(-1)/rr/r(4/9)) assuming r is positive. r(9242/45) Simplify ii(3/4)iiii8i(i/i(-3/2)i)/i(i/(ii/i*(-1)))/i((i(-2/3))(-4))**(-14) assuming i	{ "pile_set_name": "DM Mathematics" }
3? 2 What is the millions digit of 2325467? 2 What is the hundreds digit of 136278? 2 What is the ten thousands digit of 110204? 1 What is the thousands digit of 32844? 2 What is the ten thousands digit of 97321? 9 What is the hundreds digit of 114756? 7 What is the hundreds digit of 3125046? 0 What is the tens digit of 187455? 5 What is the tens digit of 942374? 7 What is the thousands digit of 265076? 5 What is the thousands digit of 5258960? 8 What is the units digit of 7602122? 2 What is the millions digit of 1629266? 1 What is the hundred thousands digit of 138775? 1 What is the millions digit of 1543291? 1 What is the millions digit of 14006021? 4 What is the hundreds digit of 320928? 9 What is the tens digit of 1374481? 8 What is the ten thousands digit of 13840056? 4 What is the ten thousands digit of 523286? 2 What is the ten thousands digit of 1268383? 6 What is the units digit of 1246064? 4 What is the thousands digit of 18769543? 9 What is the units digit of 284323? 3 What is the tens digit of 139312? 1 What is the thousands digit of 602590? 2 What is the tens digit of 1461699? 9 What is the tens digit of 47964? 6 What is the units digit of 29857469? 9 What is the units digit of 3413898? 8 What is the hundreds digit of 1622070? 0 What is the ten thousands digit of 10789331? 8 What is the tens digit of 3905141? 4 What is the tens digit of 27125406? 0 What is the tens digit of 226611? 1 What is the hundreds digit of 424384? 3 What is the ten thousands digit of 1065836? 6 What is the thousands digit of 12963999? 3 What is the units digit of 3936? 6 What is the hundreds digit of 604744? 7 What is the units digit of 11276070? 0 What is the units digit of 207035? 5 What is the thousands digit of 216554? 6 What is the tens digit of 741054? 5 What is the hundreds digit of 17354718? 7 What is the hundred thousands digit of 2506004? 5 What is the ten thousands digit of 16733775? 3 What is the units digit of 300902? 2 What is the millions digit of 5748351? 5 What is the hundreds digit of 12609928? 9 What is the ten thousands digit of 27079? 2 What is the ten thousands digit of 691222? 9 What is the hundred thousands digit of 331118? 3 What is the tens digit of 1312478? 7 What is the ten thousands digit of 521577? 2 What is the ten thousands digit of 2135651? 3 What is the hundreds digit of 312380? 3 What is the ten millions digit of 10402952? 1 What is the units digit of 836094? 4 What is the thousands digit of 22429? 2 What is the millions digit of 11352165? 1 What is the hundreds digit of 3664693? 6 What is the hundreds digit of 309056? 0 What is the tens digit of 388041? 4 What is the thousands digit of 190389? 0 What is the tens digit of 27802? 0 What is the hundreds digit of 369475? 4 What is the units digit of 10021303? 3 What is the hundred thousands digit of 385635? 3 What is the ten thousands digit of 11619013? 1 What is the hundreds digit of 1292429? 4 What is the hundreds digit of 33789036? 0 What is the tens digit of 5642344? 4 What is the millions digit of 2296810? 2 What is the hundreds digit of 6039913? 9 What is the hundreds digit of 4623467? 4 What is the ten thousands digit of 212792? 1 What is the tens digit of 47891? 9 What is the thousands digit of 15565082? 5 What is the tens digit of 751952? 5 What is the ten thousands digit of 987952? 8 What is the ten thousands digit of 1674456? 7 What is the millions digit of 20967050? 0 What is the ten thousands digit of 1351099? 5 What is the ten thousands digit of 156878? 5 What is the hundreds digit of 487940? 9 What is the units digit of 29170406? 6 What is the thousands digit of 4263275? 3 What is the hundred thousands digit of 31154304? 1 What is the thousands digit of 2331583? 1 What is the hundreds digit of 1300737? 7 What is the thousands digit of 11130781? 0 What is the hundreds digit of 2814048? 0 What is the units digit of 1125901? 1 What is the hundred thousands digit of 3852319? 8 What is the tens digit of 148654? 5 What is the units digit of 3543456? 6 What is the hundreds digit of 21029948? 9 What is the thousands digit of 242075? 2 What is the units digit of 1275898? 8 What is the ten millions digit of 11419739? 1 What is the thousands digit of 11829532? 9 What is the hundreds digit of 94993? 9 What is the hundreds digit of 2439592? 5 What is the units digit of 874605? 5 What is the ten millions digit of 18768220? 1 What is the hundreds digit of 371810? 8 What is the thousands digit of 123548? 3 What is the thousands digit of 480497? 0 What is the thousands digit of 3308215? 8 What is the tens digit of 9649589? 8 What is the hundred thousands digit of 219992? 2 What is the tens digit of 1065146? 4 What is the ten thousands digit of 73110? 7 What is the tens digit of 927039? 3 What is the units digit of 62051? 1 What is the units digit of 1183550? 0 What is the units digit of 261609? 9 What is the hundred thousands digit of 278340? 2 What is the ten thousands digit of 97580? 9 What is the tens digit of 56487? 8 What is the millions digit of 1656890? 1 What is the thousands digit of 18557919? 7 What is the thousands digit of 1417039? 7 What is the units digit of 14595? 5 What is the tens digit of 19657876? 7 What is the hundreds digit of 2767998? 9 What is the thousands digit of 393325? 3 What is the units digit of 484128? 8 What is the ten thousands digit of 516740? 1 What is the ten thousands digit of 115805? 1 What is the ten thousands digit of 85056? 8 What is the hundred thousands digit of 1825137? 8 What is the hundreds digit of 21147116? 1 What is the ten thousands digit of 84909? 8 What is the hundred thousands digit of 817609? 8 What is the thousands digit of 5378325? 8 What is the hundreds digit of 1685998? 9 What is the ten thousands digit of 634911? 3 What is the ten thousands digit of 21712269? 1 What is the millions digit of 2809487? 2 What is the ten millions digit of 33333880? 3 What is the thousands digit of 19675313? 5 What is the ten thousands digit of 1253638? 5 What is the tens digit of 4209440? 4 What is the hundreds digit of 2017105? 1 What is the hundreds digit of 3222084? 0 What is the units digit of 667358? 8 What is the units digit of 709567? 7 What is the thousands digit of 1733456? 3 What is the thousands digit of 6289808? 9 What is the ten thousands digit of 1163531? 6 What is the hundreds digit of 173324? 3 What is the ten thousands digit of 4270026? 7 What is the tens digit of 1384162? 6 What is the tens digit of 519201? 0 What is the hundreds digit of 15338705? 7 What is the hundreds digit of 843339? 3 What is the thousands digit of 5460993? 0 What is the hundred thousands digit of 149309? 1 What is the hundreds digit of 5133147? 1 What is the ten thousands digit of 17648807? 4 What is the hundred thousands digit of 385353? 3 What is the ten thousands digit of 235192? 3 What is the hundred thousands digit of 943750? 9 What is the ten thousands digit of 357277? 5 What is the units digit of 1097205? 5 What is the hundred thousands digit of 8561878? 5 What is the thousands digit of 225794? 5 What is the thousands digit of 5764045? 4 What is the units digit of 664302? 2 What is the units digit of 2196551? 1 What is the units digit of 108609? 9 What is the hundred thousands digit of 348547? 3 What is the ten thousands digit of 112786? 1 What is the tens digit of 7245432? 3 What is the millions digit of 2266799? 2 What is the millions digit of 10054465? 0 What is the tens digit of 1400903? 0 What is the tens digit of 5363087? 8 What is the hundred thousands digit of 902821? 9 What is the tens digit of 448674? 7 What is the ten thousands digit of 2542190? 4 What is the hundreds digit of 207499? 4 What is the units digit of 35573? 3 What is the hundreds digit of 478101? 1 What is the thousands digit of 5462210? 2 What is the ten thousands digit of 1026819? 2 What is the units digit of 662292? 2 What is the thousands digit of 1246065? 6 What is the thousands digit of 481530? 1 What is the tens digit of 37007463? 6 What is the units digit of 1266462? 2 What is the ten millions digit of 14808017? 1 What is the hundred thousands digit of 9581472? 5 What is the ten thousands digit of 68427? 6 What is the tens digit of 81260? 6 What is the thou	{ "pile_set_name": "DM Mathematics" }
= -6 - -10. Let w = 7 - q. Suppose -15 = -r - m, wm = 4r + 4m - 45. Is r prime? False Let a(z) = z + 3. Let i be a(-3). Let r be -3 + i/(-3) + 0. Let d(o) = -3o*3 + 3o*2 - o. Is d(r) prime? False Let y(j) = 34j*2 - j + 4. Is y(3) prime? True Suppose 3y - 5w + w - 29 = 0, 9 = -2y - 3w. Suppose -5z = -4n - 253, -3z + 2n = -yn - 144. Is z a prime number? True Suppose 0 = -4k + 2n - 224, 0 = -3k - 2n - 78 - 90. Let a = k - -103. Is a a prime number? True Let b(d) = -4d2 + 7d + 6. Let g(o) = o*3 + 8o2 + o + 4. Let l be g(-8). Let u be b(l). Is (-4)/(-10) - u/10 composite? True Let v(k) = k2 + 5k - 2. Let a be v(-6). Suppose -1 = f + a. Let r = -3 - f. Is r a prime number? True Let o(s) = s3 + 3s*2 - 6s - 3. Let j be o(-4). Suppose 0 = -jn + 25, 0a + 2a - 159 = 3n. Is a a prime number? False Let x(d) = -6d3 - 6d*2 - 2d - 3. Is x(-4) a prime number? True Let p(v) = -v + 7. Let h(o) = o*3 - 10o*2 + 2o - 10. Let l be h(10). Let c = l + -18. Is p(c) prime? False Suppose 0 = -5q + 15. Let w be (-1)/(-3) + (-680)/(-3). Suppose g = -qg - 3y + 320, -3g = -y - w. Is g a composite number? True Let k(c) be the third derivative of c5/30 - c4/8 + 2c3 + c2. Is k(-9) composite? True Is (-4)/123-1465 a composite number? True Let y(f) = 5f - 2. Let t be y(8). Suppose 117 = -5v - t. Let a = 116 + v. Is a prime? False Suppose -a = -3k - 33, 25 = 3a - 3k - 80. Suppose g - 5c = 2g - 18, 4c - 12 = 0. Suppose -2x = 2, j + gx = 2j - a. Is j a composite number? True Let j = 8 + 0. Let m = 73 - j. Is m composite? True Suppose 2k + 22 = 4a, 0 = 4a + 5k + 2 - 3. Let n = 55 + a. Is n a prime number? True Let p be (-6)/(-21) + (-69)/21. Is -34(-1)/2 + p prime? False Let f(c) = -c3 + 8c*2 + 10c - 6. Let z be f(9). Suppose 2n = 3r - 393, -zn - 2 = -11. Is r prime? False Let u = -533 + 991. Is u composite? True Suppose -74 - 101 = -u. Let q be (-5)/(15/(-6)) + u. Suppose 742 = 4o + 3a, -5a + 0a = o - q. Is o prime? False Suppose 5d - 1505 - 80 = 0. Is d a prime number? True Suppose -2z + 2 = 20. Is (-6)/27 - 1307/z prime? False Suppose 3l - 1 = 5, -4c = -5l - 5514. Is c a composite number? False Suppose -3v + 24 = -0v. Let i be ((-3)/(-4))/((-2)/v). Is 5 + 51 - i/1 composite? False Is 2/8 + 104/(-32) + 524 a composite number? False Suppose 0 = 2o - 9 + 3. Suppose 212 = -oh + 7h. Is h a composite number? False Let k(d) = 13d + 16. Is k(15) prime? True Suppose -2w = -672 - 1118. Is w a prime number? False Suppose 0 = 5d + 2s - 27, 0 = 5d - s + 5s - 29. Suppose -4n + 2n = -4t + 590, -dt = -5n - 730. Is t a prime number? True Let p be 2 - 1 - (-142)/2. Let u = 137 - p. Suppose 3a + 0n - 63 = -3n, 0 = -3a - 4n + u. Is a a composite number? False Suppose -c = c - 814. Is c a composite number? True Let o(z) = z3 - z2 - z + 3. Let j be o(0). Let u(h) = 3 - 5h + 7h + 3h + jh. Is u(8) composite? False Let l(k) = -57k + 2. Let d be (-24)/(-9)(-6)/4. Let f be l(d). Suppose 0 = -3y - 2y + f. Is y composite? True Suppose 0 = 2s + s - 429. Is s composite? True Let f = -68 - -330. Is f prime? False Let h = -14 - -27. Is h prime? True Let i(h) = h*2 - 3h + 1. Suppose -2l = -3p + 43, -l = 2p - p - 21. Suppose -5b = -2z - p, -b - 1 = -2b + z. Is i(b) prime? True Suppose y = 3y - 142. Is y prime? True Suppose 3h = z + 2, 3z + h = 6 - 2. Let p be (-96)/3z/2. Is (-4)/(2 - p/(-7)) a prime number? False Let s = -986 + 1653. Is s a composite number? True Let l(f) = f*2 + 4f - 1. Suppose -38 = -5z + 22. Suppose 4s = s + z. Is l(s) a prime number? True Let l = -2211 - -3848. Is l prime? True Suppose 3o - 26 = 5i, 2o - 4i - 7 - 11 = 0. Suppose ou - 2u = 1535. Is u a prime number? True Let x be (-4)/(-3)(-165)/(-2). Let t = -41 + x. Is t a composite number? True Suppose -12 - 36 = -y. Suppose -2t - 2t - y = 0. Let s = t - -43. Is s prime? True Is 1 + -5 + (-9)/3 + 886 composite? True Let j(w) = 8w. Let b = 4 + -2. Let p be j(b). Suppose f - p + 2 = 0. Is f a composite number? True Suppose -3p - 1551 = -3k, 0 = 3k - 4p - 663 - 884. Is k a composite number? False Suppose -9332 = -4o + q, 2q + q - 6999 = -3o. Is o a composite number? False Let k(c) = 2c + 0c + 1 + 0. Let y be k(1). Is (-1)/(0 + y/(-63)) a prime number? False Is (-1 + -289)/(2 + -4) prime? False Let h(b) = -b + 13. Let t be h(11). Let g be -129 + (-1 - t - -1). Let n = -34 - g. Is n composite? False Suppose 2n = -4k + 8k - 276, -75 = -k + 2n. Is k a composite number? False Suppose 9d = 13d - 356. Is d a composite number? False Let l = -143 + 87. Let k = l - -87. Is k prime? True Suppose -x = -4x + 12, 0 = c + 3x - 8069. Is c a prime number? False Suppose -t = 2t - 249. Is t composite? False Let l(s) be the third derivative of -65s4/24 - 2s*2. Suppose -2p + 4m = -2, -3p + m - 1 = -m. Is l(p) prime? False Let d(l) = -8l + 5. Let g(f) = -f2 + 3f - 4. Let i be g(3). Is d(i) prime? True Is (382/(-1))/(-2)1 composite? False Let q = -69 + 237. Suppose -3m + q + 27 = 0. Let v = -28 + m. Is v a prime number? True Let f(m) = m + 1. Let n be f(-8). Let w(a) = -a*3 - 7a*2. Let s be w(n). Suppose 0p - 2p + 6 = s. Is p prime? True Let h(u) = -u3 - u2 - u. Let i be h(-1). Is (1 - (-2)/1)i composite? False Suppose -n - 4d = 2n - 203, 3n - 3d - 210 = 0. Is n prime? False Let u = -11 + 11. Suppose u = 10w - 5w - 785. Is w prime? True Let c(i) = 2i - 16. Let a be c(0). Let f = a - -227. Is f prime? True Let w(z) = -4z - 3. Let u(g) = -g*2 + 4g - 4. Let c be u(4). Is w(c) a composite number? False Is 8253/(-6)2/(-3) a prime number? False Let i(f) = 0 - 3 + f2 - 5 + f. Is i(-6) a composite number? True Let v(q) = 8q + 787. Is v(0) prime? True Suppose 0 = 7q - 306 - 1843. Is q a composite number? False Suppose -5 = 5n, 0 = 2z - n - 3n + 222. Is 2/((-1)/1) - z a composite number? True Suppose 4y = 20, -3h - 25 = -h - 5y. Let b = 8 + -4. Suppose hn = bn - 460. Is n composite? True Suppose -x + 7 = -12. Is (x/(-3))/(10/(-30)) a prime number? True Let l = 361 - 151. Suppose -z + 2c = -l - 144, 2z - 700 = 2c. Let k = z + -81. Is k composite? True Suppose p - n - 533 = 0, -4n = p + p - 1078. Is p prime? False Let l = 14 + -20. Let r be 1/(-1)l - 1. Suppose -20 = -5f + 3v, -rv = -f - 0f - 18. Is f a composite number? False Suppose 0 = 4r + 4 - 16. Suppose -3 = rw - 24. Is (1 + 12)(w + -5) a prime number? False Let m = -14 + 19. Suppose 0h + mh - 395 = 0. Is h composite? False Suppose l = j - 223 - 38, 2j = -2l + 526. Is j composite? True Is 3 + -2 - -13376 a prime number? False Suppose -271 = -x + 2a + 320, -4x + 5a + 2352 = 0. Is x composite? True Let k = 110 + -57. Is k a prime number? True Let i(f) = -27f + 26. Is i(-13) a prime number? False Suppose -2m + 8 = -4m - 3o, -5m = -4o - 26. Suppose 0 = -mt - 0t + 8. Suppose 2s = tk + 8, -s - 4k - k + 11 = 0. Is s a prime number? False Let q(i) = i - 2. Let d be q(2). Suppose d = a - 2h + 69, 2a = 6a + 2h + 236. Let r = 18 - a. Is r a prime number? True Let p(d) = -30d - 1. Is p(-10) composite? True Let x be -3 + 0 + 3 + 1. Is (-1)/(x/(-85)) - -2 a composite number? True Let o = 87 + -137. Let k be ((-12)/(-10))/((-1)/o). Let v = k - 23. Is v a prime number? True Let d(z) = z2 + 9z - 5. Let t be d(-10). Let x(k) = 5k2 + 8. Is x(t) prime? False Let l be (5 - 2)/((-2)/(-50)). Let u = 44 + l. Is u a composite number? True Let a = 44 - 22. Let k = 179 - a. Is k composite? False Suppose 0 = 3x - 7x + 12. Suppose xg - 23 = -2. Is g a prime number? True Let f(v) = 175v - 3. Is f(2) a prime number? True Let f(n) = n + 1. Let h(z) be the first derivative of -2z*2 - 60z - 2. Let b(o) = -3f(o) - h(o). Is b(0) prime? False Let v = 20 + -15. Suppose -3l + i = 4i - 780, -15 = vi. Is l a composite number? False Let n(t) = 20t + 3. Let i be n(-6). Suppose 431 + 345 = -4r. Let w = i - r. Is w composite? True Suppose -3s - 15 = 4k - 0s, 0 = k + s + 4. Let b be 1 + k/(-1) + -2. Is 53 - (-1 + 2)b prime? False Let y be -2 - 1 - (-27 + 2). Is (-3)/15 + y/10 composite? False Suppose o - 304 = -w, 2o + 1213 = 6o + 3*w. Is o composite? True Let j = -16 + 309. Is j pri	{ "pile_set_name": "DM Mathematics" }
-10p + 378 + m = 0. Is p a multiple of 14? True Suppose 0o + 130 = 5o. Let a(m) = -m3 + 25m*2 + 28m - 56. Let r be a(o). Is 0 - r - (-19 + (-2 - -1)) a multiple of 17? False Suppose -730b + 726b - 3024 = 0. Let y = -132 - b. Does 39 divide y? True Let h be ((-4)/122)/((-2)/(-6)). Is ((-14)/4 - h)-394 a multiple of 37? False Suppose -45j = -22687 - 146 - 15867. Does 11 divide j? False Let v = 100 - 105. Is 16 a factor of 4/(-2) - (-52 - v)? False Let p be (-172)/(-10)-1-5 - 0. Let l = -42 + p. Does 22 divide ((-1206)/(-4) - -1)l/55? True Is (-515655)/(-105) + 228/(-39) + (-8)/52 a multiple of 63? False Let l be 670/(-18) - 5/(-90)4. Let j = 41 + l. Suppose -js + 396 = 2s. Does 9 divide s? False Let l = -822 - -1192. Suppose 4j = 4q + 380, 3q - q = 4j - l. Let h = 127 - j. Does 9 divide h? False Let v(r) = -2r + 18. Let i be v(-5). Suppose -5j - 2j = -i. Suppose 3q - jq + 54 = 0. Does 11 divide q? False Let q = 192 - 188. Suppose -qy = -5t + 420, 6t + y = 5t + 84. Is 7 a factor of t? True Suppose 0 = -10w - 2w - 36. Does 39 divide ((-18)/w - -320)/1? False Is ((-21)/(-6) + 10/(-4))5183 a multiple of 73? True Let d be (4 - -4)(-2 + (-10)/(-4)). Suppose -2w - 3 = -5a - 6, -da = 3w - 39. Is 6 a factor of w? False Suppose 23v = 41v - 164268. Is v a multiple of 179? False Suppose 5a + 4f = -0f + 1088, 3a + 5f - 645 = 0. Suppose -b - 5p = -112, b = 3p - 76 + a. Is 6 a factor of b? True Suppose 896n = 902n - 5292. Is n a multiple of 2? True Let a = -356 - -352. Does 9 divide 2/a(-7 + -1201)? False Suppose 34n - 33n = -13086. Let c be 4/14 - n/63. Suppose 0 = -5i - 2g + 368, 3i - c = -2g + 16. Is i a multiple of 12? True Let j(w) = w*2 - 2w - 133. Let x(d) = 2d2 - 30d + 115. Let m be x(5). Does 2 divide j(m)? True Suppose 0 = 505a - 729a + 3088960. Does 10 divide a? True Let x = 28369 - 18727. Does 129 divide x? False Suppose 8p - 12p - 4f + 3180 = 0, -f = -4p + 3160. Is p a multiple of 7? True Let s(j) = -j*3 + 8j*2 + 3j. Let p be s(8). Suppose -20 = 4a - p. Does 14 divide -2 - a(-2 - 196)? True Let k be (0 - 2) + (-9)/(-1). Let q be 10 - ((-230)/69 + 2/6). Suppose -kw - 1014 = -qw. Is 13 a factor of w? True Suppose u - 16 = -2f, 4f - 75 = -5u - f. Suppose 0 = i - 3d - 11, i + 2d - 6d - u = 0. Suppose 4m + im = 180. Does 10 divide m? True Suppose -15s = -40s + 21s. Suppose -60o + 54o + 840 = s. Does 14 divide o? True Let w(g) be the second derivative of -g5/5 - g3/3 - 4g*2 + 57g. Is w(-4) a multiple of 16? True Let q(v) = -5v - 239. Let s be q(-47). Let a(j) = -6j*3 - 8j*2 - 12j - 14. Is a(s) a multiple of 4? False Let j(g) be the first derivative of 4g3 - 7g*2 - 19g + 13. Let y(t) be the first derivative of j(t). Is 21 a factor of y(12)? False Let v(c) = 9c2 + 2c. Let s(g) = 2g - 30. Let y be s(20). Suppose -5h = -yh + 5. Is v(h) even? False Let l = 73 - 68. Suppose -ln + 419 = -21. Let g = n - 5. Does 14 divide g? False Let i(p) = p*2 - 15p - 13. Let u be i(16). Suppose 1105 = 4w + 3x, -5w + uw + 550 = 2x. Suppose -w = -5t - 5t. Is t a multiple of 8? False Let g = -12226 - -14140. Is g a multiple of 87? True Is (-420)/(-7)(1 + 131/4) a multiple of 25? True Let x be ((-39)/(-2))/(6 + (-1395)/234). Suppose -2u + 55 = -5v - 202, 4u - 3v - x = 0. Is 6 a factor of u? True Let x = 193 + -146. Let q = -20 + x. Does 27 divide q? True Let y = 1218 - 777. Let b = 561 - y. Is b a multiple of 3? True Suppose 58 + 62 = i. Let a(p) = -p*2 - 57p + 524. Let t be a(8). Is (5/t)/(363/i - 3) a multiple of 8? False Let x = -35203 + 51852. Is x a multiple of 13? False Let o = -6281 + 6701. Is 7 a factor of o? True Suppose -85z = -312311 - 39419. Is 17 a factor of z? False Suppose 5w - 4v = -0w + 372, v - 154 = -2w. Let r be 547 + -1 + (5 - (-6 - -7)). Suppose 71l + r = wl. Is l a multiple of 10? True Suppose 0 = -200u + 171u + 412438. Is 13 a factor of u? True Suppose 5k - 11313 = -o, 335o = -5k + 338o + 11301. Is 29 a factor of k? True Let c = -374 - -371. Does 11 divide 134 - (c + 3 - 2)? False Let m be 40/(-5) + (2 - 45). Is 15 a factor of ((-934)/4)/(m/102)? False Suppose 12 = 5a + 5q - 13, -3q + 9 = a. Suppose ab + 5y - y - 215 = 0, 5b - 5y = 405. Suppose 43 = 3w + m, 0 = 5w + m - 2m - b. Does 4 divide w? False Suppose -2u = 4, -5u + 254 = -r + 5528. Does 7 divide r? True Let h be -2 + 2 + 21 + 2/2. Let x = h - 23. Does 5 divide 978x/(-14) - (-2)/14? True Let t(y) = -4y2 + 9y - 30. Let z be t(-8). Let f = z + 452. Does 9 divide f? False Let f(t) = -1822t + 1280. Is 37 a factor of f(-17)? False Let x(k) = k2 + 12k + 567. Let n be x(0). Let i(f) = -2f + 5. Let d be i(-2). Suppose 3z + n = -6t + dt, 5t = 4z + 948. Is t a multiple of 37? False Is ((1 + 8 - 8552) + -13)(-19)/3 a multiple of 31? True Suppose 3g + 3j - 3531 = 0, -3g - 5j = -1147 - 2374. Suppose -8v + g = -58. Does 5 divide v? True Let n(v) = -v*3 + 6v*2 + 6v + 10. Let t(r) = r*3 + 18r*2 + 2r + 44. Let y be t(-18). Let m be n(y). Let g = m + 121. Does 17 divide g? True Suppose k + 4k - 15 = 0. Let w be 11/(((-3)/2)/k - -1). Let f = w + -1. Is f a multiple of 6? False Let u(a) = -8013a*3 + 2a*2 - 18a - 20. Is 3 a factor of u(-1)? True Does 33 divide ((-15939)/2)/(18/(-36))? True Let n be ((-15)/9)/((-5)/2)144. Let q = -61 + n. Is 9 a factor of (6/9)/((-2)/(-3)) + q? True Let j be 3 - -28 - (-5 + 1). Suppose 5c = -0c + 5k + j, 10 = 4c + 2k. Is c - 815/(-2) a multiple of 32? True Suppose f - 8818 = -3l, 4484 - 1538 = l - 3f. Does 21 divide l? True Let k = 8 + -6. Let j(g) be the second derivative of 7g4/12 - g3/3 + 3g2/2 + 471g. Is j(k) a multiple of 3? True Let n(j) = -637j + 1043. Does 222 divide n(-13)? True Let n(r) be the first derivative of -r4/4 - 13r*3/3 - 11r*2/2 - 55r + 82. Does 59 divide n(-14)? True Suppose 8h - 1 = -41. Let s be (-10)/4(24 + 2)h. Let t = -175 + s. Does 25 divide t? True Suppose -5g - x + 23013 = x, 5g - 3x = 23043. Is g a multiple of 88? False Let y(z) = 3z2 - 10z - 26. Let p(o) = o + 1. Let h(g) = -g*3 + 9g*2 + 7g - 17. Let a(m) = h(m) + 5p(m). Let f be a(10). Does 18 divide y(f)? False Is 44 a factor of (0/(-2) - (-6)/9) + 14457670/570? False Suppose j + 3 = 4l, l = 3j - 6j - 9. Suppose l = -9g + 528 + 1515. Is g a multiple of 9? False Let c = 37 - 136. Let l be 1/(-3 + 2) + 5. Is 9 a factor of (c4/(-16))/(1/l)? True Suppose 3a = -3b + 4446, -a + 4b = -812 - 700. Is 31 a factor of a? True Suppose 0 = -3n - 2n + 10. Suppose -5p - 4o - 4 = -n, 0 = 4p - 2o - 14. Suppose -pg + 4i = 2i + 4, -5g - 4i = -35. Is g a multiple of 2? False Let b = 9088 - 555. Is 85 a factor of b? False Let i = 387 + -381. Suppose -2z + 855 = ib - 9b, -5b = 2z - 879. Is 12 a factor of z? True Suppose y - 18y - 4216 = 0. Let a = y + 516. Is 67 a factor of a? True Let y(o) = 9o + 62. Let l be y(-11). Let q = l - -425. Does 5 divide q? False Let v(w) = 19w + 3w3 - 20w - 1 - 2w3. Let b(a) = 7a*3 - 12a*2 - 8a - 22. Let c(t) = b(t) - 6v(t). Is 18 a factor of c(13)? False Let j = 29 - 45. Let f be 4/(13 + j - 14/(-4)). Suppose m = k - 9, -2k + 27 = -fm + 3m. Is 6 a factor of k? True Let l(k) be the third derivative of k6/24 - k5/60 - 5k4/24 + k3 - k2 - 35. Is l(2) a multiple of 8? True Let k be -3((-110)/(-3))/5. Let o(n) be the third derivative of -n*5/60 - 7n*4/8 + 22n*3/3 - 8n*2. Does 8 divide o(k)? False Does 27 divide 57230/19 - 202/1919? False Suppose 193 = 47h - 42. Let b = 2 - -1. Suppose -m - 1 + 44 = bi, 0 = -4i - hm + 72. Does 8 divide i? False Let i = -4477 + 6837. Does 14 divide i? False Let g be ((-1)/(-2))/((-2)/(-12)). Suppose 0 = gy - 15, 5t - 23 + 3 = -2y. Suppose 0 = 4j - tj - 84. Does 12 divide j? False Let i(q) = 9q - 67. Let h be i(8). Does 14 divide 360 + 5/(-5) + h? True Let f be (-2)/10 + 483/115. Suppose 0 = -0t + t + fy - 328, 0 = -4t + y + 1380. Is 43 a factor of t? True Suppose -2j = -u - 10835, 420 = -2j + 5u + 11283. Does 80 divide j? False Suppose 33n = 9n + 44088. Suppose 4w - u = n, -3w = -5w + 2*u + 914. Is 46 a factor of w? True Let l be (-100922)/42 + 22/(-231	{ "pile_set_name": "DM Mathematics" }
*3 + 5x*2 + 7x + 14. Let q be v(9). Let j = 249 + q. What is the third smallest value in j, -0.5, p? j Let i = -4974 + 4974.3. What is the third biggest value in i, -1/4, 15/31? -1/4 Let u = -4744.5 - -4745. Which is the second smallest value? (a) u (b) 4/3 (c) -36 (d) -0.4 (e) 1/6 d Let t = 21312.03 - 21698. Let i = -386 - t. Which is the second biggest value? (a) 0 (b) 0.3 (c) -0.4 (d) i a Let u(w) = -4w2 - 12w - 22. Let z be u(-4). Let l = -15 - -17. What is the second biggest value in z, 1, l? 1 Let l = 19.5 - 23.5. What is the fourth smallest value in l, 3, 14/9, -0.2? 3 Let s = -1/24 + 109/312. Let x = s - 25/39. Let o be ((-6)/3)/(22/2). What is the fourth smallest value in x, -2, o, -1? o Let r = 6 + -6.4. Let v = -0.35 - 431.65. Let c = 430 + v. What is the third biggest value in r, -5, c? -5 Let j be 63/15 - (-32)/40. Suppose 5t - 30 = jr, -r = -3t + 3r + 20. Let f = -17 - -16. Which is the third smallest value? (a) -1/7 (b) -5 (c) t (d) f a Let t = -847 + 5059/6. Let z = -1.18941 - 0.81059. What is the third smallest value in 5, t, z? 5 Let l = -494.9 + 497.9. Which is the third smallest value? (a) -0.4 (b) -20/3 (c) -3/4 (d) l (e) 2 a Let n = 1.35 - 3.28. Let j = 0.07 - n. Let u = -571.9 + 572. What is the second biggest value in -3, j, u? u Suppose 544 = -15z + 4279. What is the third smallest value in z, -0.4, -6/5? z Let m = -7 - -503. Let z = m - 504.76. Let p = z + -0.24. Which is the smallest value? (a) p (b) 0.2 (c) -2/15 a Let l = -60.5 + 60. Let t(m) = -3m*2 + 9m + 1. Let v be t(-3). Let w = v - -50. Which is the second biggest value? (a) w (b) l (c) -9 a Suppose 25q - 27q = 5w - 108, -5q = 2w - 39. Suppose -4k = g + 31, -2k + 5g - w = 21. What is the biggest value in 1, k, -5? 1 Let n(i) = -i*3 - 8i*2 + 20i + 3. Let g be n(-10). Suppose 35 = gt - 1. Suppose -28f = -31f + t. What is the third smallest value in f, 0.5, 1/3, 2? 2 Let x = -3421/2 + 1679. Let j = 4.946 + 0.054. What is the second biggest value in j, x, 1/3, 1/4? 1/3 Suppose -392h - 5x + 50 = -387h, 3h = x + 10. What is the third biggest value in -1/4, 18, h? -1/4 Suppose -562 = 2u - 3l, -4l - 15 + 7 = 0. Let y be (3/8)/((-1917)/u). Which is the third smallest value? (a) y (b) 2 (c) 0.2 b Let b = 2384 + -2383. What is the second smallest value in 0.3, -0.4, b, 1/7? 1/7 Let r = 22.303 + -22. Let y = r + -5.303. What is the biggest value in 3, 12, 0, y? 12 Suppose 0 = -0q - 14q + 56. Let s be 1(-10)/q16/(-40). Let j be s9/424. What is the third biggest value in -4, -3, j, 1/7? -3 Suppose 5i + 4m = -7, 0 = -593i + 594i - 4m + 11. What is the biggest value in -31, i, 6/7, -11? 6/7 Let a = -646.9 + 757. Let z = 123 - a. Let m = 13 - z. What is the second smallest value in 0, m, -4? 0 Let z = -13339/9 - -1482. Which is the biggest value? (a) z (b) 1 (c) 16 (d) 2 (e) 3/5 c Let u be (-9580)/18 - ((-112)/(-63) + -2). Let v = u + 19686/37. Which is the second biggest value? (a) v (b) -5 (c) -0.1 c Let x = 7 + 34. Let i = x - 40. What is the smallest value in -0.4, i, -4, -1/2? -4 Let f = -175.174 + 175. Let u = -0.674 - f. What is the smallest value in 0.3, u, -7? -7 Let k(v) = 6v*3 + 2v*2 + 2. Let o be k(-2). Let g = o + 42. Let p be (g + 35/(-10))/4. Which is the biggest value? (a) -1 (b) -5 (c) p c Let q be (-3 + 200/70)-16. Which is the fourth biggest value? (a) 0.1 (b) -0.4 (c) q (d) -1/4 (e) 5 d Let v be 14 + (-4)/(-88)-312. Which is the third biggest value? (a) v (b) -28 (c) 2/7 b Let f = -0.518 + 0.338. Let r = f + 8.18. Which is the third biggest value? (a) 0.01 (b) r (c) -0.4 (d) 4 a Let l be (-70)/63 + 4/3. Suppose -4x - 10 = 10. What is the second smallest value in l, 4, x, -1/3? -1/3 Let g = -17339 - -17322. Let k = 14.5 + -15. Which is the second biggest value? (a) -2 (b) k (c) 1.2 (d) g b Suppose -5810 = -550q + 716q. Which is the second smallest value? (a) 1/3 (b) q (c) -10 c Let g(w) = 5w2 + 2w*2 - 76 + 155 - 82. Let i be g(2). What is the biggest value in i, -0.4, 3/2? i Let o = -43016.7 - -43017. Let i = -19 + 39/2. Let t be (-16)/(-21) - 1/3. Which is the second biggest value? (a) t (b) -1 (c) i (d) o a Let r = -71 + 68. Let p = r + -24. Let t be 3/10(18/p - -2). Which is the smallest value? (a) -0.4 (b) t (c) 5 (d) 0.5 a Let j be 49/9 - (4 + 1). Let z = -12 - -9. Which is the third biggest value? (a) z (b) -0.01 (c) j a Let g = -6/17 + 35/51. Let w = 0.048 - 66.048. Let i = w - -66. Which is the third biggest value? (a) g (b) i (c) 4 b Let p(s) = s*3 + 2s*2 - 2s - 1. Let z be p(-3). Let k = 5058.6 - 5058.68. What is the second smallest value in k, z, 0? k Let x = -29.45 + 32.3. Let j = x - 3.15. What is the second biggest value in 2/3, j, 1.1? 2/3 Let i be ((-30)/(-390))/(4/(-56)). Which is the second biggest value? (a) -2 (b) i (c) 5 (d) -5 b Let n = 32962.07 - 32962. What is the smallest value in n, 0.53, 2/3, -4/9? -4/9 Let w(f) = 6f + 99. Let t = 81 + -97. Let m be w(t). Which is the third biggest value? (a) m (b) -0.2 (c) 0.2 b Suppose 2w + 12 = -5y, 4y - 49w = 19w + 60. Let r = 4.1 + -4. Which is the second biggest value? (a) r (b) y (c) 2/9 a Let g = -0.05 + -1.95. Let u = g + 4.7. Let w = 1.0607 + -0.6607. Which is the second smallest value? (a) u (b) 1 (c) -1/2 (d) w d Let m(u) = -25u - 153. Suppose 4t + 4 + 2 = -p, 4p = -3t - 24. Let x be m(p). Which is the smallest value? (a) -5 (b) 1/33 (c) 0 (d) x a Let m = -15.8 - -16. Suppose -4x - 118o = -117o + 4, 4x - 2o - 8 = 0. What is the smallest value in 5/6, -95, x, m? -95 Let u(w) = 12w - 67. Let q be u(6). Suppose 2 - 12 = qy. What is the fourth biggest value in -1/5, 0.4, 2, y? y Let q = 6.49 - 6.69. Which is the biggest value? (a) -5/17 (b) 24 (c) q b Let j = -2.77 - 0.23. Let m = -83.5 - -83.2. Which is the fourth biggest value? (a) 5/4 (b) j (c) -4 (d) m c Suppose -3v - 15 = -p, -2v - 5p - 22 = 5. Let l be (-3)/v - (-63)/(-198). Which is the third smallest value? (a) 3/5 (b) 4 (c) l (d) -0.4 a Let h = 9318 - 9317.6. Which is the third smallest value? (a) -0.3 (b) h (c) -0.009 b Let r = -20555/3 - -6853. What is the third biggest value in 568, 1/10, r? 1/10 Let w = 21976.3 - 21976. Which is the third biggest value? (a) -0.15 (b) w (c) -2/7 (d) 3 (e) -3 a Let z be ((-24)/(-15))/(6/(-15)). Let w = -0.08 + 0.18. Let x = w - 0.4. Which is the third biggest value? (a) 3 (b) z (c) x (d) -5 b Let v = 8823 - 1173461/133. What is the second smallest value in v, -0.04, -2? -0.04 Let r = 756.5 + -838. Let g = 81.2 + r. What is the second smallest value in -104, g, -0.2, 4? g Let p = -2146 + 2174. Which is the smallest value? (a) 0 (b) 2/13 (c) p a Let l(g) = g*2 + 8g - 11. Let j be l(-9). Let b be -1 - j - 4/5. Let i be 32/14 + (-62235)/3227. What is the second biggest value in b, i, -2? -2 Let h = 119.5 - -2.5. Let y = h + -123. Which is the smallest value? (a) 0.3 (b) y (c) -7/3 c Let k = -5 - -2. Let j be 130/(-520) - (3/(-4))/3. Let m be 6/(-16) + j + 66/(-528). What is the third biggest value in 0.2, k, m? k Let z = 23.9 + -24. Let w = 194.65 - 203.65. Which is the third biggest value? (a) z (b) w (c) -0.7 b Let r(h) = 3h3 + 68h*2 - 9h + 343. Let u be r(-23). Which is the second biggest value? (a) u (b) -6/5 (c) 17 c Let y(m) = 50m2 + 33m - 10. Let w be y(1). What is the second biggest value in w, -5, 4, 1? 4 Let q = -9558 + 9556. What is the fourth biggest value in q, 0.02, 0.5, -14? -14 Let z = 0.1304 - 104.7304. Let k = 145 + z. Let l = k + -40. Which is the third smallest value? (a) l (b) 4 (c) -2 b Let x = -0.03 + -0.27. Let g = 0 - -0.12. Let o = 782.4 + -785.4. Which is the third biggest value? (a) x (b) 1/3 (c) o (d) g a Let w = 7714615/7677 - 957/853. Let u = w + -1004. Let a = -0.3 - 0.7. What is the smallest value in a, 1/2, u, 5? a Let m = 103 + -109. Let k be m/3 + (-143)/(-65). Let t(n) = -n3 - 1. Let w be t(1). What is the biggest value in w, k, -15? k Let q = -329 - -334. Let u(i) be the second derivative of -i3/3 + 5i2/2 - 5i. Let g be u(3). What is the second smallest value in g, -0.2, q? -0.2 Let f(x) = -2x2 + 4x - 9. Let b be f(0).	{ "pile_set_name": "DM Mathematics" }
(b(q)). 2702836q Let y(h) = 2h. Let g(p) = 30p - 68. Let l(w) = 49w - 147. Let r(m) = 7g(m) - 4l(m). Determine r(y(k)). 28k + 112 Let k(m) = -7m*2 + 3. Let s be ((-1)/3)/((-30)/6390). Let w(n) = -68n*2 + 214n*2 - 74n*2 - sn*2. Determine w(k(a)). 49a*4 - 42a2 + 9 Let s(m) = m2 + 2m - 6. Let l(z) = 8z*2 + 18z - 54. Let u(k) = 2l(k) - 18s(k). Let i(f) = -106f + 5. Give i(u(b)). 212b2 + 5 Let n(x) = x2 - 2990x - 1. Let u(l) = 224l*2. What is n(u(k))? 50176k*4 - 669760k*2 - 1 Let j(o) be the first derivative of 3o*2 + 1. Let c(q) = -1164q*2 + 597q*2 + 571q*2. Determine j(c(b)). 24b*2 Let j(t) = -2t. Let s(d) = -12d2 + 5023d + 5. What is j(s(f))? 24f2 - 10046f - 10 Let z(y) = 2y2 + 23y. Let g be (-10)/(-6) + 12/36. Let h(o) = -37o2 + 12o*g + 7o*2 + 16o*2. Determine z(h(n)). 8n*4 - 46n*2 Let l be (320/(-60) + 7)/((-1)/3). Let p(m) = 9m - 5. Let n(t) = 2 - 1 + 1 - 4t. Let y(a) = ln(a) - 2p(a). Let d(v) = 69v. Calculate y(d(j)). 138j Let y(x) = x2. Let a(l) be the first derivative of l5/60 - 17l4/4 + l3/3 - 65l + 37. Let p(i) be the third derivative of a(i). Calculate y(p(f)). 4f*2 - 408f + 10404 Let v(j) = -j2 - 177. Let g(h) be the third derivative of -h5/20 + 107h2. What is v(g(l))? -9l*4 - 177 Let s(k) = -4k2 + k2 + 4k2. Suppose 5b + 96 = 106. Let x(o) = -206o2 + 62o*2 + 47o*2 + 66o*b. Give x(s(m)). -31m*4 Let v(b) = -120232b. Let n(z) = -z - 13. Give n(v(l)). 120232l - 13 Let m(a) = 68a*2 - 4a - 4. Let i(d) = -35d2 + 2d + 2. Let b(w) = -2i(w) - m(w). Let g(k) = 381k*2 - 15k. What is g(b(f))? 1524f4 - 30f*2 Let r(s) = 9s - 11. Let f(b) = -5b + 6. Let g(j) = -11f(j) - 6r(j). Let t(z) = 256z + 0z - 323z. Calculate t(g(c)). -67c Let c(t) = t. Let v(w) = -9w*2 + 23084w. Calculate c(v(k)). -9k2 + 23084k Let c(m) = -61m - 86. Let t(u) = -3u*2. Determine t(c(w)). -11163w*2 - 31476w - 22188 Let u(i) = 99i. Let f(k) = -k2 - 100027. Determine f(u(a)). -9801a*2 - 100027 Let r(c) be the second derivative of 3c*4/4 - c - 8498. Let y(t) = -3t + 2t2 + 3t. Calculate y(r(b)). 162b4 Let u(p) = 127p. Let o(g) be the first derivative of g*5/60 + 71g*2 - 103. Let h(j) be the second derivative of o(j). What is h(u(x))? 16129x*2 Let v(u) = -1027862u. Let z(f) = -f*2. Calculate v(z(q)). 1027862q*2 Suppose 21y - 30 = 15y. Suppose yc - q - 56 = 0, -q + 4q = 12. Let t(a) = 8a - 4a + ca. Let f(v) = 2v. Determine f(t(p)). 32p Let y(r) be the second derivative of 2r3/3 + 849r + 3. Let f(o) = -2o2 - 1957. Calculate y(f(x)). -8x*2 - 7828 Let q(x) = 14x - 32. Let m(j) = -5j + 12. Let v(y) = -8m(y) - 3q(y). Let p(d) = 2444d - 1. Give p(v(k)). -4888k - 1 Let v(m) = -m2. Let k(s) be the third derivative of -2s*6/45 + 235s*4/24 - 2s*2 + 2. Let z(a) be the second derivative of k(a). What is z(v(b))? 32b*2 Let h(j) be the third derivative of -427j*5/6 + 2j*2 + 12j - 1. Let d(l) = -4l2. What is h(d(c))? -68320c*4 Let h(m) be the first derivative of 0m + 25 + 1/2m2. Let o(z) = 4z - 1. Calculate h(o(g)). 4g - 1 Let d(y) = 2. Let j(h) = -2h - 3. Suppose -19o - 27 = 11. Let z(t) = oj(t) - 3d(t). Let s(v) = 15v. Calculate z(s(x)). 60x Let a(d) = 7854065d. Let q(b) = -11b. Determine q(a(l)). -86394715l Let s(q) = 7q2. Let b(r) be the first derivative of -268r*3/3 - 2166. Give s(b(w)). 502768w4 Let m(c) = -c2 + 52014c - 52014c. Let z(b) = 6b2 + 10b. Determine m(z(h)). -36h4 - 120h*3 - 100h*2 Let b be (-4)/4(-2 + 5 - -2). Let t(f) = f*2 + f + 1. Let c(n) = -12n*2 - 6n - 6. Let d(q) = bc(q) - 30t(q). Let p(v) = -2v. What is p(d(y))? -60y*2 Let y(l) = -20l + 1. Let m(a) = -9a2 + 107a - 11. Give y(m(c)). 180c2 - 2140c + 221 Let t(q) = 8q2. Let b(u) = 3u - 2 + 5 - 6 + 12 + 4. Determine b(t(v)). 24v2 + 13 Let d(t) = -14t - 60. Let g(l) = 154l + 672. Let a(r) = -56d(r) - 5g(r). Let n(h) be the first derivative of 2h*2 + 16. Calculate n(a(x)). 56x Let o(x) = 12x. Let h(m) be the first derivative of -2m*3/3 - 101m + 121. Let f(k) be the first derivative of h(k). What is o(f(s))? -48s Let z(d) = 2d - 3d + 2d - 2d. Let g(t) be the first derivative of 1/2t*2 - 23 - 13t*3 + 0t. What is z(g(b))? 39b2 - b Let q(x) be the second derivative of x3/2 - 2454x. Let g(l) be the third derivative of -l5/15 - l2. Determine q(g(f)). -12f2 Let r(h) = -h2. Let o(k) be the third derivative of k8/10080 - 19k*7/5040 + 3k*5/4 - 74k*2. Let i(l) be the third derivative of o(l). What is i(r(t))? 2t*4 + 19t*2 Let g(f) = 14218005285f - 14218005285f - 7f*2. Let w(x) = -15x - 6. Let n(k) = -16k - 5. Let r(v) = -6n(v) + 5w(v). Give g(r(l)). -3087l2 Let t(l) = l2. Let q(h) = 25h + 16. Let y(n) = n + 2. Suppose 4r = 38 - 26. Let p(b) = rq(b) - 24y(b). Give p(t(x)). 51x2 Let t(h) = 2h*2. Let y(s) = 102s - 4. Let j(m) = -2m. Let k(n) = j(n) + y(n). Let r(u) = u + 1. Let x(i) = -2k(i) - 6r(i). Calculate t(x(d)). 84872d*2 - 1648d + 8 Let u(f) = -2f2. Let b(n) = -13n - 6. Let i be b(-5). Let y = -1481 + 1536. Let j(w) = yw - 119w + iw. What is u(j(k))? -50k*2 Let f(q) = -67q + 25q + 23q + 18q. Let u(w) = 7w*2 - 3w + 3. Let i(m) = -28m2 + 11m - 11. Let z(x) = 6i(x) + 22u(x). What is z(f(b))? -14b2 Let c(a) = 15a. Let w(k) = -33k2 - 20k + 22. Determine w(c(v)). -7425v2 - 300v + 22 Let j(m) = 1805m2. Let n(o) be the third derivative of o5/12 - o2 + 9o - 7. Calculate n(j(c)). 16290125c4 Let l(s) = -s. Suppose 4g - 3v - 2817 = 0, 3g = 5v + 2060 + 61. Let n(q) = 1413q - 705q - gq. Calculate n(l(d)). -6d Suppose -2 = -9p + 97. Let t(v) = 25v + 11v - pv. Let k(o) = -3o*2. Determine k(t(s)). -1875s*2 Let g(b) = -15b. Let x(q) be the second derivative of 505q4/12 - 7q - 213. What is x(g(y))? 113625y2 Suppose -2 + 0 = g, -4g - 23 = 3o. Let h be (-5 - (o + 1))-298. Let w(x) = 295 + h - 10x2 - 593. Let s(q) = 2q*2. Determine w(s(d)). -40d*4 Let p(o) = -7o*2 + 2. Let w(d) be the second derivative of 7d*4/12 - 3d*2/2 - 3d - 7. Let c(y) = 3p(y) + 2w(y). Let a(v) = 4v2. Calculate a(c(m)). 196m*4 Let h(o) = 2o*2. Let m(v) = -1835v - 1687 + 844 + 841. Determine m(h(g)). -3670g2 - 2 Let g(q) = 14q - 187. Let d(n) = 5n - 66. Let s(y) = -17d(y) + 6g(y). Let m(r) be the second derivative of r3 + 11r*2/2 - 3r. What is m(s(a))? -6a + 11 Let n(w) be the third derivative of w7/5040 - 3w*5/4 + 39w2. Let p(r) be the third derivative of n(r). Let m(d) = d - 54. Give m(p(f)). f - 54 Let f(b) be the first derivative of -b3/3 - 33b2/2 - 301. Let y(x) = -118x - 1. What is f(y(c))? -13924c2 + 3658c + 32 Let p(d) be the third derivative of 0d + 3/8d*4 + 1/3d*3 - 1 + 21d*2. Let r(y) = 2y. What is p(r(c))? 18c + 2 Let u(w) be the second derivative of -7w6/240 - w4/6 + 19w3/6 - w + 13. Let y(j) be the third derivative of u(j). Let v(l) = -4l*2. Determine y(v(m)). 84m*2 Let o(g) = 336g. Let q(f) = -2f + 59918. Determine q(o(r)). -672r + 59918 Suppose 2i - 3807 = 899. Let m(b) = i - 5b2 - 2353. Let d(r) = r2 + 17. What is m(d(l))? -5l4 - 170l*2 - 1445 Let m(g) = 5037g. Let q(h) = 2h2 + 14h - 2. What is q(m(d))? 50742738d2 + 70518d - 2 Let r be (-715)/(-44) + (-1)/4. Let k(w) = 23w + 6w - rw. Let a(v) = 4v. Let l(f) = 5f. Let q(s) = 4a(s) - 4l(s). Determine q(k(y)). -52y Let h = -402 - -413. Let j(c) = 27c2 - 11c*2 - 12c*2 - hc2. Let p(t) be the first derivative of -t2 + 1. Calculate j(p(k)). -28k2 Let m be (20/6)/(28/(-36) - -1). Suppose -7p + 57 = m. Let q(u) = -4u + pu - u*2 - 2u. Let h(w) = -w2. Give q(h(i)). -i4 Let q(s) = -s. Let x(f) be the first derivative of 53f2/2 + 10f + 1871. Give q(x(p)). -53p - 10 Let z(q) = -1353762q. Let w(b) = -b + 2. Determine w(z(v)). 1353762v + 2 Let r(x) = -5610x2 - 41. Let t(c) = c2. Calculate r(t(p)). -5610p4 - 41 Let g(v) = -v. Let p(t) = 559t*2 + 58t + 8. Let o(i) = -202i2 - 20i - 3. Let c(z) = 11o(z) + 4p(z). Determine g(c(a)). -14a2 - 12a	{ "pile_set_name": "DM Mathematics" }
5985c2 - 12272 Find the third derivative of 120405362x*3 - 70638592x*2 wrt x. 722432172 What is the third derivative of 413078o*3w*4 + 73o3 - o2w4 + 14ow2 - 2ow + 18w*2 wrt w? 9913872o*3w - 24o2w Find the second derivative of 16141590j4 - j3s - 2js - 10509621s wrt j. 193699080j*2 - 6js Find the second derivative of 472146124y*3 + 229942342y - 1. 2832876744y Find the first derivative of 14526840a*3 + 3857178 wrt a. 43580520a*2 What is the second derivative of -215648595r*4 - 4r - 16365900 wrt r? -2587783140r2 Find the second derivative of 10262z*4 + 380z*3 + 2z*2 - 27064679z wrt z. 123144z2 + 2280z + 4 What is the second derivative of 20d2v + 11d2w + 339d2 + 8dvw - 7dv + 2d + 13651v + w wrt d? 40v + 22w + 678 What is the third derivative of -836640085j3 - 316134728j*2 wrt j? -5019840510 What is the third derivative of 26503o*4 - 3765o*3 - 31o*2 + 5449o - 3? 636072o - 22590 Find the third derivative of 3853i*5 - 167i*4 - 2i*3 - 5803209i*2. 231180i*2 - 4008i - 12 Find the second derivative of 388178b5w - 3b3w*2 + 11bw2 + 2bw + 2b - 756w wrt b. 7763560b*3w - 18bw*2 What is the third derivative of -17060771l*3nw + 3l*2nw + 3l*2n - 27l2 - 114ln - lw + 2 wrt l? -102364626nw Differentiate -f*4 - 1219f*3 - 3f*2 + 14f - 8303445 wrt f. -4f3 - 3657f*2 - 6f + 14 What is the first derivative of -3u2 - 17255161u - 20299647? -6u - 17255161 What is the third derivative of 546921828p*3 + 3p*2 + 5609185p wrt p? 3281530968 Find the second derivative of -500046f2 - 7f - 50370. -1000092 What is the second derivative of -18068758i2u*2 + 1924i*2u - 6u2 - 8775u wrt u? -36137516i2 - 12 What is the second derivative of -2a*2fr - 219a*2f + 16a2r*5 + 4681480afr*3 - 2ar + 2a - 562fr + 11f - r wrt r? 320a*2r*3 + 28088880afr Find the third derivative of 17415789h3l*4 - 4h*3l*2 + 37h*3l + 2h2l*3 + hl - 5h + 6l*2 + 20 wrt l. 417978936h*3l + 12h2 What is the first derivative of 162pu + 40454012p - 76364u wrt u? 162p - 76364 Find the first derivative of 15738053b3 - 20663095 wrt b. 47214159b*2 What is the third derivative of 295k*4 + 930535k*3y - k*2y + 33k2 - 1106740ky - k - 2y wrt k? 7080k + 5583210y What is the second derivative of 45903k5 - 6k*4s*3 - 4488ks3 + 27s*3 wrt k? 918060k*3 - 72k*2s*3 Find the second derivative of 9147581l*2r*2z*3 + 9lr2z*3 + 53lr2z + 961lrz3 wrt l. 18295162r*2z*3 Find the second derivative of -2407827h*3j*2 - 2h*3j + 2hj*2 + hj + 23107j2 - 6j + 1 wrt h. -14446962hj*2 - 12hj Find the second derivative of -212457719o*2 + 221969574o wrt o. -424915438 What is the second derivative of 58109022hw*2 + 7hw + h - 11w*2 - w - 42313 wrt w? 116218044h - 22 What is the second derivative of 52mr*2 - 8330mr + 279m - 80974r4 wrt r? 104m - 971688r2 What is the derivative of 7z*4 - 261381z*2 + 6734479 wrt z? 28z*3 - 522762z What is the second derivative of -117898949o5 + 48442763o wrt o? -2357978980o3 Differentiate 2874683u - 1042214 with respect to u. 2874683 Find the first derivative of 275c3x*2 - 128137c*2x*3 - 213122168x*3 wrt c. 825c*2x*2 - 256274cx3 What is the derivative of -5617683h*3 + 4h*2 - 28077570? -16853049h*2 + 8h What is the third derivative of -2566g4l - 4g4 - 3315g*3l*2 + 2g*2l2 + g2l - 190g*2 + 2gl2 + 8825gl - l2 wrt g? -61584gl - 96g - 19890l2 What is the first derivative of -724744166o + 143547716? -724744166 What is the second derivative of 286q3 - 679468q*2 - q + 241080825? 1716q - 1358936 Find the second derivative of 728825549s3 - 2s*2 - 245963592s wrt s. 4372953294s - 4 Differentiate 81892366a*2 + 77772683. 163784732a Find the second derivative of -10755520ky*3 + 2957ky - 3k - 2y - 7 wrt y. -64533120ky Differentiate -3m*2 + 400mx2 - 2981m + 413x2 + 111x - 94 with respect to m. -6m + 400x*2 - 2981 What is the third derivative of -8v*4 + 527469v*3 + 51v*2 + 46728? -192v + 3164814 Differentiate 36614923z2 - 49840117. 73229846z What is the third derivative of 17295834l3 + 2l*2 - 4l + 21702 wrt l? 103775004 What is the third derivative of 80815017m3 - 2m*2 + 13811547 wrt m? 484890102 Differentiate 1436474htw*3 + 62hw3 + 2hw2 + 5h - 2tw*3 + t - 10w*3 + 16w*2 wrt t. 1436474hw3 - 2w*3 + 1 Find the second derivative of 110224g*4 + 178g*2y*3 - 24gy3 - 12742gy - 24g - y*3 wrt g. 1322688g*2 + 356y*3 What is the first derivative of -835170y*4 + 178y*3 - 284819519 wrt y? -3340680y*3 + 534y2 Differentiate t2y2 + 1050t*2y + 68134t2 - 12t - 10y2 + 1 wrt y. 2t*2y + 1050t2 - 20y What is the third derivative of -44452424d4 + 2d*3 - 3d*2 + 558188d + 139 wrt d? -1066858176d + 12 What is the second derivative of -2c*3s*3 + 2c*3s + 234936c3 + 47c*2 - 15cs2 + 1505769s*3 wrt s? -12c*3s - 30c + 9034614s Differentiate -3507638x - 22942712 wrt x. -3507638 What is the third derivative of -149253236b*3 - 107398316b*2 wrt b? -895519416 What is the derivative of 7651k*4 + 3881k*2 + 19382068? 30604k*3 + 7762k What is the second derivative of 70974950j4 - 101164462j? 851699400j2 Find the second derivative of -2l*3u - 558l3 - 157l*2u + 4l2 - 2691lu + 2l + 2u + 16147 wrt l. -12lu - 3348l - 314u + 8 What is the second derivative of i2k*3 + 28227642i*2r + ik3r - 2k3r - 66447708r wrt i? 2k*3 + 56455284r Differentiate -2i2 + 9287252i - 95920297 wrt i. -4i + 9287252 What is the second derivative of -2706795q*3 + 3q*2 + q - 32086373? -16240770q + 6 What is the third derivative of -4s4 + 1083226s*3 + 13352s*2 - 13? -96s + 6499356 What is the second derivative of -129015739x2 - 237169147x? -258031478 Find the second derivative of -8h4 + 2h*3 + 430041h*2 + 1911h - 2702. -96h2 + 12h + 860082 Find the second derivative of 73f2l*2o*2 - 2f*2l - 65292f2o*2 - 2f*2o - 4f2 + 2159fl2o + 179flo - f wrt o. 146f*2l*2 - 130584f*2 What is the second derivative of -513531888i*4 + 83931508i? -6162382656i2 Find the second derivative of -245n*3s*2 + 26n*2s*2 - 170n*2 + 9ns2 + 3n - 1684s2 + 3s wrt n. -1470ns*2 + 52s*2 - 340 Differentiate 292243400f*2 + 157959657 with respect to f. 584486800f What is the derivative of 6087999w2 - w + 768008 wrt w? 12175998w - 1 Find the second derivative of -775051151q2v*3 + 2qv3 - 2qv2 - 19qv + v3 - 47326 wrt q. -1550102302v*3 What is the third derivative of -10675799s*3 - 237047s*2 - 17s? -64054794 What is the first derivative of -357y4 + 6y*3 - 2y*2 + 2y + 509133? -1428y3 + 18y*2 - 4y + 2 Find the first derivative of -16341k3q + 126k3 - 8998k*2 - 31q wrt q. -16341k3 - 31 Find the second derivative of 6301747z*2 - 2904450z wrt z. 12603494 What is the third derivative of 227ad*4 + 2ad3 + 7a - 2d4 + 2756d*3 + 136093d*2 + d wrt d? 5448ad + 12a - 48d + 16536 Differentiate -384914d*3w + 11d2w*2 + 7w*2 + 323919w with respect to d. -1154742d2w + 22dw*2 What is the third derivative of -712423130i*6 + 87299200i*2 wrt i? -85490775600i*3 What is the derivative of -10d*2g + 94136717d2 - 738761dg + g4 wrt g? -10d*2 - 738761d + 4g3 Find the second derivative of 361594124d*2 - 2d - 428301189. 723188248 Differentiate 14541g2k + 2g2 - 236gk - 4g + 368655k + 80 with respect to g. 29082gk + 4g - 236k - 4 What is the second derivative of 6q*2u*2 + 15q*2u + 55609qu*2 - 119qu - 2q + u*2 wrt u? 12q*2 + 111218q + 2 What is the third derivative of -3178p2x*3 + 4269p*2x + 16px*3 - 5x*3 - 163x*2 wrt x? -19068p*2 + 96p - 30 What is the second derivative of 23i2z + 3266109i2 + 22iz - 399i - 21 wrt i? 46z + 6532218 What is the first derivative of -9j**4 +	{ "pile_set_name": "DM Mathematics" }
(8/7) assuming v is positive. v22 Simplify (u/u12uu/u(-4)u*(-1/3)u(u/(uu*(-2/5)u))/u)(-3/17) assuming u is positive. u(89/85) Simplify (y6/y(3/8)(yy/(y/(y(-1/4)/y)))(-8))(-10) assuming y is positive. y(-305/4) Simplify (((h/h*(-3))/(hh(-1/5)))(6/7))(-23) assuming h is positive. h(-2208/35) Simplify ((s1)36/(s8/(s/s(-3))))(2/7) assuming s is positive. s(64/7) Simplify (((dd(-4/3))/(d(-2/11)d))/((d/(((dd(-5))/d)/d))/(d/(d/d(-2/21)))))14 assuming d is positive. d(-1270/11) Simplify (i/i(-6))50/((ii*(3/13))/(iii4i)) assuming i is positive. i(4625/13) Simplify ((l/(l(-1/2)l))(8/7)l*(-6/7)l(2/11))(-31/5) assuming l is positive. l(248/385) Simplify (((d/((d2d)/d))(-6/17))(1/9))4 assuming d is positive. d(8/51) Simplify ((t(-1/2))(-1/9)/(tt0)28)24 assuming t is positive. t(-2012/3) Simplify n(1/3)/(n(-1/14)/n)(n(n/n(-2))/n)(-4/11) assuming n is positive. n*(145/462) Simplify (jj(7/3))43j/(jj/(jj/((j(13/6)/j)/jj)j))j/(j*(-2/5)j) assuming j is positive. j*(4337/30) Simplify (((nn*6n)/(n/(nn0)))/(n5(n/n(-6))/n))(-40) assuming n is positive. n120 Simplify (a(-4/7)a(aaaa(1/2))/a((a/a(2/9))/a)(-19))(-13/3) assuming a is positive. a(-11713/378) Simplify ((n/n*2nn)(20/9)n2/((n(2/9)n)/n))33 assuming n is positive. n132 Simplify ((h/h(1/12)h)/h(4/7))36 assuming h is positive. h(339/7) Simplify (h0)(-49)/((h(3/7)/hh)/(h9h)) assuming h is positive. h(67/7) Simplify u(1/19)u/(uuu(u/u*(-2/9)u)/uuuu)(u((u/((u/(u/u(-10)u)uu)/u))/u)/u)/((u/(uuu*12u))/u) assuming u is positive. u*(3220/171) Simplify (((ii*(-6/11))/ii(-2/5))38)(-36) assuming i is positive. i(71136/55) Simplify ccc/c*9c*(-1/6)(c(-4/7))(-43) assuming c is positive. c(773/42) Simplify (((p(-1/4)p)(-41))50)(-1/4) assuming p is positive. p(3075/8) Simplify f5/f(5/2)(f/(f*(-1)f))/(ff(-9/2)) assuming f is positive. f7 Simplify (k/((k/k(-13/2))/k)k)/k*15(k*(-7)/kkk)/(k(-10)k) assuming k is positive. k*(-33/2) Simplify ((pp/(p/(p(p(-4)p)/p))pp*(-8)pppp)/(p(6/7)p/(p/((p/(p*8pp))/pp))))(-16/3) assuming p is positive. p(-352/21) Simplify (p4/p)42(p/(p/((p(-2/11)/p)/p)))(6/37) assuming p is positive. p(51138/407) Simplify (m(-19/4)m(5/7))2 assuming m is positive. m(-113/14) Simplify (b(1/4))*(-45)(b/(bb3b)b)/bb0 assuming b is positive. b(-61/4) Simplify (q/(qq/q(-8)))/(q((q/(q*(-21)q)q)/q)/qqq)(q*(3/2)q)(-28) assuming q is positive. q(-102) Simplify oo(-11)o*(-4/9)o*10o(-15) assuming o is positive. o(-139/9) Simplify (p/(p*4p)pp(-12))/((p(-3)/p)/(p/p(1/3))) assuming p is positive. p(-31/3) Simplify (rrr((r/(rr*7r))/r)/rrr)*(-45)r(-1/14)/(r/r(-1/23)) assuming r is positive. r*(72091/322) Simplify ((p(p/((pp/p3)/p))/pp)/p)*(-10)(ppp/(p/(p/(pp/p(-5/6)ppp)p)))/(pp6/p) assuming p is positive. p(-227/6) Simplify h(-1/4)/((h/h(7/6))/hh)hh(-5/6)h9 assuming h is positive. h(109/12) Simplify (x*(10/7)x17)/(x(6/7)x(-3/4)/x) assuming x is positive. x(541/28) Simplify ((nnn/n(-2/19)nnn/n*(2/17))/((nn*(-1/7))/(nn/(nn(-7)/n))))18 assuming n is positive. n(575082/2261) Simplify ((f/(f(-1/4)f))*6f/(f*1/ff)ff/f*(-10/9)f)(-7) assuming f is positive. f(-707/18) Simplify x(-1/7)/x(-8/9)(xxx(x/x*(-3))/xx)/(x/((xx/(x/(x/(x((xxx/(x/(x*(-5)x))xx)/xxx)/x))))/x)x) assuming x is positive. x(362/63) Simplify (q(-2/71)(q/(q/(q/((qq(-1/37))/qq))))/q)/(q/q*(-22/5)q/q(1/2)) assuming q is positive. q(-181293/26270) Simplify ((xx(xx/(x/(x/x20)))/xxxx)/xx)(-1/57)(x(2/3)/x)17 assuming x is positive. x(-103/19) Simplify (q(4/5)q)(4/11)(q/q(-10/11))/q11 assuming q is positive. q(-464/55) Simplify j(-2)j(-4/5)(j/(j/(j*3j)))(1/22) assuming j is positive. j(-144/55) Simplify ((t/((t(2/41)/t)/t))/(t(2/3)t))/(((t11/t)/t)/t15) assuming t is positive. t(896/123) Simplify (c/((c(cc8)/c)/c))(-4/31)/((cc*(-1/20)/c)/cc(2/7)) assuming c is positive. c(7237/4340) Simplify (s/s9)/(s/(s/(s/s(-1/2))))s(10/9)s/(sss*(-6/5)s) assuming s is positive. s(-827/90) Simplify ((x(-8)/(x/(x/x6)))/(x(-2)xxx(5/2)/x))(-3/13) assuming x is positive. x(93/26) Simplify (((k/(k/(k(2/9)kk)k))/kk)/k)(-37)((k/(kkk9))/k)/k17 assuming k is positive. k*(-326/9) Simplify (jj14/j)(-12/11)(j/(j/(jj9)))(-15) assuming j is positive. j*(-1818/11) Simplify hh*16h/h*9(h*(-12)h)/hhh(-12/7) assuming h is positive. h(-26/7) Simplify ((r/(rr8)rr/(rr(-6/7)))/(r(1/7)/(r(-2/9)/r)))(-1/12) assuming r is positive. r(473/756) Simplify (v(1/19)/(v/v*(1/12)))/((vv(v/(v(-2/19)v)v)/v)/v(-17)) assuming v is positive. v(-4553/228) Simplify n(-2/17)n/(nn19)nn11nn(-2/11) assuming n is positive. n(-1178/187) Simplify (d(2/11)d(-20)/d)/(d(1/17))(-1/6) assuming d is positive. d(-23347/1122) Simplify (t*(6/29)ttt*(2/3))/((t/(tt/(tt(-25)t)t))/(t/((tt/(tt17)tttt)/t)t)) assuming t is positive. t(3730/87) Simplify (r(-2/9))*(-1/8)(r/((r((r/r(2/27))/r)/rr)/r))/rrr*(-1)/rr assuming r is positive. r*(11/108) Simplify ((zz(-1))(-18)zz/(zz/((zz*(-1/14))/z))z/(zz(zz/(zzz(z/(((z/(z/z*(3/8)z))/zz)/z))/z)zz)/z))49 assuming z is positive. z(217/8) Simplify (m(-2/15))(18/5)/((mmm(1/18)/m)/m29) assuming m is positive. m(12359/450) Simplify ((a(a/(aa(2/11)))/a)/(a/a(-3/7)a))/(a(-3))(1/2) assuming a is positive. a*(-171/154) Simplify (((nnn(-1))/n)/n)(-27)n*(1/5)n/(n/(nn/((n/(nnn/n(1/6)))/n))) assuming n is positive. n(961/30) Simplify (((a5)3)24)(-2/21) assuming a is positive. a(-240/7) Simplify ((zz(z(-2/5)z)/z)/(z*7z)z(-3)z/(zz(-7)/z))(-3) assuming z is positive. z(21/5) Simplify (a/a7a/(a*(1/2)/a)a)/((aa(-1/8)/a)/((a/(a/(a/a(7/3))))/a)) assuming a is positive. a(-137/24) Simplify (d(3/5))(2/31)/(d/(d/(d/(((d/(((d/(d(-11)d))/d)/d))/d)/d)))d(-10/9)) assuming d is positive. d(-13741/1395) Simplify (f/((f/f(1/14))/f))/ff*4f(f/(f/(ff/(f(ff*21)/f)ff)))/ff*(-29)ff assuming f is positive. f(-573/14) Simplify ((s(-1/4)/s)(-16)/((s/(s(2/13)/s))/s6))4 assuming s is positive. s(1256/13) Simplify ((s33)(1/2))(-5/9) assuming s is positive. s(-55/6) Simplify (l/(l(7/6)/l))(-30)l/((l/l*(-22))/l)l(-26)/l assuming l is positive. l(-73) Simplify (x*(-5)x)/(x/(x/x*(-3/4)))xx(-4/7)x0 assuming x is positive. x(-79/28) Simplify (yyyy4/yyyyy)(-37)(y5/y)43 assuming y is positive. y*(-198) Simplify (x/(xxx(-3)x)x)(-48)/((xx7)/(x/x(-2))) assuming x is positive. x(-101) Simplify p(-7/4)/(p/p*(11/2))(p/(pp10)p)/(pp/((p/p14)/p)) assuming p is positive. p(-89/4) Simplify (x(-2/5))(-33)/(x(-2/3)x)(-17/6) assuming x is positive. x(1273/90) Simplify ((uu(-6))/u3)/((u/(u/(uu/((u(uu*3)/u)/u)uu))u)/u)(-2) assuming u is positive. u(-6) Simplify (j/j5)/j8(j(-2))(2/105) assuming j is positive. j(-1264/105) Simplify (rr39)/r(-4/9)(r/r(-8/3))/(r31/r) assuming r is positive. r(127/9) Simplify ((pp/p*(-1/11)p)/p(2/21))(1/28) assuming p is positive. p*(173/1617) Simplify (i/(i/(((ii/i*(1/12))/i)/i)))/(ii*(3/7)i)i6/((i(8/3)/i)/i) assuming i is positive. i(79/28) Simplify z(2/3)z*(-17)(zz(-3/2))/zz/(z3/z) assuming z is positive. z(-113/6) Simplify (((qq28)/q)/q(-1/45))(-10/17) assuming q is positive. q(-2522/153) Simplify (t(-9)t*(3/7)t)/(t*(-2/31)t(-1/30)) assuming t is positive. t(-48653/6510) Simplify ((((y/((yy(-22))/yy))/y)/y)/yy(-10)y)(-4) assuming y is positive. y(-40) Simplify ((p*(-1/3)p*(1/9))/(ppp0p)(7/3))(-31) assuming p is positive. p*(2015/9) Simplify ((ww(-3/4)/w)/w)18*(w/(w	{ "pile_set_name": "DM Mathematics" }
wfw. 0 What is prob of sequence zls when three letters picked without replacement from szlkb? 1/60 Four letters picked without replacement from {g: 6, x: 5, o: 1, v: 2, q: 1, j: 2}. Give prob of sequence ojvj. 1/14280 Two letters picked without replacement from {o: 5, e: 1, f: 5, y: 6}. Give prob of sequence ef. 5/272 Three letters picked without replacement from {f: 2, y: 1, t: 1, x: 4, o: 3, c: 1}. What is prob of sequence oto? 1/220 Three letters picked without replacement from tjjtttjjtt. Give prob of sequence ttj. 1/6 Three letters picked without replacement from {p: 6, q: 2, s: 10, g: 2}. Give prob of sequence sgg. 1/342 What is prob of sequence aj when two letters picked without replacement from {j: 14, a: 5}? 35/171 Two letters picked without replacement from {m: 6, y: 13}. What is prob of sequence my? 13/57 Calculate prob of sequence gu when two letters picked without replacement from {g: 2, l: 5, y: 9, u: 3}. 1/57 Two letters picked without replacement from {f: 10, j: 2}. What is prob of sequence ff? 15/22 What is prob of sequence jbqq when four letters picked without replacement from {q: 4, b: 4, j: 6}? 12/1001 Calculate prob of sequence rr when two letters picked without replacement from {j: 1, r: 5, m: 4}. 2/9 What is prob of sequence tt when two letters picked without replacement from rtttttttttr? 36/55 Calculate prob of sequence zzzz when four letters picked without replacement from {z: 7}. 1 Four letters picked without replacement from {l: 4, r: 3, c: 4}. What is prob of sequence lrcc? 1/55 What is prob of sequence qq when two letters picked without replacement from {u: 1, q: 2, w: 2, i: 7, f: 5, t: 3}? 1/190 Four letters picked without replacement from zzzzzzzuzzzzrzzzzz. Give prob of sequence zuzz. 7/153 Two letters picked without replacement from vvvvuvououomouv. What is prob of sequence ou? 8/105 Three letters picked without replacement from {b: 2, r: 1, q: 2, j: 1, x: 1, w: 1}. What is prob of sequence xqr? 1/168 What is prob of sequence oo when two letters picked without replacement from {u: 2, o: 1, x: 1, q: 2, z: 1}? 0 Two letters picked without replacement from {s: 1, u: 1, i: 1}. Give prob of sequence iu. 1/6 What is prob of sequence jj when two letters picked without replacement from bbjbbjbbbbbbjjbbbbbj? 1/19 Calculate prob of sequence kmj when three letters picked without replacement from {d: 4, w: 3, k: 2, y: 1, j: 4, m: 1}. 4/1365 Three letters picked without replacement from {a: 3, z: 2, h: 1, i: 6, n: 1}. What is prob of sequence zii? 5/143 Two letters picked without replacement from {s: 4, q: 1, r: 3, a: 11}. What is prob of sequence ra? 11/114 Calculate prob of sequence addo when four letters picked without replacement from {o: 5, d: 4, a: 2}. 1/66 What is prob of sequence mhm when three letters picked without replacement from hmhhhmhmhhmhhh? 5/91 Calculate prob of sequence ava when three letters picked without replacement from {n: 2, v: 2, a: 5, w: 3, f: 3}. 4/273 What is prob of sequence ror when three letters picked without replacement from rooorrorroorrrooooor? 11/95 Three letters picked without replacement from pieyyyyi. What is prob of sequence yii? 1/42 Two letters picked without replacement from {d: 1, g: 1, j: 1, b: 1, a: 1}. What is prob of sequence bg? 1/20 Three letters picked without replacement from {z: 7, m: 3}. Give prob of sequence mzm. 7/120 Calculate prob of sequence oo when two letters picked without replacement from oooooocceo. 7/15 Four letters picked without replacement from {w: 2, x: 1, r: 3, p: 1, q: 2, b: 3}. Give prob of sequence xbwp. 1/1980 Four letters picked without replacement from {s: 2, e: 3, n: 4, x: 8, j: 2, a: 1}. What is prob of sequence xsjj? 4/14535 Two letters picked without replacement from hhpm. What is prob of sequence pm? 1/12 What is prob of sequence cqcj when four letters picked without replacement from {c: 6, t: 1, q: 3, j: 2}? 1/66 Three letters picked without replacement from oalebabnnba. Give prob of sequence nba. 1/55 What is prob of sequence qb when two letters picked without replacement from nbqbbnd? 1/14 Calculate prob of sequence we when two letters picked without replacement from sseewkseheezh. 5/156 Three letters picked without replacement from {p: 1, t: 2, y: 2, o: 1}. What is prob of sequence tot? 1/60 Calculate prob of sequence bn when two letters picked without replacement from nnbbobbfbob. 6/55 Four letters picked without replacement from {c: 1, p: 1, o: 1, v: 1, f: 1}. What is prob of sequence pfov? 1/120 Calculate prob of sequence qcq when three letters picked without replacement from qqqqqqcqqqcc. 9/55 What is prob of sequence xs when two letters picked without replacement from {x: 4, s: 6}? 4/15 Four letters picked without replacement from tqututqqmqyqtqmuq. What is prob of sequence uquu? 1/1360 Calculate prob of sequence aqa when three letters picked without replacement from {a: 3, q: 2}. 1/5 What is prob of sequence vr when two letters picked without replacement from vrvvvvrv? 3/14 Three letters picked without replacement from {s: 1, y: 2, a: 2, g: 2, p: 1}. What is prob of sequence gyp? 1/84 Three letters picked without replacement from tjtjjt. Give prob of sequence jjj. 1/20 Two letters picked without replacement from {u: 6, j: 5, m: 3, d: 5, t: 1}. What is prob of sequence td? 1/76 What is prob of sequence wwd when three letters picked without replacement from dww? 1/3 What is prob of sequence lll when three letters picked without replacement from lllllllllvll? 3/4 Calculate prob of sequence gpgg when four letters picked without replacement from gpggpggggggg. 4/33 What is prob of sequence ngen when four letters picked without replacement from {e: 6, g: 4, n: 10}? 6/323 Two letters picked without replacement from {t: 1, z: 5, h: 4}. Give prob of sequence tz. 1/18 Calculate prob of sequence se when two letters picked without replacement from {s: 3, m: 2, e: 10, v: 1}. 1/8 What is prob of sequence xx when two letters picked without replacement from {d: 5, x: 3, s: 5}? 1/26 What is prob of sequence qt when two letters picked without replacement from {t: 1, q: 2, d: 3, i: 1, x: 5}? 1/66 Four letters picked without replacement from wwlw. What is prob of sequence llww? 0 What is prob of sequence gdpz when four letters picked without replacement from wpzwgdgf? 1/840 Calculate prob of sequence kq when two letters picked without replacement from {h: 4, l: 2, o: 6, q: 1, k: 2}. 1/105 Calculate prob of sequence wemw when four letters picked without replacement from {w: 4, m: 3, e: 5}. 1/66 Two letters picked without replacement from {n: 7, j: 2, z: 5}. Give prob of sequence nz. 5/26 Two letters picked without replacement from vviviiiiii. Give prob of sequence vi. 7/30 What is prob of sequence zgd when three letters picked without replacement from gkddzdgddzkddgddgz? 3/136 Three letters picked without replacement from {n: 1, v: 4, r: 5, o: 6}. What is prob of sequence vvv? 1/140 Three letters picked without replacement from {g: 2, d: 1, z: 3, e: 3, m: 6}. What is prob of sequence egz? 3/455 Calculate prob of sequence za when two letters picked without replacement from {a: 18, z: 1}. 1/19 Two letters picked without replacement from bbjmjjbbbjmmj. What is prob of sequence bj? 25/156 What is prob of sequence gccg when four letters picked without replacement from sgcgcccsccsmsccsgs? 7/1530 Four letters picked without replacement from {m: 3, j: 8}. Give prob of sequence jmmj. 7/165 Calculate prob of sequence uumn when four letters picked without replacement from {z: 3, m: 3, y: 2, k: 3, u: 5, n: 3}. 5/2584 Two letters picked without replacement from {x: 1, t: 1, d: 1, c: 1, a: 1}. Give prob of sequence da. 1/20 What is prob of sequence pr when two letters picked without replacement from {p: 10, r: 9}? 5/19 Calculate prob of sequence jljl when four letters picked without replacement from {j: 3, l: 15}. 7/408 What is prob of sequence vgt when three letters picked without replacement from ggdtvtggtttvtt? 1/39 Three letters picked without replacement from qtutmirr. What is prob of sequence trq? 1/84 Three letters picked without replacement from {z: 12, h: 1}. What is prob of sequence zzz? 10/13 Three letters picked without replacement from zjdjjjdjddjjdj	{ "pile_set_name": "DM Mathematics" }
3/3 + o - 65. Give l(t). 10 Let d(w) be the first derivative of -3/2w2 - w + 5. Let h(s) = -s3 + 5s2 - s + 4. Let r be h(5). What is d(r)? 2 Let c(o) = -o3 + o2 - 1. Let z(t) = -t3 + 6t*2 + 3t - 2. Let j(l) = -2c(l) + z(l). Calculate j(-3). 0 Let o be (-4)/(-4)-1-4. Let m(h) be the third derivative of h7/2520 - h6/360 + h5/60 - h2. Let c(q) be the third derivative of m(q). What is c(o)? 6 Let q = 6 - 8. Let o(j) = -2j*2 - 6j + 1. Let n(v) = v. Let p = -4 - -5. Let f(c) = po(c) + 5n(c). Determine f(q). -5 Let x(v) = -2v + 1. Suppose 14 - 54 = -5n. Let y = 12 - n. Determine x(y). -7 Let z(w) = -4w. Let b = 10 - 7. Suppose -2 = -3s - 4p, 2s + 0s - p + 6 = 0. Let u = b + s. Calculate z(u). -4 Let g be (-2)/3(-81)/6. Suppose 2c + c = g. Let q(y) = y - 4 + c + 2y. Calculate q(-1). -4 Suppose 3v = 3z + 24, 0v + 2z + 1 = -3v. Let i(n) = n - n2 + 0 - v - 6n. Let u(w) = w*2 + 6w + 3. Let l be u(-2). Determine i(l). -3 Let t(r) = 5r2 + 3 + 2r*3 - 4r*2 + 2r + 0 - r*3. Determine t(-2). -5 Let x(w) = -11w*2 + 6w + 17. Let j(p) = -5p2 + 3p + 8. Let l(d) = -9j(d) + 4x(d). Give l(5). 6 Let y(a) be the first derivative of -a2 - a + 4. Give y(-3). 5 Let k(z) = -z2 - 4z. Let q(a) = -3a*2 - 14a. Let o(b) = -7k(b) + 2q(b). Calculate o(2). 4 Suppose -24 - 63 = -4i + u, 3i = -u + 67. Suppose -4n + 17 = -f, -2f - n - i = 3f. Let p(y) = y3 + 6y*2 + 3y - 5. What is p(f)? 5 Suppose 3 + 10 = -p. Let f be p/(-5) - 4/(-10). Let r(v) = v*2 - 2. What is r(f)? 7 Let i(x) = -5x. Let b(y) = 4y + 3. Let s be b(-3). Let p = 3 + s. Let m be ((-3)/p2)/(-1). Give i(m). 5 Let x = -107 + 103. Let m(a) = -a*2 - 6a + 5. Calculate m(x). 13 Let x(c) = -c*2 - 2c + 2. Let y be 16/40 - (-51)/(-15). Determine x(y). -1 Let a(l) = l*2 + 7l + 1. Let z(c) = 4c - 41. Let s be z(9). What is a(s)? -9 Let p = 1 + 0. Let o(s) = 2s - 1 - p + s*3 + 3s*2 + 0s*3 - 3s. Calculate o(-3). 1 Let a = -19 + 12. Let c = a - -4. Let q(o) = 2o2 + 2o + 4. Let s(x) = -x*2 - x. Let n(g) = q(g) + 3s(g). Determine n(c). -2 Let d(v) be the first derivative of v5/120 + v4/8 - 3v3 - 7. Let i(t) be the third derivative of d(t). Determine i(-3). 0 Let v(h) = 11h*2 - 21h + 6. Let x(k) = 4k2 - 7k + 2. Let n(s) = 3v(s) - 8x(s). Calculate n(7). 2 Let q(m) be the second derivative of -m*3/2 + 5m*2/2 - 4m. Let a be (-42)/10 + 13/65. Determine q(a). 17 Suppose 5r = 2o + 15, -o = -5r - 4 + 19. Let q(t) = -6t + 2t + rt + 0t + 5. Calculate q(-4). 9 Let q be 3/2-4(-12)/9. Let i(a) = a2 - 5a - 11. What is i(q)? 13 Let a(k) = -k*3 + 3k + 1. Let p be (-69)/(-46)(-8)/61. What is a(p)? 3 Let z(h) be the third derivative of -h*6/120 + 3h*5/20 - 7h*4/24 - 5h*3/3 - 20h*2. Calculate z(8). -2 Let z(c) = c - 1. Let i be z(-4). Let r be (3/9)/(1/6). Let t(k) = k + 2k - 4k - r + 0. Give t(i). 3 Let d(n) = -3n*3 + 2n*2 + n. Suppose -2l = -l - 6. Let p be (2/l)/(4/(-12)). Give d(p). 4 Let g(w) be the third derivative of 0 + 0w - 1/120w*6 - 2w*2 + 1/15w*5 + 1/3w*3 + 0w*4. Give g(4). 2 Suppose 62 = 12f + 14. Suppose v - 15 = -4q, -5v + 3q = 1 - 7. Let p(u) = 4u*3 + fu + 2 - 5uv - 4u*2 + 5u - 3u. Determine p(-5). -3 Let q(d) = 0d*2 - d - 11d*3 + 4d*2 + 1 - d - 2d*2. What is q(1)? -10 Let n(u) = -6u2 + u. Let h = -1 - -2. Let t = -3 - h. Let c = 3 + t. Determine n(c). -7 Let x(o) = o - 3. Let d = 40 + -37. Determine x(d). 0 Let g(c) = c3 + 4c2 - c - 3. Let r(i) = -i3 - 7i*2 - 6i + 5. Let j be r(-6). Suppose l + 29 = -0l - jx, -5l = x + 25. What is g(l)? 1 Suppose -6i + 6 = -5i. Let s(o) = 5o + i - 4o2 - 10 + 2o*2. Suppose -2p = -6p + 12. What is s(p)? -7 Let z be (-58)/(-14) + (-7)/49. Suppose 35 = -zt - t. Let b(o) = o*2 + 8o + 6. Determine b(t). -1 Let d(f) = -2f3 + f2 + 3f - 1. Let j(x) = 0x3 - x3 - 3x + 5x + x2. Let o(n) = -2d(n) + 5j(n). Let l be (-2)/(2 - (-10)/(-4)). Determine o(l). 2 Suppose -u = 2u - 5i - 48, -2i + 90 = 4u. Suppose -5s - 4k = -30, u = 4s - s + 3k. Let q(v) = -2v + 2v + v3 + 1 - 2v2. What is q(s)? 1 Let x = 2 + 2. Let j(a) = a - 7. Let b(h) be the third derivative of h4/8 - 10h3/3 - h2. Let m(k) = xb(k) - 11j(k). Calculate m(2). -1 Let s(l) be the third derivative of -l8/6720 - l7/2520 + l6/180 - l5/120 + 5l*4/24 - 7l*2. Let k(o) be the second derivative of s(o). Give k(-3). 5 Let y(m) = -m - 6. Suppose 0 = -2g, -g - 3 = -5z - 23. Let q = z + 8. Suppose -2k = -r - 0 - 4, r = -2k - q. Give y(r). -2 Let s(f) = -f2 + 6f + 1 - 8f + f. Calculate s(-5). -19 Let c(f) = 9 - 9 - f. Let d(g) be the third derivative of -g5/60 + 5g*4/12 - 5g*3/6 + 2g*2. Let q(y) = 5c(y) + d(y). Determine q(4). -1 Let v(n) be the third derivative of 7/6n3 + 0n + 0 - 4n2 - 1/12n*4. Let z = 12 - 7. Calculate v(z). -3 Let d be (-34)/10 + 18/(-30). Let w(j) = -3j - 7. Let v(l) = -l - 1. Let g(t) = v(t) - w(t). Calculate g(d). -2 Let j(o) = -14o + 20. Suppose 0 = -2q - 3g + 3, q - 5q + 5g + 17 = 0. Let d(b) = 2b + 2b - 2b - 7 + qb. Let n(f) = -11d(f) - 4j(f). What is n(3)? 0 Let s(m) = -m2 - 2m + 7. Let f be (-2 + -1 - (-72)/40)5. Determine s(f). -17 Let n = -3 - -5. Suppose -2 = -nb - 0b. Let t(y) = -3 + 5 - y + b. Calculate t(-4). 7 Let s(p) be the second derivative of p3/6 + p2 - 16p. Give s(-5). -3 Let n be (-10)/4(-10)/5. Let h(y) = 2y2 - y3 + 4y2 + y - 2 + n. Give h(6). 9 Let o(g) be the third derivative of g5/60 - g4/4 - 6g2. Calculate o(5). -5 Let l = -53 + 49. Let x(p) = p3 + 3p2 - 5p + 1. Calculate x(l). 5 Let n(s) = -s*2 - 5s - 4. Let t(l) = -2l - 3. Let a be t(-3). Suppose -ai - 5 - 4 = 0. Give n(i). 2 Let y(c) = -c3 - c2 - c + 1. Let m(x) = -2x3 - x2 - 7x + 1. Let k(n) = m(n) - y(n). Let q(v) = v. Let p(h) = -k(h) - 6q(h). What is p(-1)? -1 Let c(k) be the third derivative of -k5/60 - 11k*4/24 - 5k*3/6 - 25k*2. Determine c(-10). 5 Let t be (-4)/(-8) - 3/(-2). Let n(a) = -8 - 2 - ta + 2. Give n(-6). 4 Let d(f) = f + 1. Let q(c) = 4c + 4. Let n(i) = 7d(i) - 2q(i). Let g be (-3 + 0)(-2)/(-1). Give n(g). 5 Let m(y) = -y*2 + 4y + 2. Let l be 3 - ((-9)/3)/(-1). Let f = -4 - l. Let w be (-12)/1818/f. What is m(w)? 5 Let d(b) be the second derivative of -b3/6 - 3b*2 - 23b. Suppose l + 3l + 24 = 0. What is d(l)? 0 Let s(x) = -4x*2 - 3x - 4. Let n(v) = 7v2 + 5v + 7. Let k(a) = -3n(a) - 5s(a). Let j be 2/(2 - 0)0. Calculate k(j). -1 Let t(d) be the first derivative of 5d*2/2 - 8. Determine t(-2). -10 Let h = -3 - -7. Suppose c = 2z + h, -3c + 13 - 1 = -2z. Let d(a) = -a*3 + 3a*2 + 3a. Calculate d(c). -4 Let m(b) = 6b3 - 2b*2 + 2b - 1. Let o be m(1). Let w(l) = l*2 - 2l - 2. Calculate w(o). 13 Let f(s) = -s3 + s2 - 1. Let q be 8/14 - (96/(-21))/(-8). What is f(q)? -1 Let u be (-18)/14 + 2/7. Let c = u + 5. Let a(w) = -w*2 + 4w - 2. Calculate a(c). -2 Let g(k) = -10k. Suppose -6z = -4z + 2. Let b be (3 + 0)/(z + 2). Suppose -bs + s - 2 = 0. What is g(s)? 10 Let i be (-1)/1 - 1-3. Let l(j) = j2 - 10j + 1. Let y be l(10). Let z(c) = y + ic - 1. Give z(-2). -4 Let u = -66 + 71. Let r(o) = o2 - 5o. Calculate r(u). 0 Let z(h) = h - 4. Suppose -3m - 9 = 3n, 2 = 3n + m + 5. Suppose 3 + n = x. What is z(x)? -1 Let i(n) = n2 - 4n + 2. Suppose z - 5u = -15 - 4, 3z - 5u + 7 = 0. Give i(z). 14 Let w = -554 - -33241/60. Let h(n) be the third derivative of 0n - wn5 + 3n2 + n3 + 0 + 1/6n4. Give h(5). 1 Let z(a) = a - 2. Let k(l) = -l - 9. Let g(c) = -k(c) + 4z(c). Give g(4). 21 Let q(h) = h*2 - h. Suppose 4p - 2 = 14. Suppose 3 = 3d + pf, 0 = 5d + 2f - 5. Give q(d). 0 Let t(h) = -h + 1. Let p(r) = 6r - 1. Let f(q) = p(q) + 4t(q). Let b be (0 + 0)/(-4 + 2). Let j be (-5)/((-10)/6) + b. What is f(j)? 9 Let m(w) be the third derivative of w*4/24 - 7w3/6 - w2. Calculate m(0). -7 Let h(y) = -y - 1. Let s = 27 + -9. Let w = 30 - 43. Let v = s + w. Give h(v). -6 Let g(w) = 22w - 1. Let j(d) be the second derivative of -5d3/2 + d2/2 + 3d. Let t(r) = 5g(r) + 7j(r). Calculate t(-2). -8 Let o be -1 + 42/2. Let c(	{ "pile_set_name": "DM Mathematics" }
6 Let b = -2/1385 - 3597/2770. Let m = -1843 - -12944/7. Find the common denominator of m and b. 70 Let f be ((-63)/(-33))/((-13)/191). Let y = -302/13 - f. What is the common denominator of ((-1)/(-5))/(3/129) and y? 55 Let o = 88003/12 + -7339. Find the common denominator of o and 61/12. 12 Let i be (-9)/(-15) + 1182/30. Suppose -2v + 6v = i. Calculate the lowest common multiple of v and 12. 60 Let g = -16 - -22. Calculate the common denominator of -47/8 and (3/54)/(g/(-153)). 24 Let p(n) = n*2 + 8n - 12. Suppose 6z - 40 = 2z. What is the lowest common multiple of p(-10) and z? 40 Calculate the common denominator of 2 - 1 - (-54)/(-20) and 5/(24/15 + -2). 10 Let a = -32 + 36. What is the smallest common multiple of 7 and a? 28 Suppose 0b = 5b + 40. What is the lowest common multiple of 12 and 2/b - 41/(-4)? 60 Suppose -2c + 3 = -3. Suppose -2d - 2d + cg + 24 = 0, -5g = -5d + 25. What is the smallest common multiple of d and 1? 9 Find the common denominator of -1 - -1 - (-108)/40 and 903/(-210) - 6/(-2). 10 Let g = 16 + -6. Let n be (-2)/8 - 2/(-8). Let x = 16 + n. Calculate the least common multiple of g and x. 80 Let r(o) = -1 - 9o + 3o2 - o3 + 4o2 + 2o3. Calculate the smallest common multiple of 10 and r(-8). 70 Let b(i) = i2 - 13i + 15. Let z be b(12). What is the least common multiple of 20 and 40/((-12)/z)-1? 20 Suppose -5t + 3l + 53 = 0, -4t - l = -3t - 17. What is the least common multiple of 10 and t? 130 Suppose 9k = 7k + 24. What is the least common multiple of k and 9? 36 Let a(q) = -5q. Let d be a(-2). What is the common denominator of 50/9 and ((-4)/50)/((-2)/d)? 45 Let q(f) = f2 - 3f - 5. Let u be q(5). Suppose -ub + b = -5204. Let k = -7775/6 + b. Calculate the common denominator of 17/4 and k. 12 Suppose -y = 14 + 6. What is the smallest common multiple of 9 and 6/(y/8 + 4)? 36 Calculate the smallest common multiple of (-8)/(-40) - (-49)/5 and 5. 10 Let i = -4/109 - 1159/1090. Let x be 3/((-27)/(-5))14962. Let y = 8304 - x. Find the common denominator of i and y. 90 Suppose 0 = -z - 4q + 18, 0z = -2z - 5q + 36. Suppose 2c = -6, 2t - t = 5c + 19. Calculate the least common multiple of z and t. 36 Let g be (-751)/36 + 6/(-27). Let i = g - -53/4. What is the common denominator of i and (-6)/15 - (-202)/180? 18 Let y = -304/55 + 283/110. Let f(a) = a2 + 5a. Let t be f(-6). Calculate the common denominator of t/4(-49)/12 and y. 88 Find the common denominator of 33/8 and ((-12)/(-20))/(14/185). 56 Let x = -25/242 + -4/121. Calculate the common denominator of -5 and x. 22 Let r = -1458 - -2973/2. Calculate the common denominator of 5/2 and r. 2 Let l = -854 - -6849/8. Let k = 1886/3 - 2525/4. Calculate the common denominator of k and l. 24 Let f = 8 - 8. Suppose f = -3s + 6s - 6. Suppose -5h - 2 = -4o, 0 = -2h - 2h - so + 14. Calculate the smallest common multiple of h and 8. 8 Let i be 4/2 - (-6274)/(-715). Let z = 204/65 + i. Calculate the common denominator of 1/4 + 1/56426 and z. 77 Suppose 0w + 3 = w. Suppose 0 = f - 7 - 4. What is the lowest common multiple of w and f? 33 Suppose -4s - 11 = 29. Calculate the common denominator of (2/(-4)71)/(-3) and ((-13)/(-6))/(s/(-18)). 30 Let h = -833731/24 + 34745. Calculate the common denominator of -64/3 and h. 24 Let z be 91/(-7) + (-1 - -2). Find the common denominator of -45/14 and 282/(-4)2/z. 28 Suppose -3g + 8g - 10 = -2p, 2g = -p + 3. Let k(q) = -q3 - 4q*2 + q - 4. What is the least common multiple of k(p) and (-516)/(-54) + (-8)/(-18)? 80 Suppose -2r = -2i + 16, -i - 2r - 2 = 2r. Let l(f) = f + 19. What is the least common multiple of i and l(-9)? 30 Let v = 2012522/541 - 3720. Let h = v + -23299/9738. Let t = -4175/384 - -37/128. What is the common denominator of h and t? 36 Let z = -1/18584 - -687629/390264. What is the common denominator of z and 11/18? 126 Let k = 2593/3 + -887. Let h = -10 + 15. Find the common denominator of (-153)/60h/2 and k. 24 Let l be -72((-1)/3 - -1). Let o = -28 - l. What is the common denominator of 226/o + (-3)/3 and 47/20? 20 Suppose 0 = 2j - 0j - 18. Calculate the smallest common multiple of j and 7. 63 Suppose 91 + 21 = 7b. Calculate the least common multiple of 44 and b. 176 Let o be (5 - 2)/(12/8). Suppose -on - 10 = -3n. Calculate the lowest common multiple of 3 and 0/(2/2) + n. 30 Let i(n) = n*3 - 2n*2 + 2n - 2. Let b be i(2). Let m be 2/(-4)0/b. Suppose 2w + m = 2. What is the lowest common multiple of w and 1? 1 Suppose -4s + 3c + 18 = 0, 4c = 3s + 4 - 21. Suppose 24 = -2b + 5l, 0 = sb + l + 56 - 3. Let u = b + 37. What is the least common multiple of 22 and u? 220 Suppose -2a = 4c - 62, 5c - 4a = 42 + 42. What is the lowest common multiple of c and 20? 80 Let j = -882 + 17653/20. Find the common denominator of j and -85/64. 320 Calculate the least common multiple of 22 and (80/5)/(0 + 1). 176 Suppose -4g = -6g + 28. Calculate the smallest common multiple of 6 and g. 42 Let n(y) = -2y*3 + 23y*2 + 14y - 10. Calculate the lowest common multiple of 16 and n(12). 112 Suppose -2r - 52 = -3g, 4 + 0 = r. Let y = -16 - -38. What is the least common multiple of g and y? 220 Let g = 22220/699 - 697931/28892. Let q = g + 14/31. What is the common denominator of 91/24 and q? 24 Let p = -77557/10 - -7762. Find the common denominator of p and 1 + -1 + -1 + 51. 10 What is the common denominator of -2 - 605/30 - 3 and 47/6? 6 Let v(j) = 3j2 + 4j + 2. Suppose -5u + 62 = 4b, -4b - 27 = -5u + 11. What is the smallest common multiple of u and v(-2)? 30 Let b(o) = -o*3 - 7o*2 - o - 4. Let p be b(-7). Suppose 3i - 45 = -pk, -k - 3i = -4i - 21. Calculate the smallest common multiple of k and 2. 18 Let y(q) = 3q*3 - 6q*2 + 5q - 1. Calculate the lowest common multiple of 9 and y(2). 9 Let y be ((-3)/4)/(3/12). Let r be (4/4)/(1/y). Calculate the common denominator of (-490)/(-12) - 2/r and 95/4. 4 What is the common denominator of -7/13 and (-1 + 312/(-30))/(2/2)? 65 Let s(j) = -j*2 + 6j - 5. Let o be s(4). Suppose 2m = 10, ok - 45 = -5m + 46. Calculate the smallest common multiple of k and 16. 176 Let o(l) = 2l + 1. Let h(u) = u - 1. Let r(f) = -3h(f) + o(f). Let p be r(3). Let w = p - 0. Calculate the lowest common multiple of w and 3. 3 Let r(m) be the third derivative of -m4/2 - m3/6 + m2. Let g be (9/(-6))/((-12)/(-8)). What is the least common multiple of 6 and r(g)? 66 Let p = 8 - 2. Suppose -y = v - 6, 0 = v - 2y - p. Calculate the least common multiple of 22 and v. 66 Let z(c) = -c*3 + 5c*2 + 8c - 4. Let b be z(6). Let i = -2/93 - -343/93. Calculate the common denominator of 2/(-4) + 97/b and i. 24 Suppose 5c = 4d + 4 - 19, -5c + 35 = d. What is the least common multiple of 10 and d? 10 Let l be 7/(28/24) - -3. What is the smallest common multiple of 23 and 6(-2)/((-12)/l)? 207 Suppose 5d = -u - 9, -d = -5d + u. Let x be ((-10)/8)/(d/(-12)). What is the least common multiple of 10 and 10(36/x)/(-3)? 40 Let g = -9 - -10. Suppose g = d + h, -4d + 2d + h = -2. Calculate the lowest common multiple of 5 and d. 5 Suppose 3z - 8 = z. Suppose 4b - 4 = -j - 3j, -b - 24 = -zj. Let t = b - -8. What is the smallest common multiple of t and 16? 16 Suppose 0 = 4f + 8, -3h - 2f = h. What is the common denominator of (20/192)/(h/3) and -115/6? 48 Let b = 35 - 30. What is the least common multiple of 7 and b? 35 Let x = 91 + -71. Calculate the least common multiple of 44 and x. 220 Let b = 18 + -17. Suppose 4d + 4 = -4x, -5x - 2d + 11 = -d. Calculate the smallest common multiple of x and b. 3 Let w(h) = h*3 - 5h*2 + 8. Let k be w(4). Let i(f) = -7f*2 - 5f - f*3 + 7f + 8 + 6f. What is the lowest common multiple of 2 and i(k)? 8 Let r = 15 - 11. Suppose ry = -37 - 115. Calculate the common denominator of y and ((-142)/40)/((-2)/4). 10 Suppose y + i = 2y + 380, y = 4i - 392. Let n = 2995/8 + y. Find the common denominator of -16/3 and n. 24 Suppose -3d - 5k = 16, -4k + 3k - 11 = -2d. Let r be (-36)/272(-14)/d. Let u = 2131/340 - r. Find the common denominator of u and 57/20. 20 Calculate the lowest common multiple of (-20)/130 - 160/(-26) and 2. 6 Let l(a) = -7*a - 4. Let g be l(-4). Su	{ "pile_set_name": "DM Mathematics" }
prime factors of 12378928. 2, 773683 List the prime factors of 84835. 5, 19, 47 What are the prime factors of 15404? 2, 3851 What are the prime factors of 9297843? 3, 53, 58477 List the prime factors of 158332. 2, 23, 1721 What are the prime factors of 176568? 2, 3, 7, 1051 What are the prime factors of 506088? 2, 3, 11, 71 What are the prime factors of 52201? 52201 What are the prime factors of 303750? 2, 3, 5 List the prime factors of 391402. 2, 11, 17791 List the prime factors of 33715056. 2, 3, 23, 30539 What are the prime factors of 26523103? 26523103 List the prime factors of 316836. 2, 3, 13, 677 List the prime factors of 7238098. 2, 7, 83, 6229 List the prime factors of 4017572. 2, 13, 77261 What are the prime factors of 4181325? 3, 5, 197, 283 What are the prime factors of 20351? 47, 433 What are the prime factors of 1470434? 2, 7, 105031 List the prime factors of 2691928. 2, 336491 List the prime factors of 1679577. 3, 559859 What are the prime factors of 1056407? 11, 137, 701 List the prime factors of 193992. 2, 3, 59, 137 What are the prime factors of 8650517? 8650517 What are the prime factors of 317080? 2, 5, 7927 List the prime factors of 20005342. 2, 7, 1428953 What are the prime factors of 1110801? 3, 479, 773 List the prime factors of 2556702. 2, 3, 142039 What are the prime factors of 397673? 397673 List the prime factors of 8445647. 7, 109, 11069 What are the prime factors of 208678? 2, 103, 1013 What are the prime factors of 443569? 7, 63367 List the prime factors of 13445. 5, 2689 What are the prime factors of 1619877? 3, 7, 77137 List the prime factors of 15262803. 3, 565289 List the prime factors of 53455. 5, 10691 What are the prime factors of 280312? 2, 37, 947 What are the prime factors of 4464151? 89, 50159 What are the prime factors of 10000111? 11, 101, 9001 List the prime factors of 1085974. 2, 542987 List the prime factors of 3314386. 2, 37, 44789 List the prime factors of 636505. 5, 127301 List the prime factors of 2134578. 2, 3, 355763 List the prime factors of 3447813. 3, 41, 28031 List the prime factors of 162280. 2, 5, 4057 What are the prime factors of 7441141? 19, 391639 What are the prime factors of 389440? 2, 5, 1217 List the prime factors of 269479. 7, 137, 281 List the prime factors of 498480. 2, 3, 5, 31, 67 What are the prime factors of 21854420? 2, 5, 7, 37, 4219 What are the prime factors of 18548525? 5, 741941 List the prime factors of 67955. 5, 13591 What are the prime factors of 394283? 47, 8389 What are the prime factors of 224591? 224591 What are the prime factors of 1674148? 2, 7, 59791 List the prime factors of 46566. 2, 3, 13, 199 What are the prime factors of 1348206? 2, 3, 37, 6073 List the prime factors of 4254536. 2, 11, 13, 3719 List the prime factors of 362692. 2, 11, 8243 List the prime factors of 703195. 5, 140639 What are the prime factors of 176020? 2, 5, 13, 677 What are the prime factors of 8898010? 2, 5, 11, 23, 3517 What are the prime factors of 136724? 2, 7, 19, 257 List the prime factors of 7648429. 73, 104773 List the prime factors of 501826. 2, 13, 19301 What are the prime factors of 3644202? 2, 3, 491, 1237 List the prime factors of 118593. 3, 13177 What are the prime factors of 42772? 2, 17, 37 What are the prime factors of 4137637? 7, 591091 List the prime factors of 2505385. 5, 501077 What are the prime factors of 17420969? 37, 470837 What are the prime factors of 518315? 5, 7, 59, 251 What are the prime factors of 11417989? 11, 971, 1069 What are the prime factors of 11104844? 2, 1129, 2459 List the prime factors of 2466912. 2, 3, 7, 3671 What are the prime factors of 12447014? 2, 19, 327553 List the prime factors of 6748181. 11, 613471 What are the prime factors of 136362? 2, 3, 22727 What are the prime factors of 1341680? 2, 5, 31, 541 List the prime factors of 2636034. 2, 3, 439339 What are the prime factors of 2999808? 2, 3, 7, 31 What are the prime factors of 2523116? 2, 29, 21751 List the prime factors of 7819353. 3, 868817 What are the prime factors of 31671? 3, 17, 23 List the prime factors of 5446770. 2, 3, 5, 7, 37, 701 What are the prime factors of 842404? 2, 210601 What are the prime factors of 17740? 2, 5, 887 List the prime factors of 180926. 2, 61, 1483 What are the prime factors of 165232? 2, 23, 449 What are the prime factors of 2206330? 2, 5, 7, 43, 733 What are the prime factors of 1918530? 2, 3, 5, 21317 List the prime factors of 4182287. 41, 83, 1229 List the prime factors of 182910. 2, 3, 5, 7, 13, 67 List the prime factors of 3174283. 7, 113, 4013 List the prime factors of 344947. 17, 103, 197 What are the prime factors of 8964926? 2, 61, 73483 What are the prime factors of 321967? 397, 811 What are the prime factors of 352543? 352543 List the prime factors of 1117093. 61, 18313 List the prime factors of 2992178. 2, 7, 213727 What are the prime factors of 2690260? 2, 5, 134513 What are the prime factors of 5133928? 2, 29, 22129 What are the prime factors of 12486495? 3, 5, 7, 109, 1091 List the prime factors of 190674. 2, 3, 11, 107 List the prime factors of 1645893. 3, 47, 1297 What are the prime factors of 73289? 83, 883 List the prime factors of 230738. 2, 43, 2683 List the prime factors of 3413309. 3413309 What are the prime factors of 444224? 2, 11, 631 List the prime factors of 1360563. 3, 43, 53, 199 List the prime factors of 10660908. 2, 3, 888409 List the prime factors of 9062096. 2, 487, 1163 What are the prime factors of 1301497? 1301497 List the prime factors of 8679651. 3, 53, 79, 691 List the prime factors of 218830. 2, 5, 79, 277 List the prime factors of 172948. 2, 43237 List the prime factors of 6087965. 5, 13, 229, 409 What are the prime factors of 451087? 7, 13, 4957 List the prime factors of 18575311. 18575311 What are the prime factors of 5306195? 5, 197, 5387 What are the prime factors of 1081114? 2, 540557 List the prime factors of 1778242. 2, 727, 1223 List the prime factors of 4047954. 2, 3, 23, 29333 List the prime factors of 12033258. 2, 3, 137, 14639 List the prime factors of 3291435. 3, 5, 7, 43 List the prime factors of 111021. 3, 23, 1609 What are the prime factors of 3214511? 113, 28447 List the prime factors of 187432. 2, 7, 3347 List the prime factors of 4216346. 2, 101, 20873 What are the prime factors of 584538? 2, 3, 97423 List the prime factors of 1643201. 7, 234743 What are the prime factors of 21620466? 2, 3, 7, 8171 List the prime factors of 4159983. 3, 31, 41, 1091 What are the prime factors of 951193? 951193 What are the prime factors of 200610? 2, 3, 5, 743 What are the prime factors of 2255514? 2, 3, 293, 1283 List the prime factors of 13209754. 2, 6604877 What are the prime factors of 796741? 11, 72431 What are the prime factors of 232910? 2, 5, 23291 List the prime factors of 4047203. 43, 94121 What are the prime factors of 370771? 101, 3671 What are the prime factors of 17437564? 2, 47, 92753 What are the prime factors of 13807634? 2, 2251, 3067 What are the prime factors of 276945? 3, 5, 37, 499 What are the prime factors of 1110730? 2, 5, 31, 3583 What are the prime factors of 1536957? 3, 170773 List the prime factors of 1387761. 3, 17, 27211 What are the prime factors of 787039? 11, 71549 List the prime factors of 1650342. 2, 3, 23, 11959 What are the prime factors of 533272? 2, 191, 349 What are the prime factors of 233440? 2, 5, 1459 What are the prime factors of 2296298? 2, 613, 1873 List the prime factors of 12526906. 2, 7, 894779 List the prime factors of 432638. 2, 216319 What are the prime factors of 1936747? 1936747 What are the prime factors of 510890? 2, 5, 47, 1087 List the prime factors of 407987. 19, 109, 197 What are the prime factors of 112177? 13, 8629 List the prime factors of 91633. 43, 2131 What are the prime factors of 9393108? 2, 3, 23, 34033 What are the prime factors of 22417168? 2, 59, 23747 List the prime factors of 2619590. 2, 5, 261959 What are the prime factors of 216461? 7, 17, 107 List the prime factors of 3504045. 3, 5, 79, 2957 What are the prime factors of 9802247? 7, 13, 107717 What are the prime factors of 956382? 2, 3, 7, 3253 List the prime factors of 7371357. 3, 7, 173, 2029 What are the prime factors of 1418326? 2, 7, 13, 7793 What are the prime facto	{ "pile_set_name": "DM Mathematics" }
Divide -13621 by -16. 13621/16 Divide 232 by -31. -232/31 Divide 1486 by -218. -743/109 -38899 divided by 2 -38899/2 372319 divided by 8 372319/8 42135 divided by 1 42135 -5 divided by -60206 5/60206 Divide 1677216 by 559072. 3 6295028 divided by 4 1573757 0 divided by -25547 0 What is 31 divided by -3192? -31/3192 What is -25740 divided by -78? 330 What is 1 divided by 321524? 1/321524 What is 3858 divided by -6? -643 Calculate 1119 divided by 432. 373/144 52332 divided by 267 196 487 divided by -455 -487/455 586 divided by -39 -586/39 Calculate 1394397 divided by -1394397. -1 17845 divided by 14 17845/14 What is -248034 divided by 14? -124017/7 What is 242202 divided by 6? 40367 -75300 divided by -15060 5 What is 188480 divided by -4712? -40 27301 divided by -27301 -1 Calculate -926503 divided by -4. 926503/4 7379 divided by 157 47 -37805 divided by 7561 -5 Divide -17280 by 4320. -4 -45024 divided by 11256 -4 What is -50453652 divided by 6? -8408942 Calculate -335544 divided by -10824. 31 Divide 6216 by 168. 37 25800 divided by -20 -1290 3041 divided by 8 3041/8 Divide 43 by 515. 43/515 127 divided by 7351 127/7351 What is -90876 divided by -2? 45438 Calculate -3291 divided by 1097. -3 -17892 divided by 12 -1491 Calculate 0 divided by 10910. 0 -1531 divided by 7 -1531/7 Divide -64148 by 4. -16037 Calculate 1073580 divided by 87. 12340 65 divided by 3898 65/3898 What is 20088 divided by -108? -186 Divide 221922 by 9. 24658 What is -12195 divided by -5? 2439 Calculate 10184 divided by -4. -2546 -351 divided by -1 351 Calculate -845622 divided by 845622. -1 What is 1448 divided by 73? 1448/73 Calculate 0 divided by -26443. 0 10 divided by 441 10/441 Calculate 1614 divided by 174. 269/29 What is -2 divided by 56387? -2/56387 Calculate 80 divided by 74013. 80/74013 2 divided by -167231 -2/167231 What is 36512 divided by 8? 4564 407333 divided by 37 11009 Calculate 809750 divided by -9875. -82 Divide -8095 by -8095. 1 What is -2628177 divided by -13341? 197 What is 51 divided by -1065? -17/355 What is 2 divided by 4400? 1/2200 7776 divided by 19 7776/19 What is 68 divided by -1012? -17/253 Divide -690248 by -4. 172562 Calculate -926856 divided by 4. -231714 42702 divided by -3882 -11 Divide 160947 by 2. 160947/2 What is 468368 divided by -117092? -4 Divide 756656 by -189164. -4 Divide 423712 by -2. -211856 Divide 5 by 8124. 5/8124 What is -16200 divided by -26? 8100/13 What is 218468 divided by 54617? 4 -1467749 divided by 4 -1467749/4 What is 7169 divided by 3? 7169/3 Divide 6302 by -527. -6302/527 Divide 171681 by -643. -267 What is -252893 divided by 4? -252893/4 Calculate 461776 divided by 38. 12152 What is -403163 divided by 4? -403163/4 Divide -32256 by 126. -256 -8799 divided by 122 -8799/122 Divide -101031 by -51. 1981 -912064 divided by 3 -912064/3 What is 21 divided by 3699? 7/1233 What is -355032 divided by 36? -9862 Calculate 2 divided by -10982. -1/5491 58625 divided by -35 -1675 Calculate 2334 divided by 933. 778/311 What is -406000 divided by 125? -3248 What is 70315 divided by -49? -1435 What is -511302 divided by -127? 4026 -65280 divided by -4352 15 What is 284429 divided by 3? 284429/3 Divide 98620 by -20. -4931 11907 divided by 42 567/2 What is 243375 divided by 825? 295 Divide 31925 by -6385. -5 147642 divided by 4474 33 What is -24202 divided by 12101? -2 What is -379 divided by 30? -379/30 4 divided by -211394 -2/105697 163436 divided by -40859 -4 What is -516325 divided by 103265? -5 What is -25440 divided by 2120? -12 Divide -869400 by 54. -16100 Calculate 8016 divided by -8. -1002 Calculate 0 divided by 348891. 0 What is -169688 divided by 84844? -2 -546147 divided by -21 26007 Calculate 48886 divided by 24443. 2 What is -5 divided by -22591? 5/22591 Divide 13 by 26464. 13/26464 What is -3 divided by 19717? -3/19717 Calculate 2313 divided by 6. 771/2 What is 574254 divided by 63806? 9 What is -4153096 divided by -8? 519137 Calculate -939585 divided by -15. 62639 What is -1824562 divided by 3? -1824562/3 Calculate 276827 divided by 276827. 1 -803 divided by -101 803/101 What is 1087270 divided by 217454? 5 4606 divided by -34 -2303/17 -66967 divided by 167 -401 Calculate 1753096 divided by -3. -1753096/3 Divide 66614 by -1. -66614 What is 13 divided by 9902? 13/9902 57436 divided by 2 28718 What is 42606 divided by 2? 21303 Divide -1 by 467428. -1/467428 -40955 divided by 1 -40955 What is -20085 divided by -309? 65 Calculate -16080 divided by 1608. -10 Divide 2266560 by 6. 377760 Calculate -7070069 divided by 150427. -47 Calculate 218 divided by 565. 218/565 What is 15926 divided by 22? 7963/11 What is 0 divided by -11767? 0 What is 490498 divided by -21326? -23 What is -13107 divided by -6? 4369/2 Calculate 13925 divided by -7. -13925/7 Calculate -102735 divided by 20547. -5 Calculate 306 divided by 7698. 51/1283 Calculate 8592 divided by 24. 358 Divide 1 by 224121. 1/224121 -801044 divided by 46 -17414 What is -281252 divided by -70313? 4 -2832 divided by -354 8 -1949 divided by 1083 -1949/1083 Divide -355 by 124. -355/124 Calculate 9 divided by -4005. -1/445 What is -150750 divided by -150? 1005 What is 163 divided by 177? 163/177 What is -130 divided by 3270? -13/327 What is 3 divided by 153449? 3/153449 Divide 321171 by 3. 107057 -3508080 divided by 48 -73085 43784 divided by -4 -10946 Calculate 17260 divided by -5. -3452 What is -98210 divided by 5? -19642 16 divided by 14025 16/14025 Calculate -1726677 divided by -27. 63951 Divide -2639 by -132. 2639/132 Divide 256233 by 3. 85411 Calculate 5 divided by 378792. 5/378792 -47056 divided by 47056 -1 5347740 divided by 57 93820 Divide -12 by 10098. -2/1683 Divide -8 by 199. -8/199 What is -335521 divided by 1? -335521 -524 divided by -1990 262/995 166092 divided by 5 166092/5 Divide -10496 by -64. 164 What is -1521 divided by -70? 1521/70 -35947 divided by -62 35947/62 169660 divided by 16966 10 402589 divided by -11 -36599 Calculate 344565 divided by -15. -22971 What is 61540 divided by -3077? -20 -326 divided by -422 163/211 -301380 divided by 6 -50230 Divide -283635 by -9. 31515 -78624 divided by 78624 -1 Calculate -174 divided by 37998. -29/6333 Calculate 12 divided by -1905. -4/635 Divide 62300 by 20. 3115 -494735 divided by 5 -98947 Calculate -18060 divided by 20. -903 Divide -22247 by -6. 22247/6 -156800 divided by 896 -175 What is -449642 divided by 4? -224821/2 -28773 divided by -9591 3 Calculate -13 divided by -4091. 13/4091 What is 210 divided by 1825? 42/365 Divide 4 by -8992. -1/2248 7 divided by -52418 -7/52418 Divide 1132597 by -2. -1132597/2 Divide -501906 by -1. 501906 -1288800 divided by 12 -107400 Divide 107 by 1602. 107/1602 Calculate -4320 divided by 80. -54 What is 60345 divided by -5? -12069 What is 13692 divided by -15? -4564/5 -184040 divided by -172 1070 Calculate 7128 divided by 81. 88 Divide 4 by 763466. 2/381733 Divide -38 by -4395. 38/4395 Calculate -1 divided by -564107. 1/564107 Divide 28114 by -66. -14057/33 -1095 divided by -60 73/4 What is 483 divided by 40? 483/40 What is 2883761 divided by 5? 2883761/5 1914 divided by -6 -319 What is -1140315 divided by -1? 1140315 Divide -2 by 5803. -2/5803 Calculate -2 divided by -506316. 1/253158 What is 53 divided by 6689? 53/6689 -2 divided by -1591 2/1591 What is -1631988 divided by -6? 271998 What is -44018 divided by 1? -44018 What is -20569 divided by 307? -67 What is 806166 divided by -4? -403083/2 What is -425587 divided by -3? 425587/3 -5642 divided by -2821 2 What is -1408260 divided by 6? -234710 Divide 211135 by 42227. 5 Divide 20502 by 9. 2278 Calculate 896800 divided by -50. -17936 Calculate 88782 divided by -6. -14797 Calculate -23325 divided by 3. -7775 What is 635096 divided by 1031? 616 Divide -2716 by -194. 14 Divide -2103 by 48. -701/16 Divide -1683332 by -4. 420833 What is -26 divided by -21520? 13/10760 What is 1065368 divided by -24776? -43 13 divided by -84077 -13/84077 Divide 370 by 4344. 185/2172 Divide 108378 by -36126. -3 -336630 divided by -147 2290 640 divided by -378 -320/189 -866263 divided by -283 3061 Calculate -667524 divided by 44. -15171 What is 0 divided by 54895? 0 Calculate -2583 divided by 2583. -1 -39241 divided by 1 -39241 Divide -13818 by -282. 49 -	{ "pile_set_name": "DM Mathematics" }
. 29848 What is the smallest common multiple of 110 and 90? 990 Calculate the lowest common multiple of 1 and 607. 607 What is the common denominator of -9/5 and -41/66? 330 What is the least common multiple of 8 and 2146? 8584 What is the least common multiple of 6 and 4982? 14946 What is the lowest common multiple of 5 and 75358? 376790 Calculate the least common multiple of 208 and 24. 624 Calculate the least common multiple of 66 and 2460. 27060 Find the common denominator of 137/192 and -7/124. 5952 What is the common denominator of -49/39 and -22/639? 8307 What is the common denominator of -31/30 and 53/40? 120 Calculate the least common multiple of 32 and 144. 288 Find the common denominator of 1/620 and -91/20. 620 What is the common denominator of -59/54 and -23/16? 432 Calculate the common denominator of 103/52 and 19/24. 312 What is the least common multiple of 24 and 66? 264 What is the lowest common multiple of 18 and 72? 72 What is the lowest common multiple of 116 and 2204? 2204 Calculate the common denominator of 115/2112 and -27/44. 2112 Calculate the least common multiple of 297 and 55. 1485 Calculate the least common multiple of 3048 and 18. 9144 What is the common denominator of -35/232 and -61/145? 1160 Find the common denominator of -133/24 and 37/63. 504 Calculate the common denominator of 83/5828 and 65/18. 52452 Calculate the common denominator of -41/55 and 40/33. 165 What is the common denominator of -67/14 and -141/140? 140 What is the common denominator of -109/40 and -1/86? 1720 Find the common denominator of -149/552 and 89/138. 552 Calculate the smallest common multiple of 2844 and 948. 2844 Calculate the smallest common multiple of 1275 and 30. 2550 What is the common denominator of 13/24 and -53/6? 24 Find the common denominator of -113/1092 and 107/3192. 41496 What is the smallest common multiple of 446 and 53? 23638 What is the lowest common multiple of 4 and 20? 20 What is the smallest common multiple of 12 and 9? 36 Calculate the common denominator of -103/84 and -145/1812. 12684 Calculate the common denominator of 87/608 and 91/2. 608 Calculate the common denominator of -28/9 and 101/16374. 49122 Calculate the common denominator of 20/21 and 23/7. 21 Find the common denominator of -31/70 and 107/12. 420 Find the common denominator of -88/75 and -37/195. 975 Find the common denominator of 75/13502 and -22/3. 40506 Calculate the common denominator of 41/7755 and 26/3525. 38775 What is the common denominator of 37/55 and -1/665? 7315 What is the least common multiple of 36 and 600? 1800 Find the common denominator of -33/4 and -19/32. 32 What is the smallest common multiple of 44 and 55? 220 What is the smallest common multiple of 76 and 128? 2432 What is the least common multiple of 16 and 342? 2736 Calculate the common denominator of -59/3 and -103/12. 12 Calculate the common denominator of 2/7 and -16/23. 161 What is the common denominator of 101/50 and 57/185? 1850 What is the common denominator of 91/162 and -49/10? 810 What is the common denominator of 61/12 and -101/44? 132 Calculate the common denominator of 27 and -37/82. 82 Calculate the common denominator of 23/477 and 17/351. 18603 Calculate the common denominator of 29/76 and -111/44. 836 What is the smallest common multiple of 56 and 728? 728 Calculate the smallest common multiple of 260 and 654. 85020 What is the common denominator of 1/6 and 67/144? 144 What is the smallest common multiple of 101 and 6? 606 What is the least common multiple of 10 and 667? 6670 Find the common denominator of 139/1224 and -37/136. 1224 Find the common denominator of -65/2772 and 127/2772. 2772 Calculate the least common multiple of 7 and 2. 14 Calculate the common denominator of 149/180 and 83/24. 360 What is the common denominator of -69/152 and -103/40? 760 What is the common denominator of 97/48 and -109/630? 5040 Calculate the common denominator of 46/5 and -101/4. 20 Find the common denominator of -12/13 and -43/9. 117 What is the least common multiple of 160 and 160? 160 What is the smallest common multiple of 25 and 1995? 9975 What is the lowest common multiple of 560 and 252? 5040 Calculate the common denominator of 83/4 and 24/5. 20 Find the common denominator of 149/18 and -25/1197. 2394 What is the smallest common multiple of 5 and 1135? 1135 Find the common denominator of 67/102 and -2/21. 714 Calculate the least common multiple of 297 and 99. 297 Calculate the lowest common multiple of 22 and 11. 22 What is the least common multiple of 24 and 58? 696 Calculate the lowest common multiple of 360 and 16. 720 What is the least common multiple of 40 and 10? 40 Find the common denominator of -107/1974 and 103/12. 3948 What is the lowest common multiple of 12 and 9610? 57660 Calculate the least common multiple of 44 and 254. 5588 What is the least common multiple of 292 and 2993? 11972 Calculate the common denominator of -31/6 and -43/90. 90 What is the common denominator of -73/2318 and -93/16? 18544 What is the smallest common multiple of 4 and 26516? 26516 Calculate the common denominator of -81/484 and -119/24. 2904 What is the common denominator of 35/236 and -19/132? 7788 Calculate the lowest common multiple of 3474 and 30. 17370 What is the least common multiple of 18 and 767? 13806 Calculate the least common multiple of 49 and 16. 784 What is the lowest common multiple of 120 and 576? 2880 What is the smallest common multiple of 130 and 80? 1040 Calculate the least common multiple of 168 and 234. 6552 Calculate the common denominator of 8/75 and -173/60. 300 What is the common denominator of -59/6 and 143/474? 474 What is the common denominator of -69/10 and 48/43? 430 What is the common denominator of 49/4 and -149/5676? 5676 Calculate the least common multiple of 20 and 1372. 6860 What is the smallest common multiple of 2 and 2? 2 What is the lowest common multiple of 40 and 5376? 26880 Calculate the least common multiple of 44 and 24. 264 Calculate the common denominator of -31/30 and 35/1458. 7290 Calculate the common denominator of -145/1344 and -35/2112. 14784 Find the common denominator of 1/28 and -23/3. 84 Calculate the common denominator of 14/13 and -115/14. 182 Calculate the smallest common multiple of 72 and 9. 72 What is the lowest common multiple of 5 and 21? 105 Find the common denominator of -77/360 and -49/180. 360 What is the lowest common multiple of 25 and 150? 150 Find the common denominator of -19/172 and -6/11. 1892 What is the smallest common multiple of 800 and 900? 7200 What is the lowest common multiple of 50 and 15? 150 Find the common denominator of 163/90 and 76/1125. 2250 What is the common denominator of -101/1584 and 79/3168? 3168 Calculate the lowest common multiple of 96 and 27. 864 What is the lowest common multiple of 164 and 4? 164 What is the smallest common multiple of 76332 and 16? 305328 Calculate the common denominator of 31/98 and 5/1197. 16758 What is the common denominator of 42/779 and -26/3? 2337 Calculate the lowest common multiple of 140 and 2380. 2380 Calculate the common denominator of -91/50 and 1/200. 200 What is the common denominator of -101/3980 and -25/4378? 43780 What is the lowest common multiple of 546 and 21? 546 What is the least common multiple of 384 and 15? 1920 Calculate the least common multiple of 4 and 250. 500 What is the smallest common multiple of 132 and 132? 132 Find the common denominator of 129/1240 and 5/744. 3720 Calculate the common denominator of 25/112 and 71/16. 112 Calculate the smallest common multiple of 1029 and 63. 3087 What is the least common multiple of 6213 and 33? 68343 What is the smallest common multiple of 12 and 40? 120 Find the common denominator of 79/28 and -13/588. 588 Calculate the common denominator of -77/36 and -79/160. 1440 Calculate the common denominator of 53/869 and -17/790. 8690 Calculate the smallest common multiple of 780 and 2. 780 Find the common denominator of 7/8 and 99/184. 184 Calculate the lowest common multiple of 108 and 6. 108 Calculate the common denominator of -49/75 and -1/150. 150 What is the smallest common multiple of 10 and 2064? 10320 What is the smallest common multiple of 451 and 123? 1353 What is the least com	{ "pile_set_name": "DM Mathematics" }
Is a a prime number? True Is 356/2314 - (-31534)/26 a composite number? False Let f(o) = 170o - 4. Let t = -12 - -20. Let m be f(t). Suppose m = 5c - 1249. Is c a composite number? False Let y(q) = q3 + q2 + q + 6469. Suppose -3j + 2 = b, -b - 1 + 3 = -3j. Is y(j) a composite number? False Suppose -2s + 49778 + 2852 = 4b, 3b - 5s - 39466 = 0. Is b composite? True Let z(b) = 4b3 - 9b*2 + 3b - 11. Suppose 9 + 18 = 3c. Is z(c) composite? False Let o be ((-48)/(-3))/(-4) - -6. Suppose -ou - 9 = u. Is (u/1 - -4)553 a prime number? False Suppose -6 = 2o + 6. Is (-2)/(-4) - 255/o composite? False Let j be 2/(-11) + 34791/(-11). Is (j/3)/((-11)/33) a composite number? False Suppose -3s + 78096 = 3z, 2s + 78104 = 5s - 5z. Is s composite? True Let t(r) = 4r2 - r - 2. Let w(b) = -b3 - 8b2 + 2b + 9. Let q be w(-8). Is t(q) prime? False Suppose 0 = -3v + 2b + 5423, 0 = -5v - 4b + b + 9013. Suppose 2d + 3r - 621 = 0, 4r - 195 = 5d - v. Suppose 2n + n - d = 0. Is n prime? False Let u = 2168 + 269. Is u a composite number? False Let m = -54 - -252. Suppose -8k = -14k + m. Is k prime? False Suppose -25z = -24z - 4. Suppose 5g = 2i - 146 + 2145, -zi - 790 = -2g. Is g composite? False Is 248/160 + (-27782)/(-5) a prime number? True Is -6 + (0 - 6) - -89417 a prime number? False Let r = -1606 + 3705. Is r prime? True Suppose -12 = -3v - 0. Suppose vd - 564 = -0d. Is d a composite number? True Suppose -27861 = 70n - 73n. Is n a prime number? False Let n be (2/5)/(6/210). Suppose g = 2, -2d - n = -3d - 5g. Let t(b) = 113b - 5. Is t(d) composite? True Let z = -58 + 55. Is (5 - (z + 4)) + 947 + 0 a prime number? False Is (-61 - 9972)(1 + -2) prime? False Suppose 25u - 30u + 5 = 0. Is (-97)/1-10 - (4 - u) a prime number? True Let a be -750(1 - 0/3). Let p be a/(-21) - (-6)/21. Suppose 0o = -4o + p. Is o a composite number? True Let i = -879 + 1648. Is i prime? True Suppose 7w + 12730 = 4b + 4w, 3w = 3b - 9549. Is b composite? False Suppose 5t + 3c - 2c = 15, t - 5c = 29. Suppose 0 = tu - 90 - 1522. Is u a prime number? False Suppose 6f - 5 = 5f. Suppose 309 + 819 = s + fc, 3364 = 3s - 5c. Is s composite? False Let z(c) = -c2 - 8c - 9. Let t be z(-6). Let p = 61 - 58. Suppose -pq - tv - 2v = -330, q - 118 = v. Is q prime? False Is (146348/1)/41 prime? True Let y be 6/18 + (-5)/(-3). Suppose -1911 - 1003 = -yc. Is c a composite number? True Let b(h) = 2h*2 + 12h + 21. Is b(34) prime? True Suppose 0 = -u + 5m - 21, 2u + u - 2m = 2. Suppose 2i - 4111 = -3w, -5w - ui + 8542 = 1689. Is w composite? True Is (-2 - 938/(-6))/(3/45) composite? True Suppose 108116 = 2u + s, 0 = u + 2s - 7s - 54069. Is u prime? True Suppose -298 = -6c + 1964. Is c a prime number? False Suppose 0 = -4k - 4r - 60, -6k - 40 = -5k - 4r. Is (-29)/((k/(-55))/(-4)) prime? False Let w = 109 - 104. Suppose -wa = -5n + 740, -3a + 15 = -6a. Is n a prime number? False Let r be (-1)/(4/(-56)1 - 0). Let g(w) = 67w - 5. Is g(r) a composite number? True Let u(w) be the second derivative of -587w3/3 + 25w*2/2 + 2w - 3. Is u(-3) a prime number? True Let k = 1381 + -3475. Let b = k - -3235. Suppose 0 = 4a + 297 - b. Is a prime? True Let u be (-3)/(36/16 + -3). Suppose -un + 1652 = -0n. Is n a prime number? False Let w(y) = -336y - 43. Is w(-17) a composite number? False Suppose -p - 51693 = -3f, 2f - 12p = -11p + 34462. Is f composite? False Suppose -3g + 31 - 3 = 4z, -5g = 3z - 10. Let n(w) = 106w + 22. Is n(z) a prime number? False Let b(o) = -132o - 34. Let w be b(20). Let s = w - -8901. Is s a prime number? False Let g be (-53262)/(-24) + 10/(-8). Let y = g + -65. Is y prime? True Suppose 4j + 2 = 2j. Let y be 0/(-3) + j + 165. Suppose 0 = -o - o + y. Is o composite? True Let j be (-1)/(-13/33). Suppose 4i - 5 = j. Suppose 35 = ip + 5o, 4o = 3p + o - 33. Is p composite? True Let q(w) = 2w2 - 34w - 99. Is q(-20) a composite number? False Let g = -24 + 24. Is -3 - g - 4-20 a composite number? True Suppose -3 = 3c - 2h - 1, 2c + 13 = -h. Let k(f) = f + 6. Let s be k(c). Suppose -3i = -3n - 1419, 3i + 4n - sn = 1419. Is i a composite number? True Let s(p) = 1828p + 41. Is s(5) composite? False Let l be 8/6(-381)/(-2). Suppose -49s + 37 = -50s. Let u = s + l. Is u composite? True Let j(o) = 82o - 1. Let n(v) = v + 1. Let t be n(2). Suppose -6r = -tr - 6. Is j(r) a prime number? True Let y = 20 + -13. Let b be (5 + 1)(y + -6). Suppose 0 = 2f + b - 130. Is f a prime number? False Let x = -173 - -3424. Is x composite? False Let v = 1845 + -1142. Is v a prime number? False Suppose -322264 = -8w + 380560. Is w a composite number? False Let d(b) = -90b - 129. Is d(-9) composite? True Let d(s) = 2s3 - 7s*2 + 8s - 19. Let x be (-2)/(-5) - 48/(-5). Is d(x) a composite number? False Let h(u) be the first derivative of u*4/4 - 14u*3/3 - 11u*2/2 + 27u - 44. Is h(15) composite? True Let f(i) = 6i3 - 5i*2 + 14i + 7. Let h(x) = x3 + x2 + 1. Let c(g) = -f(g) + 5h(g). Let k = -4 + 10. Is c(k) prime? False Let x be (-7713)/(-81) + 2/(-9). Suppose 4r - 247 = -x. Is r prime? False Suppose 0 = -11j + 9j + 2k + 1090, -5j + 2717 = -k. Is j composite? True Let o(g) = 1021g - 21. Let z be o(-5). Let s = -3237 - z. Is s composite? False Let b = -6287 - -9166. Is b a composite number? False Is -6 - -10 - (-7402 + -3) a composite number? True Let m(f) = -2f*3 + 4f*2 - 2f. Let k be m(2). Suppose t = 5t + 16. Is 2/t - 766/k composite? False Let o(f) = -f2 + 13f + 3. Let k be o(8). Suppose -7r + k = -8r. Is (r/1)/(-8 + 7) prime? True Let v(o) = -428o3 + o2 - 5o - 5. Is v(-2) a composite number? False Let a(m) = -21m + 3. Suppose -2l - 37 = -3g, 0 = 4g + 2l + l - 21. Suppose 2t + g = 1. Is a(t) a prime number? False Let c be (-3)/((-36)/16 - -3). Is (111/c)/(15/(-260)) a prime number? False Let r = -9 - -1. Let w be 1173/15 - r/(-40). Let z = w + -52. Is z prime? False Suppose 0 = -c + 4. Suppose 3d - 2a = 263, d = cd + 3a - 273. Is d composite? False Let s(k) = 3k3 - 5k*3 + 0k*3 - 74 + 2k + 69 + 4k2. Is s(-5) a composite number? True Let k(j) = -349j - 1. Let g(t) = -1. Let o(b) = -5g(b) + k(b). Is o(-1) prime? True Suppose 4j - 4 = 2j. Suppose 732 - 2087 = -5t + 5c, 533 = jt - 5c. Is t composite? True Let s be (-2)/(-15) - 32/15. Let k be (s + (-5)/3)18. Let l = k + 97. Is l a prime number? True Let m(n) = 7n - 3. Let a be m(4). Suppose r - 3h = h - 5, 0 = -2r + h + a. Suppose 2c + r = -c, -q + 2c = -93. Is q a prime number? True Let y = -53922 + 16452. Is (y/(-18))/((-1)/(-3)) a composite number? True Suppose -p + 246 = -5p + 2z, 3p = -z - 192. Let y = p + 150. Is y composite? True Suppose -5d + 5946 = u, 0 = -2u + d + 810 + 11093. Suppose -15m = -4m - u. Is m prime? True Suppose 0h = -h. Suppose h = 7v - 4v - 402. Is v a composite number? True Suppose 2y = 20 + 20. Let d = 83 - y. Suppose 0 = -c + 4c - d. Is c composite? True Suppose -92p + 90p = -4614. Is p a prime number? False Suppose -3 = 3i - 15. Suppose 0 = iv + 4r - 40, -r = -4r - 12. Is v prime? False Suppose 5j - 3794 = -3p, -275 - 473 = -j + 3p. Is j a composite number? False Let s be 0/(5 - (5 + -1)). Is 853/(-1 - (s - -1 - 3)) a composite number? False Let n(v) = 2v2 - 4v - 19. Let k = 2 + -9. Let u = k - -15. Is n(u) prime? False Suppose h - 3696 = -2h. Let m = h - -988. Is (2/6)/(10/m) a prime number? False Let x be ((-27)/2)/(9/2700). Let m = 6769 + x. Is m prime? True Let f(h) = 3h*2 + h - 4. Let o be f(3). Suppose -1731 = -29q + oq. Is q composite? False Let a(m) = m + 7m + 2m2 - 5 - m2 - m. Let k be a(-8). Is (-2)/k + 1347/9 prime? True Let k(h) = -h3 + 5h*2 + 2h + 5. Let m be k(8). Let o = -363 - m. Let p = 23 - o. Is p composite? True Let z(p) = -208p - 27 + 18 - p - 86p. Is z(-4) a composite number? False Is -331(1/(-2) + (-5)/10) a prime number? True Suppose -4i = -2m - 30, -2i + 2m + m = -25. Let h(f) = -2 - 5f*2 + 5f + 3 + f*3 + 0f*3. Is h(i) a composite number? True Suppose -87042 = -29x + 28639. Is x prime? True Let j = 1184 - 804. Let h = j - 121. Is h prime? Fa	{ "pile_set_name": "DM Mathematics" }
1638408, 1643266? 1649510 What is next in 92022, 183727, 275418, 367089, 458734, 550347, 641922? 733453 What comes next: -7614, -7869, -8264, -8775, -9378, -10049, -10764? -11499 What is next in 27013486, 54026994, 81040502? 108054010 What comes next: 49429278, 98858555, 148287832, 197717109, 247146386? 296575663 What is next in -2815, -9762, -20855, -36088, -55455, -78950? -106567 What is next in 59934853, 119869707, 179804561, 239739415? 299674269 What is next in -1202421, -1202416, -1202409, -1202400, -1202389, -1202376? -1202361 What is next in -4007, -8095, -12261, -16505, -20827, -25227? -29705 What is next in -10535048, -21070117, -31605202, -42140309, -52675444? -63210613 What is next in -186, -542, -1116, -1956, -3110? -4626 What is next in 591804, 591821, 591838, 591855, 591872? 591889 What comes next: -46406, -46052, -45700, -45350? -45002 What is the next term in 35057, 64568, 94079? 123590 What is next in -435571, -435558, -435543, -435526? -435507 What comes next: -12376, -12414, -12480, -12574, -12696, -12846, -13024? -13230 What comes next: 87, 173, 277, 399, 539, 697, 873? 1067 What is next in -38106462, -76212926, -114319390, -152425854? -190532318 What is next in 7048864, 7048909, 7049034, 7049281, 7049692, 7050309, 7051174? 7052329 What comes next: -3587, -7619, -12521, -18725, -26663, -36767, -49469? -65201 What is next in -647, 2939, 6525, 10111, 13697? 17283 What is the next term in -220490281, -220490280, -220490279, -220490278? -220490277 What is next in -13771, -27633, -41495, -55357, -69219, -83081? -96943 What is the next term in -8909, -17679, -26297, -34757, -43053, -51179, -59129, -66897? -74477 What is the next term in -14268802, -28537606, -42806410, -57075214? -71344018 What comes next: 5989112, 23956458, 53902036, 95825846, 149727888, 215608162, 293466668? 383303406 What is the next term in 769126, 769123, 769120, 769117? 769114 What is next in -31916, -30364, -28822, -27296, -25792, -24316, -22874? -21472 What is the next term in -176695, -353393, -530091, -706789? -883487 What is the next term in 10904, 44395, 100464, 179111, 280336? 404139 What comes next: -14349, -14869, -15373, -15861? -16333 What comes next: -1514680, -3029361, -4544042? -6058723 What is the next term in 6192, 10248, 14288, 18306, 22296, 26252, 30168, 34038? 37856 What is the next term in 277, 1220, 2815, 5062, 7961? 11512 What is the next term in -11834, -11851, -11848, -11813, -11734, -11599, -11396? -11113 What comes next: 1316509, 1316527, 1316545, 1316563? 1316581 What is next in -154088, -613915, -1380292, -2453219, -3832696, -5518723, -7511300? -9810427 What is the next term in 10095, 8917, 7739, 6561, 5383, 4205? 3027 What comes next: 522, 2072, 3636, 5226, 6854, 8532, 10272? 12086 What is next in -892, -2630, -5474, -9382, -14312, -20222, -27070? -34814 What is next in 2828, 22636, 76416, 181154, 353836, 611448? 970976 What comes next: -20316, -41048, -61774, -82494, -103208, -123916, -144618? -165314 What is next in -6724, -13668, -20866, -28324, -36048, -44044, -52318? -60876 What is next in -1753, -7161, -16297, -29155, -45729, -66013, -90001? -117687 What is next in -6518, -12999, -19480, -25961? -32442 What is next in -2140, -7691, -16918, -29827, -46424, -66715, -90706? -118403 What is next in -14923, -119402, -402949, -955084, -1865327, -3223198, -5118217? -7639904 What is next in 2958, 2762, 2142, 858, -1330, -4662, -9378, -15718? -23922 What comes next: 13171, 23523, 33875, 44227, 54579, 64931? 75283 What is next in -61, -5, 177, 485, 919? 1479 What comes next: -1079292, -2158437, -3237582? -4316727 What is the next term in 2029779, 4059547, 6089315, 8119083? 10148851 What is the next term in 2295, 2166, 1961, 1680? 1323 What is the next term in 761929, 1523718, 2285507, 3047296? 3809085 What is next in 196438925, 392877853, 589316781, 785755709? 982194637 What comes next: -156351, -312434, -468517, -624600, -780683, -936766? -1092849 What is next in -1682195, -1682197, -1682193, -1682177, -1682143, -1682085, -1681997? -1681873 What is next in -423728, -1697474, -3820394, -6792494, -10613780, -15284258? -20803934 What is next in -453834, -453813, -453780, -453729, -453654, -453549, -453408, -453225? -452994 What is next in -5456847, -10913774, -16370701? -21827628 What is next in -369, -2625, -8655, -20343, -39573, -68229, -108195? -161355 What is next in 4121, 8334, 12587, 16874, 21189, 25526? 29879 What is the next term in -26216, -52356, -78404, -104354, -130200, -155936, -181556? -207054 What comes next: 5361, 5444, 5563, 5730, 5957, 6256? 6639 What comes next: -1768116, -3536225, -5304330, -7072431, -8840528? -10608621 What is the next term in 28550, 28565, 28584, 28607, 28634, 28665? 28700 What is the next term in -56632, -113389, -170144, -226897, -283648? -340397 What is the next term in 3473, 13605, 30305, 53417, 82785, 118253? 159665 What is the next term in 3710, 11654, 23828, 40232, 60866? 85730 What comes next: 271907236, 271907233, 271907228, 271907221, 271907212? 271907201 What is next in 2361, 4178, 5437, 6120, 6209, 5686? 4533 What is the next term in 45065, 44056, 43047, 42038? 41029 What comes next: 763, 703, 561, 301, -113, -717, -1547, -2639? -4029 What is the next term in 3968653, 7937214, 11905773, 15874330, 19842885? 23811438 What comes next: 38736, 71655, 104574, 137493? 170412 What comes next: -4316, -4914, -5508, -6098? -6684 What is the next term in 11896, 49090, 111584, 199372, 312448? 450806 What comes next: -38743, -38811, -38879? -38947 What is next in 132288, 264242, 396198, 528156, 660116? 792078 What comes next: 89122, 89209, 89294, 89377, 89458, 89537, 89614? 89689 What is the next term in 13679, 27245, 40807, 54365, 67919, 81469? 95015 What comes next: 1234, 16682, 58612, 140266, 274886, 475714, 755992, 1128962? 1607866 What is next in -13649, -13581, -13469, -13319, -13137? -12929 What is the next term in 8839, 14868, 20881, 26872, 32835, 38764? 44653 What is next in -188, -575, -1164, -1955, -2948, -4143, -5540? -7139 What is next in 47864, 95562, 142926, 189788, 235980, 281334, 325682, 368856? 410688 What comes next: 54446, 54462, 54474, 54470, 54438? 54366 What is next in 1243, 5809, 13417, 24067, 37759? 54493 What is the next term in 37695847, 37695850, 37695853, 37695856, 37695859? 37695862 What is next in -252, -414, -514, -558, -552? -502 What is next in -91947, -184002, -276057, -368112, -460167, -552222? -644277 What is the next term in -6054, -12692, -19330, -25968, -32606, -39244? -45882 What comes next: 29668937, 29668938, 29668939, 29668940? 29668941 What is the next term in 274061, 548124, 822183, 1096238, 1370289, 1644336? 1918379 What comes next: -34488, -69111, -103810, -138585, -173436, -208363? -243366 What is the next term in -1757250, -1757277, -1757322, -1757385, -1757466? -1757565 What is the next term in -11017252, -22034517, -33051784, -44069053, -55086324, -66103597? -77120872 What is the next term in 43896427, 43896423, 43896419, 43896415, 43896411? 43896407 What comes next: -85690, -171436, -257228, -343060, -428926, -514820? -600736 What comes next: 778742, 778730, 778718, 778706? 778694 What comes next: 4132425, 4132428, 4132431, 4132434, 4132437? 4132440 What is the next term in -2272534, -2272528, -2272522, -2272516? -2272510 What comes next: 150912667, 301825333, 452737999, 603650665, 754563331, 905475997? 1056388663 What is the next term in -688, -3051, -7538, -14599, -24684, -38243, -55726, -77583? -104264 What comes next: -1238179, -4952824, -11143931, -19811500, -30955531, -44576024? -60672979 What comes next: 12785, 1902, -8983, -19870? -30759 What is next in 387509, 775041, 1162575, 1550111, 1937649? 2325189 What is next in 1744, -7646, -23288, -45176, -73304, -107666, -148256? -195068 What comes next: 37, 335, 881, 1669, 2693, 3947? 5425 What is next in -163417, -653808, -1471153, -2615458, -4086729, -5884972? -8010193 What is the next term in -63082, -126107, -189132, -252157? -315182 What is next in -440, -6401, -22558, -54005, -105836, -183145, -291026? -434573 What comes next: -1192777254, -1192777255, -1192777256, -1192777257, -1192777258, -1192777259? -1192777260 What is the next term in -2644, -6682, -13502, -24496, -41056, -64574	{ "pile_set_name": "DM Mathematics" }
(-9)b/(((b*24/b)/bb)/b) assuming b is positive. b(-30) Simplify u(-4)uu*(-5)uuu/u*(-3/2)u(3/4) assuming u is positive. u(-11/4) Simplify (cc2c)(1/3)/((c/c0)/c)36 assuming c is positive. c(4/3) Simplify (o/(o/o(1/4)))(-1/16)/(o(-1))(2/133) assuming o is positive. o*(-5/8512) Simplify (yy(y(-44)y)/y)/yy/y(-13/6) assuming y is positive. y(-239/6) Simplify (b(-1))(17/5)b/((bb(-2/3))/bb)(b/b(-6/7))/b assuming b is positive. b(-197/105) Simplify (uuuu*(-2/7)u)(1/5) assuming u is positive. u(26/35) Simplify (z/(z/(z((z/z(2/5))/zz)/z)))*(1/42)/((zzz/(z/((zz/z*(-2/25))/z))z)/(zzz(-11))) assuming z is positive. z(-4573/350) Simplify (sss0/s)(-6/5)ss(s(s/s*3)/s)/sss4 assuming s is positive. s(14/5) Simplify (uu/u*2uu)(1/19) assuming u is positive. u(2/19) Simplify (((d/(dd((ddd0)/d)/d))/d)/d)(4/21)/((d/(d/d2))/d)(-18) assuming d is positive. d(122/7) Simplify ((g(-1/6)/g)/(((g/(gg*0/g)g)/g)/g))(1/9) assuming g is positive. g(-7/54) Simplify b*(-15)bb(-4/21) assuming b is positive. b(-298/21) Simplify bb*(-1)b/b*0(b(1/3)/b)(-1/18) assuming b is positive. b(28/27) Simplify (((t(-3/10)/t)/t)/t)33 assuming t is positive. t(-1089/10) Simplify (q11)(2/3) assuming q is positive. q(22/3) Simplify d(-17)d(-5)d assuming d is positive. d(-21) Simplify (a0)*(-23/6)/(aa/(a*(3/2)/a)a2) assuming a is positive. a(-7/2) Simplify (q*(-3)q/q(-2))/(q7q(2/17)) assuming q is positive. q(-121/17) Simplify (g(-1))(-24)/((g(-4/9)g)/g4) assuming g is positive. g(247/9) Simplify ((pp/(pp*1p))/(p/p*(5/3)))/(p/(pp*(4/3))p/(p/((pp(-1))/p))) assuming p is positive. p2 Simplify ddd(1/21)d(-15) assuming d is positive. d(-272/21) Simplify ((f*2f)/f)/f*(2/13)(f/(f(-2/7)/f))(-2/79) assuming f is positive. f(12856/7189) Simplify (v(-4))(2/15) assuming v is positive. v(-8/15) Simplify u*2u(21/2) assuming u is positive. u(25/2) Simplify ((w/(ww(1/2)))/ww*(-1/2))/(www/w2w)(-10) assuming w is positive. w18 Simplify (ss(2/5)s)*(-19)/((ss*(-2/5)s)/s)(-45) assuming s is positive. s(-93/5) Simplify (u/u(1/3))39/(u(1/4))49 assuming u is positive. u(55/4) Simplify h(-12)/(hhhhh*(-1/2)h) assuming h is positive. h*(-33/2) Simplify i/(ii*(-14))i/((i*4i)/i) assuming i is positive. i11 Simplify (x0)*29(x*0x)(1/5) assuming x is positive. x(1/5) Simplify ((o(-1))(-2))(-40) assuming o is positive. o(-80) Simplify (q*(1/10)/(q/((qq(2/21))/q)))26 assuming q is positive. q*(-2197/105) Simplify ll/(l*(-1/5)/l)llll(-10)/ll assuming l is positive. l*(-19/5) Simplify ((ii*(1/2))/((i/(i/(ii*(2/15)i)))/i))(-41) assuming i is positive. i(-451/30) Simplify r*(-12)/(rr/r(1/2)) assuming r is positive. r(-27/2) Simplify (q*(-13)qq)/(q(2/35)q) assuming q is positive. q(-422/35) Simplify (v/v6)(-1/10) assuming v is positive. sqrt(v) Simplify w(1/6)/(w/w*2w) assuming w is positive. w*(1/6) Simplify ((y/((yy*0/y)/yy))/y)/y*2y(-1/3)/y(1/7) assuming y is positive. y(-52/21) Simplify p(-2/67)/(p*(18/7)/pp) assuming p is positive. p*(-1220/469) Simplify (r/(r/(rr(1/3)/r)))(-16)/((r*(-4)r)/(r/(r/(rr1)))) assuming r is positive. r(-1/3) Simplify ((r(-4))11)(-1/21) assuming r is positive. r(44/21) Simplify (a0)(-7/3)/((aaa(-6/11))/(a3/a)) assuming a is positive. a(6/11) Simplify (n/(n/(n(2/7)n)n))18 assuming n is positive. n(36/7) Simplify (u6/u)/(u(2/29)/u) assuming u is positive. u(172/29) Simplify (g/((((g/(g10g))/g)/gg)/g))14 assuming g is positive. g182 Simplify v(-5/4)/v(-34) assuming v is positive. v(131/4) Simplify ((d(1/6))19)(-3/2) assuming d is positive. d(-19/4) Simplify (ll(-2))(-36/5)/((l/l2)/l)(-7) assuming l is positive. l(-34/5) Simplify (o/o(-3/4)oo/(((o/(o*(1/5)o))/o)/o))/(o*0/oo)(1/7) assuming o is positive. o(119/20) Simplify (vv(3/11))/vv(-1/29) assuming v is positive. v(76/319) Simplify ((q/(q/q(1/10)))/(q(-5)q))/(qqq/(q(-2/3)q))9 assuming q is positive. q(-199/10) Simplify (u/(uu(-1/11))u/(u((uu/(uu3))/u)/u))(-25/2) assuming u is positive. u(-1125/22) Simplify (ss/(sss*5ss))(-7/3) assuming s is positive. s(49/3) Simplify (s2/s3)/((s(2/11)/s)/ss(-2/7)) assuming s is positive. s(85/77) Simplify (cc(c*1c)/c)*(-18/7)/(c/((c(cc(-9)/c)/c)/c)cc(-1)) assuming c is positive. c(-131/7) Simplify ((a(-2/3))(-3/7))(2/115) assuming a is positive. a(4/805) Simplify (k(-13))45 assuming k is positive. k(-585) Simplify (tt*(-3)t(tt*0tt)/t)2 assuming t is positive. t2 Simplify j(9/5)/jj(7/4) assuming j is positive. j(51/20) Simplify ((o/(o/o(-2/7)))/o)18/((o/(oo(2/7))o)/o(oo(-3/2))/o) assuming o is positive. o(-299/14) Simplify (gg(-2)g/(g/(g/g14)))20 assuming g is positive. g*(-280) Simplify (t/(tt1/t))(-25/2)/((tt/(t(t/(tt/t(5/4)))/t))/tt0/t) assuming t is positive. t(1/4) Simplify (qqq/(q/q8))/q(1/5) assuming q is positive. q*(49/5) Simplify ((mm/(((m/(((m/(m/m*(-1)))/m)/mmm))/mm)/m))(-1/32))(-13) assuming m is positive. m(13/32) Simplify (c(3/4)c)44 assuming c is positive. c77 Simplify (r1)(-8/13)/((((r/(((r6/rrr)/r)/r))/r)/rr)/(r/(rr/((r(1/5)/r)/r))rr)) assuming r is positive. r(233/65) Simplify bb/b*(-28)bb(-30) assuming b is positive. b Simplify (oo(-1))(-29/4)o(2/9)/(oo*(-3)o) assuming o is positive. o*(11/9) Simplify ((pp/(p/((p*4/p)/p))p)/p)/p*4((p(-6)/p)/p)/p(-1/4) assuming p is positive. p(-35/4) Simplify (n(-18)/nn)7 assuming n is positive. n(-126) Simplify (xx*(2/21))/(xx/x*(-1/8))x*(1/2)x0 assuming x is positive. x(-89/168) Simplify j*(-7)/((jj*6)/j)(j(-2/5))40 assuming j is positive. j*(-29) Simplify ((bb*(2/7)b)/(b/b*4b))(-24) assuming b is positive. b(-720/7) Simplify (ddd(d/(dd*(2/11)))/ddd/(d/d(-1/5)))/((dddd*(-5))/ddd/(d(-3)d)) assuming d is positive. d*(89/55) Simplify (k(k(2/27)/k)/k)(-2/9) assuming k is positive. k(50/243) Simplify (z(-1))(25/4)/(z5/z(-1/2)) assuming z is positive. z(-47/4) Simplify ((r8/r)/(((r/(r/(r/r(-5/7))))/r)/r))/((rr(-3/4)/rr)/rrrr(2/19)) assuming r is positive. r(3155/532) Simplify g(-1/8)g(4/5) assuming g is positive. g(27/40) Simplify ll0ll(-18) assuming l is positive. l(-16) Simplify (u/(uu(uu/((u/(u/u*1u))/u))/uu))(-3/20)((uu(-4))/u)/(u/(uu*(2/3)u)) assuming u is positive. u(-26/15) Simplify (p(4/5))11 assuming p is positive. p(44/5) Simplify (h/h*(3/5))/(hhh/(hhhhh/(h/(h/(h5h))h)hh))h*(-4/3)h(-2) assuming h is positive. h(-89/15) Simplify (s10/(s/s(1/4)))/((s*(2/9)s)/s10) assuming s is positive. s(649/36) Simplify a*(1/7)(aa15)/a assuming a is positive. a(106/7) Simplify ((t/t(-6))/((t(-2/3)/t)/t))/((t4t)/(tt1t)) assuming t is positive. t(23/3) Simplify (b(-5)b(-6))/((b(1/12)/b)/(bb8)) assuming b is positive. b(-13/12) Simplify ((yyy/((y*(-7/4)yyy)/yy))/y)/(y/(y/(y34y))yy) assuming y is positive. y(-145/4) Simplify ((i2i)46)(2/11) assuming i is positive. i(276/11) Simplify ((uu*(-5)uu)/(uu/(u*0/uu)))/(u*(2/7)uu/u(-4)) assuming u is positive. u(-72/7) Simplify (n8/nn)/n29 assuming n is positive. n(-21) Simplify (ggg(-2/7))(-5/17)(g7g)/((gg(-5))/g) assuming g is positive. g(1487/119) Simplify (d/(d/d35)dd)26 assuming d is positive. d962 Simplify (y(-2)/y7)(-7) assuming y is positive. y63 Simplify (w(-19)/www(-8))(-3/5) assuming w is positive. w(81/5) Simplify (ss*1)/(ss/(s(-17)/s)) assuming s is positive. s(-18) Simplify b4/(b(-12/11)b) assuming b is positive. b(45/11) Simplify (x(-5)x*(-2)x)/((x/x*(2/7))/(xxx(4/5)x)) assuming x is positive. x(-102/35) Simplify u(8/7)/(u/((u/(u/(u/(((((u/(u*(-35)u	{ "pile_set_name": "DM Mathematics" }
rs of 18121. 18121 What are the prime factors of 2821? 7, 13, 31 List the prime factors of 854. 2, 7, 61 List the prime factors of 5561. 67, 83 What are the prime factors of 11162? 2, 5581 What are the prime factors of 20239? 37, 547 What are the prime factors of 3676? 2, 919 What are the prime factors of 44345? 5, 7, 181 List the prime factors of 51981. 3, 17327 List the prime factors of 1162. 2, 7, 83 What are the prime factors of 747? 3, 83 What are the prime factors of 6331? 13, 487 List the prime factors of 15515. 5, 29, 107 What are the prime factors of 175? 5, 7 List the prime factors of 3287. 19, 173 List the prime factors of 30168. 2, 3, 419 What are the prime factors of 6228? 2, 3, 173 List the prime factors of 38949. 3, 12983 What are the prime factors of 1864? 2, 233 What are the prime factors of 36617? 7, 5231 What are the prime factors of 11863? 11863 What are the prime factors of 9987? 3, 3329 What are the prime factors of 20582? 2, 41, 251 What are the prime factors of 2147? 19, 113 What are the prime factors of 9120? 2, 3, 5, 19 What are the prime factors of 162? 2, 3 List the prime factors of 82811. 82811 What are the prime factors of 123367? 19, 43, 151 What are the prime factors of 1091? 1091 List the prime factors of 128. 2 What are the prime factors of 64814? 2, 23, 1409 What are the prime factors of 33136? 2, 19, 109 List the prime factors of 9506. 2, 7, 97 List the prime factors of 546. 2, 3, 7, 13 List the prime factors of 215. 5, 43 What are the prime factors of 1260? 2, 3, 5, 7 What are the prime factors of 594? 2, 3, 11 List the prime factors of 31384. 2, 3923 List the prime factors of 2558. 2, 1279 List the prime factors of 1586. 2, 13, 61 List the prime factors of 1337. 7, 191 What are the prime factors of 900? 2, 3, 5 List the prime factors of 3469. 3469 What are the prime factors of 20103? 3, 6701 What are the prime factors of 1260? 2, 3, 5, 7 List the prime factors of 10313. 10313 What are the prime factors of 677? 677 What are the prime factors of 164050? 2, 5, 17, 193 What are the prime factors of 3669? 3, 1223 List the prime factors of 46833. 3, 67, 233 What are the prime factors of 8221? 8221 What are the prime factors of 852? 2, 3, 71 What are the prime factors of 12796? 2, 7, 457 What are the prime factors of 2086? 2, 7, 149 List the prime factors of 1373. 1373 List the prime factors of 1034. 2, 11, 47 What are the prime factors of 20021? 20021 List the prime factors of 21018. 2, 3, 31, 113 What are the prime factors of 1705? 5, 11, 31 What are the prime factors of 5470? 2, 5, 547 List the prime factors of 23572. 2, 71, 83 List the prime factors of 2367. 3, 263 What are the prime factors of 51149? 7, 7307 What are the prime factors of 7207? 7207 What are the prime factors of 1507? 11, 137 What are the prime factors of 2952? 2, 3, 41 List the prime factors of 545. 5, 109 List the prime factors of 3207. 3, 1069 List the prime factors of 13283. 37, 359 What are the prime factors of 59366? 2, 29683 What are the prime factors of 2323? 23, 101 What are the prime factors of 31955? 5, 7, 11, 83 What are the prime factors of 1199? 11, 109 List the prime factors of 5544. 2, 3, 7, 11 List the prime factors of 3093. 3, 1031 List the prime factors of 11288. 2, 17, 83 List the prime factors of 294. 2, 3, 7 What are the prime factors of 17020? 2, 5, 23, 37 What are the prime factors of 1980? 2, 3, 5, 11 What are the prime factors of 1222? 2, 13, 47 What are the prime factors of 47668? 2, 17, 701 List the prime factors of 19051. 19051 List the prime factors of 3739. 3739 What are the prime factors of 1241? 17, 73 What are the prime factors of 1623? 3, 541 List the prime factors of 3024. 2, 3, 7 What are the prime factors of 1181? 1181 What are the prime factors of 10484? 2, 2621 What are the prime factors of 38653? 38653 What are the prime factors of 21469? 7, 3067 What are the prime factors of 23738? 2, 11, 13, 83 What are the prime factors of 92812? 2, 23203 What are the prime factors of 400? 2, 5 List the prime factors of 3083. 3083 What are the prime factors of 2663? 2663 What are the prime factors of 2210? 2, 5, 13, 17 List the prime factors of 8809. 23, 383 List the prime factors of 5589. 3, 23 List the prime factors of 5586. 2, 3, 7, 19 List the prime factors of 90660. 2, 3, 5, 1511 What are the prime factors of 1538? 2, 769 What are the prime factors of 6881? 7, 983 List the prime factors of 21194. 2, 10597 What are the prime factors of 5859? 3, 7, 31 List the prime factors of 214. 2, 107 What are the prime factors of 2776? 2, 347 List the prime factors of 13712. 2, 857 List the prime factors of 1336. 2, 167 List the prime factors of 317. 317 List the prime factors of 7250. 2, 5, 29 What are the prime factors of 60677? 47, 1291 What are the prime factors of 48966? 2, 3, 8161 List the prime factors of 38199. 3, 7, 17, 107 List the prime factors of 2693. 2693 What are the prime factors of 21637? 7, 11, 281 List the prime factors of 25583. 25583 List the prime factors of 32121. 3, 43, 83 What are the prime factors of 337? 337 List the prime factors of 2346. 2, 3, 17, 23 What are the prime factors of 147179? 147179 What are the prime factors of 18479? 17, 1087 What are the prime factors of 7341? 3, 2447 List the prime factors of 15. 3, 5 What are the prime factors of 19705? 5, 7, 563 What are the prime factors of 25323? 3, 23, 367 List the prime factors of 4793. 4793 What are the prime factors of 16415? 5, 7, 67 List the prime factors of 56320. 2, 5, 11 List the prime factors of 5610. 2, 3, 5, 11, 17 What are the prime factors of 121843? 121843 What are the prime factors of 4794? 2, 3, 17, 47 List the prime factors of 7362. 2, 3, 409 List the prime factors of 1589. 7, 227 List the prime factors of 31423. 7, 67 List the prime factors of 3928. 2, 491 What are the prime factors of 2785? 5, 557 List the prime factors of 13882. 2, 11, 631 List the prime factors of 16629. 3, 23, 241 List the prime factors of 1417. 13, 109 What are the prime factors of 57703? 19, 3037 List the prime factors of 3045. 3, 5, 7, 29 What are the prime factors of 72678? 2, 3, 12113 What are the prime factors of 1241? 17, 73 What are the prime factors of 2132? 2, 13, 41 What are the prime factors of 10634? 2, 13, 409 List the prime factors of 18574. 2, 37, 251 What are the prime factors of 14252? 2, 7, 509 What are the prime factors of 20427? 3, 11, 619 What are the prime factors of 440? 2, 5, 11 What are the prime factors of 277? 277 What are the prime factors of 2797? 2797 What are the prime factors of 9735? 3, 5, 11, 59 What are the prime factors of 42875? 5, 7 What are the prime factors of 1888? 2, 59 List the prime factors of 586. 2, 293 List the prime factors of 17913. 3, 7, 853 List the prime factors of 58605. 3, 5, 3907 List the prime factors of 36677. 36677 List the prime factors of 13706. 2, 7, 11, 89 What are the prime factors of 4228? 2, 7, 151 What are the prime factors of 17757? 3, 1973 What are the prime factors of 3685? 5, 11, 67 List the prime factors of 135072. 2, 3, 7, 67 List the prime factors of 301. 7, 43 What are the prime factors of 1415? 5, 283 What are the prime factors of 45454? 2, 22727 List the prime factors of 115903. 115903 List the prime factors of 10600. 2, 5, 53 What are the prime factors of 13686? 2, 3, 2281 What are the prime factors of 3655? 5, 17, 43 List the prime factors of 1133. 11, 103 What are the prime factors of 24135? 3, 5, 1609 List the prime factors of 747. 3, 83 List the prime factors of 559. 13, 43 List the prime factors of 70350. 2, 3, 5, 7, 67 What are the prime factors of 54422? 2, 27211 List the prime factors of 1366. 2, 683 List the prime factors of 5544. 2, 3, 7, 11 List the prime factors of 390. 2, 3, 5, 13 What are the prime factors of 41915? 5, 83, 101 List the prime factors of 16318. 2, 41, 199 List the prime factors of 42956. 2, 10739 What are the prime factors of 26844? 2, 3, 2237 List the prime factors of 272. 2, 17 List the prime factors of 53321. 71, 751 List the prime factors of 6260. 2, 5, 313 List the prime factors of 107123. 107123 What are the prime factors of 13496? 2, 7, 241 What are the prime factors of 5175? 3, 5, 23 What are the prime factors of 909? 3, 101 What are th	{ "pile_set_name": "DM Mathematics" }
= p + 4v, 3p + v = -iv for p. 0 Let o be ((-30)/(-9))/(2/12). Suppose -3i - o = -8i. Solve 0q + 11 = -3q + 2p, 3q = ip - 19 for q. -1 Let z(i) = i*2 - 5i - 10. Suppose 8 = 2n - 6. Let s be z(n). Solve -k - sk - 2l = -18, -4k + 5l = 12 for k. 2 Let m = 3 + -3. Let w be (-5 + 3)/(-1) - -1. Suppose -wx + 3n = x - 20, 5n = 4x - 20. Solve 5s + x = m, s + 10 = r - 4s for r. 5 Suppose -5s = 21 - 26. Solve 5q = 5z + 10, -z = -5q + q - s for z. -3 Let s(w) = 8w + 3. Let x be s(-2). Let g be (-2)/(-4) + x/(-2). Solve gu = 3u - 2v + 10, 4v - 8 = -4u for u. 3 Suppose 19j - 25 = 14j. Solve -v + 0y = y - 1, -jy = -4v + 31 for v. 4 Let k be 68/12 + (-3)/(-9). Suppose k = -0f + 2f. Solve -5v + fu = 27, -2v - 3u + 24 = -6v for v. -3 Let j = -6 - -10. Solve -u = -6u + 5q - 20, jq = 16 for u. 0 Let c(x) = 3 - 6 + 0x + 2x - 1. Let z be c(3). Solve y - 3n = -z - 4, -4n + 12 = 0 for y. 3 Let j be 0 - -1 - (-4 - -2). Suppose jo + 13 = m + 4, -5m = 3o + 9. Let v be 3 - -1(o + 0). Solve w = -5x - 5, v - 15 = 3w for x. 0 Let p(l) = l*3 + 10l*2 + 11l + 12. Let o be p(-9). Let u = o - -9. Solve k - ug - 2 = -4, -17 = 4k - 3g for k. -5 Suppose 4 - 48 = 4x. Let k = 16 + x. Suppose 4t - 5w - 18 = 0, -2t + 0t = 5w + 6. Solve 3m - 2g + 2 = -g, -5m + tg = k for m. 1 Let b be ((-6)/7)/((-6)/21). Solve -20 = -5d, -b = 5i - 0i - 2d for i. 1 Let c(f) = f2 + 4f + 3. Let m be c(-4). Suppose -mb = -b - 4. Suppose g - 64 = -3g. Solve 5x = 2o + g, 0 = -2x + o + 4o - b for x. 4 Let m = 21 + -1. Solve -4l - m = 0, 0 = 3p - p - 3l - 17 for p. 1 Let d be 3/(-2) + 166/4. Solve 2v + d = -3v - 5m, 5m + 15 = 0 for v. -5 Let c(h) = h3 + 4h*2 + 2h. Let i be 3-1 - (-2 - -2). Let g be c(i). Suppose 16 = gu - 38. Solve 5a = 2y - u, 5a - 2a + 14 = -2y for y. -1 Let r(g) = -7g - 1. Let z(h) = -20h - 3. Let f(s) = -11r(s) + 4z(s). Let p be f(-4). Solve -2y - 4q = y - 19, -4q + p = -5y for y. 1 Let a(j) = j + 11. Let c be a(-7). Let h = c + 1. Solve -3t + 4w = 23, -3w + 2w = -ht - 10 for t. -1 Suppose 3f = -8 + 20. Suppose f = -0i + i. Suppose 2j = ij - 6. Solve 5b + 9 + 21 = 5o, -jo = -6 for b. -4 Suppose 5s + 3 = n - 11, 3n + 2s - 8 = 0. Solve -3k - 2k = -no - 14, 4o + 2k = 0 for o. -1 Let r be 0 + ((-4)/1 - -8). Solve 2o - 18 = -4n, 0o - 20 = -ro for n. 2 Suppose -4g + 14 = 2. Solve 4t + 8 = 4d, -3 - 8 = 2d + gt for d. -1 Suppose 0 = 11p - 14p + 18. Suppose pf = 4f. Let a be (0 - 4)2/(-2). Solve 0 = am - 2i + 16, f = -3i - 2i + 20 for m. -2 Suppose -2v + 3k = -10, 4v - k - 4k - 20 = 0. Suppose -a = -v - 7. Let i be -1 + 0 + (-2 - -7). Solve a = -h - h + 2g, i = -h - g for h. -5 Let z = 57 + -53. Solve -zg + 12 = 3a, -2g = -2a - 0g - 6 for a. 0 Let h(o) = 7o - 9. Let z be h(7). Let l be (19/2)/((-4)/8). Let w = l + 34. Solve -2k - w = k, -5f = -5k - z for f. 3 Let s(w) = w2 - 10w + 4. Let u be s(10). Solve -2i + 3y = -ui - 1, y = -3i + 2 for i. 1 Let s be (5/2)/(1/6). Suppose 0 = 3w - 0w - s. Solve 5g + 21 = -4i, -4i - 6 = -5g + w for g. -1 Suppose -7z + 5z = -8. Let k be -2(1 + (2 - z)). Solve 0 = -5w - b - 28, 0w + kw + 7 = b for w. -5 Let u(h) = 2h3 - 3h*2 + 3h - 3. Let z be u(2). Suppose -7 - 21 = -zg. Solve 2 = -3p + l, gl + l + 2 = 3p for p. -1 Let x = 20 - 16. Let r = 3 + 2. Let n(c) = -c + 10. Let k be n(r). Solve xl - 11 = 5b, -4b + 25 = kl + b for l. 4 Let x(b) be the second derivative of -b3/6 + b2/2 + 2b. Let r be x(-5). Let z = 4 + r. Solve 4a - 4y + 4 = -0, 2a - 5y - z = 0 for a. -5 Let l(z) = -2z*2 + z + 11. Let g be l(-5). Let c be 2/(-10) - g/20. Solve cs + 3m = s + 1, 2m = -5s - 8 for s. -2 Let c = -51 - -30. Let s = 27 + c. Suppose -4b + 0b = -12. Solve -3a + a + 6 = 0, 4a = bg + s for g. 2 Suppose -3x + 5x - 10 = 0. Solve 0 = -4r + xk + 13, -k = r - 1 - 0 for r. 2 Suppose 0 = l - 0y - 3y - 12, 0 = 2y - 10. Solve x + 18 = -c + 6x, l = -5c + 4x for c. -3 Let t(v) = v*3 - 7v*2 + 12v - 4. Let i be t(5). Suppose -a + 0 = -i. Solve 5f = -2q - 33, 2f - a = 3q + q for f. -5 Let h(m) = -m - 5. Let f be h(-5). Let j = f - -4. Suppose 0 = jw - 24 + 8. Solve 3u - wi = -6, -4 = -0u + 2u + 2i for u. -2 Suppose -5d - 20 = -0d. Suppose 6c + 4c = 80. Let a = d + c. Solve 8 = 2v + 3h, 0 = -v - ah + h + 10 for v. -2 Suppose 2 = -0m + 2m. Solve 18 = -5h - 2n, n - m + 5 = 0 for h. -2 Suppose -4b + 3 = -9. Suppose 0 = -4f, -2h + h + b = -f. Let v be (-28)/(-12) + 2/h. Solve 0k - 17 = 5k + vn, -4n - 4 = 2k for k. -4 Let c = 31 - 27. Solve -t + 2d + 4 = 0, ct + 32 = -2d + 8 for t. -4 Let u = 7 - 6. Let j be 4 - (2 + 1) - u. Suppose 3z = l + 4, 2z = 2l - jz - 4. Solve l = s - 5i - 5, -1 = -s + 2i for s. -5 Let p(n) be the first derivative of -n*4/4 - 7n3/3 - n2 - 9n + 1. Let b be p(-7). Let j be 0/(-2) - 0/2. Solve -4 = -y, j = 3i - bi + 5y - 10 for i. 5 Suppose 0l + 32 = 4l + 4y, 3l - 14 = -y. Solve 3b - 3 = -li, 1 - 7 = -4b - 2i for b. 2 Let l = -45 - -49. Solve -4b - z - 9 = 0, -z - lz - 28 = 3b for b. -1 Let d(f) = -f - 4. Let i be d(-4). Let u be -47/(-28)7. Solve i = -3w + 4n - 5, w + 4w - u = -n for w. 1 Let u be (-2)/5 - 12/(-5). Let x = u + 3. Solve 0 = xr + o - 23 - 1, 3r + 4 = 4o for r. 4 Let i be ((-2)/6)/(6/(-288)). Solve -4p + 5a - i = 6a, 0 = -5a - 20 for p. -3 Suppose -5d + 48 - 8 = -3o, -4o - 40 = -5d. Suppose d = -4x - 4q, 0 = -3x - 5q - 0q - 14. Solve -5l + 4r = -r + 35, -4l = xr + 4 for l. -3 Let x(j) = 2j - 5. Let w be x(5). Suppose 12 = 5t + 2k, -4k = -4t - 0k + 4. Solve -2q = -3m + 13, -tq - 16 = -wm - 1 for q. -5 Let w be 2/(-4)6/3. Let n be ((-2)/2)/(w/(-5)). Let r be 4/10 - 13/n. Solve -3m = l + 4l + 2, -2m = rl + 1 for m. 1 Let u be ((-1)/3)/(2/(-12)). Solve -d = -4z + 19, -3d = -4z + ud + 31 for z. 4 Let h(f) = -2f*3 - 2f*2 + 6f + 1. Let z be h(-3). Solve z = 4y + 3u, y = -0u + 2u + 2 for y. 4 Suppose 4n - 191 + 15 = 0. Suppose 0 = -3d + 2t - 3 + n, -d - 5t + 25 = 0. Solve 2u + 5 = 4j - 3u, 0 = -3u - d for j. -5 Suppose 0b + 5b = 70. Suppose 4g - 4n + 4 = 0, 0g - 4n + b = g. Let f be (2 - 3) + 1 + 7. Solve gr + f = c, 0 = -3c + c - 3r - 14 for c. -1 Suppose -1 = -s + 1. Suppose 12 = -sk + 4k. Solve 4y - 5f - k = 0, 3y - 4f = -0 + 5 for y. -1 Let n(u) = -u2 + 2 - u2 + 3u + u*2. Let a be n(3). Solve -3x + l = 2, -5x = l - 0 - a for x. 0 Let c be 1/(-3) + (-363)/(-9). Solve 4i = 3f - 1, 0 = -8i + 3i - 4f - c for i. -4 Let m(r) = -r*2 - 11r + 3. Let z be m(-11). Solve 5o + 26 + 4 = 3y, zy + 4o - 3 = 0 for y. 5 Let o = -33 + 41. Solve 3q = -2d + 3 - 16, -d - o = 3q for d. -5 Let b(f) be the first derivative of -f2/2 + f - 1. Let m be b(4). Let q = 0 - m. Solve qy - 1 = 2z - 3z, 2y = -4z - 6 for z. -2 Let u = -30 - -30. Solve u = 2d + 4f - 28, d - 4f + 12 + 4 = 0 for d. 4 Let s = 36 + -23. Solve 4w + 5d - 11 = 0, 3w - 7w = -3d + s for w. -1 Let a be 25/15-1-3. Solve -4b - 5p = 20, b + 0b - 5p = -a for b. -5 Let v be 6/(-4) + (-2)/(-4). Let t be (4 + v)/(3/3). Solve -3g = 2f - 14, -2 = -f - 2g + tg for f. 4 Let k be (-2)/(-2 + (-224)/(-116)). Suppose -2m - 3 = -4l + 3l, 0 = 3l - m - 9. Solve li - 5t + 21 = -i, -4i = 5t - k for i. 1 Let w(h) = -h - 1. Let k be w(-13). Suppose l + k = 4l. Solve 0 = -2t - 8, -a + 5t - 5 = la for a. -5 Let o(k) = -k*2 - 27k - 24. Let w be o(-26). Solve 4b + 7 = -2x - 11, 4x + 16 = wb for x. -5 Let g = 17 - 8. Let c be (56)/(g/6). Suppose 3l = -b - b + 15, -4l + 5b + c = 0. Solve -j + 0u = 2u + l, -5j + 14 = -3u for j. 1 Suppose 6s - 3q = 2s - 6, -2q + 4 = 0. Let k = 2 + s. Solve ku + 0b + 2b - 2 = 0, 5u + b - 17 = 0 for u. 4 Suppose -u - 2u - 4 = -5n, -2u + 4 = 0. Solve nh - 2l - 3 = -5l, 0 = 5h - 2l + 21 for h. -3 Suppose 6y = 2y + 16. Solve 3d - 4l - 24 = 0, y = 2d - l - 7 for d. 4 Let r(c) be the second derivative of -c5/20 + 5c*4/12 + 5c*2/2 + c. Suppose -9 + 4 = -f. Let v be r(f). Solve -3p - 5n = 0, 8 = -vp - n - 14 for p. -5 Let t be (-1)/(-2)(-5 + 11). Solve -c + 2d = -4, t*c -	{ "pile_set_name": "DM Mathematics" }
ivative of z*4/6 + 3z. Let q(d) = -3d2. Determine q(m(k)). -12k*4 Let o(b) = 471b*2. Let y(j) = 3j*2. Calculate o(y(s)). 4239s*4 Let l(p) = -82p. Let a(s) = -s. What is l(a(z))? 82z Let f(b) = -2b. Let x(c) = 23c. Determine f(x(d)). -46d Let n(r) be the second derivative of -r*3/3 - r. Suppose 4q = 8 + 4. Let m(h) = -h - qh + 6h. Give m(n(v)). -4v Let y(n) be the third derivative of n5/60 + n2. Let v(s) = -728 + 5s + 728. Determine v(y(h)). 5h2 Let o(j) = 3j*2 + 5j*2 - 3j*2. Suppose 2n - w = 8, -n - 4n - 5w - 10 = 0. Let z(q) = q*2 + 3q*n + 4q*2 - 6q*2. Determine o(z(i)). 20i*4 Let y(s) = 19s + 16. Let v(x) = x. Determine v(y(f)). 19f + 16 Suppose 2l - 24 = -4n, 17 = -0n + 5n - 4l. Let m(d) = nd - 2d - d. Let u(f) = -3f. Give u(m(q)). -6q Let z = 70 - 40. Suppose 4y + 10 = z. Let u(j) = 3j - yj + 0j. Let m(s) = s*2. Give m(u(i)). 4i*2 Let n(o) = 3o*2 + 2o + 1. Let p be n(-1). Let b(d) = -d*2 + 2 - 2 + 3d*p. Let g(k) = k. Give b(g(u)). 2u*2 Let o(a) = 7a + 11. Let m(c) = -11c - 16. Let g(y) = -5m(y) - 8o(y). Let n be g(-11). Let d(q) = 8q + nq - 8q. Let v(h) = 2h2. What is v(d(f))? 18f*2 Let c(p) = -24p2. Let s(d) = d2 - 3. Give c(s(i)). -24i4 + 144i*2 - 216 Let v(w) = 3w. Let f(a) = 6a + 4. Determine v(f(h)). 18h + 12 Let l(m) = -6m2. Let k(q) = -3q - 25. What is k(l(i))? 18i2 - 25 Let m(n) = 3n*2. Let f(k) = 10184k*2. Determine m(f(p)). 311141568p4 Let h(f) = f2. Let r(c) = 1144c. Give h(r(u)). 1308736u*2 Let p(o) = 4o + 4. Let g(h) = 21h + 22. Let j(w) = -2g(w) + 11p(w). Let x(n) = -n + 17. Give x(j(l)). -2l + 17 Let f(m) = -m - 175. Let q(s) = 4s2. Calculate f(q(c)). -4c*2 - 175 Let v(s) = 2s. Let b(z) = 161 - 3z2 - 161. Determine b(v(u)). -12u*2 Let n(t) = 2t*2. Let b(k) = 15536k. Give b(n(v)). 31072v2 Let o(l) = l. Let s(a) be the second derivative of -11a*3/6 + 6a. Calculate o(s(d)). -11d Let z(n) = 6n - 6. Let f(b) = -49b2 + 2. What is f(z(o))? -1764o*2 + 3528o - 1762 Let f(t) be the third derivative of -7t4/12 + 18t2. Let x(p) = p2. Calculate x(f(o)). 196o2 Let y(d) = -2d*2 - 2106d. Let v(r) = 2r2. Calculate y(v(g)). -8g*4 - 4212g*2 Suppose -8b + 3b = -25, -w = -3b + 13. Let n(x) = 3x + wx - 4x. Let u(l) = l. Give n(u(h)). h Let n(m) = -4m. Let j(s) = 156 + 9s - 156. Determine j(n(z)). -36z Let h(n) = -12 - 2n + 12. Let i be (-8)/(-5) + (-4)/(-10). Let v(a) = 2a*2 - 3a*i + 3a*2. Determine v(h(d)). 8d*2 Let d(g) = 2g*2. Let k be (-1)/2 - 7/(-14). Let a(m) be the first derivative of 0m + km2 - 2 - 1/3m*3. Calculate d(a(j)). 2j4 Let o(w) = w2 + 2w2 - w2. Let i(u) = -1 + 6 - 5 - u2. Calculate o(i(s)). 2s*4 Let o(s) = -29s. Let d(y) = 143y2. What is o(d(g))? -4147g*2 Suppose 4a = -1 + 17. Let f(i) = ai - 15i + 9i. Let u(t) = 9t*2. Calculate u(f(j)). 36j*2 Let y(t) = 2t*2 + 2035. Let c(i) = i. Calculate y(c(k)). 2k*2 + 2035 Let h(w) = 7w. Let l(b) = -86b2. Calculate h(l(d)). -602d2 Let j(u) be the second derivative of -u4/12 + 3u2/2 - u. Let f(a) be the first derivative of j(a). Let d(v) = -2v. Determine f(d(k)). 4k Let u(s) = 3s + 44 - 82 + 38. Let j(g) = -22g2. Give j(u(m)). -198m*2 Let z(p) be the first derivative of 4p2 - 3. Let a(r) be the first derivative of -r2/2 + 1. Calculate z(a(b)). -8b Let b(k) = -2k. Let a(y) = 6y. Let i(m) = -67m. Let s(x) = 66a(x) + 6i(x). Give s(b(u)). 12u Let v(t) = 11t. Let r(i) = 16i2. Calculate r(v(x)). 1936x*2 Let x(q) = -6q*2. Let t = 1 + 2. Let g(u) = -u - u + tu. What is g(x(w))? -6w2 Let r(a) = -2a*2 + 5a + 5. Let g(u) = -u - 1. Let f(v) = -5g(v) - r(v). Let w(y) = -13y*2. Give f(w(s)). 338s*4 Let k be (1 + 0)4 + -1. Let o(a) = -2a2 + 7a*2 - ka2. Let s(b) be the third derivative of -b4/8 - 3b2. What is s(o(l))? -6l*2 Let z(k) = 8k. Let n(d) = -d*2 + 2. Let p = -16 - -23. Let q(m) = -4m*2 + 7. Let y(s) = pn(s) - 2q(s). What is y(z(b))? 64b2 Let l(f) be the first derivative of -f5/30 + 2f2 - 2. Let c(t) be the second derivative of l(t). Let w(p) = 5p. Calculate w(c(a)). -10a2 Let s(l) be the second derivative of -l4/6 - 2l. Let w(m) = 8m + 10m - 14m. Give w(s(q)). -8q*2 Let r(j) = -3491j*2. Let h(w) = -6w*2. Calculate r(h(y)). -125676y*4 Let m(o) be the first derivative of 2 + 0o + 3/2o2. Let t(v) = v. What is m(t(j))? 3j Let y(f) = f2. Let a(s) = s2 - 363s. Give y(a(x)). x4 - 726x*3 + 131769x2 Let j(v) be the first derivative of -v3/3 - 7. Let p(g) = -14g2. Give j(p(r)). -196r*4 Let w(z) = 0z*2 + 2z*2 - 3z2 - z2. Let s(t) = 3t2 + t2 - 5t*2 - 3t*2. Calculate w(s(k)). -32k4 Let r(u) be the second derivative of u3/2 - 7u. Let a(t) be the third derivative of -t5/30 + 2t*2. Determine r(a(l)). -6l*2 Let n(j) = 6j. Let u(t) = 25t - 2. Determine n(u(r)). 150r - 12 Let v(c) be the first derivative of 1 + 0c2 + 1/2c3 - c. Let y(k) be the first derivative of v(k). Let n(h) = -h2. What is n(y(d))? -9d2 Let n(z) = 2z. Let y(f) be the first derivative of -f5/30 - f2/2 - 3. Let o(s) be the second derivative of y(s). Calculate n(o(x)). -4x2 Let n(c) be the second derivative of -2c + 0c3 + 1/6c*4 + 0c*2 + 0. Let v(s) = 4s*2. Determine n(v(p)). 32p*4 Let o(r) = 34r. Let c(g) = -2g2. Give o(c(i)). -68i*2 Let k(g) = -18g. Let q(w) be the first derivative of w*4/6 - w - 8. Let v(y) be the first derivative of q(y). Calculate k(v(a)). -36a*2 Let y(s) = -5s. Let q(c) be the first derivative of c*2 - 4. Give q(y(v)). -10v Let u(m) = 6m2. Let n(j) be the second derivative of j3/6 + 7j. Give u(n(r)). 6r2 Let r(g) = 159g*2. Let h(t) = -2t. Calculate h(r(n)). -318n2 Let n(i) be the third derivative of 0i3 + i2 - 1/24i4 + 0i + 0. Let w(r) be the first derivative of 2r2 - 3. What is w(n(j))? -4j Let w(v) = 59v2 - 17v*2 + 30v*2 + 15v*2. Let b(s) = s. Give b(w(k)). 87k2 Let q(x) = x2 - 1. Let s(a) = 1. Let v(l) = -5q(l) - 5s(l). Let o(h) = 5h. Determine o(v(d)). -25d*2 Let g(r) = -5r*2 - 5r. Let y(i) = -5i. What is y(g(d))? 25d*2 + 25d Let h(f) = -15f. Let d(b) be the second derivative of b7/1260 + b4/2 + 4b. Let u(v) be the third derivative of d(v). Give u(h(n)). 450n2 Let r(m) = 6m. Let o(f) = -4f2 - f2 + 3f*2. Give r(o(j)). -12j*2 Let l(o) = 0o + o - 3o. Let a(f) be the first derivative of -2f*2 - 4. Give a(l(d)). 8d Suppose 7l - 12 = 4l. Let z = l + -2. Let b(o) = -2o + oz + 2o. Let w(m) = 3m2. Calculate b(w(x)). 9x*4 Let z(t) = 4t*2. Let m(r) = 63r*2 - 18. Let u(f) = 18f*2 - 5. Let d(h) = -5m(h) + 18u(h). Determine d(z(k)). 144k*4 Let f(s) = s. Let j(q) = -15q + 1. Calculate j(f(y)). -15y + 1 Let u(n) be the first derivative of 3n*2/2 + 1. Let o be 3 - 0 - (1 - 1). Let m(s) = 4s - os - 3s. What is u(m(r))? -6r Let t(j) = 200j*2 - 3j + 2. Let r(u) = -2u. What is t(r(n))? 800n*2 + 6n + 2 Let t(q) be the third derivative of 0q4 - 4q*2 + 0 + 0q + 2/15q5 + 0q*3. Let c(v) = v. Calculate c(t(d)). 8d2 Let o(y) = -y2. Let m(z) = 5z. Calculate o(m(g)). -25g2 Let d(x) = x2 - x. Let w(z) = 3z2 - 4z. Let q(h) = -4d(h) + w(h). Let j(g) = -28g. Calculate j(q(s)). 28s2 Let v(g) = -g2. Let z(w) = -1047w*2 + 1. What is v(z(b))? -1096209b*4 + 2094b*2 - 1 Let i(j) = 4j. Let y(s) = -52s2 - 4. What is y(i(a))? -832a*2 - 4 Let n(g) = -g. Let s(m) be the second derivative of 0 + 0m*3 + m + 0m*2 + 1/6m*4. Determine n(s(p)). -2p2 Let a(t) = -t2. Let c(u) = u - 4. Let j be c(0). Let o be (-5 - j) + (-6)/(-2). Let n(d) = -do - d2 + 4d2. Calculate a(n(k)). -4k*4 Let o(f) be the second derivative of 0f*2 + 0 + 7/3f*3 - 6f. Let j(w) = -2w. Calculate j(o(a)). -28a Let m(b) = -2b3 + 2b - 1. Let s be m(1). Let o(u) = -4u2 + 3. Let f(j) = j2 - 1. Let i(w) = so(w) - 3f(w). Let l(h) = 2h*2. What is l(i(a))? 2a*4 Let i(r) = 5r - 6. Suppose -4b = -0b - 20. Let v(d) = 2 - d - b + 4. Let o(m) = i(m) + 6*v(m). Let j(y) = y. What is o(j(l))?	{ "pile_set_name": "DM Mathematics" }
c2 - 14368 + 14375c*2 - 4c - 29c wrt c. 118c - 33 Let f(m) be the first derivative of 99m3 + 2m*2 + 683m - 1363. What is the second derivative of f(d) wrt d? 594 Let y = 4 + 1. Suppose -1 = yj - 11. Find the second derivative of -4 + 6 - j + 4b + 21b5 wrt b. 420b*3 Let x(l) be the first derivative of 854l*5/5 - 5l*3/3 - 4l*2 - 1564. What is the third derivative of x(w) wrt w? 20496w Let j(m) = -13m - 85. Let v(a) = 14a + 85. Let t(w) = -3w - 34. Let l be t(-10). Let c(y) = lv(y) - 5j(y). Differentiate c(o) wrt o. 9 Let r = -32 - -34. Let u = 22 - 11. What is the second derivative of -4z - uzr + 18z*2 - 9z + 17z2 wrt z? 48 Let k(c) = 10c*4 + 109c + 87c - 117c. Let q(o) = -19o4 - 159o. Let w(j) = 5k(j) + 3q(j). Find the second derivative of w(f) wrt f. -84f2 Let h = 534 - 532. Let v(x) = x2 - 4. Let z be v(-3). Find the third derivative of 5bz - b5 + 19bh + 2b*5 - 8b*5 wrt b. -120b*2 Let h be ((-120)/(-45))/(4/31). Let j be ((-1)/2)/(1/(-4)). Differentiate -12 - 4b + hb + jb - b wrt b. -1 Let y be (-2 - 79)/(36/(-24)) - -6. What is the second derivative of -r - 30r + yr + 30r*2 wrt r? 60 Suppose 0u - 3u - 10 = h, 4u + 2h = -16. Let a be u/9 + (-6)/((-378)/1589). What is the third derivative of -24i*3 - 9i + ai2 + 9i wrt i? -144 Suppose -w + 22 = 4x - 3w, -w + 7 = 4x. What is the third derivative of -37o*2 + 14o*2 - 19o*2 + 8o*x wrt o? 48 Find the third derivative of 870c*6 + 650c*2 - 84 + 84 - 64c*2 - 2c wrt c. 104400c3 Suppose 0a + 275 = -5a + 4w, -5a + w - 290 = 0. Let j = a - -66. Find the third derivative of 2f*6 + jf*6 + 14f*6 + 4f*2 + 10f*2 wrt f. 2760f*3 Suppose 8 = -2a - 5h, -5h + 15 = 5a - 10h. Differentiate -a + 19x + 3x + 2x2 - 39x with respect to x. 4x - 17 Let f be (0 + 3 - 9/2)/(77/(-154)). Let z(q) be the second derivative of 12q - 11q2 - 7/3q*f + 0. Find the first derivative of z(a) wrt a. -14 Differentiate 543z + 590z + 510z - 2008z - 2754 wrt z. -365 Let k = 1 + 3. Let l = 20 - 18. What is the first derivative of 7 - 5i*2 - 6i*2 + ki*l wrt i? -14i Let v(n) = 2787n3 + 4n*2 + 11n - 2. Let w(u) = -13936u3 - 22u*2 - 55u + 10. Let h(f) = -11v(f) - 2w(f). Find the second derivative of h(i) wrt i. -16710i Suppose -5j + g = -g + 610, 0 = -5j + 4g - 610. Let u = j - -127. Find the second derivative of 4s4 + 20s*5 + 18s*u - 4s*4 - 8s wrt s. 760s3 Let s(b) be the second derivative of 0b*6 + 0b*3 + 0 + 0b*2 + 0b*5 - 29/4b*4 + 13b - 16/21b7. Find the third derivative of s(c) wrt c. -1920c*2 Suppose 86 = 24u + 19u. Find the third derivative of 19x*u + 159x*3 - 311x2 - x4 + 141x3 - 35x*3 - 29x*3 wrt x. -24x + 1416 Let w(o) be the second derivative of -520o7/21 + o6/10 - o5/20 - o4/12 - 1687o*3/6 + 4238o. What is the third derivative of w(f) wrt f? -62400f2 + 72f - 6 Suppose -q - 4w + 8 = -0q, 0 = 5q - 3w + 6. What is the derivative of -y + 2 + qy - 64 wrt y? -1 Let d be (-72)/15-1 + (-12)/(-60). Suppose 0 = -dv + 2g + 2, 2 = -v - g + 8. What is the derivative of 120cv - 11 + 56 - 106c*2 - 1 wrt c? 28c What is the derivative of -2384h + 333 - 1308 + 482 wrt h? -2384 Let t(a) = a3 - 4a*2 + 10a - 15. Let b be t(3). What is the third derivative of 2 - 313x6 + 560x*6 - 21x*2 - 304x*b wrt x? -6840x*3 Let w(q) = 4575q*3 + 6682q*2 - 14q + 8. Let i(h) = 1524h3 + 2227h*2 - 5h + 3. Let g(m) = -14i(m) + 5w(m). Find the third derivative of g(j) wrt j. 9234 Find the second derivative of -3550c - 9677c*2 - 3570c + 7130c + 214 wrt c. -19354 Let s(v) be the first derivative of 26v*6 - 4v*3/3 + 2453v*2/2 + 1797. Find the second derivative of s(a) wrt a. 3120a3 - 8 Let d(x) = -x2 - 4x + 2. Let r be d(0). Find the third derivative of 29 - 30 + 163q*3 + 9q*2 - 5qr wrt q. 978 Let l(y) = y3 + 4y2 - 5y - 12. Let v be l(-4). Find the second derivative of -10r3 + 37r*2 + 23r + vr3 - 39r*2 wrt r. -12r - 4 Let y be (21/9 - 2)(2 + 1). What is the derivative of y - 5806w*3 + 5806w*3 - 102w*4 + 8 wrt w? -408w*3 Let k(u) be the third derivative of 1493u*4/8 - 347u*3/6 - 5u*2 + 48u. What is the first derivative of k(a) wrt a? 4479 Let z(s) be the third derivative of 2837s4/24 + 580s*3/3 + 2429s*2 - 1. What is the derivative of z(q) wrt q? 2837 Let x be (47 + (1 - 4))/2. Let g be (-3 - (1 - x))/(3 - 1). What is the derivative of 18 + 239y*3 - 241y*3 + g wrt y? -6y*2 Let z(f) = -7535f + 11650. Let i(q) = 7479q - 11650. Let d(o) = 5i(o) + 6z(o). Find the first derivative of d(k) wrt k. -7815 Let r(h) = -421h*2 + 5h - 3897. Let g(c) = 2100c2 - 26c + 19486. Let v(p) = 2g(p) + 11r(p). What is the derivative of v(n) wrt n? -862n + 3 Suppose j - 357 = -297. What is the first derivative of -j - 21o - 39 + 81 wrt o? -21 Let z(w) be the first derivative of 63w4/4 + 875w - 996. What is the first derivative of z(n) wrt n? 189n2 Let s be -6((-380)/8)/(-5). Let k = 77 + s. What is the derivative of 9 - 4h - 2h - 1 + kh wrt h? 14 Let d(f) = -3797f*3 - 2f*2 + 768f + 2. Let t(u) = 2u3 - u2 - 2u + 1. Let g(c) = -d(c) + 2t(c). Find the second derivative of g(a) wrt a. 22806a Let n(i) = -7i - 221. Let z be n(-32). What is the third derivative of 107d*6 + 132d*2 - 91d*2 + 29d2 + dz - 3d4 + 3d*4 wrt d? 12840d*3 + 6 What is the third derivative of -621o*4 - 704o*4 - 1207o*2 - 529o*2 + 416o*2 wrt o? -31800o Suppose 10m + 2309 = 7989. Find the first derivative of 3i + 8i4 - 4i + 540 - m wrt i. 32i3 - 1 Suppose 0 = 2y - 5g + 1 - 24, -25 = -4y + 3g. What is the second derivative of 32l*4 - 17 + 154l*4 - 7l - 30ly + 31l*4 + 69l*4 wrt l? 3072l*2 Let f be (1 - 0)/(-6 - -8). Let m(t) be the second derivative of -14t - 11/10t5 + 0t*3 + 0 + 0t*4 - ft*2. Differentiate m(i) wrt i. -66i*2 What is the third derivative of 41 - 11a*2 - 3 - 27 + 13 - 272a*5 wrt a? -16320a*2 Let r = 3 + 10. Let f = r + -7. Find the first derivative of -fg*4 - 5g*4 - 35 + 36g*4 wrt g. 100g*3 Let y(z) be the third derivative of -1/30z*5 + 0z + 1/2z3 + 42 - 23/210z*7 + 2z*2 + 1/24z*4 + 0z*6. Find the second derivative of y(n) wrt n. -276n*2 - 4 Find the third derivative of -43008q + 21470q + 2 + q2 - 4508q*3 + 21358q wrt q. -27048 Find the third derivative of -2270c3 - 2272c*3 + 4542c*3 + 2671c*2 + 3287c*5 + 9c*5 wrt c. 197760c*2 Let f(j) = 1091j*3 + 35j*2 - 28j + 2. Let w(p) = -2182p3 - 78p*2 + 56p - 5. Let x(h) = 5f(h) + 2w(h). Find the third derivative of x(s) wrt s. 6546 Suppose -3l = -19 + 13. Differentiate ld*3 - 4d*4 + 29 - 19d*4 - 13d*4 + 12d*4 with respect to d. -96d*3 + 6d*2 Suppose -3z - 22 = -f, -4f - 3z + 0 + 58 = 0. Suppose 9s - f = 20. Find the third derivative of 27b*4 + 12b*6 - 58b*4 + 9b*2 + 31b*s wrt b. 1440b*3 What is the second derivative of 221d*4 - 350d - 437d + 1063d wrt d? 2652d2 Let y(q) be the third derivative of 207q*8/56 - 4q*5/5 - 13q*3/3 - 5q*2 + 3q - 58. What is the third derivative of y(v) wrt v? 74520v2 Let v(b) be the second derivative of -327b6/10 + b4/12 + 2b3 - 770b. What is the third derivative of v(s) wrt s? -23544s Differentiate -1268c - 1205 - 1102 + 2986 with respect to c. -1268 Let x(g) be the second derivative of -617g6/30 + g4/12 + 59g*2/2 - 31g - 13. What is the third derivative of x(n) wrt n? -14808n Suppose -c = 3t - 11, 2t + 0c = c + 14. Suppose -i = -4y - 11, 2i - 4y = 3i + t. What is the second derivative of -ik4 - 80k + 78k + k4 wrt k? -24k*2 Find the second derivative of 374r - 158r + 1123r - 1987r2 + 75r + 1045r wrt r. -3974 Let n = -25 - -28. Let i be 1/(-2) - (-210)/20. What is the derivative of -5 + i - n + 7u*4 wrt u? 28u3 Let n(r) be the first derivative of -r5/5 - 121r4/4 - 2919r - 7744. Differentiate n(k) wrt k. -4k3 - 363k*2 Let x(u) be the second derivative of 194u4/3 + u3/6 + 2639u2/2 - 1555u. Differentiate x(o) wrt o. 1552*o + 1 L	{ "pile_set_name": "DM Mathematics" }
roys. 1/70 What is prob of sequence kxqp when four letters picked without replacement from {q: 1, m: 1, x: 1, k: 1, d: 2, p: 1}? 1/840 Calculate prob of sequence dxx when three letters picked without replacement from jxjrjdxxjxjsjjsrd. 1/170 Calculate prob of sequence oxr when three letters picked without replacement from {q: 1, m: 3, x: 1, u: 3, r: 2, o: 1}. 1/495 Calculate prob of sequence feef when four letters picked without replacement from {w: 5, f: 8, e: 2}. 2/585 What is prob of sequence jdbd when four letters picked without replacement from {d: 2, b: 4, j: 3}? 1/126 Two letters picked without replacement from {h: 1, e: 2, v: 1, p: 3}. What is prob of sequence vp? 1/14 Two letters picked without replacement from {a: 3, l: 7, v: 3, c: 6}. What is prob of sequence cl? 7/57 Two letters picked without replacement from {q: 6, v: 6}. Give prob of sequence qv. 3/11 Two letters picked without replacement from {i: 1, j: 1, p: 2, q: 1, g: 2}. Give prob of sequence ig. 1/21 Calculate prob of sequence jpvp when four letters picked without replacement from {p: 3, j: 2, v: 5, r: 2}. 1/198 Three letters picked without replacement from {t: 11, d: 1, u: 1, j: 6, f: 1}. Give prob of sequence jjj. 1/57 What is prob of sequence xzz when three letters picked without replacement from zzxz? 1/4 Four letters picked without replacement from ppppppzppz. What is prob of sequence pzpz? 1/45 Calculate prob of sequence wdw when three letters picked without replacement from wdddwdwwwd. 5/36 Four letters picked without replacement from wurrwuuurrwur. What is prob of sequence uwrr? 5/286 Calculate prob of sequence lu when two letters picked without replacement from zzuzzzlzzelu. 1/33 What is prob of sequence vr when two letters picked without replacement from adrsvra? 1/21 Two letters picked without replacement from urrfuarurffr. Give prob of sequence uf. 3/44 Calculate prob of sequence ihjr when four letters picked without replacement from {r: 7, i: 1, j: 1, h: 3}. 7/3960 What is prob of sequence lb when two letters picked without replacement from {l: 1, p: 4, b: 6}? 3/55 Calculate prob of sequence axx when three letters picked without replacement from {x: 2, a: 2}. 1/6 Calculate prob of sequence ug when two letters picked without replacement from {g: 8, u: 2}. 8/45 Two letters picked without replacement from {v: 1, b: 1, q: 1, z: 1, d: 1}. What is prob of sequence qz? 1/20 Calculate prob of sequence lrl when three letters picked without replacement from {r: 1, l: 14}. 1/15 Three letters picked without replacement from meemmmeccecememmmem. Give prob of sequence cce. 7/969 Three letters picked without replacement from {k: 1, v: 1, l: 4, d: 1, a: 8}. What is prob of sequence llv? 2/455 Calculate prob of sequence mfcl when four letters picked without replacement from {c: 1, m: 1, l: 1, f: 1, p: 1}. 1/120 Two letters picked without replacement from {s: 1, n: 1, c: 1, m: 1, l: 1, j: 2}. Give prob of sequence sn. 1/42 Two letters picked without replacement from sbksubud. What is prob of sequence bd? 1/28 Calculate prob of sequence ek when two letters picked without replacement from etoktuqu. 1/56 Calculate prob of sequence nwwn when four letters picked without replacement from {p: 6, w: 9, n: 4}. 3/323 Three letters picked without replacement from {w: 4, h: 2, s: 3, n: 1, v: 1}. Give prob of sequence hwh. 4/495 Two letters picked without replacement from {j: 1, p: 2, g: 1, v: 1, y: 2, n: 1}. What is prob of sequence nv? 1/56 Calculate prob of sequence gg when two letters picked without replacement from {r: 5, g: 5, l: 5, p: 1, a: 3}. 10/171 What is prob of sequence pj when two letters picked without replacement from {p: 1, h: 2, j: 3, s: 1, g: 5, b: 3}? 1/70 Calculate prob of sequence pkmp when four letters picked without replacement from bpbpmbllbkkp. 1/990 Three letters picked without replacement from qvvqqqqvqqqqqqqqvqqq. What is prob of sequence qvv? 8/285 What is prob of sequence tjj when three letters picked without replacement from jttj? 1/6 What is prob of sequence yg when two letters picked without replacement from {n: 2, g: 6, x: 1, y: 2}? 6/55 Two letters picked without replacement from {o: 2, v: 2, t: 4}. Give prob of sequence tt. 3/14 Calculate prob of sequence bkk when three letters picked without replacement from {b: 10, k: 10}. 5/38 Three letters picked without replacement from {j: 5, f: 3, d: 4, m: 1, r: 5}. Give prob of sequence frd. 5/408 Four letters picked without replacement from {v: 6, z: 4}. What is prob of sequence zzzv? 1/35 Two letters picked without replacement from {n: 15, h: 5}. What is prob of sequence hh? 1/19 Calculate prob of sequence nj when two letters picked without replacement from jjdjjjjjjjn. 9/110 What is prob of sequence vv when two letters picked without replacement from {v: 8, f: 6, y: 4, q: 1, t: 1}? 14/95 Calculate prob of sequence rx when two letters picked without replacement from oxrvrxrcoccmvvrvooov. 2/95 Three letters picked without replacement from uvyuity. What is prob of sequence tyu? 2/105 Calculate prob of sequence aap when three letters picked without replacement from agaacggpcagppr. 3/182 What is prob of sequence nnpe when four letters picked without replacement from {p: 1, t: 1, e: 1, i: 1, n: 2, x: 1}? 1/420 What is prob of sequence rw when two letters picked without replacement from {c: 1, p: 1, r: 1, w: 1, d: 1}? 1/20 What is prob of sequence oi when two letters picked without replacement from eiozoeezgzozeyeogee? 2/171 Two letters picked without replacement from ttsgcttccccckxtcccc. Give prob of sequence tc. 25/171 Two letters picked without replacement from {n: 10, t: 4}. What is prob of sequence tn? 20/91 Two letters picked without replacement from rrtgtggg. Give prob of sequence rg. 1/7 Three letters picked without replacement from {f: 1, q: 2, z: 1}. What is prob of sequence qzq? 1/12 Two letters picked without replacement from qjtjhqjsjqjqjjt. What is prob of sequence qj? 2/15 Four letters picked without replacement from {u: 1, b: 1, m: 2, o: 1, k: 2, t: 2}. Give prob of sequence kbom. 1/756 What is prob of sequence mh when two letters picked without replacement from mhummwwiim? 2/45 Calculate prob of sequence hxnx when four letters picked without replacement from kkknhnkxhxx. 1/330 Calculate prob of sequence ccwo when four letters picked without replacement from cjjjccuowu. 1/840 Calculate prob of sequence rb when two letters picked without replacement from {r: 1, b: 1, v: 1, d: 3, c: 5}. 1/110 Four letters picked without replacement from wwkwkkwkwkkkkk. Give prob of sequence kwww. 45/2002 Three letters picked without replacement from {t: 3, y: 3, f: 1, v: 5, s: 6, m: 2}. What is prob of sequence ymf? 1/1140 Two letters picked without replacement from vvbvvvvbvvvvvvvbvbv. What is prob of sequence vv? 35/57 What is prob of sequence kf when two letters picked without replacement from {c: 5, f: 1, z: 4, w: 1, k: 3}? 3/182 Three letters picked without replacement from jojqjsojoqsojoil. What is prob of sequence ilq? 1/1680 What is prob of sequence ggvo when four letters picked without replacement from gvnogovoong? 1/165 Calculate prob of sequence cssv when four letters picked without replacement from {z: 1, s: 3, c: 6, k: 1, v: 3}. 9/2002 Calculate prob of sequence gs when two letters picked without replacement from {g: 1, s: 5, p: 2, b: 4, o: 2, r: 1}. 1/42 What is prob of sequence bp when two letters picked without replacement from {b: 2, p: 1}? 1/3 What is prob of sequence ru when two letters picked without replacement from ruuuuuuruuuuuuuuuruu? 51/380 Four letters picked without replacement from mplrdrdlprdrrppdpd. Give prob of sequence rrdr. 5/1224 Two letters picked without replacement from xesoxeqooxe. Give prob of sequence eq. 3/110 Two letters picked without replacement from vnvnquunvyyxqvn. What is prob of sequence nu? 4/105 What is prob of sequence fr when two letters picked without replacement from srrrfrfsrrr? 7/55 Calculate prob of sequence eg when two letters picked without replacement from {e: 2, g: 1}. 1/3 What is prob of sequence ofg when three letters picked without replacement from {f: 1, o: 1, g: 1}? 1/6 Four letters picked without replacement from {s: 2, j: 1, a: 2}. What is prob of	{ "pile_set_name": "DM Mathematics" }
+ 2/103. Let s = -4 - -3. Let y = -9/28 - -4/7. What is the nearest to s in 5, y, c? y Suppose 2b + 4 = b. Let p = -13 - -14. Let n = p - b. What is the nearest to -1 in -0.2, 2, n? -0.2 Let z = 1.6 + -1.6. Which is the closest to z? (a) -3 (b) 2/5 (c) 31 b Let u = 82 + -81.9. What is the nearest to u in -0.4, 3, -6, 1/2? 1/2 Let n = -36.8 - -37. Let g be 3/(-5) + 1 + -1. Let r = 0.12 - -2.88. Which is the closest to n? (a) g (b) -4 (c) r a Let w = -5.4 - -5. Let s = -3679 - -3684. What is the closest to -2/7 in 6, s, w? w Let j = -0.0949 + 0.0949. What is the closest to -1/3 in j, -3/7, -0.5, 0.4? -3/7 Let d = -6 - -4. Let h = 1.67 - 2.596. Let s = -0.074 + h. Which is the nearest to d? (a) -4/3 (b) -2/11 (c) s a Let g = 2.75 + -2.45. Which is the closest to 24? (a) g (b) 0.4 (c) 0.5 (d) -1 c Let x = 0.459 + 0.001. Let m = x + -0.16. Let p = 0.36 + 0.04. What is the closest to 0 in p, -2, m? m Suppose -3x = -7x - 20. Let m = 0.347 + 0.153. Let u = 0.04 - -0.06. Which is the closest to 1/2? (a) u (b) m (c) x b Let q be (-3)/(-12) + (-58)/16. Let l = q + 33/8. Let p = -19/6 - -121/42. What is the closest to 1/4 in p, l, -0.5? l Let m = -0.284 + 0.12. Let n = m + -0.036. Which is the closest to 2/3? (a) 1 (b) n (c) 4/5 c Let q = 7721/4 + -1930. Which is the closest to q? (a) 50 (b) 4 (c) 1/4 c Let u = -2 + 1.9. Suppose 0s + 18 = 3s. Let d be (-72)/(-126)s/(-8). Which is the nearest to 2/3? (a) d (b) u (c) -1/6 b Let s be (365/(-50) - -7)/((-6)/8). Which is the nearest to s? (a) 4 (b) 12 (c) 2 c Let b = 704 + -2815/4. What is the closest to b in 1/4, -0.8, 1/3? 1/4 Suppose 3b - 3k = -2b + 8, b = 3k + 4. What is the closest to 9 in -0.04, b, 0.2? b Let g = 96 - 1250/13. What is the nearest to 0 in 2, g, -1/5? g Let x = -3.01 - -3.05. What is the closest to -1 in -2/9, -2, x? -2/9 Let h = -1.1 - 8.9. Let n = 10.4 + h. What is the closest to 1 in -3/5, -4, n? n Let v = 11.1 + -11.5. Let p = -3 + 2. Which is the closest to p? (a) v (b) -3 (c) 2/3 a Let s = -42/47 + 274/517. Let w = 2.229 + -6.229. What is the nearest to s in 4, 3, w? 3 Let x be 8/20 + 14/(-10). Let u be (-4)/6 - ((-32)/24 - x). What is the closest to -0.1 in 5, u, -0.2? -0.2 Let z = -107 - -533/5. Let d = 0.54 - 0.5. Which is the closest to d? (a) -2 (b) -3 (c) z c Let h(m) = -m*3 - 50m2 - m - 50. Let s be h(-50). Which is the closest to 0.1? (a) -0.2 (b) 2.7 (c) s c Let o = 282 - 283. Let q(r) = r2 - 6r + 1. Suppose -g = 2y + 2, 2g = 5y - 2y + 24. Let i be q(g). What is the nearest to 1/4 in 1/4, o, i? 1/4 Let j(k) = k2 + 15k - 1. Let f be j(-4). Let o = -224/5 - f. Which is the closest to -2? (a) 0.1 (b) o (c) -3/5 c Let s = -1489 - -1492. Let o = -0.3 - -0.2. Which is the nearest to -0.2? (a) -6 (b) o (c) s b Let u be (20/(-30))/((-2)/(-2)). Let s(g) = -2g2 - g + 6 + g2 - 16. Let j be s(0). Which is the nearest to u? (a) 0 (b) 2/3 (c) j a Let z = -307 + 306.9. Which is the closest to -86? (a) z (b) -2/5 (c) 5 b Let l be 35/28 + 36/(-24). What is the nearest to -1 in 12, 0.4, l? l Let j = 3.78 + 0.22. Let q = -18 - -31. Let l = q - 13. Which is the closest to l? (a) j (b) 1 (c) 2/9 c Suppose -5h + 5g = -220, 12g - 17g = -4h + 172. What is the closest to -1 in h, -0.5, -1, -0.4? -1 Suppose 0 = -l + 2k + 6, -2 = l - 0k + 2k. Suppose 2i + 3i = -25, -4a + 29 = -5i. Let t be (a/(-3))/((-12)/(-9)). What is the closest to t in 4, -0.5, l? -0.5 Let u = 353.21 + -356. Let i = -0.21 + u. Let t = -2.9 - i. Which is the closest to 2/5? (a) t (b) 0.3 (c) -4 b Let b = -28 + 27. Let l = 4.5 - 0.5. Let j = 3.8 - l. What is the nearest to b in 1/2, -3, j? j Let u = 22 + -32. Let i = u - -6. Let h = 0.08 + 0.02. Which is the closest to h? (a) i (b) 3/5 (c) 1/3 c Let x be (-3 - (-45)/20)/(90/16). Which is the closest to 1? (a) -5 (b) x (c) 0.4 (d) 0.5 d Let g = 4.3 + -4. Let j be ((-24)/30)/(((-40)/25)/(-4)). What is the closest to j in 2/7, -1, g? -1 Let i = -135.61 - 2.39. Let k = -137 - i. Which is the closest to 2/3? (a) 2/27 (b) -2/11 (c) k c Let j = -25.81 - -25.31. Which is the closest to -0.8? (a) -3/7 (b) j (c) 3 (d) 0.5 b Let p = 12 - 7. Let f = 2 + -1.7. Let l = 172.3 + -172.4. Which is the nearest to l? (a) 2/3 (b) f (c) p b Let t = 2 - 3. Let h = 95 + -47. Let f = h + -40. Which is the closest to t? (a) f (b) 5 (c) 3/4 c Suppose 31 = 12l - 29. Which is the closest to -0.1? (a) -4/5 (b) -6 (c) l (d) -0.4 d Suppose -9 = s + y - 12, -4y + 11 = 3s. Which is the closest to s? (a) 10 (b) -5/2 (c) 0.1 (d) 1/3 d Let m = -280050/79 + 3545. What is the nearest to -2 in 2, 3, m, 0.3? m Let k be (-17)/18 - (-9 - (-2 - 6)). Which is the nearest to k? (a) 0 (b) -9 (c) 2 a Let v(r) = r*3 + 4r*2 - 5r + 4. Let q be v(-5). Let w be q/6 - (-14)/(-6). Let h = 0.11 + 0.09. Which is the closest to h? (a) -2/5 (b) w (c) 5 a Let q be (13 + -16)(-3)/9. What is the nearest to q in -2/5, 3, -0.3, 5? -0.3 Let h = 12 - 10. Let f = h - -3. Which is the closest to -1/2? (a) -4 (b) f (c) -2 c Let u be ((-3)/42)/((-13)/52). Which is the nearest to u? (a) -0.17 (b) -0.03 (c) -3 (d) 0.4 d Let d = 23.73 - -0.27. Let l = 24.4 - d. What is the nearest to -3 in 2, -0.1, l? -0.1 Let v = -253/4344 + 3/181. Which is the nearest to 0? (a) -4 (b) 1 (c) v c Let z = 0.497 - 8.497. Which is the closest to 1/3? (a) 8 (b) -4 (c) z b Let h = 351.9 + -368. Let t = h + 16. Let i = -2.5 - -3. What is the nearest to 1/3 in -1, i, t? i Let p(v) = 8v - 106. Let u be p(13). Which is the nearest to -0.3? (a) -3 (b) u (c) 2/11 c Let d be 2/((-3 + 4)-3). Let i = 456 - 3190/7. Which is the closest to d? (a) -5 (b) i (c) -0.4 c Let k be 7/4 - 2/(-8). Let u(s) = -6s + 2. Let z(m) = -m + 1. Let i(l) = u(l) - 5z(l). Let t be i(-3). Which is the closest to -0.1? (a) t (b) -5 (c) k a Let n be -4 - (-5 - -3)/(6/13). Which is the closest to 8? (a) -0.2 (b) -1/3 (c) -2/3 (d) n d Let f be -3 - (-2)/(0 + 2). Let q = 179.8 + -179.87. Which is the nearest to 0? (a) q (b) 1/3 (c) f a Let z = -4 + 6. Suppose -4h - 4k + 4 = h, -3k - 24 = -3h. Suppose -4 = -3y - 2l, hy - 5l + 4 = -10l. What is the nearest to 1 in -5/2, y, z? z Let v = 3.971 + 0.029. What is the nearest to 0 in v, 2/7, 0.5? 2/7 Let i = -4.4 + 4. Let n be 50/24 + (-4)/(-6). Let f = 9/4 - n. Which is the closest to -2/3? (a) f (b) 0.5 (c) i a Let n = 0.63 + -0.13. Let b = 20 - 22. Let g = 0 + 1. What is the nearest to g in -2/13, b, n? n Let w(c) = c*3 - 4c*2 + 4c - 4. Let x be w(3). Let v = -0.15 + -3.85. Let h = -7/15 + 1/15. What is the closest to h in v, x, 0.1? 0.1 Suppose 0 = -0b - b. Let s = 35 - 179/5. Let n = 2.9 + -3. What is the nearest to b in n, s, 0.2? n Let w be (-35)/(-36) + (-135)/180. Which is the nearest to 0? (a) 0 (b) w (c) 0.03 a Let i = 0.085 - -0.115. Which is the closest to 0? (a) 2/7 (b) 25 (c) i c Let w = -27 - -14. Let x = 73 - 86.5. Let d = x - w. What is the nearest to -1/4 in -4, d, -1/5? -1/5 Let y = -0.1814 + -2.8186. Let x = -0.2 - -1.2. Let r = x - 1. Which is the nearest to r? (a) y (b) 2 (c) 0.4 c Let y = 1.67 + 0.43. Let j = 0.9 + y. Let q = 0.95 - 0.75. Which is the nearest to q? (a) j (b) 0 (c) -2/17 b Let a = -154 + 165.9. Let s = a - 11.9. What is the nearest to 2/89 in 0.1, s, 3? s Let l = -763 - -762.9. What is the nearest to l in 2/17, -2/7, -2, -4? -2/7 Suppose 0 = -9o + 6o + 12. Suppose -2u + 20 = -ot - 6u, 2 = -4t + 5u. Which is the closest to -0.2? (a) t (b) -2/17 (c) -2/7 b Let o be (-36)/5 - 77/(-11). Which is the nearest to -7? (a) 4 (b) 0.5 (c) o (d) -5 d Let l = 0 - 0.1. Let p = 61.8 - 61.7. Which is the closest to p? (a) l (b) -3/4 (c) -0.4 a Let j be (-4 - 1) + 1/(-1). Let x(n) = -2n2 - 19n - 4. Let o be x(-9). Let z = j + o. What is the closest to -1/4 in 0.3, z, -0.4? -0.4 Let k be 24/(-40) + (-814)/110. Which is the nearest to 2? (a) -5 (b) k (c) 0.2 c Suppose 4s - 16 = -4z, -z - 4*z + s = -14. What is the nearest to 0.2 in 12, z, 0, -1? 0 Let s = 1640.64 + -1641. Which is the nearest to -2? (a) 1 (b) s (c) 2/3 (d) -0.03 b Let z = 2.417 + -2.71. Let k = z - 0.007. Which is the closest to -3/2? (a) -4 (b) k (	{ "pile_set_name": "DM Mathematics" }
289 Divide -420075 by 2986. -420075/2986 1126546 divided by -16 -563273/8 Divide -4 by -6817906. 2/3408953 Divide -60014217 by -2. 60014217/2 Calculate 4 divided by 265942980. 1/66485745 Divide -1 by 22929735. -1/22929735 6541767 divided by 726863 9 Divide -85750880 by 8. -10718860 Calculate 72865644 divided by -3. -24288548 What is 8681442 divided by 798? 10879 -239997203 divided by -23 10434661 Calculate 17556224 divided by -20. -4389056/5 Divide 1588 by 3355. 1588/3355 Calculate 77514657 divided by 2348929. 33 Divide 27143 by -754. -27143/754 Divide -4472672 by 944. -4738 Divide 14914930 by 8. 7457465/4 -1461669330 divided by 22146505 -66 What is -2600075 divided by -9? 2600075/9 1361043900 divided by 37005 36780 -7803720 divided by -3816 2045 Calculate 3850850 divided by -1925425. -2 6613 divided by -25 -6613/25 Divide -3 by 2107726. -3/2107726 187005936 divided by 2704 69159 17263 divided by 4045 17263/4045 Calculate -7540169 divided by 13. -580013 What is -1792 divided by 19245? -1792/19245 Divide -10201330 by 351770. -29 Divide 4781 by 14589. 4781/14589 Calculate 69002605 divided by -13800521. -5 What is 21503485 divided by -4300697? -5 62662 divided by 53 62662/53 289300 divided by -550 -526 -4 divided by 3310840 -1/827710 Calculate -32330127 divided by 10776709. -3 What is -67467820 divided by 69340? -973 Divide -566 by -142463. 566/142463 Calculate -1015060 divided by -3. 1015060/3 -3482473 divided by -1 3482473 Divide -177 by -2202805. 177/2202805 What is 23985808 divided by 88? 272566 Divide -3629 by -967. 3629/967 What is -94270831 divided by -375581? 251 What is -6046755 divided by 5? -1209351 -276785646 divided by -6 46130941 What is -23760794 divided by -2? 11880397 Calculate 168 divided by -176360. -21/22045 Calculate 115714 divided by 93. 115714/93 15143504 divided by 8 1892938 -5650488 divided by 8 -706311 Calculate 9149828 divided by 13. 9149828/13 46033 divided by 416 3541/32 5886810 divided by 43606 135 Calculate 7488731 divided by 7. 7488731/7 Calculate -1048135 divided by 935. -1121 What is 328 divided by 84576? 41/10572 Divide 1482712 by -6391. -232 Calculate -4340008 divided by -458. 9476 Divide -1164492 by -18. 64694 What is 1270304 divided by 14? 90736 What is -1659936 divided by -414984? 4 What is 35644020 divided by -8911005? -4 Divide -873 by 48275. -873/48275 What is 2 divided by 1453705? 2/1453705 Calculate 1 divided by 3908920. 1/3908920 Calculate 19902789 divided by 4. 19902789/4 What is 0 divided by -33160811? 0 Divide 17075334 by -2. -8537667 683832 divided by -6 -113972 29 divided by -3007705 -29/3007705 What is 11930490 divided by 60255? 198 Calculate -3137420 divided by -285220. 11 Divide -16398830 by -66934. 245 17 divided by 26968053 17/26968053 -112 divided by -160427 112/160427 2 divided by 15335311 2/15335311 Calculate -13296294 divided by -9. 1477366 Calculate -1015761 divided by -1015761. 1 What is 113505 divided by -37835? -3 What is -3469 divided by 404? -3469/404 What is -34 divided by -1203873? 34/1203873 Divide 2 by -52882157. -2/52882157 4366 divided by 26 2183/13 Calculate -2996 divided by -10553. 2996/10553 Divide -26016 by -23378. 13008/11689 Divide 189768448 by -64. -2965132 Calculate -2 divided by -16669805. 2/16669805 What is -57658305 divided by -19605? 2941 -11176802 divided by 798343 -14 43 divided by -79089 -43/79089 What is 76982535 divided by 21? 3665835 Calculate -1535705124 divided by -7640324. 201 What is -748751016 divided by 4958616? -151 Divide 15024 by 532. 3756/133 46175058 divided by -558 -82751 -242 divided by 319273 -242/319273 Divide -4500640 by 736. -6115 What is 11413 divided by 6? 11413/6 Divide 928096 by -5044. -184 -4 divided by -8830723 4/8830723 Calculate -639895 divided by 8. -639895/8 Divide -1602687 by -55. 1602687/55 Divide -2749 by -1063. 2749/1063 Divide 976118708 by 4036. 241853 What is 5 divided by -674436? -5/674436 Divide 362136 by -30178. -12 Divide 36521430 by 10061. 3630 What is -111267910 divided by -26? 4279535 What is 3183180 divided by -1166? -2730 What is 102153220 divided by 20430644? 5 Divide 55808130 by 2. 27904065 -210 divided by 87436 -105/43718 What is 3 divided by 92117849? 3/92117849 What is 3 divided by 3529997? 3/3529997 Divide 4330844 by -309346. -14 What is 81 divided by 2789128? 81/2789128 What is -291 divided by 57704? -291/57704 -2200523 divided by -5 2200523/5 What is -4314015 divided by -15? 287601 Divide -1559122 by -2. 779561 Calculate -564952300 divided by -2. 282476150 What is 981355 divided by -5? -196271 Calculate -3 divided by -191770931. 3/191770931 What is -342472 divided by 12? -85618/3 What is -434547750 divided by -650? 668535 What is 50766980 divided by -13970? -3634 Divide 177830885 by -35566177. -5 Calculate 556423580 divided by -145. -3837404 What is 28220424 divided by -14110212? -2 Divide 323679545 by -4. -323679545/4 Calculate 28739164 divided by 2. 14369582 113582 divided by -1 -113582 Calculate 2040500 divided by -22. -92750 Divide 186178388 by 47543. 3916 -121 divided by 304776 -121/304776 Divide 2012775 by 1. 2012775 What is 143892 divided by -361? -143892/361 Divide 1029 by 17493. 1/17 What is 38197363 divided by 22723? 1681 Calculate 4453134 divided by 21. 212054 Divide -156446 by -453. 156446/453 -16695754 divided by 34 -8347877/17 Calculate 32 divided by -17160738. -16/8580369 Divide 319190677 by -12149. -26273 What is 8014298 divided by -11? -8014298/11 Calculate -208007149 divided by -3. 208007149/3 Divide -142368666 by 1031657. -138 Calculate 4102461 divided by 209. 19629 Divide -1229955 by 3. -409985 Calculate -663910464 divided by -38. 17471328 What is -5376120 divided by -284? 18930 Divide -3 by -47943306. 1/15981102 Divide -345826049 by -187643. 1843 Divide -298266561 by -1341. 222421 38617780 divided by -3 -38617780/3 What is 31822725 divided by 11345? 2805 What is -28269472 divided by -576928? 49 Divide -632728 by 1472. -79091/184 23 divided by 1697659 23/1697659 6577824 divided by -205557 -32 Calculate -759449200 divided by -5. 151889840 -5323486 divided by -20554 259 Divide -7186140 by -39. 184260 402896193 divided by 4854171 83 277196950 divided by -138598475 -2 Divide 33341872 by 8335468. 4 What is -46516470 divided by -231? 201370 Divide 4 by -4805416. -1/1201354 Divide 2 by 3034537. 2/3034537 4979 divided by -13969 -4979/13969 Divide 5 by -1250369. -5/1250369 Calculate 15766680 divided by -15830. -996 -50185377 divided by 187 -268371 What is -12988184 divided by 4? -3247046 Divide 13203870 by 2. 6601935 Divide -31498764 by 3. -10499588 Divide 72234162 by -132297. -546 Calculate 47218752 divided by -15739584. -3 What is 20250 divided by -13328? -10125/6664 -14908010 divided by 65 -229354 Divide -1604327 by 5669. -283 273374 divided by 1986 136687/993 What is 99486 divided by 33162? 3 -7883716 divided by 764 -10319 What is -2243759 divided by -8? 2243759/8 -1187 divided by -82305 1187/82305 Divide 40707 by -7772. -40707/7772 What is 2233694 divided by 9346? 239 12 divided by -236605 -12/236605 2 divided by -23668342 -1/11834171 Calculate 10059147 divided by 63. 159669 Calculate 16904743 divided by -8. -16904743/8 What is -41941404 divided by 98454? -426 Divide -5142450 by 2571225. -2 What is -251 divided by -69965? 251/69965 -2327650 divided by -130 17905 37879 divided by 148 37879/148 Calculate -1 divided by 108937081. -1/108937081 Divide 160337532 by 6. 26722922 Calculate 43700 divided by -16118. -21850/8059 Divide 11082752 by 316. 35072 224592 divided by -9358 -24 Calculate -55584 divided by 352. -1737/11 What is -43452 divided by 571? -43452/571 3004 divided by -5695 -3004/5695 Calculate 9336712 divided by 3542. 2636 What is 526726071 divided by -9? -58525119 Divide 2178 by 92799. 242/10311 Divide -398371110 by -2. 199185555 -798 divided by -96841 798/96841 Calculate 9 divided by 540462. 3/180154 Calculate -90785696 divided by 1004. -90424 Calculate -122732391 divided by 122732391. -1 -80445 divided by -1514 80445/1514 -2486016 divided by 24 -103584 Divide 21505143 by -24747. -869 Divide -31595876 by -2836. 11141 42493857 divided by -14164619 -3 Divide 1952771922 by 2. 976385961 8255688 divided by -196564 -42 Divide -717663 by -142. 717663/142 Calculate -589 divided by -1984. 19	{ "pile_set_name": "DM Mathematics" }
-23u3 + 4u*2 - 4u*2)(3u - u + 0u). -49u4 Expand -3 + 2v*2 + 3 + (-81 - 103 + 158v + 185)(1 + 2v - 1). 318v2 + 2v Expand (5q - q - 3q)((28 + 19 + 8)(-22q - 8q - 42q) - 4q + q + 0q). -3963q*2 Expand -2w3 + w5 - w*3 + 4w*3 - 15w*4 + 15w*4 - 3w*5 + (-5w*3 - 2w*3 + 2w*3)(5w2 - 4w*2 - 2w*2). 3w5 + w3 Expand (-4 - 3x + 4)(-4x + 2x - x) - 2x2 + 0x2 - x2 + (x + 0x + 13x)(x - x - x). -8x*2 Expand (7c*2 + 2c*2 + 8c*2)(-47c - 31c + 17c) + c2 + 2c3 - c2. -1035c3 Expand (3 + 0 - 2)(-x*2 + 1439x*4 - 1 + 1429x*4 + 2x*3 - 2887x*4) + 0x*2 + 3x*4 + 0x*2. -16x*4 + 2x3 - x2 - 1 Expand 1187d3 + 55354d*2 - 55354d2 + (d3 - 4 + 4)(2 + 2 - 6). 1185d*3 Expand (-5k*2 - 17k + 17k)(-1752k - 1893k + 3971k). -1630k*3 Expand (6386q + 13286q + 529 - 529)(-2 + 2 + q*2). 19672q*3 Expand 7551 + 52n - 7551 + (-2 + 0 + 3)(-5n - n + 5n) - n - 6n + n. 45n Expand 3s*4 - 7s*4 + 2s*4 + 0s4 + s4 + 2s4 + (3 - 3 - 2)(0s4 + s4 - 2s*4) + 3 + 35s*2 - 35s*2 + 3s*4. 6s*4 + 3 Expand (2f*2 + 2f - 2f)(-705 + 1208 + 1649 + 1623 + 481). 8512f2 Expand (-2d - 2d + 2d)(4 - 19 - 28)(26 + 5 - 9). 1892d Expand (7025b - 3b2 - 54038 - 54036 + 108076)(-2b3 + 5b*2 - 5b*2). 6b*5 - 14050b*4 - 4b*3 Expand (35s + 905 - 905 - 4s3)(-2s + 2s - 21s). 84s*4 - 735s*2 Expand 26437 - 26437 + 44f - f*2 - 3f*3 + (f + 2f - 5f)(-4f + f2 + 4f). -5f3 - f2 + 44f Expand (o*2 + 3o*2 - 6o*2)(-99 - 62 - 157). 636o2 Expand 0 + 2m*3 + 0 + (-172m + 274m + 227m)(-16m*2 + 10m*2 - 13m*2). -6249m*3 Expand (-40 + 26 + 20)(3r4 - r3 + r3) - r - 26r*2 - 8r*4 + 0r*4 + 28r*2. 10r*4 + 2r*2 - r Expand (-10 + 20 - 3)(-7y2 - 37y + 2y2 + 7y*2)(3y - 2y - 2y). -14y*3 + 259y*2 Expand -2t*3 + 0t*3 - 3t*3 + (t - 15t*2 - 16t*2 + 22t*2)(-4t - 4t + 4t)(-3 - 4 + 3). -149t3 + 16t*2 Expand (0 + 0 - c)(1 - 1 - c) + 187 - 20c2 - 187 - 393 + 393 + 85c*2. 66c*2 Expand (3m*2 - 2m*2 + 0m*2)(-5m + m + 0m)(2545 + 138m - 2545). -552m4 Expand (-f3 + 6f*3 - 12f*3)(-2 + 2 + 2f)(-35 - 140 - 124 + 129). 2380f4 Expand -1580 + 3190 - 374r*2 - 1603 + (2r - r - 3r)(-r - r + 0r). -370r*2 + 7 Expand -356w + 631w + 631w + (-1 + 3 - 4)(4w + 3w - 5w) + 4w - 2w + 0w - 2w - 5w + 4w. 901w Expand (0v + 0v + v3)(-225 - 374v - 8 + 235). -374v*4 + 2v*3 Expand 2p + 2p - 3p + (0 + 0 + 2p)(1 - 4 + 2) + 2p + p - p + 206p + 1147p - 163p. 1191p Expand (0r4 - r4 - r*4 + (2r + r - r)(r2 - r2 - r3) - r4 - 3r*4 + 3r*4)(0 + 12 - 4 + (-4 + 4 + 1)(-4 + 3 + 0) - 19 - 37 + 15). 170r*4 Expand (72774y - 72389y + 3 - 2)(2y4 + 5y4 + y4). 3080y5 + 8y*4 Expand (2x - 2x + x)(4x + 277x*2 - 272x*2 + 0x). 5x3 + 4x2 Expand (k3 - 2k3 - 2k*3)(-72 + 39 + 19)((-2 + 1 + 0)(3 - 1 + 0) + 2 - 2 + 2 + 2 - 1 + 1) - 6 + 13 + 39k3 - 41k*3. 82k*3 + 7 Expand ((3 - 2 + 0)(-2 - 2o + 2) + 800o - 1066o - 2272o)(-2 + 2o*2 + 2). -5080o*3 Expand (-149h - 540h - 104h)(5 - 5 - h). 793h*2 Expand 1219c + 78c4 - 1219c + (-66 - 8c + 66)(4c2 + c3 - 4c*2). 70c*4 Expand -10z*2 - 54 + 1901z + 53 - 1904z + z3 + (z2 + 0z*2 - 2z*2)(-59 + 3z + 59). -2z*3 - 10z*2 - 3z - 1 Expand (2i3 + 2i3 - i3)(-429i + 2696i + 2771i). 15114i4 Expand -3765r - 3915r + 7779r + 3r5 - 117r2 + (-r3 - 3r3 + 3r*3)(0r - 2r*2 + 0r). 5r5 - 117r*2 + 99r Expand (5d4 + 4d*4 - 4d*4)(-16d - 8d + 10d)(10 + 0 - 3). -490d5 Expand (98x - 24x - 48x)(-63 - 50 + 5). -2808x Expand (0 + 1 - 2)(4q - 4q + 3q + (72 - 43 - 52)(2q + q + 0q)). 66q Expand (-62 - 123 - 182)(-2u + 6u - u)(0 + 3 + 0). -3303u Expand 5w*3 - 2w*2 + 2w*2 + (2w + w - 5w)(5w2 - 3w2 - w2) - 53w3 - 62w*3 + 119w*3 + (-3w + 0 + 0)(-3 + 3 - 2w*2). 13w*3 Expand (-7k*4 + 3k*4 - 3k*4)(908k - 6 + 864k - 1707k). -455k*5 + 42k*4 Expand -2z4 - z4 - 4z4 + (-z4 + z4 - 2z*4)(-89 + 57 + 84). -111z4 Expand 28 - 24t - 28 + (1 - 2 - 1)(-2t - t + 0t) - t + 0 + 0 - 7 + 7 + 3t + (2 - 2 - 2)(3t - 2t + t). -20t Expand (-21l + 142 - 142)(20 - 18 + 2l + 16l) + (1 + 0 + 1)(l - l - 2l*2). -382l*2 - 42l Expand (878s + 1264s + 271s - 664s)(-3 + 4 + 1). 3498s Expand (4116t2 - 2253t*2 - 2t + 2 - 2122t2)(18 - 18 - 7t). 1813t*3 + 14t*2 - 14t Expand (3n - 8n + 3n)(23 - 34 - 55) + (-n + 0n - 4n)(-3 - 7 + 15). 107n Expand ((2 + 1 - 1)(52c - 104c + 19c) + 21c - 2c + 14c)(c4 + c4 + c*4). -99c*5 Expand (0 + 0 + 1)(-54d - 149 + 149)(166d2 - 64d*2 - 2d*2). -5400d*3 Expand (-2 - 6t*2 + 2 + 0 - 2t*2 + 0 + (3t - t - 4t)(-2t + 3t + 0t))(0t + 4t + 8t). -120t*3 Expand (120 - 120 + 19r)(-r2 + 6r*2 - 4r*2) + 6r2 - r3 - 6r2 + 3r*2 - 3r*2 - 2r3 - r3 + 2r3 - 2r*3 + (2r - 3 + 3)(3 - 3 - r2). 13r*3 Expand (3d - 2d + 2d)(2 - 2 + 2d*4) - 56d*5 - 36d*5 + 2329 - 2339. -86d*5 - 10 Expand -343 + 222 - 2x + 418 + (3x + x + 0x)(-3 + 1 + 3) + x + 4x - 4x. 3x + 297 Expand n3 + 1 - 1 - 1 + 1 - n3 + (3 + n*2 - 3)(1 + 6n - 1) + 15n*3 - 12n*3 + 19n*3. 28n3 Expand (x4 + 1 - 1)(91 - 47 + 1) - x4 + 0x*4 + 2x*4 - 2x4 + 24 - 24 - 1 + 1 + x4 + (2x4 + 4x*2 - 4x*2)(5 - 2 - 2). 47x4 Expand (3 + 1 - 6)(0 + 19 + 1)(6w*3 + 5w*3 - 5w*3)(0 - 7 - 5). 2880w3 Expand (240z + 153z - 537z)(0 + 3 - 1)(1 - 3 + 0). 576z Expand (-13 - 77 + 18)(5 + 0 - 4)(-1 - 2 + 0)(3 + 2 + 1)(0o + 0o + o4). 1296o*4 Expand (1060578s - 1060578s + 1409s*2)(-s + 4 - s + s). -1409s3 + 5636s*2 Expand -3n - 2n + 6n - 2 + 2 - n + (-2n - n + 2n)(3 - 5 + 0) + 0n + 5n - 4n + 11n + 9n + 16n + (-3 + 5 - 1)(2n - 3n + 2n) + 2n + 5n - 5n. 42n Expand (41753 - 41753 + 45m)(-m2 + 3 - 3)(-1 + 4 - 2) + 2m3 - 2m3 - m3. -46m3 Expand -10x*4 + 5x*4 + 2x*4 + (-37x + 8x3 + 37x)(x - 2x + 2x). 5x*4 Expand (a + a - 3a)(5 - 2 + 2)(-243a - 320a + 87a). 2380a*2 Expand (5p - 2p + 14p)(4p - 5p + 3p)(-1 + 12 - 3) - 4p*2 + 3p*2 + 2p*2 + (0 + 0 - p)(p + 0p + p) + (-2p + 0p + p)(-4p - p + 0p). 276p2 Expand ((4c + 2c - 4c)(4 + 1 - 4) - 2c + 3c + c)(256 - 61c - 512 + 255). -244c*2 - 4c Expand (3o + 12 - 12)(7o2 - 7o*2 + 2o*3)(-49o + 4o + 7o). -228o*5 Expand (15 + 2z*3 - 17 + 29)(-3z2 + 5z*2 - 3z*2) + 1133z*2 - 16z*5 - 226z*5 - 1133z*2. -244z*5 - 27z*2 Expand (-2u*3 - 3u*3 + 3u*3)(2u2 - 4u2 + u2) + (-3u + 3u + u*3)(24u2 + 30u*2 - 21u*2) + 0u*5 - 2u5 - u5. 32u5 Expand (3 - 3 - 9)(-1 + 24 - 12)(2r + 0r - 3r). 99r Expand 2d*2 - d + d - 448 + 27d*2 + 448 + (2d - 3d + 0d)(-3d - 6d + 0d) + 0d2 - 2d*2 + 5d*2. 41d*2 Expand (-107 + 107 + 78d*2)(-23d3 - 5d*3 + 7d*3). -1638d*5 Expand (33n + 76n - 16n)(-5n3 + n3 + 3n3) - 4n*4 + 8n4 + n4. -88n4 Expand -2i*2 + 4i*2 + 0i*2 + 3i*2 - 4i + 4i + (-5i + 3i + 4i)(42i - 47i + 58i) + (3i - 3i - 2i)(-i + i + i) + 0i2 + 0i*2 - 2i*2. 107i*2 Expand (-100 - 2n + 102 + 4n)(4 - 1 + 2) + 3n - 4n + 2n. 11n + 10 Expand 27f - 633 + 633 + (-f - f + 5f)(-1 + 0 + 4) - 2f + 3f - 2f. 35f Expand 10 - 15f - 10 + (-34 + f + 34 + 0f - f + 2f + (0f - 3f + f)(-2 - 1 + 5) + 2f - 5f + 0f)(-3 + 0 + 4)(-4 + 5 - 2). -10f Expand (-2712 + 1389 - 87s*2 - 10s - 32s2 + 1322)(5s - 2 + 2). -595s*3 - 50s*2 - 5s Expand (-3w - w + 5w)(-3w + 2w + 3w) + 4w - w2 - 4w - 13w2 - 30w*2 + 9w*2 + 2w*2 - 71 + 71 + 32w + (5w - 4w - 3w)(3 + 2w - 3). -35w*2 + 32w Expand (2d2 - 4d*2 + 3d*2)(240 - 187 + 940d - 947d). -7d3 + 53d*2 Expand g - g - 21g*3 + (2g - 2g + 3g*2)(22 + 5g - 22)(4 + 2 - 5). -6g3 Expand 189x*2 - 230x*2 - 449x*2 + (-3x + x + 4x)(4 - 4 -	{ "pile_set_name": "DM Mathematics" }
5. Give -n(o) + 4t(o). 2o + 1 Let z(p) = 10p. Let n(q) = -17q - 11. Let g(t) = 3t + 2. Let x(y) = 11g(y) + 2n(y). Give -5x(c) - z(c). -5c Let o(r) = -3 + 1 + 1 + 2. Let g(j) be the third derivative of j4/24 + j3/6 + j2. Calculate 4g(n) - 4o(n). 4n Let t(q) = -6q2 + 2q + 7. Let j(u) = -7u2 + 2u + 8. Let c = -19 + 23. Suppose -co + 3m = 16, o + 3m = -3o - 16. What is oj(f) + 5t(f)? -2f2 + 2f + 3 Let u(i) be the second derivative of -4i + 1/2i*3 + 0 - 3/2i*2. Let v(n) = -n + 1. Determine 2u(m) + 7v(m). -m + 1 Let m(o) = -26o*2 + 30o + 5. Let k(d) = -d*2 + 6d + 1. Determine 5k(b) - m(b). 21b*2 Let m(f) = 7f*2 + 12f + 4. Let n(y) = -3y2 - 7y - 2. Calculate -3m(d) - 5n(d). -6d2 - d - 2 Let h(c) = -2c + 5. Let q(k) = -6k + 99 - 33 - 52. Determine -17h(j) + 6q(j). -2j - 1 Let z(j) = 23j2 + 4j - 5. Let m(g) = -138g2 - 23g + 28. What is -6m(t) - 34z(t)? 46t2 + 2t + 2 Let k(z) = 4z2 - 1087z - 14. Let g(n) = 2n2 - 543n - 6. Give -5g(s) + 2k(s). -2s2 + 541s + 2 Let b(w) = 3w2 + 4w - 2. Let u = 2 - -5. Let j(y) = -2y + 9y*2 - 11y + 13y2 + 6 - 32y*2. Calculate ub(l) + 2j(l). l2 + 2l - 2 Let o(s) = 4s2 - 2s. Suppose 0l + 25l - 50 = 0. Let i(p) = -p*2 + p. What is lo(x) + 4i(x)? 4x*2 Suppose 0 = 5l - 13l + 72. Let h = -4 - -7. Suppose -5a - hi - i = l, 0 = i + 1. Let u(r) = -r. Let o(z) = 2z - 1. What is ao(p) - 3u(p)? p + 1 Let q(m) = -3m2 + m + 20. Let c(v) = -5v*2 + v + 39. Calculate 4c(p) - 7q(p). p2 - 3p + 16 Let l(w) = 4w + 3. Let f(a) = 5. Calculate 2f(c) - 3l(c). -12c + 1 Let h(n) = 2n2 + 23n - 17. Let r be h(-12). Let b(c) = -4c3 + 5c*2 - 2c + 6. Let o(l) = -3l3 + 4l*2 - l + 5. What is rb(s) + 6o(s)? 2s3 - s2 + 4s Let g(z) = -z + 3. Suppose 44 = 2n - 0n. Suppose 0 = -w - w - n. Let q(p) = 1. Calculate wq(o) + 4g(o). -4o + 1 Let y(x) = -196x2 + 42x. Let k(q) = -751056 + 751056 + 5q - 23q*2. Calculate 42k(w) - 5y(w). 14w*2 Let c(q) = -3q. Let s be c(5). Let b(t) = -t. Let n(a) = -a*2 + 2a + 2. Let g be n(-1). Let p(u) = 3u2 + 15u. What is gp(l) + sb(l)? -3l2 Let b(p) = -5p*2 + 23. Let a(i) = -4i*2 + 19. What is 3a(l) - 2b(l)? -2l*2 + 11 Let s = 23 - 26. Let r(q) = 4q2 + q + 1. Let n(l) = -l2 + l - 1. What is sn(i) - r(i)? -i2 - 4i + 2 Suppose 4v - 138 = -106. Let z(g) = -4g*2 - 2g - 3. Let n(i) = -11i2 - 5i - 9. Determine vz(f) - 3n(f). f*2 - f + 3 Let n(z) = 27z - 161. Let h be n(6). Suppose -12 = 4s - 0. Let o(k) = k3 - 3k + 5. Let f(v) = -v + 1. What is ho(l) + sf(l)? l*3 + 2 Let w(n) = -9n + 8. Suppose -2a = -4, -2z - 2a = -6a. Let x(k) = 3k - 3. Let s(t) = 5t + 1. Let i be s(2). What is ix(m) + zw(m)? -3m - 1 Let r(b) = 25b - 39b2 - 2b + 45b2. Let x(q) = 4q*2 + 15q. Calculate 5r(h) - 7x(h). 2h2 + 10h Let m(s) be the second derivative of -s*3 + 32s + 1. Let z(g) = -g. Determine -2m(i) + 11z(i). i Let n(p) = 1. Let r(i) be the third derivative of -1/12i4 + 0 + 0i + 0i3 + 33i*2. Determine 2n(c) + r(c). -2c + 2 Let p(c) = 8c. Let b(r) = 61r + 50r + 34r. Determine -6b(a) + 110p(a). 10a Let j(f) = -10f + 36. Let s(z) = -7z + 2. Give j(b) - 5s(b). 25b + 26 Let p(v) = -3v2 + 9. Suppose -2t - 1 + 5 = 0. Let x be (-110)/(-12) + t/(-12). Let i be 153/30 + -4 - (-1)/(-10). Let a(z) = -1. Calculate ip(m) + xa(m). -3m2 Let j(t) = t - 4. Let w(x) = x - 9. Let v(p) = -2j(p) + w(p). Let m(k) = -6k - 2. Give m(h) - 5v(h). -h + 3 Let k(j) = j*3 + 3j*2 + 2j - 2. Let t(a) = a3 + a2 - a + 3. Let w(d) = -5d3 - 5d*2 - 6. Let r(c) = -3t(c) - w(c). Calculate 3k(y) - 2r(y). -y*3 + 5y2 Let x(j) = -j2 + 2j + 3. Let w(d) be the first derivative of -d3/3 + 3d*2/2 + 3d - 75. Determine -2w(i) + 3x(i). -i*2 + 3 Let r(w) = 81w*2 - 16w. Let h(f) = -16f2 + 3f. Suppose 0 = -19x + 13x + 12. Give xr(u) + 11h(u). -14u2 + u Suppose 5g = 7 - 2. Let h(x) = -6x - 2. Suppose 20 = -5m + 2r, m = 6m + 2r. Let p(w) = -w - 1. Give gh(n) + mp(n). -4n Let i(s) = 18s + 129. Let f(g) = 7g + 65. What is -5f(d) + 2i(d)? d - 67 Let w(j) be the first derivative of -j4/4 - j3/3 - j*2/2 - j - 192. Let y(c) = -18c*3 - 5c*2 - 5c - 5. What is -5w(l) + y(l)? -13l*3 Let w(p) = 4p*2 - 2p + 107. Let h(f) = -8f2 + 5f - 213. Determine 2h(k) + 5w(k). 4k2 + 109 Let z be -4(-1)/4 + 1. Let t(d) = 6d - dz - 2d - 5d. Let p(g) = -2g*2 - 3g + 2. Calculate p(o) - 3t(o). o2 + 2 Let v(q) = -24q*2 + 6 - 2q*3 - 3q*3 + 2q*3 + 7q + 19q2. Let a be (-1)/(-1) + 60/20. Let k(i) = 2i*3 + 4i*2 - 6i - 5. What is av(x) + 5k(x)? -2x3 - 2x - 1 Let m(r) = -5r3 - 6r + 158. Let u(f) = -4f3 - 5f + 157. Calculate 5m(a) - 6u(a). -a*3 - 152 Let b(l) = l - 1. Let r = -4 - -3. Let v(k) = -5k - 8. Let x(z) = rv(z) + 2b(z). Let u(y) = -15y - 13. Let d = -21 - -34. What is dx(w) + 6u(w)? w Let a(h) = 27h + 12. Let g(m) = 2m + 1. What is 2a(f) - 18g(f)? 18f + 6 Let l(z) = z + 1. Let r(m) = 7m3 - 4m*2 - 6m - 6. What is -4l(d) - r(d)? -7d*3 + 4d*2 + 2d + 2 Let f(t) = -149t + 7. Let n(z) = -z + 1. What is -f(m) + 6n(m)? 143m - 1 Let l(s) be the third derivative of -s4/12 - s3/2 + 37s*2. Let h(w) = -w. Determine 4h(o) - l(o). -2o + 3 Let c(u) = -u. Let h(x) = -x2 - 5x - 53. What is -4c(d) + h(d)? -d2 - d - 53 Let z(a) = a. Let b = -114 + 115. Let k(o) = 12o. What is bk(g) - 18z(g)? -6g Let d(k) be the first derivative of -1/2k*2 - 1/3k*3 + 1 + 5k. Let z(x) = -5 + 1 - 2x + 3 + 3x. Give -d(m) - 3z(m). m2 - 2m - 2 Let k(d) = -d*2. Let f(u) = 7u*3 + 3u*2. Let x(b) = f(b) - 2k(b). Let j(y) = 3y3 + 2y*2. Give -5j(n) + 2x(n). -n3 Let k(y) = 3y*2 - 3y2 + y + y2 - 4y. Let s(b) be the second derivative of -b4/4 + 5b*3/3 + 47b. Give -14k(m) - 4s(m). -2m2 + 2m Let m(d) = -d*2 - 2d. Let q(c) = -c. Let f be 3 + (2 - (0 + 4)) - 2. Calculate fm(r) - q(r). r2 + 3r Let n(m) = 81m3 + m2 + 10m + 5. Let p(h) = -2h - 1. Calculate -n(z) - 5p(z). -81z3 - z2 Let a(k) = -4k3 - k2 + 4k - 3. Let h(r) be the first derivative of 3r4/4 + r3/3 - 3r2/2 + 2r - 218. Determine 2a(c) + 3h(c). c3 + c2 - c Let g(u) = 4u + 1. Let h(l) = -5l - 2. Let x(m) = 14m - 171. Let y be x(12). Let f = 3 + -5. What is fh(t) + yg(t)? -2t + 1 Let m(s) = 5s2 - 6s + 6. Let h(o) = -o + 4. Let w = 102 + -100. Let q(b) = b - 3. Let a(x) = wh(x) + 3q(x). What is -6a(k) - m(k)? -5k*2 Let j(z) = -192z*3 + 2z*2 + 2z + 2. Let d(v) = -v3 - v2 - v - 1. Give -2d(c) - j(c). 194c*3 Let z(v) = -3v*2 + 5v - 3. Let s(r) = -2r2 + 4r - 3. Let x(f) = -f*3 - 13f*2 + 27f - 50. Let m be x(-15). Calculate ms(h) + 4z(h). -2h2 + 3 Let i(b) = 5b*3 + 4b*2 + 4b + 4. Let n(k) = -k*2 - k - 1. Suppose -4g + 3p + 52 = 65, 3p + 3 = 0. What is gn(a) - i(a)? -5a*3 Let p(h) = -3h*2 + 128h + 4. Let x(o) = -4o2 + 127o + 5. Give 5p(y) - 4x(y). y*2 + 132y Let g(b) = -b*2 - b. Let x be (1 + -3)/(6/(-75)). Suppose 12 + 28 = -4w. Let m be (40/x)/((-4)/w). Let u(y) = 6y2 + 4y. Determine mg(q) + u(q). 2q2 Let f = -660 + 661. Let c(v) = v3 - v - 1. Let r(y) = 4y3 - y + 1. What is fc(m) + r(m)? 5m3 - 2m Let g(v) = 5v3 + 2v*2 + 5v + 3. Let f(q) = q*3 + q. Calculate -3f(k) + g(k). 2k3 + 2k*2 + 2k + 3 Let v(o) = 19o2 + 2o - 1. Let p(n) = 19n2 + n. Determine 4p(d) - 3v(d). 19d*2 - 2d + 3 Let k(n) = 7n3 - 3n*2 + 7n + 7. Let t(u) = -3u3 + u2 - 3u - 3. What is 2k(y) + 5t(y)? -y3 - y2 - y - 1 Let o(b) = -6b2 - 10b. Let x = -596 + 595. Let l be (25/(-15))/(2/(-12)). Let m(k) = -k*2 - k. What is lm(d) + xo(d)? -4d*2 Let h(i) = -17i*2 - 9i - 12. Let r(g) = 9g2 + 4g + 6. Calculate -6h(s) - 13r(s). -15s2 + 2s - 6 Let u(w) = 3w2 - 1. Let q(a) = 880a*2 - 66. Calculate -q(x) + 66u(x). -682x2 Let s(d) = -56d - 1. Let o(k) = 58k + 2. Calculate 3o(h) + 4s(h). -50h + 2 Let a(s) = 4s3 + s2. Let g(t) = t2 - 6t + 8 + 0t2 + 1. Let u be g(6). Let i(p) = 8p**	{ "pile_set_name": "DM Mathematics" }
= 20.4 - 18. Let q = -0.4 + l. What is the third smallest value in u, q, 0.3? q Let v = 8 + -11. Let y(w) = -w*3 + 8w*2 - 2w. Let r be y(6). Let x be ((-3)/2)/(r/(-32)). Which is the smallest value? (a) 3 (b) v (c) x b Let u = -17 - -12.9. Let g = 4 + u. Let v = -0.3 + 0.8. Which is the third biggest value? (a) v (b) -4 (c) g b Let z = 0.16 + -2.16. Let j be (-2)/4 - (-15)/54. What is the second biggest value in 2/3, z, j? j Suppose -3m - m - 4 = -z, z - 3m - 2 = 0. What is the third smallest value in z, 5, -3? 5 Let u = -5.5 + -1.9. Let d = u + 7. Which is the smallest value? (a) 1/4 (b) -0.5 (c) d b Let o(i) = i + 352. Let n be o(0). Let q be n/(-70) - (2 - 5). Let u = q - -10/7. Which is the biggest value? (a) 1/2 (b) u (c) 1 c Let w = -2.1 + 6.1. What is the second biggest value in 1/4, w, 3/32? 1/4 Let j = -15.8 - -16. Which is the third biggest value? (a) 0.1 (b) 2/3 (c) j a Let t = 0.7 - 0.2. Let p = -0.05 + 5.05. Let c be (-6)/93/17. What is the smallest value in t, c, p? c Let n = 0 - 4. Suppose 2w = 6w - 12. What is the third biggest value in w, -0.5, n? n Let p = 1.7 - 2.4. Let u = p - 0.3. Let z = u + 0.5. Which is the third smallest value? (a) z (b) 0 (c) -3 b Let f = 21 - 20. Which is the second biggest value? (a) f (b) -18 (c) 3 a Let x be ((-1023)/(-4598))/(2/(-4)). Let t = 5/19 + x. Which is the biggest value? (a) t (b) -0.1 (c) 0.07 c Let n = -440 - -1321/3. Suppose -o = -0o + 1. Let d be o(-1 - (-1)/(-1)). What is the third smallest value in d, n, -2? d Let w(u) = u3 - 6u*2 + 4u - 1. Let f be w(5). Let h be -2 - (-2 + f/(-4)). What is the smallest value in 0, h, 4? h Suppose -p + 29 = 2v, -3v + 0v - p = -41. Let s be (v/(-40))/(6/8). Let q = -4.5 + 5. What is the third biggest value in q, s, 4? s Let l be ((-1)/(-3))/(2/24). What is the second biggest value in -0.4, l, 1? 1 Let d(h) = h2 - 2h + 3. Let w be d(2). Let q be (54/(-16) + w)2. Which is the third biggest value? (a) -5 (b) 0.4 (c) q a Let n(p) = 19p + 76. Let w be n(-4). What is the fourth smallest value in -1/5, -0.1, -1/2, w? w Let w = -15 + 12. What is the smallest value in 0.2, w, -1/2? w Let v = -0.56 + 0.6. Let l = -2.04 + v. Let i = 0 + -1. What is the third biggest value in i, l, 0? l Let g be 0 + -1 + (-1956)/14. Let t = 141 + g. Which is the second biggest value? (a) t (b) -4 (c) -1 c Let o = -40 + 278/7. Let b = -0.05 + 0.12. What is the third smallest value in 0.5, b, o? 0.5 Let y = -22 - -15. Let a = 4 + y. What is the biggest value in -0.2, a, -2? -0.2 Let t = 0.04 - -0.76. Let g = -0.7 + t. Let i be (4/6)/(44/(-12)). What is the second biggest value in g, i, -0.3? i Let d(w) = -4w2 - w. Let g be 0/(-2) + -2 + 1. Let t be d(g). Which is the third biggest value? (a) 0 (b) -1 (c) t c Let n be (15/60)/(10/(-8)). Which is the biggest value? (a) n (b) -9 (c) 0 c Let j = 7 + -11. Let k = -0.085 + -1.915. What is the biggest value in 4, j, k? 4 Let j(r) = -2r - 6. Let z be j(-5). Which is the fourth smallest value? (a) 2 (b) 0.1 (c) z (d) -0.2 c Let d be (0 + 3/(-6))-50. Suppose -2o + d = 3o. Suppose or = 4r + 1. What is the smallest value in 4, r, -3/4? -3/4 Let a = -4 - -9. Let p = -5.1 + a. Let f = 12 + -7. What is the smallest value in 4, f, p? p Suppose 3o - 280 = 176. Let b be 8/(-6)12/o. What is the smallest value in -1, 0, b? -1 Let p = -151 + 2266/15. What is the second biggest value in 1, 1/11, p? 1/11 Let o(h) = 3h - 43. Let z be o(12). Let r = 7 + -4. What is the smallest value in r, 0.3, z? z Let p = -102 - -81. Which is the smallest value? (a) p (b) -5 (c) -0.2 (d) -1 a Suppose 5x - x = 3m - 14, 25 = -5m - 3x. Let f(z) = -z*2 - 6z + 6. Let r be f(-7). Which is the biggest value? (a) m (b) r (c) 3/4 c Let d = 35.1 + -35. Which is the third smallest value? (a) 1 (b) d (c) -2 a Let d = 301 + -306.96. Let g = 22 + -22.04. Let v = g + d. Which is the biggest value? (a) -0.1 (b) v (c) 0.1 c Let l = -58 - -58.1. What is the second biggest value in l, -3, -0.5? -0.5 Let z be (-5)/(-40)1-4. Which is the second biggest value? (a) -1/6 (b) -0.03 (c) z a Let k = 123 + -122.5. Which is the biggest value? (a) 2/23 (b) -4 (c) k (d) 5 d Let o be 13/5 + (-3)/5. Suppose m - 2z = -13, 5m + 0z + 33 = oz. What is the second biggest value in 2, m, 0? 0 Let d(s) = s*2 - 4s - 2. Let v be d(3). Let x = 14.8 - 15. Let t = -24 + 47/2. Which is the third smallest value? (a) t (b) v (c) x c Let g = 8.4 - 8. Let n = 80 - 157/2. What is the smallest value in -0.4, n, g? -0.4 Let m = -8 - -7. Which is the smallest value? (a) m (b) 0.2 (c) 1/4 a Suppose 0 = 3y + 134 + 31. Let j = 163/3 + y. Let n be (6/195)/((-1)/5). Which is the second biggest value? (a) j (b) n (c) 4 b Let v = 5.5 - 5.2. What is the third biggest value in v, -2, -0.2? -2 Let l = 56.5 + -56. Which is the second smallest value? (a) 1 (b) l (c) -4 (d) 2/5 d Let r = 37.6 + -38. What is the second biggest value in 0.3, r, 2? 0.3 Let w = 17/91 + 5/13. Let g(t) be the first derivative of -t2 - 1. Let q be g(2). Which is the second smallest value? (a) 0.5 (b) w (c) q a Let i = 22.958 - -0.042. Let r = i - 32. Which is the third biggest value? (a) 0.5 (b) 4 (c) r c Let g be 10/(-4)((-24)/510)/1. Which is the third smallest value? (a) g (b) -1/4 (c) -2 (d) -3/7 b Let o = -7.92 + 8. Let i = 0.42 + o. What is the third smallest value in 2/5, 2, i? 2 Let o = -0.28 + -0.12. Which is the biggest value? (a) 0.4 (b) o (c) -4 a Let r be (14/(-4))/(-7 + 4). Which is the third smallest value? (a) 0.3 (b) 0 (c) r c Let w be 2/(-5)(-1)/(-2). Let o = -17.2 - -17.4. Which is the second smallest value? (a) w (b) o (c) -0.6 a Let n = -1.9 - -1.5. Suppose 2j = -2a - 12, 0 = 5a + j - 0j + 10. What is the third smallest value in 1/5, n, a? 1/5 Let d(b) = -b + 1. Let m be (-14)/(-49) + (-19)/(-7). Let s be d(m). What is the biggest value in 0.02, s, -0.1? 0.02 Let s = -51/4 + 13. Which is the second biggest value? (a) 2 (b) s (c) -3 b Let b be 3/(-2)8/6. Let x be ((-3)/(-15))/(b + 3). Let y be ((-2)/2)/(14/(-4)). What is the second smallest value in y, 1/3, x? y Let d = -2 - 0. Which is the second biggest value? (a) 1 (b) 0.6 (c) d b Let t = 36 + -32. Let l = -2 + 2.2. Let p = 0.3 + l. What is the second biggest value in 0, p, t? p Let r = 80/3 - 566/21. Let l = -3.2 + 3. Which is the second smallest value? (a) r (b) l (c) 1/3 b Let s = -202 - -185.4. Let p = s - -17. Which is the second smallest value? (a) 1 (b) 2/17 (c) p c Let p = 1.95 + -2. Let d = p + 3.05. Let k be 30/24(-1 + -1). Which is the biggest value? (a) k (b) 0.3 (c) d c Let h = 0 + -5. Let o = -0.279 - 0.021. Let i be -1 + ((-30)/17)/(-2). Which is the third smallest value? (a) h (b) o (c) i c Let t be -1 + 1/(12/15). Let i = -0.8 + 0.3. What is the third biggest value in t, i, 2/5? i Let l = -6 + 11. Suppose -6 = 2p - t, 0p - 3t + 2 = -2p. What is the third smallest value in 2/7, p, l? l Let o = -77 - -73. What is the fourth smallest value in -3, o, 2, 0.4? 2 Let x be (1 - 0)31/(-1). Let b = 4 + x. Let c be (-6)/b3 - 0. What is the second smallest value in c, -1, -3? -1 Let k = -32.8 + 33. Which is the third biggest value? (a) 5 (b) 2/13 (c) k b Let z = -9 + 3. Let m be (z + 1)/(0 + -3). What is the smallest value in -5, m, 4? -5 Let r be 3/6 + (-1)/(-1)1. What is the fourth smallest value in 1/2, 4, r, -5? 4 Let r = 47 - 47. Which is the biggest value? (a) 2 (b) r (c) 4 (d) 5/2 c Suppose -5n + 0 = m + 8, -2m + 4n = 58. Let d = -24 - m. Which is the smallest value? (a) 4/9 (b) d (c) -5 c Let t = 131/3 + -44. Which is the fourth biggest value? (a) -0.1 (b) t (c) 1 (d) -2/5 d Suppose -87m + 9 = -84m. Which is the second biggest value? (a) -5 (b) -4 (c) m b Let w = 23 + -18. Suppose 3d - 10 = w, 2d - 14 = l. What is the second biggest value in 0.5, l, 1/5? 1/5 Let p = -9/44 - 1/22. Which is the third biggest value? (a) 5/2 (b) -5 (c) p b Let r be 6/7(-15)/30. Which is the biggest value? (a) 4 (b) 5 (c) r b Let d = -21 + 19. Let t be -4513(-1 + 24/26). Let f = t - 347. What is the smallest value in -0.5, f, d? d Let d(t) = -t**2 + t + 2. Let f be d(-4). Let u be (	{ "pile_set_name": "DM Mathematics" }
0 AM What is 318 minutes after 7:43 AM? 1:01 PM How many minutes are there between 12:36 AM and 11:23 AM? 647 What is 197 minutes before 8:09 PM? 4:52 PM What is 149 minutes after 5:54 AM? 8:23 AM How many minutes are there between 7:08 AM and 6:10 PM? 662 What is 401 minutes after 7:28 PM? 2:09 AM How many minutes are there between 4:31 PM and 2:13 AM? 582 How many minutes are there between 12:20 AM and 10:43 AM? 623 What is 54 minutes after 11:39 AM? 12:33 PM What is 401 minutes after 8:53 PM? 3:34 AM How many minutes are there between 12:52 AM and 12:22 PM? 690 What is 76 minutes after 8:32 PM? 9:48 PM What is 669 minutes after 12:48 PM? 11:57 PM What is 644 minutes before 12:30 PM? 1:46 AM How many minutes are there between 11:08 PM and 6:31 AM? 443 What is 587 minutes before 11:58 AM? 2:11 AM How many minutes are there between 8:26 AM and 9:01 AM? 35 How many minutes are there between 6:11 AM and 8:46 AM? 155 How many minutes are there between 4:15 PM and 9:59 PM? 344 What is 11 minutes before 11:48 AM? 11:37 AM What is 681 minutes before 11:27 PM? 12:06 PM How many minutes are there between 1:43 AM and 6:34 AM? 291 What is 315 minutes after 1:14 PM? 6:29 PM What is 300 minutes before 11:31 PM? 6:31 PM What is 421 minutes before 8:04 AM? 1:03 AM What is 706 minutes before 3:02 AM? 3:16 PM How many minutes are there between 1:36 PM and 10:04 PM? 508 What is 317 minutes after 9:09 AM? 2:26 PM How many minutes are there between 3:43 AM and 8:20 AM? 277 What is 623 minutes after 2:20 PM? 12:43 AM What is 585 minutes before 10:11 PM? 12:26 PM How many minutes are there between 3:45 PM and 2:31 AM? 646 How many minutes are there between 9:14 AM and 7:03 PM? 589 How many minutes are there between 12:08 AM and 1:38 AM? 90 How many minutes are there between 10:53 AM and 6:47 PM? 474 How many minutes are there between 7:27 PM and 5:58 AM? 631 How many minutes are there between 1:07 PM and 11:06 PM? 599 How many minutes are there between 8:05 AM and 3:51 PM? 466 How many minutes are there between 11:09 AM and 12:20 PM? 71 What is 661 minutes after 1:19 AM? 12:20 PM What is 92 minutes after 9:10 PM? 10:42 PM What is 661 minutes before 7:03 PM? 8:02 AM What is 254 minutes after 12:06 PM? 4:20 PM How many minutes are there between 5:01 AM and 4:05 PM? 664 What is 10 minutes after 2:07 AM? 2:17 AM How many minutes are there between 5:29 PM and 3:56 AM? 627 How many minutes are there between 3:14 PM and 12:42 AM? 568 What is 459 minutes before 5:45 PM? 10:06 AM How many minutes are there between 1:45 AM and 1:30 PM? 705 How many minutes are there between 9:25 PM and 1:20 AM? 235 How many minutes are there between 3:38 AM and 2:25 PM? 647 How many minutes are there between 12:37 AM and 5:01 AM? 264 How many minutes are there between 2:24 AM and 7:01 AM? 277 What is 305 minutes after 3:17 PM? 8:22 PM What is 185 minutes after 8:31 PM? 11:36 PM How many minutes are there between 5:37 PM and 8:28 PM? 171 How many minutes are there between 2:10 AM and 2:21 AM? 11 How many minutes are there between 6:02 PM and 3:18 AM? 556 How many minutes are there between 4:55 PM and 10:10 PM? 315 What is 404 minutes before 11:38 AM? 4:54 AM How many minutes are there between 1:10 PM and 6:13 PM? 303 What is 524 minutes before 12:14 PM? 3:30 AM How many minutes are there between 8:54 PM and 12:00 AM? 186 How many minutes are there between 12:16 AM and 11:17 AM? 661 How many minutes are there between 8:51 AM and 10:28 AM? 97 What is 303 minutes after 6:06 AM? 11:09 AM What is 524 minutes before 4:35 PM? 7:51 AM How many minutes are there between 6:55 PM and 2:43 AM? 468 What is 697 minutes after 8:23 PM? 8:00 AM How many minutes are there between 11:27 PM and 8:04 AM? 517 How many minutes are there between 12:56 PM and 12:14 AM? 678 How many minutes are there between 2:36 AM and 2:48 AM? 12 What is 167 minutes after 7:37 AM? 10:24 AM How many minutes are there between 1:57 AM and 10:05 AM? 488 What is 244 minutes before 5:14 AM? 1:10 AM How many minutes are there between 4:34 PM and 11:33 PM? 419 How many minutes are there between 1:31 PM and 11:49 PM? 618 How many minutes are there between 8:51 AM and 2:19 PM? 328 How many minutes are there between 8:17 PM and 3:25 AM? 428 What is 289 minutes before 1:35 AM? 8:46 PM How many minutes are there between 5:10 AM and 3:15 PM? 605 What is 56 minutes after 11:53 PM? 12:49 AM How many minutes are there between 6:06 PM and 11:47 PM? 341 How many minutes are there between 5:07 PM and 12:40 AM? 453 What is 457 minutes before 1:52 PM? 6:15 AM What is 639 minutes after 7:36 AM? 6:15 PM What is 502 minutes before 1:59 AM? 5:37 PM How many minutes are there between 5:27 AM and 11:20 AM? 353 How many minutes are there between 8:10 PM and 1:32 AM? 322 How many minutes are there between 2:00 PM and 12:23 AM? 623 What is 166 minutes before 5:51 PM? 3:05 PM What is 597 minutes before 4:47 PM? 6:50 AM How many minutes are there between 2:28 AM and 1:44 PM? 676 What is 302 minutes after 8:48 AM? 1:50 PM What is 406 minutes before 8:44 AM? 1:58 AM How many minutes are there between 11:37 AM and 9:44 PM? 607 How many minutes are there between 9:55 AM and 3:36 PM? 341 What is 623 minutes before 5:29 AM? 7:06 PM How many minutes are there between 6:25 AM and 5:56 PM? 691 What is 97 minutes after 10:10 PM? 11:47 PM What is 366 minutes after 9:28 PM? 3:34 AM What is 153 minutes before 1:23 AM? 10:50 PM How many minutes are there between 10:03 PM and 6:27 AM? 504 What is 197 minutes before 12:04 PM? 8:47 AM How many minutes are there between 1:22 PM and 6:50 PM? 328 What is 264 minutes before 5:38 PM? 1:14 PM What is 69 minutes after 10:22 PM? 11:31 PM How many minutes are there between 5:25 PM and 6:14 PM? 49 What is 69 minutes before 2:57 AM? 1:48 AM What is 578 minutes before 3:06 AM? 5:28 PM What is 623 minutes before 11:08 PM? 12:45 PM What is 482 minutes after 5:02 PM? 1:04 AM What is 443 minutes after 12:43 AM? 8:06 AM How many minutes are there between 11:37 PM and 2:30 AM? 173 What is 265 minutes after 8:10 PM? 12:35 AM What is 507 minutes before 3:01 AM? 6:34 PM How many minutes are there between 10:29 AM and 9:36 PM? 667 What is 386 minutes after 6:56 PM? 1:22 AM How many minutes are there between 5:42 PM and 6:22 PM? 40 How many minutes are there between 4:21 PM and 11:19 PM? 418 How many minutes are there between 6:21 PM and 1:17 AM? 416 How many minutes are there between 2:10 AM and 6:25 AM? 255 How many minutes are there between 11:07 PM and 10:26 AM? 679 What is 628 minutes before 5:32 AM? 7:04 PM What is 328 minutes before 10:30 PM? 5:02 PM What is 185 minutes before 6:59 AM? 3:54 AM How many minutes are there between 2:24 PM and 2:49 PM? 25 How many minutes are there between 11:51 PM and 10:00 AM? 609 What is 559 minutes after 4:03 PM? 1:22 AM How many minutes are there between 7:58 PM and 9:20 PM? 82 How many minutes are there between 6:27 PM and 3:51 AM? 564 How many minutes are there between 4:30 PM and 1:37 AM? 547 What is 237 minutes before 9:48 PM? 5:51 PM How many minutes are there between 3:04 AM and 10:23 AM? 439 How many minutes are there between 11:20 AM and 12:50 PM? 90 How many minutes are there between 2:28 PM and 6:05 PM? 217 How many minutes are there between 8:36 AM and 5:49 PM? 553 How many minutes are there between 12:33 PM and 3:24 PM? 171 How many minutes are there between 1:38 PM and 4:13 PM? 155 What is 576 minutes after 10:08 PM? 7:44 AM What is 502 minutes before 11:36 AM? 3:14 AM What is 385 minutes before 7:33 PM? 1:08 PM What is 539 minutes before 1:59 PM? 5:00 AM How many minutes are there between 12:59 AM and 12:28 PM? 689 What is 620 minutes before 4:39 AM? 6:19 PM How many minutes are there between 8:32 PM and 2:09 AM? 337 What is 560 minutes after 5:46 PM? 3:06 AM What is 136 minutes after 3:08 AM? 5:24 AM How many minutes are there between 7:19 PM and 6:34 AM? 675 How many minutes are there between 1:28 AM and 5:54 AM? 266 What is 703 minutes before 2:33 PM? 2:50 AM What is 458 minutes before 7:58 AM? 12:20 AM How many minutes are there between 11:36 PM and 6:16 AM? 400 How many minutes are there between 3:50 PM and 3:45 AM? 715 What is 289 minutes before 8:33 AM? 3:44 AM What is 211 minutes after	{ "pile_set_name": "DM Mathematics" }
Rearrange (-5 + 2 + 1 + (1 - 4 + 4)(-2 + 4 - 4))(18 - 15i - 18) to the form ni + c and give n. 60 Rearrange (-20a - 97 + 97)(4a + 2 - 2 - 2a*3) to ua*4 + pa*3 + s + ja*2 + ba and give u. 40 Express (-22 - 4m - m + 0m)(-1 - m + 1) + (3m + 3m - 5m)(-3 + 2m + 3) in the form h + ym2 + qm and give y. 7 Express (-2 - 2v + 2)(3v2 - v2 - 4v*2) + (-3v + 4v - 7v)(4v2 + v2 - 3v2) as nv + kv2 + o + sv*3 and give s. -8 Express (13 + 24 - 28)(-i + 0i + 0i + (i - 2i - i)(5 - 4 - 3)) as pi + y and give p. 27 Rearrange 2 - 2 - 2r + 14r to p + wr and give w. 12 Rearrange -23w + 19w + 40w + 48w to aw + y and give a. 84 Rearrange -13v*2 + 75 - 75 + (-2 + 2 - 2v)(v + 0v + v) - 3v2 + 3v*2 - 2v*2 + (0v*2 + 3v2 - v2)(-1 - 3 + 3) to t + hv + kv2 and give k. -21 Express 0p + 0p + 2p*4 + (-1 + 0 + 0)(-3p4 + 133p - 133p) in the form op*2 + tp*3 + jp + q + gp4 and give g. 5 Express 0 - 2 - 3k + 14k + 13k in the form m + xk and give m. -2 Rearrange 2v*3 + 2v*2 + 2 + 0 - 3v - 8v - v4 + 9v to the form dv3 + h + yv*2 + rv*4 + iv and give d. 2 Express (-7 - 1 + 5 - v)(0v + 0v + 2v) + 3v2 + 3v*2 - 5v*2 in the form xv*2 + lv + t and give x. -1 Rearrange 13 - 18 + 5 - 16m to f + rm and give f. 0 Express w*3 - 8w - 1 - 2 + w*2 + 7w + (2w - w + w)(w2 + w2 + 0w2) in the form aw + x + kw3 + bw*2 and give a. -1 Rearrange -5r - 398 + 398 + 3r to kr + t and give t. 0 Express (-25c - 6 + 6)(4c + c - 3c) + 2c + c2 - 2c - 2c2 + 0c + 0c in the form bc + m + vc2 and give b. 0 Rearrange -2a - 67 - 2a2 + 110 - 73 to the form y + fa + ta2 and give f. -2 Rearrange (-4 - 1 - 1)(-6f + 0f + 13f) to y + rf and give r. -42 Rearrange w - 7w - 6w to v + mw and give m. -12 Express 13u*3 - 675u*2 + 676u*2 + 12u*3 as iu*3 + s + ku + bu2 and give i. 25 Express 1 - 3h*2 + 8h*2 + 189h - 195h + 1 in the form xh*2 + wh + l and give x. 5 Express (-2 + 1 + 3)(-4 + 2 + 5)(0d + d + d)(-3d2 + 0d2 + d2) in the form nd3 + rd + m + gd2 and give n. -24 Rearrange 5 - 7 - 4 + 7 + 5k to the form q + ak and give a. 5 Express (0q + 5q - q)(-q + 4q - q)(0 + 5 - 3) - 13 + 13 + 6q2 + q2 + 1 - 1 + (4 - 4 + 2q)(3q + 4q - 5q) as wq + j + zq*2 and give z. 27 Rearrange 114w*2 - 113w*2 + 6w - 2 - 2w3 + 0w*3 + 4w*3 to kw*3 + y + iw + bw2 and give y. -2 Express (-45j*2 + 45j*2 - 2j + 5j3 - 5)(j - j + j) as wj2 + mj*4 + yj*3 + kj + o and give o. 0 Express (5 - 4 - 4)(-71 - 15t*3 + 71) as vt*2 + d + jt*3 + kt and give j. 45 Express 3l3 + 5l*3 - 6l3 + l2 in the form t + nl3 + wl*2 + kl and give n. 2 Express (4 + o - 4)(-3 - 1 + 2) + o + 0o + 0o + 4o - 3 + 2 + 0o in the form i + no and give i. -1 Rearrange (6m + 31m + 14m)(2m - 3m - 3 + 1) to a + hm2 + zm and give h. -51 Express -11 + 6 - 4a + 6a as h + na and give h. -5 Express (14 - 8 - 2i - 16)(-2 - 2i + 2) as bi2 + ki + j and give k. 20 Express -c*2 + 14c - 5c + 5c*2 + 10 - 13 in the form mc + oc2 + y and give y. -3 Express 41j + 18j - 9j as gj + n and give g. 50 Rearrange -c4 - c - 8c*2 - 4 + 3c + 3c2 + 6c2 + c3 to the form tc2 + b + wc*3 + kc + qc4 and give w. 1 Rearrange -11a*2 - 15a*2 - 5a*2 to the form ba*2 + la + m and give b. -31 Rearrange (-3j3 - j3 + 3j*3)(j + 2j + 0j) + 2j4 + 3j*4 + 0j*4 to wj*3 + hj + tj2 + c + oj*4 and give o. 2 Express (0y - 30y - 60y)(0y + 3y + 0y) in the form wy2 + ly + p and give w. -270 Rearrange 3c2 - 2c2 + c2 + (8c - 11c*2 - 8c)(2 + 3 - 3) to dc + q + bc2 and give b. -20 Express (41m*3 - 42m*3 - 200m*3)(-1 + 3 - 1) as qm3 + s + om + zm2 and give q. -201 Express -31t*2 - 6t*2 - 14t*2 as dt*2 + x + mt and give d. -51 Rearrange (2p + 0p - 4p)(p + p + 0p)(-7 + p*2 - 2p*2 + 0p*2) to the form z + kp*3 + np*2 + up + yp4 and give y. 4 Express -44p - 3932 + 3932 in the form mp + r and give m. -44 Rearrange (-35 + 10 - 19)(3 + 0 - 2)(2y + 1 - 1) to jy + p and give j. -88 Express -13k*3 + 3 + 2k*3 - 4k*3 + 2k*3 in the form nk*2 + vk*3 + mk + f and give f. 3 Rearrange (-4m2 + 3m2 - m2)(2 + 1 - 2)(3m - 5m + m)(6 + 6m - 6) to om + hm*4 + ym*3 + km*2 + w and give h. 12 Rearrange 3 - 8b - 14 + 9b - 3 to the form n + zb and give z. 1 Rearrange (2 - 4 + 0)(-3 + 2 - 1)(19s - 3 - 6 + 11) to the form v + is and give v. 8 Express -11d - 3 - 7d*2 + 14d - 3d in the form g + jd + td2 and give t. -7 Express -53n + 1 - 1 + 56n as w + in and give i. 3 Express (a - 12a - 4a)(7 - 2 - 2)(-4 - 1 + 4) as o + la and give l. 45 Rearrange 0 - 33r + 3 + 23r to br + w and give w. 3 Rearrange (-16 + 16 + d)(-3 + 3 + 3d*2) to yd + ud2 + s + ad*3 and give a. 3 Rearrange (28 - 60d + 26 - 54)(d + d - 3d) to h + xd + gd*2 and give g. 60 Express 6f3 + f2 - 8f3 - 6f*4 + 4f + 4f3 + 3f*4 in the form pf*4 + yf + u + xf3 + df*2 and give y. 4 Express -44f + 40f + f2 - f2 - 2f*3 as uf + tf2 + xf3 + b and give u. -4 Rearrange (a4 - 4a2 + 4a*2)(-5 - 3 + 3) - 3a2 + 7 - 7 + 2a*4 to the form ya*3 + ua + fa4 + c + xa*2 and give f. -3 Rearrange (-3c + c + 0c)(3 - 5 + 3) + (0 - 1 - 1)(2c - 2c + c) + c - 5c + 2c + 0c + 0c - 7c to hc + n and give h. -13 Rearrange -w4 + 3w*4 + 9 - 6 - w + 3w*2 to the form p + cw*2 + aw*3 + jw + xw4 and give x. 2 Express (4 + 1 - 3)(4 - 2 + 0)(3 - 3 + 2z)(-7 - 18 - 1) in the form rz + v and give r. -208 Express -10d3 - 1 - 2d - d - 15d3 + 22d*3 as ud*3 + f + qd*2 + td and give f. -1 Rearrange (-2f2 + 0f*2 - 14f*3 + 3f*3)(1 + f - 3 + 5f) to the form bf + zf4 + cf*3 + g + kf2 and give k. 4 Rearrange (-r3 - 2r3 + 0r*3)(-3r + 5r - 4r + 3) to the form s + cr + jr3 + ur*4 + pr*2 and give u. 6 Rearrange (2b2 + b2 - b*2)(-2b + 7 - 12 - 7) to pb*3 + xb*2 + u + yb and give x. -24 Express (-3i + 0i - 2i)(-1 - 6 - 3) in the form t + zi and give z. 50 Express x + 2x + 14x - 3x as k + px and give p. 14 Express 83 + 72b - b*2 - 35b - 36b as r + ob*2 + db and give r. 83 Rearrange (-7 + 0 - 4)(8g*2 - 5g*2 + 3g*2) to pg*2 + cg + f and give p. -66 Rearrange (18r + 227 - 227)(r2 - r2 - r*2 + r) to d + sr*2 + tr + fr3 and give f. -18 Rearrange -1 - 1 - 7a3 + 0 + a2 + 9a3 to xa*3 + la*2 + za + g and give x. 2 Rearrange (-1 - 3 + 3)(7 + 8i - 7) to the form h + li and give l. -8 Rearrange (p - 9 + 6 - 3p)(-5 - 2 + 2) to the form fp + a and give a. 15 Express (2 - 4k3 - 2)(13k + 2k - 2k) as dk*4 + sk + wk2 + r + tk*3 and give d. -52 Rearrange (-6 - 3 + 1)(5k - 5k - 2k)(-k - 4k + 2k) to nk2 + mk + v and give m. 0 Rearrange -27 + 31v + 2v*3 + 27 - 11v to the form ov + mv*3 + d + lv*2 and give o. 20 Rearrange (31 - 8 - 17)((1 + g - 1)(1 + 1 - 4) + 1 - 1 - 2g) to kg + x and give k. -24 Rearrange -8k + 2 + 8k2 - 3k2 - k4 - 6k2 to yk + dk3 + c + nk*2 + mk*4 and give m. -1 Express 81i*2 + 2 - 9i + 6i + 3i in the form zi2 + ki + o and give z. 81 Rearrange (-12 + 29 + 27i2 + i - 16)(-i + 4i - 2i) to si3 + mi*2 + wi + h and give w. 1 Express 8u2 - 43u*3 + 23u*3 + 24u*3 - 3u2 - 3 - u4 as p + lu3 + vu*4 + yu*2 + su and give l. 4 Rearrange -12l3 - l2 + 4l*2 - 4l*2 + l + 9l*3 to the form hl*2 + dl + q + kl3 and give h. -1 Rearrange 4 - 379y - 4 + 376y - 8y*2 to the form q + hy + oy2 and give o. -8 Express (37k - 55k - 77k)(2k - 2k + k2) in the form f + uk + lk2 + hk*3 and give h. -95 Express -5h*4 + 204 - 2h3 + h2 - 204 - 11h4 - h in the form d + gh*2 + vh*3 + wh*4 + ch and give w. -16 Express -80q + 543 - 543 as o + uq and give u. -80 Rearrange 18c3 - 27c*3 - 6c + c*2 + 12c*3 to i + zc*3 + rc*2 + qc and give q. -6 Express -2l - 4 - 6 + 11 - l3 + l as w + jl*3 + sl	{ "pile_set_name": "DM Mathematics" }
of z? 1 Let z be ((-245)/(-10) - -1)128/6. Suppose -116c + 117c - z = 0. What is the tens digit of c? 4 Suppose -16l = 4t - 17l - 1875, 0 = -3t - 4l + 1411. What is the tens digit of t? 6 Suppose 6j - 31j = -44525. What is the thousands digit of j? 1 Suppose l + 5l - 30 = 0. Suppose -32 - 48 = -lu. Suppose -3f = -5n - 112, -n + 108 = 2f + u. What is the tens digit of f? 4 Suppose 47l + 402 = 120. Let g be (-4 + 5)/(0 - -1). What is the units digit of (l/(-12))/(g/192)? 6 Let q = 1561 - -6819. What is the thousands digit of q? 8 Let i be -2 + (0 - -5) - 18. Let j be (-12 - i) + (-6)/(-2). Suppose jy = 2b + 3y - 6, y + 12 = 4b. What is the units digit of b? 3 What is the thousands digit of (1/3)/((-42)/(-367794))? 2 Suppose -3n + g = -189, -2n - 3g + 120 = 5. What is the thousands digit of 1149/14-4(-217)/n? 1 Suppose -5w - 8w = -13. What is the tens digit of 46((-11)/22)/(-1w)? 2 Let r(m) = 6483m + 14. Let c be r(1). Suppose 5i - c = -2h, -i - 3h = -1538 + 236. What is the hundreds digit of i? 2 Let a be ((-114)/(-9))/((-2)/6). Let k = -392 - -479. Let f = k + a. What is the tens digit of f? 4 Suppose 4s = 5v + 26990, -v + 6084 + 7404 = 2s. What is the tens digit of s? 4 Suppose 0 = 5x - 2h - 40, 5x - 2h = 3h + 55. Let o be 8/(-6)x/4. Let v(k) = -15k - 8. What is the units digit of v(o)? 2 Let q(a) = 250a + 40. Let w be q(-8). Let c = 2986 + w. What is the hundreds digit of c? 0 Let l = -22 + 3. Let i(q) be the third derivative of -q*5/60 - 17q*4/24 + 13q*3/2 + 2q*2 - 8q. What is the units digit of i(l)? 1 Suppose 0 = 62n - 2n - 183082 - 158018. What is the thousands digit of n? 5 Let j be (-10 + 8)/(3/(-6)). Let m be 624/1030/j. Suppose 5f - m + 8 = 0. What is the units digit of f? 2 Let l = 1753 - 516. Suppose -8p - 5a - 429 = -9p, 3p - l = 5a. What is the hundreds digit of p? 4 Suppose 5v = 5, -2v - 43 = -o + 3v. Suppose -13 + o = 7a. Suppose ap = h + 123, -2h - 97 - 5 = -4p. What is the tens digit of p? 2 Let o = -36 + 38. Let p(a) = 1 - 6a - 3a + 7 - oa. What is the units digit of p(-5)? 3 Let q = 334 - 311. Suppose -33l + 11890 = -ql. What is the units digit of l? 9 Let r(f) be the third derivative of -1/24f*4 + 0f + 4f3 - 13f*2 + 0 + 1/30f*5. What is the units digit of r(0)? 4 Let k = 1969 + -1828. Suppose -199 = 3t + 2d - 44, 4t - 4d = -220. Let h = t + k. What is the units digit of h? 8 Let y = 50 - 39. Suppose -j + 96 = yj. Suppose -jq = -5q - 69. What is the units digit of q? 3 Let m = 167 - 173. What is the units digit of -1271m/((-24)/(-4))? 7 Let y = 22 - 15. Let z(d) = 8d + 4d + 1 + 7d + yd. What is the tens digit of z(2)? 5 Let a = -3239 - -11803. What is the hundreds digit of a? 5 Suppose 5l - 4u - 145099 = 0, l - 6l = 5u - 145090. What is the thousands digit of l? 9 Let t(z) = -68z + 1689. What is the thousands digit of t(-7)? 2 Let c(a) = -a3 - 9a*2 - 4a - 17. Let y be c(-9). Let r = y - 4. Suppose -t - 2t = -3f - 33, -3t + r = 3f. What is the units digit of t? 8 Let s(k) = 4k - 8. Let y be (5/(-70)-7)/(2/8). Let g be s(y). Suppose gz - 5z = -645. What is the hundreds digit of z? 1 Let n = 54540 + -29750. What is the units digit of n? 0 Suppose 0 = -93g + 41g + 379532 + 349144. What is the ten thousands digit of g? 1 What is the ten thousands digit of -2 - (-11)/2225546? 1 Let h(x) = 50x*2 - 26x + 5. What is the tens digit of h(2)? 5 Suppose 44i - 41i = 4h + 15818, -5i + 3h + 26356 = 0. What is the thousands digit of i? 5 Suppose 2p - d - 94 = 0, -62 - 175 = -5p + 2d. Let s = p - 49. Suppose s = 2j - 3b - 213 - 14, 2j = -4b + 220. What is the hundreds digit of j? 1 Let h be -5 + 0 - 25/(-5). Suppose -g + 8 = -m, -1 = -2g - m - hm. What is the tens digit of (-2)/g - (-2464)/96? 2 Let l(b) be the second derivative of -6b + 6b*2 - 1/2b*3 + 0. What is the tens digit of l(-6)? 3 What is the units digit of (-99)/6617(-1886)/3? 1 Suppose 2i = -46 + 354. Let y = i + -742. Let t = y + 837. What is the units digit of t? 9 Let l(b) = 32b2 - 10b + 4. Let t(p) = p*2 - 14p + 9. Let r be t(13). Let s be l(r). Suppose -3o - s = -7o. What is the units digit of o? 9 What is the units digit of 12767 + -443/12? 6 Let r = 40875 - 4017. What is the thousands digit of r? 6 Suppose -3m + 22521 = -3j, -2j + 16828 = 2m + 1830. What is the units digit of m? 3 Let p = 4255 - 1167. What is the thousands digit of p? 3 Let l(v) = 4v*2 + 6v + 1557. What is the units digit of l(-40)? 7 Let j = 26 - -6. Let w = j - 20. What is the units digit of w/84 - (-334)/14? 4 Suppose 0 = r + 3c - 361, 3r - 2c - 1078 = -6c. Let g = r + 470. What is the hundreds digit of g? 8 Suppose -5x = -3o - 3138, -1248 = 3x - 5x + 3o. What is the units digit of ((-16)/(-5))/((-6)/(x-2))? 2 Suppose 53315 = 10g - 119895. What is the hundreds digit of g? 3 Suppose 421p = 6738435 + 11935020. What is the thousands digit of p? 4 Let l be (42/(-9))/(12/90-5). What is the units digit of (1858/l)/(-10(-9)/315)? 9 Suppose 2 - 2 = 3p. Let h be -3 - (p + -15 + 0). Let x(w) = 9w - 18. What is the units digit of x(h)? 0 Let k(s) = -2s + 79. Suppose 0 = -2v + 25 - 19. Suppose -j + vj = 5f + 15, -2f - 6 = 5j. What is the units digit of k(j)? 9 Let g(a) = -78 - 15 - a*2 - 23a - 9a + 7a. What is the units digit of g(-8)? 3 Let u be (-11 - -7) + -368 + 2. Let s be 15/(-35) + u/(-14). What is the tens digit of s - (-4 + (-10)/(-5))? 2 Let f = -2397 + 1633. Let l = 1570 + f. What is the hundreds digit of l? 8 Let o = -37 - -38. Suppose -5 - o = -2i. Suppose -4p = -u - 2p + 65, -ip = -u + 67. What is the tens digit of u? 6 Suppose -1114d + 29342976 = -698d. What is the tens digit of d? 3 Suppose -27h + 44253 + 255069 = 0. What is the tens digit of h? 8 Suppose -2p = -3p - 2r + 626, -3r + 2519 = 4p. Let z = p + -26. What is the tens digit of z? 0 Let d(n) = 7 - 59 - 29 + 779n - 717n. What is the tens digit of d(12)? 6 Suppose -96i + 942088 = -40i. What is the thousands digit of i? 6 Suppose 0 = -t + 1, -5t + 0t + 20 = 3y. Suppose h = 5p - 1215, 0 = -yp - 2h - 74 + 1274. What is the hundreds digit of p? 2 Suppose -4t - 48 = -2q - 12, 2q = -2t + 18. Let a(g) = 2g3 - 15g*2 - 23g + 13. What is the units digit of a(q)? 3 Suppose -5w - j - j + 22665 = 0, -18135 = -4w - j. Suppose -4v = 3k - w, -v + 2275 = v - k. What is the thousands digit of v? 1 Suppose -5s - 4h = -2h - 11946, -4s = -3h - 9543. Suppose 4w - s = -4q, 0 = q + q + w - 1194. What is the hundreds digit of q? 5 Let x = 45 + -58. Let k(j) = -4j*2 - 20j + 2j2 - 23 + j2. What is the units digit of k(x)? 8 Let j = -17403 - -35535. What is the tens digit of j? 3 Let d be (-33)/(-6) - 3/2. Suppose g = 2p + 12, -3p - 52 = -dg + 11. Let b = g + 3. What is the units digit of b? 1 What is the hundreds digit of 14/7 + (-4)/(-10) + 379017/45? 4 What is the thousands digit of 2(-78)/12 - -20935? 0 Let f = -9941 - -19770. What is the units digit of f? 9 Let d = 9014 + -8745. Suppose 5u - 33 = -5a + 492, 0 = -a + 4u + 120. Let s = d - a. What is the tens digit of s? 6 Let h(f) = 37f + 10f - 2f. Let k(l) = 2l - 4. Let a be k(3). What is the units digit of h(a)? 0 What is the units digit of (13 - 10 - 720)-11? 7 Suppose -y - 5p + 11022 = 0, -15369 = -y + 5p - 4337. What is the tens digit of y? 2 Suppose 5p = 25, 4p + 2 = q + 5p. What is the hundreds digit of (1 + q)/(((-24)/(-1359))/(-4))? 4 Let m be ((-2)/5)/((-3887)/(-780) + -5). Suppose -2445 + 13653 = mw. What is the hundreds digit of w? 4 What is the ten thousands digit of 1567107/(-54)(-8)/12? 1 Let f(l) = 1741l + 1840. What is the ten thousands digit of f(10)? 1 Let l be (-150)/(-120) + (-14)/(-8). Suppose 4f + 14a - 10a - 2920 = 0, a = l. What is the tens digit of f? 2 Suppose -5c - 2w = -116207, -c + 25423 = w + 2181. Suppose c = 28k - 26403. What is the hundreds digit of k? 7 Let d(o) = -69o + 870. What is the tens digit of d(2)? 3 Let p = 105398 + -67625. What is the tens digit of p? 7 Let l(a) = -a*3 - 25a*2 - 9a - 35. Let k be l(-26). Suppose -3*c + k = -241. What is the tens digit of c? 7 Let t = 9478 + -6613. What is the hundreds digi	{ "pile_set_name": "DM Mathematics" }
-0.4 a Let k be (-7)/(-21)(-2 + -1). Which is the nearest to -1? (a) k (b) 11 (c) 0.2 (d) -0.5 a Let x = 64 - 187. Let l = -125 - x. What is the nearest to 2.3 in 5, l, -0.1? -0.1 Let p = -51 - -30. Let o = p - -20.7. Which is the nearest to 2/3? (a) 3 (b) 2 (c) o c Let h = 3301 + -3272.37. Let n = -0.37 - h. Let v = -29 - n. Which is the nearest to v? (a) -19 (b) 2/17 (c) -5 b Let q(a) = 148a - 1031. Let c be q(7). What is the closest to 0.1 in -6, c, -12/5, -7/4? -7/4 Let y(i) = i*2 - 18i + 3. Let u be y(18). Which is the nearest to -9/17? (a) 0.2 (b) 2/15 (c) u (d) 4 b Let t = 130.2 - 11.2. Let o = t + -220. Let h = o + 101. Which is the nearest to 0.2? (a) -2 (b) 2/7 (c) h b Let m = 4 + -3.8. Let t be 0/(5 - (7 - 3)). Suppose t = -3s - 3d + 15, 2s - 5s - 2d = -10. Which is the nearest to 0.5? (a) 4 (b) s (c) m c Let y = 5.2 - 30.4. Let q = -838 + 863. Let c = y + q. What is the closest to c in -0.5, 0.5, 3? -0.5 Let m be 0/((-4)/2 - -1). Let d(h) = 4 + 2h - 8h + 5h + h + h. Let v be d(m). Which is the nearest to 1? (a) v (b) 0 (c) -1 b Let f = -0.53 - -1.53. Let s = 0.1346 + -0.4746. Which is the nearest to f? (a) s (b) 0.5 (c) -3 b Let u = -16.5 + 44.3. Let v = -24.8 + u. What is the nearest to -2/19 in 4, -0.2, v? -0.2 Let l = -0.09 - -0.03. Let v = 0.94 - l. Let q = 49.52 + -50.02. What is the closest to v in -5, q, -2/19? -2/19 Let y = 10 - 5. Let i be 20/(-200)1460/(-657). Which is the nearest to 2/5? (a) 4 (b) y (c) i (d) -1 c Let g = 0.33 + -3.33. What is the nearest to 2/3 in 0.0234, g, -1/4? 0.0234 Let x = -61708 - -61712. Let q = -6.4 + 8. What is the nearest to q in x, -5, 0.3? 0.3 Let u = -8.584 - -8.624. Suppose 0 = -d + 2v + 3v - 8, 0 = 4d - 3v - 2. What is the nearest to d in u, -2, 4? u Let l = 1744.5 + -1744. Let r = 3 + -3. Which is the closest to r? (a) 4/3 (b) l (c) 7 b Let q = 47.1 - 47. Let y be -2(6/5 + -1) + 0. What is the nearest to y in q, 8, -2/13? -2/13 Let f = 0.1 - 0.21. Let v = 102.9 + -103. Let s = 10 - 11. What is the closest to f in s, v, -4? v Let k(u) = -u*3 - 4u*2 + 2u + 13. Let c be k(-3). What is the nearest to 0 in -5, 1/94, c, -1? 1/94 Suppose 2l + 24 = 3s - 2l, s - 5l = 19. Let g be -3s/(-8)-2. Let k = -0.05 + 0.35. Which is the closest to 2? (a) -0.4 (b) k (c) g b Let o = 26866 - 26865.5. Which is the closest to 72? (a) -0.5 (b) -1/20 (c) 0.3 (d) o d Let g = -1 + 1. Let h = -923 - -421. Let k = -500 - h. Which is the closest to -0.08? (a) g (b) 1/2 (c) k a Let k(q) = -45q2 + q + 1. Let f be k(1). Let u = 42 + f. Let l = 307/3 + -103. What is the closest to u in -2/9, 1, l? l Let i be ((-2232)/992)/(9/48). Which is the nearest to 0? (a) -3/8 (b) -3 (c) i (d) 2/13 d Suppose -11s - 5 = -390. Suppose -5x = -s + 20. Which is the closest to x? (a) -1/11 (b) 1/4 (c) 0.4 c Let v = 0.64 - 0.34. Let l = -710 + 710.1. Let a = -0.02 - -0.42. What is the closest to l in v, -0.4, a? v Let m be (4 + -3)/((-1)/(-3)). Let j = -4285.5 + 4286. Which is the closest to m? (a) -4 (b) -3 (c) 4/7 (d) j c Let o = -243 + 240. Let j be o/(-5 - (1 + -9)). Let f = -7 - 7. Which is the closest to j? (a) -2/9 (b) -0.4 (c) f b Let w be 4 + ((-66)/(-9))/(-2). Let z = -126 - -125.37. Let j = z + 0.73. Which is the nearest to 2? (a) -1 (b) w (c) j b Let f = -23 + 24. Let w = 0.17 - 35.17. Let m = -33 - w. Which is the nearest to f? (a) -0.1 (b) 0.6 (c) m b Let v = -596.9 + 600.9. Let z = -0.003 - 3.897. What is the closest to 3 in v, z, -3? v Let v = -44 - 23. Let o = v + 332/5. Let c = 13/34 - -2/17. What is the nearest to 7 in -2/15, c, o? c Let f = 4019 + -4018.7. Which is the closest to -1? (a) 2 (b) f (c) -9 b Let t = -1161/5 - -231. Let i = 124 + -121. What is the nearest to i in t, 0, 4? 4 Let t be ((-96)/40 + 2)/(12/(-10)). Let w be 3 + (-21)/(-9) + -5. Which is the nearest to t? (a) w (b) 2/9 (c) 5 a Let l = -1.3 + 0.3. Let n = 1.4 + l. Let h be 4/(-26) - 210/(-520). Which is the closest to -3? (a) 5/6 (b) n (c) h c Let d = 13.99297 + 0.00703. Which is the nearest to 1? (a) -2/3 (b) 1/7 (c) d b Let q = 66 - 66.06. Let v = 459 - 461. Which is the nearest to v? (a) -0.1 (b) -2 (c) q b Let m = 125914 - 125319.01. Let g = m - 595. Which is the nearest to -1/4? (a) 0 (b) 0.1 (c) 5 (d) g d Let t = 0.4 + 0.1. Let d = 73 + -78.4. Let k = 5.7 + d. What is the closest to -6/7 in k, t, 1/3? k Let d = 3.8037 - 0.8037. Let h be (3/6)/((-33)/(-36)). What is the closest to h in -0.5, 0.5, d? 0.5 Let g = -4149 - -20748/5. What is the nearest to 0.34 in -5, 0.5, g, 1.4? 0.5 Let o = 3 + -2.9. Suppose -5m - 7 = -167. Let s be (-150)/48 - (-4)/m. What is the closest to -0.1 in s, 5, o? o Suppose -40v + 18v + 374 = 0. Let c = v + -15. What is the nearest to -0.1 in 19, -1, c? -1 Let f = 7605/2 + -3804. What is the nearest to -2/7 in -1, -26/9, f? -1 Let r(i) be the second derivative of -i*4/6 + 28i*3/3 + 30i*2 + 118i. Let q be r(29). Which is the closest to q? (a) 2 (b) 0.05 (c) 3 a Let w be -29 + -6 + -5 + 20. What is the closest to w in 0.1, -2/15, -3? -3 Let i = 683 - 679. What is the closest to 1 in -0.1, 0.6, 1/6, i? 0.6 Let n = 23215 + -23214. What is the nearest to 0.07 in n, 14/9, -0.4? -0.4 Let n = 5713 + -5710. What is the closest to n in -1/9, -4, -0.1? -0.1 Let s = 29.981 + -29.99. What is the closest to 0.2 in 5, s, 1, 2/13? 2/13 Suppose 13v + 65 = -7u + 9u, v + 5 = -u. Let o = -3.94 - 0.06. What is the closest to -2/79 in v, 2/11, o? 2/11 Let s = 378799/6 + -63133. Let z = -0.8 - -0.3. Which is the nearest to 0.2? (a) s (b) z (c) 2/45 a Suppose -3u = 2u + 4u. Suppose 5a - g - 25 = u, 5a + 4g - 1 - 49 = 0. Let y be (-1 + 10/a)(-3)/(-2). What is the nearest to 6 in -1, y, 0.1? y Let r = 4.4 + 0.6. Suppose -46 = -2k - 4l, -2l - 34 = -k - k. Suppose 0 = -13w - 6 + k. What is the nearest to w in r, -0.3, 3/4? 3/4 Suppose -4t - 7 + 17 = -3t. Which is the closest to 4/15? (a) 0.1 (b) 2/7 (c) t (d) 2 b Let x = -0.64883 - -0.14883. Which is the closest to 2? (a) x (b) -2 (c) -0.05 (d) -6 c Let g be 0 - (-20)/18 - 1. Let q = 0.0002 + 0.1718. Let b = q - -0.028. What is the closest to b in g, -0.1, 0.3? g Let j = 294.0637 - 0.0637. Let r = 294 - j. Let o be -1 + 3 - 12/7. Which is the nearest to r? (a) o (b) -2 (c) -0.4 a Let l be (141/(-45) + 3)/(126/(-105)). Let k = 1967 - 1964. What is the closest to -2 in k, -2/3, -1, l? -1 Let h = 7.69 - 3.69. Let q = -32 + 13. Let c = -20 - q. What is the nearest to c in 2/27, h, 0? 0 Let c = 5719 + -5700. Let t = -5.02 - -0.02. What is the closest to 1 in -3, t, c? -3 Let j = 23.6 + -24.39. Let k = -2.79 - j. Let s = -3.04 + 0.04. What is the closest to s in 2, 4, k? k Let k = 29216.9 - 29216. Which is the nearest to k? (a) -3 (b) -25 (c) -10/9 c Suppose -4d = -2f, -d + 22f + 9 = 26f. Which is the closest to d? (a) -0.1 (b) 35 (c) -2/15 a Let q be -5 + 2/(-6)30. Let u be 4 - 44/10 - (q - -4). Which is the nearest to u? (a) 3 (b) 5 (c) -5 a Let z = 3836 + -3831. Which is the nearest to -0.4? (a) -0.7 (b) z (c) -2/5 c Let i = 13.4192 - -0.5808. What is the closest to -6 in 5, -2, i? -2 Let f = 12.98 + -13. Let z be -1 - (-4)/63. Suppose -2 - z = l. What is the closest to 1 in 4/3, f, l? 4/3 Let h = -0.3933 + 0.8933. What is the nearest to -1/2 in -1, 1/6, h, -0.7? -0.7 Let x = -14197 - -14197.1. What is the closest to x in 0.3, -4, -5, 1/12? 1/12 Let q = 0.32 - -36.68. Let d = 18 - q. Let l = d - -18. Which is the closest to l? (a) 0.08 (b) -2 (c) -2/9 c Suppose 0 = 50t - 49t - 5. Let m = -14.5 + 15.8. Let p = 0.2 - 0.1. Which is the closest to p? (a) t (b) m (c) 4 b Let p = 0.7 - 0.8. Let c be 154/1694 - 25(-1)/(-33). What is the nearest to p in -5, c, -38? c Let g = 9068 + -9066. Suppose 0 = -6h + 3h. Which is the closest to g? (a) h (b) -5 (c) -17 a Let u = 260 - 300.6. Let k = 40.3 + u. Which is the nearest to 0? (a) 5 (b) 62 (c) k c Let j = -499 - -500. Let q be (-28)/(-21) - (9 + -8). What is the nearest to -1 in j, q, -2, -15? -2 Let m = 0.6 + 0. Let l = m + -0.6. Let o = 0.08678 + -4.08678. What is the nearest to 2 in l, o, -1? l Let u = -430.29 - -427.29. Which is the nearest to -0.3? (a) -39 (b)	{ "pile_set_name": "DM Mathematics" }
multiple of 11 and p. 33 Let w = -35 - -41. Calculate the least common multiple of w and 15. 30 Let q = -671 + 349. Let d = -735/2 - q. What is the common denominator of d and -58/9? 18 Let s = -51 - -56. Calculate the least common multiple of 5 and s. 5 Calculate the smallest common multiple of (-3(-2)/15)/((-10)/(-50)) and 8. 8 Suppose 0 = -2i - 4 - 0. Calculate the lowest common multiple of 2 and -1 - (-22 - (-5 - i)). 18 Suppose -3y - 3 + 21 = 0. Suppose -5b = -2i - 48, 2b - 12 = -i - 0i. Calculate the least common multiple of b and y. 24 Calculate the common denominator of 182/8(-26)/(-741) and 67/10. 570 Let f = 441/2 - 224. Let l = 685/6 + -181/2. Calculate the common denominator of f and l. 6 Let w = -809/360 - -141/40. Calculate the common denominator of -51/20 and w. 180 Calculate the common denominator of -43(81/21 - 4) and 35. 7 Suppose -f = -10 - 2. Suppose -g - f = -5g. Calculate the least common multiple of 7 and g. 21 Let r be 0 + 3 - (-12 + -1). Let z = r - 0. What is the least common multiple of z and 8? 16 Let l = -27/53 + -463/1484. What is the common denominator of -65/12 and l? 84 Find the common denominator of (36 - 1)/((3 + 3)/(-3)) and 63/4. 4 Let b = -2450 - -26987/11. Find the common denominator of b and -91/10. 110 Let x = -27 - -31. What is the least common multiple of x and 28? 28 Suppose -s - 10 = 4s, -3z + 24 = 3s. Let v(k) = -2k. What is the lowest common multiple of v(-5) and z? 10 Let d(y) = y + 396. Let c be d(0). Suppose 2k - 9142 = -2882. Calculate the common denominator of k/c + (-6)/33 and 75/22. 198 Let p = 1720/161 - 180/23. Let v be (-10)/6(-69)/2. Let u = -249/4 + v. What is the common denominator of u and p? 28 Let k(a) = -5a3 + 1. Let n be k(1). Let o = n - -6. Find the common denominator of 43/8 and o-47(-1)/32. 16 Suppose -10s + 7s = -21. What is the least common multiple of s and 11? 77 Suppose 0 = -3v - 2v + 120. Let f(s) = -s3 + 3s - 1. Calculate the common denominator of 4/(v/(-45))1 and f(-3). 2 Suppose a = 2n - 8348 - 115, -1 = a. Let k = -3575099/776 + 35765/97. Let p = n + k. What is the common denominator of p and -23/5? 40 Let t = -304 + 1464/5. Suppose 2s + 184 = 2u, -5u = s - 4s - 456. What is the common denominator of t and (-616)/u + 9/(-15)? 45 Let t be (-2 - 124)/(4/(-12)). What is the common denominator of 151/12 and (14/t)/(4/366)? 36 Let d be (-1)/(-2) + (-2)/(-4). Calculate the common denominator of (304/28)/(d + 1) and 38/7. 7 Let r = 1/418977 + 7487869/837954. Let t = r - -45/26. What is the common denominator of 46 and t? 3 Suppose 4v + 2f = 47 - 7, 0 = -5v + 2f + 32. What is the common denominator of 153/12v/33 and 71/9? 99 Let o = 1 - 47/7. Let g = 7 + 14. Calculate the common denominator of o and g. 7 Let a be 2/5 + (-43)/(-5). Suppose 1 - a = -4s. Let c(d) = -8d - 7. Calculate the least common multiple of s and c(-2). 18 Let s = 9737 - 369909/38. Calculate the common denominator of s and 35/16. 304 Suppose 5y = 3o - 2o + 79, 3y - 4o - 44 = 0. What is the lowest common multiple of y and 12? 48 Let s be (33 + -1)/(35 - -2). Let v = s - 159/740. Calculate the common denominator of 43/10 and v. 20 Suppose -2w = 4q - 28, 2w + 0w - 3q + 7 = 0. Suppose -25 = -3m - 2v + 29, -2m + 52 = -wv. Calculate the lowest common multiple of 2 and m. 20 Let z = -5 - -11. What is the smallest common multiple of 1/(-1) - (0 - 21) and z? 60 Let m = 8 - 0. Let n = 2 + -1. What is the least common multiple of n and m? 8 Suppose 0 = s - 84 + 370. Calculate the common denominator of -35 and (-2)/(-3) + s/6. 1 Let x = -20 - -36. Calculate the smallest common multiple of x and 10. 80 Let s(w) = 4w3 - w2 + 2w - 1. Let r be s(1). Let i = -1 + r. Suppose im - 3 = 39. What is the least common multiple of m and 14? 14 Let n(w) = -w*2 + 6w + 9. Let s be n(7). Suppose -5a + 23 + s = 0. Suppose a = d - 5. What is the lowest common multiple of 16 and d? 80 Suppose 40477 = -4d - 0m + 3m, -3m - 10138 = d. Let a = d - -161883/16. Calculate the common denominator of a and 27/4. 16 Find the common denominator of 712/126 + (-51)/119 and -5/11. 99 Suppose -3v - 2j + 6 = j, 5v - 50 = 5j. Suppose 2 = -2i + 2x, 4i + i = -4x + 40. Suppose it + 12 = 36. Calculate the lowest common multiple of t and v. 6 Let p = 20 + 0. What is the least common multiple of p and 32? 160 Suppose -2t + 36 = -4r, -5t + 2r + 65 = -3r. Calculate the smallest common multiple of 12 and t. 24 Let z = -3 + 8. What is the smallest common multiple of z and 33 + -2 + 0? 35 Let a = 73/17 - 835/238. Let y be -3(-6626)/24 - 2. Let q = y + -818. What is the common denominator of q and a? 28 Let j = 0 + 2. Suppose -9r = -13r. Suppose r = 6u - 50 + 8. What is the least common multiple of j and u? 14 What is the common denominator of -18/7 and (-4)/(-14) - 792/(-70)? 35 Suppose 2o - 3o + 10 = 0. Suppose -4t - w - 6 = -0, 3t = -w - 4. What is the least common multiple of o and (-5 - t) + 14 + -1? 10 Let j = -3 - -7. What is the lowest common multiple of 22 and 12 - (-4)/(2 - j)? 110 Calculate the common denominator of 337/(-260) - 10/65 and ((-9)/(-20))/(1/9). 20 Let z(k) = -k*2 + 2k + 6. Calculate the smallest common multiple of 4 and z(0). 12 Calculate the least common multiple of 11 and 4 - (-161)/(-35) - (-43)/5. 88 Suppose 5u = -0u - 4b + 31, -5u - 2b = -23. Calculate the least common multiple of u and 3. 3 Let p(m) = -m2 - 8m - 10. Let x be p(-7). Let k be -1171(x - 78/(-27)). Let d = k + -131. Calculate the common denominator of d and -14/11. 99 Let c(b) = 3b - 20. Calculate the least common multiple of 30 and c(8). 60 Suppose 4t - 3z + 2z - 1 = 0, -3z = 3. Let r be -5(-2 + t + 5). Calculate the smallest common multiple of ((-6)/r)/((-2)/(-90)) and 2. 18 Let q = -18 - -30. Find the common denominator of 2 - (-1 - (-106)/q) and -20/9. 18 Let m = -7355/46 + 160. What is the common denominator of m and 21/2? 46 Let j = -18/109 + 4613/872. Find the common denominator of -70/3 and j. 24 Suppose x = 6x - 40. Calculate the lowest common multiple of x and 4. 8 Suppose -2q + 12 = -q. Let y = q - 10. What is the lowest common multiple of y and 22? 22 Let h(w) = -w3 - 7w*2 - w - 7. Let p be h(-7). Suppose p = 2j - 16 - 12. Let y = 36 - 16. What is the smallest common multiple of j and y? 140 Let o(c) = -36c. Calculate the least common multiple of 20 and o(-1). 180 Let q be (-3 - 0) + 1049/345. Let r = 21847/2760 - q. Find the common denominator of -7/9 and r. 72 Suppose 0 = -2y + 4c + 22, y + 8 = -4c - 5. Suppose -yr + 7r - 8 = 0. What is the lowest common multiple of 7 and r? 14 Suppose 3x - 119 = -2. Let j = -2/573 - 41825/1146. What is the common denominator of j and x? 2 Let a = 5 - 5. Suppose -r = -ar - 2. Suppose -5h - 2d + 19 - 5 = 0, 0 = -h - 3d + 8. Calculate the least common multiple of r and h. 2 Find the common denominator of 53/22 and 492/64(-8)/18. 132 Let o be 16/20 - (-62)/10. Suppose om - 48 = 92. What is the smallest common multiple of m and 6? 60 Suppose 0 = -5x + 5 + 55. Let r = x + -9. Let d(z) = z*2 - 4z + 5. What is the least common multiple of r and d(4)? 15 Suppose 3v + 5y = 249, -2v + 129 + 37 = 2y. Let u = v - 671/8. Find the common denominator of u and (34/10)/((-2)/3). 40 Let m = 1 - -7. What is the smallest common multiple of (-20)/(-6) + -3 + 295/15 and m? 40 Let v = 95 + -46. Let x = -1/465 + -19061/1860. Calculate the common denominator of v and x. 4 Let b = -1/1727 - 8484/260777. Let c = b + -9493/604. Let u = 11 - 8. What is the common denominator of u and c? 4 Calculate the common denominator of 46/(-4) - -12 and (17/21)/(42/63). 14 Let k = -14540/11 + 1323. Suppose 0 = -3x + 63 + 117. What is the common denominator of k and ((x/(-8))/5)/12? 88 Calculate the common denominator of -11/14 and 0 - 1 - (-438)/(-60). 70 Let i(w) = w*2 - w + 22. Suppose -5d = -14 - 6. What is the least common multiple of i(0) and d? 44 Calculate the lowest common multiple of (3 - 1)-65/(-20) and 10. 30 Let c(t) = 2*t + 50. What is the least common multiple of 22 and c(-9)? 352 Let o be ((-4)/14)/(2/(-14)). Let h = -7 + 13. What is the smallest common multiple of h and (-7)/(14/(-36)) - o? 48 Let m(w) =	{ "pile_set_name": "DM Mathematics" }
1 + 3. Let x = f - 4. Let a(p) = -25p2 - 6p - 3. Let m(c) = 8c2 + 2c + 1. Let i(z) = xa(z) - 7m(z). Calculate i(-1). -5 Let u(b) = -7b3 - b - 3b + 18b3 + 3b + b2. Determine u(1). 11 Let f(y) = y2 + y + 1. Let n(g) = g + 6g2 - 3 + g - 3g*2 + g. Let m(r) = -2f(r) + n(r). Give m(0). -5 Suppose 2 = -4h + q - 17, 4q = -4h - 4. Let l(d) = -d - 8. Determine l(h). -4 Let y(s) = -s3 - 4s*2 + 4s. Suppose 2t = -0t + 28. Let v be (-63)/t - 2/4. What is y(v)? 5 Let x(v) = 5v - 2 - v2 + 5 - 2. Suppose 5z - t - 2t = 33, 20 = 4z + 4t. What is x(z)? -5 Let d(l) = -l3 - 7l*2 + 2l + 8. Let q be d(-7). Let g(b) = b*2 + 6b. Give g(q). 0 Let f(w) = -7w - 2w + 3w. Suppose -16 = -3u - u. Suppose -ur - 5 = r. Give f(r). 6 Suppose 2l - 10 - 2 = 0. Let t be (-2 + l/4)-2. Let f = 3 - t. Let x(v) = 2v*3 - 4v*2 + 3v. Give x(f). 6 Let m(z) = -2z - 6. Let h be 48/15 - 1/5. Suppose -7 = y + 3x, y = -2x - h - 3. Determine m(y). 2 Let h(d) be the third derivative of -d5/60 - d4/12 - d3/2 + d2. Suppose 5l = -4m + 3m - 29, 0 = 2m - l + 3. What is h(m)? -11 Suppose -3g + 15 = -6g. Let j = 7 + g. Let p(z) = -2z*j + 3z*2 - 4z*3 - 2z*2. What is p(1)? -5 Let n = 31/2 + -15. Let w(z) be the first derivative of 0z*3 + 2 + 1/4z*4 - nz*2 + z. Calculate w(2). 7 Let s(o) = 2 + 0o2 - o2 - 6o - 2 - 2. Determine s(-6). -2 Suppose 6 = -2q, -2z - 5 = 2z + 3q. Suppose 4w = 16, 0 = 3g - 3w + 5 + z. Let y(v) = -v*2 + v - 2v - 2 + v*3 + 2v. Give y(g). 4 Let r(m) be the third derivative of -m4/24 - m3/3 - 2m2. Let x = -3 + 3. Calculate r(x). -2 Let p be (-13 + 0)/(-1) + 0. Let v(h) be the second derivative of h5/20 - 13h4/12 + h2 + 2h. Let k be v(p). Let b(m) = 2m*2 - m - 2. What is b(k)? 4 Suppose 16 + 2 = 3j. Let o(x) = -2x + 9. What is o(j)? -3 Let c(p) = -p - 4. Let d(f) = f2 - 5f + 3. Let w be d(3). Give c(w). -1 Let y(h) = -9h3 - h2 - h. Let w = -14 - -13. What is y(w)? 9 Let m be 0 - (-1)/(3/(-15)). Let u = 4 - 6. Let n(o) = -5o + 31. Let f(q) = -q + 8. Let g(w) = un(w) + 9f(w). Give g(m). 5 Suppose -2 = 4j + 14. Let c(r) = -2r*3 - 8r*2. Let m(t) = 3t*3 + 12t*2. Let o(l) = -7c(l) - 5m(l). Give o(j). 0 Let t(w) be the first derivative of -w4/4 - 2w3 + w2 + 7w + 2. What is t(-6)? -5 Let s(c) = 1 + 0c*3 - 11c*3 + 0 - 2c2 + c2. Calculate s(1). -11 Suppose -4t + 3i - i + 8 = 0, 0 = -5t - 5i - 20. Let q(h) = -2 + t + h*2 - 3h + 0h2 + 4. What is q(2)? 0 Let l(z) = -z3 + z2 + 5z - 4. Let b be -2(-1 - 3/(-2)). Let g = b + 17. Suppose -4q = 4 - g. What is l(q)? -7 Suppose -2c = 5v - 4c + 32, 3c - 3 = 0. Let o = 1 + v. Let m(d) = d*2 + 5d + 5. Determine m(o). 5 Let q(b) = 4b3 - 25b*2 + 21b + 3. Let h(l) = -l*3 + 6l*2 - 5l - 1. Let m(i) = 9h(i) + 2q(i). Suppose -2u + 3 = -5. Let n = -1 + u. Determine m(n). -3 Let p(q) = q3 - q2 + q + 1. Let z(x) = -7x*3 + 12x*2 - 12x - 6. Let k(j) = -6p(j) - z(j). Suppose -3b = -2b - 4. What is k(b)? -8 Let n(a) = -3 - 2a + 3. Let k(v) = -v*3 - 7v*2 + 9v + 4. Let q be k(-8). Let w be 2(q/2 + 0). Determine n(w). 8 Let a(f) = 5f*2 + 60 + 6f - 56 + f*3 - 10f. Calculate a(-6). -8 Let k(j) = j*2 - j - 3. Suppose 5 = -m + 8. Calculate k(m). 3 Let k be (1 - 2)(-4 + 1). Let y(l) = -5l - 3 + 2 + 3l - 3l2 - lk. Let x be (-4)/(-6) - (-11)/(-3). What is y(x)? 5 Suppose -4o = 12 + 8. Let n be (1 + 6)1/1. Let c(i) = -n - 4i + 6i - 4i. Calculate c(o). 3 Let l(p) = 0 + 8p + 1 - 7p + 0p. Calculate l(2). 3 Let o(b) = 0b + 7b2 + 2b*3 - 5b - 3b3. Suppose 23h - 22h = 6. What is o(h)? 6 Suppose -5w = -4w. Let x = w - 3. Let j(s) = 3s*2 + 2s2 + s3 - 2s2. What is j(x)? 0 Let u(b) = -7b - 3. Let w(t) = -14t - 7. Let c(q) = -5u(q) + 2w(q). Suppose 2n = 8 - 6. Determine c(n). 8 Let g = 4 + -2. Let w(v) = -4 - v*3 + 3v - 2v2 + 3v + 5vg. Let m = -1 + 5. Give w(m). 4 Let t(u) = u3 + 4u*2 + 3u + 4. Suppose 6r - 9 = -27. What is t(r)? 4 Let r(f) = 25f*2 + 9f + 15. Let c(u) = 12u2 + 4u + 7. Let h(l) = 13c(l) - 6r(l). Give h(1). 5 Let r(g) = -1 - 8g2 + 9g*2 + g + 4g + 5. Let s(i) = -i*2 + 7i - 9. Let b be s(6). Give r(b). -2 Let p(r) = r - 2. Let h(i) = -i + 1. Let l(w) = -5h(w) - 6p(w). Let c be l(5). Let f(d) = d*2 + d - 1. Calculate f(c). 5 Let u(z) = -1 - 4 + 3z + 4 - z*2 - 4z. Give u(-3). -7 Let g(r) = -r*3 + 0r*2 - 4r + 2 + r*2 + 2r*2. Give g(2). -2 Let b = 1 - -3. Suppose -3d - 8 = -2u, -4d + bu = -d + 4. Let l(i) = -i - 9. Calculate l(d). -5 Let a(m) = m - 8. Let r be a(11). Suppose -ry + 1 = 4. Let i(t) = -13t2 - t. Determine i(y). -12 Let m = 79 + -74. Let f(y) be the third derivative of y4/24 - 11y*3/6 + 2y2. Calculate f(m). -6 Let s be (4/6)/2 - 10/3. Let w(z) = -z - 5. Give w(s). -2 Let y(h) = h3 + 6h2 + 4h - 2. Suppose 3u - 7 = -a - 2, 3u + 3 = 0. Let p = a - 14. Let z be p/27 + (-129)/27. What is y(z)? 3 Let j(n) = n + 78 - 87 - 3n. Determine j(-6). 3 Let q(a) = 6 + 6a*2 - 3a + 0a + a. Let v(u) = 2u*2 - u + 2. Suppose -y + 5j + 5 = 0, 2j + 11 + 18 = -5y. Let m(x) = yq(x) + 14v(x). Determine m(-3). -8 Let b = -9 + 21. Suppose -a = a + b. Let c(t) = t*3 + 5t*2 - 5t - 8. Calculate c(a). -14 Let x(t) be the first derivative of 2t3/3 - 2t + 2. Let a = 5 - 7. Give x(a). 6 Let q(t) be the first derivative of t*3/3 - 9t*2/2 + 10t + 2. Determine q(8). 2 Let t(d) be the third derivative of d*5/60 + 5d*4/24 - 5d*3/6 - 46d2. Give t(-4). -9 Let x(f) = -f3 + 4f2 + 8f - 4. Let t = 24 + -25. Let l = 4 - t. Determine x(l). 11 Let u(n) be the first derivative of 0n3 - n + 3 - 1/2n*2 + 1/4n*4. Calculate u(0). -1 Let j(n) = -5n*3 - 3n + n*3 + 3n*3 - 5 - 5n2. Let k be (-3)/(6 - -3) - (-22)/(-6). What is j(k)? -9 Let s(j) = -j3 + 5j2 - 2j + 1. Let y(p) = p*2 + 8p + 5. Let z be y(-6). Let n = z + 11. Determine s(n). 9 Suppose a - 3d + 10 = 0, -2a - 5d = -2d - 16. Let f(q) = -4q - aq + q*2 + 2 + 3q. Calculate f(4). 6 Let i = -18 + 14. Let d(p) = p + 2. Determine d(i). -2 Let p(b) = -b + 1. Let x be p(1). Suppose 0 = -d - 3d + 12. Let r(l) = l - l3 - 1 + d - 1. Determine r(x). 1 Let d(l) = -4l2 - l. Let p(r) = r3 - 12r2 + 2r - 23. Let h be p(12). Determine d(h). -5 Let y(f) = 9f + 2. Let h(i) = 10i + 2. Let d = 3 + -10. Let w(m) = dy(m) + 6h(m). Suppose 0 = 3n - 2g, 5n + 2g + 6 + 10 = 0. Determine w(n). 4 Let j(m) = -3m3 - 3m*2 - 4m - 2. Let d be j(-2). Suppose v = -2v + d. Let q(c) = c2 + 2c - 3c + vc*2. What is q(1)? 6 Let q = 11 + -6. Suppose -s - 5z + 40 = -5s, -qz + 30 = -2s. Let u(o) = 3o*2 - 11o - 1. Let w(a) = -a*2 + 5a. Let i(d) = -2u(d) - 5w(d). Give i(s). -8 Let k(l) = -9l3 - l3 - l2 - 2 + 12l*3 - l. Suppose 6 = 2d + 2. Give k(d). 8 Let p(v) = 2v3 + 0v*2 - 3v*2 + 1 + 0v + 0v3 + 2v. What is p(2)? 9 Let r(m) = -3m2 + 2m + 1. Suppose 0h - 16 = -4h. Suppose 0 = -n - 4j + 9 - 3, -hj + 4 = 0. Let c be ((-2)/(-4))/(n/(-4)). Determine r(c). -4 Let q(s) = s*2 - 3s + 4. Let d(g) = -g - 3. Let c be d(3). Let k(r) = -r + 4. Let l be k(-6). Let p be (-115)/(-25) + c/l. Calculate q(p). 8 Let v(b) = -6b + 1. Let r be v(1). Let u(o) = -2o - 5. What is u(r)? 5 Suppose -9 = -2h - 5. Let u(z) = -z3 + z2 - z + 2. Give u(h). -4 Let n(m) = -4m + 9. Let q(b) = 2b - 4. Let v(c) = -6n(c) - 13q(c). Let x = 7 + -11. Calculate v(x). 6 Let k(l) be the third derivative of -l4/24 - 7l*3/6 + 3l*2. What is k(-5)? -2 Let k(o) be the second derivative of -5/2o*2 + 3o + 0 + 1/3o3. Give k(4). 3 Let n(r) be the first derivative of r4/4 + 6r + 2. Suppose 4d = 5c + d - 2, -5c - 14 = d. Let y = -2 - c. Give n(y). 6 Suppose -3k + 8k = 0. Suppose kz - 3z = 12. Let f(x) = 3x + 5. What is f(z)? -7 Let b(y) = -4y3 + 2y - 1 + 5y3 - 5y*2 + 5 + y. Suppose -u + 2u = 3. Determine b(u). -5 Let w(z) be the third derivative of z5/60 + z4/8 + 2z3/3 - 2z*2. Let x be w(-3). Suppose l + x = 3l. Let k(q) = -q*3 + 2q*2 + q. Determine k(l). 2 Let r(b) = 4b*3 + 8b*2 + 6b - 5. Let c(g) = -3g3 - 7g*2 - 5g + 5. Let v(	{ "pile_set_name": "DM Mathematics" }
the smallest common multiple of 24 and y? 72 Calculate the common denominator of (-8)/14 - (18 - (-140550)/(-7602)) and 16/51. 9231 Let o(l) = l*3 + 4l*2 - 10l. Let k be o(-8). Let d = 180 + k. Calculate the smallest common multiple of d and ((-5)/(-25))/(1/5). 4 Let m = 291221409 - 4028465767102/13833. Let x = 10/477 - m. Calculate the common denominator of x and (5 + -6)(-7 + 678/12). 58 Let a be 54742/(-28) - 17/((-357)/12). Let n = -17665/9 - a. Find the common denominator of 58/33 and n. 198 Calculate the least common multiple of 16 and (1652/6 - 8/6) + -2. 272 Suppose 5q - 176 = -2j, -6j = -3j - 3q - 285. Let v be ((-35)/21 - -2) + j/5. Let f = -47/6 + v. Calculate the common denominator of -15/151 and f. 1510 Let p(f) = f*3 + 6f*2 + 2f - 5. Let b be p(-5). Calculate the common denominator of (-6)/b - 8/(2400/(-1970)) and -173/30. 30 Suppose -5u + 10438 = -y - 40817, 4u = -5y + 41004. Let q = 369149/36 - u. What is the common denominator of 11/36 and q? 36 Let m(l) be the first derivative of -1333l4/4 - l3/3 + l*2 - 3l + 1. Let d be m(2). Let c = d - -170573/16. Find the common denominator of 133/12 and c. 48 Calculate the common denominator of 13823278/532168 - (23 - -3) and 53/1548. 20124 Let k = -583 - -633. Let t = -320/9 - -224/9. Calculate the common denominator of ((-12)/18)/(-4 + 165/k) and t. 21 Calculate the common denominator of 61/826 and (-190)/105((272952/(-7552))/(-9) - 4). 3304 Calculate the lowest common multiple of 3336 and 12 - 72/(60/(-10)). 3336 Let b = -9195 - -9219. Calculate the least common multiple of 116 and b. 696 Let w be 2 + (-53755)/7679 + 135/27. Let b = -468399/76790 + w. Calculate the common denominator of b and -91/50. 50 Suppose 222i - 177i - 315 = 0. What is the lowest common multiple of 1827 and i? 1827 Let c = -7699 + 7993. What is the smallest common multiple of c and 448? 9408 What is the common denominator of (19422/(-1040) - -22)/(36/16) and -107/520? 4680 Let s = -15306 + 15790. Calculate the least common multiple of 462 and s. 10164 Let o(s) = 3s*3 - 9s*2 + 7s + 14. Let v be o(-4). Find the common denominator of -103/12 and (-56)/(-140)v/(-144). 36 Suppose 4y + 10 = 9y. Suppose -3u + 2j = -4u + 71, 0 = yj - 8. Find the common denominator of 37/22 and u/(-12)153/(-162). 264 Let b(n) be the second derivative of 3n5/20 + n2/2 - 26n. Let s be b(1). Suppose 26 = 6x - s. What is the least common multiple of x and 8? 40 Let z(t) = -5t. Suppose -3f + 15x = 12x - 156, -x - 244 = -5f. Suppose 0b = -4b + f. What is the lowest common multiple of b and z(-3)? 60 Suppose -8g + 7g + 27 = -u, -3g = 5u - 105. Calculate the least common multiple of 60 and g. 60 Calculate the common denominator of 3/6 - (-3 + (-3224)/(-880)) and -63/1475. 16225 Let b be 54706/20434/1052. Let s = b + -22/263. Find the common denominator of 53/27 and s. 108 Let r = -27 + 32. Suppose 11 = 2j + rg - 4g, -3g + 25 = 4j. Calculate the common denominator of -29/6 and (j/10)/(-1) + (-4147)/195. 6 Let g = -1595 + 3649. Suppose -5j - 4s + g = -344, 3 = -s. What is the smallest common multiple of 22 and j? 5302 Let m = -15038377/75829800 + -2/126383. Find the common denominator of m and -139/180. 1800 Let x = 469/80 - -511/16. Let y = x - 3299/80. Calculate the common denominator of 46/14(-4)/8 and y. 112 Let y(m) = -483m. Let w be y(1). Let v be w/(-308) + (-1)/(-4). Let o = -1681/132 + v. Calculate the common denominator of 47/14 and o. 84 Suppose -5q = -q + 32. Let m = q + 18. Suppose -u = -1 - 3. What is the lowest common multiple of u and m? 20 Suppose 48 + 120 = -14n. What is the smallest common multiple of 91 and (-2 - n/(-8))/(10/(-140))? 637 Suppose -y + 446 = 3m, -615y + 611y = -5m - 1750. Calculate the smallest common multiple of y and 1040. 11440 Let b = -4883/10 + 497. What is the common denominator of b and -31/10? 10 Let l(a) = -4a - 8. Let g be l(9). Let c = -36 - g. Calculate the lowest common multiple of c and (-4)/(-3)63/14. 24 Let i = 250639/30 - 8353. What is the common denominator of i and -85/84? 420 Suppose 0 = -3n - 4z + 38, 2034n + 14 = 2033n + 2z. Let s = -10 - -21. Calculate the least common multiple of s and n. 22 Let g(j) = -11j - 1526. What is the least common multiple of 136 and g(-139)? 408 Let v be -4 - (-57)/15 - (-1)/5. Let f = v - -1. Let x(j) = -j - 3. What is the least common multiple of f and x(-5)? 2 Let d(u) = -7u2 + 3u + 7. Suppose 3n - 24 = 9n. Let f be d(n). Calculate the common denominator of -29/10 and (-1 - 10/8)/(f/150). 130 Suppose 2o = -2i + 554, -i - 8o = -13o - 307. Suppose -5u - 3a + 2a = -i, a - 225 = -4u. Calculate the smallest common multiple of 9 and u. 171 What is the common denominator of 3 - (-53780)/(-17400) - 0/1 and 43/348? 1740 Suppose 477f - 481f + 48 = 0. Calculate the smallest common multiple of f and 9776. 29328 Let g = -93019/7 - -13290. What is the common denominator of g and 71/108? 756 Let s(g) = -g*3 - 11g*2 + 9g. Let a be 6/14 + 4 + 570/42. Let v be (-2)/6 + (-210)/a. What is the least common multiple of 2 and s(v)? 36 Let j = 72731/2149416 + 3/26536. Find the common denominator of j and 83/297. 3564 Let b = 25108 + -10824. What is the smallest common multiple of 4 and b? 14284 Let n(y) = -y*3 - 25y*2 - 119y - 63. What is the least common multiple of n(-19) and 480? 480 Let c(k) = 16k2 - 7k - 18. What is the least common multiple of c(-4) and 10? 1330 Let k = 52103/8 - 6524. What is the common denominator of (-1)/((-12)/(-7))(-54)/459 and k? 408 Suppose 5g - 25 = 2q + 6, 2q = 3g - 21. Let r be 1 - (q/3 - 2) - 3. Calculate the common denominator of 19/11 and r2/8(12 + -91). 44 Let f(z) = -2z*3 - 14z*2 + 11z + 72. Calculate the least common multiple of 63 and f(-8). 1008 Suppose 29l - 132 = -16. Suppose -5c - 443 = -ld, 2d - c = 190 + 33. Calculate the smallest common multiple of 28 and d. 112 Find the common denominator of ((-84)/(-64))/((-15)/(-68)) and (13/33)/1 - (-155021)/4378. 20 Let s = -21 - 197. What is the common denominator of 132/(-20) - -7 - s/(-20) and 15/59? 118 Suppose 0 = 3g + b - 24, 4g - 9g + 40 = -3b. What is the smallest common multiple of 2 and g/2 + (-632)/(-4)? 162 Find the common denominator of 13/380 and (6/(-32))/((-3555)/10586). 2280 Let j = 30373 - 1518767/50. Let r = 185465601/440237 + -6/62891. Let b = 29917/70 - r. Calculate the common denominator of j and b. 50 Suppose -2b + 3o + 93 = -48, 4b - 3o - 279 = 0. Suppose b = -v + 77. What is the lowest common multiple of v and 2? 8 Suppose -16q + 37q = 4137. Let y = 242 - q. What is the least common multiple of y and 15? 45 Let j(g) = g2 + g + 2. What is the smallest common multiple of j(3) and 26(495/(-15))/(-11)? 546 Suppose -358 = -122q + 1350. Calculate the lowest common multiple of (-1)/((-1)/50) - 2 and q. 336 Let a = 11 - -19. Let s = a - -41. Suppose 0 = -3t + l + s, -24 - 26 = -2t - 2l. What is the lowest common multiple of t and 33? 264 Suppose 0 = 14q - 9q. Let b = -129 - -101. Calculate the common denominator of q + -3 - 2(-40)/b and -127/6. 42 Suppose -2i - 1018 = -8i + 3338. Calculate the smallest common multiple of i and 2541. 5082 Let l = 458 + -454. Let g(q) = q3 - q2 + q + 1. Let t be g(0). Let m(n) = 21n*2 - 1. Calculate the least common multiple of l and m(t). 20 Find the common denominator of (-1344)/288(-110)/25935 and -71/8. 17784 Let i = 73 - 280. Let v = i - -227. What is the smallest common multiple of 35/24/5 and v? 140 Let g be 1 + (1 - 0)-271. Let b = -265 - g. Calculate the smallest common multiple of 26 and b. 130 Let s = -83/28 + 311/28. Let p(w) = w*3 - 13w*2 - 2w - 17. Let x be p(12). Let b = x + 1751/10. What is the common denominator of s and b? 70 Let s(c) = 2c2 - 9c - 28. Let n be s(7). Suppose 0 = -3j - n + 79. Let y = 27 - 7. What is the smallest common multiple of j and y? 120 Find the common denominator of (2/8)/(189/(-84))246/(-14) and 2/(-5) - 4/21. 105 Let x = -70 + 112. Let h = x - 48. Find the common denominator of -1163/105 + h/(-10) and 17/12. 84 Find the common denominator of -53/351 and 8383/13130(-5)/21. 4914 Suppose 590 + 274 = 4*d. Calculate the smallest common mult	{ "pile_set_name": "DM Mathematics" }
s the third biggest value in -0.5, 4.991, -7? -7 Which is the third biggest value? (a) -533/10 (b) -1/7 (c) -1.63 (d) 2 (e) -0.01 b Which is the fifth biggest value? (a) 91/2 (b) 4 (c) 7291 (d) 0.04 (e) -1/11 e What is the smallest value in 5, -12/29, -9, -0.1, 4/19? -9 Which is the fifth biggest value? (a) 2/7 (b) 1.9 (c) -28 (d) 134 (e) 1 c What is the third smallest value in 13/3, -587, 5, -34? 13/3 What is the second smallest value in 0.4, 9.54, 31641? 9.54 What is the second smallest value in 0.012, 6.7, -4358/3? 0.012 Which is the smallest value? (a) 0.1 (b) 1 (c) 0.2 (d) 0.7 (e) 13 (f) -0.2 (g) 602 f Which is the smallest value? (a) -2/13 (b) 0 (c) 1/5 (d) -4/5 (e) -1.2 (f) 2.82 (g) -58 g Which is the second smallest value? (a) 0.01 (b) -531/9641 (c) -3 b What is the fourth biggest value in 1/7, 63557, 130, 4? 1/7 What is the fourth biggest value in 10/139, 127, -0.3, -1/4, -0.1? -1/4 What is the third smallest value in 10, -5, 0.3, -0.0428, -4.5, -1? -1 What is the smallest value in -5, -3, 497404, 2? -5 What is the smallest value in 1/73, 13.6, 0.24, -25? -25 What is the second biggest value in 98/3, 47, -9/4, -2/5, -42? 98/3 Which is the second biggest value? (a) 2.464 (b) -1.9 (c) 29 a What is the fourth biggest value in -77, -3/58, 0.3, -1/12, 1/4? -1/12 Which is the third smallest value? (a) -8678 (b) 8 (c) 7 (d) -2/7 c Which is the biggest value? (a) 2 (b) -28 (c) -1 (d) -8/17 (e) -3 a What is the second biggest value in -0.4, 115, -183132? -0.4 What is the smallest value in 1/11, 0.5, -0.2, -0.118057615? -0.2 Which is the biggest value? (a) -35 (b) 695.392 (c) 1/11 b What is the fourth biggest value in 29, 0.85, -224, 3/5, -2, -6? -2 Which is the seventh biggest value? (a) -2 (b) 0.7 (c) 0.4 (d) 5 (e) -1/191 (f) -5 (g) 5/7 f What is the second biggest value in 0, -1/5, 0.01, 1, -2, 2, 921? 2 What is the fourth biggest value in 21487, -118, -4/7, 0.2? -118 What is the fourth smallest value in 36764, -1/4, 2/83, 2? 36764 Which is the second smallest value? (a) 4/5 (b) 29/27 (c) 1.353 b What is the fourth biggest value in -2/9, 0.11, 0.6, 37, 11, 14? 0.6 What is the smallest value in 2/5, -3, 50, 0.3, 8/53, 55/7? -3 What is the biggest value in -8, 1/2, 15, 4/3, -2, -6/53, 0.4? 15 Which is the biggest value? (a) -0.3 (b) -246241089 (c) -1/5 (d) -3 c Which is the third smallest value? (a) -1 (b) 5 (c) 0.1 (d) -3 (e) 10659 (f) -1/2 f What is the smallest value in 2/5, 16634, -3/4, -5, -1/5, 1/6? -5 What is the biggest value in -23/43686, -2, 2? 2 Which is the fifth biggest value? (a) -11 (b) -0.4 (c) -792004 (d) 2/7 (e) 5 c What is the second smallest value in -0.11, 4, -2, 3059, 5, -2/7? -2/7 Which is the second biggest value? (a) -21 (b) 1.2877 (c) -0.06 (d) -2/5 c What is the fourth smallest value in 48, 13, -0.4, -2304? 48 Which is the second smallest value? (a) 3.7 (b) -324 (c) 6/5 (d) 3/8 (e) 0 (f) 0.08 e What is the seventh smallest value in -10, -1/2, -1, 221, -3/2, -2, -0.4? 221 What is the third smallest value in 8/3, -76086/13, 4? 4 Which is the smallest value? (a) 471 (b) 1/41 (c) -10.27 c Which is the sixth smallest value? (a) -1 (b) -0.5 (c) -2.2 (d) -446 (e) -1/4 (f) -0.05 (g) 1/3 f Which is the smallest value? (a) -4/3 (b) 0.1 (c) 1910/3 (d) -2/89 (e) 2/17 (f) 1/3 (g) -0.4 a What is the biggest value in -7875, -3/5, -0.1, 3, -4/3? 3 Which is the smallest value? (a) -660/43 (b) 607/5 (c) 0 (d) -0.1 a Which is the third biggest value? (a) 1/3 (b) 4589 (c) -58 (d) 23 (e) 5 e What is the third smallest value in -25, 0.088, 641, -2? 0.088 What is the fifth smallest value in -105, 1, 0.4, -1/9, -1, 16/9? 1 Which is the third biggest value? (a) -1/2 (b) -4 (c) -1/7 (d) -1/5 (e) -1090/7 (f) -2/3 a What is the fourth biggest value in 3, 2/5, -124/3, -2/163? -124/3 What is the third biggest value in -12/17, -0.2, 0.5, -0.1663, -2/23, -5, 3? -2/23 What is the fifth biggest value in 0.15, -0.4, -29, 2/3, -1, 0.055? -1 What is the third smallest value in -19, 2/78935, -0.5? 2/78935 What is the fifth smallest value in -39, -2/7, -15, 2.75, 5/6? 2.75 What is the third biggest value in -2.5, 0.185, 3, -4, -3/2, 0.1, -19? 0.1 Which is the second biggest value? (a) -12 (b) 1 (c) -0.129316 (d) 0.5 d What is the smallest value in 157, -2, -3, 1, -0.2, 0.1, 5? -3 Which is the second biggest value? (a) 0.1 (b) -11/4 (c) -1/2 (d) -2/3 (e) -131 (f) -0.2 f What is the third biggest value in 8026, 6, -341, -1/6? -1/6 Which is the smallest value? (a) -4 (b) 2/3 (c) 50 (d) -3 (e) -270 (f) 5 e What is the second biggest value in 0.0089, 0.2, -189, 0.3? 0.2 What is the fifth smallest value in 1, -7, -1, -327, -5? 1 What is the smallest value in 23, 138809, -9? -9 Which is the seventh biggest value? (a) 0.5 (b) -106/13 (c) -1/4 (d) -10/21 (e) 1/4 (f) -1 (g) -7 b What is the second biggest value in -4, 103, 1/130, -14? 1/130 Which is the smallest value? (a) -0.1 (b) 0 (c) -100 (d) 1/2 (e) 5 (f) 0.2 (g) -528 g Which is the second smallest value? (a) -0.1 (b) -2 (c) 4/21 (d) 1 (e) 0.16 (f) 2/3 (g) 29/6 a What is the second smallest value in -4/7, -0.48, 44/405555? -0.48 What is the seventh smallest value in 2/19, 0, 2/3, 288, -5.3, -2, -0.5? 288 What is the fourth smallest value in -0.12, -30.87, 1/4, 26? 26 Which is the smallest value? (a) 13 (b) 27 (c) -2 (d) 0.5 (e) -4 (f) 39 (g) -252 g Which is the smallest value? (a) 3 (b) 36 (c) 0.1492 (d) -36 d Which is the second smallest value? (a) -2.69 (b) -0.5 (c) 0.4 (d) 9/206 b What is the second smallest value in 0.2, 0, 0.1, 5/13, -1.466? 0 What is the fifth smallest value in -2/11, -166, -3.15, -70/11, -4? -2/11 Which is the second smallest value? (a) 0 (b) 3/2 (c) -18.8064 (d) 7/3 a What is the fourth smallest value in 4, -4, 2.782, 162? 162 Which is the third smallest value? (a) -1/4 (b) -0.2 (c) -4/335 (d) 20/33 c What is the fourth smallest value in -43, 144, -3, -15, 1? 1 Which is the fourth smallest value? (a) 3/5 (b) -3 (c) 4/9 (d) -85 (e) 486 a What is the third smallest value in -0.0498, 2, 303/3923? 2 What is the third smallest value in 7, -6/11, -5729? 7 Which is the smallest value? (a) -1 (b) 2/9 (c) -17904/7 c Which is the biggest value? (a) 5/6 (b) 152523 (c) -120 b Which is the second biggest value? (a) 1019 (b) -58 (c) 0.1066 c Which is the sixth smallest value? (a) 1699 (b) -44 (c) -1 (d) -133 (e) 0 (f) 0.3 a What is the third biggest value in -3/7, -22, 3/80, -485, -5, -2? -2 What is the third smallest value in 167, -2, -23, 470? 167 Which is the second biggest value? (a) 2.3 (b) -1.5521 (c) 0.04 (d) -2 c Which is the smallest value? (a) -1/4 (b) -1/7 (c) 0 (d) -21628 (e) -404 d What is the biggest value in 5, 3, 4, -384, 35.1, 1.4? 35.1 What is the third biggest value in -774, -1/6, -0.5, 5, 2617/3, -0.1? -0.1 What is the biggest value in -1.1, -0.4, 37/7, 1/32, -2/67? 37/7 What is the third biggest value in 2/171, 0.1, 13, 1, -10, -3/4, -0.2? 0.1 What is the smallest value in 12/30511, 2, -2? -2 What is the second smallest value in 625, -4, -5, 19.403? -4 Which is the second biggest value? (a) 0.05 (b) -45361 (c) 2/7 (d) -1 (e) -4 (f) -1/3 (g) 3 c What is the biggest value in -22/97, -3, -1191? -22/97 Which is the fifth smallest value? (a) 0.3 (b) 130 (c) -226/15 (d) -1 (e) 1/3 b Which is the third smallest value? (a) -0.13 (b) -323 (c) -2/5 (d) 1 (e) 10/17 (f) 1/3 a Which is the fourth biggest value? (a) -3 (b) 4 (c) 5 (d) 5.13088 a Which is the smallest value? (a) -53 (b) 1/6 (c) 2 (d) -3 (e) 4/3 (f) -0.104 (g) 4 a What is the fifth biggest value in -1/7, 19, 3, 0.2, -0.5, -26? -0.5 What is the third smallest value in -2, -0.35, -23, 1.14, 3? -0.35 What is the fourth smallest value in -9/19, -0.075, 2/5, -0.04, -0.02, -1/6? -0.04 What is the third smallest value in 13/15051, -1.65, 3? 3 What is the fourth smallest value in 32.4, -1/2, 2/11, -4.8, -0.414? 2/11 What is the second smallest value in 2/17, -12.4, -1/3, -23? -12.4 Which is the biggest value? (a) -1 (b) 1498125 (c) -0.04 b What is the second smallest value in 2373, 0.374, -0.4, -5? -0	{ "pile_set_name": "DM Mathematics" }
? False Suppose 16p + 4q - 3391 = 13p, -p + 1137 = 3q. Suppose 121j - 116j = p. Is j a multiple of 15? True Let a(h) = 2h2 - h + 9. Let r be a(3). Is 61 a factor of ((-56)/r + 3)/(1/885)? False Let s(z) = 14949z - 1181. Is s(1) a multiple of 11? False Let h = 599 - 596. Is 2 a factor of 153 - h - (-30)/6? False Let a(w) be the second derivative of 5w4/4 + 37w*3/3 + 7w*2/2 + 4w - 2. Does 4 divide a(-6)? False Suppose 29489h - 29475h - 20084 = 23176. Is h a multiple of 3? True Let j(h) = -8h + 20. Let o = 14 - 12. Suppose 5p + 0p - 27 = ov, 5v + 36 = 2p. Does 17 divide j(v)? True Suppose 2o - 10 = -h, -5h + 2o = o - 28. Let s = -40 - -44. Is s40/15h a multiple of 16? True Let g = 3975 + -3398. Does 9 divide g? False Suppose 6i + 8i - 27i + 188981 = 0. Does 58 divide i? False Suppose -292c + 3284120 + 374008 = -461408. Is c a multiple of 57? False Suppose 2t - 976 = -4v, 2v = t - 163 - 329. Is 10 a factor of t? True Suppose 4c = 5n + 5, 21 = 4c + n - 2. Suppose 0 = cl - 3z - 715, 5l - 4z = 6l - 166. Does 17 divide l? False Let a be (15/(-3) - -520)/((-1)/(-2)). Is 8 a factor of (-1)/(-25/a)? False Let g(h) = -4h - 52. Let p be g(-24). Suppose 5k + 689 = 4c, -3k = -c + 130 + p. Suppose q - c = -2q. Is q a multiple of 5? False Let c = -14946 + 14950. Suppose -27 - 13 = 2n. Does 14 divide (-6)/3 + (-8 + c - n)? True Let f(j) = 3j*2 - 7. Let n be f(3). Let h(c) = 4c - 68. Let w be h(n). Suppose -2k + w = -4. Does 8 divide k? True Let x = 9427 + -6767. Is x a multiple of 8? False Let l(h) = -63 + 19 - 16h + 18h. Let r be l(23). Suppose -5d = -3t + 105, 0 = -rt - 0t - 3d + 70. Is t a multiple of 7? True Let o be -158(42/(-12) + 4). Let l = o - -109. Does 15 divide l? True Let c = -274 - -274. Suppose 5g - b - 1029 = 0, 4g + cg = -2b + 826. Is 71 a factor of g? False Let z = -23323 + 50863. Is 17 a factor of z? True Does 9 divide (1 - 5 - -2)-1037 + 2 + 3? True Suppose 187 = 2n - 301. Let d = -144 + n. Is d a multiple of 10? True Suppose 5z + 4b = 30850 - 4187, 16002 = 3z + 3b. Is 5 a factor of z? False Let w(z) = -16z*3 + 23z*2 - 25z - 26. Let i(r) = -r*3 + 4r*2 - 5r - 5. Let s(h) = -11i(h) + 2w(h). Let p = 1 + -2. Does 6 divide s(p)? False Let o be 15584/(-44) + 6/33. Let c = o - -519. Is c a multiple of 11? True Suppose 9 - 2 = 7y. Let k be (-4)/8(-82)/y. Suppose -4b = i - k - 164, -2i = 3b - 150. Is b a multiple of 12? False Let u be ((-12)/(-14))/(4/14). Does 22 divide u/(-3) - -235 - (4 - 0)? False Let g(z) = -1251z*3 - 2z*2 - 3z - 1. Let o be g(-1). Does 52 divide (27 - 28)/(2 - o/624)? True Let b(f) be the first derivative of -f*2/2 + 84f - 27. Is 14 a factor of b(9)? False Let n(w) = 399w2 + 13w + 130. Is 72 a factor of n(-8)? False Let c = -8923 + 21335. Does 66 divide c? False Suppose 5i - 44637 = -3y, -5y = -i + 6703 + 2202. Is i a multiple of 7? True Let g(x) = -3x*2 + 11x - 1. Let l be g(3). Let o(d) = -22 + 0 - 18d + ld + 3d. Is o(-7) a multiple of 6? True Let y(o) = 554o - 3791. Is y(28) a multiple of 82? False Suppose l - 2l + 106 = 4u, -5u - 238 = -2l. Is 44/(-24) - l/(-9) a multiple of 3? True Does 39 divide 1048/6(1275/2)/85? False Suppose -2x - 1081 - 446 = 3p, -x + 1025 = -2p. Let w = 595 + p. Does 12 divide w? True Let b(d) = -227d - 2569. Does 5 divide b(-37)? True Suppose -1 = -3q + 5j - 0, -9 = -5q + j. Let f be ((-715)/52)/(q/8). Let h = -10 - f. Is h a multiple of 9? True Suppose 1771 + 129 = 5f - 2h, 3f = -4h + 1114. Does 18 divide f? True Suppose 5c + 227 - 1260 = -2a, 3a = 4c + 1492. Suppose 5b - 504 = -4l, l + 3b - a = -3l. Is 3 a factor of l? True Let p be (-76)/(-28) + 6/21. Let m = 27 + -25. Suppose -mu + 131 = 3u - f, u + pf - 23 = 0. Is 4 a factor of u? False Let b(a) = -a*3 + 11a*2 + 10a. Suppose -17t = -30t + 78. Does 12 divide b(t)? True Let n be (((-100)/(-8))/(-5))/((-1)/2). Suppose -4p = -0b + nb - 2332, 2p + b = 1166. Let j = p + -383. Is 39 a factor of j? False Let m(j) = 273j - 6787. Is 23 a factor of m(30)? True Let c be -3 + (-5)/15-87. Suppose -ct + 23t = 0. Suppose -4y = -5d - ty + 512, y = -3. Does 17 divide d? False Let z be ((-4)/(-3))/((-2)/(-3)). Let l(j) = -45j3 - j2 - 5j - 1. Let r(y) = -6y*3 - y. Let c(h) = -l(h) + 6r(h). Is 25 a factor of c(z)? True Let j be ((-6)/18)/((-1)/126). Is (-7)/j - (-1766)/12 a multiple of 25? False Let z(v) = -v*2 - 6v - 9. Let n be z(-5). Is ((-16)/24)/(((-4)/(-99))/n) a multiple of 16? False Let k(y) = 20y3 + 5y*2 + 6y + 2. Let z be k(-2). Is 6 a factor of (6 - 7)z + (0 - 2)? False Suppose -k + 2w = -6454, -10k + w = -14k + 25789. Is 32 a factor of k? False Let n = 229 - 111. Let r be 32/(-3 + 5)(-1 - -6). Let l = n - r. Is l a multiple of 7? False Does 100 divide 397 - -1 - (-19 - (-24 + 7))? True Let d = -471 + 481. Does 5 divide (1108/d)/(288/45 - 6)? False Suppose -f + 2j + 12786 = 4898, 5f + 5j - 39365 = 0. Is f a multiple of 31? False Let k(v) = 37v3 - 6v*2 + 37v - 13. Does 7 divide k(4)? False Let p(u) = 310u3 + 7u*2 + 12u - 70. Is p(3) a multiple of 227? True Let x = -11 - -12. Suppose -2f - x = -2n - 69, -5f + 200 = 5n. Let b = f - 29. Does 8 divide b? True Let f(k) = 4186k2 - 8k + 11. Does 40 divide f(3)? False Let d(w) = -14w + 1. Let a be d(1). Let v(n) = -7n - 14n2 - n3 + 4n + n*2 + 23 + 2n. Is 17 a factor of v(a)? False Suppose 5r = 4f - 10473, 451f + r + 7863 = 454f. Does 6 divide f? True Suppose 7p + 45 = -1271. Let j = 480 + p. Does 41 divide j? False Let k = -4325 - -6430. Does 17 divide k? False Let y(f) = 866f + 3585. Is 4 a factor of y(7)? False Suppose -v + 1621 = 5z, -3z + 1962 = 3z - 3v. Does 13 divide z? True Let u(y) = -6y - 36. Let j be (15/(-6) + -1)/(6/12). Let m be u(j). Is (m + (-8)/2)/((-2)/(-88)) a multiple of 27? False Let q(n) = -n3 + 9n*2 + n + 10. Suppose -5g + 20 + 15 = 0. Is q(g) a multiple of 7? False Does 2 divide (4/8)/(34/13124)? False Let g(l) = -7l3 + 51l*2 + 22l + 16. Is 76 a factor of g(-8)? True Let p be 3(-2)/(-3) - 5474/(-34). Let a = p - 91. Suppose 6x - a = 3x. Is 6 a factor of x? True Let j(u) = 7u + 4. Let i(m) = -m + 1. Suppose 4t = -t - 5. Let r(z) = tj(z) - 3i(z). Is 6 a factor of r(-4)? False Suppose -4x + 82232 - 16232 = -4g, 3g = 2g. Is x a multiple of 55? True Let c be ((-14)/(-6))/((-3)/(-108)). Let z(q) = q3 - 39q*2 - 125q + 27. Let o be z(42). Let n = c - o. Is n even? False Suppose 5w - 44 = -34. Suppose 0 = 3g - 4a - 1848, 4a = wg - 5g + 1824. Is g a multiple of 34? True Suppose -5a - 19 = -o, -4o + 2 = a - 11. Suppose ox - 3c = -4c + 1502, -2x - 3c = -756. Is x a multiple of 15? True Let c be (-529)/(-138) + (-14)/(-12) + -1. Suppose -2b + 3a = 39, -2b = -ca + 27 + 17. Is 21 a factor of (b/(-15))/((-6)/(-315))? True Let h = 63480 - 31620. Is h a multiple of 10? True Let f be 69/(-8)2 - 6/8. Is 5 + -3264/f a multiple of 7? True Is 11 a factor of -38681(-8)/48 - 1? True Suppose 6n - 7n + 736 = 0. Suppose 16l + n = 20l. Is 23 a factor of l? True Let z(l) = -232l + 2072. Does 103 divide z(-19)? False Let y be ((-20)/(-6))/5-3. Let g be (-42)/63(-642)/4. Let a = g + y. Is a a multiple of 11? False Let b be ((-13)/(-3) + 12/(-3))-1119. Let w = b - -458. Is 3 a factor of w? False Let i(s) = 2s*3 - 4s*2 - 1. Let k be i(3). Let h(o) = 58o + 304. Is 49 a factor of h(k)? False Is (-161 - (-92)/(-23))/((-3)/358) a multiple of 116? False Let s(y) = y*3 + 6y*2 - 20y - 193. Is s(17) a multiple of 6? True Let g = 37 - 83. Let b = g + 45. Is (3/3)/(b/(-10)) a multiple of 5? True Let g(q) = -3q + 99. Let b be g(33). Let x(h) = -2h3 + h2 - 2h + 575. Does 23 divide x(b)? True Suppose -3458 = -7k + 161. Suppose 2b = b - 258. Let t = b + k. Does 37 divide t? True Suppose j = 5490 + 33106. Suppose -j = -23f - 232. Does 11 divide f? False Suppose 4o = 4p + 1772, 4o - 6p + p = 1775. Is 44 a factor of o? True Let a = -14 - -181. Let w = a + 15. Is 14 a factor of w? True Let m(t) = -5t3 - 28t*2 - 411t - 65. Does 25 divide m(-15)? True Let p(g) be the third derivative of 5g4/4 + 34g*3 - 220g**2. Is p(17) a multiple	{ "pile_set_name": "DM Mathematics" }
2 + 0x - 5. Give q(v(j)). -26j Suppose 4u = 5d + 5u - 14, -2u = -3d - 2. Let h(a) = -d + 2 + a. Let o(n) = 3n + 7. Let v(m) = m + 2. Let g(k) = -4o(k) + 14v(k). What is h(g(w))? 2w Let s(z) = -7z*2 + 236z - 236z. Let w(m) be the first derivative of -m3/3 - 2. Calculate s(w(o)). -7o*4 Let y(n) = -n. Let p be 3/(-2 + (-14)/(-4)). Let g(r) = 0r - 3r + pr + 2r. Give y(g(s)). -s Let x(o) = -3o*2. Let l(n) = -154n. Determine l(x(p)). 462p2 Let z(p) = -p2. Let i(c) = -c3 - 8c*2 - 15c - 4. Let d be i(-6). Let w(b) = 9b + 10 + 4 - d. Calculate z(w(y)). -81y2 Let k(o) = o2 + 5. Let f(i) = -2. Let c(p) = 5f(p) + 2k(p). Let g(h) = h - 2h - 4h + 2h. Give c(g(y)). 18y*2 Let t(s) = 9s. Let u(l) = 446l. What is u(t(z))? 4014z Let k(g) be the first derivative of 0g - 1/2g2 - 1. Let a(r) be the third derivative of -r4/4 + 2r2. What is a(k(w))? 6w Let s(o) = 7o2. Let x(v) = -13v*2. Let h(l) = -13s(l) - 6x(l). Let u(w) = -3w*2. What is u(h(y))? -507y*4 Let w(z) = -497z. Let g(f) = f. Calculate w(g(j)). -497j Let i(l) = -162l*2 + 2l. Let g(x) = 4x. Determine g(i(o)). -648o*2 + 8o Let u(j) = 124 - 124 - 4j2. Let c(v) = -30v*2. Let x(r) = -4c(r) + 36u(r). Let i(a) = -a. Give i(x(b)). 24b*2 Let t(n) = -4n. Let m(v) = -221v + 6. Calculate t(m(q)). 884q - 24 Let h(v) = 274v2. Let i(n) = -2n. Calculate i(h(t)). -548t2 Let m(l) = 2l. Let a(h) = -h*3 + 6h*2 - 3h - 6. Let o be a(5). Let v(b) = o + 7 - 11 + b*2. Calculate m(v(z)). 2z*2 Let v(c) = -51c - 4. Let t(d) = 3d. Give t(v(h)). -153h - 12 Let j(n) = -8n. Let b(h) = -14h*2. Determine b(j(q)). -896q*2 Let v(q) = -397q*2. Let l(t) = -27t*2. Calculate l(v(g)). -4255443g*4 Let y(i) = -34i - 24. Let p(o) = o. Determine p(y(s)). -34s - 24 Let d(v) = 2v*2. Let x(a) = 2a*2 + 10. Determine d(x(t)). 8t*4 + 80t*2 + 200 Let t(p) = -2p*2. Let y(b) = 9b - 186 + 186. Give y(t(l)). -18l2 Let g(y) = -14 + 24 + 4y2 - 10. Let o(l) = l2. Calculate o(g(u)). 16u4 Let p(x) = -2x2. Let l(q) be the second derivative of q3/2 + 19q. Give l(p(s)). -6s*2 Let w(h) = -7h - 27. Let g(l) = 10l. Determine w(g(x)). -70x - 27 Let d(x) = -2x2. Let j(a) = 2a*2 + a - 1. Let i be j(1). Let u(c) = 3c - 6c - ic - 8c. Calculate u(d(h)). 26h*2 Let g(y) = -9y*2. Let i(b) = -1. Let r(h) = -h + 7. Let d(n) = -14i(n) - 2r(n). Determine d(g(m)). -18m2 Let h(k) = k2. Let p(f) = -5f2 + 9f + 12. Let u(y) = y*2 - 2y - 3. Let o(b) = 2p(b) + 9u(b). Calculate o(h(r)). -r*4 - 3 Let l(j) = -30j*2. Let u(d) = -7d*2 + 2d*2 + 3d*2. Calculate u(l(f)). -1800f*4 Let x(g) = -g. Let s(i) = -370i. Determine x(s(l)). 370l Let p(n) = -5n. Let m(f) = 2 - 2 - f. Let c(z) = z. Let q = -1 - -6. Let x(v) = qm(v) + 6c(v). Determine p(x(h)). -5h Let n(x) = 49x*2. Let t(v) = 56v*2 + 3v. Determine t(n(h)). 134456h4 + 147h*2 Let h(f) = 66f + 55. Let n(b) = -b - 1. Suppose -13g + 18g = 275. Let i(y) = gn(y) + h(y). Let p(o) = -o. Calculate i(p(m)). -11m Let h(v) = -15v2 - 93v + 93v. Let i(n) = -2n. Give h(i(y)). -60y2 Let n(z) = -6z*2 - 4 + 8z2 + 4. Let a(b) = b2. Give a(n(g)). 4g4 Let g(k) = 13k*2 - 5. Let c(s) = 6s*2 - 2. Let v(o) = -5c(o) + 2g(o). Let l(u) = 2u. Give l(v(q)). -8q2 Let r(f) = 3f. Let c(v) = -16v. What is c(r(l))? -48l Let z(a) be the second derivative of -3a3/2 + 9a. Let g(k) = 3k2. Give g(z(m)). 243m*2 Let w(g) = 4g*2 + 2g. Let l(r) = -8r2 - 5r. Let i(n) = -2l(n) - 5w(n). Let d(s) = -2s2. Give d(i(v)). -32v*4 Let y(c) = 2c. Let s(m) be the first derivative of -5m3 - 70. Calculate s(y(d)). -60d*2 Let z(b) = -2 + 5b - 4 + 6. Let v(r) = -4r2 + 3r. Let k(q) = -q*2 + q. Let n(m) = -3k(m) + v(m). Give n(z(c)). -25c2 Let q = 0 + -7. Let k(g) = -13g*2. Let y(h) = 9h*2. Let f(a) = qy(a) - 5k(a). Let c(n) = 7n. Give f(c(x)). 98x2 Let x be (-16)/(-3) - (-3)/(-9). Let t(d) = 8d - xd - d. Let n(m) = -3m. What is t(n(s))? -6s Let z be (15/25)/(2/70). Suppose 5h + k - z - 9 = 0, 5h - 4k - 55 = 0. Let v(f) = 5f + 4 - hf - 4. Let x(l) = 3l2. What is x(v(r))? 12r*2 Let k = 9 + -5. Let o(a) = -4 + 2a*2 + 0a*2 + k. Let b(i) = 3i. Calculate b(o(x)). 6x2 Let f(h) = -6h. Let o(g) = -g*2 - 9g + 1. Let t be o(-9). Let p(d) = -d - t + 1. Determine f(p(c)). 6c Let j(i) = -2i*2. Let y(k) = -2k*2 - 4k. Let q(z) = 3z2 + 5z. Let v(m) = 4q(m) + 5y(m). Give v(j(p)). 8p4 Let i(d) = -4d. Let x(z) = -z*2 - 3z + 3. Let w be x(-3). Let h(q) = 0q - wq + 3q + q. Give i(h(r)). -4r Let q be 1 + (-4 + 1)/(-3). Let l(t) = 2t2 + 7t*2 - 4tq. Let n(v) be the first derivative of v3/3 - 10. Give n(l(h)). 25h4 Let a(d) be the first derivative of 2d*3/3 - 18. Let x be (-3)/(-1) - (2 + -2). Let t(m) = 4m + 4m - xm. Determine t(a(h)). 10h2 Let n(w) = w + 923 - 923. Let r = 7 - 11. Let m(c) = 4c. Let p(x) = -x*2 + 3x. Let h(s) = rp(s) + 3m(s). Determine h(n(f)). 4f2 Let t(r) be the third derivative of r5/20 - 4r2. Let z(l) be the second derivative of l4/6 - l. Calculate t(z(y)). 12y4 Let b(g) be the first derivative of -g4/12 + g + 2. Let f(a) be the first derivative of b(a). Let i(x) = -2x*2 + 2x*2 - 3x*2. What is i(f(r))? -3r*4 Let m(x) = -2x. Let z(s) = -1361s. Give m(z(r)). 2722r Let f(g) = -3g. Let t(q) = 8q - 1. What is f(t(i))? -24i + 3 Let t(a) = 1695a. Let o(r) = 14r2. Calculate o(t(b)). 40222350b*2 Let z(t) = -433t*2. Let d(g) = -5g*2. What is z(d(r))? -10825r4 Let w(y) be the second derivative of -y3/2 - 3y. Let c(b) = b. Determine c(w(v)). -3v Let i(u) = -u*2 - 9u - 8. Let w be i(-8). Let x(g) = wg - 6g + 5g. Let m(v) = -v2. Calculate x(m(b)). b2 Let k(v) = 228v*2. Let y(t) = -2t. Determine y(k(b)). -456b2 Let k(z) = -z. Let o(r) be the second derivative of 0r*3 - 5/12r*4 + 0r*2 + 2r + 0. Calculate k(o(c)). 5c2 Let k(g) = -4g. Let b(i) = -1 + 2i - 3 + 4. Determine b(k(h)). -8h Let l(z) = -16z. Let b(x) = -18x - 1. Determine b(l(g)). 288g - 1 Let f(m) = 5m*2 + 4m*2 - 6m2. Let b(z) = z2. Determine b(f(a)). 9a4 Let m be ((-16)/12)/(4/(-6)). Let y(g) = 4g*2 - 5g*2 + 5gm + g2. Let h(s) = 2s2. Determine y(h(x)). 20x*4 Let s(l) = -2l*2. Let v(m) be the first derivative of -2/3m*3 + 0m*2 + 1 + 0m. What is v(s(p))? -8p4 Let a(i) = 0i*2 + 4i*2 - 6i*2. Let h(d) = 2 - 2 + 3d. Calculate h(a(z)). -6z2 Let l(m) = -2 + 0 + m + 3. Let k(c) = c2 + 3c + 3. Let v(z) = k(z) - 3l(z). Let h(d) = 2d*2. Calculate v(h(u)). 4u*4 Let f(w) = -8w - 1. Let t(v) = -12v. Calculate t(f(m)). 96m + 12 Let m(p) = 358p. Let j(d) = 2d. What is m(j(o))? 716o Let x(j) be the second derivative of 1/6j*3 + 4j + 0j2 + 0. Let m(u) = u2. Give x(m(r)). r2 Let u(b) = b2. Let h(m) be the third derivative of -m6/360 - m3/2 + 2m2. Let z(r) be the first derivative of h(r). Calculate z(u(t)). -t4 Let b(h) = -1190h. Let w(f) = -2f*2. What is b(w(i))? 2380i*2 Let t(s) be the third derivative of 2s*5/15 + 22s*2. Let h(m) = 3m. Give h(t(n)). 24n2 Let g(i) be the second derivative of i4/12 + 2i. Let h(v) = -3v2 + 3. Let d(r) = 3r*2 - 4. Let p(y) = -3d(y) - 4h(y). Calculate p(g(q)). 3q*4 Let m(p) be the first derivative of 3p*3 - 7. Let r(d) = -d. What is r(m(n))? -9n*2 Let i(l) = -l. Let o(c) be the second derivative of 0c*3 + 0c*2 + 0 + 1/6c*4 - 6c. Calculate i(o(j)). -2j2 Let d(b) = 3b + b - 2b - b. Let v(t) be the second derivative of -t4/2 + t. Calculate v(d(o)). -6o*2 Let m(z) = -6z*2 - 5. Let u(i) = -5i*2 - 4. Let q(p) = -4m(p) + 5u(p). Let w(h) = -2h*2. Determine w(q(t)). -2t4 Let b(f) be the first derivative of f3 - 21. Let n(p) = -24p2. Give n(b(d)). -216d*4 Let o(z) = 8z*2 - 10z*2 - 18z*2. Let i(w) = 2w*2. What is o(i(s))? -80s*4 Let h(n) = -477n*2. Let t(r) = -19r*2. Calculate h(t(w)). -172197w*4 Let g(m) = 4m. Let y(r) = -55r + 1. Give g(y(h)). -220h + 4 Let r(i) = 12i. Let p(m) = -28m*2. Determine r(p(b)). -336b2 Let c(p) = p2 + 76. Let a(u) = 7*u.	{ "pile_set_name": "DM Mathematics" }
s*4 - 3s*3 + 376s*2 - 17s + 2556 wrt s? 132s2 - 18s + 752 What is the second derivative of -793520h4 + 7h + 61108 wrt h? -9522240h2 Find the second derivative of -8646n*3 - 16n*2 - 736187n. -51876n - 32 What is the second derivative of -15788a*2h*3s*3 + 6a*2h*3 + 13213ah3 - 10as3 - h3s*2 + h wrt a? -31576h*3s*3 + 12h*3 What is the first derivative of -12107im - 3i + 30m2 + 119492 wrt m? -12107i + 60m Differentiate -112976n*4 - 497565 wrt n. -451904n*3 Differentiate -2l*4 + 122433l*3n + 1075509n wrt l. -8l*3 + 367299l*2n Find the second derivative of 32848o4 - o3 - o2 + 191755o wrt o. 394176o2 - 6o - 2 Find the third derivative of -211641j6 + 226599j*2 wrt j. -25396920j*3 Find the second derivative of 3394a*3s*2 + 2a*3 - 7411as wrt s. 6788a*3 Find the second derivative of 2b*2f*3r*2 + 642b*2f*2r*2 - 7bf3r*2 - bf*2r*2 - 10bf2 + f3 wrt b. 4f*3r*2 + 1284f*2r*2 Differentiate 3l*2y - 2l2 + 192ly + 114l - 2y - 68910 with respect to l. 6ly - 4l + 192y + 114 What is the second derivative of -2150c*3k - 822c3 - 2ck + 5c - 37169k + 2 wrt c? -12900ck - 4932c Find the second derivative of 513086t4 - t3 - t2 - 137t - 5034. 6157032t2 - 6t - 2 What is the third derivative of -41j6 + 328j*4 - 1390436j*2 + 2 wrt j? -4920j*3 + 7872j Find the third derivative of -5b2m*3o*2 + 2b*2m*3 - 68b*2m*2o*3 + 2b*2m*2o*2 + 40909bmo - 22474m3o*3 wrt o. -408b*2m*2 - 134844m3 What is the first derivative of -d4 + 24021d2t - dt - 107t + 397 wrt d? -4d3 + 48042dt - t Find the first derivative of 45536b*2dk3 + 2b*2d - b*2k*3 - 51808b*2k2 + b2 - 2k wrt d. 45536b*2k*3 + 2b*2 Differentiate 12133s*2 + 3sv - 90v + 12 wrt s. 24266s + 3v Find the third derivative of -w*4y*3 - 2w*4 + 18w*3y*3 - 7w*2y*3 + 87w*2y*2 + 2w*2 + 74wy3 - 7wy2 wrt w. -24wy3 - 48w + 108y3 What is the first derivative of 17788c*2hs + 897c*2 - hs - 83h wrt s? 17788c*2h - h What is the first derivative of -343605k - 491890? -343605 What is the third derivative of g3n - 7487g3 + 32408g*2n - n wrt g? 6n - 44922 Find the second derivative of 96948d*2u*3 + 45d*2u + 2d2 - 12du wrt u. 581688d*2u Find the second derivative of -71340k2 - 115225k. -142680 What is the third derivative of 2560889u5 - 48064u*2 - 1? 153653340u*2 Differentiate 124g*3ls + 4g*3 + 14g*2ls + 138g*2 + 3gls + 16l with respect to s. 124g*3l + 14g2l + 3gl What is the derivative of -11d4 - 2056d*2 - 3d + 246883 wrt d? -44d3 - 4112d - 3 What is the second derivative of 273c3p*3 - 2c*3 + 25800c*2p + cp3 wrt p? 1638c*3p + 6cp What is the derivative of -1465858t4 + 5957199? -5863432t3 What is the third derivative of -d4m - d4 + 329d*3m - 20d3 - d2m + 5d2 - 2d + 11m + 376 wrt d? -24dm - 24d + 1974m - 120 What is the first derivative of 5g*4 - 2g*2o*2 + 10137g*2y + o*2y + 21o2 - 81oy + 3o + y wrt g? 20g3 - 4go2 + 20274gy Find the third derivative of 29428h*3 + 12300h*2 wrt h. 176568 Find the second derivative of -19686s*3 - 8s*2 - 87021s + 1. -118116s - 16 Find the second derivative of b3s*3 + 302b*3s + 2b3 + 52bs3 + bs*2 - 228s*2 + 29s - 1 wrt s. 6b3s + 312bs + 2b - 456 What is the first derivative of -1817321m*2 - 874201? -3634642m Find the second derivative of 1132lr*2 - 57110lr + 5r*2 - r wrt r. 2264l + 10 What is the second derivative of 2x4 - 7x*3 - 6x*2 - x + 103869 wrt x? 24x*2 - 42x - 12 Find the first derivative of -2f2l - 38f2 - 15fl + 24f + 2144713l wrt f. -4fl - 76f - 15l + 24 Find the second derivative of h3z2 - h3 - 68h2z + h*2 - 5hz3 - 4hz2 + 2hz - 18z*3 wrt z. 2h*3 - 30hz - 8h - 108z Differentiate 2s*2 + 31122s - 5836 with respect to s. 4s + 31122 What is the derivative of -489741i*2 + 3i + 4205799 wrt i? -979482i + 3 Differentiate -40464av2 - 141v*2 + v + 236 with respect to a. -40464v*2 What is the derivative of -4s*2x - 105s2 + 177sx - 6957x - 13 wrt s? -8sx - 210s + 177x Find the third derivative of -396i5 + 11i*4 - 2i*3 - 2732i*2 - 19i wrt i. -23760i2 + 264i - 12 What is the second derivative of 980264l4 - 1271430l? 11763168l2 What is the derivative of 333698t - 326033 wrt t? 333698 What is the second derivative of 1164c4v - 43c2vy - 2c*2 + cvy + 118cy + 6c + 82 wrt c? 13968c2v - 86vy - 4 What is the third derivative of 3730n6 + 5n*4 - 12022n*2? 447600n*3 + 120n What is the second derivative of -38293u3 + 46821u? -229758u What is the third derivative of -1068k*3u*3 + 2304k*3u*2 - 10k*3u - 3k2u*3 - 6u*3 + 1 wrt u? -6408k*3 - 18k*2 - 36 Differentiate 5726ny - n + 3y - 17171 with respect to y. 5726n + 3 Find the third derivative of 255149s5 + s4 + 2s2 - 75s + 41 wrt s. 15308940s2 + 24s Find the second derivative of -3d3z - 8d3 + 334d*2 + 9dz - 75d - 15z wrt d. -18dz - 48d + 668 What is the derivative of 12d4z - 185d4 + 3dz + 227439z wrt d? 48d3z - 740d3 + 3z What is the derivative of -6arv3 + 439arv - 3av + 2rv*3 + 3rv2 + 115r - 25v wrt a? -6rv3 + 439rv - 3v Find the first derivative of 2y4 - 1106987y*2 + 4719945. 8y*3 - 2213974y What is the third derivative of -184546c3x - 660c2x - 2c - 2x + 111 wrt c? -1107276x Find the third derivative of 58903f*3 - 36658f*2. 353418 Find the second derivative of -33643f*2 + 40f - 162. -67286 What is the first derivative of -9pw*2 - 384156p - 387w2 + 20w wrt w? -18pw - 774w + 20 Find the third derivative of -t6 + 158t*5 + 26t*3x + 2t2x - 13t + 3x + 5 wrt t. -120t3 + 9480t*2 + 156x What is the third derivative of 12cd*2j + cdj*2 - 5cj3 + 2d*2j*3 + 1536d*2j*2 + 142dj3 wrt j? -30c + 12d2 + 852d What is the third derivative of -3k6 - k4 + 826k*3 + 65966k*2 wrt k? -360k*3 - 24k + 4956 What is the third derivative of 292310r5w2 - r2w2 - 11439r*2w wrt r? 17538600r2w*2 What is the derivative of -137gx2z*3 + gx*2z - 26gx + 179g - 2x*2 - 2x - 6z wrt z? -411gx2z*2 + gx*2 - 6 What is the first derivative of -14j*2z + 8j2 + 2jz + 265j + 41273z - 8 wrt j? -28jz + 16j + 2z + 265 What is the third derivative of -7574c*4 + 2c*3 - 96c*2 + 3 wrt c? -181776c + 12 Find the first derivative of 141621a3i*2j - a*3i*2 + 7771a*2i*2 - 4a*2 + 2i wrt j. 141621a3i*2 Find the first derivative of -2bl2 - 3bl - 238552b - 6l3 + 80l wrt l. -4bl - 3b - 18l*2 + 80 What is the third derivative of -147c*3f*3h + 1280c3f + 2c2f*2h - c*2h + 132cf*3h + 8cf*2 wrt f? -882c*3h + 792ch What is the second derivative of 77m2p*3 + 33m*2p*2w - m*2w + 2mp*3w - mp3 + 2mp2w - 18p3w - 10w wrt m? 154p*3 + 66p*2w - 2w Find the third derivative of inux*3 + 2inux2 - inux - 7iux2 - 3iu - 3458ix4 + 2ix2 + 67ux3 - 5x wrt x. 6inu - 82992ix + 402u Find the second derivative of -27684r5 + 2r*3 + 61r - 50 wrt r. -553680r3 + 12r What is the third derivative of -12i2y*4 - 15i*2y*2 + 100iy - 2198y*6 - 47y wrt y? -288i2y - 263760y3 What is the third derivative of 32l*4n - 37l4 + 2l*3n + 105l2n - 2ln + 14n wrt l? 768ln - 888l + 12n Find the first derivative of -18098c*3 + 142410. -54294c*2 What is the derivative of -256c*3 - 89c*2 - 230541? -768c*2 - 178c What is the third derivative of l*3p*2 - 2l*3p + 6045l3 - 36l*2 + 327lp2 wrt l? 6p*2 - 12p + 36270 Find the second derivative of -120z4 + 77z*3 + 24z*2 - 57z + 3236 wrt z. -1440z2 + 462z + 48 Find the second derivative of -14jx*5 - 29220jx2 + 2269305jx wrt x. -280jx3 - 58440j Find the th	{ "pile_set_name": "DM Mathematics" }
Let t(s) = -s*3 + 3s*2 + s - 4. Let v be (-7)/(-4) - 13/(-52). Let g be t(v). Suppose 0f + 789 = 2r - f, -387 = -r + gf. Is r prime? True Is (-3)/(-33) - (1 - 5110705/55) prime? True Suppose 23c - 20c - 42855 = 0. Is c composite? True Let a = 14119 - 3320. Is a composite? False Is (-474708)/(-54) + (-2)/(-18) a composite number? True Suppose z = -25z + 120146. Is z a prime number? True Suppose 0 = 11b - 24652 - 12649. Is b prime? True Suppose 6o = 53426 + 22000. Is o a composite number? True Let j be ((-51)/(-34))/(3/4). Suppose ju + u - 2b = -512, 846 = -5u - 4b. Let z = u + 597. Is z a composite number? True Suppose 3595 = 4v + o, 0v + 2701 = 3v - 4o. Is v a prime number? False Suppose -5g + 2h + 2h = -542, 4g + 4h = 448. Suppose g = q - 91. Is q prime? False Is (5/(-2) - -2)/(8/(-3376)) composite? False Let a(n) = n*2 - 3n - 4. Let v be a(4). Suppose h + 120 = 6h - 5g, 2h + 5g - 13 = v. Let k = h - -2. Is k a prime number? False Let w be ((-12)/9)/2-3. Is (-1 + w)/(10/4090) composite? False Suppose 8a - 53897 = -9073. Is a prime? False Let i(y) = 4y2 - 11y - 9. Let r(o) = o*2 + 10o - 7. Let k be r(-8). Let x = -31 - k. Is i(x) prime? False Let d(m) = -7 + 4 - 2m - 1. Let s be d(-4). Suppose p - 205 = -3j, -j + 51 = -0j - sp. Is j a prime number? True Suppose -5a + 2y + 110 = 0, a = 2y - 1 + 23. Suppose a + 66 = -r. Let i = -35 - r. Is i a prime number? True Let u = -96 - -104. Is (-8)/(u/3)(-1119)/9 prime? True Let u(s) = s2 - 11. Let j(m) = m3 - 9m2 + 8m + 2. Let i be j(8). Let d = 12 - i. Is u(d) prime? True Let j(y) be the third derivative of y*6/120 - 11y*4/24 - 19y*3/6 - 37y*2. Is j(12) prime? False Suppose 4t + 66650 = 2v, 5v = -11t + 6t + 166610. Is v a prime number? False Let c(u) = 5u2 - u - 2. Let i be c(-1). Suppose 2x + 5h = 519, 1029 = 4x + ih - 3h. Is x prime? True Let o = -12342 - -27187. Is o composite? True Suppose 5q + 6q - 61435 = 0. Is q composite? True Let n = -52 + 58. Suppose nf = 3f + 1899. Is f a prime number? False Let d = 15 - 8. Suppose -4s - 537 = -ds. Is s prime? True Suppose -33s + 36s = 12. Suppose -1926 = -sd + 214. Is d prime? False Let n = 64100 + -18271. Is n a composite number? True Let p(b) be the second derivative of -2b5/5 - b4/4 - 2b2 - 2b. Let i be p(-3). Suppose a + 22 = i. Is a prime? True Let p(q) = 27q + 10. Let a be p(18). Suppose -2c + 2m + m = -349, a = 3c + m. Is c a prime number? True Let h(w) = w*2 - w - 4. Let i be h(3). Suppose -3r + 4u = -437, 2r + iu - 276 = -8. Is r a composite number? False Suppose 8o - 9o + 4 = 0. Let t(n) = 141n - 10. Is t(o) composite? True Suppose 3g - 6 = 0, 9g = -2n + 5g + 122890. Is n a prime number? True Let q(x) = -242x + 10. Let l(v) = -v3 - 6v*2 + 5v - 7. Let k be l(-7). Let s be q(k). Is (s/(-16) - 2)4 a composite number? True Is 5754515/90 - (-11)/(-198) a composite number? True Let r be 5/(0 + 4/340). Suppose -v + r = -0v + 3u, 421 = v + 2u. Is v prime? False Let t = 380 + 357. Is t a composite number? True Suppose -4g + 2452 = -3d, -2g - 1240 = -4g - 2d. Suppose 0 = -2w + w. Suppose w = -5v + g - 171. Is v composite? False Let a be -10((-28)/(-10) - 3). Suppose -5r - c = -13024, -ar + 6260 = -4c + 1046. Suppose -2u + r = 3u. Is u a composite number? False Suppose 1667 = n - 2q, 3n + 1666 = 4n - 3q. Suppose 3s = -502 + n. Is s prime? True Suppose -6i + 7i = 8519. Is i a composite number? True Suppose 11o = 6o. Suppose -5k + 9k - 20 = o. Suppose 3u = 2u + kc + 31, -5u - c + 155 = 0. Is u prime? True Suppose 27w - 78727 = 24w - 4o, -4o + 26253 = w. Is w a prime number? True Let v = 568 - 258. Let g = -107 + v. Is g composite? True Let j(k) = -33k3 + 2k*2 + 4k - 7. Let l be j(-4). Suppose 55s - 52s = l. Is s composite? True Let z(m) = 133m + 9. Let q be z(5). Suppose 1312 = 6u - q. Is u composite? False Let a(y) = y*2 - 8y - 8. Let i be a(9). Is (-8 + 7)(i - 956) a composite number? True Let o(w) = -187w3 + w2 + 2w + 3. Suppose 25r = 29r + 8. Is o(r) prime? True Let s(l) = -l2 - 5l - 2. Let n be s(-4). Suppose 7b - 58 = nb + k, k + 10 = b. Is ((-380)/6)/((-8)/b) a composite number? True Suppose 6h + 3o = 3h - 15, 4h = -3o - 15. Let y(k) = -k2 - 2k - 2. Let b be y(-2). Is h - (-422)/(4 + b) a prime number? True Let d = 33618 - -1189. Is d a composite number? False Let h = 570 + 617. Is h a prime number? True Suppose -2t = -5o - 9582 - 6111, 4o + 12559 = -3t. Let r = o - -4982. Is r composite? True Let p be (0 + 4/16)20. Suppose -2m + 1022 = 4y, py + m - 1273 = -0m. Let w = 445 - y. Is w a composite number? False Suppose d + 3a = 3404, -3d + 5a = -10227 + 85. Is d a composite number? False Suppose 66 + 312 = 6b. Suppose 4u = b + 21. Is u a prime number? False Suppose 0 = -9k + 10k - 4. Suppose -kx + 11 + 113 = 0. Suppose 2u - x + 5 = 0. Is u composite? False Let l = -2098 + 5931. Is l a prime number? True Is (92/(-20) - -2)(-20 + -935) a prime number? False Suppose -22s + 6514 = 4i - 27s, -2i + 3258 = -2s. Is i prime? False Suppose 0 = 7o - 3o - 12. Suppose 19 = -4x - t, 2t + o = -3. Let y(q) = 3q2 + 2q - 7. Is y(x) composite? True Let p(g) = 9g - 11. Let m be p(3). Let x(y) = y2 - 6y - 17. Is x(m) composite? True Let h(p) = 295p2 - 2p - 1. Let l(z) = -z. Let c be l(3). Let q be h(c). Suppose -262 = -6d + q. Is d composite? False Suppose -16s = -3s - 401739. Is s composite? True Suppose 38i = 32i + 139134. Is i composite? False Let g(i) = i. Let v(y) = -6y + 4y + 2 + 56y*2 + y + 107y*2. Let x(s) = 3g(s) + v(s). Is x(-1) a prime number? True Let q(j) = -j*3 - 7j*2 + j + 2. Let z be q(-9). Suppose 5s = 320 + z. Suppose -3n - 2n = -s. Is n a composite number? False Let c(w) = w*3 + 9w*2 - 10w + 6. Let r be c(-10). Suppose -6a = 6 + r. Is a/(2/(-165)) + -2 prime? True Suppose 739088 = 1337i - 1321i. Is i a composite number? True Suppose 4c - 3s = 2s - 8, c - 5s = -17. Suppose -5t - cv = -2339, 3v = -2v - 10. Is t a composite number? True Suppose 3n + 10412 = 155. Let t = -1954 - n. Is t composite? True Let b be 44/8 + (-1)/(-2). Let d be b/(-2) + -279 + -2. Let l = -129 - d. Is l a composite number? True Let a be 438 - (-7 + 4). Suppose a = 4d - 277. Suppose d = 4n - 168. Is n prime? False Let h(x) = -54x*2 - 14x - 6. Let w(f) = 107f2 + 29f + 11. Let z(l) = -7h(l) - 3w(l). Is z(-4) a composite number? False Is (5 + 5 + -5)/(15/449763) a composite number? False Let y = 171 - 167. Let f be 4 - (0 + (-4)/2). Let j = f + y. Is j composite? True Is (-5)/1 + 9/(-3) + 5253 a prime number? False Let d = 373 - -39721. Is d prime? False Is (-13)/1564790728/(-3) prime? False Let m be (171/4 + -3)-4. Let p = 0 - m. Suppose 4v - p = v. Is v a prime number? True Let a = 2 + -5. Let b be -3 + (a - 0) + 6. Suppose r = -2, b = g + 3r + r - 387. Is g a composite number? True Let r be -1 + (1 - (4 + -13)). Let q = r - 5. Suppose 1303 = 5u - 4m - 0m, 0 = -qu - 3m + 1030. Is u a prime number? False Suppose 6 = 2w, -3w + 12 = 5i - 17. Suppose m + in - 41 = 26, 0 = 2n. Is m a prime number? True Suppose k + 2 = 0, -4k + 2 = m + 4m. Is (10 - 13) + m155 a prime number? True Is (-2178547)/(-21) + (-8)/(-12) prime? False Suppose -x = 2x - 9. Is x/(-6) + (-21165)/(-6) composite? False Let t(f) = 84f + 45. Let q(d) = 17d + 9. Let y(v) = 11q(v) - 2t(v). Let k be y(7). Suppose 0 = 5u - 3u - k. Is u a prime number? True Let z be -1 - 4/(-6) - 156584/(-69). Suppose -3i + 92 = -z. Is i prime? True Let t = 1388 + -847. Is t prime? True Let b be -201295/10-3. Suppose 7v + b - 29876 = 0. Is v a composite number? True Let d(l) be the second derivative of -l5/20 - l4 - 11l3/6 + l2/2 - 5l. Let g be d(-8). Let b = -118 - g. Is b a composite number? True Let a(p) be the first derivative of 75p*2/2 - 31p - 22. Is a(10) composite? False Let q(w) = 5w3 - 32w*2 + 13w + 1. Let f be q(7). Let t be 152(-5)/2. Let b = f + t. Is b a prime number? True Let v be 4985/1(-10)/(-10). Suppose -v = -7c + 8280. Is c prime? False Let a(l) = 9l2 - 21l + 49. Is a(22) a prime number? True Let b = -3	{ "pile_set_name": "DM Mathematics" }
. -4 Solve 2o + 2u = -12, 2o + 4u = 3o - 4 for o. -4 Solve l = -4o + 3l - 26, 5o - 3l + 35 = 0 for o. -4 Solve g = 2p - 3g + 12, 3g - 11 = p for p. 4 Solve 0 = -4m - 8z + 16, -3m + 16z - 14z = -4 for m. 2 Solve 6k = 2k + 3m, k - 4m = -13 for k. 3 Solve g = -2c - 3c + 14, -2c = -5g + 16 for c. 2 Solve -2k - 7 = i, 0 = -17k + 13k + 4i + 16 for k. -1 Solve 5a - 4 = 4a + 5g, -16 = -4a + 4g for a. 4 Solve 0 = -2i - 4z, -5i + 14 = 4z + 2 for i. 4 Solve 0 = -4h - t + 8, -8h - 2t + 4 = -4h for h. 3 Solve 5x - 18 = -4n + 8, 3x - 2n = -2 for x. 2 Solve -310d + 305d - 4p - 20 = 0, -5p = -4d + 25 for d. 0 Solve -3f - 21c + 26c = 15, f = 5c - 5 for f. -5 Solve 3 = -0k - 3k - 4w, 0 = -5k - 3w - 5 for k. -1 Solve 2l - n + 5 = 0, 5l + 0l + 14 = 2n for l. -4 Solve -5z = -7f + 23, 2f + 13 = -5z + 26 for z. 1 Solve 3o + 3 = 0, -5v + 3o - 14 = 3 for v. -4 Solve -3y - 2y + 19 = 3u, 2u = 3y - 19 for u. -2 Solve -m = -f - 2, -6f = -f + 4m + 10 for f. -2 Solve -6 = -3w - 3t, -3w + 4t + 2 = 5t for w. 0 Solve 2w = u - 6, 3u = 5w + 18 - 4 for u. -2 Solve f - 6 = 4y + 11, f - 12 = 3y for y. -5 Solve 2p + 38 = -2j + 22, 0 = -p + 5j + 16 for p. -4 Solve 2n - 3k = -4k - 4, -4k - 8 = 0 for n. -1 Solve -2t = -17 + 15, t = -f for f. -1 Solve 0 = 3n + 2 - 14, 2n - 16 = 2h for h. -4 Solve -4z = -h - 10 + 2, 4z - 8 = 2h for z. 2 Solve r = 2j + 14, -13r = 3j - 14r + 19 for j. -5 Solve -2m + k - 21 + 28 = 0, -3k - 3 = 0 for m. 3 Solve 3s + 3 = -4n + 4, -3s = -4n + 7 for s. -1 Solve -17 = -2k + 5u - 2, -u - 20 = 3k for k. -5 Solve -i - 4 = -3m + 4m, -4i + m = 1 for i. -1 Solve n - 3h = -10, 16 - 2 = n + 5h for n. -1 Solve -3 = -q + 4v, 24q - 19q - 5v = 0 for q. -1 Solve -y + 11m = 10m - 3, y - 9 = 3m for y. 0 Solve 3f - 4z + 8 = 22, -18 = 4f + 2z for f. -2 Solve 32r - 31r - 16 = -4u, 5r = -5u + 20 for r. 0 Solve -n + 20 = 4y, -y + 4n = -0 - 5 for y. 5 Solve -3 = -4g + 3y, -2g + 5 = -4y + 1 for g. 0 Solve 3c + 12n - 14n = 3, 2n + 1 = c for c. 1 Solve 0 = -5d + o - 14 + 25, -4o = 3d - 2 for d. 2 Solve 6p = -b + 2p + 17, 0 = -4b + 4p - 12 for b. 1 Solve -12 = -2j + 3m, -2j + 3m - 6m - 12 = 0 for j. 0 Solve 14 = -2a + 4x, 4a + 0x + 23 = 3x for a. -5 Solve 5l - 13 = p, 0 = 4l - 20p + 16p - 20 for l. 2 Solve 4j = -2a + 6a + 8, 3j - 16 = 5a for a. -5 Solve 213v - 217v = c + 14, -2 = c + v for c. 2 Solve 245i + 2b + 6 = 240i, -5i + 9 = -3b for i. 0 Solve -4a - 2i = 8, 3i + 13 = -4a + 3 for a. -1 Solve -b - b = -3x - 6, -2x - 2b = -6 for x. 0 Solve -2y - 3s = -20, 4s = y + 16 - 4 for y. 4 Solve 10 = -4a + 2l + 4, 1 = -2a + 3l for a. -2 Solve 4l - 2 = 2s + 12, 2s - 2l = -2 for s. 5 Solve 5y + 4 = -t - 14, -y = -5t + 14 for t. 2 Solve 0 = -4u + 3r + 14, -3r + 1 = u + 5 for u. 2 Solve 0 = -2x + 5b - 27, -101 = 4x - 3b - 68 for x. -6 Solve 3v = -3d, 4d - 6 = 14 for v. -5 Solve 3f + l - 7 = 0, 6l + 3 = 2f + 7l for f. 4 Solve -c + 7 = 4w + 2, 0 = 2c + 6 for w. 2 Solve 8 = 4q, -46 = -5t - 4q - 53 for t. -3 Solve -k - 62t = -59t - 3, -4k - 8 = 2t for k. -3 Solve -f - 18 = -5q, -5f + 11 = 5q - 19 for q. 4 Solve 2y - 4 = 6o - 4o, -8 = -y - 5o for y. 3 Solve -9 = 3r - 2j, 5r - j = -18 + 3 for r. -3 Solve -3v - 13 = -7v - 3h, 15 = 4v + h for v. 4 Solve 3i - 6 = 0, 0 = 3t + 2i + 3 - 7 for t. 0 Solve 0 = -2x + 2, 180 - 191 = -3p + x for p. 4 Solve 2x - 15 = -5k, 5k - 28 + 13 = 0 for x. 0 Solve 0 = 4u - 12, 3y + 2u = 5u - 9 for y. 0 Solve 0 = 5v + 3j - 10, j + 7 + 3 = 5v for v. 2 Solve 0 = 5p - 3m - 9, 10 = -5p + m + 23 for p. 3 Solve -3 = 3n, 5j + 3n + 8 = -10 for j. -3 Solve 5j - f = -4 - 11, 26 = -3j + 4f for j. -2 Solve 0 = -0l + 4l + 3r - 15, 2l - 4 = 2r for l. 3 Solve -2d = -2z + 2, 38z = -5d + 36z + 30 for d. 4 Solve 4v = 5r - r - 16, 5r - 30 = -5v for r. 5 Solve -3u - 4n - 12 = 0, 2u + 4n = 5u - 12 for u. 0 Solve 5t + 0 = -y + 15, -5t + 20 = 2y for y. 5 Solve 2i - 5d + 9d + 10 = 0, 5d + 19 = 4i for i. 1 Solve 3d + 9j - 12j = 21, -2j = 3d - 1 for d. 3 Solve -4w + 4 = -3u, -u = 4w - 16 + 12 for w. 1 Solve 4f + 3o + 33 - 48 = 0, -5o + 5 = 0 for f. 3 Solve -22t - 2k = -23t - 8, -t + 5k = 14 for t. -4 Solve 3g + 3h = -3 - 0, -4h = -3g - 10 for g. -2 Solve -5n = 2w + 9, -n - 5w + 0 = -12 for n. -3 Solve -5x = 3u + 13, -u = 3u - x + 2 for u. -1 Solve 4a - 4u = 0, -a = -2u + 4u + 3 for a. -1 Solve 2f + 4l - 10 = f, 5l - 20 = -5f for f. 2 Solve -3w - 10 = 5z + 6, 0 = -5z - 10 for w. -2 Solve -2b + 4 = -5a, 4b - 20a = -15a - 2 for b. -3 Solve -3d = 2f - 5, 5f = f + 4d for f. 1 Solve 0 = 4g + 3a - 6a - 24, a = 5g - 19 for g. 3 Solve -4u = 5m - 12, -2u = 2m - 0 - 6 for m. 0 Solve -5p + 19 = 4d - 10p, 7 = -2d - 3p for d. 1 Solve -2g = 3u + 7, -2g + 0 = -3u - 11 for u. -3 Solve -4l + 3x - 16 = 0, l + 5 + 4 = 2x for l. -1 Solve t - 2s = -2, -5t + 3 + 5 = -s for t. 2 Solve 0 = -2z + 3o - 10, -5z + 10o = 6o + 11 for z. 1 Solve -a = 2a - 4g - 29, 0 = a - 2g - 13 for a. 3 Solve 0 = 2b - 5g - g - 6, -b = -2g - 3 for b. 3 Solve -11l + 15l - o = -18, 0 = l - o + 3 for l. -5 Solve 3d - 36f + 1 = -38f, 9 = -5d + 4f for d. -1 Solve 0 = p + 3l - 20 + 14, -2 = 3p - l for p. 0 Solve -4z - 20 = 0, -8d + 4z + 30 = -10d for d. -5 Solve 0 = -o - 2, 2o + 30 = -8m + 7o for m. -5 Solve 3z + a = -2z, 3a = -2z for z. 0 Solve 2j - 4v = 6, 3j - 5v - 1 = -3v for j. -1 Solve -2u - 7 = p + 3u, u + 17 = 5p for p. 3 Solve -2c = -2z - 2, -2c + 7 = z - 4 for z. 3 Solve -4c - 2 = 3p, -3p - 10 = 11c - 15c for p. -2 Solve -17 = 5k - o, 2k = 3k - 2o + 7 for k. -3 Solve -4y = y - 5, -2c = y - 1 for c. 0 Solve 25 = -5r, t - 5r - 29 = 2t for t. -4 Solve 3d - 4b - 3 + 22 = 0, 4d = 3b - 16 for d. -1 Solve -4m - 5r = 13, m = 3r - 4r - 3 for m. -2 Solve 8x - 4x = -3t + 23, 10 = 3x - 5t for x. 5 Solve 6 = 5j - 3y - 20, -3j + y + 14 = 0 for j. 4 Solve -2u = 3l - 3, l - 2l = -5u - 18 for l. 3 Solve -w = 2m + m + 20, -3m - 35 = 4w for w. -5 Solve -2p - m = 6, 5p + 4m = 2p - 14 for p. -2 Solve -2p - 2r = -2, 17p - 13p - 2r + 20 = 0 for p. -3 Solve -15 = -3o + 3f + 6, -f = -3o + 11 for o. 2 Solve 10i - 5i + k = -3, 0 = -3k + 6 for i. -1 Solve -5o - 4z - 16 = 0, -2o + 5o + 5z = -7 for o. -4 Solve 4y = -d - 0d + 11, 0 = -4d + 12 for y. 2 Solve -3u - 3h = 17 - 26, -h + 2 = 0 for u. 1 Solve 0 = 2r + 45d - 42d - 7, 3r + 3d = 9 for r. 2 Solve 1 = 3m - 5g + 26, -7 = 3m + 4g for m. -5 Solve b - 12 = 4u + 8, 0 = -4b - u - 22 for b. -4 Solve -4i = 5n + 9, -12i + 7i - 6 = n for i. -1 Solve m = -4f, 2m + 12 = 5f - 1 for m. -4 Solve -3s = -3t, -4s + 12 = 5t - 15 for t. 3 Solve -37f + 33f = 0, 0 = 2j - 2f for j. 0 Solve t - 10 + 9 = m, 2m - 5 = -5t for m. 0 Solve 3w + 12 = 0, w - 4 = b + 3w for b. 4 Solve 5c = -5t, c + 4t = -t for c. 0 Solve -5v + 6 = -n - 8, 0 = 2v - 4 for n. -4 Solve 4c + 0 = v - 2, 3c + 13 = -5v for v. -2 Solve -3q = 2n, 30q = 4n + 29q for n. 0 Solve 4t - 12 = -6s + 2s, 0 = 3s - t - 1 for s. 1 Solve 0 = -q - 3z - 2 + 3, -4q - 4z + 4 = 0 for q. 1 Solve 0 = 2u - 5l + 573 - 589, 10 = -5l for u. 3 Solve 0 = l + 3z - 1, 3z = l - 0z - 1 for l. 1 Solve n = 3t + 8, -3n - 2 - 10 = 3t for t. -3 Solve s = -3r + 6 + 8, 6 = 3r - 3s for r. 4 Solve -4c = -z + 29 - 9, 3z - 2c - 10 = 0 for z. 0 Solve -g = -4d - 17, 0 = 4d - 3 + 15 for g. 5 Solve 0 = -p + 2p, 0 = -q - 3p + 3 for q. 3 Solve 8p + 3 = a + 4p, 3a = -5p + 9 for a. 3 Solve -4q - 118w + 20 = -116w, 10 = 2q - 5w for q. 5 Solve 3t = 5y + 37, 9 - 5 = -4t - 4y for t. 4 Solve 0 = 3l - 4i + 11, 21 = -4l - 3i + 2i for l. -5 Solve 0s + 4l + 9 = 5s, -s - 3 = -2l for s. 5 Solve 0 = 4p + t + 9, -4t + 20 - 31 = -9p for p. -1 Solve 2u = 4w - 2u, 4u = -w + 25 for w. 5 Solve -2p = -2h + h - 6, 3h + 13 = 5p for h. 4 Solve 8 = 4f + 4x, 6f - 9 = 2f - 5x for f. 1 Solve 2i - 6 = -4h, 4i + 7 + 1 = -3h for i. -5 Solve -213d + 214d = 2t - 3, 3d + 4t - 11 = 0 for d. 1	{ "pile_set_name": "DM Mathematics" }
= u - 1, 0u - 9 = -5s - u. Determine w, given that -9/2 - 3/2ws - 6w = 0. -3, -1 Suppose -j = -4 - 3. Let m = j - 5. What is p in -mp5 - 3p*4 + 3p*5 + 4p4 = 0? -1, 0 Let h be 1 + -3 + -3 + 1. Let r = 6 + h. Factor -1 + o5 + o + 0o4 + 5o*r - 3o2 - o4 - 2o3. (o - 1)3(o + 1)*2 Suppose 24 = 16a - 40. Determine n so that -13/2n2 - 137/4n*3 + 9n + 42na - 49/4n5 + 2 = 0. -2/7, 1, 2 Let b = -9 - -11. Let m(o) = -o2 - 7o - 4. Let j be m(-6). Let 2h*3 - 5h*3 + jh3 + hb = 0. Calculate h. 0, 1 Let c(r) be the second derivative of r5/130 - r4/39 + r*3/39 - 16r. Solve c(q) = 0 for q. 0, 1 Let p(c) be the third derivative of -c6/120 + c5/20 - c*3/6 + 9c*2. Let i(v) be the first derivative of p(v). Suppose i(x) = 0. Calculate x. 0, 2 Let 0 - 1/4c - 1/4c2 = 0. Calculate c. -1, 0 Let l(n) be the first derivative of n6/8 + 7n*5/20 + 5n4/16 + n3/12 - 3. Factor l(x). x*2(x + 1)*2(3x + 1)/4 Let -21/5s*2 + 9s - 27/5 + 3/5s3 = 0. What is s? 1, 3 Let f(l) be the first derivative of -5l9/3024 - l8/240 - l*7/420 + 2l3 + 9. Let r(k) be the third derivative of f(k). Let r(n) = 0. Calculate n. -1, -2/5, 0 Let h(q) be the first derivative of q6 + 28q5/5 + 11q*4 + 8q3 - q2 - 4q - 7. Factor h(i). 2(i + 1)*3(i + 2)(3i - 1) Let i = 73/324 - -2/81. Let w(c) be the third derivative of 0c - 3c*2 + 0 - 1/2c*4 + ic*5 + 3/40c*6 - 2c*3. Factor w(u). 3(u - 1)(u + 2)(3u + 2) Factor 6/5m*3 - 3/5m + 0m2 + 0 + 0m*4 - 3/5m*5. -3m(m - 1)2(m + 1)2/5 Let -1/2 + v2 - 1/2v4 + 0v*3 + 0v = 0. What is v? -1, 1 Solve -f + 0f + 2f*2 - 3f + 2 = 0 for f. 1 Let u(w) = -w*3 + 7w*2 + 4w. Let s(g) = -g*3 + 13g*2 + 7g. Let z(v) = 4s(v) - 7u(v). Let z(p) = 0. Calculate p. -1, 0 Factor -4w - 4w*2 + 24 + 4w*3 + 20 + 4w*4 - 44. 4w(w - 1)(w + 1)2 Let i(d) be the first derivative of -d4/4 + d*3 + 9d*2/2 - 2d + 3. Let y(s) be the first derivative of i(s). Factor y(p). -3(p - 3)(p + 1) Let y(x) be the first derivative of -x*6/12 - 6x*5/5 - 27x*4/4 - 18x*3 - 81x*2/4 + 5. Factor y(f). -f(f + 3)*4/2 Let g(h) be the second derivative of 0 - 8/3h*3 + 81/40h*5 - 15/8h4 - h2 - 2h. Find o such that g(o) = 0. -2/9, 1 Let x(m) be the third derivative of m6/40 - 7m*4/8 - 3m*3 - 7m*2. Factor x(h). 3(h - 3)(h + 1)(h + 2) Let l(q) be the first derivative of -q*6/18 - 2q*5/15 + 2q3/9 + q2/6 + 1. Factor l(a). -a(a - 1)(a + 1)3/3 Let k(g) be the first derivative of g4/24 - g3/6 + g2/4 - g/6 - 8. Factor k(w). (w - 1)*3/6 Suppose -5n + 15 = 5v, 5v = 2n - 5n + 5. Let y(k) be the second derivative of 1/12k4 + 0 + 1/6k*2 - k + 1/6k*3 + 1/60kn. Factor y(w). (w + 1)3/3 Suppose 23 = 4f + 3x, -9 = 4f - 3x - 2. Let z be (-4)/(-3) + 22/6. Factor 1/4mz + 1/4m*4 - 1/4m*f + 0 - 1/4m*3 + 0m. m*2(m - 1)(m + 1)2/4 Let v = 839/40 - 108/5. Let j = -3/8 - v. Solve 1/2c*3 + 1/2c*2 - jc*4 - 1/4c - 1/4c5 - 1/4 = 0. -1, 1 Suppose -40m = -28m - 24. Suppose 1/3i*3 + 4i - 2im - 8/3 = 0. Calculate i. 2 Let t be 9 - (18 + -12)1/2. Let u(k) be the third derivative of -1/9k3 + k2 + 0k - 1/9k4 + 0 - 1/45k*t - 1/315k*7 - 1/15k*5. Factor u(h). -2(h + 1)*4/3 Let j = 23/8 + -17/8. Factor -3/4r*2 - 3/4r + 3/4r3 + j. 3(r - 1)*2(r + 1)/4 Let w be (-3 - 0)/(-3) - -2. Let r = w - 3. Factor 0x + 1/3x2 + r + x3 + 2/3x4. x2(x + 1)(2x + 1)/3 Let x = 5 - 5. Find m, given that m + 16m5 + m - 14m*5 + xm - 4m3 = 0. -1, 0, 1 Let r(z) be the first derivative of z4/14 - 4z*3/7 + 9z*2/7 - 8z/7 - 5. Factor r(j). 2(j - 4)(j - 1)*2/7 Let z = -42/59 - -2933/3540. Let w(f) be the third derivative of -1/40f*6 - 1/3f*3 + 0f + 0 + 1/8f4 - 3f*2 + zf*5 - 1/42f*7. Factor w(d). -(d - 1)(d + 1)*2(5d - 2) Let u(w) be the third derivative of -w6/900 + w5/150 - w4/60 + w3/2 + 3w*2. Let y(b) be the first derivative of u(b). Let y(m) = 0. What is m? 1 Let b be (-28)/(-10) + ((-84)/30 - -3). Factor 0o - 1/4o2 + 3/4ob + 0. o2(3o - 1)/4 Let -8 + 8g2 + 4g*3 - 2g*2 + 2g*2 - 4g = 0. Calculate g. -2, -1, 1 Let i(k) = -22k2 + 26k + 12. Let c be ((-36)/15)/(3/(-10)). Let b(z) = 15z2 - 17z - 8. Let x(t) = cb(t) + 5i(t). Factor x(u). 2(u - 1)(5u + 2) Suppose r = 5j + 14, 4r + 3j = -r + 14. Factor -62d2 - 1 + 2d - rd + 61d2. -(d + 1)2 Let g(p) be the first derivative of p*6/9 - 2p5/5 + p4/2 - 2p3/9 + 5. Factor g(z). 2z*2(z - 1)*3/3 Suppose -4j = -14 + 2. What is w in 4w4 + jw*3 + 3 + 2w*4 - 3 + 3w*5 = 0? -1, 0 Let u(v) be the first derivative of -3v*5/5 + 3v*4/4 + 2v*3 + 2. Suppose u(q) = 0. What is q? -1, 0, 2 Suppose -2p - 3p = 0. Suppose 0 = 2h - 3a - 23, p = -8h + 3h - a + 15. Factor -j3 - 2j3 - jh + 2j3. -j3(j + 1) Suppose 44m4 - 78m*3 - 8m*5 - 22m + 29m2 - 7m*2 + 3 + 39m*2 = 0. Calculate m. 1/2, 1, 3 Solve 3/2j - 3/4 - 3/4j2 = 0. 1 Let d(o) be the second derivative of o4/12 - 4o*3/3 + 8o*2 + 3o. Let d(q) = 0. What is q? 4 Factor 16/3v - 32 - 2/9v*2. -2(v - 12)2/9 Let l(v) be the first derivative of v6/24 + v5/10 - v4/8 - v3/3 + v2/8 + v/2 + 6. Find j, given that l(j) = 0. -2, -1, 1 Suppose -48 - 142g + 4g*2 - 151g + 309g = 0. Calculate g. -6, 2 Suppose 1/5u*3 + 0u*2 + 0u + 0 = 0. Calculate u. 0 Find f such that -3/5f2 + 3/5 + 0f = 0. -1, 1 Let n be (18/10)/((-2)/(-30)). Factor 2a4 + a2 - 8 - na*2 + 10a*3 - 22a*3 - 24a - 4a4. -2(a + 1)*2(a + 2)2 Let b(h) be the third derivative of h8/2856 + 4h7/1785 + h6/170 + 2h5/255 + h4/204 + 5h2. Factor b(k). 2k(k + 1)4/17 Let c(m) = -m - 6. Let s be c(-7). Let h = -1 + s. Factor 0n - 2n + n2 + hn + 1. (n - 1)*2 Suppose -4y + 0y + 12 = 0. Factor 0k*2 - 2k*4 + 4k - k*5 + 6k*y - 5k*2 + 15k2 - k5. -2k(k - 2)(k + 1)3 Let i(v) be the first derivative of 6v*5/25 - 27v*4/20 + 12v*3/5 - 6v*2/5 - 15. Suppose i(t) = 0. Calculate t. 0, 1/2, 2 Let k = -11 - 1. Let w = 12 + k. Factor 3/4q*2 + w - 1/2q. q(3q - 2)/4 Let q(g) be the second derivative of 0 - 3/20g5 + 3/2g*3 + 3g*2 + g + 0g*4. Suppose q(x) = 0. Calculate x. -1, 2 Let c = -65 - -65. Factor 5/2a*3 + 0 + ca - 1/2a2. a2(5a - 1)/2 Determine d, given that -16d*2 - 7d - 7d + 2d*5 + 4d*4 - 6 - 4d3 + 2 = 0. -1, 2 Let u(i) = i2 + i - 27. Let o be u(0). Let g be 1/((-3)/(o/3)). Let -h*g + 2 - 2h*2 + 2h + 0h3 - h3 = 0. Calculate h. -1, 1 Let l be 100/12 - (-2)/3. Suppose -p3 + 6p*2 - lp*4 + 6p4 + p3 - 3 = 0. Calculate p. -1, 1 Let l = 13 + -26. Let w(g) = -15g2 + 21g + 7. Let o(i) = -7i2 + 10i + 3. Let v(x) = lo(x) + 6w(x). Determine h so that v(h) = 0. 1, 3 Suppose -5y = 2t - 29, 0 = -7t + 3t - y + 13. Solve 5zt - 3z*2 + 2z*2 - 16z + 11 + 5 = 0. 2 Let j = -47 - -50. Suppose 0p = -p + j. Factor 0 + 1/2ap + a2 + 1/2a. a(a + 1)*2/2 Let j(z) = 8z*3 + 3z2. Let h(p) = p2 - 8p + 1. Let k be h(6). Let s(y) = 3y3 + y2. Let f(r) = ks(r) + 4j(r). Factor f(m). -m*2(m - 1) Let m be 4 + 3/(-9)0. Suppose n = mn - 12. Factor no2 - 2o*2 - 4o*2 - 4o. -2o(o + 2) Let l = 26 - 22. Suppose -lk + 7k = 0. Factor 0w2 + 0 + 0w*3 - 1/5w*4 + kw. -w*4/5 Let d(o) be the first derivative of -9o*6/10 + 117o*5/25 - 6o*4 + 12o*3/5 + 4. Factor d(v). -3v*2(v - 3)(3v - 2)*2/5 Find o, given that 10o*4 + 10o*2 + 0 + 0o - 5/3o5 - 55/3o*3 = 0. 0, 1, 2, 3 Let n(b) be the second derivative of 0 - 1/180b*6 + 1/20b*5 + 2/3b*3 + 0b*2 - b - 1/6b4. Let l(g) be the second derivative of n(g). Solve l(j) = 0. 1, 2 Let l(r) be the second derivative of r6/135 - 2r5/45 - r4/54 + 4r*3/27 - 51r. Factor l(w). 2w(w - 4)(w - 1)(w + 1)/9 Let d be (2/(-6))/(2/(-114)). Let h = d + -19. Find u, given that -1/4u2 + 1/4u*3 + h + 0u = 0. 0, 1 Let i be -1 + -1 - (-75)/15. Let y(b) be the third derivative of -1/120b6 + b2 + 0 + 0b*4 + 0b + 0bi - 1/60b*5. Let y(s) = 0. Calculate s. -1, 0 Suppose 2	{ "pile_set_name": "DM Mathematics" }
Calculate prob of picking 2 m and 2 u when four letters picked without replacement from {u: 3, q: 3, n: 2, m: 5, p: 2}. 2/91 Three letters picked without replacement from mqmccaqcqqt. What is prob of picking 1 q, 1 a, and 1 c? 4/55 Calculate prob of picking 1 o, 1 a, 1 k, and 1 h when four letters picked without replacement from kooauaouhuokuuuu. 4/455 Four letters picked without replacement from {z: 2, q: 4, w: 7}. Give prob of picking 1 w and 3 q. 28/715 What is prob of picking 3 n when three letters picked without replacement from {n: 6, q: 6}? 1/11 Two letters picked without replacement from lylllly. Give prob of picking 2 l. 10/21 Calculate prob of picking 2 q and 1 c when three letters picked without replacement from nccnqnnnnnnnqn. 1/182 What is prob of picking 2 p and 2 r when four letters picked without replacement from rprpppp? 2/7 What is prob of picking 2 m and 1 a when three letters picked without replacement from {a: 6, o: 2, s: 2, f: 3, m: 3}? 9/280 Four letters picked without replacement from {j: 2, z: 3}. What is prob of picking 2 z and 2 j? 3/5 Calculate prob of picking 1 d, 1 i, and 1 q when three letters picked without replacement from {y: 2, f: 1, i: 4, d: 1, q: 1}. 1/21 Three letters picked without replacement from {s: 1, q: 2, t: 2}. Give prob of picking 2 t and 1 s. 1/10 Two letters picked without replacement from llllulluuulllullll. What is prob of picking 2 u? 10/153 Three letters picked without replacement from kyyykykkkkykkyykyky. What is prob of picking 2 y and 1 k? 120/323 What is prob of picking 2 q, 1 t, and 1 e when four letters picked without replacement from eqtmqgs? 1/35 Calculate prob of picking 1 w and 3 p when four letters picked without replacement from {a: 2, w: 3, p: 3}. 3/70 What is prob of picking 2 b and 1 d when three letters picked without replacement from {b: 3, q: 2, d: 1, o: 2, t: 3, v: 7}? 1/272 What is prob of picking 3 d and 1 y when four letters picked without replacement from {d: 3, x: 1, j: 4, y: 3}? 1/110 Calculate prob of picking 1 q and 1 w when two letters picked without replacement from {q: 1, w: 12}. 2/13 Two letters picked without replacement from {x: 1, f: 5, d: 2, y: 4, e: 2, k: 1}. Give prob of picking 1 f and 1 k. 1/21 What is prob of picking 1 u and 1 g when two letters picked without replacement from {z: 1, r: 4, u: 2, g: 2, d: 1}? 4/45 Two letters picked without replacement from {v: 8, p: 3}. What is prob of picking 1 p and 1 v? 24/55 Calculate prob of picking 1 v and 1 j when two letters picked without replacement from {g: 4, u: 9, o: 4, j: 1, v: 1}. 1/171 What is prob of picking 2 p when two letters picked without replacement from {p: 9, q: 5}? 36/91 Two letters picked without replacement from nbllclqqdlbbddcqd. What is prob of picking 2 l? 3/68 Calculate prob of picking 1 f and 1 c when two letters picked without replacement from cnfcfncnnccnjcnccc. 2/17 Three letters picked without replacement from mmmmmmmmmmmmmmummmm. Give prob of picking 3 m. 16/19 Four letters picked without replacement from {e: 2, c: 1, w: 1, b: 3, q: 6}. Give prob of picking 1 q, 1 c, and 2 w. 0 What is prob of picking 1 z and 2 h when three letters picked without replacement from {h: 3, j: 5, z: 1}? 1/28 What is prob of picking 1 q and 1 j when two letters picked without replacement from {g: 2, q: 3, j: 4}? 1/3 Calculate prob of picking 3 c and 1 q when four letters picked without replacement from qcqqccqqqcqqqqqcccq. 35/323 Two letters picked without replacement from qmqrhqr. What is prob of picking 1 h and 1 r? 2/21 Two letters picked without replacement from rnfdkffrfdrfkfdlk. What is prob of picking 2 r? 3/136 Four letters picked without replacement from gvggvkktvvdvdgduuv. What is prob of picking 2 k and 2 g? 1/510 Two letters picked without replacement from slblkttttkbtttt. What is prob of picking 1 b and 1 t? 16/105 What is prob of picking 2 f and 2 x when four letters picked without replacement from qqooxoxofxqqffx? 6/455 What is prob of picking 1 x and 1 h when two letters picked without replacement from {x: 2, h: 4, w: 1}? 8/21 Four letters picked without replacement from {s: 3, a: 3, b: 2}. What is prob of picking 1 b, 1 a, and 2 s? 9/35 Calculate prob of picking 1 g and 1 b when two letters picked without replacement from cgccbggg. 1/7 What is prob of picking 3 u and 1 r when four letters picked without replacement from uvuuuuurrruruvuuuv? 11/51 Four letters picked without replacement from {b: 1, v: 2, a: 1, h: 1}. What is prob of picking 2 v, 1 b, and 1 h? 1/5 Calculate prob of picking 3 v when three letters picked without replacement from ovvoooooooooovvovooo. 1/114 Four letters picked without replacement from fgxxgxxf. Give prob of picking 2 f and 2 x. 3/35 Calculate prob of picking 1 b, 1 x, and 1 w when three letters picked without replacement from wbwwxwbwbbb. 5/33 Four letters picked without replacement from sizhzhspspszsfispp. Give prob of picking 2 i, 1 z, and 1 h. 1/510 Calculate prob of picking 1 a, 2 b, and 1 h when four letters picked without replacement from {b: 2, h: 1, f: 1, c: 1, j: 1, a: 1}. 1/35 Three letters picked without replacement from essseseseeesseesess. Give prob of picking 1 s and 2 e. 120/323 What is prob of picking 1 m and 2 p when three letters picked without replacement from mppmpmpmmrm? 12/55 Three letters picked without replacement from wjjhjzzzzzzzwzzzhhjj. Give prob of picking 3 j. 1/114 Four letters picked without replacement from errerrrrrmerrrmrrr. Give prob of picking 2 m and 2 e. 1/1020 What is prob of picking 3 n when three letters picked without replacement from {n: 7}? 1 Calculate prob of picking 3 v when three letters picked without replacement from vvvqqvv. 2/7 What is prob of picking 1 k and 2 n when three letters picked without replacement from fkfnkffcnnffk? 9/286 Four letters picked without replacement from {h: 1, g: 2, u: 2, f: 1, p: 5, q: 4}. What is prob of picking 1 f, 2 q, and 1 g? 4/455 Calculate prob of picking 1 l, 2 e, and 1 w when four letters picked without replacement from oleclwcolczclww. 0 What is prob of picking 2 o and 2 s when four letters picked without replacement from {o: 12, s: 6}? 11/34 Four letters picked without replacement from {p: 6, t: 3, b: 6}. Give prob of picking 3 p and 1 b. 8/91 Four letters picked without replacement from zzzmpllpppzzllzmzm. What is prob of picking 3 z and 1 p? 7/153 What is prob of picking 2 n when two letters picked without replacement from {y: 7, n: 2, f: 3}? 1/66 Calculate prob of picking 2 o when two letters picked without replacement from {m: 3, o: 15}. 35/51 Three letters picked without replacement from eekmejeee. What is prob of picking 1 j and 2 k? 0 Four letters picked without replacement from {p: 1, d: 1, x: 5, a: 2, c: 3, q: 3}. Give prob of picking 1 c, 1 p, and 2 d. 0 Calculate prob of picking 1 y and 1 m when two letters picked without replacement from {m: 1, y: 2, z: 1}. 1/3 What is prob of picking 4 h when four letters picked without replacement from hlhhhlc? 1/35 Three letters picked without replacement from mttodqiqd. What is prob of picking 1 m and 2 q? 1/84 What is prob of picking 1 n, 1 k, and 1 c when three letters picked without replacement from enxkc? 1/10 Calculate prob of picking 1 n and 1 x when two letters picked without replacement from lnulghhxlxlg. 1/33 Three letters picked without replacement from bjqvqvqrqirqvvr. Give prob of picking 1 b, 1 j, and 1 v. 4/455 Two letters picked without replacement from ysksavg. Give prob of picking 1 k and 1 g. 1/21 Two letters picked without replacement from {p: 12, f: 1, m: 5}. What is prob of picking 1 p and 1 f? 4/51 Calculate prob of picking 1 l and 3 r when four letters picked without replacement from rlrrllrlrhhrrlrh. 2/13 Calculate prob of picking 3 l and 1 o when four letters picked without replacement from clzcclluozlzbz. 4/1001 What is prob of picking 1 g and 1 d when two letters picked without replacement from dfdgeewdwwwed? 2/39 Calculate prob of picking 3 q and 1 d when four letters picked without replacement from ddddqddqdqqddd. 40/1001 Two letters picked without replacement from iiiiiqiqiii. Give prob of picking 2 q. 1/55 What is prob of picking 3 s when three letters picked without replacement from as	{ "pile_set_name": "DM Mathematics" }
of 1642761. 3, 17, 1193 What are the prime factors of 7637420? 2, 5, 7, 17, 3209 List the prime factors of 6410395. 5, 1282079 List the prime factors of 2776453. 31, 89563 What are the prime factors of 146222? 2, 113, 647 List the prime factors of 736361. 736361 List the prime factors of 1409649. 3, 61, 7703 What are the prime factors of 2624612? 2, 656153 What are the prime factors of 1489838? 2, 7, 106417 What are the prime factors of 21128660? 2, 5, 7, 150919 List the prime factors of 5179339. 11, 17, 27697 What are the prime factors of 6285873? 3, 11, 67, 2843 What are the prime factors of 1184422? 2, 19, 71, 439 What are the prime factors of 649803? 3, 7, 11, 29, 97 What are the prime factors of 8007175? 5, 11, 2647 List the prime factors of 8638. 2, 7, 617 What are the prime factors of 13980453? 3, 4660151 List the prime factors of 784005. 3, 5, 52267 List the prime factors of 330836. 2, 11, 73, 103 What are the prime factors of 851162? 2, 13, 19, 1723 List the prime factors of 1004121. 3, 31, 59, 61 List the prime factors of 2458426. 2, 1229213 List the prime factors of 20314500. 2, 3, 5, 29, 467 What are the prime factors of 2789958? 2, 3, 464993 What are the prime factors of 3544346? 2, 13, 23, 5927 What are the prime factors of 818437? 61, 13417 List the prime factors of 5149192. 2, 643649 What are the prime factors of 4403232? 2, 3, 15289 List the prime factors of 2944405. 5, 588881 What are the prime factors of 598275? 3, 5, 2659 List the prime factors of 136400. 2, 5, 11, 31 List the prime factors of 9363279. 3, 173, 18041 List the prime factors of 9271898. 2, 23, 353, 571 List the prime factors of 1000756. 2, 17, 14717 What are the prime factors of 22810854? 2, 3, 11, 31, 11149 List the prime factors of 27994654. 2, 13997327 What are the prime factors of 742941? 3, 82549 List the prime factors of 2910595. 5, 582119 What are the prime factors of 17357266? 2, 257, 33769 List the prime factors of 2277455. 5, 455491 What are the prime factors of 452295? 3, 5, 19, 23 What are the prime factors of 3182659? 3182659 What are the prime factors of 3306437? 19, 101, 1723 List the prime factors of 352167. 3, 117389 List the prime factors of 24531055. 5, 179, 27409 List the prime factors of 1247100. 2, 3, 5, 4157 What are the prime factors of 5635061? 617, 9133 What are the prime factors of 2236435? 5, 17, 83, 317 List the prime factors of 15491286. 2, 3, 83, 10369 List the prime factors of 459521. 459521 List the prime factors of 786300. 2, 3, 5, 2621 List the prime factors of 22427325. 3, 5, 263, 379 What are the prime factors of 420884? 2, 43, 2447 What are the prime factors of 868097? 83, 10459 What are the prime factors of 1257301? 599, 2099 What are the prime factors of 685513? 685513 What are the prime factors of 228823? 7, 97, 337 What are the prime factors of 1094233? 7, 156319 List the prime factors of 241625. 5, 1933 List the prime factors of 33875. 5, 271 What are the prime factors of 2833812? 2, 3, 19, 1381 List the prime factors of 691971. 3, 7, 83, 397 List the prime factors of 16616617. 16616617 List the prime factors of 6438134. 2, 3219067 List the prime factors of 190978. 2, 17, 41, 137 List the prime factors of 6174339. 3, 157, 13109 List the prime factors of 6815380. 2, 5, 11, 13, 2383 What are the prime factors of 135167? 17, 7951 What are the prime factors of 223371? 3, 8273 List the prime factors of 125581. 31, 4051 What are the prime factors of 1706135? 5, 341227 What are the prime factors of 41600? 2, 5, 13 List the prime factors of 31166. 2, 15583 List the prime factors of 26004. 2, 3, 11, 197 List the prime factors of 692961. 3, 101, 2287 What are the prime factors of 8015141? 8015141 List the prime factors of 1817542. 2, 908771 List the prime factors of 2209387. 419, 5273 What are the prime factors of 9277540? 2, 5, 307, 1511 List the prime factors of 970258. 2, 17, 28537 List the prime factors of 7550232. 2, 3, 41, 7673 List the prime factors of 6909275. 5, 276371 List the prime factors of 5238198. 2, 3, 7, 5939 List the prime factors of 1188171. 3, 132019 List the prime factors of 4678889. 29, 161341 List the prime factors of 2397562. 2, 131, 9151 What are the prime factors of 1234267? 47, 26261 What are the prime factors of 5772206? 2, 11, 59, 4447 List the prime factors of 154661. 13, 11897 What are the prime factors of 1663477? 1663477 What are the prime factors of 145670? 2, 5, 7, 2081 List the prime factors of 14049950. 2, 5, 487, 577 What are the prime factors of 378621? 3, 37, 379 What are the prime factors of 108204? 2, 3, 71, 127 What are the prime factors of 19096996? 2, 4774249 List the prime factors of 23207540. 2, 5, 29, 40013 What are the prime factors of 2930635? 5, 53, 11059 What are the prime factors of 2176412? 2, 7, 19, 4091 List the prime factors of 2781024. 2, 3, 59, 491 List the prime factors of 7303323. 3, 2434441 What are the prime factors of 3201023? 7, 65327 List the prime factors of 16996526. 2, 19, 313, 1429 What are the prime factors of 899098? 2, 449549 What are the prime factors of 315649? 83, 3803 What are the prime factors of 27531? 3, 7, 19, 23 List the prime factors of 713293. 7, 14557 What are the prime factors of 1145301? 3, 19, 71, 283 What are the prime factors of 220557? 3, 37, 1987 What are the prime factors of 306720? 2, 3, 5, 71 List the prime factors of 4564096. 2, 181, 197 List the prime factors of 2113714. 2, 41, 149, 173 List the prime factors of 539324. 2, 73, 1847 What are the prime factors of 1170443? 1170443 What are the prime factors of 532987? 7, 13, 5857 List the prime factors of 263552. 2, 29, 71 What are the prime factors of 2556469? 19, 197, 683 List the prime factors of 299601. 3, 33289 What are the prime factors of 695076? 2, 3, 57923 What are the prime factors of 5185085? 5, 17, 61001 What are the prime factors of 176294? 2, 181, 487 What are the prime factors of 2823584? 2, 88237 List the prime factors of 10976900. 2, 5, 11, 17, 587 List the prime factors of 413687. 19, 21773 List the prime factors of 172625. 5, 1381 List the prime factors of 1606129. 7, 199, 1153 What are the prime factors of 39507694? 2, 17, 1161991 What are the prime factors of 3739839? 3, 43, 53, 547 List the prime factors of 717870. 2, 3, 5, 23929 What are the prime factors of 929858? 2, 151, 3079 List the prime factors of 10191805. 5, 13, 156797 What are the prime factors of 1591103? 1591103 List the prime factors of 187950. 2, 3, 5, 7, 179 What are the prime factors of 61414? 2, 30707 List the prime factors of 878687. 53, 59, 281 What are the prime factors of 19534213? 61, 431, 743 List the prime factors of 1876507. 1876507 List the prime factors of 8800057. 7, 179593 List the prime factors of 205060. 2, 5, 10253 What are the prime factors of 190417? 17, 23, 487 List the prime factors of 494519. 494519 List the prime factors of 247043. 23, 467 List the prime factors of 425636. 2, 97, 1097 What are the prime factors of 7830253? 1151, 6803 List the prime factors of 7177938. 2, 3, 1196323 List the prime factors of 478443. 3, 7, 22783 List the prime factors of 157547. 13, 12119 List the prime factors of 1985317. 1985317 List the prime factors of 5674916. 2, 13, 109133 List the prime factors of 706445. 5, 23, 6143 List the prime factors of 273050. 2, 5, 43, 127 What are the prime factors of 726723? 3, 80747 List the prime factors of 26588523. 3, 13, 103, 6619 List the prime factors of 1998711. 3, 11, 13, 1553 What are the prime factors of 10304667? 3, 23, 67, 743 List the prime factors of 1625398. 2, 812699 What are the prime factors of 77366? 2, 101, 383 What are the prime factors of 1448695? 5, 29, 97, 103 What are the prime factors of 712719? 3, 7, 419 What are the prime factors of 242380? 2, 5, 12119 What are the prime factors of 387585? 3, 5, 11, 29 What are the prime factors of 464728? 2, 11, 5281 List the prime factors of 10150071. 3, 17, 199021 List the prime factors of 3404749. 1061, 3209 What are the prime factors of 211739? 11, 19249 What are the prime factors of 23339887? 593, 39359 What are the prime factors of 3435807? 3, 1145269 List the prime factors of 460780. 2, 5, 23039 What are the prime factors of 118411? 118411 List the prime factors of 567220. 2, 5, 79, 35	{ "pile_set_name": "DM Mathematics" }
- (-284)/(-14))/(4/12). Which is the closest to -5/6? (a) -30 (b) -2/11 (c) 4/7 (d) k d Let f = 1136.9 + -1136. Let l be (-8 + 11)/((-9)/(-2)). Let k = 0.6 - -2.4. Which is the nearest to l? (a) 1/6 (b) k (c) f c Let i = -3413.4 + 3413. Which is the closest to 1? (a) i (b) -0.1 (c) -0.2 (d) 1/2 d Let w = -0.9 + -0.1. Let x be (-2 - 9) + (13 + -22 - -15). Which is the nearest to w? (a) x (b) -6/7 (c) -2/3 b Let b = -201.6 + 201.3. What is the nearest to -0.1 in 0, 8, b, -1? 0 Let h = -0.32 - -0.02. Let p(w) = 2w2 + 2w + 96. Let k be p(-9). Suppose k = -4j + 256. Which is the closest to 4/9? (a) h (b) j (c) -3 a Let b = 1 - -0.5. Let f = b + -1. Let l be (306/204)/((-6)/4). What is the nearest to -0.1 in l, -3/5, f? -3/5 Let x = -80.47 + 81. Let v = -9805.1 + 9805. Which is the nearest to v? (a) x (b) 0.3 (c) -0.1 (d) -5 c Suppose 132 = -8z - 76. Let o be 163/z + (-4 - -6). What is the closest to o in 3, 0.5, -2? 0.5 Let f = 83 - 79. Let z = -49.5 + 7.5. Let s = -41.9 - z. What is the nearest to f in s, -2, -3? s Suppose 30 = 3o - 2q, 5q + 10 + 5 = 0. Suppose 3i = i + o. Let u = 0.3 + -0.1. Which is the closest to u? (a) 0.1 (b) -0.1 (c) i a Let z = 86.7 - 86.4. Which is the nearest to 27? (a) 5 (b) z (c) 3 (d) 1 a Let m = -0.03 + 0.83. Let l = -267397/4 - -66850. Which is the closest to -1? (a) 0.3 (b) m (c) l a Let w = -0.47807 - -0.48227. What is the closest to w in 5, 2/7, -4? 2/7 Let w = 184 - 232. Let o = 51 + w. What is the nearest to -1/2 in o, 1, 3/2? 1 Suppose 5f - 3i = -25, -5f + 10 = -7f - 2i. Let p be f - 18/(-6) - 30/(-13). Which is the nearest to -2? (a) 3 (b) p (c) -4 c Suppose 0 = -3d - 6q + 11q - 21, -3d = -2q + 12. Let c be (-1 - (d + 4)) + 4425/1425. Let p = -2 - -1.5. What is the nearest to c in 4, -0.3, p? -0.3 Let k = -306.1 + 306. Let b = -9.27 + 10.27. Let x = 16 + -58/3. What is the closest to k in x, -2, b? b Suppose -443 = 264p + 2197. What is the closest to 1 in 116, p, 5, 2? 2 Let q = 135367/13 + -10413. What is the closest to 0 in q, -0.2, 0.08, -2/3? 0.08 Let t = -0.3003 - -56.3003. Let r = 81 - 27. Let j = t - r. Which is the closest to -2? (a) -3 (b) j (c) -5 a Let j = -0.3 + 0.5. Let q = -6737 + 6732. Which is the nearest to -1.1? (a) 3/7 (b) j (c) q b Let z be (7/(-42))/((-26)/52). What is the nearest to 5 in 1/6, -0.1, -2/31, z? z Let q = -0.58739 - -0.98739. Let w = -8 - -4. Which is the closest to -12? (a) 2 (b) q (c) w c Let q = 5.3 - 5. Let c = -712552.9 + 712553. What is the nearest to 0.1 in c, -5, 4, q? c Let u = 0.09 - -0.01. Let r = 0 - -0.2. Suppose 47q = -0q - 47. What is the closest to u in r, 4, q? r Let q = -8497 - -8499. What is the closest to q in -0.06, -1, -0.3, -35? -0.06 Let l(p) = -3 - 4p - 54 - 17 - 2p. Let f be l(-12). What is the closest to f in 2, -5, 2/7? 2/7 Let q be 36/(-9)3/2. Let w be q/(-3) + (4 - 240/39). What is the closest to w in -4, 5, -0.01? -0.01 Let a be ((-3)/(-5 - -2))/((-9)/108-164). What is the closest to -0.2 in 5/3, a, -1/9? -1/9 Let o = -16.7 - -27.93. Let b = o + -0.23. Let z be 16/8 + (-20)/4. What is the closest to z in 5, b, 4? 4 Let l = -6.56 - -7. Let q = l - 0.24. Let x = 10 + -18. Which is the closest to -0.1? (a) 4 (b) x (c) q c Let n = 4750.7 - 3215.8. Let b = n - 1535. Let q = 31/40 + 1/40. What is the nearest to -6 in 0.4, q, b? b Let z = -8426 - -42126/5. What is the nearest to -5 in 0.4, -1, z, -3? -3 Let q = 51 - 50.7. Suppose 5h + 2s + 9 = 0, -3s = -6h + 2h + 2. Let a be (h/(-6))/(3/9). What is the closest to a in -5/2, -2/3, q? q Let n(y) = y2 + 53y + 590. Let g be n(-16). Which is the nearest to 32? (a) 0.1 (b) 5 (c) g (d) 3 b Let x be (18 - (-525)/(-30))(-3 + 1). What is the closest to 1 in x, -64, -3? x Suppose -4v + 275 = j, -2j = -3j + 5v + 284. Let y = j - 270. Which is the nearest to 0.3? (a) -0.3 (b) -0.5 (c) y a Let h = 9 - 8. Let q = h - 0.9. Suppose -9o = -15o + 29o. What is the closest to o in q, 5, 3? q Suppose -3n = -2n + 2. Suppose 3t = -w + 141, -t + 4w = 10 - 57. Let x be (1/8)/(48 - t). What is the closest to 0.1 in x, n, -5? x Let a = 4690 + -4689.8. What is the closest to -2.5 in a, 0.5, -22, 4? a Let y be (-4)/21/(-3). Let p = 75 - 527/7. Let u = 61970 + -61970. Which is the closest to p? (a) 4 (b) y (c) u c Let h be ((-10)/(-6))/((1485/22)/27). Which is the nearest to h? (a) 9 (b) -0.01 (c) -0.08 (d) 0.3 d Let y = -6 + 5.5. Let i = 5 + 2. Let q be (16/70)/(-2)(-4)/(48/42). Which is the closest to q? (a) 1/11 (b) y (c) i a Let k = 24 + -21. Suppose 16y = 20y - 4. Let d be 4y + 266/(-56). What is the nearest to d in -4/3, k, -0.3? -0.3 Let h = -0.08 + -2.92. Let m = -513 - -421. Let t be (-1)/((-4)/336m) - -1. Which is the nearest to -2/9? (a) h (b) 1 (c) t c Let j = -2067 + 2064. Which is the closest to 11? (a) 0.5 (b) -2 (c) 1/8 (d) j a Let p = 1870 - 1854. What is the nearest to p in -1/4, 9, 1? 9 Let s be (-2382)/(-15880)(-4)/3. What is the nearest to s in 3, -41, 4, -0.3? -0.3 Let i = -34040 - -33609. What is the nearest to 0 in -1/5, i, -3/5, -3? -1/5 Let j = 5042 - 5103. What is the nearest to 1/3 in -5, j, -3/2, 5? -3/2 Let x be (-3)/(11 - 2) - (-845)/(-2535). Let g = 0.814 - -3.276. Let j = g + 0.01. What is the nearest to x in -1, -0.5, j? -0.5 Let i be (3/(-4))/(9/(-15)). Let z = -0.052 - -663.052. Let o = -659 + z. What is the closest to -1 in i, -2/13, o? -2/13 Suppose m + d + 4d = -33, 0 = 2d + 4. Let a(n) = -6n - 136. Let g be a(m). What is the closest to g in 0.5, 1, -3? 1 Let q = -0.11 - -11.11. Let z = q - 10.9. Let o = -7.6 - -7.5. Which is the closest to o? (a) -0.1 (b) z (c) 5/6 a Let q be (6(-10)/(-120))/7(-7)/2. What is the closest to -2/5 in q, 2/19, 0.05? q Let y be (-1356)/(-30)(-6)/1. Let f = y - -271. What is the closest to -3 in 1/4, -7, f? f Let f = 5828 + -58281/10. Which is the closest to 1.3? (a) 5 (b) f (c) 0 (d) 0.7 d Let w = -0.02 + 8.02. Let k = w + -7.3. Let t = 21.5 - 18.5. Which is the nearest to -0.1? (a) t (b) k (c) 0.4 c Let j(c) = c3 + 4c*2 + 3c - 2. Let r be j(-3). Let z = -17246.5 + 17247. What is the nearest to 1 in 5, z, r? z Let u = 642 - 671.1. Let x = 11.1 - u. Let r = 40 - x. Which is the nearest to r? (a) 3 (b) 3/4 (c) 0 c Let i be -3(2 - (-68)/(-33)). Let l = 191.11 - 191. Let x = -0.81 + l. Which is the nearest to -1/4? (a) i (b) -1 (c) x a Let x = 310.99 - 311. Let q = 30.5 - 23. Let m = q + -8. What is the nearest to -1 in m, x, 0.5? m Let j = 4.00954 + -0.00954. Which is the nearest to 0.1? (a) j (b) -3/4 (c) 0.3 (d) 0.24 d Let h = 3061 + -3067. Which is the closest to -3? (a) h (b) 5 (c) -4 (d) -8 c Let g be (-8)/28(-6)/(-8)2. Let l = 4.65 + -5.05. Let p be 5(14/(-10) - -1). What is the closest to p in l, 0.3, g? g Let c(j) = j*2 + j - 34. Let u be c(-8). Let p = -0.02112 + 4.02112. What is the closest to -0.3 in p, -2, -0.2, u? -0.2 Let l = -1.3 - -0.3. Let c(n) = -9n*2 - 84n - 22. Let g be c(-9). Let w be (-3 + 1)(-2)/8. What is the nearest to l in -1, w, g? -1 Let w = -0.17676 + 0.06676. What is the nearest to 2 in 2, w, 0? 2 Let f = -40.07 + -1.93. Let v = -365 + 406.3. Let s = f + v. Which is the closest to -1/3? (a) s (b) 3 (c) -0.1 c Let y(g) = 13g - 38. Let n be y(3). Let a be n + (-13)/(-22)-2. Let b = -10 - -9.9. What is the nearest to -1/5 in b, -1/4, a? a Let o = -145 - -127. Let n = -13 + -6. Let h = n - o. What is the nearest to -3/4 in -0.6, h, -0.1? -0.6 Suppose 0 = -3k + 5d - 79, -3k + 30d = 31d + 85. Which is the closest to -3? (a) k (b) -3 (c) 14 b Let v = -6219 + 6192. Which is the nearest to 0.1? (a) 2 (b) v (c) 0.3 (d) -3/5 c Let q = 217 - 224. Let j = 10 - 2. Let z = j - 8.4. What is the nearest to q in z, -4, 5? -4 Let f = 1669.2 - 1886.2. Which is the nearest to 4? (a) f (b) 2/3 (c) 2/5 b Let i = 2/123 - -113/615. Which is the closest to i? (a) 0.19 (b) -3/2 (c) -2/17 a Let q = 5391 - 5392. Let o = -1/5 + 17/10. Which is the nearest to 4? (a) 0.3 (b) q (c) o c Let j = 16157 - 16158. Let o = -6 - -1. Let u = -3 - -1. What is the closest to j in o, u, 5? u Let r = -5 + 5.1. Let w = 3.4483 + -3.1483. Which is the nearest to -8? (a) w (b) r (c) 2/3	{ "pile_set_name": "DM Mathematics" }
6. Let t(x) = 4x2 + 16x + 16. Let b(n) = -n*2 - 5n - 5. Let g(q) = 16b(q) + 5t(q). Calculate i(g(u)). 24u2 - 6 Let l(j) = -4j*2 - 18302j. Let f(i) = i. What is f(l(z))? -4z2 - 18302z Let c(l) = -3l. Let m(p) be the second derivative of p4 + p2 + 582p. Calculate m(c(o)). 108o2 + 2 Let q(g) = -781g + 781g + g2. Let h(c) = 1881 - 1881 + 8c + 5c. Calculate h(q(b)). 13b2 Let s(o) be the first derivative of -o3/3 - 15. Let r(f) = 0f2 + 3 - 3 - 7f*2. What is s(r(q))? -49q*4 Let w(z) = 2z. Suppose -20 = s - 3s - 4q, 0 = -q + 4. Let b(j) = sj + 0j - j - 4j. What is w(b(t))? -6t Let c(y) = y. Let v(h) = h + 4. Let t(z) = -1. Let o(f) = 1. Let m(a) = o(a) + 2t(a). Let n(k) = 14m(k) + 4v(k). Give c(n(j)). 4j + 2 Suppose -4v + 0v + 24 = 0. Let q(k) = -k - vk + 8k - 5k. Let o(a) = -3a. What is o(q(d))? 12d Let n(i) = 5i + 7. Let l(j) = -2j - 3. Let g(s) = -14l(s) - 6n(s). Let p(w) = w2. Let k(x) = -23x*2. Let b(z) = -k(z) - 46p(z). Determine b(g(r)). -92r2 Let k(x) = -2x*2. Let i(o) = 2o*2 + 5. Let g(s) = 2s*2 + 4. Let m = 29 + -25. Let t(v) = mi(v) - 5g(v). Give t(k(w)). -8w*4 Let w(x) = -52574x. Let v(k) = -k. Calculate v(w(y)). 52574y Let t(x) = -x + 15410. Let j(u) = 3u. What is j(t(r))? -3r + 46230 Let x(r) = 6r*2. Let q be (-11 - 1) + 6 + 35. Let j = 12 - -17. Let u(n) = j - q + 3n. Calculate u(x(k)). 18k2 Let j(f) = 1 + 6 + 4 - 2f*2 + 7 - 36. Let c(o) = 2o. Give c(j(m)). -4m2 - 36 Let m be ((-4)/(-2))/((-3)/18). Let v = m - -14. Let p(i) = -i + iv + i - 5i*2. Let x(y) = -3y. Calculate x(p(u)). 12u2 Let u(s) = 4s*2 + 3s - 3. Let q(m) = m*2 + m - 1. Let g(b) = -3q(b) + u(b). Let w(k) = -5k2 + 11k*2 + 22k*2 + 20k*2. What is g(w(f))? 2304f*4 Let w(o) = -o. Let u(k) = 11k - 5. Let n(b) = -10b + 3. Let s(a) = 7n(a) + 6u(a). Give s(w(h)). 4h - 9 Let g(f) = 223f - 3. Let n(q) = -q2 - 15. Give n(g(u)). -49729u*2 + 1338u - 24 Let i(u) = -11 + 22 - 3 + 15u - 8. Let b(p) = 34p. What is b(i(z))? 510z Let b(s) = -s - 22. Let v be b(-9). Let h = v - -15. Let j(w) = w2 + 11w*2 + 0w*h. Let y(c) = -2c*2. Give y(j(i)). -288i4 Let x(w) = -w2 - 1733w + 1. Let f(d) = -2d*2. What is x(f(s))? -4s*4 + 3466s*2 + 1 Let v(z) be the first derivative of -9z*2 - 280. Let t(q) = 11q*2. Calculate v(t(b)). -198b2 Let j(l) be the second derivative of -l3/2 - 2l. Let o(m) = -60m*2 + 110m*2 - 62m*2. Determine j(o(x)). 36x*2 Let s(l) = -104l*2 - 32l + 64. Let i(o) = -16o2 - 5o + 10. Let b(u) = 32i(u) - 5s(u). Let k(v) = 3v. Determine k(b(a)). 24a*2 Suppose -5p + 59 = -101. Let n(t) = 28t + pt + 31t - 96t. Let q(d) = -20d. What is n(q(k))? 100k Let b(r) = 82r. Let a(k) = -990k. What is a(b(o))? -81180o Let c(u) = 13u. Let h(q) = 2q + 713. What is h(c(o))? 26o + 713 Let i(d) = -2d + 2d + d. Let x(j) = -1. Let m(b) = 2b - 12. Let l(o) = m(o) - 12x(o). Let c(h) = -h. Let u(z) = 9c(z) + 4l(z). What is u(i(r))? -r Let p(s) = 77484s. Let z(t) = -t2. What is p(z(g))? -77484g2 Let f(l) be the first derivative of -l2 + 27. Let a(g) = 7g2 - 7g. Determine a(f(z)). 28z2 + 14z Let p(y) = -y. Let r(u) = -u - 7. Let a be r(-7). Suppose 2g = -ag + 4. Let k(i) = 4i2 + i2 - 2i*g. What is k(p(z))? 3z*2 Let j = -74 + 76. Suppose -2d = -3s - 19, -3d - 5s - 16 = 3. Let v(i) = -i2 - 7i*2 + 6i*j - 2i*d. Let u(o) = o. Give v(u(p)). -4p*2 Suppose 4c = 2 + 6. Suppose 0 - c = -i. Let a(n) = -2n2 - ni + 5n*2 + 0n*2. Let s(u) = -u. Give a(s(j)). 2j2 Let c(v) be the first derivative of v4/12 + 21v - 36. Let m(n) be the first derivative of c(n). Let d(j) = 9j. Calculate m(d(f)). 81f2 Let m(o) be the first derivative of -o2 + 864. Let g(n) = 5n*2 - 13. Determine m(g(h)). -10h*2 + 26 Let o(w) = 12w*2 - 108w - 5. Let n(v) = -17v. Determine o(n(j)). 3468j*2 + 1836j - 5 Let a(s) = -2 - 183s2 + 170s*2 + 2. Let l(t) = -259t*2. Let w(g) = -119a(g) + 6l(g). Let h(j) = 4j. Give w(h(b)). -112b2 Let a(t) = -57t - 1. Let z(q) = 741q2. Calculate a(z(r)). -42237r*2 - 1 Let z(n) = 26n*2 + 2n. Let d(l) = 3l. Let j(r) = -10r. Let y(q) = -14d(q) - 4j(q). Determine y(z(f)). -52f2 - 4f Let o(a) = -11a - 6. Let r(p) = -2p + 6. Let z be r(6). Let d(y) = y + 1. Let k(h) = zd(h) - o(h). Let i(t) = 5t*2. Determine i(k(s)). 125s*2 Let h(n) = -12n*2 + 37n*2 - 10n*2 - 9n*2. Let i(w) = 33w*2. What is i(h(k))? 1188k4 Let l(c) be the third derivative of c5/20 - 2c2. Let v(o) be the first derivative of -4o*3/3 - 1. Give v(l(m)). -36m4 Let z(w) = -w2. Let p(c) = -196c - 110 + 577c - 190c - 189c. Give p(z(s)). -2s2 - 110 Let m(k) = -39k. Let x(v) be the first derivative of -11v2/2 + 88. What is m(x(r))? 429r Let x(g) = -g*2 + 3. Let y(p) = -2. Let c(k) = -2x(k) - 3y(k). Let m(q) = 230q*2. Determine c(m(i)). 105800i4 Let u(o) = o2 - 3o. Let r(a) = a2 - 7a. Let m(n) = -6r(n) + 14u(n). Let l(i) = 2i2 + 292217 - 292217. Give l(m(t)). 128t*4 Let c(a) = -6131a. Let z(w) = -3w2. Determine c(z(l)). 18393l*2 Let f(i) be the second derivative of -9i3/2 - i. Let o(c) be the first derivative of c2 + 465. Calculate o(f(j)). -54j Let c(f) = 8f + 4f - f. Suppose -4o = -3x - 23, -23 = 2o - o + 5x. Let b(j) = 2j - 9j + oj + 6j. Calculate b(c(r)). 11r Let c(i) = -i. Let q(n) = n - 4. Let o be q(6). Suppose 0 = -9j - 9 + 36. Let t(z) = 2z*2 + 4z*2 + jz*2 - 4z*o. Give t(c(x)). 5x*2 Let f(j) = -j - 1524. Let p(s) = 24s - 2. What is f(p(a))? -24a - 1522 Let a(m) be the second derivative of 0m*3 - 1/6m*4 - 11m + 0 + 0m2. Let x(b) = 7b. Determine x(a(q)). -14q2 Let z(f) be the second derivative of f3 + 7f. Let t(x) be the first derivative of -3x2/2 + 1. Determine t(z(o)). -18o Suppose -3p + 4p - 5 = 0. Suppose 2i + 4 = -r, 6i = pr + 3i - 19. Let z(h) = 41h - 41h - rh2. Let d(n) = 3n. Give d(z(a)). -6a2 Let u(t) = -30t + 9t + 11t + 5t + 9t. Let l(p) = -110p2. What is u(l(m))? -440m2 Let a(z) be the third derivative of z4/6 + 11z2 - 6. Let s(c) = 2c*2 + 11. Determine s(a(y)). 32y*2 + 11 Let u(c) = -273c - 3. Let q(w) = 0 + 21w - 8w - 11w + 0. What is q(u(m))? -546m - 6 Let f(y) = 6y2 - 11. Let r(x) = 6 - 27x*2 + 48x*2 - 24x*2. Let k = -28 + 17. Let o(j) = kr(j) - 6f(j). Let l(n) = 5n. Calculate l(o(p)). -15p2 Let q(d) = -832d*2. Let n(i) = -40i*2. Determine q(n(c)). -1331200c*4 Let o(s) = -5s. Let x(t) = -1 + 5t + 16t - 1 + 8t + 10t. Calculate x(o(c)). -195c - 2 Let o(t) = 8t. Let i(h) be the first derivative of 5h2 - 148. Determine o(i(q)). 80q Let m(t) = 63t. Let r(a) = -2449a*2 + a - 3. Calculate m(r(w)). -154287w*2 + 63w - 189 Let f(v) = v*2 - 12. Let y(l) = -2l*2 + 9l + 3. Let x(z) = -5z2 + 21z + 7. Let c(t) = -6x(t) + 14y(t). Give f(c(p)). 4p4 - 12 Let d(z) = z2 - 4z + 6. Let i be d(4). Suppose -2p + 0 = -i. Let j(x) = -px + 2x - 4x + 2x. Let l(r) = -2r. Calculate j(l(v)). 6v Let a(t) = 45 + 17 + 3t*2 - 10. Let q(g) = g. What is a(q(f))? 3f*2 + 52 Suppose -5a - 21 = -4j, a - 3 = -j - 0a. Let r(t) = -4t + jt + 3t. Let y(v) = -v + 6v - 2v - v. Give r(y(s)). 6s Let t(u) = 105182u2. Let f(w) = -2w. Determine t(f(o)). 420728o2 Let i(z) = -46z. Let d(n) = -14445n. Determine i(d(g)). 664470g Let u(f) = 18f2. Let r(v) = 6v*2 - 378v. What is r(u(z))? 1944z4 - 6804z*2 Let q = 137 + -137. Let b(k) be the third derivative of 0 + qk*4 + 0k - 2k2 + 0k*3 + 1/20k5. Let o(g) = g2. Give o(b(n)). 9n4 Let x(o) = -346 + 346 + 3o. Let h(c) = 8c2. Give h(x(d)). 72d2 Let f(l) = -l2. Let c(o) = 4o + 2o - 2o + 8o. Let m(j) be the third derivative of -j4/8 + j2. Let z(y) = -2c(y) - 9m(y). Give f(z(b)). -9b2 Let o(g) = -4g. Let y(n) be the second derivative of -n*3/2 + 19n. Give y(o(f)). 12f Let g(b) = 3b*2. Let u = 32 + -24. Suppose 0 = 4o - uo + 8. Let h(n) = -35 + 14 + 21 + no. Determine h(g(i)). 9i*4 Let r(m) = 35m - 5. Let g(j) = -36j + 6. Let t(s) = -5g(s) - 6*r(s). Let y(h) be the	{ "pile_set_name": "DM Mathematics" }
847454 + 4? 847458 In base 15, what is -3b - d2ce? -d31a In base 16, what is -4f9e + -7? -4fa5 In base 6, what is -4232 + -5100? -13332 In base 10, what is -4 + 45253? 45249 In base 9, what is 184 + 522? 716 In base 5, what is 14244 - -1124? 20423 In base 11, what is 8a0125 + 5? 8a012a In base 12, what is -185aa9 - -1? -185aa8 In base 4, what is -102 + 222312? 222210 In base 9, what is -1 + 134757? 134756 In base 5, what is -422331013 + 0? -422331013 In base 9, what is -13160 - -1055? -12104 In base 14, what is -5086 + 1? -5085 In base 2, what is 10011011010000 - -100? 10011011010100 In base 6, what is 20430 + -1200? 15230 In base 10, what is 5 + -4981? -4976 In base 5, what is -24001040 + -4? -24001044 In base 12, what is -3 - -8957? 8954 In base 15, what is -65 - -292? 22c In base 10, what is -3 - -51517? 51514 In base 10, what is 389514 + -2? 389512 In base 9, what is 13161 - -1? 13162 In base 7, what is -26302616 + 5? -26302611 In base 7, what is -23 - 14641? -14664 In base 16, what is -fb4 + -6? -fba In base 10, what is -150 - 252? -402 In base 13, what is -76 - -2302? 2259 In base 3, what is 2121212 + 10? 2121222 In base 7, what is 4650 - 3? 4644 In base 15, what is -4 + -24a0e? -24a13 In base 8, what is -360544 + -14? -360560 In base 9, what is -314 + -248? -563 In base 7, what is 11 - -131053? 131064 In base 15, what is -786 - 13? -799 In base 11, what is 9 + 53571? 5357a In base 8, what is 121470 + -3? 121465 In base 5, what is -1 - 4202301? -4202302 In base 14, what is 16 + 3d74? 3d8a In base 7, what is -3 + 434111? 434105 In base 15, what is -147 + ac? -8a In base 12, what is -2 - 55a10? -55a12 In base 8, what is -7453 + 26? -7425 In base 4, what is -132220 - -1012? -131202 In base 8, what is 127543 + 11? 127554 In base 15, what is 10849 + -2? 10847 In base 9, what is -4 - 137538? -137543 In base 8, what is 2 + -331063? -331061 In base 5, what is -14040414 - 1? -14040420 In base 5, what is -10403212 + 22? -10403140 In base 5, what is -4 + -11142304? -11142313 In base 9, what is -1 - 7251? -7252 In base 5, what is -21 + 430333? 430312 In base 4, what is 1 - -12110322? 12110323 In base 9, what is 2 - -3764? 3766 In base 7, what is 1023422 - -2? 1023424 In base 10, what is 7697 + -4? 7693 In base 14, what is -8326 - -3d? -82c7 In base 2, what is 1100 - 11001110110101110? -11001110110100010 In base 9, what is -122553 - -1? -122552 In base 2, what is -1011010000011010111 + 101? -1011010000011010010 In base 14, what is 1 + -2033? -2032 In base 8, what is 34640 - 51? 34567 In base 6, what is -12 - 232520? -232532 In base 16, what is 687ff - 0? 687ff In base 14, what is 2b8b - d6? 2a95 In base 10, what is 2483628 + 4? 2483632 In base 15, what is -2c - 11bbc? -11be9 In base 4, what is 132 - 211012? -210220 In base 12, what is -54415 + 31? -543a4 In base 13, what is 2 + 2940? 2942 In base 7, what is -2021 + 5535? 3514 In base 5, what is -30322344 + 1? -30322343 In base 4, what is -2013 + 3322? 1303 In base 8, what is -16343 - -223? -16120 In base 13, what is 85a4 - 4? 85a0 In base 12, what is -211b2 + 51? -21161 In base 2, what is -100100 - -101000001110? 100111101010 In base 9, what is -68 + -2306? -2375 In base 5, what is -121210 + 1041? -120114 In base 14, what is -6 - d181? -d187 In base 4, what is 2330 + -220121? -211131 In base 16, what is -5 - 18fc1? -18fc6 In base 8, what is 215 + 543? 760 In base 16, what is -d4 - 39a? -46e In base 5, what is -2 + 11304014? 11304012 In base 15, what is -4 - -4e28? 4e24 In base 2, what is 101001000 - 101000100010? -100011011010 In base 14, what is -5840 - 3? -5843 In base 7, what is 1234 + 25505? 30042 In base 16, what is -165676 + -1? -165677 In base 7, what is -3 + -2624604? -2624610 In base 2, what is -1110011011 - -1010101110? -11101101 In base 10, what is -5 + 173890? 173885 In base 5, what is -243204223 - -2? -243204221 In base 13, what is -55521 - -1a? -55504 In base 14, what is 40 - -714? 754 In base 11, what is 19a1 + -2? 199a In base 16, what is 4b3 + 60? 513 In base 15, what is -16 - -2b96? 2b80 In base 13, what is -ab28 - -b? -ab1a In base 3, what is -1010 - -111000? 102220 In base 7, what is 33362 + -11? 33351 In base 14, what is 7869 - 17? 7852 In base 8, what is 31635 - 45? 31570 In base 5, what is -220 + 341? 121 In base 11, what is 1688 + -a? 1679 In base 13, what is -62a - -41? -5b9 In base 11, what is 71a + -99? 631 In base 16, what is 3 - cc348? -cc345 In base 15, what is 115bab + -2? 115ba9 In base 7, what is 12 - 605400? -605355 In base 12, what is -22 + 1643? 1621 In base 13, what is -512 + -6b? -580 In base 15, what is -6d6 - 55e? -c45 In base 8, what is -555 + 11630? 11053 In base 8, what is -427 - -3727? 3300 In base 7, what is -5004301 - 2? -5004303 In base 5, what is -13 - 32303? -32321 In base 3, what is -21100011 - -11? -21100000 In base 8, what is 10303 - -244? 10547 In base 14, what is -5 + -16a74? -16a79 In base 8, what is -3020 - 1073? -4113 In base 2, what is -1101001010111111 + 10? -1101001010111101 In base 10, what is -4469 + -2? -4471 In base 8, what is -1 + -220466? -220467 In base 4, what is 2102330 - 0? 2102330 In base 4, what is 330022 + 2? 330030 In base 5, what is 1240 - -132104? 133344 In base 6, what is -103305 - 31? -103340 In base 9, what is -16621 - 3? -16624 In base 11, what is -789 - -403? -386 In base 16, what is -40d + -3e? -44b In base 4, what is 11030 - 1332? 3032 In base 10, what is 339850 - -4? 339854 In base 2, what is 10101 - -11011111? 11110100 In base 10, what is -195716 + -4? -195720 In base 9, what is 3407 + -35? 3362 In base 9, what is 0 + 3143? 3143 In base 15, what is -2 + 52d8? 52d6 In base 10, what is 6 - 83140? -83134 In base 15, what is 155 - -b95? cea In base 3, what is 2100002 + -21011? 2001221 In base 14, what is 95 + -42? 53 In base 10, what is -15 - 821? -836 In base 2, what is 1011010110 - 10111101110? -1100011000 In base 4, what is 1100323 + 2? 1100331 In base 5, what is -14 - -43123? 43104 In base 3, what is 10202022 - -22? 10202121 In base 14, what is -4 + -402db? -40301 In base 8, what is -6 - -22701? 22673 In base 12, what is -97 + 198b? 18b4 In base 4, what is -1 - -2103130? 2103123 In base 4, what is -1 + 2123321? 2123320 In base 3, what is -2202022102110 + -1? -2202022102111 In base 3, what is -20 + -11201001? -11201021 In base 5, what is 22 - 4402122? -4402100 In base 15, what is 618d - -19? 61a7 In base 7, what is -2664540 - 1? -2664541 In base 11, what is 50a76 + 0? 50a76 In base 10, what is 5901 - 2? 5899 In base 2, what is -1111111011 + -101? -10000000000 In base 6, what is -22135442 - 5? -22135451 In base 2, what is -111110100100 - 11? -111110100111 In base 11, what is -1700 + -2? -1702 In base 7, what is 3213522 + -10? 3213512 In base 16, what is -11 + -c69? -c7a In base 3, what is 2010000001 + -12? 2002222212 In base 7, what is 1320214 + -2? 1320212 In base 11, what is 35489 - -46? 35524 In base 8, what is 35637 + -4? 35633 In base 14, what is -5c - -434a? 42cc In base 8, what is 25 - -12671? 12716 In base 11, what is 7a245 + -a? 7a236 In base 3, what is 110121110010 + 1? 110121110011 In base 5, what is 110404 - -110? 111014 In base 7, what is 2230306 - -2? 2230311 In base 9, what is -2 + -1268067? -1268070 In base 8, what is -341 - -406? 45 In base 4, what is -1230231332 - -2? -1230231330 In base 7, what is -221 - 320? -541 In base 8, what is 0 - 223063? -223063 In base 13, what is 82748 + -4? 82744 In base 6, what is 440 - -253? 1133 In base 2, what is 11001001001100001 - 100? 11001001001011101 In base 12, what is -127 - -139? 12 In base 5, what is 3 + -2004014? -2004011 In base 13, what is 2881 + -16? 2868 In base 9, what is 13 + 3764? 3777 In base 16, what is 27 - 2bf52? -2bf2b In base 12, what is -5 - b1b65? -b1b6a In base 7, what is 6 + -23532? -23523 In base 4, what is 1010322302 + -3? 1010322233 In base 11, what is -8324 + 102? -8222 In base 16, what is -6d0 + -2d? -6fd In base 4, what is 11330221 - 231? 11323330 In base 13, what is 13 - 459? -446 In base 13, what is -1 + -800a8? -800a9 In base 6, what is -54 - -1050? 552 In base 6, what is -3103 - -41124? 34021 In base 12, what is -1 - -13510? 1350b In base 16, what is -2 + -30d12? -30d14 In base 16, what is -8 + 56b? 563 In base 13, what is 0 + -	{ "pile_set_name": "DM Mathematics" }
by 2680735. 9 What is the remainder when 79931 is divided by 5279? 746 Calculate the remainder when 211896 is divided by 4707. 81 What is the remainder when 1545450 is divided by 772725? 0 Calculate the remainder when 1652204 is divided by 3560. 364 What is the remainder when 3020037 is divided by 53? 44 What is the remainder when 129587739 is divided by 5750? 5739 Calculate the remainder when 403312 is divided by 1904. 1568 Calculate the remainder when 30461 is divided by 150. 11 What is the remainder when 2765239 is divided by 12456? 7 Calculate the remainder when 274917884 is divided by 48. 44 Calculate the remainder when 4768490 is divided by 825. 815 What is the remainder when 78875357 is divided by 160? 157 What is the remainder when 10184678 is divided by 116? 110 What is the remainder when 616662 is divided by 1465? 1362 What is the remainder when 68552 is divided by 592? 472 Calculate the remainder when 3467715 is divided by 99077. 20 What is the remainder when 181784 is divided by 18145? 334 What is the remainder when 1108303 is divided by 1108221? 82 What is the remainder when 3045071 is divided by 825? 821 Calculate the remainder when 122051 is divided by 7178. 25 Calculate the remainder when 36878144 is divided by 9692. 84 Calculate the remainder when 167189133 is divided by 17. 15 Calculate the remainder when 25054715 is divided by 7179. 5 Calculate the remainder when 284668 is divided by 40077. 4129 Calculate the remainder when 44868106 is divided by 1996. 22 Calculate the remainder when 59273 is divided by 1969. 203 Calculate the remainder when 926202 is divided by 2058. 102 What is the remainder when 932523 is divided by 378? 375 What is the remainder when 113208040 is divided by 4043? 4040 What is the remainder when 252544 is divided by 63059? 308 What is the remainder when 11188 is divided by 1291? 860 What is the remainder when 8451247 is divided by 2816984? 295 What is the remainder when 1194599 is divided by 319? 263 What is the remainder when 48557108 is divided by 2644? 48 What is the remainder when 616658 is divided by 6491? 13 Calculate the remainder when 3009399 is divided by 142. 135 What is the remainder when 105202 is divided by 781? 548 Calculate the remainder when 1112730 is divided by 2576. 2474 What is the remainder when 12946 is divided by 4301? 43 Calculate the remainder when 231298 is divided by 2996. 606 Calculate the remainder when 4312116 is divided by 154004. 4 What is the remainder when 9236963 is divided by 348? 347 What is the remainder when 376754490 is divided by 1824? 1818 What is the remainder when 151619 is divided by 36953? 3807 What is the remainder when 2575836 is divided by 1287906? 24 What is the remainder when 49389772 is divided by 2334? 2332 What is the remainder when 583965 is divided by 462? 459 What is the remainder when 3212427 is divided by 1603? 15 Calculate the remainder when 95478 is divided by 23778. 366 What is the remainder when 111953589 is divided by 39? 33 What is the remainder when 289602 is divided by 3254? 3250 Calculate the remainder when 279248 is divided by 470. 68 What is the remainder when 285557 is divided by 4894? 1705 Calculate the remainder when 982980 is divided by 506. 328 Calculate the remainder when 842785 is divided by 724. 49 What is the remainder when 1445970 is divided by 73? 59 Calculate the remainder when 1779309 is divided by 249. 204 Calculate the remainder when 15774 is divided by 7878. 18 What is the remainder when 166244628 is divided by 313? 312 What is the remainder when 11338317 is divided by 336? 333 What is the remainder when 7703371 is divided by 695? 686 Calculate the remainder when 10564457 is divided by 367. 362 Calculate the remainder when 237986 is divided by 47546. 256 What is the remainder when 228988 is divided by 253? 23 Calculate the remainder when 78441 is divided by 39152. 137 Calculate the remainder when 140929 is divided by 806. 685 What is the remainder when 104407081 is divided by 629? 0 Calculate the remainder when 16991 is divided by 16118. 873 What is the remainder when 713944 is divided by 144? 136 What is the remainder when 104327600 is divided by 117? 104 Calculate the remainder when 27172 is divided by 3846. 250 What is the remainder when 29455 is divided by 4307? 3613 Calculate the remainder when 12701545 is divided by 303. 88 What is the remainder when 13916 is divided by 2283? 218 Calculate the remainder when 28926 is divided by 3318. 2382 Calculate the remainder when 124436918 is divided by 124436918. 0 What is the remainder when 47518037 is divided by 392711? 6 Calculate the remainder when 7071829 is divided by 48. 37 What is the remainder when 249799 is divided by 27752? 31 What is the remainder when 302496 is divided by 13733? 370 What is the remainder when 20784393 is divided by 57574? 179 What is the remainder when 42534996 is divided by 178? 116 What is the remainder when 8853780 is divided by 387? 381 Calculate the remainder when 2144788 is divided by 714887. 127 What is the remainder when 75429 is divided by 4241? 3332 Calculate the remainder when 3354396 is divided by 559058. 48 Calculate the remainder when 7704266 is divided by 695. 191 What is the remainder when 1807457 is divided by 48? 17 Calculate the remainder when 41899146 is divided by 3939. 3 What is the remainder when 16939927 is divided by 33478? 59 Calculate the remainder when 5683 is divided by 1651. 730 What is the remainder when 964638 is divided by 555? 48 What is the remainder when 7708938 is divided by 137657? 146 Calculate the remainder when 1393595 is divided by 199062. 161 Calculate the remainder when 1483427 is divided by 87. 77 What is the remainder when 6591389 is divided by 14329? 49 Calculate the remainder when 103369 is divided by 34418. 115 What is the remainder when 424412817 is divided by 4794? 4791 What is the remainder when 347603 is divided by 2896? 83 Calculate the remainder when 4769764 is divided by 596219. 12 What is the remainder when 22412 is divided by 7082? 1166 Calculate the remainder when 848235 is divided by 16. 11 Calculate the remainder when 12127567 is divided by 2203. 52 What is the remainder when 5516338 is divided by 1550? 1438 What is the remainder when 13186379 is divided by 125? 4 What is the remainder when 5814244 is divided by 1162846? 14 Calculate the remainder when 507269 is divided by 2096. 37 What is the remainder when 10073233 is divided by 598? 521 What is the remainder when 4074178 is divided by 1259? 54 What is the remainder when 2058857 is divided by 2353? 2335 What is the remainder when 593960 is divided by 906? 530 What is the remainder when 4106977 is divided by 10319? 15 What is the remainder when 18633420 is divided by 451? 355 What is the remainder when 3001464 is divided by 130498? 10 Calculate the remainder when 404078 is divided by 67294. 314 What is the remainder when 23031840 is divided by 3867? 3855 Calculate the remainder when 21064719 is divided by 7021570. 9 Calculate the remainder when 2602083 is divided by 2166. 717 Calculate the remainder when 5429288 is divided by 1853. 1851 Calculate the remainder when 1998821 is divided by 666261. 38 What is the remainder when 24877901 is divided by 176439? 2 Calculate the remainder when 1057852 is divided by 6651. 343 What is the remainder when 209792 is divided by 52304? 576 What is the remainder when 2942631 is divided by 2137? 2119 What is the remainder when 16715 is divided by 8346? 23 What is the remainder when 1262917 is divided by 15401? 35 Calculate the remainder when 19594323 is divided by 878. 875 What is the remainder when 1336629 is divided by 6146? 2947 What is the remainder when 31184 is divided by 364? 244 Calculate the remainder when 2762672 is divided by 37843. 133 What is the remainder when 104903 is divided by 51679? 1545 What is the remainder when 3152313 is divided by 49? 45 What is the remainder when 123699 is divided by 287? 2 What is the remainder when 161967 is divided by 4624? 127 What is the remainder when 116777733 is divided by 9305? 9288 What is the remainder when 2414490 is divided by 111? 18 Calculate the remainder when 139491 is divided by 1758. 609 What is the remainder when 389176 is divided by 467	{ "pile_set_name": "DM Mathematics" }
AM and 12:48 PM? 526 How many minutes are there between 9:17 AM and 10:06 AM? 49 What is 700 minutes after 9:54 PM? 9:34 AM How many minutes are there between 2:51 AM and 5:08 AM? 137 How many minutes are there between 8:17 PM and 11:28 PM? 191 What is 111 minutes before 6:55 AM? 5:04 AM How many minutes are there between 7:12 PM and 3:33 AM? 501 What is 652 minutes after 7:58 AM? 6:50 PM How many minutes are there between 4:28 AM and 11:47 AM? 439 How many minutes are there between 10:45 PM and 10:01 AM? 676 How many minutes are there between 10:17 PM and 1:22 AM? 185 What is 237 minutes after 8:09 AM? 12:06 PM What is 185 minutes before 6:48 PM? 3:43 PM How many minutes are there between 1:11 AM and 12:23 PM? 672 What is 217 minutes before 11:28 PM? 7:51 PM How many minutes are there between 11:44 AM and 10:28 PM? 644 What is 51 minutes before 1:42 PM? 12:51 PM What is 137 minutes after 11:28 AM? 1:45 PM What is 126 minutes before 4:56 AM? 2:50 AM How many minutes are there between 8:42 AM and 12:37 PM? 235 How many minutes are there between 10:28 PM and 6:20 AM? 472 How many minutes are there between 8:55 PM and 12:24 AM? 209 How many minutes are there between 9:24 PM and 5:07 AM? 463 How many minutes are there between 12:45 PM and 6:02 PM? 317 How many minutes are there between 7:46 PM and 7:14 AM? 688 How many minutes are there between 12:20 AM and 9:27 AM? 547 What is 439 minutes before 5:30 AM? 10:11 PM What is 543 minutes after 11:53 AM? 8:56 PM What is 432 minutes after 12:59 PM? 8:11 PM How many minutes are there between 7:15 PM and 2:54 AM? 459 What is 557 minutes after 12:56 AM? 10:13 AM How many minutes are there between 8:23 PM and 11:19 PM? 176 What is 385 minutes after 3:21 AM? 9:46 AM What is 111 minutes after 5:39 PM? 7:30 PM What is 517 minutes before 7:39 PM? 11:02 AM What is 663 minutes before 3:56 PM? 4:53 AM What is 582 minutes before 6:21 AM? 8:39 PM What is 69 minutes before 4:21 AM? 3:12 AM What is 56 minutes after 3:32 PM? 4:28 PM How many minutes are there between 1:38 PM and 10:50 PM? 552 How many minutes are there between 5:37 PM and 5:43 PM? 6 What is 609 minutes after 6:49 PM? 4:58 AM How many minutes are there between 11:10 AM and 12:13 PM? 63 How many minutes are there between 5:48 PM and 7:18 PM? 90 How many minutes are there between 8:51 AM and 5:03 PM? 492 How many minutes are there between 3:56 AM and 10:22 AM? 386 What is 457 minutes before 8:42 AM? 1:05 AM What is 424 minutes after 11:34 PM? 6:38 AM What is 491 minutes before 1:54 AM? 5:43 PM What is 166 minutes after 7:44 AM? 10:30 AM How many minutes are there between 3:39 AM and 1:07 PM? 568 How many minutes are there between 10:00 AM and 7:30 PM? 570 What is 101 minutes after 6:26 AM? 8:07 AM What is 692 minutes after 2:53 AM? 2:25 PM What is 171 minutes after 4:49 PM? 7:40 PM What is 53 minutes after 3:39 PM? 4:32 PM How many minutes are there between 2:05 PM and 1:23 AM? 678 How many minutes are there between 12:45 AM and 7:46 AM? 421 What is 607 minutes before 2:07 PM? 4:00 AM What is 628 minutes before 4:23 PM? 5:55 AM What is 49 minutes after 12:10 AM? 12:59 AM What is 251 minutes after 10:09 AM? 2:20 PM What is 576 minutes before 4:46 PM? 7:10 AM How many minutes are there between 7:47 AM and 6:23 PM? 636 What is 321 minutes after 4:23 PM? 9:44 PM How many minutes are there between 1:36 PM and 2:26 PM? 50 What is 391 minutes before 4:26 AM? 9:55 PM What is 402 minutes after 5:26 PM? 12:08 AM What is 702 minutes before 1:15 PM? 1:33 AM What is 36 minutes before 2:15 AM? 1:39 AM What is 355 minutes before 4:37 PM? 10:42 AM What is 170 minutes after 5:38 PM? 8:28 PM What is 429 minutes before 12:26 AM? 5:17 PM How many minutes are there between 4:53 PM and 12:31 AM? 458 How many minutes are there between 6:35 AM and 4:30 PM? 595 What is 91 minutes before 3:15 PM? 1:44 PM What is 480 minutes after 7:34 AM? 3:34 PM What is 493 minutes before 3:22 PM? 7:09 AM How many minutes are there between 7:20 AM and 7:39 AM? 19 How many minutes are there between 6:07 AM and 12:55 PM? 408 How many minutes are there between 11:13 PM and 8:11 AM? 538 How many minutes are there between 8:43 PM and 2:20 AM? 337 What is 376 minutes before 10:30 AM? 4:14 AM How many minutes are there between 4:21 PM and 4:56 PM? 35 What is 203 minutes before 10:04 PM? 6:41 PM What is 491 minutes after 7:26 AM? 3:37 PM What is 520 minutes before 10:38 AM? 1:58 AM What is 39 minutes before 6:58 AM? 6:19 AM How many minutes are there between 6:29 AM and 1:53 PM? 444 How many minutes are there between 4:08 AM and 11:55 AM? 467 How many minutes are there between 7:30 PM and 10:10 PM? 160 What is 332 minutes before 4:24 PM? 10:52 AM What is 705 minutes before 9:55 AM? 10:10 PM How many minutes are there between 3:46 PM and 8:48 PM? 302 What is 462 minutes before 7:07 AM? 11:25 PM How many minutes are there between 1:44 PM and 12:59 AM? 675 What is 676 minutes before 5:53 PM? 6:37 AM What is 20 minutes after 8:35 AM? 8:55 AM What is 191 minutes after 8:12 PM? 11:23 PM How many minutes are there between 8:55 AM and 5:40 PM? 525 What is 11 minutes before 3:42 PM? 3:31 PM What is 165 minutes after 7:28 PM? 10:13 PM What is 181 minutes before 8:19 AM? 5:18 AM How many minutes are there between 2:01 AM and 9:40 AM? 459 What is 355 minutes before 8:22 PM? 2:27 PM How many minutes are there between 11:47 PM and 9:36 AM? 589 How many minutes are there between 1:06 AM and 4:11 AM? 185 What is 472 minutes after 3:30 AM? 11:22 AM How many minutes are there between 3:15 PM and 12:27 AM? 552 How many minutes are there between 12:57 AM and 8:22 AM? 445 How many minutes are there between 7:23 PM and 7:12 AM? 709 What is 71 minutes before 3:45 AM? 2:34 AM How many minutes are there between 8:31 AM and 11:26 AM? 175 What is 90 minutes before 1:15 PM? 11:45 AM How many minutes are there between 5:41 PM and 3:19 AM? 578 What is 708 minutes after 8:10 PM? 7:58 AM How many minutes are there between 3:39 AM and 4:14 AM? 35 What is 181 minutes before 8:55 AM? 5:54 AM How many minutes are there between 9:48 PM and 12:53 AM? 185 How many minutes are there between 4:50 AM and 2:20 PM? 570 What is 4 minutes after 10:13 PM? 10:17 PM How many minutes are there between 11:27 PM and 4:29 AM? 302 What is 194 minutes after 1:43 AM? 4:57 AM How many minutes are there between 11:22 AM and 5:56 PM? 394 What is 402 minutes after 9:43 AM? 4:25 PM What is 235 minutes before 6:37 PM? 2:42 PM What is 428 minutes after 1:39 AM? 8:47 AM How many minutes are there between 1:48 PM and 5:44 PM? 236 What is 680 minutes after 10:24 PM? 9:44 AM What is 662 minutes before 7:32 AM? 8:30 PM How many minutes are there between 1:00 AM and 7:42 AM? 402 How many minutes are there between 6:28 PM and 4:52 AM? 624 What is 646 minutes before 3:03 AM? 4:17 PM What is 616 minutes after 1:34 PM? 11:50 PM What is 719 minutes after 3:19 PM? 3:18 AM How many minutes are there between 10:49 PM and 7:10 AM? 501 How many minutes are there between 7:19 PM and 9:01 PM? 102 What is 670 minutes after 5:00 PM? 4:10 AM What is 538 minutes after 10:23 AM? 7:21 PM What is 398 minutes before 1:12 AM? 6:34 PM What is 559 minutes before 9:32 AM? 12:13 AM How many minutes are there between 11:22 PM and 10:55 AM? 693 What is 62 minutes after 7:02 AM? 8:04 AM What is 203 minutes after 1:26 PM? 4:49 PM How many minutes are there between 12:17 PM and 3:13 PM? 176 How many minutes are there between 12:04 PM and 5:35 PM? 331 How many minutes are there between 8:28 PM and 3:52 AM? 444 How many minutes are there between 4:59 AM and 4:08 PM? 669 How many minutes are there between 8:43 AM and 3:24 PM? 401 How many minutes are there between 10:02 PM and 7:50 AM? 588 How many minutes are there between 6:32 AM and 1:26 PM? 414 How many minutes are there between 9:23 PM and 1:06 AM? 223 How many minutes are there between 4:24 PM and 6:45 PM? 141 What is 54 minutes after 1:25 AM? 2:19 AM How many minutes are there between 7:07 AM and 8:09 AM? 62 What is 2 minutes after 7:59 PM? 8:01 PM How many minutes are there between 4:43 AM and 12:59 PM? 496 How many minutes are there between 12:54 AM and 11:01 AM? 607 How many minutes are there between 2:08 AM and 2:49 AM? 41 What is 630 min	{ "pile_set_name": "DM Mathematics" }
second biggest value? (a) 2 (b) 129 (c) -4 (d) 4 d Which is the biggest value? (a) -0.05 (b) -9 (c) 5 c Which is the third smallest value? (a) -0.38 (b) -0.29 (c) 2/3 c What is the smallest value in -3/5, 0.1, -224? -224 Which is the third biggest value? (a) 0.2 (b) 0.1 (c) 15 (d) 0.05 b What is the smallest value in -72, 4/9, -0.4? -72 Which is the third smallest value? (a) -1/3 (b) -320 (c) 2/5 (d) -3 a Which is the fourth smallest value? (a) -0.4 (b) 0.1 (c) 48 (d) -2 c What is the second biggest value in 11, -0.2, -12.9, 2/7, 0.3? 0.3 What is the fourth smallest value in -227, 4, -5, 3? 4 Which is the fourth smallest value? (a) 0.1 (b) 2/13 (c) 2/161 (d) -0.3 (e) 0 a Which is the second biggest value? (a) 0 (b) 1/104 (c) -1/11 (d) 1/3 b Which is the fourth biggest value? (a) 8 (b) 4 (c) -0.5 (d) -10 d Which is the smallest value? (a) 0 (b) 2/3 (c) 1 (d) 5.7 a Which is the smallest value? (a) -0.027 (b) 11/3 (c) 0.5 (d) 0.2 a Which is the biggest value? (a) -0.5 (b) 2/5 (c) 2.2 c Which is the second biggest value? (a) -5 (b) -1 (c) 2/39 (d) 2 c What is the second biggest value in 4, 0, 1, -5? 1 What is the biggest value in -3, -0.2, 77? 77 What is the fifth smallest value in -3/5, 0.4, -4, -7/776, -3? 0.4 Which is the biggest value? (a) -1 (b) 0.45 (c) 2.3 c Which is the second biggest value? (a) -0.15 (b) 0.4 (c) 0 c Which is the second smallest value? (a) 1/4 (b) 13/4 (c) 1 (d) -5 (e) -1 e What is the fourth smallest value in -5, 0.5, 0.4, -0.044? 0.5 Which is the fifth biggest value? (a) 0.2 (b) 16.5 (c) 0.4 (d) -5 (e) 1 d What is the third smallest value in 0.08, 0.038, 2/7, -4? 0.08 What is the third biggest value in 1/7, 2/51, -3/2, -91? -3/2 What is the third smallest value in 0.39, -2, 2, 0.2? 0.39 What is the third smallest value in 3, 0.179, 4? 4 What is the second biggest value in 0.5, -0.01, 7.76? 0.5 Which is the fifth biggest value? (a) 2 (b) -1 (c) -2/3 (d) 1/3 (e) 5 b Which is the second biggest value? (a) -42/11 (b) 2 (c) -4 (d) 6 b Which is the smallest value? (a) 1/2 (b) 3/8 (c) -12 c What is the fifth biggest value in 0.1, 0.5, 1/11, 2/3, -1/5? -1/5 What is the second smallest value in -2/5, -5, 0.31, -4? -4 What is the smallest value in -11/2, -21/4, 3, 0.1? -11/2 Which is the biggest value? (a) 5 (b) -3 (c) 0.8 a Which is the second smallest value? (a) 1 (b) -4 (c) -1 (d) 2/5 c What is the second biggest value in -0.4, 52, 0.3? 0.3 Which is the third biggest value? (a) -6 (b) -0.97 (c) 6 a Which is the smallest value? (a) -0.01 (b) -165 (c) 0.2 b Which is the fourth smallest value? (a) -0.5 (b) -0.03 (c) -0.2 (d) 2/835 d Which is the second biggest value? (a) 0.8 (b) -1/16 (c) 0.4 (d) -5 c Which is the second biggest value? (a) 3 (b) -4/3 (c) -2/7 (d) -2/13 d Which is the second biggest value? (a) -0.4 (b) 8/7 (c) 1 c What is the second smallest value in 0.1, 1, 2/7? 2/7 What is the second smallest value in -24, -9, 3? -9 Which is the biggest value? (a) -4 (b) 208 (c) 20 (d) -5 b Which is the third biggest value? (a) 5 (b) 3 (c) 17 (d) -3 b Which is the second biggest value? (a) 0.163 (b) 0.9 (c) -3 a Which is the fifth smallest value? (a) -2 (b) -1 (c) 0.09 (d) 0.08 (e) 4/5 e What is the third biggest value in -2/3, 2/3, 5, 3.3, 3? 3 What is the fifth biggest value in 0.2, 14, 4/3, -59, 4? -59 Which is the second smallest value? (a) 469 (b) -2/9 (c) -0.2 (d) -4 (e) 2 b What is the third smallest value in -3, 1/2, 2.05, 1? 1 What is the biggest value in 0, -3/5, 2, -0.8? 2 Which is the biggest value? (a) -4 (b) 2/7 (c) -0.07 b Which is the second biggest value? (a) 4 (b) 23 (c) 89 b Which is the biggest value? (a) -6 (b) 6 (c) -10 b Which is the second biggest value? (a) 4 (b) 13/7 (c) -0.1 b What is the third biggest value in 4, 2/15, 10? 2/15 Which is the biggest value? (a) -1/2 (b) 0.5 (c) 2/5 (d) -3/16 (e) -4 b What is the biggest value in 194, -5, -1/5, -1/9? 194 Which is the smallest value? (a) 2/5 (b) -2/17 (c) -0.3 (d) -1/3 d What is the third smallest value in -3/2, 0.5, 2? 2 Which is the smallest value? (a) 55 (b) -3 (c) 0.5 (d) 0.6 b What is the fourth smallest value in -8, -0.4, -3, -1/101? -1/101 Which is the second biggest value? (a) -0.5 (b) 0 (c) 57 b What is the second smallest value in 0.27, -0.17, 1? 0.27 What is the biggest value in 4/5, 1, 3, -0.16? 3 What is the fourth smallest value in -0.9, -1/3, 6, 0.5? 6 What is the second biggest value in 8, 0.2, -2, -22? 0.2 Which is the second biggest value? (a) 0.5 (b) 2/33 (c) 2 a Which is the biggest value? (a) 2/3 (b) 12 (c) -0.8 b What is the biggest value in 0.02, -2/11, 4/11? 4/11 What is the second smallest value in 4, 0.03, 2/3, -12, -0.9? -0.9 Which is the fourth smallest value? (a) -1/3 (b) 0.2 (c) -3/7 (d) -2 b What is the second smallest value in 0, -1.2, 5, 2? 0 Which is the second smallest value? (a) 186 (b) 5 (c) -5 b Which is the smallest value? (a) 32 (b) -1 (c) -2/11 (d) 4 b Which is the third biggest value? (a) -0.1 (b) -5 (c) 7.8 b Which is the fourth smallest value? (a) 6/5 (b) -134 (c) 0.2 (d) -0.2 a What is the second biggest value in 10/3, -0.3, -0.4, 3? 3 What is the fifth smallest value in 0.9, -3, -0.05, -6/5, -2? 0.9 What is the biggest value in -0.3, 12, 18, -0.5? 18 Which is the biggest value? (a) 0.11 (b) -1/2 (c) -5 (d) 1/3 d What is the second biggest value in 10/23, 0.4, 0? 0.4 What is the second smallest value in 2/9, 6/11, -2/5, 1/12, -1/3? -1/3 Which is the third smallest value? (a) -1 (b) -5 (c) -3 a What is the biggest value in -4, 2, -301? 2 What is the smallest value in -1, 0.08, -1/7, -1/8? -1 Which is the second biggest value? (a) 1/51 (b) 1/3 (c) -5 a Which is the fourth smallest value? (a) 0.5 (b) -0.5 (c) -1/6 (d) 0.09 (e) 12 a What is the third biggest value in 7, 1/2, -40? -40 Which is the smallest value? (a) 2/197 (b) -2/11 (c) -0.3 c What is the second smallest value in -2/5, 0.1, -8/195, 0.4? -8/195 Which is the biggest value? (a) -4 (b) 0 (c) -11 (d) 0.5 (e) 0.16 d Which is the third biggest value? (a) 4 (b) 106 (c) -2 (d) -0.4 d What is the fifth smallest value in 0.4, -9/11, 0.2, 2, -0.3? 2 Which is the third smallest value? (a) -3 (b) -2/23 (c) -0.3 (d) -9/7 c Which is the fourth smallest value? (a) -2 (b) 11 (c) 1 (d) 0.2 (e) 2 e What is the third biggest value in -5, -1, 0.232? -5 Which is the smallest value? (a) -28/13 (b) 2/9 (c) -1/2 (d) -1 a What is the third smallest value in -1.6, -1, 48? 48 What is the smallest value in -0.3, -10/9, 0.5? -10/9 Which is the smallest value? (a) -0.7 (b) -1/4 (c) 3 (d) 14 a What is the fourth biggest value in -1/4, 7, 2/3, -4, -1? -1 What is the second smallest value in 0.2, -0.05, 24/17? 0.2 What is the biggest value in 0, -1, -0.49, 1? 1 What is the smallest value in 1/7, -5, 0.4, -365? -365 What is the fourth biggest value in -2, -3, -2/31, 4? -3 What is the second smallest value in -6/17, -0.4, -2, 0.1? -0.4 Which is the second biggest value? (a) -4 (b) 4/3 (c) 0 (d) 5 b Which is the third smallest value? (a) -2/11 (b) 4988 (c) 0.3 b Which is the second smallest value? (a) -2 (b) -5 (c) 0.2 (d) -4 d What is the fourth biggest value in 2, -11, -9, -0.3? -11 What is the third biggest value in 0.05, -1/2, 0.1, 0.03? 0.03 Which is the second biggest value? (a) 4 (b) -3 (c) 7 a Which is the second smallest value? (a) -4/3 (b) -834 (c) 4 a Which is the third smallest value? (a) 0.5 (b) 0 (c) -0.4 (d) 566 (e) 2/3 a Which is the second smallest value? (a) -0.4 (b) -420 (c) -1/11 (d) -0.5 d Which is the smallest value? (a) -0.5 (b) -1/7 (c) -18 c Which is the fourth smallest value? (a) 0.2 (b) -0.8 (c) -0.5 (d) -3 a Which is the second biggest value? (a) -2 (b) 0.65 (c) 3 (d) -1 b Which is the biggest value? (a) -0.4 (b) -1 (c) 5080 c Which is the third biggest value? (a) -1 (b) 5 (c) 4 (d) 0.43 d What is the second smallest value in -20, -13, -17? -17 What is the third smallest value in -4.5, 3, 0, -3? 0 What is the third biggest value in 0.4, -0.5, -2785? -2785 What is the second biggest value in 3,	{ "pile_set_name": "DM Mathematics" }
? 49073.544 How many kilograms are there in thirteen quarters of a tonne? 3250 How many milliseconds are there in 17/2 of a second? 8500 Convert 16324.79g to nanograms. 16324790000000 What is 0.2328349 centuries in months? 279.40188 Convert 130628.8 decades to years. 1306288 Convert 0.4896453t to milligrams. 489645300 What is 21/8 of a kilometer in meters? 2625 What is one tenth of a litre in millilitres? 100 What is 50723.16 millimeters in kilometers? 0.05072316 How many kilograms are there in 11/8 of a tonne? 1375 What is 2/125 of a litre in millilitres? 16 Convert 2.699352 kilograms to micrograms. 2699352000 What is nine sixteenths of a day in minutes? 810 How many meters are there in 33.44437 millimeters? 0.03344437 What is 1430.914um in kilometers? 0.000001430914 What is 1/5 of a millennium in centuries? 2 Convert 45.52469nm to micrometers. 0.04552469 What is 383778.7 milligrams in tonnes? 0.0003837787 What is 3/5 of a gram in milligrams? 600 How many milliseconds are there in 2/15 of a minute? 8000 How many millilitres are there in eleven eighths of a litre? 1375 What is fourty-five halves of a milligram in micrograms? 22500 What is one tenth of a milligram in micrograms? 100 How many grams are there in 79.68821ng? 0.00000007968821 How many kilograms are there in six fifths of a tonne? 1200 How many seconds are there in 6/25 of a day? 20736 Convert 107.1504 micrograms to milligrams. 0.1071504 How many millilitres are there in fourty-one halves of a litre? 20500 Convert 0.7902993 tonnes to grams. 790299.3 How many months are there in 52/5 of a decade? 1248 What is 5/4 of a millennium in months? 15000 Convert 89.1342 months to decades. 0.742785 Convert 877662.1ml to litres. 877.6621 What is 498.624 centuries in decades? 4986.24 How many years are there in fourty-seven quarters of a millennium? 11750 Convert 890557.7 millennia to centuries. 8905577 What is 13.9433 decades in years? 139.433 How many minutes are there in one tenth of a week? 1008 How many milligrams are there in one fifth of a gram? 200 How many meters are there in 11/8 of a kilometer? 1375 What is 18/5 of a milligram in micrograms? 3600 How many months are there in 9877.699 years? 118532.388 How many months are there in 12/25 of a millennium? 5760 What is three eighths of a millimeter in micrometers? 375 Convert 16.99841 days to seconds. 1468662.624 What is 6/25 of a kilogram in grams? 240 Convert 20.95894um to nanometers. 20958.94 What is 1161.743mm in kilometers? 0.001161743 How many minutes are there in 0.1188047 weeks? 1197.551376 How many litres are there in 23722.14 millilitres? 23.72214 What is 668897.7 litres in millilitres? 668897700 What is 13/4 of a week in hours? 546 How many months are there in seventeen sixths of a year? 34 How many months are there in 19/4 of a millennium? 57000 Convert 577.2775 grams to micrograms. 577277500 What is fourty-eight fifths of a kilogram in grams? 9600 How many decades are there in 779024.8 centuries? 7790248 What is 9.269566ng in milligrams? 0.000009269566 How many nanometers are there in thirty-one fifths of a micrometer? 6200 How many millilitres are there in 9.595097l? 9595.097 What is 610.2189l in millilitres? 610218.9 Convert 1645566.867 nanoseconds to weeks. 0.0000000027208446875 What is 667.4754 millimeters in nanometers? 667475400 How many minutes are there in 233.0766ms? 0.00388461 Convert 840986.4 millilitres to litres. 840.9864 Convert 71.66416nm to micrometers. 0.07166416 How many millilitres are there in thirteen eighths of a litre? 1625 What is 7/4 of a gram in milligrams? 1750 What is 2418.873nm in kilometers? 0.000000002418873 Convert 0.4528332 months to millennia. 0.0000377361 How many centuries are there in 3422.433 millennia? 34224.33 How many seconds are there in 746.9621 weeks? 451762678.08 What is eleven halves of a week in hours? 924 What is one sixth of a hour in seconds? 600 What is 223.8193 years in decades? 22.38193 What is three fifths of a kilogram in grams? 600 How many kilograms are there in 27/5 of a tonne? 5400 Convert 97393.57um to meters. 0.09739357 Convert 911.1643um to millimeters. 0.9111643 Convert 2453.136 grams to kilograms. 2.453136 How many milliseconds are there in 1/60 of a minute? 1000 What is 7/8 of a litre in millilitres? 875 How many grams are there in 6/5 of a kilogram? 1200 How many micrometers are there in 182.6783 millimeters? 182678.3 Convert 28819.08 months to millennia. 2.40159 What is 17/6 of a week in minutes? 28560 What is 3383.2035 nanoseconds in hours? 0.00000000093977875 How many milliseconds are there in 50.00347 minutes? 3000208.2 Convert 772.6338 micrometers to kilometers. 0.0000007726338 What is 5941.771 millennia in centuries? 59417.71 What is 46.52783 milligrams in grams? 0.04652783 What is three fifths of a kilometer in centimeters? 60000 What is sixty-five thirds of a day in minutes? 31200 How many nanograms are there in thirty-seven halves of a microgram? 18500 How many nanoseconds are there in thirty-seven fifths of a microsecond? 7400 Convert 5.46072mm to meters. 0.00546072 How many millimeters are there in 122947.6km? 122947600000 How many grams are there in 7/2 of a kilogram? 3500 How many years are there in 40.49681 decades? 404.9681 How many milliseconds are there in 4/75 of a minute? 3200 What is 578.7686mm in centimeters? 57.87686 Convert 619.0009 centimeters to micrometers. 6190009 What is 3/10 of a century in decades? 3 What is 3/10 of a milligram in micrograms? 300 Convert 3.743088ml to litres. 0.003743088 How many seconds are there in 5.778458ms? 0.005778458 What is 0.3724501 litres in millilitres? 372.4501 How many grams are there in 3/25 of a kilogram? 120 Convert 1234546.38ns to days. 0.00000001428873125 What is 5149.147 nanograms in tonnes? 0.000000000005149147 How many kilograms are there in 52226.27 milligrams? 0.05222627 What is 3/10 of a century in decades? 3 What is 724047.3 nanometers in micrometers? 724.0473 How many centuries are there in twenty-six fifths of a millennium? 52 How many millilitres are there in 48/5 of a litre? 9600 How many centimeters are there in 1/10 of a kilometer? 10000 Convert 64976.98 millennia to decades. 6497698 What is seven halves of a milligram in micrograms? 3500 What is 11/2 of a century in months? 6600 How many years are there in 21/2 of a decade? 105 How many millilitres are there in 779.998l? 779998 What is four thirds of a hour in seconds? 4800 What is 65644.42ug in kilograms? 0.00006564442 How many decades are there in 63.65743 centuries? 636.5743 What is 7/8 of a litre in millilitres? 875 How many years are there in 31/2 of a millennium? 15500 What is 0.1259057l in millilitres? 125.9057 What is seven halves of a micrometer in nanometers? 3500 How many seconds are there in 6036.415 days? 521546256 What is twenty-nine thirds of a century in months? 11600 What is 7/4 of a microgram in nanograms? 1750 Convert 1167.446 grams to milligrams. 1167446 How many nanometers are there in 11/2 of a micrometer? 5500 How many millimeters are there in 1.639418 kilometers? 1639418 How many micrometers are there in one quarter of a centimeter? 2500 What is 6033.133 micrometers in nanometers? 6033133 What is 18/5 of a meter in millimeters? 3600 How many kilograms are there in 5/8 of a tonne? 625 What is 11/2 of a litre in millilitres? 5500 What is 0.9339862um in meters? 0.0000009339862 How many millilitres are there in one quarter of a litre? 250 How many centuries are there in nine tenths of a millennium? 9 What is 0.901942 decades in years? 9.01942 How many nanometers are there in 3/8 of a micrometer? 375 How many millilitres are there in thirteen quarters of a litre? 3250 What is 502.0453 micrograms in nanograms? 502045.3 How many decades are there in 6.136303 years? 0.6136303 What is 17/6 of a week in hours? 476 How many millilitres are there in one tenth of a litre? 100 What is 17/2 of a microgram in nanograms? 8500 How many decades are there in eighteen fifths of a millennium? 360 What is seventeen quarters of a litre in millilitres? 4250 How many grams are there in 73831.28 nanograms? 0.00007383128 Convert 7.750835 centuries to years. 775.0835 How many millilitres are there in 8/25 of a litre? 320 How many mil	{ "pile_set_name": "DM Mathematics" }
+ 6410. Give -3o(a) + 16x(a). -2a2 - 4a Let q(k) = -19 + k*2 + k - 33 + 0k*2 + 69 - 16. Let u(c) = 3c*2 + 7c + 15. Give 5q(w) - u(w). 2w*2 - 2w - 10 Let n(d) = d*2 - d - 1. Let c be 2/(-2 + (2 - 2)). Suppose -111 = -38x + 41. Let f(g) = -xg - 4 - 5g + 23g2 - 18g*2 + g. Give cf(k) + 6n(k). k2 + 2k - 2 Let r(w) = -4w2 + 2w - 1. Let q(g) be the third derivative of g5/60 - g4/24 + g3/6 - g2 + 116g - 2. What is 6q(p) + 2r(p)? -2p*2 - 2p + 4 Let x(b) = -2b - 7. Let s(f) = -3f - 1609. Determine s(h) - 2x(h). h - 1595 Let y(d) be the third derivative of d6/40 - 2d*5/15 - 11d4/24 + d3/6 - d*2 + 628d. Let w(s) = -s*3 + 3s*2 + 4s. What is -11w(v) - 4y(v)? -v3 - v2 - 4 Let q(y) = -y - 12. Let z(f) = 2556 - f - 653 - 640 - 654 - 634. Calculate -5q(n) + 3z(n). 2n - 15 Let t(h) = -3h*3 + 6h*2 - 4h - 4. Let w(x) be the second derivative of x*5/5 - 7x*4/12 + 5x*3/6 + 2x*2 + 15x - 77. What is 5t(j) + 4w(j)? j*3 + 2j2 - 4 Let i(j) = -j2 - 248j - 79. Let f(u) = u2 + 124u + 34. What is 7f(o) + 3i(o)? 4o2 + 124o + 1 Let s(h) = 62h + 6. Let k(g) = -19 + 7 + 2 + 62g + 17. Determine 6k(u) - 7s(u). -62u Let n(h) = -6h*2 + 5h + 4. Let f(p) = -5p2 + 6p + 4. Let g be 30/(-6) + (-9 + 13)15/6. Give gf(x) - 6n(x). 11x*2 - 4 Let d(a) = 6a2 + a3 + 3 - 9 - 3a3. Let h(r) be the second derivative of r4/12 - r2/2 - r. Let l = -15062 + 15063. Give ld(f) - 6h(f). -2f*3 Suppose 11v = 40v - 841. Let h = -34 + v. Let z(y) = -5y. Let k(t) = 9t. Calculate hz(w) - 2k(w). 7w Let p(x) = -3x3 + 4x*2 + 4x - 6. Let a(u) = 4u - 4 - 2u*3 - 6 + 4u2 - u - u2 + 5. Let q = 4 - 29. Let o = q + 21. Give oa(m) + 3p(m). -m*3 + 2 Let k(m) = m - 91. Let r(p) = 42p - 3640. Let a(y) = -120k(y) + 3r(y). Let t(n) = 2n - 2n - n. Calculate 2a(z) + 10t(z). 2z Let r(z) = 2z*2 + 6z - 1. Let h(w) = -28w2 + 150w + 12. What is -h(b) - 12r(b)? 4b*2 - 222b Let j(m) = 19m - 108. Let x(t) = -18t + 107. What is 3j(g) + 4x(g)? -15g + 104 Suppose -d + 28 = 6d. Let w(k) = -6k - 1. Let s(c) = -13c - 2. Let a be 3/(-4(-4)/(-48)). Determine aw(t) + ds(t). 2t + 1 Let t(b) = 67b + 9. Let i(l) = -7l - 1. Determine 4i(y) + t(y). 39y + 5 Let l(h) = 10h. Suppose 3y + 6 = -4s, 34 - 14 = 4y - 4s. Let k(f) = 4f + 41 - yf - 41 - f. Suppose 4g + 4 = -0. What is gl(a) + 8k(a)? -2a Let d(x) = 3x*2 - 10x - 8. Let t(c) = 9c + 6. Give 2d(a) + 3t(a). 6a*2 + 7a + 2 Let k(y) = -5y3 - 52y*2 - 2. Let m(c) = -26c*3 - 260c*2 + 2c - 9. Give 11k(h) - 2m(h). -3h3 - 52h*2 - 4h - 4 Let z(r) = r*2 - 22r + 97. Let o be z(16). Let d(s) = 26s + 5. Let n(y) = 1. Give od(j) - 5n(j). 26j Let x(r) = 122r + 43. Let j(q) = -3q + 11. Calculate 4j(f) - x(f). -134f + 1 Let q(l) = -23l + 8. Let z(p) = 8p - 3. Let v(f) = 42f - 1355. Let r be v(32). Determine rz(b) - 4q(b). 4b + 1 Let q(r) = -6r2 - 1203r + 4. Let i(j) = -7j2 - 1195j + 6. Calculate -2i(n) + 3q(n). -4n2 - 1219n Let l(i) = -i3 + i2 + i. Let s = 4794 - 4793. Let a(v) = -4v3 + 24v*2 + 6v. What is sa(w) - 6l(w)? 2w3 + 18w*2 Let u(b) = 13b - 27. Let d(y) = 7y - 14. Calculate -13d(o) + 6u(o). -13o + 20 Let y(u) = -2u - 324. Let j(m) = 2m + 324. What is 4j(n) + 5y(n)? -2n - 324 Let r(p) = -5p*2 + 885p - 2. Let y(b) = -2b2 + b - 1. What is r(d) - 2y(d)? -d*2 + 883d Let h(g) = -3g - 4. Let f(n) = 53n + 71. Let i(j) = -f(j) - 18h(j). Let q(l) = -6l - 20. What is 5i(y) + q(y)? -y - 15 Let g(i) = 42i*2 - 7i + 124. Let d(b) = -23b2 + 4b - 63. Determine -7d(c) - 4g(c). -7c2 - 55 Let m(k) = 104k*2 - 14k. Let u(y) = 21y2 - 3y. Let w(n) = -367n + 14. Let f be w(0). Determine fu(t) - 3m(t). -18t*2 Let l(o) = -720o*3 - 2o + 13. Let u(p) = -359p3 - p + 7. Give -6l(w) + 11u(w). 371w*3 + w - 1 Let d(c) = -67c - 2c3 + 9 + 146c - 74c - c3 + 2c*2. Let f = 30 - 28. Let j(r) = -4r*3 + 7r + 3rf + 1 - 6 + 0 + 18. Calculate 7d(u) - 5j(u). -u3 - u2 - 2 Let u(x) = -x2 - 3. Let s(o) = 9o*2 + 294o + 16. What is -s(h) - 5u(h)? -4h*2 - 294h - 1 Let g(i) = -10i2 - 785. Let f(t) = 6. What is -3f(k) + g(k)? -10k2 - 803 Let n(k) = 375k*2 + 45k + 45. Let b(p) = 17p2 + 2p + 2. Let g = -4179 + 4134. Calculate gb(j) + 2n(j). -15j2 Let r(l) = -l + 1. Let t(a) = a3 - 17a*2 - 17a - 23. Let z be t(18). Let o be 29/z - (-5 + 105/25). Let i(x) = -9x + 5. Calculate or(m) + i(m). -4m Let y(j) = -30j + 5. Suppose 431o = 659o + 1140. Let x(s) = -45s + 8. Give ox(t) + 8y(t). -15t Let y = -4687 + 4691. Let t(w) = 351w. Let q(m) = 11m. Calculate yt(o) - 130q(o). -26o Let m(f) = -395f - 14. Let r(u) = -402u - 18. Determine -4m(t) + 3r(t). 374t + 2 Let i(n) be the third derivative of -6n2 - 1/6n*4 - 1/3n*3 + 0n + 0. Let v(j) = j. Let o(f) = -f. Let h(r) = 4o(r) + 5v(r). Give h(l) + i(l). -3l - 2 Let r be 20 + 24/156 + 4/(-26). Suppose y - 2m = -2, 3y + r = 8y - 4m. Let x(t) = -10t - 14. Let k(s) = 7s + 9. What is yk(i) + 5x(i)? 6i + 2 Suppose -145j + 460 = -665j - 580. Let b(v) = -69v3 - 11v*2 + 11v - 11. Let w(h) = 14h3 + 2h*2 - 2h + 2. Give jb(q) - 11w(q). -16q3 Let p(i) = i2 - 1. Let d be ((-44)/(-12) - 3)4518/(-12). Let s = 249 + d. Let r(m) = m*3 + 2m*2 + 2m - 2. Give sp(v) + r(v). v3 + 2v Let f(o) = -395o - 3. Let s(r) = 376r + 4. What is 6f(q) + 5s(q)? -490q + 2 Let v(c) = c. Let a be -1 - 0(-7)/119. Let j(p) = -32p2 - 16p. Calculate aj(z) - 16v(z). 32z2 Let l(o) = -7o*2 - 4o + 4. Let w(m) be the second derivative of 1/2m3 - 3/2m*2 + 1/2m*4 - 14m - 4. Calculate 3l(k) + 4w(k). 3k2 Let i(l) = 2 + 0 + 6l + 2. Let w(k) be the third derivative of k*4/4 + 5k3/6 + k2 + 19222k. Calculate -5i(o) + 4w(o). -6o Let z(k) = -k*2 + 1. Let o(b) = -3b*2 + 55b + 37. Let a be o(19). Let g(x) = -3x3 + 2x*2 - 4. Give ag(d) - 4z(d). 3d*3 + 2d2 Let w(g) be the second derivative of -g2/2 - 1267g. Let p(o) = 3o*2 + 10o - 6. Determine p(f) - 6w(f). 3f*2 + 10f Let r(t) = -181. Let g(o) = o - 143. What is 4g(j) - 3r(j)? 4j - 29 Let s(r) = -96r + 221. Let q(d) = 81d - 221. Determine 6q(w) + 5s(w). 6w - 221 Let x(h) = -6h3 - 5h - 5. Suppose -3u + 60 = 2u. Let m(j) = 879j2 - 15j*3 - u - 12j - 879j2. Suppose 19 - 7 = i. Give ix(q) - 5m(q). 3q3 Let t(h) = h2 - 4h + 1. Let d(z) = 12z*2 - 14z + 9. Determine d(f) - 3t(f). 9f*2 - 2f + 6 Let g(r) = -r*2 + 4r. Let p(f) = -72f2 + 5f. What is 2g(q) + p(q)? -74q*2 + 13q Let u(m) be the third derivative of -11m4/24 + m3 - 1204m*2. Let w(f) = 32f - 17. Calculate -11u(l) - 4w(l). -7l + 2 Let g(l) = 7l*2 - 2l - 7. Let q(o) = -120o2 + 35o + 120. Let p be 1992/60 + 45/25. Give pg(r) + 2q(r). 5r2 - 5 Let d be 4 - (7 - 2 - -6 - 48/6). Let c(j) = -j. Let b(u) be the third derivative of u4/24 + u3/6 - u2. What is dc(x) + 3b(x)? 2x + 3 Let u(r) = -578. Let v(f) = f + 1151. Give 5u(y) + 3v(y). 3y + 563 Let w(z) be the third derivative of z6/120 + z5/12 + z4/8 - 5z*3/6 - 2z*2 + 388z. Let b(r) = -r*3 - 2r*2 - 2r + 2. Give -5b(d) - 2w(d). 3d3 + 4d Let s(n) = -2n2 + 33n + 2. Let y(r) = -3r2 + 55r + 3. Let w(h) = -5s(h) + 3y(h). Let d(i) = -2i3 - 4i*2 - 25i + 6. What is -d(k) - 6w(k)? 2k*3 - 2k*2 + 25k Let m(j) = -11j3 + 5j*2 - 5j - 5. Let u(b) = -12b3 + 4b*2 - 4b - 4. Let q be (-70)/(-4)420/1470. What is qu(z) - 4m(z)? -16z*3 Suppose -3g + 0g = 126. Let a(l) = 32l - 8l - 5 - 11l - 16l + 17l. Let b(t) = 119t - 42. Calculate ga(s) + 5b(s). 7s Let o(b) = -17b2 - 27b + 112. Let d(a) = 6a2 + 10a - 36. Give -8d(u) - 3o(u). 3u2 + u - 48 Let a(j) = -2j - 15. Suppose -5 + 27 = 2y + 2h, 8 = -4h. Let t be 4/38 + ((-4032)/76)/(-9). Let x(f) = -4f + 0 + 2 + 5f + 5. Give ta(i) + yx(i). i + 1 Let o(g) = 6g - 1965. Let m(j) = -8j + 1971. Give 4m(t) + 5o(t). -2t - 1941 Suppose 2k + 2a = 0, 85a = k + 80a - 30. Let s(x) = 19x2 + 5. Let l(h) = 48h*2 + 12. Determine kl	{ "pile_set_name": "DM Mathematics" }
2 - 167. 1194d*2 Collect the terms in 6 + 2 - 79z + 0 + 41z + 30z. -8z + 8 Collect the terms in -9j*3 - 11j*3 + 5j*3 - 3j*3 + 6j*3. -12j*3 Collect the terms in 91n + 97n - 274n + 91n. 5n Collect the terms in 2l - 53l + 10l + 32l - 2l2 + 9l. -2l2 Collect the terms in -6730r*2 - 7335r*2 - 198r*2. -14263r*2 Collect the terms in 0y - 2456 + 0y + 30y*3 - 31y3. -y3 - 2456 Collect the terms in 3a3 - 1684808a + 1684808a. 3a*3 Collect the terms in 137l*2 - 7l*2 - 54l*2 - 36l*2. 40l*2 Collect the terms in -3 - 38w - 62w - 12w. -112w - 3 Collect the terms in -2n*2 + 3n - 3n + 80 - 95. -2n*2 - 15 Collect the terms in -6071a + 3032a + 3030a. -9a Collect the terms in y + 26776y*2 - 27881y*2 - y. -1105y*2 Collect the terms in -6k + 4k3 - 3k + 9k. 4k*3 Collect the terms in -13u + 41u - 5u + 18u + 8u. 49u Collect the terms in -127 + 60r + 39 + 47 + 42. 60r + 1 Collect the terms in 8 + 260i*2 - 95i*2 - 133i*2. 32i*2 + 8 Collect the terms in 18446787 + 33w - 18446787. 33w Collect the terms in 3j*3 + 34j + 33j3 - 19j - 12j - 12j*3. 24j*3 + 3j Collect the terms in 2c + 6c - c - 13c - 8c. -14c Collect the terms in 3f*3 + 48715159f*2 - 48715159f*2. 3f*3 Collect the terms in -255298s*3 + 510659s*3 - 255362s3. -s3 Collect the terms in -302v - 2446v*2 - 2447v*2 + 302v + 7333v2 - 2441v2. -v2 Collect the terms in 17419s + 2718s - 4570s + 31917s. 47484s Collect the terms in -4b - 3b2 - 3b*2 + 101b + 3b2. -3b*2 + 97b Collect the terms in 257t - 7t*2 + 198t - 455t. -7t*2 Collect the terms in 1 - 1 + 283q - 379q. -96q Collect the terms in -154w + 419w + 234w + 110w. 609w Collect the terms in 2p*3 + 37p*2 - 71p*2 + 999 + 34p*2. 2p*3 + 999 Collect the terms in -2 - 2 + 4 + 250691v - 250691v + 10v*2. 10v*2 Collect the terms in 2782d*3 + 2763d*3 - 8344d*3 + 2778d*3. -21d*3 Collect the terms in 1878 + 32h - 1878. 32h Collect the terms in 1240w + 347w + 236w. 1823w Collect the terms in 18870d*2 - 18870d*2 + 2047d*3. 2047d*3 Collect the terms in -113f*2 - 3 - 166f*2 - 2f + 5. -279f2 - 2f + 2 Collect the terms in 201y - 407y - 2y2 + 206y. -2y2 Collect the terms in -4v*2 - 13 - 163 + 3v*2 + 3v*2. 2v*2 - 176 Collect the terms in -10q - 13q - 15q + 21q. -17q Collect the terms in 44 - 42 + 0i - 549i*2 + i - 580i*2. -1129i*2 + i + 2 Collect the terms in -124658j*2 + 12j*3 + 124658j*2. 12j3 Collect the terms in z2 + 4805z - 2482z - 2323z. z2 Collect the terms in 15i + i*3 - 5i - 10i - 247. i3 - 247 Collect the terms in h - 14h - 28h - 30h + 18h. -53h Collect the terms in 20x3 - 383486 + 383486. 20x*3 Collect the terms in -22f + 15f + 42f + 20f. 55f Collect the terms in -181472081g + 181472081g + 8g3. 8g*3 Collect the terms in 10260u*2 - 30784u*2 + 10278u*2 + 10267u*2. 21u*2 Collect the terms in 933c*2 - 3679 + 3679. 933c*2 Collect the terms in -4 - 9c + 0 - 173c2 + 3. -173c*2 - 9c - 1 Collect the terms in -6752a - 4 + 4 - 3486a. -10238a Collect the terms in -247d + 698d + 1336d + 865d. 2652d Collect the terms in 48s2 + 189s*2 - 240s*2. -3s*2 Collect the terms in -86o + 7o + 6o + 34o. -39o Collect the terms in 902m + 1126m + 936m - 983m. 1981m Collect the terms in -2c - 4 + 441 - 437. -2c Collect the terms in 3h*2 + 3 - 69h*3 - 165h*3 + 21h3 - h2. -213h3 + 2h*2 + 3 Collect the terms in -173j*3 + 112j*3 + 138j*3 + 157j*3. 234j*3 Collect the terms in -33662o + 22o2 - 33663o + 134653o - 33662o - 33666o. 22o*2 Collect the terms in 78893b - 1 - 2 - 78901b. -8b - 3 Collect the terms in -4w - 395094w*2 + 395093w*2 + 4w. -w*2 Collect the terms in 32z*2 - 63z*2 + 6 - 5. -31z*2 + 1 Collect the terms in -38 + 5j + j + 4j - 9j. j - 38 Collect the terms in 6 - 3 + 178u3 - 11 + 4 + 5. 178u*3 + 1 Collect the terms in -10696y*2 + 47 + 10651y*2 - 47. -45y*2 Collect the terms in -140f - 281f + 402f. -19f Collect the terms in 1345y*2 + 446y*2 - 97y*2. 1694y*2 Collect the terms in -12148s + 12148s + 9s*3 - 31s*3. -22s*3 Collect the terms in 98071q - 48972q - 3q*3 - 49099q. -3q3 Collect the terms in -10382s*3 + 5202s*3 + 5138s*3. -42s*3 Collect the terms in 906n + 6n3 - 3n*2 - 906n - 2. 6n3 - 3n*2 - 2 Collect the terms in 0y2 + 632 - 1890 - y2 + 621 + 637. -y*2 Collect the terms in -1453i*2 + 19i - 1453i2 - 19i + 2907i2. i2 Collect the terms in 79a*3 - 297a*3 + 70a*3 + 75a*3 + 69a*3. -4a*3 Collect the terms in -19a - 27a - 3a + 16a - 26a. -59a Collect the terms in -2680n*2 - 2675n*2 - 2675n*2 + 10699n*2 - 2672n*2. -3n*2 Collect the terms in 40108d + 1 - 40111d - 2. -3d - 1 Collect the terms in -24q2 - q + q - 12q*2 + 26q*2. -10q*2 Collect the terms in -280d + 237d + 1214d + 1020d. 2191d Collect the terms in -3a + 4 + 0 + a - 6a. -8a + 4 Collect the terms in 958s - 2928s + 975s + 983s. -12s Collect the terms in -36w2 + 2w + 64 - 18 - 46. -36w2 + 2w Collect the terms in 545b - 1037b + 497b. 5b Collect the terms in -997a2 - 645a*2 - 358a*2 + 152a*2. -1848a*2 Collect the terms in -13m*2 + 14m*2 - 3 + 15m*2. 16m*2 - 3 Collect the terms in 147 - 147 + 2836c*2. 2836c*2 Collect the terms in -g + g + 493713g*2 - 493716g*2. -3g*2 Collect the terms in -478u*3 + 480u*3 + 31u*2 - u - 2u + 3u. 2u*3 + 31u*2 Collect the terms in 0n*3 - 9n*3 - 5n*2 + 2n + 22n. -9n*3 - 5n*2 + 24n Collect the terms in 78r2 - 2165074 + 2165074. 78r*2 Collect the terms in 171 - 316 + 2j - 3j + 145. -j Collect the terms in 656f*2 - 1084f*2 - 1160f*2 - 308f*2. -1896f*2 Collect the terms in -22w*2 - 73w*2 + 16w*2 + 3w. -79w2 + 3w Collect the terms in 7652 - 7657 - 4a + 3a. -a - 5 Collect the terms in 2 - 17z2 - 4 - 24 - 39z*2. -56z*2 - 26 Collect the terms in 2q*2 + 3 + 3046q*3 - 1 - 2629q*3 + 5696q*3. 6113q*3 + 2q*2 + 2 Collect the terms in -229c + 110c + 17c + 99c. -3c Collect the terms in -2g3 + 49841113 - 49841113 - 2g*3. -4g*3 Collect the terms in -663a*2 + 4884a*2 + 3585a*2 + 2a - 313a2. 7493a*2 + 2a Collect the terms in 788j + 780j - 3138j + 801j + 794j. 25j Collect the terms in -9u3 - 13u*2 - 10u*3 + 5u*2 + 8u*2 + 20u3. u3 Collect the terms in -1117b + 2b2 + 590 - 597 - b2. b*2 - 1117b - 7 Collect the terms in 10963221g2 - 10963221g*2 - 22g*3. -22g*3 Collect the terms in 13p*3 - 1128p*3 - 640p*3. -1755p*3 Collect the terms in 9v + 5v - 19v + 4v + 1678. -v + 1678 Collect the terms in -352p*3 + 884p*3 - 11373p*3. -10841p*3 Collect the terms in -763s*3 - 12s*3 - 4280s*3 - 2297s*3. -7352s*3 Collect the terms in 0x*2 + 2x*2 - 10x*2 - 8x*2 - 11x*2. -27x*2 Collect the terms in 1785y - 1539y - 245y. y Collect the terms in -8s2 - 7159838s - 31s2 + 7159838s. -39s2 Collect the terms in -794q - 5667q - 2180q. -8641q Collect the terms in 23u*2 - 9130426 + 9130426. 23u*2 Collect the terms in -254 - 19n + 46n + 254. 27n Collect the terms in -40209z2 - 32744z*2 + 18173z*2 + 2. -54780z*2 + 2 Collect the terms in 152r - 302r - r2 + 150r - 4r2. -5r*2 Collect the terms in -285 - 6c + 6c + 48c*2 - 50c*2. -2c*2 - 285 Collect the terms in -67z*2 - 8 - 1 - 106z*2 - 10z*2 + 8. -183z*2 - 1 Collect the terms in -1497h*2 - 6h*3 - 1507h*2 + 3680h*2 - 676h*2. -6h*3 Collect the terms in 4206g*3 - 1386g*3 - 1380g*3 - 1406g*3. 34g*3 Collect the terms in -102c*2 + 18c*3 + 213c*2 - 110c*2. 18c3 + c2 Collect the terms in 19 + 14 + 8h2 + 26h - 33. 8h2 + 26h Collect the terms in -867j - 736j + 1600j. -3j Collect the terms in 1 + 4b - 5 - 5b + 0. -b - 4 Collect the terms in p + 226364 - 3p - 226364 - 3p. -5p Collect the terms in 10016d*2 + 1 - 1 - 32238d*2. -22222d*2 Collect the terms in 19f**3 +	{ "pile_set_name": "DM Mathematics" }
at is next in 1583841, 1583800, 1583699, 1583508, 1583197? 1582736 What is next in 28817, 115298, 259445, 461258, 720737, 1037882? 1412693 What is the next term in -110809, -110814, -110819, -110824, -110829? -110834 What is the next term in -24768, -23577, -22384, -21189, -19992, -18793? -17592 What comes next: 67464, 269759, 606942, 1079019, 1685996? 2427879 What is the next term in 28515274, 57030545, 85545816, 114061087, 142576358? 171091629 What comes next: -93, -114, -53, 102, 363? 742 What is the next term in -9254791, -9254659, -9254527, -9254395? -9254263 What is next in -4215014, -16860114, -37935280, -67440512, -105375810, -151741174, -206536604? -269762100 What is next in -445, -55, 499, 1211, 2075, 3085, 4235? 5519 What is the next term in -13439, -13435, -13427, -13415, -13399, -13379, -13355? -13327 What is next in -4041, -32161, -108475, -257079, -502069, -867541, -1377591, -2056315? -2927809 What is the next term in -4844, -6908, -10338, -15128, -21272, -28764, -37598? -47768 What comes next: -10385, -9675, -7751, -4007, 2163, 11365, 24205? 41289 What is next in 23924107, 47848212, 71772317, 95696422? 119620527 What comes next: -6771, -6317, -5851, -5367, -4859, -4321, -3747? -3131 What is the next term in 1422, 1423, 1426, 1431, 1438? 1447 What comes next: 334727216, 334727221, 334727228, 334727237, 334727248? 334727261 What is next in -254, -1223, -4026, -9581, -18806, -32619, -51938, -77681? -110766 What comes next: -2758, -5753, -8734, -11701, -14654, -17593? -20518 What comes next: 2016, 15555, 52146, 123315, 240588, 415491? 659550 What comes next: 6855, -390, -7637, -14886, -22137, -29390? -36645 What is next in 42713126, 85426251, 128139376? 170852501 What is the next term in -345536896, -345536895, -345536894, -345536893? -345536892 What comes next: 66, 1288, 3294, 6066, 9586, 13836, 18798? 24454 What is next in 994, 1096, 1178, 1240, 1282, 1304? 1306 What is the next term in 296443, 592728, 888853, 1184818? 1480623 What is next in -724267, -724332, -724397, -724462, -724527? -724592 What is next in -398, -1479, -3340, -6029, -9594, -14083, -19544? -26025 What is next in -10720868, -10720874, -10720880, -10720886, -10720892, -10720898? -10720904 What is next in 80199, 80184, 80167, 80148, 80127, 80104, 80079? 80052 What is the next term in 554927, 554981, 555035? 555089 What is the next term in 59857, 119868, 179883, 239902, 299925, 359952? 419983 What is the next term in -346563, -1386295, -3119191, -5545257, -8664499? -12476923 What comes next: -31663, -31605, -31547, -31489? -31431 What is the next term in -35875, -35034, -33623, -31636, -29067, -25910? -22159 What is the next term in 538953, 1077918, 1616883, 2155848, 2694813? 3233778 What is next in 1667736, 3335480, 5003232, 6670992, 8338760? 10006536 What is the next term in -16513, -16487, -16381, -16141, -15713, -15043, -14077? -12761 What comes next: -4432, -4183, -3778, -3223, -2524, -1687, -718? 377 What is next in -10908, -20946, -30116, -38418, -45852, -52418, -58116? -62946 What comes next: 61197809, 61197815, 61197821, 61197827, 61197833, 61197839? 61197845 What is the next term in 5033, 11896, 20593, 31124, 43489, 57688, 73721? 91588 What is the next term in 30501, 31259, 32521, 34287? 36557 What comes next: -132423, -265269, -398121, -530979, -663843? -796713 What comes next: -91, -922, -3293, -7978, -15751, -27386? -43657 What comes next: 24818, 24736, 24574, 24326, 23986, 23548? 23006 What comes next: -59, -197, -565, -1319, -2615, -4609? -7457 What is the next term in -623690, -1246971, -1870252, -2493533, -3116814? -3740095 What is the next term in -2754735, -2754708, -2754657, -2754576, -2754459, -2754300, -2754093, -2753832? -2753511 What is the next term in -9166, -18349, -27538, -36733? -45934 What is next in 32491, 31996, 31507, 31024? 30547 What comes next: -120388, -240482, -360276, -479764, -598940, -717798, -836332? -954536 What comes next: 159, 506, 827, 912, 551? -466 What comes next: 673770, 1347145, 2020520, 2693895? 3367270 What is next in -2303, -2255, -2181, -2075, -1931? -1743 What comes next: 229570, 459079, 688562, 918007, 1147402? 1376735 What is the next term in 10380256, 10380238, 10380208, 10380166, 10380112, 10380046? 10379968 What is the next term in 29080, 58262, 87444, 116626, 145808? 174990 What is the next term in -510, -1368, -2544, -4056, -5922, -8160? -10788 What is the next term in 251444, 251583, 251722, 251861, 252000? 252139 What is the next term in -757501, -3029946, -6817353, -12119722? -18937053 What is the next term in 1433693, 1433682, 1433667, 1433648, 1433625, 1433598? 1433567 What is the next term in -256, -501, -690, -817, -876? -861 What is the next term in 1816976, 1817343, 1817710, 1818077? 1818444 What is the next term in -49821, -99121, -148421, -197721? -247021 What comes next: -1980567, -1980645, -1980775, -1980957, -1981191, -1981477? -1981815 What comes next: -39832512, -79665028, -119497544, -159330060, -199162576, -238995092? -278827608 What is next in 41191067, 82382132, 123573197? 164764262 What is next in -19723497, -78893895, -177511233, -315575517, -493086753, -710044947? -966450105 What is next in 24798, 23194, 21590? 19986 What is next in -44804, -88864, -132936, -177026, -221140, -265284, -309464? -353686 What is next in 13327903, 26655782, 39983661, 53311540, 66639419, 79967298? 93295177 What comes next: 22430, 44821, 67204, 89573, 111922, 134245, 156536? 178789 What comes next: -527156, -527177, -527198? -527219 What is next in -146326, -292664, -439000, -585334, -731666, -877996? -1024324 What comes next: -32102, -64074, -95890, -127544, -159030, -190342, -221474? -252420 What is next in -198549, -794153, -1786827, -3176571? -4963385 What is next in -54994, -110153, -165312, -220471, -275630, -330789? -385948 What is next in 1328, 10746, 36342, 86216, 168468, 291198, 462506, 690492? 983256 What is next in 56193254, 112386510, 168579764, 224773016, 280966266, 337159514? 393352760 What is the next term in -119413673, -119413680, -119413687? -119413694 What is next in 21798866, 21798868, 21798872, 21798878, 21798886, 21798896? 21798908 What comes next: -101446, -101500, -101554, -101608, -101662? -101716 What is next in 6275393, 6275395, 6275397? 6275399 What is the next term in -655, -1215, -1785, -2383, -3027, -3735, -4525, -5415? -6423 What is the next term in 2973909, 2974143, 2974377, 2974611, 2974845, 2975079? 2975313 What is next in -3205, -13818, -31539, -56368, -88305, -127350? -173503 What is next in 125494, 124336, 123178, 122020? 120862 What is the next term in -143961, -287987, -432013, -576039, -720065? -864091 What comes next: -991250, -1982522, -2973794? -3965066 What is the next term in -217124, -433334, -649544, -865754, -1081964, -1298174? -1514384 What is the next term in -20441, -40993, -61647, -82403? -103261 What is next in -3621909, -7243796, -10865671, -14487528, -18109361? -21731164 What is next in 117110, 117815, 118522, 119231, 119942, 120655? 121370 What comes next: 637896, 637908, 637920, 637932, 637944, 637956? 637968 What is the next term in 626, 589, 546, 497, 442, 381, 314? 241 What comes next: 33177824, 33177778, 33177730, 33177680, 33177628, 33177574, 33177518? 33177460 What is next in -1907, -14793, -49599, -117233, -228603, -394617, -626183, -934209? -1329603 What is next in -66324643, -132649287, -198973931? -265298575 What is next in 1712, 1728, 1820, 1982, 2208, 2492, 2828, 3210? 3632 What comes next: 3115457, 6230837, 9346217, 12461597, 15576977, 18692357? 21807737 What comes next: 85698152, 171396306, 257094460, 342792614, 428490768? 514188922 What comes next: 11074, 10688, 9654, 7648, 4346, -576, -7442? -16576 What is the next term in -5045, -9564, -14083, -18608, -23145? -27700 What is next in 11347, 9032, 6719, 4408, 2099? -208 What is the next term in 607, 528, 389, 184, -93, -448, -887? -1416 What is the next term in -8953, -17632, -26329, -35044? -43777 What is the next term in -251471, -502335, -752589, -1002233, -1251267? -1499691 What is next in -611615, -1223310, -1835005, -2446700, -3058395? -3670090 What is the next term in -88213114, -88213117, -88213120, -88213123, -88213126? -88213129 What is next in -3529, -3570, -3629, -	{ "pile_set_name": "DM Mathematics" }
ns digit of w? 1 Let z(n) = -n*3 - 14n*2 + 14n - 12. Let k be z(-15). What is the units digit of (48/(-20) + k)15? 9 Suppose l - 8 + 31 = 0. Let q = -15 - l. What is the units digit of q? 8 Let i = 79 - 43. What is the units digit of i? 6 Let r be 18/(4 + (-4 - -1)). Let u = -6 + r. What is the units digit of u? 2 What is the tens digit of 1328/12 + -2 + (-3)/(-9)? 0 Let l(g) = -g - 16. Let j be l(0). Let m = j - -1. Let t = -9 - m. What is the units digit of t? 6 Suppose -22 + 7 = -3x. Suppose 5f = 5c - 0f - 25, -xc - 3f = -9. What is the units digit of c? 3 Let y = -11 + 20. What is the units digit of y? 9 Let w(c) = 24c*2 - 2c. What is the units digit of w(-1)? 6 Suppose 0f = -c - 5f + 37, 3c - 11 = 5f. Suppose -c = -6p + 2p. What is the units digit of p? 3 Suppose 0 = -7h + 2h + 75. Suppose 5b = 5x - 32 - 23, 2x - h = -5b. Suppose 5g - x = 5. What is the units digit of g? 3 What is the tens digit of (177/(-2))/(4/(-8))? 7 Suppose 70 = -4x + 9x. What is the tens digit of x? 1 Suppose -4k + 25 + 21 = 3s, 0 = -4s + 3k + 28. Suppose -3x + 2x = -s. What is the units digit of x? 0 Let a = 30 + -49. Let g = -9 - a. What is the tens digit of g? 1 Let h = 12 - -2. What is the tens digit of h? 1 Let q(x) = 9x + 8. What is the tens digit of q(2)? 2 Let k = -3 - -53. What is the tens digit of k? 5 Let p(f) = 5f - 1. Let w = 0 - -2. Suppose 6 = -4o - 2d, 0o + wd = o - 11. What is the units digit of p(o)? 4 Suppose 2u = 4, -u = -4h + 4u + 2. Suppose -3t + 2w - 5w = -30, -38 = -ht + 5w. What is the tens digit of t? 1 Suppose -4c + 716 = 4y, -2 = -3c + 7. What is the tens digit of y? 7 Let g be (0 - -4)6/8. Suppose 4t + 1 = -3, 5p - 12 = -gt. What is the units digit of 6/9 - (-34)/p? 2 Suppose -4g = 2x - x - 47, 74 = 2x + 3g. What is the tens digit of x? 3 Suppose 0 = -j - 3j + 24. Let x(p) = 6p - 5. What is the tens digit of x(j)? 3 Let h = 0 - -1. Suppose s = u - 4s - 13, -2u = -s + h. What is the units digit of 3/2 + (-1)/u? 2 Let q be 131/5 - 1/5. Let g = -16 + q. What is the tens digit of g? 1 Let t(j) = -3j3 - 2j + 1 + j2 - j3 + 0j3 + 0. Let d be t(1). What is the units digit of ((-7)/(-4))/((-1)/d)? 7 Let o(f) = -5f + 1 - 2f + 0f + 6f. Let d(p) = -2. Let y(a) = -4d(a) - 3o(a). What is the tens digit of y(5)? 2 Suppose 2f - 31 = 3l - 7, l = -f + 17. What is the units digit of f? 5 Let w(a) = a. Let h be w(2). Suppose -v - hv = -54. What is the units digit of v? 8 Let j(x) be the first derivative of 3x2/2 + 2x + 3. What is the units digit of j(4)? 4 Suppose -u + 35 + 13 = 0. What is the tens digit of u? 4 Let m be (-1 + -5)/(2/2). What is the tens digit of ((-12)/(-15))/(m/(-105))? 1 Suppose x + 2f = 19, -3x + 43 = x - 3f. What is the tens digit of x? 1 Suppose 5h - 14 = -z, h = -4h + 5. What is the units digit of z - (6 - (-8)/(-2))? 7 Let o(j) = j3 - 7j*2 + 5j + 1. Let v be o(6). What is the units digit of (-22)/v - 4/10? 4 Let c(m) = -12m + 40. Let d(i) = 3i + 3 - 7 - 1 - 5. Let h(j) = 2c(j) + 9d(j). What is the tens digit of h(8)? 1 Suppose 2j - 83 = 3g, 4j - 4g = 22 + 150. What is the tens digit of j? 4 Let a be ((-160)/(-25))/((-4)/(-70)). Suppose 0 = -2w - 2w + a. What is the units digit of w? 8 Let c(i) = -i*3 + 8i*2 - 5i - 5. Let d be c(7). Suppose 2k - 23 = d. Suppose -k = -5j + j. What is the units digit of j? 4 Suppose j - 4j = -21. What is the units digit of j? 7 Suppose 2l = 9 + 5. Let y be (-2)/l - (-248)/(-14). Let c = y + 30. What is the units digit of c? 2 Let r = 7 - -1. Suppose 278 = 5f + r. Suppose 0 = 2p + 4y - 28, 5p + y + y = f. What is the tens digit of p? 1 Let v = -183 + 331. What is the tens digit of v? 4 Suppose 4v - 3x - x + 16 = 0, -3x = -6. Let w = 10 + v. What is the units digit of w? 8 Let y be (0 - 1)/((-2)/10). Suppose s - 5u + 17 = 2s, yu = 10. What is the units digit of s? 7 Let w = 95 - 47. What is the units digit of w? 8 Suppose -4m + 2g = 3g + 22, m + 4 = -g. What is the units digit of (-29)/(-2) + m/4? 3 Let z = 10 - 5. Suppose -a + 4s = -0a + 5, -zs + 75 = 5a. What is the units digit of a? 1 Let n be 0/(-3) + 1 + 15. Suppose 2p = n + 26. What is the units digit of p? 1 Let y(o) = 2o2 - 3o - 4. Let x be y(3). Suppose -9 = -5u - 4. Suppose u = -xb + 36. What is the units digit of b? 7 Let b(h) = h*3 + 8h2 + h + 9. Let d be b(-8). What is the units digit of 5/(7/2 - d)? 2 Let l = 15 + 1. What is the units digit of l? 6 Let b(c) = -4 - c2 + 0 + 2c2 + c. Let n = -3 - 0. What is the units digit of b(n)? 2 Let h = 104 + -72. What is the units digit of h? 2 Suppose 77 = 2a - 3r, -4a + 2a = 5r - 117. What is the units digit of a? 6 Let r(k) = 2k2 + 9k + 1. What is the units digit of r(-6)? 9 Suppose -1 = -y + 2. Suppose -4n + y = -1. What is the units digit of n? 1 Let m be 44/20 - 1/5. Suppose -6 = -2a - mn + 4n, -3n - 3 = 3a. What is the units digit of a? 1 Suppose 0 = 7b - 593 + 194. What is the tens digit of b? 5 Let q = 5 + -8. What is the tens digit of (q/(-6))/((-1)/(-42))? 2 Let l = 16 - 10. What is the units digit of (21/l)/(-7)-16? 8 Suppose -29t = -25t. Let h = 6 + -4. Suppose 0 = -s - t + h. What is the units digit of s? 2 Let r be 70/(-4) + 2/(-4). Let m be (-273)/(-11) + 8/44. Let f = m + r. What is the units digit of f? 7 Let w(l) = -l*3 - 2l*2 + 4l + 3. Let u be w(-3). Let z be u - 2/(-4 + 2). Suppose -5s = -26 + z. What is the units digit of s? 5 Let n = -18 - -2. Let q be 14/(-49) + n/(-7). Suppose -24 = qz - 66. What is the tens digit of z? 2 Let r = 15 - 9. Suppose 30 = rz - z. What is the units digit of z? 6 Suppose -z - 4 = -3n - 13, -2z = -5n - 17. Let k(f) = f*3 - 7f*2 - 3f + 5. Let m be k(z). What is the units digit of (-3)/(-7) + (-420)/m? 9 What is the tens digit of (13/(-3) + 3)(-90)/4? 3 Let p(f) = -2f*3 - 2f*2 + f - 2. Let k be p(-2). Suppose 3i - 48 = -kl, 7 = 3i - 2l - 23. What is the tens digit of i? 1 Let i = -1 - -10. Let z = i - 4. Suppose 0 = 3n - 3b - 21, -zn + 4b = 3b - 27. What is the units digit of n? 5 Let t be 8/5(-10)/(-4). Suppose -22 = -tm - 3r, -2r = 5m - 6r - 12. What is the units digit of m? 4 Suppose 0 = 5z + 4a - 225, 0z + 4a + 62 = 2z. What is the tens digit of z? 4 Suppose -13x + 8x = -255. What is the units digit of x? 1 Let p(i) = -i3 - 3i*2 + 5i + 4. Suppose 5m + 5v + 30 = 0, 4m + 5v - 4v = -18. Let k be p(m). Suppose 0 = 2x - kx - 10. What is the units digit of x? 5 Let n = 41 - 16. Suppose 5s - n = -5. Suppose -5v = -0v + a - 11, 5v - 6 = sa. What is the units digit of v? 2 Suppose -2m + 486 = 4m. What is the tens digit of m? 8 Let g be (-4)/(-7)21/6. What is the units digit of (1/g)/((-2)/(-40))? 0 Let r be (-20)/(-3)6/4. Let k = -5 + r. Suppose -5u + kc + 60 = 0, 7 = u + c - 5. What is the units digit of u? 2 Let d = -138 + 223. What is the tens digit of d? 8 Suppose -96 = -7j + 3j + 4b, b - 90 = -5j. Let w = j - 8. Let p = w + -8. What is the units digit of p? 3 What is the tens digit of (-138)/(184/(-112) + (-1)/(-7))? 9 Let t(s) = s*2 + 4s - 6. Suppose 4o - 42 - 70 = 0. Suppose -5b = -2r - 19, -o = 3r + 4b - 11. What is the tens digit of t(r)? 1 Let o(w) = -w3 - 5w*2 - 5w - 6. What is the units digit of o(-5)? 9 Let n = 2 + 0. Suppose 2t = -4k + 12, k - 1 = t + n. What is the units digit of 1 - (t - (2 - 0))? 3 Let w = -2 + 19. Let l = w - 15. What is the units digit of l? 2 What is the units digit of (281 - 1)/4 + 3? 3 Let b be (-16)/24 - (-110)/(-6). Let j = 5 - b. What is the units digit of j? 4 Let u = 442 + -316. What is the tens digit of u? 2 Let l = -161 - -275. What is the hundreds digit of l? 1 Suppose 2n - 57 = -n. Let v = n + -11. What is the units digit of v? 8 Suppose 0 = 2h - 4, -2s = 3h - 30 + 4. Suppose 0 = 4g - s + 2. What is the tens digit of (4 - -7) + (g - 1)? 1 Suppose -1 = o - 3. Let i be (6/8)/(o/48). Let h = i - 9. What is the units digit of h? 9 Let n(j) = 2j - 4 + 0 + 1. Suppose 2 = -k + 6. What is the units digit of n(k)? 5 Suppose -5g = -2 - 18. Suppose 0 = h - 6h + l + g, 2 = 3*h - l. What is the tens digit of (-67)/(-3) - h/3? 2 Let k = 56 + -24. What is the tens digi	{ "pile_set_name": "DM Mathematics" }
Let i be -2 + 6 + 9/((-36)/14). What is the smallest value in -2, i, -27? -27 Let f be -21 - (0 - (-7)/(-7)). Let u be -3 + f + 14/4. What is the third biggest value in 0.4, u, -2/7? u Let t = -157.86 + 3.86. Let z = 153.9 + t. Which is the biggest value? (a) -0.4 (b) -1.7 (c) z c Let l = 11 + -10. Let v = 1.41 - 1.71. What is the third smallest value in l, -4, 0.1, v? 0.1 Let x = -140.8249 + 0.1249. Let p = -141 - x. Let d = 6 + -4. Which is the biggest value? (a) 3/4 (b) d (c) p b Let x = 1385 - 1385.7. Let j = -0.07 + 0.66. Let d = x + j. Which is the smallest value? (a) d (b) -1/5 (c) 3 b Suppose 20s - 17s - 15 = 0. Suppose 0 = su - 3u. Which is the second smallest value? (a) -5 (b) u (c) 2/11 b Let a be (0 - (-2)/(-2))-366. Let b(o) = -o*3 + a + 4o*2 - 366 - 2o. Let z be b(3). What is the second biggest value in -0.4, z, 4? z Let m = 2.6 + 70.4. Let i = m + -72.9. What is the second biggest value in i, -0.4, -5? -0.4 Let h be 34/(-5) - -7 - 13/15. Which is the second biggest value? (a) 1/8 (b) -149 (c) h c Let z be (-1015)/(-56) + 21/(-16). Let u = 33/2 - z. What is the second biggest value in -8, u, 2, -0.3? -0.3 Let i = -0.5 - -0.1. Let n = -0.6967 - -0.5967. What is the third smallest value in n, i, -0.04? -0.04 Let u = -11.811 - 2.189. Which is the second smallest value? (a) -0.3 (b) u (c) 0 (d) 9 a Let x = -152.14 - -148. Let y = -0.14 - x. Let d = 12/41 - 2/287. Which is the second biggest value? (a) y (b) 4/9 (c) d b Let i be 2/12 - 8212/(-72). Let k = i + -114. Which is the third smallest value? (a) 2/7 (b) 0 (c) k a Let o = -1.56 - -53.56. Which is the smallest value? (a) o (b) 2 (c) -4 c Let t = 3.43 + 0.57. What is the third biggest value in -1, -0.06, -0.3, t? -0.3 Let z = -202.9 - -203. Which is the second smallest value? (a) 0.2 (b) 31 (c) z a Let l = 2.64 - 1.64. Which is the third smallest value? (a) l (b) 0.3 (c) 0.9 a Let d = 0.289 + -0.3. Let t = 0.311 + d. Which is the second smallest value? (a) -3 (b) -0.2 (c) t b Let j be 2/9 - (-85)/(-45). Let k = 259 + -257. Which is the biggest value? (a) -2/11 (b) j (c) k (d) 0.4 c Let q = 0.0476 - -2.0524. What is the second biggest value in -0.5, -3, q? -0.5 Let m = 0.288 - 0.288. Let j = -4 + 4.4. What is the fourth smallest value in m, 3, 4, j? 4 Let n be 2/(-3)(-25)/(-10). Let s = 43/6 - 106/15. What is the second smallest value in s, -5, 1, n? n Let h = -3/1853 + 1910/35207. Which is the third biggest value? (a) 0 (b) 1 (c) h a Let c be 4/18 - 260/(-45). Suppose -y = -cy - j + 4, 0 = -5y - 3j + 2. What is the third smallest value in 0.4, 5, y? 5 Let v = -361/42 + 59/7. Suppose 0 = -2d - 2d + 16. What is the smallest value in -2/3, d, v? -2/3 Suppose k - 31 = 4y, k - 2y + 13 = 2k. Let l = -13 + k. Let z be l/(-4)4/12. What is the second smallest value in z, 1, 5? 1 Let a be ((-2)/(-16)-2)/(9 - 8). What is the second smallest value in 1, -2, 0.03, a? a Let n = -11.75 + 8.75. What is the second biggest value in 149, n, -2? -2 Let g = 12/35 + -247/210. Let b(r) = 4r2 - r + 1. Let o be b(1). Let z be (3/(-9))/(11/6). What is the second smallest value in g, z, o? z Let h = -651.7 + 652. Which is the smallest value? (a) h (b) 9 (c) 12 a Let u = 0.67 - 1.17. Let d = 11 + -12. Which is the biggest value? (a) -4 (b) d (c) u c Let b = 700 + -699.7. What is the smallest value in -0.3, 11, 0.4, b? -0.3 Let r = 0.08 + 0.02. What is the third smallest value in 18, -3, r? 18 Let h = -183 + 180. What is the third smallest value in h, -1, 2, 20? 2 Let h be 3/2(-8)/(-3). Let a = 1565 - 3133/2. Let j = -65/4 + 17. What is the second biggest value in j, a, h? j Let k be 1/8(-4)/2. Let x be (-102)/1428 + ((-3)/2 - (-1 - 1)). Which is the fourth biggest value? (a) 0.2 (b) 1.4 (c) k (d) x c Let o be 0 - (4/12)/(-3 + 0). What is the biggest value in 2/9, -2, o, -0.5? 2/9 Let p = -2 + 2.04. Let d = 6.3 + -6.7. What is the third biggest value in d, p, -1? -1 Let s = -0.13 - -0.23. Let h = -1942/9 + 216. Which is the second biggest value? (a) s (b) 2/23 (c) h a Let f = -54/29 + 133/87. What is the fourth smallest value in -0.01, -2, 2/11, f? 2/11 Suppose -101z = -99z + 30. Let l be (-35)/z - (-3)/(-9) - -2. Which is the fourth smallest value? (a) -1/4 (b) l (c) 0.2 (d) -2/11 b Let p(u) = -2u - 14. Let q be p(-6). What is the fourth biggest value in 2.1, q, 3/4, 0? q Let x = 8 - 13. What is the second biggest value in 3, -2/9, x, 0.4? 0.4 Let w = -0.59 + 0.99. Let y = -2.69 - -0.29. Let q = w + y. What is the third biggest value in -0.5, q, -4? -4 Let t = -14 + 9. Let r(u) = 51u - 4. Let w be r(-3). Let g = w + 2981/19. Which is the biggest value? (a) g (b) 3 (c) t b Let x = -1.5 - 1.7. Let k = x + 3.5. What is the third biggest value in -3/10, 1, k? -3/10 Let c = -11.5 - -11. Let g = -1.5 + c. Let b be 6/102/3. What is the second biggest value in g, b, 5? b Let g = 0 + -0.4. Let y(p) = 44p - 44. Let l be y(1). Which is the second biggest value? (a) 1/2 (b) l (c) g b Let j = -299.6 - -300. Which is the biggest value? (a) 4 (b) j (c) 21 c Let a = -0.02 - -0.2. What is the third biggest value in -1/2, 1/10, a? -1/2 Let z be ((-2)/(-4))/(22/(-4)). Let f = 36173 - 36183. Which is the third biggest value? (a) 1 (b) z (c) 0.4 (d) f b Let p = 183 + -184.98. Let t = p - 0.02. What is the second smallest value in t, -2/51, -0.5? -0.5 Let r = 1.04 - 0.14. Let p = -188.9 + 205. Let s = 16 - p. What is the second smallest value in s, -4, r? s Let c = 13 - 9. Let m = c - -4. Let f = m + -3. What is the smallest value in f, 4, -1? -1 Let g = -238 - -241. Let w = 80 + -1601/20. What is the third smallest value in w, g, -0.5? g Let x = 105 - 102. Which is the second biggest value? (a) 0 (b) x (c) 32/35 c Let k = 377/63 + -50/9. What is the fourth biggest value in -6, k, -2/5, -1/14? -6 Let h = 1.31 - -65.69. Let x = -66.8 + h. What is the biggest value in x, 8, 0.5? 8 Let t = -9679/9 - -1075. Which is the second biggest value? (a) t (b) 3 (c) 0.5 (d) -4 c Let g = 383 - 435. Which is the fourth biggest value? (a) 4 (b) -0.4 (c) g (d) -1 c Suppose -o + 5j + 72 = 3j, -3j = -2o + 148. Suppose -5f + o + 10 = 0. Let q = 14 - f. What is the third biggest value in q, 0.2, 2/13? q Suppose 6v + 20 = 2. Let h = -0.2 - -1.2. Let m = h + -1.08. Which is the smallest value? (a) m (b) v (c) 0 b Let d(m) = -m2 + 14m + 20. Let i be d(16). Let k be 5/i - 6/(-24). Which is the second biggest value? (a) k (b) -2/7 (c) 3 a Let o = -120623 - -13751111/114. Let i = o - 18/19. Let d = i + -7/3. What is the second biggest value in -5, 0.4, d? d Let d = 2723 + -2666.05. Let r = -57 + d. What is the second smallest value in 4, r, -1/2, 0.4? r Let v = -2.05 + 0.05. Let l = 0.4 + 0.1. Let j = -232 - -232.1. What is the third biggest value in j, l, v? v Let p = -3.3 + 2.2. Let i = p + -0.9. Let r = 1.6 + i. What is the second biggest value in r, 0, 0.1? 0 Let o = -0.3 + -0.9. Let v = o - 0. Let z = v - -0.2. Which is the smallest value? (a) 0.2 (b) z (c) 0.4 b Suppose -a = 5v + 15, 0 = -6v + 2v + 3a + 7. What is the second smallest value in 6, -0.3, v, -1.5? -1.5 Let r = 912 + -911. Which is the biggest value? (a) 4/23 (b) 2 (c) 0 (d) r b Suppose 7k + 5k - 240 = 0. Suppose 0w = 2w - 28. Let z be ((-24)/k)/(w/(-5)). What is the third biggest value in 0.2, z, 0? 0 Let x be 68/(-6) - (-429)/39. Which is the second biggest value? (a) -4 (b) 5 (c) x (d) 12 b Let h = -0.3 + 1.3. Let i = h + -0.8. Let w be 7/(-7) + -7 + (-49)/(-6). What is the second smallest value in i, -1/4, w? w Let u = 23.945 + 0.055. Let n = u - 23.5. Which is the biggest value? (a) n (b) 3/5 (c) -5 b Let h = 149/3 + -49. Let w be 2090/(-1650) - 2/(-3). Which is the third biggest value? (a) -3 (b) w (c) h (d) 1 b Suppose 5j - 9 = 6. Let t = -8.36 - -1.66. Let k = t - -7. What is the smallest value in j, 3/4, k? k Let n = 54 - -26. Let s = n + -79.7. Which is the biggest value? (a) 0.5 (b) s (c) -4 (d) 3/4 d Let g = -7 - -4. Suppose 5z = 5l - 40 - 10, 0 = 3l. Which is the fourth biggest value? (a) 3/5 (b) 2 (c) g (d) z d Let b = 1.48 + -1.18. What is the second smallest value in 0.02, -5, b? 0.02 Let z = -396	{ "pile_set_name": "DM Mathematics" }
812) + (-1533)/10731). 58 Evaluate (192/1664-65)/(6/(-112)(4 - 8)). -35 1-5 + (-5760)/(-380) + 12/(-76) 10 (7 - 7876)/61 + 160 31 ((-147)/(-5292))/((-10)/(-2)((-15)/50 - 0)) -1/54 Evaluate (-5 + 1/1)/(((-31921)/(-3151))/233). -92 What is ((-125)/(-238) - (-1704)/(-1491))6/21? -3/17 Calculate (702/(-17820)-132)/(-22/(-10)). 13 Evaluate -937 - -924 - (285/(-27) - 4). 14/9 (-9)/27(-195)/(-26)18/(-105) 3/7 Calculate ((1/(2 - (-9 + 14)))/3)/(110/(-462)). 7/15 What is the value of 0 + (-96)/28 - (-51094)/15155? -2/35 Evaluate 3/(-12)(-216)/52(-40)/180. -3/13 What is the value of (-9)/(-1) - ((-544)/(-152))/((-22)/209)? 43 What is the value of (-10146)/197847 + 9939/234-2? -85 What is the value of (17666/(-3212))/((-33)/15)? 5/2 Calculate ((-3)/(-22))/(492/38786) - 13. -9/4 Calculate -5(-9)/(-378)(3/2 + 1617/(-154)). 15/14 What is the value of (-8 - (-5782)/735) + 5313/1710 + -3? -1/38 (-22)/2 - -3 - (-2282 + 2295) -21 Calculate -22 + 18 - (-1148)/(-76) - 50/(-475). -19 Calculate (742 + -798)/((-98)/(-210)). -120 What is (1334 - 854)(-4)/(-32)? 60 (-20)/25 - ((-6)/(-4) - 327/120-12) -35 Evaluate (944/(-354))/((-4)/18) - (-59)/(-5). 1/5 What is 36/(-390)(-819)/315? 6/25 (-24 - 36)40/240 -10 What is the value of (-1)/7((-27)/12 + (387/(-36) - -11))? 2/7 Evaluate ((40 - 41) + 54/(-4))6/(-18)-6. -29 Calculate 3/(-45) + 656/(-60). -11 Evaluate (45 - 13603/305)/(126/(-15) - -1). -2/37 What is 9 + 2590/(-287) + (-25500)/13530? -21/11 What is ((3 + 1640/(-544))(-52)/39)/((-2)/(-6))? 1/17 What is 42/4834 + 50/759/(-8)? 29 Calculate (-22)/14 + (-32 - -32)/(-85). -11/7 (-176)/18 - (7 + (-731)/43) 2/9 What is the value of (-138)/8694-693 + 180/(-33) + -1? 50/11 5 + ((-3195)/(-150) - 14)4/(-6) 2/15 Evaluate (34 - (-173 - -112)) + -58. 37 What is the value of 184/(-352) + (-2 - 140/(-55))? 1/44 974/532 + (-3)/(-114) 13/7 109746/(-737) - -150 - (0 - (-263)/(-11)) 25 What is (-9)/(-36) + -1 - (150/(-80)58 + 11)? 97 Evaluate (-2)/90(-5645 + 5204). 49/5 Evaluate ((-1)/188)/(-25(-63)/18900). -3/47 (49/((-7007)/506) - -16) + -12 6/13 (-23)/(4048/165)(-1)/(5/(-2)) -3/8 What is ((-2872)/400 + 7)/((-9)/(7 + 11/22))? 3/20 (525/65 - 8) + 3192/9880 2/5 What is 65((-5910)/390 + 16)? 55 Calculate 12/(-19)5890/620 - -21. 15 Evaluate -7 + 6 - 16 - (334601/(-5576) + 43). 1/136 (23/(-69))/(-332 + 344 - 1098/92) -46/9 What is 1/(-102)(140/5612/5 - 2)? -2/51 What is ((-36)/(-6) - 7)/((-64)/(-2240))? -35 What is the value of (221 - 323) + (-17984)/(-176)? 2/11 What is 418/(-1088054)274 + (-1)/((-38)/(-908)) + 1? -23 Evaluate (-178)/(-16) - ((-12)/((-12)/29) + -16 + -2). 1/8 Calculate (2/1)/(19 + -23 + 19 + (-6 - -2)). 2/11 ((-13 - 6060/(-480)) + 1/8)(-1 + -355) 89 What is (-1180)/(-2574) + 5695/(-765) + 7? 2/143 What is (-8724)/(-7270)(-8)/12190/(-4)? 38 What is (67445/141)/7 + -54? 43/3 -11 + (43 - (-36 + 88)) + ((-1360)/(-14))/4 30/7 What is the value of (-1190)/573751545 - (-2)/45? -32 Calculate (-135)/15(6 + 0). -54 What is the value of (-103)/((-9270)/60) + 12/(-21)? 2/21 Evaluate (-276)/1104 + 340/16. 21 What is the value of (2/(-6))/(683/194655)1? -95 Calculate (-35)/227513(-85)/2142. 1/126 13 - (37 - 24) - 16/(-208) 1/13 ((-82)/(-4) - (19 + (17 - 29)))-6 -81 What is -782(-1673)/20076? 13 (-81 - -1355)/(-91) + 1524/115 + 2/5 -8/23 What is ((-3780096)/1177)/64 - -48? -24/11 Evaluate 8/22 + (-110250)/(-3850). 29 Evaluate 19750/(-1000) - 35/(-20). -18 Calculate (-15 + 4)/(129/(-33) + (-196)/(-17 - 32)). -121 What is the value of ((-10)/(-1) - 2573/(-31)) + (-364)/26? 79 Evaluate (-2167)/(-1379) + 12/((-252)/201). -8 267/53 + (-21)/(73458/132) 5 Calculate (-280)/805-12(-8)/(-224)-7. -24/23 Calculate ((-8)/16)/(173/692). -2 What is the value of (1-2 - -1 - 0) + 63412 + -63448? -37 Evaluate 3555/(-570)2/(-3) + -196 + 192. 3/19 Evaluate 9(-32)/(-216)(-4935)/94. -70 What is (527/408 - (((-14)/(-4))/7 + 1))-2? 5/12 Calculate 3 - 21/6 - 22/(-44)(-95)/(-10). 17/4 What is 10/9((-1260)/(-60) - (-117)/(-5))? -8/3 What is the value of (-5)/3 + 2 - ((-1773600)/(-9900) - 179)? 2/11 Evaluate (-5 + -3 - -10) + -49 - 42/7. -53 Calculate ((-18)/4)/((-127143)/(-3164448)). -112 -1 + (-145)/(-104) - 22545/(-2672)30/(-405) -3/13 (5181/2596 - 2)/((-21)/(-168)) -2/59 (0/(-1) - (-402)/4)/(((-9888)/(-64))/103) 67 ((-5)/(250/20))/(44/2805-9) 17/6 (458 + -455)/((-48)/87 + (-5)/(-10)) -58 Calculate -120 - 147/((-6468)/3344). -44 Calculate (5 + ((-14)/147)/((-147)/(-8918)))/((-7)/6). 2/3 What is ((-259347)/(-10))/(-319) + 81? -3/10 Calculate ((-3773)/1078)/((-49)/(-5)). -5/14 What is (362 - 393) + (-6)/((-72)/276)? -8 Calculate (89/(10947/(-3526)))/(0 - (-4)/12). -86 What is the value of 825/351 - 8(-350)/(-1200)? 2/117 Evaluate 21464/3360 + 8448/(-1320). -1/84 What is (14824/12208)/(1/(-2))? -17/7 Calculate ((-7067)/148 - -50)/(45/40). 2 What is (-40600)/(-15225)((-150)/8 + 0)? -50 Evaluate (11 - 1794/276)344/18. 86 What is ((-597)/1592)/(3/(-16)) + 0 + 64/(-18)? -14/9 Calculate 70/(165/33) + (9 - 20)/(-3 - -2). 25 (10 - 560/(-48))/((-10)/30) -65 Evaluate ((-39291)/28065)/(1/5). -7 (-30)/16(-22568)/16120 21/8 What is 874/30 - (-12 - 2236/25814/(-10))? 29 Evaluate 702/(-312) - (-1 + (-30)/(-75) - (-5198)/(-3160)). -2/395 What is (232/6)/(6(-6)/(-45)(-2195)/2634)? -58 What is 7/((-7)/2) + ((-228)/(-11) - (-1017)/3729)? 19 What is (20/(-40) + (-94887)/5434 + 18)1/(-4)? -2/209 What is the value of (-2298 + 2300)/((-2)/(-33))? 33 What is the value of 22/28-32 - (168/378 - (-52)/126)? -26 (-126)/7 - -16 - (-8)/(-10) -14/5 Evaluate (5 - (-876)/(-172))/(78/(-13) + 10). -1/43 What is 3465/(-30)(-8 + 14 + (-96)/18)? -77 -21 + -28 + (114 - 128) -63 Calculate (-4 - 2)/(10/(-42)732/610). 21 What is the value of (-14080)/(-1984) - (-48)/(-496) - 230/32? -3/16 What is 2023/(-63) - (-45695)/1235? 44/9 Evaluate 8/(((-2150)/80)/215). -64 What is the value of (5880/(-10780))/(27/132)((-3)/(-14) + 0)? -4/7 What is the value of ((-35)/(-4))/(((-210)/672)/((-1)/4))? 7 741/26 + -30 + 186/80 - (-20)/(-32) 1/5 Calculate (470/8)/((-19)/((-1216)/(-80))). -47 What is the value of ((-1161)/4257(-22)/(-2))/(9/(-132) - 0)? 44 Calculate (-686 - -691) + -489(-3)/(-288). -3/32 Evaluate 3/(-42)4 + (-89)/((-5607)/(-288)). -34/7 (-20)/(0 - (-16)/(-10) - 10820/(-13525)) 25 What is (-1139)/34(975 - 977)? 67 Calculate 22 - ((-774)/(-63))/((-207)/(-322)). 26/9 What is 6(1 - 2) + ((-75776)/44992)/(2/(-38))? 26 What is (-9556184)/1670592 - (0 + (-3)/(126/4))? -45/8 (17/221039)/(6/(-3) + 76/20) 1/6 What is the value of 84700/(-287980)(-119)/5? 7 What is the value of (708/64)/(-151/(-20)) - (-41 + 53)? 11/4 Calculate (32794/(-4674) + -4 - (-33)/3)/(2/3). -1/41 Calculate ((-120)/1024)/(3771/5028). -5/32 Calculate (1(-1 - -2))/((6/(-8))/(198/(-24))). 11 What is ((-2033)/214 - 1/(-2)) + (-414)/(-48)? -3/8 ((-1071)/(-111384))/((-1)/(-4)) 1/26 (99/(-70))/3 + (-4)/(-196)28 1/10 What is (27/243)/(-4 - (-1314)/243)? 3/38 (-54)/(-441) - (-397860)/(-55860) -7 Calculate (77 + -113 - (-788)/12)/(4/6 + -1). -89 73 + (-23622)/127 + 103 -10 Calculate ((-32)/84)/(-26(-54)/(-117) + 22/3). 4/49 What is ((-1056)/88 + (-1)/(4/(-88)))/((-2)/18)? -90 What is ((-30)/45)/((-44)/66) - -19? 20 Evaluate ((-394)/(-33) - ((-30)/11 + 24/9)) + 18. 30 Calculate (-15)/(-240)12 + 11639/44. 38 What is the value of (57/(-133))/((-34)/(-7))(800/48 - 18)? 2/17 Calculate 69/4071 - 85932/(-1829). 47 -32 + ((-345588)/38316 - 2/(-103)) -41 What is the value of 351/(-39) - ((-36015)/(-1500) + -33)? -1/100 Calculate (-426)/(-9) + 1325/75. 65 What is ((-66)/(-15) - 4)/(3 - 3177/1095) - 4? 1/18 What is the value of (-38)/2 - 846/9216-208? 3/32 Evaluate (-329)/10 - (28 - (-14059)/(-510) - (-2)/(-6)). -33 Evaluate (1 + -2)/((-804)/40 - (-20 - -39 - 39)). 10 What is the value of 1767713/82677 - (-5 - -6 - 2)4/14? 65/3 (-144)/(-2)(493/174 + 14/(-6)) 36 What is the value of -21(-2)/14 - (36/3 - 1)? -8 What is the value of (-35508)/807 - -53? -29 What is (0 - (-5 + 2))/(((-144)/(-60))/((-656)/(-20)))? 41 What is 2283/69 - (232/(-506) + (-6876)/(-12606))? 33 Evaluate (-4)/(-2)522/(-3393). -4/13 ((-33484)/5327)/((-33)/147) 28 0 - (4/(-14)(-4)/(-8))/(504/(-588)) -1/6 (-5265)/(-189) - 41/(-287) 28 4284/(-918)(1*6	{ "pile_set_name": "DM Mathematics" }
of 436 and 4142. 218 What is the greatest common factor of 1885 and 145? 145 What is the highest common factor of 27 and 81? 27 Calculate the highest common factor of 3 and 81. 3 Calculate the highest common divisor of 13040 and 16. 16 Calculate the greatest common divisor of 238 and 136. 34 Calculate the highest common factor of 2236 and 572. 52 Calculate the highest common factor of 201 and 5360. 67 What is the highest common factor of 42 and 378? 42 Calculate the highest common divisor of 4611 and 783. 87 Calculate the highest common divisor of 36814 and 632. 158 What is the highest common divisor of 182 and 26? 26 What is the greatest common factor of 456 and 3021? 57 What is the highest common factor of 65803 and 23? 23 What is the highest common factor of 13 and 65? 13 What is the greatest common divisor of 276 and 120? 12 Calculate the highest common divisor of 3 and 75. 3 Calculate the highest common divisor of 295 and 15. 5 What is the highest common divisor of 8558 and 44? 22 Calculate the greatest common divisor of 564 and 423. 141 Calculate the greatest common factor of 30 and 3. 3 What is the greatest common factor of 6 and 48? 6 What is the greatest common factor of 67 and 1? 1 Calculate the highest common divisor of 14 and 58. 2 What is the greatest common divisor of 30 and 490? 10 What is the highest common factor of 15 and 5? 5 What is the highest common divisor of 94 and 141? 47 What is the highest common factor of 22 and 242? 22 Calculate the greatest common divisor of 1211 and 35. 7 What is the highest common factor of 256 and 88832? 256 What is the highest common divisor of 2324 and 224? 28 Calculate the greatest common divisor of 4544 and 704. 64 Calculate the greatest common factor of 10 and 7270. 10 What is the greatest common factor of 320 and 60? 20 Calculate the greatest common divisor of 14 and 10. 2 Calculate the highest common factor of 429 and 39. 39 What is the greatest common factor of 1020 and 318? 6 Calculate the greatest common factor of 22 and 2222. 22 What is the greatest common factor of 275 and 11? 11 Calculate the highest common factor of 16226 and 190. 38 What is the greatest common divisor of 265 and 5? 5 Calculate the greatest common divisor of 6 and 6. 6 What is the highest common factor of 1023 and 99? 33 Calculate the greatest common divisor of 377 and 667. 29 Calculate the greatest common factor of 325 and 65. 65 What is the highest common divisor of 6591 and 26? 13 Calculate the highest common factor of 28 and 32. 4 What is the greatest common factor of 80 and 1080? 40 What is the highest common divisor of 8697 and 39? 39 Calculate the highest common factor of 300 and 1770. 30 What is the highest common factor of 60 and 9? 3 Calculate the highest common divisor of 4 and 2308. 4 Calculate the greatest common factor of 672 and 72. 24 Calculate the highest common factor of 1748 and 988. 76 What is the highest common factor of 171 and 437? 19 Calculate the highest common factor of 16 and 304. 16 What is the highest common divisor of 708 and 12? 12 What is the greatest common divisor of 1044 and 792? 36 What is the greatest common factor of 13 and 767? 13 Calculate the greatest common factor of 3 and 81. 3 What is the highest common divisor of 65 and 2613? 13 Calculate the greatest common factor of 28 and 994. 14 What is the highest common divisor of 790 and 20? 10 Calculate the greatest common factor of 156 and 15236. 52 Calculate the greatest common factor of 2 and 1466. 2 Calculate the greatest common divisor of 2086 and 298. 298 Calculate the greatest common factor of 105 and 175. 35 Calculate the greatest common factor of 370 and 2146. 74 What is the highest common factor of 3 and 8427? 3 What is the greatest common divisor of 1598 and 893? 47 Calculate the greatest common divisor of 112 and 8. 8 What is the highest common factor of 12 and 96? 12 Calculate the highest common factor of 3050 and 175. 25 What is the greatest common divisor of 244 and 732? 244 What is the highest common factor of 2483 and 65? 13 Calculate the highest common divisor of 171 and 893. 19 Calculate the highest common divisor of 252 and 868. 28 What is the highest common factor of 845 and 195? 65 What is the highest common divisor of 18 and 5175? 9 What is the highest common divisor of 860 and 40? 20 What is the highest common factor of 432 and 784? 16 What is the greatest common factor of 55 and 320? 5 Calculate the highest common factor of 297 and 22. 11 Calculate the highest common divisor of 12905 and 145. 145 Calculate the greatest common divisor of 2059 and 174. 29 What is the greatest common divisor of 14 and 8386? 14 What is the highest common factor of 102 and 6? 6 What is the highest common factor of 160 and 512? 32 What is the greatest common factor of 2422 and 154? 14 Calculate the greatest common divisor of 6 and 294. 6 What is the greatest common factor of 10 and 2940? 10 What is the highest common factor of 200 and 104? 8 What is the greatest common divisor of 432 and 108? 108 Calculate the greatest common divisor of 1170 and 54. 18 What is the greatest common factor of 6802 and 1? 1 Calculate the highest common divisor of 162 and 2322. 54 Calculate the greatest common divisor of 318 and 6254. 106 Calculate the greatest common divisor of 80 and 384. 16 Calculate the highest common divisor of 506 and 24. 2 What is the greatest common divisor of 189 and 54? 27 Calculate the highest common divisor of 258 and 215. 43 Calculate the highest common factor of 630 and 70. 70 Calculate the greatest common factor of 58 and 377. 29 Calculate the highest common factor of 12 and 56. 4 What is the greatest common factor of 3146 and 2178? 242 Calculate the greatest common factor of 403 and 155. 31 What is the greatest common divisor of 637 and 13? 13 Calculate the highest common factor of 781 and 3337. 71 Calculate the greatest common divisor of 513 and 216. 27 Calculate the greatest common factor of 1465 and 5. 5 Calculate the greatest common factor of 2104 and 40. 8 Calculate the highest common divisor of 4377 and 12. 3 What is the greatest common divisor of 1581 and 15? 3 Calculate the greatest common factor of 139 and 2. 1 Calculate the highest common divisor of 108 and 150. 6 Calculate the highest common divisor of 25 and 120. 5 Calculate the highest common factor of 4608 and 72. 72 What is the highest common factor of 18 and 90? 18 Calculate the greatest common factor of 615 and 30. 15 Calculate the highest common factor of 310 and 6. 2 Calculate the highest common divisor of 168 and 8568. 168 What is the highest common divisor of 14 and 74928? 14 Calculate the highest common divisor of 11772 and 9. 9 Calculate the greatest common factor of 336 and 378. 42 What is the highest common factor of 31 and 713? 31 Calculate the greatest common factor of 153 and 99. 9 What is the greatest common divisor of 135 and 45? 45 Calculate the highest common divisor of 9945 and 1275. 255 What is the greatest common divisor of 15 and 20505? 15 Calculate the highest common factor of 1925 and 280. 35 What is the greatest common divisor of 152 and 2112? 8 Calculate the greatest common factor of 567 and 4131. 81 Calculate the greatest common divisor of 1320 and 4. 4 Calculate the greatest common divisor of 122 and 33062. 122 What is the greatest common divisor of 623 and 10324? 89 Calculate the greatest common divisor of 167 and 24048. 167 What is the greatest common divisor of 2790 and 270? 90 What is the greatest common factor of 77 and 11? 11 What is the greatest common divisor of 26 and 26? 26 What is the highest common factor of 2261 and 357? 119 What is the greatest common divisor of 396 and 72? 36 Calculate the highest common divisor of 33 and 153. 3 Calculate the greatest common factor of 10 and 10. 10 What is the greatest common factor of 143 and 65? 13 What is the greatest common divisor of 11 and 22? 11 Calculate the greatest common divisor of 1121 and 295. 59 What is the greatest common factor of 500 and 140? 20 Calculate the greatest common divisor of 12 and 174. 6 Calculate the highest common factor of 1086 and 12. 6 Calculate the highest common factor of 9087 and 39. 39 What is the greatest common divisor of 27 and 9?	{ "pile_set_name": "DM Mathematics" }
be i(-2). What is the highest common factor of 335 and r? 67 Let d(h) = 6h - 3. Let x be d(1). Let l be 7 - x - (-4 - 36). Calculate the greatest common divisor of l and 11. 11 Let p(y) = -y. Suppose -5s = 17 - 2. Let t be p(s). Let n be 4/(-6)-68t. Calculate the greatest common factor of 17 and n. 17 Let b(n) = 26n - 13n + 10 - 14n + 5 + n3. Let h be b(0). What is the greatest common factor of 165 and h? 15 Suppose -3a + 243 = -3y, 6y = -2a + 2y + 180. What is the greatest common divisor of 42 and a? 42 Suppose -35 = -2f + l, -51f = -49f - 4l - 20. Calculate the greatest common factor of f and 260. 20 Let p(u) = 2u + 19u*2 + 0u - 37u2 - 7 + 19u*2. Let s be p(3). Calculate the greatest common divisor of 88 and s. 8 Suppose 0 = 2o + 2o - 120. Suppose -2r - 78 = 4g - 7r, 112 = -5g - r. Let n = o + g. What is the highest common factor of 24 and n? 8 Suppose 0 = x - 18 - 6. Suppose x = -3s - 18. Let a be s/10(-8 + 3). Calculate the greatest common divisor of 63 and a. 7 Suppose -7w + 2w - 5 = 0, 969 = -4t - w. Let v be 1/(-6) + t/(-12). What is the highest common factor of 160 and v? 20 Let c = -271 + 648. Calculate the highest common factor of 26 and c. 13 Suppose -3k = -5j + k + 36, 5j = -k + 16. Suppose 5r - 36r + 372 = 0. Calculate the highest common factor of r and j. 4 Suppose -6v + 2v - 2x = -20, -6 = -2v - 3x. Suppose -4q = -vq + 16. Let u = 46 - -26. What is the highest common factor of q and u? 8 Let q be (-2618)/(-16) - -616/256. Calculate the highest common divisor of 16 and q. 4 Let q(p) = p3 - 7p*2 + 4p. Let j be q(7). Let o = 78 - 74. What is the greatest common factor of j and o? 4 Let o be -3 + 28/4 + 1. Suppose -4n - 1414 = -ok, -5n + 7 + 13 = 0. What is the highest common factor of 26 and k? 26 Let f be 2/(2/3)1. Let y be (8/(-20))/((-2)/10). Let p be y/(-1 + 14/12). Calculate the greatest common factor of f and p. 3 Let k be (-28)/(-2) + (-2)/(-2). Suppose -128 = 19w - 223. What is the greatest common factor of k and w? 5 Let p(n) = n + 13. Let b be p(-4). Suppose 0h = -h + b. What is the greatest common divisor of h and 36? 9 Let h be 0 + (4/4 - -22). Suppose 4j + h = 5j. What is the highest common factor of 69 and j? 23 Let u(x) = -x*2 + x + 20. Let d be u(-5). Let h = 20 + d. Let v = -22 - -72. Calculate the greatest common factor of v and h. 10 Let c = 36 + -18. Let d(h) = 8h - 12. Let n be d(6). What is the greatest common divisor of n and c? 18 Let l = 28 - 1. Let u = -35 - -37. Suppose uj + 2d - 50 = 0, j - 21 = 4d - 7d. What is the greatest common factor of l and j? 27 Let l(o) = o*3 + 7o*2 - 2o - 27. Let j be l(-8). Let y = j + 105. Let q be -1 + (-3 - -2) + 22. What is the highest common factor of y and q? 10 Suppose 0 = 3r + i + 39, 0r - i = -3r - 33. Let q be 130/50 - (r/5 - -2). What is the greatest common factor of q and 3? 3 Let t be ((-40)/(-3))/((-1)/(-3)). Let d be 291 + (71 - 60). What is the highest common divisor of t and d? 40 Suppose 67g - 80 = 63g. Suppose -2p + 2i = -3i - 13, 4p + 2i = 14. Calculate the highest common factor of g and p. 4 Let d be (-2)/8 + (-34)/(-8). What is the highest common divisor of d and 92? 4 Suppose -2a + a = -4. Suppose -123u + 540 = -108u. What is the greatest common divisor of a and u? 4 Let g(v) = -v*2 - 17v - 28. Let c be g(-14). Let s be (-2)/3 + (-92)/(-12). What is the highest common divisor of s and c? 7 Suppose -4g = -13 - 11. Suppose 2z + 181 = 11. Let y be ((-136)/z)/((-4)/(-90)). What is the highest common divisor of y and g? 6 Let h(m) = 7 - 5 - m - 8 + 39. Let r be h(23). What is the greatest common factor of 20 and r? 10 Suppose -3p = 12, 5p = -4s - s + 350. Calculate the greatest common divisor of s and 2. 2 Suppose -b + 8 = 3b. Suppose 0 = -5i + 4z + 101, bi = 2z + 3 + 37. Let f = -60 - -165. Calculate the greatest common factor of f and i. 21 Suppose -p - 68 + 79 = 0. What is the highest common factor of 2 and p? 1 Suppose 3c - 32 = -4l, -2c + 0 + 8 = 0. Let n = -62 + 109. Let o be (n + (1 - 3))1. What is the greatest common factor of l and o? 5 Let y(t) = -8t - 64. Let v be y(-8). Let a be 4/6 - (-1)/3. Let x be (57 + v)a - -3. Calculate the highest common factor of x and 6. 6 Suppose 3p - 5b = 83, -p + b + 27 = -0b. What is the highest common divisor of 1742 and p? 26 Suppose -24d = -29d + 990. What is the greatest common divisor of d and 11? 11 Suppose 6w - w = 4c + 1330, 5w - c - 1345 = 0. Calculate the highest common divisor of w and 15. 15 Suppose 4k + 12 = 5k. Let s be 1/(4 - 2058/514). Let l = s + 353. What is the greatest common factor of l and k? 12 Let c = 123 + 21. Calculate the highest common factor of c and 108. 36 Let o(q) = 53q - 60. Let t be o(3). Calculate the greatest common divisor of 11 and t. 11 Let j be (-230)/(-12) - (-5)/(-30). Calculate the greatest common factor of j and 247. 19 Let d(v) = 20v*2 + v - 2. Suppose 6u - 5u = -1. Let g be u/((-2)/(0 + 4)). Let s be d(g). What is the greatest common factor of s and 8? 8 Suppose 0g = v - 3g + 48, 5g - 240 = 5v. Let x = v - -51. Calculate the greatest common divisor of 3 and x. 3 Let c be 165/(-10)(-4)/2. Let v be -4 + -4 + 8 + 4. Suppose c = -p + vp. Calculate the highest common factor of 55 and p. 11 Suppose 0x + 720 = 2x. Suppose -w - 9w + x = 0. Calculate the highest common factor of 24 and w. 12 Suppose 25d = 27d - 142. What is the greatest common factor of d and 1? 1 Let k be 6 + (2 - (-2)/1). Suppose -33 = -ka + 7a. Suppose -19 = -3p + a. What is the greatest common factor of p and 10? 10 Let w(h) = 3h*2 + 4h + 1. Suppose -11a + 12a = -5. Let f be w(a). What is the highest common factor of f and 8? 8 Suppose 6 = 2p - 74. Calculate the greatest common divisor of p and 8. 8 Suppose -2q + 53 = 2k - 177, 565 = 5k - 5q. Let x = 130 + -50. Suppose -3v - t = -5t - x, 5v - k = -3t. What is the greatest common factor of v and 36? 12 Let l(u) = -u2 + 22u. Let g be l(16). Let d be (10 - -6)/(5/3 - 1). Calculate the greatest common factor of g and d. 24 Suppose -6 = -0g - 3g. Suppose 2t = 3t - g. Let i(z) = -12z - 106. Let j be i(-9). Calculate the greatest common factor of t and j. 2 Let z(r) = 66r*2 - 7r - 2. Let j be z(-2). Calculate the highest common divisor of j and 36. 12 Let z(n) = 3n2 - 25n - 108. Let t be z(12). Calculate the greatest common divisor of 32 and t. 8 Suppose -8k - 9k = -187. Calculate the highest common divisor of 77 and k. 11 Let i = 10 - -12. Calculate the greatest common factor of i and 33. 11 Suppose -5m = -z - 7, -z + 3m + 9 = 10. Let t be -6624/(-6). Calculate the highest common divisor of z and t. 8 Let a(k) = -k*2 + 8k + 4. Let t be a(6). Let i = 281 - 183. Let q = 210 - i. Calculate the greatest common divisor of q and t. 16 Let y be (72 - -6) + 6 + (1 - 5). What is the greatest common divisor of 464 and y? 16 Suppose 4z - 5z = 5q - 260, -4z + 208 = 4q. Let x = q + -28. What is the highest common divisor of 12 and x? 12 Suppose -5a + a - 90 = -3m, m + 2a - 20 = 0. Calculate the greatest common divisor of m and 442. 26 Suppose -4b + 4 + 16 = 0. Suppose -3n + bm + 12 = 0, 0 = -4n + n - 2m + 33. What is the highest common divisor of 9 and n? 9 Let a be 12(374/(-3))/(-17). Calculate the highest common divisor of a and 33. 11 Let l(a) = -a*3 + 12a*2 + 15a - 18. Let q be l(13). Suppose -k = -3k. Suppose 2f - q = -kf. What is the highest common divisor of f and 6? 2 Suppose 3 + 8 = -v. Let t = v - -15. Suppose -6h = -3h + 5p - 70, -tp = 5h - 134. Calculate the greatest common divisor of 10 and h. 10 Suppose -6u + 0u = -150. Calculate the highest common divisor of 425 and u. 25 Suppose -v = -3v + 6. Suppose -2y = 2q - 96, y + vq - 12 = 36. Calculate the greatest common divisor of 32 and y. 16 Let d(g) = g2 - 32. Let a be d(12). Calculate the highest common divisor of a and 14. 14 Let s(m) = -m2 + 13m + 98. Let j be s(18). Calculate the greatest common factor of 136 and j. 8 Let u(w) = 23w + 7w2 + 39 - 4w*2 - 4w*2. Let k be u(20). What is the highest common factor of 9 and k? 9 Let u(m) = 32m*2 + 189m - 9. Let i be u(-6). What is the greatest common	{ "pile_set_name": "DM Mathematics" }
hat is the remainder when 104 is divided by l? 14 Suppose -5f = -5n - 3460 - 3730, -2n = 5f - 7183. Calculate the remainder when f is divided by 40. 37 Suppose t = -4j + 15, -5j = -2j - 4t - 35. Suppose 4u - 382 = -2l, ju + 64 = 5l - 936. What is the remainder when l is divided by 67? 63 What is the remainder when 4898 is divided by ((-2)/3)/(-2(-5)/2940-7)? 26 Suppose -4k - 586 = 5g, 5k - g = 2g - 714. What is the remainder when (k/(-45))/8 + (-73)/(-5) is divided by 9? 6 Suppose 0 = t + 4z - 2z - 7, -8 = 2z. Let p be (7 + 2)/(5/(-365)) + 0. What is the remainder when (p/(-12))/((-9)/(-12)) is divided by t? 13 Let k be 374/10 - (-42)/70. Let a = 40 - k. Suppose av = 7 + 5. What is the remainder when 10 is divided by v? 4 Suppose 4112w - 4099w = 975. Let x = 66 + 165. What is the remainder when x is divided by w? 6 Suppose 5i + 35 + 25 = 0. Let n = -65 + i. Let p = 109 + n. Calculate the remainder when 127 is divided by p. 31 Let o = -21 - -55. Let u(i) = 6i - 140. Let c be u(19). What is the remainder when c/215/(-3) is divided by o? 31 What is the remainder when (78/(-65))/(2/(-45)) is divided by 6 + -3 + -2 - -11? 3 Let r(y) = 17y*2 - 5y + 5. Let g be r(6). Calculate the remainder when g/5 + 12/(-30) is divided by (73/511)/(2/420). 27 Suppose 2s = 11s - 36. Suppose -156 = -2t - t + o, 0 = -t + so + 63. Calculate the remainder when t is divided by 28. 23 Suppose 3u + 105 = 8u. Let r be 7/(u/(-6)) + 0. Calculate the remainder when 18 is divided by (-10)/(-6)(-1 + r + 6). 3 Let f be 188/14 + (4 - (-62)/(-14)). Let y(v) = v3 - 13v*2 + 4v - 13. Let q be y(f). Let n = q - 32. Calculate the remainder when 31 is divided by n. 3 Let m(v) = -8v - 1. Let w be m(8). Let l = w + 57. Calculate the remainder when 21 is divided by (-36)/l + ((-30)/4)/(-5). 3 Suppose 0u + u - 286 = 0. Let o = 2223 - 2165. Calculate the remainder when u is divided by o. 54 Suppose 1424 = u + 1369. Calculate the remainder when u is divided by 26. 3 Suppose -5d - 45 = 5u, -5d - 12 = 8. Let z(b) = -b3 + b2 - 9b - 37. Calculate the remainder when z(u) is divided by 46. 20 What is the remainder when 125 is divided by ((-9039)/3668 + 4/(-14)1)-12? 26 Calculate the remainder when 2679 is divided by -15 + 48/(-14 + 26) + 6. 4 Suppose -4n - s + 118 = 0, 2n + 2s = 5n - 83. Suppose 227i - 228i = -4x + 320, 0 = -4x - i + 328. Calculate the remainder when x is divided by n. 23 Suppose 1626 = 42l - 6564. What is the remainder when l is divided by 111? 84 Let o be 134 - (0/(-2))/(-4). Let q = -109 + o. Calculate the remainder when 222 is divided by q. 22 Suppose 3d + 856 = 5v, 13v - 10v + 5d - 534 = 0. Calculate the remainder when v is divided by 43. 1 Let s be (15 - 9)4/(-6). Let b = 30 - -5. What is the remainder when b is divided by (-63)/54-15 - 6/s? 16 Let a(g) = -26g*2 - 4g + 13. Let u(f) = -26f2 - 3f + 15. Let p(n) = -7a(n) + 6u(n). Calculate the remainder when p(-1) is divided by 5. 0 Suppose 4r = -5c + 18830, 4069 = -5c + 4r + 22899. What is the remainder when c is divided by 12? 10 Suppose -31 = 23h - 146. Let b(n) = n2 - 3n + 11. Calculate the remainder when 62 is divided by b(h). 20 Suppose -3t - 47 + 92 = i, -i - 4t + 43 = 0. Suppose 357 + i = 24j. Suppose -3l - 248 = -7l. What is the remainder when l is divided by j? 11 Let c(j) = j3 - j2 - 11j - 3. Let w be c(4). Let i be (12w/20)/((-2)/10). What is the remainder when 44 is divided by (-30)/(-2i/(-3))? 14 Suppose 9d - 60 = -6. Calculate the remainder when 700 is divided by d. 4 Suppose 10004 = 25i - 14271. Calculate the remainder when i is divided by 48. 11 Suppose 41 = 5m - 2b - 208, -240 = -5m + 5b. Calculate the remainder when 1883 is divided by m. 47 Calculate the remainder when 4/(-10)(-1 + 6) - (-945 + 1) is divided by 45. 42 What is the remainder when 4360 is divided by -147(-5)/153(-5)/(-15)? 48 Let o(s) = -4s - 4. Let w be o(-1). Suppose -5t + 519 = 3b - 4b, w = t + 3b - 91. Calculate the remainder when t is divided by 55. 48 Let l be 30/4(-8)/(-12). Suppose -g + 5 = -9a + 10a, lg = -4a + 20. Suppose g = 2y - 9y + 42. What is the remainder when 11 is divided by y? 5 Let v = 5737 + -3232. What is the remainder when v is divided by 76? 73 Let d = -35792 - -36735. What is the remainder when d is divided by (-444)/(-30) + 2/10? 13 Suppose -249m + 253m - 6528 = 0. Calculate the remainder when m is divided by 17. 0 Let f = -45 + 44. Suppose -4u + 60 = 4v, 2u + 3u = -4v + 70. What is the remainder when u is divided by (10 + f)6/9? 4 Let a(v) = -35v3 + v. Let u = 4 + 20. Let o be 6/4 - 60/u. What is the remainder when 99 is divided by a(o)? 31 Let r(k) = 3k + 7. Let g be r(-1). Suppose 0 = 3h - 4m - 84, 9h - 4m - 140 = gh. Let f = h + -1. Calculate the remainder when f is divided by 5. 2 Let w = 24 + 102. Suppose 5o - w = -o. What is the remainder when 65 is divided by o? 2 Calculate the remainder when (-2413465)/(-492) - 5/(-4) - (-2)/(-3) is divided by 23. 7 What is the remainder when 314 is divided by 87 - (13 - (0 + 28))? 8 Let s be (-4 - -10) + (4 - 6). Suppose 2g - 4n - 80 = 0, sn + 122 = -0g + 3g. What is the remainder when 6/36 + (-995)/(-6) is divided by g? 40 Let r be 24/2(-4)/(-15 + 3). Suppose rd - 23 = v, -3 = -4v + 1. Suppose 0 = dw - 7w + 13. What is the remainder when 35 is divided by w? 9 Suppose -17j = -0j - 5049. Let b = 331 - j. Calculate the remainder when 121 is divided by b. 19 What is the remainder when 3/(-5)100/(110/(-11)) - -174 is divided by 14? 12 Let b be 1(-9)/(-4)60. Suppose bx = 136x - 76. Calculate the remainder when x is divided by 7. 6 Let i = 198 - 49. What is the remainder when i is divided by 41? 26 Suppose -3v + 8v - 55 = 0. Suppose -vk = -73 + 18. Suppose -4h + 83 - 20 = kx, -2h + 4x = -38. Calculate the remainder when 30 is divided by h. 13 Suppose -2p - 2p + 57 = r, -3p + 144 = 3r. Suppose -r = -2u + 4n + 23, -3n = -4u + 126. Calculate the remainder when 117 is divided by u. 27 Let h = -5149 + 5168. Suppose 180 - 40 = 4b. What is the remainder when b is divided by h? 16 Let y be (4 + 24/(-5))-5. Suppose -3t + d = -4, 0 = -yd - 3 - 1. Calculate the remainder when 69 is divided by (3 - -5)t3. 21 Let w(o) = -36o3 - o2 - 19o - 17. Let u be w(-1). Let s = -3 - -14. Let f = u - s. What is the remainder when 100 is divided by f? 22 Let j(f) = f*3 - 12f*2 + 34f + 23. Let z = 97 - 92. What is the remainder when 483 is divided by j(z)? 15 Let j = 19354 - 19129. What is the remainder when j is divided by (2/(-5))/((-1)/95)? 35 Let l(b) = b*2 + 5b - 4. Let i be l(-6). Suppose if = v - 12, -f + 14 + 7 = v. Calculate the remainder when v is divided by 4. 2 Let u(l) = -l + 21. Let v = 72 - 81. Let t be u(v). What is the remainder when (-5)/t - 326/(-12) is divided by 15? 12 Let h = 28898 + -28855. Calculate the remainder when h is divided by 20. 3 Let t(h) be the second derivative of 0 + 33h - 3/2h2 + 2/3h*3 + 1/12h*4. What is the remainder when t(-8) is divided by 4? 1 Let q be (300 + 0)(15 - 22). What is the remainder when ((-10)/(-6))/((-100)/q) is divided by 23? 12 Let f = 234 + -118. Calculate the remainder when f is divided by (-1)/7 - 4720/(-112). 32 Let h(q) be the first derivative of 3q2/2 + 20q + 18. Let j(v) = 7v + 39. Let l(c) = 5h(c) - 3j(c). Calculate the remainder when 51 is divided by l(-5). 12 Suppose -5f - 4b = -45, -5f + 7 + 38 = 5b. Suppose -4u + f = -127. What is the remainder when u is divided by 12? 10 Suppose h + x - 8 - 10 = 0, -3h - 5x = -50. Suppose -2z = 36 - 12. What is the remainder when h is divided by (-11)/3(9 + z)? 9 Let m = 28068 + -27669. Calculate the remainder when m is divided by 15. 9 Let i(t) = -1 + t*2 + 3t - 7t - 4 + 0. Let u be i(5). Let l(o) = o2 + 14. What is the remainder when l(u) is divided by 8? 6 Let b(q) = -11q - 1559. Calculate the remainder when 2603 is divided by b(-147). 51 Let g(y) = -6y3 + 2y*2 - 38y - 142. Calculate the remainder when g(-4) is divided by 420. 6 Let r = -664 + 675. Suppose -2y - 2c = -7y + 60, 5c - 25 = 0. Let j = 34 - y. What is the remainder when j is divided by r? 9 Calculate the remaind	{ "pile_set_name": "DM Mathematics" }
(a) g (b) -3/8 (c) 2/7 a Let g = -6 + -4. Let j be 91/105 - (-2)/g. Which is the closest to -0.1? (a) 4 (b) j (c) 5 b Let w = 0.2 + 0.1. Let k = 111 + -110. Which is the nearest to k? (a) 2/3 (b) w (c) 2 a Let y be -2 + (-2)/5 - -2. Let h be (-2)/1010/8. What is the nearest to 2/7 in 2/3, y, h? 2/3 Let p(l) = 3l*2 - 16l - 13. Let d be p(6). What is the closest to d in -0.3, -4, -5? -0.3 Let a = -27 + 26.5. What is the closest to -1/4 in a, -0.4, -0.8? -0.4 Let p be (1 - 2 - 9/12) + 1. What is the nearest to -2/3 in 0.4, p, 0.2? p Suppose 2z = 3n + 383, 3n + 197 = z - 185. Let q = n + 633/5. Let k = -3.2 - -3. Which is the closest to 1/2? (a) -2/7 (b) k (c) q b Let s(h) = -3h + 20. Let j be s(5). Which is the closest to -1/3? (a) j (b) 2/3 (c) 2/11 c Let z = 3 - 2.9. Let s = 300 - 4498/15. Let q(n) = 3n - 35. Let v be q(13). Which is the closest to -1? (a) v (b) z (c) s b Let n = -0.7 - -10.7. Let i = n - 8. What is the closest to 0.2 in -1, i, 0.5? 0.5 Suppose -5t + 5h = 25, -h - 3 = t - 0. Let w = -0.4 - 2.6. Which is the nearest to 1/3? (a) w (b) 4 (c) t a Suppose 6 = r - 4r. Let h be 20/(-11) + 2/(-11). Let v be (-1)/h + (-3)/3. Which is the closest to 1? (a) 0 (b) r (c) v a Let y be (-5)/4 + (-1 - -3). Suppose 16r + 6 = 14r. What is the closest to 0 in 4, y, r? y Let j = -0.12 - -0.14. Which is the closest to j? (a) -1 (b) 3/4 (c) 4 b Suppose h = 3u, -5h - 4u = -3u. Let l(r) = r + 9. Let x be l(-6). Suppose -2v = xv - 5. Which is the nearest to 0? (a) h (b) v (c) -3 a Let q = -0.309 - -0.109. Which is the closest to 2/3? (a) q (b) -1 (c) 1 c Let k = -3 - -1.6. Let q = 0.6 - k. Let r = 9 - 6. Which is the closest to q? (a) r (b) -4 (c) -1/4 a Let a = 51 - 50.6. What is the nearest to a in -0.3, -1/2, -0.2? -0.2 Let o = -6.9 + 13.9. Which is the nearest to -0.4? (a) 1/7 (b) 0.3 (c) o a Let p be (-4)/(2/1)2. Let k be (p/6)/((-4)/(-6)). Let j = 1 - 1.5. Which is the closest to k? (a) 1/3 (b) 4 (c) j c Let w = 0.1 + 0.2. Let h = -1.9 - 0. Let j = h + 1.9. What is the nearest to j in w, 4, -2? w Let o = 9.1 + -9. Let l be (-40)/(-15)(-2)/(-12). Which is the closest to o? (a) 0.4 (b) 0.1 (c) l b Let t = 0 + 0. Suppose 0 = -2r + 3z - 13, 2z = r + 5 + 2. Let m be (-17)/r - 8/20. Which is the nearest to t? (a) -0.2 (b) -1 (c) m a Let m = 0.05 + -0.05. Which is the closest to m? (a) -4/3 (b) 2/5 (c) 1 b Let t = 28 - 33. Which is the nearest to 1/3? (a) -4/5 (b) -2/3 (c) t b Let f = -159 - -155. What is the nearest to 0.1 in -2, 1, f? 1 Suppose 3t + 2 = -0t - z, 22 = -5t + 3z. Let f(d) = 4d + 48. Let u be f(-13). Which is the nearest to 1/3? (a) t (b) u (c) 4 a Let j(b) = -b*2 + 4b - 2. Let p be j(6). Let r be 39/p348/(-9). Let k = 108 - r. What is the closest to 0 in k, -0.2, -0.3? -0.2 Let l be 219/9 + (-2)/6. Let s = 74/3 - l. Which is the nearest to s? (a) 0 (b) 2 (c) 2/3 c Let l be ((-3)/(-9))/(10/(-4)). Which is the nearest to 0? (a) 1/3 (b) -1 (c) l c Let y = -0.06 + 1.06. Let q be (-10)/156/32. Which is the nearest to y? (a) 0.5 (b) -3/7 (c) q a Let x = 0 - -0.4. Let t = -5 + -4. Let z be ((-4)/69)/((-6)/t). Which is the closest to -1/2? (a) -1/2 (b) x (c) z a Let y be ((-2)/6)/(1/3). Let n be (0/(-1) + -1)y. Let i be 4/(32/(-14)) + 2. What is the nearest to n in 1/2, i, -0.3? 1/2 Let m be (9/12)/((-180)/32). What is the closest to 0 in 1/6, m, -1? m Let w(h) be the second derivative of h4/12 + 7h*3/3 - 5h*2/2 + 5h. Let u be w(-14). What is the closest to -3 in u, 0.5, 5/3? u Let d = -3.07 + 0.07. Let h = -19/108 + -2/27. Which is the nearest to 0.1? (a) 1 (b) h (c) d b Let v = 1 - 1.5. Which is the closest to 0? (a) -0.1 (b) 1/4 (c) v a Let q = 5 + -13. Let a = 11 + q. Suppose 0 = -2v - 8 + 10. What is the nearest to v in -5, 2, a? 2 Let c = 29 + -31. What is the nearest to 0 in c, -0.023, -4? -0.023 Let x = 2.1 + -2.3. Which is the nearest to -2? (a) -1/2 (b) 0.1 (c) x a Suppose 0 = -3s + 2 + 1, -4q - 5 = -s. Let o = q + 0. Let d(k) = -k + 4. Let m be d(2). Which is the nearest to o? (a) 1 (b) 0.4 (c) m b Let r be (15/20)/(-3 - 0). Suppose 0 = 3p - 2m + 5, 4p = -3m + 16 - 51. Which is the closest to -1? (a) r (b) 1/5 (c) p a Let p = 30.3 + -29. Let i = p + -0.3. Let n = i - 1.4. Which is the closest to -1? (a) n (b) -1/2 (c) 5 b Let l = 1 + -2. Which is the closest to l? (a) -0.1 (b) -1/3 (c) 2/9 b Let u = -0.1 + 0.3. Let a(g) = -g3 - 7g*2 - 6g + 1. Let w be a(-6). What is the closest to w in -0.1, -4, u? u Let v = 2 - 0. Which is the closest to v? (a) 4 (b) -3 (c) 3 c Let y = -3.4 - -4. Let j = 1.1 - y. Which is the nearest to 3? (a) j (b) -3 (c) 2/5 a Let j(v) = v*3 - 4v*2 + 5v - 2. Let m be j(3). Let z = 7 - m. Which is the closest to z? (a) 0 (b) 0.4 (c) 0.2 b Let p be (-3)/15 - 8/10. Let v be (p/5)/(2/6). Let x be (2/(-4))/((-1)/4). Which is the nearest to 0.1? (a) 0.2 (b) x (c) v a Let o = 0.2 - -0.8. Let d = o + -4.8. Let k = 4 + d. Which is the closest to 0.2? (a) -1/3 (b) 2 (c) k c Let d = -0.08 + -4.92. What is the closest to -1/4 in 1/5, d, -1/3? -1/3 Let g = 1800/37 + 4877/296. Let r = 65 - g. Which is the closest to 1? (a) 0.1 (b) -5 (c) r a Let q = 1 - 1. Let b = 12 + -12.2. Let t = 615/3913 - 1/301. What is the nearest to q in b, t, 4? t Let h = -1.2 + -0.8. Let v = 0.2 + -0.5. Let a be (30/(-45))/(0 - 2). What is the nearest to a in v, -3, h? v Let d(k) = k3 + k2 - k - 4. Let w be d(0). Suppose -2 = -4v + 2m, 15 = -0m - 5m. Which is the closest to 2/7? (a) v (b) -2 (c) w a Let c = -5.5 - -3.5. What is the nearest to -1 in 4, c, 5? c Let i = -197/2 + 99. Which is the closest to i? (a) -1 (b) -0.2 (c) -2/7 b Let k(q) = q*3 - 4q*2 - 6q + 4. Let o be k(5). Which is the closest to o? (a) -0.1 (b) 0.4 (c) 0.03 a Let v = 59 - 65. What is the closest to v in 1/9, -2/9, -1/4? -1/4 Let g = 9 + -9.06. Let h = 4 - 3.94. Let k = h + g. Which is the closest to k? (a) 0.3 (b) -2 (c) 3/4 a Let q = -8.4 - -8. Let m = 0.1 + 0. Which is the closest to -2? (a) -3 (b) q (c) m a Let l(k) = 12k - 49. Let q be l(4). Which is the nearest to q? (a) -1/6 (b) 10/7 (c) -1 c Let f be (4/6)/(1/3). Suppose 0a - a - f = 0. Let x be 1/3 + a/(-12). What is the closest to x in -0.1, 0.1, 0.4? 0.4 Let k = 0.1 - 0.1. Let w = -6 - -5.9. What is the closest to -1 in k, -0.2, w? -0.2 Let s = 162 + -162.1. What is the nearest to s in 0.09, 4, -3/8? 0.09 Let z = 20.963 + 0.037. Let o = 26 - z. Let x = -0.4 + 0.2. Which is the closest to x? (a) o (b) -3/2 (c) -0.3 c Let d = 13/12 + -4/3. Let y = -870.7 - -871. Which is the closest to 0? (a) -4/7 (b) y (c) d c Let o = 3 - 0. What is the nearest to 3 in 0.1, o, -3/4? o Let o = 5 - 10. Let u = -6 - o. Which is the closest to -0.1? (a) -5 (b) 0 (c) u b Suppose -2n - 3n = 25. Let v(b) = b + 4. Let u be v(n). Let g be (1 + -2)4/6. What is the nearest to u in g, 4, -0.3? g Let k(p) = p2 - 3p + 1. Let d be k(3). Let h(m) = -m*2 + 4m. Let g be h(3). What is the closest to -3 in g, 2/7, d? 2/7 Let a be (6/(-4) - 0)32/(-168). What is the closest to a in -0.4, 3, -2/3? -0.4 Let k = -39 - -40. Which is the closest to k? (a) 0.5 (b) -7 (c) -3 a Let q = 3 - 2.5. Let x = -2.1 + 2. Let g = x - 0.3. Which is the closest to 0? (a) q (b) 2/21 (c) g b Let l = 1.4 - 1.2. Which is the nearest to l? (a) 0 (b) 5 (c) -2/11 a Let w = 0.152 + 7.148. Let s = -7 + w. What is the closest to -1/2 in s, -3, -2? s Let m = 54 - 53.9. Which is the closest to m? (a) 5 (b) 4 (c) -1/5 c Let t(x) = x2 - 7x - 3. Let i be t(8). Let y be i/15 + 42/9. What is the nearest to 1 in y, -0.2, -1? -0.2 Let n = 1331/9 - 149. Which is the closest to -0.1? (a) 0 (b) n (c) 1/4 a Let s = 187 - 188. Which is the closest to -2? (a) s (b) 3/2 (c) 2 a Let o = -2.58 - 0.12. Let i = -3 - o. Which is the closest to -2/5? (a) -0.1 (b) i (c) -1/6 b Suppose 141m = 137m - 12. Let i = -3.2 - 0.8. Which is the nearest to 0? (a) i (b) 3/5 (c) m b Let d = -0.025 - 0.395. Let v = d + 0.02. Let w = v + 0. What is the closest to 1/3 in -5, -2/3, w? w Let o = -2.5 + 2. Let i = -0.6 + -4.4. Let q = -8 - -12. What is the closest to 1 in q, o, i? o	{ "pile_set_name": "DM Mathematics" }
240? 6 Let i = -8 - -35. Let k be i/515/3. Suppose -53 = -ky + 26y. What is the remainder when y is divided by 14? 11 Let d(m) = 262m - 40. Let n be d(5). Suppose -n = -11p + 1315. Calculate the remainder when p is divided by 34. 31 Suppose -492 = 9w + 30. What is the remainder when w/(-4)(-132)/(-22) is divided by (-20)/(-1) + 12? 21 Let v(x) = 5x3 - 7x*2 - 3x - 33. Let c be v(6). Let u = 874 - c. What is the remainder when u is divided by 39? 19 Suppose -a + i + 435 = -647, 2a - 2152 = -2i. What is the remainder when a is divided by 30? 29 Let u = 360 + -305. Suppose -u + 235 = 5y. Calculate the remainder when 214 is divided by y. 34 Let t be 4 + (-21 - -21)/(3 - 1). Suppose tw + 8 = 0, -6w = -5o - 5w + 312. Calculate the remainder when o is divided by 13. 10 Let h = 49 - 47. Let w be (25 - 2 - 2)/(1 - h). Let a(i) = 2i + 50. What is the remainder when 79 is divided by a(w)? 7 Calculate the remainder when -18 + (-5131 - -11)/(-20) is divided by 222. 16 Let l(f) = 26f + 3583. What is the remainder when 540 is divided by l(-129)? 82 Let u(r) = -r3 - 16r*2 - 36r + 219. What is the remainder when u(-13) is divided by 1/3(72 - 3)? 19 Suppose 4a + 3b - 59 = 63, 0 = 5a - 5b - 135. Suppose a - 42 = -y. What is the remainder when 103 is divided by y? 12 Suppose -q + 469 = -3n, 604 = -4n - 4q - 0q. Let z = n - -160. What is the remainder when 13 is divided by z? 3 Let p = 0 - 17. Let v = p - -31. Suppose -767 = -7h + n, -11n + 13n - 6 = 0. Calculate the remainder when h is divided by v. 12 Let m = 15 - 10. Suppose -s - 2 = -2w - 4, -4s - 1 = -mw. What is the remainder when 2 - s(-1)/(4/(-30)) is divided by 9? 5 Let n be 5 + (3 - (0 + 5)). Suppose 0 = -5p - 10, -16 = -nx + 5p - 6p. Let y(m) = 39m - 9. Calculate the remainder when y(1) is divided by x. 0 Let u = 13579 - 13551. Calculate the remainder when ((-72)/28)/(2/(-84)) is divided by u. 24 Let o(h) = -17h + 649. What is the remainder when 161 is divided by o(33)? 73 Suppose -5l + 10 = -25. Suppose -lg + 4g + 117 = 0. Suppose 0 = 2i - 3c - 245, 7688i - 7692i = c - 455. Calculate the remainder when i is divided by g. 37 Let j be (-2)/4(66 + -3 + 7). Let z = j + 70. Calculate the remainder when 63 is divided by z. 28 What is the remainder when 716 is divided by (-20)/25(-772 - 113)? 8 Suppose -3o = 2w - 3453, -31w + 33w = 3o + 3471. What is the remainder when w is divided by 25? 6 Suppose -7a + 47 = 19. Suppose -26s + as = -440. What is the remainder when 22 is divided by s? 2 Let q = -6 + 2. Let j be (-195 + -1)/q - -1. Suppose -3h + 64 = r - 5, -2r + j = 2h. What is the remainder when 43 is divided by h? 21 Suppose -2z = -8, 72z - 313 = -a + 74z. What is the remainder when a is divided by 77? 13 Let d = -88 + 91. Suppose -3j - 12 = 3, 87 = 4k - dj. Suppose 0 = -4u - 2y + k, -2u + 0u + 5y + 15 = 0. What is the remainder when u is divided by 4? 1 Suppose 3s - 9s + 990 = 0. Suppose 9j = 6j + s. Let u = -52 + j. Calculate the remainder when u is divided by 3. 0 Suppose -2c + 10 = 0, -2r - c = -7r - 60. Let x(q) = -q - 2. Calculate the remainder when (86/(-6))/(1/(-3)) is divided by x(r). 7 Let y(u) = 30u2 + 25u - u*3 + 7 + 28u*2 - 92u*2 + 37u*2. Calculate the remainder when y(6) is divided by 17. 15 Suppose 25 - 103 = -4a + 2r, -2r = -2a + 42. Suppose 10y - 9y - 102 = -2j, -y - 153 = -3j. What is the remainder when j is divided by a? 15 Suppose -68 = -5r + 3r + 4x, -r = -11x + 11. Calculate the remainder when 8799 is divided by r. 43 Suppose -z - 759 + 4908 = -2d, 5z - 20719 = -3d. Calculate the remainder when z is divided by 81. 14 Suppose 46288 = 3m + 5m. Suppose -2034 = -34y + m. Calculate the remainder when y is divided by 47. 42 Let t(x) = 9x - 1. Let y(i) = 10i - 2. Let h(l) = 4t(l) - 3y(l). Let s be h(0). Suppose 6a = s + 382. What is the remainder when a is divided by 34? 30 Let a(n) = -123n2 + n + 1. Let w be a(-1). Suppose 0 = 47l - 15412 + 4508. Let q = l + w. What is the remainder when q is divided by 28? 25 Let d = 135 - 114. Let h(q) = -201q. Let c be h(-2). Suppose -5i = -c - 213. Calculate the remainder when i is divided by d. 18 Suppose 158 = 3s - 49. Let q = -50 + s. Suppose 22i - qi = 24. Calculate the remainder when 46 is divided by i. 6 Let q = -927 + 512. Let o = q - -497. What is the remainder when 244 is divided by o? 80 Let t(c) = -c3 - 2c*2 + c. Let w be t(0). Suppose w = 71p - 68p - 231. Calculate the remainder when p is divided by 13. 12 Suppose 144y + 399 = 163y. Let l(v) = 1 + 7v - 2v3 - 3v*3 - 4v - v*2 + 6v*3. What is the remainder when l(4) is divided by y? 19 Suppose -22m + 562 = -37 - 17. Calculate the remainder when 531 is divided by m. 27 Let m = 210 - 131. What is the remainder when 250 is divided by m? 13 Let p(h) be the first derivative of 21h4/4 + h3/3 - h2 + 2h - 2. Let u be 11 + (-160)/(12 - -4). Calculate the remainder when 131 is divided by p(u). 21 Let g(j) = j*2 + 13j - 13. Let n be g(-10). Let v = n + 43. Suppose 0 = x + 3, 5i + vx - 124 = -2x. What is the remainder when i is divided by 7? 5 Suppose -5b + 21890 = i, -8b + 5b + 5i = -13134. What is the remainder when b is divided by 13? 10 Let p = 811 + -445. Let m = p - 348. What is the remainder when 303 is divided by m? 15 Let o = 399 + -236. Let c = o + -155. What is the remainder when 13 is divided by c? 5 Suppose n + 4i = 349, -4n + 3i - 2i + 1396 = 0. What is the remainder when n is divided by 89? 82 Let o = -194 + 264. Let h = -90 + 54. Let n = h + o. What is the remainder when n is divided by 12? 10 Let g(m) = -m3 + 27m*2 - 50m + 14. Let u be g(25). Suppose -uw + 184 + 124 = 0. What is the remainder when -31 - 30-3 is divided by w? 21 Suppose 0 = -4w - 2v - 410 + 1606, -4v = w - 285. Calculate the remainder when 616 is divided by w. 14 Let h be 902/12 - 6/36. Suppose 2491z = 2486z + h. Calculate the remainder when 29 is divided by z. 14 Let w be (-1)/((22/(-4))/11). Suppose 5m - 5l - 55 = -wl, -3m + 52 = 2l. Calculate the remainder when 153 is divided by m. 13 Suppose 1525l - 157 = 1522l - 4q, -q - 165 = -4l. Calculate the remainder when 5888 is divided by l. 40 Let x = -5644 + 6105. Calculate the remainder when x is divided by 89. 16 Let q be -23/12 - 567/(-14). Suppose 0 = -6w - 4w + q. Let u = 109 - 105. What is the remainder when w is divided by u? 0 Suppose 5t - 2b = 3b + 45, -3b = t - 1. Let h(n) = n*2 + 11n + 3. Let i be h(-13). Calculate the remainder when i - ((-7 - -11) + -6) is divided by t. 3 Suppose -10 = 4m - 9m. Let p be m + (-6)/9 - 2/6. Calculate the remainder when -1((-4)/(-2) + -42) - p is divided by 21. 18 Suppose 0 = -16r - 8r + 9r + 11940. Calculate the remainder when r is divided by 261. 13 Let v(h) = -h*3 - 11h*2 - 13h - 18. Let g = -37 - -27. Let j be v(g). Suppose -jd = -14d + 44. What is the remainder when 41 is divided by d? 19 Let c be -1 - -7 - (-6 + 2). Suppose 11x - cx - 6 = 0. Suppose xn + 5y = 2n + 12, 2n - 3y - 28 = 0. Calculate the remainder when n is divided by 3. 2 Suppose -5o - 4z - 59 + 19 = 0, 3o + 4z = -16. Let t(h) = 2h*2 + h - 62. What is the remainder when t(o) is divided by 54? 52 Suppose 5o - 3t - 113 = 0, 4o + 3t = -0o + 85. Suppose 4b + 3h - 23 = 0, -5h - 32 + 17 = 0. What is the remainder when o is divided by b? 6 Let v(j) = -j2 + 3j + 5. Let w = 22 + -19. Suppose -3a - 3f + 96 = 0, 4a - wf - f = 88. Calculate the remainder when a is divided by v(0). 2 Suppose 5x + 7 = -2x. Let m be 2 - (-2 - x)69. Let f = m + -54. What is the remainder when 83 is divided by f? 15 Let b(x) = -266x3 + x2 + x + 1. Let j be b(-1). Let n = -69 + j. Calculate the remainder when n is divided by 50. 48 Suppose -19z - 67981 = -69102. Calculate the remainder when 378 is divided by z. 24 Suppose -2w + 3k = -45, 0 = 5w - 2k - 136 - 4. Let j = -15 + w. What is the remainder when 24 is divided by j? 9 Let x(m) = m + 4. What is the remainder when (-5)/(-12) + (-4)/6 - 3427/(-92) is divided by x(6)? 7 Suppose 5d - 27 = 58. Suppose -du = -38u + 1722. What is the remainder when u is divided by 22? 16 Suppose 7 = r - 2x - 3	{ "pile_set_name": "DM Mathematics" }
4/6 - s3/3 - s2/2 = 0. Calculate s. -1, 0, 3 Factor q5/4 - 21q4/4 + 69q*3/2 - 56q*2 - 96q. q(q - 8)2(q - 6)(q + 1)/4 What is x in x2/3 - 26x/3 - 407/3 = 0? -11, 37 Factor 4w3 - 668w*2 + 2620w - 1956. 4(w - 163)(w - 3)(w - 1) What is u in 6u*3 + 159u*2 - 429u + 174 = 0? -29, 1/2, 2 Let 50c3 + 155c*2 + 115c + 10 = 0. What is c? -2, -1, -1/10 Let -5z3 + 65z*2 + 5z - 65 = 0. Calculate z. -1, 1, 13 Factor -2l2/5 - 24l/5 - 22/5. -2(l + 1)(l + 11)/5 Factor 3f3/4 + 45f*2 - 1161f/4 + 891/2. 3(f - 3)2(f + 66)/4 Factor -z*4/3 - 152z*3/3 - 2888z*2 - 219488z/3 - 2085136/3. -(z + 38)*4/3 Factor 4d*5 - 8d*3 + 4d. 4d(d - 1)*2(d + 1)2 Factor -s2/4 - 3s/2 - 2. -(s + 2)(s + 4)/4 Factor 87880h5 + 50700h*4 + 9750h*3 + 625h*2. 5h*2(26h + 5)3 Solve -2048i*4 - 155904i*3 - 173664i*2 - 64908i - 8100 = 0. -75, -3/8 Factor -q*2/5 - 14024q/5 - 49168144/5. -(q + 7012)*2/5 Let -2j*3 - 84j*2 + 110j + 1032 = 0. What is j? -43, -3, 4 Solve -4r3 + 52r*2 + 1200r = 0. -12, 0, 25 Determine r so that 2r2/5 - 174r/5 = 0. 0, 87 Suppose 2h2/5 + 172h/5 + 3698/5 = 0. What is h? -43 Suppose -56x2 - 1044x - 648 = 0. Calculate x. -18, -9/14 Find c such that -c5/4 + c4 + 3c3/2 - c2 - 5c/4 = 0. -1, 0, 1, 5 Let f*2 - 16f + 64 = 0. Calculate f. 8 Factor -2p4/3 - 112p*3/3 - 640p*2 - 13312p/3 - 32768/3. -2(p + 8)3(p + 32)/3 Factor 2b3 - 6b*2 - 12b + 16. 2(b - 4)(b - 1)(b + 2) Factor -103b*3/4 + 99b*2/4 + b. -b(b - 1)(103b + 4)/4 Solve -j*5/4 - 3j*4/4 + 13j*3/2 + 9j*2 - 22j - 24 = 0 for j. -6, -2, -1, 2, 4 Factor -w*3/5 + 94w*2/5 + 389w/5 + 294/5. -(w - 98)(w + 1)(w + 3)/5 Solve 15s4 + 1221s*3 - 3354s*2 - 6576s - 2016 = 0. -84, -1, -2/5, 4 Determine l, given that -l*5/7 + 2l*4 - 43l*3/7 + 30l2/7 = 0. 0, 1, 3, 10 Factor -g2 + 182g - 537. -(g - 179)(g - 3) Factor -2z2/15 - 3796z/15. -2z(z + 1898)/15 Find g, given that -2g3/3 + 2g*2/3 + 22g + 42 = 0. -3, 7 Find x, given that 25x2 + 20x - 5 = 0. -1, 1/5 Find b, given that -4b3/3 + 1164b*2 - 253460b - 763876/3 = 0. -1, 437 Factor -3j4/2 - 15j*3/2 - 12j*2 - 6j. -3j(j + 1)(j + 2)2/2 Factor c4/4 + 2c*3 - 33c2/4 + c + 11. (c - 2)2(c + 1)(c + 11)/4 Let 2y4/3 - 152y*3/3 + 1100y*2 - 15400y/3 + 12250/3 = 0. Calculate y. 1, 5, 35 Factor w*2/3 - 247w/3 - 248/3. (w - 248)(w + 1)/3 Suppose -2o*3/9 - 24o*2 - 648o = 0. What is o? -54, 0 Factor 5w4 - 20w*3 - 15w*2 + 70w - 40. 5(w - 4)(w - 1)*2(w + 2) Determine g, given that -65g5/9 - 289g*4/9 + 3166g*3/9 - 4276g*2/9 + 1624g/9 - 160/9 = 0. -10, 2/13, 2/5, 1, 4 Factor 4k3 + 3984k*2 + 7956k + 3976. 4(k + 1)2(k + 994) Suppose -2z4 + 80z*3 + 84z*2 - 80z - 82 = 0. Calculate z. -1, 1, 41 Find b such that 28b3 + 104b*2 + 52b - 24 = 0. -3, -1, 2/7 Let -4k5 - 3266k*4 - 1632k*3 = 0. What is k? -816, -1/2, 0 Solve 3l*2 + 171l - 540 = 0 for l. -60, 3 What is a in a*2 - 138a + 137 = 0? 1, 137 Factor -2k3/11 + 6k*2/11 + 18k/11 + 10/11. -2(k - 5)(k + 1)*2/11 Factor -15t*4 - 55t*3 - 40t*2 + 20t. -5t(t + 2)*2(3t - 1) Solve -2z*5 + 78z*4 - 1044z*3 + 5724z*2 - 13770z + 12150 = 0 for z. 3, 15 Suppose 2r3/9 + 16r*2/3 + 130r/9 + 28/3 = 0. Calculate r. -21, -2, -1 Find u, given that u*3 + 8u*2 + 17u + 10 = 0. -5, -2, -1 Factor -5o4/6 - 20o*3 - 55o*2 - 160o/3 - 35/2. -5(o + 1)3(o + 21)/6 Determine p so that -10p2 - 64p - 24 = 0. -6, -2/5 Find o such that 56o5/9 + 278o*4/9 - 14o*3/9 - 20o*2/9 = 0. -5, -1/4, 0, 2/7 Solve 4s*5/3 - 14s*4 + 172s*3/3 - 114s*2 + 328s/3 - 40 = 0 for s. 1, 2, 5/2, 3 Let q*5/3 + 5q*4 + 67q*3/3 + 43q*2 + 112q/3 + 12 = 0. Calculate q. -9, -2, -1 Factor -o*2/3 + 5o - 14/3. -(o - 14)(o - 1)/3 Suppose -4c*2 - 112c + 116 = 0. What is c? -29, 1 Solve 4j2 + 756j - 760 = 0 for j. -190, 1 Determine y so that y*2/6 - 22y/3 - 15/2 = 0. -1, 45 Suppose 2i2/7 + 76i/7 - 78/7 = 0. Calculate i. -39, 1 Factor -4s2 - 4s + 8. -4(s - 1)(s + 2) Suppose g*2/2 + 97g/2 + 315 = 0. Calculate g. -90, -7 Factor -3i2/8 - 6603i/2 - 14533203/2. -3(i + 4402)2/8 Let 12j*2 + 16j - 28 = 0. Calculate j. -7/3, 1 Factor 5p2 + 590p. 5p(p + 118) Factor 3t2 - 4776t + 1900848. 3(t - 796)2 Suppose -2k*5/5 - 4k*4/5 + 14k*3/5 + 16k*2/5 - 24k/5 = 0. Calculate k. -3, -2, 0, 1, 2 Let 2a3 + 18a*2 + 48a + 40 = 0. What is a? -5, -2 Determine t so that -3t5/5 + 66t*4/5 - 411t*3/5 + 156t*2 = 0. 0, 4, 5, 13 What is l in -5l*5 + 5l*4 + 100l*3 + 80l*2 - 320l - 400 = 0? -2, 2, 5 Determine f, given that -4f5 + 44f*4 - 104f*3 - 104f*2 + 300f + 252 = 0. -1, 3, 7 Factor 2c2/9 - 16c/3 + 88/9. 2(c - 22)(c - 2)/9 Factor -2d2/5 + 26d/5 - 12. -2(d - 10)(d - 3)/5 Factor -y*4/8 + 13y*3/8 - 57y*2/8 + 95y/8 - 25/4. -(y - 5)*2(y - 2)(y - 1)/8 Suppose -4s*5 + 4s*4 + 28s*3 - 52s*2 + 24s = 0. Calculate s. -3, 0, 1, 2 Let 324v3 + 792v*2 + 304v + 32 = 0. Calculate v. -2, -2/9 Factor -2x3 - 78x*2 - 76x. -2x(x + 1)(x + 38) Let -2q*5/9 - 104q*4/9 - 562q*3/3 - 8360q*2/9 - 6776q/9 = 0. Calculate q. -22, -7, -1, 0 Factor 2u4/9 + 4u*3/9 - 2u*2/9 - 4u/9. 2u(u - 1)(u + 1)(u + 2)/9 Factor -5o2 + 110o + 240. -5(o - 24)(o + 2) Suppose 2u3/3 - 3844u*2/3 + 1843192u/3 + 3701776/3 = 0. Calculate u. -2, 962 Find l such that -3l5 + 27l*4 - 24l*3 = 0. 0, 1, 8 Suppose -3w*3 - 24w*2 + 3w + 24 = 0. What is w? -8, -1, 1 Factor -2g4 + 6g*3 + 56g*2 - 120g. -2g(g - 6)(g - 2)(g + 5) Find l such that -l*3 + 164l*2 + 165l = 0. -1, 0, 165 Find a, given that 3a3 - 51a*2 + 198a = 0. 0, 6, 11 Determine a so that a4/4 + a3/4 - a2/4 - a/4 = 0. -1, 0, 1 Factor -a5 + 9a4 + a3 - 9a2. -a2(a - 9)(a - 1)(a + 1) Factor -2s*2/7 + 4s/7 + 96/7. -2(s - 8)(s + 6)/7 Solve 4k2/9 - 704k/9 - 3620/9 = 0 for k. -5, 181 Find c, given that c*3/2 - 289c*2/2 + 10512c - 10368 = 0. 1, 144 Factor -v*2/2 + 9v + 319/2. -(v - 29)(v + 11)/2 Factor 3d*5/4 - 63d*4/4 + 207d*3/2 - 447d*2/2 + 783d/4 - 243/4. 3(d - 9)2(d - 1)*3/4 Factor -5v*3 - 15775v*2 - 12450415v - 12434645. -5(v + 1)(v + 1577)*2 Factor -3k*2/5 + 3k/5 + 36/5. -3(k - 4)(k + 3)/5 Factor -a*4/4 - 19a*3/4 - 4a*2 + 9a. -a(a - 1)(a + 2)(a + 18)/4 Determine g so that -g4/2 - 17g*3 - 123g*2/2 - 45g = 0. -30, -3, -1, 0 Solve -5t2 + 865t - 860 = 0. 1, 172 Factor 2i2/7 + 38i/7 + 68/7. 2(i + 2)(i + 17)/7 Suppose 3g5/5 - 33g*4/5 - 168g*3/5 + 1308g*2/5 + 1248g + 960 = 0. Calculate g. -4, -1, 10 Determine q, given that -q*5 - 186q*4 - 8828q*3 - 16184q*2 + 35328q + 67712 = 0. -92, -2, 2 Find s, given that -s*4/10 + 22s*3/5 + 9s2/2 = 0. -1, 0, 45 Solve f5/8 - 17f4/8 - 417f*3/8 + 6821f*2/8 + 1805f/2 = 0 for f. -20, -1, 0, 19 Factor 2w4 + 26w*3 + 72w*2. 2w*2(w + 4)(w + 9) Let 2f*2 + 90f + 88 = 0. Calculate f. -44, -1 Factor -y*2/5 + 459y/5. -y(y - 459)/5 Factor 6j*2 - 6j + 4/3. 2(3j - 2)(3j - 1)/3 Factor -4r2 + 828r. -4r(r - 207) Factor m*3/2 - 2m*2 - 40m - 96. (m - 12)(m + 4)2/2 Factor 3f*4 - 798f*3 + 70488f*2 - 2043618f - 2114907. 3(f - 89)3(f + 1) Let s*3 - 37s*2/5 - 17s + 117/5 = 0. What is s? -13/5, 1, 9 Factor -h*2/5 + 478h/5 + 1443/5. -(h - 481)(h + 3)/5 Suppose -4j*3/3 + 53j*2 + 68j + 41/3 = 0. What is j? -1, -1/4, 41 What is h in 20h3 - 64h*2 + 48h = 0? 0, 6/5, 2 Determine o so that -o3 + o2 + 2o = 0. -1, 0, 2 Factor -m2/7 - 125m/7 - 246/7. -(m + 2)(m + 123)/7 Factor -82m*2 + 108m. -2m(41m - 54) Factor 5c*4 - 120c*3 + 425c*2 - 510c + 200. 5(c - 20)(c - 2)(c - 1)2 Suppose -u5/2 + 7u*4/2 + 11u*3/2 - 23u*2/2 - 5u + 8 = 0. What is u? -2, -1, 1, 8 Find n, given that 22n4/5 - 114n*3/5 + 108n*2/5 - 16n/5 = 0. 0, 2/11, 1, 4 Factor 2b3/3 + b2 - 2b/3 - 1. (b - 1)(b + 1)(2b + 3)/3 What is n in -5n*5 - 25n*4 - 30n*3 + 20n*2 + 40n = 0? -2, 0, 1 Determine l so th	{ "pile_set_name": "DM Mathematics" }
9d - 8. What is q(h)? -18 Let t(d) = d3 + 16d*2 + d + 17. Let i be t(-16). Suppose n + i = -2. Let r(k) = -3k - 3. Determine r(n). 6 Let d be -15 + -19 + -1 + -1. Let i be (-4 - d - -3) + 2. Let m(q) = -q + 3q + 39 - i. Determine m(6). 14 Let h(t) be the first derivative of 5t*2/2 - 3t - 335. Determine h(-3). -18 Let y be 135/12 - (-8)/(-32). Let p(u) = u + 2. Determine p(y). 13 Let g(u) = u*2 - 5u + 6. Let a be g(6). Let n(s) = -5s + 6 + as - 5s. What is n(6)? 18 Let c(z) = z3 - 6z*2 - 2z - 4. Let t = -207 + 213. What is c(t)? -16 Let u(j) = -7j - 25261 + 25261 + j2. Suppose 0 = -5d - 5b + 8 + 32, 16 = 3d - b. What is u(d)? -6 Let c(k) = -2k2 - 4k. Let n be ((-4)/10)/((-11)/110). Suppose 0 = -0u - 4u - 12. Let j be n/(-4)(-12)/u. Calculate c(j). -16 Let n(i) = i3 - 14i*2 + 14i - 11. Let v be n(13). Suppose 0 = -3z + v + 4. Let t(u) = 0u - 2 + 2u + 3u - 3uz - 3u. What is t(2)? -10 Let z = -1086 + 1082. Let r(v) = 13v + 4. Calculate r(z). -48 Suppose 0j - 10 = 5j. Let g be (-22)/(-10) - (-48)/60. Let y(r) = -g - 2r - 1 + 1 - 2r. Give y(j). 5 Let m be 6 + 1/((-6)/1684). Let u(y) = y - 1. Calculate u(m). -2 Let y(g) = -g2 - g - 5. Let h(o) = -o2 - 2o - 5. Let j(f) = 6h(f) - 5y(f). Let q(w) = -w3 - 13w*2 - 2w - 30. Let i be q(-13). Determine j(i). 7 Let n(z) = 5z - 76 - z2 + 82 - z3 + 0z*2 - 3z*2. Calculate n(-4). -14 Let j(i) = 6i. Let n(w) = -9w + 2. Let v be n(3). Let t be 1 + v + 0/3. Let y be (-32)/t(-6)/4. Calculate j(y). -12 Let z be (-1)/(-2)(-12)/(-6). Let o(y) = 14y - z - 9y - 4y. Let j be (-2)/(-1) + (-2 - -1). What is o(j)? 0 Let c(f) = -7f3 + 18 - 4f*3 + 5f*2 - 5f - 15 + 12f3. Suppose -2k + 3 = -4v - 1, 3k - 5v = 2. Determine c(k). -3 Let x(h) = -3 - 1 - 7h + 3 + h*2 + 6h2 - h3. Suppose 2a + 2r - 12 = 0, -a - 2a + 19 = 4r. Suppose g - 1 = 0, -2y - ag = y - 23. Determine x(y). -7 Let h(n) = -n + 2. Let j(u) = -4u - 8. Let c(k) = -5h(k) + j(k). Calculate c(17). -1 Let q be (-12)/((-36)/33) + -13. Let t(l) be the third derivative of l6/120 - l5/60 - l4/8 - l3/2 + l2. Give t(q). -9 Let d = 4 - 3. Let m(g) be the first derivative of -g2/2 + g - 31. Give m(d). 0 Let i(k) be the first derivative of -k*2 + k + 159. Suppose 2j = -2 - 2. Determine i(j). 5 Let u(d) = -12d3 + d - 1. Let k(o) = -o. Let h(s) = 2s*2 + 18s - 1. Let i(y) = -h(y) + 2k(y). Let g be i(-10). What is u(g)? -12 Let f(j) = -7 - 2j - 14 - 12 - 20 + 50 + j2. Give f(3). 0 Let i(r) = r + 7. Let b(z) = z3 - 16z2 + 13z + 23. Let a be b(15). Let x be -4 + (-2 + a)/3. What is i(x)? 0 Let l(h) = -h*2 - 2h - 1. Let o(w) = w*2 + 7w - 5. Let i be o(-8). Let u be (-30)/(-20)(-4)/i. Determine l(u). -1 Suppose 0 = -2s + s. Let p be 18/6 - (s - -3). Suppose -k + 4d - 4 = 3k, p = 5k + 5d + 25. Let x(v) = -2v2 - 3v - 1. What is x(k)? -10 Let b(d) = -3d2 - 2 + 113d*3 - 1 + 2d - 111d3. Let h be b(2). Let f(v) = 3v + 1. Let m(z) = -2z - 1. Let r(l) = -4f(l) - 5m(l). What is r(h)? -9 Let t(c) = c2 - 14c - 14. Suppose 7n - 4s = 109, 2s - 11 = -n + 2. Calculate t(n). 1 Let r(t) = t2 - 15t + 5. Suppose -4i + 88 = 5x, 0 = i + 2x - 5 - 20. What is r(i)? 39 Let v = -11 + 30. Let x(s) = -2 - 2s2 + s2 + 37s - 16s - vs. What is x(2)? -2 Let f be 9/(-6)(-20)/15. Let q be (4/(-2) - f)2. Let n(x) = x + 3. What is n(q)? -5 Let k be (-2)/5 + 459/135. Let b(o) be the first derivative of ko - 9 + 1/2o2. Determine b(-2). 1 Let j(u) = -2u*2 - 26u + 30. Let s be (-11904)/868 + (-9)/7 + 1. What is j(s)? 2 Let t(u) = 2u + 4. Let x be t(-1). Let p(o) = -7 + 3o*3 + 5o*3 - 10o*3 - 7o*x + 3o*3 + 6o. What is p(6)? -7 Let k(w) be the third derivative of -w*5/60 - 7w*4/8 + 19w*3/6 - 69w*2. Calculate k(-22). -3 Let r = 12 - 26. Let g = 8 + r. Let h(u) = 7u*2 + 5u + 8. Let a(d) = 12d2 + 11d + 16. Let x(m) = 3a(m) - 5h(m). Give x(g). -4 Let s be ((-24552)/55)/24 + (-3)/(-5). Let d(v) = -v*2 - 20v - 36. What is d(s)? 0 Suppose 23 - 11 = 6l. Let z(y) = -4y + 16y2 - 17y*l + 3y. Calculate z(-1). 0 Suppose 3c - 2c = 5. Let i(f) = f - 7. Let w(b) = 2b + 14. Let q(s) = 3s + 14. Let n(m) = 4q(m) - 5w(m). Let o(y) = -7i(y) + 3n(y). Calculate o(c). 2 Let d(r) = -105r - 2r*2 + 0 + 2 - 4 + 120r. Give d(7). 5 Let u(v) = -v*3 - 3v*2 - 3v + 3. Let c be u(-3). Let r(t) = -t*3 + 11t*2 + 12t - 3. Determine r(c). -3 Let n(d) be the third derivative of -1/120d6 + 16d*2 - 1/15d*5 + 0 + 0d - 7/6d3 + 1/6d*4. Determine n(-5). -2 Suppose 0o - 4v = 2o + 94, 0 = 5v. Let p = o + 53. Let w(u) = 3u - 1. Determine w(p). 17 Let s be 0/(((-1)/2)/((-4)/(-8))). Let v(p) be the third derivative of 0p3 + 0 + 1/10p*6 + 1/24p*4 - 1/30p*5 + sp - 3p2. Give v(1). 11 Let i(n) be the third derivative of n5/20 + n4/3 + n3/2 - 453n*2. Give i(-2). -1 Let k(s) = s - 11. Let g(r) = -2r*2 - 13r + 7. Let l be g(-6). Determine k(l). 2 Let l(n) be the third derivative of n6/24 + n5/30 + n*4/24 + 2n*2. Let u = -15 + 16. Suppose r - u = 2r. Calculate l(r). -4 Let o(d) = -d3 + d2 - 2d + 3. Suppose -8s + 11 + 21 = 0. Suppose -g + 2 = 1, sr + 3g - 11 = 0. Calculate o(r). -5 Let y(g) = 159g2 - 53g*2 + 1 - 2 - 42g*2 - 51g*2 + 0. Suppose 6 = -3o, -2c - 1 = c - o. Let p = -2 - c. Determine y(p). 12 Let x(v) = -6v*3 + 5v*2 - 45v + 16. Let b(f) = -f3 + f2 - 8f + 3. Let o(z) = 11b(z) - 2x(z). Suppose 0 = -k - 4 + 3. What is o(k)? -1 Let v(a) = 4a + 0 - 9 + 4a2 + 5. Let w(q) = -3q*2 - 3q + 4. Let z(y) = 2v(y) + 3w(y). Let g = -26 - -23. Give z(g). -2 Suppose -5 = -5k, 4u + 0k - 14 = 2k. Suppose -4p + 3p = -2. Let b(m) = -7m - 4 - 29m*2 + 6 + 30m*p. What is b(u)? -10 Let d(m) be the third derivative of -5/24m*4 + 0 - 7/60m*5 + 5/3m*3 + 1/120m*6 + 24m*2 + 0m. What is d(7)? -25 Suppose -17h + 10 + 58 = 0. Let n(o) be the second derivative of -5/12o*h - 1/2o*2 - 1/20o*5 - 3o - 2/3o3 + 0. Calculate n(-3). -7 Let s(a) = 7a*3 + 1. Let o(z) = -19z + 24. Let k be o(-6). Let j = k - 139. Calculate s(j). -6 Let z(k) = -k*2 + 9k - 22. Suppose 15y = 18y - 5c - 10, 4y - 24 = -4c. Give z(y). -2 Let n(z) = z + 2. Let p be n(0). Suppose -p = 2w - 6. Let a(g) be the second derivative of g5/20 - g4/6 - 2g3/3 + 3g*2/2 - 9g. Give a(w). -5 Suppose i + 7 = 3p, 5p + 0i - 15 = 5i. Let u(l) = 6l - 6l*2 + 2l*p + 2l2 + l2. What is u(4)? 8 Suppose -u + 3t + 3 = 0, 5u + 2t = 18 - 3. Suppose x - 2d = -2, -5x + 3d + 0 - u = 0. Let p(w) = 156w - 175w + 9 + 20w. What is p(x)? 9 Let p = -308 - -314. Let u(d) = 6d - 11d2 - 2 + 10d*2 + 0. Determine u(p). -2 Let x = -15 - -21. Let q(n) = 1. Let i(g) = -2g + 12. Let u(h) = i(h) - 4q(h). Determine u(x). -4 Let h(w) = -8w + 43. Let j(o) = o*3 + 10o*2 - 22o + 26. Let n be j(-12). Let d(u) = -2u + 11. Let k(z) = nh(z) - 9d(z). What is k(9)? 5 Suppose -5b + f - 3f - 8 = 0, -4b = 2f + 6. Let u be 2 + 2/4b. Let m(s) = -32s + 11. Let k(j) = 14j - 5. Let h(a) = 9k(a) + 4m(a). What is h(u)? -3 Suppose 19d = 14d - 25. Let u(o) = o*2 - 10o - 2. Let p(v) = v*2 - 9v - 2. Let m(t) = du(t) + 6p(t). Give m(4). -2 Suppose 3a - 10 = s - 2s, 0 = -2a + s. Let q(b) = -7873b2 - b3 - 3b + 3935b*2 + 3942b2 + 2. Give q(a). 4 Let c(b) be the first derivative of b3/6 + 25b + 34. Let t(l) be the first derivative of c(l). Calculate t(-2). -2 Let i(r) = -r - 19. Suppose -16s + 154 = -27s. Give i(s). -5 Let f(z) = -z3 - 2z*2 + z + 4. Suppose -5y = 3y - 16. Suppose q = yh + 5q - 10, -h + q - 7 = 0. What is f(h)? 10 Let m(x) = 2x*3 + x - 2. Let i(k) = 2k*3 + k - 2. Let g(w) = -3i(w) + 2m(w). What is g(2)? -16 Let i(l) = l2 - 6l + 4. Let b(t) = -6t3 + t2 + t. Let y be b(-1). Let p be -5 + 7 + 3y. Let m be 75/p + (-2)/(-8). Determine i(m). -4 Let u(j) be the first derivative of j*3/3 - j + 22. Let d be 6/4(-44)/(-33). Give u(d). 3 Let i(r) = r*2 + 9r + 1. Let g(w) = -w*2 - 8w + 36. Let o be g(9). Let c be o/17 - (-3 - 212/(-68)). What is i(c)? -13 Suppose 0o + 8 = -4o. Let l = o + 7. Let k(s) = 2s + 3s - 6*s. Giv	{ "pile_set_name": "DM Mathematics" }
+ 2o - 24, 4j = -o + g. Let d = j - -134. Is d prime? True Let c(q) = -8q3 - 7q*2 - 11q + 11. Is c(-15) a prime number? True Suppose 5o + 25589 = 2c - 36515, 0 = 4c - 2o - 124160. Is c a composite number? True Let f(j) = -5j2 - 10j + 54. Let g be f(11). Let s = -164 + g. Let x = 886 - s. Is x composite? True Let u = -2220 - 1622. Let i = 249 - u. Is i a prime number? True Suppose w - 3w = 2l + 16, 4l + 24 = -2w. Let b(f) = -2f - 5. Let t be b(w). Suppose -tm = -0m - 861. Is m a prime number? False Suppose 1 = -5z - k - 14, -2z + 3k + 11 = 0. Let v(x) = 4x + 13. Let c be v(z). Suppose co = 4414 + 831. Is o prime? True Let c(q) be the first derivative of -29q2/2 + 40q + 1. Suppose 3z = -2k - 49, -5k - 3z = 8 + 92. Is c(k) a composite number? True Suppose -2651 - 7513 = -14a. Let o = a - 275. Is o prime? False Let p = -4333 - -2494. Let b = 7472 + p. Is b composite? True Let d be (-5)/((-15)/63) - 5. Suppose -12367 = -dz + 3217. Is z prime? False Suppose -26p + 221825 + 334706 = -3p. Is p prime? True Let o(x) = -3x3 - 15x*2 - 36x + 22. Let z be o(-13). Suppose z = 7j - 1803. Is j a composite number? False Suppose 0 = -5p + 6 + 14. Suppose 5v = pv + 3. Suppose 0 = -vd + d + 434. Is d composite? True Let s(t) = 795t*2 - 3t + 1. Let u(o) = -o*2 + o. Let w(q) = -s(q) - 2u(q). Let l be w(1). Let g = 2450 + l. Is g prime? True Let f(x) = -x*2 - 29x - 190. Let z be f(-17). Is (-48)/168 - (-33072)/z a composite number? True Suppose -2n - 17 = -3i, 0 = n + 4i - i + 22. Let f(t) = -91t + 34. Is f(n) a prime number? True Suppose 5r - 886119 = 74541. Is r/180 + 2/(-5) a composite number? True Is -7436386/(-30) + (-12)/20 a prime number? True Suppose -4c - 59 = -75. Suppose 0 = 5u + 5z - 38005, -cu + z + 30404 = -4z. Is u a composite number? True Suppose 44u = -27u + 3570519. Is u a composite number? True Let r(w) = 423w*2 + 418w - 69. Is r(22) a composite number? False Let a be 2/4 - (-1 + -1)46194/(-24). Let q be (2/(-5))/(2/28040). Let j = a - q. Is j a prime number? True Let g = -12036 + 491. Is -101(-9)/((-90)/g) a composite number? True Is ((-356493)/9)/(105/(-315)) prime? True Suppose 0 = -4b + 9 - 1. Suppose -x = -3u - 3064, 5x - 6x - bu = -3039. Is x a composite number? False Let p(k) = k + 3k - 4k*3 - 7k - 7k2 - 2k - 1. Suppose -108q + 104q = 16. Is p(q) composite? False Suppose -5i = 2s - 99705, 49855 = -17s + 18s + 2i. Is s a composite number? True Suppose -14a = -47 - 149. Let n(q) = -q*3 + 12q*2 + 30q - 26. Let f be n(a). Is (-4 + 2611/2)/(f/4) a prime number? False Let t(q) = -33452q + 2467. Is t(-2) composite? False Let k(w) = 6w*2 - 32w - 4. Let p be k(6). Suppose pd = 33368 + 38052. Is d a composite number? False Let t(u) = -14u3 - 2. Let j(y) = -y3 + 5y2 + 7y - 4. Let c be j(6). Let i be t(c). Is (((-16)/(-6))/4)/((-2)/i) a composite number? True Suppose -485z = -482z - 6, b + 5z - 82077 = 0. Is b composite? False Let j = 17347 - 12252. Is j a composite number? True Let v(k) = -139k*2 - 1. Let x be v(1). Let z = 113 + x. Is 6472/6 + (-9)/z a composite number? True Let k = 39 - 37. Suppose kq + 10 = 6. Is ((-248)/32)/(q/8) prime? True Suppose -39g = -33g - 66. Let s(k) = 8k2 - 11k - 36. Is s(g) a prime number? True Let s = 52 + -48. Let u(m) = 3m - 5. Let p be u(2). Suppose sa - 3361 = -5b, 4b - 5b = -p. Is a prime? True Let n be ((-1488)/30)/(10/(-325)). Suppose 4f = -q + n, 4f - 4q - 458 = 1154. Is f prime? False Suppose 0j + 2j + 5c = 18, 3j - 18 = -3c. Is (j/2 - -642) + -3 composite? False Suppose 32a - 33a - 3u = -51249, 0 = -7a - 3u + 358635. Is a a prime number? False Let r(t) = 18t - 34. Let d be r(2). Suppose 4a - 32 = -4s, -s = -5s + 4a + 8. Suppose 0 = 2x - sm + 4m - 957, -x + 481 = dm. Is x a prime number? True Suppose 2x = -2w + 2052, -2x - w + 2052 = -5w. Suppose n - 506 = x. Suppose -4r + 1240 = -0h + 4h, 5h = r + n. Is h prime? True Let p = 11 + 0. Suppose -pk + 7k + 116 = 0. Let y = 190 - k. Is y composite? True Suppose -5f - 156508 = 12i - 13i, -4i = -3f - 625913. Is i prime? False Suppose 68w - 6 = 67w. Suppose 5r = -2u + 7306, wu - 14584 = 2u - 3r. Is u a prime number? True Let r(k) = -27788k*3 + 2k*2 - 8k - 7. Is r(-1) composite? False Let v = -1457 + 105350. Is v composite? True Suppose 677g + 152g - 174280626 - 110987393 = 0. Is g composite? False Let p = -58 - -89. Let b = p - 55. Is (-4)/(b/(-184)(-2)/3) a composite number? True Let h = 2 + 0. Let s be h/7 + 13167/49. Let y = s + -6. Is y a prime number? True Let a = 247 + 4382. Suppose -4t = -12, -t + a + 4479 = 3d. Is d composite? True Suppose 3w - 8 = -w. Let a be w - 1/(1/(-2651)1). Suppose -7i = -0i - a. Is i composite? False Suppose 5h + 2d - 484243 = 0, -h - 26d = -22d - 96863. Is h a composite number? False Let v = 561178 - -78493. Is v a prime number? True Let q = 35149 + 74868. Is q a prime number? True Let x(f) = f2 + 5f + 2. Suppose 17j - 36 = 23j. Let n be x(j). Is 23061/12 - 6/n a prime number? False Suppose 46f + 11514 = 44f. Let y = -3883 - f. Is y composite? True Suppose -f - 5k = -2k - 40, 0 = 4f - k - 108. Suppose -fz = -35z + 54649. Is z a prime number? False Suppose 1072131 = 13d + 5d - 434559. Is d composite? True Suppose -54r + 185505 = 3w - 51r, 247328 = 4w + 2r. Is w composite? True Suppose 3j = -0j. Let m(k) = 239 - k + 6k2 + 13k*2 - 16k*2 - 2k*2. Is m(j) prime? True Suppose 5 = 3g - 1. Let x be (2 - -16)(g - (-51)/6). Let n = x - 110. Is n prime? True Is -5 + -1 - (0 + -198992 + -11) composite? False Let o = 16483 - -10776. Is o a composite number? False Let p(u) be the third derivative of u6/120 + u5/60 - 3u*4/8 + 5u*3/6 + 11u*2. Suppose -2b + 7 = -1. Is p(b) a composite number? True Suppose 4q - 4m - 4 = 4, 5m = 2q - 7. Is q + 7395 + 6 + 0 a prime number? False Let a(c) = -6c3 - 3c*2 - 15c + 62. Let p be a(7). Let y = -809 - p. Is y prime? True Let t be (-1)/19/(54/(-24)). Suppose -w = -v + tw + 1429, 0 = 5v - 2w - 7191. Is v a composite number? False Suppose -13w = -4w - 117. Let s(m) be the second derivative of 7m4/12 - 23m*3/6 + 11m*2/2 + 5m. Is s(w) prime? False Let y = 30036 + 8225. Is y a prime number? True Let k be (-6)/(-4) + (-590667)/(-14). Let p = k + -23038. Suppose p = 3m + 3221. Is m a prime number? False Suppose 5k = 4q - 598 - 178, -4k - 183 = -q. Suppose -84g = -20g + 3584. Let x = g + q. Is x prime? False Suppose 3u + 362580 = 3m, u + 2u = 5m - 604306. Is m prime? True Let m(v) = 2v2 + 25v + 41. Let l be m(-11). Suppose 0 = ly - 13358 - 103530. Is y composite? True Suppose 39h - 57613 = 38h. Suppose -12u + 27335 + h = 0. Is u a prime number? True Suppose -w = 3i - 241435, 4w = -5i + 2w + 402393. Is i a prime number? False Suppose -3814567 = -334s + 2712127. Is s prime? True Suppose 1174254 = 5o + s, 4o - 2s + 234849 = 5o. Is o prime? True Suppose 2i = 4f + 174578, -14i + 18i - 349153 = 5f. Is i composite? True Let y = -9 + 11. Let u = -1687 - -6185. Suppose n - 1693 = 5v, yn = 5v - 1112 + u. Is n a composite number? False Let n(f) = 8f + 61. Let a be n(-7). Suppose 3q - k + 462 = 2011, -aq - 4k + 2576 = 0. Is ((q/8)/1)/((-1)/(-2)) a prime number? False Let i = -450 + 453. Suppose w - 1896 = -c + 657, -w = ic - 7667. Is c a composite number? False Let r = 91988 + -26821. Is r prime? True Is -4 - (0/18 - (-3 - (-111416)/1)) a prime number? True Let g(t) = -15500t3 - 4t*2 - 4t + 1. Is g(-1) a composite number? True Let m be (-4)/12 - ((-10)/6)/5. Suppose 5q - 4t - 21001 = m, q + 2t = 3388 + 815. Is q a prime number? True Let v be 2(-7394)/(-12) - (-256)/(-192). Let q = v - -2746. Is q a composite number? True Let g = -80 + 78. Let a(s) = -11s3 - 4s*2 - 7s - 9. Is a(g) composite? True Suppose -22 = -2a - 322. Let t be (-2 - a/9)/(2/243). Suppose t + 2438 = 4y. Is y a prime number? False Let t(u) be the third derivative of -u*6/120 + 4u5/15 + u4/3 + 5u3/6 - 2u*2 - 26u. Is t(12) prime? True Suppose -3i + 160256 = 3q - 1447396, 3i - 15 = 0. Is q a composite number? False Suppose 641028 = 2394	{ "pile_set_name": "DM Mathematics" }
)(4w*2 - 2w*2 - 3w*2) + (4w*3 - 3w*3 + 3w*3)(w - w - w). -3w4 Expand (5p*2 + 18 - 18)(-4p2 + 5p*2 + 0p*2) + 6p - 5p + 1 - 4 + 4p*4. 9p*4 + p - 3 Expand (-83 + 94 - 60)(-1 - y + 1). 49y Expand (919z*3 - 5378z*2 + 5378z*2)(z*2 + z - z). 919z*5 Expand ((-2 + 3 - 4)(0 + 3 + 0) + 2 + 2 - 3)(p2 - 2p*2 + 2p*2)(0p + 10p + 2p). -96p*3 Expand -4 + 4 + 2j - 4j + 3j + 0j + 0 + 0 - 2j + (0 + 0 + 2)(-j + 0 + 0) - 3j + 6j - 2j - 5j + 5j - j + 551j + 244j + 84j. 876j Expand (o3 - o3 + o*4)(-15 + 4 - 9)(-7o + 0o - o). 160o*5 Expand (3 + 0 - 1)(47898y5 - 2y - 48040y5 - 2y*3 + 0y). -284y5 - 4y*3 - 4y Expand (s - s + 2s)(-15s2 - 7s*2 - 14s*2) - 2s*3 + 3s*3 + 0s*3. -71s*3 Expand (0g*4 + 2g*4 - 4g*4)(0 + 0 + 1)(g + 41g + 51g). -186g*5 Expand (-11l + 31l + 6l)((4 - 4 + 2)(0l + 2l - l) + l + 1 - 1 + 0l + 0l - 2l). 26l*2 Expand (-4d2 + d2 + 4d2 - 2d*2 + 4d2 + d2 + (-3d + 5d - 3d)(1 - d - 1))(1282 + 1380 - 2800 - d). -5d*3 - 690d*2 Expand (-3q + 2q + 0q + (-1 + 1 + 1)(0q + q - 2q))(8241q - 32 - 8242q - 131). 2q2 + 326q Expand (3i + 0i - 2i)(-3i + 0i + 7i)(-5i3 + 25i - 25i). -20i*5 Expand (-3a - a + 5a)(2a - a + 5a)(-3a*2 + 3a*2 - 2a*2)(-4 - 2 + 7). -12a4 Expand ((-3 + 1 + 0)(-1 + 0 + 2) + 2 - 1 + 0 + (4 - 1 - 1)(-3 + 5 - 1) + 399 + 252 + 94)(o - 4 + 4). 746o Expand (0 + 3a*2 + 0)(-2a - 4 + 4) - 101a*3 + 644 - 644. -107a*3 Expand 2i + 0i - 3i + (2i - i - 2i)(0 - 1 + 0) + 2i + 1 + 2i - 3i + (-3 + 7 - 2)(3i - 4i + 4i). 7i + 1 Expand -94399x + 94399x - 254x*4 - 4x*4 + 3x*4 - 3x*4 + (-7x3 + x3 + 4x3)(-3x + 0x + 2x). -256x*4 Expand (-4 + 22 + 27)(-3t3 + t3 + t3) + 2t*3 + 0t3 - t3. -44t3 Expand (q4 - q4 + q4)(167 + 123 - 177 - q). -q*5 + 113q*4 Expand (-3 + 13 + 6)(2k - k + k + (-k - k - k)(-5 + 0 + 4)). 80k Expand (-d2 + 2d*2 - 3d*2)(4 - 4 + 2) + 2d2 + 0d + 0d - 3d - 2d2 + 3d + (5 - 1 - 2)(-d2 + 3d*2 - 4d*2) + 0d*2 + 6d2 - d2. -3d2 Expand 4w + w - 3w + (0w + w + 0w)(-1 + 0 + 8)(-42 + 29 + 28). 107w Expand (4j - 17j - 16j)(2 - 2 - 3j2) + 2j*3 - 2j*2 + 2j*2. 89j*3 Expand (1 - 3 + 1)(g*4 - 2g4 - g4) + g*4 - 2g*4 + 0g4 + (-g4 + g4 + g4)((2 - 5 - 1)(-1 + 2 - 6) + 1 + 0 + 1). 23g4 Expand -o - 4o - 5o + (-5 + 2 + 4)(3o + 2o - 3o) + 0o - 4o + 6o + 2o - 3o + 3o + 7o - 42o + 0o - 3o + 2o + 3o + (-o - 3o + 2o)(-3 + 4 - 3). -33o Expand (-5 + 6 + 15)(-4a - 2a*5 + 3a*5 + 2a*5). 48a*5 - 64a Expand (44 - 21 - 26)(0p + 2p + 0p). -6p Expand 957d*2 - 696d2 + 4 - 4 - d2 + 2d2 - 3d*2 + (2 - 6 + 3)(d*2 + 3d*2 - 3d*2) - 3d2 - d2 + 2d2. 256d*2 Expand (-2w + 2w + 4w)(13w + w + 5w). 76w*2 Expand (-2458w + 2458w + 3871w*2 - 625w*2)(-2w2 + 2w2 + w2). 3246w4 Expand ((-4s + 2s + 3s)(0 + 1 - 3) - 2s - s + s - 8s + 41 - 41)(-3s2 - s4 + 3s*2). 12s*5 Expand (-1 + 7 + 1)(3 + 1 - 6)(-86m*3 - 112m - 137m + 88m*3). -28m*3 + 3486m Expand 2n5 - 2n5 + n5 + (-4n4 + 11n - 11n)(10n + 4 - 4). -39n*5 Expand (-1343i*4 + 1342i*4 - 329 - 531)(-2i + 3i + 0i). -i5 - 860i Expand (-3b - 2b + 4b + (2b - b + b)(1 - 3 + 0) - 9b - 74b - 7b)(2b - 4b + 2 + b - 4b + 3b - b + (-2b - 4 + 4)(-3 - 1 + 5)). 475b*2 - 190b Expand -157 - 23v5 + 157 + (-v2 + 5v*2 - 2v*2)(-4v2 - 4v*3 + 4v*2) + 1 - 6 - 2v*5 + 6. -33v*5 + 1 Expand 783w*3 - 783w*3 + 39w*5 + (w - w - 2w*2)(17w2 + 6w*3 - 17w*2) + 2w*5 + 0 + 0. 29w*5 Expand 3o*2 + 0o + 0o + (3o - 6o + 2o)(261 - 261 - 26o). 29o2 Expand 43o*2 - 43o*2 + o + 3o*3 + (-3o*2 + 4o*2 - 2o*2)(-5o + 3o - o). 6o3 + o Expand (-10l*3 - 12l*3 + 11l*3)(-2 - 2 + 2) - 4l2 + 10l*3 + 4l*2. 32l*3 Expand (-h + 3h - 3h)(12 - 2 - 39)(-5h - 71 + 32 + 35). -145h2 - 116h Expand (5h - 3h - 3h)(-5 - 4 + 1)(-h2 - h2 + 0h*2) + (-3h + 2 - 2)(0h + 2h2 + 0h). -22h3 Expand (-3o*2 + 4o*2 - 3o*2)(-285 + 116 - 28 + (1 - 4 + 1)(-1 - 2 + 1))(2o - 2 + 2). 772o*3 Expand 5g - 4g - 6g + (2 + 0 - 1)(-5g + 7g + 9g). 6g Expand (-3a*4 + 4a*4 - 3a*4)(6354 + 2334 + 50 - 1316). -14844a4 Expand (-j - 15j + 0j)(0 - 2 + 3 - 1 + 2 - 3 + (1 + 3 - 3)(-4 + 0 + 5) + 3 + 1 - 2)(-5 + 0 + 4)(0j - 2j - j). -96j*2 Expand (2 - 1 + 0)(-1 + 4 - 2)(2 - 3 + 2)(-14l4 + 34l*4 + 2l*4). 22l*4 Expand 37f*4 + 3786 - 3787 - 107f*4 - 2f*2 + 2f2 - f4 + (f4 + f4 - 3f4)(2 + 3 - 4). -72f4 - 1 Expand -r2 + 2r2 + r2 + (-5 + 5 - 2r)(0r - r + 0r) + 3r2 - 4r*2 + 2r*2 - 300r*2 - 145r*2 + 126r*2 - 2r*2 - 2r*2 + 2r*2. -316r*2 Expand (9c2 + c2 + 0c2)(0 + 0 - 1)(-c + 2c + 2c). -30c*3 Expand 23j*3 - 4 + 4 + (j - 5j + j)(2 + 1 - 4)(3j2 + j2 - 3j*2). 26j*3 Expand (3l + l*2 - 3l)(74 - 3 - 24). 47l*2 Expand (-8z - 6z3 + 8z)(-30z - 17z + 37z)(3z - 4z + 0z) - 3z5 + 5z*5 - 3z*5. -61z*5 Expand (11 - 11 - 14c)(12 - 19c - 12). 266c2 Expand (0 + 15 + 2)((4w4 + 6w*3 - 6w*3)(2w - 2w - w) + 2w5 - 3w*2 + 3w*2). -34w*5 Expand (0b + b - 2b)(-2b2 + 0b2 + b2 + (-5 + 5 + 1)(-3b*2 + 3b*2 - 2b*2) - 5b2 - b2 - b*2). 10b*3 Expand (17 + 11 + 3)(-5 + t + 5)(3 - 3 + t). 31t*2 Expand (2o - 2o + 2o*2)(4o2 + o2 - 7o*2) + 3o*4 - 5o4 + o4 + 149o4 + 205o*4 + 304o*4. 653o*4 Expand (-4 - 1 + 1)((-9 + 19 + 9)(-6w + 0w + 3w) + w - 1 + 1). 224w Expand -16l*3 - 2l*3 + 62l*3 + (-2 + 2l + 2)(-4l2 + l2 + 4l2). 46l*3 Expand (6970 - 232m - 6970)(2 - 3 - 1). 464m Expand -8a3 - a5 + 8a*3 + (4 - a - 4)(-2a4 + 2a*4 + 2a*4). -3a*5 Expand (-60h - 58h + 21h)(-h2 + h2 - 6h2 + (h2 + 0h + 0h)(0 - 2 + 1)). 679h*3 Expand (2h - h - 1 + 7)(-h2 - 3 + 3) + (-14h*2 + 5h*2 - 6h*2)(3h + 3h - 5h). -16h*3 - 6h*2 Expand (23 - 43 + 29)(-b*5 - 3b5 + b5) + (b*3 - 4b*3 + 2b*3)(-38 + 8b2 + 38). -35b*5 Expand (4o - 6 + 3 + 1)(2 + 3o - 2). 12o2 - 6o Expand (97 + 99 - 197 + 98g)(3g2 + 2g - 3g - 5g*2). -196g*3 - 96g*2 + g Expand (-2n + n - n)(0 + 0 - 2n) + (3 + n*2 - 3)(-1 + 2 - 2). 3n2 Expand (22o2 - 14748 + o5 + 14748)(0 + 6 - 4). 2o*5 + 44o*2 Expand (1 - 1 + 1)(-2 + l + 2) + (-2 - 4 + 5)(-2l - 2 + 2) + 203 + 82l - 203 + l + 5l + 4l. 95l Expand 8m3 - 8m*3 + 31m*4 + (-58 + 58 + 3m*2)(-m*2 - 3m*2 + 2m*2). 25m*4 Expand (2 - 26x + 211x - 15x)(0x - 4x + 5x + x*2). 170x*3 + 172x*2 + 2x Expand (-2i + i + 2i)(i + 2i*4 - i) + 673i*3 - 673i*3 + 26i*5. 28i*5 Expand 3j*2 - 25j*3 - 9j*2 + 23j*3 + (-4j + 2j + 6j)(4j2 - j2 - 2j2). 2j*3 - 6j*2 Expand ((-2o*2 + 5 - 5)(-2o2 + o - o) + o3 - 148o*4 + 84o*4 + 2 - 2o*3)(-3o + 2o + 0o). 60o5 + o4 - 2o Expand (0 + 0 - 1)(-43 + 43 - 156f). 156f Expand (-4a + a + 2a)(-6a - 8a - 2a)(1 - 6 + 4)(-5 + 5 + 2). -32a2 Expand (34 - 18 + 10)((0h - h + 3h)(2 - 1 - 2) + 0h - 2h + h + h - 2h - h + (1 - 1 - 1)(-3h + 2 - 2) + 3h + 2h - 4h). -26h Expand (19 + 13524q - 6q*3 - 13524q + 2q2)(-q2 - q2 + q*2). 6q*5 - 2q*4 - 19q*2 Expand (-6n + 0n + 3n)(2 - n - 2) + (-4 + 4 + 2n)(10n + n - n). 23n2 Expand (-5 + 2 + 0)(-c + c - 2c2 + (-13c*2 - 4c*2 - 6c*2)(-1 + 3 - 1) + (-4 - 2c + 4)(-3c + 7c - 2c) + 3c - 3c - 2c*2). 93c*2 Expand -2y*2 - 10y2 + y2 + (12y - 2y + 25y)(y - 4 + 4). 24y2 Expand (1 - 4 + 5)(5 - 3 + 0)(b2 - 7b*2 - 7b*2). -52b*2 Expand 0v*3 + 2v*3 - 4v*3 + (v - v - 2v*2)(-4v - 1 + 1) + 4v3 + v3 - 4v3 + (0 - v2 + 0)(-4v + 2v + 13v). -4v*3 Expand (102 - 529 - 229)(-4o + 4o - 2o)(-4o - o + 3o). -2624o2 Expand 2x - 2x2 - 2x + 2x2 + 4x - 4x + (-1 + 0 + 0)(-x*2 + 2x*2 + 0x*2) + 2x**2 +	{ "pile_set_name": "DM Mathematics" }
r? 14 What is 1255269190 to the power of 1/3, to the nearest integer? 1079 What is 49873505 to the power of 1/7, to the nearest integer? 13 What is 1595988245 to the power of 1/2, to the nearest integer? 39950 What is 203168665 to the power of 1/2, to the nearest integer? 14254 What is the third root of 3401133549 to the nearest integer? 1504 What is the fourth root of 41970586 to the nearest integer? 80 What is the ninth root of 6020688118 to the nearest integer? 12 What is the cube root of 11478652 to the nearest integer? 226 What is the square root of 2403057942 to the nearest integer? 49021 What is 29872539 to the power of 1/2, to the nearest integer? 5466 What is the cube root of 3597900638 to the nearest integer? 1532 What is the square root of 556913890 to the nearest integer? 23599 What is the square root of 368727473 to the nearest integer? 19202 What is the sixth root of 16339433 to the nearest integer? 16 What is 290844301 to the power of 1/9, to the nearest integer? 9 What is the square root of 72398617 to the nearest integer? 8509 What is the cube root of 4339045137 to the nearest integer? 1631 What is 75784837 to the power of 1/8, to the nearest integer? 10 What is 3750943974 to the power of 1/2, to the nearest integer? 61245 What is the square root of 2339746251 to the nearest integer? 48371 What is the fifth root of 1100837677 to the nearest integer? 64 What is the third root of 73522667 to the nearest integer? 419 What is the seventh root of 890273280 to the nearest integer? 19 What is the square root of 1114157888 to the nearest integer? 33379 What is 826863479 to the power of 1/2, to the nearest integer? 28755 What is 43476910 to the power of 1/10, to the nearest integer? 6 What is the tenth root of 395099121 to the nearest integer? 7 What is the cube root of 90580948 to the nearest integer? 449 What is 279610321 to the power of 1/10, to the nearest integer? 7 What is 664511859 to the power of 1/2, to the nearest integer? 25778 What is the fifth root of 434222423 to the nearest integer? 53 What is the third root of 259952440 to the nearest integer? 638 What is 1278421017 to the power of 1/3, to the nearest integer? 1085 What is the fifth root of 5574088161 to the nearest integer? 89 What is the square root of 4998358 to the nearest integer? 2236 What is the tenth root of 240998636 to the nearest integer? 7 What is the ninth root of 20547915 to the nearest integer? 6 What is the square root of 322497189 to the nearest integer? 17958 What is 184175066 to the power of 1/4, to the nearest integer? 116 What is the eighth root of 81626617 to the nearest integer? 10 What is 61031028 to the power of 1/2, to the nearest integer? 7812 What is the fourth root of 2264851002 to the nearest integer? 218 What is the eighth root of 807185 to the nearest integer? 5 What is the square root of 7308749 to the nearest integer? 2703 What is 462368201 to the power of 1/4, to the nearest integer? 147 What is the eighth root of 950507362 to the nearest integer? 13 What is the fourth root of 43770869 to the nearest integer? 81 What is the square root of 88727715 to the nearest integer? 9420 What is 54465178 to the power of 1/2, to the nearest integer? 7380 What is the cube root of 2426952236 to the nearest integer? 1344 What is 177768791 to the power of 1/5, to the nearest integer? 45 What is the eighth root of 1683074603 to the nearest integer? 14 What is 34800002 to the power of 1/2, to the nearest integer? 5899 What is 26706205 to the power of 1/4, to the nearest integer? 72 What is the sixth root of 2086333410 to the nearest integer? 36 What is 207019521 to the power of 1/2, to the nearest integer? 14388 What is the square root of 473464387 to the nearest integer? 21759 What is 37674803 to the power of 1/2, to the nearest integer? 6138 What is the square root of 239884297 to the nearest integer? 15488 What is the third root of 413377813 to the nearest integer? 745 What is 43371896 to the power of 1/2, to the nearest integer? 6586 What is the sixth root of 263604816 to the nearest integer? 25 What is 27745747 to the power of 1/3, to the nearest integer? 303 What is the cube root of 504670791 to the nearest integer? 796 What is the third root of 2544961936 to the nearest integer? 1365 What is 61591160 to the power of 1/6, to the nearest integer? 20 What is 428145260 to the power of 1/6, to the nearest integer? 27 What is the cube root of 314236782 to the nearest integer? 680 What is the sixth root of 1463292386 to the nearest integer? 34 What is the third root of 32494368 to the nearest integer? 319 What is 14916163 to the power of 1/6, to the nearest integer? 16 What is the cube root of 17001860 to the nearest integer? 257 What is 106191516 to the power of 1/3, to the nearest integer? 474 What is the square root of 174742289 to the nearest integer? 13219 What is the square root of 23183353 to the nearest integer? 4815 What is the square root of 304651223 to the nearest integer? 17454 What is the third root of 53288391 to the nearest integer? 376 What is 1541461075 to the power of 1/2, to the nearest integer? 39261 What is 18455050 to the power of 1/2, to the nearest integer? 4296 What is the cube root of 354420188 to the nearest integer? 708 What is the third root of 116286381 to the nearest integer? 488 What is 148601531 to the power of 1/10, to the nearest integer? 7 What is the cube root of 553002558 to the nearest integer? 821 What is the eighth root of 21569032 to the nearest integer? 8 What is the cube root of 21520921 to the nearest integer? 278 What is the square root of 7662924256 to the nearest integer? 87538 What is 52287603 to the power of 1/2, to the nearest integer? 7231 What is 3055372061 to the power of 1/4, to the nearest integer? 235 What is the fourth root of 302240884 to the nearest integer? 132 What is 144353681 to the power of 1/2, to the nearest integer? 12015 What is 647937437 to the power of 1/2, to the nearest integer? 25455 What is 2295982093 to the power of 1/7, to the nearest integer? 22 What is 1126476124 to the power of 1/5, to the nearest integer? 65 What is 109943903 to the power of 1/2, to the nearest integer? 10485 What is the cube root of 13028530 to the nearest integer? 235 What is 6190823479 to the power of 1/3, to the nearest integer? 1836 What is 535489666 to the power of 1/3, to the nearest integer? 812 What is the third root of 1608687654 to the nearest integer? 1172 What is the third root of 178944172 to the nearest integer? 564 What is the fifth root of 219324943 to the nearest integer? 47 What is the square root of 4659784190 to the nearest integer? 68263 What is 316866870 to the power of 1/7, to the nearest integer? 16 What is the ninth root of 6359643224 to the nearest integer? 12 What is 77519799 to the power of 1/2, to the nearest integer? 8805 What is 2637961048 to the power of 1/2, to the nearest integer? 51361 What is the third root of 113025802 to the nearest integer? 483 What is the square root of 227814506 to the nearest integer? 15094 What is the cube root of 51251786 to the nearest integer? 371 What is 185209782 to the power of 1/6, to the nearest integer? 24 What is the tenth root of 44755166 to the nearest integer? 6 What is the third root of 326014458 to the nearest integer? 688 What is 52634909 to the power of 1/6, to the nearest integer? 19 What is 67380273 to the power of 1/3, to the nearest integer? 407 What is 5316308 to the power of 1/10, to the nearest integer? 5 What is the square root of 2071076280 to the nearest integer? 45509 What is the ninth root of 169113118 to the nearest integer? 8 What is the fourth root of 72264633 to the nearest integer? 92 What is the third root of 114731794 to the nearest integer? 486 What is the third root of 31644604 to the nearest integer? 316 What is the square root of 33280456 to the nearest integer? 5769 What is the sixth root of 98100066 to the nearest integer? 21 What is 21401395 to the power of 1/2, to the nearest integer? 4626 What is the seventh root of 39625813 to the nearest integer? 12 What is 186032197 to the power of 1/6, to the nearest integer? 24 What is the sixth root of 139374913 to the nearest integer? 23 What is the square r	{ "pile_set_name": "DM Mathematics" }
m {t: 1, x: 5, c: 3, s: 1, u: 1}. What is prob of picking 1 c and 1 s? 3/55 Calculate prob of picking 1 i, 1 o, and 1 b when three letters picked without replacement from {p: 1, g: 3, c: 1, b: 2, o: 3, i: 1}. 2/55 Four letters picked without replacement from wwywyweywyywyyyey. What is prob of picking 2 y and 2 e? 9/595 Three letters picked without replacement from {p: 5, b: 3, g: 8}. Give prob of picking 3 p. 1/56 Three letters picked without replacement from ymyymyymymmyy. What is prob of picking 3 m? 5/143 Three letters picked without replacement from xttggtgtettttgxt. What is prob of picking 2 g and 1 x? 3/140 Calculate prob of picking 1 u and 1 z when two letters picked without replacement from zepepupup. 1/18 Two letters picked without replacement from qqrrqqqqqqrrqqqqqqq. Give prob of picking 1 r and 1 q. 20/57 Three letters picked without replacement from kkkkkkkeek. Give prob of picking 2 e and 1 k. 1/15 What is prob of picking 2 d when two letters picked without replacement from rrdq? 0 Calculate prob of picking 1 i and 1 y when two letters picked without replacement from iyziirz. 1/7 Two letters picked without replacement from vndvzvn. Give prob of picking 1 v and 1 n. 2/7 Calculate prob of picking 1 i, 2 q, and 1 w when four letters picked without replacement from {l: 1, i: 2, q: 8, w: 9}. 168/1615 Four letters picked without replacement from {e: 2, j: 7, u: 1, c: 4, q: 1}. Give prob of picking 1 u and 3 j. 1/39 Three letters picked without replacement from rrrrrrrrrlrr. Give prob of picking 2 r and 1 l. 1/4 Calculate prob of picking 1 l, 1 i, and 2 v when four letters picked without replacement from {v: 3, i: 6, o: 1, l: 2, e: 5}. 9/595 What is prob of picking 2 n when two letters picked without replacement from {n: 6, x: 2}? 15/28 Two letters picked without replacement from tdldpp. What is prob of picking 1 d and 1 t? 2/15 Two letters picked without replacement from {t: 1, a: 2, f: 1, j: 1}. Give prob of picking 1 f and 1 j. 1/10 What is prob of picking 2 d when two letters picked without replacement from {d: 2, v: 2}? 1/6 What is prob of picking 1 m, 1 u, and 1 o when three letters picked without replacement from {u: 1, o: 2, m: 3, t: 7, e: 4}? 3/340 Two letters picked without replacement from urqq. Give prob of picking 1 r and 1 q. 1/3 Four letters picked without replacement from jjjjpjjjjjjpjjjjjj. What is prob of picking 4 j? 91/153 What is prob of picking 2 w when two letters picked without replacement from pnpwzwbwnzwwzwwbz? 21/136 Calculate prob of picking 2 m when two letters picked without replacement from {o: 4, d: 8, y: 1, k: 1, m: 3}. 3/136 Two letters picked without replacement from {u: 3, x: 1, j: 16}. Give prob of picking 1 u and 1 x. 3/190 Three letters picked without replacement from bcccbbbbbbccbcbcbcbc. Give prob of picking 2 b and 1 c. 33/76 Two letters picked without replacement from {z: 2, o: 1, u: 2, n: 1, i: 1, w: 1}. What is prob of picking 1 z and 1 w? 1/14 Calculate prob of picking 2 z and 2 u when four letters picked without replacement from {u: 8, z: 2}. 2/15 Three letters picked without replacement from repebbbpbhe. What is prob of picking 2 b and 1 p? 4/55 Calculate prob of picking 1 y and 1 f when two letters picked without replacement from wxwymmxzyfwmxwxwww. 2/153 What is prob of picking 1 h and 3 v when four letters picked without replacement from {v: 1, h: 4, e: 5, g: 1}? 0 What is prob of picking 1 h, 1 i, and 1 f when three letters picked without replacement from {h: 13, f: 3, i: 3}? 39/323 Calculate prob of picking 1 k, 1 v, and 1 m when three letters picked without replacement from kkvekvdkdmgd. 2/55 Four letters picked without replacement from ohsooknonohhhooho. What is prob of picking 1 s, 1 k, 1 o, and 1 n? 4/595 What is prob of picking 2 r when two letters picked without replacement from {r: 2, h: 5}? 1/21 Calculate prob of picking 2 f when two letters picked without replacement from ooffofooooooooofooo. 2/57 Three letters picked without replacement from {l: 12, h: 1}. Give prob of picking 2 l and 1 h. 3/13 Calculate prob of picking 3 t and 1 s when four letters picked without replacement from {t: 8, s: 5}. 56/143 What is prob of picking 1 e and 1 y when two letters picked without replacement from yzkeooaa? 1/28 Four letters picked without replacement from {w: 10, x: 2, u: 1, b: 1}. What is prob of picking 1 u, 2 x, and 1 b? 1/1001 Calculate prob of picking 3 x and 1 i when four letters picked without replacement from {x: 2, i: 4, n: 3}. 0 What is prob of picking 1 r, 2 a, and 1 l when four letters picked without replacement from {r: 1, y: 1, l: 9, a: 4}? 18/455 Two letters picked without replacement from {y: 1, q: 1, i: 1}. What is prob of picking 1 i and 1 y? 1/3 What is prob of picking 1 n and 1 w when two letters picked without replacement from fnffzbznbwwf? 2/33 Two letters picked without replacement from {f: 2, i: 7}. What is prob of picking 2 i? 7/12 Two letters picked without replacement from {o: 1, t: 1, b: 1, a: 1, i: 1}. What is prob of picking 1 b and 1 a? 1/10 Three letters picked without replacement from {f: 2, e: 4}. Give prob of picking 2 f and 1 e. 1/5 Four letters picked without replacement from {t: 2, z: 4, h: 2, a: 3, d: 6, f: 1}. Give prob of picking 2 a, 1 z, and 1 d. 2/85 Calculate prob of picking 1 l and 3 s when four letters picked without replacement from {l: 2, u: 6, s: 7, h: 1, p: 3}. 35/1938 What is prob of picking 1 y and 2 u when three letters picked without replacement from yykuyykokyjkkjoukkk? 5/969 What is prob of picking 1 y and 2 c when three letters picked without replacement from {q: 2, y: 3, d: 4, s: 3, n: 1, c: 3}? 9/560 Calculate prob of picking 2 n and 1 h when three letters picked without replacement from {h: 2, s: 1, v: 1, n: 4}. 3/14 Four letters picked without replacement from {y: 10}. What is prob of picking 4 y? 1 Three letters picked without replacement from {d: 1, p: 3, y: 1, s: 2, v: 4, j: 4}. What is prob of picking 1 d and 2 s? 1/455 Three letters picked without replacement from ymmummtttui. Give prob of picking 1 m, 1 i, and 1 t. 4/55 Four letters picked without replacement from ffffff. Give prob of picking 4 f. 1 What is prob of picking 2 j and 1 g when three letters picked without replacement from {y: 5, g: 2, q: 4, j: 2}? 1/143 Three letters picked without replacement from ggqqgggqqq. What is prob of picking 3 q? 1/12 Two letters picked without replacement from {w: 17, c: 1}. Give prob of picking 1 c and 1 w. 1/9 Four letters picked without replacement from {h: 3, p: 7, o: 2, q: 4, y: 1}. What is prob of picking 1 y, 1 q, and 2 p? 3/85 What is prob of picking 3 t when three letters picked without replacement from {t: 4, g: 3}? 4/35 Two letters picked without replacement from hvhchvhidhhvhvh. Give prob of picking 2 v. 2/35 Two letters picked without replacement from zzpsspszssszzpp. Give prob of picking 2 p. 2/35 What is prob of picking 2 t when two letters picked without replacement from tctctcttctctt? 14/39 Four letters picked without replacement from {c: 3, m: 12, u: 2}. What is prob of picking 3 m and 1 c? 33/119 Two letters picked without replacement from {k: 1, g: 5, x: 12}. Give prob of picking 1 k and 1 x. 4/51 Four letters picked without replacement from nifttfiiitninit. Give prob of picking 1 n, 2 i, and 1 f. 6/91 Three letters picked without replacement from hvakusa. Give prob of picking 1 s, 1 v, and 1 a. 2/35 What is prob of picking 1 q, 1 e, and 1 r when three letters picked without replacement from {q: 13, e: 1, r: 3}? 39/680 Two letters picked without replacement from rwrrrwrrr. What is prob of picking 2 r? 7/12 What is prob of picking 3 x when three letters picked without replacement from xxxjjxx? 2/7 Four letters picked without replacement from hxxpppyyppypxhrxy. Give prob of picking 2 x, 1 h, and 1 p. 18/595 Two letters picked without replacement from vvvvvffvvvvvv. Give prob of picking 2 f. 1/78 Three letters picked without replacement from {m: 1, a: 3, p: 3}. What is prob of picking 3 a? 1/35 What is prob of picking 3 u when three letters picked without replacement from {z: 4, d: 4, u: 3}? 1/165 What is prob of picking 1 o and 2 r when three letters picked without replacement from ororrr? 3/5 What is prob o	{ "pile_set_name": "DM Mathematics" }
- 5x - 202, -4x + 93 = 5d - 139. Calculate the greatest common factor of d and q. 24 Suppose 0 = -3i - 2i. Suppose -4x + 174 + 78 = i. Calculate the highest common factor of 9 and x. 9 Let b = -6 - 140. Let s = 290 + b. Let o be (s/(-90))/((-1)/5). What is the highest common factor of 2 and o? 2 Let g(t) = 4t + 2. Let a be g(-3). Let f be (-8)/10 - 218/a. Suppose 3u - 4i - 226 - 14 = 0, -177 = -2u - 3i. What is the highest common factor of f and u? 21 Suppose -14k = w - 15k - 8, 4w - 3k = 28. Calculate the greatest common factor of 34 and w. 2 Suppose 10 + 26 = 4f. Let p = 419 + -320. Calculate the highest common divisor of f and p. 9 Let j be 9 + (1 + 3)/(-1). Suppose 0 = 2g + j - 117. What is the greatest common factor of g and 21? 7 Let m be (-2)/(-4)6 - (-681)/3. Calculate the highest common divisor of 20 and m. 10 Let c be (-4)/6(5 - 3)-3. Let o be 4/8 + 142/c. Calculate the highest common divisor of 48 and o. 12 Let r = 2 + 31. Let v(l) = -l*3 + 3l*2 + 3l. Let d be v(3). Suppose -d - 2 = -z. What is the greatest common divisor of r and z? 11 Let l be 9/(-15) + (-6)/(-10). Suppose la = -5a + 40. Suppose -2k - 2b - b = 1, k + 4b + 3 = 0. What is the highest common divisor of a and k? 1 Let o(n) = -n2 - 11n - 20. Let c be o(-8). Let d be 1/c - ((-127)/4 - 0). What is the greatest common divisor of 48 and d? 16 Let s(p) = 10p2 - 34p - 163. Let u be s(-8). Calculate the highest common divisor of 7 and u. 7 Suppose -22l + 561 = 11l. Calculate the highest common factor of l and 51. 17 Let j(y) = -y + 25 - 3 - 3y + 5y. Suppose -2x = -3r - x - 38, 2r = 3x - 16. Let b be j(r). What is the greatest common divisor of 2 and b? 2 Suppose -490 = -2v - d, 36 = -d + 38. Calculate the highest common factor of 183 and v. 61 Let s = -1 - 1. Let q be 1/s + (-174)/(-12). Suppose -2i + 4r = -20, -i + 22 = 4i - 3r. Calculate the greatest common divisor of i and q. 2 Suppose 5o - 5k = -20, 0 = o + 2k - 6 - 2. Let s be (1-33)/(-3) - o. What is the greatest common factor of 22 and s? 11 Let p be 8 + -4 - (-40)/5. Suppose 4y - p = 0, -5w + 4y - y + 36 = 0. Calculate the highest common divisor of w and 81. 9 Let b(h) = -2h3 + h2 - 7h + 14. Let y be b(0). What is the greatest common factor of 5 and y? 1 Suppose 7i + 6 = 8i. Suppose 0 = 8m - 15 - 1. Calculate the greatest common factor of m and i. 2 Suppose -296 + 8 = -2c. What is the highest common divisor of 216 and c? 72 Let a be 6/(-10) + 63/5. Let h(k) = 6k + 6. Let o = -15 + 17. Let y be h(o). What is the highest common divisor of a and y? 6 Suppose 0 = 5s + 44 - 29. Let q be s + 1 - 10/(-1). Suppose -5n + h = 2h - 99, -2h - 42 = -2n. Calculate the greatest common factor of q and n. 4 Let l(s) be the first derivative of 1/2s2 - 2 + 3s. Let h be l(4). Calculate the highest common divisor of 21 and h. 7 Suppose -16 = -2h + 2w, -3h = -5w - 16 + 2. Let n(u) = -u*2 + 28u - 6. Let l be n(h). Calculate the highest common factor of 27 and l. 27 Suppose -31 = -5p - 1. Let z(y) = p - 2y - 14 + 9. Let m be z(0). Calculate the greatest common factor of 8 and m. 1 Let l(h) = -2h2 + 19h + 31. Let d be l(10). Suppose -5 = -2q + d. Calculate the greatest common divisor of q and 13. 13 Suppose -206 - 214 = -5j. Suppose -14b - j = -17b. What is the greatest common factor of 70 and b? 14 Suppose 3q + u - 63 = -2q, 2u = 3q - 30. Suppose 3m + 2w - q = -2w, 3m - 18 = -2w. Calculate the greatest common divisor of 16 and m. 8 Let k be 01(-4)/8. Suppose k = 6j - j - 45. Suppose 3a - 72 = -j. What is the greatest common factor of a and 231? 21 Let v be 4/22 - (-9 - (-19881)/(-99)). Suppose -20 = 3k - 110. What is the highest common divisor of k and v? 30 Let r(f) = -4 + 1 - 2 + f. Let j be r(8). What is the greatest common divisor of j and 33? 3 Suppose 0 = 4n - 15n + 264. Calculate the greatest common factor of n and 66. 6 Suppose 8i - i = 0. Suppose 18c - 21c + 39 = i. What is the greatest common factor of c and 117? 13 Let v be 7 + -7 - (-3)/1. Suppose -4b - v = -7b. Let t be b/(-2)(-90 + -2). Calculate the highest common factor of 115 and t. 23 Let y = 9 + -6. Suppose -5j = yi + 15, 5i = -6j + 3j - 9. Let h be -1 - (1 + i)-85. Calculate the greatest common divisor of 21 and h. 21 Let z = -208 + 216. What is the greatest common divisor of z and 4? 4 Suppose -2q - 5 = o, q + 3o - 3 + 18 = 0. Let b = 8 - q. Suppose 12w - 180 = bw. What is the greatest common factor of 5 and w? 5 Suppose -z - 268 = -295. Let d be (1 - -44)4/10. Calculate the greatest common factor of d and z. 9 Suppose -40y - 930 = -70y. Suppose f - 58 = -3i + 30, 3i - 2f = 103. What is the highest common divisor of y and i? 31 Suppose -5k + i + 429 = 0, -26k = -29k - 2i + 247. Let q(b) = 5b + 2. Let w be q(3). Calculate the highest common factor of w and k. 17 Suppose 0 = 12y - 6087 + 807. What is the greatest common divisor of 40 and y? 40 Suppose -6f + 30 = -3f. Suppose 8u = 6u - 230. Let c be 2/12 - u/30. What is the greatest common factor of f and c? 2 Suppose -s - 4s + 10 = 0. Let v(r) = -7 + 7 + 0 + 15r*s. Let o be v(-1). What is the highest common factor of o and 75? 15 Suppose 5s = 4s + 2. Let t be 1/((2/5)/s). Let q be (1/(-1))/(1/(-5)). Calculate the greatest common divisor of q and t. 5 Let p(j) = j2 - 21j + 0j2 + 7 + 5j*2 - 4j2. Let s be p(11). What is the greatest common divisor of s and 6? 6 Let g(q) = q3 + 3q2 - 5q. Let f be g(-4). Let j(h) = fh + 5 + 2 - 17. Let u be j(5). What is the highest common factor of u and 40? 10 Let s be 11/44 + 1/(-4) - -18. Calculate the greatest common divisor of s and 3636. 18 Let j be (2 - (-30)/(-12))/(2/(-24)). What is the greatest common factor of j and 24? 6 Let g(b) = -b3 + 9b*2 + 10b + 10. Let x = -9 - -19. Let c be g(x). Let t = 9 - 7. Calculate the highest common factor of t and c. 2 Let q be 1 - (-11)/(55/90). Let n be 36/270 - 6266/(-30). What is the greatest common divisor of q and n? 19 Let p = -11 - -19. Let k be ((-6)/p)/(4/(-192)). Calculate the greatest common factor of k and 12. 12 Suppose 2v + 2g + 26 = 8, -4 = -g. Let d be (2/(-3))/(4/(-144)). Let w = d + v. What is the highest common divisor of w and 11? 11 Suppose -4a - k + 21 = -41, 47 = 3a + k. Suppose 2x = -76 + 286. Calculate the highest common factor of a and x. 15 Suppose 0 = -5i - 0i, -4t = -2i - 284. Suppose -2j + t = -91. What is the highest common divisor of j and 9? 9 Let j be ((-6)/(-8))/(6/40). Suppose 0x + 2x + 4l = 92, 4x = -jl + 181. What is the highest common factor of x and 110? 22 Let i = -152 + 161. Suppose x = -ix + 2080. Calculate the greatest common factor of 16 and x. 16 Suppose -d - 3w - 4 = 0, 2d + 6w - 3w = -2. Suppose l + y - 4 = 0, 5l + 2y + d = 34. Calculate the greatest common factor of l and 24. 8 Let v be (-41)/(-4) + (-6)/(-8). Let r be (7 + -6)(15 + 0). Suppose 2m - r = 29. What is the highest common divisor of m and v? 11 Suppose -s = 33 - 83. Let c be (-5 - -5)2/4 - -20. Calculate the highest common factor of s and c. 10 Suppose 0 = -6a - 3a + 45. Let l(p) = p - 1. Let b be l(a). Calculate the greatest common divisor of b and 12. 4 Let l be 2((-12)/8 + 3). Suppose -c - 4 = -2f, -lf + 4f - 3 = 0. Calculate the greatest common divisor of c and 1. 1 Suppose -643l = -656l + 4563. What is the highest common factor of l and 39? 39 Let v = -5 + 15. Suppose -234 = -5i + 316. What is the highest common factor of v and i? 10 Suppose 0 = -3t - 4m + 184, 5t + m - 225 - 59 = 0. Let h = -15 + 16. Suppose y + h - 9 = 0. Calculate the highest common divisor of t and y. 8 Let x = 44 + -65. Let y = x - -31. What is the highest common divisor of 2 and y? 2 Let h = 4 + -4. Let q = h - -8. Suppose 0 = 6t - qt + 36. What is the greatest common factor of 6 and t? 6 Suppose 0 = -z - 3 - 51. Let c be z - 1 - (-15 - -12). Let g = -36 - c. What is the greatest common divisor of 4 and g? 4 Let l be 10/(-2)1058/(-230). Calculate the greatest common divisor of l and 1403. 23 Let o(v) = 2v2 - 47v + 108. Let x be o(21). Calculate the greatest common divisor of 8 and x. 1 Let z be (-7 - -16) + -31. Suppose 0 = zr - 0*r - 54. What is	{ "pile_set_name": "DM Mathematics" }
x*2 - 3x. What is the tens digit of g(2)? 0 Let f be ((-1)/2)/((-2)/24). Suppose -ft = -t - 15. Suppose 3i = -tp - 0p, 3p = 4i - 7. What is the units digit of i? 1 Suppose -y + 3q = -0q - 14, 2 = 5y + 2q. What is the units digit of y? 2 Suppose 6 = -2y - y. What is the units digit of 2/(y/(-1))13? 3 Let v be -241/((-4)/(-2)). Let x(j) = -j3 - 18j*2 - j - 26. Let f be x(-18). Let a = f - v. What is the units digit of a? 4 Let a be 2 + -1 - (-4 + -1). Suppose -4q + a + 2 = 0. Suppose -qx = 2l, 2l + 2 = 4x + 4l. What is the units digit of x? 1 Let n(d) = 13d - 7. Let i(h) = -25h + 13. Suppose -2q - 2w + w + 18 = 0, 5w - 13 = -3q. Let c(s) = qn(s) + 6i(s). What is the units digit of c(-1)? 8 Let r = 61 - 38. What is the units digit of r? 3 Let q be 4/14 + (-36)/(-21). Let g(k) = 1 + 3k - k - 4k2 + 3k*3 - 2 - qk*3. What is the units digit of g(4)? 7 Let a(q) = -2q*3 + 11q + 23 - 11q + q3. Let p be a(0). Let v = 32 - p. What is the units digit of v? 9 Suppose 68 = -5p + 293. What is the units digit of p? 5 Suppose -2o - o = 6. Let b = 11 - 0. Let h = b + o. What is the units digit of h? 9 Suppose v - 28 - 3 = 0. What is the units digit of v? 1 Let z = -3 - -3. Suppose z = -0v - 2v + 4. Suppose v = l + 1. What is the units digit of l? 1 Suppose 101 = 5c - 489. What is the units digit of c? 8 Let q = 3 - -2. Suppose 4z = qz - 6. Let m(y) = -y*2 + 6y + 8. What is the units digit of m(z)? 8 Suppose 3w - 9 = -3. Suppose 2l - 4 = w. What is the units digit of l? 3 Let n(f) = f - 1. Let w be n(2). Suppose w - 66 = -5p. Let a = p - 1. What is the units digit of a? 2 Let x be (-4)/6 + 136/6. Suppose 31 = -u + 3d + d, 5d + x = -u. Let s = 50 + u. What is the units digit of s? 3 Let x = 14 + -24. Suppose 3f = 2i - 38, 5i - 67 - 7 = -3f. Let a = i + x. What is the units digit of a? 6 Suppose 2m + 13 = -7. Let u = 22 + m. What is the tens digit of u? 1 Let j(u) = 5u2 - u - 1. Let z be j(-2). Suppose 2g = z - 5. What is the units digit of g? 8 Let x(k) = 16k2 - 50k - 30. Let t(o) = 3o2 - 10o - 6. Let b(u) = -11t(u) + 2x(u). Let p be b(10). What is the units digit of 1/(-3) + 104/p? 7 Let j(y) = y + 4. Suppose 4q = 3a - 19, 2q - 4 + 16 = 2a. Suppose -15 + 0 = -ao. What is the units digit of j(o)? 7 Let f(d) = d - 4. Let i be f(-4). What is the units digit of (-3 - 1)6/i? 3 Let m(h) = 35h2 + 2h + 1. What is the tens digit of m(-1)? 3 Let m(v) be the first derivative of -v*2/2 + v - 1. Let u be m(-2). Suppose 4a = -2r + 14, -ua - r + 11 = -0a. What is the units digit of a? 4 Suppose 3m = 5k + 259 - 1179, 4m = -3k + 552. What is the units digit of k? 4 Let n = 19 + -14. Suppose -nv = -5 - 45. What is the tens digit of v? 1 Suppose 0h + 3x + 9 = 4h, 5h = -3x + 18. Let y = h + -1. What is the units digit of (-9)/6 - (-19)/y? 8 Let k(f) = -f3 + 10f*2 - 10f - 9. What is the units digit of k(8)? 9 Let u(z) = -z + 3. Suppose 3p + 0p - 4x - 15 = 0, 8 = 5p - x. Let d(h) = 1. Let r(q) = pu(q) - 2d(q). What is the units digit of r(-3)? 4 Let m(r) = r*2 + 4r - 53. What is the units digit of m(-20)? 7 Suppose 5 - 2 = -b. What is the units digit of b/6 + 93/6? 5 Suppose 0x - 3x + 33 = 0. What is the tens digit of x? 1 Suppose 4 + 7 = -2x + 5z, -7 = -2x - z. Suppose -5u = -b - 19, -4b - xu = 2u + 4. Let a = 0 - b. What is the units digit of a? 4 Let m(t) = 10t*3 - t. Suppose -3p - 2 = -5. Let i be m(p). What is the units digit of 22/6 - (-3)/i? 4 Let y be (4 + -2 - -5)8. What is the units digit of y/23/2? 2 Let u = 74 + -48. What is the units digit of u? 6 Let i be (-2)/(-7) - 10/(-14). Let j be i/((-2)/3 - -1). Suppose -j - 25 = -4q. What is the units digit of q? 7 Let t = -50 - -65. What is the tens digit of t? 1 Suppose 5r + 2f + 17 = 0, 0f + 5 = -2r + f. Let h = 6 + r. What is the units digit of h? 3 Suppose -3f = -7f - 76. Let z = 30 + f. What is the tens digit of z? 1 Let s(r) = 2r*2 - 2r + 0r + 6r + 1. Let j be s(-4). Suppose 3 = -k + 2h + 6, 2h + j = 3k. What is the units digit of k? 7 Suppose 0 = p + 3p - 140. What is the units digit of p? 5 Suppose -l + 19 + 2 = 0. What is the tens digit of -9(l/(-9) - -1)? 1 Suppose 4u = 93 + 31. What is the tens digit of u? 3 Let x(g) = g*2 + 5g + 1. Let v(d) = d - 5. Let m be v(7). Suppose -mc + 20 = -6c. What is the units digit of x(c)? 1 Let o(j) = 3 + 7 - 3 + 2j. What is the units digit of o(12)? 1 Suppose -15 = -t + 5s, 0 = 5t - 3s + 2s - 27. Suppose f + f = y - 5, -23 = y + tf. What is the units digit of (0 + (-5)/3)y? 5 Let g = 7 + 7. Let x = g - -9. What is the tens digit of x? 2 Let p(c) = 8c - 1. Let m be p(-2). Let s(i) = i. Let y be s(-1). Let o = y - m. What is the units digit of o? 6 Suppose -n + 15 - 1 = 0. Suppose 0 = 5s + n + 11. What is the units digit of (7 - 2)(-5)/s? 5 Let j(g) = g*3 + 4g*2 + g + 1. Let n be j(-3). Let w = n + -3. What is the units digit of w? 4 Let n be 1/((-16)/(-5) + -3). Suppose -nz = -2r + 48, 2r - 6 = -3z + 26. What is the tens digit of r? 1 Suppose g - 34 = -8. What is the tens digit of g? 2 Suppose -2h - 2 = -4. Let y = 5 - h. What is the units digit of y? 4 Let n(f) = -2f2 - f2 + 1 + 2 - 11f + 4f2. What is the units digit of n(11)? 3 Let u(y) = -9y + 19. What is the units digit of u(-15)? 4 Let y(c) = -c*3 - 3c*2 + 2c. Let r be y(-3). Let i = r - -9. Suppose ia - a - 12 = 0. What is the units digit of a? 6 Suppose c - 4 = -2k + 5, -3k - 5c + 17 = 0. Suppose -2 = l + k. What is the units digit of (-4)/6l/4? 1 Let v(a) = a. Suppose -4t = -3q + 37, 3t + 9 = 4q - 3q. Suppose -4s + q = s. What is the units digit of v(s)? 3 Let y(k) = 12k*2 - 3k - 2. Let o be y(2). Let b = o - 23. What is the units digit of b? 7 Let f = 85 - 59. Suppose -5t + 81 - f = 5h, -4h + 54 = 2t. What is the tens digit of h? 1 Suppose -4r - 4k = -336, k - 80 = -r - k. What is the units digit of r? 8 Let y(j) = 2j - 7. Let x be y(8). Suppose 2z - 25 = x. What is the units digit of z? 7 Let n(c) = c*2 + 3c. Let w be n(-4). Suppose 0 = 3o + wg - 31, 5o + 3g - 37 = -0g. What is the units digit of o? 5 Let f = -5 - -3. Let t be 20/(-6) - f/6. Let n(m) = m3 + 4m*2 + 2m - 1. What is the units digit of n(t)? 2 Let u = 16 - 35. Let s = 33 + u. What is the tens digit of s? 1 Let s(f) = 41f - 2. What is the units digit of s(4)? 2 Suppose -596 = -46u + 42u. What is the units digit of u? 9 Let d(u) = 20u*2 - 8u - 8u2 - 13u*2. What is the tens digit of d(-6)? 1 Let k = -206 - -310. What is the units digit of 2/7 + k/28? 4 Let o(q) = -q + 10. Let t be o(7). Suppose l = 5r + 27, -tl + 27 = -l - r. What is the tens digit of l? 1 Suppose 3k + 12 = 7k. Suppose 0 = kb - 30. What is the tens digit of b + (-1 - 1-2)? 1 Let s = 0 - -6. Suppose 3f - s = -0. What is the units digit of (f - 4)9/(-2)? 9 Let f be 14(13/(-2) + -3). Let i = f + 189. What is the units digit of i? 6 Let x(d) = 71d3 + 2d*2 - 3d + 1. Let i be x(1). Let f = 123 - i. What is the tens digit of f? 5 Suppose 4c + 768 = 4o, 3o - 159 = -4c + 424. What is the hundreds digit of o? 1 Suppose 3c = -2w + 2c + 8, -4c = 8. Let g(p) = 2 + 11p - 3 - wp - p*2. What is the units digit of g(4)? 7 Let h = -5 - -9. Suppose 3o = 5o - h. What is the units digit of o? 2 Let o(q) = -q3 - 12q2 - q - 7. Let f be o(-12). Let c = f + 2. What is the units digit of c? 7 What is the tens digit of (-2475)/(-27) - (-1)/3? 9 Let k(i) = -i3 - 3i2 + 4i - 4. Let a be k(-4). Suppose -5h = -38 - 22. Let t = h + a. What is the units digit of t? 8 Suppose 2q - 18 = 2h, 4h = -4q + 11 + 9. Suppose 10d - 39 = qd. What is the tens digit of d? 1 Let p(j) = -2j. Let l be p(-2). Let d(a) = -a*2 + 3a + 5. Let w be d(l). Suppose i + w = 2. What is the units digit of i? 1 What is the units digit of (-18)/(-5) + 12/(-20)? 3 Let x(a) = -a*3 + 9a*2 + 3. Let n be x(9). Suppose y + 3 = ni - 7, -5i = 3y - 12. What is the units digit of i? 3 Let d = 1 - 1. Suppose di - 2i = 2h - 6, -9 = 2h - 3i. Suppose 5a - 33 - 22 = h. What is the units digit of a? 1 Let d be 78/2 - (3 - 1). Suppose 5j + d = m, 2j + 35 = m - j. What is the units digi	{ "pile_set_name": "DM Mathematics" }
olve -i - ni - 6 = 0 for i. -2 Let f be (-4)/(-26) + (-304)/(-52). Suppose 4u + f = x + 58, -2u + 32 = x. Solve -1 = -3r + u for r. 5 Let z(v) = v + 3. Let k be z(-3). Solve -u + 0 - 3 = k for u. -3 Let z be (-4 - -2 - -2) + 3. Solve zs + 14 = 2 for s. -4 Suppose 4d = 8, 2i + 2d - 12 = 10. Suppose 3g + p = i, -g + 3g - 2p - 14 = 0. Solve -g = -4t + 4 for t. 2 Suppose 4i - 2k - 30 = 0, 3i - 3k - 19 - 2 = 0. Suppose -2m - 14 = -2l, -3l - 5m = l + i. Solve 5z - l = 2 for z. 1 Let l be ((-282)/9)/((-2)/3). Let d = l + -31. Solve j = -3j + d for j. 4 Let p be (-4)/(-26) + (-3)/(117/6). Solve p = -d + 4d for d. 0 Let k(n) = -n - 4. Let v be k(6). Let a = 2 + 8. Let l be (-4)/v + 16/a. Solve lj + 16 = 6j for j. 4 Let s = -14 - -25. Suppose -sx = -6x. Solve -6 = -xu - 3u for u. 2 Let x = 3 + -1. Suppose -xq + 15 = q. Solve q = w + 1 for w. 4 Suppose 4u = i + u - 10, 4i + 3u = 10. Solve 2z + i = -4 for z. -4 Suppose 5k + 4 = -3d, -4k = 3d - d + 2. Solve 0 = i + k for i. -1 Let i = 17 + -31. Let q = 17 + i. Solve 4z - q = 9 for z. 3 Let c(q) = q3 - 3q*2 - 6q + 11. Let g be c(4). Solve -w = -g - 0 for w. 3 Let x be (225/(-30))/((-2)/4). Solve 0 = d - 6d - x for d. -3 Suppose 9 + 33 = 3h. Let j = 20 - h. Solve -jv - 12 = -2v for v. -3 Suppose -k + 5k = 0. Solve 0 = 4r - kr - 20 for r. 5 Suppose -4 = 4n - 16. Let q be 1 + -3 + (-6)/(-1). Suppose qr = 6 + 6. Solve ny + 6 = -r for y. -3 Suppose -7b + 3b = -0b. Solve 0z - 4z = b for z. 0 Let d = 15 + -10. Suppose x - dx = -8. Suppose 2h = 2o - 14, 4h + h = -xo. Solve -25 = ot - 5 for t. -4 Suppose -3l + 2p = -6l + 20, 2l - 3p + 4 = 0. Solve -n = n + l for n. -2 Suppose l + 3j = -0l + 15, l = 5j - 25. Solve ls + 15 = 3s for s. 5 Let f = -5 - -8. Suppose -fi = 3l - 15, 5i + l - 25 = 2l. Solve -w = -iw for w. 0 Suppose -12 = -0w + 2w. Let n be ((-18)/w)/(3/2). Solve 0 = ni - 12 + 2 for i. 5 Suppose 0 = 5c + 15, -3o - 5c + 2c = 9. Let h be 38/14 - (-2)/7. Solve -hs + 6s - 12 = o for s. 4 Let x = 3 + -2. Suppose 3p - 14 = -5w, p + 2w = 4 + x. Let k be -11 - (-6 + 1). Solve kq - pq + 5 = 0 for q. -5 Suppose 4u - 6u = -50. Suppose 4n = -4g, 3g + u = -2g. Let q(m) = m2 - 2m - 5. Let o be q(n). Solve 3a = a + o for a. 5 Let f = 33 - 24. Solve f = -2d + 1 for d. -4 Suppose -7 = 7y - 70. Suppose 2l - yl + 28 = 0. Solve lu + 4 = -8 for u. -3 Suppose -3m - 5 = -4m. Suppose -mi = -0i. Solve 2g = -i - 4 for g. -2 Let t(c) = -c + 5. Let s be t(0). Let f be (2 - 1)(s + -3). Solve 1 + 7 = -fj for j. -4 Let y = -35 - -41. Solve -y = -3j + 9 for j. 5 Suppose -4r = -b, 2b = -r - 6 - 3. Let t be 6/(-6)(0 + b). Solve 4f + 20 = t for f. -4 Let n = 7 - 5. Suppose -1 = k - n. Let x be 1(k + -2)/(-1). Solve 0 = 2c + x - 7 for c. 3 Let n be -7 + 3 + 7 + -3. Solve 0 = z - nz - 1 for z. 1 Let i(o) = o3 - 6o*2 + 6o. Let b be i(5). Solve -bw = -w + 16 for w. -4 Let a = -29 + 17. Let q be 1/6 - 34/a. Solve qx = 2 + 10 for x. 4 Let r = 1 - -2. Suppose v = rj - 2, 0j - 4j = -4v + 8. Suppose -1 = js - 3. Solve -6 = q - s for q. -5 Let v be 0 + -2 - (-4 - 2). Suppose -s - 16 = -2s. Suppose -2h - 5k + k + 8 = 0, 0 = 2h - 4k - s. Solve -6 - h = -vq for q. 3 Let x = -1 - -5. Suppose -4q + q = -xn - 20, 4q + 5n - 37 = 0. Let k = -68 + 68. Solve 3r - qr - 10 = k for r. -2 Let i be 48/9 + 3/(-9). Solve -3x = -ix for x. 0 Suppose -4c = 2h - 0h - 14, 3 = 3h - 3c. Solve 2j + hj - 20 = 0 for j. 4 Suppose -u + 1 - 2 = -2r, u - 1 = r. Let p = -1 + u. Let f be (p - 1)/(2/10). Solve fa = a for a. 0 Let t(n) = -2n - 11. Let l be t(-8). Let q be (-432)/(-10) - 1/l. Suppose -3y - 6 = j - q, 2j + 10 = 0. Solve 0 = 5f - y + 4 for f. 2 Suppose 2d + 2d = 24. Suppose 0 = 5n - 9 - d. Let s = -22 + 34. Solve 3 = na + s for a. -3 Suppose 8d - 16 = 16. Solve dl - 15 = l for l. 5 Suppose 0t + 37 = -5j - 4t, 0 = -5j + t - 47. Let c(h) be the third derivative of h*4/24 + 11h3/6 + h2. Let x be c(j). Solve o = -xo for o. 0 Suppose -5q = -q. Let t(i) = -i*3 + 4i*2 - i - 2. Let x be t(3). Suppose xv = 3c + 14, c + 2 = -v + 9. Solve -b + q - c = 0 for b. -2 Let l = -3 - -8. Suppose -2 = 4j - lk, -k = -3j - 3k + 10. Solve z = -j + 3 for z. 1 Let q = 24 - 4. Suppose 4c + q = 2r + c, 2r + 3c = -4. Solve b + b - r = 0 for b. 2 Let x be (-2)/10 - 16/(-5). Let q be 10/x - (-4)/6. Suppose -2f - 5l = 10, -3l + l - q = -5f. Solve 2 = -b - f for b. -2 Let c(l) = -l2 - 5l + 1. Let x be c(-4). Let i be (2 - (x - 0)) + 5. Solve 4q - iq = 6 for q. 3 Let n be 5 - (-2 + -2 + 8). Solve -c + 0 - n = 0 for c. -1 Let p(f) = f*3 - 5f*2 + 4f - 2. Let r be p(3). Let o = r - -8. Solve -4a + 17 - 1 = o for a. 4 Let c(j) = j2 - j + 2. Let g be c(0). Suppose 3r + 2r = 25. Solve gi + 5 = -r for i. -5 Let i be ((-3)/4)/(1/(-4)). Solve -it + 8 = -t for t. 4 Suppose 4t + 4m - 1 = 3, 5t - 25 = 5m. Let f be 8/t - 12/18. Solve -2d + 8 = -f for d. 5 Suppose 2z + 3z = 20. Suppose 5s - z = -4n, -4s + 5n = s + 5. Solve 2i + 1 + 1 = s for i. -1 Suppose 5p - 15 = c - 4c, 12 = 4p - 2c. Suppose 5y + 2 = 4k, -y + pk - 7 + 0 = 0. Solve -yr + 4 = -4 for r. 4 Let d(r) = r3 - 5r*2 + 2r - 8. Let k be d(5). Solve -kv + 12 = 2 for v. 5 Let q be 12/30 + (0 - 4/10). Solve 3i = -q + 12 for i. 4 Let m = -4 - -6. Let p(h) = -h*3 + 3h*2 + 1. Let v be p(3). Solve -mq = -1 - v for q. 1 Suppose 5 = 3t - u, -u + 15 = 2t + 5. Solve -6 = 3p + t for p. -3 Suppose 0 = -4q - 38 + 102. Solve 4p - 4 = q for p. 5 Let g = 27 - 25. Solve -1 - g = -3v for v. 1 Let f be (-4)/12(-101 + -1). Suppose -q = -2, 3p + 9 - f = -2q. Suppose 3x = p + 5. Solve -xn = n for n. 0 Suppose -5p - 1 = 2u, 4u - 7 = -0p - p. Let b be (-1)/3 - 125/(-15). Suppose b = 5i - 3k, 2i - 3k + 8 = i. Solve 0 = ir - u - 2 for r. 1 Suppose 5q = -2i - 2i + 18, 0 = 4q + 3i - 14. Let r be (-2)/8 + 218/8. Solve 5s + r = q for s. -5 Suppose -28 = -4l + 4s, 2s + 3 = 4l + 3s. Suppose -w = -lb - b + 12, -b + 11 = 2w. Solve -wg + 4g + 4 = 0 for g. -4 Suppose 0 = -3j - 3v - 9, -3j - 3v = -v + 5. Let h = 14 + -10. Let q(g) = g3 - 5g*2 + 7g - 5. Let p be q(h). Solve 2k = j + p for k. 4 Suppose 3x - 6 = 3. Let p be (1 - 0)2/(-2). Let t = 2 + p. Solve -xo = -11 - t for o. 4 Let a be -3 + 4 + -3 - -5. Let d = -1 + a. Solve -dz + 4 = 2 for z. 1 Let q be 4(3 + 21/(-6)). Let y be (q/(-6))/(5/90). Solve 3s - 3 = y for s. 3 Let q(s) = -s2 + 10s - 8. Let r(h) = 9h. Let a be r(1). Let l be q(a). Solve -2y + 3 - l = 0 for y. 1 Let l be 6/(-9) - 14/(-3). Suppose -lp = -9p + 15. Solve 4z = pz for z. 0 Let j be 25/(-10)16/(-20). Solve jv + 0 = -8 for v. -4 Suppose 2z = 13z - 44. Solve -1 = -x - z for x. -3 Suppose 0 = 2l - 4v - 5 + 1, -4v = -3l + 6. Suppose -3f = -lf + 5. Let h be f/5-51. Solve -4d + h = -3 for d. 2 Suppose 0 = 2j + 5n - 70, 0n + 2n = 0. Let h be (2 + -1)/(7/j). Solve 0 = -hf + 3f - 8 for f. -4 Suppose -h = -3 - 0. Solve 1 = n + h for n. -2 Suppose 2s = 6s - 48. Let u = -10 + s. Solve -2 = uz - 10 for z. 4 Let j be -3((0 - 2) + 1). Solve js + 12 = -s for s. -3 Let g be (-4)/(-8)(-1 - 3). Let j(o) = -o2 + 2. Let b be j(g). Let t be 1 + 0 + (-4)/b. Solve 8p = tp - 15 for p. -3 Let y be (-136)/(-36) - 4/(-18). Suppose -yg = -0g - 4. Solve -n - g + 3 = 0 for n. 2 Let t = -27 + 35. Solve tz = 4z + 16 for z. 4 Let f = 3 - -1. Suppose -6a = -fa - 16. Solve -3i = -ai - 25 for i. -5 Let r be 5/3 - (4/6 - 1). Solve 0 = rz - 6 - 4 for z. 5 Let n(p) = -p + 5. Let d(a) = 3a - 16. Let q(b) = -2d(b) - 7n(b). Let h be q(3). Solve h = -i - i for i. 0 Let n = 6 - 4. Let v = 12 - 12. Solve v = -nt + 3t + 5 for t. -5 Let i = 32 - 25. Solve -i = 5z + 3 for z. -2 Let k(d) = -5d3 - d2 + 1. Let f be 115(-3)/(-9). Suppose -10 = 3s + 4v + 1, 4s + 14 = -fv. Let i be k(s). Solve 0 = x - ix for x. 0 Suppose -4n + r = 6r + 13, -32 = -4n + 4r. Suppose 5o - 104 = -2i + 9, 3i - 4o - 112 = 0. Let j = i + -24. Solve -2b - nb = j for b. -4 Let b(m) = m*2 - m. Let f be b(-1). Solve -fj + 5 + 5 = 0 for j. 5 Suppose 0 = -5r + 8r - 6. Solve -r*z = -z - 2	{ "pile_set_name": "DM Mathematics" }
1? 4471306 In base 12, what is -6ab + 1081b? 10130 In base 7, what is 51464253 + -6? 51464244 In base 2, what is -11101010001011 + 11110010? -11100110011001 In base 9, what is 1772820 + 41? 1772861 In base 6, what is 140053341044 - 5? 140053341035 In base 12, what is -5 + 1aa7624? 1aa761b In base 3, what is -1120221 - 1111112? -10002110 In base 9, what is -2500 - 76830? -80430 In base 12, what is 738 + -43a7? -386b In base 10, what is 1584 - -246506? 248090 In base 3, what is 1212 - 1120120112011? -1120120110022 In base 6, what is -12554 - -54? -12500 In base 15, what is b70 - 127? a48 In base 16, what is -3719 - 232f? -5a48 In base 2, what is -10101100011101011011010 - 0? -10101100011101011011010 In base 16, what is -52 - 75d96? -75de8 In base 2, what is -101100001111101011010 - 1? -101100001111101011011 In base 3, what is 100011211012212 + -11? 100011211012201 In base 5, what is 312 + 124430? 130242 In base 5, what is 203211334224 + 10? 203211334234 In base 12, what is a60a + 434? aa42 In base 2, what is -101 - -10110111000110101100101? 10110111000110101100000 In base 11, what is -9 + -375a31? -375a3a In base 14, what is -10a38 + dd? -10939 In base 13, what is -10 + -4aa8a? -4aa9a In base 13, what is -b51 + -a258? -b0a9 In base 13, what is 10b096a0 + -1? 10b0969c In base 15, what is 1775421c + -1? 1775421b In base 8, what is 20 - -14351322? 14351342 In base 12, what is -12362 + 213? -1214b In base 11, what is -4 + -3075314? -3075318 In base 13, what is 8 + 125796? 1257a1 In base 16, what is -10a - -ca1? b97 In base 9, what is 1884081 + 41? 1884132 In base 12, what is 65565504 + 2? 65565506 In base 11, what is 40442 - a3? 4034a In base 7, what is 15330020 + 130? 15330150 In base 13, what is -430 + 85b9? 8189 In base 3, what is 2 + 11021120101212? 11021120101221 In base 9, what is -77 - 154620? -154707 In base 4, what is -30312121 + 2102? -30310013 In base 4, what is -1033001003 - -211? -1033000132 In base 7, what is 20 - -12663535? 12663555 In base 13, what is c9b7 - -164? cb4b In base 5, what is 4 + -24230012244? -24230012240 In base 10, what is -3 - -1058514? 1058511 In base 14, what is -533a484 + 5? -533a47d In base 5, what is -4 + -142404030? -142404034 In base 14, what is 763 + -6a9? 98 In base 13, what is -2c785 - -9? -2c779 In base 4, what is -221021311122 + -23? -221021311211 In base 9, what is -1005 + 60168? 58163 In base 13, what is 3282 - 11b0? 20a2 In base 15, what is -9bc12 + -11? -9bc23 In base 15, what is 460 - -b1d3? b643 In base 12, what is -604 + -a07? -140b In base 5, what is -31042231412 + -22? -31042231434 In base 9, what is 55 - -403551? 403616 In base 2, what is -1011100010 - -11111101111011? 11110010011001 In base 12, what is -1a26 + -1543? -3369 In base 3, what is -1221 - -11211122220020? 11211122211022 In base 11, what is -172 - 19826? -19998 In base 9, what is -3 - -200168442? 200168438 In base 2, what is -100100111011110 + 10100010? -100100100111100 In base 2, what is 100001010111000 + 10101101011111? 110111000010111 In base 2, what is -100000010010011001 - -1001? -100000010010010000 In base 12, what is 23 - -17839b? 178402 In base 7, what is 1030254 + -24? 1030230 In base 11, what is 5a81 + 3414? 9395 In base 11, what is -a + -3063020? -306302a In base 11, what is 35166474 + -17? 35166458 In base 5, what is -104113300 + -14? -104113314 In base 14, what is -1b8a8 + 4b5? -1b3d3 In base 13, what is 325784c - 1? 325784b In base 16, what is -4 - 3ce057? -3ce05b In base 3, what is 22120221112111121 - -11? 22120221112111202 In base 10, what is 155 + 1671707? 1671862 In base 14, what is -a + -21659a? -2165a6 In base 9, what is -8654 - 33456? -43221 In base 10, what is 365912 - 2449? 363463 In base 9, what is 28544 + 3084? 32638 In base 16, what is cc - 9f2? -926 In base 2, what is -1110101111100100 + -10100? -1110101111111000 In base 13, what is -137c2a6 + 4? -137c2a2 In base 7, what is 4205 - 15626? -11421 In base 10, what is 135 - 1215660? -1215525 In base 10, what is 13501348 - 1? 13501347 In base 11, what is -19822 - -974? -18959 In base 9, what is -163385 + -78? -163474 In base 7, what is 336315330 - -2? 336315332 In base 4, what is 1 - 112222123113? -112222123112 In base 14, what is 27d54a2 - -9? 27d54ab In base 9, what is -53044 - 55? -53110 In base 11, what is 384a9a + 17a? 385169 In base 4, what is 2202130202301 - 10? 2202130202231 In base 10, what is 863 - 14146? -13283 In base 4, what is -3 + 2112000322012? 2112000322003 In base 15, what is edd - -5191? 617e In base 12, what is -467 - 1217a1? -122048 In base 5, what is 22004 - 2010? 14444 In base 12, what is a02a - -100? a12a In base 5, what is 1131214033343 - -1? 1131214033344 In base 10, what is -3 + -76639964? -76639967 In base 15, what is 420869d + b? 42086a9 In base 6, what is 242555 - 50? 242505 In base 8, what is -4635774 + 12? -4635762 In base 12, what is -114 - -81557? 81443 In base 6, what is 22402211 + -4100? 22354111 In base 13, what is -8 + 2359c11? 2359c06 In base 4, what is -12 - 110110221? -110110233 In base 11, what is -297a59 + 0? -297a59 In base 11, what is 4a2 - -1092a9? 1097a0 In base 15, what is 7 + -b871e2? -b871da In base 16, what is -b5 - -1091? fdc In base 7, what is -65 + 1545411? 1545313 In base 6, what is -3133 + -2450500? -2454033 In base 6, what is 44012231 - -31? 44012302 In base 2, what is 101000110000010111000001110011 + -10? 101000110000010111000001110001 In base 13, what is -5ab230 - -35? -5ab1c8 In base 7, what is 15 - -32623401? 32623416 In base 15, what is 2779cb + -2? 2779c9 In base 16, what is -3522 + -608? -3b2a In base 10, what is 22 - 3579530? -3579508 In base 14, what is 28 + 9232b? 92355 In base 12, what is -20506 - -2507? -19bbb In base 16, what is 1382a6e - -5? 1382a73 In base 13, what is 119c91 - 147? 119b47 In base 3, what is 101012201020121 - -2? 101012201020200 In base 2, what is 10010000111100 - 1000110001? 10001000001011 In base 13, what is 1 - -2c2c88? 2c2c89 In base 2, what is -111010100000011101010000 - 1? -111010100000011101010001 In base 6, what is 20135542 - 2033? 20133505 In base 12, what is -51 + 17173? 17122 In base 15, what is -30b - -1065? c59 In base 2, what is -1000000010000100101101 - -101? -1000000010000100101000 In base 2, what is 100111 - 1000011100011100001000? -1000011100011011100001 In base 4, what is 1 - -30102012320312? 30102012320313 In base 16, what is -4c828d + -e? -4c829b In base 6, what is -124210 - 205501? -334111 In base 7, what is 50432 - -461? 51223 In base 13, what is -387 - -1aca? 1743 In base 16, what is -aca9d1b - -3? -aca9d18 In base 5, what is -224 - 22224404? -22230133 In base 4, what is -2310333020 + 12? -2310333002 In base 11, what is -3a + 139730? 1396a1 In base 12, what is 2 + 1b0383a2? 1b0383a4 In base 16, what is -4 + 1b279e05? 1b279e01 In base 3, what is -102021111010 + -220? -102021112000 In base 6, what is -100 + 30125312? 30125212 In base 12, what is -104b55415 + 1? -104b55414 In base 5, what is -2011 - -110340330? 110333314 In base 9, what is 266711 - -11? 266722 In base 2, what is 101 + 11010110001101010000010? 11010110001101010000111 In base 11, what is 3048a102 + 1? 3048a103 In base 16, what is -31 - c7244? -c7275 In base 14, what is 3dc2d + -105? 3db28 In base 10, what is 9401324 - -3? 9401327 In base 16, what is -66b0 + -21d? -68cd In base 12, what is 1 - -520452? 520453 In base 8, what is -321613 + -1404? -323217 In base 2, what is 1101 - -1011110010001011110010101? 1011110010001011110100010 In base 15, what is -28d573d - -2? -28d573b In base 4, what is 1221 - -2013203010? 2013210231 In base 9, what is 40 - -15353713? 15353753 In base 3, what is 2002022201222 - -1? 2002022202000 In base 4, what is -103320211220 + -1? -103320211221 In base 6, what is 313205551 - 223? 313205324 In base 13, what is 7b10796 + 5? 7b1079b In base 8, what is -404017762 - 5? -404017767 In base 10, what is 26 + 68920? 68946 In base 10, what is -2882298 - 51? -2882349 In base 7, what is 13155 + -23502? -10314 In base 3, what is -10 + 1011122002022222? 1011122002022212 In base 10, what is -606671 - 21? -606692 In base 11, what is -752610 + 0? -752610 In base 2, what is -1001001 + 11011110000100110101110? 11011110000100101100101 In base 16, what is -3 - 713ab? -713ae In base 11	{ "pile_set_name": "DM Mathematics" }
y (b(-31)/((b(20/9)b)/bb)(b(-4))(-3/5))38 assuming b is positive. b(-54416/45) Simplify (((m/(mm*(-6))m/(m/((mm0)/m)))/((mm(5/6))/m(-1/2)))(-7))(-8/3) assuming m is positive. m(616/9) Simplify ((o(-3)o/o5)/(oo*(3/7)oo0))/((o/(o(-1)o))(-21)/(o/o(1/2)(oo7)/o)) assuming o is positive. o(267/14) Simplify (f*(-1)(f/(ff42)fff)/f((f(-8/3)/f)/f)18)(18/11) assuming f is positive. f(-2250/11) Simplify (n9/(nn/(n/(nnn/n(-1/7)))))46/(n*8/(nn/n(-4/7)))(29/3) assuming n is positive. n(3590/21) Simplify ((l/(l(2/19)/l)lll/l(-3/2))/(((l/l7)/l)/l(1/8)))/((l/(ll(-2)/l))(-7/6)l2l/(l*(3/5)l)) assuming l is positive. l*(11871/760) Simplify c((c/(cc/(cc*(-21)))cc)/c)/cccc*42(c(-40)/c)(8/3) assuming c is positive. c*(-256/3) Simplify ((aa/(a/a*0)a)32/(a(-4/5)/aa/(aaaa*(6/5)a)))/(((a/(a/a*3)a)/(aa/a0))/(a(-1))44) assuming a is positive. a24 Simplify (((v/(v/((vvv/(v/((vv/(v/v*37v)v)/v))vv)/v)))(-6))(-17/2))(-1/12) assuming v is positive. v(-170) Simplify (y7y/y3)/(y/(y0y)y*(-1/3))((y/(yy(-4)))/(y/y(-7)))/((yy(-1/5))/y(-7)) assuming y is positive. y(-97/15) Simplify ((x9x)/xx(1/4))(-17)/(x*(-5)/(xx*5/xx))(1/3) assuming x is positive. x(-1843/12) Simplify (f/(fff*7)f(-1))/(f(2/7))*(2/81)(ff(-1))(-15)(ff(-1)/f)(-46) assuming f is positive. f(20975/567) Simplify ((x/(x/x(1/2)))/x(2/19))/(x/(xxx/(x(x*2/xx)/x))x(-6))xx(-2/5)x*(1/9)(x/(x/(x*(-1)/x))x)(6/19) assuming x is positive. x(11611/1710) Simplify ((ww/(w19ww))/(w/w(1/40))(ww/(((ww(-8)/w)/w)/w))/w(-9))34 assuming w is positive. w(697/20) Simplify ((y*(-1/4)y)/y*(-1/6)y(4/5)/y(-6))/(((y*(1/4)y)/yy)/(y(-1/5)yy)y*2yy(-1/7)) assuming y is positive. y(568/105) Simplify (((k2)(-14/9)k*(-2/11)kk(-10))8)(-6/7) assuming k is positive. k(19472/231) Simplify ((s(1/5)ss/s(2/5))/(s(1/2)ss)(-33/2))/((s(1/4))(-24)s1/s(-3/4)) assuming s is positive. s*(473/10) Simplify ((a/(aa*(-12)a))*(5/12)(aa/(a/(aa*(3/31))))/(aa(-40)))44 assuming a is positive. a(186923/93) Simplify (j22j26j(jj(-1/3))/(j/((j/((j23j)/jj))/j)))(-10/13) assuming j is positive. j(-740/39) Simplify (((g(g/(g/g(-3/8)))/ggg(-1/4)g)3)47)5 assuming g is positive. g(7755/8) Simplify (m1)36/(((mm/(m6/m))/m)/((mmm(2/19))/mm))m(-3/4)/(mm*(-1/11)/m)(m0/m)(-6/19) assuming m is positive. m(34913/836) Simplify ((a/a(1/8))(-13)/((a(-10)/a)/(a/(a(((a(-1/3)/aa)/a)/a)/a))))(-47) assuming a is positive. a(-3337/24) Simplify (w(-1))(1/18)(w(1/3)w)/(w/w*(-2/9))(ww/(w3w)w1/w)(-34/5) assuming w is positive. w(1229/90) Simplify (n(-6)n*(-1/4)n(n/n(-1/3))/((n((((nn(8/5)n)/n)/n)/n)/n)/n))/((n2)24(n(2/5))(15/4)) assuming n is positive. n(-3181/60) Simplify ((s/s(1/2))(-47)/(s(-2/11)s(-3)))/((s/s(-5/3)sss(2/7)s)/(s/(s*(1/3)/s)s(3/4))) assuming s is positive. s(-7347/308) Simplify ((z*(-1)z)*(-11/2)(z/z(-2))(-1/42))(-2/15) assuming z is positive. z(1/105) Simplify (k*11k*(-1/11)(k/(kk/((k11/k)/kk)k))/kk/(kk(-14)))29 assuming k is positive. k(10179/11) Simplify ((cc*(2/7))/ccc)34c*(-1)/cc*(-7)cc(-1/3)/((cc*(-1/2))/c)(cc(-2/11))/(c/((c(3/8)/cc)/ccccc)) assuming c is positive. c(135041/1848) Simplify ((a(2/9)aa)(-5/7))(-47)/(((((a/(aa(6/7))a)/a)/a)/aa(-3/7))/(a/a(-1/4))(2/125)) assuming a is positive. a(35059/450) Simplify ((((r5/rr)(-1/2))50)1)38 assuming r is positive. r(-4750) Simplify (i/i(-6/11))*0(i/((ii/(i34ii))/i))(1/53) assuming i is positive. i(36/53) Simplify (z/(z/(z/((z/((zz0)/z))/z))))(-1/3)/(zz1)(-21)(zz/z(-6)zz(5/2))9 assuming z is positive. z(871/6) Simplify ((m(2/3))(-16/3)(m*(2/17)m)/mmm/m*(-6))/(((m/(mm/(m*(-1/7)m))mm)/m)/(mm(-5)mm)m*(-2)/(mm(-5)/m)) assuming m is positive. m(-1387/1071) Simplify (h/h28)48/((h/(h/(hhhh(2/13))hh))/h(-27)) assuming h is positive. h(-17214/13) Simplify ((r(-2/7))(-19)/((r(1/3)r)/((r*2r)/r)))/((r(-1))(21/2)/((r*0/rr)/r)0) assuming r is positive. r(697/42) Simplify (y*(-2/9)(y*(-1)yy)/y)(-25)((y*(-3)y)(-7))39 assuming y is positive. y(4964/9) Simplify ((p(-1/3)/p)/pp)43/((pp*(-1)p)/(pp6))((pp/(p(-10)p)pp)/(p*(-1/4)pp))(3/7) assuming p is positive. p(-3907/84) Simplify (x/(xx*(-35)x))/(x*21x)(x(-1/49)x)(-3/14) assuming x is positive. x(4044/343) Simplify (z/(zz(1/7))(z*5z)/zz(-1/2)(zz/z(-7))/z)/(((((z/z(-2/9)z)/z)/zz)/z(-1/7))/(zz/((z*(1/4)/z)/z)z)22) assuming z is positive. z(7276/63) Simplify (kkkk45kkk)*(-1/37)(k19)46 assuming k is positive. k(32287/37) Simplify (((k(-9)k)/(kk*0))/(kk*9k/(kk7k)))/(k2/(k/k3)(k(-1))14) assuming k is positive. 1/k Simplify ((k(-1/4))(5/11)/(k(((k(k/(k/k(1/2)))/kkkk)/k)/k)/kk(4/5)))/((kk(-2))(24/11))29 assuming k is positive. k(13389/220) Simplify ((l12/(l/((l/(l/l(-34)))/l)))/((l/(l*4l)l)/(ll6)))35 assuming l is positive. l(-490) Simplify ((g29/((g*18g)/g))/(g*21g*21g))(-30/13) assuming g is positive. g(960/13) Simplify ((f0)10)*(-48)((f(f/((f/(f(f*(-2/5)f)/f))/f))/f)/ff)(-2/27)f(-1/5)/f(-2/7) assuming f is positive. f*(-31/945) Simplify ((o/(o/(((oo*(-1))/oo)/oo)))39)13/(o(4/3)/ooo(4/9)(oo(-6))/(o/(o(-2)/o))) assuming o is positive. o(65/9) Simplify (((o/(ooo(-5/6)o))/oo(-28))/((oo(o/(oo/(oo43ooo)))/o)/oo(2/13)/oooo))(-7) assuming o is positive. o(42763/78) Simplify ((p/(pp/(pp*(-5/2)p)))/p*(3/7)(p((p(-3)p)/p)/ppp)/(p/(p/p*(-1/3))p))/(p*(11/2)/(pp11))(1/2) assuming p is positive. p(-29/84) Simplify (x(-3/11)/(xx15x))*6/((xx(-2))(2/47)/(x/(x*1x)x(-1/3))) assuming x is positive. x(-162742/1551) Simplify ((j/(jj/(jj/j12j)))/j(-11))(-5/13)/((j(j3j)/jj(-2))/(j(2/9)/(j(-1/7)/j))) assuming j is positive. j(-835/819) Simplify v/v(-6)vv(2/3)(v1)(-6)(v(v/(vvv1))/v)(-3/29)v(1/2)/vvv(-1) assuming v is positive. v(413/174) Simplify (uuu(2/21)u/u*(-10/11)(uu(-1)u)/u(1/7))33 assuming u is positive. u(1123/7) Simplify ((s/s(2/7))*(-7/12)/((ss*1s)/(s(1/2)/s)))/((s1s)(-17)/((s/(s/(s/(s/(s(-1/4)s)))))/(ss(-3)))) assuming s is positive. s(197/6) Simplify d(2/11)/(d(-4)d)(d/(d(-2/7)d))*(3/7)d3/d(1/2)(d1)(-16) assuming d is positive. d(-10991/1078) Simplify (a(2/7)/(((a/(a/(a/(aaa/a(-7)))))/a)/a))49(a(-1/2))44/(a(-2/3)/a)(4/9) assuming a is positive. a*(14357/27) Simplify (((k(k/k*2)/kk)/(kkk(k/(k/(k6/k)))/k)k*(-4)k*(-2)k)(4/17))(-22/7) assuming k is positive. k(1056/119) Simplify (v(-2)/(((v/(v*(-2/9)v))/v)/v)(vvv/(vv/(v(-1)/v)))(8/3))/(v*0vv(1/12)(v(-1)/v)(-2/35)) assuming v is positive. v*(-5149/1260) Simplify (ww*(5/12)w)/(w*(-43)/w)w(11/7)/w31 assuming w is positive. w*(1427/84) Simplify (qqq(1/2)q/(qq(qq(-2/17)/q)/q))(-28)/((q(-3/2)/qqq)/(qq*5)(q(-2/7))(-46)) assuming q is positive. q(-19025/238) Simplify (u(-2/9)(u(-2/23)/u)/u(u/(u*(3/2)uu)u)/u3)/((((u(-7)u)/u)/(u6/u))/(u(3/4)/(u(2/13)uuu))) assuming u is positive. u(29999/10764) Simplify (((b/b(-1))*(-47)((b/(b/(b/(b*2b))))/bb)(9/8))(-16/3))(1/45) assuming b is positive. b(308/27) Simplify ((j0j(-2/3))/(j(-2/75)/j(-7/5)))(5/3) assuming j is positive. j*(-17/5) Simplify ((ddd/(d/d0))(2/61)/(d(-1)d(dd*(-7))/dddd))(-30) assuming d is positive. d(-7440/61) Simplify ((g(-1/6)/(((g0/g)/g)/g))/(g*(-5)gg(-2/3)))/((g(-1/2))2)(15/4) assuming g is positive. g(45/4) Simplify (c19c)*(-2/7)c(-2/9)/c(-27) assuming c is positive. c**(1327/63) Simplify (((((m/	{ "pile_set_name": "DM Mathematics" }
to three decimal places. 0.007 Suppose 0 = -t - 4d + 10, -3t = -5t + 5d - 19. Let w = 6 + t. Suppose -15 = c - 3z, -2c + wc = -5z - 63. What is c rounded to the nearest 10? -20 Let m(a) = -2a2 - 11a. Let g be m(-5). Suppose 0 = r + 2f - gf + 56, 4f = r + 59. Round r to the nearest 10. -50 Suppose -3f = -72 - 120. Let p = 15 + -24. Let h = f + p. Round h to the nearest 10. 60 Let p = 1153 - 1152.9183. What is p rounded to three dps? 0.082 Suppose w - 4g - 2018 = -623, -4w - g + 5580 = 0. Let t = -6307 + w. Let i = t - 4088. Round i to the nearest ten thousand. -10000 Let w(i) = -i*2 - i + 13. Let b be w(0). Let c = b + -8. Suppose -2942 = -5x - 4d, x + 5d = cx - 2370. Round x to the nearest one hundred. 600 Suppose -5a - 149 = 21. Let u = a + 35. Let k be -2 - u/1 - 46. Round k to the nearest 10. -50 Let w(l) = -2l + 5. Let z be w(5). Let o be (1 + 4)3/z. Let a be -66 + (0/o)/(-1). Round a to the nearest ten. -70 Suppose -z - 1421866 = z. Let u = -343480 - z. Suppose u = -v - 2882547. Round v to the nearest one hundred thousand. -3300000 Let s = 178.216 - 178. Round s to 1 dp. 0.2 Let z(v) = 8v3 - 8v*2 - 8v - 21. Let i be z(9). Let k = i - 3031. Round k to the nearest one hundred. 2100 Let l = 4.43 + -9.64. Round l to the nearest integer. -5 Let g = 4 - 0. Let h(w) = -8971w - 6. Let z(i) = 17941i + 11. Let s(m) = -5h(m) - 2z(m). Let l be s(g). What is l rounded to the nearest one thousand? 36000 Let b = 4.085 - 1.18. Round b to one decimal place. 2.9 Let m = -133734621 + 94704621. Round m to the nearest one million. -39000000 Let w = 43.9 + -44.171. Let a = 2545520 - 2545519.7290119. Let n = a + w. Round n to six dps. -0.000012 Let v be 5 + (-1 - (5 - 7)). Let g be (-43196)/v + (-30)/45. Round g to the nearest 1000. -7000 Let b = -37260.132891 - -37873.27461536. Let i = b + -575.141723. Let g = -38 + i. Round g to seven decimal places. 0.0000014 Let y = -605943 + 605943.07000082. Let g = 2.93 - 3. Let q = g + y. Round q to 7 decimal places. 0.0000008 Suppose 17 = b - 19. Let t be (-384)/b150/(-4). Let m = t - 269. What is m rounded to the nearest 10? 130 Let f = 39 - 33. Suppose 5n - 225015 = 3v, fv + 374997 = v - n. Round v to the nearest 10000. -80000 Let o = -5.8 + 4.84. Let s = o - -0.16. Let f = -0.7955 - s. What is f rounded to three dps? 0.005 Let a = 1.042 - 1.037926. What is a rounded to 4 decimal places? 0.0041 Let q(p) = -10p - 2. Let b be q(-1). Suppose -3f - b = -f, 2v - 5580 = -5f. Round v to the nearest one hundred. 2800 Let l be -17525001/((-5)/(-20)). What is l rounded to the nearest 100000? -7000000 Let k = -221.879 - -222. Let x = k - -0.409. Round x to one dp. 0.5 Let d = -2.743 + 2.746152. What is d rounded to 5 dps? 0.00315 Let v = 3004.47 - 3027. Let t = 0.47 - v. Let g = t - 23.22. Round g to 1 dp. -0.2 Let y(r) = -3r*3 - 14r*2 + 7r + 4. Let a be y(-11). Let l = a - 6136. What is l rounded to the nearest 100? -3900 Let u = -223.7 + 237. Let x = u - 13.259. What is x rounded to two decimal places? 0.04 Let p = -0.06518958 + -11.93490242. Let g = 80 + -68. Let r = p + g. What is r rounded to 5 decimal places? -0.00009 Suppose -9v + 133745 + 241555 = 0. Round v to the nearest ten thousand. 40000 Let g be (378/15)/((-6)/20). Let h(d) = d3 + 22d*2 + 13d - 5. Let f be h(-21). Let w = g + f. Round w to the nearest ten. 80 Let o = -271 - -271.0419. Round o to two dps. 0.04 Let g(r) = r*3 + 3r*2 + 2r - 2. Let n be g(-2). Let m be n + 3 + 1 + -16802. Round m to the nearest 1000. -17000 Let m = -692777.80093 - -692549.8. Let f = m - -228. Round f to 4 decimal places. -0.0009 Let u be -2 + -82900 - (9 + -11). What is u rounded to the nearest ten thousand? -80000 Let h(p) = -13701p2 + 5p + 14. Let m be h(-2). Round m to the nearest 1000. -55000 Suppose -2x + 2z + 4449 = 3z, -3x + z + 6661 = 0. Suppose -3i + 12 = i. Suppose 2a - 4k = -0a + 1484, ia = 2k + x. Round a to the nearest 100. 700 Let m = 0.0461846093 + -4.9461840293. Let f = m - -4.9. What is f rounded to seven dps? 0.0000006 Let m = 31064 - 21764. Round m to the nearest 1000. 9000 Let b = 17.9 - 180.4. Let u = 162.3431 + b. Let d = -0.149 - u. What is d rounded to 3 decimal places? 0.008 Let u be -3 - (-1195 - 0) - (-12)/(-3). Round u to the nearest 100. 1200 Suppose 269678 - 819672 = 4w - 2h, 2h = -4w - 550006. What is w rounded to the nearest 10000? -140000 Let y(r) = 4372r - 288. Let i be y(4). Round i to the nearest 1000. 17000 Let a(z) = 4648z - 8. Let y(x) = x - 11. Let p be y(7). Let c be a(p). Let q be (-200)/((-4)/c-1). Round q to the nearest 100000. 900000 Let j = 376 + -259. Let y = -458.84001 - -575.8405. Let d = j - y. Round d to 4 decimal places. -0.0005 Let l = 3222.00002813 - 3222. Round l to 6 decimal places. 0.000028 Let p = -205.36 - -3.36. Let y = p - -201.9747. Round y to 3 decimal places. -0.025 Let t = -0.28 - 0.26. Let x = -532418.539961 - -532418. Let z = x - t. What is z rounded to five decimal places? 0.00004 Let n be 10/4-2 - -4. Let x be (2 - n)/(14/546). What is x rounded to the nearest 10? 120 Let f = 137.21 + -136. Round f to the nearest integer. 1 Let d = 592.00000067 + -592. Round d to six dps. 0.000001 Let f = -3599 + 3599.01601. What is f rounded to 3 decimal places? 0.016 Let t = 16.15 + -16. Let a = 0.339 - t. Round a to two dps. 0.19 Let v(a) = a*2 + 2a + 2. Let j be v(-2). Let p(h) = 413h3 + 669 - 669 - h2. Let y be p(j). What is y rounded to the nearest one thousand? 3000 Let w = -50.9 + 53. Let i = w + -2.03. Let f = i + 0.067. What is f rounded to two dps? 0.14 Let h = -0.595 + 1.52. What is h rounded to 2 decimal places? 0.93 Suppose c = 6c. Suppose 48 = 4h - ch. Round h to the nearest ten. 10 Let r = 993.999998308 + -994. Round r to seven dps. -0.0000017 Let p = 0.83000396 + -0.83. What is p rounded to 6 decimal places? 0.000004 Let d = -3017144.99518 - -3017393. Let g = -248 + d. Round g to 4 dps. 0.0048 Let k = -820 + 855.9. What is k rounded to the nearest 10? 40 Let u = 29596.9 + -1111.9. Let r = -28485.032942 + u. Let f = r - -0.033. What is f rounded to 5 dps? 0.00006 Let k = -130 + 129.9256. What is k rounded to two dps? -0.07 Let d = -87.400006 + 87.4. Round d to 5 dps. -0.00001 Let m = -83 + 84.26. Round m to 1 dp. 1.3 Let g = 3812 - 3812.03847. What is g rounded to three decimal places? -0.038 Let v = -16.5396 - -45.5584. Let z = -29 + v. What is z rounded to 3 dps? 0.019 Let j be -5 + 4 - -38 - (-2)/1. Suppose -47b = -jb - 2016000. Round b to the nearest 10000. 250000 Let r = -30.57761 + 0.58461. Let j = r - -30. Round j to two decimal places. 0.01 Let x = 70.27 - 69. Let j = x - -0.01. Let f = j - 1.97. Round f to 1 dp. -0.7 Let o = 90.4 + 1.9. Round o to the nearest 10. 90 Let a = 14907 - 14921.806. What is a rounded to 1 dp? -14.8 Suppose 0 = 3f - 7f - m + 2, -m = 3f - 2. Let s be (2 - f)/(-1) + 186. Suppose 61 = -2y + y + 4x, -4y + 4x - s = 0. What is y rounded to the nearest 10? -40 Let p = -93.1 + 138.8. What is p rounded to the nearest integer? 46 Let b(j) = j - 1. Let t(h) = -244h + 10. Let r(x) = 5b(x) + t(x). Let w = -50 - -45. Let f be r(w). Round f to the nearest 100. 1200 Let i = -523.7 - -313.4. Let a = 55 - 257. Let t = a - i. What is t rounded to zero decimal places? 8 Let v(h) = 264h - 12. Let d(b) = -b*3 + 13b2 - b + 8. Let o be d(13). Let j = o + 13. Let w be v(j). Round w to the nearest one thousand. 2000 Let v(c) = c2 - 4c - 9. Suppose 3z + 12 + 3 = 0. Let s be v(z). Round s to the nearest integer. 36 Suppose 11 = -0v - 2v + n, 0 = v + n + 7. Let a be 20v/460. Round a to the nearest 1000. -2000 Let a = 58.0706 - 168.07496. Let t = a + 110. What is t rounded to three dps? -0.004 Let k = 100.4 - 117. Let a = k - -16.599858. What is a rounded to five dps? -0.00014 Suppose 5z - o + 75400004 = 0, 4o = 4 + 12. Round z to the nearest one million. -15000000 Let u be 1/(-2) - (-124978)/4. Let j be 9/12 + u/(-16). Let v be 2/3 + j/3. What is v rounded to the nearest one hundred? -700 Let i = 1323289.5879038 + -6385.5879288. Let g = i + -1316918. Let s = -14 - g. Round s to 5 decimal places. 0.00003 Let g = -0.16943 + 10.50783. Let a = -10.4 + g. Round a to 2 decimal places. -0.06 Let w(	{ "pile_set_name": "DM Mathematics" }
Suppose 3k + 2l + 4 = 0, 5k - 4l - 30 = -0k. Let o(r) = 4r + 53 - 5r + kr. Does 53 divide o(0)? True Suppose -j - 2u = -10179, 2j + u - 21006 = -648. Is j a multiple of 13? True Let o = -360 - -367. Suppose 6x - ox + 448 = 4j, -4x + 1712 = -4j. Is x a multiple of 72? True Let h be (-5990)/60 - (-2)/(-12). Let k be (-60)/50h/3. Suppose s - k = -s. Is s a multiple of 5? True Let r(s) = -55s + 97. Let v(w) = 58w - 97. Let m(j) = -3r(j) - 4v(j). Does 9 divide m(-12)? False Let n(g) = g*3 - 7g*2 + 3g - 21. Let x be n(7). Let l be (x + (1 - -4))(-184)/(-115). Does 7 divide ((-2)/3)/(l/(-1092))? True Let c = 48 - 41. Suppose 243 = cp - 4p. Let m = 175 - p. Is m a multiple of 47? True Is (-54192)/(-17 - -5) - 11 a multiple of 5? True Let k(l) be the first derivative of 22l - 151 + 117 + 44l + l2. Is k(-13) a multiple of 4? True Let c(q) = -q2 + 19q + 19. Let u be c(19). Let d = 189 - u. Does 34 divide d? True Let k = 976 + -432. Does 32 divide (-15 + 3)k/(-12)? True Let v(d) = 2d*2 - 3d - 10. Let w be v(-2). Suppose -wt = 2t - 312. Does 16 divide t? False Suppose 161t = 3t + 58049 + 41491. Is t a multiple of 21? True Suppose -184 = -y + 3y. Let q = -1682 - -1826. Let s = q + y. Is s a multiple of 13? True Let u be 2 + 4016/(-6) + (-3)/(-9). Let a = -435 - u. Let b = a - 113. Is 23 a factor of b? False Suppose -355 = -18h + 13h. Suppose 0 = -4d, 2c = -67d + hd + 910. Is c a multiple of 35? True Let q = -2933 - -3982. Is 4 a factor of q? False Let i = -63 - -72. Let w be 2/((-12)/(-2971)) + i/(-54). Let t = -348 + w. Is 15 a factor of t? False Let y(a) = 2a*3 - 5. Suppose 10l = 11l. Let b be y(l). Is (-54)/b + 1/5 a multiple of 2? False Let k(f) = -82f + 6801. Is k(30) a multiple of 14? False Let i be (-5)/((-50)/4)5. Suppose 0 = -4s + 2q - 2, 5s + 2q - i = s. Suppose -22j + 28j - 132 = s. Does 4 divide j? False Let p(t) = t2 + 26t + 53. Let z be (-17 - (-9)/(-3)) + (-8)/2. Is 2 a factor of p(z)? False Let f = 3 + -6. Let d(a) be the second derivative of 3a4/4 + 5a*3/6 + 7a*2 + a + 507. Does 10 divide d(f)? True Let p = -48969 - -76976. Is p a multiple of 34? False Suppose -344 = -127g + 164. Is 4 a factor of g? True Does 2 divide ((-61/8)/((-21)/1036))/1? False Let x(a) = 6a*2 + a + 111. Is x(-9) a multiple of 21? True Let g(b) = 30362b*3 - 4b*2 + 17b - 15. Is g(1) a multiple of 115? True Let i(s) = s*3 - 15s*2 + 97s - 531. Is i(27) a multiple of 172? True Let b = -37238 + 77138. Is b a multiple of 42? True Suppose -24715 = -22s + 57653. Does 26 divide s? True Is 54 a factor of (-7386)/(-6) - (2 - -12)? False Let i(k) = 33k + 27 + 0k3 + k2 + k3 - 22k*2 - 56k. Let v be i(22). Suppose 0z - 225 = -vz. Is 25 a factor of z? False Let k = 62 - 51. Suppose -kl - 168 = 10l. Does 14 divide 2/((-8)/(-387)(-6)/l)? False Let s(z) = 199z - 1089. Does 142 divide s(30)? False Let j = -40 + 42. Let g(w) = -w*3 + 3w*2 - 4w + 5. Let k be g(j). Does 11 divide k165/(-20)-4? True Suppose -5j + 10 = -5s, 4s = 5j - 26 + 11. Suppose 3a - ja = -860. Is a a multiple of 10? False Suppose -31 = -4k - 5n, 5n - 10 = -5k + 25. Suppose 182 = -c + 2c - l, -kc + 758 = 2l. Is 17 a factor of c? True Let m be 671/99 + (-2)/(-9). Suppose -mi + 956 = -3i. Suppose 3d - i = -p, 6d - 4p - 404 = d. Is 16 a factor of d? True Let h(t) = 532t2 - 60t - 180. Is h(-3) a multiple of 18? True Let h = -15 - -19. Suppose 3g = -ha + 271, -3g = -a - 141 - 125. Is 8 a factor of g? False Let p = 4807 - -11648. Is 15 a factor of p? True Let o(q) = 2q3 - q2 - 14q - 35. Let v(d) = -3d3 + d2 + 21d + 52. Let z(k) = -8o(k) - 5v(k). Is z(5) a multiple of 2? False Let y(w) = 94w - 2103. Does 14 divide y(29)? False Suppose -255d = -302d + 27072. Is 12 a factor of d? True Let b = 9152 - -13390. Does 221 divide b? True Let n(z) = -31z + 15. Suppose 59 - 14 = -15b. Let i be n(b). Let g = -68 + i. Is 10 a factor of g? True Suppose -3f + 8f = 3s + 31, f - 15 = 5s. Suppose -fc = -3c - 648. Is 36 a factor of c? True Let t = 108376 + -48666. Is 35 a factor of t? True Suppose 0 = -5y + 6y - 18. Let m be y/(-15)(-30)/12. Let k(v) = 4v*2 + 8. Is k(m) a multiple of 11? True Suppose 5s = -0f + f - 1253, 2s + 6173 = 5f. Is 10 a factor of f? False Suppose -2d = 20 + 36. Let i = d + 20. Let a(g) = 3g2 + 13g - 4. Does 14 divide a(i)? True Let u(l) = -3l3 - 10l*2 + 5l + 3. Let z be u(-6). Is (20/8 - 1) + z/6 a multiple of 15? True Let z be 66 - -1882 - ((-1 - -1) + -2). Suppose 32l - 42l = -z. Is 7 a factor of l? False Let c(i) = i*2 - 4i + 13. Let t be c(8). Let l = 48 - t. Suppose -5u = -lz + z - 270, z = 0. Is u a multiple of 8? False Let r be (-9)/((-152)/(-32) - 4). Is 16 a factor of (-3081)/(-6) - r/(-8)? True Let x(b) = 38b + 39. Let h be (9/(-3) - -6)(6 - 3). Let s be x(h). Suppose 0 = -5m + s + 24. Is 17 a factor of m? False Suppose 0 = -y + 66 - 69. Does 42 divide y(8 - -1042)/(-3)? True Suppose 0z = 14z - 336. Suppose 2t - 6t + 20 = 0, -3q - 3t + z = 0. Does 14 divide (-67 - (-5 + q))-1? False Suppose 0 = 10p - 2p + 16. Is 13 a factor of 4/p-269 - (5 - 0)? True Let p(r) be the third derivative of r5/30 + r4/3 + 187r3/6 - 2r*2 + 10r. Is p(0) a multiple of 3? False Let u(r) = -16r3 + 6r*2 - 2r - 4. Suppose 4 = 4i, -5g + 0 = -2i - 23. Let t be u(g). Is t/(-56) + 4/(-14) a multiple of 11? True Let u(a) = -a2 + 5a - 4. Let t be u(3). Suppose td - 146 = 42. Let i = d + 56. Does 25 divide i? True Let q(i) = -3i*3 + 37i*2 + 17i - 27. Is 3 a factor of q(9)? True Suppose -34 = -6b - 10. Suppose 64 = -bo - 5r, 4r = 3o + o + 64. Does 22 divide 175 + o/(-2) + -3? False Suppose 23 = -7n + 44. Suppose -26 = -5v - 11, -5f = nv - 1729. Is 17 a factor of f? False Suppose -19y + 23y - 1576 = 0. Is 3 a factor of y? False Suppose 23d + 10d = 0. Suppose -4o + 2424 = -101j + 105j, d = -j + 4. Is 8 a factor of o? False Suppose t = 23 - 21. Is 37 a factor of (-24)/60 - ((-1657)/5 - t)? True Let p(f) = 11f2 + f + 24. Let t be p(-6). Suppose -3c = 2o + 10, 3o + 2c + 17 = -2c. Does 20 divide 4/14 + o/((-231)/t)? True Let x = 361 - 231. Let f = x - 33. Does 9 divide f? False Let m = 95084 + -30476. Does 96 divide m? True Let t(j) = 51j + 562. Let o be t(0). Let f = -422 + o. Is 6 a factor of f? False Suppose 3d + 0c + 484 = -2c, -d - 166 = 3c. Does 24 divide (43 - -1)110/d-4? False Let j = -820 - -825. Does 6 divide (13338/(-65))/(j/(-25))? True Let f be 1/((-11)/(-51) - 22/(-187)). Suppose 0 = 5p - 3p + fm - 1411, -2m - 10 = 0. Does 31 divide p? True Suppose -2m + 0m + 32 = 0. Let w(l) = 54 - ml - 28 - 36. Is 14 a factor of w(-5)? True Suppose 7w - 520 = -170. Is 6(-115)/w-5 a multiple of 3? True Suppose -8 = -7c + 4c + s, 0 = 2c - 2s. Suppose 990 = w + cw. Is 11 a factor of w? True Let n = 25677 - 17181. Does 12 divide n? True Let t = -196 - -279. Let a = t + -56. Is a a multiple of 5? False Does 9 divide (-202)/(-303) + (-294125)/(-15)? False Let p be (86/(-3))/(8/(-24)). Let u = -212 + p. Is (2/(-4))/(3/u) a multiple of 21? True Let l be (-42)/12(-8)/14. Suppose 3n - 4 = -n, lt = -5n + 19. Is t even? False Let j(l) = -525l - 2443. Is 72 a factor of j(-9)? False Let c = 7788 - 4800. Does 9 divide c? True Is 11 a factor of ((-11)/3)/(13(-11)/292149)? True Let l = 33407 - 32633. Is l a multiple of 9? True Suppose 89s = 99s - 20720. Suppose 4v = -2j + 2072, 4v + j = -2j + s. Is v a multiple of 37? True Suppose -6o + 167 = 791. Is 3 a factor of (o + 3)(-4)/(4 - 0)? False Let v = 16 - 13. Suppose p = -2a + v + 6, 5a - 24 = -3p. Suppose -120 = -9q + pq. Does 10 divide q? True Suppose -11403 = 22l - 385535. Is l a multiple of 44? False Let t(p) = -p*2 + 6p + 4. Let r be t(6). Let d be -1-64/r. Suppose 0 = 8v - dv - 128. Does 13 divide v? False Let i = -30 - -26. Let y be (-6 - -2)/(i/5). Suppose 635 = yb - 5d, 0b - 4d - 379 = -3b. Does 43 divide b? True Let i be 6/21 + 96/56. Suppose j - 111 = 3z, 0j + 2z + 238 = ij. Suppose j = 4s - 397. Does 13 divide s? True Is 101 a factor of (-2)/2(1 + 100)1184/(-32)? True Let k(v) = -v*3 + 5v**2 + v - 7.	{ "pile_set_name": "DM Mathematics" }
. Which is the smallest value? (a) -4/3 (b) g (c) 2 (d) 2/13 a Let l = 4.997 + 0.003. What is the third biggest value in -5/4, l, -1? -5/4 Let v = -0.1 - -0.11. Let l = v - -7.99. Let c = -4 + l. What is the third biggest value in -1, c, -2? -2 Let g = -7/10 + 1/5. Which is the smallest value? (a) 4 (b) -0.2 (c) g c Let x = 22 + -37. Let p = x + 14.93. Which is the third biggest value? (a) -4 (b) 0 (c) p a Let c(z) = -12z. Let d be c(8). Let k = 147494/5 - 29594. Let y = d - k. What is the smallest value in 2/5, -0.1, y? y Let t = -0.037 - 0.263. Let d(h) = -2h*2 + 5 + 0h3 - 2 - h3 + 3h. Let i be d(-2). Which is the smallest value? (a) i (b) t (c) 2/3 a Let d = -0.07 - -0.07. Let j = d - -0.4. What is the third smallest value in j, 0.1, 5? 5 Let i = 2.6 + 0.4. Let d = -1664/9031 + 2/821. Which is the third biggest value? (a) i (b) d (c) 1/3 b Let f = -0.07 + 0. Let d = f - 3.93. Let m = -8/49 + 22/735. Which is the biggest value? (a) m (b) -4/5 (c) d a Let t = 10 - 23. Let g = -17 - t. What is the smallest value in g, -2/5, -2? g Let y = 5 + -3. Let t = 3.86 - -0.14. Let w = t - y. Which is the second smallest value? (a) 1/3 (b) w (c) -2 a Let n = -3/55 - -131/385. Let h = -7 - -7. What is the second biggest value in 2, n, h? n Let r = -5 + 9. Which is the biggest value? (a) r (b) -1 (c) -3 a Suppose -z - 10 = -2z. Let n be (0 - -1) + (-2)/z. Let m = -4.3 - -4.6. What is the second smallest value in m, n, -3? m Let k = -9 - -25/3. Which is the second biggest value? (a) 0.4 (b) 0.5 (c) k a Let p = -196 - -1369/7. What is the third smallest value in 2, -5, p? 2 Let t = 0 + -5. Let o = 5 - 0. Which is the biggest value? (a) -3/2 (b) o (c) t b Let f = -29.3 - -14. Let l = 15 + f. Which is the biggest value? (a) -4 (b) 2 (c) l b Let d = -6/13 + 68/91. What is the third smallest value in 2, 2/9, -1, d? d Let l = 0.01 + 0.09. Let g = -11/72 - -3/8. Which is the third biggest value? (a) g (b) l (c) -6/5 c Let y = -25.1 - -26. Which is the smallest value? (a) y (b) -0.3 (c) 2/5 b Let t = -134.1 - -134. What is the smallest value in t, 4/7, 1/2? t Suppose -2x = 4k - 414, -2k + 68 + 144 = -4x. Let p be (-1)/4 + k/544. What is the third biggest value in p, -5, -3? -5 Let t be 112/882 - (-4)/(-18). Which is the second smallest value? (a) -5 (b) t (c) -2 c Let y = 6.88 + 0.72. Let o = y + 1.4. Let i = o - 6. What is the smallest value in i, 4, -3? -3 Suppose 9 = -2j - j. Let w = -0.5 - -0.3. Let d = 0.2 + w. What is the third smallest value in -4, d, j? d Let b be (-4)/(-14) + (-26)/(-7). Let j be (-4)/(-144) + (-1)/b. What is the biggest value in 2/5, j, -2/7? 2/5 Let k be 60/(-9)6/2. Let q be (3/(-28))/((-5)/k). Let a = 3.16 + -0.16. What is the biggest value in q, -0.1, a? a Let a = -1 + 4. Let m = -1173/8 + 147. What is the smallest value in m, a, -4? -4 Let g = -500869/77 - -6505. Let j = g + -4/7. Which is the biggest value? (a) -0.2 (b) 2 (c) j b Let v = 5 + -7. Let d be (v/(-15))/(6/(-20)). Which is the biggest value? (a) -2/9 (b) d (c) -3 a Let o be -6(8/(-6) + 2). Let h = 0.402 - -0.098. Which is the third biggest value? (a) o (b) h (c) 0.2 a Suppose 0 = -2y + 2q - q, -2q - 5 = y. What is the third biggest value in -5, y, 0.07? -5 Let u = 34.2 - 34. Let f be 3/(-12) + 1 - 1. Which is the smallest value? (a) f (b) 2 (c) u a Let t = -33/70 + 1/14. Let z = -1 - -0.7. Let p = z - 0. Which is the second biggest value? (a) -5/6 (b) p (c) t c Let v = 21 + -24. Which is the second biggest value? (a) 3/2 (b) -2/3 (c) v (d) -4 b Let q be 3/(-1) + (-30)/(-12). Which is the smallest value? (a) q (b) -1 (c) -3 c Let p = -0.4 - 1.6. Suppose 3 = 3q - 3. Suppose -qh + 6 = -0h. Which is the second biggest value? (a) 4 (b) h (c) p b Let i = -8.12 - -0.12. Let f = i - -7.5. What is the smallest value in f, 0.5, 0.2? f Let m = -112 + 112.4. Which is the biggest value? (a) -8 (b) -3 (c) 1 (d) m c Suppose -4n = -3h + 12, 0h + 3h = -2n + 12. Suppose m + 4m = n. What is the second biggest value in -4, 4, m? m Let y = 0.1 + -1.6. Let m = y + 1. What is the third biggest value in 1/6, m, -5? -5 Let u = -247 - -235.3. Let l = u - -12. Let s be ((-7)/3)/((-2)/(-6)). Which is the third smallest value? (a) 2/3 (b) l (c) s a Let l = 15 + -8. Let g = l - 7.3. Let h = -5.01 - -0.01. Which is the second smallest value? (a) h (b) g (c) 3 b Let f(l) = 3l - 12. Let y be f(3). Which is the biggest value? (a) y (b) -1/8 (c) 1/7 (d) 2/3 d Let r = 15 + -20. What is the second smallest value in -2, 0.5, r? -2 Let g = 8.9 - 6.8. Which is the biggest value? (a) 0.1 (b) 1 (c) g c Let n = 34.4 + -30. Let x = -3.6 - 0.4. Let s = n + x. What is the second biggest value in 0, s, 1? s Suppose 0 = 3g + 1 + 5. Suppose 0 = -v + 1. Let p be v(-4 - g) - 0. Which is the third smallest value? (a) 1 (b) p (c) -4 a Let s = 0.02 + -0.32. Let f = -21 + 11. Let r = f + 6. Which is the third biggest value? (a) r (b) s (c) 0.2 a Let x = 0 + -1. What is the second biggest value in x, -0.4, -0.5? -0.5 Let f = 0.78 - 3.78. Which is the second smallest value? (a) f (b) -2/5 (c) 1/4 b Let g = -7 + 5.5. Let w = g + 2. Let q = -1 + 0.5. What is the second smallest value in -1/3, w, q? -1/3 Let f = 0.2 + -0.7. Which is the smallest value? (a) 5 (b) f (c) 0.2 b Let c be (2/(-3))/((-4)/6). Let y be (4 - c) + (-36)/15. What is the smallest value in 0.5, y, -2? -2 Suppose 14s = 9s + 15. Let k = 0.6 - 0.1. Which is the third biggest value? (a) s (b) k (c) 5 b Suppose 4w + 8 = 28. What is the biggest value in w, 2, 3? w Let d = -3 - 1. Let v = -5 - -3. Let q = -581/429 + 3/143. What is the biggest value in v, q, d? q Let y = -0.9 + 5.9. Let m = -16 + 15.6. Which is the biggest value? (a) m (b) y (c) 1/3 b Suppose 4m = 7m + 12. Let v = -17/5 - m. Let k = -24.8 - -21.8. What is the second biggest value in -5, v, k? k Let q = -1 - -1.3. Let s = -20 - -41/2. What is the second smallest value in 1, q, s? s Let w = 9 - 8.8. Let j = 3.1 - 3. Which is the biggest value? (a) w (b) j (c) -0.3 a Let n = -70 - -70.2. What is the third biggest value in n, -0.5, 0.4? -0.5 Let g = 1.1 - 1. Let r = 30 - 19. Let m = -11 + r. What is the third biggest value in g, -3, m? -3 Let m(t) = 2t - 1. Let h be m(-1). Let l be 323/9. Suppose -5y = 4w - 5, 5w - 5y + 3 = -l. Which is the smallest value? (a) h (b) w (c) 3 a Let h(u) = 7u - 6u*2 + 5u*2 - 6 + 2u*2. Let o be h(-6). Let w be (-2 - 21/o)-1. Which is the second biggest value? (a) w (b) -4 (c) -0.1 c Suppose -s - 4 = -f, -3f - 2s = s - 18. Which is the fourth biggest value? (a) f (b) 3 (c) 3/5 (d) 2/11 d Let n be (0 - -1)/((-12)/9). Let s be ((-112)/(-12))/4 + -2. Which is the second smallest value? (a) s (b) n (c) 4 a Let h(n) = -n*3 + 7n*2 + 9n - 10. Let p be h(8). Let g(a) = -a*2 + a + 2. Let m be g(p). Let w be 1/m - 30/8. What is the smallest value in -2, w, -0.2? w Let n = 2/17 - 23/51. Let g be (-1)/2 - (-15)/14. Let q = -25 - -73/3. Which is the second biggest value? (a) g (b) n (c) q b Let w = -0.8 - -4.8. Let q = -5 - w. Let s = q + 13. What is the third biggest value in s, -1/5, -3? -3 Let v = -7 - -7.3. Let p = 9.4 - 9. Let j = 13 + -13.5. Which is the third biggest value? (a) v (b) p (c) j c Let j be ((-5)/(-35))/(6/12). Let v = 0.358 - -1.672. Let a = v + -0.03. What is the third smallest value in a, -3, j? a Let x = 0.03 + 4.97. What is the second smallest value in 0.2, -1, x? 0.2 Let x be (0 + 4)/((-14)/(-1141)). Let g = 2611/8 - x. Which is the smallest value? (a) g (b) 3 (c) 2 a Suppose -4i = -8i + 20. What is the second biggest value in -5, 0.1, i, 4? 4 Let m = 0.2 + 0. Let p = -0.6 + 5.6. What is the third smallest value in p, m, -2/9? p Suppose 4w - 3i + 5i = -6, 2w = 4i + 12. Let n = 10 - 9.59. Let d = n - 0.01. Which is the second smallest value? (a) d (b) w (c) 3 a Let u = 0 - 5. Let o = u + 6. Let y = 6 - 4. Which is the second biggest value? (a) o (b) -1/2 (c) y a Let j(w) = -w + 15. Let r be j(14). Let z be (20/6)/((-6)/(-9)). What is the second biggest value in r, 0.2, z? r Let t = -16 + 18. Let g = -0.03 - 4.97. What is the third smallest value in t, -0.4, g? t Let	{ "pile_set_name": "DM Mathematics" }
o the power of 1/2, to the nearest integer? 1727 What is the cube root of 20096559 to the nearest integer? 272 What is 178720 to the power of 1/10, to the nearest integer? 3 What is the tenth root of 1428912 to the nearest integer? 4 What is the fourth root of 14179 to the nearest integer? 11 What is the eighth root of 10408150 to the nearest integer? 8 What is 160084 to the power of 1/2, to the nearest integer? 400 What is the third root of 10246888 to the nearest integer? 217 What is 885973 to the power of 1/2, to the nearest integer? 941 What is 1068421 to the power of 1/2, to the nearest integer? 1034 What is the cube root of 136461 to the nearest integer? 51 What is the fourth root of 9741460 to the nearest integer? 56 What is 438745 to the power of 1/3, to the nearest integer? 76 What is the third root of 93121 to the nearest integer? 45 What is 3286271 to the power of 1/2, to the nearest integer? 1813 What is the cube root of 20267300 to the nearest integer? 273 What is 110354 to the power of 1/3, to the nearest integer? 48 What is 526164 to the power of 1/6, to the nearest integer? 9 What is the square root of 1233520 to the nearest integer? 1111 What is the square root of 1425218 to the nearest integer? 1194 What is 1706430 to the power of 1/10, to the nearest integer? 4 What is the square root of 4663522 to the nearest integer? 2160 What is the cube root of 3175136 to the nearest integer? 147 What is the square root of 119786 to the nearest integer? 346 What is the tenth root of 731892 to the nearest integer? 4 What is 4457700 to the power of 1/2, to the nearest integer? 2111 What is the square root of 4041159 to the nearest integer? 2010 What is 330766 to the power of 1/3, to the nearest integer? 69 What is 10353903 to the power of 1/4, to the nearest integer? 57 What is the third root of 12452510 to the nearest integer? 232 What is the cube root of 30418897 to the nearest integer? 312 What is 289596 to the power of 1/7, to the nearest integer? 6 What is the third root of 131434 to the nearest integer? 51 What is the fourth root of 11029954 to the nearest integer? 58 What is the square root of 66088 to the nearest integer? 257 What is the sixth root of 2516430 to the nearest integer? 12 What is the cube root of 966523 to the nearest integer? 99 What is the tenth root of 168157 to the nearest integer? 3 What is 7956660 to the power of 1/5, to the nearest integer? 24 What is 7379004 to the power of 1/3, to the nearest integer? 195 What is the cube root of 745434 to the nearest integer? 91 What is the square root of 9891293 to the nearest integer? 3145 What is the third root of 221217 to the nearest integer? 60 What is the eighth root of 3596228 to the nearest integer? 7 What is the ninth root of 17864076 to the nearest integer? 6 What is 43842 to the power of 1/10, to the nearest integer? 3 What is 433476 to the power of 1/7, to the nearest integer? 6 What is 407326 to the power of 1/2, to the nearest integer? 638 What is 785777 to the power of 1/5, to the nearest integer? 15 What is the tenth root of 39710 to the nearest integer? 3 What is 620399 to the power of 1/3, to the nearest integer? 85 What is 335353 to the power of 1/3, to the nearest integer? 69 What is 152966 to the power of 1/3, to the nearest integer? 53 What is the cube root of 16021913 to the nearest integer? 252 What is the third root of 84933 to the nearest integer? 44 What is 2170848 to the power of 1/7, to the nearest integer? 8 What is the square root of 134850 to the nearest integer? 367 What is 13707908 to the power of 1/2, to the nearest integer? 3702 What is 37576006 to the power of 1/2, to the nearest integer? 6130 What is the square root of 5456436 to the nearest integer? 2336 What is 3933747 to the power of 1/7, to the nearest integer? 9 What is 3237 to the power of 1/2, to the nearest integer? 57 What is the third root of 3185648 to the nearest integer? 147 What is the square root of 313161 to the nearest integer? 560 What is 2451182 to the power of 1/2, to the nearest integer? 1566 What is the tenth root of 589735 to the nearest integer? 4 What is the square root of 1650433 to the nearest integer? 1285 What is 8312889 to the power of 1/2, to the nearest integer? 2883 What is the fourth root of 614149 to the nearest integer? 28 What is 931052 to the power of 1/9, to the nearest integer? 5 What is the square root of 4212190 to the nearest integer? 2052 What is 111094 to the power of 1/4, to the nearest integer? 18 What is 225413 to the power of 1/7, to the nearest integer? 6 What is 2842140 to the power of 1/3, to the nearest integer? 142 What is the square root of 3115523 to the nearest integer? 1765 What is 950738 to the power of 1/9, to the nearest integer? 5 What is the square root of 644711 to the nearest integer? 803 What is 2302329 to the power of 1/6, to the nearest integer? 11 What is the third root of 51295 to the nearest integer? 37 What is the cube root of 1491840 to the nearest integer? 114 What is 2313872 to the power of 1/3, to the nearest integer? 132 What is the cube root of 231049 to the nearest integer? 61 What is 3413358 to the power of 1/2, to the nearest integer? 1848 What is 349560 to the power of 1/2, to the nearest integer? 591 What is the seventh root of 1087841 to the nearest integer? 7 What is 2766941 to the power of 1/6, to the nearest integer? 12 What is the cube root of 3224074 to the nearest integer? 148 What is the eighth root of 250782 to the nearest integer? 5 What is 1204792 to the power of 1/2, to the nearest integer? 1098 What is 13474635 to the power of 1/2, to the nearest integer? 3671 What is 185949 to the power of 1/3, to the nearest integer? 57 What is 155820 to the power of 1/8, to the nearest integer? 4 What is 284810 to the power of 1/8, to the nearest integer? 5 What is the third root of 309066 to the nearest integer? 68 What is the fifth root of 9510059 to the nearest integer? 25 What is the cube root of 150085 to the nearest integer? 53 What is the tenth root of 1371305 to the nearest integer? 4 What is 1273642 to the power of 1/2, to the nearest integer? 1129 What is the fourth root of 766483 to the nearest integer? 30 What is the square root of 178227 to the nearest integer? 422 What is 376172 to the power of 1/2, to the nearest integer? 613 What is 9259913 to the power of 1/2, to the nearest integer? 3043 What is the square root of 5702932 to the nearest integer? 2388 What is the third root of 7633400 to the nearest integer? 197 What is the square root of 744521 to the nearest integer? 863 What is 114356 to the power of 1/2, to the nearest integer? 338 What is 47924 to the power of 1/2, to the nearest integer? 219 What is 949665 to the power of 1/4, to the nearest integer? 31 What is the third root of 1862967 to the nearest integer? 123 What is 32908 to the power of 1/4, to the nearest integer? 13 What is 246914 to the power of 1/2, to the nearest integer? 497 What is the seventh root of 38782509 to the nearest integer? 12 What is the square root of 134155 to the nearest integer? 366 What is 508972 to the power of 1/3, to the nearest integer? 80 What is 11042645 to the power of 1/2, to the nearest integer? 3323 What is 47444 to the power of 1/2, to the nearest integer? 218 What is the third root of 430519 to the nearest integer? 76 What is 1134363 to the power of 1/9, to the nearest integer? 5 What is the sixth root of 12398583 to the nearest integer? 15 What is 1828718 to the power of 1/5, to the nearest integer? 18 What is 105885 to the power of 1/5, to the nearest integer? 10 What is the fourth root of 731825 to the nearest integer? 29 What is the third root of 1155178 to the nearest integer? 105 What is 12436875 to the power of 1/2, to the nearest integer? 3527 What is the eighth root of 1178751 to the nearest integer? 6 What is the cube root of 3607916 to the nearest integer? 153 What is the square root of 29986368 to the nearest integer? 5476 What is the seventh root of 19657214 to the nearest integer? 11 What is 22871263 to the power of 1/3, to the nearest integer? 284 What is the fourth root of 197339 to the nearest integer? 21 What is 34855042 to the power of 1/3, to the nearest integer? 327	{ "pile_set_name": "DM Mathematics" }
es next: -1199, -1221, -1241, -1259, -1275, -1289? -1301 What comes next: -81, -136, -191, -246, -301? -356 What is next in 37726, 75435, 113128, 150805, 188466, 226111? 263740 What comes next: 68, 207, 440, 767, 1188, 1703, 2312? 3015 What is next in 33, -30, -159, -372, -687, -1122, -1695, -2424? -3327 What is the next term in -271, 110, 743, 1628, 2765, 4154? 5795 What comes next: -1291, -2616, -3965, -5338, -6735? -8156 What is next in 731727, 1463454, 2195181, 2926908, 3658635? 4390362 What is the next term in -5120, -5102, -5084? -5066 What is next in 59152, 59270, 59466, 59740? 60092 What is next in -1511, -1960, -2709, -3758? -5107 What comes next: -569, -1136, -1717, -2318, -2945? -3604 What is next in 82, 35, -80, -293, -634? -1133 What is the next term in -107, -282, -523, -830? -1203 What is next in -199, -419, -639, -859? -1079 What is the next term in -8, 66, 188, 358, 576, 842? 1156 What comes next: -282248, -282245, -282240, -282233, -282224? -282213 What is the next term in 224, 278, 364, 482, 632, 814? 1028 What is next in 2396, 3168, 3940, 4712, 5484? 6256 What is the next term in 3602, 3959, 4554, 5387, 6458, 7767? 9314 What is next in 50594, 50591, 50588, 50585, 50582? 50579 What is the next term in 8914, 17759, 26604? 35449 What is the next term in 2931, 5859, 8781, 11697, 14607, 17511, 20409? 23301 What is the next term in -1812, -3082, -4352, -5622, -6892? -8162 What is next in 435, 928, 1759, 2928, 4435? 6280 What comes next: 650, 1192, 1510, 1490, 1018, -20, -1738? -4250 What is the next term in -358, -313, -192, 41, 422, 987, 1772? 2813 What is the next term in -10114, -20464, -30812, -41158, -51502, -61844, -72184? -82522 What is next in -1337, -1307, -1289, -1289, -1313? -1367 What comes next: 318690, 1274785, 2868276, 5099163, 7967446, 11473125, 15616200? 20396671 What is next in 264, 1108, 2518, 4494, 7036, 10144? 13818 What is the next term in -1525, -1538, -1555, -1570, -1577, -1570? -1543 What is next in -27, 0, 33, 66, 93, 108, 105? 78 What is the next term in 119189, 119199, 119223, 119267, 119337, 119439, 119579? 119763 What is the next term in -39249, -39252, -39257, -39264, -39273? -39284 What is next in -2701, -5353, -8005, -10657, -13309? -15961 What is the next term in -4830, -4875, -4920? -4965 What comes next: -31098, -31103, -31108, -31113, -31118? -31123 What comes next: 79, 90, 45, -68, -261, -546? -935 What is next in 29, -94, -305, -610, -1015, -1526, -2149, -2890? -3755 What comes next: -151, -816, -1481, -2146, -2811, -3476? -4141 What comes next: -5026, -10047, -15066, -20083, -25098, -30111, -35122? -40131 What is the next term in -205, -1669, -5661, -13447, -26293, -45465, -72229? -107851 What comes next: -98, -126, -140, -140, -126, -98? -56 What comes next: -50919, -101840, -152761, -203682, -254603, -305524? -356445 What comes next: -7404, -7389, -7360, -7317, -7260, -7189, -7104? -7005 What is next in 80, 30, -52, -160, -288, -430, -580? -732 What is next in -843, -1012, -1479, -2394, -3907, -6168? -9327 What is the next term in -8838, -8836, -8834? -8832 What comes next: -471, -3706, -12481, -29562, -57715, -99706? -158301 What comes next: 106779, 106773, 106755, 106719, 106659, 106569? 106443 What comes next: 218, 792, 1752, 3098, 4830? 6948 What comes next: -4862, -4876, -4892, -4910, -4930, -4952, -4976? -5002 What is next in -1204, -2147, -2836, -3277, -3476, -3439, -3172, -2681? -1972 What is next in -2646990, -2646992, -2646994, -2646996, -2646998? -2647000 What comes next: -66, -144, -282, -486, -762, -1116? -1554 What comes next: 208, 596, 984? 1372 What is next in -1351, -2283, -3837, -6013, -8811? -12231 What is next in -28430, -28428, -28426, -28424, -28422? -28420 What is next in 3044, 5884, 8724, 11564, 14404? 17244 What is next in -315, -477, -651, -843, -1059, -1305, -1587, -1911? -2283 What is next in 1469, 5860, 13171, 23396, 36529, 52564? 71495 What is the next term in 64651, 129304, 193957, 258610, 323263, 387916? 452569 What comes next: -28671, -28653, -28635, -28617? -28599 What is next in -33, -183, -331, -477, -621? -763 What is next in -7458, -7335, -7212, -7089, -6966, -6843? -6720 What comes next: 796, 843, 948, 1135, 1428, 1851? 2428 What is next in -14246, -28492, -42738, -56984, -71230, -85476? -99722 What comes next: -651247, -651246, -651245, -651244, -651243, -651242? -651241 What comes next: 138, -13, -226, -513, -886, -1357, -1938, -2641? -3478 What is the next term in 554, 552, 564, 590, 630, 684? 752 What is the next term in 379, 1569, 3555, 6337, 9915, 14289? 19459 What is next in 53928, 107851, 161774, 215697, 269620, 323543? 377466 What is next in -152, -184, -216? -248 What is next in -3434, -3290, -3066, -2768, -2402, -1974, -1490, -956? -378 What is next in -57199, -228740, -514633, -914872, -1429451, -2058364, -2801605? -3659168 What is next in 2530, 2536, 2542, 2548, 2554? 2560 What is next in -265, -507, -753, -1003? -1257 What comes next: -567858, -567859, -567860, -567861, -567862, -567863? -567864 What is next in 167, 406, 647, 890, 1135? 1382 What comes next: -2840, -5722, -8634, -11582, -14572, -17610, -20702? -23854 What comes next: 4108, 7917, 11726, 15535, 19344? 23153 What comes next: -257203, -257202, -257201, -257200, -257199, -257198? -257197 What is the next term in 398636, 398632, 398626, 398618? 398608 What is next in 1771, 3725, 5683, 7645? 9611 What is next in -43652, -174595, -392834, -698369? -1091200 What is the next term in 22401, 22400, 22391, 22368, 22325, 22256? 22155 What is next in -411, -570, -985, -1782, -3087, -5026? -7725 What comes next: -1196, -1179, -1134, -1049, -912, -711? -434 What is next in -195446, -195442, -195438? -195434 What is next in 3075637, 6151275, 9226915, 12302557? 15378201 What is next in 10403, 10409, 10421, 10439? 10463 What is the next term in 399, 401, 403, 405, 407, 409? 411 What is next in -19575, -78313, -176219, -313299, -489559, -705005, -959643, -1253479? -1586519 What comes next: -2334, -4674, -7020, -9372, -11730? -14094 What is next in 127924, 127922, 127920? 127918 What is next in -177, 258, 1463, 3822, 7719, 13538, 21663? 32478 What is next in 23, 79, 165, 281, 427, 603, 809? 1045 What is next in 1214, 1253, 1326, 1439, 1598, 1809? 2078 What is next in -28800, -28796, -28792, -28788? -28784 What is next in -2250, -2237, -2224? -2211 What comes next: 134, 117, 86, 41, -18, -91? -178 What is next in -174208, -348411, -522612, -696811? -871008 What is the next term in 133, 242, 315, 352? 353 What is next in 101, 230, 383, 548, 713, 866? 995 What is the next term in -2043, -8150, -18329, -32580? -50903 What comes next: -90631, -362542, -815717, -1450150, -2265835, -3262766, -4440937? -5800342 What is next in -394, -412, -422, -424, -418? -404 What is the next term in -212, -224, -236, -248, -260, -272? -284 What comes next: -2671, -5283, -7881, -10459, -13011, -15531, -18013, -20451? -22839 What is next in 14, 205, 706, 1667, 3238, 5569? 8810 What is the next term in 578, 1217, 1886, 2585, 3314, 4073, 4862? 5681 What is the next term in -1449, -2870, -4289, -5706, -7121, -8534? -9945 What is the next term in -6430, -6526, -6686, -6910, -7198, -7550? -7966 What is next in -596, -1163, -1694, -2171, -2576, -2891, -3098? -3179 What is next in -1549, -1555, -1561, -1567, -1573, -1579? -1585 What is next in 23081, 46164, 69247? 92330 What comes next: -18424, -36842, -55258, -73672, -92084? -110494 What is next in -1769, -3493, -5211, -6923, -8629, -10329, -12023? -13711 What is the next term in 607, 574, 479, 292, -17? -478 What is next in -2258, -4349, -6436, -8519, -10598, -12673? -14744 What comes next: -3267, -6499, -9731, -12963, -16195? -19427 What is the next term in 469066, 469067, 469068? 469069 What is next in 1978, 1949, 1904, 1837, 1742, 1613, 1444, 1229? 962 What is next in -9460, -9456, -9452, -9448? -9444 What is next in 457, 400, 253, -26, -479, -1148, -2075? -3302 What is next in -109338, -109339, -109340, -109341, -109342, -109343? -109344 What is next in -900, -1802, -2704, -3606? -4508 What is next in 39, 54, 43, 6, -57, -146? -261 What is next in -381, -1446, -3205, -5652, -8781? -12586 What is the next term in -303, -1169, -2599, -4581, -7103? -10153 What is	{ "pile_set_name": "DM Mathematics" }
0sqrt(5) + 162576 Simplify (-4sqrt(88)-1-4)/(3-2sqrt(8)6). 4sqrt(11)/9 Simplify (sqrt(104)/(sqrt(4) - (sqrt(4) + sqrt(4)2 + sqrt(4))))/(sqrt(2) + sqrt(2) + (-3sqrt(18))/sqrt(9) - sqrt(2)) + 3. sqrt(13)/6 + 3 Simplify 5(-5 + sqrt(1008) + 0 + 4). -5 + 60sqrt(7) Simplify ((sqrt(119) - (-2sqrt(119)2 - sqrt(119)) - (sqrt(119)-2 - sqrt(119))1)/((sqrt(896)-5)/sqrt(8)))2. 1377/400 Simplify ((2(sqrt(7) + sqrt(21)/(sqrt(6)/sqrt(2)) + sqrt(7)) - -3(sqrt(7)2 - sqrt(7))*25) + 5)-2. -220 - 12sqrt(7) Simplify -5 + (sqrt(76) - (0 + sqrt(76)-4))2 + 5. 1900 Simplify (-6sqrt(40)/sqrt(2) - (sqrt(20) - (sqrt(20) + sqrt(80)/sqrt(4)))3)/(sqrt(8)/sqrt(2)4 - sqrt(64)/sqrt(4)). -3sqrt(5)/2 Simplify (sqrt(224)/(2sqrt(567)) + (3 + sqrt(128)/sqrt(4) - ((sqrt(2048) - -1sqrt(2048)) + sqrt(32))))2. -1148sqrt(2)/3 + 659681/81 Simplify (-6(sqrt(343) - 1sqrt(343)) - -2sqrt(343)-4)*2 + 4 + -2sqrt(343) + -3. -14sqrt(7) + 21953 Simplify -1(-5 + -4(1sqrt(98) + sqrt(98)) + 0 + sqrt(98)2)2. -3553 - 420sqrt(2) Simplify ((sqrt(5000) + 1)*2 + -2)33. 900sqrt(2) + 44991 Simplify (3(51sqrt(132) - sqrt(132)))/(sqrt(132)/(sqrt(11)1) - ((sqrt(120) - sqrt(120)-1) + sqrt(120))/sqrt(10)). -6sqrt(11) Simplify -6(sqrt(2156) + 2) + sqrt(2156)-1-2. -56sqrt(11) - 12 Simplify ((sqrt(3) - (sqrt(3) + -1))-2 - sqrt(36)/(sqrt(24)/sqrt(2)))-1-6. -12 - 6sqrt(3) Simplify (-6sqrt(228)2 - (sqrt(228) - (sqrt(228)-24 + sqrt(228))))/(sqrt(84)/(sqrt(7) + (sqrt(7) + (sqrt(7) - sqrt(252)))3)). 220sqrt(19) Simplify (-1 + (5(sqrt(36) + sqrt(144)/sqrt(4) + sqrt(36)))/(-5-4(sqrt(48) - sqrt(3))))2. -sqrt(3) + 7/4 Simplify ((-5sqrt(104) - sqrt(104))5)/((sqrt(8) - sqrt(8)2)-3). -10sqrt(13) Simplify (((sqrt(18))*2 + sqrt(2))35 - (sqrt(648) + -1 + sqrt(648))2)-3. -261sqrt(2) + 6969 Simplify (3-3(2 + sqrt(68)))2 + (-1 + sqrt(68))2 + -1 + (sqrt(68) - ((sqrt(68) + -1)2 + sqrt(68))) + 4. 648sqrt(17) + 5835 Simplify ((sqrt(140) - 1sqrt(140) - sqrt(140)) + sqrt(35) + sqrt(35) + (sqrt(35) + sqrt(140))2)/(sqrt(14)/sqrt(2)-56). -sqrt(5)/5 Simplify (sqrt(75)/sqrt(3))/sqrt(5)-3 - ((sqrt(4455)-1 + sqrt(4455))/sqrt(11))*2. -3sqrt(5) Simplify sqrt(162)/(4(sqrt(6)2 - sqrt(6))) - -4(sqrt(1323) + -1sqrt(1323))*2. 3sqrt(3)/4 Simplify sqrt(51)/(sqrt(3) - 1sqrt(3)6) - (1 + sqrt(68) + -2). -11sqrt(17)/5 + 1 Simplify 6((0 + -2sqrt(19))-1 - (2(2sqrt(2736) + sqrt(2736)))*2). -590976 + 12sqrt(19) Simplify (0 + 1(2(sqrt(18)5 + sqrt(18)) - sqrt(18))/sqrt(9))2. 242 Simplify (4 + -53sqrt(1053) + 3 + sqrt(1053)-1 + 2 + 0 + sqrt(1053))*2. -2430sqrt(13) + 237006 Simplify (((1 + sqrt(2448) + -5)-2 + 5 + 1)5)*2. -16800sqrt(17) + 249700 Simplify ((sqrt(196)3)/(2(sqrt(7) + sqrt(567)))-3)2. 567/100 Simplify ((2 + sqrt(700))-5)*2 + ((sqrt(7) - (sqrt(7) + 1))5 - (-1 + sqrt(700) + sqrt(700))). 980sqrt(7) + 17596 Simplify ((sqrt(200) + sqrt(200)1)4 + -3)2 + -3 + 1sqrt(200) + -2. -470sqrt(2) + 12804 Simplify (1 + -4 + sqrt(153))2 - (2 + (sqrt(153)-3)*2). -1217 - 18sqrt(17) Simplify (4sqrt(143)-14)/((sqrt(132)-2-3)/sqrt(12)). -8sqrt(13)/3 Simplify -3((sqrt(1053)1)*2-6 + -5 + 1). 18966 Simplify (-5(2 + 4 + 4(sqrt(75) + sqrt(75) + (sqrt(75)-2 - sqrt(75)))) + 3)2. -5400sqrt(3) + 30729 Simplify 2((sqrt(56)1)/sqrt(7)5 + 2). 4 + 20sqrt(2) Simplify 3 + (5 + sqrt(10)/sqrt(2) + sqrt(5) + 1 - 22(1 + sqrt(5))*2). -15 - 6sqrt(5) Simplify (-1 + sqrt(245) - sqrt(80)-6)2 + 5 + sqrt(5) + 1 + 1 + sqrt(5) + (sqrt(20)/sqrt(4) + 5)2 + -3. -50sqrt(5) + 4840 Simplify -2 + (sqrt(450) + 5 - sqrt(350)/(sqrt(7)-2)). 3 + 35sqrt(2)/2 Simplify (-5(-5 + sqrt(14)/(-1sqrt(567))-1))2. -250sqrt(2)/9 + 50675/81 Simplify (3 + sqrt(117) + sqrt(117) + sqrt(65)/(sqrt(15)/sqrt(3)))*2 + 4. 42sqrt(13) + 650 Simplify (1 + sqrt(272) - sqrt(272)) + (sqrt(34)/sqrt(2)-1)2 - (4(2sqrt(68) - (1 + sqrt(272))))2. 2 Simplify (6(1-2sqrt(133) - sqrt(133)))/((2(sqrt(35) + sqrt(140)/sqrt(4)))/sqrt(5)). -9sqrt(19)/2 Simplify (sqrt(2401) - -1sqrt(2401)-2)/(sqrt(35)/(sqrt(5)-2) - 4sqrt(112)). 14sqrt(7)/33 Simplify ((-4(sqrt(170) + -1sqrt(170)))/(-2sqrt(10)4))2 + 3(-2 + (sqrt(17) - (sqrt(51)/sqrt(3) - sqrt(17))))-1. -3sqrt(17) + 6 Simplify -5 + 5sqrt(68) + sqrt(68) + sqrt(68) - (-6(sqrt(119) - sqrt(119)-4) + sqrt(119) + sqrt(119))/sqrt(7). -5 + 42sqrt(17) Simplify 1 + sqrt(114)/sqrt(6) + sqrt(19) + 0 - (-1sqrt(950))/sqrt(2). 1 + 7sqrt(19) Simplify (sqrt(119)-5-1)/(sqrt(7) + sqrt(126)/sqrt(2)) + 2. 2 + 5sqrt(17)/4 Simplify (sqrt(16)1-2)/(4sqrt(1152)). -sqrt(2)/24 Simplify (sqrt(40) + sqrt(2560)-6)/(5sqrt(72)). -47sqrt(5)/15 Simplify -1 + (((sqrt(1539) + 1 - sqrt(1539))-1 - sqrt(1539))*2 - sqrt(1539)) + (1sqrt(1539) + 5 - sqrt(1539)) + -1. 9sqrt(19) + 1543 Simplify (sqrt(50)-2 - (sqrt(8) + 1))*2 - (-1 + (-5(sqrt(2) + sqrt(2)-2))2). 24sqrt(2) + 240 Simplify -3 + (sqrt(700) - (-3 + sqrt(700) + sqrt(700) + 0)*2) + ((3 + 2 + sqrt(700))-5)*2. 2630sqrt(7) + 15313 Simplify (sqrt(51)/(sqrt(33)/(3sqrt(11))))2 + -3sqrt(425) + -3. -15sqrt(17) + 150 Simplify -3(((sqrt(171)-2)/sqrt(9) - sqrt(342)/sqrt(2))4 + 2)*2. -22812 + 240sqrt(19) Simplify (sqrt(12) + -3)-5-5 + 1(sqrt(363) - (0 + sqrt(363) + 0))2. -75 + 50sqrt(3) Simplify ((sqrt(480)/sqrt(300))/sqrt(8))*2 + sqrt(180) + -1sqrt(180) + -2. -9/5 Simplify 5(-4 + sqrt(405)) + ((sqrt(10) - sqrt(10)-1)/sqrt(2) + sqrt(5))*2 + sqrt(80)1. 25 + 49sqrt(5) Simplify -5(sqrt(54)/sqrt(3)4 + ((sqrt(4)1)/sqrt(2) + sqrt(2) - sqrt(72))*2). -160 - 60sqrt(2) Simplify (14sqrt(931) + 3)*2 + (sqrt(931)4-5)26. 168sqrt(19) + 2249305 Simplify -5(sqrt(13)-1 + -4 - (-2 + -1 + sqrt(13))). 5 + 10sqrt(13) Simplify ((2sqrt(6) + sqrt(6))3)/(sqrt(3) + sqrt(12)-5 + sqrt(3)) + (sqrt(540)/sqrt(10))/(-2sqrt(27)). -13sqrt(2)/8 Simplify ((sqrt(112)-4 - sqrt(112) - sqrt(112))/sqrt(8))/(sqrt(1134)/sqrt(2)). -2sqrt(2)/3 Simplify (-1 + (sqrt(288) - (sqrt(288) - (sqrt(288)-3 - sqrt(288)))) - sqrt(288))*2 + (sqrt(64) - 2sqrt(64)-3)/sqrt(8). 134sqrt(2) + 7201 Simplify (2 + sqrt(11) + -1)*2 + -2sqrt(22)/sqrt(2) + (1sqrt(11) + -3 - sqrt(11))2 + (sqrt(11) + -1)5. 16 + 5sqrt(11) Simplify 4(3(sqrt(18)/sqrt(2))/sqrt(3) + ((sqrt(3) + (sqrt(48) - sqrt(3)))-3 - (-1 + sqrt(12) + sqrt(3))))*2. -96sqrt(3) + 1732 Simplify (sqrt(33) + 4sqrt(1617) + sqrt(1617))/(sqrt(275) - (-2sqrt(275) - sqrt(275)) - sqrt(275)). 12sqrt(3)/5 Simplify (sqrt(84)/(sqrt(63)2 - sqrt(7)))/(sqrt(20)/(sqrt(20)/(sqrt(4)2))). sqrt(3)/10 Simplify sqrt(88)/(sqrt(32)/sqrt(4)3) - (1sqrt(1584) - sqrt(1584))-5. sqrt(11)/3 Simplify (-1(sqrt(30) + sqrt(90)/sqrt(3)))/(sqrt(6) + sqrt(162)/sqrt(3) + sqrt(6)) + -5. -5 - 2sqrt(5)/5 Simplify -2 + sqrt(448)4 + (sqrt(42)/(sqrt(66)/(-3sqrt(11) + sqrt(11))))*2. 26 + 32sqrt(7) Simplify (2 + (4 + -2sqrt(500) + sqrt(500))2-5)-4. -1600sqrt(5) + 10312 Simplify (3(sqrt(200)-2 - sqrt(200))/sqrt(10) - (-2 + sqrt(60)/sqrt(3)2))6. -132sqrt(5) + 12 Simplify ((sqrt(208) + 1)3)*2 + -1sqrt(117)2. 66sqrt(13) + 1881 Simplify 5-6-2((0 + sqrt(891))6)*25. 9622800 Simplify sqrt(40)/(sqrt(88)/(-1sqrt(11))) - (-1sqrt(160))/sqrt(2). 3sqrt(5) Simplify -3(((sqrt(4212) + sqrt(52))6)/(sqrt(32)/sqrt(2)))2. -35100 Simplify 3(-5 + sqrt(1008)1)2-6. -18594 + 2160sqrt(7) Simplify 4((sqrt(528) + sqrt(528)2)-6)/(-54sqrt(9)/sqrt(3)). 72sqrt(11)/5 Simplify 2(-61sqrt(4500))/(sqrt(576) - -2sqrt(576)5). -15sqrt(5)/11 Simplify (sqrt(833)-3 + 2 - sqrt(833) - (5 + 0 + sqrt(833)))*2. 210sqrt(17) + 20834 Simplify (-4(-1(sqrt(98) + 0) - sqrt(98) - (sqrt(98) + -21sqrt(98) + sqrt(98)))-1)2. 6272 Simplify ((-32sqrt(272) + sqrt(272))/sqrt(8))/(sqrt(18)-1 - sqrt(2) - (sqrt(14) + sqrt(42)/sqrt(3))/sqrt(7)). 5sqrt(17)/6 Simplify (1 + -1 + sqrt(1300) + 3(sqrt(1300) + -1sqrt(1300)) + -4 + -3)2. -140sqrt(13) + 1349 Simplify 5(sqrt(114)/(sqrt(6) + sqrt(96)) + 1) + -4 + (3-1sqrt(1216))2. sqrt(19) + 10945 Simplify (3(2 + -4 + 3sqrt(147) + sqrt(147) + 4) + 1)2. 1176sqrt(3) + 21217 Simplify ((-1sqrt(1900) + 0)5 + 4 + -4 + 3sqrt(1900))*2. 7600 Simplify -1 + sqrt(252) + sqrt(63) + -1 + sqrt(175)	{ "pile_set_name": "DM Mathematics" }
icrograms? 859828300000000 How many millimeters are there in 31121.15 meters? 31121150 What is eleven halves of a day in hours? 132 What is 128.2521km in meters? 128252.1 How many years are there in fifty-two fifths of a decade? 104 How many kilometers are there in 0.2752289 centimeters? 0.000002752289 What is 26/7 of a week in minutes? 37440 How many millilitres are there in 1/20 of a litre? 50 What is twenty-five halves of a century in years? 1250 What is 8973.242 years in months? 107678.904 How many micrograms are there in 3/50 of a gram? 60000 What is 5.349061 weeks in hours? 898.642248 What is 671607.1km in nanometers? 671607100000000000 How many seconds are there in 1/28 of a week? 21600 What is 0.0011177 millennia in years? 1.1177 How many minutes are there in 8711.252 days? 12544202.88 What is 1.702723us in milliseconds? 0.001702723 What is 0.070391g in kilograms? 0.000070391 What is 97898.96l in millilitres? 97898960 What is 72752.51 nanograms in tonnes? 0.00000000007275251 How many minutes are there in 9039.921 seconds? 150.66535 What is one fifth of a gram in milligrams? 200 Convert 0.5021201 micrograms to kilograms. 0.0000000005021201 How many tonnes are there in 5321.325mg? 0.000005321325 What is 201.8505 months in millennia? 0.016820875 What is 8/3 of a minute in seconds? 160 Convert 1362.032 seconds to milliseconds. 1362032 Convert 85237.75 milligrams to grams. 85.23775 How many milliseconds are there in 7/4 of a second? 1750 How many millilitres are there in 6/5 of a litre? 1200 How many decades are there in 73602.72 millennia? 7360272 What is one quarter of a litre in millilitres? 250 What is 11/2 of a litre in millilitres? 5500 What is 0.4030778 grams in milligrams? 403.0778 How many milligrams are there in 11/10 of a gram? 1100 What is one twentieth of a millisecond in microseconds? 50 What is 5.645816 milliseconds in seconds? 0.005645816 What is 2526.672t in milligrams? 2526672000000 What is 7/4 of a century in years? 175 Convert 83075.949ms to days. 0.0009615271875 What is 55.5253 centimeters in micrometers? 555253 What is 64/5 of a meter in centimeters? 1280 What is 12854.331 months in years? 1071.19425 How many grams are there in 7/4 of a kilogram? 1750 What is twenty-six fifths of a decade in years? 52 How many millilitres are there in 366633.1l? 366633100 What is seven halves of a week in minutes? 35280 What is five eighths of a kilometer in meters? 625 What is 17877.57l in millilitres? 17877570 Convert 9.131295 microseconds to seconds. 0.000009131295 How many months are there in one quarter of a century? 300 What is 147.3538 centuries in years? 14735.38 What is nineteen quarters of a milligram in micrograms? 4750 What is three tenths of a microgram in nanograms? 300 What is fourty-nine quarters of a meter in millimeters? 12250 What is 1/5 of a century in months? 240 How many micrograms are there in 61.86252 nanograms? 0.06186252 What is 2.237418 centuries in decades? 22.37418 How many minutes are there in 5/4 of a hour? 75 What is 997.9016 nanograms in milligrams? 0.0009979016 How many tonnes are there in 423698.6 micrograms? 0.0000004236986 What is fifty-five quarters of a kilogram in grams? 13750 How many millilitres are there in 25/4 of a litre? 6250 How many years are there in six fifths of a millennium? 1200 How many nanograms are there in 569116.9mg? 569116900000 Convert 816.331um to meters. 0.000816331 How many months are there in 9835.684 centuries? 11802820.8 What is 982.0421us in seconds? 0.0009820421 What is 7/4 of a millisecond in microseconds? 1750 What is 2056.095 meters in millimeters? 2056095 How many months are there in 3/5 of a century? 720 What is 37/2 of a centimeter in millimeters? 185 How many years are there in 6/25 of a century? 24 Convert 0.7087645 micrograms to nanograms. 708.7645 How many kilograms are there in twenty-five quarters of a tonne? 6250 What is 6/25 of a microsecond in nanoseconds? 240 What is 1/4 of a day in hours? 6 How many seconds are there in 3/40 of a week? 45360 What is 0.301914mg in nanograms? 301914 How many tonnes are there in 4.563689 kilograms? 0.004563689 What is three fifths of a micrometer in nanometers? 600 What is 69648.34 milligrams in nanograms? 69648340000 What is eleven halves of a litre in millilitres? 5500 How many micrometers are there in thirty-three fifths of a centimeter? 66000 What is 5.649175 years in millennia? 0.005649175 What is 27/2 of a day in minutes? 19440 What is 6799.8 centuries in millennia? 679.98 How many micrograms are there in one fifth of a milligram? 200 What is 4/3 of a minute in milliseconds? 80000 How many months are there in thirteen quarters of a millennium? 39000 How many milligrams are there in six fifths of a gram? 1200 How many milligrams are there in 5/4 of a gram? 1250 Convert 80.95157 decades to millennia. 0.8095157 How many seconds are there in three fifths of a hour? 2160 How many grams are there in 683.3098 tonnes? 683309800 What is one quarter of a kilometer in centimeters? 25000 What is one twentieth of a minute in milliseconds? 3000 Convert 0.8625603 nanoseconds to microseconds. 0.0008625603 What is 815.1076ml in litres? 0.8151076 How many months are there in 3/40 of a decade? 9 How many grams are there in 284.2119ng? 0.0000002842119 What is 272.5264 nanograms in micrograms? 0.2725264 How many millennia are there in 3661.601 centuries? 366.1601 How many minutes are there in 1410.4632ms? 0.02350772 How many millilitres are there in twenty-seven quarters of a litre? 6750 How many micrometers are there in 33/5 of a millimeter? 6600 What is 7989.444 litres in millilitres? 7989444 How many millilitres are there in 296481.3l? 296481300 How many millilitres are there in 6.2733 litres? 6273.3 How many micrometers are there in 5/8 of a millimeter? 625 Convert 0.3907931 millennia to months. 4689.5172 What is one twentieth of a millimeter in nanometers? 50000 What is twenty-seven quarters of a kilometer in meters? 6750 What is 43/2 of a litre in millilitres? 21500 How many nanograms are there in 6/5 of a microgram? 1200 What is seventeen quarters of a week in hours? 714 How many hours are there in 403.16886 microseconds? 0.00000011199135 What is 0.7898925 decades in years? 7.898925 What is 55/4 of a meter in millimeters? 13750 Convert 3.431407 decades to millennia. 0.03431407 What is fourty-six fifths of a century in months? 11040 Convert 7565.68us to milliseconds. 7.56568 What is 99239647.5s in weeks? 164.08671875 What is one twentieth of a litre in millilitres? 50 What is five sixths of a millennium in months? 10000 Convert 8678.836 centimeters to meters. 86.78836 How many milligrams are there in 786433.7 grams? 786433700 What is six fifths of a gram in milligrams? 1200 What is 558.7206g in milligrams? 558720.6 What is 7380.824mg in micrograms? 7380824 How many centimeters are there in fifty-four fifths of a meter? 1080 Convert 5956.668 weeks to minutes. 60043213.44 What is 0.2675552 kilograms in milligrams? 267555.2 What is 18/5 of a milligram in micrograms? 3600 How many millilitres are there in nineteen quarters of a litre? 4750 How many microseconds are there in 68.57884 milliseconds? 68578.84 How many kilometers are there in 27.71372cm? 0.0002771372 How many litres are there in 14.02507 millilitres? 0.01402507 How many millilitres are there in 0.2979581 litres? 297.9581 Convert 7.422579 millilitres to litres. 0.007422579 How many millilitres are there in 51/2 of a litre? 25500 Convert 5282.602 years to centuries. 52.82602 How many millilitres are there in eleven halves of a litre? 5500 What is 0.6051153l in millilitres? 605.1153 Convert 0.7348166 days to microseconds. 63488154240 How many seconds are there in 3007.675 hours? 10827630 What is 50.76147 litres in millilitres? 50761.47 What is one twentieth of a meter in millimeters? 50 How many months are there in one sixth of a year? 2 What is sixty-one quarters of a micrometer in nanometers? 15250 What is fifty-three quarters of a milligram in micrograms? 13250 How many tonnes are there in 427253.8g? 0.4272538 What is 532503.2l in millilitres? 532503200 How many microseconds are there in 72.40341 minutes? 4344204600 How many millilitres are there in 1/10 of a litre? 1	{ "pile_set_name": "DM Mathematics" }
is divided by z. 35 Suppose 355399 = 171v - 62380 + 84842. Calculate the remainder when v is divided by 5. 2 Let r(f) = -f2 + 243f + 180. What is the remainder when r(0) is divided by 135? 45 What is the remainder when ((-43276)/31)/(2 + -8)3 is divided by 3? 2 Suppose j - 14 = -10, -3w + j = -185. What is the remainder when 1194 is divided by w? 60 Let z = 69 - -157. Suppose 5j - 4l - 66 = 13, -j - 1 = -5l. Calculate the remainder when z is divided by j. 17 Let q be 3 + 2 + 1 + -3. Suppose -24 = -3s - 3z, qs = 5s - z - 22. Suppose -211 = -6r - 37. Calculate the remainder when r is divided by s. 9 Let p(f) = -f*3 + 10f*2 - 13f - 17. Suppose -3r - 2 + 36 = 5d, 3r = -6. Let l be (10 - 11)/((-1)/d). What is the remainder when 33 is divided by p(l)? 5 What is the remainder when ((-45)/40)/((-108)/23616) is divided by 56? 22 Suppose 86j - 91j + 6498 = 2b, 4b - 13032 = -4j. Calculate the remainder when b is divided by 233. 2 Let a(b) = b*3 - 17b*2 - 273b + 9. Calculate the remainder when 1887 is divided by a(-8). 108 Suppose 606 = x + 3q, -2x + 364q = 366q - 1200. What is the remainder when x is divided by 195? 12 Suppose 4v - 2a = -14, 7v + 2a - 2 = 5v. Let r = 64 + v. Suppose 0 = 2b - 3b + 32. Calculate the remainder when r is divided by b. 30 Let j = -73 - -213. Let m(u) = 21u + 465. Calculate the remainder when j is divided by m(-21). 20 Let b(u) = -2u2 - 4u - 3. Let m be b(0). Let i be (((-558)/(-15))/m)/(1/(-5)). Suppose 2g + i = 3g. Calculate the remainder when g is divided by 13. 10 Let t be 118/(9/((-27)/(-6))). Suppose 54c - tc = -10. Let y = 54 - c. What is the remainder when y is divided by 11? 8 Let c(y) = -y*3 - 14y*2 + 12y - 15. Let t be c(-15). Suppose 42z = 40z + t. Let a = -330 - -508. What is the remainder when a is divided by z? 13 Suppose 3j = 2j. Let h(o) be the third derivative of -o*6/120 + 133o*3/6 - 132o*2. Calculate the remainder when h(j) is divided by 34. 31 Suppose -101u + 15652 = 145u - 74u. Suppose -2a - 4k + 94 = 0, -a + 54 = 4k + 7. What is the remainder when u is divided by a? 44 Suppose -46a + 11782 = -13702. Calculate the remainder when a is divided by 10. 4 Suppose -t + 69 = 4m + 4t, -5t = -4m + 99. Suppose 219 = 3j + m. Let r = j + -35. Calculate the remainder when r is divided by 8. 7 Suppose 3x - v + 1560 = 8x, 4x + 2v = 1242. Let r = 338 - x. Calculate the remainder when r is divided by 19. 6 Let a(i) = -6i*3 - 52i*2 - 53i + 18. What is the remainder when 656 is divided by a(-8)? 98 Suppose -856m = -651m - 343990. What is the remainder when m is divided by 35? 33 Suppose 0 = -4p - 3x + 18, 4x = 2p - x + 4. Suppose 5t + 280 = 3f, -35f + 32f = pt - 288. Calculate the remainder when f is divided by 24. 23 Let v = -2175 + 2298. What is the remainder when v is divided by 106? 17 Suppose 0 = 5x - 1532 - 883. Calculate the remainder when x is divided by 99. 87 Let s be 8 - (7 + 315) - 2. Let z = 627 + s. Calculate the remainder when z is divided by 8. 7 Suppose 0 = 4w - a - 136, 3w - 42 = -5a + 83. Suppose -2m + 16 - 2 = 2l, 3l + w = 5m. Calculate the remainder when 143 is divided by m. 3 Let l = -10011 + 10047. What is the remainder when 1148 is divided by l? 32 Let u = -20 + 13. Let j(p) = -p3 - 4p*2 - 7. Calculate the remainder when j(u) is divided by 36. 32 Suppose 14j = 1152 + 7331 + 1261. Calculate the remainder when j is divided by 50. 46 Suppose -154u = -27998 - 453714. What is the remainder when u is divided by 149? 148 Suppose 0 = 4x - 2t - 75 - 35, -2t - 2 = 0. Calculate the remainder when 1302 is divided by x. 6 Let v(d) = -19d - 19d - 15 + 43d. Let z = -66 - -78. What is the remainder when v(7) is divided by z? 8 Suppose -245a + 249a - 2348 = 0. Calculate the remainder when a is divided by 56. 27 Suppose 3w = -0w - 5h - 3, -w + 2h = -10. Suppose -3q - 4s + 146 = 0, ws = 23 - 15. What is the remainder when 127 is divided by q? 35 Let a be 18(40/6)/4. Suppose s = -9s + a. Calculate the remainder when (-14)/(-77) + s/((-66)/(-326)) is divided by 3. 0 Suppose 0 = -5t + 4f + 1599, 484f - 488f - 642 = -2t. Suppose -5c + 270 - 110 = 0. Calculate the remainder when t is divided by c. 31 Let s = -173 - -242. Let v = s - 52. What is the remainder when 29 is divided by -1 - (2 - (v - -1))? 14 Suppose 8n + 1875 = -1405. Let p = -379 - n. What is the remainder when p is divided by 7? 3 Let v(u) = 5u*2 + u - 13. Suppose 2 = -i - 3. Let h be v(i). Let j = 181 - h. What is the remainder when j is divided by 11? 8 Suppose 1074 = 2q - 198. Let m = 771 - q. Calculate the remainder when m is divided by 17. 16 Let d(q) = 22q2 + 31q - 340. Calculate the remainder when d(8) is divided by 55. 51 Let x = -3 + 2. Let f(n) be the first derivative of -73n2/2 + n + 260. Calculate the remainder when f(x) is divided by 19. 17 Suppose 10l = 44l - 4l - 9930. Calculate the remainder when 583 is divided by l. 252 Let u = -750 + 1474. Let t = 136 - 103. What is the remainder when u is divided by t? 31 Let c = -12315 + 19452. What is the remainder when c is divided by 59? 57 Let f(v) = 997v - 3741. Calculate the remainder when f(4) is divided by 38. 19 Let d(r) = -4r*3 - 9r*2 - 6r + 17. Calculate the remainder when d(-3) is divided by 1 - (1 - -9)-2. 20 Let n(z) = z3 + 21z*2 + 9z + 12. Calculate the remainder when n(-19) is divided by 182. 17 Suppose -g - 113 = 3n - 26, -4g = 0. Let j = n + 38. What is the remainder when j is divided by 6? 3 Let x(i) = i*2 + 12i + 27. Let t be x(-3). Suppose -5y = 2u + 85 - 238, t = 4y + 12. Calculate the remainder when u is divided by 22. 18 Let a(p) = p - 5p + 4 + 0p + 5p. Let b be a(0). Suppose 0 = j + 2f - b, -5j + 24 + 6 = 5f. Calculate the remainder when 44 is divided by j. 4 Suppose 585 = -o + 6o. Suppose -160 = 12q - 2q. Let t(h) = 4h + 88. What is the remainder when o is divided by t(q)? 21 Suppose -34 = -2j + 2c, -5j + j + 59 = -c. Calculate the remainder when (-2)/3306/(-12) is divided by (-5 + (-27)/(-6))/((-1)/j). 3 Suppose 0 = -4i + 10 - 2. Let n(u) = 29u3 - 3u*2 + 2u + 3. What is the remainder when n(i) is divided by 46? 43 Let o be 96 - 91 - (-305 - 2/(-2)). Let s = o + -220. Calculate the remainder when s is divided by 26. 11 Let q be (-8(-7)/(-42))/(2/3). What is the remainder when 64 is divided by ((-14)/(-4) + q)/(6/60)? 4 Let h = 1120 - 1120. Suppose -45 = -7a + 2a. Calculate the remainder when a is divided by 0/4 + 4/1 - h. 1 Suppose 6915 + 2178 = 21q. Let w = q + -191. Calculate the remainder when w is divided by 63. 53 Let h = 346 - 365. What is the remainder when 31 is divided by (25/25)/((-1)/h)? 12 Suppose 0 = -2f - 2t - 6, -26 = -2f - t - 29. Suppose f = m - 3c, 3m - 8c = -6c + 28. Calculate the remainder when 42 is divided by m. 6 Let q(h) = -h2 + 5h + 61. Let l be q(11). What is the remainder when 153 is divided by (40 - -1)/(-6 + (l - -12))? 30 Suppose 1252 + 852 = 60j - 416. Calculate the remainder when 50 is divided by j. 8 Suppose -b = 5, 0 = 4r - 2b + b - 5. Suppose r = 10w - 31w + 1554. What is the remainder when w is divided by 19? 17 Let z = 242 + 43. Suppose -6g + 9g - z = 0. Let y = -76 + g. Calculate the remainder when 93 is divided by y. 17 Let x = 67 + -65. Let m(h) = 16h*2 - 19h*3 - 31 - 5h*x + 5h - 15h3 + 35h*3. What is the remainder when m(-7) is divided by 12? 10 Suppose -11m + 49 = -4m. Suppose 3t - 210 = -0t. Let a = -50 + t. What is the remainder when a is divided by m? 6 Let j(g) = 4g*3 + 6g*2 + g - 6. Let k be j(-4). Let o = k + 323. Calculate the remainder when 113 is divided by o/4 - 3/12. 37 Let n(s) = -136s + 40s + s2 + 70s + 97. Calculate the remainder when n(24) is divided by 33. 16 Let u be (74/(-4))/((-2)/(-4)). Let v be 48/(-4)(-1 - (-18)/4). Let i = u - v. Calculate the remainder when 13 is divided by i. 3 Let l = -36 + 73. Suppose 4k = 2b - 8, -k = -4b + 2b + 8. Suppose 2y = br - 4 + 16, -5y + 3r = -44. Calculate the remainder when l is divided by y. 7 Suppose 0 = d + 5x - 3, -3d + 0x - 5x = -19. Suppose 6a - 5p = 3a + 73, -2*p + d = 0. Calculate the remainder when a is divided by 16. 15 Suppos	{ "pile_set_name": "DM Mathematics" }
0 Find the second derivative of 2i3t*2 + 961i*2t*2 - 1547i*2 + 154it - 5279t*2 wrt i. 12it2 + 1922t*2 - 3094 What is the second derivative of -36652d*2w - 2dw - 3d - 95w + 6 wrt d? -73304w What is the second derivative of -2154793f*5 + 1553616f + 2? -43095860f3 What is the second derivative of 37i*2x*3 - 2i*2x*2 - 5i*2x + 56i2 + 2ix3 + 90ix2 - 61x*3 wrt i? 74x*3 - 4x*2 - 10x + 112 What is the second derivative of 3829p3 - 6p - 1928? 22974p Find the second derivative of -229qs3 + qs - 4q - 255s*2 + 2s + 792 wrt s. -1374qs - 510 What is the second derivative of -6l5 - 3226l*3 - 2l*2 - 1548l + 8 wrt l? -120l3 - 19356l - 4 What is the second derivative of 13d5 - 9276d3 + d2 - 56596d wrt d? 260d*3 - 55656d + 2 What is the second derivative of 50b4 + 752b*3v + 8bv + 5332b wrt b? 600b*2 + 4512bv What is the third derivative of -27956d*2l*3 - 95d*2l*2 + 49l*3 + 2803l*2 wrt l? -167736d*2 + 294 Find the second derivative of 520832d*2q*3 + 3dq3 - 91dq2 + 70dq wrt d. 1041664q*3 Differentiate 140994b*3l*2 - 104483b*3 wrt l. 281988b*3l What is the third derivative of 92416f3 + 2079f*2 + f? 554496 Find the third derivative of -24701g*5 - 47129g*2 - 1 wrt g. -1482060g*2 What is the second derivative of -33790u*2 - 5124u wrt u? -67580 Find the first derivative of 2m2t - 210813m2 - 2mt2 - 77068mt wrt t. 2m*2 - 4mt - 77068m Find the second derivative of -4753610g3 + 275g - 334. -28521660g Find the second derivative of 2mu5 + 26673mu3 + 92694m - 2u wrt u. 40mu3 + 160038mu Find the third derivative of g6 - 2g*4 + 201016g*3 - 427g*2 - 2077 wrt g. 120g*3 - 48g + 1206096 What is the first derivative of -4c3i - 82c2i - 4ci - c + 29625i + 2 wrt c? -12c*2i - 164ci - 4i - 1 Find the second derivative of 2557b*2v*4 - 20374b*2v - 3bv*4 wrt v. 30684b*2v*2 - 36bv2 What is the derivative of -4716n*2 + 59475? -9432n Find the third derivative of 5kl*3w*2 - 924kw2 + 5kw - 186l*3w*2 - 31l*3w + 2l2w - 2lw wrt l. 30kw*2 - 1116w*2 - 186w Find the second derivative of -101100z4 + 60z - 3442 wrt z. -1213200z2 What is the third derivative of 3977f*5 + 2f*4 - 2f*3 + 27520f*2? 238620f*2 + 48f - 12 What is the second derivative of f*3r - 2f3 + 3446f*2r + 36fr - 11f - 2r - 5 wrt f? 6fr - 12f + 6892r Find the second derivative of -115g3 - 6287g*2 + 15947g - 61. -690g - 12574 What is the second derivative of -1128165a*2 + 12950a + 2 wrt a? -2256330 Find the second derivative of 188782u3z*2 - 1750uz + u + 8z*2 wrt u. 1132692uz2 What is the first derivative of -56jr2 + 18jr - 544681j - 30r2 - r wrt r? -112jr + 18j - 60r - 1 Find the first derivative of -2j*3t - 88j2t + 5j2 - 62665t wrt j. -6j2t - 176jt + 10j What is the third derivative of kv*2x*4 + 903kv2x - 55754kx*4 - 2v*2x*2 + 2v*2x + 6 wrt x? 24kv*2x - 1338096kx Differentiate -4461643k - 2445347 wrt k. -4461643 What is the third derivative of -a2f*3w + 4167a2fw4 + 1523a*2f - 10af*3w*4 - 4w*2 wrt w? 100008a*2fw - 240af3w Differentiate -2408c3k*2 + 13265c3 + c2 + ck4 wrt k. -4816c*3k + 4ck*3 What is the first derivative of 90j*2 + 3339j + 3402994? 180j + 3339 Find the third derivative of -74584b*3c*3r*2 - 2b*3r*2 + 66962b*2cr2 + 2bc3r wrt b. -447504c3r*2 - 12r*2 Find the second derivative of 13098v*3 + 41566v. 78588v Find the first derivative of -1952b*2lr + 23blr - 85908lr wrt b. -3904blr + 23lr What is the third derivative of a3b2 - a3bd - 567a3d*2 + 88a*2bd2 + 3a*2b + ab2d + 3b2 wrt a? 6b*2 - 6bd - 3402d*2 What is the second derivative of 14331j*3p - 2j3 + 358jp - j + p wrt j? 85986jp - 12j Find the second derivative of 37h2jx + 76h*2j + 2hjx + 2hj + 4hx - 29j - 17 wrt h. 74jx + 152j Find the second derivative of -y4 - 590y*3 - 295y*2 - 517612y. -12y2 - 3540y - 590 Find the third derivative of -3024n6 + 2n*3 - 23n*2 - 2n - 29. -362880n3 + 12 Find the third derivative of -7n*3z*3 + 14n*3 + 4n*2 - nz*2 - 68n + 7859z3 wrt z. -42n*3 + 47154 Find the second derivative of 6k*2o3 + k2o - 21ko3 + 900ko2 - 548ko - 28 wrt o. 36k*2o - 126ko + 1800k What is the second derivative of -a2p3 - a2 - 25ap*3 - 6ap + 762a + 134p2 - 3p wrt p? -6a2p - 150ap + 268 What is the derivative of -320k3 + 3k*2 - 167k - 1463800? -960k2 + 6k - 167 What is the third derivative of 23442q6 - 351q*2 + 33? 2813040q*3 Find the first derivative of -308z*2 + 48z - 48167. -616z + 48 Find the second derivative of -6595o5 + o2 - 205o + 25. -131900o*3 + 2 Find the second derivative of -100779jr3w*2 - jr*2w + 2jr*2 + 2r*3w*2 + 21601r*3w wrt w. -201558jr*3 + 4r*3 What is the second derivative of -456405i*3x*2 + 13i*3 + 3i*2x + 23ix - 2 wrt x? -912810i3 What is the derivative of 47w*3 + 80w*2 - 6w + 150778? 141w2 + 160w - 6 What is the third derivative of 41n3y3 + n3y2 + 405n*2y*6 + 13ny2 + 8y wrt y? 246n3 + 48600n*2y*3 What is the second derivative of 66857m*4 - 2m - 9044? 802284m2 What is the third derivative of -422984c*3u*3 + 2c*3 + 8c*2u*3 + 20208cu3 - u2 wrt c? -2537904u*3 + 12 Find the second derivative of 942c*2x*3 + 441c*2x*2 + 2c*2x - 2cx*3 + 49cx + 2c - 3 wrt c. 1884x3 + 882x*2 + 4x Find the third derivative of -3225743y6 - y4 + 62462y*2 + 3y - 4 wrt y. -387089160y3 - 24y What is the second derivative of 1315g3 - 83g*2 - 32387g - 17? 7890g - 166 What is the derivative of -181475py - 415y + 170 wrt p? -181475y What is the derivative of 2705076p - 619382? 2705076 Differentiate 2162j3m*3 + 3jm3 - 1004m*3 - 11m*2 with respect to j. 6486j*2m*3 + 3m*3 Find the second derivative of 966t*3v*2 - 14t*2v*2 + tv*2 + 2tv - t - 1581v wrt t. 5796tv*2 - 28v*2 What is the third derivative of 447a*2c*5 + 1819a*2c*2 + 8ac6 + 7c*2 wrt c? 26820a*2c*2 + 960ac3 Find the first derivative of s2v*3 - 5353s*2 - 40308v*3 wrt s. 2sv3 - 10706s What is the third derivative of 2229047i3j2 + i2j2 - 491767i*2 wrt i? 13374282j*2 Find the second derivative of 1917b*3 + 9b*2 - 200b + 184. 11502b + 18 Find the second derivative of -2g*5 - 49359g*3 + 80008g - 3 wrt g. -40g3 - 296154g What is the second derivative of 58f5 - 637f*2 - 77f + 107? 1160f3 - 1274 Find the second derivative of 1011705c*2 + 454923c. 2023410 What is the first derivative of -6008d2z - 3961837d2 + 2dz - 8z wrt z? -6008d2 + 2d - 8 Find the second derivative of 183r5 - 7r*3 + 12r*2 - 2264807r wrt r. 3660r3 - 42r + 24 What is the third derivative of -171838g6 + 30378g*2? -20620560g*3 Find the third derivative of 1501012d*3 - 6289434d*2. 9006072 What is the derivative of -138557i*2 - 175366? -277114i Differentiate -4pq*2 - 497pq - 944256p + 2q2 + 67q with respect to q. -8pq - 497p + 4q + 67 What is the third derivative of -7b2z*5 + 4b*2z*2 + 2b*2z - 341bz*2 - 4750z*5 + 2 wrt z? -420b*2z*2 - 285000z*2 Find the second derivative of -26809f*2k*2 + 696f*2 + k wrt k. -53618f*2 What is the second derivative of -919243y*2 - 1110015y wrt y? -1838486 Find the second derivative of 83904w4 + 2w*2 + w + 46375. 1006848w*2 + 4 Find the third derivative of 99z*5 - 1892z*4 + 360z*2 - 80 wrt z. 5940z*2 - 45408z What is the second derivative of -2n5 - n3 - 10188n*2 - 109n - 151? -40n3 - 6n - 20376 What is the second derivative of -5608fz*2 - 6fz - 538f + 7z2 + 1 wrt z? -11216f + 14 Find the second derivative of -561p3v*2 + 2p*3v + 1937p3 - 4p*2v*2 - 2p*2v + 10p + 5v*2 wrt v. -1122p**3 -	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.