Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
j? True Suppose -4d + 140 = 4m, 3d - 7d + 135 = 5m. Let w be 3d/(-12) + 4. Which is smaller: w or -1? w Let m = 0.3 + -0.2. Let n = -36 + 9. Let h = 28 + n. Do m and h have different values? True Suppose -l + 3z - 5 = 5, 4z = 16. Suppose -2j = -5j. Suppose -2k - 3t - 4 = j, k - 17 + 8 = 4t. Is l smaller than k? False Let x be 18237/(-42) - 6/(-16)-4. Let i = x - -435. Which is smaller: -1 or i? -1 Suppose 0 = -2q + 2j - 176, -8q + 6q = 4j + 170. Let u = q - -88. Which is greater: 9/4 or u? 9/4 Let x = 239/623 - -4/89. Is x > 0? True Let o(h) be the first derivative of h4/12 - h3/6 + h2/2 - 12. Let a(r) be the second derivative of o(r). Let q be a(0). Which is bigger: q or 2/15? 2/15 Let r be ((-24)/156 - (-189)/(-39)) + 8. Which is smaller: -90 or r? -90 Let r(o) = 23o - 67. Let c be r(3). Which is greater: 14/9 or c? c Let p = 27 + -23. Suppose -pa + h + 21 + 1 = 0, 2a + 2h - 16 = 0. Let l(n) = n2 - 8n + 12. Let t be l(a). Are t and -0.06 unequal? True Let q be 8/(-16) - 14/(-4). Suppose -3s = -2s - 2b + 9, -qs + 28 = 5b. Is s greater than or equal to 3? False Suppose 2o = 5f - 82 + 13, -5f + 63 = -4o. Let q = 15 - f. Let b be (5 + q)(-4)/50. Which is greater: b or 1/3? 1/3 Let c(j) = -j*2 - 3j - 2. Let n be c(-4). Let h be (((-4)/n)/2)/(2/(-6)). Which is smaller: h or 2/217? h Let p = 45.6 + -123.4. Let u = p + 78. Is u >= -12? True Let u = 18 + -26. Let o be ((-6)/8)/(33/u). Is o less than or equal to -1? False Let b = -328 + 330. Is b > 13? False Suppose 0 = 5f + 11 + 74. Let z = 47 + -66. Which is bigger: f or z? f Suppose -4q - 70 = -9q + 5v, -2q = 2v - 28. Let f be 4/(-14) - ((-438)/q + 1). Which is greater: f or 31? 31 Let k be (-8 + -2)4/8. Let p(x) = x3 + 6x*2 + 5x - 2. Let z be p(k). Let c be z/(-2) - (-52)/4. Which is greater: 13 or c? c Let f be 2/(-7) - 774/(-63). Let m = 1 - f. Let j = m + 11. Which is smaller: 1/26 or j? j Let z = -5.2 + 8.5. Let g be (10/(-35))/((-16)/28). Is g bigger than z? False Let u = -1262 - -169109/134. Let k = -333/268 - u. Is k at least 3? False Let m be (-9)/18(1 - 11). Let y = m + -7. Let r be 6/(-32)(-42)/(-7). Which is smaller: r or y? y Suppose 3w - 82 = -2y + 122, -y + 107 = -w. Which is smaller: y or 423/4? y Let a = 102 - 59. Let c = -48 + a. Which is bigger: 2 or c? 2 Let f = -2/29 - 129/232. Which is greater: -1 or f? f Let r(k) = 2k2 - 13k + 3. Suppose -d = 2b - 2 - 5, -5b = 2d - 15. Let a be r(d). Which is smaller: -13 or a? -13 Let j = 0.108 - 1.316. Let h = j + 0.208. Let n be 42(-1 + 3/2). Which is smaller: h or n? h Let k = -13210/3111 - -2/183. Which is greater: -4 or k? -4 Let z = 2530 + -2530.45. Which is smaller: 6/13 or z? z Let b be 4 + 2 + (-210)/37. Does -1 = b? False Let u = 1459/418 - -2/209. Which is greater: 5 or u? 5 Let u be (-33)/(-2)(2 + (-112)/24). Do -50 and u have different values? True Let w = 0.1164 + -11.1164. Is w >= 53? False Suppose -1 = -4y + 3. Let p be 8/(1 + -2)-1. Is y <= p? True Let v = -61 - -90. Let r = 29.1 - v. Which is bigger: -1.4 or r? r Let s be (-2)/(-10) + 2349/405. Which is bigger: s or 50/9? s Let m be ((-1392)/84)/(590/4). Let z = -10/59 - m. Let g be 0/(2/1)1. Is g <= z? False Let s be (-2 + 3)/((-3)/21). Let m be s/(21/(-6)) + -2. Suppose 2u + 6 = -mu. Is -1/4 bigger than u? True Let a = 22986/2147 + -282/113. Is a < 9? True Suppose g - 34 = 2q, 0 = 5q - 3g + 2g + 79. Is -0.1 not equal to q? True Let r be 4 + (193/2)/(10/1). Let i = r + -49/4. Is i at least as big as 0? True Let o(u) = u*2 + u - 6. Let h = -28 + 31. Let k be o(h). Is k < 6? False Suppose 0 = 3c - 2c - 17. Let s = 15 - c. Is s greater than 0? False Let z = 403 - 218. Is z at least 185? True Let i = 11.82 + -12. Let j = i - -0.18. Let l = -3 - j. Are l and 0.2 nonequal? True Suppose -10 = -4k - k. Suppose -kg = 3l - 12, -3l - 63 = -4g - 3. Let y be (-19)/2 + 18/g. Is -7 smaller than y? False Let u(i) = -i - 14. Let d be u(-19). Suppose 8 = do + 3. Is o bigger than 9? False Let i = 33556/51 + -658. Is -1 greater than i? False Suppose -5c = r + 2r - 11, -c - 2r = 2. Suppose cm = 6 + 2. Let l be 0/11 - m/2. Is l < -4? False Let l = 22 - 19. Suppose -i - 4 = -2u, -i - 1 = lu - 2. Is u at most as big as -1/46? False Let y be (0 - -5) + 0/3. Let p be -3 + 1 + (y - 3). Let w = -125/2 - -1373/22. Which is greater: w or p? p Let h(m) = m2 + 4m + 5. Let x be h(-3). Let o be 0 + -3 - (x - 33). Suppose i = 5i + o. Do -5 and i have the same value? False Let s = 2 + -3. Let t be -2 + (-5 + 3)42. Let h = 84 + t. Which is greater: h or s? s Let t = -1149 + 1111. Which is greater: 4 or t? 4 Suppose -10 = 5f - 55. Let t = f + -23. Is -13 at most as big as t? False Let q = -108 + 110. Suppose -qh = h + 5d + 36, 0 = 2d. Is -11 <= h? False Let w(a) = -9a + 41. Let p be w(-17). Which is smaller: 195 or p? p Let v(b) = 4b*2 - 2b + 3. Let k be v(-2). Let x = k - 24. Let o = -21/2 - -103/10. Which is greater: x or o? o Let d = 77161982/1819 - 42420. Is 1 greater than d? True Let s be 1((-11395)/(-2275) - 5). Which is smaller: s or 0? 0 Let g = 202 + -199. Is g less than 399? True Let y be (9 - 1327416/66372) + 11. Is -1 less than y? True Let i(y) = 5y - 8. Let v = 57 - 64. Let s be i(v). Is s not equal to -43? False Suppose 53 = -4v + 3z, 5v + 2z + 60 = 7z. Which is bigger: -15 or v? -15 Let u = -518 - -516.1. Which is smaller: u or -11/9? u Let i(c) = c3 + 9c*2 + 8c - 5. Let a = -4 + -4. Let p be i(a). Let u(d) = -d*3 - 6d*2 - 5d. Let w be u(p). Which is greater: -2 or w? w Let q(y) = y*2 + y - 19. Let c be q(4). Which is bigger: 1/1429 or c? c Let n = 23 - 37. Which is smaller: -1/3 or n? n Let w be (-3)/1 + 0 - -3. Suppose 9 = -3k + 5t - wt, 9 = 3t. Let g = -14 + 19. Which is bigger: g or k? g Suppose -z - 3z = -4y - 16, 4y + 5z = 20. Suppose 0 = -3g - 5q - 11, -3g + 25 = -yq - 4q. Suppose -u + 7 = j, 5j - 39 = -0u - gu. Is j at most 8? False Let j = -0.22 - 2.18. Let c = j - -2.5. Let g = -1/67 + -62/335. Which is greater: g or c? c Let p = -35 - -43. Suppose -p = -6f - 176. Let x be 1005/(-35) + (-4)/14. Is x smaller than f? True Let r = 1.93 + -2.1. Let y = 0.25 + r. Which is bigger: y or 0.1? 0.1 Suppose s = -10t + 11t - 289, 4s + 1171 = -t. Which is smaller: s or -293? -293 Let d(i) = -i3 + 10i*2 + i - 2. Let a(l) = -3l*3 + 41l*2 + 5l - 8. Let x(p) = -2a(p) + 9d(p). Let j be x(3). Does j = -15? False Let d be (-10)/15(-60)/(-8). Let t be d/(180/8)3. Is t < -0.4? True Let t = -257 - -772/3. Is -7/8 <= t? True Suppose 10 = -2q, 0 = -4m + 5m + 3q. Suppose 4o - 2t - 6 = 0, -5o - m = -o + 5t. Let n be ((-2)/39)/(3/9). Which is bigger: n or o? o Suppose -170v + 151v = 1862. Which is smaller: 1/2 or v? v Let c(s) = -s*3 + 30s*2 - 46s + 74. Let i be c(28). Is 354 at most i? True Let t(n) = -16n - 122. Let s be t(-25). Is 278 equal to s? True Let y = 28 + 34. Let n = y + -62.8. Let c(v) = v. Let u be c(-1). Is n at least u? True Let v = -8 - -5. Suppose 11z - 7 + 20 = -31. Which is smaller: z or v? z Suppose 0 = a - 2t - 11, 0t - 3t = 0. Suppose -ao = -4o - 70. Let k = 12 - o. Does k = 3? False Suppose -j + 7 = -0j. Suppose -5x + 16 = -jx. Is x > -10? True Let p = 37 + -554/15. Is 1 equal to p? False Let m be 1 + -4 - (16/6 - 4). Is m greater than or equal to 1? False Suppose 8a + 4x + 20 = 13a, 0 = -a - 4x - 20. Which is smaller: 3.5 or a? a Let j = 1/1575 - 5734/1589175. Is j at most 1? True Let g = 98 + -50. Suppose 9v - g = 3v. Suppose 2s = 4w + w - v, 4w = -2s + 10. Is 1/21 greater than s? False Let p = -897 - -898. Let y = -50 - -30. Is y >= p? False Let g be 1/(-7) - (-299)/182. Is -6 > g? False Suppose 7p - 360 = 12p. Let l be (2072/(-102))/((-4)/p). Let m = l + 366. Which is smaller: 1 or m? m Suppose -22 + 62 = -20l. Does l = 148? False Let r = 544/13 + -16838/403. Which is bigger: -0.7 or r? r Let j = -9 + 15. Suppose 0 = 2u + t + j, 2t = -3t + 10. Let w(k) = k*3 + 3k2 - k + 5. Let g be w(-4). Is g greater than or equal to u? False Let b(v) = -v2 - 16v - 9. Let u be b(-16). Let n be 3/(-9)u - 10. Let s be (n/(-4))/(18/144). Are 14 and s unequal? False Let n be 3/(9/26)*(-3)/(-2). Supp	{ "pile_set_name": "DM Mathematics" }
What is the fourth smallest value in 0.3, -1/4, -3, -0.1282? 0.3 Which is the biggest value? (a) 2.7 (b) 5 (c) 458 c What is the third biggest value in -1/12, 157, 5, -5, 9, 13? 9 Which is the second biggest value? (a) -2/17 (b) -13 (c) 3 (d) 9 (e) 1/2 c Which is the biggest value? (a) -0.06 (b) 90/11 (c) 0.11 (d) 14 (e) 4 d Which is the second smallest value? (a) -0.4 (b) 1830 (c) -56.8 (d) 5 (e) 3 a Which is the biggest value? (a) -6/7 (b) -1 (c) -1.22 a Which is the smallest value? (a) 3/5 (b) 94 (c) 48 (d) -2 (e) -5 (f) -0.2 e What is the second biggest value in 61/4, -1/4, 31, 22/7? 61/4 What is the smallest value in 5, 5211, 2/13? 2/13 Which is the fourth smallest value? (a) 4/5 (b) 0.1 (c) -2/7 (d) 5396 (e) -4 a What is the fourth smallest value in -5/4, 0, 566, -0.5? 566 Which is the biggest value? (a) -323/4 (b) 0.5 (c) -5 b What is the sixth biggest value in 1, -1/6, 1/7, -15, 13, -0.3? -15 What is the fifth smallest value in 0, 5, 69, 1/9, 1/4? 69 What is the second biggest value in 2, -153, -0.007, 0.07? 0.07 What is the second biggest value in -25, -2, 1786? -2 What is the third biggest value in 0, 1/3, 3, -1/5, -0.014? 0 Which is the sixth biggest value? (a) 0.1 (b) 2/3 (c) -2/7 (d) -20/9 (e) -0.4 (f) 52 d What is the smallest value in 3, -3, -89, -1/2? -89 Which is the third smallest value? (a) -47 (b) -0.1 (c) -2 (d) -154 c What is the fourth biggest value in 31, 3, -0.2, 25, -2? -0.2 Which is the biggest value? (a) 4 (b) 25671 (c) 2 b Which is the second smallest value? (a) -39 (b) -0.4 (c) 8 (d) 0.1 (e) -1/4 b What is the third smallest value in -177, 343, 4? 343 Which is the smallest value? (a) 3/2 (b) -0.3 (c) 3/685 (d) 2 b Which is the fourth biggest value? (a) 1/7 (b) -2/9 (c) -94 (d) -0.5 c Which is the third smallest value? (a) -0.0969 (b) 33 (c) 0.5 b What is the fifth smallest value in -5, 5, -0.7, 2, 1, 14? 5 Which is the biggest value? (a) 5 (b) 1 (c) -10 (d) -3 (e) 4 (f) 19 f Which is the third smallest value? (a) 7 (b) -67 (c) 1044 c Which is the fifth biggest value? (a) 3 (b) -1 (c) 14 (d) 4 (e) -5/328 b Which is the second smallest value? (a) 2 (b) 0.5 (c) 73 (d) -0.054 b What is the third smallest value in -1, 3, -0.05, 0.4, -5.9? -0.05 What is the smallest value in -12, -4/5, 2/425? -12 What is the third smallest value in -1/5, -0.6, -4/83? -4/83 Which is the biggest value? (a) -0.54 (b) 2/65 (c) -4/7 (d) 2/3 d Which is the biggest value? (a) 3.24 (b) -5 (c) 5 (d) -2/59 c Which is the fifth smallest value? (a) -2 (b) 3 (c) -6 (d) -0.3 (e) 1.2 (f) 0.044 e What is the third smallest value in -3, 0.165, -1/4? 0.165 What is the second smallest value in 75, -0.3, -9, 2, -1/5, -0.5? -0.5 Which is the smallest value? (a) 0 (b) 45395 (c) -1 c What is the second biggest value in -52, -49, 5.7? -49 What is the fourth biggest value in -0.3, -0.0127, 2/15, -2, -135? -2 Which is the smallest value? (a) 0.03 (b) -1/2 (c) 4/7 (d) -169 (e) 0.2 d Which is the second biggest value? (a) 0.62 (b) 1/4 (c) 0.4 (d) -24 c Which is the second smallest value? (a) 24 (b) -7/9 (c) -27 b What is the fifth biggest value in 28, 4, 2/9, -8, -0.1? -8 Which is the smallest value? (a) 4 (b) 0.5 (c) -4 (d) 48 (e) 1/10 c What is the second biggest value in -2070, 17, 0.03? 0.03 What is the biggest value in 0.08, 1172, 1? 1172 What is the biggest value in 5, -3697, 0.32, -0.5? 5 What is the smallest value in -1333, -8, 2? -1333 What is the fifth smallest value in -0.3, 0.9, -88, -2, 3? 3 What is the smallest value in 2/29, -2/9, 5, -0.46? -0.46 What is the fourth smallest value in 3/26, 0.4, -0.9, 804? 804 Which is the second biggest value? (a) 2 (b) -75 (c) -0.046 c Which is the fourth biggest value? (a) -0.1 (b) -6670 (c) -5 (d) 4 b Which is the third smallest value? (a) -2604 (b) 9 (c) -7 b What is the fourth biggest value in 0.22, -1, -0.202, -2, -0.3? -1 What is the third smallest value in -2, -51/200, 3, 5, 2? 2 What is the second biggest value in -0.66, -5, 0.6, 2/13, 1? 0.6 Which is the fourth biggest value? (a) 4/7 (b) 2 (c) 32.12 (d) -1/4 d Which is the fourth biggest value? (a) -1 (b) -1/10 (c) -0.87 (d) 4 (e) 1 c What is the second smallest value in -0.2, -273117, 5? -0.2 Which is the third smallest value? (a) 0.4 (b) -775 (c) -2 (d) -2/5 (e) -0.2 (f) -2/9 d Which is the smallest value? (a) 49/423 (b) -4 (c) -0.2 (d) -1 b What is the second biggest value in 5, -3/8, -3, -16? -3/8 Which is the fourth biggest value? (a) -6 (b) -1/400 (c) 1/4 (d) -4 a What is the biggest value in 14, 3, -1, -0.14, -0.4, -0.7? 14 Which is the third biggest value? (a) -585 (b) 0.11 (c) 3/26 a Which is the fourth biggest value? (a) 4 (b) -1/23 (c) 6 (d) -0.2 (e) 0.05 b Which is the fourth smallest value? (a) -0.05 (b) -120 (c) 1/3 (d) 4 d Which is the second biggest value? (a) -36 (b) 1/7 (c) 1/6 (d) -9/5 (e) -0.3 (f) -1 b Which is the fourth smallest value? (a) -2/139 (b) 0.4 (c) -0.3 (d) -0.23 b Which is the smallest value? (a) 0.2 (b) -33 (c) 87 (d) -2 (e) -5 (f) -0.1 b What is the second smallest value in 0.29, 0, -48, 0.5? 0 Which is the second biggest value? (a) 669 (b) 5 (c) 0.103 (d) -0.04 b Which is the biggest value? (a) 0.31 (b) 0.151 (c) 3 (d) 116 (e) 2/9 d Which is the fifth biggest value? (a) -0.75 (b) 4/3 (c) -1 (d) -70/13 (e) 2/17 d Which is the third biggest value? (a) 1 (b) -1432 (c) 8/7 b Which is the biggest value? (a) 13215 (b) -4 (c) -0.1 (d) 1/8 a Which is the smallest value? (a) 0.1 (b) -1650 (c) -157 b What is the biggest value in 0.2, -267/73, 0? 0.2 Which is the fifth biggest value? (a) -3 (b) 5 (c) -0.9581 (d) -0.5 (e) 4 (f) -1 f Which is the second smallest value? (a) 0 (b) 74/7 (c) 49 b What is the smallest value in 89, 306, -0.1, -0.4? -0.4 Which is the second smallest value? (a) -0.021 (b) 0.04 (c) 2/47 b What is the fourth biggest value in -135, -36, -6.7, -3? -135 What is the second biggest value in -3, 0.2, 1/6, 135773? 0.2 Which is the second biggest value? (a) -2/13 (b) -308 (c) -1 c Which is the fifth biggest value? (a) -93 (b) -0.1 (c) 0.6 (d) 1/3 (e) -1/6 (f) 1/6 e Which is the biggest value? (a) -525 (b) 31/5 (c) 0.03 b What is the third smallest value in -44, -5, 53, -2, 2/5? -2 Which is the second smallest value? (a) -2/15 (b) -3 (c) -4 (d) -5/8 (e) -0.3 b What is the second biggest value in -2/5, -2, 0.1, -0.5, -0.289? -0.289 What is the second smallest value in 1/3, -48/37, 4, 0.1, -19? -48/37 What is the fifth biggest value in -0.3, -3/5, 0.09, 1/8, 0, -1? -3/5 Which is the fourth biggest value? (a) 2.4 (b) 5 (c) -36/61 (d) -1 d What is the third smallest value in 0.24, 6, -2/4251? 6 Which is the fourth biggest value? (a) -5 (b) 0.14 (c) -48 (d) 1/21 c What is the fifth biggest value in -177, -1/9, -0.2, 0.1, 8/7? -177 Which is the smallest value? (a) -0.07 (b) 25 (c) -0.5 (d) -8/7 d What is the fifth smallest value in 11/3, 0, 0.175, -0.02, 0.2? 11/3 What is the second biggest value in 0, -0.06, -2, -174/11, 0.144? 0 Which is the third biggest value? (a) 0.2225 (b) 0 (c) 27 (d) -1 b Which is the third smallest value? (a) 0.2437 (b) 3 (c) 2 b Which is the third biggest value? (a) -1 (b) -2/13 (c) -61 (d) -2/3 (e) 2/11 d What is the second biggest value in -3967, 39, -5? -5 What is the third biggest value in 1/4, -0.1, 1/6, -1/4, -5/2? -0.1 Which is the second smallest value? (a) 4611 (b) -5 (c) 1/9 (d) 0.06 d Which is the fifth smallest value? (a) 3/4 (b) 0.1 (c) 427 (d) 8/11 (e) 0.4 c Which is the fifth smallest value? (a) 3.01 (b) -3 (c) 14 (d) 2/7 (e) -18 c What is the fifth smallest value in 2/37, -16, 0, 5, -1/3? 5 Which is the third smallest value? (a) -0.04473 (b) 0.2 (c) -0.4 (d) -0.3 a What is the third smallest value in 3/2, 2/3, 187, -0.1? 3/2 Which is the second biggest value? (a) -0.5 (b) 2963/3 (c) 0 c Which is the second smallest value? (a) 3 (b) -2/15 (c) -22 (d) 1 (e) 1/72 b What is the fourth smallest value in 5/6, 1, -6.59, 3? 3 What is the second biggest value in 0.9, 0.1745, 0, -1/3, 1/3, -3? 1/3 What is the fift	{ "pile_set_name": "DM Mathematics" }
ers picked without replacement from zzenznn? 9/35 Two letters picked without replacement from {s: 7, p: 3, h: 3, w: 2}. Give prob of picking 2 w. 1/105 Two letters picked without replacement from jgddrjdd. What is prob of picking 1 j and 1 d? 2/7 Two letters picked without replacement from zzlzzlflf. What is prob of picking 1 l and 1 f? 1/6 Four letters picked without replacement from rrrrrrrkrgkgrrk. Give prob of picking 2 k and 2 r. 9/91 What is prob of picking 2 i when two letters picked without replacement from siu? 0 Calculate prob of picking 1 x and 1 v when two letters picked without replacement from vvvbxxvxvvxxkkxbbkb. 4/19 What is prob of picking 3 f when three letters picked without replacement from ffffffffffdfddfdfff? 455/969 What is prob of picking 1 w and 2 r when three letters picked without replacement from rwrbwwwrfjfjpr? 6/91 Three letters picked without replacement from hhhhhhh. Give prob of picking 3 h. 1 Calculate prob of picking 1 v and 1 c when two letters picked without replacement from gvcgc. 1/5 Three letters picked without replacement from {i: 7, v: 3, l: 2}. Give prob of picking 2 l and 1 v. 3/220 Four letters picked without replacement from {x: 2, y: 2, k: 2, s: 2}. Give prob of picking 2 k and 2 y. 1/70 Two letters picked without replacement from {k: 5}. What is prob of picking 2 k? 1 Four letters picked without replacement from {u: 1, s: 3, e: 12}. Give prob of picking 3 e and 1 s. 33/91 Calculate prob of picking 1 m and 3 w when four letters picked without replacement from kwwwmkumwuuuwwm. 4/91 Two letters picked without replacement from qbzzecjq. Give prob of picking 1 j and 1 e. 1/28 Two letters picked without replacement from vvgg. What is prob of picking 1 v and 1 g? 2/3 What is prob of picking 1 z and 1 d when two letters picked without replacement from {r: 1, d: 11, o: 4, u: 1, z: 2}? 22/171 Four letters picked without replacement from {n: 3, d: 12}. What is prob of picking 2 d and 2 n? 66/455 Calculate prob of picking 1 r and 1 i when two letters picked without replacement from {i: 2, n: 1, p: 7, v: 2, q: 1, r: 1}. 2/91 What is prob of picking 4 c when four letters picked without replacement from {u: 2, c: 9}? 21/55 Two letters picked without replacement from {r: 2, d: 3}. What is prob of picking 1 d and 1 r? 3/5 Two letters picked without replacement from {x: 2, u: 1, e: 1, r: 4}. Give prob of picking 1 e and 1 x. 1/14 Four letters picked without replacement from kkyttft. What is prob of picking 1 f, 2 k, and 1 t? 3/35 Four letters picked without replacement from {s: 6, j: 12}. What is prob of picking 4 j? 11/68 Two letters picked without replacement from edudeu. What is prob of picking 2 u? 1/15 Calculate prob of picking 1 g and 1 d when two letters picked without replacement from nngbssgndgin. 1/22 Calculate prob of picking 2 v and 1 g when three letters picked without replacement from {x: 1, z: 3, g: 4, m: 1, v: 2}. 4/165 Calculate prob of picking 1 i and 1 a when two letters picked without replacement from issaiq. 2/15 Two letters picked without replacement from {x: 7, h: 2, a: 4, e: 1}. Give prob of picking 1 x and 1 e. 1/13 What is prob of picking 2 s and 2 e when four letters picked without replacement from aeaieseiseidiisiai? 1/170 Two letters picked without replacement from {d: 3, o: 13}. What is prob of picking 2 d? 1/40 Calculate prob of picking 2 m and 1 y when three letters picked without replacement from {x: 5, y: 1, s: 11, m: 3}. 1/380 Three letters picked without replacement from uneeeuueeueee. What is prob of picking 1 n and 2 e? 14/143 Calculate prob of picking 1 n and 1 t when two letters picked without replacement from ntt. 2/3 Four letters picked without replacement from qqrxqrnxdddrqkq. Give prob of picking 2 q and 2 x. 2/273 Calculate prob of picking 1 y and 2 j when three letters picked without replacement from jygggjygy. 1/28 Two letters picked without replacement from ltlwwwwttwtwt. What is prob of picking 2 w? 5/26 Calculate prob of picking 1 t and 2 p when three letters picked without replacement from {q: 1, p: 6, t: 4, c: 2, m: 2}. 12/91 Calculate prob of picking 2 r and 2 q when four letters picked without replacement from zxrqrjqdzxrr. 2/165 Four letters picked without replacement from {c: 5, n: 9}. What is prob of picking 2 c and 2 n? 360/1001 Calculate prob of picking 3 j when three letters picked without replacement from {g: 3, j: 11}. 165/364 Three letters picked without replacement from bibpzugpu. Give prob of picking 1 p, 1 b, and 1 u. 2/21 Two letters picked without replacement from zzgwgzdzzxzwzggwdd. What is prob of picking 2 w? 1/51 Calculate prob of picking 4 b when four letters picked without replacement from hbhhbfbbbh. 1/42 Calculate prob of picking 1 z and 1 l when two letters picked without replacement from tltzxxtnxtxxtltntnt. 2/171 Two letters picked without replacement from {m: 1, y: 8, g: 2, n: 5, z: 2}. Give prob of picking 2 z. 1/153 Calculate prob of picking 4 h when four letters picked without replacement from hhhwhqww. 1/70 Two letters picked without replacement from kkkkkk. What is prob of picking 2 k? 1 Calculate prob of picking 1 i, 1 j, and 1 u when three letters picked without replacement from {u: 1, o: 3, z: 1, j: 1, i: 1}. 1/35 Calculate prob of picking 3 b when three letters picked without replacement from {b: 7, p: 3}. 7/24 Calculate prob of picking 1 r and 2 y when three letters picked without replacement from rdyyyddjjjykyjdryyy. 56/969 Calculate prob of picking 1 m, 2 j, and 1 v when four letters picked without replacement from mmmmmmmmjmmmmjvjjjmv. 52/969 What is prob of picking 4 p when four letters picked without replacement from {p: 1, d: 2, e: 1}? 0 Three letters picked without replacement from {o: 3, r: 4, b: 2, d: 1, k: 1}. Give prob of picking 1 o, 1 r, and 1 k. 4/55 Two letters picked without replacement from {i: 1, q: 7, e: 1}. Give prob of picking 2 q. 7/12 What is prob of picking 1 y and 1 a when two letters picked without replacement from {s: 1, r: 2, a: 1, y: 2, l: 1}? 2/21 Calculate prob of picking 1 b, 1 z, and 1 k when three letters picked without replacement from {z: 4, g: 8, k: 2, b: 3}. 3/85 Calculate prob of picking 2 p when two letters picked without replacement from ddpxlpxdxpddlptmppdm. 3/38 Calculate prob of picking 1 r and 3 b when four letters picked without replacement from brbbemrrbbbrbrrrbbb. 70/323 Four letters picked without replacement from kzzzzzkzkzz. What is prob of picking 3 z and 1 k? 28/55 Calculate prob of picking 2 i when two letters picked without replacement from jijjijjjjjjjjjjjjj. 1/153 What is prob of picking 2 r, 1 a, and 1 e when four letters picked without replacement from {e: 5, a: 8, r: 2}? 8/273 Two letters picked without replacement from {r: 1, e: 2, x: 1, c: 1, f: 1, u: 2}. Give prob of picking 1 e and 1 c. 1/14 Two letters picked without replacement from {m: 5, b: 2, k: 1, h: 1, q: 7, u: 4}. What is prob of picking 2 q? 21/190 Three letters picked without replacement from {d: 3, k: 4, j: 5, a: 1}. What is prob of picking 2 d and 1 k? 6/143 What is prob of picking 2 k and 1 u when three letters picked without replacement from {k: 5, l: 4, x: 1, u: 3, a: 1}? 15/182 Two letters picked without replacement from nlnn. Give prob of picking 2 n. 1/2 Three letters picked without replacement from {x: 7, u: 5, d: 4, j: 3}. Give prob of picking 3 u. 10/969 Four letters picked without replacement from {z: 4, w: 3, n: 4, x: 1, e: 4}. Give prob of picking 1 x and 3 n. 1/455 What is prob of picking 1 i and 3 s when four letters picked without replacement from {r: 2, z: 4, o: 2, i: 1, s: 3}? 1/495 Four letters picked without replacement from {p: 5, n: 2, h: 7}. What is prob of picking 4 p? 5/1001 Calculate prob of picking 2 o and 1 g when three letters picked without replacement from {d: 1, x: 4, o: 3, g: 4, v: 2}. 3/91 Four letters picked without replacement from yuuuszsuzyfsszuu. Give prob of picking 1 y, 1 f, and 2 z. 3/910 What is prob of picking 2 j when two letters picked without replacement from jjjfqft? 1/7 Two letters picked without replacement from {d: 7, v: 5}. Give prob of picking 2 d. 7/22 What is prob of picking 3 q when three letters picked without replacement from gsqqsgqsqgqqss	{ "pile_set_name": "DM Mathematics" }
18. Suppose -12o = -5o - 56. Differentiate o + tp - 2p + 5 + 4p wrt p. 5 What is the second derivative of 209u*5 + 1258u*5 + 4078u*5 - 160u + 221u5 wrt u? 115320u3 Let t(x) be the first derivative of -x5/5 - x*4/2 - 713x*2/2 + 2405x + 5750. Differentiate t(c) wrt c. -4c3 - 6c2 - 713 Let d(u) = u3 - 6u2 - 14u + 2. Suppose -8p + 32 = -4p. Let j be d(p). What is the second derivative of 96x2 - 96x*2 - 3x*3 + jx*3 + 8x wrt x? 90x Find the third derivative of -3821f*2 + 226f*6 + 3312f*2 + 731f*6 wrt f. 114840f*3 Let q(l) = 1659l*3 - 878l*2 - 85l - 5. Let h(a) = 1660a3 - 877a*2 - 102a - 6. Let b(s) = 5h(s) - 6q(s). What is the third derivative of b(w) wrt w? -9924 Let x(o) = o. Let q(c) = 54c - 50. Let b be 4-38/24. Let a(n) = bx(n) - q(n). What is the derivative of a(h) wrt h? -58 What is the derivative of -2077 + 4409p + 3966p + 4322p - 65p wrt p? 12632 Let d(y) = 22y + 46. Let r be d(-2). What is the third derivative of -55w*2 - 5w*5 + 51w*2 + 204w*2 + 8w*r + 138w*6 + 6w*5 wrt w? 16560w*3 + 60w*2 Let m(a) be the first derivative of -979a*2/2 + 1325a + 416. What is the first derivative of m(h) wrt h? -979 What is the third derivative of 82t2 + 92t*2 - 146t*5 - 163t*5 - 41t*2 wrt t? -18540t*2 Let b(g) be the third derivative of 92g*6/15 - 203g*3/6 + 351g*2. What is the derivative of b(p) wrt p? 2208p*2 Let j = 1783 - 1781. Let n(x) be the first derivative of -1/2x*4 + 0x*3 + 17x*j + 0x - 12. Find the second derivative of n(m) wrt m. -12m Let h(s) = 30s*3 - 10s*2 - 6s - 389. Let g(m) = 90m3 - 27m*2 - 17m - 1167. Let t(o) = 6g(o) - 17h(o). Find the first derivative of t(n) wrt n. 90n2 + 16n Let a(d) be the first derivative of -5d4/4 - 20d*3/3 - 2d*2 + 556d + 3990. What is the first derivative of a(m) wrt m? -15m2 - 40m - 4 Let t(u) be the second derivative of 1732u4/3 + u3/3 - 43u*2/2 + 4u + 915. What is the second derivative of t(o) wrt o? 13856 Suppose -3y + 357 = -3w, -2y - y = 2w - 362. What is the first derivative of -784m4 + ym + 28 + 782m4 + 2 wrt m? -8m*3 + 120 Let p(g) = -2523g + 141. Let k(c) = 5042c - 281. Let a(y) = -4k(y) - 9p(y). What is the first derivative of a(i) wrt i? 2539 Let n(q) be the second derivative of -4 - 12q - 38q2 - 61/6q*3. What is the first derivative of n(t) wrt t? -61 Suppose 0 = -2k + b + 2, -4k - 3b = -4b - 6. What is the second derivative of ok - 21o*2 + 3o*5 + 70o - 37o2 wrt o? 60o*3 - 114 Find the second derivative of 163 + 264z*2 - 290z*2 + 20z*5 - 7z*5 - 5z*5 + 3z wrt z. 160z3 - 52 Find the first derivative of -41 + 845s + 362 + 383 - 47 + 1442s wrt s. 2287 Suppose -5n = -31 + 6. Find the first derivative of -66 - nt2 - 47t + 7t2 + 41t wrt t. 4t - 6 Let t(x) be the second derivative of -63x*3 + 29x*3 + 63x*3 - 6x*2 + 169x. Find the first derivative of t(s) wrt s. 174 What is the derivative of -9i4 + 656 + 1000 - 782i + 74i3 + 782i wrt i? -36i3 + 222i2 Let q(p) = -p3 + 6p2 - 8p + 2. Let x be q(4). What is the first derivative of -5g + 6g*2 - 42 - 5g*2 - xg*2 + 15 wrt g? -2g - 5 Let s(r) = -2627r + 3392. Let h(v) = 1314v - 1681. Let l(y) = -5h(y) - 2s(y). What is the derivative of l(k) wrt k? -1316 Differentiate -1167 + y*2 - 2775y*3 + 77 - y - 447 + y wrt y. -8325y*2 + 2y Let a = -18177 + 18177. Let q(w) be the first derivative of aw3 + 15/2w*4 - 12w + 0w2 - 15. Differentiate q(n) wrt n. 90n*2 What is the second derivative of 8278 + 1624u*4 - 25u - 8278 wrt u? 19488u2 Let f(k) be the third derivative of 0k + 5/6k3 - 59 + k2 - 1/4k*4 - 1/2k*5. Find the second derivative of f(q) wrt q. -60 Let z(y) = -247y*3 - 51y*2 + 6y. Let u(h) = -5h2 - h. Let l be 12/60 + 3 + 28/10. Let j(w) = lu(w) + z(w). What is the third derivative of j(k) wrt k? -1482 Let r = 123 - 177. Let k = r - -60. Differentiate k - 2v2 - v2 + 6v*2 - 4v*2 with respect to v. -2v Let c = 146 + -142. Let o(r) be the first derivative of 18 + 0r2 + 0r*c + 0r*3 + r + 17/5r*5. Find the first derivative of o(d) wrt d. 68d*3 Let f = 78 - 88. Let b = f - -12. Find the second derivative of 13d - 5d - 11d*4 - bd + 26d wrt d. -132d*2 Let b = 500 - 496. Find the second derivative of 4n*4 + 110n + n*b - 98n - 6n4 - 7n*5 wrt n. -140n*3 - 12n*2 Let w(g) = 5611g*2 + 14g - 1448. Let x(y) = -11222y2 - 35y + 2895. Let k(z) = -5w(z) - 2x(z). What is the derivative of k(q) wrt q? -11222q Let q(n) be the second derivative of -59/20n*5 - 41/6n*3 + 1 + 0n*2 + 0n*4 - 3n. Find the second derivative of q(l) wrt l. -354l Let r = 89 - 85. Suppose -ry = -y - 4z - 6, y - 4z = 2. What is the third derivative of 10c6 - 28c*6 + 10c*y + 9c*2 wrt c? -2160c*3 Let g(h) = -7h + 44. Let f be g(-2). Differentiate -100p4 - 31p*4 + 31p*4 - 10 - f wrt p. -400p*3 Let h(s) = -6288s*2 - 88s + 1. Let l(p) = -18864p2 - 259p + 4. Let n(q) = 19h(q) - 6l(q). Find the second derivative of n(w) wrt w. -12576 Suppose -k - 161 = -5s, 23 = s - 3k + 2. Differentiate -145 - 144 - sg + 99 + 47g - 3g2 with respect to g. -6g + 14 Let n(i) be the third derivative of i*7/210 + 371i*6/120 - 11i*5/15 - 70i*2 + 1. What is the third derivative of n(o) wrt o? 24o + 2226 Let t(u) = -4u + 43. Let k be t(8). Find the third derivative of -kz*2 - 11z2 - z2 - 138z3 + 2z*4 + z + 13z*2 + 3z wrt z. 48z - 828 Let q(i) = -5i - 35. Let o be q(-12). What is the derivative of -o + 5k - 8k + 22k + 80 wrt k? 19 Let g(f) = 8f - 2. Let k be g(1). Suppose -1 = -kb + 11. Find the second derivative of 1472l*2 - 31l - 1472lb + 16l*4 wrt l. 192l*2 Let s be ((-1)/(-2))/((-37)/(-222)). Find the third derivative of -4602 + 4602 + 100u*2 - 51u*s wrt u. -306 Let k = 45827/11958 + 2/1993. Let j(l) be the third derivative of -23l*2 + 0 + 0l + kl3 - 9/8l*4. What is the derivative of j(x) wrt x? -27 Let f(y) be the first derivative of -4y*7/21 + 77y*4/6 - 13y + 43. Let o(i) be the first derivative of f(i). What is the third derivative of o(a) wrt a? -480a2 Let v(z) be the third derivative of 0z - 2z3 + 0 + 111z*2 + 77/30z*5 + 1/6z*4. Find the second derivative of v(b) wrt b. 308 Differentiate -316 + 7332p + 7705p + 2052p - 5378p wrt p. 11711 Let c(v) be the first derivative of 0v3 + v2 + 0v4 - 14 - 3v + 17/20v5. Let w(b) be the first derivative of c(b). Differentiate w(d) wrt d. 51d*2 Differentiate -1662 + 6973 - 1522m*2 - 26m*2 - 585m*2 - 1041m*2 wrt m. -6348m Let f(d) be the second derivative of -1/6d3 + 0 + 119d - 13/20d5 - 62d*2 + 0d*4. Differentiate f(y) wrt y. -39y*2 - 1 Let i(l) be the second derivative of 65/6l*3 + 3/14l*7 + 0l*6 + 0l*5 - 4l + 0l4 - 9 + 0l*2. What is the second derivative of i(j) wrt j? 180j*3 Let x = 2107 + -2102. Let g(t) be the first derivative of 0t*2 + 0t*x + 0t*4 + 1/3t*6 + 0t + 2/3t3 - 13. Find the third derivative of g(u) wrt u. 120u*2 Suppose -4l + 28 = 4j, 3j + 2j + l - 27 = 0. Suppose -4 = -jr + 3r. Find the second derivative of -5p + 31p2 + 29p*r - 9p*3 - 60p*2 wrt p. -54p Suppose 6z = -0 - 0. Suppose 0 = 2x - zx - 4. Find the first derivative of -13 + 43 + 30f*x - 15 wrt f. 60f Suppose m + 142 - 148 = 0. Find the first derivative of -8c2 - c2 + m - 36 wrt c. -18c Let m(c) = 4c + 26. Let j be m(-6). Differentiate -8a + 8a + 38 - 20 + 6a*j wrt a. 12a Let y(l) be the first derivative of -1165l6/6 + 2l*3/3 + 6563l*2/2 - 1268. What is the second derivative of y(v) wrt v? -23300v*3 + 4 Let d(c) = 1149c*4 - 5c*3 + 465c + 30. Let f(w) = -1148w4 + 6w*3 - 467w - 36. Let t(s) = -6d(s) - 5f(s). Find the second derivative of t(p) wrt p. -13848p2 Let c be 102(((-490)/(-15))/(-7) + 5). What is the third derivative of -cp3 - 6p*3 - 96p*3 - 213p*2 - 10p*3 wrt p? -876 Find the third derivative of -434 - 137t*6 - 129t*6 - 736t*2 + 734t*2 - 10t*6 wrt t. -33120t**3 Let u(q) be the first derivative	{ "pile_set_name": "DM Mathematics" }
a prime number? True Suppose -15q - 13q - 114233 + 2043517 = 0. Is q a prime number? True Is 26583810/308 + -1(-2)/(-28) a prime number? True Let k(f) = -7058f + 343. Is k(-2) a prime number? False Suppose 92n + 1465731 = 5738119. Is n a composite number? False Suppose 2n + 5c + 53 = 3n, n + 3c = 37. Suppose -237388 = -nb + 9b. Is b prime? False Let j(c) = -2c*3 - c - 93. Let p be j(0). Let t = 7144 + p. Is t a composite number? True Let u(h) be the third derivative of -19h*2 + 0 - 2/3h*4 + 11/20h*5 + 1/3h*3 + 0h. Is u(-9) a prime number? True Suppose 41 = 10y - 49. Suppose -3r = -r - 260. Is (r - -1)y/9 a prime number? True Suppose 4p = 2s + 1004434, 2p - 78s - 502235 = -79s. Is p a prime number? False Suppose -1097985 - 1779153 - 52551 = -189w. Is w composite? True Let s(n) = -12910n*3 + 34n + 89. Is s(-3) prime? False Suppose -3a + z = -1457687, 3z + 1196553 = 5a - 1232936. Is a prime? True Let i be 2 - (-2 - (2397 - -4)/1). Let b = -284 + i. Let k = b + -1400. Is k composite? True Suppose -d - 4d - 2q + 11799 = 0, -d + 2349 = -5q. Let z = d + -342. Is z prime? True Let d be (-13389)/(-4) + (-10)/40. Suppose 2i + 5q - d = 0, -3i - i = 5q - 6699. Is i/(-10)25/(-10) a prime number? True Let w(y) = -1752y + 1393. Is w(-57) a composite number? True Let o = -638 - -461. Suppose -2x = -0x - 3d + 127, 0 = 4x - 3d + 251. Let p = x - o. Is p composite? True Let v = 70133 - -80681. Is v prime? False Let d = 576 - -74. Let n = d + 4577. Is n composite? False Let n(c) be the first derivative of -34c*2 + 35c + 5. Let y be (-31)/4 + 12/16. Is n(y) prime? False Is 1/(((-16)/(9 - 1))/(-25414)) a prime number? False Suppose 81 - 89 = -l. Is (2874/l)/((-6)/(-136)) prime? False Suppose -40j = -36j + 20. Let u(t) be the first derivative of -5t4 - t3/3 + 5t*2 + 4t - 1. Is u(j) prime? False Suppose 4u - 20 = -3j, 2u - j = 8 + 2. Suppose uy = -2y. Suppose yx + 2x - 54 = 3k, x + k = 17. Is x a prime number? False Let z be 26/4-82. Let t = 648 - z. Let k = -253 + t. Is k a prime number? True Suppose 0 = 7b + 2b - 81. Suppose -b = -j - 2j, -3j + 83254 = 5g. Is g a composite number? False Suppose 6p - 275300 = 152614. Is p a prime number? False Let l = 1347847 - -96072. Is l a prime number? False Let g be (-2 - -3)1 + (10 - -40369). Suppose 0 = 2f + 3z - 25559 + 5365, 4f = -4z + g. Is f composite? False Suppose 0j + 5j = 70. Let r be 3242j/4(-1)/(-7). Suppose 0 = 4v - 5i - r, -2v = -8i + 12i - 830. Is v composite? False Let l = -604 + 2816. Suppose 1613 + 3862 = -15r. Let o = l + r. Is o composite? False Let q = -311 + 313. Is 109466/14(-1 + q) a prime number? False Let b(s) = -1103s + 8 + 1079s + 246s2 - 1. Is b(-8) composite? True Let g(a) = a3 + 5a*2 - 9a - 16. Let d be g(-6). Suppose -5w + 8x - 11x = -18729, -x + 7492 = dw. Is w composite? True Let z = -3630 - -11849. Is z a composite number? False Let c be (-7)/(-7)-1 - 1192. Let d = 2568 - c. Is d a prime number? True Let v = -59 - -56. Let o be (-8)/24(-3681)/v. Let t = 2610 - o. Is t composite? False Let v(z) = -1556z3 - 6z*2 - z + 2. Let t(g) = 1557g*3 + 5g*2 + g - 2. Let j(f) = 6t(f) + 5v(f). Is j(1) a prime number? False Let h(j) = 6j - 31. Let s be h(5). Let u be -3 + (s - -4) - -2. Suppose uq = 6q - 3556. Is q prime? False Suppose 3t + 553h - 1210569 = 557h, 3t - 2h = 1210551. Is t prime? True Is 67/(603/5232960) + 9 + -2 a composite number? False Suppose -19c + 18c + 5 = 0. Suppose 6u = 7u - c. Suppose 0 = j + uj - 708. Is j prime? False Suppose 19j - 4657295 - 2746792 = 1443358. Is j composite? True Let j(m) = -202581m - 1965. Is j(-2) a prime number? False Suppose 21414608 = 42p + 4937294. Is p prime? False Suppose 2t + 3706886 = 2l, -3706888 = -2l - 7t + 10t. Is l a composite number? True Let d(p) be the second derivative of -1211p3/3 - 13p*2/2 - p - 45. Is d(-2) a prime number? True Suppose -8j = 2j + 210189 - 673499. Is j a composite number? True Let f(n) = -3n*3 + 55n*2 - 37n - 40. Is f(17) prime? True Let x(m) = 38m3 - 5m*2 - 77m + 732. Is x(10) a prime number? False Let i(d) = 71d3 + 7d*2 - 12d - 33. Is i(8) a composite number? False Suppose 3d + 4g - 3 = 10, -g = 3d - 19. Let v = -30 + d. Let z(h) = -h3 - 23h*2 - 3h - 14. Is z(v) a composite number? True Let j(i) = 1192i + 1063561. Is j(0) composite? False Let x be (-5)/(-3)1059 - -7. Suppose -5w - 2671 = -3f, -f - f = w - x. Is f composite? False Let z be 2/(-13) + (-158)/(-13). Let n = 120 + z. Let k = 319 - n. Is k a composite number? True Suppose -5917365 + 10228075 = 123l - 9904031. Is l prime? False Is (-15)/(-5) + 971081 + 5 a prime number? False Suppose 0 = -3v - 5i + 10, -5v + i + 24 = 2i. Suppose 5r + 13q = 8q + 54230, 4r + vq = 43383. Is r a prime number? True Let k be ((-1)/2)/(4/162). Let o be k + (630/12)/((-3)/(-114)). Let z = o + -795. Is z prime? False Let l(s) = 2203s*2 - 6s + 6. Let b(p) = -6609p2 + 18p - 18. Let u(i) = -4b(i) - 11l(i). Is u(1) a composite number? False Let q(t) = t*2 - t - 1. Let c(j) = 4j*2 + 9j + 12. Let m(p) = c(p) - 5q(p). Let r be m(7). Suppose r = -3v + 2085. Is v a composite number? False Suppose 24h = 20h + 20256. Suppose 4q - h = 4j, 4q + j = -0q + 5089. Is q a prime number? False Let r(c) be the first derivative of c*4/4 + 2c*3/3 + 57c*2/2 + 31c + 108. Is r(23) composite? True Let f(s) = -5s3 + 29s*2 - 2s + 25. Let z(b) = 14b3 - 88b*2 + 6b - 73. Let k(y) = -17f(y) - 6z(y). Is k(-7) a composite number? False Let n be ((-20)/(-6))/(42/(-95445)). Let y = n - -11494. Is y composite? False Let z(v) = 9327v + 1652. Is z(115) a prime number? False Suppose -10o - 24 = -4. Is 11014 + (-1)/(-1) + (2 - o) a prime number? False Let k = 199237 + -70050. Is k a prime number? True Suppose 6q = 23q - 6171. Let i = q + 338. Is i a composite number? False Is ((-16)/(-8))/(-18/(-1730516)) a prime number? False Suppose -57b = -74b + 43b - 11769446. Is b composite? False Let t be ((-3)/30-5)/(2/20). Suppose -tl + 1651 = -384. Is l a prime number? False Let v = 13572 - -5471. Is v a prime number? False Let v(x) = -x*3 - 23x*2 - 20x + 44. Let t be v(-22). Let b be ((-3)/(-9))/(3/18) + t. Suppose -2y = 2, -3f - y = bf - 7654. Is f a composite number? False Suppose 5l = -3k, -2k - 3k = -l. Suppose 15526 = -la + 14a. Is a prime? True Is -166762(231/14 - 17) a composite number? True Suppose 3w - 2q = 4w + 23, 2w = 2q - 28. Let i = 298 - 194. Let v = i - w. Is v a composite number? True Let r(d) = 170d - 135. Let k be r(16). Suppose 2s + 5m + 5104 = -s, 2s = -m - 3412. Let f = k + s. Is f composite? False Suppose -20 = 4l, -3o + 53490 = -3l - 188106. Is o composite? False Let k = -365621 + 572848. Is k a composite number? False Suppose -11m = 6m - 85. Let d(q) = 41q - 1. Let l be d(4). Suppose -x + 197 = mr, 3r = -3x - l + 730. Is x a composite number? True Let o be (2 - 1) + -14 + 15. Suppose om - 5265 = -1375. Is m a composite number? True Let y(b) = -852b + 44. Let r(x) = -284x + 15. Let z(a) = 11r(a) - 4y(a). Is z(2) a composite number? False Let b be (2-4)/(-2 - -5 - 5). Suppose -4m + 728 + 720 = -bw, 5m + w - 1780 = 0. Suppose -2a = -m + 135. Is a a prime number? False Let g = -94 - -92. Is (-4690 + g)/(-3) + 3 composite? False Let t(f) = 605f2 + 99f - 123. Is t(-29) a prime number? True Let t = -92 + 94. Let q(g) = -16g + 8g + 16g + 8g + 4 + 63gt. Is q(-5) a prime number? True Let p = 80 - 48. Let v = p - 1936. Is (-27)/9(v/3 + 1) a prime number? True Is 77382 - 38/(-19)14/4 composite? True Let v be 1/(8/(-6)) - 18764/(-16). Suppose 114a = 110a + v. Is a composite? False Let b = -699 - -701. Suppose 2m = -2m + 372. Is (b + 5)(4 + m) a composite number? True Let g(d) = -416d + 1. Let b(y) = -y2 + 6y + 16. Let k be b(9). Let q(n) = 208n - 1. Let p(s) = kq(s) - 6g(s). Is p(6) composite? True Is (7 - (21 + -16))/((-2)/(-3309)) a prime number? False Let i be -2 + -1 - (3 + (3 - 1112)). Let q = i + -112. Is q a composite number? False Suppose -141z + 129*z + 2717014 + 3008870 = 0. Is z composite? True Let a be (-200	{ "pile_set_name": "DM Mathematics" }
hout replacement from herevvnrnetee. What is prob of picking 1 h and 2 n? 1/286 Three letters picked without replacement from {x: 6, s: 8, b: 3}. What is prob of picking 1 x and 2 s? 21/85 What is prob of picking 2 k and 1 w when three letters picked without replacement from {a: 3, s: 2, g: 9, k: 2, w: 3}? 1/323 What is prob of picking 1 o and 1 r when two letters picked without replacement from vaqqrqqoqvvvvaqqrq? 2/153 Calculate prob of picking 2 y and 1 n when three letters picked without replacement from yytynynnyn. 1/3 Two letters picked without replacement from {x: 5, w: 1, o: 4, r: 1, s: 3, m: 1}. Give prob of picking 1 s and 1 r. 1/35 Calculate prob of picking 2 f when two letters picked without replacement from wezfzhewpfewzwpwww. 1/153 Four letters picked without replacement from ccccuckcuccccc. Give prob of picking 1 k and 3 c. 15/91 What is prob of picking 2 g and 1 k when three letters picked without replacement from {g: 3, k: 9, h: 4}? 27/560 Three letters picked without replacement from tecttjjddetctttpttt. What is prob of picking 2 j and 1 t? 10/969 Calculate prob of picking 1 t, 1 c, and 1 q when three letters picked without replacement from cqkcgkqkkqctqqk. 3/91 Four letters picked without replacement from {g: 8, l: 8, x: 2}. Give prob of picking 1 l, 2 x, and 1 g. 16/765 Calculate prob of picking 1 x and 1 d when two letters picked without replacement from xixxiixxidyiixbix. 7/136 Four letters picked without replacement from ttfvtvvvdvvqvvqqtvq. Give prob of picking 1 q and 3 v. 28/323 Four letters picked without replacement from bibbrbliibi. What is prob of picking 4 b? 1/66 Two letters picked without replacement from {p: 7, h: 2, i: 2}. What is prob of picking 1 p and 1 i? 14/55 Calculate prob of picking 1 g and 1 u when two letters picked without replacement from {u: 1, g: 11}. 1/6 Two letters picked without replacement from yybybb. What is prob of picking 2 y? 1/5 What is prob of picking 1 a and 1 e when two letters picked without replacement from eaw? 1/3 What is prob of picking 2 p, 1 f, and 1 v when four letters picked without replacement from wfwwvpmpjpjppfpvw? 3/119 Calculate prob of picking 3 n and 1 b when four letters picked without replacement from {i: 1, b: 3, e: 1, n: 5, p: 1}. 1/11 Calculate prob of picking 2 f and 2 g when four letters picked without replacement from ggggfgfgg. 1/6 Calculate prob of picking 1 m and 2 l when three letters picked without replacement from {m: 3, r: 1, l: 1, o: 2, h: 5}. 0 Two letters picked without replacement from ntcccgnccncccxxxxccn. What is prob of picking 1 t and 1 g? 1/190 What is prob of picking 1 u and 1 f when two letters picked without replacement from ffsuf? 3/10 What is prob of picking 1 n and 1 r when two letters picked without replacement from rnanrrrnnrnrnrnrnnnn? 44/95 What is prob of picking 1 a, 1 v, and 1 c when three letters picked without replacement from {a: 9, o: 7, k: 1, v: 2, c: 1}? 3/190 What is prob of picking 1 o, 1 c, and 1 p when three letters picked without replacement from {p: 1, q: 1, o: 3, b: 3, c: 1, x: 9}? 1/272 Calculate prob of picking 1 o, 1 u, and 1 l when three letters picked without replacement from pofpulofv. 1/42 Three letters picked without replacement from bbabbabbbbbb. What is prob of picking 1 b and 2 a? 1/22 Two letters picked without replacement from eeeeceececee. What is prob of picking 2 e? 6/11 Calculate prob of picking 2 x and 2 z when four letters picked without replacement from {z: 3, x: 8}. 14/55 Three letters picked without replacement from {v: 1, d: 1, e: 2, p: 2, j: 1, m: 1}. Give prob of picking 1 j, 1 e, and 1 p. 1/14 Three letters picked without replacement from {t: 3, r: 2, p: 1, j: 5, x: 5}. Give prob of picking 1 x and 2 t. 3/112 What is prob of picking 1 m, 1 a, and 1 v when three letters picked without replacement from nalvwaanmwanwnvva? 3/136 Three letters picked without replacement from {n: 3, u: 1, m: 3, z: 2, e: 2, h: 7}. What is prob of picking 1 e, 1 h, and 1 u? 7/408 Four letters picked without replacement from {f: 5, p: 9, o: 2}. Give prob of picking 1 p and 3 f. 9/182 Four letters picked without replacement from {e: 3, n: 15}. What is prob of picking 1 n and 3 e? 1/204 Three letters picked without replacement from zpxxxxkxzzxxxpzxxzx. What is prob of picking 3 x? 55/323 Four letters picked without replacement from {b: 2, g: 5, m: 5, j: 3, e: 1}. What is prob of picking 1 g, 1 j, 1 e, and 1 b? 3/182 Two letters picked without replacement from {v: 2, i: 17}. Give prob of picking 2 i. 136/171 Three letters picked without replacement from lukicucl. Give prob of picking 2 l and 1 c. 1/28 Three letters picked without replacement from shfrhnh. What is prob of picking 1 r, 1 s, and 1 h? 3/35 Four letters picked without replacement from ixxdqixxdqif. What is prob of picking 2 q, 1 f, and 1 i? 1/165 Four letters picked without replacement from {m: 2, e: 14, p: 1, a: 2}. What is prob of picking 1 m, 1 e, and 2 a? 7/969 Three letters picked without replacement from bdddbdddddddd. Give prob of picking 1 d and 2 b. 1/26 Four letters picked without replacement from {e: 8, q: 2, j: 7, p: 2}. What is prob of picking 2 e and 2 p? 7/969 Four letters picked without replacement from {w: 4, q: 2, p: 8}. Give prob of picking 3 w and 1 q. 8/1001 Calculate prob of picking 1 h and 2 a when three letters picked without replacement from haaaaaaaahahahahah. 33/68 What is prob of picking 4 h when four letters picked without replacement from hdqdhhhd? 1/70 What is prob of picking 3 f when three letters picked without replacement from rrrffffffff? 56/165 What is prob of picking 2 i and 1 j when three letters picked without replacement from {j: 3, f: 3, w: 2, i: 5}? 15/143 Calculate prob of picking 1 a and 1 z when two letters picked without replacement from {y: 1, z: 1, a: 9, g: 1}. 3/22 Calculate prob of picking 1 v and 1 i when two letters picked without replacement from iioijjojvoooovifj. 1/17 Calculate prob of picking 1 v, 1 u, and 2 j when four letters picked without replacement from jygugvjyjeg. 1/110 What is prob of picking 2 i and 1 b when three letters picked without replacement from {i: 6, b: 2}? 15/28 Three letters picked without replacement from iiiixiiixii. Give prob of picking 1 i and 2 x. 3/55 Calculate prob of picking 4 r when four letters picked without replacement from {r: 3, b: 1, z: 4}. 0 Three letters picked without replacement from bwdddbmbbbmbbd. Give prob of picking 2 d and 1 b. 3/26 What is prob of picking 3 y when three letters picked without replacement from {y: 17, d: 3}? 34/57 Four letters picked without replacement from {q: 1, n: 1, r: 2, y: 1, p: 2, f: 1}. Give prob of picking 1 p, 1 f, 1 q, and 1 y. 1/35 Calculate prob of picking 1 r and 3 i when four letters picked without replacement from iifrrrxxix. 1/70 Four letters picked without replacement from {e: 1, h: 1, x: 1, v: 1, l: 1, w: 2}. Give prob of picking 2 w, 1 v, and 1 l. 1/35 What is prob of picking 1 i and 3 e when four letters picked without replacement from bibbibiiei? 0 What is prob of picking 3 p when three letters picked without replacement from zpzzwzpzplzpz? 2/143 Two letters picked without replacement from jjjjjjjjmmmjjpmmm. Give prob of picking 2 m. 15/136 Calculate prob of picking 1 q and 2 c when three letters picked without replacement from {q: 2, u: 1, e: 2, h: 1, c: 3, y: 3}. 3/110 Calculate prob of picking 2 v and 1 h when three letters picked without replacement from cvcchccvvvvvvcvvcvc. 15/323 What is prob of picking 1 c, 1 i, and 2 z when four letters picked without replacement from zcizc? 2/5 What is prob of picking 2 u when two letters picked without replacement from {p: 2, u: 5, v: 11, r: 1}? 10/171 Calculate prob of picking 1 q and 2 n when three letters picked without replacement from qqqqqqqqqnnqqqqqqn. 15/272 Three letters picked without replacement from {b: 3, s: 5}. What is prob of picking 3 s? 5/28 Three letters picked without replacement from {m: 12, y: 1, h: 1, v: 2, p: 1}. Give prob of picking 1 p, 1 v, and 1 y. 1/340 Two letters picked without replacement from gytgttt. Give prob of picking 2 g. 1/21 What is prob of picking 1 c, 1 k, and 1 t when three letters picked without replacement from bccctkkkbbtkbbc?	{ "pile_set_name": "DM Mathematics" }
9.886155 - -0.103245. Let h = k + x. What is h rounded to 3 decimal places? -0.011 Let u = -2.7 - -3.1. Let f = u + 10.4. Let j = 10.8000388 - f. Round j to 6 dps. 0.000039 Suppose -4p + 12 = 0, -2a + a + 30 = 5p. Let v = 23 - a. Let b be 242/v + 3/(-12). Round b to the nearest 10. 30 Let l = 2098031764.99999988 + -2098031805. Let o = -40.003 + 0.003. Let g = o - l. Round g to 7 decimal places. 0.0000001 Let v be 2 + (26/143 - 62/(-22)). Suppose va = 21422434 + 2542096. Let r = a - 2392906. Round r to the nearest one million. 2000000 Let o = -1225 - -507. Let f be (9 - 3)1/(-4)o. What is f rounded to the nearest ten? 1080 Let g(a) = -6a2 + 53a + 11. Let v be g(9). Let y be (v + 141/(-6))74. Round y to the nearest 100. -1600 Let k = -11.211 - -11.21109318. Round k to 5 decimal places. 0.00009 Let v be (-2)/10 + 231/55. Suppose -l + 292000 = 2q, 2q + 477424 = vl - 690576. What is l rounded to the nearest 100000? 300000 Let o = -2489 + 2614.3. Round o to the nearest one hundred. 100 Let p = 7853 - 7837.5212. What is p rounded to the nearest integer? 15 Let w = -2321.44 + 10363.535. Let m = w - 8005. Let g = m - 37. What is g rounded to two decimal places? 0.1 Let b = -1396.69 - -1396.690063283. What is b rounded to five decimal places? 0.00006 Suppose 11a - 73520 = 10a. Suppose 0h + a = 8h. Round h to the nearest one thousand. 9000 Let k = -1919.6165 - -1919. Let w = k - -0.1289. Round w to 2 dps. -0.49 Let h = -38 - 15. Let x = -52.91 - h. Let a = -0.322 + x. Round a to 2 dps. -0.23 Let b = -4223 - -4222.965756. What is b rounded to 4 decimal places? -0.0342 Let h = 22889 + -23139.937. Let q = 249.4 + h. Round q to 1 decimal place. -1.5 Let l = 38469.25101 - 38469. Let h = -0.251 + l. What is h rounded to six decimal places? 0.00001 Let f = 35.5 + -41.8. Let t = 6.3000564 + f. Round t to 5 dps. 0.00006 Let l be (619 + -4)(8 - -6). Suppose r + l = -13r. Round r to the nearest 100. -600 Let f = -1.682 - -2.69. Let g = 0.546 - f. What is g rounded to 2 decimal places? -0.46 Suppose -p + 3u + 34 = 3p, -3p + 4u + 29 = 0. Let x(i) = 7292i - 44. Let j be x(p). What is j rounded to the nearest 10000? 50000 Let y = 156757 - 101405. Suppose -4g + 314040 = -y. Suppose 2607652 = 9c - g. What is c rounded to the nearest one hundred thousand? 300000 Let r = 9884 + -5840. Let m = r + -4044.12027. Let h = 0.12 + m. What is h rounded to four dps? -0.0003 Let b = -1998.5 - -2012.083. Let r = -0.017 - b. Let x = 14.23 + r. What is x rounded to 1 decimal place? 0.6 Suppose 55 = 7c + 6. Suppose 34400 = -15i + ci. What is i rounded to the nearest one thousand? -4000 Let t = 472.8965 + -473. Let z = t + 87.5035. Let k = z + -100. What is k rounded to zero decimal places? -13 Let x be 7-1 + (-126201 - -15). Let b = x + 54693. What is b rounded to the nearest 1000? -72000 Let v(s) = -2s*2 - 5s - 71. Let t be v(-8). Let u be ((-3876950)/t)/((-2)/120). Round u to the nearest one hundred thousand. -1500000 Suppose 0 = -6w + 62 - 50. Suppose -5m - 16 = -4u, 2u - wm + 17 = 3u. Let g be (2/(-6) - -1) + 9449994/u. What is g rounded to the nearest one million? 1000000 Suppose 4o = 29931 + 98889. Let p = -69005 + o. What is p rounded to the nearest one thousand? -37000 Let y = 2446.0000287 + -2446. Round y to 6 decimal places. 0.000029 Let z = 516 + -361. Let s = z - 154.99999549. Round s to 7 dps. 0.0000045 Let u = 103 + -102.93. Let g = -0.028 + u. Let x = g - 0.04209. What is x rounded to 4 dps? -0.0001 Let s = 22774793.8874765 - 22774478. Let y = 0.0704765 - s. Let h = -316 - y. What is h rounded to two decimal places? -0.18 Let u = 1021 - -217. Let p = -586 + u. What is p rounded to the nearest 100? 700 Suppose 19a + 2a + 72220946 = -1623739054. Round a to the nearest one million. -81000000 Let w = 7862 + -7862.04361. Round w to 3 dps. -0.044 Let i = -99120042 - 37954883. Let z = i + 137074934.0299487. Let t = -9.03 + z. Round t to 5 decimal places. -0.00005 Let l = -105381.1409985 - -105381. Let k = l + 0.141. What is k rounded to six decimal places? 0.000002 Suppose -10s + 15s - 3o = -6287619, -4s - 5030092 = -4o. Let v = s + -169475. What is v rounded to the nearest one hundred thousand? -1400000 Let j = -863.2 + 863.200000491. What is j rounded to 6 dps? 0 Let u = 5427.1 + -5427.099951574. Round u to 5 dps. 0.00005 Let k = 36 - -12. Let w = 79 - k. Let r = -30.9987 + w. What is r rounded to three decimal places? 0.001 Let g = -78280.087 + 78312. Round g to 1 dp. 31.9 Suppose -2o + 6 = -0. Suppose 0a = 3a, l + 3a - 43003 = 0. Suppose 14876 + 10909 = -ok + 5u, u + l = -5k. What is k rounded to the nearest 1000? -9000 Let p(k) = -k2 + 9k + 12. Let b = 24 + -14. Let u be p(b). Suppose r - 4r - 2m = 3872, 4m = ur + 2576. Round r to the nearest 100. -1300 Let r = 2655.99977529 - 2656. Round r to five dps. -0.00022 Let g = -6344.9987944 - -6345. What is g rounded to four decimal places? 0.0012 Let l = -14 - -14.16. Let i = l + -17.56. Let z = i - -17.844. What is z rounded to one dp? 0.4 Let q = 73 - 395. Let w = q - -372.3. What is w rounded to the nearest 10? 50 Let c = 8265.10469 - 8265. Round c to 3 dps. 0.105 Let i = -89.95289963 + 89.474796. Let y = i - -0.440104. Let f = y - -0.038. What is f rounded to 7 decimal places? 0.0000004 Let q be 12/20 + 76/(-10). Let z(w) = 11 + w - w*2 + 3w*2 + 15w*2 - 6w*2 - 7w*2. Let v be z(q). Round v to the nearest 1000. 0 Let d = -207.547 + 217.07. What is d rounded to one dp? 9.5 Let l = 607.35724224 - 12.35726174. Let z = l - 595. Round z to six decimal places. -0.00002 Let v be (-4 + -21 + -72485)((-1)/2 - 0). Round v to the nearest 100. 36300 Let s = -43.3 - -61.2. Let f = 12.6 - s. What is f rounded to the nearest ten? -10 Let c = 62828902 - 62828826.276997. Let b = c + -74.42300341. Let v = b - 1.3. Round v to 7 decimal places. -0.0000004 Let q = -0.0199456 + -0.052239. Let m = -0.072 - q. Round m to five decimal places. 0.00018 Let v = 37.32 + -32.13. Let g = 1278.5 - 1273.2514. Let h = g - v. What is h rounded to two dps? 0.06 Let d = 768 - 801.78. Let h = d - 8.52. What is h rounded to the nearest integer? -42 Let r(w) = 7w3 + 101w*2 + 923w - 8. Let u be r(-9). Round u to the nearest 1000. -5000 Let q = -30323.67003 - -30326. Let i = q - 2.33. What is i rounded to 6 dps? -0.00003 Let u = -372890.1403 - -372871. Round u to 0 dps. -19 Let k = -31.3 + 40.4. Let b = k - 9.099446. Round b to 5 dps. 0.00055 Let h = -23058 + 23058.0015733. Round h to 5 decimal places. 0.00157 Suppose -59z - 41z - 51z = -343072. Round z to the nearest 1000. 2000 Let m be -4 + 2 - (4 - 10). Suppose w + 4y - 34447 = -y, -4y = mw - 137708. Suppose u - w = 59578. What is u rounded to the nearest ten thousand? 90000 Let f = -152529 - 224161. What is f rounded to the nearest 1000? -377000 Let i = -27824 + 27824.0000030146. What is i rounded to seven decimal places? 0.000003 Let t = 8254 - 8254.00010014. Round t to 5 dps. -0.0001 Let f = -7 - -9. Suppose -2l + 13 = -3s, 2l + s = 3 - f. Suppose -2d + 316 = o, 840 + 374 = 4o - ld. What is o rounded to the nearest 10? 310 Let y = -4261.1 - -4260.85061. Round y to 2 dps. -0.25 Let u = -3161668 - -2111666. Let a(x) = -580x - 4061. Let c be a(-7). Let y be c + (-1)/((-1)/(3 + u)). Round y to the nearest one hundred thousand. -1100000 Let d = 23959 + -23958.9918135. What is d rounded to 3 dps? 0.008 Let x = 105.826 - 35.191. Round x to the nearest 10. 70 Let a = 0.171 + -0.143. Let x = a - 0.304. Round x to one dp. -0.3 Let i = -217.0017206 - -217. Round i to three dps. -0.002 Let n = 344428 - 344466.0078. Let s = n + 38. What is s rounded to 3 dps? -0.008 Suppose -2z = 2w - 24650, 4z - 51602 = 4w - 2294. Round z to the nearest one hundred. 12300 Let x(z) = 178256z*3 - 12z*2 - 23z - 49. Let g be x(-3). What is g rounded to the nearest one million? -5000000 Suppose -4f = 4, w - 5w - 3*f = 97395. What is w rounded to the nearest one hundred? -24300 Let h = -946.5 - -945.8193. What is h rounded to 2 dps? -0.68 Let t = 4596 + -4596.00001869. Round t to six decimal places. -0.000019 Let y = 0.0094 - 796.0094. Let g = y + 273. Let w = -522.99999739 - g. Round w to 7 decimal places. 0.0000026 Let j = 625992724.9999871	{ "pile_set_name": "DM Mathematics" }
t of o(-3)? 1 Let l be (-3)/15 + (-42)/(-10). Suppose -lh + 4 = 0, 6b + 4h - 91 = 3b. Let i = -14 + b. What is the units digit of i? 5 What is the units digit of 32/1212/8? 4 Let v = -264 + 369. What is the tens digit of v? 0 Suppose -5p - 8 = 4v + 42, 0 = 4v + 20. Let o be (-28)/42 - (-20)/p. What is the tens digit of ((-60)/o)/1 - 3? 1 Let t(q) = 238q - 8. Let f be t(4). Suppose f = 2n + 324. What is the tens digit of (n/(-25))/(2/(-10))? 6 Let w(s) = s*2 - 4s + 3. Let m be w(-4). Let g = 23 - m. What is the units digit of (-6)/g(2 - -56)? 9 Suppose -5x - 2 - 8 = 0. What is the tens digit of x/(-3) - 372/(-9)? 4 Suppose 0 = 3j - v - 0v - 1076, 8 = 2v. What is the units digit of j? 0 Let m(s) = s3 + 8s*2 - 12s - 4. Let x be m(-10). Let h be (-3 - (-1)/(-1)) + 1. What is the tens digit of (-14)/h(-432)/x? 2 Suppose 11x = 6x + 255. What is the units digit of x? 1 Let j be 2 + (0 - 1) + -3. Let s be -4(j + (-3)/(-2)). Suppose 5t - 2 = 4f, st - 3f + 1 + 1 = 0. What is the units digit of t? 2 Let c = -731 + 1226. What is the hundreds digit of c? 4 Let c(m) be the third derivative of -m5/60 - m4/2 - 2m3/3 - 3m*2. What is the units digit of c(-8)? 8 Let n be (0 + 2)/(8/(-12)). Let p(g) = 10g*2 + 5g + 14. What is the tens digit of p(n)? 8 Suppose 4a = 4 + 8. Suppose -j - 385 = -2v, 2j = -4v + aj + 773. What is the tens digit of v? 9 Suppose 0 = -5w - 20, 120w = k + 118w - 818. What is the hundreds digit of k? 8 Suppose 0 = -4u + 1 - 5, -u + 24 = 5a. Suppose -26 - 24 = -am. What is the tens digit of m? 1 Suppose 0 = -4a + t + 61, -5a + 87 = 4t - 5. Suppose -426 + a = -5z. What is the tens digit of z? 8 Let u = 126 - 56. Let f = u + 2. What is the tens digit of f? 7 Let y(h) = -8h + 90. What is the hundreds digit of y(-26)? 2 Suppose 0 = -3w + 2k + 3913, -8w + 10w - 3k - 2602 = 0. What is the units digit of w? 7 Let s(c) = 2c*2 + 32c + 180. What is the units digit of s(-27)? 4 Suppose 27g - 25g - 230 = 0. Suppose -4m - 207 = -3v, 4m + m - g = -2v. What is the units digit of v? 5 Suppose -2v - 644 + 2426 = 0. What is the units digit of v? 1 What is the units digit of 2/10 - (6 - 50236/20)? 6 Let q = 1236 + -507. What is the tens digit of q? 2 Let w(c) be the second derivative of 17c*3/3 - 19c*2/2 - 8c. What is the units digit of w(4)? 7 What is the thousands digit of ((-5)/5 - -923)(-3)/(-2)? 1 Let v be ((-12)/10 - 0)30. What is the tens digit of (-194)/(-18) + v/(-162)? 1 Suppose -3u + 37 = 3f - 11, -5f + 64 = 4u. What is the units digit of (u/(-12))/(43/(-918))? 2 Suppose -5p - 5f + 640 = 0, 0 = -3p + 2p + f + 124. Suppose -9q + p = -2q. What is the units digit of q? 8 Let o(y) = 6y - 2. Let u be o(2). Suppose g + 5 = 0, -5t + 4g + u = -0. Let n = t + 4. What is the units digit of n? 2 Let d = -9 + 39. Suppose 0 = -dr + 28r + 370. What is the tens digit of r? 8 Suppose -6h - 648 = 1134. Let z = 559 + h. What is the hundreds digit of z? 2 Suppose 11b - 1950 = -36. What is the hundreds digit of 3/(8/24 + (-55)/b)? 1 Let r be 0(0 + (-2)/(-4)). Let a(y) = 4y - 4. Let t be a(2). What is the tens digit of 10 + t + -3 + r? 1 Let o(v) = -2v2 + 20v + 13. Let h be o(10). Suppose -hj + 72 = -9j. What is the tens digit of j? 1 Suppose 3w - 501 = -2m + 1376, -624 = -w + m. What is the tens digit of w? 2 Let g(q) = -68q + 89. What is the hundreds digit of g(-6)? 4 Let w(p) = 71p + 38. Let t be w(3). Let l = 466 - t. What is the hundreds digit of l? 2 Suppose 4r = 4d + 22 + 2, d = 2r - 11. What is the tens digit of (-217)/(-5) + 3/r? 4 Suppose -3b + h = 13, 1 = 3b + 5h - 10. What is the units digit of -1 + (b - 1) + 35? 0 Let s(b) be the second derivative of 19b3/6 + 11b*2/2 + 2b. Let t(z) = z3 + z2 - 7z + 5. Let p be t(2). What is the tens digit of s(p)? 6 Let t = -278 - -408. What is the hundreds digit of t? 1 Let a be (-4 - (-6 - 1))(0 - -1). Suppose v + 4z = -v + 326, az - 6 = 0. What is the hundreds digit of v? 1 Suppose 5x - 906 = c, 0 = 6x - 3x + 4c - 539. What is the tens digit of x? 8 What is the hundreds digit of (-3 - 2760/25)(4 + -9)? 5 What is the units digit of (-25)/(-15) - 9854/(-6)? 4 Suppose h + 3h = -t + 4, 2h = 3t + 16. Suppose ho - 134 = -36. What is the units digit of o? 9 Let f(q) = q2 - 6q + 2. Let y(c) = 2c2 - 8c + 12. Let r be y(3). What is the units digit of f(r)? 2 Let u(z) = 156z3 + 4z*2 - 64z + 186. What is the hundreds digit of u(3)? 2 Let c = 53 + -52. Let j(n) = -1 + 1 + n*2 + 32n3. What is the tens digit of j(c)? 3 Let j(h) be the second derivative of -h3 + 15h2/2 + 13h. Let u be j(5). Let n = 55 - u. What is the tens digit of n? 7 Let v be 5/(-60)3 - 133/(-4). Suppose -v = -a + 80. What is the units digit of a? 3 Suppose 5t + 823 = x, 4235 = -x + 6x + 5t. What is the tens digit of x? 4 Let n(x) = -x*3 + 9x*2 + 2x - 8. Let w be n(9). Suppose d + b - 10 = 0, 4d = -0d + 4b + 8. What is the units digit of (w/(-4))/((-3)/d)? 5 Suppose -z + 32 = 5o, 0 = -3o - 3z + 4 + 20. Suppose os - 257 = 1. What is the tens digit of s? 4 Suppose 5n = 3i - 8388, n = 5i - 9i + 11207. What is the units digit of i? 1 Suppose 2w - 3y + 349 = 0, -5w = -y - 0y + 905. Let d = 269 + w. What is the tens digit of d? 8 What is the tens digit of (14 - 13)8/(-20)-35? 1 What is the tens digit of ((-57528)/(-54))/(2/3)? 9 Let o(q) = -q2 + 3q - 4. Suppose -4m + m + 21 = 0. Let r be o(m). Let v = r - -48. What is the units digit of v? 6 Let l be 12(2 - 0)4/8. Suppose 0 = ls - 1045 - 431. What is the hundreds digit of s? 1 Let l be (-18)/8(-16)/12. Suppose 2q = lq - 15. What is the units digit of q? 5 Let k(t) = 4t*2 - 20t - 2. Let r(a) = 5a2 - 20a - 2. Let o(x) = -6k(x) + 5r(x). What is the units digit of o(-20)? 2 Suppose 3q = f - 3, 0 = -5f + 3q + 14 + 1. Suppose 156 = 2y - fa, 2a = 4y - 2a - 316. What is the units digit of y? 1 Let q = -1276 + 2642. What is the tens digit of q? 6 Suppose -3n + 191 + 241 = 0. Suppose -3t + n = -t. What is the tens digit of t? 7 Let p = -17 + 132. Let d = 198 - p. What is the tens digit of d? 8 Let q(f) = -250f - 22. What is the units digit of q(-4)? 8 Suppose -3r + 70 = 2r + 5l, 5l = 3r - 2. Let a = 12 - r. Let t = 3 + a. What is the units digit of t? 6 Suppose -5n + 3f + 389 = 0, -f = -2n - 6f + 168. Let o = 141 + n. What is the hundreds digit of o? 2 Let h be (114/(-15))/((-2)/5). Let b = h + -15. Suppose -4n - 3g = -84 + 28, bn - 80 = 3g. What is the tens digit of n? 1 Let v(h) = h*2 - 8h - 5. Let r be v(9). Suppose -y + 11 = 4c, 3c + 3y = rc - 19. Let i = c - -18. What is the units digit of i? 2 Let q(i) = i*2 + 8i + 17. What is the units digit of q(17)? 2 Suppose -4a - 2a = -78. Let d = 11 + a. What is the tens digit of d? 2 Let a = -5 - -8. Let o = -161 - -160. What is the tens digit of o - 62a/(-6)? 3 Suppose 16a - 19a + 612 = 0. What is the tens digit of 13/(26/a) - 6/(-3)? 0 Suppose -5y + 25 = 105. Let t be ((-20)/y)/(2/8). Suppose -m + u = -7, -2m + t = -5u - 12. What is the units digit of m? 6 Let z = 2329 + -26. What is the units digit of z? 3 Let s = 6759 - 4815. What is the hundreds digit of s? 9 Suppose 3i = q - 830 - 1603, 0 = -2q + 2i + 4882. What is the tens digit of q? 4 Suppose 284v = 278v + 720. What is the hundreds digit of v? 1 Suppose 138468 = 38k - 39182. What is the tens digit of k? 7 Let n = 318 + -113. Suppose -6r + 5q = -2r - 855, -r + 3q = -n. Suppose -r = -5x - 4w, -x = 5w - 31 - 13. What is the units digit of x? 4 Let u be ((-3)/(-9))/(3/45 + 0). Suppose 0 = -us - 4c + 292, 2s - c + 3c = 118. What is the tens digit of s? 5 Suppose -2c - 10 = 26. Let m(z) = z*3 + 17z*2 - 21z - 15. What is the units digit of m(c)? 9 Let o = -1035 - -1463. What is the tens digit of o? 2 Let b be 2(-3 - -4) - 0. Let k(r) = -r3 + 7r*2 - 6r + 5. Let p be k(6). Suppose l - 3j - 36 = -0l, bl = pj + 67. What is the units digit of l? 1 Let w be 2 + -86 + 2 + -1. Let l = w - -157. What is the units digit of l? 4 Suppose -3r + 745 = k, 0 = 5r - 0k + k - 1239. Suppose 0 = o + 4, o = 3x + 6o - r. What is the units digit of x? 9 Suppose 35 + 56 = 3n	{ "pile_set_name": "DM Mathematics" }
5. Let t be f(-5). Round t to the nearest 10000. 10000 Let a = -134344888 - -134344862.0000012. Let m = 26 + a. What is m rounded to 6 dps? 0.000001 Suppose 2 = 2a, -13630440 + 96730441 = -3u + a. Round u to the nearest one million. -28000000 Let h = 0.084 - 19.084. Let l = -7 + 30.6. Let z = h + l. What is z rounded to 0 decimal places? 5 Let u be (-4)/(2/(-1 - 0)). Let f(q) = 2299q2 - 8q - 16. Let c be f(-4). Suppose 0 = us + 2s - c. Round s to the nearest one thousand. 9000 Let f = -230 + 230.88. What is f rounded to 2 decimal places? 0.88 Let s = -64 + 65. Let o be -2s - 2(-7 + 33). What is o rounded to the nearest 10? -50 Let n be (300140/9)/(2/564). Suppose 3d + d = n. What is d rounded to the nearest 100000? 300000 Let d(z) = z*2 + 18z + 18. Let p be d(-17). Let u be p(-4)/4 - -3. Suppose uf - 6f + 19988 = -3x, 4f = -x + 20004. Round f to the nearest one thousand. 5000 Let q = 56 - 56.0000995. Round q to five dps. -0.0001 Let m = 274 + -275.66. Round m to one decimal place. -1.7 Let m = 2860.03 - 2910. Round m to the nearest integer. -50 Let l = 58 + -11. Let g = -5 - l. Let y = 51.99884 + g. Round y to 4 decimal places. -0.0012 Let s = 13736.006123 - 13736. What is s rounded to 3 dps? 0.006 Let h = -8 - -7.92. Let k = h - -0.043. What is k rounded to two decimal places? -0.04 Suppose -4n = 10 - 38. Let r = 3 + n. Let z be (-909998)/r - 7/35. What is z rounded to the nearest ten thousand? -90000 Let c = 1278.0001166 - 1278. Round c to 4 decimal places. 0.0001 Let f = -79 + 33. Let o = -3.154136416 - 42.845863124. Let t = o - f. What is t rounded to seven dps? 0.0000005 Let l = -1163 - -4411. Let u = 3248.02938 - l. Let j = 0.03 - u. What is j rounded to 4 dps? 0.0006 Let x = -31.999292 - -32. What is x rounded to 4 dps? 0.0007 Let t = -15597214.99757 - -15596649. Let k = t + 566. Round k to 4 dps. 0.0024 Let k = -266967.74 - -266337.73701. Let n = k + 630. Round n to 3 dps. -0.003 Let t(h) = 79h + 13. Let n be t(-37). Round n to the nearest 100. -2900 Suppose -5t + 21939994 = 2n, 0t - n = 3t - 13163997. What is t rounded to the nearest one million? 4000000 Let q = -8050227 + 2777338. Let p = 26718332 - 13645443. Let k = p + q. What is k rounded to the nearest 1000000? 8000000 Let k(l) = 8568l*2 - 3l - 3. Let o = 50 + -47. Let m be k(o). What is m rounded to the nearest ten thousand? 80000 Let a be (-3 - -8)(-2740)/25. Let s = 988 + a. What is s rounded to the nearest one hundred? 400 Suppose 4x = x + 3o - 24, -3o = 4x + 32. Let s be (-250)/((x/448)/(-3 - -2)). Round s to the nearest 1000. -14000 Let v = -127284305 - -127284306.11501006. Let r = v + -1.115. What is r rounded to six dps? 0.00001 Suppose -r = -0r - 14292722. Suppose c + l = 6213432, -2l - 16774403 = -5c + r. Let p = -2713427 + c. Round p to the nearest 1000000. 4000000 Let j = -2152 + 2152.000001823. Round j to 7 decimal places. 0.0000018 Suppose 3i + 3h + 23295 = -0i, h - 5 = 0. What is i rounded to the nearest one hundred? -7800 Suppose -2z + 3p - 11 = -35, 2p = -3z + 10. Suppose 0 = zb - 2b - 179132. Let i = -83783 + b. Round i to the nearest ten thousand. -40000 Let l = 2.1 + 0. Let o = -0.1 + l. Let y = 1.991 - o. Round y to 2 decimal places. -0.01 Suppose -3i + 62 + 1 = 0. Let f be (769972/i)/(2/(-6)). Let z be (10/(-2) - -1) + f. What is z rounded to the nearest ten thousand? -110000 Let g be 5 - (12/(-4) - -4). Suppose -3o = -o - 418. Suppose 0 = 4b + gz + 380, -z - 186 - o = 4b. What is b rounded to the nearest 1000? 0 Let p = -14876.08 + 14599. Let v = 282 + p. Let c = v + -5. Round c to one decimal place. -0.1 Let d(r) = -20r + 5. Suppose -4k + 4 = 44. Let c be d(k). Round c to the nearest 10. 210 Let o = 38 - 139. Let c = -164 - o. Let w = -33.5 - c. Round w to the nearest integer. 30 Let d = -0.4 - -0.06. Let h = d + -0.4. Round h to one decimal place. -0.7 Let v be 34199996 - (-2 + (-15)/(-5)). Suppose 0 = s + 2s + a - 34200001, -3s + v = -5a. What is s rounded to the nearest 1000000? 11000000 Let f(a) = -6 + 8a*2 - 2a + 1 - 2a - 63a*3. Suppose 0 = 9j - 14j + 25. Let p be f(j). Round p to the nearest 1000. -8000 Let w = -126 - -126.000000348. Round w to 7 decimal places. 0.0000003 Suppose 143801 = -45w + 43w + f, 0 = 4w - 3f + 287603. What is w rounded to the nearest 10000? -70000 Let a = -92.944 - 0.056. Let r = a + 176. Let f = -83.000107 + r. What is f rounded to five decimal places? -0.00011 Suppose 2s + 14 = 22. Let x be 7 - (0 + 4/2). Suppose 14699975 = sj - j + 5f, -xf = 25. Round j to the nearest 1000000. 5000000 Let d = 0.07990401 + -0.0799. Round d to six decimal places. 0.000004 Let r = 734 + -1390. What is r rounded to the nearest one hundred? -700 Let p = -0.1241 + -0.4169. What is p rounded to one decimal place? -0.5 Let k = -260 + 480. Let j = -4956281750.9999889 + 4956281531. Let p = k + j. What is p rounded to six decimal places? 0.000011 Let d = 2.4 - 1.4. Let r = 0.99894 - d. What is r rounded to 4 decimal places? -0.0011 Suppose k - 2119085 = 1060915. Round k to the nearest one million. 3000000 Suppose -5p + 2p + 15 = 0. Suppose -2l + 2c = -6, 0 = 2l + 2c - p - 1. Suppose 141 + 6159 = -lm. Round m to the nearest one thousand. -2000 Let q = -147.8452 + 0.0452. Let l = 0.173 - -160.827. Let n = l + q. What is n rounded to the nearest integer? 13 Let g = 962 + -586. Let j = -379.02 + g. Round j to 1 dp. -3 Let g be ((-3)/2)/3(-10 + 0). Suppose 2q = -3z - 102599996, -gq = -4q - 2. What is z rounded to the nearest one million? -34000000 Let b(l) = -970004l - 16. Let v be b(-4). Round v to the nearest one hundred thousand. 3900000 Let a be -10(-3)/(-6) + 3. Let i(n) be the second derivative of -79375n5 - n4/12 - n*3/3 + 7n. Let k be i(a). Round k to the nearest one million. 13000000 Let d be ((-3)/2)/(1/8-4). Suppose dj + 7200012 = 3t, -7j = -5j + 8. What is t rounded to the nearest 1000000? 2000000 Let t(h) = 64h*2 - 13h + 8. Let m be t(8). Let r be (4 + -664)m/6. Round r to the nearest 100000. -400000 Let s = -402.694 - -409. Let b = s - 6.42858. Let t = -0.121 - b. Round t to 4 dps. 0.0016 Let w = -52.31 - -52. Let i = -12.31 - w. Let d = i - -13.42. What is d rounded to one decimal place? 1.4 Let o = -92 + 29. Let r = o + 43.4. Round r to zero dps. -20 Let v be -5 + 4 - 6/(-2). Let m = v - -29. Let k = m + -19. Round k to the nearest ten. 10 Let r = 0.013 + -4.913. Let q = r - -4.89962. What is q rounded to five decimal places? -0.00038 Let q be (-8 - -5)(0 - -2). Let j(i) = -i*3 - 5i*2 + 5i - 6. Let d be j(q). Suppose d = -0o - o - 700000. What is o rounded to the nearest 100000? -700000 Let z = -110298 - 275118. Let y = z - -168416. What is y rounded to the nearest 10000? -220000 Let u = -936 - -941.93. Let a = 6 - u. What is a rounded to two decimal places? 0.07 Let j = 108.806 - -0.194. Let w = -7 - j. Let i = w - -115.9877. Round i to 3 decimal places. -0.012 Let r = -0.04199958 + 0.042. What is r rounded to five dps? 0 Let l = 142.181703 - -6462.277997. Let y = 6640.4597041 - l. Let t = y + -36. What is t rounded to 6 dps? 0.000004 Suppose 4m - 437 - 282 = -z, 2z = 2m + 1418. Suppose p + 2a = 6a + 222, 3p = -3a + z. What is p rounded to the nearest ten? 230 Let n = 34 + -16. Let p be (-1043999992)/(-36) + 4/n. What is p rounded to the nearest one million? 29000000 Let u = -4.95 + 4.9. Let c = u - 0.9. Round c to one decimal place. -1 Let i = 141.2 - 141.200355. What is i rounded to four dps? -0.0004 Let n = -3 + 8. Suppose 7k = 2k - n. Let r be -38(-2 + 103 + k). Round r to the nearest one thousand. -4000 Let n = -9.08 - -8. Let h = 10.28 + n. Let c = h - 9.199957. What is c rounded to five decimal places? 0.00004 Suppose -4p = -5p + 5. Suppose 62254 + 12351 = -d - pv, -v = 1. Round d to the nearest ten thousand. -70000 Let j = -3372.1 - -3186. Let v = -135 + -62. Let w = v - j. What is w rounded to the nearest integer? -11 Let k(r) = 1122r2 + 2r + 20. Let z be k(19). What is z rounded to the nearest 10000? 410000 Let r = -0.2312 - -0.23116814. What is r rounded to six decimal places? -0.000032 Let i = 16.312 - 0.012. Let v = i + -1.3. Let l = v - 15.035. What is l rounded to 2 dps? -0.04 Suppose 7*b - 254597	{ "pile_set_name": "DM Mathematics" }
) = -9k + 9. Let r(b) = 2l(b) - 3q(b). Give r(4). 18 Let b(c) = 6c + 4. Let v(p) be the third derivative of p4/24 + p3/6 + p*2. Let f(m) = -b(m) + 5v(m). Let n be -4(2 + (0 - 1)). Determine f(n). 5 Let f(k) = k - 1. Let i be -2 - (-3)/(6/26). Suppose -3p + u + i = 0, -2u - 6 - 13 = -5p. Suppose -2w + 25 = -pz, -z + 20 = -w - 6z. Determine f(w). 4 Let t(h) = 6h + 3h - 6 - 8h. Calculate t(5). -1 Let f(b) be the third derivative of -b4/8 + b3/6 + 25b2. Determine f(-4). 13 Let t be -2 + (-5)/1-1. Let w be (t - 3)/((-2)/1). Let n(a) = -4a + wa + 3a2 + a2 + a3 - 2. Calculate n(-5). -7 Let j(v) = 8v + 4. Let f(d) = 7d + 3. Let s(k) = -7f(k) + 6j(k). Give s(-7). 10 Let z = 9 - -26. Suppose -4o = 7 - z. Let s(a) = a*2 - 6a - 5. Give s(o). 2 Let h(o) = -o + o*2 - 7o + 2 + 1. Let n be h(7). Let u(f) = f*2 + 3f. Calculate u(n). 4 Let s(u) = -u*3 + 4u*2 - u + 4. Let l be (4 + -1)/(3 - 2). Let r be l/2(-24)/(-9). Calculate s(r). 0 Let z(d) = d + 9. Suppose -5n - 25 = -n + o, -4o = 3n + 9. Give z(n). 2 Let c(r) be the second derivative of -1/6r*3 + 1/2r*2 + 3r + 1/20r5 - 1/6r*4 + 0. Give c(2). -1 Let v(s) = s - 3. Let a be v(5). Suppose -3w + 10 = at, -4 = -2w - 3w + 3t. Let h(r) be the second derivative of -5r3/6 + 200r. What is h(w)? -10 Let l(r) = -r*3 + 7r*2 - 7r - 6. Let n be (-18)/(-15)(-20)/(-4). Give l(n). -12 Let j(f) be the second derivative of -f5/20 - f4/3 - 2f3/3 - f2 - f. Calculate j(-3). 1 Let s(p) = -p*2 + 8p - 3. Let u(a) = -2 + 0 + 3 + a. Let h be u(6). Let f be s(h). Let k(w) = w*3 - 5w*2 + 4w + 5. Give k(f). 5 Let p be (-6(-12)/(-18))/(-1 + 2). Let q(c) = -c3 - 2c*2 + 6c + 3. What is q(p)? 11 Let u = 12 - 7. Let m(o) = o2 + o + 1. Let t(p) be the third derivative of -p5/60 - p*3/6 + 3p*2. Let z(h) = -6m(h) - 7t(h). Calculate z(u). -4 Let k(r) = -5r + 0r + 3 + 3r. Suppose -3u + 3n - 9 = -3, 2u - n = -6. Let b be u/(-10) - 36/(-10). What is k(b)? -5 Let g(q) = -3 - 2q*2 - 3q*3 + 6q*2 + 3q + 4q3. Let b be g(-3). Let y(i) = -i2 - 4i - 4. What is y(b)? -1 Let r(v) = -395v + 802v - 398v. Let c be (4/6)/((-2)/3). What is r(c)? -9 Suppose 3n + 3 = 3k, -n + 5k = 2k + 1. Let b(j) = 6j + 2. Let y = 2 - 1. Let f(u) = u + 1. Let w(s) = yb(s) - 3f(s). What is w(n)? -4 Suppose 18 = 4m - 2. Let w(a) be the first derivative of -a4/4 + 5a3/3 - a2/2 - a - 45. Let o be w(m). Let s(j) = j*3 + 6j*2 - j - 5. Give s(o). 1 Suppose 15 = 3u - 0. Let t(n) = 2n3 + 6n2 - n - 2. Let r(b) = b3 + b - 1. Let s(i) = 3r(i) - t(i). Calculate s(u). -6 Let q = 12 + -9. Let d = q + -6. Let f(v) = 8v + 3. Let a(n) = -7n - 3. Let y(b) = -5a(b) - 4f(b). Calculate y(d). -6 Let a(s) = -s2 + 2s - 3. Let m be a(3). Let j(v) = -v*2 - 6v + 6. What is j(m)? 6 Let q(y) be the third derivative of -y4/12 + y2 + 21. Give q(-1). 2 Let a(c) = -c*3 + 2c*2 + c. Let d be 2 + 0/(3-1). Let t be 4d3/12. What is a(t)? 2 Let g be (-2 - 1/1) + 0. Let p(s) = s*3 + 6s*2 - 8s + 8. Let m(i) = i*3 + 5i*2 - 7i + 7. Let x(f) = -5m(f) + 4p(f). Determine x(g). 6 Let t(m) = 3m + 6. Let r(n) = 1. Let v(d) = 6r(d) - t(d). Give v(-2). 6 Let s(y) be the third derivative of 0y - 1/24y*4 + 1/6y3 + y2 + 0. Give s(5). -4 Let n(h) = 3h2 + 25h - 27. Let i(d) = 2d2 + 13d - 14. Let f(g) = -5i(g) + 3n(g). Let r(p) = -2p - 16. Let c be r(-12). Determine f(c). 5 Suppose -11 = -0p - 4p - w, -5p + 5w = -20. Let j(m) = -m2 + 3m + 3. Give j(p). 3 Suppose -6r = -3r - 3. Let h(i) = -7i2 - 2i + 1. Determine h(r). -8 Let a(d) = -d*3 + 6d*2 + d - 3. Suppose 0 = 5f + f - 36. What is a(f)? 3 Let r(d) = -d*2 + 8. Suppose 39 = -5w - a + 6, 0 = 4w + 4a + 36. Give r(w). -28 Let b(p) be the first derivative of p4/4 + p3 - 3p2 - p - 1. Let s = 4 - 8. What is b(s)? 7 Suppose -4o - 8 = -b, 2o + o = 5b + 11. Let y(u) be the second derivative of -u5/20 - u4/4 - u3/3 - u2/2 - 2u. What is y(o)? 5 Suppose -4u = -48 - 0. Suppose i + 3i + u = 0. Let l(k) = -k3 - 3k*2 + 2k. Calculate l(i). -6 Suppose -3l + 16 = o + 4o, 5l = -2o + 14. Let n(p) = l - 3p - 2 + 4. Let z be (6/(-4))/(2/(-4)). Determine n(z). -5 Suppose 3h + 2i = 20, 5i + 17 = 3h + 4i. Let m(o) = o*3 + 1 - 1 + 2o*2 - 9o*2 + 1 + 7o. Give m(h). 7 Suppose -1 = 2z - 7. Let v(m) = m2 - 3m - 1. What is v(z)? -1 Let s be (4 - -1)12/(-10). Let b(w) = w2 + 6w - 3. What is b(s)? -3 Let j(l) = 18l2 - 32l*2 - 13l + 7 + 15l2 + 4l. Calculate j(6). -11 Let u(j) = -4j - 3. Let c(s) = -s - 1. Let p be (-1)/(-2) - (-9)/2. Suppose 2q + 13 = -p. Let z(m) = qc(m) + 2u(m). Determine z(0). 3 Let p(j) = j*3 + 9j*2 + 9j + 10. Let y be p(-8). Let o(u) = 6u - 3u - 4u + yu. What is o(-2)? -2 Let i(m) = 102 - 44 + m*2 - 54 + 5m. Give i(-5). 4 Let l(z) = 3z - 3. Let x(n) = 8n - 9. Let b(a) = 11l(a) - 4x(a). Give b(-7). -4 Let c(i) = 10i3 - 2i*2 + i - 12i*3 + 6i3. Let u(f) = -f3 + 7f2 - 6f + 1. Let r be u(6). Determine c(r). 3 Let d(y) = -y*2 - 5y - 2. Let x be d(-3). Let l be (-2 + (-5)/(-2))-2. Let k(s) = 2. Let c(f) = -f - 1. Let n(a) = lk(a) - c(a). Determine n(x). 3 Let i be (-30)/75 + (-22)/(-5). Let j(t) = -t*3 + 4t*2 - 5t + 6. Determine j(i). -14 Let b(m) = -6m3 + 11m*2 - 9m - 3. Let g(i) = 7i3 - 12i*2 + 10i + 3. Let k(d) = -6b(d) - 5g(d). Let o = 17 - 12. Give k(o). -2 Let w be 2/(-4)(-30)/5. Let h(o) = -ow - o3 + 3o - 2 + 3o3 - 4o2. Calculate h(3). -2 Let c(z) = -z3 + 6z2 - 6z - 3. Let i(m) = m*2 - m + 14. Suppose 7q = 2q. Let n be i(q). Suppose 2f - n = -4. Give c(f). -8 Let x(b) be the second derivative of -b5/20 - b4/4 - b3/6 + b2 - 2b + 37. Calculate x(-3). 5 Suppose -5r = -3 - 27. Let s(c) = -3c + 7. Determine s(r). -11 Let w(k) = -2k + 2k2 + k2 + k - 2k*2. What is w(-2)? 6 Let q(l) = l + 4. Suppose 3w - 4i = 7w + 12, -3i = 9. Suppose h + wj - 2 = -j, 0 = 4j + 4. Let u be (1 - h)(2 + -5). Give q(u). 10 Let s(i) = -2i + 3i*2 - 3 - 2i*2 + 0i*2. Give s(4). 5 Suppose -t + 18 = -5z, -4 - 8 = -t + 3z. Let s(y) = 2y*t + 0y - 3y - 3y*3 - 6y*2 - 3y - 7. Determine s(-5). -2 Let o be (-6)/(-36) - 69/(-18). Let h(u) = 6 + 0u2 - 5u + 5u2 - 3 - u3. Determine h(o). -1 Let r(x) = -x + 2x + x + x*2 + 1 - x. Suppose -2g = -3p + 3, -p - 2g - 7 = -0g. Let c(b) = -5b*2 - 10b - 6. Let o(m) = pc(m) - 6r(m). Give o(4). 0 Let s(b) = 6b + 1. Suppose 0v = 2v + 8. Let h be (3 - 5)/(v/(-2)). Determine s(h). -5 Suppose 7 - 1 = 3g. Let n(o) be the first derivative of 1 - o*g - 4/3o*3 + 2o. Determine n(-2). -10 Suppose 5 - 29 = -4u. Suppose 2r - u = 0, 0 = 4s + 4r - 10 - 10. Let v be -4 - 1/s-2. Let z(j) = j2 + j - 2. Give z(v). 4 Let g(c) be the third derivative of -c5/60 + 3c4/8 + c3 - 4c2. What is g(7)? 20 Let k(h) be the second derivative of 2h3/3 + h2 + 8h. Suppose -3d + 2d - 2 = 0. What is k(d)? -6 Let r(s) be the second derivative of s4/6 - s3/6 + s2/2 + s - 18. Give r(4). 29 Let k(s) be the second derivative of s4/6 - s3/6 + s2 + 8s. What is k(2)? 8 Let i(o) = -o - 12. Let c(t) = 2t + 23. Let m(h) = -3c(h) - 5i(h). What is m(-8)? -1 Let x(b) = -2b - 6. Let m = 2 + -2. Let p be (-12)/(-9)(3 - m). Suppose 3g + 25 = -2s, -2s - pg - 13 = 17. Determine x(s). 4 Let o(c) = -c2 + 4c + 4. Let w be 18/4 + 27/(-18). Suppose 9 = -wm - 6. Let i be 3 - (3 + 1) - m. Give o(i). 4 Let f(n) = -n + 6. Let c = 9 - 6. Suppose cu = -3u. Calculate f(u). 6 Let t(l) = l - 10 - 2 + 6. Calculate t(6). 0 Let g(w) be the third derivative of -w5/60 - 5w4/24 + w3/3 + 14w2. Determine g(-7). -12 Let b be (-1 - 0/(-4))-1. Let j(x) = 2x + 1. What is j(b)? 3 Let n be 4/6 + 14/6. Let z = 2 + 3. Suppose p + nq = -1, 8p + zq - 15 = 3p. Let j(c) = -c + 12. Give j(p). 7 Let f(n) = 5n - 1. Let t(h) = -2h - 7. Let b be t(-8). Let w(p) = -2p. Let s(y) = bw(y) + 4f(y). Suppose 2u - 5u + 12 = 0. Give s(u). 4 Let u(y) = 8y + 6. Let r(h) = -7h - 6. Let k(m) = -7r(m) - 6u(m). Let f be (-4)/6 + 24/9. Let s(a) = -a**2 - 1. Let n be s(f). Calculate k(n). 1 Let w(c) =	{ "pile_set_name": "DM Mathematics" }
e. n(-9193/132) Simplify ((s(-25)s)(2/7))(2/3) assuming s is positive. s(-32/7) Simplify (x(1/3)/(xxx(x/(x/(xx(-2/13)))x)/xx))/(x(-1/2)/xxxxx((x/x(-10))/x)/x) assuming x is positive. x(-1249/78) Simplify (p/(pp/p(-1)p))*(-15)/((p/((pp*(-14))/pp))/p(8/7)) assuming p is positive. p(225/7) Simplify (ff19ff)/(f(ff/(f/f5f))/f)(f(-5)/f)/(f((f/f*(-20))/f)/ff) assuming f is positive. f*(-10) Simplify ((cc(1/5))/c)(-1/4)(cc*2)/(c/(cc*(4/13)c)c) assuming c is positive. c(847/260) Simplify (q13)28/((q/(qq*5))/qq/(q/(q(qqq(-2/85)qq)/q))) assuming q is positive. q(31112/85) Simplify ((n(-1/4))(2/9)(n(-2))(1/55))(-7/5) assuming n is positive. n(637/4950) Simplify s*(-4)/ss*(-14)/ss*5(s/(s/(sss/(s/s(-15)))))/s assuming s is positive. s(-29) Simplify n*(-14)n*0n*(-2/9)n(-13/2) assuming n is positive. n(-373/18) Simplify (x(-1/6))34xx/x*16x(-11) assuming x is positive. x(-92/3) Simplify (d*44((d*(-16/5)d)/d)/d)(-37) assuming d is positive. d(-7363/5) Simplify (g(ggg(2/3)/g)/g)/gg/(gg/(((gg*(-18))/g)/g))(((g*(-2/25)/g)/gg)/g)/(g/(g*(-11/5)/gg)g) assuming g is positive. g(-1921/75) Simplify (f0)(1/8)/(f(-12)/(fff2)) assuming f is positive. f16 Simplify (((p/p(-1/4))/p4)(1/24))18 assuming p is positive. p(-33/16) Simplify (ooo(oo(1/2)o)/ooooo)*(-28)/((oo(2/3))/o)(-18/11) assuming o is positive. o(-2606/11) Simplify ((d/d(-17))/(d/d(-3)))/(d(-11)/d(-1/7)) assuming d is positive. d(174/7) Simplify ((vv/v24)(3/5))(2/19) assuming v is positive. v(-132/95) Simplify (j(-28)/jjj)(-24)jj(jjj*(9/8)/j)/jj(-7/2)/j assuming j is positive. j(5173/8) Simplify u*(-1/14)u/(u/(u((u(u/((uu(-23))/uuu))/uu)/u)/u))u(4/9)u*(-2/97)/uuu assuming u is positive. u(285413/12222) Simplify (bb(bbbb*(3/7))/bb(6/13))/((b/b(-2/9))/b)16 assuming b is positive. b(1093/819) Simplify (((b(bbb11b)/b)(-33))46)36 assuming b is positive. b(-765072) Simplify ((k*(1/20)/kk)/(kkk15))(-42) assuming k is positive. k(7119/10) Simplify o(2/21)/(o/o*(-1/11))(oo(-4/11))/o16 assuming o is positive. o(-3779/231) Simplify (h30/(h(1/33)/h))/((((h/(h/(hh*(1/32)))h)/h)/h)/(h*(-1/8)h)) assuming h is positive. h(33595/1056) Simplify ((o1/(o(o(-3)o)/ooo))(-22))(3/7) assuming o is positive. o(-66/7) Simplify ((u(-12/5)/u)/uu)0/(uu(-1/8))(-2/43) assuming u is positive. u*(7/172) Simplify (yy(-10))(-30)y(-1/3)y/((y/(yy23/y))/yy)y assuming y is positive. y(881/3) Simplify rr*(3/20)/rr*(17/3)r(-25)/((((r/r(17/2))/r)/r)/r) assuming r is positive. r*(-521/60) Simplify (((uu*4)/u)/u)/uu(u(u*(-3/7)uu)/u)/uu*(-6/5)u10 assuming u is positive. u(433/35) Simplify a/(a/(a(aaaaaa/((a*(-12)aa)/a)a)/aa))(a/a*4)/aa*5aaa(-13) assuming a is positive. a9 Simplify (tt/t9)(-32)(t(-7)/t)/t(-4) assuming t is positive. t220 Simplify (z(-2))*(10/7)((((z/z*(1/12))/z)/zz)/zz)/z(-2/7) assuming z is positive. z(-223/84) Simplify (ll*(2/9)l*(-6)l)/(ll4)(-18/13) assuming l is positive. l(368/117) Simplify (r2r)30/(r(-2/7)/(rr(-3))) assuming r is positive. r(618/7) Simplify d(1/2)/dd*(-6)/d(d(2/5))26 assuming d is positive. d(29/10) Simplify (d10)*8d1/d(1/12) assuming d is positive. d*(971/12) Simplify ((((yy*(2/3))/yy)(-2/21))(12/7))43 assuming y is positive. y(-1720/147) Simplify (((v(-8))(-11))(2/37))(4/11) assuming v is positive. v*(64/37) Simplify ((zz*18)/((zz/(zz/((z(-7)z)/z))z)/zz))23 assuming z is positive. z575 Simplify (i18/i2)/(i/(i(i/i(-2/5))/i)i/i*(-5/7)i) assuming i is positive. i(479/35) Simplify ((v3/v((vv7)/v)/v)(-11/3))(-6) assuming v is positive. v176 Simplify (r(2/7))(-4/15)/((rr/r(1/5))/r(-4/13)) assuming r is positive. r(-2981/1365) Simplify (x/(xx(-4)))(-4/37)(xxx/x(4/3)x)/(x*15xx) assuming x is positive. x(-1639/111) Simplify (w4)(-15)w/w*(-8)www(-12) assuming w is positive. w(-61) Simplify (((mm/m(-11))/m17)7)(-24/7) assuming m is positive. m96 Simplify ((t(-1/4))23tt/(t(-3/4)/t)t(3/2))(-20) assuming t is positive. t10 Simplify (l(19/2)ll/(l/(ll(7/8)l)l)l)/(l(-1))(1/22) assuming l is positive. l(1181/88) Simplify ((g(1/3)/g)*(3/5)g(g(g/(g/g*5))/g)/gg(1/4))(-9/11) assuming g is positive. g(-873/220) Simplify ((((t(-2/3)t)/tt)(-1/6))33)(3/38) assuming t is positive. t(-11/76) Simplify ((c*(-1/12)/(c/(c((c0/c)/c)/c)))(-6/37))(-29) assuming c is positive. c(-29/2) Simplify ((j/(jj(2/45)))/j(1/2))(-25) assuming j is positive. j(245/18) Simplify ((l/(l0/l))(-1)(l/l(-2/7))(-45))(3/10) assuming l is positive. l(-1257/70) Simplify (vv/(v/(v((v/(v/(vv(-17/4)/v))v)/v)/vv)))/v(-9)(v/(v*(-15)v))/v12 assuming v is positive. v(39/4) Simplify (((b/b(2/11))18)19)(-6/17) assuming b is positive. b(-18468/187) Simplify (f(-1)ff(2/23))/((f/((f/(f/(f/f(-2/11))))/f))/(f*(-5/8)f)) assuming f is positive. f*(-721/2024) Simplify (((dd*(-27)/d)/d)/((dd*(-2/65)d)/d))/(d*(-28/5)d/((d*21d)/d)) assuming d is positive. d*(-219/65) Simplify (uu/(u2/u))(-31)/(u/((uuu(-1/3))/u))46 assuming u is positive. u(-139/3) Simplify ((b/b(-6/11)b(-3)/b)(3/34))4 assuming b is positive. b(-162/187) Simplify z/z(-1/4)z*2(zz(-1/8)/z)(-14) assuming z is positive. z5 Simplify (((ff*(-10))/f)/f)/(ff*(1/21))(f(-2))(-32) assuming f is positive. f*(1091/21) Simplify ((v((v*(-20/3)v)/v)/vvv)(7/6))(1/2) assuming v is positive. v*(-49/18) Simplify (((vv*(2/15)vv)/(((v/(v(3/5)/v))/v)/v))/((v/(v/((v/(v/(vv*(-9)v))v)/v)))/((vv(v/v(-7/4))/v)/v)))(-19) assuming v is positive. v(-15371/60) Simplify (n(-5))41/((nn/n(1/3))/n)(-18/11) assuming n is positive. n(-2243/11) Simplify (y(1/2)y)2y*2yy/((yy25/y)/y) assuming y is positive. y(-17) Simplify (z*(-5/2)zz(-4/11))/(z28z(3/5)) assuming z is positive. z(-3351/110) Simplify (s*(-3/8)ss)(11/3)/(s4)(-18/13) assuming s is positive. s(3587/312) Simplify (pp*(-2/3)/pp)*(-2/41)/(pp*(-2/7)p)(-4/37) assuming p is positive. p(5386/31857) Simplify (pp(-2/17))(17/4)/(p(-1/21))(-2/33) assuming p is positive. p(10387/2772) Simplify (x(-2)x6)/(x(1/2)x3) assuming x is positive. sqrt(x) Simplify (ff*2ff(-11))/(f(-3/14)f)(1/41) assuming f is positive. f(-4029/574) Simplify yy(-6/7)/yy*3(y/(yy6)y)/(y/y*(8/7)y) assuming y is positive. y(-26/7) Simplify ((r(2/11))*(-4/9)/(rr2)(-1/24))42 assuming r is positive. r(245/132) Simplify ((z(zz*(-2/7))/zz(2/3))38)(1/12) assuming z is positive. z(551/126) Simplify (u/(uu(-3/4))uuu*35u)(-3/31) assuming u is positive. u(-15/4) Simplify ((v/((v*8v)/v))/v(-1/8))/(v7)(-28) assuming v is positive. v(1513/8) Simplify (d(-24))(-8)d(2/65)d(-1) assuming d is positive. d(12417/65) Simplify ((j(5/2)/j(-6))(-35))(-48) assuming j is positive. j14280 Simplify ((v1)15/(v/(v2vvv)v(3/5)))8 assuming v is positive. v(736/5) Simplify (b(-2/85)/bb((b*(11/2)b)/b)/bb)/(b7bb)(2/137) assuming b is positive. b(124487/23290) Simplify (((g(-2/7)gg)/((g(-6/11)/g)/gg))(-31))7 assuming g is positive. g(-7781/11) Simplify (i(5/2)i/(i/(i/(((i(-1)i)/i)/i)))(i/(i(1/5)/i)i)/i(4/5))(-38) assuming i is positive. i(-285) Simplify a(-6/7)a1/a((aa/a(-4/5))/a)/((aa(-7))/a) assuming a is positive. a(278/35) Simplify (l/l(-2/11))(-4/5)l/(l/(l(-2)ll))l(-2/35) assuming l is positive. l(-386/385) Simplify www/((w*(-1)w)/w)w/(w/w(1/36)w)(w/(w(4/5)/ww))(-3/34) assuming w is positive. w(9211/3060) Simplify (((k(2/3))3)(-3))(-15) assuming k is positive. k90 Simplify l/((l(-5/6)l)/l)ll(-1/10)lll**(-	{ "pile_set_name": "DM Mathematics" }
4 Let a = 28 + -26. Let w(d) = -2d2 + 2. Let p be w(a). Let c be 1/(2/p) + 3. Solve -5i - 42 + 17 = c for i. -5 Let c = -175 + 175. Solve -51w + 52w - 5 = c for w. 5 Let p(q) = 6 - 2q - 4 - 3q*2 + 4q2. Let v be p(3). Let b(j) = -j2 - 85j + 1620. Let f be b(16). Solve vr = fr + 1 for r. 1 Suppose 4q = 8q + 260. Let d = q - -67. Solve 0 = dj - 4 - 2 for j. 3 Let q(x) be the first derivative of -11/3x3 - 8 - 1/4x*4 - 11/2x*2 + 6x. Let m be q(-10). Solve 0 = -5u + u + m for u. 4 Let b(s) be the first derivative of 5s*4/4 - 2s*3/3 + 3s*2/2 - s - 18. Let u be b(1). Solve 0 = 6a - a - u for a. 1 Let j(a) = -a*2 - 15a - 22. Let y be j(-13). Suppose -5n - 18 - 2 = 3u, 0 = 5u + n + y. Solve 0 = 5b - ub - 15 for b. 3 Let m(v) = -2v - 5. Let s be m(-5). Suppose 0 = -c + 9 + 8. Let p be c + -18 + 22. Solve -p = -o - s for o. -2 Let a(f) = -f3 - 8f*2 - 7f + 10. Let o be a(-7). Let w = 11 - o. Solve 6 - w = 5t for t. 1 Suppose 4p + 5 + 24 = y, y = 5p + 34. Suppose 3c - y = -3t, -c - 3t + 0 + 3 = 0. Solve -4b + 5 = -c for b. 2 Let y(j) = j3 + 5j*2 + 4j - 1. Suppose -4b - 2 = -2n, -2 = -4n + 4b - 6. Let c be y(n). Solve 0 = ca - 3a - 8 for a. 4 Suppose 0 = -5a + 118 + 37. Suppose 3b = k + a, -b + 3k - 7 = 7k. Let w be (1 + 2)/(b/6). Solve -wx + 1 = -x for x. 1 Let v be 3 - ((-232)/174 - (-34)/(-6)). Solve -23j + vj = -7j for j. 0 Let u(o) = o*2 - 30. Let k be (42/105)/(1/15). Let a be u(k). Solve 2b + 0 - a = 0 for b. 3 Let k be (-3)/(-7)(-70)/(-10). Solve -5m = k - 23 for m. 4 Let h be ((-3)/(3 + 0))/(-1). Solve 5 = m + h for m. 4 Let f be (-68)/(-20) - 2/5. Let q(d) = -d + 16. Let w(o) = o*2 + 6o + 14. Let a be w(-6). Let m be q(a). Solve fu - mu = 0 for u. 0 Let r = 19 + -11. Suppose -r + 32 = x. Suppose y + 8 = g - 0y, -x = -4g + 2y. Solve -w + gw = -15 for w. -5 Let d be 40/220 - (-2)/(-11). Solve 2t + d = -4 for t. -2 Suppose 3u - 36 = 3n, -u = u - 5n - 27. Let r = u - 9. Suppose -ra + 0a = 0. Solve -2m - 2m - 8 = a for m. -2 Suppose -4y + 3y + 5j = -25, 0 = 5y + 5j - 5. Suppose n - 5h = -2n - 24, 4n = yh - 37. Let w = -13 - n. Solve 2t + 2 + 2 = w for t. -2 Let u(g) = -g*3 - 22g*2 - 21g + 17. Let b be u(-21). Solve 0 = -ba + 13a for a. 0 Let d be 8/(-44) - (-8)/(88/35). Solve 8 = -m + d for m. -5 Suppose 0 = 7r - 6r + p - 12, 87 = 5r - 4p. Solve -rd = -17d - 10 for d. -5 Let b = -12 + 12. Suppose -w + 8 = 3w, b = 3k - 4w - 82. Let z be (36/k)/(6/15). Solve 0 = 2c - zc for c. 0 Let h = -209 - -217. Solve hl = 3l for l. 0 Suppose 0 = -9q + 33 + 12. Solve -qp - 3 + 18 = 0 for p. 3 Let y(p) = -p - 6. Let x be y(0). Let i be (8/x)/((-8)/12). Solve 2w + 2 = -i for w. -2 Let n be (1/(6/8))/(8/12). Suppose -r = -no - 2, 4r - 5o - 7 + 2 = 0. Solve 5q + r = -25 for q. -5 Let j = 352 + -206. Let d = 148 - j. Suppose 8 - 2 = o. Solve -4 - o = -dr for r. 5 Let k(t) = -t3 + 8t*2 + 3t - 18. Let p = 35 + -27. Let y be k(p). Solve -3s = -s + y for s. -3 Let x(s) = s2 + 13s + 36. Let h be x(-4). Solve i - 3 = -hi for i. 3 Let n(q) = -3q + 33. Let y be n(10). Suppose 0 = yf - 5a - 6, 0 = -4a + a. Solve m - f = -m for m. 1 Let z(d) = -d2 + 17d - 28. Let r be z(15). Suppose 30 = -rh + 8h. Solve -i - h + 0 = 0 for i. -5 Let o(g) = -2g2 + 6g + 8. Let j be o(4). Suppose 2b - 21 = -0s + 3s, b - 4s - 18 = j. Solve -4 = -2u + bu for u. -1 Let v be 123/(4 - 1 - 0). Solve -v = 10q + 9 for q. -5 Suppose 0 = 5s - 30 + 120. Let j be (4/(-6) + 0)s. Suppose -l + j = -4r, 3l = 9r - 4r + 15. Solve -k + l = -2 for k. 2 Let u be (-6)/(-10)5 - -1. Let n be (u/(-7))/(-2) + 57/21. Solve -8 - 7 = np for p. -5 Suppose 4p - 5p = 0. Suppose p = -3n - 0n. Solve n = -3u - 2u + 15 for u. 3 Let w = 9 + -7. Suppose c + m - 2 = 0, wc - 4c + 4m - 2 = 0. Solve 4f - c - 3 = 0 for f. 1 Suppose 4 = 53j - 52j. Solve -jl + 27 - 7 = 0 for l. 5 Let m(j) = -j*3 - 7j*2 - j - 2. Let h be m(-7). Suppose 0 = q - hi - 22, -4q + 4i = -q - 44. Let k = -119 - -124. Solve 0 = -ko - 13 - q for o. -5 Let q be 6 + ((-12)/2)/3. Let z(x) = 3x. Let p be z(q). Suppose 0 = 4l - p - 8. Solve -lw - 4 = -w for w. -1 Let n(z) = z*2 - 30z + 2. Let h be n(30). Solve -3j + 3j = -hj for j. 0 Let j = -228 - -127. Let s = j + 102. Solve -i + s = 4 for i. -3 Let l = -687 + 715. Solve -l = -j - 28 for j. 0 Suppose -30a + 26a + 56 = 4g, 3g - 3a = 30. Solve -14l - g = -18l for l. 3 Let v(c) be the first derivative of 2c3/3 + 7c*2/2 + 3c + 2. Let y be v(-3). Let b(t) = t*2 + 9t + 10. Let w be b(-8). Solve y = wh + h + 3 for h. -1 Suppose 2n + 5p - 25 = 0, -148n + 35 = -147n - 5p. Solve -4h = h + n for h. -4 Let s(o) = -3o - 4. Let j be s(-3). Suppose f + jx - 11 = 0, -x - 4 = -3x. Suppose -2t + 6 = -q, 3t - 4q = -0q - f. Solve -tz = -0z - 15 for z. 3 Let v(q) = -6q + 35. Let f be v(4). Solve -f = p - 8 for p. -3 Let j(g) = 42g*3 - g. Let x be j(1). Suppose a = -5o + 12, 3a + 5 = -4o + x. Let y = a + -6. Solve yt = t for t. 0 Let z(f) = -f2 - 56f - 773. Let t be z(-31). Solve 4o - 2o = -t for o. -1 Suppose 0 = -2y + 1 + 5. Let k = -15 - -25. Suppose -p - 5 = -3x, 2x = -2p + 4p + k. Solve x = -yi - 15 for i. -5 Suppose -5b - 4i = -59, b + 3i - 47 = -3b. Suppose bk = 7k. Solve -2p - 8 = -k for p. -4 Let h(w) = 7w*3 - 11w*2 - 19w + 18. Let g(p) = 6p3 - 11p*2 - 18p + 17. Let i(z) = 6g(z) - 5h(z). Let a be i(12). Solve -3o - 2 - 1 = a for o. -1 Suppose -7 = -3b + 8. Solve 3 = -bd + 8 for d. 1 Suppose -30j + 613 = -227. Solve -jz = -36z - 32 for z. -4 Let z = -52 + 55. Suppose -5w = 0, 0 = 4u - 0u + zw. Solve u = 3q - 2q - 5 for q. 5 Let q be (30 - -5)4/10. Solve 0 = -qp + 20 + 36 for p. 4 Suppose 0j + 12 = 4j. Let s = j + 5. Suppose -sk = -3k. Solve -8l + 3l = k for l. 0 Let j(m) = 7m + 5. Let q be j(3). Suppose -4u + 4f + 28 = 0, -5f - q = -3u - 1. Suppose 5b - 4b = 0, 0 = ur + 2b - 10. Solve 1 = -rw + 3 for w. 1 Let v(i) = -4i2 - 8i + 9. Let t(l) = l*2. Let s(y) = -3t(y) - v(y). Let o be s(-9). Suppose -m - 2k = 0, 2m + 2k = -ok + 2. Solve -3z + z = -m for z. 1 Suppose -416z = -411z - 20. Let x = -4 + 7. Suppose a - f - 5 = x, -zf = -12. Solve 5v - a + 1 = 0 for v. 2 Let p(s) = s - 4. Let v = -35 - -73. Suppose 3z = -2l - z - 4, 5l - v = 2z. Let o be p(l). Solve -o = 3k + 4 for k. -2 Let w = 4 + -3. Suppose -z + w = -7. Solve 2q + 0q = -z for q. -4 Suppose 21 = -11i + 14i. Suppose 3v - 37 + i = 0. Solve -m - m = -v for m. 5 Suppose 0 = -l - 2v + 4, -v = l - 0 - 4. Solve lm + 2 - 10 = 0 for m. 2 Let o be 0 + 1 + (5 - (6 - 3)). Solve 5m = -o + 18 for m. 3 Let s(q) = 2q + 1 + 0q - 5q + 2q. Let l be s(-1). Suppose -3b = 4u - 25, -5b - 12 = -lu + u. Solve -ua + 3a - 4 = 0 for a. -1 Suppose 2r + 209 + 47 = -4z, -3z - 202 = -r. Let d = 68 + z. Solve 0 = -5u + du for u. 0 Let o be 9143/(-205) - -22/(-10). Let u = 57 + o. Solve 4v - u = -0 for v. 3 Let f = -47 - -87. Suppose -9g = -11g + f. Suppose 0 = -0m + 2m - g. Solve -3p - m = -p for p. -5 Suppose 0 = 3r + 3l - 63, 57 = -4r + l + 166. Let u = r - 21. Solve 0 = 3a - 4a - u for a. -5 Let t(k) = k2 - 5k + 8. Let j be t(6). Suppose 2z - 3z = -j. Let q = 16 - z. Solve -qu = -0u - 4 for u. 2 Let x = -1717 - -1724. Solve -xw - 12 = -10w for w. 4 Suppose -2w + 29 = -7. Suppose 2q = q + w. Let j be (-18 + 1320/77)/(6/(-14)). Solve 5d + q = -j for d. -4 Let p(w) = -2w*2 + 63w - 19. Let o be p(31). Solve 9g - og + 6 = 0 for g. 2 Suppose -4q = 4c - 8, -3c + 0c + q + 14 = 0. Solve -7 + c = -i for i. 3 Let w be (-1)/(2/(-16)2). Let v be ((-6)/6-7)/(-1). Let r(n) = -8n - 48. Let c be r(v). Solve wd - c = 8 for d. 4 Suppose 8g + 2 = 6g, 3f - 17 = -g. Solve 2k - 2 + f = 0 for k. -2 Suppose -5u = 5p - 45, -4u = -0u - 5p. Suppose ub + z - 84 = b, -2z = -3b + 74. Suppose -2n + 5 = -1. Solve 0 = -5j + b + n for j. 5 Let j = 217 - 215. Solve -4s = -2s + j for s. -1 Suppose -7c - 14c + 42 = 0. Solve -13 = co - 11 for o. -1 Suppose 5q - 5p - 15 = 0, -8q = -5q - 4p - 6. Solve -q - 6 = 6i for i. -2 Suppose 4n = -n + 50. Suppos	{ "pile_set_name": "DM Mathematics" }
is 26306 to the power of 1/10, to the nearest integer? 3 What is the square root of 6824 to the nearest integer? 83 What is 21888 to the power of 1/5, to the nearest integer? 7 What is the cube root of 790 to the nearest integer? 9 What is the cube root of 3171 to the nearest integer? 15 What is the square root of 13450 to the nearest integer? 116 What is the square root of 1314 to the nearest integer? 36 What is the square root of 235 to the nearest integer? 15 What is 2601 to the power of 1/3, to the nearest integer? 14 What is the cube root of 4288 to the nearest integer? 16 What is the ninth root of 10774 to the nearest integer? 3 What is the third root of 536 to the nearest integer? 8 What is 17756 to the power of 1/2, to the nearest integer? 133 What is the fourth root of 17107 to the nearest integer? 11 What is the cube root of 59465 to the nearest integer? 39 What is 76556 to the power of 1/3, to the nearest integer? 42 What is the cube root of 194293 to the nearest integer? 58 What is the third root of 10379 to the nearest integer? 22 What is 56 to the power of 1/4, to the nearest integer? 3 What is 542 to the power of 1/8, to the nearest integer? 2 What is 16840 to the power of 1/3, to the nearest integer? 26 What is 4762 to the power of 1/5, to the nearest integer? 5 What is the eighth root of 139029 to the nearest integer? 4 What is 892 to the power of 1/2, to the nearest integer? 30 What is the square root of 512 to the nearest integer? 23 What is the third root of 2546 to the nearest integer? 14 What is 319 to the power of 1/2, to the nearest integer? 18 What is 2474 to the power of 1/9, to the nearest integer? 2 What is 46068 to the power of 1/10, to the nearest integer? 3 What is 12413 to the power of 1/7, to the nearest integer? 4 What is the square root of 3537 to the nearest integer? 59 What is the fifth root of 5085 to the nearest integer? 6 What is the cube root of 21198 to the nearest integer? 28 What is 29607 to the power of 1/3, to the nearest integer? 31 What is 54638 to the power of 1/2, to the nearest integer? 234 What is 26994 to the power of 1/10, to the nearest integer? 3 What is the fourth root of 1992 to the nearest integer? 7 What is the square root of 14083 to the nearest integer? 119 What is the ninth root of 8250 to the nearest integer? 3 What is 115499 to the power of 1/2, to the nearest integer? 340 What is 1572 to the power of 1/6, to the nearest integer? 3 What is 16 to the power of 1/4, to the nearest integer? 2 What is the cube root of 15395 to the nearest integer? 25 What is 8416 to the power of 1/8, to the nearest integer? 3 What is 30311 to the power of 1/10, to the nearest integer? 3 What is 1039 to the power of 1/10, to the nearest integer? 2 What is 19022 to the power of 1/2, to the nearest integer? 138 What is the fifth root of 73402 to the nearest integer? 9 What is 6682 to the power of 1/3, to the nearest integer? 19 What is the square root of 194 to the nearest integer? 14 What is 2160 to the power of 1/9, to the nearest integer? 2 What is 1062 to the power of 1/4, to the nearest integer? 6 What is the cube root of 5185 to the nearest integer? 17 What is 9952 to the power of 1/2, to the nearest integer? 100 What is the square root of 72773 to the nearest integer? 270 What is 2710 to the power of 1/5, to the nearest integer? 5 What is 4055 to the power of 1/9, to the nearest integer? 3 What is 7622 to the power of 1/2, to the nearest integer? 87 What is the square root of 98013 to the nearest integer? 313 What is the square root of 5049 to the nearest integer? 71 What is 104781 to the power of 1/3, to the nearest integer? 47 What is 6576 to the power of 1/7, to the nearest integer? 4 What is the fourth root of 11065 to the nearest integer? 10 What is the square root of 344 to the nearest integer? 19 What is the square root of 481 to the nearest integer? 22 What is the third root of 13191 to the nearest integer? 24 What is the third root of 6358 to the nearest integer? 19 What is 36432 to the power of 1/2, to the nearest integer? 191 What is the fourth root of 44340 to the nearest integer? 15 What is the square root of 53183 to the nearest integer? 231 What is 15776 to the power of 1/2, to the nearest integer? 126 What is 56664 to the power of 1/2, to the nearest integer? 238 What is the square root of 1461 to the nearest integer? 38 What is 2763 to the power of 1/4, to the nearest integer? 7 What is 17 to the power of 1/4, to the nearest integer? 2 What is 178141 to the power of 1/5, to the nearest integer? 11 What is the third root of 1754 to the nearest integer? 12 What is 22672 to the power of 1/7, to the nearest integer? 4 What is the cube root of 633 to the nearest integer? 9 What is the fourth root of 18016 to the nearest integer? 12 What is the cube root of 204 to the nearest integer? 6 What is the third root of 9712 to the nearest integer? 21 What is the fourth root of 195 to the nearest integer? 4 What is the square root of 6157 to the nearest integer? 78 What is the eighth root of 53026 to the nearest integer? 4 What is the cube root of 4527 to the nearest integer? 17 What is 8735 to the power of 1/6, to the nearest integer? 5 What is the third root of 26944 to the nearest integer? 30 What is the cube root of 1604 to the nearest integer? 12 What is 2304 to the power of 1/8, to the nearest integer? 3 What is the third root of 19455 to the nearest integer? 27 What is 147193 to the power of 1/2, to the nearest integer? 384 What is 39165 to the power of 1/5, to the nearest integer? 8 What is 174939 to the power of 1/3, to the nearest integer? 56 What is the square root of 3032 to the nearest integer? 55 What is 940 to the power of 1/9, to the nearest integer? 2 What is the seventh root of 932 to the nearest integer? 3 What is the square root of 1295 to the nearest integer? 36 What is the square root of 342 to the nearest integer? 18 What is the third root of 19322 to the nearest integer? 27 What is the square root of 11595 to the nearest integer? 108 What is the square root of 1600 to the nearest integer? 40 What is the cube root of 3612 to the nearest integer? 15 What is 845 to the power of 1/2, to the nearest integer? 29 What is the sixth root of 31539 to the nearest integer? 6 What is the cube root of 4572 to the nearest integer? 17 What is 708 to the power of 1/2, to the nearest integer? 27 What is 3910 to the power of 1/2, to the nearest integer? 63 What is 1050 to the power of 1/2, to the nearest integer? 32 What is the tenth root of 1526 to the nearest integer? 2 What is 1535 to the power of 1/2, to the nearest integer? 39 What is the square root of 47 to the nearest integer? 7 What is 25298 to the power of 1/9, to the nearest integer? 3 What is 89126 to the power of 1/8, to the nearest integer? 4 What is 1815 to the power of 1/3, to the nearest integer? 12 What is 112595 to the power of 1/2, to the nearest integer? 336 What is the cube root of 1087 to the nearest integer? 10 What is the third root of 3256 to the nearest integer? 15 What is 72 to the power of 1/2, to the nearest integer? 8 What is the eighth root of 1805 to the nearest integer? 3 What is 14387 to the power of 1/7, to the nearest integer? 4 What is 3227 to the power of 1/7, to the nearest integer? 3 What is 14186 to the power of 1/2, to the nearest integer? 119 What is the cube root of 22921 to the nearest integer? 28 What is the square root of 42829 to the nearest integer? 207 What is 161297 to the power of 1/6, to the nearest integer? 7 What is the cube root of 259 to the nearest integer? 6 What is 55598 to the power of 1/2, to the nearest integer? 236 What is the square root of 11847 to the nearest integer? 109 What is 767 to the power of 1/4, to the nearest integer? 5 What is 20678 to the power of 1/3, to the nearest integer? 27 What is 14423 to the power of 1/3, to the nearest integer? 24 What is the square root of 6671 to the nearest integer? 82 What is the cube root of 59144 to the nearest integer? 39 What is 2942 to the power of 1/2, to the nearest integer? 54 What is the cube root of 120264 to the nearest integer? 49 What is the ninth root of 15248 to the nearest integer? 3 What is 88661 to the power	{ "pile_set_name": "DM Mathematics" }
7. Is f a composite number? False Let t(d) = 1267d - 27. Let z be t(16). Suppose z = 6k - k. Is k composite? False Let j(d) = 7d2 + d + 4. Let y be j(-3). Let t = 61 - y. Is (t + -2)((2 - 0) + -609) a prime number? False Let r be (200/(-2))/(26/(-6227)). Suppose -24i + 66938 = -r. Is i a prime number? False Let w(m) = 6553m*3 - 177m*2 + 691m - 7. Is w(4) a prime number? True Let i = 20113 - 827. Is i prime? False Suppose -322g + 32086330 + 25219044 = 0. Is g prime? True Suppose 460l - 15953972 = 167l - 165l. Is l a composite number? True Suppose 0 = 2w + 4k + 8, -k - 2 = -2w - 0. Suppose -2x + 7x = 590. Suppose 4m - 354 + x = w. Is m prime? True Suppose -4l = -4a - l - 100, a + 25 = l. Is (-3665)/(-3)(-15)/a prime? True Let g(v) = 2v - 28. Let z be g(14). Let l(w) = w*2 - 2w + 3. Let j be l(z). Is (127/(-4))/(-1 - j/(-4)) prime? True Suppose -2g = -4y - 10, 5g - 2y - 2 = g. Is g - -1 - (-7934)/2 composite? False Let f(z) = 8z - 267. Let g be f(5). Let a = 426 - g. Is a composite? False Let d(q) = q3 - 7q*2 + 10q - 24. Let n be d(6). Suppose 5s - 90 = 40. Suppose ny + y = s. Is y composite? True Let j(t) = -2t2 + 25t - 12. Let f be (-384)/(-112)7/2. Let y be j(f). Is ((-2)/(-4))/((-4)/(-2672)) - y prime? False Let a = 191267 - 71818. Is a a prime number? False Let l(n) = -3n*3 - 5n*2 - 14n - 33. Let z(f) = 4f3 + 5f*2 + 15f + 33. Let r(w) = 3l(w) + 2z(w). Is r(-10) a prime number? True Is 3/(-9) + (65419/3 - -9) a composite number? True Suppose 4s - y - 21 = 0, -4y - 14 = -7s + 5s. Suppose -3p + 2x = -2625, p - 863 = sx - 1. Is p a composite number? False Let u = 103723 - 53052. Is u a composite number? False Suppose -3x = -3j - 422394, 2x + j + 26806 = 308381. Is x prime? False Let n be (-25)/(-3) + (-4)/3. Suppose -g + 2 = -5i, 3i + i = -g - n. Is (3 + 1096/(-3))g prime? True Let v = -52030 + 83530. Let q be (v/(-24))/(9/(-12)). Let p = q + -313. Is p prime? False Let p be (9 - 2)603 + 6. Suppose -3o = -0o - p. Is o prime? True Suppose 2s - 5n = 10125, -5n + 5085 = s - 3n. Suppose k - 4488 - s = -2w, -k + w = -9572. Is k a composite number? True Let o be 1 - 3/((-15)/(-5)). Suppose o = 6r - 12. Suppose 0 = -9x + rx + 469. Is x a composite number? False Let o be -13 + 1 - (-4)/(-2). Let n = 55 + o. Let v = n + 222. Is v a prime number? True Let m(h) = -19625h - 533. Is m(-6) a prime number? False Is 166035 + (-3 + 7)1 prime? False Suppose 3j - 26 = 4d, -3j = -0j - d - 20. Suppose p + 3 = -0, -3y + 4p = -j. Is y/(34/(-3522)) a composite number? False Let y(q) = q2 + 10q - 23. Let g be y(-12). Let a be 2358/(1 + 5) + g/(-1). Let v = 1559 - a. Is v a composite number? True Let k(o) = -111o3 - o2 + 4o. Let c(m) = 166m3 + m2 - 6m. Let u(v) = -5c(v) - 8k(v). Let z be u(2). Let q = -74 + z. Is q composite? True Suppose -9 + 3 = t - 4q, -44 = -4t - q. Suppose 14u = 46 + t. Suppose -um + 572 = -496. Is m prime? False Let f(z) = -742z + 32. Let l be f(8). Let b = 10595 + l. Is b prime? True Suppose 0 = 3s + 3n - 84, -s = -n - 30 + 2. Suppose 197 = 5z + u, 189 = 9z - 4z - 3u. Let x = s + z. Is x a prime number? True Suppose 3z + 573 - 219 = 4y, -4z - 468 = -4y. Let n = 120 + z. Suppose 130 - 4 = np. Is p composite? True Suppose 3k + 47 = -3z - 2z, -2k - z = 22. Let a(m) = 6m2 - 52m + 26 + 34m + 25m. Is a(k) a prime number? True Let t(u) = 2710u2 + 111u + 697. Is t(21) a prime number? False Let q = 1626977 + -1149594. Is q a composite number? False Suppose -61k = -66k, -2d = 5k - 131962. Is d a composite number? False Let y be (-1)/(-3 + 2177/726). Let p = y - -2765. Is p a prime number? True Let q(r) = 48258r + 101. Is q(1) prime? False Is 6(-75 - -77 - (1 + (-591591)/18)) composite? False Let m = 528 + -508. Is (0 + 2)10610/m prime? True Let r(c) = -7823c - 25. Let u be r(-25). Suppose 0 = 9p + p - u. Is p composite? True Let w(p) = -26p3 + p2 - p - 1. Let z be w(-1). Is (z/(-54))/(2/(-14648)) a composite number? True Let i = 70 - 121. Let d = -49 - i. Is (4202 + -5)-3d/(-18) composite? False Let i be 51 - 40/81. Suppose ij - 31j = 292755. Is j a composite number? True Let u(k) = 33980k + 111. Is u(2) prime? True Suppose 0 = 9r - 39 - 51. Suppose n + f = -2, -rn + 11n + 5f = -18. Suppose t + 95 = 3h, -2h + nt = -5h + 89. Is h a prime number? True Let k(f) = f - 1. Let y be k(1). Let j be (0 + y)19/38. Suppose -5o + 1488 + 47 = j. Is o a composite number? False Let n(z) = 19z2 - 7z + 14. Let p be n(18). Suppose 2m = 5g + 1911, -4m - 2214 = -2g - p. Is m a prime number? False Suppose 0f - 4f - 3y + 63852 = 0, -2y + 63848 = 4f. Let h = -467 + f. Is h a prime number? True Suppose 0k = 4j - 3k + 4, -4j - 2k = 4. Let n(o) = -24o3 + 2o*2 - 2o - 3. Let q be n(j). Suppose 6v - 2885 - q = 0. Is v a prime number? False Let r(m) = 2m + 164 + 144 - 334. Let l be r(4). Let w(n) = -n*2 - 21n + 33. Is w(l) a prime number? False Let t = 1187 - 702. Is -14 - -10 - (-4 - t) a prime number? False Suppose -2578x = -2605x + 1217079. Is x a composite number? False Suppose 8 = -2c, -5w + 5c = -7w + 9434. Let g = -2974 + w. Is g a composite number? False Let d(q) = -q - q*2 - 4 + 2 + 1. Let t(v) = 2v*2 + v - 1. Let j(x) = d(x) + t(x). Is j(-26) prime? False Let b(i) = 176i - 26i - 6i - 121. Is b(7) prime? True Suppose -939784 = -14a + 6a. Is a composite? True Suppose 0 = 60y - 36765 - 2835. Let f(s) = -48s*2 - 3s. Let k be f(3). Let u = k + y. Is u a composite number? True Suppose 3u = d - 5u - 157705, u + 630882 = 4d. Is d composite? False Let u(x) = -1651195x*2 - 9x - 9. Let b be u(-1). Is (-12)/(-22) - b/209 prime? True Is 199293/(-8(-36)/96) prime? True Let h = 151 + -35. Let o = 580 - h. Suppose -1307 = -11l + o. Is l a composite number? True Suppose v = 4v - 108. Suppose 75 = 3l - v. Suppose 3w + 5r - 49 = 102, -5r = w - l. Is w a prime number? False Suppose -2u - u + 5867 = 5a, 7866 = 4u - 2a. Suppose 6q - u + 446 = 0. Is q a prime number? False Is -845424/(-6) - 2/6 a prime number? False Let y(g) = 279 - 89 - 25g + 2g - 96 - 90. Suppose -j + 4t - 21 = 0, -6 = 4j + 3t + 21. Is y(j) composite? False Suppose 0 = -5n - 5q + 5035, -3q - 440 - 4635 = -5n. Suppose 3o = -2y - o + n, -4y + 2060 = -4o. Suppose 4283 = 9d + y. Is d composite? False Let r be 76/19 - 60/(-3). Suppose rt + 6809 = 37841. Is t a prime number? False Suppose 3b = -4o + 91244 + 54490, 0 = -2o - 2b + 72866. Suppose 5p + 4t - o = 3t, 36425 = 5p - t. Is p composite? True Let r be (-8 - -6)/((-3)/(-9228)). Let x = r + 11659. Is x a composite number? False Suppose 0 = -2v + p + 323609, 0 = 14p - 13p - 5. Is v a composite number? False Let j = 243 - 212. Suppose -4i + ji - 134109 = 0. Is i prime? True Suppose -1283c = -1286c + 56139. Is c prime? True Let z = -962 + 1477. Let n(j) = 760j + 2. Let x be n(2). Suppose 3c - x = z. Is c a composite number? True Suppose -57g + 56g + 653657 = -2m, -g - 4m + 653627 = 0. Is g a prime number? True Suppose 14t = -t + 7125. Is t2 + (-8 - -11) composite? False Let w be 4 - ((-3)/(-9))/((-2)/60). Let i(k) = 2 + 5 - 10k*2 + 12 - 6k + k*3 + 22k. Is i(w) a prime number? False Let u = 8 + -4. Suppose 0 = uh - 4p - 2068, 4h - 2p = -6p + 2068. Suppose -4s = 3l - 2601 - h, -2s = -5l - 1572. Is s a prime number? False Suppose 0 = -101j + 105j + t - 1510982, 1133223 = 3j + 3t. Is j a prime number? False Let i = 415 + -505. Is ((-6)/(-15) + (-438594)/i)3 a prime number? True Let f be 6/21 + 145/7. Let q = 26 - f. Suppose -140 = -qr + 245. Is r a prime number? False Let v = 94 + -91. Suppose 8 = vy - 4t - 3, y + 5 = -3t. Is (y/(-2))/(2/(-1516)) prime? True Suppose 763m - 762m - 3f = 1239968, -5m = -4f - 6199829. Is m prime? False Suppose 8i - t - 19 = 6i, 3t = 4i - 39. Is -1(85401/6)/i-2 a prime number? True Suppose 3s = -3b + 1683, 0b - 567 = -b - 3s. Let l be (b/8)/(355/120 - 3). Let z = l + 2539. Is z composite? True Suppose 4w = -3f + 880865, 31f + 293587 = 32f - 3w. Is f composite? True Let t(n) = 84447n + 11150. Is t(7) a prime number? True Let h(c) = 636c*2 + 30c -	{ "pile_set_name": "DM Mathematics" }
the second derivative of x(q) wrt q. -2574 Let g(u) be the second derivative of -4916u3/3 - 295u*2 - 229u - 11. What is the first derivative of g(q) wrt q? -9832 Let z(g) = -80g3 - 7g*2 + 83. Let i(d) = 53d*3 + 5d*2 - 55. Let w = 167 - 90. Let h = w + -72. Let s(c) = hz(c) + 7i(c). Differentiate s(a) wrt a. -87a*2 Let t(o) = 635o*2 + 148o + 96826. Let k(f) = 141f2 + 33f + 21517. Let w(d) = 22k(d) - 5t(d). Differentiate w(l) wrt l. -146l - 14 Let q(k) = 7k - 3. Let f be q(1). What is the first derivative of 59 - o + 2o2 + 14o*2 - fo + 3o wrt o? 32o - 2 Let q(b) = -4b - 20. Let z be (264/14)/(-3) + (-8)/(-28). Let j be q(z). Find the second derivative of jm - 128m3 - 12m + 108m3 wrt m. -120m Suppose 13i = 7i + 18. Find the third derivative of 2l5 - 49l + 12l2 - 8l*2 - il*2 - 35l*6 wrt l. -4200l*3 + 120l2 What is the second derivative of -y2 + 56275 - 56275 + 244y4 + 8y*3 + 5106y wrt y? 2928y2 + 48y - 2 Let w(u) be the first derivative of -2u7/7 - 809u*4/2 - 2u*3/3 + 171u*2/2 + 4u - 5579. What is the third derivative of w(t) wrt t? -240t3 - 9708 Let w(r) = r2 - 1. Let i = 165 + -160. Let o(y) = -34y*3 - 5y*2 + 31y + 5. Let u(c) = iw(c) + o(c). What is the second derivative of u(k) wrt k? -204k Let p(i) = -i*3 - 4i*2 - 5i - 3. Let o be p(-4). Find the first derivative of 622y3 - o + 89 - 3y*4 + 6y*4 - 647y*3 wrt y. 12y*3 - 75y*2 Let s(t) be the second derivative of 367t*8/8 - 8t*4/3 + 19t3/6 - t2 + 508t - 7. What is the third derivative of s(z) wrt z? 308280z*3 Let a be 8/5 - (-3)/(-5). Let l be (11/(77/2))/(a/7). What is the second derivative of 2g + 43g2 - 10g - 71gl wrt g? -56 Let x = -118 + 137. What is the third derivative of 65p*2 - 132p*2 + 55p*2 - 6p*6 - xp*6 wrt p? -3000p*3 What is the second derivative of 24n - 1 + 8n - 10n - 5567n4 + 0 + 20n wrt n? -66804n2 Find the third derivative of -24s*3 + 11s*4 + 46s*4 - 1202s*2 + 25s*3 + 16s*4 - 24s*6 - 61s*4 wrt s. -2880s*3 + 288s + 6 Let k be (-122)/(-2) - (7 + -3). Differentiate 37n + 81n + 46n - 235n - k wrt n. -71 Find the second derivative of -16d + d - 40 - 76d*3 - 3d + 314d3 - d wrt d. 1428d Suppose a = 4x - 13, 2x + x + 20 = 5a. Let p = -342 + 345. What is the third derivative of 0u*2 + 3u*p - 4u*3 - 11u*3 - au*2 wrt u? -72 Let z(c) = -12c + 8. Let v be z(-4). Suppose 0a - v = -4a. Find the second derivative of -3j - 18j*2 + 10j - 3j + aj wrt j. -36 Let y(s) be the second derivative of -s*7/7 - 3s*6/10 + 9s*5/10 + 2s*3/3 - 679s*2/2 - 24s - 115. What is the second derivative of y(j) wrt j? -120j3 - 108j*2 + 108j Let a(m) = 9m3 + 97m*2 - 5. Let g = 69 + -77. Let p(r) = -13r*3 - 145r*2 + 8. Let u(z) = ga(z) - 5p(z). What is the third derivative of u(t) wrt t? -42 Let s(z) be the third derivative of -7z6/120 - z5/4 - 1149z3/2 + 3z*2 + 367. Differentiate s(x) wrt x. -21x*2 - 30x Let y(o) = -7o2 + 109o + 207. Let a(l) = -7l2 + 109l + 234. Let g(r) = -5a(r) + 6y(r). Differentiate g(k) with respect to k. -14k + 109 Let t = -31 - -34. What is the third derivative of -97s*3 - 22s*3 - 4s + 3s2 + 2s - 33st wrt s? -912 Let c(d) be the second derivative of 0 + 0d*2 + 59/2d*4 - 174d - 57d3. Find the second derivative of c(q) wrt q. 708 Suppose -8k + 2a = -5k - 8, 2k - 10 = -a. Find the third derivative of -4 + 49 - m6 - 5m*2 - 13m*4 + km*2 + 29 wrt m. -120m*3 - 312m Differentiate 2763r2 - 821r*2 - 3451 - 1263 + 1926r*2 wrt r. 7736r Let s(f) be the first derivative of -1327f4 + 1312f3/3 - f2 - 2f - 1164. What is the third derivative of s(b) wrt b? -31848 Let m(b) be the second derivative of -47b*3/2 - 17b*2 + 160b. Let u(h) = 289h + 67. Let i(l) = 5m(l) + 3u(l). Differentiate i(z) with respect to z. 162 Let w(c) = c3 - 8c*2 + c + 162. Let s be w(0). Find the second derivative of 184n*5 + 62n + 10n5 - sn wrt n. 3880n3 Let o(v) = -21. Let i(l) = -3502l + 4918. Let y(t) = i(t) - 2o(t). What is the first derivative of y(x) wrt x? -3502 Let z(b) be the second derivative of 3b*7/14 - 16b*4 + 1331b3/6 + b2/2 - 59b - 9. Find the second derivative of z(f) wrt f. 180f*3 - 384 Suppose -525 + 414 = -3j. What is the third derivative of 20c3 + jc*3 - 14c*2 + 2 + 4c*3 + 10c*3 wrt c? 426 Let p = -744 - -1510. What is the second derivative of -16a*2 - 1552 - 10a + 775 + p + 13a2 - 21a2 wrt a? -48 Let q(r) be the second derivative of r5/20 + 277r4/6 + 1112r*3/3 + 493r. Find the second derivative of q(j) wrt j. 6j + 1108 What is the first derivative of 1369 + 658 + 3051p*4 - 758p*4 + 137 wrt p? 9172p*3 Let t(c) = -4c - 62. Let r be t(-16). What is the derivative of rm - 72 - 19m + 104 - 57 wrt m? -17 Let i(v) = v*3 - 10v*2 + v + 54. Let g be i(10). Differentiate 184z + g - 82 - 57 wrt z. 184 Let t(r) be the second derivative of -763r5/10 - 179r*3/6 - 3r + 17. What is the second derivative of t(v) wrt v? -9156v Let h(r) = r2 + 2r - 2. Let d(q) = -464q2 - 36q + 390. Let w(a) = -2d(a) - 36h(a). What is the first derivative of w(j) wrt j? 1784j Let a(t) = -1850t*3 + 6t*2 + 180t + 13. Let m(l) = 1851l3 - 7l*2 - 173l - 17. Let r(h) = 5a(h) + 4m(h). Find the third derivative of r(n) wrt n. -11076 Let n(d) = 60d4 + 59d*2. Let y be 138/(-23)1/3. Let s(k) = -180k4 - 177k*2. Let m(j) = ys(j) - 7n(j). What is the third derivative of m(v) wrt v? -1440v Let x(c) be the second derivative of -5c6/2 - c3/3 + 1877c*2 - 1352c. What is the first derivative of x(h) wrt h? -300h3 - 2 Suppose -465t + 418t + 94 = 0. Let i(j) be the first derivative of -2/3j*3 + t + 13j + 0j2. Find the first derivative of i(p) wrt p. -4p Find the third derivative of 451556 - 2729j6 + j - 451556 + 802j*2 wrt j. -327480j*3 What is the third derivative of -1096 + 5888g*6 + 3965g*2 - 1041 + 2137 wrt g? 706560g*3 Find the third derivative of 755f*4 + 2273f*4 - 567f*4 - 1218f*2 wrt f. 59064f Let a(b) = 2b2 - 9b + 1. Let k be a(7). What is the third derivative of -132n4 + 3n*2 + 4n*6 + 15n*4 - kn - 3n6 wrt n? 120n*3 - 2808n Let l be 96/36-331/(-2). What is the second derivative of 2w2 - lw - 46w4 - 12w*4 - 3w*2 - 41w*4 wrt w? -1188w*2 - 2 Let n(t) be the first derivative of -2t5/5 + t3/2 - 75t2 - 152t - 28. Let u(q) be the first derivative of n(q). Differentiate u(o) wrt o. -24o2 + 3 Let o(y) be the third derivative of 503y*5/20 - 80y4/3 - y2 - 285. What is the second derivative of o(b) wrt b? 3018 What is the second derivative of 7v - 101 + 4v - 926v3 - 45v + 105 wrt v? -5556v What is the third derivative of 292226w*3 - 3w*2 - 293323w*3 - 113w + 6w2 wrt w? -6582 Let x = -157 + 241. What is the derivative of -46t*2 - x + 195 - 208 - 147 - 6t + 4t wrt t? -92t - 2 Differentiate 62p - 62p + 465p2 - 1037 - 1877p*2 with respect to p. -2824p Let t(i) = 27i - 209. Let s be t(8). What is the second derivative of 29x*3 + sx2 - x2 - 108x - 4x*2 - 13x wrt x? 174x + 4 Find the second derivative of 171h*5 - 52h*5 + 363h*5 - 9978h + 106h5 + 6h*2 wrt h. 11760h*3 + 12 Suppose -21u + 48 = 16 - 52. Let d(i) be the third derivative of 2/3i3 + 16i*2 + 0 + 3/5i*5 + 0i + 0iu. Find the first derivative of d(r) wrt r. 72r Suppose 0 = -19o + 11o + 32. Differentiate -273u4 + 46u*4 + 102 + 0u*o with respect to u. -908u*3 Let s(l) be the second derivative of 233l*3/2 + 1103l*2/2 + 4l + 141. Differentiate s(i) wrt i. 699 Suppose -5l + 11 + 9 = 0. Differentiate -47 - 72p*4 + 31p*l + 3p*4 with respect to p. -152p*3 What is the second derivative of 144267 - 47j - 144310 + 2j - 2j + 8769j2 wrt j? 17538 Let f(c) = -c + 4. Let t be f(2). Suppose 33m + 2a = 33m, 0 = 4m + 5a - 8. What is the third derivative of 15p5 - 2pm - p5 + 0pt wrt p? 840p*2 Let j(m) be the first derivative of -1994m*5/5 - 1190m**3 + 2077. What is the third derivative of j(w) wrt w?	{ "pile_set_name": "DM Mathematics" }
) -2 (b) 4311 (c) 2 a What is the closest to 110 in 3, 0.3, 0.1, 1/5, 4/3? 3 Which is the closest to -0.1? (a) -1411 (b) 1/3 (c) 3 b What is the closest to -1/18 in 74, -15, 3? 3 Which is the nearest to -0.08? (a) 1 (b) 2/3 (c) 25 b Which is the nearest to -2/481? (a) -1.2 (b) -3 (c) -2/11 (d) -0.11 d Which is the closest to 0.2? (a) 2/9 (b) 21 (c) -0.7 (d) 1/4 (e) -12 a What is the closest to 2.8 in 4, 1, 9, -0.028? 4 Which is the nearest to 2/5? (a) -2 (b) 411 (c) 2/9 c What is the nearest to -0.2 in -4.3, 0, -43? 0 Which is the nearest to -0.3? (a) -3 (b) 4 (c) -60008 (d) -2 (e) -5 d Which is the closest to 0? (a) -19 (b) -0.2 (c) 74 b Which is the closest to 2870? (a) 2 (b) 0.3 (c) -0.06 a What is the closest to -59 in -0.5, 0.4, -12/5, 3/7, 5? -12/5 Which is the closest to -1? (a) 19/4 (b) 4/7 (c) -3/13 (d) -0.5 d What is the closest to -2 in 1, 9, -0.2, -160? -0.2 What is the nearest to -1.8 in 0.03, -27, 2/25? 0.03 Which is the nearest to 3? (a) -1/5 (b) -189 (c) -2 (d) 2 d What is the closest to 7 in -0.2, -1, 3, 1? 3 What is the closest to -3/4 in 2/7, 2/23, 1/115, 6/5? 1/115 Which is the nearest to 8? (a) -2 (b) 246.78 (c) 1/4 c What is the closest to -10 in 0.08, 4, 7.6? 0.08 Which is the closest to -0.04? (a) 6/19 (b) -5 (c) -30 (d) -0.2 d Which is the nearest to 3? (a) 2/7 (b) 9 (c) 117 (d) 1/2 d Which is the nearest to 0? (a) -5 (b) 1209 (c) -3 (d) 83 c Which is the closest to 1? (a) -0.5 (b) -1.6 (c) 0 (d) -8 (e) -1/9 c What is the nearest to -262/35 in 2/5, 2, -4? -4 Which is the closest to 1/2? (a) -6 (b) -34.5 (c) 9 (d) 2/11 d Which is the nearest to 1.4? (a) -11549 (b) 0.4 (c) -4 b Which is the nearest to -4? (a) 404 (b) -3 (c) 1 (d) 13 b What is the closest to 3 in -1, 0.427, -5/6? 0.427 Which is the nearest to 2? (a) -2 (b) -13 (c) -0.054 (d) -0.3 c Which is the closest to 0.048? (a) -2/9 (b) -3 (c) -3/5 a What is the closest to 125 in 0.5, -4, -5, 5? 5 Which is the nearest to 0.05? (a) -2 (b) 0.3 (c) 3 (d) 730 b Which is the nearest to 0? (a) -1 (b) -15155 (c) 2/19 (d) -0.1 d What is the closest to -1 in -3, 5/114, 0.27? 5/114 Which is the nearest to 1? (a) -0.05 (b) 4/3 (c) -11840 b What is the nearest to -0.14 in 3, 10, -58? 3 Which is the nearest to 2/7? (a) -0.05621 (b) -4/3 (c) -6/11 a What is the closest to 135 in -1/8, -2/19, -23/2? -2/19 Which is the nearest to -1? (a) 3/2 (b) -2 (c) 548 b Which is the nearest to 2/3? (a) -3 (b) -5549 (c) -2/5 (d) -2/17 d What is the nearest to 0.11 in -3/17, 58, -4? -3/17 Which is the nearest to -20? (a) -8 (b) -2/7 (c) 2 (d) 3/4 a What is the closest to -1.932 in 5, -2/3, 0.0288? -2/3 What is the closest to -1 in -3, 6, 295, -2/5, -2? -2/5 Which is the nearest to 0? (a) -0.45 (b) 0.7 (c) -4 (d) 0 (e) 3 d Which is the nearest to -1/13? (a) 0.4 (b) 5 (c) -2/15 (d) -2/19 (e) 1.2 d Which is the nearest to 1/3? (a) -4 (b) -5 (c) -11.2 (d) -70 a Which is the closest to 21? (a) 14 (b) -2/23 (c) -7 a What is the nearest to 11 in 9, -1/4, 11/5? 9 Which is the nearest to 0.1? (a) -2 (b) -1 (c) -2/5 (d) 50 (e) 0.3 e What is the closest to -1/2 in 5, -13, 3/25, -3, 0.5? 3/25 Which is the closest to 4? (a) -3 (b) 42 (c) 1 c Which is the closest to -2/47? (a) -0.025 (b) -1 (c) -3 a What is the closest to -0.644 in 3/7, 2/11, 4, -0.3? -0.3 Which is the nearest to -4/9? (a) -4 (b) -0.3 (c) 6/29 b What is the nearest to 0.07 in -4, 0.13, -21, -0.2, -0.4? 0.13 What is the nearest to -0.1 in -1/3, 5, -14.67, -1, 0.03? 0.03 Which is the nearest to 1? (a) -92 (b) 2/5 (c) -24.2 b Which is the closest to 3/73? (a) -0.5 (b) 2/9 (c) -1 (d) -2 (e) 0.3 b Which is the closest to -3391/2? (a) -0.5 (b) -0.1 (c) -2 c What is the nearest to 1 in 60/11, 1/4, 29, -0.3, -1.7? 1/4 What is the nearest to 0 in 3, 54.3, 1/5, -3/4? 1/5 What is the nearest to -2/3 in 5, -80/7, -0.3, 2? -0.3 What is the closest to -1 in -0.4, 3768, -0.1? -0.4 What is the nearest to -7555 in 25, 1/5, 1/2? 1/5 Which is the nearest to 405? (a) -0.5 (b) 4 (c) 3 (d) 5 d What is the closest to -72 in -1/7, -15, -0.1? -15 Which is the closest to -2/11? (a) -21 (b) -0.4 (c) 0.1 (d) -6 (e) -9/4 b What is the nearest to 29 in -0.3, -24, 5, 0.237? 5 Which is the closest to -6? (a) 0.3 (b) 5 (c) 4 (d) -0.3 (e) -4/5 e What is the nearest to -2 in 147, -1/39, 4/5, 4? -1/39 What is the closest to 0.33 in -2/5, 3, 9, 0.4? 0.4 Which is the closest to 14? (a) -1/2 (b) 0 (c) 1/249 (d) 1 d Which is the nearest to -2/9? (a) -4 (b) 3 (c) -17 (d) 8 (e) 17 b What is the closest to 0 in 1.2, -0.5, -1, 361? -0.5 What is the nearest to -0.2 in 2/7, -1/4, 86, 0.186? -1/4 Which is the nearest to 4? (a) 4/7 (b) 24 (c) -77 a What is the nearest to -86 in -2/7, -2.8, -2? -2.8 Which is the closest to 2/5? (a) -155 (b) 3 (c) 5 (d) 2/53 d What is the nearest to -2/7 in -2/19, 0.6, -2/27, -3/2? -2/19 What is the closest to -1 in 6, 14, -2/9? -2/9 What is the closest to -0.3 in -22, 1, 2688? 1 Which is the nearest to 2/3? (a) 2/7 (b) -0.0073 (c) 2 (d) -9 a Which is the nearest to 612? (a) -0.5 (b) 4/7 (c) 1/4 b What is the nearest to -2/17 in -0.1, -1080/13, -3/4, -4? -0.1 What is the closest to -2 in 3, -1, 1043, -0.9? -1 Which is the closest to 0? (a) -338 (b) -3/11 (c) -4 b What is the closest to 0.2 in 9, -3, -2/13, -3/58? -3/58 Which is the closest to -5? (a) 0.08 (b) -1/2 (c) -5 (d) 2 (e) 3.9 c Which is the nearest to -1/5? (a) -1/4 (b) -79 (c) 5 a What is the nearest to 4974 in 0, -0.1, -4? 0 Which is the closest to 3/2? (a) -6 (b) 3 (c) -1/25 b Which is the closest to -2/11? (a) 1500 (b) -1/4 (c) -0.2 (d) -0.3 c Which is the nearest to -0.4? (a) 0 (b) -3/7 (c) 39 (d) 5 (e) -5 b What is the closest to -4 in -422, -1/10, 3/2, -0.2? -0.2 What is the nearest to 1/7 in -0.3, 1/15, -0.013? 1/15 What is the nearest to 1 in -28, 0.2, -0.4, 2/3, 0.4? 2/3 What is the nearest to 0.1 in 1, -11, 1/6, 4? 1/6 Which is the closest to -0.194? (a) 5 (b) 9/2 (c) -2/17 (d) -3/4 c What is the closest to -1 in 9.4, 2, 23/2, 5? 2 What is the closest to -448 in 5, 0.97, -5/4? -5/4 What is the closest to 2 in -24530, -4, 1? 1 What is the nearest to 1 in -887, 0.4, 5, -4, -3/2? 0.4 Which is the nearest to -2/7? (a) 2/7 (b) -1.78 (c) -3 (d) 4 a Which is the closest to -0.4? (a) 33 (b) -0.2 (c) 4/7 (d) 6/5 (e) -0.12 b What is the nearest to -0.17 in -2357, -4/3, -1? -1 Which is the closest to -4? (a) -15895 (b) -0.4 (c) -3 (d) -2/3 c What is the nearest to -2 in 264, 15, -0.1? -0.1 Which is the nearest to 34? (a) -25 (b) -5 (c) 0.5 (d) -0.5 (e) -0.2 c What is the nearest to 2/45 in 6/25, -1.2, 0? 0 What is the closest to -7 in 7, -3, -1? -3 What is the closest to -0.01 in 0.4, 5/2, -0.2, -1027, -3? -0.2 Which is the closest to -2/31? (a) 95 (b) -2/59 (c) 5 b Which is the nearest to -0.024? (a) -12 (b) -0.5 (c) -0.2 (d) 30 c Which is the closest to 1/8? (a) 0 (b) 2 (c) 4/7 (d) 11 (e) -142 a Which is the nearest to 13/2? (a) -59 (b) 1/7 (c) 0 b Which is the nearest to 1? (a) 0.4 (b) -0.6 (c) 0.12 (d) -0.1 (e) 4 a What is the closest to 2/7 in 12.3, 7, -21, 1? 1 What is the closest to 12/49 in -1, 1.6, -11/4, -5? -1 Which is the nearest to -1? (a) 1 (b) -16.6 (c) 2 (d) -1/2 (e) 3 d What is the nearest to -0.2 in -2/7, 7, 1, -10? -2/7 What is the nearest to 0 in -0.3, 2/7, -13, -159, -0.1? -0.1 What is the closest to -3 in -5966, -2, -4/5? -2 What is the closest to -0.00895 in 2, -4, 2/5, 1? 2/5 What is the closest to -0.03 in 0.105, 5, 3/4, 6? 0.105 What is the nearest to 0.1 in 4011, -3, -0.01? -0.01 Which is the nearest to 2? (a) 4186/9 (b) 2 (c) -0.5 b What is the nearest to -1/4 in 10, 5, -13? 5 What is the nearest to -4 in 5, -4585, 0.05? 0.05 Which is the nearest to 25/2? (a) -1/4 (b) -1/14 (c) -0.1 (d) 6 d What is the closest to -1 in -1/6, 0.5, 2, -5, -0.11? -1/6 Which is the closest to -1/4? (a) -0.5 (b) -4 (c) 94.2 (d) 5 (e) 0.3 a Which is the closest to 0.1? (a) -1/2 (b) 0.02 (c) -6.9 (d) -5 b What is the nearest to -4/9 in -2/5, 7/5, 0.3, 419? -2/5 Which is the nearest to 1? (a) -1/2 (b) 2 (c) 0.5 (d) 87 (e) 0.4	{ "pile_set_name": "DM Mathematics" }
of (-7)/(((-9)/(-36))/(-1 + c))? 1 Let d = 7138 - -9923. What is the hundreds digit of d? 0 Let d(x) = -3x + 9x + 40 + x*2 + 0x*2 - 5x. What is the tens digit of d(6)? 8 Let l(h) = -10h3 - 7h*2 - 7h - 2. Suppose -8s = 5m - 10s + 28, -3s + 16 = -m. What is the units digit of l(m)? 4 Let g be -24 - (-5 - (-1 + 0)). Let r be (-1)/(-5) + (-116)/g. What is the units digit of (675/10)/9r? 5 Let l(h) = -4h*2 - h - 1. Let t(m) = -9m*2 + 2m - 2. Let a(y) = -5l(y) + 2t(y). What is the units digit of a(-28)? 7 Suppose 5x = 174 - 164. Suppose -xr = 31 - 187. What is the tens digit of r? 7 Let c be (2/(3/(-3)) - 16)/(-2). Suppose c = -10j - 11. What is the tens digit of 2485/28 + j/(-8)? 8 Let b = -12982 - -48909. What is the hundreds digit of b? 9 Let p(v) = -27v*3 + 631v*2 + 14v - 54. What is the units digit of p(19)? 0 Suppose 0 = 18u - 32359 - 449069. What is the tens digit of u? 4 Suppose 9h + 42 - 78 = 0. Suppose -6 = -2q - 0. Suppose 3k + 210 = 3s, -qs - 70 = -hs + 5k. What is the tens digit of s? 7 Suppose 4k + 39 = 119. Let i = k + -20. Suppose ij = -j + 63. What is the units digit of j? 3 Let r = 503 - 204. Suppose 2v - 1289 = -r. What is the hundreds digit of v? 4 What is the thousands digit of 315/18(-30200)/(-70)? 7 Suppose h - 94 = -100, 4h + 12922 = 2c. What is the hundreds digit of c? 4 Let k(u) = u*2 + 14u + 50. Let t be k(-6). Suppose -2c - 5 = -3c, -tc + 1159 = 3q. What is the units digit of q? 3 Let s be (2/4)/(2/(-4)) + -3. What is the units digit of (s + 5/2)/((-12)/632)? 9 Suppose -7w + 11070 = 2w. Let t = w - 850. What is the units digit of t? 0 Let z = -4 + 8. Let h = 1431 - 1428. Suppose -zf + hn + 52 = -224, -n = 4. What is the units digit of f? 6 Let y = 9580 - 2855. What is the hundreds digit of y? 7 What is the tens digit of 126/(-36)728600/(-35)? 6 Let l(v) = -v3 - 147v*2 + 9v + 5471. What is the hundreds digit of l(-148)? 0 Let c(o) = 238o + 1355. What is the hundreds digit of c(74)? 9 Let m(c) be the third derivative of 4c*6/15 - 7c*5/60 + 3c4/8 + c3/6 - 2c2 - 51. What is the hundreds digit of m(2)? 2 Suppose 0 = 4c + c - 5580. Let s be c/(-20) + 1/(-5). What is the units digit of (6/(-8))/(21/s)? 2 What is the tens digit of (15 - -7681) + (-10 - -2)? 8 Suppose 12d = 25 + 23. Suppose k + d = o + 2o, 14 = 4k - 2o. Suppose 4l + 5p - 347 = 0, p - 185 - 254 = -kl. What is the units digit of l? 8 Let m = -7321 - -12223. What is the tens digit of m? 0 Suppose 4x - b = -3b + 28, x = -b + 7. What is the hundreds digit of 217(-3)/(-3) + x? 2 Let l = -3746 - -47907. What is the thousands digit of l? 4 Let g(k) = 2k. Let s(h) = 11h + 24. Let n(x) = 3g(x) - s(x). What is the tens digit of n(-30)? 2 Let o(q) = -q + 8. Let v be o(6). Suppose -3t = -vt - 312. Suppose -4a + 414 = 3b, -2b + t = 3a + b. What is the tens digit of a? 0 Let m be (2/(-6))/((4/(-6))/2). What is the tens digit of m/(4 + (-4 - -1)) + 235? 3 Suppose -x = 4a - 69350, 0 = -x + 541 - 543. What is the hundreds digit of a? 3 What is the thousands digit of (3 - (-210)/(-66) - (-973105)/(-55))-1? 7 Suppose k + 3 = -2a - 2, -4a + 15 = -3k. Suppose a = 5m - i + 414, 0m - 3i - 169 = 2m. Let j = 164 + m. What is the tens digit of j? 8 Suppose 0 = -i - 19 + 62. Suppose -4z + i = 35. What is the hundreds digit of z + 1 - (2 - 144)? 1 Let p = -24821 - -45592. What is the ten thousands digit of p? 2 Let r(z) = -17z + 9. Let x be r(0). What is the tens digit of 3(-4 - (-480)/x)? 4 Let d(r) = r3 + 15r*2 + 21r + 7. Let b be 2/(8/(-44)) - (-1 + 2). What is the tens digit of d(b)? 8 Let x = 5 + -14. Let l(w) be the second derivative of w*4/6 + 5w*3/3 - 10w*2 - w + 1. What is the tens digit of l(x)? 5 What is the thousands digit of ((-1137064)/(-30) - 3/9) + (-148)/(-740)? 7 Suppose -123 = 5w + z + 6, 2w = 4z - 34. Let f(x) = -48x + 42. What is the hundreds digit of f(w)? 2 Suppose 5203 = -2l + 3q + 19477, -35711 = -5l + q. What is the thousands digit of l? 7 Let z = -1888 + 12778. What is the ten thousands digit of z? 1 Suppose 96 = -b + 2z - 4z, -2b = 5z + 192. Let r = b + 525. What is the tens digit of r? 2 Let o = -67 - -73. Let a = o + -2. Suppose 241 = aq - 67. What is the units digit of q? 7 Suppose -2k = -3q - 167, k - 38 = 4q + 58. Suppose 2t = 2626 + k. What is the hundreds digit of t? 3 Suppose 5u = 3r + 49175 - 12146, -3u - 4r = -22171. What is the tens digit of u? 0 Let s = -10469 - -12319. What is the units digit of s? 0 Let g be (4/(-6))/(-4 - (-14)/3). Let o be 66 - (4 - 0/g). Let d = o + -54. What is the units digit of d? 8 Let l = 2202 - 895. Suppose -24h - l = -33683. What is the hundreds digit of h? 3 Let s(b) = 1923b - 272. What is the hundreds digit of s(6)? 2 Let b be (-361)/10 - 65/(-650). What is the units digit of (-2 - b/8)2560/25? 6 Let v(c) = -c + 2330. Let l be v(0). Suppose 3u = 5h - l, 3h + 2u - 1374 = -u. Let t = -270 + h. What is the hundreds digit of t? 1 Let n be 4(-25)/(-10) - -1. Suppose -ny + 25 = -6y. Let c = y + -2. What is the units digit of c? 3 Let r = -122 + 241. Let n = r + 110. What is the tens digit of n? 2 Suppose 12w = -8w + 40. Suppose 1284 = wx - 4g - 644, 0 = 3x + 4g - 2922. What is the units digit of x? 0 Suppose c - 904 = r + 14614, 0 = c - 5r - 15530. What is the tens digit of c? 1 Suppose h - 4h = 3h. What is the hundreds digit of (h + 2)/((-18)/(-1557))3? 5 Suppose 58678 = 173y - 135766 - 191000. What is the thousands digit of y? 2 Let v be (569 + -3)/2 - 2-2. What is the tens digit of (1476/v)/(0 - (-1)/126)? 4 Let x(a) = a2 + 11a + 27. Let h be x(-8). Suppose ho + 1446 = 3d, -5d + 4o + 629 = -1779. What is the hundreds digit of d? 4 Let n = 7858 + 11364. What is the units digit of n? 2 Let q = 36704 - 819. What is the hundreds digit of q? 8 Suppose 112n - 55n + 102n = 3671946. What is the units digit of n? 4 Let i be (563/(-2))/((-11)/22). Let c = i - -50. What is the hundreds digit of c? 6 Let c = 366 + 30. Let k = c + -273. What is the units digit of k? 3 Let z = 18844 + 218. What is the thousands digit of z? 9 Suppose p - 2p - 145 = 5u, -4p + 170 = -5u. What is the units digit of u/(5/25-2 - 0)? 5 Suppose 3o = 2w + o - 126, -3w + 184 = -4o. Let a = -2227 - -2208. Let z = a + w. What is the units digit of z? 9 Let b be (1 + -2)/(7/(-131901)). What is the tens digit of b/21 + (16/14)/(-4)? 9 Let q be ((-15)/10)/(3/(-6)). Suppose 0 = -5r - qg + 67, 38 = 5r + g - 31. Suppose -62 - 1128 = -ru. What is the tens digit of u? 8 Let f(g) = -5278g3 - g + 1. What is the tens digit of f(-1)? 8 Suppose -6u = -7u. Suppose 0 = 2g + 10, 5j + g - 2920 = 3g. Suppose -8b + 2b + j = u. What is the units digit of b? 7 Suppose 118 + 3672 = 10g. Suppose g - 71 = 4v. Suppose -r = 1, -3l + 3r + v = -223. What is the tens digit of l? 9 Suppose -17s - 8773 + 125238 = -27797. What is the thousands digit of s? 8 Let s = -175 + 28. Let u(j) = -6j*2 + 9j + 6. Let f be u(-6). Let z = s - f. What is the hundreds digit of z? 1 Let b be (-21)/6(1 - (-1 - 0)). Let l(q) = 6q + 6 + 2q2 - 7q + 6. What is the hundreds digit of l(b)? 1 Let l = -31970 - -53752. What is the hundreds digit of l? 7 Let r(w) be the first derivative of -w*4/2 + 2w*3 - 3w*2 - 17. Let m be r(3). What is the tens digit of (4 - (-204)/m)/((-2)/21)? 7 What is the hundreds digit of (-11 - 78/(-6)) + (0 - -3460)? 4 Let p(g) be the third derivative of 5/8g*4 - 21g*2 - g - 1/5g*5 + 0 + 8/3g*3 + 1/120g*6. What is the tens digit of p(11)? 6 Suppose h + 2817 = -5u, 4u + 3h + 1649 = -598. Let q = u - -927. What is the hundreds digit of q? 3 Suppose 2q = r - 11768, 3q + 1041 = 4r - 46046. What is the units digit of r? 4 Suppose -6n - 10 = -8n. Suppose 414 = 3g + 2v, 4g = ng + 2v - 138. Let a = -8 + g. What is the units digit of a? 0 Let p be 4 - 54/15 - 454/10. Let o = 87 - p. Suppose o + 388 = 2x. What is the hundreds digit of x? 2 Let x(k) = k3 - 10k + 24. Let v be x(14). Let h = -1407 + v. What is the tens digit of h? 2 Let j(z) = 3 + 18z + 5 + 9z*2 + 2z*3 - 3z*3 + 6z**2. Let d be j(16). Let b = d + -14. What is the tens digit of b? 2 Suppose 0 = m + 3	{ "pile_set_name": "DM Mathematics" }
hat is the difference between 21.48319225 and -14099? 14120.48319225 Calculate -0.8295315 + -45077382. -45077382.8295315 Calculate -2815.8575 - -953.456. -1862.4015 What is the difference between -473346 and -0.131306? 473345.868694 What is 18 take away 1023601232? -1023601214 What is -5.55 - -6264839069? 6264839063.45 Calculate -0.025346323458776 - -5. 4.974653676541224 What is the distance between 0.06067 and 65497.981? 65497.92033 What is -0.112 - 647948097251? -647948097251.112 Add together -183 and 1251811619424. 1251811619241 Put together -57604 and 43080140. 43022536 What is -7647861041 take away -277? -7647860764 Add together -12999 and 2721651. 2708652 Add together -6775 and -0.17775123. -6775.17775123 Calculate 249 + -110740087.773. -110739838.773 What is -28.1 plus 425499270? 425499241.9 Calculate -41.8491 + 4416608. 4416566.1509 Sum -1.0058792468 and 21. 19.9941207532 17.363+1746782632 1746782649.363 What is the difference between -6 and 154.127027263? 160.127027263 What is -16892730 - -0.187405? -16892729.812595 Add -224 and 204754148. 204753924 What is -53 less than -804727324.61? -804727271.61 What is 289123018114 + 3? 289123018117 -0.06 - 233544.51451043 -233544.57451043 What is -47180457 less than 0.07753? 47180457.07753 645560 - -0.053996 645560.053996 Work out -0.16794 + 295488362. 295488361.83206 Work out -0.4430806 + 500330. 500329.5569194 Calculate -0.2 + -396850027.708. -396850027.908 What is the difference between -11405220.816352 and 1? 11405221.816352 Sum -723 and -3961926.31. -3962649.31 Total of -602977395335 and 0.048. -602977395334.952 What is -87253066 less than 74534? 87327600 1985.3+672287727 672289712.3 Add together 317647 and 387073. 704720 Work out -0.7 - -803991287332. 803991287331.3 813.42500008222 + 3 816.42500008222 Sum -141239 and 1659947. 1518708 Total of 29858 and 15401405. 15431263 Calculate 3.971844466659 - 0.03. 3.941844466659 Work out 108075615 - -10790. 108086405 What is 5714 plus 30787260.111? 30792974.111 5+-106.1093074867 -101.1093074867 What is -33090112681 less than -6? 33090112675 Add 0.07993443788 and -0.9. -0.82006556212 -5.1726144520004 - -0.06 -5.1126144520004 Put together 166281831339595 and 0.02. 166281831339595.02 Calculate -461358583 - 3652. -461362235 Total of 1.91 and 4604511.477. 4604513.387 Calculate -7.872 - 31.977603. -39.849603 Sum 5514.3 and -634.53379. 4879.76621 What is the distance between 0.14 and -247265864.6075? 247265864.7475 0.07449673584+0.5 0.57449673584 -1202 - -255206284 255205082 -90501.7+737672.57 647170.87 Total of 0 and -145297.042189. -145297.042189 Work out 1471 - 398950101. -398948630 Add 0.2 and 2458633820341. 2458633820341.2 Work out 166.14980603 + -0.24. 165.90980603 What is 3010583413 less than -43538? -3010626951 What is 146788369624 - -12.5? 146788369636.5 Total of -210392657724976 and -0.4. -210392657724976.4 -214215358213 + -59 -214215358272 What is -4530 take away -43205093596? 43205089066 Sum 3999067502 and -18. 3999067484 What is 0.06 take away -14423032728? 14423032728.06 Total of 794 and 98963352. 98964146 What is -65767 less than -6839.18? 58927.82 -1.5369692 + -48.2648 -49.8017692 What is 113 minus 1502030382? -1502030269 What is 2698273797.38701 - -0.3? 2698273797.68701 Subtract -1.551 from 105123261. 105123262.551 Subtract 1.6 from 0.02362481161377. -1.57637518838623 What is 8266.933599 take away 1781? 6485.933599 Calculate -88411722945508 + 0.2. -88411722945507.8 Subtract -44228129475 from -4485. 44228124990 -56134354.7 + 6.6 -56134348.1 Put together -158944958.8234 and 0.3. -158944958.5234 Add together 1033 and 56.74399791. 1089.74399791 Total of -111548.4 and 1039.9982. -110508.4018 -28781557+1347927 -27433630 Add together 3 and 232442872000156. 232442872000159 What is 26024252066.169 minus 5? 26024252061.169 Calculate -0.0277 + 14863.1589903. 14863.1312903 What is -2197991.11168 - -0.351? -2197990.76068 Add together 23839 and -5949144. -5925305 What is -0.1111968531194 + 220? 219.8888031468806 What is 110.881 + 268130.3? 268241.181 Sum 62868641571 and 0.07473. 62868641571.07473 Add 0.18 and -18341.320017. -18341.140017 Sum 0.97843 and -1.20718194. -0.22875194 Put together -13484255 and -0.21328. -13484255.21328 What is 4.364877425 + 7012? 7016.364877425 What is -1 - 21229690987119? -21229690987120 Add -500157063 and -1.2412. -500157064.2412 What is 0.116 plus -2923.5867972? -2923.4707972 Work out -78135834405766 - 0.4. -78135834405766.4 -18233287014 + 0.01 -18233287013.99 Calculate 472466433 - -1399. 472467832 Work out -196656 + -5566301. -5762957 What is the distance between -2 and -2330849249326? 2330849249324 What is -1647.7932 minus 38380.43? -40028.2232 Work out 22036465 - -0.03025. 22036465.03025 Calculate 0 + -0.034674493584239. -0.034674493584239 Put together -97174061583 and 5. -97174061578 8946.82+32.12 8978.94 What is the distance between -2012843.37 and 3569? 2016412.37 Sum 1.61 and -0.230616585413. 1.379383414587 -896695828232 - -3 -896695828229 Total of 1438159252 and 68. 1438159320 Work out -30 - -4578995443659. 4578995443629 Subtract -513 from -0.842100415086. 512.157899584914 Add 1645734.066302 and 745. 1646479.066302 What is -7556.457 take away -339.69? -7216.767 What is 0.9512 + 13145983.9? 13145984.8512 Add -4323 and -23115.32959. -27438.32959 Subtract 82 from 2248182111. 2248182029 What is 83750025 - 314.7? 83749710.3 Sum -123.7 and -1.99613644. -125.69613644 What is -2.6 - -48510060758? 48510060755.4 Subtract 0.5 from -81020431012. -81020431012.5 What is -442.896 plus -65281356? -65281798.896 Subtract -189 from 111.6023923791. 300.6023923791 Calculate -17640338.7 - -6842. -17633496.7 Subtract 33858 from 0.068005108. -33857.931994892 110936.203429 - -2499 113435.203429 Work out -303 + 1018.097108. 715.097108 What is the distance between -151.4 and -3201600879? 3201600727.6 What is 0.07396 - 3031996? -3031995.92604 What is -85.525661919 - -3? -82.525661919 What is -1905.37 + 0.16952? -1905.20048 What is the difference between -706.031039043 and 4? 710.031039043 What is 1.1 + 55902729919208? 55902729919209.1 What is 3 minus 553.075227101? -550.075227101 What is -0.1058 minus 8310325103? -8310325103.1058 Add together 2180993016754 and -0.12. 2180993016753.88 Total of 147760156048 and 8319. 147760164367 Add -0.3 and -29.08388718664. -29.38388718664 What is 6.90484939145 + -678? -671.09515060855 Add together -1871399.52 and 2704. -1868695.52 Calculate -4 - -1035489848.22. 1035489844.22 Add together 51.1077 and 0.3008326287. 51.4085326287 Calculate -169 + 594366.431. 594197.431 What is -25412040422 minus -9? -25412040413 Subtract -2572126 from 1825279. 4397405 What is -25717 + -9593798? -9619515 Work out 132888963.6063 - -4. 132888967.6063 What is the difference between -0.4907828 and -0.27294? 0.2178428 What is -0.1 take away 40989687022722? -40989687022722.1 0.10959+0.307373993 0.416963993 Total of 16979397890 and -4. 16979397886 What is the distance between -0.038276 and -47399024? 47399023.961724 Add together -0.0914846601 and 4208. 4207.9085153399 -841 + -192218296941 -192218297782 What is 155584854498 minus 1208? 155584853290 -30656697179 - -3.6 -30656697175.4 Sum 0.07480003379 and 0.017. 0.09180003379 Add -1.6 and -0.21118219903. -1.81118219903 Sum 2726629010454 and 259. 2726629010713 Calculate 3337849767 + -69.29. 3337849697.71 Calculate -0.02 + -0.02677495286. -0.04677495286 What is -514246.8714481 + 1.11? -514245.7614481 Calculate -4903648.1 - 256.2. -4903904.3 Calculate -2210456147 + 0.1. -2210456146.9 -268212.60422 + 136.9 -268075.70422 What is 60773 + -4411984.4? -4351211.4 Add together -2494395 and -0.0699772. -2494395.0699772 What is the distance between 0.06901 and 0.3053652391? 0.2363552391 What is 0.30698229 minus 8342.3? -8341.99301771 Add together -264 and 728091985305. 728091985041 What is the difference between -21639663 and 0.010613? 21639663.010613 Total of -0.0193312502 and -581635. -581635.0193312502 Sum -74636 and 1076.2259. -73559.7741 1.0034 - 10.3534371 -9.3500371 0.5 + 1257103126026 1257103126026.5 What is 100644356 take away -3215? 100647571 Subtract 0.1 from -3.07009206336. -3.17009206336 What is -1274402 - 0.16048? -1274402.16048 Put together -0.7581 and -22301.428. -22302.1861 3332	{ "pile_set_name": "DM Mathematics" }
cc7))/c)/c18((((cc16)/c)/cc)/cc)/c(-17))(-34) assuming c is positive. c(-238) Simplify (c(-3)cc/c6)/((cccc/(c/(((c((cc*(2/3))/c)/c)/c)/c)))/ccc2)(c/(cc0))(-7/5)/(c(-2/5))(-4/15) assuming c is positive. c(-808/75) Simplify ((rr*(-18)/rrrrrrr(-1/6)r)/(r*(-1/4)rr31/r))(4/15) assuming r is positive. r(-103/9) Simplify (w(1/4)/w(-4/5)(w1)(-30))/((ww/((w/w1)/w))(24/5)/((w(-2/11)/w)/(ww/(w*(-6)w)))) assuming w is positive. w(-11337/220) Simplify (f(-1)f(f*(-8)ff)/f)(-1/19)/((ff(f/(f/f(-2)))/f)27/(f(1/3)/f)(-3/2)) assuming f is positive. f(539/19) Simplify (ii(i1ii)/i)(-3/4)/(i/(i/(i(-2/13)i))i/(i/(ii*(-5))i)i)((ii(6/11))/i(-2/5))/(i3(i*4i)/i) assuming i is positive. i*(-3504/715) Simplify (f/(f/(f/(f/(f/(fff(-1/3))f))))f)19/((ff(-3/5))/(((f6f)/f)/f))(f/(ff4))/(ff*2)(fff*3)/ff/f(-2/5) assuming f is positive. f(85/3) Simplify ((o*0o)*(-2/17)o*8oo0/o)/((o(-2/9)o8)/(o(2/7))(1/21)) assuming o is positive. o(886/7497) Simplify (u/(uu6))/(u/u(-7))u*(2/3)u(uu*(-5))/uuu/(uu/u*(-3/5)u)u2u/(u*(-1/5)/uuuu)uu/u(-3) assuming u is positive. u(-191/15) Simplify (a3)31/(a(-31)/a41) assuming a is positive. a165 Simplify ((((y/y(2/19))/y(-3/5))/(y2)(-2/67))42)9 assuming y is positive. y(3739932/6365) Simplify ((o(-1)/o)(-19)/(o*(-2/7)/ooo/(oo(o/((oo*(2/3)o)/o)o)/o)))/(o(-6)/((o(-2/9)o)/oo))(2/45) assuming o is positive. o(110339/2835) Simplify ((q(-18)/q(-4/9))/((q/q27)/((qq33)/q)))(-46) assuming q is positive. q(-17158/9) Simplify ((t/t26)/ttt(-4/27))/((t(5/6)/t)/ttt/(t/(t/t*12))tt) assuming t is positive. t(-863/54) Simplify (p(1/2)p*(-5)p)(-31)/((p0/p)*(-43)(p*(-2/5)pp)(-4)) assuming p is positive. p(719/10) Simplify b(-5)b/(bb/b(3/2))((bb(-6/7)b)/b)/bb(2/19)(((((b3/b)/b)/b)/b)/(b/(b/((b1/b)/b))))/((b/b6)/b(1/10)) assuming b is positive. b*(-101/665) Simplify ((((b(b(-11)/b)/b)/(b(-10)b))10)(-2/23))44 assuming b is positive. b(2640/23) Simplify (((((xx22/x)/x)/x)/x(2/25))/(x(10/13)/x(-13)))(-25) assuming x is positive. x(-1999/13) Simplify (((v/v*(8/9)v0)/(v2v)20)(-14/11))49 assuming v is positive. v(33614/9) Simplify q(2/19)/q(2/13)(q1)3((qqq(1/3)q)/((q/q*(-2/7)q)/q))12 assuming q is positive. q(47587/1729) Simplify (((((ddd/(d*(-2/15)d)dd)/d)/d(-3/8))(1/24))31)(1/16) assuming d is positive. d(13051/46080) Simplify ((f(-1))*(-37)((f/(f*(-6)f))/f)/(f/(f/f*5f)))/((f(-1/3))(-8/5)ff/(ff(-2/9)f)ff/(ffff(-1/7))) assuming f is positive. f(12002/315) Simplify ((((m/(mm/(mm(-4)m)))/m10)/(m/(((m(2/7)/m)/m)/m))(-2/157))(-1/10))(-3/26) assuming m is positive. m(-657/4396) Simplify (((dd(-44))/d)/(dd/d(-33/5)))/(d31)(-12) assuming d is positive. d(1597/5) Simplify ((m/(m*(1/3)m))*(-49)(m*11m)/(mmm/(m/(m*(-5/12)/m)mm)))(-23) assuming m is positive. m(-2737/4) Simplify (c(-2/9)c2)(-3/13)/(((cc/(c/((c/c(1/4)c)/c)))/c)*(-3)cc0cc(-2/7)/c) assuming c is positive. c(1229/1092) Simplify j(4/3)jj(-1/6)j(jj*0j)*(1/2)j*(-1/8)j*(2/3)jjj*(3/5)jjjj(-6/5)jj assuming j is positive. j(1333/120) Simplify ((u(-8)/uuu(-4/5))/(uu/u*(1/6)u(2/25)))/((u/(((u/u(-3/5))/u)/u))/(((uu(-3/2))/u)/uuu))19 assuming u is positive. u(-3511/75) Simplify ((x(2/17))(8/7))(2/5)/(x14/(xx*(1/2)x))45 assuming x is positive. x(-615761/1190) Simplify b(-10/13)/(b18b)(bb16)/(bb14) assuming b is positive. b(-231/13) Simplify (w30/w(-16))/((ww(-1/6)w)/w)18 assuming w is positive. w31 Simplify ((kk/(kkk36)kk(-13)/k)/((k/k(3/16))/((k(k*(7/2)/kkk)/kkkk)/k)))(-25) assuming k is positive. k(17325/16) Simplify ((oo(-18)o)/o*12(o*(3/5)/o)/(oo/(ooo*(-5)/ooo)))(-39) assuming o is positive. o(6318/5) Simplify (c/(c(-8)c)c((c/c*(3/4))/ccc)/c)(-2/105)/(c(-9/2)/c(-1/15))(2/7) assuming c is positive. c(229/210) Simplify ((z(-22)/zzz(-4))/(z/(z(-8)z))36)48 assuming z is positive. z*(-15072) Simplify (pp1)(-17)((p(-5/3)p)/p)/((pp(-1/3)pppp)/p)(p(2/7)/p)(2/37)/(pp/((p2/p)/p)p/p(3/2)) assuming p is positive. p(-63515/1554) Simplify (d(2/7))(-16/5)d(1/9)/d(-6)((ddd*(-5/2)dd)/d(d/(d(d/(d4d))/dddd))/d)/(d(1/2)/d(-1/8)) assuming d is positive. d(15301/2520) Simplify (((yy(1/2))22(y(-1/4)/yyy)(-42))(-10/9))(-36) assuming y is positive. y60 Simplify ((b(2/11)/((bbb(5/3))/b))/((bb(-2/39))/b(2/21)))(5/9) assuming b is positive. b(-50125/27027) Simplify ((qq(-9))(-17)/(((q1/q)/q)/(q((qqq(11/2))/q)/q)))(2/105) assuming q is positive. q(41/15) Simplify ((b(1/3))(-44))44((b/b(-4))/(bb*(1/11)b))/((bb(1/2))/(b(4/7)/b)) assuming b is positive. b(-297691/462) Simplify ((b(-5)b(-2/9))/((b/((((b(-4)b)/b)/b)/b))/b11))(1/19) assuming b is positive. b(-11/171) Simplify ((((qqq(-2/5)/q)/(q/(q(q*3/q)/q)q))/(q*(-2/7)q/q(1/2)))47)(-2/23) assuming q is positive. q(-1269/805) Simplify (d24/d)/(d/d(2/95))d(-9/5)/((d/(d(-5/6)/d))/d) assuming d is positive. d(10481/570) Simplify ((u/u(-2/23))/uu/(u*6u)u(u/(u/(u*(-1)/u)uu))/u(1/4))/((u(-1/3))26/(uu*(-1)u(2/3))) assuming u is positive. u(47/276) Simplify ((i*8i)/(i/i(-1)))(2/5)(i(7/4)i(5/3)/i)/(i0/((ii2/ii)/i)) assuming i is positive. i*(433/60) Simplify (((tt/t*11)/t)/tt/t(-1/5))18((t/(tt/(t/(tt/t(-4/5)))tt))/(t/(t/t1)))/(t(-1/4)/(t(-9)/tt)) assuming t is positive. t(-3819/20) Simplify ((((k(-11/4)k)/k)/k)/(k(1/5)/k))(-9)((k/(k/(k/k*(-3/4))))/kkk(2/13))/(k/(kk/k*4)kk(kk6)/k) assuming k is positive. k(2269/130) Simplify ((x(-1/3))(-1/12))7/((x/x0)/x(2/29))(-49) assuming x is positive. x(47831/1044) Simplify ((m/(mmm(-4/17)/m))/(m/(m/((mm*(-10)m)/m)))(m(-17))(-21/5))(-17) assuming m is positive. m(-6854/5) Simplify (((h(-6/5)hh(-3/4))/(h(-1))12)(-6/11))21 assuming h is positive. h(-13923/110) Simplify ((p8/(p/p(1/24)p))/(p*(-21)/pp16))36 assuming p is positive. p(867/2) Simplify ((z(-1)/z)1)(-35)(zz*(-2)zz(z(-3/2)/z)/z)/((z(2/13)/zz)/z1) assuming z is positive. z(1777/26) Simplify (((n/(n/n(-2/13))n(2/21))/(n7n(-6)/nn))(-15))47 assuming n is positive. n*(67915/91) Simplify ((zz*(-1/3)/z((z*(-11)z)/z)/z(z/(z2z))(-2/37))(-25))34 assuming z is positive. z(1153450/111) Simplify ((f*6/(((ff*(-1)/ff)/f)/fff))/(ff(-4)/ffff(-4)))/((f/(f/(f(2/7)/f)))*46(f(-1/3)/f)(-11)) assuming f is positive. f(634/21) Simplify ((k/(k7/k))/((kk(-1/9))/k)k(-1/5)/(k/k(-1/20)))28 assuming k is positive. k(-1547/9) Simplify (((tt/(tt/(t/t*(-8/5)t)))/t)*(23/4)(t(-11)/t)29)(1/23) assuming t is positive. t(-6661/460) Simplify ((z/(z(z(2/7)z)/zzzz))16)(4/7)((zz(-1/3))/z)(-42/11)/(z/z0zz(-2/9)) assuming z is positive. z(-148178/4851) Simplify ((w/w(-1/8))/w(-1))(2/137)/((w0)(2/63)(ww/(w/(ww(-1/4))))(-36)) assuming w is positive. w*(34541/548) Simplify (aa2/a)18a/(a/a(-3))(aa(-4))/a(((aa((a/(a/(a/(aa/(aa*(1/6))a))))/a)/a)/a)/a(3/2))/(a(2/5))(-37) assuming a is positive. a(607/15) Simplify (((k*(-1/2)/(kk(-2/19)))/(k(1/6)/kkk6))25)24 assuming k is positive. k(-86200/19) Simplify ((p*3p(-1/3)/p)/((p/p(-2/19))/p4))/(p(-1/10)pp*(-5)p)28 assuming p is positive. p(26038/285) Simplify (j42/j(3/5)(j/j41)/(j(j/(j/(j45/j)))/j))(-1/34) assuming j is positive. j(213/170) Simplify ((b/b1b)11)(-11/7)/((b(-2))(-1/39)/(b(-2/13)/(b(-7)b))) assuming b is positive. b(-3137/273) Simplify ((r(1/2)/r)/r)(1/6)/(r(-1))*43(r(r/(r/(r/((r/(r(2/7)r))/r))))/r)*(-35)(r	{ "pile_set_name": "DM Mathematics" }
i(r). 2r(r + 2) Let a(q) = 2q3 + 10q*2 - 10q - 2. Let s(i) = 3i3 + i2 + i + 1. Let t(z) = -a(z) - 2s(z). Determine f so that t(f) = 0. -2, 0, 1/2 Let k(y) be the third derivative of -y*5/150 - 2y*4/5 + 5y*3/3 - 134y*2. Factor k(s). -2(s - 1)(s + 25)/5 Let k(y) = -3y*2 + 3y + 10. Let q be -3 - ((-3 - 0) + 0). Let h(g) = 1 - 2g - g + qg + 3g2 - 10. Let d(b) = -4h(b) - 3k(b). Factor d(c). -3(c - 2)(c + 1) Suppose 12 = 5b - 8. Let r(g) be the first derivative of 0g + 2/25g*5 - 2/15g*3 + b - 1/5g*2 + 1/10g*4. What is n in r(n) = 0? -1, 0, 1 Let k be 27/6 - 200/80. Factor -1/4h*5 + 3/4h*4 + 0h*k - 1/2h*3 + 0h + 0. -h*3(h - 2)(h - 1)/4 Let c(f) be the first derivative of -2/15f*3 + 2/5f + 13 - 1/10f2 + 1/20f*4. Solve c(d) = 0. -1, 1, 2 Factor 255/4u*2 + 1008u - 256 + u3. (u + 32)2(4u - 1)/4 Let n(q) = -17q4 - 3q2 + q5 + 3q4 + 5q4 + q3 + 8q4 - 6q - 4. Let y(l) = l*4 + l + 1. Let g(m) = -n(m) - 4y(m). Factor g(x). -x(x - 1)(x + 1)*2(x + 2) Let 2/5h4 + 16/5h*3 + 24/5 + 56/5h + 46/5h2 = 0. What is h? -3, -2, -1 Let f be (66/(-176))/(14/(-4) + 3). Let y(l) be the first derivative of -4l*3 - fl*4 - 15/2l*2 - 6l - 2. Solve y(d) = 0 for d. -2, -1 Let d = 17 - 15. Factor 4sd - 3s*2 + 10s + 5s2 - s2. 5s(s + 2) Let p(q) be the second derivative of q6/45 - 2q*5/15 - 11q*4/18 + 22q*3/3 - 24q*2 - 29q + 10. Find u, given that p(u) = 0. -4, 2, 3 Let g(f) be the first derivative of -43f3/2 - 33f*2 - 3f/2 - 84. Solve g(o) = 0 for o. -1, -1/43 Let h(t) be the second derivative of -t*6/35 + 13t5/70 - t4/42 - 13t3/21 + 4t*2/7 + 9t + 18. Solve h(l) = 0. -1, 1/3, 1, 4 Let s(z) be the second derivative of 5z4/12 - 5z*3/3 - 3z - 39. Determine p so that s(p) = 0. 0, 2 Let q = 42548903/235105244 - 227/118084. Let k = 1/362 + q. Let -4/11w3 + 0w*2 + 2/11 - kw*4 + 4/11w = 0. Calculate w. -1, 1 Suppose -4o + 1208 - 420 = 0. Let -100q + 8 - 103q + oq + q2 - 3 = 0. What is q? 1, 5 Let u(k) = k3 - 23k2 + 78k - 36. Let o be u(19). Solve 0 - 4/7v + 10/7v*o - 8/7v*3 + 2/7v*4 = 0 for v. 0, 1, 2 Let g(d) be the first derivative of -21d*4/16 - 88d*3 - 13425d*2/8 - 1875d/2 - 592. Let g(r) = 0. Calculate r. -25, -2/7 Let n(s) be the first derivative of 15/2s4 + 0s + 20s3 + s5 + 20s*2 + 14. Factor n(v). 5v(v + 2)3 Let z(k) be the first derivative of -27/25k*5 - 21/5k*3 - 22 + 6/5k - 9/10k2 - 15/4k*4. Factor z(f). -3(f + 1)*3(9f - 2)/5 Let v(m) be the third derivative of m8/336 - 53m*7/42 + 220m*6 - 19602m*5 + 838530m*4 - 3162456m*3 - 17m2 + 7. Find k such that v(k) = 0. 1, 66 Let j(o) be the first derivative of o6/11 - 2o5/11 - 29o*4/11 + 80o*3/33 + 138. Solve j(m) = 0. -4, 0, 2/3, 5 Let h(f) = 2f*3 + 293f*2 + 4196f - 3. Let n(d) = -7d3 - 878d*2 - 12591d + 8. Let r(x) = 8h(x) + 3n(x). Factor r(m). -5m(m + 29)*2 Let n(g) be the third derivative of 1/360g*6 + 2/9g*3 + 0 + 1/8g*4 + 19g*2 + 1/30g*5 + 0g. Factor n(j). (j + 1)*2(j + 4)/3 Factor 81/5l + 3/5l*2 + 30. 3(l + 2)(l + 25)/5 Factor 1/5m*4 + 9 + 12/5m*3 + 84/5m + 10m2. (m + 1)(m + 3)*2(m + 5)/5 Factor -9576/5h3 - 684/5h + 12/5 + 2352/5h4 + 10083/5h*2. 3(h - 2)*2(28h - 1)2/5 Let x(a) be the third derivative of 1/504a*8 + 10a + 0a3 - a2 - 1/90a*6 + 0a*4 + 0 + 0a*5 - 1/315a*7. Solve x(g) = 0. -1, 0, 2 Let i be (-308)/84 + -1 + 4/6. Let y(g) = -2g3 - g + 4. Let u(w) = -w3 - w + 2. Let l(x) = iy(x) + 7u(x). Factor l(j). (j - 2)(j + 1)2 Let l be (-7 + 7)/(-3 - 0). Suppose 37 - 25g + 3g2 + g + 11 + lg = 0. What is g? 4 Suppose 0 = -392v - 300v - 69v + 2283. Solve -2/5i*4 + 4/5i*v + 0 + 0i + 0i2 = 0. 0, 2 Suppose 4d = 8d - 44. Find g, given that -d + g3 + 1 + 3 - 9 + 24g - 9g2 = 0. 1, 4 Let r = -3 - -7. Let i be 2/(-2) - (-5 - 1). Factor 2k*r - 4k*2 - ik*2 + 3k*2 + 4k. 2k(k - 1)*2(k + 2) Suppose -76m + 71 = -157. Factor 0r - 2/9rm + 2/9r*2 + 0. -2r*2(r - 1)/9 Let s(r) be the second derivative of -2r6/15 + 7r5/5 + r4 - 46r3/3 + 28r*2 + 90r. Factor s(u). -4(u - 7)(u - 1)*2(u + 2) Let n(m) = 4m4 - 9m*3 - 4m*2 + 12m - 3. Let s(q) = 12q4 - 28q*3 - 12q*2 + 36q - 8. Let c(i) = -8n(i) + 3s(i). Factor c(o). 4o(o - 3)(o - 1)(o + 1) Let c(i) = -12i2 - 10i - 8. Let b(z) = 2z. Let k(q) = 5b(q) - c(q). Factor k(f). 4(f + 1)(3f + 2) Let b(t) be the second derivative of 12t*2 + 23t*3 + 0 + 37/10t*6 + 5/14t*7 + 95/4t*4 + 267/20t*5 - 2t. Factor b(s). 3(s + 1)3(s + 4)(5s + 2) Suppose 4m - 10 = -3k, 0 = 3m + 2k - 6 - 2. Factor -3r2 + mr*3 - 16 + 8r*2 + 7r*2. 4(r - 1)(r + 2)2 Suppose 7r - 4r = -z - 12, -z - 5r - 16 = 0. Let c be 6 + 28/z + 0 + -1. Factor 2/3f - 1/3f2 - c. -(f - 1)2/3 Let -5u + 5/3u*2 - 650/3 = 0. What is u? -10, 13 Let c(s) = -20s - 116. Let r be c(-6). Let b(m) be the third derivative of -9/10m3 - 6m*2 - 3/100m*5 - 1/600m*6 - 9/40m*r + 0m + 0. Factor b(y). -(y + 3)*3/5 Let y be 4 - 33/9 - ((-104)/6 - -17). What is n in -5/6n + 0 - 2n4 - 4n*2 + yn*5 - 35/6n3 = 0? -1, -1/2, 0, 5 Let v(r) be the third derivative of r5/480 + 21r4/32 + 125r*3/48 - 649r*2. Factor v(s). (s + 1)(s + 125)/8 Let q be (-2 - -6)1/20. Let s(b) be the first derivative of 6 + 0b + 1/30b6 + qb*3 - 3/25b*5 - 1/5b*2 + 1/20b*4. Find t such that s(t) = 0. -1, 0, 1, 2 Let f(z) be the third derivative of 0z + 1/735z7 - 10z*2 - 2/21z*3 + 0 - 5/84z*4 - 1/70z*5 + 1/420z6. Let f(s) = 0. What is s? -1, 2 Let y(j) be the first derivative of -j4/12 - 5j3/3 + 8j*2/3 + 93. Factor y(r). -r(r - 1)(r + 16)/3 Factor -230x + 247x + 54x*3 + 4x*5 - 20x*4 - 3x*5 - 52x*2. x(x - 17)(x - 1)3 Let i(d) be the first derivative of 13/9d*3 + 1/6d*4 + 8d - 7 + 4/3d2. Let n(g) be the first derivative of i(g). Factor n(t). 2(t + 4)(3t + 1)/3 Find y such that 343/6y3 - 79092 - 1911y*2 + 21294y = 0. 78/7 Let g = -7614/5 + 59117/40. Let r = 45 + g. What is j in 1/8 + 1/4j + rj*2 = 0? -1 Suppose 5 = -11t + 10t. Let p be t - (-1 + (-396)/39). Suppose 10/13j - 280/13j3 + 1152/13j*5 - pj*2 + 960/13j*4 + 2/13 = 0. Calculate j. -1, -1/6, 1/4 Let p be 0 - (-2 + 0/3). Let m(y) = -2y*2 - 14y + 19. Let b be m(-8). Factor 2i4 - 3i + i + 7i2 - 6ib - ip. 2i(i - 1)*3 Suppose 0 = 148v - 150v + 10. Factor -8 + 4z*2 - vz*2 + 7z*2 - 10z*2 - 12z. -4(z + 1)(z + 2) Find g such that -6g + 20g*2 + 1710g*3 + 28g*4 + 2g - 1658g3 = 0. -1, 0, 1/7 Let o = -311/24 + 105/8. Let g(k) be the third derivative of -ok*4 - 1/105k7 - k2 + 0k + 0k*3 + 1/10k*5 + 0k*6 + 0. Let g(h) = 0. What is h? -2, 0, 1 Let l be 189/72 - (15/24 + -1). Let s(a) be the first derivative of 5/12a*l + 1/4a - 2 - 3/4a2. Factor s(y). (y - 1)(5y - 1)/4 Suppose -39b + 37b = 0. Let s(g) be the third derivative of 1/9g*4 + 4/9g*3 + 1/90g*5 + b + 0g + 7g2. Factor s(d). 2(d + 2)*2/3 Let h be 2/6(1 - 0). Let x = -303/2 + 917/6. Factor 4/3f5 + hf*3 + 0 - xf*4 + 0f + 0f2. f3(2f - 1)2/3 Let g(o) be the second derivative of o7/105 - o6/60 - o5/30 + o4/12 + 9o*2/2 + o. Let p(l) be the first derivative of g(l). Find w such that p(w) = 0. -1, 0, 1 Suppose -44j = -43j. Let d(q) be the second derivative of 1/28q*7 + 0q*5 + q - 1/20q*6 + 0 + jq*3 + 0q*2 + 0q*4. Factor d(i). 3i*4(i - 1)/2 Let m(r) be the third derivative of -r6/60 + r5/6 + r*4/6 - 8r*3 - 191r*2. Solve m(l) = 0. -2, 3, 4 Let r be 15 + (405/10)/(-3). Let 0i*2 - 3/2i*4 + 0 + 0i - ri3 = 0. What is i? -1, 0 Let t(c) be the third derivative of -c6/780 + 2c5/195 - c4/156 - 2c3/13 - 2c2 - 1. Solve t(n) = 0 for n. -1, 2, 3 Let u(f) = -f3 + 3f2 + 2. Let g be u(3). Let x be (-169)/(-234) + 2/(-9). Find i, given that -x + 1/2i*3 + 3/2i - 3/2ig = 0. 1 Let -8/3y + 2/3y2 - 8 = 0. What is y? -2, 6 Let n = -440/3 - -147. Let v(y) be the first derivative of 0y*2 - 8 + 0y + ny*3. Fac	{ "pile_set_name": "DM Mathematics" }
it of p? 6 Suppose -3w + 8 = 17. Let j(q) = q3 + q2 + q + 1. Let a(i) = 3i3 - i2 + 2i + 6. Let n(m) = -a(m) + 4j(m). What is the tens digit of n(w)? 1 Let f be (-1 + 3)/(-4 - -5). Suppose -fc = -q - q - 24, 4c + 4q = 32. What is the units digit of c? 0 Suppose 5s = 4j + 41, -2j - 20 = -2s - 4j. Let i(l) = sl3 + 0l*2 - 2l*2 + 4l2 - l. What is the units digit of i(1)? 0 Let w(r) = -r3 + 8r2 - 9r + 14. What is the tens digit of w(4)? 4 Suppose 3m = 2t - 17, -8m = 3t - 3m + 3. Suppose tn - 19 = 33. What is the units digit of n? 3 Let a(c) = 6c2 - 1. Let w be a(-1). Suppose 4 - 14 = -wk. Suppose 0l + 4z - 14 = -kl, -5l - 5z + 35 = 0. What is the units digit of l? 7 Let t(k) = k2 - 13k + 6. Let o be t(13). What is the units digit of ((-188)/o)/((-10)/15)? 7 Let g be (2 - -1) + (0 - 0). Suppose z - y = 3z - 9, z - gy - 8 = 0. What is the units digit of z? 5 Suppose 0t - d + 293 = 3t, 0 = -t - 5d + 121. Suppose u - t = -3u. What is the units digit of u? 4 Let h(s) = -5s - 2. What is the units digit of h(-1)? 3 Suppose -4m - 3y = -0m - 28, 5y - 16 = m. What is the units digit of m? 4 Let b be (-15)/(-2)16/6. Suppose 0 = -2u - 2 + 12. Suppose -uy = -z + 3z - 15, -4z = b. What is the units digit of y? 5 Let s(w) = -w*3 - 4w*2 - 3w - 2. Let t be s(-3). What is the units digit of ((-2)/t - 2) + 2? 1 Suppose 0y - 2y = 0. Suppose 17 = t + 2. Suppose yh + 5h = t. What is the units digit of h? 3 Let x = 0 - -19. Let a = 49 - x. Suppose -z = 4u - a, -5z + 2u + 10 = -3z. What is the tens digit of z? 1 Let b(r) = 2r2 + 4r + 3. Let p be b(-2). Suppose -2f = -3f - a + 4, -4a + 16 = 3f. Let h = p + f. What is the units digit of h? 3 Let l be 15 + (-14 - -11). What is the units digit of 3/6(l + 8)? 5 Suppose -3f = -8 - 10. Suppose -14 - f = -5u. Suppose 3y + 5h = -0y + 15, 0 = -uy - 2h + 34. What is the units digit of y? 0 Let g(f) = -f2 + 4f. Let u be g(3). Suppose 0y - 7 = -o + 2y, 0 = -5y - 5. Suppose -2s = 3w - 23 + 1, us = -ow + 36. What is the units digit of w? 6 Suppose -a - 5u - 4 = 0, -4a + 0u = 3u - 1. Suppose 52 = 4d - j - j, 2j = -2d + 14. Let y = a + d. What is the tens digit of y? 1 Suppose -2s + 16 = v, -1 + 50 = 4v + 5s. Let j = -4 + v. What is the units digit of j? 2 Let z be -1(-3 + -1)/(-4). Let w(c) = -23c + 2. What is the units digit of w(z)? 5 Let i = 152 - 61. Suppose -2x + 72 = -b, -29 - i = -4x - 4b. What is the units digit of x? 4 Let k = -59 + 94. What is the units digit of k? 5 Let s(f) = 5f - 2. Let h be s(-2). Let b = h - -17. What is the units digit of b? 5 Suppose 3x + 30 = 6x + 3d, -2x + 20 = -5d. What is the tens digit of x? 1 What is the tens digit of (3/(-1))/(3/(-17))? 1 Let s(l) = 3l2 + 4 + 2l*2 - 4l*2 + 3. What is the units digit of s(0)? 7 What is the units digit of (79 - (-3)/(-3))1? 8 Let r = 3 + -5. What is the units digit of (-1)/(134/(-66) - r)? 3 Let p(d) be the first derivative of d*4/4 - 2d*3 + 4d*2 - 4d + 2. What is the units digit of p(5)? 1 Suppose -5 = -0w - w. Let p(v) = 6v - 9. What is the tens digit of p(w)? 2 Let v(o) = 2o2 - 2o. Let f be v(2). Let d be -2 + (-12)/(-2 + f). Let m = -2 - d. What is the units digit of m? 6 Let v(p) = 6p + 1. Suppose 0 = 2j - 0j + 2. Let o be v(j). Let i = 3 - o. What is the units digit of i? 8 Let h = 57 + -31. What is the units digit of h? 6 Suppose -4l - 13 = -4z - 5, 3l = z. Let g = -1 + l. Suppose -2w + 2v + 8 = 0, g = 4v - 0v - 16. What is the units digit of w? 8 Let s = 129 + -11. What is the units digit of s? 8 Suppose 0 = -0g + 2g - 26. What is the tens digit of g? 1 Let t = 6 + -1. What is the units digit of t + (1 - -3 - 1)? 8 Suppose 0 = -2n - 2j + 4j, -5j = 2n - 21. Suppose ns + 12 = 6s, -5g - 2s = -68. What is the tens digit of g? 1 Let k = -27 - -34. What is the units digit of k? 7 Let l(k) = -2k*2 - 15k - 8. Let y be l(-10). Let n = y - -86. What is the tens digit of n? 2 Let x(n) = n*2 - 5n - 1. What is the units digit of x(-4)? 5 Suppose -3h + 6h - 198 = -4r, -100 = -2r - h. Suppose -y + 7 = 3k, 5y = k + r - 0. What is the units digit of y? 0 Let u = 142 + -122. What is the units digit of u? 0 Suppose -5m - 48 - 27 = 0. Let x be 5/m + 68/(-3). What is the units digit of 1 - 2 - (x + 1)? 1 Suppose 2a + 3a = 70. Let j = -3 + a. What is the units digit of j? 1 Let r = -22 - -26. Suppose 0 = -rl + 3l + 36. What is the tens digit of l? 3 Suppose 19w - 2w = 459. What is the tens digit of w? 2 Let h(o) = -o2 - 7o - 4. Let j be h(-6). Suppose -21 + 1 = -jf. What is the tens digit of f? 1 Suppose -5g + 3 = -7. Let z(j) = 2j2 - 5j + 3. Let p be z(3). Suppose -go - o + p = 0. What is the units digit of o? 2 Suppose -5d + 15 = -5. Suppose -v - 3 = -d. What is the units digit of v? 1 Let k = -11 - -77. What is the units digit of k? 6 Let n(k) = -3k. Let r = -13 - -10. What is the units digit of n(r)? 9 Let r(o) = o2 - 12o + 1. What is the tens digit of r(14)? 2 Let k(p) = -7p - 1. Let j be k(-1). Suppose 8m - jm - 38 = 0. What is the tens digit of m? 1 Let v be ((0/3)/(-2))/(-2). Let j = -1 + 6. Suppose y - 29 = -3r, vy = r - jy + 1. What is the units digit of r? 9 Let z = -169 + 295. What is the units digit of z? 6 Suppose -4y + 133 = -5k, -y - 3k - 3 = -15. Suppose -f + 0 = 4, y = 5h + 2f. What is the units digit of h? 7 Suppose 2z + 3m = 80, -3m - 42 = -z - 4m. Let x be z - -3(-4)/6. Suppose -6c - 27 = -p - 2c, -2p = -3c - x. What is the tens digit of p? 1 Let c = 25 - -57. What is the units digit of c? 2 Let l(a) = 10a2 + 3a. What is the tens digit of l(2)? 4 Let o(v) = -v - 6v + 0v2 - 5 - v2 + 2. Let k(y) = y*3 + 3y*2 - 2y + 3. Let n be k(-4). What is the units digit of o(n)? 7 Let a be 3/(-6)(0 - -62). What is the tens digit of -3a/(-6)-2? 3 Let y = -8 + -10. Let x be 9/y74-1. Let t = x - 21. What is the units digit of t? 6 Suppose 2g = 4g + 2a - 12, -5g + 5a + 60 = 0. What is the units digit of g? 9 Let h = 29 - 27. Suppose 0 = 5v - 9 - 86. Suppose hf + w = 13, 5f = -3w + v + 13. What is the units digit of f? 7 Let o(w) be the first derivative of -w*3/3 + 7w*2/2 - 6w - 1. Let a be o(4). What is the units digit of (-10)/(-4) - (-3)/a? 3 Suppose -2d - 3x = -5x - 264, 3x + 260 = 2d. What is the hundreds digit of d? 1 Let t(d) = 0 - 4d - 3 + 3d. What is the units digit of t(-5)? 2 Let g = 299 - 126. What is the tens digit of g? 7 Let i(j) = -9j*2 + 6j + 1. Suppose 0 = -0m + m - 5. Let v(z) = -8z*2 + 5z + 1. Let o(r) = mi(r) - 6v(r). What is the tens digit of o(-2)? 1 Let h = 18 + 59. What is the tens digit of h? 7 Let o(b) = b*3 + 7b*2 + 3b + 3. What is the tens digit of o(-3)? 3 Suppose -20 = 5x, 0 = -o - 0o - 4x - 8. Suppose -q + 3q = o. What is the units digit of q/14 + (-248)/(-14)? 8 Suppose 4v - 1 = 5v. Let d = 5 + v. Suppose -2h - 20 = -dx, 5x - 5h - 28 = -h. What is the units digit of x? 4 Let i(l) = -l*2 - 23l + 51. What is the tens digit of i(-22)? 7 What is the units digit of ((-10)/3)/5 + 685/15? 5 Let l(a) = -a*2 + 6a - 6. Let y be l(5). Let i = y + 5. Suppose 4u - i = 3u. What is the units digit of u? 4 What is the hundreds digit of -6 + 660/(2 + 3)? 1 Suppose -6h + 92 = -376. What is the units digit of h? 8 Let i(x) = 2x + 7. Let l be (-1)/22-10. What is the tens digit of i(l)? 2 Suppose 810 = 42u - 37u. What is the units digit of u? 2 Suppose 4m + 24 = -4w, -7 - 1 = -4m + 4w. What is the units digit of 0 - m - (-20)/2? 2 What is the units digit of (5 + -3)/(4/6)? 3 Let l(r) = r + 3. Let c be l(4). Suppose -225 = -cg + 2g. Suppose 2j - g = -5. What is the tens digit of j? 2 What is the tens digit of ((-7)/((-42)/12))/(2/89)? 8 Let m(b) = -b - 31. Let n be m(0). Let k = -21 - n. What is the tens digit of k? 1 Let x = -10 + 16. Suppose xn - 33 = 3n. What is the tens digit of n? 1 Let r(b) = b3 + 8b*2 - 4. Let d be r(-6). Suppose -d = -5f + f. What is the units digit of f? 7 Let v = 80 + -7. What is the tens digit of v? 7 Let l = 0 + -1. Let h = -11 - l. What is the tens digit of h/3*(-5 + 2)? 1 What is the tens digit of (111/(-9))/((-37)/12 + 3)? 4 L	{ "pile_set_name": "DM Mathematics" }
pose -bt = -3731 - 8539. Is t a composite number? True Let v(n) = 10n + n*2 + 5 + 16 - 2n. Let p be v(10). Suppose a = -2, -3c = -2c + a - p. Is c a prime number? False Let a = 2933 - -16040. Is a a prime number? True Let g(n) = 202n2 - 10n + 47. Is g(3) prime? False Let q(y) = 8y2 - 151y + 43. Is q(40) prime? True Suppose -1786 = -10f + 5664. Is f composite? True Let l = -801 + 5654. Is l composite? True Suppose -10 = f - 7. Let a(q) = 43q*2 + 3q + 5. Let n(v) = 129v2 + 8v + 14. Let c(d) = 7a(d) - 2n(d). Is c(f) composite? False Let d = -55 - -60. Suppose dp - 3m = -5m + 8969, 4m = -12. Is p a composite number? True Let i(d) = -210d + 131. Is i(-13) prime? True Let x = 4616 + -2265. Is x a prime number? True Let q = 29 - 20. Let a = -120 - -123. Is (127/a)/(3/q) prime? True Suppose 3g = 8g - 30715. Is g composite? False Let m(p) = p2 - 1. Let h(g) = -g2 - 12g + 7. Let n(k) = -h(k) + m(k). Let i be n(11). Let o = i - 181. Is o a prime number? False Let h = 33 + -49. Let c = h + 24. Let k = c + 59. Is k a prime number? True Let o(q) = q*3 - 31q*2 - 110q + 139. Is o(43) prime? True Suppose 3894 = 16z - 10z. Is z composite? True Let y be 38/9 - (-8)/(-36). Suppose c - 2 = -2a + a, 3a + 8 = yc. Suppose 2q + aq = 138. Is q a composite number? True Is ((-63239)/66)/(1/(-6)) prime? True Suppose 2184 = 3k - 4h, 0 = -3k + 5h - 697 + 2878. Let j = k - 379. Is j a composite number? False Suppose 410 = 3d - 15556. Is d/(-15)10/(-4) prime? True Suppose 5n = -g + 1448, 2g + 0g - 2905 = -n. Suppose -5b + g = 388. Is 2(-2)/(-12)b a composite number? False Let n = -1618 + 3928. Is (-1)/((-954)/n + (-4)/(-10)) composite? True Let a = 13814 + -8797. Is a prime? False Suppose -4x = -3u - 14527, -5638 = -2x + 2u + 1626. Is x prime? True Suppose -2m - 4l + 13 = -11, 4m + 2l - 18 = 0. Let b(i) = -6i*m - 3 + 4 + 0i*3 + 0 + 3i + 2i3. Is b(6) prime? False Is 149/(-6(-4)/24) prime? True Let q be -6(-4 - -4 - (1 - 2)). Let z = 377 + -238. Let r = z - q. Is r a composite number? True Suppose 0 = -32o + 190505 - 77065. Is o a prime number? False Let g = -3350 - -10574. Suppose t + w - 734 - 1072 = 0, -4t + w = -g. Let m = t + -689. Is m a composite number? False Let v(d) = 4d*2 + 8d - 6. Let s be (0 - 2 - -3)11. Let w be v(s). Suppose 4u = -5r + u + w, 2u + 236 = 2r. Is r a prime number? False Suppose -5o - 6131 = -b, -6o = -o + 10. Suppose -2r = p - 7r - 2072, -b = -3p - 4r. Is p a composite number? True Suppose -5j + 14 = -6. Let h(d) = 117d - 1. Is h(j) a prime number? True Let x(p) = -4p - 10. Let k be x(-5). Let s be 36/k - 18/30. Suppose -284 = -h + 3b + 2b, h - sb = 278. Is h a composite number? False Let q(c) be the first derivative of 34c*3/3 + 5c - 7. Let v be q(-4). Suppose v = 3j - 570. Is j a composite number? False Let n be 5-3 - (1 - 3). Let h be (3 + 7/(-3))-159. Let p = n - h. Is p prime? False Let m be 4074/2 - (-9 + 5). Suppose 0 = 4p - m - 451. Is p a composite number? True Let p = 12344 - 4725. Is p composite? True Is (-9)/(-12) - (-147914)/104 a composite number? False Suppose 5h - 3c - 29 = 0, 20 = 3h + 2c - 5. Suppose 4256 = -hu + 17185. Is u a composite number? False Is ((-18296)/(-16))/(15/6 - 2) prime? True Suppose 37g = 46g - 79011. Is g a prime number? True Let u be 10/(-2)(5 + -6). Let g(h) = h*2 - 4h - 1. Let s be g(u). Is ((-109)/s)/((-1)/4) a composite number? False Let y(j) = j*3 + 8j*2 + 7j. Let b be y(-7). Suppose b = 6p - 1384 - 2054. Is p a prime number? False Is ((-5403)/6)/((-16)/32) prime? True Let u be -1(-6 + 3 - -3). Suppose ua + 2a = 4030. Let b = -1020 + a. Is b a composite number? True Let f be (6/(-5))/((-24)/(-160)). Let z(o) = -o*3 - 9o*2 - 8o + 2. Let c be z(f). Suppose -3l + 199 = 2d - 247, -cl - 892 = -4d. Is d prime? True Let d(w) = -3w3 + 9w*2 - 8w - 5. Let x(m) = -38m + 8m*2 - 5 + 3m*3 + 0 + 31m - 5m3. Let s(c) = 5d(c) - 6x(c). Is s(-5) a composite number? True Suppose 4r + 4 = 2r, -4a + 4r + 244 = 0. Suppose -57t - 3386 = -at. Is t a prime number? True Let q(h) = -h3 - 6h*2 - 3h - 15. Let j be q(-6). Suppose d - 576 = -jd. Suppose 20 + d = 2z. Is z prime? False Let j(k) = k*3 + 9k*2 - k - 6. Let f be j(-9). Suppose 5v + 6 = -fs + 62, -5v + 48 = -s. Is v a composite number? True Let q(l) be the third derivative of -l6/120 + l5/12 - l4/8 + l3/6 - 2l2. Let g be q(3). Let t(u) = 3u - 15. Is t(g) a prime number? False Suppose 0 = -6w + 2w - 5i + 5, w = -4i - 7. Suppose s - ws = -1492. Is s a prime number? True Let l(n) = 2n + 9. Let g be l(6). Let f be (g/21)/(1/3). Suppose fo = -58 + 397. Is o a composite number? False Suppose 11q = 19q + 17080. Suppose 22 = -0v + v. Is 4/v - q/55 composite? True Let u(n) = 879n - 94. Is u(9) a prime number? True Is (-2(-2)/(-1))/((-104)/290082) composite? True Let w be 2-1439/(-2). Let c = -1974 - -1674. Let g = w + c. Is g a prime number? True Let r = -136477 + 289362. Is r prime? False Let x be 4 + (-5 - 0) + 4. Suppose 511 = 5n + xl + 25, -3n = -3l - 282. Let h = 307 - n. Is h prime? True Let f(s) = -11s + 6. Let g(o) = o. Let w(r) = 23r - 9. Let x(a) = -6g(a) + w(a). Let t(n) = -7f(n) - 5x(n). Is t(-8) a prime number? True Suppose -3934 - 3091 = -5n. Let q = 186 + 1928. Let i = q - n. Is i a composite number? False Suppose -42j + 14j + 10668 = 0. Is j prime? False Let x(a) = -2a3 - 9a*2 + 14a - 7. Suppose -3l + 4 = 34. Is x(l) a composite number? False Let v be (-1)/(5/(-260)) + 4. Suppose 0 = -3c - 14 + v. Is c prime? False Suppose 3y - 6 = y. Suppose -3g = -2g - y. Suppose -gb = -4o + 508, -5o - 362 = 2b - 997. Is o prime? True Let n = 3 + 0. Let g be 7/((n - -2)/(-125)). Let u = -93 - g. Is u a prime number? False Suppose 0 = -13s + 10s - 189. Let m = s + 242. Is m prime? True Suppose 0 = -4v - 20, -c + 11v - 12v + 9224 = 0. Is c a composite number? True Let q(i) = -i*2 - 14i - 7. Let m be q(-13). Suppose 0 = mg - 75 - 1959. Is g a composite number? True Let q(y) = y3 - 6y*2 - 6y + 2. Let l be q(7). Let b = l + -7. Suppose -u = bu + 6, 0 = 2a + 3u - 80. Is a a composite number? False Let l = -24 + 33. Is (863/2)/(l/18) composite? False Let j = -2876 - -1495. Let b = j - -3090. Is b composite? False Let q be 180/(-27)12/(-5). Suppose 3 = m - q. Is m a prime number? True Let m(i) be the second derivative of 7i4/6 - i3/6 - i2 - 6i. Let z be m(-1). Suppose -5u - z = -948. Is u a prime number? False Let g(s) be the second derivative of s6/40 - s5/15 + 5s*4/24 + 7s*3/6 - 3s*2 + 4s. Let d(f) be the first derivative of g(f). Is d(6) prime? True Suppose -4k = -7k - 3i + 27216, 5 = -5i. Is k a composite number? True Let r(f) = 240f2 - 12f + 37. Is r(10) a prime number? True Let z be 902/(-4)(-2)/1. Suppose 5t - 5k - z = t, t = -3k + 134. Is t a prime number? False Let h = -1 - -138. Let x = h - -256. Is x a composite number? True Let l(u) = 586u - 1. Let q be l(1). Let n = q - 142. Is n composite? False Suppose 0 = -12x + 4x + 32. Is 1434/8 + (-1)/x composite? False Suppose 0 = -4p - 3f + 140548, 6p - 3f = 4p + 70274. Is p a composite number? True Let d(t) = -7t - 46. Let l be d(-7). Is 2072/32 - l/(-12) prime? False Suppose 0 = 2w + b - 13, 5w - w - 17 = -5b. Suppose -wd - 2442 + 14930 = 0. Is d a composite number? True Let f(o) be the first derivative of 1/3o*3 + 3/2o*4 + 3 - o + 1/2o2. Is f(2) composite? False Let i(s) = s2 + 3s + 4. Let q be i(-5). Is 40/q(-70)/(-20) composite? True Suppose -2m - 4i + 8650 = 0, 3i - 2i - 8653 = -2m. Is m a prime number? True Is ((-2)/(-4 + 0))/(4/9992) prime? True Let n be (-6 + 5)/(33/12 - 3). Is (n/(-16)831)/(3/(-20)) a composite number? True Suppose -3w = -9c + 4c + 10677, -4w = 3c - 6383. Let m = -1439 + c. Is m prime? False Suppose -4r = -318 - 462. Let y be 6/(-9) + 590/(-15). Let u = y + r. Is u a composite number? True Suppose -5g + 9 + 6 = 0, -5h + 5g = -7520. Let w = 2424 - h. Is w composite? True Suppose -10i = -47043 - 247. Let c = i - 2120. Is c composite? False Let y(l) be the third derivative of l*6/60 - 7l*5/60 - 13l**3/6 -	{ "pile_set_name": "DM Mathematics" }
n c - 261c3 + 171c*3 + 135c*3. 45c*3 + c Collect the terms in -8 + 3 + 69b + 3. 69b - 2 Collect the terms in 5d + d + 0d + 3d. 9d Collect the terms in -234r*2 - 225r*2 + 470r*2. 11r*2 Collect the terms in -20 - 16 + 61 + 17f - 23. 17f + 2 Collect the terms in -12 + 8 + 4u*3 + 4. 4u3 Collect the terms in -1 - p2 - 12 - 9. -p*2 - 22 Collect the terms in 619x*3 - 1153x*3 - 1229x*3. -1763x*3 Collect the terms in 39476 - 39476 - 2b. -2b Collect the terms in -4 + 4 - 454j*2 + 520j*2. 66j*2 Collect the terms in -1155v + 1155v - 3v*3. -3v*3 Collect the terms in 130z*2 - 68z*2 + 4z3 - z3 - 62z2 - z3. 2z*3 Collect the terms in -231 + 231 + 5u. 5u Collect the terms in -i3 - 2i3 - i3 + 2i3. -2i*3 Collect the terms in -101x*2 - 41x*2 + 41x*2 - 118x*2. -219x*2 Collect the terms in -12n - 2 + 3 - 1. -12n Collect the terms in -2330573a*2 + 2330570a*2 + 0 + 0. -3a*2 Collect the terms in 6w*2 + 6w*2 - 8w*2. 4w*2 Collect the terms in -126w - 24w - 14w. -164w Collect the terms in -3s*2 - 16s*2 - 4s*2. -23s*2 Collect the terms in 41r*3 + 0r - 36r3 + 0r. 5r3 Collect the terms in 111d*2 + d - d - 106d*2. 5d*2 Collect the terms in -16t + 89t - 71t. 2t Collect the terms in 27z*2 - 27z*2 - 2z*3. -2z*3 Collect the terms in 78y*2 - 78y*2 - 3y*3. -3y*3 Collect the terms in 34t*2 + 0 - 41t*2 + 0. -7t*2 Collect the terms in -9o + 5o2 + 10o - o. 5o2 Collect the terms in -3c + 3c - 18c + 9c. -9c Collect the terms in -7 - 14 - 6r2 + 21. -6r*2 Collect the terms in 15m*3 - 17m3 + m3. -m3 Collect the terms in -i3 - 2i3 - i3 + 2i*3. -2i*3 Collect the terms in 15r - 3 - 3r + 27r. 39r - 3 Collect the terms in 9a - 3a - 4a + 9a. 11a Collect the terms in 5 - 15b - 10b*3 + 15b. -10b3 + 5 Collect the terms in -26k*2 + 14k*2 - 13k*2. -25k*2 Collect the terms in -10j + j + 3j. -6j Collect the terms in -4f + 6f - 3f - 2f. -3f Collect the terms in -j + 2j - 3j + j + 0j. -j Collect the terms in 24f2 + 18f*2 - 3f*2. 39f*2 Collect the terms in -11d*2 + 43d*2 - 14d*2 - 17d2. d2 Collect the terms in -12698h - h2 + 12698h. -h*2 Collect the terms in 79o*2 + 1 - 5 + 4. 79o*2 Collect the terms in 0o*2 + 11 - 11 + 59o*2. 59o*2 Collect the terms in -54 - 61 + 6h - 61 + 180. 6h + 4 Collect the terms in x3 + 52x - 2x3 - 78x + 2x3. x3 - 26x Collect the terms in -5541h2 + 2767h*2 + 2768h*2. -6h*2 Collect the terms in -59t + 22t + 1 - 10t. -47t + 1 Collect the terms in -27 - 5l*2 + 4l + 27 - 3l2. -8l*2 + 4l Collect the terms in 1 - 1 + 12m2 + 8m*2. 20m*2 Collect the terms in 11 - 11 + 22c. 22c Collect the terms in -3 + 3 + 90u - 89u. u Collect the terms in -19r + 7r + r - 16r. -27r Collect the terms in -8j*2 + 0j*2 + 3j*2. -5j*2 Collect the terms in 4n*3 - 49050 + 49050. 4n*3 Collect the terms in 3n*3 + 11 - 2n*3 + 2n*3 + 0n*3. 3n*3 + 11 Collect the terms in -415q*3 - 423q*3 + 839q3. q3 Collect the terms in 407h3 - 296h*3 - 222h*3. -111h*3 Collect the terms in -37s*2 + 2s*2 + 40s*2 - 3s*2. 2s*2 Collect the terms in -2q + 9 - 9 + 5q - q. 2q Collect the terms in 145m - 48m - 49m - 47m. m Collect the terms in -8 + 1449h - 1448h + 0 + 8. h Collect the terms in -2j3 - 12j*3 + 16j3 + j3. 3j3 Collect the terms in -2w + 34 + 6w - 34 + 2w. 6w Collect the terms in -314s*2 - 316s*2 + 625s*2. -5s*2 Collect the terms in 3b*3 + 115458b - 115458b. 3b*3 Collect the terms in -541653j*2 + 270827j*2 + 270827j2. j2 Collect the terms in -4f - 27f*3 + 4f - 710f3. -737f*3 Collect the terms in -5m - 4 - 1 - 1. -5m - 6 Collect the terms in -385p - 17 + 17. -385p Collect the terms in -548y*3 + 22y*2 - 22y*2. -548y*3 Collect the terms in -144 + s + 144 - 3s. -2s Collect the terms in -x + 10x - 4x. 5x Collect the terms in -241c3 + 110c*3 + 137c*3. 6c*3 Collect the terms in -664q*3 - 10q*2 + 10q*2 + 340q*3 + 322q*3. -2q*3 Collect the terms in 10z*2 - 2z*2 - 6z*2 - 11z*2. -9z*2 Collect the terms in 75b*3 + 77b*3 + 156b*3. 308b*3 Collect the terms in 12l*3 - 8l*3 + 6l*3. 10l*3 Collect the terms in 7l*2 - 6l*3 - 4l*2 - 3l*2. -6l*3 Collect the terms in -17j*2 + 903 - 903. -17j*2 Collect the terms in 282m*2 - 570m*2 + 283m*2. -5m*2 Collect the terms in -31q + 70q - 42q. -3q Collect the terms in 1 - 120j + 2 + 118j - 3. -2j Collect the terms in 203q3 + 7q*3 + 388q*3. 598q*3 Collect the terms in 3m - 9m + 5m + 3m. 2m Collect the terms in -2f2 - 201803f + 201803f. -2f*2 Collect the terms in -9y*3 - 1659y + 818y + 841y. -9y3 Collect the terms in -3559 - 3557 + 3i + 10680 - 3564. 3i Collect the terms in 8a*2 - 75a*2 - 39a*2. -106a*2 Collect the terms in 36 - 16 - 26j*2 - 20. -26j*2 Collect the terms in 3d*2 - 11d*3 - 3d*2 + 18d*3. 7d*3 Collect the terms in -13k*2 + 63k*2 - 14k*2 - 17k*2. 19k*2 Collect the terms in -14u + 52u - 19u - 17u. 2u Collect the terms in -4t + t + 7t. 4t Collect the terms in -33375 - 7r + 33375. -7r Collect the terms in k2 - 4283k - 8k2 + 4283k. -7k2 Collect the terms in -2i*2 - 629i + 2 + 629i. -2i*2 + 2 Collect the terms in 5i*3 - 18i*3 - 5i*3. -18i*3 Collect the terms in -503i*3 + 166i*3 + 172i*3 + 169i*3. 4i*3 Collect the terms in -20 - 24 + 56 - 12l*3 - 12. -12l*3 Collect the terms in 23p*3 + 3p - 3p - 25p*3. -2p*3 Collect the terms in -2 + 0l*3 + 7l*3 - 6l3. l3 - 2 Collect the terms in -1033i - 7i*2 - 5i*2 - 6i*2 + 1036i. -18i2 + 3i Collect the terms in -2q3 - 1608q + 804q + 3q*3 + 804q. q*3 Collect the terms in -4b + 4b + 1233b*2 - 2466b*2 + 1235b*2. 2b2 Collect the terms in -a2 + 3a2 + 5a*2 - 5a*2 + 3a*2. 5a*2 Collect the terms in -14j*3 - 3 - 2j + 3. -14j3 - 2j Collect the terms in -1108 + 549 - 8t2 + 559. -8t*2 Collect the terms in 18k + 20k - 48k + 19k - 13. 9k - 13 Collect the terms in -19y - 73 + 4y*2 + 73. 4y*2 - 19y Collect the terms in 267u - 802u + 265u + 269u. -u Collect the terms in 23d2 - 14d*2 - 5d*2. 4d*2 Collect the terms in -40o + 40o + 4o*2. 4o*2 Collect the terms in 0 + 37r - 54r + 0. -17r Collect the terms in -3f - 1006f*2 + 3f + 1007f2. f2 Collect the terms in -11t*3 - 40t*3 - 125t*3. -176t*3 Collect the terms in -74p*2 + 2p - 109p3 + 74p*2. -109p*3 + 2p Collect the terms in -416493 - m3 + 416493. -m3 Collect the terms in 2581 - 2581 - z2. -z2 Collect the terms in 10n3 + 10n*3 - 9n*3. 11n*3 Collect the terms in -18x*2 - 14x*2 - 15x*2 + 49x*2. 2x*2 Collect the terms in -6v + 6v + 11v*2 + 0v*2. 11v*2 Collect the terms in 582277i - 582277i - 2i*2. -2i*2 Collect the terms in -266h + 266h - 2h*2. -2h*2 Collect the terms in -2b + 10b3 - b + 7b. 10b3 + 4b Collect the terms in 0 - 3w2 - 388w + 35w - 4. -3w*2 - 353w - 4 Collect the terms in -2a + 78a*2 - 55a*2 + 2a. 23a2 Collect the terms in -190x + 66x + 72x + 61x. 9x Collect the terms in -2a - a + 1249a*3 + 0a. 1249a3 - 3a Collect the terms in 86 + 3q + 83 - 169. 3q Collect the terms in -88k + 5 - 195k + 76k. -207k + 5 Collect the terms in -99c + 12c*2 - 99c - 103c + 301c. 12c2 Collect the terms in 28f*3 - 91f*3 + 29f*3 + 30f*3. -4f*3 Collect the terms in 23n + 26n - 5n. 44n Collect the terms in -309i*2 - 6 + 311i*2 + 6. 2i*2 Collect the terms in -62z + 122z - 59z. z Collect the terms in -1 - 14a2 + 4a*2 + 2a*2 - 2. -8a*2 - 3 Collect the terms in 2f + 0f - 4f + 1 - f. -3f + 1 Collect the terms in -4j*3 - 2j*3 + 62j - 130j + 68j. -6j3 Collect the terms in -h3 - 3h*3 + 0h + 2h. -4h*3 + 2h Collect the terms in 5 - 5 + 28f3 - 17f*3. 11f*3 Collect the terms in -z - 25 + 25 - 2z. -3z Collect the terms in -88a*2 + 43a*2 + 41a**2	{ "pile_set_name": "DM Mathematics" }
2 - 3o*2x - o*2 + 23ox - 6x*2 wrt x. -13274448o*2 What is the second derivative of 64il4 + 3204il3 + 33510il + i - l2 wrt l? 768il2 + 19224il - 2 Find the first derivative of 828520i - 3492702. 828520 Find the first derivative of -5lp + 952223l + 2594p wrt p. -5l + 2594 What is the second derivative of 2r*5 - 33983r3 - r2 + 52194r - 2? 40r*3 - 203898r - 2 Differentiate 315bk - 30b - 349204k with respect to b. 315k - 30 Find the second derivative of -8a*2j*2 - 945a*2j - 4j4 + 2j*2 - 44 wrt j. -16a*2 - 48j*2 + 4 What is the second derivative of 432a5 + a4 - 3a2 + 569319a? 8640a3 + 12a*2 - 6 Differentiate 2m*3n*2 - 184930mn3 - 113n*3 - 219n*2 - 2 wrt m. 6m*2n*2 - 184930n3 What is the third derivative of b2x4 + 7b*2x + 3796x5 - 541x*2 - 15x wrt x? 24b2x + 227760x2 Find the third derivative of 2jv4 - jv*3 + 343jv + 2v*4 + 86v*3 + 2v*2 - 11 wrt v. 48jv - 6j + 48v + 516 What is the third derivative of 884d*4p + 11d3 - 2113d*2p + 4p wrt d? 21216dp + 66 Find the third derivative of 36111y*5 + 2y*4 - 88y*2 - 260y - 2. 2166660y2 + 48y What is the derivative of -86bj*2 + 2bj - b + 22j*2 + 6686 wrt j? -172bj + 2b + 44j What is the third derivative of -99097f5 + f2 + 7f + 612 wrt f? -5945820f*2 Find the third derivative of -2u*3y*2 + 30926u*3y - 6u3 + 216u*2y*2 + 13u*2y - 4uy + 2y2 wrt u. -12y*2 + 185556y - 36 What is the derivative of 20b3z*2 + 54b*3 - 5b - 992z3 + 14 wrt z? 40b*3z - 2976z2 Differentiate 825k*3n - 13k3 + 2k*2n + 2k2 + 4kn + 243 wrt n. 825k*3 + 2k*2 + 4k Differentiate 86l3r*2 + 4l*3 + 1995l*2 - 66lr3 wrt r. 172l*3r - 198lr*2 Find the first derivative of -17b*2vx - 12174b*2x*2 - 2bv + 39vx2 - 12vx + 2v - 29x2 wrt b. -34bvx - 24348bx*2 - 2v What is the third derivative of 210901j4 + 72j*2 - 168j - 1? 5061624j What is the third derivative of 206672s*4 - 2s*2 - 98s - 131 wrt s? 4960128s What is the derivative of -w4 - 90867w + 65240? -4w3 - 90867 What is the second derivative of 220f*2n*3t + 149f2t - f*2 - 815fn3 + 923fnt - 2n2t wrt f? 440n3t + 298t - 2 What is the second derivative of -6a*2q + 225a2 + 45aq + 108a wrt a? -12q + 450 Find the second derivative of 3g*2y*2 + 702g*2y - 20041y2 + 67y wrt y. 6g2 - 40082 What is the third derivative of 44r*5 + 284r*3 + 2r*2 + 22r - 130 wrt r? 2640r2 + 1704 Find the third derivative of -2157229k*3 - 3541649k2. -12943374 What is the second derivative of h4t + 5394h*4 + 4h*2 + 4738h - 64t - 1 wrt h? 12h*2t + 64728h2 + 8 Differentiate -145617u + 175046 with respect to u. -145617 Find the third derivative of -21gm*3n*3 + 2040gm3 + 19870gm2n*2 + gmn + 2n*3 wrt m. -126gn3 + 12240g Find the first derivative of 2l3 - 31l*2 + 2227l - 2576757 wrt l. 6l2 - 62l + 2227 Find the second derivative of 1219g3q - 6g2q + gq + 3g + 7q + 6 wrt g. 7314gq - 12q What is the third derivative of 420p5 - 2p*4 - 65p*3 + 446331p*2? 25200p*2 - 48p - 390 Find the third derivative of -6847m4x + m*3x - 5m2x - 435m2 + m - 5x wrt m. -164328mx + 6x Find the third derivative of -g6 + 168g*5 + 3g*4 - 15745g*2 wrt g. -120g*3 + 10080g*2 + 72g Find the first derivative of -2s3z - 198595sz*2 + 2z*2 - 124605z wrt s. -6s2z - 198595z2 Differentiate -1774179a + 329870 with respect to a. -1774179 What is the second derivative of -208504d2i + 3di - 3d - 751i - 2 wrt d? -417008i Find the second derivative of -313at2 + 212at + 6a - 149t2 + t wrt t. -626a - 298 What is the second derivative of -4927g4 - 36029g? -59124g2 What is the second derivative of -l3 + 5150l*2 - 18171l + 1 wrt l? -6l + 10300 What is the second derivative of -3196w*5 + 2w*3 + 13w*2 - 254168w - 2? -63920w3 + 12w + 26 What is the second derivative of -3647946ao*2 - 2577695ao wrt o? -7295892a What is the second derivative of -8di*2 + 116diw - 5di - 2dw - i*2w - 2343i2 wrt i? -16d - 2w - 4686 Find the third derivative of 90897j*3 - 5j*2 - 8114j wrt j. 545382 Find the second derivative of -153952q2 - 148654q. -307904 What is the third derivative of -273p3s4 - p3s2 + 30p*2s4 + p2s2 - 665p*2 wrt s? -6552p*3s + 720p2s What is the third derivative of -3756go*4 - go*2 - 53go - 3o*5 + 24o*3 + 3597o*2 wrt o? -90144go - 180o*2 + 144 What is the second derivative of 3h*3o2 + h3 + 15h2o*2 + 2525h*2o - 656ho*2 - 2o*2 wrt o? 6h*3 + 30h*2 - 1312h - 4 What is the second derivative of -84200k2 + 79k - 30? -168400 Find the second derivative of -21086x2 + x - 13 wrt x. -42172 What is the third derivative of 21ij6 - 23ij3 - 2ij2 - 6106ij - 1170j*4 + 4j*2 wrt j? 2520ij3 - 138i - 28080j Find the second derivative of 13112f*3q*3 - 3f*2q*3 - 835fq3 - 7q*2 wrt f. 78672fq3 - 6q*3 Find the first derivative of -17157i*2 + 100581 wrt i. -34314i What is the third derivative of 3f4i + 4633f4 - 282f*2i - 5i wrt f? 72fi + 111192f What is the first derivative of -b*2 - 345685b + 255402? -2b - 345685 Find the third derivative of -2r*3t*3 - 21519r*3t2 - r2t3 - 18r*2t - 3rt*2 - 3t*3 wrt r. -12t*3 - 129114t*2 What is the third derivative of -285p*6 - 13p*5 - 121980p*2? -34200p*3 - 780p*2 Find the second derivative of -163p*3 - 37p*2 + 5p + 1319. -978p - 74 Find the second derivative of -36331b*2 + 320b + 190. -72662 Find the second derivative of 10i2o2 + i2o + 5iko*2 - 12ik + io - 6ko*2 - 134ko + 2 wrt o. 20i*2 + 10ik - 12k What is the third derivative of -804039d3 + 1576960d*2? -4824234 What is the derivative of -995549g*2 - 875690? -1991098g Find the second derivative of 62g3 - 1518g*2 + 566211g wrt g. 372g - 3036 What is the derivative of 4ruv - 32rux2 - 23ru - rvx2 + 110rv - 17uv - 28x*2 wrt v? 4ru - rx*2 + 110r - 17u What is the second derivative of -815c*3 - 3c*2 + 63854c wrt c? -4890c - 6 What is the third derivative of -107521a*3 - 146280a2? -645126 What is the derivative of d2g2l - 3d2g*2 - 4d*2g - 1009d2 + 49943dg2l*2 - 2dg2 + 5l wrt l? d*2g*2 + 99886dg2l + 5 Find the second derivative of -26r3z*2 - 35r*3z - 7r3 - rz*2 - rz - 23z2 wrt z. -52r*3 - 2r - 46 Find the third derivative of -26943y4 - 13425y*2 - y. -646632y Find the second derivative of -108q5 - 51q*4 - 4q*3 - 245563q + 2 wrt q. -2160q3 - 612q*2 - 24q Differentiate 604667c + 475118. 604667 Differentiate h3w - 1018288h3 + 254101h*2w*2 + 2h*2w with respect to w. h*3 + 508202h*2w + 2h2 Find the second derivative of 4206l*2z*2 + 10l*2z - 3lz - z*2 - 83 wrt z. 8412l2 - 2 Differentiate a3dr + 13189a3d - 4a2dr + 49a*2d + 8dr - 204r with respect to r. a3d - 4a2d + 8d - 204 What is the third derivative of -12t*6 - 843t*4 - 26636t*2 wrt t? -1440t*3 - 20232t Find the third derivative of 12f4n + 2f4 - 454f*3n*2 + 506f*2 + 63fn2 - f wrt f. 288fn + 48f - 2724n2 What is the third derivative of 1146565y*6 + 3y*2 + 97873? 137587800y*3 What is the third derivative of 5t*4w*3 + 36t*4w - 5t3w*3 + 19835t*2w + 2t2 - tw*3 wrt t? 120tw3 + 864tw - 30w3 Find the third derivative of -o4v + o4 + 8o*3v*3 - 1872o*2v*3 + 8o*2v*2 wrt o. -24ov + 24o + 48v3 Find the third derivative of 837423l*3 + 874456l*2 wrt l. 5024538 Find the first derivative of -8b*4k - 498b4 - 1480k + 4 wrt b. -32b3k - 1992b3 What is the third derivative of -2016a*2g*3 + 2a*2g*2 + 107154ag2 + g3 wrt g? -12096a*2 + 6 What is the second derivative of -7ix3y - 5192ix*3 - 95ixy - 59xy wrt x? -42ixy - 31152i*x Differen	{ "pile_set_name": "DM Mathematics" }
121021120 -8468241 (base 9) to base 2 -10001010010101110000001 -10111010010001 (base 2) to base 6 -131105 Convert -1323647 (base 9) to base 4. -2300313022 What is 1046141 (base 10) in base 9? 1864028 Convert 12237 (base 13) to base 12. 17363 Convert 101111100001101110 (base 2) to base 12. 947a6 What is 447bc3 (base 13) in base 16? 18abad 54ba6 (base 12) to base 8 333256 Convert -193a (base 15) to base 16. -154f Convert 513355112 (base 6) to base 5. 4231131131 What is -212320 (base 6) in base 8? -41770 What is 10c2082 (base 13) in base 15? 6c30b1 What is 42479 (base 16) in base 10? 271481 Convert -6834a (base 13) to base 9. -317857 What is 1125918 (base 14) in base 8? 37100722 What is -111001101110011 (base 2) in base 13? -105b6 -261106 (base 9) to base 7 -1226313 Convert 120269 (base 13) to base 5. 102210330 Convert -1201364 (base 7) to base 16. -250f7 What is 1a74812 (base 11) in base 10? 3490863 What is -24254123 (base 7) in base 8? -10204003 -3062207 (base 8) to base 6 -25224011 11630404 (base 7) to base 13 2a988c Convert -545353424 (base 6) to base 5. -10001003340 Convert 6042231 (base 10) to base 5. 3021322411 210001221 (base 4) to base 16 24069 20324044 (base 5) to base 11 104851 What is a23286 (base 12) in base 15? 351346 42400405 (base 6) to base 16 12fc95 853306 (base 9) to base 14 d2dd7 What is -83392 (base 15) in base 11? -264555 51227267 (base 8) to base 10 10825399 Convert -30000231 (base 4) to base 16. -c02d Convert -1002101122222 (base 3) to base 13. -173474 Convert -25a14 (base 13) to base 8. -210266 -6336758 (base 9) to base 6 -200400342 11000010101010110110111 (base 2) to base 7 105135323 670535 (base 8) to base 16 3715d What is -7d332 (base 14) in base 3? -120111200022 Convert -8c1c23 (base 13) to base 2. -1100101001111001010010 2e1ae0 (base 15) to base 10 2233335 -6ad785 (base 16) to base 13 -15b20b7 928c4 (base 13) to base 8 1001453 What is 43292 (base 14) in base 5? 20144131 Convert 20121100211 (base 3) to base 4. 133233223 Convert -110110100100111111011 (base 2) to base 12. -722b63 -11003233113 (base 5) to base 16 -b3a8ce Convert -202122000 (base 3) to base 7. -61563 Convert -91b5b2 (base 12) to base 5. -1040430321 What is -448a2 (base 13) in base 9? -208721 What is -10000011100101010101 (base 2) in base 10? -538965 What is -14710413 (base 8) in base 15? -46b4cc What is 6a6a7 (base 14) in base 15? 51c3e Convert 17e484 (base 16) to base 14. 2ca8cc -405434 (base 9) to base 3 -110012111011 Convert 2246654 (base 7) to base 3. 112021022222 Convert 1722a60 (base 12) to base 8. 22154550 What is 10332211221 (base 4) in base 3? 2110022001000 What is 3146250 (base 7) in base 13? 10488c Convert -23000211310 (base 4) to base 5. -1214323004 Convert 21474 (base 14) to base 16. 13a4e -1101101010001011010 (base 2) to base 13 -128951 What is -1253134 (base 7) in base 11? -102549 -169989 (base 10) to base 12 -82459 What is -53026042 (base 7) in base 13? -c0a051 Convert -2123560 (base 7) to base 13. -906c4 -311303300 (base 4) to base 5 -24023100 What is 1110002 (base 5) in base 14? 70c1 What is -1a51a9 (base 11) in base 7? -2446330 What is -2200352 (base 7) in base 8? -1015450 386ba4 (base 12) to base 2 11100001101100101100 What is -97243 (base 10) in base 15? -1dc2d -22949 (base 16) to base 9 -235258 87128 (base 10) to base 12 42508 -8652 (base 12) to base 15 -4585 What is 246b5a0 (base 13) in base 2? 101011001111011010000010 Convert -c83b68 (base 13) to base 10. -4692540 What is 55c287 (base 13) in base 5? 1004313313 26255366 (base 7) to base 12 979225 1123221331 (base 4) to base 13 101b57 Convert -1124311440 (base 5) to base 13. -6c1046 Convert 1506a6 (base 12) to base 14. 92b82 Convert 133222222 (base 4) to base 15. 28671 -3012003003 (base 4) to base 14 -1718b1 15533a (base 11) to base 2 111010111010100101 Convert -3cbcdb (base 15) to base 14. -5622b6 What is 183671 (base 10) in base 4? 230311313 Convert -214770 (base 11) to base 4. -1103233033 -b1b7b (base 16) to base 15 -e5a3b Convert -182857 (base 14) to base 16. -d013d 1137887 (base 12) to base 3 20020011222111 -340324 (base 5) to base 8 -27274 Convert 10011100110000100 (base 2) to base 16. 13984 Convert -b6a3b (base 14) to base 9. -742008 What is -20200212022110 (base 3) in base 8? -15450777 What is 2201220020 (base 3) in base 15? 10e66 -24533301 (base 6) to base 4 -3000320011 Convert 100001101001101100111110 (base 2) to base 3. 121121011220200 -24034410 (base 6) to base 5 -143021043 -110111100011100110 (base 2) to base 13 -7c766 11011011110000001110 (base 2) to base 16 dbc0e -8256 (base 11) to base 12 -6407 -22208 (base 10) to base 5 -1202313 Convert 1379b24 (base 14) to base 10. 9438804 -11403042 (base 5) to base 16 -1a097 Convert c16cb (base 14) to base 6. 13545111 What is -1100100101101011111011 (base 2) in base 16? -325afb Convert 212388 (base 9) to base 5. 13021230 -58152e (base 15) to base 9 -7821108 What is -21910 (base 11) in base 14? -b7b3 -24a16 (base 13) to base 14 -1a8dd 5db47 (base 15) to base 14 7b23c -67dc (base 16) to base 5 -1322323 What is 124663 (base 10) in base 14? 33607 What is 1100101000001000000000 (base 2) in base 10? 3310080 -19b (base 16) to base 5 -3121 Convert 101011111100001110111 (base 2) to base 11. 8a3877 -11221133123 (base 5) to base 12 -42b4488 Convert -12460567 (base 9) to base 13. -136461a 404613 (base 8) to base 16 2098b Convert 712323 (base 11) to base 6. 40313052 Convert -101221312 (base 5) to base 4. -1211010011 What is 4112551 (base 6) in base 15? 3d294 What is 10133243322 (base 5) in base 7? 154536613 What is -1205122 (base 7) in base 10? -153043 What is 23475152 (base 8) in base 4? 103213221222 -125664 (base 10) to base 9 -211336 Convert 11303213 (base 5) to base 15. 20a3d What is -11fece (base 16) in base 13? -323a48 55001 (base 7) to base 9 20735 What is 151105514 (base 6) in base 9? 5807361 86ca64 (base 13) to base 15 429331 What is 225312452 (base 6) in base 2? 1111111011111011010000 4753849 (base 10) to base 3 22221112001111 -2042413120 (base 5) to base 2 -10000010000111001101111 -407327 (base 9) to base 6 -5102211 Convert 8118275 (base 10) to base 2. 11110111110000000000011 What is -252070 (base 8) in base 10? -87096 What is 449401 (base 10) in base 2? 1101101101101111001 Convert -49157 (base 14) to base 7. -1342540 -26b238 (base 14) to base 2 -101000110010111000010 What is -367179 (base 10) in base 6? -11511523 Convert 8ba87 (base 14) to base 6. 11140103 What is 45201022 (base 8) in base 12? 332b32a Convert -2232221303 (base 4) to base 9. -1310275 101000011110111 (base 2) to base 13 9585 Convert 4384953 (base 10) to base 9. 8223020 What is -143306040 (base 7) in base 14? -13851c7 What is -77436 (base 10) in base 12? -38990 -1be53 (base 15) to base 4 -112031202 Convert 13154 (base 14) to base 2. 1011011101000110 What is 21aa414 (base 12) in base 13? 1449028 Convert -111001010011101111 (base 2) to base 6. -5010423 What is 100110100100110001110 (base 2) in base 10? 1264014 What is -2322002330 (base 4) in base 12? -308bb8 Convert -11430022 (base 5) to base 4. -122121221 11313103013 (base 4) to base 16 1774c7 Convert -2134342 (base 5) to base 12. -193a7 What is -101100011001000011110 (base 2) in base 6? -51102210 37ca7a (base 13) to base 3 2112011211021 66977 (base 10) to base 2 10000010110100001 What is 101202111101 (base 3) in base 4? 303230323 What is 10100000100010010 (base 2) in base 4? 110010102 Convert -291713 (base 10) to base 9. -484135 -151a06 (base 11) to base 9 -400744 -a7902 (base 11) to base 15 -316e8 Convert 16030344 (base 7) to base 3. 2220002010020 21848a (base 11) to base 16 54f45 Convert -41061415 (base 7) to base 4. -31010213122 Convert -1a276 (base 14) to base 16. -10330 420470 (base 8) to base 5 13431301 What is 1030102 (base 4) in base 15? 16a7 Convert 15336446 (base 7) to base 2. 101100111010011010100 What is -1320337 (base 11) in base 14? -436715 Convert 3dc39 (base 16) to base 15. 4ee5a Convert 5b3b9 (base 12) to base 6. 2350353 Convert -10111010101101100110 (base 2) to base 3. -1102212001222 30a640 (base 12) to base 10 764688 Convert b0123 (base 15) to base 2. 10001000000001001101 -198b (base 14) to base 13 -2153 What is 402691 (base 10) in base 5? 100341231 What is -2009060 (base 11) in base 5? -140223	{ "pile_set_name": "DM Mathematics" }
7524, -1700960? -1984358 What is the next term in 523, 4779, 16507, 39445, 77331, 133903? 212899 What is the next term in -488, -725, -1430, -2831, -5156, -8633, -13490? -19955 What comes next: -4424, -8754, -13052, -17318, -21552, -25754? -29924 What is the next term in -85362, -85384, -85444, -85560, -85750, -86032? -86424 What comes next: -13442, -13382, -13272, -13106, -12878, -12582, -12212, -11762? -11226 What is next in 461234, 1844943, 4151128, 7379783, 11530902, 16604479? 22600508 What is the next term in 75, 315, 973, 2259, 4383? 7555 What is the next term in 2844070, 2844077, 2844086, 2844097, 2844110, 2844125? 2844142 What comes next: -343, -1695, -4019, -7309, -11559? -16763 What is next in -2834660, -2834664, -2834668, -2834672, -2834676? -2834680 What is next in -917600, -917590, -917578, -917564, -917548, -917530? -917510 What is next in 1333, 6766, 16301, 29938, 47677, 69518? 95461 What is the next term in -39681, -79471, -119263, -159057? -198853 What is the next term in 9525, 4876, 225, -4428, -9083, -13740? -18399 What is the next term in -142984, -572103, -1287302, -2288581, -3575940? -5149379 What is next in 1226072, 1226094, 1226128, 1226180, 1226256, 1226362, 1226504, 1226688? 1226920 What is next in -20330171, -40660345, -60990519, -81320693, -101650867, -121981041? -142311215 What is the next term in -670246, -1340463, -2010652, -2680813, -3350946, -4021051? -4691128 What comes next: 292228, 584546, 876864? 1169182 What is next in -242463531, -242463532, -242463533, -242463534, -242463535, -242463536? -242463537 What comes next: 4735, 2609, 475, -1673, -3841, -6035, -8261, -10525? -12833 What is next in -1401022, -1401023, -1401024, -1401025, -1401026, -1401027? -1401028 What is next in -62805, -62712, -62501, -62112, -61485? -60560 What is the next term in 1479426, 1479542, 1479658, 1479774, 1479890? 1480006 What is next in 45168981, 45168978, 45168975, 45168972? 45168969 What is next in 12737812, 12737805, 12737798? 12737791 What is next in -46392, -185554, -417468, -742122, -1159504, -1669602, -2272404, -2967898? -3756072 What is next in -140583, -281107, -421631, -562155, -702679, -843203? -983727 What is the next term in -357946, -1431911, -3221856, -5727787, -8949710, -12887631, -17541556? -22911491 What comes next: -2356998, -4713998, -7070996, -9427992, -11784986, -14141978, -16498968? -18855956 What is next in 54775, 54767, 54759, 54751, 54743? 54735 What comes next: -1495436, -2990873, -4486308, -5981741? -7477172 What is the next term in 74756, 75212, 75668? 76124 What is next in -10199, -81542, -275143, -652118, -1273583, -2200654? -3494447 What is the next term in 38621239, 38621214, 38621189? 38621164 What is next in -22226, -22209, -22192, -22175? -22158 What is the next term in -2029628, -4059271, -6088928, -8118605, -10148308, -12178043, -14207816, -16237633? -18267500 What comes next: -660101, -660128, -660153, -660170, -660173, -660156, -660113, -660038? -659925 What comes next: 2111979, 2112250, 2112521, 2112792, 2113063? 2113334 What is the next term in 235084, 470163, 705242, 940321, 1175400, 1410479? 1645558 What comes next: 492658, 492624, 492586, 492544? 492498 What is the next term in -1134, -2895, -5264, -8241, -11826, -16019, -20820? -26229 What comes next: -3328376, -6656781, -9985186, -13313591, -16641996, -19970401? -23298806 What comes next: 877008, 1754015, 2631018, 3508017? 4385012 What comes next: 1517468, 3034917, 4552356, 6069779, 7587180? 9104553 What is next in 21022, 38356, 55690, 73024, 90358, 107692? 125026 What is the next term in -33, 13, 143, 375, 727, 1217, 1863, 2683? 3695 What is next in -4090, -8268, -12446, -16624, -20802, -24980? -29158 What comes next: 334313, 334317, 334321, 334325, 334329, 334333? 334337 What is the next term in -23403, -23777, -24401, -25275, -26399? -27773 What comes next: -1864, -7928, -24378, -56404, -109196, -187944, -297838, -444068? -631824 What is the next term in -18029, -43580, -69131, -94682, -120233? -145784 What is next in 1097668, 1097603, 1097534, 1097461, 1097384, 1097303? 1097218 What comes next: -299163, -1196649, -2692471, -4786629, -7479123, -10769953? -14659119 What is the next term in -239214, -478387, -717556, -956721, -1195882? -1435039 What comes next: 183444, 733706, 1650778, 2934660, 4585352? 6602854 What is next in 1709, -699, -7215, -19891, -40779, -71931, -115399, -173235? -247491 What is next in -245, -214, 127, 772, 1715, 2950, 4471, 6272? 8347 What is the next term in -27777, -44244, -60699, -77136, -93549, -109932? -126279 What is the next term in -30044983, -60089960, -90134937, -120179914, -150224891, -180269868? -210314845 What is next in -10763, -40555, -89373, -157217, -244087, -349983? -474905 What comes next: -178, 2806, 8954, 18266, 30742? 46382 What is next in -468915, -468957, -468985, -468987, -468951, -468865, -468717, -468495? -468187 What comes next: -600, -1325, -2196, -3213, -4376, -5685, -7140? -8741 What comes next: -32320679, -32320681, -32320683, -32320685, -32320687? -32320689 What is the next term in 527751, 527646, 527361, 526806, 525891, 524526, 522621, 520086? 516831 What is next in -2532, -10128, -22786, -40506, -63288, -91132, -124038? -162006 What is the next term in -109307031, -109307036, -109307045, -109307058, -109307075, -109307096, -109307121? -109307150 What is the next term in -2831523, -5663053, -8494583? -11326113 What is next in 12041, 12027, 11997, 11945, 11865? 11751 What comes next: 32048989, 64097981, 96146975, 128195971, 160244969, 192293969, 224342971? 256391975 What comes next: -48885896, -48885898, -48885900, -48885902, -48885904, -48885906? -48885908 What is the next term in 85723, 85631, 85539, 85447, 85355? 85263 What comes next: 17016, 18146, 19276, 20406, 21536, 22666? 23796 What is the next term in 32992, 132784, 299084, 531874, 831136, 1196852, 1629004? 2127574 What is the next term in -154176, -308399, -462622, -616845, -771068, -925291? -1079514 What is the next term in 2495, 4937, 7399, 9881, 12383? 14905 What is the next term in -24562080, -49124141, -73686200, -98248257, -122810312? -147372365 What comes next: 398208, 796372, 1194536? 1592700 What is next in -42777, -90245, -137713? -185181 What comes next: 29014, 116039, 261072, 464113, 725162, 1044219, 1421284? 1856357 What is next in 25282, 43806, 62328, 80848, 99366? 117882 What is next in -87383, -698131, -2355889, -5584163, -10906459, -18846283, -29927141? -44672539 What comes next: -207909, -417708, -627507, -837306? -1047105 What is next in 5473, 11084, 16741, 22444, 28193, 33988? 39829 What comes next: 27521, 55161, 82797, 110429, 138057? 165681 What is the next term in 3151444, 6302889, 9454334, 12605779, 15757224? 18908669 What is the next term in 387060, 1548015, 3482932, 6191805, 9674628, 13931395, 18962100, 24766737? 31345300 What comes next: -352134024, -352134028, -352134034, -352134042, -352134052, -352134064? -352134078 What is the next term in -67169, -134340, -201515, -268694? -335877 What comes next: -18783504, -18783506, -18783508, -18783510? -18783512 What comes next: 14734, 20967, 27202, 33439, 39678? 45919 What comes next: -975, -5928, -18775, -43422, -83775, -143740, -227223? -338130 What comes next: 1220, 2844, 4960, 7568, 10668, 14260? 18344 What comes next: -1746, -1918, -2210, -2628, -3178, -3866, -4698, -5680? -6818 What comes next: 27531, 220534, 744483, 1764858, 3447139, 5956806, 9459339, 14120218? 20104923 What is next in 288703, 577361, 866019, 1154677, 1443335? 1731993 What is the next term in 436, 613, 884, 1249, 1708, 2261, 2908? 3649 What is next in 1459864, 1459902, 1459940, 1459978, 1460016, 1460054? 1460092 What comes next: 3902, 15586, 35044, 62282, 97306, 140122, 190736, 249154? 315382 What is next in -271729, -543469, -815219, -1086979, -1358749, -1630529, -1902319? -2174119 What is next in -3229, -3176, -3115, -3046, -2969? -2884 What comes next: 97153, 194184, 291215, 388246, 485277? 582308 What is next in -1819078, -1819128, -1819178? -1819228 What is next in 11866, 12535, 13204, 13873? 14542 What comes next: 2849701, 5699331, 8548961? 11398591 What is next in 1055887, 1055890, 1055867, 1055812, 1055719, 1055582, 1055395, 1055152? 1054847 What is the next	{ "pile_set_name": "DM Mathematics" }
3 - 8). -17 What is the value of 7 + 1(51012/564)/(-13)? 2/47 What is (5/2)/((-330)/(-36) - 9)? 15 ((160/(-30))/(-8))/((-6)/(-63)) 7 Evaluate (-18)/(-15)(-65)/(-26) + -2. 1 Calculate (-704)/2160 + (4/(-6))/(115/(-69)). 2/27 Evaluate 17100/(-1900) + 2/3 + 398/48. -1/24 What is the value of (-4715)/391 + 10/170? -12 Evaluate 261/(-432)4 - (-7 - (-340)/48). -5/2 (-2)/40 - (-1242)/(-11960) - (-386)/(-26) -15 (16 - 10) + -2((-66)/12 - -4) 9 Evaluate (4047/71 + -57)((-3)/(-2))/(-3). 0 Evaluate 4850/(-3395)(-84)/10. 12 What is ((-242)/220 + 6/10)/((-6)/228)? 19 What is the value of (-78)/91 - (5238/(-819) + (0 - -6))? -6/13 What is the value of 53/114 + (-10)/170(-170)/(-20)? -2/57 Calculate (-91)/273 + 9/54. -1/6 Calculate (7/(-3))/(1715/7350). -10 What is ((-3112)/120 - 15/225)/(-1 - 1)? 13 36888/33814 + (-258)/55 -18/5 Calculate (-910)/28 + 22 - (-3)/(-2). -12 What is the value of (21 - 23 - 7)(-4)/(-6)? -6 Calculate -6(1 - (1724/1914 + 112/1624)). -2/11 Calculate (12/3 - (-132)/(-30) - 0) + 1. 3/5 What is (-1512/(-144))/((-365)/60 + 6)? -15 What is -4 - (-62)/31 - (7 - (0 + 2))? -7 (-5)/(-6) - (-3276)/216 16 Evaluate (190/570)/(1/(-69)). -23 What is (-5)/511 - ((4 - 7) + 5)? -13 Evaluate (((-196)/322)/(-14))/((-3)/(-6)). 2/23 (889/(-381))/(4/(-12)) 7 Calculate (-765)/(-1071)(-8)/(-10). 4/7 Evaluate -3 + (-318)/(-70) - (-330)/550. 15/7 Evaluate ((-141)/216 - (-4 - -3)) + 40/(-320). 2/9 Evaluate (3 + 5 + -6 + 7)6/6. 9 What is the value of (-21)/(-54)1176/(-49)? -28/3 4 - (81/(-18))/((-42)/28) 1 Calculate 4/(-182) - 360000/182000. -2 Evaluate ((-1140)/152)/(10/(-8)). 6 (-7)/6((-6327)/(-1036))/19 -3/8 2 + (-9 - (-6)/3) - 8/2 -9 What is the value of (-5)/75 + 434/35 + -10? 7/3 Calculate ((-210)/(-18) - 11) + (-2)/62. 0 What is the value of ((-12)/(-14))/((-9)/(-42) + 30/(-105))? -12 What is the value of 65/78 - (-472)/(-48)? -9 What is (-2 + 4)/(1 + 9) + 182/(-210)? -2/3 Evaluate ((-183)/1044 - (-7)/42)-8. 2/29 What is (-4760)/(-272) + 42/(-4) - 53/7? -4/7 What is the value of (117/(-30) - -4) + 0? 1/10 What is ((-18)/(-4) + 0)/(-4 - 399/(-114))? -9 What is the value of (385/(-66))/(-35)20 + -6? -8/3 Evaluate 2 + 1 - (-8 + -5)(6 - 8). -23 (-4)/(-96)16(2 + (-50)/4) -7 1/((4/(-102))/((-20)/(-30))) -17 What is the value of 9/(18/(-16))40/(-32)? 10 ((-1449)/(-115) + -15)/(15/(-125)) 20 Calculate (84/77)/(1040/(-176) - -6). 12 Calculate 2(-21 - (-20 - -3)). -8 What is (-6 - -2 - (108/21)/(-1)) + -1? 1/7 What is the value of 16/16812(-3)/12? -2/7 (-18)/(-117) - 2033/4173 -1/3 ((-527)/496)/(-17) - (-10)/352 1/11 What is -66 + 62 - 48/4? -16 Evaluate (40/(-30))/((-2)/(-10) + 803/(-165)). 2/7 Calculate (-4)/(-22)(-5093)/(-4167). 2/9 Calculate 3/(-15)(-68 - -62). 6/5 -1 - (-9 + (-9)/(-6))4 29 ((-39)/2)/((-21)/(-14)) + 3 -10 What is the value of -3 + -1 + (-30)/(-18)198/15? 18 (-28)/16 - (-9 - -7) 1/4 What is the value of (-75)/(-2)((-2460)/45)/82? -25 Evaluate (-145)/(-87) + ((-534)/342)/1. 2/19 What is (1 + 19)/(40/(-16))? -8 What is (-11 - (-575)/46)(-80)/12? -10 Evaluate (284/(-781) - 62/(-110))/(2/90). 9 What is the value of 1/((1634/(-1615) - -1)/(1/(-5)))? 17 What is ((-577)/25 + 23)(-2)/(-8)5? -1/10 What is the value of (-7)/27147/(-343)? 1/9 24/(-26)(-364)/(-56) -6 What is the value of -36 - -30 - ((-33)/55)/((-2)/(-10))? -3 Calculate (-17 - -4)(1 + 0). -13 Calculate (-218)/14 - 220/(-4158)-27. -17 Evaluate 7 + -4 + 11/(-3). -2/3 Calculate 9/180 - (-2 - (-10 + (-711)/(-90))). -1/20 Calculate 16/416-45/10. -1/13 What is the value of 215 - 622968/20817? 2/27 What is (2/7)/(2(-21)/98 - 0)? -2/3 (-3)/7 - ((-614)/28 + 17 + 7) -5/2 What is the value of 4 - 7143/540? 1/30 Evaluate -27218/(-360) + (-2)/(-5). 14 (23/140)/(-13 + 7990/658) -1/20 Evaluate (-10790)/(-1992)2/(-5). -13/6 Calculate ((-10)/((-400)/60))/((-6)/(-64)). 16 What is the value of 166/(-83) + 160/10? 14 What is the value of (-1)/(-18) + 11094/(-32508)? -2/7 What is the value of 2/(-6)((-2)/(-3))/(106/(-477))? 1 What is the value of 141/846 - -1(-214)/(-12)? 18 What is the value of (440/160)/(6/8) - 3? 2/3 Calculate (-22)/(4598/2451) + 13 + -1. 3/11 Calculate (282/240 + -6 - -5)6/(-21). -1/20 What is the value of (((-114)/75)/19)/(3/15)? -2/5 What is ((-132)/(-12) + -10)(10/6 - 2)? -1/3 What is the value of 40 - 546/(89 - 47)? 27 ((-38)/684)/(8/(-32)) 2/9 What is the value of 744/53 - 90/2385? 14 Evaluate 12/(-10) - (2884/(-2520) - 4/72). 0 5/(-3)((-25095)/1225 - -21) -6/7 (-15 - (-5943)/378) + 6/(-27) 1/2 -5(-7 + 252/24)(-4)/(-14) -5 Calculate ((-1)/2 - (20 - 19))4. -6 Evaluate (-25)/13(-31 - -44). -25 Evaluate (18/135-5)/(29/(-1479)). 34 Calculate 5/28/(-10) + 67 + -49. 16 Calculate 35 - 30 - 17/33. -12 Calculate ((-140)/(-105) + -1)(-36)/10. -6/5 Calculate (-5)/((-90)/(-196)) - 91/819. -11 10/824/(-3) - (-170 + 192) -32 Calculate (16 + -8 + 11)/(-1). -19 What is (-18)/121 - (11 + 2439/(-198))? -2/11 What is the value of ((-1)/2-1227)/3? 9 Calculate ((-616)/48 - -10)-6. 17 What is the value of ((-690)/54 - -13)/(2/(-9)-1)? 1 Calculate (90/130)/(55/(-10) - -7). 6/13 What is the value of (24 - (147 + 22))7/35? -29 Evaluate 28 - 0 - (37 + -51) - 11. 31 Evaluate (9 + 2)/((-2)/(-22)11). 11 (196/(-63) + 2)33/18 -5/9 What is the value of (-1)/(-2) + (414/84)/(-3)? -8/7 What is -1540/(-900)(-15)/2? -5 What is the value of (-39)/(-79 - 38)(-12)/(-22)? 2/11 (-2)/((10 + -11)2(-3)/(-30)) 10 Evaluate 130/(-33) + (-572)/(-143). 2/33 2/60(-133)/1336/(-1) 1/5 (-13 + 14)/1 + -11 -10 (5 - 4)-3 - (-3 + 15) -15 What is the value of (0 + 1 + -21)(-726)/(-605)? -24 Calculate (-215)/(-19) - (-32 + 8 - -35). 6/19 What is the value of (21 - -3)/4 - (21 - (-23 + 46))? 8 What is the value of 102/70 + -1 - (-5 + (-140)/(-25))? -1/7 What is (-4)/((-32)/10) + -15(-888)/4320? 13/3 What is (-3 - -5 - 12/5)(-10)/(-16)? -1/4 What is the value of 2312/4352 + (-2)/4? 1/32 (-27 - -21 - -20) + 3/1 17 What is (-19 - 29) + 63 + -8 + -1? 6 Calculate 1/(-4)-2(-4)/8. -1/4 What is the value of (-300)/(-180) - ((-12)/(-4))/(6/4)? -1/3 (-7 + 7)/((-1)/((110/30)/11)) 0 What is (2/(-8) + (-12)/48)332/(-9711)? 2/117 What is the value of -15 + 9 + 9 + (-2)/((-2)/(-1))? 2 Evaluate 72/1080(-75)/3. -5/3 Calculate (-30)/(-39) + (-6324)/6851. -2/13 (588/322)/(-21) - (-418)/46 9 (-342)/306 - 1/5(-5 + 0) -2/17 Evaluate (101 - 11)/10 + 354/(-32) - -2. -1/16 What is the value of (7 + 13)/(-10) + -8? -10 Evaluate (-17)/(1 + 0) + 20251/1841. -6 What is the value of ((-30)/(-4) - (-680)/(-136))2? 5 What is the value of (6 - (-132)/(-18))-6? 8 What is 1 - ((576/20)/8 - 7 - -2)? 12/5 What is the value of 1431/(-144) + 10 - (-195)/(-48)? -4 What is the value of (29 - (-10063)/(-348))/((-2)/3)? -1/8 (7/(-147))/(4/48-2) 2/7 Evaluate ((-6)/(-36))/((-150)/180) - (-71)/5. 14 (-2)/7(-35)/(-45)16/(-16) 2/9 What is (-2)/(-12 + -1 + 11)? 1 Evaluate 4511/62719. 15 What is the value of ((-1)/6 - -1) + (-15561)/14364? -1/4 What is the value of ((-18)/(-135))/(1/2)? 4/15 Evaluate 18/44(5 - (-102)/(-18)). -3/11 What is (551/(-232))/(-19) + -3 + (-111)/(-8)? 11 (384/320)/((132/(-40))/(-11)) 4 What is the value of (-6)/15 + (2772/(-35))/12? -7 What is 1/((-3)/6) + -1 + (-88)/(-48)? -7/6 Evaluate 66/30 - 7/75. -14/5 What is 7/(-42)-30 - -7? 12 What is the value of ((-27874)/196)/11 + 2/(-28)? -13 What is the value of -12(-4)/6546/(-364)? -12 What is ((-1)/(35/56))/(4(-63)/360)? 16/7 Evaluate 11730/920 + (-6)/12(-2)/4. 13 What is the value of (-3)/(-9) + (-384)/72 + 12? 7 ((-864)/(-378)(-8)/(-10))/((-4)/10) -32/7 Evaluate ((-24)/(-30))/(4/(-50)) - -133. 23 Evaluate (-1)/((-12)/(-8))8/1657. -19 Calculate (-142)/(-46) + (-304)/3496. 3 What is (-54)/66(-11)/(-33)? -3/11 What is the value of (-3 + 330/100)/(1/(10/(-4)))? -3/4 What is 418/(-374) - (-2)/17? -1 -3 - (-17 - (-852)/60) -1/5 What is (-3 - -27)(((-315)/(-27))/(-7) + 2)? 8 Evaluate 300/(-875)40/(-3) + -5. -3/7 What is (7 - (-98)/(-21))(2 + (-21)/6)? -7/2 -11 + 4030/364 - ((-2682)/(-28))/(-3) 32 Evaluate (-408)/(-420)10 + 3 + -13. -2/7 Calculate -20589/1900 - (-4)/(-5). -7 3/16(-4130)/1239 -5/8 What is the value of 1-38 + (601 - 567)? -4 Evaluate 1750/(-750)(-4)/42. 2/9 What is the value of -123*(-1)/(-126	{ "pile_set_name": "DM Mathematics" }
44? 44 Suppose -x = -2c - 5, 3x - 16 = -3c - 1. Suppose 0 = 5i + 3m - 1474, xi - m - 1470 = -6m. What is the greatest common divisor of i and 37? 37 Let y(b) = -b3 - 7b*2 - 21b - 21. Let r be y(-7). What is the greatest common divisor of 28 and r? 14 Suppose 6 = 2n, 4q - 1072 = 3n - 7n. Calculate the highest common factor of 20 and q. 5 Suppose -u + 38 - 22 = 0. Let k(f) = f*2 - 12f + 40. Let o be k(u). What is the highest common divisor of 13 and o? 13 Suppose -12 = d - 3h, -4d + 12 = 2h - 10. Suppose -4y + 55 = -dq, -10 = -3y - 2q + 10. Calculate the greatest common divisor of 35 and y. 5 Let u be (-2 - 0) + 449 + -9 + 10. Suppose -8y = -y - u. What is the greatest common divisor of y and 48? 16 Let g = -176 + 184. What is the greatest common factor of 6 and g? 2 Let b = -624 + 1119. What is the greatest common factor of b and 45? 45 Let p = -244 + 447. Let a(d) = d*2 - 7d - 15. Let q be a(11). What is the highest common divisor of p and q? 29 Let p(f) = 2f - 3. Suppose -x = -4 - 8. Let y be 8/x + (-62)/(-6). Let l be p(y). What is the greatest common factor of l and 209? 19 Suppose -c + 9 = 2c. Let w(i) = -5i - 6 - i + i2 + ci. Let u be w(6). Calculate the greatest common divisor of 48 and u. 12 Let r be 41/(-4) + 12/(-16). Let o = 5 + r. Let p be 1521/52 + o/(-8). Calculate the greatest common factor of p and 45. 15 Let q be ((-5)/4)/(2/(-16)). Let n = 48 - 49. Let c = 4 - n. Calculate the greatest common factor of q and c. 5 Let h = -210 - -223. Let t(z) = 2z2 - 10z + 11. Let k be t(11). What is the highest common divisor of h and k? 13 Let f = 84 - -28. Suppose -5b = -k - 23, 3b - 5k = 5b + 7. Suppose -7 = -bc + 49. Calculate the highest common factor of f and c. 14 Let o(q) = 15q + 147. Let h be o(-7). Suppose -4i + 12 = 0, 0 = -b + i + 53. What is the highest common factor of b and h? 14 Suppose 4f - 289 = -821. Let z = f + 275. Suppose 4x - 26 = z. Calculate the greatest common factor of 6 and x. 6 Suppose 8w = -11737 + 11777. Suppose -2n + n = -5. What is the greatest common factor of n and w? 5 Let k(v) = 3v - 16. Let t be k(7). Suppose -p - 2c = -20, t = -3p + 3c + 20. Suppose -pg + 48 = -6g. Calculate the greatest common factor of 108 and g. 12 Let n(a) = -a3 + 7a*2 + 16a - 19. Let y be n(8). Calculate the highest common factor of y and 63. 9 Let k(j) = 10j2 - 37j + 5. Let w be k(4). Let q(l) = -l*3 - 7l*2 - 6l - 8. Let p be q(-7). What is the highest common divisor of p and w? 17 Suppose 0r + 300 = 3r. Let u = -12875 - -12935. Calculate the highest common factor of u and r. 20 Let o = -1133 - -1149. Let n(y) = y*3 - 5y2 + 4. Let v be n(6). Calculate the highest common divisor of o and v. 8 Let g(k) = k3 - 21k2 - 48k + 55. Let b be g(23). Calculate the highest common factor of b and 9. 9 Let s = -2424 - -2586. What is the highest common divisor of s and 234? 18 Suppose -4o + 33 = -5v - 126, 5v + 3o = -152. Let w = v + 33. Let n be (-4)/(w/(-4 + 0)). What is the greatest common factor of 2 and n? 2 Let s(t) = t*2 + 11t + 4. Let q be s(-11). Suppose 5b + 7 = qb + 4w, 4b - 3w + 2 = 0. Calculate the highest common divisor of b and 1. 1 Let i be 15 - 19 - 1101/(-3). Calculate the highest common factor of 33 and i. 33 Let a(d) = 3d*2 + 2d + 1. Let z be a(-2). Let x be -2(2 + 20/(-8)). Let o be (73 - (-2 + 3))1/x. What is the greatest common divisor of z and o? 9 Let i be 0((-10)/4 + 3) - -68. What is the highest common factor of i and 17? 17 Suppose 0 = -2d - 2p + 72, -154 = -5d - 2p + 26. Calculate the highest common divisor of 252 and d. 36 Let y = -28 + 32. Let l be (-2 - -8)/(2/y). Calculate the highest common factor of 108 and l. 12 Let k be ((-18)/6)/((-3)/11). Let u be 162/4 + 3. Calculate the highest common factor of k and u. 11 Let y be (-4)/3(-1107)/18. Calculate the greatest common divisor of 41 and y. 41 Let a(k) = -6k + 8k2 - 8 - 3 - 4 + k3. Let y be a(-8). Calculate the highest common factor of y and 22. 11 Let f(v) = 6 + 9v - 4v - 3v - 5v. Let s be f(-2). Calculate the greatest common factor of 4 and s. 4 Let y(m) = 3m*3 + 26m*2 + 6m + 4. Let v be y(-6). Let n be 12/(-2 + 11/4). Calculate the greatest common factor of v and n. 16 Let j be (-185)/20 - 1/(-4). Let h = 11 + j. Suppose -2f = 2w - 60, -5w + 2w + hf = -90. What is the greatest common factor of 10 and w? 10 Let y be (-33)/((-1416)/(-132) + -11). Calculate the greatest common factor of y and 11. 11 Suppose -3b + 3 = 0, 5z = 2b - 103 + 601. Let l(d) = -d*3 - 12d*2 - 32d - 80. Let o be l(-10). What is the highest common factor of z and o? 20 Let n be -3 + 5/1030. Suppose -2w + 6 = -n. Calculate the highest common divisor of w and 3. 3 Suppose 18 = -4b + 90. Calculate the greatest common divisor of b and 10. 2 Suppose 20 = -5m + m. Suppose d - 5j - 27 = 3d, 3d + 49 = j. Let n = m - d. What is the highest common factor of 11 and n? 11 Let c = 40 - -48. Suppose m - 10 + 0 = -w, -17 = -2m - 5w. What is the greatest common divisor of m and c? 11 Suppose -2d + 220 = -0d. Suppose -6b - 8 = -8b. Suppose -x + d = bx. Calculate the greatest common factor of x and 11. 11 Suppose -11b - 3157 = -52b. Calculate the highest common divisor of 7 and b. 7 Suppose -o = -5i + 125, 5o + 28 - 3 = i. Suppose -i = 2v - 4v + 5h, -4v + 2h + 42 = 0. Calculate the highest common divisor of 90 and v. 10 Suppose -3f = 3d - 99, 3d + 4f = 4d - 18. Let s be -2((-10)/d - (-446)/(-12)). What is the highest common divisor of 15 and s? 15 Let g(c) = 32c + 10. Let i be g(-3). Let z = 30 - i. Calculate the greatest common factor of z and 29. 29 Let n(f) = -f*3 + 4f*2 - 2f - 2. Let o be n(3). Let q be 15 - 2 - 4/o. Calculate the greatest common factor of q and 45. 9 Suppose -2l + 210 = 3l. Let d be (-112)/l(-9)/4. What is the greatest common factor of d and 18? 6 Let j = -46 + 144. Let b = j + -62. Calculate the highest common factor of 36 and b. 36 Let o = -172 - -202. Calculate the highest common factor of 18 and o. 6 Let v(b) = 24b - 68. Let k be v(4). Calculate the greatest common divisor of k and 112. 28 Let w(g) = -g*3 - 2g*2 + 6g + 7. Let a be w(-5). Let x = a + -27. Let q be (-2)/(-5) - (-40)/x. Calculate the highest common divisor of 8 and q. 2 Let v(x) = -2x2 - 93x - 41. Let n be v(-46). Calculate the greatest common divisor of 155 and n. 5 Suppose 5i = 3 + 17. Suppose ir = 3r + 72. Calculate the greatest common divisor of r and 9. 9 Suppose -2d - 69 = -23. Let h = -21 - d. Calculate the highest common divisor of 16 and h. 2 Suppose 5k = s - 15, -k + 77 = 4s - 4k. Suppose 3l + s = 7l. Suppose -lq - 792 = -9q. What is the greatest common factor of 18 and q? 18 Let d(w) = 60w - 14w + 4w + 2 - 8. Let s be d(1). What is the greatest common factor of 11 and s? 11 Let h = 2 + 0. Let z = 18 - 4. Let u = z - h. What is the highest common divisor of u and 60? 12 Let n(m) = 21m - 49. Let h be n(3). Let y(t) = 154t*2. Let r be y(1). Calculate the greatest common factor of h and r. 14 Suppose -42 + 234 = -6t. Let s(z) = z*3 - 7z*2 + 6z + 8. Let l be s(6). Let u be (-190)/(-8) - l/t. What is the greatest common divisor of u and 60? 12 Suppose -8z - 5f = -4z - 233, 124 = 2z + 4f. Calculate the greatest common divisor of z and 78. 26 Let p(h) = 2h*3 - 2h*2 + 2h + 1. Let i be p(2). Suppose 3 = t + 5c - 3, 2c - 70 = -3t. Calculate the highest common divisor of t and i. 13 Let q(x) = x3 + 3x*2 - 4. Let w be q(-2). Suppose -1 - 9 = -5j, w = -2u + 4j. Calculate the highest common divisor of 1 and u. 1 Suppose -2b + 17 + 41 = 0. Suppose 0 = 3h - 276 - 36. Suppose 0 = -n + h + 215. Calculate the greatest common divisor of b and n. 29 Let s = 2052 - 1758. What is the greatest common divisor of 42 and s? 42 Let s(k) = -3k + 8. Let t be s(-9). Let h = -32 + t. Suppose hv - 45 = 9. What is the highest common divisor of v and 18? 18 Suppose 2f - d = -3 - 32, -f = -d + 15. Let j = f - -37. Let c = -98 + 115. Calculate the greatest common divisor of j and c. 17 Suppose 754 = 14j - 1430. Calculate the greatest common factor of 108 and j. 12 Let d be (-4 + (0 - -1))-25. Suppose -2o - 2 = -12. Supp	{ "pile_set_name": "DM Mathematics" }
y*2 + 3y*2)(-7 + 3 + 2) - 5y2 + y2 + 0y*2 to uy*2 + m + iy and give u. -5 Rearrange -2l3 - 2l + 10l3 + 371 - 370 + l4 to fl + jl4 + q + ml*2 + zl*3 and give m. 0 Rearrange 3 - 8 + y - 7y + 3y to f + ly and give l. -3 Express -6 + 68a3 - 6a*2 + 3a*2 - 62a*3 in the form ja*3 + za + q + ba2 and give b. -3 Express -4j*3 - 2 - 6j2 - j3 + 3j3 as w + zj*2 + ij*3 + qj and give i. -2 Express (0 + 2 - 8)(p - 2 + 2 + (4 + 0 - 3)(-p - 4p - p)) in the form i + np and give n. 30 Express (h + 2h3 - h)(1 - 1 - 2h) + 28h*4 - 2h*4 + 65h*4 - 4h*4 in the form o + vh*3 + bh*2 + lh + rh4 and give l. 0 Express (4h*3 + 0h*3 - 3h*3)(-8 - 5 - 13)(2 - 3 + 0) as ah + kh2 + zh*3 + q and give z. 26 Rearrange 3y - 5y + 5y to o + fy and give f. 3 Rearrange (8 - 3 - 4)(-8 + 8 - 6b)(-6 + 3 + 1) to the form ib + f and give i. 12 Express 8o + o + o in the form mo + d and give m. 10 Rearrange (-4w + 5w + w)(-10w - 3w - 2w) - 2w - 2 + 2 - w*2 to the form rw + m + qw2 and give q. -31 Rearrange (9p*2 + 0p*2 + 0p*2)(-2p + 0 + 0) + 3p*3 - 2p*3 + 0p3 - p3 + 0p3 + 2p*3 to the form mp*2 + wp + f + ip3 and give i. -16 Express 12u - 22u2 + 16u + 1 - 26u as yu*2 + mu + x and give y. -22 Express (-1 + 2y2 + 1)(0y2 + y2 - 1 - 5y*2) as uy*3 + ky*2 + wy + g + by4 and give b. -8 Express 3j*2 - 2j*2 + 18j*2 in the form uj + f + lj2 and give u. 0 Rearrange f3 + 3f2 - f2 + 0f2 - 2 + 2f to bf3 + kf*2 + d + vf and give k. 2 Express (o*3 - 4o*3 + 4o*3)(3o + 6o - 5o - 2) as co*2 + io*3 + y + ho*4 + po and give h. 4 Express (2 - 2 - i)(-3i - 9i + 2i + (-i - 1 + 1)(0 - 4 + 5) + i + 2i - i) - 2i2 + 4i*2 + 3i*2 in the form p + di*2 + gi and give d. 14 Express 18o + 47o*2 - 45o*2 + 7o in the form q + wo + jo*2 and give j. 2 Express (4 - 4 - a)(-2 + 1 + 3)(1 - 24 + 8)(2 - 1 - 2) as ia + j and give i. -30 Express (-2 - 1 + 1)(1 + 0 + 0)(-2m - m + 4m - 3m + 2m + 3m + (2 - 2 - m)(1 - 4 + 1)) in the form im + v and give v. 0 Rearrange (0 + 0 + 11w2)(2w - w - 3w) to b + jw3 + kw*2 + cw and give b. 0 Express (5 - 4 - 4)(2 - 2 - 2w)(2w*2 - 2w2 + w3) in the form cw2 + g + jw*4 + iw*3 + yw and give j. 6 Rearrange (-3 + 0 + 1)(0t - 3t + 0t)(3t*2 + 6t*3 - 3t*2) to the form d + vt*3 + ct*4 + bt*2 + ut and give c. 36 Express 8v2 + 4v*2 - 6v*2 + 2 in the form m + jv*2 + av and give j. 6 Express 15 - 280r - 2r*2 + 50 + 280r as p + br2 + or and give p. 65 Express -13u2 - 4u*2 + 1 + 3u*2 - 2 as p + ju*2 + tu and give j. -14 Express (3 + 1 - 2)(2 - 3n - 2) + (-4 - 4 + 1)(-7n + 2n + 3n) in the form g + xn and give x. 8 Express -x3 + 8 - 1 + 3 + x2 - 7 - 2x*4 as p + jx*3 + wx*2 + tx + rx4 and give p. 3 Rearrange (46 + 2r - 51 - r)(12r - 3r2 - 12r) to the form k + ur3 + tr + zr2 and give u. -3 Rearrange (3 + 2 - 4)(-4 - 1 + 0)(-2a + 3a + 0a) to the form p + xa and give x. -5 Express j2 - 21 + 40 + 7 in the form hj + m + zj2 and give h. 0 Rearrange (1 - 2 + 0)(2 - 4 - 1)(0 + 0 - 2j*2 + 17j*2 + 200 - 200 + (-j + 2 - 2)(3j - 4j - j) - j*2 - 1 + 1) to zj*2 + hj + c and give z. 48 Express q2 - q2 + 2q4 + (-4q + 4q + 3q)(-5q + 5q + 22q*3) in the form mq*3 + iq*4 + f + xq + kq2 and give i. 68 Express -q4 + 2q + 2q - 1 + 3q*4 - 2q as jq2 + nq*4 + k + iq*3 + zq and give z. 2 Rearrange 2o2 - 378 + 378 + o to so + uo2 + p and give u. 2 Rearrange (-3g3 + g3 + 4g3)(-14 - 4 - 11)(-2g - 5 + 5) to pg + bg*3 + wg*4 + h + ng*2 and give w. 116 Express (-a + 0a + 2a)(18a - 4a - 9a) - 3a*2 - 3a*2 + 4a*2 as ca + y + oa2 and give y. 0 Express (5 + 3t*2 - 5)(-t + 3t + 0t) in the form dt2 + zt*3 + p + ut and give z. 6 Express -15w3 + 4w*3 + 2w*4 + 8w*3 + 4w - w*3 as n + hw*2 + bw*3 + aw*4 + qw and give b. -4 Express -11z - 18z + 3z + 5z - 2z - z - 5z - 3z + 6z + (3 - 6 + 4)(z + 2 - 2) + 2z - 2z + 2z in the form uz + c and give u. -23 Express (-4l + 0l + 6l)(-66 - 15 + 1) in the form sl + q and give s. -160 Rearrange (2x - 2 + 2)(10x - 6x - x) + (4x2 - 4x2 - x2)(-3 + 1 + 4) to the form mx*2 + kx + a and give m. 4 Express -13 - 47y2 + 13 as ry*2 + p + ly and give r. -47 Rearrange 0a + a + 2 + 5a*3 - 7a*3 to ya + qa3 + z + ha*2 and give z. 2 Rearrange ((-1 + 1 - y)(-1 + 7 - 3) - 2y + 4y - 4y)(-2 + y + y - y + (2y - 5y + 2y)(-2 - 4 + 5)) to c + oy2 + fy and give f. 10 Rearrange 2n - 2n - n + (4n - 2n + n)(-1 - 3 + 5) - 4 - 6n - 3 + 5 to the form an + s and give s. -2 Express 122u - 123u - 2u*3 - 3u*4 + 17u*2 + 2u*4 in the form lu*4 + tu*2 + ju + g + iu3 and give l. -1 Rearrange -y4 + 5 + 15y - 2y3 - 16y - 7 to sy + g + iy*3 + ny*2 + ry*4 and give i. -2 Express (-1 + 4 + 0)(14r2 - 8r*2 - 22r*2) in the form fr + p + xr2 and give x. -48 Rearrange (27 - 38 + 24)(-3g + g + 4g) to xg + a and give x. 26 Express (-4j2 + j2 + 2j2)(0j - 1 - j2 + 0j*2 + 2j) as ij3 + k + zj + lj4 + sj*2 and give i. -2 Express (-3s3 + s3 - 5s3)(4 - 4 - s + 3s - 5s + s + (2s - 4 + 4)(-2 + 0 + 0) - s + s + 2s) as y + as*2 + gs*4 + cs*3 + ns and give g. 28 Express -7 + 15 - 16b - 8 as ub + j and give u. -16 Express -6r4 + 6r*4 - 6r*4 + (46 - 10r*3 - 46)(-4 + 4 + 6r) as mr*4 + jr + t + vr3 + zr*2 and give m. -66 Rearrange 3r2 - r2 - r*2 - 8r*3 + 15r*3 to the form ar*3 + qr*2 + hr + f and give a. 7 Rearrange (b*2 + 2b*2 - 5b*2)(-13875 + 80b2 + 13875) to the form nb + hb3 + rb*2 + f + pb*4 and give p. -160 Rearrange -4 + 13y - 3 + 7 to x + ny and give n. 13 Express -187g2 - 2 - g4 + 9 + 185g2 as kg*2 + bg*4 + rg + i + yg3 and give b. -1 Express (0d*4 - 2d*4 + 3d*4 + (1 - 2d*3 - 1)(-2d + d - d))(-13 - 16 - 5) as r + yd + zd*4 + qd*3 + hd*2 and give z. -170 Express 6j + 0j - 4j - j*2 - 10j*2 in the form lj*2 + t + aj and give a. 2 Express -16 - 2b + 6b + 18 + 2b3 - 2b as ib2 + fb + gb3 + c and give g. 2 Express 22 - 12 + 14 + 3y2 - y2 as by2 + j + dy and give j. 24 Rearrange -6p - p2 - 8 + 6p to the form yp2 + lp + i and give y. -1 Rearrange (4r2 - 15r*2 - 8r + 10r)(1 + 1 - 4) to wr + jr*2 + u and give j. 22 Rearrange -18a + 64 - 64 to ba + v and give b. -18 Express -w - 2w*3 - 8 - 4w*2 + 4w*2 + 23 - 2w*4 in the form u + kw + bw2 + yw*3 + cw*4 and give k. -1 Rearrange (2 - 3 - 1)(18 - 14i3 - 18) - 3i*3 + 2 - 2 to ni*2 + ci + gi3 + q and give g. 25 Rearrange -11 + 5k + 11 to the form bk + l and give b. 5 Express -10c - c + 0 + 2c + 2 in the form z + qc and give z. 2 Rearrange (7 + 19 + 2)(2y + y*4 - 2y) to a + ly4 + my + hy3 + zy*2 and give l. 28 Rearrange a - 2a*2 + 5a2 - a2 + a*2 to the form fa + j + va2 and give v. 3 Rearrange 7 + 8 - 45q*2 + 82q*2 - 44q*2 to y + xq + cq2 and give y. 15 Express 4r*2 + 5r*2 - 3r2 + r2 as wr2 + p + ir and give w. 7 Rearrange -38 + 3b + 5 - 5b to the form y + lb and give l. -2 Rearrange 14 - 13 - 7t + 5t to gt + h and give h. 1 Express (-x*3 + 1 - 1)(-9x - x + 12x) in the form gx3 + mx*4 + q + ux*2 + hx and give m. -2 Rearrange -2 + j*3 - 10j*4 + 2j*4 + 1 to xj*2 + mj + bj4 + cj*3 + r and give c. 1 Rearrange (-2u + 2u - 8u*2)((-1 + 2 + 0)(-1 - 4 + 3) + 2 - 4 + 1 - 3 + 0 + 4)(2 - 5 - 1) to mu2 + d + bu and give m. -64 Express (-1 + 1 - 2p)(0p + 0p - 2p) + 2 + 2p*2 - 2 + 0p*2 + 6p*2 - 4p*2 + (-2p + 4 - 4)(3p - p - p) in the form a + hp2 + zp and give h. 6 Express 11n + 8n - 46n - 49n as v + bn and give b. -76 Express 188 - 72k - 188 + k + k - k + k + k - 4k + (-4k + 2k + 0k)(-3 + 3 + 1) as l + tk and give t. -75 Rearrange (4u - 1 - 4u + u*2)(-5u2 + 2u*2 - 4u*2) to the form du*4 + ru*3 + xu + l*u	{ "pile_set_name": "DM Mathematics" }
e fourth smallest value in -0.04, -0.3, 53, 6253, -2/3? 53 Which is the sixth smallest value? (a) -0.5 (b) 1/227 (c) 0.4 (d) -2/13 (e) 2/27 (f) 0.76 f What is the second smallest value in 5, -27, 182, 2, 1, 4, -2/15? -2/15 What is the second smallest value in 111, 6/29, 9/185, -0.3? 9/185 Which is the second smallest value? (a) 6/5 (b) -1484 (c) -4 (d) -6 (e) -0.06 d Which is the third smallest value? (a) 0.5 (b) -1/307 (c) -2/7 (d) 2/121 d Which is the third biggest value? (a) 2/11 (b) 1 (c) 0.14 (d) 11 (e) -0.302 (f) 17/2 b What is the third smallest value in 14551, 0.13, 1/5? 14551 Which is the third smallest value? (a) 17/3 (b) -1776 (c) 3 (d) 2 (e) 5 (f) -6 d Which is the fourth smallest value? (a) 5/2 (b) 0.5 (c) 1867 (d) 255.6 c What is the smallest value in -1, -1/3, 5, -5/3, -2/18933? -5/3 What is the sixth biggest value in 0.1, -0.6, -3/8, -5, 2, -1/185, -3/4? -3/4 Which is the smallest value? (a) 1 (b) 0.14 (c) -3 (d) 3157648/7 (e) -1 c Which is the fifth biggest value? (a) 10.4 (b) -1/7408 (c) 1/7 (d) 0.1 (e) 3 b Which is the fifth biggest value? (a) -2.9 (b) 1 (c) 0.2 (d) -75/7 (e) 3 d What is the fifth smallest value in 0.5, 0.1711, 0.3, 304, -6? 304 Which is the biggest value? (a) -134/7 (b) 82 (c) -153 b Which is the fifth biggest value? (a) -0.2 (b) -3/8 (c) -12 (d) -24310/9 (e) -0.5 d Which is the second biggest value? (a) 3560503 (b) -1.7 (c) -3/5 c Which is the biggest value? (a) 2/5 (b) -3978 (c) 2/21 (d) 378 d Which is the third smallest value? (a) -43 (b) 3 (c) 2/17 (d) 19/5 (e) -4 c Which is the third biggest value? (a) 3 (b) -61949118 (c) 1/7 b Which is the fourth smallest value? (a) 179 (b) -0.68 (c) -2 (d) -7/9 a Which is the fifth smallest value? (a) 6 (b) -1252 (c) 0.8 (d) -5 (e) 1 (f) -27 e Which is the second smallest value? (a) 0 (b) 4 (c) -5/4 (d) -161874901 (e) -2/5 c What is the second smallest value in 2/3, -0.9, -1030/7, -0.2, 1/5? -0.9 Which is the fourth biggest value? (a) -26 (b) -1/87 (c) 6 (d) -2 (e) -1 (f) -3 d Which is the fourth biggest value? (a) 0 (b) -4 (c) -2810 (d) 0.3 (e) 90 b Which is the third biggest value? (a) 3 (b) 0 (c) 106852.296 b Which is the third smallest value? (a) 1/5 (b) -483 (c) 0.024 (d) 2/15 (e) 2/17 (f) -0.3 (g) -0.1 g Which is the second biggest value? (a) 0.1 (b) -9 (c) 11 (d) -1.02 (e) -25 (f) -2/5 (g) 1 g What is the second smallest value in -103.2, 21, -0.093? -0.093 What is the fourth smallest value in -241, -2/13, -2, -19/4, 2, -0.5? -0.5 What is the biggest value in 172, -1481, 2/5? 172 Which is the sixth smallest value? (a) 4 (b) -0.1 (c) 1/7 (d) 6/55 (e) 18.33 (f) 2/13 e What is the biggest value in -3, -1/43601851, 2/7, 1/4, 2? 2 What is the third biggest value in -6/7, -0.5325738, -0.4? -6/7 What is the second biggest value in -146, -3, 21, 0, 76, 3, -0.4? 21 Which is the second biggest value? (a) 5 (b) 0 (c) -0.3 (d) 1/6 (e) -8671 (f) 1 f Which is the smallest value? (a) -69845 (b) 4 (c) -1109 a Which is the fifth biggest value? (a) -99.94 (b) 1/2 (c) -0.5 (d) -352 (e) 0.2 d What is the second smallest value in 0.02, -2, -63, 0.1, 4, 6, 3/2? -2 What is the second smallest value in -2/7, -3, -0.3, 1106, -1? -1 What is the smallest value in -4/7, -0.8, 682, 5, 0.7, -2/5, -3? -3 What is the second smallest value in 0.2, 2/5, -2, -0.2, 52/5, 103, -59? -2 Which is the smallest value? (a) -2 (b) -2/97 (c) -4 (d) -3 (e) 58 (f) 2 c Which is the second biggest value? (a) 50 (b) 4 (c) -3/4847 (d) -0.5 b What is the second biggest value in 4, 22, -162/7, -4, 1/9, 3? 4 Which is the second smallest value? (a) 5 (b) -1 (c) -6 (d) -25643 (e) -5 c Which is the second biggest value? (a) 0.3 (b) 60312 (c) -2/29 a Which is the second biggest value? (a) -12/11 (b) -5.291 (c) 8 a Which is the third smallest value? (a) -0.5 (b) 883 (c) 23 (d) 126/11 c Which is the fourth smallest value? (a) -245.9 (b) 275 (c) 0.2 (d) -3 (e) 3 (f) 5 (g) -0.03 c What is the fifth smallest value in -1/4, -0.1, -127, 2/7, -3224? 2/7 What is the fourth smallest value in 0, 2/2687, -163, 9/26? 9/26 What is the fourth biggest value in -108, 0.2379, -3, -4? -108 What is the third smallest value in 1366.29, -1, 0.16? 1366.29 Which is the biggest value? (a) -5 (b) 3 (c) -292.169 (d) -0.1 b What is the fifth biggest value in -25, -3, 6/7, -2, -1/5, 11/16? -3 What is the second biggest value in 52/3, 2/5, -75, -1, -2, 1? 1 Which is the second smallest value? (a) 3 (b) 0.26 (c) -132.18 (d) -2 (e) 0 d Which is the third biggest value? (a) 26.21 (b) 3 (c) 4 (d) -0.5 (e) -5/4 (f) -0.2 b Which is the fourth smallest value? (a) 1.5 (b) -19 (c) -34 (d) -4/7 (e) -6 d What is the biggest value in -42, -4, 0.2, -0.1, -6, -200? 0.2 What is the second biggest value in -2/3, -63, -0.3, -20, -2, 2/9, -0.25? -0.25 What is the fourth smallest value in -2, 0.39, -21.2, -1, -160? -1 Which is the seventh smallest value? (a) -5 (b) 0.4 (c) -4 (d) 13 (e) 2.8 (f) -2/7 (g) 6 d Which is the third biggest value? (a) -1/6 (b) -0.1 (c) -3 (d) -0.12 (e) -20/19 (f) -295 a What is the fourth smallest value in -0.3, 0.2, 1/8, 72819, -2/5? 0.2 What is the sixth biggest value in -2/29, -2/11, 6, 0.4, -2, 19/421? -2 Which is the sixth biggest value? (a) 5 (b) 50 (c) 1/3 (d) -1/1598 (e) 2/9 (f) 103 d What is the third biggest value in 32/7, 2/75, -149833? -149833 Which is the second biggest value? (a) -13345 (b) 7 (c) 42/11 (d) -1 c Which is the fifth biggest value? (a) 0.3 (b) 1 (c) 0.1 (d) 50/11 (e) -0.18 e What is the biggest value in 5, -0.2, 3/7, -3, -79.0733? 5 What is the fifth biggest value in 2, 0.01, -33, 46, 0.22? -33 What is the fourth biggest value in -12/73, -8, -0.4, -0.5, 0.23, 0.1? -0.4 What is the second biggest value in -1/9, -5/4, 1, -59451? -1/9 What is the sixth smallest value in -2/7, 2/3, -54795, -2/5, 36, 0.4? 36 What is the biggest value in -25, -0.1, 1339/14? 1339/14 Which is the smallest value? (a) -2/3 (b) -2558 (c) -6/13 (d) -13 b Which is the fourth smallest value? (a) -0.2 (b) 4/3 (c) 47 (d) -2 (e) 2 (f) -1487 b Which is the second smallest value? (a) -1 (b) -6345 (c) 307 a Which is the fifth biggest value? (a) -0.05 (b) -14 (c) 1 (d) -3 (e) 6/5 (f) 4.2 (g) -0.2 g Which is the second smallest value? (a) 0.5 (b) -2/13 (c) 249028 a What is the smallest value in 0.1, 8.5, 0.9, -2, -0.1? -2 What is the biggest value in -372, 15874, 31? 15874 Which is the fourth biggest value? (a) -0.75 (b) -3263 (c) 34 (d) -5 b What is the fifth smallest value in 0, 2958, -146, 0.1, 0.7, -0.2? 0.7 What is the third smallest value in 34, 3/5596, 1/14? 34 Which is the third biggest value? (a) -174 (b) 100435 (c) 1 a Which is the sixth biggest value? (a) 4 (b) 2/109 (c) -11 (d) 4/3 (e) 2170 (f) 1/3 c Which is the fourth biggest value? (a) -0.5 (b) 136 (c) -4 (d) -2/19 (e) -2.0896 e Which is the biggest value? (a) -0.1 (b) 6596091 (c) 0.2 b What is the smallest value in -1, 277183.24, -8, 0.1? -8 What is the biggest value in 0.6, 0.5, -3, 13, -0.100228? 13 What is the sixth smallest value in -312, -4/5, 0.29, -3, 4, -0.5? 4 What is the fifth smallest value in -7.9, 3, -6/11, 1.3, 37? 37 Which is the fifth biggest value? (a) 1/7 (b) 2 (c) 4 (d) 1/4 (e) -13 (f) -3/5 (g) 1/14 g What is the third smallest value in -3360, 64, -3? 64 What is the smallest value in 1447834, 1/9, -1/6? -1/6 Which is the fourth biggest value? (a) -9071 (b) -3/4 (c) -38/5 (d) 2/15 a Which is the smallest value? (a) -49.5 (b) 0.6 (c) -106052 c What is the second biggest value in 386, 0.4, 1, 0.5, 0, -28, -57? 1 Which is the fourth biggest value? (a) 1.283 (b) -5 (c) -1/1882 (d) -1 (e) 0 d Which is the third biggest value? (a) -2 (b) -239 (c) 3 (d) -770/23 d Which is the third smallest value? (a) 0.4 (b) -18 (c) -5 (d) 41 (e) 3/4 (f) -281 (g) 0.3 c Which is the second biggest value? (a) 9737/45 (b) -5/6 (c) -7 b Which is the second smallest value? (a) 3/14 (b) 0.4 (c) -1/5 (d) -5 (e) -1516 (f) 0.5 d Which is the biggest value? (a) -7.5 (b) -2/3 (c) 57/7 (d) -0.089 c Which	{ "pile_set_name": "DM Mathematics" }
, x = 2g + 4u - 2142. What is the thousands digit of g? 1 Let l be (0/(-6 - -10))/(-11). Suppose l = 3a - 7a. Suppose i = -5, -3z + 339 = -az + 3i. What is the units digit of z? 8 Suppose -7v + 2l = -11v + 13608, -12v + 5l = -40868. What is the units digit of v? 4 Let l(q) = -14q + 3. Let n be l(0). Suppose 0 = -ns + j + 4136, -5j + 1414 = 4s - 4088. What is the thousands digit of s? 1 Let g(a) = -69a + 710. What is the hundreds digit of g(-33)? 9 Let h(v) = 3v3 - v2 - 8. Let l be h(4). Suppose -l = -4i - 0i. Let k = i + -30. What is the units digit of k? 2 What is the thousands digit of 16589/1 + (-5)/35-214? 6 Let b(i) = i3 + 16i*2 + 16i + 9. Let s be b(-15). Let n be s/9 + -21(-8)/36. Suppose l = u + 97, -3l + nu + 279 = 5u. What is the units digit of l? 4 Suppose 2m - 6m + 202 = 2r, 0 = -2m + 10. Suppose 2a - 8v + 11v = r, a - 38 = -4v. What is the tens digit of a? 5 Let p(x) = -x*3 + 20x*2 + 26x + 10. Let n = -3 - -24. What is the tens digit of p(n)? 1 Suppose 18r - 13r + 28120 = 5g, -3g + r = -16872. What is the tens digit of g? 2 Let a(x) = x - 3. Let w(z) = -z + 5. Let s(p) = 7a(p) + 3w(p). Let j be s(2). Suppose -jy - y = -204. What is the units digit of y? 8 Let b be 12/10 + (-5)/(150/(-24)). Suppose br - 426 - 4304 = 0. Suppose -365 = 10w - r. What is the hundreds digit of w? 2 Let u(l) = -l2 + 19l - 71. Let y be u(9). Let i = 239 + y. What is the units digit of i? 8 Let u(k) = -k*3 + 7k*2 - 12k + 10. Let p be u(6). Let n = -13 - p. What is the units digit of n? 3 Let j(z) = -81z - 839. What is the tens digit of j(-11)? 5 Let p = -2088 + 4389. What is the tens digit of p? 0 Let h be 123/18 + (-2)/(-12). Suppose -9p - 30 = -hp. Let s = p + 19. What is the units digit of s? 4 Let h = -5829 + 12293. What is the thousands digit of h? 6 Let z = -23 - -34. Suppose -i + 4x + z + 1 = 0, 123 = 4i - x. Suppose -i = -3k + 79. What is the tens digit of k? 3 Suppose -4t - 835 = -y, -3y + 8t + 2570 = 9t. Suppose w - 3z + 85 = 374, -3w - 3z = -y. What is the tens digit of w? 8 Suppose -38k - 53k = -561106. What is the hundreds digit of k? 1 Let x be (-2)/(-1 + (-255)/(-257)). Let i = x + -12. What is the units digit of i? 5 Let q = 53279 - 15352. What is the tens digit of q? 2 Let l be (3/(-1) - 2)174/145. Let f(y) = -57y + 52. What is the hundreds digit of f(l)? 3 Suppose -124h - 1771 = -117h. Let v = -59 - h. What is the tens digit of v? 9 Let j be (-2 + 0)/((-1)/(-4)). Let p(h) = -20h + 104. What is the hundreds digit of p(j)? 2 Let f = 199 - 199. Let s(k) = -k*3 + 3k*2 + k + 1178. What is the units digit of s(f)? 8 Let h(q) = 237q + 1056. What is the ten thousands digit of h(127)? 3 Suppose r + 2j + 596 = -194, 3187 = -4r + j. Let a = r - -1388. What is the units digit of a? 2 Suppose -w - 4g = 9, 15g + 6 = -2w + 11g. What is the tens digit of 5 + (1 + (-861 - w))/(-1)? 6 What is the hundreds digit of (708/120)/(-59) + 164102/20? 2 Suppose 0 = 44x - 51x + 11851. Let j = 3005 - x. What is the thousands digit of j? 1 What is the units digit of -2 + 20 + -27 + (-3 - -7204)? 2 Suppose -150218 = -3x - 373k + 377k, -100107 = -2x - 5k. What is the tens digit of x? 6 Suppose -83l + 493891 = -212259 + 172543. What is the tens digit of l? 2 Suppose -32 = -3x - 4g, 0 = -10x + 5x - 2g + 30. Let w(i) = 7i*3 - 7i*2 - 5i + 9. What is the hundreds digit of w(x)? 3 Suppose -j = 2t - 84700, 27t + 42350 = 28t - 4j. What is the tens digit of (t/(-33) + 8)(-6)/4? 1 Suppose -81q + 84q = 4d - 15146, 3803 = d + 2q. What is the tens digit of d? 9 What is the tens digit of 10 - (-39 - (-5 - 3))? 4 Let p be ((0/4)/2)/(-13 + 14). Suppose 155t - 144t - 10846 = p. What is the tens digit of t? 8 Suppose -64 = -29o - 6. Suppose -2q + 7q = -oy + 570, -q - 1479 = -5y. What is the tens digit of y? 9 Suppose -22b - 71b = 24b - 909090. What is the units digit of b? 0 Let u = 17 + 16. Suppose u = -4z + 217. Let o = 83 - z. What is the tens digit of o? 3 Suppose -10297 = 18r - 211897. What is the units digit of r? 0 Let b(q) = 7q*3 - 7q - 7. Let f be b(-1). What is the hundreds digit of (-1932)/(-23)(-48)/f? 5 Let h(f) = -32f + 37. Let i be h(-17). Suppose -2l + 283 = 2x - i, 0 = 5l - 5x - 2200. What is the units digit of l? 6 Let i be 46/(-23)(-1 - 2/2). Suppose -5a + 51 = 2b - ia, -4a = 5b - 132. What is the tens digit of b? 2 Let c = 8997 + -6260. What is the hundreds digit of c? 7 Suppose 3n + c - 24327 = 0, -4n + 24c - 29c = -32403. What is the units digit of n? 2 Let v = 5 - 5. Let j = 227 + -224. Suppose 0m - 97 = -4l + jm, v = 4l + 5m - 105. What is the tens digit of l? 2 Let n = -185 - -144. Let g = 144 + n. What is the units digit of g? 3 Let y = 8400 + -1434. What is the hundreds digit of y? 9 Suppose 175t = 317t - 170t + 390376. What is the hundreds digit of t? 9 Let x be (4/(-16))/((-2)/32). Suppose -2t - 942 = -xi, -2i + 4t - 133 = -595. What is the units digit of i? 7 Suppose -42719 = -5o + 3q, -2q = 5o - 33031 - 9673. What is the hundreds digit of o? 5 Suppose -100l - 10112 + 75312 = 0. What is the units digit of l? 2 Let k = 106 + -102. Let z be ((-942)/k)/((-6)/8). Let f = z - 182. What is the tens digit of f? 3 Let z = 71 + -22. Suppose o + 2 = 0, 4p - 44 = -4o - 12. Suppose p = -l + z. What is the tens digit of l? 3 Let c be -1(6 - (361 - 1)). Let f = -232 + c. What is the tens digit of f? 2 Suppose 362 = -3s + 1073. Let u = s - 207. What is the tens digit of u? 3 Suppose -2z - p = 2z - 25999, -4z = 3p - 25989. What is the thousands digit of z? 6 Suppose 8m = 10m - 4968. Suppose 0 = -3x + 9x - m. Suppose -156 = -5o + x. What is the units digit of o? 4 Suppose 390 = -20o - 90. Let u be (-2 + -1)260/(-6). Let q = o + u. What is the tens digit of q? 0 Let a(b) be the third derivative of -14b2 + 0 + 7/3b*3 + 1/8b*4 + 0b. What is the tens digit of a(8)? 3 Let m be 11(1 + 1)-12. Let y = 21054 - 21621. Let g = m - y. What is the hundreds digit of g? 3 Suppose -c = -14 - 0. Suppose -5p = -4m + 40, 0p - 3p - 12 = 0. Suppose -1386 = -cj + mj. What is the hundreds digit of j? 1 Let c(r) = r*3 + 9r*2 + 3r + 25. Let i be c(-9). Let j(y) = -324y - 32. What is the hundreds digit of j(i)? 6 Let m(c) = -7c*2 + 15c + 31. Let k(w) = 20w2 - 44w - 94. Let j(q) = -6k(q) - 17m(q). Let h be j(7). Suppose -9 = 2r - h. What is the tens digit of r? 2 Let g be (400/125)/((-4)/10). What is the units digit of 2((-19295)/(-150) - g/(-60))? 7 Let x = -1201 + 9426. What is the units digit of x? 5 Let a = 54303 - 17482. What is the tens digit of a? 2 Let h = 360 - 217. Let x be 2 + 45/4. Suppose xn - h = 4. What is the tens digit of n? 2 Let k = -14952 + 23740. What is the thousands digit of k? 8 Let b(c) = -c*3 - 8c*2 + c + 10. Let n be b(-7). Let a = 42 + n. What is the units digit of (34/a - 0)-4? 4 Let s be (204/5)/(40/100). Let x(c) = c*3 - 7c*2 - 6c + 2. Let w be x(9). Let b = w - s. What is the units digit of b? 8 Let y be (675/(-150))/((-6)/40). What is the units digit of ((-36)/y3 - -4)3065? 6 Let f = -2817 + 2812. Let a = 100 + -150. Let b = f - a. What is the units digit of b? 5 Let y(n) = 179n + 1231. What is the units digit of y(57)? 4 Let g(v) = 4v + 30. Let c(r) = 4r + 29. Let w(m) = 5c(m) - 4g(m). Let u(s) = -57s*2 + 3477s + 5. Let d be u(61). What is the tens digit of w(d)? 4 Let v = 1956 + -1841. Suppose -3h + 4h - 4o - 1062 = 0, -h + 3o = -1064. Suppose -v = -5u + h. What is the hundreds digit of u? 2 Let o(y) = y2 + y + 3. Let s be o(0). Suppose sq - 3 = 9. Suppose -i + qk + 171 = 4i, 0 = -4i + k + 128. What is the units digit of i? 1 What is the units digit of 3 - (8778/(-28) + -3)/((-2)/(-60))? 8 Let b = -6167 - -13276. What is the units digit of b? 9 Let h be (8/16)/((-6)/(-4))-9. What is the hundreds digit of 366 - (4 - (h - -5))? 3 Suppose -2w + 118 = 5l - 3027, -4l - 4w + 2516 = 0. Let r = -312 + l. Suppose 3x = 4q + 487, -4q + r = 2x + q. What is the hundreds digit of x? 1 Suppose -2v - 42 = -5v. Let i(g) = 3g - 40. Let n be i(v). Let k(f) = 27f*2 + 2f - 3. What is the units digit of k(n)? 9 Let f(u) = -2*u	{ "pile_set_name": "DM Mathematics" }
d*5 - 83d*2 - 340016d + 2 wrt d. -7866864720d2 What is the second derivative of -31427i*3y*3 - 92553i*3 - 73i*2y*3 + 44y wrt y? -188562i3y - 438i2y Find the second derivative of 125229802d5 + 94442d + 9. 2504596040d3 What is the third derivative of 128530740q*4 + 95q*2 + 62q - 766 wrt q? 3084737760q Differentiate 257296912s*4 + 372591887. 1029187648s*3 What is the third derivative of -379119783u*6 + 1454181834u*2 wrt u? -45494373960u*3 Find the third derivative of -12o*5 + 1082119o*3 - 20o*2 + 378764. -720o*2 + 6492714 Find the second derivative of -1212885c4 + c3 + c*2 - 11c + 515549 wrt c. -14554620c2 + 6c + 2 Find the first derivative of -40730572k + 49210904. -40730572 Differentiate -1777373i*3 - 6028064 with respect to i. -5332119i*2 What is the first derivative of 6o*2s*2 + 382791670o*2 + 58os + 158s*2 wrt s? 12o*2s + 58o + 316s What is the third derivative of 598969628i3nq2 - 49i*2nq - 3inq*2 + 171in - 5iq - 3n - 2q wrt i? 3593817768nq2 Differentiate -56q*2 - 58636q - 18317994 wrt q. -112q - 58636 What is the second derivative of 7385jv3 - 2546659jv + 124v*3 + 5v + 12 wrt v? 44310jv + 744v Find the second derivative of -534535616v*2 - 2042075v - 1 wrt v. -1069071232 Differentiate 76962618b3q*2 - 4bq2 - 169346208q*2 with respect to b. 230887854b*2q*2 - 4q2 Differentiate -b3 + 13093b2 - 3b + 20259310 with respect to b. -3b2 + 26186b - 3 Differentiate -g*2m*2 + 3g*2m + 441g2 - 13492g - 58134m2 wrt m. -2g*2m + 3g2 - 116268m What is the derivative of -5j3 + 2828521j*2 + 4j + 349689053? -15j2 + 5657042j + 4 What is the second derivative of 18701759d2t*2y - 2d2ty2 - 468d*2t - 2d2y*2 - dt*2y*2 + ty + 2597y2 + 2 wrt t? 37403518d*2y - 2dy*2 Find the third derivative of -28bx5 + 18255688bx4 - 13bx2 - 83bx + 1113b + 3x2 + x wrt x. -1680bx2 + 438136512bx Find the second derivative of 9601543b*2 + b + 7650869. 19203086 What is the derivative of -144944181cf3 - 225f*3 - 260f*2 - 21f wrt c? -144944181f3 Find the third derivative of -15412601l*4 + 19424384l*2 wrt l. -369902424l Find the first derivative of s*4 + 2388024s*3 + 12s*2 + 59820562 wrt s. 4s*3 + 7164072s*2 + 24s What is the derivative of -9525262o - 3438478? -9525262 Find the third derivative of -202x*3y*3 - 14956x*3y + 6x3 - 3x*2y*3 + 1711xy3 + 6x + y*2 wrt y. -1212x*3 - 18x*2 + 10266x Differentiate -3572890b + 14180285 with respect to b. -3572890 What is the third derivative of -18o*4 - 12355528o*3 + 2o*2 + 8964582o + 5 wrt o? -432o - 74133168 Find the third derivative of -8055j*2z4 - j2z2 - j2 + 86358jz + 62z*4 - 2z*2 wrt z. -193320j*2z + 1488z What is the second derivative of 11174400k*2w + 56kw - 21k - 99w + 20 wrt k? 22348800w What is the second derivative of 14b*2m*3 + 2b*2m*2 - 2b*2m - 23744b2 + 4bm3 - bm*2 - 30605m*3 - 8m*2 wrt b? 28m*3 + 4m*2 - 4m - 47488 What is the third derivative of -164903930k4n*3 + 2k*3n3 - k2n2 + 2k*2 - 22kn3 + 1748n3 - n2 + 2n wrt k? -3957694320kn3 + 12n*3 Differentiate -11inu*2 + 1003440inu - 2in + 2nu - 20433n + 5255u*2 - u with respect to i. -11nu2 + 1003440nu - 2n Find the third derivative of 298446066k2w*3 + 2k*2w*2 + 250k*2 - 2kw2 + 42k + 103w wrt w. 1790676396k*2 Differentiate 3495523n + 8300225 with respect to n. 3495523 Differentiate -14002r2 + 114rx - 3623687x with respect to r. -28004r + 114x What is the first derivative of 1417828p3 - p2 - 6p - 43363355? 4253484p2 - 2p - 6 What is the second derivative of -107607c3 + 296c*2 - 100930511c? -645642c + 592 Find the third derivative of -17923564d*3h3 + d2h2 - 2d*2 - 31342634dh3 - dh*2 wrt d. -107541384h*3 Find the third derivative of -422428464i*5 + 21i*2 + i + 224272 wrt i. -25345707840i*2 Differentiate 124np3 - 270np2 + np + n + 15618339p3 with respect to n. 124p*3 - 270p*2 + p + 1 What is the derivative of 5586h*3 + 13h*2 + 9h - 26342391? 16758h2 + 26h + 9 What is the third derivative of -12699030n3 - 39n*2 + 64999 wrt n? -76194180 What is the second derivative of -19379f*2r - 2f2t + 11f2 + frt + 10fr + 42ft - 43rt - 2r - t wrt f? -38758r - 4t + 22 What is the third derivative of -4443g4 - 1011g*3 + 51681833g*2 wrt g? -106632g - 6066 What is the first derivative of -167944535s + 108044655 wrt s? -167944535 Find the third derivative of -3a*2qz2 + 60638a*2q + 4a2z*3 - 2aq2z*3 + aq*2z + 73255az*3 wrt z. 24a*2 - 12aq2 + 439530a What is the derivative of 9737889l3r - 315993l3 + 7l*2 wrt r? 9737889l*3 What is the third derivative of 9474mn6 - 817mn5 + 15mn2 - 5839004n*2 wrt n? 1136880mn3 - 49020mn2 What is the derivative of -15603004a*2h*3 - 4a*2h*2 - 4h3 + h2 - 4670533h + 2 wrt a? -31206008ah3 - 8ah2 What is the third derivative of 147196259h*5 + 1345944h*2 + 5? 8831775540h*2 Find the third derivative of -49023322k4 - k3 - 43272054k2. -1176559728k - 6 What is the derivative of 11947074a4 - 33178247 wrt a? 47788296a*3 What is the second derivative of -32278265h*3 - 650195h wrt h? -193669590h Find the first derivative of 182531462v*4 + 30814010. 730125848v*3 Find the second derivative of -44469301h*2 - 1200h - 1468. -88938602 Find the third derivative of 152635765n4 + 243911n*2 + 7n - 1. 3663258360n What is the derivative of 8643346x*2 - 3087532 wrt x? 17286692x What is the second derivative of 6205m3 - 3051m*2 - 4721296m wrt m? 37230m - 6102 Differentiate 88ox + 44801515o + 12217x wrt x. 88o + 12217 Find the first derivative of -297377909c3 - 13261800 wrt c. -892133727c*2 What is the second derivative of -2666c*2f*2z*2 + 23785c*2f*2z + cf2z - 62967032cf - z*2 wrt c? -5332f*2z*2 + 47570f*2z Find the third derivative of 10524004w3 + 75383837w*2 wrt w. 63144024 Find the third derivative of 43792700v*5 - 193381v*2 - 123 wrt v. 2627562000v*2 Find the second derivative of -137404132g*2 + 109773628g. -274808264 Find the second derivative of -1100q4 - q3 - 24050q*2 - 50070q + 5549 wrt q. -13200q2 - 6q - 48100 Differentiate 11a2f - 5a2ik + 609a*2i - afi + 347ak + 26816243fik + i with respect to f. 11a*2 - ai + 26816243ik Differentiate 18628855h3r*2 - 13r*2 + r + 31980 with respect to h. 55886565h*2r*2 Find the second derivative of -14s*3z*2 - 1320s*3 + 38sz - 224453z*3 wrt z. -28s*3 - 1346718z Find the third derivative of -14553197g3 + 1258385g*2 + 3g wrt g. -87319182 What is the third derivative of 17171645q4 + 103129q*2 + q - 17 wrt q? 412119480q What is the third derivative of -4c3dx2 + 7506c*3x4 - c3 - 1015cdx4 + 298389x*2 wrt x? 180144c*3x - 24360cdx What is the derivative of 288821958d*2l + 143d2 - 358772d wrt l? 288821958d2 What is the third derivative of 657b*3ln3 - 5155b*3n3 + b2ln*3 - 5b*2ln2 - 12b*2l - 3b2 - 50bln*3 - 2bln wrt b? 3942ln*3 - 30930n*3 Find the first derivative of 5293a*4 - 12a*3 - 25a - 95786402. 21172a3 - 36a*2 - 25 Find the first derivative of -30448l*3nt - 59622655l*3 - 23l*2nt + n wrt t. -30448l*3n - 23l2n Find the second derivative of m*3 + 8903041m*2 + m - 18501994. 6m + 17806082 What is the derivative of 84992m3n + 63251050m3 - 2mn2 - 294mn wrt n? 84992m*3 - 4mn - 294m What is the second derivative of -34849o5 - 5356o*2 + 2669o + 4786? -696980o3 - 10712 What is the first derivative of -53236537i - 61774529? -53236537 Find the second derivative of 426x4 + 3x*3 - 9931x*2 - 835x - 90315 wrt x. 5112x2 + 18x - 19862 Find the second derivative of -166z5 + 1487z*4 + 15z*3 - 663401393z. -3320z3 + 17844z*2 + 90z Find the second	{ "pile_set_name": "DM Mathematics" }
1062. Solve 0 = -cb - b - 45 for b. -3 Suppose 0 = 4o + 4n - 84, -3n + 82 + 19 = 5o. Let r = o - 19. Suppose 5 = 4t + 4j - 7, 3j - 14 = -4t. Solve rx + 25 = tx for x. 5 Suppose 107746 + 113138 = 22j + 57j. Solve 2801s = js - 15 for s. -3 Let j(c) = -2c - 41. Let k be j(-10). Suppose 0 = 8z - 7z + 18. Let r = z - k. Solve 1 + r = -2s for s. -2 Let f(o) = -62o - 7425. Let p be f(-120). Solve 0 = i - pi - 70 for i. -5 Let q be (-2)/5(-7 + 2). Let u = 182 + -158. Suppose -u = -0j - 4j - 4p, -4j + 16 = 2p. Solve -qm = jm + 16 for m. -4 Suppose -5467 = -13326i + 13255i. Solve -iw - 39 = -655 for w. 8 Let u(b) = 21b - 132. Let t be u(10). Let x be 104/t - (-2 + (-30)/(-9)). Solve x = 3p + 4 - 16 for p. 4 Suppose 3g + 1519 = -28g. Let c be (-3)/(6/7)28/g. Solve cv = 4v - 6 for v. 3 Let f(b) be the third derivative of -b7/5040 + b6/90 - b5/12 - 3b*2. Let g(z) be the third derivative of f(z). Let w be g(3). Solve wi + 0 = 20 for i. 4 Let p = -834 - -838. Solve 0 = 4g - 8 + p for g. 1 Suppose -370y = -418y + 1344. Solve -58 + 226 = -yq for q. -6 Let w = 4 - 2. Let m(i) = -11i - 34. Let q be m(-4). Suppose wz = -q + 22. Solve -u = -zu + 10 for u. 2 Suppose d = 12 + 2. Suppose 18c = dc + 8. Let h be -6(2 + (-5)/c). Solve r - 4 = -hr for r. 1 Suppose -t + 5x - 11 - 5 = 0, -30 = -5t + 3x. Let z be (-1 - (8 - t))1. Solve 4 = -h - zh for h. -4 Suppose -6u - 50 = -236. Let i = u - 7. Suppose 0 = -3t - i + 42. Solve -3q + q = t for q. -3 Let u = 2 + 28. Let j be ((-1)/(15/12))/((-6)/u). Solve -7b = -jb for b. 0 Let n(w) = 12w - 32. Let v be n(4). Let l be v/104 - ((-200)/26)/2. Suppose -11 = 3o + 4m, 3o + 4 = o - 2m. Solve lg - og = 5 for g. 5 Let f be 6/(-6)12(-2)/4. Suppose 6a + 2a = 2a. Solve 2g - f = -ag for g. 3 Let o be (-24)/18(-3)/2 + -84. Let a = o - -44. Let f = 39 + a. Solve 3 + f = -y for y. -4 Suppose -v + 5n + 4 = 0, -5v - 2n + 5 = -15. Suppose 9 = 3a + 3c, -c + 4 - 1 = -va. Solve 5m + 43 - 28 = a for m. -3 Let z(f) = f2 - 5f - 11. Let g be z(-2). Suppose 0 = 2c - 3c - g, 2c = 4m - 34. Solve -ma = -6a - 5 for a. 5 Suppose -b + 3r = -19, -356 + 338 = -2b - 4r. Solve 3f = bf - 3f for f. 0 Let c(d) = d + 13. Suppose 4g - 2x - 28 = 0, -6g = -3g + 3x - 30. Let t be ((0 - 1)g)/1. Let l be c(t). Solve 4u + l = 1 for u. -1 Let b(g) = -11g - 22g - 383 - 72 + 45g - 31g. Let w be b(-24). Solve -w = 4i + 11 for i. -3 Suppose -5a + 3k + 19 - 3 = 0, 2k = a + 1. Let z be (-6)/(-4) + a/10. Suppose zi - 14 = -4. Solve 0s + 5s + i = 0 for s. -1 Let f = -599 - -1005. Suppose -18j + f = 11j. Solve -j + 18 = y for y. 4 Let p(w) = -5w2 - 113w + 43. Let y be p(-26). Let d = y + 411. Solve d = n + 15 for n. -3 Suppose -j + 7 = 3. Let o be 4 - j1/(-2)-1. Solve oz - 6z + 12 = 0 for z. 3 Let g(p) = -5p + 136. Let x be g(15). Suppose -82l + xl = -42. Solve 2 + l = -4d for d. -1 Let n(m) = -m*3 + 9m*2 + 10m - 20. Let x be n(10). Let s be x + 22 - (0 - (-1 - -2)). Suppose -3w - 3w = -sw. Solve 0z + 3z = w for z. 0 Let s be (-30)/(-255) - 1900/(-34). Let o be (14/s)/((-2)/(-16)). Solve -4l + ol = 0 for l. 0 Let y be (0/2)/(-1 + 0). Suppose y = 4a + 12, -3a + 100 = -b + 10. Let f = -95 - b. Solve -29 = -5m - f for m. 5 Suppose 0 = 5x - 3h - 0h - 94, 42 = 6h. Solve -xv - 20 = -28v for v. 4 Suppose 6k + 21 - 69 = 0. Let t(u) = 6u - 44. Let d be t(k). Solve -o + do = 0 for o. 0 Let u(n) = -n2 + 6. Let p be u(0). Suppose po - 82 = -10. Solve -og = -0g - 36 for g. 3 Suppose v - 39 = -0v. Suppose 4r = -v - 1. Let c = 10 + r. Solve 4 + c = -a for a. -4 Let b(x) = -13x3 + 53x + 166. Let u be b(-3). Solve u = -11t + 325 for t. -3 Let l = -4636 + 4785. Solve -lf + 134f = 0 for f. 0 Let v be (-1)/((-3)/(-219)) + -2. Let h = v - -114. Suppose 35 - h = -2n. Solve y - ny + 1 = 0 for y. 1 Let w(s) = -4s*3 + s + 2. Let b be (-3 - (-246)/14) + 12/(-21). Let u = b + -15. Let n be w(u). Solve 8 + 2 = -ng for g. -2 Suppose -25n - 52 = 273. Let a(t) = 6t + 95. Let c be a(n). Solve 6l - 1 = c for l. 3 Let w(a) = 2a*2 + 6a + 4. Let x be w(-4). Suppose 0 = -3g + 259 - 241. Let l(y) = -y2 + 14y - 46. Let b be l(g). Solve -bk = k - x for k. 4 Let l = 3815 + -3810. Solve 49 = -lx + 24 for x. -5 Let h(m) = -m*3 + 11m*2 - 8m - 4. Let d be h(10). Let g = -11 + d. Suppose 3y = -3y + 150. Solve gw - y = -0w for w. 5 Let j(a) = 2a - 26. Let h be j(22). Suppose h = -952o + 955o. Solve 6 = -ov + 4v for v. -3 Suppose -8m + 124 - 48 = -52. Solve 160 = ms - 48s for s. -5 Suppose -2l + 22 = 4u, -25 = -7u + 2u. Let n(r) = -6 - l - 3r + 22. Let m be n(5). Solve 0 = -mf + 5f - 15 for f. 3 Let c = -2217 - -4681. Let v be 2 + 32/(-12) - c/(-42). Solve v - 54 = 2t for t. 2 Let p(g) = g*2 - 10g + 14. Let v be p(9). Let f(w) = w*2 - 3w - 4. Let y be f(4). Solve -vs - 6 + 1 = y for s. -1 Suppose -q + 6 = -0. Let t be -6 - -25 - 266/14. Suppose 0 = 3o - 13j + 18j - q, t = -5j. Solve 0 = -or - 3r - 15 for r. -3 Let n(f) = -3f + 8. Let z be 2/(-6) + (-57)/(-9). Let q be n(z). Let m be (q/(-15))/((-2)/(-6)). Solve -10 = -mw - 0w for w. 5 Let f be (-4)/(-20) - (-138)/10. Suppose 4m = 11m - f. Suppose -mq + 8q = 0. Solve 2n + qn = -8 for n. -4 Let o = -6 - -14. Let g = o - 4. Suppose -5x - gp + 15 = -25, x - p = -1. Solve -4w = 20 - x for w. -4 Let m(x) = 9x + 13. Let o be m(-4). Let z = 11 + 19. Let d = z + o. Solve -3t = -d - 2 for t. 3 Suppose 0 = -3v + p + 29, 2p - 5p = 3v - 9. Solve vr = 3r - 0r for r. 0 Let s = 4180 - 4178. Solve -38v + 180 = -sv for v. 5 Suppose -4c - 277 = 5m, 4c - 16 - 49 = m. Suppose 0 = 5k - p - 285, -2 = -3k - 5p + 197. Let y = m + k. Solve 0 = d - 1 - y for d. 2 Let c be -27 - (174/145)/((-3)/10). Let k = c + 43. Solve -k = -4r - 28 for r. -2 Suppose 20c - 23c + 10 = 4p, 16 = 5p + 2c. Solve 6 = pk - 14 for k. 5 Let u = -296 - -151. Let j = u - -157. Let h be 3/6 + 15/6. Solve -y - j = hy for y. -3 Suppose -91 = -5q - z, 5q - 76z = -79z + 93. Let k(x) = -x + 1. Let h be k(-6). Solve -a = -ha + q for a. 3 Let j(a) = -a3 - 3a*2 + 4a + 4. Let q be j(-4). Let y be (-2)/(-11) + 350/(-110). Let l = -3 - y. Solve -m + q = -lm for m. 4 Let m(a) = 5a + 7. Let r be m(-15). Let i(w) = -w*3 + 15w*2 - 20w + 16. Let d be i(14). Let k = r - d. Solve 0 = -2g - kg - 8 for g. -4 Suppose -77n - 99 + 3382 = -2415. Solve -6 = 17i - n for i. 4 Let i(p) = -3p3 + p + 1. Let h(z) = -16z*3 + 51z*2 - 142z + 149. Let y(d) = h(d) - 5i(d). Let a be y(48). Solve a = -5c + 9 - 14 for c. -1 Let v be 15462/69 - 6/69. Solve -4y + v = 204 for y. 5 Let t be 8/5 + (-8)/(-20). Suppose -tl = -2q - 6, 15 = 5l - 3q - 0q. Let s be -3 - -12(-8)/(-16). Solve -3i - l = s for i. -2 Suppose -15 = -7i + 210 + 160. Solve in - 18n + 185 = 0 for n. -5 Let k be -6 + 12/(-10)(-22)/(-33)-580. Solve 7p + 493 - k = 0 for p. -5 Let a(g) = -2g2 + 32g + 38. Let y be a(17). Let v be (-5)/15 - y/(-12). Solve v = z - 5z for z. 0 Let a(z) = 85z + 4252. Let s be a(-50). Suppose -21 = -5t + w, 5t - 5w + w = 24. Suppose 5 = -5y + j, 3j = sy + 19 - t. Solve -2l + 0l = y for l. 0 Let u be 51/12 + (-27)/12 + 2. Let m be (u - 8 - -8)11. Solve mk = 48k + 8 for k. -2 Let d(c) = c + 7. Let h be d(-2). Suppose -2k = -h + 5. Solve k = -5q - 17 - 8 for q. -5 Let b = 34 - 29. Suppose -4 = 4l + f, 4f = -bl + 7f + 12. Suppose -5n + 54 = -3y, -y + 0y = 5n - 42. Solve i - 4i + n = l for i. 3 Suppose 14c = -2m + 310, c + m + 9 - 26 = 0. Suppose 5l - 70 = -6a + 4a, -96 = -4a + l. Solve -as + cs = 4 for s. -2 Suppose -52r = 429 - 1521. Solve -rs - 116 = -74 for s. -2 Let a(w) = -26w + 399. Let t be a(4). Solve 8x - t + 303 = 0 for x. -1 Suppose 21h - 275 = -4h. Solve hq + 30 = -4q for q. -2 Suppose -5m - 554 = -4y, 2y = 3m + 249 + 83. Let q = 116 + m. Solve 20 = -qz + z for z. -4 Let b = -147 - -239. Let f = 92 - b. Solve -20v + 18v - 10 = f for v. -5 Let j(s) = -s2 + 18s + 5. Let y be j(18). Suppose 5p + 2f - 60 = 0, -f = 4p - 3f - 48. Suppose k = yk - p. Solve -ka = -7a - 8 for a. -2 Let r(k) = k2 - 9k + 18. Let c b	{ "pile_set_name": "DM Mathematics" }
rder. -303, -4, -4/3, -1/10, 0.1, 5 Put -2, -3, 4, 2712, 1 in descending order. 2712, 4, 1, -2, -3 Sort -1, -11.8, 2/5, -3/8 in decreasing order. 2/5, -3/8, -1, -11.8 Sort -54, -1, 17, 1 in ascending order. -54, -1, 1, 17 Put 46, 1069, 4, -4, 1, -2 in decreasing order. 1069, 46, 4, 1, -2, -4 Put 373, 3, 404 in increasing order. 3, 373, 404 Put -3.9, -3, 0.12, -2 in descending order. 0.12, -2, -3, -3.9 Put 6, -4, -3141, 2, 1 in ascending order. -3141, -4, 1, 2, 6 Put -111, 1, 9, -3 in ascending order. -111, -3, 1, 9 Sort -209, 3, -20, 1 in increasing order. -209, -20, 1, 3 Put -33, -4, 6, 1899, 5, -1 in decreasing order. 1899, 6, 5, -1, -4, -33 Put -8, -0.1, 0.099, 1 in descending order. 1, 0.099, -0.1, -8 Sort 89, -4, -348, -3, 3. -348, -4, -3, 3, 89 Sort 2/9, -12/19, 2/5, 3/4, -5, 8. -5, -12/19, 2/9, 2/5, 3/4, 8 Sort -2, 3, -13, 2, -1, 12 in descending order. 12, 3, 2, -1, -2, -13 Sort -3, -4, 2, 0.12, 3 in ascending order. -4, -3, 0.12, 2, 3 Sort 5, 394, 2, -2, 8 in ascending order. -2, 2, 5, 8, 394 Put 7, 2/9, 50, -2 in descending order. 50, 7, 2/9, -2 Put -0.1, -4, -15/8, -1/67 in ascending order. -4, -15/8, -0.1, -1/67 Sort 0, 2/5, -2/47, 0.06, 5 in ascending order. -2/47, 0, 0.06, 2/5, 5 Put -4, -7, 2.6, 1, 0.3 in ascending order. -7, -4, 0.3, 1, 2.6 Put -11, 3, -31, -3 in decreasing order. 3, -3, -11, -31 Sort 1, 0, 10, -23, -1 in descending order. 10, 1, 0, -1, -23 Put -100, 2, 1, -47, -4 in increasing order. -100, -47, -4, 1, 2 Sort 2, -24, -3, -4, 111. -24, -4, -3, 2, 111 Sort -11, 5, -12, -2, 2, 142 in descending order. 142, 5, 2, -2, -11, -12 Sort -140, 5, -2, 4, 2. -140, -2, 2, 4, 5 Put 2, 13, 7, -15, -2 in ascending order. -15, -2, 2, 7, 13 Sort 440819, 3, 5, 0.3 in descending order. 440819, 5, 3, 0.3 Sort 0.2, -23.16, 13/18, 0.5 in descending order. 13/18, 0.5, 0.2, -23.16 Put -26, 45, -4, 2 in decreasing order. 45, 2, -4, -26 Sort -2305, 1, -38. -2305, -38, 1 Put 220, -6, 19 in descending order. 220, 19, -6 Sort 2/17, -4, -5372, -5 in ascending order. -5372, -5, -4, 2/17 Sort -0.3, -41/6, 0 in decreasing order. 0, -0.3, -41/6 Sort 5, 214, 1, 7, 4 in increasing order. 1, 4, 5, 7, 214 Sort -3, -125, 27, -32 in decreasing order. 27, -3, -32, -125 Put -1, 2, -540 in decreasing order. 2, -1, -540 Sort 5, -1, 4. -1, 4, 5 Sort 1, -4, -203, 5 in ascending order. -203, -4, 1, 5 Put -49, 0.1, 27/310 in descending order. 0.1, 27/310, -49 Sort 4, -21, -4, 5, 23. -21, -4, 4, 5, 23 Put -1/12, 13, -5, 808, -3/2 in descending order. 808, 13, -1/12, -3/2, -5 Sort -2, 14, 3, 1334 in decreasing order. 1334, 14, 3, -2 Put 1813, 5, -8 in ascending order. -8, 5, 1813 Sort 4, 45, 4874 in decreasing order. 4874, 45, 4 Sort 16, -468, 0. -468, 0, 16 Put 47, 29/11, 0.5, -2, -10, 1/5 in descending order. 47, 29/11, 0.5, 1/5, -2, -10 Put 23848, -1, -2 in increasing order. -2, -1, 23848 Put 5, -1.4, -374.2, 1 in descending order. 5, 1, -1.4, -374.2 Sort 0.4, -1/3, 813. -1/3, 0.4, 813 Sort 14, -3, -36, 3, 5, 2 in decreasing order. 14, 5, 3, 2, -3, -36 Put -25, -1, 1, -2029 in decreasing order. 1, -1, -25, -2029 Put 2/3, -371, 11, -0.1 in descending order. 11, 2/3, -0.1, -371 Put 105, -1, -1659 in ascending order. -1659, -1, 105 Sort -3, -38, 19, 4/3. -38, -3, 4/3, 19 Sort -4, 14, 1, 0, 5, -64 in increasing order. -64, -4, 0, 1, 5, 14 Put -245, -2, 1553 in descending order. 1553, -2, -245 Put -94, 0, -108, 1 in increasing order. -108, -94, 0, 1 Sort 2, -1, -4, -60, -272 in increasing order. -272, -60, -4, -1, 2 Put -0.1, -11/3163, 0.2, 3, 2/9 in ascending order. -0.1, -11/3163, 0.2, 2/9, 3 Sort 5, -4645, 16, -0.3 in increasing order. -4645, -0.3, 5, 16 Sort 3, 0, -10, 6013. -10, 0, 3, 6013 Put -2, -14, 157, 6 in increasing order. -14, -2, 6, 157 Put -0.64, 48, 0.4 in ascending order. -0.64, 0.4, 48 Sort 547, -0.5, -0.016 in increasing order. -0.5, -0.016, 547 Sort 2/11, 117, 4, -4, 3 in ascending order. -4, 2/11, 3, 4, 117 Sort -13.5, 0.5, 0.3, 7, -3. -13.5, -3, 0.3, 0.5, 7 Sort -4, -1/1074, 3/5, 0.5 in decreasing order. 3/5, 0.5, -1/1074, -4 Put -38/9, 1/2, 16 in ascending order. -38/9, 1/2, 16 Put -3, 1222, -5, 4, 5, 29 in decreasing order. 1222, 29, 5, 4, -3, -5 Put -20, 2, -6, -45, -5 in ascending order. -45, -20, -6, -5, 2 Sort 5, -917, -4, -3, -1 in decreasing order. 5, -1, -3, -4, -917 Sort -11.9, -0.1, -2/1725. -11.9, -0.1, -2/1725 Put 0.17, 0.020997, -5 in increasing order. -5, 0.020997, 0.17 Sort -3, 5395, -5, 5 in ascending order. -5, -3, 5, 5395 Sort 9, 56, 2, 16, 5 in descending order. 56, 16, 9, 5, 2 Sort -1, 170, 114 in decreasing order. 170, 114, -1 Put 1, 105, -401 in decreasing order. 105, 1, -401 Put 2/3, 0, -2, -65, 6 in increasing order. -65, -2, 0, 2/3, 6 Sort 2/3, -18, 1/7, -0.17 in increasing order. -18, -0.17, 1/7, 2/3 Sort -4/15, 0.03518, -4 in descending order. 0.03518, -4/15, -4 Put 440, 0, 300 in increasing order. 0, 300, 440 Sort 52, -1132, -5/3 in ascending order. -1132, -5/3, 52 Put -270, 4, -3, 5, -4 in descending order. 5, 4, -3, -4, -270 Put -16.6, 2/3, -0.053, -0.1, -1 in descending order. 2/3, -0.053, -0.1, -1, -16.6 Sort 1, 4, 2, -5, 298 in descending order. 298, 4, 2, 1, -5 Sort -0.5, 963, -4, 27, 5 in decreasing order. 963, 27, 5, -0.5, -4 Put 158, -77, 1 in increasing order. -77, 1, 158 Sort -0.2, 0.04, -3/7, -144, -3, -1 in descending order. 0.04, -0.2, -3/7, -1, -3, -144 Sort 92, -0.13, 22, -0.5 in decreasing order. 92, 22, -0.13, -0.5 Sort 1, -5, -2, 11, -45, 6. -45, -5, -2, 1, 6, 11 Put 4, -1/4, 23191, -5, -0.5 in descending order. 23191, 4, -1/4, -0.5, -5 Sort 128, -1, 163. -1, 128, 163 Sort 4, -4, 2, 143. -4, 2, 4, 143 Put -4, -3, -2, -1, -16, 5 in decreasing order. 5, -1, -2, -3, -4, -16 Sort 571, -242, -1, 4 in descending order. 571, 4, -1, -242 Sort -5/12, -3, -8.1787 in ascending order. -8.1787, -3, -5/12 Put -273, -43, 5, 4 in descending order. 5, 4, -43, -273 Sort 3030, -0.2, 0.3 in descending order. 3030, 0.3, -0.2 Sort 3, -4, 5, 3.807 in descending order. 5, 3.807, 3, -4 Put -33916, -5, 2 in ascending order. -33916, -5, 2 Put -30, -5, 21, -27, -4 in descending order. 21, -4, -5, -27, -30 Sort -1/13, 0.5, -2, -4/773 in decreasing order. 0.5, -4/773, -1/13, -2 Sort -1, -1724, 758 in ascending order. -1724, -1, 758 Sort -0.128, -1, 1/4, -0.05, -1/2 in decreasing order. 1/4, -0.05, -0.128, -1/2, -1 Put -0.14, -2415, -3, 0.03 in increasing order. -2415, -3, -0.14, 0.03 Put -5, 3/96385, -0.4 in ascending order. -5, -0.4, 3/96385 Put -137, 0, 126 in descending order. 126, 0, -137 Sort -4, 2, 10, -2, 4/3 in decreasing order. 10, 2, 4/3, -2, -4 Sort -7, 0, -47, -4 in decreasing order. 0, -4, -7, -47 Put -2.7, -0.3994, 2 in ascending order. -2.7, -0.3994, 2 Sort -5, 3, 5, 24, 3055 in decreasing order. 3055, 24, 5, 3, -5 Sort 5, 10, 11, 235 in descending order. 235, 11, 10, 5 Put 3, -1606, 0, 4, 18 in ascending order. -1606, 0, 3, 4, 18 Sort -1, 3, -330637, -3 in decreasing order. 3, -1, -3, -330637 Sort 4, -57, 21, 0, 1. -57, 0, 1, 4, 21 Sort -4, 4, -1, 2356, 1, -3. -4, -3, -1, 1, 4, 2356 Sort -3, 4022, 0.9 in descending order. 4022, 0.9, -3 Sort -1/916, -1/5, 33 in descending order. 33, -1/916, -1/5 Sort 2, -3, -26518, -2. -26518, -3, -2, 2 Sort 0.033, -0.3, -2, -14/9, 0. -2, -14/9, -0.3, 0, 0.033 Put -76, -132, 4, 2, 3, 5 in decreasing order. 5, 4, 3, 2, -76, -132 Sort 4, -52048, 2 in decreasing order. 4, 2, -52048 Sort 4.8, 2, 5, 69 in descending order. 69, 5, 4.8, 2 Put 3/8, -1/4, 2/11, -3, 3/2, 5351 in ascending order. -3, -1/4, 2/11, 3/8, 3/2, 5351 Sort -1, 7, 4, -3, 13, 8 in increasing order. -3, -1, 4, 7, 8, 13 Sort -4, -50, 3633 in decreasing order. 3633, -4, -50 Put 0.1, 10, -3, -17830 in increasing order. -17830, -3, 0.1, 10 Put -8/3, -1.54, -1/12, -7, -1 in descending order. -1/12, -1, -1.54, -8/3, -7 Sort -2, -1, 2169, 1, -5 in decreasing order. 2169, 1, -1, -2, -5 Put 38, 3, -137, 0, -23 in descending order. 38, 3, 0, -23, -137 Put 82, 37, 2 in descending order. 82, 37, 2 Sort -12, 1390, 7 in descending order. 1390, 7, -12 Sort -46, -5, -28, -3 in descending order. -3, -5, -28, -46 Put 4243175, 0, -5 in descending order. 4243175, 0, -5 Put -4, -5, 52, 31 in increasing order. -5, -4, 31, 52 Put 11, 4, -3, 124, -4 in increasing order. -4, -3, 4, 11, 124 Sort 6, -2, -7, 3, 1, -34 in descending order	{ "pile_set_name": "DM Mathematics" }
37/18. What is the nearest to z in q, -5, y? y Let n = 1 - 1. Let d be -2(-35)/20 - 4. Let r be (-4)/5(-2)/(-4). What is the nearest to r in n, 1/9, d? d Let t = 25 - 20. Let f = -1.33 + 5.33. Which is the nearest to -0.3? (a) t (b) f (c) 0.4 c Let r = 36/11 - 224/55. What is the nearest to 0.1 in -1/2, -4, r, -3/7? -3/7 Let z = 576 + -578. Let r = 347 - 4509/13. Which is the nearest to -1/2? (a) z (b) -1/8 (c) r b Let i = -466 - -459. What is the nearest to 1 in -0.3, 0.1, i, -0.4? 0.1 Suppose -v - 2 = -0. Let h be v2/6 + (-14)/(-6). Which is the closest to -2? (a) 2 (b) h (c) 0.5 c Let o be 13/4 + 3/(-12). Let t be 2/o + (-1 - 1). Let h = -539 + 539. What is the nearest to h in -4, 0, t? 0 Let t = 177 - 176.9. Which is the closest to -2? (a) t (b) -1 (c) 2 (d) 5 b Let d = -5.182 + 0.182. What is the closest to -1 in -0.02, -2/11, d? -2/11 Suppose -40v + 7 = -42v + 5u, 5v + 5u = 0. Which is the nearest to -1/4? (a) v (b) 3/5 (c) 2 a Let u = -0.0252 - 0.0748. Let k = -97 + 93.1. Let x = k + 4. What is the closest to x in 0, 4, u? 0 Let t = -329/26 + 25/2. What is the closest to -2/7 in t, -19, 1/5, 5? t Let x = 13 - 10. Let p = -11 + 10.9. Let g = 17 + -13. Which is the closest to p? (a) g (b) x (c) 0 c Let k = 3.72 + -3.7. Let o = -2.6 + 2.98. Let d = k + o. Which is the closest to 0? (a) 0.6 (b) d (c) -0.1 c Let s = 80 - 41. Let f = -36 + s. What is the closest to 0 in -0.2, 0, f? 0 Let i = -22 + 23.4. Let j = i - 1.7. What is the closest to -2 in 0.2, j, -3? -3 Let i = 1.1 - 1.37. Let q = -0.47 - i. What is the closest to q in 3, 1, -1/7? -1/7 Let y = 1045.8 - 1046. What is the closest to -4 in 0.1, y, 5, 7? y Let k = -4/125 + -867/250. Let a = -2.2 - -4.2. What is the nearest to a in k, 2, 2/3? 2 Let i(g) = -7g + 35. Let k be i(5). Which is the closest to 1? (a) 0.1 (b) k (c) 1/3 c Let c = -638.4 + 638. What is the nearest to -0.1 in 4/7, c, -0.1, 0? -0.1 Let p = -575 + 575.1. Which is the closest to p? (a) 3 (b) -2/3 (c) 2 (d) 3/2 b Let i = -92 - -91. Which is the closest to 0? (a) -0.4 (b) i (c) 3 a Let s = 583 - 578. What is the nearest to -2/3 in 9, 0.2, 0.1, s? 0.1 Let k(l) = l - 10. Let q be k(14). Suppose 0 = -3g + qg + 3. Let h = 0.12 + -0.02. Which is the closest to h? (a) 0.5 (b) g (c) 0.4 c Let v = -52.6405 + 0.0405. Let k = -53 - v. Which is the closest to -1? (a) 0.3 (b) k (c) -1/4 b Suppose -5d + 13 = 2j, -3d + 2d + 5j + 8 = 0. Let w = -11/2 + 6. Suppose 3b + 73 = 70. What is the nearest to b in w, 2, d? w Suppose v = -f - 76 + 81, 3f = -4v + 18. Let j be (-2)/(4/2) - -6. Suppose jw = 3w. Which is the closest to 0? (a) w (b) v (c) -3/7 a Let j = -56 - -36. Let c be (-1 - -2)/(j/30). Let x = 1.1 - 1. What is the closest to 0 in x, -2/3, c? x Let n = -2.665 - 0.035. Let f = -2.4 - n. Let w = 0.6 - f. Which is the nearest to 0? (a) 5 (b) 3/8 (c) w c Let h = -0.1 + 0.1. Let t = 4.9747 + 0.0253. What is the nearest to h in 4/9, t, 0.5? 4/9 Let f be (-7 + 11)/(-12)12/(-34). Which is the closest to -4? (a) 5 (b) f (c) 3/4 b Let p = -194 + 391/2. What is the closest to 2 in 78, p, 4/7? p Suppose 0 = -19v + 5 - 43. Suppose 5q - 15 = 5t, -4t - 3q - q = 20. Let i = 6 + t. What is the nearest to -1 in -1, v, i? -1 Let g = -3645/7 - -521. What is the closest to 2/11 in 1, g, 0.4? g Let h = 0.31 + 2.69. Let p = -2.7 + h. What is the nearest to 1 in p, -0.1, -0.3? p Let j be -10((-3)/2 - 0). Let n be (-3)/(-3) + j/(-13). Suppose 5d = -0d - 4b + 15, 3b = 15. What is the nearest to d in 3, -0.3, n? -0.3 Let k(i) = -i*2 + 12i - 5. Let m be k(11). Let z be (-6)/3 + m + 65/(-10). Which is the nearest to -0.1? (a) -0.5 (b) z (c) -1 a Let g = 0.0225 + -0.0225. What is the closest to 0.1 in 2/5, -1.9, g? g Let w = 1/210 - 6/35. What is the nearest to 8 in w, -2, -5? w Let i = -7264 - -51046/7. Let q = -28 + i. What is the closest to q in -3, -4/7, 0? 0 Let v = 4.37 + -0.37. Let y = v - 2. Which is the nearest to -2? (a) y (b) 0 (c) -1/10 c Let r be (1/(-12)-2)/((-4)/(-6)). Which is the nearest to r? (a) 0 (b) 9 (c) -1 a Let m(t) = -2t*3 + 2t*2 + 11t - 20. Let d be m(2). Which is the closest to d? (a) -1 (b) -8 (c) -0.2 b Let q = -0.0733 - -0.0733. Suppose 3k = -2k + 335. Let i = k - 137/2. Which is the nearest to 0? (a) i (b) q (c) -0.4 b Let a = 33 - 30.5. What is the nearest to 1 in a, -4, 5? a Let h = -12.9 - -13. Let j = -0.583 + 5.583. What is the closest to -6 in j, -0.4, h? -0.4 Let q = 19 - 37. Let x = 5 - -12. Let i = x + q. What is the nearest to i in -5, -0.3, 2/5? -0.3 Let w = -1 + -1. Let t be 30/(-105)14/30. Which is the closest to -2? (a) w (b) t (c) -1/2 a Let v = 0 - 3. Let s = 2 - v. Suppose -7a + 8 - 1 = 0. What is the nearest to a in s, -0.4, -1? -0.4 Let v = -61.4203 - -0.0203. Let l = v - -61. What is the nearest to 2/7 in -2, -3, l? l Let h be -1 + -3 - 354/(-93). Let x = 104/217 + h. Which is the nearest to -1? (a) -0.3 (b) x (c) 4 a Let t be (6/4)/(180/24). Let l = t + 2/15. Which is the closest to l? (a) 1/9 (b) -0.3 (c) -2/15 a Let d = -4.031 + 0.031. Which is the nearest to d? (a) 4 (b) -0.1 (c) 2/9 b Let f = 0.7 - 0.3. Suppose -5x + 2x = 87. Let z = -30 - x. Which is the nearest to z? (a) 4 (b) 0 (c) f b Let k(x) = x*3 - 20x*2 - 45x + 18. Let v be k(22). What is the nearest to -0.3 in 0.05, v, -3/2, 5? 0.05 Let k = 7/30 + -247/930. What is the closest to -1/4 in 0.5, k, -0.4? -0.4 Let w = -673 + 4039/6. What is the nearest to 14 in w, 1/5, -2? 1/5 Let m = 1.021 - 0.021. Which is the closest to 1/9? (a) 7 (b) -4 (c) m c Let r = -47 + 48. Let s be 2 + -1 + 2 - r. Which is the nearest to 0? (a) -1/7 (b) -4 (c) s a Let v = -1215 + 37668/31. What is the nearest to -1/4 in 4, v, -3? v Let l = 0.052 + -38.052. Let w = l - -38.1. Let p = 75 - 677/9. What is the closest to p in -0.2, w, 3? -0.2 Let v = -288 + 346. Which is the closest to 2/5? (a) -0.1 (b) 5 (c) v (d) -4 a Suppose -124x + 117x + 7 = 0. Let h = -0.3 - 0.7. Let n = -0.3 + -1.7. Which is the closest to x? (a) n (b) 5 (c) h c Let j(n) = n - 4. Let v be j(5). Let k = v - 23. Let u = k - -23. Which is the nearest to -0.1? (a) u (b) 4 (c) -3 a Let p = 10.4 + 0.6. Let g = 12 - p. What is the closest to -2/5 in -1, 0, g? 0 Let p = -44482/19 - -2341. Which is the closest to 2/7? (a) 5 (b) p (c) -5 (d) -3/4 b Let t = -27.023 + 0.023. Let l = 0.71 + 25.79. Let s = t + l. Which is the nearest to 2/7? (a) s (b) -2/5 (c) -0.1 c Let o = -81.67 - -82. Let h = -4.67 - o. Let y = -4 - -9. What is the closest to 0.1 in y, -4, h? -4 Let g = 1.565 - 1.265. Let x be 1/(-4) + 9/20. What is the closest to 2 in g, x, -2? g Let c be (-6)/(-1)(-5 - 4). Let d = -271/5 - c. Let m = -3.4 - -1.4. What is the closest to -1 in m, d, 3? d Suppose -1 - 7 = -4r - 4w, 3r - w - 10 = 0. Let d = -9 + r. Let y be (d/(-4))/((-9)/(-1)). Which is the closest to -2? (a) 0 (b) -2 (c) y b Let z be (102/84 - 1)/(3/(-6)). Let o = 1 + 0. Let x be o + -1 - (-2)/19. Which is the closest to x? (a) -5 (b) z (c) 2 b Let v = -355 + 352. Which is the closest to 0? (a) -7 (b) 0.4 (c) 2/19 (d) v c Let l = 1.004 - 0.004. Let s be 10/2 + 0/1. Suppose -1 = 4d + sp - 5, 4 = p. What is the closest to l in -1, 5, d? -1 Let s = -71.3 + 71.25. Let c = -6 - -5. What is the nearest to s in 1, c, 0.4? 0.4 Let a = 0.1 - 5.1. Let f = 5.26 + a. Let u = 0.04 + f. What is the nearest to 2 in 2/13, u, 3? 3 Suppose 2f - 3d = -5d - 6, 19 = -5f - d. What is the nearest to -0.1 in -16, 5/2, -0.1, f? -0.1 Let n = 13.89 - 14.89. Let b(d) = -d*2 + 2d + 2. Let y be b(3). What is the closest to y in -1/7, 2, n? n Let f = -1.6 - -0.2. Let c = -4.6 + f. Let l = 8 + c. What is the nearest to -2 in l, 0.4, -2? -2 Let w = 0.2 + 0.3. Let d = 148.4 - 152.4. Which is the nearest to 2? (a) w (b) 2 (c) d b Let n = 0.1 - 1.1. Let f = -107 + 116. Let h = -6 + f. Which is the closest to n? (a) -0.2 (b) h (c) 2 a Let x be (-5 + 6)*10/25. What is the closest to -1 in -0.5, 10, x? -0.5 Let i = 18.01 - -0.99. Which is the nearest to -2/3? (a) i (b) -0.3 (c) 0.3 b Let j = -437 + 440. Let r = -0.6 + -0.4. Let q = -97/42 - -13/6. What is the closest to 0 in q, r, j? q Let i be (-2)/	{ "pile_set_name": "DM Mathematics" }
te the remainder when 1540/(-66)(-108)/21 is divided by 43. 34 Let d(q) = -q3 + 2q*2 + 3q + 1. Let a = 11 + 7. Let r be -23/a9. What is the remainder when d(r) is divided by 20? 17 Suppose -26p + 34p - 656 = 0. Calculate the remainder when p is divided by 19. 6 Let s(i) be the second derivative of -i*3/2 + 17i*2/2 + 16i. Calculate the remainder when 2 is divided by s(5). 0 Let y(q) = q*3 + 10q*2 + q - 2. Let a be y(-10). Let r = a - -12. Suppose -6 = -rd - d. What is the remainder when d is divided by 4? 2 Calculate the remainder when 179 is divided by (-23 - (2 - -4))-3 + 5. 87 Let b be (2 + -1)/((-9)/(-18)). Let s be b + (1 - 2/(-1)). Let x(n) = 4n - 6. Calculate the remainder when x(s) is divided by 4. 2 Suppose -2i = -3m - 3i + 21, -3m + i = -15. Let x(a) = a*2 - 10a + 2. What is the remainder when x(12) is divided by m? 2 Let b(v) = -v*2 + 2v - 3. Let p be b(3). Calculate the remainder when 114 is divided by p/(-10) + (-112)/(-5). 22 Suppose -4y + 32 + 22 = -2u, 0 = -y - 5u + 30. What is the remainder when 97 is divided by y? 7 Let g(i) = -i3 + 6i*2 + 7i. Let w be g(7). Suppose w = k - 3t - 23, -8 = 2t + 2. What is the remainder when 23 is divided by k? 7 Let t = 80 + -81. Calculate the remainder when (-4)/56-926 - t/(-7) is divided by 24. 18 Let h be (1 - (-2)/(-1))-7. Let r = h - 2. Let v(a) = a*3 - 2a*2 - 2a + 1. Calculate the remainder when r is divided by v(3). 1 Let b(x) = -x*3 + 3x2 - x - 20. Calculate the remainder when b(-4) is divided by 65. 31 Let b(l) = l2 + 1. Let t(j) = 14j2 + j. Let s(q) = -5b(q) + t(q). What is the remainder when s(3) is divided by ((-81)/6)/(2/(-4))? 25 Let t(w) = 2w2 + 17w - 6. Let b be t(-9). Let v = b + 30. What is the remainder when v is divided by 6? 3 Suppose -181 = 4a - 1297. Let l = a - 160. Let s = 25 + 5. What is the remainder when l is divided by s? 29 Let f(w) = w + 211. What is the remainder when f(-17) is divided by 49? 47 Calculate the remainder when 83 is divided by (-2)/(-2) + 26/2. 13 Suppose -5a - 23 = -l - 0l, -5a = -4l + 77. Suppose 0 = -f + 63 - l. Calculate the remainder when f is divided by -3 + 24 - (1 - 3). 22 Let p = -3 - -5. Suppose -3u + 4a = -16, 0a = pu + 2a + 8. Let v(w) = w + 16. Calculate the remainder when 47 is divided by v(u). 15 What is the remainder when 1076 is divided by -3 - (-42)/124? 9 Let d(l) = -4l - 17. Let n be d(-5). Suppose nh - 69 - 516 = 0. Calculate the remainder when h is divided by 33. 30 Let q = 115 + -68. Suppose -5c = -c + 8. What is the remainder when q is divided by 15/c(-80)/25? 23 Suppose -3j = -5k - 102, j + k - 34 = -0j. Calculate the remainder when 405 is divided by j. 31 Suppose -30s + 7321 = -4319. What is the remainder when s is divided by 3? 1 Let k(c) = c2. Let v(g) = 5g*2 - 4g + 2. Let u(b) = -2k(b) + v(b). Calculate the remainder when u(3) is divided by 3. 2 Suppose 31y - 2569 = 4158. Calculate the remainder when y is divided by 11. 8 Let k = 8 + -11. Let b(g) = g*2 + 3. What is the remainder when 45 is divided by b(k)? 9 Suppose -11c - 6c = -2278. What is the remainder when c is divided by 34? 32 Suppose 0 = -2l + 3l + 13. Let b(d) = -d2 - 12d + 18. Calculate the remainder when 19 is divided by b(l). 4 Suppose -k + 94 = 31. Calculate the remainder when 107 is divided by (84/k)/((-2)/(-57)). 31 Calculate the remainder when 10863/34(-4)/(-6) is divided by 5. 3 Suppose 7b = 4b + 51. Suppose 3r + 3v - 7 = 257, -2r = -5v - 197. Suppose -r = -3p + 8. Calculate the remainder when p is divided by b. 16 Let u = 53 - 50. Calculate the remainder when 3(-196)/8(-2)/u is divided by 25. 24 Let b(w) be the first derivative of -w*4/4 + 5w*3/3 - 3w*2/2 + 3w + 4. Calculate the remainder when 19 is divided by b(4). 5 Let v = -22 + 23. Suppose 3z - 5l - 38 = 0, -z = -5l + l - v. Suppose -2i + i = -11. Calculate the remainder when z is divided by i. 10 Let i(b) = -8b - 42. Let c be i(-9). What is the remainder when 38 is divided by (-2)/(-3) + 0 + c/9? 2 Let u be 1-4 - (12 + -6). Let p(v) = -v - 8. Let h be p(u). Suppose -hd = -3d + 31. Calculate the remainder when 90 is divided by d. 28 Let d be (-1 - -1)(-6)/(-18). Suppose 4g - 5g + 68 = d. Suppose 3w + 2n = 5 + 70, -5n = 5w - 130. Calculate the remainder when g is divided by w. 22 Let w = -17 + 23. Suppose -wm + 11 = -31. Calculate the remainder when 25 is divided by m. 4 Suppose 3j = 5j - 3x - 64, -3x = 0. What is the remainder when 215 is divided by j? 23 Suppose -20y + 15y = 300. Let d = y - -83. Suppose 4 - 32 = -4a. Calculate the remainder when d is divided by a. 2 Suppose 29h - 4985 - 2323 = 0. Calculate the remainder when h is divided by 5. 2 Let j be -16(0 - 2)/(-4). Let t = 19 - j. Suppose -3s - 3w + t = 0, 6s - 3w = 4s + 38. Calculate the remainder when 37 is divided by s. 11 Suppose 4y + 3151 = 5s, 4s - 527 = 5y + 1992. Suppose 0 = -10w + s + 329. What is the remainder when w is divided by 25? 21 Let c(n) = n3 - 2n*2 + 3n - 13. Let j(t) = -3t3 + 6t*2 - 10t + 39. Let a(h) = -11c(h) - 4j(h). Calculate the remainder when a(5) is divided by 25. 22 Let v(g) = -g*2 + 21g - 71. Suppose -2j = 2j - 112. Let n = j + -18. Calculate the remainder when v(11) is divided by n. 9 What is the remainder when 152 is divided by -2 - (-306)/14 - (-6)/42? 12 Suppose 11w + 69 = 179. Let f(t) = 2t + 7. What is the remainder when f(5) is divided by w? 7 Let s(a) = -a*3 - 12a*2 - 11a + 1. Let z be (-4)/((-4)/11)-1. Let m be s(z). Suppose 8 + m = 3j. What is the remainder when 4 is divided by j? 1 Let i = 10 + -5. Suppose -3u = -3 - 12, ia = 4u + 75. Let o(s) = s2 + 1. What is the remainder when a is divided by o(-3)? 9 Suppose 0p - 3p + c + 67 = 0, 2c - 34 = -2p. What is the remainder when 123 is divided by p? 18 Suppose -4d = -2x - 1586, -6d + 10d + 5x = 1579. What is the remainder when d is divided by 21? 18 Let w = 385 + -360. Calculate the remainder when w is divided by ((-14)/(-3))/(4/6). 4 Let n(d) = 2d2 + 61d - 15. Calculate the remainder when n(-32) is divided by 42. 39 Let t be 25/(-4) - (-1)/4. Suppose -13c - 13 = -14c. What is the remainder when (-18 + 1)/(2/t) is divided by c? 12 Let j(z) = -2z2 - 16z - 5. Calculate the remainder when 73 is divided by j(-4). 19 Let i be -2-3(-1)/(-2). Calculate the remainder when 12 is divided by (i + 9/(-6))24/9. 0 Let a be (3 + -2)/(4/20). Suppose 10 + 15 = -ah. Let n = h - -15. Calculate the remainder when 28 is divided by n. 8 Let z(h) = -30h - 1. Let c(j) = j2 - j - 14. Let k be c(0). Let x = -16 - k. What is the remainder when z(x) is divided by 20? 19 Let g be (-24)/40 + 4/(-10). Let j be ((-12)/(-30))/(g/(-5)). Suppose -jv + 193 - 39 = 0. What is the remainder when v is divided by 26? 25 Let q be 3 + (4 - -115). Suppose -4z + 48 = l + 4l, 5z = 4l - q. What is the remainder when 31 is divided by l? 7 Let h(y) = -y2 + 16y + 32. Let j = 1 + 16. Calculate the remainder when 59 is divided by h(j). 14 Let v(t) = 2t + 10 - 7t - 22. What is the remainder when 37 is divided by v(-5)? 11 Let m(g) = g*2 - 34. What is the remainder when 71 is divided by m(-7)? 11 Suppose 0k = -6k - 270. Let c = k - -52. Calculate the remainder when c is divided by 3. 1 Let c(m) = m3 + 4m*2 + 12. Let t be c(-4). Suppose 0 = -5v - 3h + 54, 3v = -5h + 10h + t. Calculate the remainder when 44 is divided by v. 8 Suppose u = 4a + 3u + 178, -4a = -5u + 213. Let y = -20 - a. Suppose -2i + 3w = -2w - 3, 3w = 3i - y. What is the remainder when 27 is divided by i? 13 Suppose -2t + 109 = -87. What is the remainder when t is divided by ((-5)/4)/((-1)/20)? 23 Suppose t + 4t = 25. Suppose 2k = -4r + 104, tr - 4k - 117 = -0k. Calculate the remainder when 47 is divided by r. 22 Let a = 25 - 22. Calculate the remainder when a is divided by 3. 0 Suppose 0 = -5b + 4r - 65, 0 = -2b + 2r - 8 - 20. Let s = 16 + b. Suppose -47 = -2c - 11. What is the remainder when c is divided by s? 4 Suppose -21c = -0c - 2457. What is the remainder when (-11)/(1/(-121)) is divided by (c + 6)*1/3? 39 Let g = 21 + -12. What is the remainder when 24 is divided by g/6 - (-161)/14? 11 Sup	{ "pile_set_name": "DM Mathematics" }
2) - 6) + -3 + 7. 16 (1 - (-1 - -5) - 0) + (4 - 2) -1 10 - ((22 - 10) + 12) -14 Calculate (-8 - -3) + (42 - 28). 9 What is (41 - -29) + -25 + -20? 25 Evaluate 6 - 8 - ((-15 - -7) + 1). 5 -10 + 15 - (-8 + (22 - 12)) 3 Calculate (-22 - -26 - (-5 + 4 + -3)) + 6. 14 Evaluate -40 + (-18 - -16) + 21. -21 What is -14 - (1 + 4 + (0 - 8))? -11 Evaluate -11 + 3 - (3 + -6 - 7) - -3. 5 Calculate -1 + (-5 - (13 - 26)) + -4 + 1. 4 What is the value of 0 + -3 - 2 - (-15 + -1 + 8)? 3 -1 + 0 + 1 - (97 + (24 - 121)) 0 (-3 - 10 - -5) + (4 - -15) 11 What is 2 - (-10 - (-2 - -1))? 11 Calculate -54 - ((-69 - -7) + 26). -18 Calculate 7 + -6 - (4 - 13). 10 What is (-9 - ((-14 - -2) + 4)) + 13? 12 7 + (-4 - 2) + (3 - -3) + -7 0 15 - (49 - (16 - 2)) -20 Calculate -2 - -7 - (-35 + 32 + 2 + 15). -9 13 + 10 + -12 + 6 + -39 -22 What is the value of (-24 - -12 - -11) + -23? -24 What is -26 + 0 + (42 - 20)? -4 Evaluate (-3 - 9) + 7 - (2 - 2 - 2). -3 Evaluate (-206 - -216) + (4 + -2 - 13). -1 Calculate (-12 - (-3 + -14)) + 1 + -3 + 0. 3 (3 - -4) + (-1 - 10 - -5) 1 Evaluate (-16 - -20) + 2 + (-4 - (-1 - 1)). 4 Calculate -11 + (-15 - (22 + -51)). 3 Evaluate -25 + (-2 - 4) + 13 + -3. -21 What is the value of -3 - ((-1 - (-2 + 4)) + 8 - -3)? -11 What is (61 - 40 - 20) + 13 + 2? 16 What is 12 + (7 - 11) - 0? 8 Calculate -9 - -17 - (-6 - -4) - (2 - -1). 7 Evaluate 2 + (0 - (-10 + 3) - -13) + -7. 15 7 + -1 + (1901 - 1931) -24 Calculate 0 + -2 + 9 + (-3 - (6 - 11)). 9 What is the value of -29 + (0 + 0 - -15)? -14 What is -9 + 2 + 8 + -9? -8 What is the value of (37 - (-9 - -36)) + -12 + 1? -1 What is 1 + 24 + (-99 - -84)? 10 Calculate (1 - (3 - 4)) + 6 + 15. 23 What is 4 + (-34 - -40) + -11 + -2? -3 What is the value of (-8 - 10) + -8 + (11 + -5 - -6)? -14 What is the value of -11 + -4 + 8 + 3? -4 (-4 - (-5 + 16)) + (1 - (-1 - 4)) -9 Calculate -19 + (-4 - -21) + 6 - (30 - -1). -27 Evaluate 2 - 6 - (-26 + 31 + -7). -2 What is the value of 17 + -16 + 26 + -4 + -29? -6 Calculate (0 - -8) + (-10 - -29 - (2 + 11)). 14 (-16 - (-4 - 6)) + 12 - 1 5 Evaluate 562 + -540 + (-1 - (11 - 0)). 10 What is (3 - 1) + (9 - 11)? 0 (1 - -2) + (12 - 26) + -12 -23 What is the value of 27 - (24 + 9 - 16)? 10 Evaluate 0 - -25 - (-50 - (-38 - 8)). 29 Calculate -610 + 608 + -20 + 1 + 0. -21 What is the value of (2 - 11 - -2) + (312 - 297) - -5? 13 What is the value of -8 + 3 + -1 + -13 + 11 + -2? -10 What is the value of 52 + -41 + -3 + 6? 14 (-12 - (0 + 6)) + 5 -13 Calculate (-320 - -310) + 0 + -1. -11 -13 + 17 + (14 - 12) 6 Evaluate (-12 + -10 - -18) + -4. -8 What is 42 + -107 + 51 + 41 + -1? 26 What is 76 + -69 - (-2 - (-2 - -16))? 23 -20 + (0 - 0 - -10) + (-6 - 0) -16 What is the value of 9 - 2 - (-97 + 125 - (-2 - -5))? -18 Calculate 11 - 1 - (-29 - -40). -1 Calculate (-6 + 1 - -4) + -4 + (30 - 1). 24 Evaluate (71 - 67) + (3 + -5 - 3) + 19. 18 What is 11 + (-5 - 7 - (3 + -11 + 15))? -8 What is (1 - 6) + -3 + 4 + -2 + -1? -7 What is the value of 0 + -5 + -12 - -6? -11 Evaluate 29 + -21 + (2 - 9) - (18 + 0). -17 What is 14 + -25 + (38 - (5 + 3))? 19 Evaluate -2 + (-48 + 44 - (5 - 0)). -11 What is (5 - (3 - (3 - 1) - -4)) + 12? 12 What is 12 - 18 - (-35 + 20)? 9 What is -11 - (23 - 38) - 25? -21 Calculate -4 - (4 - (0 + -6 + 17) - 4). 7 What is 3 + -9 + 1 + (10 - (6 + 5))? -6 Evaluate 10 + -1 - (-6 - (-5 + -24)). -14 What is the value of -14 - (-25 - 7 - -1) - (-5 - -8)? 14 What is the value of -4 + 14 + -2 + -6? 2 What is (4 - 4 - 6) + -9 + 23 + -1? 7 What is the value of 570 - 569 - (-1 + 4)? -2 Calculate 5 - (-7 - (-10 - 5)). -3 What is the value of 23 + (1 - (-3 - -22))? 5 What is the value of 5 + -3 - ((2 - -14) + (-9 - -3))? -8 Evaluate 2 + 24 + -115 + 68. -21 Calculate 87 - 109 - (-2 + -32). 12 What is 1 + -12 + 3 + (-45 - -46)? -7 -24 - ((2 - (-13 + 28)) + 11) -22 What is 16 + 50 + -68 + 4 + (-2 - -1)? 1 What is -18 - (-27 + 8) - (5 - 0)? -4 30 + -3 - (18 + 9) 0 3 + 1 + -4 + -7 -7 Calculate (-1 - 3) + -1 + (479 - 494). -20 What is the value of 10 + -7 - -3 - (-3 - (1 + -3))? 7 Evaluate -6 + -22 + 25 + -15. -18 Evaluate 55 + (23 + -80 - -21). 19 Calculate 7 + (0 - -3 - (-12 - -16)). 6 What is the value of -3 + 22 + (-17 - -17) - 39? -20 Calculate -3 - (1 - 1 - (66 + -58)). 5 What is -21 + 14 + (7 - -8)? 8 Calculate (-4 + 17 - -10) + -13. 10 What is the value of (25 - (21 - 9)) + -12 + (-10 - -14)? 5 What is (-1 - 1) + 6 + -12 + -83 + 100? 9 Calculate 22 + -12 - (4 + -3 + 30). -21 What is the value of -6 + (2 + 0 + -10 - -17) + -19? -16 Calculate (14 - -3) + (-6 - -2). 13 Evaluate (1 - 1) + 4 + (7 - (21 - 8)). -2 Calculate 62 + -56 - (0 + 10) - (-1 - -4). -7 What is the value of 21 + -31 + (1 - (-2 - -2 - 0))? -9 What is 7 + -4 + 0 + -4 + 3 + 10? 12 What is -64 - -42 - (5 - 36)? 9 What is the value of (-6 - (-16 - -16)) + (12 - -1) - -2? 9 What is the value of 1 + -1 + -21 + 12? -9 Calculate 1 - 3 - (-3 - (-13 - (-16 - -11))). -7 Evaluate 3 + (-7 - (-38 - -20)). 14 Evaluate -14 - ((-2 - 11) + 11). -12 What is -1 - 8 - -5 - -15 - (-1 - -4)? 8 What is 6 - (8 + 8 + -20)? 10 Calculate -7 + (22 - 53) + 15. -23 Evaluate (20 + -17 - 2) + 1 + 10. 12 -8 + 2 - (231 + -227 + -3 + 1) -8 What is the value of 9 + -2 - (-1 + -2 - (75 - 73))? 12 19 + -13 - -7 - 26 -13 What is -23 - (-16 - (11 + -5 + -16))? -17 Calculate -5 + -4 + 18 + 3 + -8 + 7. 11 What is -79 - -88 - ((2 - -12 - 3) + -3)? 1 Evaluate 1 - (18 - (-1 - (3 + (-9 - -4)))). -16 What is 23 + 18 + -31 + -6? 4 What is 5 + 1 - (222 + -233)? 17 Evaluate -18 - (14 - 27) - (-1 - -12). -16 What is the value of -1092 + 1083 + (7 - (1 - (0 + 3)))? 0 Calculate 4 - -1 - (-28 + 25). 8 What is -117 + 109 - (-21 + (2 - 0))? 11 Evaluate (4 - 32 - -23) + (-3 - 14). -22 -8 + 27 + -24 + 6 + -2 - 9 -10 -15 - -10 - -3 - (-2 + 3) -3 20 + 1 - 17 - (-31 - -1) 34 What is 74 + -63 + -1 + -2 + -2 + -33? -27 Evaluate -3 - (5 - 2 - (3 + -3 - -11)). 5 (12 - 1) + 36 + -20 + -21 6 What is the value of ((12 - 9) + -8 - -5) + (5 - -2)? 7 Calculate -6 - -21 - (-3 - -6). 12 What is the value of 6 + (-7 - ((4 + -10 - 3) + 8))? 0 -30 + (6 - -25) + 19 20 Calculate -11 + (7 - 19) + 24. 1 Evaluate -6 + 0 - (-1720 + 1690). 24 Calculate -2 + 6 - (13 + -3 + -15). 9 Calculate -2 + 7 + (2 - 14) + -1. -8 Calculate (-9 + (6 - 2) - -1) + -2. -6 Evaluate 1 + (4 - (2 - 2) - 3) + -5. -3 What is 1 + 34 - (73 - (68 - 8))? 22 -14 + -3 + (-11 - (-9 + 0 + 0)) -19 Evaluate 0 + (-7 + 37 - 3) - -4. 31 What is (-1 - -17 - (-41 - -46)) + 14? 25 Calculate 27 + 1 + 46 + -54 - (19 + -13). 14 Evaluate -483 - -491 - (16 - (1 + 0)). -7 What is the value of (24 - -6) + (-3 - -2) + -11? 18 (-13 - -1) + 3 - (-23 + 14) 0 Evaluate (41 - 68) + 34 - (0 - -9). -2 Evaluate -2768 + 2761 + (-1 - (1 - -6)). -15 20 + -40 + 8 + 21 9 Evaluate -39 - 0 - (-174 + 150). -15 -19 - 16 - (-92 - -82) -25 (-12 + 9 - (2 - -12)) + 8 -9 Evaluate -2 - ((-4 - 3) + (30 - 20)). -5 Evaluate -4 + (-5 - 2) + 1. -10 What is 31 + (-23 + 7 - -3)? 18 Calculate 5 - (3 - 8 - -5). 5 Calculate -20 + 3 - (12 + -27). -2 What is 1 + (-1 + -1 + 3 - (15 - 6))? -7 -10 - ((-36 - -21) + 4) 1 -5 + (10 - 15) + (3 - 6) -13 Calculate -2 + -8 + 17 + 2 + -9. 0 (26 - -4 - 28 - (-1 - -4)) + 17 16 Calculate -10 - (16 + -4 + -14 + 22). -30 What is the value of 21 - (-18 - (2 - 31))? 10 What is 14 + (-3 - -4) - (40 + -33)? 8 Evaluate 10 - 5 - (-4 + 9 - (0 - -7)). 7 What is 5 + -10 - (7 - (4 + (-8 - -9)))? -7 -289 + 279 - (6 + -2 + 0) -14 Calculate -5 + -9 + 8 + (-18 - (8 - 16)). -16 Evaluate (25 - -1 - -4) + (-17 - -6 - -13). 32 Evaluate (1 - 7) + (1 - -5 - 4) + -4. -8 Evaluate -6 - (-23 - -31 - 24). 10 -19 + -4 + 38 + -31 -16 What is the value of (10 - (-7 + 19)) + 5? 3 Calculate 13 + -2 + (32 - 45). -2 Evaluate -5 + (-13 - -4 - -6). -8 Evaluate -10 + (7 - (15 + -3 - -4)). -19 What is (1 - 7 - 3) + (6 - -20)? 17 What is 15 + (6 + -2 - (-19 + (39 - 12)))? 11 What is 0 + -1 + (-13 - -10 - (-16 - 0))? 12 What is the value of -16 - (-4 - 6 - (-7 - -4 - 4))? -13 Calculate (-16 - -12) + 34 + -58. -28 What is the value of (56 + -47 + (-6 - 0) - -2) + 6? 11 What is -6 - ((2 - -3) + -3 + -4 + -13)? 9 (-6 - (2 - 28)) + 7 + -9 18 What is the value of (-6 + 3 - 5) + -4 + (2 - 1)? -11 Evaluate -33 + -2 + -4 + -3 - -13. -29 What is the value of 71 + 7 + -60 - (3 + 0 + -1)? 16 Calculate -47	{ "pile_set_name": "DM Mathematics" }
de 140 by 77827. 140/77827 Calculate -81845386 divided by -5846099. 14 -11044866 divided by 238 -46407 809539944 divided by -1416 -571709 1031382 divided by 99 10418 What is -138790240 divided by -645536? 215 What is 150460 divided by -75230? -2 Divide 5260710 by 1645. 3198 What is -1105933 divided by -38? 58207/2 What is 6114793 divided by -11? -6114793/11 What is 9387952 divided by -56? -167642 What is -208739375 divided by -333983? 625 -31846703 divided by 23891 -1333 Calculate 21134400 divided by 888. 23800 4 divided by 246802592 1/61700648 Divide 263059431 by 3. 87686477 What is -2 divided by -71459543? 2/71459543 12316 divided by -1492 -3079/373 Divide -19776533 by 4. -19776533/4 -12384976 divided by -16 774061 841184 divided by 466 420592/233 -43616 divided by -26 21808/13 Calculate 60509835 divided by -81. -747035 -2864736 divided by -477456 6 Divide 5 by -65537452. -5/65537452 -12321 divided by 8566 -12321/8566 Divide 62215629 by -7. -8887947 What is 5 divided by 60813933? 5/60813933 Divide 52090967 by -1. -52090967 Calculate 0 divided by 27430647. 0 What is 13322024 divided by -56? -1665253/7 Calculate 24771382 divided by 12385691. 2 Calculate -1189328 divided by -1813. 656 What is 145280924 divided by -134? -1084186 Calculate -5 divided by 9231911. -5/9231911 Calculate 13636420 divided by -7196. -1895 -8 divided by -1084768 1/135596 Divide -1137990 by 227598. -5 Calculate -20327201 divided by -6. 20327201/6 22590580 divided by 10 2259058 -15812652 divided by 15 -5270884/5 Calculate -5384960 divided by 38464. -140 -5624764 divided by 5 -5624764/5 16890 divided by -531 -5630/177 -184 divided by 634258 -92/317129 -916639164 divided by -42686 21474 Divide -19 by -2890394. 1/152126 Divide -243446962 by 209. -1164818 Divide 5913614 by -2. -2956807 -15752640 divided by -2625440 6 -166 divided by -811594 83/405797 Calculate 13234270 divided by -2646854. -5 Calculate -32164020 divided by 5628. -5715 Divide -59270864 by -1. 59270864 Divide -1 by -407939. 1/407939 What is -186995952 divided by -62331984? 3 What is 13800910 divided by 2760182? 5 Calculate -240825475 divided by 19. -12675025 What is 57 divided by 22948? 57/22948 Calculate 232088630 divided by -7486730. -31 Calculate 114642752 divided by 8188768. 14 What is 4 divided by -198425244? -1/49606311 Calculate -45742 divided by 4232. -22871/2116 125784 divided by 84 10482/7 Calculate 56955069 divided by 22. 56955069/22 What is -4 divided by -25358010? 2/12679005 Divide 24126345 by -1608423. -15 Calculate 44904832 divided by 368. 122024 Divide -572240 by 811. -572240/811 Calculate 69138175 divided by -13827635. -5 257902 divided by -979 -257902/979 Divide -22220649 by -4. 22220649/4 What is 12454 divided by 2649? 12454/2649 What is 96 divided by 158948? 24/39737 2 divided by 5011375 2/5011375 What is -3749526 divided by -4? 1874763/2 Divide -6541632 by 817704. -8 Calculate 2085564 divided by 52. 40107 What is -7298 divided by -5090? 3649/2545 Divide 33792 by 7728. 704/161 Calculate -68 divided by -168573. 68/168573 What is -10187408 divided by -308? 33076 -4209518 divided by -2 2104759 9 divided by 2487712 9/2487712 0 divided by 10881898 0 2 divided by -3761988 -1/1880994 Divide 129410658 by 6. 21568443 13581696 divided by 15024 904 What is 3804930 divided by 3? 1268310 Divide -164652864 by 12. -13721072 Calculate 3110766 divided by 36. 518461/6 Divide 4 by 63631622. 2/31815811 1006100192 divided by -1123 -895904 -2 divided by 35581157 -2/35581157 What is -6434720 divided by -262? 24560 Calculate 22793458 divided by 19106. 1193 Divide -151802923 by -3. 151802923/3 Calculate -37241555 divided by -2. 37241555/2 Calculate 111 divided by -1513806. -37/504602 Calculate -47195264 divided by -43378. 1088 What is 1603837440 divided by 14752? 108720 Calculate 1305758390 divided by -5. -261151678 Divide -74395881 by 10627983. -7 Divide 787 by -2846. -787/2846 What is -20144282 divided by -1? 20144282 Calculate 14321 divided by -70. -14321/70 Divide 202069101 by 13. 15543777 444 divided by 605481 148/201827 -2729160 divided by -570 4788 -19744831 divided by -13 19744831/13 Calculate 419471301 divided by 393. 1067357 5 divided by -589920 -1/117984 -4755 divided by -104 4755/104 What is 174968720 divided by 34993744? 5 28078184 divided by 2 14039092 What is 105609355 divided by 5? 21121871 Divide 7 by 76225. 7/76225 Divide 2120967 by 31. 2120967/31 Divide -180401108 by 45100277. -4 What is 586807224 divided by 68? 8629518 329 divided by 41264 329/41264 -28588844 divided by 10306 -2774 Divide 31 by -2725. -31/2725 What is 56316208 divided by -944? -59657 Divide -20631 by 133. -20631/133 Divide -13174 by -3085. 13174/3085 64290394 divided by -9184342 -7 What is 25836216 divided by -5303? -4872 What is -4 divided by -4589826? 2/2294913 Calculate 140 divided by 85385. 28/17077 What is -2930 divided by -15151? 2930/15151 Divide -1818 by 10029. -606/3343 What is 109766815 divided by -5? -21953363 Divide -31901391 by 2. -31901391/2 803972666 divided by -4 -401986333/2 Divide -36815227 by -3. 36815227/3 -62794090 divided by 137105 -458 536221338 divided by -6 -89370223 3893092 divided by 11942 326 Divide 6078 by 14985. 2026/4995 Divide -3456558 by -126. 27433 Divide 78 by 49284. 13/8214 Calculate -227 divided by 47687. -227/47687 -252753154 divided by -126376577 2 -5 divided by 299548 -5/299548 -43720854 divided by 2 -21860427 -8691 divided by 23823 -2897/7941 5331974 divided by 5331974 1 Calculate -543976 divided by 4. -135994 Divide -156461382 by -9. 17384598 Calculate 5 divided by 6883737. 5/6883737 What is -229113430 divided by -13? 17624110 Calculate 1 divided by -550648. -1/550648 Divide 24698205 by 45. 548849 Calculate 49680945 divided by -122669. -405 Calculate 6253 divided by 12650. 6253/12650 Divide 41054637 by 13684879. 3 Calculate -127102080 divided by 5880. -21616 Calculate -128130560 divided by 3203264. -40 What is -351586413 divided by 39065157? -9 Calculate -6339571 divided by 6339571. -1 -261331 divided by -198 261331/198 Divide -338 by 53749. -338/53749 Calculate -623058932 divided by 4. -155764733 -21 divided by -2367942 7/789314 -117531872 divided by -1159 101408 Calculate -87101 divided by -184. 3787/8 What is -4209 divided by -5140? 4209/5140 What is -85393461 divided by -9? 28464487/3 Calculate 0 divided by -15212980. 0 -261985 divided by -343 261985/343 -119594884 divided by -636143 188 -130409 divided by 75 -130409/75 Divide -3731 by 1075. -3731/1075 -40970016 divided by -284514 144 What is 1433535880 divided by 286707176? 5 -2029627 divided by 6 -2029627/6 10 divided by 56721701 10/56721701 -412707305 divided by 1985 -207913 Calculate -15 divided by 84619154. -15/84619154 Calculate 151579872 divided by 24. 6315828 Calculate -169584 divided by -2926. 84792/1463 Divide 8368409 by -7. -1195487 What is -14717 divided by 3727? -14717/3727 What is -56 divided by 128623? -56/128623 41741007 divided by -5963001 -7 -390624044 divided by -10379 37636 Divide -2071 by -80474. 2071/80474 -7924290 divided by -295 26862 Calculate -230700273 divided by 3. -76900091 Divide 1671 by -102. -557/34 Divide 131749770 by -26349954. -5 58124820 divided by 9687470 6 What is -4854558 divided by 6? -809093 Divide -3 by -42741530. 3/42741530 43 divided by -569531 -43/569531 Calculate -10637064 divided by 22584. -471 What is 58 divided by 48357? 58/48357 743128 divided by -1 -743128 What is -231225624 divided by -11529? 20056 Calculate 811542441 divided by 1119. 725239 Divide 718941912 by -5273. -136344 879 divided by 1419 293/473 What is 51043734 divided by -810218? -63 What is -2 divided by -3720145? 2/3720145 Calculate 20464 divided by -612. -5116/153 15295947 divided by 24 5098649/8 Calculate 283 divided by -35850. -283/35850 What is 127097376 divided by -18452? -6888 What is -10300500 divided by -147150? 70 22910246 divided by 5 22910246/5 -23135504 divided by 272 -85057 -7446580 divided by 54 -3723290/27 Divide -1030052 by 5479. -188 -64455 divided by -1 64455 16877300 divided by 61372 275 What is 5453617 divided by 5453617? 1 What is -358 divided by -1444553? 358/1444553 4483 divided by -527 -4483/527 Calculate -25362981 divided by 7. -3623283 What is -149930 divided by -2726? 55 What is -4017938 div	{ "pile_set_name": "DM Mathematics" }
he third derivative of i4/8 + i3/3 + 2i2. Determine h(z). -7 Let f(u) = 5u*3 + 3u*2 + 4u + 8. Let y be f(-3). Let d = y + 110. Let x(n) = -n*3 - 3n*2 + 1. Let s be x(d). Let m(p) = 7p - 3. What is m(s)? -24 Let i(c) = 12c3 + 4782 + 5c*2 - 4c + c - 4784 - 13c3. Give i(4). 2 Let y(c) = -c2 + 477. Let i(k) = k2 - 159. Let l(x) = -7i(x) - 2y(x). Let r(w) be the first derivative of l(w). What is r(-1)? 10 Let w(g) be the first derivative of g5/30 - g4/6 + 53g2 + 98. Let k(y) be the second derivative of w(y). What is k(3)? 6 Let n(r) = r2. Let y(b) = -b*2 - 2b. Let p(v) = -3n(v) - 2y(v). Calculate p(8). -32 Let o be (2178/84 + 485/(-70) + 7)-2. Let h(c) = -c3 - 53c*2 - 52c - 2. Determine h(o). -2 Let n(l) be the third derivative of -11l5/60 + l4/24 + l3/6 - 335l*2. Let b = 8 - 9. Determine n(b). -11 Let r(m) = -19m*2 + 7m. Let s(w) = 3w2. Let v(k) = -r(k) - 6s(k). Let p be 41 - 44 - (-1)/((-2)/(-88)). Let z = p - 35. What is v(z)? -6 Let b(y) be the first derivative of -2y3 - 3y*2 - 19 + 9y + 1/4y4. Determine b(7). 16 Let f(z) = z2 - 32z - 69. Suppose 2074 = -3s + 64s. What is f(s)? -1 Let h(t) = t + 21. Let i be (-6018)/(-236)(-6)/9. Calculate h(i). 4 Let z(x) = 9x*2 + 3x + 3. Let h be z(0). Let m(s) = 6s2 - 7s*2 - 139s*h + 95s*3 + 2s*2 - 1 + s + 77s*3. What is m(1)? 34 Let j be 16/(-88) + (-70)/(-22). Suppose 5d - 5f - 15 = 0, d - 2f - j = -0f. Let y(s) = 0s + 6650 - s - 3324 - 2s - 3328. What is y(d)? -11 Let s(h) = 6h*3 + 12h*2 - 2h - 1. Let g(w) = -366w + 14637. Let j be g(40). What is s(j)? -49 Let k(y) = 7y*3 + 4y*2 + 25y - 2. Let q(b) = b*2 + 13b. Let v(s) = k(s) - 2q(s). Give v(2). 60 Let b(x) = -4x*2 - 268 + 5x*2 + 2x + 269 + 5x3. Let y(d) = 4d*3 + 2d*2 + 2d. Let c(a) = -3b(a) + 4y(a). What is c(-3)? 9 Let m(a) = 24a + 119. Let o be m(-5). Let i(q) be the third derivative of -q6/24 + q3/6 - 24q*2. What is i(o)? 6 Suppose -111z + 113z = 4x + 30, -4z + 6x + 56 = 0. Let d(u) = -5u + 39. Give d(z). -16 Let k(w) = -w + 8. Let t = -42 - -63. Suppose -5o + t = -3c - c, o = 3c + 13. Let x be 0 - -3c/(-3). What is k(x)? 4 Suppose -5g = 3z + 65, 189z - 186z - 26 = 2g. Let q(x) = -x - 20. What is q(g)? -7 Let r(k) = 3 + 0k3 + 12k - 26k2 + k3 - 27k*2 + 36k*2. Determine r(16). -61 Let y(t) = 2t*2 - 55t + 34. Let v be y(27). Let d = 11 - v. Let h(f) = 3 + 3f2 - 6f - 2f2 + 1. Determine h(d). -4 Let w(r) = -2r + 11. Let l = -7077 - -7084. What is w(l)? -3 Let n(z) = 18z2 + 5 + 4 - 4 - 4. Suppose -3l + w = -21 + 15, 5l - 4w - 17 = 0. Determine n(l). 19 Let j(w) = w*3 - 10w*2 - 10w - 9. Let l be j(11). Let z(h) = 59 - lh3 - 3h*2 - 2h + 3h3 - 64. Let i be 24/(-60) - 44/(-10). Determine z(i). 3 Let i(a) = -a2 + 10a + 4. Let m(v) = -v*3 + 21v*2 + v - 21. Let q be m(21). Suppose q = -4f + 3n + 24, -52 = -4f - n - 3n. Calculate i(f). 13 Let l be (8/(-10))/(1/60). Suppose 0 = 8f - 10f - x - 93, 5x = 25. Let a = l - f. Let y(n) = -n + 1. What is y(a)? 0 Let x(l) be the second derivative of -l*4/12 - 3l*2/2 - 31l. Let z = 1831 + -1831. Calculate x(z). -3 Let u(x) = -49 - 83697x - 83690x + 167389x. Calculate u(24). -1 Let h(v) be the second derivative of v5/20 + 2v*4/3 - 11v*3/6 - 13v*2/2 + 1208v. Calculate h(-9). 5 Suppose 3w - 216 = -39. Let l = w + -52. Let h be (-6)/(-1) + -6 + 0 + l. Let k(i) = i3 - 7i*2 + 2i - 8. Determine k(h). 6 Let j(p) be the second derivative of -p4/12 - p3 - 3p2/2 + 50p + 5. Determine j(-6). -3 Suppose -5t + 4p = -p, 4p - 8 = 2t. Let o be t((-12)/16)/(-3). Suppose -3a - o = -16. Let n(y) = -y - 6. Give n(a). -11 Let r = -586 + 582. Let a = 0 - r. Let o(i) = 2i2 - 3i - 2. Calculate o(a). 18 Let u(t) be the third derivative of -t*6/120 + 2t*5/15 + 11t4/24 - t3 + 2t2 - 17t + 21. Determine u(10). -96 Let b be (3 + -1 - 2)/(6/(5 - -1)). Let r(y) = 4y2 - 17. Calculate r(b). -17 Let r(p) = -2p*2 - 5p - 38. Let g(i) = -3i2 - 9i - 79. Let x(d) = -4g(d) + 7r(d). Let m(c) be the first derivative of x(c). Calculate m(1). -3 Let r = 103 - 54. Let s = -57 + r. Let t(f) = -2f - 20. Let a be t(s). Let o(c) = -c + 5. Give o(a). 9 Let y(z) = -z + 1. Let b(r) = 29r + 5. Let m be (-2 - 3/(-1)) + 16 + -18. Let f(h) = mb(h) + 4y(h). Give f(-1). 32 Let d(i) = 44 + 60i + 67i + 60i - 188i - 12. Calculate d(4). 28 Let h(v) = -v*2 - 16v + 41. Let n be h(-22). Let t = n - -85. Let o(a) = 6a + a2 - 2 + 1 - 2. Determine o(t). -3 Let m be (-4 - 147/6)/(11/198). Let a = m - -508. Let b(s) = s. Let i(u) = -3u - 1. Let g(j) = -4b(j) - 2i(j). Calculate g(a). -8 Suppose 4o + 3a - a - 28 = 0, 4a = -8. Suppose -13g = -12g + o. Let k(b) = b3 + 8b2 - b + 3. Determine k(g). 11 Let y(z) be the first derivative of z3/3 - 9z2 - 2z + 1884. Determine y(19). 17 Let p(n) be the second derivative of n*5/20 + 7n*4/12 - 2n*3/3 - 13n*2/2 + 1253n + 1. Determine p(-7). 15 Let g = -159 + 179. Let b(p) = -g - p + 2p - p3 - 5 - 2p + p*2. Give b(0). -25 Suppose 0 = 4p - 2l - 2l - 40, 10 = 2p + 3l. Suppose 0q - pq = -16. Let h(t) = 42 + 7t2 - 43 - 4t*q + 0t2. Calculate h(1). 2 Let z(k) be the third derivative of k6/120 + k5/10 + k4/6 - 2k3/3 + 496k*2. Suppose -2p + 6 = 0, 3a + a = 4p - 36. Calculate z(a). -28 Let g(h) = -6h - 1. Let a = 54 + -48. Suppose 4j - aj = 260. Let w be (-52)/j(-3)/(6/(-10)). What is g(w)? -13 Let d(z) = 1532 - 36z - 459 - 738 - 660. What is d(-9)? -1 Let d(k) = k2 - 7k + 17. Let j be d(6). Suppose -17 = -jp + 38. Let x(v) = v3 - 6v*2 + 6v + 1. What is x(p)? 6 Let d(p) = 3p + 14. Let g be d(0). Let v(a) be the first derivative of ga - 15a - 4 - 4 + a2. Give v(5). 9 Let z(i) be the third derivative of -i6/120 + i5/10 + i3/2 + 16i*2. Let c be z(6). Let s be (-1)/(-2)(3 + c). Let p(l) = -7l - 1. Give p(s). -22 Let n be -3 - -2(-28)/(-8). Let v be n/(-2) + (-7 - -10). Let g(q) be the second derivative of -3q5/10 + q3/6 - 32q. What is g(v)? -5 Suppose -19w + 18w + 1 = 0. Let y(t) = 6t - 3. Let m be y(w). Let b(r) = -16 - 7r - r2 - rm + 13r2 - 3r. What is b(11)? -5 Suppose 2573c = 2574c - 3. Let t(x) = 3x2 - 3x - 2. Let l be t(-2). Let n(k) = 18 + ck - l - 4k + 5. Give n(-5). 12 Let y(t) = -3t2. Let o be 6252/(-22) + 44/242. Let f = o + 282. Determine y(f). -12 Let g(s) be the third derivative of -s6/120 - s5/6 + 13s*4/24 - 5s3/3 + s2 - 2357. Calculate g(-11). -32 Let w(t) = -2t3 - t2 + 2t + 3. Let r(j) = 5j3 + 10j*2 - 11j + 11. Let s(g) = -r(g) - 2w(g). Determine s(-9). 1 Let u = -4050 - -24301/6. Let k(b) be the third derivative of 0 - 18b*2 + 0b + 5/24b4 + ub3. Calculate k(1). 6 Let a(w) be the third derivative of -w5/60 + w*4/6 + 32w*3/3 + 2w*2 + 2w. Let g be a(10). Let b(i) = i. Calculate b(g). 4 Let o(u) = u*2 + u + 2. Let c be o(-2). Suppose 0x + cx - 12 = 0. Let z(d) be the third derivative of d4/8 - 2d*3/3 - 446d2. Determine z(x). 5 Let r(v) = -v3 - 13v2 - 2v - 17. Let a be r(-13). Let w(m) = -12m2 + 13m*2 + 0m*3 - 2m3 + m3 + am3. Calculate w(1). 9 Let r = -11877 + 11880. Let v(l) = -7l - 17. Determine v(r). -38 Suppose -5w + 2q + 28 = 3, 0 = -q - 5. Let s(v) = 3 + 7v + 0v*3 + 0v*2 + 6v2 + vw. Suppose -13t = 6t + 100 - 5. Determine s(t). -7 Let u(t) = -4t + 45. Let k be ((-16660)/(-7140))/(1 - (76/30 + -2)). Determine u(k). 25 Let y = -168 + 267. Let l = 83 - y. Let g be ((-2)/l)/1 - 29/232. Let k(j) = j2 - 20. Calculate k(g). -20 Let s(x) be the second derivative of x6/120 - x5/12 - x4/4 - 5x*3/6 - 15x*2/2 - 44x + 1. Let b(i) be the first derivative of s(i). What is b(6)? -5 Let u(j) = -68j2 - 6j - 1. Let v(h) = -39h2 - 4h - 1. Let y(t) = 4u(t) - 7v(t). Give y(-3). 0 Let g(n) = 2n2 - 10n + 21. Let p be g(-12). Let y(h) = ph2 + 2h + 2h + 432h*2 - 863h*2. What is y(3)? -6 Let k(c) = 2c + 1. Let q be k(-1). Let a = -2 + q. Let z(w) be the second derivative of w5/20 + w4/3 + w*3/6 - 2w*2 + 18277w. What is z(a)? 2 Let i = 2399 + -2396. L	{ "pile_set_name": "DM Mathematics" }
alculate 8/10(-29)/((-25578)/(-105)). -2/21 What is (62/(-124))/(2/20)? -5 Evaluate (52/(-13))/(((-4)/3)/(102/(-9333))). -2/61 What is 8(-10)/85022/(-1620)? 31 13993/(-11994)((-1)/(-98))/(3/(-6)) 1/42 Evaluate (-5)/(-2)6104/1090. 14 Calculate ((-10)/(-2))/((-368)/1840). -25 2/(-6)51/(-15)15 17 (95/(-6))/(620/(-744)) 19 What is ((-8)/(-4))/(5230/(-50))? -2/23 What is the value of (1/(-11))/(360/(-1320))? 1/3 Calculate (64/30)/(2268/(-17010)). -16 Calculate (3006/16533)/((-1)/88). -16 What is (2/(-24))/((-1957)/(-3914))? -1/6 Calculate ((-84)/7182)/(1/(-9))-1. -2/19 What is ((-5)/4)/((-11)/3963)? 15 What is 6/(3/((-27)/(-18)))? 3 (-15)/(-10)(2/(-15))/((-2)/(-80)) -8 Evaluate (1340/804)/((-10)/24). -4 Calculate ((-6)/(-42))/((-2)/(-70)). 5 Calculate (((-7)/((-63)/(-12)))/(-2))/((-36)/(-594)). 11 1/(10/14)120/(-12) -14 What is the value of (1-34)/((-2)/(4/((-8)/2)))? -17 What is the value of (2/4)/(1/(-18))? -9 2/321626/6 13/3 Evaluate ((-39)/78)/((22/(-33))/((-6)/(-3))). 3/2 What is the value of 182/(-91)(3/8)/(27/(-12))? 1/3 7((-80)/(-8))/(-350)15 -3 (-106/168)/((-22)/((-528)/(-30))) 2/7 Evaluate ((-876)/1095)/((-2)/(-10)). -4 What is the value of (-168/(-80))/(4/20)? 8 ((-126)/(216/(-12)))/(3/(-3)) -7 What is the value of ((1-3)/(120/(-40)))/(1/(-16))? -16 Evaluate (552/46)/(-218/(-48)). 16 Calculate ((-33)/5)/(443/2215). -33 ((-5)/20)/(3/4) -1/3 What is the value of 544/(-2992)(6/(-4))/1? 3/11 What is (-6885)/(-340)11/((-165)/20)? -27 What is the value of ((-6)/(-1)(-78)/39)/(-5)? 12/5 Calculate ((-28)/91)/(24/(-156)). 2 What is the value of (-9)/(-6)8/10(-80)/96? -1 Calculate (4/(-27))/((-144)/(-108)). -1/9 Calculate (-2)/((-4)/(-2))(-1510)/(-2114). -5/7 What is (-335)/2077(-63)/(-84)(-16)/(-30)? -2/31 (5/10-234/(-2))/(-1) -17 Evaluate (-35/(-27))/(10/(-180)-6). 5/3 What is the value of (11/(-22))/(20/(-680))? 17 What is the value of (32/4)/(((-10)/(-25))/(1/5))? 4 122/(-33)15/46 -15 What is the value of ((-33)/(-6))/((-66)/132)? -11 Evaluate 69/(-5)(-3840)/(-288)(-1)/8. 23 Evaluate (-8)/(-6)(-3)/(-42)-3. -2/7 Evaluate ((-112)/(-196))/((-152)/(-28)). 2/19 Evaluate (-36)/1197-57(-2)/(-8). 3/7 Evaluate (4/236)/((-67)/(-3953)). 1 ((1134/(-36))/(-21))/((-12)/10) -5/4 Calculate ((-252)/(-700))/(6/10). 3/5 Evaluate ((-4)/(8/(-6)))/(15795/1404). 4/15 (-4)/2(337/(-2022))/(3/(-45)) -5 What is ((9/(-14))/(17/(-68)))/((-18)/(-63))? 9 Calculate ((-8)/(-5))/(120/(-900)). -12 (-790)/(-711)12/4 10/3 Evaluate (128/(-960))/((-2)/9). 3/5 What is ((6/91)/(44/154))/(-3)? -1/13 (52/39)/(8/(-12)) -2 What is (-13)/(507/3744-6)? 16 What is the value of -13636/486? -8/3 276/68172(-38)/(-2) 1/13 414/(-1265)11(-20)/88-2 -18/11 Evaluate ((-1)/8)/((162/1215)/((-16)/50)). 3/10 What is the value of (206/(-14729))/((-32)/44)? 1/52 Evaluate (4/3)/(((-8)/(-18))/1). 3 Evaluate (((-16)/(-5))/(-4))/((-98)/35). 2/7 What is the value of (-2(-4)/(-8))/((-2646)/252)? 2/21 (6/(-30))/((-3)/15)-19 -19 Calculate (40/10)/((952/(-6))/14). -6/17 Calculate 6(-10)/44(-21)/105. 3/11 Calculate (1/(6/108))/((-24)/(-16)). 12 ((-243)/270)/((-60)/(-50)) -3/4 Evaluate ((-30)/(-10))/(13/((-104)/(-24))). 1 What is (3/(-14))/(684/27937)? -1/8 What is the value of (3/(-12)30)/(81/36)? -10/3 Calculate ((-56)/4)/(105/21). -14/5 Calculate 2(-2)/((-8)/30)-1. -15 ((-516)/5418)/(3/(-28)) 8/9 Evaluate 35/20(20/(-70))/(-2). 1/4 Evaluate (-1)/(10(-14)/1820). 13 What is (-6)/448/468? -2/13 (5/3)/((-9)/3726-23) 30 What is the value of ((-230)/69)/((-15)/(-9))? -2 What is the value of ((-14)/(-6))/((-17)/(-51))? 7 Evaluate ((-2786)/11940)/((-14)/(-8)). -2/15 What is the value of (1/3)/((16/40)/((-156)/40))? -13/4 Evaluate (510/(-50))/(5/603). -4 What is ((-4)/(-9))/((-363)/16335)? -20 What is 45/(-12)-8(-3)/((-18)/(-3))? -15 What is 6((-7)/112-60)/((-15)/(-10))? 15 Evaluate 328/(-3444)(-63)/(-6). -1 Evaluate ((-1072)/670)/(156/(-45)). 6/13 Evaluate 1-1((-14)/(56/(-4)))/1. -1 What is the value of 18/41148/(-67158)? -1/13 What is the value of ((-4)/(-15))/((-48)/(-1728)16)? 3/5 What is the value of (((-2)/(-24))/((-2)/6))/((-154)/(-528))? -6/7 Calculate (57/(-5814))/(2/(-6)). 1/34 Calculate (-1828)/1371((-3)/(-14))/((-8)/(-16)). -4/7 What is (-1)/((57/209)/(-3)(-1)/1)? -11 What is -1322/(-1573)-33? -6 What is the value of 12/(-44)66/(-6)286/33? 26 Calculate ((-52)/(-234))/((-8)/(-612)). 17 What is the value of (3/(-9))/(450/(-405))? 3/10 Evaluate 49/21(-135)/15. -21 ((98/168(-6)/21)/1)/(-2) 1/12 Calculate ((6/39)/(4/8))/2. 2/13 What is the value of (1/(-2))/((-125)/(-6250))? -25 What is the value of 2/20/(((-96)/12)/(-8))? 0 What is the value of (-3615)/216942/(-2)? 35 What is the value of 505/101-8(-1)/(-10)? -4 What is -16(-15)/((-2100)/(-14))? 8/5 Evaluate (-90)/9-1(-8)/10. -8 Calculate 3654/116(-4)/(-18)-1. -7 Evaluate 2/(9440/(-198)). -1/10 (12/(-9))/((-36)/(-135)) -5 Evaluate (-36(-15)/5940)/(1/253). 23 Calculate (42/252)/(22/231). 7/4 What is the value of ((539/792)/(-49))/((-30)/405)? 3/16 Calculate (2/14)/((3/15)/(56/20)). 2 Evaluate ((-6)/4)/((1/6)/(43/(-387))). 1 (-14)/(-4)(-8536)/8148 -11/3 (-4)/7(-980)/420 4/3 16/(-80)(-50)/40 1/4 What is the value of (17/(-85))/((8/(-12))/(12/(-9)))? -2/5 What is the value of -43(9/(-18))/(63/(-6))? -4/7 Calculate (89/1246)/((-7)/(-8))7. 4/7 Evaluate 30/16(-368)/(-414). 5/3 Evaluate (9/(-36))/(((-72)/(-99))/8). -11/4 What is the value of (1-1)/((21/66)/((-91)/(-26)))? -11 What is (4/(-8))/((102/(-272))/(15/(-4)))? -5 Evaluate (-6)/(-8)3/((-1323)/84). -1/7 What is the value of (((-51)/(-34))/((-14)/(-4)))/(4/(-7))? -3/4 What is (5/((-255)/(-2)))/(5/(-90)-3)? 4/17 What is ((64/20)/(-4))/(294/(-3675))? 10 What is 10/16(-18)/15? -3/4 Evaluate 4((-81)/(-315))/(156/91). 3/5 What is 2/8-151452/(-4235)? 9/7 What is the value of 1(-2)/3(-190722)/(-6692)? -19 Calculate 552/(-897)(-1)/(-4). -2/13 ((-2)/(-2))/(-216/(-54)1) 3/7 What is the value of (-14/8)/((-17)/(1428/(-7)))? -6 11960/57408(-12)/(-5) 1/2 Evaluate ((-1970)/(-591))/((-1)/(-6)). 20 ((-18)/(-15))/(1674/5115) 11/3 What is ((195/(-9))/13)/(19/342)? -30 2-5(-31)/(-1085) -2/7 Evaluate 5/(165/(-9))(-2090)/228. 5/2 ((-6)/64)/((-1)/5(-630)/(-56)) 1/24 What is the value of (-43)/(774/(-240))-34/10? -16 Calculate ((-20)/(-20))/(300/(-24)). -2/25 210/10(-18)/54 -7 ((-15)/(-180))/(2/115/40) 1/9 What is (7(-43)/7224)/(((-3)/(-2))/3)? -1/12 What is the value of ((-2)/(18/((-18)/(-6))))/((-16)/(-432))? -9 135/180(-8)/2-3 9 What is ((48/(-18))/(5/3))/((-8)/(-100))? -20 What is the value of (5/(-4))/((-6)/(-24))? -5 What is (-3)/((24/8)/(-9))? 9 20/655/(-50)-13 2/5 What is the value of (-102/10)/(60/(-5))? 1/6 What is ((-39)/65)/(4(-2)/(-80))? -6 Evaluate 4/(-80)(-3)/((-12)/4)-8. 2/5 Calculate (-22)/(-308)-21(-14)/(-6). -7/2 Evaluate (102/(697/(-41)))/((-558)/(-3)). -1/31 What is ((-1)/(8/(-12)))/(161/46)? 3/7 Calculate 96/(-140)(-115)/(-46). -12/7 Evaluate 12/(-672)-7-424/(-22). 6/11 What is the value of ((-88)/(-198))/((-20)/(-45)-3)? -1/3 Evaluate ((6/(-6))/((-2)/(-12)))/(243/(-567)). 14 Calculate (-6)/(-75)(-6)/60425/34. -1/10 Calculate 1/((45/(-55))/9). -11 Evaluate 38/(-4)(-57512)/(-19513). -28 What is 2/16(-936)/(-9)? 13 19(-7)/(-1575)(-10)/(-4) 1/10 Calculate (330/880)/(3/2). 1/4 (1/2)/(16/(-1216)-19) 2 ((99/(-189))/11)/((-24)/588) 7/6 ((-126)/882)/((-3)/(-6)) -2/7 Evaluate (-43)/(1204/280)(-4)/(-8). -5 What is (375/10)/1536/(-9)? -10 Calculate (-2)/(1/((-18)/45)). 4/5 Calculate ((1-2)/2)/(693/(-2079)). 3 42(-246)/(-3608) 6/11 Calculate ((-7)/(105/(-2)))/(65/(2470/(-76))). -1/15 What is the value of (52/(-117))/((-34)/9)? 2/17 What is the value of (-23)/(-46)(-138)/(-12)? 23/4 ((-2)/(-2))/7(-14)/(182/(-39)) 3/7 Calculate ((-190)/(-210))/(3/63). 19 What is 203/(-58)(-3)/((-33)/22)? -7 Evaluate (-24)/(-220)50/(-30). -2/11 Calculate ((-534)/(-178))/((99/30)/11). 10 Evaluate 15/(-6)-33(-46)/5313. -5/7 Evaluate 1/(494/26628/(-8)). -2/13 What is (66/(-21))/(22/77)? -11 Evaluate 45(-18)/2916(-4)/50. 1/45 What is the value of 53(-1)/(-2)(-68)/102? -5 What is the value of (-2)/(-4)((-2312)/17)/(-17)? 4 What is the value of (8/(-5))/(4/(-6))(-5)/2? -6 What is the valu	{ "pile_set_name": "DM Mathematics" }
4(p - 2613)(7p - 2) Let -j2/6 - 12373j/3 + 24748/3 = 0. What is j? -24748, 2 Factor -4j2 - 126436j + 758760. -4(j - 6)(j + 31615) Suppose -a*2/5 + 103a - 7014/5 = 0. What is a? 14, 501 Determine z, given that 45z3 - 7022z*2 + 274092z - 12168 = 0. 2/45, 78 Find z, given that 53z5/2 + 793z*4/2 + 1893z*3 + 3638z*2 + 2404z - 96 = 0. -8, -3, -2, 2/53 Factor 2v3/3 - 614v*2/3 + 608v. 2v(v - 304)(v - 3)/3 Solve 3l*3 - 10989l*2 - 110115l - 275475 = 0. -5, 3673 Factor -4m2 - 2046080m - 261652710400. -4(m + 255760)2 Find k such that 5k*4/2 + 60k*3 - 855k*2/2 + 665k - 300 = 0. -30, 1, 4 Let 2h4/5 + 298h*3/5 + 4146h*2/5 + 16982h/5 + 13132/5 = 0. Calculate h. -134, -7, -1 Let 3v5 + 210v*4 + 4476v*3 + 18882v*2 - 207279v + 183708 = 0. Calculate v. -27, -21, 1, 4 Let -v*4/8 - 21v*3/8 - 161v*2/8 - 531v/8 - 315/4 = 0. What is v? -7, -6, -5, -3 Suppose 4v5/7 - 435v*4/7 - 9049v*3/7 - 28423v*2/7 + 29013v/7 + 1270 = 0. What is v? -14, -5, -1/4, 1, 127 Solve 2i4/9 + 4058i*3/9 + 16168i*2/3 + 193760i/9 + 258176/9 = 0. -2017, -4 What is l in -760l3/13 - 9118l*2/13 - 24296l/13 + 64/13 = 0? -8, -4, 1/380 Factor 3h4 + 783h*3 - 75378h*2 + 74592h. 3h(h - 74)(h - 1)(h + 336) Let -2y5/7 + 208y*4/7 + 128y*3 - 3424y*2/7 - 3552y/7 + 10368/7 = 0. What is y? -6, -2, 2, 108 Let -c*2/9 + 209719c/9 + 209720/9 = 0. Calculate c. -1, 209720 Suppose 20x3 - 138092x*2 + 82840x + 55232 = 0. Calculate x. -2/5, 1, 6904 Factor 858675m3 + 604500780m*2 - 4519668m + 8448. 3(m + 704)(535m - 2)2 Suppose 25p*5 - 2140p*4 + 30565p*3 - 43930p*2 + 4600p + 10880 = 0. What is p? -2/5, 1, 16, 68 What is p in -6p4 - 2764p*3 - 28894p*2 - 42336p - 16200 = 0? -450, -9, -1, -2/3 Find p, given that -27p2 - 98940p - 271920100/3 = 0. -16490/9 Determine j, given that 234j5 + 5043j*4 + 28689j*3 + 35739j*2 + 12405j + 546 = 0. -13, -7, -1, -1/2, -2/39 Suppose 2b2 + 301620b + 11371828050 = 0. What is b? -75405 Determine x so that 3x3/5 - 196x*2/5 + 1127x/5 - 354/5 = 0. 1/3, 6, 59 Find s, given that 2s3 - 2064s*2/5 - 41742s/5 - 4860 = 0. -18, -3/5, 225 Let y*4 + 1314y*3 + 444589y*2 + 8501580y + 41860900 = 0. Calculate y. -647, -10 Factor r*3/11 + 5054r*2/11 - 10115r/11 - 15168/11. (r - 3)(r + 1)(r + 5056)/11 Solve -2v5 - 174v*4 - 3588v*3 - 9740v*2 - 9402v - 3078 = 0. -57, -27, -1 Factor 3w3 - 1401w*2 + 8313w - 6915. 3(w - 461)(w - 5)(w - 1) Determine h, given that h2/9 - 1349h/9 + 9296/3 = 0. 21, 1328 Solve -3q2 + 157758q - 2073965547 = 0. 26293 Factor 65x2/2 + 14135x - 2175/2. 5(x + 435)(13x - 1)/2 Factor -4s*3 - 92s*2 + 733380s + 126668700. -4(s - 487)(s + 255)*2 Find h, given that 3h*2 - 21375h + 64098 = 0. 3, 7122 Factor 2t2/7 - 132462t/7 + 132460/7. 2(t - 66230)(t - 1)/7 Factor -120t3 - 2067t*2 - 11670t - 21675. -3(t + 5)2(40t + 289) Factor s2/4 - 135s/4 - 2573/2. (s - 166)(s + 31)/4 Suppose -26l*4/5 + 164l*3/5 + 2l*2/5 - 172l = 0. What is l? -2, 0, 43/13, 5 Suppose -92929254649n2 - 1219372n - 4 = 0. What is n? -2/304843 Factor -4y2 - 64632y - 129248. -4(y + 2)(y + 16156) Let -2i5/5 - 3328i*4 - 6918908i*3 + 13874440i*2 + 48492294i + 138511368/5 = 0. What is i? -4161, -1, 4 Factor 24r3 - 1371r*2 + 1515r - 168. 3(r - 56)(r - 1)(8r - 1) Factor -5z2 + 5394380z. -5z(z - 1078876) Factor -2i3/11 + 8532i*2/11 - 8530i/11. -2i(i - 4265)(i - 1)/11 Solve -5k*4 - 4120k*3 + 33445k*2 + 137280k = 0 for k. -832, -3, 0, 11 Solve -5r3 + 3590r*2 + 18055r + 14460 = 0. -4, -1, 723 Suppose 2u2 - 3950u - 11868 = 0. Calculate u. -3, 1978 Find t, given that -4t5/5 - 36t*4/5 + 172t*3/5 + 276t*2/5 - 792t/5 - 864/5 = 0. -12, -2, -1, 3 Let 20v3 - 25335v*2 + 220105v + 56610 = 0. Calculate v. -1/4, 9, 1258 Suppose 2d3 - 239998d*2 + 479990d - 239994 = 0. Calculate d. 1, 119997 Find m, given that 576m4 + 29577m*3/7 - 57726m*2/7 + 24063m/7 + 54/7 = 0. -9, -1/448, 2/3, 1 Factor -j*4/4 + 179j*3/4 - 7737j*2/4 - 24479j/4 - 8281/2. -(j - 91)*2(j + 1)(j + 2)/4 Factor -2g*2 + 725754g + 725756. -2(g - 362878)(g + 1) Factor 3m3/2 - 342m*2 + 30741m/2 - 15030. 3(m - 167)(m - 60)(m - 1)/2 Solve -5x*4 - 35x*3 + 620x*2 - 1540x + 960 = 0 for x. -16, 1, 2, 6 Solve -5936f3 - 10068f*2 - 4272f - 140 = 0 for f. -1, -35/53, -1/28 Find k such that -3k4 - 237k*3 + 60357k*2 + 121413k + 60822 = 0. -186, -1, 109 Factor -5q2 - 680695q + 2042130. -5(q - 3)(q + 136142) Suppose -3b4/8 - 201b*3/2 - 19767b*2/2 - 422100b - 6615000 = 0. Calculate b. -84, -50 Determine m, given that -m*3 + 585m*2 + 1173m + 587 = 0. -1, 587 Find r, given that 2r4/7 + 740r*3/7 + 2206r*2/7 + 1468r/7 = 0. -367, -2, -1, 0 Suppose z*2/12 + 5087z/6 + 25877569/12 = 0. Calculate z. -5087 Determine g so that 2g4/9 - 2458g*3/3 - 7396g*2/9 + 24592g/3 - 59008/9 = 0. -4, 1, 2, 3688 Suppose -4c3/3 + 320c*2/3 + 2752c/3 + 5632/3 = 0. Calculate c. -4, 88 Let s*3 + 194919s*2 + 9498451599s + 9498256681 = 0. What is s? -97459, -1 Suppose 5f5/6 + 35f*4 - 10565f*3/6 + 47255f*2/3 + 1760f - 47360/3 = 0. What is f? -74, -1, 1, 16 Solve 10n3/7 - 552n*2/7 + 1170n/7 - 212/7 = 0 for n. 1/5, 2, 53 Factor 4r2 + 1237396r. 4r(r + 309349) Factor 4y3/7 + 23076y*2/7 + 23048y/7 - 19776. 4(y - 2)(y + 3)(y + 5768)/7 Solve -2p*2/3 + 284p/3 - 3008 = 0. 48, 94 Factor p*4/3 + 5942p*3/3 - 5944p*2 + 17834p/3 - 5945/3. (p - 1)*3(p + 5945)/3 Find y, given that -2y3/3 + 8320y*2/3 - 2887038y + 5762988 = 0. 2, 2079 Find v, given that 2v4/9 - 74v*3/3 - 914v*2/9 - 230v/3 = 0. -3, -1, 0, 115 Factor t*3/4 + 8281t*2/4 + 2070t. t(t + 1)(t + 8280)/4 Factor 3r3/5 - 774r*2/5 + 53568r/5 - 92256. 3(r - 124)2(r - 10)/5 Factor -3x3 + 35553x*2 - 639225x + 2875419. -3(x - 11833)(x - 9)*2 Let -3j*4/4 + 579j*3 - 217629j*2/2 - 1131945j - 11466075/4 = 0. What is j? -5, 391 Let -3h5 - 177h*4 - 261h*3 + 4785h*2 + 9336h - 13680 = 0. What is h? -57, -4, 1, 5 Let f*5/2 + 113f*4/2 + 1443f*3/2 + 5715f*2/2 + 3564f = 0. What is f? -99, -8, -3, 0 Determine k so that 3k5 - 30k*4 + 51k*3 + 156k*2 - 180k = 0. -2, 0, 1, 5, 6 Find v such that 4v5 + 1880v*4 + 7480v*3 + 11200v*2 + 7460v + 1864 = 0. -466, -1 Factor -483605g4 + 5310325g*3 + 102585g*2 + 495g. -5g(g - 11)(311g + 3)*2 Find y, given that -5y*4 + 3855y*3 + 39050y*2 = 0. -10, 0, 781 Let -2o*3/17 - 12248o*2/17 - 293088o/17 - 1756800/17 = 0. Calculate o. -6100, -12 Determine m, given that -4m3 + 100824m*2 = 0. 0, 25206 Find h such that 5h*3 + 9247h*2 + 12930h - 11088 = 0. -1848, -2, 3/5 Solve 3a2 + 170736a - 341484 = 0. -56914, 2 Solve d*5/2 + 13d*4 - 449d*3 - 958d*2 + 897d/2 + 945 = 0. -45, -2, -1, 1, 21 Solve a*5 - 215a*4 + 5703a*3 + 215a*2 - 5704a = 0 for a. -1, 0, 1, 31, 184 Factor -2m3 + 282m*2 - 276m - 560. -2(m - 140)(m - 2)(m + 1) Factor -4x*2/7 + 89492x/7 + 89496/7. -4(x - 22374)(x + 1)/7 Factor 2h3 - 1366h*2 + 69390h - 917082. 2(h - 629)(h - 27)*2 Factor 5i*3/3 + 25i*2/3 - 20i - 60. 5(i - 3)(i + 2)(i + 6)/3 Factor 5c*4 + 1110c*3 - 3360c*2 + 3370c - 1125. 5(c - 1)3(c + 225) Solve -55k3/2 + 22713k*2/2 + 11798k + 414 = 0 for k. -1, -2/55, 414 Suppose 2z2/5 - 978z/5 - 8964/5 = 0. Calculate z. -9, 498 Find s, given that 4s4 - 300s*2 - 1000s = 0. -5, 0, 10 Factor 4l2 - 304080l + 608144. 4(l - 76018)(l - 2) Factor -2k3 + 10482k*2 - 13408758k - 857391722. -2(k - 2651)2(k + 61) Factor -s*2/3 - 269768s - 54581080368. -(s + 404652)2/3 Suppose -z5 + 793z4 - 150346z*3 - 2714862z*2 - 14807205z - 24111675 = 0. What is z? -7, -3, 405 Factor -24v2/5 - 3002v/5 - 50. -2(v + 125)(12v + 1)/5 Factor 3s*2 + 16692s - 116991. 3(s - 7)(s + 5571) Suppose -25a5/2 - 3565a*4/2 - 26760a*3 - 77860a*2 - 46360a + 32760 = 0. What is a? -126, -13, -2, 2/5 Let 86d4/11 - 78d*3/11 - 180d*2/11 - 16d/11 = 0. Wh	{ "pile_set_name": "DM Mathematics" }
r(c) = -255c2 + c + 1. Let f(g) = 511g*2 - 3g - 1. Let u(w) = -6f(w) - 13r(w). Let l be u(2). Let q = l - 1559. Round q to the nearest one hundred. -600 Let l = -2176 + 3686. Suppose -5i - p + 3p + l = 0, 0 = 5i + p - 1510. Round i to the nearest 10. 300 Let l be 1640/(-15)61250. Round l to the nearest 100000. -800000 Let i = 643.859 - -0.141. Let r = -643.8532 + i. Round r to two dps. 0.15 Let r = 157.6252 - -0.4548. What is r rounded to zero decimal places? 158 Let b = 1062 - 1063.449. Let k = b - 0.228. What is k rounded to 1 decimal place? -1.7 Let l = 8177004712.00000252 - 8177004950. Let b = l + 238. What is b rounded to six dps? 0.000003 Let h = -6220.989192 + 6221. Round h to 4 dps. 0.0108 Let r = 155.45 + -499. Round r to the nearest 10. -340 Let s = 29771.8847 + -29772. What is s rounded to 1 dp? -0.1 Let q = 141662.0000089389 - 141662. What is q rounded to 7 dps? 0.0000089 Let c = -599.82 + -26.88. Round c to the nearest 10. -630 Let g = 109.309506 + -103.39433829. Let v = g + -0.01467371. Let f = v + -5.9. What is f rounded to 4 dps? 0.0005 Let v = -141465544 - -13395544. Round v to the nearest one million. -128000000 Let f = -7284 - -7131.523. Let y = -154.5 - f. What is y rounded to 2 dps? -2.02 Let r(i) = -2i*2 - 20i - 28. Let o be r(-8). Let b be 143298 + o + (6 - 4) + -4. What is b rounded to the nearest ten thousand? 140000 Suppose -312858 = 22r - 24r - 1451058. Round r to the nearest 1000000. -1000000 Let w = -4.1 - -1. Let i = -5.2 - w. Let f = i - -2.100011. What is f rounded to five decimal places? 0.00001 Suppose 2q - 412 = -4i, 271 = 2q - 4i - 117. Let x be (-57 + 251957)/(0 - 2/q). What is x rounded to the nearest one million? -25000000 Let k(x) = -1209796x - 6928. Let o be k(7). What is o rounded to the nearest 1000000? -8000000 Let p = -32446905016.99999337 - -32446905328. Let j = 590.8 - 279.8. Let m = p - j. What is m rounded to 7 dps? 0.0000066 Suppose g = 2b - 3383403, -2g = -5b - 402513 + 8861019. What is b rounded to the nearest 100000? 1700000 Let a = 2113.18897157 + -2113.19. What is a rounded to 5 decimal places? -0.00103 Let u = -0.037667 - -5335.137667. Round u to the nearest 100. 5300 Let i = 98 + -86. Let k be (-6)/i-61 - -1. Suppose 2z = -2l + 9138, -2z - kl + 1251 = -7885. What is z rounded to the nearest one hundred? 4600 Let p = 4173 + -9511. What is p rounded to the nearest one hundred? -5300 Let i = 64 + -56. Suppose 3 = 9x - ix. Suppose 1763 = 4c + xa, -3c = -c + 5a - 885. Round c to the nearest 100. 400 Let r = -0.05 - -105.05. Let f = r - 105.0275. What is f rounded to three dps? -0.028 Let i = -1569.61 + 1576. Let z = 1299023.687200723 - 1299030.0772. Let f = z + i. Round f to seven dps. 0.0000007 Let w = -1.2923 - -1.2922970088. What is w rounded to 7 decimal places? -0.000003 Let h(q) = -32385167q + 668. Let g be h(4). What is g rounded to the nearest one million? -130000000 Let s(b) = -749b*3 + 8b*2 + 17b + 14. Let j be s(-14). Round j to the nearest ten thousand. 2060000 Let g be (-1)/((-4)/28) - (209510 + 5). What is g rounded to the nearest one hundred? -20900 Let w = -4381474 - -4381019.1286. Let z = 455 + w. What is z rounded to 2 decimal places? 0.13 Let t(r) = -r2 - 5r + 41780172. Let b be t(0). Let m = 24680172 - b. Round m to the nearest 1000000. -17000000 Let m = -450 + 938. Let q = -521.1 + m. What is q rounded to the nearest ten? -30 Let b = -793177 - -4977377. Round b to the nearest 1000000. 4000000 Let n(p) be the first derivative of -157p3/3 + 5p*2/2 + 22p + 42. Let r be n(9). Round r to the nearest one thousand. -13000 Let i = 0.511 + -1.929. Let z = 7.248 + i. What is z rounded to the nearest integer? 6 Let l = -1060 + 966. Let d = 306557.41930089 - 306651.4193. Let z = l - d. Round z to seven decimal places. -0.0000009 Let y = 8875.9995961 - 8876. Round y to five dps. -0.0004 Let o = 3288719758 - 3287099147.2121. Let z = 1620446.78789929 - o. Let u = z + 164. Round u to 6 decimal places. -0.000001 Suppose -14b = 68 - 96. Suppose 363991 = bi - 3m, -36m = 3i - 38m - 545994. What is i rounded to the nearest ten thousand? 180000 Let w = 5.1 - 1103.1. Let k = w - -1097.996681. What is k rounded to four dps? -0.0033 Let a = -21.5218136 - -0.0307136. What is a rounded to 1 dp? -21.5 Suppose 4h + 89o - 84o - 297099965 = 0, 0 = -2h + 2o + 148550014. Round h to the nearest one hundred thousand. 74300000 Let t = -5.23 - -5.2. Let f = -0.28 + t. Let y = f - -0.35. Round y to 2 dps. 0.04 Let b(t) = 3t - 25. Let c be b(10). Suppose ck - k = 80. Suppose -k = 3x + 169. Round x to the nearest 10. -60 Let g = 3.4 - 3.78. Let r = -20.82 + g. Let m = 21.1999847 + r. What is m rounded to six decimal places? -0.000015 Suppose -m + 4 = 0, -2b + 4m - 16 = -0m. Suppose bu - 2u = 2n - 73799996, 2u = -4. Round n to the nearest 1000000. 37000000 Suppose 16n - 119 = -n. Let j(v) = 9129v + 97. Let c be j(n). What is c rounded to the nearest ten thousand? 60000 Let t = -3 - -9. Suppose tp = 2p + 140400012. Let k be 1 + (-6 + 3 - 1) + p. Round k to the nearest one million. 35000000 Let v = 0.488 - -0.284. Let u = v + -0.739. What is u rounded to 2 decimal places? 0.03 Let p = -3853 - -3852.94665. What is p rounded to 2 dps? -0.05 Let o = -37827.0086301 - -37827. Round o to 3 decimal places. -0.009 Let w = -511 - -523. Suppose -4i - 1930803 = -3y, -wi + 7i - 2y = 2413498. What is i rounded to the nearest 10000? -480000 Suppose -2h + 639 = -5b + 3564, -4b - 5h = -2340. Let s = b - 487. Round s to the nearest integer. 98 Let a = 338 + -322. Let q(y) = -10901y + 16. Let h be q(a). What is h rounded to the nearest ten thousand? -170000 Suppose -2r = -l + 11740, 9l + r - 46996 = 5l. Round l to the nearest 100. 11700 Let i = 242.43 - 241.0819. Let q = i + -0.1911. Let z = 54.143 + q. Round z to the nearest ten. 60 Suppose -259k + 274k + 86100 = 0. Round k to the nearest ten thousand. -10000 Let o = 438.999966944 + -439. What is o rounded to seven dps? -0.0000331 Let n = -8612.9999996947 + 8613. Round n to 7 dps. 0.0000003 Let c = 888.8632 - -0.1368. Let m = c - 888.9258. What is m rounded to three dps? 0.074 Suppose -39x + 2209840 = -16x. Suppose 0 = 22o - 30o - x. What is o rounded to the nearest one thousand? -12000 Let j = 116 - 116.448. Let k = 20.652 - j. Let d = 12.2 - k. What is d rounded to the nearest integer? -9 Let v = 2 - -13. Suppose -2x - v = -19. Suppose -i - xi = 1200. Round i to the nearest one thousand. 0 Let g = -0.0555 + 0.1512. Let v = -0.10019 + g. What is v rounded to three dps? -0.004 Let n = 325 - 456. Let g = n + 26. Let s = -105.0086 - g. Round s to 3 decimal places. -0.009 Let g = 3.722 + -1.841. Let v = g - 0.231. Round v to one dp. 1.7 Let b = -6.7 + 0.5. Let t = b + -2. Let f = 8.1999672 + t. What is f rounded to six dps? -0.000033 Let l be 39428012/2 - (135/20 - (-6)/(-8)). What is l rounded to the nearest one million? 20000000 Let o(m) = -36m2 - 42m + 79. Let k be o(27). Let l be (-2)/14 + 1k/7. What is l rounded to the nearest 10000? 0 Let j = 114656.851342 - 114657. What is j rounded to three decimal places? -0.149 Let a(o) = 3149o*2 + 303o - 10. Let c be a(3). What is c rounded to the nearest one hundred? 29200 Let z = -0.365 - -0.777. Let k = z - 1.64. Round k to 2 dps. -1.23 Let a(c) = c*2 - 19c + 37. Let r be a(17). Suppose 0 = -3j - rg + 2 - 221, -j = -g + 73. Round j to the nearest 100. -100 Let x = 11818322.6999965 + -11818498.7. Let r = 176 + x. What is r rounded to five dps? 0 Let k be (-8)/(-6)(-39)/(-26). Suppose h = 2o - 228404, -2o + 67250 = -kh - 161158. Round o to the nearest ten thousand. 110000 Let n = 7.926 - 7.2467. Let x = 2108.68 + -2108. Let r = x - n. What is r rounded to four decimal places? 0.0007 Let z = 108 + -99.25. Let v = -66.65 - z. What is v rounded to the nearest 10? -80 Let p be 7/105-1059-145. Round p to the nearest one thousand. 10000 Let a = 7504 - 7623.67. Let m = a - -2.67. Let f = m - -116.928. What is f rounded to 2 dps? -0.07 Let f = -204.36 + 213. Let j = -13.79 - f. What is j rounded to the nearest 10? -20 Let b = -129.1133933 + 142.113392. Let a = 18 + -5. Let z = b - a. What is z rounded to seven dps? -0.0000013	{ "pile_set_name": "DM Mathematics" }
-3, 316, 6, 4, -7. -7, -3, 4, 6, 316 Put 0.01, -1/31, -5, 1.16, 0.3 in ascending order. -5, -1/31, 0.01, 0.3, 1.16 Put -12726, -3, 0, -1 in decreasing order. 0, -1, -3, -12726 Sort -4/3, 0.1, -856, -3, 2, 0.06 in ascending order. -856, -3, -4/3, 0.06, 0.1, 2 Sort 2, -8, -1593, 4 in increasing order. -1593, -8, 2, 4 Sort -13, 2, 0.4, 621. -13, 0.4, 2, 621 Sort 19, -2.3, 70, -1, -2/17 in decreasing order. 70, 19, -2/17, -1, -2.3 Sort -5, 3, 1, 25, 15, -10 in descending order. 25, 15, 3, 1, -5, -10 Put -1/1274, -2, 2/47, 4 in decreasing order. 4, 2/47, -1/1274, -2 Sort -59, 0, -5, 164, -2 in decreasing order. 164, 0, -2, -5, -59 Put 10, -0.4, 11, 2, 1 in increasing order. -0.4, 1, 2, 10, 11 Sort -1355, 0.18, -10/9 in ascending order. -1355, -10/9, 0.18 Put 2/3, -0.3, 23, -1/6, 2/11 in decreasing order. 23, 2/3, 2/11, -1/6, -0.3 Sort -1, -7, -0.29, -0.2, -1.3 in descending order. -0.2, -0.29, -1, -1.3, -7 Sort -2, 154636, 2, 4 in ascending order. -2, 2, 4, 154636 Sort 138, -0.3, -1, -0.1, 26, -1/4 in descending order. 138, 26, -0.1, -1/4, -0.3, -1 Sort -32, 821, 0 in descending order. 821, 0, -32 Put 0.3, -2, 33.47, 0.2, -3, 2 in descending order. 33.47, 2, 0.3, 0.2, -2, -3 Put 0, 4, 1, 248, -1 in increasing order. -1, 0, 1, 4, 248 Put 0.8, 0.1, 1/26, 0.7, 3 in decreasing order. 3, 0.8, 0.7, 0.1, 1/26 Put -3, 3, 168054 in ascending order. -3, 3, 168054 Sort 1052, -2, 2, 3, -138. -138, -2, 2, 3, 1052 Sort -2/135, -2/13, 2, 7/2, -2/11 in decreasing order. 7/2, 2, -2/135, -2/13, -2/11 Sort 0.0238, -1, 0.6, -4/5, -0.3 in decreasing order. 0.6, 0.0238, -0.3, -4/5, -1 Sort 2, -1, 4, 29, -13. -13, -1, 2, 4, 29 Sort 5, -4, 1, -20, -5, 2 in descending order. 5, 2, 1, -4, -5, -20 Put 2826/5, 1/2, -3/8, 2/5 in decreasing order. 2826/5, 1/2, 2/5, -3/8 Put 6197, 3/2, -1/2, -5 in decreasing order. 6197, 3/2, -1/2, -5 Sort -774, -8, 5. -774, -8, 5 Put -5, -1, 1, 6, 0, 24 in descending order. 24, 6, 1, 0, -1, -5 Sort -5, -2/9, 28, -0.25. -5, -0.25, -2/9, 28 Put -0.55, 4, -294 in descending order. 4, -0.55, -294 Put -1, -51, 15, 4, 0.3, -0.5 in increasing order. -51, -1, -0.5, 0.3, 4, 15 Put 61, -1, 535 in descending order. 535, 61, -1 Sort -16, -4, 1, 1869 in decreasing order. 1869, 1, -4, -16 Sort 120401, 4, 0 in decreasing order. 120401, 4, 0 Sort 5/2, 0.5, -5/1687, -0.14, 2 in ascending order. -0.14, -5/1687, 0.5, 2, 5/2 Put 41, 0, -6846 in decreasing order. 41, 0, -6846 Put 32, 3/5, -2/13, 23, 0.046, 0.1 in descending order. 32, 23, 3/5, 0.1, 0.046, -2/13 Put 0.5, -2, 782, 5/4, -2/3 in increasing order. -2, -2/3, 0.5, 5/4, 782 Put -10, -4, 1998, 1, -1 in descending order. 1998, 1, -1, -4, -10 Put -1, 5, 11, 34, 173, -4 in increasing order. -4, -1, 5, 11, 34, 173 Sort -5, 2187, -3. -5, -3, 2187 Sort 1881.5, -0.2, 0, -4 in ascending order. -4, -0.2, 0, 1881.5 Put -11, -1/89, 24/23, -4 in increasing order. -11, -4, -1/89, 24/23 Put -3, 81.1, 1/8, 3 in increasing order. -3, 1/8, 3, 81.1 Sort -36/769, 3/7, -0.2. -0.2, -36/769, 3/7 Sort -35, 40, 12 in descending order. 40, 12, -35 Sort -471, 0, -35. -471, -35, 0 Put -2, -29, -36, 2 in descending order. 2, -2, -29, -36 Sort 0, 39, -2, -1/4, -0.3, -5 in decreasing order. 39, 0, -1/4, -0.3, -2, -5 Sort 0, 2/7, -35, 1 in decreasing order. 1, 2/7, 0, -35 Put 0, 16066, 4 in decreasing order. 16066, 4, 0 Sort -12, 443, 270. -12, 270, 443 Sort -1, -1159, 3, -33 in decreasing order. 3, -1, -33, -1159 Sort -6, -11/2, -20, 4, 5 in descending order. 5, 4, -11/2, -6, -20 Sort 1/5, 390, -1/5, 2, 3 in decreasing order. 390, 3, 2, 1/5, -1/5 Put 4, -3, -75, -56 in descending order. 4, -3, -56, -75 Sort 4, 5, 0, 1, -88 in descending order. 5, 4, 1, 0, -88 Put -17, 82, -6, -21, 5, -5 in descending order. 82, 5, -5, -6, -17, -21 Put 10, 33, 1, 11 in decreasing order. 33, 11, 10, 1 Sort -0.4, -0.09, 17, 1/7 in increasing order. -0.4, -0.09, 1/7, 17 Sort -1, -195, 65/4 in descending order. 65/4, -1, -195 Put 1, 3, -152, -5, -14, -3 in ascending order. -152, -14, -5, -3, 1, 3 Put 29, 3, 1, 43 in decreasing order. 43, 29, 3, 1 Sort 78, -4, -69117 in decreasing order. 78, -4, -69117 Sort 10, -16, 17, -1, 2, -7 in ascending order. -16, -7, -1, 2, 10, 17 Put -32, -4, 1, -80, -1, 4 in ascending order. -80, -32, -4, -1, 1, 4 Put 81, 3/8, 127, 0.3 in descending order. 127, 81, 3/8, 0.3 Sort -4, -3, 0.323, -1, -0.5, 1. -4, -3, -1, -0.5, 0.323, 1 Sort -0.23, 0.2, -1, 0.4, -1.2. -1.2, -1, -0.23, 0.2, 0.4 Put 0.4, 0, -50, 13, 41, -2/7 in decreasing order. 41, 13, 0.4, 0, -2/7, -50 Put -3, -0.11, 4, 5, -0.059, -1/2 in descending order. 5, 4, -0.059, -0.11, -1/2, -3 Sort -0.1, -0.11, -5, 7, 82. -5, -0.11, -0.1, 7, 82 Sort -2, 204, 4, -3, 2, 5 in descending order. 204, 5, 4, 2, -2, -3 Put -0.4, 106/7, -24 in decreasing order. 106/7, -0.4, -24 Sort 210, -3, 28, 3 in descending order. 210, 28, 3, -3 Sort 0.2, 0.4, 1/2, 8/3, -3/100. -3/100, 0.2, 0.4, 1/2, 8/3 Sort 21, -95, 0, 65, -5 in decreasing order. 65, 21, 0, -5, -95 Sort 0.1, -4, 0.13, 1/4, -0.04, -18 in increasing order. -18, -4, -0.04, 0.1, 0.13, 1/4 Sort -5, -1/2, 0.2, -110, 4. -110, -5, -1/2, 0.2, 4 Put -7/5, -9, 49 in decreasing order. 49, -7/5, -9 Sort 2/11, -432/11, 2, 3, -0.36. -432/11, -0.36, 2/11, 2, 3 Sort -9, 85, 2, 1, -5, -45 in ascending order. -45, -9, -5, 1, 2, 85 Put 0, 5, 2, 11, 245 in decreasing order. 245, 11, 5, 2, 0 Put 3, -5, -345, -28 in decreasing order. 3, -5, -28, -345 Sort 1/30, 4/5, 1/5. 1/30, 1/5, 4/5 Sort 4, 2, -3, -23, -76 in increasing order. -76, -23, -3, 2, 4 Put 0.9, 21, 11.64, -1 in descending order. 21, 11.64, 0.9, -1 Put 6, 7, -1, 0.8 in decreasing order. 7, 6, 0.8, -1 Sort 11, -20326, 2 in increasing order. -20326, 2, 11 Sort -4, 4, 1, 125, -7. -7, -4, 1, 4, 125 Sort 25/4, -2/9, -3, -0.27, -2/39 in decreasing order. 25/4, -2/39, -2/9, -0.27, -3 Put 3, 0, 35856 in decreasing order. 35856, 3, 0 Put -473, -4, 1, -2, -16 in ascending order. -473, -16, -4, -2, 1 Sort -5, -1, 7, 37, -2, 5 in decreasing order. 37, 7, 5, -1, -2, -5 Sort -4, 5, -1/3, -33. -33, -4, -1/3, 5 Sort 4, -2, 5, 896 in decreasing order. 896, 5, 4, -2 Put -22318, -4, -139 in increasing order. -22318, -139, -4 Put -303, 4342, -1 in increasing order. -303, -1, 4342 Sort 5, -5, 3, 116, 2, -2. -5, -2, 2, 3, 5, 116 Put 1, 1310, 2/3 in decreasing order. 1310, 1, 2/3 Sort 0, -5/2, -2/9, -31 in descending order. 0, -2/9, -5/2, -31 Put 4, 14/13, 5/4, 59 in decreasing order. 59, 4, 5/4, 14/13 Sort -5, 0, 34, 1, 47, 3. -5, 0, 1, 3, 34, 47 Sort -5, 5, 0.5, -0.088, -17. -17, -5, -0.088, 0.5, 5 Put 15, 1/2, -3/4, 4, 1/11, 193 in descending order. 193, 15, 4, 1/2, 1/11, -3/4 Sort 1/2, 1/33, -0.04, 1/16, -4. -4, -0.04, 1/33, 1/16, 1/2 Sort -1, -3, 4, -29, -130 in increasing order. -130, -29, -3, -1, 4 Sort 1/5, 46, 2188. 1/5, 46, 2188 Put -1, 2, 19, -5, 1 in descending order. 19, 2, 1, -1, -5 Sort -3/7, 4488, -1/9 in ascending order. -3/7, -1/9, 4488 Sort -4, 28, 83, -5, -2 in descending order. 83, 28, -2, -4, -5 Put -0.3, -0.1, 2, 102, -7 in descending order. 102, 2, -0.1, -0.3, -7 Sort -3/4, 0.24, -11/5, 3/7 in decreasing order. 3/7, 0.24, -3/4, -11/5 Put -0.3, 1, 3, -0.1624, -2/5 in ascending order. -2/5, -0.3, -0.1624, 1, 3 Sort 4, 233, -54 in ascending order. -54, 4, 233 Sort -5, -21, -3, -1, -38 in ascending order. -38, -21, -5, -3, -1 Sort -0.2, 3, 1/4, -18, -5/2 in increasing order. -18, -5/2, -0.2, 1/4, 3 Sort 67/90, 0, -0.3, 0.04. -0.3, 0, 0.04, 67/90 Put -1, 3, -147, -54, -6 in descending order. 3, -1, -6, -54, -147 Put -1/2, -0.4, -6, -5, 66 in ascending order. -6, -5, -1/2, -0.4, 66 Sort -0.00261, -1/6, -6 in descending order. -0.00261, -1/6, -6 Sort 13, -1/5, 6, -0.5, 0.042. -0.5, -1/5, 0.042, 6, 13 Sort -2/11, -1/17, 1, 1/2, 2/9, -2 in descending order. 1, 1/2, 2/9, -1/17, -2/11, -2 Put -4, 5, -400, 1, 4 in descending order. 5, 4, 1, -4, -400 Sort 10, -3, 37, 3, 1, -5. -5, -3, 1, 3, 10, 37 Put 4, 2/11, 0.325 in descending order. 4, 0.325, 2/11 Sort -61, 0, -79, 1 in ascending order. -79, -61, 0, 1 Sort -380949, -2, 4 in decreasing order. 4, -2, -380949 Sort 0.4, 4, 6/17, -86. -86, 6/17, 0.4, 4 Sort 0.02, -11177, -0.4, 1 in increasing order. -11177, -0.4, 0.02, 1 Sort -4, -0.4, -69629 in descending order. -0.4, -4, -69629 Put 256, 0, 7 in increasing order. 0, 7, 256 Sort -303, 5, -3, 9, -11	{ "pile_set_name": "DM Mathematics" }
j - 861. Find the common denominator of d and 65/9. 18 Let o = 15070 + -15068. What is the least common multiple of 2620 and o? 2620 Find the common denominator of -55/552 and (32/42)/((837/(-1395))/((-14)/(-5))). 1656 Suppose -9h - 4 + 31 = 0. Suppose 3p = -d + 82, -3p - 225 = -hd - 5p. Calculate the common denominator of 67/8 and d/(-6) - (-12)/(-48). 24 Let o(h) = 2h*3 - 5h*2 - 13h + 3. Let s be o(5). Calculate the smallest common multiple of (-12)/27 - (-217)/s and 1. 3 Suppose 122d - 145d + 4893 = -857. What is the lowest common multiple of d and 150? 750 Suppose -217u + 221u = 2d + 2980, 2978 = 4u - d. What is the least common multiple of u and 1488? 1488 Let u = -19802/49 - -3623919/9016. Let d = u + 30/23. What is the common denominator of -59/171 and d? 1368 Let t be (2635/51)/(2/(-3) + 1). Suppose -5 - t = 4i. Find the common denominator of (44/28)/(i/(-126)) and 31/12. 60 Let l = -8931354184/6421 + 1390960. What is the common denominator of l and 4/11? 70631 Suppose 2u - 6u + 4 = -2k, -4u = 4. Let g be 2/(-1270)3/k. Let b = g + 5777/1270. Find the common denominator of 7/6 and b. 60 Let p = -795 + 817. Calculate the common denominator of -23/344 and (-12 + p)(34/8)/1. 344 Let y(w) = -24 - 37 + 10 - 13w + w*2 - 9 + 0w*2. Suppose -5i + 0i = -320. What is the smallest common multiple of y(17) and i? 64 Let n = -4289150459/1998 - -2146722. What is the common denominator of n and 49/1776? 15984 Suppose -2m - 2m + 4s = -52, -3s = -m + 9. Let x(a) = -2a*3 + 29a*2 + 19a. What is the least common multiple of x(m) and 36? 180 Let d be -2 - (-121)/(-132)(-99)/138. Let k = -28/23 - d. What is the common denominator of k and -65/172? 344 Suppose 0 = -2v + 4v + 2s - 22, 3s = 2v + 3. Suppose 98 = va - 184. Calculate the lowest common multiple of a and 9. 423 Let t be (48/36)/(8/18). Let c be 0 - (t + -1 + -24). What is the common denominator of -119/30 and c/62/(-10)? 30 Let q(c) = 3c2 + 584c - 1773. What is the least common multiple of 8/(2/(-2) - -2) and q(3)? 24 Let a(j) = -42j - 28. Let k be a(-2). Calculate the common denominator of 363/432k/42 and -67/108. 108 Suppose 44o = x + 48o - 278, 898 = 3x - 4o. Calculate the lowest common multiple of 45 and x. 4410 Let m = -5 - -13. Suppose 0 = -4r - 0r + m. Suppose -v + 9 = -1. Calculate the least common multiple of v and r. 10 Let s = -58 + 66. Suppose sy = 532 - 196. Suppose 0 = 4x - 20, -2z + 19 = 5x - 2x. Calculate the least common multiple of y and z. 42 Suppose o = 11o + 70. What is the common denominator of 79/60 and o(-5)/(-180)291/21? 180 Suppose 37y = 32y + 5a + 2180, 1764 = 4y + a. What is the least common multiple of 341 and y? 13640 Let l be (-1 - -36)/(9/132678). Let r = l - 6701980/13. Let d = 171253/390 - r. Find the common denominator of d and 47/30. 30 Let b = -688/5 + 2369/15. Suppose j + 4p = 14, 3p - 29 = 4j - 9. What is the common denominator of b and ((-247)/j + -1)(-164)/820? 6 Suppose 4h + 314 - 30 = 0. Let v = -35 - h. Suppose r + v = -m + 4m, 0 = -m - 5r + 12. Calculate the smallest common multiple of m and 22. 132 Let t be 1074/6(7/(-4) - -3). Let n = 228 - t. Find the common denominator of n and ((-26)/(-48))/((-1)/(-3)). 8 Let u = 1/437 + -20981/2185. Calculate the common denominator of -137/60 and u. 60 Let i = -65/32 - -1147/352. Let n = i - -1547/66. Find the common denominator of n and -61/30. 30 Suppose d + 4 = 9. Let k be 7 - (20/5 - -1). What is the least common multiple of d and (-1 + k)/(-4(-8)/2848)? 445 Let l = 28928619/624602180 - -8/227957. What is the common denominator of l and 37/2192? 10960 Calculate the common denominator of 212/6198/(-264)2/35 and -4((-15)/(-84) + 1). 35 Let s = -4253879/112648738 + 8/83197. What is the common denominator of s and -31/10? 6770 Let s = -696 + 749. Suppose 0n - 93 = 3n. Let c = s + n. Calculate the least common multiple of 20 and c. 220 Let o = 47602/113145 - -2/5955. Find the common denominator of o and -31/384. 7296 Let x = 2593 - 15509/6. Let b = -515/2 + 211. What is the common denominator of b and x? 6 Suppose 5t - 7259 = 6f, 2f + 571 = 4t - 5239. Calculate the lowest common multiple of 1 and t. 1453 Suppose -15u + 540 = -540. Calculate the least common multiple of u and 72. 72 Let m = 253 - 255. Calculate the lowest common multiple of 3/(-6) - 41/m and 14. 140 Let n = 393457/60 + -4209/20. Let m = -6366 + n. Let y = -2675 - -15995/6. What is the common denominator of y and m? 6 Let x(i) = 5i*2 - 323i + 226. What is the least common multiple of 27 and x(65)? 9612 Let m = 671 - 4085/6. Find the common denominator of m and 5(-1)/4(-26 - 30439/(-915)). 12 Suppose n - 2608 = 9n. Let g = 418 + n. What is the smallest common multiple of g and 4? 92 Let m = 30551644197/92 + -332079379. Let u = m - 3710. Find the common denominator of 49/8 and u. 184 Calculate the common denominator of 9/1 - (54243/(-108))/(-49) and 0/5 - (-31)/12. 12 Let p = 4405051/24 - 183542. Let g = 4961277623/3948 + -8796692/7. Let o = g - -138/47. Find the common denominator of p and o. 24 Suppose 12 = 4a, -2g + 22 = a - 923. What is the lowest common multiple of 15 and g? 2355 Let l(s) = -43s*2 + 3013s - 144. Calculate the least common multiple of 220 and l(70). 660 Let b be -5 + (-1 - 1089/21) + 5. Let c = b + 845/14. Find the common denominator of c and 8. 2 Let d(b) = -2b3 + b2 + 1. Let i be d(0). Calculate the common denominator of -85/21 and i/3(-125)/(-65). 273 Let u = -46573 - -67321. Let i = u - 5477437/264. Find the common denominator of i and 97/24. 264 Let c = -63 - -67. Let v(x) = x + 8. Suppose 3j + 3 = 3g, 4j + g = -j + 1. What is the lowest common multiple of v(j) and c? 8 Let f = -27222 + 27278. Calculate the lowest common multiple of f and 12. 168 Let l(y) = -y3 + 8y*2 + 7y + 22. Let s be l(9). What is the smallest common multiple of 152 and -14710/(-75) - s/(-10)? 760 Let a be ((-16044)/126)/(1/(1-3)). Suppose -a = -m - n - 3n, 1448 = 4m - 4n. Calculate the smallest common multiple of 20 and m. 3660 Let d be (16/(-3))/(-2)(8 - -106). Let a = -156 + d. What is the lowest common multiple of a and 14? 1036 Suppose 5v + 185 = 5r, -13 = v + 2r + 9. Let o be (v/6)/(6/36). Calculate the common denominator of ((-36)/o)/((-3)/(-36)) and 25/12. 12 Suppose -1374 - 2480 - 1726 = -155k. Calculate the smallest common multiple of 396 and k. 396 Let p = -377 + 737. Let y(c) = 3c + 15. Calculate the common denominator of y(10) and (-15)/2(-306)/p. 8 Let i(z) = 591z3 - 30z*2 + 55z + 8. Calculate the lowest common multiple of 6 and i(2). 14178 Let f be -63/(-24)32626/15. Suppose -4z + 9738 = -10z. Let c = z + f. Find the common denominator of 81/14 and c. 70 Let l(r) = -7r3 + 2r*2 + 5r - 2. Suppose 15774 = -107b + 16202. What is the least common multiple of l(-5) and b? 1796 Suppose 10h + 458 - 2258 = 0. Let s = -135 + h. Calculate the smallest common multiple of 27 and s. 135 Find the common denominator of 490/(-36) - (180 - 195) and -167/1740. 5220 Let h = -501 - -1822. Let q = h + -1325. Let g = 27245/8 - 3396. What is the common denominator of q and g? 8 Let k(w) = w*2 + w + 8. Let g be k(8). Let b = -76 + g. Suppose 17s + b = 21s. What is the lowest common multiple of 15 and s? 15 Find the common denominator of ((1617/1372)/(78/8))/((-2)/(-4)) and 55/13. 91 Suppose -5o + 340 = 5g, -2o + 141 = 4g - 125. Let s(f) = 4f*2 + 6f - 39. Let q be s(0). Calculate the lowest common multiple of 36 and (-1254)/q - 10/g. 288 Suppose w - 17 = -2s + 18, -5w + 4s = -133. Suppose -5p = -141 - w. What is the least common multiple of p and (-5)/(-30) + (-238)/(-12)? 340 What is the common denominator of 91/114 and (12(-20)/(-11520))/(64/(-1164))? 14592 Calculate the common denominator of (0 - 74)(-11)/(-132) and ((152/14)/(-2))/(80/(-5)). 168 Let b be ((-2064)/270)/(2/1390). Let x = b + 5319. What is the common denominator of (-2)/3 - 188/78 and x? 117 Find the common denominator of 728/144 + (-4)/(-18) and (117/(-30))/((-18)/(-14)). 60 What is the least common multiple of 6435 and ((-192)/(-10) - (-42 + 36))/(8/1300)? 45045 Suppose 102h = 98*h - 156. Calculate the smallest common multiple of 34 and	{ "pile_set_name": "DM Mathematics" }
m kcckk. Give prob of picking 1 c and 2 k. 3/5 What is prob of picking 4 q when four letters picked without replacement from dzdqzzqqzqzzzrzqqqz? 35/3876 Two letters picked without replacement from {z: 5, h: 5, n: 3, o: 1, b: 5, a: 1}. What is prob of picking 1 o and 1 n? 3/190 Two letters picked without replacement from hwwhqnnwhhhqwhhnhhx. Give prob of picking 1 w and 1 x. 4/171 Two letters picked without replacement from gkkqyqlqgkgln. Give prob of picking 1 q and 1 g. 3/26 Two letters picked without replacement from giktktgr. Give prob of picking 1 r and 1 g. 1/14 Calculate prob of picking 1 a and 1 q when two letters picked without replacement from {p: 2, k: 1, q: 3, a: 4}. 4/15 Two letters picked without replacement from {r: 4, o: 5, s: 6}. What is prob of picking 2 s? 1/7 Two letters picked without replacement from {u: 8, b: 5}. Give prob of picking 1 b and 1 u. 20/39 Three letters picked without replacement from {h: 1, o: 10, g: 3, z: 1, j: 2, y: 2}. What is prob of picking 2 o and 1 h? 15/323 Two letters picked without replacement from txttqrttvttttt. Give prob of picking 1 t and 1 q. 10/91 Four letters picked without replacement from {i: 2, x: 6, f: 3, r: 1}. Give prob of picking 3 f and 1 x. 2/165 Calculate prob of picking 1 c and 1 a when two letters picked without replacement from jzacjnacznzz. 2/33 Three letters picked without replacement from {i: 1, c: 1, d: 2, m: 1, o: 2}. What is prob of picking 1 c, 1 o, and 1 m? 2/35 Two letters picked without replacement from eryryaereeyeeeeerree. Give prob of picking 1 e and 1 r. 11/38 Three letters picked without replacement from qxxbbqxxbxbxbbqxx. What is prob of picking 1 q, 1 x, and 1 b? 18/85 Calculate prob of picking 1 j, 1 b, and 2 s when four letters picked without replacement from zrbjssbj. 2/35 Four letters picked without replacement from {q: 4, r: 4, g: 2, p: 5}. Give prob of picking 1 g and 3 p. 4/273 Four letters picked without replacement from vvrosrh. Give prob of picking 2 r and 2 v. 1/35 Two letters picked without replacement from {x: 3}. Give prob of picking 2 x. 1 Four letters picked without replacement from {t: 4, j: 8, i: 2}. What is prob of picking 1 j and 3 t? 32/1001 What is prob of picking 1 b and 1 p when two letters picked without replacement from bpbpbbbbb? 7/18 What is prob of picking 3 s and 1 c when four letters picked without replacement from {a: 3, c: 2, s: 5}? 2/21 Two letters picked without replacement from depieedpded. What is prob of picking 1 i and 1 e? 4/55 Calculate prob of picking 3 k when three letters picked without replacement from {c: 9, k: 10}. 40/323 Two letters picked without replacement from {d: 2, w: 1, j: 1, l: 1}. What is prob of picking 1 j and 1 l? 1/10 What is prob of picking 1 k and 1 u when two letters picked without replacement from qfuquuffufffqkufqqu? 2/57 What is prob of picking 2 r and 1 o when three letters picked without replacement from {x: 3, v: 5, r: 3, m: 1, o: 1, i: 4}? 3/680 Four letters picked without replacement from {r: 4, q: 3, y: 1, n: 5}. Give prob of picking 3 y and 1 n. 0 Calculate prob of picking 1 z and 1 i when two letters picked without replacement from zzjzi. 3/10 Calculate prob of picking 1 c and 1 e when two letters picked without replacement from {n: 1, e: 1, w: 1, c: 2}. 1/5 Calculate prob of picking 3 s when three letters picked without replacement from sesessse. 5/28 What is prob of picking 1 v and 1 f when two letters picked without replacement from {c: 1, f: 3, v: 1}? 3/10 Three letters picked without replacement from {s: 1, n: 1, x: 7, k: 4, w: 2}. What is prob of picking 1 x and 2 w? 1/65 What is prob of picking 1 h and 1 q when two letters picked without replacement from qbhdd? 1/10 Three letters picked without replacement from {g: 7, u: 2, p: 11}. Give prob of picking 3 g. 7/228 Calculate prob of picking 1 s and 1 n when two letters picked without replacement from {c: 2, q: 1, n: 6, s: 3, w: 2}. 18/91 Calculate prob of picking 3 i and 1 t when four letters picked without replacement from titiitttttsttsii. 9/182 Calculate prob of picking 1 e, 1 i, and 1 b when three letters picked without replacement from bbbbebbabibbtbbab. 3/170 Four letters picked without replacement from dlalallz. Give prob of picking 3 a and 1 l. 0 Two letters picked without replacement from {g: 8, d: 2, c: 5, v: 1}. Give prob of picking 2 d. 1/120 Three letters picked without replacement from {n: 14, j: 4}. Give prob of picking 1 j and 2 n. 91/204 Three letters picked without replacement from effaexeeeeeexxjffeex. What is prob of picking 1 e, 1 a, and 1 j? 1/114 What is prob of picking 3 h and 1 v when four letters picked without replacement from bbbbhbhhvhbbbhhhbhh? 7/323 Four letters picked without replacement from btibbbdbbbndbi. Give prob of picking 1 i, 1 b, 1 t, and 1 d. 32/1001 What is prob of picking 3 m when three letters picked without replacement from raracfms? 0 Four letters picked without replacement from {c: 1, r: 1, h: 2, m: 1, a: 1, j: 2}. What is prob of picking 1 a, 1 m, and 2 j? 1/70 What is prob of picking 1 k, 1 w, and 1 l when three letters picked without replacement from lklzwzeezkllkzellz? 3/136 Three letters picked without replacement from {a: 1, e: 1, m: 2, h: 2}. What is prob of picking 1 h and 2 m? 1/10 Three letters picked without replacement from aazzaaaaaz. What is prob of picking 3 a? 7/24 Three letters picked without replacement from {m: 1, o: 18}. Give prob of picking 3 o. 16/19 Two letters picked without replacement from {s: 1, z: 2, g: 1}. Give prob of picking 1 g and 1 s. 1/6 Calculate prob of picking 2 b when two letters picked without replacement from {c: 1, a: 1, b: 2, m: 2, s: 1, z: 1}. 1/28 Four letters picked without replacement from {o: 5}. Give prob of picking 4 o. 1 Two letters picked without replacement from {e: 1, r: 3, t: 4, s: 1, d: 2}. Give prob of picking 2 r. 3/55 Three letters picked without replacement from neenbebnbbbfebeb. Give prob of picking 1 e and 2 n. 3/112 What is prob of picking 1 g, 1 l, and 2 r when four letters picked without replacement from {g: 2, j: 4, h: 1, r: 9, l: 3}? 18/323 Four letters picked without replacement from ggggg. Give prob of picking 4 g. 1 Three letters picked without replacement from {y: 1, v: 17}. What is prob of picking 3 v? 5/6 Two letters picked without replacement from {g: 5, e: 8, y: 4}. Give prob of picking 2 y. 3/68 What is prob of picking 1 l, 1 b, and 1 q when three letters picked without replacement from {j: 4, l: 4, d: 3, b: 1, q: 1, y: 1}? 1/91 Two letters picked without replacement from {a: 11, g: 3}. What is prob of picking 2 a? 55/91 Three letters picked without replacement from gkppgikikpkpkpkkk. Give prob of picking 1 g and 2 p. 1/34 Calculate prob of picking 1 f, 2 x, and 1 n when four letters picked without replacement from xfnxhfxfflfnnnhnnhuu. 6/323 Calculate prob of picking 1 v and 3 t when four letters picked without replacement from vtctjvttkrkv. 4/165 Four letters picked without replacement from {s: 7, j: 3}. What is prob of picking 1 j and 3 s? 1/2 Two letters picked without replacement from {l: 4, c: 3, d: 10, w: 3}. Give prob of picking 2 w. 3/190 What is prob of picking 1 n and 3 y when four letters picked without replacement from {y: 11, n: 1}? 1/3 Calculate prob of picking 1 f and 1 z when two letters picked without replacement from fnz. 1/3 Calculate prob of picking 2 a and 1 m when three letters picked without replacement from {a: 13, m: 5}. 65/136 Calculate prob of picking 1 v and 1 i when two letters picked without replacement from yviidviodyvm. 3/22 Two letters picked without replacement from {s: 10, c: 4, y: 2}. Give prob of picking 2 y. 1/120 Four letters picked without replacement from {s: 4, u: 2, z: 3, d: 1}. What is prob of picking 2 z, 1 u, and 1 s? 4/35 Three letters picked without replacement from hbaxbbnnghxg. What is prob of picking 1 n, 1 g, and 1 b? 3/55 Calculate prob of picking 1 r and 1 s when two letters picked without replacement from {q: 5, s: 3, e: 4, m: 2, r: 5}. 5/57 Three letters picked without replacement from {h: 6, n: 4, o: 3, v: 1}. Give prob of picking 2 n and 1 h. 9/91 What is prob of picking 2 q when two letters picked without replacement from oqsvsq? 1/15 Calculate pr	{ "pile_set_name": "DM Mathematics" }
ive of 81qw*2 - 2qw - 4052w*2 + 1 wrt q. 81w*2 - 2w Find the second derivative of -100t3w*2 + 56t*3w + 2t3 - tw wrt w. -200t3 Differentiate 2bk2l*2 - bl*3 - 6bls - 16k2 + 4kl3s + 2kl*3 wrt b. 2k*2l2 - l3 - 6ls What is the third derivative of -21c4q + 2c3 - 41c*2q + 3c2 wrt c? -504cq + 12 Find the second derivative of -165o*4 - 2o*2z*3 + 4o - z*3 wrt o. -1980o*2 - 4z*3 Differentiate -12809v*2 + 14575 wrt v. -25618v What is the second derivative of 233o2 + 212o? 466 Find the third derivative of 194b6 - 2b*2 - 140b. 23280b3 Find the second derivative of -14786i*2 + 3i - 3216. -29572 What is the third derivative of -23d5o - d*3k2 + d3o3 + 2d*2k*2o*3 + 220dk2o + ko3 wrt d? -1380d*2o - 6k2 + 6o*3 Find the second derivative of 4g*4 - 131g*2 + 222g. 48g2 - 262 Differentiate k2l + 72k2y*3 + kly3 - 4l wrt l. k*2 + ky*3 - 4 Differentiate -3f*3s + 197f3 - 2f*2g - f*2 - 174fgs + 3f with respect to s. -3f*3 - 174fg What is the second derivative of -20c*2p2 - c2p - 117c*2 - 3cp2 wrt p? -40c*2 - 6c Find the third derivative of -19k3v*3 - 832k*3v*2 + 7k*2v*4 wrt v. -114k*3 + 168k*2v Differentiate -242k4 - 168 with respect to k. -968k*3 Find the second derivative of 8b*2o3 + b2 + 370bo*3 + 7b - 313o wrt o. 48b*2o + 2220bo What is the third derivative of 14p5 - 45p*4 + 166p*2 wrt p? 840p*2 - 1080p Differentiate -925u - 959. -925 Find the first derivative of 80a*2b - 2a2c - 16abc + 2a + 25b - 24c wrt c. -2a2 - 16ab - 24 What is the second derivative of ik*3l + 12ik*3p + 2ik*3 + ik*2l + 7ip*2 - 5k*3lp2 + k3p*2 + 2kp wrt p? 14i - 10k3l + 2k3 What is the third derivative of -4b*4x + 5b3px - 2b*3p - b*2px + 6b*2 - p - 4 wrt b? -96bx + 30px - 12p Find the second derivative of -5m2x*2 + 8m*2x - 288mx*2 wrt m. -10x*2 + 16x What is the first derivative of 2d3g*3 + 5d*2g*3 + 15d*2 - 49g*3 + 2g wrt d? 6d2g*3 + 10dg3 + 30d Differentiate -66gh*3 - 17gm3 - 7gm + 2h*3m - 6h3 with respect to m. -51gm2 - 7g + 2h3 What is the derivative of 14hjo + 3hj + 10ho + jo - 213o wrt h? 14jo + 3j + 10o Differentiate 1000h3 - 837 with respect to h. 3000h*2 What is the third derivative of -23m*5 - 15m4 - m3 + 3801m2? -1380m*2 - 360m - 6 Find the second derivative of 6350o3 + 11247o. 38100o Find the first derivative of h4p + 1145h2p3 - p3 - 4 wrt h. 4h3p + 2290hp3 What is the derivative of k3u2 - 31k*3 + 8k*2 + 76u*3 wrt u? 2k*3u + 228u2 Find the third derivative of -59f*2z*3 + 6f*2z - 18fz*3 - 3z*2 + 32z wrt z. -354f2 - 108f What is the third derivative of 2c4d + 2c4 + 33c*3d - 47c2d wrt c? 48cd + 48c + 198d What is the second derivative of 12b2dk2 + 6b*2dk - 3b*2d - 157b2k*2 - 3b*2k + 15b wrt k? 24b*2d - 314b2 Find the second derivative of 498p*4 + 315p wrt p. 5976p2 What is the derivative of 82o*2 - 29 wrt o? 164o Find the third derivative of 149f4 + 4f*3 - 1870f*2 wrt f. 3576f + 24 What is the third derivative of 3938r5 - 5139r*2? 236280r*2 What is the derivative of -8r*4 + 9rt2 + 113t*2 wrt r? -32r*3 + 9t*2 Find the first derivative of 3i*2r - ir2 + 3ir + 67r*2 - 2 wrt i. 6ir - r2 + 3r Differentiate 441iv + 80i - v wrt v. 441i - 1 Differentiate -5s3 + 53s*2 + 10684. -15s*2 + 106s What is the derivative of 9027l3 + 4841? 27081l*2 Find the second derivative of 5464h*3 - 7384h wrt h. 32784h Find the second derivative of -6bp3 + 7bp2z*2 + 2bpz*2 - 4bz - 6p*3z*2 - 2p*2z wrt z. 14bp*2 + 4bp - 12p*3 Find the third derivative of -124gj5 + 40gj2 - 2j*5 + 2j*2 wrt j. -7440gj2 - 120j*2 Differentiate -2u*2 + 39u - 111 wrt u. -4u + 39 Find the third derivative of 15520n*4 - 18n*2 - 6n + 10. 372480n Find the third derivative of 699x*4 + 672x*2. 16776x Differentiate 4238y3 - 1728 wrt y. 12714y*2 Find the third derivative of -2g*3n*4 - 12g*3n*3 - 8g*3n2 - g3 - 3g2n*3 - 5gn2 wrt n. -48g*3n - 72g3 - 18g2 What is the first derivative of -g2mo - 3g2o + 6g2 + 683gmo + 84g wrt m? -g2o + 683go What is the second derivative of -3wx*2z*3 + 1716wx2z*2 + 4wz + 8x*2 + 25z wrt z? -18wx*2z + 3432wx*2 Differentiate 717y + 352 wrt y. 717 Find the second derivative of -3jq*2s*2 - 2jq2 - j + 2qs2 + 94qs + 2s*2 wrt q. -6js2 - 4j What is the second derivative of -452j2k*3 - 2j*2k + 21jk*3 + 34 wrt j? -904k*3 - 4k What is the third derivative of -4789z4 + 3767z*2? -114936z Find the third derivative of 2440n4 - 1254n*2 wrt n. 58560n Differentiate -u*3y*2 - 2065u*3y + 464u3 + 2u with respect to y. -2u3y - 2065u3 What is the third derivative of -454q*3 - 1269q*2 wrt q? -2724 What is the second derivative of 2o*5 + 141o*3 - 2o - 108? 40o3 + 846o Find the third derivative of 2j5q*2 + 3653j*5q + 3j2q*2 + 283j*2 wrt j. 120j*2q*2 + 219180j*2q Differentiate -52u3y - 2u2y + 3uy*2 - 6859y*2 with respect to u. -156u*2y - 4uy + 3y2 What is the first derivative of 81s*4 - 169? 324s*3 Differentiate -289k*2 + 117. -578k Find the second derivative of -119d3s + 3d3 - d2s*2 + 501ds - d - 2s*2 wrt d. -714ds + 18d - 2s2 What is the first derivative of 2p*2 - 174p + 884? 4p - 174 Find the second derivative of 7n*5 - 175n*4 + 107n - 1. 140n3 - 2100n*2 What is the third derivative of 27v*6z2 - v5z3 - 4v*2z*3 - 11v*2z*2 wrt v? 3240v*3z*2 - 60v*2z*3 Find the first derivative of -ru + 117r - 40u - 1 wrt r. -u + 117 Find the second derivative of 598l5v + 12l2v - 957lv + 2 wrt l. 11960l3v + 24v Differentiate 586o*4 - 3050 with respect to o. 2344o*3 What is the first derivative of 25k*2y*2 - 3k*2y + 143k2 - ky*2 wrt y? 50k*2y - 3k2 - 2ky Differentiate -3f*4k*2 - 33fk3 + 86k*3 with respect to f. -12f*3k*2 - 33k*3 What is the second derivative of 514v*2 - 1568v wrt v? 1028 Find the third derivative of q*4x*3 - 327q*4x*2 + 167q*2x*2 - 2x*3 wrt q. 24qx3 - 7848qx2 Find the third derivative of fk*4 - 286fk2 - 264k*4 + 2k*2 wrt k. 24fk - 6336k Find the third derivative of -5p4 - 707p*3 + 40p*2 - p - 46. -120p - 4242 What is the derivative of 2g2uz + 3g*2 + 15guz - gz2 - 14u - 5z2 wrt g? 4guz + 6g + 15uz - z2 What is the third derivative of -452n*3 - 495n*2 wrt n? -2712 What is the derivative of 2336fj2 - 4258j*2 wrt f? 2336j*2 What is the first derivative of -2418b - 2539? -2418 Find the third derivative of -6h6 + 214h*3 - 8h*2 - 6 wrt h. -720h*3 + 1284 What is the derivative of 384j*2 + 86? 768j What is the second derivative of 530p3 + p - 221 wrt p? 3180p What is the third derivative of 34ix*4 + 14ix2 - 4i + 3x6 + x2 wrt x? 816ix + 360x*3 Find the second derivative of -2o*3 - 47o*2 + 1440o. -12o - 94 What is the first derivative of -75v4 - v2 - 27 wrt v? -300v3 - 2v Find the second derivative of 8777r2 - 77r + 45 wrt r. 17554 Find the second derivative of -j*3p*3 - 90j*3 + 7193jp5 + 79jp wrt p. -6j*3p + 143860jp*3 What is the second derivative of -374vw5 + vw - 168v wrt w? -7480vw3 Find the second derivative of -689c*3 + 4c*2 + 4210c. -4134c + 8 What is the derivative of 358v + 85? 358 What is the second derivative of -5ct*2 + 32ctu*3 + 2ctu*2 - 2ct - 124t*2u*3 + 2t*2u - 2t2 + tu*2 wrt t? -10c - 248u3 + 4u - 4 Find the first derivative of -2dz*2 - dz + 446d + 2z*2 + 8751 wrt d. -2z*2 - z + 446 Differentiate 2k*3q*4 - 129k*3q*3 + 789k*3 with respect to q. 8k*3q*3 - 387k**	{ "pile_set_name": "DM Mathematics" }
e product of 18833 and 534.5? 10066238.5 Calculate 10644241. 6442410 What is -72 times 1074.67? -77376.24 -6 times -3534.1232 21204.7392 -10 times -0.4102458 4.102458 Calculate -5.7305-0.3535. 2.02573175 Multiply 7881 and 12722. 100262082 0.2875282 * 10 2.875282 Calculate 0.1-8508839. -850883.9 -25179930 times 8 -201439440 Work out 8.76 -105739. -926273.64 2 times 19653805 39307610 Multiply -9150791 and -0.1. 915079.1 Product of -1094 and -3.2335. 3537.449 Work out 0.572 * -3991.27. -2283.00644 -0.22511 * -24527 5521.27297 -12578.47 * 983 -12364636.01 What is the product of -54 and -55941? 3020814 Work out 71054.8 * 6. 426328.8 What is 164366 times -35? -5752810 Product of -0.47 and 0.03316286. -0.0155865442 What is 0.2086 times -543.22? -113.315692 What is the product of -0.03464 and -505? 17.4932 What is the product of 2.77438 and -35? -97.1033 0.4 times 65.69039 26.276156 -52 * -442547 23012444 16319-253 -4128707 -10 times -322776 3227760 1791-6579 -11782989 What is the product of -16 and 438512? -7016192 -1.016613-0.99 1.00644687 -0.2 times 127125916 -25425183.2 Work out 1.4598 -0.0467. -0.06817266 Calculate -0.071.122666. -0.07858662 0.599-2.9765 -1.7829235 What is the product of 29.7 and 20018? 594534.6 Calculate -0.1222739.4. -22273.94 Calculate 6.18637358. 231096.588 27.2799 times -110 -3000.789 What is -3 times 2730.3159? -8190.9477 -2510 * -108785 273050350 Work out 40895.3 * 1.96. 80154.788 What is -5 times 0.075095877? -0.375479385 What is 417811 times -1870? -781306570 What is 1.6 times -2294.4291? -3671.08656 Calculate -1605131.36. -218297.68 Product of -0.1 and -17373090. 1737309 Calculate -13486.293. -3486.293 What is the product of 2 and 47133.807? 94267.614 Calculate -50.07901532. -0.3950766 Calculate -0.027904-379. 10.575616 Work out -3.1 * -509741. 1580197.1 What is the product of -949 and -1.469618? 1394.667482 -1.2 times -10154737 12185684.4 -3.354 * 180.2 -604.3908 -26 times -6063778 157658228 What is the product of 159509.6 and 18.5? 2950927.6 Multiply 18.0902 and 0.07. 1.266314 What is the product of -0.05 and 8.272902? -0.4136451 What is the product of -0.598 and -86499? 51726.402 Multiply 22.3 and -164037. -3658025.1 Multiply -35 and 23.3641. -817.7435 Work out 2101893 * -4. -8407572 2 times -55739.1 -111478.2 What is 0.07943 times -8583? -681.74769 What is 12199 times -254? -3098546 Calculate 0.1026608.721. 674.089542 Work out -3 -4468895. 13406685 -77486 times -3046 236022356 Calculate 19-39449308. -749536852 Multiply -2410 and -39.2. 94472 -0.2-96348959 19269791.8 Work out 1.993 * -156529. -311962.297 What is 289758 times 0.035? 10141.53 Calculate -869452-0.089. 77381.228 642036.3-3 -1926108.9 What is the product of 410 and 8.741? 3583.81 Multiply -1.026 and -0.027. 0.027702 Calculate 0.70480156. 4.228809 Multiply 11250.4 and -0.18. -2025.072 -28-4049.021 113372.588 Multiply 0.071 and -4.37189. -0.31040419 777436 * -6 -4664616 Product of -0.44 and 216175. -95117 Product of -0.2 and 201117189. -40223437.8 Product of -0.06005 and 963. -57.82815 37753-160 -6040480 Work out 24 -239.614. -5750.736 0.2597 times 87269 22663.7593 Work out -129.1 * 42.8. -5525.48 Calculate 78.348590.1. 7.834859 What is -2 times 2616506? -5233012 0.87 times 1502584 1307248.08 Work out -3.46728 3.17. -10.9912776 Product of 1976 and -48.5083. -95852.4008 Calculate -19.587.4. -1704.3 What is -8520.63 times 0.04? -340.8252 What is -172 times 358339? -61634308 37.47 299.9 11237.253 Work out 120 * -90985. -10918200 Work out -14374 * 0.10733. -1542.76142 Calculate 15319.142. 5319.142 Product of -15248.38 and 77. -1174125.26 82817.49 times -0.08 -6625.3992 3 times -24887660 -74662980 Calculate 102.5871315. 512.935655 What is 581 times 775.7? 450681.7 45 * -7300.2 -328509 -18.432 times -1447 26671.104 What is 53345353 times -22? -1173597766 Product of 7975 and -0.03061. -244.11475 What is the product of 6037 and 2662.1? 16071097.7 Work out 3.5236 * 1.255. 4.422118 Product of -29952 and 10.8. -323481.6 15 * -1785537 -26783055 Work out -0.04 * -8074730. 322989.2 What is the product of 6 and -684838? -4109028 Multiply 0.17993702 and 0.065. 0.0116959063 -1.4553 times 197 -286.6941 1162753 times -3.9 -4534736.7 Multiply 8 and -1845005. -14760040 Work out 0.1 * 22893837. 2289383.7 Product of 1149 and -0.0609. -69.9741 What is 12982.58 times -146? -1895456.68 What is the product of -931183396 and -0.3? 279355018.8 1 * 6120510 6120510 Calculate -0.13462422. -60114.86 What is the product of -17.4982 and -1337? 23395.0934 90612525 22653125 What is the product of -1007.5 and 9.621? -9693.1575 Work out 146794 * 149. 21872306 -4767 times -0.1781 849.0027 What is -3 times -1879.421? 5638.263 Work out 4 * 134080. 536320 266906118 times 3 800718354 What is -1.8406834 times -0.3? 0.55220502 Calculate -1090342420.5. -54517121 What is the product of 15.844 and -47.51? -752.74844 Calculate -4.250212.6. -210892.92 Calculate -116600.058411. -681.07226 36.379 times 1.9 69.1201 Calculate -369.75-0.0797. 29.469075 -534.811414 -2139.24564 Multiply -88 and 417183.5. -36712148 75.9 0.0093837 0.71222283 Multiply -7547058 and -0.09. 679235.22 Multiply -17956 and -6016. 108023296 What is the product of -27908452 and -0.3? 8372535.6 -1 times 84252555 -84252555 -114455 * 108.4 -12406922 -42266478-2 84532956 -1210690 142 -171917980 5-8151508 -40757540 Calculate -117947539. -17947539 Multiply -3.3 and -3677637. 12136202.1 9274215-0.4 -3709686 Product of 185.488 and -223. -41363.824 Multiply 8 and 0.004671. 0.037368 6460.6630.2 1292.1326 -3.93-2708.4 10644.012 What is the product of 0.19 and -2.5907236? -0.492237484 Product of -0.6 and -3023.91. 1814.346 Product of -5.393 and -125. 674.125 Multiply -6 and 17372546. -104235276 0.10912222 24.22464 Calculate -0.856178794. -44943035.2 -0.3 times 30396599 -9118979.7 Multiply 0.133781 and -12. -1.605372 -0.2-37175323 7435064.6 Multiply 49 and -1634.905. -80110.345 Multiply 0.08 and -6676137. -534090.96 0.138324-0.045 -0.00622458 Multiply 3945 and 791. 3120495 -0.4 times 8738671 -3495468.4 Calculate 8-4.042401. -32.339208 Work out -0.0722 * -0.0878108. 0.00633993976 Product of 11 and 32153411. 353687521 69.64629 times 0.07 4.8752403 Calculate -302.911264.1. -382908.531 Calculate -144997-0.4. 57998.8 Multiply 0.2611155 and -3. -0.7833465 Multiply -86750 and -41.2. 3574100 -0.3698512.22 -0.82106922 Product of 30 and 11685483. 350564490 Work out 3327 107247. 356810769 -1041102 times 26 -27068652 What is 0.1549052 times -1? -0.1549052 What is -1657.3 times -17.9? 29665.67 577320-17 -9814440 Multiply -206 and 0.369647. -76.147282 What is the product of 291 and 437.67? 127361.97 Calculate 20-422157.4. -8443148 -1316165 * -0.06 78969.9 Work out -26 * 2482779. -64552254 Product of -0.009979 and 0.2505. -0.0024997395 Calculate -381-2188.3. 833742.3 What is 34545.069 times -0.3? -10363.5207 What is 5.5 times 0.097633? 0.5369815 -0.5 -160.769599 80.3847995 -5500 times 2140 -11770000 -1965 times -4937 9701205 What is the product of 40792 and 0.03? 1223.76 0.4 * 168157.35 67262.94 Calculate 2379.53-38.6. -91849.858 Multiply -134.4889 and 0.3. -40.34667 What is 0.673 times -1133? -762.509 27348.149 0.7 19143.7043 What is the product of 2 and -11063151.7? -22126303.4 Work out 116 * -4521.784. -524526.944 What is 0.4 times -246.42559? -98.570236 Calculate -840113.47. -95314.8 Calculate -105237921. -24981705 95054 * -31 -2946674 1312 * 0.03166 41.53792 172 times 952879.6 163895291.2 -0.61310485.7 -786291.42 What is the product of -2176.37814 and 5? -10881.8907 -1.88664240.3 -0.56599272 -14867 * 53 -787951 What is -0.2 times -7.2144873? 1.44289746 Product of 17078 and 0.938. 16019.164 1900.72 * 15 28510.8 Product of 0.89 and 1118667. 995613.63 Multiply -6.31 and 4945. -31202.95 What is the product of -14 and 0.08792384? -1.23093376 What is the product of -0.046 and 115.585? -5.31691 0.2 * -1974780 -394956 Multiply 3173 and -2433. -7719909 Calculate -1410674.80.5. -705337.4 Product of -177052218 and 0.2. -35410443.6 Work out -0.046117 60. -2.76702 What is -0.3 times 2802.203? -840.6609 Multiply -3216700 and 8. -25733600 Calculate 0.1*4.51065. 0.451065 Product of 11051 and -874	{ "pile_set_name": "DM Mathematics" }
v2 + 12v + 378 What is the y'th term of -942, -3434, -7530, -13236, -20558, -29502, -40074? -y*3 - 796y*2 - 97y - 48 What is the f'th term of -101, -181, -255, -323, -385, -441, -491? 3f2 - 89f - 15 What is the p'th term of 372, 619, 866, 1113, 1360? 247p + 125 What is the a'th term of -12220, -24538, -36856, -49174, -61492? -12318a + 98 What is the q'th term of 1446, 1401, 1342, 1263, 1158? -q3 - q2 - 35q + 1483 What is the x'th term of -1148, -1422, -1696, -1970, -2244? -274x - 874 What is the z'th term of -59, -434, -1447, -3416, -6659, -11494, -18239, -27212? -53z3 - z2 - z - 4 What is the t'th term of -146896, -146903, -146912, -146923? -t2 - 4t - 146891 What is the b'th term of -789, -709, -545, -255, 203, 871? 7b3 + 31b - 827 What is the y'th term of 10625, 42653, 96041, 170795, 266921? y*3 + 10674y*2 - y - 49 What is the f'th term of 252, 2101, 7128, 16923, 33076? 265f3 - f2 - 3f - 9 What is the x'th term of -84725, -169444, -254163? -84719x - 6 What is the n'th term of 956, 951, 946, 941, 936? -5n + 961 What is the r'th term of -1237, -1195, -1151, -1105, -1057, -1007? r2 + 39r - 1277 What is the c'th term of 2156, 4372, 6626, 8918, 11248? 19c2 + 2159c - 22 What is the q'th term of -567843, -567844, -567845, -567846, -567847, -567848? -q - 567842 What is the t'th term of 2896, 2832, 2780, 2746, 2736, 2756, 2812? t*3 - 71t + 2966 What is the i'th term of 2209616, 2209618, 2209620? 2i + 2209614 What is the b'th term of -13877, -13894, -13911? -17b - 13860 What is the m'th term of 462, 1895, 4296, 7659, 11978, 17247? -m*3 + 490m*2 - 30m + 3 What is the f'th term of 24345, 24360, 24375? 15f + 24330 What is the b'th term of 4780, 4778, 4776? -2b + 4782 What is the b'th term of -1733, -1728, -1705, -1652, -1557, -1408, -1193, -900? 2b3 - 3b2 - 1732 What is the c'th term of -290093, -290094, -290095, -290096, -290097, -290098? -c - 290092 What is the r'th term of -44926, -44933, -44952, -44989, -45050, -45141, -45268? -r3 - 44925 What is the h'th term of -56879, -227517, -511915, -910073, -1421991, -2047669, -2787107? -56880h2 + 2h - 1 What is the b'th term of 195, 274, 379, 522, 715, 970, 1299, 1714? 2b3 + b2 + 62b + 130 What is the g'th term of -5711, -11434, -17159, -22886, -28615? -g*2 - 5720g + 10 What is the u'th term of -3523300, -3523301, -3523302, -3523303, -3523304, -3523305? -u - 3523299 What is the o'th term of 9263, 18370, 27477? 9107o + 156 What is the x'th term of -72, -243, -522, -903, -1380, -1947, -2598? x3 - 60x*2 + 2x - 15 What is the k'th term of 1308, 3193, 5078, 6963? 1885k - 577 What is the z'th term of 96, 371, 822, 1443, 2228, 3171? -z3 + 94z*2 + 3 What is the f'th term of 4285, 4276, 4267? -9f + 4294 What is the l'th term of 448261, 448264, 448269, 448276, 448285, 448296, 448309? l*2 + 448260 What is the w'th term of -117, -218, -325, -438, -557, -682? -3w*2 - 92w - 22 What is the k'th term of -1935, -1947, -1985, -2061, -2187, -2375, -2637? -2k3 - k2 + 5k - 1937 What is the y'th term of -1023, -1192, -1361, -1530, -1699, -1868? -169y - 854 What is the t'th term of 4061, 4121, 4181, 4241? 60t + 4001 What is the a'th term of -18734, -18730, -18724, -18716, -18706, -18694? a2 + a - 18736 What is the j'th term of 33830, 67679, 101540, 135419, 169322, 203255, 237224? j3 + 33842j - 13 What is the r'th term of 1631, 6509, 14645, 26045, 40715? r3 + 1623r*2 + 2r + 5 What is the n'th term of 398545, 398548, 398551, 398554, 398557? 3n + 398542 What is the b'th term of 678, 1260, 1842? 582b + 96 What is the m'th term of -61091, -122185, -183279? -61094m + 3 What is the z'th term of 267, 478, 555, 432, 43, -678, -1797? -11z3 - z2 + 291z - 12 What is the h'th term of 9387, 37511, 84369, 149961, 234287, 337347, 459141? 9367h*2 + 23h - 3 What is the h'th term of -8096603, -8096601, -8096599, -8096597, -8096595? 2h - 8096605 What is the o'th term of -178, -269, -386, -517, -650? 2o*3 - 25o*2 - 30o - 125 What is the i'th term of -682, -1365, -2048, -2725, -3390, -4037, -4660? i*3 - 6i*2 - 672i - 5 What is the l'th term of 371, 709, 987, 1175, 1243, 1161, 899? -5l3 + 373l + 3 What is the l'th term of 206, 786, 1726, 3020, 4662? -l*3 + 186l*2 + 29l - 8 What is the a'th term of 293, 630, 1003, 1418, 1881? a*3 + 12a*2 + 294a - 14 What is the i'th term of -107, -247, -457, -773, -1231, -1867, -2717, -3817? -6i3 + i2 - 101i - 1 What is the t'th term of -2092, -2087, -2088, -2095, -2108, -2127, -2152? -3t2 + 14t - 2103 What is the g'th term of 5520, 6652, 7784, 8916, 10048, 11180? 1132g + 4388 What is the w'th term of 14228, 28457, 42686, 56915, 71144? 14229w - 1 What is the o'th term of 3351, 6714, 10097, 13506, 16947, 20426, 23949, 27522? o*3 + 4o*2 + 3344o + 2 What is the y'th term of 299, 672, 1045, 1418, 1791, 2164? 373y - 74 What is the h'th term of 17, 132, 329, 608? 41h*2 - 8h - 16 What is the i'th term of 7369, 14711, 22041, 29353, 36641, 43899, 51121, 58301? -i*3 + 7349i + 21 What is the s'th term of -1430, -5747, -12952, -23051, -36050? -s*3 - 1438s*2 + 4s + 5 What is the f'th term of -28, -349, -1208, -2869, -5596, -9653, -15304? -44f3 - 5f*2 + 2f + 19 What is the s'th term of -21105542, -21105537, -21105520, -21105485, -21105426, -21105337, -21105212, -21105045? s*3 - 2s - 21105541 What is the b'th term of 22013, 44032, 66051, 88070, 110089, 132108? 22019b - 6 What is the b'th term of 68, 124, 222, 380, 616, 948, 1394? 3b*3 + 3b*2 + 26b + 36 What is the p'th term of 3616, 28892, 97500, 231106, 451376, 779976, 1238572? 3611p3 - p + 6 What is the v'th term of -30808, -61633, -92478, -123343, -154228? -10v*2 - 30795v - 3 What is the a'th term of 3016, 3180, 3458, 3850, 4356? 57a2 - 7a + 2966 What is the n'th term of 67765, 67770, 67775? 5n + 67760 What is the w'th term of 7465, 7488, 7511, 7534? 23w + 7442 What is the l'th term of -1695, -1730, -1753, -1758, -1739, -1690, -1605, -1478? l*3 - 42l - 1654 What is the f'th term of 41329, 82696, 124067, 165442? 2f2 + 41361f - 34 What is the j'th term of -180, -265, -350, -435, -520, -605? -85j - 95 What is the s'th term of 205, 469, 915, 1543, 2353? 91s*2 - 9s + 123 What is the x'th term of -7451, -14911, -22373, -29837, -37303? -x*2 - 7457x + 7 What is the j'th term of 2635, 5530, 8687, 12106, 15787? 131j2 + 2502j + 2 What is the z'th term of -47, -57, -27, 49, 177, 363, 613, 933? z*3 + 14z*2 - 59z - 3 What is the o'th term of 16739, 66952, 150639, 267800? 16737o2 + 2o What is the r'th term of 22571, 45177, 67783, 90389? 22606r - 35 What is the r'th term of -2952, -5988, -9024, -12060? -3036r + 84 What is the o'th term of -417, -1708, -3887, -6978, -11005, -15992, -21963, -28942? -4o3 - 420o*2 - 3o + 10 What is the n'th term of -285, -772, -1409, -2196, -3133, -4220, -5457? -75n2 - 262n + 52 What is the q'th term of 4492, 8971, 13450, 17929? 4479q + 13 What is the f'th term of -131, -67, 29, 163, 341? f3 + 10f*2 + 27f - 169 What is the j'th term of 699, 1375, 2001, 2553, 3007, 3339? -4j3 - j2 + 707j - 3 What is the d'th term of -5949, -11725, -17501, -23277, -29053? -5776d - 173 What is the l'th term of 468, 986, 1504, 2022? 518l - 50 What is the t'th term of -8735, -8789, -8843, -8897, -8951, -9005? -54t - 8681 What is the j'th term of -968, -961, -924, -845, -712, -513? 2j*3 + 3j*2 - 16j - 957 What is the n'th term of 40778, 40777, 40776? -n + 40779 What is the k'th term of -606, -2367, -5302, -9411? -587k2 - 19 What is the m'th term of -27984, -27990, -27996, -28002, -28008, -28014? -6m - 27978 What is the b'th term of -1123, -956, -777, -580, -359? b*3 + 160b - 1284 What is the u'th term of 89115, 178234, 267353, 356472? 89119u - 4 What is the m'th term of 766671, 1533341, 2300011? 766670m + 1 What is the j'th term of -7117, -7134, -7163, -7210, -7281, -7382, -7519? -j*3 - 10j - 7106 What is the t'th term of -63968, -127921, -191874, -255827, -319780? -63953t - 15 What is the s'th term of 230817, 230805, 230777, 230727, 230649, 230537, 230385, 230187? -s3 - 2s**2 + s + 230819 What is the o'th term of -7291, -	{ "pile_set_name": "DM Mathematics" }
-m*3 - 3m*2 - 2m + 2. Let i be b(o). Solve z - 1 + i = 0 for z. -1 Let n(q) = 3q - 5. Let d be n(4). Let f = 9 - d. Solve p + 0p + f = 0 for p. -2 Let f(s) = s*2 + 4s*3 - 2s*3 - 4s + 3 - 4s2. Let u be f(3). Suppose -u = -5i + 4z, 2i - 5i + 15 = -z. Solve -2k - 8 = -ik for k. 2 Let p(x) = -4x*3 - 4x2 - x3 + 5 + 6x3 + 2x*2 - 7x. Let v be p(4). Solve -2d - v = -1 for d. -4 Let f(p) = p3 + 4p*2 - 7. Let d be f(-5). Let m be 6/21 - d/(-14). Let u be 0/(m - (-3 + -1)). Solve 2 = -q - u for q. -2 Let q(m) = -3m - 3. Let g be q(-3). Let p be 4/g + 4/(-6). Let s(b) = -b + 3. Let k be s(0). Solve 0 = l - pl - k for l. 3 Suppose -w = 2 + 1. Let q = w + 6. Solve qf + 6 = -0 for f. -2 Suppose 17 + 7 = 4h. Solve hp - p = 10 for p. 2 Let l(b) = 11b2 + 4b + 3. Let w(q) = 11q2 + 5q + 4. Let m(n) = 4l(n) - 3w(n). Let g be m(-1). Let t be 6/g + (-12)/20. Solve r + 3r = t for r. 0 Let v be (-5)/15 + (-26)/(-6). Suppose -2t - 10 = -3t. Solve -t = n + vn for n. -2 Let w(b) = b*2 + 17b - 16. Let u be w(-18). Solve 1 = ux - 5 for x. 3 Let m(w) = -w2 + 9w - 8. Let v be m(8). Suppose 15 = 5t - 5c, v = -2t - 2c - 2 + 20. Suppose -3o - 15 = -to. Solve 0 = os + 12 + 13 for s. -5 Suppose 9 = -3b - 9. Let y(f) = 13f2 - 3f - 3. Let c(w) = -7w2 + 2w + 2. Let k(t) = 11c(t) + 6y(t). Let z be k(b). Solve 3v - 1 = -z for v. -5 Suppose -63 + 7 = -14h. Solve -hj + 1 = 17 for j. -4 Let j(q) = q2 - q - 2. Let w be j(4). Let v = w - 4. Suppose 0 = -i + vi - 10. Solve -ib = -4b - 8 for b. -4 Let w be (12/18)/(16/(-6))-68. Solve -5q = 3 + w for q. -4 Let y be (-37)/(-7) + 8/(-28). Let i = y + -2. Let q = i + -3. Solve q = -2n + 2 - 0 for n. 1 Suppose -10 = -2i, 33 - 6 = k + 4i. Solve 2d = -1 - k for d. -4 Let f be (-6)/10 + 185/(-25). Let a be (f - -12) + (0 - 0). Solve 2o + 2 = ao for o. 1 Suppose 2m + 2k + 20 = -2k, -3k = -3m + 15. Solve m = 2t + t for t. 0 Suppose -2 = -3t + 2b + 4, -2t + 4b = -4. Let d be (156/65)/(t/5). Solve -y + d = 2 for y. 4 Let n(x) = x*2 + 19. Suppose -y + 5 = -2y, 5y = -2o - 25. Let i be n(o). Suppose 0 = 4h - i - 1. Solve -ht = -t for t. 0 Let s = -33 - -61. Suppose -s = -5c + 3d, -4c - 4d = d - 15. Suppose -9 = -h - c. Solve 3i - i = -h for i. -2 Suppose 0 = -4x - 23 + 279. Let z be x/10 + 2/(-5). Solve 3m + z = -0m for m. -2 Let t(w) = -w3 - w2 - 3w - 7. Let x be t(-3). Suppose 4p + p = x. Solve -21 + 9 = -po for o. 3 Suppose n + 22 = 6n + s, 5s = -n + 14. Solve 2y + n = -6 for y. -5 Let k be (1/3)/(3/45). Solve 7z - k = 2z for z. 1 Let r = -206 + 550. Let g be r/44 - (-2)/11. Solve 2a = -0a + g for a. 4 Let j(m) = 16m + 11. Let q be j(4). Suppose 5r + 20 = q. Solve -1 + r = -5y for y. -2 Suppose 0 = -2r + 4. Let w be 7 + 2 - (r + 1). Solve 3d + 21 = w for d. -5 Let f = 1 - -1. Suppose -fv = -3 - 1. Suppose 4 = 3g - vg. Solve 0 = w - g + 2 for w. 2 Let h(v) = -v*3 - 4v*2 + 4v + 1. Let r be h(-5). Let l be 2/r - 2/6. Solve lc = c for c. 0 Suppose -5 = -2q - 1. Solve 0w - 6 = qw for w. -3 Suppose 0f = 5f - n + 15, 2f + 13 = -n. Let s = f + 9. Let j be 10/(-8)(-16 + 0). Solve -j - 5 = -su for u. 5 Let q(h) = h + 4. Let f be q(-4). Suppose 5i + 1 = 4i - 2a, -3i - a = -22. Let j be 2(-2)/((-12)/i). Solve -6 = jc - f for c. -2 Let g(l) = l2 - 12l + 13. Let o be g(11). Solve -oq + 3q = 0 for q. 0 Let u(o) = o + 14. Let h be u(-10). Solve -5c + 1 = -h for c. 1 Suppose 2j + 2g - 8 = 0, -4g = 5j - 11 - 5. Suppose y + 0y = j. Solve -q = -yq + 5 for q. -5 Let w be (-19 - 1)(-1)/2. Let l(p) = -2p - 10. Let r be l(-7). Suppose -n + 6n - 2c - 24 = 0, rc - 42 = -5n. Solve nu - 4u + w = 0 for u. -5 Let t = 6 + -2. Suppose 3 = -z + d, -4z - td + 2 = -10. Solve -3n + 8n - 25 = z for n. 5 Let z be (8/20)/((-2)/(-20)). Let i(h) = -h2 + 4h. Let x be i(z). Solve x = 3r + 1 + 2 for r. -1 Suppose -4k + m = -17, -3k - 8m = -3m - 30. Let n = 16 - 11. Suppose no + p - 6 = -2p, 24 = 3o - 5p. Solve -ot - k = -2t for t. -5 Let a be 4 + ((-20)/(-4) - (-3 + 1)). Solve 3g - 2 = -a for g. -3 Let d = -3 - -3. Solve d = -2a + 6a + 16 for a. -4 Suppose 7s - 8s - 13s = 0. Solve s = -4a + 5 - 13 for a. -2 Let l(v) = -v*3 + 4v*2 + 11v + 8. Let d be l(6). Solve -2b + 16 = db for b. 4 Let l(d) = d*2 + 2d - 1. Let f be l(-3). Let y be f + 0/(-2) - -18. Suppose -3k + y = k. Solve -ku = -u for u. 0 Let n = 58 + -48. Solve -nj = -6j for j. 0 Let s(f) = f*3 + 4f*2 - 8f - 5. Let b be s(-5). Solve -5z + 0z = -b for z. 2 Suppose 5d - 19 = i, 0 = 2i + i + 2d - 11. Solve i = 2n - 5 for n. 3 Suppose -5v + 0 + 10 = 0. Solve 0a + a + v = 0 for a. -2 Suppose 0 = -5v + 2z + 15, 6 = 3v - v - 3z. Solve vy - 2 = -5 for y. -1 Let f(d) = -d3 + 12d*2 - 12d + 16. Let w be f(11). Suppose -25 = -5b, -b - 9 = -0m - 2m. Suppose 5 = -2z + mz. Solve -2h - z = w for h. -3 Suppose -l = 5y - 13, 2l + l + 4y = 72. Solve l = -4m + 12 for m. -4 Suppose -4s + 48 = 5c - s, -s + 1 = 0. Solve -4m + c = -11 for m. 5 Suppose 90f - 95f = -45. Solve 2w + f = -1 for w. -5 Let x(c) = 4c2 - 47c - 7. Let g be x(12). Solve gh - 2h = 15 for h. 5 Let k = -8 + 1. Let l be -8 - k - 3-1. Solve 4s + 6 = ls for s. -3 Let w be ((-4)/6)/((-1)/6). Let a be ((-6)/w)/(3/(-4)). Solve -d + 3 = -a for d. 5 Suppose j = 4 + 26. Suppose j = 5a - 0. Let l = a - 4. Solve -y + ly = 3 for y. 3 Suppose 5w - w = 4. Solve 2l - w - 1 = 0 for l. 1 Suppose 4b + 45 + 3 = 0. Let q be 15/(-2)b/10. Solve 0 = 4l - q - 3 for l. 3 Suppose -5s = 5w - 30, s - 6 = -0s - 5w. Let l = -4 + s. Solve -ln - 4 = -0 for n. -2 Let v be (-12)/8 - (-21)/122. Solve 0 = -vu - 6 - 2 for u. -4 Suppose -9f + 6f = 6. Let s = f - -6. Solve n = 2n - s for n. 4 Let q(n) = -4 + 10 + 3n - 4n. Let p be q(0). Suppose c = 3c - p. Solve 0a + a = -c for a. -3 Let m(l) = -4l + 15. Let s be m(3). Solve -sf = f + 12 for f. -3 Let d(t) = t*3 + 7t*2 - t - 9. Let s be d(-7). Let j be -10/(s/1). Suppose jn - 24 = -4n. Solve 6 + n = 4g for g. 3 Let z be 2 + (-41)/2. Suppose z = -0r - 5r. Suppose 3c - 11 = 1. Solve r = -3v - v - c for v. -1 Let h = 43 + -39. Solve -o + h = -0o for o. 4 Let p = 36 - 32. Solve 0 = 4o - p - 12 for o. 4 Let a = 10 + -3. Solve 0 = -3p + ap + 20 for p. -5 Suppose 2p + 12 = -4y + 6p, 2y + 5p = 29. Solve -f = yf - 9 for f. 3 Suppose -3y = 2y. Let t(a) = -4a + 3a - a*3 + 4a*2 - 4 + y. Let m be t(3). Solve 0 = -mc - 2 - 6 for c. -4 Let x be 238/(-28) + 2/4. Let i be 2/40 + -11. Let c = x - i. Solve z - c = -6 for z. -3 Let m(h) = -h - 4. Let v be m(-10). Solve 4 = 2o + v for o. -1 Let j(p) be the first derivative of p*4/4 - 4p*3/3 - 2p*2 - 6p - 2. Let t be j(5). Let x be t/((-1 + -1)/4). Solve 3 + 3 = xi for i. 3 Let p(a) = a + 8. Let x be p(-7). Let b be -2 - (x + -2 - 2). Solve b + 0 = c for c. 1 Let m be 10 - (5 - (-6)/(-3)). Solve -4w = m + 13 for w. -5 Let v be -123(5 + -6). Suppose -5k + 7 = -v. Let z(o) = 2o*2 - o - 1. Let r be z(2). Solve -j - r = -kj for j. 1 Let p = -5 + -5. Let f = -10 - p. Solve fd - d = -4 for d. 4 Let h(w) = -w3 + 9w*2 + w - 5. Let f be h(9). Suppose 2 + 1 = n. Let r = -3 + 5. Solve -rt - f = -nt for t. 4 Suppose t + 6 = -0. Let m be (-8)/t(-9)/(-2). Suppose 4g + 2b = 4b - m, -2b + 6 = -g. Solve -c + 3c = g for c. 0 Let i be (-1 - -4) + 17. Let t = i + -11. Let n = 4 + t. Solve -nv + 8v = -10 for v. -2 Let h(b) be the third derivative of b6/120 - b5/15 + b4/6 + b3/6 - b*2. Let k be 2 + (-1 + -1 - -3). Let m be h(k). Solve 0 = -5o + mo - 2 for o. -2 Suppose -5h - 2 = -4h, 4b = -3h + 22. Suppose 0 = 4p - bp. Solve -5o + 4o - 3 = p for o. -3 Suppose 4l = 5l - 3o - 24, -3l = 5o - 44. Let b = l + -13. Suppose 27 - 7 = by. Solve -yh = -7 - 5 for h. 3 Suppose 36 = -2t + 6t. Let y = 9 - t. Solve 25 = 5u - yu for u. 5 Suppose z + 12 = -2z, -3c + 199 = -z. Let k = -25 + c. Let m be (1/2)/(2/k). Solve -4a - m = a for a. -2 Suppose -5j + 5p = 25, j + p + 0p = 5. Solve -10 = -5z - j for z. 2 Suppose 3b - 8 = -p + 4b, -b = -5p + 32. Let g be ((-8)/6)/(1/(-3)). Solve -g*f = -f - p for f.	{ "pile_set_name": "DM Mathematics" }
when three letters picked without replacement from jhtajrr. 1/35 Two letters picked without replacement from {u: 6, w: 2}. What is prob of picking 1 w and 1 u? 3/7 Calculate prob of picking 2 j when two letters picked without replacement from {w: 1, g: 3, j: 12}. 11/20 Three letters picked without replacement from {r: 2, f: 5, u: 6}. Give prob of picking 2 r and 1 u. 3/143 What is prob of picking 1 i and 1 m when two letters picked without replacement from mimmmmmiimm? 24/55 Calculate prob of picking 1 u, 1 s, and 1 t when three letters picked without replacement from {x: 2, t: 1, k: 3, w: 5, s: 1, u: 1}. 1/286 Three letters picked without replacement from {h: 7, n: 2, e: 8, x: 1, t: 1}. Give prob of picking 3 e. 56/969 Two letters picked without replacement from gllwwlllwlbkbl. Give prob of picking 1 w and 1 g. 3/91 What is prob of picking 2 f when two letters picked without replacement from {n: 10, f: 9}? 4/19 Calculate prob of picking 1 v, 2 q, and 1 x when four letters picked without replacement from vvxvkxxxqvqxxvkkxvq. 21/646 What is prob of picking 4 w when four letters picked without replacement from wwwwwwwww? 1 Three letters picked without replacement from {m: 8, d: 2, q: 2, h: 3}. What is prob of picking 1 q and 2 d? 2/455 Calculate prob of picking 1 r and 1 n when two letters picked without replacement from {n: 1, i: 2, r: 2}. 1/5 Three letters picked without replacement from zzzzzzz. Give prob of picking 3 z. 1 Two letters picked without replacement from {y: 1, l: 4, b: 2}. What is prob of picking 1 b and 1 l? 8/21 Three letters picked without replacement from bzlhhblzzbbzbzl. What is prob of picking 2 h and 1 l? 3/455 Four letters picked without replacement from {k: 3, m: 1, f: 6, y: 4}. Give prob of picking 1 y, 2 k, and 1 m. 12/1001 Calculate prob of picking 1 o and 1 e when two letters picked without replacement from eefooeoo. 3/7 What is prob of picking 2 f and 1 j when three letters picked without replacement from {f: 9, j: 7}? 9/20 Three letters picked without replacement from yizyyzjzyzi. What is prob of picking 1 i, 1 y, and 1 j? 8/165 What is prob of picking 1 q and 1 c when two letters picked without replacement from aaqcaaaqaaawwccq? 3/40 Two letters picked without replacement from mhmmxwxcxmuuxcc. Give prob of picking 1 u and 1 m. 8/105 Three letters picked without replacement from txptopxtxux. What is prob of picking 2 t and 1 p? 2/55 Three letters picked without replacement from {a: 4, h: 3, b: 9}. What is prob of picking 1 a and 2 b? 9/35 Three letters picked without replacement from {m: 2, q: 3, b: 4, y: 1, a: 4, k: 1}. What is prob of picking 1 b and 2 a? 24/455 What is prob of picking 2 h and 1 r when three letters picked without replacement from hhhhhrhrrhrrr? 63/143 What is prob of picking 2 a when two letters picked without replacement from {d: 3, m: 1, a: 1}? 0 Calculate prob of picking 1 i, 1 j, 1 o, and 1 q when four letters picked without replacement from eeiequejeoe. 1/330 Three letters picked without replacement from {a: 2, o: 11}. Give prob of picking 2 a and 1 o. 1/26 What is prob of picking 3 t when three letters picked without replacement from {t: 10, g: 2}? 6/11 What is prob of picking 1 y and 1 p when two letters picked without replacement from {p: 1, h: 1, y: 2, z: 1, f: 2}? 2/21 Calculate prob of picking 4 j when four letters picked without replacement from jhhjjhjhjjjjhjjjjhh. 165/1292 Calculate prob of picking 2 d and 2 h when four letters picked without replacement from {q: 2, d: 1, b: 5, h: 1}. 0 Calculate prob of picking 1 a and 1 x when two letters picked without replacement from eeeaexeaeaaeaeaaxed. 14/171 Calculate prob of picking 2 y when two letters picked without replacement from {x: 6, y: 2, n: 5, s: 2, z: 1, r: 3}. 1/171 Calculate prob of picking 2 p and 2 f when four letters picked without replacement from {g: 4, p: 3, f: 7}. 9/143 Calculate prob of picking 2 q and 1 r when three letters picked without replacement from qqqrrqqqrqrqqqqrqqq. 455/969 What is prob of picking 2 q when two letters picked without replacement from {n: 13, q: 3}? 1/40 Two letters picked without replacement from zzbxbbbx. What is prob of picking 1 z and 1 b? 2/7 Four letters picked without replacement from {b: 3, r: 11}. What is prob of picking 2 r and 2 b? 15/91 Calculate prob of picking 1 t and 1 x when two letters picked without replacement from {l: 1, w: 2, x: 1, t: 2, k: 1}. 2/21 What is prob of picking 2 x and 1 k when three letters picked without replacement from {e: 1, k: 2, t: 1, x: 2, r: 2}? 1/28 What is prob of picking 1 n and 2 v when three letters picked without replacement from nvvvnvvvvvv? 24/55 Calculate prob of picking 3 d when three letters picked without replacement from dxdddxdd. 5/14 Two letters picked without replacement from iikiikiikkiiikkk. Give prob of picking 2 k. 7/40 Calculate prob of picking 2 t when two letters picked without replacement from {f: 4, t: 2}. 1/15 Two letters picked without replacement from {i: 2, n: 3}. Give prob of picking 2 i. 1/10 What is prob of picking 1 b and 1 w when two letters picked without replacement from {b: 2, w: 5, u: 5, q: 5}? 5/68 What is prob of picking 1 m, 1 q, and 1 i when three letters picked without replacement from qmiiimmi? 3/14 Calculate prob of picking 1 h and 1 m when two letters picked without replacement from mhh. 2/3 Calculate prob of picking 2 u when two letters picked without replacement from {u: 2, a: 1, e: 2, k: 1}. 1/15 Three letters picked without replacement from qdqd. What is prob of picking 2 q and 1 d? 1/2 Calculate prob of picking 1 g and 1 y when two letters picked without replacement from {o: 2, y: 3, q: 7, g: 3, z: 5}. 9/190 Calculate prob of picking 1 g, 1 s, 1 l, and 1 q when four letters picked without replacement from lilsgoq. 2/35 What is prob of picking 2 x when two letters picked without replacement from {o: 3, g: 2, x: 3}? 3/28 Two letters picked without replacement from tjtrjrurttj. What is prob of picking 1 j and 1 u? 3/55 Two letters picked without replacement from {g: 2, z: 1, w: 4, b: 1}. Give prob of picking 1 g and 1 b. 1/14 What is prob of picking 2 c and 1 j when three letters picked without replacement from {j: 4, c: 2, g: 10}? 1/140 Calculate prob of picking 1 j and 1 e when two letters picked without replacement from wqejjejjw. 2/9 What is prob of picking 2 p and 1 q when three letters picked without replacement from {z: 1, k: 1, p: 2, q: 1}? 1/10 Four letters picked without replacement from {z: 7, h: 2}. What is prob of picking 1 h and 3 z? 5/9 Calculate prob of picking 1 s and 3 c when four letters picked without replacement from {z: 5, a: 1, c: 3, s: 4}. 4/715 Two letters picked without replacement from wwhllhllwlghhl. What is prob of picking 1 w and 1 g? 3/91 Two letters picked without replacement from ssssssvssvsssvvssv. Give prob of picking 1 s and 1 v. 65/153 What is prob of picking 1 c and 1 m when two letters picked without replacement from {c: 1, w: 5, i: 1, m: 3}? 1/15 Three letters picked without replacement from vveefveeeevvevjv. Give prob of picking 1 e and 2 v. 21/80 Calculate prob of picking 1 y and 1 i when two letters picked without replacement from {i: 1, y: 1, s: 1, o: 1, t: 1, g: 2}. 1/21 Two letters picked without replacement from {d: 8, c: 1, u: 4, m: 2}. Give prob of picking 1 d and 1 u. 32/105 Three letters picked without replacement from ddldgguuuguulglitd. What is prob of picking 1 l and 2 g? 3/136 Calculate prob of picking 2 z and 2 c when four letters picked without replacement from {c: 7, n: 2, z: 2}. 7/110 Three letters picked without replacement from iqijjqqjqqkqkqq. Give prob of picking 1 q, 1 j, and 1 k. 48/455 What is prob of picking 2 f and 1 a when three letters picked without replacement from {f: 5, a: 2}? 4/7 Two letters picked without replacement from rrrrrrrrrr. What is prob of picking 2 r? 1 Two letters picked without replacement from mkkiiikikikiki. What is prob of picking 1 i and 1 m? 1/13 Three letters picked without replacement from nnnnn. What is prob of picking 3 n? 1 Calculate prob of picking 2 k when two letters picked without replacement from {k: 10, h: 10}. 9/38 Four letters picked without replacement from prcrccrrrrppcrcrprr. Give prob of pi	{ "pile_set_name": "DM Mathematics" }
-23 What is 0 + (36 + (3 - 1) - (-49 + -10 - -59))? 38 (-42 - (-34 + -39 + 14)) + (1 - -46) 64 -1 - 0 - 27 - (25048 - 24998) -78 Evaluate -1 - (109 - -1) - (-139 - (-123 - 9)). -104 What is the value of 1 + 2 + -17 + (332 - 140) + -220? -42 What is the value of 1 + 11 + (1 - 0) - (27032 - 26981)? -38 79 + 0 - (37653 - 37524) -50 -18 + ((-9 - 1) + -1 - (-1502 + 1502)) -29 Evaluate -26 + -1 + 0 + -1 - ((112 - 31) + -80). -29 Calculate -23 - 1 - (41 - ((-49 - -22) + 57)). -35 What is -109 + -12 - (0 - 1 - -20 - 6)? -134 Calculate 6 + 21 + (-14 - 1) + (-2 - -35). 45 36 + 2 + -3 - (15 + -40 + 29) 31 Evaluate ((6 - -8) + -9 - 14) + 20. 11 Evaluate -2 + 96 - (-6 - (-1 - 27) - 2). 74 What is (-78 + 156 - 131) + 42? -11 (8 + -1 - 21) + 21 + -20 + 37 + -46 -22 What is the value of 3524 - 3600 - (-2 - (9 + 1))? -64 What is 18 - -1 - 36 - (-48 + 3)? 28 What is the value of 36 + 10 + -81 + 20 - (-1 - 25)? 11 What is (-9 - 0) + 8 + 41 - (-12 - (10 - 12))? 50 Evaluate (-49 - -52 - -103) + -1 + -23. 82 (-78 - -137) + -142 - -161 78 What is the value of 73 + -83 + (-4 - 33)? -47 Calculate -9 + (669 - 665) + (-1 + 5 - (6 + -117)). 110 What is the value of -1 - ((-10 - -3) + 3 - (2 - 1)) - -34? 38 -7 + (-6 - ((-8 - (5 - 7) - -29) + 10)) -46 Evaluate (135 - -27) + -29 - 70. 63 What is (-10 - -30) + -10 + (45 - -14) + 4 + 1? 74 -34 + -40 + (111 - 50) -13 -2789 + 3007 - (126 - 3) 95 Evaluate (-23 - 25 - -2) + 44. -2 Evaluate -42 - -3 - (-75 - (30 - 31)). 35 What is (18 + -1 - -5) + -4 + (4 + 4 - -2)? 28 (-24 + 53 - 10) + 1 + -3 17 Evaluate 51 - (-32 + (47 - 0)). 36 What is the value of -10 + (-2 - -4) + 93 + 11 + -13 - -15? 98 Evaluate (1485 - 1510) + 7 + 1. -17 Calculate 16 - (-16 + 10 + (-25 - -6) + -5). 46 Calculate (-60 - -76) + -137 + 111. -10 What is the value of (32 - 16) + (15 - 11) - -13? 33 -85 - (103 + (-184 - 66)) 62 102 + -115 + (-7 + -19 - -10) -29 42 + -6 - (43 + -11 + -35) 39 -1 + 1 - ((1 - ((17 - 47) + 52)) + 3) 18 -12 + (5 + 24 + -12 - 6) + (-8 - -8) -1 Calculate -44 + -82 + (74 - 4). -56 0 + (-8 - (-2 - -3)) + -208 + 168 -49 What is -187 + 192 + 0 + -32 + 1 + 0? -26 -6 + (16 - (21 + (11 - 12))) -10 What is the value of -71 - -7 - -19 - (-3 - ((-6 - -11) + -1))? -38 (-236 - -233) + 9 + -2 + (4 - 5) + 3 6 Calculate 42 + (-60 - -21) + (11 - -9). 23 Evaluate -50 - (-210 + 233 + -1 + 3). -75 59 + (79 - 153) - (-8 - 1) -6 What is -23 - (19 - 3 - (2 - -24))? -13 What is the value of (9 + -55 - -23) + 9 - 26? -40 Evaluate 21 - ((-15 - 6) + 5 + 11) - -16. 42 What is the value of 98 + (-52 - -5) + 0? 51 Calculate 1 - (14 - (-132 + 133 - (5 + 0))). -17 -14 + -4 + -34 + -9 + 27 -34 What is 49 + (80 - 138) + (0 - 10)? -19 Calculate (4 - (-10 - -11)) + (57 + -1 - -11). 70 What is -73 + 85 + (-1 - -2) - (-19 + 5 + 7)? 20 -107 + 5 + (140 - 86) -48 What is the value of -6 - (-5 + -39) - (0 + -31)? 69 (35 - -61) + -48 + 3 + (2 - -7) 60 Calculate -2 + -5 - ((-13 - -6) + 7) - 3. -10 What is the value of 29 + (21 - (18 + (1 + -11 - -1)))? 41 What is -147 + (0 + 4 + 2 - (56 + (46 - 99)))? -144 Evaluate (1419 - 1395) + (-1 - 75) + 0. -52 -103 - -69 - (-72 + (7 - 10)) 41 398 + -408 + (14 - -45) 49 (-6 + 0 - -11 - 8 - -3) + 31 + 5 36 What is -17 + 16 + -2 + 107 - ((-2 - -17) + -8)? 97 Calculate -31 + 0 - (-1518 + 1473). 14 Evaluate (129 - 65) + -23 + -18. 23 Evaluate -3 + 2 - (9 - (-3 + 3 + 9)). -1 -43 - (-2 - 138) - 189 -92 Evaluate 13 - (-1 + -2 + -42 + (11 - -43) + -25). 29 What is 74 + -11 + -67 + (4 - 31)? -31 Calculate (1 - (2 + 127)) + (182 - 211) + 50. -107 Calculate -21 + 16 + 13 + (47 - (-3 + 4)). 54 Evaluate 20 + 41 + -28 + -101 - 20. -88 (-4 - -5) + 2 - (14 + 20 + -27) -4 Evaluate -2 + -41 + 2058 + -2067. -52 Calculate (113 - 41) + -48 - 53. -29 Calculate 1 - 0 - -2 - (-5741 - -5701). 43 What is -123 - (137 + 21 + -409)? 128 Calculate 229 + (-314 - -79) - (2 - -20). -28 What is the value of (44 - 109) + 99 + -1 + -6? 27 Calculate (9 - 4 - 36) + -499 + 503. -27 What is the value of 78 - (10 + (-25 - (-26 + 23)))? 90 What is (7 - 15) + -5 - 28? -41 What is 4 + (9 - 5) - (-53 + 30)? 31 19 - (68 - (-24 - (5 + -10))) -68 What is 208 - (-80 - -133 - -50)? 105 What is 161 + (2 - (-12 + 16 + 5 - 2) - 10)? 146 What is (34 - -5) + (55 - 41 - (9 + -2 + -3))? 49 What is 10 - 1 - (-81 - (79 - 116))? 53 -15 + (-9 - -8) - (12 + -24) -4 What is -1 - (-26 + (17 - 4) - (-6 + 9))? 15 43 - (-11 - -19 - (0 - -11)) 46 What is the value of (21 - (179 - 58)) + 49? -51 Evaluate -17 + 7 + (1 - (-1 - (-22 + 11)) - 0). -19 What is 16 + 31 + -85 - (4 + -29)? -13 What is 2 - -96 - (-10 - (-19 - (-28 - -18)))? 99 Evaluate (26 + -1 - (57 + -42)) + -16. -6 What is the value of 45 + 4 - 3 - (11 + -33 - -29)? 39 Evaluate (-14 - (-1 - 6) - 5) + (5 - (7 - -26)). -40 (-15 - -20) + 15 - 68 - -23 -25 What is the value of -76 - -78 - -103 - 125? -20 Calculate 6 - (-46 - (-18 - (-34 + 4 + 13))). 51 Calculate 7 - (8 + -22) - -2 - 59. -36 -4 - 1 - (582 + -589) 2 (-50 - -1) + -2 - (193 + (13 - 196)) -61 26 + -29 - (55 + -64 - (-40 + 0)) -34 Calculate -1 + 7 - (-20 - (-20 - -5) - -5) - 46. -40 What is (-12 - 0) + (-9 - 7 - (-9 + 1))? -20 What is 1 + -3 + -61 + (4966 - 4939)? -36 Evaluate -82 + (-105 - -57) + 64. -66 Evaluate -876 - -840 - (-16 + -2) - (-41 - 1). 24 0 + 0 + -2 + (-46 - -59) - -34 45 Calculate -18 - (-1 - (-5 + 1 + 4)). -17 What is the value of -49 + (-2 - -2) - (-24 + (31 - (-24 + 25)))? -55 What is the value of (1403 - 1386) + 71 + (4 - -1)? 93 Evaluate -33 + (55 - (23 + 5) - -4) - (1 - -108). -111 Evaluate 585 + -583 + (-3 - (-1 + 1) - (-1 + -28)). 28 What is the value of -61 + -62 + 67 + 87? 31 What is 0 + 9 + -15 + (2 + -5 - (134 + -145))? 2 What is the value of 1 + (13 - (32 + -41)) + 23? 46 Evaluate 24 + -46 - -27 - (5 + -4 - (-7 + -49)). -52 What is the value of (7 - -108) + (-16 - -7) - (-208 + 220)? 94 Calculate 21 - ((3 - 15) + 21 + -28). 40 (-45 - -51 - -37) + (-3 - (-8 - (-1 - -3))) 50 What is 1 + 12 - ((-63 - 114) + 134)? 56 Evaluate (58 - -41) + -144 + (-62 - -1). -106 (43 - 19 - 57) + 18 -15 Evaluate (6 - ((23 - 7) + -31)) + 19 + 8. 48 (1103 - 1017) + 9 + -35 + 3 63 -80 - (6 + -27 - (-37 - (-6 + -10))) -80 7 + (-3 - -5 - (3 + (-17 - (12 - 82)))) -47 What is the value of -37 - (72 + -76 + (9 - 3 - 1) + -7)? -31 Evaluate (-17 + 17 - -1) + 5 + -7 + -2 - 29. -32 What is (-12 - -15 - (-41 - 5)) + 36 + -23? 62 What is (91 - (187 - 115)) + -53? -34 What is (3 + -7 - -52) + -3234 + 3248? 62 What is the value of -36 + 22 - (-8 + 1 - (105 + 46 + -11))? 133 Calculate 8 - (-3 - ((13 - 4 - -6) + -15)) - 116. -105 What is the value of (-18 - (-23 + 11)) + (-18 - -5) - 1? -20 Evaluate 7 - (-7 - (-1 - (-5 + 20))). -2 What is -214 + 154 + (-1 - -21) + -19? -59 What is the value of 9 + -29 + (20 - 18) + 11? -7 Calculate 475 - 478 - (0 - 2) - -3. 2 What is the value of 23 + -17 + 4 + -15 - (7 - 11)? -1 What is 80 + -20 + (79 - 207)? -68 Evaluate 109 - 115 - -3 - (12 - -2). -17 What is the value of -3 - (1 + -1 + (6 - 4)) - (191 - 179)? -17 (-1 - 0) + 1 - ((-46 - (-67 - -73)) + 61) -9 What is the value of (9 - (5 - (-8 + 4))) + -3 + -36 + 3? -36 What is (5 - 89) + (-56 - -170)? 30 Evaluate -12 - (12 + 0 + -45 + -13). 34 What is the value of 110 - 186 - -85 - (18 + -2 - 3)? -4 Calculate 68 + -155 + -45 + 141. 9 What is the value of -217 + 240 + (0 - -18) - -4? 45 Calculate (59 + -23 - -4) + -3 + -20 + -29. -12 Calculate -14 + 12 + -9 - 31. -42 Calculate -13 + (10 - -1) + 11 - 0 - (-13 - -4). 18 What is (5 - 16) + -9 - -32 - (-10 - (0 + 0))? 22 Calculate (10 - 15) + 56 - (247 + -269). 73 What is the value of (5 - 9) + (85 - 185 - (-5 + 14))? -113 What is -28 + (17 - (-1 + (-17 - 12)))? 19 What is the value of -53 + 174 + -115 + 72? 78 Calculate 31 + (9 - 28) + 35 + -12. 35 What is -26 - (39 - -2 - 53)? -14 Evaluate -43 + 46 + (-31 - -71). 43 Calculate 0 + (-17 - -15 - 121) + (22 - 6). -107 What is -54 + -22 - (-11 + 10 + 8) - -9? -74 Calculate (-12 - -28) + 4 + 0 + 52 + -80. -8 What is 64 - 95 - (25 - 4)? -52 Calculate (51 - -16) + -67 + 43 + -1. 42 Calculate -3 + 0 + -38 + -1 + (-46 - -76 - 35). -47 What is (-1 + 11 - (59 - 36 - (16 + 2))) + -39? -34 What is the value of 2 + 2 + 1 + (-25 - (21 - 7)) - 3? -37 43 + 84 + -238 + 9 + -4 -106 -24 + 53 - (-6 - -91) -56 Evaluate 40 + (0 + -12 + -	{ "pile_set_name": "DM Mathematics" }
20 Let q = 1150264534 - 1628774511467/1416. Let r be 4/(-472)2/(-24). Let x = q - r. What is the common denominator of -67/20 and x? 20 Let p be -396 - ((-21)/(-2))/7. Suppose 2x - 399 + 2337 = -5z, -784 = 2z + 3x. Let q = z - p. Calculate the common denominator of q and 97/4. 4 Suppose 96 - 60 = 2h. Calculate the least common multiple of 12 and h. 36 Suppose -4b + 52 = 4c, -5b - 3c + 35 = -26. What is the lowest common multiple of 8 and b? 88 Let x be (3/9)/(102/(-3698253)). Let r = -12087 - x. What is the common denominator of r and -15/22? 374 Let m be (0 - 1)/((-393)/75). Let l = m + 5458/917. Find the common denominator of 19/10 and l. 70 Let z be 27310/(-25) + (-6)/10. Let l = z - -17585/16. What is the common denominator of l and -19/10? 80 Let t be (-1)/(-5) - 93/15. Find the common denominator of 950/(-42) + t/(-21) and 121/6. 6 Let x = 608/7 + -5123/56. Let s = 1985/50838 - -11/458. Let b = -2278/333 + s. What is the common denominator of b and x? 72 Suppose 4686 - 1361 = 5s. Calculate the common denominator of -38 and s/(-150) - 2/5. 6 What is the common denominator of 63/2 and 1 - (100/5)/((-474)/(-15))? 158 Suppose -7w - 14 = -42. What is the lowest common multiple of (-11)/(-3) - 1/(-3) and w? 4 Calculate the common denominator of -1/2 and (-2)/(-10) + (-174)/20. 2 Let h = 25047 - 501043/20. Find the common denominator of 3/9 - (-19)/(-48) and h. 80 Let a(n) = -n - 2. Let i be a(0). What is the least common multiple of 8 and 2 - ((i - -2) + -2)? 8 Let v = 11 - 7. What is the lowest common multiple of v and 11? 44 Suppose -5s = -10 - 10. Let h(o) = 2o*2. Calculate the lowest common multiple of h(1) and s. 4 Let q = -688 + -715. Let o = -5535/4 - q. Calculate the common denominator of o and 0 - (50/12 - -2). 12 Let o be 1 + (-1)/((-1)/14). What is the least common multiple of o/1(-20)/(-25) and 12? 12 Suppose -3s + 50 = 2s. Let v(w) = 2w - 4. What is the lowest common multiple of v(3) and s? 10 Let u(g) = -14g - 22. What is the least common multiple of u(-5) and 10? 240 Let l(h) = 6h - 10 - h2 + 4 + 4h. Let s be l(10). Let p = s + 12. What is the least common multiple of 2 and p? 6 Find the common denominator of (-2001)/(-145)(-5)/32 and -89/10. 160 Let f be (-3 + (-14)/(-6))-6. Suppose -4k + 50460 = l + 3l, 2l + fk - 25234 = 0. Let x = 151231/12 - l. Find the common denominator of -33/20 and x. 60 Let n(o) = -9o2 + 3o + 4. What is the common denominator of 11/19 and n(-2)? 19 Suppose 4d = 3x + 15, -d - 3x + 0x = 0. Suppose -dg + 51 = 3t, -91 = -4g - g - 3t. Calculate the lowest common multiple of 20 and g. 20 Suppose 21 = b - 5f, -4f - 78 = -5b - 6f. Suppose -5d + 4d + 3o + 8 = 0, 3d + o + b = 0. Find the common denominator of -44/5 and 2/d + (-129)/(-42). 35 Suppose 3z - 5 = -2. Calculate the least common multiple of z and (48/40)/((-6)/(-15)). 3 Let n = 13747823 + 3987973. Let r = n - 1064097773/60. Let j = r + -4201/5. Calculate the common denominator of j and -91/6. 12 Let a = 0 - -1. Suppose 28 = 3f + 22. What is the smallest common multiple of f and 17/1 + 1/a? 18 Let l = 2644 + -39676/15. What is the common denominator of l and 55/24? 120 Let y = -16 + 23. What is the least common multiple of y and 2? 14 Let n be (-2)/5 + (-48)/(-20). Suppose 3x = nx - 1244. Let j = 17405/14 + x. What is the common denominator of j and -73/8? 56 What is the common denominator of -109/40 and 2/11 - (-9540)/528? 40 Let l(n) = -n*2 - 4n - 7 - 8n2 + 3n2 + n3. Calculate the smallest common multiple of (-6)/(-5)(-3 + 8) and l(7). 42 Find the common denominator of (-4 - 99/(-21))/(12/(-266)) and -61/12. 12 Let g be ((-2)/(-2094))/(25/60). Let d = -38747/3490 + g. Find the common denominator of d and -39/14. 70 Suppose -6 = -4w + 2. What is the least common multiple of w and 1-2 - (-6 - -2)? 2 Suppose 4m - 2m + 4 = 4r, 2m - 6 = -r. Let p = -1556 - -31099/20. Calculate the common denominator of (-3)/(-12)(-160 + r) and p. 20 Let r = -37 + 12. Let j be ((-12)/(-15))/((-1)/r). Suppose 0 = 4g - 2c - j, 3g - 23 + 3 = -c. Calculate the smallest common multiple of 6 and g. 6 Let s = 23 - -23. Calculate the lowest common multiple of s and 2. 46 What is the least common multiple of 12 and (-3)/9 - 57/(-9)? 12 Suppose -11 - 7 = -3d. Calculate the lowest common multiple of d and 19. 114 Let c = 299087 - 5381635/18. Let z = 1034/9 - c. Find the common denominator of z and 4 - 2 - 58/36. 18 Let z be (-184)/126969098/1808624. Let d = z - 2/113039. Let o = d + 184/3. Find the common denominator of -47/9 and o. 36 Let c(n) = n3 - 15n*2 + n - 12. Let l(t) = t + 15. Let s be l(0). What is the lowest common multiple of 6 and c(s)? 6 Suppose 2a + g + 2g = 246, 2g = -4. Calculate the smallest common multiple of a and 10. 630 Let j be (-160)/(-8) - (0 - 0). Suppose x - j = -x. Suppose 4p + 5u = -p + 115, p - 29 = -3u. What is the smallest common multiple of x and p? 20 Let i = 15 - 12. Find the common denominator of 2 + 2/((-20)/14) and (153/(-60))/(i/14). 10 Let t(d) = 5d + 6. Let j be t(-4). Let g = j + 32. Calculate the least common multiple of 22 and g. 198 Suppose z = -4z. Suppose -2w + r = -w + 7, -3w = 4r - 14. Calculate the common denominator of -41/9 and ((-51)/w - z) + 2. 18 Suppose 5p + 25 = 2j, 4p + 28 - 8 = 0. Suppose 52 = 4b - 0b + 4x, j = -2x - 6. Calculate the least common multiple of b and 8. 16 Let a be (-3)/12 - 7381/(-4). Let t be 3 + -4 - a/8. Let j = t - -232. What is the common denominator of 23/4 and j? 8 Let y(z) = 5z*2 + 4z - 1. Let i be y(-3). Suppose -i = 5u + 3. Find the common denominator of u and 31/5. 5 Suppose 5v - 9 = 16. Let l be 8710/(-4) + v/10. Let y = l + 4259/2. Find the common denominator of 49/5 and y. 10 Let t be (-3)/(11/(-4) + 3). Find the common denominator of 9/2 and (-27)/t(-10)/11. 22 Let q be (-919)/3 - 2/(-6). Let z = -989/3 - q. Find the common denominator of z and -20/7. 21 Let d be 2/3 + 92/6. Suppose -5t + 71 = d. Suppose 4u - 2u = 4. Calculate the lowest common multiple of u and t. 22 Suppose -5s = -41 + 1. Let w(y) = 11y - 1. Let p be w(1). Suppose p = d - s. Calculate the smallest common multiple of 20 and d. 180 Suppose 3h = 3k + 42, -4h + 34 + 23 = -3k. Calculate the smallest common multiple of 12 and h. 60 Suppose 0s = -3s + g + 7, 2g + 12 = 5s. Let z(r) = -r*3 + 9r*2 - 8r + 11. What is the smallest common multiple of z(8) and s? 22 Let c = 31/30 + -557/60. Calculate the common denominator of (-1 + (-3)/(-4))79 and c. 4 Suppose 19 + 11 = 5q. What is the lowest common multiple of q and 10? 30 Suppose -3d - 8 = -2x, 0 = 5d - 2d - 12. What is the smallest common multiple of 1 and x? 10 Suppose 5w + 384 - 964 = 0. Let b be -1 - (-13 - (-1 + 1)). What is the common denominator of w/(-22)(-3)/b and 95/2? 22 Let u = 7382 + -44179/6. Calculate the common denominator of u and 40/7. 42 Let a = -1 - -5. Calculate the smallest common multiple of 11 and a. 44 Let l be 1/3 - 640/(-6). Suppose -359 = -3h - l. Calculate the common denominator of -1 - 3/(h/62) and -85/8. 56 Let c = -31 - -19. Calculate the common denominator of 15/4 and ((-2)/c)/(4/498). 4 Let m be (3/69)/((-2)/222). Let j = 1829/460 + m. Let l = -97469/22 + 4432. What is the common denominator of j and l? 220 Let v(s) = -3s*3 - 2s*2 - 2s - 1. Calculate the smallest common multiple of v(-1) and 34. 34 Suppose 6a = 4a - 8. Let s(l) = l*2 - 2l - 6. What is the least common multiple of 18 and s(a)? 18 Let g = -56 + 29. Suppose -z - 17 = 1. Let t = z - g. Calculate the smallest common multiple of t and 10. 90 Let n be 2 + (221)/3. Suppose 5g + n = 86. Suppose -5k + 8 = -4k. Calculate the lowest common multiple of k and g. 56 Find the common denominator of (-12)/27-46 + (-6)/(-27) and -63/44. 132 Let w(r) = 318r*2 + 2r + 3. Let g be w(-3). Let n = -22911/8 + g. Find the common denominator of (-76)/(-10) + 2/4 and n. 40 Let i = -18422312/1363 - -13516. Let j = i + 31413/21808. Find the common denominator of j and -89/14. 112 Let x(a) = 2*a + 23. Calculate the smallest common multiple of x(-8) and (4 - -1) + (-1 - 0). 28 Let l be ((-891)/4)/(-3) + 1. Let h = l + -89. Calculate the common denominator of h and -71/2. 4	{ "pile_set_name": "DM Mathematics" }
- 2h3 + 0h*3. Let d be r(-8). Suppose v = -3q - 3, 3q + 274v - 24 = 270v. Put q, 1, d, -2 in descending order. d, 1, -2, q Let s = -21.5 - -21.8. Let w = 3101663/87 + -35652. Let t = w - -1/29. Put t, s, -2/7 in ascending order. t, -2/7, s Let f = 108 - 96. Suppose 0 = fb - 40 - 20. Suppose 2r = 5r - 5l + 15, 5r - l = -3. Put r, -7, b, -5 in descending order. b, r, -5, -7 Let l = 5053 - 5051. Sort -1/2, -15/17, l in descending order. l, -1/2, -15/17 Let r be ((-2 + 3)8)/(-16 - -18). Sort 16, r, -7 in descending order. 16, r, -7 Let n = 6 - 5.7. Suppose -b + 3d + 35 = 0, -3d = -2b - 6d + 52. Suppose 4c + 3y + b = 0, 7 = -c - 5y - 13. Sort 2/7, c, n in ascending order. c, 2/7, n Let n = 50.6 + -11.6. Let v = n + -38.79. Sort 0, v, 3, 0.1 in ascending order. 0, 0.1, v, 3 Let g = 6.9 + -8.3. Let b = 0.2 - 1.2. Let l = g - b. Put -5, l, 1 in ascending order. -5, l, 1 Suppose 3q + 3 = 3z + 36, -3q = 4z - 33. Suppose q = m + 5w, -16 = -2m - 2w - 2w. Suppose -4x - 2 = -m. Sort -4, x, 4 in descending order. 4, x, -4 Let k = -8266 - -8267. Let c be (-11)/(-2) + (-9)/6. Sort k, c, 0 in descending order. c, k, 0 Let y be (-16100)/(-2576) - (6 - 0). Sort -2/15, 1, y, -25/2 in ascending order. -25/2, -2/15, y, 1 Let o = 1.1 + -0.7. Let x = 2.2 + -91.2. Let n = x - -88. Put o, n, 3 in ascending order. n, o, 3 Suppose 0 = 6i + 18. Suppose 2c + 8 = 4k - 2, 2c - 14 = -4k. Sort 11, c, -5, i in decreasing order. 11, c, i, -5 Let g = -140 + 130. Let j be (g/(-20))/((-1)/(-6)). Sort j, -0.1, 1, -1 in decreasing order. j, 1, -0.1, -1 Let r = 121/84 + -7/12. Let p = r - 46/21. Sort -2/11, 0.4, p, -1/11 in decreasing order. 0.4, -1/11, -2/11, p Let z = -7/5 + 2. Let s = 2.203 - -2.797. Sort s, -0.1, z in descending order. s, z, -0.1 Let x(i) = -7i2 + 174i + 21. Let f be x(25). Suppose -3u = 3p - 12, 0 = -2p - u + 5. Put p, f, -5, -28 in decreasing order. p, f, -5, -28 Let z be 3472/27300 + (-10)/65. Let m be 5 - (0 + 159/33). Sort m, 2, z in decreasing order. 2, m, z Let z(f) = -4f + 14. Let j be z(4). Let c = 8 - -63. Suppose -29 = -3g - 4w, -w + c = 2g + 3g. Sort g, -3, j. -3, j, g Let t be (8/(-30) - 0)/(14/(-105)). Sort t, 3, -0.0601 in increasing order. -0.0601, t, 3 Let h = 113 - 117. Let d be ((-29)/(-145))/(2/(-10)). Sort -11, 0, h, d in decreasing order. 0, d, h, -11 Let s = 4.87486 + 0.12514. Put s, -0.04, -0.022 in decreasing order. s, -0.022, -0.04 Let w = 67 + -107. Let o = -60 - w. Suppose -6t + 30 = -0t. Put o, t, 2 in decreasing order. t, 2, o Let d be ((-8)/(-6))/(-4) - (-53)/(-3). Let l be (93/6)/(3/d). Let o = 191/2 + l. Sort 0.5, 2, o, -8 in ascending order. -8, 0.5, 2, o Let k = -477 - -262. Let t = k - -214. Sort 17, -3, -2, t in descending order. 17, t, -2, -3 Let c(b) = 247b - 494. Let x be c(2). Let m be (-6)/(-4)(-58)/3. Sort 5, m, x, -4. m, -4, x, 5 Let g = 0 - 0. Let z = -0.408 - -3.618. Let m = -3.71 + z. Sort m, 4, g in decreasing order. 4, g, m Let y = -1192 - -5962/5. Put 4, 0.2, y, 0.08 in increasing order. 0.08, 0.2, y, 4 Let l = 162/5 + -65/2. Let q = -1135.4 + 1139.4. Put l, q, 0.4 in decreasing order. q, 0.4, l Let q = 347115/2 + -173557. Suppose -5u = -2u - 6. Sort 3, q, -2/3, u in descending order. 3, u, q, -2/3 Suppose 0 = -20819j + 20810j - 36. Sort 4, j, 2/27363 in descending order. 4, 2/27363, j Suppose 0o + 2i = -o - 11, -4o = 4i + 32. Let w(u) = -u*3 + 8u*2 + 10u + 23. Let b be w(9). Suppose 5a = b - 7. Sort -1, o, a, 0 in descending order. a, 0, -1, o Let t = -137.18 + 137.27. Sort 0.2, -5/29, t in ascending order. -5/29, t, 0.2 Let o = 0 - 9. Let i = 194.098 + -194.898. Sort o, i, -5 in descending order. i, -5, o Let x = -150 - -275. Let n = -194 + x. Sort 3/7, n, -4/9, -3 in decreasing order. 3/7, -4/9, -3, n Let n = -31 - -28. Let z(u) = -u3 + 4u*2 - 5u + 4. Let v be z(2). Suppose h - 2p = -11, vh + 28 = -3h + p. Sort -2, n, -1, h in decreasing order. -1, -2, n, h Let t = 510 - 505. Put 2/3, t, 33, -0.5 in decreasing order. 33, t, 2/3, -0.5 Let z = -3717 + 3712. Sort -4, 4, -215, z, 3. -215, z, -4, 3, 4 Let u = -0.09591 - -7.09591. Sort u, -1, -0.32, 0.2, 4. -1, -0.32, 0.2, 4, u Let c = 637/4 - 639/4. Sort 2.1, 1/8, c, 1 in decreasing order. 2.1, 1, 1/8, c Let u = -0.07 - 0.23. Let s(j) = -j3 + 10j*2 - 5j - 33. Let y be s(9). Let r(d) = 4d - 10. Let g be r(y). Put 4, -0.05, g, u in decreasing order. 4, g, -0.05, u Let n = 48 + 87. Suppose -9s - 36s = n. Suppose 0 = -0r + r - 5. Sort -2, 0, s, r in ascending order. s, -2, 0, r Let s be 4 + ((-2)/4)/((-3)/42). Let a(i) = 4i - 2. Let f be a(s). Suppose -48 = 6m + f. Sort m, -1/3, 2, 2/5 in decreasing order. 2, 2/5, -1/3, m Let a be ((-128)/12)/(-8) + (-8)/6. Let f = 3 - -2. Put -2, f, -5, a in decreasing order. f, a, -2, -5 Let v = 310721/28 - 11099. Let m = v + 9/28. Put -3, -0.32, m, -2 in ascending order. -3, -2, m, -0.32 Let d(w) = w3 + w2 - w + 7. Let f be d(0). Let o = -3 + f. Let k(r) = r*2 - 78r + 1. Let c be k(0). Sort c, o, 3 in decreasing order. o, 3, c Let u be (-21)/(-6) + (-2)/4. Let x be (-4)/(-20) - (-579)/5. Let g = x + -120. Sort g, u, 0 in ascending order. g, 0, u Let h = -5168 - -5168.13. Sort 0, 20, h in ascending order. 0, h, 20 Let x(b) = -37b - 441. Let t be x(-12). Suppose m = -2m + 9. Suppose -22 = mu - 7. Put u, t, 11 in descending order. 11, t, u Let k = -7.487 + 7.487. Put 1, k, 6, 5, 1/23 in ascending order. k, 1/23, 1, 5, 6 Suppose -6x = -4o - x - 655, o + 5x = -170. Suppose 86 = -53r + 96r. Sort o, 0, r in increasing order. o, 0, r Let m(p) = -p*2 - 9p - 3. Let r be m(-9). Let g be (5 + -4)r/15. Let t = 3149/20 - 781/5. Sort 0.4, g, 1, t in ascending order. g, 0.4, 1, t Let c(s) = 2s*2 + 304s - 3238. Let n be c(10). Let i = 4 + -6. Sort i, 6, n in increasing order. i, n, 6 Let f = 0.37 - -15.63. Let v = -0.59526 - 1.60474. Sort v, f, 4 in decreasing order. f, 4, v Let s = -22 + 88. Suppose -sc + 68c - 6 = 0. Let m(b) = b*3 - 5b*2 - 3. Let o be m(5). Sort o, -1, c in ascending order. o, -1, c Let x be (-46)/(-2) + 5598/(-311). Sort x, 13, -6, -5, 1. -6, -5, 1, x, 13 Let j = 9344 + -9337. Put -1, 12, j, -5 in ascending order. -5, -1, j, 12 Suppose 5j = -4g - 4, 17 = g + 5j + 33. Sort -0.8, 2/13, -1, g in ascending order. -1, -0.8, 2/13, g Let s(w) = -6w2 - 42w + 73. Let h be s(-7). Put 5, -4, h in ascending order. -4, 5, h Let r = 3.5 - -0.5. Let f = -207 - -151. Let d be 6/4 - (-91)/f. Sort 2/9, 1, d, r in descending order. r, 1, 2/9, d Suppose 3w = -18w - 3w. Sort -5, w, -80 in descending order. w, -5, -80 Let u be 1((-1)/(-6))/1. Let o(v) = v*3 + 34v*2 + 35v + 137. Let i be o(-32). Let y = i - 1068. Sort 0.3, y, -0.4, u in increasing order. y, -0.4, u, 0.3 Let s = 4982 - 4981.6. Suppose 3l - 1 - 11 = 0. Let q = 0.1 - 5.1. Put s, l, -0.2, q in decreasing order. l, s, -0.2, q Let k = -3.6 + -26.4. Let a = k + 59. Let d = 29 - a. Sort -0.5, d, -0.16. -0.5, -0.16, d Let p = -0.04 + -0.96. Let c = 908.3 + -907.9. Put -34, c, 5, p in decreasing order. 5, c, p, -34 Let b be 27 + (-7714)/609. Sort b, 4, 701, -5 in ascending order. -5, b, 4, 701 Let a be (31 - 2156/66)/((-5)/(-3)). Put 2, -4, 0, 1, a in ascending order. -4, a, 0, 1, 2 Let y be 8/14 - 35784/196. Let d = -464 + 464.2. Sort 3, y, d. y, d, 3 Let n = -0.0047 - -0.0122. Let k = 1.0925 + n. Put 0.1, -4/7, k, 3 in ascending order. -4/7, 0.1, k, 3 Suppose 0 = -25k + 143 - 118. Sort 50, -72, k in ascending order. -72, k, 50 Let p = 2.9 - 3. Let g = 0.3 + p. Let d = 0.01659 + -4.01659. Put d, 10, g in descending order. 10, g, d Let i(u) = 9u*2 - 29u - 12. Let z be i(4). Suppose zl = 20l - 16. Put -2, l, 11 in ascending order. -2, l, 11 Let q be 0 + 0 + 3/(-48). Let x = 288 - 285. Suppose -2g - 6 = 4r, -2r + xg = -2 + 1. Sort 2, q, r in decreasing order. 2, q, r Suppose -5n - 25 = 0, 0x - 170 = -5x + 3n. Suppose 0f = 4a - f + 22, -a - 11 = -3f. Put a, -3, x in decreasing order. x, -3, a Let r(g) = -6g + 22. Suppose 66 = 8z - 14. Suppose -zj = -12*j + 8. Let a be r(j). Put -5, a, 0, -1 in descending order. 0, -1, a, -5 Let d = 574897672902/6005 + -95736498. Let u = d - 2/1201. Sort u, -4/5, -1 in decreasing order. u, -4/5, -1 Let c = -183 + 187. S	{ "pile_set_name": "DM Mathematics" }
= -8. Let l(q) = q + q + 3q - vq. What is l(r(j))? -3j Let s(f) be the first derivative of -f2 - 12. Let l(a) be the first derivative of -a3/6 - a + 1. Let v(o) be the first derivative of l(o). Give s(v(g)). 2g Let c(f) = -7f2. Let z(u) = 226u*2 - 1. Determine c(z(s)). -357532s*4 + 3164s*2 - 7 Let l(u) = -31u. Let r(j) = -9j. Give l(r(q)). 279q Let s(h) = -h. Let b be 0 - 0 - (-3)/1. Suppose 2n - b - 1 = 0. Let i(v) = v + 0v - nv. Give i(s(u)). u Let d(n) = -235n. Let q(m) = -2m2. Give q(d(b)). -110450b*2 Suppose 2v + 4k = 12, 2v + 0v - 2k = 0. Let w(h) = -2h + h - vh + 2h. Let g(n) = -2n*2. Give g(w(d)). -2d2 Let r(j) = j2. Let o(d) = 7d2 + 5d - 5. Let c(s) = -s*2 - s + 1. Let i(q) = -20c(q) - 4o(q). What is i(r(h))? -8h4 Let t(j) be the first derivative of j2 + 2. Let n(q) = -q*2. Calculate t(n(s)). -2s2 Let r(n) be the first derivative of -n3/3 - 1. Let m(d) be the second derivative of -d*4/4 - 4d. Give m(r(a)). -3a4 Let r(k) = 0k - k - 3k. Let t(g) = -3g*2 + 2g + 2. Let v(s) = -16s2 + 11s + 11. Suppose -2 = 4b - 10. Let y(z) = bv(z) - 11t(z). What is y(r(o))? 16o*2 Let x(d) = 17d*2. Let l(s) = -5s. Calculate x(l(a)). 425a2 Let i(b) = -b. Let l(v) = -150v - 16. What is i(l(t))? 150t + 16 Let n(a) be the second derivative of -2a + 0 - 1/6a3 + 0a2. Let g(t) = -t2. Determine n(g(k)). k*2 Let x(s) = -2s*2. Let f(d) = -7612d. What is x(f(m))? -115885088m2 Let d(b) = 4587b + 1. Let v(a) = -a. Determine v(d(u)). -4587u - 1 Suppose 7c - 2d + 24 = 4c, -c + 2d = 12. Let l = -4 - c. Let p(q) = lq - 3q + 2q. Let f(g) = 4g2. Calculate p(f(y)). 4y*2 Let l(p) = -2p*2. Let k(m) be the first derivative of 19m*3 + 10. Give l(k(b)). -6498b4 Let f(x) = x. Let o(y) = y3 + 6y2 + 6y + 6. Let b be o(-5). Let s be 4/b(-4)/(-8). Let i(m) = 0m*2 - 6m2 - ms + 6m2. What is f(i(p))? -p2 Let u(j) = -j2. Let q(i) = 70i*2 - 3. Determine q(u(o)). 70o*4 - 3 Let k(v) = -69v - 1. Let u(x) = 2x2. Determine u(k(z)). 9522z*2 + 276z + 2 Let q(k) = -183k2 - 2k. Let a(f) = -14f2. Calculate q(a(y)). -35868y*4 + 28y*2 Let y(k) = -12k. Let z(t) = t. Let u(w) = 6y(w) + 68z(w). Let h(o) be the second derivative of o*3/3 + o. What is h(u(g))? -8g Let o(v) = v - 1. Let h(f) = 6f2 + 3f - 3. Let c(s) = -h(s) + 3o(s). Let y(x) = -2x*2. Calculate c(y(p)). -24p4 Let d(a) = -a2 + a + 2. Let s be d(3). Let f(i) = i*2 - 2. Let t(k) = -5k*2 + 9. Let h(q) = st(q) - 18f(q). Let w(n) = 5n. Calculate w(h(y)). 10y2 Let o(j) be the third derivative of -1/24j*4 + 0j + 0 - j*2 + 0j3. Let z(f) be the third derivative of f5/30 + 8f2. Calculate o(z(d)). -2d*2 Let d(j) = 10j*2 + 3j + 3. Let p(s) = 9s2 + 2s + 2. Let t(i) = -2d(i) + 3p(i). Let w(o) be the second derivative of -o*3/3 - 11o. What is w(t(v))? -14v2 Let b(d) = -9d. Let a(j) = -3j2 + 104j. What is b(a(l))? 27l2 - 936l Let i(u) be the third derivative of u*5/20 + 4u*2. Let r be 1/(-4) - 15/(-12). Let t(v) = -v - r + 1. Give i(t(f)). 3f*2 Let f(c) = 2c. Let w(t) = 6t2 + 5t + 5. Let b(x) = -7x2 - 6x - 6. Let g(y) = -5b(y) - 6w(y). Calculate g(f(u)). -4u2 Let s(k) = 53k. Let x(g) be the second derivative of g*3/3 - 47g. Determine s(x(v)). 106v Let h(p) = p2. Let n(i) = 3312i. Calculate n(h(x)). 3312x2 Let o(q) be the third derivative of -q4/24 - q2. Let a(l) be the second derivative of 0 + 4l + 2/3l3 + 0l*2. Calculate o(a(f)). -4f Let b(o) = -2o. Let i(x) = 5x - 5 + 5. Calculate i(b(t)). -10t Let t(k) = -40k*2. Let p(i) = -36i. What is t(p(j))? -51840j2 Let k(w) = -8w*2 - 9w*2 + 31w*2 - 13w*2. Let d(f) = -4f - 4. What is d(k(l))? -4l2 - 4 Let v(h) = 17h. Let l(o) = -992o. What is v(l(y))? -16864y Let a(b) = b. Let y(z) be the third derivative of -z*2 + 0z - 1/60z5 + 0z*3 + 0z4 + 0. Calculate a(y(r)). -r2 Let q(d) = -10d2 + 14d - 14. Let i(g) = 2g2 - 3g + 3. Let u(l) = -14i(l) - 3q(l). Let y(t) = -9t2. Determine u(y(c)). 162c4 Let r(p) = -p2. Let w(s) = -2s2 - 13. Calculate w(r(h)). -2h*4 - 13 Let b(f) = 10f + 6. Let x(j) = -8j - 5. Let o(c) = 5b(c) + 6x(c). Let w(g) = -g - 26. Determine o(w(p)). -2p - 52 Let z(j) = 283j2. Let u(y) = -5y*2. Determine u(z(r)). -400445r4 Let v(d) = d2. Let s be -1 + -1 + -2 + 7. Suppose -sr + 6 = -0r. Let g(y) = y*r - 5y + 5y. Determine g(v(z)). z4 Let u(l) = -l2 + 9. Let m(b) = -2 - 3 + 1 + 2. Let s(d) = -9m(d) - 2u(d). Let k(h) = -5h*2. Give s(k(x)). 50x*4 Let v(t) = -2t - 510. Let c(q) = 2q. Determine c(v(j)). -4j - 1020 Let i(z) be the first derivative of 1/2z2 + 0z - 3. Let v(s) = -5s. Determine v(i(f)). -5f Let r(j) = -10j. Let n(h) = 22h*2. Calculate n(r(i)). 2200i2 Let z(f) = f. Let p(d) = -d2 + 155d + 2. Calculate z(p(u)). -u2 + 155u + 2 Suppose 3b - 4w = 25, -2b - 2 + 14 = 2w. Let d = b + -5. Let c(l) = 5l2 - 2l2 - ld. Let v(m) = -3m. Give v(c(q)). -6q*2 Let d(x) = 2x - 6x - 6x. Let v(h) = -h + 0h + h - h. Calculate v(d(a)). 10a Let j(w) = -2w. Let a(b) be the second derivative of 0b*2 + 0b*3 - 5/12b*4 + 0 - 3b. What is a(j(d))? -20d2 Let q(y) = 2y*2. Let b(h) be the second derivative of 0 + 2h + 0h2 + 1/3h*3. Give q(b(i)). 8i*2 Let r(m) = -7m - 5. Let v(q) = 10q + 7. Let f(k) = 7r(k) + 5v(k). Let h(u) be the first derivative of -u3/3 + 2. Determine h(f(d)). -d2 Let p(l) be the third derivative of -l4/12 - 8l*2. Let c(f) = 8f. Determine c(p(k)). -16k Let j(s) = 2s*2. Let n(p) be the first derivative of 6p*3 + 21. Calculate j(n(x)). 648x4 Let p(i) = i2. Let s(y) be the first derivative of 0y2 + 0y + 7 - 1/3y3. What is p(s(a))? a4 Let l(x) be the third derivative of -19x*4/24 - 6x*2. Let i(t) = 2t*2. Give i(l(c)). 722c*2 Let n(f) be the first derivative of 0f + 3 + 1/2f2. Let j(c) = -4c. Calculate n(j(s)). -4s Let a(n) = 8n*2. Let k(p) = -152p*2. Determine k(a(z)). -9728z4 Let u(a) be the first derivative of a3/3 + 1. Let g(m) = 4m. Calculate g(u(v)). 4v*2 Let m(t) = -t - 5. Let j(h) = -h. Give m(j(d)). d - 5 Let k(f) = -59f*2 + 3f. Let t(w) = 7w. Calculate k(t(g)). -2891g*2 + 21g Let w(b) = 3b. Let c(u) = -2u*2 - 485u. What is c(w(z))? -18z2 - 1455z Suppose -3v + 9 = 4j, -4v + 0v - 4j = -8. Let w = 3 + v. Let p(t) = wt*2 + 0t*2 - 3t2. Let a(y) = y2. Determine p(a(r)). -r4 Let f(v) = v2. Let q(u) = 5u. Let d(w) = 11w. Suppose 0 = 4l - 0l - 5h - 35, 2h = 2l - 16. Let y(a) = lq(a) - 2d(a). What is y(f(i))? 3i*2 Let d(z) = 144z*2. Let r(u) = 4u*2. Determine r(d(g)). 82944g*4 Let x(s) = 6s. Let j be (-42)/(-63) + (-2)/3. Let p(a) be the first derivative of 1 - 1/3a3 + ja + 0a2. What is p(x(u))? -36u*2 Let w(f) = 1068f*2. Let p(s) = 6s*2. Give p(w(x)). 6843744x*4 Let l(h) = 18h. Let k(y) = 272 + y*2 - 272. What is k(l(x))? 324x2 Let p(h) be the second derivative of h4/12 - 19h. Let u(m) = 29m*2. Calculate u(p(b)). 29b4 Let u(g) = -g2. Suppose -50 = 4t + 10. Let n be 6/t - 24/(-10). Let r(s) = s + ns - s. Determine u(r(v)). -4v2 Let b(d) = -2d + 31. Let a(l) = 5l. Determine a(b(y)). -10y + 155 Let x(w) = 5w - 8. Let i(q) = 3q - 5. Let y be 20/30 + (-13)/(-3). Let g(l) = yx(l) - 8i(l). Let a(f) be the first derivative of -f*2/2 - 1. Give a(g(n)). -n Let v(x) = -22x - 12. Let k(n) = -9n - 5. Let c(m) = 12k(m) - 5v(m). Let w(g) = 7g. Determine w(c(u)). 14u Let r(b) = 2b*2. Let v(u) be the first derivative of 0u*2 - 3 + 0u - 4/3u3. Determine r(v(m)). 32m*4 Let r(i) = i. Let d(w) = -262w. Give r(d(g)). -262g Let f(o) = o - 13. Let q be f(14). Let d(m) = 2m + 1 - q. Let z(c) = 5c2. Calculate z(d(n)). 20n2 Let r(p) be the third derivative of p5/30 + p2. Let x(k) be the second derivative of -k4/6 - 21k. Calculate r(x(q)). 8q*4 Let b(r) = -11r*2. Let c(x) = 0x*2 - 2x*2 + 2x*2 + 3x*2. What is b(c(i))? -99i*4 Let k(b) = -6b. Let l(w) = 9w - 18. Calculate k(l(p)). -54p + 108 Let q(v) = 7v - 2. Let s(y) = 15y - 5. L	{ "pile_set_name": "DM Mathematics" }
+ 25. Let x be w(11). Suppose xp - 2 = -5. Suppose 3y - 6y = -5v - 16, 5v + 18 = 4y. Which is bigger: v or p? p Suppose 0 = c - 3, -5v = -2v + 5c - 66. Suppose -40 = -3z + 11. Is z greater than v? False Suppose 3m + 3i - 6 = -0i, -3i = -m + 14. Suppose 98 = 3q + 4h, -8q - mh = -3q - 160. Do q and 32 have the same value? False Let o be (-6)/4152/60. Suppose -4g - 5c = -244, -6g = -9g - 3c + 186. Let u = 63 - g. Which is bigger: u or o? u Let a(x) = -x2 + 2x. Let k = 10 - 9. Let z be a(k). Let g = 3 + -3. Is g not equal to z? True Suppose -b + 38 = 3a - 71, 0 = 5a + 3b - 179. Let j = -113/3 + a. Let m = 16/9 + j. Which is greater: 0 or m? m Let q = -334/5 - -25728/385. Which is greater: 1 or q? 1 Suppose 72c - 9 = 81c. Which is greater: -2/5 or c? -2/5 Let o(c) = c3 - 6c*2 + 4c + 5. Let y be o(5). Suppose yh + h = 7. Let n = 40 - 40. Which is greater: h or n? h Let f = 0.027 - -0.093. Let y = 0.02 - f. Are 0.27 and y non-equal? True Suppose -4a - 2g = 90, -5a = 2g - 0g + 112. Does -24 = a? False Let h = -63/2 + 31. Let c = -1/4 + h. Which is bigger: c or 1? 1 Suppose -3i - 8 = 2u, 4u + 4i - 3i + 16 = 0. Let x be ((-8)/(-18))/((-3)/18). Which is smaller: u or x? u Let z = 1/412 - -2459/5356. Is -0.9 at least as big as z? False Let x = 6.7 - 7. Let j = -1.77 - 4.23. Do j and x have the same value? False Let x = -119/33 - -3932/825. Is x >= 1? True Let r(h) = 1124h*2 + 8h + 7. Let f be r(-1). Which is greater: 0 or f? f Let a = -0.046 + -37.954. Let n = a - -37. Let q = 112 - 1233/11. Which is smaller: q or n? n Let x(f) = 3f - 16. Let o be x(4). Let b be 8/12 - (-88)/(-114). Which is smaller: o or b? o Suppose q + 2 = -h, -12q = h - 9q + 2. Let d(o) = o3 - 5o*2 - 5o - 5. Let x be d(6). Let c be 3 + x + 2h. Which is bigger: c or 1/6? 1/6 Let s be (-2)/(-2)(0 - -5). Let c = -8 + s. Let x be ((-4140)/81)/20 + 1. Which is smaller: c or x? c Suppose -q + 6q - 5 = 0. Let n = -300 + 5999/20. Which is smaller: q or n? n Let v(i) = -15i + 24. Let h be v(2). Which is bigger: h or -18? h Let u = -1 + -37. Let j = u + 20. Let s(m) = m*3 + 29m*2 + 60m + 145. Let o be s(-27). Which is smaller: j or o? j Let c = 266863/7 - 38239. Which is smaller: c or -117? -117 Suppose -q - 4q = 0. Suppose 0 = -2x + 3o + 16, -4 = o. Suppose qy - 2y = x. Which is greater: y or 2/15? 2/15 Suppose y - 3b - 24 = 0, -y - 7b + 20 = -9b. Is y > -4? True Let q = 258.98 - 259. Which is smaller: 2/83 or q? q Let p be (1/(-111))/(1/(-2)). Let m = 236/777 - p. Let k be -2 - (-1 + 0/(-2)). Is m greater than or equal to k? True Suppose 3u = -u - 44. Let r = 18 - 0. Suppose 5h + 49 = 3l, 2h - 3l = -l - r. Is u >= h? True Let w be (-18)/21 - (-581823)/(-567). Which is smaller: -1026 or w? w Let o be ((-4)/2770)/(9/(-60)). Let a = 7982/34071 + o. Let x = -88/697 + a. Is x greater than or equal to -1? True Let r(l) = -3l - 9. Let i be r(-8). Suppose 5n = 295 - i. Which is greater: 55 or n? n Let n = -223 + 119. Is -104 greater than or equal to n? True Let t(u) = -71u*2 - 445u + 5. Let p be t(-6). Let i = -27 - -147. Which is greater: i or p? i Let q be (-2)/(-16) + (-4380)/(-34080). Which is smaller: q or -1? -1 Let n(p) be the second derivative of 7p5/20 - p2/2 + 3p. Let x be n(-1). Let c = x - -4. Is c < -4? False Let a = 6 - 6.7. Let z = 0.82 + a. Let u = 1.12 - z. Which is bigger: u or -3/7? u Let w = 62 - 41. Let f = 1687 - 1664. Which is smaller: w or f? w Let r = -151 - -130. Which is smaller: -16 or r? r Suppose 5m - 17 = -137. Let v be m/((-1)/(-2) - -1). Let c be v/(-40)(-50)/(-8). Is 3 at least c? True Let k(v) = v*2 + 4v - 3. Let n be k(-5). Suppose 3w = nw + 2. Suppose 4h = 4g - 1 + 17, 0 = wg + h - 1. Which is bigger: -3/4 or g? -3/4 Suppose 8 = -4h - 8. Suppose 4k = 112 + 200. Let p be (2/(-20))/(3 + (-231)/k). Which is greater: p or h? p Let t = -326 - -330. Does 0.1 = t? False Let o be (5 - -1)/((-10)/(-5)). Let l be (o - 1) + (-1 - -4). Let m = -16 - -23. Is l > m? False Let f be (-6)/(-4) + 90/20. Suppose f + 6 = 4q. Let t be q - ((-600)/51)/(-4). Is -1 greater than t? False Let t = -27 + 27.7. Let l = t - -0.3. Is l greater than 2? False Let q be 11 - (-268)/(-24) - 1054/12. Are 5 and q non-equal? True Let o be 5 - (198/(-27))/(7624/(-5196)). Which is bigger: o or -1? o Let x = 858 - 605. Is x at most 251? False Let i be 48/20 + (-2)/5. Let h be (i/(-6))/((-2)/(-186)). Is h > -32? True Suppose -5p = -p - 20. Suppose 5 = pn, 2t + n - 2n = 93. Is 47 bigger than t? False Let z = -29899/28 + 4137/4. Which is smaller: z or -34? -34 Let d be 6/(-20)(-12)/(-318). Which is greater: d or -1? d Suppose -j + 13 = -0i + 2i, 5i - 2j = 10. Suppose -5g + ih = 9, -3g + 5h = h - 1. Let q be (-9)/(-15) - (-1)/g. Is 14 < q? False Let t = 129.2 + -131.2. Which is smaller: -608 or t? -608 Let p = -11.96 - -12.06. Which is smaller: -651 or p? -651 Suppose 4c - 39 = 5t, -4c = -5t + 9t - 84. Do c and 0 have the same value? False Let a be (-75)/30 - (-1)/(-2). Let v be a10/(-15) - 1. Which is bigger: 1/20 or v? v Let x = -4663/105 + 281/7. Is -3 equal to x? False Let x be (-3)/915 + 1. Is -2/33 >= x? True Suppose 17 = -10y + 127. Is y greater than 0.21? True Suppose n + j = -0j - 471, n + 3j + 479 = 0. Let b = n + 8875/19. Is 1 smaller than b? False Let p(y) = 55y + 63. Let t be p(1). Is 118 smaller than t? False Let u be 3((-28)/16 + 2)12. Let w(b) = b*2 - 5. Let y be w(-4). Is u <= y? True Let q = -4060 + 28422/7. Let x = 2 - 1. Let h be (2/(-4))/(2 + x). Are q and h non-equal? True Let h be (-4)/6 + (-426)/(-693). Let l = 669368 - 257706469/385. Let m = l - h. Which is smaller: 0 or m? 0 Let x = 1.23 + 0.17. Let f = x + -1.24. Let m = f + -0.36. Which is smaller: m or -1? -1 Suppose i + 7i = 24. Suppose l + 3l + 16 = 4h, -il = -4h + 13. Is 3/7 bigger than h? False Suppose 5v + d = -5, 0 = -5v - 2d + 4d + 10. Let w be v - (10 - 0)(-68)/85. Which is smaller: w or 9? w Suppose 4y + 89 = -79. Let f be 26/(-60) - y/105. Which is smaller: -1 or f? -1 Let m = -63.2 - -63.1. Which is bigger: -637 or m? m Suppose -c + 8 = 3c. Suppose cy = 3y - 10. Let j = -29225 - -29236. Which is bigger: j or y? j Let n(x) = x3 + 5x*2 + 9x + 9. Let s be n(-3). Which is smaller: s or 6/65? s Let b(o) = o*2 + 7o. Let z be (-1)/((-2)/(-56)4). Let t be b(z). Let a be (4/(-8))/(26/(-12)). Is a > t? True Let p be 10/12060. Do p and 1/792 have the same value? False Let n = 0.23 + -0.23. Let c be ((-9)/(-6))/(3/(-12)). Let y = c - -9. Is y not equal to n? True Suppose 3j - 1490 = -2771. Is j less than or equal to -1285/3? False Suppose 5x + 10 = 2v - v, 0 = 5x. Let f be (v/15)/((-1)/6). Let d(l) = 2l + 11. Let q be d(f). Is q less than 6? True Suppose 33 = -4n - 3v + 2v, 0 = 2n + 2v + 18. Are -10 and n nonequal? True Let p be (-280)/2660 - (410/(-1368) + 0). Which is smaller: -1 or p? -1 Suppose -3j - 29 = -5m, 2m + 0m - 11 = j. Let y be m/2(-35)/42. Is -1 less than or equal to y? False Let m be 3/(-5) + (0 - 1). Suppose -110g + 362g + 252 = 0. Is g less than or equal to m? False Let s be ((-2)/(-1))/((-9)/(-3) + -20). Are 1 and s non-equal? True Suppose -3o - 4 = -o. Let k = 65 - 55. Which is bigger: o or k? k Let j be 20/130 - 5/117. Let p = -181/756 + -2/189. Which is greater: j or p? j Let t = 153 + -151. Which is smaller: t or -86? -86 Let s = -0.117 + 10.967. Let c = s + -10. Let d = -0.15 - c. Which is smaller: d or 5/2? d Let h be (1 - 2)1 + 0. Let c be (-181)/955 + h/(-3). Let l = -2/191 + c. Which is smaller: -1 or l? -1 Let m = -13 + 4. Let n be 0 - 10/(-5) - 192/20. Which is smaller: m or n? m Let j = 77 - 115. Suppose 22n + 234 = 16n. Are n and j equal? False Let d(t) = -t*2 + 11t - 8. Let h be d(12). Let s = h + 17. Let m(n) = n*2 + 3n + 1. Let y be m(s). Does -6/13 = y? False Let h be (-83)/55 + 1073/1480 + (-1)/8. Let w be (-4)/14 + (-4)/(-14). Suppose w = 4v + v. Is v at most h? False Let t = 900 + -232201/258. Is 1 equal to t? False Let h be 2/(-8) - 26/(-8). Suppose hg = -2 - 1. Is g > -7? True Let l(x) = x*3 + 5x*2 - x - 5. Let n be l(-5). Suppose 4 = -nj - j. Let z be 52/39*(-1)/j. Which is bigger: 2/7 or z? z Let v = -1	{ "pile_set_name": "DM Mathematics" }
3, -1, g in decreasing order. 3, -1, g Let x be ((-6)/(-9) - 0)(3 + 3). Let j = -3 - 1. Put 1, x, j in decreasing order. x, 1, j Let m = -0.94 + 1.24. Let s = 0.5 + 0. Let k = -0.3 + -0.7. Sort k, s, m in increasing order. k, m, s Let d = 20 - 17. Sort 5, d, -5 in descending order. 5, d, -5 Let w be (6 + -9 + 8)1/4. Put 2, -12, w in increasing order. -12, w, 2 Suppose 0 = -4z + 5b + 41, 0 = z - 4b - 28 + 4. Sort z, -3, 2. -3, 2, z Let f = 91 - 90.5. Sort f, -2/5, -1, -3/4 in decreasing order. f, -2/5, -3/4, -1 Let i be (-24)/(-14) - (-8)/28. Let b be (-10)/(-15)(-15)/(-2). Sort b, i, -3. -3, i, b Let d = 1.2 - 1. Let h = 0.258 + 16.842. Let c = 17 - h. Put c, 0, d in decreasing order. d, 0, c Suppose -8 + 0 = -t - 2b, -4t - b + 4 = 0. Sort 4, t, -4. -4, t, 4 Let k = -50 - -51. Sort -2, 0, 2, k in increasing order. -2, 0, k, 2 Let a = -0.23 + 0.43. Sort -4, a, -2/7 in decreasing order. a, -2/7, -4 Suppose -2h + 9 = -x, -3x + 0x + 2h = 11. Let i(g) = -3g3 + g2 - g - 1. Let v be i(x). Let k = -23 + 20. Sort v, k, 0 in ascending order. k, 0, v Let o = -25 + 27. Put -0.038, -1/2, o in decreasing order. o, -0.038, -1/2 Let f(u) = 9u + 22. Let q be f(-5). Sort 0.4, -4, 5, q in descending order. 5, 0.4, -4, q Suppose -4n = -3k + 8, 0n + 4k = n - 11. Let q = 5 + -3. Let h(c) = -2c. Let g be h(q). Sort g, 3, n in increasing order. n, g, 3 Suppose 3h - 5 = -2h. Let t be (2 - h) + (-2732)/2415. Let w = 1/483 - t. Sort -5/6, 0.4, w. -5/6, w, 0.4 Let d = -2 - -1.8. Let s = -5 + 5.1. Let v = d + s. Put 0.1, -2/19, v in ascending order. -2/19, v, 0.1 Let g = 0.38 + 0.02. Let y = 0.3 - 0.2. Let m = -2.73 - -2.68. Put g, m, y in descending order. g, y, m Let v = -16771/15 + 1116. Let i = 12/5 + v. Let m = 133/3 - 45. Put -4/5, m, i in ascending order. -4/5, m, i Suppose 0 = 5u + 4 - 9. Let c = 2 - u. Sort 4, c, 7 in descending order. 7, 4, c Let s be (-4 - -9) + (-123)/24. Put s, 4, -1.2, -5 in descending order. 4, s, -1.2, -5 Suppose 2m + 8 = 2s, -5m = -m - 5s + 19. Suppose -3h - 4 + 10 = 0. Put -5, m, h in decreasing order. h, m, -5 Let l = -15 - -12. Let b = 2.8 - 3. Let c = b + 1.2. Put c, 4/3, l in increasing order. l, c, 4/3 Let r = 1 + 4. Suppose -3p + 5p = -rw - 7, 3p - 24 = 4w. Sort 2, 5, p. 2, p, 5 Suppose -4b + 12 = -5x, 5b - 4 - 2 = 4x. Let m(r) = -r + 9. Let l be m(7). Sort -3, l, x in decreasing order. l, -3, x Let t = -126 - -130. Let s = -3 + 5. Let a be (3 + -2 - s) + 3. Put -4, t, a in decreasing order. t, a, -4 Suppose -3i = n - 5n + 14, 3i = 2n - 4. Let c = -2 - 2. Sort i, c, -3 in descending order. i, -3, c Let n = 3 - 2.9. Let r = n - 0.5. Let y = -2.4 - r. Sort -3, y, -0.2 in decreasing order. -0.2, y, -3 Suppose 8l - 8 = 10l. Let a(q) = -q*3 - 5q*2 - 3q - 1. Let x be a(l). Sort -4, x, 4. x, -4, 4 Let d be 2 - (-4 + 8) - -3. Suppose 0p = -4p. Suppose -d = c - p. Put -5, c, 0 in ascending order. -5, c, 0 Let j = -99 + 98.6. Put j, 1/6, -0.1, -7 in ascending order. -7, j, -0.1, 1/6 Let n(a) = a*3 - 5a*2 + 4a. Let g be n(4). Let h be 3 + 1 - (-2)/(-1). Let v = 4 - h. Sort -3, g, v in descending order. v, g, -3 Suppose 10d - 11 + 1 = 0. Sort 4, -1, d, -2. -2, -1, d, 4 Let u be ((-2)/(-4))/(3/(-12)). Let x be 2/(-4) - 4/(-8). Suppose xc + c = 0. Sort 2, c, u in decreasing order. 2, c, u Let x be (1/6)/(2/18). Sort 1/10, x, -0.4. -0.4, 1/10, x Let k = -3.4 - -3.5. Let g = -1 + 0.84. Let r = 0.06 + g. Put k, r, 0 in ascending order. r, 0, k Let w = -83 + 88. Sort w, 0.4, 3, 1/4 in descending order. w, 3, 0.4, 1/4 Suppose 4y - 2 = -4i + 2i, 0 = 4y - 3i + 13. Let g be y/(1(-1)/(-4)). Sort 0.1, -0.5, g in ascending order. g, -0.5, 0.1 Let z be (-2)/414. Suppose -5w = 5, 0 = 3l + w - 49 + 11. Suppose -3b - 3f + 15 = 0, l - 4 = 5b + f. Put -1, b, z in descending order. b, -1, z Let i = 15 + -10. Put 2, -4/7, 1/4, i in decreasing order. i, 2, 1/4, -4/7 Let u = -1.2 + -9.8. Let r = u - -8. Let p = 0.29 + 0.21. Put 5, p, r in ascending order. r, p, 5 Let v = 2.78 - -0.22. Put v, 5, -1 in descending order. 5, v, -1 Let a(v) = -v3 + 7v*2 + v - 7. Let h be a(7). Sort -1, -5, h in descending order. h, -1, -5 Let b = 0.51 - -0.09. Let n = -0.4 + 0.6. Let z = n - b. Put 0.3, -2, z in increasing order. -2, z, 0.3 Suppose -8 = 2f - f. Let o = -4 - f. Let x = -8 - -10. Sort -1, x, o in descending order. o, x, -1 Let c = -8 + 12. Suppose -v - 2 = -cb - 6, 4b = 0. Put v, -4, 1 in descending order. v, 1, -4 Suppose -1 = -2u + u. Let p be (3 - u)/(4/(-10)). Put -2, -3, p in descending order. -2, -3, p Suppose -4b + b + 3w - 3 = 0, -3 = 3b - 4w. Suppose 4g = g. Sort b, 4, g in decreasing order. 4, g, b Suppose o - 3h = 2h - 1, -4o - 4 = h. Let d be -3 + o - (4 - 5). Sort 4, 0, d in descending order. 4, 0, d Let r(n) = n3 + 4n*2 - 6n - 5. Let d be r(-5). Let g = 4 - 9. Put g, 2, d in descending order. 2, d, g Let h(j) = 13j3 - j2 - j + 1. Let g be h(1). Suppose 20 = 5t - 0t + 4p, p = -3t + g. Let c be 0 + (-2)/t-8. Put 0, c, -6 in descending order. c, 0, -6 Let r be 136/28 + 2/14. Sort -5, 7, r. -5, r, 7 Let s = 49 - 53. Sort -1, -5, 3, s. -5, s, -1, 3 Suppose 0 = q - 4r - 16, -2q + 0r = 3r + 1. Let c = 3 + 5. Let l be -1 - c/(-12) - -1. Put l, q, 3 in ascending order. l, 3, q Suppose 2q - 12 = 4j, 4q - 2j - 12 = 6. Put q, 6, 3 in descending order. 6, q, 3 Let t be 5 - 3 - 31/4. Let n = t - -11/2. Sort 0, 5, n in decreasing order. 5, 0, n Let l be 9/(-2) - 3/6. Let b be ((-1)/5)/(3/l). Sort -1/5, 1, b in ascending order. -1/5, b, 1 Let c be (-104)/22(-4)/16. Let h = -14077/5 + 309813/110. Let w = h - c. Put w, 0.5, -2 in descending order. 0.5, w, -2 Suppose -2b + 20 = 3b. Suppose 4c = bv + 16, -c + 3v + 12 = -2c. Suppose c = g - 3g. Sort 5, -1, g in descending order. 5, g, -1 Let y = 0.02 + -0.1. Let r = 0.38 + y. Sort -2, r, 0.4 in decreasing order. 0.4, r, -2 Let u = 0.26 + 1.94. Let x = -8.2 + 8. Let a = x + u. Sort a, -2, 0.3. -2, 0.3, a Suppose 2n + 30 + 50 = 0. Let z be -2 + (n/28 - -3). Sort z, -17, 2/3 in increasing order. -17, z, 2/3 Let a = 3.9 + -3. Let c = -4.9 + a. Put c, -2/7, 0.5 in decreasing order. 0.5, -2/7, c Let f(l) = l3 - 4l*2 + 6l - 4. Let c be f(4). Suppose -2r + c = 3r. Suppose 9 = -5g + rh, -8g - 3h = -4g + 1. Put 4, 3, g in ascending order. g, 3, 4 Let u = -16 - -14. Let g = 4/23 - -7/92. Sort 2/13, g, u. u, 2/13, g Let c = 0.3 - -3.7. Suppose 0 = -2g + 4t - 8, 1 + 5 = 2t. Sort c, g, 0.2 in decreasing order. c, g, 0.2 Let j be -2 + (-2 - 18/(-3)). Suppose 0 = -c - jc. Sort 4, -5, c. -5, c, 4 Let v(d) = 3d*2 - 1. Let w be v(1). Let o be w + -2 + 10/2. Let u be ((-4)/10)/(2/(-10)). Sort u, 2/9, o in descending order. o, u, 2/9 Let s be (4/(-5))/((-2)/5). Suppose -3u = z - 10, -su - 2u - 3z + 10 = 0. Suppose 3c + 9 = ua, 20 = 5c + a + 4a. Sort -4, -2, c. -4, -2, c Let v = 4 - 5. Put v, 3, -3 in ascending order. -3, v, 3 Let s = -0.62 - -0.22. Let v = -1/6 + -1/6. Put s, -3/2, v in decreasing order. v, s, -3/2 Let k = -8.3 - -8. Let w = 8 + -5. Let b = -2.7 + w. Put 2, k, b in decreasing order. 2, b, k Suppose 2u + 3 + 7 = 4v, -v = u + 2. Sort 0, 9, v. 0, v, 9 Let n = -2.2 - -2.7. Put -7, -2/9, n in descending order. n, -2/9, -7 Let w(u) = 17u*2 - u + 1. Let t be w(1). Suppose -3 = -5n + t. Sort 3, -2, n in descending order. n, 3, -2 Let t = 3 - 3. Let k = -50 - -47. Sort t, k, 1 in ascending order. k, t, 1 Suppose -6 - 6 = -3f. Suppose 3a - a = f. Let j = -1 - -1. Put j, a, -4 in descending order. a, j, -4 Let k = -84 - -417/5. Put 2, k, 3 in decreasing order. 3, 2, k Let g = -40 - -39.89. Sort g, -5, -3 in ascending order. -5, -3, g Let d(f) = -3f + 1. Let k be d(-1). Suppose -4 = 2a - s, 5s - 4s = -2a - 4. Sort 2, k, a in decreasing order. k, 2, a Let u = 3.9 - -0.1. Put -1, u, -3/2 in decreasing order. u, -1, -3/2 Let t = 2.9 + -2.6. Put -1/7, t, 0.1 in ascending order. -1/7, 0.1, t Let l = 902/5 + -181. Sort 0.3, 2/11, l, 3. l, 2/11, 0.3, 3 Let l = 0.25 + 0.03. Let t = 0.08 - l. Sort -1/3, -2/7, t in decreasing order. t, -2/7, -1/3 Let h(d) = -d3 + 4d*2 - 4d + 3. Let p be h(2). Suppose 8a - 7a = -24a. Let i(m) = m2 + 3m + 2. Let b be i(-3). Sort b, p, a. a, b, p Suppose	{ "pile_set_name": "DM Mathematics" }
he greatest common factor of 237 and 123? 3 Calculate the greatest common factor of 16476 and 12. 12 What is the highest common divisor of 2480 and 30? 10 Calculate the greatest common divisor of 700 and 8542100. 700 What is the greatest common factor of 320 and 46760? 40 What is the greatest common divisor of 530 and 1866395? 265 What is the greatest common divisor of 785409 and 582? 291 Calculate the greatest common divisor of 288 and 774. 18 Calculate the greatest common divisor of 193989 and 6. 3 Calculate the greatest common divisor of 155 and 339680. 5 Calculate the greatest common divisor of 2013698 and 62. 62 What is the greatest common factor of 170172 and 18? 18 What is the greatest common divisor of 72 and 80118? 18 What is the greatest common divisor of 444 and 584230? 74 What is the greatest common factor of 87327 and 27231? 939 What is the greatest common factor of 25016 and 177? 59 What is the highest common factor of 696112 and 64? 16 What is the greatest common divisor of 120 and 12435? 15 Calculate the highest common factor of 220577 and 21. 7 What is the greatest common factor of 54225 and 432? 9 Calculate the highest common factor of 6096375 and 9. 9 What is the greatest common divisor of 378 and 2877? 21 Calculate the highest common factor of 183431 and 118. 59 What is the highest common divisor of 2194190 and 34? 34 Calculate the highest common divisor of 2852192 and 3264. 544 What is the greatest common factor of 67 and 806881? 67 What is the greatest common divisor of 106 and 28037? 53 Calculate the greatest common factor of 900864 and 621. 207 What is the greatest common divisor of 18981 and 23256? 171 What is the greatest common divisor of 318 and 72186? 318 Calculate the highest common factor of 43119 and 1431. 27 What is the greatest common divisor of 447583 and 57? 19 What is the highest common divisor of 1359 and 72178? 151 What is the greatest common factor of 593328 and 24? 24 Calculate the greatest common factor of 955140 and 12. 12 What is the greatest common factor of 31 and 1302961? 31 Calculate the greatest common divisor of 550 and 80075. 25 What is the highest common divisor of 103682 and 183098? 2206 Calculate the highest common divisor of 1228607 and 85. 17 What is the greatest common factor of 475 and 15325? 25 Calculate the highest common factor of 23328 and 20898. 486 Calculate the highest common divisor of 68174 and 383. 383 Calculate the greatest common divisor of 49 and 14609. 7 What is the highest common factor of 125 and 3035? 5 What is the highest common divisor of 9151530 and 67? 67 What is the highest common factor of 32058 and 90? 18 Calculate the highest common factor of 52871 and 539. 49 What is the highest common factor of 7422747 and 1527? 1527 Calculate the highest common divisor of 333 and 433640. 37 What is the highest common factor of 203377 and 87? 29 Calculate the greatest common factor of 35 and 398405. 35 Calculate the highest common divisor of 5824 and 49868. 364 Calculate the highest common divisor of 880 and 5850020. 220 What is the greatest common divisor of 18874 and 118? 2 What is the greatest common divisor of 1957592 and 312? 104 Calculate the highest common divisor of 46 and 19067. 23 What is the greatest common divisor of 957386 and 314? 314 Calculate the highest common factor of 14337 and 767. 59 What is the highest common divisor of 171589 and 6897? 209 What is the greatest common factor of 45 and 147? 3 Calculate the highest common factor of 7452 and 259164. 828 What is the highest common divisor of 23769 and 340272? 1251 What is the highest common divisor of 2323 and 7084? 23 Calculate the highest common divisor of 24897 and 9264. 579 Calculate the highest common factor of 2185 and 253345. 115 What is the greatest common divisor of 348 and 2059? 29 What is the highest common factor of 378 and 6342? 42 What is the highest common factor of 1792 and 2513? 7 Calculate the highest common factor of 2532251 and 5046. 841 What is the highest common divisor of 81 and 165? 3 What is the greatest common factor of 235 and 24865? 5 Calculate the highest common divisor of 8064 and 4515. 21 What is the highest common divisor of 157 and 1061477? 157 Calculate the highest common divisor of 434245 and 190. 95 What is the highest common divisor of 222 and 10101? 111 Calculate the greatest common divisor of 1551 and 825. 33 Calculate the highest common divisor of 105 and 41685. 105 Calculate the greatest common factor of 957 and 21516. 33 What is the highest common factor of 8043 and 33321? 1149 Calculate the highest common factor of 1108 and 44874. 554 Calculate the greatest common factor of 7498 and 17604. 326 What is the highest common factor of 40 and 1901300? 20 Calculate the highest common divisor of 161 and 149017. 23 Calculate the highest common factor of 5624 and 3848. 296 Calculate the highest common divisor of 282 and 20586. 282 What is the greatest common divisor of 1014 and 167817? 507 What is the greatest common divisor of 16470 and 14762? 122 Calculate the greatest common divisor of 60 and 1975110. 30 What is the highest common factor of 3142 and 18? 2 What is the greatest common divisor of 56 and 89992? 56 Calculate the highest common divisor of 1111440 and 55. 55 Calculate the highest common divisor of 46536 and 888. 24 Calculate the greatest common factor of 1655 and 355. 5 What is the highest common divisor of 3800 and 60? 20 Calculate the greatest common divisor of 13481 and 4394. 13 What is the highest common factor of 116343 and 135? 27 What is the highest common divisor of 855 and 45999? 171 What is the highest common divisor of 540 and 2412? 36 What is the greatest common divisor of 5124808 and 104? 104 What is the highest common divisor of 70027 and 14101? 239 What is the greatest common factor of 407 and 28934? 37 Calculate the greatest common factor of 240 and 13395. 15 Calculate the highest common divisor of 3387 and 48. 3 Calculate the highest common factor of 92245 and 380. 95 What is the highest common divisor of 8 and 146? 2 Calculate the highest common factor of 233292 and 12. 12 Calculate the greatest common factor of 180 and 3711. 3 What is the greatest common factor of 6104 and 77063? 763 Calculate the greatest common divisor of 494 and 112138. 494 Calculate the highest common divisor of 588962 and 198. 22 What is the greatest common factor of 1 and 16396? 1 Calculate the greatest common divisor of 548530 and 665. 95 Calculate the highest common divisor of 220 and 238060. 20 What is the greatest common factor of 28261 and 59? 59 Calculate the highest common divisor of 403806 and 39. 39 What is the highest common factor of 10465 and 49335? 1495 Calculate the greatest common factor of 2127 and 4. 1 Calculate the highest common divisor of 1391320 and 105. 35 Calculate the greatest common divisor of 432 and 720. 144 What is the highest common factor of 284 and 2843692? 284 Calculate the greatest common divisor of 51016 and 1400. 56 Calculate the highest common divisor of 2280698 and 56. 14 What is the greatest common factor of 108 and 69705? 9 What is the highest common factor of 5346 and 42834? 66 What is the highest common divisor of 855 and 11400? 285 Calculate the greatest common factor of 4350 and 522. 174 What is the greatest common factor of 29100 and 2100? 300 What is the greatest common divisor of 81143 and 53? 53 Calculate the greatest common divisor of 8448 and 228. 12 Calculate the greatest common factor of 54 and 249534. 54 What is the highest common factor of 32 and 300952? 8 Calculate the highest common divisor of 57 and 62529. 57 Calculate the greatest common factor of 82520 and 1240. 40 Calculate the highest common factor of 559776 and 2176. 544 Calculate the greatest common factor of 4181 and 1813. 37 What is the greatest common factor of 154947 and 609? 87 What is the highest common factor of 8 and 316? 4 Calculate the highest common divisor of 56800 and 208. 16 Calculate the highest common divisor of 57379 and 98. 49 Calculate the greatest common factor of 1287940 and 10. 10 Calculate the greatest common factor of 21590 and 19685. 635 Calculate the highest common divisor of 390 and 182130. 390 What is the highest common factor of	{ "pile_set_name": "DM Mathematics" }
mplify ((u*(8/3)u)/u)47/(u(-16)u(-5/6)) assuming u is positive. u(853/6) Simplify (((p11/p)/p)/p)(-15)/((((pp*24)/p)/p)/pp*32p) assuming p is positive. p(-175) Simplify ((c(-11/2)c)/((cc/(c*(-5)c))/c))/((c*(-31)c)/c(-15)) assuming c is positive. c(11/2) Simplify (f/f*(-4/11)f(-1/7))/(f(1/7))(-5/9) assuming f is positive. f(901/693) Simplify (((tt(-1/4)t)/(t*3t))(-3/19))(-11) assuming t is positive. t*(-297/76) Simplify (uu*(14/3)uu)(-1/64)/(uu/(uu/(uu*(3/7))uuuu)u)(-4/3) assuming u is positive. u(-2977/1344) Simplify ((j*(1/35)(jj(-4)j)/j)(-39))(-20) assuming j is positive. j(-16224/7) Simplify (w(4/3))*13w*(3/4)w0 assuming w is positive. w(217/12) Simplify (i/(i/((i/i*15)/i))(i*2i)/ii)/(i(-4))30 assuming i is positive. i108 Simplify (uu/(u(-22)/u))/u(1/2)((uu*(-12))/uu)(-27) assuming u is positive. u(643/2) Simplify f/((f/f*(-2/11))/ff)ff/(f/(f/(f/(((f/f*18)/f)/f))))fff/(f/(f/(f/f*(1/16))))ff(5/4) assuming f is positive. f(-2441/176) Simplify (vv*15v*17v)/(vv/(vv(-6)))(1/6) assuming v is positive. v*(197/6) Simplify (yy/y*(-19)(y/(((y/((y*(13/7)y)/y))/y)/y))/y)(-42) assuming y is positive. y(-1002) Simplify i*(-23)ii/i(-13)i/(i/i*(5/9))i(-26) assuming i is positive. i(-301/9) Simplify (r(-11))(-3/16)r(10/9)r*(3/16)r assuming r is positive. r*(157/36) Simplify hh*4h/h*(5/6)hh(-11)hh/(hh*5)hhh assuming h is positive. h*(-35/6) Simplify (ll*(3/4)l)/l*(2/21)(ll1)(-2/9) assuming l is positive. l(557/252) Simplify (mm*(-1/6)((m/(m/m*(-2/3)))/mm)/m(mm*(-6/11)m)/m2)(2/13) assuming m is positive. m(-7/33) Simplify (s27s(-3)/s)(-48) assuming s is positive. s(-1104) Simplify (i(-2/17))(-6/17)i*(-2/9)iii*(-2/13)i assuming i is positive. i(90127/33813) Simplify (r(1/34))(11/3)/(r(-11)r)(2/31) assuming r is positive. r(2381/3162) Simplify (d/(d(-15)d))/d*(1/4)d*(1/12)(d((ddd(8/7)/d)/d)/d)/d assuming d is positive. d(629/42) Simplify (y/((yy*12y)/y)y)32/(y(2/17)yy(-19)) assuming y is positive. y(-5680/17) Simplify (nn/n(-2/17))(8/17)(n(-10/3)/n)/n17 assuming n is positive. n(-17632/867) Simplify qq*2(q/(q(q/q(5/6)q)/q))/q(qq(-1/5))(8/7) assuming q is positive. q(577/210) Simplify (t/t(-19)t(-4))/(t(-1/36)(t/(t/t32))/t) assuming t is positive. t(-539/36) Simplify ((a/(a(-5/9)/a))/a(4/19))/(((a/(a((a/(a/a20))/a)/aa))/aaa)/aa18) assuming a is positive. a(572/171) Simplify ((i(-2/21)/((i(-7/5)i)/ii))/(i4)(-19))(-22) assuming i is positive. i(-176264/105) Simplify (i(3/19)i/(ii(ii(-37)i)/ii))(-1/35) assuming i is positive. i(-649/665) Simplify a(-5/3)a(a/(a19/a))/a(a/(aa(-4/17)))/(aa/(((a/(aaa/(aa(-16)/aa)))/a)/a)) assuming a is positive. a*(-2011/51) Simplify (hh*(3/14)h)/h*(-1/17)(h(-1/2))(1/9) assuming h is positive. h(2375/1071) Simplify ((d(-1/22)/d)(-1/12))(-12/13) assuming d is positive. d(-23/286) Simplify q8(q/((q(-7)/q)/q))/q(q(qq(-2/3))/q)(-7) assuming q is positive. q*(44/3) Simplify (qq(-3))(-48)/((q(q(-1/4)q)/q)/q(-8)) assuming q is positive. q(349/4) Simplify (i*(-14/5)i)*(-3/2)/((i/(i/(i(i*(-3/2)i)/i)))/(ii(2/13))) assuming i is positive. i(283/65) Simplify q(-4)/(q/(q2q))q(12/11)q(-3) assuming q is positive. q(-43/11) Simplify (((g(-2)/g)38)8)(2/71) assuming g is positive. g*(-1824/71) Simplify cc*(-4/9)cccc(4/7)/c(c/(c/(cc/(cc*(5/3)c)c)))(-18) assuming c is positive. c(953/63) Simplify (y(-15)/y(yyy*(2/9)y)/y)/(y*(3/5)yy(1/5)) assuming y is positive. y(-701/45) Simplify ((ccc(5/11))(-14))(4/5) assuming c is positive. c(-1512/55) Simplify zz/(z/(z/(z*(-1/3)zz)))z*17(zzzzz*(-7/4)/zz)/z(-2/5) assuming z is positive. z(1199/60) Simplify ((x/(x/x(-2/3)))/x)(1/31)(x(-2/13)/x)44 assuming x is positive. x(-61445/1209) Simplify (j/j(-7/5)jj(-35))(1/12) assuming j is positive. j(-79/30) Simplify (z(2/13)(zz(((z/(z/z*12)z)/z)/zz)/z)/z)/(z/(z(2/17)/z))(-2/29) assuming z is positive. z(78726/6409) Simplify ((v/v(2/13))/vvv15/v)/(vv/v7)41 assuming v is positive. v(2858/13) Simplify (y/(((y/(y/(y22/y)))/y)/yyy))/(yy/(y(8/5)yyy))y/y(2/7)y/(y/y*(-6)y) assuming y is positive. y*(-829/35) Simplify ((yy(-1))(-6/7)(y(y/y(-1))/y)2)(2/47) assuming y is positive. y(8/47) Simplify (((a/(a/(a/(a*6/a))))/a(a*(1/3)/a)/a)/(aa/(a*(-8)/a)(aa4a)/a))45 assuming a is positive. a(-1020) Simplify ((y/(yy(y*(2/125)y)/yyy)y)/y13)/((y/(y16/y)y)/y(11/2)) assuming y is positive. y(871/250) Simplify (z/(zz11))/z5(z*8z)/((z(1/19)/z)/z) assuming z is positive. z(-96/19) Simplify ((h/(h*(-3/4)h)h)/h28)/(h/(h(h*(-3/10)h)/hh)h)(-2/7) assuming h is positive. h(-3663/140) Simplify (h(-1/7))(14/9)/(h*(1/19)/(hh*(1/31)h)) assuming h is positive. h*(9316/5301) Simplify ((u(u/(uu0/u)u)/u(u(uu(uuu*(-5))/uu)/u)/u)(-34))(12/7) assuming u is positive. 1 Simplify (l*(-1/20)ll(4/15))(-5/9) assuming l is positive. l(-73/108) Simplify z(-5/3)z*35(z/(z/(zz(-24))z))(-1/22) assuming z is positive. z(1136/33) Simplify ((c/(c/(((c*(8/11)c)/c)/ccc)))/c(-5/3))(-19/2) assuming c is positive. c(-1064/33) Simplify ((c7c)/cc(2/15))20 assuming c is positive. c(428/3) Simplify (j/j(-4/5)j/j(1/25))/(((j(3/4)/j)/jj)/jj(4/7)j) assuming j is positive. j(1707/700) Simplify ((j/(j/j(-10)))/(j*(2/27)j))/((j*9j)/j)(-2/111) assuming j is positive. j(-10901/999) Simplify (z/((zz0)/z))(-3/10)/(((zz*(-1/6)z)/zz)/(z/(z/(zz*(-4)z)z))) assuming z is positive. z(-77/15) Simplify i13ii(-5/7)(ii(-6/5)/ii)/(ii(2/33)) assuming i is positive. i(13889/1155) Simplify (m(-1/4)/m)6/((mm*(-1/15))/(mm/m*(-1)m)) assuming m is positive. m*(-133/30) Simplify (qq*(-3)q)*32(((q/((q/q*(3/5))/q))/qq)/q)/((qqq5)/q) assuming q is positive. q(-187/5) Simplify ((k*(1/16)/k)/kk9/k)/(k(-1/7)/(((k(k/((k(-3/7)kkk)/k)k)/k)/k)/k)) assuming k is positive. k(519/112) Simplify ((dd*(-7)d)/d)*2(d(d/(d18d))/d)/(ddd(-9)) assuming d is positive. d(-23) Simplify ((y(-1/11)/y)/y(1/14))/((y/y*(-2/5))/yy)(-7) assuming y is positive. y(6651/770) Simplify ((l*(-3)lll*(2/5))/((ll*3)/lll(2/9)))(-6/7) assuming l is positive. l(62/15) Simplify (((((t/((t0t)/tt))/t)/tt)/t)/(t(t/(t(-4)/t))/t)(t(-3)/t)/(t/(t/(t3t))))0 assuming t is positive. 1 Simplify c/(c/(((c/c(2/17))/c)/c))c*(6/13)((c(c(c*(-22)/c)/c)/c)/cc)/cc(-2/33) assuming c is positive. c(-180259/7293) Simplify ((j(5/7)j)/jj(2/11)(j2)(-1/44))(-36) assuming j is positive. j(-2358/77) Simplify (l*(2/23)ll/(ll13))/(l(3/5)/(l6/l)) assuming l is positive. l(-864/115) Simplify (f*(-17)f)*(43/5)fff/(f/f*(-2/5)f)fffff/(f7f) assuming f is positive. f(-140) Simplify (w(-1/6))*48(w(-1)/w)(-39) assuming w is positive. w70 Simplify (o(-5)oo/(((o(oo*(2/13))/o)/ooo)/o))/(oo/(o*(1/3)o)oo(1/2)) assuming o is positive. o(-493/78) Simplify (q(1/4))(-37/3)(q(-3/8)/q)/(q/q1qq) assuming q is positive. q(-155/24) Simplify (q(-4)/((q/(q/(q/(q(2/11)/q)))q)/qq)(q0/q)(4/17))(-2/29) assuming q is positive. q(2638/5423) Simplify (((d*(-2/11)/dd)/d)(-11))34 assuming d is positive. d442 Simplify (x(-2))5/(((x(-1/4)/x)/x)/x)34 assuming x is positive. x(201/2) Simplify (l11/(l(-10)/l))/((l/l*(2/7)l)/(l/((l/(l/(ll4)))/l)l)) assuming l is positive. l*(128/7) Simplify (gg(g/(g/(g(-1/20)/g)))/g)/ggg(-6)gg11g/(gg1) assuming g is positive. g(99/20) Simplify ((n(-2/41)n)/(n(-6/13)/n))/(n(-22/3)(n/(n(n(n(-6/7)/n)/nn)/nn))/n) assuming n is positive. n(110687/11193) Simplify (c2/(c/c(-8/3)c))1 assuming c is positive. c(	{ "pile_set_name": "DM Mathematics" }
-3. Which is the third smallest value? (a) z (b) m (c) 5 c Let c = -1.7 - 2.3. Suppose -3 = -o + 4o. Let k be 2-1 - (-3 - o). What is the third biggest value in 4, k, c? c Let s = 673/3 - 225. Let j be (1/(-3))/((-2)/2). Which is the second biggest value? (a) j (b) -3/8 (c) s b Let x = 5.5 + 16.5. Let f = x - 22. Let v = -0.4 + -0.1. Which is the second biggest value? (a) f (b) v (c) 4 a Let j = -0.2 - -2.1. Let u = j + -0.9. Which is the smallest value? (a) -3 (b) u (c) 0.04 a Let v = 0.07 - 5.07. Let z = -0.7 + 1.4. Let g = -1.1 + z. What is the smallest value in v, g, 2/5? v Let x = 29 - 24.1. Let j = 0.1 + x. Let v = 0.6 - 2.6. Which is the third smallest value? (a) j (b) 1/7 (c) v a Let q be 3/4(-16)/(-18). What is the third biggest value in 0.2, q, 3? 0.2 Let g = 0.068 + 22.432. Let u = g - 22. Let l = 8 - 8.3. Which is the second smallest value? (a) 3 (b) l (c) u c Let l = -9 - -10.4. Let p = l - 1.9. Which is the second smallest value? (a) p (b) -0.3 (c) 5 b Suppose 3s + 4d + 3 = d, -s + 2d + 8 = 0. What is the second biggest value in 1, s, -1/12, -0.2? 1 Let r = 0.1 - -1.9. Which is the third smallest value? (a) 1 (b) 0 (c) r c Suppose -s = 3s + 4j - 36, 80 = 5s - 2j. Let n = s - 17. What is the third biggest value in 1, n, -0.2? n Let j = 0.347 + 0.153. What is the biggest value in 13, -1, j? 13 Let z be 9/4 + (-2)/8. Let j be 3 - z/(8/13). Which is the third smallest value? (a) -2/5 (b) j (c) 4 c Let n = 2.2 - 2. Let v = 3 + 0. Let q = 18 + -19. Which is the third smallest value? (a) n (b) q (c) v c Let i = -6 + 3. Let x = -0.83 + 0.33. Which is the second smallest value? (a) i (b) x (c) 8 b Let v = -5.49 - -0.49. What is the fourth smallest value in v, -1/3, 4, 0.1? 4 Suppose -3q - d + 16 = 0, d - 4 = 2q - 2d. Which is the third smallest value? (a) -0.2 (b) 1/8 (c) q c Let m = -25150698/155 + 162262. Let n = 1/31 - m. Which is the smallest value? (a) 0 (b) n (c) -2/9 c Let v = -6 - -16. Let d = v + -12.1. Let h = -2 - d. Which is the smallest value? (a) -3 (b) 0 (c) h a Let n be (20/15)/(4/(-70)). Suppose 5i = -0i - 15, 2i + 29 = -k. Let s = k - n. What is the second biggest value in s, 2, -0.4? s Suppose -3u - 15 = -0u. Let h = u + 43/9. Let i = -4 + 3. Which is the third smallest value? (a) -0.5 (b) i (c) h c Let i = 27 + -27.05. What is the second biggest value in 1, 0.2, i? 0.2 Let r = -113 - -109. Let y = -2 + 1. What is the biggest value in r, -1/2, y? -1/2 Let u = -9.9 - -10. Suppose 5d = w + 2 - 18, 4w + d = 1. Which is the smallest value? (a) -1 (b) w (c) u a Let n = 0.09 + -0.15. Let h = n - 0.24. Which is the third smallest value? (a) -0.4 (b) 0.05 (c) h b Let l be ((-1)/(-14))/(4/(-8)). Which is the biggest value? (a) 4/7 (b) 0.1 (c) l (d) -5 a Let x be (3/(-3))/(-1)-2. Let m = -12 + 20. Let u = -13 + m. Which is the third biggest value? (a) 2/9 (b) x (c) u c Let z = 743.19 - 739. Let o = z - 0.19. Which is the smallest value? (a) -0.5 (b) o (c) -2 c Let k = 4 + 0. What is the smallest value in 1, k, -4? -4 Let r = -31 + 31.4. What is the smallest value in r, -0.12, -3/2? -3/2 Let n = 3.5 - 3. Let q = 0.8 - n. Let v = -0.88 - -0.58. Which is the third smallest value? (a) q (b) v (c) -2/11 a Let b be (-2)/7 - (-3)/84. Let j = 214211/87 + -2463. Let q = j + 4/29. What is the smallest value in 5, b, q? q Let b = -10 + 7. What is the second smallest value in 1/12, 1/6, b? 1/12 Let p = -35/3 - -271/24. Which is the third smallest value? (a) 3 (b) p (c) 1/3 a Let k = -34 + 33.5. Let p = 0.1 - 0.08. Which is the second smallest value? (a) p (b) 1/6 (c) k a Let g = 26 + -31. Which is the fourth biggest value? (a) 1 (b) -2 (c) -0.4 (d) g d Let m = 0.2 + -0.1. Let t = -0.1 - m. What is the second smallest value in -3, 3, t? t Let h = 0.44 + -0.04. Let i = -2.4 + 2. Let k = h + i. What is the third smallest value in 2/11, 1/4, k? 1/4 Let g = 11 - 10.6. Which is the smallest value? (a) -3/2 (b) g (c) 2 a Let x be (-12)/(-9) + (5 + -2 - 5). Let s = -4.04 - -0.04. What is the third smallest value in s, x, -2? x Let q = -1/84 + 1891/84. Suppose -2l + 2d = 52, -2l + 2d = -3d + 61. Let v = q + l. What is the biggest value in 0, 0.2, v? 0.2 Suppose 2r - 25 = -5b, -4b + 2b = -5r - 10. What is the second biggest value in r, -6/13, -2/13? -2/13 Let p = -6 - -6.4. What is the second biggest value in -4/3, -3, p? -4/3 Let t = -5/12 - 1/12. Which is the fourth biggest value? (a) t (b) 2/7 (c) 0 (d) 0.3 a Let c = 38 + -41.1. What is the third smallest value in 0.2, -0.4, c? 0.2 Let q be 8/36 + (0 - 0). Let s(d) = d + 12. Let t be s(-9). Suppose 0 = tw + 2w - 25. Which is the biggest value? (a) w (b) -4 (c) q a Suppose 2l = -3l - 15. Which is the third biggest value? (a) 2 (b) -10 (c) l b Let x = 0.04 + -0.04. Let u = -4 + x. Which is the biggest value? (a) -0.2 (b) u (c) -1 a Let u = -64/11 + 598/99. Let j = 11.9 - 12. What is the third biggest value in j, 4, u? j Let y be ((-5)/10)/(29/6). Let o = -47/174 - y. Let j = 5 - 10. Which is the third smallest value? (a) o (b) -3/4 (c) j a Let d = -13.2 + 13. What is the second biggest value in -3, d, 4/7? d Suppose 2b = 2a, 0b - 6 = 2b. Let x = -5 - a. Let r be x/4(-1)/(-2). What is the smallest value in 3/5, r, 0.2? r Let h(z) = 3z - 8. Let u be h(1). What is the biggest value in 5, u, -0.4, -3? 5 Let o = 94 - 93.5. Which is the smallest value? (a) 5 (b) 2/13 (c) o b Let g = -11 - -7. Let n = 0.02 - -0.28. Let q = n + -0.1. Which is the second biggest value? (a) 4 (b) g (c) q c Let b = -0.6 - -1.6. Let w = -0.9 + b. What is the second biggest value in -1/5, w, 5/2? w Let b = -20/9 - -13/18. Let k = -20 + 25. Let o = -0.5 + 0.3. What is the third smallest value in k, o, b? k Let i = -2 + -0.5. Let v = 0.5 - i. What is the smallest value in 0.2, v, 0.3? 0.2 Let i be 37/(-7) - (-4)/14. What is the smallest value in 5, 0.1, i? i Let i = -3 - -6. Let f = 2 - i. Let g = 2 + f. What is the third biggest value in g, -3, -2/3? -3 Let v be ((-8)/(-14)-1)/(-6). Let y = 1.02 - 0.82. Which is the smallest value? (a) -1 (b) v (c) y a Let o = 0.24 - 1.44. Let m = 5.2 + o. Which is the biggest value? (a) 5 (b) -2/7 (c) m a Let m = -0.45 - -4.85. Let s = m - 4. What is the third smallest value in 0.2, -5, s? s Let c = 52 + -49. Let f = -0.1 - -0.1. What is the third biggest value in f, 0.1, c? f Let j be -1 - (-2)/(3(-2)/(-12)). Let v = -0.3 - -0.5. Let r = v + -0.2. Which is the second biggest value? (a) j (b) -0.5 (c) r c Let w = -1.15 + -0.05. Let g = 1.4 + w. Which is the biggest value? (a) 1 (b) g (c) 4 c Let l = -8/13 - -19/52. What is the smallest value in 0.1, 0.2, -0.2, l? l Let s = 50 + -152/3. Let z = 17/3 + -6. What is the third smallest value in s, 3/2, z? 3/2 Let o(s) = 34s. Let r be o(4). Let g be r/(-264) + (-4)/(-22). Which is the second smallest value? (a) -0.1 (b) g (c) 0.1 a Let k = -1.51 + 1.4. Let d = k + -4.89. Let w = -8 + 41/5. Which is the smallest value? (a) -2 (b) d (c) w b Let x = -0.4 - -0.2. What is the second biggest value in 1, 0.1, x? 0.1 Let w = 1 + -0.6. Let n be (-2)/((-27)/(-6) - 4). What is the biggest value in 5, w, n? 5 Suppose 3x + 6 = 2x. Let m be (-136)/14 + (-4)/14. Let n = m - x. Which is the second biggest value? (a) -2 (b) n (c) -3 c Let x be 2 - (17/15 + 1). Let m = -4 - -5. Let d = m - 1. Which is the second smallest value? (a) d (b) x (c) 0.2 a Let x be (-2)/(-7) + 772/42. Let q be ((-158)/(-63))/((-2)/(-15)). Let v = q - x. What is the second biggest value in -5, 0, v? 0 Let u be 1 + (3 - (1 + 1)). Which is the third biggest value? (a) u (b) -0.06 (c) 1 b Let x = -20/39 - 2/13. Suppose m = 1 + 2. Let r be (-1)/(-10)(m - 2). Which is the second biggest value? (a) r (b) 4 (c) x a Suppose -10 = -3s + 4t, -2t + 1 = 4s - 5. Suppose 5h + 5z - 10 = 0, -z = z + s. Let j = -3 - -3.2. What is the smallest value in 3/4, j, h? j Let b = 5 + 1. Let v = -3 + b. What is the smallest value in 0, 1, v? 0 Let a = 1 + 2. Let r = -5/12 + 7/6. What is the second biggest value in -0.3, r, a? r Suppose w - 2w - 5 = 0. Let p = 0.1 + 0.3. Which is the biggest value? (a) w (b) p (c) -5/3 b Let x(k) = 5	{ "pile_set_name": "DM Mathematics" }
Suppose n = 5a - 13, -4a + 78 = 3n + 22. What is the smallest common multiple of 18 and n? 36 Let w(s) be the third derivative of -23s6/120 + s5/30 - s*4/24 - 4s*2. Let t be w(1). Let j = t + 34. Calculate the least common multiple of 18 and j. 36 Let i = 1669 + -1651. Calculate the smallest common multiple of i and 3. 18 Suppose 2x - 2 + 6 = 0. Let l = -3239 - -16252/5. What is the common denominator of l and -3 + 69/x + 1? 10 Suppose -5m = -5a + 20, 2a = 5a - 5m - 18. Let t(p) = 19p3 - p2 + p - 1. Calculate the least common multiple of t(a) and 40. 360 Let w(q) = q*3 - 2q*2 - 7q - 7. Let m be w(4). Find the common denominator of m1 - 98/(-18) and ((-16)/5)/(36/(-50)). 9 Let t = -286 + 637. What is the common denominator of (-906)/1652/t and (-2)/8 - 38/88? 198 Let y(u) = u - 5. Let n = -16 + 21. Let k be y(n). Calculate the common denominator of k + ((-105)/(-16))/(-7) and 81/20. 80 Let h(f) = -7f2 + f - 1. Let p be h(1). Let g be 2/p - (-1756)/6097. Let k = g + -6115/7839. Find the common denominator of k and -71/8. 72 Suppose -15 = -x + 5v, -v = -x - 7 + 2. Let z = 8 - x. What is the smallest common multiple of 6 and z? 18 Let z(s) = 78s3 - 5s*2 + 4s. Calculate the lowest common multiple of z(1) and 238. 2618 Let k = -2353879/3704634 + 303/4379. Let t = 1/94 + k. Find the common denominator of t and (-185)/15 + (-2)/(-4). 18 Let s = -3 + -7. Let w be (-877)/(-450) - 5/s. Let l = w + 11/25. Calculate the common denominator of -48/11 and l. 99 Let d = 90 - 90. Suppose -k + 2b + 16 - 2 = d, 0 = b - 1. What is the smallest common multiple of k and 36? 144 Suppose 7u - 10 = -5g + 2u, -4g - 5u + 6 = 0. Calculate the least common multiple of 9 and 1/(0 + 3/9) + g. 63 Find the common denominator of 65/3 and 32/((-56)/(-7)) - (-292)/(-66). 33 Suppose -9q - 5q - 70 = 0. What is the common denominator of 57/7 and q/(-10) + (-74)/3? 42 Let q be ((-22)/3)/(2/(-15)). Calculate the common denominator of 63/16 and (2/q)/((-24)/2190). 176 Let v be 6/(-12)(-4)/1. Suppose -3h = -9, vz - h = -4h - 21. What is the common denominator of (38/(-8))/(z/(-90)) and -131/18? 18 Let t(a) = -a - 3. Let v be t(-1). Find the common denominator of -37/3 and (v + 74/6)/((-8)/(-18)). 12 Let t = -287 + 331. What is the least common multiple of 76 and t? 836 Let j = 413 + -337. What is the lowest common multiple of 16 and j? 304 Suppose 2g = -15 - 301. Find the common denominator of 1g(-3)/(-12) and ((-2)/36)/(22/(-246)). 12 Let i(s) = -3s - 2. Let v(f) be the second derivative of -f3/6 + 21f*2/2 + 4f. What is the smallest common multiple of v(12) and i(-2)? 36 Suppose 0 = -u + 2 + 43. Let s = 67 - u. Calculate the lowest common multiple of 6 and s. 66 Suppose -h + 2h - 30 = c, 0 = -5h - 4c + 132. Suppose -5t - 2z = -18, -3t + z + 9 = 4z. Calculate the lowest common multiple of t and h. 28 Let w(t) = -3t2 - t2 - 5t + 5t*2 - 4. What is the least common multiple of 36 and w(7)? 180 What is the common denominator of ((-833)/(-85))/((-32)/(-10)) and 67/22? 176 Let p = -28971/8 - -3615. Let w = 12 + -9. What is the common denominator of p and (-3)/w + 47/6? 24 Let a(s) = -2s + 1. Let i be a(3). Let n be 37/i - (-2)/5. What is the common denominator of (-350)/12 - n/(-21) and -91/8? 8 Suppose 2f + 0 = 8. Let h = -19 - -22. Suppose -2n = -5o + 100, -ho - n + 3 + 46 = 0. Calculate the least common multiple of o and f. 36 Suppose 0 = 5c + 5x - 5 - 30, x = -3c + 13. Suppose -cj - 3 = 4y - 2, 3 = -j. Suppose -5t + 20 = -3t. What is the smallest common multiple of y and t? 10 Let y be -27(-5)/((-45)/(-6)). Calculate the least common multiple of 10 and (4 - y - -4)/(-1). 10 Find the common denominator of 8 + (-4612)/672 + -2 and 85/54. 1512 Let o = -2 - -12. Suppose -3x = o + 2. Let g(n) = -n3 - 3n*2 + n - 4. What is the lowest common multiple of 20 and g(x)? 40 Suppose i + 5b + 10 = 0, 11b + 24 = 4i + 15b. Suppose 2s - 5s = -204. What is the smallest common multiple of s and i? 340 Let d = -31480/9 + 3502. Calculate the common denominator of (-2)/(-7) - (-59)/63 and d. 9 Calculate the common denominator of (7991/(-31476))/((-1)/(-2)) and 14/33. 2838 What is the common denominator of (-5)/(40/(-32)) + 16/(-17) and 20/3? 51 Let w be 0 + 0 + -1 - 13312. Let s = w - -212939/16. Find the common denominator of s and (-1419)/220 + 21. 80 Let r(w) = -91w + 7. Let k be r(8). Let v = k + 438. Let n = -1990/7 - v. What is the common denominator of n and 37/3? 21 Find the common denominator of (-70)/140(-38)/(-10) and -103/6. 30 Let t = -46 - -33. Suppose -3j + 2c = -89, 7j - 3j - 104 = -c. What is the least common multiple of j and t/(-2) - 2/(-4)? 189 Suppose 23 - 99 = -4p. Calculate the common denominator of -1 - (0 - 166/18) and -3 - (p/(-10) + 2). 90 Let z be 8420/(-4664) + 2/(-4). Let w = -11/106 + z. Find the common denominator of (((-60)/(-18))/10)/((-42)/225) and w. 154 Let s be (1088/6)/(-1) + -1. Let g = -7685/42 - s. Calculate the common denominator of ((-10)/15)/(88/630) and g. 154 Let v = -3699/136 - -286/17. Find the common denominator of v and -79/10. 40 Let j be ((-250)/15)/((-2)/93). Let g = j + -12493/16. What is the common denominator of g and (-26)/(-130)105/2? 16 Suppose 181 = 3g + 97. What is the least common multiple of g and 7? 28 Suppose -x + d + 38 = 4d, -2x = 2d - 92. Suppose 4u + 20 = -2p, 4p + 2u = -p - x. Let w = p - -18. What is the smallest common multiple of 12 and w? 24 Let c = 27 + -34. Find the common denominator of 3934/784 - (-1)/c and 99/20. 40 Let f(u) = -6u2 - u + 5. Let o(k) = 2 + k - 4 - 3k*2 + 2k*2 + 4k*2. Let m(q) = 2f(q) + 5o(q). What is the smallest common multiple of 6 and m(-3)? 18 Let n be (2/(-8))/((-155)/764020). Let p = -546586/341 - n. Let d = p + 2833. What is the common denominator of d and -151/6? 66 Let u = -773 - -1148. Calculate the least common multiple of u and 30. 750 Suppose 78 = 4n + 5d, 0d - 40 = -2n - 2d. Suppose s - 46 = -n. What is the smallest common multiple of s and 8? 24 Suppose -3s - 28 = -4b - 216, 3s = -b + 193. What is the least common multiple of 10 and s? 320 Let i = -47267/78 + 606. What is the common denominator of i and 53/39? 78 Calculate the common denominator of ((-572)/(-33) - 11)/((-8)/(-9)) and 33/29. 232 Let t = 309 - 307. Let s(g) = 4g - 1. Let d be s(-1). Let r = t - d. Calculate the lowest common multiple of 8 and r. 56 Suppose 5a + 43 - 18 = 0, -u + 4a = -484. Calculate the least common multiple of 8 and u. 464 Suppose 0 = 9m + m - 20. Suppose -22u - 503 + 1955 = 0. Calculate the lowest common multiple of m and u. 66 Let f(s) = 25s + 52. What is the smallest common multiple of 104 and f(0)? 104 Let v(g) = -g - 7. Let t be v(-6). Calculate the common denominator of -27/2 and (t - -231)(-12)/(-336). 14 Suppose 58 = -14r + 142. Let o(q) = q3 + 5q*2 - q. What is the least common multiple of r and o(-3)? 42 Suppose -3c + 4s + 20 = -0s, 25 = -5s. Suppose c = -j + 2t - 9, 20 = 5j + t + 2t. What is the lowest common multiple of j and 26? 26 Find the common denominator of 89/20 and 3956/601681/1. 6540 Find the common denominator of ((-6)/20)/((-21)/882) and -32/131. 655 Let k = 22/193 + 8189/965. Calculate the common denominator of 17/322 and k. 1610 Let z be -1(-2 + 1) + (20 - 36). What is the lowest common multiple of 4 and 6/(-15) + (-21)/z6? 8 Calculate the least common multiple of (-40)/(-105)-9(-7)/2 and 32. 96 Suppose -i + 9 = 5p + 14, -3i + 13 = p. Calculate the common denominator of -143/24 and (-2)/12p/(-7). 168 Let w be (-10)/(34/12). Let q = -9 - w. What is the common denominator of 213/42q - 3 and 119/10? 70 Suppose -5k = 5c - 25, -2c - 29 = -7c - 3k. What is the lowest common multiple of 70 and c? 70 Let i(g) = -80957260g*2 - 2g - 2. Let t be i(3). Let y = t - -10882598850781/14936. Let r = 2/1867 + y. What is the common denominator of -11/4 and r? 8 Let v = 5008 + -230351/46. Calculate the common denominator of v and -31/6. 138 Calculate the smallest common multiple of 7 and (-1)/(8/(-20))462/55. 21 Suppose 7t = 8*t + 9. What is the common denominator of -37/5 and t/5 - (-7 + 11)? 5 Let z be ((-389643)/(-10))/(12/2). Let v =	{ "pile_set_name": "DM Mathematics" }
0.5 (e) 99 c Which is the nearest to -1/3? (a) -9 (b) 95 (c) 9 (d) -0.12 d Which is the nearest to 2/7? (a) -24 (b) -34.1 (c) 0.2 (d) 15 c Which is the nearest to -4? (a) -0.5 (b) -496 (c) 0.0492 a What is the nearest to -0.1 in 10/13, -157, 25? 10/13 Which is the closest to -7? (a) 2/33 (b) 2 (c) -4 (d) -70 (e) 0.5 (f) -3/14 c Which is the nearest to 1/2? (a) -0.4 (b) 3819 (c) -0.1 (d) -109.2 (e) 2/15 e Which is the closest to 1/14? (a) 2/3 (b) -2697 (c) 1/2 c What is the closest to 50 in 4, 271, 66/7? 66/7 What is the closest to 0.30382 in -1, 0.4, -0.1, 1/9? 0.4 Which is the closest to 2? (a) 0.1 (b) -127.49 (c) 0.9 c Which is the nearest to -3/61? (a) -155 (b) -55/8 (c) 6 c What is the closest to -52.5 in 19/96, -4, 7, 0.5? -4 What is the nearest to 2/3 in -574821/8, -4/3, 3? -4/3 What is the closest to 1/3227 in -0.5, -2, -0.45, 0? 0 What is the closest to -20 in 0, 2/11, 4, -52, 5? 0 What is the closest to -2/7 in 0.2, 4, 3.1, 0, 175092? 0 What is the nearest to 2 in -0.4, -0.57232, -0.3? -0.3 Which is the nearest to 12? (a) -0.6 (b) 4 (c) -12.246 b What is the closest to 1 in 7, -1, -14, -1/3, 57/8? -1/3 Which is the nearest to -1? (a) 248734 (b) 2/91 (c) 1/3 b Which is the nearest to -1? (a) 0.3 (b) 0.5 (c) -54 (d) 1 (e) 0.2 e Which is the nearest to -3/16? (a) -0.5 (b) 38015 (c) -2/3 a Which is the closest to 155/3? (a) 2 (b) -1/15 (c) -1.19 a What is the nearest to 38 in 53, 4, 0.018, -0.078, 0, 2? 53 What is the closest to 0 in 3, 0.3, -0.8, -3489, -4? 0.3 Which is the closest to -221? (a) -0.02 (b) 54 (c) -2 (d) 1/9 (e) -2/15 c What is the nearest to 0.02 in 0, -0.03, 8/209? 8/209 What is the closest to -1.1 in 146, 3/7, 0, -70? 0 What is the nearest to -45 in -3, 2/41, -2/7, -3/2, -51? -51 Which is the closest to 1? (a) -185 (b) 4 (c) -36/17 (d) -3/5 d Which is the closest to 0? (a) 0 (b) -54 (c) -3 (d) -13 (e) -5512 a What is the nearest to -6 in -2, 572, 26, 0? -2 What is the nearest to -2 in 1/3, 615, 2/95, -0.8? -0.8 Which is the nearest to 0.3? (a) 2 (b) 1 (c) 2/11 (d) -14 (e) -8 (f) 15 c What is the closest to 3 in -0.14, 0.06, 9, 421? 0.06 What is the nearest to -4 in -4, 4, -27703? -4 Which is the nearest to 2? (a) 2/11 (b) -25 (c) 0.4 (d) -0.1 (e) -0.04 (f) 1/2 f Which is the closest to 4/9? (a) 7 (b) -1 (c) -0.2 (d) 208.42 (e) 13 c Which is the nearest to 2? (a) -0.3 (b) 1513320 (c) 4 c Which is the nearest to 202? (a) -6/7 (b) -100 (c) 0 (d) 3/4 (e) 8 e Which is the closest to -0.2? (a) 2 (b) 7739 (c) 0 (d) -3 (e) 3.9 c Which is the closest to -2? (a) -5 (b) -0.05 (c) 3109 (d) -5/37 (e) -6/5 e Which is the closest to 0? (a) -21 (b) -5/6 (c) -529 b What is the closest to -29 in -0.01208, -3, 3? -3 What is the closest to 2/3 in 29403, 9, 0.75? 0.75 Which is the nearest to -923? (a) -1.5 (b) 93/2 (c) 3 a What is the closest to 0.2 in -5, -1, 0.6, 568, -0.007? -0.007 Which is the nearest to 1? (a) 175 (b) -0.5 (c) -1168 (d) 4 b What is the closest to 2/9 in 2/9, 5/2, -28, -1/5, 0.32, 0.08? 2/9 Which is the closest to -2/7? (a) 4 (b) 3/4 (c) -1/7 (d) 0.5624 (e) 2/19 (f) -2.5 c What is the closest to 0.2 in 5, -2/17, 0.2, 0, 30039? 0.2 What is the closest to 1 in -1/5, -6, -0.4, -1/13316? -1/13316 What is the nearest to -0.1 in 2/1583, 0.14, 0.3, -3457, 2/5? 2/1583 What is the closest to 2/9 in 100.3, 2382, 1/4? 1/4 What is the closest to 1 in 22, 0.4, 1/15, 39, -664? 0.4 Which is the closest to -0.1? (a) 2/11 (b) -1 (c) -1.2 (d) 3661.5 (e) 0.2 (f) 0.3 a What is the nearest to -0.544 in 0, -67, -79, 0.3? 0 What is the nearest to -71.7 in 0.1, -2, 0, 4, -262, 1/4? -2 What is the nearest to 0.2 in 67, 4/7, 37, -3? 4/7 What is the closest to -0.02 in -0.74, 2, 114, -0.4? -0.4 Which is the nearest to 2/9? (a) 6/139 (b) 1 (c) 5 (d) -3 (e) -454 (f) -0.5 a Which is the closest to 1? (a) -4 (b) -1/4 (c) -0.2 (d) -1.02 (e) 2/231 e Which is the nearest to 7? (a) -3 (b) -2/3 (c) -1/2 (d) -14/827 (e) 0.9 e Which is the closest to 2201? (a) 0.181 (b) 0.4 (c) 0 (d) -4 b What is the closest to 324 in -0.05, -5, 210, -0.1, 0.5? 210 Which is the closest to 9? (a) 68.4 (b) 22 (c) 1.6 c What is the closest to 1/88 in 0.023, 1/4, -2/19, -22? 0.023 What is the closest to -1 in 3/4, 1508, 3, -4556? 3/4 Which is the nearest to -6.5? (a) 1/5 (b) -3/65 (c) 2 (d) 0.3 b What is the closest to 0.121 in -6, 2, 11, -5? 2 Which is the closest to 0.7? (a) 184/7 (b) 2 (c) -1 (d) 14.1 (e) -0.4 e Which is the nearest to 1? (a) -2/5 (b) -8727 (c) 1 c What is the closest to -1963 in 8, 0.46, 4? 0.46 What is the closest to -2360 in 5, -0.2, -5, -2/7, -0.06? -5 Which is the nearest to -17769? (a) 3 (b) 5 (c) -0.328 c Which is the closest to -0.1123? (a) -2.8 (b) 0.03 (c) 5 (d) -0.3 b Which is the nearest to 0.1? (a) -5 (b) 0 (c) -276759 b Which is the nearest to -14? (a) 3687 (b) -1/3 (c) -1 (d) -4 (e) -3 d What is the closest to -1 in 0.07, 67.89, 0.1, 8, -2/33? -2/33 What is the nearest to 0 in 1/2, -13, 3, 194, -162? 1/2 Which is the nearest to 0.1? (a) -7 (b) 3/4 (c) -0.07 (d) -2/7 (e) 240 (f) -5 c Which is the nearest to 2/33? (a) -1171 (b) -6 (c) -0.226 (d) 0 d Which is the nearest to 2? (a) 2/3 (b) 10566 (c) 0 (d) 8/3 d What is the nearest to 1 in 2/3, 2, 1341.024, -3? 2/3 What is the nearest to 387 in 2/15, -1, 3/7, -3, 16? 16 Which is the closest to -209? (a) 2 (b) 1/4 (c) 0.03 (d) 0.1 (e) -805 c What is the nearest to 14 in 2/11, -3, -7, -8? 2/11 What is the closest to 44 in -0.5, -39149, 4/85? 4/85 Which is the closest to -1.594? (a) 9 (b) 19/40 (c) 5 b What is the closest to 0.1 in 5, -2, 0.13, -0.2, -19613? 0.13 What is the closest to 0.2 in -2/7, -0.217, 0, 0.3, 183? 0.3 What is the closest to 6 in -1121, 1/2, -1, -84? 1/2 Which is the closest to 0.1? (a) -0.04 (b) -0.4 (c) -0.3 (d) 16665 a What is the closest to 0 in -0.1, 1, -15, -1/2, -1.18, -1/198? -1/198 Which is the nearest to 1/4? (a) -5/11 (b) -1/14 (c) 0 (d) 1490 (e) 1/5 e Which is the closest to -3.308? (a) -5/13 (b) -9/4 (c) -0.06 b Which is the closest to 0.379? (a) 2/15 (b) 0.3 (c) 0.714 (d) 0.1 b What is the nearest to -1/3 in 2, 0, 1/66, -20/3, 5/28, 1? 0 What is the nearest to -1/3 in -2, -0.06, -4/7, 5, 1227, -8? -4/7 Which is the nearest to 0.01? (a) 124 (b) 15 (c) 769 b Which is the nearest to 0? (a) -60353 (b) -0.006 (c) 0.27 b What is the closest to -22 in 0.17, -0.4, 770? -0.4 What is the closest to -148616 in -31, 0.5, -0.4? -31 What is the closest to 1 in 1/999, -4, -0.3, -2/259, 4? 1/999 What is the nearest to 0.1 in -0.02, -4, -0.2, -2/3, 2/729? 2/729 Which is the nearest to 2? (a) -0.1 (b) 3 (c) 5 (d) 573156 b What is the nearest to 0.1 in 1, 0.09, -203.69, -0.5, 5? 0.09 Which is the closest to 1? (a) 2293 (b) -0.4 (c) -2 (d) 31 (e) 34 b Which is the closest to 0.7? (a) 5 (b) 170 (c) 4558/5 a Which is the closest to -3? (a) -5 (b) 645 (c) -203 a Which is the nearest to -0.1? (a) -10/9 (b) -118 (c) 58 (d) 7/6 a What is the closest to -1 in 2/3, -1, -3/5, 3/4, -32296? -1 Which is the closest to -0.1? (a) -0.09 (b) 28 (c) -3/2 (d) -3/8 (e) -54/7 a What is the closest to 0 in 2/13, 2882, -5, 2, 0.9? 2/13 What is the nearest to -31.093 in -5, -4/45, 10? -5 Which is the nearest to 4? (a) 43/40117 (b) 2 (c) -7 (d) -0.2 b What is the nearest to 3/15116 in 0.5, 1, 8/17? 8/17 What is the closest to -591/2 in -8, 0.5, 8.3? -8 Which is the nearest to 3291? (a) 4 (b) 1/13 (c) 247 c Which is the closest to -1? (a) -55 (b) 5 (c) 1/7 (d) 45 (e) -5 c Which is the closest to 1? (a) 4 (b) -1/3 (c) -8.268 b What is the nearest to -0.07 in 3/7, -2, 7024/17, -3, 2/15? 2/15 What is the closest to 2/9 in -0.24, -0.3, -2/11, -0.2, 201/7, -3? -2/11 Which is the nearest to 1? (a) 0.3257 (b) 3/22 (c) 4 (d) -0.01 a What is the nearest to -3094 in 0, -206, -1/3, 4, 1/4? -206 What is the nearest to 0.2 in 244, -1613, 1, 0.2? 0.2 Which is the nearest to 0.6? (a) -0.2 (b) 5 (c) -0.3949 a What is the closest to 1.06 in -768, 10, 2, 1? 1 What is the closest to 0 in 445, -0.0341, -5, 4/3, -2? -0.0341 What is the nearest to -0.4 in 0.1, 7244, -1, 3,	{ "pile_set_name": "DM Mathematics" }
rest to -2 in -1, -2/13, 0.5, 4? -1 What is the closest to -0.09 in -1/4, -10, -0.2, 3? -0.2 What is the nearest to -65 in -0.3, 0.1, 0? -0.3 Which is the nearest to 1? (a) -1/12 (b) 2 (c) -0.025 b Which is the closest to 2/7? (a) 0 (b) -4/5 (c) 106 (d) -2 a Which is the nearest to -1? (a) 1/6 (b) -0.1 (c) -8/7 (d) -2/3 c Which is the nearest to -0.5? (a) 5 (b) -3 (c) -1.1 (d) 2/5 c Which is the closest to 0.01? (a) 0.1 (b) -0.3 (c) 0 (d) -2/11 c Which is the nearest to 1? (a) 0 (b) -1/6 (c) 5 (d) 2/23 d What is the nearest to -0.3 in 0.3, -2, 72, 4? 0.3 What is the closest to 0 in 0.2, 3/7, -0.3, 182/11? 0.2 Which is the nearest to -47? (a) -3/4 (b) -3 (c) -5 (d) 2 c Which is the closest to -54? (a) -1 (b) 3 (c) -3 c Which is the nearest to -3? (a) 6.8 (b) 0 (c) -2 (d) 0.5 c Which is the closest to 19? (a) 1 (b) -0.06 (c) -0.31 a What is the nearest to -0.1 in 2, -6072, -0.2? -0.2 Which is the nearest to 0.1? (a) -45 (b) 0.18 (c) 1 (d) -5 b What is the nearest to -1 in -3, 1/5, -4/7, 2/59? -4/7 Which is the nearest to -0.1? (a) -3/4 (b) 0.7 (c) 12 a Which is the closest to -0.6? (a) -1 (b) -4 (c) 3/5 (d) 2/17 a Which is the nearest to 0.1? (a) -1 (b) 58 (c) -5 a Which is the nearest to 5? (a) 4 (b) -1/3 (c) -0.5 (d) 3 a What is the nearest to 58 in 0.3, 0, 1.5? 1.5 Which is the closest to 3? (a) 4 (b) 11 (c) -2/7 a Which is the nearest to -0.3? (a) 4/5 (b) 7/3 (c) 2 (d) -44 a Which is the nearest to -27? (a) 0.1 (b) 2 (c) -5 (d) -3 c Which is the nearest to -1.7? (a) 1 (b) 1/3 (c) 29 b Which is the nearest to 5? (a) 8 (b) 1/3 (c) 92 a What is the nearest to -1/7 in -0.3, -0.54, 1/4? -0.3 What is the closest to -1 in 0.13, -4, 0.2? 0.13 What is the closest to -19 in -4, 0.4, -0.2, -1/3? -4 Which is the closest to 1/2? (a) -24 (b) 4 (c) -1/5 (d) 3 c Which is the nearest to 4? (a) 0.2 (b) -5/8 (c) -3 a What is the closest to 1 in -2/3, -4, 4, 0.12? 0.12 What is the closest to 1 in -3/4, -10/33, -2? -10/33 Which is the nearest to -7? (a) 0 (b) -4 (c) -5 c What is the nearest to 0 in 5, 0.37, 10? 0.37 What is the closest to 1.22 in -3, -5, -1.2? -1.2 Which is the closest to -0.1? (a) 0.3 (b) 1.2 (c) 1.8 a Which is the closest to -2? (a) -2/5 (b) -20 (c) -2 c Which is the nearest to -3/4? (a) -0.4 (b) 3/11 (c) 0.2 a What is the nearest to 0 in -1/2, -4, -9, 3/7? 3/7 What is the nearest to 22 in 0, -5, 0.09? 0.09 What is the closest to 11 in 4, -3, -4, -0.5? 4 What is the nearest to 2/5 in -5/12, -2/11, -5/2? -2/11 What is the nearest to 1/3 in -3, 0.5, 1, 0.1? 0.5 What is the closest to 2/57 in 0.3, -0.5, 5, 2/5? 0.3 Which is the nearest to 0.3? (a) -2 (b) 0.3 (c) -3 (d) -2/5 b Which is the nearest to -1? (a) 9 (b) -35 (c) -5 c What is the closest to 2/7 in 0.11, 2.1, -4, -0.3? 0.11 Which is the closest to -3? (a) 4 (b) -0.5 (c) 28 b Which is the nearest to 6? (a) -1/5 (b) 0.15 (c) 0.2 c Which is the nearest to -1/2? (a) 0.3 (b) 43 (c) 5 (d) -3/5 d Which is the closest to 2.8? (a) -1/12 (b) -1 (c) -2/9 a What is the closest to 9/8 in -2/9, -5, 17? -2/9 What is the closest to -2/3 in -0.7, -0.5, 8, -4? -0.7 Which is the closest to 1? (a) 681 (b) -2/3 (c) 0 (d) -2 c What is the closest to -0.1 in 5/2, 3, -4, -53? 5/2 What is the nearest to -13 in -1/4, 16, 0.1? -1/4 Which is the closest to -0.1? (a) -1/3 (b) -0.093 (c) -5/4 b Which is the closest to -1? (a) 1/37 (b) -3 (c) -7 a What is the closest to 0 in -0.4, -0.18, 0.06? 0.06 What is the nearest to 8 in 2, 15, -1, 1.6? 2 Which is the closest to -3? (a) 2/59 (b) 0.2 (c) -0.5 (d) 2 c What is the nearest to -0.2 in -1, -4, -3, 1? -1 What is the nearest to -3/5 in -2/11, 1, -5, 0.1? -2/11 Which is the nearest to 0? (a) 4/7 (b) -4/5 (c) 1/2 (d) 0.08 d Which is the nearest to 1/4? (a) -0.15 (b) -1 (c) -5 a What is the nearest to -1 in -1/9, -0.02, 41? -1/9 What is the closest to 3/5 in 5, 1/8, -0.5, 0? 1/8 What is the nearest to 2 in 3/8, -5/4, 2/13? 3/8 What is the nearest to 1 in -0.1, -2, 0.03, 0.4? 0.4 Which is the closest to 0.1? (a) -3/2 (b) -0.4 (c) -0.3 (d) -15 c Which is the closest to 0.5? (a) 1/4 (b) -3/2 (c) -5/3 a What is the closest to 1 in -2/15, 1/4, 47, 0.5? 0.5 Which is the nearest to 3? (a) -5 (b) 20 (c) -4 c What is the closest to 0.2 in 0.4, -3/8, -13/5, 0.1? 0.1 What is the closest to 0.1 in -10, 3, -0.2? -0.2 Which is the closest to -1? (a) -0.04 (b) -2/5 (c) -0.8 c Which is the nearest to 0.5? (a) 1/49 (b) -2 (c) -2/13 (d) 0.3 d Which is the nearest to 1? (a) 6/7 (b) 0.4 (c) 0.3 (d) 3 a What is the closest to 1 in -3, -5, -17? -3 What is the nearest to 28/9 in 0.3, 4, 4/7? 4 What is the closest to -2/45 in -0.1, -2/7, 0.4? -0.1 What is the closest to 1 in -4, 3, -82, -1/7? -1/7 Which is the nearest to -16.1? (a) -2/25 (b) -5 (c) 0.4 (d) -0.1 b What is the closest to -929 in -2/23, -1/4, -2? -2 Which is the nearest to 1.9? (a) -5 (b) -0.3 (c) -2/3 b Which is the nearest to -2? (a) 2 (b) -10 (c) 4 (d) 0.1 d Which is the closest to 1? (a) 3 (b) 0.1 (c) 7 b What is the closest to -2/3 in 0.2, 5, 0.3, -0.3? -0.3 What is the closest to 2 in 1/6, 0, 9? 1/6 Which is the closest to -296? (a) -3 (b) 0.2 (c) -1 a What is the closest to -1/2 in -0.02, 1/6, -3? -0.02 What is the closest to 0 in -4, -0.4, 2, -2/249? -2/249 What is the closest to 1 in 4/3, 0.4, 3/5, -5? 4/3 What is the closest to 3 in -4, 0.3, -2/15? 0.3 What is the closest to 0 in -0.9, -4, 0.2, -57? 0.2 Which is the nearest to 0? (a) 0 (b) 2/9 (c) -138 (d) 2 a Which is the nearest to -20? (a) 1 (b) -0.1 (c) 2/5 (d) -2 d Which is the nearest to -2/61? (a) 5/4 (b) 0.3 (c) 4 (d) 5 b Which is the closest to 1? (a) -3/142 (b) 5 (c) -0.3 a Which is the nearest to -2/7? (a) 5 (b) 118 (c) -5 c What is the nearest to -2/5 in 3, 0.02, 3/5? 0.02 Which is the nearest to 0.2? (a) 0.15 (b) -2/3 (c) -3 a What is the nearest to -6 in 18, -10/9, -4/7? -10/9 What is the nearest to -2/3 in 15/13, 2/11, -1/9? -1/9 What is the closest to 22.3 in 1, 2, -3/4, 5? 5 What is the nearest to -1 in -4/3, 128, 0.5, -0.2? -4/3 Which is the nearest to -1? (a) -0.5 (b) 0.4 (c) -0.2 (d) -1 d What is the closest to 0.2 in 2, -3/2, 24? -3/2 What is the closest to 2/15 in 5, 2, -10.5? 2 Which is the nearest to 0.2? (a) 3/4 (b) -0.036 (c) 1/2 b Which is the nearest to 18? (a) 0.6 (b) 0.5 (c) -1 a What is the closest to 5 in -3, -0.5, -0.073? -0.073 What is the nearest to -2 in 1/4, -1/20, -0.4, -3? -3 What is the closest to 0 in 5/8, -10, -5/4? 5/8 What is the nearest to 0 in 4, 1/2, -0.4, 1/13? 1/13 What is the nearest to 0 in 2/7, 84, 1/6? 1/6 What is the nearest to 3 in 1/6, -2/7, -431? 1/6 What is the closest to 2.1 in 2, -2/9, 0.3? 2 What is the nearest to 3 in -0.1, 0, 1, -4? 1 Which is the nearest to -8? (a) 1/7 (b) -1/2 (c) 1 (d) 0 b What is the nearest to 31 in -1/6, 1, -0.1? 1 Which is the nearest to 1? (a) -1/4 (b) 3/7 (c) 0.5 (d) 4 c Which is the nearest to -1? (a) -0.2 (b) -2/25 (c) 38 a Which is the nearest to 2/7? (a) -0.485 (b) -1 (c) -5/3 (d) -0.5 a Which is the closest to -2? (a) 4/3 (b) 0.055 (c) -5 (d) 129 b Which is the closest to 2/11? (a) -3 (b) -4 (c) 2/9 c What is the nearest to 2 in 0.4, 5, 35, -0.3? 0.4 What is the closest to 0 in 5, 8, -4.5, 1/7? 1/7 Which is the nearest to -2/7? (a) -2 (b) 1 (c) 3 (d) 0.4 d Which is the nearest to 0? (a) -2/3 (b) 2/27 (c) 5 b Which is the nearest to -0.05? (a) 0.4 (b) -3/5 (c) 1 a Which is the nearest to -0.3? (a) -2/11 (b) -0.07 (c) 1/5 a What is the nearest to -2/5 in -1/9, 0.07, 0.1? -1/9 What is the closest to 6 in 4, 1/10, -4.2? 4 Which is the nearest to -2? (a) -2/7 (b) -0.5 (c) 2/15 b What is the closest to -2 in -0.3, -23, 1/3? -0.3 What is the nearest to -3/4 in 4, 2, -2? -2 What is the closest to -2 in 4/9, -5, 2, 1/5? 1/5 Which is the closest to -1? (a) 0.3 (b) 0.2 (c) 18 b Which is the closest to 17? (a) 1/5 (b) -394 (c) -2/3 a Which is the nearest to 0? (a) 1/4 (b) -2/9 (c) -0.3 (d) 4 b What is the nearest to 3 in 4/7, -3, 0.2, 2? 2 What is the nearest to 0 in 3/8, 2, 0.4, 21.2? 3/8 Which is the nearest to -3? (a) 2/3 (b) 28 (c) 4 (d)	{ "pile_set_name": "DM Mathematics" }
sands digit of n? 2 Let x be 247/57 + (-2)/6. Suppose 11937 = xd + 19d. What is the hundreds digit of d? 5 Let w = 714 + 289. Suppose 10m - 2537 - w = 0. What is the hundreds digit of m? 3 Suppose 186034 = -128p + 132p + 10g, 5p - 3g = 232527. What is the hundreds digit of p? 5 Let f(k) = k*2 - 10k + 5. Let c be f(10). Suppose 352 = -cs - 128. Let y = 100 + s. What is the units digit of y? 4 Let x(o) = -37o*3 + 3o*2 - 20o - 42. Let r be 10 + -6 - (-10 + 16). What is the tens digit of x(r)? 0 Suppose 10l = 7l + g + 80222, 5g - 53504 = -2l. What is the thousands digit of l? 6 Suppose q + 3i + 5 = 0, 3q + 3i + i = -40. Let w = 8 + q. What is the units digit of (19 + w)/(2/(-16)-2)? 8 Suppose -5s = -2p + 1, 0 = 7p - 2p + s - 43. Let b be (48/16)/(6/p). Suppose -74 = -3q + 2q + i, 0 = bi - 8. What is the units digit of q? 6 Let v(q) = -6q*2 + 11q - 1. Let w be v(3). Let d be (-23)/(2/4 + 13/w). Suppose -d + 49 = -2s. What is the tens digit of s? 0 Suppose 128 = -8o + 12o. Let k = o + -27. Suppose -5h = -h + kt - 25, -3h - t + 27 = 0. What is the tens digit of h? 1 Suppose 13m - 999 = -z + 15m, -4m - 3992 = -4z. What is the hundreds digit of z? 9 Let j(h) = 7h + 320. Let m be (07/(-42))/7. What is the tens digit of j(m)? 2 Let u(f) = -4f2 + f - 44. Let g(s) = -s2 - 15. Let z(a) = 7g(a) - 2u(a). Let w be z(-7). Suppose -11q = -w - 680. What is the units digit of q? 6 Let m = -5912 + 9796. What is the thousands digit of m? 3 Let h = -62 - -82. Let y(o) = 29o - 96. What is the tens digit of y(h)? 8 Let x = 113446 - 64584. What is the hundreds digit of x? 8 Suppose -3a = -5y + 83, -5a + 2y = -2 + 134. Suppose -4 + 6 = i. What is the units digit of (-13)/a + 1/i? 1 Suppose -l + 2 + 1 = 0. Suppose -4q - 1 = -lq. What is the tens digit of 11/33(247 + q)? 8 Suppose 0 = 3s + 7 - 166. Let u = -20 + s. Let i = -28 + u. What is the units digit of i? 5 Suppose 5q = 24097 + 3633. What is the thousands digit of q? 5 Let o = 104 + 46. Suppose -138 = -4z - o. What is the tens digit of ((-4)/3)/(z/225)? 0 Let n(m) = 3m*2 - m + 2. Let s be n(0). What is the hundreds digit of (-104)/78(-441)/s? 2 Let w = -87610 + 140532. What is the thousands digit of w? 2 Suppose 421p = 425p + 1292. What is the hundreds digit of (-1 - p) + -23 + 25? 3 Let m(k) = k*3 + 5k - 15. Let x(n) = -2n3 - 9n + 31. Let i(w) = -5m(w) - 3x(w). What is the hundreds digit of i(5)? 1 Let s be (8/(-2))/((-16)/1368). Suppose 3p = 3m - s, 2m - p + 75 - 305 = 0. What is the tens digit of m? 1 Let v(t) be the first derivative of -2t*3/3 + 2t*2 + 3t + 5. Let d be v(3). What is the hundreds digit of d - (209/(-2) + (-3)/6)? 1 Let d be (1530/40)/(1/(-4)). Let g = d - -137. What is the tens digit of g/(-12) - 92/(-3)? 3 Let h(s) = s*2 - 36s + 246. Let j be h(9). Suppose -5u = -3f - 6757, -ju + 4059 = 2f - 5f. What is the hundreds digit of u? 3 Let t(z) = 2606z - 428. What is the hundreds digit of t(4)? 9 Let b = 3974 + 13445. What is the thousands digit of b? 7 Let d(q) = 8q3 - 32q*2 + 204q - 49. What is the hundreds digit of d(17)? 4 Suppose 0 = -26r + 22r + 27r - 311305. What is the ten thousands digit of r? 1 Let i(k) = 2k*2 + 21k - 11. Let d be i(-11). Suppose d = -6h + 1279 - 241. What is the units digit of h? 3 Let a be (-136)/(-12) + (-6)/(-9). Let t(m) = 25m - 96. What is the hundreds digit of t(a)? 2 Suppose 0 = 67t - 633039 - 86183 - 574749. What is the units digit of t? 3 Let n = -72 + 95. Suppose -4u - 8 = g, 2g + 3g - n = u. Suppose 68 + 128 = gq. What is the units digit of q? 9 Suppose 0 = i + y - 4, -i + 5y - 6 = y. Suppose 5h = h - 8, a - ih - 545 = 0. What is the hundreds digit of a? 5 Let u(b) be the third derivative of b*5/6 - 7b*4/24 + 43b*3/6 - 25b2. What is the units digit of u(5)? 8 Let u = 14748 + -5876. What is the tens digit of u? 7 Let r = -19562 + 35843. What is the thousands digit of r? 6 Let l = 37804 - 31207. What is the thousands digit of l? 6 Let q(r) = r2 - 14r - 16. Let a be q(15). Let y be (-3 + 3)/(-4) + 1 + a. Suppose -2m = -3k - 131, ym - 3k = 5m - 338. What is the units digit of m? 7 Suppose -769707 - 174886 - 135839 = -36u. What is the units digit of u? 2 Suppose 0t + 531352 = 12t + 22t. What is the thousands digit of t? 5 Suppose -3c + l + 74338 = 0, -3c = -4l - 15767 - 58574. What is the tens digit of c? 7 Let l(o) = -556o*3 - 2o*2 - 13o - 21. What is the hundreds digit of l(-3)? 0 What is the thousands digit of ((-20)/(-5) + -6274 - -1)/(-1)? 6 Let u be 2/(5 - (6 - 2)). Let t be (u/(-8))/(22/(-264)). Suppose -4p = l - 189, 245 = -0p + 5p + tl. What is the units digit of p? 6 Let k(r) = -8r + 157. Let m(p) = -22p + 473. Let h(v) = -17k(v) + 6m(v). What is the units digit of h(-14)? 3 Let c(i) be the second derivative of -i*5/20 + 3i*4/4 - 3i*3/2 + 4i*2 - i. Let l be c(8). Suppose 2k - 366 = -lk. What is the tens digit of k? 8 Suppose 35495 + 41586 = 58a - 106315. What is the thousands digit of a? 3 What is the thousands digit of (2 - 1737)32(2 + (-72)/30)? 2 Suppose f - 2f + 393 = q, -5q = -5f + 1935. Suppose 4i + 4g = 1560, -11g + 6g = -i + f. What is the tens digit of i? 9 Suppose -7y + 37y = 343350. What is the tens digit of y? 4 Let l(h) = 88h*2 + 5h - 6. Let w be ((-6)/4 + 1)/(6/(-48)). What is the tens digit of l(w)? 2 What is the ten thousands digit of (-2)/(-1116/1189144)? 1 Let b(c) = 11 - 66 + 6 + 16c + 1. Suppose -6v = -2v - 68. What is the tens digit of b(v)? 2 Suppose -3d + 24 = 0, -3t + 169231 = -2d + 31340. What is the tens digit of t? 6 Suppose -48x + 67x = 1748. Suppose -90a = -xa + 1026. What is the hundreds digit of a? 5 Suppose -16g - 22 + 70 = 0. Suppose 4h + 9 - 5 = -3j, 2j - gh = -14. Let d(w) = -12w + 14. What is the tens digit of d(j)? 6 Suppose 0 = -h + 3j + 619, -4j + j - 3 = 0. Let t = h - 279. What is the tens digit of t? 3 Let n be 591/12 - 6/(-8). Let l = n + -48. Suppose -y = ly - 3w - 216, y = -3w + 52. What is the units digit of y? 7 Let m be 10/(-4) - 4/8-15. What is the units digit of -3 + -2 + (8 - m) - -1362? 0 Suppose 4w = 5g - 266, 1 + 0 = w. Suppose 0 = -18x + 12x + g. Suppose -409 = -4n - x. What is the tens digit of n? 0 Suppose -5842 = 277i - 278i + 4s, 0 = 2i + 3s - 11684. What is the units digit of i? 2 Suppose -24b + 56397 - 996897 = -156b. What is the thousands digit of b? 7 Suppose -5s + k = 290 - 735, s + 4k - 110 = 0. Let y = 103 - s. What is the units digit of 2 + (-3 - -1) + 78 + y? 1 Suppose a - 130 + 467 = 0. Let w = a - -673. Suppose -31j + 28j + w = 0. What is the units digit of j? 2 Let u(r) be the third derivative of r4/4 + r3 + 4r*2. Let d(h) = -5h - 6. Let w(i) = -3d(i) - 2u(i). What is the units digit of w(0)? 6 Let g(f) = -f*3 + 21f*2 - 40f + 80. Let d be g(21). Let r = 1877 + d. What is the hundreds digit of r? 1 Let p be (3 + -2)-3 + 6. Suppose 0 = -5d - pb + 18, -5d + b + 12 = -2b. Suppose dr = 11r - 8. What is the units digit of r? 1 Suppose -3q - 476 = -q. Let j(r) = 2r2 - 55r + 429. Let d be j(27). Let z = d + q. What is the tens digit of z? 6 Suppose -12 = -4k, 2b + 3k - 1 = 10. Let d be b - ((-12)/(-8))/((-6)/(-56)). Let y = d - -45. What is the tens digit of y? 3 Suppose -1488290 = -193u - 202244 + 5708853. What is the thousands digit of u? 6 Let c be 5/((-95)/(-686)) - 60/570. Let l = c + 1816. What is the thousands digit of l? 1 What is the units digit of 18300/9(-8904)/(-1060)? 0 Suppose -19p = -76p - 137309 + 957539. What is the ten thousands digit of p? 1 Let o(k) = 145k*2 - 87k + 173. Let x(u) = 36u2 - 22u + 43. Let b(r) = -2o(r) + 9x(r). What is the thousands digit of b(6)? 1 Suppose 4o - 67 - 13 = 0. Suppose 6t - o = 2t. Suppose -2j - tv = -339, 73 + 423 = 3j - 5v. What is the tens digit of j? 6 Let g be 3/6 - (-1062)/4. Let d = 293 + 86. Suppose 3i - i - g = -2r, -i - d = -3r. What is the hundreds digit of r? 1 Let u(c) = -23c3 + 28c*2 + 191c + 39. What is the hundreds digit of u(-8)? 0 Suppose 340 = 8r - 6r. Let l = -163 - -473. Let y = l - r. What is the units digit of y? 0 Suppose -5a - 5m + 1 = -24, -a = -3*m	{ "pile_set_name": "DM Mathematics" }
derivative of o*6/120 - 3o*5/20 + 5o*4/24 + 13o*3/3 + 48o*2. Let m be i(8). Solve -3l = 2l + 2b - 14, b = 2l - m for l. 2 Let z be (0 - -13)(4 + -3). Let n be (-2)/3 + (-68)/5406-53. Solve 4i + 3j + 7 = 4j, -i + 4j - z = n for i. -1 Let j be (0 + 14/(-21))/((-20)/(-90)) - -10. Solve -b + 14n = 10n - j, -1 = -b + n for b. -1 Let o be 3510/(-936)(-8)/10. Solve g + 2p = 4, -op = -2g - 0g + 15 for g. 6 Let a = -95 - 46. Let n = -139 - a. Solve -4f + 2k + n + 0 = 0, k = -f + 8 for f. 3 Let r(z) = -6z - 100. Let m = -153 - -136. Let s be r(m). Let x be ((-10)/1)/(-12). Solve 0 = -5u - 3y - 6, 4u = su + xy - 21 for u. -3 Suppose -120 = -14z + 2z. Let m be 13 + 1/(2/z). Solve -3b + 5 = -5n + m, 0 = -2n - 3b + 22 for n. 5 Let p(v) = -64v - 180. Let c be p(-3). Solve -5y + k = -12, y - k = -4k + c for y. 3 Let x(z) = 2z3 - 9z*2 - 14z + 48. Let f be x(5). Suppose -1 = 2t + fs, 13 = 3t + s - 3. Solve 4j + t = -g, 2g - 5g + 15 = 0 for j. -3 Suppose 0 = f - 2h - 13, 7f - 5h = 3f + 37. Solve -d + 0d = i - 4, -3 = fd - 2i for d. 1 Let r(b) be the third derivative of b4/24 + b3/2 + b2. Let h = 487 + -486. Let n be r(h). Solve d + 9 = v, -2v + 3v = nd + 24 for d. -5 Let x(p) = -p*2 + 188p - 1089. Let r be x(6). Solve 0 = -3t - rw + 2 - 8, 0 = -2w for t. -2 Suppose -5h + h - 21 = c, -26 = c + 5h. Let l be c - -4 - (-2 + 3)/1. Solve -2i = 5w - 20 - 10, -7 = -3i + lw for i. 5 Let g = -1563 - -1578. Solve -4z + u + g = 14, 3 = -3u for z. 0 Suppose 0p + 3p = 2l + 29, -3l - 12 = 0. Solve n + 8 = -3v, n + 4v = -4 - p for n. 1 Let l = 1184 + -1180. Solve -15 = -5f - i, -5i + 28 = lf - 5 for f. 2 Let p(v) = 26v + 678. Let k be p(-26). Solve -11c + 2 = n - 14c, -n - 8 = kc for n. -4 Let t(s) = s*3 - 28s*2 - 124s - 118. Let z be t(32). Solve -4r = -d + z, r + 5d - 2 + 15 = 0 for r. -3 Let m(q) = q*2 + 225q - 2333. Let n be m(10). Solve 24v - 3s = 28v - n, -3v = s - 14 for v. 5 Suppose w - 3w = -8. Suppose 3a = -x - 2, wx + a + 2a - 10 = 0. Suppose 5d - 4 = 5r + 6, -3d + 12 = 0. Solve -xz = u + 2u + 4, -4 = -rz for u. -4 Suppose -d + 3d - 3m = 14, 0 = -5d - 3m + 14. Let v = -84 - -94. Solve x - v = -x + 4u, 0 = -du - 4 for x. 3 Let i = 153 + -155. Let m be 3/i2 + 9/3. Solve mk + 4 = -2k + s, 0 = -s - 2 for k. -3 Let p(g) = 22g - 836. Let s be p(39). Solve 7 = x + 5v - 3, -4v + s = -2x for x. -5 Let a = 9965 - 9962. Solve 3i = 4p - 23, ai + 4p - 8 = 9 for i. -1 Suppose 0 = 2z + 4, -43 + 133 = 2w - 5z. Let n = w + -56. Let k be 4/(n/(-62))2. Solve -5f + 9 = -6, 5q - 2f + k = 0 for q. -5 Suppose -13t = 8t + 23t - 440. Solve -4d = -2l - 2, t - 47 = -5l - 4d for l. 5 Let l = -12 - -17. Let w = -678 + 684. Let x = l + w. Solve -3h - x = -2h + 5b, 7 = -3h - 2b for h. -1 Let a be ((4 - 5) + -1 + -2 - -5)3. Solve 4 = -121x + 119x, -4c - 22 = ax for c. -4 Let a be (1 - 1) + 570/(0 - -6). Let r = 90 - a. Let p be (r/10)/(-1(-3)/(-66)). Solve v = -5w + p, v + 0v + 4 = 0 for w. 3 Let z be (-2)/((-4)/(-5)(675/(-66) - -10)). Solve s + 5 = 3v + z, s + 3v + 18 = 0 for s. -6 Suppose -m - 5a = -12, -8 = 2m - 4m - 2a. Suppose 5q - mh + 5h = 26, 3h = 2q - 2. Solve -3t - b - qb + 5 = 0, 2t - 8 = -b for t. 5 Suppose -15n + 30 = -12n. Let r be (n/(-15)1)/((-10)/30). Solve 2 = ra + w, -2w = 3a + 2 - 7 for a. -1 Let b = -8269 - -8272. Solve -3p - 42 + 21 = -bz, 5p + 5z - 5 = 0 for p. -3 Suppose 0 = -5t - 4x + 84, -t + 16 = -3x - 16. Let h be ((1 - -1) + 1)t. Suppose 52 = 4s - 2q, 5s - 4q - h = q. Solve -k + 16 = 3k, -k + s = 5f for f. 2 Suppose 12z - 36 = 8z. Suppose 4h - 13 = -5l, 4h = 4l + 2h - 26. Suppose 6 = lr - 9. Solve -16 = 5y - 3s + z, ry - 4 = -2s for y. -2 Let o be -65/10 + 5. Suppose oa + 4a = a. Suppose af + 3m + 15 = 4f, 0 = 4f + m - 11. Solve 4t = -3j - 31, j - ft - 2 = -j for j. -5 Let b(p) = -p2 - p + 6. Suppose -2t = -52 + 52. Let y be b(t). Let q = 11 - y. Solve 2g + 8 = 2c, qc - 10 - 4 = -g for g. -1 Suppose 25 = 5n + 5s, 5n + 0s = 3s + 17. Let t(h) = -4h + 3h - 10 + 1 + h*2. Let z be t(n). Solve 5u - 10 = 0, 0v + 9 = 3v + zu for v. 1 Let l(n) = 69n + 773. Let w be l(-11). Solve 5m = 3c - w, -22c + 6 = -m - 23c for m. -4 Let o = -7 - -16. Suppose -5b + 67 = 3g, -25b = 2g - 23b - 38. Let v = g - o. Solve 5u - 40 = vx, -u - 3u - 5x = -5 for u. 5 Let v = 1596 + -1594. Solve -4 = 4h + 3z, -vh - 2h - 4 = -4z for h. -1 Suppose -3u = -6y, -1 = 135u - 134u - 3y. Solve 0 = 4w, uw + 6 = -17m + 19m for m. 3 Let q(b) = 46b*2 + 182b + 33. Let z be q(-4). Solve 5k = 4m + z, 10k - m + 16 = 14k for k. 5 Let f(i) = i*3 - 5i*2 + 6i - 6. Let s = 5 - 1. Let l be f(s). Suppose -ln + n = n. Solve 2m - 4p + 5 - 21 = n, -5p - 25 = 0 for m. -2 Let v be 2/(-9) - 38/(-9). Suppose 0 = 2z - m, vm - 19 = -4z - 7. Let r be (-1)/1 + 6 - z. Solve 5o - 6 = -3b, 8 = 5o - 4o + rb for o. 0 Let j = -1857 - -1862. Solve -2a - 22 = -jz, -8 = 5a - z + 1 for a. -1 Suppose 6 = p - 2a, 2a + 7 = 2p - 3. Suppose -pn + 0n = -24. Let s be n/(-12) + (-18)/(-4). Solve -5q + 2u - 11 - 1 = 0, s = 4q - 5u for q. -4 Suppose -5f + 0f = 0. Let b(r) = -3r + 39. Let h be b(f). Let c be (-48)/(-26) - (-6)/h. Solve -ca - 3u - u - 10 = 0, 3u + 30 = 3a for a. 5 Let j be (29 - -4)(-216)/(-3564). Solve z - 4d = 5, 3z + 5d = -jz for z. 1 Let s = 11 - 4. Let o(y) = -y*3 - 91y*2 - 4y - 361. Let v be o(-91). Solve -2i - s = -a, vi - 3a + 5 = 5i for i. -2 Let v(d) = -13d2 + d + 135. Let h(x) = 35x*2 - 4x - 405. Let a(r) = 3h(r) + 8v(r). Let w be a(14). Solve -wp - 3o + 20 = o, 5o = p + 25 for p. 0 Let j(h) = -8h + 13. Let d(n) = -24n + 35. Let z(p) = 2d(p) - 7j(p). Let l be z(3). Solve 9 = lw + 3q, q + 0q - 3 = w for w. 0 Let g be (-28)/5305/(-8)-4. Let s = g + 857. Solve 0 = 4i + v + 16, -i + 0i = sv + 4 for i. -4 Let c be ((-8)/(-24))/(2/18). Suppose -4w = -5d + 183, -cd + 0d = 3w + 117. Let j = w - -44. Solve l + 3h = -2, -4l + jl = -h - 10 for l. 4 Let r be ((-7)/(-14))/((-3)/(-4)) - 2812/(-228). Solve -q + 4p + 1 = r, 5q + 5p - 40 = 0 for q. 4 Let j be (-3)/2(-120)/45. Let i be 1/(j - 8) + (-1)/(-4). Suppose 12u - 24 = -i. Solve p - up + 3l - 6 = 0, -3p = 2l + 7 for p. -3 Suppose -n = 89o - 91o + 1, 3o - 3 = 0. Solve 0 = -3l - 4y + 14, -n = -5l - 2y + 13 for l. 2 Let d(j) = 5j - 7j - 61 - 161 + 9j. Let y be d(32). Solve v - yl = -0v - 4, -3v - 3l = -6 for v. 0 Let p be (-9)/(-9) + 2/(-1). Let g(j) = j*2 + 43j + 42. Let u be g(p). Solve -d + 5w = 0, u = -4d - 3w + 5 + 18 for d. 5 Let o be (-599)/6 - -9 - (-10)/12. Suppose 186 = -2s - j, -3s + 7s + j = -370. Let g = o - s. Solve -gv + 14 = 2z, -5v + 2z - 5z + 27 = 0 for v. 3 Let b be ((-6)/(-9))/((-4)/6). Let y be (b - (-12)/8)4. Suppose -5u + 30 = -yu. Solve -u = -2p, -2g + 8 = 4p - 2 for g. -5 Let h be 9/2 - (24 + 1222/(-52)). Solve 241z - 245z = hw - 32, -z - 3w = -14 for z. 5 Let p be -14 - (-3 - 15). Suppose 5q + p = 6q. Suppose -q = 8k - 15k. Solve -2 = -4m - kc, 4c = -3m - c - 2 for m. 1 Let n be -52 - (-4 - (-2 + 0)). Let k be (-76)/(-13) - n/325. Solve r - 3d + 10 = 0, kr - 2r + 16 = 4d for r. -1 Let b be 12/(-28)4/6 - 184/(-56). Solve -12 = 3t - bn, -n + 4 = 11t - 7t for t. 0 Suppose 2v + 2a = 12, v + 1 - 19 = 3a. Suppose 0 = 4g - 5g + 3o + v, g - 5o = 13. Solve 4i - 2y - gy = -2, -2i + 5y + 4 = 0 for i. -3 Let j = -31764 + 31768. Solve -3p + 10 = f - 0, 4p = jf - 8 for f. 4 Let q(s) be the first derivative of s*3 - 7s - 62. Let o be q(2). Suppose 5m = p + 16, -p - 13 + 0 = -4m. Solve g = -2b - o, -b - mg = -11 + 1 for b. -5 Let d be (-1)/3((-5822)/328 - (-1)/(-4)). Solve 4k + 3n = 9k + 9, 2k = 2n - d for k. 0 Let o = 110 + -105. Suppose -on = -5h - 25, -n + 8 + 3 = -4h. Solve -2i + s = 6, 6 = -0i - 2i + ns for i. -3 Suppose -26f + 15 = -31f. Let k(g) = -g3 - g2 + 3g - 3. Let z be k(f). Let i(a) = -a - 3. Let q be i(-8). Solve 3h = -5w - z, -qh = 4w + w for w. -3 Let i be 78/(-208) - (3 + (-108)/32). Let m(u) = -4*u + 2. Let	{ "pile_set_name": "DM Mathematics" }
ve 43a + 70a = -48a - 4669 for a. -29 Solve -o = 9o + 132 + 148 for o. -28 Solve 43k - 138k - 53k + 5032 = 0 for k. 34 Solve -6339 = -25f - 6039 for f. 12 Solve 29v - 16v - 245 = -22v for v. 7 Solve -3j = 6j + 18 + 27 for j. -5 Solve 4h + 8h + 1578 = 1518 for h. -5 Solve 22j + 459 = -29j for j. -9 Solve 101a - 715 = 8a + 29 for a. 8 Solve 14m + 64 = 7m + 15m for m. 8 Solve 3086 = 315a - 694 for a. 12 Solve 117j = 702 + 1657 - 253 for j. 18 Solve 0 = -603u + 1300 + 1000 + 2524 for u. 8 Solve -1100x = -246x - 15372 for x. 18 Solve -8a + 28a - 170 = -14a for a. 5 Solve -47g - 1255 = 33g + 185 for g. -18 Solve -392q + 862 = -5410 for q. 16 Solve -29v - 912 + 1167 = 922 for v. -23 Solve 265t + 1309 + 7378 = -246t for t. -17 Solve -25o + 37 + 34 = -79 for o. 6 Solve 22k - 97k - 1792 = 53k for k. -14 Solve 233i + 3668 + 293 = 0 for i. -17 Solve -61c + 119c = 61c + 12 for c. -4 Solve 0 = -4m + 3842 - 3806 for m. 9 Solve 0 = -784z + 12251 - 5402 + 19023 for z. 33 Solve 45p + 11p = 8p + 432 for p. 9 Solve 44p + 50p = 118p - 24 for p. 1 Solve -80 = 13z - 132 for z. 4 Solve 780p = -817 + 37 for p. -1 Solve -22u + 531 + 533 = 130u for u. 7 Solve -5866 - 1536 + 318 = 253r for r. -28 Solve -80d - 798 = -158 for d. -8 Solve -110o + 41o + 69 = 0 for o. 1 Solve 0 = -g + 25234 - 25241 for g. -7 Solve -57d - 6d = -1008 for d. 16 Solve 0 = 90l - 54l - 22 - 302 for l. 9 Solve -158 + 260 = -133v - 563 for v. -5 Solve 49 - 161 = -16u + 80 for u. 12 Solve 244c - 287c - 477 = -4 for c. -11 Solve 17i = -8i - 270 + 120 for i. -6 Solve 1025 + 66 + 925 = 96l for l. 21 Solve -150 = 20g - 13g - 22g for g. 10 Solve -96 = -1321j + 1305j for j. 6 Solve 0 = -0t + 3t - 4075 + 4129 for t. -18 Solve 0 = -83u - 120u - 2030 for u. -10 Solve -24u - 686 = 130 for u. -34 Solve 231l - 308l - 693 = 0 for l. -9 Solve -296f + 101 + 275 + 216 = 0 for f. 2 Solve -29o + 49o = 240 for o. 12 Solve 194q = 1646 + 1264 for q. 15 Solve -403 = -120l + 180 + 497 for l. 9 Solve 2071 - 91 = 132t for t. 15 Solve 7v = -0v - 11v - 72 for v. -4 Solve -52x = -128 + 24 for x. 2 Solve -3058v + 3034v - 192 = 0 for v. -8 Solve -29d - 47d - 159d + 3525 = 0 for d. 15 Solve 0 = -43861k + 43725k - 3944 for k. -29 Solve -137p + 287p = 1650 for p. 11 Solve -45l + 97l - 396 = 96l for l. -9 Solve -296v - 182v - 13384 = 0 for v. -28 Solve -456d - 4d + 2159d - 62863 = 0 for d. 37 Solve 7c - 42 - 77 = -0 for c. 17 Solve 353c = -4077 - 5407 + 1012 for c. -24 Solve 56s + 156 + 68 = 0 for s. -4 Solve 520v - 486v = -238 for v. -7 Solve 9s + 30s - 1089 = 6s for s. 33 Solve -660f + 4872 = -125f + 12362 for f. -14 Solve 0 = 70g + 18 + 279 + 333 for g. -9 Solve -417t + 512t - 2755 = 0 for t. 29 Solve -485m - 100 = -460m for m. -4 Solve 16z + 74 - 3 - 7 = 0 for z. -4 Solve -152 = 41x - 38x - 22x for x. 8 Solve 65q - 102q - 374 = -54q for q. 22 Solve -85h - 80h - 120 = -157h for h. -15 Solve -133w + 264 = -199w for w. -4 Solve 0 = -44k - 18k + 744 for k. 12 Solve 933 + 267 = -48w for w. -25 Solve -271v + 126v + 136v - 54 = 0 for v. -6 Solve 67 + 42 + 91 = 25y for y. 8 Solve 12288g + 221 = 12305g for g. 13 Solve 5o + 2543 = 2593 for o. 10 Solve 0 = 41s + 41s - 511 - 63 for s. 7 Solve 1520g = -22859 - 28821 for g. -34 Solve -474h = 30h for h. 0 Solve 805 - 772 = -33z for z. -1 Solve 19j + 112 - 17 = 0 for j. -5 Solve 0 = 19q + 21 + 151 - 20 for q. -8 Solve -36p + 148 + 320 = 0 for p. 13 Solve 41 - 21 = 3i + i for i. 5 Solve 21m = 1155 - 1176 for m. -1 Solve 142s = 124s - 72 for s. -4 Solve 481 - 2473 = 235b + 2003 for b. -17 Solve 6t = -67t - 1523 - 1032 for t. -35 Solve -546x = 101x + 246x - 1786 for x. 2 Solve 5622 + 4466 = 388f for f. 26 Solve -11140w + 11079w = 305 for w. -5 Solve -40k - 65 - 215 = 0 for k. -7 Solve -304j - 1528 = 600 for j. -7 Solve 3952t = 2714t - 22284 for t. -18 Solve 109m + 9120 = 589m for m. 19 Solve -611l + 582l = -203 for l. 7 Solve 23n = -12n - 132 - 498 for n. -18 Solve -14t = -30007 + 30245 for t. -17 Solve 127h + 1249 - 124 = 52h for h. -15 Solve 143y - 88 = 913 for y. 7 Solve 788t - 7720 = -756t for t. 5 Solve -190t = -70 + 86 - 586 for t. 3 Solve -85l + 6l - 811 + 21 = 0 for l. -10 Solve 247t - 16t - 1617 = 0 for t. 7 Solve 5w - 10265 = -10320 for w. -11 Solve -31f = -344 + 623 for f. -9 Solve 187h - 23h + 1968 = 0 for h. -12 Solve -39l + 304l = -88l + 5295 for l. 15 Solve -107a - 152a - 2048 = -3a for a. -8 Solve 247 + 2220 = 172p + 59 for p. 14 Solve -297j = 103j - 4000 for j. 10 Solve -46k + 74 = 196 + 752 for k. -19 Solve 37u + 12 = -67 - 69 for u. -4 Solve -182v - 94v = 2484 for v. -9 Solve 37b = -263 - 107 for b. -10 Solve -16m + 291 = -59m - 10 for m. -7 Solve -932v + 3593 = 25029 for v. -23 Solve 0 = -72t + 122t + 500 for t. -10 Solve 397q + 23q = 4214 + 406 for q. 11 Solve 100 = -58p + 30 + 186 for p. 2 Solve 0 = 1061u - 1085u + 360 for u. 15 Solve 0 = -37q + 139 + 42 + 189 for q. 10 Solve -1240y + 1228y + 312 = 0 for y. 26 Solve -54i + 23i = 0 for i. 0 Solve -6x - 25 = -91 for x. 11 Solve 31m - 799 + 396 = 0 for m. 13 Solve 6r - 25 = 25r + 32 for r. -3 Solve -151q - 174q - 10317 = 218q for q. -19 Solve 466 = -26b + 934 for b. 18 Solve 0 = 1844h - 1680h + 328 for h. -2 Solve 336k - 65 = 331k for k. 13 Solve -68i + 272 = 1972 for i. -25 Solve 15h = -76h + 192 - 829 for h. -7 Solve 0 = -125o - 155o - 5040 for o. -18 Solve 59z - 2135 = -86z - 250 for z. 13 Solve 20m - 977 = -42m + 139 for m. 18 Solve 55m = -1333 + 2048 for m. 13 Solve -24l - 28l = -6l - 184 for l. 4 Solve 141 + 778 = 225q + 6094 for q. -23 Solve 319f + 324f - 180f + 13890 = 0 for f. -30 Solve 9145 = -1243z + 26547 for z. 14 Solve -13123c + 2262 = -13045c for c. 29 Solve 131g + 1553 = -1304 - 1597 for g. -34 Solve 16c + 86c + 25687 = 28441 for c. 27 Solve 9296p = 9289p - 42 for p. -6 Solve 385s - 380 = 1275 - 115 for s. 4 Solve -65i - 357 = 59i - 145i for i. 17 Solve -278l = -322l + 80 + 580 for l. 15 Solve 747n = 830n - 2988 for n. 36 Solve -610a - 193a - 24963 = -70 for a. -31 Solve 525a + 1339 = 422a for a. -13 Solve 1093d - 1158d = 975 for d. -15 Solve -53516 + 53672 = -12r for r. -13 Solve 278q - 9289 + 1227 = 0 for q. 29 Solve 560 = -129w + 44 for w. -4 Solve 38o = -36 - 116 for o. -4 Solve 133g = -174 + 3484 - 118 for g. 24 Solve -52y - 1474 = 22y + 80 for y. -21 Solve 14i = -38i + 13i - 117 for i. -3 Solve 4 - 1 = -19v - 54 for v. -3 Solve -200k + 141k - 873 = -156k for k. 9 Solve -8r = 15r - 45r for r. 0 Solve -87q - 1514 = 76q + 1257 for q. -17 Solve -520t + 6096 = 14486 + 8250 for t. -32 Solve 420v = 233v + 2618 for v. 14 Solve -261 + 317 = -8d for d. -7 Solve 49s + 463 = 23s + 99 for s. -14 Solve -42s = 29 - 29 for s. 0 Solve -211b + 2550 = 44b for b. 10 Solve -261b + 273b + 192 = 0 for b. -16 Solve -6544z + 6583z = -195 for z. -5 Solve -26488 = -235a - 628a - 341a for a. 22 Solve 147p = 144p - 9 for p. -3 Solve -1032 = -11s + 3s - 944 for s. 11 Solve -12b = -b + 9b + 200 for b. -10 Solve -76p + 176p = -79p - 3580 for p. -20 Solve -1881 - 319 = -275x for x. 8 Solve -136u + 289u = 81u for u. 0 Solve 39s - 26 = 175 - 6 for s. 5 Solve 569c + 154 + 622 = -931 for c. -3 Solve 0 = -35s - 5s + 22s - 162 for s. -9 Solve -1900 = 155a - 55a for a. -19 Solve 30 = -117q + 147 for q. 1 Solve -66a = -1455 + 1983 for a. -8 Solve -338m + 83m + 4590 = 0 for m. 18 Solve 20 = -15j + 2j + 7 for j. -1 Solve 8l = -3l - 1166 + 913 for l. -23 Solve -83t - 585 - 183 = 643 for t. -17 Solve -101 + 326 - 2569 = 293y for y. -8 Solve 2354 = 319r - 517 for r. 9 Solve 0 = 306t + 1680 - 456 for t. -4 Solve -135u - 1799 = 122u for u. -7 Solve -17403 = 15b - 17553 for b. 10 Solve 793f - 706 - 5638 = 0 for f. 8 Solve -1073 + 1359 = 22z for z. 13 Solve 2028p + 6650 = 2294p for p. 25 Solve 73v + 0 = -0v - 292 for v. -4 Solve -518f - 13900 = 177f for f. -20 Solve 26p = -64287 + 64651 for p. 14 Solve 289 = -33c - 5c + 213 for c. -2 Solve -13w + 3w - 29 - 1 = 0 for w. -3 Solve 36a + 162 = 238 - 796 fo	{ "pile_set_name": "DM Mathematics" }
prime? True Is 34255313303 a composite number? False Is 903277451 prime? False Is 36028237673 composite? False Is 4131552149 prime? False Is 6080293651 prime? False Is 2278256303 a prime number? True Is 2227592249 composite? False Is 1280557319 a prime number? False Is 41090756439 composite? True Is 6076470451 prime? False Is 172840893331 a prime number? True Is 75003594233 prime? True Is 19113419813 composite? False Is 12501099659 a composite number? True Is 4472039993 composite? True Is 7008905689 prime? True Is 3851483947 a prime number? True Is 549527509 prime? False Is 960862685 prime? False Is 2706215749 a composite number? False Is 311555957 prime? False Is 27615703223 composite? True Is 602667743 prime? True Is 100613729 prime? True Is 52847032019 composite? False Is 318507509 a prime number? False Is 4254736687 a prime number? True Is 1231738493 composite? True Is 168767843 prime? False Is 18316056223 a composite number? False Is 35608851769 composite? False Is 162152249498 a prime number? False Is 1608520141 composite? True Is 14310383 composite? True Is 975309443 composite? True Is 8334243991 composite? False Is 2081072263 a composite number? True Is 7171797453 composite? True Is 2976908665 prime? False Is 6555946039 a composite number? True Is 2693189771 a prime number? False Is 21054414649 a composite number? False Is 1745414543 prime? True Is 379990433 a composite number? True Is 787402163 composite? True Is 18978551759 prime? True Is 221996897497 a composite number? False Is 702667733 composite? True Is 3938514149 composite? False Is 1888071805 a prime number? False Is 34928257379 prime? False Is 963849622 composite? True Is 12080475851 a composite number? True Is 4675942681 a prime number? False Is 14615003057 a composite number? True Is 2592073201 a prime number? True Is 2753244101 a composite number? False Is 19154278753 a composite number? True Is 15297792439 a composite number? False Is 3434290269 prime? False Is 383025814 a composite number? True Is 18422597389 a composite number? True Is 3533214701 a prime number? True Is 895659317 composite? True Is 15656115547 prime? True Is 76569042271 a prime number? True Is 10548752749 a composite number? True Is 58788931 a composite number? False Is 17041757479 a prime number? True Is 2727540863 composite? False Is 5069210951 composite? True Is 817180241 composite? True Is 1087405393 a prime number? False Is 940681643 composite? True Is 16460506727 prime? False Is 15905106509 composite? True Is 33133772131 a prime number? True Is 72275249 prime? True Is 29485363 composite? False Is 374218409 a composite number? True Is 20622595141 composite? True Is 7621789683 a prime number? False Is 284973895 a composite number? True Is 25057330009 prime? True Is 659277761 prime? False Is 190290623 a composite number? True Is 4907233909 prime? True Is 13750146691 prime? True Is 4052656259 a composite number? False Is 717445754 a prime number? False Is 179935891 prime? True Is 8739111893 composite? True Is 28549077757 composite? False Is 4730656979 composite? True Is 33602208361 composite? False Is 16510956047 a prime number? False Is 7147515679 a prime number? True Is 1842472217 a composite number? False Is 629107529 composite? True Is 345692357 a composite number? True Is 72369497 a prime number? True Is 2862882107 composite? False Is 41273711774 composite? True Is 12831236003 prime? True Is 82735794763 a composite number? False Is 7621306991 prime? True Is 1928961929 a composite number? True Is 134301607079 a prime number? True Is 4034375123 a composite number? True Is 17939301271 a prime number? False Is 477334625269 a prime number? False Is 16028497777 a prime number? True Is 299214346985 prime? False Is 7646505005 a composite number? True Is 69932227681 a composite number? False Is 445451359 composite? True Is 6667569151 a prime number? True Is 8434143489 prime? False Is 1132428977 a prime number? False Is 58402621 prime? True Is 6202492603 prime? True Is 237345233 prime? True Is 372220153 a composite number? True Is 648937687 prime? False Is 4562817517 prime? True Is 102458747 a prime number? True Is 209976387239 a composite number? False Is 588816451 prime? False Is 181882681 a composite number? False Is 12710267391 prime? False Is 7780231931 composite? True Is 9927129607 composite? True Is 8011497427 prime? False Is 9748515137 prime? False Is 4239418559 a prime number? True Is 1533170707 prime? True Is 383363873 prime? True Is 17667906853 a composite number? False Is 215700392071 a prime number? False Is 180045113617 a composite number? False Is 43987492947 composite? True Is 16952237529 a composite number? True Is 15475559577 composite? True Is 69701709835 prime? False Is 1389616229 prime? False Is 3367476941 a prime number? True Is 108562609 composite? False Is 978302813 composite? False Is 256389569 prime? True Is 20790691819 prime? True Is 63619450753 composite? False Is 295038073 prime? False Is 36508379945 a composite number? True Is 41275936717 composite? True Is 4593890303 prime? False Is 569840897 a composite number? False Is 2786684833 a prime number? True Is 125416691 a composite number? True Is 2443321333 a composite number? False Is 9487644619 prime? False Is 3339053461 composite? True Is 785735999 a prime number? False Is 2929498783 a composite number? False Is 9310059271 a composite number? False Is 112270044655 prime? False Is 12808858357 a composite number? True Is 1574018395 a prime number? False Is 64382469059 prime? True Is 180035087 composite? False Is 52779863263 composite? True Is 58741073 composite? True Is 1449276109 composite? False Is 4489651343 a composite number? True Is 498921521 prime? False Is 2765975791 a composite number? True Is 600373106 a prime number? False Is 1158561251 prime? True Is 95899391851 prime? True Is 6389287051 composite? True Is 902544763 prime? True Is 77031416029 prime? True Is 266292505631 prime? True Is 14641347849 prime? False Is 698208473 a prime number? True Is 10168142095 prime? False Is 3400656713 a composite number? False Is 31908545933 composite? True Is 112684125329 a prime number? True Is 8773325611 a prime number? True Is 369483701 composite? True Is 788579933 a composite number? True Is 1144089599 a composite number? False Is 6289519477 composite? True Is 648237103 composite? False Is 102384203762 a prime number? False Is 1220611877 prime? False Is 3601186073 a composite number? False Is 2212222687 a prime number? False Is 5382385919 a prime number? True Is 309993107 a prime number? True Is 13670514958 prime? False Is 715168901 composite? True Is 25919037887 a composite number? False Is 257138903 a composite number? True Is 27060490021 composite? True Is 6358310467 prime? False Is 452240795 a prime number? False Is 480800011 a prime number? True Is 21186118819 a composite number? True Is 19693663201 prime? True Is 7941730661 a prime number? True Is 378944717 composite? True Is 3591894157 a prime number? False Is 19673232107 composite? False Is 245318603 composite? False Is 66481995691 a composite number? True Is 877775101 composite? True Is 1471972207 a prime number? False Is 5361202817 a composite number? False Is 2569738823 a composite number? False Is 3235766399 composite? False Is 329992415882 a prime number? False Is 3575504458 prime? False Is 659692981 a composite number? True Is 5662155049 a composite number? False Is 256340763669 composite? True Is 533113667 prime? True Is 51559349 a prime number? True Is 2007612701 composite? True Is 11446020517 a prime number? False Is 135103844641 a prime number? False Is 1333700222521 composite? False Is 2070743117 a composite number? True Is 11816145773 prime? False Is 23534213453 composite? False Is 3928279414 a prime number? False Is 10811799811 a prime number? True Is 41121371527 composite? False Is 7418764277 a prime number? False Is 4363104679 a prime number? True Is 164000580809 composite? True Is 109778320813 a composite number? True Is 4577113249 a prime number? False Is 333448501 composite? False Is 58572281 a composite number? False Is 40426111987 a prime number? False Is 835981423 a prime number? True Is 27994202063 a composite number? False Is 414751943 a compos	{ "pile_set_name": "DM Mathematics" }
60340059 + 312460340059 - 13p + 4p - 6p. -15p Collect the terms in 4m - 1138 + 829 + 307. 4m - 2 Collect the terms in 41m - 265m + 55m + 49m + 98m. -22m Collect the terms in -796673u3 - 796732u*3 + 1593412u*3. 7u*3 Collect the terms in -58830d*3 - 2d + 4d - 2d + 0d. -58830d*3 Collect the terms in -84p*2 + 40p*2 + 44p*2 + 1126335p*3. 1126335p*3 Collect the terms in 461x*3 + 10x*2 - 10x*2 + 662x*3 - 347x*3. 776x*3 Collect the terms in -35 + 10031696k*2 + 35 - 10031675k*2. 21k*2 Collect the terms in -121726 - 2989b*2 + 121726 + 2956b*2. -33b*2 Collect the terms in -57231q*3 + 113579q*3 - 56347q3. q3 Collect the terms in 3482v2 + 3494v*2 - 6977v*2 + 8v - 7v. -v2 + v Collect the terms in 5n - 3n + 0n + 81 - 29n3 - 18 + 25n*3. -4n*3 + 2n + 63 Collect the terms in 30c - 72c + 9c + 51c + 15 + 4c2 - c2. 3c*2 + 18c + 15 Collect the terms in -221f - 246f + 1001f - 211f - 290f. 33f Collect the terms in 5p - 12p - 1332 + 1264. -7p - 68 Collect the terms in 9682h + 5546h - 433h + 11009h. 25804h Collect the terms in 218058u3 - 493295u*3 + 275241u*3. 4u*3 Collect the terms in -95055j + 206355j - 111299j. j Collect the terms in 12i + 46 - 2469 + 384. 12i - 2039 Collect the terms in 22f3 + 188f - 83f + 0 + 71f*3 + 0 - 110f. 93f3 - 5f Collect the terms in 342 + 35a2 - 34a2 - 170 - 168. a2 + 4 Collect the terms in 8 - 8 - 8w2 - 9w*3 - 7w*3 - 49w. -16w3 - 8w*2 - 49w Collect the terms in -221s2 - 1595s*2 - 888s*2 - 585s*2 - 281s*2. -3570s*2 Collect the terms in -11f - 28 + 21 - 14 + 13f + 21. 2f Collect the terms in 185392p3 - 370619p*3 + 185529p*3 + p - p. 302p*3 Collect the terms in -193 - 37p + 41 + 50 + 61 + 39. -37p - 2 Collect the terms in 6269g*3 - 43324g*3 - 36823g*3. -73878g*3 Collect the terms in -2646 - 6810 - 7104 - 2x. -2x - 16560 Collect the terms in -22t*2 - 8t*2 + 37t*2 + 13 + 55t*2 - 10. 62t*2 + 3 Collect the terms in 407d + 408d + 276 - 547 - 796d + 272. 19d + 1 Collect the terms in -25l - 39l3 + 15l*3 - 6l*3 + 22l. -30l3 - 3l Collect the terms in -65052w2 + w3 - 164385w*2 + 14825w2. w3 - 214612w2 Collect the terms in 151d*2 + 148d*2 + 39d - 601d2 + 151d*2 + 147d*2. -4d*2 + 39d Collect the terms in 142z + 44 + 49 + 73 - 54z - 169 + 222z. 310z - 3 Collect the terms in -86j2 + 7j*2 - 484626j + 2j2 + 1 + 484628j. -77j2 + 2j + 1 Collect the terms in 76a3 - 26413829 + 26413829. 76a*3 Collect the terms in 103q*2 + 65 - 370q*2 + 101q*2 + 70q*2 + 95q2. -q2 + 65 Collect the terms in 3290921q + 3290589q - 6581506q. 4q Collect the terms in 235z2 - 162z*2 + 6 - 143z*2 - 103z*2. -173z*2 + 6 Collect the terms in -t + 468 - 122 - 120 - 192. -t + 34 Collect the terms in 210968g - 210967g + 2917 + 2914 + 2916 - 8747. g Collect the terms in -265q*3 + 647q*3 + 318q*3. 700q*3 Collect the terms in -4 + 2 + 40499k + 4 - 2. 40499k Collect the terms in -3o2 - o2 + 5 + 46o - 44o + 109. -4o2 + 2o + 114 Collect the terms in 112842v + v3 - 7 - 3v*3 + 4v*3. 2v*3 + 112842v - 7 Collect the terms in -3 + 2620g - 2 - 2 + 8 - 1792g. 828g + 1 Collect the terms in -132417a - 43a2 + 132417a + 0a2. -43a*2 Collect the terms in -58t + 12t - 6t - 197t + 59t - 10t. -200t Collect the terms in 272853d2 + 272857d2 + d3 - 818558d2 + 272848d2. d3 Collect the terms in -3212178424 + 1606089210 - c + 1606089214. -c Collect the terms in -2685g + 1731g + 1177g. 223g Collect the terms in -264q3 - 113q*3 - 91q*3 + 6q + 264q3 - 5q. -204q3 + q Collect the terms in 18 + 3w - 4w - 56 - 3767w*3 + 29. -3767w*3 - w - 9 Collect the terms in -73o - 30o + 145o - 16o - 9o - 11o - 8o. -2o Collect the terms in 18w - 7w - 2w + 20w - 23w - 7w. -w Collect the terms in 2 - 916594h*2 + 925683h*2 - 2. 9089h*2 Collect the terms in 17m - 15m + 223 + 1801m*2 - 111 - 113. 1801m*2 + 2m - 1 Collect the terms in 17352o - 571o + 23439o. 40220o Collect the terms in -2b3 + 19b*2 - 169b - 19b2 - 72b + 241b. -2b*3 Collect the terms in -1798190g*3 + 899101g*3 + 899104g*3. 15g*3 Collect the terms in 19 + 23 - 42 + 35583h. 35583h Collect the terms in -4813635z - 4 + 4 + 2406782z + 2406851z. -2z Collect the terms in 20208i*3 - 40669i*3 + 20468i*3. 7i*3 Collect the terms in 189947t - 193878t - 3 + 6. -3931t + 3 Collect the terms in 3277h2 - 3404h*2 - 311h + 313h. -127h*2 + 2h Collect the terms in 1935z3 - 1930z*3 - 19z + 279 + 16z - 279. 5z*3 - 3z Collect the terms in u3 + u2 + 43u3 + 125u*3 + 162u*3 + 18u*3. 349u3 + u2 Collect the terms in 94105u - 376432u + 94105u + 94104u + 94106u. -12u Collect the terms in -129 + 2i2 + 33 + 28 + 42 + 26 - 76i. 2i2 - 76i Collect the terms in 2499686m2 - 833230m*2 - 833224m*2 - 833228m*2. 4m*2 Collect the terms in -843d*2 + 1689d*2 - 4 + 4 + 11682d*2. 12528d*2 Collect the terms in -57u*2 - 397u*2 + 1155u*2 + 2689u*2. 3390u*2 Collect the terms in 65747w*2 - 12 + 4227w - 4227w + 12. 65747w*2 Collect the terms in -759b + 0 - 24 + 150b - 21. -609b - 45 Collect the terms in 139i - 1 + 1 + 444i + 1619i - 3674i. -1472i Collect the terms in 32381 + 679o - 1361o + 681o. -o + 32381 Collect the terms in -59j3 - 64j*3 - 10 - 51j*3 + 6 + 173j3 - 21. -j3 - 25 Collect the terms in 2 - 52474u + 104993u - 52500u. 19u + 2 Collect the terms in l2 + 48 + 14 + 12 + 10 - 20 - 64. l2 Collect the terms in -1177x2 - 11x*3 - 1229x*2 + 1 + 2406x*2 - 34x*3. -45x*3 + 1 Collect the terms in 13g + 2 + 0 - 122g. -109g + 2 Collect the terms in 62318i - 186843i + 62319i + 62418i. 212i Collect the terms in -6 + 5 - 7091r*3 + 6495r*3. -596r*3 - 1 Collect the terms in -2523 - 8s - 10s - 875 + 312. -18s - 3086 Collect the terms in -106a3 - 3a - 12982 - 563a3 + 12982 + 7a. -669a3 + 4a Collect the terms in 2829l3 + 2l*2 - l + 5230l*3 - 5l*2 + 3l*2. 8059l*3 - l Collect the terms in -16150 + 31o*3 + 28o*3 - 16o*2 + 16150 + 16o*2. 59o*3 Collect the terms in 368058851w*3 - 2 - 368058848w*3 + 2. 3w*3 Collect the terms in 4586 + 3y - 11y - 13749 + 4576 - y2 + 4587. -y2 - 8y Collect the terms in 2 + 3 + 2204j - 9346j - 4. -7142j + 1 Collect the terms in 48733o + 48736o + 48715o + 48715o - 194860o. 39o Collect the terms in -837498t + 49 - 49 + 837350t. -148t Collect the terms in -43p + 569p*2 + 30p + 13p + 206p*2. 775p*2 Collect the terms in 2238267412 - 2238267412 - 29d*3 - 2d*3. -31d*3 Collect the terms in -1345959p + 1345959p - 10p*2. -10p*2 Collect the terms in 55t + 0t - 3t*2 - 69 + 0t*2 + 4t2 + t2. 2t2 + 55t - 69 Collect the terms in 309t2 + 3t - 213t2 - 90t*2. 6t*2 + 3t Collect the terms in -889709 - 595v2 - 7v + 889709. -595v2 - 7v Collect the terms in -73n3 + 26n*3 + 118 + 16 - 3n*2 + 3n*2. -47n*3 + 134 Collect the terms in -10 + 31 - 16 - 30 + 57u. 57u - 25 Collect the terms in 3g + 26932g2 - 138 - 26925g*2 - g - g. 7g*2 + g - 138 Collect the terms in -24367u + 48717u - 24354u - 69u2. -69u*2 - 4u Collect the terms in -20027 + 38729 - 18702 - 4q2. -4q2 Collect the terms in c2 + 0c + c2 - 60c + c*2 - 5 - 4c. 3c2 - 64c - 5 Collect the terms in -98954f2 + 296805f*2 - 98941f*2 - 98942f*2. -32f*2 Collect the terms in 14054i*3 + 3i*2 - 13617i*3 - 3i*2. 437i*3 Collect the terms in -45048m*2 + 22542m*2 + 22564m*2. 58m*2 Collect the terms in 185v*2 + 166154v + 166146v - 42v*2 - 332298v. 143v2 + 2v Collect the terms in -1025842 + 2051399 - 1025673 + 0g + g. g - 116 Collect the terms in -8852k*2 - 9109k*2 - 3k*3 + 27037k*2 - 9076k*2. -3k*3 Collect the terms in -62447c*2 - 3c + 3c - 634063c*2. -696510c*2 Collect the terms in 3322r - 1236r + 2691r - 1018r. 3759r Collect the terms in 4o - 7o + 1225o*2 - 12	{ "pile_set_name": "DM Mathematics" }
? 6 Let g = 8 + -5. Suppose 0 = -gj + 3p + 12, -4j + 3p = -2j - 9. Suppose 3t - 4h = 25, t + jh = 5t - 31. What is the units digit of t? 7 Suppose -4v - 3p + 636 = 0, v + 3p - 159 = -2p. What is the tens digit of v? 5 Suppose 0y = 5y - 5. What is the units digit of (-4 + -2)(y - 2)? 6 Let n = -136 - -198. What is the units digit of n? 2 Let z be (-1)/(-3) - 24/(-9). Let v(m) = 0m + 4m - 2m2 + mz - 6m - 2. What is the units digit of v(3)? 1 Suppose -6w + 4w - 10 = -3u, 3w = -4u + 2. What is the tens digit of 35 + 1 + -3 - u? 3 Suppose -4c = -3c - 2f - 113, 5c = 5f + 550. What is the hundreds digit of c? 1 Suppose -18 = l + 4p, -3l + 0l + 4p + 26 = 0. Let o be (-1 + 2)-1-1. Let i = l + o. What is the units digit of i? 3 Let a(r) = 4r2 - r - 2. Let s be a(2). Suppose -36 = -5h + h. Suppose -hi + s = -6i. What is the units digit of i? 4 Let f(u) = -u - 4. Let c be f(-2). Let z(d) = 5d2 - d - 4. What is the tens digit of z(c)? 1 Let d(g) = 11g*3 - 15g*2 + 3g + 4. Let w(y) = 5y3 - 7y*2 + y + 2. Let z(x) = 3d(x) - 7w(x). What is the tens digit of z(-2)? 2 Let w = 1 - 0. Let v = 0 + w. Suppose -r - v = -3. What is the units digit of r? 2 Suppose -312 = -4a + 2f, 3a - 389 = -2a + 2f. What is the units digit of a? 7 Suppose -2l - 7 = -3. Let b be 18/(-5 - l) + -1. Let j(v) = -v. What is the units digit of j(b)? 7 Let z(o) = o + 9. Let m be z(-10). What is the units digit of 10m/4-2? 5 Suppose 0 = 5b - 20, -3d - 2b + 23 = 3b. What is the units digit of d? 1 Suppose 0 = u + 4, 0o = 4o + u - 208. What is the units digit of o? 3 Let m(d) = -9d + 2. What is the units digit of m(-2)? 0 Let r = 342 + -181. What is the hundreds digit of r? 1 Let w(g) = -g*2 - 9g - 9. Suppose 3k + 5 = 2q - q, 3k - 10 = -2q. Suppose k = 5t + 2 + 33. What is the units digit of w(t)? 5 Suppose 2h = 5m - 76, 4m - h = -3h + 68. Let f = m - 8. What is the units digit of f? 8 Let l(r) = 5r + 11. Let j(p) = p + 3. Let h(z) = -9j(z) + 2l(z). Let w be h(5). Suppose wq - 12 = -2q. What is the units digit of q? 6 Let t be (3 - 2)-113. Let z = 5 - t. What is the tens digit of z? 1 Suppose 63 + 15 = 2l. What is the units digit of l? 9 Suppose -18 = -3n - a, -24 = -4n - 4a + 2a. Let l(z) = -z3 + 4z*2 + 7z + 2. Let t be l(5). Let k = t - n. What is the units digit of k? 6 Let h be -44/(-14). What is the tens digit of 1 + (2 - h) + 30? 2 Let x be (-2)/(-3) + (-6)/(-18). Let z be 0/2x/(-2). What is the tens digit of 5/(z - 3/(-6))? 1 What is the tens digit of 18/((6/9)/1)? 2 Let u = 29 - 17. Suppose 5w + 3o - 128 = o, 0 = w - 3o - u. What is the tens digit of w? 2 Suppose -v - 77 = 3i + 3v, -5v - 103 = 4i. Let x = i - -43. Let g = x - 7. What is the units digit of g? 9 Suppose -180 = -6u + 168. What is the units digit of u? 8 What is the units digit of (-1)/(-10)528? 4 Suppose -3g = 17 - 2. Let h = g - -10. Suppose 0 = -5k + 7 + 13, -13 = o - hk. What is the units digit of o? 7 Let m be (3/4)/((-1)/(-4)). Suppose -mi + 2i + 35 = 0. What is the units digit of i? 5 Suppose 5p - 106 = 54. What is the tens digit of p? 3 Let y(j) = -j3 + j - 3. Suppose 2f + q - 10 = 0, -2q = 2f + 2q - 22. Let p be y(f). Let h = -13 - p. What is the units digit of h? 4 Let s = 37 + 9. What is the units digit of s? 6 Let t = 13 + 26. What is the units digit of t? 9 Let t = 1 + 0. Let a be (2 + -2)1/t. Suppose a = f - 6 - 2. What is the units digit of f? 8 Let z(w) = -w + 11. Let a(n) = n - 5. Let p be a(4). Let r be 6 + -3 - (p - -4). What is the units digit of z(r)? 1 Let z = 11 - 3. Suppose 5i = zi - 6. What is the units digit of i? 2 Let o be -9 - (4/(-2) - 0). Let c(y) = -y - 2 + 3y - 2y - 2y. What is the tens digit of c(o)? 1 Suppose -5a - 20 = -2r, -a = 5r - 6a - 35. Suppose 32 = 3p + rb, 4p - p - 3b = 48. What is the units digit of p? 4 Suppose 0 = -2v + v - 1. Let b = v + 3. Suppose i = -2, h - 3i + bi = 4. What is the units digit of h? 2 Let m = 1 + -1. Suppose -2n - 2 = -mn. What is the units digit of (-2 + 4 + n)/1? 1 What is the units digit of -2734/(-9)? 6 Let t(p) = p*2 + p. Let g be t(-2). Suppose 4 = gz - 2. What is the units digit of z? 3 Let k = 4 - -3. What is the units digit of k? 7 Let b(g) = 2g - 3. What is the tens digit of b(11)? 1 Suppose 0f = -f + 5. Suppose 0 = i + c + c + 3, 3c + 11 = fi. What is the units digit of i? 1 Let x(d) = 2d2 - 3d + 3. Let b be x(-3). Let m = b - 20. What is the units digit of m? 0 Let r(n) be the second derivative of n*5/20 + 3n*4/4 + 4n*3/3 - 4n*2 - 2n. What is the tens digit of r(-7)? 3 Suppose p - 5p = 2f + 26, 20 = -4p. Suppose -16 = -0t + 2t. Let r = f - t. What is the units digit of r? 5 Let x = 289 - 155. What is the tens digit of x? 3 Suppose -2p - 12 = -14. Suppose -5x + 11 - p = 0. What is the units digit of x? 2 Suppose l - 4n = -1 - 1, -4l - 5n - 29 = 0. Let o be 1 + 1 - (l + 3). Suppose 5 = -i, -1 - 20 = 4p + oi. What is the units digit of p? 1 Suppose 0 = -3u - 5y + 84, 2u = -2u + y + 112. What is the units digit of u? 8 Suppose 8 = -4t + 5i, 3t - 5t + 3i - 6 = 0. What is the units digit of t? 3 Let a = 24 + 15. What is the units digit of (4/6)/(2/a)? 3 Let o(a) = 9a*2 + 3a - 3. Let l be o(-5). Suppose -5t = v - l, 2t - 93 = 6v - 3v. What is the units digit of t? 2 Suppose 5f = -2u - 155, -f + 2u = 3f + 106. Let h be 3/2-112. Let l = h - f. What is the units digit of l? 1 Let f = 27 - 29. What is the tens digit of (f + -1)/(33/(-506))? 4 Suppose 0 = 12h + h - 2613. What is the tens digit of h? 0 Suppose 5c + 11 - 71 = 0. Let i be (-4)/c - 32/(-6). Suppose -i - 39 = -4o. What is the tens digit of o? 1 Let j(o) = 2o*2 + 2o - 3. Let u be j(3). Let t be (-6)/u - 9/(-7). Suppose 2d - 3 = -t. What is the units digit of d? 1 Suppose -108 = -4o + 3c, 0o + o = 4c + 40. What is the tens digit of o? 2 Suppose 3d - 133 = -2s, 0d + 3d = 2s + 149. What is the units digit of d? 7 What is the units digit of (-1)/(-8) + (-7932)/(-32)? 8 Suppose -2a = -4a - 26. Let z = 27 - 2. Let p = a + z. What is the units digit of p? 2 Let a(f) = -41f3 + f2. What is the tens digit of a(-1)? 4 What is the units digit of 1(-3 - (-4 - 0))? 1 Suppose -o - 33 = 2o. What is the units digit of (-2)/o + (-256)/(-44)? 6 Let o(n) = 0n - 5n2 + 3n + 10n2. Let w be o(-5). Suppose 5k = 2d - 74 + 18, w = 5d - 5k. What is the units digit of d? 8 Suppose -510 = -4d + 110. What is the units digit of d? 5 What is the tens digit of 4 + 1113/18 + 2/12? 6 Suppose -4k + 73 = 2p - k, -157 = -5p + k. What is the units digit of p? 2 Let q = -122 + 282. What is the units digit of q? 0 Let j(m) = -m. Let w = -2 + -8. What is the tens digit of j(w)? 1 Suppose -5p = 5, -g - 4p - 36 = -3g. Suppose -7l + 3l + g = 0. Suppose -o = s - 3 - 7, 5o = ls - 22. What is the units digit of s? 8 Let f(u) = u*3 - 5u*2 + u - 5. Let w be f(5). Let c(m) = m + 3. Let j be c(w). Suppose -q + 1 = -4x + 38, 3x + jq = 9. What is the units digit of x? 8 Let q(z) = z*3 - 4z*2 - 2z - 1. Suppose 0 = 2b - 2 - 8. Let u be q(b). Suppose -5l + u = 4. What is the units digit of l? 2 Let a be (-41)/(-2) + (-3)/(-6). Let p = a - 3. What is the units digit of 2 + p/3 + -1? 7 Let v(f) = -f*3 - 7f*2 - 4f + 12. Let d be v(-6). Let g(t) = t*2 + 4t + 2. Let n be g(-4). Suppose nb = -db + 34. What is the tens digit of b? 1 Let i(d) = -3d + 2. Let w = 1 + -6. What is the tens digit of i(w)? 1 Let o be 0 + (-3 - -10) + -3. Suppose 0 = 4x - 0x - o. Let w = 2 + x. What is the units digit of w? 3 Let k(n) = 6n*3 - 6n*2 - 10n + 8. What is the tens digit of k(4)? 5 Suppose -8a - 50 = -3a. Let y = 18 + a. What is the units digit of y? 8 Let s = 15 - 9. Let u = 8 - s. Suppose 2 = -3p - ud - 5, -3p + 23 = -4d. What is the units digit of p? 1 Let i(t) = 6t2 - 5. Let z(n) = -5n*2 + n + 6. Let f(r) = -4i(r) - 5z(r). What is the tens digit of f(9)? 2 What is the tens digit of 760/16 - (-2)/4? 4 Let m(p) be the first derivative of -p4/4 + 4p + 3. What is the units digit of m(0)? 4 Let g(m) = 4m + 3. Let n be g(-2). Let u(r) = -2r - 7. Let v be u(n). Suppose 0f - vf = -	{ "pile_set_name": "DM Mathematics" }
e -u = -4v + 268, -3v - 7u + 4u + 216 = 0. Suppose x = 77 - v. Solve -17 = t + 5l, 5l + a + x = 2t for t. 3 Suppose 649 - 273 = 188f. Solve -2m = 5q - 7m - 10, -5m + 11 = fq for q. 3 Let n = -363 - 622. Let v = -982 - n. Solve 7b + 6 = 4b - k, -24 = 5b - vk for b. -3 Let y = 101 - 181. Let b be ((-16)/(-5))/((-16)/y). Solve 8 = -2w - 4z, w + w - 4z = b for w. 2 Let k(p) = 2p2 + 145p + 616. Let l be k(-68). Solve 3c + 7 = 10f - 11f, lf + c = -17 for f. -4 Let r = -2902 - -2923. Solve -4 = 4o + y - r, 4y = 2o - 4 for o. 4 Let q = 62 - 59. Let u = q - -17. Let r = -16 + u. Solve 3s = 5z - 12 - 16, -s + 19 = rz for z. 5 Let p(j) = -4j2 - 15j + 6. Let l be p(-4). Solve -21x + 26x = t - 19, -lx = -t + 10 for x. -3 Let c be 2-1(-18)/4. Suppose v + 4l + 16 = 25, v - 5l = -c. Solve -n = -g - 8 - v, -4n = -2g - 26 for g. -5 Suppose 30 = 2m + 21a - 16a, 4m + a - 24 = 0. Solve x + w - 24 = -28, x - m = 2w for x. -1 Suppose -2x = -j - 4x - 4, -2j - 2x - 4 = 0. Let a = -8 - -10. Solve 2f + ag = 16, -f + 0f - 2g + 11 = j for f. 5 Let g(m) = 19m2 + 16m - 87m2 + 27m*2 + 18m*2 + 25m*2. Let z be g(-8). Solve 5x = -zw + 2w - 23, 0 = -4x - 20 for w. -1 Let h = 96 + -79. Suppose -2p + h - 1 = 0. Let m be p/48(0 + 6 - 0). Solve -5n - 4 = a, 2a - 2n + 3n - m = 0 for a. 1 Let f be 0/174/56. Suppose f = 5p - 5m - 28 - 7, -5m - 15 = -p. Solve ps + 32 = -4t, -2s - t = -s + 7 for s. -4 Let h = 120 + 1. Let j = 62 - h. Let p = -27 - j. Solve -c + 2v - 7 = -1, 3c + 4v - p = 0 for c. 4 Suppose 0p - u = -4p + 81, 76 = 4p + 4u. Suppose 0 = 6i - 9i. Suppose i + p = 2d. Solve 2o + c - 3 - 1 = 0, 2c = 2o - d for o. 3 Suppose 0 = 539z - 88936 + 28029. Solve 0 = 5s + 5u - 63 + z, -3u = -s + 10 for s. -5 Suppose 47l - 65004 + 64910 = 0. Solve -3x - 5r + 19 = 0, -lr = -5x - r + 13 for x. 3 Let z = 683 - 657. Suppose -z = -20n - 6. Solve m = -2u - n, -4m + 9m + 33 = 4u for u. 2 Suppose -3r = -249 + 234. Solve n - 2 = -3z, rz + 4 + 6 = 5n for n. 2 Let c be (-6 - 114/(-9))/(-2)12/(-8). Solve -4o - q = 3, -2q - 11 + c = -4o for o. 0 Let x(w) = w*3 - 7w*2 + 4w + 13. Let r be x(6). Let m be r((-20)/70 + (-46)/(-14)). Solve l - 12 = -5y, 5y = -0l - ml + 6 for y. 3 Let b(x) = -6x3 - x2 - x. Let r be b(-1). Suppose -m = rm - 14. Suppose v - 2j = -7, 4v + 3j + m = 29. Solve vw = 3f + 3, 4w - f - 36 = -5f for w. 5 Suppose 2g + 3k - 36 = 0, -1 = -g + 5k + 4. Solve -3f = -4z - 6, gz - 5 = -2f + 18z for f. -2 Suppose 3j - 3u = 75, -160 = j + u - 171. Solve -3c = -2z + 18, 64c - 67c = 4z + j for c. -6 Let u(w) = 4w + 8. Let y be u(-1). Suppose p + p = 5l - 19, l - 3p = -y. Solve -lr = -5f + 25, r - 3 = -5f + 4 for r. -3 Suppose -6n = -37n - 930. Let v be (-24)/n - 4/102. Solve -2i + 6l - 2l + 6 = 0, v = -2i - 4l - 2 for i. 1 Suppose -46k = -43k + 1911. Let t be (-9828)/k + 6/(-14). Solve -4g + 4u = -2g - 20, -t = -2g + 3u for g. 0 Let b = 3920 - 3917. Solve -9 - 9 = -3i + bt, 4i + 4t = -16 for i. 1 Suppose 0 = 126b + 28b - 501 - 731. Solve 2 = -y + 2x, -bx + 9x + 2 = 2y for y. 2 Let q(g) = -4g + 44. Let d be q(10). Suppose h - d = 5. Suppose -2o + 5s + 26 = 0, 0s = 2o - 2s - 14. Solve h = -r + oc, -4r - 8 = -2r - c for r. -3 Let m be (-9)/(4 + -7)(-4)/(-6). Suppose 0z - 4 = -z + g, 0 = -5z - mg + 20. Let s be 6/z(-10)/(-3). Solve 3o + 12 = -sw, 4w + 2o + 5 = -3 for w. 0 Let s be 17 - 6 - 63/7. Solve 0 = 2j - 2d + 6, -128 = 3j - sd - 121 for j. -1 Let o = -957 + 962. Solve k - o = -5s, 5s + 9 + 6 = -5k for s. 2 Suppose -13 = -3b - 19. Let t(g) = -6g - 8. Let s be t(b). Let q(f) = -10f + 2. Let a be q(-2). Solve 0 = 3p - 9o + 4o + 31, 0 = -p + so - a for p. -2 Suppose 0d + 4a + 18 = 2d, -9 = d + 4a. Suppose 9p - 63 = -0p. Let g be 13/4 - p/28. Solve -k = -3i + 17, gk + i = 2k + d for k. -2 Let k = -4128 + 4131. Solve -7d + 11d + 20 = 4x, 0 = kx for d. -5 Let y = 925 + -922. Solve g - 3v = 12, 4v = yg - v - 20 for g. 0 Suppose 0 = -2k - 5r + 21, 50r = 4k + 53r - 49. Solve -kv + 24 = -5d - 12v, 0 = -2d - 2v for d. -4 Suppose 0 = 2r, 2r + 312 = -3p + 4r. Let q = p - -108. Solve -i = -2t, 4i - 4t = q - 0 for i. 2 Suppose -268 = 2l - 258, -87 = -3h + 3l. Solve t + hs - 18 = 22s, -17 = t - 5s for t. 8 Let f be 9/428 + (-2)/(-7). Solve z = -4p - 8, -4z = -p - z - f for p. -2 Let t = 161 + -159. Suppose -tz + 6z - 8 = 2p, 3p = 0. Solve -5c + 5v = 2v + 5, zc + 2v + 18 = 0 for c. -4 Let f = -19 + 29. Suppose -fh = -22h. Solve -8 = -2z + 5p, -3z + 4z - 4p - 7 = h for z. -1 Let v(q) = -22 + 3q + 6q - 12q + 5q. Suppose -50 + 14 = -3w. Let m be v(w). Solve p - ma + 1 = 4, 5a = 5p - 5 for p. -1 Suppose 143z = 6z + 411. Solve 4u + 7 = -3m + 32, -zu = m - 15 for m. 3 Let z(v) = -8v - 38. Let x be z(-10). Let l = 42 - x. Let d(b) = -b*2 + 20b + 25. Let c be d(21). Solve l = 5o + 2k - 20, -4o = -ck - 4 + 16 for o. 2 Let x = -630 - -639. Suppose -2r + 18i - 15 = 13i, 3i = 4r + x. Solve 0a + 5a = 3o - 18, -4a + 2o - 14 = r for a. -3 Suppose -1138r + 3m = -1140r + 16, -3m + 11 = r. Solve -39v + 35 = i - 44v, -35 = rv for i. 0 Suppose -141 - 3 = 53z - 101z. Suppose -t + 3t = 10. Solve l - td = 11, 0 - z = d for l. -4 Let n(v) = -v2 + 10v - 20. Let y = 37 - 37. Suppose yw - 5f + 55 = 5w, 2f - 10 = 0. Let a be n(w). Solve i + 22 = -i + al, i - 4l + 19 = 0 for i. -3 Let v be 1/16108/(-81) + (-61)/(-12). Solve 0 = -3p + 43 - 55, 2p - 2 = -vz for z. 2 Let d = -28 + 48. Let u(r) = -14r + 7. Let i be u(-2). Suppose -27 = 2s - i. Solve -sl = -2k + d, 3k = k + 4 for l. -4 Let o = 70 - 65. Suppose 0 = ot + 7t - 264. Suppose tz = 6z + 80. Solve -5j + 6r = 3r - 19, zr = -j + 15 for j. 5 Suppose 0 = 3o + 120 + 276. Let h = o + 157. Solve 3x + r - h = -4r, 0 = -5r + 25 for x. 0 Suppose -231 = -31d + 10d. Suppose dq + 7 = 29. Solve -b = -2m - 2, -m - 4 = -qb - 4m for b. 2 Let v(o) = o2 - 43o. Let y be v(0). Solve y = 4j + 3r - 16, 3r + 9 = 5j - 11 for j. 4 Suppose -38 = -2d - 5k, 0d = 5d + 4k - 95. Suppose -3v = -6v - 45. Let l = d + v. Solve 3q - w - l = 9, 3w = -3q - 3 for q. 3 Suppose 3a - 2 = 2o, 85a - o = 81a + 11. Solve 11b + 11 = -ar + 8b, 0 = 2r + 2b + 8 for r. 1 Let k be (-2)/(-5) + 8/44 + (-1638)/(-1155). Solve -4z = km, 24 = -5z - m + 27 for z. 1 Let a be ((-63)/42)/(12/(-40)). Solve 4f = f + 6, -ap + 17 = f for p. 3 Let n = -292 + 314. Let r = 21 - 38. Let f = n + r. Solve 3 = h, 2a - 31 = -2a - fh for a. 4 Let i(u) = -25u*2 - 387u + 217. Let p be i(-16). Solve -5y + p = -2w, 2w - 3w = 2y for y. 1 Suppose 0 = -4u + 1 + 7. Let r = 11 - 7. Suppose 2f - 248 = -234, 2t + 2f = 26. Solve 8 = -rc - un, -5n + 0 - t = 3c for c. -2 Let i be (-4)/(-22) - 318/11(-14)/(71 + 13). Let g(x) = x*2 + 3x + 1. Let h be g(-5). Solve -c + 4 = 2p, ic + 2 - h = p for p. 1 Suppose -r = -3g - 11, -10 = -2r + 3r + 4g. Solve 0 = -7h + 6h - 5v - 22, 2v - r = 5h for h. -2 Let w be 150/(-5)(1 + (-32)/20). Let z be (-15)/9w/(-5). Let y be z/(-8)544/(-51). Solve -y = 3n + 2o, 2n = 5o + 4 - 3 for n. -2 Suppose 0 = 85m - 247m + 2592. Solve -2v + 7 = 3y, 148v - 144v + 4y = m for v. 5 Suppose -32 = -7a + 31. Suppose -408 = -ay - 381. Solve -5r + s + 1 = -4, 0 = -ys - 15 for r. 0 Let h(t) = -14t + 10. Let c be h(2). Let b(f) = -5f - 90. Let y be b(c). Solve 2s + u - 6 = 0, -2s + 3u + u - 14 = y for s. 1 Suppose -n - 4n + 10 = 0. Let g(o) = 5o*n - 5o - 4o2 + 2 + 16o + 2. Let t be g(-11). Solve 0 = 5z + tk - 0k + 35, -2k - 16 = 2z for z. -3 Suppose -3r - 12 = -7r. Suppose 0 = rg, 0g = -f + 5g + 4. Let x be ((2/4)/(18/(-144)))/(-9 - -7). Solve fi + 20 = 2v, i = xv - i - 10 for v. 0 Suppose 7 = -b + 5d, -2 = 506b - 504b - 4d. Solve 0 = f - 3u + 2 + b, 2f - 5u = -7 for f. 4 Let c be 2/5 + (-16)/(-10). Let o(d) = -dc - d2 - 11d + 4 - 6d + 24d. Let m be o(4). Solve mt + n = -3t - 17, 0 = 4t + 2n + 24 for t. -5 Suppose -361 = -9t - 10t. Suppose -t + 70 = 17k. Solve -kx - 2u + 6*u = -	{ "pile_set_name": "DM Mathematics" }
2q = w + 5q - 572. Is 52 a factor of w? True Let d = 327 + 2267. Does 65 divide d? False Suppose -71750 = -80x + 121450. Does 40 divide x? False Let z be 1408 + (-1 - 0) + -3. Suppose -h + z = 5h. Is 18 a factor of h? True Suppose 0 = 5k + 3d - 5567 - 3217, -d + 3513 = 2k. Is 19 a factor of k? False Suppose -5f = 5x - 4540, -7x + 2x + 4575 = -2f. Is x a multiple of 11? True Suppose 57 = -4p + 21. Let a(d) be the third derivative of -d6/120 - 2d*5/15 + 7d4/24 - d3 - 25d2. Is 3 a factor of a(p)? True Let s = 196 - 118. Suppose -5d - 3 = l - 0l, 5l + 4d + s = 0. Is 10 a factor of (3 - (l + 0)) + -1? True Let r(v) = -21v - 21. Let f be r(5). Let l = f - -518. Suppose -z - z = 3i - l, 2i + 5z - 276 = 0. Is i a multiple of 32? True Suppose 0b = -b + 66. Let p = 6 - b. Is 16 a factor of p((-26)/6 - -4)? False Suppose -4i + 14 = j, 0 = -0i + 4i + 5j - 22. Suppose id + 15 = -0. Is 11 a factor of (-154)/(-6)(d + 8)? True Let n = -62 + 64. Suppose -82 = -nj + j. Is j a multiple of 10? False Suppose 4u = 3w - 180, -3w + 0w = 5u - 180. Suppose s - 6s + w = 0. Suppose x = -2n + 36, -5x = n - 3x - s. Is 5 a factor of n? True Suppose 0 = -t - 2q - 0q - 7, 0 = -4t - 2q - 10. Let o = t - 1. Is 585/85 - o/17 a multiple of 3? False Let v(t) = 36t*2 - 3t - 3. Let q be v(-2). Let d = -106 + 191. Let c = q - d. Does 13 divide c? False Suppose 0 = -3z + z + 10. Suppose -a + 370 = zt + 4a, -a - 271 = -4t. Is 22 a factor of t? False Suppose 9i + 8960 = 23i. Is i a multiple of 20? True Let u(z) = -z3 + z2 - z. Let c(o) = -7o2 - 2o. Let b(t) = -c(t) - u(t). Suppose 0 = 3s - 0s + 3, p - 2s = -3. Does 5 divide b(p)? True Let w(g) = g3 + 10g*2 - 7g - 7. Let c be w(-5). Suppose -5d - t - 48 + c = 0, 0 = 3d + t - 61. Let u = -11 + d. Is u even? False Let s be 379/4 - (-3)/(-4). Let o = 165 - s. Is o a multiple of 27? False Let g(y) = -3y + 12. Let h be g(-5). Let v = 38 - h. Let a(p) = p + 9. Does 7 divide a(v)? False Is 6 a factor of (147/(-35) - -5)/(2/520)? False Suppose -2n + 14 - 2 = 2b, -n - 4b = -9. Let k = 15 - 12. Suppose -na + 37 = p, 4p - 3a = 3p - k. Is 6 a factor of p? True Let r(u) = -2u - 22. Let w be r(-12). Suppose 0 = -4q - 3a + 4a + 10, 2a - w = -3q. Suppose 2y - 8 = 5i + 7, qy - 35 = i. Is 5 a factor of y? True Let f(r) = -12r*2 - 15r + 18. Let o(h) = -6h2 - 7h + 9. Let v(d) = -6f(d) + 11o(d). Does 6 divide v(-5)? False Suppose 6m - 3n = m + 30, 0 = m + n - 6. Let j(i) = 12i - 24. Does 8 divide j(m)? True Let s(d) = d2 + 7d - 6. Let c be s(-8). Is 16 a factor of (-144)/48 - ((-72)/c - -1)? True Let r be -3(-35)/3 + 4. Let z = -5 + r. Suppose -8l - z = -9l. Is l a multiple of 34? True Suppose 4u = -3u + 63. Suppose 0v + uv - 117 = 0. Is 4 a factor of v? False Suppose -8i = -10i + 8. Is 54-1(-4 - i/(-6)) a multiple of 30? True Let o(k) = 2k*2 + 11k - 26. Is o(4) a multiple of 5? True Let u(q) = -3 - 4 - 5q + 4. Let t be u(-2). Suppose 0 = tw - 5w - 68. Is 34 a factor of w? True Does 18 divide (-106140)/(-48) - (2/8 - 0)? False Let u(m) = 5m + 22. Let w be u(-4). Suppose -wb + 8 = 0, 5s - 169 = -2b + b. Is 11 a factor of s? True Let a = -10 + 17. Let d = 134 + -93. Let y = d - a. Is 8 a factor of y? False Is (-1226 + 0)/(-1) + (-55 - -56) a multiple of 109? False Let k be (3 + -2 + 0/3)58. Suppose -kx - 715 = -63x. Does 27 divide x? False Suppose -13 = 2w + 5. Let m(n) = -n3 - 8n*2 + 9n - 9. Let k be m(w). Let f(h) = -h*3 - 7h*2 + 12h - 1. Is 8 a factor of f(k)? False Let v(r) be the second derivative of -r5/20 + r4/12 + r*2/2 + 3r. Let o be v(1). Let u = o + 114. Is 22 a factor of u? False Suppose 3i + 0n + n + 539 = 0, 2n = -3i - 541. Let t = 93 - i. Does 12 divide (3/(-2))/((-8)/t)? False Let o(w) = -7w2 + 116w - 79. Does 21 divide o(10)? False Let h(t) be the third derivative of -t*6/120 + 2t5/15 - t4/24 + 19t3/6 + 2t*2. Is 8 a factor of h(8)? False Let x be (-1840)/(-64) - (-10)/8. Is 4218/x - (-3)/(-5) a multiple of 25? False Suppose -63n + 184624 + 21197 = 0. Is 99 a factor of n? True Suppose -i - 30 = -6i. Let r(j) be the third derivative of j4/24 + 4j*3/3 + 120j*2 - j. Is r(i) a multiple of 14? True Let b(o) = -6o + 9. Let f be b(-18). Let d = 11 + f. Is 16 a factor of d? True Let h = 2413 + 128. Is h a multiple of 33? True Let g(h) be the third derivative of h*6/120 + 2h*5/15 + 3h*4/8 + 4h*3/3 + 3h*2. Let w be g(-8). Let x = -44 - w. Is 5 a factor of x? True Let a = -4 - -4. Suppose -3u = -au - 12. Suppose -u = j - 25. Is 10 a factor of j? False Let d be (129/2)/(18/12). Suppose -m + f = 6f - d, m - 34 = 4f. Is 20 a factor of m? False Suppose 0 = -18i + 5i + 1781. Is i a multiple of 10? False Suppose a + 4 = 3h, -15 + 3 = -h + 3a. Suppose ho - 4o + 36 = 0. Is o a multiple of 3? True Suppose 3i + 15 = 6i. Suppose 18 = io - 2y, 3y + 0 + 4 = -4o. Suppose -u - 5w - o = -22, -2w = 3u - 112. Does 20 divide u? True Suppose -2064 = 5b - 17b. Does 4 divide b? True Suppose -2p + 28 = -4h, 0p + p + 2h = -2. Let q(d) = 50d - 25. Let t be q(p). Suppose -37 = -4m + t. Is 13 a factor of m? True Suppose 0w = 2w. Let v(o) = o*3 - 4o*2 - 20o - 2. Let i be v(7). Suppose ib - b - 176 = w. Does 11 divide b? True Let o = -51 + 640. Let j = -347 + o. Suppose -3n = 5s - j, 5n + 4s - 320 = n. Does 14 divide n? False Suppose 0 = v - 3b - 15, 2v + 2b = -11 + 1. Suppose 3j - 316 = -2f, v = 5f + j - 465 - 325. Does 16 divide f? False Suppose -2s - 3y + 528 = 0, -5y - 65 = -s + 186. Is 6 a factor of s? False Suppose -4v - 2421 = -8v + 3u, 0 = -5u + 25. Is 21 a factor of v? True Suppose -2x = 10 - 62. Let r = x + 4. Is 6 a factor of r? True Suppose -5s - 3s = 0. Suppose -3y + 189 = -2i - i, s = -2y + 4i + 124. Does 16 divide y? True Let b(x) = 14x - 1. Let c = 4 - -3. Let u = -6 + c. Is b(u) even? False Suppose 21m = 6m + 150. Suppose -1 = 3p - m. Does 3 divide p? True Let x be (63/5)/(21/70). Suppose 3y = 4y - x. Does 14 divide y? True Let j = 340 - -110. Is 15 a factor of j? True Let w(o) = 2o - 24. Let h be w(12). Suppose hu - 12 = -6u. Is (-532)/(-8) - 1/u a multiple of 33? True Suppose 6r - 584 = 406. Is 5 a factor of r? True Is ((-27922)/(-7) - -1) + 69/483 a multiple of 57? True Let b(k) = -k2 + 14k + 21. Let v be b(15). Suppose -i + vi - 485 = 0. Does 13 divide i? False Let t(j) = 147j3 - j2 + j + 1. Does 46 divide t(1)? False Let a(l) = 140l - 233. Is a(13) a multiple of 69? True Suppose i + 0i = -2p - 7, -4p + 4i + 16 = 0. Let l be (6/(-8))/(p/4). Is 11 a factor of l/(-7) - 80/(-7)? True Suppose -3d + 11j - 10j + 2304 = 0, -3d = -5j - 2292. Is d a multiple of 21? False Let n = 87 + 134. Let a = -152 + n. Does 19 divide a? False Let c be 2/28/((-24)/(-603)). Let s = -156 + c. Does 5 divide s? True Let d be (-6)/9 + (-34)/(-6). Let h be -3 + 6 - 5 - d. Let b(m) = -2m + 17. Is 13 a factor of b(h)? False Suppose 583 + 217 = 10c. Is c a multiple of 8? True Is 105/126 + (-12302)/(-12) a multiple of 54? True Let s = 3 + 26. Suppose -2 - s = -l. Is 7 a factor of l? False Let k(w) = 4w*3 - 9w*2 - 5w - 7. Let u be k(7). Suppose 0 = 5g - u - 456. Does 45 divide g? False Let h(n) = -n2 - 19n + 10. Let t = -3 - 8. Let i be h(t). Suppose 13 = -5w + i. Is w a multiple of 13? False Let z = 1918 + -1912. Let t = 1012 - 382. Suppose -zu + t = -0u. Does 24 divide u? False Let v = 193 + -299. Let s = -37 - v. Does 23 divide s? True Let j = 4082 + -2424. Does 10 divide j? False Let s = -6 - -11. Suppose sk = g - 15 + 40, 2k - g = 13. Suppose ku = 96 - 20. Is 13 a factor of u? False Suppose -4x = -1322 - 1626. Does 41 divide x? False Let h be 29 + 2 - (1 - 0). Let r(v) = 2v + 16. Let f be r(-6). Suppose h = fz - 330. Does 30 divide z? True Let v(f) = f2 - 13f + 4. Let u be v(6). Let i = u + 21. Does 17 divide 3/2i-2? True Let s = 86 + -60. Suppose 4c - s - 274 = 0. Is 10 a factor of c? False Suppose -5f + 228 = 118. Is 2 a factor of f? True Let y(m) = m + 6. Let f be y(-4). Suppose 3n - o = fo + 228, 3*o + 15 = 0. Let u = n - 43. Is 9 a factor of u? False Let g = 643 + -185. Is g a mu	{ "pile_set_name": "DM Mathematics" }
n + 16 = 4u + 5, x = 4n + u + 16 for n. -5 Suppose 19 = s - g + 22, -3g + 15 = 0. Solve -f = -sb - 0f - 6, 8 = 2f for b. -1 Let l(u) = u*3 + 5u*2 - 11u - 25. Let j be l(-6). Solve 0 = 5h - jk - 30, -5h + k = 2k - 24 for h. 5 Let d be (-29)/(-3) - (-16)/(-24). Let y = 12 - d. Solve 0 = -5b + 25, 21 = -0z + 2z + yb for z. 3 Suppose -10f + 563 - 113 = 0. Solve 4r = -4a, 0 = -5r - 5a + 9a + f for r. 5 Let z(m) = 15 + 6 + 7 + 2m + 5. Let x be z(-14). Solve 4g - 15 = -3i + 4i, -3g + xi = 10 for g. 5 Suppose -53z + 48z + 20 = 0, 0 = 2y + 3z - 12. Solve o + v + 14 = -3v, -5o - 2v + 2 = y for o. 2 Suppose -4o + 3a = -39, 51a = 4o + 56a + 1. Solve -z - oh - 1 = -h, -2 = 2z + 5h for z. -1 Suppose 0 = -y - 5i - 6, -2i + 3 - 45 = -4y. Solve -s + 4s - 12 = -4p, 3p - y = 5s for p. 3 Let d be (-6)/(6(-1)/20). Suppose 3f = f + 4. Suppose -2g - 2 = 4c, 5c = -3g + c + 3. Solve -5i + d = -gx, fi + 2i - 17 = 3x for i. 5 Let k = 32 - 32. Suppose -2s - 3x - 8 + k = 0, -5s + 18 = -2x. Solve -sr - 2 = -3y + y, -13 = -3r - y for r. 3 Let w be (81/6)/(-27)-10. Solve -3d = 5u + 1, -2d + 0d + wu = 9 for d. -2 Let j be (-2)/(0 + 1 - 2). Suppose -3l + x = 192 - 215, 3l - 3x - 27 = 0. Solve 4n = -jt + 22, -n + 3n = 5t - l for n. 4 Let f(u) = 4u*2 + 8u - 24. Let y be f(2). Solve -2v - 7 = yn - 5n, -2v - 13 = -3n for v. -5 Let l = -8 + 12. Suppose lf - 122 = 118. Let z = -42 + f. Solve k + 1 = -5r - 1, -z = 3r - 5k for r. -1 Let y be 0/(-5 - -4)(-4)/(-8). Solve 4h + 5p - 32 = y, 5h + 2 = 3h + 2p for h. 3 Let f be (-138)/(-253)44/6. Solve 4k = -fv - 4, 4k = -17v + 18v + 21 for k. 4 Suppose -28 = 9m - 16m. Solve c - 7 = ma, -5c + 3c + 5 = -5a for a. -3 Let g(d) = -3d*2 - 5d - 32. Let n be g(-6). Let b be n/(-70) + (-9)/(-21). Solve -3p - 3c - 31 = bp, 5c = p - 5 for p. -5 Let u(z) = z*2 + z + 1. Let a be u(-2). Suppose x - 4x + 6 = -g, 0 = -g - ax + 6. Solve -h + d = g, -d + 12 = 4h - 2d for h. 4 Let m(z) = -z2 - 30z + 26. Let s be m(0). Solve n - 3n - 3q + 18 = 0, 2n = -5q + s for n. 3 Let a(h) = h - 4. Let z be a(5). Suppose -g + z = -10. Let f = g + -9. Solve 2x = -3k + 3x - 14, -3k + fx = 13 for k. -5 Suppose -81 = -3n - 3. Suppose -l = l - n. Let i = l + -9. Solve 3s = q + i, -2s - s + 20 = -5q for q. -4 Let g(d) = -d2 + 3d + 2. Let t be g(4). Let u be -4 + 9/(3 + t). Let h be -3 + 24 - (1 + 0). Solve -4y - h = 0, um - 2y - 16 = 4 for m. 2 Suppose 1292j + 16 = 1296j. Solve 8 = -4o + 3t - 2t, 4o + jt + 28 = 0 for o. -3 Let c = 2 + -1. Let l(y) = 2y2 + 1. Let g be l(c). Suppose -w = -gs + 16, -1 + 5 = -4w. Solve 3n + s = z, -n - 5z = 15 + 8 for n. -3 Suppose 19h - 52h = -66. Suppose 5d - 58 = -4r - 7, 4d - 37 = -3r. Solve ht + 0t = -3c + r, -27 = -3t - 4c for t. 5 Suppose 0 = 5v - 4v + 7. Let g = v + 9. Suppose 0 = 4n - 12, 0o - 4o = 2n - 46. Solve -5j - 4s = s + 20, -o = gs for j. 1 Let n(u) be the second derivative of -u4/12 - 5u*3/3 - 13u*2/2 + 5u. Let k be n(-10). Let j = 17 + k. Solve -y = 4h - 13, y + 0y = jh - 19 for h. 4 Suppose 20 = -24b + 14b. Let n be (-40)/(-30)(-3)/b. Solve 4s = -20, -s + 12 = -nv - 5s for v. 4 Let w = -53 + 41. Let c = w - -13. Solve -2b = 5h + 4, -4b + c = 4h - 3 for b. 3 Suppose 0a = -4a. Suppose 2z = 6, 0y - 2y + 3z = 9. Suppose y = 5i - 33 - 7. Solve 3w - t + i = a, -w - 10 = 4w - t for w. -1 Suppose -66v + 36 = -48v. Solve -3n = -5l + 27, l + v + 3 = -2n for l. 3 Let v = -23613 + 23615. Suppose -t - t = 2q - 2, -3q - 5t + 5 = 0. Suppose -2z + 17 + 23 = q. Solve 0g = -s + 4g - z, -5s + vg - 10 = 0 for s. 0 Suppose -3z + 30 = -5h, 4z - 2h - 26 - 28 = 0. Suppose 20k - zk = 25. Solve -l = -3x + 2, -3 - k = 3x + l for x. -1 Let a(q) = 0 + 17 - 94q + 179q - 88q. Let l be a(4). Solve 0s + 20 = ln - 3s, n + 4 = -s for n. 1 Let c(f) = -f - 24. Let g be c(-14). Let t be 2(g/4)/(-5). Solve -5m = -0m + 5l + 15, t = m + 5l for m. -4 Suppose 2q + 99 = 5q. Let u be 225/q - (-8)/44. Suppose h + 12 = uh. Solve -l = 2v + hv + 17, 0 = 3v - l + 11 for v. -4 Let g = 25 - 22. Suppose -gp - p = -216. Let r be 2/(-12) - (-9)/p. Solve c - w + 0w + 8 = r, -4c = 3w - 3 for c. -3 Let k(d) = 4d - 102. Let r be k(27). Solve 0h + 2h - 2o - r = 0, -o = 2h for h. 1 Suppose b + 4 = -2h, 1 + 22 = 4b - 5h. Solve 4a - by = -22, -a - y = -0y + 1 for a. -4 Let j be (-6 + 3)/((52/(-24))/13). Solve 5 + j = -3f + 5v, 0 = -4f + 3v - 16 for f. -1 Suppose -p + 3p = 0. Suppose -2m = 7 - 19. Suppose -ms = -s + 4x, -2s - 5x = 17. Solve 3k - su + u + 24 = p, 12 = 4u for k. -5 Let a(h) = h*2 - 5h - 189. Let m be a(17). Solve 0 = 5v - 5z - 9 + 24, 4v - z + m = 0 for v. -4 Let p be (-4)/8 + (-30)/(-4). Suppose pm + 224 = -m. Let y = m + 40. Solve 0 = 3j - 4v + 26 - 3, -2j = -2v + y for j. -1 Let y(m) = 5 - 3 - 4 - 6m + 9m. Let r = -5 - -7. Let s be y(r). Solve sv = -n - 7, -3v - 4n - 8 = -7v for v. -1 Suppose 2d + 8 = 4o - 8, 3o = -d + 17. Solve -n + 1 = k - on, k - 5n = 1 for k. 1 Suppose 0 = -p - f + 3, -2p - f = p - 7. Suppose -pk = -7k + 35. Suppose -k = -w - 5. Solve -wr - 5j + 10 + 11 = 0, 2r - 6 = -2j for r. -2 Let w = -678 + 690. Solve u - 2 - w = -4o, -2o = -5u - 18 for o. 4 Let k = -752 - -757. Solve -4h = ku + 19, 5h + 5u = -26 + 6 for h. -1 Let o(v) = v3 + 24v*2 + 22v + 18. Suppose 2z = -21 - 25. Let c be o(z). Solve 2j = -3q + 6q + 23, 4j = 5q + c for q. -5 Suppose -5u - 67 = -5n + 58, 2n - 3u = 50. Suppose 0 = nc - 20c - 10. Solve -z - b + 1 = 0, cz - 1 = 4b + 1 for z. 1 Suppose 3w - 12i + 8i - 23 = 0, -w + 4i = -13. Solve -20 = -b - 3k, -wb + 4k = 6 - 11 for b. 5 Let m(l) = 11l - 11. Suppose -15 + 18 = c. Let a be m(c). Let h be (-4)/(-22) + 1568/88. Solve 0 = 3y - 5x + a, 3x = 5y + 4x + h for y. -4 Suppose 0l + 5f = 2l - 4, -4f = 5l - 10. Suppose 3d - 23 = -4m, -2d - ld + m = -18. Solve 10 = -4z - dp, 3z + 21 = 3p - 0 for z. -5 Let v(x) = -2x3 - 15x*2 + 8x + 2. Let l be v(-8). Suppose q = 7 - l. Solve 4c = 5w + 25, -3w = 2c - qw - 12 for c. 5 Let z(f) = -f2 + 1. Let p = -1 - 0. Let a = p - 0. Let n be z(a). Solve n = 4g - 12, 9 = -3k - 0k + 5g for k. 2 Suppose -6p = -3p + 3y, 2p = 3y + 5. Let x be p/(-2 - (-5)/2). Suppose 15 = xs + s. Solve 9 = -sz - 16, -2w + 26 = -4z for w. 3 Let s(m) = 5m + 63. Let y be s(-12). Suppose -4q = yn - 69, -3n + 5 = q - 1. Solve 4r - 5h + 9 = -6h, 0 = 4r - 5h - q for r. -1 Let d be 4 - (-1 - (4 - 4)) - 3. Suppose -10 = -3b + dw, 6w - w = -10. Solve 5i - 4a - 7 = 0, b = -5i + 3a - 2a for i. -1 Suppose 0 = -2l + 5l - 6. Solve 3x = -5c - 6 - l, 0 = -4c - 3x - 4 for c. -4 Suppose -4l + 38 = -3j - 22, -l + 15 = 3j. Solve -2h - 2h + v = 9, 0 = 5v + l for h. -3 Let x be 1 - (0 - (-1)/2)2. Suppose x = -0h - 4h + 56. Solve 5s + j + j - 13 = 0, -3s + h = -5j for s. 3 Let k = 328 - 326. Solve -2h + 3a - ka - 6 = 0, 2h + a = -14 for h. -5 Let g(v) = v2 + 4v - 7. Let t be g(-6). Let r(h) = -h*2 - 9h + 222. Let b be r(-20). Solve -4w = bl - 16, -3l - 6 = w - tw for l. 2 Let a = 4 - 4. Suppose 5m - 4 - 6 = a. Solve -y + 5 = ml + 1, 12 = -2l - 5y for l. 4 Suppose -27s = -22s - 10. Solve 5a - 15 = w, -sa + 12 = -6a - 4w for a. 2 Suppose -2c - 26 = -2p - 2p, 5p + 5c + 5 = 0. Let b be (-15)/21-6 - p/14. Solve f = 6f - 15, 1 = by + 3f for y. -2 Let a be 48/22 + 22/(-121). Suppose -u + 9 = au. Solve uj + n - 12 = -j, -3j = 3n - 9 for j. 3 Let k be 4 - (-1 - 1) - (-66 + 69). Solve 0 = c - kb - 2, 4c - 5 - 13 = 2b for c. 5 Suppose s + s - 10 = -4d, s = 2d - 15. Solve -o - d = b, b + 20 = -3b + 4o for b. -5 Let v be 21344/1392-31/(-2). Solve f - v = 4j, 4f + 4j = 3f - 17 for f. 3 Let d(o) = o*3 - 7o*2 + 7o - 6. Let n be d(6). Suppose 3v = -4p + 18, p + v - 3v + 1 = 0. Solve -h - f = -2f + p, n = 2f for h. -3 Suppose -1 = 4d - 213. Let b = d - 48. Solve -2p - bo = -35, -19 = -2p - o - 4 for p. 5 Let l(x) = 2x3 + x2 + x + 5. Let s be l(0). Solve -3a - 4w = 0, sa = -5w + 6*w for a. 0 Let	{ "pile_set_name": "DM Mathematics" }
closest to n? (a) 12 (b) -0.5 (c) 5/4 b Let l = -480628/31 + 15504. Which is the closest to -0.4? (a) 0.5 (b) l (c) -12 (d) -4 b Let w = -195.9 + 984.5. Let h = w + -789. Let v = 2206/23 + -96. What is the nearest to v in h, 1/3, 4? h Let m = -1.03 + 42.63. Let t = 39 - m. Which is the nearest to -1? (a) 1 (b) t (c) -0.3 c Let z(f) = -f*2 + 70f + 376. Let i be z(75). Which is the closest to -2/3? (a) 4 (b) -4 (c) 0 (d) i c Let r be (-99)/(-1188)(-2 - -4). What is the closest to -0.02 in 0, 19, 3, r? 0 Suppose -i + 3 = -t - 178, i + 3t - 161 = 0. Let w = i + -173. Which is the closest to -1? (a) -3 (b) w (c) -2 c Suppose 5m - 21 = 2m - 0. Let r be 70/(-25) + (-1)/5. Let t = -3.98 - 0.02. Which is the nearest to -1? (a) t (b) r (c) m b Let q(u) = -u*3 - 42u*2 + 90u + 85. Let a be q(-44). What is the closest to 6 in 0.08, a, -2? 0.08 Suppose 5z + i + 17 = 0, 2 = z - 14i + 16i. What is the closest to 0.3 in -11, -1, z, 1.1? 1.1 Let p = -67 + 134. Let t = p - 71. Let q = -10 + 50. Which is the closest to 0.1? (a) -1/8 (b) q (c) t a Let j = 40/2949 + -176437/35388. Let h = 47/9 + j. Let d = 0.1 - 1.1. Which is the closest to d? (a) 9 (b) -2/5 (c) h b Let v = 7 + -5. Let o = -0.1173 + 87.7173. Let z = o + -88.1. What is the closest to -1 in z, 3, v? z Let h be (-107)/(-8) - 8 - 5. Which is the nearest to 0? (a) -0.4 (b) -10 (c) -0.24 (d) h c Suppose -402 = -5g + 5x - 407, -5g - 4 = -4x. Which is the closest to g? (a) -272 (b) 1/5 (c) 4/9 b Let i be (8/132)/(5/108/6). What is the closest to i in -21, 0.4, -2, -0.4? 0.4 Let n = 3 + -2.9. Let s be (22/8)/1 - 3. Let p be ((-128)/48)/(-2) + 5/3. Which is the closest to n? (a) p (b) s (c) -4 b Let j = 184.9 - 90.2. Let k = j + -95. Let n be ((-1)/(-1))/((-2)/6). What is the nearest to 4 in k, -5/2, n? k Let g = -12.95401 + -0.04599. Which is the closest to -37? (a) -0.5 (b) g (c) 4 b Let w = 1197 - 637. Let t = w + -560. Which is the closest to t? (a) -2/11 (b) 3/5 (c) 9 a Let m = 68 + -339/5. Let f = -1.09781 + -0.00219. Which is the closest to 0.03? (a) 3/7 (b) f (c) 0 (d) m c Let l be (-3)/48(4 - 2). Let m = -1074/187 + 25/17. Let r = m + 163/33. Which is the nearest to 2? (a) r (b) l (c) 0.06 a Let o = 331 - 323. What is the nearest to 1 in o, 0.6, 2/9, -0.5? 0.6 Let b = -205 - -202.26. Let d = 0.46 - b. Let o = d - 2.8. What is the closest to -1 in o, -0.1, -3? -0.1 Let y = 43 - 257/6. Let z = 263.93 + -265. Let s = z + 1.37. Which is the nearest to y? (a) s (b) 3/8 (c) 1 a Suppose 682 - 738 = 16p + 12p. What is the closest to -0.1 in -14, p, 0.3, 11? 0.3 Suppose -147w + 144w = -54. Suppose -15 = -wd + 21d. What is the closest to 4 in d, -4, 4? 4 Let i = 92.39 - -4.11. Let w = i + -96. Let n(c) = c2 + 6c. Let t be n(-6). What is the nearest to -0.1 in t, w, -3/11? t Let k = 0 + 3. Let n = 17.743 - 0.243. Let i = -20.5 + n. What is the nearest to i in k, 2, 0.2? 0.2 Let u = 1.6 - 1.4. Suppose 101g - 100 = 81g. Which is the closest to -1/2? (a) u (b) 1 (c) -17 (d) g a Suppose 7 + 4 = -i. Let q(j) = j*3 + 12j*2 + 10j - 13. Let a be q(i). What is the closest to 1 in -0.1, a, 37? -0.1 Let n = 91.7 - 99.5. Which is the closest to -0.7? (a) n (b) -0.5 (c) 3 b Let x = 0.89 - 0.59. Let a = -3 + 7.1. Let l = 3.8 - a. What is the nearest to x in 0, 0.4, l? 0.4 Let k = -412.55 + 418.55. Which is the nearest to k? (a) -1 (b) -2 (c) 4 c Let s = 29040 + -29018. What is the closest to -3/7 in -1, 1/4, s? -1 Let i = 0.1 - 0.3. Let h be 2/(247/(-19) + 21/(-7)). Which is the nearest to i? (a) h (b) -0.09 (c) 3 a Let k be (-24)/(-108) - 312860/495. Let j = k + 632. What is the nearest to 2/5 in 1/5, -5, j, 1/7? 1/5 Let q = 0.28 + 0.92. Let y = q - 1.1. Let k = 294 + -2644/9. Which is the closest to k? (a) 0 (b) y (c) -0.2 b Let r = -53 + 48. Let c = -446.6 - -447. What is the nearest to -0.2 in r, c, 0.2? 0.2 Let p be 4/(-13 + 549/45). Which is the closest to -8? (a) 1 (b) p (c) -2 (d) -0.4 b Let m = 0 - 3. Let v(u) = 377u + 4902. Let o be v(-13). Which is the closest to 1/2? (a) o (b) m (c) 0.3 c Let j = 110 - 109. Let u be ((-228)/370)/(-5 - 295/(-50)). Let n = u - -2/111. What is the nearest to -2 in n, -3, j? -3 Let w = -349.0729 - -0.0729. Let a = w - -349.5. What is the nearest to 23 in -4, a, -3? a Let w = 50/141 - 1/47. What is the nearest to 0 in w, -1/5, 7? -1/5 Suppose 0 = g + 6 - 26. Suppose -gm + 15m + 10 = 0. Let r = -5.08 + 0.08. Which is the closest to -1? (a) m (b) r (c) -2/43 c Suppose 5t + 2 = -2z, -9t + 2z + 4 = -13t. Which is the nearest to 28? (a) 5 (b) -3 (c) t (d) 0.3 a Let y = -87884 + 87894. Let z = -0.3 - -0.4. Which is the nearest to z? (a) 0.4 (b) 5 (c) y (d) -2/11 d Let c be (-315)/702/3. What is the closest to 0.007 in c, 5, 9, 3? 3 Let d = -0.061 - -69.061. Let v = 69.2 - d. What is the nearest to -0.2 in -0.1, v, 2/11? -0.1 Let n = 0.56 - 0.5. Let h = -0.01 - n. Let t = 95/22 - 131/66. Which is the closest to t? (a) h (b) 0.3 (c) -2/13 b Let w = -168260.3 + 168259. Let a = -0.3 - -0.7. What is the nearest to -0.3 in a, w, 0.2? 0.2 Let y = 7231 - 7234. Which is the nearest to 1/4? (a) y (b) -0.04 (c) 4 (d) -13 b Let k(u) = -u2 - 6u - 8. Let s be k(-7). Let f be (-3(-2)/(-30))/(9/s). Let v = -0.07 + -0.03. Which is the nearest to v? (a) f (b) -9 (c) -1/5 c Let s(f) = -f - 12. Let l be s(-8). Let r be (1 - 2) + -5 - (-460)/80. Which is the nearest to 0? (a) l (b) -3 (c) -2/29 (d) r c Let s = 0 - -0.1. Let y = 134967 - 404902/3. Which is the closest to s? (a) 2 (b) 32 (c) -0.1 (d) y c Let r = -16654 + 116575/7. Which is the closest to -2.2? (a) -0.3 (b) -0.11 (c) 2 (d) r d Let a = 0.5 + -0.499. Let s be (-10)/24(-249)/(-830). What is the closest to a in -2/11, s, 0.3? s Let g = 0.34 + -0.04. Let t = -1172506/5 + 234501. What is the closest to 0.1 in 4, g, t, -0.06? -0.06 Let d = 0.69 - 566.69. Let k = d + 582. What is the closest to -4 in -4, 4, k? -4 Suppose -x + l = -2l + 111, 4l - 222 = 2x. Let i = x - -125. Suppose 5j - 2j + 4r + i = 0, -8 = 4r. Which is the closest to j? (a) 1/11 (b) 3 (c) 1 a Suppose 3u + 2 + 16 = -2t, 5t + 5u + 40 = 0. Let v be 9/(4/56 + t/(-14)). Let m be 9/v - 11/2. Which is the closest to -2? (a) 0 (b) m (c) -0.5 c Let a = 34/27 + -700/513. Let q = -0.187 + 1.187. What is the nearest to 0 in 0, a, q? 0 Let m = -1.4 + 0.9. Let f(i) = i2 + i - 7. Let w be f(3). Suppose -5 = -wg + 5h, 3g + 2h + 5 = 3h. Which is the nearest to 1? (a) g (b) -0.4 (c) m b Let y = 4.57 - 7.57. Let z = -0.03 - 0.17. Let i = 0.8 - z. What is the closest to i in 8, 0, y? 0 Let u(w) = 11w2 + 13 - 29w + 72w - 60. Let n(i) = -5i*2 - 21i + 24. Let q(r) = -13n(r) - 6u(r). Let o be q(13). What is the nearest to 1 in -5, o, 0? 0 Let t = 1 - 2. Let s(i) = i*2 + i. Let p(m) = -3m*2 - 20m - 31. Let d(q) = -p(q) - s(q). Let a be d(-7). What is the nearest to t in 2/5, a, -3? 2/5 Let o = -12589 + 13188.3. Let n = o - 599. What is the closest to 7 in 5, n, -3? 5 Suppose -3 = -6t + 4t - n, 2n = -3t + 7. Let s be (t/(-33))/((-76)/(-336)). Let j = -6/19 + s. Which is the nearest to -8? (a) 0.3 (b) -2/17 (c) j c Let p = 2.57 + -2.58. What is the closest to -2 in p, 0.2, 1/4, 0.5? p Let v = 223 - 223.2. Let d = 6.5 - -3.5. Let w = -9.9 + d. Which is the closest to -0.1? (a) w (b) -2.3 (c) v c Suppose 142 = 376r - 234r. Suppose -2 = -3k - 4s, 0 = -2k + 4s - 9 - 3. Let u be 2 + (k - (-8)/(-6)). What is the nearest to 0.06 in 2, r, u? r Let g be -3(-1)/7504/792. Which is the nearest to -1/2? (a) 1 (b) g (c) 89 b Let s = -21145 - -21144.91. Which is the closest to 40? (a) 0 (b) s (c) -1/6 a Let k be (115/(-46)6/(-55))/(6/(-4)). Let x = -6.4 + 3.6. Let j = x + -0.2. What is the nearest to -1/3 in j, k, -2/13? k Let c = 2090 - 2089. What is the closest to 19 in -0.11, c, -1, -3? c Let n = -136 - -197. Let x = -61 + n. Let t be 3/((-6)/(-5)) + -2. Which is the nearest to t? (a) -5 (b) -3 (c) x c Suppose -10l + 42 = -8l. Let q be 28/l(10/8 - -1). Let j = -583/4 + 146. What is the closest to j in q, 5, -5? q Let x = -209252 + 47081804/225. Let k = x - 6/25. Let z = -354/5 - -71. What is the	{ "pile_set_name": "DM Mathematics" }
4 dps. 0.0018 Let d = -482 - -481.571. Let p = d + 0.284. Round p to 1 dp. -0.1 Let f = -246 + 245.481. Let j = f - -0.52315. Round j to 4 decimal places. 0.0042 Let l = -259.79869 + 34.80139. Let n = l - -225. What is n rounded to 4 dps? 0.0027 Let u = -13633 - -13632.994059. What is u rounded to four dps? -0.0059 Suppose 460848 = 21x + 11466 - 98718. What is x rounded to the nearest ten thousand? 30000 Let b = -16207 + 16207.01723. What is b rounded to two decimal places? 0.02 Suppose 17c + 2814504 = -7773051 + 3361365. What is c rounded to the nearest ten thousand? -430000 Let d = -14.47 + 26.07. What is d rounded to 0 decimal places? 12 Let n = 25878902.000662 + -25879420. Let l = 915 + -397. Let c = n + l. What is c rounded to four decimal places? 0.0007 Let h = -91.8 - -55. Let s = h - -3.8. Let g = s - -33.000024. What is g rounded to 5 dps? 0.00002 Let t(g) = -12736g2 - 232g - 1396. Let l be t(-6). What is l rounded to the nearest ten thousand? -460000 Let u = 2161.98 + -1903. Let q = -265 + u. What is q rounded to 1 dp? -6 Suppose -r = 5c + 589495, -3c - 305944 = 2r + 47746. What is c rounded to the nearest 10000? -120000 Let q = -12.7 - 117. Round q to the nearest ten. -130 Let b = 42973.3208 + -43165.32079516. Let y = -192 - b. Round y to 7 dps. -0.0000048 Let h = 1781.1257 + -1781. Let b = h - 0.126347. What is b rounded to 4 decimal places? -0.0006 Let t = -46194202776.01484 + 47991328677.0148267. Let u = -1797126151 + t. Let w = 250 + u. What is w rounded to 6 decimal places? -0.000013 Let t be (-5)/(-25) - (-1617174)/5. Suppose 3288393 = 11k - 2118822. Suppose -k = -5l + t. Round l to the nearest 10000. 160000 Let h = -38078.93 + 37896. Let z = -157 - -339. Let c = h + z. What is c rounded to one dp? -0.9 Let i = -177 - -173.08. Let b = 3.6 + i. Let t = 0.3199987 + b. What is t rounded to six dps? -0.000001 Let l = 183 + -117. Let p = l - 66.652. Round p to 2 dps. -0.65 Let d(q) = 5q*2 + 37q - 3978000. Let n be d(0). Round n to the nearest 1000000. -4000000 Let n = -103.63788331048 + -0.36211753352. Let o = -104 - n. Round o to 7 dps. 0.0000008 Suppose 3 = n + 4r + 5, 2n - 2r = -4. Let b(a) = -28837a - 6. Let d be b(n). Suppose 3j = d + 95332. Round j to the nearest 10000. 50000 Let y = 18096.4 + -16599. Round y to the nearest 1000. 1000 Let g = -7742.2 - -14588.5. Round g to the nearest 1000. 7000 Let i = -0.34 + -0.63. Let b = 22.93 - i. Let a = 23.90109 - b. What is a rounded to four dps? 0.0011 Let i(a) = -82052a + 20. Let d be i(-5). Suppose -2u = -8u + d. Suppose v + 17955 - 120550 = -3z, 2z - u = -4v. Round z to the nearest 1000. 34000 Suppose 22o + 578762 = 3025162. Round o to the nearest ten thousand. 110000 Let t = -10.073 + 336.723. Round t to zero dps. 327 Let d = -3907 + 3906.9983245. Round d to 5 dps. -0.00168 Let l = -38877 + 36333.3. What is l rounded to the nearest ten? -2540 Let q(k) = 1092k3 - 10k*2 + 2k. Let r be q(3). What is r rounded to the nearest 1000? 29000 Let d = 43.1136 + -43.1. Let t = 0.0124 - d. Round t to three decimal places. -0.001 Let a = 3821 + -1920. Let m = a - 3181. What is m rounded to the nearest 1000? -1000 Let y(z) = -501875z2. Let n(v) = -5v - 31. Let i be n(-7). Let s be y(i). What is s rounded to the nearest 100000? -8000000 Let w = 39620.99931696 + -39621. What is w rounded to six dps? -0.000683 Let g = 7.56569673 + -0.31600833. Let k = 7.25 - g. What is k rounded to 5 decimal places? 0.00031 Let a = -33.5 + 24. Let p = 141336.8120011 - 141327.312. Let b = p + a. Round b to six dps. 0.000001 Let y = -5.96 - -1.05. Let u = y + -187.69. Round u to the nearest 10. -190 Let o = 2.571432 - 2.575. Round o to four decimal places. -0.0036 Let c = -0.0044 + 0.0344. Let y = -398.47 - c. What is y rounded to the nearest 10? -400 Let z = -9452 + 9452.004468. Round z to 4 decimal places. 0.0045 Let r = -70144.3 + 73467. Round r to the nearest one hundred. 3300 Suppose 21 - 15 = m. Suppose mn + 12n = -30420. Round n to the nearest 1000. -2000 Let k(o) = -8o2 + 318o + 356. Let b be k(-58). Round b to the nearest one hundred thousand. 0 Suppose 3 = 3d - 27. Suppose dk - 9 - 11 = 0. Suppose 0 = -ky + y - 5850000. What is y rounded to the nearest one million? -6000000 Let z = 6239.0000021195 - 6239. Round z to 7 decimal places. 0.0000021 Suppose -21b + 23b - 14b + 4281600 = 0. What is b rounded to the nearest 100000? 400000 Let s = 2999 + -2998.943. Let y = -6112 + 6111.94307. Let u = y + s. Round u to four decimal places. 0.0001 Let g = -0.27235771 + -0.15064528. Let w = -0.423 - g. What is w rounded to seven decimal places? 0.000003 Let u be (-4)/(-3) + 24/36 + 975599981. What is u rounded to the nearest 1000000? 98000000 Let o = 29 + -30.16. Let x = o - -100.16. Let b = 103.7 - x. What is b rounded to 0 decimal places? 5 Let j = 186798 + 66965. Let d = j - 253756.99998. Let y = 6 - d. Round y to 5 decimal places. -0.00002 Let p = -4432.99966248 - -4433. Round p to 5 decimal places. 0.00034 Let w(c) = -4489c - 25. Let s(j) = -1496j - 8. Let f(p) = -17s(p) + 6w(p). Let a be f(3). Round a to the nearest one thousand. -5000 Suppose 28c = 25c + 173811. Let f = c + -19137. What is f rounded to the nearest ten thousand? 40000 Suppose 2u + 3y + 1277175 + 3312611 = 0, 0 = -u + 4y - 2294882. Let i = 18064890 + u. What is i rounded to the nearest 1000000? 16000000 Let o = 367.0423793176 + -0.0422203176. Let i = 194 + -561. Let r = o + i. Round r to five dps. 0.00016 Let l = 2.02 + -67.62. Let n = l + 66. What is n rounded to 2 dps? 0.4 Suppose -51 - 41 = 4l. Let f = l + -100. Let v = -194 - f. Round v to the nearest 10. -70 Let b = -193 + 61. Let q = 131.99881 + b. What is q rounded to 3 decimal places? -0.001 Let b(n) = 696n*2 + 71n - 92. Let u be b(7). What is u rounded to the nearest 1000? 35000 Let c = 7186339 + -4751539. What is c rounded to the nearest ten thousand? 2430000 Let j = -49.507624 - -49.52. Round j to 4 decimal places. 0.0124 Suppose 20 = -3a + 7a. Let b be -2 - (-18)/a - 4/(-10). Suppose bi - 3087 = h - 12781, 0 = -5h - i + 48503. What is h rounded to the nearest 1000? 10000 Let l = 0.0853 + -0.103. Let k = l + 0.0715. Round k to two dps. 0.05 Let t = -263019 + 263317.201. Let p = t + -298. What is p rounded to two decimal places? 0.2 Let q = 204.69 - 113.67. Round q to the nearest 10. 90 Let h = -58 - 23. Let y = -75.36 - h. What is y rounded to the nearest integer? 6 Let l be -2 - 0 - (41948/(-3) + 16/24). Round l to the nearest 1000. 14000 Let m = 360.732 - 2.932. Let t = m + -356.259. Round t to 1 decimal place. 1.5 Let n = 27978.966 + -27990. What is n rounded to 1 dp? -11 Let w(k) = 29 - 17k - 8k - 7k + 16k - 5k. Let v(l) = 6l*2 - 3l + 1. Let d be v(2). Let n be w(d). What is n rounded to the nearest one hundred? -400 Let o = 8706 + -8705.99978642. Round o to 6 dps. 0.000214 Let r = -994361.7 - -1239691. Let o = r + -245400.29973. Let s = o + 71. Round s to 4 decimal places. 0.0003 Let c = -312 + 145. Let k = c + 167.073. Let g = k + -0.07327. Round g to four decimal places. -0.0003 Let x be 4/26 + (400/104 - 0). Suppose -xq - 173790 + 4461790 = 0. Round q to the nearest 100000. 1100000 Let u = -0.0029568174 + 0.00296. Round u to seven decimal places. 0.0000032 Let p = 28 + -23. Suppose -5955 = -5c - pv, -2c - 3v + 2394 = -4v. Suppose -3m + d + 0d - c = 0, -20 = 4*d. What is m rounded to the nearest 100? -400 Let j = 476.91706 + -500.815. Let w = 135.1 - 159. Let x = j - w. What is x rounded to 4 decimal places? 0.0021 Let m = 281.27 + -281.348974. Round m to three dps. -0.079 Let i = 28.425 + 443.091. Let h = -479.6 + i. Let b = 7.8 + h. Round b to 1 decimal place. -0.3 Let g = 54.69428 - 54.72. What is g rounded to 4 dps? -0.0257 Let r = 287.9 - -32.1. Let l = r - 320.0000928. What is l rounded to 5 decimal places? -0.00009 Let f be (-20)/((-20)/(9 - 4)) - -99243. Round f to the nearest one thousand. 99000 Let w = 17050.4442 - 17049. Round w to two dps. 1.44 Let s = -4719.2681 + 4719. Let b = 0.281 + s. Round b to three dps. 0.013 Let l = 1518.9998101 + -1519. What is l rounded to five dps? -0.00019 Let w = -3.906 + -38.169. Let p = w - -44. Let i = p + -2. What is i rounded to 2 decimal places?	{ "pile_set_name": "DM Mathematics" }
2a + 8 = -f. Let i(o) = -o3 + 4o*2 - 3o + 3. Let j be i(3). Put f, 5, j in ascending order. j, f, 5 Suppose 3 = -3y - 2x + 1, -y - 4x = 4. Sort -4, y, -1 in increasing order. -4, -1, y Let x = 6.973 + 0.027. Let p = 0.3 + -0.8. Sort p, -3, x. -3, p, x Let v = -31 - -157/5. Put 4, v, -1/5 in descending order. 4, v, -1/5 Suppose 0 = 2u - 2w - 0 - 8, 0 = -5u - w + 20. Suppose -4k + u = -p + 3p, 5k = -2p + 7. Suppose y - 4 = z, 0z - 2 = 3y + 4z. Sort 0, k, y. 0, y, k Let u = 10 - -32. Let v = u + -41.67. Let j = v - 0.03. Put j, 0.4, -5 in descending order. 0.4, j, -5 Let n be 4/(-6) - 2/(-6). Let r = -3 - -6. Let k = 0.7 + -1.7. Put r, n, k in decreasing order. r, n, k Let g = 2 - -3. Put 1, -1, g in ascending order. -1, 1, g Let y = -121 + 607/5. Let x = 2.1 - 0.1. Put -3, y, x in descending order. x, y, -3 Suppose 0w - 14 = -3w + 5r, 3r = -3. Let u be 3w/(-3)1. Sort -1, u, 3 in descending order. 3, -1, u Let a be -2 + 0/(-1) - 3. Put -2, -3, a in increasing order. a, -3, -2 Let c(v) = -v3 + 10v*2 - 2. Let g be c(10). Put -4, g, 21 in increasing order. -4, g, 21 Suppose -14 = 2v + 3d, 5v + 5d + 28 = d. Put 5, 2, v, -1 in decreasing order. 5, 2, -1, v Let i(a) = 2a + 1. Let d be i(0). Sort 4, d, -4, 6. -4, d, 4, 6 Suppose -3s - 2a + 16 = 0, -4s + 2a - 4a + 18 = 0. Let b = 1 + s. Put b, 1, -3 in increasing order. -3, 1, b Let d = 0 - -4. Let s = -6 + d. Put 3/2, 2/5, s in ascending order. s, 2/5, 3/2 Suppose -3o + 10 + 2 = 0. Let q = 25 + -20. Sort q, o, -1 in descending order. q, o, -1 Let x = 261057/109 + -2395. Let l = x + 97/654. Sort 1/7, l, 0 in descending order. l, 1/7, 0 Let z = -42 + 203/5. Put -3, z, 0.4 in decreasing order. 0.4, z, -3 Let s be -6(-1)/(-6)21/56. Put s, -0.4, 1/4, 3 in descending order. 3, 1/4, s, -0.4 Suppose p - 5p - 3d + 16 = 0, d = 2p - 18. Let f = -8 + p. Suppose -30 = 5x + 3y, 12 = 3x - 2x - 3y. Sort x, f, 2 in descending order. 2, f, x Let m(k) = -k*2 + 9k - 3. Let o be m(6). Let r = o + -8. Let f = r + -2. Sort 2, f, 1 in descending order. f, 2, 1 Let n be 5 + -2 + 2 - 2. Suppose -3o + 17 = 2. Let g = 2 - o. Sort -5, n, g. -5, g, n Let r = 6.9 - -0.1. Let m = 4 - r. Let k = m + -2. Put 0.5, -0.3, k in increasing order. k, -0.3, 0.5 Let d be (-2)/(-6) - (-8)/12. Suppose -4n + 15 = -n. Sort n, d, -5 in decreasing order. n, d, -5 Let z = -0.04 - -5.04. Let a = -0.43 - -0.03. Sort z, a, 2 in decreasing order. z, 2, a Let z = 7 - 4. Suppose -3b + 21 = -3j - 2b, -29 = 4j - b. Let d = -8 - j. Sort z, 4, d in increasing order. d, z, 4 Suppose -4n + 10 = 2l, 3l + 3n = -0l + 6. Let h = -11 + 25. Let j = 9 - h. Put j, l, 0 in decreasing order. 0, l, j Suppose -3r - 5l = -3l - 14, -4r + 28 = -2l. Suppose 5s - 14 = -2i, 5s - r = -2i + 4i. Sort i, 0, -4 in descending order. i, 0, -4 Suppose 2v = 3v - 3. Sort v, 0, -1 in ascending order. -1, 0, v Let h = 1.38 - 1.5. Let s = 3.88 - h. Let u(p) = -p2 - 2p - 3. Let v be u(-2). Put v, s, 0 in decreasing order. s, 0, v Let w(y) = -y*2 - 6y - 3. Let l be w(-5). Let u = 5 - l. Suppose -4d - s - 4 = us, 4d - 4 = -2s. Sort d, -4, -2. -4, -2, d Let p(t) = t*3 + 8t*2 + 2. Let k be p(-8). Suppose z + 20 = -3z - 3q, 5z + 14 = -q. Let f = k - z. Put -3, f, -4 in descending order. f, -3, -4 Let i(v) = 2v + 4. Let r be i(-5). Let w(k) be the third derivative of -k4/12 + 11k*3/3 + 6k*2. Let l be w(11). Sort r, l, 4. r, l, 4 Let h = -0.08 + -4.92. Let n = -31 - -24. Put -0.5, h, n in decreasing order. -0.5, h, n Suppose 0 = 2s - 3s + 1. Suppose 0c + s = c. Suppose 0g - 3g + c = -2y, 5g + 2y + 25 = 0. Sort g, 4, 0. g, 0, 4 Suppose p + 0 + 1 = 0. Put p, 5, 12 in increasing order. p, 5, 12 Let b be (-1)/6 + (-5)/(-30). Let c be (2 - 4)/(4/(-6)). Suppose -r = -3, 1 = -2t + 2r - 1. Put t, c, b in decreasing order. c, t, b Let h be (-2)/4 - 1/(-2). Suppose h - 4 = -j. Put 0, j, -5 in increasing order. -5, 0, j Let f(g) = g2 + 3g - 5. Let y be f(-5). Let u = 105 - 109. Sort y, u, 1 in decreasing order. y, 1, u Let u = 4.9 - 1.9. Put 2, u, -2 in descending order. u, 2, -2 Suppose 0 = -k + 1 + 18. Let m be -1 - ((-59)/k + 2). Let q = 0.036 + 0.164. Sort 1/2, q, m. m, q, 1/2 Suppose 2p + 1 - 7 = 0. Let b be (-1 + 3 - 9) + p. Put 0, b, 2 in ascending order. b, 0, 2 Suppose 5 = -d + 1. Let m be 8/d - -17. Suppose -m = 4j + 11. Put 2, 3, j in ascending order. j, 2, 3 Let w = 3 - -2. Let z(k) = k2 + 2k - 4. Let l be z(-4). Suppose lg + 6 + 10 = 0. Sort 3, w, g in ascending order. g, 3, w Let j(o) = o2 - 7o - 3. Let q be j(7). Put q, 6, -2, 5 in increasing order. q, -2, 5, 6 Let p = 0.16 - 1.06. Let u = -3.1 + p. Sort 0.2, u, -5. -5, u, 0.2 Let r be 3 + -2 - (-22)/2. Suppose -r = 5p - 32. Suppose -3u - 2 = -pu. Sort u, -3, 2/7 in increasing order. -3, 2/7, u Let z = -2.99 - 0.01. Let k = z - 1. Let w = 1.2 + -1.4. Put k, 2/9, w in decreasing order. 2/9, w, k Let c(v) = -2v + 16. Let g be c(6). Sort g, 0, 2 in increasing order. 0, 2, g Let n = -10 - -8.9. Let g = -8.9 + n. Sort g, -2/13, -5 in decreasing order. -2/13, -5, g Let a be (-1 - -2)/(1/(-2)). Let j be 2 + -2 + 4 + a. Suppose jl - 6 = -l. Sort -3, 3, l. -3, l, 3 Let z be ((-3)/(-2))/((-9)/12). Sort -4, 4, z. -4, z, 4 Let d = -0.37 + -0.03. Put d, -0.3, 2/23 in descending order. 2/23, -0.3, d Suppose 2x + g + 1 = -0g, 4g = -4x - 4. Put x, 1, -5 in ascending order. -5, x, 1 Suppose -2w - 13 = 3t, 5w - 2t + 24 = -t. Let s be w/1310/25. Let o be 2/20(-5)/(-2). Put s, o, -1/4 in increasing order. -1/4, s, o Suppose -3l + 4l + o - 3 = 0, -5o + 5 = -5l. Suppose -g = -0 - l. Sort 3, -4, g in increasing order. -4, g, 3 Let z be 9/128/12. Sort -4, z, 2 in descending order. 2, z, -4 Let f(z) = -z*3 + 16z*2 + 16z + 20. Let j be f(17). Sort -3, j, 1 in decreasing order. j, 1, -3 Let a = -1.051 + 0.051. Let k = 2 - 2. Sort -3, a, k in descending order. k, a, -3 Suppose x - 1 = 1. Let t be -21x(-3)/18. Let k = t + -11. Sort 4, 2, k in ascending order. k, 2, 4 Suppose -25 = -5j, -3n = 2n + 5j - 30. Suppose 7 = 2g - n. Suppose -2w - g = 2. Sort 5, w, 0. w, 0, 5 Let g(w) = w*3 + 4w*2 + 7w + 6. Let o be g(-4). Let p be 4/o + 265/(-55). Suppose 0 = -4f + 4. Sort p, -1, f in descending order. f, -1, p Suppose 0 = -6z + z - i + 15, 0 = 5z - 2i. Sort 0, z, -1, -4 in descending order. z, 0, -1, -4 Suppose 2n - 5r = -2, 0 = -2n + 4n - 4r + 2. Let m(u) = 0u - 2u + 1 + u. Let o be m(-4). Sort -5, o, n in descending order. o, n, -5 Let f(k) = -k + 3k - 3 - 1. Let l be f(4). Let v = -18 - -23. Sort l, v, -4 in descending order. v, l, -4 Let c = -1.4 + 1. Let q = -19 - 9. Let f be 2/5 - q/(-245). Sort f, 1, c. c, f, 1 Let w be (-3)/(-5) - (-8)/(-20). Let l = 1 + -2. Put w, l, -3/8 in increasing order. l, -3/8, w Let s be 6/4 - (14 - 4)/5. Sort -5, 19, s, 3 in descending order. 19, 3, s, -5 Let o be -1 - -1 - (-10 + 2). Let w = 5 - o. Let q(y) = y*2 + y - 56. Let v be q(7). Sort v, 1, w in decreasing order. 1, v, w Let q be (-18)/9(-10)/4. Suppose -b - qt - 3 = 10, -2 = 5b + 4t. Put b, -4, 0 in increasing order. -4, 0, b Let a be ((-1 - -6) + 0)/1. Let q be (-6)/(-4)(-1 + -27). Let o be (-4)/(-6) - (-4)/q. Put o, 1, a in ascending order. o, 1, a Let l = 0.504 + -0.004. Let q = -2 + 3. Sort -5, l, q in ascending order. -5, l, q Suppose 0 = -5z, 0 = 5j + 2z - 2 - 13. Let x be (9 - (-57)/(-6)) + (-2)/4. Sort j, 0, x in descending order. j, 0, x Let j = -0.2 + 0.18. Let u = 2.02 + j. Let n = 0 - u. Sort -1/2, n, 5 in increasing order. n, -1/2, 5 Suppose v = 5v. Sort v, 8, 1 in descending order. 8, 1, v Suppose -3z = -0z + d + 18, -4z - 25 = d. Put z, -4, 2/13 in ascending order. z, -4, 2/13 Let o = -142/35 - -4. Put 4/5, 0.5, o in ascending order. o, 0.5, 4/5 Let o = 4.6 - 0.6. Let j = -0.06 + 0.56. Put o, 0.1, j in increasing order. 0.1, j, o Let t(m) = 5m*2 + 10m + 2. Let j be t(-2). Sort 13, -1, j in descending order. 13, j, -1 Let q(g) = g*2 + 4g. Let d be q(-3). Let j = d - -1. Let x = -178.7 - -179. Sort -4, x, j in decreasing order. x, j, -4 Let u = -0.412 + 0.002. Let k = 0.11 + u. Let b = -0.1 - 0.9. Sort b, 1, k in decreasing order. 1, k, b Suppose 3s - 5 = 8s. Sort 5, 3, s in ascending o	{ "pile_set_name": "DM Mathematics" }
t w = 1/2 - 5/6. Which is smaller: g or w? g Let v be 219/5 + 1/5. Let z be 6/(1 - v/(-12)). Which is greater: 2 or z? 2 Let h = -49351/10388 - -2/2597. Do -4 and h have different values? True Let m(l) = -l - 5. Let z be m(-4). Let n = 11.07 + -11. Let a = n - 1.07. Is z at least a? True Let d be 1/2-2-29. Let s = d - 50. Let m be (7/s)/(2/6). Which is smaller: 1/3 or m? m Suppose 3y = -4t, -5 = 6t - 9t - y. Suppose 2 + 1 = m. Is m at least as big as t? True Let k(i) = -i*2 + 8i - 3. Let d be k(5). Let b be (d4/56)/2. Let m = -1 + 0. Which is smaller: m or b? m Let q = 0 + -0.1. Let s = 7 - 18. Is s greater than q? False Let f(i) = -i3 + i2 + i + 2. Let n be f(2). Let g be (-6)/10 + 1 + n. Is 1 smaller than g? False Suppose 6a - 9 = 3a. Let y(s) = -3s*3 + 5s3 - sa + 6s2 - 6s + 8. Let z be y(-7). Are -2/9 and z nonequal? True Let n = 8 + -14. Are -6 and n non-equal? False Let m = 0.4 - 0. Let h = m - 0.4. Let q = 7 + -5. Which is smaller: q or h? h Let s(u) = -u*3 - 8u*2 - 9u - 16. Let b be s(-7). Let p(j) be the first derivative of -j3/3 - j2 - 1. Let k be p(b). Is k bigger than -6/13? True Let k = 0.097 + -7.097. Let b = -3/11 + 31/33. Do b and k have the same value? False Suppose 0 = -6g + 2g - 2f + 226, 3f - 283 = -5g. Is g < 56? False Suppose -3s + 2s = -4d - 12, 2s = 2d. Suppose 3n = -11 + 2. Let a be -3-1(n - -2). Is d at least a? False Let b(t) be the third derivative of -t4/24 - 4t3/3 + t2. Let l be b(-8). Which is smaller: l or -2/15? -2/15 Let p = 0.18 + -0.38. Is -17 greater than or equal to p? False Let w = -1.47 + 1.5. Does -2/3 = w? False Suppose -6a - 9 = -3. Let q be 15/17(-262)/(-3). Let h = q - 77. Which is smaller: h or a? a Suppose 6 = -2d - d. Let r be (-6)/(d/(-3) + 0). Let b = r + 9. Is 2/9 at least b? True Let x(o) = 2o*2 - 2o - 4. Let n be x(3). Suppose 4s - 21 = -3v, -n = -v - s - 1. Suppose vg - 2g = 0. Are g and 1 non-equal? True Suppose 3v - 8v = 10. Let m be v/(-4) - 1/6. Which is smaller: m or 2/9? 2/9 Let k = -3.031 - -0.031. Let j = 1.5 + -1. Which is smaller: j or k? k Let b be 9/(-3) - 25/(-9). Which is smaller: -1 or b? -1 Let q(x) = x*2 - 7x. Suppose 4f - 50 = -0l + 3l, f - 16 = -l. Let z = f + -8. Let j be q(z). Is -6 smaller than j? False Let p be 2/24135/18. Let r = 0 - -2. Is p at least r? False Let p = 7 - 2. Suppose 0 = -3s + 3a + 3, -4s - 5 = pa. Which is smaller: 1 or s? s Let w = -0.3 - -0.6. Let c = -0.7 + 0.8. Do c and w have different values? True Let a = -42 - -42. Which is greater: 14 or a? 14 Let d = 218 - 1530/7. Which is smaller: -1 or d? -1 Let n be 10/(-55) + 62/(-22). Which is smaller: n or 1? n Suppose -2v + 3t - 8 = 0, -5v - 2 = -3t - 0. Which is greater: v or 21/8? 21/8 Let d = 3/2 + -17/10. Does d = 2? False Let c(r) = -5r2 + 2r + 9. Let d(t) = t*2 - 1. Let w(s) = c(s) + 6d(s). Let o be w(-3). Are 6 and o non-equal? False Suppose v = -w - 13, 2v + 35 = -2w - w. Let l be (5/(-30))/(10/w). Let c = l + 1/10. Is c < -1? False Let j(q) = -q2 - 8. Let x be j(0). Let h(l) = l2 + 8l + 1. Let v be h(x). Is v greater than 0? True Let b = -7901/70 + 823/7. Let j = -11/2 + b. Is j less than or equal to -2? False Let y = -1 - 2. Let i = y - -2.5. Suppose -23 = -3m + 5v, 2m + 3 - 17 = 3v. Which is bigger: i or m? m Suppose 0 = -3z + 4y + 1, 5 = 4z + 3y + 37. Suppose -2d + 3d = -5. Is d bigger than z? False Suppose 0 = 6p - p - 5. Which is smaller: p or 16/9? p Suppose -5b = c - 648, 0b - 3c = -3b + 378. Let j = b - 647/5. Let y = -2.8 - -3.1. Is j equal to y? False Let l = -2 + 6. Let f be (3/6)/(2/l). Let h = -379/5 - -76. Which is smaller: h or f? h Let w = 0 - 5. Let x = w + 5.1. Is 0.06 at most as big as x? True Let j(i) = 3i2 - 1. Let g be j(2). Suppose 2z = -5w + g, 4z - 10 = -0z + 2w. Suppose -5u + z = -2. Which is smaller: 2/5 or u? 2/5 Let u(w) = 15w*2. Let s be u(1). Suppose 4z - z = s. Are 4 and z equal? False Let u = -3 + 3. Which is smaller: 20 or u? u Suppose -2 = -4w + 2w. Is 3 != w? True Let k = -8 + 9. Let u(j) = -j*2 - 5j + 2. Let v be u(-5). Let n be 9/(-4) + 0 + v. Is n < k? True Let u = -3 - -3. Let m = u + 3. Let l be 3(-1 - (-5)/m). Is 2 greater than l? False Let b = -1 + 0.95. Let j = b + -0.15. Is -2/5 != j? True Let j be (-2)/3 - 52/12. Let u be j/2 - (1 - 3). Is 1 at least as big as u? True Let v = 44 + -43. Let b be (-2)/(-5)5/(-7). Is v smaller than b? False Suppose -k = -2k + 2. Let w = 3 + -1. Suppose r - 6 = -wr. Is r not equal to k? False Let v = 6 + 1. Suppose -vm = -6m - 1. Do 4/11 and m have different values? True Let y = 0.083 - -0.017. Which is greater: y or -58? y Let l = -1.6 + 1.5. Which is bigger: l or -4/5? l Let a be (3 - (-18)/(-8))22. Is a at least as big as 18/11? True Suppose z + z - 3d - 1 = 0, -5z = -d + 4. Let j be (1 - 0) + 0/z. Which is greater: 2/7 or j? j Let u = 0.28 + -0.3. Let a = -36 - -33.98. Let x = a - u. Which is bigger: x or 0.1? 0.1 Let l = -13.9 + -0.1. Which is smaller: -1 or l? l Let y = 10 - -1. Let f = y - 9. Let s be (1 - f)(-2 + 3). Is 0 >= s? True Let n be 0 + 5 + -2 + 2. Suppose -nl - 5s + 3s = -51, 4l + 3s = 45. Suppose -l - 3 = -4h + 2b, 4b + 12 = -4h. Is h at most as big as 2/13? False Suppose -12p = -14p + 8. Is 4 bigger than p? False Let p be (2/(-14))/((-3)/(-9)). Let w = 3 + -3. Which is bigger: p or w? w Let g(r) = -r*3 + 5r*2 - 6r + 1. Let j be g(5). Which is smaller: -28 or j? j Let x(y) = -y*2 - 4y + 14. Let i be x(-6). Suppose in + 1 = 3. Which is smaller: 2/7 or n? 2/7 Suppose -4x = -x + 2n - 25, 3x = 2n + 17. Is x < 7? False Suppose -6b - 14 + 80 = 0. Which is smaller: 8 or b? 8 Suppose 0 = 2g + 23 + 7. Suppose -66w - 620 = 304. Which is greater: w or g? w Suppose 4y - 172 = -5m - 31, 3y + 3m = 105. Which is smaller: y or -1? -1 Let t = -0.2 - -0.2. Let i = 13 - -2. Let d be 0 + -2 - i/(-6). Is t < d? True Let k = 29 - -125. Suppose 5n + 485 = -5l, 4n + 5l + 239 = -k. Let z be 8/44 + n/22. Which is smaller: -3 or z? z Let o = -7 - -7.01. Let a = o - 0.01. Are a and 0 equal? True Suppose -2g + 2 + 0 = 0. Let x be (-152)/434 + (-14)/(-49). Which is bigger: g or x? g Let c(t) = -t3 - 4t2 - 3. Let a be c(-4). Let p be (a/6)/(6/(-8)). Is p not equal to 0? True Let i be (94/(-440))/(-1) - (-14)/(-56). Is 0 at most as big as i? False Let l(g) = -g2 - 2g + 1. Suppose -5p - 4 - 11 = 0. Let d be l(p). Suppose -3x - 11 = -4v, 0x + 2x - 2v = -6. Which is smaller: x or d? d Let f(c) = c3 + 4c*2 + 4c + 4. Let y be f(-3). Let q = 0.1 + -2.1. Let b = q + 4. Is b less than y? False Let y be (6 - 10)(-1 - 0). Let f be (0 - -6)y/(-6). Let m(g) = g*3 - 4g*2 + g + 2. Let b be m(3). Is f less than b? False Let x = 12.7 + -12. Let s = x - 0.9. Let n = 187/3 - 63. Is s greater than or equal to n? True Let b be 12/(2/(-9)). Let j = 10 + b. Are j and -1 equal? False Let j be -2 - (-1 + -2 + 1). Suppose ja - 1 = a. Which is bigger: a or -2? a Let a = -5 - -7. Let c be a - (-18)/(-17)2. Let s be (2/(-6))/(3/9). Which is smaller: s or c? s Let x = 15.2 + -1.2. Let t = 14.3 - x. Is 0 bigger than t? False Let s(w) = w*2 + 9w + 3. Let i be s(-9). Let f be (-45)/(-6)i/(-15). Is 2/7 at least f? True Let x be 1 + 2/(-2 + 3). Suppose 0 = xd + 3 - 12. Let h be ((-4)/(-6))/(2/d). Which is smaller: 2/5 or h? 2/5 Suppose 5l + 4 = 9l. Is l < 1? False Suppose r - 25 = -4. Are 20 and r unequal? True Let z be (5 - (-318)/(-63))2. Are z and -1 equal? False Let o be (5/3 - 1)-9. Suppose x - 2f - 7 = 0, 4 = -5x + 4f - 7f. Let y be -1x8 + 1. Is o equal to y? False Let t = -818 + 5735/7. Which is smaller: t or 1? 1 Suppose 15 = 7q - 2q. Let k = 9 - q. Suppose -k = -c - 2c. Which is greater: c or 5/3? c Let r = 9 - 8. Are -1/21 and r unequal? True Suppose -2l - l - 3k = 0, 0 = -2l + 5k + 35. Suppose -3b + 16 = b + 4z, z = -2b + 7. Which is smaller: b or l? b Let j = -26 - -26. Let q = -3 + 4. Suppose 3n - q = -4. Which is smaller: n or j? n Let k = 884/1661 - -2/151. Is k at least -0.07? True Let q be ((-1)/32)/((-5)/150) + -1. Are q and 2 equal? False Suppose 6j - 105 + 21 = 0. Which is smaller: 15 or j? j Let z be 11 + 1*(-3 - -2). Is	{ "pile_set_name": "DM Mathematics" }
) - 2r(c). Let u(o) = -o - 7. Let y be u(4). Is g(y) prime? False Let m = 95 + 326. Suppose -4c + 343 + m = 0. Is c composite? False Let z = -30 + 213. Let r = z - 130. Is r a composite number? False Let o(l) be the first derivative of l*3/3 + 4l*2 + l - 1. Let m = -13 - -4. Is o(m) a prime number? False Suppose s + 2a = 31, -5s + 2a - 3a + 119 = 0. Suppose -5d - s = -w, -4w - d = -8w + 92. Is w a prime number? True Let i = -198 + 563. Is i a composite number? True Suppose 5n - 2n - 60 = -4o, 3n - 39 = 3o. Is n/56 + 1354/14 prime? True Let t = 3 - 1. Suppose -3i - 2g - tg + 130 = 0, 3i - 94 = 5g. Is i prime? False Suppose -m = 4m - 395. Is m prime? True Suppose 0 = 3f + 1 - 10. Let r be 113(0 + 9). Suppose 5c = -3b + r, 55 = fc + b - 3b. Is c a prime number? False Let v = 18 + 16. Suppose -7 = -4q - 5p + 53, -4p - v = -5q. Is q a prime number? False Suppose -2m - 2x + 99 = -5x, -2m + 89 = -5x. Suppose 0o = 3o - m. Is o a composite number? False Suppose -j - j + 50 = 3z, 5j = z + 108. Suppose -3a = 3 - 0. Is j - (2 + 3a) prime? True Suppose -2p - 12 = -2w, -p + 4w = -2p - 1. Let x(o) = o3 + 5o*2 - 6o - 7. Let h be x(p). Let r = h + -13. Is r prime? False Suppose -1381 - 1275 = -4n - 4j, -j = -2n + 1337. Is n a prime number? False Let x(c) = -c2 + 2c + 2. Let b be x(4). Let v = b - -10. Suppose k + 168 = -5f + 825, 0 = f - vk - 123. Is f composite? False Let w(k) be the third derivative of -k*7/840 - 7k6/720 + k5/12 + 3k2. Let n(f) be the third derivative of w(f). Is n(-10) a composite number? False Let t = 25 + -36. Let a = t + 22. Is a prime? True Let a = 408 - 221. Is a a prime number? False Is (-5)/((-10)/(-7))-122 prime? False Let t = -40 - -62. Suppose 5x + t = 5h + 4x, 5h + 5x - 40 = 0. Suppose -4f + 909 - 174 = -hg, -2f - 3g = -373. Is f a prime number? False Let v = 191 + -286. Let k = v - -154. Is k a composite number? False Let l(d) = -2 + d2 + 13 + 2d*3 + 3d - 3d3 - 3. Let w be l(6). Let q = 239 + w. Is q a prime number? False Let b(m) be the third derivative of m5/15 - m4/6 - m3/2 + 4m*2. Is b(-4) composite? True Is 12 + (30 - -3857) prime? True Suppose -12 = -4d - 2s, 4s - 9 = -4d - d. Suppose 4q - 2a - 231 = q, -159 = -2q + 3a. Suppose -dc - 3t + 560 = -q, -t + 508 = 4c. Is c composite? False Let x = 0 - -19. Suppose -o - x = -2o. Suppose -o - 27 = -2r. Is r a composite number? False Let d be ((-302)/8 - -3)4. Let q be d(-1)/((-1)/(-2)). Suppose 3 = 3t - 2t, 0 = 5l + t - q. Is l a prime number? False Suppose -5d + 44 = 4h - 3h, 2d = -3h + 15. Let i = 16 - d. Let m = i + -5. Is m composite? False Let k = 4 + 0. Suppose -ki + 220 = -0i. Is i a composite number? True Suppose 0 = 6v - 24v + 85338. Is v a prime number? False Is (-2018)/(-3) + 3/182 a prime number? True Suppose -12 = -2f - f. Let t(x) = 3x*2 + x - 3. Is t(f) a prime number? False Suppose 4b - 644 = -0b. Is b a composite number? True Suppose 2d = -2h + 270, -2d - 3d - 4h = -676. Suppose -x = 4u - d, 3x = -2u + 4x + 74. Is u composite? True Let q = 9 + -16. Let t = -7 - q. Suppose 2 = -5m - 3, t = 5d - 2m - 97. Is d a composite number? False Is ((-74)/3-3)/(3 - 1) a prime number? True Is 12/(-3) + 4 - -763 a prime number? False Suppose -8 = o - 4x + 3, 2x = o + 5. Let r(a) = 51a. Is r(o) composite? True Suppose f - 4c - 175 = 0, 2f + c = 3f - 166. Is f a prime number? True Suppose 4i - 642 = 2i + 5w, -5w = i - 336. Is i prime? False Let t(a) = -6a3 + 3a*2 + a + 5. Is t(-3) prime? True Suppose -5b + 0b + 40 = 0. Let i = b + -6. Suppose io = 3j + 5o - 255, 0 = -j + 2o + 97. Is j composite? False Let z(r) = -66r + 5. Is z(-4) composite? False Let g(c) = -18c3 + 2c*2 + 3c + 3. Is g(-2) a prime number? True Suppose 2b + 2b - 1676 = -4p, -4b + p = -1676. Is b prime? True Let q(w) = -14w + 5 - 8w + 0. Is q(-8) composite? False Let x(v) be the third derivative of 9v4/8 - v3/3 + v2. Is x(5) prime? False Let o = -14 - -19. Suppose od = 165 + 290. Is d a prime number? False Suppose -2o + 6 = -2. Let n be (-342)/(-8) + 1/o. Suppose -2y = 8, -u = 2u + 5y - n. Is u a prime number? False Let s(c) = c - 9. Let d be s(11). Suppose 0 = -2r + 3r - dq - 175, 3r + q - 497 = 0. Is r a composite number? False Let k(a) = -14a + 13. Is k(-7) a composite number? True Let b = 6 - 2. Suppose 0 = -3j + y - b, y - 2y - 12 = 5j. Is 6j/4-2 composite? True Is (13321/21)/((-2)/(-6)) a composite number? True Let u be 2 - 31/(2 + -3). Let a(c) = 2c2 + 1. Let w be a(1). Suppose 0z + u = wz. Is z prime? True Suppose 2y = 5456 + 3518. Is y a composite number? True Suppose -7v + 3v = -4, -5v = 2a - 21. Let i be 506/a - 2/8. Suppose -i = -p - d, 2p - 339 = -3p + d. Is p composite? False Suppose -3l + 5 = 53. Is ((-220)/l + -2)4 prime? True Is (1/(2/(-223)))/(4/(-8)) prime? True Let w be 3 + 2 + (-20)/4. Suppose wh = 5h - 1455. Is h composite? True Suppose 2y = 193 + 385. Is y composite? True Suppose -7 = -x - 2v, 3v - 4v = 3x - 11. Let s(g) = -10 + 2g*3 - 7g*2 + 4g + 2gx + 2g*3 - 7g*3. Is s(-8) a prime number? False Let o be ((-5)/(-2))/((-4)/(-8)). Suppose 366 = og - 3g. Is g prime? False Let i be ((-208)/(-20))/((-2)/(-15)). Let v = 244 - i. Is v composite? True Let l = 3132 + -2211. Is l a prime number? False Let y(m) = m2 - 234. Let p be y(0). Let i be 2/(-7) - (-4722)/14. Let b = p + i. Is b prime? True Let m(f) = -3f2 - f + 11. Let q be m(-5). Let z(l) = -l2 - 2l + 2. Let s be z(-4). Let o = s - q. Is o composite? False Let y(a) = 2a*3 - 6a*2 + 15. Is y(5) composite? True Suppose -o + 3o - 6 = 0. Let w be 5 + 1/(-1) + 1. Suppose -z = wi - 34, -2z + i = oi - 44. Is z composite? False Let n(t) = -t3 + 3t + 1. Let u be n(-3). Suppose -24 - u = -p. Is p composite? False Let m be 2 + 0 - (1 + -35). Suppose 0 = 2d + 3q - 5 + 22, -q = d + 6. Let s = d + m. Is s prime? False Let a = -69 - -148. Is a a composite number? False Let k = -119 + 47. Is 1/1 + k/(-2) a prime number? True Let n(u) = 2u - 13. Let q be n(8). Suppose 0 = qv - 5d - 821, -3d - 117 - 154 = -v. Is v a composite number? False Suppose -4d + 5v = -0v - 11049, -d = -4v - 2765. Is d a composite number? True Let t(v) be the second derivative of v*4/6 + 13v*3/6 + 15v*2/2 - 5v. Is t(-10) composite? True Suppose -3b = 5s - 200, -4s - 4b + 147 = b. Suppose 36 = z - s. Is z a prime number? True Let m = 127 + -124. Let u(c) = 13c2 + 3. Let l be u(-4). Is l + 0m/(-9) prime? True Suppose -47 = 2l - 7. Is (-6)/(-10) + (-2528)/l composite? False Let q be (3/6)/((-1)/(-24)). Suppose -12 = 5o - o - 2l, -4o = 3l + q. Let a = o + 14. Is a prime? True Let c(r) = 11r*2 - 3r + 3. Is c(-4) prime? True Let q(j) = j*2 + 6j - 7. Let o(n) = 2n2 + 12n - 14. Let r(b) = 3o(b) - 5q(b). Let g be r(-7). Suppose -x = -gx - 7. Is x a composite number? False Let z be -24(32/12 - 3). Suppose 0 = 13i - zi - 4075. Is i a prime number? False Suppose 4q + 5a + 366 = 10807, 2q - 5222 = -4a. Is q a composite number? False Let t be 2 + (1 + -4)/(-1). Suppose -ta + 107 - 356 = -2r, 509 = 4r + a. Is r composite? False Suppose -14 = w + 3a - 49, -2w - a = -70. Let c = 301 - w. Is (1/(-2))/((-1)/c) a composite number? True Suppose -5z - 4x = 26, 5z + 2x = -3x - 30. Is z/4 + 273/14 a composite number? False Is 6/18 - (2 - (-4012)/(-6)) prime? False Let j be 1701/(-6)-2 - 1. Suppose 4o - j = 174. Is o prime? False Let x = 283 - 184. Let z = x + -45. Suppose b - c - z = -6c, 0 = -5b + 3c + 186. Is b composite? True Let f(v) = -v3 - 14v*2 - 6v - 17. Is f(-14) a prime number? True Let c = -2166 + 3190. Suppose 5q - 601 = c. Suppose -q = -s - 4s. Is s a prime number? False Is (21 + -4)/(6/42) a prime number? False Let s(z) = -z*2 - 1. Let o be s(1). Let u be (-3 + o)4/2. Is 6/(-15) + (-104)/u prime? False Let s(z) = 16z. Let j be s(1). Suppose j = u - 5u. Let i(w) = w*3 + 3w*2 - 6w - 1. Is i(u) prime? True Let r = 14 - 47. Let p = r - -60. Suppose p = 4c - 61. Is c a composite number? True Let p(f) be the first derivative of f6/360 + f4/4 - f*3/3 + 2. Let n(x) be	{ "pile_set_name": "DM Mathematics" }
8. Give l(-13). -8 Let t(m) = 97m - 353. What is t(4)? 35 Let x(m) = -2m - 1. Determine x(2). -5 Let m(f) = f*3 + 9f*2 + 8f + 8. Give m(-8). 8 Let s(h) = h*3 + 8h*2 + 8h + 7. Determine s(-6). 31 Let y(x) = -x + 6. What is y(6)? 0 Let l(x) = -4x - 36. Calculate l(-11). 8 Let o(u) = u - 4. What is o(9)? 5 Let f(q) = 6q*2 - 6q + 3. Give f(2). 15 Let d(r) = r*2 + 6r - 57. Determine d(-11). -2 Let d(j) = j*3 + 15j*2 - 2j - 8. Determine d(-15). 22 Let b(f) = f*3 + 3f*2 + 3f + 3. Calculate b(-2). 1 Let b(z) = -3z3 - 5z*2 + 3z. What is b(1)? -5 Let x(g) = -g*2 - 2g - 7. Give x(-2). -7 Let c(z) = z*3 + 6z*2 + 3z - 8. What is c(-6)? -26 Let v(g) = g*3 - 7g*2 + g - 9. Calculate v(7). -2 Let n(j) = 3j + 80. Calculate n(-23). 11 Let v(l) = -l*3 + 33l*2 - 2l + 59. What is v(33)? -7 Let f(r) = -r + 8. Calculate f(-5). 13 Let j(c) = c*3 - 5c*2 - 2c - 1. Calculate j(6). 23 Let u(q) = q*2 - q - 42. What is u(0)? -42 Let a(j) = 6j - 17. Determine a(5). 13 Let b(w) = w*3 - 5w*2 - 18w + 56. What is b(6)? -16 Let i(f) = -f*2 + 16f - 29. What is i(14)? -1 Let x(y) = -2y2 + 8y + 7. Determine x(4). 7 Let d(r) = -2r3 - 21r*2 - 11r - 13. Determine d(-10). -3 Let v(h) = h*2 + 11h + 15. What is v(-8)? -9 Let m(b) = 3b2 - 86b - 14. Give m(28). -70 Let d(y) = -9y + 4. Determine d(-5). 49 Let c(w) = w2 - 17w + 35. Calculate c(15). 5 Let l(i) = i3 - i2 - i + 12. Determine l(0). 12 Let p(k) = 2k2 - 46k - 59. Determine p(28). 221 Let w(s) = -s*2 + 5s - 4. What is w(7)? -18 Let p(n) = -n*3 - 6n*2 + 4n - 18. Calculate p(-7). 3 Let f(m) = -m*3 + 28m*2 + 20m + 272. Give f(29). 11 Let c(x) = x*3 - 7x*2 - 6x + 72. Determine c(5). -8 Let r(w) = -w*3 + 22w*2 - 22w + 8. What is r(21)? -13 Let i(y) = y*2 + 10y + 22. Give i(-3). 1 Let m(a) = -a*2 + 61. Determine m(0). 61 Let d(g) = 13g - 11. What is d(-9)? -128 Let l(u) = -u*2 + 14u - 21. Determine l(12). 3 Let m(b) = b*3 - 6b*2 - 4b - 7. Determine m(4). -55 Let c(p) = -p*3 + 5p*2 - 2p - 8. What is c(3)? 4 Let p(i) = -3i - 5. Give p(4). -17 Let d(v) = -v3 + 4v*2 + 2v + 7. What is d(5)? -8 Let z(i) = i*3 + 7i*2 + 10i + 10. Give z(-7). -60 Let k(u) = -u + 10. Calculate k(9). 1 Let b(j) = -4j. Give b(-6). 24 Let t(x) = 6x*2 - 9x + 7. Give t(4). 67 Let i(k) = -25k + 456. Determine i(18). 6 Let m(z) = z - 21. Calculate m(11). -10 Let f(n) = -2n*3 - 21n*2 - 7n + 21. Give f(-10). -9 Let r(y) = -4y + 17. Determine r(6). -7 Let d(z) = z2 + 275z - 1123. Give d(4). -7 Let b(c) = -69c + 58. Calculate b(1). -11 Let a(t) = -5t + 95. Determine a(0). 95 Let k(p) = p*3 - 53p*2 - 107p - 187. What is k(55)? -22 Let u(g) = -g*3 - 6g*2 - 11g - 18. Calculate u(-5). 12 Let k(b) = 16b - 228. Determine k(14). -4 Let l(z) = -z3 - 13z*2 + 13z - 35. Calculate l(-14). -21 Let b(l) = l*3 + 4l*2 - 6l + 1. Determine b(-5). 6 Let w(r) = 6r + 6. Calculate w(-4). -18 Let q(f) = -f2 + 25f - 148. What is q(12)? 8 Let v(z) = -z + 2. Calculate v(4). -2 Let w(j) = -3j3 - j2 + 2j + 2. What is w(-2)? 18 Let j(z) = z - 20. Calculate j(8). -12 Let l(r) = -r*2 - 7r - 8. What is l(-4)? 4 Let n(h) = -h*2 + 24h - 8. Calculate n(13). 135 Let a(w) = 7w3 - w2 - w. What is a(2)? 50 Let f(l) = l2 - 2l - 1. Give f(-2). 7 Let d(f) = 4f - 37. Calculate d(9). -1 Let c(d) = -3d + 7. Calculate c(11). -26 Let y(f) = f3 - f2 + f - 1. What is y(0)? -1 Let r(l) = 3l - 8. Calculate r(14). 34 Let l(x) = 8x + 37. What is l(-11)? -51 Let y(c) = -c*3 - 12c*2 + 11c + 11. Give y(-13). 37 Let k(s) = -s*2 - 7s + 23. Give k(-9). 5 Let l(p) = -p*3 + 16p - 4. Give l(-4). -4 Let l(c) = -c*2 + 34c + 191. Calculate l(39). -4 Let f(j) = -12j + 46. Determine f(3). 10 Let q(h) = -h2 - 6h - 5. What is q(-8)? -21 Let u(v) = -v*3 + 2v*2 + v + 3. Calculate u(3). -3 Let v(j) = -2j*2 + 21j + 8. Give v(11). -3 Let y(j) = -16j + 600. Give y(38). -8 Let n(u) = 4u + 49. What is n(-20)? -31 Let d(m) = 9m - 25. What is d(5)? 20 Let r(t) = t2 - 15t - 25. Give r(15). -25 Let m(z) = 12z2 - 7z - 10. Calculate m(-2). 52 Let a(u) = -2u2 + 2u + 59. Give a(-5). -1 Let a(m) = -6m2 + 6m - 6. Give a(4). -78 Let c(k) = 17k - 110. Determine c(6). -8 Let l(h) = h2 + 13h - 254. Give l(-24). 10 Let t(d) = -3d + 32. What is t(10)? 2 Let a(p) = -p3 + 6p*2 + 7p - 8. Calculate a(7). -8 Let f(i) = i*2 - 9i + 7. Give f(8). -1 Let h(x) = 18x + 3. What is h(1)? 21 Let s(t) = -242t - 483. What is s(-2)? 1 Let t(a) = -a*2 + 19a. What is t(19)? 0 Let k(r) = r*2 + 13r - 1. Give k(-14). 13 Let r(v) = -2v3 + 10v*2 + 10v + 18. What is r(6)? 6 Let z(d) = 14d3 - 2d + 2. Calculate z(1). 14 Let i(k) = k + 13. Give i(-20). -7 Let a(q) = -3q + 20. Determine a(6). 2 Let q(k) = -k3 - 7k*2 - 4k - 2. Calculate q(-7). 26 Let o(t) = t3 - t2 + 3t + 5. Determine o(0). 5 Let m(i) = -18i*2 - 3i - 2. What is m(-1)? -17 Let d(l) = l*2 - 11l + 22. Determine d(6). -8 Let w(z) = 2z2 + 3z + 3. Calculate w(-2). 5 Let u(h) = 15h + 117. Calculate u(-12). -63 Let j(t) = -8t*2 + 6t - 27. Calculate j(3). -81 Let y(r) = r*3 + 6r*2 + 3r + 4. What is y(-2)? 14 Let z(b) = -b*2 + 4b - 2. Calculate z(1). 1 Let h(f) = f*2 - 5f + 7. Calculate h(7). 21 Let c(i) = -i*3 + 9i*2 - 8i + 7. Determine c(8). 7 Let p(z) = -19z2 + z + 2. Give p(-1). -18 Let s(k) = -k + 8. What is s(9)? -1 Let u(j) = -j2 + 16j - 33. Calculate u(14). -5 Let w(n) = 5n - 26. What is w(11)? 29 Let c(q) = 23q + 1. Give c(-2). -45 Let j(z) = -9z3 + 2z2 - z - 4. What is j(-2)? 78 Let u(y) = y3 + 6y2 + y + 7. Give u(-6). 1 Let k(u) = 2u*2 + 22u - 4. What is k(-11)? -4 Let p(v) = 80v3 - v2 + 3v + 3. Determine p(-1). -81 Let v(k) = -k*3 - 7k*2 - 3k + 2. Calculate v(-4). -34 Let k(w) = -35w - 181. Give k(-5). -6 Let l(v) = v3 - 15v*2 - 13v + 200. Determine l(15). 5 Let l(h) = -48h - 134. Determine l(-3). 10 Let o(i) = i3 + 57i*2 - 58i - 17. Calculate o(-58). -17 Let o(n) = 16n2 - 9n + 16. What is o(2)? 62 Let f(j) = 3j + 25. Give f(-8). 1 Let w(p) = -2p + 29. Give w(-14). 57 Let x(b) = -3b2 + 175b - 45. Give x(58). 13 Let o(w) = -2w2 + 15w - 5. What is o(8)? -13 Let s(x) = x*2 + 12x + 8. Determine s(-8). -24 Let g(r) = -r*3 - 19r*2 - 21r - 22. Give g(-18). 32 Let l(r) = -r*2 + 10r - 17. What is l(6)? 7 Let j(s) = -s*3 - 7s*2 + 20s - 1. Determine j(-9). -19 Let s(q) = -q*3 - 17q*2 + 19q + 16. Determine s(-18). -2 Let t(a) = a*3 + 12a*2 - 14a - 23. Determine t(-13). -10 Let a(j) = -3j2 + 5j - 16. Give a(7). -128 Let t(o) = o*3 + 18o*2 + 30o - 32. Give t(-16). 0 Let o(i) = -8i + 33. Give o(4). 1 Let l(m) = m3 + 12m*2 - 13m + 1. Give l(-13). 1 Let a(m) = 9m2 - 3m + 3. Calculate a(1). 9 Let i(a) = a*3 + 3a*2 - a + 5. What is i(-4)? -7 Let o(r) = 5r*2 + r. What is o(1)? 6 Let l(k) = 2k*2 - 34k + 27. Determine l(16). -5 Let l(r) = -96r - 481. Determine l(-5). -1 Let x(a) = a3 - 9a + 7. What is x(3)? 7 Let x(u) = u*2 - 24u + 41. What is x(24)? 41 Let b(u) = -u*3 - 17u*2 + 2u + 12. Determine b(-17). -22 Let v(b) = -b*2 + 3b + 13. Give v(-4). -15 Let l(y) = -y - 6. What is l(-3)? -3 Let l(z) = 6z - 27. Determine l(5). 3 Let g(a) = 4a - 20. Determine g(4). -4 Let w(i) = -i*3 + 2i2 - i - 2. Determine w(-1). 2 Let g(d) = d3 + 9d2 - 13d - 18. Calculate g(-10). 12 Let c(b) = 5b - 74. Give c(14). -4 Let o(g) = -g + 16. Calculate o(11). 5 Let a(g) = 5g*2 + 38g + 17. Calculate a(-7). -4 Let w(o) = o*2 - 12o - 23. Calculate w(14). 5 Let h(d) = d*3 - 10d*2 - 11d - 1. Calculate h(11). -1 Let b(m) = 10m + 47. Calculate b(-6). -13 Let m(a) = -13a + 5. Calculate m(-4). 57 Let x(k) = 13k + 20. What is x(-4)? -32 Let g(u) = -u3 + 8u*2 + 2u + 8. What is g(8)? 24 Let r(b) = -b*2 - 14b - 43. Determine r(-11). -10 Let o(g) = -g*3 - 10g*2 - 8g + 7. What is o(-9)? -2 Let l(t) = -t*3 - 39t*2 - 2t - 70. Give l(-39). 8 Let m(y) = y + 25. Calculate m(-9). 16 Let x(w) = -w*2 - 6w + 7. Determine x(-6). 7 Let j(r) = 4r + 13. Give j(-3). 1 Let b(q) = -2q + 40. What is b(-17)? 74 Let k(h) = -36*h + 2. Calculate k(1). -34 Let m	{ "pile_set_name": "DM Mathematics" }
t the prime factors of c. 7, 79 Suppose 35j + 47j - 68j - 240478 = 0. List the prime factors of j. 89, 193 Suppose 2v + 26 = -7g + 5g, 3g + 2v = -39. List the prime factors of (-2 - 84 - -2 - -1)g. 13, 83 Suppose 3w - 180 = 9w. Let z be (-146)/w1 - (-172)/1290. List the prime factors of 112 + 2 - 1/(z - 4). 113 Suppose -287h + 9217089 + 4034562 = 0. What are the prime factors of h? 3, 15391 Suppose -10n + 13n = 2v - 130, -4n = 5v + 181. List the prime factors of 2/((n/(-110))/(62/10)). 31 Suppose -2x + 4g + 18498 = 0, 0 = 2x - 52g + 53g - 18468. List the prime factors of x. 3, 3079 Suppose -7517w + 49356 = -7505w. List the prime factors of w. 3, 457 Let u(l) = l3 - 5 - 5 - 5 - 7l*2 - 4l + 23l2. Suppose -11f + 24 - 200 = 0. List the prime factors of u(f). 7 Let g = -91 - -94. Suppose gu - 3t = 27, 0 = 5u + 5t - 15. List the prime factors of 1u/((-24)/(-388)). 97 Let x(c) = -c3 + 3c*2 + 4c + 2. Let r be x(4). Let l be (3 + -2)/((r/(-5))/2). Let o(m) = 3m2 + m + 38. What are the prime factors of o(l)? 2, 3 List the prime factors of -2913056/483/(-3). 97, 191 Suppose 0 = 9k + 69 + 21. What are the prime factors of (k - (1 - 6)) + 58? 53 What are the prime factors of -217/204-169158? 11, 233 Suppose -u + 94y = 90y - 14809, 2u + 3y - 29585 = 0. What are the prime factors of u? 14797 Let m = -30 + 35. Suppose mr - 5c = 1130, -c + 489 + 647 = 5r. List the prime factors of r. 227 Suppose 6t - 4f - 336 = 2t, -4f - 249 = -3t. Let d = t - 65. List the prime factors of 11/d - 5/4-50. 3, 7 Suppose 0 = -5w + 2a + 23, 4w + 3 = -2a + 25. Suppose wt + 2c = 4950, -23t - 5c = -18t - 4935. What are the prime factors of t? 2, 31 Suppose 4662 = 20r + 22r. Suppose 3s = -5z + 1950 - r, -3z - 9 = 0. What are the prime factors of s? 2, 3, 103 Let v be (-128)/(-10) + (-12)/15. List the prime factors of 2/v2 - 425/(-3). 2, 71 Suppose -16p + 12p + 12 = 0. Suppose -5c - 7 = p. What are the prime factors of (3 - 16)(c - 3)? 5, 13 Let i be (-6)/8 - (-525)/140. Suppose 75 = 4a + q, a - 5q + 0 - 3 = 0. Suppose -io + 3 = -a. What are the prime factors of o? 7 Let u(l) = -l3 + 5l + 2. Let v be u(3). What are the prime factors of (-195)/78296/v? 2, 37 Let r = -2 + 10. Suppose -a - r = 2s - 4s, 2 = 5s + 2a. Suppose 6 = -3p, -sp = -5x + x + 496. What are the prime factors of x? 3, 41 Suppose 5d - 9 = -3c + 2d, 2d = 3c - 19. Suppose -4l = -3z + 443, -5z = 3l - l - 695. Suppose 36 - z = -cs. What are the prime factors of s? 3, 7 Let n(a) = -a*3 - 10a*2 + 37a - 13. Suppose 2p - 7v = -4v - 38, -5v - 19 = 3p. List the prime factors of n(p). 13 Suppose 0u + 85627 = 2u + 1249. List the prime factors of u. 3, 7, 41 Let s(m) = 33m + 44. Let u(p) = 34p + 45. Let a(n) = 4s(n) - 3u(n). What are the prime factors of a(15)? 491 Let q(h) = -14h - 40. Let w be q(-4). Suppose -wp + 22260 = 548. What are the prime factors of p? 23, 59 Suppose 4m + 3z = -1, 3m + z + 9 = -4z. Let t(i) = 1 - 1 - 9i*3 + 7i + 8i3 + im. What are the prime factors of t(3)? 3 Let r(u) = -92u + 12. Let p be r(-3). Let d = 130 + 111. Suppose 4x + 47 = 3b - d, p = 3b + x. List the prime factors of b. 2, 3 Let s(k) = -k3 + 7k*2 - k + 4. Let p be s(8). Let a = -68 - p. Suppose aj + 2j = 318. List the prime factors of j. 3, 53 Let j = 14541 + -8665. List the prime factors of j. 2, 13, 113 What are the prime factors of ((-1)/((-9)/7710))/((-52)/(-1794))? 5, 23, 257 Let c = 4304 - -811. List the prime factors of c. 3, 5, 11, 31 Suppose a - 15 = 4a + 5q, 0 = a - 3q + 5. Let p be 5/(a/(-15)3). Suppose -2w = 2r - 33 + 7, 2w - 19 = pr. What are the prime factors of w? 2, 3 Suppose 0 = -22s - 9 + 273. Let m(r) = 3r2 - 58. What are the prime factors of m(s)? 2, 11, 17 Let z = 181 - 126. Suppose 9g + 10 = z. Suppose 254 = gi - 86. List the prime factors of i. 2, 17 Let s = -69 + 69. Suppose -2t + 6 + s = 0. Suppose 213 = 4z + 5k, tz - 3k = 149 + 4. List the prime factors of z. 2, 13 Suppose -g = 5x - 13145, 19x + g = 15x + 10517. List the prime factors of x. 2, 3, 73 Suppose 4t = -h + 3h - 14, 3t - 5h - 7 = 0. Let v be (720/(-6))/(t/(-8)) + 0. Let b = v - -284. List the prime factors of b. 2, 31 Let o = -318 + 718. Let b be (3/4)/((-4)/o)1. List the prime factors of (15/b + (-4)/5)-164. 2, 41 Let t(f) = 17f*2 - 8f - 29. Let m be t(-7). Suppose 2g - m = 5u, -4g - u = -3g - 437. What are the prime factors of g? 3, 5, 29 Let t(d) = 5d2 + 6d - 36. Let m be (36/15)/(63/15 - 4). List the prime factors of t(m). 2, 3, 7 Suppose 27698 = 16c + 11008 - 22398. What are the prime factors of c? 7, 349 Suppose 0 = -f - 3y - 4, -6y = -2f - 3y - 8. What are the prime factors of (((-2035)/20)/1)/(1/f)? 11, 37 Suppose 293u - 2684004 = -1136574 + 3720417. What are the prime factors of u? 3, 13, 461 Let x(t) = t*2 + 9t - 5. Let n be x(-10). Suppose -4s = l + 23, -3s - nl - 22 = -9. List the prime factors of 4 + 20/s - 319/(-3). 107 Suppose 2r - 6r = 16. Let h(s) = -s2 - 2s - 6. Let y be h(r). What are the prime factors of (-1242)/y - (-10)/35? 89 Let u(d) = -20d + 1 - d3 + 574d*2 + 0 - 585d*2. Let p be u(-9). Suppose 0 = -2y + p - 3. List the prime factors of y. 2 Let f(m) = m*2 + 3m - 30. Let c be f(-7). What are the prime factors of 1082/2 - 25/10c? 2, 3, 7, 13 Let z be ((-13)/(91/12))/(2/(-7)). Suppose -zl = 530 - 3074. What are the prime factors of l? 2, 53 Let y = 0 + 85. Let f(a) = 25 - 9a - a - y. List the prime factors of f(-11). 2, 5 Suppose -3s = 2a - 10, -4s + 18 = -a - a. Suppose -sf + 240 = 2g, 2g = f + 4f + 258. What are the prime factors of g? 2, 31 Let a = 180 + -180. Suppose 36i - 33i - 1212 = a. List the prime factors of i. 2, 101 Suppose -898821 = -96f + 399003. List the prime factors of f. 11, 1229 Let g = -4293 - -18037. Suppose -g = -15v - 889. What are the prime factors of v? 857 Suppose 22q - 19q + 1047 = 0. Let j = q - -614. What are the prime factors of j? 5, 53 Let m = 179234 - 121637. List the prime factors of m. 3, 73, 263 Let b(m) = 11m - 25. Let c be b(5). Suppose 5v - c = -5s, s + 3v - 10 = -s. Let y(f) = 3f + 20. What are the prime factors of y(s)? 2, 11 Let k be ((-114)/((-12)/(-4)))/(4/(-6)). Suppose kg - 1316 = 53g. List the prime factors of g. 7, 47 Let k = 126820 + -58349. List the prime factors of k. 13, 23, 229 Suppose -7f + 5 = -9. Suppose 0 = -5d - 5, 0 = fo + 2o - 4d - 1676. List the prime factors of o. 2, 11, 19 Let y(h) = 3h2 + 39h + 2209. What are the prime factors of y(54)? 13063 Let p = -13327 + 31545. List the prime factors of p. 2, 9109 Let d(u) = 2u3 - 5u*2 + 13u - 9. Let q = 545 + -540. List the prime factors of d(q). 181 Let m(l) = 9l2 + 13l - 14. Let u(b) = 4b2 + 7b - 7. Let i(y) = 3m(y) - 7u(y). Let w be i(-6). Let x = 62 + w. What are the prime factors of x? 3, 31 Suppose -8k = -u - 3k + 124, -4k - 528 = -4u. Let l = 107 + -153. Let q = u + l. List the prime factors of q. 2, 11 List the prime factors of (-184658)/(-7) - 92/(-1127)7/2. 2, 5, 1319 What are the prime factors of 2933 + (2 - (4 - -2))? 29, 101 Suppose -h = -19w + 21w - 7255, -3w - 3h + 10875 = 0. List the prime factors of w. 2, 3, 5, 11 Suppose -4t = 137724 + 38772. List the prime factors of 2/((-88)/t) + 2/11. 17, 59 What are the prime factors of ((-14)/8 - (-9)/(-6 + -30)) + 530? 2, 3, 11 Let m(q) = 2q2 - 165q + 3365. List the prime factors of m(83). 2, 431 Let a(j) = -3j3 + 9j*2 - 3j + 17. Let f be a(8). Let u = -660 - f. List the prime factors of u. 307 Suppose 132 = -4l + l. Let x(m) = m2 - 16m - 11. Let b be x(15). Let a = b - l. List the prime factors of a. 2, 3 Let d(j) = -2831j - 3336. List the prime factors of d(-14). 2, 18149 Let c be ((-7)/5)/((-6)/30). List the prime factors of (-2)/c + 60/14 - -967. 971 Let n(q) = -q3 + 36q*2 + 69q - 63. What are the prime factors of n(36)? 3, 269 Let s(t) = 131t2 - 65t + 186. List the prime factors of s(3). 2, 3, 5, 13 Let u be (324/15 + 2)/(14/(-420)). Let v = u - -1381. List the prime factors of v. 673 Let p(y) = 4y2 + 7y - 11. Let f be p(-3). Suppose 10x - fx = 2454. What are the prime factors	{ "pile_set_name": "DM Mathematics" }
osest to -3 in 13, -1/13, -1/2, -24/7? -24/7 Which is the nearest to 1? (a) 4 (b) -13 (c) 0.2 (d) -4 c What is the nearest to -2/7 in -22, -1.6, 2/17, -1/3? -1/3 What is the closest to -0.1 in 5, 0.37, 3/371? 3/371 What is the closest to -4 in 0.5, -1/2, 0.31, -7? -7 What is the closest to -0.046 in 10.6, 2/5, 4? 2/5 Which is the nearest to 0? (a) 0.3 (b) -1.2 (c) -0.2 (d) -63 c What is the closest to 1/3 in 0.01, -46/853, 4, 1/3, -4? 1/3 Which is the nearest to 0? (a) 2/9 (b) 32 (c) 1/28 (d) 0.5 c What is the nearest to 3/50 in 0.1, 0.4, 3, 4, 1/2? 0.1 Which is the nearest to -1? (a) -12 (b) -2/15 (c) -0.2 (d) -106 (e) 2/13 c What is the closest to 0.03 in -0.5, 2/3, 0.31, -0.4? 0.31 What is the closest to -20 in 1, 245, -0.2? -0.2 Which is the nearest to -0.07266? (a) -0.2 (b) 0.02 (c) -0.3 b What is the nearest to 0.1 in -1/3, -0.03, -477, -0.1, -3? -0.03 Which is the closest to 0? (a) -3 (b) 4/147 (c) -2/7 (d) -6.7 (e) 0.2 b Which is the nearest to 1/11? (a) -3 (b) 21 (c) 3 (d) -2/5 d Which is the closest to 0? (a) -11 (b) -1073 (c) 6 c What is the closest to 1.3 in 10, -0.4, 2, 1/7, -314? 2 Which is the nearest to 1? (a) 0.2 (b) -1 (c) 1673 a What is the closest to 10/733 in -1/4, -3, -1, 4/7, 1/4? 1/4 What is the closest to 1/4 in 4, -2/7, -1/2, -26, -5? -2/7 What is the closest to 27/2 in 2/45, 2/7, -2, -5? 2/7 Which is the closest to -1? (a) 4 (b) -1/4 (c) 5.3 (d) 4/5 (e) -1.19 e Which is the nearest to 2? (a) 12 (b) -1/6 (c) 2.5 c Which is the closest to -12? (a) -5 (b) 2/3 (c) -1/5 (d) -1.75 (e) 2/9 a Which is the closest to 1? (a) 2/17 (b) 0.1 (c) 54/7 (d) 2 (e) 4 a What is the closest to 8/11 in 8, -1/5, -2/309? -2/309 What is the closest to -1 in 2, 783, -0.4, 3/41, -3? -0.4 Which is the nearest to 4? (a) 0.4 (b) -413 (c) 4 (d) 1/4 c Which is the nearest to 2/7? (a) -0.2 (b) 118 (c) -50 (d) 0.1 d What is the closest to -2/3 in 0.1, -1, 60177? -1 What is the nearest to 102053 in -5, 0.5, 1/4? 0.5 What is the closest to 0.3 in 134, -0.1, -0.3, -0.4, -0.5? -0.1 Which is the closest to 2? (a) 3 (b) -0.3 (c) -1/2 (d) -18/13 (e) -7 a What is the closest to 2/9 in 2.5, -0.7, 3, 19/9? -0.7 What is the closest to -1 in 4, -14.4, -3? -3 Which is the closest to 0.065? (a) 0.2 (b) -0.21 (c) -37 (d) -4/3 a Which is the closest to -1/7? (a) 1/7 (b) -0.5 (c) -5.936 (d) -5 a Which is the closest to -0.1? (a) -46 (b) -4 (c) 16 (d) 3 (e) 5/3 e Which is the nearest to 0.2? (a) 5 (b) -0.38615 (c) 0.1 (d) 0.2 (e) -4 d What is the nearest to -3.1 in -1, 8, 2/11, -4/27, -2/17? -1 What is the nearest to -0.2408 in 2/7, 0.4, -0.2? -0.2 What is the nearest to 4242 in -26, 0.3, -5? 0.3 Which is the closest to -0.4? (a) -3 (b) 2/3 (c) -2/103 (d) -0.27 d Which is the closest to 0.03? (a) -1/4 (b) 2377/4 (c) -2 a Which is the nearest to 0.367? (a) 4/17 (b) 3 (c) -0.4 a Which is the nearest to -1? (a) 0 (b) -1/4 (c) -10.96 (d) 2/3 b What is the nearest to 704 in -0.1, -0.04, -2, 1/3? 1/3 What is the closest to 0.1 in -1510, 2, 3? 2 Which is the closest to -1? (a) -1 (b) 4 (c) -1/4 (d) -20 (e) -52 a What is the nearest to -1/3 in 1, -135, 6, 19? 1 What is the nearest to 2 in -0.2, 801, 1, -5? 1 What is the closest to -0.1 in 50532, -1/4, 1/8? -1/4 What is the closest to 1/4 in 0.08, -151, -3? 0.08 What is the closest to 0 in -1, 4/5, 0.04, 3/4, -37? 0.04 Which is the closest to 241? (a) 0.4 (b) 20 (c) 2/13 (d) 4 b What is the closest to 2/5 in 2, -3, -0.9, 26? -0.9 Which is the nearest to -1? (a) 5 (b) 3 (c) -0.2 (d) 0 (e) -495/38 c Which is the nearest to 0? (a) 69 (b) -2 (c) -5 (d) -1 d Which is the closest to 452? (a) -5/7 (b) 2/9 (c) -0.4 (d) -0.13 b Which is the closest to -0.15? (a) 0.3 (b) -27/121 (c) -4 b What is the closest to -2 in -0.3, 0, 7.77, 0.1? -0.3 Which is the closest to 0.2? (a) 3 (b) -506 (c) 0 c What is the nearest to -12/5 in 2, 6, 200? 2 What is the closest to -81.7 in -4/7, 6/29, 0.5, 2? -4/7 Which is the closest to 1? (a) -0.2 (b) -1/12 (c) -5 (d) 5 (e) -4/9 b What is the closest to -2 in -5/2, 2/3, 2256, 4/7? -5/2 What is the nearest to -1 in 2/7, 36850, 0.1, 0.09? 0.09 Which is the closest to 0.1? (a) -1/3 (b) -79 (c) -52 (d) 0 d What is the closest to 383 in -1, 5, -0.5, -0.16, -1/4? 5 Which is the nearest to -2? (a) 5 (b) 15938 (c) -1/4 c Which is the closest to 10? (a) -283/6 (b) 2/5 (c) -0.4 b What is the closest to -2/7 in 2/5, 1/148, 100/7? 1/148 Which is the nearest to 8? (a) 1 (b) 73 (c) -5 a Which is the closest to -0.1? (a) -4 (b) -15 (c) 0 (d) -0.3 (e) -61 c What is the nearest to 2 in -0.05, -1/4, 100, -2/9? -0.05 Which is the closest to -3? (a) 0 (b) -2 (c) -3/5 (d) -5 (e) 4/5 b Which is the nearest to 0.1? (a) 1/33 (b) -0.3 (c) 27 (d) -0.9 (e) 0.3 a Which is the nearest to 0.1? (a) 1284/7 (b) 1/4 (c) 3 (d) -17 b Which is the nearest to 2/11? (a) -75 (b) 0.4 (c) -2/9 (d) 0.3 d What is the closest to 2 in 0, -2/3, 164, -11? 0 What is the closest to 5 in -81, 0, 5? 5 Which is the closest to -0.1? (a) -2 (b) -0.3 (c) 34 (d) -0.1 d What is the nearest to -3 in 2/9, 10/531, 26? 10/531 Which is the nearest to -1.2? (a) -0.33 (b) -4 (c) 0 (d) 11 (e) -3 a What is the closest to 20/3 in -0.104, -4, 135? -0.104 Which is the closest to 0? (a) 24 (b) 111 (c) -5 (d) 2 d Which is the closest to 1? (a) -3/8 (b) -2/5 (c) 0.4 (d) 5655 c Which is the closest to -5? (a) 1 (b) 0.5 (c) 6/161 c What is the closest to -5 in -1/2, 31, 4? -1/2 Which is the nearest to 0.2? (a) -0.041 (b) 11 (c) -1/4 (d) 0.5 a What is the nearest to 0.1 in 10417, 4, -0.1, -3/7? -0.1 Which is the nearest to -1025/4? (a) 1/5 (b) 1 (c) -1/2 (d) 1/4 c What is the closest to 0.7 in 1.5, 2/3, -4/5, -4, -0.09? 2/3 What is the nearest to 1/4 in 2/13, -0.1, -342, -1? 2/13 Which is the closest to -0.8? (a) 4 (b) -2/23 (c) 16 (d) -4.5 (e) 1 b What is the nearest to -1/3 in 2, -1.28, -37? -1.28 Which is the closest to -2/3? (a) 2/23 (b) -0.10961 (c) 0.1 (d) 0.2 b Which is the closest to -2/7? (a) 0.0344 (b) 0.3 (c) -327 a What is the closest to 2 in 7, 1/7, 10/7, 0.1, 3? 10/7 Which is the closest to -1/3? (a) 5 (b) 4 (c) -31/23 (d) -4 (e) 3 c Which is the nearest to 0? (a) -0.5 (b) -2/9 (c) -1/5 (d) 8492 c What is the closest to 0.1 in 71, 1, -1/2, 299? -1/2 What is the closest to 0 in 5, 2.8, -48/19? -48/19 Which is the nearest to -0.4? (a) 5 (b) 0.17 (c) -4 (d) -155 b What is the closest to -380 in -85, 2/7, 0.6? -85 Which is the nearest to -5? (a) -4 (b) 3/8 (c) 31 a Which is the closest to -1/4? (a) 65 (b) -2 (c) 43 (d) 4/7 (e) 0.1 e What is the nearest to 0.5 in 0.4, 2/3, 44, -1/4? 0.4 Which is the closest to 5.5? (a) -5 (b) -10 (c) 2 (d) -14 c Which is the nearest to -5.09? (a) -27 (b) -0.4 (c) 6 b What is the closest to -0.2 in -4/3, 0.1, -193.8, -4? 0.1 What is the closest to 11 in -0.4, 0.6, -10.3? 0.6 Which is the nearest to 1? (a) -0.5 (b) -0.339 (c) -5 b Which is the closest to -3? (a) -5 (b) -0.3 (c) 8401 a What is the closest to 16 in 1/3, 19, -35? 19 What is the closest to -3/8 in 2, -882, 0.3, 0? 0 Which is the nearest to -1? (a) 3 (b) 4/13 (c) 20704 b What is the nearest to -144 in -1, -0.4, -1/2, 2/9, -1/10? -1 Which is the nearest to 0.1? (a) -1/2 (b) -4 (c) 0.04 (d) 17/7 (e) 4 c Which is the closest to -1? (a) 477/2 (b) -1 (c) -15 b What is the nearest to 3/20 in 4, -13, -4, -2, 7? -2 Which is the closest to -6? (a) 1/54 (b) 3/7 (c) 3 (d) 5 (e) 26 a What is the closest to -0.1 in 48, 1/2, -18? 1/2 Which is the nearest to -7? (a) 2 (b) 180.7 (c) -1.1 c Which is the nearest to 0.5? (a) -0.1 (b) -3 (c) 2 (d) 10/29 d What is the closest to -1 in -3, -3.72, -9/7? -9/7 What is the nearest to 103/14 in 0.4, 0, 5, -36? 5 Which is the closest to 2? (a) 3/4 (b) 21 (c) 1 (d) -3 c Which is the nearest to 1/5? (a) 56 (b) 0 (c) -0.076 b Which is the closest to 1? (a) 4 (b) 20 (c) 0.2 (d) -47 c What is the closest to 5 in 28, -1/5, 1, -1.6? 1 Which is the nearest to 3? (a) 3 (b) -305 (c) -5 (d) -4 a What is the nearest to -2 in -4, 4, -2/167, 6? -2/167 What is the closest to 2/61 in 1, -4/121,	{ "pile_set_name": "DM Mathematics" }
)(h + 165321)2/5 Factor 24s*2 + 1541828s + 5909988. 4(s + 64239)(6s + 23) What is y in -y2/4 - 6676923y/2 - 44581300747929/4 = 0? -6676923 What is c in c*2/2 + 783871c + 39192925/2 = 0? -1567717, -25 Factor -q*3/4 - 379713q*2/2 - 4556529q/4 - 1708695. -(q + 3)*2(q + 759420)/4 Factor -3r2 + 181437r - 13228914. -3(r - 60406)(r - 73) Factor -34t2 - 2668828t/5 + 31398/5. -2(t + 15699)(85t - 1)/5 Suppose 5n*4 + 52065n*3 - 1776545n*2 - 5798085n = 0. Calculate n. -10447, -3, 0, 37 What is m in 3m3/5 - 10068m*2/5 - 67620m + 17558263296/5 = 0? -1152, 2254 Find a such that -a*5/5 - 759392a*4/5 - 144169052403a*3/5 + 9872108a*2/5 + 1874206794112a/5 + 1730028628992/5 = 0. -379696, -3, -1, 4 Suppose -4l4/3 + 3416l*3 + 233328l*2 - 44547208l/3 - 15078980 = 0. What is l? -105, -1, 41, 2627 Solve 2n2/13 + 28914n/13 + 89689300/13 = 0. -9950, -4507 Factor -5p2 - 2687220p - 361057566420. -5(p + 268722)2 What is f in -4f*3 - 62044f*2 + 1242404f - 1180356 = 0? -15531, 1, 19 Determine r, given that 5r4/3 + 503375r*3 - 3020270r*2/3 = 0. -302027, 0, 2 Factor 4j*3/5 + 52996j*2/5 + 180791468j/5 + 34550217548/5. 4(j + 203)(j + 6523)*2/5 Factor -75i*2 - 18415i + 8610. -5(i + 246)(15i - 7) Factor g3/5 - 112326014g2/5. g2(g - 112326014)/5 Factor 5g*3 + 665705g*2 - 15979080g + 95878800. 5(g - 12)2(g + 133165) Solve 4x4 - 3181710x*3 + 632707294034x*2 - 949055373066x + 316351260738 = 0 for x. 1/2, 1, 397713 Determine v so that -7584v4 + 181989v*3 - 1455480v*2 + 3877824v + 13824 = 0. -9/2528, 8 Suppose 3w2 + 228129w - 18726750 = 0. Calculate w. -76125, 82 Let a*3/5 - 10861a*2 + 434392a/5 - 868752/5 = 0. What is a? 4, 54297 Let p*4/5 - 10597p*3/5 + 74126p*2/5 + 42388p/5 - 59304 = 0. Calculate p. -2, 2, 7, 10590 Factor 5m3 - 30230m*2 + 992595m - 2705850. 5(m - 6013)(m - 30)(m - 3) Let 2b*2/7 - 126858b/7 - 761220/7 = 0. What is b? -6, 63435 Solve -5z2 - 19066285z + 57198900 = 0. -3813260, 3 Solve 3n3/8 + 2335869n*2/4 + 14015193n/8 + 4671729/4 = 0. -1557243, -2, -1 Find a, given that 7a4/10 + 69109a*3/10 + 197334a*2/5 - 59202a/5 = 0. -9867, -6, 0, 2/7 Determine o, given that 6o3/5 - 1466119o*2/5 + 244353o/5 = 0. 0, 1/6, 244353 Solve -14l3 + 8336l*2 + 1249966l - 4383024 = 0 for l. -127, 24/7, 719 Find p such that 2p5/7 - 814p*4/7 + 19910p*3/7 - 37386p*2/7 + 18288p/7 = 0. 0, 1, 24, 381 Suppose -2u2/3 + 812u + 191216/3 = 0. Calculate u. -74, 1292 Solve -4v2/3 + 472880v/3 + 630528 = 0. -4, 118224 Solve -3x5 - 180x*4 + 29277x*3 + 1619994x*2 - 27516384x + 25867296 = 0. -84, 1, 13, 94 Factor -2k3/15 - 19726k*2/15 - 18992222k/15 - 1607803462/5. -2(k + 523)2(k + 8817)/15 Suppose -5v2 + 226530110v - 2565794536830605 = 0. What is v? 22653011 Factor 4u4/7 - 221749700u*3/7 + 4097744046924264u*2/7 - 3605846948918076207312u - 25240932740170802125152/7. 4(u - 18479142)3(u + 1)/7 Factor -g*4/8 + 3826401g*3/8 + 26784905g2/4. -g2(g - 3826415)(g + 14)/8 Suppose 8r4/17 - 28398r*3/17 - 693126r*2/17 - 822020r/17 = 0. What is r? -23, -5/4, 0, 3574 Suppose 10617z2 + 262388536z - 49428 = 0. Calculate z. -24714, 2/10617 Factor 2j4 - 162974j*3 + 4642986576j*2 - 51518062321280j + 151291238388694016. 2(j - 25672)3(j - 4471) Factor 2n4 + 70772088n*3 + 834781477418700n*2 + 3282180734671273801208n + 9846534690982435481538. 2(n + 3)(n + 11795347)*3 Determine a, given that 3a*4 - 361762146a*3 + 10905986799686127a*2 + 43623951539890356a + 43623952986938988 = 0. -2, 60293693 Suppose -2x4/9 + 34824x*3 - 12285277882x*2/9 + 171818004412x/3 - 109085491360 = 0. What is x? 2, 40, 78333 Solve 2y5 + 3362y*4 + 756925y*3/2 + 1471062y*2 + 2377791y/2 + 273780 = 0. -1560, -117, -3, -1/2 Factor 4u3 - 269460u*2 - 7547632u - 25878912. 4(u - 67393)(u + 4)(u + 24) Factor -2t*2/5 - 208265402t/5 - 41653080. -2(t + 1)(t + 104132700)/5 What is o in 2o2/19 + 1130o - 218500 = 0? -10925, 190 Find z, given that 3z2 + 572421z - 3434634 = 0. -190813, 6 Solve -o*4/7 - 13425o*3/7 + 40353o*2 + 1411705o/7 - 1680750/7 = 0. -13446, -5, 1, 25 Solve -2m5 - 155618m*4/3 + 15264418m*3/9 - 139029010m*2/9 + 234132272m/9 - 109900808/9 = 0 for m. -25969, 1, 46/3 Let -13a4/5 - 56882a*3/5 - 153653a*2 - 2411892a/5 + 1282428/5 = 0. What is a? -4362, -7, 6/13 Factor 5a3 + 28060a*2 + 3905085a - 28712250. 5(a - 7)(a + 150)(a + 5469) Let -3c*3 - 654c*2 + 3333c - 2676 = 0. What is c? -223, 1, 4 Suppose -2p5/5 - 358p*4/5 - 6114p*3/5 + 245878p*2/5 + 251636p/5 = 0. Calculate p. -154, -43, -1, 0, 19 Let -p*4 - 4805p*3 + 115896p*2 = 0. Calculate p. -4829, 0, 24 Find s, given that -4s*3 - 2931524s*2 - 11726048s - 11726032 = 0. -732877, -2 Suppose -2i2 + 239920i - 17743128 = 0. What is i? 74, 119886 Factor -5p4 + 49760p*3 - 9285570p*2 + 582490440p - 12206044305. -5(p - 9763)(p - 63)*3 Let 169g*4/2 + 2111967g*3/2 + 15660769g*2 + 26213136g + 11683152 = 0. What is g? -12482, -13, -12/13 Suppose -1922l5/9 - 3066272l*4/9 + 1978840l*3/9 - 106400l2/3 = 0. What is l? -1596, 0, 10/31 Factor -i2 - 224991i - 9447858. -(i + 42)(i + 224949) Determine k so that 2k3/9 - 394k*2/3 + 54100k/9 = 0. 0, 50, 541 What is j in 3j4/4 + 263101j*3/2 - 1754067j*2/4 - 2367949j/2 + 438510 = 0? -175404, -2, 1/3, 5 Factor -5d3 + 8450d*2 + 1144080d. -5d(d - 1816)(d + 126) Solve 2h*2 + 178455984h + 3980817278176032 = 0 for h. -44613996 Solve 3n2/5 + 137847n/5 - 689610 = 0. -45974, 25 Find f, given that 28f5 - 447084f*4 + 3256316f*3 - 7597332f*2 + 5937192f - 1149120 = 0. 2/7, 1, 3, 15960 Let 2n3 + 1374n*2 - 12500n + 19488 = 0. Calculate n. -696, 2, 7 Solve -29282k5/3 + 4665276k*4 + 85702598k*3/3 - 96385744k*2/3 - 1085432k - 27104/3 = 0 for k. -7, -2/121, 1, 484 Factor 4m3 + 533028m*2 + 17818302432m + 4052486771536. 4(m + 229)(m + 66514)*2 Factor -2k*3/7 + 1275234k*2/7. -2k*2(k - 637617)/7 Determine r so that 5r3 + 59542970r*2 + 177268263821045r = 0. -5954297, 0 Find y such that -y*2/3 + 10980692y/3 - 30143899199716/3 = 0. 5490346 Find n such that -n*4/2 + 34151n*3/2 - 331647567n*2/2 + 658850999913n/2 = 0. 0, 2657, 15747 Let 2h2 + 38667464h - 77334936 = 0. What is h? -19333734, 2 What is i in 5i5 - 4300i*4 + 1039980i*3 - 47982800i*2 - 4160000i + 192000000 = 0? -2, 2, 60, 400 Let -a*2/3 - 779095a/3 - 259698 = 0. What is a? -779094, -1 Factor -h*3 + 1946h*2 + 49780h - 1156651400. -(h - 1310)*2(h + 674) Find b such that 4b5 - 8640b*4 + 34472b*3 + 51760b*2 - 34476b - 43120 = 0. -1, 1, 5, 2156 Factor c*2 - 83680286c + 1750597566260449. (c - 41840143)2 Find r, given that r3 + 463r2 + 52699r + 437517 = 0. -281, -173, -9 Factor 578g3/9 + 2176g*2/9 - 1036850g/3 + 9337708. 2(g + 86)(17g - 699)2/9 Solve -3y*2/2 - 386369910y - 24880284558901350 = 0. -128789970 Determine h, given that 2h4 + 250h*3 + 8452h*2 + 60272h + 88704 = 0. -72, -44, -7, -2 Determine k so that -4k2 - 2124101712k - 281988005182583184 = 0. -265512714 What is a in -15a5 - 15125a*4 + 546310a*3 - 1502400a2 = 0? -3130/3, 0, 3, 32 Let a4 - 6307a3 + 56705a*2 - 144869a + 94470 = 0. What is a? 1, 3, 5, 6298 Factor d*2/7 - 108045724d/7 + 2918469618671044/7. (d - 54022862)*2/7 Determine s so that -5s*2 + 1629105s + 347226210 = 0. -213, 326034 Suppose -2331z5/5 - 6983z*4/5 + 16347z*3/5 + 6979z*2 - 42108z/5 + 36 = 0. What is z? -3, 10/2331, 1, 2 Find f such that f*4 + 1689856f*3 + 713888116218f*2 - 12850565719048f - 13564452145411 = 0. -844937, -1, 19 Factor 2l2 + 32100l - 6039792. 2(l - 186)(l + 16236) Factor -2j2/11 - 17638592j/11 + 35277192/11. -2(j - 2)(j + 8819298)/11 Suppose 2j4/7 + 81300j*3/7 + 835507850j*2/7 + 188953395000j/7 + 10803346445000/7 = 0. What is j? -20210, -115 Factor -2d2/13 + 600204d/13 - 30605202/13. -2(d - 300051)(d - 51)/13 Find o, given that -5o2 + 1097965o + 57107700 = 0. -52, 219645 Determine x	{ "pile_set_name": "DM Mathematics" }
-36)(-24)/10. Let a = -84 - -96. Let p be 3(3 + 16/a-3). Which is bigger: p or k? p Let o be -212 + 1392 - (2 - -5). Which is smaller: 1181 or o? o Let k be (0/(55/(-30) + (-20)/(-24)))/(-2). Is -67/148 bigger than k? False Suppose -v - 4 = -2n, 5v - 3n = -7 - 20. Let u be v + (6 - 4/(-1298)). Which is smaller: 1 or u? u Let u = 1832/11 + -167. Is -3/25 at most u? False Suppose 3v + 4r = 9, 0 = 3v + 3r + 2r - 9. Suppose 0w - w - 22 = -j, -vw - 76 = -j. Let d = -20 + -9. Which is smaller: d or w? d Suppose 5x - w - 5 = 4w, -2x + 5w = -11. Let f be 1 - 22x/(-52). Suppose i + 4 = 2k, -3i - 2i = 3k - 6. Do i and f have different values? True Suppose 3 = -4n - 77. Let j = -1121 + 1116. Let c be (-4)/n - 19/j. Which is bigger: 5 or c? 5 Suppose 3i + 32 = 4b, -2b + 7b = -i + 21. Let l be 8/(-20) + (-2)/(-5). Suppose lm + bc + 26 = m, -m - c = 4. Which is smaller: -2/25 or m? -2/25 Suppose -1069z + 1104z = -315. Let y = -10 - -1. Are y and z equal? True Let v = 0.6 - -0.4. Let l = -21960 + 21888. Which is greater: v or l? v Suppose 1015 + 774 = -8j + 477. Suppose 5o + 818 = -0w - w, -480 = 3o - 3w. Which is greater: o or j? o Suppose 33l = -105l - 746 - 496. Which is smaller: l or 164? l Suppose 0 = 17w - 7w - 120. Let o(i) = i*2 - 4i + 6. Let q be o(3). Let t be ((-1)/(-2))/(q/84). Which is smaller: t or w? w Let m(a) = -3a - 2. Let l be m(-3). Let g(i) be the first derivative of -3i*2/2 + 17i - 1607. Let d be g(l). Are d and 1 nonequal? True Let m = 288959/471 - -255841247/61701. Let z = m + -4760. Which is bigger: z or 1? 1 Let q = -12265/18923863 + -2/14819. Let c = 3779/66404 - q. Let p(l) = 5l2 - 102l + 385. Let m be p(5). Which is greater: m or c? c Let z be (6134/(-40))/(270/120) - 6/(-10). Which is smaller: z or -67? z Let h = 9.12 + -9. Let v = h + -0.02. Let b = -9.98 - -12.08. Which is smaller: v or b? v Let a be (-29 + 21)(130/4 + -2). Let u = a - -245. Which is bigger: -1/545 or u? u Let l(x) = -2x*2 - 146x + 1659. Let w be l(10). Which is bigger: w or 2/3167? 2/3167 Let f = -36 - -51. Suppose 4v + f - 31 = 0. Suppose 3c - 31 = -vu, 0 = c - 3c + 4u + 34. Is c greater than 13? False Let m(h) = h2 - 6h - 79. Let x be m(10). Let t = -34 - x. Which is smaller: t or 6? t Let n = 659909/4 - 165984. Which is greater: n or -1006? -1006 Let o = -428 + 440. Let p(v) = -v*3 + 14v*2 - 25v + 11. Let l be p(o). Are l and -2/59 nonequal? True Let o be ((-70)/(-245))/(2/(-42)) + 1336/161. Does o = 3? False Suppose -3h + 3 - 12 = 0. Let b be 19 + (5 - 6) + -9. Let n be 1b/h - -2. Which is smaller: -3/7 or n? n Suppose 3b - 3i + 296 = 110, 3b - i = -178. Is b less than -66? False Let u = 1.6 - 18.6. Let b = -18 - u. Let m = 26 - 184/7. Which is greater: b or m? m Let x = -166.4 - -138.4. Let d = 3/34 + 47/238. Is d > x? True Suppose -134k + 7038 = -332. Is 394/7 < k? False Let m be ((-4490)/(-145) - 16) + (2 - 13). Is -1/3 < m? True Let u = -47/18 - -10/9. Suppose -3k + 5k + 3q = -68, -4q = -5k - 193. Which is greater: k or u? u Let u = 234908/17 - 13816. Let k = 2 + -1. Which is smaller: k or u? k Let n be ((-2)/20)/(204/(-20)). Let l = 104894 - 104893. Which is smaller: n or l? n Suppose 1224 = -18g - 10g - 4488. Is g greater than -202? False Let l be ((-31)/62-5)/(503/(-2)). Is l smaller than 1? True Let b be 1382071/2355 + 2/15. Is 587 equal to b? True Let o be 10/2 - (-2 + 5). Suppose 5k + ox = 78, 3k - 12 = x + 26. Which is greater: 9 or k? k Suppose -4b - 2b = -24. Suppose -bq + 5v - 5 = 180, 2q + 4v = -86. Let y = -0.12 - -1.12. Which is bigger: y or q? y Let a = -223 - -235. Suppose 7 - 11 = -2c - 2n, -a = -4n. Which is smaller: -4 or c? -4 Suppose 18n - 17n = 0. Suppose -l + 5b = -nb - 14, 3b + 6 = l. Let x(c) = -c - 9. Let w be x(-2). Is l > w? True Let d(q) be the first derivative of q3/3 - 3q - 42. Let n be d(-3). Is 7 less than n? False Let n = -18807149/251 + 74929. Which is greater: -1 or n? n Let q(h) = h*3 - 5h*2 - 7h - 6. Let o be q(6). Let r be (-160)/(-300)4(3 + -2)-6. Which is greater: o or r? o Let g be (2 - 0) + -1 - (41 + 0). Let y be (-9)/6g/90. Let u be -1(-3)/(-6)-2. Which is smaller: u or y? y Let v be 0 - 1(-3)/3. Let l be (-236)/4130 - (0 + (-2)/10). Are v and l equal? False Let s = 281.51 - 283. Let x = 4.51 - s. Is x less than or equal to 23? True Let g = -22 - -45. Let d = g - 22.2. Let m = 0.6 - d. Which is smaller: 3/5 or m? m Let l = -6312 - -6734. Is l >= -1? True Suppose s = -3s - 1512. Let n be (18/33)/3 + s/990. Which is greater: n or 2? 2 Let n = -1.751 - -1.3. Let d = -383 + 382.9. Is d smaller than n? False Let b = -15 + 10. Let s = 113.164 + -0.164. Let c = -113.3 + s. Which is greater: b or c? c Let a be 1/(-5) - 3036/2420. Let v(w) = w + 6. Let g be v(-4). Let u be -3g/120. Is a > u? False Let k = -31189 - -31188. Which is greater: -33/413 or k? -33/413 Let t be 10/(-25)(-331 - 4)1. Let r = -111 + t. Which is smaller: 24 or r? r Suppose 0 = 6z + 2m - 4032, 0 = -3z - 0m - 4m + 2007. Do z and 673 have different values? False Suppose -5v - 5 = -5m, 3v - 4v - 1 = 2m. Let x = 896 + -31352/35. Is m bigger than x? False Suppose -429u + 792 = -357u. Which is greater: u or 20? 20 Suppose 0 = 7o + 116 - 3553. Is o bigger than 491? False Suppose -17o - 892373 - 504887 = 363o. Is o less than -3676? True Let r = -50 - -93. Suppose 42h - 1071 = rh. Let g be 544/h - 4/(-18). Which is greater: g or 1/29? 1/29 Let q(c) = -12c + 99c - 85c - 10c + 4. Suppose 10 = -f + 6f. Let o be q(f). Is -12 greater than o? False Suppose a + 42 = 5s, 42s - 16 = 4a + 41s. Is -92/81 bigger than a? True Let a(x) = 3x - 1. Let w be a(-1). Let y be 1 + w + -6 + 10. Suppose -2 = -4d + 6. Do d and y have the same value? False Suppose -2s - 161i + 166 = -157i, 9i + 415 = 5s. Which is smaller: s or 65? 65 Let f(r) = -3r - 2. Let z be f(-4). Suppose -5y = -5h - 95, -30h = -2y - 32h + 2. Is y greater than or equal to z? True Let d = -14 - -10. Let y be d/(80/116) - -3. Suppose -5u - 6 = 3f, -3u + 26 = -3f + 20. Do y and f have the same value? False Let o = -16903/29 - -583. Let p(m) be the third derivative of -m6/120 - m5/60 + m4/12 - m3/6 + 2m*2. Let b be p(1). Which is greater: o or b? o Let f = 6.76 + -799.82. Let o = 776 + f. Let p = 0.06 + o. Is -1 less than p? False Let k = -109 - -61. Let f = 70 + k. Suppose 3n + 4q - q = 9, 0 = 4q - 16. Which is greater: n or f? f Let k(h) = -9h3 + 55h*2 - 6h + 1. Let q be k(6). Let g = -0.19 - -0.28. Let w = g + -0.02. Which is greater: q or w? q Let z = -16503 - -16500.3342. Let f = 0.0342 - z. Is f != -1/4? True Let u be (12 + -102)/(-18)(0 + -1 - -50). Which is smaller: 1706/7 or u? 1706/7 Suppose -y - 4u = -8u + 34, -5y = -2u + 206. Let h be (-8)/(56/35) - y. Which is greater: 33 or h? h Let t be ((-465)/124)/(3/(-64)). Let c = -111 + t. Is -31 at least c? True Suppose -d = -4q + 17, 4d - 46 = -5q - 156. Suppose 29h - 24h = -145. Is d smaller than h? False Let s be -110 + 3 + -2. Let g = s - -3. Let o be (2(-115)/30 - -9)(-5 - -2). Is g at least o? False Let q be (1944/(-45))/(-9)1370/92. Which is bigger: q or 71? q Suppose 5m + 3 = -2, -3m = 5f - 7. Let o be 3/((-3)/f) - (-18)/9. Is o at least as big as -1/161? True Let s be (0/(-2))/(158/79). Which is smaller: s or 6/625? s Let n(r) = -r2 + 30r - 38. Let w be n(4). Is w less than 129/2? False Let v = -243 + 403. Let a be -3088/v. Is a less than -15? False Let s(k) = 175k - 3230. Let m be s(-4). Which is smaller: -3929 or m? m Suppose 3y + 48 = 7y. Let p be (2/4-2)/(y + -9). Let w = p - 1/15. Which is smaller: w or -1? -1 Suppose 20a - 19a + 5i = -13, 2i + 2 = -2a. Let x = 12 - 7. Let c = 5 + x. Is a <= c? True Let t = 74 - 70. Suppose -4m = 2v + 38, v = -tm + 3 - 32. Which is greater: v or -7? -7 Let y(t) = -t*3 - 6t*2 + 29t + 20. Let z be y(-9). Suppose 0 = -zf - 2, 14 + 13 = -4l + f. Let h be 139/(-20) + (-2)/8. Is h at most l? True Let s be -25(5 + -6) + -5. Suppose 4w = s, -5w + 30 = 5c + 5. Are c and 3/38 nonequal? True Let p(q) = q*2 + 14q + 134. Let m be p(-6). Suppose -z + 37 = -50. Which is greater: m or z? z Suppose x +	{ "pile_set_name": "DM Mathematics" }
6000 What is 0.00083851 rounded to five decimal places? 0.00084 What is -0.001543245 rounded to 4 decimal places? -0.0015 Round -0.26009 to three decimal places. -0.26 Round -0.00034061 to four dps. -0.0003 Round -11072.64 to the nearest 10. -11070 Round 184.50477 to one decimal place. 184.5 Round 0.014009853 to 4 dps. 0.014 What is 0.638986 rounded to 3 dps? 0.639 Round -0.045287429 to three dps. -0.045 What is 0.0000658118 rounded to seven decimal places? 0.0000658 Round -132394.13 to the nearest 10000. -130000 What is 0.0006504206 rounded to 4 decimal places? 0.0007 What is -0.0195216 rounded to four dps? -0.0195 Round -0.00002569 to five decimal places. -0.00003 Round 0.0184504 to 3 dps. 0.018 What is -0.1525849 rounded to 2 dps? -0.15 What is 33214.4 rounded to the nearest one thousand? 33000 Round -4.3584 to 1 dp. -4.4 Round -0.000042725 to 5 decimal places. -0.00004 Round 0.003679405 to 5 dps. 0.00368 Round 0.1904023 to two decimal places. 0.19 Round -2.196808 to one decimal place. -2.2 What is 348525.3 rounded to the nearest one thousand? 349000 Round -0.06325852 to three dps. -0.063 What is 0.00015957028 rounded to 7 dps? 0.0001596 What is -1.409377 rounded to 2 decimal places? -1.41 Round 0.008279515 to 4 decimal places. 0.0083 Round -43600900 to the nearest one hundred thousand. -43600000 Round -0.87323 to one decimal place. -0.9 What is -0.3030414 rounded to three decimal places? -0.303 Round -0.00001172562 to six decimal places. -0.000012 What is 3.640655 rounded to 3 decimal places? 3.641 What is 0.00000784561 rounded to 6 dps? 0.000008 What is -0.12226081 rounded to 4 decimal places? -0.1223 Round 0.00046729061 to six decimal places. 0.000467 What is 0.797143 rounded to one decimal place? 0.8 What is 1300.9293 rounded to zero decimal places? 1301 Round -0.000065674 to 6 decimal places. -0.000066 What is -1.464825 rounded to 2 decimal places? -1.46 Round -170248300 to the nearest 1000000. -170000000 Round -0.000003601575 to 7 dps. -0.0000036 Round -0.546297 to three decimal places. -0.546 Round 691461790 to the nearest 1000000. 691000000 What is 322137 rounded to the nearest ten thousand? 320000 What is -0.01924732 rounded to four decimal places? -0.0192 What is -11.08105 rounded to the nearest integer? -11 What is -0.000324164 rounded to six dps? -0.000324 What is 656816 rounded to the nearest 10000? 660000 What is -38.71321 rounded to the nearest ten? -40 Round 6362.22 to the nearest 10. 6360 Round 1.964875 to one decimal place. 2 What is 0.0037102172 rounded to 4 dps? 0.0037 What is 1.5741822 rounded to two decimal places? 1.57 Round -34359390 to the nearest one million. -34000000 What is 18.753559 rounded to the nearest integer? 19 Round 287.775 to zero dps. 288 What is -1.119328 rounded to one decimal place? -1.1 Round 0.00003946508 to 6 dps. 0.000039 What is -2741850 rounded to the nearest 100000? -2700000 What is 0.004054168 rounded to four dps? 0.0041 Round 3263594 to the nearest one thousand. 3264000 What is 91869.8 rounded to the nearest 100? 91900 Round -0.0006242011 to four dps. -0.0006 Round -0.0002331 to 3 dps. 0 Round -2818.6388 to the nearest 100. -2800 What is 0.0895217 rounded to three decimal places? 0.09 What is 0.00002020758 rounded to 6 decimal places? 0.00002 Round -9.90509 to zero decimal places. -10 Round -828804 to the nearest one hundred thousand. -800000 Round 0.042345217 to 4 decimal places. 0.0423 Round 584159 to the nearest 100000. 600000 What is -0.00002212269 rounded to 7 dps? -0.0000221 Round 149701.7 to the nearest ten thousand. 150000 What is 0.00004362255 rounded to 5 decimal places? 0.00004 Round -0.0001241755 to seven dps. -0.0001242 What is 24.905604 rounded to one dp? 24.9 Round 0.0002373054 to 7 dps. 0.0002373 What is -14247.863 rounded to the nearest 1000? -14000 Round 821.8098 to the nearest integer. 822 What is -0.00001882833 rounded to six decimal places? -0.000019 What is 0.0007900707 rounded to 7 dps? 0.0007901 What is 553147 rounded to the nearest 1000? 553000 Round 27393110 to the nearest 10000. 27390000 Round 0.155018 to three decimal places. 0.155 What is 10.2017 rounded to one dp? 10.2 Round -125365000 to the nearest one hundred thousand. -125400000 Round 10316800 to the nearest one million. 10000000 What is -0.00626724 rounded to three decimal places? -0.006 Round -1117289000 to the nearest 1000000. -1117000000 Round -4.289136 to 2 dps. -4.29 What is -17.88497 rounded to the nearest integer? -18 Round -1.9821829 to 1 dp. -2 Round -0.0013171557 to 5 decimal places. -0.00132 What is -3.08434 rounded to two dps? -3.08 Round -3082817.5 to the nearest ten thousand. -3080000 Round -0.0305606 to 4 decimal places. -0.0306 Round -18.054967 to the nearest integer. -18 What is 0.0000005554142 rounded to 7 dps? 0.0000006 Round -11040.45 to the nearest ten. -11040 What is -0.0000392417 rounded to 7 decimal places? -0.0000392 What is 24.45375 rounded to one dp? 24.5 Round 0.000012202593 to seven decimal places. 0.0000122 What is 2025630 rounded to the nearest ten thousand? 2030000 Round -25.57372 to 1 decimal place. -25.6 Round 0.91858 to two dps. 0.92 What is -582.253 rounded to the nearest integer? -582 Round 250.9848 to the nearest integer. 251 Round -171883900 to the nearest 1000000. -172000000 What is -9698670 rounded to the nearest one million? -10000000 What is 0.00003012606 rounded to six dps? 0.00003 Round -118.9428 to one decimal place. -118.9 What is 250.702 rounded to one dp? 250.7 What is 0.00011239819 rounded to seven dps? 0.0001124 What is 0.0000368044 rounded to five decimal places? 0.00004 Round 1.418711 to 3 dps. 1.419 What is 0.0245085 rounded to four dps? 0.0245 What is -331.18 rounded to the nearest one hundred? -300 What is -1183674.4 rounded to the nearest one hundred thousand? -1200000 What is 13.620811 rounded to one dp? 13.6 What is -1386853.48 rounded to the nearest ten thousand? -1390000 What is -0.03359 rounded to one dp? 0 What is 44674460 rounded to the nearest 1000000? 45000000 What is 945.54 rounded to the nearest ten? 950 Round -0.0011212535 to five decimal places. -0.00112 Round -21.111 to zero decimal places. -21 What is 92955.7 rounded to the nearest one thousand? 93000 What is 0.000000356216 rounded to seven dps? 0.0000004 What is 1.549438 rounded to two dps? 1.55 Round 128974.2 to the nearest one thousand. 129000 What is 39.95503 rounded to the nearest integer? 40 What is -9.553887 rounded to 2 decimal places? -9.55 Round -0.00817874 to 3 dps. -0.008 Round 0.0000047624447 to six dps. 0.000005 Round -3.778974 to 2 decimal places. -3.78 What is 81135 rounded to the nearest 10000? 80000 Round -8693911 to the nearest 1000. -8694000 What is -2498478 rounded to the nearest 1000000? -2000000 Round -15750.8 to the nearest 100. -15800 Round -0.000006727207 to six decimal places. -0.000007 What is -81.05 rounded to the nearest 10? -80 What is -0.00002618169 rounded to 7 decimal places? -0.0000262 What is -375.16 rounded to the nearest 10? -380 What is -0.059283688 rounded to 4 decimal places? -0.0593 What is -39.1577 rounded to zero decimal places? -39 What is 20.214 rounded to two decimal places? 20.21 Round 8330.734 to the nearest 100. 8300 Round 0.159966 to three dps. 0.16 What is -0.0061141 rounded to three dps? -0.006 What is -181245550 rounded to the nearest one million? -181000000 What is -0.00000088082 rounded to seven decimal places? -0.0000009 What is 1761.2701 rounded to the nearest integer? 1761 What is -1701.499 rounded to the nearest 100? -1700 Round -0.0005993486 to 5 decimal places. -0.0006 What is 0.00003391 rounded to four dps? 0 Round 0.000585132 to 5 dps. 0.00059 What is 0.31042893 rounded to three decimal places? 0.31 What is -0.000004919847 rounded to six dps? -0.000005 What is -101.8873 rounded to one decimal place? -101.9 What is 2398.79 rounded to the nearest integer? 2399 What is -122.0894 rounded to the nearest 10? -120 Round 1263.067 to zero dps. 1263 What is 0.00036287634 rounded to 5 decimal places? 0.00036 Round -0.000001057747 to seven decimal places. -0.0000011 What is -108661760 rounded to the nearest one hundred thousand? -108700000 What is 1361.1742 rounded to the nearest integer? 1361 What is 2807559.8 rounded to the ne	{ "pile_set_name": "DM Mathematics" }
= 36. Let c(v) = -4v + 7. Calculate jr(s) + uc(s). 2s + 1 Let w(j) = -6j2 + 33j - 31. Let s(c) = c*2 + c + 6. Calculate -5s(v) - w(v). v*2 - 38v + 1 Let c(g) = -9g + 5 - 7 + 3 - 3 - 27g*2 + 11. Let b(h) = 13h*2 + 4h - 4. Calculate -9b(i) - 4c(i). -9i2 Let f(u) = u3 - u2 + u + 1. Let z = 5570 + -5572. Let a(p) = 4p*3 - 2p*2 + 2p - 11. Give zf(w) + a(w). 2w*3 - 13 Let x(y) = 37y + 4. Let f(j) = 0 - 2 + 2j + 3 + 10j. Let l(p) = -2p2 + 4p + 128. Let d be l(-7). Give dx(a) - 7f(a). -10a + 1 Let a(q) be the first derivative of -q3/3 + q2/2 + q - 3629. Let l(y) = -5y*2 - 30y + 7. What is 6a(s) - l(s)? -s2 + 36s - 1 Let n(h) = -31h3 + 5h*2 - 5h - 5. Let i be 1/(-3)(29 + -17 + -105). Let m(y) = -186y*3 + 31y*2 - 31y - 31. Give in(r) - 5m(r). -31r3 Suppose -21c + 103 = 8c - 100. Let y(a) = 2a + 12. Let m(r) = -r - 6. Calculate cm(j) + 4y(j). j + 6 Let w(f) = 11f + 6. Let d(a) = -22a - 12. Give -3d(u) - 5w(u). 11u + 6 Let v(o) = -9o*2 - 9o - 7. Let w(l) = -13l2 - 13l - 10. Let n(u) = 8u2 - 29u - 30. Let i be n(-1). Calculate iv(k) - 5w(k). 2k2 + 2k + 1 Let s(x) = 44x2 + 13x - 4. Let o(n) = -9n2 - 2n. What is 4o(t) + s(t)? 8t*2 + 5t - 4 Let t = 157 + -120. Let k = 33 - t. Let r(z) = 2z2 - 2z + 5. Let p(o) = 2o - 45 - o + 41 - 2o*2. What is kr(f) - 5p(f)? 2f*2 + 3f Let s(u) = 11u2 - u + 4. Let w(v) = -8v*2 - 2v - 5. Give 2s(a) + 3w(a). -2a2 - 8a - 7 Let x(y) = -289y2 - 4y. Let v(r) = -283r2 - 3r. What is 7v(k) - 6x(k)? -247k2 + 3k Let k(s) = 3s3 - 6s*2 - s - 6. Let f(d) = 0 + 0 + 10d*2 - 11d2 - 1 + d3. Let g(m) = m*2 - 39m - 120. Let x be g(42). Give xf(c) - k(c). 3c*3 + c Let j(d) = -3493d*3 - 4d - 96. Let x(t) = 6986t3 + 7t + 168. Calculate -7j(y) - 4x(y). -3493y3 Let m be (9/(-4))/((-3)/12). Suppose y = -4q + 12, 101q = 97q + 4y - 8. Let i(l) = 4l + 2l - 4l*2 - 2l. Let c(d) = d*2 - d. What is mc(p) + qi(p)? p2 - p Let y(f) = 1224 + 24f - 5f - 2426 + 1207. Let d(j) = -20j - 6. What is 5d(h) + 6y(h)? 14h Let f(n) = -n2. Let q(d) = -1 - 1 + 0 + d + 4 - 2d*2. Let y(b) = 144b + 863. Let l be y(-6). What is lq(a) + 5f(a)? -3a2 - a - 2 Let z(a) = 771a*2 - a - 2. Let q(m) = -386m*2 + m + 1. What is -5q(r) - 3z(r)? -383r*2 - 2r + 1 Let i(c) = -3c3 + c. Let h be i(-1). Let l(m) = h - 4m - 17m + 11. Let d(t) = -150 + 10t + 545 - 251 - 150. Give 13d(v) + 6l(v). 4v Let y(j) = -26j*3 - 5j. Let d(w) be the second derivative of -27w5/20 - 2w*3/3 + 1494w. Determine 5d(f) - 4y(f). -31f3 Let d = 872 + -869. Suppose -dk = -66 + 48. Let n(j) = 2j3 - 5j*2 + 4j + 6. Let y(u) = -6u3 + 14u*2 - 11u - 17. What is ky(t) + 17n(t)? -2t3 - t2 + 2t Let v(k) = 126k + 17. Let b(p) = -501p - 75. Determine -4b(a) - 18v(a). -264a - 6 Let u(t) = -245t*3 - 305t*2 - 1. Let s(d) = -19d*3. What is 26s(b) - 2u(b)? -4b*3 + 610b2 + 2 Let s(k) be the second derivative of -k5/20 + k4/3 - k3/6 + k*2 - 477k + 3. Let g(a) = -4a3 + 16a*2 - 4a + 9. Give -2g(u) + 9s(u). -u*3 + 4u*2 - u Let f(s) = 7s*2 + 7s + 2. Let g(i) = 1335i2 + 1335i + 525. Let h(t) = 111t2 + 111t + 44. Let o(x) = -3g(x) + 35h(x). Determine -35f(j) - 2o(j). -5j2 - 5j Let r(u) = 1232u - 52. Let q(s) = s - 11. What is 5q(a) - r(a)? -1227a - 3 Let a(s) = -10s - 120. Let d(j) = 41j + 481. Determine -9a(k) - 2d(k). 8k + 118 Let f(k) = 6k2 - 39k - 5. Let m(z) = -17z2 + 102z + 14. What is 8f(r) + 3m(r)? -3r2 - 6r + 2 Let p(l) be the second derivative of l*4/6 + 3l*2/2 - l. Suppose -2b = -3b + 5y - 8, 3b + 3y = 30. Let q(m) = -5m2 - 7. Calculate bp(c) + 3q(c). -c2 Suppose -3v - 17 = u, u + u = -3v - 16. Let q(l) = l. Let n(k) = 11k + 61 - 160 + 99. Calculate vq(o) + n(o). 5o Let p be ((-3)/(-5))/((-38)/(-380)). Let k(h) = 26 - 27 + h*2 - 2h*2. Let i be (2 + -3)/(-1) + -2. Let j(s) = -8s*2 - 8. Determine ij(n) + pk(n). 2n*2 + 2 Let u(o) = -2. Let q(x) = -3. Let b(a) = 5q(a) - 7u(a). Let t(k) = -3k + 13. Let i(m) = -3m + 11. Let w(r) = -4i(r) + 3t(r). Determine 5b(f) - w(f). -3f Let a(n) = -4n - 70. Let v = -692 + 687. Let g(s) = 3s + 47. What is va(h) - 7g(h)? -h + 21 Let l(i) = -33i*3 - 72i*2 - 10i - 151. Let f(p) = 7p3 + 15p*2 + 2p + 30. What is -19f(j) - 4l(j)? -j*3 + 3j*2 + 2j + 34 Let l(m) = m - 1. Let o = 3239 + -3243. Let d(q) = -14q - 4. What is ol(w) + d(w)? -18w Let q(d) = -7d*3 + 3d - 2. Let l(a) = -82a + 47. Let t(o) = -35o + 20. Let k(n) = 3l(n) - 7t(n). Calculate -2k(f) - q(f). 7f*3 - f Let s(j) = -2 - 5j - 5j + 35j + 2j + 8j. Let k(a) = 69a - 5. Calculate 2k(y) - 5s(y). -37y Let a = -2589 - -2575. Let s(w) = 10w2 + 24w - 4. Let k(x) be the second derivative of -x*4/6 - 5x3/6 + x2/2 + 6x. Give ak(c) - 3s(c). -2c*2 - 2c - 2 Let j(k) = 36k - 26 - 5k - 14k - 9k - 6k. Let o(c) = 1. Calculate -j(q) - o(q). -2q + 25 Let z(h) = 9676h2 + 451. Let i = 11305 - 11303. Let n(s) = -43s*2 - 2. Give iz(u) + 451n(u). -41u*2 Let g(z) = 76z*3 + 28z*2 - 96z - 4. Let c(y) = -35y3 - 13y*2 + 47y + 2. Give -13c(h) - 6g(h). -h3 + h2 - 35h - 2 Let d(s) = 8s*3 + s - 2. Let q = -9 - -3. Let g = -163 + 167. Let f(m) = -g + 10m*3 - 1212m + 1214m + 5m*3 + 0m*3. Determine qf(r) + 11d(r). -2r*3 - r + 2 Let b be (-23 + 18)/((-5)/3) - 0. Let t(i) be the second derivative of -5i4/12 + i3/2 - i*2 - 19i. Let m(r) = 6r2 - 4r + 2. Give bm(p) + 4t(p). -2p2 - 2 Let j = -1 - 0. Suppose 5z + 3q = 300, -41q - 60 = -z - 43q. Let p(m) = -7m - 51 + 104 - z. Let h(k) = -k - 1. What is jp(r) + 5h(r)? 2r + 2 Let z(f) = -f. Let t(p) = -2p*3 + 8p*2 + 23p - 22. Let x be t(9). Let g be 14/(-5) - (-125)/x. Let w(i) = 8i*2 - 8i. Calculate gw(h) + 8z(h). -8h2 Let t(k) = -468k*3 + 42k*2 + 42k + 42. Let y(i) = 4i2 - 62i + 72. Let x be y(15). Let u(n) = 55n3 - 5n*2 - 5n - 5. What is xu(q) + 5t(q)? -30q3 Let d(z) = -1207z. Let c(s) = 3625s. Give -4c(x) - 11d(x). -1223x Let d(c) = -14c - 92. Let r(n) = -37n - 277. Give 11d(k) - 4r(k). -6k + 96 Let n(i) = 6i*3 - 2i*2 - 563i - 11. Let p(g) = -13g3 + 4g*2 + 1124g + 25. Determine 9n(j) + 4p(j). 2j3 - 2j*2 - 571j + 1 Let z(m) = 1. Let a(t) = -2t2 + 2t - 2. Let j be (-24)/16(90/27)/5. Give ja(s) - 3z(s). 2s*2 - 2s - 1 Let t(d) = -d*2 - 17d - 45. Let z be t(-14). Let n(u) = 2u - 4. Let p(o) = -4o + 9. Determine zp(h) - 7n(h). -2h + 1 Let j(d) = -d3 - 9d*2 - 22d - 57. Let t be j(-7). Let n(u) = 3u + 5. Let l(o) = 1. Determine tn(y) + 3l(y). -3y - 2 Suppose -16 = -4w, 0 = 2x + x + 2w - 32. Let n be x/(-28) + (36/14)/2. Let g(j) = 3j2 - j + 2. Let m(f) = -f2 - f. Give ng(h) + 2m(h). h*2 - 3h + 2 Let k(v) = v + 17. Let f(n) be the second derivative of 9n2/2 + 1757n. Calculate 7f(d) - 4k(d). -4d - 5 Let m(u) = -19u + 87. Let q(p) = -9p + 45. Determine 4m(z) - 9q(z). 5z - 57 Let f(p) = 8p2 - 3p - 3. Let w = -2850 - -2845. Let g = 4 + -7. Let t(l) = -15l2 + 5l + 5. Give gt(y) + wf(y). 5y2 Suppose 12191 = -4q + 12167. Let m(x) = 3x2 + 26x. Let c(s) = s*2 + 9s. What is qm(h) + 17c(h)? -h*2 - 3h Let s(z) = 26z2 - 14. Let m(w) = -1. Suppose -18622 + 18118 = -42d. What is dm(v) - s(v)? -26v*2 + 2 Let p(a) = -7a*3 - 5a + 4. Let v = -7309 - -7304. Let n(l) = 8l3 + 6l - 5. Determine vn(t) - 6p(t). 2t3 + 1 Let x(h) = -22h*2 - 7. Let m(n) = -11n*2 - 170n - 3. Let d(o) = 17o. Let v(j) = 10d(j) + m(j). Determine -7v(z) + 3x(z). 11z2 Let a(o) = o2 + o - 1. Suppose 0 = -4v + 5b - 7, b = 10v - 6v + 11. Let t(p) = -2p*3 - 3p*2 - 7p + 3. Give va(u) - t(u). 2u*3 + 4u Let j(a) = 3a3 - 2a - 2. Let v(x) = 29x3 - 10x - 135. Determine -5j(r) + v(r). 14r*3 - 125 Let n(k) = -4975k + 204. Let x(y) = -3731y + 157. Give -10n(m) + 13x(m). 1247m + 1 Let z(n) = -3n3 - 32n*2 - 10n - 6. Let v(u) = u*3 + 33u*2 + 12u + 8. Calculate -3v(o) - 4z(o). 9o3 + 29o*2 + 4o Let d(z) =	{ "pile_set_name": "DM Mathematics" }
t(324) - sqrt(324)2 - sqrt(324) - sqrt(4))). 0 Simplify (-34sqrt(396) - (-1 + (sqrt(396) - 2sqrt(396))))*2. -132sqrt(11) + 47917 Simplify 5 + (2 + sqrt(56)/sqrt(8) - (-3 + sqrt(567)))*2. -80sqrt(7) + 478 Simplify (sqrt(343) + sqrt(343)2 + 5 - (sqrt(343) + sqrt(343) + 2 + -5))2 + -4. 112sqrt(7) + 403 Simplify (1 + sqrt(17) + sqrt(17) + -2)-3 - ((sqrt(833) + 0)-5)*2. -20822 - 6sqrt(17) Simplify 3(2 + sqrt(28)/sqrt(4) + (sqrt(700) - (-1 + sqrt(700)))2 + 3 + sqrt(175) + 0). 18 + 18sqrt(7) Simplify (-6(sqrt(119) + -42sqrt(119) + sqrt(119)))/(-41sqrt(448)). -9sqrt(17)/8 Simplify (sqrt(76) + (sqrt(76) - (5(sqrt(76) + 1sqrt(76)) + sqrt(76)) - sqrt(76)) - (sqrt(76) + 1sqrt(76)-6))/((sqrt(4) - sqrt(100)1) + sqrt(4)21). 5sqrt(19)/2 Simplify (-6sqrt(300)/sqrt(6))/(sqrt(10) - (sqrt(10) + (sqrt(640) - sqrt(640)3))). -3sqrt(5)/8 Simplify (-4 + ((sqrt(90)/sqrt(3))/sqrt(10) - sqrt(48)2 - sqrt(432)-4))2. -328sqrt(3) + 5059 Simplify ((sqrt(144)/sqrt(4))/sqrt(6) + sqrt(6))/(sqrt(98) + sqrt(98)1)-56. -30sqrt(3)/7 Simplify (1 + sqrt(1584))*2 + 3 + 4 + (sqrt(22)/sqrt(2)-2)*2. 24sqrt(11) + 1636 Simplify ((2-1sqrt(272))2 - (-5 + sqrt(272) + 1 + sqrt(272))2) + -14((1sqrt(272))2 - sqrt(272)). -1104 + 80sqrt(17) Simplify -3(sqrt(125) + -6(sqrt(125)2 + sqrt(125)) - sqrt(125) - (-1 + 2sqrt(125)))*2 + -1. -150004 + 600sqrt(5) Simplify 5 + -3 + (sqrt(30)/(sqrt(1000) - (sqrt(1000) + sqrt(1000)2) - sqrt(10)))2. 295/147 Simplify (-2((-3sqrt(931) + sqrt(931) + -2)2 + -3))*2. 1568sqrt(19) + 59780 Simplify ((sqrt(80) + -1sqrt(80) + 4)-1)*224. 128 Simplify ((sqrt(84) - -2(sqrt(84) + -2sqrt(84) - sqrt(84) - sqrt(84))) + sqrt(84) - (sqrt(84) + -4(2sqrt(84) - sqrt(84))))/((5sqrt(3)-2 + sqrt(3))6). sqrt(7)/27 Simplify (-4 + (-1 + sqrt(684)3)2 + -4)-6. -36894 + 216sqrt(19) Simplify 4 + (sqrt(104) + (sqrt(104)-1 - sqrt(104))-5)/(5sqrt(128) + sqrt(8))6. 4 + 22sqrt(13)/7 Simplify ((-1 + 3sqrt(180) + 0)2 + -4)-2. -3234 + 72sqrt(5) Simplify 4 + 5 + 4(sqrt(704) - sqrt(704)-2)2. 25353 Simplify (-2 + 5 + ((-1sqrt(21) - sqrt(21))-3)/sqrt(3))3 + 0. 9 + 18sqrt(7) Simplify -2((sqrt(140)/((sqrt(810)-2 - sqrt(810)) + sqrt(810) - sqrt(810) - sqrt(810)))/(3-1sqrt(98) - sqrt(98)))2. -1/72576 Simplify 5 + -1 + (sqrt(720) + sqrt(720) + sqrt(720) + sqrt(720) + 2sqrt(720) + -4 - ((-2 + sqrt(720))-2 - sqrt(720)))2. -1728sqrt(5) + 58388 Simplify 1 + (sqrt(384) + sqrt(384) + sqrt(384) + (sqrt(384) + -1sqrt(384))1)/((sqrt(2200) + -2sqrt(2200) - sqrt(2200))/sqrt(11)). -6sqrt(3)/5 + 1 Simplify 4 + ((sqrt(200)15 + 3)3)2. 2700sqrt(2) + 45085 Simplify ((-3 + sqrt(1900) + 2sqrt(1900) - sqrt(1900))2 + 4 + 5)4. -480sqrt(19) + 30472 Simplify sqrt(35)/(-1sqrt(7))-4 - (sqrt(720) - -3(sqrt(720)2)2). -8640 - 8sqrt(5) Simplify -3(((sqrt(88)-2)/sqrt(4))/sqrt(11) + (sqrt(6)/sqrt(3) + -5)-3)2. -825 + 450sqrt(2) Simplify (sqrt(242)-2 + 4 - 3(sqrt(242) + -4sqrt(242) + sqrt(242)))2. 352sqrt(2) + 3888 Simplify -4 + (0 + sqrt(425) + 3 + sqrt(425) + (-1(1 + sqrt(425)) - sqrt(425)) + sqrt(425))2. 20sqrt(17) + 425 Simplify (((sqrt(51) - sqrt(1275))-4)/sqrt(3) - (sqrt(153) + 4 + -2 + sqrt(153)))2. -40sqrt(17) + 1704 Simplify ((sqrt(250) + sqrt(250)1)3)/(sqrt(20)/(-1sqrt(196))). -210sqrt(2) Simplify (-6(-4 + sqrt(320)2 + sqrt(320)-1 + sqrt(320) + -3)5)*2. -201600sqrt(5) + 1196100 Simplify (-2(sqrt(78) + (sqrt(78)2 + sqrt(78) - sqrt(78) - sqrt(78))2)/(sqrt(144)/sqrt(6)))2. 117 Simplify (2(0 + (sqrt(468) - (-1 + sqrt(468)))1 + 0)-6)*2. 144 Simplify (sqrt(42)-4-3)/(sqrt(6) + (sqrt(36)/(sqrt(24)/sqrt(4)) - sqrt(6))). 12sqrt(7) Simplify (-1sqrt(19)-5 + sqrt(19))4 + (-2sqrt(19)-2)2 + -4. 24sqrt(19) + 300 Simplify ((sqrt(75) + -3)4)2 + 2 + (sqrt(75) + sqrt(75) + 2)2. -440sqrt(3) + 1650 Simplify sqrt(2) - sqrt(4)/(2sqrt(2) - sqrt(2)) - (5 + 1 + sqrt(2)) - (sqrt(8)3-6)2. -2598 - sqrt(2) Simplify (-5(4 + -3 + sqrt(33)/sqrt(27) + 1)-2)2. 400sqrt(11)/3 + 4700/9 Simplify (sqrt(48)/(-4sqrt(12)))/(-1sqrt(162)). sqrt(2)/36 Simplify -5((1sqrt(36)/sqrt(3))/(sqrt(196)4))2. -15/784 Simplify ((-63(3 + sqrt(325))-4 + 1)-6)2. 5624640sqrt(13) + 62348004 Simplify 3 + (-5 + -4 + 0 + sqrt(891) + (-4 + sqrt(891)-2 - (1sqrt(891) + 0)))*2. 468sqrt(11) + 3736 Simplify (-2 + sqrt(432))2 + (-2 + sqrt(3) - sqrt(3))2 + -4 - (-1 + (sqrt(243) + 1)*2). -66sqrt(3) + 193 Simplify (((sqrt(12)26 - sqrt(12))-4)/(sqrt(256) - (3sqrt(256) - sqrt(256))2))2. 121/12 Simplify (sqrt(63)/sqrt(36) + 1)-3 - (sqrt(7) + -2 + 0 + 6sqrt(28)). -29sqrt(7)/2 - 1 Simplify (5sqrt(12) + -3 - (-1(sqrt(3) + 0) + 5)) + -3 + -1. -12 + 11sqrt(3) Simplify (-1(0 + -1sqrt(1300) - (sqrt(1300)1 + sqrt(1300) + -3)))*2. -180sqrt(13) + 11709 Simplify (5 + 6(sqrt(125) + 0) + -6(-5sqrt(20) + -4))2. 5220sqrt(5) + 41341 Simplify ((sqrt(1584)3)2 - (sqrt(11) + sqrt(1100) + (sqrt(1100) - -3sqrt(1100)))) + 0. -51sqrt(11) + 14256 Simplify ((sqrt(132) + (sqrt(132) - -1(sqrt(132) + -2sqrt(132))) + sqrt(132))/sqrt(12) + (sqrt(11) - sqrt(55)/sqrt(5)1)6)2-5. -220 Simplify (5((6(sqrt(143)2 - sqrt(143) - sqrt(143) - sqrt(143)) - sqrt(143)) + sqrt(143) - sqrt(143)))/(2sqrt(11)-2 + sqrt(44)/(sqrt(4) - 2sqrt(4))). 7sqrt(13) Simplify (((sqrt(12)2)/sqrt(2) - (sqrt(96)-3 - sqrt(6)))/((-1sqrt(432) + sqrt(432) - sqrt(432))-3))2. 25/72 Simplify 4 + (sqrt(432) + (1sqrt(432) - sqrt(432)) + 0)*2. 436 Simplify -5 + 0 + (sqrt(99)/(sqrt(729)-3)6)2. -361/81 Simplify (-6(sqrt(243) - (1sqrt(243) - sqrt(243))) - sqrt(243))/((sqrt(1296) - sqrt(1296)-3)-2 - sqrt(1296)). 7sqrt(3)/36 Simplify (-1-2sqrt(95)-2)/(sqrt(320) - 1sqrt(320) - (sqrt(5) + (sqrt(60) + (sqrt(120)/sqrt(2) + sqrt(60) - sqrt(60)))/sqrt(12))). 4sqrt(19)/3 Simplify (41sqrt(5445) - sqrt(5445) - sqrt(5445))/(5(sqrt(9) - 6sqrt(36)))2. -4sqrt(5)/5 Simplify 5(23sqrt(209))/(sqrt(88)/(sqrt(8) + sqrt(80)/sqrt(10))). 60sqrt(19) Simplify ((2sqrt(136)-3 - sqrt(136)) + (sqrt(136) + sqrt(136) + 1sqrt(136))-3)/(sqrt(48)/(-2sqrt(6)2)). 64sqrt(17) Simplify (-1 + 5 + (sqrt(1331)-1 + -2 - -4-2sqrt(1331)))2. -396sqrt(11) + 107815 Simplify (0 + (-2sqrt(190)-1 + sqrt(190) - sqrt(190))/(-1sqrt(640) + sqrt(640) + sqrt(640)))2. 19/16 Simplify -4 + ((sqrt(76) + sqrt(76)-2)5)/(sqrt(8)/(sqrt(2)-2)). -4 + 10sqrt(19) Simplify ((5 + -3((0 + sqrt(720))-3 + -1))-2)*2. 6912sqrt(5) + 233536 Simplify (3 + 1 + sqrt(38)/sqrt(2) + sqrt(171)/(1sqrt(144)))2. 10sqrt(19) + 731/16 Simplify ((-5(-1sqrt(5) + sqrt(5)) + sqrt(10)/(sqrt(2)1))14)2. 80 Simplify (5 + (-4 + sqrt(700) - sqrt(700)) + 5 + ((sqrt(700) - sqrt(700)-4)3 - sqrt(700)))2. 1680sqrt(7) + 137236 Simplify 5(1(sqrt(13) + 1))*2 - (sqrt(832) + -2 + sqrt(52)). 72 Simplify (6(-6sqrt(102)-2 + sqrt(102)))/(sqrt(12)/sqrt(288)). 936sqrt(17) Simplify (1 + (sqrt(252) - (sqrt(252)-2 - sqrt(252))2 - sqrt(252))/(sqrt(4) - (sqrt(4) + sqrt(484)-2)) + 4)*2. 90sqrt(7)/11 + 3592/121 Simplify (3 + 2 + sqrt(176)3 + 3)2. 192sqrt(11) + 1648 Simplify 6(-1 + (-1 + sqrt(325))2 + (sqrt(325)-2)*2 + 2)1. -60sqrt(13) + 9762 Simplify 5(-1(4 + sqrt(684))2)*2. 960sqrt(19) + 14000 Simplify ((sqrt(245)4)26 - ((sqrt(720) + (sqrt(720) - (1 + sqrt(720))) + sqrt(720))2 + (sqrt(180))2 + sqrt(5))) + -4. 47sqrt(5) + 20455 Simplify (-1sqrt(99)-5 + sqrt(99))/((sqrt(72)-6)/sqrt(8)). -sqrt(11) Simplify (((sqrt(2700) - sqrt(27) - sqrt(27))/sqrt(9) + sqrt(3))-4 - 4sqrt(675))*2. 27648 Simplify 4(0 + (-4 + -2sqrt(1216)4)-6)2. 73728sqrt(19) + 11208960 Simplify (-4(-1 + sqrt(13)) + -4 + 1 + 2 + sqrt(13) + 0)2. -18sqrt(13) + 126 Simplify (2sqrt(24)-12)/(sqrt(40)/sqrt(5)-1 + 5sqrt(72)). -2sqrt(3)/7 Simplify -4((sqrt(833) + -2 + 5)-5 + 1)6. 336 + 840sqrt(17) Simplify ((-1 + (sqrt(720) + -1 - sqrt(720)))*2 + (sqrt(720) - ((0 + sqrt(720))-2)*2))-1 + 5. -12sqrt(5) + 2881 Simplify (6(sqrt(85) + (sqrt(85)1 - sqrt(85))-6 + sqrt(85)))/(sqrt(20)6 + (-4(sqrt(15)/sqrt(3) - sqrt(5) - sqrt(5)) - sqrt(5))). 4sqrt(17)/5 Simplify 1(-4 + (sqrt(833)2-1)*2 - 6(2 + (1 + sqrt(833))*2)). -1688 - 84sqrt(17) Sim	{ "pile_set_name": "DM Mathematics" }
+ 6121h - 2h*2 + 3 - 6092h in the form dh + rh*2 + xh*3 + i and give x. 8 Express 377x3 + x2 - 4587x3 + 0x*2 - 6279x*3 as nx + vx3 + j + zx*2 and give z. 1 Rearrange 41x*2 + 38x*2 - 39x*2 - 4 + x + 8 to the form fx + sx2 + q and give s. 40 Rearrange (55003b - 28152b + 67275b)(-2 + 4 + 0) to l + cb and give c. 188252 Rearrange (-6 - 4 - 6)(0j*4 + 8j*4 + 36j4 - j3) to the form qj4 + tj*2 + w + bj + pj3 and give q. -704 Rearrange 1077g*2 - 69g + 25g + 25g + 21g to rg + cg2 + n and give r. 2 Express 30r + 55r + 271r + 1023r as n + ar and give a. 1379 Express (7 + 1 + 1)(-289u - 325u - 23u)(-5u + u + 3u) as nu + r + xu2 and give x. 5733 Express 35974l - 1071l3 - 35974l + 2 in the form k + rl + tl*3 + fl*2 and give t. -1071 Rearrange 23n*4 + 23n + 19n3 + 2n*2 + 5n*2 - 6n*2 + 1 - 24n - 17n3 to the form yn*2 + tn*4 + un + v + ln3 and give y. 1 Express (3o - 45o + 5o)(-3 - 3 + 1)(-4 - 1 + 1)(-3 + 1 + 1) in the form g + uo and give u. 740 Rearrange -347 - 324 + 671 - 90n2 + 17n to the form bn + zn*2 + c and give b. 17 Rearrange -41z*2 - 20 + 33 - 13 - 8 - 20 to the form d + qz + mz2 and give m. -41 Rearrange (4r + r - 4r)(-7238r + 8092r + 17814r) to nr*2 + o + wr and give n. 18668 Rearrange 29z4 + 98 - 26z*4 - 8z4 - z2 to the form wz2 + k + cz*4 + iz*3 + yz and give c. -5 Rearrange 9 - 35 + 360t2 + 9 + 15 + 837t*2 to the form ct*2 + st + x and give c. 1197 Express (4j2 - 3j*2 - 2j*2)(-518 - 1112j + 1031 - 513)(3j - 2j - 3j) in the form zj + dj3 + gj*4 + tj*2 + o and give g. -2224 Express 0n + 2n + 0n + (0 - 2 + 1)(-n - 4n + 4n) + 30n + 174n + 23n + (9 - 4 - 4)(0n + 2n - 4n) as g + cn and give c. 228 Rearrange (-6748t - 4272t - 4728t + 548t - 1716t)(0t + t - 3t) to the form dt + ft2 + o and give f. 33832 Rearrange 6h*2 - 10h*2 + 10h*2 + (5h - 4h + 3h)(-1 + 1 + h) + 0h2 - h2 + 2h2 + (-2h - 2 + 2)(0 - 2h + 0) to rh + xh*2 + l and give x. 15 Express (94 + 60 - 34)(w*3 + 5w*3 - 5w*3) + 2483w - 2483w + 7w*3 in the form uw + vw2 + g + jw*3 and give j. 127 Express 2 + 143j*2 - 11j*3 - 5 - 18j*3 + 28j*3 in the form ij*3 + cj*2 + a + lj and give c. 143 Express -185270s + 185270s + 1 - 502s2 as x + ns + ws2 and give x. 1 Rearrange -45b*2 + 46b*2 - 33 + 441973b*3 - 441972b*3 - 9b to zb3 + fb + rb2 + v and give v. -33 Express -2z*2 + 2 - 44z*3 + 210z + 32z + 46z*3 as mz*2 + xz*3 + az + w and give w. 2 Express (-1 + 153g - 370g + 174g)(2 + 0 + 0 + (3 - 5 + 1)(-1 - 2 + 2) + 2 - 4 + 4 + 2 + 1 - 4 + 0 - 4 + 3) + 5g + g + g as r + vg and give v. -122 Rearrange -272w*2 - 2w - 193w2 - 20w*2 + 49w*2 + 3 to the form xw*2 + mw + g and give m. -2 Express -4x2 + 34x*2 + 248017 - 248063 in the form u + hx + yx2 and give y. 30 Rearrange (2495r - 2500r + 1875 + 4099 - 184)(-3 + 1 + 0) to the form vr + b and give b. -11580 Express 46 - 42 - 220v - 98v - 118v + 20v as r + lv and give r. 4 Rearrange ((6 - 5 + 5)(-2v*2 + 7v*2 - 4v2) - 3 + 3 - v2)(0v - 4v - v) to the form pv*3 + av + mv2 + w and give p. -25 Rearrange (-196w + 157w + 208w)(0 + 0 - 354w*2 + 23w*2) to pw + zw3 + tw*2 + x and give z. -55939 Rearrange ((3 - 3 - 1)(-i + i - i*2) + 118 - 118 - 21i*2)(42435i - 42592i - 1 - 2) to the form gi3 + h + ui + vi2 and give v. 60 Rearrange (-60 + 4 - 3 + 0)(6 + 4l - 8 - 15l) to the form kl + z and give z. 118 Express -424c*2 + 474c*2 + 228c*3 - 225c*3 - 72 as nc + y + mc3 + hc*2 and give y. -72 Rearrange 3h - 5h + 4h + (6 - 6 - 2h)(178 + 57 - 17) to zh + g and give g. 0 Express -25q - 31q - 34 + 4 + 33q - 32 as l + mq and give m. -23 Rearrange (4 - 1 + 5 + (-1 + 9 - 25)(3 + 0 - 4))(-3p + 3p - p - 4) to k + ap and give a. -25 Express (-2 + 3 + 1)(-w4 - 2w*2 + 2w*2) - 1024w*4 - 2017w*4 + 1019w*4 as bw*4 + dw + hw2 + c + uw*3 and give b. -2024 Express 1129b - 7 + 4b2 - 1128b + 16 - 1 + 2 as nb2 + x + yb and give x. 10 Rearrange -758 - 680h + 758 + 0 + 6h + 0 + (-1 + 4 + 0)(4 - h - 4) to yh + r and give y. -677 Rearrange (20w2 + 32w*2 + 16w*2)(6 - 4 + 2) + 6w2 + 4w*2 + 4w*2 to the form fw + aw2 + o and give a. 286 Rearrange (-i2 + 2i*2 - i - 2i*2)(4 - 1846365i + 1844107i - 2) to ai2 + q + mi + wi3 and give a. 2256 Rearrange 52630h - 52630h + 3 + 46h*2 to p + th + yh2 and give p. 3 Express -5438q - 28 + 10869q - q3 + 2 + 5q*2 - 5430q as y + xq2 + iq + fq3 and give f. -1 Express (3w*2 - 3w*2 + 3w*3)(38775w - 4456 - 4465 - 4463 + 13384) in the form pw*3 + v + yw*4 + tw*2 + mw and give y. 116325 Express -155n + 63 + 58n + 36n + 62n as bn + z and give b. 1 Express 1364x + 488x + 1707x as nx + q and give n. 3559 Express (-110 + 36 + 29)(1 - 3a - 1) - 455 - 40a + 455 as sa + k and give k. 0 Rearrange 326z*3 - 28z + 518z3 + 30z - 75z3 + 2 to g + cz + qz3 + az*2 and give q. 769 Rearrange 1010 + s - 6s + 7s + 356 - 3s*2 + 147 to the form os + ms2 + a and give o. 2 Express 2l*2 + 11l*2 - 4l*2 - 981l*3 + 1142l*3 as yl*2 + rl*3 + ml + o and give y. 9 Rearrange (1885m + 5806m - 2814m)(5m2 - 5m*2 + 2m*2)(1 - 1 + 2m) to zm*4 + pm + om2 + qm*3 + c and give z. 19508 Rearrange (4 + 2 - 4 + (-166 + 196 + 909)(-6 - 5 + 5) - 2 - 3 + 4 + 0 - 3 + 2)(z - 3z + 4z) to the form a + fz and give f. -11268 Express (-2f2 + 0f2 + f2)(-15 - 258148f*2 + 15 + 137865f*2 + 145300f*2) as wf*2 + z + pf*4 + of + rf3 and give p. -25017 Rearrange (4 + 1 - 4)(-g + 3g - g) + 2 + g - 2 - 289g + 317g - 196g + (0 - 2 + 3)(0g + 4g - 3g) to the form lg + a and give l. -165 Express 2 + 5w + 3w2 - 126w*3 - 128w3 - w4 - 6w2 + 251w*3 - 6w*2 in the form uw*3 + sw*2 + vw + k + lw4 and give s. -9 Rearrange -1593h*2 + 813h*2 + 648h*2 to the form qh*2 + mh + o and give q. -132 Express -2 + 81532p2 - 10 - 81534p*2 + 4p*4 - 6p in the form wp3 + qp + rp2 + np*4 + u and give r. -2 Express -2315 - 4885g + 2315 as lg + d and give l. -4885 Express 162 + 64i + 0i3 + i3 + 192 - 352 + 16i*2 as ri*3 + hi*2 + ni + v and give n. 64 Express -9y3 + 2y*2 + 17y + 14y + 15y + 41y - 11y*3 as sy + cy3 + l + ay*2 and give s. 87 Rearrange -97i*2 + 997i - 132i2 - 1001i + (4 + 0 + 0 - i)(15 + 5i - 15) to ki + c + fi*2 and give f. -234 Rearrange 5525 - 5522 - 144z - 22z + (4 - 1 - 1)(2z + 0z + 0z) + 4z - 3z + 4z to iz + g and give g. 3 Rearrange 187t + 22t3 - 187t + 0t3 - 6t*3 - 10t*3 + (10t + 2t2 - 10t)(2t - 6t + 2t) to the form yt3 + z + xt*2 + vt and give v. 0 Express -24p3 + 137p - 43p2 + 42p*2 + 22p*3 as kp*3 + dp*2 + cp + o and give c. 137 Express 1454o3 - 1 - 57o*2 + 59o*2 - 1458o*3 + 0 + 4 - 2o in the form wo2 + so*3 + lo + j and give l. -2 Express -6o3 + 7o*3 + 634o*4 - 376o*4 - 4o*2 - 2 as do*4 + lo*2 + j + po*3 + fo and give j. -2 Rearrange 665z2 + 944z*2 - 1280z*2 - 6144z*2 - 1370z*2 to s + pz*2 + qz and give p. -7185 Express 7 + 8j2 - 3j*2 - 7 - 9j*3 - 2j + 41j2 as pj + mj2 + u + zj*3 and give m. 46 Express (-3h - h + 2h)(1 - 3 + 6) + 2489h - 2660h - 8128h - 8447h - 4183h in the form uh + k and give u. -20937 Rearrange -5707n - 3955n - 176n - 149n to the form mn + s and give m. -9987 Rearrange (0s + 2s + 0s)(-17254s - 9808s - 24064s + 1091s) to the form os + ys2 + z and give y. -100070 Express 84d*2 - 275d - 42d + 76d*2 - 166d*2 as ad*2 + vd + s and give a. -6 Rearrange (32 - 8i + 8 + 10i)(43i*3 - 31i + 31i)(-3 + 14 + 8) to ni2 + oi*4 + ci*3 + z + ji and give o. 1634 Express -h + 0 + 0 - 32h + 65h in the form c + xh and give x. 32 Express 3 - 20v4 + v2 + 47v4 + 8149v*3 - v - 8154v*3 in the form xv*2 + uv + pv3 + dv**4 + o and give p.	{ "pile_set_name": "DM Mathematics" }
. 5, 7, 227 Let f = -33341 - -53525. What are the prime factors of f? 2, 3, 29 Suppose -f + 28 - 25 = 0. Suppose 7u = fu - 4i + 60, 3u + 2i = 48. List the prime factors of u. 2, 3 Suppose -4c + 80920 = -2x, -4x - 17037 = 3c - 77771. List the prime factors of c. 2, 67, 151 Suppose 3f + 5t = 1353, 2f + 184 - 1086 = 2t. Let i = 843 - f. List the prime factors of i. 2, 7 List the prime factors of (18/(-12))/(14/(-4)) - 1882274/(-322). 2, 37, 79 Suppose 2h - 555 = 259. List the prime factors of 217412/h - (-4)/(-22). 2, 3, 89 Let t be (-2 + (-48)/(-15))/((-6)/15). Let y be t/1(-6)/(-36)-130. Suppose 5f - y = -0. List the prime factors of f. 13 Suppose 3z + x = 29, -11x + 54 = 5z - 15x. Suppose -zu + 18u - 3272 = 0. What are the prime factors of u? 409 Suppose -13m = -10881 - 5564. Suppose -2s = 3s + m. Let n = 428 + s. What are the prime factors of n? 5, 7 Let f(r) = -148r3 - 3r*2 - 10r - 62. What are the prime factors of f(-5)? 18413 Let o(z) = z*3 + 2z + 17. Let v be o(0). Let d = v - 17. Suppose 2q - 74 - 108 = d. List the prime factors of q. 7, 13 Let g(d) = -4d - 116. Let i be g(-11). List the prime factors of (-6)/i6702 + (-1)/2. 2, 3, 31 Let u be 4/12 + (-2328)/(-9). Suppose 257c + 642 = uc. List the prime factors of c. 3, 107 Suppose -4k = 2b + 12, 4b + 12 - 38 = 2k. Suppose 0 = 4u - t + 201, -u = -4u - bt - 127. Let l = -5 - u. What are the prime factors of l? 2, 11 Let j = 6 + -5. Suppose p - 3 = 1, -j = o + 3p. What are the prime factors of (-5 + 4)/(1/o)? 13 Let a = 12486 - 3617. List the prime factors of a. 7, 181 Suppose 0 = 129n + 19n + 321116 - 2120056. List the prime factors of n. 5, 11, 13, 17 Let n(a) = 20a*2 - 57a*2 - 1 + 109a*2 + 105a*2 + a. Let s be n(1). Let k = s - 89. What are the prime factors of k? 2, 11 Suppose g = t + 16984, 880g = 879g + 3t + 16986. List the prime factors of g. 3, 17, 37 Let u = -16548 + 16539. Let r(p) = 4p2 + 2p*2 - 3p*2 + 5p - 3. What are the prime factors of r(u)? 3, 5, 13 Suppose 3g + 76 = -2k + g, 5k - g = -184. Let f = k + 66. What are the prime factors of f? 29 Let q be (1 - 10) + (2-2)/(-4). Let o be 4233/(-4) - q/32. What are the prime factors of o/(-14) + (-8)/14? 3, 5 Suppose 218t = 228t - 8810. Suppose -3o = 3y - 2o - t, 3o - 873 = -3y. List the prime factors of y. 5, 59 List the prime factors of 5 - ((-145278)/(-3))/(-6). 2, 3, 673 List the prime factors of 33698 - -205 - (0 + -1). 2, 13, 163 Suppose 5b + 30 = 5a, -5a - b = -5b - 28. Suppose 5k - 675 = s - 247, 0 = -as - 12. What are the prime factors of k? 5, 17 Let q = -222 - -516. Let w = 1499 - q. List the prime factors of w. 5, 241 Suppose 5z + 65 - 355 = 0. Let l = -868 + 853. Let f = l + z. What are the prime factors of f? 43 Let m(a) = -a3 - a2 + 24a - 138. List the prime factors of m(-19). 2, 3, 41 Let g be (8 - (-119)/(-7))/(-1). What are the prime factors of (-984)/g168/(-16)? 2, 7, 41 Let t(k) = 24k2 + k + 1. Let s be t(-1). Suppose -si + 3i = -777. What are the prime factors of i? 37 Let y be 4/(-10) - (-17)/5. Let f(c) = c2 + 4c - 17. Let b be f(-8). Suppose -5z = -r + b, -2r - 9 = -yr - z. List the prime factors of r. 2, 5 Let i = -115 + 142. Suppose 33j - ij - 702 = 0. What are the prime factors of j? 3, 13 Let l(y) = -3y*2 + 59y - 152. Let n(t) = -2t2 + 39t - 101. Let a(r) = 5l(r) - 7n(r). What are the prime factors of a(11)? 2, 17 Let b(m) = 2m + 6. Let c be b(-5). Let a(u) = 75u + 1150. Let f be a(-15). Let k = f + c. List the prime factors of k. 3, 7 Suppose 0 = -q - 5x + 28, -x - 110 = -3q - 3x. Let n = -34 + q. Suppose -ns = -2b - 0s + 56, -2s + 44 = b. What are the prime factors of b? 2, 3 Let d = 10325 - 4916. List the prime factors of d. 3, 601 Let t(m) = -23m + 5 - 48m - 58m + 37m - 2m*2 - 3m*2. List the prime factors of t(-5). 2, 5, 17 Let j(f) = -2f + 20. Let r be j(10). Suppose r = -y - 28 + 27. Let t(s) = -31s3 + s2 - s - 1. List the prime factors of t(y). 2 Suppose o - 7460 = -2w, -w + 3745 = 120o - 117o. What are the prime factors of w? 3727 Let q(a) = -2a - 2. Let g be q(-3). Let y be (23/(207/6))/(4/24). Suppose -gp - 5b + 87 = 0, -yp + p - 5b + 59 = 0. What are the prime factors of p? 2, 7 Let j = -151 + 312. Let a = j - 132. What are the prime factors of a? 29 Suppose -5s - d + 204 = -280, -2s = 2d - 192. Let m = s - 65. What are the prime factors of ((-408)/m)/((-1)/20)? 3, 5, 17 Let g(z) = z*2 + z - 8. Let d be g(-4). Suppose -u = -2p - 15, -3u - 5p + 38 = -dp. Suppose -ut + 1134 = -699. What are the prime factors of t? 3, 47 Let j(a) = a - 14. Let n be j(14). Suppose 0 = -nw + 7w - 21. Let x(t) = 7t2 - t + 10. What are the prime factors of x(w)? 2, 5, 7 Let p be 68/14 + (-12)/(-84). Suppose pt = 4t - 3v + 6, 4t = 2v + 24. List the prime factors of 72 + 1 + 1/(-3)t. 71 Suppose 2487m - 2562m = -786600. What are the prime factors of m? 2, 3, 19, 23 Suppose 3s + 27 = 3q - 0q, 2q = -s + 6. Suppose -qm = -3m - 8. Suppose 3i - 362 = 4y - 5y, 4i - my - 456 = 0. What are the prime factors of i? 7, 17 Let k(x) = -4x3 - 11x + 14 + 3x3 - 24 + 16x2 + 13. Let a be k(16). Let z = -9 - a. What are the prime factors of z? 2, 41 Let b(k) = k3 + 15k2 + 19k + 58. Let z be b(-15). Let p = 566 + z. What are the prime factors of p? 3, 113 Suppose z - 8d - 19049 = 0, -9d = -2z - 4d + 38142. What are the prime factors of z? 19081 Let z(b) = -b - 70b3 + 0b + 1 + 37b3 - 2b*2 + 34b*3. Let w be z(0). List the prime factors of 18 + -14 - (-68)/w. 2, 3 Suppose l + 3g - 37 = -0g, 3l - 75 = 3g. Let t(j) = -j2 + 30j + 61. Let b be t(l). Let f = b - 86. What are the prime factors of f? 31 Suppose -2a = 8a - 17a + 55454. List the prime factors of a. 2, 17, 233 Let o(n) = -4n*3 + 145n*2 - 6n + 65. List the prime factors of o(33). 2, 1753 Let q be (-9061)/(-10) - 13/130. Suppose 2t + q = 1494. List the prime factors of t. 2, 3, 7 Suppose -34688 = -2k - f, 22k + f - 17341 = 21k. What are the prime factors of k? 11, 19, 83 Suppose -523 = -2f - 1555. Let p = -236 - f. Suppose -2i - p = -6i. List the prime factors of i. 2, 5, 7 Suppose 0 = 2j - 5w - 26, 0w + 3w = -3j - 3. Let k(q) = -4q3 - 3 - 3q*2 - 2 + j + 5q*3 - 7q. List the prime factors of k(6). 2 Suppose 68w - 259747 - 1737375 = -58918. List the prime factors of w. 3, 3167 Suppose -118 = 2u - 132. Suppose -uc + 2449 = 804. List the prime factors of c. 5, 47 Suppose 52 = -55k + 42k. What are the prime factors of (k - 5) + 4 - -49? 2, 11 Suppose -3j - 4l = -42200, -4l + 39853 - 11721 = 2j. What are the prime factors of j? 2, 3517 Suppose 9o - 102 = 276. Let i(x) = 5x2 + 9x - 4x + o - 47. List the prime factors of i(-6). 5, 29 Suppose 0 = -63f + 20f + 74433. List the prime factors of f. 3, 577 What are the prime factors of (-21 + 20)/((-3)/5283)? 3, 587 Suppose -10o - 8581 = 5579. Let k be (o/18)/((-1)/3). Suppose 91 - k = -5j. List the prime factors of j. 29 Let h(n) = n3 - 11n*2 - 9n - 5. Suppose -6q + 12q = 72. Let m be h(q). Let z = m - 11. List the prime factors of z. 2, 5 Let u(o) = -63o3 - o2 - 2o. Let b be u(-1). Let k(a) = -9a + b + 55 - 133. What are the prime factors of k(-7)? 7 Suppose 3r = 5h - r - 1945, -2h = -3r - 778. Let o = 708 - h. List the prime factors of o. 11, 29 Suppose -24d + 311 = -104521. What are the prime factors of d? 2, 3, 7, 13 Let n = -474 - -478. Suppose 5k + nh - 3684 = 0, 5k - 5460 + 1768 = -2h. List the prime factors of k. 2, 5, 37 Let r(n) = 6n2 + 8n - 30. Let w(l) = -l*2. Let x(v) = r(v) + 5w(v). Let u be x(-11). List the prime factors of ((-4 + u)-2)/(4/592). 2, 37 Let s be (12/10 - 0)-70. Suppose 127j = 128j + 155. Let a = s - j. List the prime factors of a. 71 Let l(b) be the third derivative of b*5/60 + 11b*4/8 - 6b*3 + 18b*2. What are the prime factors of l(16)? 2, 11, 17 Suppose -3f - m + 4m + 462 = 0, 5f - 777 = -2m. Suppose -fc + 158c = 1449. List the prime factors of c. 3, 7, 23 Let x(s) = 2s*3 - 19s*2 + 11s - 5. Let u be x(9). Suppose -157 + u = -6h. Suppose f = -2i + 12 + 6, -4*i + h = -f. What are the prime factors of i? 7	{ "pile_set_name": "DM Mathematics" }
4l - 4. Let j(s) = -4h(s) - 14p(s). Find the third derivative of j(o) wrt o. -3180 What is the first derivative of -804 - 360784b + 726224b - 359336b wrt b? 6104 Let t = -142 + 144. Let d(i) = -115i2 + 3i - 112. Let l(r) = 230r2 - 7r + 225. Let n(k) = tl(k) + 5d(k). What is the first derivative of n(s) wrt s? -230s + 1 Suppose -8i = i - 54. Find the third derivative of -13z6 - 11z*i + 11 + 7z*6 - 5z*2 wrt z. -2040z3 Let s = -63 - -89. Let r(j) = -28 - j3 - j + s + 0j. Let h(w) = w3 - w - 1. Let f(t) = -h(t) + r(t). Differentiate f(c) wrt c. -6c*2 Find the second derivative of 1426c*2 + 719c*2 + 1107c*2 + 10492c - 486c2 + 380c*2 wrt c. 6292 Find the third derivative of 5382y*6 + 88y*5 + 3286y*2 - 140y*5 + 52y*5 + 144y*6 wrt y. 663120y*3 Let d(u) be the third derivative of 113u*8/6 + 239u*5/15 - 10u*2 - 3u + 7. What is the third derivative of d(n) wrt n? 379680n2 Let x(m) be the second derivative of 0m*4 + 0 + 0m*2 + 82m + 29/3m3 - 2/5m*5. What is the second derivative of x(f) wrt f? -48f Let w(u) be the second derivative of -268u4/3 + 13u*3 - 9u*2/2 - 5057u. What is the second derivative of w(o) wrt o? -2144 Let d(j) = -j*3 + 6j*2 + 10j - 3. Let g be (1 - 0)/((-17)/(-119)). Let a be d(g). Find the third derivative of b*6 + 6b*6 + ab*2 + 6b*6 wrt b. 1560b*3 What is the second derivative of -4838v*4 + 71v - 671v + 215v*4 wrt v? -55476v2 Let h(a) = a2 + 13a + 53. Let n be h(-8). Find the third derivative of 0x*2 - 133x*6 - 7x - nx + 2x*2 - 42x wrt x. -15960x3 Let g(p) = 476p*3 - 8p*2 - 7p - 3464. Let q(r) = 239r3 - 3r*2 - 3r - 1732. Let x(f) = 3g(f) - 7q(f). Differentiate x(a) wrt a. -735a2 - 6a Find the third derivative of -2f2 - 5811f*3 + 18882f*3 - 1025f - 10166f3 wrt f. 17430 Let n(z) be the third derivative of -11z*6/30 - 7z*5/10 + 4061z*4/8 + 8887z*2 - 2. What is the second derivative of n(d) wrt d? -264d - 84 Let s(o) be the first derivative of -2404o6/3 - 2o*5/5 - 5779o*3/3 + 8737. Find the third derivative of s(k) wrt k. -288480k*2 - 48k Suppose i - 2i + 2 = 0, i + 13 = w. What is the first derivative of -w - 59o*4 + 5o*4 - 77o*4 - 84 wrt o? -524o*3 Suppose -48 = 2u - 10u. What is the third derivative of -705j*2 - j + 25j*u + j + 722j*2 wrt j? 3000j*3 Let u(h) = -32350h*2 - 3954h + 2. Let b(v) = -8099v2 - 989v + 1. Let o(s) = 9b(s) - 2u(s). Find the second derivative of o(r) wrt r. -16382 Let x(n) = 7636n - 5882. Let o(t) = -2t - 7. Let r(m) = 2o(m) - x(m). What is the first derivative of r(c) wrt c? -7640 Let h = -189 - -191. Find the third derivative of -11 + 0w*h - 2w*4 - 2w3 - w2 + 3w4 - 11w*3 wrt w. 24w - 78 Let r(o) be the third derivative of 2239o7/210 + 562o*3 + 14o*2 + 17o. What is the first derivative of r(n) wrt n? 8956n3 Let n(d) = -502d3 - d2 - 7d + 91. Let t(w) = 1006w*3 + 2w*2 + 13w - 182. Let v(k) = 7n(k) + 3t(k). Find the second derivative of v(m) wrt m. -2976m - 2 Let b be (-162)/(-32) + (-38)/608. Let p(i) be the second derivative of -6i - 3/2i2 + 0 + 0i*4 + 0i*3 + 3/5i*b. What is the derivative of p(l) wrt l? 36l*2 Let q(w) be the second derivative of 36w + 49/12w4 + 0 + 34/3w*3 + 0w*2. What is the second derivative of q(p) wrt p? 98 Let h(u) be the third derivative of 0u*5 + 0 + 1/42u*7 - 1/24u*6 + 8u*2 - 7u - 37/8u4 + 0u*3. What is the second derivative of h(z) wrt z? 60z*2 - 30z Let n(m) be the second derivative of -295m7/42 - m4/4 - 281m*2/2 + 1115m. What is the third derivative of n(d) wrt d? -17700d2 Let n(y) be the first derivative of 17y*3 + 41/2y*2 + 40 + 0y. What is the second derivative of n(g) wrt g? 102 Let c(s) = -1. Let b(z) = 5z2 - 37z + 0z2 + 12 + 56z - 334. Let u(j) = -b(j) - 5c(j). Differentiate u(x) wrt x. -10x - 19 Let p(t) be the second derivative of -5t7/2 + 3t*5/20 - 8t*4/3 + 7t*3/2 + 944t. Find the third derivative of p(b) wrt b. -6300b2 + 18 Let k be 32/6 - 1. Suppose k = -5z + 84 + 21. Find the first derivative of -zj*4 + 9j*4 + 0j*4 + 40 wrt j. -48j*3 Let g(d) be the first derivative of -671d*7/7 + 68d3 - d2/2 - 1590. Find the third derivative of g(k) wrt k. -80520k3 Find the first derivative of 240 + 247p*4 + 626p*4 - 214 - 756 + 169p*4 wrt p. 4168p*3 What is the second derivative of 1563n + 318n - 213735n*2 + 214481n2 wrt n? 1492 Let l(p) = p2 + 2p - 96. Let i be l(-11). What is the second derivative of -102930h*i + 81h*5 + 102930h*3 + 179h wrt h? 1620h3 Let d = -61 + 19. Let s = d - -74. Find the third derivative of -sg*3 - 1550 + 11g*2 + 1550 wrt g. -192 What is the derivative of -1321t + 119 + 158 - 1217 - 1773 wrt t? -1321 Let c(f) be the first derivative of 221f6/30 - 71f*2/2 - 184f + 121. Let a(l) be the first derivative of c(l). Find the first derivative of a(h) wrt h. 884h3 Let z(k) be the third derivative of -953k*8/168 - 193k*5/30 + 119k*2 - 3. What is the third derivative of z(a) wrt a? -114360a*2 Let y = -208 - -195. Let k(x) = -16x*3 + 26. Let f = 13 - 7. Let b(i) = -32i*3 + 53. Let l(c) = fb(c) + yk(c). What is the derivative of l(q) wrt q? 48q*2 Let x(r) be the first derivative of 3r*5/5 - 77r*4 - 797r*2 + 975. What is the second derivative of x(f) wrt f? 36f*2 - 1848f Let w(y) = -127y2 + 6y + 1235. Let n(j) = -139j2 + 7j + 1236. Let s(x) = 2n(x) - 3w(x). Differentiate s(f) wrt f. 206f - 4 Let d = -47 - -50. What is the first derivative of -579 - 586 - 335s*d + 1156 wrt s? -1005s*2 Let x(t) be the second derivative of -121t*6/5 - 18t*3 - 47t*2/2 + 4224t - 2. Find the second derivative of x(f) wrt f. -8712f2 Let h = 72 + -55. Find the second derivative of -72f - hf4 + 2 + 361910f*2 - 361910f*2 wrt f. -204f*2 What is the derivative of -1292 + 148w + 349w - 61w - 129780w2 + 129779w*2 wrt w? -2w + 436 Let d be (1/3)/(-1 + (-220)/(-219)). Let y = 78 - d. Find the second derivative of -17r + 5r + yr2 + 7r*2 wrt r. 24 Let u(s) be the second derivative of -1381s*4/12 + 857s*3/6 + 433s + 3. Find the second derivative of u(g) wrt g. -2762 Let k(n) be the second derivative of 1 + 23/12n4 - 10/3n*3 - 1/2n*2 - 5n. What is the second derivative of k(b) wrt b? 46 Let z(o) = -227o - 2873. Let q(m) = -231m - 2876. Let f(d) = 9q(d) - 8z(d). What is the derivative of f(p) wrt p? -263 Let v(k) be the first derivative of k*6/60 + 3k*4/4 - 112k*3/3 + 3. Let p(w) be the third derivative of v(w). What is the derivative of p(u) wrt u? 12u Suppose j = -b + 7, 0 = 4b + 2j - 15 - 7. What is the third derivative of 0s4 + 6sb - s4 + 26s2 + 82s*3 - 7s*4 + 106s*2 wrt s? -48s + 492 Let j(v) be the first derivative of -1/2v2 - 28 - 28/3v*3 - 32v. What is the first derivative of j(c) wrt c? -56c - 1 Let i(a) be the third derivative of 13a*6/40 - 61a*5/60 - 2221a*4/24 - 1144a*2. Find the second derivative of i(m) wrt m. 234m - 122 Differentiate 2300 + 1464c - 282c*2 + 2805 + 281c*2 with respect to c. -2c + 1464 Suppose -5t = -2i + 31, 2 = 5i + 2t - 3. Let q be 15/4 - (i + 52/(-16)). What is the first derivative of -39l - 4l*q + 19 + 39l - 6l4 wrt l? -40l*3 Find the second derivative of -160i + 53i + 48i*2 - 740 + 51i + 57i - 2i*3 wrt i. -12i + 96 Let b(p) be the third derivative of 0 + 5/2p4 - 8p*2 + 9p + 203/6p3. Differentiate b(t) with respect to t. 60 Let o(m) be the first derivative of -34m*5/5 + 7m3/3 - m2 + 77m + 1933. Find the second derivative of o(h) wrt h. -408h*2 + 14 Differentiate -7238 - 592g2 - g3 + 3g3 + 1512g*2 - 932g*2 - 331g*4 wrt g. -1324g*3 + 6g*2 - 24g Let k(c) be the first derivative of 525c2 - 1353c - 972. What is the derivative of k(y) wrt y? 1050 Let x(o) be the third derivative of -56o5/15 + 295o*4/6 + 114o*2 + 1. What is the second derivative of x(p) wrt p? -448 Let c(z) be the second derivative of -2z*7/21 + 429z*5/20 - 1967z*4/4 - 9549z. Find the third derivative of c(p) wrt p. -240*	{ "pile_set_name": "DM Mathematics" }
g3. -188g*3 Collect the terms in 21f - 6f - 4f - 10f. f Collect the terms in -27g*2 + 27g*2 - 2g*3 + 25. -2g*3 + 25 Collect the terms in 83323s - 166647s + 83325s. s Collect the terms in -3y2 + 3y*2 + 3y*2 + 10y - 5y2. -2y*2 + 10y Collect the terms in b + 19b3 - 4b + 3b - 20b3. -b3 Collect the terms in -4r2 - 4r*2 + 10r*2. 2r*2 Collect the terms in 4n*3 + 3n*3 - 11n3 + n3. -3n3 Collect the terms in -1 - 4k*2 - 2k2 + k2. -5k2 - 1 Collect the terms in -11x - 2x + 16x. 3x Collect the terms in 19u*2 + 22u*2 - 48u*2. -7u*2 Collect the terms in 119t + 28t2 - 119t + 6. 28t2 + 6 Collect the terms in b - 8b - 24 + b + 9b. 3b - 24 Collect the terms in 55908r2 - 27957r*2 - 27954r*2. -3r*2 Collect the terms in 116m - 1 + 1 + 0. 116m Collect the terms in -36 + 6r - 38 + 111 - 37. 6r Collect the terms in 3f + f - 8f + 3f. -f Collect the terms in -18w + 26w - 15w. -7w Collect the terms in 0 - 4 - 5 + 9 - 2x3. -2x*3 Collect the terms in 161f - 171f - 1 - 522f. -532f - 1 Collect the terms in -164g + 58g - 432g. -538g Collect the terms in -1663w*2 - 423w*2 - 635w*2 + 2. -2721w*2 + 2 Collect the terms in -1 - z + 4z - 2z + 0z. z - 1 Collect the terms in -2555 - 4w2 + 2555. -4w*2 Collect the terms in -25 - 5t + 4t - 2t + 2t. -t - 25 Collect the terms in -28w*2 + 116w*2 - 35w*2 - 52w2. w2 Collect the terms in 21u3 + 38u*3 + 25u*3 - 102u*3. -18u*3 Collect the terms in -20c + 7c - 27 + 27. -13c Collect the terms in 13d + 12d - 31d + 10d. 4d Collect the terms in -111942o*2 + 223881o*2 - 111938o2. o2 Collect the terms in -p*3 + 9p*3 - 8p*3 + 3p*3. 3p*3 Collect the terms in 64g - 19g + 64g. 109g Collect the terms in 15y*2 - 8y*2 + 3y*2. 10y*2 Collect the terms in 0 + 0 + 77f*2 - 59f*2. 18f*2 Collect the terms in 0k*2 - 4k*2 + 5k*2 - 3k*2. -2k*2 Collect the terms in -20k*3 - 12k*3 + 21k*3. -11k*3 Collect the terms in -32g*2 + 71g*2 + 6g*3 - 39g*2. 6g*3 Collect the terms in 0 + 0 - 92f + 34f. -58f Collect the terms in 50d3 - 29d*3 - 24d*3. -3d*3 Collect the terms in -188g + 4g2 - g2 + 377g - 189g. 3g*2 Collect the terms in 11s - s - 12s. -2s Collect the terms in 110s + 72s + 20s. 202s Collect the terms in -47k - 107 + 107. -47k Collect the terms in 434k2 + 2k - 2k + 428k*2 - 853k*2. 9k*2 Collect the terms in 0 - 1 - 7 - 2f. -2f - 8 Collect the terms in 18c - 15c - 9c. -6c Collect the terms in -4h - 6h2 - 2h*2 - 13h*2 - 14h*2. -35h*2 - 4h Collect the terms in -3d3 + 3d3 - d3 + 2d3. d3 Collect the terms in 9d*2 + 7d*2 - 12d*2 - 8d*2. -4d*2 Collect the terms in 3g*3 - 4g*3 + 2g*2 - 6g*3. -7g*3 + 2g*2 Collect the terms in -3u*2 + 7u*2 - 3u2 + u2. 2u2 Collect the terms in 413 - 413 + 2u*3. 2u*3 Collect the terms in -4 + 4 + 4067y*3 - 4065y*3. 2y*3 Collect the terms in 83737 + 2s - 83737. 2s Collect the terms in 3y*2 - 11 - 4y*2 - 1 + 2y2. y2 - 12 Collect the terms in -442j3 - 436j*3 + 873j*3. -5j*3 Collect the terms in -115d*2 - 2 + 41d + 0 - 41d. -115d*2 - 2 Collect the terms in -2s*3 + 0 - 10 + 4. -2s*3 - 6 Collect the terms in o + 9 - 11 + 2 + 99o*3. 99o*3 + o Collect the terms in -3k - 3341447 + 3341447. -3k Collect the terms in 2m*3 - 124m + 124m. 2m*3 Collect the terms in -4 + 1958c + 1963c + 4 - 3916c. 5c Collect the terms in -1 - 16 + b3 - 6. b3 - 23 Collect the terms in -2495 + 2495 + v2. v2 Collect the terms in -3t + t - 7t3 + 3t + t. -7t3 + 2t Collect the terms in -611q2 - 607q*2 - 611q*2 + 1827q*2. -2q*2 Collect the terms in 96k + 222k - 2035k. -1717k Collect the terms in 59 - 59 - 17j*3 + 16j3. -j3 Collect the terms in 4y3 + 48y + 72y - 3y3. y3 + 120y Collect the terms in 5 - 4 + 284t - 318t. -34t + 1 Collect the terms in -14d3 - 7d*3 + 24d*3. 3d3 Collect the terms in -v3 + 18v + 8v - 45v + 11v. -v*3 - 8v Collect the terms in 4504i2 - 2253i*2 - 2253i*2. -2i*2 Collect the terms in 3l*3 - 4l3 - l3. -2l3 Collect the terms in -9s3 - s3 + s*3 + 8s3. -s3 Collect the terms in -58d2 + 58d*2 - 4d*3. -4d*3 Collect the terms in 6j*2 + 0j*2 - 3j2 + j2. 4j2 Collect the terms in 50310f*2 - 50310f*2 - 26f*3. -26f*3 Collect the terms in 55466r - 27732r - 27736r. -2r Collect the terms in 12207f - 24418f + 12212f. f Collect the terms in -483g3 + 486g*3 + 56g - 56g. 3g*3 Collect the terms in 60f*3 - 125f*3 + 59f*3. -6f*3 Collect the terms in 7g - 4g + 4g*2 - 8g*2. -4g*2 + 3g Collect the terms in 10v + 2v*3 + 0v*3 - 10v. 2v3 Collect the terms in -15o*3 + 9o*3 + 54o*3 + 128o*3. 176o*3 Collect the terms in -u + 944u*2 + 3u - 2u. 944u*2 Collect the terms in -55c - 6c - c3 + 61c. -c*3 Collect the terms in 245g*2 + 234g*2 - 478g2. g2 Collect the terms in 2k3 - 146k + 296k - 150k. 2k3 Collect the terms in -393 + 393 - 11o. -11o Collect the terms in 3f + 35 + f - 9 - 2f. 2f + 26 Collect the terms in 2356v - 4v*2 - 2356v. -4v2 Collect the terms in -87j*3 - 3 + 3 + 0. -87j*3 Collect the terms in -3 + 3 - 1071a*2 + 2607a*2. 1536a*2 Collect the terms in -2 + 20m*2 - 52m*2 + 2. -32m*2 Collect the terms in 38k*2 + 2k - k*2 - 6k. 37k2 - 4k Collect the terms in -1281s2 + 4041s*2 + 5772s*2. 8532s*2 Collect the terms in -90q + 91q + 1 - 1. q Collect the terms in -74a*2 + 74a*2 + 12a*3. 12a*3 Collect the terms in 14c + 10960 - 10960. 14c Collect the terms in -8w + 10w + 4w. 6w Collect the terms in 17p*2 - 24p*2 - 38p*2. -45p*2 Collect the terms in -5x*2 - 9x*2 + 16x*2. 2x*2 Collect the terms in -339 - 2x + 102 + 237. -2x Collect the terms in 13 - 14 + 2s + 1. 2s Collect the terms in -4g + 4g - g + 4g. 3g Collect the terms in -5g*2 - 3855 + 3855. -5g*2 Collect the terms in -171a*2 - 5a*3 - 173a*2 + 3a*3. -2a*3 - 344a*2 Collect the terms in 6a*3 + 119a - 119a. 6a*3 Collect the terms in -1413v + 704v + 712v. 3v Collect the terms in -24o + 2142 - 2142. -24o Collect the terms in 11g - 14g + 10g - 14g. -7g Collect the terms in -6f + 27f - 116f. -95f Collect the terms in -17p3 + 2p*3 + 7p*3. -8p*3 Collect the terms in -4w*2 + 7557w*3 + 4w*2 - 7559w*3. -2w*3 Collect the terms in 4k*2 - 51k*2 - 41k*2. -88k*2 Collect the terms in -2z*3 + 3z*3 - 2z*3 + 3z*3. 2z*3 Collect the terms in 0 + 64o*3 - 2 - 66o*3 - 2. -2o*3 - 4 Collect the terms in -49b + 11b + 7b + 6b + 7b. -18b Collect the terms in 828 + 2y - 828. 2y Collect the terms in 6x*3 + 42 - 42. 6x*3 Collect the terms in 31 + 30 + 3p*2 - 61. 3p*2 Collect the terms in 15 - 24 - 3 - d + 12. -d Collect the terms in 2j - 374 + 188 + 186. 2j Collect the terms in -17k + 3k + 0 + 1 - 2. -14k - 1 Collect the terms in 50r2 + 98r*2 - 14r*2 + 17r*2. 151r*2 Collect the terms in -l - 31l*2 + l - 24l*2. -55l*2 Collect the terms in 164s*2 - 39s*2 - 41s*2 - 40s*2 - 43s2. s2 Collect the terms in g - 5g - 6g - 3g. -13g Collect the terms in 7y3 + 8y*3 - 17y*3 + 7y*3. 5y*3 Collect the terms in 2h + 2h3 - 2h*3 - 3h*3 + 0h*3. -3h*3 + 2h Collect the terms in -81i3 - 10i*3 - 33i*3. -124i*3 Collect the terms in 55 - 55 + 96z. 96z Collect the terms in 1 - 2 - z + 3 - 2. -z Collect the terms in -116n - 107n + 330n - 108n. -n Collect the terms in 117r*2 + 12 + 12 - 24 - 127r*2. -10r*2 Collect the terms in -10h - 4h - 24h + 18h. -20h Collect the terms in -586v2 + 586v*2 + 104v*3. 104v*3 Collect the terms in -9n3 + n3 + 9n3 - 3n*3 - 2n*3. -4n*3 Collect the terms in -1 + 1 + 93b - 106b. -13b Collect the terms in 4u3 + 7u*3 - 2u + 0u. 11u*3 - 2u Collect the terms in -12w2 - 13w*2 - 9w*2 + 30w*2. -4w*2 Collect the terms in -16202 - 4r + 16202. -4*r Collect the term	{ "pile_set_name": "DM Mathematics" }
/(-6832)? 2/21 Calculate (16146/(-4485))/((-3)/(-25)). -30 Calculate (-12 - 2) + 408/34 + (-4)/3. -10/3 Calculate -15 + 98/14 - (-21)/28-4. -11 Calculate 10/(-16) + 30233/24680. 3/5 Evaluate -4 - (-7 - ((-5)/(-45) + 284/36)). 11 Evaluate -20(85/(-425))/(1/2). 8 Evaluate 22/2 - 3283/335. 6/5 Evaluate 1/(12/42 - (-75)/(-140)). -4 Calculate 402/469(-1)/(-6) + (-61)/35. -8/5 What is the value of -6((-10)/25)/(414/225 + -2)? -15 Evaluate 18/243 + (-436)/54 + 7. -1 What is 40/10 + (-410)/492(-116)/(-25)? 2/15 Calculate (-3 - (-15)/9)-9. 12 Calculate (-1 - -7) + 52 + 851/(-23). 21 (-12 - -14)/(4 - (-1166)/(-297)) 27 9 - 4 - ((-129)/21 - 176/(-154)) 10 Evaluate ((-1632)/(-120))/(-17) - ((-198)/(-40) - 3). -11/4 What is (-58)/(6/3) + (21 - 464/29)? -24 Evaluate (-4 - 1) + 44 + -17 + -25. -3 1(-2)/10 - ((-273735)/175)/(-79) -20 What is the value of (-3 - (0 + 2))(-11 - 39/(-3))? -10 What is the value of (-3892)/182 + (-80)/(-208)? -21 (-14)/(70/65) - -3 -10 Calculate (1 - 0)3 - (-34 + 13 + 30). -6 What is the value of 1/7 - (-1020)/(-2142)? -1/3 What is 9(-50)/(-90) - -7? 12 Evaluate (208/312)/((-5)/28/210). -7 Calculate (0 + -14)(1941/87992)/((-12)/(-34)). -7/8 What is 3337/940 + (-7)/2? 1/20 Calculate (-14)/357 + (-512)/(-2652) + (-212)/26. -8 What is the value of 1302/266 + 18 - 22/(-38)? 23 What is (-47)/(-70) + -220/70? 1/10 Evaluate ((-217)/(-210))/31(-4)/3. -2/45 What is ((-222)/44)/(-1) - (-46)/((-5152)/504)? 6/11 Calculate ((-56)/3)/(-38 - (-2640)/72). 14 Calculate 40/(-180) + 16902/(-486). -35 Evaluate (-9)/((-6)/2) - 76/(3192/1386). -30 What is the value of (-1323)/297 - 6/11? -5 1/((-1258)/6216 + 4/14) 12 What is the value of 30/(-8) - (-13 - 26)/13? -3/4 Calculate 8 + (-3 + (6 - 38))/(-5). 15 (-90)/240 + 46/(-48) -4/3 What is the value of -3(25 + 3335/(-138))? -5/2 11/((-29)/((-58)/(-2))) -11 What is the value of (-9)/21 + 1628/2590? 1/5 Evaluate -9 + (-871)/(-91) - ((-4)/(-56) - 0). 1/2 What is the value of 1611/(-1074) - (-1)/4-14? -5 Evaluate 2715/180 + (-44)/528. 15 What is (1 + 1 + 23/(-4))184/1104? -5/8 Calculate 55/102 + 204/(-5202). 1/2 What is the value of (0 + 160/(-30) + 4)(-21)/182? 2/13 ((-4)/(-7))/((140/(-1568))/(-5)2) 16 What is (40/(-60))/((-438)/270 + (-10)/(-6))? -15 (-18)/(-12)(264/(-42) - (-6)/21) -9 Calculate -111 - (493 - 485). -19 What is ((-143)/6864)/(6/(-8))? 1/36 What is (-3460)/2076 + 0 + (-4)/(-6)? -1 4 - 96/33 - 9834/363 -26 What is the value of (-3)/(56/(24/(-3)))? 3/7 What is the value of ((-316)/(-65))/(2/(-5)) - 8/(-52)? -12 Evaluate (-34)/(-187)66 + (-1 + 0)-5. 17 Calculate 946/330 - 2/(8/12). -2/15 Calculate (108/96 + -2)/(4/32) + 4. -3 What is (-2(-6)/32)/(32 - 1590/50)? 15/8 Calculate -4 + 3/(12/68) + (-160 - -160). 13 Calculate 17 + ((-1850)/58 - (-146 - -131)). 3/29 What is the value of -9 - (3 - (-180)/(-50))5? -6 Calculate 0/2 + 8/(-24)(-3)/17. 1/17 What is the value of -7 + -1117/(-105)? 2/5 What is the value of 185/3515 - (-9)/551? 2/29 316/(-72)(-2 - (-2)/4) 1 (-8466)/(-332)8/(-34)8/(-78) 8/13 Evaluate 12 + 672/(-40) - -3. -9/5 (196/36 + -6)(1 - (-301)/(-70)) 11/6 Evaluate (-70)/(-44)-2 - (-253 - -250). -2/11 What is 99224/10990 + 5/(20/(-36))? 1/35 Evaluate 24/(-420) + ((-18)/150)/(14/(-2690)). 23 What is ((-3536)/(-765))/(-13) + (-8)/(-10)? 4/9 What is the value of ((-6)/20)/((-249)/8134) + 27/(-15)? 8 What is (-978)/296 + (-52)/(-16)? -2/37 Evaluate (12/108)/(33/(-5643)). -19 Evaluate 37/((-555)/9) - (0 + 54/10). -6 What is the value of -2 + 93/42 - 140/(-280)? 5/7 What is the value of (-17)/3-1 - (16/(-12) - 0)? 7 42(226/(-4859) + 184/258) 28 Calculate 196/588(-6)/(-10). 1/5 Evaluate 410/14 - 24 - (-1)/((-14)/4). 5 (-14)/(-175) + 173/25 7 Calculate 145/(-6) - (1204/2064)/((-14)/(-20)). -25 What is (28/15190-5)/(2/14)? -2/31 What is (-24)/12 - 11 - (7 + -6)? -14 (-451)/(-245) + (-145)/87 + (-4)/30 2/49 Calculate (-18)/(-21) + 11446/(-826). -13 Evaluate (-8 + 1)(-45)/(-21). -15 What is (-12)/(-6)4(-3)/96? -1/4 What is 50(-27)/(-45)(-2)/4? -15 (15 + (-1092)/70)2/6 -1/5 What is the value of -2 + (-16 - 0/10)? -18 What is 95/285((-2)/(-3) - (-33)/(-9))? -1 What is (-1355)/(-50) + -25 - 2? 1/10 What is the value of (0 - 1)/(12/(-264)1)? 22 (0 - -22)/(24 - -3 - 29) -11 294/30 + -9 + (-48)/(-15) 4 Evaluate 6655/4356 + (-21)/12. -2/9 What is -28(37 + (-2915)/77)? 24 Calculate 7(((-98952)/(-43316))/(-38) - 2/(-26)). 2/17 Calculate (14/6 + -2)33/(-1). -11 Evaluate (-6)/124124/279-3. 2/31 Calculate (24/(-12))/((-4)/(-46)). -23 Evaluate (-4)/(-9) + ((-42770)/(-117))/(-35). -10 Calculate -10 - 2(-7)/(42/(-15)) - 1. -16 What is -11 + 8/(-6)1 + (-12)/18? -13 Calculate (-12 + 7)34/(-425). 2/5 (-14 - -16) + 10 + 10 22 What is the value of (1 + 5)((-8)/9)/(-59 + 55)? 4/3 What is the value of -14(-3)/21356/791? 36 Evaluate -9 + 2844/396 - (12/(-22))/(-3). -2 What is the value of 15/(270/56) + 28/(-27 - -13)? 10/9 What is the value of 291/15 + 16/(-90) + 56/(-252)? 19 Evaluate (-2)/(((-40)/16)/5). 4 Evaluate 12/30(-2 - -4). 4/5 Calculate 36(-42)/(-168) + 6. 15 Evaluate ((-3)/(-36))/((-38)/2 - (-25538)/1356). -1/2 (-12)/(-2) + -1 - (-101 - -100) 6 What is (2 + -5 + 169/91)/1 + 2? 6/7 -17 + (11 - 5 - -13) 2 Calculate ((-21)/(-12) + 2)/((-582)/388). -5/2 What is the value of ((-4032)/19845 + 10/45)(-10)/8? -1/42 What is the value of 52(12/54 - 1/(-36))? 13 (9 - (-690)/(-70))(-42)/(-45) -4/5 Evaluate (66/(-216)6)/(0 - (-1)/(-6)). 11 Evaluate ((-35)/(-10))/(-1 + (-9)/(-2) + -3). 7 What is the value of 644/(-110)5? -12 What is (1273/57 - 22)(-34 + (-1 - 1))? -12 Calculate -1 - (-6)/(780/91). -3/10 What is the value of (-198045)/4401 + 16 + 0/1? -29 (-16 - (-19 + 58)) + 34 -21 What is the value of (-117)/21216/(-3952)? 18 What is (-21)/((-28917)/90)186/180? 2/51 What is -614/18(-5)/((-30)/(-9))? 7 (-11920)/745 - (18/(-2) - 2) -5 What is (-4 - 1)(-1869)/445? 21 28/12(-23)/322 -1/6 Calculate ((4437/68)/(-29))/((-3)/(-4)). -3 Evaluate (-66)/(-18) - 46/69. 3 Calculate ((-470)/(-6768))/(10/(-6)). -1/24 210/28-2 + -2 -17 What is the value of (66/4)/((-2604)/(-1736))? 11 What is the value of 6/20 + ((-1)/(-36))/((-225)/4230)? -2/9 What is the value of 16 + 1-4(206 - 199)? -12 What is (-154)/(-1232) + (-6)/16? -1/4 What is (-11)/((-99)/(-15)) + 4(-29)/(-36)? 14/9 What is the value of (160/(-55) - (-2 + -1))156/39? 4/11 What is 177023/(-275880) + -2 + (-38)/(-16)? -4/15 Calculate 4/(8/(-11))(447 - 443). -22 (228/(-18))/1 + (-615)/(-369) -11 What is the value of 24/((-1080)/145) + 2/9? -3 What is the value of -3(8 + -2) - (-24)/(-6)? -22 What is the value of 3/9 + 170/102? 2 ((-1074)/(-84) - 2/7)/((-5)/(-10)) 25 (-4)/441 + -5(-860)/(-1100) -4 Evaluate 1 + 4 + 27/(-9) - -6. 8 Evaluate 5/4 - 530/1272. 5/6 What is the value of ((-3)/2790-45)/(3/(-2))? -1/31 Calculate -20 - 5/(55/22). -22 165/396 + 232/(-96) -2 What is ((-1)/4)/(((-396)/(-42))/((-128)/(-56)))? -2/33 Evaluate (-2 + 76/36)(-7 + 4). -1/3 4 + 1/3 - 22/66 4 0/(-25) - 6/(-21) 2/7 What is (57/(-6) + 9)((-6)/45 + 0)? 1/15 Evaluate 307/(-1535) + (-89)/5. -18 20/270-30 - -3 - 1 -2/9 What is 51600/1720 - (30 + 0)? 0 -1 + ((-27)/(-72))/(3/40) + -8 -4 Evaluate ((-1050)/875)/(((-1)/50)/(2/(-6))). -20 What is 1713/(-13) - -24? 7 Evaluate ((-18)/(-16))/((-14943)/(-4688)). 6/17 Evaluate (-5)/210-12 - (-20)/(-1085)19. -2/31 What is (-1)/((-4)/(-3 + -1))(3 - -2)? -5 Calculate (-258)/559 + 10794/(-273). -40 Calculate (-1 + 3)/(4/2642-6). -11 Evaluate 1/9 - ((-289)/4335)/(6/(-10)). 0 What is (-191404)/8780 + 6/(-5)? -23 What is the value of ((-16)/(-64))/(305/100 - 4 - -1)? 5 (-60104)/(-16588) + 8/26 - 4/1 -2/29 What is -9 + 2763/126 + -13? -1/14 What is (-6 - 0)(0 + 280/(-36) - -8)? -4/3 Evaluate (3 + -5)(-5)/50(-1 - -1). 0 Evaluate ((-32)/(-5))/(952/(-1190)). -8 What is 1/(-2)(-17)/323-19? -1/2 36 - 4290/117 - 4/(-5) 2/15 (2 - (-50)/(-28))8/(-12) -1/7 What is (14/119)/((-396)/(-7854))? 7/3 Calculate ((-2)/(-8))/(-2 - -21 - 15795/780). -1/5 Calculate (-3)/155 + (6 + -5 - 9). -9 ((-4)/18 + (-200)/180)1/(-2) 2/3 Calculate 6/12048/24. 1/15 What is (266/(-57))/(10/(-12) - 6/(-4))? -7 What is the value of (-6)/(-8) + 3608/352? 11 Evaluate 3/1(570/(-9))/(-38)-2. -10 Calculate ((-9)/(-2	{ "pile_set_name": "DM Mathematics" }
5x, -3z - oz = -2x - 16 for x. -3 Suppose -2a + 6 = -0a. Suppose -s = as - 12. Solve 2l - sf = -6f + 4, -2f - 19 = -3l for l. 5 Let i(a) = a*2 + 8a. Let k be i(-7). Let g = -5 - k. Let l(j) = j - 7. Let n be l(9). Solve gt - u = 2u - 7, 3t + 4u = -n for t. -2 Suppose -11j + 12 = -7j. Suppose -2n - js + 43 = 2s, -4s - 91 = -5n. Solve 9 = -u + 3p, u = 4u - 5p + n for u. -3 Let f(o) = -o + 7. Let s = 1 - -4. Let u = s - 0. Let p be f(u). Solve 2 + 0 = -pg + q, 5g + 6 = 2q for g. -2 Let l(n) = -n2 - 8n - 5. Let s be l(-4). Suppose -m + 0 - 2 = 0. Let b be m + (-4)/(8/(-14)). Solve -3z + 6 + 3 = a, -z = ba + s for a. -3 Suppose -3d + 3n = -d, 4n = 8. Let r = 7 - d. Solve -p - 2k + 14 = 0, k + 4 = -rp + 5k for p. 4 Let l(g) = -g*3 + 8g*2 + 2g - 11. Let r be l(8). Solve rs = 3v - 9, -s = -4v + 2v + 6 for v. 3 Let r(x) = -x*3 - 3x*2 - x - 1. Let l be r(-3). Let b = -40 - -50. Solve -lp - m + 8 - 1 = 0, 4p - 2m = b for p. 3 Let f be (-3)/(-1 - 2) + -2. Let m be (1 + 0)f/(-1). Let k = m + 2. Solve -kh + 2 = 2g, h + 3h = 0 for g. 1 Suppose -5h + 72 = -4g + 28, g - 2h + 14 = 0. Suppose -2c = -3c. Let v = c - g. Solve 4m + v = -n, -5n = 3m - 0 - 4 for m. -2 Let m = -42 - -45. Solve 5w - 29 = u - mu, -4w + 28 = 4u for w. 5 Let a = -11 - -13. Suppose 0 = 4h + h + 90. Let m = h + 32. Solve -2j - at = -4, -5j = -0j - t + m for j. -2 Let h be (2/3)/((-2)/(-15)). Solve 3s = 3x - x - 2, -hs - x = -1 for s. 0 Let s be 4 + -2(-3)/2. Let x be 6/(0/(-2) + 2). Solve 4n = -st + 2t - 41, 0 = xt + 3n + 27 for t. -5 Suppose -4p + 25 = p. Let y = -18 + 28. Let k be 24/15y/4. Solve px - 5 = 0, x - k - 7 = -5r for r. 2 Let f(b) = 7b. Let l be f(1). Let m = l + -5. Suppose -mo + 2 = -0o. Solve o = y - 3u, 0 = -u + 4u - 3 for y. 4 Let j = 98 + -94. Solve -3d = -5u + 13, -ju + 7 + 1 = 0 for d. -1 Suppose 1 = w - 1. Solve -4c - 2m = -24, wc + 3m = m + 14 for c. 5 Let f = -120 - -176. Suppose o + o = f. Solve -5i - 2q = o, -q + 8 = -5i + 2q for i. -4 Let l(q) = -4q3 + 2q*2 - 1. Let o be l(-1). Suppose oi - 48 = -18. Solve 4f - ir + 5r = -17, -3f = -r + 14 for f. -3 Suppose 3x + z - 5 = 0, -2x + 5z - 24 = 1. Solve x = -m + 4m - 12, -2j - 12 = -5m for j. 4 Suppose 2f + 4o + 52 = -f, 0 = -2f + 3o - 29. Let p = 43 + f. Let i be (4/(-6))/((-3)/p). Solve -5w - 4q = 17, 3q = 3w - 0q - i for w. -1 Suppose -17d + 19d = 4. Solve 4 + 3 = -3z + 2w, 0 = 2z - dw + 2 for z. -5 Let p = -2 + 2. Suppose 0 = 2f - pf - 12. Solve 0 = -o - 3, o = -4t + fo - 1 for t. -4 Let t be 6/(-15) + (-14)/(-10). Let a = -5 - t. Let k be a/9(-3 - 0). Solve -4o + 4 = 2n, 2 = 4o - ko + 4n for o. 1 Suppose 4x - 2a - 56 = 8, -8 = -4a. Solve -4h - x = 5n, 13 = -2n + n + 4h for n. -5 Let z(q) be the second derivative of q4/12 - q3/3 - 3q2/2 - q. Let m be z(-2). Solve 3a - 2f = 7, 5a + 4f = 46 - m for a. 5 Suppose 0 = -b + j + 11, -b + 17 + 4 = -3j. Solve 0 = 2k + 3q - 2, -b = -k - 3q - 2 for k. -2 Suppose j - 14 = 4q - q, 4q = 3j - 37. Suppose -2d = m - j, 6d - 2d - 2 = 2m. Solve 4c - 4 = 0, -4h + dc + 0c = 7 for h. -1 Suppose -3h - 2h + 21 = 2d, 15 = h + 4d. Solve 25 = -4p - p, -5g = hp - 10 for g. 5 Suppose 2o + 2 = -2. Let n be (o/5)/(8/(-40)). Solve -x - l = -nx + 4, 0 = -3x + 5l + 20 for x. 0 Let c(m) = m + 29. Let o be c(-16). Solve 0 = 4w - k - o, w - 2k + 2 = 7 for w. 3 Let c(p) = -p3 - 3p*2 + 4p + 4. Let q be c(-4). Let o(w) = 9w2 - 2w + 2. Let h be o(2). Solve -3l + h = -8l + 3j, -4l - qj = 8 for l. -5 Let g(y) = 8y + 16. Let k be g(-2). Solve 5b + 7o - 2o + 10 = 0, k = -4b - 3o - 8 for b. -2 Suppose -3x + 5x = 16. Let q be -4x/6-3. Suppose 0 = -0k + 4k - q. Solve 16 = -4o, -c + 6c - 41 = ko for c. 5 Let o = 1 - -4. Suppose 3k + 4u - 2 = 2u, -45 = -5k + ou. Let h = -22 + 24. Solve -16 = -hq + 4t, kq = q + 2t + 12 for q. 2 Suppose -5d = -2v - 61, 4v - 106 = -5d - 33. Solve 0 = -j - 5r + 19, j + 2j = -4r + d for j. -1 Let i be -4 - ((-28)/(-2))/(-2). Solve -ic + 0c - o = 20, -2o = 2c + 20 for c. -5 Suppose 0 = 5w + a - 13 - 1, 0 = 3w - a - 10. Solve -w = -p + k - 4, -2k + 6 = 2p for p. 1 Suppose -o + 13 = 2y, 0 = 2o - 3o + 3y - 12. Suppose w + ol - 5 = -3w, -5 = -5w - 5l. Solve 0 = -ws - 3u - 8, -3u = -3s - 6 + 24 for s. 2 Suppose 2y - 16 = -2. Let n be 57/21 + 2/y. Suppose -d + 6d + 32 = 3x, -x - d = -8. Solve -5t = -m + 4 + x, nm + 2t = 5 for m. 3 Let r = 4 - 3. Suppose 0 = 3k - 3z - 2 - r, -32 = -5k - 4z. Solve l - 2x = -k, 5l + x = 13 - 0 for l. 2 Suppose s + 3p - 9 = 0, 2s + 3p - 14 = p. Solve -3l + 3w = -s - 0, 3l + 2w = 1 for l. 1 Let c be -3 + 5 + (-1 - -1). Suppose -b - 10 = -t + 4b, b + c = 0. Solve t = 4v + 5g - g - 20, -18 = 2v - 5g for v. 1 Suppose -h - c = -7, 0c = 5h - 5c + 5. Suppose -hm = -0m. Let a(u) = -u + 4. Let j be a(m). Solve js = -2f - 16, -3f + 8 = -2s - 2f for s. -4 Let q = 59 - 58. Solve 2l = -3a - 0 - q, 5a + 3l + 2 = 0 for a. -1 Let s be (-7)/(-2) - 1/2. Suppose 2k - 4f + 12 - 36 = 0, 4k - 3f - 28 = 0. Let g be 1/(2/k)4. Solve -3r = -6, -sn + 2n + g = 3r for n. 2 Let c = -183 - -187. Solve -f = f + 5j + 29, 3f + cj + 26 = 0 for f. -2 Suppose -m - 20 = -5m. Let d(y) be the first derivative of -y4/4 + 7y*3/3 - 7y*2/2 + 9y + 1. Let v be d(6). Solve -va = -0h + 2h + 8, 5h = -m for a. -2 Let t be (2/4)/((-1)/(-16)). Suppose 10d - 8 - 22 = 0. Solve dv = 5u - t, -3 = -4u - 5v + 4v for u. 1 Suppose 9o - 80 = 4o. Solve 0 = 5j + 3r + 4 + o, 3r + 10 = 5j for j. -1 Let o be (3 + -6)(-1)/1. Solve 0 = -2w - 2m, 0 = -2w + 5m - om - 16 for w. -4 Suppose -13z = -7z - 126. Solve 5h + 41 = -2k + 6k, -5h = k + z for k. 4 Let g(k) = 2k2 + 7k. Let v be g(-4). Solve -vx - b - 5 = 0, -3x - b + 3 = 2b for x. -2 Suppose -3w - 2w = 0. Let g be (w - 1)/((-2)/38). Suppose -18 = -r - 3h, -g = -3r - 0h - 2h. Solve 3l - 30 = 3d, rl = 2 + 13 for d. -5 Let h be (-20)/6-1 + 10/15. Solve 5n + 4f - h = 5, 3n - 5 = -2f for n. 1 Let c(q) = 2q + 5 + 1 - 5. Let m be c(3). Suppose -r + l + m - 2 = 0, 5r - 2l - 10 = 0. Solve -3o + ro = -4f + 14, 2f = 2o + 8 for f. 2 Let h = 22 - 22. Suppose hw = -5w. Let i(f) = -f2 - 5f - 2. Let a be i(-2). Solve au + 20 = w, 2o - 5u = 9 + 16 for o. 0 Suppose -2t + 0d + d + 7 = 0, 5t = -3d + 23. Let p(m) = -23m + 1. Let k be p(1). Let u = k - -41. Solve tx = -3n + 24, -x - 4n + u = -0n for x. 3 Suppose -10 = -d - 4d. Solve q = -y + 1, -dy + 5q + 2 = -0 for y. 1 Let m be 8/36/4. Let f = -4 + m. Suppose -4v + 2x + 12 = -fx, -22 = -4v - 3x. Solve 2t - 11 = -3u - 2t, 5t = vu + 6 for u. 1 Suppose d = -2a + 6 + 6, -4d + 3a + 4 = 0. Solve -2o - dt + 0t = 20, 0 = -4o - 5t - 25 for o. 0 Suppose 84 = 30p - 2p. Let a be -1 + 5 - 4/2. Solve ag + 5 = -s, 14 = -ps + 4g - 1 for s. -5 Let d(x) = 7x + 18. Let i(n) = 4n + 9. Let t(j) = 3d(j) - 5i(j). Let r be t(-9). Solve -3s + g = -rs - 8, -g = -s + 6 for s. 1 Let v(j) = j2 + 3j + 3. Let z be ((-3)/(-1)-1)/1. Let b be v(z). Solve bl + 6 = -3i, 4l = 3i + i for l. -1 Suppose 0 = 3z + 5m + 4, -3z - 3m - 12 = -0z. Let f = 11 + z. Solve 2y = 4h + 4, 2 = 4y - 2h - fh for y. -2 Suppose 0 = -2d - d + 39. Let o = -1 + 3. Suppose -2m + 5q - o = 0, -7 = -4m - 5q + 19. Solve -3a + 3h = 2h - 18, 0 = -5a - mh + d for a. 5 Let p(z) = 2z + 11. Let s be p(-4). Solve 0 = 5h + sd - 4, 0 = -3h + 6h + 3d for h. 2 Let j(k) = -4k*2. Let l be j(-1). Let s be l/(-4) - (1 + 136). Let b be s/(-36) - 4/(-18). Solve -4z + 5c - 6 = -4, bz - 10 = -c for z. 2 Let s(b) = b*2 - 2b. Let j be s(3). Solve -9 = -5r + 5o - 39, -jr - 5o + 22 = 0 for r. -1 Let z be 4/(-4)(1 + -12). Solve g + 2h + z = 5h, 4h = 16 for g. 1 Let q be -1(1 + 2)-3. Let k be (q/(-6))/(3/(-8)). Solve -2i - ky + 0y = -16, 3i - 2y = 0 for i. 2 Let l be ((-6)/8)/((-3)/8). Solve 3h + 26 = -4o + 9, lo = -h - 7 for h. -3 Suppose 4j - 7 = 5q, 2j = -3j + 5q + 10. Suppose 0 = -u - 2r + 1, 4u + 9 = -5r - 2. Let w = -5 - u. Solve -2o + wn + 11 =	{ "pile_set_name": "DM Mathematics" }
r is positive. r(-30/11) Simplify (o18)(-1/5) assuming o is positive. o(-18/5) Simplify k*(4/9)k/(k/k(-1/4)) assuming k is positive. k(7/36) Simplify ((t(-3/8)/t)/((t/t6)/t))/(t*(-1/6)tt/(t/(t/t(2/7)))tt) assuming t is positive. t(181/168) Simplify w(1/2)ww/w(1/5)w/((w*(-9)/w)/w)w(-2/5) assuming w is positive. w(139/10) Simplify (h/h*8)/((h/(h/(hh(-20))))/h) assuming h is positive. h13 Simplify (lll/(l*(-3)/l)l)49/(l/l(-2/11))(-26) assuming l is positive. l(4650/11) Simplify ((ggg/g(-7))/g)/(g(-5)gg) assuming g is positive. g12 Simplify (s(-1/3)s(-4/3))/(((s(-3/5)/s)/s)/s(1/5)) assuming s is positive. s(17/15) Simplify (d/(d/(d/d(2/9))d)(d/(d/(dd(1/2))))/d)(-1/24) assuming d is positive. d(-5/432) Simplify (((a/a11)/a)/a(-1/17))(-7/13) assuming a is positive. a(1302/221) Simplify g/g(5/6)gg/g*(6/7)g*(2/3)/gg/(g/g9) assuming g is positive. g(419/42) Simplify y/y*(-2/5)yy0(y*(-1/10)y)/((y*(2/9)/yy)/y) assuming y is positive. y(367/90) Simplify k(8/7)k/(kk/k*(-13))k assuming k is positive. k(-83/7) Simplify l(1/10)/l(-2/35) assuming l is positive. l(11/70) Simplify (s/(s/((s*(-1/4)ss)/s)))46/(((s(-1/3)/s)/s)/((sssss(3/5)s)/s)) assuming s is positive. s(1243/30) Simplify b(10/7)/b(-20) assuming b is positive. b(150/7) Simplify t(-10/11)/t11 assuming t is positive. t(-131/11) Simplify (j(-6/11)j)(-9/2) assuming j is positive. j(-45/22) Simplify (m/m5)(2/49) assuming m is positive. m(-8/49) Simplify ((a/(a/a10))/a)/a(6/17) assuming a is positive. a(147/17) Simplify (g/g(-8)g)/gg(1/12)g*(-3)g/(g/(gg(-1/6)g)) assuming g is positive. g*(95/12) Simplify ((mm*(-1))/(mm(mmm(mmmmmmm*(3/8))/mm)/m))/(m/(m/(m/(m/(m/(mm(-2))))m))m(-7)) assuming m is positive. m(-51/8) Simplify (s(-5/4)/s11)(1/16) assuming s is positive. s(-49/64) Simplify (p(-11)p)/p(-1/5) assuming p is positive. p(-49/5) Simplify (ttt*(-2/17)tt(-8)t)2 assuming t is positive. t(-140/17) Simplify ((p*(-3)p)/p)(1/19) assuming p is positive. p(-3/19) Simplify (((b/(b/(b*(-1)b)))/b)/b)*(-15)/((b/(bbbb*(-4)bb))/b(5/2)) assuming b is positive. b(65/2) Simplify ((h5)(4/13))41 assuming h is positive. h(820/13) Simplify (d1d(3/7))(-50) assuming d is positive. d*(-500/7) Simplify ((oooo6)/o(-13/4))(-1/30) assuming o is positive. o(-49/120) Simplify n*(-29)/((nnn(7/3))/n) assuming n is positive. n(-97/3) Simplify ((f(-2/15)/f)(-26))3 assuming f is positive. f(442/5) Simplify (t(t/(tt(1/4)t)t)/tttt(1/16))/(t(-7)t/t8) assuming t is positive. t(253/16) Simplify yy*(-1/10)y*(-19)y assuming y is positive. y(-171/10) Simplify (n/(n(2/5)nn)n)/(n0nnn)(nn(-1))(-15/2) assuming n is positive. n(-17/5) Simplify g(2/13)/(g*(-7)/g)((gg/(gg/(g*(-9/2)g)g)g)/g)/g(1/11) assuming g is positive. g(1019/286) Simplify (ooo(-4)/o)(-2/21) assuming o is positive. o(2/7) Simplify i3i/(i/i(2/21))i(-1/10)/i(-2/13) assuming i is positive. i(8597/2730) Simplify (j(-2/11))(-5) assuming j is positive. j(10/11) Simplify ((d/(d*(2/15)d))/(d/(d/(dd7))))/(dd*3d(d/d(-1))/d) assuming d is positive. d(-212/15) Simplify (t(1/18)t)/(t/t(-1/23)) assuming t is positive. t(5/414) Simplify ((q/q(-7))/q0)/(q*(-3)q(-1)) assuming q is positive. q12 Simplify (jjjj(-3))/(j(j/(j/j*(-1/4)))/j)j6/(j/j(1/3)) assuming j is positive. j*(67/12) Simplify (zz*(-1/15))/(zz/(zz(17/2)/z)) assuming z is positive. z(223/30) Simplify (a(-1/6))42 assuming a is positive. a(-7) Simplify (jjj(4/7))(-28) assuming j is positive. j(-72) Simplify j6jj/(((j/j9)/j)/j)j(-9)/j(-4/7) assuming j is positive. j*(67/7) Simplify (ll9)(5/2) assuming l is positive. l*25 Simplify (qqq(1/3)q/(q(q/q(-4))/qq))/((q/((q(qqq3)/q)/q))/((q/(qq/q(2/21)))/q)) assuming q is positive. q(-11/7) Simplify l/((ll(-2/15)/ll)/ll)l(l(-17/3)/l)/l assuming l is positive. l(-98/15) Simplify i/((i(3/34)/i)/i)i/(i/i(11/3)) assuming i is positive. i(671/102) Simplify n/n*4(nn8)/n(n/((n/n*7)/nn))/(n0/n) assuming n is positive. n13 Simplify a(2/31)/a5 assuming a is positive. a(-153/31) Simplify y(-24)/((y/((y*(-2/9)/y)/y))/yy) assuming y is positive. y(-245/9) Simplify (m/(m(2/3)/m))/(m/((m/(m/(m(-8/3)/m)))/m)) assuming m is positive. m(-13/3) Simplify (w/(w/w*15w))/(w/(w*(-8)/w)w) assuming w is positive. w3 Simplify (a(2/13)a(-5/3))/(((aa/(a/(a/(a/((a/((aa(2/13))/a))/a))a)a)a)/a)/aa(-3/4)) assuming a is positive. a(-95/156) Simplify ((b(2/5))(-5/17))(-39) assuming b is positive. b(78/17) Simplify (z(-1)/z(3/10))/(z(1/4)(z/(zz(1/4))z)/z) assuming z is positive. z(-13/10) Simplify ((c4)(-34))(-1/3) assuming c is positive. c(136/3) Simplify ((((v(-1/6)v)/v)/v)/v)/vvv/v(-1/34) assuming v is positive. v(-58/51) Simplify x(-4)x(2/65) assuming x is positive. x(-258/65) Simplify (c*(24/7)c)/(c/c14) assuming c is positive. c(122/7) Simplify w24/w(-20) assuming w is positive. w44 Simplify (c0)*(1/65)/((cc*(-5)c)/((cc(4/13)cc)/c)) assuming c is positive. c(69/13) Simplify (t/t(-1/3))(-1)(t/t*(-8))/(t/(tt/(t/(t(t/(t/t(-1/4)))/tt))t)) assuming t is positive. t(113/12) Simplify (v6)(10/3) assuming v is positive. v20 Simplify ((mm10)/m)36 assuming m is positive. m360 Simplify (f/(f/f(2/7))f)(1/69)/(f(2/3))(-10/7) assuming f is positive. f(67/69) Simplify k2((k/k*0)/k)/k((kk(-6)k)/k)/(k*(-3/5)k) assuming k is positive. k(-22/5) Simplify (y(4/13)y)/y(9/7) assuming y is positive. y(2/91) Simplify (m/m(-1/2))/(m/(m3m))(m(-5)m)/(m/m(-5/3)) assuming m is positive. m(-13/6) Simplify (f(2/7))20f(-10)f/f(-3/10) assuming f is positive. f(-209/70) Simplify ((p(p(1/5)/p)/ppp)/(p/(((pp*(-1/13)p)/p)/pp)))/((p(1/9)p)/(((p/(p*(-2/3)ppp))/pp)/pp)) assuming p is positive. p*(-773/585) Simplify (c/(c(c/(cc(3/10)c))/c))13 assuming c is positive. c(299/10) Simplify (((l/(l*(-1/5)/l)l)/l)/l)/(l/(l(l(-2/3)lll)/l)l)l*(-4)ll4 assuming l is positive. l(38/15) Simplify (p(-6)/(p(-8)/p))/((p(2/19)/p)/(p/(p4p))) assuming p is positive. p*(-2/19) Simplify y(y(y/y(-10))/y)/yyy/y(2/43) assuming y is positive. y(557/43) Simplify (u/(u/(u(1/5)uu)))32/((u/(((u/(u/(uu*9/u)))/u)/u)u)/(u*(1/9)/uu)) assuming u is positive. u(3398/45) Simplify y(2/7)/(y(-13)/y) assuming y is positive. y(100/7) Simplify yyyy/y19y4 assuming y is positive. y(-11) Simplify (c(-2))25 assuming c is positive. c*(-50) Simplify rr*13r(1/8) assuming r is positive. r(113/8) Simplify (((h*(6/11)/h)/h)/hhh/(h/(h/(hh/(h1/h)))))/(h/(((h(-2/9)/h)/hh)/h))(-49) assuming h is positive. h(15388/99) Simplify (g/(g(-6)/g)ggg*(2/13)/gg)/(g*(1/10)/(g/(g/(gg*(3/11)/gg)))) assuming g is positive. g*(16197/1430) Simplify (aa/a0)8/(a*6aaaaa/((a*(2/23)a)/aa)) assuming a is positive. a(140/23) Simplify ((a(-7/3)/a)/a)(-2/49) assuming a is positive. a(26/147) Simplify (b/(b/(b/(bb/(b/(b/(b/(b/b*(-5))))))))b(b/b(-8))/b)/(b(2/3))(26/7) assuming b is positive. b(11/21) Simplify s(-20)/ss(8/9) assuming s is positive. s(-181/9) Simplify ((xx/(x/(x/x(-8))x))/x)/(x/(x*15xx)) assuming x is positive. x24 Simplify (s(s/(ss/(s/(s(-2)ss))))/ss)(3/22)/(s/(s1ss))(7/10) assuming s is positive. s(169/110) Simplify (b/(b/(bb1b)))*(2/9)(((bb(3/2))/b)/b)/((bb*1)/bb) assuming b is positive. b(-5/6) Simplify (u(-1/8)uu*8u)/(u*(-2/5)u/((u/(uu/((u(2/5)u)/u)))/u)) assuming u is positive. u(307/40) Simplify (h(1/23)/h)/hh(-5/3) assuming h is positive. h(-250/69) Simplify (vvvv*0/vvvvvv*(-6/5)/v)/((v(v*(2/5)/v)/v)/vv8) assuming v is positive. v(-13/5) Simplify (i*(-1)i)/(ii*(-3/14)	{ "pile_set_name": "DM Mathematics" }
0). Solve 0 = -2q - 6, 3q + 1 = -yj - 0q for j. 2 Let n be (8/(-10))/(-34/120). Let i(c) = 10 + 2c*2 - 3c*3 + 7c + 5c2 + 2c*3. Let g be i(n). Solve 2f - 3x - 2x = 17, -gx + 6 = -4f for f. -4 Suppose 5k - 9 = -r + 5r, 0 = 4r - 16. Let d(n) = kn + 4n2 - n + 3n - n*3 - n. Let q be d(5). Solve 0 = c - qc + 2p + 4, -c = -3p - 1 for c. 1 Suppose -16s - 12 = -22s. Suppose -8 = -sp - 4. Suppose -6o = -o. Solve 2f = 5y - y, o = -f + 4y - p for f. 2 Let h = -5 + 7. Suppose -27g = 12 - 147. Solve -hy - 2o = 8, -go = -y + 10 + 4 for y. -1 Let z(j) = j3 - 6j*2 + j + 6. Let a be z(6). Let v = a - 8. Solve 2k + 3k - 26 = -vm, -4m = k - 18 for m. 4 Suppose 3c - 12 = 0, -c = q + 2q - 16. Suppose -5z + 3m + 2m = -5, 3z - qm = 4. Solve z = -3u + 4g - 4, -5u - 2g + 38 = 10 for u. 4 Suppose 4y = f + 1 + 6, -4y + 22 = 2f. Let v(p) = p3 - 5p*2 - 1. Let u be v(6). Solve 3o = 2x - 2o + u, 2x - 15 = -fo for x. -5 Let w = -75 + 83. Let h(d) = d*3 - 8d*2 + 2. Let x be h(w). Solve -3u = 0, 4g - 4u - 2 = x for g. 1 Let l(o) = 2o. Let k be l(3). Suppose -62r + 44 = -40r. Let b be 8/(-6)36/(-24). Solve 0 = -bq - rx - k, -q - q + 5x + 22 = 0 for q. 1 Suppose -d = -2x - 1, 0 = 5d - 3d + 2x - 8. Solve -5z + n = 15, -5z + 21 = -dz + 5n for z. -2 Let a be ((-6)/9)/(2/(-15)). Suppose -24 = c - ac. Solve 4o = -2y + c, 3y + o + o = 9 for y. 3 Suppose -94 = -5q - p, -4q + 5q - 18 = -p. Suppose -7r + q = -6r. Let d = 19 - r. Solve d = -4x - 4k - 17 - 3, x - 10 = 2k for x. 0 Suppose 4q - 11 = -4d + 25, 3d = q - 17. Solve -c = 5k + 13, -4c - k - q = -c for c. -3 Let p(j) = 5j + 87. Suppose -17r - 189 = 100. Let o be p(r). Solve -w = 4z - 13, -ow + 4z = -3 + 13 for w. 1 Let g(r) = r2 - 61r + 39. Let z(p) = p*2 - 30p + 20. Let x(a) = -3g(a) + 5z(a). Let o be x(-18). Solve 2i + 0j + 3 = j, 3i + 5j = -o for i. -4 Let w(u) = -u*3 - 7u*2 - 14u - 9. Let p(t) = 2t2 + 13t + 1. Let x be p(-6). Let j be w(x). Solve -3b - 2g = -g - 6, 0 = -2b - 3g + j for b. 1 Let o be (((-150)/35)/(-5))/(9/42). Suppose 2k + 8 = 5t + 3k, 4k + 16 = ot. Solve 2 = -tz, -5 = -4g + 4z + 7 for g. 2 Let l = 83 + -75. Suppose 5z + lm - 100 = 3m, 5m + 44 = 4z. Solve 0 = -i + 5f - 1 - z, 2f = 8 for i. 3 Suppose 84 = -i - 3i. Let l = i + 24. Let j(q) = -q*2 + q + 10. Let b be j(l). Solve 2s = -bz - 2s + 28, s = z - 3 for z. 5 Suppose -9l + 12 = -6l. Let v be l(78/108 - (-4)/(-18)). Solve -4g + 20 = 4f, -f - f + 2g = -v for f. 3 Let k = -187 - -297. Suppose 2i - 50 = n + 3n, -4i = -3n - k. Solve 3m = -m - 4z + 36, -z = 5m - i for m. 5 Suppose -2r - 3r - 4y = -153, 2r - 3y - 52 = 0. Solve -4s + 2d + r = 1, -2 = 2s + 3d for s. 5 Let l(m) = 9m + 2. Let p be l(2). Let d(c) = c2 - 11c - 10. Let t be d(12). Let b be (-5 + t)(-2)/3. Solve 0 = -5w - 4z - p, -bw + w - 4 = 4z for w. -4 Suppose 4j - 2o - 92 = 0, 43 + 1 = 2j - 2o. Solve 5l - 5c = -c - 36, 4l - 2c + j = 0 for l. -4 Suppose -2v + 4 = 4p - 0, -11 = -3v - p. Solve -7a + 2a - 1 = j, 0 = 3j - va + 3 for j. -1 Suppose 2o - 40 = -5p, -4o + p - 2p + 80 = 0. Suppose -3h - 2h = -o. Suppose -c = -hc + 9. Solve 4 = cj + 10, -2j = z + 6 for z. -2 Let r be (14/(-4))/((63/(-14))/9). Suppose -rm + 5m + 8 = 0. Solve -x - 3u = -5, 4u - 1 = -mx + 11 for x. 2 Suppose 0 = 5c + 5v - 300, 4c + v = -c + 280. Let z = -53 + c. Solve -5 = -zx + o - 2, -4x + 3 = -5o for x. 2 Suppose 19p - 260 - 44 = 0. Solve f = -3f - 5o + p, -4f = -5o - 16 for f. 4 Suppose -g = -2c - 202, 0c - 829 = -4g + c. Let d be (-14)/(-4)g/28. Solve -d = 2o + 4t, -4o - 5t - 23 = 17 for o. -5 Suppose 4s = -a + 44, -a + 25 = -3s - 5. Let l be 6/(-15) + a/15. Solve -2h = 2f - 10, l = 5f - h - 5 for f. 2 Let v(b) = -b*3 - 11b*2 + 12. Let o be v(-11). Let m be ((-4)/o)/(3/9). Let u be (m + -1)(-1 - 1). Solve ut + 4l - 1 = 3t, 3l = 3 for t. -3 Let f be 840/18 - 4 - 1/(-3). Suppose f - 37 = 3t. Solve -5r - 24 = -4v, r - 4v + 6 = -tv for r. -4 Let v be (48/21)/1 + 40/(-140). Solve 5 = 3l - 5l + b, -vl = 2b + 14 for l. -4 Let b be 4 + 1 + -2 + -1. Suppose -v = q + 1 - 8, 5v = -q + 19. Solve 0 - 4 = -vz - bh, -4h + 6 = 5z for z. 2 Suppose 4 - 9 = -g. Let t be (0/2)/(-2 - -1). Suppose -2w + 2j + 16 - 6 = t, -2w - 4j + 10 = 0. Solve wa - 32 = 3x, -ga = -0x + 3x - 8 for x. -4 Let d(u) = 3u - 3. Let o be d(4). Solve -3j - 2t = o, 0 = -3j + j + 3t - 6 for j. -3 Let k be 261/(-435) + (-9)/(-15). Let v(s) = s*2 - 2s - 4. Let o be v(5). Solve k = 4r - 3f + o, 0 = -5r + 4f + 2 - 16 for r. -2 Suppose 5a + 102 = -4w, -2w = -3a - 6w - 58. Let o = a + 32. Let r be (-11 + o)/(2/(-4)). Solve 2k + 3h - 31 = -3k, 0 = k + rh - 9 for k. 5 Let a = -56 + 56. Suppose c - 6c = -10. Let f = c + 3. Solve -j - 4b - 13 = -aj, -fj = 5b + 20 for j. -1 Suppose -14 = -h - h. Let y = -1 + h. Let q = 4 + y. Solve 3i = -3a + 30, 0a - 2a - q = -4i for i. 5 Let c = 7 - 12. Let l(o) = o2 + 6o + 8. Let z be l(c). Solve -5r = -zx + 2, 3r = r - 4x - 6 for r. -1 Let s(j) = j*3 + 4j*2 - 5j + 5. Let w be s(-5). Let m be 9/116/6. Solve wx + m = -q - 0, -2x = -3q + 13 for x. -5 Suppose -4g + 94 = -2t - 0t, -5g + 3t = -120. Suppose -5z + 2h = 5h + 8, -4z = 5h + 9. Let r = z + 10. Solve 3o = -b + r, -3o - b + g = 4b for o. 2 Suppose 44n + 15 = 47n. Suppose -nq = 15, -4y + 24 = -0y - 4q. Suppose 2c - d - 6 = -0d, 0 = 3d - 12. Solve 3o = 4m + y, 5m - 4 = o - co for o. 1 Let w be -14-12(-8)/(-448). Solve 25 = 5q, -wr + 2r = q - 8 for r. 3 Suppose 5q = 5p - 385, 2q + 5 = q. Suppose 18r - p = 10r. Solve 0 = 5a - s - 19, 4s = 2a + 5s - r for a. 4 Suppose 0 = 4u, 0 = -b - 3u - 16 + 6. Let z be ((-15)/(-2))/(2/(-4)). Let t = b - z. Solve 3h + 2g + 17 = -2h, 0 = 5h + 5g + t for h. -5 Suppose k - 3y = -4, 2y = -6k + 4k + 8. Let z be (k/3)/((-2)/(-15)). Solve 23 = -3o - zd, 2o - 7o = -3d - 7 for o. -1 Suppose 72w - 67w - 85 = 0. Solve -g = 3o + w, -20 = o + o + 5g for o. -5 Let z be (-1)/(-7) + (-169)/(-91). Solve p - zp + 5a + 7 = 0, 5a + 13 = 4p for p. 2 Suppose 13j + 20 = 59. Suppose 5c - 3f = 37, j = -c - 2f - 0. Solve 4m - 4o + 9 = 1, cm = 3o for m. 3 Let y(t) = t*3 - 5t*2 - 6t + 2. Let s = 18 + -12. Let w be y(s). Let o = -5 + 10. Solve -k + 0k + 2 = -oc, 3c + 9 = -wk for k. -3 Let d(i) = -3 + 4i - 3i - 3i - 10. Let s be d(-9). Suppose 0 = -2f - 0p - p + 23, -5f + sp + 35 = 0. Solve 0 = -l + 4g - 4, 4l - g + f = -6 for l. -4 Let d(h) = -h2 + h + 8. Let f be d(3). Solve 33 = 5c + 4a, c + f = 5a - 3 for c. 5 Let t = -21 + 10. Suppose -5v + 138 = 4d, -2d - 3d = 3v - 166. Let a = d + t. Solve -2b - 3b - a = 4n, -2n = -2b - 12 for n. 1 Suppose 1507r - 1510r + 78 = 0. Solve 0 = -2a - 4g - r, 11a - 7a + 4g + 36 = 0 for a. -5 Suppose -2l - 50 = 5w - 85, 5w - 45 = -4l. Solve r = ws + 7, -2s - 3 = -3r - 8 for r. -3 Let b(x) = -2x + 12x*3 + 2x + 2x2 + 4x*3. Let t be b(-2). Let a be t/(-66) - (-4)/22. Solve 3g + i + 23 = -g, -ag - 7 = -i for g. -5 Let l be (48/4)/(-11 - -13). Solve 3g + l = 2k - 6k, -5g + 13 = -k for g. 2 Suppose 2t + 14 = 5j, 0j = -t - j. Let q be 4/t - (-6 - -7). Let c = -1 - q. Solve -5w = -ch + 11, -h + 6w + 5 = 4w for h. 3 Let p be (-1 - -2)/((-5)/75). Let j be p/624/(-30). Suppose -v + 0r + 2r + 13 = 0, -jr - 1 = 3v. Solve b = -d + 10, -3b = 2d - vd - 10 for b. 5 Let y = -338 - -343. Solve -yw = 4c, -4c + 16 = w - 0 for c. 5 Let y(v) = -v2 + v - 1. Let w(m) = m2 + 10m - 14. Let p(l) = w(l) + 2y(l). Let q be p(10). Solve 0 = j + 3i + 11, j - 5i - 1 - q = 0 for j. -5 Let z = -351 - -356. Solve -zl = -0l + 5w + 25, 3l - 17 = 5w for l. -1 Let b be 44/110(-45)/(-6). Solve 5f - 8 = -bj, 39 - 7 = -4j + 4f for j. -4 Let w(q) = q3 + 8q*2 - 11q - 2. Let n be w(-9). Solve n = 4z + 5d, 4d = -2z - d + 8 for z. 4 Let t be -4 + 13 + -8 - -3. Solve -tn - 4 = f, -4n - 12 = 9f - 6f for n. 0 Let h(n) = n*3 - 20n*2 - 20n - 21. Let m be h(21). Suppose -4x = -3x - 4l - 20, m = -3x + l + 38. So	{ "pile_set_name": "DM Mathematics" }
1 in 1/127, 29, 0.03, -4.6? 0.03 What is the closest to -60 in 5, -0.2, -40? -40 What is the nearest to -1 in 81/58, -7/27, 0? -7/27 Which is the nearest to 0.1? (a) 3 (b) -1 (c) -2518 b What is the nearest to -1 in -0.22, -3, 5, -0.3, -24? -0.3 What is the nearest to 6806 in 1, 0.5, -17, -0.2? 1 Which is the closest to -2? (a) 2/5 (b) -0.064 (c) 1/5 b Which is the closest to -1/3? (a) -2/13 (b) 2353 (c) 0 a Which is the nearest to 2? (a) 2/73 (b) 3 (c) -4 (d) 2 d Which is the closest to 1/4? (a) 0.97 (b) 8 (c) 4 (d) 0.04 d Which is the closest to -348? (a) 1 (b) 2.1 (c) -0.4 (d) -0.3 c What is the closest to -2 in 17, -12, -3/5, 15, -0.3? -3/5 What is the closest to 434 in -0.5, -0.2, -2/9, -4? -0.2 Which is the closest to 0.1? (a) -118/17 (b) 0.2 (c) 1 b Which is the nearest to -1? (a) 2/15 (b) -5/41 (c) -2/9 c Which is the closest to -1? (a) -0.3 (b) 0.4118 (c) 2 (d) 3/4 a What is the closest to -2/7 in -5, 23, 0.2, -0.59, -3? -0.59 What is the nearest to -1 in -2/45, -3/2, -0.3? -3/2 What is the closest to 1004 in 3/5, -2, 5, 1, 2? 5 Which is the nearest to -0.3? (a) -5 (b) -27.79 (c) -0.06 c Which is the nearest to -848? (a) -3/2 (b) -0.3 (c) 2 (d) 0 (e) -4/17 a What is the nearest to -25 in -39/5, 1, -2.1? -39/5 What is the nearest to -1 in 0.2, 149, 0.1, 1/3? 0.1 What is the closest to 0.69 in -144, -2, 2/11? 2/11 What is the nearest to -0.4 in -0.2, -11, 0.06, 5? -0.2 Which is the nearest to -1/3? (a) -3.9 (b) -15 (c) 3/5 (d) 0.1 d Which is the nearest to -2/7? (a) 2 (b) 2781 (c) 1.3 (d) -2/5 (e) 0 d Which is the nearest to 1? (a) 215111 (b) -0.4 (c) -0.5 (d) -2/7 d What is the nearest to -3/4 in 9, 3/4, -2/9, -0.1, 0.1? -2/9 Which is the closest to 1? (a) -2/13 (b) 0.6 (c) 2/11 (d) 3140 b Which is the nearest to 0.3? (a) -3/3622 (b) -0.3 (c) 6/7 a What is the closest to -192 in -51, 2, -14? -51 Which is the closest to -1? (a) -0.0315 (b) -8 (c) -1/3 c What is the closest to -10 in -233, -0.5, 0.4, -5? -5 What is the nearest to 0.1 in 5, 0.04308, -3/7? 0.04308 What is the closest to -2/19 in 46, -4/17, 1/10? -4/17 What is the closest to -4 in 5/2, 1/941, 1.8? 1/941 Which is the closest to 0? (a) -0.027 (b) 5 (c) 228 (d) 4 (e) 9 a Which is the nearest to 1.8? (a) 2 (b) -2 (c) -0.942 (d) -4 a What is the closest to -2/65 in -0.4, 118, 4? -0.4 Which is the nearest to -9? (a) 7 (b) -0.5 (c) 41 (d) 5 b Which is the closest to 12? (a) 0.5 (b) 37 (c) -0.35 (d) -5 a What is the nearest to -0.3 in 1.84, -3, 1, 0.1, -7? 0.1 Which is the nearest to -2/3? (a) 3 (b) -13 (c) -4 (d) 95 (e) -10 c What is the nearest to 2.1 in 18, 0, 5, -30? 0 Which is the nearest to 4? (a) 0.17 (b) -36 (c) -0.4 (d) 0.042 a Which is the closest to 1? (a) -128 (b) 0.08 (c) -13 b What is the closest to -10.8 in -4, -2, 9, 5? -4 Which is the closest to 0? (a) 0 (b) -20/23 (c) 3 (d) -0.1 a What is the closest to 1/5 in 2, -1/4, -0.3, -2/5, 487? -1/4 Which is the closest to 849? (a) 1/6 (b) -0.02 (c) 1/4 (d) 2/19 (e) -2/15 c What is the nearest to -3 in 0.5, -5, 146? -5 What is the closest to -1302 in -3/4, -2/5, -2/9, 5/2? -3/4 Which is the nearest to 17? (a) -9 (b) -37/4 (c) -2 (d) 3/4 d Which is the closest to -10? (a) 4798 (b) 0.1 (c) 1/3 b What is the nearest to -1/66 in 0, -18, 1/5, -0.3? 0 What is the nearest to 0.1 in 1/5, 0.1, 261, 34, -3/7? 0.1 What is the closest to 1 in -1/70, -37/3, -0.1, -1? -1/70 What is the nearest to -1588 in 0.2, -0.3, -1/14, 2/9? -0.3 What is the closest to 2/9 in -8, -5, -14.6, -4? -4 Which is the nearest to 221? (a) 0 (b) -104/3 (c) 3 c What is the nearest to 24 in 15/8, 0.11, -1? 15/8 What is the closest to 51 in 0.044, -4, 0.2, -1/3? 0.2 Which is the closest to 0? (a) 0.1 (b) -16 (c) -0.2 (d) -13 a What is the nearest to -2/3 in -13/2, -9, 4/29? 4/29 What is the closest to 270 in 4, -2/23, -5? 4 Which is the closest to -2? (a) 14 (b) -107 (c) 4 c Which is the nearest to 1? (a) 9/4 (b) 2 (c) 45/308 (d) 0.3 (e) 2/11 d What is the nearest to -3/31 in -1/3, -1/2, -3/20? -3/20 Which is the nearest to 386? (a) 5 (b) -5 (c) 6.5 c What is the closest to -2 in -1, -5, 7, -4, 9? -1 What is the nearest to 5/3 in -1, -242, 0? 0 What is the closest to 0 in -6/5, -1, 3/11, -6? 3/11 Which is the closest to 1/4? (a) 2/41 (b) 133 (c) -1 a Which is the nearest to 0? (a) -1 (b) -4.46 (c) -3/2 (d) 0.2 d Which is the nearest to -2/9? (a) 5 (b) -2/7 (c) -4 (d) 1.007 b What is the closest to -1/5 in -5, -0.3, -18, 1/2? -0.3 What is the nearest to -1 in 2.49, -4, -2/5? -2/5 Which is the nearest to 18.36? (a) 0.5 (b) -1 (c) 2 (d) -2/11 (e) 3 e Which is the nearest to 27? (a) -6.8 (b) -0.1 (c) -4 b What is the closest to 0 in 15, 1.3, -4/7, -16, -4? -4/7 Which is the nearest to 0.2? (a) -3 (b) 0 (c) -102 b What is the closest to 2/15 in 1/33, 5, -0.2, -17? 1/33 What is the nearest to -8/7 in 0.8, -7, -14/19? -14/19 Which is the closest to -0.3? (a) -0.2 (b) -104 (c) 652 a Which is the closest to -0.1? (a) -2 (b) -1.845 (c) 0.02 c What is the nearest to -4/7 in -1307, 3, -2, -3? -2 Which is the closest to -11? (a) 212 (b) -311 (c) 1 c Which is the closest to -4? (a) -4 (b) -0.074 (c) -0.5 a What is the nearest to -1 in -4, 2/159, 1? 2/159 Which is the closest to -82? (a) -3 (b) -82/11 (c) -13 c Which is the nearest to -0.1? (a) -7 (b) 0 (c) -1231/4 b Which is the closest to -10? (a) -13 (b) 0.1 (c) 0.2 (d) 11 (e) -1/3 a Which is the nearest to -0.3? (a) 0.2 (b) 6 (c) -0.6 (d) 0.09 c Which is the nearest to -0.1? (a) 0.27 (b) -5 (c) 3/8 (d) 1/7 d Which is the nearest to 1? (a) 2 (b) -0.3 (c) 223 (d) 10 a Which is the closest to -4? (a) 4 (b) -32 (c) -4/9 c What is the closest to 6 in 2/11, 2/17, -269? 2/11 What is the nearest to -6/11 in -384, 2, -2/3? -2/3 Which is the closest to 0.1? (a) -0.84 (b) -29 (c) -4/7 (d) -5 (e) -13 c Which is the nearest to -0.1? (a) -0.2 (b) -0.4 (c) -315 (d) -2/219 (e) 5 d Which is the nearest to 2.09? (a) 0.01 (b) 2 (c) 0.1 b What is the closest to 0.2 in -3/5, -0.8, -0.71, 2/9? 2/9 Which is the nearest to -5.6? (a) 4 (b) -0.5 (c) -2/7 (d) 0 b Which is the closest to 19/2? (a) 2/411 (b) 2/9 (c) -0.02 b Which is the closest to 1? (a) -197 (b) -7/10 (c) -0.3 c What is the nearest to 1/4 in 4, 0.23, -2, 18/17? 0.23 What is the nearest to 0.2 in 13/9, 0.5, 1/4, 1171? 1/4 Which is the nearest to 0? (a) -5.2 (b) 0.5 (c) 6 (d) -1.9 (e) 2/13 e Which is the closest to 4? (a) -2/19 (b) 2671/3 (c) 1/5 c Which is the nearest to -0.2? (a) -0.10665 (b) 5 (c) -0.2 c What is the nearest to -0.32 in 0.1, -4, -2/7, 139? -2/7 What is the closest to 0.1 in -19, 5, 38, -0.1, -1/2? -0.1 Which is the closest to -1? (a) 2.7 (b) 0.3 (c) 0.14 (d) -2/9 (e) 5 d What is the nearest to 42 in -56, 2.3, 2/9? 2.3 Which is the closest to 2/21? (a) 1/27 (b) -0.1 (c) -2.1 a What is the nearest to -2/7 in -0.6, -2/15, 2, 34, 0.3? -2/15 What is the closest to 17 in -4/5, 1/6, -55/3, -5? 1/6 What is the closest to 0 in 5, -80, 2/5, -4? 2/5 Which is the closest to 0.11? (a) -2 (b) 784 (c) -0.2 c Which is the closest to -1? (a) 1.2 (b) 3 (c) 85 (d) 0.5 (e) -3/5 e Which is the nearest to -35? (a) 10 (b) -11 (c) -5 (d) -1 (e) 4 b What is the nearest to 2/5 in 0.062, 0, -0.059? 0.062 Which is the closest to -38? (a) -0.4 (b) -0.3 (c) 10 (d) 1 a Which is the nearest to 1243? (a) 2 (b) -29 (c) -3 a What is the closest to -2 in 0.5, 3, -0.138, -4/3? -4/3 What is the nearest to -2/3 in 70, 1/6, 2/21, 1/3? 2/21 What is the nearest to 9 in -4, 0.2, 2/13, -1, -27.6? 0.2 Which is the nearest to 1.1? (a) -3 (b) -1 (c) -23 b What is the closest to -1 in 1, 38, -2, 0.7? -2 What is the closest to 3/5 in 0.03, 10, -1.4, -4? 0.03 Which is the nearest to 0.2? (a) 3/11 (b) -31/3 (c) -3/7 a What is the closest to 3727 in 55/3, 0.5, -3, -0.5? 55/3 Which is the nearest to 0.08? (a) 0.6 (b) 5 (c) -70/13 a What is the nearest to 38 in -5, -33/7, 1, 0.2? 1 Which is the closest to -0.1? (a) 6 (b) -2 (c) -679 (d) -2/9 d What is the nearest to 2 in 112, -2/7, -2/9, -2/17, -13? -2/17 What is the closest to -2 in 0.5, 1, -5.69, 3? 0.5 Whic	{ "pile_set_name": "DM Mathematics" }
b). Factor r(s). -2(s + 1)3/3 Solve 8/7 + 2o*4 - 2/7o*5 - 32/7o - 38/7o3 + 50/7o*2 = 0. 1, 2 Let c(o) be the first derivative of 1/9o*2 + 4/27o*3 + 1/18o*4 + 0o + 21. Find w, given that c(w) = 0. -1, 0 Let q be (-1540)/(-130) - ((-4)/(-26))/(-1). Let v be (18/q)/(3/10). Factor 0l + 2/3l*4 - 1/3l*v + 0 - 1/3l*3 + 0l2. -l3(l - 1)2/3 Let w(d) = -50d*2 + 48d + 83. Let u(x) = 123x2 - 120x - 207. Let n(f) = 5u(f) + 12w(f). Factor n(j). 3(j + 1)(5j - 13) Let n be (6095/212)/((-51)/12) + 7. Find x such that -nx + 2/17x3 + 0 + 2/17x*2 = 0. -2, 0, 1 Find d, given that -16/3d + 2/3d2 + 8 = 0. 2, 6 Let h(i) be the third derivative of i7/56 - 5i6/96 + i5/24 + 60i2. Let h(x) = 0. What is x? 0, 2/3, 1 Let x = -18299/30 + 610. Let w(k) be the second derivative of 0 + 10k - 1/4k4 + 0k*2 - xk*6 + 0k*3 + 1/5k5. Factor w(z). -z2(z - 3)(z - 1) Factor 125m3 + 7m*5 - 190m*2 + 170m - 2m5 - 40m*4 - 30m - 40. 5(m - 2)3(m - 1)*2 Let a(g) be the first derivative of 2g*6/21 - 8g*5/35 + 8g*3/21 - 2g*2/7 + 44. Factor a(r). 4r(r - 1)3(r + 1)/7 Let w be (4 - 3) + 1(-3 + 2). Suppose -14u + 12u + 8 = w. Factor 6/5b*2 + 3/5b*u - 9/5 + 12/5b*3 - 12/5b. 3(b - 1)(b + 1)*2(b + 3)/5 Let l(g) = 139g3 - 235g*2 - 92g - 18. Let a(y) = 70y3 - 118y*2 - 46y - 8. Let p(m) = -5a(m) + 2l(m). Factor p(s). -2(s - 2)(6s + 1)2 Let l = -19 + 22. Solve 4g - 4gl + 8g*4 - 10g*4 + 3 - 1 = 0. -1, 1 Suppose -4r - 45 = -13. Let z be -13r/12. Find k such that 1/3k + 1 - 2/3kz = 0. -1, 3/2 Let i(q) = -q3 - q*2 + 1. Let a(d) = 4d*5 + 16d*4 + 12d*3 - 12d*2 - 20d - 4. Let y = -60 - -56. Let n(k) = yi(k) + a(k). Let n(w) = 0. What is w? -2, -1, 1 Let k(a) be the second derivative of 5a*7/189 + 79a*6/135 + 3a*5/5 - 47a*4/27 - 59a*3/27 + 5a*2/3 + 71a - 4. Suppose k(b) = 0. Calculate b. -15, -1, 1/5, 1 What is d in 5/3d2 - 80d + 960 = 0? 24 Let m = 111 + -87. Suppose -5v + 3a + 25 = 0, 4 = 4v - 4a - m. Let 1/3tv - 1/3 - 1/3t + 1/3t3 = 0. What is t? -1, 1 Let v(c) be the first derivative of -c6/27 - 28c*5/45 - 11c*4/6 + 224c*3/27 - 64c*2/9 + 81. Solve v(n) = 0. -8, 0, 1 Factor -20/3r - 2/9r2 + 0. -2r(r + 30)/9 Let v be (2 - 32/12)-9. Let y(z) be the third derivative of 0 - 1/12z3 + 1/96z*4 + 0z + 1/30z5 + 1/96z*v + 7z2. Factor y(b). (b + 1)2(5b - 2)/4 Let z(t) = -17t + 134. Let u be z(8). Let d be (-1 - 1)/(u/97). Suppose 3/7m4 + 3/7m + dm3 + 0 + 9/7m*2 = 0. What is m? -1, 0 Let y = -19950 - -19952. Factor -1/3g*y + 5/3g - 5/3g3 - 2/3 + g4. (g - 1)2(g + 1)(3g - 2)/3 Let q(g) = -g*3 - 6g*2 + 15g - 6. Let n be q(-8). Suppose -5w = nw. Find r, given that 1/4r3 + wr*2 - 1/4r*4 + 0 + 0r = 0. 0, 1 Let b(u) = u4 - u2 - u - 1. Let y(q) = -q*5 + 8q*4 + 2q*3 - 10q*2 - 7q - 4. Let s = 47 + -53. Let p(o) = sb(o) + y(o). Factor p(x). -(x - 2)(x - 1)*2(x + 1)2 Let m(j) be the second derivative of j6/180 + j5/90 - j4/18 + 3j2 - 4j. Let f(t) be the first derivative of m(t). Factor f(i). 2i(i - 1)(i + 2)/3 Let p(q) be the first derivative of -49/4q*4 - 46/3q*3 - 2q - 17/2q2 - 18/5q5 - 8. Determine h so that p(h) = 0. -1, -1/2, -2/9 Let l(c) be the first derivative of -c4/46 + 20c3/69 + 11c*2/23 + 184. What is h in l(h) = 0? -1, 0, 11 Suppose 9 = 2y + 3. Suppose 4g + 2 = -3o - 2o, -6 = yo. Suppose 3q + gq + 4q3 + q4 + 5q*2 + 0q*3 - 3q = 0. What is q? -2, -1, 0 Let s(t) = -29t + 92. Let y be s(3). Let g(q) be the second derivative of 8q*3 - 16q*2 + 0 - 3/2q*4 + 1/10q*y - 5q. Determine c, given that g(c) = 0. 1, 4 Determine z, given that -2z4 - 4z*2 + 0z*4 + 6z*3 + 0z*2 + 2z - 2z2 = 0. 0, 1 What is n in 10976n*2 + 42n*4 + 1176n*3 + 1/2n*5 + 0n + 0 = 0? -28, 0 Let v(o) be the first derivative of o*4/34 + 2o3/51 - o2/17 - 2o/17 + 99. Factor v(z). 2(z - 1)(z + 1)2/17 Let o(k) = k2 - 6k + 12. Let p be o(5). Suppose pl - 35 = -0l. Factor -8u2 - 4u - 4ul + 10u*4 + 4u*5 + 4u*5 - 2u*4. 4u(u - 1)(u + 1)3 Let b(l) be the second derivative of l6/360 + l*5/120 + 3l*3/2 - 2l. Let d(w) be the second derivative of b(w). Suppose d(i) = 0. Calculate i. -1, 0 Let s(i) be the first derivative of -i8/1680 + i6/180 - i*4/24 + 13i*3/3 - 28. Let x(g) be the third derivative of s(g). Find m, given that x(m) = 0. -1, 1 Suppose 65 = t + 4t. Suppose t = g + h, 5g - h - 38 = 3h. Let 53l2 - 4 + 2 - 84l - 200l2 - g = 0. Calculate l. -2/7 Let u(f) = 5f - 16. Let d be u(4). What is n in 11n2 - 32n*2 + 15n*3 - 5n*d + 11n*2 = 0? 0, 1, 2 Let x(z) be the third derivative of 0z + 1/72z6 - 1/1008z*8 - 2/315z*7 + 0z*5 + 13z*2 + 0 + 0z*4 + 0z*3. Solve x(b) = 0. -5, 0, 1 Suppose -s - 30 = 5o, 0 = -2o + 12 - 24. Let p be 2/(2 - 0)0. Factor sz + pz*4 + 0z*2 + 2/13z*5 - 2/13z*3 + 0. 2z*3(z - 1)(z + 1)/13 Let -a2 + 6a3 + a2 - 3a4 - 3a*2 = 0. What is a? 0, 1 Let n(z) = -6z - 46. Let f be n(-11). Factor -38a - 8a*2 - 39a + fa3 + 65a. 4a(a - 1)(5a + 3) Let y = -37/10 - -673/90. Let t(r) be the first derivative of -yr3 + 7 + 0r - 5/6r4 - 2r*2. What is l in t(l) = 0? -3, -2/5, 0 Let x = 40/269 + 189/538. Factor xu*3 + u + 0 - 3/2u*2. u(u - 2)(u - 1)/2 Find g, given that -4 + 5g*4 - 8g*3 + 17/2g - g*2 - 1/2g*5 = 0. -1, 1, 8 Find f such that 9f*2 - 162f - 1/6f3 + 972 = 0. 18 Let d(u) be the first derivative of u6/6 - 3u5/5 - u4/2 + 4u3 - 4u*2 - 93. Factor d(z). z(z - 2)*2(z - 1)(z + 2) Factor -9p*3 - 11p*5 - 12p - 2p4 - 4p*4 + 24p*2 + 14p*5. 3p(p - 2)(p - 1)*2(p + 2) Let i = 53278/5 + -10650. Solve -12/5 + 8/5b3 + 3/5b*4 - 11/5b*2 - ib = 0. -3, -1, -2/3, 2 Suppose -4j = -0j - 3t - 177, 207 = 4j + 3t. Factor -4l*2 + 15l2 + l3 + 36 + jl + 2l*2. (l + 1)(l + 6)*2 Let h be 7 + 8/(-4) + 551/(-116). Suppose hd*2 + 0 - 1/4d = 0. What is d? 0, 1 Let s = 149 - 127. Let p(h) = 5h - 110. Let g be p(s). Factor -1/2j*2 - 3/4j*3 - 1/4j*4 + 0 + gj. -j*2(j + 1)(j + 2)/4 Let o(m) = -m3 + 16m*2 - 12m - 18. Let q be o(14). Let j = 3 - 1. Factor qc2 + 2c*4 + 4c*3 - 2 - 4c - 206cj. 2(c - 1)(c + 1)3 Suppose -4d + 1 = 3h - 0h, -5d + 5 = 5h. Suppose -3m3 + 3m*3 - 4 + 4m*2 - 4m*h + 5m - m = 0. Calculate m. -1, 1 Suppose -3l + l = -38. Determine h, given that 10h*3 + 13h + 15 + 5h - 24h*2 - l = 0. 2/5, 1 Let d(n) be the first derivative of -2n*3/33 + 158n*2/11 - 12482n/11 - 22. Factor d(k). -2(k - 79)2/11 Let z = 7 + -5. Suppose -w = -0w - z. Factor 1 + 2rw - r + r2 - 4r2 + r3. (r - 1)*2(r + 1) Let n(d) = -d*2 - 6d + 11. Let o be n(-5). Let q(z) = 3z - 1. Let t be q(1). Factor 0 - j2 - 22j - oj2 - 4 - jt. -2(j + 1)(9j + 2) Let p = -66 + 73. Let k(u) be the second derivative of -1/70u5 + 1/42u*3 + 0u*2 + 0 + 0u*4 + 0u*6 - 3u + 1/294up. Determine n so that k(n) = 0. -1, 0, 1 Let x(k) = 152k*2 - 465k + 29. Let l be x(3). Factor -9/5g - 3/5 - 9/5g*l - 3/5g*3. -3(g + 1)3/5 Let m(l) be the first derivative of l6/39 - 4l5/65 + l4/26 - 64. Suppose m(t) = 0. Calculate t. 0, 1 Let y(v) be the third derivative of -v6/20 + 28v*5/15 + 79v*4/12 + 20v*3/3 - 786v2. Find j such that y(j) = 0. -1, -1/3, 20 Let o(c) be the first derivative of -c8/420 - c7/105 - c6/90 - 10c3 - 12. Let v(t) be the third derivative of o(t). Factor v(z). -4z*2(z + 1)*2 Let z(p) be the second derivative of -7/15p*3 + 0 + 2/25p*5 + 19p + 2/5p2 + 2/15p4. What is u in z(u) = 0? -2, 1/2 Let g(l) be the third derivative of l5/300 + 7l4/120 - 127l*2. Factor g(h). h(h + 7)/5 Suppose 4v + 0j - 10 = j, 0 = -5v - 5j. Factor 6c + 16 - 288c*v + 14c + 292c2. 4(c + 1)(c + 4) Let n(v) be the third derivative of 1/3v*4 - 1/20v*5 - 1/60v*6 - 2/3v*3 - 18v*2 + 1/210v*7 + 0v + 0. Factor n(k). (k - 2)(k - 1)2(k + 2) Factor 73z2 - 85z*2 + 7z*2 - 585z*3. -5z*2(117*z + 1) Let n(f) b	{ "pile_set_name": "DM Mathematics" }
331021? -1003032 In base 2, what is 111111110001011 + 11001011111010? 1011001010000101 In base 2, what is 101110000 - -1101010110010000? 1101011100000000 In base 7, what is -230323 + -121? -230444 In base 2, what is 1010110001011101010011001 - 111? 1010110001011101010010010 In base 10, what is 55 + 19801? 19856 In base 3, what is 111 - -1212121012210? 1212121020021 In base 13, what is 123 + 34a05? 34b28 In base 9, what is -268 + 2062182? 2061813 In base 6, what is 120421323 + -23? 120421300 In base 16, what is c070 + -91? bfdf In base 11, what is 3 - -4722011? 4722014 In base 10, what is 90 - -110160? 110250 In base 3, what is 1012 - -212202212020221? 212202212022010 In base 14, what is 236 + 2c724? 2c95a In base 15, what is 15 + 20573dd? 2057403 In base 10, what is 2375839 - -53? 2375892 In base 11, what is 560 + 1781? 2231 In base 2, what is 11101110110 + 101011001000101? 101110110111011 In base 5, what is 4 + -2022133332? -2022133323 In base 3, what is -2011020101210201002 + 2? -2011020101210201000 In base 11, what is -1054 - -4923? 387a In base 13, what is 1a + -11c628? -11c60b In base 4, what is -103 - 131320333203? -131320333312 In base 16, what is e + -17d8f7d? -17d8f6f In base 13, what is -1999 + -35a5a? -37726 In base 12, what is -1557b9 - 98? -155895 In base 15, what is 2 - -10e2383e? 10e23841 In base 2, what is 11011000100001011110111111 + -1010? 11011000100001011110110101 In base 3, what is 11222122 + 20100202022? 20112201221 In base 9, what is 4 + -2377042? -2377037 In base 3, what is 1010 + 1222102211201? 1222102212211 In base 2, what is 1011100 + 10111111001001000? 10111111010100100 In base 14, what is -2982 - -444? -253c In base 16, what is -306be32 - 9? -306be3b In base 11, what is 738 - 7335? -66a8 In base 9, what is 4 - -8145254? 8145258 In base 5, what is 32 - 3010130201? -3010130114 In base 16, what is 6c37 + -101d? 5c1a In base 9, what is 110641 + 271? 111022 In base 8, what is 6 - 404016005? -404015777 In base 2, what is 100011 - -1001111100001111111? 1001111100010100010 In base 8, what is -510447 + -10? -510457 In base 2, what is -111000001100 + -100101101? -111100111001 In base 6, what is 151200244 + -1? 151200243 In base 9, what is -1183773 + -33? -1183816 In base 13, what is 12564 + -3c22? b642 In base 9, what is 12 + 1246607? 1246620 In base 5, what is 4043124223 + 3? 4043124231 In base 10, what is -190451 + 1773? -188678 In base 8, what is -1 + -253110150? -253110151 In base 10, what is 132 + -33980? -33848 In base 3, what is -1112 - 2211120010022? -2211120011211 In base 6, what is 2 + 15254021? 15254023 In base 9, what is -3 + -13443575? -13443578 In base 16, what is -134 - 1fffb9? -2000ed In base 13, what is -47228 - 7? -47232 In base 11, what is 6693181 - -5? 6693186 In base 4, what is 13020 + -3232313? -3213233 In base 16, what is -3c + 86fe95? 86fe59 In base 14, what is -2c8 - -242d? 2145 In base 11, what is -4 + 350707? 350703 In base 5, what is 22 + -130404341? -130404314 In base 3, what is 110000202 - -1222? 110002201 In base 2, what is -11101100101000111110001000 + 1001? -11101100101000111101111111 In base 16, what is -f8a967 - -3? -f8a964 In base 12, what is 4 - 496a536? -496a532 In base 16, what is -1a48c + -2f1? -1a77d In base 3, what is 212111212102200 + -21? 212111212102102 In base 11, what is -5 - -10867a57? 10867a52 In base 11, what is 3 - -157a7139? 157a7141 In base 16, what is a9df2 - -d? a9dff In base 12, what is -7b - 1b433? -1b4b2 In base 4, what is 113322213 + 31? 113322310 In base 7, what is -4 + 221043? 221036 In base 16, what is f8 + 10ee1? 10fd9 In base 9, what is -12 - 24718530? -24718542 In base 2, what is -101 - -1101000101011101001011? 1101000101011101000110 In base 16, what is ec9 + 785? 164e In base 14, what is -b53 + 70041? 6d2cc In base 8, what is 3477 - -15244? 20743 In base 6, what is -5324500134 - -4? -5324500130 In base 3, what is -11211102 + 22121221112? 22110010010 In base 15, what is -16 + a878bc? a878a6 In base 11, what is -3868 - -30050? 27293 In base 7, what is 2 + 101543363? 101543365 In base 14, what is 2 - -24a25a? 24a25c In base 13, what is -2996583 + -1? -2996584 In base 10, what is -32264 - -12? -32252 In base 15, what is 331981 + -122? 33185e In base 6, what is -4003 + -541124? -545131 In base 10, what is 1767 - -16308? 18075 In base 6, what is 540115123 + 30? 540115153 In base 2, what is -1010010000001100001 - -111001? -1010010000000101000 In base 6, what is 4 - -325314113? 325314121 In base 6, what is 2333 - 22022344? -22020011 In base 7, what is 1426461331 - -4? 1426461335 In base 11, what is -29505333 - -1? -29505332 In base 8, what is 14427 + -33771? -17342 In base 7, what is -141 - -31521162? 31521021 In base 15, what is 0 - 6a9e4a8? -6a9e4a8 In base 16, what is -129 - -57393? 5726a In base 16, what is 17b - -4903a? 491b5 In base 7, what is -33112 - -14226? -15553 In base 2, what is 100101001111010000111111111 - 1100? 100101001111010000111110011 In base 4, what is -30 - 1013321311? -1013322001 In base 10, what is 20878 + 312? 21190 In base 13, what is 3901a9ca + -4? 3901a9c6 In base 2, what is -101 - 111110010011001000110101? -111110010011001000111010 In base 14, what is -73a282 + 2? -73a280 In base 2, what is -10010011111000011011101001 - 10? -10010011111000011011101011 In base 12, what is 142 + -16853? -16711 In base 14, what is -4a7595 - -5? -4a7590 In base 12, what is 1300b4 - 208? 12baa8 In base 13, what is 15aa9b1 - -2? 15aa9b3 In base 10, what is 4 + 189404197? 189404201 In base 10, what is 86211991 + 5? 86211996 In base 12, what is -2 - -302520? 30251a In base 3, what is 20202221 - -1100? 20211021 In base 2, what is -10110010111100111010111 + 10111100? -10110010111100100011011 In base 5, what is -301 + 214211? 213410 In base 3, what is -101 - -202222022122? 202222022021 In base 2, what is 1011010110110110001001111 - 0? 1011010110110110001001111 In base 14, what is -b84d - -98? -b795 In base 6, what is -152122 - 4244? -200410 In base 3, what is 2 - 102020102220002? -102020102220000 In base 2, what is 111 + 10101111010101101001? 10101111010101110000 In base 13, what is -178 + cb0? b35 In base 10, what is -863 + 162652? 161789 In base 3, what is -12 - 2201112111121111? -2201112111121200 In base 9, what is 515 - -200017? 200533 In base 15, what is 52 + 5640e3? 564145 In base 7, what is -104 + 23024564? 23024460 In base 12, what is 3 - 50847307? -50847304 In base 14, what is 292852 - 47? 292809 In base 4, what is -1323100133002 - 2? -1323100133010 In base 10, what is -233274 + -30? -233304 In base 2, what is 11011101000101010101000 + -11? 11011101000101010100101 In base 4, what is -11 - 20223133321? -20223133332 In base 12, what is -9 - -75818a8? 758189b In base 11, what is 287a960a + 5? 287a9614 In base 13, what is -230c + -194? -24a3 In base 16, what is -1b05 + 520e? 3709 In base 15, what is 59071c - 2d? 5906de In base 15, what is a1 + -1020? -e6e In base 5, what is 1010332 + 1432114? 2443001 In base 6, what is 0 - -140131505? 140131505 In base 5, what is 102 + 40100422? 40101024 In base 9, what is 4 + 188040183? 188040187 In base 14, what is a9ac4b + 9? a9ac56 In base 7, what is -16622 + -1? -16623 In base 3, what is 1110121112122 + -12? 1110121112110 In base 12, what is -28 - -82714? 826a8 In base 8, what is 1423131 + -55? 1423054 In base 13, what is -b + 3084a? 3083c In base 2, what is -11000 - -1010011001001101? 1010011000110101 In base 16, what is 3f - -eefc1? ef000 In base 5, what is 20044 - 13111412? -13041313 In base 13, what is 594a8 - 4? 594a4 In base 9, what is -323 - -78328? 78005 In base 9, what is 17854 - -223150? 242114 In base 5, what is 4 + 2110340200? 2110340204 In base 13, what is -249 - -706b? 6b22 In base 16, what is cbb - -1ca? e85 In base 6, what is -1105251 - -1312? -1103535 In base 3, what is -11 - -1022222222212020? 1022222222212002 In base 6, what is 11 - 4150313414? -4150313403 In base 12, what is 1b967429 - -1? 1b96742a In base 12, what is -32408 - 8bb4? -3b400 In base 16, what is 7d + 1019? 1096 In base 5, what is -10 - -3330040141? 3330040131 In base 3, what is 1101 + 2? 1110 In base 10, what is -7 - -63943? 63936 In base 2, what is 11 + -10101111101110101111011110? -10101111101110101111011011 In base 13, what is 3 + -	{ "pile_set_name": "DM Mathematics" }
-4 Solve s + 4 = -0s for s. -4 Solve -46r + 86 = -6 for r. 2 Solve -8 = -3h - 5 for h. 1 Solve -5t + 8 = 23 for t. -3 Solve 0 = -2h - 4h + 18 for h. 3 Solve 98j - 168 = 126j for j. -6 Solve 0 = 24d - 20d + 20 for d. -5 Solve 19 = d + 18d for d. 1 Solve 23q - 130 + 107 = 0 for q. 1 Solve -69m + 104 = -95m for m. -4 Solve 0 = 111c - 721 - 278 for c. 9 Solve 2a + 11 = 7 for a. -2 Solve 12g + 0g = -12 for g. -1 Solve -15 + 21 = -3f for f. -2 Solve 27 = -6m + 3 for m. -4 Solve 22r = 139 - 51 for r. 4 Solve -3n - 24 = 21n for n. -1 Solve -34t + 118 + 52 = 0 for t. 5 Solve -23r = 124 - 170 for r. 2 Solve -25p = 24p - 294 for p. 6 Solve -10f + 1 = 1 for f. 0 Solve 1 = 86o - 87o for o. -1 Solve 9n - 17 = -35 for n. -2 Solve 0 = -15k - 37 - 8 for k. -3 Solve 0 = 18y - 667 + 505 for y. 9 Solve -6t + 7t = 1 for t. 1 Solve -9l + 42 = 87 for l. -5 Solve -76z + 23z = 371 for z. -7 Solve -8 = -39y + 41y for y. -4 Solve 50t - 72t = 88 for t. -4 Solve p - 2p - 3 = 0 for p. -3 Solve 110 = 46x - 24x for x. 5 Solve 43y = 4y - 234 for y. -6 Solve i - 110 + 101 = 0 for i. 9 Solve 2211 - 2177 = -17y for y. -2 Solve l = -217 + 217 for l. 0 Solve -13k + 10k - 6 = 0 for k. -2 Solve -1198r + 60 = -1183r for r. 4 Solve 70z - 77z + 14 = 0 for z. 2 Solve -247 + 244 = t for t. -3 Solve 0 = -15o + 14o + 3 for o. 3 Solve -259j + 254j - 10 = 0 for j. -2 Solve -18i + 28i + 10 = 0 for i. -1 Solve -28i + 3 = -25i for i. 1 Solve -19i + 54i + 105 = 0 for i. -3 Solve -27y = -24y - 9 for y. 3 Solve 4 = -5z + 9z for z. 1 Solve -32x = -19x - 11x for x. 0 Solve 3 = -4n + n for n. -1 Solve 12l = 10l - 4 for l. -2 Solve -3 = -6c - 21 for c. -3 Solve -x - 3x = 8 for x. -2 Solve 0 = -119w + 136w - 102 for w. 6 Solve 12t = 44t + 128 for t. -4 Solve 19 + 29 = 16p for p. 3 Solve -6 = 35j + 169 for j. -5 Solve 36 = 24m - 12 for m. 2 Solve 534s - 192 = 558s for s. -8 Solve 3y + 17 = 5 for y. -4 Solve -68 = -10b - 128 for b. -6 Solve 0 = 9b - 7b - 10 for b. 5 Solve -7w = 305 - 333 for w. 4 Solve 0 = -t + 60 - 57 for t. 3 Solve 8 = 7g + 29 for g. -3 Solve 0 = 4c - 0 - 12 for c. 3 Solve -15i = 390 - 270 for i. -8 Solve -143f = -146f - 9 for f. -3 Solve 137t - 148t = -33 for t. 3 Solve -3s = 21s + 48 for s. -2 Solve -19 = -4v - 27 for v. -2 Solve 4 = 79h - 75h for h. 1 Solve 23b + 40 = -6 for b. -2 Solve 35c - 169 + 414 = 0 for c. -7 Solve 0 = -20r + 78 - 158 for r. -4 Solve 2o + 16 = 20 for o. 2 Solve 15 = 343y - 348y for y. -3 Solve 11 - 12 = -s for s. 1 Solve -28x + 18x = 0 for x. 0 Solve 26n + 40 = 34n for n. 5 Solve 0 = -2l - 1 + 3 for l. 1 Solve 4i = -4i - 8 for i. -1 Solve 14 = -17p + 48 for p. 2 Solve -333t = -322t + 33 for t. -3 Solve -5 = 2n + 5 for n. -5 Solve 0 = c - 7c - 12 for c. -2 Solve 6 = -6q - 6 for q. -2 Solve -153 = 50z + 47 for z. -4 Solve -124a = -137a for a. 0 Solve -1 = -2w - 5 for w. -2 Solve 3b + 0 = -3 for b. -1 Solve 5 = 7p - 23 for p. 4 Solve -76 = 7h - 111 for h. 5 Solve 0y = -y - 4 for y. -4 Solve 12f - 139 = -115 for f. 2 Solve 21u - 27u - 18 = 0 for u. -3 Solve 7a - 3a = -20 for a. -5 Solve 416b + 30 = 413b for b. -10 Solve 120k - 138k = 108 for k. -6 Solve -y = 3y for y. 0 Solve -145 = -22t + 31 for t. 8 Solve -18z = -6z - 48 for z. 4 Solve 676 = -129v - 614 for v. -10 Solve 17 = -5u + 12 for u. -1 Solve 16d - 10 = 6 for d. 1 Solve -36d + 43d + 35 = 0 for d. -5 Solve 2n + 2n = 8 for n. 2 Solve 10u - 15u - 10 = 0 for u. -2 Solve -31r + 19r + 24 = 0 for r. 2 Solve 14t = 16t + 2 for t. -1 Solve 40 - 8 = -16i for i. -2 Solve -38g + 30g = 40 for g. -5 Solve -8m + 32 = -16m for m. -4 Solve -24u + 192 = -24 for u. 9 Solve 2d - 14d = -24 for d. 2 Solve 5z + 3 + 12 = 0 for z. -3 Solve 0 = 2p - 16 + 24 for p. -4 Solve 0 = 2d - 11 + 3 for d. 4 Solve -92z = -22z for z. 0 Solve -6z - 5z + 55 = 0 for z. 5 Solve -5 = -u - 0 for u. 5 Solve -22d + 6 = -19d for d. 2 Solve 0 = 18l + 5l + 115 for l. -5 Solve 2y + 65 = 81 for y. 8 Solve 16b = 19 - 3 for b. 1 Solve -123t = -328 - 41 for t. 3 Solve 15 = 7g + 22 for g. -1 Solve -12q - 28 - 32 = 0 for q. -5 Solve 0 = -8f + 39f - 248 for f. 8 Solve 0 = 26a - 45a + 19 for a. 1 Solve -3t + 12 = 6 for t. 2 Solve -22h - 161 = -7 for h. -7 Solve -4 = 7r + 17 for r. -3 Solve 12 = -5p - 13 for p. -5 Solve -18t + 20 + 70 = 0 for t. 5 Solve -2o + 7o + 5 = 0 for o. -1 Solve 12 = -2d + 14 for d. 1 Solve 24 + 6 = 6u for u. 5 Solve 8y = 11y for y. 0 Solve 0 = 13w + 51 + 1 for w. -4 Solve -72 = -157q + 166q for q. -8 Solve 2x = -27 + 21 for x. -3 Solve 2b + 11b + 26 = 0 for b. -2 Solve -46o + 16 = -30o for o. 1 Solve -7z - 4 = 3 for z. -1 Solve p - 90 = -92 for p. -2 Solve 11 - 39 = -7g for g. 4 Solve 7j + 4 = 8j for j. 4 Solve 0 = 56h - 58h for h. 0 Solve -114 = -89u - 25 for u. 1 Solve 0 = 3p + 65 - 71 for p. 2 Solve -52 + 42 = 10c for c. -1 Solve -3o + 10 = 13 for o. -1 Solve 43v - 114 = 62v for v. -6 Solve -128n + 130n = -4 for n. -2 Solve 30f + 10f = 200 for f. 5 Solve -55 = 15y - 10 for y. -3 Solve 0 = -131q + 128q + 3 for q. 1 Solve 779f = 776f + 18 for f. 6 Solve -5o - 3 = -4o for o. -3 Solve 6i - 20 = 11i for i. -4 Solve 182 = 13u + 260 for u. -6 Solve 0 = -379b + 361b - 90 for b. -5 Solve 2v + v = 3 for v. 1 Solve 14 + 6 = -4t for t. -5 Solve 8 + 21 = -29q for q. -1 Solve -10h = -35 + 145 for h. -11 Solve -9h = -6h - 6 for h. 2 Solve 0 = 4l + 6l + 40 for l. -4 Solve 125m - 48m = 385 for m. 5 Solve 11 + 10 = -7z for z. -3 Solve -2x + 76 = 17x for x. 4 Solve 386r = 397r - 66 for r. 6 Solve 38n - 50n + 60 = 0 for n. 5 Solve 16g + 22 = -10 for g. -2 Solve 245 = -40g - 35 for g. -7 Solve -22z + 16z - 12 = 0 for z. -2 Solve 6i + 4 + 26 = 0 for i. -5 Solve -4x + 41x = 222 for x. 6 Solve -19z - 13 + 184 = 0 for z. 9 Solve 0 = 3q - 12 for q. 4 Solve 0 = 5b + 22 + 3 for b. -5 Solve 154n - 40 = 144n for n. 4 Solve 124 = 15i + 124 for i. 0 Solve 14 = -68r + 54r for r. -1 Solve 4j = -j for j. 0 Solve 4900z = 4893z + 70 for z. 10 Solve 42t = -11t - 16t for t. 0 Solve -11w + 3w = -16 for w. 2 Solve 0 = 2b + 15b + 17 for b. -1 Solve 1 = -6c + 13 for c. 2 Solve -28j + 5 = -27j for j. 5 Solve 0 = -13s + 5s + 24 for s. 3 Solve 28x - 37x = 9 for x. -1 Solve -170l + 4 = -174l for l. -1 Solve 141n - 95 = 122n for n. 5 Solve -2o - 17o - 95 = 0 for o. -5 Solve -122r + 143r + 105 = 0 for r. -5 Solve -29g + 140 = -63 for g. 7 Solve z - 17 = -12 for z. 5 Solve 4552 = 7v + 4580 for v. -4 Solve 0 = 15b - 16b + 3 for b. 3 Solve 9 = 167w - 164w for w. 3 Solve 34 = 2n + 36 for n. -1 Solve 0 = -d - 69 + 67 for d. -2 Solve 15p - 27 = 33 for p. 4 Solve -19 - 53 = 36d for d. -2 Solve 116 - 104 = 3o for o. 4 Solve 3f = 4f - 4f for f. 0 Solve -348k = -353k - 10 for k. -2 Solve 0k - 12 = -4k for k. 3 Solve -5p - 197 + 207 = 0 for p. 2 Solve 697 = 11z + 708 for z. -1 Solve -117f - 117 = -130f for f. 9 Solve 3s = -s - 12 for s. -3 Solve -2m = -2 + 4 for m. -1 Solve -3v + 402 = 390 for v. 4 Solve -147u - 114 = -128u for u. -6 Solve z = 3z + 10 for z. -5 Solve 7h + 2h = 36 for h. 4 Solve -11v - 3 - 30 = 0 for v. -3 Solve -49s + 520 = 79 for s. 9 Solve 26l + 2 = 25l for l. -2 Solve 9b - 4b = 25 for b. 5 Solve -2 = -13t + 15t for t. -1 Solve 18m = 20m for m. 0 Solve -76l + 205 = -555 for l. 10 Solve 57x = 53x for x. 0 Solve -31t = -0 + 31 for t. -1 Solve -351 = -w - 352 for w. -1 Solve -6f - 1380 + 1362 = 0 for f. -3 Solve -21k = -33k + 12 for k. 1 Solve -15b = -b + 70 for b. -5 Solve 0 = 4t + 901 - 925 for t. 6 Solve 5 = 36j - 31j for j. 1 Solve 2h + 4 = -2 for h. -3 Solve -4 = 7w - 18 for w. 2 Solve -13f - 13f + 156 = 0 for f. 6 Solve 110q + 25 = 105q for q. -5 Solve -93 + 28 = -13q for q. 5 Solve 0 = -137x + 160x - 92 for x. 4 Solve 0 = -18m + 20m + 10 for m. -5 Solve 0b - 78 = 26b for b. -3 Solve 51c - 66c + 30 = 0 for c. 2 Solve 89z - 4 = 93z for z. -1 Solve 31 = -6c + 1 for c. -5 Solve -40 = 18y + 68 for y. -6 Solve 26p = 18 + 8 for p. 1 Solve 45 - 38 = -7d for d. -1 Solve -5i - 6 + 16 = 0 for i. 2 Solve -18i + 80 = 8 for i.	{ "pile_set_name": "DM Mathematics" }
mon multiple of 14 and f. 42 Let c(b) = b - 2. Let f(w) = w - 1. Let h be f(3). Suppose 5k + 5 = 2d, -d = 4k - hk - 16. What is the lowest common multiple of d and c(5)? 30 Let t = -3 - 3. Let z = t - -11. What is the smallest common multiple of 9 and z? 45 What is the common denominator of -19/18 and 0 + 0 - 262/(-24)? 36 Let v = -24 - -15. What is the common denominator of -17/11 and 12(16/v)/4? 33 Let p(r) = r3 - 4r*2 + 3r + 4. Let y be p(4). Suppose h - 2h = y. Let q = -9 - h. What is the lowest common multiple of q and 11? 77 What is the least common multiple of 300/44 + 6/33 + 2 and 8? 72 Let p(z) = -z2 - 6z - 2. Let m be p(-4). Suppose -2v = m, -v + 0v - 18 = -5y. Calculate the least common multiple of (6/8)/(y/36) and 5. 45 Let o = 15 - 11. Suppose -2u = -2f - 16, -2u + 5u - 4f = 26. Calculate the least common multiple of o and u. 12 Suppose 5p - 110 = -2u, -p - 20 = 4p. Suppose -3h + 0h = -4o - 53, 5h = -5o + u. Calculate the common denominator of ((-66)/(-100))/((-2)/h) and 45/4. 20 Let j = -6 - -16. Let f be 6((-10)/6 + 2). Let y(r) = 2r - 3. Calculate the smallest common multiple of y(f) and j. 10 Let h(t) = -t*2 + 4t + 2. Let c(k) = -k - 1. Let f(p) = -4c(p) - h(p). What is the smallest common multiple of 11 and f(-3)? 11 Suppose 92 = 5p - 8. What is the least common multiple of 3 - (-48)/40(-45)/(-6) and p? 60 What is the common denominator of 97/12 and (83/(-15))/((-12)/15)? 12 Calculate the common denominator of 2391/504 + 6/(-21) and 56/9. 72 Suppose -2u + 17 = 3f, -4u + 2f + 10 = -0f. Suppose -ua - 64 = -5t, 4t = -0t + 2a + 50. What is the smallest common multiple of 10 and t? 60 Let l(p) = p3 - 8p*2 + 10p - 8. Let d be l(6). Find the common denominator of (285/3 - -2)/(-22) and 7/d - (-1)/(-2). 220 Suppose -g = -2g + 9. Suppose -38 = -3f + 4y, -2f = -3y - 15 - g. What is the smallest common multiple of 8 and f? 72 Let c(z) = z2 + 5z + 4. Let r be c(-3). Let t be r/345/(-10). Suppose tg - 1 = 5. What is the lowest common multiple of 11 and g? 22 Let v be (3 - 5 - -3) + 3. Suppose 8 = -2q - 2p, q = vq - 5p - 28. What is the lowest common multiple of q and 9? 9 Let n = -7 + 9. Suppose -no + 0o - 2f = -20, -o + f + 14 = 0. Calculate the lowest common multiple of 6 and o. 12 Suppose -3 = n, 5i = 4n + 284 - 97. Suppose i = 2s + 3s. Suppose 0 = 3o - 5z - 19, 12 = 2o - 5z + z. What is the smallest common multiple of o and s? 56 Let t be 17608/1734 - (-4)/6. Let z = 7/578 + t. Find the common denominator of z and 14/4(-8)/3. 6 Calculate the least common multiple of 12 and 2/5(3 - -12). 12 Let u = -8448 - -67667/8. What is the common denominator of u and -7/6? 24 Suppose 2t - 43 = 13. What is the lowest common multiple of t and 12? 84 Let l = 4/135 + -3121/540. What is the common denominator of (-92)/(-69)(-149)/(-24) and l? 36 What is the common denominator of 1/46 and (4 - 95/(-40))(0 - 1)? 184 Let f = 196145/16 + -12265. Let a be -226(-2)/(60/3). Let u = a - 1309/40. Find the common denominator of f and u. 16 Calculate the lowest common multiple of 8 and (8/(-6))/(12/(-18)). 8 Suppose -4n = -4i + 28, -3i - 5n + 5 = -0n. Suppose 5z - o - 32 = 1, 0 = 3z + 2o - 12. What is the least common multiple of i and z? 30 Let j be (-6)/(-21) + 14632/(-7). Let a = j + 687. Let h = -16801/12 - a. What is the common denominator of h and -1/22? 132 Suppose -13 + 53 = 4u. Let g = 1 - -2. Suppose m = 7 - g. What is the lowest common multiple of m and u? 20 Let k = -8 + 7. What is the common denominator of 2 + (3/k - -4) and -69/4? 4 Suppose 4z - 2z - 32 = 0. Let l be 10/4(-14)/(-5). Suppose -13 = -2s + l. Calculate the smallest common multiple of s and z. 80 Let d(y) = y*2 - 3y. Let n be 4/6 + (-50)/(-6). Let a(c) = -4c2 + 12c + 1. Let b(m) = nd(m) + 2a(m). What is the smallest common multiple of 2 and b(4)? 6 Suppose 2r - 5r = 0. Suppose 0 = -rt + 4t - 48. Calculate the lowest common multiple of 8 + (1 + -1)/(-2) and t. 24 Find the common denominator of -23/(-66)-29 and (-25)/(-11) + (1 - 0). 11 What is the least common multiple of 4 and 2/(3/(-30)(-20)/36)? 36 Calculate the common denominator of 17/82 and 85/(-374) + (-10)/(-2). 902 Let t = -34 - -38. Let k(s) = s2 - 2s + 3. What is the least common multiple of t and k(3)? 12 Find the common denominator of ((-7)/10)/((-7)/98) + 2 and (-42)/(-5)30/(-32). 40 Suppose 0 = -2w - 0w + 6. Calculate the common denominator of 17/11 and 931/24w. 88 Let n(k) = 5k*2 + 4k. What is the least common multiple of n(-2) and 6? 12 Let m(q) = 5q - 2. Calculate the smallest common multiple of m(4) and 30. 90 Let v be (-8938)/(-669) + 1 + -4. Let p = 6/223 - v. Find the common denominator of 35 and p. 3 Let w(f) = f - 6. Let y be w(8). Let o = y - 0. What is the smallest common multiple of o and (-2 + 1 - -4) + 0? 6 Let c = 12381/56 - 1482/7. What is the common denominator of 127/54 and c? 216 Let i(c) = 2c*2 - 4c + 6. Suppose -26 = 3b - 122. Let l be 6/4b/12. What is the smallest common multiple of i(l) and 4? 44 Let b = -12330/7 - -1767. Let g = 210/41 + -4847/410. Calculate the common denominator of b and g. 70 Suppose 27 = 3k - a - 23, 3k - 74 = -5a. Let z be (-1)/((-3)/122). Let y = 16 - z. What is the least common multiple of k and y? 126 Let s = -1/67 + -2744/201. Calculate the common denominator of s and 34/5. 15 Let w(a) = -a*3 - 6a*2 - 7a - 5. Let n = 8 - 13. Let p be w(n). Find the common denominator of p/(-15) - 85/6 and -56/9. 18 Let a = -83/18 + 19/9. What is the common denominator of -67/18 and a? 18 Let s = 0 - -5. Suppose 0 = -g + 4r, sg - 4r + 4 - 20 = 0. What is the smallest common multiple of 10 and g? 20 Let l = 21 + -11. Let y = 343 + -338. What is the lowest common multiple of l and y? 10 Let w = -75 + 135. Calculate the common denominator of 3/16 and (-4)/(-20) - (-713)/w. 48 Calculate the common denominator of (0 + 29)/(-7 + 24) and -37/6. 102 Calculate the common denominator of 1/(-6) + 0 + (-124)/21 and 61/18. 126 Let c = -4617/4 + 1147. Find the common denominator of c and (2/(-24))/(5/261). 20 Let j be (7/(-3))/((-2)/6). Suppose -6 = -m + 5u + 10, -4m + u = -j. What is the common denominator of -81/2 and 80/15 + m/2? 6 Let g = -7 - -1. Let k(w) = -4w*2 + 6w - 8. Let u be k(g). What is the common denominator of -23/7 and (-8)/(-28) - u/(-21)? 21 Let y(s) = 15s3 - s2 + s + 1. What is the lowest common multiple of 60 and y(1)? 240 Let p = 17 - 11. Let g(v) = -v2 - 2v + 5. What is the least common multiple of p and g(0)? 30 Let f be (-7)/((-28)/12) - 3. Suppose 0 = g - 8 - f. Let j(s) = s3 - s2 - 2s + 2. What is the smallest common multiple of g and j(3)? 56 Let i(r) = r2 + 5r + 2. Let v(q) = q*3 + 10q*2 - 12q - 8. Calculate the smallest common multiple of v(-11) and i(-6). 24 Let a(z) = -z*2 - 9z - 4. Let n be a(-8). What is the common denominator of -57/7 and 2/n + (-80)/6? 42 Let y be 0/(3 + -2 + 1). Suppose y = 5z - 10 - 30. Let t = 2 + z. What is the smallest common multiple of 16 and t? 80 Let i = -18 - -33. Let n = -9 + i. What is the smallest common multiple of 6 and n? 6 Let p(q) = -q2 - 18q + 34. What is the smallest common multiple of p(-18) and 6? 102 Find the common denominator of 31/16 and (412/6)/(0 - 8). 48 Suppose -2f = 5d - 80, -3d + 6 = -5f - 11. What is the lowest common multiple of d and 24? 168 Let z be 4/(-10) + (-623978)/(-220). Let k be -2839 - (4/10 + (-42)/30). Let n = z + k. What is the common denominator of -19/12 and n? 132 Let x be (7/21)/((-1)/(-9)). Suppose -l + 8d = xd - 17, 0 = -2l + 2d + 2. Let r = 10 + l. Calculate the lowest common multiple of 3 and r. 21 Suppose -3y = -0y - 81. What is the smallest common multiple of 27 and y? 27 Suppose -b + 20 = -5g, 4b = -3g + b - 12. Suppose 3h = -4 - 5. Calculate the common denominator of 53/20 and (h/g)/(27/366). 60 Suppose 0t + 4n = t + 6, -2n + 48 = 4t. Let o(b) = b - 9. Let q be o(9). Let c = 5 - q. What is the lowest common multiple of t and c? 10 Suppose 7 = -w + 5w - r, 5w - 5r = 5. Suppose -wn = -2q + 22, -q - 2n = q - 2. Calculate the least common multiple of 10 and q. 30 Let f = 791 - 2966. Let u = f - -13147/6.	{ "pile_set_name": "DM Mathematics" }
is the nearest to 2? (a) 3/5 (b) -739 (c) -4/5 a What is the nearest to -1 in 1/4, -1/5, 14, 0.3, 0.593? -1/5 What is the nearest to 4 in -12.397, -0.1, -2/13? -0.1 What is the nearest to 1 in -23, -2/7, 0.3? 0.3 Which is the nearest to 0.2? (a) -3 (b) 465 (c) 1 (d) -58 c Which is the closest to -55? (a) 16 (b) 0.02 (c) -0.54 (d) -3 d What is the closest to -9 in 2/197, 5, 4/3, -5/2? -5/2 What is the closest to 1 in -5, 0, 21, -0.1? 0 What is the nearest to 115 in 4, 579, 2? 4 Which is the nearest to 2? (a) -10 (b) 90 (c) -21 (d) 0.06 d What is the closest to -2 in -2, 0.3, 4, -3, 0.026? -2 Which is the nearest to 1? (a) 0.4 (b) 37/4 (c) 3/8 (d) -0.1 (e) 17 a What is the nearest to 37 in 1/5, -3, -0.066, 0? 1/5 Which is the closest to 0.1? (a) 3 (b) -38 (c) 4/3 (d) -0.3 (e) 1 d Which is the closest to -2? (a) -2 (b) -702/5 (c) -2/9 a Which is the closest to 8/5? (a) -2/11 (b) -457 (c) 1/6 (d) -1/4 c What is the nearest to -2 in 0.1, -37106/3, -19? 0.1 What is the nearest to 1 in -1.08, 1.4, 0.1, 13? 1.4 Which is the nearest to 1/17? (a) 7 (b) -2 (c) 6/11 (d) -5 (e) 3 c Which is the closest to -5? (a) 0.4 (b) -0.06 (c) 37 (d) -2/35 b What is the nearest to 0 in -5, 18, -1/21? -1/21 What is the closest to 53 in -5/4, -0.2, -0.4, -1? -0.2 What is the nearest to 1 in -86, 0.7, -1/2? 0.7 Which is the closest to -21/22? (a) -5 (b) 3 (c) -1/4 (d) 4 (e) -3/23 c What is the nearest to -14 in 24.2, 1/7, 5? 1/7 Which is the closest to 1/35? (a) 3 (b) 2 (c) -523 b What is the nearest to 1/2 in -1, -1017, 0.1? 0.1 Which is the nearest to -0.2? (a) 0.0837 (b) 0.2 (c) 4 (d) -1/4 d What is the nearest to -8 in -2/15, 63, -0.13? -2/15 Which is the closest to -41? (a) -28 (b) 2 (c) 0.8 (d) -0.4 a Which is the closest to 72? (a) -5 (b) 5 (c) 0.21 (d) 1 (e) 0 b Which is the closest to -18? (a) 0 (b) 0.144 (c) 7 (d) 2/5 (e) -5 e What is the nearest to 0.1 in 0.06, 11, 229, 4, 0.4? 0.06 Which is the nearest to -2? (a) -4/37 (b) 2/5 (c) 2/21 a Which is the nearest to -49/2? (a) -3 (b) -0.06 (c) -0.1 (d) -1/4 a What is the closest to 1/3 in -4, 4/7, 0.2, 127/6? 0.2 What is the nearest to -0.5 in 1812/11, -1.3, 0.5? -1.3 Which is the nearest to 1? (a) -1008 (b) -0.2 (c) 20/9 (d) -0.3 b What is the nearest to -87 in 2/3, 0.2, -0.113? -0.113 What is the nearest to -2 in 0.8569, -2, -0.5? -2 Which is the nearest to 4? (a) 62 (b) 4/5 (c) -0.2 b Which is the closest to -3? (a) 0.02 (b) 4 (c) -4203 a What is the nearest to 3 in 2/7, -2, 7/167? 2/7 Which is the nearest to 0? (a) 2/5 (b) 320 (c) 0 (d) 1 c What is the nearest to -1/68 in 3, 1, -0.0229? -0.0229 What is the nearest to 1/10 in -0.3, -2, -1/4, -3, 8? -1/4 What is the nearest to -1 in -2/59, -1/2, 2.9, 3? -1/2 What is the nearest to -42 in -4/15, -22, 0, 5, -4? -22 What is the nearest to 1 in 0.01, -12, 1/4, -4, -3/10? 1/4 What is the nearest to -3/8 in -9, 2/5, -2/3, -0.24, -0.01? -0.24 Which is the nearest to -45? (a) -3 (b) 13 (c) -1/3 (d) -1 (e) 4 a Which is the closest to -8? (a) 396 (b) 1/3 (c) -4/3 (d) -5 d What is the closest to 1 in -0.1, 0.02, -4, 0, -788? 0.02 What is the nearest to -2310 in 3, 179/5, 1? 1 Which is the nearest to 340? (a) 4 (b) -6 (c) -0.5 (d) -0.4 (e) -2.1 a Which is the closest to 0.7? (a) 22/7 (b) 4/5 (c) 2/15 b Which is the closest to -0.1? (a) -0.2 (b) 2 (c) 0.09 (d) 0.2 (e) 39/61 a What is the nearest to 5 in 3/7, 4, -2, -60, -1/3? 4 Which is the nearest to -1? (a) -425/9 (b) 2 (c) -6/7 (d) -0.2 c Which is the closest to 1.4? (a) 86 (b) 0.3 (c) -5 (d) 4 b What is the closest to -59.9 in -5, 1, 16? -5 Which is the closest to -2/9? (a) -0.5 (b) -0.1 (c) 1/7 (d) 1 b What is the closest to -1/125 in 1/2, -8, 1, -4? 1/2 What is the closest to 0 in -1, -4, 9912, 0.2? 0.2 Which is the nearest to 467? (a) -2/51 (b) 0.3 (c) 1 (d) 4/9 c What is the nearest to -2/3 in -0.189, 2, 0.06, 0.1, -0.02? -0.189 Which is the closest to -0.9? (a) 1/4 (b) -247 (c) 0.1 (d) 0 d Which is the closest to 65? (a) 3 (b) -7776 (c) 4/3 (d) -0.4 a Which is the nearest to -0.1? (a) -5 (b) 0.8 (c) 8 b What is the closest to 6 in -18/7, 1, -14, -2/5? 1 What is the closest to -15/14 in 18, 1/4, -0.5, 1? -0.5 Which is the nearest to -9? (a) 4 (b) 454 (c) 1 c What is the nearest to -4 in 4/7, -0.2, 64558? -0.2 What is the closest to -1 in -1, 0.23, 10, -0.3, 5? -1 What is the closest to -1/25 in -0.3, -2/61, 1/5? -2/61 Which is the nearest to 1/6? (a) 3 (b) 4/5 (c) -5 (d) 1169 (e) -4 b Which is the closest to 9/2? (a) 6/7 (b) -0.5 (c) -44 (d) 0.5 (e) -3 a What is the closest to 34 in 0.5, -3/2, 2/19, 4? 4 What is the nearest to 4 in 0.05, 78, -4, 71? 0.05 What is the closest to 2/7 in 0.2, -872, -0.8, -5, -0.1? 0.2 What is the closest to 0.1 in 2, 493, 4/7, 0.17? 0.17 Which is the closest to -128/15? (a) -2/3 (b) 4/7 (c) -45 a What is the nearest to 17 in 0, 0.33, 3/2? 3/2 What is the closest to 1 in 128, -4, 2, -2/23? 2 Which is the closest to 3/7? (a) -9057 (b) -1/4 (c) 5 (d) 3/2 b Which is the closest to -444? (a) -0.05 (b) -315 (c) -5 b Which is the nearest to -1.3? (a) 0 (b) -0.06 (c) 13/8 (d) -0.2 d What is the closest to 38 in 0.5, -0.9, 1/5, -35? 0.5 Which is the closest to -12? (a) 2/5 (b) -2/19 (c) -2/25 (d) 2/11 (e) -2/7 e What is the closest to -4 in 472, 4, 2? 2 What is the nearest to -0.1 in 1407, -118, -5? -5 What is the nearest to 2/13 in -3, 5/3, -0.6, 0, 96/13? 0 What is the nearest to 1 in -5/3, -2, -1, 7/10, -279? 7/10 Which is the closest to -1? (a) -30 (b) 2/13 (c) -1/4 (d) 2/7 (e) 0 c Which is the nearest to -6? (a) 1/67 (b) -0.6 (c) -3 (d) -2/5 c What is the nearest to 15 in 15/7, 0.2, 1/4, 7, 1/9? 7 Which is the nearest to 2? (a) 2/11 (b) -56/25 (c) 1/4 c What is the closest to 0.1 in 377, -2, -51, -11/2? -2 Which is the closest to -1? (a) 12/5 (b) 3 (c) -21 (d) -1/4 d Which is the nearest to 1/3? (a) 4 (b) 1/4 (c) -2/207 (d) -0.08 (e) -0.4 b What is the nearest to -1/4 in 4, 85, 8, 6? 4 What is the closest to 1 in -1, -0.08, 106? -0.08 Which is the closest to -1/2? (a) 0.03 (b) 0 (c) -3 (d) -425 (e) 3/5 b Which is the closest to 0.4? (a) -0.1 (b) 4 (c) 7/3 (d) -0.88 a Which is the closest to 0? (a) -0.4 (b) 11/2 (c) 1066 a What is the closest to 18/5 in 2/9, -1, -11/3, 9, -4? 2/9 Which is the nearest to 0? (a) -563 (b) -173 (c) 0.5 (d) -5 c Which is the nearest to 0? (a) -54 (b) 0.38 (c) 5 b What is the closest to -0.1 in 4, 0.2, 0.29621? 0.2 What is the closest to 2 in 57/2, -2/29, 0.03, -1/8? 0.03 What is the closest to 0.1 in -5, 46, 0.3, 11, -0.2? 0.3 Which is the nearest to 1/6? (a) -2/11 (b) -3 (c) -1131 (d) -1/4 (e) 0.1 e What is the closest to -1686 in 1, 5, -5? -5 What is the closest to 631 in 2/5, -2/21, -2, 0, 2? 2 Which is the closest to 1? (a) -33 (b) -4/5 (c) 1/16 c Which is the closest to -57.08? (a) 3 (b) 0 (c) 6 b What is the nearest to 1 in -0.2, 2, -2/3, -0.01, 1/9? 1/9 Which is the nearest to -66/7? (a) 18/5 (b) -5 (c) 3 (d) -1 b Which is the nearest to 13? (a) -0.1 (b) -0.9 (c) 2/39 c Which is the closest to 27? (a) 1/2 (b) 0 (c) 95 (d) 0.06 a Which is the nearest to -24? (a) -0.02 (b) -3/2 (c) 1/870 b What is the closest to -1 in -3/59, 202, 3/2, 0.02, 5? -3/59 What is the nearest to -12 in 2/119, 1/3, 0.01, 2/7? 0.01 What is the nearest to 488 in -0.1, -5, 3/5, 0.2? 3/5 Which is the nearest to -711? (a) 61 (b) -0.06 (c) -5 c Which is the closest to 124? (a) 19 (b) -1 (c) 0 a What is the closest to -3 in 4/115, -0.1, -3, 2/3? -3 Which is the nearest to 1/2? (a) 0.02 (b) 1419 (c) 2/3 (d) -1 c Which is the nearest to 62? (a) -0.5 (b) -10/39 (c) 0 c What is the closest to -236 in -2, -0.5, 2/3, -0.2, 0.4? -2 What is the nearest to -7379 in -1/12, -0.4, 7? -0.4 Which is the nearest to -0.2? (a) 4 (b) 18 (c) 9 (d) -0.8 d Which is the closest to -158? (a) -8.6 (b) 0.4 (c) 0.24 a What is the closest to 0.072 in 3, 0.5, -2, -1? 0.5 What is the closest to -0.38 in -0.2, -3/4, 1/22, 2, -1/10? -0.2 What is the closest to 4 in -1229, -4/3, 2/15, 0.06? 2/15 What is the closest to 0.1 in -3, 183, 2/5, 5? 2/5 What is the closest to	{ "pile_set_name": "DM Mathematics" }
(-5)/(j/(j(jj3)/j))) assuming j is positive. j(-13/4) Simplify (((l/(l/(l/l(2/3))l)l)/l(-1))/((ll(-2/5)/l)/(l/(l/l(-1)))))(-8) assuming l is positive. l(-88/15) Simplify (u(-3/4))(10/3)(u(-1))(3/14) assuming u is positive. u(-19/7) Simplify (z(-25)z*(-3/13)z)(-39) assuming z is positive. z945 Simplify ((aaa1)(-11)(aa*(2/5)a)(13/4))(-33) assuming a is positive. a(4158/5) Simplify (o(-2/5))(7/2)/(o(1/7)/((o(-1/6)/o)/o)) assuming o is positive. o(-779/210) Simplify ((t*(-12/11)t)/t)/t*(5/2)(t/t3)(5/3) assuming t is positive. t*(-457/66) Simplify ((p/(p/(pppp*(1/5)ppp)))/p)14/(p11/p)(-7/8) assuming p is positive. p(1631/20) Simplify (((t/((t/(tt(2/3)))/t))/t)(-5)t/(t*(-2)t)t(-1/13))6 assuming t is positive. t(-500/13) Simplify w(-3/5)/ww*(-4)w/w*9w/(ww/w(-5))w assuming w is positive. w*(-93/5) Simplify ((o(oo(-2/31)/o)/oo)/(ooo/(o*(2/19)o)o))/(o(13/2)/(o/((oo*(-1)o)/o))) assuming o is positive. o*(-8787/1178) Simplify ((aa/a*29)/(aa*25a))/(a*16a)(-44) assuming a is positive. a694 Simplify (g*6g(-1/6))/(g31/(g(4/5)/g)) assuming g is positive. g(-761/30) Simplify ((nn(-1/4)n(-1))/((n/(n6n))/(n(2/5)/n)))(1/4) assuming n is positive. n(103/80) Simplify r(r/(rr4/r))/rr*(2/21)(r/r(2/3))(-33) assuming r is positive. r(-292/21) Simplify (b(1/2)b/(b10b))(-1/18) assuming b is positive. b(19/36) Simplify (ww((w/(w/(w/((w/w*(1/43)w)/w)w)))/w)/www/w(-37))/((ww/w(-8/5))/w(3/7)) assuming w is positive. w(55462/1505) Simplify ((u/(u(-2/19)/u))/(u(-22)/u))/((u(6/5)/u)/uu(2/57)) assuming u is positive. u(7373/285) Simplify ((z/z(-20)z)/z)*(2/11)(z/(z/(zz(3/4))))(1/3) assuming z is positive. z(581/132) Simplify ((nnn20)/n(-11))/((n/n(-8/5))/n4) assuming n is positive. n(172/5) Simplify (i/(iii/((i/i(-24))/i))i)/i*(-1/10)(i/i*(2/3)i)/i34 assuming i is positive. i(-287/30) Simplify ((q/(q*29q))/q(-32))/(q(2/29)q/(q/(qq/q31))) assuming q is positive. q(926/29) Simplify (j*(-6/11)/((j/(jjj(-5/3)))/jj))/((((jj(j/(j*(2/5)j)j)/jj)/j)/j)/(j/j*(3/2)j)) assuming j is positive. j*(-433/330) Simplify (a/(((a/(a/(aa*11a)a))/a)/aa)a/a2)/(a/(a/a(1/2))a*(10/9)a) assuming a is positive. a(-245/18) Simplify (o/((o4/o)/o))(-11)/(o(11/4)/(o/(oo(-4/5))oo)) assuming o is positive. o(221/20) Simplify (p((p/(p*(1/4)/p)p)/p)/pp(1/8))/(p(-2/23)p(-2/5)) assuming p is positive. p(2173/920) Simplify ((j*9jj(-6))24)(-1/4) assuming j is positive. j(-24) Simplify ((d/d(2/7))(-1/7)/(d(-7)d5))45 assuming d is positive. d(4185/49) Simplify ((j/j(-2)j)/j)/j(jj(2/25)/jjjj)/j(jj1/j)6 assuming j is positive. j(252/25) Simplify ((z/(z(-1/2)/z))(-12/5)/(z(-3)z)(5/11))(-21) assuming z is positive. z(1176/11) Simplify ((v/v(19/4))/vv(v((vv/v(-1/30)v)/v)/v)/v)(-4) assuming v is positive. v(163/15) Simplify ((ff(-5)fff*(-2/3))/((f/(fff(f/f(-2/3))/f))/f)42)(4/11) assuming f is positive. f(1816/33) Simplify (w*21www(((w((((w*(-14/5)ww)/w)/w)/w)/w)/w)/w)/www)/(w(2/3)/((w/w(-21))/w)) assuming w is positive. w(593/15) Simplify (((t/(tt*(-6)t))/t(2/3))/(t(1/4))32)(1/20) assuming t is positive. t*(-11/60) Simplify ((o/(ooo/(ooo(-1)/o)o))(-5/12)/(o(-1)/(o*(-3/7)oo)))(-47) assuming o is positive. o(-5029/28) Simplify (d(-2))(-38)(dd(d/((ddd/d*14d)/d))/d)/ddd(d/d13d)/d assuming d is positive. d78 Simplify w(-9)(w(-5/4)/w)/w(w/(w(w/(w3/w))/w))(-44) assuming w is positive. w(-401/4) Simplify ((m/(m/(mm*(-2/5)m)))/mm(m/((m*5m)/mmm))/m)/(m/m(-1/4))(-10/13) assuming m is positive. m(-577/130) Simplify ((n(-50))(-13))(1/8) assuming n is positive. n(325/4) Simplify y3/((yy15)/y)(y/((y/y*(-1/3)yy)/y)y)(-6/19) assuming y is positive. y(-226/19) Simplify ((p(pp*(-6/13))/pp)/p(-1))(-22/5) assuming p is positive. p*(-726/65) Simplify (((vv(vvv(-11)/vv)/v)/v)/vv/v(-12))/(vv/v*(3/10)v11) assuming v is positive. v(-97/10) Simplify (bb/b(-1))(11/5)(b*(1/3)bb)/(b3/bb) assuming b is positive. b(89/15) Simplify (((o(-2)oo)/oo)/o(2/27))11 assuming o is positive. o(-22/27) Simplify (((c(11/2)c)/(c/((c*3/c)/c)c))/(c/(c/(cc(-8)))c(3/8)))(-5/8) assuming c is positive. c(-485/64) Simplify b(-29)bb*27bb32bb((bb27b)/bb)/bb assuming b is positive. b63 Simplify (r0rrrr*6rr)/(r/((r(-2)r)/r)r)(-30/11) assuming r is positive. r(241/11) Simplify (x21/(((xxx(-16/3))/x)/x))/(x10/((xx*(-2/59)x)/x)) assuming x is positive. x(3062/177) Simplify (x(-3)x1/x)/(x(-3))(-15/7) assuming x is positive. x(-66/7) Simplify ((zz/z(-25))/z)/(z(-8)z)(z/z(2/17))(-9/2) assuming z is positive. z(987/34) Simplify ((d(1/4)d)21)24 assuming d is positive. d630 Simplify ((l/((l(1/2)/ll)/l))*(15/8)l(-9/5)/l(1/4))26 assuming l is positive. l(793/40) Simplify (v/v2)28v/v(1/3)vv(5/2) assuming v is positive. v(-143/6) Simplify ((l(2/3)l*(1/3)llll)/(l(-2/3)/l(l/l*(-6))/ll))(-15) assuming l is positive. l5 Simplify (o/(oo2))(3/14)o(-11)/o(3/11) assuming o is positive. o(-901/77) Simplify (p(3/7)/p)*(1/18)(p7)37 assuming p is positive. p(16315/63) Simplify ((r(-4)/(rr(2/5)))/(rr(-1))(2/29))(-31/4) assuming r is positive. r(837/20) Simplify (k*(-7/6)/kkk6)(-1/6) assuming k is positive. k(-29/36) Simplify g/(g/(g/(g/(g/(g(-7/2)g)))))(g/g(1/24))/gg(-9)/(g(-31)/g) assuming g is positive. g(635/24) Simplify ((m5/m)(-33))4 assuming m is positive. m(-528) Simplify (d/d2)*(23/6)d*(1/2)d(-8/7) assuming d is positive. d(-94/21) Simplify ((n/n*(-14)n(-1/6)/n)27)(-33) assuming n is positive. n(-24651/2) Simplify (n*(-18)n)(-2/3)/(n0nn(-5/3)) assuming n is positive. n12 Simplify (c/c*(-2/29)(c/(c/c*(-25)))/cc)/(c*(6/13)c/(c/(c*(-8)/c)c)) assuming c is positive. c(-5426/377) Simplify ((g(-1/9)g)/(g/(g/((g15/g)/g))g))/(g(-5))(15/2) assuming g is positive. g(439/18) Simplify g(3/7)/(((((g*(1/55)/gg)/g)/g)/g)/g)(gg*15gg)/g(-32) assuming g is positive. g(20948/385) Simplify ((lll/((l/((l/(l/(l(l*4/l)/l)))/l)ll)/l))/((l/((llll*(-19))/l))/lll))/(l/(l/(l(-7)/l)))(-46) assuming l is positive. l(-384) Simplify b/((b/(b(-10)/bb))/b)b(-4/11)bb(-11/2)/(bb/b*11b) assuming b is positive. b(-129/22) Simplify k24kk*(13/5)k*(-20)k(-3)/k assuming k is positive. k(18/5) Simplify ((yy(-2))(-27)/(y(5/2)/(y/((yy(2/7))/y))))5 assuming y is positive. y*(1765/14) Simplify (a/(aa/(aa14)a))/(a/(a/(a*(1/9)/a)a))((aa*12a)/aa)/(a/(a/(aa/(aa15)))) assuming a is positive. a(386/9) Simplify ((cc*(-6)/cc)/c(-16/5))3 assuming c is positive. c*(-27/5) Simplify ((gg(-26))/g(-24))/(g(-1/6))(12/7) assuming g is positive. g*(-5/7) Simplify ((g(gg(1/3))/gg)*(-7/4)/((gg/(gg(-1/3)/g))/g5))(2/9) assuming g is positive. g(-17/54) Simplify ((v0v)/v)*(1/6)(v/(vvvv/(v2/v)))44 assuming v is positive. v(-88) Simplify (n/((nn(3/17))/n))/n14n14/(nn((n(1/21)n)/n)/n) assuming n is positive. n(-80/357) Simplify ((w/w(-13)w)/(w/w(-15)))/(w/(w/w11)w(-21)) assuming w is positive. w9 Simplify ((qq2)/(q(-1/4)/q)q/(q/(q/((qq(-1/6))/q)))q(qq6)/q)(-42) assuming q is positive. q*(-1043/2) Simplify (gg*(-9)gg/g(-2/25))/(g/g8g*(2/61)g) assuming g is positive. g*(72/1525) Simplify (ii*(-1/14)ii/(i/(i/(i((i(-9)/i)/i)/i))))/(i/(i2/i))(-2/63) assuming i is positive. i(195/14) Simplify (((q/(q(q/q(7/5))/q))/(q2q))/(q/((qq(3/2))/q)qq9))(-14) assuming q is positive. q(777/5) Simplify (d1/d)5/(dd2)(2/23) assuming d is positive. d(-6/23) Simplify ((p(2/27)p)/p)/(p/(pp/p*(2/5)))p*(2/9)p/((ppp**8)/p) assumin	{ "pile_set_name": "DM Mathematics" }
/11 + p*2/11 - 5p. Let a(v) = 0. Calculate v. -1 Factor -8t - 2 + 32t*2 + 2 - 4t*4 - 20t*2. -4t(t - 1)2(t + 2) Let o(z) be the third derivative of 1/20z5 + z2 + 0z + 1/12z4 - 1/6z*3 + 1/90z*6 + 0. Let k(x) be the first derivative of o(x). Factor k(q). 2(q + 1)(2q + 1) Let x(f) be the first derivative of -f*5 + 5f*3/3 - 10. Determine h, given that x(h) = 0. -1, 0, 1 Let z be (-2)/17 - 20/(-170). What is o in 2/5o*2 - 1/5 - 1/5o*4 + zo*3 + 0o = 0? -1, 1 Let a(t) be the third derivative of t*5/135 - 7t*4/54 + 20t*3/27 - 22t*2. Factor a(f). 4(f - 5)(f - 2)/9 Let g(v) be the second derivative of -v7/210 + v6/75 - v4/30 + v3/30 - 7v. Let g(p) = 0. Calculate p. -1, 0, 1 Let d(v) = 4v2 + 5. Let b(c) = -15c*2 - c - 19. Let m(z) = 6b(z) + 22d(z). Find w such that m(w) = 0. -2, -1 What is c in 2c*5 + 0c*4 + 48c - 4c2 + 4c*4 - 50c + 0c2 = 0? -1, 0, 1 Factor -10f*3 + 14f*4 - 8f*4 - 11f*4. -5f*3(f + 2) Find d, given that -8/9d + 2/9d*2 + 8/9 = 0. 2 Let v be (14/10 - 1)(-15)/(-99). Let k(w) be the third derivative of 1/132w4 + w2 + 1/165w*5 - vw*3 + 0 - 1/660w*6 + 0w. Factor k(a). -2(a - 2)(a - 1)(a + 1)/11 Let f(c) be the third derivative of 1/90c*5 + 0c + 1/36c4 + 0 - c2 + 0c*3 - 1/180c*6 - 1/315c*7. Find m, given that f(m) = 0. -1, 0, 1 Determine v, given that 32/7v - 4/7v2 - 64/7 = 0. 4 Find p, given that 69p*3 + 71p*4 + 2 - 44p*4 - 11p*2 + 19p + 70p2 = 0. -1, -1/3, -2/9 Let b(c) = 0c*2 - 8c + 5c2 + 0c*2 + 5c2. Let y(h) = -h3 - h*2. Let m(f) = b(f) + 2y(f). Factor m(o). -2o(o - 2)*2 Factor 9i*2 - 44i + 24i - 4i*2. 5i(i - 4) Let a = 102 + -914/9. Factor -a - 2/9s*2 - 2/3s. -2(s + 1)(s + 2)/9 Factor 3/2r3 - 1 + 3r - 1/4r4 - 13/4r2. -(r - 2)2(r - 1)2/4 Let t be (-9)/(-27) + (-29)/(-3). Let n(o) = -o3 + 10o*2 - o + 12. Let r be n(t). Determine i, given that -5/3i*4 + 4i*3 + 2/3i + 0 - 3ir = 0. 0, 2/5, 1 Let c(q) = -7q*2 - 2. Let v(y) = -3y*2 - 1. Let w = 12 - 16. Let s(k) = wc(k) + 9v(k). Find h such that s(h) = 0. -1, 1 Solve -4/3u + 1/3 + 4/3u3 - 1/3u*2 = 0 for u. -1, 1/4, 1 Let t be ((-1)/(-7))/(-1)(-602)/172. Factor t - o + 1/2o2. (o - 1)2/2 Let t(s) be the first derivative of -3s*5/5 + 9s*4/4 - 6s*2 - 2. Factor t(c). -3c(c - 2)2(c + 1) Suppose 0 = -3r + 3i + 15, -10 = -2r + 3i + 1. Factor -4c - 8c*2 + 6c*2 + 9c*r + 8c*3 - 3c*4. 2c(c + 1)2(3c - 2) Let g(x) be the third derivative of x8/3360 + x3/2 - 2x2. Let i(f) be the first derivative of g(f). Factor i(k). k4/2 Let d = 3/37 + -203/2960. Let o(q) be the third derivative of -q*2 + 1/672q*8 - 1/140q*7 + dq*6 - 1/120q*5 + 0 + 0q*4 + 0q*3 + 0q. Factor o(m). m*2(m - 1)*3/2 Let r be -4 - (-16)/(-7)-2. Let 0 - 2/7s - 2/7s*3 - rs*2 = 0. What is s? -1, 0 Let k(x) = -2x*2 - 10x - 2. Let a(c) = -3c + c + 0c + 3c. Let q(l) = -6a(l) - k(l). Factor q(o). 2(o + 1)2 Let d(v) be the first derivative of -3v*4 + 44v*3/3 - 16v*2 - 16v + 46. Factor d(z). -4(z - 2)2(3z + 1) Let k(i) be the third derivative of -i5/120 - 5i*4/48 + 27i2. Find t such that k(t) = 0. -5, 0 Let w(i) be the second derivative of -i5/30 + i*3/9 - 8i. Factor w(v). -2v(v - 1)(v + 1)/3 Let v be 21 + 52/(-8). Let j = 5 + v. Solve -1/2 + 3/2u2 + 1/2u - u*4 - ju3 = 0 for u. -1, 1/2, 1 Let o(f) be the first derivative of -f4/6 - 10f3/9 + 13f*2/3 - 14f/3 - 2. Factor o(j). -2(j - 1)2(j + 7)/3 Let v = 20/19 - 62/95. Let j = -97 + 487/5. Solve -jt3 + 0 + vt*2 + 0t = 0 for t. 0, 1 Let u(v) be the second derivative of 3v + 1/2v*2 - 1/360v*6 + 1/30v*5 - 1/6v*4 + 0 + 4/9v3. Let i(t) be the first derivative of u(t). Factor i(q). -(q - 2)3/3 Let i(q) be the third derivative of -q10/60480 + q8/6720 - q6/1440 - q4/12 - 2q2. Let w(b) be the second derivative of i(b). Factor w(z). -z(z - 1)*2(z + 1)*2/2 Let -3b*2 + 4b*3 - 5b*3 - 9b*4 + 10b*3 + 3b*5 = 0. What is b? 0, 1 Factor 2 + 31o*2 - 48o*5 - 5o*2 + 1 - 48o*4 + 22o*2 + 24o*3 + 21o. -3(o - 1)(2o + 1)4 Let m(u) be the third derivative of -u7/2100 - u6/900 + u5/300 + u4/60 + u3/6 + 3u*2. Let v(g) be the first derivative of m(g). Factor v(z). -2(z - 1)(z + 1)2/5 Let o(r) be the third derivative of 1/20r*5 + 5r*2 + 0r*3 - 1/40r*6 + 0r + 1/4r4 + 0. Find a such that o(a) = 0. -1, 0, 2 Let i(f) be the third derivative of f8/336 - f7/105 + f5/30 - f4/24 - 11f*2. Solve i(h) = 0 for h. -1, 0, 1 Let n = -49 + 151/3. What is f in -2f*2 - 2/3f*3 - n + 2/3f*4 + 10/3f = 0? -2, 1 Let b(s) = -8s - 2. Let r(t) = t2 + t + 1. Let u(p) = b(p) + 2r(p). Factor u(j). 2j(j - 3) Let l(x) be the third derivative of -x*6/30 + 7x*2. Factor l(q). -4q*3 Let v(x) be the second derivative of -7x*5/100 + 13x*4/30 - 13x*3/30 - 3x*2/5 + 3x. Solve v(y) = 0 for y. -2/7, 1, 3 Find t, given that 1/2t - 1/2t*2 + 0 - 1/2t*3 + 1/2t*4 = 0. -1, 0, 1 Let z(w) be the second derivative of -2w*6/15 + 4w*5/5 - 5w*4/3 + 4w*3/3 - 4w. Factor z(b). -4b(b - 2)(b - 1)2 Let r(o) be the first derivative of 0o + 0o2 - 3/4o4 + o3 + 2. Find h, given that r(h) = 0. 0, 1 Let 2 + 6 - 2i5 + 15i*4 - 14i*2 + 15i*4 + 2i*3 - 24i*4 = 0. What is i? -1, 1, 2 Let q = 1 + 2. Suppose -17 = -5y + q, y = -2j + 12. Factor 0 + 0h*2 - 1/3h*3 - 1/3h*5 + 0h - 2/3hj. -h3(h + 1)*2/3 Suppose 2g + 12 = 5g. What is j in -3j*2 + gj*2 - 2j - 3j2 = 0? -1, 0 Let w = 781/5 + -156. Solve -wh2 - h4 + 2/5h + 0 - 8/5h*3 = 0 for h. -1, 0, 2/5 Let v = -150 - -1952/13. Factor 8/13t*4 - 12/13t*3 + 0 + 8/13t*2 - vt - 2/13t5. -2t(t - 1)4/13 Let q(g) be the first derivative of -g5/180 - g4/24 - g3/9 - g2 + 3. Let c(u) be the second derivative of q(u). What is z in c(z) = 0? -2, -1 Factor 65i - 3 - 23i2 + 9i*3 - 4i*3 - 17i*2 - 27. 5(i - 6)(i - 1)2 Let x = -2 + 7/3. Let h(g) be the first derivative of -1 + 0g*2 + 1/3g*3 - xg - 1/6g4. Factor h(p). -(p - 1)2(2p + 1)/3 Let c(b) be the second derivative of b7/105 + b6/20 + b5/10 + b4/12 - 3b*2/2 + 3b. Let h(k) be the first derivative of c(k). Factor h(a). 2a(a + 1)*3 Let c(g) be the first derivative of -1/5g*3 - 5 + 0g + 3/25g5 + 3/20g*4 - 3/10g*2. Solve c(l) = 0 for l. -1, 0, 1 Factor -3/5m*3 + 9/5m + 0m2 + 6/5. -3(m - 2)(m + 1)2/5 Let v be 2/(-4) - (-11)/10. Let o = -15 + 15. Factor -3/5s*2 + o + 3/5s*4 - 3/5s*3 + vs. 3s(s - 1)*2(s + 1)/5 Let n(a) be the third derivative of -a*6/24 + 5a*5/12 - 5a*4/3 + 10a*3/3 - 11a*2. Factor n(d). -5(d - 2)*2(d - 1) Let b(s) be the third derivative of s*5/60 + 5s*2. Suppose b(w) = 0. What is w? 0 Let m(d) = 13d*4 + 27d*3 + 43d*2 + 27d + 8. Let o(y) = 6y4 + 14y*3 + 22y*2 + 14y + 4. Let c(s) = -2m(s) + 5o(s). Factor c(g). 4(g + 1)4 Factor -3u*4 + 4u*4 + 6u*3 - 4u*3 - 3u5. -u3(u - 1)(3u + 2) Let k(w) be the second derivative of -7w*4/108 + 2w*3/9 + 2w*2/9 - 12w. What is s in k(s) = 0? -2/7, 2 Let j(d) be the first derivative of -14d5/55 - 9d*4/22 - 4d*3/33 - 1. Factor j(b). -2b*2(b + 1)(7b + 2)/11 Let g(y) = -y*2 - 7y - 10. Suppose -n + 4 = 3d + 6, d = 3n + 16. Let k be g(n). Suppose 2/3o2 - 2/3 + ko = 0. Calculate o. -1, 1 Factor 7p2 + 4 + 5p2 + p3 + p - 13p - 5p*3. -4(p - 1)3 Let f(m) = m5 - m4 + m3 - m - 1. Let v(t) = 10t5 - 30t*4 - 5t*2 - 15t - 15. Let w(l) = 15f(l) - v(l). Factor w(i). 5i*2(i + 1)*3 Let z(i) be the third derivative of -5i*8/21 - 32i*7/21 - 79i*6/24 - 7i*5/3 + 25i*4/24 + 5i*3/3 - 16i2. Solve z(n) = 0 for n. -2, -1, -1/4, 1/4 Let x(t) be the second derivative of -t6/105 + t5/70 + t4/21 + 6t. Factor x(m). -2m*2(m - 2)(m + 1)/7 Let a(c) be the second derivative of 0c*3 + 1/48c*4 - 2c - 1/8c2 + 0. Determine k so that a(k) = 0. -1, 1 Let l(t) be the first derivative of -4t*3/3 + 16t*2 - 64t - 15. Let l(v) = 0. What is v? 4 Let j(k) be the third derivat	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.