Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
6 - z. Calculate the lowest common multiple of 2 and m. 14 Let h be 7/(-3) - (-6)/18. What is the smallest common multiple of 3 and h/3 + (-32)/(-12)? 6 What is the common denominator of 3 - (-2 + (-219)/(-72)) and -46/21? 168 Let s = -12 - -20. Calculate the smallest common multiple of s and 14. 56 Let j = -8038/3 + 2704. Calculate the common denominator of 65/22 and j. 66 Let y be (-35)/18 + (4 - 2). Let u = -184/9 - y. Find the common denominator of u and 45/22. 22 Find the common denominator of ((-98)/40 - -2) + 0 and (121/(-30))/(2/(-6)). 20 What is the common denominator of 2/(-3) + 276/90 and -115/6? 30 Let z be 1(-12)/(-4) - 28. What is the least common multiple of 8 and 90/z15/(-6)? 72 What is the smallest common multiple of (-4)/6 + 24/9 and (-10)/(-30)(-3)/(-1)? 2 Let x = 12 + 1. Let b = x + -7. Calculate the common denominator of 101/2 and (45/8)/(b/20). 4 Let h(q) = -1 + 3 + 6q - 7q + 3q*3 - 2q*2. Calculate the least common multiple of h(2) and 6. 48 Let m = 2295 + -25215/11. What is the common denominator of (-75)/(-9)3/(-8) and m? 88 What is the smallest common multiple of (-1 + 3)(25/2)/5 and 60? 60 Let f be (-21)/(-6) - 3/6. Suppose 0 = 3s + fl - 21, 5s + 3l - 34 + 5 = 0. Let t = 31 + -17. Calculate the least common multiple of t and s. 28 Let h be 348 + (-3)/((-6)/(-2)). Let a = 1425/4 - h. What is the common denominator of a and 32/((-72)/50)? 12 Suppose -4g + x - 9 = 0, 3x - 13 = 4g + 6. Let i be ((-9)/(-18))/(g/98). What is the common denominator of 25/6 and (-2)/(-1) + i/10? 30 Let f = -13 - -8. Let u(j) = -j2 - 8j + 2. Let k be u(f). Suppose 65 - k = 4d. Calculate the lowest common multiple of d and 22. 132 Calculate the common denominator of (2/4)/((-9)/222) and 91/2. 6 Let d(y) = -y3 + 4y*2 + y - 1. Let u be d(4). Let q be (-10136)/(-426) - 1/u. Let h = 80/71 - q. Find the common denominator of h and 25/3. 3 Suppose -4y + 2y = 10. Let o(f) = -f2 - 6f + 6. Calculate the lowest common multiple of o(y) and 3. 33 Let n = 8725 + -15176. Let u = 13254077/6 - 2202541. Let d = n + u. What is the common denominator of -5/14 and d? 42 Let y = 12 + -4. Let m = y - 2. What is the lowest common multiple of m and 14? 42 Let w(x) = -x*2 + 8x + 17. Let i be w(7). Suppose h + 3h = i. Calculate the least common multiple of 9 and h. 18 Let y(u) be the third derivative of -u4/24 + u3/6 + 5u*2. What is the lowest common multiple of 10 and y(0)? 10 Let s = -8677/897 + 2/299. What is the common denominator of -53/4 and s? 12 What is the lowest common multiple of 6/57 + 36/19 and 38? 38 Suppose -4x = 2i - 2, 0x + 2i = 4x + 2. Let b = x - -6. What is the lowest common multiple of b and 10? 30 Let s = 68/25 - 22669/8325. Let k = -24305/1332 + s. Calculate the common denominator of k and 63/10. 20 Let v(p) = 5p - 11. Suppose -4r = 3u - 29, 3u - 6 = u. What is the least common multiple of 16 and v(r)? 112 Let i = 27 + -13. What is the least common multiple of (-50)/(-3) + i/(-21) and 12? 48 Let n be 24/9 + (-1)/(-3). Suppose -ny + 65 = 5j, 0 = -j - y + 3y. Calculate the smallest common multiple of 8 and j. 40 Suppose -b = -2x + 12 + 33, -5x - 4b = -80. Let w(h) = 7h - 3. Let k be w(5). Suppose -2s = -6s + k. Calculate the lowest common multiple of s and x. 40 Let f(u) = 2u*2 + 4u - 8. What is the least common multiple of f(2) and 12? 24 Let j = 121/37 + -661/666. Calculate the common denominator of 3/(-30)(-150)/8 and j. 72 Let r = 7/50 + 351/350. Find the common denominator of (62/(-3))/((-10)/3) and r. 35 Let p(l) = 3l - 4. Let t be p(6). Let r = t - -87. Suppose 0b - 178 = 4k + 2b, 2k + 5b + r = 0. What is the common denominator of 41/5 and k? 5 What is the common denominator of (7/(-84))/((-1)/94) and 37/5? 30 Let p(v) = -2v*2 - 13v + 4. What is the lowest common multiple of p(-6) and 12? 60 Suppose 0 = 3i - 2i - 15788. Let d be (1/(-8))/(33/i). Let y = d + 777/11. What is the common denominator of 35/8 and y? 24 Let c be 30/(-16)(-70)/(-110). Let a = -163/88 + c. What is the common denominator of -37/16 and a? 176 Let c = 2261/4 - 571. Let p(d) = 27d*3 - 6d*2 + 7d - 5. Let r be p(4). Let z = -36499/22 + r. Calculate the common denominator of z and c. 44 Let o(t) = t*2 + 3t + 2. Let a be o(-4). Suppose -j - 5 = -aj. Calculate the lowest common multiple of 6 and j. 6 Let z = 10 + -2. Let h = 5 + 3. What is the least common multiple of z and h? 8 Let u(q) = 2q*2 + 6q + 10. Suppose -z = -29 + 9. What is the smallest common multiple of u(-3) and z? 20 Suppose -66 = h - 8. Calculate the common denominator of h/28 + -1 + 0 and 2/(-20)222/(-12). 140 Let i(q) = -280q*2 + 4q - 3. Let u be i(3). Let d = u + 15119/6. Calculate the common denominator of 1/2 - 77/(-20) and d. 60 Let j(g) = -g + 56. Let z be j(0). Calculate the common denominator of -10/9 and 8/(-3)(-36)/z. 63 Let d = 17 + 3. Calculate the lowest common multiple of d and 16. 80 Let x = 183/31 + -3677/124. Let l = 257/8 + x. What is the common denominator of -62/9 and l? 72 Suppose -d = -2i - 18, 15 + 55 = 3d - 2i. Let x = d - 20. What is the smallest common multiple of 16 and x? 48 Suppose 0s + 5k - 36 = 4s, -s - 4k + 12 = 0. Let u = 8284 + -182209/22. Calculate the common denominator of (-5)/42 - s/(-6) and u. 154 Calculate the least common multiple of 41/5 - 16/80 and 386. 1544 Let i = 0 - -5. Suppose -5r - 3a = -25, r + a = 6r - i. What is the least common multiple of 16 and r? 16 Let w = -20771/8 - -2588. Suppose -4m = -p - 2 - 33, 4m + 180 = -4p. Find the common denominator of p/16 - (-9)/6 and w. 16 Let l = -3931/2330 - 3/233. Find the common denominator of l and 51/4. 20 Let g = -2 + -3. Let l = g + 12. Calculate the lowest common multiple of 1 and l. 7 Suppose 4a + 4u - 28 = 0, -2a - 2 = -3u + 4. Let n(x) = x*3 + 3x*2 + x. What is the lowest common multiple of n(-2) and a? 6 Let w = -12 - -16. Suppose 5m = 5k + 115, -m + 2k + 8 = wk. What is the smallest common multiple of 6 and m? 18 Suppose 0 = 3c + 4n - 49, -c + 3n = -1 - 11. Find the common denominator of -101/6 and -2 - c/18 - 2. 6 Let t = 30 - 24. What is the smallest common multiple of 32 and t? 96 Let x = -8039 + 48377/6. Let p = -391 + 6645/17. Let z = 185/272 + p. What is the common denominator of x and z? 48 Let m(h) = -3h + 32. Calculate the least common multiple of 4 and m(0). 32 Suppose -6 = -2c - 20. Let v(a) = -a*2 - 8a - 1. What is the least common multiple of v(c) and 4? 12 Let n = -10 - -6. What is the common denominator of 45/4 and (n - 49)(-1)/2? 4 Let c be (-2)/(-3) + (-10)/15. Suppose c = 4v - 27 - 17. Let t(x) = -x*2 - 5x + 4. Calculate the lowest common multiple of v and t(-3). 110 Let p = 7 - 3. Let l(k) = k*3 - 10k*2 + 12k - 7. What is the lowest common multiple of p and l(9)? 20 Suppose -3r - 46 = -1. Let s = r + 21. Let x = 9 + 3. Calculate the smallest common multiple of x and s. 12 Suppose 0 = -2p - 0p + 10. Suppose z - 3g = -3z + 13, 0 = -5g + p. Calculate the least common multiple of 10 and z. 20 Suppose 31 = -o + 39. Let a(f) = -f + 9. Let k be a(6). Suppose 0 = -ki + b - 18 + 89, 3b = -15. What is the lowest common multiple of o and i? 88 Let y be (5240/18)/((-2)/7). Let d = 1020 + y. Find the common denominator of 38/9 and d. 9 Suppose 5o - 98 + 18 = 0. What is the least common multiple of (-2 + 12)(-3)/(-3) and o? 80 Suppose 5c = 5k - 5, 4c = -4k + 2c + 22. Let g(v) = 0v*2 - 2v*2 - 2v - 3 + 3v2. What is the lowest common multiple of g(k) and 5? 5 Let p(r) = -r2 - 3r - 2. Let o be p(-2). Suppose 3u - 3g - 36 = u, -2g = o. What is the lowest common multiple of u and 16? 144 What is the common denominator of 29/9 and (0 + (-2)/(-10))46? 45 Find the common denominator of -79/14 and (-18)/81 - 482/(-36). 42 Let c be 2/(-8) + (-50419)/4. Let j be (1/57)/((-10)/c). Let h = 360/19 - j. Find the common denominator of h and 61/10. 30 Find the common denominator of -122/(-24)-2 and 27/12(-6)/(-45). 30 Suppose 0 = 3o + 2o - 30. Calculate the smallest common multiple of 6/4 - 104/(-16) and o. 24 Let a = -101203/8 - -12666. Let p = a - 327/16. Find the common denominator of -57/14 and p. 112 Suppose 2f - 270 = 5*f. Calculate the common denom	{ "pile_set_name": "DM Mathematics" }
-84g - 5x - 322, -3g + 3 = -3x for g. -4 Solve -342 + 318 = -3c - y, -3c + 60 = 5y for c. 5 Solve -y - 2 = 2o, 0 = 8503y - 8501y - o + 19 for y. -8 Solve -s = -d, -5d + 26 - 18 = -s for d. 2 Solve -3r - 2i = 86 - 67, -42 = 4r + 6i for r. -3 Solve 293b = 308b - 5m + 55, 5m = b - 1 for b. -4 Solve -2824w + 2825w = -y + 9, -3y = 2w - 22 for w. 5 Solve -3365z - 5 = -3360z + 5y, z + 2y = -1 for z. -1 Solve 40 = 4j - 7v, -86v + 89v = -3j - 3 for j. 3 Solve -3c = -3p + 6, 3c + 18p - 51 - 69 = 0 for c. 4 Solve 5k - 3g + 42 = 0, 2g = -1855 + 1853 for k. -9 Solve -34 = t + 3f, 2t - 42f = -45f - 35 for t. -1 Solve -4 = -4l - 4w, -4772w + 4778w - 24 = 3l for l. -2 Solve 4b - 5a - 60 = 0, 2b + 815a - 112 = 838a for b. 10 Solve 6w + 5 = 3k - 22, 2w + 5k - 21 = 0 for w. -2 Solve -3m + 3r + 30 = 0, 3 = -2m + 3r + 23 for m. 10 Solve y = -5s + 6, 31s - 35s - 4 = 3y for s. 2 Solve j = 2, -328k + 8j + 8 = -332k for k. -6 Solve 0 = -8r + 7r - 5p + 16, -12 = 3r - 5p for r. 1 Solve 5m = 4o + 21, 3m - 456o = -454o + 11 for m. 1 Solve 13v - 18v + x = -3, 2v = 3x - 4 for v. 1 Solve -1 = -a - 615f + 613f, -4a + 4f = 8 for a. -1 Solve 2r + 35820 = 3k + 35805, 25 = 5k - 3r for k. 5 Solve 438c - 433c + 39 = 3h, c = 4h - 52 for c. 0 Solve -3y + 3h = -9, -237h = 5y - 232h - 5 for y. 2 Solve 277x + 6k + 31 = 282x, 1 = -k for x. 5 Solve -h = -4p + 1, 12h - 17h - 5 = -p for p. 0 Solve -49 = -2i - 77, 50 = 4d - 3i for d. 2 Solve 5m + 5c + 40 = 0, 999m - 1000m + 17 = -4c for m. -3 Solve -336v + 339v + 31 = 5c + 7, 0 = -c - v for c. 3 Solve -21m + 20m - 18 = -4o, 3o = -3m + 21 for o. 5 Solve 4f + 22 = 5x, -355 + 357 = -2f + x for f. 2 Solve -9c - 2x = -13c + 50, 17c - 4x - 235 = 0 for c. 15 Solve 5h - 10 = 0, -5t - 21 = -135h + 132h for t. -3 Solve -2v - g - 3 = 0, 8v - 24 = 13v + 8g for v. 0 Solve 3b = -5q + 2, -280b + 275b - q = -18 for b. 4 Solve 255s + 36 = 269s - 4k, 0 = s + 4k - 24 for s. 4 Solve -3n + 139 - 123 = 2a, n - a - 2 = 0 for n. 4 Solve 0 = -3l + n + 12, -l + 959n - 961n = -11 for l. 5 Solve 5s = -23 - 42, 0 = -5p - 10s - 145 for p. -3 Solve 5q = -4w + 9, -3q + 11146w - 11149w + 6 = 0 for q. 1 Solve -4t - h - 25 - 22 = 0, 48 = -3t - 5h for t. -11 Solve 408g - 3z + 21 = 413g, 2z + 30 = 4g for g. 6 Solve -18 = -6y, -6 = -3294m + 3291m + y for m. 3 Solve 0 = 3g - 4t - 13, 38t = g + 43t + 21 for g. -1 Solve -231v + 227v = -2j + 32, -19 = 3v + j for v. -7 Solve -5k - 21 = -4l + 47, -4l + 101k - 100k = -20 for l. 2 Solve 5s - 17 = n, -260n + 17 = 3s - 264n for s. 3 Solve 10 = 5k - 5, 26z + 4k = 21z + 12 for z. 0 Solve 5d + 24a + 24 = 0, 5 = -4d - 11a + 6a for d. 0 Solve -2g - 1 = -104t + 103t, 4g - 9t - 5 = 0 for g. -1 Solve 0 = 2h + 3m + 14, 4m + 484 - 477 = -5h for h. 5 Solve 4i + 1 = 7s, -2i = 3406s - 3401s + 9 for i. -2 Solve -2p + 4225h = 4227h + 28, p + 5h = -54 for p. -4 Solve 47846i = o + 47845i + 17, o + 4i = 93 for o. 5 Solve -2f = 4y - 297 + 329, 52 = -4f - 5y for f. -8 Solve -i - 56 = -u - 60, 0 = -4u for i. 4 Solve -4w = 5l - 20, 0 = 228w - 225w + 4l - 15 for w. 5 Solve 3f - 2x - 7 = 0, 10214x - 10211x + 27 = -f for f. -3 Solve -2f = -2n, -59f + n - 2n + 4 = -56f for f. 1 Solve 5j = -4x + 11, -7111j + 2x = -7110j - 5 for j. 3 Solve 0 = 62x - 67x + 3c - 10, -20 = 4c for x. -5 Solve -4s - 8 = 0, -9l - 5s - 13 = -8l for l. -3 Solve -4c - 13t + 10t = -4, -2t = -4c + 24 for c. 4 Solve 0 = -5o + 10, 5x - 97o = -102o - 10 for x. -4 Solve 2a = 5z + 15, 124 = -3a + 5z + 139 for a. 0 Solve -5207i - 3y - 92 = -5223i, -4y = 4i - 4 for i. 5 Solve -5l + 6 + 19 = -5v, 3l - 591 + 570 = 0 for v. 2 Solve 0 = 4c + 309 - 317, 4f + c + 10 = 0 for f. -3 Solve 26i - 31i + 7k = -2, -2i = 4k + 6 for i. -1 Solve -5s - 173m + 172m - 12 = 0, 3m + 16 = -5s for s. -2 Solve -5f = s - 4, 27f - 16f - 12f = -2s + 8 for s. 4 Solve -n + 50 = -3r, -5n - 3r - 6 = 50 for n. -1 Solve -43g = 5a + 149, 5g + 114a = 113a - 19 for g. -3 Solve 2h + 325z - 326z = 1, 0 = -5h - 5z - 20 for h. -1 Solve 5w + 20 = 0, -4i = 5w + 23 - 11 for i. 2 Solve 0 = i - l - 7, -6 = 186i - 188i + l for i. -1 Solve -u - 2q = -3, -11u + 6u + 2q - 33 = 0 for u. -5 Solve 6p - p + m - 35 = 0, 0 = -p + 5m + 33 for p. 8 Solve 91 = -4m - 5n, -227n + 232n = -m - 34 for m. -19 Solve -18 = -2u - 6k, -2k = -5u - 198 + 175 for u. -3 Solve -3r + 2q - 53 = 0, -172 = 2r - 3q - 135 for r. -17 Solve -4f = 2h + 2, 218f + 4h - 6 = 220f for f. -1 Solve f + 4r - 4 = 0, -4r = -6f - 179 + 175 for f. 0 Solve -n + 14 = -2i + 3, -3i - 29 = -4n for n. 5 Solve 19z - 20z = -2c + 6, 2c = 10 for z. 4 Solve -4t = -5p - 280 + 262, 4p + 4t - 36 = 0 for p. 2 Solve -4q - 145 = 25l, -2l + 0l + 38q = 36q for l. -5 Solve -m + 2r - 7 = 0, -5m - 177 = -4r - 166 for m. 1 Solve -2608i = -y - 2610i - 3, 5i = 2y + 15 for y. -5 Solve -83h - 56 = -95h - 4z, -3h = -5z - 4 + 2 for h. 4 Solve 560 = -5p + 3d + 498, -2p = -2d + 40 for p. -1 Solve -36 = 5n + 21v, 3v - 8v = -5n - 10 for n. -3 Solve -10c = -14c - 36, 2c + 3 = 5z for z. -3 Solve 51 = -7s + 14190k - 14194k, -7s - 3k - 47 = 0 for s. -5 Solve -5 = -5g, -16g - 8 = 5o - 19g for o. -1 Solve 13 - 18 = -5v, -5v + 3 = -o for o. 2 Solve -2n - 18 = -2b - 20, -3n - 4b + 3 = 0 for n. 1 Solve -2j - 6q = -8q - 16, 4 = 3j + q for j. 3 Solve -4j = -5p + 37, -5j + 8j + 19 = 2p for p. 5 Solve 0 = -2r + 4v + 34, -v + 46 = -5r + 77 for r. 5 Solve -5z = 56g - 59g + 81, -z - 23 = -4g for z. -15 Solve 3b = -2m + 21, 2m + 11 = 3b - 10 for m. 0 Solve 6i + 116d = 115d + 1, -2i - 5d = -5 for i. 0 Solve 5m = -46v + 50v + 60, -2v + 3m = 32 for v. -10 Solve s - 46768c + 46763c = 23, 9 = -2s - c for s. -2 Solve -p - 32 = -4o, -3 = 5o + 2p - 30 for o. 7 Solve -16 = -4n + m + m, m - 17 = -3n for n. 5 Solve -u = 2c + 14424 - 14410, -5c + 4u - 61 = 0 for c. -9 Solve 1 = -3p + 4j, 187j - 89j - 3 = 95j for p. 1 Solve -3h - 6d - 43 = -3d + 5, 4d + 48 = 0 for h. -4 Solve 0v - 6v = -w + 10, 5v = 3w - 4 for v. -2 Solve -3a + 14b + 3 = 11b, b = 3a - 7 for a. 3 Solve -32o - 26 = 5z - 16o - 13o, -5z = -29o - 198 for z. -1 Solve -2d = -4w - 8, -407d - 3w - 4 = -409d for d. -4 Solve 2v + 23p - 112 = 68, 2v - 5v = -2p + 22 for v. -2 Solve -9y + 13y - 3 = -3q, 0 = -y + 3 for q. -3 Solve 806l = 804l - 17u + 24, 4u = l + 13 for l. -5 Solve 0 = -16o + 11o - 3z + 9, 2o = 2z + 10 for o. 3 Solve 5v + 1 = -3q + 6, -229v - 6 = -226v for q. 5 Solve 0 = -4v - 4l + 16, 174v - 5l = 175v - 20 for v. 0 Solve -3q = -3o - 81, -561o + 6q - 166 = -559o for o. 1 Solve -1 = -t + 3j, t + 60j + 11 = 75j for t. 4 Solve 9 = -q - 4g, 3g = 1302 - 1305 for q. -5 Solve 4x - 4m + 149 = 145, x = 3m - 13 for x. 5 Solve 3b - 40 = -4h, 23 = 26b - 22b + h for b. 4 Solve -5s - 2q = 1, 5q + 21 - 17 = -11s for s. 1 Solve 2d = 3r + 4, 305d + 180d = 970 for r. 0 Solve 0 = -2o + 3u - 12, o - 32u + 34u = -6 for o. -6 Solve 11y = 8f - 3f - f - 7, 4 = -4y for f. -1 Solve -22358x + 22361x = 3k - 33, 5x + 4k = 35 for x. -1 Solve -3o + 5p = 37, -2425 + 2385 = 5o - 4p for o. -4 Solve -4o - 5u + 57 = 0, 33o = 31o - u + 9 for o. -2 Solve -493o = 4j - 491o - 20, 2j + 5o = -0j + 42 for j. 1 Solve -98j - 4x + 40 = -93j, 3 = -3j + 3x for j. 4 Solve 5s - q - 40 = 0, 5s + 12q - 210 = 47q for s. 7 Solve -78f + 74f + 20 = -15o, -10 = o - 2f for o. 0 Solve -2x + 76i - 77i - 18 = 0, -8x - 76 = 2i for x. -10 Solve 18j - 12 = -4t + 20j, 4 = 2j for t. 4 Solve -5p + 117b - 31 = 119b, -4p + 28 = -5b for p. -3 Solve -3y - h = 1, -60h + 30h = -3y + 30 for y. 0 Solve 5t - 22686g - 30 = -22691g, 2g - 32 = 2t for t. -5 Solve 127l + 4h - 9 = 128l, -4l - 4h = -4 for l. -1 Solve 0 = -5g - 2b - 39, 6g - 144b + 9 = -141b for g. -5 Solve 5j = -4v - 29, 4j - 18 = -2v + 8j for v. -1 Solve -5a = 5y - 32 + 57, 4a + 2*y = -16 for a. -3 Solve -77211 + 77182	{ "pile_set_name": "DM Mathematics" }
a) -13 (b) 0 (c) -10 (d) -127 b Which is the closest to -0.5? (a) 118 (b) -1797 (c) -0.4 (d) 0.1 c What is the nearest to 0.1 in 0.21, 2, -675167? 0.21 What is the nearest to 2.2 in -3/34, -12.39, 3? 3 What is the closest to -0.2 in 94, -6, 3/4, -40? 3/4 Which is the nearest to 8? (a) -740 (b) 2/3 (c) 134 (d) -0.5 (e) 5 (f) -2/3 e What is the closest to 0.16 in -10/3, -1, -2, -24, -0.2? -0.2 What is the closest to -114 in -2/51, -1/11, 1? -1/11 What is the closest to 1 in -27/7, 0, -2/14445? 0 Which is the nearest to -2.59899? (a) -0.7 (b) 1 (c) 12 a Which is the closest to 1.41? (a) -3 (b) 5 (c) 11/7 (d) -101 (e) -2/3 c What is the nearest to -44 in -5, -6, -751, 3? -6 Which is the closest to -1.8? (a) -5 (b) -10.95 (c) 0.6 c Which is the closest to -8/7? (a) -1/4 (b) 0.1 (c) -2/7 (d) 1 (e) -10 (f) -28 c Which is the nearest to 861/20? (a) 104 (b) -0.1 (c) -0.3 (d) -0.4 (e) -1/2 b Which is the nearest to -1/2? (a) -1 (b) -0.62050008 (c) 0.2 b What is the nearest to -1 in 2/3, -544, 3/7, 0.4, 1, -7126? 0.4 Which is the closest to -1/3? (a) 7 (b) -0.1 (c) -38 (d) 0.2 (e) -444 (f) 0.1 b Which is the closest to 2/7? (a) 0.5 (b) -4 (c) 0.3 (d) -5 (e) -453393 (f) -3/4 c Which is the closest to -183? (a) 0.1 (b) 10 (c) -5 (d) -4 (e) -355 e What is the closest to 244/7 in 1, -4/7, -1, -0.01, 4, 2? 4 Which is the nearest to -2/5? (a) 20.627 (b) 11 (c) 7 c What is the nearest to 2/3 in 3, 2179, -4/5, 1/3? 1/3 What is the nearest to -2/3 in 318.2, 0.3, -2, -11? 0.3 Which is the nearest to -0.1? (a) 0.805 (b) 4 (c) -8.7 (d) -4 a Which is the nearest to -3? (a) 75 (b) -0.2 (c) -5514 b Which is the nearest to 0.1? (a) 138 (b) -16360 (c) 0.5 c What is the nearest to 0 in -60877, 1/2, 0.1, -2/11? 0.1 Which is the closest to 1064? (a) -19/3 (b) -19 (c) -1 c Which is the closest to -1/9? (a) 4 (b) 0.02 (c) -42/149 b Which is the nearest to -1/3? (a) -0.13 (b) 0.6 (c) -3344 (d) 1/6 (e) 3/4 a What is the closest to 0 in 59, -78, 2/3, 4, -5, -14? 2/3 Which is the nearest to 856? (a) -0.3 (b) 0.4 (c) 0 (d) -4.9 b Which is the nearest to 2979? (a) -2/13 (b) 5/6 (c) -2 (d) 2 (e) -4 d Which is the closest to -0.06? (a) 0.074 (b) -3 (c) -0.16 (d) 2/3 c Which is the nearest to 306.116? (a) 0.2 (b) 0 (c) -1/5 a What is the nearest to -0.07 in 4/19, -6, -4, -26, 2? 4/19 Which is the nearest to 1? (a) 42.09 (b) -80 (c) 5/3 (d) -0.3 (e) -3 c What is the closest to -1 in -2.1, 0, 2/19, -0.04, 4590? -0.04 What is the nearest to 0 in -16, -0.08, -3/11, -2? -0.08 What is the closest to 1/32502 in -0.01, -1, 47? -0.01 What is the closest to -8 in 2, -2/9, 3, 210? -2/9 Which is the closest to -9? (a) -1375 (b) 50/9 (c) -5 c Which is the nearest to 6.5? (a) -1/4 (b) 1731 (c) 2/7 c What is the closest to 177.1 in -1/3, 1/4, 1/3, -1/4? 1/3 What is the closest to -1/3 in 1, 0.1, -2/5, 2/17, -0.011, 60? -2/5 Which is the nearest to 0? (a) 209 (b) 3 (c) -40 (d) -58 (e) 0.3 e Which is the closest to -9/7? (a) 281 (b) -1 (c) 0.2 (d) -2/67 b Which is the closest to 3/5? (a) 2/3 (b) -2 (c) -60077 a What is the closest to 5/6 in -3, 1, 1132, 6/13, -0.1, -0.5? 1 What is the closest to -3 in -3/3496, 0, 1/609? -3/3496 Which is the nearest to 3? (a) -0.664 (b) 11 (c) 2/7 (d) 5 (e) 0.5 d What is the nearest to 0 in -2, -1, -178, 13/2, -3/5? -3/5 What is the closest to 0.1 in 0.86467, 1, 9, 8? 0.86467 Which is the closest to -0.03? (a) 40 (b) -4376 (c) -3/7 (d) 2/5 c Which is the closest to -1? (a) 1.2 (b) -175 (c) -0.2 (d) -0.068 c Which is the closest to 2? (a) -0.05 (b) 0 (c) -11 (d) 15/214 d What is the closest to -270 in 55, 1/4, -0.5, 7, -4? -4 What is the closest to 2 in -875, -0.1, 3, -478? 3 What is the nearest to 1134543 in 5, -3, 1/2? 5 What is the nearest to 243 in 6/17, 0, 2/13, 1, -0.06? 1 What is the closest to -1 in 174/26189, -0.1, 10, -4? -0.1 Which is the closest to 144? (a) -1/2 (b) -1 (c) 2/793 c Which is the nearest to 363? (a) 4/9 (b) -0.4 (c) 7 (d) -0.3 (e) 4 c Which is the nearest to -0.1? (a) 7 (b) -563 (c) 1/3 (d) 4 (e) 0.064 e What is the nearest to -1/3 in 11, -8, 233, 1/4, 0.5, -25? 1/4 Which is the nearest to -15.8098? (a) 5 (b) -0.1 (c) -3 (d) -4 (e) -5.3 (f) -2 e What is the closest to 7 in -2, 3, 5, 49, 17? 5 What is the closest to -0.2 in 3.539, 0.8, -1, -35? -1 Which is the closest to 6859? (a) 2 (b) 5 (c) 2/3 (d) 9 (e) 0 d Which is the closest to -2? (a) -3/7 (b) -14812 (c) -6 (d) -5 a Which is the nearest to 0.2? (a) 1 (b) 212 (c) -0.1 (d) 0.024 d What is the closest to 1.72 in 24.316, -0.4, 1/8, 0.4? 0.4 What is the closest to -2/11 in -2/7, -2/17, -0.313, -1, -2/3? -2/17 What is the nearest to -1/3 in -23/54, 0, -1? -23/54 What is the closest to -1262.3 in -4, -2, 4? -4 What is the nearest to 0.1 in -1/11, -9432, -5, 22? -1/11 Which is the nearest to 1? (a) -61 (b) 0.4 (c) -12.1 (d) 5 b Which is the nearest to -0.5? (a) 67 (b) 0.3 (c) 1 (d) 120 (e) -0.5 (f) 8 e What is the closest to 2 in 0.197, -3899, -21? 0.197 What is the nearest to 2 in -4, 587, 13, 3/4, 1/5, -88? 3/4 What is the closest to 0.3 in 1/1659, -1/6, -4, -150? 1/1659 What is the closest to 1/13 in -976.2, -0.1, 2/49? 2/49 Which is the nearest to 22? (a) -12 (b) -564 (c) 0.171 c What is the nearest to 0.1 in 5, 6, 1/872, 2/17, 0, -43? 2/17 Which is the nearest to 12.82? (a) 1.4 (b) 1/4 (c) 0.093 (d) 0.1 (e) -2/7 a What is the closest to 4 in 38/7, 1/13, 0.1, 2/17, -6/5? 38/7 What is the nearest to -5 in -4, -1, -11.7, -0.1, 3/7, 36? -4 Which is the nearest to -5? (a) 0.7 (b) -5 (c) -0.119 (d) -4 (e) 5 b Which is the closest to 2/3? (a) 0.126 (b) -2/7 (c) 1 (d) 86/11 (e) -3 c Which is the nearest to 2.2? (a) 2 (b) 0 (c) -90 (d) 32 a Which is the nearest to 0.1? (a) 4 (b) 17 (c) 0.5 (d) 393 (e) 13/4 c What is the nearest to -31 in -3/7, -0.9, 1, -40, -2? -40 What is the nearest to -2 in -0.3, 1080.7, -3094? -0.3 Which is the nearest to -9942? (a) -26 (b) 0.4 (c) 0 (d) -0.3 a Which is the closest to -1? (a) 7 (b) 267 (c) 1/2 (d) 2.54 c What is the closest to 1 in 8.66, 0.3, 0.4, 1314? 0.4 What is the closest to -0.1 in -2.03, 287.1, 1.2? 1.2 Which is the nearest to 2/7? (a) 5/4 (b) -8/3 (c) 2/41 (d) 0.3 (e) -0.6 d Which is the closest to -4/9? (a) -1546 (b) -25 (c) -1/42 c What is the closest to -0.1 in -3, 1/84, -17, 1, -67, -0.11? -0.11 Which is the nearest to 3/14? (a) -24 (b) -1/4 (c) -1/6 (d) 0.5 (e) -5 (f) -13 d Which is the closest to -10? (a) 5/3 (b) 4 (c) 78/11 (d) 3.6 (e) 59 a Which is the nearest to -1/2? (a) -5.6 (b) 2 (c) -0.5 (d) 0.2 (e) -0.005 c Which is the closest to 1/17? (a) 0 (b) 16 (c) 0.167 (d) 1/3 a Which is the closest to -2.13? (a) 11992 (b) 4/13 (c) 0.2 c Which is the closest to 0? (a) -352 (b) 1.47 (c) -2.84 b Which is the nearest to 7? (a) -22 (b) 2/19 (c) -1377 b What is the closest to 484.507 in -8, -2, 5, 2, -0.2? 5 Which is the nearest to 3? (a) -6978 (b) 0.577 (c) -5 (d) 0.2 b Which is the nearest to 0.052? (a) 4 (b) -0.1 (c) -17/3 (d) -5 b Which is the nearest to 1.08? (a) 0.1 (b) -7 (c) 2/3 (d) 4 (e) -55 c What is the nearest to -2 in -18678.3, -2, -4? -2 Which is the closest to -0.1? (a) -20949 (b) -3/4 (c) -3/407 c What is the nearest to 2/5 in 9.578, 0.6, 76? 0.6 What is the nearest to -22 in -0.1, 34/21, -1/3, -3? -3 What is the closest to -30/19 in -40, 5, 44, 0.3? 0.3 Which is the nearest to -3/31? (a) 32 (b) -0.4 (c) 0.06 (d) -39 c What is the nearest to -1111 in -2, 0.4, 19.492, -2/9? -2 What is the closest to 0.285 in 2, -1/4, -0.5, 5, 1/33, -1/5? 1/33 Which is the nearest to -0.1? (a) -1/7 (b) 0.4 (c) 4821/4 (d) -1/3 (e) -1/4 a What is the nearest to 0.4 in 22, 0, 3/2, -0.0554, -5? 0 What is the nearest to -11/2 in -0.23, -0.3, 1.3, 0.4, -14? -0.3 What is the closest to 1 in 2.3, -52, 202, -1/4, -12, 1/12? 1/12 What is the closest to 59.291 in 0, -3, -5, 40? 40 What is the closest to -0.036 in 1, -6, 12, 14? 1 Which is the closest to 1.18? (a) -2/19 (b) 2 (c) 5 (d) 0.4 d Which is the closest to -9999? (a) 4 (b) -21 (c) -2 (d) -2/13 b Which is the nearest to 0.1? (a) 3	{ "pile_set_name": "DM Mathematics" }
+ 2 + 3)(-7k + 14k + 5k). 84k Expand t + 5 - 3 + 3t + (2 - 2 - 2)(-6 + 6 + 18t). -32t + 2 Expand (15b*3 - 4 + 1 - 11b*3)(4 + 1 - 6 + (-4 + 3 + 0)(4 - 5 - 1) - 1 + 3 - 3 - 1 + 0 - 5). -24b*3 + 18 Expand (0 - 2l*3 + 0 + 0l*3 + 4l*3 - 3l*3 + (-2 - 1 + 1)(3 - 3 + 2l3) + 0l*3 + 3l3 + l3)(2l + l - 9l). 6l*4 Expand (14v + 3v - 2v)(2v - 4 + 2v - 3v). 15v2 - 60v Expand (0 + 1 + 2 + (2 - 2 - 1)(-2 - 1 + 1) + 0 + 5 - 4)(-5v3 + v3 + 5v*3)(4v2 + v2 - 3v*2). 12v5 Expand o4 - 4o2 + 4o*2 + (-5o + 4o + 3o)(2 - 2 - 2o*3) + (2o*2 + 3o*2 - 6o*2)(-o*2 + 2o*2 + 0o*2) - 28o*4 + 39o*4 + 81o*4. 88o*4 Expand (-7 + 2i + 7)(9i*3 + 5i*2 - 5i*2)(-3i + 2i - 3i). -72i*5 Expand (0s + 3s - s)((-2 + 1 + 2)(s - s - s) + 3s + 0s - 6s + 6s - 16s - 51s). -130s*2 Expand -39285p - 4 + 4p2 - 8p*2 + 39281p - 2p2 + 0p*2 + 3p*2 + (-3 + 0 + 1)(-2p2 + p2 + 0p2). -p2 - 4p - 4 Expand 3q*2 - 25q*2 - 4q*2 + (4 - 4 + 4q)((-4 + 2 + 1)(-q + 2q - 3q) + 3q + q - 2q - 2q + 0 + 0)(4 + 2 - 4). -10q2 Expand (-4 + 3 + 6p - 5p)(0 + 0 + p)(-25 + 3 + 145). 123p*2 - 123p Expand (-2u3 - 1 + 1)(3u - 5u + 4u) + 16u*4 - 15u*4 + 256u*4. 253u*4 Expand -125 + 256l*5 + 125 + (-3 + 2 - 1)(-3l5 - l5 + 2l5) - l5 - 5l + 5l. 259l5 Expand (-1 - 1 + 0)(42 - 87 - 2274n + 45). 4548n Expand (-2v + 83v*4 + 1862 + 2v*5 - 1862)(0 + 1 + 0). 2v5 + 83v*4 - 2v Expand (n2 + n2 + 0n2)(-n*3 + 5n*3 - 2n*3) + 4n*5 - 3n*5 + 0n*5 + 85n*2 - 85n*2 + 38n*5. 43n*5 Expand 2r2 - r + r + r2 - 2r2 - 2r*2 + (-2 + 2 + r)(4 + 2r - 4) + 0r*2 + 0r*2 - 3r*2 - 14r*2 - 3r*2 + 31r*2 + 38r*2. 50r*2 Expand ((-6m + 2m + m)(m + 4m - 3m) + 1 - 2m2 - 1)(16m + 15m - 8m). -184m*3 Expand (185h - 23h + 78h)(-3 + 4 + 3). 960h Expand (0s - 2s + 0s)(32s4 + 26s - 26s). -64s*5 Expand (195o + 2053 - 2053)(-2 - 4 + 4)(5 - 1 - 2). -780o Expand (2 - 2 - 2)(-73o - 91o + 309o + (4o - o + o)(5 - 3 - 1)). -298o Expand (-z + z - z*2)(-2z + 0z + 0z)(2z + 3z - 2z)(3503 + 5z - 3503). 30z*5 Expand (-2l*2 - 1 + 1)(-3 - l*2 + 3) + 18l*4 + 3l*3 + 16l*4 + 8l*4. 44l*4 + 3l*3 Expand -95f - f*2 - 4422 + 4422 + (-3 + 3 + 1)(2f2 + 0f*2 + 0f2). f2 - 95f Expand (-4 + 4 - 1)(-26 + 17 + 10)(3y + 2y - 2y). -3y Expand -2v2 + v2 + 3v2 + 4v*2 - 2v*2 + 0v*2 + (-16 + 16 + 3v)(-4v + 2v + 0v) + 0v2 - 2v*2 + 5v2. v2 Expand (-3 + 3 - 1)(-12f*4 - 6f*4 + 0f*4) + 4f*4 + 4f*4 - 4f*4. 22f*4 Expand (-s - 7s + 3s)(-1 + s + 1) + 4s2 - 3s*2 + 2s2 + s2 + s - 2s2 - s2. -4s*2 + s Expand (0h*4 - 2h4 - h4)(1 + 4 - 6)(0h + 2h + 2h). 12h*5 Expand -6t3 - t3 + t*3 + (-t + 2t + t)(-t2 - t2 + 4t*2) + (-1 - 2t*2 + 1)(-1 + 2t + 1) - 3t + 2t3 + 3t. -4t3 Expand (-4y*2 + 3y*2 + 2y*2)((-3y2 - 18 + 18)(-2y - 2y + 2y) + 2y - 2y - y3). 5y*5 Expand (40i + 4 - 4)(3i*2 - 4 - 2i*2 + 11). 40i*3 + 280i Expand (-2l2 + 0l*2 + 0l*2)(-4 + 4 - 1)(11 + 3 + 14). 56l*2 Expand (-1 - 1 + 3)(g*2 + 3g*2 - 2g*2) - 2g2 + g2 + 2g2 + 38g*2 - 32g*2 + 29g*2. 38g*2 Expand (4p*2 - 7p2 + p2)(-3p + 2p - 4p)(7 - 2 - 3). 20p3 Expand (-z4 - 2z4 + 0z*4)(z - 4z + z). 6z*5 Expand -7s*4 - 3s*4 - 20s*4 + (-6s + 4s - 6s)(1 - 1 - 2s*3). -14s*4 Expand -s + 0s + 0s + 5 + (0s + 0s + 2s)(15 + 2 + 3). 39s + 5 Expand -4r2 + 2r2 + r2 + (0r - r - r)(-1 + 2r + 1) + 140r*2 - 8439 + 8439. 135r*2 Expand (-2d*3 + 4d3 - d3)(1 - 162d - 3 + 56d). -106d*4 - 2d*3 Expand (-2 - 6y*2 + 3y*3 + 2 + 7y*2)(-476y2 - 157y*2 + 156y*2). -1431y*5 - 477y*4 Expand (-2s + 4s + 0s)(0 + 2 - 4) + 31s - 60s - 81s. -114s Expand 2 - 2 - 2y*2 + (-7 + y + 7)(-4y + 3y + 4y). y2 Expand (-249 - 473 + 462)(9i + 0i + 0i). -2340i Expand (-d*3 + 0d*3 + 2d*3)(2d + 0 + 0) + d3 + 80675d*2 - 80675d*2 - 504d*4. -502d4 + d3 Expand (2s2 - 2s2 - s3 + (-3s2 + 0s*2 - 5s*2)(1 - 1 - 2s))(0 + 1 + 1)(1 + 0 + 2). 90s*3 Expand (-80 + 15n + 80)(-1 - 5 + 5)(-3 - 10 - 14)(2 + 1 - 2). 405n Expand (-4 - 1 + 3)(-4i + 4i - 2i)(4i*2 + 2 - 2) - 3i + 4i + i3 - 2i. 17i3 - i Expand (b + 2b - b)(0 + 3b*2 + 0) - 533b + 3b3 + 533b. 9b3 Expand (5 - 4 + 0)(-2d - 2d + 5d + (2 + 14 - 3)(0d - d - d) - 2 + 2 + d). -24d Expand (0u2 + 2u*2 + 0u*2)(0u - 4u + 6u) - 2u - 41u3 + 2u + 31u3. -6u*3 Expand (3x - 3x - 2x)(16 + 1165x - 1167x + 16). 4x*2 - 64x Expand (14r + 12r + 20r)(-4r + 4r - 2r). -92r*2 Expand (2 - 3 + 3 - 4 + 5 - 2 + 0 + 1 + 1 + (4 + 0 - 2)(-2 - 2 + 6) + 2 - 1 + 0 - 43 - 13 - 30)(-b + 2b + b). -156b Expand (-4g2 - g2 + 4g2)(-7 + 17 + 3). -13g2 Expand (-a4 + 4a4 - a4)(2 + 1 + 0 + (-4 + 6 - 4)(-2 + 0 + 4))(4a - 2 + 2 + (0 + 3 - 1)(a + 0a + 7a)). -40a*5 Expand (-367m + 1018m - 14m)(3 + 2 - 3). 1274m Expand (z*2 - 6 + 6 - 9z*4)(2z + z - 6z)(1 - 3 - 1). -81z*5 + 9z*3 Expand (1 - 20 + 4)(12m + 10m - 19m). -45m Expand 5c - 2c - 4c + (3c + c - 2c)(4 - 4 - 2) - 2c + 1 - 1 + 6c - 5c + 9c. 3c Expand (-10d + 3d + d)(-d - 3d + 8d). -24d2 Expand (11 - 2 - 2)(d + d + 5d). 49d Expand 3c - c - 3c + 767 + 163c - 767 + (3c - 2c + 0c)(2 - 1 + 1). 164c Expand (-34x - 443 + 443)(3 + 2 - 3)(x2 + x2 + 9x*2). -748x*3 Expand (-9q + 8q - 18 - 16 - 2)(-16q2 - 5q2 - q2). 22q3 + 792q*2 Expand (-2t - 2t + 3t)(-6 + 3 - 2)(-3 + 5 + 3). 25t Expand (9m - 16m - 4m)(-2m + m - 2m) + (-2 + 2 - 2m + (-m + m + m)(3 - 1 - 4) - m + 2m - 2m)(2m - 5m + 4m). 28m*2 Expand 52w*5 + 24w*5 + 10w*5 + (-4w + 0 + 0)(-6w*4 + 3w*4 + 2w*4). 90w*5 Expand (4 + 22 + 35)(2p + 2p + 4p + 3p). 671p Expand (-4l*4 + 4l*4 - 5l*4)(49 - 10l - 49) + 2l*5 - 2l5 - l5. 49l5 Expand (144x - 229x + 219x)(-x3 + 0x*3 + 2x*3). 134x*4 Expand ((2 + 2u - 2)(2 + 0 + 2) + 8u - 10u - 7u)(2u - 2u + u3). -u4 Expand (11n - 28n + 16n)(-10 + 16 - 4 - n). n2 - 2n Expand (-2w + w + 3w)(w3 + w3 + 2w*3)(w - 2w - w). -16w*5 Expand (-3s + s + 3s)(4s3 - 5s*3 + 3s*3) + 4463s + 22s4 - 4463s. 24s4 Expand (-2 - 2 - 6)(-g*2 + 2g - g - g*2)(0 + 3 + 1). 80g2 - 40g Expand 3h - 3h - h*2 + (22h + 13h - 10h)(-2 + 0 + 1)(-3 + 2h + 3). -51h2 Expand m5 + 0 + 0 + (-2m - 2m - 6m)(94m4 + 5m - 112m4 - 7m). 181m5 + 20m*2 Expand (-125 + 139 + 570)(3f - f - 3f)(2 - 5 + 1). 1168f Expand -3b + b + 0b + (-4 - 1 + 6)(0b - 2b + 3b) + 18b + 95b - 295b. -183b Expand (9 - 9 + 2l)(-3 + 3 - 2l)(9 - 17 + 14)(1 + 4l - 1). -96l3 Expand (3h - 3h + h2)(h - 3h + 0h + (-1 - 2 - 2)(0h - 2h + 3h) + 3h - 4h + 7h). -h3 Expand (-3u*2 - 2u*2 + 7u*2)(4u + 8u*3 - 36u*3 + 3u*3). -50u*5 + 8u3 Expand (-g2 - 4g2 + 4g*2)(3 - 4 + 2) - 3 - g*2 + 3 - 3g2 + g2 + g*2 + 52g*2 + 36g*2 - 19g*2 + 17g*2. 83g*2 Expand 4s*2 - 4s*2 + 5s2 + (-s + s2 + s)(0 - 5 + 0 + (-1 - 1 + 0)(0 - 3 + 0)). 6s2 Expand 3 - 2i*3 - 3 + (4i + 13i - 23i)(-3 + 3i*2 + 3). -20i*3 Expand 0l - 3l + 2l - 34l - 70l + 152l + (-1 - 1 + 0)(-2l + 0l + 3l). 45l Expand (-3o + 6 + 5 - 1)(0 + 3 + 0 + (-6 + 2 + 1)(-2 + 1 - 1) - 3 - 1 + 6). -33o + 110 Expand (0t - 5t - 3t)(-3t2 + 4t*2 - 3t2) + (-t2 + 0t2 + 0t*2)(-275 + 275 - 48t). 64t*3 Expand (12b + 0b + 8b)(-5b*2 + 3b2 - b2) + (-2b + 3b + b)(b2 + 3b*2 - 2b*2). -56b3 Expand -q2 + q2 + q5 - q*5 + 9q*5 + 5q*5 + (-q + 4 - 4)(2q4 - 2q + 2q) - 4q5 - q5 + 2q5 - 3q*5 + 3q5 - q5. 8q5 Expand (1294z*3 + 1237z*3 - 2440z*3)(0z + 0z + z*2 + (-z + 4z - 5z)(5z - z - 2z)). -273z5 Expand 101 - u2 - 2u3 - 101 - u4 + (-5u3 + 4u3 - u3)(-2u -	{ "pile_set_name": "DM Mathematics" }
? s Let w = -0.1 + 0.1. Suppose -15g + 9g = 0. Which is the nearest to g? (a) w (b) 0.2 (c) 0.3 a Let k be -2 - -3 - 4/6. Let m(l) = l*2 - 7l + 3. Let f be m(5). Let q be (f/(-28))/((-14)/16). What is the nearest to q in 1/2, k, 0.1? 0.1 Suppose t - 15 = -0t - 4y, 3t + 4y = 21. What is the closest to 0 in t, 4, -2? -2 Let i = -1.4 + 1.4. What is the nearest to 2 in 2, 2/9, i? 2 Let q = 226/3 - 76. Which is the closest to -5/2? (a) 3/7 (b) q (c) 2/11 b Let h = 3 - 2.9. What is the nearest to h in -0.5, -5, -2? -0.5 Let q = 3.5 + -3.5. Which is the closest to -2? (a) q (b) 3/4 (c) 2/7 a Let y = -16 - -15. Suppose 2k - 132 = -4x, -3k + 2x + 198 = 5x. Let o = 329/5 - k. Which is the nearest to 0.1? (a) o (b) 5 (c) y a Let y be 10/(-10) + -11. Which is the nearest to 0? (a) -0.3 (b) y (c) 1/2 a Let m = 0.95 - 1. Let u = 0.05 + m. What is the closest to u in 2/7, 1/4, 0? 0 Let q = 0.1 - -0.1. Let y be -2114/(-72) - 6/2. Let l = -1 + 2. What is the closest to 0 in l, q, y? y Let m = -0.03 + 0.08. Let l = m - -0.05. Which is the closest to l? (a) 1 (b) 0.5 (c) -2/7 c Let o be (4 + (-110)/25)(-15)/6. What is the nearest to -3 in o, 0, -5? -5 Let g = 14.6 + -15. What is the nearest to -1/4 in -5, 0.4, g? g Let n = -0.09 + -3.91. Let m = -7 - n. Let i = 8 + m. What is the closest to -2/3 in i, 3/7, -1? -1 Let o = -36 - -39. Let j = -0.3 - 6.7. Which is the nearest to 0.1? (a) j (b) o (c) -0.3 c Let s be (-5)/(-6) - 2/4. Let t = -5 - -16. Let l = t - 10. Which is the nearest to -1? (a) 3 (b) l (c) s c Let l = -0.18 + 0.08. What is the nearest to 1 in 0.1, -0.2, l? 0.1 Suppose 0 = -7l - 14 + 28. Which is the nearest to -1? (a) l (b) -3/4 (c) -1 c Let r = -22 - -32. What is the closest to -1 in 0.2, 0.5, r? 0.2 Suppose j = 5l - 7 - 12, -3l + 21 = -3j. Which is the nearest to 0? (a) -5/4 (b) l (c) -2/3 c Let r = -1.4 - -0.4. Suppose -m - 4m = 5. Which is the nearest to m? (a) r (b) 0 (c) 1/5 a Let n(l) be the first derivative of -l2/2 - 4l + 1. Let r be n(-3). What is the closest to r in -0.3, 5, 1? -0.3 Let m = -4 - -3. Let q = -0.02 + 1.02. Let p = -2 + q. Which is the nearest to p? (a) m (b) -4 (c) 1/3 a Let c(q) be the first derivative of q*2/2 + 2q + 4. Let w be c(0). What is the closest to w in 4, 2/7, -2/5? 2/7 Let o be (2/(-3) - -1)(40 + -40). Let q = -2.04 - -0.04. Let w = 1.7 + q. Which is the nearest to o? (a) 1 (b) w (c) -4 b Let s = -1.4 - -0.4. Let y(q) = q. Let h be y(3). Let o = -86 - -603/7. Which is the closest to s? (a) 0.4 (b) h (c) o c Let a = -3.16 + 0.46. Let s = a - -2.7. What is the closest to s in -5, 0.4, 0.3? 0.3 Let z = -43.7 - -44. Which is the closest to 1? (a) 5 (b) z (c) 5/4 c Let w be (-8)/1212 - -4. What is the closest to 1 in 0.2, 0.1, w? 0.2 Let i = 8 + -10. Let p = -1 + 2. Which is the nearest to p? (a) -0.2 (b) 2 (c) i b Let g = -5.7 - -4.7. Which is the closest to -1? (a) -2/17 (b) 5/2 (c) g c Let x be (-2)/7 - 834/14. Let h = 60 + x. Let u = -1.7 - -1.9. What is the closest to 1 in u, 2, h? u Let k = 1 + 0. Let h = k - 1. Let r = 0.7 + 0.3. Which is the closest to r? (a) 1/7 (b) h (c) -2/7 a Let y be -2 + 166/34 + -3. Which is the closest to 0.2? (a) y (b) -0.1 (c) 1/3 c Let c = -3.06 - -0.06. Let i = 3.1 + c. What is the nearest to 0 in -3, i, 2/21? 2/21 Let z = 0.05 + -3.05. Let p = -83.5 - -83. Which is the closest to -3/5? (a) 0.2 (b) z (c) p c Let i = -1.6 - -3.5. Let b = i + -1.6. Let v be -10(2 + -1). What is the nearest to v in b, 3, -1/5? -1/5 Let s = -13 - -13.2. Let x = -0.22 + -0.08. Which is the nearest to -2? (a) 1 (b) s (c) x c Let v = -18 + 21. What is the nearest to -1 in v, 0.1, -0.2? -0.2 Let l = -2.1 + 0.1. Let t(m) = -m*2 - 5m - 3. Let n be t(-5). Let x be (-6)/((43 + -1)/n). What is the nearest to 1 in x, -1/5, l? x Let m(c) = c*2 + 2c + 3. Let y be m(-2). What is the closest to -0.2 in 5, y, -1? -1 Let a = 11 + -8. What is the closest to 1.4 in -4, a, -2? a Let o = -7 + 8. Let m = 0 + 0.2. What is the nearest to o in -1, -3, m? m Suppose 0 = -3n + 3r - 3, -4r = 4n - r + 25. Suppose 0 = 5g - g + 12. What is the closest to 0 in g, n, -2/5? -2/5 Let o = 1.9 + -5.9. What is the nearest to -0.1 in 0, o, -1? 0 Suppose 0 = -10n + 18n - 24. Which is the nearest to 0? (a) n (b) 5 (c) -10/3 a Let k = -17.8 - -18. Suppose -3j - j + 8 = 0. Let m be j - (2/(-7) - -2). Which is the closest to -5? (a) 3 (b) k (c) m b Let z = 0.3 - 0.1. Suppose 0 = 2r - 0r + 6. Let f = -8.1 + 8. Which is the closest to -2/7? (a) z (b) f (c) r b Let j(x) = -x - 1. Let l be j(-3). Suppose -8 - 2 = -lr. What is the closest to -0.2 in 0.5, 3, r? 0.5 Let h = 1240/9 + -138. What is the nearest to h in 0.3, -7, 2/7? 2/7 Let l be 141/(-6). Let i = 0 - 1. Let u = -0.04 - 0.16. Which is the closest to l? (a) i (b) -2/15 (c) u a Let d = -247/8 - -31. Let b = 0.2 - 0.3. What is the closest to b in 2/3, 2, d? d Let a(k) = k2 - 4k + 4. Let p be a(0). What is the closest to 1 in 3/5, -4/5, p? 3/5 Let t = 2/59 - 65/177. Let g = 7/8 + -3/8. What is the closest to t in g, -3/4, 2/11? -3/4 Let n be ((-24)/15)/(2/(-10)). Let k be (-20)/n(-4)/35. What is the nearest to -1 in k, 0.4, 1? k Suppose -n - 6 = 2n, 4 = -z + 2n. Let q = z + 22/3. What is the closest to 1 in 3/8, -1/6, q? 3/8 Let j = 8 - 5. Which is the nearest to -1? (a) 0.4 (b) 1 (c) j a Let a = 0.058 + -0.158. What is the closest to a in 0.5, 0.4, -4? 0.4 Let i = -20.2 - -20. Which is the nearest to i? (a) 4/3 (b) 4/7 (c) 3 b Suppose 0 = 17m - 33 + 16. What is the closest to m in -2/23, -2, -6/11? -2/23 Let x = 337/20 + -88/5. Let v = -0.1 + 0. What is the closest to v in x, 5, 2? x Suppose 0 = 5i - 2 + 17. Let k(l) be the first derivative of 2l*3 - l + 3. Let p be k(1). Which is the nearest to 0.1? (a) i (b) p (c) 1/2 c Let s = 10 + -4. Let g = 6.2 - s. What is the nearest to 0 in g, 5, -0.5? g Let u = -73/252 + -5/36. Let h = -3.2 - 0.8. What is the closest to -1 in 1, h, u? u Let s = 3739/2324 + -510/83. Let z = -30/7 - s. Which is the closest to 0? (a) z (b) 2 (c) 4 a Let a = -9 - -7.2. Let s = -1.7 - a. What is the nearest to s in 3/5, -2/11, 4? -2/11 Let k be (-24)/18 - (-2)/((-30)/(-23)). What is the closest to 0.1 in -0.5, 3, k? k Let k = 0.1 - -0.1. Let c = -8.3 - -8. Let u = 0.09 + 0.01. What is the nearest to u in c, k, 1? k Let n = 1.95 - -1.05. What is the closest to n in 1, 0.1, -4? 1 Suppose -i + 3i + 5t - 7 = 0, t = i - 21. Let h be i/3010/4. Which is the closest to 1/2? (a) h (b) -0.5 (c) -0.1 c Let c = 973/45 + -107/5. Let t = 2 - 5. What is the nearest to 1/3 in t, c, -5? c Let b = -29 - -89/3. Let x = -3 - -3.2. Suppose 0 = -4u + 12 - 0. What is the nearest to b in u, x, -0.2? x Let i = -4.2 - -0.2. Suppose -4f = -3f. Which is the closest to f? (a) i (b) 1 (c) -0.5 c Let s be (4/39)/((-12)/18). What is the closest to 0.1 in 1, -1/6, s? s Suppose 4f = 2 + 2. Let h(j) = -j3 - j2 - 2. Let x be h(-2). Let a = x - f. What is the nearest to 1 in a, -0.3, 3? a Let p = -0.25 - -0.38. Let g = -0.23 + p. What is the closest to -1/3 in -0.4, 4, g? -0.4 Let w = -17 + 15.8. Let r = w - -1.7. What is the closest to 1 in r, -5, -4? r Let n be (-4)/(-8)(1 - 2). Let w = 10 - 9.86. Let s = 0.04 - w. Which is the nearest to s? (a) -2 (b) n (c) 2 b Let h be -4(1 + (-3)/2). Let z be (h/(-5))/((-14)/10). Let d be 125/(-30)3/10. Which is the nearest to z? (a) -0.1 (b) d (c) -4 a Let j = 349/565 - 2/113. Let y = 0.012 + 0.088. Which is the closest to y? (a) 0.4 (b) -3/7 (c) j a Let g = -0.03 - 0.77. Let z = g - -3.77. Let k = z + 0.03. Which is the closest to 0? (a) 4 (b) k (c) 0.2 c Let d = -8 + 8. Let h be d + 1/(-4)3. Let k = -4.3 - -4. Which is the nearest to -1? (a) -2 (b) k (c) h c Let w = 49 + -242/5. Which is the nearest to 0? (a) w (b) -0.3 (c) -5 b Let t be 0 - ((-20)/(-12) + 1 + -3). Which is the closest to 1? (a) t (b) 5 (c) 2 a Let n = -9.4 - -0.4. Let d = 8.7 + n. Let m = 1.7 - -0.3. What is the closest to m in -1, d, -0.5? d Let z = 35 - 38. Let i = -0.3 - -0.4. Which is the nearest to i? (a) 3 (b) 2/3 (c) z b Let l = -0.33 + -3.67. Let f be (-3)/2*2 + 1. Let j be f - (-1 - (-9)/(-7)).	{ "pile_set_name": "DM Mathematics" }
275))1) + 1 + 3 + sqrt(275)))2-3. -7500 + 450sqrt(11) Simplify 4(2(0 + (sqrt(396) + sqrt(396) + -2)-6) + ((sqrt(396) + 2(-2 + sqrt(396)) - sqrt(396)) + sqrt(396) - (sqrt(396) + 2)2)*2). -960sqrt(11) + 1936 Simplify (-6sqrt(126)/sqrt(324)5)/(5-2sqrt(12)/(2sqrt(24))). 2sqrt(7) Simplify -2 + (sqrt(13) + 1 + sqrt(13) + sqrt(13) + -5 - sqrt(156)/(sqrt(96)/sqrt(8)))*2 + 4 + sqrt(1053) + -1 + 0. -7sqrt(13) + 69 Simplify (-3 + (6(sqrt(200) + -3-1sqrt(200) + sqrt(200)))/(sqrt(90)/(sqrt(9) - (sqrt(54)/sqrt(3))/sqrt(2) - sqrt(9))))2-5. -90045 - 1800sqrt(5) Simplify (sqrt(200) - ((sqrt(200) - (-4(0 + sqrt(200)) - sqrt(200)))*2 - sqrt(200))) + 2 + (sqrt(18) - 6(sqrt(18) - (sqrt(72) - sqrt(18))))/sqrt(9)-2. -7198 + 18sqrt(2) Simplify (-6sqrt(195)/(sqrt(60)/(1sqrt(12))))/(5(sqrt(75) - ((-5(sqrt(75) - 1sqrt(75) - sqrt(75)) - sqrt(75)) + sqrt(75) - sqrt(75)))). 2sqrt(13)/25 Simplify (2-4(-1sqrt(288) + sqrt(288)))/(2(2sqrt(9)-2 + sqrt(9)))4. 0 Simplify (((sqrt(168) - -2sqrt(168))/sqrt(7))/sqrt(12) - ((sqrt(2) - (-3 + sqrt(2)-2 + sqrt(2))) + sqrt(4)/(sqrt(8)/sqrt(4)))2)-3 + 4. 45sqrt(2) + 85 Simplify (2(1 + (4 + (sqrt(605) + 1 + sqrt(605))6 - (5 + -2(sqrt(605) + 3)))))*2. 14784sqrt(5) + 474896 Simplify (-4(sqrt(77)/sqrt(7)1 + sqrt(33)/(sqrt(12)/sqrt(4)) + (-2 + sqrt(1584) - sqrt(11) - (-4sqrt(77))/sqrt(7))))2. -1088sqrt(11) + 50928 Simplify (2 + 3(-4 + (sqrt(468) - (sqrt(468) + -1 - sqrt(468))))-2 + -2)*2 + 1. -1296sqrt(13) + 17173 Simplify ((6(sqrt(12) + sqrt(3) + 5) + 5sqrt(21)/(sqrt(28)/sqrt(4)) + 0)34)*2. 198720sqrt(3) + 358128 Simplify ((sqrt(475) - sqrt(475)2)21 + 2)2 + ((3(sqrt(475) + 2 + sqrt(475)))2 - (-2 + sqrt(475) + 3 + sqrt(475))2). 300sqrt(19) + 17139 Simplify (((sqrt(117) + -1 + sqrt(117))-4 + sqrt(117) - (4 + (sqrt(117) - sqrt(117)-1))) + -3(sqrt(39)/sqrt(3) + -4 - sqrt(1300)1))2. 144 Simplify -1 + ((-5 + (sqrt(176) - -3sqrt(176))*2)5 - (4 + 2 + ((sqrt(176) - sqrt(176)-3)2 - sqrt(176)))) + 1. 4sqrt(11) + 11233 Simplify ((1sqrt(180)/sqrt(10) - sqrt(18)) + (6sqrt(648) + sqrt(18) - sqrt(18)))/(-1sqrt(54)/(sqrt(9)2)-4). 18sqrt(3) Simplify ((5 + 4 + -1sqrt(539))1-6)2 + 2. -4536sqrt(11) + 22322 Simplify 2 + sqrt(243) + sqrt(288)/sqrt(6) + (-53sqrt(192)1)2. 13sqrt(3) + 43202 Simplify (sqrt(78)22 - 6(sqrt(78) - sqrt(78)4))/((sqrt(378)-1)/(sqrt(448)1)). -176sqrt(13)/3 Simplify (sqrt(3168)-1)/(2sqrt(162)) - -6((sqrt(1584) - (sqrt(1584) + -1 + 1))2 - (0 + (sqrt(1584) + 1)2)). -9510 - 434sqrt(11)/3 Simplify 2 + 5(sqrt(63)/sqrt(225))*2 + (sqrt(42)/sqrt(3)-4)/(sqrt(20)/(-2sqrt(10))). 17/5 + 8sqrt(7) Simplify (4 + 2sqrt(539)-3 + -2sqrt(539) + -5 + (0 + sqrt(11) + 1 - (-2 + sqrt(11) + -5)))2. -784sqrt(11) + 34545 Simplify ((2(sqrt(156)-1 + sqrt(156)) + sqrt(156))/(sqrt(9)/(sqrt(3)-2 + sqrt(3))) - (-1 + sqrt(325) + 2 - 5(1 + sqrt(637) + sqrt(637))))*2. 504sqrt(13) + 51613 Simplify (-4(sqrt(36) - (sqrt(36) - 1(sqrt(36) - sqrt(144)))))/(-2sqrt(192)2-3). sqrt(3)/12 Simplify (-3 + (0 + -1sqrt(847) + -43sqrt(847))3)2. 2574sqrt(7) + 1288296 Simplify -1((sqrt(700) - sqrt(700)1)-4 + 4 + sqrt(700) + 1 + 2 + -6(sqrt(700) + 1) + sqrt(700) + 1(sqrt(700) - (sqrt(700)3)*2)). 30sqrt(7) + 6299 Simplify -3(4 + (sqrt(2) - sqrt(10)/(sqrt(5) - sqrt(80))) + 0 - ((-2sqrt(200) + 2 - sqrt(200))-5)2). -9004sqrt(2) + 135288 Simplify (-5(sqrt(4212)2 + -6sqrt(52)2))/((sqrt(288) + (-2sqrt(288) - sqrt(288)))/(-2sqrt(128))). -40sqrt(13) Simplify -4 + 1(-2 + 0 + sqrt(208) + sqrt(208) + sqrt(208) + 4 + (sqrt(208) + 2(sqrt(208) - sqrt(208)-2) - (-2 + sqrt(208) + 1)))*2. 216sqrt(13) + 16853 Simplify (-1(-4sqrt(190) - sqrt(190) - sqrt(190))-3-2)/(-1sqrt(80)/sqrt(512)3). -96sqrt(19) Simplify ((sqrt(180) + -2sqrt(180)2 - (4 + -1sqrt(180) + sqrt(180))) + 3 + -3sqrt(180) + -4(-3 + sqrt(180)))*2. -1320sqrt(5) + 18121 Simplify (sqrt(5) + 2 + sqrt(5) + 2 - (sqrt(360)/sqrt(8) + sqrt(45))/sqrt(9))*2 - -5(3 + sqrt(320)1)2. 240sqrt(5) + 1661 Simplify -5(((-1 + sqrt(192))53 + 5)2 + 2(sqrt(192) + -1 + sqrt(192)-1 + sqrt(192))-4). -216540 + 12320sqrt(3) Simplify 2(-4 + (4((sqrt(539) - (sqrt(539) + 1 + sqrt(539))) + -1)3-3)2). 72576sqrt(11) + 1407448 Simplify ((6(-3 + -1 + sqrt(13))5)*2 - (-5 + 3(sqrt(208))*2 + 0)) + 5. -7200sqrt(13) + 25486 Simplify (((sqrt(63)1)/sqrt(7) + (sqrt(72) + sqrt(72)1)/sqrt(8))-3)/(3((sqrt(21) + sqrt(21) + sqrt(189))/sqrt(7) - -5((sqrt(12) - sqrt(3)) + sqrt(3)))). -sqrt(3)/5 Simplify (4(sqrt(49) - (sqrt(49) + sqrt(98)/sqrt(2) + sqrt(49)) - sqrt(49))53)/(2sqrt(700)-2-5). -9sqrt(7)/10 Simplify ((sqrt(216)-2)/sqrt(8) + (sqrt(27) + sqrt(243))4)/((-5sqrt(729) - sqrt(729))-2). 7sqrt(3)/54 Simplify (3((sqrt(342)/(sqrt(18)/sqrt(3)))/(2sqrt(147)) - (((sqrt(171) - 2sqrt(171)) + sqrt(171))/sqrt(9) + sqrt(76) + (sqrt(76)-4 - sqrt(76)))))2. 2183499/196 Simplify (23sqrt(6171)5)/(-1(sqrt(147) + sqrt(147) + (2sqrt(147) - sqrt(147))5 + sqrt(147))). -165sqrt(17)/28 Simplify ((-5 + sqrt(5) + (sqrt(60)/sqrt(3))/sqrt(4) + (sqrt(5) + 0 - sqrt(5)) + -1 + 0)*2 + 5)-3. -183 + 72sqrt(5) Simplify (-3(sqrt(3630)1 + sqrt(3630) + ((sqrt(360)1)/sqrt(12) - sqrt(30))))/((sqrt(108)-1)/(sqrt(24)/sqrt(3))). 44sqrt(5) Simplify (2(-2(-3(2 + sqrt(1053)) + 5) + 3)2)*2. 8640sqrt(13) + 606928 Simplify 5 + -4(0 + 1 + sqrt(13) - sqrt(13))-4 + (sqrt(65) - -6(sqrt(65) + -2sqrt(65) + sqrt(65)))/(2sqrt(605) + sqrt(605) + sqrt(605) + sqrt(605)) + 3. sqrt(13)/55 + 24 Simplify ((sqrt(36)/sqrt(2))/sqrt(9) - (sqrt(128) + -1))-6 + 0 + 2 + (1 + sqrt(288)2)2-4. -4616 - 150sqrt(2) Simplify 5((((sqrt(272) - -2sqrt(272)-3)*2 - sqrt(272)) + -3)6 - (4 + (-42sqrt(34))/(sqrt(24)/(-2sqrt(12))))). -200sqrt(17) + 203890 Simplify ((-1 + (sqrt(72) + 4sqrt(72)2 - (sqrt(72) + -2sqrt(72) + -1)) + -5 + sqrt(72) + sqrt(72) + -4 + -3)-1)*2. -1728sqrt(2) + 10512 Simplify (sqrt(102)13 + -2sqrt(102)3)/(-23(sqrt(600) - (sqrt(600)2 + sqrt(600))))-3. 3sqrt(17)/40 Simplify ((-2sqrt(152)-6 + sqrt(152) + 42sqrt(152) + sqrt(152))1)/(-6sqrt(648)1 - 1sqrt(648)-1). -22sqrt(19)/45 Simplify ((-2sqrt(68) - sqrt(68) - sqrt(17))-4)2 + -1 + ((sqrt(153)-2 + sqrt(153))*2 - ((sqrt(17)4)*2-5 + sqrt(17))). -sqrt(17) + 14840 Simplify ((sqrt(68) + sqrt(68)2)1 - (sqrt(68) + sqrt(68) + -54sqrt(68)))/(5(sqrt(196) + sqrt(196)2-5 + sqrt(196))). -3sqrt(17)/40 Simplify (2(sqrt(684) + 1) + 6(sqrt(684) + sqrt(684) + 0 + sqrt(684)) - 1(5 + -3sqrt(684) + 4))*2. -1932sqrt(19) + 361885 Simplify 1(-2sqrt(38)/sqrt(2) + (2sqrt(38))/sqrt(2)) + 6(sqrt(475) - (((3sqrt(475) - sqrt(475))2 - sqrt(475)) + sqrt(475)))*2. 25650 Simplify -1 + (6(-5(sqrt(48) - sqrt(3)) - (4 + sqrt(6)/sqrt(2))) + sqrt(27)-2-4 + 2)2 + -4. 3168sqrt(3) + 16031 Simplify (1(sqrt(208) - (sqrt(208) + 1sqrt(208) + sqrt(208)))4)/(((2sqrt(96))/sqrt(4))/(sqrt(24)/sqrt(4)1)). -8sqrt(13) Simplify (2(-1(sqrt(170)2 + sqrt(170)) - sqrt(170)-1-5))/(((sqrt(300) + 1sqrt(300) - sqrt(300))/sqrt(5))/(sqrt(864)-2)). 384sqrt(17) Simplify 3 + ((sqrt(27)1 + 4)1)2 + ((1 + sqrt(6)/sqrt(2) - sqrt(3))2 + 0)-1. 24sqrt(3) + 45 Simplify -5((((sqrt(1539) + 1 + -5 - sqrt(1539)) + sqrt(1539) + sqrt(1539) - sqrt(1539))41)2 + (-3(1 + sqrt(1539) - sqrt(1539))5-4)*2). -142400 + 5760sqrt(19) Simplify (-1(sqrt(128) + -1) + sqrt(128) + sqrt(6)/sqrt(3)-5 + (-4sqrt(392))/(sqrt(400)3))*2. -178sqrt(2)/15 + 16067/225 Simplify (sqrt(39)/sqrt(3) + -4 + (sqrt(117) + 0 - sqrt(117) - sqrt(117))*2 + (2(-1 + sqrt(13)) - (1 + sqrt(13) + 4)))-4. -424 - 8sqrt(13) Simplify (sqrt(42)/(sqrt(7) - (sqrt(7) + (sqrt(7) - sqrt(112)))) + sqrt(6) + (-2sqrt(12))/sqrt(2))/(sqrt(3200) + 3(-1sqrt(3200) - sqrt(3200))). sqrt(3)/300 Simplify -5((-3 + sqrt(60)/(sqrt(25)/sqrt(5)) - (sqrt(81)/sqrt(3)-2)/(sqrt(27)/sqrt(3)-1)) + 3). 0 Simplify (sqrt(245) + -3 + sqrt(245) + 0 + 5)*2 + ((-1sqrt(40)2)/(-1sqrt(8)-1))2. 56sqrt(5) + 1004 Simplify ((-6(sqrt(84)/sqrt(4) + sqrt(21)) + sqrt(21) - -5(-2sqrt(21) + sqrt(21)))5)/((sqrt(252)-3 - sqrt(252))-1-3). 10sqrt(3)/9 Simplify -5(4(sqrt(1584) - -1*sq	{ "pile_set_name": "DM Mathematics" }
qrt(396))*2 + 1) - sqrt(396))). -39685 + 1020sqrt(11) Simplify sqrt(150)/(sqrt(6)/(sqrt(6)/sqrt(3))) + ((sqrt(100)2)/sqrt(2) + (sqrt(450) + (sqrt(450)2 + sqrt(450) - sqrt(450)) + sqrt(450))/sqrt(9))*2. 5sqrt(2) + 1800 Simplify (6sqrt(13)-2 + 5 + sqrt(104)/(sqrt(200)1))2. -118sqrt(13) + 45878/25 Simplify 36(sqrt(832) + 1 + sqrt(832) + 2 + sqrt(832)) + -2. 52 + 432sqrt(13) Simplify ((sqrt(13) - 21sqrt(13))3 - (sqrt(1872)1 + sqrt(13) + 0 + 4))2. 128sqrt(13) + 3344 Simplify sqrt(162) - ((sqrt(162)1 - sqrt(162))2 + -3) - (sqrt(20)/sqrt(490) + sqrt(2) + sqrt(2) + 5). -2 + 48sqrt(2)/7 Simplify ((sqrt(110)/(-5sqrt(35)/sqrt(7)))/(3(sqrt(275) - sqrt(11))-2))2. 1/7200 Simplify ((sqrt(567)3 + sqrt(7))-3 + -3 + (-1 + sqrt(7))2 + sqrt(7) + 3)-1. -8 + 85sqrt(7) Simplify (4 + 1sqrt(171) + -4 + -2)*2 + -5 + -4. -12sqrt(19) + 166 Simplify 2(-4(sqrt(1377) - sqrt(1377)1)2 + sqrt(1377) + (1 + sqrt(1377))4). 8 + 90sqrt(17) Simplify 15(sqrt(88)4)/(sqrt(11) - 4sqrt(44)) + -1. -40sqrt(2)/7 - 1 Simplify ((-1sqrt(112))2 + (sqrt(700)2 - sqrt(700)) + -5)1. 10sqrt(7) + 107 Simplify (sqrt(1216) + 0)*2-5 + 0 + 5. -6075 Simplify (-6sqrt(252) - sqrt(504)/sqrt(2))/(3(2sqrt(4) + sqrt(4))2). -7sqrt(7)/6 Simplify -2((sqrt(475) - (sqrt(475) + -2)1)2 + sqrt(475)) + 4. -10sqrt(19) - 4 Simplify 3 + (-1sqrt(44)/sqrt(2))/(sqrt(275)1). -sqrt(2)/5 + 3 Simplify 0 + ((sqrt(7) - (-3 + sqrt(63)))-3 + -5)-4. -24sqrt(7) + 56 Simplify sqrt(7) + -5 + sqrt(7) + -1 + (sqrt(847) + 0)2 - ((sqrt(140)/(sqrt(20)/sqrt(2)))/(sqrt(16)/sqrt(2)))2. 2sqrt(7) + 3357/4 Simplify sqrt(104)/(sqrt(24)/sqrt(3)) + sqrt(325) + -2 + ((sqrt(208)-1)/sqrt(4) + -6sqrt(208))*2. 6sqrt(13) + 8786 Simplify 5 + -1 + (0 + sqrt(80) + -6-3sqrt(80))*2 + -3. 28881 Simplify 5 + (sqrt(70) - (sqrt(70) + -1sqrt(70)1))/(sqrt(20)/sqrt(2)6 + sqrt(10)). sqrt(7)/7 + 5 Simplify ((sqrt(3) + -1 - sqrt(3))4 + sqrt(3) - (sqrt(432) + -1))2 - (-5 + -1 + sqrt(363) - sqrt(363))2-5. 66sqrt(3) + 552 Simplify (sqrt(49) + sqrt(98)/sqrt(2))/sqrt(7)-5 + 2(sqrt(28) + -1 + sqrt(28) - sqrt(28) - sqrt(28) - sqrt(28))2. -2sqrt(7) + 58 Simplify 4 + -3sqrt(76)-2 + 1sqrt(76) + (1(-1 + sqrt(19)))*2 + 2. 26 + 12sqrt(19) Simplify (0 + 2sqrt(80) + -3)2 + -122sqrt(80). -64sqrt(5) + 329 Simplify -4(sqrt(68)2-3 - (-1 + sqrt(68) + 2))*2 + -2. -13334 - 112sqrt(17) Simplify (4 + (-3(-2 + sqrt(176) - sqrt(176)) - sqrt(176)) + 5)2. -120sqrt(11) + 401 Simplify (-6(sqrt(112) - (sqrt(112) - (sqrt(112) + sqrt(112)2 + sqrt(112))-2)) + 4 + sqrt(7)-1 + -1 + sqrt(28))*2. 1158sqrt(7) + 260752 Simplify -1(-3 + (-3(-3 + sqrt(1900) - sqrt(1900)) - sqrt(1900) - sqrt(1900))*2) + 1. -7677 + 360sqrt(19) Simplify (-4(sqrt(132) + (sqrt(132) - (-2sqrt(132) + sqrt(132))))-2)/(((-2sqrt(84) - sqrt(84) - sqrt(84))-6)/sqrt(7)) + 2. 2 + sqrt(11) Simplify -5(((sqrt(55)/(sqrt(5) - -1sqrt(5)) + sqrt(1100)1)-4)2 + -5). -96995 Simplify -4(sqrt(378)/sqrt(6) + sqrt(315)/sqrt(5) + sqrt(63)/((sqrt(108) + (sqrt(108)2 - sqrt(108)) + sqrt(108))/sqrt(12)) + 4). -76sqrt(7)/3 - 16 Simplify -4 + -4 + (sqrt(1053) - -2(sqrt(1053) + -1 - sqrt(1053))2) + -3 + -4. -13 + 9sqrt(13) Simplify (-1(sqrt(176)33 + (sqrt(176) - (sqrt(176) - (sqrt(176) + sqrt(176)-3 + 0))))5)2. 215600 Simplify -2 + -4sqrt(26)/sqrt(2)13 + 4. -12sqrt(13) + 2 Simplify (((-2 + sqrt(243))2)*2 - sqrt(243)) + (sqrt(243)2 + 5)*2. 27sqrt(3) + 1985 Simplify (1(-2 + sqrt(300) + -3)53)2. -22500sqrt(3) + 73125 Simplify (sqrt(343) - 6(sqrt(343) + 1)2)-6 + ((sqrt(70)-1-4 - sqrt(70)) + sqrt(70))/(sqrt(160)2). 925sqrt(7)/2 + 12384 Simplify -1 + (3(sqrt(143) - (sqrt(143)3 + sqrt(143))))/(sqrt(99)/(sqrt(36)/sqrt(4))). -9sqrt(13) - 1 Simplify -3((((sqrt(147) + sqrt(147) + -1(-1 + sqrt(147)) + sqrt(147) - sqrt(147) - sqrt(147)) + -2 + sqrt(147) + 1sqrt(147))-6)2 + 0). -63612 + 3024sqrt(3) Simplify 1 + (-5 + sqrt(1100) + 2)*2 + -5 + -3 + sqrt(1100) + sqrt(1100). -40sqrt(11) + 1102 Simplify -1(1sqrt(3993)1)/(sqrt(99)/(sqrt(9) - sqrt(81)) - (sqrt(11) - (sqrt(11) - 1sqrt(33)/sqrt(3)))). 22sqrt(3)/3 Simplify (sqrt(1944) - (sqrt(1944) - (-5(sqrt(1944)1 - sqrt(1944)) + sqrt(1944))))/(31sqrt(1728)). sqrt(2)/4 Simplify ((sqrt(104)/(sqrt(8) + (sqrt(216) + sqrt(24) + sqrt(24))/sqrt(3)) + 4)6)*2. 48sqrt(13) + 589 Simplify -4 + 6((sqrt(68) + -1)2 - (-1 + sqrt(85)/sqrt(5))). -30sqrt(17) + 416 Simplify (-33(sqrt(171) + -4(0 + sqrt(171) + sqrt(171)) - (2 + (sqrt(171)-1 - sqrt(171)))) + 2)*2. 5400sqrt(19) + 346675 Simplify (1sqrt(84)-5)/((sqrt(96)/sqrt(2))/sqrt(4))-6. 30sqrt(7) Simplify ((2 + sqrt(300) + 2 - sqrt(300)) + sqrt(300) + sqrt(300)-65)*22. -4640sqrt(3) + 504632 Simplify 1sqrt(847)-1-5 - (4sqrt(847)-2-1)2. -54208 + 55sqrt(7) Simplify (-2 + 3(sqrt(7) + -1 + sqrt(7)))2 - -3(1sqrt(7) + 2). -57sqrt(7) + 283 Simplify (-4(3 + (3(sqrt(304) - (sqrt(304) + -1)) - sqrt(304))) + -3)*2. -864sqrt(19) + 5593 Simplify -3 + (sqrt(228)/(sqrt(84)/(-1sqrt(7))) - (sqrt(931) + (1 + sqrt(931) - sqrt(931))-3 + sqrt(931)))*2. -90sqrt(19) + 4281 Simplify 1(1(-3(sqrt(68) - sqrt(17)))2 + ((-1sqrt(2448))*2 - (sqrt(17) - (4 + (sqrt(17) + (-1sqrt(17))*2 + sqrt(17) - sqrt(17)))))). 2622 Simplify 2 + (sqrt(152) + -5(sqrt(152) - sqrt(152)1) + sqrt(152))/(sqrt(8) + sqrt(40)/sqrt(180)). 2 + 12sqrt(19)/7 Simplify ((sqrt(44)/sqrt(2))/sqrt(2)-1 + sqrt(99)/(sqrt(9) - (1sqrt(1089) + sqrt(1089))))*2. 5324/441 Simplify -5-4(2sqrt(1900) + 5)*2-5-5. 100000sqrt(19) + 3812500 Simplify 3(-4 + sqrt(243) + 3 + -1)2. -108sqrt(3) + 741 Simplify (-5 + sqrt(605) + -2 + sqrt(605) + sqrt(605) + sqrt(605) + -1(sqrt(605) + sqrt(605) + (sqrt(605) - sqrt(605)-1)))2 + 2. 51 Simplify ((sqrt(500)/sqrt(10))2 - 3sqrt(162)) + 5. -27sqrt(2) + 55 Simplify -4((-1 + sqrt(833))2 + -2 - (sqrt(1700) + 1 + -3)). -3336 + 96sqrt(17) Simplify ((sqrt(330)1)/sqrt(6))/sqrt(5)-2 - (sqrt(88)/(sqrt(8)-2) - (sqrt(11) - (sqrt(396) + -1))2). -23sqrt(11)/2 + 276 Simplify (-4(2sqrt(24) + sqrt(24)) + sqrt(24))/(1sqrt(2)36). -11sqrt(3)/9 Simplify (-3 + 2 + 1 + -2 + sqrt(153))*2-3. -471 + 36sqrt(17) Simplify 2(63sqrt(242)3)2-5. -7056720 Simplify -6(sqrt(17) - sqrt(68)/((sqrt(64) - sqrt(4)) + sqrt(4))) - sqrt(119)/(1sqrt(7)1). -11sqrt(17)/2 Simplify 4((sqrt(7) - sqrt(252)4) + -1sqrt(343) + sqrt(7)). -116sqrt(7) Simplify ((1sqrt(637))25 + -31sqrt(637))6. -126sqrt(13) + 19110 Simplify ((sqrt(891) - (sqrt(891) - (sqrt(891) + 0)))2 - sqrt(891))2-3 - (sqrt(891) + 0 + sqrt(891) + 4 + (5(0 + sqrt(891)))2). -24952 - 18sqrt(11) Simplify 2 + (sqrt(425) + sqrt(17) + 4 + ((sqrt(17) + sqrt(17) + sqrt(51)/sqrt(3))-2)2 + sqrt(17))6. 42sqrt(17) + 3698 Simplify ((sqrt(35) + sqrt(35)1-3 - sqrt(35))/(sqrt(180)-1)-2-2)*2. 28 Simplify -1sqrt(38)/sqrt(2)-52 - (-5(sqrt(19) - -3sqrt(19))*2 - (sqrt(19) + ((sqrt(209) - (sqrt(209) - -3sqrt(209)))/sqrt(11))*2)). 11sqrt(19) + 1691 Simplify -51sqrt(891) + 1 - 4(-2sqrt(891)2 + sqrt(891)). 1 + 63sqrt(11) Simplify (sqrt(171) - (sqrt(171) - (sqrt(171) - (sqrt(171) - (sqrt(171)2 - sqrt(171)))5) - sqrt(171)) - 1sqrt(171)-3)/((sqrt(90) + 2sqrt(90)-1)/sqrt(10)). -5sqrt(19) Simplify (sqrt(110)/sqrt(2)2)/(sqrt(55)/sqrt(80))2. 16sqrt(5) Simplify sqrt(500) - (sqrt(500) + 1) - (5sqrt(45))2 - sqrt(35)/(sqrt(35)/sqrt(5))-6. -1126 + 6sqrt(5) Simplify ((sqrt(91) + ((sqrt(91)15 - sqrt(91)) + sqrt(91) - sqrt(91) - sqrt(91)))-3)/(2(sqrt(140)/sqrt(4))/sqrt(5)). -6sqrt(13) Simplify (-1sqrt(117) - (sqrt(65)/sqrt(5) + -3)) + 0. -4sqrt(13) + 3 Simplify (sqrt(125) + (sqrt(125) - (sqrt(125) + 2sqrt(125))) + 1 + 4 + (sqrt(125)-2 + sqrt(125) - sqrt(125)) + 3)*2. -240sqrt(5) + 1189 Simplify -5-2(3(sqrt(13) + 0 + sqrt(13)) + (-1sqrt(1872) - sqrt(1872) - sqrt(13)) + (-5(sqrt(104) + -1sqrt(104) + sqrt(104)))/sqrt(8))*2. 74880 Simplify ((sqrt(54)/(1sqrt(9)))/(sqrt(20)/(sqrt(160) + sqrt(10))))*26. 450 Simplify (6(sqrt(156) + 3sqrt(156)-2 + sqrt(156) + sqrt(156) - sqrt(156)))/(sqrt(48)/(sqrt(16)/sqrt(4)-2)). 48sqrt(13) Simplify (-1 + (5sqrt(832)-1 + -3 + sqrt(832) + 1)-5)**2. 288	{ "pile_set_name": "DM Mathematics" }
(l) = 108l2 - 72l + 12. Let h(w) = -27w2 + 18w - 3. Let f(u) = 4a(u) + 15h(u). Factor f(g). 3(3g - 1)*2 Let z be (-5)/(-10)-3 - 14/(-4). Solve 2/5tz + 0 - 4/5t = 0 for t. 0, 2 Suppose 4 = 4h - 12. Let g = 6 - h. Find o, given that -4o*2 - 2o*g - 2o3 + o - o + 8 = 0. -2, 1 Let z(a) be the second derivative of a8/1680 - a7/280 + a6/120 - a5/120 + a3/3 + 2a. Let i(r) be the second derivative of z(r). Factor i(n). n(n - 1)*3 Factor 10/9t*2 + 0 + 2/9t*3 + 8/9t. 2t(t + 1)(t + 4)/9 Find l such that -2l - 3l + l + 10l*2 + 0l = 0. 0, 2/5 Let s(m) be the first derivative of 3m7/2 - 2m*6 - 9m5/20 + m4/2 - 3m - 2. Let z(d) be the first derivative of s(d). What is y in z(y) = 0? -1/3, 0, 2/7, 1 Find c, given that -7/4c + 3/4 + 5/4c2 - 1/4c*3 = 0. 1, 3 Suppose -5c = 1 - 11, v = c. Factor 6g2 - 2g*2 - 2g*2 - vg. 2g(g - 1) Let z be ((-4)/(-30))/(-4 - (-216)/45). Factor -2/3w2 - 1/6w - 2/3w4 - zw5 - w3 + 0. -w(w + 1)4/6 Let r = 978 + -976. Factor 0 - rc - 4/3c2 - 2/9c*3. -2c(c + 3)2/9 Let y(o) be the first derivative of o8/420 + o7/840 - o6/90 - o5/120 + o3 + 9. Let g(m) be the third derivative of y(m). Factor g(n). n(n - 1)(n + 1)(4n + 1) Let r(a) be the third derivative of a5/60 - 5a*4/6 + 50a*3/3 - 55a2. Factor r(o). (o - 10)2 Suppose -2v - 7 = -11. Factor -vk*3 - 5k4 - 18 + 18. -k3(5k + 2) Let j(a) = a*3 + 4a*2 + 4a + 4. Let f be j(-3). Let p = 1 + f. Factor -o*3 - 2o - o*3 + 2o*p + 2o*2. -2o(o - 1)2 Let d be (2/8)/(51/24 - 2). Let v(x) be the second derivative of x + 0 - 1/12x*4 - 1/2x*d - 1/3x*3. Let v(t) = 0. Calculate t. -1 Let f(m) be the third derivative of -7m*2 + 0m - 2/3m3 - 1/30m*5 + 0 + 1/4m*4. What is s in f(s) = 0? 1, 2 Factor 16p + 44p2 + 36p*2 + 579p*3 - 487p*3 + 28p*4. 4p(p + 1)(p + 2)(7p + 2) Suppose 0 = s + 4b + 239, -4s - 876 = b - 5b. Let m = 2011/9 + s. Factor 2/3j*2 - 4/9 - mj*3 + 2/3j. -2(j - 2)(j + 1)(2j - 1)/9 Let o = 3 + 0. What is y in y*o + 2 - 3y*2 + 3y - 7 + 4 = 0? 1 Factor 64/9 + 32/9h + 4/9h*2. 4(h + 4)*2/9 Let t be 4/(-5) - (-90)/108. Let y(r) be the second derivative of 2/15r*3 - 4r - 1/10r2 + 0 - tr*4 + 1/50r*6 - 1/25r5. Factor y(c). (c - 1)2(c + 1)(3c - 1)/5 Let a be (-4)/160 - -25. Suppose -4v = -9v + a. Suppose 12/7w2 - 8/7w*4 + 2/7w - 4/7 + 6/7wv - 8/7w*3 = 0. What is w? -1, -2/3, 1 Let m(w) = -5w*2 - 30w - 47. Let b(p) = -5p2 - 30p - 48. Let z(c) = -2b(c) + 3m(c). Find f, given that z(f) = 0. -3 Suppose -12/7f3 - 6/7 + 2/7f*4 + 10/7f + 4/7f2 + 2/7f*5 = 0. What is f? -3, -1, 1 Let o(k) be the first derivative of -28k*3/3 - 60k*2 - 32k + 6. Factor o(c). -4(c + 4)(7c + 2) Let k(p) be the third derivative of -p5/135 - p4/27 + 2p*3/9 + 8p*2. Suppose k(b) = 0. What is b? -3, 1 Let -1/3u*2 + 3 + 8/3u = 0. What is u? -1, 9 Let u be 1/(-1)-2 - 14/8. Factor -1/2 - uf*2 - 3/4f. -(f + 1)(f + 2)/4 Let s = 12 - 10. Suppose -14h - 11h2 - 9h*3 + 10h + 21h3 + hs + 18h4 = 0. Calculate h. -1, -1/3, 0, 2/3 Let k(s) = s2 - 5s + 6. Let u be k(4). Let f(i) be the second derivative of 5/6i*4 + 0 + i + ui*2 + 7/3i*3. Suppose f(n) = 0. Calculate n. -1, -2/5 Suppose -h - 3p = -2, -5p = -3h - 4p + 6. Solve -2/11a*h - 2/11a*3 + 2/11 + 2/11a = 0. -1, 1 Suppose 5x - 14 + 4 = 0. Let g(l) be the first derivative of -2/5l*5 - 2 + 2/3l*3 - 1/2l*x + 1/6l*6 + 0l*4 + 0l. Factor g(i). i(i - 1)3(i + 1) Solve 3 - 101r2 + 110r*2 - 7 + 3r*3 - 8 = 0 for r. -2, 1 Suppose 9/7b - 12/7b2 + 3/7b*3 + 0 = 0. What is b? 0, 1, 3 Let m(h) be the second derivative of -1/10h*5 - 1/15h*6 + 1/6h*4 + 0 + 1/21h*7 + 0h*3 - 4h + 0h2. Solve m(k) = 0. -1, 0, 1 Let o be -4 + 3 - 3/(-2). Factor 0 - 2p2 + p4 + op5 + 2p - 3/2p3. p(p - 1)*2(p + 2)*2/2 Suppose -5f = -0f - 30. Let k(w) be the third derivative of 0w - 3w2 - 1/540w*f - 2/27w*3 + 0 - 5/108w*4 - 2/135w*5. Factor k(p). -2(p + 1)*2(p + 2)/9 Let p be (15/(-6))/5-68. Let m = 104/3 - p. Determine g so that 2/3 + mg*2 + 4/3g = 0. -1 Let o be 5/(-6)-18/10. Let ou5 - 2/3u*3 + 0 + 2/3u*4 + 0u - 2/3u2 = 0. Calculate u. -1, 0, 1 Let w(o) be the first derivative of 4o*3/3 - 4o*2 + 4o - 7. Let w(l) = 0. What is l? 1 Let i(k) be the second derivative of -k6/1980 + k5/330 - k4/132 - k3 + 5k. Let b(a) be the second derivative of i(a). Factor b(m). -2(m - 1)*2/11 Let 6o + 0o3 - 15o*2 - 3o*4 - 3o*3 + 15o*3 + 0o = 0. What is o? 0, 1, 2 Let t(h) be the first derivative of h6/15 - h4/10 - 1. Factor t(r). 2r3(r - 1)(r + 1)/5 Let g be -1 + 4/3 - (-77)/(-330). Let w(c) be the first derivative of 8/25c*5 + 0c*3 + gc*4 + 0c - 3 + 0c2. Factor w(n). 2n*3(4n + 1)/5 Let i(p) be the second derivative of -p6/180 + p5/60 + p3/3 - 5p. Let s(q) be the second derivative of i(q). Factor s(y). -2y(y - 1) Let r(p) be the second derivative of 0p2 - 1/35p*7 - 1/50p*5 + 4/75p*6 + 0p*3 + p + 0p*4 + 0. Solve r(o) = 0 for o. 0, 1/3, 1 Suppose -16j*3 + 7j*3 + 5 + 10j - j*3 - 3j*2 - 2j*2 = 0. What is j? -1, -1/2, 1 Let n(o) be the second derivative of 2o - 1/21o3 - 2/7o*2 + 0 + 1/42o*4. Find r, given that n(r) = 0. -1, 2 Let l(d) be the second derivative of 0d*3 + 1/30d*5 + 1/36d*4 + 0 + 0d2 - d. Factor l(x). x2(2x + 1)/3 Let q(n) = n*4 + 3n*3 + 10n*2 + 15n + 1. Let y = 6 + -3. Let a = 4 - 8. Let p(w) = w*4 + 2w*3 + 9w*2 + 16w. Let v(r) = aq(r) + yp(r). Factor v(d). -(d + 1)*2(d + 2)*2 Let c be (-2)/3 - (-26)/39. Solve -6/7t*2 + 4/7t + c + 2/7t3 = 0. 0, 1, 2 Let n be (-16)/(-8) - (1 + -1). Factor 4/7z + 22/7z2 + nz*4 + 0 + 32/7z*3. 2z(z + 1)2(7z + 2)/7 Let p be (2 - (4 + -2))/(-1). Let c(r) be the first derivative of -2 + pr*2 + 1/21r*6 + 0r + 0r5 + 4/21r*3 - 3/14r*4. Factor c(f). 2f*2(f - 1)*2(f + 2)/7 Let a(k) be the first derivative of k6/1440 + k5/80 + 3k4/32 + k3 + 5. Let v(o) be the third derivative of a(o). Factor v(n). (n + 3)2/4 Suppose 0b + 20 = -4l - 4b, -5 = 5l + b. Let p = l + 7. Factor 10r*3 - 2 - 5r*2 - 2r*3 + 8r - pr2 - 2r*4. -2(r - 1)*4 Let n(q) be the third derivative of 0q + 0 - 1/12q3 - 2q*2 - 1/12q*4 - 1/40q*5. Suppose n(t) = 0. Calculate t. -1, -1/3 Let o be ((-6)/40)/(24/(-60)). Let m(i) be the first derivative of oi*2 + 3/4i*3 - 4 - 3/2i. Factor m(x). 3(x + 1)(3x - 2)/4 Let m(h) = -2h + 16. Let p be m(7). Solve -7i3 + 20i - 4 - 15i2 + 3i*p - 29i3 = 0. -1, 1/3 Let p(k) be the first derivative of k6/360 - k5/60 - k4/8 + 4k3/3 - 2. Let j(g) be the third derivative of p(g). Solve j(f) = 0. -1, 3 Suppose 30 = 5d + 4t, -3d = -0d - 4t + 14. Factor 16s - 1 + 11 + 2s*3 - d + 10s*2. 2(s + 1)(s + 2)2 Let h(y) be the first derivative of -y5 - 15y*4/4 - 5y*3 - 5y2/2 - 12. Let h(r) = 0. Calculate r. -1, 0 Let p(q) be the second derivative of q5/20 - 7q4/24 + 7q3/12 - q2/2 - 13q. Let p(u) = 0. What is u? 1/2, 1, 2 Let y = -69 - -69. Let b(h) be the second derivative of y - 4/3h*3 - 1/6h*4 - 4h*2 - h. Suppose b(q) = 0. Calculate q. -2 Let m = -178 - -339. Let f = m + -641/4. Suppose -1/2 - 1/4x*2 - fx = 0. What is x? -2, -1 Let a(l) = -l4 + l3 - l*2 - l. Let s(i) = 2i*4 + 43i*3 + 87i*2 + 77i + 25. Let y(w) = 3a(w) - s(w). Factor y(u). -5(u + 1)*3(u + 5) Let z(k) = 2k2 - 12k - 36. Let m(w) = -3w2 + 25w + 71. Let s(t) = 4m(t) + 7z(t). Factor s(p). 2(p + 4)2 Let n be 28/(-40)-5 + (-2)/4. Solve 0s2 + 3/2s*4 - 3/2 + 3s - ns3 = 0 for s. -1, 1 Let i(q) be the first derivative of -2q*5/85 + 3q*4/34 - 4q*3/51 + 18. Factor i(x). -2x*2(x - 2)(x - 1)/17 Let l(o) = 2o*2 - o - 1. Let p be l(-1). Suppose s - ps = -3. Let 4/5y4 + 9/5y*s + 1/5y + 0 + 6/5y2 = 0. What is y? -1, -1/4, 0 Suppose 0 = 2f + 2s + 3s - 1, -5f - s + 14 = 0. What is r in 4r*f + 3r*4 - 4r*3 + 6r*3 + 0r**4 = 0? -2, 0 Let j be (-10 - 0)/(13/(91/(-14))). Find v, g	{ "pile_set_name": "DM Mathematics" }
1 - 2460c2 + 11832c/11 + 4624/11 = 0. Calculate c. -34, -1/4, 2/3 Suppose 2i4/15 - 6i*3/5 - 46i*2/15 + 6i/5 + 44/15 = 0. What is i? -2, -1, 1, 11 Solve 4c3 + 40c*2 - 156c = 0. -13, 0, 3 Factor -l*3 - 26l*2/7 - 20l/7 + 8/7. -(l + 2)*2(7l - 2)/7 Find n, given that -3n*2 + 171n + 174 = 0. -1, 58 Factor -3i3/2 - 2466i*2 - 1013526i. -3i(i + 822)*2/2 Find w such that 6w*5/7 - 30w*4/7 + 6w*3 + 6w*2/7 - 48w/7 + 24/7 = 0. -1, 1, 2 Factor 5929h4/5 + 1232h*3/5 - 552h*2/5 - 64h/5 + 16/5. (7h + 2)2(11h - 2)2/5 Factor -5202d*3/11 + 98430d*2/11 + 704d + 152/11. -2(d - 19)(51d + 2)2/11 Determine c so that 7c*5/6 + 149c*4/6 + 133c*3 + 598c*2/3 + 140c/3 = 0. -14, -5, -2, -2/7, 0 Determine s so that 4s4 + 40s*3 + 140s*2 + 200s + 96 = 0. -4, -3, -2, -1 Solve -4l2 + 152l - 868 = 0 for l. 7, 31 Determine a so that 5a3 + 8250a*2 + 4537500a + 831875000 = 0. -550 Factor 148g3 + 136g*2 - 12g. 4g(g + 1)(37g - 3) Factor p*2 - 70p + 136. (p - 68)(p - 2) Solve 2z*4 + 50z*3/3 - 70z*2/9 - 50z/3 + 52/9 = 0. -26/3, -1, 1/3, 1 What is d in -2d5/11 + 8d*4/11 + 70d*3/11 - 300d2/11 = 0? -6, 0, 5 Suppose -z3/5 - 88z2/5 - 2021z/5 - 3698/5 = 0. Calculate z. -43, -2 Suppose u*5 - 9u*4 - 33u*3 - 35u*2 - 12u = 0. Calculate u. -1, 0, 12 Determine w so that w*5 - 18w*4 + 74w*3 - 124w*2 + 93w - 26 = 0. 1, 2, 13 Factor -2m2/3 + 604m/3 - 45602/3. -2(m - 151)2/3 Suppose -4b*4 + 18b*3 + 135b*2/4 - 275b/2 + 375/4 = 0. Calculate b. -3, 5/4, 5 Solve k*2/2 + 12k - 25/2 = 0 for k. -25, 1 Let 30d3 - 81d*2 + 24d + 36 = 0. Calculate d. -1/2, 6/5, 2 Suppose -5c3 + 20c*2 - 20c = 0. Calculate c. 0, 2 Solve -3i4 - 42i*3 - 99i*2 + 336i - 192 = 0 for i. -8, 1 Factor q*2/4 + 813q/4. q(q + 813)/4 Solve r3 - 19r*2 + 55r + 75 = 0. -1, 5, 15 Factor 3n4/5 - 36n*3. 3n*3(n - 60)/5 Solve -4i2 - 320i - 6400 = 0 for i. -40 Determine l, given that -2l4 - 748l*3 - 69938l2 = 0. -187, 0 Factor i3/3 - i*2 - 3i - 5/3. (i - 5)(i + 1)2/3 Factor h3 + 119h*2 + 687h + 1017. (h + 3)*2(h + 113) Determine z, given that 242z3/13 + 88z*2/13 + 8z/13 = 0. -2/11, 0 Factor -3r2/2 + 9r/2 + 405. -3(r - 18)(r + 15)/2 Find k such that 3k3 - 126k*2 - 705k = 0. -5, 0, 47 Let -3l4 - 129l*3 - 861l*2 - 735l = 0. Calculate l. -35, -7, -1, 0 Determine n, given that 7n3/3 + 1027n*2/3 + 37000n/3 - 16428 = 0. -74, 9/7 Factor 2f4/9 - 20f*3/9 - 6f*2 + 8f. 2f(f - 12)(f - 1)(f + 3)/9 Suppose 4394y4 - 124046y*3 + 887328y*2 + 2115072y - 29859840 = 0. Calculate y. -5, 144/13 Determine c, given that 4c4 - 96c*3 + 576c2 = 0. 0, 12 Factor -y5 + 6y4 - 14y*3 + 16y*2 - 9y + 2. -(y - 2)(y - 1)4 Factor 4w*3 + 848w*2 - 3444w + 2592. 4(w - 3)(w - 1)(w + 216) Determine r, given that -2r*4/3 - 8r*3/3 + 28r*2 - 24r - 54 = 0. -9, -1, 3 Find i such that -i*4 - 30i*3 + 99i*2 - 4i - 132 = 0. -33, -1, 2 Let -2z2/7 + 4668z/7 - 2723778/7 = 0. Calculate z. 1167 Find h such that -2h2/17 - 50h/17 + 52/17 = 0. -26, 1 Determine h so that 3h4/5 + 4h*3 - 7h*2/5 = 0. -7, 0, 1/3 Let 8f*2/3 - 188f/3 - 32 = 0. Calculate f. -1/2, 24 Factor j4/4 + j3/4 - 25j2/4 - 25j/4. j(j - 5)(j + 1)(j + 5)/4 Solve -2g*4/7 - 6g*3/7 + 6g*2/7 + 22g/7 + 12/7 = 0 for g. -3, -1, 2 Solve -2t2 - 4t = 0 for t. -2, 0 Let 4107b4/4 - 28305b*3/4 + 11547b*2 + 1311b + 36 = 0. Calculate b. -2/37, 3, 4 Suppose -2m5 - 36m*4 + 44m*3 + 104m*2 - 186m + 76 = 0. What is m? -19, -2, 1 Factor -5q4/2 + 105q*2/2 + 50q. -5q(q - 5)(q + 1)(q + 4)/2 Suppose 5n5 + 1310n*4 - 9325n*3 + 24110n*2 - 26860n + 10760 = 0. Calculate n. -269, 1, 2 Factor -r*2/6 + 50r/3. -r(r - 100)/6 Factor -j4 + 7212j*3 - 17337648j*2 + 13893235264j. -j(j - 2404)3 Solve -15m*3 + 230m*2 - 285m + 70 = 0. 1/3, 1, 14 Factor 4a3 + 344a*2 + 7396a. 4a(a + 43)*2 Suppose -16h*4 + 60h*3 - 100h - 24 = 0. Calculate h. -1, -1/4, 2, 3 Factor 4z3 - 24z*2 + 12z + 40. 4(z - 5)(z - 2)(z + 1) Factor v3/4 - 119v*2/4 + 870v + 900. (v - 60)*2(v + 1)/4 Let 13d3/5 + 3d*2 + 2d/5 = 0. What is d? -1, -2/13, 0 Solve 2h4/15 + 136h*3/5 - 2h*2/15 - 136h/5 = 0. -204, -1, 0, 1 Suppose 4g5 + 24g*4 + 20g*3 - 96g*2 - 144g = 0. Calculate g. -3, -2, 0, 2 Find i, given that -i*5/3 + 106i*4/3 + 436i*3/3 + 440i2/3 = 0. -2, 0, 110 Factor -g2/4 + 215g/2 - 46225/4. -(g - 215)2/4 Factor -t2/5 + 28t/5. -t(t - 28)/5 Solve 9v*4/5 - 66v*3/5 - 3v*2/5 + 156v/5 + 84/5 = 0. -1, -2/3, 2, 7 Find n, given that -8n5/3 - 8n*4 - 10n*3/3 + 20n*2/3 + 6n + 4/3 = 0. -2, -1, -1/2, 1 Factor -2f3/5 - 282f*2/5 - 1008f - 4840. -2(f + 10)2(f + 121)/5 Suppose 2d5/15 - 4d*4/3 + 6d3/5 = 0. Calculate d. 0, 1, 9 Factor -o5/6 - 5o4/3 - 3o3/2. -o3(o + 1)(o + 9)/6 Factor q*3 + 127q*2 - 257q + 129. (q - 1)*2(q + 129) Factor -20i4 + 36i*3 - 12i*2 - 4i. -4i(i - 1)*2(5i + 1) Factor x3/6 + 77x*2/3 + 1136x/3 + 1472. (x + 8)*2(x + 138)/6 Let 5y3 + 4745y*2 + 1128120y + 1123380 = 0. Calculate y. -474, -1 Factor -5t3 + 60t*2 - 135t. -5t(t - 9)(t - 3) Factor -n2/6 - 401n/3 - 160801/6. -(n + 401)2/6 Factor o3/2 - 2o2 - 7o/2 + 5. (o - 5)(o - 1)(o + 2)/2 What is h in -h*2/3 + 18h - 53/3 = 0? 1, 53 Suppose 2i3/11 - 1930i*2/11 + 3852i/11 = 0. Calculate i. 0, 2, 963 Determine v so that 27v3/2 + 1272v*2 + 282v = 0. -94, -2/9, 0 Determine n, given that -10n3/3 + 1082n*2 + 11140n/3 + 1312 = 0. -3, -2/5, 328 Find o, given that 4o2 + 704o + 30976 = 0. -88 Factor 3a2 - 66a - 144. 3(a - 24)(a + 2) What is a in -a*2 + 172a - 340 = 0? 2, 170 Suppose -9x3/4 + 23x*2/4 + x - 7 = 0. Calculate x. -1, 14/9, 2 Find u, given that -2u*3/11 - 6u*2 - 432u/11 + 1944/11 = 0. -18, 3 Suppose 60l5 + 425l*4 - 450l*3 - 75l*2 + 40l = 0. Calculate l. -8, -1/3, 0, 1/4, 1 Factor 2k3/5 - 44k*2/5 + 38k/5 + 84/5. 2(k - 21)(k - 2)(k + 1)/5 Factor v4/4 + 3v*3 + 11v2/4. v2(v + 1)(v + 11)/4 Factor 2x2/5 - 48x/5 + 238/5. 2(x - 17)(x - 7)/5 Find f, given that f*5 + 3f*4 - 5f*3 - 27f*2 - 32f - 12 = 0. -2, -1, 3 Factor -4j3 + 116j*2 - 780j - 900. -4(j - 15)2(j + 1) Factor 2r4/3 - 14r*3/3 - 2r*2 + 38r/3 + 28/3. 2(r - 7)(r - 2)(r + 1)2/3 Solve 3s*4 + 48s*3 + 231s*2 + 294s = 0 for s. -7, -2, 0 Determine k, given that -k*5 + 93k*4 - 1910k*3 - 12098k*2 + 1911k + 12005 = 0. -5, -1, 1, 49 Determine d so that 3d5 - 4d*4 - 4d*3 + 6d2 + d - 2 = 0. -1, -2/3, 1 Determine o, given that o4/3 - 24o3 + 203o*2/3 + 96o - 276 = 0. -2, 2, 3, 69 Find h such that 2h3 - 392h*2 + 17544h + 166464 = 0. -8, 102 Solve v*3/5 - 4v*2 - 43v/5 - 22/5 = 0 for v. -1, 22 Factor -2c3/5 - 2c*2 + 56c/5 + 64/5. -2(c - 4)(c + 1)(c + 8)/5 Factor 10p*2 + 114p - 72. 2(p + 12)(5p - 3) Factor -3v*4/4 + 231v*3/4 + 117v*2/2. -3v*2(v - 78)(v + 1)/4 Factor -2j*4 + 2j*3 + 2j*2 - 2j. -2j(j - 1)*2(j + 1) What is y in 3y4 - 14y*3 + 8y*2 = 0? 0, 2/3, 4 What is w in 2w*3/13 + 328w*2/13 - 664w/13 = 0? -166, 0, 2 Factor 3b4/4 + 715b*3/4 + 119b2/2. b2(b + 238)(3b + 1)/4 Factor y3/2 + 12y*2 - 51y/2 - 1445. (y - 10)(y + 17)2/2 Factor 2z*4/17 + 20z*3/17 - 14z*2/17 - 392z/17. 2z(z - 4)(z + 7)2/17 Find w, given that -8w*4/5 + 66w*3/5 + 336w*2/5 + 296w/5 - 96/5 = 0. -2, 1/4, 12 Find l, given that -5l3 - 4530l*2 - 1368060l - 137718040 = 0. -302 Factor w*3 - 43w*2 + 496w - 1728. (w - 27)(w - 8)2 What is t in t5 + 3t4 + t3 - 3t2 - 2t = 0? -2, -1, 0, 1 Determine g, given that -4g3 + 156g*2 + 160g = 0. -1, 0, 40 Factor -h*5/4 + 17h*4/2 - 16h3 - h2/2 + 65h/4 - 8. -(h - 32)(h - 1)*3(h + 1)/4 Factor -5d2 + 260d + 5865. -5(d - 69)(d + 17) Let 6u4/11 + 28u*3/11 - 98u*2/11 + 8u/11 + 56/11 = 0. Calculate u. -7, -2/3, 1, 2 Factor 2o5 - 170o*4 + 4700o*3 - 38860o*2 - 92510o - 48778. 2*(o -	{ "pile_set_name": "DM Mathematics" }
irst derivative of -3z4/2 - 4z3/3 + z2 - 4z - 149. Let q(v) = 19v*3 + 11v*2 - 5v + 14. Let p(a) = -2q(a) - 7s(a). Factor p(k). 2k(k + 2)(2k - 1) Determine z so that -950/7z + 472/7z*2 + 2/7z*3 + 68 = 0. -238, 1 Find w such that 3/4w - 45/2 + 3/4w2 = 0. -6, 5 Let m(p) be the third derivative of -p5/15 + 23p*4/6 - 88p*3 - 1826p*2. Factor m(w). -4(w - 12)(w - 11) Let x(j) be the first derivative of j3/3 - j2 + 2j + 30. Let y be x(0). Factor -s*2 - 122s*4 + 59s*4 - ys*3 + 62s4. -s2(s + 1)2 Let l(m) = -60m - 837. Suppose 2b = s + 10, 0 = 2s + 13b - 12b + 30. Let n be l(s). Factor -20/7p + 4/7 + 40/7p*2 - 4/7p*5 - 40/7p*n + 20/7p*4. -4(p - 1)*5/7 Determine x so that 0 + 1/7x*2 - 376/7x = 0. 0, 376 Let b(z) be the first derivative of 2025z2 + 0z - 60z3 + 1/2z*4 - 5. Factor b(q). 2q(q - 45)2 Factor 0 + 1/4m*2 - 180m. m(m - 720)/4 Suppose 3 = -c + f + 2f, -4f - 61 = 3c. Let q = 17 - c. Let -3 + q + 5d2 + 20d - 14 = 0. Calculate d. -3, -1 Let r be 22/(-38) + (190/10)/38. Let l = 13/76 - r. Let -1/2 - lk + 1/2k*2 + 1/4k*3 = 0. Calculate k. -2, -1, 1 Factor 3l3 + l2 - 284l4 + 281l*4 + 5l*2. -3l*2(l - 2)(l + 1) Suppose -3m + 51 = 0, 1060 - 1130 = -g - 4m. Determine u so that 2/7u*g - 22/7u + 0 = 0. 0, 11 Let m(f) be the first derivative of f6/480 - f5/240 - f*4/16 + 3f*2 - 2. Let u(l) be the second derivative of m(l). Suppose u(p) = 0. Calculate p. -2, 0, 3 Find m, given that -63/4m*5 + 3m + 51/4m3 + 15m*2 + 0 - 15m*4 = 0. -1, -2/3, -2/7, 0, 1 Let v(j) be the first derivative of -3/40j*5 - 22 + 3j*4 - 48j*3 + 384j*2 + 2j. Let l(b) be the first derivative of v(b). Factor l(o). -3(o - 8)3/2 Let t(d) be the second derivative of 55d*5/4 + 5d*4/4 - 100d*3/3 + 30d*2 + 205d - 6. Factor t(h). 5(h + 1)(5h - 2)(11h - 6) Let j = 514665 + -3602654/7. Let 48/7 - jn*2 + 22/7n = 0. What is n? -2, 24 Let x = -8 - -12. Let n(d) = -d - 22. Let t be n(-24). Determine h so that 4/11h3 + 2/11 + 2/11h*x - 4/11h*t - 2/11h*5 - 2/11h = 0. -1, 1 Let a(p) = -8p2 - 372p - 17304. Let z(l) = -42l2 - 1860l - 86522. Suppose 14n - 30n = -256. Let i(q) = na(q) - 3z(q). Suppose i(t) = 0. Calculate t. -93 Let c(p) be the first derivative of 5/4p4 + 2/3p*5 - 10/3p*2 + 34 + 0p - 5/18p6 - 20/9p*3. Determine o so that c(o) = 0. -1, 0, 2 Let v(t) = 35t*3 + 5815t*2 - 191300t + 1452650. Let b(d) = 3d3 + 529d*2 - 17391d + 132059. Let a(q) = 45b(q) - 4v(q). Factor a(n). -5(n - 49)2(n - 11) Let r(d) be the first derivative of -625d6/12 - 7325d*5/2 - 7200d*4 - 17180d*3/3 - 2284d*2 - 456d + 564. Solve r(w) = 0 for w. -57, -2/5 Let u(m) = 337m + 3035. Let b be u(-9). Let p = -1/8 - -29/8. Suppose -4 - 9j - pjb = 0. What is j? -2, -4/7 Let d(z) be the second derivative of -z5/4 + 415z*4/6 - 17630z*3/3 + 33620z*2 + 112z. Factor d(q). -5(q - 82)2(q - 2) Let a(p) = p*3 - 5p*2 + 7p - 11. Let r be a(4). Factor r + 1 - 1065g3 + 1037g*3 + 8g*2 + 20g*4 - 2. 4g*2(g - 1)(5g - 2) Let x(i) be the third derivative of -i*5/12 - 115i*4/12 + 425i*3/2 - 2467i*2. Solve x(z) = 0 for z. -51, 5 Let g(x) = -5x*5 - 7x*4 + 82x*3 - 72x*2 - 42x - 12. Let w(h) = -2h3 + 2h*2 + h + 6. Let r(b) = g(b) + 2w(b). Determine a so that r(a) = 0. -5, -2/5, 0, 2 Let a = 675 - 740. Let q be (a/20 + 4)1. What is u in -3/8u - q - 15/8u3 + 3u2 = 0? -2/5, 1 Let p(c) be the first derivative of c6/12 - c*5/5 - 13c*4/8 - 5c3/3 - 4404. Factor p(t). t2(t - 5)(t + 1)(t + 2)/2 Determine y, given that -2/9y*2 - 256/9 + 86/3y = 0. 1, 128 Let o(q) be the third derivative of 29/8q4 + 14q*3 + 0 + 2q + 128q2 + 1/20q*5. Factor o(h). 3(h + 1)(h + 28) Let v(q) = 3q*3 + 29q*2 + 29q + 11. Let d be v(-8). Let b be (10/16)/(-5 - d/(-18)). Find o such that 15/2o2 + bo*4 - o - 2 - 23/4o3 = 0. -2/5, 1, 2 Let j(x) be the first derivative of x3/12 + 365x2/4 + 2064. Find u, given that j(u) = 0. -730, 0 Let k(r) be the first derivative of -4/15r*2 + 0r*3 + 1/30r*4 - 170 + 0r. Factor k(a). 2a(a - 2)(a + 2)/15 Let f be (14/49 - 16/56)/(-3). Let k(y) = 59y - 2. Let m be k(2). Determine x so that -720 - 5x2 + fx - 4x - mx = 0. -12 Suppose -1017 = 13p - 561 - 508. Let -8/17 + 22/17z*2 + 40/17z*3 + 4/17z*5 + 22/17z*p - 8/17z = 0. What is z? -2, -1, 1/2 Factor -23z3 - 37z*3 + 1797 - 1094 - 510z - 265z2 - 1063 - 10z*4 + 5z*4. -5(z + 2)(z + 3)2(z + 4) Let h(p) = -2p + 11. Let c(y) = -4y*2 + 77y - 77. Let q(b) = 2c(b) + 14h(b). Factor q(v). -2v(4v - 63) Let w(b) be the third derivative of -1/1512b*8 + 1/270b*6 - 1/135b*5 + 1/27b*3 - 97b*2 + 0 + 0b - 1/108b4 + 1/945b*7. Factor w(l). -2(l - 1)*3(l + 1)*2/9 Let k(b) be the second derivative of 1/5b*5 + 29/6b*3 + 5b*2 - 43/12b*4 + 0 - b. What is y in k(y) = 0? -1/4, 1, 10 Factor 3133h*3 + 3005h*2 + 0h*4 - 8220h + 459h2 - 3485h*3 + 2332h + 4h4 + 2772. 4(h - 77)(h - 9)(h - 1)*2 Let p(k) = -51k*3 + 231k*2 + 541k + 1661 - 22k - 1703. Let c(f) = 5f*3 - 23f*2 - 52f + 4. Let d(l) = -21c(l) - 2p(l). Factor d(i). -3i(i - 9)(i + 2) Let c = -25324 - -25326. Determine h so that -63h - 3/7h3 + 9h*c + 147 = 0. 7 Let u be 276/(-207)(175/(-20) + 5). Solve 1/2a3 + 0a*2 + 0a + 1/2au + a4 + 0 = 0 for a. -1, 0 Let s be (3 - (-230)/(-72)) + (-6)/27. Let z = 11/20 + s. Factor 4/15q - zq2 + 0. -2q(q - 2)/15 Let v = -8971/4 + 2243. Factor -16 - vh*2 + 4h. -(h - 8)2/4 Let i(d) be the first derivative of d7/105 - 4d6/75 - 116d + 56. Let l(s) be the first derivative of i(s). Let l(z) = 0. What is z? 0, 4 Suppose 3170 + 1081 = 39v. Let o = v + -109. Solve o - 6/17s*2 + 4/17s + 2/17s3 = 0 for s. 0, 1, 2 Let d = -1483 - -2575. Find j, given that 7047j*2 + d + 807 - 7039j*2 + 232j - 217 = 0. -29/2 Let n(i) be the first derivative of -i*6/840 - 11i*5/28 - 3025i*4/56 - 14i3/3 - i2 + 69. Let z(b) be the third derivative of n(b). Factor z(c). -3(c + 55)2/7 Let k(h) = -2h*2 - 45h - 60. Let a be k(-21). Let v(p) be the first derivative of -1/15pa - 7 + 0p + 0p2. Factor v(f). -f2/5 Let k(h) be the second derivative of -5h*4/24 + 125h*3/36 + 15h*2/2 - 2611h - 1. Factor k(f). -5(f - 9)(3f + 2)/6 Let g(i) be the first derivative of 2i*5/15 + 7i*4 - 2i*3/3 - 128i*2/3 - 56i + 852. Solve g(z) = 0 for z. -42, -1, 2 Let g = -1151919/140 + 8228. Let s(q) be the third derivative of 0 + 0q - 1/96q*4 - 13/480q*6 + 0q*3 + gq*7 - 18q*2 + 1/30q*5. Factor s(j). j(j - 1)*2(6j - 1)/4 Let k = 67400 + -202196/3. Factor 8 + ku*2 + 20/3u. 4(u + 2)(u + 3)/3 Let h = -393836 - -393840. Factor -8/5u + 6/5u*2 + 4/5u*3 - 8/5 - 2/5u*h. -2(u - 2)*2(u + 1)*2/5 Suppose 57o = 8o + o. Suppose o = -3v - 2z + 2, -2v = -v + z. Factor 2r3 + 0 - 18/7r*v + 4/7r. 2r(r - 1)(7r - 2)/7 Factor -28f - 41f*3 + 24f3 - 24 + f2 + 15f2 + 21f*3 - 16. 4(f - 2)(f + 1)(f + 5) Let g(z) be the second derivative of -z*6/165 - 149z*5/110 + z - 400. Factor g(i). -2i*3(i + 149)/11 Factor -136/5 + 1/5r3 + 206/5r - 71/5r2. (r - 68)(r - 2)(r - 1)/5 Let s = -47 + 29. Let f be s/(-21)(2 + 5/(-10)). Let -3/7t5 + 0 + ft*3 + 0t + 6/7t2 + 0t*4 = 0. What is t? -1, 0, 2 Let j(g) be the first derivative of 2g*3/21 + 39g*2/7 - 1620g/7 + 7150. Factor j(m). 2(m - 15)(m + 54)/7 Solve 2119l + 0l*4 - 720 + 38166l*2 + 205l*3 - 5l*4 - 39106l*2 - 659l = 0 for l. 1, 2, 36 Let u(y) be the second derivative of y*6/40 - 69y*5/160 - 3y*4/8 - 2y + 493. Factor u(x). 3x2(x - 12)(2x + 1)/8 Let r(v) be the third derivative of 0v - 7/1080v*6 + 0 - 38v*2 - 11/540v*5 + 0v*3 - 5/216v*4 - 1/1890v*7. Factor r(c). -c(c + 1)*2(c + 5)/9 Let p(o) be the third derivative of 13/16o4 + 0o - 1/672o8 - 7/15o*5 + 17/120o*6 - 1/70o*7 - 254o*2 + 0 - 5/6o3. Find n such that p(n) = 0. -10, 1 Let l(z) = -z3 - 7z2 - z + 35. Let f be l(-6). Suppose 2s = -4u + 6, 3s - 34 =	{ "pile_set_name": "DM Mathematics" }
). -17700j4 Let l(x) = 2x*2. Let p(h) = -h + 32656193. Determine p(l(r)). -2r*2 + 32656193 Let b(k) = -71k + 3198. Let g(x) = -31x. Give g(b(f)). 2201f - 99138 Let g(z) = z*2. Let k(m) = -m + 13. Let h be k(5). Let x(d) be the second derivative of 2d*3 + 6d - hd + 12d + 7d. Calculate g(x(n)). 144n*2 Let n = 108 - 106. Let m(a) = 14a + 3 - n + 31a. Let y(l) = 2l. Calculate y(m(c)). 90c + 2 Let v(q) be the third derivative of -3q*4/8 - 19q3/3 + q2 - 2q + 823. Let w(l) = 2l. Calculate w(v(t)). -18t - 76 Let w(a) = -192a + 265a - 39a - 36a. Let s(z) = -635z. Determine w(s(c)). 1270c Let z(v) = -54348v*2. Let p(n) = 5936n. Give p(z(w)). -322609728w2 Let o(a) = 2a. Let p(g) = 83g + 917. Give o(p(b)). 166b + 1834 Let u(f) be the second derivative of 7f3/3 - 26f - 15. Let m(g) be the third derivative of g*4/8 - 5g*2. What is m(u(x))? 42x Let c(x) be the third derivative of 2/15x5 + 17x + 0 + 0x3 + 0x4 + x2. Let o(r) = 6r. What is c(o(j))? 288j*2 Let f(a) = -3988a*2. Let t(g) = 2627g. Give t(f(q)). -10476476q2 Let c(q) = 2q*2. Let y(b) = -878 - 883 + 684b*2 + 752b*2 + 1761. What is y(c(v))? 5744v*4 Let m(y) be the second derivative of -23/12y*4 + 0 + 0y*2 - 4y + 0y3. Let z(v) = -v2 + 1176v - 1176v. Give z(m(a)). -529a*4 Let l(g) = -2g*2. Let r(i) = -22i + 358946. Give r(l(m)). 44m2 + 358946 Let z(m) = 7468m. Let s(r) = -18257r + 9133r + 9125r. Give z(s(y)). 7468y Let f be 8/((-4)/(-2)) + 2. Let r(l) = -6l + fl + 8l. Let a(d) be the second derivative of d3/6 - 1285d. Give a(r(b)). 8b Let y(u) = 14785u*2. Let x(k) = -40k. Give x(y(l)). -591400l2 Let s(o) = 67644o - 33821o - 33825o. Let k(q) = 13809q2. What is s(k(r))? -27618r*2 Let u(v) = -512v + 1536. Let f be u(3). Let o(k) be the third derivative of 1/60k5 + f + 0k*3 + 0k + 8k2 + 0k*4. Let a(j) = 10j. Give a(o(m)). 10m2 Let j(y) = -2602y. Let m(h) = 2526h2. Give j(m(n)). -6572652n*2 Let s(a) = -713a. Let h(m) = -5 + 5 - 20257m + 20259m. Calculate h(s(d)). -1426d Let c(w) be the second derivative of -5w*3/6 - 15w*2/2 + 21w + 90. Let n(g) = -13g2. Determine n(c(k)). -325k*2 - 1950k - 2925 Let p(j) = 151103j2. Let g(n) = -42n. Calculate p(g(z)). 266545692z2 Let o(a) = 1. Let l(x) = x + 9. Let r(g) = -4l(g) + 36o(g). Let v(m) = -2m + 33. Let i be v(15). Let f(b) = -b + 11b - ib. Give f(r(d)). -28d Let a(s) = -19s. Let p(v) be the first derivative of 2v3/3 + 32v - 1123. Give a(p(x)). -38x2 - 608 Let i(p) = 54p*2 - p. Let r(z) = -252237z. Calculate i(r(g)). 3435669225126g2 + 252237g Let r(q) be the first derivative of 3q2 + q - 6. Let i(y) = -95y*2 + 9y + 9. Let b(u) = -21u2 + 2u + 2. Let z(p) = 9b(p) - 2i(p). Calculate z(r(h)). 36h2 + 12h + 1 Let a(b) = -57770b. Let i(x) = -25x*2. What is i(a(v))? -83434322500v*2 Let c(v) = -208v*2 + 45. Let q(g) = -8632g*2 + 1872. Let m(k) = 208c(k) - 5q(k). Let f(n) = -4n - 1. Calculate m(f(p)). -1664p2 - 832p - 104 Let i(a) be the first derivative of a*2 - 11a + 88. Let z(o) be the first derivative of -o*3/3 - 8. Calculate z(i(n)). -4n*2 + 44n - 121 Let j(u) = -3u2 - 50940u. Let f(l) = 352l. Determine f(j(t)). -1056t*2 - 17930880t Let r(f) = 3f. Suppose -15 = -2m + s, -m + 0m = 3s - 11. Let c(b) = b*2 - 9b + 10. Let x be c(m). Let n(j) = j*x - 5j*2 + 7j*2. Calculate n(r(l)). 27l*2 Let d(h) = 3h. Let f be 11/2 - 16/32. Let c(v) = -fv2 - v2 - 148v + 148v. What is c(d(r))? -54r*2 Let x(f) = 10f*2 - 2. Let v(j) = -5322570j. Calculate v(x(u)). -53225700u2 + 10645140 Let d(p) = 3p + 49. Let l(q) = 708q + 24 - 24 - 373q - 366q. Give l(d(g)). -93g - 1519 Let u(z) = 8z2. Let h(g) be the second derivative of 0g*2 - 15 - 7/2g*3 + 4g. What is h(u(b))? -168b2 Let n(f) = -64f*2 + 1. Let s(p) be the first derivative of 2p*3/3 + 2238. Calculate s(n(m)). 8192m*4 - 256m2 + 2 Let p(t) be the third derivative of -t5/12 - 19t2 + 8. Let d(w) be the third derivative of 0 + 10w*2 + 0w*3 + 0w + 0w4 - 1/60w*5. Give d(p(x)). -25x*4 Let a(h) = 26h*2 - 17h. Suppose -3 + 21 = 3n. Let x(o) = -9o*2 + 6o. Let c(z) = na(z) + 17x(z). Let i(f) = -f*2. Calculate i(c(w)). -9w4 Let u(s) be the third derivative of -s4/24 - 3431s3/6 - s2 - 6108s. Let m(j) = j2. Give u(m(g)). -g2 - 3431 Let v(k) = 324k. Let o(x) = 21x*2 + 1172. Give o(v(q)). 2204496q*2 + 1172 Let l(p) = -2768p*2 + 24158p. Let o(z) = 5z2. Calculate l(o(c)). -69200c*4 + 120790c*2 Let b be ((-1)/2)/((-2)/68). Let c(m) = -bm + 8m + 6m. Let x(o) = -171o2 + 11. Let g(d) = 94d*2 - 6. Let l(t) = -11g(t) - 6x(t). Calculate c(l(u)). 24u2 Let q(c) = -c2. Let d(b) = 242199949b. Calculate q(d(k)). -58660815295602601k*2 Let w(c) = 2c*2. Let n(q) = 2669q*2 - 40q - 8. Let m(b) = 1780b2 - 25b - 5. Let d(t) = 8m(t) - 5n(t). Give w(d(u)). 1602050u4 Let p(r) be the third derivative of r5/40 - 221r*3/6 - 156r2. Let j(l) be the first derivative of p(l). Let i(a) = a2 + 2a. What is j(i(q))? 3q*2 + 6q Let q(z) = 2z. Let f(i) = 110i - 22. Suppose 24 = -8t + 14t. Let x(u) = -55u + 10. Let j(r) = tf(r) + 9x(r). Determine j(q(k)). -110k + 2 Let x(u) be the first derivative of 46u3/3 + 2558. Let o(b) = 10b*2 + 5. Determine o(x(v)). 21160v*4 + 5 Let w(h) be the second derivative of 245h4/12 - h2/2 - 2167h. Let a(u) = -5u. Calculate w(a(d)). 6125d2 - 1 Let n(v) = -24v - 18. Let j(z) = 11z + 8. Let l(h) = 9j(h) + 4n(h). Let r(f) be the first derivative of -f2 - 3f + 25. What is l(r(x))? -6x - 9 Let m(x) = -10x*2 - 1039398. Let a(d) = -4d*2. Determine m(a(b)). -160b*4 - 1039398 Let h(l) = -3l*2 + l. Let i(g) be the third derivative of -5g4/8 + g3/6 - 36g2 - 19g. Calculate h(i(z)). -675z2 + 75z - 2 Let i(r) = 303360r. Let w(x) = -20x + 1. Give w(i(h)). -6067200h + 1 Let s(f) = -33f*2. Let g(d) = -331084d. Determine s(g(o)). -3617348296848o2 Let l(r) = 2r*2. Let q(j) = -204819576j*2. What is l(q(o))? 83902117425639552o*4 Let d(u) = -2u*2 - 23u. Let c(t) = -659t2 + 1324t*2 + 0t + 0t - 670t*2. What is d(c(z))? -50z*4 + 115z*2 Let y(t) = -197t*2 - 202t*2 + 580t*2 - 141t*2. Let a(g) = 15g*2. What is a(y(q))? 24000q*4 Let d be (3 - (-20)/5) + 0. Suppose 2l + 1445 = dl. Let u(r) = 138r*2 + 146r*2 - lr*2. Let m(p) = -15p*2. What is u(m(w))? -1125w*4 Let u(w) = 5w - w - 3w - 7w + 5w. Let c(a) be the second derivative of a3/3 - 12a*2 + 3a. Calculate c(u(v)). -2v - 24 Let b(c) = -c. Let z(o) = -8o - 4. Let y be (90/24)/5 - 26/(-8). Let i(j) = -5j - 3. Let w(s) = yi(s) - 3z(s). Calculate w(b(f)). -4f Let m(p) = -10p - 21940962. Let r(c) = c. Calculate m(r(o)). -10o - 21940962 Let l(a) = -15 + 15 - a*2. Suppose -y + 0y - 5c + 33 = 0, -5y - 5c + 65 = 0. Let o(s) = -ys*2 - 1617 + 1617. What is l(o(u))? -64u*4 Let p(n) = -10n. Let g(q) = q*2 + 21q + 103. Let i be g(-14). Let f(o) = io + 4o + 18o. What is p(f(b))? -270b Let f(w) = -42w2. Let y(n) be the second derivative of -n4/12 + 73n*2/2 - n + 24. Let i(k) be the first derivative of y(k). Determine i(f(d)). 84d*2 Let n(r) be the second derivative of 0r*3 + 0 - 14r - 13/12r4 + 0r*2. Let u(o) = o + 4o - 6o - o. Give u(n(j)). 26j2 Let k(l) be the third derivative of -l6/360 + 79l4/24 - 3l*2 - 28. Let j(t) be the second derivative of k(t). Let o(d) = 5d - 6. Determine j(o(h)). -10h + 12 Let g(y) = 561y. Let t(h) be the third derivative of -h*4/12 + 2h*2 + 905. Determine g(t(v)). -1122v Let u(y) = -21y + 5. Let d(i) = -33473i. What is u(d(c))? 702933c + 5 Let f(i) = i2 - 921i - 1. Let q(d) = 312d. Give q(f(h)). 312h*2 - 287352h - 312 Let c(a) = 3a - 11. Let n(w) = 2w + 19. Let k(p) = c(p) + 3n(p). Let u(s) = -3s. Give u(k(z)). -27z - 138 Let d(w) = -83w - 45w + 131w + 403w. Let z(g) = -g. What is z(d(p))? -406p Let r(c) = -2c + 0c + 6c - 2c. Let h(i) be the third derivative of -7i4/8 - 19i*2 + i. Give h(r(d)). -42d Let a(d) = -d. Let u(w) = -23w	{ "pile_set_name": "DM Mathematics" }
s? 4 Suppose r - 14r = -104. Calculate the remainder when 14 is divided by r. 6 Let w = 14 + -9. Suppose -5s - 2 = -6s - 3x, 2 = -s - wx. What is the remainder when s is divided by 5? 3 Let l(w) = -w2 + 8w - 6. Let d(s) = 2s3 - 24s*2 + 22s + 5. Calculate the remainder when l(5) is divided by d(11). 4 Let i = -47 + 183. What is the remainder when i is divided by 20? 16 Let f(u) = -u*3 - 17u*2 - 20u + 9. Calculate the remainder when f(-16) is divided by 38. 35 Suppose 4n = 3h - 201, 8h - 303 = 3h - 4n. Calculate the remainder when h is divided by 16. 15 Let o(b) = -b3 - 2b2 + b. Let j(z) be the first derivative of z3/3 + 3z2/2 + z + 1. Calculate the remainder when j(-5) is divided by o(-3). 5 What is the remainder when 516/10 - ((-13)/(-5) - 3) is divided by 27? 25 What is the remainder when 6 is divided by 9/63 + (-60)/(-21)? 0 Suppose -6y + y + c = -103, 2c = -4y + 88. What is the remainder when y is divided by 11? 10 Let a = 172 - 86. What is the remainder when a is divided by 30? 26 Suppose 44 = -4i + 12. Suppose -3b - 6n + 27 = -n, 0 = b + 4n - 16. Calculate the remainder when (10/b)/((-1)/i) is divided by 11. 9 Let t be 26/(-30) + (-22)/165. Suppose 0 = -3y + 16 + 20. What is the remainder when (3 + -1)t + 37 is divided by y? 11 Let o(g) = -14g + 1. Let k be o(4). Let c = k - -87. What is the remainder when c is divided by (-22)/(11-2)? 10 Let o(i) = -3i3 + i2 - i. Let b be o(-2). Let r = b + -21. Calculate the remainder when r is divided by (-48)/(-20) - (-6)/10. 0 Let s = -2 - -1. Let w(u) = 21u2 - 1. Let l = 22 + -15. What is the remainder when w(s) is divided by l? 6 Let f(q) = -q3 + 16q*2 - 28q + 23. What is the remainder when 41 is divided by f(14)? 18 Suppose 2n + k = 69, k + 193 - 46 = 4n. What is the remainder when n is divided by 19? 17 Let a = -8 + 13. Suppose -d = -0d - a. What is the remainder when d is divided by 4? 1 Let o(v) = 9v - 1. Let z be (-2)/5 - 114/(-10). Suppose -d - 5 + z = 0. Calculate the remainder when o(2) is divided by d. 5 Let l(o) = 4o2 - 3o - 3. What is the remainder when -18 + 51 + 2/(2/3) is divided by l(-2)? 17 Let d(h) = 7h + 17. Let k = 1 - -1. Suppose 0 = 2f + 2g + 2, 0g = -4f - kg + 2. What is the remainder when d(-2) is divided by f? 1 Let n(b) = b*3 + 9b*2 - 10b + 5. Let k be n(-10). Suppose -3c = -kc + 76. What is the remainder when c is divided by 13? 12 Calculate the remainder when 320/24 - (-1)/(-3) is divided by 3. 1 Let i be ((-135)/12)/(3/(-108)). Suppose 5s + f - i = 0, -2s + 3s - f = 87. Calculate the remainder when s is divided by 28. 26 Let b = -204 - -301. Suppose 4s = 100 - 0. What is the remainder when b is divided by s? 22 Suppose -2c + 3j = -36, -26 = 3c - 5j - 78. Calculate the remainder when c is divided by (-13)/(-2)(0 + 2). 11 Suppose 5q + 7 = -4i - 22, 23 = -3q - i. Let z be (6/q)/((-3)/(-9)). Let r = z - -8. What is the remainder when 17 is divided by r? 5 Suppose -6i + 10 = -i. Suppose -y + 4z + 25 = -z, -5y + iz = -79. Let o = -9 + y. What is the remainder when 16 is divided by o? 4 Let h be 14/6(1 - -2). Let l(y) = y + 10. Let d be l(h). Suppose 2a - 5x = -d, a - 5a + 2x + 6 = 0. What is the remainder when 13 is divided by a? 1 Let h = 470 + -288. Calculate the remainder when h is divided by 37. 34 Let z be 2/(-4)(-46 + 0). Let f = z + -14. What is the remainder when 25 is divided by f? 7 Let x = 32 - 23. Suppose 0 = t + 2t - 6. Suppose 2d = tq + 5d - 39, -60 = -2q + 4d. What is the remainder when q is divided by x? 6 Let m be 3(-1)/(0 + -1). Let o be (m + -2)/((-2)/(-8)). Suppose 8 = oz - 0. Calculate the remainder when z is divided by 2. 0 Let u(a) = -a*3 + 6a*2 - 4a + 4. Suppose -2j - 2 = 10. Let m be ((-4)/j)/((-2)/(-12)). What is the remainder when u(m) is divided by 11? 9 Let w(p) = p2 - 3p + 2. Let r be w(7). Suppose a = 2a - n - r, 3a = -3n + 66. What is the remainder when a is divided by 9? 8 Let n(j) = -2j*3 + 2j*2 + 2j + 1. Let g = 20 - 13. Calculate the remainder when g is divided by n(-1). 1 Suppose 4q = 3q + 78. Suppose -2f - q = -w - w, -2f - 119 = -3w. Let t(k) = 2k*3 - 5k*2 + 2k - 1. Calculate the remainder when w is divided by t(3). 13 Suppose 17 = -5j + 57. Let z = 4 - -1. Suppose l - z = -0l. What is the remainder when j is divided by l? 3 Calculate the remainder when 36 is divided by (13 + 0)/(0 - -1). 10 Let f = -79 + 8. Suppose -314 - 256 = 5p. Let c = f - p. What is the remainder when c is divided by 15? 13 What is the remainder when (-3)/((-1)/83) is divided by 4? 0 Let m(n) = -n + 1. Let j be m(1). Calculate the remainder when 35 is divided by 9 + j/(3 - 0). 8 Suppose 2r + 3 = 3r. Suppose 6f = rf + 72. Suppose k + 3k - 4j - f = 0, 4k - 15 = -5j. Calculate the remainder when k is divided by 2. 1 Suppose -16f + 99 = -5f. What is the remainder when 34 is divided by f? 7 Suppose 0 = 7n - 3n - 44. Suppose 3 = -4j + n. Suppose jf = 6 + 8. What is the remainder when 12 is divided by f? 5 Let c(y) = 6y + 2. Let b be c(2). Suppose -5i + b = -76. Calculate the remainder when i is divided by 2 + (2 + 10 - 4). 8 Suppose 0 = -0l - 3l + 66. Calculate the remainder when l is divided by 13. 9 Let a(i) = i*2 + 7. Let b = -3 + 5. What is the remainder when a(-5) is divided by (66/12)/(1/b)? 10 Suppose -5u = 0, 3u + 2u + 12 = 4o. Suppose -t + ot = 0. Calculate the remainder when (t - 2)/((-2)/32) is divided by 11. 10 What is the remainder when (-4)/18 + (-1384)/(-72) is divided by 11? 8 Let m = -111 - -162. Suppose c = m - 16. Calculate the remainder when c is divided by (1 - 2/(-6))9. 11 Let q(m) = -3m + 2. Let u be q(-6). Let a = u - 3. What is the remainder when a is divided by 10? 7 Suppose -82 = 2f + 94. Let r = f + 154. What is the remainder when r is divided by 17? 15 Suppose -4v + 154 + 222 = 0. What is the remainder when v is divided by 24? 22 Suppose 5x - 44 = 6. What is the remainder when 38 is divided by x/(3/3) + 3? 12 Let s(j) = j2 + 4j. Let q be s(3). Suppose q = 4u + 1. Calculate the remainder when 22 is divided by u. 2 Let d(u) = u + 6. Let r be d(-4). Suppose 2 = 4x - 2, rn + 2x = 110. Calculate the remainder when n is divided by 14. 12 Let a = 1 + -3. Let l = 8 + a. Let w = 5 + l. Calculate the remainder when w is divided by 6. 5 Let l(c) = 4c + 5. What is the remainder when l(4) is divided by 13? 8 Suppose -5k + 5v + 85 = -30, -5v - 1 = k. What is the remainder when k is divided by 11? 8 Suppose 31 = 2a - 69. Suppose -5j + a = -0j. What is the remainder when 17 is divided by j? 7 Let n(f) = f2 - 2. Let v be n(-2). Suppose 2o + v = 10. Suppose p - 6 = -0p. What is the remainder when p is divided by o? 2 Suppose -y - y = 8. What is the remainder when 11 is divided by (-1)/((-11)/y + -3)? 3 Suppose 3w - 14 - 55 = 0. Let d be (3 + (-18)/3)/(-1). Suppose -2y - 5a - 1 = 0, -dy + 8a + 51 = 5a. Calculate the remainder when w is divided by y. 11 Suppose 3l = -l + 8. What is the remainder when 33 is divided by (1/1)/(l/36)? 15 Suppose 0 = 4u - 91 - 109. Calculate the remainder when u is divided by -3 + 0 - (-24 - -4). 16 Let m(h) = -2h + 39. Calculate the remainder when 33 is divided by m(16). 5 What is the remainder when 35/2(-98)/(-35) is divided by 13? 10 What is the remainder when 46 is divided by (0 - (-98)/6) + 9/(-27)? 14 Suppose -58 - 22 = -4k. Suppose 4u = 66 + 170. What is the remainder when u is divided by k? 19 Suppose -4c + 4m + 168 = 0, -4c + 128 = -c - 5m. What is the remainder when c is divided by 14? 13 Let d = 188 + -113. What is the remainder when d is divided by 19? 18 Suppose -4n + 0 = -4. Let w(r) = -r*3 + 10r2 + r - 9. Calculate the remainder when w(10) is divided by n. 0 Let y(i) = i3 + 8i2 + 7i + 4. Calculate the remainder when 19 is divided by y(-7). 3 Let s(n) = -n*3 - 3n*2 + 2n. Let i be s(-5). Let d = i - 24. What is the remainder when 31 is divided by d? 15 Calculate the remainder when (4/(-4))/(1/(-65)) is divided by 17. 14 Let n be (-8)/60 - (-446)/(-30). Let j = n + 22. What is the remainder when 27 is divided by j? 6 Let i = 22 + 9. What is the remainder when i is divided by 4? 3 Suppose -9w - 2w + 308	{ "pile_set_name": "DM Mathematics" }
atest common factor of 4 and 172. 4 What is the greatest common divisor of 324 and 2889? 27 What is the greatest common divisor of 9912 and 168? 168 What is the highest common divisor of 452 and 791? 113 What is the highest common factor of 621 and 1053? 27 Calculate the greatest common factor of 513 and 135. 27 What is the highest common divisor of 8 and 11? 1 What is the highest common divisor of 614 and 1535? 307 Calculate the greatest common divisor of 144 and 368. 16 Calculate the greatest common divisor of 2028 and 468. 156 Calculate the greatest common factor of 297 and 27. 27 What is the greatest common factor of 728 and 2080? 104 What is the greatest common divisor of 4818 and 1254? 66 What is the highest common divisor of 1 and 2662? 1 Calculate the greatest common divisor of 1166 and 848. 106 Calculate the greatest common divisor of 1313 and 143. 13 What is the greatest common divisor of 12643 and 269? 269 What is the greatest common factor of 2070 and 15? 15 What is the highest common divisor of 525 and 1260? 105 What is the highest common divisor of 4 and 6268? 4 What is the highest common divisor of 9 and 7? 1 Calculate the greatest common divisor of 72 and 1344. 24 What is the highest common divisor of 108 and 99? 9 What is the highest common divisor of 135 and 45? 45 Calculate the greatest common divisor of 49 and 35. 7 What is the highest common factor of 157 and 9? 1 Calculate the highest common factor of 720 and 45. 45 What is the greatest common divisor of 12 and 279? 3 What is the greatest common factor of 1173 and 34? 17 What is the highest common divisor of 12496 and 22? 22 What is the highest common divisor of 21 and 23163? 21 Calculate the greatest common factor of 510 and 19992. 102 Calculate the highest common divisor of 3328 and 2048. 256 Calculate the highest common factor of 96 and 3. 3 What is the highest common factor of 3206 and 14? 14 What is the greatest common divisor of 25790 and 10? 10 Calculate the highest common divisor of 242 and 77. 11 What is the greatest common factor of 105 and 45? 15 What is the highest common divisor of 513 and 114? 57 What is the greatest common divisor of 156 and 8268? 156 What is the greatest common divisor of 3660 and 120? 60 Calculate the greatest common divisor of 190 and 170. 10 Calculate the highest common factor of 50 and 30. 10 Calculate the greatest common divisor of 140 and 868. 28 Calculate the highest common factor of 61 and 183. 61 Calculate the greatest common divisor of 33 and 44. 11 What is the highest common divisor of 132 and 9? 3 What is the greatest common divisor of 9248 and 136? 136 Calculate the greatest common factor of 490 and 60. 10 Calculate the greatest common factor of 10 and 2750. 10 Calculate the highest common divisor of 5648 and 16. 16 What is the greatest common factor of 30 and 18? 6 What is the greatest common factor of 2541 and 484? 121 Calculate the greatest common divisor of 365 and 584. 73 What is the greatest common factor of 176 and 539? 11 What is the greatest common factor of 364 and 168? 28 What is the highest common factor of 1032 and 264? 24 What is the highest common divisor of 1518 and 99? 33 Calculate the greatest common factor of 87 and 145. 29 What is the highest common factor of 52 and 2002? 26 What is the highest common divisor of 303 and 3? 3 What is the highest common factor of 2071 and 872? 109 What is the greatest common divisor of 36 and 9? 9 What is the highest common factor of 23883 and 57? 57 What is the greatest common divisor of 26 and 4? 2 Calculate the greatest common divisor of 9 and 1536. 3 What is the greatest common divisor of 1197 and 665? 133 What is the greatest common divisor of 11925 and 25? 25 Calculate the greatest common divisor of 80 and 32. 16 What is the highest common divisor of 34 and 3? 1 Calculate the greatest common factor of 26330 and 10. 10 Calculate the greatest common factor of 72 and 14058. 18 What is the highest common factor of 1581 and 124? 31 What is the highest common factor of 99 and 63? 9 Calculate the highest common divisor of 6 and 726. 6 Calculate the greatest common factor of 483 and 273. 21 Calculate the highest common factor of 2 and 122. 2 Calculate the highest common factor of 597 and 4577. 199 Calculate the greatest common factor of 603 and 1340. 67 Calculate the greatest common divisor of 44 and 11. 11 Calculate the highest common divisor of 21 and 91. 7 What is the greatest common factor of 1136 and 16? 16 Calculate the highest common divisor of 156 and 1222. 26 Calculate the greatest common divisor of 7 and 161. 7 Calculate the greatest common factor of 136 and 85. 17 Calculate the greatest common divisor of 15 and 95. 5 What is the greatest common divisor of 104 and 676? 52 What is the highest common divisor of 2 and 622? 2 What is the greatest common divisor of 51 and 187? 17 What is the greatest common divisor of 2212 and 56? 28 What is the greatest common divisor of 136 and 448? 8 Calculate the highest common divisor of 6579 and 43. 43 What is the highest common divisor of 360 and 310? 10 What is the greatest common divisor of 1012 and 1144? 44 Calculate the highest common divisor of 72 and 300. 12 What is the highest common divisor of 25 and 9? 1 Calculate the highest common factor of 171 and 19. 19 What is the greatest common factor of 258 and 18? 6 Calculate the greatest common factor of 3082 and 335. 67 What is the highest common factor of 116 and 35264? 116 What is the greatest common divisor of 340 and 10268? 68 What is the highest common divisor of 303 and 20806? 101 What is the greatest common divisor of 915 and 30? 15 Calculate the greatest common factor of 21 and 175. 7 What is the highest common divisor of 3440 and 320? 80 Calculate the highest common factor of 114 and 133. 19 Calculate the greatest common divisor of 255 and 2190. 15 Calculate the highest common divisor of 1410 and 30. 30 Calculate the highest common factor of 533 and 41. 41 What is the greatest common divisor of 12 and 114? 6 What is the greatest common divisor of 20 and 540? 20 What is the highest common factor of 184 and 4? 4 Calculate the highest common factor of 10 and 33140. 10 What is the highest common divisor of 55944 and 296? 296 Calculate the greatest common factor of 2025 and 375. 75 What is the greatest common factor of 18 and 186? 6 What is the highest common divisor of 3300 and 5? 5 What is the greatest common factor of 3186 and 118? 118 Calculate the highest common divisor of 1072 and 1273. 67 Calculate the greatest common divisor of 753 and 14056. 251 What is the highest common factor of 1192 and 8? 8 Calculate the greatest common factor of 18 and 102. 6 What is the greatest common factor of 126 and 252? 126 What is the greatest common factor of 45 and 9555? 15 Calculate the greatest common divisor of 256 and 12. 4 Calculate the greatest common factor of 130 and 26. 26 What is the highest common divisor of 32 and 1336? 8 What is the greatest common factor of 29 and 5771? 29 What is the greatest common factor of 3730 and 20? 10 What is the greatest common factor of 355 and 1917? 71 What is the highest common divisor of 33 and 11? 11 What is the greatest common divisor of 342 and 266? 38 What is the greatest common divisor of 8998 and 22? 22 Calculate the greatest common factor of 178 and 534. 178 What is the highest common divisor of 33 and 2673? 33 Calculate the highest common divisor of 11 and 85327. 11 Calculate the highest common divisor of 27 and 225. 9 What is the highest common factor of 2424 and 288? 24 Calculate the highest common factor of 6875 and 55. 55 What is the greatest common factor of 2244 and 132? 132 Calculate the highest common factor of 2 and 94. 2 What is the greatest common factor of 289 and 68? 17 What is the greatest common divisor of 92 and 8? 4 Calculate the greatest common factor of 24 and 156. 12 What is the greatest common divisor of 2666 and 62? 62 Calculate the highest common divisor of 66 and 12. 6 Calculate the highest common divisor of 493 and 17. 17 What is the greatest common factor of 6 and 21? 3 Calculate the highest common factor of 180 and 120. 60 What is the greatest common divisor of 637 and 140? 7 Calculate the greatest comm	{ "pile_set_name": "DM Mathematics" }
4? 33 What is the remainder when 329 is divided by 81? 5 Calculate the remainder when 465 is divided by 162. 141 What is the remainder when 137 is divided by 105? 32 Calculate the remainder when 52 is divided by 7. 3 What is the remainder when 2770 is divided by 66? 64 Calculate the remainder when 238 is divided by 15. 13 Calculate the remainder when 149 is divided by 46. 11 Calculate the remainder when 187 is divided by 32. 27 Calculate the remainder when 1104 is divided by 27. 24 Calculate the remainder when 3302 is divided by 14. 12 What is the remainder when 250 is divided by 22? 8 What is the remainder when 17196 is divided by 117? 114 Calculate the remainder when 284 is divided by 58. 52 What is the remainder when 59 is divided by 12? 11 Calculate the remainder when 2097 is divided by 68. 57 Calculate the remainder when 1489 is divided by 186. 1 What is the remainder when 1832 is divided by 19? 8 What is the remainder when 10661 is divided by 820? 1 What is the remainder when 449 is divided by 23? 12 Calculate the remainder when 5213 is divided by 93. 5 Calculate the remainder when 1533 is divided by 64. 61 Calculate the remainder when 253 is divided by 250. 3 What is the remainder when 522 is divided by 112? 74 What is the remainder when 6187 is divided by 9? 4 Calculate the remainder when 1444 is divided by 310. 204 Calculate the remainder when 2686 is divided by 53. 36 Calculate the remainder when 171 is divided by 33. 6 What is the remainder when 744 is divided by 16? 8 What is the remainder when 209 is divided by 47? 21 What is the remainder when 253 is divided by 47? 18 Calculate the remainder when 745 is divided by 250. 245 What is the remainder when 12 is divided by 8? 4 Calculate the remainder when 114 is divided by 48. 18 Calculate the remainder when 415 is divided by 70. 65 What is the remainder when 57 is divided by 51? 6 What is the remainder when 15051 is divided by 6? 3 What is the remainder when 861 is divided by 213? 9 What is the remainder when 102 is divided by 69? 33 What is the remainder when 125 is divided by 84? 41 Calculate the remainder when 572 is divided by 48. 44 Calculate the remainder when 55 is divided by 26. 3 Calculate the remainder when 32883 is divided by 18. 15 Calculate the remainder when 1113 is divided by 361. 30 Calculate the remainder when 822 is divided by 404. 14 Calculate the remainder when 75 is divided by 44. 31 Calculate the remainder when 3940 is divided by 1311. 7 Calculate the remainder when 1139 is divided by 15. 14 What is the remainder when 5605 is divided by 8? 5 What is the remainder when 945 is divided by 86? 85 What is the remainder when 239 is divided by 24? 23 Calculate the remainder when 55 is divided by 5. 0 Calculate the remainder when 307 is divided by 22. 21 Calculate the remainder when 1082 is divided by 7. 4 What is the remainder when 1093 is divided by 79? 66 Calculate the remainder when 888 is divided by 4. 0 Calculate the remainder when 127 is divided by 17. 8 Calculate the remainder when 801 is divided by 26. 21 Calculate the remainder when 5049 is divided by 840. 9 What is the remainder when 29466 is divided by 139? 137 What is the remainder when 2768 is divided by 232? 216 What is the remainder when 133 is divided by 9? 7 What is the remainder when 167 is divided by 5? 2 Calculate the remainder when 2361 is divided by 84. 9 Calculate the remainder when 381 is divided by 357. 24 What is the remainder when 217 is divided by 73? 71 What is the remainder when 354 is divided by 94? 72 What is the remainder when 2748 is divided by 153? 147 Calculate the remainder when 15829 is divided by 377. 372 Calculate the remainder when 449 is divided by 113. 110 What is the remainder when 141 is divided by 29? 25 What is the remainder when 6134 is divided by 99? 95 What is the remainder when 431 is divided by 48? 47 Calculate the remainder when 83 is divided by 16. 3 What is the remainder when 5 is divided by 3? 2 Calculate the remainder when 2843 is divided by 219. 215 Calculate the remainder when 131 is divided by 78. 53 What is the remainder when 2314 is divided by 10? 4 Calculate the remainder when 182 is divided by 62. 58 Calculate the remainder when 356 is divided by 121. 114 Calculate the remainder when 1708 is divided by 337. 23 Calculate the remainder when 266 is divided by 30. 26 What is the remainder when 1218 is divided by 400? 18 What is the remainder when 5 is divided by 5? 0 What is the remainder when 463 is divided by 33? 1 What is the remainder when 543 is divided by 21? 18 What is the remainder when 68 is divided by 18? 14 What is the remainder when 23390 is divided by 16? 14 Calculate the remainder when 1340 is divided by 92. 52 Calculate the remainder when 2007 is divided by 100. 7 What is the remainder when 84 is divided by 45? 39 Calculate the remainder when 56 is divided by 42. 14 What is the remainder when 930 is divided by 19? 18 What is the remainder when 3766 is divided by 4? 2 What is the remainder when 205 is divided by 23? 21 Calculate the remainder when 157 is divided by 27. 22 What is the remainder when 678 is divided by 99? 84 What is the remainder when 326 is divided by 8? 6 Calculate the remainder when 434 is divided by 19. 16 What is the remainder when 2805 is divided by 108? 105 Calculate the remainder when 179 is divided by 59. 2 What is the remainder when 443 is divided by 74? 73 What is the remainder when 53 is divided by 7? 4 What is the remainder when 6263 is divided by 6? 5 What is the remainder when 81 is divided by 31? 19 Calculate the remainder when 341 is divided by 110. 11 What is the remainder when 6749 is divided by 15? 14 Calculate the remainder when 98 is divided by 9. 8 What is the remainder when 276 is divided by 111? 54 Calculate the remainder when 81 is divided by 54. 27 Calculate the remainder when 1028 is divided by 10. 8 What is the remainder when 2954 is divided by 373? 343 What is the remainder when 7190 is divided by 58? 56 What is the remainder when 2699 is divided by 76? 39 Calculate the remainder when 940 is divided by 29. 12 Calculate the remainder when 1702 is divided by 13. 12 What is the remainder when 339 is divided by 20? 19 What is the remainder when 624 is divided by 617? 7 Calculate the remainder when 627 is divided by 207. 6 What is the remainder when 343 is divided by 84? 7 What is the remainder when 43 is divided by 2? 1 What is the remainder when 575 is divided by 72? 71 Calculate the remainder when 269 is divided by 51. 14 Calculate the remainder when 75 is divided by 42. 33 What is the remainder when 482 is divided by 44? 42 Calculate the remainder when 132 is divided by 26. 2 Calculate the remainder when 42 is divided by 14. 0 What is the remainder when 170 is divided by 89? 81 What is the remainder when 466 is divided by 157? 152 Calculate the remainder when 1751 is divided by 65. 61 What is the remainder when 1381 is divided by 122? 39 What is the remainder when 71 is divided by 22? 5 What is the remainder when 2328 is divided by 7? 4 What is the remainder when 959 is divided by 30? 29 Calculate the remainder when 153 is divided by 11. 10 Calculate the remainder when 90 is divided by 70. 20 What is the remainder when 38350 is divided by 94? 92 Calculate the remainder when 524 is divided by 17. 14 What is the remainder when 90 is divided by 72? 18 What is the remainder when 95 is divided by 25? 20 Calculate the remainder when 1128 is divided by 162. 156 What is the remainder when 2065 is divided by 1013? 39 What is the remainder when 152 is divided by 14? 12 Calculate the remainder when 295 is divided by 27. 25 Calculate the remainder when 276 is divided by 115. 46 What is the remainder when 204 is divided by 27? 15 Calculate the remainder when 106 is divided by 32. 10 Calculate the remainder when 281 is divided by 11. 6 What is the remainder when 581 is divided by 216? 149 Calculate the remainder when 959 is divided by 32. 31 What is the remainder when 297 is divided by 77? 66 What is the remainder when 2322 is divided by 25? 22 What is the remainder when 1900 is divided by 112? 108 What is the remainder when 27507 is divided by 23? 22 What is the remainder when 1246 is divided by 618? 10 Calculat	{ "pile_set_name": "DM Mathematics" }
by b? 17 Suppose q - 6m + 4m = 18, 2m = -33q + 526. Calculate the remainder when 4473 is divided by q. 9 Let q = 151 - -69. Calculate the remainder when q is divided by (-1 - 2) + (2 - -38). 35 Let b = 14 + 26. Let l = 42 - b. Suppose -64 = -3f - f + lc, -3c + 12 = 0. Calculate the remainder when f is divided by 10. 8 Suppose 3c + c - 143 = -5p, 2c = -6. Let j(b) = 4b2 + 4b - 15. Let w be j(-7). Suppose -wm + 152m = -7. What is the remainder when p is divided by m? 3 Let z(h) = 38h - 14. Let s be z(2). Suppose m - 2o = 3, 2m - 7m - 5o + 75 = 0. Calculate the remainder when (s/(-8))/(2/(-8)) is divided by m. 9 Suppose 0 = -15i + 11i + 12. Suppose -id = -2d + b - 52, -5d = -3b - 268. Let y = -48 + d. Calculate the remainder when y is divided by 3. 2 Suppose -1881 = -8w - 409. Let v = w - 169. What is the remainder when (1 - (-2 - -2))27 is divided by v? 12 Suppose -7v = 11v - 277 - 47. Calculate the remainder when 1366 is divided by v. 16 Let b(w) = 72w*2 - 2w - 3. Calculate the remainder when b(-2) is divided by 17/(510/12) - 10143/(-105). 95 Suppose -4h + 5w + 905 = -h, 0 = -3h - w + 881. Suppose -5t + h = d, -2t + 13 + 105 = 3d. Calculate the remainder when t is divided by 15. 14 Suppose -39 = -2q + 3u - 12, 5 = -u. Suppose -2n + 56 = 3y - q, -3y = -12. Suppose 0 = p - 9 - 4. Calculate the remainder when n is divided by p. 12 Let s(g) = -g3 - 5g*2 + 23g + 223. What is the remainder when s(-6) is divided by 47? 27 Let x = -200523 - -200556. Let w = 395 + -261. What is the remainder when w is divided by x? 2 Suppose 18 = 5k - 122. Let z(q) = q2 - 18q + 69. Let n(y) = -y*2 - 5y + 26. Let p be n(-6). What is the remainder when z(p) is divided by k? 25 Suppose 949 = 5y + 2n + 374, -493 = -4y + 5n. Suppose 22o = 18o - 744. Calculate the remainder when y is divided by 2/(-4 - o/45). 12 Let j(f) = -f*2 - 23f - 100. Let r be j(-16). Let q = r + 666. What is the remainder when q is divided by 62? 58 Let p = 1462 + -1448. Calculate the remainder when 78 is divided by p. 8 Suppose -39n = -42n + 3717. What is the remainder when n is divided by 54? 51 Let j be 105 + 0/(-12) + 1-2. Let g = -82 + j. What is the remainder when g is divided by 13 + ((-4)/(-3) - 169/39)? 1 Calculate the remainder when -61422/(-64) + 46/736 is divided by ((-1 - -1) + 15)1. 12 Let w = 275 - 696. Let u = -404 - w. Calculate the remainder when 33 is divided by u. 16 Let p(d) = 8d*2 + 158d - 24. What is the remainder when 367 is divided by p(-20)? 15 Suppose 0z + 3t = 2z - 1, -2z - t = -5. Suppose -3w = -3x - 93, -5w - zx + 113 + 21 = 0. What is the remainder when 276 is divided by w? 24 Suppose 7r = 10r + 15. Let b(v) = 13v. What is the remainder when b(1) is divided by (r - -3)(-3)/2? 1 Suppose -y + 85 = 30. Suppose 5t - y = -5c, 0 = -3c + 2t - 7 + 45. Let p = 185 + -114. Calculate the remainder when p is divided by c. 11 Let x(y) = y2 - y + 31. Let n = -76 + 91. What is the remainder when x(-6) is divided by n? 13 Let g(t) = t3 + 2t2 + 2t - 3. Let u(q) = 9q2 + 210q + 895. What is the remainder when u(-18) is divided by g(2)? 14 Let k = 56 - 39. Let a = -295 + 311. Suppose -p + 3r + 4 = 0, r + a = 2p + 3r. What is the remainder when k is divided by p? 3 What is the remainder when ((-26)/(-3) - 1)/((-120)/(-40680)) is divided by 19? 15 Let q(r) be the third derivative of r6/120 - 7r5/60 - r4/3 - 2r3/3 - 8r*2. Let g be q(8). What is the remainder when (-12)/1570/g is divided by 4? 2 Suppose 2681 = 8g - g. Let t = g + -154. What is the remainder when t is divided by 46? 45 Suppose 2t - 28 = 3z, 0 = 4t - 0t + 4z - 16. Let p(q) = 6q - 43. Suppose 3 = -3o + 54. What is the remainder when o is divided by p(t)? 2 Let o = 12903 + -12734. What is the remainder when o is divided by 39? 13 Suppose -130 = -594d + 581d. What is the remainder when 5439 is divided by d? 9 Suppose 6l - 24158 - 11392 = 0. Calculate the remainder when l is divided by 49. 45 Let o = -102 - -498. Suppose -4m + k + 57 = 0, 3m = -m - 2k + 54. Calculate the remainder when (-130)/(-6) + -12(-11)/o is divided by m. 8 Let k(z) = -27z*2 - 11 + 44z*2 + 5z + 3. Calculate the remainder when k(3) is divided by 7. 6 Suppose 295s - 274 = 174s + 75230. What is the remainder when 1268 is divided by s? 20 Let x be 3 - (2/(-2))/1. Let m(c) = 6c2 - 29c - 90. What is the remainder when m(-3) is divided by x/(-10) - 94/(-10)? 6 Let n(x) = 14x3 - 9x*2 + 14x + 7. What is the remainder when n(3) is divided by 32? 26 Suppose -4r + 4x + 16040 = 0, 3r - 13390 = -2x - 1390. What is the remainder when r is divided by 18? 8 Suppose 11m - 464 = 3m. Let s = m + -42. What is the remainder when 464/5 - (-2)/10 is divided by s? 13 Suppose 0 - 3 = -i. Suppose 0 = -5w + iw - l + 273, -5w + 4l = -715. Calculate the remainder when w is divided by 71. 68 Let u be 2/(16/2)40. Calculate the remainder when 75 is divided by 432/10 + u/((-650)/13). 32 Let f = -186 + 357. What is the remainder when f is divided by 29? 26 Suppose 990 = z - 12z. Let q = -79 - z. Let g(d) = -15d - 9. Calculate the remainder when g(-2) is divided by q. 10 Let f = 3 + 5. Suppose -420 = 2q - fq. Let z = q + 27. What is the remainder when z is divided by 20? 17 Let k(x) = x3 + 3x*2 - 8x + 3. Let u be (17/(-21) - (-22)/154)6. What is the remainder when 36 is divided by k(u)? 17 Let h = -4864 + 6122. What is the remainder when h is divided by 42? 40 Suppose 4 = -10x + 11x. Suppose 0 = xa + f - 35, -3f - 5 = -3a + 40. Suppose 0z = -2z + 14. What is the remainder when a is divided by z? 3 Suppose i - 304 = 5i. Let r = 113 + i. Suppose h = r + 72. Calculate the remainder when h is divided by 16. 13 Let w(u) = 18u*2 - 30u + 121. What is the remainder when w(5) is divided by 416? 5 Let f = -5660 + 6045. What is the remainder when f is divided by 57? 43 Let p = 19 - -26. Let u = 1399783 + -1399738. Calculate the remainder when u is divided by p. 0 Calculate the remainder when 4640/3090/24 is divided by 135. 40 Suppose 3s - 17 = -3k + 139, 3k - 204 = -4s. Suppose o - 111 + 23 = 0. What is the remainder when s is divided by (o/(-20) + (-12)/20)-4? 8 Let d(p) = -14p + 129. What is the remainder when d(-15) is divided by 114? 111 Suppose 108 = 29l - 11l. Suppose 0c = -7c + 119. Suppose 15p - cp = -22. What is the remainder when p is divided by l? 5 Let k(y) = 4y*2 + 29y + 89. Calculate the remainder when 660 is divided by k(-6). 11 Let s(y) = 3y2 + 75y - 943. Calculate the remainder when s(13) is divided by 34. 29 Suppose -170o - 48776 = -204o + 35442. Calculate the remainder when o is divided by 37. 35 Let y = 4 + -1. Let i(v) = -6v2 + 14v + 62. Calculate the remainder when i(0) is divided by y. 2 Let h(m) = 2m3 - 179m*2 + 265m - 5. What is the remainder when 313 is divided by h(88)? 64 Suppose -4r = 2v - 2 - 6, 0 = -2v - 2r + 8. Suppose v = h, -3h - 139 = -5i - 26. Let w = -1301 + 1305. Calculate the remainder when i is divided by w. 1 Suppose -r = -6r, -c = 115r - 110r - 122. What is the remainder when 1340 is divided by c? 120 Let c = -531 - -553. Suppose cs - 5275 = 1215. Calculate the remainder when s is divided by 13. 9 Let t(q) = 6q - 8. Let n be t(5). Let f = 71 - n. Let l = 35 + f. What is the remainder when l is divided by 17? 16 Let b be 171/5 + 136/(-340). Calculate the remainder when ((-174)/(-9) - 7)/(1/b) is divided by 20. 17 Suppose 4j + 2o = 3o + 709, 2o = -2j + 352. Suppose -5u + 2f + j = 36, 3 = -f. Calculate the remainder when (-48)/8(-424)/24 is divided by u. 25 Suppose -709t = -656t - 14310. What is the remainder when t is divided by 262? 8 Let y(p) = -2p2 - 13p - 13. Let v = -86 - -81. Let x be y(v). Suppose -11s = xs - 260. What is the remainder when 76 is divided by s? 16 Suppose 9r - 156 = -3r. Let o(v) = 4v - 47. What is the remainder when o(17) is divided by r? 8 Let i(d) = d3 + 12d*2 + 12d + 19. Let s be i(-7). Suppose 146 = -17p + s. What is the remainder when 45 is divided by p? 1 Let a = -6830 + 6842. What is the remainder when 377 is divided by a? 5 Let n be 0 + 30/8 + 93/372. Suppose -3p + 431 = nd, -5p + d + 7	{ "pile_set_name": "DM Mathematics" }
s? -0.12 What is 0.0000449425 rounded to six dps? 0.000045 Round 571.608 to the nearest one hundred. 600 What is -0.10486174 rounded to 3 decimal places? -0.105 What is -0.000156127 rounded to 7 decimal places? -0.0001561 What is -1296.856 rounded to the nearest one hundred? -1300 Round -18853100 to the nearest ten thousand. -18850000 Round -2335378000 to the nearest 1000000. -2335000000 Round 1267811.9 to the nearest 100000. 1300000 Round -0.11452746 to 3 decimal places. -0.115 Round -0.89283714 to four decimal places. -0.8928 Round -1.782666 to three dps. -1.783 Round -5.282678 to the nearest integer. -5 Round -0.377786 to three dps. -0.378 Round 1.853483 to the nearest integer. 2 What is -6.354523 rounded to 1 decimal place? -6.4 What is 4443.161 rounded to the nearest ten? 4440 Round 21.837 to the nearest 10. 20 What is 9.2981 rounded to 0 decimal places? 9 Round 56444.37 to the nearest 10000. 60000 Round -0.00005957635 to five dps. -0.00006 Round 0.0070279316 to 4 decimal places. 0.007 Round 0.946 to one dp. 0.9 What is 4671010 rounded to the nearest one hundred thousand? 4700000 Round -278103000 to the nearest one million. -278000000 What is -275.6556 rounded to one dp? -275.7 What is 0.0000005484168 rounded to seven dps? 0.0000005 What is -0.00001940074 rounded to 7 dps? -0.0000194 Round -59453970 to the nearest 100000. -59500000 Round -0.000000531258 to 7 decimal places. -0.0000005 What is -1639.109 rounded to the nearest 100? -1600 Round 0.4193856 to 3 dps. 0.419 What is -4278640 rounded to the nearest 10000? -4280000 What is -0.00000228513 rounded to seven decimal places? -0.0000023 Round -0.0012002398 to five decimal places. -0.0012 Round 0.001846301 to six decimal places. 0.001846 What is -99507960 rounded to the nearest 100000? -99500000 What is 0.005361624 rounded to six decimal places? 0.005362 What is 54.66015 rounded to the nearest 10? 50 What is 30.67897 rounded to the nearest integer? 31 What is -1.199288 rounded to 2 dps? -1.2 What is -297226.57 rounded to the nearest ten thousand? -300000 Round 5988.19 to the nearest one hundred. 6000 Round -1252.3689 to the nearest ten. -1250 What is -276207100 rounded to the nearest 100000? -276200000 What is 1713.45 rounded to zero dps? 1713 Round 0.0000036372 to seven decimal places. 0.0000036 What is 1129.839 rounded to 0 dps? 1130 What is -0.0000001839 rounded to seven dps? -0.0000002 Round -85.8464 to the nearest 10. -90 What is 85155700 rounded to the nearest 1000000? 85000000 Round -47.3008 to the nearest integer. -47 What is 14.88412 rounded to the nearest integer? 15 Round 0.0004132734 to 5 decimal places. 0.00041 Round -13152902 to the nearest one million. -13000000 What is -111489600 rounded to the nearest 100000? -111500000 What is -26677.4 rounded to the nearest 10? -26680 What is -0.00407672 rounded to 4 dps? -0.0041 Round -26382.741 to the nearest one hundred. -26400 Round -188.9694 to the nearest 100. -200 Round 4294265.2 to the nearest 1000. 4294000 What is -18903.9 rounded to the nearest 1000? -19000 What is -0.000553522 rounded to 5 decimal places? -0.00055 What is 0.37456193 rounded to 2 decimal places? 0.37 Round 109859000 to the nearest 100000. 109900000 What is 345569.5 rounded to the nearest 10000? 350000 Round -0.0457183 to 4 dps. -0.0457 Round -0.0004790409 to five dps. -0.00048 Round 162622.89 to the nearest ten. 162620 What is 28737.9 rounded to the nearest one hundred? 28700 What is -0.5198849 rounded to one decimal place? -0.5 What is -0.531634 rounded to 1 dp? -0.5 What is 10553.002 rounded to the nearest ten? 10550 Round 0.000111228 to 4 dps. 0.0001 What is 7.4804 rounded to zero dps? 7 Round 15283957 to the nearest 10000. 15280000 Round 0.0371651 to 3 decimal places. 0.037 What is -0.000342796 rounded to 5 dps? -0.00034 What is -0.00079355811 rounded to 5 decimal places? -0.00079 What is 287.042 rounded to the nearest 100? 300 What is -0.00039332 rounded to four dps? -0.0004 What is -274987.37 rounded to the nearest one hundred? -275000 What is -6224.0108 rounded to the nearest ten? -6220 Round -62.1995 to 1 dp. -62.2 What is -0.085047452 rounded to 3 decimal places? -0.085 Round 0.0737374 to 4 decimal places. 0.0737 What is 0.000003307128 rounded to 7 dps? 0.0000033 What is -4080031000 rounded to the nearest one million? -4080000000 What is -1061981 rounded to the nearest ten thousand? -1060000 Round 7457.48 to the nearest ten. 7460 Round -797.0172 to the nearest 100. -800 Round -2.444049 to one dp. -2.4 Round -112.11951 to one dp. -112.1 What is -0.0155366 rounded to two dps? -0.02 Round -5.8678409 to 2 dps. -5.87 What is -12886.467 rounded to zero dps? -12886 What is 86333812 rounded to the nearest 1000000? 86000000 What is 0.0644354 rounded to 4 dps? 0.0644 Round -0.00799954 to 5 decimal places. -0.008 What is 0.00067677 rounded to 4 decimal places? 0.0007 What is 4764.496 rounded to the nearest integer? 4764 Round 0.0010744036 to 4 dps. 0.0011 What is 0.0003629938 rounded to five dps? 0.00036 What is -0.0000001328608 rounded to 7 decimal places? -0.0000001 Round -0.00000406296 to 7 decimal places. -0.0000041 Round 171.354 to the nearest 10. 170 Round 0.0000758201 to 7 decimal places. 0.0000758 What is 0.000001685287 rounded to seven dps? 0.0000017 Round 0.0000003194346 to seven decimal places. 0.0000003 Round 17576.33 to the nearest ten. 17580 Round -0.01698845 to four decimal places. -0.017 What is -1.539507 rounded to three decimal places? -1.54 Round -16.1829587 to 3 decimal places. -16.183 Round 33036310 to the nearest one million. 33000000 What is 6603185 rounded to the nearest 10000? 6600000 Round 6360.828 to the nearest 100. 6400 Round -81733.7 to the nearest 100. -81700 Round 507118 to the nearest 1000. 507000 Round -0.000374492 to six decimal places. -0.000374 What is -65480.38 rounded to the nearest one hundred? -65500 Round -76.1687 to 1 decimal place. -76.2 What is 0.0453576 rounded to 4 dps? 0.0454 Round -0.7098856 to four dps. -0.7099 Round 80.626 to 1 decimal place. 80.6 What is 11.80505 rounded to 1 dp? 11.8 What is -99.688 rounded to the nearest ten? -100 What is 0.00749235 rounded to 6 dps? 0.007492 Round -0.0006129348 to 5 decimal places. -0.00061 What is 42314.2 rounded to the nearest 10000? 40000 What is -7.23691 rounded to zero decimal places? -7 What is 0.0010328902 rounded to six decimal places? 0.001033 Round 0.0003736944 to 4 dps. 0.0004 What is 237509.19 rounded to the nearest one hundred? 237500 Round 28.488771 to 2 dps. 28.49 Round -1.214057 to 2 dps. -1.21 What is 822104100 rounded to the nearest 1000000? 822000000 What is -591775000 rounded to the nearest one million? -592000000 What is 0.00462412 rounded to 3 decimal places? 0.005 What is -0.000334153 rounded to five decimal places? -0.00033 Round -0.000019520263 to six dps. -0.00002 What is 33588.14 rounded to the nearest one thousand? 34000 Round 0.0776423 to two decimal places. 0.08 What is -332871100 rounded to the nearest one hundred thousand? -332900000 Round -0.00630021 to 3 decimal places. -0.006 What is -813.3435 rounded to the nearest one hundred? -800 What is -0.6535477 rounded to 1 decimal place? -0.7 Round -53769000 to the nearest one million. -54000000 Round -89424.85 to the nearest one thousand. -89000 Round 3.121589 to 1 dp. 3.1 What is -26290910 rounded to the nearest 100000? -26300000 Round -5138.43 to the nearest one hundred. -5100 Round -82744.08 to the nearest 1000. -83000 Round -0.000060460886 to five dps. -0.00006 What is -6818.301 rounded to the nearest one thousand? -7000 What is -6090139 rounded to the nearest 100000? -6100000 Round 311.1431 to 1 decimal place. 311.1 What is 116.2435 rounded to one decimal place? 116.2 Round 30835700 to the nearest one hundred thousand. 30800000 Round 0.000956521 to 6 dps. 0.000957 Round -0.0000249075 to six dps. -0.000025 What is -0.1181372 rounded to four dps? -0.1181 What is -6.84406 rounded to two dps? -6.84 Round -4.654311 to the nearest integer. -5 Round -5943.9364 to the nearest one thousand. -6000 What is 268780 rounded to the nearest one hundred thousand? 300000 Round -0.00000249022 to seven decimal places. -0.0000025 What is 810902000 rounded to the nearest one million? 811000000 What is -144997	{ "pile_set_name": "DM Mathematics" }
Expand (-2 + 1 + 0)(-1 + 1 + 8t)((4 - 3 + 0)(2t - 4t + 4t) + 3t - t + 0t). -32t*2 Expand (10j + 4j2 - 10j)(2 - 2 - j3). -4j*5 Expand (1 - 4 - 2)(-4d3 + 2d*4 + 4d*3). -10d*4 Expand (2u - 5u + u)(-3 - 2 + 3) - 2u - 3u + 3u - 4 + 4 - u - 3u + 2u - 3u. -3u Expand ((-2 + 5 - 2)(6v - 2v - 2v) - 2v + v + 0v)(0v + 0v - v2). -v3 Expand -4z + 5z + 0z + (3 - 1 - 4)(-3 + z + 3) + (0 + 0 + 1)(z + 2z - 5z) + 2 - 2 - 4z. -7z Expand (-5 + 4 - 6)(-5p2 - 2p*4 + 5p*2). 14p*4 Expand (-3y2 - y2 + 2y2)(-9 - 5 + 0 + (-4 - 3 + 5)(2 - 1 + 1)). 36y*2 Expand (-5u + 4u + 2u)(-7 - 5 - 3). -15u Expand 3s2 - 5s + 5s - s2 - 2s*2 + 2s*2 + (2 - 2s - 2)(-8s + 2s + 2s). 10s2 Expand (-4 - 2 - 160j*2 + 159j*2)(-j*2 + 2j + 3j2 - j). -2j4 - j3 - 12j2 - 6j Expand (1 - 1 - 5)(-5t*2 + 4t - 4t). 25t*2 Expand (2i3 - i3 - 2i3)(-5i2 - 24 + 24 + 63i*2). -58i5 Expand (-n5 + n5 + n5)(1 + 0 - 2)(4 - 2 - 1). -n*5 Expand (o + 0 + 0)((2o - 4o + 0o)(-3 - 1 + 2) + 2o - 2 + 2 + 2o - 2o + 2o - 2o + 4o - o + 0 + o + 0)(-3 + 1 + 1). -10o*2 Expand (-7q*4 + 2q - 2q)(2 + 1 + 3). -42q4 Expand (w + w2 + 0w*2 - 3w*2)(-w*3 + 0w*3 - 7w*3). 16w*5 - 8w*4 Expand -13t*4 + 1 - 1 + 0t + t*4 + 0t + (-2t4 + 3t*4 + 0t*4)(-5 + 5 - 2). -14t4 Expand (6 + 11 - 15)(-1 + 4 + 1 - 2l). -4l + 8 Expand (2g + 2g - 3g)(-1 - 4g + 3g + 0g). -g2 - g Expand -52 + 52 + 9f*3 + (0 + 2 - 3)(-2f3 - 4f*3 + 5f*3). 10f*3 Expand (5b - 4b + 9 - 3b)(-3 - 1 + 3)(-3b + 3b + b). 2b2 - 9b Expand 5o2 + 2 + o2 - 2o*2 + (2o - 5o + o)(-2 + o + 2). 2o2 + 2 Expand (6 - 3 - 5)(q + 0q - 7q)(2q + 0q - 3q). -12q2 Expand (8 + 0 - 1)(2r - 1 + 1). 14r Expand ((o - o - o)(2o*2 - 2o*2 + 2o*2) - 6 + 4o*3 + 6)((1 - 2 - 1)(0o + 2o + 0o) + 1 - 1 - 2o). -12o*4 Expand (1 - 2 - 2 + 3s)(2s*3 - 3s + 3s). 6s*4 - 6s*3 Expand (0c2 - c2 + 0c2)(2 + 0 - 3) + (0c + 2c + 0c + (2 + 2 - 5)(4c - 3c - 3c) + 2c - 2 + 2 - 4c + 0c - 4c)(-5c + c + 2c). 5c2 Expand (11l*3 - 108l + 108l)(-3l2 + l2 + 4l*2). 22l*5 Expand (2x - 3 + 3)(-2 + 3 - 3) - 3x + 0 + 0 - 3x + 0 + 0x - 3. -10x - 3 Expand (128w - 63w - 69w)(-2 - 2 + 2). 8w Expand (-20j3 + 6j*3 - 70j*3)(0j + 2j*2 + 0j). -168j5 Expand (-5b + 5b - 3b)(0b*3 - 2b*3 + 3b*3) + (6b*3 + 0b*3 - 4b*3)(-3 + 3 + 2b) + 3b - 3b + 5b*4. 6b*4 Expand (-5i + 56 - 56)(2i - 2i + 3i*3). -15i*4 Expand (-2i*2 - 2i*2 + 2i2 - i2 + 0i2 - i2 + 2i2 + i2 - 2i2 + (0i2 + i2 + i*2)(2 + 4 - 4))(0i + 2i - i) + 5i*3 - 3i + 3i. 6i*3 Expand (-2m*3 + 0m*3 + 4m*3)(3m2 + 2m - 2m) + (0m + 2m - 3m)(-4m*4 + 6m4 - m4) + 4m5 + m3 - m3. 9m*5 Expand -2p*4 - 3p*4 - 4p*4 + (2 - 2 + 2)(-p + p - 2p4) + (2p*4 + 0p*2 + 0p*2)(-2 - 2 + 5). -11p4 Expand (5n - 6n + 6n)(4 - 3 + 5). 30n Expand (4 - 4 + 4)(0a + 2a + 0a) - 1 - 1 + 11a - 10a. 9a - 2 Expand (-3w + 0w + w)(7 + 8 - 11)(w - 4w + w). 16w2 Expand (f - 2 + 2)(-21f2 + 6f*2 + 11f*2 + 3f*3). 3f*4 - 4f*3 Expand (-2l*2 + 0l + 0l)(-1 + 0 + 3)(l + 3l - l)(-5 + 2 - 1). 48l*3 Expand (4r - 2r2 - 4r)(7r - 6 + 6) + 2r3 - r3 + 0r*3 + r + 2r*3 - r + (0r*3 + 2r*3 - 3r*3)(-1 - 1 + 0). -9r3 Expand (0 + p + 0)(4p3 + 0p3 - p3) - p - p*4 + p + (-5p + 3p2 + 5p)(-2p*2 + 3p*2 - 3p*2). -4p*4 Expand (-3u*4 - 4u*4 + 6u*4)(2u + 4 - 3 + 29u). -31u5 - u4 Expand (0z*4 + 2z*4 - 4z*4)(1 + 2 - 1). -4z4 Expand (-6f + 2f + 0f)(-6f*3 - 4f + 0f3 + 7f*3). -4f*4 + 16f*2 Expand (3r*2 + 0r*2 + 0r*2)((4 - 4 - 2r)(-5r + 4r + 0r) + (-1 + 2 + 1)(0r2 - r2 - r2)). -6r*4 Expand ((39 - 92 + 40)(-2w3 + 2w3 - w3) + 3w3 - w3 - w3)(11w2 - w2 - w2). 126w*5 Expand (-r + 4 - 4)(5r - 6r + 5r)(-r + r*2 + r + 2r*2 - 3r*2 + 3r2 + (r2 - 2r + 2r)(-1 + 0 + 3) - r + 6r*2 + r). -44r*4 Expand -n + 0 + 0 + (0 + 3 - 4)(n + n - 3n) + 20n + 12n - 9n. 23n Expand -t + t - t3 + 6t*3 - 35t + 35t + (-t + 4 - 4)(-2t2 + 2t2 + t2). 4t3 Expand (1 + 2 - 4)(-8m + 0m + 3m). 5m Expand -3d2 + 2d*2 + 3d*2 + (-2d - 3d + 4d)(-6d + 4d + 0d) + d - 2d2 - d + 3 - 3 - d2. d2 Expand (-3k + 2k + 0k)(1 + 2k - 1)(-6 - 2 + 3) + 4k*2 - 3k*2 + 2k*2. 13k*2 Expand (-15 + 1 + 6)(-2s3 - 1 + 1)(4s2 + 0s*2 - 2s*2). 32s*5 Expand ((0b - 3b + 2b)(4 - 4 - b) + (1 - 4 + 1)(44 - 1 + 15)(3 - 3 + 2b*2))(-5b - b2 + 5b). 231b4 Expand ((-2a + 6a - 2a)(2 - 2 - a2) - 17a*3 + 5a*2 - 5a*2)(-3a2 - 1 - a + a) + 1 - 1 + 2a*5. 59a*5 + 19a*3 Expand (m - 2 + 2)(0 - 3 + 0)(1 + 3 - 3). -3m Expand (5 - 1 - 2)(-2v*2 - 83 + 0v + 81 - 2v). -4v*2 - 4v - 4 Expand (-3u + u + 0u)(-3 - 2 - 7). 24u Expand 3t + 2t + t + (t - 2t - t)(4 - 1 - 1). 2t Expand (1 - 1 + 2r)(4 - 2 + 0)(6 - 3 - 1). 8r Expand (3b*2 + 2b*2 - 3b*2)(1 - 2 + 2). 2b2 Expand (10k*2 + 3 - 3)(-3 + 3 + k - 1). 10k3 - 10k*2 Expand -1 + 1 + k + 5k - 3k + k + (2k - 6k + 3k)(-2 + 2 + 2) - k - k + 3k. 3k Expand -3x*2 - 2x*2 + 4x*2 + (4x + x - 3x)(-2 + 2 + x) - 2x - 7x*2 + x + 14x*2. 8x*2 - x Expand (-2t - 1 + 1)(-t + 3t + 4t - 3t + 0t + t + (-1 + 3t + 1)(2 + 1 - 2)). -14t*2 Expand (-g + 0g + 3g)(-2g + 0g + 5g) + (-5g + 0g + 6g)(-3g - 2g + 4g) + 2g2 + 2 - 2. 7g*2 Expand (-3 + 3 - 2)(-11g - 24g + 10g). 50g Expand (d + 0 + 0 + (-3d + d + 4d)(-1 + 1 - 2))(-3 + 2 + 2)(d2 + 0d*2 - 2d*2). 3d*3 Expand (6g + 0g - 3g)((-2g - 2 + 2)(-1 + 1 + 2) - 1 - 2g + 1 + 1 - 1 - 2g + (-4g + 12g - g)(2 + 0 + 0)). 18g2 Expand (-u - u + 0u)(7 + 2 - 6)(-4u + 0u + 3u). 6u2 Expand -p5 + 5p2 - 5p2 + p5 + 0p5 - 3p5 + (p3 + p - p)(4p*2 + 0p*2 + 0p*2) + (0 + 0 + 2p)(5p*4 - 4p*4 - 3p*4). -3p*5 Expand 484 + 41i - 484 + 2i - 4i + 0i + (3 - 4 + 0)(3 - 3 - i) - 1 + 2i + 0i + 3. 42i + 2 Expand (k3 + 2k*3 - 2k*3)(0k2 - 4k*2 + 2k*2) + 86k*2 - 45k*2 - 40k*2 - 16k*4 - 2k*5. -4k*5 - 16k4 + k2 Expand (-3 - 2 + 2)(-5d*2 + 2d*2 + 2d*2)(9 - 9 + 7d). 21d*3 Expand (-2k*2 + 1 - 1)(-5k3 + 5k*3 - 2k*3). 4k*5 Expand (2 - 7 + 3)(0g5 + 0g*5 + 2g*5 + 0g5 + g5 + 6g5 + 4g2 + (-g4 + 3g - 3g)(-3 + 3 + g) + 2g*5 + g - g). -20g*5 - 8g*2 Expand (20d + d + 5d)(3d4 - 3d*4 - 2d*4). -52d*5 Expand (4z + 2z - 4z)(-7 + 3z + 7)(0 + 0 + 2z*2). 12z*4 Expand (j + 2j - j)(2j - 4j + 4j + (4 - 4j - 4)(3 - 3 + 3)). -20j2 Expand (7i*2 - 7i*2 - 5i*3)(0 + 0 + 1)(-5 + 25 + 2). -110i*3 Expand (0p + p - 12p)(4p4 + 3p*4 - 2p*4 + 20p*4). -275p*5 Expand ((2 - 3 - 1)(-s - 3s + 3s) + 3s - 3s + s + (0 + 2 - 1)(2s + 0s - 4s) + (-4s + 3s + 3s)(1 + 0 + 1))(0s - 2s + 4s). 10s2 Expand -8 + 8 + 5d*3 + (4 - 4 - 2d*2)(-3d - 2d + d) - 3d2 + 3d*2 - 2d*3. 11d*3 Expand (3m2 - m2 + 0m2)(-1 + 1 + 2m2) + (2m - 2m + 3m)(-2m*3 - 3m*3 + 2m*3). -5m*4 Expand (5 - 1 - 1)(7v - 3v + 2v)(4v - 5v + 0v + (-2v - 2 + 2)(0 + 2 + 0) - 6v + 3v + v - v + 1 - 1 + 3 - 3 - v). -162v*2 Expand 4i - 6i + i + (-4 + 3 + 2)(-2i + 3i - 2i) - i + 0i + 3i - i - i + 0i + (4 - 4 + i)(2 - 2 - 2) + 0i + i - 2i + 2i - 2i + 4i. -i Expand (2n - 4 + 0n + 2)(4 - 3 + 1)(6 - 3 - 1). 8n - 8 Expand (1 - 1 - t)(-3t + 3 - 3) - 7t - 2t2 + 53 - 53 - 2t2 - t2 + 4t2 + 2t + t*2 - 2t + (0t + t + t)(2t + 0 + 0). 7t*2 - 7t Expand (-3i + 3i + i*2)(5 + 5 - 5)(0i + 2i - i). 5i*3 Expand (-3 - 2 + 4)(11z4 + 3z - 2z4 - 5z*4). -4z*4 - 3z Expand (-4y3 + 2y*3 + 4y*3)(-4y2 + 4y2 - y2) + (y - 2y - 12y)((5 - 5 + y4)(-1 + 0 - 1) - y*4 - 3y*3 + 3y*3). 37y*5 Expand (-1 + 1 - v)(-3v - 2v + 2v - 1 + (3 + 2v	{ "pile_set_name": "DM Mathematics" }
posite number? False Let m(r) = r - 12. Let n be m(0). Is (-8958)/(-22) - n/(-66) composite? True Let w(j) be the third derivative of 1/3j3 + 0j + 0 + 7j2 + 3/20j*5 + 7/24j*4 - 1/120j*6. Is w(9) composite? True Suppose -79u + 4404598 = -2582241. Is u a prime number? False Let h(k) = 448k - 7. Let w(r) = r3 + 7r*2 - 21r - 25. Let z be w(-9). Is h(z) a prime number? False Let c = -257 + 461. Let l(v) = 5v + 59. Let h be l(-11). Suppose hs + 0s - c = 0. Is s a composite number? True Let j = 33 - 27. Is 4/j - 6313/(-3) prime? False Suppose 190296 + 779779 = 25y. Is y prime? True Let o = 51 - 36. Let r be 10/(-25) + (-294)/o. Let j = 907 + r. Is j prime? True Suppose 0d + 3d + 5u - 763 = 0, -4 = u. Suppose -6q + d = -717. Is q prime? True Let r = 1822 - 665. Is r a prime number? False Let x(k) = 2k3 + 3. Let i(g) = -g3 - 8g*2 - 7g + 5. Let q be i(-7). Is x(q) a composite number? True Suppose 119955 = 30g - 25g - 5m, 5g + 2m = 119969. Is g composite? False Let h = 9358 - -2871. Is h prime? False Suppose 3z = -4q + 58858, -14q - 5z = -18q + 58874. Suppose 10l + q = 69566. Is l composite? True Suppose 3o + h - 6281 = 3h, 3h + 2089 = o. Suppose 0 = 3s - 3j - 254 - o, 5s = j + 3899. Suppose -4q = 5l - 1997, -2l + 2q + 3q = -s. Is l composite? False Suppose 22q = 134925 - 6291. Is q a prime number? False Suppose 5c + 3k = 3c + 55660, k = -5c + 139137. Is c composite? False Let d = 6 + -2. Let s = d + -2. Suppose -m = -5w + 414, -3w + 0m = sm - 251. Is w prime? True Let i be ((-2)/4)/(1/(-6)). Suppose it = 6, -3z + t - 3 = -10. Suppose -3l - 4y = -1749, -y - 534 = -zl + 1230. Is l a composite number? False Let x(k) = 483k - 1. Let r(q) = -242q + 1. Let l(a) = -7r(a) - 3x(a). Is l(3) prime? False Let t(n) = 424n2 - 13n + 5. Is t(4) a prime number? True Let d(x) = x*3 + 12x*2 + 10x - 10. Let a be d(-11). Suppose -3t + 2b = a - 150, 3b = t - 59. Is t composite? False Let z = 31 - 16. Suppose -2m - 18 = -4s, 5m + 3 = s - z. Is 586/s(-3)/(-2) prime? True Let f be -166(0 + -3 - 49/14). Let m = -514 + f. Is m prime? False Let f be (-4)/(-20) - 2/10. Suppose 0n - 4y - 8 = 4n, -12 = 3y. Suppose -2k + f = -n, -5k = -3j + 58. Is j prime? False Let p(n) = 25n - 2. Let d(l) = -l + 1. Let u be d(-1). Let q(w) = -25w + 1. Let r(a) = uq(a) + 3p(a). Is r(9) prime? False Suppose 4z + 24 = 8z. Suppose -zs - 2s = -80. Is s a prime number? False Suppose -1 - 2 = -u. Let q be (-2 - -3)/(u/(-15)). Let i(b) = -2b + 1. Is i(q) a prime number? True Suppose m + 3 = 6. Suppose -10 = mn + 2. Is (-45)/60 - 479/n a prime number? False Let v(d) = d3 - d + 7d*2 - 1 + 6d - 2. Let f be v(-5). Suppose 3u = 3, 20 = 3b - 3u - f. Is b prime? False Suppose -21u + 30575 = 4u. Is u composite? False Let x be (-931)/(-114) - 1/6. Let v = -4 + x. Suppose 6u - 406 = vu. Is u prime? False Suppose 0 = -12w - 0w + 48. Suppose 106717 = 17v - wv. Is v a prime number? True Let b = -153639 - -224348. Is b a composite number? False Let w be -26938 + (-5 - (-4 - -3)). Is 6/(-36) - w/12 prime? False Suppose 0 = n + 4g - 3, -3n = -5g - 3 - 6. Suppose -4z - 7016 = -5q, 5q + nz - 7024 = -z. Suppose 3x - q = 2427. Is x a prime number? True Suppose -36 = -5w + 74. Suppose -c = c - w. Let o(h) = h*3 - 10h2 - 12. Is o(c) a composite number? False Let g = -5347 + 9348. Is g composite? False Let m(o) = o2 - 11o + 10. Let w be m(10). Suppose 0 = 3j - wj - 1005. Suppose 0 = -3v, -5v - 81 + j = 2c. Is c a prime number? True Let f(v) = -8v + 36. Let d be f(6). Is (0 + (-3466)/8)d/3 composite? False Let v be 51/(-85) - 56/(-10). Suppose 2q - 3867 = -vo, q + 5o - 1933 = 3o. Is q prime? True Let z = 6132 + -2615. Is z a prime number? True Let k = 70 + -68. Suppose 0j + 3u + 2680 = kj, -4009 = -3j - u. Is j prime? False Suppose 4r - 5r = -5. Let x be 876/6 + r + -2. Is x - (-6 + 3 - -3) a prime number? True Let f = -1154 + 726. Is -4 - (1/(1/2) + f) a composite number? True Let f(a) = a - 4. Let w be f(9). Suppose -164 = -wn + 2b, 2b - 3b = -3. Is n a prime number? False Let r(w) = w*2 + 3w + 4. Let i be r(-5). Suppose -5t = -251 - i. Suppose -v - 418 = -2c + t, -3v + 9 = 0. Is c a composite number? True Let a(h) = -h3 - 14h*2 - 2h - 28. Let w be a(-14). Suppose 4k + p - 4852 = -p, -4p = w. Is k prime? True Let m = 18452 + -10825. Is m composite? True Let t(m) = 5094m + 329. Is t(8) a prime number? True Suppose 0 = -7g + 5g - 198. Let o = -66 - g. Is o prime? False Suppose 4g = 2g + 188. Let f = 155 - g. Let z = 21 + f. Is z a composite number? True Suppose -15p = -11p. Let i(f) = f + 0f - 2f + 247. Is i(p) a prime number? False Let s be (-8183)/(-3) - 2/(-6)-2. Suppose -q - s = -5t + 3t, 2t - 4q - 2742 = 0. Is t prime? True Let x(b) = b*2 - 10b + 8. Let h be x(9). Let v be (-8 - -26) + 2 + h. Suppose -u + 4k + v = 0, -5 - 48 = -2u + 3k. Is u a composite number? False Let p(a) = 2a*2 - 6a - 517. Is p(64) a composite number? True Suppose -s + 3u + 1552 = 0, 4u - 599 + 3697 = 2s. Is s a prime number? True Suppose 21k + 2 = 22k. Suppose -kn = 4j - 6230, -5n + 11617 = j - 3949. Is n a prime number? False Let c(d) = -d*3 - 5d*2 + 6d - 2. Let w = -11 - -5. Let l be c(w). Is (-3 - 158/l) + 1 prime? False Suppose 0c + 4c - 2v + 842 = 0, v = 4c + 837. Let k = c + 374. Is k composite? True Suppose -8t + 124010 = 2t. Is t composite? False Let r(g) = -8g2 + 7. Let i(q) = -q3 - q + 1. Let l(p) = i(p) + r(p). Let u be l(-9). Let d = -59 + u. Is d a composite number? True Suppose -6q = -q. Suppose -3n - 5c - 405 + 4714 = q, -3c = -n + 1427. Suppose 3b - 2b = 3v - n, -5b = 4v - 1936. Is v prime? True Let r = 44 - 40. Is r/(-24) + (-16790)/(-12) a prime number? True Let n = 5819 - -12300. Is n a prime number? True Let t be (5/(-2) - 2)-2. Suppose tl = 4l - 3a + 287, -5l = -2a - 292. Is l prime? False Let z(i) = i - 1. Let k be z(5). Let q = k - 5. Let j = q + 14. Is j a composite number? False Suppose -4s + s - 37705 = -4w, 0 = -3w + 5s + 28276. Let m = 1420 + w. Is m a prime number? True Suppose -4s = 2y + 280406, -5s - 370640 = y - 20134. Is (4/(-6))/((-6)/s-1) composite? False Let q(l) = 1895l + 30. Let u be q(-7). Is (-3)/(-12) + u/(-20) a composite number? True Suppose i - 106 - 4087 = 0. Is i composite? True Suppose -s = 5x - 1240, 3x - 962 = -4s - 235. Let t be 4/(22/(-58)). Let v = x + t. Is v prime? True Let q(r) = r2 - 4 - r3 + 5r - 6 + 4. Suppose s + 0 - 3 = 2h, -4h - 21 = s. Is q(s) composite? True Suppose -824 = -3h - 5u, 5u = -6h + 2h + 1092. Suppose -7j - h = -8j. Let g = j - 185. Is g prime? True Let c = -13884 + 24689. Is c a composite number? True Let x = 953 + 558. Is x prime? True Suppose -83530 = -0y - 10y. Is y composite? False Suppose 4y - 4o - 18 = 14, -3y = -4o - 27. Is 2/5 - (-1533)/y composite? False Let r = 21570 + -5669. Is r composite? False Let h(w) = -1326w - 53. Is h(-16) composite? False Suppose -4x = -3r - 5x + 11, -3x = -2r. Suppose 5 = rh + 2n, 2h - 4n + 0 = -2. Let b = h - -20. Is b prime? False Suppose 3t - 3 = 6, 5t = -5c - 45. Let j = -12 - c. Suppose 0 = -2n - jn - f + 66, 89 = 3n - f. Is n prime? True Let g(r) = 3 + 5r*2 - 2r*2 - 3r*3 - 7. Let v be g(-8). Suppose -11h + v = -7h. Is h composite? False Suppose -2o + 1993 = 2l - 71, -3l + 12 = 0. Let j be 38/14 - 2/(-7). Suppose 7a = ja + o. Is a prime? True Let k be (1 - 1)/(-2 + 0). Suppose k = -4r - 3t + 3896, 5r - 1733 - 3148 = -t. Is r composite? False Suppose 7t + 862490 = 17t. Is t prime? True Suppose 3q + 2q - 5 = 0, -2a + 3 = -q. Suppose av - 4v + 812 = 0. Suppose -4y - v = -1250. Is y a composite number? False Suppose -2k = 4z + 22, 4z = 3z - k - 7. Let b be z/16 - 2189/(-4). Suppose -138 - b = -q. Is q a composite number? True Suppose -2h - 6 = -5c + 2h, 4h = -5c + 14. Suppose -w = -cd - 3w - 64, -w + 24 = -d. Is (-8)/d + (-14715)/(-21) a prime number? True Let h = 491 + -52. Is h a prime number? True Let w = 5 + -5. Suppose 4u - 3696 = 2a + 2a, w = -3a + 2*u - 2773. Let y = -426 - a. Is y a prime number? True Let c = -333	{ "pile_set_name": "DM Mathematics" }
1, 503, 74419 What are the prime factors of 317040799? 317040799 What are the prime factors of 11921087? 11921087 What are the prime factors of 3754168255? 5, 1987, 377873 List the prime factors of 2362022592. 2, 3, 53, 232117 What are the prime factors of 21529432? 2, 19, 139, 1019 What are the prime factors of 1784738109? 3, 7, 11, 7726139 List the prime factors of 1489648056. 2, 3, 13, 4774513 List the prime factors of 890911873. 890911873 What are the prime factors of 655576571? 13, 50428967 What are the prime factors of 42526896? 2, 3, 885977 What are the prime factors of 7176119239? 61, 117641299 What are the prime factors of 342523740? 2, 3, 5, 13, 439133 What are the prime factors of 28374735? 3, 5, 73, 25913 What are the prime factors of 157965950? 2, 5, 37, 103, 829 List the prime factors of 129914049. 3, 43304683 List the prime factors of 40254783. 3, 197, 68113 What are the prime factors of 417623350? 2, 5, 8352467 List the prime factors of 973302758. 2, 486651379 What are the prime factors of 3604326246? 2, 3, 6521, 30707 What are the prime factors of 254356670? 2, 5, 59, 7307 List the prime factors of 155840709. 3, 23, 2258561 List the prime factors of 282447401. 17, 41, 311, 1303 What are the prime factors of 18272728? 2, 563, 4057 What are the prime factors of 92130878? 2, 7, 71, 13241 List the prime factors of 365425729. 877, 416677 What are the prime factors of 21171566? 2, 13, 29, 43, 653 What are the prime factors of 162287028? 2, 3, 1069, 4217 List the prime factors of 140333551. 140333551 What are the prime factors of 966067494? 2, 3, 7, 4793, 4799 List the prime factors of 79736226. 2, 3, 41, 324131 What are the prime factors of 132822229? 1933, 68713 What are the prime factors of 2713716? 2, 3, 25127 List the prime factors of 1931521572. 2, 3, 17, 1052027 List the prime factors of 44071056. 2, 3, 306049 What are the prime factors of 347566289? 7, 1597, 31091 What are the prime factors of 27211053? 3, 9070351 What are the prime factors of 2163023015? 5, 53, 8162351 List the prime factors of 1976173437. 3, 7, 73, 487, 2647 List the prime factors of 666210718. 2, 19, 131, 133831 What are the prime factors of 5473771? 43, 127297 What are the prime factors of 227622453? 3, 2341, 32411 List the prime factors of 31207357. 31207357 List the prime factors of 561054794. 2, 643, 436279 What are the prime factors of 6108022089? 3, 13, 17, 3070901 List the prime factors of 1130258554. 2, 565129277 List the prime factors of 642988. 2, 23, 29, 241 List the prime factors of 579876199. 7, 29, 43, 66431 What are the prime factors of 6874692? 2, 3, 11, 52081 List the prime factors of 21872841. 3, 7290947 What are the prime factors of 605997495? 3, 5, 19, 43, 53, 311 List the prime factors of 2393464. 2, 17, 17599 List the prime factors of 8381550. 2, 3, 5, 71, 787 What are the prime factors of 79281473? 79281473 What are the prime factors of 78503562? 2, 3, 1907, 2287 What are the prime factors of 4024999874? 2, 7, 287499991 List the prime factors of 3377952831. 3, 11, 163, 491, 1279 What are the prime factors of 521727654? 2, 3, 7, 17, 53, 811 What are the prime factors of 366583533? 3, 122194511 List the prime factors of 1457803598. 2, 728901799 List the prime factors of 249876099. 3, 11, 41, 61561 What are the prime factors of 451233172? 2, 13, 281, 30881 List the prime factors of 5328126384. 2, 3, 7, 29, 313, 1747 What are the prime factors of 62985417? 3, 11, 157, 12157 What are the prime factors of 272063490? 2, 3, 5, 541, 16763 List the prime factors of 281238418. 2, 19, 1877, 3943 What are the prime factors of 93220586? 2, 71, 656483 List the prime factors of 98720155. 5, 19744031 List the prime factors of 53378487. 3, 17, 116293 List the prime factors of 23851665. 3, 5, 67, 293 List the prime factors of 259114985. 5, 51822997 List the prime factors of 242010872. 2, 30251359 List the prime factors of 396270720. 2, 3, 5, 89, 773 What are the prime factors of 195271920? 2, 3, 5, 271211 List the prime factors of 217183094. 2, 108591547 What are the prime factors of 761798936? 2, 47, 2026061 List the prime factors of 2260106289. 3, 7, 1193, 30071 What are the prime factors of 165569772? 2, 3, 13797481 List the prime factors of 5941400148. 2, 3, 709, 232777 What are the prime factors of 158664846? 2, 3, 191, 138451 What are the prime factors of 3410385666? 2, 3, 1429, 397759 What are the prime factors of 20331641? 11, 1848331 List the prime factors of 2779579. 11, 71, 3559 List the prime factors of 43001235. 3, 5, 401, 2383 List the prime factors of 4172491822. 2, 2086245911 List the prime factors of 9064057844. 2, 19, 119263919 List the prime factors of 16341097. 17, 961241 What are the prime factors of 181000356? 2, 3, 15083363 List the prime factors of 5572984442. 2, 4733, 588737 What are the prime factors of 3495954956? 2, 13, 5171531 What are the prime factors of 30722493? 3, 443, 23117 List the prime factors of 25905227. 19, 1363433 What are the prime factors of 69246705? 3, 5, 11, 73, 5749 What are the prime factors of 101580525? 3, 5, 17, 26557 What are the prime factors of 42108417? 3, 13, 39989 What are the prime factors of 613787807? 101, 491, 12377 What are the prime factors of 82843296? 2, 3, 37, 83, 281 List the prime factors of 718546534. 2, 359273267 List the prime factors of 280385205. 3, 5, 83, 113, 1993 What are the prime factors of 203189528? 2, 739, 34369 What are the prime factors of 7802963? 7, 1114709 What are the prime factors of 1609789031? 11959, 134609 List the prime factors of 58460776. 2, 11, 113, 5879 What are the prime factors of 2979410057? 13, 229185389 List the prime factors of 2360933941. 173, 599, 22783 What are the prime factors of 958882363? 61, 15719383 What are the prime factors of 739620868? 2, 7, 571, 46261 List the prime factors of 120170633. 11, 277, 39439 What are the prime factors of 1382948585? 5, 43, 337, 19087 What are the prime factors of 62231636? 2, 15557909 What are the prime factors of 27739483? 27739483 List the prime factors of 963768635. 5, 19, 10144933 List the prime factors of 212603103. 3, 19, 414431 List the prime factors of 6561254146. 2, 3280627073 List the prime factors of 155287038. 2, 3, 19, 71693 What are the prime factors of 6885957492? 2, 3, 1663, 115019 List the prime factors of 2577335724. 2, 3, 71592659 What are the prime factors of 435646694? 2, 7, 31117621 What are the prime factors of 2600401953? 3, 643, 769, 1753 List the prime factors of 65564231. 19, 3450749 What are the prime factors of 788132849? 7, 112590407 What are the prime factors of 210049312? 2, 11, 409, 1459 List the prime factors of 136324910. 2, 5, 23, 47, 12611 What are the prime factors of 2466425670? 2, 3, 5, 509, 161521 What are the prime factors of 79532402? 2, 751, 52951 List the prime factors of 58806265. 5, 7, 1680179 List the prime factors of 502964879. 3389, 148411 What are the prime factors of 2687667683? 17, 53, 103, 28961 What are the prime factors of 14204617? 7, 149, 13619 What are the prime factors of 71112829? 71112829 List the prime factors of 996650636. 2, 17, 14656627 What are the prime factors of 1095582676? 2, 1097, 249677 What are the prime factors of 277691142? 2, 3, 37, 139, 8999 What are the prime factors of 4422420045? 3, 5, 32758667 What are the prime factors of 1741005989? 17, 5501, 18617 What are the prime factors of 203955189? 3, 2267, 29989 What are the prime factors of 1403902? 2, 701951 List the prime factors of 662999911. 7, 61, 1552693 List the prime factors of 400181507. 11, 2803, 12979 What are the prime factors of 45064465? 5, 9012893 List the prime factors of 17702164. 2, 4425541 What are the prime factors of 1006081095? 3, 5, 491, 136603 What are the prime factors of 71840494? 2, 11, 3265477 What are the prime factors of 43385909? 7, 239, 25933 What are the prime factors of 3970630996? 2, 137, 7245677 What are the prime factors of 363837778? 2, 59, 3083371 What are the prime factors of 4165256? 2, 19, 67, 409 List the prime factors of 72323209. 7, 10331887 What are the prime factors of 48449398? 2, 211, 114809 What are the prime factors of 116666213? 19, 2311, 2657 List the prime factors of 4223185654. 2, 2111592827 What are the prime factors of 28909	{ "pile_set_name": "DM Mathematics" }
econd derivative of q*4/3 + 16q*3 + 2q*2 + 87q + 1. What are the prime factors of w(-28)? 2, 113 Let y = 3 + -5. Let w(s) be the third derivative of -s6/8 + s5/20 + 5s4/24 + 25s*2 - 3s. What are the prime factors of w(y)? 2, 61 Let w(o) = -2o - 2. Let s be 238/56 - (-2)/(-8). Suppose -3k - 21 = sv, -5v - 35 = -0k - 5k. What are the prime factors of w(v)? 2, 5 Let z be (1 - 255)(-4)/(1 - -7). Let s = z + -73. List the prime factors of 3576/s + 6/(-27). 2, 3, 11 Let d(t) = -t3 - 7t*2 - 4t - 7. Let a be d(-8). Suppose -j = 5f + a, -2j + 4f = -j + 71. Let k = 115 + j. List the prime factors of k. 2, 3 Let b be (2/3)/(354/(-90) + 4). Let m = 14 - b. Suppose 3g + 3z = 330, mz + z + 227 = 2g. List the prime factors of g. 3, 37 Suppose -141743 = 69d - 300758 - 179637. List the prime factors of d. 2, 3, 409 Let d = 244 + -410. Let t = d + 247. Let y = -53 + t. What are the prime factors of y? 2, 7 Let b = 64078 - 26625. What are the prime factors of b? 13, 43, 67 Let q(y) = 26y2 + 4y - 12. Let j be q(2). List the prime factors of j/1530/1. 2, 5 Let k(d) = 120d*2 - 10d + 43. Suppose 0 = 28i - 17 - 67. What are the prime factors of k(i)? 1093 Let f = -156 + 153. What are the prime factors of 5/50 + (-1239)/30f? 2, 31 Let i(d) = d*2 + 5d + 9. Let x be i(-2). Suppose -53 - 13 = -xb. Suppose -n + b + 80 = 0. List the prime factors of n. 2, 3, 17 Let q = 6823 - 2081. What are the prime factors of q? 2, 2371 Let y(g) = -g2 - 172g*3 - 1 - 2 - 2 - 2. What are the prime factors of y(-2)? 3, 5, 7, 13 Let o be (-16)/16(5 - 0). List the prime factors of o - (4 - (375 - -2)). 2, 23 Suppose 5h + k = 45, -3 + 18 = -h - 5k. Suppose -5q = 4p - 6221, hq - 5p + 2485 = 12q. What are the prime factors of q? 3, 5, 83 Let o(d) = -3d*3 - 19d*2 - 13d + 21. List the prime factors of o(-23). 2, 5, 2677 Suppose 0 = -21w + 46108 + 171956. Suppose -s + 23s - w = 0. What are the prime factors of s? 2, 59 Let m = -699 + 3042. What are the prime factors of m? 3, 11, 71 Let a(y) = -2 + 4 + 28y + 11 - 1. Let c be a(8). Suppose -c = 66b - 68b. What are the prime factors of b? 2, 59 Let a be ((-3429)/(-36))/(21/(-8)). Let j be ((-2)/(-3))/((-2)/a). Suppose -5m = -25, j + 612 = 4i + 3m. List the prime factors of i. 181 Let h = -1720 + 5393. What are the prime factors of h? 3673 Suppose 19v + 0v - 183737 = -12v. What are the prime factors of v? 5927 Let c be (((-45)/12)/5)/((-1)/28). Let q = 27 - c. Suppose -294 = -qw - w. What are the prime factors of w? 2, 3, 7 Let x(y) be the second derivative of -y4/12 - 5y*3/2 + 3y*2/2 + 13y. Let o be x(-9). Let j = -41 + o. What are the prime factors of j? 2 Suppose -2c - 15u = -12u - 37, 51 = 3c + 3u. What are the prime factors of (-12)/c(-18305)/10? 3, 523 Let l(m) = -579m + 378. List the prime factors of l(-13). 3, 5, 17, 31 Suppose 359z = 354z + 760. Let c = -130 + z. What are the prime factors of c? 2, 11 Let f(x) = -x3 + 8x*2 + x + 9. Let o(n) = 4n*2 - 2. Let k be o(1). Suppose w = -kc + 6 - 2, 6 = -3c. What are the prime factors of f(w)? 17 Let i be (-90)/(-25) - 4 - 8976/(-15). Let b = -273 + i. List the prime factors of b. 5, 13 Let t = -300 - -306. Suppose ts = 2s + 3g + 1581, -5s + 3g = -1977. What are the prime factors of s? 2, 3, 11 Let r = 67 - -47. Let n = r + -112. Suppose ni = 2h + 424, -713 = -4i - 4h + 127. What are the prime factors of i? 211 Let j = -277 - -280. Suppose js - 210 + 75 = 0. List the prime factors of s. 3, 5 Let p(i) = -59i - 306. Let t be p(-51). Let y = 3916 - t. List the prime factors of y. 1213 Suppose 0s + 688 = 8s. Suppose -74 - s = -5d. What are the prime factors of d? 2 Suppose -4i = -4z + 64, 0i + i + 5 = 0. Let r(t) = -t*3 + 14t*2 - 13t + 18. What are the prime factors of r(z)? 2, 7, 17 Let d(o) be the second derivative of o*4/4 - 2o*3 + 31o*2 - 6o - 1. Let g be (-3 + 1)/(14/(-49)). What are the prime factors of d(g)? 5 Let j(d) = 3d + 23. Let q be j(-15). Let y = q - -1. List the prime factors of (-6)/y - (-948)/14. 2, 17 Suppose 658z + 49968 = 667z. What are the prime factors of z? 2, 347 Let m(d) = d2 - 2. Let h be m(2). Suppose a = -hg + 612, -2g + 306 = -g - 5a. What are the prime factors of g? 2, 3, 17 Let t = -31 - -40. Let l = 21 + t. Let n = 54 - l. List the prime factors of n. 2, 3 Let a = 1044 + -1053. List the prime factors of -1 + a/(27/1176)-5. 3, 653 Suppose 5o - 230 = -3s, 8o = 3s + 3o - 220. List the prime factors of (-30)/s(-785 - 0). 2, 157 Let a(w) be the first derivative of w4/4 + 4w*3/3 + 25w*2/2 - 39w + 133. What are the prime factors of a(6)? 3, 157 Suppose 5z + 4a - 316 = 0, -3z + 83 = a - 108. Suppose zn - 75n + 2673 = 0. What are the prime factors of n? 3 Suppose 9m + 30m - 4326 = 9246. What are the prime factors of m? 2, 3, 29 Let c = 1447 - 1439. Let d(u) = -u2. Let q(o) = -o3 + 18o*2 - 16o - 8. Let p(l) = 6d(l) + q(l). What are the prime factors of p(c)? 2, 3, 5 Let q(x) = -39x - 6. Let w be q(-2). Let p = 589 - w. Suppose 0 = -4j - 73 + p. What are the prime factors of j? 3, 37 Let b(q) = q2 - 15q - 7. Let j be b(16). Suppose -724 = -jg + 5g. What are the prime factors of g? 181 List the prime factors of 2 - 50((-1467)/45)/((-3)/(-6)). 2, 7, 233 Suppose -6h + 83 + 1 = 0. Suppose 18s = hs + 12. Suppose sx + 0x = 321. What are the prime factors of x? 107 Let j be (-53)/(-11) + 60/330. Suppose -jq = -0q - 15, -5q + 9 = 2d. Let z(b) = 14b2 - 3b - 4. What are the prime factors of z(d)? 131 What are the prime factors of 408/340(-26230)/(-4)? 3, 43, 61 Suppose -946 + 2836 = -5o. Let j = o - -530. What are the prime factors of j? 2, 19 Let x = -13526 + 42629. What are the prime factors of x? 3, 89, 109 Let v = -41 - -46. Suppose -4u + 925 = -vs + 3327, 3s - 1440 = 2u. Suppose 4x = s + 70. What are the prime factors of x? 137 Suppose 20b = 1563 + 257. Let c = 100 - 56. Let z = b - c. What are the prime factors of z? 47 Let g be (248/2)/4 + (-4)/1. Let c = g + -5. What are the prime factors of 1303/5 + c/55? 61 What are the prime factors of 4/8 + (-143640)/(-80)? 2, 449 Suppose 5n - 70545 = -88v + 91v, 0 = -2v. List the prime factors of n. 3, 4703 What are the prime factors of ((-1)/(-1))/(16/506403)? 5, 211 Suppose -2d + 2c = 2592, -4d + 5c - 5637 = -457. Let b = -838 - d. Suppose -8r + r = -b. List the prime factors of r. 2, 3, 11 Suppose 56n - 29833 - 130796 = 340235. List the prime factors of n. 2, 13, 43 Let o = -38125 - -62546. List the prime factors of o. 24421 Let f = 86578 - 45497. What are the prime factors of f? 41081 Suppose 0 = -27o + 4o + 69. Suppose 2d + 0d - 408 = of, 4f = -2d + 380. What are the prime factors of d? 2, 3, 11 Let s(p) = p2 - 2p + 5. Let x(d) = -d*3 + 4d*2 + 5d. Let l be x(4). Suppose -ly + 15y = 60. What are the prime factors of s(y)? 173 Suppose -21b = -7b + 1680. Let n = b + 247. What are the prime factors of n? 127 Let i = 928 + -924. List the prime factors of 2691/2 - ((-2)/i - -3). 17, 79 Suppose -3o + 11134 = -32r + 28r, o - 3703 = 3r. What are the prime factors of o? 2, 11, 13 Suppose 1692 = 44w - 41w. Suppose 0m + w = 2m + 4g, -4m - 4g = -1148. What are the prime factors of m? 2, 73 Let g be 48/(-360) + (-11554)/(-30). Suppose 482 = 5c - 4l, -5c + 3l + g = -c. Let i = c + -37. What are the prime factors of i? 3, 19 Suppose -15u = -18u + 27. Suppose -2082 = -uw + 996. List the prime factors of w. 2, 3, 19 Let h = 4 + -11. Let x be ((-2)/(-6))/(h/(-42)). Suppose 3n = -t + 40, 0 = xt + 2n - 62 - 34. List the prime factors of t. 2, 13 Let c = -92 - -162. Suppose -6u = -u - c. List the prime factors of 2 + 1244/u - 2/(-14). 7, 13 Let w be (196 - -2)(2 - 105/(-14)). Let d = -832 + w. What are the prime factors of d? 1049 Suppose 9 = -5x - 1, -a - 3x = -23. Suppose 0 = -7o + 6o - 20. Let b = a + o. What are the prime factors of b? 3 List the prime factors of (10 - (-1340080)/(-100))(-5)/3. 2, 11159 Let s(b) = -4b - 10. Let z be s(-3). Suppose 0 = zm - 0m - 10. What are the prime factors of 3 - m - (1 - -1 - 29)? 5 Let w = -355 + 376. Suppose -33402 = -wg - 17*g. What are the prime factors of g? 3,	{ "pile_set_name": "DM Mathematics" }
- 2o + 4o - 4o + o + (2o + 2 - 2)(3 + 0 - 4) - 3o - o + 6o - 9o + o - 2o)(-2 + 3 - 2). 11o Expand -18q - 2q - 21q - 2q + 4q - 4q + (4 + 1 - 3)(4q - 6q + q). -45q Expand (-14 + 16 - 13)(0b - 2b + 0b). 22b Expand (-3g3 - g3 + 0g*3)(7g2 - 2g*2 + 4g*2). -36g*5 Expand (5v - 75 + 75)(-2v - 5 + 5)(2 - 1 - 2). 10v*2 Expand (2 + 8 + 0)(0s4 - 4s*4 + 3s*4). -10s*4 Expand (4i + i - 3i + (i + 1 - 1)(2 + 1 - 2))(2i*3 - 3i*3 + 6i*3). 15i*4 Expand (2 - 2 - 2)(11i2 - 11i*2 + 11i*2). -22i*2 Expand (26 + 28 + 9)(-n + n - n). -63n Expand 2d + 0 + 0 + (4d - 5d + 0d)(1 + 3 - 5) + 6d + 47 - 47. 9d Expand (-2l + 2l + l*3)((1 + 2 + 1)(8l - l - 3l) + 6l - 4l - 3l). 15l4 Expand (2b + b - b)(-4 + 5 + 2) + 0 + 0 + b + 0b + 2b + 0b + (2 - 5 + 2)(-3b + b + b) - 1 - 3b + 1. 7b Expand -11f3 + 35f*3 - 9f*3 + 2f*3 - 3f3 - f3 + (0f + f - 2f)(-2f - f*2 + 2f). 14f3 Expand 3v + 1 - 1 + (2 + 0 - 1)(-v + 2 - 2). 2v Expand (3n + 2n - 4n)(-n + 4n - 5n) - 3 + 3 - n*2 - 4n*2 - 3n*2 + 6n*2 + (0n*2 + 0n*2 + 6n*2)(6 - 3 - 2). 2n2 Expand -u2 + 4u2 - u2 + (2 - 2 + u*2)(-1 - 1 + 4) + (-1 - 4 + 4)(-u + u - u2) - 4u*2 + 2u*2 - 3u*2 + 1 + 3u*2 - 1. 3u*2 Expand ((2 - 2 + 2)(2 - 7 + 3) + 6 + 0 - 3)(-2f4 + f3 - f*3). 2f*4 Expand (3r + 3r3 - r - r3)(3r + 3r - r). 10r4 + 10r2 Expand m3 - 5m3 + m3 + (-3m*2 + 2 - 2)(0m - 5m + 2m). 6m*3 Expand (-4 - 8 + 2)(-4j + 5j + 0j + (1 - 4 + 0)(j + 3 - 3)). 20j Expand (0 + 2 - 4)(1 - 1 + 2m) + (3 + 1 - 6)(-22m + 8m + 4m). 16m Expand ((0 - 3 + 1)(2w2 - 3 + 3) + 3 - 3 + w2 - 4w2 - w2 + w2)(-1 - w + 1). 7w3 Expand (6 + 3 + 6)(2 - 2a - 2)(3 - 1 + 1). -90a Expand (-6 - n + 6)(-1 - 79n - 68n + 157n). -10n*2 + n Expand (0g + 2g - 3g)(-5 + 3 + 7). -5g Expand (-3h + 2h - h)(3 - 1 + 0) - h - 5h - h - 2 - h + 2. -12h Expand (0 - 3 + 2)(4s - 3s + s)(6s2 - s2 + 8s2). -26s3 Expand -t3 - 4t3 + 4t*3 + (2t - 8 + 8)(-2t + 2t - 2t*2). -5t*3 Expand (0i + 3i - i)(-144i2 - 2 + 149i*2 + 1). 10i*3 - 2i Expand (-3 + 2 - 1)(2h + 0h + h + 2h - 2h - 4h - 2h + 1 - 1 + 0h - 2h + 3h + (3h + 3h - 5h)(-3 + 2 - 1) - 3h + 0h + 2h). 10h Expand ((2 + 3 - 4)(0 - 3 + 2) + 3 - 2 + 1 - 20 - 23 + 15)(3h2 - 2h*2 - 3h2 - h2 - 4h2 + 4h*2 + (0h - 4h + 6h)(5h + 0h - 3h)). -27h2 Expand x - x - 2x*3 + (x + 0 + 0)(3x - 3x + x*2) + (-2 + 4 + 0)(-2x3 + 5x*3 - 2x3). x3 Expand 2w2 - 4w*2 + 3w*2 + 4w*2 - 2w*2 + 0w*2 + (-2w + 4w + 0w)(-4w + 4w - 2w). -w2 Expand l2 - l*2 - 2l*5 + (4 - 1 - 1)(0l5 - l5 + 5l*5). 6l*5 Expand -15i*3 + 15i*3 - 5i4 - i4 - 2i4 + 0i*4 + (2i*3 + 2 - 2)(-i + 1 - 1) - i4 + i3 - i*3. -11i*4 Expand (-2v + 4v - 3v)(-5v - 2v - v) + (-2v*2 - 4v*2 + 4v*2)(2 - 2 - 2) - 2v2 + 0v*2 + 0v*2. 10v*2 Expand (-1 + 15 - 8)(3k3 + 3k - k*3 - 3k*3) + 3k*2 - 3k*2 + 2k*3. -4k*3 + 18k Expand (-2b2 + 2b*2 + 2b*3)(6 - b - 6). -2b4 Expand (-8 + 1 - 5)(0p - 4 + 4p + 5). -48p - 12 Expand (4n + 21 - 21)(-5n + 3n + 2 - 1)(0 - 4 + 3). 8n2 - 4n Expand (j - 2j - j)(-2j3 + 2j*3 + 2j*4) - 2j3 + j5 + 2j3 - 9j*5 + 0j*5 - 2j*5. -14j*5 Expand (-2n + 3n - 4n)(6 + 3 - n - 5). 3n*2 - 12n Expand (-2 + 2 + 2x)(-44x2 + 13x*2 + 15x*2). -32x3 Expand (-y2 + 6y2 - y + 5y*2)(y*2 + 0y*2 - 2y*2). -10y4 + y3 Expand (-8c + 5c - c)(4c*3 - 2c*3 - 3c*3) - 7c*4 + 25c*3 - 25c*3. -3c*4 Expand (-461 + 461 - 25m*3)(-1 + 1 - 2m2). 50m*5 Expand (3 + 0 - 2)(0g3 - 2g*3 + 4g3) + g3 - g + g + 35g3 - 46g*3 + 27g*3. 19g*3 Expand (-5y + 3y + y)(-6 + 0 + 1). 5y Expand -2u - 6u + 13u - 2u4 + 2u*2 - 2u2 - u4 + 1 - 1 - u*4 + (2u - 2u + 2u*2)(-4u2 + 3u2 - u2) + 2u4 - 4u + 4u. -6u*4 + 5u Expand (-1 + 2 - 3)(2m4 - m4 + m*4) - 8m*4 + 12m*4 + 11m*4. 11m*4 Expand (1 - 1 - 2b*4)(7 - 24 - 475b + 477b)(-4 + 2 + 3). -4b*5 + 34b*4 Expand (2 - 2z - 2)(7 + 2z - 7 + (2 - 2 + 2)(2z + 2 - 2)). -12z2 Expand 0c + 0c - c + (-253 + 253 + 3c)(6 - 1 - 3). 5c Expand (2 - 2 + 1)(-4 - n + 4) + (n + 2n - n)(-4 + 1 + 1). -5n Expand 0 + c + 0 + (0 + 12 - 5)(-3c + 2c + 2c) - 2c + 3c + 0c. 9c Expand (-2v - 2v + 3v)((-4 + 4 - 5v)(0v2 + 0v2 - v2) + 4v3 - v3 - v3). -7v*4 Expand (2 + b - 2)(-3b - 5b + 0b)(-1 + 1 + 2)(0 - 2 + 1)(0b2 + 4b*2 + 4b*2). 128b*4 Expand (-2 - 4 + 4)(-8 + 9 - 7)(2w*3 - 2w*4 - 2w*3). -24w*4 Expand 4v*2 - 3v + 3v + (2 - 2 + 2v)(2v - 4 + 4) + 2v2 - 2v2 + v2 - 2v2 - 3v + 3v. 7v*2 Expand (2b - 5b + 0b + (4b - b - 4b)(-2 - 1 + 5) + 0b - b - b)(-3b3 - b4 + 3b3). 7b5 Expand (y2 + 0y2 + 0y*2)(2y2 + 2y*2 - 2y*2)(-5 - 9 + 0). -28y4 Expand (4 - 3 - 4)(1 + 0 + 0)(g + 1 - 1)(2g - 6g + 3g). 3g*2 Expand (3 - 2 - 5)(-12q + q - 19q). 120q Expand (-3s + 0s + 5s)(-s - 2s + 7s - 6). 8s*2 - 12s Expand (-2j2 + j - j)(3 - 2j - 3)(-6j + 3j - 2j) + 2j*2 + 2j*4 - 2j*2. -18j*4 Expand (-13m*2 + 4m*2 - 3m*2)(2m + 3 - 3)(-2m2 + 4m*2 + 0m*2). -48m*5 Expand (-3 + 1 + 3)(-1 - 2 + 1)((z3 + 3z*3 - 2z*3)(-2z - 2z + 3z) + 4z*2 - 4z2 - z4). 6z4 Expand h + 12h + 9h + (-4 + 4 - 1)(-4h - h + 2h) + 2h + 2h - 5h. 24h Expand (-2q - 3q + 7q)(-26q + 26q + 16q2) - q3 - 2q*3 + 4q*3. 33q*3 Expand 14j*3 + 12j - 12j + (j - j + 2j*2)(-j + 0 + 0). 12j3 Expand (0a + 0a + 2a)(4a - 2a - a) + 2a2 + a2 - 2a2 + (-4a - a + 7a + 19)(-a + 3 - 3). a*2 - 19a Expand (f*2 - 2f*2 + 3f*2)(10f - 2 - 25f + 10f). -10f*3 - 4f*2 Expand 3g3 - g3 + 3g3 + (2 - 1 + 1)(-g*3 + 2g*3 - 3g*3) - 2g*3 + 3g*2 - 3g2. -g3 Expand 2k + 4k - 3k + (0 - 3 + 4)(-k + 0k - k). k Expand (-37w + 37w + 8w*2)(-w - 1 + 1). -8w3 Expand (0h - 4h + 2h)(5h - 5h - 4h*4). 8h*5 Expand (-1 - 2 - 4)(-l*3 + l - l). 7l*3 Expand (2q*2 - 2q*2 - 3q*2)(2q + 2q + 0q)(-1 - 4 + 3). 24q3 Expand (-8z*2 + 12z*2 - 4z - z*2 + (3z + 0z - 4z)(-3z + 5z - 3z))(0z*2 - 4z2 + z2). -12z4 + 12z*3 Expand (50 - 50 - 2b - 3b2 - b3)(3b - 2b - 3b). 2b*4 + 6b*3 + 4b*2 Expand (-3 + 3 + 2)(4 - 4 - y) - 4y - y + 6y + 2y + 4y - y + (-3 - 1 + 6)(0 + 0 + y). 6y Expand (2 - 7a - 2 + (5 - 5 - 2a)(0 + 4 - 2))(1 - 4 + 1 + (-2 + 1 + 0)(-2 + 6 - 2)). 44a Expand -4 - 37b2 - 1 + 38b*2 - 3b*5 + (8b - b - b)(-5b*4 + 0b*4 + 3b*4). -15b5 + b2 - 5 Expand ((f - 6f + 3f)(-7 + 5 + 0) - 4f + 3f + 2f)(-1 + 0 + 2). 5f Expand -14s3 + 14s*3 - 3s*4 + (-3s*4 + 6s*4 - 2s*4)(-4 + 2 + 1) - s3 + s4 + s*3. -3s*4 Expand (-2 + 4 - 1)(-3 - 2 + 3)(5g - 6g + 12 + 0g). 2g - 24 Expand (-r2 - 1 + 1)(-64r + 26r + 29r). 9r*3 Expand (t - 7t + 4t + (-t - t + 0t)(-5 + 4 + 3) - 1 + 1 + 2t + 5 + t - 5 - 3 + 3 - t)(-4t + 6t - 5t) + 61t - 61t + 4t2. 16t*2 Expand 3f + 0f + f + f + 0f + 2f - f - 3f + 2f - f + 0f + 0f + (-f - 2 + 2)(0 - 4 + 5). 3f Expand (2a2 + a + a2 - 5a2)(1 + 1 - 5). 6a2 - 3a Expand (-4d - 4d - d)(-2d + 5d - 5d)(3d - 4 + 4). 54d3 Expand (-3q*2 + 0q2 + q2)(4 - 11 - 13) - q2 + 3q*2 - 5q*2 + (0q + 0q + 2q)(q - q - 2q) + 3q2 - 2q*2 + 0q*2. 34q*2 Expand (0m + m - 8m)(-m + 3 - 3) + m*2 + 3m*2 - 2m2 - 2 + m2 + 2 + (-2 + 2 + m*2)(-1 + 1 + 1) + m*2 + 0m + 0m - 2m2 + m2 + 2m2. 13m*2 Expand 2 - 2 + h + (-4 + 0 + 3)(-2 - h + 2) + h + h + 0h - h - h + 3h + 0h + 27 - h - 20 + (h + 2h - 2h)(4 - 3 - 3). 2h + 7 Expand (3 + 0 - 2)(j - 4 + 4) + 3j - 4j - 3j + (-4j - j + 3j)(-1 - 4 + 3). j Expand (-3m - 2m*2 + 3m)(0 + 0 + 2m) + (m*2 + 2 - 2)(-5m + 0m + 2m). -7m*3 Expand (a - a + a)(4 + 2 - 3). 3a Expand (h + 0h - 4h)(-h	{ "pile_set_name": "DM Mathematics" }
equence qdj when three letters picked without replacement from {d: 3, j: 1, q: 3, n: 3, l: 3, h: 1}? 3/728 What is prob of sequence llr when three letters picked without replacement from {r: 3, l: 3, d: 5, b: 6}? 3/680 Two letters picked without replacement from {c: 8, m: 1, f: 2, a: 2}. Give prob of sequence fm. 1/78 Four letters picked without replacement from {o: 4, v: 1, z: 7, n: 3, r: 2}. Give prob of sequence rzvo. 1/1020 Two letters picked without replacement from {l: 1, j: 2, f: 1, e: 1, w: 2}. Give prob of sequence le. 1/42 Three letters picked without replacement from vyvfvvvvvf. What is prob of sequence yvv? 7/120 Two letters picked without replacement from {v: 1, f: 1, t: 2, n: 1, s: 1, z: 1}. Give prob of sequence sn. 1/42 What is prob of sequence jayy when four letters picked without replacement from {j: 2, y: 12, a: 3}? 33/2380 What is prob of sequence qqe when three letters picked without replacement from {t: 7, q: 2, d: 5, e: 2, b: 1, m: 3}? 1/1710 Calculate prob of sequence nuf when three letters picked without replacement from {n: 1, q: 1, c: 1, u: 2, f: 1, e: 2}. 1/168 Calculate prob of sequence qj when two letters picked without replacement from zqzjj. 1/10 Two letters picked without replacement from oohhnnnoqowonoqoooh. Give prob of sequence oo. 4/19 Four letters picked without replacement from {k: 1, b: 1, p: 8, a: 2, l: 2}. What is prob of sequence pbpk? 1/429 Calculate prob of sequence ny when two letters picked without replacement from {t: 1, g: 2, y: 2, u: 4, n: 1}. 1/45 Three letters picked without replacement from dnriirirnnw. What is prob of sequence irn? 3/110 Two letters picked without replacement from usuuusuu. What is prob of sequence uu? 15/28 Two letters picked without replacement from zyyyywyyyywyyyyywwwz. Give prob of sequence yy. 39/95 Three letters picked without replacement from {v: 2, f: 4, i: 4, h: 5}. Give prob of sequence fvi. 16/1365 Calculate prob of sequence ra when two letters picked without replacement from {a: 2, w: 6, y: 1, k: 5, r: 5}. 5/171 Calculate prob of sequence gye when three letters picked without replacement from eoohyge. 1/105 Calculate prob of sequence wwss when four letters picked without replacement from wwwwhsswbhbbs. 1/143 What is prob of sequence ll when two letters picked without replacement from {z: 2, l: 2, a: 1, x: 1}? 1/15 Calculate prob of sequence lrl when three letters picked without replacement from lrllrlllll. 7/45 What is prob of sequence de when two letters picked without replacement from {n: 1, t: 1, e: 3, d: 2}? 1/7 Calculate prob of sequence wm when two letters picked without replacement from {v: 5, w: 5, d: 1, m: 6}. 15/136 Calculate prob of sequence uu when two letters picked without replacement from {m: 1, p: 4, u: 2, d: 9, c: 1}. 1/136 Three letters picked without replacement from {p: 1, f: 9, i: 4}. Give prob of sequence pii. 1/182 What is prob of sequence ixt when three letters picked without replacement from xxit? 1/12 Calculate prob of sequence ynyy when four letters picked without replacement from ynynytyyt. 5/126 What is prob of sequence ljl when three letters picked without replacement from dydqlgglgjlq? 1/220 Calculate prob of sequence bve when three letters picked without replacement from {k: 4, f: 1, p: 1, v: 7, b: 3, e: 2}. 7/816 Calculate prob of sequence tfft when four letters picked without replacement from ffttfffftf. 1/20 What is prob of sequence ii when two letters picked without replacement from {i: 11, g: 5}? 11/24 Two letters picked without replacement from dpdpppdppppp. Give prob of sequence pd. 9/44 Four letters picked without replacement from {n: 2, h: 2, g: 1, o: 2, z: 1}. Give prob of sequence ozhg. 1/420 Four letters picked without replacement from ereeerrerr. What is prob of sequence errr? 5/84 Three letters picked without replacement from geeemmeeeeeemzgeree. What is prob of sequence mme? 4/323 Calculate prob of sequence aayc when four letters picked without replacement from {u: 5, c: 1, y: 1, o: 3, a: 3}. 1/2860 What is prob of sequence zxx when three letters picked without replacement from {k: 1, o: 1, l: 1, t: 5, z: 1, x: 4}? 1/143 Two letters picked without replacement from ssxxbsbijjixpxj. Give prob of sequence sj. 3/70 What is prob of sequence gc when two letters picked without replacement from dpocopddddodgcgpgccd? 3/95 Two letters picked without replacement from {q: 1, c: 1, x: 2, m: 1, j: 2}. Give prob of sequence mx. 1/21 Four letters picked without replacement from wwjjjjjwwjjwjj. What is prob of sequence wwwj? 45/2002 Two letters picked without replacement from jmm. What is prob of sequence mj? 1/3 Three letters picked without replacement from xkbkkxxx. What is prob of sequence kbx? 1/28 Three letters picked without replacement from {y: 1, e: 2, l: 1}. What is prob of sequence lee? 1/12 Four letters picked without replacement from oojjgojgjo. Give prob of sequence gooo. 1/105 Four letters picked without replacement from dypydpoddpdpopy. Give prob of sequence oppy. 1/273 Four letters picked without replacement from cccccectccccccc. What is prob of sequence ccte? 1/210 Four letters picked without replacement from {q: 8, y: 8, k: 1, l: 1}. Give prob of sequence qkyl. 2/2295 Calculate prob of sequence jjbb when four letters picked without replacement from wbbjbjbjwj. 1/35 Three letters picked without replacement from wggwwgg. Give prob of sequence wgg. 6/35 Calculate prob of sequence qepf when four letters picked without replacement from epqqqef. 1/140 Calculate prob of sequence mol when three letters picked without replacement from {m: 2, o: 1, l: 1}. 1/12 Calculate prob of sequence twtj when four letters picked without replacement from jmttfwf. 1/420 What is prob of sequence ov when two letters picked without replacement from vdpppvpojojjvj? 3/91 What is prob of sequence opz when three letters picked without replacement from {p: 7, o: 4, z: 2}? 14/429 Four letters picked without replacement from gyzkzhhyi. Give prob of sequence hgzk. 1/756 Three letters picked without replacement from {e: 2, p: 3}. Give prob of sequence epp. 1/5 What is prob of sequence dnn when three letters picked without replacement from {d: 5, n: 7}? 7/44 Calculate prob of sequence epd when three letters picked without replacement from ddedzyp. 1/70 Calculate prob of sequence xx when two letters picked without replacement from xxxxixiiiiii. 5/33 Calculate prob of sequence pp when two letters picked without replacement from {p: 2, v: 2, m: 9, q: 1, k: 3}. 1/136 Calculate prob of sequence qa when two letters picked without replacement from {g: 1, q: 1, u: 1, w: 4, a: 8}. 4/105 Calculate prob of sequence xpdr when four letters picked without replacement from xrdfppfxdhrrrppxxdxf. 2/969 Calculate prob of sequence ocl when three letters picked without replacement from {o: 2, y: 4, z: 1, h: 2, c: 1, l: 4}. 1/273 Calculate prob of sequence sw when two letters picked without replacement from {u: 1, e: 1, w: 1, x: 1, s: 1}. 1/20 What is prob of sequence gnnn when four letters picked without replacement from ngggngggngggggnggg? 7/1530 Calculate prob of sequence qcc when three letters picked without replacement from {t: 7, c: 2, q: 4, y: 1}. 1/273 What is prob of sequence rao when three letters picked without replacement from rrarrooro? 5/168 Four letters picked without replacement from rcrrrrtcxrmqtmmmrmm. Give prob of sequence xrcc. 7/46512 Four letters picked without replacement from {n: 1, c: 1, z: 2, q: 3, d: 2, x: 3}. What is prob of sequence zxcd? 1/990 Two letters picked without replacement from ixiiiiii. What is prob of sequence ix? 1/8 What is prob of sequence br when two letters picked without replacement from {j: 3, a: 1, w: 2, d: 2, r: 2, b: 4}? 4/91 Calculate prob of sequence nn when two letters picked without replacement from {v: 2, m: 2, n: 2}. 1/15 Three letters picked without replacement from iixxawaiibaxia. What is prob of sequence axi? 5/182 What is prob of sequence umqg when four letters picked without replacement from qqbuquuqugbuquqquqm? 7/11628 What is prob of sequence vb when two letters picked without replacement from {v: 3, b: 1, q: 5}? 1/24 Four letters picked without replacement from zazcpaccacuacuazpc. What is prob of sequenc	{ "pile_set_name": "DM Mathematics" }
p'th term of 125, 927, 3097, 7319, 14277, 24655, 39137? 114p3 + 4p + 7 What is the l'th term of -272, -1077, -2408, -4259, -6624, -9497, -12872? l*3 - 269l*2 - 5l + 1 What is the m'th term of 5498148, 5498149, 5498150, 5498151? m + 5498147 What is the j'th term of -3396, -6791, -10186, -13581, -16976, -20371? -3395j - 1 What is the u'th term of 220, 1734, 5848, 13864, 27084, 46810, 74344, 110988? 217u*3 - 2u2 + u + 4 What is the p'th term of 66788, 66792, 66808, 66842, 66900? p3 - 3p + 66790 What is the l'th term of -2286, -4478, -6670, -8862, -11054, -13246? -2192l - 94 What is the p'th term of 21882, 21904, 21926, 21948, 21970, 21992? 22p + 21860 What is the o'th term of -489, -530, -593, -678, -785, -914? -11o*2 - 8o - 470 What is the s'th term of -382, -766, -1160, -1570, -2002, -2462? -s3 + s2 - 380s - 2 What is the l'th term of 4960, 4959, 4958, 4957? -l + 4961 What is the v'th term of -175, -726, -1619, -2830, -4335, -6110? 4v*3 - 195v*2 + 6v + 10 What is the s'th term of 42799, 42806, 42811, 42814? -s*2 + 10s + 42790 What is the v'th term of -232119, -232117, -232115, -232113, -232111? 2v - 232121 What is the y'th term of 45, 79, 105, 99, 37? -4y*3 + 20y*2 + 2y + 27 What is the g'th term of -229, -928, -2095, -3730, -5833, -8404, -11443? -234g2 + 3g + 2 What is the i'th term of 7205, 7169, 7133, 7097, 7061? -36i + 7241 What is the j'th term of 2555, 2548, 2541, 2534? -7j + 2562 What is the z'th term of 836, 929, 1026, 1127, 1232, 1341? 2z2 + 87z + 747 What is the o'th term of -234, -227, -222, -225, -242? -o*3 + 5o2 - o - 237 What is the q'th term of 132779, 132784, 132791, 132800, 132811, 132824? q2 + 2q + 132776 What is the v'th term of 3418103, 3418104, 3418105, 3418106? v + 3418102 What is the f'th term of -1052, -2176, -3292, -4400, -5500? 4f*2 - 1136f + 80 What is the r'th term of 2832, 5743, 8652, 11559? -r*2 + 2914r - 81 What is the n'th term of -15000, -30118, -45236, -60354, -75472? -15118n + 118 What is the j'th term of 2490454, 4980910, 7471366, 9961822, 12452278, 14942734? 2490456j - 2 What is the a'th term of 1443, 1124, 805? -319a + 1762 What is the p'th term of -7377, -14754, -22131? -7377p What is the z'th term of 4450, 4458, 4478, 4516, 4578, 4670, 4798? z*3 + z + 4448 What is the a'th term of -5845, -23401, -52661, -93625, -146293, -210665? -5852a2 + 7 What is the o'th term of -9169, -9216, -9303, -9436, -9621, -9864, -10171? -o3 - 14o2 + 2o - 9156 What is the t'th term of 17286, 17315, 17364, 17433, 17522? 10t2 - t + 17277 What is the o'th term of 8101, 8097, 8093, 8089, 8085? -4o + 8105 What is the n'th term of 5681, 5675, 5665, 5651, 5633, 5611? -2n2 + 5683 What is the y'th term of 818, 1654, 2498, 3350, 4210, 5078? 4y*2 + 824y - 10 What is the g'th term of -119981, -119979, -119977, -119975, -119973, -119971? 2g - 119983 What is the q'th term of -368, -1431, -3202, -5681, -8868? -354q*2 - q - 13 What is the i'th term of 428, 290, 58, -268, -688? -47i*2 + 3i + 472 What is the p'th term of 28237, 28250, 28265, 28276, 28277, 28262? -p*3 + 7p2 - p + 28232 What is the b'th term of -2905537, -2905535, -2905531, -2905525, -2905517? b2 - b - 2905537 What is the h'th term of 45, 185, 427, 783, 1265, 1885? 2h3 + 39h*2 + 9h - 5 What is the c'th term of 318, 302, 286, 270? -16c + 334 What is the w'th term of -35, -150, -321, -530, -759, -990, -1205, -1386? 3w*3 - 46w*2 + 2w + 6 What is the f'th term of 8366, 16854, 25342, 33830? 8488f - 122 What is the d'th term of 862, 827, 770, 691, 590, 467, 322? -11d*2 - 2d + 875 What is the d'th term of -240, -265, -316, -405, -544, -745, -1020, -1381? -2d3 - d2 - 8d - 229 What is the a'th term of 32860, 131439, 295738, 525757, 821496, 1182955, 1610134? 32860a2 - a + 1 What is the l'th term of 489, 1948, 4385, 7806, 12217, 17624, 24033? l3 + 483l*2 + 3l + 2 What is the j'th term of -155, -161, -145, -107, -47, 35, 139? 11j2 - 39j - 127 What is the l'th term of -806, -1617, -2450, -3317, -4230, -5201, -6242, -7365? -2l3 + l2 - 800l - 5 What is the r'th term of 123445, 123451, 123461, 123475? 2r2 + 123443 What is the l'th term of 17225, 17246, 17269, 17294, 17321? l2 + 18l + 17206 What is the a'th term of -17585, -70360, -158327, -281486, -439837? -17596a2 + 13a - 2 What is the v'th term of 5732, 10708, 15684, 20660, 25636, 30612? 4976v + 756 What is the t'th term of -46247, -46240, -46233, -46226, -46219? 7t - 46254 What is the x'th term of 36497, 145930, 328319, 583664, 911965, 1313222? 36478x2 - x + 20 What is the d'th term of 246, 451, 650, 843, 1030, 1211, 1386? -3d*2 + 214d + 35 What is the o'th term of -1368, -1364, -1358, -1350, -1340, -1328, -1314? o*2 + o - 1370 What is the v'th term of -1788, -7178, -16160, -28734, -44900, -64658? -1796v*2 - 2v + 10 What is the h'th term of -262448, -262447, -262446? h - 262449 What is the l'th term of 742147, 1484293, 2226439? 742146l + 1 What is the c'th term of -2013, -2031, -2065, -2115, -2181, -2263? -8c*2 + 6c - 2011 What is the w'th term of -10, 35, 156, 389, 770? 6w3 + 2w*2 - 3w - 15 What is the v'th term of 963033, 963032, 963031, 963030, 963029, 963028? -v + 963034 What is the b'th term of -56580, -113162, -169744, -226326, -282908? -56582b + 2 What is the b'th term of 1291, 2570, 3849? 1279b + 12 What is the j'th term of -9450, -18879, -28262, -37575, -46794, -55895, -64854, -73647? 4j3 - j2 - 9454j + 1 What is the o'th term of -85054, -85072, -85090, -85108, -85126? -18o - 85036 What is the q'th term of 73, 22, -43, -104, -143, -142? 3q*3 - 25q*2 + 3q + 92 What is the w'th term of 1620, 6649, 15030, 26763, 41848, 60285? 1676w2 + w - 57 What is the g'th term of -3086206, -3086206, -3086204, -3086200, -3086194? g2 - 3g - 3086204 What is the k'th term of 721, 751, 783, 817, 853, 891? k*2 + 27k + 693 What is the m'th term of 887, 1827, 2755, 3665, 4551, 5407, 6227, 7005? -m*3 + 947m - 59 What is the o'th term of -32406, -32399, -32396, -32403, -32426? -o*3 + 4o*2 + 2o - 32411 What is the m'th term of -12098, -48321, -108686, -193187, -301818, -434573, -591446, -772431? m*3 - 12077m*2 + m - 23 What is the y'th term of -115, -251, -417, -613, -839? -15y*2 - 91y - 9 What is the s'th term of -46469, -92921, -139373, -185825? -46452s - 17 What is the c'th term of -173947, -347896, -521845? -173949c + 2 What is the j'th term of 415, 340, 261, 184, 115, 60? j*3 - 8j*2 - 58j + 480 What is the x'th term of -13266, -26533, -39800, -53067, -66334, -79601? -13267x + 1 What is the x'th term of 339, 733, 1173, 1659, 2191, 2769? 23x*2 + 325x - 9 What is the d'th term of 30, 132, 300, 534, 834, 1200? 33d2 + 3d - 6 What is the y'th term of 665, 2554, 5679, 10034, 15613, 22410, 30419, 39634? -y*3 + 624y*2 + 24y + 18 What is the n'th term of 76, 272, 788, 1780, 3404? 26n3 + 4n*2 + 2n + 44 What is the s'th term of 333, -675, -2349, -4683, -7671, -11307, -15585, -20499? s*3 - 339s*2 + 2s + 669 What is the t'th term of 1099, 1756, 2399, 3022, 3619, 4184, 4711, 5194? -t3 - t2 + 667t + 434 What is the a'th term of 26432, 52856, 79268, 105662, 132032, 158372, 184676, 210938? -a3 + 26431a + 2 What is the l'th term of 1455, 5892, 13285, 23628, 36915? -l*3 + 1484l*2 - 8l - 20 What is the o'th term of 639, 1248, 2263, 3684, 5511, 7744? 203o2 + 436 What is the j'th term of 50, -177, -558, -1093? -77j*2 + 4j + 123 What is the w'th term of -2657, -2648, -2633, -2612, -2585, -2552? 3w2 - 2660 What is the i'th term of -2264, -18090, -61038, -144668, -282540? -2260i3 - i2 - 3i What is the v'th term of -111135, -111134, -111133, -111132? v - 111136 What is the f'th term of 3495, 14107, 31845, 56715, 88723, 127875, 174177? f3 + 3557f*2 - 66f + 3 What is the q'th term of 1109, 1090, 1071? -19q + 1128 What is the m'th term of -521, -1069, -1617, -2165, -2713? -548m + 27 What is the a'th term of -664, -714, -814, -976, -1212, -1534, -1954, -2484? -2a3 - 13a*2 + 3a - 652 What is the y'th term of -81450, -81439, -81414, -81369, -81298, -81195, -81054, -80869? y3 + y2 + y - 81453 What is the q'th term o	{ "pile_set_name": "DM Mathematics" }
(w) = -2w3 + 27w*2 - 15w + 23. Let u be y(13). Suppose -k = -2 - 0. What is the second biggest value in u, k, 6? k Let l be (-2 + 2)(-1)/2. Let d = -56.4 + 60.4. Which is the second biggest value? (a) l (b) -2 (c) d a Let n = 103 - 103. What is the smallest value in 4, -0.5, 2/9, n? -0.5 Let z = 48 + -48.5. Which is the fourth biggest value? (a) 145 (b) 1 (c) -3 (d) z c Let p = -1 - 5. Let n = -0.376 + 2.376. What is the second smallest value in p, -1, -5, n? -5 Let b be (-34)/(-4) - 1/(-2). Let z = -14 + b. Let p = -552 - -552.5. What is the third smallest value in z, 0.4, p? p Let z = -47.3 + 44.3. Which is the second biggest value? (a) -3/7 (b) -2/19 (c) z a Let v = 23.033 - 23. Let l = v - -4.967. Which is the second biggest value? (a) 0.3 (b) l (c) 1 (d) -5 c Let x = 3380 + -3378.009. Let j = x - -0.009. Which is the third biggest value? (a) -5 (b) -0.4 (c) j (d) 1/4 b Let d = 787/2 - 3931/10. What is the second biggest value in -0.4, d, -2/7, 0? 0 Suppose 2c - 2565 = -c. Let g be c/(-70)2/96. Let f = g + -1/32. What is the biggest value in 0.1, -1, f? 0.1 Let q = -1847 - -1847.5. What is the biggest value in -0.1, q, 3, -0.9? 3 Suppose 8d + 46 = 6d. Let y be -1(d/(-8) - 3). What is the smallest value in y, -2/5, 0.5? -2/5 Suppose k + 5 = -3u, 16k - 2 = 14k. Which is the biggest value? (a) u (b) -8 (c) -2/7 (d) 3 d Let r = -13 + 13.12. Let z = 8.88 + r. Let k = 9.2 - z. Which is the second smallest value? (a) 1/2 (b) -0.3 (c) k c Let z = -1202/9 - -722/9. Let p = z + 53. Let n be -3(0 + 6/99). Which is the biggest value? (a) p (b) -4 (c) n c Let g(l) = 7 + 11 - 24 + 12 - l*2 + 10l. Let r be g(11). Let c = -7 - -10. What is the smallest value in 17, r, c? r Let y(t) = -t*3 + 2t2. Let m be y(2). Let s = 431.7 - 432. What is the second smallest value in s, m, -6? s Let k = 40 - 58. Let t = k - -19.4. Let u = -1.6 + t. Which is the third biggest value? (a) -4 (b) -1 (c) u a Let u = 10 - 10.48. Let f = u + 0.43. Which is the third smallest value? (a) 2/5 (b) f (c) 0.5 c Let o = -2/151 - 143/604. Let g = -58 - -57.42. Let h = g - 0.42. Which is the biggest value? (a) h (b) -2/5 (c) o c Let u = 1844 - 1844. Let q = -4 - -3.92. Which is the third biggest value? (a) -3 (b) q (c) u (d) -1 d Let b = 3 - 4. Let s(d) = d2 - 8d - 88. Let f be s(14). What is the fourth biggest value in 1, 0.5, f, b? f Let y = 6.5 - 0.5. Let q = -198.3 + 198. What is the second biggest value in q, y, 2/7? 2/7 Let t be 10/(-6) - 2/6. Let i = -3411 + 3406. What is the third biggest value in -1/3, t, i? i Let j be (-15)/(-3) - 378/78. Which is the second smallest value? (a) j (b) 4 (c) -3 a Let b(u) = -u2 - 4u + 10. Let r be b(-5). Let j = -2.8 + -0.2. Let o = -3.3 - j. What is the smallest value in r, 4, o? o Let s = 5.18 - 5.68. Which is the second smallest value? (a) -1/6 (b) -2/7 (c) 2/7 (d) s b Let h be ((-145)/(-25) - 6)/(2/5). What is the second biggest value in 7, -0.15, h, -5? -0.15 Let k be (-2)/(-6)(-12)/16. Let x = 1/4 - k. Let q = 0.61 + -1.11. What is the second biggest value in x, q, 5? x Let l = -4183 + 79479/19. Let i = 15/11 - -3/22. What is the fourth smallest value in l, 0.4, 2, i? 2 Let z be 2/(-7) - 38/(-35). Let w = 10 + -10.1. What is the third smallest value in -0.09, w, z? z Let g be ((-415)/(-4))/(-321/36). Let f = g - -59. Which is the biggest value? (a) 1 (b) f (c) 1/3 (d) 5 d Let j be (-224)/28 - 147/(-19). What is the second biggest value in -3/7, j, 0, 0.2? 0 Let y = 1.3 - 1.5. Let w = -12 + 9. Let p be ((-4)/32)/(2 + w). What is the third smallest value in p, y, -4/5? p Let g = -1916 + 1917.2. Which is the fourth smallest value? (a) 2/5 (b) -1 (c) -3 (d) g d Let i = 126 + -120.95. Let t = i + -0.05. What is the second smallest value in t, 2/15, 7? t Let z = 26.8 - 27. Let g be 135/25 - 2/5. Which is the second biggest value? (a) z (b) g (c) -2/3 a Let j = 335 - 340. What is the biggest value in -1, -3, 5, j? 5 Let p = -11.3 + 0.9. Let q = 3.6 - p. Let g = q - 14.2. What is the biggest value in 0.2, g, 3? 3 Let x = -0.044 + -0.016. Let f = -0.06 - x. Which is the third biggest value? (a) f (b) 0.02 (c) -0.06 c Suppose -3r + 6 = -21. Let g = 2498.1 - 2498. Which is the smallest value? (a) r (b) -1/4 (c) 0 (d) g b Let i = 939/8 - 117. Suppose -65m + 60m - 18 = 4v, 3v - 2 = 4m. Which is the fourth biggest value? (a) 3 (b) i (c) 2/7 (d) m d Let a = 0.04 + 0.25. Let b = a - 0.18. Let z = -2.11 + b. What is the second smallest value in z, -2/9, -4/5? -4/5 Let g = -510.55 + 510. Which is the third smallest value? (a) -1 (b) g (c) 1 c Let m be -4(17/68 - 5/28). What is the third smallest value in 1, -2/5, m, 0.02? 0.02 Let z = 897.6 + -898. Which is the third biggest value? (a) -0.07 (b) z (c) -5 (d) -2/9 b Let k = -0.726 + -5.274. What is the third biggest value in -2, -0.4, -1/3, k? -2 Let y be (-4)/(-8) - 148/(-192). Let w = y - 15/16. Let j = -13/9 - -38/45. Which is the second biggest value? (a) 5 (b) j (c) w c Suppose 2s - 50 + 52 = -j, -5j + s + 1 = 0. What is the third smallest value in -2/9, 0.14, j, -3? j Let s = -2 + 2. Let d = 1264 - 1261. Which is the third biggest value? (a) s (b) d (c) 9 a Let w = -166/9 + 812/45. Which is the second smallest value? (a) 1.5 (b) -1 (c) 4 (d) w d Let l = 0.021 - 0.021. What is the third smallest value in -1/4, 50, l, 2/5? 2/5 Let m = -2 - -7. Let p = 2607 - 2604. What is the biggest value in 0, p, m, -1/6? m Let p = 1 + -6. Let r = 113.8 - 108. Let k = 6.8 - r. What is the smallest value in p, 1/3, k? p Let m = 4 + 2. Let v = m + -6. What is the second smallest value in -0.05, 2/7, v? v Let l = -23 - -9. Let i = 13.94 + l. Let f = i - 4.94. What is the smallest value in f, -3, 0.1? f Suppose 2l - 2 = -2b, l + 9 = b - 0l. Suppose 4 = g - b. Suppose 0 = 3w - 6 - g. What is the third smallest value in -2, w, -2/11? w Let f = 32.7 - 34.7. Let i = -0.3 + 4.3. Which is the second biggest value? (a) -9 (b) f (c) i b Let o(n) = -n2 - 14n - 15. Let u be o(-10). Let g = 29 - u. Which is the second biggest value? (a) 0.3 (b) g (c) 5 b Let f(w) be the second derivative of 5w3/6 - w2/2 + w. Let r be f(1). Let d = -1322 + 1322.1. Which is the second biggest value? (a) r (b) -1 (c) d c Suppose -2h - 1 - 7 = 0. Let d be (20/h + 2)-1. What is the second smallest value in d, 0.1, 4? d Let o = 1.02 + -2.02. Let g = -30 - -21. What is the second biggest value in o, -0.1, -5, g? o Let g = 29 - -304. What is the biggest value in 0, g, 0.1? g Let d = -4 + -61. Let v be (-48)/(-195) - 10/d. Which is the biggest value? (a) -1/5 (b) v (c) -6 b Let c = 0.243 + 3.757. What is the third smallest value in -3, 23, c? 23 Suppose -4i + 8i = -f - 16, -f - 4 = i. Which is the second biggest value? (a) -30 (b) 2/7 (c) -4 (d) f d Let x = 0.0617 - -0.0283. What is the biggest value in -2, 0.19, x? 0.19 Let q = 636 + -26711/42. Which is the biggest value? (a) 5/4 (b) q (c) 2 c Let p = 35 - 5. Let q = p - 29. Which is the smallest value? (a) -6 (b) 0.2 (c) q a Let s = 128.9 - 130.9. What is the second biggest value in 3/5, -37, s? s Let y = -0.5 + 4.2. Let t = 26.3 + y. Which is the biggest value? (a) 2/9 (b) t (c) 4 (d) 0.1 b Let t be (6 + 4)/(-7 + -1). Which is the smallest value? (a) 0 (b) t (c) 127/3 b Suppose -22 = 21t + 20. What is the fourth smallest value in t, 21/8, -0.5, 1? 21/8 Let h = 49 - 52. Which is the biggest value? (a) h (b) 5 (c) -1/4 b Let j = 3.3 + -3.4. Let v = -0.2 + j. Let n be (30/(-7))/(-3) + -1. What is the second biggest value in v, n, 0.3? 0.3 Let u(x) = -2x2 - 4x + 1. Let j be u(-3). Let i be ((-43)/(-15))/1 + (-52)/(-390). Which is the third biggest value? (a) i (b) 1 (c) j c Let x = -238/15 - -71/5. Let h = 20.4 + -13.4. Let d = -2 - 0. Which is the second biggest value? (a) x (b) h (c) d a Let v be (1 - 0) + 170/45 - 5. What is the smallest value in -5, -1, v, -0.05? -5 Let w be 3 - -26(-1)/42. Let j(u) = -u*3 - 9u*2 + 9u - 9. Let c be j(w). Let q = 0.02 + -2.02. What is the biggest value in c, q, -2/11? c Let v = 204 - 208. What is the third biggest value in v, 2/9, -5? -5 Let m(b) = -2*b + 3. Let h be m(2). Let z = -	{ "pile_set_name": "DM Mathematics" }
= 805 - 624. What are the prime factors of q? 181 Let a = -61 - -66. What are the prime factors of 3509/44 + (10/8)/a? 2, 5 Suppose 3a + 14 = 5. Let p be (-22 - 1)-1 - a. Suppose y = n + 8, 2y - 20 = -4n + p. What are the prime factors of y? 13 Let l be -275 + (1 + -1)/((-14)/(-7)). Let j = -165 - l. What are the prime factors of j? 2, 5, 11 Let q be (27/(-12))/(6/(-32)). Suppose 0 = 3d - q + 6. Suppose -df - 13 - 5 = -3h, 4h - 2f = 24. What are the prime factors of h? 2, 3 Let m = 421 - 31. What are the prime factors of m? 2, 3, 5, 13 Let k(h) = -h2 - 2h + 6. Let z(g) = -2g2 - 3g + 12. Let f(u) = 7k(u) - 4z(u). Let q = -4 + 9. List the prime factors of f(q). 3 Let w be 1(4 + -3) - -32. Suppose 0 = c + 11 - w. List the prime factors of (c/(-4))/(2/(-8)). 2, 11 Suppose -2x + 3 = -1. Suppose 3h + 12 = 5f + h, -xf + 16 = 2h. Suppose 5t - 28 = -4z + 9t, 2t = -fz + 46. What are the prime factors of z? 2, 5 Let j be 327 + (-1 + 0)/(2/(-6)). Let g = j + -176. What are the prime factors of g? 2, 7, 11 Let t = -173 - -175. List the prime factors of t. 2 Let a(j) be the first derivative of -j4/4 - j3 + 3j*2 + 4j + 3. Let s be a(-5). Let n = 52 - s. List the prime factors of n. 2, 7 Let v = -10 - 0. Let i be (-22)/55 - 4/v. Suppose -3g = 5h - 134, 0 = 5h - ih - 5g - 110. What are the prime factors of h? 5 Suppose -16896 = -6w + 5076. What are the prime factors of w? 2, 1831 Let h = -124 - -401. List the prime factors of h. 277 Suppose 2p + 58 = 262. What are the prime factors of p? 2, 3, 17 Suppose -3768 = -95f + 91f. What are the prime factors of f? 2, 3, 157 Let z = 712 + -221. List the prime factors of z. 491 Let x(q) = q3 - 5q2 - q - 6. Let p be x(5). Let t(v) = -v2 - 11v + 3. Let o be t(p). List the prime factors of o/(-9) + (-68)/(-6). 11 Suppose 3b - b = 12. Let h be ((-8)/(-10))/(b/15). Suppose hz + 4w + 33 = 7z, 4w - 12 = 0. List the prime factors of z. 3 Let b be 2/4 + (-686)/28. Let n = b - 12. List the prime factors of (-1 + (-4)/(-16))n. 3 Let t(x) = x3 + 11x*2 + x - 15. Let k be t(-11). Let l = k + 29. Suppose -2a - j = -89, 0a - la + 131 = j. What are the prime factors of a? 2, 3, 7 Let o(d) = -11 - 6d - 19 - d3 + 1332d*2 - 1340d*2. What are the prime factors of o(-9)? 3, 5, 7 Let k = 461 - 433. Suppose n = -4n + 255. Suppose -13 = -2g - 2p + n, -g = 5p - k. List the prime factors of g. 3, 11 Suppose 4m + 0m = 104. Let d be -1 - (4/(-6))/((-2)/39). Let w = m - d. List the prime factors of w. 2, 5 Let j(u) = -u3 - 2u*2 + 2u + 1. Let v be j(-3). Suppose 0 = g - 4n - 19, -vg + 0n + 2n + 20 = 0. Suppose g = r - 7. List the prime factors of r. 2, 5 Let s(n) = -n - 1. Suppose -3r - 2 = 10. Let k be s(r). Suppose -ko + 138 = -0o. What are the prime factors of o? 2, 23 Let z be ((-2)/6)/((-2)/6). Suppose -2g + 7 = 3x, 5x + 0 = -2g - 3. List the prime factors of (z - -19)/(g - 9). 2, 5 Suppose -4x = -0x. Suppose -3v = -6v - 2d - 10, x = -4v - 4d - 20. Suppose 9u - 4u - 40 = v. What are the prime factors of u? 2 Suppose 3l - 4l = -2, 5l - 1790 = -5h. List the prime factors of h. 2, 89 Let x(f) = 2f2 + 16f. Suppose 4d = a - d - 4, 16 = -4d. List the prime factors of x(a). 2 What are the prime factors of (1530/(-120))/((-1)/361)? 3, 17 Let b(v) = 3v - 20v - 3 - 1 + 0. What are the prime factors of b(-5)? 3 Let g be (-20)/(-9) + (-18)/81. Suppose u - g = -0u. Suppose 3r + 2i = -2r + 27, -4r + 18 = -ui. List the prime factors of r. 5 Suppose -635w - 1525 = -636w. List the prime factors of w. 5, 61 Suppose 0 = -2h - 4i + 1038, 2i + 647 = 2h - 379. What are the prime factors of h? 5, 103 Suppose -z - 4900 = -11z. List the prime factors of z. 2, 5, 7 Let p = 9 - 6. Suppose y - 4y = 2b - 39, -pb = 2y - 61. What are the prime factors of b? 3, 7 Let x(j) = j*3 + 15j*2 - 9j - 1. Let k be x(-15). Suppose k = 3d - u, -3d - 82 = -5d - 3u. List the prime factors of d. 2, 11 What are the prime factors of (615 - -10) + (8 - 0)? 3, 211 Let u = -3 - -5. Suppose -uy = -58 - 6. What are the prime factors of y? 2 Let f(u) = -8u - 18. Let a be f(-12). Suppose 0 = -o - 43 - a. Let t = -58 - o. What are the prime factors of t? 3, 7 Suppose 5c + 4b - 1655 = 0, -5c - 4b = -3c - 662. List the prime factors of c. 331 Suppose -22c + 10635 = 3441. What are the prime factors of c? 3, 109 Let q(m) = -m - 1. Let x(t) = 6t + 20. Let o(z) = -4q(z) - x(z). Let c = -20 + 5. What are the prime factors of o(c)? 2, 7 Suppose -y - 22 + 17 = 0, 2o - 746 = -4y. List the prime factors of o. 383 Let j = -75 - -591. Let y = j - 273. List the prime factors of y. 3 Let c(q) = q*2 + q + 29. Let v be c(-13). Let u = -41 + v. List the prime factors of u. 2, 3 Suppose 4a + 5i + 39 = 0, 99 = -5a - 3i + 34. Let l = a - -26. What are the prime factors of l? 2, 5 Let t = -163 + 167. Suppose 0 = -g - 5x + 360, 3x - 5x + 1440 = tg. List the prime factors of g. 2, 3, 5 Let j(y) = -8 - 11 + 25 + y. Let r be j(6). Let z = r - 10. What are the prime factors of z? 2 Let h = -60 - -65. Suppose -2t + 7t + hq - 1080 = 0, 5q = 15. List the prime factors of t. 3, 71 Suppose -3m - 357 = -3i, -2i - 2i + 3m + 475 = 0. What are the prime factors of -2 + i + (6 - 2)? 2, 3, 5 Let u(o) = -9020 + 9030 + 0o - 65o. List the prime factors of u(-3). 5, 41 Suppose 4b + p - 27 = 16, 4b + 3p - 49 = 0. Let l be b/6 - 6/(-18). Suppose -l = u - 2u. What are the prime factors of u? 2 Suppose -5i - 4 - 6 = 0, -5i - 202 = -2z. Suppose 4j = 2l - 82 - 8, -2l + 2j = -z. What are the prime factors of l? 3, 17 List the prime factors of (-1 - (-11 - 808))/((-2)/(-8)). 2, 409 What are the prime factors of (14 + 6703)(10/6)/5? 2239 Let m(j) = j - 3. Let t be m(5). Suppose -tn + 0n + 12 = 0. What are the prime factors of 57/n - (-18)/(-12)? 2 Let u = -54 + 55. Let d(q) = 16q2 + 2q - 2. List the prime factors of d(u). 2 Suppose 4n = 6y - 5680, y + 4y + 2n = 4760. What are the prime factors of y? 2, 5, 19 Let z(q) = -7q3 + 6q*2 + 11q + 5. Let c be (-34/20)/((-4)/(-20)). List the prime factors of z(c). 5, 43 Let u(k) = k3 - 4k*2 + 3k + 3. Let o be u(3). Let b be (66 + o + -5)/1. Suppose 91 = 5f - b. What are the prime factors of f? 31 Suppose 0 = -5v - 4j + 3439 + 1114, -3v + 4j = -2719. List the prime factors of v. 3, 101 Suppose -5v - 489 = -4739. Suppose 11i - v - 2769 = 0. List the prime factors of i. 7, 47 What are the prime factors of (112/84)/((-4)/(-13659))? 29, 157 Let q(b) = -186 - b + 0b - 3b + 171. Suppose 22 = -3v - 14. List the prime factors of q(v). 3, 11 Suppose -6t + 12 = -2t. Suppose 0 = tx + x - 508. What are the prime factors of x? 127 Let k(s) = -35s3 + s2 + 7s + 2. List the prime factors of k(-2). 2, 17 Suppose -5d = 66 - 46. Let w(n) be the second derivative of -7n3/6 - n2 - n. List the prime factors of w(d). 2, 13 Let k be 7/(7/8) - 4. Suppose ku - 194 = 122. What are the prime factors of u? 79 Let f = 95 - -252. List the prime factors of f. 347 Let f = -26 + 30. Suppose -5b - 8 = -3b, fy - 432 = 3b. What are the prime factors of y? 3, 5, 7 Suppose 2r + 15r - 34136 = 0. List the prime factors of r. 2, 251 Suppose -4h = -0u + 4u - 12, -2h + 2u = -22. Let i = 20 + h. Suppose -i = 4p - 5j - 69, 2j = -4. What are the prime factors of p? 2 Let s be (-8112)/(-64) - 3/4. Suppose -5b - 5l = -365, -2b + 3l + s = l. List the prime factors of b. 2, 17 Let a be (-6 + 5)6/(-2). Let y be 2/a(-2 + 5). Suppose 15 + 19 = yb. What are the prime factors of b? 17 Let z = -21 - -66. Let i = 87 - z. List the prime factors of i + -3 + (-12)/(-3). 43 Let a be ((1404/(-15))/4)/((-1)/5). Let q be (-2 - 2)6/(-8). Suppose -6n + n - 2g = -118, 0 = -5n - qg + a. What are the prime factors of n? 2, 3 Let n = -30 + 28. Let r be (-6)/(-1)n/(-3). List the prime factors of (47 + -2)/(4/r). 3, 5 Let h(o) = -1 + o3 - o3 - o2 - 4o*3 + o. Let b be h(1). Let f = b + 18. List the prime factors of f. 13 Let z be 12/(-42) + (-60)/(-14). Let i be (-2 + 8 + 1)1. What are the prime factors of 12z/(12/i)? 2, 7 Let d(v) = -795v*3 - 1. Let p be d(-1). Suppose -4j - p = g - 4g, 3g + 5*j = 803. Suppo	{ "pile_set_name": "DM Mathematics" }
8 = -4u, 2u - 5 = -4q + 3. Solve p = -us + s + 4 for s. -4 Let b(j) = -j*3 + 9j*2 + 2j - 17. Let t be b(9). Let c(g) = 10g2 - g - 1. Let y be c(t). Solve -2x - y + 2 = 0 for x. -3 Let q be 12/(-9)((-23)/2 - -7). Solve -3f + 15 = -qf for f. -5 Suppose 5j + 20 = -5f, -2j - 21 = -2f - 29. Solve 0m - 3m - 10m = j for m. 0 Suppose -2b = -0b - 18. Let p(o) = -2o + 63. Let y be p(29). Solve -6 - b = yn for n. -3 Suppose -2l + 5 = -l. Suppose 14 = -4g + 34. Suppose 2v + 11 = -0v - 3w, 0 = -4v - gw - 17. Solve 0 = lt - 3t + v for t. -1 Let c be (-30)/(-8)16/3. Suppose -m - 8 = -4m - 2b, -4m = -2b - c. Suppose -3s = -3, 0 = o - ms + 2 - 0. Solve -oj + 2 = -4 for j. 3 Let a = -662 + 664. Let k be (-15)/(-12) + 2/(-8). Let d be 4(2 + 0/k). Solve aw = 4w - d for w. 4 Suppose 5a + 2 - 12 = 0. Suppose 191 = 5u - 2v, -u = au - 2v - 113. Suppose 86 = 5q - u. Solve -4m + q = m for m. 5 Let y(s) = 2s*2 + 55s + 31. Let f(k) = -k*2 - 28k - 15. Let a(c) = 11f(c) + 6y(c). Let i be a(-21). Solve -2o + 0 + 8 = i for o. 4 Suppose -3z = 6, 4i + 49 = -4z + 9. Let v be 100/16 - (-2)/i. Suppose -l + 20 = 3n, -6 + 11 = 4n - 3l. Solve 4 = nd - v for d. 2 Suppose 2t + 0t + 11 = -f, 3f + t + 8 = 0. Let z be (-1 - f - -2) + -17 + 20. Solve 9 = 4m + z for m. 1 Let m = 309 + -305. Solve 11t = -4t + mt for t. 0 Let a(t) = t + 15. Let x be a(0). Let l be 6/(3 - 35/x). Let k be (-24)/16(-12)/l. Solve 0 = -kf + 6f - 20 for f. 5 Let d(p) = -p - 8. Let u be d(-10). Suppose -3g - 4s + 20 = -0g, g + s = 7. Solve -uz + g = -6z for z. -2 Let x = 16 + -16. Suppose -n - 3i = -xn + 6, 3i = -15. Let a be (-1)/1(-11 + n). Solve 0 = 4q + 6 + a for q. -2 Let c = 755 - 752. Solve -36 = ck + 9k for k. -3 Let l be 7/(-2) + (5 - 45/10). Let s be 56/24 - (-1)/l. Let j(n) = n*3 + 3n*2 - 2. Let z be j(-2). Solve z = -d + sd for d. 2 Let z(p) = -p*3 - 4p*2 - p - 4. Let t be z(-3). Let h = -10 - t. Solve h = 2y - 6y for y. 0 Suppose 0 = -2r + 4. Suppose k - 32 = -5g, -44k + 46k - 5g = 4. Let m = 7 - 1. Solve ro - mo = k for o. -3 Let n = -16 - -21. Suppose -nw - 50 = 4m - 19, m = 2w - 11. Let i be 3((-3)/m - -2). Solve 0 = 2p - ip - 20 for p. -4 Let l(o) be the first derivative of -3o2/2 + 48o - 9. Let k be l(15). Solve 0 = kg + 5 + 7 for g. -4 Let g(k) = k3 - k2 + 3k + 27. Let z be g(0). Solve 3x = -z + 30 for x. 1 Let b = -888 + 904. Solve -31 = -bn + 1 for n. 2 Suppose 5h = -4t + 71, 0t + 3t - 72 = -5h. Solve 0 = -12u + hu - 6 for u. 2 Suppose -3o - 84 = -5o. Suppose -3z = 2q + z - o, 2q - 5z = 24. Let b = 18 - q. Solve -5s - 16 = -b for s. -3 Suppose -880 = -58c + 47c. Solve -21f = -5f + c for f. -5 Let h be (-9)/(-6) - (1/(-2))/1. Solve hr + 4r + 18 = 0 for r. -3 Suppose 102u - 106u = -8. Solve 0y = y + u for y. -2 Suppose -2m + 2c = m - 23, 5c = -5m + 5. Solve mj = 1 - 6 for j. -1 Suppose -42 = -17n + 3n. Let k(t) = -t*2 - 7t + 11. Let w be k(-8). Solve -2f + w = -nf for f. -3 Let c(l) = 6l3 + l2 - 1. Let i be (-6)/(-1)(-1)/(-6). Let y be c(i). Suppose 0 = -4x + 7x - y. Solve 3 = -xg + 5 for g. 1 Let n be (-2)/(-12) - 2/(-12)-79. Let o = n + 15. Solve o = -b + 3 for b. 1 Suppose -13x = -0x. Suppose -4z - 20 = 5p, -z - 2p = -xz + 8. Solve -5l = -zl + 15 for l. -3 Let r be (-644)/(-184)(-4)/(-7). Suppose 0 = -4c + 12, -2p - 5c + 19 = -32. Solve p = 4t + r for t. 4 Let p = -41 + 45. Solve -4d + p = -0 for d. 1 Suppose 12 = -g + 5g. Suppose 2 = -gc + 14. Let y = 3 + -1. Solve 3z - c = yz for z. 4 Let p(g) = -g*3 + 15 - 2g - 7g2 - 1 + 4g. Suppose -k - 4 = 3. Let y be p(k). Solve yo = o + 5 for o. -5 Suppose -3g = 4x - 0x - 22, 5x - 3g - 41 = 0. Solve 8w = xw + 4 for w. 4 Let m(p) = p + 1. Let a(z) = z*2 - 9z - 8. Let y(g) = -a(g) - m(g). Let c be y(7). Suppose 5l + 4 - c = 0. Solve 0 = lx - 7 + 3 for x. 2 Let j = 6 + -16. Let p = -1 - j. Solve 2y = -y + p for y. 3 Let h(k) = k3 - 30k*2 + 83k - 18. Let u be h(27). Solve -13o + o = -u for o. 3 Let o(v) = 16v*2 - 3v - 2. Let l(g) = g + 17. Let k be l(8). Suppose 2p - 4 - 10 = -4a, -5a + k = -5p. Let n be o(p). Solve 5m = -n + 42 for m. 5 Let g = 573 - 562. Solve -g = 2f - 7 for f. -2 Suppose 265b + 21 = 272b. Solve m - 6 + b = 0 for m. 3 Let x = 33 - 41. Let y be (-6)/(-3) + (-6 - x). Solve -yv - v = -25 for v. 5 Suppose 30r - 408 = -38r. Solve rw + 5 = w for w. -1 Let n(t) = -2t3 - 7t*2 - 10t - 2. Let q be n(-2). Solve -14 - 10 = -ql for l. 4 Let n(t) = 7t - 3t2 + 6 + 4t*2 + 0t*2. Let i be n(-8). Let f = i + -11. Solve 2 = -fr - 4 for r. -2 Let q be 15/((-2)/1(-3)/6). Solve q = 7p - 13 for p. 4 Suppose l - 4l = -5n - 616, -5l - n = -1036. Solve -lo = -208o + 2 for o. 2 Suppose -1885s + 1902s = 1003. Solve -so + 6 = -56o for o. 2 Let l(a) = 9a*2 + a + 4. Let v(k) = 4k*2 + 2. Let g(z) = -3l(z) + 7v(z). Let o be g(2). Solve o = 4w - 2w - 6 for w. 3 Let p = 17 + -19. Let z be -3 + 28 + 0/p. Suppose -j = -5g + 25, 2g - 23 = j + 2j. Solve -5 = -gd - z for d. -5 Suppose -8a - 2a = 0. Solve a = 2t + t + 15 for t. -5 Let m(h) be the third derivative of -7h4/12 + h3/6 + 3h*2. Let u be m(-1). Let b be 312/54 - 2/(-9). Solve bo - o = u for o. 3 Suppose 0 = 5y - 2u - 27, -12u + 8u = -y + 9. Let t(z) = z*2 - z + 2. Let o = 6 + -4. Let r be t(o). Solve w + rw = y for w. 1 Let k(v) = -v*3 + 6v*2 - 5v + 7. Let h be k(5). Suppose -4u = -h - 13. Solve -4l - 11 = u for l. -4 Let p be 12/(-42) + (-144)/(-14). Suppose -4c + p = c. Suppose -g + 7 = 2d, cg - 15 = -3d - g. Solve dv + 20 = -3v for v. -4 Suppose 0 = -26a + 46 + 448. Solve -4l - a - 1 = 0 for l. -5 Let b(g) = -g*3 - 4g - 5. Let a be b(-4). Solve 0 = ah - 73h - 6 for h. 3 Let k = -13929 - -13929. Let n(w) = -w*2 - 3w + 2. Let c be n(-3). Solve cf = -kf - 8 for f. -4 Let x = 1049 + -1043. Solve xu + 192 - 174 = 0 for u. -3 Suppose 16 = 5y - 4. Suppose -2w + 2r - yr - 16 = 0, 0 = 5w - 5r + 50. Let o be (-6)/(-4)(-24)/w. Solve -4h - 16 = -o for h. -3 Let n be (102/(-221))/(2/(-13)). Suppose -2o + 15 = 5q, -110 = -5o - 0q + 2q. Solve 0 = nl + l + o for l. -5 Let k = -805 + 810. Solve k = 16n - 11n for n. 1 Let h be (7 - 8)/(2/94). Let d = -43 - h. Solve dm = -20 - 0 for m. -5 Let g be ((-264)/36)/(3/9 - 1). Solve -2m = 15 - g for m. -2 Suppose -978 = 8k + 278. Let g = k + 163. Solve -j = -gj for j. 0 Let q be (3 - 21)/(-3) - 2. Suppose 0 = 3r - qj - 19, 2j + 0 = -2. Solve -3a + ra = 8 for a. 4 Let y = -2 + 37. Solve -y = -6b - b for b. 5 Suppose -3d + 3v + 13 + 5 = 0, 5d - 21 = 2v. Solve -di - 4i = 0 for i. 0 Suppose 285 = 3x + 3s, 2x + 0x - 181 = s. Suppose 5a = -18a + x. Let n be 1/(-2) - (-9)/2. Solve -a = 2i + n for i. -4 Suppose 4q - 65 = -q. Let d = q - 11. Suppose -3k = 14 - 5, dr - 2k = 12. Solve l - 4l = -r for l. 1 Suppose -17z + 3 = -18z. Let s = z + 8. Solve sg = 12 + 3 for g. 3 Suppose -13 = k + 6. Let r = -19 - k. Solve 4x + x + 10 = r for x. -2 Suppose -4g = 3y + 2, 2 = 4y + 2g - 2. Let v(s) = -2s - 4. Let a be v(-4). Suppose -2c + 0 + 4 = 0. Solve 0 = cl - al - y for l. -1 Suppose 10 = 5b - 3b. Solve 0 = bh - 2 + 27 for h. -5 Let i(n) = -n*3 - 15n*2 - 14n + 1. Let z be 9/(-4 - (-2 - 1)). Let m be (z/(9/14))/1. Let x be i(m). Solve 2 = 3d - x for d. 1 Let k be (-4 - (-2 - -1)) + (13 - 10). Let g be (-14)/(-4)(-1)/(-7)k. Solve -j - 3 - 2 = g for j. -5 Let u(v) = v - 68. Let k(l) = -34. Let r(w) = -7k(w) + 3u(w). Let i be r(-10). Suppose 0 = -5m - 2g - 2g + 25, -3g + 20 = 5m. Solve 0 = s + m - i for s. 3 Let b(u) = u*3 + u - 2. Suppose -3r + 2p = 2r - 13, 0 = 2r + 3p + 10. Let c be b(r). Solve c = 3v - 19 + 4 for v. 5 Let a be (-10 - 3) + (3 - 2). Let o = -9 - a. Suppose -2b - ob - 20 = 0, 4g + 5b = -12. Solve 8 + 2 = gy for y. 5 Suppose -40 + 0 = -5i - 5d, -3i = -5d. Suppose -2w = 6, 5y + 2w = 3w + 23. Suppose yu + 4 = 6u. Solve -c + uc = i for c. 5 Suppose -3d + 6d + 20 = 4v, -3d = 0. Solve -vl + 3l = 4 for l. -2 Let v(y) = 12y*2 + 5y - 6. Let q be v(1). Suppose -1 = 3c + q, -h = 4c + 16. Solve h =	{ "pile_set_name": "DM Mathematics" }
3. Let i be j(2). Let s be 336/102 + (6 - 10). Is i at least as big as s? False Let x be ((-1986)/(-18))/(2/(-2))-3. Is x smaller than 333? True Suppose -4q = 11 + 1. Let o be 6/(-9)q/(-54). Do o and 1 have the same value? False Let l(b) = -b2 - 5b + 3. Let d be l(-4). Suppose -5r - 168 + 33 = 0. Let u = 35 + r. Are d and u equal? False Suppose 2l + 9 = 5c, 5l = l + 4c. Let d be (l/(-1) + 3)/1. Let u = 1 + d. Which is greater: u or 2? 2 Suppose -87 = 5i - 3k - 71, -17 = 4i - k. Is -0.046 bigger than i? True Let w(z) = -z*3 - 7z*2 - 8z + 10. Let r be w(-9). Let a = r - 2194/9. Suppose -5y + 19 + 1 = -5p, -5p - y = -10. Which is bigger: p or a? p Let d be ((-1)/(-2))/((-7)/14) + 284. Let k = 1965/7 - d. Which is smaller: -2 or k? k Let l = -348 - -348. Is l <= -1/824? False Suppose 3p + 5s - 6 = 1, 5p - 3s + 11 = 0. Let g = 16498/75 - 220. Is g less than p? False Let r be 92((-3)/1 - (-104)/32). Let l be r/9 + (-24)/6. Which is smaller: -0.1 or l? l Let j be -2 - (2 - (-134)/(-33)). Let a = -232 + 232. Are j and a equal? False Let t be 28/21(-3)/2. Let x be (t + 134/66)(-23 - -20). Which is smaller: -2 or x? -2 Let k(u) = -38u - 607. Let r be k(-16). Is r smaller than 11/32? False Let g(v) = 0v - 3 - v - 4 + 0. Let y be g(-10). Suppose 2x = 2z, -5z = -2x + yx. Which is smaller: x or -1? -1 Let r = 2.317 + -0.017. Let x = -2.35 + r. Which is smaller: x or -0.1? -0.1 Let b be (12 + 0)510/340. Which is smaller: b or 37/2? b Let r = 195 - 213. Which is smaller: -200/11 or r? -200/11 Let x(b) = b + 12. Let a be x(0). Let g be (-10)/a - 16/(-24). Is 0 smaller than g? False Suppose -2a + 14 = -4n, -5n - 2a + 7a = 25. Let d(p) = -p2 + 1. Let c be d(n). Which is greater: 2 or c? 2 Suppose 0 = 2n - 6 + 78. Let z = n - -38. Which is smaller: z or 9/11? 9/11 Let a = -508.948 - -509. Which is smaller: a or 1? a Let v = -1.6 - -1.3. Suppose 0 = -2z + z - 1. Let y be (-1)/z - (-2)/4. Is v smaller than y? True Let j(w) = -2w - 4. Let d(x) = x*3 + 4x*2 - 5x - 6. Let v be d(-5). Let n be j(v). Let p be (-4)/n - 1/(-2). Is p at least as big as -2/11? True Let k = 455 + -329. Which is bigger: -1 or k? k Suppose 13o = 15o + 634. Is -317 > o? False Let v be 0 + (-2)/9 - 423/(-81). Suppose vm - m + 8 = 0. Which is smaller: -9/11 or m? m Suppose -8p + 152 = -4p. Let h = -38 + p. Is h less than or equal to -2/45? False Let v(t) = -112t - 15. Let b be v(1). Which is smaller: -129 or b? -129 Suppose -5z + 3z - 118 = 3s, 0 = -4s + 2z - 162. Let i be (1 - s/(-4))-1. Let j be (8/6)/(3/i). Which is smaller: 0 or j? 0 Let q = 160663/41 - 3920. Which is smaller: q or 0? q Suppose -3b + 4w - 246 = 0, 3b = 6b + 4w + 270. Is -86 greater than b? False Suppose 9 = 3k - 3l, 4k - 3k + 6 = -2l. Let v be 15/3 + k - 0. Suppose vw = 2w. Is 6/11 at most as big as w? False Let m be (-16)/20 + 1295/1775. Which is greater: 1 or m? 1 Suppose 3f - 5u + 30 = 0, 2f - 2u = -2f - 40. Which is greater: f or -12? f Let f = -0.09 - -0.46. Let z = -0.47 + f. Which is bigger: z or 4? 4 Let t = 28 + -24. Suppose -ty - 24 = -2y. Is -12 at most y? True Let k = 74 + -44. Suppose 3v - k = 5y, -y + 2v - 6 = -2v. Let l(i) = -i2 - 5i - 5. Let g be l(y). Which is greater: g or -13? g Let x be 0(-3)/(-2 - -5). Is x less than or equal to 1/63? True Let q = -3713/10 + 372. Let p be 8/(-40) - (-1 + 4). Let w = q + p. Which is smaller: w or -3? -3 Suppose -5c = -2c + 90. Let f = -14/9 + 17/9. Is c equal to f? False Let m = -2/9 - -13/18. Let v = 3 - -11. Let g = 12 - v. Which is smaller: m or g? g Let m(l) = -16l + 58. Let b be m(-2). Is b equal to 177/2? False Let w be (-1)/4 - 393/(-1540). Are w and 1 unequal? True Let v = 60 + -55.8. Let m = v + -4.4. Which is bigger: m or 0.1? 0.1 Let j = -1549 + 1523. Are j and 26 nonequal? True Suppose -2t - 2t - 28 = 2i, -56 = 4t - 5i. Suppose -4d + 398y - 395y - 25 = 0, -2d = 3y + 35. Which is smaller: t or d? d Let q be (6/6)/(2/12). Suppose -1 = r - q. Suppose 0 = 3a - 3v - 3, -r = 4a - 4v + 3v. Are -7/4 and a nonequal? True Let i = 40 - -2. Let l = 41 - i. Is l < 0.11? True Let f be 3/((-9)/2772-2). Which is bigger: 461 or f? f Let r = 24 - 9. Suppose -4o + 3o = 4t - 8, -3t - r = -o. Let v be (20/(-75))/(o/10). Are 5 and v nonequal? True Let t = 2 - -4. Let s be (-9)/t(-8)/36. Are -1 and s equal? False Let q = -150 - -151. Suppose -5w + 30 = -2w. Let i be (-9)/w24/(-18). Is i less than or equal to q? False Suppose -5s = -5t - 110, 2s + 3t = t + 52. Let m be -2 + 0 - s/(-10). Is m at least 30? False Suppose 0 = 3t - 3s + 8s + 4, 0 = t + 4s + 13. Which is greater: 62 or t? 62 Let t be ((-15)/25)/(-2 - (-1)/2). Is t less than 3010? True Let u be (-1 + (4 - 1))1. Let s be ((-16)/144)/(u/(12/(-34))). Is 0 >= s? False Suppose 0 = -3v - 2v + 20. Suppose 0 = 4s - vj - 16, -5 = 5j - 0. Let u = 743 - 743.1. Is s greater than or equal to u? True Let l = 16 + -28. Let t be (-3)/l + -2 + 259/20. Is t at least as big as 10? True Let n be ((-8)/(-72))/((-4)/(-18)). Are -111/2 and n non-equal? True Let h(u) = u*2 - 2u - 9. Let v = -55 + 59. Let b be h(v). Which is bigger: b or 3/20? 3/20 Let f(t) = -t*2 + 3t + 4. Let m be f(4). Let w = 1947 - 1953. Is w less than m? True Let i(x) = -x*3 + 12x*2 + 30x + 4. Let r be i(14). Is r <= 34? True Let f = 490/14841 - 4/153. Let i = f - 628/6693. Which is greater: i or -1? i Suppose 2f - 4r - 4 = 0, -4f + 17 = -2r + 3r. Suppose -20 = -9m + fm. Let b be (-2)/(-8) - 5/m. Is -1/8 not equal to b? True Let m(w) = -w2. Let n(o) = -3o*2 - 16o + 10. Let h(y) = 2m(y) - n(y). Let t be h(-16). Let f be 10/25t/18. Are f and 0 equal? False Let x = -5.22 - -2.25. Let q = -0.03 + x. Let t be 2/(5 - 4)(-2)/4. Which is greater: t or q? t Let m = 805.7 - 806. Is -128 greater than m? False Let s = 6 - -6. Let y = -2 - -13. Let v = y - s. Does v = -1/17? False Let o be (2/6)/(6/(-4)). Let q = 807 + -808. Is o > q? True Let p(m) = -7m + 2. Let k be p(8). Let b be -57 + (0 - 5 - -8). Is b <= k? True Let g(o) = 2o - 20. Let j(b) = b - 7. Let x(l) = 6g(l) - 17j(l). Let c be x(-1). Suppose -p - 5 = cp. Is -2/9 less than p? False Let m be ((-6)/(-2))/626. Suppose -5r - 2 = m. Let q be ((-1)/3)/(r/18). Is q greater than 3? False Suppose v = -0 - 16. Let i = -98 - -113. Let w = i + v. Which is bigger: -2/11 or w? -2/11 Suppose -76 = -1054l + 1058l. Suppose 4g + 0g = -80. Are l and g equal? False Let h be (-21)/12(-7 - 1). Let m = h - 11. Is m > 4? False Suppose -40 - 100 = -10f. Which is bigger: 5 or f? f Let j be (-2)/10 + (-39)/260-4. Is j <= 462? True Let m(w) = 8w + 16. Let x be m(-2). Is -47 less than x? True Suppose -25 - 5 = 2h - 2q, -2q + 50 = -3h. Let b be ((-55)/h - 3)/(1/2). Which is smaller: b or -0.03? b Let q = 1838/255 + -2/255. Is 6 smaller than q? True Let j be -3 - 4(63/12)/7. Let w be 45/(-105)(-20)/j. Which is bigger: w or -2? w Let a = 96.76 + 1.24. Let z = a + -97.9. Which is smaller: z or -64? -64 Suppose -6 = 4m - 3x - 41, 3m - 4x = 28. Suppose 6b = 3b. Let v(j) = -j3 + j2 - j + 8. Let o be v(b). Is o equal to m? True Let o(c) = -c*2 - 2c + 4. Let v be o(-4). Let s be (-4)/12 - 76/(-3). Suppose 0 = -5j - s, -4y = 2j - 7j - 9. Does v = y? True Let b = 98304220/8313 + -201020/17. Let x = -2/163 - b. Is x greater than or equal to -2/21? False Let k = 2.8 + 0. Let o = k + -12.8. Which is smaller: o or 1/2? o Let d(t) = -34t - 1045. Let a be d(-31). Are -28 and a equal? False Let m = -3 + 3. Suppose -f = -3k - 1 - 6, -3 = 3k. Let j be (6/20)/(f/5). Which is greater: m or j? j Let o be ((-13)/(-39))/((-1)/3). Let v = -2861/36 - -159/2. Which is smaller: o or v? o Suppose 29u - 1472 = -7359. Which is greater: -204 or u? u Let a be ((-3)/(-9))/(1/(-3)). Let f be (0 + a)/((-16)/9520). Let b be (-5)/(-3)34/f. Which is smaller: b or 1? b Let d = 3.3 + -2.3. Let a = d + -0.8. Which is greater: a or -0.13? a Suppose -r - 5d = -607, 0 = 3r + d + 3d - 1832. Let i be ((-3)/(-2))/(27/r). Which is bigger: i or 33? i Let n be 2/2432/(-6). Let r be (-28)/(-10) + -1 + 12/10. Suppose 5i + r + 12 = d, -5i = 15. Which is smaller: n or d? n Let n be (0 + (-69)/6)2. Let u =	{ "pile_set_name": "DM Mathematics" }
git of -1(-2 - -3)a? 1 Suppose 3v - 42 = -3i, v = 2i + 20 + 3. What is the tens digit of v? 1 What is the units digit of -20(-4 + 68/20)? 2 Suppose b + 4b = 130. What is the units digit of b? 6 Suppose 5v - 2v - 3 = 0. Let i(t) = 38t*2 - 2t + 1. What is the units digit of i(v)? 7 Suppose -5q + 2t = -540, 4q - 32 = 2t + 398. Suppose 4z = -z, 5w + 5z = q. Let o = w + -13. What is the units digit of o? 9 Let f(o) = o + 1. What is the units digit of f(4)? 5 Suppose -2p - 3j = -127 - 192, 0 = 2p - 2j - 324. What is the tens digit of p? 6 Let l = 19 - -5. Suppose 4m + 0 - l = 0. What is the units digit of m? 6 Let q be ((-12)/7 - -2)7. Let s(v) = -3v - 4 + 7vq + 4 + 4v. What is the units digit of s(-1)? 6 Let a be 0/((-4)/63). Let d(n) = -n2 + 18. Let b be d(a). Suppose 0 = 3q - 0q - b. What is the units digit of q? 6 Suppose -13b + 552 = -5b. What is the units digit of b? 9 Let y(p) = -p3 - 7p*2 - 2p + 4. Let t be y(-7). What is the units digit of (t/(-4))/(3/(-6))? 9 Let w be 176 + (-2 + -1)1. Suppose -5j + 175 = 5o, 3j + 2j + 3o = w. What is the units digit of j? 4 Let v(z) = 2z2 + z + 2. Let i be v(-5). Let d(c) = -2c - 12. Let q be d(-6). Suppose 5j - 4b = i, q = 3j + 3b - 18 - 21. What is the tens digit of j? 1 Let z be ((-8)/12)/((-2)/9). Let u(n) = 2n - n3 - 5n*z - 3n*3 + 1. What is the units digit of u(-1)? 8 Let f = 22 + 29. Suppose -5d + 34 = a - 0a, -3a + 2d = -f. Suppose -3b + a = -2. What is the units digit of b? 7 Suppose -5n + 39 = -3f - 26, 3n - 5f - 55 = 0. What is the units digit of n? 0 Let n = -104 - -176. What is the tens digit of n? 7 Suppose 0 = -3o + 2o + 2w, 3o - 7 = -w. Let a(x) = x*2 - 11x + 9. Let n be a(11). Suppose -f = -2l + n, -f + l + o = 6. What is the units digit of f? 1 Suppose 2 + 1 = 3g. Let j(q) = 7q2 + 1. What is the units digit of j(g)? 8 Let c = -5 + 7. Let l be 16/(-56) + c/7. Suppose -3m + 12 = -lm. What is the units digit of m? 4 Suppose 2 = -3b - 1. Let r(o) = -19o + 1. What is the units digit of r(b)? 0 Suppose -204 = -2n + 356. What is the units digit of n/12 + 1/(-3)? 3 Let a(j) be the first derivative of 2j3 - j2/2 - 1. Let y = 2 + -3. What is the units digit of a(y)? 7 Let g = 42 - 24. Suppose 0 = -2k + g + 4. What is the units digit of k? 1 Let p = -27 - -70. What is the tens digit of p? 4 Let k(o) = 10o + 3. Let b be k(-2). Let w(h) = 13h*2 - 7h + 5. Let f(i) = -39i2 + 20i - 14. Let u(q) = bw(q) - 6f(q). What is the tens digit of u(-1)? 1 Suppose -6z - 40 = 5m - 3z, -25 = -5z. Let k = 15 + m. What is the units digit of k? 4 Let j be (-18)/(-6) - (-47 - -2). What is the units digit of j/(-10)(-90)/27? 6 Let o(s) = s3 - 7s*2 + 7s + 3. Let y = 19 - 13. What is the units digit of o(y)? 9 Suppose s = -3s + 432. Let u be (s/16)/(6/32). Suppose 7 = -3c - r + u, -1 = c + 3r. What is the tens digit of c? 1 Suppose -l + 5o + 7 = l, l - 4o = 8. Let x(y) = 5y + 1. Let k(p) = 6p + 2. Let n(h) = 4k(h) - 5x(h). What is the units digit of n(l)? 7 Suppose -4q + 12 = -0q. Suppose -qn = -3r, 5r + 2n - 4n - 12 = 0. Suppose -2z + 3c = -8, rz + 5c - 31 = 7. What is the units digit of z? 7 Let m = -4 + 7. Let l(p) = -3p + 4. Let d be l(m). Let h(g) = -g2 - 8g - 7. What is the units digit of h(d)? 8 Suppose -3d + 166 + 228 = 5y, -160 = -2y - 2d. What is the tens digit of y? 7 Let k = 1 + -1. Suppose -j - 6 = -kj. What is the units digit of 10/(-15) - 34/j? 5 Let x = 9 - 19. Let d = -1 - x. What is the units digit of d? 9 Suppose 0b = -5b + 50. Let x be b/(-35) - 16/(-7). Let h(k) = k2 + 2. What is the units digit of h(x)? 6 What is the tens digit of (-4 + -8)/((-6)/8)? 1 Let u be 129/4 - (-2)/(-8). Suppose 3a = -5s + u, 3s + s = 2a + 8. What is the units digit of s? 4 Suppose -3j - 23 = -5o - 4, j - 5o + 23 = 0. Suppose 6 + 0 = jv. Suppose 4k - 1 = v. What is the units digit of k? 1 Let p be (-1 + 3)/(2/4). Suppose 21 + 7 = pw. What is the units digit of w? 7 Let w(s) = -s2 + 11s + 8. What is the tens digit of w(6)? 3 Let b(f) = -6f + 11. What is the units digit of b(-6)? 7 Let s(n) = -8n - 9. What is the tens digit of s(-6)? 3 Let b = 133 - 89. What is the tens digit of b? 4 Suppose 3j = -0j + 18. What is the units digit of j/412? 3 Suppose 3a = -3k, -2a - 18 = -6a + 2k. Suppose 3d = -0d - a. What is the units digit of d(-3)/(4 - 1)? 1 Suppose 0 = u + 4z, 5u + z - 15 - 4 = 0. Let d = -2 + u. Suppose x - 12 = d. What is the units digit of x? 4 Suppose -5w + l = -4w - 21, -l = 0. What is the units digit of 216/w + 6/(-21)? 0 Suppose -2 = -0b + 2b. Let r = b - 2. Let l(u) = u*3 + 2u*2 - 3u + 2. What is the units digit of l(r)? 2 Let k(b) = -b3 - b2 + 2b + 2. Let j be k(-2). Suppose jm - m - 13 = 0. What is the units digit of m? 3 Let a(b) = 4b - 10. What is the units digit of a(29)? 6 Suppose 2f + 68 = 4v + 4f, 5v - f - 71 = 0. What is the units digit of v? 5 Suppose 0 = -r + 2r - 4. Suppose 6o + 8 = 2o, -rz + 5o + 70 = 0. What is the units digit of z? 5 Suppose 5w = w + 20. Suppose -39 = -2h + wf, 0 = -4h - 5f - 1 + 4. Suppose 0 = -x - 0x + h. What is the units digit of x? 7 Suppose -5a = -15, -29 = -y - a - 4a. Let m = y - 0. What is the units digit of m? 4 Suppose 0 = -2w + 16w - 2394. What is the units digit of w? 1 Let w(b) = -8 + 6 + b*2 + 3 + 4b. What is the units digit of w(-7)? 2 Let t = 40 + 82. Suppose -4y + v = -t, v = y - 11 - 18. Let x = y + -17. What is the tens digit of x? 1 Suppose -4i = 4a - 42 - 34, -44 = -2a + i. What is the tens digit of a? 2 Suppose 24 = 2a - q, 0 = 4a + 2q - 19 - 37. Suppose -c + 2h + a + 41 = 0, -5h = -c + 66. What is the units digit of c? 6 Suppose 7k = 9k - 48. Let t = k + 17. What is the tens digit of t? 4 Let w(t) = 70t - 4. What is the hundreds digit of w(2)? 1 Let n be 3 + -2 - (1 + 0). Suppose n = 4m + 4l + 12, 0 = 2m - 7m - 3l - 7. What is the units digit of m? 1 Let r = 93 + -8. What is the tens digit of r? 8 Suppose 0x + 45 = -x. Let j = -158 + 95. Let o = x - j. What is the units digit of o? 8 Let s = 45 - 20. What is the units digit of s? 5 Suppose 0 = 3l - 0z + 4z - 27, 4z = 3l - 3. What is the units digit of l? 5 Suppose 0 = 6u - 2u + 48. Suppose -n = -0v + v - 19, 2n = -5v + 86. What is the units digit of v/3 + (-8)/u? 6 Let u(h) = 3h - 1. Let k be u(3). Suppose -s + 3 = -k. What is the units digit of s? 1 Let f be (-68 - 1)(-1 + 10). What is the units digit of f/(-45) + (-2)/(-10)? 4 Suppose -2k = k + 60. What is the units digit of -4 - -7 - k/2? 3 Suppose -2t + 4t = 0. Suppose 0 = -tf - 2f + 3a + 15, 4 = 4a. What is the units digit of f? 9 What is the units digit of 4/((-16)/(-28)) - -3? 0 Let y be ((-5)/(-3))/(4/(-12)). Let d(b) = -b3 - 5b*2 - b - 2. Let h be d(y). Suppose -r + h = -5. What is the units digit of r? 8 Let f = 32 + -15. Suppose f = r + 2w, 3r - 2r - 12 = 3w. Let b = r + -10. What is the units digit of b? 5 Let v(f) = 22f2. What is the units digit of v(1)? 2 Let q(r) = r2 - 4. Let u = -3 + 0. Let a be q(u). Suppose 0t - 25 = -at. What is the units digit of t? 5 Suppose 3y = 2y + 1, 694 = -4v - 2y. Let u = v - -252. Suppose -4t + u = -6. What is the tens digit of t? 2 Suppose 4u = 3r - 47, -2u + r = 4r + 1. Let m = 13 + u. What is the units digit of m? 5 Let l(x) = -2x + 2. What is the units digit of l(-2)? 6 Let h(m) = m*3 - 15m*2 - 22m - 4. What is the units digit of h(17)? 0 Let j(c) = c*2 + 4c - 2. Let w be j(-4). Let l be (4/2 - 0) + w. Suppose a - 5z - 6 = 0, l = -3a + 2z - 6z + 37. What is the tens digit of a? 1 Suppose -140 = -36r + 31r. What is the units digit of r? 8 Suppose 5z = -x + 25 + 61, -z + 4x + 13 = 0. What is the units digit of z? 7 Let v be (-2)/(-5) + (-51)/15. Let z be (-6)/(-1) - (v - -4). What is the units digit of z(9/(-5))/(-3)? 3 Let y(u) = -u + 3. Let j be y(-14). Let r be (-1 + 31)(2 - 1). Suppose 3l + t = 2t + j, 0 = 2l + 4t - r. What is the units digit of l? 7 Suppose 3q - 4 = q + r, -2 = 4q + 3r. Let l be 0 + (q - 1) - 12. Let t = -5 - l. What is the units digit of t? 7 Suppose -2f + 12 = 2f. Suppose fo = 2*o. Suppose 0	{ "pile_set_name": "DM Mathematics" }
41310kr*2 + 4 What is the second derivative of -2fk4 + 2fk2 + 5fk - 7f - 8k4 - 5 wrt k? -24fk2 + 4f - 96k2 Find the second derivative of -4b*3hx2 - 3b*3x + 27b2x*2 + 4bh2x*2 + 315bh2 - hx wrt x. -8b3h + 54b2 + 8bh2 What is the second derivative of 35t*4x - t*2x*2 + 17tx - x2 wrt t? 420t*2x - 2x2 Find the third derivative of -659d*3 + 2d*2 + 3d - 124 wrt d. -3954 What is the third derivative of -f*3o*3 + 2f*3o*2 + 2f*2o*4 - 2fo2 + 5321o*3 + 1727 wrt o? -6f*3 + 48f*2o + 31926 Find the third derivative of -2sw*4 - 4sw3 + 2sw2 - 36s + 4w4 + 11w*3 - 2w*2 - 5w wrt w. -48sw - 24s + 96w + 66 Differentiate -13b3 - 2b*2i*3 + 65i*3 - 3 with respect to b. -39b*2 - 4bi3 What is the first derivative of -116n*2 + 2n - 119? -232n + 2 What is the third derivative of -8310k3 - k2 + 4k - 2? -49860 What is the third derivative of 312n*6 + 2n*3z - 2n2z - 1025n2 wrt n? 37440n*3 + 12z Find the second derivative of -2w3 + 3024w*2 + w - 3461 wrt w. -12w + 6048 What is the second derivative of -2192o2v + 790o + v wrt o? -4384v Find the second derivative of -149b2 - 1005b wrt b. -298 Differentiate 8273x3 + 6443 with respect to x. 24819x*2 Find the first derivative of 10985jo2 - 7j - 2o3 + 743 wrt o. 21970jo - 6o*2 Find the second derivative of -497y*4 + 3y + 166. -5964y2 Find the third derivative of -1845p*3 + 2p*2 + 1300p wrt p. -11070 What is the second derivative of -4d5s - 71d4s + d*3 + 411d - 2s wrt d? -80d*3s - 852d2s + 6d Find the second derivative of d2p*4 - 680d*2p3 - d2p - 9478p wrt p. 12d2p*2 - 4080d*2p Find the third derivative of -286qw*3 - 5qw2 - 35q - 18w3 + 2w wrt w. -1716q - 108 Differentiate 3663x*2 - 4x - 16882. 7326x - 4 What is the second derivative of -149j*2 - 607j? -298 Differentiate -14d2l*2 - 17d*2 - 28l + 3 with respect to l. -28d2l - 28 Find the second derivative of -4j2z - 12j2 - 1213jz + j wrt j. -8z - 24 Find the second derivative of -10i4 + 167i wrt i. -120i2 Find the first derivative of 2fkxy + 3fk + 4fxy + 2fy + 254kxy + ky wrt f. 2kxy + 3k + 4xy + 2y Find the second derivative of -24r*5y + 24r2y + 19ry - 17y - 1 wrt r. -480r*3y + 48y What is the third derivative of 5307d3 + d2 - 2775d wrt d? 31842 Find the second derivative of -143k*4 + 5k*3 + 2k*2 + 2k - 197 wrt k. -1716k2 + 30k + 4 What is the third derivative of -2d5 - 319d*3 + 7d*2 + 8 wrt d? -120d2 - 1914 What is the derivative of -a2c2 - 5287a*2cf - ac*2 - 2c*2 + 2cf - 2693 wrt a? -2ac2 - 10574acf - c2 Find the third derivative of k3rx - 28k3r + k*3x - 8k3 + 959k*2x - 4kr wrt k. 6rx - 168r + 6x - 48 Find the first derivative of np3 + 154n + 55p3 wrt n. p3 + 154 Find the first derivative of 2d*3 + 3d*2m + 2dm*3 + 17m*3 - 2m wrt d. 6d2 + 6dm + 2m*3 Differentiate -15h*2 + h + 164 wrt h. -30h + 1 Find the third derivative of 390k4 - 7k*3 + 9849k*2 wrt k. 9360k - 42 Differentiate 2b2i*3 - 157b*2 - 2bi3 - 15bi wrt i. 6b*2i*2 - 6bi2 - 15b What is the second derivative of -p*2r - 4853p2 - 293pr + 10p wrt p? -2r - 9706 What is the second derivative of -49h*2p*2 - 3h*2 + 2hp3 + 3h - 37p wrt p? -98h*2 + 12hp What is the first derivative of 3ax3 - ax - 359a wrt x? 9ax2 - a Find the third derivative of 5c*2r*4 - 7c*2r*3 - 4c*2r*2t + 2c2r2 + c2rt - 51cr*2t + 3r4t wrt r. 120c2r - 42c2 + 72rt Find the third derivative of -b3c*2h*2 - 355b*3h*2 + 171b*2c*2h + 2b2c*2 + 2bh2 wrt b. -6c*2h*2 - 2130h*2 Find the second derivative of -12ov5 + 13ov2 + 222ov - 3o wrt v. -240ov*3 + 26o Differentiate -2h4 - 116h*2k*3 + 2h*2 - 105k*3 with respect to h. -8h*3 - 232hk3 + 4h What is the derivative of 32d - 244 wrt d? 32 What is the second derivative of -7979p*3 + 1851p wrt p? -47874p What is the third derivative of -8ac3 - ac*2t - ac - 117c*3t + 6c3 + 2c*2t + 100 wrt c? -48a - 702t + 36 What is the third derivative of 2cq*4t - cq3 + cq*2t - cq2 - 505q*4t - 76q2t wrt q? 48cqt - 6c - 12120qt What is the derivative of -354w - 1041 wrt w? -354 What is the third derivative of 20t*4 + 68t*3 - 3902t*2? 480t + 408 Find the second derivative of -2p4 - 3p*3 + 60p*2 + 8p + 30. -24p2 - 18p + 120 Differentiate -x*3z - 3x3 + 174x*2 + 189xz2 with respect to z. -x3 + 378xz What is the third derivative of -r4 + 57r*3 + 13r*2 + 7? -24r + 342 What is the second derivative of 33a3f*2q*2 + 2a*3q*2 + 71af2 - 4af + 3 wrt f? 66a*3q*2 + 142a What is the first derivative of -2138d2 - 13940? -4276d What is the derivative of 2a3 + 62au3 + 4au - 5u*3 - 78u wrt a? 6a2 + 62u*3 + 4u What is the second derivative of 162f2w*5 - 85f*2 - 2w wrt w? 3240f2w3 What is the first derivative of r3 + 13r2 + 141? 3r*2 + 26r What is the second derivative of 73j5 + 3j*3 - 562j? 1460j3 + 18j What is the third derivative of 3360l3 + 6917l2 + 2? 20160 What is the derivative of -d3 - 198d2 - 5d - 5392? -3d2 - 396d - 5 What is the derivative of c*3 - 348c*2 + 4c + 17389? 3c2 - 696c + 4 What is the first derivative of -2gs - 2450g - 14s*2 - 14s wrt s? -2g - 28s - 14 What is the first derivative of 5h3iqz + 15h3q - 2h2iq2 + 29hiq*2z - 2hiq2 + 7hi wrt z? 5h*3iq + 29hiq*2 Find the second derivative of 3a*5df - 2a*2d - 23a2f*3 + adf + af - 3df*2 - 9f*3 wrt a. 60a*3df - 4d - 46f3 What is the third derivative of -i4 + 335i*3 - 16i*2 + 12i wrt i? -24i + 2010 Find the second derivative of -11j*5 + 10j*2 + 451j - 1 wrt j. -220j3 + 20 What is the second derivative of -11qu2 - 5quv*2 - 5qv + 36u*3v*2 - 4u*3v wrt v? -10qu + 72u3 Find the third derivative of bjm3t*3 + 55bjm*3 + 20bjt + 3bmt3 - 6jm3 + jm*2t*2 + 2m*2 wrt m. 6bjt*3 + 330bj - 36j Find the third derivative of -7202o3 + 13321o*2. -43212 What is the third derivative of 459m*3r*2 - 14m*2r*2 - mr*2 wrt m? 2754r*2 Find the second derivative of -52v*2 - 123v - 2 wrt v. -104 Differentiate 14aov + 2ao + 36av + 4ov + v wrt o. 14av + 2a + 4v What is the third derivative of -5927b*4 + 91b*2 + 21? -142248b What is the second derivative of 7h4 - 184h*2 - 1912h? 84h2 - 368 What is the first derivative of 27b*4 - 85b*3 - 6917 wrt b? 108b*3 - 255b*2 Differentiate 7a*3cr - 7a*3c - 4a2crt + a*2ct - 3acr - 4act wrt r. 7a*3c - 4a2ct - 3ac What is the third derivative of 9875q*6 - 7q*2 + q + 605 wrt q? 1185000q*3 Find the second derivative of 259n*4 + 31n. 3108n2 Find the second derivative of -3g*2lw2 + 46g*2lw + 9gw2 + 3lw2 + lw - 3 wrt w. -6g2l + 18g + 6l Find the second derivative of -3f5u - 311f2u - 290fu - 4u wrt f. -60f*3u - 622u Differentiate -95u*2 + 107 wrt u. -190u Find the third derivative of 16du*5 + 2du2 + u6 - 3u*2 + 17 wrt u. 960du2 + 120u*3 What is the third derivative of -48a*3 + 34a*2 - 5? -288 Find the third derivative of 390r*3 - 1095r*2. 2340 Find the first derivative of -7c - 112. -7 What is the second derivative of 126h3v + 4h3x*2y - 15h3x*2 + 2hy + vx*2y + 3x wrt x? 8h*3y - 30h3 + 2vy What is the third derivative of -2i*3o*4 - 18i*3 + 20io2 + 242o*4 wrt o? -48i*3o + 5808o Find the third derivative of -91s*3v3 - s3v2 - 2s*3v - s*2v*4 - 14v wrt v. -546s3 - 24s*2v What is the second derivative of -146m5s - 2m3s + 4m + 72s wrt m? -2920m3s - 12ms Differentiate -354b - 10424. -354 What is the first derivative of -16a*2y3 - a2 + 7	{ "pile_set_name": "DM Mathematics" }
-v for r. 0 Suppose -k = 2o - o + 11, -3k + 2o - 38 = 0. Let a be (-9)/12 - 321/k. Solve -2r - 3r - a = 4w, -5w - 18 = -r for r. -2 Let u be 5/2022. Solve q = 5d + 7 - u, -3q = -d + 10 for q. -4 Let h = 53 + -49. Solve 3a - 10 = hx, -2a = 3a + 3x + 22 for a. -2 Suppose -p = p. Suppose -2h + 125 = 5q, 5q - 2h - h - 100 = p. Solve -2v + 3c = -0v + q, 4c - 36 = 4v for v. -4 Let i be 2(-2 - -1) + 16. Suppose 5o = i + 6. Solve 4m = ox + 4, -2x + 4m + 0m = -4 for x. -4 Let i(c) = c + 1. Let l be i(4). Solve -h = lz + 2h - 9, -6 = -4z - 2h for z. 0 Suppose 0a - 3x = 2a - 7, 5x - 7 = -a. Suppose -i + 0l + 5l = 10, 3i + l = 2. Suppose i = 4k - 5k + 5. Solve ay + 4z + 0 = 2, -ky + 2z = 31 for y. -5 Suppose -4p - 2q - 4 = -32, 4q - 16 = 0. Solve pd - 3d + 21 = 3g, -g + 2d = -11 for g. 5 Let b(p) = -p*2 + 6p - 3. Let i(x) = -x*3 + 3x*2 - x + 2. Let d be i(2). Let u be b(d). Solve -6 = -3v + 3r - 0, -2v - ur + 25 = 0 for v. 5 Suppose -3m + 30 = 2m. Let j(w) = w - 6w*2 + 0w - 1 - 1 + w*3. Let q be j(m). Solve qv - 5 = -k, 2v + k + 2 = 7 for v. 0 Suppose -5n - 15 = 45. Let o be ((-3)/2)/(n/16). Suppose -2b + 5v = -13, -v - 17 = -4b - 0v. Solve -2f - u - bu - 16 = 0, o = -2f + 2u for f. -3 Let w be (4/166)/((-9)/(-12)). Solve wx - 8 = -2j, -3j - 7 = -5x - 3 for x. 2 Let h(z) be the second derivative of z + 3/5z*5 + 1/2z*2 + 1/12z*4 - 1/3z*3 + 0. Let m be h(1). Solve x + 6 + m = 5o, -3o + 3 = 2x for x. -3 Suppose 18 = 3b + 5q, 2b + q = 4b + 1. Solve b = 4m + u - 6, 3m - 3u = 24 for m. 3 Suppose y + 0y = 26. Let d be 2 + -9 + 3/(-1). Let q = d + y. Solve q + 18 = 3w + 5i, -3i = -15 for w. 3 Let r(q) = -q2 + 5q - 1. Let u be r(4). Suppose ub = b. Suppose -c + 5v - 20 = 0, -4 + 9 = -2c + 3v. Solve 3t + i = -bi + 11, t - c = i for t. 4 Let m = -5 + 8. Suppose -4f - 25 = 5v, -2f + 0f + 15 = -mv. Suppose f = -h + 2. Solve -30 = -2q - 2q + 2a, hq + 3a = -5 for q. 5 Let v be (-15)/10(1 - 13). Suppose 0 = f - 4n - 9, -f = 3f + 2n - v. Solve -fs - 30 = -2t + 5t, -3s + t - 4 = 0 for s. -3 Let x(s) = -s - 13. Let m be x(-16). Solve 3o + mc - 6 = 0, 5o - c - 3c = 28 for o. 4 Let i be (-14)/(-4) - (-6)/(-4). Suppose -5 = 2h - 4c - 1, -7 = ih - 5c. Let o = -1 + h. Solve 0 = -5v, 2y = 3v + o + 7 for y. 5 Suppose 4t = 2t + 12. Let s = 11 - t. Solve -3k - sd = -13, -k + 2d + d - 5 = 0 for k. 1 Let s(f) = -f + 4. Let t(n) = -n + 1. Let c(v) = -s(v) - 5t(v). Let z be c(4). Solve 7w - 4w = 5d + 10, z = 2w - 5d for w. -5 Let h(d) = 2d3 - 2d - 1. Let f be h(2). Let c = 9 + f. Suppose 225s - 222s = 15. Solve 4j = -3k - c, -20 = -j + sj + k for j. -5 Let j be (-1)/((-6)/18) - (0 - 3). Solve 32 = -3k - 4s, s - 25 = js for k. -4 Suppose -5v = -l - l - 19, -4l + 2v = -2. Suppose 2o + 36 = lm, -2m - 2o = -50 + 16. Solve 4c - 3c + m = -3j, 30 = -5c - 5j for c. -2 Let j(g) be the third derivative of -g5/60 - g4/6 - g*3/3 - 3g*2. Let t be j(-4). Let w be (0/1)/t - 0. Solve z + 3b + 9 = w, 0 = -b - 4b - 10 for z. -3 Suppose -4u - 12 = 20. Let q(a) = a*2 + 9a + 11. Let o be q(u). Solve -5h = -9 - 1, 15 = ot + 3h for t. 3 Let c = -2 + 9. Suppose -5o + 35 = -5h, o + 3h + 2 = -c. Suppose 0v = v - 3. Solve -4d + vd - 5 = -2s, os = 2d + 5 for d. 5 Let m = 6 + -2. Suppose -15 = -2b + 5g, 3b + 0g - 11 = -mg. Suppose 0 = -3q + 2 + 10, 0 = -2c + 2q - 4. Solve ca + 2n = -6 - 6, b = -n for a. -1 Let h be (-238)/(-15) + (-3)/(-45)2. Solve 5j - 2s + h = j, -4j - 5s - 30 = 0 for j. -5 Let v be 6/4(-4)/(-3). Let q be 15/6 + v/(-4). Solve 3z = qs - 8, z - s = 6z + 9 for z. -2 Let b(m) = -m2 + 5m + 4. Let j be b(5). Suppose -3y + 2p = -38, -63 = -5y + 5p - 2p. Let d = -3 + 5. Solve 3k + k + y = -jo, 3k + 8 = -do for k. -2 Let w(c) = -5c - 4. Let v be w(-2). Solve -3o - i - v = 2i, 3o - i = -10 for o. -3 Suppose -3m + 11 = 2m + 3f, -4m + 4f = 4. Let l be m(-1 - 1)/(-1). Solve -li + 5q + 25 = 3i, -20 = 4q for i. 0 Suppose -5 + 20 = 2h + 5m, 60 = 2h - 4m. Solve f + 4w = -w - 10, h = f - 5w for f. 5 Suppose -2f = 2g + 2, 4f = 5g - f - 35. Let h be 0 - 0 - (1 - 7). Solve 5b - gx = 25, hb - b = 4x + 25 for b. 5 Suppose 3i - 3d - 33 = 0, -7d + 2d - 47 = -4i. Solve 2s - 4x - x = -i, 0 = 5x for s. -4 Suppose 6 = 2r + 2. Let g be (-2)/(-4)4-19. Let b = 53 + g. Solve 0 = -4y - z + 21, -ry + z = 3y - b for y. 4 Let a(b) = 3b - 9. Let l be (1 - -6) + (-1)/1. Suppose -l = -0w - w. Let u be a(w). Solve 3m - 9 = 3k + 4m, 3m = -3k - u for k. -3 Suppose 0y = -4b - 3y + 8, 2b = y + 4. Suppose -4p + 22 = -0p + 2m, 5p - 14 = bm. Solve -5a + 6 = -4z + 17, pa + 8 = 4z for z. -1 Let n(j) = 5j*2 + j + 1. Let h be n(-1). Let r(z) = -3z - 29. Let g be r(-11). Solve 0l - gf = -l + 6, -hf = l + 3 for l. 2 Suppose 7 = 4i - 1. Suppose -3l + 1 + 5 = 0, il - 31 = -3r. Solve -b = -5a + b + 21, 2a + 5b + r = 0 for a. 3 Let i be 4/18 - (-250)/90. Let p = -1 + i. Solve 2u + 3 = 3q - 1, p = -u - 2q for u. -2 Let k = 23 - 11. Suppose -r = 4g + 3r, 5r = -g - k. Solve 5v - gn = -31 + 6, 5v + 25 = -3n for v. -5 Suppose -m + 0w + 3w - 4 = 0, -3m + 5w = 0. Solve 0b + 4b = g + 3, -g = mb - 15 for b. 2 Suppose -2r - h + 7 = 0, -4r + 9h - 7 = 4h. Solve -5p - 5 = rv, 2p = 2 - 0 for v. -5 Let h = 5 - 5. Let g(t) = t*2 + t - 4. Let a be g(h). Let c be (2 + a - -6)5. Solve -4y + 5w = 25, -y - c = -0w - 4w for y. 0 Let x(q) = -q*3 + 13q*2 + 2q - 11. Let v be x(13). Solve -4g = 4m - 36, 5g = 2g + v for m. 4 Let l(f) = -1. Let o(q) = -q + 2. Let u(k) = -4l(k) - o(k). Let v be u(0). Let h be (-20)/(-4 + -1)(0 + 1). Solve s - hp - 9 = -4, -6 = -4s + vp for s. 1 Let k(t) = 4t + 3. Let p be k(-2). Let q = p - -8. Solve 0 = -x - 3l + 8, 4x - 6x - ql = -4 for x. -4 Let w(i) = -i - 5i + i + 1. Let l be w(-1). Let a = 0 + l. Solve 5t + 5 = 2p, -p - at - 20 = -t for p. -5 Let q be -1412/(-4). Let y = 11 - 7. Solve 0 = 3k - 0m - 3m + 12, 0 = yk - m + q for k. -1 Let o(a) = a*3 + 3a*2 - 4a - 3. Let m be o(-2). Solve 3h - 3 = 0, 0h - 5h + m = 2u for u. 2 Suppose -3v + 4 = -v, m = v - 3. Let k be m - 4-2 - 3. Solve 5d + kl = -2 + 9, l = d + 4 for d. -1 Let q(s) = 2s + 1. Let m be q(1). Let t = m - 0. Solve 2 = 4i - 18, -k - ti = -17 for k. 2 Let b = 13 + -9. Let g be (-1)/(-1)(2 + 0). Let l = 5 - g. Solve -5f - 2 = bq - 11, -3q + 6 = lf for f. 1 Let w(i) = 2i + 18. Let g be w(-8). Suppose 3t - 15 = -gt. Solve -2k + 0 = l + t, -3l = 2k - 7 for k. -4 Suppose p - 3 - 1 = 0. Solve pi = 3s + i - 3, -3 = -i for s. 4 Let a be 93/(-9) + 4/(-6). Let b = a - -11. Let h be ((-1 - 0)-2)/1. Solve b = -2j - 2g + 4, -hg = -5j + g + 2 for j. 1 Let p be (-2)/6 + (-21)/(-9). Let x = 15 + -14. Solve -6t + pt + 5z = x, -3z = 9 for t. -4 Suppose -4c = b - 11, 5c + 3b + 0b = 5. Let q(v) = -v3. Let i be q(-1). Let j be (8 - 1) + i-2. Solve -6 = -h + cr, -3r + 6r + j = h for h. 2 Suppose 2j + 4d = j - 14, -3j + 43 = -5d. Suppose -3a = 5i - 20, -3a = -ja - 4i + 16. Solve -3x - 11 = -u + x, a = 5u - 4x + 9 for u. -5 Let v(q) = -q2 - 5q - 2. Let k = 5 - 7. Let z be v(k). Solve za - 10 = -4d + 2a, -3d = -a for d. 1 Let c = 11 - 6. Let m = 7 - c. Solve 2u = 3x - 2x + 1, 0 = -3x + u + m for x. 1 Let u = 12 - -3. Solve -3q - 3y - 5 = -5y, -3y = 3q - u for q. 1 Let g(i) = -i - 3. Let x be g(-9). Solve 0 = 3p - 3z + x, 0 = p + 2p - 5z + 10 for p. 0 Let o(i) = 4i - 1. Let t be o(1). Let k = 35 - 21. Suppose -2 + k = tx. Solve 4v = 16, 4 = 4q - 0q - xv for q. 5 Let j(x) = -x2 + 1. Let b(v) = -v3 - 5v*2 - 3. Let u(k) = -b(k) - j(k). Let h be u(-6). Solve f = hf + 5q + 8, -q = -2f - 5 for f. -3 Suppose -5i - x = -9, -3x + 5x = -4i + 6. Let u = i - 2. Solve u - 3 = h, 3h = 3p - 24 for p. 5 Let k be (-1 - -3)/(2/(-4)). Let v be (0 - -2) + 5 + k. Solve 0 = vd - 2l - 2, 4l + 6 = 5d for d. -2 Let o = -2 + 10. Solve 2j - o = -y, -y + 3j + 14 = 4y for y. 4 Let z be (-5)/((-10)/(-6)) + 3. Solve 3y - 2f = 4, 0y - y + 4*f - 2 = z for y. 2 Let y	{ "pile_set_name": "DM Mathematics" }
greatest common divisor of 64 and 1216. 64 Calculate the greatest common divisor of 312 and 1794. 78 Calculate the greatest common factor of 31 and 1271. 31 What is the greatest common factor of 10 and 5410? 10 What is the greatest common factor of 25 and 2425? 25 What is the highest common divisor of 240 and 90? 30 What is the highest common factor of 26 and 10? 2 What is the greatest common divisor of 4165 and 294? 49 Calculate the greatest common factor of 498 and 3. 3 What is the greatest common factor of 22606 and 127? 127 What is the greatest common factor of 3 and 177? 3 Calculate the greatest common factor of 104 and 702. 26 Calculate the highest common factor of 402 and 36. 6 What is the highest common divisor of 18 and 171? 9 What is the highest common factor of 75 and 135? 15 What is the greatest common divisor of 2211 and 33? 33 Calculate the greatest common divisor of 2482 and 646. 34 Calculate the highest common factor of 2 and 2. 2 What is the greatest common factor of 1519 and 62? 31 What is the greatest common divisor of 17 and 2567? 17 What is the highest common divisor of 24 and 216? 24 Calculate the greatest common factor of 1700 and 75. 25 Calculate the highest common divisor of 66 and 6. 6 What is the highest common factor of 49 and 7497? 49 Calculate the greatest common divisor of 4 and 2986. 2 Calculate the greatest common factor of 15 and 4665. 15 What is the highest common divisor of 6858 and 127? 127 What is the greatest common divisor of 14129 and 199? 199 Calculate the greatest common factor of 6 and 34. 2 Calculate the highest common divisor of 22 and 17248. 22 Calculate the highest common factor of 1333 and 31. 31 Calculate the highest common factor of 1012 and 44. 44 What is the greatest common factor of 3600 and 104? 8 Calculate the highest common factor of 1260 and 165. 15 What is the highest common divisor of 4 and 82? 2 What is the highest common divisor of 1073 and 232? 29 What is the greatest common divisor of 5490 and 50? 10 Calculate the greatest common divisor of 156 and 96. 12 What is the highest common factor of 808 and 344? 8 What is the highest common factor of 4364 and 4? 4 Calculate the highest common divisor of 4182 and 408. 102 Calculate the highest common divisor of 1375 and 440. 55 Calculate the highest common divisor of 7641 and 3679. 283 Calculate the greatest common divisor of 85 and 289. 17 Calculate the greatest common factor of 15 and 270. 15 Calculate the greatest common divisor of 30 and 465. 15 Calculate the highest common divisor of 7 and 581. 7 Calculate the highest common factor of 195 and 345. 15 What is the highest common divisor of 2 and 146? 2 Calculate the greatest common factor of 69 and 33. 3 Calculate the highest common divisor of 16014 and 102. 102 What is the highest common factor of 171 and 59850? 171 What is the highest common divisor of 13 and 3328? 13 What is the greatest common factor of 220 and 13530? 110 What is the highest common factor of 4 and 214? 2 Calculate the greatest common divisor of 1891 and 31. 31 What is the greatest common factor of 61 and 11651? 61 What is the greatest common divisor of 55 and 121? 11 What is the greatest common divisor of 20 and 1420? 20 Calculate the greatest common factor of 952 and 102. 34 What is the highest common factor of 56 and 10696? 56 What is the highest common factor of 13735 and 410? 205 Calculate the greatest common factor of 1179 and 36. 9 Calculate the greatest common divisor of 142 and 2. 2 Calculate the highest common divisor of 11 and 57541. 11 What is the highest common factor of 3465 and 35? 35 What is the highest common divisor of 108 and 27? 27 What is the greatest common divisor of 288 and 36? 36 What is the highest common divisor of 32339 and 73? 73 What is the greatest common divisor of 364 and 156? 52 Calculate the highest common divisor of 8295 and 105. 105 Calculate the highest common divisor of 138 and 24. 6 Calculate the highest common divisor of 324 and 2304. 36 What is the greatest common divisor of 36089 and 151? 151 Calculate the greatest common divisor of 17 and 153. 17 What is the greatest common factor of 3129 and 14? 7 Calculate the greatest common divisor of 18 and 738. 18 Calculate the highest common divisor of 592 and 32. 16 What is the greatest common factor of 2537 and 172? 43 What is the highest common divisor of 174 and 493? 29 Calculate the greatest common divisor of 669 and 30551. 223 What is the greatest common divisor of 159 and 7897? 53 What is the highest common factor of 250 and 170? 10 What is the greatest common factor of 340 and 884? 68 What is the greatest common divisor of 153 and 1020? 51 Calculate the highest common factor of 3808 and 96. 32 What is the greatest common divisor of 341 and 55? 11 What is the greatest common factor of 189 and 27? 27 Calculate the highest common divisor of 16 and 848. 16 Calculate the greatest common divisor of 129 and 215. 43 Calculate the greatest common divisor of 1012 and 5324. 44 Calculate the highest common factor of 90 and 390. 30 Calculate the highest common divisor of 16756 and 236. 236 Calculate the greatest common divisor of 975 and 825. 75 What is the greatest common factor of 2815 and 10? 5 What is the greatest common divisor of 46 and 230? 46 What is the highest common divisor of 44 and 1364? 44 What is the highest common factor of 138 and 1334? 46 What is the greatest common factor of 1296 and 2187? 81 Calculate the greatest common divisor of 130 and 455. 65 What is the greatest common divisor of 19 and 437? 19 Calculate the highest common factor of 2107 and 147. 49 Calculate the highest common factor of 1152 and 4. 4 Calculate the highest common divisor of 3484 and 260. 52 Calculate the greatest common divisor of 3332 and 4. 4 What is the highest common divisor of 162 and 27? 27 What is the highest common divisor of 725 and 58? 29 What is the greatest common factor of 15 and 535? 5 What is the highest common divisor of 18 and 9? 9 What is the highest common divisor of 8 and 184? 8 Calculate the greatest common divisor of 9460 and 5590. 430 Calculate the highest common divisor of 388 and 4462. 194 Calculate the highest common factor of 15 and 30. 15 What is the highest common factor of 9 and 9522? 9 What is the highest common divisor of 87 and 3654? 87 What is the greatest common divisor of 756 and 1728? 108 What is the greatest common divisor of 576 and 104? 8 Calculate the greatest common divisor of 7 and 21. 7 Calculate the greatest common factor of 96 and 9456. 48 Calculate the highest common factor of 330 and 20. 10 Calculate the highest common divisor of 9102 and 148. 74 What is the highest common divisor of 94332 and 84? 84 What is the greatest common factor of 34599 and 114? 57 What is the highest common factor of 126 and 1098? 18 What is the greatest common divisor of 81 and 1089? 9 What is the greatest common factor of 296 and 3404? 148 What is the greatest common factor of 11370 and 30? 30 What is the greatest common divisor of 226 and 8701? 113 What is the greatest common factor of 2028 and 36? 12 Calculate the highest common divisor of 8 and 20. 4 Calculate the greatest common divisor of 8814 and 78. 78 What is the highest common divisor of 513 and 8037? 171 What is the greatest common divisor of 129 and 3? 3 Calculate the greatest common divisor of 236 and 2950. 118 What is the highest common divisor of 243 and 54? 27 What is the greatest common factor of 2853 and 81? 9 Calculate the greatest common factor of 256 and 2944. 128 What is the highest common divisor of 174 and 13137? 87 What is the highest common factor of 2322 and 162? 54 Calculate the greatest common divisor of 19112 and 8. 8 What is the highest common factor of 209 and 22? 11 Calculate the highest common divisor of 1856 and 290. 58 What is the highest common divisor of 1353 and 33? 33 What is the highest common divisor of 57 and 39? 3 What is the highest common factor of 366 and 726? 6 Calculate the highest common divisor of 21 and 123. 3 What is the greatest common factor of 26 and 169? 13 What is the highest common factor of 9 and 189? 9 Calculate the greatest common divisor of 1075 and 1763. 43 What is the greatest common divisor of 1838 and	{ "pile_set_name": "DM Mathematics" }
ound 1.8249 to 0 dps. 2 Round -24.83 to zero decimal places. -25 What is -0.01735 rounded to 4 dps? -0.0174 What is -0.00008185 rounded to six dps? -0.000082 Round -91.25 to the nearest 10. -90 Round -14.59 to the nearest integer. -15 Round 0.291 to one decimal place. 0.3 Round -25.3073 to 0 dps. -25 Round -843 to the nearest 10. -840 Round -0.5874 to 1 dp. -0.6 What is 64890000 rounded to the nearest one million? 65000000 Round 110.6 to the nearest 10. 110 What is 4.259 rounded to 1 dp? 4.3 Round -945610 to the nearest 100000. -900000 Round -714.662 to the nearest 10. -710 Round -968600 to the nearest 100000. -1000000 Round -1619.5 to the nearest ten. -1620 Round 1501.2 to the nearest ten. 1500 What is 0.004589 rounded to four dps? 0.0046 Round -0.000757 to five decimal places. -0.00076 What is -1.27 rounded to the nearest integer? -1 Round -1022 to the nearest 100. -1000 What is 0.05537 rounded to two dps? 0.06 Round -29.106 to the nearest integer. -29 What is 0.36517 rounded to 3 decimal places? 0.365 What is 306700 rounded to the nearest 10000? 310000 What is -0.0047894 rounded to 5 dps? -0.00479 Round -4658 to the nearest one thousand. -5000 What is -0.0363 rounded to two dps? -0.04 Round 3705 to the nearest 100. 3700 Round 21310 to the nearest 10000. 20000 What is 2.17335 rounded to two decimal places? 2.17 What is 0.01508 rounded to 3 decimal places? 0.015 What is -18.635 rounded to one decimal place? -18.6 Round -0.00003696 to six decimal places. -0.000037 What is -329866 rounded to the nearest one thousand? -330000 Round -0.00008713 to 6 dps. -0.000087 What is 354.97 rounded to the nearest integer? 355 Round -0.6246 to two dps. -0.62 Round 0.00000079 to 6 decimal places. 0.000001 Round -707000 to the nearest one hundred thousand. -700000 What is 0.0005601 rounded to four decimal places? 0.0006 Round -2.644 to 0 decimal places. -3 Round 0.01279 to 3 decimal places. 0.013 What is -0.000001176 rounded to 7 dps? -0.0000012 What is -324400 rounded to the nearest 1000000? 0 Round 25.386 to 1 dp. 25.4 What is 0.000002179 rounded to 7 dps? 0.0000022 What is -72380 rounded to the nearest ten thousand? -70000 Round 13208 to the nearest one hundred. 13200 What is -0.00022187 rounded to five decimal places? -0.00022 Round 0.001766 to four dps. 0.0018 Round -0.23686 to three decimal places. -0.237 Round 514900 to the nearest 100000. 500000 Round 0.18845 to 3 decimal places. 0.188 What is 2.3012 rounded to 2 decimal places? 2.3 What is 0.000002189 rounded to seven dps? 0.0000022 What is 0.00052 rounded to 3 dps? 0.001 Round -22.07 to 0 dps. -22 What is -0.0040205 rounded to three dps? -0.004 What is 0.014303 rounded to 2 decimal places? 0.01 What is -0.0001356 rounded to 4 decimal places? -0.0001 What is 0.00062542 rounded to 5 dps? 0.00063 Round 0.000010753 to 6 dps. 0.000011 What is -0.000000392 rounded to six decimal places? 0 What is -0.091905 rounded to two decimal places? -0.09 Round -0.003421 to four decimal places. -0.0034 Round -4.55 to one decimal place. -4.6 Round -1.5848 to 2 dps. -1.58 Round 293.4 to the nearest 10. 290 Round 46509 to the nearest 1000. 47000 What is 0.0104288 rounded to 3 dps? 0.01 What is 0.00000529 rounded to seven dps? 0.0000053 What is -704.27 rounded to the nearest integer? -704 What is -34624 rounded to the nearest 1000? -35000 Round -0.004859 to three dps. -0.005 Round 0.4626 to 2 decimal places. 0.46 What is 0.15661 rounded to 2 decimal places? 0.16 What is -895000 rounded to the nearest one hundred thousand? -900000 Round 0.05924 to 3 dps. 0.059 What is 0.9021 rounded to 2 dps? 0.9 What is -0.000014363 rounded to six dps? -0.000014 What is 426900 rounded to the nearest one thousand? 427000 Round 1255.9 to the nearest 100. 1300 Round 0.8778 to 2 dps. 0.88 What is 1443.4 rounded to the nearest 100? 1400 What is -814.2 rounded to the nearest ten? -810 What is -81.8 rounded to the nearest integer? -82 Round -1926800 to the nearest 100000. -1900000 Round 3099.5 to the nearest 1000. 3000 Round 670000 to the nearest one million. 1000000 What is 10.41 rounded to the nearest integer? 10 What is 2.1255 rounded to 1 dp? 2.1 What is 20100 rounded to the nearest 100? 20100 What is 18220 rounded to the nearest 1000? 18000 Round 0.0005293 to 4 decimal places. 0.0005 What is 0.53239 rounded to 1 decimal place? 0.5 What is 0.21659 rounded to 3 dps? 0.217 What is 184.8 rounded to the nearest ten? 180 Round 20.0876 to the nearest integer. 20 What is -156400 rounded to the nearest ten thousand? -160000 What is 57960 rounded to the nearest 10000? 60000 Round -4843.4 to the nearest one hundred. -4800 Round 23596700 to the nearest 100000. 23600000 What is -9184600 rounded to the nearest one million? -9000000 What is 7510 rounded to the nearest one hundred? 7500 What is 56421 rounded to the nearest ten thousand? 60000 Round -0.00073518 to four decimal places. -0.0007 What is -0.0004456 rounded to five dps? -0.00045 What is 32300 rounded to the nearest 10000? 30000 Round -319500 to the nearest 10000. -320000 Round 665000 to the nearest one hundred thousand. 700000 Round -9610 to the nearest 1000. -10000 What is -541100 rounded to the nearest 10000? -540000 Round 0.004922 to four dps. 0.0049 What is 0.603 rounded to two decimal places? 0.6 Round 42155 to the nearest 100. 42200 What is -4751 rounded to the nearest 1000? -5000 Round -147949000 to the nearest one million. -148000000 What is -0.0022994 rounded to three dps? -0.002 What is 0.35 rounded to 1 decimal place? 0.4 Round -0.000006628 to 7 dps. -0.0000066 Round 1696 to the nearest one hundred. 1700 What is -0.00002367 rounded to 6 dps? -0.000024 What is 6.1 rounded to the nearest ten? 10 Round 0.00005735 to 6 dps. 0.000057 What is -0.0178195 rounded to three decimal places? -0.018 Round -0.839 to 2 dps. -0.84 Round 0.000002632 to 7 decimal places. 0.0000026 What is -0.0006141 rounded to five dps? -0.00061 Round -0.16609 to three dps. -0.166 What is -7786000 rounded to the nearest one million? -8000000 What is 64285000 rounded to the nearest one million? 64000000 What is 586.16 rounded to the nearest 100? 600 Round 699.28 to the nearest ten. 700 What is 56850 rounded to the nearest 10000? 60000 What is 146000 rounded to the nearest ten thousand? 150000 Round -35570 to the nearest ten thousand. -40000 What is -7.9622 rounded to 0 decimal places? -8 Round -22900 to the nearest 1000. -23000 Round 0.000038125 to five dps. 0.00004 Round -1211800 to the nearest 100000. -1200000 Round -30200 to the nearest 100000. 0 Round 7.5023 to 2 dps. 7.5 Round 0.00245 to four dps. 0.0025 Round 50.91 to the nearest integer. 51 Round -91700000 to the nearest one million. -92000000 What is -0.0051906 rounded to four decimal places? -0.0052 Round 0.0000772 to 6 decimal places. 0.000077 What is 533060 rounded to the nearest 1000? 533000 What is 762780000 rounded to the nearest 1000000? 763000000 Round 26200 to the nearest one hundred. 26200 Round 0.00128153 to four decimal places. 0.0013 Round 0.008184 to four dps. 0.0082 What is 0.000001934 rounded to seven decimal places? 0.0000019 Round 53750000 to the nearest 1000000. 54000000 Round 7.213 to 0 dps. 7 What is 14936 rounded to the nearest 100? 14900 What is 557230 rounded to the nearest 100000? 600000 Round 0.0028025 to five dps. 0.0028 Round 32160 to the nearest one thousand. 32000 Round 126.99 to zero dps. 127 What is 141.7 rounded to the nearest 10? 140 Round 0.00006263 to 5 dps. 0.00006 What is -0.0000306 rounded to six dps? -0.000031 What is 0.2807 rounded to three dps? 0.281 Round -535740 to the nearest ten thousand. -540000 Round -21.7 to the nearest 10. -20 Round -0.0000009463 to seven dps. -0.0000009 What is 1180 rounded to the nearest one thousand? 1000 Round 28613 to the nearest one thousand. 29000 What is 0.00008225 rounded to 6 dps? 0.000082 What is 6252.26 rounded to the nearest one hundred? 6300 What is 0.00000083234 rounded to 7 dps? 0.0000008 What is -50571000 rounded to the nearest 100000? -50600000 What is 118.607 rounded to the nearest 10? 120 Round 5.144 to 1 dp. 5.1 What is -1.681 rounded to the nearest ten? 0 Round 0.00067914 to 4 decimal places. 0.0007 What is -5791700 rounded to the nearest 1000000? -6000000 Round -0.01861	{ "pile_set_name": "DM Mathematics" }
r of 675 and 33885. 135 Calculate the greatest common divisor of 55 and 50545. 55 What is the highest common factor of 268818 and 330? 66 What is the highest common factor of 210 and 7329? 21 What is the greatest common factor of 1931456 and 206? 206 What is the greatest common factor of 5004 and 1467? 9 What is the greatest common factor of 66845 and 290? 145 What is the greatest common factor of 23840 and 616115? 745 What is the highest common divisor of 48420 and 90? 90 Calculate the highest common divisor of 502 and 5534. 2 Calculate the highest common factor of 493 and 101133. 17 Calculate the highest common divisor of 402135 and 5. 5 Calculate the greatest common divisor of 13057 and 1430. 11 What is the greatest common factor of 120 and 179688? 24 What is the highest common divisor of 9246 and 18? 6 What is the greatest common factor of 1728 and 108? 108 What is the highest common divisor of 1542 and 6? 6 Calculate the greatest common divisor of 1463922 and 1336. 334 What is the greatest common factor of 33299 and 2814? 469 Calculate the greatest common factor of 4336 and 272. 16 What is the greatest common divisor of 228 and 14400? 12 What is the highest common factor of 6058 and 8? 2 Calculate the greatest common factor of 2652 and 171821. 13 What is the greatest common divisor of 36195 and 1140? 285 Calculate the greatest common divisor of 3484 and 23584. 268 Calculate the highest common divisor of 1987874 and 14. 14 Calculate the highest common divisor of 4653 and 330. 33 Calculate the highest common factor of 104 and 2020174. 26 Calculate the greatest common divisor of 622 and 1261416. 622 What is the greatest common divisor of 9060 and 1860? 60 What is the greatest common divisor of 6985 and 485? 5 What is the highest common factor of 52 and 306956? 52 What is the highest common divisor of 10 and 49750? 10 Calculate the highest common divisor of 23 and 136551. 23 Calculate the highest common factor of 432 and 3440. 16 Calculate the greatest common divisor of 76042 and 8492. 386 What is the greatest common divisor of 1180 and 3967750? 590 What is the greatest common factor of 8608 and 18304? 32 Calculate the greatest common factor of 3828 and 5154. 6 What is the greatest common divisor of 44 and 5951? 11 Calculate the highest common divisor of 33984 and 177. 177 What is the greatest common divisor of 804406 and 708? 118 Calculate the greatest common factor of 5670 and 2170. 70 What is the greatest common factor of 855 and 24320? 95 What is the highest common divisor of 36750 and 490? 490 What is the greatest common factor of 1919 and 13851? 19 Calculate the highest common divisor of 507609 and 63. 9 What is the highest common divisor of 127 and 73? 1 Calculate the highest common divisor of 19446 and 903. 21 What is the greatest common factor of 127131 and 93? 93 What is the highest common divisor of 316360 and 8360? 440 What is the greatest common divisor of 96 and 416544? 96 What is the greatest common factor of 3084 and 7296? 12 What is the greatest common divisor of 3287 and 1045? 19 Calculate the highest common divisor of 472 and 33925. 59 Calculate the greatest common divisor of 1285197 and 636. 159 Calculate the greatest common divisor of 147 and 27. 3 What is the greatest common factor of 20 and 179520? 20 Calculate the highest common factor of 564 and 61899. 141 Calculate the greatest common factor of 44 and 40854. 22 What is the greatest common divisor of 780 and 219921? 39 Calculate the greatest common divisor of 8 and 4480376. 8 What is the greatest common divisor of 3074 and 51504? 58 What is the greatest common factor of 7337 and 16192? 253 Calculate the greatest common factor of 18 and 4122. 18 Calculate the greatest common factor of 39168 and 21. 3 Calculate the highest common factor of 109117 and 513. 19 Calculate the greatest common divisor of 6912 and 74496. 768 What is the greatest common factor of 168 and 1037414? 14 Calculate the greatest common divisor of 1104997 and 53. 53 What is the highest common factor of 5934 and 1702? 46 What is the greatest common divisor of 101472 and 2478? 42 Calculate the greatest common factor of 429 and 10686. 39 What is the highest common divisor of 30190 and 225? 5 Calculate the greatest common divisor of 3042 and 15574. 26 What is the greatest common divisor of 1055600 and 1131? 377 What is the greatest common factor of 1662 and 408021? 831 Calculate the greatest common factor of 1581 and 558. 93 Calculate the highest common divisor of 14501 and 136. 17 Calculate the highest common divisor of 3285 and 180. 45 What is the highest common divisor of 904 and 6212? 4 What is the greatest common divisor of 515 and 55311? 103 Calculate the highest common divisor of 1760 and 917488. 176 Calculate the greatest common factor of 198 and 10170. 18 Calculate the highest common divisor of 16 and 4601776. 16 Calculate the greatest common divisor of 99 and 360987. 33 What is the greatest common divisor of 10 and 7614? 2 What is the greatest common divisor of 657685 and 21070? 1505 Calculate the highest common factor of 345472 and 128. 128 Calculate the greatest common factor of 3618 and 13230. 54 What is the highest common factor of 1808 and 26208? 16 What is the highest common divisor of 170 and 145010? 170 Calculate the greatest common divisor of 102011 and 20709. 767 What is the greatest common factor of 26 and 633763? 13 What is the greatest common factor of 9338 and 29232? 406 Calculate the greatest common factor of 27 and 108159. 3 Calculate the highest common factor of 817 and 37797. 43 What is the highest common divisor of 192867 and 159? 159 What is the greatest common divisor of 407 and 1650? 11 What is the greatest common factor of 14932 and 72? 4 What is the greatest common divisor of 58488 and 168? 24 Calculate the highest common factor of 1624 and 34307. 203 What is the highest common factor of 384 and 942? 6 What is the greatest common divisor of 546 and 13065? 39 Calculate the highest common factor of 39967 and 153. 17 What is the greatest common divisor of 2666 and 6293? 31 What is the highest common factor of 18148 and 2109356? 1396 What is the greatest common factor of 2094 and 9074? 698 Calculate the highest common factor of 145275 and 525. 75 What is the highest common factor of 43446 and 78? 78 Calculate the greatest common factor of 176251 and 1011. 337 What is the greatest common divisor of 1805 and 15275? 5 Calculate the highest common factor of 459 and 90504. 27 Calculate the highest common divisor of 249 and 192477. 249 What is the greatest common divisor of 31191 and 2109? 111 What is the highest common divisor of 10 and 230? 10 Calculate the greatest common factor of 2542 and 2666. 62 What is the greatest common factor of 12762 and 216? 18 Calculate the greatest common factor of 555 and 185. 185 What is the greatest common factor of 289376 and 24? 8 What is the highest common factor of 1632 and 8992? 32 Calculate the greatest common divisor of 5 and 5054305. 5 What is the highest common divisor of 162 and 10410? 6 What is the highest common factor of 2330 and 24495290? 2330 Calculate the highest common divisor of 224 and 70880. 32 Calculate the highest common factor of 49 and 4067. 49 What is the greatest common divisor of 418 and 13772? 22 Calculate the greatest common divisor of 301155 and 255. 255 What is the greatest common divisor of 18750 and 222? 6 Calculate the greatest common factor of 12792 and 429. 39 Calculate the greatest common factor of 1717725 and 19425. 2775 Calculate the highest common factor of 2729903 and 451. 451 Calculate the greatest common factor of 9 and 1590021. 9 What is the highest common divisor of 91 and 3283? 7 Calculate the highest common divisor of 106680 and 576. 24 Calculate the greatest common divisor of 96311 and 148. 37 What is the highest common divisor of 28 and 338828? 28 Calculate the greatest common factor of 44965 and 425. 85 What is the greatest common factor of 204189 and 3480? 87 What is the greatest common factor of 648 and 14010? 6 Calculate the greatest common factor of 1386 and 84798. 126 Calculate the greatest common divisor of 466 and 250. 2 What is the highest common divisor of 166225 and 59475? 1525 What i	{ "pile_set_name": "DM Mathematics" }
525b2/4 - 58529b/4 + 34347/2. (b - 107)*2(b - 3)(b - 2)/4 Factor 3f*3/7 - 2883f*2/7 + 2880f/7. 3f(f - 960)(f - 1)/7 Suppose -4i*5 - 116i*4 - 412i*3 - 284i*2 + 416i + 400 = 0. Calculate i. -25, -2, -1, 1 Factor 3x3 + 111x*2 + 480x. 3x(x + 5)(x + 32) Find u such that -u2 - 1750u - 1749 = 0. -1749, -1 Solve 2y5 - 36y*4 + 110y*3 + 420y*2 - 112y - 384 = 0 for y. -2, -1, 1, 8, 12 Factor 2k4 + 56k*3 + 170k*2 - 3468k. 2k(k - 6)(k + 17)2 What is l in 5l*4 - 560l*3 + 13305l*2 + 28310l + 14440 = 0? -1, 38, 76 Factor 3r4/4 - 45r*3/4 + 21r*2/2. 3r*2(r - 14)(r - 1)/4 Let -y4 - 11y*3 - 42y*2 - 68y - 40 = 0. Calculate y. -5, -2 Solve -2r2/5 - 36r - 720 = 0. -60, -30 Solve 2m4/7 - 664m*3/7 + 1322m*2/7 - 660m/7 = 0 for m. 0, 1, 330 Factor -m*3/3 - 3m*2 + 25m/3 + 11. -(m - 3)(m + 1)(m + 11)/3 Determine q, given that 18q3/7 + 5718q*2/7 - 7648q/7 + 2552/7 = 0. -319, 2/3 Factor -4n3/3 - 23n*2/6 - 13n/6 + 1/3. -(n + 1)(n + 2)(8n - 1)/6 Factor 21w*3/5 + 699w*2/5 - 1272w/5 - 84. 3(w - 2)(w + 35)(7w + 2)/5 Let 4q3 + 20q*2 - 3000q = 0. Calculate q. -30, 0, 25 Factor -108c3 + 532c*2 + 2632c + 192. -4(c - 8)(c + 3)(27c + 2) What is t in t*4/4 + 12t*3 - 49t*2/4 = 0? -49, 0, 1 Factor -2k*4/5 + 6k*3/5 + 98k*2/5 + 18k. -2k(k - 9)(k + 1)(k + 5)/5 Find i such that 56i3/3 - 450i*2 + 142i/3 + 16 = 0. -1/7, 1/4, 24 Solve 48c4 - 218c*3 + 362c*2 - 262c + 70 = 0. 7/8, 1, 5/3 Find q, given that -4q5/5 - 21q*4/5 + 47q*3/5 - 3q*2 - 7q/5 = 0. -7, -1/4, 0, 1 Let -16t5/3 - 104t*4/3 - 209t*3/3 - 58t*2/3 + 75t + 54 = 0. Calculate t. -9/4, -2, -1, 1 Suppose -3y5 + 27y*4 - 69y*3 + 21y*2 + 72y - 48 = 0. Calculate y. -1, 1, 4 Factor -2g4 - 8g*3 - 4g*2 + 8g + 6. -2(g - 1)(g + 1)*2(g + 3) Determine r, given that 2r4/9 + 58r*3/9 + 208r*2/3 + 2944r/9 + 5120/9 = 0. -8, -5 Factor 3w3 + 54w*2 + 45w - 102. 3(w - 1)(w + 2)(w + 17) Determine a, given that a4/2 + 203a*3/2 - 309a2 = 0. -206, 0, 3 Suppose -v3 + v*2 + 182v = 0. Calculate v. -13, 0, 14 Factor -2b2/17 - 76b/17 - 74/17. -2(b + 1)(b + 37)/17 Solve s*2/3 - 8522s/3 + 18156121/3 = 0. 4261 Solve 3b2 + 144b = 0. -48, 0 What is a in 2a5/3 - 7a4/3 - a3 + 25a2/3 - 23a/3 + 2 = 0? -2, 1/2, 1, 3 Suppose 4i2 + 3996i - 8008 = 0. What is i? -1001, 2 Find g such that 5g4 - 25g*2 + 20 = 0. -2, -1, 1, 2 Determine i so that 2i*4/5 + 94i*3/15 + 178i*2/15 - 382i/15 + 104/15 = 0. -13, -4, 1/3, 1 Factor 2k4/3 - 232k*3 - 2848k*2 - 34432k/3 - 15360. 2(k - 360)(k + 4)*3/3 Find k, given that 3k*2/5 + 36k/5 + 12 = 0. -10, -2 Let 3r4 - 48r*3 - 51r*2 = 0. Calculate r. -1, 0, 17 Solve 4u*2/3 + 52u = 0 for u. -39, 0 Factor -z*2/2 + 21z/2 + 36. -(z - 24)(z + 3)/2 Solve -10v*2/11 + 2v/11 + 8/11 = 0. -4/5, 1 Find t such that 4t2 + 68024t + 289204036 = 0. -8503 Determine v so that -3v3/7 - 39v*2/7 + 45v - 513/7 = 0. -19, 3 Solve -2i4/3 - 10i*3 + 2i*2 + 86i/3 - 20 = 0 for i. -15, -2, 1 Factor -3j3 + 30j*2 - 33j - 210. -3(j - 7)(j - 5)(j + 2) Suppose 3s*3 - 42s*2 + 123s + 168 = 0. What is s? -1, 7, 8 What is h in -h*2 + 30h - 125 = 0? 5, 25 Factor u*2/7 + 68u/7 + 1156/7. (u + 34)2/7 Let a3 - 158a2 + 157a = 0. What is a? 0, 1, 157 Factor 4d3 + 36d*2 + 104d + 96. 4(d + 2)(d + 3)(d + 4) Factor 551o*3/4 - 1101o*2/2 + 549o + 2. (o - 2)*2(551o + 2)/4 Suppose -2k*3/5 + 4k*2 + 46k/5 + 24/5 = 0. What is k? -1, 12 Suppose 28u5 + 456u*4 + 2592u*3 + 6080u*2 + 5568u + 1152 = 0. What is u? -6, -2, -2/7 Find n, given that -7n5/2 - 69n*4/2 - 23n*3 + 228n*2 - 32n = 0. -8, -4, 0, 1/7, 2 Factor -n*2/2 - 101n - 10201/2. -(n + 101)*2/2 Find p, given that 405p*5 + 1195p*4 + 750p*3 - 40p*2 = 0. -2, -1, 0, 4/81 Factor 3c*4 + 38c*3 + 84c*2 + 40c. c(c + 2)(c + 10)(3c + 2) Find v such that 2v4/3 + 28v*3/3 + 128v*2/3 + 76v + 42 = 0. -7, -3, -1 Determine o so that -11o5 + 46o*4 - 19o*3 - 64o*2 + 12o = 0. -1, 0, 2/11, 2, 3 Factor -72f2 + 196f + 60. -4(f - 3)(18f + 5) What is u in -3u*5/4 - 39u*4/4 + 213u*3/4 + 99u*2/4 - 459u/2 = 0? -17, -2, 0, 3 What is s in 2s3/3 + 10s*2/3 - 24s = 0? -9, 0, 4 What is g in 2g3/5 - 512g*2/5 + 33274g/5 - 64516/5 = 0? 2, 127 Suppose -14s4/11 + 1278s*3/11 + 4914s*2/11 + 2482s/11 - 1140/11 = 0. What is s? -3, -1, 2/7, 95 What is n in 3n3/4 - 21n*2 + 75n - 72 = 0? 2, 24 Determine y so that -2y5/5 - 14y*4/5 - 6y*3 - 2y*2 + 32y/5 + 24/5 = 0. -3, -2, -1, 1 Determine y, given that -35y3 + 920y*2 - 6175y + 1690 = 0. 2/7, 13 Factor -5n2/4 - 5n/2 + 10. -5(n - 2)(n + 4)/4 Factor -2l4/5 - 3614l*3/5 - 326886l*2 - 1630818l/5. -2l(l + 1)(l + 903)2/5 Determine s so that -s4/5 - 11s*3/5 + 12s*2/5 + 256s/5 - 256/5 = 0. -8, 1, 4 Factor -4v4 + 16v*3 - 20v*2 + 8v. -4v(v - 2)(v - 1)2 Let -f2/2 + 16f - 78 = 0. Calculate f. 6, 26 Let 3j3 - 6j*2 + 3j = 0. Calculate j. 0, 1 Factor 5m2/3 - 515m/3 + 170. 5(m - 102)(m - 1)/3 Solve -10c4/3 + 134c*3/3 - 272c*2/3 + 88c/3 = 0 for c. 0, 2/5, 2, 11 Factor -3t2/4 - 3t/4 + 3/2. -3(t - 1)(t + 2)/4 Factor -261b2 - 525b - 6. -3(b + 2)(87b + 1) Factor -2m*3/9 + 478m*2/9 - 476m/9. -2m(m - 238)(m - 1)/9 What is i in -i3 - 8i*2 + i + 8 = 0? -8, -1, 1 Factor 3u*3/5 + 177u*2/5 + 2484u/5. 3u(u + 23)(u + 36)/5 Determine v, given that 3v*4 - 3v3 = 0. 0, 1 Factor n4 - 5n3 + 6n*2 + 4n - 8. (n - 2)*3(n + 1) Determine b so that 2b4/5 + 2b*3 - 26b*2/5 + 14b/5 = 0. -7, 0, 1 Suppose 4d2/3 + 2304d + 995328 = 0. What is d? -864 Find y, given that 2y5/9 + 2y*4/9 - 4y*3/9 - 4y*2/9 + 2y/9 + 2/9 = 0. -1, 1 Suppose k4/3 - k3 - k*2 + 11k/3 - 2 = 0. What is k? -2, 1, 3 Factor -5v3/3 - 246v*2 + 296v/3. -v(v + 148)(5v - 2)/3 Find u such that u2 + 332u - 2720 = 0. -340, 8 Determine k, given that k*3 + 11k2 - k - 11 = 0. -11, -1, 1 Suppose k2 + 15k - 2296 = 0. What is k? -56, 41 Solve -3375w*4/2 + 65475w*3/2 - 12915w*2 + 1714w - 76 = 0. 2/15, 19 Factor 2x3 - 50x*2 + 48x. 2x(x - 24)(x - 1) Factor -405n*3 - 9360n*2 + 8560n - 1920. -5(n + 24)(9n - 4)2 Solve -2j*2 + 2j + 40 = 0 for j. -4, 5 Factor -3z3/2 - 9z*2/2 + 6z. -3z(z - 1)(z + 4)/2 Factor 3h*5 - 669h*4 + 55062h*3 - 1929906h*2 + 20556423h + 158340015. 3(h - 57)4(h + 5) Factor 6n2 - 183n/5 + 252/5. 3(n - 4)(10n - 21)/5 Factor -5x*5 + 385x*4 - 755x*3 + 375x*2. -5x*2(x - 75)(x - 1)2 Solve 5x*4 - 1020x*3 + 78030x*2 - 2653020x + 33826005 = 0. 51 Suppose z*3/5 - 45z*2 + 888z/5 - 884/5 = 0. What is z? 2, 221 Factor f*4/2 - 19f*3 + 18f*2 + 19f - 37/2. (f - 37)(f - 1)2(f + 1)/2 Factor 48f2 + 20f + 2. 2(4f + 1)(6f + 1) Factor -5n2 - 12540n - 7862580. -5(n + 1254)2 Solve -3g*5 - 27g*4 + 210g*3 + 1962g*2 + 4401g + 2673 = 0 for g. -11, -3, -1, 9 Factor -4m3 - 60m*2 - 188m - 132. -4(m + 1)(m + 3)(m + 11) Factor -3t*5/2 + 3t*3/2. -3t*3(t - 1)(t + 1)/2 Factor -a4/5 + 14a*3/5 - 33a*2/5 - 112a/5 - 64/5. -(a - 8)*2(a + 1)*2/5 Determine r so that 4r*4 - 84r*3 - 600r*2 - 1264r - 864 = 0. -2, 27 Factor m*4 + 33m*3 + 206m*2 - 240m. m(m - 1)(m + 10)(m + 24) Factor 2x*2 + 572x + 40898. 2(x + 143)2 Factor 2k*2 - 1330k + 1328. 2(k - 664)(k - 1) Find l, given that 3l2/2 - 39l/2 - 2775 = 0. -37, 50 Factor -3v3 - 21v*2 + 120v - 132. -3(v - 2)2(v + 11) Solve -25b5/3 - 5b*4 + 34b*3/3 + 14b*2/3 - 3b + 1/3 = 0 for b. -1, 1/5, 1 Determine m, given that -8m3 - 2m*2 + m = 0. -1/2, 0, 1/4 Factor 3w*3/2 + 21w*2/2 + 21w/2 - 45/2. 3(w - 1)(w + 3)(w + 5)/2 Let -2s*3/3 + 446s*2/3 + 452s/3 - 896/3 = 0. Calculate s. -2, 1, 224 Determine k so that 21k3 + 72k*2 + 69k + 18 = 0. -2, -1, -3/7 Determine m so that -m*4 + 7m*3 + 753m*2 + 1481m + 736 = 0. -23, -1, 32 Find x, given that -56x4 - 142x*3 - 120x*2 - 38x - 4 = 0. -1	{ "pile_set_name": "DM Mathematics" }
f 7? True Let m(f) be the third derivative of -3f4/8 + 161f*3/3 - 41f*2. Is m(0) a multiple of 23? True Suppose 0q - 2q + 8 = -4j, q = -5j + 4. Suppose 5a + v - 680 = 0, -v = qa - 2v - 553. Does 2 divide a? False Suppose o + 81 = -3w - 127, 0 = -4o - 4. Let g be (1596/(-63))/((-2)/(-9)). Let h = w - g. Is 15 a factor of h? True Does 74 divide 4329/13(-246)/(-27)? True Is (-12 - 6)120/(-4)2 a multiple of 30? True Suppose 0 = -d + 2, d - 16 = 4r + 10. Let j(h) = -21h - 16. Let f be j(r). Suppose t - f = -t. Does 19 divide t? False Let b = 264 - 185. Let m = b - 30. Let c = m - -71. Is c a multiple of 30? True Suppose -14r + 11r = d + 1, 4 = -4d + 5r. Let q(y) = -428y3 - y2 - y - 1. Is q(d) a multiple of 44? False Let g be ((-2)/6)/((-1)/51). Suppose -2n = -3 - g. Suppose -5d + nd - 260 = 0. Is d a multiple of 13? True Let j(d) be the third derivative of -d5/60 + 7d*4/2 - 5d3/2 - d2. Let p(m) be the first derivative of j(m). Is 21 a factor of p(0)? True Let y(v) = -3v3 - 7v*2 - 6v - 4. Let d(t) = -t3 - t2 - 1. Let f(r) = 2d(r) - y(r). Is 5 a factor of f(3)? False Let c(y) = y3 - 28y*2 + 183y - 89. Is 3 a factor of c(27)? False Suppose -9h = 14h + 6h - 1015. Does 5 divide h? True Let n(m) = m3 - 42m*2 + 41m + 1. Let l be n(41). Does 41 divide 3 - 0/l - (-190 + 12)? False Let f(q) = 5q2 + 11q + 35. Let j be f(-5). Is ((-7)/(j/(-114)))/((-2)/(-270)) a multiple of 18? True Let y be 1851/((-10)/8). Let m = 304 + y. Is m a multiple of 4? True Let n(y) = y3 + 8y*2 - 13y - 31. Let s(d) = -d*3 + 11d*2 - 10d - 9. Let a be s(10). Let w be n(a). Suppose -16r + 517 = -wr. Is r a multiple of 2? False Suppose -m + 1509 = 5r, -2m = -4m + 3r + 3083. Is m a multiple of 36? False Let w = 485 + -265. Let c(f) = f*3 + 15f*2 - 28f - 38. Let x be c(-17). Let u = w + x. Does 16 divide u? True Is 3 a factor of (((-1680)/1400)/(3/5))/(4/(-706))? False Is (2/(-7) - 115022/6965)-235 a multiple of 28? True Suppose 3t - 170 = 4s + 155, 2t = -2s + 184. Does 3 divide t? True Let n be (0 + -2)/(6/(-375)-5). Let s = n - -26. Is 54/s + -2 + (1 - -1) a multiple of 27? True Let t(v) = -3v - 7. Let r be t(-3). Suppose -p - 3c = rp - 1062, 4p - 1401 = -c. Does 23 divide p? False Let v(g) = g*3 - 5g*2 + 6g - 6. Let m be (-2 - 0)/((-13)/(195/6)). Let r be (m/10)/((-2)/4) + 6. Does 8 divide v(r)? True Let f(m) = 2m + 3 - m2 + 2 + 0m - 15m3 - 4. Let d be f(2). Let x = -69 - d. Does 10 divide x? True Let z = -80 - -54. Let s = z - -220. Let q = s - 48. Does 12 divide q? False Let b(d) = -d3 + 22d*2 + 18d + 18. Let y be b(22). Suppose -1506 + y = -7k. Is 39 a factor of k? True Let t(x) = -x2 + x + 160. Let s be t(-12). Suppose -2c = -sm - 924, 3m = -5c + 877 + 1368. Is 12 a factor of c? False Suppose 1031n - 1037n = -19152. Is n a multiple of 84? True Suppose 3b + 5x - 2828 - 728 = 0, -5910 = -5b - 5x. Does 11 divide b? True Let t(p) = 2p + 47. Let r(a) = a + 23. Let h(c) = -5r(c) + 2t(c). Let b be h(-24). Suppose bw + 280 = 2y, -554 = -3y - y + 3w. Is y a multiple of 27? False Let u be (16890/(-12) - (-6)/(-4))-1. Let y = -771 + u. Does 22 divide y? True Suppose 14z - 16z + 232 = 0. Suppose -7k + 242 = z. Is k a multiple of 2? True Suppose 2361p = 2368p - 91. Is 2351/p - (2 - 56/26) a multiple of 24? False Let z(b) = b*2 - 31. Let f be z(6). Suppose fk - k - 128 = 0. Is (-3)/((-12)/(-2))(0 - k) a multiple of 11? False Let f = 988 - -9792. Is f a multiple of 187? False Let t be (-65)/(-7) - (-4)/(-14). Let d = t + -3. Suppose -dm - 55 = -205. Is m a multiple of 2? False Suppose 3w - 5 = -0x - 5x, 4x - 31 = 3w. Suppose 2g - 2a - x = -0, -5a - 8 = -3g. Does 12 divide g/(6/4) + 2816/24? False Suppose -12p + 32 = -4p. Suppose 273 = pm + 45. Is m a multiple of 8? False Suppose 287 = -9o + 944. Suppose 2h - 471 = -o. Suppose -3x + m + h = -4m, 0 = -5x + 4m + 323. Is x a multiple of 9? True Suppose -2y - 12 = -20. Suppose 2j = -f + 398, f - yf - j + 1199 = 0. Is 16 a factor of f? True Suppose -2m + 6f - 1 = 3f, -2f + 2 = 0. Suppose -2n = -3y + 66, -7n = -3n - 12. Does 19 divide 79/m + y/(-8)? True Suppose 0 = -2o - 12, 87j - o = 92j - 20374. Is 9 a factor of j? False Suppose -5p + 6 = -4. Let q(o) = 0 - 2o + 2 + 3op - 13. Does 9 divide q(5)? True Suppose -5f + b = -948, -2f + 447 = -3b + 86. Is f a multiple of 65? False Let q be (6/4)/((-12)/(-15232)). Let k = -1204 + q. Is k a multiple of 55? False Is 27162/9 + -6 + -6 - -8 a multiple of 26? False Let c = -55 - -367. Suppose d = 2, 0 = -2b - 0d - d + c. Is b a multiple of 58? False Suppose -312 = -r - 327. Let m(g) = g*2 + 6g + 1. Let d be m(-4). Is (d/3)/(1/r) a multiple of 21? False Let w(q) = -352q + 1646. Is 30 a factor of w(-7)? True Is 185 a factor of ((-4)/(-3))/(602/4176375)? True Suppose -4u - 76 = -4t, -55 = 3u - 5t + 4t. Let d = u + 25. Suppose 6p = 5p + d. Is p even? False Suppose -3s + 5n + 260 = 0, 4s - 8n = -13n + 300. Suppose 0 = -421d + 417d + s. Is 12 a factor of d? False Let s(q) = q2 + q + 29. Let b be s(-6). Let m = -47 + b. Suppose 5a - m = 13. Is a a multiple of 5? True Let a = -1293 - -2295. Suppose 4c - 4s = 2c + a, -1014 = -2c - 2s. Is 62 a factor of c? False Let t be -1(-1)/(1/23). Suppose -53 = 5x - 8. Let p = t + x. Is p a multiple of 14? True Let k(f) = f2 + f - 14. Let i be k(-5). Suppose 5z - 1220 = -0z. Is 6 a factor of 1/3 + (z/i - 1)? False Let d be (3 + -6)-1 + 12. Suppose -3u = -q - 1027, -4u - dq + q = -1364. Does 12 divide u? False Suppose 0 = -2d + 6, 3c + 27d = 32d + 150. Let h = 20 - 54. Let b = c + h. Is 7 a factor of b? True Suppose 2l + 53 = 2a - 3, 0 = a + 2l - 13. Let f = 42 - a. Suppose -16z = -fz + 39. Is z a multiple of 4? False Suppose 169x = 166x + 6216. Suppose -26m = -33m + x. Is m a multiple of 9? False Let m(x) = -2x*2 - 11x - 42. Suppose 42 = -9k - 3. Let u(i) = i2 + 6i + 22. Let q(l) = ku(l) - 3m(l). Is q(-9) a multiple of 26? False Suppose 4018 = -6z + 15593 + 6551. Is 5 a factor of z? False Suppose 21x - 20423 - 70297 = -14x. Is 3 a factor of x? True Suppose 13u = -2u + 228000. Is 50 a factor of u? True Let h be (-2 - -4) + (-992)/(-3 + 1). Suppose -32m + 35m = 3p + h, -2m = 4p - 350. Is 20 a factor of m? False Suppose 18p - 64 = 22p. Is (-6)/p - (-68926)/176 a multiple of 7? True Suppose -5z = 4c + c + 20, 4c + 3z + 13 = 0. Is c/((4/(-6) + 1)/(-1)) a multiple of 3? True Suppose 78 = -2b + 5b. Let v(i) = 8i - 112. Does 48 divide v(b)? True Let v(x) = 6x*3 + 5x*2 - 2x - 1. Let i(z) = -z3 + z2 + z + 1. Let c(b) = -5i(b) - v(b). Does 5 divide c(-11)? True Suppose 4j = 149 - 13. Let m = j + -32. Suppose w = 2x - 227, -mx - 5w - 12 = -269. Does 10 divide x? False Suppose 120y - 123y = 4d - 38834, 48544 = 5d + 4y. Is d a multiple of 2? True Suppose 106 = -26t + 28. Let d(b) = -45b + 185. Does 10 divide d(t)? True Let d(n) = 76n + 101. Let p be 1064/114(-3)/(-2). Is d(p) a multiple of 75? False Suppose 38k - 87698 = 538. Is 9 a factor of k? True Let p = -3824 + 7600. Does 4 divide p? True Is 2 a factor of -4 + (-80)/(-15) + 247280/120? True Suppose 7g - 167938 = 114302. Is 160 a factor of g? True Let m be 7 - (3 - -2) - 3. Let s(h) = -36h + 45. Is s(m) a multiple of 18? False Let k = 383 + -382. Let b(x) = 8x*2 + 16x - 17. Is 7 a factor of b(k)? True Suppose -3p = -5p + 16. Suppose -96 = 2i - pi. Is (-483)/141/((-6)/i) a multiple of 23? True Let t(g) be the third derivative of -g4/24 + g2. Let z(i) = 2i - 6. Let s(n) = t(n) - z(n). Is 6 a factor of s(-4)? True Suppose 0 = -2255d + 2211d + 294800. Does 268 divide d? True Let g(s) = -s*2 + 10s - 16. Let i be g(6). Suppose -550 = -5h + 5r, 6r = -3h + ir + 325. Does 35 divide h? True Suppose j - 4x - 2280 = 0, 5 = -13x + 8x. Suppose -z + 566 = n, -3z = -4n - 4z + j. Is n a multiple of 10? True Let c = 27029 - 5278. Is 71 a factor of c? False Suppose -24 + 0 = -3l. Suppose -14a - 72 = -la. Is 13 - -124 - 5/(15/a) a multiple of 16? False Let p = 6444 - 4236. Is 24 a factor of p? True Let w(a) = -215a2 + 14a + 4. Let d be w(-2	{ "pile_set_name": "DM Mathematics" }
1573) + -2sqrt(1573) + -4 + -2 + sqrt(1573)-1 + sqrt(1573))*2 + -6sqrt(1573)-1 + 2. 198sqrt(13) + 1611 Simplify (-3sqrt(156)/sqrt(4) + sqrt(1404)-1)/(sqrt(27)/(-1sqrt(81))). 27sqrt(13) Simplify -6(-5 + sqrt(1300)1 + 2 - (sqrt(1300) + (-1 + sqrt(1300))-4)-3)*2. -499686 + 8640sqrt(13) Simplify (-5 + 2sqrt(275) + 5 + 1 + sqrt(275) + sqrt(275) + 0)2-5-6. 1200sqrt(11) + 132030 Simplify (2sqrt(50) - (2sqrt(2) + -3))6 - (3 + sqrt(242) + 0 + 4). 11 + 37sqrt(2) Simplify (1 + -3sqrt(1377)-1 + -5)*2. -216sqrt(17) + 12409 Simplify (-1 + ((0 + sqrt(5)-4)3 + 4)3)2. -792sqrt(5) + 6601 Simplify ((sqrt(624)1-4)/((sqrt(72)-4)/sqrt(6) - sqrt(12))2)*2. 3328/25 Simplify -1 + 1 + sqrt(171)/sqrt(144) + 6(-1sqrt(19) - sqrt(19))2 + 5 + sqrt(475). 21sqrt(19)/4 + 461 Simplify -1(0 + 2 + sqrt(300)). -10sqrt(3) - 2 Simplify ((5(-4sqrt(176) + sqrt(176)))/(sqrt(576) - sqrt(576)-1))2. 275/16 Simplify (-5sqrt(686)-1)/((sqrt(1458) - sqrt(1458)3) + sqrt(1458)). -35sqrt(7)/27 Simplify (sqrt(252)2-3-4 + 4(sqrt(252) + 1 + -1 - sqrt(252)) + 5)2. 1440sqrt(7) + 145177 Simplify ((1 + sqrt(931) - sqrt(931) - sqrt(931))*2 + sqrt(931) - -2sqrt(76)/sqrt(4)) + 1 + -4-3(sqrt(76) - (-1 + sqrt(76)))*2. -5sqrt(19) + 945 Simplify (-3 + (-1 + sqrt(500) + -1)-4)2 + 1. -400sqrt(5) + 8026 Simplify (-3 + 3 + (3 + sqrt(176)-1 - sqrt(176))2 + -5(sqrt(176) - 1sqrt(176)))-3. -2139 + 144sqrt(11) Simplify ((sqrt(500) + -3 - (sqrt(405)-6)*2) + -4)5-4. -200sqrt(5) + 291740 Simplify (51sqrt(9) - sqrt(9))/(sqrt(30)/(sqrt(30)/sqrt(3))) - (sqrt(972) - (sqrt(972)-2 + sqrt(972)) - sqrt(12))/(sqrt(176)/sqrt(11) - sqrt(4)). -13sqrt(3) Simplify -2(-5 + -2(sqrt(1300) + (5 + sqrt(1300)1)2)). 440sqrt(13) + 5310 Simplify ((sqrt(104)1 + sqrt(104))-5)/(sqrt(8) + (sqrt(968) - sqrt(968)-3) + sqrt(8)) + 2. -5sqrt(13)/23 + 2 Simplify 1(1 + 5(sqrt(405) - 2sqrt(405)) + -4)2. 270sqrt(5) + 10134 Simplify (5(-1sqrt(77) + sqrt(77))-3)/(4sqrt(539)1). 0 Simplify -6((sqrt(300) + -1 - sqrt(300))*2 + sqrt(363)-1). -6 + 66sqrt(3) Simplify -6(-2sqrt(2736) + 5 + (-3 + sqrt(1900) + 4)2). -11436 + 24sqrt(19) Simplify (sqrt(125) - (sqrt(125) - ((1 + sqrt(125) + sqrt(125))-1 + sqrt(125))) - (3sqrt(125) + -2))*2. -40sqrt(5) + 2001 Simplify (1 + sqrt(99)/(1sqrt(9)) + sqrt(11) + sqrt(11) + sqrt(11) + -1 + -2)2 + ((sqrt(891) - (sqrt(891)-2 + 4))1)2. -232sqrt(11) + 8215 Simplify 1(sqrt(19) + sqrt(57)/sqrt(3)1 - sqrt(19)) - (2sqrt(171)6)*2. -24624 + sqrt(19) Simplify 4(1 + -2sqrt(275)) + (4(sqrt(275) - 4-1sqrt(275)))*2 + 5. -40sqrt(11) + 110009 Simplify 0 + (5 + (sqrt(44)/sqrt(4))*2 + 5 + 0)-5. -105 Simplify (-12sqrt(171) + sqrt(171) + sqrt(171) + -62sqrt(171))/(sqrt(225) + 1sqrt(225) + sqrt(225) - 1sqrt(81)) + -3. -sqrt(19) - 3 Simplify 4(sqrt(1300)-2)*2-5 + 1(sqrt(1300) + 1) + (-2 + sqrt(1300))-1. -103997 Simplify (1(((sqrt(726) - sqrt(726)-2 - sqrt(726)) + sqrt(726) + sqrt(726))/sqrt(3) + 1))*2. 88sqrt(2) + 3873 Simplify -5 + (6sqrt(55)/(-5sqrt(25)/sqrt(5))-4)2. 6211/25 Simplify ((3((sqrt(133)1 - sqrt(133)) + sqrt(133)) - sqrt(133))-2)/(5-1sqrt(847)). 4sqrt(19)/55 Simplify ((sqrt(256) + -4(sqrt(256) + (sqrt(256) - 2sqrt(256) - sqrt(256)) + sqrt(256)))/((sqrt(2) - 2sqrt(8)/sqrt(4))-6))23. 32/3 Simplify -4(-4 + (-2sqrt(171) + 4 - sqrt(171)-43)). -120sqrt(19) Simplify -3(2sqrt(931)-4 + -1 - (1 + (sqrt(931) + 0 + -4 - sqrt(931))))*2. -178764 + 672sqrt(19) Simplify ((1 + sqrt(325) - sqrt(325))3)2 + 4 - (((sqrt(325)-2)*2 + sqrt(325))2 + -2 + 0 + sqrt(325)). -2585 - 15sqrt(13) Simplify 4 + 1 + ((sqrt(98) - (-4sqrt(98) - sqrt(98) - sqrt(98)))*2-2 - sqrt(98) - (sqrt(98) + -1)-4). -9603 + 21sqrt(2) Simplify -6(3((sqrt(1377) + -1 - sqrt(1377)) + sqrt(1377))-5)2. -1860300 + 24300sqrt(17) Simplify 0 + sqrt(448) + -1 + -4 + -5sqrt(448)2 + 3. -72sqrt(7) - 2 Simplify (-1 + -1sqrt(468)3)22. 72sqrt(13) + 8426 Simplify -4((sqrt(30)/(sqrt(18)/(sqrt(9)1) + sqrt(2)))/(sqrt(33)/((sqrt(99)/sqrt(3))/sqrt(3))))2. -5 Simplify ((sqrt(275) + 1)-6 + -1sqrt(275) + -2 + -2)2. 700sqrt(11) + 13575 Simplify 5(sqrt(18) + 5 + 4sqrt(6)/sqrt(3))*2 + (sqrt(100)/sqrt(2) + sqrt(2) - -4(sqrt(72))*2). 356sqrt(2) + 903 Simplify ((sqrt(270)/(sqrt(36)/sqrt(4)))/((sqrt(54) + sqrt(1350) - sqrt(54))/sqrt(9))2-2)*2. 16/5 Simplify (5sqrt(4200)-2)/(-1(sqrt(6) + 4sqrt(96))). 100sqrt(7)/17 Simplify (-1(sqrt(147) + sqrt(147)-2-2 + -3 + 3sqrt(147)))*2. -336sqrt(3) + 9417 Simplify ((sqrt(684) - (sqrt(684) + -3-3sqrt(684)))-4 + -2 + 1 + 2sqrt(684))*2. -456sqrt(19) + 987697 Simplify -6(1 + sqrt(175)) + (3sqrt(63)4)/sqrt(9). -18sqrt(7) - 6 Simplify ((sqrt(285) + sqrt(285)-2)/sqrt(5))/((sqrt(3) + sqrt(6)/sqrt(2))3)-5. 5sqrt(19)/6 Simplify 5(0 + sqrt(252)4 + 0). 120sqrt(7) Simplify (-1sqrt(2400))/((sqrt(88) + 1sqrt(88))/sqrt(11)) + 3. -5sqrt(3) + 3 Simplify -4 + (1sqrt(176)-6 - (1 + sqrt(176))2)2. 128sqrt(11) + 11264 Simplify ((sqrt(30) + -2sqrt(30))-6 + sqrt(270)6)/((2sqrt(66)-4)/sqrt(11)). -3sqrt(5) Simplify -4 + (-5(1 + sqrt(1377) + sqrt(1377) + 0))2. 900sqrt(17) + 137721 Simplify ((sqrt(117) + (sqrt(117) - (sqrt(117) - sqrt(117)-3)1))/(sqrt(324)1)-3)*26. 78 Simplify (3 + -3 + sqrt(833)3 + sqrt(833) + -5)2. -280sqrt(17) + 13353 Simplify 5 + (sqrt(512)-2)/(sqrt(144)6). -4sqrt(2)/9 + 5 Simplify 5 + (1(sqrt(1377)-2 - sqrt(1377))3 + 3)*2. -486sqrt(17) + 111551 Simplify ((sqrt(931)1-4 - sqrt(931))2 - (-3 + (sqrt(931)2 - sqrt(931)))-3)2. 882sqrt(19) + 45700 Simplify ((sqrt(1053) + -2sqrt(1053) - sqrt(1053))-4 + -2)*26 + -2. -1728sqrt(13) + 404374 Simplify -5(sqrt(40)/(sqrt(10)/sqrt(2)))/(-1sqrt(196)). 5sqrt(2)/7 Simplify 1-2((1 + sqrt(147))-4)2-5. 2240sqrt(3) + 23680 Simplify (((sqrt(684) - (sqrt(684) + 1)) + sqrt(76)/sqrt(36))2 + (sqrt(57)/(-2sqrt(147) + sqrt(147)))*2)-6. -3086/147 + 4sqrt(19) Simplify -1(-2-1sqrt(190)3)/(1(sqrt(240)/sqrt(4))/sqrt(6)). -6sqrt(19) Simplify ((4sqrt(495)2)/(sqrt(11) + (-2sqrt(66))/sqrt(6) - (sqrt(44)/sqrt(2) + sqrt(22))/sqrt(2)))*2. 320 Simplify ((sqrt(300) - (4 + sqrt(300)-2 + sqrt(300) - sqrt(300))) + 2)*2 - (-6(sqrt(300) + 0) + -5(0 + sqrt(300)))2. -33596 - 120sqrt(3) Simplify ((3-1sqrt(567) + sqrt(567) - 3(sqrt(567) + -1)) + -3 + (sqrt(567) + 1 + 4 - sqrt(567)))2. -450sqrt(7) + 14200 Simplify (5 + (sqrt(180) - (-4 + -1 + sqrt(180)) - sqrt(180)) + 3 + 0)*2. -156sqrt(5) + 349 Simplify -2(4 + (3sqrt(605)-5 + sqrt(605) - (sqrt(605) - (2sqrt(605) + -5))))*2. -204492 - 572sqrt(5) Simplify -5((1 + 1 + sqrt(147) - sqrt(147)) + 3(sqrt(147) + 1) + -5)*23. -19845 Simplify sqrt(110)/(sqrt(10) + sqrt(160)) - (sqrt(55)/(sqrt(5) + (sqrt(5) - sqrt(50)/(sqrt(90)/sqrt(9)))))*2. -11 + sqrt(11)/5 Simplify -3 + sqrt(2448) + -2 - (-4(-2 + sqrt(2448)))*2. -39237 + 780sqrt(17) Simplify (-2 + sqrt(68)-1)2 + -2 + 2. 8sqrt(17) + 72 Simplify 1(-2 + 1 + sqrt(17) + sqrt(17)) + 3(sqrt(1700)-2 + sqrt(1700))2. 2sqrt(17) + 5099 Simplify -1(sqrt(147) + 2)23 + (sqrt(147) + -2 + 5 + sqrt(147))-3. -462 - 126sqrt(3) Simplify ((2 + sqrt(847))*2 + sqrt(847) + -1 + -5)-5. -4225 - 275sqrt(7) Simplify (3 + -3(-1 + (sqrt(80) - sqrt(80)-1)) + 5 + 3)2. -672sqrt(5) + 3076 Simplify (sqrt(171) - 2sqrt(171)4 - (sqrt(171) + 11sqrt(171) + sqrt(171)))/(sqrt(729)1 - -3(sqrt(144) + sqrt(9))). -5sqrt(19)/12 Simplify 2(6sqrt(17)-1)*2 + 3 + sqrt(17) + sqrt(17)2-3. -5sqrt(17) + 1227 Simplify ((sqrt(104) - -2sqrt(104)1 - sqrt(104)) + sqrt(104))/(sqrt(96)/(sqrt(12) + sqrt(24)/sqrt(2))) + (-2-1sqrt(78))/(sqrt(18)/(sqrt(3)1)). 8sqrt(13) Simplify (-1(-1 + sqrt(162) + (sqrt(162) - (sqrt(162) + -3)) + 4 + 5)5)*2. 4950sqrt(2) + 7075 Simplify 3 + (sqrt(684) + 3 - ((sqrt(76))*2 + -5)) + -5. -70 + 6sqrt(19) Simplify 0 + -1((0 + sqrt(1539))-3 - (6sqrt(1539)2 - sqrt(1539))*2). 27sqrt(19) + 186219 Simplify 5 + (-3 + sqrt(2448) + -3 - ((3 + sqrt(2448) - sqrt(2448)) + -5)). 1 + 12sqrt(17) Simplify ((1sqrt(198) + sqrt(198))/sqrt(11))/(-2(sqrt(36) - sqrt(9))) - (5 + -6(sqrt(2) + sqrt(18) + 1)). 1 + 23sqrt(2) Simplify (-2 + 3(	{ "pile_set_name": "DM Mathematics" }
60)/((-20)/(-4)))/(-1) and k. 60 Let l = -27 + 39. Calculate the least common multiple of 20 and l. 60 Let x be 4 - 9 - (-1 + 1). Let j = x - -6. What is the least common multiple of 1 and j? 1 Let c be (-50)/(-30) + (-2)/(-6). Suppose -3m + 150 = 2m. What is the lowest common multiple of (264/m)/(c/5) and 4? 44 Let s be 18/(0 - 2/(-3)). Let x = -18 + s. What is the least common multiple of x and 11? 99 Suppose 2g - 4s + 32 = 0, 5g + 15 = -6s + 3s. Let d = 7 + g. Calculate the lowest common multiple of 3 and d. 3 Let s be (-3)/(9/6) + 7. Let z(r) = r3 - 4r*2 - 4r + 1. What is the smallest common multiple of z(s) and 16? 48 Suppose -55r + 51r = -20. Calculate the least common multiple of 88 and r. 440 Let y = 2097/6220 + 4/311. Calculate the common denominator of y and 93/32. 160 Let r(w) = 2 - 2 + 0w + 4 - w. Calculate the lowest common multiple of 1 and r(-4). 8 Suppose -z + 67 = 3i, -2i - 110 = -3z + z. Suppose -z = -4t + t - 5c, 0 = c - 2. Calculate the lowest common multiple of t and 14. 112 Let p = -7 + 9. Suppose l - p = 1, -3l = u - 14. Calculate the least common multiple of 10 and u. 10 Let u = -11446 + 160315/14. Find the common denominator of (2/24)/((-8)/306) and u. 112 Suppose -3h + 5x + 27 = -h, h - 15 = 4x. Calculate the smallest common multiple of 8 and h. 88 Let x = 57 + -29. Let l be 256/(-14) + 8/x. Calculate the least common multiple of 6 and (-2)/(-9) - 140/l. 24 Let t = -11 - -28. What is the common denominator of (-2)/(-4)t + -1 and 101/8? 8 Let u = 7/55168850 - 59116182222/7916729975. Let i = -36/205 + u. Calculate the common denominator of 97/20 and i. 140 Suppose -27b = -34b + 196. What is the least common multiple of b and 36? 252 Suppose 5w + 10 = 3k, k + 2w = 4w + 4. Suppose k = 3o - o - 14. What is the smallest common multiple of o and 5? 35 Let c(p) = 13p2 + p. Let h(v) = -6v*3 - 3v*2 + 2v. Let w be h(2). Calculate the smallest common multiple of c(1) and w/(-10) + (-2)/(-5). 42 What is the common denominator of (-19)/(-44) + 33/44 and 25/4? 44 Let o(s) = 35s - 9. Let d be o(5). Let j = -641/4 + d. Calculate the common denominator of j and (3 - 2) + (-170)/8. 4 Calculate the common denominator of -97/4 and -2 + 4 - 53/7. 28 Let n = 81041/16 - 5063. Let m be (3/(-18))/(94/(-889)). Let d = m - -392/47. Find the common denominator of d and n. 48 Let j(d) = d. Suppose -2n + 12 = -4n. Let m(o) = -o3 - 6o*2 - o - 2. Let s be m(n). What is the smallest common multiple of 28 and j(s)? 28 Let k = -273/38 + -851/228. Let t = 613/13 + 8121/26. Let d = t - 327. What is the common denominator of d and k? 12 Let w = -688 + 2769/4. Suppose 2 = 2n - 0. What is the common denominator of n/((126/88)/(-7)) and w? 36 Let u be -3 + 2 - (-378572)/72. Let z = -5260 + u. What is the common denominator of 85/18 and z? 18 Let z be 3 + -5 + 31. Find the common denominator of -61/4 and z/526/4. 20 Let j = -8 + 13. Calculate the least common multiple of j and 7. 35 Calculate the common denominator of -46/11 and (54/57)/((-3)/(-8)). 209 Let p be 1 + 3 + -1 + 1. Suppose 4q + 44 = 5u - 8, -2u + 4 = pq. What is the least common multiple of ((-6 - -3) + -1)-1 and u? 8 Suppose 4d - 25 = 15. What is the least common multiple of d and 7? 70 Find the common denominator of 3135/(-22)(4/(-6) + 1) and -33/20. 20 Suppose -46 + 73 = l. What is the lowest common multiple of l and 18? 54 Let y = 15 + -5. Calculate the least common multiple of 8 and y. 40 Calculate the least common multiple of 10 and 49/6 + -1 + (-1)/6. 70 Let c = -12 - -10. Let s be 0 + c - (-127497)/6120. Let r = s - -1/2040. Calculate the common denominator of r and 53/18. 18 Let i be 2 - 4 - -22. What is the least common multiple of 7 and (-9)/(-1(-1 + i))? 63 Let m(k) = 503k - 5. Let d be m(11). What is the common denominator of d/240 - 2/10 and -58/5? 30 Find the common denominator of 31/6 and (-4)/14 + (-2158)/(-252). 18 Calculate the common denominator of -65/2 and (-1)/5(-392)/7. 10 Suppose 0 + 2 = -2r - 3p, 2r = 5p + 14. Suppose 5h = -5, 2s - rh = -0s + 8. Calculate the smallest common multiple of 10 and s. 30 Let i = -2/13349 - -387173/347074. What is the common denominator of -53/10 and i? 130 Suppose 5s - 4k = 70, 0s - 2 = s - 4k. Calculate the smallest common multiple of 8 and s. 72 Suppose 0 = r + 1 - 4. Let q = r - -1. Suppose 0p - 2p = -3z + 6, -2z + 5p + q = 0. What is the least common multiple of z and 6? 6 Let v(n) = 8n - 5. Let u(x) = -17x + 10. Let z(i) = 4u(i) + 9v(i). Let d(f) = f*2 + 6f + 5. What is the least common multiple of d(-6) and z(4)? 55 Let r = 14/11 + -211/88. Let t = 6391 + -1737. Let i = t - 28003/6. Find the common denominator of i and r. 24 Suppose 0 = -3s + 26 - 2. Calculate the least common multiple of s and 10. 40 Let x(f) = -f3 - 11f*2 + 10f - 4. What is the lowest common multiple of 22 and x(-12)? 220 Let d(r) = -r*2 + 3. Let f be d(3). What is the least common multiple of 2(-22)/(f/3) and 18? 198 Find the common denominator of -2/7 and 6(-2)/44 - 1. 77 Let a be -16(0 + -5 + 3). Suppose -4g = -a - 8. What is the least common multiple of g and 1? 10 Find the common denominator of ((404 + -2)/6)/(33) and -49/15. 45 Suppose w + 2w = -2b - 20, 0 = -2w + 2b. Let h(n) = 1899n - 1. Let g be h(w). Let x = g - -121489/16. Calculate the common denominator of -91/6 and x. 48 Let v = -7 - -11. Suppose -30 = -b - vb. What is the lowest common multiple of 8 and b? 24 Let h be -1 + 2 + (-77870390)/(-64276). Let g = 4/16069 - h. Let v = g + 1173. What is the common denominator of v and -52/9? 18 Let v = 142556195/14 - 10176857. Let l = v - 5721. Find the common denominator of -43/20 and l. 140 Let k be (-219)/((-1580)/392 - -4). Let f = -128737/18 + k. Calculate the common denominator of f and -63/8. 72 Suppose 4d - 27 = -3. What is the least common multiple of d and 9? 18 Find the common denominator of 2 - (1617/12)/(-7) and 18/5. 20 Suppose -14n + 10 = -9n. What is the least common multiple of 11 and n? 22 Let w be 12/(-2) + (-2)/(-1). What is the common denominator of (-12)/(-9)(-30)/44 and 1 + w/18 + 0? 99 Let o = 9847 - 58949/6. Find the common denominator of o and 57/14. 42 Let a = 2 - -4. Let k(c) = c*2 - 6c - 6. Let f be k(a). Find the common denominator of 14/3 and 1/f(-40)/(-6). 9 Let w = 65926 - 328178/5. Let f = w - 292. Find the common denominator of 77/(-10) - (1 - -2) and f. 10 Let i(r) be the first derivative of 2r3/3 + r2 - r + 1. Calculate the smallest common multiple of i(-3) and 2. 22 Let u = 11417/32 - 357. Calculate the common denominator of u and -27/16. 32 Let g(d) = -d*2 - 6d + 5. Calculate the least common multiple of 2 and g(-5). 10 Calculate the common denominator of 1 + 2026/(-858) + (-20)/130 and -71/4. 132 Let q(b) = 2b - 10. Let t be q(11). Suppose -4i = -4 - 4. What is the smallest common multiple of 16/6 - t/18 and i? 2 Let q = -4 + 2. Let m = q - -8. Suppose a = -3a + 16. What is the smallest common multiple of m and a? 12 Let x = 8914 + -142569/16. Calculate the common denominator of -31/12 and x. 48 Let s(f) be the second derivative of -f3/3 + f2/2 + f. Calculate the least common multiple of s(-3) and 10. 70 Let h = -25713/20 - -1286. Calculate the common denominator of -77/2 and h. 20 Suppose -3y + 24 = 3n, 2n + n - 4 = y. Suppose 5a - p - y = 0, -a - 4p + 30 - 8 = 0. What is the smallest common multiple of a and 7? 14 Suppose -3w - 2w = -110. Suppose -o + w = o. What is the smallest common multiple of o and 60/27 - (-2)/(-9)? 22 Let t = -623/860 - -115/43. What is the common denominator of t and 69/22? 220 Let x = -1/53 + 276/583. Let p = -1/4030 - -139037/8060. Calculate the common denominator of p and x. 44 Let a(d) = -3d - 57. Let c be 117/5 + 2/(-5). Suppose -83 = -5k - c. Calculate the smallest common multiple of k and a(-21). 12 Let l = 31689/16 + -1983. Find the common denominator of l and -71/18. 144 Suppose 0 = -5j - 15, -3m + 38 + 46 = -j. Let v = m - 7. What is the least common multiple of v and 20? 20 Let t(c) = c - 5. Let q be t(5). Suppose -2h - h - 45 = q. Calculate the common denominator of (303/(-6) + 1)/h and -20. 10 Suppose k = 0, u - 2k = k + 3. Suppose 7 = u*x - 8. C	{ "pile_set_name": "DM Mathematics" }
21, -178, -263, -382, -541? -746 What is next in -210, -418, -626, -834, -1042? -1250 What is next in -2138, -4276, -6414, -8552, -10690? -12828 What is next in -11, -31, -51, -71, -91, -111? -131 What is the next term in -470, -487, -504? -521 What comes next: 1731, 3461, 5191, 6921? 8651 What comes next: -97, -91, -85? -79 What is the next term in 2340, 2342, 2344? 2346 What comes next: -1826, -1801, -1738, -1619, -1426? -1141 What is next in 6, 1, -22, -75, -170, -319, -534? -827 What comes next: 1699, 1697, 1695, 1693? 1691 What is next in -20530, -20529, -20528, -20527? -20526 What is the next term in -68, -99, -130, -161, -192? -223 What is next in 41, 297, 979, 2297, 4461, 7681, 12167, 18129? 25777 What is the next term in -84, -352, -798, -1422, -2224, -3204, -4362? -5698 What comes next: -80, -198, -348, -524, -720? -930 What comes next: -13, -15, -17, -19? -21 What is next in -582, -587, -592, -597, -602? -607 What is the next term in 153, 288, 423? 558 What comes next: -3, -47, -157, -363, -695, -1183, -1857? -2747 What is the next term in 48, 63, 78, 93, 108, 123? 138 What is the next term in 161, 164, 177, 206, 257, 336, 449? 602 What is next in 4500, 4501, 4502? 4503 What is next in 31, 10, -11? -32 What is the next term in 7, -12, -29, -44, -57, -68? -77 What is the next term in -28, -108, -244, -436, -684, -988, -1348? -1764 What comes next: 94, 361, 808, 1435, 2242, 3229? 4396 What is next in 36, 169, 390, 699? 1096 What is the next term in 64, 126, 188, 250, 312? 374 What is the next term in -3795, -7585, -11375? -15165 What is the next term in -11, -13, -17, -23, -31, -41, -53? -67 What is next in -1858, -1872, -1908, -1978, -2094? -2268 What comes next: 78, 68, 36, -30, -142, -312, -552, -874? -1290 What is the next term in 4, -12, -42, -92, -168, -276, -422, -612? -852 What is the next term in -1763, -3527, -5291? -7055 What is the next term in -1, -21, -55, -103? -165 What is the next term in 29, 368, 1307, 3146, 6185? 10724 What is the next term in -78, -42, 30, 150, 330, 582, 918, 1350? 1890 What is the next term in -8, -14, -18, -20? -20 What is the next term in -32, -138, -314, -560, -876, -1262? -1718 What is next in 4529, 4523, 4517? 4511 What is next in -268, -1071, -2400, -4249, -6612, -9483, -12856? -16725 What is the next term in 125, 151, 177? 203 What is next in 45, 74, 105, 138? 173 What is next in 35, 14, -29, -100, -205, -350, -541? -784 What comes next: 923, 1841, 2759? 3677 What is the next term in -131, -122, -107, -86, -59, -26, 13? 58 What comes next: -34, -42, -54, -70, -90, -114? -142 What comes next: -126, -264, -412, -576, -762, -976, -1224? -1512 What is next in -6, -1, 12, 39, 86, 159, 264, 407? 594 What is next in 1333, 2672, 4011, 5350, 6689? 8028 What comes next: -25, -35, -45, -55, -65, -75? -85 What is next in -33, -38, -55, -90, -149? -238 What comes next: 127, 110, 83, 46, -1? -58 What is next in -820, -1641, -2462, -3283, -4104, -4925? -5746 What is next in -244, -245, -246, -247? -248 What is next in -27, -54, -83, -114, -147, -182, -219? -258 What is the next term in -1271, -1269, -1267, -1265? -1263 What is the next term in 17, 86, 203, 368, 581, 842? 1151 What is next in 47, 33, 11, -19, -57, -103? -157 What comes next: -5, -36, -125, -302, -597, -1040, -1661, -2490? -3557 What comes next: -85, -172, -259, -346, -433? -520 What comes next: 59, 63, 57, 35, -9? -81 What is next in -27, -44, -61, -78, -95, -112? -129 What comes next: -42, 26, 92, 156, 218, 278, 336? 392 What is the next term in -1, -10, -17, -22? -25 What comes next: 173, 353, 533, 713, 893, 1073? 1253 What comes next: 749, 1496, 2243, 2990, 3737, 4484? 5231 What is next in -33, -50, -67, -84, -101, -118? -135 What is next in -70, -143, -216, -289? -362 What is next in 18, 31, 58, 105, 178, 283, 426? 613 What is next in -276, -1094, -2458, -4368, -6824? -9826 What is next in 81, 160, 239, 318, 397? 476 What comes next: -104, -82, -38, 34, 140, 286, 478, 722? 1024 What is the next term in -612, -2456, -5532, -9840, -15380, -22152? -30156 What comes next: -336, -338, -350, -378, -428, -506, -618, -770? -968 What is next in 27, 25, 15, -3, -29, -63? -105 What is next in 113, 111, 109, 107? 105 What comes next: 3168, 3161, 3154, 3147? 3140 What is the next term in 268, 257, 246, 241, 248, 273, 322, 401? 516 What is next in -20, -57, -118, -203, -312? -445 What is the next term in 100, 399, 890, 1567, 2424, 3455, 4654, 6015? 7532 What is next in 91, 176, 269, 376, 503, 656, 841, 1064? 1331 What comes next: -247, -485, -723? -961 What comes next: 70, 67, 64, 61, 58? 55 What is next in 105, 384, 847, 1494, 2325, 3340? 4539 What comes next: -443, -446, -459, -488, -539? -618 What is next in -456, -475, -506, -549, -604, -671? -750 What comes next: 118, 102, 86? 70 What is the next term in -171, -177, -187, -201, -219, -241? -267 What is next in -37, -30, -11, 26, 87? 178 What is next in -7, -107, -385, -931, -1835, -3187, -5077, -7595? -10831 What comes next: 1, -23, -79, -179, -335? -559 What is next in -2, 34, 94, 178, 286? 418 What comes next: 15, 45, 93, 159, 243, 345? 465 What comes next: 212, 407, 602, 797, 992, 1187? 1382 What comes next: 80, 180, 280, 380? 480 What comes next: -357, -725, -1103, -1497, -1913, -2357, -2835? -3353 What is next in -93, -189, -285, -381, -477, -573? -669 What is next in -1, -17, -49, -103, -185, -301, -457, -659? -913 What is next in -7, -1, 9, 23, 41, 63, 89? 119 What is next in 1647, 1645, 1643? 1641 What is next in -70, -71, -72, -73? -74 What is the next term in 340, 345, 360, 391, 444, 525, 640? 795 What is the next term in -32, -57, -108, -197, -336, -537? -812 What is next in 30, 16, -20, -90, -206? -380 What comes next: 298, 287, 268, 241, 206, 163? 112 What comes next: -380, -385, -392, -401, -412, -425, -440? -457 What is the next term in 50, 39, 14, -31, -102, -205, -346, -531? -766 What is next in 12, -13, -46, -87, -136, -193? -258 What is next in 101, 268, 435? 602 What comes next: -17128, -17126, -17124, -17122, -17120, -17118? -17116 What is next in 1585, 3137, 4691, 6247, 7805, 9365? 10927 What is next in -311, -308, -305, -302? -299 What is next in 186, 331, 476, 621, 766? 911 What is the next term in -30, -10, 38, 120, 242, 410, 630? 908 What is next in 588, 1174, 1762, 2352, 2944? 3538 What comes next: 19, 29, 39, 49? 59 What comes next: -114, -229, -344, -459, -574, -689? -804 What is next in 434, 432, 430, 428? 426 What comes next: 743, 1499, 2255? 3011 What comes next: -427, -843, -1259, -1675, -2091? -2507 What is the next term in -123, -246, -381, -534, -711, -918? -1161 What comes next: 8, 10, 12, 14, 16? 18 What comes next: -4, 44, 120, 218, 332, 456? 584 What comes next: -168, -634, -1410, -2496, -3892, -5598? -7614 What comes next: -30916, -61831, -92746, -123661? -154576 What is next in 8, 7, 4, -1, -8, -17? -28 What is the next term in -200, -199, -198, -197, -196, -195? -194 What is next in -333, -665, -997? -1329 What is the next term in 157, 285, 413, 541, 669, 797? 925 What is next in 15, 55, 121, 225, 379, 595? 885 What is the next term in 26, 33, 26, -1, -54, -139? -262 What is the next term in -223, -423, -623, -823, -1023? -1223 What is next in 47, 80, 113, 146, 179, 212? 245 What comes next: -9, -50, -117, -210, -329, -474? -645 What is next in 28, 32, 42, 64, 104, 168? 262 What comes next: -18, 13, 66, 141? 238 What is next in -2083, -2080, -2075, -2068, -2059, -2048, -2035? -2020 What is next in 284, 605, 950, 1331, 1760, 2249, 2810? 3455 What is the next term in -1093, -2190, -3287, -4384, -5481? -6578 What is next in 39149, 39148, 39147, 39146, 39145, 39144? 39143 What is next in 779, 1558, 2337? 3116 What comes next: -457, -453, -449, -445, -441, -437? -433 What is the next term in -8570, -8572, -8576, -8582? -8590 What is next in 1668, 1672, 1678, 1686? 1696 What comes next: -32, 2, 60, 142? 248 What comes next: 3862, 3858, 3852, 3844, 3834, 3822, 3808? 3792 What comes next: -6, -11, -18, -27, -38, -51, -66? -83 What is next in 34, 34, 36, 40? 46 What comes next: -98, -90, -60, 4, 114, 282, 520? 840 What is the next term in 128, 513, 1154, 2051, 3204, 4613? 6278 What comes next: 74, 73, 72, 71, 70? 69 What comes next: 441, 396, 351, 306, 261	{ "pile_set_name": "DM Mathematics" }
) Simplify (q*4q)/(q/(qq/(qq*3)q))q/(q(2/21)q)(q/q7)/q assuming q is positive. q(-86/21) Simplify (o(-1/17))14(o/(o/(o/o(-4/5))))6 assuming o is positive. o(848/85) Simplify ((k(-2/21)k)(-27))(10/7) assuming k is positive. k(-1710/49) Simplify (q(8/3)/(q/q(4/3)))/((q/q(-1/7)qq)/qqq(4/7)q) assuming q is positive. q*(-12/7) Simplify (((n/(n/(n(n/n1)/n)))/n)/n)(-3)n(-16)n/n*(-1/3)n assuming n is positive. n(-23/3) Simplify r(-2/51)rrr37r((rr/r*26rrr)/r)(12/17) assuming r is positive. r(1246/51) Simplify v*(2/13)/vv*(-1/3)v(v/(v4/v))/v(-25) assuming v is positive. v(890/39) Simplify ((a(4/3)a)/(a*(-11)/a))/(a/(a/((a/(a/(aa(-2/3)/a)))/a)))25 assuming a is positive. a*56 Simplify ((a/((a/(a((aa(-8)a)/aa)/a))/a)a)/a)*35/(aa(a(1/3)/a)/aa(-2)) assuming a is positive. a(-520/3) Simplify (((ff(1/11)f)/f2)/(f(1/4)/(f(fffff(2/5)/ff)/f)))(3/5) assuming f is positive. f(2799/1100) Simplify (g*(-4/13)g)*45g*(-1/17)/gg*(-4/5)g assuming g is positive. g*(33476/1105) Simplify ((m/(m/(m/(mm*(1/4)m))))/m*(-1/4))/((m/((m/(mm/(mm/(mm*(-11/2))mm)))/m))/m(-7)) assuming m is positive. m(-5/2) Simplify ((ww/(w*(2/7)/w)w)/w)*(-4/5)w*(8/9)w10 assuming w is positive. w(2746/315) Simplify (z*(-7)z*(-2/19)/z(z/z(-1/3))(11/5))(39/5) assuming z is positive. z(-19162/475) Simplify sss*(-7/5)sss(ss/(s*(-16)s)s)/s((s*(-5)/s)/ss)(-22/5) assuming s is positive. s47 Simplify (p(-1/4))0/(p*7p11) assuming p is positive. p(-18) Simplify (((r(-8)/r)/r10)/(((rr(-1/11))/r)/((rr((((r(-13)/r)/r)/r)/r)/r)/r)))42 assuming r is positive. r(-16590/11) Simplify (d/(d0d))*(-26)d*(-8)d/(d/(d*(1/20)d)d) assuming d is positive. d(-159/20) Simplify (t(-3/4)/t(2/3)t*(-13/5)t7)(5/8) assuming t is positive. t(179/96) Simplify (((t(-5)t)/((t(-4/3)/t)/tt))/(t*3t/(t(tt(-1/4))/t)))46 assuming t is positive. t*(-1357/6) Simplify (g/((g/(ggg(-1/3)))/g))(6/35)(g(gg/g*(-1/10)g)/g)/((g/g(4/13))/g) assuming g is positive. g(3517/910) Simplify (uu10)(-3/44)u(-13/2)/(u/(u/u(-10))) assuming u is positive. u(11/4) Simplify (l11l)(-2)(l(-5))(-4) assuming l is positive. l*(-4) Simplify (((ww/(w/w*(-1))ww)(-26))(-5))(-13/6) assuming w is positive. w(-1690/3) Simplify (((u0)21)(-21))(1/22) assuming u is positive. 1 Simplify ((x((x/(x/(xx0))x)/x)/x(x(-27)x)/x)(-28/9))(1/6) assuming x is positive. x(364/27) Simplify (t(-3/8)tt/t*7t*7/tt/t(-2))(-22) assuming t is positive. t(-319/4) Simplify (f/f(2/9))(2/33)/(f(-10)/(ff(8/3))) assuming f is positive. f(4073/297) Simplify t(3/7)/(tt*(-1/19))t/t*(-2)tt0 assuming t is positive. t(463/133) Simplify ((q/q(-8/5))/(q(-7/3)/q))(-36) assuming q is positive. q(-1068/5) Simplify ((((l(1/8)/l)/l)/ll)/l*(2/19)(ll(-1/6))/lll/((l/l(-2/17))/l))35 assuming l is positive. l(-71785/7752) Simplify (c/(c/c(2/19)))/c11c*(-15)ccccc25 assuming c is positive. c(59/19) Simplify (ii/(ii(5/4)/i))(-46)/(i*(2/27)ii)(2/31) assuming i is positive. i(-57977/1674) Simplify ((oo/(o((o/(o/(o/o(1/7))))/o)/ooooo)o)/oo(o(oo*(-2/21))/o)/o(o/o(-5))/(o/o(-2/11)))16 assuming o is positive. o(14288/231) Simplify k*(-2/59)k*17k/k*1kk(kk(-25)k)/k assuming k is positive. k(-297/59) Simplify (v(2/5)vv(20/7)/v)/((v/v(-26))/(v(12/11)/v)) assuming v is positive. v(-9106/385) Simplify r*23rr/r(-2/5)(r/(r/(rr(1/8))))/r(1/4) assuming r is positive. r(1051/40) Simplify ((r3r)/r)/(rr(-3/5))(r/(r(r(r/r*(-1/3)r)/r)/r))39 assuming r is positive. r(-247/5) Simplify (q/q(1/4))(12/5)q(4/9)/(qqqq(-10)) assuming q is positive. q(416/45) Simplify ((y*(-7)y)/(((y*9/yy)/y)/y))/((y*(-8/7)/y)/(yy10)) assuming y is positive. y(1/7) Simplify (t(-6))(-1/61)(t(-5))(-1) assuming t is positive. t(311/61) Simplify (fff7/ff)*(-20)/((fff(-11))/ff(-15)) assuming f is positive. f(-155) Simplify ((kk/k(2/3))/(kkkk*2)k*(-3)kk/(k((k/k*1)/k)/kk))(-24) assuming k is positive. k112 Simplify (f(-6/11)/((((f(-5)f)/f)/f)/f))(5/14) assuming f is positive. f(355/154) Simplify ((((f(5/6)/f)/f)/f(-2/15))(4/25))(6/11) assuming f is positive. f(-124/1375) Simplify (kk(4/13))11k23/(k(1/2)/k) assuming k is positive. k(985/26) Simplify (n(nn(-10))/n)/n32(n*(-2/73)/n)/nn/n(6/5) assuming n is positive. n(-15778/365) Simplify ((y/(yy/((y/y2)/y)))/(y(2/29)y))/((y/(y/(y*11/yy)))/y(-5)) assuming y is positive. y(-582/29) Simplify (((a*0a)(9/7))46)(-5/7) assuming a is positive. a(-2070/49) Simplify ((yy(-12))/(y/(y(-1/7)/yyy)))(2/47) assuming y is positive. y(-156/329) Simplify ((tt*(-6/11)tt6)/(t1)(-11/6))(2/47) assuming t is positive. t(613/1551) Simplify (dd*30)/(d/(d/(d/(((dd*16)/d)/d))))((dd(-14/5)/dd)/d)/(d*27/dd) assuming d is positive. d(76/5) Simplify (((v/v(1/11))/v)/v*(-6)v/(v/(vv(-2/29)))vv(6/7)v)(-5/9) assuming v is positive. v(-12030/2233) Simplify (v(2/5))(-2/65)(vv(-2/3))/v7 assuming v is positive. v(-6512/975) Simplify ((b(-1/2))*(1/93)b*6/((bbbb*(2/3)bb)/b))(-41) assuming b is positive. b(-10127/186) Simplify (x(-3)x)(-1/15)/((x(5/6)x)/(xx(-4))) assuming x is positive. x(-47/10) Simplify (h/((h*(-4)h)/h))/h*(1/19)h*(-3/16)hhh(hh17)/h assuming h is positive. h(7527/304) Simplify (((j/j*0j)/(jj/(jj*(-1/2)/jj)))(-3/25))(-14) assuming j is positive. j(21/25) Simplify (p18p6)/(p(1/5)/p(4/13)) assuming p is positive. p(1567/65) Simplify ((d(-1)/((d/((d/(dd*(-3)))/d))/d))/(d/(d/(d/(d/(d/(dd*(-3/11)d)d))))d(-1/3)))(-1) assuming d is positive. d(-35/33) Simplify (b5/bbb6)/(b(-6/11)/(b*11b)) assuming b is positive. b(259/11) Simplify ((h(-3/2)/h)/h)*(4/5)h*(1/7)h7/h assuming h is positive. h(117/35) Simplify (v/(v*(-8)/v)v0)/(v(1/9)/(vv/v(-1/5)v)) assuming v is positive. v*(589/45) Simplify (((qq(-4/9))/(q/q(-1)))45)(-1/38) assuming q is positive. q*(65/38) Simplify (kk*(-4/13)k(17/5))(-1) assuming k is positive. k(-266/65) Simplify (d/d9)(-27)/(d(-3/4)d)50 assuming d is positive. d(407/2) Simplify (x24xx(-28)xx)/((x(-2/51)/x)/((x(-2/39)x)/x)) assuming x is positive. x(-8/663) Simplify u(-2/67)uu/(u/(uu/(uu/(uu/u21)u)))u30uu/u(-3/8) assuming u is positive. u(7153/536) Simplify z(4/17)(z/z*(-5/11))/z((zzz*(-6)/zz)/z)(-26) assuming z is positive. z(24439/187) Simplify (u/(uu/(u/(u(u/u*(-7))/u))))/(uu*(-5/8))(u(-1/16))(30/7) assuming u is positive. u(-121/14) Simplify (s(-22/3)/sss*(-17))/(ss*(-4/11)s/s(-5/8)) assuming s is positive. s(-7021/264) Simplify z16/z(-3)(z(-5)/z)(-1/23) assuming z is positive. z(443/23) Simplify (c(-2/5)/c(-3)c*(-2/3)/(c/(c/(c/(c/(c/(ccc3/c)))))))(-17/5) assuming c is positive. c(-1258/75) Simplify fff(ff/((ff*(-12))/f))/ffff(ff*(-5))/fff(f/f(2/3))(-1/17) assuming f is positive. f*(815/51) Simplify (((z/(z/(zz*(-3/7)))zz)/z(z*(1/2)zz)/z)/(z(-4)/z(1/6)))50 assuming z is positive. z(7600/21) Simplify (w(-4/5))(4/31)/(w8www/(ww(2/17)/w)) assuming w is positive. w(-28947/2635) Simplify (((aaa7)(-20))(-2/141))(-7/9) assuming a is positive. a(-280/141) Simplify ((p(-4/9)p(2/21)/p)/(p1/p)(-22))21 assuming p is positive. p(-85/3) Simplify (q3q/(q3/q))/(q11q0/q) assuming q is positive. q(-8) Simplify (xx(2/3)x/x*(-1)((x/x1)/x)(-15))(-5) assuming x is positive. x(-280/3) Simplify (((b/(b/(b/(b/(b*2b)))))/bb)(5/3)/(b(-1/2)b/b(-1/5)))(-50) assuming b is positive. b(-215) Simplify (((r(-1/3))42)(2/23))(-38) assuming r is positive. r(1064/23) Simplify (d(-4/25)/(d(1/2)/d))**(-1/51) assuming d is posi	{ "pile_set_name": "DM Mathematics" }
-144sqrt(2) + 1161 Simplify ((sqrt(75) + -1)1 + -2)3. -9 + 15sqrt(3) Simplify (sqrt(616)/(sqrt(33)/sqrt(3)))/(sqrt(200)6). sqrt(7)/30 Simplify (sqrt(363))2 + -1 + -5sqrt(6)/sqrt(2). -5sqrt(3) + 362 Simplify sqrt(80)/sqrt(4)-1. -2sqrt(5) Simplify (-5(4 + sqrt(19)) - 5sqrt(57)/sqrt(3))2. 400sqrt(19) + 2300 Simplify (sqrt(6) + sqrt(42)/sqrt(7) + sqrt(6))/sqrt(2) + (sqrt(108))*2-2. -216 + 3sqrt(3) Simplify (sqrt(175)2)*2 + -2sqrt(175). -10sqrt(7) + 700 Simplify ((1 + 1 + sqrt(363))-2)*2 + 4. 176sqrt(3) + 1472 Simplify (4(sqrt(171) + -1sqrt(171)))/sqrt(9). 0 Simplify sqrt(20)/(3sqrt(10)) - (sqrt(56) - sqrt(14))/sqrt(7). -2sqrt(2)/3 Simplify (sqrt(19) - (sqrt(57)/sqrt(3) - sqrt(19))*2)-6 + 0. -6sqrt(19) Simplify -5((sqrt(192) + (-4sqrt(192) - sqrt(192)))2 + sqrt(192)). -15360 - 40sqrt(3) Simplify (sqrt(432)/sqrt(9))/sqrt(4)-3. -6sqrt(3) Simplify -5(-4 + sqrt(3)) - (sqrt(27) + -4). -8sqrt(3) + 24 Simplify ((sqrt(396)-2 + sqrt(396))-4 + sqrt(396))/sqrt(9)-5. -50sqrt(11) Simplify (sqrt(12)/(sqrt(36)-5))2. 1/75 Simplify 3((sqrt(18)/sqrt(2))/sqrt(3) - (sqrt(9)/sqrt(3))*24). -36 + 3sqrt(3) Simplify 2 + (sqrt(75))2 - 61sqrt(3). -6sqrt(3) + 77 Simplify (sqrt(16)-12)/(sqrt(8) - (sqrt(8) + -6-1sqrt(8)))4. 4sqrt(2)/3 Simplify (sqrt(60)/sqrt(40))/sqrt(3). sqrt(2)/2 Simplify ((sqrt(5) - sqrt(20)/sqrt(4) - sqrt(5))-2)2 - sqrt(20)-5. 20 + 10sqrt(5) Simplify 4(3 + sqrt(133)/sqrt(7) + sqrt(19)). 12 + 8sqrt(19) Simplify ((sqrt(720) + -1 + sqrt(720))-5)*2 + sqrt(720) + 3 + sqrt(720)-1. -1200sqrt(5) + 72028 Simplify ((sqrt(684) + sqrt(684)1)3 - sqrt(684))2. 17100 Simplify sqrt(17) + (sqrt(272) + 0)2 + (sqrt(425) + 3)2. 31sqrt(17) + 706 Simplify (-5 + sqrt(2057)2 + -4 + sqrt(2057))2. -594sqrt(17) + 18594 Simplify (sqrt(68) + 6(1sqrt(68) + sqrt(68) - sqrt(68)))/(sqrt(28)/(sqrt(7)-1) - sqrt(4)). -7sqrt(17)/2 Simplify (sqrt(240) - 6sqrt(240)2)/sqrt(5) + 4. -44sqrt(3) + 4 Simplify -2 + (sqrt(160)/sqrt(72))/(sqrt(400) + (sqrt(400) - -2sqrt(400))). -2 + sqrt(5)/120 Simplify 1sqrt(7)2-6. -12sqrt(7) Simplify (sqrt(2299) - (sqrt(2299) - -5sqrt(2299)1) - sqrt(2299) - sqrt(2299))*2 - sqrt(2299). -11sqrt(19) + 112651 Simplify ((sqrt(605) + 0 + sqrt(605))1)2 + (-5(-1 + sqrt(605) + sqrt(605)) + sqrt(605))*2. -990sqrt(5) + 51450 Simplify (3sqrt(88) - sqrt(88))/sqrt(8) + sqrt(495)/sqrt(5). 5sqrt(11) Simplify ((-3sqrt(288))/sqrt(12))/sqrt(8). -3sqrt(3) Simplify (-1(sqrt(44) + -1))2 + -5. -4sqrt(11) + 40 Simplify 0 + sqrt(10)/((((sqrt(200)/sqrt(4) - sqrt(50)) + sqrt(50) - sqrt(50)) + sqrt(50))/sqrt(10)). sqrt(2) Simplify (-4sqrt(27)/sqrt(3))/(sqrt(3) - sqrt(162)/sqrt(6)). 2sqrt(3) Simplify (5(sqrt(432) + -1)2 + 2)*2. -1920sqrt(3) + 43264 Simplify (sqrt(1584)1 - (sqrt(132) + sqrt(132)-1)/sqrt(12))*2. 1584 Simplify -1(sqrt(17) + (sqrt(136)/sqrt(128))2). -sqrt(17) - 17/16 Simplify -5 + (sqrt(272))2 + 5sqrt(17)-2. -10sqrt(17) + 267 Simplify sqrt(1008) + sqrt(1008)3 + 5 + 3. 8 + 48sqrt(7) Simplify (-3sqrt(108) - sqrt(108))1. -24sqrt(3) Simplify sqrt(245) + (sqrt(245) - (sqrt(245) + 2 + sqrt(245))*2) + -4 + sqrt(245). -988 - 35sqrt(5) Simplify 5(3(0 + sqrt(475)) - (0 + sqrt(475)1)2). -2375 + 75sqrt(19) Simplify ((-6sqrt(88)2)/(sqrt(968) - (-2sqrt(968) + sqrt(968)) - sqrt(8)))2. 176/49 Simplify (sqrt(114)/sqrt(150) + (-4sqrt(76) - sqrt(19)))*2. 36784/25 Simplify 3((sqrt(171) + -1)-6)2. -648sqrt(19) + 18576 Simplify (sqrt(52)/(sqrt(28)/sqrt(7)) - (sqrt(325) + (sqrt(325)2 - sqrt(325)) + sqrt(13)))2 + 1. 1301 Simplify ((sqrt(85) - 1sqrt(85))2)/(sqrt(5) - (-4(sqrt(5) - sqrt(20)) - sqrt(5))). 0 Simplify 2 + (1 + sqrt(19))*2 + 4 + 5 + 0. 2sqrt(19) + 31 Simplify (6(sqrt(45) + 1)5)*2. 5400sqrt(5) + 41400 Simplify 5 + (4sqrt(77)2)/((2sqrt(77))/sqrt(11)). 5 + 4sqrt(11) Simplify (sqrt(21) - sqrt(84)/sqrt(4)5)/((-1sqrt(12))/sqrt(4)). 4sqrt(7) Simplify ((4 + sqrt(153) + 0 + 5)-5)*2. 1350sqrt(17) + 5850 Simplify sqrt(80)1 + 1. 1 + 4sqrt(5) Simplify (-5sqrt(91)3)/sqrt(7). -15sqrt(13) Simplify (sqrt(448) - (sqrt(448) + (2 + sqrt(448))2 + -5)) + -4. -451 - 32sqrt(7) Simplify (sqrt(25) - sqrt(900)-4)/sqrt(5). 25sqrt(5) Simplify (((sqrt(160) - -3sqrt(160))/sqrt(8))/(1sqrt(324) + sqrt(324)))*2. 20/81 Simplify ((sqrt(216) - (sqrt(216) + sqrt(216)-3)) + sqrt(216) - sqrt(216) - sqrt(6))/(sqrt(98)-3). -17sqrt(3)/21 Simplify -1(sqrt(9)/sqrt(12) - (sqrt(9)/sqrt(3) + -3)2). -13sqrt(3)/2 + 12 Simplify ((sqrt(153)/(-2sqrt(9)) - sqrt(17)) + (sqrt(17) - sqrt(17)-2) + 4)*2. 12sqrt(17) + 217/4 Simplify 4(0 + (sqrt(2)-2 + 5)*2 + sqrt(2)). -76sqrt(2) + 132 Simplify (sqrt(7200)-1)/(-1sqrt(810)). 4sqrt(5)/3 Simplify (sqrt(44)/(2sqrt(2)) - sqrt(22))/((-1sqrt(77))/sqrt(7)). sqrt(2)/2 Simplify sqrt(3) + ((sqrt(63)/sqrt(3))/sqrt(7))2 - (sqrt(75)2)*2. -297 + sqrt(3) Simplify -4(4 + -4 + sqrt(17))*2. -68 Simplify sqrt(33)/sqrt(3)-2 + (-1sqrt(33)/sqrt(3))2. -2sqrt(11) + 11 Simplify ((sqrt(7) + sqrt(21)/(sqrt(3)-2))-4)*2-1. -28 Simplify sqrt(38)/(sqrt(8)/(sqrt(256) + sqrt(4))). 9sqrt(19) Simplify (2 + 4 + -1sqrt(539))*2. -84sqrt(11) + 575 Simplify ((sqrt(700) - (1 + sqrt(700) + sqrt(700) + 0)) + 1 + sqrt(700) + -5)*2. 25 Simplify (sqrt(156)/sqrt(3) - sqrt(13)) + -1 + -1. -2 + sqrt(13) Simplify ((-3 + sqrt(1539))5)*2. -1350sqrt(19) + 38700 Simplify (-4sqrt(77)2 + sqrt(77) + sqrt(77))/sqrt(11). -6sqrt(7) Simplify sqrt(55)/(sqrt(11) - (sqrt(11) + sqrt(55)/sqrt(5))-2). sqrt(5)/5 Simplify (1(-2 + sqrt(4)/(sqrt(2)-2)))*2. 2sqrt(2) + 9/2 Simplify ((0 + sqrt(125))3)2. 1125 Simplify (-1(sqrt(396)-2)2 + (-1sqrt(396) + -2 - sqrt(396))*2)5. 20 + 240sqrt(11) Simplify -1(sqrt(2) - (5 + sqrt(2)-5)). -6sqrt(2) + 5 Simplify (-2sqrt(968) + sqrt(968) + sqrt(968))-1. 0 Simplify 1 + sqrt(5)1 - (sqrt(15)/sqrt(3) + 5)2. -29 - 9sqrt(5) Simplify (sqrt(42)/(sqrt(6)1)2 + -32(sqrt(7) + -1))*2. -48sqrt(7) + 148 Simplify (-4 + sqrt(325)-2)2. 80sqrt(13) + 1316 Simplify -3 + sqrt(637) + sqrt(637) - (sqrt(637) - (sqrt(637) + -2))*2. -7 + 14sqrt(13) Simplify (sqrt(720)1)2 + 4. 724 Simplify (sqrt(3400) + (sqrt(3400) + -4sqrt(3400) - sqrt(3400)) + sqrt(3400) + sqrt(3400))/sqrt(2). -10sqrt(17) Simplify -3 + sqrt(325)-1. -5sqrt(13) - 3 Simplify -5(sqrt(5) - (sqrt(50)/sqrt(40))*2). -5sqrt(5) + 25/4 Simplify (2 + (sqrt(1100) + sqrt(1100)-1 + -2)4)*2. 36 Simplify 3(5 + (-3 + sqrt(3))*22). -36sqrt(3) + 87 Simplify 4 + (-3(1sqrt(171) - sqrt(171)))/sqrt(9). 4 Simplify ((sqrt(1900) - 1sqrt(1900)) + -4)*2. 16 Simplify ((sqrt(52) - sqrt(208))-4)/((sqrt(12) - sqrt(108))/sqrt(3)) + 0. -2sqrt(13) Simplify (-2sqrt(70)/sqrt(40))*2-1. -7 Simplify (-2(2sqrt(228) - sqrt(228)))/(sqrt(144)/(sqrt(36)/sqrt(3))). -2sqrt(19) Simplify 16-2sqrt(5)-6. 72sqrt(5) Simplify (1 + -3sqrt(7) + sqrt(7))2 - (-1sqrt(1008) + sqrt(1008))*2. -4sqrt(7) + 29 Simplify 4 + sqrt(243)2 + sqrt(243). 4 + 27sqrt(3) Simplify (-6((sqrt(1100) + (2 + sqrt(1100) + 0 - sqrt(1100)) - sqrt(1100)) + sqrt(1100) + 1 + 0))2. 2160sqrt(11) + 39924 Simplify ((sqrt(11) - (sqrt(11) - sqrt(44)))6 + (4sqrt(77))/sqrt(7))2. 2816 Simplify (4 + sqrt(704) + 3)2. 112sqrt(11) + 753 Simplify (4-3sqrt(684)2)*2. 393984 Simplify (5((sqrt(114)2 - sqrt(114)) + sqrt(114)))/(sqrt(60)/sqrt(40)). 20sqrt(19) Simplify -1(sqrt(13) - (sqrt(65)/sqrt(20))2 - (-2 + sqrt(52))). 5/4 + sqrt(13) Simplify -3sqrt(475) - sqrt(209)/(sqrt(77)/sqrt(7)). -16sqrt(19) Simplify (sqrt(7) - (sqrt(7) - (4 + 2 + sqrt(7))2))-5. -215 - 60sqrt(7) Simplify (sqrt(140)/(sqrt(35)/sqrt(7)))/(sqrt(44)/(sqrt(11)-2)). -2sqrt(7) Simplify (2 + sqrt(176) + -5)2. -24sqrt(11) + 185 Simplify ((sqrt(170)-25)/(sqrt(1440) - (sqrt(1440) - (2sqrt(1440) - sqrt(1440)))))2. 425/36 Simplify (-1 + -1 + -1sqrt(162) + -1 + (sqrt(162) - (sqrt(162) + 0 + sqrt(162) + sqrt(162) - sqrt(162)) - sqrt(162)))*2. 162sqrt(2) + 1467 Simplify (-3 + sqrt(7) + 2 - sqrt(315)/sqrt(5))*2. 4sqrt(7) + 29 Simplify (((sqrt(264)3 - sqrt(264) - sqrt(264))/sqrt(11))/(-3sqrt(8)-3))2. 1/27 Simplify (sqrt(105)/(sqrt(10)/sqrt(2)))/(3-2*sqrt(7)). -sqrt(3)/6 Simplify sqrt(17	{ "pile_set_name": "DM Mathematics" }
3h + 196 = -0, -h = -v + 38. Let u = v - 14. Let j = 148 - 68. What is the remainder when j is divided by u? 26 Let s = -12 - -77. Let i(j) = -2j*2 - 28 - sj + 51j + j2 + 0j*2. Calculate the remainder when 50 is divided by i(-9). 16 Suppose 3k + 6j - 59 = 4j, 0 = -4k + j + 97. What is the remainder when 608 is divided by k? 10 Suppose -4z - 129 = -3t, 6t + 93 = 8t - 5z. Suppose -3m - t = -6m. What is the remainder when 35 is divided by m? 9 Let n = 382 + -222. What is the remainder when n is divided by (-868)/(-32) - ((-225)/(-72))/25? 25 Suppose 24m - 8944 = -19m. What is the remainder when m is divided by 5? 3 Calculate the remainder when ((-9)/6)/(98/(-4704)) is divided by (2 + 0 - 1) + 2 + 17. 12 Suppose -39i - 127i + 17430 = 0. What is the remainder when i is divided by 48? 9 Let j(p) = p*3 + 18p*2 + 19p + 36. Let g be j(-17). Let c be (-80)/(-15)18/g. Suppose 0 = b - 3b + c. What is the remainder when 118 is divided by b? 22 Suppose 5h = 290 - 175. Let n = h + 29. Calculate the remainder when 103 is divided by n. 51 Suppose 0 = -5m + 217 + 3. Suppose 3b = 3, -2u + 0b = -b - 523. Calculate the remainder when u is divided by m. 42 Let q(h) = -1810h + 32611. Suppose -4x = -r - 8, 3r + 0x = -5x - 24. Let t(g) = -g. Calculate the remainder when q(18) is divided by t(r). 7 Let t = 420 - 420. Suppose 0 = -0o + 5o + 2y - 175, t = 3y. What is the remainder when 382 is divided by o? 32 Let s be (-18)/30 - 1156/(-10). Let f(t) = -11t + 202. Let a be f(18). Suppose ab = 3b + s. What is the remainder when b is divided by 13? 11 Let r = -1998 - -2192. Calculate the remainder when r is divided by 57. 23 Let r(v) be the first derivative of v4/2 + 2v*3/3 - 3v*2 + 3v - 200. Suppose 0 = -6t + t + 270. What is the remainder when t is divided by r(2)? 9 Suppose -5t + 0c = 4c + 48, 2t - 2c = -12. Suppose 4p = 7p + 6. Calculate the remainder when ((-4)/t)/(p/(-792)) is divided by 50. 48 Suppose -24i = -22i + 3q - 92, 0 = 3i + 2q - 128. Calculate the remainder when 1130 is divided by i. 10 Let f(h) = 338h - 1673. What is the remainder when 1660 is divided by f(5)? 11 Let a = 116 + -83. What is the remainder when (-72738)/(-1458) - (-4)/36 is divided by a? 17 Suppose 0b + b + 5n = -18, -b - 48 = -n. Let c = b + 41. Let l = c - -5. What is the remainder when 16 is divided by l? 1 Let r(y) = 149y + 138. What is the remainder when 253 is divided by r(0)? 115 Let w(g) = -31g + 0g3 - 16g*2 + 5g*3 - 4g*3 - 5g*2 + 16g*2 + 11. What is the remainder when 83 is divided by w(9)? 27 Let j be 66/88 + 2/8. What is the remainder when 262 is divided by ((-66)/2)/(j + 10/(-5))? 31 Let a = 27 + -11. Let i(u) = 28u + 93. Let m be i(8). Suppose m = 5s + 92. What is the remainder when s is divided by a? 13 Let f(g) = -g - 14. Let r(t) = -t3 - 5t*2 - 2t. Let y be r(-2). Let m be f(y). Calculate the remainder when 35 is divided by -82/m18/4. 11 Let y(s) be the first derivative of s*4/4 - 5s*3/3 - 9s*2 - 10s + 149. What is the remainder when 45 is divided by y(8)? 7 Let f be 8/132-3 - (-706)/11. Suppose -4y - h + 140 = 0, -2h = 2y - 3h - f. What is the remainder when 99 is divided by y? 31 Let w(t) = -t3 - 4t*2 + 22t - 3. Let z be w(-7). Calculate the remainder when 44 is divided by 30/(-4 - z - 4). 14 Let c(u) = u*2 - 16u + 52. What is the remainder when c(17) is divided by 22? 3 Suppose 4m + 5v = 12, 8v - 15 = -5m + 5v. Let c be ((-22)/77)/(3702/(-1848) + 2). What is the remainder when ((-12)/(-8))/(m/c) is divided by 23? 21 Let j = 8126 - 8121. What is the remainder when -1 + 2 + 9 + -4 is divided by j? 1 Let x be 2/(-2 - -3) + 2. Suppose 7y - 12 = xy. Calculate the remainder when 117 is divided by 95/y + 1/4. 21 Let b = 6859 - 6197. Calculate the remainder when b is divided by 35. 32 Let s = -1336041 - -1336128. Let x = -122 + 179. What is the remainder when s is divided by x? 30 Suppose -2z = -6, 0 = 2h + h - 2z - 450. Calculate the remainder when 586 is divided by h. 130 Let h = -179 - -163. Calculate the remainder when 267 is divided by h/40 + (-152)/(-5). 27 Let l(u) = u*2 - 6u. Let x be l(12). Suppose -112 = -2f + x. What is the remainder when f is divided by ((-4)/(-2))/(2/31)? 30 Let a = -75 - -77. Suppose 4t + 4c - 24 - 16 = 0, 2c = 2t. Suppose 2o - 3 - 1 = 0, 2s + to - 26 = 0. What is the remainder when s is divided by a? 0 Suppose -4r + 14 = -6r. Let y = 0 - r. What is the remainder when (-574)/(-28) - (0 - 1/(-2)) is divided by y? 6 Let f be ((2/(-5))/((-24)/1080))/2. Suppose m - 9 = -o, -13o = -fo + 20. What is the remainder when 80 is divided by m? 10 Let l(j) = -j - 14. Let p be l(-18). Let s = p + 6. What is the remainder when 129 is divided by s? 9 Let n(q) = 5q3 + 103q*2 - 36q + 50. What is the remainder when n(-17) is divided by 69? 68 Let r(y) = -y*3 - 24y*2 + 13y - 122. What is the remainder when r(-25) is divided by 6/(-9) - (-96)/9? 8 Suppose -m + 244 = 241. What is the remainder when 117 is divided by m? 0 Let f(a) = 3a2 + 37a - 26. Let r be f(-13). Calculate the remainder when 555 is divided by r - (1/(-3))/((-9)/(-837)). 28 Let s = -448 + 468. Let a = 7 - 3. Suppose 0 = -2q + 8, 3o + aq - 46 = -6. Calculate the remainder when s is divided by o. 4 Let q = -39 - -54. Suppose w - q = -0w. Suppose -4t - 3v = -162, 17 = -3v + 11. Calculate the remainder when t is divided by w. 12 Calculate the remainder when (0 - -1) + 8272/60 - 52/(-390) is divided by 1/(-2)0 - -14. 13 Let u = 875 - 849. What is the remainder when 29 is divided by u? 3 Let g = 40 - 36. Let v(n) = -n*3 + 3n*2 + 10n - 20. Let f be v(g). Suppose 0 = fj + 8j - 84. Calculate the remainder when 55 is divided by j. 6 Suppose 2m = -2m - 3r - 420, m - r + 98 = 0. Let k = 149 + m. Let s = 87 - k. What is the remainder when s is divided by 11? 7 Suppose 4n = -5d + 89, 0d = 2d - n - 33. Let g(k) = -k3 - 2k*2 + 4k + 8. Calculate the remainder when g(-4) is divided by d. 7 Let g = 48 + -49. Let q be g(0 + (3 - 6)). Suppose 0 = -k + 3k - 5i - 86, 146 = 4k + qi. Calculate the remainder when 150 is divided by k. 36 Suppose -77w = -l - 82w + 64, 2w + 6 = 0. Calculate the remainder when 568 is divided by l. 15 Let v(y) = 2y2 - 19y + 63. Let j(k) = -2k + 55. Calculate the remainder when j(0) is divided by v(4). 17 Let o(i) = -22i - 34. Let x be o(-17). Let s = 367 - x. What is the remainder when 132 is divided by s? 24 Suppose 67 + 61 = 4f. Let s(n) = -n2 + 59n - 218. Calculate the remainder when s(51) is divided by f. 30 Suppose -2w - 192 = u, 0w = 2w - 5u + 192. What is the remainder when (0 + w)/(12/(-8)) is divided by 23? 18 Suppose -91x = 11x - 180234. Calculate the remainder when x is divided by 52. 51 What is the remainder when 619 is divided by 2/19 - (-118320)/2280? 47 Suppose -24m = -39m + 30. Suppose 3y - 11 = -s + 6, 39 = ms + y. Calculate the remainder when 31 is divided by s. 11 Calculate the remainder when ((-89)/1)/((1/3)/(262/(-786))) is divided by 30. 29 Let f(g) = 3g3 + 6g*2 - 4g - 1. Let i be f(1). Suppose -3w + 13 = i. What is the remainder when 5 is divided by w? 2 Suppose -6 = 2r, 2r + 39295 = u - r. Suppose -2524 = -10i + u. Suppose i = 8y + 1629. What is the remainder when y is divided by 40? 39 Suppose -2i + 6 = -2. Let c(z) = 315z - 21. Let g(x) = -63x + 4. Let v(w) = ic(w) + 21g(w). Calculate the remainder when v(-1) is divided by 13. 11 Suppose -z + 4i - 12 = -0, -4z - 4i = -52. Calculate the remainder when (-4 + -3)/28 - (-2282)/z is divided by 26. 25 Let l(u) = 5u*2 - 2u - 3. Suppose -9y + 4 + 23 = 0. Calculate the remainder when 174 is divided by l(y). 30 Let j(o) = 111o + 10. Let s be j(3). Let p = -244 + s. What is the remainder when p is divided by 18? 9 Suppose -3774 = -91f + 14517. What is the remainder when f is divided by 41? 37 Let n = -12109 + 12191. Calculate the remainder when 1639 is divided by n. 81 Let a = -2411 + 2498. Let h = -37 - -52. Calculate the remainder when a is divided by h. 12 Let z(r) = -r3 - 14r*2 - 18r + 1. Let s be z(-13). Let f = 119 - s. Let i(h) = -31*h - 642. Calculate the remainder when f is divided by i(-21). 8 S	{ "pile_set_name": "DM Mathematics" }
prime factors of 1846? 2, 13, 71 List the prime factors of 73499. 67, 1097 List the prime factors of 569. 569 List the prime factors of 7790. 2, 5, 19, 41 What are the prime factors of 92254? 2, 193, 239 List the prime factors of 55627. 11, 13, 389 List the prime factors of 611. 13, 47 What are the prime factors of 4507? 4507 List the prime factors of 4. 2 What are the prime factors of 27939? 3, 67, 139 What are the prime factors of 26244? 2, 3 List the prime factors of 1292. 2, 17, 19 List the prime factors of 2836. 2, 709 What are the prime factors of 22235? 5, 4447 List the prime factors of 2694. 2, 3, 449 What are the prime factors of 1182? 2, 3, 197 What are the prime factors of 20082? 2, 3, 3347 What are the prime factors of 29154? 2, 3, 43, 113 List the prime factors of 6633. 3, 11, 67 List the prime factors of 827. 827 List the prime factors of 9135. 3, 5, 7, 29 What are the prime factors of 4641? 3, 7, 13, 17 List the prime factors of 28387. 28387 What are the prime factors of 40? 2, 5 What are the prime factors of 77563? 77563 List the prime factors of 515. 5, 103 List the prime factors of 2810. 2, 5, 281 What are the prime factors of 4512? 2, 3, 47 List the prime factors of 1099. 7, 157 List the prime factors of 73. 73 What are the prime factors of 343? 7 What are the prime factors of 193? 193 What are the prime factors of 825? 3, 5, 11 List the prime factors of 5758. 2, 2879 What are the prime factors of 1969? 11, 179 What are the prime factors of 131014? 2, 13, 5039 List the prime factors of 7387. 83, 89 What are the prime factors of 40043? 23, 1741 What are the prime factors of 30728? 2, 23, 167 List the prime factors of 15382. 2, 7691 What are the prime factors of 13717? 11, 29, 43 What are the prime factors of 3431? 47, 73 What are the prime factors of 27304? 2, 3413 List the prime factors of 3582. 2, 3, 199 What are the prime factors of 2166? 2, 3, 19 List the prime factors of 23639. 7, 11, 307 What are the prime factors of 69256? 2, 11, 787 What are the prime factors of 8492? 2, 11, 193 What are the prime factors of 9228? 2, 3, 769 What are the prime factors of 407? 11, 37 List the prime factors of 1282. 2, 641 List the prime factors of 2. 2 What are the prime factors of 74337? 3, 71, 349 List the prime factors of 7973. 7, 17, 67 What are the prime factors of 393? 3, 131 What are the prime factors of 377? 13, 29 What are the prime factors of 3675? 3, 5, 7 What are the prime factors of 1133? 11, 103 List the prime factors of 81640. 2, 5, 13, 157 What are the prime factors of 1043? 7, 149 List the prime factors of 223. 223 List the prime factors of 8028. 2, 3, 223 What are the prime factors of 2085? 3, 5, 139 What are the prime factors of 43734? 2, 3, 37, 197 What are the prime factors of 579? 3, 193 What are the prime factors of 1398? 2, 3, 233 List the prime factors of 116660. 2, 5, 19, 307 What are the prime factors of 50307? 3, 41, 409 What are the prime factors of 339? 3, 113 What are the prime factors of 111846? 2, 3, 7, 2663 List the prime factors of 5689. 5689 List the prime factors of 1925. 5, 7, 11 What are the prime factors of 1881? 3, 11, 19 What are the prime factors of 21983? 13, 19, 89 What are the prime factors of 664? 2, 83 What are the prime factors of 19331? 13, 1487 List the prime factors of 1146. 2, 3, 191 List the prime factors of 13860. 2, 3, 5, 7, 11 What are the prime factors of 1404? 2, 3, 13 What are the prime factors of 7113? 3, 2371 What are the prime factors of 12310? 2, 5, 1231 List the prime factors of 10061. 10061 What are the prime factors of 1162? 2, 7, 83 List the prime factors of 558. 2, 3, 31 List the prime factors of 259. 7, 37 What are the prime factors of 33121? 11, 3011 List the prime factors of 138474. 2, 3, 7, 157 What are the prime factors of 3879? 3, 431 What are the prime factors of 17537? 13, 19, 71 What are the prime factors of 944? 2, 59 List the prime factors of 8885. 5, 1777 List the prime factors of 8171. 8171 What are the prime factors of 87831? 3, 3253 List the prime factors of 157165. 5, 17, 43 List the prime factors of 18366. 2, 3, 3061 List the prime factors of 10889. 10889 List the prime factors of 28635. 3, 5, 23, 83 List the prime factors of 42. 2, 3, 7 What are the prime factors of 9847? 43, 229 List the prime factors of 7667. 11, 17, 41 List the prime factors of 687. 3, 229 What are the prime factors of 678? 2, 3, 113 List the prime factors of 3887. 13, 23 List the prime factors of 5576. 2, 17, 41 What are the prime factors of 13318? 2, 6659 List the prime factors of 2226. 2, 3, 7, 53 List the prime factors of 53380. 2, 5, 17, 157 List the prime factors of 44405. 5, 83, 107 List the prime factors of 28044. 2, 3, 19, 41 List the prime factors of 165. 3, 5, 11 What are the prime factors of 6227? 13, 479 List the prime factors of 27053. 13, 2081 List the prime factors of 65510. 2, 5, 6551 What are the prime factors of 33603? 3, 23, 487 List the prime factors of 1134. 2, 3, 7 List the prime factors of 31298. 2, 15649 What are the prime factors of 10455? 3, 5, 17, 41 List the prime factors of 5248. 2, 41 List the prime factors of 6992. 2, 19, 23 List the prime factors of 117660. 2, 3, 5, 37, 53 List the prime factors of 8637. 3, 2879 What are the prime factors of 9371? 9371 What are the prime factors of 69298? 2, 34649 What are the prime factors of 79175? 5, 3167 List the prime factors of 8190. 2, 3, 5, 7, 13 What are the prime factors of 44175? 3, 5, 19, 31 What are the prime factors of 26749? 23, 1163 List the prime factors of 5322. 2, 3, 887 List the prime factors of 38334. 2, 3, 6389 What are the prime factors of 1624? 2, 7, 29 List the prime factors of 552. 2, 3, 23 What are the prime factors of 547? 547 List the prime factors of 1729. 7, 13, 19 What are the prime factors of 736? 2, 23 List the prime factors of 1328. 2, 83 List the prime factors of 2598. 2, 3, 433 List the prime factors of 39839. 39839 List the prime factors of 1284. 2, 3, 107 List the prime factors of 135537. 3, 45179 List the prime factors of 7011. 3, 19, 41 What are the prime factors of 62381? 11, 53, 107 What are the prime factors of 4129? 4129 List the prime factors of 55338. 2, 3, 23, 401 List the prime factors of 14978. 2, 7489 List the prime factors of 142. 2, 71 What are the prime factors of 20445? 3, 5, 29, 47 What are the prime factors of 106632? 2, 3, 1481 What are the prime factors of 273? 3, 7, 13 List the prime factors of 41202. 2, 3, 7, 109 List the prime factors of 2096. 2, 131 What are the prime factors of 5861? 5861 List the prime factors of 11895. 3, 5, 13, 61 List the prime factors of 11853. 3, 439 List the prime factors of 12694. 2, 11, 577 List the prime factors of 965. 5, 193 What are the prime factors of 5566? 2, 11, 23 List the prime factors of 9161. 9161 What are the prime factors of 42606? 2, 3, 263 List the prime factors of 3567. 3, 29, 41 What are the prime factors of 3632? 2, 227 What are the prime factors of 52946? 2, 23, 1151 What are the prime factors of 110633? 317, 349 List the prime factors of 925. 5, 37 What are the prime factors of 6913? 31, 223 What are the prime factors of 6635? 5, 1327 What are the prime factors of 923? 13, 71 What are the prime factors of 106131? 3, 17, 2081 What are the prime factors of 656? 2, 41 List the prime factors of 22821. 3, 7607 List the prime factors of 6129. 3, 227 What are the prime factors of 6751? 43, 157 List the prime factors of 103. 103 What are the prime factors of 4424? 2, 7, 79 List the prime factors of 16215. 3, 5, 23, 47 What are the prime factors of 13854? 2, 3, 2309 List the prime factors of 2304. 2, 3 What are the prime factors of 9429? 3, 7, 449 List the prime factors of 17828. 2, 4457 What are the prime factors of 3777? 3, 1259 What are the prime factors of 11908? 2, 13, 229 List the prime factors of 715. 5, 11, 13 List the prime factors of 148. 2, 37 List the prime factors of 67134. 2, 3, 67, 167 List the prime factors of 12399. 3, 4133 What are the prime factors of 1207? 17, 71 List the prime factors of 11574. 2, 3, 643 List the prime factors of 491. 491 What are the prime factors of 54259? 29, 1871 What are the prime factors of 29766? 2, 3, 11, 41 List the prime factors of 46080. 2, 3, 5 List the prime f	{ "pile_set_name": "DM Mathematics" }
5 wrt p? -600p*2 Let y(x) be the third derivative of -5x8/336 + x6/60 - 37x5/30 + x4/24 + 538x*2. Find the third derivative of y(z) wrt z. -300z*2 + 12 Let c be (-9 - -6)/((-3)/4 + 0). Suppose -3d - 2d = -70. Find the second derivative of -5y + 6y4 + 0y*c + dy wrt y. 72y2 Let z(s) be the first derivative of 5s*4/24 + 13s3/6 - s2/2 - 14. Let a(k) be the second derivative of z(k). Differentiate a(l) with respect to l. 5 Let p(s) be the third derivative of 0s3 + 18s*2 + 0 + 0s - 1/2s4 - 13/60s*5. Find the second derivative of p(m) wrt m. -26 Let o(s) be the third derivative of 17s*6/120 - 7s*5/60 + 47s*3 + 161s*2. Differentiate o(h) wrt h. 51h*2 - 14h Let m be (-20)/(-3)(-42)/(-28). Let u = m + -8. Find the second derivative of 2t*u - 7t - 2t2 + 66t*3 - 59t*3 wrt t. 42t Suppose -225 = 2k + 111. Let b be (-1 - 1) + k/(-24). Find the third derivative of 5a - 10a5 + 6a*2 - ba + 0a2 wrt a. -600a*2 Let r(d) be the first derivative of 0d*3 + 0d*4 + 3d*2 + 3/5d*5 + 0d + 4. What is the second derivative of r(f) wrt f? 36f2 Let f be ((-2)/(-3))/((77/(-336))/(-11)). What is the second derivative of -25j - 76j2 + fj*2 + 74j*2 wrt j? 60 Let q be (-11 + 2)/630. Let b(f) be the first derivative of 1/3f3 + qf*4 + 0f + 4 + 9/5f5 + 0f*2. What is the third derivative of b(i) wrt i? 216i What is the first derivative of 11 + 60m2 + 52m - 2m3 - 52m + 94 + 197 wrt m? -6m2 + 120m Let z(g) = 123g6 + 6g*3 + 330g*2 - 6g + 6. Let l(f) = f6 - f3 + f - 1. Let b(v) = -6l(v) - z(v). What is the third derivative of b(m) wrt m? -15480m*3 Let b(i) be the first derivative of -579i*2/2 - 620i - 471. Find the first derivative of b(s) wrt s. -579 Let u be 4/(-12) - (-96)/(-9). Let c = u + 13. What is the first derivative of -2 + 5 - 2 + 2d4 + cd*4 wrt d? 16d*3 What is the first derivative of 330y + 335y + 359 - 611y*3 - 665y wrt y? -1833y2 Let g be 90/208/6. What is the third derivative of -6w2 + 11 - 15w*g - 11 wrt w? -1800w3 Let c(i) = i3 - i - 1. Let a be (-2)/1 + 0/(-1). Let s(g) = g*3 + g. Let z = 168 - 170. Let r(n) = ac(n) + zs(n). Differentiate r(h) wrt h. -12h*2 Let v(c) be the first derivative of -17/7c*7 + 0c*4 + 0c*2 + 0c + 0c6 + 5c*3 - 9 + 0c*5. What is the third derivative of v(x) wrt x? -2040x*3 Let q = 22 - 14. Let r be ((-12)/15)/(q/(-20)). Find the third derivative of 96c + 2c3 - 96c - 10cr wrt c. 12 Let o(z) be the second derivative of -83z*4/12 - 23z*2 - 168z. Differentiate o(a) wrt a. -166a Let d(a) = 15a*2 - 18a*5 - 3 - 24a*5 + 38a*5. Let h(w) = 5w*5 - 14w*2 + 2. Let m(l) = -2d(l) - 3h(l). Find the third derivative of m(n) wrt n. -420n*2 Let j(i) be the first derivative of -3i*8/112 + 7i*5/30 + 13i*2 + 20. Let x(z) be the second derivative of j(z). Find the third derivative of x(k) wrt k. -540k*2 Differentiate -3k + 4k + 9k - 9k + 7k - 221 with respect to k. 8 Suppose -2a + 5a = 6. Let b be (a + 1)/3 - -18. What is the second derivative of 3f2 + 19 - 5f - b wrt f? 6 Let p = -7 + 13. Suppose -h + 4h = 0. Find the third derivative of 0b*6 + hb*2 - 2b*2 - 4b*p wrt b. -480b*3 Let k = 25 + -23. Let f be 22/6 + 2/(-3). Find the second derivative of 4c*2 - 4c*k + 5c - c*f - 4c wrt c. -6c Differentiate -p3 - 54 + 7p*3 + 22 wrt p. 18p*2 What is the second derivative of -69g*3 + 5g + 0g - 11g - 9g wrt g? -414g Let w be (-6 + 44)2/4. Let q = -17 + w. What is the third derivative of 3p*q - 4p*4 + 0p*4 - 7p*4 wrt p? -264p Find the second derivative of -66z2 + 35z*2 + 31z*2 - 64z - 26z4 - 3z*3 wrt z. -312z*2 - 18z Let z(h) = 42h2 - 6h + 9. Let y be z(3). Let q = 18 + -13. What is the second derivative of -yf4 + 369f4 - fq - 6f wrt f? -20f*3 Let w(v) be the first derivative of 0v + 16/3v3 - 7 + 0v*2 - 3v*4. What is the third derivative of w(u) wrt u? -72 Let j(k) = 143k*2 + 131. Let t(h) = 143h*2 + 132. Let i(r) = -3j(r) + 4t(r). What is the derivative of i(b) wrt b? 286b Let t(w) be the third derivative of 0w + 0 - 16/3w*3 - 7/15w*5 + 0w*4 - 28w*2. Differentiate t(u) with respect to u. -56u Suppose -51 = -5c + 2c. Suppose 2p - 11 = -3s, -s = 4p - 0s - c. Find the second derivative of -9wp - 62 + 62 + 5w wrt w. -108w2 Let t be -2 - (1/1 - 9). Let y be (-4 - -7)14/t. Differentiate 8 + ya3 + 2a*2 - 2a*3 - 2a*2 with respect to a. 15a*2 What is the second derivative of 16197 + 64k + 7k - 15k - 16200 - 231k2 wrt k? -462 Let i(x) = x4 + 2. Let c(z) = 12z4 - z3 - 70z2 + 2z - 6. Let k(h) = -c(h) - 3i(h). What is the third derivative of k(o) wrt o? -360o + 6 Let p(n) be the second derivative of n4/12 + n3 - 5n2 - 5n. Let k be p(-8). What is the first derivative of -1 + k + 9l - 7l wrt l? 2 Let p(h) be the third derivative of -119h6/60 + h4/12 - h3/2 + 36h*2. Find the second derivative of p(q) wrt q. -1428q Let j = -169 + 173. Let w(d) be the first derivative of 1/2d2 + d3 + 0d + j. What is the second derivative of w(o) wrt o? 6 Let w(p) be the first derivative of -11p7/105 - p5/4 - 4p*2 + 24. Let i(r) be the second derivative of w(r). Find the third derivative of i(c) wrt c. -528c Let x(z) be the third derivative of 31/60z5 + 34z*2 + 0 + 3/20z*6 + 0z*4 + 0z*3 + 0z. Find the third derivative of x(v) wrt v. 108 Suppose -20 = -q + 6. Find the first derivative of 56 + 29 + qu4 + u - 68 wrt u. 104u*3 + 1 Let z(k) be the first derivative of 3k*8/112 - 7k*4/12 + 21k*2 - 13. Let y(g) be the second derivative of z(g). Find the second derivative of y(t) wrt t. 180t*3 Differentiate -215 + f + 186 - f + 18f*2 - 394 + f wrt f. 36f + 1 Let k(d) = -3552d + 1860. Let b(u) = -273u + 143. Let z(t) = -27b(t) + 2k(t). What is the first derivative of z(i) wrt i? 267 Let b be 4/(-8 - 12)20/(-6). Let o(c) be the second derivative of 3c + 0c2 + 0 - bc*4 - 1/6c*3. Find the second derivative of o(x) wrt x. -16 Let k be 8/(-36) + (-2332)/36. Let d = k - -305. Find the third derivative of 237w2 - w5 - 4w5 + 6w*5 - dw*2 wrt w. 60w*2 Let p(d) = -2d4 + d3 + 2d - 1. Let i(g) = -3g*4 + 18g*3 + 40g - 1. Let y(o) = -i(o) + p(o). Find the second derivative of y(k) wrt k. 12k2 - 102k Let b(s) = -2s3 - s2 - 4s. Let d(p) = p + 0p - 3p + 3p. Let f(q) = b(q) + 4d(q). Find the third derivative of f(l) wrt l. -12 Let a be 4/14 + (-6)/21. Suppose -6 + a = 2q - 5p, 0 = -q + 4p - 6. What is the second derivative of -12f - f*2 + 9f - qf2 wrt f? -6 Let g(u) be the third derivative of -287u*6/120 - 139u*3/3 + 149u*2. Differentiate g(h) with respect to h. -861h2 Let d(a) be the second derivative of a3/2 - 3a2 - 7a. Let v be d(5). What is the third derivative of 4s2 - 9s*3 + vs*3 - 2s*2 - 2s*6 wrt s? -240s*3 Let x(m) be the first derivative of 59m*6/6 - 7m*2 - 60. Find the second derivative of x(q) wrt q. 1180q*3 What is the third derivative of 95r*2 - 408r*3 + 0 + 553r3 + 0 wrt r? 870 What is the second derivative of n4 - 16n - 103n*2 - 3 - 101n - 71n + 5 wrt n? 12n2 - 206 Let g(p) be the first derivative of p7/280 + 19p6/360 - 17p3/3 - 5. Let i(w) be the third derivative of g(w). Find the third derivative of i(x) wrt x. 18 Let c(z) be the first derivative of -z3 + 155z + 90. Find the first derivative of c(l) wrt l. -6l Let l(a) be the third derivative of -19a5/60 - 7a*4/24 + 307a*3/6 + 67a*2 - 2. Find the first derivative of l(h) wrt h. -38h - 7 What is the second derivative of 2y2 - 4y*2 - 13 + 15 + 28y - 12y4 wrt y? -144y*2 - 4 Let q = 43 - 33. Find the second derivative of -qm*3 - 13m + 2m3 + 2m*3 wrt m. -36m Differentiate -263b4 - 123b*4 + 328 + 99b*4 with respect to b. -1148b*3 Let f(o) be the third derivative of -5o*9/504 - 3o*6/40 - 221o*5/30 + 302o*2. What is the third derivative of f(s) wrt s? -600s3 - 54 Let d(s) be the second derivative of -s6/30 + 31s4/2 + 101s3/2 - s2 - s + 39. Find the second deri	{ "pile_set_name": "DM Mathematics" }
4) 10 -7 + (-182)/65-5 7 Calculate (-17)/(816/208) - -4. -1/3 What is the value of (-1 - -3)/(-48 - 12/(-6))? -1/23 What is ((-38)/(-190))/(6 + 1510/(-250))? -5 7 - ((-1)/(-3))/(8/184) -2/3 What is the value of (22/(-12))/(27/162)? -11 Calculate ((-340)/(-120) - (-2)/3)260/(-35). -26 Evaluate ((-140)/(-2450))/(1/(-5)). -2/7 Evaluate 9/(-12)6744/(-1405). 18/5 Evaluate (819/126)/((-4)/(-8)). 13 What is the value of (65/(-52))/5 - (-627)/(-108) - -6? -1/18 (-5)/(-3)(-8310)/(-463975) 2/67 What is ((-424)/78)/(2222/(-66) + 33) + -8? 2/13 What is 43/(172/8) - (-60)/9-3? -18 What is (38/(-14) - -1)(76/19)/(-4)? 12/7 (-4)/(-18)(-4266)/(-40290) 2/85 What is the value of 26/(-39)1(2 + 333/(-18))? 11 Calculate (9/(-18))/((-245)/(-210)). -3/7 What is the value of (9 + -9 + (-4 - -3))/(78/26)? -1/3 Evaluate 14/35 - (-152)/20 - 4. 4 What is (-6)/(-8)12/(-42)? -3/14 What is the value of (-5)/(-2)324/(-405) - -8? 6 Evaluate 1/2(-580)/1595. -2/11 Calculate ((39/9)/(1/(-6)))/(-2). 13 Calculate (4/62 - 3919/682) + (-4)/(-22). -11/2 16 - 1296/42 - -15 1/7 Calculate ((-114480)/7224)/18 - 12/(-14). -1/43 What is the value of 3/(-12) + (-177)/(-20) + (1 - 7)? 13/5 What is -21 - (-39 - (2 + -15))? 5 (104/(-585))/((400/90)/(-20)) 4/5 1/20 + (-145464)/(-9120) 16 Evaluate (-17)/(1700/(-1525)) + 10/(-8). 14 Calculate -17 - 45/(-3) - 7. -9 (9447/134 + -61)8/19 4 Evaluate 0 + 19 + 55 + -56. 18 What is the value of -1 + 8 + 27/(-108)-28? 14 Calculate -20 + (3832/120 - 12). -1/15 What is (-924)/(-63) + ((-2)/(-6))/(-13 + 14)? 15 Calculate 664/(-249) - 60/(-9). 4 22272/(-1056) - (2 - 7) - -16 -1/11 (8/(-26))/(68/(-255)-1-15) 1/13 Calculate -2108/(-24) - 7/((-42)/78). 22 Calculate 0 + -1225/15. -20 What is the value of ((2829/(-115))/41)/(54/20)? -2/9 What is (15/3 - 35)(-5)/((-350)/4)? -12/7 Evaluate -1333/715(-21)/12. 1/10 Evaluate (5/514/(-308))/(1/4). -2/11 What is 418/(-60) - (-4)/(-20) - (-2)/12? -7 Calculate ((-45)/60 + (-78)/(-40))/(80/(-200)). -3 What is the value of 412 - 406 - 58/10? 1/5 Calculate (43/1290)/((5/(-2))/((-25)/12)). 1/36 What is the value of ((-42)/(-72)6/42)/((-6)/45)? -5/8 Calculate (((-644)/(-6))/7)/((-204)/(-306)). 23 Calculate ((65 - 2)/7)/(-2 - 200/(-88)). 33 What is the value of 0 + (-2 - 39/(-5)) - (-147 + 152)? 4/5 (1365/350 - 4) + (-422)/(-20) 21 Calculate (-81)/(-54)40/(-6). -10 Calculate (-402)/1206 - (-2)/(-3). -1 What is 162/(-36)(-56)/336? 3/4 What is (4 - 6)/(9/(-6)200/12)? 2/25 15 - 800439/(-17821)2/(-6) 2/71 What is the value of (-22)/154 + (-427)/(-1323)-3? -10/9 Evaluate 979/(-308) - -1 - (8 - (-315)/(-36)). -10/7 Calculate (30/12)/((-1080)/96). -2/9 (-1 - -19)1/(19 - 20) -18 Evaluate ((-1)/1)/((-3)/21853/(-327)). -2/17 What is the value of (-1)/(-2)-2-3? 3 Evaluate -25 - -1090/36. 0 What is (5 - 3212/660) + (-2)/6? -1/5 Evaluate (46 - 6) + (-2509)/193. 27 What is the value of 15/(-1150)(-1240)/186? 2/23 Calculate 36 - 5 - -3(-20)/6. 21 Evaluate (507/180)/(-13) + (4921/370 - 13). 1/12 6/(-14)(-259)/1665 1/15 (14/(-42)(-36)/24)/(-19) -1/38 What is the value of -10 + -6011/(-44)? 5 ((-34)/51)/((-4)/276)(-20)/(-40) 23 Evaluate 1 + (-247)/(-152)(0 + 8). 14 -6(9 + -4)/(-135) 2/9 What is the value of (4/10(-10)/(-16))/((-2)/(-4))? 1/2 What is (-192 - -198) + 726/(-30)? -1/15 Evaluate 8680/(-360) + (-2)/(-18). -24 Calculate (-90)/(-434) + 0 + (-50)/1680048. 2/31 What is -4 - (-5)/(45/36)? 0 Calculate ((14/(-20))/74)/((-1122)/255). 1/11 What is (24/99)/((-1)/(-30)20)? 4/11 Calculate ((-836)/77 + 1 + 10)(1 - -6). 1 What is (1509/9557)/(3/(-2))? -2/19 (3/8)/((-6)/(-48))(-118)/531 -2/3 (3/(-12)-3)/68 1 What is ((-4002)/116)/((-6)/(-4))? -23 -2 - (-2 + 1)55/702 -3/7 What is the value of 162/(9 + -15) - (20 + -33)? -14 What is the value of (48(-195)/(-312))/(-1)? -30 84/(-22) - -12 - (-2)/(-11) 8 What is the value of 11/((-484)/(-8)) + (-26176)/704? -37 What is the value of (-1410)/(-4785) - 16/(-232)? 4/11 Calculate 1 + -12 + (-118 - -133). 4 Evaluate ((-2)/168)/((-6)/(-28)40/(-30)). 1/24 Calculate (-35)/(-21) - (7 + 112/24). -10 Evaluate (7 - -7)(9 + (-138)/42 - 4). 24 Calculate (4/(-10))/((-6)/(-10)). -2/3 What is (1 + -10 - 1)369/738? -5 What is 6 - ((-12)/(1080/195))/(2/(-4))? 5/3 (42/21)/((-6)/24) -8 ((-26)/10 + 3)/(348/(-60)) -2/29 ((31 - 10)/(-21))/((-1)/(-7)) -7 Calculate (-4 - 7) + 11 + -8 - 1. -9 -9 - -11(-7)/((-105)/10) -5/3 9/(-15)((-64)/(-8) + -13) 3 What is the value of (-486)/36((-28)/(-21) - (1 + 1))? 9 What is the value of (-36)/15 + 2 - (-33803)/2195? 15 Calculate (-20)/175 - (-3)/(-5) - (-38)/(-133). -1 Calculate (1 - 255/285)-1. -2/19 Calculate ((-4)/6 - -1)/(((-1474)/264)/67). -4 Evaluate ((-15)/40)/((-1)/6 - (-638)/264). -1/6 (72/42)/(((-6)/(-16))/((-49)/(-28))) 8 What is the value of 119/(-1547) - 76/26 - 1-10? 7 Calculate (-83 - -99) + 6 + 440/(-8). -33 What is the value of 12/16 + (-16 - (-5343)/364)? -4/7 Evaluate ((-75)/(-2250)-12)/(2/(-165)). 33 What is -32/(-48)(-1536)/3648? -1/19 What is the value of (-12)/(-15)123/48? 3/5 Calculate (-351)/(-702)(-3)/12. -1/8 What is (-192)/60(4 - 122/16)? -8 Calculate (3-3 - -3)(-76 + 75). 6 (14/60 - 19/57)14 -7/5 What is the value of (-80)/(-100)1(66/(-12))/11? -2/5 What is the value of (-2)/((-5 - -1) + 10 + -8)31? 31 What is (2 + -5)(12/(-30) + 1)? -9/5 -36 + (-22)/(2992/(-4879)) -1/8 Evaluate 4/(-6) - (-5)/(-15). -1 What is 13135/351 - 75/9? -10/3 270/(-42)1596/(-570) 18 Calculate (-1496)/((-18768)/138) + (-1 - (-89)/(-9)). 1/9 Evaluate (-260)/156(-4 - 28/5). 16 Evaluate (-5)/(-4) + 32 + 3621/(-68). -20 Evaluate 4328/(-120) - (-13)/195. -36 Evaluate ((-1)/4)/((-3)/(-16)) - (-764)/2292. -1 Evaluate 100/15(-13)/(-1820). 1/21 -5 - (-9 - (1140/(-58))/5) 2/29 Calculate (-258)/(-24) - -3 - (-170)/136. 15 Evaluate ((-65)/26)/((-4)/(-30)-25). 3/4 What is (1506/5271)/((-12)/(-14))? 1/3 What is (-20 + (-507)/(-26))/(1/26)? -13 81/12 - (-39)/156 7 What is ((-329)/141)/(4/18 - 11/198)? -14 Calculate 19/(-38)218/4 - (-12)/48. -27 Calculate (-1008)/(-864) + (-11)/6. -2/3 What is the value of (-18)/(-8)((-17388)/(-891) + -20)? -12/11 Calculate (-2)/(-406)29-35. -5 Evaluate 44 + (-1404)/36 - (0 + -12). 7 What is 23 - (-60)/(-52)13? 8 What is (-2215/420 + (-4)/(-14))4? -2 Calculate -5 - (624/(-130) + 3/(-6)). 3/10 Evaluate (-2365)/602 + 6/14. -7/2 What is (35/(-138) - 502/(-5773))4/5? -2/15 What is the value of (71/(-3) + -3)/((-2086)/(-3129))? -40 What is the value of 9 + 4 + 1 + 5320/(-378)? -2/27 What is the value of (-1380)/5060(-5 - -3)? 6/11 Evaluate 224/2607 - ((-78080)/1056 + 74). 2/79 Evaluate ((-17622)/90)/11 + 2/(-10) + 5. -13 What is the value of (99/(-42))/((-33)/(-110)) - -10? 15/7 What is (44/(-10) + (-153)/(-45) + -3)1? -4 Calculate 36/(-21) + ((-552)/12)/(-23). 2/7 Evaluate (-4)/(-6)(-5 + 8). 2 Calculate -118 + -10((-88)/55 + 1). -12 What is the value of (6 + 1)9/(378/96)? 16 Calculate (8/(-3) - 2) + 276/414. -4 What is (10 - (11 + -4))(-6)/(-15)? 6/5 What is (-90)/105((-85)/102)/((-15)/9)? -3/7 Evaluate (-14)/(-6)(13504/448 - 25). 12 What is -2 - 61/(24339/(-840))? 2/19 Evaluate 2792/(-349) + (-180)/(-22). 2/11 Calculate -60 + 16 - -53 - (0 - -29). -20 What is the value of (-12)/(-4) + -3 - (9 + 555/(-60))? 1/4 What is the value of 0 - -8 - (-533856)/(-66464)? -1/31 Calculate -24 - -7 - 8/(-2). -13 What is the value of ((-3)/(27/(-24)))/((-114)/513)? -12 What is the value of 536/(-54) - (-21)/1701-6? -10 Calculate 16/(-24) + (-1696)/(-24)(-2)/(-8). 17 What is (-10)/(-25) - 18/((-9720)/2844)? 17/3 What is the value of (2/4)/((170/(-15))/(28/21))? -1/17 (87/116)/(66/(-4)) -1/22 What is 1/(-3) + ((-665)/14 - -1)/(-18)? 9/4 Evaluate (12/402)/((-87906)/(-5980)). 2/49 What is ((-10)/((-8)/(-4)) - -2) + (-1 - -9)? 5 What is (-40)/(-6) + (-17 - 52/(-3))? 7 Calculate (-6 - -4)8/(-104). 2/13 9/((-243)/(-150)) + (-8)/2412 14/9 Evaluate (285/(-114))/(2/(-8)). 10 What is the value of (-10)/(-30)(-2 + 4)? 2/3 Evaluate (22/(-6468)-70)/(15/(-54)). -6/7 What is 2 + (17 + -12)/(-3 - 1-8)? 3 What is 14 + (5 - 16) + -20 + 32/8? -13 Calculate 79/(-1659) + (4 - 797/21). -34 What is (-562356)/(-16764) + 9/(-66)4? 33 Calculate (-28)/(-63)((-188)/(-8) - 10). 6 (-4 + 7)*3 - (2 - 18) 25 Wh	{ "pile_set_name": "DM Mathematics" }
igit of 16902? 2 What is the units digit of 3229? 9 What is the tens digit of 978? 7 What is the units digit of 21739? 9 What is the hundreds digit of 75154? 1 What is the units digit of 5552? 2 What is the ten thousands digit of 38700? 3 What is the hundreds digit of 79724? 7 What is the ten thousands digit of 23397? 2 What is the tens digit of 25? 2 What is the units digit of 5132? 2 What is the units digit of 45302? 2 What is the units digit of 152996? 6 What is the hundreds digit of 4533? 5 What is the tens digit of 1539? 3 What is the thousands digit of 3221? 3 What is the thousands digit of 22212? 2 What is the units digit of 1379? 9 What is the tens digit of 4643? 4 What is the hundreds digit of 2020? 0 What is the tens digit of 20461? 6 What is the hundreds digit of 5874? 8 What is the units digit of 45605? 5 What is the ten thousands digit of 24043? 2 What is the hundreds digit of 439? 4 What is the tens digit of 1959? 5 What is the hundreds digit of 16218? 2 What is the hundreds digit of 433? 4 What is the ten thousands digit of 60364? 6 What is the tens digit of 8933? 3 What is the ten thousands digit of 27855? 2 What is the thousands digit of 1022? 1 What is the thousands digit of 1437? 1 What is the units digit of 2603? 3 What is the units digit of 84586? 6 What is the thousands digit of 4084? 4 What is the units digit of 23759? 9 What is the hundreds digit of 1930? 9 What is the units digit of 613? 3 What is the hundreds digit of 112465? 4 What is the tens digit of 269? 6 What is the ten thousands digit of 59496? 5 What is the units digit of 46151? 1 What is the hundreds digit of 32447? 4 What is the ten thousands digit of 73125? 7 What is the thousands digit of 1805? 1 What is the hundreds digit of 20351? 3 What is the thousands digit of 12864? 2 What is the units digit of 63713? 3 What is the ten thousands digit of 27376? 2 What is the thousands digit of 2796? 2 What is the hundreds digit of 58624? 6 What is the tens digit of 3665? 6 What is the tens digit of 1283? 8 What is the hundreds digit of 1515? 5 What is the thousands digit of 31847? 1 What is the units digit of 235? 5 What is the units digit of 10457? 7 What is the tens digit of 21102? 0 What is the units digit of 302? 2 What is the thousands digit of 1591? 1 What is the thousands digit of 1886? 1 What is the tens digit of 11639? 3 What is the tens digit of 69635? 3 What is the ten thousands digit of 41186? 4 What is the tens digit of 1389? 8 What is the ten thousands digit of 19382? 1 What is the units digit of 121? 1 What is the units digit of 36243? 3 What is the hundreds digit of 639? 6 What is the units digit of 1388? 8 What is the tens digit of 2009? 0 What is the tens digit of 5841? 4 What is the thousands digit of 3796? 3 What is the hundreds digit of 34544? 5 What is the units digit of 19613? 3 What is the thousands digit of 1368? 1 What is the hundreds digit of 12150? 1 What is the thousands digit of 3118? 3 What is the thousands digit of 20334? 0 What is the hundreds digit of 65221? 2 What is the units digit of 152858? 8 What is the hundreds digit of 2047? 0 What is the tens digit of 23809? 0 What is the hundreds digit of 1552? 5 What is the units digit of 63149? 9 What is the hundreds digit of 1476? 4 What is the hundreds digit of 1338? 3 What is the hundreds digit of 92279? 2 What is the thousands digit of 1512? 1 What is the units digit of 814? 4 What is the units digit of 44806? 6 What is the hundreds digit of 683? 6 What is the hundreds digit of 36461? 4 What is the units digit of 524? 4 What is the thousands digit of 4103? 4 What is the thousands digit of 8723? 8 What is the ten thousands digit of 63244? 6 What is the tens digit of 487? 8 What is the hundreds digit of 521? 5 What is the hundreds digit of 378? 3 What is the units digit of 16210? 0 What is the units digit of 898? 8 What is the tens digit of 649? 4 What is the hundreds digit of 7673? 6 What is the tens digit of 3097? 9 What is the tens digit of 18533? 3 What is the thousands digit of 29678? 9 What is the units digit of 993? 3 What is the ten thousands digit of 16229? 1 What is the units digit of 764? 4 What is the hundreds digit of 1517? 5 What is the ten thousands digit of 19145? 1 What is the units digit of 5732? 2 What is the tens digit of 1106? 0 What is the tens digit of 6009? 0 What is the units digit of 59038? 8 What is the hundreds digit of 7054? 0 What is the thousands digit of 1075? 1 What is the tens digit of 749? 4 What is the tens digit of 739? 3 What is the thousands digit of 12649? 2 What is the units digit of 6701? 1 What is the thousands digit of 1303? 1 What is the units digit of 192145? 5 What is the hundreds digit of 9453? 4 What is the tens digit of 6553? 5 What is the tens digit of 26169? 6 What is the ten thousands digit of 102276? 0 What is the units digit of 169? 9 What is the thousands digit of 2662? 2 What is the thousands digit of 9690? 9 What is the units digit of 8475? 5 What is the thousands digit of 2599? 2 What is the hundreds digit of 6462? 4 What is the hundreds digit of 27959? 9 What is the tens digit of 8414? 1 What is the tens digit of 7449? 4 What is the units digit of 56358? 8 What is the tens digit of 3978? 7 What is the thousands digit of 9004? 9 What is the units digit of 6481? 1 What is the units digit of 51995? 5 What is the tens digit of 87818? 1 What is the tens digit of 40530? 3 What is the hundreds digit of 548? 5 What is the thousands digit of 59098? 9 What is the ten thousands digit of 24627? 2 What is the units digit of 11355? 5 What is the units digit of 1241? 1 What is the tens digit of 361? 6 What is the hundreds digit of 12847? 8 What is the hundreds digit of 5491? 4 What is the tens digit of 248? 4 What is the units digit of 15786? 6 What is the hundreds digit of 806? 8 What is the hundreds digit of 3447? 4 What is the tens digit of 7817? 1 What is the hundreds digit of 1102? 1 What is the units digit of 12179? 9 What is the hundreds digit of 971? 9 What is the thousands digit of 2869? 2 What is the ten thousands digit of 22478? 2 What is the tens digit of 56575? 7 What is the ten thousands digit of 20716? 2 What is the hundred thousands digit of 112779? 1 What is the thousands digit of 27367? 7 What is the hundreds digit of 36150? 1 What is the thousands digit of 1522? 1 What is the thousands digit of 3214? 3 What is the tens digit of 1593? 9 What is the tens digit of 1912? 1 What is the tens digit of 9279? 7 What is the thousands digit of 61723? 1 What is the tens digit of 6071? 7 What is the units digit of 1369? 9 What is the hundreds digit of 6527? 5 What is the tens digit of 2339? 3 What is the tens digit of 1137? 3 What is the units digit of 76902? 2 What is the units digit of 68546? 6 What is the ten thousands digit of 17466? 1 What is the hundreds digit of 31036? 0 What is the tens digit of 11352? 5 What is the thousands digit of 4194? 4 What is the units digit of 5228? 8 What is the hundreds digit of 778? 7 What is the units digit of 347? 7 What is the ten thousands digit of 13057? 1 What is the hundreds digit of 5400? 4 What is the thousands digit of 91779? 1 What is the hundreds digit of 307? 3 What is the hundreds digit of 614? 6 What is the thousands digit of 3482? 3 What is the ten thousands digit of 49018? 4 What is the thousands digit of 1194? 1 What is the units digit of 82077? 7 What is the tens digit of 20584? 8 What is the thousands digit of 9407? 9 What is the tens digit of 11492? 9 What is the tens digit of 1272? 7 What is the thousands digit of 63094? 3 What is the thousands digit of 2719? 2 What is the tens digit of 791? 9 What is the ten thousands digit of 84475? 8 What is the units digit of 1633? 3 What is the hundreds digit of 155? 1 What is the hundreds digit of 410? 4 What is the thousands digit of 6762? 6 What is the tens digit of 73342? 4 What is the tens digit of 47? 4 What is the hundreds digit of 276? 2 What is the tens digit of 4555? 5 What is the units digit of 4459? 9 What is the tens digit of 7316? 1 What is the tens digit of 6461? 6 What is the units digit of 686? 6 What is the units digit of 878? 8 What is the tens digit of 48? 4 What is the units digit of 4744? 4 What is the thousands di	{ "pile_set_name": "DM Mathematics" }
positive. d(-5/2) Simplify ((l/l(-4/5))/l)/((ll(1/2)/ll)/l)((l/((l(-2/17)/l)/l))/l)/((ll(-6)/l)/l) assuming l is positive. l(1601/170) Simplify (i(-1/3)/i)(-11)(i/(i/(i(ii(-2/13))/i)))/(ii(-5)/i) assuming i is positive. i(800/39) Simplify z*(-18)zzz*(-2/13)z assuming z is positive. z*(-197/13) Simplify ((ff*(3/10)ff)/fff(-4/5))(2/3) assuming f is positive. f(5/3) Simplify u(1/10)u(1/12) assuming u is positive. u(11/60) Simplify q*43q/(qq/q(8/3)q)q assuming q is positive. q(134/3) Simplify (ll*(-17))/(l(l*(-5/6)ll)/l) assuming l is positive. l(-103/6) Simplify (r(-8/7)r)/((r*(-1/3)/rr)/rr)((r*7r)/r)/((r/(r/r(2/13)))/r) assuming r is positive. r(2194/273) Simplify (z(zz*(-3/2)/z)/zz)/(z/z*(-2))(z2)21 assuming z is positive. z(77/2) Simplify ((b(-1)/b)/b*(2/23))/(bb(2/3))(-20) assuming b is positive. b*(2156/69) Simplify ((bb/b(-4/5))/(b/(b(2/5)b)))/(b0/b)(-32/5) assuming b is positive. b(-16/5) Simplify (n(2/21))4 assuming n is positive. n(8/21) Simplify (o(-1/4))(-47)(oo/((oo*(-5)/o)/o)oo)/((oo*(-6)o)/o) assuming o is positive. o(107/4) Simplify u(8/3)/u*(3/5)(uuu*(2/9))/uu*(-4)uu assuming u is positive. u(58/45) Simplify ((tt*(-14))/(tt(1/10)))(-3/23) assuming t is positive. t(423/230) Simplify (r(-26))(1/7) assuming r is positive. r(-26/7) Simplify (b(2/23))(2/17) assuming b is positive. b(4/391) Simplify (x(-1)/x*6)/(x/((xx(-1))/x))33 assuming x is positive. x(-73) Simplify (((x/x(-2/3))/x)42)(2/7) assuming x is positive. x8 Simplify ((z(-2))(6/17))(-1/22) assuming z is positive. z*(6/187) Simplify (i(iiii/(i/(i(ii(2/5)ii)/i)))/ii*0/i)/((iii(-2/13)/i)/(ii/(ii(-4))ii)) assuming i is positive. i(751/65) Simplify ((xx*0)/(x/(xxx/x(-1/8))))/(x(-2)/xxx(-3)/x) assuming x is positive. x(73/8) Simplify h(-7)(hh/(hhh/((hh(h/(h(-18)/h))/h)/h)h))/h assuming h is positive. h*10 Simplify dd/(d*(-6)d)dddd*(3/5)/dd*(-1/4)d/d*4d assuming d is positive. d*(147/20) Simplify ((aa(2/5))/a)(-11)/(a(-2/7))(-20) assuming a is positive. a*(-354/35) Simplify qq*(-7)q*(-10)q*(5/2)q/q*(-4)q assuming q is positive. q(-15/2) Simplify (m(1/4))*(-2/11)/((m/(m/(m/(mmmm(m/(mm*(-1/3)m))/mm)))mm)/m(-2/3)) assuming m is positive. m(-25/66) Simplify dd*6d*(1/3)(d2)45 assuming d is positive. d*(292/3) Simplify (zzz20zzz)49 assuming z is positive. z1225 Simplify (j(-2/9))(-2/5)(j(5/6)j)/jj(-1/18) assuming j is positive. j(13/15) Simplify (q/(q((q/(q(qq*(-2))/q))/q)/qq))(-1/2)/((q(-9)/q)/(q/(q/q8))) assuming q is positive. q(37/2) Simplify (t*(-6)t)/(t/((t*9t)/t))t(2/11)/(t/(ttt/(t((t/((tt7t)/t))/t)/t)t)) assuming t is positive. t(156/11) Simplify h(-2/15)hh/(h/(((h/h(-6/13))/h)/hhh))h assuming h is positive. h(649/195) Simplify (b(8/3)/(b(-5)/b))(-1/2) assuming b is positive. b(-13/3) Simplify h/h(-24)h(-6/13) assuming h is positive. h(319/13) Simplify ((d(2/5)/d)/dd/d*2d)/((((d/d*(2/3))/d)/ddd)/(d1/d)) assuming d is positive. d(-29/15) Simplify (q/(q(-8)q)qq(-1/2))/((q/(q/q(-7)))/qq/((q/q6q)/q)qq) assuming q is positive. q(17/2) Simplify (i2i)(21/5) assuming i is positive. i(63/5) Simplify (t(1/9)/tttt/(tttt(9/5))t)12 assuming t is positive. t(-304/15) Simplify (v*(1/4)/v)/(vvv(-16)v) assuming v is positive. v*(49/4) Simplify ((d/((dd*(-1))/dd))/(d5/d))(-28) assuming d is positive. d*84 Simplify (z(z/(z/z(-14)))/z)/(z/((z/z6)/z)) assuming z is positive. z(-21) Simplify ((((q/(q/((q(1/3)/q)/q)))/q)/q)/q)*(3/8)/(qq(-1/2))(3/8) assuming q is positive. q*(-31/16) Simplify ((ll/((ll(-6/5))/ll))/ll)/l(-28) assuming l is positive. l(151/5) Simplify (d/(d/(d/d10)d))(4/19) assuming d is positive. d(-40/19) Simplify c*(-1)c*(-1/7)/cc/(cc(2/25))c(-4) assuming c is positive. c(-1089/175) Simplify ((((v/(v*(-8)/v))/v)/v)/vv/v*(-2/5))/(vv(-2/5))(-2/19) assuming v is positive. v*(804/95) Simplify (j(j/(jj/(j/(j/(jjj/(j/(jjjjjj*(-2)j)))))j))/j)(-37)j/j*8j/(j(j/j6)/jjjj)j assuming j is positive. j(-151) Simplify (r(-4/7)/r)/(rr(-19)) assuming r is positive. r(115/7) Simplify ((j/(((j/j*15)/j)/j))/j)/jj*6j assuming j is positive. j*22 Simplify ((pp(2/7))/p(-9/7))(-2/27) assuming p is positive. p(-4/21) Simplify ((b*(-10)/b)/(bb11))(32/3) assuming b is positive. b(-736/3) Simplify (d/(d/d(-1/4)))(-6/29)/(d/(d(-1/4)d))26 assuming d is positive. d(-187/29) Simplify (u4)(2/3) assuming u is positive. u(8/3) Simplify (b/(b(bb(-1)/b)/b)bb(-3))(5/8) assuming b is positive. 1 Simplify x(4/11)xx(-10)x(x/x0)(-3) assuming x is positive. x(-117/11) Simplify b/(b/(b((((bb40bb)/b)/bb)/b)/bb))b(-25) assuming b is positive. b17 Simplify (o(-6))(2/5) assuming o is positive. o(-12/5) Simplify x(-1/6)xx*(-4/5)x(xx(-1/5))/(x6x) assuming x is positive. x(-31/6) Simplify (m(-1/4))23/((mm(-2/7))/(m/m5)) assuming m is positive. m(-293/28) Simplify h2/h(-6/7) assuming h is positive. h(20/7) Simplify d(5/8)/d(-2/17) assuming d is positive. d(101/136) Simplify h/h(25/3)(hh/(hh(-1/17))h)/h assuming h is positive. h*(-320/51) Simplify ii*(-3/5)i(-3) assuming i is positive. i(-13/5) Simplify (jj/(jj7))(6/11) assuming j is positive. j(-36/11) Simplify (p/(((p5p)/p)/p)p*(3/8)p)36 assuming p is positive. p(-117/2) Simplify (o/(o(o(1/18)o)/o)o)/((oo*(13/2))/oo) assuming o is positive. o(-59/9) Simplify (a(5/3))(-1/52) assuming a is positive. a(-5/156) Simplify (a*(-2/5)a(-1/10))(-4/15) assuming a is positive. a(2/15) Simplify (a(-3)/a)(-35) assuming a is positive. a140 Simplify oo(-4/5)/oo(6/11) assuming o is positive. o(-14/55) Simplify (x(-1/4))(-26)x/((xx*(2/7)x)/x)x(-2/7) assuming x is positive. x(83/14) Simplify (u(3/10)/(uu(1/24)))(-2/19) assuming u is positive. u(89/1140) Simplify ((b/((b/(b/b(-5)))/b))/b(-2/3))(21/2) assuming b is positive. b(161/2) Simplify (c(-5/9))33 assuming c is positive. c(-55/3) Simplify z*(-2)z(1/3)/z assuming z is positive. z(-8/3) Simplify v/(((v(v/v(-11)vv)/vv)/v)/vv)v/v(-1/9) assuming v is positive. v(-107/9) Simplify (((r/r*13)/r)/r)/rrr(14/3)r assuming r is positive. r(-25/3) Simplify (z(-2/9))*(-5/2)(z(1/4))(2/17) assuming z is positive. z(179/306) Simplify w(-27)ww16 assuming w is positive. w(-10) Simplify ll4l*(-4)l7/((l(-4)l)/l) assuming l is positive. l12 Simplify (k/(kk*4)k2)(3/11) assuming k is positive. k(-6/11) Simplify ((n(2/13)n)/n)41 assuming n is positive. n(82/13) Simplify d/(dd*(-4))d(-15) assuming d is positive. d(-11) Simplify ((zz8/z)(-2/15))(-10) assuming z is positive. z(32/3) Simplify ((k(kk/(kk/k*7))/kk)/(k/k(1/5)))/((k/k(-1/5)k)/(k/(kk*(-8/7)k))) assuming k is positive. k(36/7) Simplify (l33/l)/l(-12) assuming l is positive. l44 Simplify r*18/rrr(1/4) assuming r is positive. r(73/4) Simplify (ccc(7/3))(-35) assuming c is positive. c(-455/3) Simplify (q15q)/(q/(q/(q*(-2/21)/qq))) assuming q is positive. q*(338/21) Simplify (((nnn1/n)/n)/n)(2/13)/(n/n(-2)n/n(-4/5)) assuming n is positive. n(-24/5) Simplify ((h(-1/4))(7/8))(-17) assuming h is positive. h(119/32) Simplify (n/((n/n*2)/n)nn(-6)n)/(n/((nnn*(-10)/nn)/n)n(-1/7)/n) assuming n is positive. n(-69/7) Simplify (((hh/(hh(hh/h(-1/4))/h))/h)/hh(h(h(-4/5)/h)/h)/h)/((h/h8)/((hh(1/7)/h)/h)) assuming h is positive. h(153/140) Simplify (a0a)(-6)/(a(1/2)/aaa)(6/7) assuming a is positive. a(-51/7) Simplify a*(-17)aa43a assuming a is positive. a28 Simplify q(-2/23)qq(q(1/6)q)/q assuming q is positive. q*(287/138) Simplify (tt*(-1/8))/t(t*(1/4)t)/t as	{ "pile_set_name": "DM Mathematics" }
7, 193, 197551 What are the prime factors of 29818590? 2, 3, 5, 31, 32063 What are the prime factors of 1192143825? 3, 5, 43, 13691 List the prime factors of 114942648. 2, 3, 4789277 What are the prime factors of 676053769? 1867, 362107 What are the prime factors of 188281343? 193, 975551 List the prime factors of 71315465. 5, 13, 37, 2281 What are the prime factors of 4105910057? 17, 241524121 List the prime factors of 81516715. 5, 7, 23, 131, 773 List the prime factors of 104845560. 2, 3, 5, 89, 9817 What are the prime factors of 1196330650? 2, 5, 571, 41903 List the prime factors of 6057775077. 3, 113, 1579, 11317 List the prime factors of 87157575. 3, 5, 131, 2957 List the prime factors of 6186816046. 2, 23, 67, 2007403 List the prime factors of 2617176427. 29, 3061, 29483 List the prime factors of 6998362093. 19, 368334847 List the prime factors of 15127444. 2, 29, 130409 What are the prime factors of 1082899294? 2, 23, 79, 297991 What are the prime factors of 230907408? 2, 3, 41, 117331 List the prime factors of 10822939. 2069, 5231 What are the prime factors of 33328923? 3, 59, 188299 List the prime factors of 30838292. 2, 19, 405767 What are the prime factors of 199447680? 2, 3, 5, 73, 1423 What are the prime factors of 223926497? 107, 2092771 What are the prime factors of 342101027? 31, 11035517 What are the prime factors of 864948640? 2, 5, 443, 12203 List the prime factors of 317329459. 23, 71, 194323 List the prime factors of 1404816654. 2, 3, 761, 307669 What are the prime factors of 39969388? 2, 19, 525913 List the prime factors of 674609192. 2, 167, 504947 List the prime factors of 6806122848. 2, 3, 7, 19, 6581 What are the prime factors of 200170998? 2, 3, 1427, 7793 What are the prime factors of 2161721673? 3, 173, 719, 1931 What are the prime factors of 196446111? 3, 19, 101, 34123 What are the prime factors of 3086131909? 7, 440875987 What are the prime factors of 373823509? 373823509 List the prime factors of 1810464554. 2, 733, 1234969 What are the prime factors of 246962228? 2, 19, 137, 23719 List the prime factors of 5692387787. 21401, 265987 List the prime factors of 356370395. 5, 23, 3098873 List the prime factors of 1591424661. 3, 11467, 46261 List the prime factors of 34425868. 2, 1931, 4457 List the prime factors of 111569235. 3, 5, 19, 29, 13499 What are the prime factors of 24162265? 5, 151, 32003 What are the prime factors of 1636906543? 1636906543 List the prime factors of 559778271. 3, 13, 29, 71, 6971 List the prime factors of 51535330. 2, 5, 7, 11, 17, 31, 127 List the prime factors of 13990370. 2, 5, 1399037 What are the prime factors of 931140923? 19, 47, 163, 6397 What are the prime factors of 104858738? 2, 103, 509023 What are the prime factors of 162866186? 2, 7, 41, 47, 6037 List the prime factors of 330821300. 2, 5, 61, 193, 281 What are the prime factors of 4153805079? 3, 41, 33770773 List the prime factors of 96175974. 2, 3, 677, 23677 List the prime factors of 478329086. 2, 239164543 List the prime factors of 1164286285. 5, 12011, 19387 List the prime factors of 220005141. 3, 179, 409693 What are the prime factors of 272148946? 2, 59, 1031, 2237 What are the prime factors of 1439275856? 2, 101, 103, 8647 List the prime factors of 1850867017. 23, 43, 479, 3907 List the prime factors of 217969127. 47, 331, 14011 List the prime factors of 2158985697. 3, 11, 1777, 3347 List the prime factors of 2669638637. 2669638637 What are the prime factors of 1908508225? 5, 13, 83, 139, 509 What are the prime factors of 1064125449? 3, 29, 47, 223, 389 What are the prime factors of 666419761? 7, 257, 370439 What are the prime factors of 322633765? 5, 23, 2805511 List the prime factors of 198673106. 2, 107, 727, 1277 What are the prime factors of 2063636776? 2, 7459, 34583 List the prime factors of 1622346672. 2, 3, 33798889 What are the prime factors of 3551704694? 2, 19, 93465913 What are the prime factors of 105255983? 7, 47, 319927 What are the prime factors of 16949478? 2, 3, 7, 13, 37, 839 List the prime factors of 297851246. 2, 7, 11, 1934099 What are the prime factors of 290528096? 2, 17, 534059 What are the prime factors of 78537141? 3, 47, 199, 311 What are the prime factors of 147840393? 3, 61, 807871 List the prime factors of 1248946661. 16481, 75781 What are the prime factors of 114346795? 5, 937, 24407 What are the prime factors of 175847269? 13, 17, 53, 15013 List the prime factors of 90337687. 11, 8212517 What are the prime factors of 316267875? 3, 5, 7, 11, 1217 What are the prime factors of 638673310? 2, 5, 11, 5806121 List the prime factors of 66511074. 2, 3, 7, 467, 3391 What are the prime factors of 324678982? 2, 43, 97, 38921 List the prime factors of 58045258. 2, 41, 707869 What are the prime factors of 4527755163? 3, 17, 617, 47963 What are the prime factors of 79520994? 2, 3, 7, 71, 2963 What are the prime factors of 1117703190? 2, 3, 5, 37256773 What are the prime factors of 952314265? 5, 7, 31, 125387 What are the prime factors of 41658466? 2, 17, 439, 2791 List the prime factors of 1471799399. 7, 43, 61, 71, 1129 List the prime factors of 4943599066. 2, 7, 353114219 What are the prime factors of 2209039911? 3, 13, 6293561 List the prime factors of 169969033. 13, 13074541 List the prime factors of 3033841920. 2, 3, 5, 790063 List the prime factors of 6723098. 2, 41, 163, 503 What are the prime factors of 2267559049? 7, 53, 701, 8719 List the prime factors of 212286059. 212286059 List the prime factors of 220886770. 2, 5, 13, 1699129 What are the prime factors of 11055756? 2, 3, 179, 5147 List the prime factors of 154639865. 5, 30927973 List the prime factors of 23304631. 7, 3329233 What are the prime factors of 260206276? 2, 11, 449, 13171 List the prime factors of 2172555207. 3, 103, 2343641 What are the prime factors of 989667300? 2, 3, 5, 3298891 List the prime factors of 93379834. 2, 46689917 List the prime factors of 36548886. 2, 3, 11, 23, 24077 What are the prime factors of 173005889? 7, 17, 1453831 List the prime factors of 394092184. 2, 953, 51691 What are the prime factors of 354056879? 11, 523, 61543 List the prime factors of 509427262. 2, 254713631 List the prime factors of 61732601. 7, 1049, 1201 What are the prime factors of 21431593? 21431593 List the prime factors of 69270816. 2, 3, 721571 List the prime factors of 148388247. 3, 7, 785123 What are the prime factors of 6213270855? 3, 5, 11, 83, 631, 719 What are the prime factors of 31741130? 2, 5, 73, 43481 List the prime factors of 116303755. 5, 23, 337, 3001 What are the prime factors of 913291816? 2, 17, 109, 61609 List the prime factors of 87550636. 2, 3037, 7207 List the prime factors of 976575907. 89, 181, 60623 List the prime factors of 964519130. 2, 5, 2161, 44633 What are the prime factors of 61386887? 61386887 What are the prime factors of 170535513? 3, 4679, 12149 What are the prime factors of 396062353? 19, 71, 331, 887 List the prime factors of 538570123. 7, 13, 641, 1319 What are the prime factors of 602914501? 7, 86130643 What are the prime factors of 1084706336? 2, 7, 233, 2969 List the prime factors of 806769343. 806769343 List the prime factors of 164382921. 3, 18264769 List the prime factors of 88734404. 2, 11, 2016691 List the prime factors of 1681051431. 3, 560350477 List the prime factors of 376681. 29, 31, 419 List the prime factors of 1780083618. 2, 3, 296680603 List the prime factors of 45241315. 5, 7, 1292609 List the prime factors of 1809883966. 2, 11, 2087, 39419 List the prime factors of 30862511. 281, 109831 List the prime factors of 1171473227. 1171473227 What are the prime factors of 76203013? 647, 117779 What are the prime factors of 38863624? 2, 4857953 What are the prime factors of 53098489? 4093, 12973 What are the prime factors of 2202952134? 2, 3, 47, 1031, 7577 What are the prime factors of 174114028? 2, 11, 29, 136453 List the prime factors of 428138822. 2, 479, 446909 What are the prime factors of 1242795520? 2, 5, 83, 5849 List the prime factors of 540831565. 5, 1373, 78781 List the prime factors of 238387461. 3, 13, 421, 14519 What are the prime factors of 357378406? 2, 7, 11, 2320639 What are the prime factors of 89463108? 2, 3, 7, 1065037 What are the prime factors of 4669764	{ "pile_set_name": "DM Mathematics" }
(4p - p - 2p)(0p - 2p + p))(-2 - 2p + 2)(-2p + 3p + 0p). 2p*4 Expand (-2 + 2 + 3s*2)((-1 - 2 + 2)(2 - 1 - 3) + 1 + 2 - 1). 12s*2 Expand (-3n - 2n + 4n)(-4 + 0 + 3)(-1 + 1 + 3n) + (n + 0n - 2n)(3n + 0n - 4n). 4n*2 Expand -3v + 0v + 2v + (-2 + 2 - 2 + (-2 + 0 + 0)(0 + 2 - 1))(4v + 3v - 3v). -17v Expand ((-1 + 7 - 1)(3 - 3 - 2)(5 - 1 - 2) + 1 + 1 + 0)(3 + 2g - 3). -36g Expand (-3g*2 - 3 + 3)(10g - 2 + 2)(6 - 2 - 2). -60g3 Expand (2 - 2 - 1)(7k2 + 4k*2 - 7k*2) - 3k*2 + 3k2 + k2 + (-3k - k + 5k)(3k - k - 4k) - 1 + 1 - 2k*2. -7k*2 Expand 0m*3 - 3m*3 + 7m*3 + (0m3 - m3 - m*3)(-2 - 3 - 7). 28m3 Expand (0 + 0 - q2)(-q - q - 3 + q) + 448q2 + 13q*3 + 2 - 448q*2. 14q*3 + 3q2 + 2 Expand -2 - h2 + 2 + (-6h + 2h + 3h)(-h + h + 2h) + 7h*2 - 5h*2 + 0h2. -h2 Expand -2o - 3 + 3 + (4o - 2o + 0o)(1 - 2 - 1) + 73o - 61 - 68 + 126. 67o - 3 Expand ((-2 + 0 + 0)(m - 2 + 2) + 3m - 3m - 2m)((-4 + 0 + 3)(2 + 1 - 2) - 2 + 3 + 1). -4m Expand (0x + x - 2x)(4x - 4x - 2x)(-1 - 3 + 7). 6x*2 Expand (-24n*2 + 18n*2 - 194n*2 - 24n*2)(3n2 + 0n2 - n2). -448n4 Expand (3j2 - j2 + 0j2)(-8 + j*2 - 2j*2 + 7). -2j*4 - 2j*2 Expand (2n + 6 + 2n2 - 7 - 5n*2)(-1 + 1 - 2). 6n2 - 4n + 2 Expand (2 - 2 - 2)(-159w + 159w - 87w*2). 174w*2 Expand (p + p - 5p - 2p2)(-3 + 3 + p)(-3p - 3p + 4p). 4p4 + 6p*3 Expand (3z + 0z2 - 2z*2 - 2z)(-1 - 2z*2 + 1) + (-3z*3 + 3z*3 + 2z*3)(1 - 1 + z). 6z4 - 2z*3 Expand 4h*4 + 26h - 26h + (-4h2 - h2 + 3h2)(-2h2 + 5h*2 - 5h2) - h2 + h*4 + 3h*4 - 3h4 + h2 - h*2 - 2h*4. 7h4 - h2 Expand (-1 + 1 + 2t2)(-1 - t + 1) + t2 - t2 + t*3 - 3t*2 + 2t*3 + 2 + 3t2. t3 + 2 Expand (-1 + 5 - 2f - 3)(0f4 + f - 2f4 + f4). 2f5 - f4 - 2f*2 + f Expand 3o + 0o + 9o + (6 - 3 - 1)(2o + 2 - 2). 16o Expand (2g*2 + 2 - 2)((3g + 0g - 4g)(2g - 2 + 2) - g2 + 6g*2 - 2g*2 + (-g + 0 + 0)(-1 - 2g + 1)). 6g*4 Expand (0w + w - 3w)(-w2 + w3 + w2) - w4 - 3w4 + 2w*4 + 2w*4 - 2w*4 + 7w*4. 3w*4 Expand 3n*4 + 0 + 0 + (3n*4 - 4n*4 + 4n*4)(3 - 2 + 4). 18n4 Expand (3g*2 - 4g*2 + 0g2 - 3 - g2 + 3 + (-2g + g + 2g)(4g - 4g - g))(0g2 - 3g2 - g2). 12g4 Expand -o + 6o - 2o + (0o + o + 0o)(-2 + 1 - 1). o Expand 30o - 30o - o*2 + (-1 + 1 - 1)(4o2 - 4o*2 - 2o2). o2 Expand (0 + 4 - 2)(0k*5 - 3k*5 + 4k5) - k5 - 39 + 39. k*5 Expand (2f4 + f4 + 0f4)(0f + 0f + f). 3f5 Expand (-3 - 17 + 0)(v*2 + 0v + 0v + (3 - 2v*2 - 3)(6 - 2 - 2) + v*2 - 2v + 2v). 40v*2 Expand (0b*2 - 4b*2 + 0b*2)(2 - b*2 + 3b*2 + 0). -8b*4 - 8b*2 Expand (3 - 5 + 0)(-2l2 + 0 + 0 - 2l*2 + 4l*2 - 6l*2 + (-3 + 3 - 2l)(1 + l - 1) - l2 + 2l - 2l - 2l*2 - 2l*2 + 3l*2). 20l*2 Expand (3c*2 + 0c*2 - 5c*2)(8 - 7 + 2 + 6c). -12c*3 - 6c2 Expand (w3 - w*3 - 2w*3)(0w2 + w2 + 0w*2) + 4w5 - w3 + 2 - w*3 - 7w*5. -5w*5 - 2w*3 + 2 Expand (-l - 1 + 1)(-l - l*4 + l) + (-3l*3 - 5l + 5l)(4l - 4l + 2l2). -5l*5 Expand (2j3 - j3 + j*3)(j - 3j + 4j) - 3j4 + 4j*4 + 0j4 - j4 - 10 + 19 + 3j4. 7j*4 + 9 Expand (0n*3 - 3n*3 + 5n*3)(-2 - n + 2) + 8n3 - n2 - 8n*3 + 3n4. n4 - n*2 Expand (2g*3 - 2g*3 - 2g*4)(-3g + 2g - g) + 2g5 + g4 - g4 + (-2g*5 + 12g*5 - 3g*5)(-4 + 4 + 2). 20g5 Expand (0 + 4 - 2)(-4g + 3g - 75 + 98). -2g + 46 Expand (3 + 3 - 2)(3 + 1 - 6)(3s - 3s + 2s) + (4 - 4 - 2s)(-2 - 3 + 6). -18s Expand 1 - 3 + l + 0l + (-3l + 2l - l)(-3 + 0 + 0). 7l - 2 Expand (-b + 0b - b)(0b2 + b2 + b2). -4b3 Expand (k3 - 3k3 + k3 + (-3 - 2k*2 + 3)(-2 + 2 + k) + k*3 + 2k - 2k)(4 + 0 + 0)(5 - 2 + 0). -24k*3 Expand (4r - 5r + 0r)(-2r - r + 5r)(-6 - 3 - 3). 24r2 Expand (0j + 2j + 0j)(-31 - 24 + 31)(-j + j + j). -48j2 Expand (0y*2 + 0y*2 + 3y*2)(-3 - 1 + 1). -9y2 Expand (3 - 4 - 1)(-1 + 2 + 1)(5 - 5 - y). 4y Expand 5l5 + 3l*4 + 0l5 - l4 - 2l5 + 4l*5 + 0l*5 + (0 + l + 0)(2l4 + l4 - 2l*4) + 2l + 2l5 - 2l. 10l5 + 2l*4 Expand (1 - 3p - 1)(6 + 3 - 3). -18p Expand -x*4 - 3x*4 + 5x*4 + (2x - 2x3 + 7x + 0x)(0x - 3x + x). 5x4 - 18x*2 Expand 4g*5 + 3g*5 - 2g5 - g5 - g5 + g5 + (-3 + 2 + 0)(2g*5 + 0g*2 + 0g*2). 2g*5 Expand (-1 - 3 + 0)(4g + 9 + 4g - 7g). -4g - 36 Expand (-3k5 + 4k*5 - 2k*5)(-4 - 1 + 12). -7k5 Expand (13u + 1 + 2 - 11u + (-1 + 0 + 2)(3u + u - 5u))(2 + 0 - 2u + 0). -2u2 - 4u + 6 Expand (-3s + 3s - 2s)(-4s - 5s + 5s) + (3 - 2s - 3)(4s + s - 3s). 4s*2 Expand (3 + 2u - 2 + 2u)(6u + 0u - u). 20u2 + 5u Expand (3 + 3i - 3)((-5i4 + i4 + 3i*4)(-5 + 3 + 1) + 4i4 + 1 - 1). 15i*5 Expand (0 + 1 - 2)(4g + 0g - 2g) + 0g + 3g - 4g - 2g + 2g - 2g. -5g Expand (-2z - 4 - 1 + 2)(0 + 0 - z)(0z + 0z - 2z). -4z3 - 6z2 Expand -o4 + o*4 + 2o*4 - 2o + 2o4 + 2o + o - 2o4 - o + (4 - 1 - 1)(-2o4 + 4o*4 + 0o*4) + 4 + 2o*4 - 4 + 3o*2 + 3o*4 - 3o*2. 11o*4 Expand (-3 + 0 - 2)(-4 + 3 + 2)(1 - 5 + 3)(4h + h3 - 4h). 5h3 Expand (8 - 14t - 8)(0 - t + 0). 14t*2 Expand (-4w + 4w - w)(-3 - 2 + 12) + 6w - w - 4w. -6w Expand -2 + 5a*2 - 7a2 + a2 + (-3a + 0a + a)(-a + 0a + 0a). a2 - 2 Expand (0o + 5o - 4o)(-7o + 2o + 0o) - 5o2 + 2o*2 + 4o*2 + (3o - 2o + 0o)(3o + 2o - 3o). -2o2 Expand (7 - 7 + 5g)(g4 - 3g*4 + 4g*4) - 6g*5 + 0g*5 - 2g*2 + 4g*5. 8g*5 - 2g*2 Expand (7y*3 - 3y*3 - 2y*3)(-y*2 + 3 - 3) + 2y*5 - 5y5 + y5 + 3y5 - y5 + 0y*5 - 11y + 11y + 8y*5. 6y*5 Expand (-2r3 - r3 + 0r3)(-1 + 5 - 2)(3r + 0r + r). -24r4 Expand (q2 + 9 - 9 - 7q)(-q*3 + 2q*3 - 2q3). -q5 + 7q4 Expand -2y*5 + 3 - 3 + (-2y2 + y2 + 2y2)(-2y3 + 3y*3 + 0y*3) + 0y*2 + 0y*2 + 2y5 - y5 + 0y5 + 3y5 - y5 - 2y3 + 2y*3. 2y*5 Expand 2z*5 + 0z*5 + 4z*5 + (2 - 1 - 2)(-2z5 + z - z). 8z*5 Expand -2a*5 - 4a*5 + 5a*5 + (-1 + 2 - 2)(a5 - a5 + a*5). -2a*5 Expand (-1 + t + 0 + 3)(4 - 2 - 3 - t). -t*2 - 3t - 2 Expand (7w + 6w - 4w)(2 - 2 + 2w + (-5w + 5w - 2w)(1 - 5 + 2)). 54w*2 Expand (2w + 3w - 6w)(-9w*4 + 22w*3 + 28w*3 - 2w - 52w3). 9w*5 + 2w*4 + 2w*2 Expand (1 - 1 + 2x*4)(2 + 0 + 0) + (-4x2 + 4x2 - x2)(-4x2 - x2 + 3x2). 6x*4 Expand (-1 - 2i + 1)(-i - i + 4i) + 0i2 - i2 - 4i*2 + (-3i + i + 3i)(0i - i + 0i). -10i2 Expand -60s*3 - 287 + 287 + (0 + 0 - 2s*2)(-2s + 5s - s). -64s3 Expand (1344w*5 - 21w*4 - 30w*4 + 2w*3 - 1346w*5)(0 + 2 + 0). -4w5 - 102w*4 + 4w*3 Expand -3t*2 - 2t*2 + 6t*2 + (-2 + 2 + 2t)(-2t - 2t + 2t) + 74t + 2t*2 - 74t - 14. -t*2 - 14 Expand (-2v - 2 + 2)(26 - 26 - 5v) - v2 - v - v2 + 0v. 8v*2 - v Expand (105r*3 - 16r*4 - 105r*3)(-2 + r + 2 - 4r + 3r + 0r + (-r + 7r - 4r)(-4 + 3 - 1)). 64r5 Expand -1 + 1 + 2n*2 + (1 + 2n - 1)(2n - n - 4n) - 6n*2 + 4n2 + n2 - n*2 + 2n*2 + 0n*2. -4n*2 Expand ((4 - 3 - 3)(4 + 1 - 3) - 3 + 0 + 5)(0p - 2p - p). 6p Expand -4o3 - o5 + 4o*3 + (7o*3 - 4o*4 - 7o*3)(o - o + 2o). -9o*5 Expand (2z - 3z - z)(-2z2 + 2z*2 + 3z*3) + (0z2 + z2 + z*2)(-2z2 + z2 + 2z*2). -4z*4 Expand 4o - 4o + 3o*4 + (-1 - 3o + 1)(-2o + 2o - 2o*3) - 3o*4 - 3o*4 + 2o*4. 5o*4 Expand -5o*2 + 4o*2 - 3o*2 + (5 + 0 - 4)(-o*2 + 2o*2 + 0o2) + 1 + o2 - 1 - 2o - 109 - o2 - 2o2 + 108 + o2 + o*2 + 0o*2. -3o*2 - 2o - 1 Expand (9 - 5 + 8)(3 - 3 - 2w). -24w Expand (-5 - 4t*3 + 5)(2t + 3 + 9 - 1). -8t*4 - 44t*3 Expand (2l - 2l - 2l*3)(2 - 5 - 495l + 477l). 36l4 + 6l3 Expand (o4 + 3o - 3o + 0o4 - o4 + 0o*4 + (-2o*2 - 2o*2 + 3o*2)	{ "pile_set_name": "DM Mathematics" }
1c + 5 for u. -6 Solve -a = -v + 1, 2v + 12715 - 12714 = -a for v. 0 Solve 4k + 85c - 84c = 28, -5k = -3c + 84 for k. 0 Solve -363j = -351j + 36, 4r + 4j + 32 = 0 for r. -5 Solve 5z = -2p - 13, 9324z - p - 5 = 9325z for z. -1 Solve 0 = 89800m - 89804m - 6r + 14, -4m + 5r - 19 = 0 for m. -1 Solve -11 = 4l + 5x, -15x + 7x + 85 = -5l for l. -9 Solve 0 = -2q + 3z - 9, 3z - 24 = 14876q - 14879q for q. 3 Solve 5g - 1083j = -1081j + 53, 4j + 7 = -g for g. 9 Solve -46 = -5d - 4b, 68b + 20 = 4d + 67b for d. 6 Solve 4u - 8 = 203p - 206p, -4p + 15 = u for p. 4 Solve 0 = -2h - 3z - 43, 1102 = -9h + 5z + 1186 for h. 1 Solve -3d - 2p - 12 = 0, -5p + 39915 = 39900 for d. -6 Solve -34f - 2 = z - 33f, -2f = 0 for z. -2 Solve 3k + 4 - 3 = -a, -1106a = -1117a - 2k + 20 for a. 2 Solve 4v - 164 = -29o, -v + 605 = -4o + 609 for v. 12 Solve -807m = -2g - 805m + 18, -2g = 2m + 10 for g. 2 Solve 0 = -2i + 50o - 95o + 50o - 6, o + 3o = 0 for i. -3 Solve 2y = 5q - 16, -125 = 5q - 9y - 162 for q. 2 Solve s - 44 = 4f, -11 = -29s - 27f + 28f for s. 0 Solve 3f - 3d - 3 = 0, -689d + 690d + 26 = 6f for f. 5 Solve -3m = -5d + 28, -293m = -294m + d - 6 for m. -1 Solve -4k + 2f + 30 = 0, -5f + 497 = -k + 518 for k. 6 Solve -5s + 19 = 449n - 448n, 4s = -n + 15 for s. 4 Solve -3b = 62m - 59m, -4b + 27 = -5m for b. 3 Solve -c + 2 - 6 = 0, -29y + 25y + 2c = 0 for y. -2 Solve 57c = -l + 52c - 18, 26 = 5l - 4c for l. 2 Solve -28039j - 49 = -4n - 28038j, -1 = j for n. 12 Solve 13p = 18p - 10, -5o + 20 = 5p for o. 2 Solve 6i - 16 = 2i - 5j + 4, -8i - 20 = -5j for i. 0 Solve 0 = 3r - 3q - 12, 0 = -73r + 68r - 4q - 25 for r. -1 Solve -772m + 4c + 8 = -776m, -2m = 5c + 10 for m. 0 Solve -q + 9 = 36692b - 36690b, -b - 56 = -5q for b. -1 Solve 0t - 9i + 47 = 5t, 0 = -4t - i + 19 for t. 4 Solve 0 = 4m + 5d - 47, -578d + 570d = 4m - 44 for m. 13 Solve -4s = 21a - 19a, 0 = 2s - a - 4 - 0 for s. 1 Solve -5s + j = 24, 3358s + 30 = 3360s + 4j for s. -3 Solve u - 2f - 26 = -25 - 18, -3u = -f + 26 for u. -7 Solve -4y - 64 = -7d - 26, 2y = 2d - 10 for y. 1 Solve 3u - 18 = 15187w - 15190w, 3u - 9 = 0 for w. 3 Solve 471g = 472g - 3a - 2, 0 = -2g - 5a + 15 for g. 5 Solve -x + 4 = -3h + 4h, -427h - 3 = -430h for x. 3 Solve 6l = 29i - 30i + 70, -5l = -4i - 39 for i. 4 Solve k = 0, 23v + k - 23 - 77 + 8 = 0 for v. 4 Solve 2x + 62 = 3i, -5762i - x = -5757i - 86 for i. 18 Solve -3r + 164 - 89 = -3s, 4r - 5s = 99 for r. 26 Solve 0 = 7y - 2h - 45, 186 - 196 = 3y + 5h for y. 5 Solve 2966t - 10 = -k + 2962t, 4k - 4t + t + 17 = 0 for k. -2 Solve 5d + 14c = 9c + 40, 0 = 4d - 2c - 44 for d. 10 Solve 0 = -o + 2u - 27 + 42, 3o - 10 = -u for o. 5 Solve 13852b - 3h = 13854b - 16, 2h - 6 = b for b. 2 Solve s = -f + 3, 6s = 2s - f + 6 for s. 1 Solve -35t = -32t + 5c - 51, -2t + 2c - 14 = 0 for t. 2 Solve y + 2521r = 2522r, -4r = 0 for y. 0 Solve 25c - 30c = 2g - 37, -c + 5 = -2g for g. 1 Solve 149u - 147u + 14 = 5t, -20 = -4u - 2t for u. 3 Solve z - 3998 + 3995 = 4c, 2z = -c + 6 for z. 3 Solve 1025t = -3l + 1017t + 31, 2t + 6 = 2l for l. 5 Solve -25 = 214w - 219w + 2s, -4w + 3s = -20 for w. 5 Solve -3b + c + 4 = 0, 0 = -5b - 2c + 278 - 253 for b. 3 Solve 2r + 18 = 111q - 108q, -4r - 18 = -3q for r. 0 Solve 95b - 68s - 26 = -70s, 4b + 5s - 65 = 0 for b. 0 Solve 0 = -j - 4 + 3, 4j - 3j = -o for o. 1 Solve -3x - 2h = 0, 762x + 3h - 2 = 759x + 1 for x. -2 Solve 0 = p - 3u + 3, -6p + 7p + 5u = 29 for p. 9 Solve -168n + 163n = -5t - 25, -5t + 5 = 0 for n. 6 Solve -n + 8 + 17 = 3f, -3n + 3f = 9 for n. 4 Solve -3b + 2o = 2, -5o - 505 + 510 = -4b for b. 0 Solve 2v + 28 = -6u, -u - 3v - 279 = -261 for u. -3 Solve 100 = 3w - 4g + 93, -3g = 4w + 24 for w. -3 Solve 186x + 29 = 191x + i, 2x - 35 = -3i for x. 4 Solve -4s = -2u + 14, 340u = -338u + 683u - 3s for u. -3 Solve x + 4n - 28 = 0, -n = 3x + 80 - 98 for x. 4 Solve 44 = -5b - 12q, -5q = -36 + 46 for b. -4 Solve -3n + 3x = -21, 290n - 294n - 2x = -28 for n. 7 Solve 5b - 6 = -m + 5, -3m = -7b + 33 for m. -4 Solve 11 = -s - 2q + 5q, 3s + 17 = 5q for s. 1 Solve 5w + 19 = 3s, -992w = -2s - 993w - 9 for s. -2 Solve -4a + 37 = 3n, -50a = -51a + 4n - 24 for a. 4 Solve -4p - 2i + 24 = 0, -47 = -8p - i - 5 for p. 5 Solve -20n = -2z + 10, -3z = -n - 0 - 15 for z. 5 Solve -2o + 49 = -3h - 7o, 3h = -2o - 34 for h. -8 Solve -2n = -176j - 504, 0 = -2j - 10n + 5n - 66 for j. -3 Solve -8g + 4g - 2s + 12 = 0, -g + 2s = -8 for g. 4 Solve -x + 425w - 420w + 21 = 0, -3x - 3w = 9 for x. 1 Solve 188h - 199h - 3i - 88 = 0, 0 = -4h + 4i - 32 for h. -8 Solve 3t + 201p = 199p + 29, 0 = -5t - 5p + 45 for t. 11 Solve q - 9 = 3o, -5q + 13o - 11o - 20 = 0 for q. -6 Solve 3g + 95f = 93f + 10, 2f = 4g + 10 for g. 0 Solve -4f - 60 = -4q, 1194q - 1189q + 2f - 47 = 0 for q. 11 Solve -1137z + 18 = -1142z + p, -2p = 5z + 24 for z. -4 Solve -22k - 100 = -0k - 4u, -2066k + 2070k + 4 = -4u for k. -4 Solve 4i = c + 13, 190c - 5i - 5 = 193c for c. -5 Solve -4b - 14 = -57m + 56m, 3m + 22b = -94 for m. -2 Solve 95 = -5l + 5c, -2l - 22 = -5c + 25 for l. -16 Solve -33 = l + 3h - 19, -3h = -2l - 1 for l. -5 Solve 0 = 5s - u + 10, -s - 106u - 2 = -104u for s. -2 Solve 0 = -2q - 2i, 124q + 114i - 113i + 492 = 0 for q. -4 Solve 3o = 5o + 7 + 1, 0 = 2v + 5o + 10 for v. 5 Solve -3c - 36 + 45 = -3v, 5v = -3c - 55 for v. -8 Solve -4q + 131 = -i + 125, 4i = -8 for q. 1 Solve -87y + 37 = -83y - 5p, 5p + 45 = 5y for y. 8 Solve l - 8 = -5v, v + 2l + 55 - 53 = 0 for v. 2 Solve 81 = m + 5w, -5m + 12w = 13w + 3 for m. -4 Solve -3y = 5f + 31, -69f = -65f + y + 8 for f. 1 Solve -16 = 4b + u, -2b + 2921u + 10 = 2917u for b. -3 Solve 87t - 86t + 29 = 4y, 5t + 5y - 55 = 0 for t. 3 Solve 2l - 235o = -231o + 30, 0 = 5l - 2o - 51 for l. 9 Solve 0 = v + 4z - 7, 1457 - 1454 = -v + z for v. -1 Solve -s = 3, -34p - 3s - 24 = -37p for p. 5 Solve 2d = -2k + 10, 0 = -30k + 29k - 4d + 5 for k. 5 Solve 2f = -3x + 23, -14x - 2f - 97 = -153 for x. 3 Solve 0 = 2o - 4, -16j + 112 = 8j - 4o for j. 5 Solve 5b - 75 = -5x, 5b = -x + 30 + 5 for x. 10 Solve 3m + 773w - 769w + 59 = 0, m = 2w - 3 for m. -13 Solve -4r = -2l + 5108 - 5092, r + 10 = -l for r. -6 Solve -2 = -f, -4k - 3f + 26 = 32 for k. -3 Solve -186h + 3k - 29 = -182h, -3k = -2h - 19 for h. -5 Solve 2s - 20y + 25y + 27 = 0, 4s = -21y - 109 for s. -1 Solve 5i + 19 = -y, i + 0y + 2y + 2 = 0 for i. -4 Solve -3b = 3p - 12, -4p = 5b + 709 - 728 for p. 1 Solve 5 = -g - c, -925g + 2c + 10 = -928g for g. 0 Solve -61u + 17 = h - 56u, 0 = -2u + 6 for h. 2 Solve 4u = -5f + 33, -8558u - 7 = -8554u - 3f for u. 2 Solve 2q - 5 = 3z, -144z + 149z + 4 = -11 for q. -2 Solve -6 = -2x - 35q + 39q, 5x + q + 29 = 0 for x. -5 Solve 0 = 2g - 3n, 1942g = 1953g - 5n - 23 for g. 3 Solve -b = 4y + 11, 40b - 39b - y = -1 for b. -3 Solve -28v + 25v - u = 5, -8 = -2v + 5u for v. -1 Solve -3w = 5b + 20, 586b = 2w + 591b + 20 for w. 0 Solve -310m - 3a = -308m + 19, -4m + 2a = 14 for m. -5 Solve -5m = -5c - 55, 126c + 4m - 74 = 124c for c. 5 Solve 3n - 2p = 7, 4n + 100p - 99p = 24 for n. 5 Solve -5w - 3i - 62 = 0, 24 = -w - 19i + 30 for w. -13 Solve 12 = -2t + 3g, 64t = 78t - 5g + 84 for t. -6 Solve 0 = -2r - 10, -t = -10r + 9r - 10 for t. 5 Solve -n = -3u - 11, -20n + 19n - 5 = 5u for u. -2 Solve -2b + 2r = 10, -8r + 12r - 17 = 3b for b. -3 Solve 5j + 26 = -466t + 462t, 2t - j + 6 = 0 for t. -4 Solve -o + 67 - 67 = 0, 4o - 6 = 6j for j. -1 Solve 183 = -4x - 4z + 171, -2x + 6 = -2z for x. 0 Solve 5g - 2q = -8 - 4, -44 = 13g - 2q for g. -4 Solve 51u + 28 = 4i + 46u, -u = 4 for i. 2 Solve -q + 14 = 3j, -5j + 35 = -14117q + 14121q for q. 5 Solve 61 = -2n - 29v + 30v, -v = 5 for n. -33 Solve 3c + 198k - 18 = 195k, -k - 9 = -2c for c. 5 Solve 214u - 219u - 35 = -5c, 4*u	{ "pile_set_name": "DM Mathematics" }
- 5w = 493 + 222, -c - 5w = -143. Calculate the lowest common multiple of c and 4. 572 Suppose 66550 = 4q - 3q - 4b, -5q + 4b + 332686 = 0. Let i be (q/180)/((-2)/(-18)). Let o = i - 3331. What is the common denominator of o and -5/6? 30 Let z = -1/5413 + 286900/59543. Calculate the common denominator of (18/(-36))/((-2)/(-50)) and z. 22 Let q = 159 + -157. Calculate the smallest common multiple of 6 and q. 6 Let b = -12 + 14. Suppose -bp + 3j = -4p + 2, j = p - 1. Suppose 2y + 12 = 2x, 2y - p = y. What is the least common multiple of 24 and x? 168 Let r = 15 + -17. Let l(f) = f3 + f2 - f + 2. Let y be l(r). Suppose 15 = 5g, yb - 2b - 5g = -55. What is the smallest common multiple of 4 and b? 20 Let t(o) be the second derivative of -o4/12 - 11o*3/6 - 2o*2 - 3o. What is the least common multiple of 22 and t(-8)? 220 Let m = -111797/3408 - -2514/71. Find the common denominator of m and -145/36. 144 Suppose -14w + 2052 = -874. What is the lowest common multiple of w and 114? 1254 Let o = 11566/399 - 482/19. Calculate the common denominator of 149/636 and o. 4452 Suppose -5g + 0g + 3o - 87 = 0, -5o + 85 = -5g. Let a = 23/131 - 4567/2882. What is the common denominator of a and ((-69)/(-4))/(g/12)? 22 Let y(m) = 6m - 30. Let f be y(9). Suppose -14j - f = -18j. What is the smallest common multiple of 7 and j? 42 Let x = -1803/299 - -6487777/568698. Let c = x + -18/1585. Calculate the common denominator of 28/27 and c. 270 Let f be (6/4)/(27/(-18)). Calculate the common denominator of 917/(-308) + (-3)/f and -85/18. 396 Let q = 9577/5 + -345017/180. Calculate the common denominator of -64/9 and q. 36 Find the common denominator of (6/(-8))/((-84)/(-91)) and (-143)/(-14) + -3 - 1. 112 Suppose -n = 2w - 20, w - 112 = -5n + 3w. Let d(s) = s*2 - 20s - 32. Calculate the least common multiple of d(n) and 24. 24 Let t = -821 + 833. Calculate the smallest common multiple of 24 and t. 24 Calculate the common denominator of -103/322 and (-364)/(-24)(-6)/(-4). 644 Suppose -4f + 74 = 2c, 4f + c + 2c - 75 = 0. Suppose -2h - 2a + 4 = -12, 3h - 4a = 52. What is the least common multiple of h and f? 36 Let m = 7312699/128 - 57131. Calculate the common denominator of 5/2 and m. 128 Let v = 794 - 1377. Let q = 5315/9 + v. Calculate the common denominator of q and -95/2. 18 What is the common denominator of 1 + 4/10 + 1118/(-270) and (0 + (-38)/18)/(8/6)? 108 Let w be 2/(-2)(-20 - -12). Calculate the common denominator of 55/9 and (404/24)/(w/12). 36 Let h = 48 + 15. What is the lowest common multiple of h and 90? 630 Suppose -15f = -13f + 4n - 100, -2f + 4n = -100. Calculate the smallest common multiple of f and 12. 300 Suppose 37 = 6x + 1. What is the least common multiple of 6 and x? 6 Suppose 0 = h - 2 - 3. Suppose 0 = -s - 4s, -66 = -3d - hs. Calculate the least common multiple of 18 and d. 198 Let g be (-1 + 10)/(-1) - 0. Let b = -17 + 29. What is the lowest common multiple of b and -3((-3)/g + -1)? 12 Let u(g) be the third derivative of -g5/30 + g4/2 - g*3/3 + 6g*2. Let m be u(13). Calculate the common denominator of (6/(-16))/(10/m) and -31/20. 20 Suppose 2g + g + 4w - 11 = 0, -3w = -4g + 48. Let m be (-21)/(-9)-19-3. Calculate the common denominator of -11/12 and m/30 + g/(-3). 60 Suppose -4k - 2473 + 2581 = 0. What is the lowest common multiple of 9 and k? 27 Suppose -l - 19 + 168 = 0. Suppose 17i = -l + 693. Calculate the least common multiple of 20 and i. 160 Suppose -356 = -5r + 129. Suppose u + i - 19 = -0i, -r = -4u + 3i. What is the smallest common multiple of 20 and u? 220 Let a = -17/4630135 - 687820442751/518575120. Let f = 9243/7 + a. What is the common denominator of f and 31/54? 432 Let y = 57 + -55. Suppose -b - 15 = 4b. Let l = b + 4. Calculate the smallest common multiple of l and y. 2 Let t = 396 + -220. Suppose t = 3d + d. What is the least common multiple of d and 11? 44 Let k be 68 + (-4)/8-2. Suppose k = l + 4. Find the common denominator of 3 - -1 - l/40 and -5/2. 8 Let y(r) = -r*2 - 9r - 8. Let l(v) = 2v3 + 3v*2 - 4v + 2. Calculate the lowest common multiple of l(2) and y(-6). 110 Let x = -4991/9 + 3942539/7110. Find the common denominator of 3/2 and x. 790 Suppose -2h = -0 - 6. Suppose -4j - 1 = -4l - 5, 0 = -2j + l + h. What is the least common multiple of ((-2)/2 + 0)-4 and j? 4 Let o = 349/2 - 188. Find the common denominator of -83/5944 and o. 5944 Suppose -13m + 10m = 6. What is the common denominator of m/8 - 1239/(-196) and (-1 - (-3)/2)-57? 14 Suppose 0 = -2u - i - 19, 2u + 5i - 2i + 9 = 0. Find the common denominator of (-3)/u - (-195)/24 and -43/9. 72 Let u = 2462417/4653 + 6/517. Let y = u + -1053/2. What is the common denominator of -39/10 and y? 90 Let o = 15699825/496 - 31653. Find the common denominator of -43/12 and o. 1488 Let a(c) = -c*2 + 13c + 11. Let q be a(14). What is the common denominator of (-67)/6 - 3/q and (9/(-28))/(4/(-48))? 42 Let z(v) = 10v - 31. Calculate the common denominator of z(0) and -1/3. 3 Find the common denominator of 3 + 0 + 606/(-252) and -71/35. 210 Let p(h) = -6h*2 - 5h + 9. Let o be p(-4). Let g = o - -73. What is the lowest common multiple of 20 and g? 60 Let b = 11 + -12. Let n = b + 7. Calculate the lowest common multiple of (8/(-24))/((-1)/6) and n. 6 Let q be 2630/18 - (-14 - -16). Let y = q + -13681/90. What is the common denominator of y and -2 + (-3)/3043? 10 Let u be 2/3 - (-2147)/(-21). Let p = 3755/42 + u. Find the common denominator of (-2)/(-8) - 930/(-200) and p. 30 What is the common denominator of -37/75 and 11(-91)/(-7700)14/5? 750 Let p = 115 - 70. What is the least common multiple of 35 and p? 315 Let t = 32 + -28. Suppose -tv - 10 = -5v. Calculate the least common multiple of v and 8. 40 Let p = 13 - 11. Calculate the common denominator of 411/36 - (1 - p/6) and 31/18. 36 Suppose 7p - 432 = -p. Suppose 3j + 5a = -j + 147, -2j + 4a = -p. Find the common denominator of -15((-58)/36 - 0) and j. 6 Let v = -444 - -464. What is the smallest common multiple of 774 and v? 7740 What is the lowest common multiple of (30/(-40))/(-1(-6)/(-3216)) and 15? 2010 Suppose -4u = -2l + 26, -4l - 3 = -0u + 3u. Find the common denominator of 1 + -1 + 180/28 and 8 + u + 93/6. 14 Let t(r) = 2 - 2 + 495r + 344r + 8. Let y be t(-6). Let j = -50331/10 - y. What is the common denominator of j and 1/10? 10 Let o(r) = 1741r - 7. Let l be o(-5). Let h = 52151/6 + l. Let t = 6275/4 - 1578. What is the common denominator of h and t? 12 Let l be (4/6)/(8/24). Let n(u) = -3 + 3 + u*3 + 6u*l + 3. Calculate the least common multiple of n(-6) and 3. 3 Suppose -y + 6y + 5825 = 0. Let f = y - -16285/14. Find the common denominator of f and (2/(-7))/(56/(-8134)). 14 Let v = 11 + -7. Let k be -7-3(-40)/(-84). What is the least common multiple of 2/k - 236/(-20) and v? 12 Suppose -2048 = -12u + 4u. Suppose 9c - u = c. Find the common denominator of 57/20 and (-8)/c - 530/(-24). 60 Suppose 5b = -0b + 2i + 249, -2b - 2i = -94. Let y = b - 27. What is the lowest common multiple of y and (-15 - -1 - -2)-1? 132 Let n = -378/13 - -4233/104. Let c = -850656 + 7679024/9. Let r = c - 2562. Calculate the common denominator of r and n. 72 Find the common denominator of ((-40)/(5/(-1)))/453 and 131/24. 3624 Let i = 11 + 16. Let c = -173 - -182. Calculate the smallest common multiple of c and i. 27 Find the common denominator of 43/175 and (-1 - -3)(-8)/(-2 + -22). 525 What is the common denominator of (2/72-1)/(2/(-129)) and 127/48? 48 What is the common denominator of -4 + (-46)/(-18) + -1 and 35/417? 1251 Suppose 5y - 20 - 20 = 0. Find the common denominator of 27 and y + -4 + 18/16. 8 Suppose -2i = 2i + 2y - 36, 0 = 4i + y - 40. Let c(a) = -a*3 + 12a*2 - 11a + 9. Let x(m) = -m + 1. What is the lowest common multiple of c(i) and x(-3)? 36 Let z(a) = -a*2 - 32a - 79. Calculate the lowest common multiple of 414 and z(-29). 1656 Let p = 205693/33 + -6234. What is the common denominator of p and 23/9? 99 Let t(y) = 2y3 - y2 + 2y + 2. What is the smallest common multiple of t(2) and 30? 90 Suppose -134 = 2*h - 8. Let d = h - -65. Calculate the lowest common mu	{ "pile_set_name": "DM Mathematics" }
late the highest common factor of 11167 and 3744. 13 Calculate the greatest common factor of 1243 and 58751. 11 Calculate the highest common divisor of 51585 and 724. 181 What is the greatest common factor of 40 and 293390? 10 Calculate the greatest common divisor of 54514 and 13488. 562 What is the highest common divisor of 3856619 and 26? 13 What is the greatest common divisor of 391 and 84507? 17 What is the highest common factor of 3 and 70011? 3 What is the greatest common factor of 70533 and 459? 153 What is the highest common factor of 729650 and 50? 50 What is the highest common divisor of 277 and 19? 1 Calculate the greatest common divisor of 243 and 19773. 9 What is the greatest common factor of 754 and 106546? 58 Calculate the highest common divisor of 1656 and 12213. 207 What is the highest common divisor of 199234 and 5782? 98 Calculate the highest common divisor of 2451 and 2623. 43 Calculate the highest common factor of 37486 and 6. 2 What is the highest common divisor of 5452696 and 2204? 2204 Calculate the greatest common divisor of 420 and 909020. 140 What is the greatest common factor of 1149208 and 8? 8 What is the highest common factor of 48764 and 1168? 292 What is the greatest common factor of 23088 and 1664? 208 Calculate the greatest common factor of 7572 and 3600. 12 What is the highest common factor of 1463 and 843106? 209 What is the highest common factor of 1928 and 5303446? 482 Calculate the highest common factor of 987019 and 106. 53 What is the highest common divisor of 6714 and 16? 2 Calculate the greatest common divisor of 61932 and 390. 78 Calculate the highest common factor of 888 and 42750. 6 What is the greatest common divisor of 149553 and 1827? 261 What is the greatest common factor of 112 and 4599? 7 Calculate the greatest common divisor of 410 and 214594. 82 What is the greatest common factor of 10509 and 129837? 339 What is the greatest common factor of 12871 and 4853? 211 What is the greatest common divisor of 172 and 51643? 43 Calculate the greatest common factor of 218373 and 249. 249 What is the greatest common factor of 135805 and 346? 173 What is the highest common factor of 98100 and 6? 6 What is the highest common factor of 52070 and 9020? 410 What is the greatest common divisor of 21096 and 128? 8 Calculate the highest common divisor of 366 and 14518. 122 What is the highest common divisor of 170084 and 404? 404 What is the greatest common divisor of 402272 and 182? 26 Calculate the highest common divisor of 41 and 3239. 41 What is the highest common factor of 1110 and 102934? 74 Calculate the greatest common factor of 7000 and 3505250. 1750 What is the greatest common divisor of 1244552 and 40? 8 What is the greatest common divisor of 1976 and 39832? 104 Calculate the greatest common factor of 28 and 46802. 14 What is the greatest common factor of 4 and 66032? 4 What is the highest common divisor of 11284 and 13468? 364 What is the highest common divisor of 95 and 2240? 5 What is the greatest common factor of 1300 and 27100? 100 Calculate the greatest common factor of 252 and 256732. 28 Calculate the highest common factor of 16379 and 1507. 11 What is the highest common factor of 252 and 19116? 36 What is the greatest common factor of 514604 and 3556? 508 What is the highest common divisor of 911537 and 9515? 1903 What is the highest common factor of 23290138 and 134? 134 Calculate the highest common divisor of 18350 and 50. 50 Calculate the highest common divisor of 72 and 8484. 12 What is the highest common factor of 3306923 and 11735? 2347 Calculate the highest common divisor of 494673 and 1629. 543 Calculate the greatest common factor of 1508 and 10788. 116 Calculate the highest common divisor of 4514097 and 1806. 903 What is the highest common factor of 722943 and 78? 39 Calculate the greatest common divisor of 1335 and 119883. 267 Calculate the greatest common divisor of 359138 and 988. 494 Calculate the greatest common divisor of 51 and 15633. 3 What is the greatest common factor of 191 and 52907? 191 Calculate the highest common factor of 3531 and 107535. 321 What is the greatest common divisor of 95925 and 15? 15 Calculate the greatest common divisor of 27 and 68589. 9 Calculate the greatest common divisor of 2490 and 8820. 30 Calculate the greatest common factor of 1955 and 340. 85 What is the highest common factor of 17928 and 2952? 72 Calculate the greatest common divisor of 1944 and 1176. 24 What is the greatest common divisor of 1037404 and 8684? 668 What is the greatest common factor of 2075 and 581? 83 What is the greatest common divisor of 37569 and 42? 21 What is the greatest common factor of 25 and 4096475? 25 What is the highest common divisor of 4350 and 12825? 75 Calculate the highest common factor of 120 and 325400. 40 Calculate the highest common factor of 621 and 4370. 23 What is the greatest common divisor of 28503 and 27? 9 Calculate the greatest common divisor of 114860 and 100. 20 What is the greatest common factor of 16 and 683888? 16 Calculate the highest common divisor of 11496482 and 82. 82 Calculate the greatest common factor of 3484 and 11256. 268 What is the highest common factor of 2674 and 5239703? 1337 Calculate the greatest common factor of 785 and 135. 5 Calculate the highest common divisor of 25708 and 488. 4 Calculate the highest common divisor of 2148 and 895. 179 Calculate the greatest common divisor of 4160 and 4615. 65 What is the greatest common factor of 260 and 652132? 52 What is the greatest common factor of 12472553 and 601? 601 Calculate the highest common factor of 184128 and 896. 448 Calculate the greatest common factor of 8 and 843056. 8 What is the greatest common factor of 4536 and 9576? 504 What is the highest common factor of 26210 and 1310? 10 What is the greatest common factor of 23 and 74957? 23 What is the highest common factor of 1714 and 1232366? 1714 What is the highest common factor of 630 and 10255? 35 Calculate the greatest common factor of 28259 and 133. 7 Calculate the highest common factor of 61 and 1094096. 61 What is the highest common divisor of 1339 and 18643? 103 What is the highest common divisor of 40147 and 152? 19 Calculate the greatest common factor of 54061 and 21. 7 What is the highest common factor of 33 and 94831? 11 What is the greatest common factor of 338 and 204997? 169 Calculate the highest common divisor of 8800 and 19580. 220 Calculate the greatest common divisor of 154 and 2477398. 154 Calculate the highest common factor of 4066 and 4750. 38 Calculate the greatest common factor of 41340 and 5088. 636 Calculate the greatest common factor of 31 and 32581. 31 What is the highest common factor of 72917 and 23998? 923 Calculate the highest common factor of 1802150 and 40. 10 What is the highest common factor of 333606 and 141? 141 Calculate the greatest common factor of 16 and 61552. 16 What is the highest common factor of 1598 and 8534? 34 What is the greatest common factor of 76587 and 6321? 147 Calculate the highest common divisor of 235791 and 639. 639 What is the highest common factor of 450 and 300? 150 Calculate the greatest common divisor of 225918 and 294. 42 Calculate the greatest common divisor of 306 and 12726. 18 Calculate the greatest common divisor of 796518 and 323. 323 What is the highest common divisor of 3304 and 381848? 472 What is the greatest common divisor of 20769 and 616749? 903 Calculate the greatest common factor of 4602 and 2298. 6 What is the highest common divisor of 283 and 103? 1 What is the greatest common factor of 55315 and 51129? 299 Calculate the highest common factor of 148 and 40972. 4 What is the greatest common factor of 130312 and 520? 104 Calculate the highest common divisor of 8624 and 441. 49 What is the greatest common factor of 19695 and 520? 65 Calculate the highest common divisor of 2772 and 25938. 198 Calculate the highest common factor of 4725 and 32319. 189 What is the greatest common factor of 71025 and 165? 15 Calculate the greatest common divisor of 11757 and 3. 3 Calculate the greatest common divisor of 96 and 15856. 16 What is the highest common divisor of 45 and 9273? 3 What is the highest common divisor of 25953 and 2532? 633 What is the hi	{ "pile_set_name": "DM Mathematics" }
-4j + 4b. Let g be (-24)/(-10) + j/15. Suppose -t = 3p + 6 + g, p + 3 = 3t. Solve -4n - 2 - 6 = t for n. -2 Let m be 1/4 + (-2)/8. Suppose -3f + 3q = 5q - 9, 2f + 5q = -5. Let g be 3 - ((-4)/2 + f). Solve mz - z = g for z. 0 Let y be (-6)/(-30) - 28/(-10). Solve -6 = yk - 0k for k. -2 Let q(x) = -x3 - 2x*2 + x + 2. Let h be q(-3). Let c = 4 + h. Solve 2v + c = -v for v. -4 Let n(q) be the first derivative of -q*2/2 - 2q + 1. Let z be n(-3). Suppose 0 = -3t + 4 - z. Solve b + 5 - t = 0 for b. -4 Suppose -7n = -3n - 20. Let u(f) = 5f*2 - 1. Let c be u(-1). Solve -11 - c = nb for b. -3 Let j(x) = 10x + 56 - 5x*2 + 4x*2 - 41. Let s be j(11). Solve -2n = -sn for n. 0 Suppose 5f + 15 = 2d - 7d, d + 3f + 9 = 0. Solve d = 5y - 16 + 6 for y. 2 Suppose 0 = -o - 1, -18 = -5d + 2o + 104. Let l = -20 + d. Solve -l = a - 3a for a. 2 Let r be (-450)/(-105) - (-4)/(-14). Let t(s) = -5s - 3. Let d be t(-3). Solve 4f + d = -r for f. -4 Suppose -3g + 15 = s, -4g + 17 = 3s - 3. Suppose 4p - 4l + 0l - 20 = 0, 4p + 4l - 12 = s. Solve pa + 3 = 3a for a. -3 Let h = 57 - 57. Solve h = v + 5 for v. -5 Let y be (-2 - 3 - -8) + 0. Solve -yk = -5k + 6 for k. 3 Let w be -210/5 - -6. Solve -5 = 3j - wj for j. -5 Let c = 9 - 4. Suppose 4i - 11i = -63. Solve cz = -i - 6 for z. -3 Suppose -5g + 100 - 20 = 0. Suppose 2n - 5n = 5f - g, -2f - 3n + 10 = 0. Solve -4y = -fy + 8 for y. -4 Suppose 4i - 16 = -4t, -2t = t - 6. Solve 6 = ip - 0 for p. 3 Let u be 3/66 + -1. Solve -2i + 12 = ui for i. 3 Let g(c) = c - 2. Let o be g(2). Let f(q) = 2q + 6. Let u be f(-6). Let t(r) = r3 + 5r*2 - 6r + 2. Let i be t(u). Solve o = in + 2n for n. 0 Suppose -w - 3w - 20 = 0. Let t(m) = -m2 - 7m - 1. Let z be t(w). Solve -c + 4c - z = 0 for c. 3 Let j(p) be the first derivative of -p4/4 + 2p*3 + p - 1. Let x be j(6). Let n = 4 - x. Solve -6 = 5s - ns for s. -3 Let g = -1 - -1. Let j = -58 + 58. Suppose j = 3c - 3h + 9, g = -c - 0h - h + 3. Solve cn - n = 4 for n. -4 Let m = -6 - -8. Suppose mf = -4 + 10. Suppose c + 0c - f = 0. Solve 0 = 3r + 3 + c for r. -2 Let w(d) = d - 1. Let n be w(-5). Let b(m) = -m - 3. Let s be b(n). Suppose sz = -3, -2u - 5z - 9 = -4u. Solve uv + 11 - 1 = 0 for v. -5 Let a = -10 + 8. Let f be (-138)/(-36) - a/12. Suppose 0 = 2g - 0g - f. Solve u + 3 = gu for u. 3 Suppose -3j = 2b - 10, 5j - j - 18 = 2b. Solve -5a + 29 = j for a. 5 Suppose -40 = -2l - 10. Solve -3a + 3 = l for a. -4 Suppose -11 - 3 = -5h - 3a, -3a + 6 = 3h. Solve 2g - h = g for g. 4 Suppose l + 5z = -21, 0 = -l - l + 4z. Let j = -2 - l. Solve -x - 15 = jx for x. -3 Let w(t) = 10t + 3t2 - t3 + 7t*2 - 2t*2 + 4 - 1. Let k be w(9). Solve -3v + 0v = -k for v. 4 Let z(s) = s3 + 5s*2 + 4s - 1. Let d(k) = k - 7. Let y be d(7). Let o = -3 - y. Let a be z(o). Solve -1 = -4m - a for m. -1 Suppose 3z + l = 11 + 4, 3l - 5 = -z. Suppose -zp + 2p = 0. Let i = 0 - p. Solve i = 3v + 5 + 1 for v. -2 Let c be (8/(-4) - 1) + 8. Solve -g - 3 = -c for g. 2 Let w be 2/(-4) + (-3)/(-2). Let t be w/((-21)/(-9) + -2). Suppose k + 10 = tl, -l - 22 = -2l + 5k. Solve -10 = -lr - 3r for r. 2 Let u be (-17)/((-85)/(-10))(-1 + 0). Solve -2 - u = 4p for p. -1 Suppose 3l + 5 = 161. Let q be (-6)/(-10) - (-301)/(-35). Let u be l/6 + q/12. Solve 2k + 2k = u for k. 2 Suppose -k = -3 + 1. Let c be (-6)/24/6. Let t = c + k. Solve -z - z + 10 = t for z. 5 Let d = -2 - -5. Suppose -g + 5 = 4t - 4g, -dg + 3 = 0. Suppose 0 = v - 4v + 9. Solve -q - v = -tq for q. 3 Let x be (10 + 2)/(30/40). Solve x = 2v + 2v for v. 4 Let f(u) = -2u. Let a(k) = k - 10. Let x be a(9). Let j be f(x). Solve 0 = 3o + 8 - j for o. -2 Let q = -1 + 1. Suppose 3w + qw = 3. Solve i = 3 - w for i. 2 Let j(w) be the first derivative of 5w4/2 - w3/3 + w + 1. Let t(b) = b2. Let f be t(-1). Let n be j(f). Solve 4p + n + 10 = 0 for p. -5 Suppose 2h = -2 + 6. Suppose 6 = 3y, hy + 3y - 14 = -z. Solve -b = -zb + 9 for b. 3 Suppose -2m - 12 = -3l - 2l, 4l = 3m + 11. Suppose 0 = 5b + 5i + 15, lb - 7b + 4i = -12. Solve 3v + v - 20 = b for v. 5 Let c = 2 + -6. Let g = c + 7. Solve -3l + g = 9 for l. -2 Suppose -5w - 4v = -26, -2v + 18 = 3w + 2w. Suppose -m - w = 4g, -g = 3m + 2g - 12. Solve m = u + 2 for u. 4 Suppose -v - 8 = -0v. Let o(t) = t*2 + 8t. Let k be o(v). Solve -m - 1 - 2 = k for m. -3 Let j = -23 - -14. Let x be 0(j/6 + 2). Let q be 3 + (-1 - -2 - 2). Solve q + x = m for m. 2 Suppose 2l = 4w - l - 79, -5l + 7 = 2w. Let m be 12/w - 7/4. Let c = m - -26. Solve c = -2h + 7h for h. 5 Let k(c) = 2c - 2c - 3c + 4c. Let o be k(3). Suppose 3i - u = 8, -i + 5u + o = 19. Solve -w + i = 1 for w. 3 Let n be (-27)/(-36) + 18/8. Let a(m) = -2 - 3 + nm - 1. Let l be a(4). Solve 0 = -2f + l - 4 for f. 1 Let f = -11 - -15. Let k = -1 + f. Suppose -kr = m + 2r + 19, 5m + 11 = -4r. Solve 4h = -13 + m for h. -3 Suppose 5s = 7s - 40. Solve -s = 5t - 9t for t. 5 Let v = 0 + 5. Let c = v + -4. Solve -o - 3 = -c for o. -2 Let y = 6 - 3. Suppose -5j + 3h + 20 = -j, -yj = 5h - 44. Let c = 16 + -9. Solve 3m + j + c = 0 for m. -5 Suppose 3z - 68 = -50. Solve 2 = 2i + z for i. -2 Suppose d = h - 13, -h + 1 = -2d - 7. Solve -13i = -hi for i. 0 Suppose b = -4n - 4b - 37, -27 = 3n + 3b. Let c(h) be the second derivative of h4/12 + h3 - 11h2/2 - h. Let y be c(n). Solve g = 2g + y for g. -5 Suppose -36 = -4s - 0s - 4a, 5s + a - 61 = 0. Suppose i + i - 4 = 0, 2i - s = -3z. Solve 1 = -zu + 4 for u. 1 Let k(h) = -h - 20. Let c be k(-22). Solve co - 1 = -11 for o. -5 Suppose 4g - 2g - 16 = 0. Solve 2x - g = -0 for x. 4 Suppose 0 = -7u + 2u. Suppose n + 9 = -un. Let a = n - -12. Solve 0 = av + 5 + 4 for v. -3 Suppose 17 = 3b - a, -2b - 3b - 4a = -17. Solve 10 = -bd - 5 for d. -3 Let o = -1 + 1. Let r = 9 + o. Solve -3j = -6j - r for j. -3 Let h(n) = 3n2 - 2n*2 - 3 + 1 - 13 + 9n. Let k = 0 - 11. Let d be h(k). Solve -d - 13 = -4g for g. 5 Let r be (-4 - -4)/51. Solve r = 3d - 4d for d. 0 Suppose 5z - g = -0g + 34, -g - 28 = -4z. Solve -3x + z = -x for x. 3 Let c(s) = s*2 - 3. Let y be c(0). Let j be 45/(-5)1/y. Solve -i + ji = 6 for i. 3 Let c(n) = n3 + 12n*2 + 11n. Let r be c(-11). Let m(y) = -y*2 - y + 3. Let u be m(r). Solve 17 + u = 5l for l. 4 Let f be 2 + -11 - (-8)/(-2). Let w = f - -13. Solve 4b = -wb for b. 0 Suppose 3h = -2h - 5g - 25, -3h + 2g = -10. Suppose h = m + 2 - 3. Solve -2z + 5 = m for z. 2 Let b(l) = l + 13. Let h be b(-11). Suppose 9 = 3m - c, 0m = hm + 4c - 6. Solve -mz = 2z + 15 for z. -3 Suppose 0 = 4i - 3i. Let b(z) = -z*2 + z + 1. Let f be b(i). Solve c - f = 2c for c. -1 Let g(s) = 2s2 - s - 3. Let b be g(-3). Suppose bq + 6 = 19q. Solve 2k - q = 4k for k. -3 Suppose -p - 4v = -6 - 7, 0 = 5v - 10. Solve 0 = 11t - 10t + p for t. -5 Suppose -9x + 4x = -2x. Solve x + 1 = -w for w. -1 Suppose -y + 1 = -3. Let p be 4/22 - 4/22. Suppose z - yz = p. Solve z = -2j - 0j - 4 for j. -2 Suppose 2m = -3i - m + 9, -5i - 4m = -15. Solve 5v = -2 - i for v. -1 Let r = -3 + 7. Suppose -3j = 6, -5z = -5j + 15 - 40. Suppose 5 = -5o - zl + 28, 5l = 2o - 3. Solve -ra - o = 8 for a. -3 Let i be (0 - 12/21)(-14)/4. Suppose 0 = -a - q - 1, 4 = -a - 0a - 2q. Let k be (-2)/a + 0 + 2. Solve -ib + 11 = k for b. 5 Suppose -5g + 9 = -6. Suppose 1 = -2q + g. Solve q = -3b - 5 for b. -2 Let b be (1 + -1)/2 - -8. Let h be (-4)/6 - (-34)/6. Suppose -hx + b = -x. Solve 0w + x = w for w. 2 Let l(s) be the second derivative of s3/3 - 6s*2 - s. Let t be l(8). Let h = -2 + 5. Solve -hc = -tc + 5 for c. 5 Suppose 0 = -3l - 2l + 6l. Solve l = -c - 3 for c. -3 Let g(f) = -f*3 - 9f*2 + 11f + 10. Let w(l) = -9l2 - 1. Let z be w(1). Let r be g(z). Solve rj + 3j = 0 for j. 0 Let j = -39 + 26. Let y = j - -18. Suppose 2h - 4 = yv, v + 6 = -4v + 3h. Solve -5k + vk - 5 = 0 for k. -1 Suppose 5 = 4o + 2b - 29, -o - b = -11. Solve 3t = 6t + o for t. -2 Let q be (-10)/(-1)(-4)/(-10). Suppose qw + 5 = 25. Solve w = -2z + z for z. -5 Suppose 6m = 7m. Solve m	{ "pile_set_name": "DM Mathematics" }
ed by 562. 444 Calculate the remainder when 3787 is divided by 1127. 406 Calculate the remainder when 8486 is divided by 354. 344 Calculate the remainder when 19573 is divided by 4878. 61 Calculate the remainder when 8981 is divided by 44. 5 Calculate the remainder when 15689 is divided by 475. 14 Calculate the remainder when 60121 is divided by 6012. 1 What is the remainder when 22427 is divided by 3736? 11 What is the remainder when 1430 is divided by 546? 338 Calculate the remainder when 10365 is divided by 57. 48 What is the remainder when 19408 is divided by 9699? 10 What is the remainder when 1359 is divided by 784? 575 What is the remainder when 158161 is divided by 15814? 21 Calculate the remainder when 1020314 is divided by 280. 274 Calculate the remainder when 48175 is divided by 365. 360 Calculate the remainder when 1543231 is divided by 308644. 11 What is the remainder when 10414 is divided by 93? 91 Calculate the remainder when 745350 is divided by 119. 53 What is the remainder when 804 is divided by 650? 154 What is the remainder when 10824 is divided by 95? 89 Calculate the remainder when 252882 is divided by 733. 730 What is the remainder when 2121 is divided by 53? 1 Calculate the remainder when 6983 is divided by 6922. 61 What is the remainder when 467 is divided by 446? 21 Calculate the remainder when 8013 is divided by 802. 795 What is the remainder when 14858 is divided by 1242? 1196 Calculate the remainder when 36660 is divided by 1927. 47 Calculate the remainder when 507777 is divided by 182. 179 Calculate the remainder when 3924 is divided by 503. 403 What is the remainder when 142314 is divided by 2? 0 What is the remainder when 15519 is divided by 118? 61 Calculate the remainder when 27988 is divided by 55. 48 What is the remainder when 9219 is divided by 412? 155 What is the remainder when 57535 is divided by 58? 57 What is the remainder when 3337 is divided by 356? 133 Calculate the remainder when 28133 is divided by 218. 11 What is the remainder when 419848 is divided by 150? 148 Calculate the remainder when 3159 is divided by 626. 29 What is the remainder when 12872 is divided by 8? 0 What is the remainder when 32743 is divided by 166? 41 Calculate the remainder when 733753 is divided by 7. 6 What is the remainder when 932926 is divided by 32? 30 Calculate the remainder when 11936 is divided by 1190. 36 Calculate the remainder when 81042 is divided by 14. 10 What is the remainder when 3279176 is divided by 155? 151 Calculate the remainder when 500587 is divided by 50057. 17 Calculate the remainder when 67088 is divided by 16766. 24 Calculate the remainder when 6848 is divided by 67. 14 What is the remainder when 80816 is divided by 341? 340 What is the remainder when 8977 is divided by 1227? 388 Calculate the remainder when 14687 is divided by 41. 9 What is the remainder when 315475 is divided by 44? 39 Calculate the remainder when 13783 is divided by 1067. 979 Calculate the remainder when 4712 is divided by 670. 22 Calculate the remainder when 1448549 is divided by 870. 869 Calculate the remainder when 57097 is divided by 163. 47 What is the remainder when 2285 is divided by 56? 45 What is the remainder when 2290 is divided by 2276? 14 Calculate the remainder when 8032 is divided by 619. 604 What is the remainder when 2765 is divided by 983? 799 Calculate the remainder when 46785 is divided by 167. 25 What is the remainder when 50901 is divided by 25436? 29 Calculate the remainder when 7390 is divided by 133. 75 What is the remainder when 256621 is divided by 5578? 33 What is the remainder when 70688 is divided by 30? 8 What is the remainder when 3336 is divided by 3329? 7 What is the remainder when 537 is divided by 120? 57 Calculate the remainder when 5269 is divided by 798. 481 Calculate the remainder when 12797944 is divided by 54. 52 What is the remainder when 21938 is divided by 203? 14 Calculate the remainder when 1743 is divided by 938. 805 Calculate the remainder when 55555 is divided by 1157. 19 What is the remainder when 12669 is divided by 6313? 43 What is the remainder when 1035 is divided by 87? 78 What is the remainder when 83154 is divided by 9? 3 Calculate the remainder when 1074 is divided by 355. 9 Calculate the remainder when 560 is divided by 258. 44 What is the remainder when 18452 is divided by 160? 52 What is the remainder when 209259 is divided by 142? 93 Calculate the remainder when 9862 is divided by 754. 60 What is the remainder when 3435035 is divided by 11? 10 What is the remainder when 146077 is divided by 589? 5 Calculate the remainder when 32511 is divided by 759. 633 What is the remainder when 32300 is divided by 109? 36 What is the remainder when 32440 is divided by 315? 310 Calculate the remainder when 2026 is divided by 159. 118 What is the remainder when 20600 is divided by 20580? 20 Calculate the remainder when 2226 is divided by 72. 66 Calculate the remainder when 49494 is divided by 44. 38 Calculate the remainder when 3950 is divided by 592. 398 Calculate the remainder when 51125 is divided by 86. 41 What is the remainder when 225 is divided by 199? 26 What is the remainder when 6813 is divided by 87? 27 What is the remainder when 4896 is divided by 16? 0 Calculate the remainder when 5393 is divided by 71. 68 Calculate the remainder when 10577 is divided by 1511. 0 Calculate the remainder when 799 is divided by 159. 4 What is the remainder when 1815 is divided by 876? 63 What is the remainder when 3241795 is divided by 239? 238 Calculate the remainder when 1546424 is divided by 331. 323 Calculate the remainder when 3576 is divided by 949. 729 What is the remainder when 20625 is divided by 2740? 1445 Calculate the remainder when 17771 is divided by 495. 446 What is the remainder when 7098 is divided by 296? 290 What is the remainder when 2234 is divided by 374? 364 Calculate the remainder when 145529 is divided by 145496. 33 Calculate the remainder when 43886 is divided by 1185. 41 What is the remainder when 189929 is divided by 103? 100 Calculate the remainder when 20533 is divided by 1465. 23 What is the remainder when 294 is divided by 69? 18 Calculate the remainder when 1618872 is divided by 30. 12 Calculate the remainder when 953 is divided by 220. 73 What is the remainder when 3533 is divided by 962? 647 What is the remainder when 110306 is divided by 46? 44 What is the remainder when 2233 is divided by 40? 33 Calculate the remainder when 13890 is divided by 979. 184 Calculate the remainder when 328795 is divided by 13. 12 Calculate the remainder when 11531 is divided by 42. 23 Calculate the remainder when 1234 is divided by 382. 88 What is the remainder when 1669 is divided by 458? 295 What is the remainder when 5388 is divided by 1102? 980 Calculate the remainder when 2152 is divided by 655. 187 What is the remainder when 2111 is divided by 91? 18 Calculate the remainder when 1615809 is divided by 22. 19 What is the remainder when 66408 is divided by 11065? 18 Calculate the remainder when 818368 is divided by 189. 187 Calculate the remainder when 84342 is divided by 27. 21 What is the remainder when 11803 is divided by 3934? 1 Calculate the remainder when 1820 is divided by 366. 356 Calculate the remainder when 328177 is divided by 10. 7 Calculate the remainder when 18121 is divided by 727. 673 What is the remainder when 10947 is divided by 1344? 195 What is the remainder when 165 is divided by 57? 51 Calculate the remainder when 517546 is divided by 26. 16 What is the remainder when 4677 is divided by 1551? 24 What is the remainder when 16697 is divided by 64? 57 Calculate the remainder when 2698 is divided by 899. 1 Calculate the remainder when 2211 is divided by 2128. 83 Calculate the remainder when 33126 is divided by 101. 99 Calculate the remainder when 82280 is divided by 2. 0 Calculate the remainder when 882254 is divided by 882233. 21 Calculate the remainder when 3120 is divided by 174. 162 What is the remainder when 42389 is divided by 4? 1 Calculate the remainder when 48915 is divided by 494. 9 Calculate the remainder when 8031 is divided by 52. 23 What is the remainder when 386899 is divided by 1697? 1680 What is the remainder when 5871 is divided by	{ "pile_set_name": "DM Mathematics" }
2/3))(-1/3))(-8)(j/j0)10/(j(4/5)/jj(-2/7)) assuming j is positive. j(3863/315) Simplify (((b/((b/(b/b*5))/b)b)/(b(2/7)/b))/(b(-4)b(-1/4)))/((bb(2/3))27)(1/24) assuming b is positive. b(61/56) Simplify (l*9l(-2/27))(-4/9)/((l1)(-39)(l/(ll/l*1)l)(-13)) assuming l is positive. l(11672/243) Simplify (b/(bb(-1/4)))39b*(3/7)/b(b*(-3)/bb)/b(bb/((bb(4/7))/b)b(1/9))43 assuming b is positive. b*(17989/252) Simplify ((zzzz*(-14)z)/(z*(-6/7)z)z10/(zz*(-6)z))(-12) assuming z is positive. z(-324/7) Simplify ((w*(2/5)w(1/7))/(w(3/2)ww(-1/4)))/(w(-8)/(ww/w2w)ww/w*(-2/3)w(-8/7)) assuming w is positive. w(2423/420) Simplify ((u22)10u/(((u/(u/(u(-1/8)/u)))/u)/u)u(u(-1/7)/u)/uu)(-6/37) assuming u is positive. u(-1017/28) Simplify (u*(2/7)u4)/((u/(u/u(-1/4)))/(u*1/uu))(u(-1)uuu(-3/2))/(u(1/5)/u(-7)) assuming u is positive. u(-303/140) Simplify (((u*5uu(5/7)/u)/(u(2/23)/(u/((u/u(-8)uu)/u))))0)(-6) assuming u is positive. 1 Simplify (mm0)(-33)(m/(m/((m/(mmm0))/m)))(-20)((m0)24)(6/23) assuming m is positive. m7 Simplify (((xx(-1/4))/x)43)(-1/4)/((x1)40/((x(x/x(2/3))/x)/(x(-2/3)x))) assuming x is positive. x(-597/16) Simplify ((oo*(-1/4)o*(3/4))/(o/((oo*(-2/15)/o)/o)oo(2/21)o))/((o*3/o)/ooo(-9)o)15 assuming o is positive. o(6109/70) Simplify (((i(-1/13)/i)/i)/i(-2/13)i(-21)ii(-34))(2/31) assuming i is positive. i(-1454/403) Simplify ((u(-3)u*1)/((uuuu/(u/(u*23u))uuuu)/uuu/(uu/(uu(-2/73)))))(-1/11) assuming u is positive. u(2407/803) Simplify (h(4/7)/(h/h(-2)))(-2/51)(((((h/h8)/h)/h)/hh)/(h/((h/h*(-4)h)/h)))(-6) assuming h is positive. h(632/21) Simplify (((n*(-1)nn)/(n/(nn*8)))/(n(n(n(-2)n)/n)/n)(-3/32))/((n3n(-1/9)/n)/(n6/((n/(n(-4/3)/n)n)/n))) assuming n is positive. n*(2789/288) Simplify (((mm*(-1))/m)/mm/(m/m*(2/9)m))/((m/((mm0)/m)m)/m)*(-5)(mmm*(6/11)mm7)(-2/45) assuming m is positive. m(868/495) Simplify ((q/q(-2/3))(14/3)/(q(-1))30)/((q(-3/2)qq(-1/2))/(qq(1/3))(-5/12)) assuming q is positive. q*(344/9) Simplify (ww*(-6)/w(w/(w/(w*(-1/3)w))ww)/w)*2((w/((w/(w/(w*1/w)))/w))/(ww(-3/7)))(-15/4) assuming w is positive. w(-589/42) Simplify (g0(((g/(g5g))/g)/g)/g)*24(g(1/2)/g)(-4/31)/(gg/(g/g1)g)(-4/9) assuming g is positive. g(-17726/93) Simplify (d*(-1)d)*34/(dd*1dd)0((dd/d3d)/dddd(1/4)/dd)/((d/d(-1/4))/d(-7)) assuming d is positive. d(-7) Simplify ((((g(-1/4)g)/(g1g))/(g(5/3)/g(-5)))(-1/4))(-16/5) assuming g is positive. g(-19/3) Simplify p4/p*(-7)(p0)6(p(ppp(1/6))/p)/p(-3)pp*(2/3)p(-2/9) assuming p is positive. p(317/18) Simplify rr/(rr*(-6)r)rr*(-2/31)(r(-10/7))(-40) assuming r is positive. r*(13905/217) Simplify (x/(xx*(2/5)xxx))/xx0/xx/(x*(-1/5)x)x/(x/(x(1/5)/x))((x(xxx1)/xx)(-8/7))33 assuming x is positive. x(-1098/7) Simplify ((((m(2/3)m)(1/21))(1/5))(-1/6))(-19) assuming m is positive. m(19/378) Simplify (uu/((u*(2/3)/u)/u)u(-4))(1/20)(u(2/5)uu)(1/16)/(u(-1))(-2/17) assuming u is positive. u(-1/1020) Simplify ((r(-1/2))37((r/r*(-4)r)/r)/(r(r/(r/(r(1/3)/r))r)/rrr))/((r(-2/7))(-2/7)(r0)(-2/3)) assuming r is positive. r(-4679/294) Simplify (p/(p(p(pp*(-2/17)pp)/pp)/p)p)(-2/11)((pp(-11)/p)/pp)/(p/(p*(-15/7)p)) assuming p is positive. p(-16756/1309) Simplify (b/b14(bbbb/b(9/5))/b)(1/7)b(-4)bb(-8)b*(-1/5)/(b(b*0b)/b) assuming b is positive. b(-486/35) Simplify ((f5/f*(-2/27)(f*(1/12)f)/f(-2/15))42)(9/2) assuming f is positive. f(23779/20) Simplify ((((j(-1))(-18/11))(3/41))(-2/11))37 assuming j is positive. j(-3996/4961) Simplify (((xx/(xx*0x))/xx)(-50/7))(-37)/((xx*(-2/13)x/((x/x*3x)/x)x)/(xx*(3/5)/xx(xxx(-4))/x)) assuming x is positive. x(-406/65) Simplify ((zz(-10))/z(3/5))*(-1/13)((zz(-3)/z)32)(3/4) assuming z is positive. z(-4632/65) Simplify ((rr/(rr(-2/13)))/(rrrr1))(-3)/((r(-2))41r(-1/3)rr/r4r) assuming r is positive. r(3583/39) Simplify f(2/7)/f*1(f(-1/4))(-3/49)(fff(3/5)f(-7))/(f(2/3)/((f/f6)/f)) assuming f is positive. f(-34591/2940) Simplify (l/(l*(11/5)/l)l/l(2/61))/(l16/(ll(-19)l)) assuming l is positive. l*(-9831/305) Simplify (sss(3/14))(2/3)/(s/((ss/((ss(-4))/s))/s)s10) assuming s is positive. s(-95/21) Simplify ((f37)(4/9)f1f/(f*(5/4)f))(-3) assuming f is positive. f(-583/12) Simplify ((((c/c*(-19))/cc(-4/7))(-1))(6/7))(-2/17) assuming c is positive. c*(1548/833) Simplify ((mm(-4/7))(-2/13)(mm/(m*(-1/3)m))(-3/32))37 assuming m is positive. m(-5143/728) Simplify ((g/(g(-1)/g))(2/59))(-6/5)/((gg1)(1/8)/((gg*5ggg)/g(-2/17))) assuming g is positive. g(175437/20060) Simplify ((w*(6/5)w/(www*(-23)/ww))/(w(-2/13)/w(-6)))(1/53) assuming w is positive. w(1128/3445) Simplify (((kkkk5)/k1)/(kkk1kk)(-7/5))/((k/(kk*0/kk))*34(k0/k)(-34)) assuming k is positive. k(-20) Simplify (((l(-1/4)l)(-19)l*(-7/3)/((l/(l/(l/(llll0))))/l))(6/25))18 assuming l is positive. l(-1467/25) Simplify ((h((h/(hhhh/h(-5)))/h)/h)/(h/(h3/h)))31/((h(-2/17)/h(-3/5))/(h(-4/5)/h(-1/7))) assuming h is positive. h(-148238/595) Simplify ((gg/(gg*(-2/5))g)/(g/g*(-1/3))(g(-1))34)/((g*1g)24/(g(1/6)/((g/g*(1/3))/gg))) assuming g is positive. g(-2443/30) Simplify u2u(1/7)uu(2/25)/uuuu/(u*(2/23)/u)uu(-1)uu0((u(u/(u/u(-2)))/u)/u)(-2/49) assuming u is positive. u(204504/28175) Simplify ((k(4/3)/k)/(k/(kkk/(kk*(-3/10)kk)k)))*(5/3)(k/((k/((k*2k)/k))/kk))(-29)(k/k(-1))(-13) assuming k is positive. k(-1493/18) Simplify (d9/(ddddd/d*(-9)d))30/(d/d0d/d(8/5))(2/9) assuming d is positive. d(-8104/45) Simplify ((t(-2))(-1/58))(-7)((t/t(-2/3))(2/3))(-8) assuming t is positive. t(-2383/261) Simplify (r/(r(r(-13)/r)/rr)r(4/5)rr(-21)r(r/(rrr/(r/(r(-11)/r)r)))/r)(-4/17) assuming r is positive. r(-8/5) Simplify (i(-3)/(i(-2/137)/i))/(i11/i(-38)) assuming i is positive. i(-6985/137) Simplify ((((x(-2/17)x)(-3/16))(-36))(-39))(2/77) assuming x is positive. x(-15795/2618) Simplify ((b(-3)/b)/b)(-42)(b/(b/b(-28)))(-1/61) assuming b is positive. b(12838/61) Simplify (((f21/(f(2/165)/f))(-43))(11/7))(-17) assuming f is positive. f(2652068/105) Simplify ((d(-5/3)(dd/d3)/d)/(d(-2/13))6)(1/23) assuming d is positive. d(-107/897) Simplify ((t/(t(-4)/t))/t8)/(t(1/8)((tt*(4/7))/t)/t)((t/(t*(-1/3)tt))/t)(-2/7)/((((t6/t)/t)/t)/(t/t(-5/2))) assuming t is positive. t(-121/168) Simplify ((zz/(zzz*3z))/z5)(15/7)/((zz(-1/3)/zz)*(-1/5)zz(-2/7)z(-1/5)) assuming z is positive. z(-59/3) Simplify (ll(-2/51)l*(2/35))/((ll/(l/(ll(-7/6)l))lll)/l(-2)) assuming l is positive. l(-20761/3570) Simplify ((a/a(1/8))/aaa6/aa)50/(a/(a/((a(2/5)/a)/a))a/(a/(a(1/2)/a))a*(-1/3)(aaa*(-4/5)/aa)/a) assuming a is positive. a*(20759/60) Simplify (((r/(r/(rrr8/r)))(1/4))33)49 assuming r is positive. r(14553/4) Simplify (t5t(-2/11))(-33)(tt/(t/((t/(t/((t*(-1/4)t)/tt))t)/t))tt)*(17/3)((ttt(-6))/t)/(t/t(4/7)) assuming t is positive. t*(-4009/28) Simplify ((((j(j(jjj2)/j)/j)/j)/j)/(j/(j(-14)/jj))(j/(j/(jj*0j)))(1/30))(-43) assuming j is positive. j*(8342/15) Simplify (((pp/(pp/(p(1/3)pp)p)ppp)/p)/((p/(p(-2/13)p))/pp)p/(p*(-2)/p)pp7)(-1/7) assuming p is positive. p(-592/273) Simplify (jj*13j*(-2/17)j(j/(j/((j/j(-2/5))/j)))/(j4jj))4 assuming j is positive. j(3156/85) Simplify ((l/l(-1))(-5/4))(4/11)(l*0l)*31/((ll(-2/7))/l3) assuming l is	{ "pile_set_name": "DM Mathematics" }
term of 2610, 2595, 2580, 2565, 2550, 2535? -15q + 2625 What is the f'th term of -6987, -7005, -7023? -18f - 6969 What is the c'th term of 624557, 624559, 624561, 624563, 624565? 2c + 624555 What is the l'th term of -227, -915, -2063, -3671, -5739, -8267? -230l*2 + 2l + 1 What is the a'th term of -7172868, -7172867, -7172866, -7172865, -7172864? a - 7172869 What is the u'th term of 284, 290, 302, 320, 344? 3u2 - 3u + 284 What is the t'th term of 7909, 62802, 211789, 501916, 980229, 1693774, 2689597? 7841t3 + t2 + 3t + 64 What is the b'th term of 241, -12, -425, -992, -1707? b*3 - 86b*2 - 2b + 328 What is the v'th term of 1460, 3087, 4714? 1627v - 167 What is the k'th term of 91788, 367154, 826098, 1468620, 2294720, 3304398? 91789k*2 - k What is the l'th term of -163, -315, -475, -655, -867? -2l*3 + 8l*2 - 162l - 7 What is the a'th term of -2787, -2917, -3047, -3177, -3307? -130a - 2657 What is the a'th term of -2491, -2608, -2801, -3070, -3415, -3836? -38a*2 - 3a - 2450 What is the l'th term of -6819, -7446, -8073, -8700? -627l - 6192 What is the u'th term of -115, -420, -911, -1582, -2427, -3440, -4615? u3 - 99u*2 - 15u - 2 What is the l'th term of 5859, 5738, 5401, 4740, 3647, 2014, -267? -18l3 + 5l + 5872 What is the y'th term of 518474, 518477, 518480, 518483, 518486, 518489? 3y + 518471 What is the i'th term of -2378, -9521, -21416, -38057, -59438, -85553, -116396? i3 - 2382i*2 - 4i + 7 What is the n'th term of -388, -680, -998, -1348, -1736, -2168, -2650? -n*3 - 7n*2 - 264n - 116 What is the l'th term of 2413, 4854, 7295, 9736, 12177, 14618? 2441l - 28 What is the g'th term of -186, 234, 1270, 2928, 5214, 8134, 11694, 15900? g3 + 302g*2 - 493g + 4 What is the i'th term of 170, 298, 430, 566? 2i2 + 122i + 46 What is the v'th term of 1165, 4672, 10507, 18664, 29137, 41920? -v*3 + 1170v*2 + 4v - 8 What is the l'th term of 2370, 4761, 7160, 9573, 12006? l*3 - 2l*2 + 2390l - 19 What is the o'th term of -2503, -2502, -2501, -2500, -2499, -2498? o - 2504 What is the b'th term of -837, -806, -777, -750, -725? -b*2 + 34b - 870 What is the s'th term of 2356, 4663, 6970? 2307s + 49 What is the v'th term of 6474, 6455, 6436? -19v + 6493 What is the k'th term of -3475, -6459, -9447, -12439, -15435? -2k2 - 2978k - 495 What is the s'th term of 1267, 1270, 1271, 1270, 1267, 1262, 1255? -s*2 + 6s + 1262 What is the n'th term of 858, 3363, 7426, 12957, 19866? -15n3 + 869n*2 + 3n + 1 What is the a'th term of 140, 270, 488, 794, 1188, 1670? 44a2 - 2a + 98 What is the s'th term of -3439, -3449, -3469, -3499, -3539, -3589? -5s2 + 5s - 3439 What is the m'th term of -288619, -288604, -288573, -288520, -288439? m*3 + 2m*2 + 2m - 288624 What is the i'th term of -923, -1856, -2795, -3740? -3i2 - 924i + 4 What is the j'th term of -124, -359, -734, -1231, -1832, -2519, -3274, -4079? 3j3 - 88j*2 + 8j - 47 What is the x'th term of -1150, -9204, -31066, -73642, -143838, -248560? -1151x3 + 2x*2 - 3x + 2 What is the u'th term of 284, 1356, 3142, 5642, 8856? 357u2 + u - 74 What is the p'th term of 6103, 12408, 18709, 25006, 31299, 37588? -2p*2 + 6311p - 206 What is the u'th term of 3618, 7250, 10884, 14520? u*2 + 3629u - 12 What is the c'th term of -2210, -4461, -6710, -8957, -11202, -13445, -15686? c*2 - 2254c + 43 What is the r'th term of 239, 223, 193, 149? -7r2 + 5r + 241 What is the a'th term of -744, -742, -740? 2a - 746 What is the n'th term of -2072, -1872, -1672, -1472, -1272? 200n - 2272 What is the u'th term of 2479, 5020, 7561? 2541u - 62 What is the g'th term of -3511, -7062, -10613, -14164? -3551g + 40 What is the k'th term of 49980, 399864, 1349546, 3198924, 6247896, 10796360, 17144214, 25591356? 49983k3 + k2 - 4 What is the o'th term of 3679, 7820, 11961, 16102, 20243? 4141o - 462 What is the y'th term of 127, 491, 1075, 1861, 2831, 3967, 5251, 6665? -3y3 + 128y2 + y + 1 What is the p'th term of -477085, -477086, -477087, -477088? -p - 477084 What is the z'th term of 123, 565, 1323, 2391, 3763, 5433, 7395? -z3 + 164z2 - 43z + 3 What is the k'th term of 5609, 11463, 17317, 23171? 5854k - 245 What is the s'th term of -490, -343, -100, 239, 674? 48s*2 + 3s - 541 What is the i'th term of -301, -753, -1483, -2629, -4329, -6721, -9943? -23i3 - i2 - 288i + 11 What is the n'th term of -31211, -31208, -31207, -31208, -31211, -31216? -n*2 + 6n - 31216 What is the q'th term of -1626, -3108, -4442, -5622, -6642, -7496? q*3 + 68q*2 - 1693q - 2 What is the u'th term of 9371, 37455, 84259, 149777, 234003? -u*3 + 9366u*2 - 7u + 13 What is the n'th term of -1011, -1568, -2187, -2874, -3635, -4476? -n*3 - 25n*2 - 475n - 510 What is the t'th term of -69, -164, -323, -546, -833, -1184? -32t2 + t - 38 What is the y'th term of 4820, 5152, 5706, 6482, 7480, 8700? 111y2 - y + 4710 What is the r'th term of -373, -824, -1273, -1720, -2165, -2608? r2 - 454r + 80 What is the t'th term of -172673, -345342, -518011, -690680? -172669t - 4 What is the j'th term of -6335, -25318, -56955, -101246, -158191, -227790, -310043? -6327j2 - 2j - 6 What is the m'th term of 156, 341, 512, 663, 788, 881, 936, 947? -m3 - m2 + 195m - 37 What is the u'th term of 232, 631, 1294, 2221, 3412, 4867, 6586? 132u*2 + 3u + 97 What is the n'th term of 621, 2465, 5535, 9825, 15329, 22041, 29955? -n*3 + 619n*2 - 6n + 9 What is the s'th term of 53, 106, 159? 53s What is the w'th term of 843, 859, 885, 921, 967, 1023? 5w2 + w + 837 What is the j'th term of -9745, -9727, -9705, -9685, -9673, -9675, -9697? -j3 + 8j2 + j - 9753 What is the k'th term of -4700, -18673, -41916, -74429? -4635k*2 - 68k + 3 What is the c'th term of 37, 102, 215, 394, 657, 1022, 1507? 3c3 + 6c*2 + 26c + 2 What is the f'th term of 8590, 8834, 9080, 9328, 9578? f*2 + 241f + 8348 What is the b'th term of -216348, -216345, -216342, -216339, -216336? 3b - 216351 What is the m'th term of 875, 705, 433, 59, -417? -51m*2 - 17m + 943 What is the c'th term of -52090, -52086, -52082, -52078? 4c - 52094 What is the y'th term of -25137, -50262, -75387, -100512? -25125y - 12 What is the p'th term of -2990, -5989, -9002, -12041, -15118, -18245, -21434? -2p3 + 5p*2 - 3000p + 7 What is the q'th term of 750, 766, 792, 828, 874? 5q2 + q + 744 What is the v'th term of -8, -17, -60, -161, -344? -4v*3 + 7v*2 - 2v - 9 What is the u'th term of 94801, 189672, 284543? 94871u - 70 What is the q'th term of 3564, 3403, 3242, 3075, 2896, 2699? -q3 + 6q*2 - 172q + 3731 What is the u'th term of 4709, 4718, 4727, 4730, 4721, 4694, 4643? -u*3 + 6u*2 - 2u + 4706 What is the p'th term of 16950, 33909, 50874, 67845, 84822, 101805, 118794? 3p2 + 16950p - 3 What is the g'th term of -744, -2980, -6688, -11856, -18472, -26524, -36000? 2g3 - 748g*2 - 6g + 8 What is the n'th term of -11429, -45713, -102853, -182849, -285701, -411409? -11428n2 - 1 What is the b'th term of -911, -7106, -23871, -56492, -110255, -190446, -302351? -881b3 + b2 - 31b What is the s'th term of -14918, -29838, -44758, -59678, -74598, -89518? -14920s + 2 What is the l'th term of -5444, -5437, -5420, -5387, -5332, -5249, -5132, -4975? l3 - l2 + 3l - 5447 What is the v'th term of -169, -383, -739, -1237, -1877, -2659? -71v*2 - v - 97 What is the x'th term of 11732, 11739, 11752, 11771, 11796, 11827? 3x*2 - 2x + 11731 What is the u'th term of -3183345, -3183346, -3183345, -3183342, -3183337? u*2 - 4u - 3183342 What is the z'th term of 1321, 1290, 1223, 1114, 957, 746, 475? -z*3 - 12z*2 + 12z + 1322 What is the z'th term of -772, -756, -740? 16z - 788 What is the d'th term of -28655, -28653, -28651, -28649, -28647? 2d - 28657 What is the w'th term of -74226, -148455, -222684? -74229w + 3 What is the c'th term of -9629, -9393, -8759, -7529, -5505, -2489? 33c3 + c2 + 2c - 9665 What is the p'th term of -266, -212, -124, -2, 154, 344, 568? 17p*2 + 3p - 286 What is the j'th term of 18, -80, -204, -360, -554, -792? -j*3 - 7j*2 - 70j + 96 What is the i'th term of 1893, 7511, 16855, 29925, 46721, 67243, 91491? 1863i*2	{ "pile_set_name": "DM Mathematics" }
b - 16, p - 2b = 8. What are the prime factors of f(p)? 2 Let s(n) = -n*2 + 5n + 4. What are the prime factors of s(5)? 2 Suppose -400 = 7j - 9j. List the prime factors of j. 2, 5 Suppose 11b - 10b = 16. List the prime factors of b. 2 Let n be 0/(4/1)-1. Let d be (-2)/((-1)/(0 + 1)). What are the prime factors of (d - n - 1)12? 2, 3 Let v(x) = -x - 5. Let d be v(0). Let m be (d + 3)(-22)/(-4). Let h = -1 - m. What are the prime factors of h? 2, 5 Suppose -5w = -3w - 3i - 171, i + 434 = 5w. List the prime factors of w. 3, 29 Let y be (-3)/(-15) + (-372)/(-15). Let j = 0 - 0. Suppose -z = -4n - 14, j = 3z + 4n - y - 17. What are the prime factors of z? 2, 7 Let l(i) = i*2 + 9i - 2. List the prime factors of l(4). 2, 5 What are the prime factors of 12/((-6)/(-2)) - -134? 2, 3, 23 Suppose -3r - 366 = -3a, -3r = -7a + 2a + 610. List the prime factors of a. 2, 61 Let q = 8 + -3. Let v(s) = q + 3s - 2s + 9. What are the prime factors of v(0)? 2, 7 Let r(w) = -w3 + w2 + w + 1. Let m(q) = 7q*2 - 2q + 5. Let z(p) = m(p) - r(p). List the prime factors of z(-3). 2, 5 Let p(u) = -4u + 3. Let g be p(2). Let x(m) = -m2 - 8m - 6. List the prime factors of x(g). 3 Suppose -18 = -3f - 2r, 4f - 19 = -2r + 7. Let u(a) = a2 - a + 1. Let q be u(2). List the prime factors of 82/f - q/12. 2, 5 What are the prime factors of (-10626)/(-99) + ((-4)/3 - 0)? 2, 53 List the prime factors of ((-5)/((-20)/168))/1. 2, 3, 7 Let q(c) = -c3 + 13c2 - 9c + 4. What are the prime factors of q(10)? 2, 107 Let x = 86 + -46. List the prime factors of x. 2, 5 Let j = 64 - 116. Let i = -28 - j. Suppose -4u + 4x + i = 0, 2x - 39 = -4u + 3x. List the prime factors of u. 11 Let b = -25 - -24. List the prime factors of -6 - -6 - (-45 - b). 2, 11 Let q = -3 - 6. Let x = q - 4. What are the prime factors of (-1 - x/7)7? 2, 3 Let n(s) = s + 5. Suppose -h - 8 = -2c, 5 = h + 3c - 7. List the prime factors of n(h). 5 Let u = 15 - 7. Let p = -4 + u. What are the prime factors of p? 2 Let f(t) = t*3 - 3t*2 - 3t - 1. What are the prime factors of f(5)? 2, 17 Let a be (-7)/14 + (-6)/(-4). Let u = a - -3. Suppose 3r + z - 51 = uz, -2r + 3z = -36. List the prime factors of r. 3, 5 Let o be 1-1 - (-7 - -6). Suppose -3r = -or. Let q(n) = n + 4. List the prime factors of q(r). 2 Suppose a - j = 173 + 26, -4a - 5j = -769. List the prime factors of a. 2, 7 Let m = 10 - 12. Let t(z) = -4z3 + z2 + 2z + 1. List the prime factors of t(m). 3, 11 Suppose 4g - 217 = -g + 3m, -4g = -5m - 184. List the prime factors of g. 41 Suppose -3y = 3, 2f - 3f + 9 = -y. What are the prime factors of f? 2 Suppose 4i - 12 = -4. Suppose -4m - a + 131 = 36, 2m + ia - 40 = 0. List the prime factors of m. 5 Let q = -175 + 336. What are the prime factors of q? 7, 23 Suppose r + z - 1 = 5z, -2r = 4z + 22. Let t = r - -12. Suppose j + 12 = tj. List the prime factors of j. 3 List the prime factors of (-26)/(-39) + 80/6. 2, 7 Let b be -4(3/2 - 2). Suppose 4t = -t + 2a + 63, -bt - a = -27. What are the prime factors of t? 13 Let r = 179 + -138. List the prime factors of r. 41 Let m be (-1)/210 - -1. Let c = 5 - m. List the prime factors of c. 3 Let o = 5 - 3. Let c = -31 - -43. Suppose -4a + c = 0, -3u = ou - 5a - 40. List the prime factors of u. 11 Suppose 0 = 5g + 5x - 110, -4g = -2x - 44 - 74. Let j = -19 + g. Let u = j - 4. List the prime factors of u. 2 Let j(v) = 4 + 4v - 3v - 2 + 1. What are the prime factors of j(6)? 3 Suppose -c + 7 = 2. Suppose -7 = -cp + 13. List the prime factors of p. 2 Let u be (3 + 33/(-9))-3. Let h(c) = 3c - 3. Let y be h(u). Suppose 24 + 0 = yg. What are the prime factors of g? 2 Let x = 4 + -1. Suppose xa - 21 = -0a. What are the prime factors of a? 7 Let f = -50 - -91. List the prime factors of f. 41 Suppose -67 = -4r + 21. List the prime factors of (r - (3 + -6)) + 3. 2, 7 Suppose 4v - 3q = 34, -4v + 2q + 22 = 5q. Suppose 0 = 2m - 3 - v. Suppose 4i - 86 = -mr, 3 = -3r + 9. What are the prime factors of i? 19 Let j(f) be the first derivative of 1/3f*3 - f - 2 + 0f*2 - 2f*4. List the prime factors of j(-1). 2 Let b = 5 + -10. Let h = -1 + 14. Let c = b + h. List the prime factors of c. 2 Let v be -23/(-2) + 0. Suppose -vb + 6 = -b. Suppose d = 2x + bx + 37, -2x + 2 = d. What are the prime factors of d? 2, 3 Let q(m) = -2m2 + m + 3. Let v be q(3). Let y = v + 24. Suppose -y = -5u - 2f + 23, 4u + 3f = 21. What are the prime factors of u? 3 Suppose 5q - k = -233, 2q + 2k + 102 = -2k. Let p = 78 + q. What are the prime factors of p? 31 Suppose 4y = -0y. Suppose -j + 4 - 2 = y. Suppose -jm = -m - 11. List the prime factors of m. 11 Let n be (-3)/1 - 381. Let x be n/9 - (-2)/(-3). What are the prime factors of (x/21)/((-2)/12)? 2 Suppose 0 = 2b - 0b + y + 59, 0 = -4b + 4y - 148. Let v = 51 + b. List the prime factors of v. 19 Let v = 1 - -3. Let i(m) = -m2 - 6m + 3. Let r be i(-6). Suppose -q - 5h + 2 = 14, -5h - r = vq. List the prime factors of q. 3 Suppose 0 = f - 7 - 21. Suppose -2n + f + 26 = 0. What are the prime factors of n? 3 Let q(r) = -r*2 + 19r + 13. What are the prime factors of q(16)? 61 Let o(c) = -c + 9. Let r be o(9). Suppose -2k + 4 = -0z + 4z, -3z + 6 = r. List the prime factors of (3/2 - k)6. 3, 7 Let z(k) be the second derivative of -k3/2 + k2/2 + 4k. What are the prime factors of z(-9)? 2, 7 Suppose 2y = 2, -6d = -2d - 4y - 12. Suppose -dj = 2k + 32 - 104, 5k - 40 = -3j. List the prime factors of j. 2, 5 List the prime factors of (-14)/3(-4 - -1). 2, 7 Let q(s) = s2 + 6s. Let i be q(9). Suppose -8v + i = -3v + 2j, -2j = 2v - 54. List the prime factors of v. 3 Let d be ((-6)/(-2) - 2) + 2. Suppose -dh = -m - 3, 3m + m = 5h - 12. Suppose h = 3u - 0u - 21. What are the prime factors of u? 7 Let i = -3 + 5. Let k(l) = -6l3 + 1. Let u be k(-1). Let q = u + i. List the prime factors of q. 3 Suppose -2x - 3d - 9 = -8d, x - 4d = -12. Suppose 0 = -4p - 0p - 20. Let n = p + x. List the prime factors of n. 3 Suppose -5g - 5k + 347 = -303, -2k + 10 = 0. What are the prime factors of g? 5 Let o(b) = b*3 + 7b*2 - 10b - 12. List the prime factors of o(-8). 2 Suppose 3d - 47 = -3l + 10, 4d + 68 = 2l. What are the prime factors of l? 2, 3 Let f = 5 - 7. What are the prime factors of (-1)/f - 39/(-6)? 7 Let h be (-2)/(-6)(1 + -4). Let s = 0 - h. Let w(n) = 9n*2 - 2n + 1. What are the prime factors of w(s)? 2 Let l be (-20)/814. Let v = 3 - l. What are the prime factors of v? 13 Suppose 5u + 3z - 2z = 1735, -u = -z - 341. What are the prime factors of u? 2, 173 Suppose -4f - 4u = -492, -5f = 3u + 257 - 882. Let x = f - 60. Suppose -g - x = -4w + 3g, g = -w + 7. What are the prime factors of w? 2, 3 Let q be 3/3 - 2 - 1. Let k = q + 9. What are the prime factors of k? 7 Let f(w) = w3 + 8w*2 + 1. Let l be f(-8). Let s = l - 4. What are the prime factors of ((-4)/s)/(-4)-27? 3 Let i(h) = 31h - 17. What are the prime factors of i(15)? 2, 7 Let a be 30/9(-48)/20. Let y be 3/(-1(-6)/(-8)). Let w = y - a. List the prime factors of w. 2 Let d(t) = 17t + 1. Let u be d(4). Let v = -16 + u. What are the prime factors of v? 53 Let w(y) = 27y2 - 1. Suppose 3 = -b + 4. List the prime factors of w(b). 2, 13 Let w(r) = r2 - r - 16. List the prime factors of w(-6). 2, 13 Let f be (-15)/(-3) - (2 - 1). Suppose -u + 3u + 2x - 12 = 0, -fu + 4 = -x. List the prime factors of (u - 0)(-15)/(-10). 3 Suppose 0 = o + 2v - 12 + 1, -4o + v + 8 = 0. Suppose q + q = -s + 37, oq - 164 = -5s. What are the prime factors of s? 31 Let c be (-2)/8 - (-30)/(-8). Suppose 8b = 10b - 128. What are the prime factors of (2 - 3)b/c? 2 Suppose 17m + 336 = 2631. What are the prime factors of m? 3, 5 Suppose 2r - r = c - 77, -c = -5r - 61. List the prime factors of c. 3 Let y(f) be the third derivative of f6/120 + 7f5/60 - f4/8 - f*3/3 - 2f*2. List the prime factors of y(-7). 19 Let q(t) = 3t - 89. Let c(h) = -h + 30. Let z(d) = -17c(d) - 6q(d). List the prime factors of z(12). 2, 3 Let n(l) = -7l3 + 2l*2 + l + 2. Let h be n(-2). Let r = -40 + h. Suppose -6p + p + r = 2*a, -a -	{ "pile_set_name": "DM Mathematics" }
-773 + 2518 - 635)) as bi2 + ci + si3 + zi*4 + h and give z. 2217 Rearrange 13c + 12 + 76 + 9c2 - 103 + 16 to the form ac*2 + gc + h and give a. 9 Rearrange (3 + 1 - 5)(-3d - d + 2d)(-31 - 1 + 126)(-4 + 3 + 2) to v + od and give o. 188 Rearrange 1216c2 - 484 + 1230c*2 + 99 - 2443c*2 to the form oc + kc2 + v and give o. 0 Express (-1536w + 839w - 1286w)(2w - 6w - 2w) in the form gw2 + a + xw and give g. 11898 Rearrange -72w - 2w*3 - 15w*2 - 7w*3 - 11w*2 + 3 + 35w + 36w to tw*3 + iw*2 + r + mw and give m. -1 Express 664j2 + 14j*4 - 666j*2 - 15j*4 - 2 + 321j*3 as fj*4 + gj*2 + pj + oj3 + b and give p. 0 Express ((1 + 3 - 2)(2 + 0 - 1) - 41 - 28 + 37)(4m - 23171 - 3m2 + 4m*2 + 23168) as cm*2 + km + u and give c. -30 Express -6d4 + 3d - 229888 - d + 29d4 + 229883 in the form vd + rd4 + o + bd*3 + qd*2 and give o. -5 Rearrange (3 - 6 + 1)((-212 + 376 - 200)(-2d + 4d - 9d) + 4d + d - 3d) + (-2 - 1 + 2)(1 - 1 - d) to y + sd and give s. -507 Express 43q2 + 734 + 1814q*2 - 732 in the form t + zq*2 + hq and give t. 2 Rearrange 676x2 - 4642x*2 - 10047x*2 + (-3x*2 + 2x*2 + 0x*2)(-2 - 2 + 5) to the form yx + cx*2 + s and give c. -14014 Rearrange (-8311 + 8311 - 282v*2)((0 - 4 + 2)(-1 + 29 - 9) + (4 - 2 - 4)(-2 - 2 + 3) + 1 - 5 + 2) to iv2 + xv + b and give i. 10716 Rearrange 4v2 - 18v*2 + 17v*2 - 3 - 4v*2 + 3 + (2v + 0v - 3v)(0v - 3v + 5v) - v*2 + 4v*2 - 4v*2 to the form fv + jv2 + z and give j. -4 Express -7p*2 + 25 + 689p + 101p + 115 - 140 as k + ip*2 + qp and give i. -7 Rearrange (158a3 - 165a*3 - 5a*2 + 15a*2)(24 + 24 - 57) to za3 + ha*2 + da + u and give z. 63 Express (-2w3 + 0w3 + w3)(-11293 + 35w - 21w - 6598 - 10w - 19293) as bw4 + xw*3 + tw*2 + dw + h and give x. 37184 Rearrange 109388h + 3h*2 + 3 - 2 - 109917h to the form vh + nh*2 + p and give v. -529 Express -7b*2 + 628b - 50b2 - 625b as fb + p + zb*2 and give z. -57 Rearrange (41574 - 63764 + 38182 + 24633)(-2p - 5p + 5p) to xp + v and give x. -81250 Express -3t2 + 12t + 10t + t3 - 7682 + 7683 + 13t in the form nt3 + w + xt*2 + kt and give k. 35 Express (208 + 457 + 258)(0g*4 + 9g*4 + 7g*4) in the form ag*2 + lg*3 + dg + x + hg4 and give h. 14768 Express (1143 - 494 + 289 + 1425)(-3d + 5d - 6d + (3d - 4d - d)(4 + 0 - 2)) in the form yd + u and give u. 0 Express 11672 - 199q - 2q2 - 11672 + 211q + 7q3 as fq + v + xq2 + nq*3 and give x. -2 Express -105387w + 2422w2 + 52689w + 52698w in the form bw*2 + jw + i and give b. 2422 Express -4385d2 - 4377d*2 + 8748d*2 - 166 as kd*2 + td + z and give k. -14 Rearrange ((-34 - 46 - 23)(0l + 0l - l) + (-1 + 2l + 1)(2 + 2 - 6))(9l3 - 4l3 - l3) to the form vl4 + g + hl*2 + xl*3 + ul and give v. 396 Express -3 - 64h + 1123h*3 - 566h*3 - 564h*3 + 1 - 23h in the form ph + rh*3 + kh*2 + z and give p. -87 Rearrange 8b3 + 1 - b2 + 8b3 + 5b*3 - 22b*3 + 24b*4 to nb + pb2 + u + ob*4 + cb*3 and give n. 0 Express (-22194 + 11109 + 11077 - 400v)(0 + 0 + v) as zv*2 + y + fv and give f. -8 Express -4450h + 982 + 447 + 4448h in the form u + th and give t. -2 Rearrange (-583 + 372 - 212 - 385)((10m + 7m - 5m)(-2m2 + 2m*2 + 2m*2) + 2m*3 - 6m*3 + 3m*3) to ym*2 + f + zm*3 + jm and give z. -18584 Rearrange 5h3 + 1 - 7h*3 + 28h*2 + 153h*2 + 98h*2 to the form oh + ch2 + xh*3 + i and give i. 1 Rearrange 5420g*2 + 1535g*2 + 3032g*2 + 1162g*2 - 2230g*2 to zg + a + tg2 and give t. 8919 Express -x2 - 23x + 78x - 35x - 3 - 24x + 6x*3 as a + ox*2 + vx + gx3 and give a. -3 Rearrange (-5552z + 1191z - 2073z)(2 + 1 + 0) + (2 - 2 + 2)(0z + z + 0z) to h + uz and give u. -19300 Rearrange -3b*3 - 21 + 165b*2 + 11 - 84b*2 - 84b*2 + 2b to i + zb2 + rb*3 + mb and give m. 2 Rearrange h - 2255h2 - 771h*2 - h + 316h*2 to fh + y + vh2 and give v. -2710 Rearrange -2t*2 + 17 - 2t*3 + 4062692t*4 + 4t*2 - 4062720t*4 to the form wt + p + jt3 + at*2 + vt*4 and give a. 2 Rearrange -11491g*4 - 11343g*4 + 10568g4 + (-3 + 3 - g2)(2 + 3g*2 - 2) to the form b + xg*3 + wg + jg2 + ag*4 and give a. -12269 Rearrange -422 - 418 + 1670 - 415 - 417 - 437y to the form v + jy and give j. -437 Express (y - 2y - y)(74 + 38 + 27)(3 - 3 + 4) as q + ny and give n. -1112 Rearrange 9u*2 - 2u*2 - 948u - 4u2 - 2u*2 + 2 to the form nu + m + cu2 and give n. -948 Rearrange 0r2 + r2 + r*2 - 266r + 59 - 59 to the form vr + i + sr*2 and give s. 2 Rearrange -74b*3 - 1 - 548b*2 - 19b*3 - 1 + 544b*2 to ob*2 + d + yb*3 + ib and give d. -2 Rearrange 3106510 - 3106510 - 5627f + (-2 + 2 + 1)(0 - 6 + 3)(-2 + 2 + 1)(3f - f - 4f) to y + pf and give p. -5621 Express 193b + 189b2 + 186b - 573b + 183b + (b - 3 + 3)(-3 + b + 3) - b + b + 3b*2 as zb*2 + a + db and give d. -11 Express 25v2 + 37v*2 + 36v*2 - 57 - 97v*2 - 5v - 2v3 in the form a + mv + iv2 + pv*3 and give p. -2 Rearrange (-11g + 5g - 9g + (0 - 3 + 4)(8g + 8g - 6g) - 3g - 3g + 7g)(10g + 0g - g) to h + vg + lg*2 and give l. -36 Rearrange 432 - 11r - 411 - 12r2 + r - 3r + 2r3 - r to the form zr*3 + mr + p + gr2 and give p. 21 Rearrange (4y - 3y + 2y)(6 - 30 - 4)(-2y + 17y - 6y + 2y - 3y - 2y + (-3y - y + 2y)(1 - 1 - 1)) to the form ry + ty2 + b and give t. -672 Express (26 - 52 + 7)(t - 2t + 0t) - 73t + 1424 - 713 - 714 + 3t + t - 2t in the form v + rt and give r. -52 Rearrange (105 - 41t - 105)(44t - 19t - 23t - 22t*2) to b + zt + mt2 + at*3 and give a. 902 Rearrange (2s*2 - 2 + 2)(4431 + 1183 + 673) to the form w + bs + qs*2 and give b. 0 Rearrange 6y*2 + 1 + 24y + 41y3 - 28y - 39y3 - 2y*4 to the form xy + qy2 + d + hy*4 + iy*3 and give h. -2 Express (3i2 + i2 - 2i2)(-5 - 4 - 7) + 0i2 - 3i*2 + 5i*2 + (29i*2 - 73 + 73)(-1 - 2 + 2) as d + pi + ai*2 and give a. -59 Express -2s*2 + 763 - 1413 + 799 + 1014 in the form as*2 + ks + f and give a. -2 Express (-443 + 443 - 68x2 + 3x)(-4 + 4 + 2 + (-1 + 2 - 3)(2 - 4 + 6)) as vx + o + zx*2 and give z. 408 Express -7l + 2l + 12l*2 - 13l - 30l2 as wl*2 + dl + q and give d. -18 Express (-2 + 4 + 0)(4233 + 5696 - 2849)(-4p2 + 2p*2 - 2p + 0p) as q + wp + zp2 and give w. -28320 Express -120 + i - 201 - 138 + 31 as f + zi and give f. -428 Express (7x + 14 - 14)(-927 - 1340 - 102 + 386)(0 + 0 + 1) as wx + o and give w. -13881 Rearrange 3k3 - 353 - 2k*2 + 1009 - 5k - 327 - 17k4 - 329 to jk*4 + ak*3 + y + zk*2 + hk and give h. -5 Express -951 + 39k2 + 29k*2 + 2k + 948 - 48k2 as tk + dk2 + x and give t. 2 Express (2l*2 - 4l*2 + 5l*2)(-18 + 629 + 897 - 177) in the form q + dl + sl2 and give s. 3993 Rearrange t4 + 56 - 3t - 125 + 7t2 + 40 + t3 + 45 to the form gt4 + kt*2 + pt + mt3 + u and give g. 1 Rearrange -10 + 38c*2 + 153c*2 + 32c*2 to the form kc*2 + qc + p and give k. 223 Express 642 - 381 + 672 + 33 - k + 318 as m + fk and give f. -1 Express (1 + 2x - 1)(11 - 741750x - 2x2 + 740986x - 1) as t + kx2 + jx + cx3 and give k. -1528 Express 51h + 64 - 388 - 47h + (-2h + 3h + 3h)(0 - 1 + 3) in the form oh + k and give k. -324 Express (465x - 1741x - 4596x)(2x2 + x2 + 0x*2) in the form rx*2 + qx + wx3 + z and give w. -17616 Express 2047o*2 + 67125 - 134244 + 67121 in the form lo*2 + zo + a and give z. 0 Rearrange -2o3 - 3o4 + o4 + 7o4 + (-2o*2 + 0 + 0)(-1 + 1 + 2o2) - 25o*4 - 73o*4 + 53o*4 to to + m + go3 + no*2 + so*4 and give s. -44 Express -32l - 12l - 45l - 38 + 75l - 2l*3 as y + ul*2 + zl + nl3 and give y. -38 Rearrange 2083o + 8679 - 8679 to h + go and give g. 2083 Express ((2 + 3 - 6)(4 + 2z - 4) + 2z + z - 4z - 3z + 2z - 3z + 4 - 4 - z + 3z - z + 0z)*	{ "pile_set_name": "DM Mathematics" }
8 PM? 3:53 PM What is 685 minutes before 7:56 AM? 8:31 PM What is 520 minutes after 2:30 PM? 11:10 PM What is 371 minutes after 5:44 AM? 11:55 AM What is 524 minutes before 5:20 AM? 8:36 PM What is 414 minutes after 6:54 PM? 1:48 AM What is 391 minutes before 2:56 AM? 8:25 PM How many minutes are there between 1:10 AM and 10:26 AM? 556 How many minutes are there between 3:33 PM and 11:11 PM? 458 How many minutes are there between 6:52 PM and 12:45 AM? 353 What is 154 minutes before 11:05 AM? 8:31 AM How many minutes are there between 11:07 PM and 6:07 AM? 420 What is 539 minutes before 2:10 PM? 5:11 AM What is 609 minutes after 10:09 AM? 8:18 PM What is 457 minutes before 6:45 AM? 11:08 PM What is 481 minutes after 4:46 PM? 12:47 AM How many minutes are there between 1:50 PM and 1:33 AM? 703 How many minutes are there between 10:29 AM and 3:56 PM? 327 How many minutes are there between 12:15 AM and 2:06 AM? 111 What is 33 minutes before 7:38 PM? 7:05 PM What is 136 minutes before 9:01 AM? 6:45 AM How many minutes are there between 6:51 PM and 10:47 PM? 236 What is 203 minutes after 7:44 PM? 11:07 PM How many minutes are there between 12:07 AM and 8:12 AM? 485 What is 546 minutes after 7:14 AM? 4:20 PM What is 145 minutes after 2:34 AM? 4:59 AM How many minutes are there between 4:32 PM and 10:46 PM? 374 How many minutes are there between 4:30 AM and 4:14 PM? 704 How many minutes are there between 1:44 PM and 9:09 PM? 445 What is 12 minutes before 4:53 AM? 4:41 AM How many minutes are there between 6:11 AM and 10:14 AM? 243 How many minutes are there between 9:36 PM and 11:46 PM? 130 How many minutes are there between 12:29 PM and 11:49 PM? 680 How many minutes are there between 7:36 AM and 3:18 PM? 462 How many minutes are there between 12:46 PM and 2:52 PM? 126 What is 173 minutes before 9:51 AM? 6:58 AM How many minutes are there between 11:44 PM and 4:42 AM? 298 How many minutes are there between 4:23 PM and 11:31 PM? 428 How many minutes are there between 4:26 PM and 11:16 PM? 410 What is 570 minutes before 11:26 PM? 1:56 PM How many minutes are there between 7:04 PM and 7:46 PM? 42 How many minutes are there between 1:32 AM and 11:31 AM? 599 What is 172 minutes before 2:53 PM? 12:01 PM What is 710 minutes after 12:08 AM? 11:58 AM What is 493 minutes before 9:46 PM? 1:33 PM What is 322 minutes after 10:33 PM? 3:55 AM How many minutes are there between 5:17 AM and 11:57 AM? 400 What is 553 minutes after 5:27 PM? 2:40 AM What is 573 minutes after 2:20 PM? 11:53 PM How many minutes are there between 3:54 AM and 9:31 AM? 337 How many minutes are there between 11:56 PM and 2:36 AM? 160 What is 265 minutes after 2:12 AM? 6:37 AM How many minutes are there between 6:49 PM and 3:10 AM? 501 How many minutes are there between 10:44 PM and 8:29 AM? 585 What is 581 minutes after 1:14 AM? 10:55 AM How many minutes are there between 3:26 AM and 12:45 PM? 559 How many minutes are there between 7:11 AM and 2:37 PM? 446 What is 91 minutes before 12:58 AM? 11:27 PM What is 539 minutes after 4:28 PM? 1:27 AM What is 691 minutes after 3:06 PM? 2:37 AM How many minutes are there between 10:40 AM and 7:14 PM? 514 What is 404 minutes before 5:13 AM? 10:29 PM What is 270 minutes before 11:24 AM? 6:54 AM What is 588 minutes before 10:01 AM? 12:13 AM How many minutes are there between 9:22 PM and 11:22 PM? 120 How many minutes are there between 4:04 AM and 4:42 AM? 38 What is 584 minutes after 4:15 PM? 1:59 AM How many minutes are there between 10:30 AM and 4:44 PM? 374 How many minutes are there between 9:31 AM and 11:37 AM? 126 What is 627 minutes after 11:28 AM? 9:55 PM What is 481 minutes after 10:00 AM? 6:01 PM What is 691 minutes after 8:12 PM? 7:43 AM How many minutes are there between 2:00 AM and 11:17 AM? 557 What is 424 minutes before 1:49 PM? 6:45 AM How many minutes are there between 12:47 AM and 1:25 AM? 38 What is 153 minutes after 8:19 PM? 10:52 PM How many minutes are there between 9:06 AM and 4:40 PM? 454 What is 675 minutes before 12:48 AM? 1:33 PM How many minutes are there between 6:14 AM and 2:58 PM? 524 What is 700 minutes after 2:22 AM? 2:02 PM How many minutes are there between 9:36 AM and 12:08 PM? 152 What is 572 minutes before 11:56 PM? 2:24 PM How many minutes are there between 3:03 AM and 5:09 AM? 126 How many minutes are there between 1:31 PM and 6:51 PM? 320 What is 300 minutes before 10:18 AM? 5:18 AM What is 289 minutes after 10:06 AM? 2:55 PM What is 11 minutes after 12:33 PM? 12:44 PM What is 507 minutes before 5:58 PM? 9:31 AM How many minutes are there between 7:54 AM and 5:32 PM? 578 What is 353 minutes after 4:05 AM? 9:58 AM What is 617 minutes after 9:40 AM? 7:57 PM What is 655 minutes before 4:29 PM? 5:34 AM How many minutes are there between 1:54 PM and 4:58 PM? 184 How many minutes are there between 8:06 PM and 3:15 AM? 429 How many minutes are there between 3:59 AM and 8:08 AM? 249 What is 467 minutes before 10:26 PM? 2:39 PM How many minutes are there between 8:07 AM and 11:22 AM? 195 How many minutes are there between 5:57 AM and 4:41 PM? 644 How many minutes are there between 3:15 AM and 2:07 PM? 652 What is 445 minutes before 4:24 PM? 8:59 AM How many minutes are there between 3:47 PM and 9:24 PM? 337 How many minutes are there between 12:38 PM and 8:06 PM? 448 How many minutes are there between 3:19 AM and 10:56 AM? 457 What is 203 minutes before 10:07 AM? 6:44 AM What is 605 minutes before 12:56 AM? 2:51 PM What is 197 minutes before 6:36 PM? 3:19 PM What is 19 minutes after 10:07 PM? 10:26 PM How many minutes are there between 6:13 PM and 8:52 PM? 159 How many minutes are there between 10:38 AM and 8:21 PM? 583 What is 88 minutes before 5:30 PM? 4:02 PM How many minutes are there between 1:36 PM and 4:12 PM? 156 What is 135 minutes before 11:06 PM? 8:51 PM How many minutes are there between 6:00 PM and 7:43 PM? 103 What is 10 minutes after 11:57 AM? 12:07 PM How many minutes are there between 6:42 PM and 9:10 PM? 148 How many minutes are there between 7:39 AM and 10:31 AM? 172 What is 391 minutes before 8:20 PM? 1:49 PM How many minutes are there between 7:31 PM and 8:09 PM? 38 How many minutes are there between 8:14 PM and 6:24 AM? 610 How many minutes are there between 2:26 PM and 12:57 AM? 631 How many minutes are there between 9:38 PM and 6:26 AM? 528 How many minutes are there between 5:09 PM and 11:35 PM? 386 What is 421 minutes after 5:27 PM? 12:28 AM What is 592 minutes before 12:55 AM? 3:03 PM What is 588 minutes after 3:25 AM? 1:13 PM How many minutes are there between 5:41 AM and 7:56 AM? 135 What is 492 minutes after 8:43 AM? 4:55 PM What is 295 minutes after 6:56 AM? 11:51 AM What is 98 minutes before 6:47 AM? 5:09 AM How many minutes are there between 11:27 PM and 7:40 AM? 493 What is 265 minutes before 1:12 AM? 8:47 PM What is 406 minutes before 8:35 AM? 1:49 AM What is 410 minutes after 10:32 AM? 5:22 PM What is 636 minutes after 7:47 PM? 6:23 AM How many minutes are there between 11:26 AM and 6:07 PM? 401 What is 636 minutes before 2:06 AM? 3:30 PM How many minutes are there between 8:44 AM and 5:43 PM? 539 How many minutes are there between 2:24 PM and 4:24 PM? 120 How many minutes are there between 5:47 PM and 3:25 AM? 578 What is 657 minutes before 4:49 PM? 5:52 AM What is 156 minutes after 6:10 AM? 8:46 AM How many minutes are there between 1:08 PM and 5:20 PM? 252 How many minutes are there between 6:43 PM and 11:41 PM? 298 What is 156 minutes after 7:40 PM? 10:16 PM What is 372 minutes after 9:34 PM? 3:46 AM How many minutes are there between 12:54 PM and 4:49 PM? 235 How many minutes are there between 2:27 AM and 3:44 AM? 77 How many minutes are there between 7:23 PM and 7:50 PM? 27 What is 401 minutes after 7:01 AM? 1:42 PM How many minutes are there between 3:40 PM and 11:52 PM? 492 What is 342 minutes after 8:02 PM? 1:44 AM How many minutes are there between 1:24 PM and 11:06 PM? 582 What is 315 minutes after 8:47 AM? 2:02 PM What is 490 minutes after 9:25 AM? 5:35 PM How many minutes are there between 2:21 PM and 12:33 AM? 612 How many minutes are there between 10:31 PM and 3:08 AM? 277 What is 682 minutes before 3:59 AM? 4:37 PM What is 136 minutes before 7:26 AM? 5:10 AM What is 2	{ "pile_set_name": "DM Mathematics" }
44. Round i to 6 dps. -0.000004 Suppose 2v = v + 18. Suppose -2z = -0z - 2u + v, 4u = z. Let n be 7/((-21)/(-1000000))z. Round n to the nearest one million. -4000000 Let a = -0.8852 - -0.9. What is a rounded to 3 decimal places? 0.015 Suppose -4p - 3m = 407991, 3m = 3p - 2p + 102009. Round p to the nearest 10000. -100000 Let h = 2 + -2.04. Round h to 1 decimal place. 0 Let b = -0.23000001 + 0.23. Round b to 7 dps. 0 Let f = -0.3 + 0.2. Let i = -54.9055 + 55. Let l = f + i. What is l rounded to 3 dps? -0.006 Let a = 0.1743047 + -11.1740747. Let v = a + 11. What is v rounded to four dps? 0.0002 Let y = 69 + -166. Let g(q) = q - 2. Let w be g(6). Let i be w/18 - y/9. What is i rounded to the nearest ten? 10 Let h = 18 + -17.9999976. Round h to seven dps. 0.0000024 Let w = 0.27 + -0.2698. Round w to three decimal places. 0 Let t = -37.39 - -38. Let j = 5.9 - 4.28. Let v = t - j. Round v to 1 dp. -1 Let t = 0.5 - 0.5. Let o = t + 0.2. Let c = 0.200004 - o. Round c to five decimal places. 0 Let j = -21 - -23. Let c = -44983 - -64983. Suppose -2a + 5k + 11429 = -8571, 4k + c = ja. Round a to the nearest one hundred thousand. 0 Let f = 6 + -4. Let w = f + 0. Let h = w + -2.00056. What is h rounded to four dps? -0.0006 Let a(r) = -28r + 2. Let k(o) = 1. Let s(m) = a(m) - 3k(m). Let f be s(4). Round f to the nearest 10. -110 Let q(k) = 2 + 3k2 + k - k3 - k. Let p be q(3). Suppose 0 = -n - 5w - 103, 5n + 4w = pn - 287. What is n rounded to the nearest ten? -90 Suppose -8 = -w + 4h, -4w - 5h - 10 = -5w. Let q(j) = -j*2 - 360. Let d be q(w). What is d rounded to the nearest 100? -400 Suppose 3z + v - 3008 = -3v, -2v - 996 = -z. What is z rounded to the nearest one thousand? 1000 Let u(f) = -873f - 8. Let z be u(4). What is z rounded to the nearest one thousand? -4000 Suppose -3w - 7 = -3h - 22, 0 = h - 2. Suppose 5s = 2 - w. Let q be s + (-1)/(-2)6. Round q to the nearest ten. 0 Let t = -26 - -76. Let l = 1196467048 - 1196467097.9999943. Let i = t + l. Round i to 6 dps. 0.000006 Let l = -84 - -58. Let f = l - -26.55. Round f to one decimal place. 0.6 Let r = 448.81 - 447. Round r to 1 dp. 1.8 Let f = 5 - 2. Let k = -1 + f. Suppose 2g + 1280000 = -kg. What is g rounded to the nearest one hundred thousand? -300000 Let m be (48955/20)/((-2)/(-536)). Suppose 5q - 2t + 5t - 819991 = 0, -m = -4q - t. What is q rounded to the nearest ten thousand? 160000 Suppose 2f + f + 18 = 0. Let p be (-2)/3 + 1796/f. Round p to the nearest 1000. 0 Let r = 96 - 95.99903. Round r to four dps. 0.001 Let v(s) = 156001s2 - 9s - 10. Let n be v(10). Suppose 4t + n = 6t. What is t rounded to the nearest one million? 8000000 Let m = 560894 - 928046. Let f = -547152 - m. What is f rounded to the nearest 100000? -200000 Suppose 8 = 2c + c + f, f = -c + 4. Suppose ck = k - 160. What is k rounded to the nearest 100? -200 Let s = -85.6838 - -1.2938. Let p = -85 - s. What is p rounded to one dp? -0.6 Let m = 0.053211073 + 9.946786687. Let h = -10 + m. Round h to seven decimal places. -0.0000022 Let c = -133 - -132.9999786. Round c to six decimal places. -0.000021 Let z(a) = 2a + 12. Let x be z(-9). Let m(o) = -3610o*2 + 6o - 4. Let q be m(x). What is q rounded to the nearest one hundred thousand? -100000 Let z = 0.03 - -0.06. Let w = 204 + -204.0836. Let m = z + w. What is m rounded to three dps? 0.006 Suppose -5z + 25 = -3f, -z + 5 = -4f - 0z. Suppose f = -7i + 2i. Suppose 5v = -iv + 1750. What is v rounded to the nearest one hundred? 400 Let d = 53.0029 - 53. What is d rounded to 3 dps? 0.003 Let k = -965823.4000135 - -965758.4. Let m = 65 + k. What is m rounded to 6 dps? -0.000014 Let o be 10/55 + (-31)/(-11). Suppose -5c + oc - 8186 = 0. Let v = c + 6093. Round v to the nearest 10000. 0 Let y(d) = -d*3 - 5d*2 - 3d + 2. Let f be y(-4). Let n be (-200)/(f3/(-12)). Round n to the nearest 100. -400 Let t = -1.4 - -0.84. Let y = t - -22.56. Let q = 22.0053 - y. Round q to three decimal places. 0.005 Suppose 3c + 2 = 14. Suppose -4y + l + 40 = 0, cy - l - 56 = 4l. Let h be -2 + 413332y/(-6). Round h to the nearest one hundred thousand. -600000 Let u = -466.23539863 + 2181420.23490863. Let f = u - 2180991. Let l = 37 + f. What is l rounded to 4 decimal places? -0.0005 Suppose -2a = 97884409 + 17615603. Let l be a/21 + (-2)/(-7). What is l rounded to the nearest 100000? -2800000 Let f(w) = -5015w*2 - 2w - 2. Let m be f(-2). Let v = m - -10443. Let u = v + 31615. What is u rounded to the nearest ten thousand? 20000 Suppose 3a + 1412 = 4a. Suppose -3u = 6y - 2y + 12, -2y = -4u - 16. Suppose -5k + a + 3588 = y. What is k rounded to the nearest 100? 1000 Suppose q = -2q + 2174970. Suppose 0 = 3x + 5n - 7 - 28, -3n = -12. Let r be q/25 + 2/x. Round r to the nearest 10000. 30000 Let s = 24.87 + -25. Let v = s - -0.129936. Round v to five decimal places. -0.00006 Let o = -33 + 32.57. Let b = o + -29.57. Let m = b - -30.092. Round m to 2 dps. 0.09 Let r(h) be the first derivative of 429h5/20 - h4/12 + h - 2. Let c(o) be the first derivative of r(o). Let k be c(-1). Round k to the nearest 100. -400 Let q = 6.4 + -6.4004. Round q to three dps. 0 Let h = -4.6 - -4.599878. Round h to five decimal places. -0.00012 Let z = 1936172641 - 1936172677.00000124. Let n = 53 + -17. Let k = n + z. Round k to 7 dps. -0.0000012 Let r = 1.1 - 8.1. Let j = -7.00000005 - r. What is j rounded to 7 decimal places? -0.0000001 Suppose 2l = 3t + 6, -2t + 0l = -3l + 4. Let h be (-959996)/4 + 2/t. What is h rounded to the nearest 100000? -200000 Let c(r) = -r*3 - 4r - 4. Let h be c(6). Let s = -8944 - h. What is s rounded to the nearest 1000? -9000 Let q = -429 + 428.146. Let l = -0.064 - q. Round l to one dp. 0.8 Let n = 2705362 + -4402174. Let q = n + 1696737.0077. Let j = q - -75. Round j to 3 dps. 0.008 Let p(l) = 7700001l2 - 2l + 1. Let o be p(1). Round o to the nearest 1000000. 8000000 Let d = -1.1 + -0.4. Let k = d + 4.6. Let a = k - 3.09942. Round a to four dps. 0.0006 Suppose -z = 3z - 8. Let h(q) = 4q - 1 + 16q + z. Let j be h(2). What is j rounded to the nearest ten? 40 Suppose d = 4d - 18. Suppose -l + 3 = 0, -4f + dl - 11 = l. Let h(t) = -93t3 - t2 + 1. Let a be h(f). What is a rounded to the nearest 10? -90 Let a = -60 + 113. Suppose 0 = l - 87 - a. Round l to the nearest 10. 140 Let r = 7 - 2.5. Let l = -18.8 + r. Let i = l + 12. What is i rounded to 0 dps? -2 Suppose 5t - 6t = 33000. What is t rounded to the nearest ten thousand? -30000 Let b = 8.0584 + 0.9368. Let k = b - 9. What is k rounded to 3 decimal places? -0.005 Let y = -59 + -991. What is y rounded to the nearest one hundred? -1100 Let u be 1104000/(-3) + (9 - 9). Round u to the nearest 100000. -400000 Let w = 23.9 + -20. Let d = 9.5 - 3.7. Let z = d - w. Round z to the nearest integer. 2 Let r = -16.1 + 0.1. Let g = r - -16.00003. Round g to 4 dps. 0 Let j = 383633 + -714587. Let v = 1000954 + j. What is v rounded to the nearest 100000? 700000 Let g = -13 - -14.1. Let y = -0.1 + g. Let q = y - 0.99. What is q rounded to 2 dps? 0.01 Suppose -4b + 1195 = -5r, 4b - 1108 = 2*r + 90. What is b rounded to the nearest one thousand? 0 Let p = -3 - -4. Let j = p - 3. Let l = j - -1.99999. Round l to four dps. 0 Let l = 0.02 + 0.08. Let f = l + -0.18. What is f rounded to 1 decimal place? -0.1 Let f = -13 - -7. Let p = f + 6.4. Let a = p - 0.4000008. Round a to 6 decimal places. -0.000001 Let j = 42 + -41.99999905. What is j rounded to 7 dps? 0.000001 Let j = 8131170.0000064 - 8131147. Let u = -23 + j. Round u to six dps. 0.000006 Let v = 38.19 - 38. Let x = -1282.2 + 1282.01093. Let k = v + x. What is k rounded to 4 dps? 0.0009 Let q = -0.9 - -0.89998. What is q rounded to five decimal places? -0.00002 Let a be (-7 + -3 - -4)/(2/(-610)). Round a to the nearest one hundred. 1800 Let x = 18794 - 8694. Round x to the nearest one thousand. 10000 Let y = -7 + 40. Let v = -32.99977 + y. What is v rounded to 4 decimal places? 0.0002 Let n = 5 + -13. Let l = 5 + n. Let z be 117005/(-15) - 1/l. What is z rounded to the nearest 1000? -8000 Let u = -8.6 - -7.74. Let l = 0.01 + u. Let g = l + 0.772. Round g to two dps. -0.08 Let x = -0.06 - -1.	{ "pile_set_name": "DM Mathematics" }
lve -107s + 396 = -124s + 855 for s. 27 Solve 5622d = 5207d - 19090 for d. -46 Solve -262 = 45g + 167 - 24 for g. -9 Solve 947 = 51k - 124 for k. 21 Solve -422i - 235i - 473 = -184i for i. -1 Solve -457804 + 141139 = 5674y + 290453 for y. -107 Solve -2780b + 4996b - 80900 - 28832 = -5622b for b. 14 Solve -999h = 1920 + 30039 + 3006 for h. -35 Solve 3386f = 27401 - 142525 for f. -34 Solve 32351l = 32544l - 7720 for l. 40 Solve -774n + 399 + 571 = -736n - 56 for n. 27 Solve 2405x + 2714x = 527257 for x. 103 Solve -1759v = -1899v - 657 + 237 for v. -3 Solve -171o + 401o = -1073o - 57332 for o. -44 Solve 189208 - 179112 = 631t for t. 16 Solve 182l - 45802 = -41434 for l. 24 Solve 424s = 146s - 200s + 19598 for s. 41 Solve 392p - 1093p = -787p - 7482 for p. -87 Solve -491862 - 160746 = 7709j + 25784 for j. -88 Solve 79a + 4254 = 658a + 130a for a. 6 Solve -15544 + 13510 = -226v for v. 9 Solve 1240x = -22193 + 7066 - 7146 - 7487 for x. -24 Solve -10026 = 45c - 10116 for c. 2 Solve -1571z = 2118z - 7469 + 217742 for z. -57 Solve -3c - 3056c = -83580 + 25459 for c. 19 Solve 5q + 84q + 8q - 14q + 4150 = 0 for q. -50 Solve -1598l - 100149 = 159l for l. -57 Solve -687q - 430q = -162q - 116510 for q. 122 Solve -151y + 42y + 3350 = 90y + 11708 for y. -42 Solve -3817p - 102697 = -213309 + 321853 + 307871 for p. -136 Solve 2929g - 132549 - 184132 = 45503 - 60497 for g. 103 Solve 1673 - 7423 = -230o for o. 25 Solve 117x - 326x + 61855 = 482x + 4x for x. 89 Solve 1184i + 35150 = 690i + 1197i for i. 50 Solve -28577 = 1343p + 10078 + 5332 + 5704 for p. -37 Solve -262l = 319l + 817l - 137004 for l. 98 Solve -38l - 58501 = -58539 for l. 1 Solve 39v - 990 = 105 - 159 for v. 24 Solve -17585 = 214h + 506h - 12265 + 23480 for h. -40 Solve -51697 = 2778l + 37199 for l. -32 Solve -3513 - 4205 = -211w - 243w for w. 17 Solve 1861k - 912k - 894k = 278 + 2857 for k. 57 Solve -23763c - 238 = -23749c for c. -17 Solve -2248 = -319b + 109b + 902 for b. 15 Solve -1173 = -647d - 8115 - 175 for d. -11 Solve -4310 = -338m + 7858 for m. 36 Solve -2877k - 749 + 8853 = -23543 for k. 11 Solve -489713 + 73361 = 5561a + 263480 - 45878 for a. -114 Solve 183v - 46v + 11218 = -8274 + 13327 for v. -45 Solve 0 = -1438w + 51035 + 12482 + 28515 for w. 64 Solve 55v - 272 = 183 + 95 for v. 10 Solve 90x + 8240 + 2076 = 1586 for x. -97 Solve -156r + 4353 = -107r + 205r - 9871 for r. 56 Solve 4269q = -171q - 204240 for q. -46 Solve -419a - 290a + 7007 = -170a for a. 13 Solve -497h - 12644 + 15129 = 0 for h. 5 Solve -13350a = -12523a + 20675 for a. -25 Solve 1246o + 14287 + 11879 = 0 for o. -21 Solve 387b = -4570 - 2271 - 8252 for b. -39 Solve -49290m + 47912m = 97838 for m. -71 Solve 113m - 45m = 293 - 701 for m. -6 Solve 1331s + 43992 = 109s for s. -36 Solve 1901212o + 53010 = 1900654o for o. -95 Solve -3090 = -14b - 28b - 61b for b. 30 Solve 0 = -34v - 1479 + 3825 for v. 69 Solve 544z = 393625 - 439865 for z. -85 Solve 2415 - 7700 = -117g - 34g for g. 35 Solve -185b - 374b = -1197b + 16588 for b. 26 Solve 38s + 4688 = 3814 for s. -23 Solve 411044 = 16648x - 858x + 1421604 for x. -64 Solve 25a = 71 - 1647 - 424 for a. -80 Solve 830a - 966a - 12920 = 0 for a. -95 Solve -3041r - 316r - 473164 = 1293r - 17464 for r. -98 Solve -1406f - 80122 - 9862 = 0 for f. -64 Solve 23z - 852 + 597 = 79z + 2041 for z. -41 Solve -508t - 184t = 0 for t. 0 Solve -298n + 718 - 3499 - 7875 = 1860 for n. -42 Solve 0 = 146r - 1702251 + 1709113 for r. -47 Solve 9p - 6p + 4p = -p - 376 for p. -47 Solve 0 = -4740u - 9567u - 786885 for u. -55 Solve 0 = -155t - 227271 + 240756 for t. 87 Solve -34z + 17787 = 505z for z. 33 Solve 576o - 70736 = -83984 for o. -23 Solve 315w - 1409w - 308w + 131794 = 2160w for w. 37 Solve -26a + 5057a + 39162 - 112447 = 153110 for a. 45 Solve 179s - 79s + 134s = -119s + 7060 for s. 20 Solve -759z - 30562 + 15706 = -2301 + 31467 for z. -58 Solve -7388 - 5419 = 199k + 526 for k. -67 Solve 0 = -58v - 12666321 + 12661797 for v. -78 Solve 0 = -24n - 76273 + 76681 for n. 17 Solve -7h - 111h - 282 - 479 = 1599 for h. -20 Solve 712x + 2058 = -1937 - 989 for x. -7 Solve -1782r + 327r + 5783 = -8767 for r. 10 Solve -1235738 = 165x - 1245968 for x. 62 Solve 18328u = 18307u + 567 for u. 27 Solve -685f + 522f - 2388f - 48469 = 0 for f. -19 Solve 238l + 195l + 4839 = -362l - 15036 for l. -25 Solve -46d - 78 = -288d - 951 + 8617 for d. 32 Solve 220 = -6922960k + 6922940k for k. -11 Solve -15248 = -3665z + 3301z + 2033 - 1265 for z. 44 Solve 58450b + 63 + 468 = 58627b for b. 3 Solve 2n - 321 = -351n + 890 + 6202 for n. 21 Solve 35h - 2h - 1124 = -1619 - 1089 for h. -48 Solve 2203859y + 2888 = 2203935y for y. 38 Solve -650m - 2183 + 7287 = -331m for m. 16 Solve -5706583 = 124o - 5701003 for o. -45 Solve 6238 = 78k + 100k - 1060 for k. 41 Solve 33v = -22v + 107v + 520 for v. -10 Solve -548 + 812 = 88r for r. 3 Solve -221t - 1246t + 123t + 11808 = 624t for t. 6 Solve -31c = -145c - 29c - 3003 for c. -21 Solve -2054z - 18197 + 4684 = 14478 + 765 for z. -14 Solve 210w + 139w - 151w + 2574 = 0 for w. -13 Solve -30341 = -1642x + 40265 for x. 43 Solve -3616p = -3906p - 1450 for p. -5 Solve -923w + 136w = -32267 for w. 41 Solve -21914f - 708347 = 869461 for f. -72 Solve 62f - 1564721 = -1562551 for f. 35 Solve -9062h = -25343h + 68284 - 247375 for h. -11 Solve 0 = 38h + 2891 - 4145 for h. 33 Solve -1437i = -1041i + 1212i + 818i - 114022 for i. 47 Solve -330f + 7700 = 613f + 15326 - 104755 for f. 103 Solve 1805 = 429a - 6775 for a. 20 Solve 260902 = -518g - 393g - 876g for g. -146 Solve -2470 + 648 + 181 = -78z + 3039 for z. 60 Solve -164431 + 171569 = 86u for u. 83 Solve -1260c = -2605c - 25555 for c. -19 Solve 923k - 494458 = -469537 for k. 27 Solve 1457 = 3501x - 3707x - 199 + 18136 for x. 80 Solve 159v - 1543v - 754v = 32070 for v. -15 Solve -10k + 1185 + 615 = -46k - 14k for k. -36 Solve 662y = 720y + 464 for y. -8 Solve -4959h = 2542h + 607581 for h. -81 Solve -1931j + 66865 = 29857 - 90438 for j. 66 Solve 0 = 1817z + 1410z + 232344 for z. -72 Solve -5887z - 20550 + 248925 = -2842z for z. 75 Solve -972u + 151175 = -1550u - 3955u - 293059 for u. -98 Solve -17103x + 17195x - 3645 = 4267 for x. 86 Solve -1092j + 4041 = 31768 + 33425 for j. -56 Solve 2772l + 45227 + 112777 = 0 for l. -57 Solve 0 = 1743m - 110751 + 6171 for m. 60 Solve -477i - 5052 = -360i + 213 for i. -45 Solve 0 = 503o + 622o - 4500 for o. 4 Solve 1795b + 114b = 212b + 86547 for b. 51 Solve -227w = -1114w - 2085w - 297200 for w. -100 Solve 514n + 276n + 2978 = 33n + 8277 for n. 7 Solve 174749 = 12r + 174977 for r. -19 Solve 5399h - 11118 = 3546h for h. 6 Solve -42m + 2750m + 136320 = 578m for m. -64 Solve -366t = 11138 + 30952 for t. -115 Solve 363 = 120506k - 120495k for k. 33 Solve 0 = 35g + 89 - 2399 for g. 66 Solve -219q + 57q = -3726 for q. 23 Solve -3855w + 6334w - 74370 = 0 for w. 30 Solve 117n - 1078633 + 1076293 = 0 for n. 20 Solve -201030 = -8564d + 395714 + 131196 for d. 85 Solve -7070728 = -63g - 7071484 for g. -12 Solve -381n = 406n - 53n + 33030 for n. -45 Solve -595t + 84908 = 2566t + 258393 + 82556 for t. -81 Solve -4092x - 1343x + 72884 = -111906 for x. 34 Solve -134386 = 912w - 569w + 1974w for w. -58 Solve 6508m - 324m = 475m - 60819 - 47652 for m. -19 Solve 155j + 48 - 437 = -137 - 97 for j. 1 Solve 703r + 35515 - 2537 = -3578 for r. -52 Solve -135s = 734 - 408 + 2914 for s. -24 Solve 518z + 34597 - 2454 = -22765 for z. -106 Solve -3604d = -81749 + 118046 + 122279 for d. -44 Solve -428936r = -428840r - 96 for r. 1 Solve 970a - 33879 = -3303 + 13074 for a. 45 Solve 4490c = 2991c + 64457 for c. 43 Solve -65v + 12595 = -140v + 135v + 169v for v. 55 Solve -7186 - 37574 = 152t - 29t + 250t for t. -120 Solve 800 = 57f - 1353 - 355 - 456 for f. 52 Solve 0 = 758g + 87563 - 70129 for g. -23 Solve -587157 - 362048 = -10415r + 258935 for r. 116 Solve 0 = 279p + 17159 + 5253 + 8836 for p. -112 Solve 98*f + 503 = 1188 + 27	{ "pile_set_name": "DM Mathematics" }
4/8 + j*3/6 - j. Let p(w) be the second derivative of b(w). What is the units digit of p(8)? 1 Suppose 0 = -4o + w + 3w + 160, -3w + 132 = 4o. What is the tens digit of o? 3 Suppose 0g - 3g + o + 29 = 0, 0 = 3g + 5o - 17. What is the units digit of g? 9 Let u(a) = -2a - 4. Let h be u(-3). Let y be (-43)/(-3) - 1/3. Suppose y = hk - k. What is the tens digit of k? 1 Let p = 0 + -4. What is the units digit of (p/(-10))/((-1)/(-10))? 4 Let t(l) = 7 + 3l - 3 + 1. What is the tens digit of t(6)? 2 Suppose -5v = -3j + 26 - 10, 3j - 4v - 14 = 0. Suppose -3 = -jp + 3. Suppose -6 = -c - 2d, -4d + d = -p. What is the units digit of c? 4 Suppose -4q + 0a - 2a + 6 = 0, 2a = 2q. What is the units digit of 318/15 - q/5? 1 Suppose 0 = -c - 4d + 123, 0c + 5c + 4d - 583 = 0. Suppose 4w = -w + c. What is the tens digit of w? 2 Let h(r) = -3r*3 - 2r*2 + 3r + 3. Suppose 15 = -q - 4y - 7, 5y = -5q - 35. What is the tens digit of h(q)? 1 Let q(z) = -z2 + z + 24. Let u be q(0). Suppose 0 = 4d - 4i - u, -4d + 2i = -11 - 7. What is the units digit of d? 3 Let x(m) = m3 + m2 - 10m + 7. What is the hundreds digit of x(6)? 1 Let t be (8/(-12))/((-4)/(-6)). Let c be (1/1)/t-2. What is the units digit of (-5 - 1)/(c + -4)? 3 Suppose 5 = -0s + 5s. Suppose 5b - 5i - 10 = 0, 5b - 11 = -i - s. Suppose by = -0y + 22. What is the tens digit of y? 1 Suppose 3c = -0c - 36. Let r be 40/c(-6)/5. Suppose rw = 33 - 13. What is the units digit of w? 5 Let v = 3 - 5. Let n = 7 + v. Suppose h - 3b + 56 = 5h, nb - 14 = -2h. What is the tens digit of h? 1 Let r be 43 - (-4 - (1 - 1)). Suppose -4a + 69 = -r. What is the tens digit of a? 2 What is the units digit of 834/15 + 2/5? 6 Let v be -342(-3 - (-5)/2). Let d be (-1 + 5)(-2)/(-4). Suppose -5s + ds = -5l + 34, -4l + v = s. What is the units digit of l? 8 Suppose 0 = -o + 3 - 1. Suppose -o - 3 = -5s. What is the units digit of s? 1 Let k = 17 - 11. What is the tens digit of (k/(-5))/(1/(-30))? 3 Suppose -14 = -4o + 26. What is the units digit of o? 0 Let p(v) = -v + 10. Let a be p(6). Let g be 3/120 - -3. Let j = a - g. What is the units digit of j? 1 Suppose -29 + 4 = -5s. Let o(f) = f + 2. Let c be o(2). Suppose -v + 0t = -st - 3, cv + t - 12 = 0. What is the units digit of v? 3 Let y = 102 + -47. What is the tens digit of y? 5 Suppose -386 = -4h + 66. What is the tens digit of h? 1 Suppose -42 = -7a + 5a. Suppose -21 = -3w + a. What is the tens digit of w? 1 Let m = -541 - -840. What is the hundreds digit of m? 2 Suppose 0 + 5 = -l, -3x + 660 = -3l. What is the units digit of x? 5 Suppose 0 = -3q - 4m + 29, m - 43 = -4q - 0m. What is the tens digit of q? 1 Let z(h) = -h2 - 3h + 2. Let u(c) = -c*3 + 8c*2 - 8c + 4. Let y(o) = 2o + 1. Let t be y(3). Let d be u(t). What is the units digit of z(d)? 2 Let h = -269 - -409. What is the tens digit of h? 4 Let x(p) = -p2 + 3p. Let n be x(3). Suppose n = 4r - 3r + 3. Let w = -2 - r. What is the units digit of w? 1 Let o = 22 + -15. Suppose 0 = 4d - 3d + o. Let h(w) = -w - 1. What is the units digit of h(d)? 6 Suppose 3c - 8 = -c. Suppose -19 = -cg - 5. Let f(k) = -k*3 + 8k*2 - 8k + 10. What is the units digit of f(g)? 3 Let r(k) = -k*2 + 7k - 4. Let a be -3(1 + 24/(-9)). What is the units digit of r(a)? 6 Let o(f) = -f + 1. Let z be o(1). Let p(g) = -g3 + g2 - g + 1. Let s be p(z). Suppose -s + 4 = y. What is the units digit of y? 3 Suppose 2c - 4j = c - 6, 0 = -c - 3j + 8. Let g(n) = n*3 + 5n*2 - 6n - 4. Let u be g(-5). Suppose 0o = -co + u. What is the tens digit of o? 1 Let l(r) = 3r - 9. Suppose 3 - 31 = -4f. Let v be l(f). What is the units digit of 3/(-2)v/(-18)? 1 Suppose -6 = -5n + 2n. Suppose -2o - no = -44. What is the units digit of o? 1 What is the units digit of (1056/60)/(1/5)? 8 Suppose -3z = 2w + w - 189, -47 = -z + 3w. What is the tens digit of z? 5 Let b(r) = -41r3 + r2 + r + 1. Let k be b(-1). Suppose 2v + 72 = 5v. What is the units digit of (8/v)/(2/k)? 7 Let v = 14 + -12. Suppose -va + 4a + 61 = 5t, 2t = 3a + 31. What is the tens digit of t? 1 Let u be 0 - (-4)/((-8)/(-6)). Suppose -ul + 8 = 2. What is the units digit of -2 - (-2)/l12? 0 Let t(d) be the second derivative of 2d3/3 + d2/2 - 2d. Suppose 2o + 3p = 23, p - 5p + 16 = -o. What is the units digit of t(o)? 7 Suppose 0 = -a - 4a. Let g be (-9 - (-4 + 1))/(3/(-2)). What is the units digit of (-1)/((-2)/g - a)? 2 Let y be 6/30 - (-72)/(-10). Let o(t) be the second derivative of t*4/12 + 5t*3/6 - 4t*2 - t. What is the units digit of o(y)? 6 Let r be (-16)/56 + 74/14. Suppose -r = i - 12. What is the units digit of i? 7 What is the units digit of 8010/40 + 2 - (-1)/(-4)? 2 Let j(i) = -8i2 - i3 + 6i + 2i*2 - 1 + 0i*3. Let s(o) = 8o*3 + 2o*2 + o. Let u be s(-1). What is the units digit of j(u)? 6 Suppose -25 = 3u + 23. Let d = -3 - u. Let j = d - 7. What is the units digit of j? 6 Let s(r) = 6r - 8. Let c be s(6). Let k(z) = z3 + 3z*2 - 2. Let w be k(-2). Suppose wh - c + 8 = -3a, h - 5a = -3. What is the units digit of h? 7 Let s(z) = 9z2 + 1 - z2 - 2z*2 - z. Let k be s(1). Let d = 11 - k. What is the units digit of d? 5 Suppose -117 = 5h + 4h. Let j = 24 - 6. Let o = h + j. What is the units digit of o? 5 Let k be 39 - (0 + -2 + 2). Let w = k + -22. What is the tens digit of w? 1 Let m be ((-18)/(-27))/(4/210). Let d = m - 19. What is the tens digit of d? 1 Let a = 2 - -1. Let q(z) = -z2 + 5z + 4. What is the tens digit of q(a)? 1 Suppose -2c + 5p - 35 = 2c, 0 = -3c - 3p - 33. What is the units digit of 18/45 + (-206)/c? 1 Let l(p) be the first derivative of -7p*2/2 - 11p - 7. What is the tens digit of l(-8)? 4 Let z(b) = -2b2 + 10b - 7. Let v(o) = 3o2 - 11o + 7. Let y = -4 - -8. Let g(k) = yz(k) + 3v(k). What is the units digit of g(-8)? 1 Suppose 105 = 2q + q. What is the units digit of q? 5 Let z be (1/2)/(2/4). Let x = z - -2. Let s = 1 + x. What is the units digit of s? 4 Let l(i) = 2i - 7. Let c(y) = 5y2 - y + 2. Let g(b) = 9b*2 - 2b + 3. Let q(d) = -5c(d) + 3g(d). Let z be q(2). What is the units digit of l(z)? 3 Let n = -341 - -632. What is the hundreds digit of n? 2 Let q = 0 - -1. Suppose 5v + q = -0v + 2h, -5h + 10 = -5v. Let c(d) = 2d3 + d2 + d - 1. What is the units digit of c(v)? 3 Suppose 6 = -q - 0q. Let v = 38 - q. What is the tens digit of v? 4 Let x be (-5)/(-1)(2 - 1). Suppose xa - 6 = -1. Let l = a - -2. What is the units digit of l? 3 Let j(x) = -x2 + 7x - 7. Suppose -2t + 8 = -4c + 5c, -5c = t + 5. Let v be j(t). Suppose -5l + 53 - v = 0. What is the units digit of l? 0 Let a(i) = -i2 + 4i - 1. Let u be a(3). Let q = -9 + u. What is the tens digit of (-4 - -6)q/(-1)? 1 Let l(u) = 4u. Let g be l(1). Suppose gb - 24 = -4q, -q + 0b = -2b + 3. Suppose 0 = -qv + 5k + 56, 4v = 4k - 1 + 65. What is the tens digit of v? 1 Suppose 0 = c + 5y - 26 - 13, -64 = -2c - 3y. What is the tens digit of c? 2 Let w(k) = -11k*3 - 2k*2 + 2k + 2. What is the tens digit of w(-2)? 7 Let k(o) = 8o2 - o - 3. Let y(a) = -8a*2 + 2a + 4. Let m(u) = 4k(u) + 3y(u). What is the units digit of m(-2)? 8 Let b(m) = -5m - 16. What is the tens digit of b(-8)? 2 Suppose -3o + 171 = 4g - 4o, -5g - 3o + 235 = 0. What is the tens digit of g? 4 Let v(t) = 2t + 1. Let q be v(3). Let o(d) be the first derivative of d3/3 - 3d*2 + 10d - 14. What is the units digit of o(q)? 7 Let y(i) = i*2 - i - 9. Let t(v) = -6 - 5 - 5 - 2v + 6 + v*2. Let l(r) = -5t(r) + 6y(r). What is the units digit of l(-6)? 8 Let k(u) = -u - 1. Let s be k(-4). Let l = s + -2. What is the units digit of l(0/1 - -9)? 9 What is the units digit of (3 - -3)6218/24? 9 Let f be 1 + 2 - 3/(-1). What is the units digit of (-8)/(1 - f/4)? 6 Let x = -7 + 11. Let p be (2/x)/(1/2). What is the tens digit of p + (-1)/((-2)/30)? 1 Suppose -14 + 5 = -c. Suppose 5r - cr = -72. What is the units digit of r? 8 Let c(r) = -2r - 7. Let b be c(-6). Suppose 0 = z - 2y, bz - 3y = -2 + 9. Suppose -2j = -3n + 28, 3n + j - 48 = -zj. What is the units digit of n? 2 Let o(u) = 4u*2 - u + 1. Le	{ "pile_set_name": "DM Mathematics" }
-13 = 3p - a. Put p, -3/7, 1/3 in decreasing order. 1/3, -3/7, p Let i be 14 - (0 - 0)/2. Suppose -q - 4n + 9 = -16, -3q + 2n + 33 = 0. Suppose qj - 7 = ij. Put j, -2, 1 in increasing order. j, -2, 1 Let v = 1.5 + 1.8. Let g = -1.3 + v. Let t = -2 + 7. Sort g, 0.05, t in descending order. t, g, 0.05 Let l(y) = -2y2 + 0y + 3y2 - 4y. Let v be l(2). Let x = 163 - 158. Sort x, 0, v in ascending order. v, 0, x Let l = 0.018 - 6.118. Let y = 4.2 + l. Let t = -1.1 + y. Put 0.4, -5, t in ascending order. -5, t, 0.4 Let q(k) = k - 1. Let z be q(-4). Suppose -5g + 3u + 10 = -2u, -g = -5u - 18. Suppose 288 = -26x - 46x. Sort z, g, x. z, x, g Let z = -4 - -90. Let j = z + -60. Let k be j/117 - 4/18. Put -4, k, -1 in ascending order. -4, -1, k Let v = 114.99 - 26.99. Sort 1/3, v, -3, 1 in ascending order. -3, 1/3, 1, v Let r = 37 - 37. Put -2/5, r, 2 in ascending order. -2/5, r, 2 Let s = 525 + -513. Suppose -3c = -c - 2. Put -4, s, c in decreasing order. s, c, -4 Suppose -4r + w = -2w - 20, -25 = -5r + 3w. Suppose -2m + 11 = 4f - r, 4f - 3m + 4 = 0. Sort f, -4, 4 in ascending order. -4, f, 4 Let b(i) = 0i + 8i - 27 - 40. Let m be b(9). Let w = 3 - 6. Sort m, -2, w in descending order. m, -2, w Suppose 270 = 3c + 3s, 6 + 74 = c - 4s. Let t = -93 + c. Put 4, 3, t, -1 in decreasing order. 4, 3, -1, t Let v(f) be the first derivative of -f*4/4 - 2f*3 + 7f*2/2 + 5f - 25. Let z be v(-7). Put z, 3, -36 in decreasing order. z, 3, -36 Let a = 255 + -259. Let t = 0.06 + 0.44. Let o = -0.7 + t. Put 10, o, a in ascending order. a, o, 10 Suppose 274 = -3j + 262. Sort 2, -1, j, 4 in descending order. 4, 2, -1, j Let s = -327.06 - -327. Put -3, -4, s, 0.3 in descending order. 0.3, s, -3, -4 Let i be 3/12(-10 - 2). Sort 31, i, 0 in decreasing order. 31, 0, i Let l = -210 - -205. Sort 103, l, -0.3 in descending order. 103, -0.3, l Let d be (-4(-2 + 1))/1. Let y = 2776 - 2781. Put d, -34, y in descending order. d, y, -34 Let v = -0.3241 - 0.0759. Put -6, v, -0.6, -1/2 in increasing order. -6, -0.6, -1/2, v Suppose 0 = 2r + 3r + 15. Suppose -3p = -8p + 35. Suppose 5y - 22 = 3m, -py + 4y - 4m = -19. Put y, 2, r in ascending order. r, 2, y Let v(f) = f*3 - 49f*2 - 4f - 86. Let h be v(49). Sort 2, h, 5 in decreasing order. 5, 2, h Let h be (11/3)/(127/(-1143)). Let r be -2 + 2 + 1 + 1. Sort r, 5, h in ascending order. h, r, 5 Let u be (8/(-14))/(36/(-252)). Sort -14, -2/7, u, -0.1 in descending order. u, -0.1, -2/7, -14 Let q be (-13 + 1)(-2)/8. Suppose -5b = -6 + 16. Put b, 1, q in ascending order. b, 1, q Let d = 19577643/130 + -150598. Let x = 9/26 + d. Let a = 2.2 + -2. Sort a, x, -3/8. x, -3/8, a Suppose 44q + 28q = 72. Sort -57, q, 5 in decreasing order. 5, q, -57 Let l = -2 - -2. Suppose -c + 3 = 0, c = 5f + 4c - 34. Let a be (1 + f)/842. Sort l, -2/11, a in descending order. a, l, -2/11 Let q = 15/19 + -18/95. Sort 5, q, -0.5, -5. -5, -0.5, q, 5 Let d = 956 - 956.1. Let k = -8.93 - -9. Sort 4, -1/3, k, d in decreasing order. 4, k, d, -1/3 Let q = 3 - 2.5. Let j = 20923 - 20923.3. Put 2/7, j, q, -5 in decreasing order. q, 2/7, j, -5 Let x = 1155 + -1158. Sort x, -4, -5, -7. -7, -5, -4, x Let m = -3 + 3. Let b be ((-18)/(-36))/((-55)/(-20)). Sort m, b, -0.2 in increasing order. -0.2, m, b Let f = -0.2 + 1.2. Let n = -43 + 41. Let t = n + 1.7. Sort t, 2, f in ascending order. t, f, 2 Let t = 133 - 100. Let a = 33 - t. Put a, -1, 1 in ascending order. -1, a, 1 Let v = 48 - 46. Sort 1/8, -8, v, -4 in ascending order. -8, -4, 1/8, v Let a = 1086 + -1034.1. Let u = -52 + a. Sort 1, 5, u in ascending order. u, 1, 5 Suppose 0 = 5a - 4y + 19 + 4, -y = a + 1. Put a, -9, 3/4 in increasing order. -9, a, 3/4 Suppose 1 - 6 = -2m + 5n, 0 = -4m - 3n + 23. Suppose i - 100 = 5z, -2z - 51 = 2z + 5i. Let b = z + 23. Sort b, 2, m in increasing order. 2, b, m Suppose -2d - 9 = -7. Let m be d/4 - 51/(-12). Sort -5, 1, m. -5, 1, m Let t = -2.91 - -3. Let c = t + 0.91. Let b(f) = f + 9. Let s be b(-12). Sort c, s, 0. s, 0, c Let u be (-3 - 110) + 24/(-8). Let t be 3/4 + (-145)/u. Put t, 16, -2 in ascending order. -2, t, 16 Let n(y) = -5y - 18. Let d be n(-4). Suppose 27 = -v - dv. Sort v, 5, -3 in descending order. 5, -3, v Suppose 2f = s - 2s + 2, -s + 5 = 5f. Let a be ((-4)/3)/((-4)/(-6)). Put 29, f, a in descending order. 29, f, a Let y = -6 + 0. Let u = y + 5.7. Let z = -2867/19 + 151. Put 2/3, z, u in descending order. 2/3, z, u Suppose 12d + 25 = 13. Let g = -16 - -34. Sort g, d, -5. -5, d, g Suppose -48 = -6h - 12. Put 2, 1, -5, h in increasing order. -5, 1, 2, h Suppose -3q + 375 = 4z, -5z + 465 = -2q + 7q. Let x = -91 + z. Sort 4, x, -2, 3 in decreasing order. x, 4, 3, -2 Let w be 2 + -2 - 5/5. Let r = -27 + 25. Sort 0, r, w in descending order. 0, w, r Let y(j) = -j*3 - 3j*2 + 18j - 6. Let a be y(-6). Suppose -o - 2o = -6. Sort o, -4, 1, a in descending order. o, 1, -4, a Let c be (32/20)/(-18/(-20)). Suppose 0 = 4h + 10 + 18. Let p = h + 5. Put c, -5, p in increasing order. -5, p, c Suppose -2y + 11 - 1 = 0. Let a be (-4 + 5)/(1/y). Let c = -8 + 10. Sort c, -2, a. -2, c, a Let o(l) = 3l2 + 5l - 38. Let v be o(-5). Put -1, 2, v in ascending order. -1, 2, v Suppose 4i - 28 = -4s, -2i = 2i - 16. Suppose -4v = -sv - 4. Suppose -5u - 29 = -v. Sort 3/4, u, -2/3 in decreasing order. 3/4, -2/3, u Let y = 0.05 + 0.35. Let r = -508 + 505. Put -1, -0.5, y, r in decreasing order. y, -0.5, -1, r Suppose -6k - 12 = -2k. Let c(w) = -2w2 - w - 14. Let r(v) = -v2 - v - 7. Let a(n) = kc(n) + 7r(n). Let g be a(-3). Sort -6, g, 3. -6, g, 3 Let l be 2 + (-3014)/(-66) + (-2)/3. Let c = l - 46. Sort -6, -1, c in decreasing order. c, -1, -6 Let q = 2.8 - 3. Let k = -0.41 - -0.11. Let s = -0.148 - -0.048. Sort s, q, k in ascending order. k, q, s Let p(f) = 3f + 39. Let w be p(-14). Put 2, w, -4 in increasing order. -4, w, 2 Let d = 125 + -125.083. Let w = d - 10.917. Sort 4, w, 0.5. w, 0.5, 4 Let w = 29 - 26. Let t be 7 + 0 - (-6 + 3 + w). Sort -3, -5, t in descending order. t, -3, -5 Suppose 3l + 12 = -3p, 117p - 122p = -l + 8. Sort 1, 155, -3, p in ascending order. -3, p, 1, 155 Let o be (-2)/5 + (280/(-50) - -9). Suppose -9c = -ow - 4c - 5, 4w = 5c. Let y = 7 + -10. Sort y, w, -3/2 in decreasing order. w, -3/2, y Let z(y) = -y*2 - 8y + 471. Let n be z(18). Sort -4, -47, n. -47, -4, n Let h be (-172)/22 + 24/(-132). Sort -2, -1, h, -7 in ascending order. h, -7, -2, -1 Let d = -125 + 255/2. Let u = d + -3. Sort -2/9, u, -5, 0.2. -5, u, -2/9, 0.2 Let r = -4 - -3.7. Let s = -76 + 71. Let i(u) = -u*3 - 9u*2 - 22u - 3. Let q be i(-4). Put q, r, s in ascending order. s, r, q Let c = 618 + -622. Sort c, -0.3, 4.54. c, -0.3, 4.54 Let u be (3 - (-30)/(-9))0. Put -3, u, 12 in ascending order. -3, u, 12 Let f be ((-41)/(-2))/((-3)/2 - -1). Let x = -36 - f. Let l = -8 + 5. Sort 0.1, x, l in ascending order. l, 0.1, x Let o = -0.4243 - -0.1243. Sort o, -5, 32, -0.2. -5, o, -0.2, 32 Let n be (-13)/(-26)(-4)/2. Put -16, 1, n in decreasing order. 1, n, -16 Suppose -d - 4 = 1. Let a be ((-58)/(-10) - (-4)/(2 - -18)) + -8. Put d, a, 21 in ascending order. d, a, 21 Let u = -0.542 + 0.142. Sort -0.19, 2, u, 3. u, -0.19, 2, 3 Let l be 12/(-2940)-14 - 1/(-14)2. Let z = 0.02 - 0.42. Sort l, 0.4, 5, z in decreasing order. 5, 0.4, l, z Let l(z) = -z - 5. Let h be l(-9). Let d be (-8 + 2)(-1)/2. Suppose -7 = 2p - 9. Sort h, p, d in decreasing order. h, d, p Let g(s) = s*2 + 2s + 3. Let a be g(3). Let z be (a/(-12))/(1/2) + -5. Sort -5, 1, -3, z in ascending order. z, -5, -3, 1 Let o be ((-200)/16 - 6)/(5/30). Sort -5, 3, o, 0 in descending order. 3, 0, -5, o Let l = 2.8 + -0.1. Let f = l - 3.7. Sort f, 0.5, -5. -5, f, 0.5 Suppose -5h - 2a + 5 = 0, -19 = 2h + 5a - 0a. Put 1, h, 26 in decreasing order. 26, h, 1 Suppose 5z = -4z + 36. Suppose -2 = -2x + 2. Let v(b) = b3 + b2 + 1. Let y be v(0). Sort y, x, z in decreasing order. z, x, y Let u = 377.4 + -377. Put 32/5, u, 0.3 in decreasing order. 32/5, u, 0.3 Let c = 1503 - 1547. Put 6, -0.3, c in ascending order. c, -0.3, 6 Let o = 12 + 14. Let v = -36 + o. Let i = v + 11. Sort i, 3/4, 3 in ascending order. 3/4, i, 3 Let r = -6 - -4	{ "pile_set_name": "DM Mathematics" }
871.113 Sum 4539 and 385.42855. 4924.42855 What is -48.515989 take away -2.2? -46.315989 -51637201 + -20.8 -51637221.8 What is -8686781.1 take away -94? -8686687.1 507168637 + -31 507168606 What is -2071.2 plus -0.00077? -2071.20077 Calculate 6 + 1875.71407. 1881.71407 What is 3717697 - -0.1? 3717697.1 28222174+-0.096 28222173.904 Put together -1063 and 203849. 202786 Calculate 8976079179 + -0.5. 8976079178.5 What is -18957 - 0.13794? -18957.13794 What is -768418007.5 less than 5? 768418012.5 What is 12503 minus -1356? 13859 Work out 3163 - 15.80572. 3147.19428 Sum 23.7 and -2.5168849. 21.1831151 What is the distance between -47.131578 and 0.04? 47.171578 Calculate -27138 + -261.5. -27399.5 0.0139+4979 4979.0139 What is the difference between 1.1 and -97965664.2? 97965665.3 Calculate -1245585283 - -0.4. -1245585282.6 Calculate -0.4 + -5029177.591. -5029177.991 What is 301733 less than 167? -301566 What is -5 - 9898699? -9898704 What is -0.2 + -54.95437? -55.15437 What is -4801 plus -58137? -62938 What is -0.017 plus -885615? -885615.017 Calculate 26.9 + 16316150. 16316176.9 Put together -31069257.4 and 0.04. -31069257.36 Calculate 17669093617 - -5. 17669093622 What is -72995078 less than 0.22? 72995078.22 Work out 0.04186 - -3950.9. 3950.94186 What is the distance between -544.6 and 4.79153? 549.39153 What is 2.9 + -29015538? -29015535.1 Total of 697751171 and -1. 697751170 Add 4320171 and 133. 4320304 Work out -11748921 + 1.1. -11748919.9 Calculate -1124 - -142.3. -981.7 Work out 14994 + -2125.4. 12868.6 Work out -432 - 156649. -157081 465 - 276671 -276206 What is 12452 less than 4697442? 4684990 Subtract -141 from -57.793. 83.207 Calculate -3.53673 + 3.373. -0.16373 Add together 24781597 and 0.14. 24781597.14 What is 8737 minus -419? 9156 Sum -11789477178 and 5. -11789477173 What is 31346 plus 5610? 36956 What is -53876 - -62697? 8821 What is the difference between -141 and -126.692? 14.308 Calculate -291874 - 1.22. -291875.22 Add together 88.61 and 13.5. 102.11 What is the difference between -4576.725 and 6? 4582.725 Subtract 145570198 from 0.578. -145570197.422 Sum 10 and 2073494. 2073504 Add together -75440867818 and 4. -75440867814 Calculate 40103.9661 - 0.2. 40103.7661 Total of -2804 and 2781.755. -22.245 Calculate -41.1 + -174405. -174446.1 Work out 18016 - 0.3741627. 18015.6258373 What is 1201318 take away 20? 1201298 Subtract 21100784.5 from -5. -21100789.5 Calculate 878624.2417 + 7. 878631.2417 What is the difference between 0 and 17284.272? 17284.272 Sum 0.4 and -15587598. -15587597.6 Calculate -4.48 - -43353. 43348.52 What is the difference between -489 and -51516.5? 51027.5 Subtract -3.554 from -40.01. -36.456 216996134 - 26 216996108 Put together -85455072.6 and 2. -85455070.6 Subtract -3 from -24279524. -24279521 What is -36012.7 less than -18537? 17475.7 Work out 35.167 - -15641. 15676.167 Work out 0.0243659 + 59864. 59864.0243659 7130628+-0.1 7130627.9 What is 0.1 - 137973191? -137973190.9 What is -130701 - 0.549? -130701.549 Subtract 19 from 163814316. 163814297 What is -12 take away -59.228692? 47.228692 Work out -55925 - -0.017. -55924.983 What is 0.2 + 45993187? 45993187.2 Calculate -0.507 + -8065.826. -8066.333 Add together -236 and 28.0413. -207.9587 -1631.9 - -0.0876545 -1631.8123455 Work out -646 - 6488. -7134 Add 27908 and 63.404. 27971.404 Calculate -30719 - 155598. -186317 What is -171 plus -0.5789796? -171.5789796 Add -113.3367 and 0.145. -113.1917 Calculate 21.569 - 0.1586. 21.4104 What is 1040348 minus -40? 1040388 Add 265633 and -0.40744. 265632.59256 What is 0.05873 plus -253.19? -253.13127 71654+-8120 63534 Calculate 4.581207 - 5. -0.418793 What is 92.7 take away 1880? -1787.3 Total of -0.2 and -62.26637. -62.46637 What is -17 - -66.800959? 49.800959 What is 1615373 less than -87? -1615460 Work out -0.1 + 77397036. 77397035.9 -35 + -6.05968328 -41.05968328 What is the difference between 0.212 and -11.112914? 11.324914 Add -41184499.89 and -7. -41184506.89 What is 0.03 - -2194110010? 2194110010.03 Add together -0.2 and -604152.19. -604152.39 What is the difference between 0.1 and -107310997? 107310997.1 What is -21.1 take away 2375518? -2375539.1 Calculate 85 - -201161538. 201161623 What is 11031 take away 195181? -184150 Add together 1337487 and 781. 1338268 Put together 0.0343 and -2.02209. -1.98779 What is -0.276 less than 4523227? 4523227.276 Work out -1 - -0.5389566843. -0.4610433157 Sum -3 and -28813.8548. -28816.8548 What is -1020960773 + 0.2? -1020960772.8 Work out -2214 - -61.5. -2152.5 What is -0.6 + -11963568? -11963568.6 Put together 0.3 and -198273679. -198273678.7 Calculate 124795.1 - -2033. 126828.1 Add together 17 and 54102917. 54102934 5034.8255 - 1 5033.8255 What is 27555444562 - 0.2? 27555444561.8 Put together 0.3 and -2628.92518. -2628.62518 Calculate -5716873 - 2. -5716875 What is 3 minus 4520950? -4520947 Calculate -1295497 - 0.59. -1295497.59 Add together 884 and 12122216. 12123100 Work out -534782.142 - -0.5. -534781.642 What is 2446 + -36661? -34215 What is the difference between 0.8327447 and 0.09? 0.7427447 Work out 1479615 + -0.065. 1479614.935 Add -0.7713 and -433819. -433819.7713 What is -2462 minus 7197? -9659 Subtract -326.4 from -2988164. -2987837.6 Total of 0.9 and -112969.6402. -112968.7402 What is the difference between -1773 and 0.08388? 1773.08388 What is the difference between -3 and -771.7895? 768.7895 Total of -137 and 6256802. 6256665 Subtract -300 from 173813. 174113 What is -2850 less than 2728.2116? 5578.2116 What is the difference between 21138 and 0.0120505? 21137.9879495 Add -29088242 and 11.65. -29088230.35 What is 0.068 plus 5.3750073? 5.4430073 What is the difference between -50.68 and -60391.82? 60341.14 3 - -5.096079189 8.096079189 Put together 16 and -10523.85. -10507.85 What is -0.15401 plus -1346193? -1346193.15401 What is -0.4 minus 667514018? -667514018.4 -22398.79+4287 -18111.79 Total of 0.6004 and 0.1447776. 0.7451776 Work out 0.418632241 - -0.4. 0.818632241 What is 2.1 - 1392682? -1392679.9 What is the difference between -144206.3 and -8? 144198.3 Add -10 and 20642930. 20642920 Calculate -0.9309 + 176559. 176558.0691 Total of -279936 and 1128. -278808 Add together -81022 and 4567. -76455 What is -46 less than 26122? 26168 Calculate -112.3487 + 527.6. 415.2513 Sum -4220049675 and 0.2. -4220049674.8 Add together 0.8 and 133277389. 133277389.8 Add 3.3261 and 0.8958. 4.2219 858815294 + -0.5 858815293.5 Sum -5 and 12.400028. 7.400028 Calculate -9892935070 - -0.4. -9892935069.6 Sum -0.4 and 187.80484. 187.40484 What is 1568930952 take away 0.2? 1568930951.8 Total of 86 and -7836547. -7836461 What is the difference between 346.6 and 0.0173527? 346.5826473 -1817 + 7.46919 -1809.53081 What is 112685 - 5834? 106851 What is 1.9 + -1693416? -1693414.1 -79 + -1898.707 -1977.707 226.6316394+3 229.6316394 Add -130838421 and -0.055. -130838421.055 What is 12553194 + -0.014? 12553193.986 What is -0.14726 plus -8106? -8106.14726 Work out 53310 + -665. 52645 Calculate -0.4 - -73410300. 73410299.6 Total of -53 and 7510.738. 7457.738 What is 37 less than 0.0786453? -36.9213547 Add together -73601 and 4226. -69375 Calculate 11282 + 0.875. 11282.875 Work out 30026 + 30.57. 30056.57 What is 4529031.669 less than -0.3? -4529031.969 Add together 12268771.389 and 0.5. 12268771.889 What is -15070 + -0.4142238? -15070.4142238 What is 6793 less than 161005? 154212 Total of 104 and -164618. -164514 Put together -13839953418 and 4. -13839953414 82330 - 1.52 82328.48 Work out 0.0006465 - 0.15. -0.1493535 What is 1.6917 minus 150.55? -148.8583 Calculate 153 - -2047929. 2048082 What is the distance between 0.12 and 506866.38? 506866.26 Sum 1.4 and 286160. 286161.4 0.007 - 462965.71 -462965.703 Work out 2.57095839 - 21. -18.42904161 Subtract -5.5 from -27315253. -27315247.5 Add -9.34228 and 0.3. -9.04228 Work out 475165 + -0.225. 475164.775 What is the distance between -803578908 and -0.4? 803578907.6 Calculate -0.0998464 - -75. 74.9001536 What is 877418788 minus 1? 877418787 What is 0.082 take away 10356.45? -10356.368 What is 8369.88 - -12034? 20403.88 -0.227+-2048.2071 -2048.4341 Add -30.793 and 0.03391. -30.75909 628+3283442 3284070 Work out -0.11 - -2522.053. 2521.943 0.18745	{ "pile_set_name": "DM Mathematics" }
n. -5n(n - 2)*2 Let w = -16905 + 67623/4. Factor -3/2 + wv + 3/2v2 - 3/4v*3. -3(v - 2)(v - 1)(v + 1)/4 Let n(z) = -z*2 + 2z + 5. Suppose -2g = -2q + 20, -12q + 45 = -4g - 7q. Let y(m) = -1. Let i(t) = gn(t) - 30y(t). Factor i(k). 5(k - 1)*2 Let k(l) be the first derivative of -3/20l*5 + 3l*3 + 21/4l*2 + 15/4l + 3/8l4 + 21. Factor k(v). -3(v - 5)(v + 1)3/4 Let p(g) = 15g + 47. Let q be p(-3). Factor 0c + 4/5c*3 + 0c*q + 0 - 2/5c*5 - 2/5c*4. -2c*3(c - 1)(c + 2)/5 Let g(x) be the second derivative of x6/10 + 3x*5/10 - 7x*4/4 + 2x*3 + 531x + 2. What is o in g(o) = 0? -4, 0, 1 Let x(g) be the third derivative of g8/10080 + g7/1008 + g6/720 - g5/80 + 3g3/2 - 13g*2. Let k(w) be the first derivative of x(w). Factor k(i). i(i - 1)(i + 3)2/6 Let i(m) be the first derivative of 9m*6/7 + 216m*5/5 - 792m*4/7 + 2144m*3/21 - 240m*2/7 - 3. Factor i(w). 2w(w + 30)(3w - 2)3/7 Suppose 0n + n = 4n. Find h, given that 4/3h*2 + 4/3h*4 + nh + 0 + 8/3h3 = 0. -1, 0 Let a be (-21)/(-3) - ((-6039)/81)/(-11). Factor 8/9j + 8/9 + aj2. 2(j + 2)*2/9 Let j(m) = -2m*2 - 4m + 4m2 + 2m*2 - 34m*3 - 2 + 30m*3. Let y(l) = -5l*3 + 4l*2 - 5l - 3. Let i(t) = 3j(t) - 2y(t). Factor i(v). -2v(v - 1)2 Let x(j) = j5 - j4 + j3 + j*2. Let i(y) = 24y*5 - 6y*4 + 66y*3 + 70y*2 + 18y. Let p(m) = -2i(m) + 44x(m). Factor p(f). -4f(f + 1)*2(f + 3)*2 Suppose 4v + v - 40 = 0. Suppose -4g + 10 = g - d, 4g = 4d + v. Factor 24r*3 - 4r2 + r - rg - 8r3 - 3r*2. r(4r - 1)2 Let b be ((-12)/(-21))/(6/21). Let k be (-2)/(10/9) + b. Factor 1/5 + 1/5o - 1/5o2 - ko*3. -(o - 1)(o + 1)2/5 Let o(d) be the first derivative of -d3/5 + 51d2/10 + 54d/5 + 131. Determine r so that o(r) = 0. -1, 18 Let q = -1/442 - -111/221. Let p(y) be the first derivative of -15/4y4 + 7 + qy*6 + 12y2 - y3 + 3/5y5 - 12y. Factor p(h). 3(h - 1)3(h + 2)*2 Suppose 8x + 11x = 95. Suppose -4u - 3 = -xy + 1, -5y = -3u - 8. Determine h so that 6/5h*u + 3/5h*3 + 0h*2 + 0h + 0 + 3/5h5 = 0. -1, 0 Let k(b) = 3b*4 + 7b*3. Let a(h) = -4h*4 - 10h*3. Let p be 9/610/3. Let g(o) = pa(o) + 7k(o). Factor g(n). n*3(n - 1) Suppose 660v + 2366 - 1163 - 1153 + 2178v2 = 0. What is v? -5/33 Let x(t) be the first derivative of -t6/6 + 4t5 - 19t4/4 - 366. Factor x(i). -i3(i - 19)(i - 1) What is j in -3j4 + 3j*2 + 19j*3 - 4j3 - j2 - 15j + j2 + 0j2 = 0? -1, 0, 1, 5 Let y(l) be the second derivative of l4/42 - 5l3/3 - 36l*2/7 - 16l + 1. Determine z so that y(z) = 0. -1, 36 Let n(p) = p*2 + p + 1. Let j = 13 + 7. Let z = j + -15. Let m(d) = 3d*2 + 11d + 5. Let f(t) = zn(t) - m(t). Factor f(q). 2q(q - 3) Let x(g) be the third derivative of -g5/330 + 15g*4/22 - 675g3/11 + g2 + 20g. Factor x(d). -2(d - 45)2/11 Let m(f) be the second derivative of f4/60 - 11f3/15 - 15f*2/2 + 9f + 2. Factor m(h). (h - 25)(h + 3)/5 Let c be (-1)/20/(-3). Find b, given that 3b3 - 3b*5 - 33b*4 + cb*3 + 33b*4 = 0. -1, 0, 1 Let m(r) = 3r*4 - 7r*2 + 6r + 2. Suppose 0 = 8n + 23 + 1. Let c(q) = 3q*4 - 6q*2 + 6q + 3. Let h(x) = nm(x) + 2c(x). Factor h(p). -3p(p - 1)*2(p + 2) Let a(l) be the second derivative of l3/6 + l2/2 - 6l. Let b be a(3). Solve -16n + 9 + bn + 2n2 + 9 = 0 for n. 3 Let b(x) be the second derivative of x4/4 + 21x3/2 - 108x*2 - 5x. Factor b(s). 3(s - 3)(s + 24) Suppose 159o - 157o = 8. Suppose -8 = -3j - of + 16, 0 = -2j + 3f - 1. Let 1/2k2 - 1/2k*j - 1/4k*5 + 0k*3 + 1/4k + 0 = 0. What is k? -1, 0, 1 Let w(v) = -v*3 - 32v*2 - 22v + 281. Let n be w(-31). Let -27/2 + 9b - 3/2b*n = 0. What is b? 3 Solve -110/3r*2 + 98/3r*3 - 92/3r - 16/3 + 6r5 + 34r*4 = 0. -4, -2, -1/3, 1 Suppose -33 = -3d - 3w, 4w - 22 = 6. Suppose 0 = -2f - 6, -6f + 2f = -5q + 12. Determine m so that -1/3m5 + qm*3 + 1/3m*d + 0m*2 + 0 + 0m = 0. 0, 1 Solve -85 + 39v - v + 39v - 22v + 20v + 10v2 = 0 for v. -17/2, 1 Let z be (74/30)/(((-1664)/12)/(-8)). Let l = 3/52 + z. Factor 0 - lb + 1/5b2. b(b - 1)/5 Let v(j) = 14j4 - 10j*3 - 20j*2 - 42j - 46. Let q(m) = -5m4 + 4m*3 + 7m*2 + 14m + 16. Let f(t) = 11q(t) + 4v(t). Factor f(z). (z - 2)(z + 1)2(z + 4) Let n be ((-2)/(-3))/((-9)/(-27)). Factor -6 - 285r4 - 8r + 287r4 - 11r2 - rn + 24r. 2(r - 1)*3(r + 3) Let r(y) be the second derivative of y*4/60 - 19y*3/15 + 361y*2/10 - 21y + 1. Factor r(t). (t - 19)*2/5 Suppose -k - p + 9 = -3p, -4p + 66 = 10k. Factor 73/6c2 + kc + 28/3c3 + 8/3c4 + 3/2. (c + 1)2(4c + 3)*2/6 Let y(v) be the first derivative of -2v*3/33 - 13v*2/11 - 450. Let y(i) = 0. What is i? -13, 0 Let j = 9 - 4. Let -2s*3 + 8s + 14s2 - 4s3 - s5 - 18s2 + js*4 + 0s5 = 0. Calculate s. -1, 0, 2 Factor -12 - b4 + 16b + 5b*2 - 3b3 + b5 + 3b3 - 9b*3. (b - 3)(b - 1)*2(b + 2)*2 Let m be ((-1)/(-3))/((-4)/3)-12. Let s be ((-102)/(-42) + -2)/(m/2). Factor 4/7 + 2/7y4 + 2/7y*3 - 6/7y*2 - sy. 2(y - 1)2(y + 1)(y + 2)/7 Suppose 0p - 6p2 + 7/2p*5 - 5/2p*4 + 0 - 22p*3 = 0. What is p? -2, -2/7, 0, 3 Let 4/3f*3 + 1/3f + 7/6f2 + 1/2f*4 + 0 = 0. Calculate f. -1, -2/3, 0 Determine w, given that 15 + 3w*2 - 5w*3 + 3w - 10 - w*3 - 8 + 3w*3 = 0. -1, 1 Let f(d) be the second derivative of 0d*2 - 5/4d*4 - 7d + 0 - d*5 + 5/6d*3. Factor f(v). -5v(v + 1)(4v - 1) Let y be 12/(-54) - 83/(-9). Let m(s) be the first derivative of -2s*3 + 8 - 27s + ys2 - 5 + s3. Factor m(z). -3(z - 3)2 Let q = -31 + 36. Let r(z) = z2 + 1. Let i(f) = f4 - f3 + f + 1. Let b(v) = qr(v) - 5i(v). Find o such that b(o) = 0. -1, 0, 1 Let z = -46 - -38. Let r be 2 - (-3)/((-540)/z)-40. Factor 0y*2 + 2/9 - ry*4 - 4/9y*3 + 4/9y. -2(y - 1)(y + 1)3/9 Let i(r) be the first derivative of -r6/30 + 14r5/25 + 4r*4/5 - 14r*3/15 - 3r*2/2 + 493. Let i(s) = 0. Calculate s. -1, 0, 1, 15 Let y(h) = h + 20. Let l be y(-12). Factor -84 + 38 - 2n*2 + 38 + ln. -2(n - 2)2 Let u(z) = 5z - 17. Let o be u(4). Let p = 10 - 7. Factor 3bp + 3b + ob4 - 4b + b. 3b3(b + 1) Let r = 95 - 86. Let n(j) = -3j - 1. Let t be n(-1). Let -5v*3 + tv*3 + 2v*3 + 4v*3 - rv*2 + 6v = 0. Calculate v. 0, 1, 2 Let u(d) be the third derivative of -d8/2184 - d7/1365 + d6/156 + d5/78 - d*4/39 - 4d*3/39 - 239d*2. Suppose u(h) = 0. Calculate h. -2, -1, 1, 2 Let d be 12/545/15. Let l(k) be the first derivative of 1/3k2 - 11 + 4/9k + dk3. Determine j so that l(j) = 0. -2, -1 Solve 39i*3 + 0 + 0i - 1/2i4 - 1521/2i*2 = 0. 0, 39 Let m(s) be the second derivative of -s - 3/2s*3 - 1/80s*5 - 33 + 1/4s*4 + 0s*2. Factor m(w). -w(w - 6)*2/4 Suppose -54p + 336 = -60p. Let a = -103/2 - p. Determine i, given that -3 - ai - 3/2i2 = 0. -2, -1 Let g(p) = -p + 3. Let n be g(-15). Suppose -3f = -0f - n. Let k(r) = 5r*2 + 4r. Let w(h) = 6h2 + 5h. Let q(u) = fw(u) - 7k(u). Factor q(a). a(a + 2) Let v(l) be the second derivative of -l6/2 - 39l*5/20 - 9l4/4 + l3/2 + 3l2 + 111l. Factor v(s). -3(s + 1)3(5s - 2) Let w be 2/1206 - (-4)/10. Let b(k) be the second derivative of -k - 1/5k5 - wk*2 + 0k*4 + 1/2k*3 + 0. Let b(q) = 0. Calculate q. -1, 1/2 Let x(w) = 5w*2 + 9w + 22. Let h(j) = 11j2 + 18j + 45. Let i(b) = 4h(b) - 9x(b). Find v, given that i(v) = 0. -6, -3 Let d = -5619 + 342749/61. Let g = 101/244 + d. Factor -1/4a3 + ga - 1/4 + 1/4a2. -(a - 1)2(a + 1)/4 Let t(s) = -s*2 + 60s + 1312. Let j be t(-17). Let i be 10/(-45)(-6)/4. Suppose -2g*4 + 0 + 13/3g*j + 4/3g - 4g2 + ig*5 = 0. Calculate g. 0, 1, 2 Let t be 1 - ((-6)/(-15) - (187/55 - 1)). Factor 2/9a*t + 0a*2 + 4/9 - 2/3a. 2(a - 1)2(a + 2)/9 Let w(g) be the third derivative of -g7/210 - g6/15 - 7g5/60 + 73g2. Factor w(p). -p2(p + 1)(p + 7) Let c(u) be the second derivative of u5/40 + u4/24 - 7u3/4 - 45u**2/4 - u - 1. Let c(i) = 0. What is i? -3, 5 Let r = -	{ "pile_set_name": "DM Mathematics" }
, 5, 0, -2 Put -1, 1, -4, 4, -5, 49 in ascending order. -5, -4, -1, 1, 4, 49 Put 0.4, -3, 0.1, 8, -2/671, 0.2 in increasing order. -3, -2/671, 0.1, 0.2, 0.4, 8 Sort 5, -4, -6, 2, 10505, -2. -6, -4, -2, 2, 5, 10505 Sort -1, -7, -3, 7, 6, 3 in descending order. 7, 6, 3, -1, -3, -7 Sort -4, -249, -116 in decreasing order. -4, -116, -249 Sort -1/3, -11506, 2/19 in increasing order. -11506, -1/3, 2/19 Sort -4, 4, -5, -15, 24 in descending order. 24, 4, -4, -5, -15 Sort 2, -2, -231505. -231505, -2, 2 Put 5, 19, 2/5, 47/3, 0.2 in descending order. 19, 47/3, 5, 2/5, 0.2 Sort 26, -22, 16 in increasing order. -22, 16, 26 Sort 12543, 7, 4, 2. 2, 4, 7, 12543 Put 4/5, 2/7, -0.5, -6, -4/3, 4935 in decreasing order. 4935, 4/5, 2/7, -0.5, -4/3, -6 Put -12, 0.1577, 5.5 in decreasing order. 5.5, 0.1577, -12 Put 3/5, -5, 0.1341, 5 in ascending order. -5, 0.1341, 3/5, 5 Sort 0.2, 5, 1.91, -6. -6, 0.2, 1.91, 5 Put 9, -2436, 14 in decreasing order. 14, 9, -2436 Put 26/271, 2/19, -2, 3 in increasing order. -2, 26/271, 2/19, 3 Sort 339, 4, -5, 5, -2, -3. -5, -3, -2, 4, 5, 339 Sort -462466, 1, -2, 0. -462466, -2, 0, 1 Put -727, 0.2, -3, 4, -4, -0.2 in descending order. 4, 0.2, -0.2, -3, -4, -727 Sort 38336, -3/4, 0.4 in decreasing order. 38336, 0.4, -3/4 Put -117, 1, 288 in descending order. 288, 1, -117 Sort -669903, 4, 4/3 in decreasing order. 4, 4/3, -669903 Sort 6/11, -2/15, -1/2, 2/27 in descending order. 6/11, 2/27, -2/15, -1/2 Sort -2, 4, 0.1, 0.6, -28/9, 15 in descending order. 15, 4, 0.6, 0.1, -2, -28/9 Sort 1, -4705, -5 in ascending order. -4705, -5, 1 Put -0.17, 1, 3, -304, 18 in ascending order. -304, -0.17, 1, 3, 18 Sort 4, -36, -0.3, 0.1, 5787 in increasing order. -36, -0.3, 0.1, 4, 5787 Sort -0.67968, 2/5, 0.5 in descending order. 0.5, 2/5, -0.67968 Sort 90943, -5, -1. -5, -1, 90943 Sort 8/7, 2, -1/9, 12, 4/5, 7. -1/9, 4/5, 8/7, 2, 7, 12 Sort -5, -1.16, 2, 0.1, -1 in ascending order. -5, -1.16, -1, 0.1, 2 Put -4, -297, -1/3, -0.018 in decreasing order. -0.018, -1/3, -4, -297 Sort -3, -1, 1, 3070, -5 in ascending order. -5, -3, -1, 1, 3070 Sort -116, 1/3, -105 in descending order. 1/3, -105, -116 Sort -46, 4, 2, -5 in descending order. 4, 2, -5, -46 Sort 86, -2/11, -0.2, -3/1112, -4 in decreasing order. 86, -3/1112, -2/11, -0.2, -4 Sort -1, -2, -7930. -7930, -2, -1 Put 852, -2, -4, 4, 3 in increasing order. -4, -2, 3, 4, 852 Sort -0.209, -2, 80, 3, 2/7, 1. -2, -0.209, 2/7, 1, 3, 80 Sort -0.3, 0.1, 16, -2, 0.089, 1. -2, -0.3, 0.089, 0.1, 1, 16 Sort 3, -380, 25, -9 in descending order. 25, 3, -9, -380 Put -27, 13, -257, 3 in ascending order. -257, -27, 3, 13 Sort 0, -245, -3, 5 in increasing order. -245, -3, 0, 5 Put 1, -1, -31, -7 in descending order. 1, -1, -7, -31 Sort -1, 3, -12, -7, 0. -12, -7, -1, 0, 3 Put 5080, 2, -9 in descending order. 5080, 2, -9 Put 22.56, -1/9, 0.5, 0.2, -2 in decreasing order. 22.56, 0.5, 0.2, -1/9, -2 Sort -1, 5, -8547/34. -8547/34, -1, 5 Put -2, -76, -7, 3, 22 in increasing order. -76, -7, -2, 3, 22 Sort -3.4, -2/3, 4, -10, -0.03, -1 in ascending order. -10, -3.4, -1, -2/3, -0.03, 4 Put -2/9, 400, 2/15, -0.4, -1/6 in descending order. 400, 2/15, -1/6, -2/9, -0.4 Sort 4, 30, 3, -1, 1, 2. -1, 1, 2, 3, 4, 30 Sort 0.011, -3, 229, 0.2 in decreasing order. 229, 0.2, 0.011, -3 Sort -3, 6, -1867 in increasing order. -1867, -3, 6 Sort 0.2, -0.0616944, -1. -1, -0.0616944, 0.2 Sort -0.3, 19, -39/8 in increasing order. -39/8, -0.3, 19 Sort -4, -2/3, -2105/8, -7, -3 in decreasing order. -2/3, -3, -4, -7, -2105/8 Sort 5, -3, 326, -1057 in descending order. 326, 5, -3, -1057 Put 2/77, -4/7, 31, -2/65 in decreasing order. 31, 2/77, -2/65, -4/7 Sort -4, 61, 1, -3 in decreasing order. 61, 1, -3, -4 Put 0, -205, -4, -71 in ascending order. -205, -71, -4, 0 Put -4, -9, -15858 in decreasing order. -4, -9, -15858 Sort 10, 190, -2, 4, 0, -8 in decreasing order. 190, 10, 4, 0, -2, -8 Sort -4, 10, -2642 in descending order. 10, -4, -2642 Put 4, 0, 15, 1568, 1 in decreasing order. 1568, 15, 4, 1, 0 Sort -6, 4, -4, 1, -7, -13. -13, -7, -6, -4, 1, 4 Put 5, 2, -4, 2030, -2, 0 in ascending order. -4, -2, 0, 2, 5, 2030 Sort 0, 11/7, -2/7851. -2/7851, 0, 11/7 Sort 12, -1975, -5 in increasing order. -1975, -5, 12 Put -34, 3/10, -1/6 in ascending order. -34, -1/6, 3/10 Sort -9, 3/2, -14/3671 in descending order. 3/2, -14/3671, -9 Sort 3/5, -2, -409/8, -0.1 in increasing order. -409/8, -2, -0.1, 3/5 Sort 6, -5, -10/3, 0.2. -5, -10/3, 0.2, 6 Put -3/2, 10, 3/4, -48/11 in decreasing order. 10, 3/4, -3/2, -48/11 Put 3, -27, -2, -76, -64 in increasing order. -76, -64, -27, -2, 3 Sort 1, -66, -9, 2, 0 in descending order. 2, 1, 0, -9, -66 Put -0.0542, 14, -2 in increasing order. -2, -0.0542, 14 Put -1/122, -0.22, 1/7 in decreasing order. 1/7, -1/122, -0.22 Sort 5, 4, 44, 165, -5. -5, 4, 5, 44, 165 Sort -21, 0.1, 0.5, 3/10, -2. -21, -2, 0.1, 3/10, 0.5 Put 0.6, 2/11, -54, 1 in decreasing order. 1, 0.6, 2/11, -54 Sort 0, -46, -3, -13, -5, -16 in ascending order. -46, -16, -13, -5, -3, 0 Sort 60, 5, 4, -4, -23, -28 in ascending order. -28, -23, -4, 4, 5, 60 Put 5, -1015, -4, 3, -3 in descending order. 5, 3, -3, -4, -1015 Sort -73, 2, -3/29 in descending order. 2, -3/29, -73 Sort -29, -41, 301, 5. -41, -29, 5, 301 Put -4, -5, 23, -16175 in decreasing order. 23, -4, -5, -16175 Sort 9, -4, -1598 in decreasing order. 9, -4, -1598 Sort -224, 0, 2/11, -20/21, -3 in descending order. 2/11, 0, -20/21, -3, -224 Sort -1, -3, 8, -6, 0. -6, -3, -1, 0, 8 Put 0.022, 2, 2/3, 63, 0.04 in descending order. 63, 2, 2/3, 0.04, 0.022 Sort 175, -638, -1 in decreasing order. 175, -1, -638 Sort 3, 6710, 0 in decreasing order. 6710, 3, 0 Sort -144, 5, -64 in descending order. 5, -64, -144 Put 14, -182, -5, 4 in decreasing order. 14, 4, -5, -182 Sort -14, 2/37, 146 in increasing order. -14, 2/37, 146 Sort 0.6, 5, 4, -29.05, 4/7. -29.05, 4/7, 0.6, 4, 5 Put 3, 51, 23, -5, 4 in decreasing order. 51, 23, 4, 3, -5 Put -0.5, -70/33, 0.6 in decreasing order. 0.6, -0.5, -70/33 Put -364, -4, -53, 3, 2 in descending order. 3, 2, -4, -53, -364 Sort -0.4, 1/38, -0.1, 1 in decreasing order. 1, 1/38, -0.1, -0.4 Put -5, -3, -8, -60 in decreasing order. -3, -5, -8, -60 Sort 20, 5, 16, 49 in descending order. 49, 20, 16, 5 Sort -515, 6, -1 in descending order. 6, -1, -515 Sort -35064, -5, 3, 1. -35064, -5, 1, 3 Put -1/62, -0.154, -2, -3, -4 in descending order. -1/62, -0.154, -2, -3, -4 Put -0.09, 21, -0.12, -2/3 in increasing order. -2/3, -0.12, -0.09, 21 Sort -0.4, 160573, 1/3 in ascending order. -0.4, 1/3, 160573 Put -296066, -2/3, 1 in ascending order. -296066, -2/3, 1 Put -1, -15, -186 in ascending order. -186, -15, -1 Sort 10, -10, -4, 2. -10, -4, 2, 10 Put 2, -8, -46732 in descending order. 2, -8, -46732 Put 4679, -1, 6 in descending order. 4679, 6, -1 Sort -22077, -1/9, -3 in descending order. -1/9, -3, -22077 Sort -1, -4, -51, 1, -3 in decreasing order. 1, -1, -3, -4, -51 Put 1, 9, -18, 84, -2 in descending order. 84, 9, 1, -2, -18 Sort 0, 2, 1, -67, -6, 17 in ascending order. -67, -6, 0, 1, 2, 17 Put -3883, -11, -4 in decreasing order. -4, -11, -3883 Put 2, -0.07, -1, 2/5, 0.5, -224 in increasing order. -224, -1, -0.07, 2/5, 0.5, 2 Sort 315, -2, -5, -121, -3 in decreasing order. 315, -2, -3, -5, -121 Sort -4, 2, 159, 0. -4, 0, 2, 159 Put -4, -3, 1, 0.36, -6, -2 in ascending order. -6, -4, -3, -2, 0.36, 1 Sort 255, -3248, 0.3 in ascending order. -3248, 0.3, 255 Put -0.1, -1, 2.3, -4, -8/7, -11 in descending order. 2.3, -0.1, -1, -8/7, -4, -11 Put 32, -795, -1 in ascending order. -795, -1, 32 Sort 14, 0, 4.9, 13, -2 in ascending order. -2, 0, 4.9, 13, 14 Sort 313, -744, 1, 3, -3 in decreasing order. 313, 3, 1, -3, -744 Put 7.5, 4, -69.2 in decreasing order. 7.5, 4, -69.2 Sort -2, 6, -1, 16, -3. -3, -2, -1, 6, 16 Sort 4, -2, 0.04, 277.1, 15 in descending order. 277.1, 15, 4, 0.04, -2 Sort -0.16, -4, -6/67, 5 in descending order. 5, -6/67, -0.16, -4 Sort 2, 69, 1/2, 0.13, 0.4, 6 in ascending order. 0.13, 0.4, 1/2, 2, 6, 69 Sort 0, -19, -28, -21. -28, -21, -19, 0 Sort -18, -83, 2/5, -2/7, -3 in ascending order. -83, -18, -3, -2/7, 2/5 Sort 12.4, 20.86, -0.5 in increasing order. -0.5, 12.4, 20.86 Put 25407, 5, 1 in increasing order. 1, 5, 25407 Put 7, -20, 8, -2 in decreasing order. 8, 7, -2, -20 Sort	{ "pile_set_name": "DM Mathematics" }
is the remainder when 57 is divided by 31? 26 What is the remainder when 257 is divided by 38? 29 What is the remainder when 88 is divided by 6? 4 What is the remainder when 1942 is divided by 65? 57 What is the remainder when 365 is divided by 34? 25 Calculate the remainder when 94 is divided by 12. 10 Calculate the remainder when 217 is divided by 20. 17 Calculate the remainder when 4642 is divided by 212. 190 Calculate the remainder when 341 is divided by 32. 21 What is the remainder when 82 is divided by 30? 22 Calculate the remainder when 2794 is divided by 33. 22 Calculate the remainder when 65 is divided by 28. 9 Calculate the remainder when 29 is divided by 24. 5 What is the remainder when 417 is divided by 106? 99 What is the remainder when 2909 is divided by 2896? 13 What is the remainder when 466 is divided by 9? 7 What is the remainder when 441 is divided by 6? 3 What is the remainder when 1216 is divided by 22? 6 What is the remainder when 334 is divided by 92? 58 Calculate the remainder when 958 is divided by 141. 112 Calculate the remainder when 287 is divided by 75. 62 Calculate the remainder when 431 is divided by 153. 125 Calculate the remainder when 834 is divided by 96. 66 What is the remainder when 57 is divided by 16? 9 What is the remainder when 515 is divided by 20? 15 Calculate the remainder when 105 is divided by 23. 13 Calculate the remainder when 2385 is divided by 1189. 7 What is the remainder when 691 is divided by 33? 31 Calculate the remainder when 18 is divided by 11. 7 Calculate the remainder when 173 is divided by 44. 41 Calculate the remainder when 5434 is divided by 1811. 1 Calculate the remainder when 3318 is divided by 41. 38 What is the remainder when 14150 is divided by 232? 230 What is the remainder when 244 is divided by 35? 34 Calculate the remainder when 260 is divided by 54. 44 What is the remainder when 1234 is divided by 312? 298 What is the remainder when 20079 is divided by 251? 250 What is the remainder when 220 is divided by 21? 10 What is the remainder when 3607 is divided by 41? 40 What is the remainder when 443 is divided by 46? 29 Calculate the remainder when 1296 is divided by 143. 9 Calculate the remainder when 442 is divided by 2. 0 What is the remainder when 158 is divided by 83? 75 What is the remainder when 2515 is divided by 34? 33 Calculate the remainder when 199 is divided by 53. 40 What is the remainder when 1245 is divided by 89? 88 What is the remainder when 3095 is divided by 12? 11 What is the remainder when 126 is divided by 47? 32 Calculate the remainder when 6466 is divided by 223. 222 What is the remainder when 609 is divided by 88? 81 Calculate the remainder when 2633 is divided by 20. 13 What is the remainder when 811 is divided by 11? 8 Calculate the remainder when 677 is divided by 16. 5 What is the remainder when 143 is divided by 72? 71 Calculate the remainder when 380 is divided by 28. 16 What is the remainder when 3533 is divided by 19? 18 Calculate the remainder when 1434 is divided by 294. 258 What is the remainder when 378 is divided by 125? 3 What is the remainder when 3168 is divided by 48? 0 Calculate the remainder when 126 is divided by 56. 14 Calculate the remainder when 90 is divided by 24. 18 What is the remainder when 10290 is divided by 18? 12 What is the remainder when 182 is divided by 37? 34 What is the remainder when 236 is divided by 89? 58 Calculate the remainder when 14390 is divided by 117. 116 Calculate the remainder when 112 is divided by 24. 16 What is the remainder when 125 is divided by 77? 48 What is the remainder when 682 is divided by 651? 31 Calculate the remainder when 2994 is divided by 25. 19 Calculate the remainder when 365 is divided by 8. 5 What is the remainder when 193 is divided by 13? 11 Calculate the remainder when 1367 is divided by 225. 17 What is the remainder when 1546 is divided by 143? 116 What is the remainder when 282 is divided by 137? 8 Calculate the remainder when 86 is divided by 16. 6 What is the remainder when 217 is divided by 112? 105 What is the remainder when 200 is divided by 14? 4 Calculate the remainder when 14 is divided by 2. 0 What is the remainder when 474 is divided by 80? 74 What is the remainder when 3264 is divided by 132? 96 Calculate the remainder when 267 is divided by 77. 36 Calculate the remainder when 460 is divided by 58. 54 Calculate the remainder when 221 is divided by 75. 71 What is the remainder when 18052 is divided by 17? 15 What is the remainder when 242 is divided by 57? 14 Calculate the remainder when 886 is divided by 5. 1 What is the remainder when 7312 is divided by 23? 21 What is the remainder when 363 is divided by 28? 27 Calculate the remainder when 1908 is divided by 240. 228 Calculate the remainder when 1855 is divided by 29. 28 What is the remainder when 431 is divided by 24? 23 What is the remainder when 55 is divided by 23? 9 Calculate the remainder when 6797 is divided by 566. 5 What is the remainder when 227 is divided by 43? 12 What is the remainder when 238 is divided by 121? 117 Calculate the remainder when 8 is divided by 4. 0 What is the remainder when 1312 is divided by 189? 178 Calculate the remainder when 29 is divided by 4. 1 Calculate the remainder when 499 is divided by 324. 175 Calculate the remainder when 517 is divided by 26. 23 What is the remainder when 1218 is divided by 10? 8 What is the remainder when 1028 is divided by 20? 8 Calculate the remainder when 36652 is divided by 79. 75 Calculate the remainder when 1040 is divided by 12. 8 Calculate the remainder when 2613 is divided by 19. 10 Calculate the remainder when 372 is divided by 97. 81 Calculate the remainder when 419 is divided by 35. 34 What is the remainder when 321 is divided by 21? 6 Calculate the remainder when 536 is divided by 33. 8 Calculate the remainder when 892 is divided by 21. 10 What is the remainder when 3014 is divided by 116? 114 Calculate the remainder when 43 is divided by 4. 3 What is the remainder when 333 is divided by 14? 11 What is the remainder when 334 is divided by 17? 11 What is the remainder when 297 is divided by 143? 11 Calculate the remainder when 32959 is divided by 277. 273 Calculate the remainder when 373 is divided by 121. 10 What is the remainder when 727 is divided by 17? 13 What is the remainder when 233 is divided by 91? 51 Calculate the remainder when 2815 is divided by 6. 1 What is the remainder when 13162 is divided by 231? 226 What is the remainder when 786 is divided by 93? 42 What is the remainder when 21105 is divided by 12? 9 Calculate the remainder when 105 is divided by 32. 9 What is the remainder when 310 is divided by 133? 44 Calculate the remainder when 376 is divided by 51. 19 What is the remainder when 50 is divided by 9? 5 What is the remainder when 566 is divided by 38? 34 Calculate the remainder when 2857 is divided by 52. 49 What is the remainder when 50 is divided by 17? 16 What is the remainder when 17 is divided by 4? 1 What is the remainder when 34769 is divided by 109? 107 Calculate the remainder when 782 is divided by 56. 54 What is the remainder when 515 is divided by 156? 47 Calculate the remainder when 1619 is divided by 323. 4 What is the remainder when 356 is divided by 8? 4 What is the remainder when 1241 is divided by 252? 233 What is the remainder when 76 is divided by 26? 24 Calculate the remainder when 119 is divided by 40. 39 What is the remainder when 3177 is divided by 29? 16 What is the remainder when 1324 is divided by 102? 100 Calculate the remainder when 12953 is divided by 34. 33 Calculate the remainder when 1476 is divided by 51. 48 Calculate the remainder when 674 is divided by 142. 106 Calculate the remainder when 1330 is divided by 291. 166 What is the remainder when 216 is divided by 45? 36 Calculate the remainder when 629 is divided by 14. 13 Calculate the remainder when 192 is divided by 49. 45 What is the remainder when 859 is divided by 144? 139 What is the remainder when 171 is divided by 43? 42 What is the remainder when 105 is divided by 54? 51 What is the remainder when 98 is divided by 26? 20 What is the remainder when 338 is divided by 34? 32 What is the remainder when 813 is divided by 256?	{ "pile_set_name": "DM Mathematics" }
a - 22a = 2046 for a. 93 Solve -1255o - 174 = -1197o for o. -3 Solve -3047f + 18218f = 7848f - 864114 for f. -118 Solve -143r - 17535 + 50340 = 20078 for r. 89 Solve 1950 + 552 + 558 = 170z for z. 18 Solve 11646t + 55096 + 95375 = -39622 - 19535 for t. -18 Solve 334k - 1431 + 11223 = 1966k for k. 6 Solve -18929 + 132053 = 1374d - 14658 for d. 93 Solve 622316h - 622277h = 1560 for h. 40 Solve 0 = 45t - 1280 - 430 for t. 38 Solve -55k = 9572 - 8802 for k. -14 Solve -7033 + 6953 = 5w for w. -16 Solve -192d + 2266 = 6d + 708 + 15616 for d. -71 Solve -956 = 101i - 103i - 1140 for i. -92 Solve -132g + 3340 = -3469 - 55 for g. 52 Solve -7494 + 93 + 1519 - 5780 = 119l for l. -98 Solve 33l + 566 - 1351 = 846 - 14 for l. 49 Solve -654s = -2165s - 128435 for s. -85 Solve -1499r - 11075 - 11104 = -7487 + 7793 for r. -15 Solve -994 + 9715 = 153y for y. 57 Solve -349983 = 314z - 326119 for z. -76 Solve 0 = -51k + 221 + 108 + 28 for k. 7 Solve 907z - 1783z - 2935 = -979z + 3245 for z. 60 Solve 0 = 1139z - 987z - 760 for z. 5 Solve 6040j - 3868j = 73848 for j. 34 Solve 434y + 78y - 29659 = -9691 for y. 39 Solve -222t - 322 = -208t for t. -23 Solve -491775 = -8978c - 6963 for c. 54 Solve 974l + 4182 + 29908 = 0 for l. -35 Solve 16976 + 11260 = 435h + 3580 - 8404 for h. 76 Solve 3165s - 1443s + 62565 + 166461 = 0 for s. -133 Solve 666692 + 655860 = -11704d for d. -113 Solve 14113c - 14597c = -21296 for c. 44 Solve 180y + 63423 - 69183 = 0 for y. 32 Solve 950b - 19243 = 707 for b. 21 Solve -666 - 814 = -116c + 397c + 487 for c. -7 Solve 0 = 476f + 5951 + 7550 + 14107 for f. -58 Solve -200n - 36081 = 375n - 20n + 78n for n. -57 Solve 12357b - 5626b = 2177b + 541926 for b. 119 Solve 126250 - 227320 - 242562 = 5286g - 31758 for g. -59 Solve -133777 = -3152h + 86863 for h. 70 Solve 0 = -845y + 231y - 9450 + 16764 + 22772 for y. 49 Solve 4165050t + 13524 = 4165197t for t. 92 Solve 225q + 11415 = -193q - 198q + 4023 for q. -12 Solve -772h - 168 = 758h - 1537h for h. 24 Solve 811p + 2552 + 4480 = -3511 for p. -13 Solve -2131 - 431 = -61g for g. 42 Solve -16z - 501z = -11401 - 8762 for z. 39 Solve -1900r + 96322 = 933r for r. 34 Solve -4506d = -2160d - 2082d - 35640 for d. 135 Solve -11295s - 11280s = -22498s + 7469 for s. -97 Solve -78092 + 85282 = 719y for y. 10 Solve -998n - 648n = 71n + 9435 - 139927 for n. 76 Solve 2597a - 455033 = -3445a - 1896a + 180007 for a. 80 Solve 1668q + 1222 = 1642q for q. -47 Solve 1879i - 3488 = 1770i for i. 32 Solve -31m - 10m = 33m + 9m + 73m for m. 0 Solve -2688 - 6875 = 131z for z. -73 Solve -19q + 270 + 18 = -22q + 75q for q. 4 Solve -1681b - 224680 = -258b + 217b for b. -137 Solve 53894 = 2995y - 6936 - 22698 - 6322 for y. 30 Solve 164f + 120 = 130 - 666 for f. -4 Solve -119f = 3887 + 1349 for f. -44 Solve 0 = -9009u + 8925u - 51 - 369 for u. -5 Solve -999d = 3341 - 43245 - 3625 - 10417 for d. 54 Solve -96g = -24g - 27g - 35g - 130 for g. 13 Solve 0 = -566q + 470q - 3648 for q. -38 Solve -18l - 46 + 31 + 0 = 129 for l. -8 Solve -2097 - 5181 = -105p - 372p + 831 for p. 17 Solve -52y - 106y - 103y = -26y + 17155 for y. -73 Solve -64953258w = -64953239w + 1045 for w. -55 Solve -185v - 12533 = -513v + 6491 for v. 58 Solve 826t - 4004 = -7308 for t. -4 Solve -137p - 4 - 2459 = 1373 for p. -28 Solve -25h - 47h - 6711 + 1167 = 0 for h. -77 Solve 91d + 963 + 2143 = 295d - 770 for d. 19 Solve 1799o - 917o = 927o - 135 for o. 3 Solve 1807646n - 1807611n - 110 + 960 = -1600 for n. -70 Solve 359 - 1219 = -117n + 310 for n. 10 Solve 0 = 30l + 925 + 326 + 1111 + 98 for l. -82 Solve -30p = -1289 + 165 - 286 for p. 47 Solve 6619q - 95 = 6632q - 381 for q. 22 Solve 13821d - 1454d + 195213 = -546807 for d. -60 Solve 0 = -436y - 10719 - 13364 + 1729 + 1862 for y. -47 Solve 29778 = 967m - 56656 + 29381 for m. 59 Solve 0 = -188a + 108a + 96a + 400 for a. -25 Solve -124 + 714 + 392 = -336x - 698 for x. -5 Solve -257b + 92b - 260b + 16150 = 0 for b. 38 Solve 15n - 93n + 526 + 2282 = 0 for n. 36 Solve -76g + 1255g = -31833 for g. -27 Solve -17i + 2414 - 1089 = 8i for i. 53 Solve -1561d - 337d = -15184 for d. 8 Solve 84c + 35c = -1809 + 696 - 1505 for c. -22 Solve -1663a + 4561 + 32663 = -902a + 1307a for a. 18 Solve -101947w = -104361w + 24140 for w. 10 Solve 766r + 1262r + 194r - 10460 = 130r for r. 5 Solve -122t - 10643 = -7105 for t. -29 Solve -16523a + 16577a + 2754 = 0 for a. -51 Solve -1171n + 41639 + 287508 = -6562n - 339337 for n. -124 Solve 185k - 49k + 261785 - 263009 = 0 for k. 9 Solve -4907 = -425g + 835 - 642 for g. 12 Solve 1688y - 8519 - 2540 = -2619 for y. 5 Solve 315z - 827z = 23552 for z. -46 Solve 3721c = 3427c - 10878 for c. -37 Solve 83d = 87399 - 91051 for d. -44 Solve -321t - 4490 = t + 5814 for t. -32 Solve 609z - 75457 = 4308z + 31814 for z. -29 Solve 91 - 2487 = -100i + 1878 + 1326 for i. 56 Solve 3661068 - 3638248 = -163c for c. -140 Solve -46x - 88 = 802 + 306 for x. -26 Solve -21357 = 429t - 23931 for t. 6 Solve -45574424w + 21390 = -45574654w for w. -93 Solve 29v = 1413 + 306 - 269 for v. 50 Solve 6204b - 6198b = 162 for b. 27 Solve 1553w - 20925 = 2018w for w. -45 Solve -21d - 141d + 54d - 96d = -1632 for d. 8 Solve 219z + 170z = -532z + 1842 for z. 2 Solve 98q - 987 = 6q - 3379 for q. -26 Solve -6501 - 349 = -525g - 5183 + 18283 for g. 38 Solve -261b + 1446 - 1114 = -2017 for b. 9 Solve -5095b + 134082 = -2612b for b. 54 Solve 673q = -415 + 1686 + 1421 for q. 4 Solve 3217 = 532h - 250 - 789 for h. 8 Solve 18032947z - 462 = 18033013z for z. -7 Solve 4302k = 4343k - 533 for k. 13 Solve -203275 = 2864k + 174k + 82297 for k. -94 Solve 2211u + 76829 - 27571 = -38437 - 745 for u. -40 Solve -15a - 75a - 3547 + 9911 = 82a for a. 37 Solve -1200n - 202320 = -4010n for n. 72 Solve -2463v = 52166 - 443 for v. -21 Solve -230y + 14760 = 573y + 427y for y. 12 Solve -159u = 825733 - 838771 for u. 82 Solve 6357 = -982z + 10285 for z. 4 Solve -38k - 25k - 830 + 3372 = -k for k. 41 Solve 0 = -23p + 130p + 20741 - 19885 for p. -8 Solve -2867 = -34a + 193a - 6265 - 4393 for a. 49 Solve 64f + 3503 - 3620 = 2624 + 3851 for f. 103 Solve 0 = 896q + 89 + 245 + 562 for q. -1 Solve 13464q - 1182010 = 178q - 18830q + 2222286 for q. 106 Solve 7203 = -255w - 3854 + 13 - 941 for w. -47 Solve 1626t = 4984t + 111346 + 156718 + 181908 for t. -134 Solve 392u = 1352u + 273u + 33291 for u. -27 Solve -162v - 1760 = -1005v + 3298 for v. 6 Solve -305165 = 200i - 303965 for i. -6 Solve -3722g = 5014g + 3345g - 701g - 1308700 for g. 115 Solve 60368b - 62260b - 210012 = 0 for b. -111 Solve 0 = 1692m + 133590 + 47454 for m. -107 Solve 4746o - 4819o - 9709 = 0 for o. -133 Solve -18n = -15n - 6n + 45 for n. 15 Solve 63f - 199 = 74f - 502 - 478 for f. 71 Solve 114x + 208x - 53667 = -200x - 81x for x. 89 Solve 11932 + 1437 + 5708 = 144q + 3669 for q. 107 Solve 76c + 1133 + 2008 = 1409 - 3208 for c. -65 Solve -9v + 70v + 2708 - 755 = -1219 for v. -52 Solve -2y = -111y + 491 - 11282 for y. -99 Solve -28 = 1197o - 2388o + 1195o for o. -7 Solve -152d + 568d = -2359 + 315 - 1284 for d. -8 Solve -9160y + 4588y - 1378 = -4625y for y. 26 Solve 258g - 22680 = -72g + 142g - 316g for g. 45 Solve 16590 = 6736s - 6578s for s. 105 Solve -2100843 = 379i - 2076587 for i. -64 Solve -2378 + 5938 = 1017g + 22883 for g. -19 Solve -3942t + 4478t = -32160 for t. -60 Solve -147935 = 3600p - 230735 for p. 23 Solve 113x + 243 = 62x + 78x for x. 9 Solve 1510 + 1150 + 1834 = -214r for r. -21 Solve 906v = -933v - 154476 for v. -84 Solve -30265n - 123799 = -29108n for n. -107 Solve 43u + 191u + 348 = 60u for u. -2 Solve -22235c = -21793c + 56225 - 19097 for c. -84 Solve -590024s + 11084 = -589861s for s. 68 Solve -7538o = -3770o - 3770o for o. 0 Solve -108520 + 3548 = 2282w for w. -46 Solve 258y + 86463 - 3248 = -11y - 1244y for y. -55 Solve -9030s + 9457s - 3416 = 0 for s. 8 Solve 0 = -13803t + 13754t - 1225 for t. -25 Solve 1314*m - 738 = 15030 for m. 12 Solve 357 + 5187	{ "pile_set_name": "DM Mathematics" }
100 + 24g). 28g*2 Expand (1 - 2a - 1)(-4 - 2 - 6) - 30 - 5a + 30 + 3a + a - 3a. 20a Expand (0f - 2f + f)(f*2 - 4f*2 + 2f*2) + 3f - 2f3 + 0f - 48f3. -49f*3 + 3f Expand 7s - 6s - 2s + (-4 + 1 + 4)(-5s + 3s - s) - 6s + 6s + 4s + (3s + 2s - 4s)(1 - 3 + 1) - 2 + 2 - 2s. -3s Expand (-s - 3s + 3s)(-8s + 90 - 90)(2 - 4 + 7). 40s2 Expand (2 + 0 + 0)(0g + 3g*2 + 0g) + (-3g + 5g - 3g)(g + 2g - g). 4g*2 Expand -15 - 32a*3 + 0 + 10 - a + a - 2a3 + (a3 - 2a3 + 2a*3)(-2 + 3 - 3) + 0 - a*3 + 0 + 0a*3 + 0a*3 - 2a*3 + 3a*3 - 2a3 + a3. -37a3 - 5 Expand j - j + j4 + ((5j - 4j - 3j)(2j + 3 - 3) + j*2 + 0j + 0j + j2 - j2 + 7j*2)(-3j2 + 2j*2 + 6j*2). 21j*4 Expand -27c + 6c + 18c + 35 + (4 + 0 - 3)(0c - 3c + 2c). -4c + 35 Expand (-5j*5 + 5j*5 - 6j*5)(3 + 2 - 3) + (9j5 - 4j*5 + 7j*5)(2 - 3 - 1). -36j5 Expand (2g*2 - 6g2 - g2)(-2g + 2g - 2g*2) - 2g*4 + 12g - 12g + (5g*4 - 3g*4 - 3g*4)(-3 - 1 + 3). 9g4 Expand -2f + 4f - 4f - f + 0f - f - 3f + 0f + 2f + (f + 5f - 4f)(0 - 4 + 2) + 2 - 2 - f + (-1 + 0 - 1)(5f - 3f + 9f). -32f Expand -v*2 - 5 + 6 - 15 + (-2v2 + v2 + 4v2)(3 + 1 - 2). 5v2 - 14 Expand (6o - o - 4o)(0 - 2 + 4)(-6o + 6o + 4o*2)(o + 2o - o). 16o*4 Expand (5f - 4f + 2f)(18f*2 + 1 - 44f*2 + 20f*2). -18f*3 + 3f Expand (2f - 2f - f)(-26f*3 - 3 + 19f*3 + 2). 7f*4 + f Expand (3r - 14r - r)(0 - 2 + 0)(1 - 12r*3 + 2r*2 + 5r*3 + 8r*3). 24r*4 + 48r*3 + 24r Expand -2p + 2p - 2p2 + (-12p + 5 - 5)(-106 + 105 - 30p - 12p). 502p*2 + 12p Expand 3t2 - 2 + 2 + (3 - 3 - 5t*2)(-2 + 10 - 1) + t - t + t*2 + (2 - 2 + 1)(2t2 + 1 - 1) + 0 - 2t*2 + 0. -31t*2 Expand (s - 1 + 1 + (s - 2s - 6s)(2 + 1 - 5) + 6s - 2s - 2s)(-3 - 2s4 + 3 + (s2 + 1 - 1)(s*2 + 0s + 0s)). -17s*5 Expand (1 + 3s - 11s - 4s)(3s - 7s - s). 60s*2 - 5s Expand (-1 - 2n2 + 1)(2n + n + n) - 2n3 + n3 + 2n3 + (1 - 1 + n2)(-3n + 3n - n). -8n3 Expand ((5 - 1 - 1)(-5 + 4x + 5) - 3x + 2x + 6x)(4x*3 - 4x*3 - 2x*3). -34x*4 Expand (23f*2 + 20f*2 + 2f*2)(-2f2 - 6f*2 + 3f + 9f2). 45f*4 + 135f*3 Expand 8n3 + n4 - 8n3 - 3n4 + n4 + 0n4 + (6n*2 - 132 + 132)(n2 + n2 - 5n2). -19n*4 Expand (0w - 3w + 2w)(1101 - 401 - 498). -202w Expand (2q3 - 2q*2 + 2q*2)(q + 3q - 6q - 1 + q + 1 + 3q - 6q + 2q + (-2q - 4 + 4)(-2 + 4 - 4) - 82q - 15q - 139q). -468q4 Expand 7d*2 + 20d - 20d + (10 - 20d - 10)(d + 0d + 0d). -13d*2 Expand (-22c*2 - 79 + 79)(-4 + 4 + c) + 0c3 + 0c3 + c3 + (-1 + 1 + c*3)(-4 - 4 + 2). -27c3 Expand -2u - u2 - 1 + 4 + 1 - u2 - 5u2 + 2u*2 + (0 + 1 - 2)(2u2 - 2 + 2). -7u*2 - 2u + 4 Expand (7u - 7u - 7u3)(2u2 - 1 + 1) + (-5u*4 + 5u*4 - 4u*5)(2 + 2 + 3). -42u5 Expand (0l + 7l + 4l)((3 + 2 - 2)(-1 - 1 + 4)(2 + 2 - 1)(3 + 0 - 4) + 2 - 3 - 1). -220l Expand (-14568 + 14568 + 257n)(2n*2 - 2n2 - n2). -257n3 Expand (f + 3 - 3)(-9f2 + 3f*4 - 4f*2 + 9f*2). 3f*5 - 4f*3 Expand (-2b*3 + 16b*3 - 3b*3)(14b - 216 + 216). 154b*4 Expand (3t + 3t - 4t)(118 - 25 + 145) - 2 + 2 - 2t. 474t Expand (1 - 7 + 1)(4 + 5 - 5)(-2k + k*2 + 2k + (2 - 2k - 2)(-4k + 2k - 2k)). -180k*2 Expand 3j - 7j + 2j + 0j + j - 3j - 1 + 0 - 4j + 2j + (-2j + 4j - j)(3 - 2 + 0). -5j - 1 Expand (-v - 5v + 5v)(4v*2 + 0v2 + v2) + (0 + 0 + 1)(-v3 - 3v + 3v) + 198 - 32v*3 - 198. -38v*3 Expand (5 + 1 - 4)((2n - 6n + 3n)(6 + 0 - 4) - 3 - n + 3 + 9 - 9 - 10n - 3n + 2n + 3n). -22n Expand (-a3 + 5a3 - a3)(-3a + a + 0a) + 12a*4 - 170a*2 + 170a*2 + (3a*2 - 3a2 - a2)(-2a*2 + 0a*2 + 3a*2). 5a4 Expand x4 - 2x4 - 2x*4 + (-x + x - x)(-1 + x*3 + 1) - 2x*4 + 2x*2 - 2x*2 + 0x4 + x4 - 2x4 + (-9 - 7x + 9)(-x3 + 5x*3 - 3x*3). -14x*4 Expand (1 - 3 + 1)(-m + 5m - 5m) + 0m - m + 2m - m + 3m - 4m + (3 - 1 - 3)(3m + 0m - 2m) - 12 - 7m + 12 - 11m - 2m + 4m. -17m Expand (38o*3 - 52o*3 - 85o*3)(-6o2 + 8o - 8o + (0 - 2o*2 + 0)(2 + 3 - 3) - o*2 - 2o*2 + 2o*2). 1089o*5 Expand (-2c + 3c + 0c)(-31 - 36 - 38). -105c Expand (-22 - 8 + 30 + 211n)(4n4 + 3n3 - n4 + 3n4). 1266n*5 + 633n*4 Expand (-7j2 - j2 + 3j2)(-4 + 3 + 2)(3j*2 + 33j - 33j). -15j*4 Expand (39 - 12 + 1 + (-1 + 1 + 1)(-4 - 1 + 6) - 2 + 1 + 3 + 1 - 4 + 2)(0z + 4z - 2z)(0z + 7z + 5z). 720z2 Expand 2b2 + b2 - 5b2 + (3b - 2 - 1 + 1)(b - 5b + 2b) - 3 - 24 + 5b*2 - 7b*2. -10b*2 + 4b - 27 Expand -8m4 + 18m*3 - 18m*3 + (0m + m - 2m)(5m3 + 2m*3 + 0m*3). -15m*4 Expand 6t*3 + 14t*3 - 6t3 + (t3 + 0t3 - 2t*3)(5 - 2 - 5) - t2 + t3 + t*2 - 1 + 2t*3 + 1 - 2t*3 + 0t*2 + 0t2 - t3 + t3 + t3. 18t3 Expand 93u*4 + 2u*5 - 20507u + 20507u + (3u5 + u5 - 3u5)(-1 + 0 + 3) + 0u5 - u5 + 3u*5 + 0u*5 + 3u5 + u5. 10u5 + 93u*4 Expand (-3s + 11s - s)(42s - 3 - 20s - 19s). 21s*2 - 21s Expand (2g + 5g - 3g)(0g + 5g + 0g)(3g2 + 252 + 8g - 252). 60g4 + 160g*3 Expand ((1 - 4 + 1)(1 - 2 + 3) - 6 + 3 + 2 + 3 - 1 - 1)((-3 + 3 + m)(1 + 0 + 0) + 4m - 3m + m + 3m + 4m + 0m). -40m Expand (2 - z*2 - 2)(z - z - 6z3) + (2z - 6z + 2z + (-1 - 2 + 4)(-3z + z + 3z))(3z4 - 4z*4 + 4z*4). 3z*5 Expand (0x*2 + 2x*2 - 4x*2)(0 + 0 + 3x2) - 8x*4 + 158x - 158x. -14x*4 Expand -8 + 8 - 45t*3 + (2t + 4t - 5t)(-2t - 2t2 + 2t). -47t3 Expand (5n*2 - 4n*2 - 2n*2)(2n - 3n - n) - 159n3 - 255n*3 - 294n*3. -706n*3 Expand (-2 - 2 + 2)(-2 + 2 - l + (0 + 1 - 2)(2l + l - 2l) + 4l - l - 2l + (l + 3l - 2l)(-4 + 4 + 1) - 3l + 3l - 4l - 3l + 0l - 3l). 18l Expand (-50q*5 + 33q*5 + 16q*4 + 10q*5)(1 - 1 - 1). 7q5 - 16q*4 Expand (1 + 5t*2 - 6 + 2t + 3)(-151 + 151 + 3t). 15t3 + 6t*2 - 6t Expand (2 - 2 + s)(-s + 0s + 2s) + (3s - 14s + 9s)(0 - 2s + 0) - 3s2 + s2 + s2. 4s*2 Expand (4w - 4w - w)(-83w + 12836 - 12836) + 2w - 2w + 2w*2 + (4w - 6w + 0w)(-3 + 2w + 3). 81w2 Expand (2 - 4 + 3)(0 - h + 0)((2 + 1 - 2)(-9 + 4 - 8) - 2 - 1 - 2). 18h Expand (28x*3 - 319x*3 - 183x*3)(-2x - 3x + 3x). 948x*4 Expand (4c - 3c + c)(-187 - 42c + 189 - 11c) - 2c + 2c + 2c2 + (2c - 2c + 2c)(-2c - 2 + 2). -108c2 + 4c Expand (-2v2 + 2v*3 + 2v*2)(3v - 3v*2 - 3v) + 3v - 3v + v*5 + (2 - 2v*3 - 2)(2v2 - v2 + v2) + 4v*3 - 4v*3 - 9v*5. -18v*5 Expand (-4 - 2 + 3)(-g + 4g - 4g) + (-1 - 1 + 0)(-2g - g - 4g) + (1 + 3 - 2)(3g - 3g + g) - 1 - g + 1. 18g Expand (-5 - 21 + 7)(2q - q + q) - 3q - q + 3q + (1 + 1 + 0)(-5q + 2q + q) + q + 3 - 3. -42q Expand (4 - 7q - 7q + 4q)(-1 + 2 - 2). 10q - 4 Expand (2g + 2g - 5g)(15g3 - 4g*3 + 15g3 + (-g2 + 4g2 - 2g*2)(-g + 2g - 3g)). -24g4 Expand (-4 - 22g + 17g + 1)(-4g3 + 4g*3 - 6g3 + (-g2 - 2g2 + 5g*2)(2g + 3 - 3) + 4g*3 - 3g*3 - 2g*3). 15g*4 + 9g*3 Expand (34 + 19 - 10)(2u - 2u - u*3)(0u + 3u - 2u). -43u*4 Expand (2r*2 + 3r2 - r2)(r - 24r - r)(4r*2 - 2r*2 - 4r*2). 192r*5 Expand (9r + 8r - 3r)(-14r3 - r2 + 11r3 - r2 + (4r - 3r - 5r)(0r - 2r2 + 0r)). 70r4 - 28r*3 Expand (-2n + n + 0n)(2 - 4 + 0)(-1 + 1 - 2)(4 - 49 - 29). 296n Expand (28a*3 - 85a*2 + 85a*2)(2 - 5 + 5)(3 + 7a - 3). 392a4 Expand -15z + 34z + 3z - 2 + z - 2z - z + (2 + 0 + 0)(-5z + 2z + z) - 3z - 2z + 3z + 6z - 5z - 3z. 12z - 2 Expand (-1 - 9 - 58)(4 - 2 - 4)(-2q + 4q + q). 408q Expand (-4 - 2 + 5)(5 - 5 - 2)(3x - 9x - 9x). -30x Expand (3v + 4v - 5v)(83 - 46 + 22v2 - 40). 44v*3 - 6v Expand (2d2 - 3d*2 - 5d*2)(1 + 0 + 1). -12d2 Expand (-6t*3 - 19t*3 - 2 - 2t*2 + 37t*3)(0 - 2 - 3 + (0 + 4 - 3)*(-3 - 3 + 3) - 6 +	{ "pile_set_name": "DM Mathematics" }
0b - 72593b*2 + 11b + 2b + 4b. -72593b2 + 17b Collect the terms in -171001m2 - 18 + 18 + 85500m*2 + 85507m*2. 6m*2 Collect the terms in -171p + 2461p3 + 171p + 1524p3 + 1804p*3. 5789p*3 Collect the terms in 98t + 0 - 4 + 2 + 0 + 98t - 185t. 11t - 2 Collect the terms in 980 + 26m + 1009 - 4m3 - 26m + 1012 - 3001. -4m3 Collect the terms in -27 + 16 + 36b*2 + 43b*2 + 38b*2 + 11 - 115b*2. 2b*2 Collect the terms in -6n*3 - 323n + 147n + 5n*3 + 194n. -n*3 + 18n Collect the terms in 4l + 7l - l - 9l + 0l + 4087. l + 4087 Collect the terms in -5l2 + 211 - 3l*2 + 220 - 561 + 174 + 6l*2. -2l*2 + 44 Collect the terms in -15 - 1749w - 37 + 52 + 1746w. -3w Collect the terms in 217187p2 + 36995p*2 + 162653p*2. 416835p*2 Collect the terms in 3o*2 + 227262 - 227262 - 2o*2 + 8o3 - o2. 8o3 Collect the terms in -12q*2 - 14q*3 - 33q - 33q3 + 45q*3. -2q*3 - 12q*2 - 33q Collect the terms in -54z2 + 54z*2 + 1401875z*3. 1401875z*3 Collect the terms in -63a*3 - 57a*3 - 40a*3 - 62a*3 - 57a*3 - 62a*3 + 350a*3. 9a*3 Collect the terms in -14429c - 83371c3 + 14429c. -83371c3 Collect the terms in -14z - 57 - 2z2 - 6z*2 + 24z*2 - 15z2. z2 - 14z - 57 Collect the terms in 0 - 4 + 4 + 163q + 454q - 3229q. -2612q Collect the terms in -1128961 + 1128961 + 450w - 2w3 - 397w - 1082w. -2w*3 - 1029w Collect the terms in -33447u - 33453u - 33447u - 33445u + 133793u + 2 + 4. u + 6 Collect the terms in 2 - 31l - 36l - 36l - 21l + 64l - 36l + 59l. -37l + 2 Collect the terms in -88v*3 - 85v*2 - v - 71v*2 + 22v*2. -88v*3 - 134v*2 - v Collect the terms in 12 - 15 - 160n - 7 + 10. -160n Collect the terms in 11942y*3 - 11944y*3 + 0y + y. -2y3 + y Collect the terms in 0l*2 + 891l*3 + 385l*3 + 734l*3 + 0l*2. 2010l*3 Collect the terms in -16284r + 8162r + 8122r - 9r2 + 24r2 + r2 + 1. 16r2 + 1 Collect the terms in -1231b*2 + 636b*2 + 571b*2. -24b2 Collect the terms in -p3 - 159177p2 + 79592p*2 + 79525p2. -p3 - 60p2 Collect the terms in -98v*2 + 54v + 54v + 54v + 56v + 58v - 275v. -98v*2 + v Collect the terms in 53g - 51g - 14g - 21g + 79g - 7g + 8g. 47g Collect the terms in 1246380g - 623122g - 623527g. -269g Collect the terms in 331j*2 + 5j*2 + 8 - 8j + 20 - 3j. 336j*2 - 11j + 28 Collect the terms in -225q + 27q + 4q - 47q. -241q Collect the terms in -2 - 2310w*2 + 4636w*2 + 2 - 2321w*2 - 170w*3. -170w*3 + 5w*2 Collect the terms in -26l*2 - 173l*2 - 5l + 5l - 28l*2 - 1556l*2. -1783l*2 Collect the terms in -555w*3 - 2091256204w + 2091256204w. -555w*3 Collect the terms in 14b*2 - 19b*2 + 17792b*3 - 17889b*3. -97b*3 - 5b*2 Collect the terms in -78 + 26v - 50v - 44v - 107v + 5v + 77. -170v - 1 Collect the terms in -117114n*2 - 117110n*2 + 351330n*2 - 117125n*2. -19n*2 Collect the terms in -187i*2 + 6i*2 + 529i*2 - 23i*2 + 246i*2. 571i*2 Collect the terms in -9q + 14q - 14680q*3 + 7q - 12q. -14680q*3 Collect the terms in -196462 - 6j*3 - 3j*3 + 18j*3 - 7j*3. 2j*3 - 196462 Collect the terms in -1732 - 1730 - 42u - 1893 + 5355. -42u Collect the terms in -286t*2 - 154t*3 + 0t - 261t3 + 286t*2 + 0t. -415t3 Collect the terms in 31d - 5509 + 34d + 50d - 116d. -d - 5509 Collect the terms in -3988 + 11946 - 2z - 3994 - 3993. -2z - 29 Collect the terms in -23407y*3 + 4668y*3 - 42394y*3. -61133y*3 Collect the terms in 514 - 1539 + 515 + 510 - 387b - 207b. -594b Collect the terms in 960n2 + 2172n*2 - 12 - 16 + 26. 3132n*2 - 2 Collect the terms in -13550t + 16 - 18 + 9t2 - 10t*2 - 11t*2. -12t*2 - 13550t - 2 Collect the terms in -637 + 6d - 618 - 3d + 1865 + 4d - 8d - 608. -d + 2 Collect the terms in 7546 - 7546 - 104m. -104m Collect the terms in 193s - 226s*3 - 101s + 237s3 - 116s. 11s3 - 24s Collect the terms in -3 + c*2 + 4c - 4 - 16 - 8 + 4. c*2 + 4c - 27 Collect the terms in -2297466b2 - 1703085b*2 + 938438b*2 + 223081b*2. -2839032b*2 Collect the terms in 136z*3 + 13z*3 - 72z + 232z - 88z - 72z. 149z*3 Collect the terms in -153198 - 18w + 307308 - 154107. -18w + 3 Collect the terms in -701919n*2 - 184287n*2 + 165433n*2. -720773n*2 Collect the terms in -2o*3 - 2099o*2 - 4035o*2 + 6132o*2. -2o*3 - 2o*2 Collect the terms in 3u - 3u + 51u - 1759. 51u - 1759 Collect the terms in -16431h*3 - 3488263h + 3488263h. -16431h*3 Collect the terms in 142q - 20q + 226q - 68q. 280q Collect the terms in 23h - 567h*2 + 285h*2 + 283h*2 - 99h. h*2 - 76h Collect the terms in 7907 - 17s2 - 2s - 6555 + 34179. -17s2 - 2s + 35531 Collect the terms in 1 - 1576x - 3 + 16 + 438x - 11. -1138x + 3 Collect the terms in 4506 + o2 - 1033 - 3454. o2 + 19 Collect the terms in 16u - 1449 - 4u - 1433 + 4317 - 1433. 12u + 2 Collect the terms in 0 - 107572s - 17 + 17. -107572s Collect the terms in -24625t + 8278t + 8227t + 8231t. 111t Collect the terms in 81f + 689f2 + 266f - 648f2. 41f*2 + 347f Collect the terms in -1 - 8565h3 - 18h + 23h + 9070h*3. 505h*3 + 5h - 1 Collect the terms in -874396p2 + 874054p*2 + 2p*3 + 30p*3. 32p*3 - 342p*2 Collect the terms in 31 + 43 + 44 - 118 + 1539w - 1593w. -54w Collect the terms in -31z3 + 2z + 154z3 - 2z - 309z3. -186z*3 Collect the terms in -19r + 60r - 24r + 17r + 4r*2 - 29r. 4r2 + 5r Collect the terms in 287701 + 294i - 287701. 294i Collect the terms in -4312a + 2269a + 2381a. 338a Collect the terms in 87581t3 - 88591t*3 + 1014t*3. 4t*3 Collect the terms in 8 + 3 + 12 - 10007k - 25 + 5. -10007k + 3 Collect the terms in -72s - 75s - 57s - 70s - 73s - 74s + 424s. 3s Collect the terms in 33773h + 210359h + 153170h - 118814h. 278488h Collect the terms in 1302p - 311p - 24p2 - 376p - 301p - 314p. -24p2 Collect the terms in 175 - 98 - 77 - 11535b - 91b. -11626b Collect the terms in 36456g + 36447g - 72933g + 63. -30g + 63 Collect the terms in -2438z3 - 23z - 10z + 30z + 2442z3. 4z*3 - 3z Collect the terms in 35i - 35i + 3754i2 - 3645i*2. 109i*2 Collect the terms in 25v*2 - 564 - 574 - 566 + 2275 - 569. 25v*2 + 2 Collect the terms in -1637398s*2 - 677674s*2 - 306020s*2. -2621092s*2 Collect the terms in -472u*3 + 1006u*3 - 557u*3. -23u*3 Collect the terms in 15001y*2 + 6681y*2 + 12344y*2 + 3 - 8481y*2 - 3. 25545y*2 Collect the terms in 5q + 10 + 14q - 12 + 4q + 30q - 29q. 24q - 2 Collect the terms in 793 + 283b - 794 - 10b. 273b - 1 Collect the terms in 909627771 - 909627771 - 414y3 + y2 + 5y. -414y3 + y2 + 5y Collect the terms in 16386g3 + 52867g*3 + 33070g*3. 102323g*3 Collect the terms in 169 + 80600d - 169 + 531220d. 611820d Collect the terms in -6h3 - 5h + 21h3 - 2h + 18h + 1 + 13h. 15h3 + 24h + 1 Collect the terms in 28g - 2 + 36g + 24g - 11430g*2 - 88g. -11430g2 - 2 Collect the terms in 823828019 - 411914011 - 411914008 - 5r. -5r Collect the terms in -2930928814p*3 + 2930928805p*3 + 3 - 3. -9p*3 Collect the terms in 17605297 - 1179d - 14148d - 17605299. -15327d - 2 Collect the terms in -3446w2 - 5055w*2 - 3616 + 3616. -8501w*2 Collect the terms in -3 + 80 + 4r*2 + 63 - 3r + 8r2. 12r*2 - 3r + 140 Collect the terms in 86 - 4c + 459 - 4c + 42c - 23c - 9c. 2c + 545 Collect the terms in -217a2 - 1 - 10a*2 + 226a2 + 1 + 0. -a2 Collect the terms in -64m2 - 65m*2 + 173m*2 - 66m*2 + 81m*2 - 64m*2. -5m*2 Collect the terms in 57r - 7r - 18r + 2233 - 21r. 11r + 2233 Collect the terms in 330b3 - 4b + 0b + b + 1284b*3. 1614b*3 - 3b Collect the terms in -1294276x3 - 1294286x*3 + 2588580x*3. 18x*3 Collect the terms in 3c*3 - 8c*3 + 4c*3 - 59c*3 + 26c3 - c3. -35c3 Collect the terms in 2237z + 166z2 + 2231z + 2257z - 6725z. 166z2 Collect the terms in 2420h - 72	{ "pile_set_name": "DM Mathematics" }
-4z = -6z - x + 699. Let t = z - 179. Calculate the remainder when t is divided by 57. 56 Let x(o) be the first derivative of o*3/3 - 9o*2/2 - 7o + 16. Calculate the remainder when 120/90(-166)/(-2) is divided by x(11). 14 Let s = -26 - -60. Calculate the remainder when -3 - (30/80 - (-1542)/(-16)) is divided by s. 25 Let x = 68972 - 68952. Let k = -3 + 39. What is the remainder when k is divided by x? 16 Let m(h) = 18h - 4. Let q(i) = -9i + 2. Let x(o) = -3m(o) - 5q(o). Let z = -75 + 160. What is the remainder when z is divided by x(-1)? 8 Let y(n) = -2 - 1 + 0n2 + n - 8n3 + n2 - 5n. Calculate the remainder when y(-2) is divided by 20. 13 Suppose -31d - 171 = -1318. Suppose t - 5 = 0, 3t = 5o - 2o - 15. Calculate the remainder when d/(-3)201/(-67) is divided by o. 7 Suppose 0 = -63q + 68q - 15. Suppose -qn + 7n = 92. Calculate the remainder when 1100/16 - (-3)/(-4) is divided by n. 22 Suppose x - 4s - 12301 = 0, 2x - 6s - 24630 = -12s. Calculate the remainder when x is divided by 27. 24 Suppose -2k = 2p + 3k - 4, 2k = 0. Suppose 32 - p = -2n. Let z = 19 - n. Calculate the remainder when 100 is divided by z. 32 Let p be (1 - -3) + 1/(-4)-60. Let h(t) = t*3 - 21t*2 + 41t - 39. What is the remainder when 629 is divided by h(p)? 17 Let n(a) = a - 2. Let p be n(2). Suppose 0 = 4z - x - 59, -2z + 5z - 2x - 43 = p. Calculate the remainder when 41 is divided by z. 11 Suppose 3o - 35a + 31a - 148 = 0, 3 = -3a. Suppose 17t = 16t + 68. Suppose -2d = -t + 18. What is the remainder when o is divided by d? 23 Let i be ((-8)/(-6))/((-6)/1171). Let d = -17 - i. Calculate the remainder when 9/((-81)/(-578)) - 2/d is divided by 13. 12 Let w = 18 + 5. Let g = -7 + w. Let v = -926 - -972. Calculate the remainder when v is divided by g. 14 Let c(x) = x + 6. Let o(v) = -v*2 + 55v - 579. Calculate the remainder when o(15) is divided by c(0). 3 Suppose -17h - 1585 = -22h. Suppose 570 = -312w + hw. Let r = -53 + 93. What is the remainder when w is divided by r? 34 Let o(m) = 160m + 961. What is the remainder when o(-5) is divided by 6? 5 Let a = -13 - -21. Let t(u) = 2u*2 - 4u + 14. What is the remainder when t(0) is divided by a? 6 What is the remainder when -8 + 6 - (5669/(-6) + (-31)/186) is divided by 86? 83 Let g(a) = -585a + 3426. What is the remainder when g(0) is divided by 5? 1 Let h = -59 + 89. Let j = 132 + -156. Calculate the remainder when h is divided by (-256)/j - 2/(-6). 8 Suppose -70q - q = -568. What is the remainder when 510 is divided by q? 6 Let l(f) be the first derivative of 18f2 + 198f + 21. What is the remainder when l(19) is divided by 34? 32 Suppose 0 = 3a - 21 - 30. Let l(f) = -52f*3 - 12f - 10. Calculate the remainder when l(-1) is divided by a. 3 Let i = 23 + -159. Let c = i - -147. Calculate the remainder when 75 is divided by c. 9 Suppose 3r + 2y = 6, r + r + 2y = 2. Suppose -2a = 4h - 66, ra + 0 + 12 = h. Calculate the remainder when 61 is divided by h. 13 Calculate the remainder when 92 is divided by ((-12)/5 - -2)/((-219)/1095). 0 Let o = 534 - 512. Let p(q) = q*3 - 24q*2 + 43q + 30. Let i(a) = 7a2 + 1. Calculate the remainder when i(-2) is divided by p(o). 5 Let q = 2562 - 2519. Let p(i) = 170i*2 - 2i + 1. What is the remainder when p(1) is divided by q? 40 Suppose -1258 = 18y - 7y - 7660. What is the remainder when 1765 is divided by y? 19 Let o(r) = -2r + 50. Let w be o(24). Suppose -wc - 3s + 28 = 0, 5c + s = 3s + 32. Suppose -4g + 7g = 39. What is the remainder when g is divided by c? 5 Suppose 2i + 9 = -2i - 3u, 0 = -3u + 3. Suppose -2p - 2q = -38, 55 = -2p + 5p + 4q. Calculate the remainder when 79 + i(-6 - -5) is divided by p. 19 What is the remainder when 764 is divided by (153 - 170) + (204 - -1)? 12 Suppose 1 = q, 3q - 284 = -3z + 7q. Suppose 2s - 4w - 104 - z = 0, -2w = 3s - 276. Calculate the remainder when s is divided by 14. 10 Let s(h) be the third derivative of h*5/30 + 4h*4/3 - 35h*3/6 + 8h*2 + h. What is the remainder when 108 is divided by s(-18)? 34 Suppose -5a + 20 = -5c, -26c = -22c - a + 4. Suppose -2q + 1 = -f + 27, -f - 4q + 26 = c. Calculate the remainder when 201 is divided by f. 19 Let q = -4 + 12. Suppose 608h - 772h = -69372. What is the remainder when h is divided by q? 7 Suppose 37n + 559 = -3n + 1359. Calculate the remainder when ((-117)/6 + 2)-6 is divided by n. 5 Suppose x + 1 = 3l, 5x - 17 = 4l - 0x. Suppose -198 = lb - 7b - 4f, -3b - 3f = -117. What is the remainder when b is divided by 23? 19 Suppose -66z + 900 = -16z. What is the remainder when 334 is divided by z? 10 Suppose -137j - 11 = -126j. Calculate the remainder when 221 is divided by (-4 + (-35 - 6))/j. 41 Suppose -2a - 110 = -0a. Let q be ((-4)/(-5))/((-22)/a). Suppose -5l - 16 = -3h, l - q = 4h - 6h. Calculate the remainder when 2 is divided by h. 0 Let u(w) = 6w + 1. Let p = 43936 - 43909. Calculate the remainder when p is divided by u(1). 6 Let x(z) = -z*2 - 13z + 3. Suppose -4s = -5s - 12. Let n be (((-39)/(-6))/(-1))/((-6)/s). Calculate the remainder when 14 is divided by x(n). 2 Suppose -k - 32 = -166a + 161a, -34 = -4a - 2k. What is the remainder when 1139 is divided by a? 5 Suppose -4 + 34 = -5c. Let t be -3((-2)/(-3) + 26/c). Suppose tp = 16p - 45. Calculate the remainder when 31 is divided by p. 4 Let o(t) be the first derivative of -t*4/2 - 14t*3/3 - 4t*2 + 13t - 54. Let k = -32 + 56. Calculate the remainder when o(-7) is divided by k. 21 Suppose 25x - 4 = 96. Calculate the remainder when 24 is divided by 16 + -3 + x/(-1 + 0). 6 Suppose -17k - 13k = -930. Let j = -117 - -289. What is the remainder when j is divided by k? 17 Suppose -60 = 5q - 225. Suppose 5d = -8 + q. Suppose x - 221 = -dc, -113 = -5c + 4x + 128. What is the remainder when c is divided by 24? 21 Let n(p) = -5p2 + 64p + 501. Calculate the remainder when 3859 is divided by n(18). 31 Let c(f) = -3f2 + 19f + 76. Let w be c(-7). Let z = w - -232. What is the remainder when 334 is divided by z? 26 Let b = 192 - 105. Let r = b + -40. Calculate the remainder when 467 is divided by r. 44 Suppose -4d = k - 77, 0k - 2k + 2 = 0. Suppose -19 = -3y - 5b, -2y + 0y + d = -3b. Suppose 31 + y = 3h. What is the remainder when 22 is divided by h? 9 What is the remainder when 283 is divided by (32/5)/((-24)/(-450))? 43 Suppose -10i - 216 = -v - 7i, 5v - 1128 = -i. Calculate the remainder when 168 is divided by v/4 - (-15)/20. 54 Let w = 36 - 49. Let c = w + -6. Let h(b) = -b*3 - 18b*2 + 18b - 2. Calculate the remainder when 30 is divided by h(c). 13 Let g(w) = -35w + 3. Let i = 1980 - 1394. Let j = i - 541. What is the remainder when g(-5) is divided by j? 43 Let g = -2607 - -3064. Calculate the remainder when g is divided by 152. 1 Let k = 127 - -28. Suppose -12f = -4p - 15f + 188, 5f + 40 = 0. Calculate the remainder when k is divided by p. 49 Suppose 13p + 15p - 4 = 29p. Let o = 49 - 19. Let m = o - p. Calculate the remainder when m is divided by 21. 13 Calculate the remainder when 676 is divided by (-3570)/(-51) + (-3 - 8). 27 Suppose -p = -2p + 5f - 9, -2p - 2 = -2f. What is the remainder when 205 is divided by (45/(-4))/(((-6)/16)/p)? 25 Let k be 5(-4)/(-10)193. Let z = -356 + k. What is the remainder when z is divided by 8? 6 Suppose 298 = -8z + 24z - 6. What is the remainder when 2046 is divided by z? 13 Let d be 193 - (16/6)/(8/(-12)). Suppose 4j = -57 + d. What is the remainder when 206 is divided by j? 31 Suppose -3n - 1314 = 15n. Let v = 146 + n. Calculate the remainder when v is divided by 13. 8 Let x be 12/((-9016)/(-4496) - 2). Calculate the remainder when (2 - x/(-20)) + 12/(-30) is divided by 59. 55 Let l = -254 + 266. Calculate the remainder when 64 is divided by 21/((27/l)/((-27)/(-18))). 8 Suppose -12a + 26a - 770 = 0. Let l = a + -50. What is the remainder when 6 is divided by l? 1 Suppose 0 = -2j - 3j + 50. Suppose 0 = -33y + 44y - 198. Suppose -10d = -yd + 216. What is the remainder when d is divided by j? 7 Suppose 5y = q - 426 - 182, -4y - 16 = 0. Suppose -42 + q = 13i. Calculate the remainder when 141 is divided by	{ "pile_set_name": "DM Mathematics" }
p - 1 + 1 + (-2 + 4 - 3)(-3p + 3p - 2p))(530 - 37p3 - 530). -143p*4 Expand 2d - d - 3d + (-18 - 95 - 29)(-d - 3d - d) - 4d + 5d + d + (d + 3d - 2d)(-1 - 3 + 1). 704d Expand 0m*2 + 0m2 - m5 + 68m + 5m*5 - 68m + (-3 - 2m + 3)(m*2 - 9m4 - m2). 22m5 Expand (4 - 4 + d2)(2 - 17 + 9)(0 + 2 + 1)(-70 - 23 - 12)(0 + 1 - 2). -1890d*2 Expand (-3x3 - x3 - 5x3)(5 - 6 - 2 + 4)(x + 6x + 3x). -90x*4 Expand (0m + 3m + m)(2m - 3 + 3) + (m - m + 2m)(-2m - 2 + 2) + (m - m + 2m)(-3m + m + 3m). 6m2 Expand 3r*2 - 5 + 5 - 6r*2 + 4r*2 - 5r*2 + (-2r + 0r - r)(0r - r + 2r) + 2r2 - 5r*2 + 0r*2 + (1 + 2r - 1)(10 - 3r - 10). -16r2 Expand b4 - 3b*4 - 2b*4 + (0b*3 + 2b*3 + 4b*3)(2b + 3b - 7b)(45 - 75 + 46). -196b4 Expand (-4 + 4 + 2z*2)(-z + 14z - 8z) - 119z3 + 33z*3 - 64z*3. -140z*3 Expand (9u - 12u + 7u)(5u*2 + 5u + 10u2 - 13u*2). 8u*3 + 20u*2 Expand (13 - 6 - 153)(-4v3 + 0v*3 + 2v*3)(4v - 3v + 5v). 1752v*4 Expand -2m*2 - m + m + (-2m + m - 4m)(722m - 356m + 476m + 3 - 3 + 2m + (0 - 2 + 0)(1 - 2m - 1)). -4242m2 Expand (-2y - 4 + 4)(-14 + 14 + 24y + (1 - 5 + 2)(-2y - 2y + 6y) + 0 + 2y + 0 + y - 12 + 8 + 0). -46y*2 + 8y Expand 20p + 13p - 30p - 5p*2 + (1 + 1 + 0)(-p*2 + 2p*2 - 3p*2) + 0p*2 + 0p*2 + 2p*2 + (2p - 2p + 2p*2)(1 - 3 + 6). p*2 + 3p Expand -92j5 + 105j*2 - 216j*2 + 114j*2 + (2 + 2 - 2)(5j5 + 4j*3 - 4j*3). -82j*5 + 3j*2 Expand (2u2 - u2 - 2u2)(-12u2 - 11u*2 + 20u*2)(-3u + u - 7u). -27u5 Expand (-5h*2 + 7h*2 + 2h*2)(-198 - 31 - 275). -2016h2 Expand (-m - m + 3m)(38053 + 45550 - 11766 + 335 + 272). 72444m Expand (1 + 0 + 0)(3z - 2 + 2)(-3 + 4 + 1 + (1 - 1 + 2)(0 + 1 + 0) - 133 - 266 + 54). -1023z Expand (-69x*3 + 106x*3 + 84x*3)(-3 + 0 + 1)(1 + 3 + 2). -1452x*3 Expand (2736z - 2679z + 4z*2 - 23z*2)(-1 + 1 - z*2). 19z*4 - 57z*3 Expand (-2 + 2 + 2d)(-3283 + 844 + 14d + 1480). 28d2 - 1918d Expand -128t + 14t - 72t + (0t + t + t)(-1 + 2 + 0) + 0t - 3t + 2t + (-3t + 1 - 2t + 3t)(0 + 1 + 1) - 6t + t + 2t. -192t + 2 Expand -l - 2l*3 + 3l*3 + 0l*3 + 4l*3 + 9l3 - l3 + (-2 + 1 - 2)(39l*2 + 12l*3 - 39l*2). -23l*3 - l Expand (1 + 2w*2 - 1 + (2w - w + 0w)(3w + 2 + w - 5w))(-41 - 22 - 11). -74w*2 - 148w Expand (2131g4 + 2640g*4 - 602g*4)(-3 + 2 - 1). -8338g4 Expand -8s*4 + 10s*5 + 8s4 + s5 + 2s5 - 2s*5 - 3s5 - s5 + 6s5 + (-s4 - 3s + 3s)(-3s + 4s + 0s) - 15s*5 - 4s5 - s5. -8s5 Expand (395 - 64 + 153)(8y + 9y + 2y). 9196y Expand (49r - 6r + 213r - 8r)(9r + 4r - r). 2976r*2 Expand (1 + 2b*2 - 1 + (2b + b - b)(-3 - 2b + 3) + (2b - 2b - b)(-12b - 16b - 2b))(2b*2 + 23b*2 - 5b*2). 560b*4 Expand (133y + 173y - 349y)(-4y*3 + 4y3 + y4 + (1 - 1 + y)(-y3 + y3 - 2y*3) - 4y*3 + 3y*4 + 4y*3). -86y*5 Expand (-2q*3 - 2q*3 + 0q*3)(-89q2 - 21q*2 + 19q*2). 364q*5 Expand -121 + 121 + 32p - 1 + 1 - 2p + (2p - 2p - 2p)(3 + 0 - 5) - 1 - 3p + 1 + 0p + 6p - 3p. 34p Expand i*2 - 2i*2 - 15i*2 + (-4i + 4i + 2i)(3 - 3 + i) + (25i + 18i - 11i)(5i - 2i - 5i). -78i2 Expand (0j + 2j - 4j)(-36j - 39j + 18j) - j*2 + 9j*2 + 13j*2. 135j*2 Expand (-2c - 2c + 2c)(58 + 709 + 1738 - 286). -4438c Expand (w + 1 - 1)(5 + 0 - 3) + 102w + 107 - 308 - 111w. -7w - 201 Expand -112j - 16j + 41j + (0 - 2 + 3)(-2j + j + 3j) - 2 - 3j + 2 - j + 0j + 0j - 4j. -93j Expand (-y + 3 - 3)(-645 + 146 - 30y + 31y). -y*2 + 499y Expand (-4l + 6l + 9l)(l*4 + 3l*4 + 0l*4) - 95l*5 - 313l*5 + 57l*5. -307l*5 Expand -320l*3 - 59655l*2 + 59655l*2 + (-25l*2 + 11l*2 - 25l*2)(l + 0l - 3 + 1). -359l*3 + 78l2 Expand (3 + z2 - 3)(-54 - 8z + 54) + (379 - 7z + z - 375)(4z2 - 4z*2 - 2z*2). 4z*3 - 8z*2 Expand (4h - 4h - h + (4h - 6h + 0h)(-2 + 0 + 3) + 163h - 293h + 153h + 4)((19 - 19 + 6h)(-2 + 2 + 4) + 5h - 4h - 4h). 420h2 + 84h Expand (2n + 2n - 2n)(1150 - 1355 + 723)(1 - 1 + 1). 1036n Expand (d - d - d)(8 - 4 + 2)(4 + 0 - 3)(-3 + 7 - 2)(-4d - 3 - 9 + 6). 48d*2 + 72d Expand (-7r2 + 2r*2 + 2r*2)(-9211 + 9211 - 59r) + 0r2 + r2 - 4r3 + 7r*3. 180r3 + r2 Expand (-86t2 + 13t*3 + 86t*2)(0t + 0t + t*2) + 4t*5 + 0t*5 - 2t*5 - 320 + 320 + 14t*5. 29t5 Expand (-r2 + r*2 + 2r*2)(-599r - 435r + 101r) + (-3r + r + 4r)(2r2 + 5r - 5r) + 0 - 2r*3 + 0 + 2r*3 - 2r*3 - 3r*3 + 10r*3 - 25 + 25. -1857r*3 Expand (0 + 0 + 1)(-3 + 2d + 3)(459d2 - 2057 - 2d*3 - 253d*2 + 2014). -4d*4 + 412d*3 - 86d Expand (-2w + w + 3w)(-2 - 2 + 2) + (2 - 2 + 1)(2w - 5w + w) + (0 + 3 - 1)(-65 + 65 + 12w) - w + 3 - 3 + 0w + 5w + 5w + (w - 2w + 0w)(0 + 1 + 0). 26w Expand 20m - 13m + 7m + (-3 + 3 + 2m)(-3 + 5 + 0) + 2 - m - 2 - 45m + 26m + 34m. 32m Expand (0d - d2 + 0d)(-4 - 4 - 2) + (-8d + 4d - 3d)(2 + 6d - 2). -32d2 Expand (2s + 1 - 1 + (3 - 3 + 2s)(3 - 6 + 1) + 2s - s - 3s - 7s - 3 + 1 + 15s)(-3 + 7 - 2)(-6s3 + 6s*3 - 7s*3). -56s*4 + 28s*3 Expand (0h*2 + 4h*2 - 2h*2)(-6h - 5h - 37h)(5h - 3h + 2h). -384h4 Expand i2 - 2 + 2 + (3i - 3i - 2i)(-3 + 2i + 3) - 13i*2 - 12i*2 + 37i*2 + (-i - 3i + 2i)(-4i - i - 3i) + 2i2 + 2i*2 - 7i*2. 22i*2 Expand (0t - 3t + 0t)(2 + 3 + 0 + (0 + 4 - 2)(-3 + 4 + 1) + 16 - 23 - 20). 54t Expand (17 - 9 - 10 + 11a)(22 + 21 + 26 - 25). 484a - 88 Expand (2j - 6j + j)(-j2 + 0j*2 + 0j2) + (-1 + j2 + 1)(-j + 5j - 3j) - j3 - 3j*3 + 2j*3 - 466j*3 - 108j*3 + 987j*3. 415j*3 Expand (7l + 7l + l)(-15l - 27 + 268 + 39l - 109). 360l2 + 1980l Expand (-6038 - 6033 + 12072 + 261y)(13 - 12 + 5)(2y*2 - y + y). 3132y*3 + 12y*2 Expand -1197a*3 + 1893a*3 - 1462a*3 + (-1 + 1 - 3a*2)(-4a + 3a - 3a). -754a3 Expand (a3 - 2a + 2a)(-1 + 2 - 9a2 - 2) + (a3 + 2 - 2)(-6a*2 - 5a*2 - 23a2) - a5 + 2a5 - 3a*5 + (a - a - a)(0a3 - 2a*4 + 0a*3). -43a5 - a3 Expand (-217 - 49 + 95)(3 - 2s*2 - 30s + 30s). 342s*2 - 513 Expand (-2s - 4s + 4s)(-1072 + 3419 + 7853 - 987 + 244). -18914s Expand (16k + 21k + 3 - 45k)(-3k4 + 5k*4 + 2k*4 + (-2k + k + 0k)(-k + k + 2k3)). -16k*5 + 6k*4 Expand 191s*2 - 32596 + 32596 + (-3 - 2 + 4)(-6 + 3s2 + 6). 188s*2 Expand (0 - c + 0)(2 - 2 + 3c) - 2c*2 + 3c*2 + 11c*2 + 9c + 5c2 - 9c. 14c2 Expand (2m*3 - 344m*2 + 21635 - 43264 + 21631)(3m2 + 0m*2 - 4m*2). -2m*5 + 344m*4 - 2m2 Expand (g2 - 6g2 + 2g*2)(3 + 28 + 33 - g). 3g3 - 192g*2 Expand (-323 + 26y + 323)(-21y*4 - 260y*2 + 260y2) + y5 - 3y5 - 12 + 12. -548y*5 Expand ((0c + 12c - c)(3c + 2c - 3c)(1 - 1 - 3c) - 2c*3 + 3c*3 - 3c*3)(-2c - 9 - c + c). 136c*4 + 612c*3 Expand -23k - 12k + 13k + (2k - k + 0k)(4 + 0 - 3) - 4 + 446k - 1 - 454k. -29k - 5 Expand (4 + 0 - 2)(a + 7a - 2a + (315a + 303a + 237a)(-4 + 1 + 1)). -3408a Expand (3 + 2g - 3 + (-2 - 1 + 4)(2g + 4g - 4g))(8508 - 4691 - 4189). -1488g Expand (72x*2 - 738 + 738)(7x - x - 5x + (-3x - x + 3x)(0 - 4 + 3) - 1 - 2x + 1 + x - 3x + 0x - 3 + 2x + 3 + 2 - 2x - 2). -144x3 Expand 56i2 + 47 - 47 - i2 - 4i2 + 4i*2 + (-4 + 2i + 4)(2i - 2 + 2) + i*2 + 0i2 + i2 + (-1 + 1 + 2i)(2 - 2 + 2i). 65i*2 Expand (-m + 7m + 1 + 0)(-116m - 109m + 49 + 227m). 12m2 + 296m + 49 Expand (-6o + 1 + 10o + 6o)(595o3 + 7o*2 - 4o*2 - 602o*3). -70o*4 + 23o*3 + 3o*2 Expand (-y - 2y + 5y)(12 - 12 - 5y) - 10y*2 - 10y*2 - 8y*2. -38y*2 Expand (606f*2 - 220f*2 - 250f*2)(2 + f - 2 + (3f - 3f - 2f)(6 - 1 - 2)). -680f3 Expand (-6p + 18p - 12p - 316p2 + 2p)(6p + 0 + 0). -1896p3 + 12p*2 Expand (-568x*2 + 443x*2 + 1700x*2)(-2 + 4 - 5)(0 - 4x + 1 + 7*x) + (	{ "pile_set_name": "DM Mathematics" }
a) f (b) 2/11 (c) -2/15 (d) 1 b Let n = -2437 + 2441. Which is the smallest value? (a) 16 (b) -4 (c) n (d) 5 b Let q = -12 - -11. Let u = q + -1. Let d be (1/15)/((-4)/806). Which is the third biggest value? (a) 2/3 (b) d (c) u c Let r = 6982 + -7562. What is the biggest value in r, -1/2, 2? 2 Let p = 744 - 744.3. Let m = -41.4 - -42. What is the biggest value in 1/3, p, m? m Let i = 14.26 + -15.26. Which is the fourth biggest value? (a) i (b) 2 (c) -2/9 (d) -0.06 a Suppose x - 173 = j, 0 = -5j + x - 4x - 889. Let w be 52/j + 23/(-92). Let l = -3 - -5. Which is the second smallest value? (a) -0.4 (b) 3 (c) w (d) l a Let u = -4.45 - -1.45. Let s be 1/(-5)(0 - -2). Let r be 483/(-115) - (-1 + 0 + -3). What is the second smallest value in r, u, -4, s? u Let w = 0.565 - 0.465. Which is the biggest value? (a) w (b) 1 (c) -2/15 (d) -0.29 b Let s = 13896 + -13892. Which is the second biggest value? (a) s (b) 2/3 (c) 1409 (d) -3 a Let r = 10.4 - 49.4. Let p = -44.6 - r. Let g = -5.9 - p. What is the second smallest value in g, 1, 4, -1? g Let a = -8869 + 8870.219. What is the third biggest value in -5, -2, 0.1, -1/9, a? -1/9 Let j be (3/(-5))/(33/(-22)). Let y = -3/2 + -1/6. What is the third smallest value in 5, y, 3, j? 3 Let h = 217 - 437. Let j = h - -217. Which is the biggest value? (a) -0.2 (b) 1/5 (c) j (d) -0.1 b Let s = 0.7854 - 0.2854. Let i be (-8)/12 + 8/10. Which is the smallest value? (a) i (b) s (c) -0.31 c Let o = 14 + 9. Let r(v) = v*3 - 10v*2 + 10v + 9. Let u be r(9). Let p = o - u. Which is the smallest value? (a) 1/5 (b) p (c) 1 a Let t = -2.4 + 2.7. Let p = -3.6 + 3.1. Let i = p + 1. What is the biggest value in i, t, 8? 8 Let a = 1336.7 - 1336.6. Let t = 4.3 + -5. Let b = t + 0.4. What is the second biggest value in b, -22, a? b Let w = 130 + -1037/8. Let r = 33.8 - 28.8. Which is the smallest value? (a) 2/3 (b) r (c) w (d) -11 d Let v = 0.2 - 0.4. Let x = -394.95 - -395.25. What is the smallest value in x, v, -0.13? v Let u = -4.53 - -4. Let d = u - -5.53. Let y be 19/30 - (-4)/(-30). Which is the second biggest value? (a) -2/9 (b) d (c) y c Let f = -71.7628 + -12.3662. Let k = f + 84. Let j = k + -0.071. Which is the third smallest value? (a) -2/7 (b) 4 (c) j b Let r be (10131/23639)/(4/(-154)-3). Let k = 3 - 0. Which is the third biggest value? (a) r (b) 1/2 (c) k b Let v = -97 + 104. Let t be (1 - v)/(9/(-6)). Let i be (-2)/(-3) - (-13)/(-15). Which is the second biggest value? (a) 1/5 (b) i (c) t a Let l = -0.08 + -97.92. Let z = l + 98. What is the second biggest value in z, -0.13, -4? -0.13 Suppose -12f + 15f = 45. Let g be 6/(-8)(-40)/f. What is the third smallest value in -2/3, -3, 0.03, g? 0.03 Let y be -5 + (-6)/(-9) + (-1 - -4). Let f = -0.1 + -0.1. What is the fourth biggest value in -0.02, y, f, 0.3? y Let w = 3.777 - -0.323. Let m = -94.7 + 99. Let s = w - m. Which is the third biggest value? (a) -6/5 (b) s (c) -0.4 (d) -0.1 c Let t = 3.9507 - 0.9507. Let m = -3 + 5. What is the fourth smallest value in 3/7, 1/3, m, t? t Let k = 21.9776 + 0.0224. What is the third smallest value in -4/5, k, -5/6? k Let z = 5.2 + -0.2. Suppose d + t - 6t = 31, -3d - 3t + 111 = 0. Let r = -32 + d. What is the third biggest value in r, z, 11/3? 11/3 Suppose 0d - a = -3d - 27, 4a - 18 = 2d. Let q be 2 - (2 - 6 - d). What is the second biggest value in q, -4/7, -3/7, 0.1? -3/7 Let m be ((17 + -8)/(-18))/(-1). Let v = -1/4 + m. Which is the fourth biggest value? (a) 1/3 (b) v (c) 4 (d) 1 b Let o be 105/(-134) + 0 - (-18 + 1120/64). Which is the smallest value? (a) -2/3 (b) o (c) -2/19 a Let m = 343/605 + 4/121. Let n = 99 + -97. What is the smallest value in n, m, 21? m Let s = 785.6641 + 0.9359. Let i = s - 793. What is the third biggest value in -2, i, -0.3? i Suppose -5d = -3n + 16, d + 6 = -9n - 26. Let z = -67 - -67.132. Which is the third biggest value? (a) z (b) d (c) 0.2 b Let v be -2(-15)/(-10) + -3. Let m be (1/v)/((-26)/78). Which is the third biggest value? (a) 0.022 (b) 0.1 (c) m a Let a = 533 + -312. Let c = a - 220.7. What is the second smallest value in -12, c, 3? c Let u = 35.62 + -32.62. Which is the second biggest value? (a) 0.0429 (b) u (c) -0.3 a Let z = -0.522 + -132.478. Let y = 130 + z. Let q = -0.5 - -0.8. Which is the fourth smallest value? (a) y (b) 2/3 (c) q (d) 2/19 b Let h = 11.8 + -15.8. Let n be ((-2)/44)/((-1)/6). Let z = 53.4 + -54.4. Which is the biggest value? (a) z (b) n (c) h b Let h = -2 - -1.1. Let w = h + 0.8. Let m = -10343/6896 - 1/6896. Which is the second smallest value? (a) 0.01 (b) 0.3 (c) m (d) w d Let u = -36001/66 + 25/22. Let x = u - -545. Let h = 4 + -4.4. Which is the biggest value? (a) x (b) h (c) 2 (d) -0.7 c Let l = -2648.5 - -2168. Let h = 481 + l. Which is the second biggest value? (a) h (b) -2 (c) 343 a Let m = 1062 + -1065. Which is the biggest value? (a) 150 (b) m (c) -7 (d) 5/2 a Let s = -9190 + 9178. Which is the second smallest value? (a) -2/23 (b) 0.5 (c) s a Let n be (-143 - 4)(-1)/(-3). Let z = -244/5 - n. Let s = -30 - -31. Which is the fourth smallest value? (a) -4 (b) -3/7 (c) z (d) s d Suppose n - 2323 = 3q, 17n = 8q + 22n + 6164. What is the second smallest value in q, -2/15, 3? -2/15 Let n be (-2)/(10/15) + 8 + 1. Suppose 379g + 8 = 375g. Which is the second smallest value? (a) g (b) n (c) -2/3 c Let t = 739 + -215. Let x = t + -522. What is the fourth biggest value in -2/31, x, 0.06, -0.3? -0.3 Let i = 3456 - 3454.2. What is the biggest value in 0, 2, i? 2 Let p = -3800 - -3815. Which is the fourth biggest value? (a) p (b) -0.3 (c) -31 (d) -1 (e) -2 e Let r = -99 + 103. Let y(o) = o*2 + 14o + 10. Let w be y(-13). Let s be 2/w - 14/(-210). Which is the biggest value? (a) s (b) r (c) -1 b Let p = -6.353 - -24.353. What is the third biggest value in -5, 0.04, -2, 3, p? 0.04 Let t = -6454 - -6458. What is the smallest value in t, -2/11, 2/571, -2? -2 Let g = -0.0298 - -2.2858. Let p = g - -0.044. Let m = 2.6 - p. What is the third smallest value in -5/2, m, 0.4? 0.4 Let g(j) = -j*3 + 30j*2 - 32j - 23. Let s be g(29). Let x = 114 + s. Let o = -0.36 + -0.04. Which is the third smallest value? (a) -2 (b) x (c) o (d) 2 d Let o = -41.16 + 14.16. What is the third biggest value in o, 4/7, -0.4, 0.5? -0.4 Let j = 2698 + -2697.5. Which is the fifth smallest value? (a) -0.22 (b) -5/2 (c) j (d) -0.5 (e) 2/5 c Let j = -831 - -878. Let y = 0.088 + -64.088. Let o = y + j. Which is the fourth smallest value? (a) 5 (b) 2 (c) 2/17 (d) o a Let j = -98.9631 + -0.0369. Let q = -103 - j. What is the second biggest value in -5, -2/103, q? q Let n be (-140 - -133)/(-2 - -1) + (-129)/14. Which is the smallest value? (a) 1 (b) n (c) 0.04 b Let n = -1424 + 1429. Let h = 250 - 285. Which is the third smallest value? (a) h (b) n (c) -5 (d) 3 d Suppose 12 = -3u - u. Let m be -8 - (-444)/(-27)(-6)/12. Which is the second smallest value? (a) m (b) 2 (c) u (d) -0.5 d Let q = -427 - -5549/13. Let d = 264 + -788/3. Which is the smallest value? (a) d (b) q (c) 32 b Let p = -3.7685 - -3.9685. Let t = 2329/13 - 179. What is the third smallest value in p, -0.5, t, 69? p Let k = 5.4385 + -0.4385. What is the third biggest value in -0.5, -0.013, k? -0.5 Let k = 5 - -12. Let h = 16.95 - k. Let w = h - 0.45. What is the second biggest value in w, 1, 1/4? 1/4 Suppose -5z + 6 = -0g + 4g, 2g - 5z + 12 = 0. Let y = -13.909 - -14.209. What is the fourth smallest value in g, y, -3/4, -1/2? y Let y = 16219.9 + -16220. Let p = 16 + -15.99. Which is the third smallest value? (a) y (b) p (c) 1.7 c Let g = -25240.9623 - -25241. Which is the third smallest value? (a) g (b) -7 (c) -2/5 a Let t(g) be the third derivative of 17g*4/24 - 49g*3/2 - 9g*2. Let n be t(9). What is the second smallest value in n, -4/3, 0.04? 0.04 Let k = 2.45 - -0.55. What is the third biggest value in 2, 2/391, k? 2/391 Suppose 375 = 2a + y - 6y, 2y = -a + 165. Let k be 56/9 - (-6)/(-27). Let v be ((-30)/a)/(k/(-20)). What is the biggest value in v, -2, 22? 22 Let x = 825 - 6611/8. Let f = x - -37/24. What is the smallest value in -3, -3/8, f? -3 Le	{ "pile_set_name": "DM Mathematics" }
ive r. 131 Express -4i2 + i4 - 47868i*3 - i + 47865i*3 - 2 + 2 in the form ci + ai4 + x + ji*2 + ti*3 and give t. -3 Express -155 + 42 + 35 + 37 + 33 - 80q in the form m + aq and give m. -8 Express 1582z*4 + 1 + 1340z*4 - z - 2493z*4 as xz + jz4 + pz*3 + k + yz*2 and give k. 1 Rearrange (4l - 5l - 3l)(-27l2 + 96 - 96) + (-l2 - 5l2 + 4l*2)(0l - 3l + 5l) to the form fl*3 + rl + s + ql2 and give q. 0 Express z + z4 - 2z*2 - 2z*3 + 135 - 136 - 4z*3 as fz*4 + sz + j + uz3 + pz*2 and give s. 1 Rearrange -21 - 332k2 + k3 + 114k2 - 2k + 109k2 + 113k*2 - 3k*3 to pk*2 + sk*3 + gk + o and give s. -2 Express 1556t3 + 23t - 1555t3 + t + 8t + 2 as it2 + r + yt + lt3 and give l. 1 Express (-2o + 4 - 4)(315 - 11 + 545) as m + co and give c. -1698 Express 110b + 37 - 37 + 13b as t + fb and give f. 123 Rearrange (-j - j + 0j)(7j*2 - 11j2 + j2) + (2j - j + j)(2j2 - j2 + 0j2) + 0 - j3 + 0 to oj + zj*3 + p + kj*2 and give z. 7 Express (3u + 10u + 13u)(2u - 2u + 4u*2) + 0u*3 + 0u3 - u3 as h + lu2 + qu + nu3 and give n. 103 Rearrange -14j*3 - 1 - 174j*2 + 4 + 15j*3 to lj + x + sj3 + tj*2 and give t. -174 Rearrange (7 + 2 + 4)((1 + 3 - 7 + (-1 - 2 + 2)(4 + 0 - 3))(2 - 2 + b) + (-b - b + 0b)(0 - 3 + 4)) to sb + y and give s. -78 Rearrange (5 - 3 + 3)(-90h2 + 17011h - 17011h) to ih*2 + k + bh and give i. -450 Express 474n3 - 469n*3 + 7n*2 + 3 + 18n*2 in the form r + dn*3 + hn*2 + cn and give r. 3 Express -171c + 197 - 197 as z + qc and give q. -171 Rearrange 0d3 - 2d*3 + 3d*3 + (1 - 1 - 1)(-7d3 + 26d*3 + 240d*3) to the form qd + pd2 + f + td3 and give t. -258 Express (-y2 - 3y + 3y)(0 + 0 + 2y) - 2y - y3 - 2 + 9058y*2 - 9058y*2 in the form cy + py3 + xy*2 + h and give h. -2 Rearrange 5 - 2b - 12b3 + 0b*3 + 17b*3 - 3b*3 + 6b*2 to kb*2 + x + nb + db3 and give d. 2 Rearrange 1 - 2k - 209k3 + 109k*3 + 17k*3 - 180k*3 to dk*2 + yk*3 + h + nk and give n. -2 Rearrange (0z4 - 5z*4 + 3z*4)(237 - 189 + 620) to az4 + iz*2 + wz + u + mz3 and give a. -1336 Rearrange 22w*2 + 81 - 81 to the form l + tw*2 + cw and give t. 22 Express 3r4 - 2r*2 + 7r*3 - 1006r + 3r2 + 1010r in the form xr + g + zr*2 + mr*3 + jr*4 and give m. 7 Express (0 + 2 - 4)(105n + 56851 + 16n - 56861) in the form q + yn and give q. 20 Rearrange -13w*2 + 17w*3 + 8w*2 + w - 31w*4 - 9w*3 + 7w*2 - 7w*3 to xw*3 + kw*4 + pw + iw2 + s and give x. 1 Rearrange -55f - 18f + 5f to bf + u and give b. -68 Rearrange -20v - 11v + 61 + 4 + 30v to the form z + hv and give h. -1 Rearrange -18g*3 - 26g*3 + 4g - g*4 + 47g*3 + 2 to the form zg*3 + a + cg*4 + qg*2 + xg and give z. 3 Rearrange 1 + 89q - 43q + 2q2 - 49q to the form wq + iq*2 + h and give i. 2 Express m - 2m*4 + 2m*3 + 142 + 77 - 243 as pm*3 + h + qm*2 + tm + am4 and give h. -24 Rearrange l3 + 0 + 38 + 25 + l2 + 6 - 10 to the form rl + cl3 + k + zl2 and give k. 59 Express (-h2 - 2h + 4h - 3h)(4 - 26087h - 2 + 26288h) as lh2 + ah*3 + m + vh and give l. -203 Express -61u + 114u - 55u - 2 - 120u*4 as ku + l + yu3 + xu*2 + tu4 and give l. -2 Rearrange (-4 + 4 - w2)(-5 + 5 - 3w - w + 3w + w + (w + w - w)(1 + 5 - 4)) to b + pw + xw*2 + tw*3 and give t. -2 Rearrange 2c + 3c - 3c + (-1 + 1 + 3)(-5c + 8c + c + (0 + 2 + 0)(5c - 3c - c) - 2 + 2 + 2c) to n + yc and give y. 26 Rearrange 108 - 56 - 52 + 167m to gm + v and give g. 167 Express 41 - 486c - 122 + 44 + 37 in the form t + wc and give w. -486 Express -4398f + 19 + 4398f + 5f4 + 3f*3 in the form gf + rf3 + z + yf*2 + bf*4 and give r. 3 Rearrange (11o - 13o - 22o)(12 - 12 - 7o) to the form mo2 + jo + v and give m. 168 Rearrange -32t - 579t*3 - 25t + 581t3 to u + kt*3 + mt*2 + wt and give w. -57 Express 302v2 + 1 + 2 - 271v*2 + 1076v*2 - 1 in the form lv + cv2 + j and give c. 1107 Express ((1 + 2 + 1)(21 - 15 + 23) + 0 + 0 + 2)(-n + n + 2n*3) in the form tn*2 + wn + m + cn3 and give c. 236 Rearrange j3 - 655 + 1317 + 2j*4 - 662 + j to the form cj*2 + aj + ij4 + yj*3 + l and give a. 1 Express (1 - 2 - 2)(-57 + 20 + 25)(0p + 4p - 5p - p - p + 4p + (-6p + 2p + 2p)(1 + 1 - 4) - p + 0p + 2p + 4p - 1 + 1) as z + jp and give j. 360 Express -3u*4 + 2u*3 - 6u*4 - 159u*2 + 11u*4 + 0u*3 in the form ku*3 + su + hu2 + pu*4 + a and give h. -159 Rearrange -50n*2 - 22n*2 + 18n*2 + 8 - 25n*2 - 9 to jn + zn2 + b and give b. -1 Express t3 - 5 - 3 + 10 + 3t - 16 in the form w + jt2 + rt + kt3 and give k. 1 Rearrange ((4 - 5 + 3)(-1 - 1 + 4) - 4 + 2 + 4)(-134r*2 + 1200r - 1200r) to mr*2 + nr + i and give m. -804 Rearrange 3a + 9a - 8a - 5a + 15 to the form n + ga and give n. 15 Express 4h + 3h3 - 4h + 2 - h + 59h3 as mh*2 + xh*3 + y + qh and give q. -1 Rearrange 3s - 19s - 201s to f + ks and give k. -217 Rearrange (-3c + 2c + 4c)(0c + 3c + 2c + (2 + 1 - 2)(-3c + 5c - c) + 841c - 2198c + 871c) to the form lc*2 + d + gc and give l. -1440 Express (1 - b - 1)(-168 + 174 + 159)(-3b + 2 - 2) as db*2 + v + qb and give d. 495 Express -13y4 - 6y + 0y2 - y2 + 11y + 4 - 6 - y*2 as ny + t + py4 + vy*2 + cy*3 and give n. 5 Express 15l + 9l - 25l + 106l2 in the form ml + v + fl2 and give m. -1 Rearrange -s + 30 + 0s2 - s3 - 7s4 + 5s*4 + 3s*3 + 0s*2 to the form ws*4 + us*3 + qs + zs2 + j and give j. 30 Express 14k*4 - 2143k3 + k4 + 2144k3 + 4k*2 as n + fk*2 + sk + qk3 + vk*4 and give f. 4 Express -5f + 42f - 3f*4 - 22f + 5f4 + 1 - f4 + 6f*3 in the form kf*3 + h + af + sf2 + df*4 and give s. 0 Rearrange -1321k + 2210k - 1272k to u + rk and give r. -383 Express -14r - 27r - 20r - 32r3 + 54r - 8r as or*3 + sr*2 + jr + t and give o. -32 Rearrange -36 - 52 - 75b + 77b - 27 to h + jb and give h. -115 Express 2408 - 192a - 2408 in the form q + ga and give g. -192 Rearrange (6 - 16 + 12 - 37w)(-22w + 7w - 25w) to the form hw2 + ow + y and give o. -80 Express 7y - 15y*2 - 7y + (y + 2y - 5y)(y + y + 0y)(-12 + 0 + 2) as ty*2 + j + sy and give s. 0 Rearrange (3 - 4 + 2)(-1574b*3 - 168b*3 - 507b*3) to the form sb*2 + a + cb*3 + wb and give c. -2249 Rearrange 11n + 20n - 67n + (-5n + 2n + n)(2 - 4 - 1) - n + 4n - 5n - 6n - 6n + n + 5n - 3n + 0n to t + jn and give j. -41 Express -52p - 39p - 126p2 + 91p + 19p2 as mp*2 + d + gp and give m. -107 Rearrange 71p + 60p - 7p - 8p to the form sp + v and give s. 116 Express -41 + 51 + f3 - 9 + 114f*2 as mf*2 + vf*3 + w + of and give v. 1 Express (2 - w - 2)(22w - 11w - 10w - 64w3) as nw*4 + z + xw + cw2 + ow*3 and give z. 0 Rearrange -2g + 31 - 1119g2 + 565g2 - g4 + 554g2 + 3g*3 to o + zg*2 + tg + kg4 + hg*3 and give t. -2 Rearrange 9 - 23x*2 + 12x*2 - 10x - 2 - 7 to lx + hx*2 + u and give l. -10 Rearrange -38a - 131a - 89a - 288a to the form sa + c and give s. -546 Rearrange -102k2 + 22k*2 + 30k*2 + 25k*2 + 28k*2 + 308k to qk2 + zk + h and give z. 308 Express -1 + 37u + 2u*4 + 47u*2 - 49u*2 + 3u3 - u3 - u*4 in the form s + zu*2 + yu + qu4 + lu*3 and give y. 37 Rearrange (-90 + 205 + 60)(a*2 - 4a*3 + 5a*3 + 2a*3) to fa + ja3 + wa*2 + k and give j. 525 Rearrange 3733i*3 - 2i*4 + 3i*4 - 3636i*3 - 3 + 2i + i*4 to fi*4 + qi*3 + ti + gi2 + l and give t. 2 Express -6v*3 - 12 - 14v + 2v4 + 4v3 + v3 - 19v + 32v as d + gv2 + bv + qv3 + cv*4 and give d. -12 Rearrange ((0 + 2 + 3)(26 - 26 - 40q) - 3 - 2q + 3)(-3q + 0q + 4q) to tq + h + lq*2 and give l. -202 Rearrange 2h*3 + 51h*2 + 29 - 2h - 53h2 + 39 - 19 + h4 to ph*4 + jh*3 + vh + rh2 + u and give v. -2 Express (-4t + 3*t	{ "pile_set_name": "DM Mathematics" }
nwo. What is prob of picking 1 t, 2 n, and 1 o? 2/91 Three letters picked without replacement from {d: 18, o: 2}. Give prob of picking 1 o and 2 d. 51/190 Calculate prob of picking 4 f when four letters picked without replacement from {n: 3, f: 15}. 91/204 Calculate prob of picking 3 h and 1 j when four letters picked without replacement from {j: 3, d: 1, y: 3, h: 3}. 1/70 Three letters picked without replacement from {v: 2, y: 3}. Give prob of picking 2 v and 1 y. 3/10 Calculate prob of picking 2 c when two letters picked without replacement from lccccccclcccccllllc. 26/57 Two letters picked without replacement from {z: 1, r: 1, k: 1, n: 2, s: 1, x: 1}. What is prob of picking 2 n? 1/21 What is prob of picking 1 b and 3 m when four letters picked without replacement from mammb? 1/5 What is prob of picking 1 f and 1 j when two letters picked without replacement from {x: 2, f: 1, j: 4, d: 3, r: 2}? 2/33 Four letters picked without replacement from {j: 3, a: 3, e: 1, c: 10, n: 3}. What is prob of picking 3 n and 1 c? 2/969 Two letters picked without replacement from {e: 5, f: 4, j: 3, r: 1}. What is prob of picking 2 e? 5/39 What is prob of picking 1 r and 1 m when two letters picked without replacement from {f: 4, s: 2, m: 2, r: 1}? 1/18 Three letters picked without replacement from mnnnmnmnnnnmnnnmnyny. Give prob of picking 1 y and 2 n. 13/95 Calculate prob of picking 2 m and 1 v when three letters picked without replacement from rmrmrrrrrvrhhrbwwvr. 2/969 Four letters picked without replacement from {k: 2, t: 1, a: 5, v: 1}. Give prob of picking 2 k, 1 v, and 1 a. 5/126 Calculate prob of picking 3 r when three letters picked without replacement from ruqqqquqqqqququuq. 0 Two letters picked without replacement from vfuyvyuuffyvuyfvvyuv. What is prob of picking 2 u? 1/19 Three letters picked without replacement from tmtomoqmmooztmmzmz. Give prob of picking 2 o and 1 q. 1/136 Three letters picked without replacement from fffffffhhhfffhfhfff. Give prob of picking 3 h. 10/969 Two letters picked without replacement from {l: 2, g: 1, i: 6, o: 1, q: 2, d: 3}. Give prob of picking 1 d and 1 g. 1/35 What is prob of picking 2 f and 1 y when three letters picked without replacement from pbipyboyobyfobpf? 3/560 Calculate prob of picking 3 s when three letters picked without replacement from isaiiyisayasssyaass. 35/969 Calculate prob of picking 2 x and 2 i when four letters picked without replacement from xtiiytxiiiiyiix. 4/65 What is prob of picking 1 h, 2 o, and 1 k when four letters picked without replacement from khooook? 12/35 Three letters picked without replacement from btyppiypbbyttbpwp. What is prob of picking 2 b and 1 i? 3/340 What is prob of picking 1 b, 1 k, 1 m, and 1 r when four letters picked without replacement from {h: 6, r: 1, b: 3, m: 1, q: 4, k: 3}? 1/340 Calculate prob of picking 3 d when three letters picked without replacement from {q: 15, d: 5}. 1/114 Four letters picked without replacement from {q: 2, v: 11}. What is prob of picking 2 q and 2 v? 1/13 Two letters picked without replacement from {o: 2, z: 2, y: 6, h: 1, b: 5}. What is prob of picking 1 h and 1 o? 1/60 Calculate prob of picking 1 o and 1 e when two letters picked without replacement from {o: 3, e: 2}. 3/5 Four letters picked without replacement from sooisnsssoins. What is prob of picking 1 s, 1 i, and 2 o? 36/715 Two letters picked without replacement from {s: 3, k: 4, l: 2, u: 2, h: 2, f: 2}. Give prob of picking 1 f and 1 u. 4/105 Calculate prob of picking 4 j when four letters picked without replacement from {z: 3, j: 7}. 1/6 Two letters picked without replacement from llkgllldlllklglglgd. Give prob of picking 2 g. 2/57 Calculate prob of picking 1 l, 1 v, and 1 k when three letters picked without replacement from drvrdddvrordlkdr. 1/280 Four letters picked without replacement from egwsseezvwszees. What is prob of picking 1 v, 1 s, and 2 e? 8/273 Four letters picked without replacement from {j: 5, s: 2, w: 1, g: 3, x: 1, l: 1}. What is prob of picking 3 g and 1 j? 1/143 Three letters picked without replacement from lxammhasx. Give prob of picking 1 l and 2 x. 1/84 Two letters picked without replacement from {e: 4, i: 1, z: 4, j: 1, w: 7}. Give prob of picking 1 z and 1 e. 2/17 Two letters picked without replacement from ggllne. Give prob of picking 1 n and 1 l. 2/15 Two letters picked without replacement from lnn. What is prob of picking 1 n and 1 l? 2/3 What is prob of picking 2 p and 2 d when four letters picked without replacement from {b: 2, e: 2, i: 3, d: 4, p: 3, n: 2}? 9/910 Three letters picked without replacement from hwhwwhhwwhhwwhww. Give prob of picking 3 h. 1/16 What is prob of picking 2 g when two letters picked without replacement from {s: 1, p: 1, n: 2, g: 2}? 1/15 Three letters picked without replacement from {l: 6, d: 7, g: 2}. What is prob of picking 2 g and 1 d? 1/65 Calculate prob of picking 1 f and 2 v when three letters picked without replacement from {h: 3, f: 3, v: 2}. 3/56 What is prob of picking 1 t, 1 p, and 1 d when three letters picked without replacement from {t: 9, m: 1, i: 2, p: 3, d: 3}? 27/272 Two letters picked without replacement from wweeekkee. Give prob of picking 2 k. 1/36 What is prob of picking 2 s when two letters picked without replacement from ssssssssssswssssss? 8/9 What is prob of picking 2 x when two letters picked without replacement from {z: 4, r: 4, x: 12}? 33/95 Four letters picked without replacement from yggyyyyygyygyygyyy. Give prob of picking 2 g and 2 y. 13/51 Three letters picked without replacement from zzyqyybqqzyzh. What is prob of picking 2 z and 1 h? 3/143 What is prob of picking 1 p and 3 v when four letters picked without replacement from {p: 4, v: 3}? 4/35 Three letters picked without replacement from kpkxkkwppkkpbp. Give prob of picking 1 k, 1 x, and 1 b. 3/182 Calculate prob of picking 4 a when four letters picked without replacement from aauauau. 1/35 Two letters picked without replacement from ctcss. What is prob of picking 2 s? 1/10 What is prob of picking 1 f, 1 u, and 1 e when three letters picked without replacement from {l: 1, u: 1, w: 5, e: 3, f: 4}? 3/91 Three letters picked without replacement from qqqqsss. What is prob of picking 1 s and 2 q? 18/35 What is prob of picking 1 d and 1 g when two letters picked without replacement from dsgvvvgvdsssvsgdgvdg? 2/19 Four letters picked without replacement from {i: 1, l: 3, q: 3}. What is prob of picking 4 q? 0 Three letters picked without replacement from dwufh. Give prob of picking 1 f, 1 h, and 1 d. 1/10 Calculate prob of picking 4 n when four letters picked without replacement from {d: 1, c: 1, e: 2, n: 4}. 1/70 Two letters picked without replacement from pppoop. Give prob of picking 1 o and 1 p. 8/15 Calculate prob of picking 2 t and 2 h when four letters picked without replacement from hhhthhhththhthhhhhh. 105/646 Three letters picked without replacement from {i: 7}. What is prob of picking 3 i? 1 Four letters picked without replacement from {b: 5, q: 6, d: 2}. Give prob of picking 1 b, 1 q, and 2 d. 6/143 Calculate prob of picking 1 z, 1 o, and 1 t when three letters picked without replacement from ooontozonnuononno. 1/85 Four letters picked without replacement from {f: 2, y: 6, v: 4}. What is prob of picking 4 y? 1/33 What is prob of picking 3 a when three letters picked without replacement from {x: 1, t: 5, f: 1, q: 1, a: 3, j: 3}? 1/364 Two letters picked without replacement from ebuxeebxebxexe. Give prob of picking 2 e. 15/91 What is prob of picking 1 f and 1 s when two letters picked without replacement from {f: 1, j: 1, z: 1, u: 1, w: 1, s: 2}? 2/21 What is prob of picking 2 j when two letters picked without replacement from {d: 3, j: 8, t: 3, p: 3}? 7/34 Three letters picked without replacement from {g: 1, d: 3, b: 3, o: 1, q: 3}. Give prob of picking 1 b and 2 d. 3/55 What is prob of picking 4 e when four letters picked without replacement from eeeeeeeee? 1 Calculate prob of picking 1 i, 1 h, and 1 d when three letters picked without replacement from hzizlyd. 1/35 Four letters picked without replacement from hvbbbxh. What is prob of picking 1 x, 2 v, and 1 b? 0 Calculate prob of picking 1 n and 1 j when two letters picked witho	{ "pile_set_name": "DM Mathematics" }
166 + 55.134. Let k = -49 + a. Let d = k + -6. What is the biggest value in 1/8, d, 5? 5 Let j be (3/5)/(6/4). Let q be (5/35)/(6/14)12. What is the biggest value in j, q, 5? 5 Let v = 12 - 11. Which is the third smallest value? (a) 0.4 (b) v (c) -0.2 b Let u = -0.022 + -0.478. Let j = -6 - -3. What is the smallest value in u, j, 0? j Suppose 237 = -0u + 3u. Let j = -313/4 + u. Let y = 0.3 + -0.4. What is the third biggest value in 0, y, j? y Let j = -4 + 1. Let g = -33 - -33.4. Which is the smallest value? (a) -0.4 (b) j (c) g b Let j = 0.1 + 0.9. Let c = -18.7 - -19. What is the second smallest value in j, c, -2? c Suppose -12u - 19 = 5. Which is the second smallest value? (a) 2/5 (b) 0.1 (c) u (d) -1 d Let z(f) = -f*2 - 10f + 5. Let l be z(-10). What is the second smallest value in -3/2, l, -1? -1 Let l = -5.09 - -0.09. Which is the third smallest value? (a) 2/7 (b) 1/71 (c) l a Let d = 6 - 10. Let u(p) = p - 2. Let x be (0 - -1)(1 + 0). Let v be u(x). What is the biggest value in 2/9, v, d? 2/9 Let d be 5 - ((-15)/(-25) + 5). What is the biggest value in 5, 0.5, d? 5 Let g be ((-2)/14)/((-3)/(-6)). Let j = 21 - 26. What is the third smallest value in 0, g, j? 0 Let m = -35 - -1084/31. Let i = 86/217 - m. Suppose -p = p. What is the second smallest value in p, 0.5, i? i Let l = 0.08 - -0.42. Which is the third smallest value? (a) -5 (b) l (c) -0.4 b Let n = 7 - 6. Let u = 4 - n. Which is the smallest value? (a) u (b) -5 (c) -3 b Let u = -14 + 16. What is the fourth smallest value in 0.5, -0.5, -1/11, u? u Let h be -1 + (20/(-16) - 1/4). Which is the fourth biggest value? (a) 2 (b) -1 (c) h (d) 0.01 c Suppose -2s + 4 - 18 = 0. What is the second biggest value in -1.5, s, 3/8? -1.5 Let j = 4.8 - 5. Let u = -11 - -6. Which is the biggest value? (a) -2 (b) j (c) u b Let d = 10.76 - -0.24. Let x = 0 + d. Let m = 13 - x. Which is the second biggest value? (a) 0.4 (b) m (c) -3 a Let f = 6 - 2. Suppose -3j + 5l = 5, 0j - 24 = -fj - l. Let p = 1.85 - 1.35. Which is the second smallest value? (a) p (b) 2/5 (c) j a Let p = 56 - 36. Let i = p + -19.6. Suppose -5z + 4z = 0. What is the smallest value in i, -4/7, z? -4/7 Let n = 6 + -4. Let h = -0.04 + -1.96. Which is the second smallest value? (a) n (b) h (c) 0 c Let b(y) = -2y - 1. Let g be b(-2). Let k = 5.6 + -6. Let t = k + -0.1. What is the biggest value in g, t, -1? g Let c = 60/11 - 1238/231. What is the third smallest value in 0, c, 4? 4 Let a = 49.05 - 51. Let v = -0.05 + a. What is the third smallest value in -0.4, v, -0.3? -0.3 Let m = -12.09 - -12. Let f = m - -0.29. Which is the second biggest value? (a) f (b) -0.4 (c) 1 a Let f = 2/9 + 1/36. Let v be 3 + -3 + -15. What is the second biggest value in f, v, 3? f Let w = 58 + -55. Which is the second smallest value? (a) -0.3 (b) 0 (c) w b Let v = 9 + -5. Let k be v/(4/(-1)) + 0. What is the third biggest value in -2/9, k, 3? k Let r be (0 + 1 - -1)/((-28)/6). What is the third biggest value in 12, 0.2, r? r Let j = 3/73 - 100/657. Which is the second smallest value? (a) 2/11 (b) -1 (c) j c Let t = 1.7 + -2.1. Let q = 0.13 + 8.87. Let d = -14 + q. Which is the smallest value? (a) t (b) 4/7 (c) d c Let q be 5/165-6 + (-4)/(-11). Let h = 4.4 + -5. Which is the smallest value? (a) q (b) h (c) -0.4 b Let j be 53/91 + 4/(-26). Which is the biggest value? (a) 2 (b) j (c) -3 a Let q be 3/107/((-126)/(-30)). Which is the third biggest value? (a) 0.1 (b) q (c) -2/5 (d) -5 c Let m be (0 + -2)6/(-4). What is the third biggest value in 0, m, -1? -1 Let v = -52 - -57. Which is the biggest value? (a) 2 (b) v (c) -0.4 (d) -2/7 b Let t = 4/109 + 307/545. Let v = -0.1 + 0.6. Let l = v - 0.3. Which is the smallest value? (a) l (b) t (c) -4 c Let n = 12.22 + -0.22. Let a = 11.7 - n. Let s = -2 + 4. What is the biggest value in 4, s, a? 4 Let v = 2/113 - -103/565. Suppose -30 = -2m - m. Let n be ((-2)/m)/((-4)/(-10)). What is the second biggest value in n, v, -5? n Let g = -9 + 6. Let d = g + 3.2. Let l = -2/227 + 1147/1362. What is the third biggest value in d, -1/2, l? -1/2 Let o = -11.01 + 11. What is the third smallest value in 0.5, o, -1/8? 0.5 Let j = 0.18 - 0.1. What is the second smallest value in -3, -1/2, j? -1/2 Let u = -0.05 - 4.95. Which is the smallest value? (a) 1 (b) u (c) -2 b Let q = -0.37 - 0.03. Let i = -2.8 - -0.8. Let x = 0.3 + 0.7. Which is the second smallest value? (a) q (b) x (c) i a Let a = -1.31 + 0.31. What is the biggest value in a, -4, -7? a Let x = -11 - -7. Let p = -3 + -3. Let o = -5.5 - p. What is the third smallest value in o, 5, x? 5 Let g = -31 - -31.38. Let m = 0.08 - g. Which is the third smallest value? (a) m (b) -1/2 (c) 5 c Suppose 0 = -5x + 10. Suppose -4w = 5p - 3w - 7, -4w + 10 = xp. Let v = -3.3 + 3. Which is the smallest value? (a) p (b) v (c) 0.2 b Let y be 13/6 - (-1)/(-2). Let q = y + -1. Which is the second biggest value? (a) 0 (b) -2 (c) q a Let y be 2/(-9)(-1)/(-2). What is the second smallest value in 0.3, y, -1? y Let f = -12.5 - -12.7. Which is the smallest value? (a) 0.4 (b) -1/5 (c) f (d) 2 b Let c = 3 - 6. Suppose 4y + 2p + 26 = 8y, -4y + 32 = -4p. What is the third smallest value in c, y, -2/13? y Let n = 40.8 - 41. Which is the smallest value? (a) 0.5 (b) 0.01 (c) n c Let w = 0.06 - 12.06. What is the biggest value in -1, -0.2, w, -0.1? -0.1 Let p = 0.019 - 0.029. Which is the smallest value? (a) 5 (b) p (c) 0.3 b Let s = 0.1 - 0.2. Let z = 15.93 + -16. Let u = z - 4.93. Which is the second biggest value? (a) u (b) -1 (c) s b Let k = 12.9 - 13. Let u be ((-12)/21)/(2 + 0). Which is the biggest value? (a) u (b) k (c) 1/8 c Let g = -1 - 3. Let k = 12 + -9. Which is the biggest value? (a) g (b) k (c) 2/7 b Let r = 44 - 46. Let s = 80 - 242/3. What is the biggest value in s, -0.4, r? -0.4 Suppose 4d + 2101 = -d - f, 5f = d + 415. Let z be 2/(-7) - (-48)/d. Which is the third smallest value? (a) -1.4 (b) 0.5 (c) z b Let u = 0.1 - 2.1. Let p = 1.96 - -0.04. Let y = -1 + p. What is the biggest value in u, y, -3? y Let k = 0.07 - 0.09. Let y = -81.02 + 83. Let d = y - k. Which is the second smallest value? (a) d (b) 0.1 (c) 2/19 c Let k = 0.75 + 0.25. What is the smallest value in k, 0.1, 1/5? 0.1 Let w = -5.93 + -0.07. Let h = 0.6 + -9.6. Let x = h - w. What is the second smallest value in -5, 2, x? x Let t = 15/17 + -9/68. Let f be (-3)/(-10) + (-2)/4. Which is the third smallest value? (a) t (b) -3/2 (c) f a Let g = 17 - 22. What is the smallest value in 0, g, -1.2? g Let h be (4/6)/(120/18). What is the biggest value in -0.1, 0, h, 0.06? h Let n(m) = m2 + m + 2. Let y(v) = v2 + v. Let z be y(0). Let t be n(z). Which is the smallest value? (a) -3 (b) t (c) 5 a Let b(g) = -g + 1. Let t be b(3). Suppose 139 = 3r + 7y - 3y, -r = 3y - 38. Let c be (r/28 + t)4. What is the biggest value in c, 5, -2/5? 5 Let b = 44 + -39. What is the third smallest value in 7/4, -1, b? b Let y be (-24)/5516(-448)/5. Let u = y + 2/197. Suppose -r - 8 = -5r. Which is the second biggest value? (a) -5 (b) u (c) r b Let m = -4486/19 - -236. What is the third smallest value in 0.08, m, 4? 4 Let k = -14.5 + 14.8. What is the second biggest value in -2, k, -0.1? -0.1 Let k = -0.2 - -1.2. Let g = k - 1.1. Which is the second biggest value? (a) -2/3 (b) g (c) 2 b Let l = -5.4 - -0.4. Let i = -1 - 3. Let r = l - i. What is the second smallest value in -2, r, -1/4? r Let x = -2.04 + 2. Let w = x + 3.04. What is the smallest value in -3/5, w, 0? -3/5 Let t = -85 + 86. Which is the second smallest value? (a) 4/5 (b) t (c) 1/5 (d) -3 c Let l = 91 - 545/6. What is the biggest value in -1, l, -4? l Let l be (-2)/(-7)14/6. Let f = 55 - 55.5. Which is the second smallest value? (a) -0.1 (b) f (c) l a Let p = -4.04 + 0.04. Suppose 2s + 10 = 4s. Which is the third biggest value? (a) p (b) -0.1 (c) s a Let x = -0.1 - -0.1. Suppose -5n - 35 = 3g, 25 = -g - 0n - 5n. Let l = 0.01 - -1.99. Which is the third biggest value? (a) x (b) l (c) g c Let h = 7 + -8.5. Let i = 2 + h. Let u(z) = z*3 + 2z*2 - 2z - 2. Let b be u(-2). What is the biggest value in i, b, -0.4? b Let	{ "pile_set_name": "DM Mathematics" }
7071 divided by -3? 13702357 What is -4 divided by -156135155? 4/156135155 483496 divided by -37192 -13 11933838 divided by 6507 1834 Calculate 21618590 divided by -1. -21618590 Divide -2075737 by 10. -2075737/10 Divide 466143045 by 5. 93228609 Divide -28 by -25558980. 7/6389745 Calculate 105589978 divided by 52794989. 2 Calculate -286163 divided by 167. -286163/167 What is 3736742 divided by 6? 1868371/3 Divide 17 by -88007. -17/88007 Calculate -2807184 divided by -467864. 6 Divide -23822144 by 14368. -1658 Calculate -904 divided by 21725. -904/21725 Calculate -153986 divided by 93. -153986/93 53225424 divided by -17741808 -3 Divide -134158 by 450. -67079/225 What is 44421 divided by 3764? 44421/3764 -95 divided by 101293 -95/101293 Calculate 4331897 divided by -98. -4331897/98 What is -2816476 divided by 2? -1408238 Divide 36320802 by 2. 18160401 What is -29571880 divided by 799240? -37 What is -14357000 divided by -10? 1435700 Calculate 144917685 divided by 48305895. 3 Divide -71634560 by -1634. 43840 Divide -2 by -37060120. 1/18530060 Calculate -19358 divided by -625. 19358/625 -627487875 divided by -12805875 49 Divide -1883 by -11846. 1883/11846 Calculate 51 divided by 1388513. 51/1388513 -5 divided by -3009286 5/3009286 2 divided by -17724783 -2/17724783 Calculate -71 divided by 5878. -71/5878 Divide -68507006 by 6. -34253503/3 Calculate 239 divided by -1377916. -239/1377916 Divide -77011868 by -6. 38505934/3 Divide -32110040 by 6. -16055020/3 2918576 divided by 2918576 1 Calculate 11 divided by -12718172. -11/12718172 What is -1148851926 divided by 12737? -90198 Divide -7695720 by -2565240. 3 Divide 257377 by -3. -257377/3 Calculate -104838537 divided by 34946179. -3 What is -483391600 divided by 96678320? -5 Divide -8217 by 2604. -2739/868 Calculate 169723793 divided by 5. 169723793/5 Divide -19400759 by 2771537. -7 Divide 4 by 657930. 2/328965 Calculate 286314 divided by 233. 286314/233 What is 5560905 divided by -1477? -3765 Calculate -4 divided by 1639115. -4/1639115 8863085 divided by 11 805735 Calculate -599880 divided by 111. -199960/37 What is -288934800 divided by -1651056? 175 Divide -5 by -77565954. 5/77565954 Calculate -30605 divided by -914. 30605/914 What is 49177534 divided by 3? 49177534/3 29684490 divided by 1978966 15 Calculate -212 divided by 15209. -212/15209 What is -9193551 divided by 87? -105673 Calculate 1017141 divided by 31. 32811 Divide 23087917 by 7. 23087917/7 What is 155793046 divided by 1297? 120118 What is 66907568 divided by -2573368? -26 Calculate -73339267 divided by 2087. -35141 Divide 2410664 by 55. 2410664/55 Divide 398671472 by -16. -24916967 What is -4939 divided by -882? 4939/882 -319972781 divided by -8647913 37 Divide -41798 by -145. 41798/145 Calculate 2 divided by -12780094. -1/6390047 What is 4 divided by 1339912? 1/334978 Divide -4 by 19454711. -4/19454711 Divide -75799026 by 2. -37899513 Calculate -1096790360 divided by -2. 548395180 Calculate -14282004 divided by 3570501. -4 What is 91858 divided by -759? -91858/759 What is -6427729 divided by -7? 918247 -8899920 divided by 846 -10520 -199906 divided by -21 28558/3 Calculate 288660 divided by 1. 288660 Divide -9345392 by 2534. -3688 -33021 divided by -12904 33021/12904 Calculate -3638800 divided by -176. 20675 Calculate -3326 divided by 5669. -3326/5669 Calculate -15455996 divided by -6. 7727998/3 What is 716736508 divided by -876206? -818 What is 97 divided by 44267? 97/44267 Divide 76616800 by 1390. 55120 What is -10554840 divided by -3? 3518280 5 divided by -2059156 -5/2059156 Divide 1235396208 by 3. 411798736 0 divided by 31766931 0 What is 15 divided by 1243155? 1/82877 What is 3321486 divided by -4698? -707 What is 1825 divided by -5185? -365/1037 Calculate -146571 divided by 156. -48857/52 Calculate 0 divided by -87050455. 0 82061376 divided by 48 1709612 Divide -29704717 by 973. -30529 Divide 8671616 by 74. 117184 What is -904608 divided by -301536? 3 Calculate -1212 divided by 6659. -1212/6659 -5953086 divided by -1984362 3 Divide 9862128 by -2. -4931064 -2 divided by -13383027 2/13383027 Calculate -14543 divided by -526. 14543/526 Calculate -45176270 divided by -22588135. 2 -7 divided by 2749487 -7/2749487 Calculate -17711784 divided by 2213973. -8 Divide -9208160 by -52. 177080 Divide -8944455 by 9. -2981485/3 9556080 divided by 79634 120 19148 divided by 5490 9574/2745 Calculate 43375 divided by 38078. 43375/38078 Calculate -9 divided by 295441. -9/295441 12 divided by 936375 4/312125 What is 13663440 divided by -504? -27110 Calculate 370147646 divided by -11. -33649786 -944 divided by -245475 944/245475 10581746 divided by 4 5290873/2 Divide -20493457 by -6. 20493457/6 Divide 41032236 by -1322. -31038 What is -242243 divided by 242243? -1 Divide -3 by -7198561. 3/7198561 What is -11835474 divided by 7? -1690782 Divide -8 by -30839335. 8/30839335 Calculate 131911262 divided by 35758. 3689 What is 371600372 divided by 22? 16890926 What is -108032364 divided by 44? -2455281 Divide 7054215 by 69. 102235 Calculate 52 divided by -147433. -4/11341 Divide 1895 by -69932. -1895/69932 Divide 53370996 by -18284. -2919 9 divided by -13261948 -9/13261948 70 divided by 1863691 70/1863691 5 divided by -3822683 -5/3822683 What is -16 divided by 2923460? -4/730865 Divide -4450576 by 342352. -13 What is 10314647 divided by -5? -10314647/5 Divide -218 by 70341. -218/70341 Calculate -4458905 divided by 6. -4458905/6 Divide 192466 by 2659. 192466/2659 34255881 divided by -7557 -4533 2528390 divided by -2 -1264195 Calculate -1 divided by 69543692. -1/69543692 852879 divided by -852879 -1 What is -124 divided by 59359? -124/59359 Divide 56638118 by -1665827. -34 Divide -127512 by 1518. -84 Calculate 78427125 divided by -875. -89631 What is -35319000 divided by 244? -144750 Divide 178603819 by 81073. 2203 What is -453793200 divided by 175? -2593104 Divide 932379840 by -1344. -693735 What is -149989272 divided by 3? -49996424 2279754 divided by 5 2279754/5 -5043130 divided by -355 14206 Divide 11252 by -619. -11252/619 Divide 0 by -3174080. 0 Calculate 13564977 divided by -4521659. -3 599888700 divided by 6 99981450 What is -1072442 divided by -277? 1072442/277 Divide -6 by 143164. -3/71582 Calculate -44187579 divided by 12. -14729193/4 What is -3401111 divided by -5? 3401111/5 Divide -42229728 by 2. -21114864 Divide -598787 by -1. 598787 -4 divided by 58923069 -4/58923069 169298973 divided by 24561 6893 Divide -214926921 by 23880769. -9 -16397174 divided by 10 -8198587/5 -21036118 divided by -2 10518059 Calculate 1 divided by 48227679. 1/48227679 What is 230009816 divided by 8? 28751227 What is -731980 divided by -5? 146396 171649 divided by -4 -171649/4 What is -559 divided by -18952? 559/18952 What is 104083350 divided by 17347225? 6 Calculate -3024406 divided by -4. 1512203/2 Divide 60174024 by -15043506. -4 -14296905 divided by 1845 -7749 What is 28170855 divided by -208673? -135 Divide 508 by 63541. 508/63541 Divide -15354133 by 8. -15354133/8 -1072934600 divided by 5 -214586920 What is 126668518 divided by -6? -63334259/3 Divide -1 by 121690710. -1/121690710 -22374 divided by 506 -1017/23 Divide 131371377 by -1. -131371377 Divide 322120 by 40265. 8 5416 divided by -6434 -2708/3217 Calculate 32922540 divided by -62118. -530 What is -321387052 divided by 2416444? -133 What is 11050 divided by -3425? -442/137 Divide -37 by 301671. -37/301671 What is 229669834 divided by 2? 114834917 2530260 divided by 2 1265130 Divide -4409 by 125978. -4409/125978 Calculate 6468605 divided by -83. -77935 Calculate 312093005 divided by -27685. -11273 What is 36490608 divided by 1584? 23037 What is 29358 divided by -846? -1631/47 What is -39829415 divided by -2096285? 19 -632 divided by -1498 316/749 -4 divided by -160702 2/80351 Calculate -44 divided by 65512. -11/16378 Calculate 9451180 divided by 4. 2362795 296113 divided by 636 296113/636 Calculate -6685 divided by 606. -6685/606 What is 1 divided by -171413? -1/171413 -3365894 divided by 3365894 -1 Calculate 17889225 divided by 2425. 7377 Divide 39413475 by -5. -7882695 7297 divided by 73281 7297/73281 -108561540 divided by -79242 1370 Calculate -5 divided by -66912815. 1/13382563 Divide -5838168 by 9912.	{ "pile_set_name": "DM Mathematics" }
is the thousands digit of 229582634? 2 What is the millions digit of 523732399? 3 What is the hundreds digit of 2248024472? 4 What is the millions digit of 205283598? 5 What is the ten thousands digit of 1063068719? 6 What is the thousands digit of 164031419? 1 What is the hundreds digit of 90034309? 3 What is the hundred thousands digit of 7562207707? 2 What is the ten thousands digit of 1347116353? 1 What is the hundred thousands digit of 257400761? 4 What is the billions digit of 2427973554? 2 What is the ten millions digit of 211567816? 1 What is the millions digit of 192753217? 2 What is the units digit of 5778143779? 9 What is the tens digit of 35676877? 7 What is the thousands digit of 5869981? 9 What is the hundred thousands digit of 265859840? 8 What is the ten thousands digit of 177475490? 7 What is the units digit of 514327441? 1 What is the ten thousands digit of 39713419? 1 What is the hundred millions digit of 1235274956? 2 What is the units digit of 239954714? 4 What is the units digit of 731187838? 8 What is the units digit of 37081371? 1 What is the thousands digit of 264392539? 2 What is the units digit of 8599547? 7 What is the ten millions digit of 17444748? 1 What is the ten thousands digit of 5502072? 0 What is the millions digit of 299371083? 9 What is the thousands digit of 29186795? 6 What is the millions digit of 73974878? 3 What is the ten thousands digit of 195290610? 9 What is the tens digit of 651191351? 5 What is the ten thousands digit of 301161958? 6 What is the units digit of 30912892? 2 What is the ten millions digit of 55103300? 5 What is the hundred thousands digit of 1998730828? 7 What is the ten thousands digit of 31016177? 1 What is the hundred millions digit of 660134691? 6 What is the billions digit of 1682299850? 1 What is the units digit of 321992967? 7 What is the ten millions digit of 1379793019? 7 What is the units digit of 53890448? 8 What is the billions digit of 1199706873? 1 What is the millions digit of 1871168009? 1 What is the millions digit of 26362884? 6 What is the hundreds digit of 1372025805? 8 What is the hundred thousands digit of 68148597? 1 What is the ten thousands digit of 202487301? 8 What is the thousands digit of 180569918? 9 What is the billions digit of 5306894769? 5 What is the tens digit of 76774496? 9 What is the hundreds digit of 3375269? 2 What is the tens digit of 312847023? 2 What is the hundred millions digit of 345599115? 3 What is the units digit of 189132086? 6 What is the ten millions digit of 1733268503? 3 What is the units digit of 1409806525? 5 What is the ten thousands digit of 29491139? 9 What is the ten thousands digit of 2205075957? 7 What is the millions digit of 97350060? 7 What is the hundreds digit of 1959897462? 4 What is the billions digit of 4711729898? 4 What is the thousands digit of 3926322193? 2 What is the billions digit of 1384755647? 1 What is the hundred thousands digit of 28813353? 8 What is the ten millions digit of 3007060740? 0 What is the billions digit of 2930335485? 2 What is the hundred thousands digit of 1225542498? 5 What is the hundreds digit of 136636560? 5 What is the thousands digit of 350559310? 9 What is the ten thousands digit of 143576812? 7 What is the hundreds digit of 248184637? 6 What is the hundred thousands digit of 177140? 1 What is the units digit of 6681872? 2 What is the hundred thousands digit of 2158932445? 9 What is the ten thousands digit of 115327077? 2 What is the hundreds digit of 5396629505? 5 What is the thousands digit of 944628? 4 What is the tens digit of 340912532? 3 What is the hundreds digit of 3235118443? 4 What is the hundred millions digit of 2809963595? 8 What is the units digit of 695752603? 3 What is the tens digit of 804520798? 9 What is the hundred thousands digit of 1187893230? 8 What is the hundred thousands digit of 1014465410? 4 What is the hundred millions digit of 4456689252? 4 What is the thousands digit of 2271356777? 6 What is the hundred millions digit of 310555811? 3 What is the thousands digit of 62810380? 0 What is the ten thousands digit of 13630740? 3 What is the millions digit of 1157256978? 7 What is the hundreds digit of 114109637? 6 What is the hundred millions digit of 210880747? 2 What is the ten millions digit of 87077384? 8 What is the hundreds digit of 393266295? 2 What is the hundreds digit of 448767831? 8 What is the ten thousands digit of 7831511? 3 What is the hundred millions digit of 542327660? 5 What is the millions digit of 232394940? 2 What is the hundred millions digit of 355057405? 3 What is the tens digit of 2678372561? 6 What is the thousands digit of 1004510520? 0 What is the millions digit of 6480656? 6 What is the ten millions digit of 231676030? 3 What is the hundred millions digit of 152378864? 1 What is the ten millions digit of 182548700? 8 What is the billions digit of 2116308964? 2 What is the ten millions digit of 171874260? 7 What is the ten millions digit of 19739955? 1 What is the units digit of 195056683? 3 What is the millions digit of 98202745? 8 What is the hundreds digit of 98442950? 9 What is the units digit of 125564999? 9 What is the hundred thousands digit of 2245883192? 8 What is the millions digit of 249305430? 9 What is the ten millions digit of 623358941? 2 What is the hundreds digit of 239902203? 2 What is the ten millions digit of 997634561? 9 What is the hundred thousands digit of 691155837? 1 What is the ten millions digit of 2079773976? 7 What is the hundreds digit of 477910982? 9 What is the ten millions digit of 294210548? 9 What is the hundred millions digit of 1189726501? 1 What is the ten millions digit of 602812399? 0 What is the thousands digit of 46809711? 9 What is the millions digit of 46361569? 6 What is the thousands digit of 197720399? 0 What is the units digit of 344500842? 2 What is the thousands digit of 485178428? 8 What is the millions digit of 164504938? 4 What is the millions digit of 143732941? 3 What is the hundred thousands digit of 32935363? 9 What is the ten millions digit of 6805561859? 0 What is the hundred thousands digit of 28162277? 1 What is the ten millions digit of 1472868302? 7 What is the millions digit of 285967820? 5 What is the ten thousands digit of 4103946396? 4 What is the hundreds digit of 39246524? 5 What is the millions digit of 302091467? 2 What is the millions digit of 51923453? 1 What is the hundred millions digit of 202779071? 2 What is the thousands digit of 322590756? 0 What is the ten thousands digit of 474136686? 3 What is the hundred thousands digit of 95734860? 7 What is the millions digit of 218895630? 8 What is the billions digit of 3363031043? 3 What is the ten millions digit of 196774944? 9 What is the ten millions digit of 109318031? 0 What is the ten thousands digit of 3262601196? 0 What is the hundreds digit of 96002800? 8 What is the tens digit of 472473808? 0 What is the thousands digit of 3752980684? 0 What is the ten millions digit of 5916465550? 1 What is the ten millions digit of 10787315? 1 What is the ten thousands digit of 4768348? 6 What is the units digit of 861574363? 3 What is the thousands digit of 11665609? 5 What is the tens digit of 725556212? 1 What is the thousands digit of 1807205338? 5 What is the millions digit of 65876832? 5 What is the hundred millions digit of 1954900228? 9 What is the hundred millions digit of 879945742? 8 What is the ten millions digit of 291535312? 9 What is the millions digit of 165426468? 5 What is the billions digit of 6793659485? 6 What is the ten millions digit of 1013455435? 1 What is the hundred millions digit of 918186621? 9 What is the hundred thousands digit of 749537871? 5 What is the thousands digit of 132611709? 1 What is the thousands digit of 923857859? 7 What is the ten thousands digit of 555006636? 0 What is the millions digit of 132909542? 2 What is the hundreds digit of 48957110? 1 What is the hundreds digit of 1074791730? 7 What is the hundreds digit of 199462623? 6 What is the millions digit of 11285961? 1 What is the thousands digit of 1002377894? 7 What is the hundred millions digit of 344552997? 3 What is the ten thousands digit of 52872359? 7 What is the units digit of 212611182? 2 What is	{ "pile_set_name": "DM Mathematics" }
Expand 5c2 + 36c - 36c + c2 - c + c + (c + c - c)(c - c - 2c) - 3c*2 + 3c*2 + 3c*2 + 2c*2 + 0 + 0. 9c*2 Expand (-t + 5t - 2t)(t - t - t*3) - 1235t*4 - 5t*3 - 160t*4 + 5t*3. -1397t*4 Expand (-3g - 6g + 2g)(6 - 6 - 7g)(-6g*2 - 2g*2 + 4g*2). -196g*4 Expand (-5u + 3u + 3u)(-3u + 3u + u2) + 0u - 2u3 + 0u - 418u3 - 14u*2 + 4u*2 + 10u*2. -419u3 Expand (-l2 - l + l)(-5 - 2 + 4)(2l - 2l - 2l)(-8l + 8 - 8). 48l*4 Expand 7p - 7p + 2p*4 + (11p - 2p + 0p)(-p3 - 2p3 + p3). -16p4 Expand (3 - 1 + 0)(-43 + 43 + 69u) + 0u - 2u - u + 5u - 5u - 3u + (0u + u - 2u)(-2 - 2 + 3) - 1 + 1 + u. 134u Expand -4y + 7y + y + (0 + 0 - y)(-2 + 2 - 2) - y + 27y - y. 31y Expand (-2x + 1 - 1)(-6 - 7 - 1) + 131 - 131 + 9x. 37x Expand -g + 0g + 7g + 7 + 2g + g - 4g + (-g - 1 + 1)(0 + 4 - 2) + 2 - g - 2. 2g + 7 Expand (3 - 6 - 10 + q)(0q4 + 0q*4 - 2q*4) + (-q + 4q - 2q)(q - q*4 - q). -3q*5 + 26q*4 Expand 8c - 5c + 4c - 3c + 0c + 0c + 0c + 2c - c + (-2c - 4c + c)(-2 + 1 - 2). 20c Expand ((-1 + 1 - 2)(5j + 0j - 7j) + (1 - 5 + 3)(-4 + 4 + j))(5j*2 + 1 + 3j*2 + 4j - 7j2). 3j*3 + 12j*2 + 3j Expand (-t + t + 2t)(-3 + 4 + 2)(-66t*2 + 29t*2 - 3t*2). -240t*3 Expand (-113 - 40 + 316)(-6q - 4q + 7q). -489q Expand (3 + 0 - 5 + (13 - 2 + 2)(0 + 1 - 3))(-t + 4t - 2t). -28t Expand (2t*3 - 3t*3 + 4t*3)(13t - 29t + 23t) - 2t*4 + 0t + 0t + (t + 2t*3 - t)(2t - t - 2t). 17t4 Expand ((0 - 1 + 2)(-2 - 2 - 3) + 6 - 1 - 3 + 6 + 1 - 1)(0k2 - k2 + 0k2). -k2 Expand 3w*2 + 0w*2 - 2w*2 + (-5 + 9 + 3)(2w2 + 0w*2 - 4w*2). -13w*2 Expand (-10 - 10 - 16)(2x4 + 2x*4 - 2x4) + x + x4 - x. -71x4 Expand (4f - 5f - f)(-5f4 + 98f*4 + 14f*4). -214f*5 Expand (0 + 2 - 3)(-5k2 + k2 + 2k*2) - 71k*2 - 52k*2 + 4k*2. -117k*2 Expand (q - 5q - 3q)(-7q2 + 2q*2 - 9q*2). 98q*3 Expand (5i + 24i + 2i)(2 - 4 + 0). -62i Expand (-466 + 152 - 170 + 57)(f + 3f - f). -1281f Expand (-q2 - q2 + 3q*2)(-37q - 276q + 7q - 624q). -930q3 Expand (11 - 18 - 10)(0 + 0 + 7f2). -119f*2 Expand (-13g + 10g + 0g)(2g - g + g)(2 - 3 + 3). -12g*2 Expand (5s - 5s2 - 5s)(5 - 3 + 3) + 13 - 6 - 2s*2 - 11. -27s*2 - 4 Expand (-93 + 28 - 116)(0j + j + 0j). -181j Expand (4h*2 - 6h*2 + 0h2 + h - h2 + 2 - 2 + (-h + 4h - 5h)(2 - 2 + 2h) + h*2 - 1 + 1)(-2h2 + 0h2 - h2). 18h4 - 3h*3 Expand (-63 + 44 + 207)(2z - 3 - 3z + 2z). 188z - 564 Expand (-171o + 205o*3 + 171o)(1 + 1 - 1) + (-3 + 2o*3 + 3)(0 - 3 + 5). 209o3 Expand (2a + 2a - 5a)(-2a*4 + 6a*3 - 6a*3) + 27a*4 - 11a*5 - 27a*4 + 0a*5 - 3a*5 + 5a*5. -7a5 Expand n4 + n*4 + 0n*4 + (4 + 4 - 6)(-147n2 + 147n*2 - 12n*4) + 13n4 + n4 - 2n4. -10n*4 Expand -40 + 40 + 5b*2 + (2b - 2b + b)(-20 - 9b + 20). -4b*2 Expand -2p3 + p2 - p*2 + (-1 - 1 + 3)(36p3 - 18p*3 - 2p*3) + 6p*3 - 2p*3 - 3p*3. 15p*3 Expand (8 + 6 + 7)(0z + 0z + 2z + (-3 + 2 + 0)(-1 - 3z + 1)). 105z Expand (-3f3 + 0f3 + f3 + 2f)(-4f2 + 2f*2 + 13 + 6f*2). -8f*5 - 18f*3 + 26f Expand (3 - 2o - 3)(2o + 0 + 0) - 4o*2 + 2o2 + o2 + 389o2 - 2088o*2 - 1136o*2. -2840o*2 Expand -4i*3 + 4i3 + i5 + (4 - i - 4)(0i*4 + 0i4 + i4) - 11i3 + 7i*5 + 11i*3 + (3i - 3i - 2i*4)(3 - 4i - 3). 15i*5 Expand (7 - 17 - 10)(18q - 18q - 26q). 520q Expand (-530 + 530 - 54c)(-2 + 3 - 2 + (-5 + 2 + 2)(3 - 3 + 2))(-3 + 5 + 0)(2c - 2c - c). -324c*2 Expand (-139 - 282 + 91 + 5)(-3o4 + o - o). 975o*4 Expand (-5s*3 + 4s*3 - 3913s*2 - 2 + 4128s*2)(-s + 2s - 2s). s*4 - 215s*3 + 2s Expand (109 + 93 - 57)(0 + 2s*2 + 0) + 0s2 - s2 + 3s2. 292s*2 Expand 4r2 - r2 - 4r2 + 6r*2 - 8 + 8 + (3r - 4r + 2r)(r - r + 2r) - 1 + 1 + 2r2 + 8r*2 - 7r*2 + 20r*2. 30r*2 Expand (0 + 0 - 39k)(-3 + 2 - 7)(-k3 - k3 + 4k3). 624k4 Expand -2 - b4 + 2 + (0b - b + 2b)(-3b3 - b3 + 3b3) + (-3b + 1 - 1)(b3 + 2b*3 - 5b*3) - 4b4 + b4 - 2b4. -b4 Expand -6a*5 + 0a5 - a5 + (-1 - 1 + 1)(0a*2 + 0a2 - a5) + a5 - a5 + a*5 + (2a*4 - 2a4 + a4)(-1 - 5a + 1). -10a5 Expand (2 + 3 + 2)(-3 - 3x2 + 1 + 1). -21x*2 - 7 Expand (28g + 10g2 - 28g)(-2g + 2 - 2)(-4 + 5 + 2). -60g*3 Expand 4u*2 - 4u*2 - 2u*5 + (u - 2u*2 - u)(32u3 + 81u*3 - 37u*3). -154u*5 Expand (-6s - s*5 - 508s*3 + 508s*3 - 2s*5)(-3 + 17 + 2). -48s5 - 96s Expand ((-3s + 0s + 5s)(-4 + 4 + 3s) - 19s*2 + 70s - 70s)(-5s2 + 2s2 + s2). 26s4 Expand (c - 3c + 0c)(-19c - 9c*2 + 19c)((c + 2c - c)(-2c - c + 4c) + c + c2 - c + 2c*2 - c + c - 17c + 17c + 2c*2). 126c5 Expand (-d3 - 2d + 2d)(4d + 6d - 3d)(0 - 2d + 0). 14d5 Expand -40v*3 - 20v*3 + 2v*3 + (-1 + 1 - 2v)(-4v2 + v2 + 2v2) - 3v2 - v3 + 3v2. -57v*3 Expand (-2 - c + 2)(-12 - 2 - 7 - 4 + 4 - 1 + (1 - 2 + 2)(-3 + 6 - 2)). 21c Expand -y*4 - 5y5 + y4 + 12y4 - 12y*4 + 5y5 + (y3 + 0y3 - 3y*3)(6y2 + 9y - 9y). -12y*5 Expand (-40u*2 - 111u*2 + 37u*2 - 18u*2)(-3 + 3 + u*2). -132u*4 Expand (-3 + s + 3)(1 - 2 - 1) - s + s - s + (4s + 0s - 6s)(-15 + 16 - 18). 31s Expand (-6f*4 + 10f*4 + 7f*4)((3 - 2 - 2)(1 - 3 + 1) + 0 - 1 - 5). -55f4 Expand -m4 + 18m2 + 6m*3 - 18m*2 + 2m*4 + 0m + 0m + (0m + 0m - 2m)(4 - 4 - 2m*3) + 2m4 + m3 - m*3 - 3m*4 + 3m4 - m4. 6m4 + 6m*3 Expand 4t*3 + 25t - 32t + 19t - 2t4 + (-t3 + 3t*3 - 4t*3)(-6t + 2t + 2t). 2t*4 + 4t*3 + 12t Expand 3 - 3 + y4 - y4 + 4 - 4 + (3y + 3y - 4y)(-3y3 - y3 + 2y*3) + (86y*3 - 86y*3 + 50y*4)(4 - 2 + 0). 96y4 Expand -5n*5 - 32065 + 2n*2 + 32065 + (3n - 2n2 - 3n)(5n*3 + 3n*3 - 3n*3) + 2n2 + n5 - 2n2 + 3n*2 - 2n*5 - 3n*2. -16n*5 + 2n*2 Expand (2 + 0 + 6)(4t - 3t + 0 + 2) + (5 - 5 - 2)(-15 + 15 + t). 6t + 16 Expand 3d4 + 0d*2 + 0d*2 + (-2d + 0 + 0)(6d*3 - 8d*3 - 8d*3). 23d*4 Expand (-2f2 + f2 + 0f2)(-6 + 1 - 1)(-1 + 7 - 3)(4 + 3 - 5). 36f2 Expand (-b + 3 - 3)(-16b + 67676 - 3b - 67670). 19b2 - 6b Expand 10k + 10k - 2k + (2 + 0 - 1)(-4k + 11k + 0k). 25k Expand (2 - 3a - 2)(a + 51a2 + 2 - 34a*2 - 37a*2)(-4a - a + 6a). 60a4 - 3a*3 - 6a2 Expand (l3 + 3 - 3)(-1 + 3 + 5) + 0l3 + l2 + 4l2 - 2l3 + l3 - 2l3 + 2l*3. 6l*3 + 5l2 Expand b2 - b*2 + 2b*2 + (-27 + 27 - 22b)(-2b - b + 4b) + (b - b - 2b*2)(0 - 2 + 4) - 32b + 11b*2 + 32b. -13b2 Expand -5k + 2k + 0k + (1 + 1 + 0)(-2 + 2 - k + (6k - 3k - 2k)(5 - 2 - 4) - 37k - 14k + 31k). -47k Expand (2o*2 + 1 - 1)(6o2 - 8o + 8o) + 2 + 0 + 55o*4 - 23o*4. 44o*4 + 2 Expand (0v + 18v - 3v)(3 - 2 + 0)(v + 0v - 3v)(-6v + 8 - 8 + (-2 + 1 - 1)(2v + v - 4v) + 1 + 2v - 1). 60v3 Expand (-3v*3 + 5v*3 - 4v*3)(-5v - 17v - 2v)(-v + 2v + 0v). 48v5 Expand (13 - 13 + 18t)(1 - 3 + 0 + (0 - 4 + 2)(-4 + 4 - 2)). 36t Expand (s - 4s + 4s)(13s3 + 3273s + 7s3 - 3273s). 20s4 Expand (-8i + 4 - 4)(i2 - 1 + 1)(2i - 2i*2 - 2i). 16i5 Expand 297b - 289b - 1 + 4 + (-3 + 2 + 3)(0b + 4b - 5b). 6b + 3 Expand (5v3 - v3 + v3)(2v2 - 1 + 0v + 3 - 14v). 10v*5 - 70v*4 + 10v*3 Expand 1342 - 7x*2 - 1344 + 6x*2 + (2x - 2x + 2x)(-x - 1 + 1). -3x*2 - 2 Expand (-26t*2 - 21t*2 + 198t*2)(-4 + 4 + t). 151t3 Expand (2o - 3o + 2o)(-2 + 0 + 0) + (-2o + 3 - 3o + 6o)(-22 + 10 - 24). -38o - 108 Expand (-3 + 0 + 4)(3 - 5 + 0)(-337 + 337 + 46q). -92q Expand (-4 + 4 - 2)(5 - f - 5 - 4f + f + 4f + (-2f - 2 + 2)(-2 + 6 - 3) - 2f - 9f - 3f). 32f Expand (-2a*3 - 3a*3 + 2a*3)((-6 - 2 + 1)(1 - 1 + 2a) - 2a + 0 + 0 + (1 - 4 + 4)(-4a + 5a + a) + 2 - a - 2 - a + 1 + 1 + 3a). 39a**4 - 6	{ "pile_set_name": "DM Mathematics" }
5 + 17hz - 14h*2 wrt h? -8h Let p = -5 - -7. Let u = p - 0. Find the third derivative of -4hu + 0h*2 + 6h*2 + 0h3 - h3 wrt h. -6 Suppose -4n + 18 - 62 = 0. Let x = n - -11. What is the first derivative of -u + xu - 2 - 2u wrt u? -3 Differentiate -30 + 14 + 26a + 14 with respect to a. 26 Let w(k) = 4k3 + k - 4. Suppose 0 = -4u - u - 35. Let x(b) = 8b3 + 3b - 7. Let v(n) = uw(n) + 4x(n). What is the second derivative of v(m) wrt m? 24m Let r be (-2)/4-18. Suppose -2k - r = -4k. Differentiate -1 + ik + 5 - 3 wrt i. 2i Let h(g) be the third derivative of -g8/336 - g5/2 + 11g4/6 - g2 + 8g. Find the second derivative of h(r) wrt r. -20r3 - 60 Suppose 2c - 4r = 4c - 8, -5c + 20 = 5r. Find the second derivative of -3 - c - 2t + 7 + t2 wrt t. 2 Let q(t) be the second derivative of 2/3t*3 + 1/2t*2 - t + 0. Differentiate q(i) wrt i. 4 Suppose -8o = -4o - 16. Differentiate -ov*2 + 2 + 1 + 2v*2 with respect to v. -4v What is the derivative of 1 - 3c4 + 15c*4 + 3 - 7 wrt c? 48c*3 Let k(u) = -5u*4 + 2u*3 - 6u*2 + 9. Let m(v) = -5v*4 + 3v*3 - 5v*2 + 9. Let x(q) = 4k(q) - 5m(q). Find the third derivative of x(d) wrt d. 120d - 42 Let r(j) be the second derivative of 1/2j3 + 0j*5 + 0j*2 + 0j*6 + 0 + 1/42j*7 + 0j*4 - 2j. What is the second derivative of r(t) wrt t? 20t3 Let z(f) = 4f - 41. Let g be z(11). Suppose 2i = -l + 3, 2i + 2l - 5l - 7 = 0. Find the second derivative of -4p3 - ip*3 + 2p + 7pg wrt p. 6p Find the third derivative of -9t3 + 9t*3 + 5t*2 + 12t*4 wrt t. 288t Let n(d) be the third derivative of 0 + 5d2 + 3/8d*4 + 0d*3 + 0d - 3/20d5. What is the second derivative of n(k) wrt k? -18 Let w be ((-12)/9 + 1 - 1)3. Let d(f) = 2f2 - 6. Let b(g) = -4g*2 + 3g*2 + 3g*2 - 7. Let p(a) = wd(a) + 3b(a). Differentiate p(o) with respect to o. -4o Suppose -6j = -j + 5. Let u(n) = -n3 - n2 + 1. Let o(z) = -z3 - 5z*2 + 6. Let k(l) = jo(l) + 5u(l). Differentiate k(b) with respect to b. -12b2 Let v(z) be the third derivative of -z7/70 - 7z5/60 + 4z*2. Find the third derivative of v(m) wrt m. -72m Let s(h) = -71h - 71. Let n(i) = 107i + 107. Let o(f) = -5n(f) - 8s(f). What is the derivative of o(k) wrt k? 33 Let m(o) = 24o2 + 2o + 1. Let a(g) = -119g2 - 11g - 6. Let j(p) = 2a(p) + 11m(p). Differentiate j(v) wrt v. 52v Let g(x) = -12x*5 - 2x*4 - 9x. Let r(o) = 35o5 + 7o*4 + 28o. Let t(z) = -7g(z) - 2r(z). What is the second derivative of t(c) wrt c? 280c3 What is the third derivative of -22r*3 - 11r*4 + 22r*3 + 5r*2 wrt r? -264r Let a(r) be the second derivative of -r*3/2 - 11r*2/2 - r. What is the first derivative of a(g) wrt g? -3 Let y(i) be the third derivative of 0i*3 + 1/8i*4 + 0i*5 + 0i*6 + 0i + 1/70i7 + 0 + 7i*2. Find the second derivative of y(p) wrt p. 36p2 Suppose -5 = -x + 3. Let c = x - 4. Find the second derivative of k4 + 0kc - k - k wrt k. 12k*2 Find the third derivative of 3h*4 - 4h*4 - 2h*4 - 2h2 - h4 wrt h. -96h Let q(c) be the third derivative of -c10/75600 - c6/360 + c5/15 + 4c*2. Let i(y) be the third derivative of q(y). Differentiate i(o) with respect to o. -8o*3 Let x be (7/3 - 1)6. Let r = -5 + x. Find the second derivative of -4i + ri + i*4 - 2i*4 wrt i. -12i*2 Let d(c) = -8c*3 + 5c. Let z(g) = g*3 - g. Suppose -2o = 29 + 41. Let v(m) = oz(m) - 5d(m). What is the second derivative of v(s) wrt s? 30s What is the second derivative of 10c*4 - 10 - 32c + 16 - 6 wrt c? 120c2 Let m(o) be the third derivative of o7/105 - 7o*5/30 - 16o*3/3 - 18o*2 - 2. Differentiate m(y) with respect to y. 8y*3 - 28y Let d(k) = 4k + 3. Let m be d(3). Let x = m - 10. What is the second derivative of -2v + 2vx + 4v + 0v5 wrt v? 40v*3 Let t(d) be the first derivative of -34d*3/3 + 16d - 3. What is the derivative of t(y) wrt y? -68y Let m(z) = -22z*3 - 4z*2 - 11z. Let l(h) = -22h3 - 5h*2 - 10h. Let d(x) = -4l(x) + 5m(x). Find the second derivative of d(y) wrt y. -132y Let i(c) be the first derivative of -c5/10 - c2/2 + c - 3. Let r(a) be the first derivative of i(a). What is the derivative of r(d) wrt d? -6d2 Let q(p) be the first derivative of p4 - 2p3 + 3 + 4p3 - p3 + 1. Find the third derivative of q(i) wrt i. 24 Let g(j) be the third derivative of -j*3/6 + 2j*2. Let s(h) = -3h*3 - 7. Suppose -4k = 17 + 7. Let p(r) = kg(r) + s(r). Differentiate p(t) wrt t. -9t*2 Let m(d) be the first derivative of 4d*3/3 - 2d - 2. Differentiate m(w) wrt w. 8w Let n(v) = -v3 - 3v*2 - v. Let b be n(-3). Let g be 6/(-8)(0 - 4). Find the third derivative of -2t2 + 3t2 + tb - t5 - tg wrt t. -60t2 Let q(r) be the second derivative of 13r*4/6 - 5r*3/6 + 15r. What is the second derivative of q(h) wrt h? 52 Let o(s) = -2s - 4. Let t be o(-3). Let r(p) be the first derivative of -2 - 1/2p*4 + 2/3p*3 + 0p*t + 0p. What is the third derivative of r(i) wrt i? -12 Let g(u) be the first derivative of u6/30 - u3/6 - 5u2/2 - 1. Let p(s) be the second derivative of g(s). Differentiate p(m) with respect to m. 12m*2 Let b(u) = -5u3 - u2 - 3u. Let d(l) = -l2 - l. Let h(j) = b(j) - 3d(j). What is the third derivative of h(g) wrt g? -30 Let d(z) = z*2 + 2. Let b be d(0). Differentiate 5 + 9n2 + nb - 3n2 wrt n. 14n Find the third derivative of -19n2 + n5 - 15n*2 + 7n*2 - 41n*5 wrt n. -2400n*2 Suppose 2 = -2i, 3c - 11 = -2c + i. Let z be 76/18 - (-2)/(-9). Differentiate -3n3 + 4n*2 - zn*c + 2 wrt n. -9n*2 Let u(y) = 24y*2 + 3y - 9. Let c(k) = 12k2 + 2k - 5. Let p(f) = 9c(f) - 5u(f). Find the second derivative of p(o) wrt o. -24 Let b(u) = -u*2 + 8u - 10. Let k be b(4). Let h be 2 + (1 - (1 - 0)). Find the second derivative of 6 + hw - k - w4 wrt w. -12w*2 Let g(h) be the second derivative of 0 - 6h + 2h2 - 2/3h*3. Differentiate g(s) with respect to s. -4 Let y be (6/5)/((-3)/15). Let z be (y/2)/(3/(-2)). Find the third derivative of 2oz - o4 + 0o4 - 6o + 6o wrt o. -24o Let a(o) = -4o3 - 3o*2 + 2o - 2. Let r(d) = -3d3 - 3d*2 + 3d - 3. Let p(l) = 3a(l) - 2r(l). Find the third derivative of p(u) wrt u. -36 What is the second derivative of 11n + 14n + 4n + 5n2 wrt n? 10 Let a(m) = m3 + 3m2 - 2m - 3. Let n be a(-3). What is the derivative of -3d - d + 0d + nd - 1 wrt d? -1 Let n(f) = -42f*4 + 3f*2 + 2f - 11. Let d(o) = -43o4 + 4o*2 + 3o - 10. Let x(y) = -3d(y) + 4n(y). Differentiate x(v) with respect to v. -156v3 - 1 Let z(g) be the third derivative of 5g*7/42 - 8g*3/3 + 34g*2. What is the derivative of z(t) wrt t? 100t*3 Let s = -1 - -1. Let q(w) be the third derivative of 0w*3 + 1/30w*5 + 1/120w*6 + 0 - 2w*2 + sw*4 + 0w. Find the third derivative of q(a) wrt a. 6 Suppose 5q + 5 + 15 = 4f, 2q + 12 = 2f. Let y = f - 6. What is the second derivative of -28 + 28 - yz - 4z*2 wrt z? -8 Let g(r) = 14r*3 - 6r*2 - 39r. Let l(d) = -13d3 + 5d*2 + 38d. Let a(z) = -5g(z) - 6l(z). What is the second derivative of a(t) wrt t? 48t Let l(n) be the first derivative of 24n*7/7 - 17n*3/3 + 34. Find the third derivative of l(w) wrt w. 2880w*3 Let q be (2 + -20)1/(-2). What is the third derivative of 2b5 + 2b*5 - 10b*2 + qb*2 wrt b? 240b2 Let s(w) be the first derivative of -w9/378 - w*5/24 + 7w*3/3 + 5. Let d(b) be the third derivative of s(b). Find the second derivative of d(h) wrt h. -160h*3 Let l(u) be the third derivative of -55u*4/24 - 19u3/3 + u2 + 11u. What is the derivative of l(h) wrt h? -55 Let r(u) = -17u*4 + 2u*2 + 2u - 13. Let g(j) = -50j4 + 7j*2 + 7j - 40. Let y(t) = 2g(t) - 7r(t). What is the first derivative of y(p) wrt p? 76p3 Let t(i) be the second derivative of 4i*6/15 - 10i*2 - 3i. What is the first derivative of t(b) wrt b? 32b3 Let c(p) be the third derivative of 2p*5/15 - 5p*4/24 + 2p*3/3 + 47p2. What is the second derivative of c(u) wrt u? 16 Find the second derivative of z + z3 +	{ "pile_set_name": "DM Mathematics" }
- 487b = 60 for b. -10 Solve -24x - 672 = 76x + 728 for x. -14 Solve -71z - 5z + 401 = -1727 for z. 28 Solve -270 - 273 + 120 = 47c for c. -9 Solve -1855p = 1858p - 3709p - 64 for p. 16 Solve 0 = 34m + 88 + 490 for m. -17 Solve -117330j = -117384j + 756 for j. 14 Solve 0 = -746l + 602l + 3456 for l. 24 Solve 46w + 3w = -109w - 632 for w. -4 Solve -77f + 1500 = 116f + 107f for f. 5 Solve 1122v + 16142 = 11125 - 17423 for v. -20 Solve 63l - 214l = 436 + 319 for l. -5 Solve 40v - 27 = -11 + 24 for v. 1 Solve -15o = 19 - 49 for o. 2 Solve -19003m + 72 = -18995m for m. 9 Solve -502f - 209f = 14220 for f. -20 Solve -29g - 8g - 1248 = -193g for g. 8 Solve 181a + 320 = 201a for a. 16 Solve -660 = -42s + 159 + 273 for s. 26 Solve -1091 = 207b + 151 for b. -6 Solve -86p - 2697 = 61p - 54p for p. -29 Solve 2067 = 823h + 1987 - 4035 for h. 5 Solve -41p - 177 - 261 = 177 for p. -15 Solve -40l = -366 - 274 for l. 16 Solve 16f = 7f - 79f + 176 for f. 2 Solve -7n + 112 - 2 = 15n for n. 5 Solve 800o - 99 = 789o for o. 9 Solve 311s + 3089 = 290 for s. -9 Solve -2 + 9 - 16 = -3k for k. 3 Solve -22v + 39v = -3v + 100 for v. 5 Solve 4628l - 4467l - 966 = 0 for l. 6 Solve 0 = -23d + 95072 - 95141 for d. -3 Solve -1923 = -101n + 602 for n. 25 Solve -97x - 1354 - 773 = 7 for x. -22 Solve 781z = -3547 - 14416 for z. -23 Solve -62 + 148 = 60q - 994 for q. 18 Solve 26a - 55a = 47a - 760 for a. 10 Solve 32q + 270 = 5q for q. -10 Solve -50 = -z - 40z - 1075 for z. -25 Solve -3899 = -155x - 334 for x. 23 Solve -350 = 145p + 51 + 34 for p. -3 Solve 34b = 82 - 50 + 750 for b. 23 Solve 0 = -105a - 10a - 986 + 181 for a. -7 Solve -1043w + 4191 = -662w for w. 11 Solve -71v = -13v - 15v + 258 for v. -6 Solve 0 = -1533p + 1638p + 1050 for p. -10 Solve 18b + 47b = -20b + 850 for b. 10 Solve 280r - 889 + 532 - 1883 = 0 for r. 8 Solve 23j - 40 = 17j - 4j for j. 4 Solve 50r = 11r - 156 for r. -4 Solve -6713i + 7272i + 1118 = 0 for i. -2 Solve -45w + 8 = -48w + 17 for w. 3 Solve -4r = -5428 + 5316 for r. 28 Solve 5981l - 58 = 6010l for l. -2 Solve -3901q = -3929q - 476 for q. -17 Solve -132r - 12r - 288 = 0 for r. -2 Solve 0 = 136i - 1076 - 100 + 224 for i. 7 Solve 2361f = 26631 + 22950 for f. 21 Solve -264366 + 265675 = -77h for h. -17 Solve 164q = -197q - 8664 for q. -24 Solve -34252 = 29r - 34513 for r. 9 Solve 588 = -88t + 2701 + 1055 for t. 36 Solve 675 = 5782m - 5707m for m. 9 Solve 0 = 254d - 189d + 1495 for d. -23 Solve 653v - 799 - 9462 = 10635 for v. 32 Solve 54z = -102 + 372 for z. 5 Solve -63p + 344 = -56p + 190 for p. 22 Solve -20y - 14 = 51 + 35 for y. -5 Solve -37c + 81385 - 81829 = 0 for c. -12 Solve 130282o = 130255o + 378 for o. 14 Solve 0 = 16y - 446 + 638 for y. -12 Solve -40727f + 40669f = -1508 for f. 26 Solve 541 + 259 = 80m for m. 10 Solve -806g + 374g - 6912 = 0 for g. -16 Solve -70i + 148 = -144i for i. -2 Solve 28 = 20i - 182 + 50 for i. 8 Solve 29104a + 741 = 29065a for a. -19 Solve 484 = -69u + 25u for u. -11 Solve -1078o + 6720 + 10528 = 0 for o. 16 Solve -266 = -104q - 1306 for q. -10 Solve -417 = 81l - 310l + 41 for l. 2 Solve 0 = 57u + 313 - 1567 for u. 22 Solve -121h - 998 + 30 = 0 for h. -8 Solve -30q = -33q + 26q + 207 for q. -9 Solve -149 - 110 = -49l + 84 for l. 7 Solve 0 = 118h - 294h - 1760 for h. -10 Solve 9183 - 8607 = 48h for h. 12 Solve -118 = -107b - 11 for b. 1 Solve 657o + 6291 = -42o for o. -9 Solve 925p = 1054p + 2322 for p. -18 Solve 37j + 1254 - 218 = 0 for j. -28 Solve -78 - 345 + 24 = -57a for a. 7 Solve 65r - 324 = -779 for r. -7 Solve 101t + 41t + 1242 = 4t for t. -9 Solve -1314 = 171w - 287w + 189w for w. -18 Solve -69u + 950 = -u - 43u for u. 38 Solve 81 = -359s + 368s for s. 9 Solve 26v + 784 = -58v - 28v for v. -7 Solve 74j - 43j = 434 for j. 14 Solve -1 + 1 = 345u for u. 0 Solve -359 - 1071 = 110w for w. -13 Solve -156g - 1948 - 943 = -83 for g. -18 Solve 532w = -2606 - 2182 for w. -9 Solve 0 = -75453b + 75441b + 48 for b. 4 Solve -34q + 648 = 546 for q. 3 Solve 47t = 18t - 30t + 826 for t. 14 Solve 17j + 29 = -38 - 171 for j. -14 Solve -49p - 59587 + 60077 = 0 for p. 10 Solve -7k + 1844 = 1893 for k. -7 Solve 1111 = -45w + 146w for w. 11 Solve 516 = -225p - 6009 for p. -29 Solve -1843 = -110b - 193 for b. 15 Solve 16n + 158n + 2896 = -2324 for n. -30 Solve -10x + 405x + 350x - 8940 = 0 for x. 12 Solve 0 = -81j - 1335 + 1740 for j. 5 Solve -u = 10u + 15u + 494 for u. -19 Solve 0 = -116j - 217j + 69j - 6072 for j. -23 Solve -28x + 368 + 80 = 0 for x. 16 Solve 6c - 8483 = -8531 for c. -8 Solve 450 = -48y - 2y for y. -9 Solve -485 - 72 - 450 = -53k for k. 19 Solve -390p = -323p + 555p + 11196 for p. -18 Solve 19124f = 19180f - 280 for f. 5 Solve 19b - 75 = 11b - 17b for b. 3 Solve -372m + 157m + 155m + 360 = 0 for m. 6 Solve 79h = -127h + 1442 for h. 7 Solve 1473 - 1697 = -112a for a. 2 Solve 925x = 906x - 114 for x. -6 Solve -341t + 8372 = -42t for t. 28 Solve 0 = 23068n - 23066n + 6 for n. -3 Solve 68v + 2013 - 2557 = 0 for v. 8 Solve g + 1044 = 5g + 1032 for g. 3 Solve 158 = 13516c - 13595c for c. -2 Solve -100r + 8458 = 7458 for r. 10 Solve -35n + 7n = -n + 378 for n. -14 Solve -37a = 127a - 1312 for a. 8 Solve -2981 = 143b - 836 for b. -15 Solve -20t - 2t - 5t = 351 for t. -13 Solve -183m + 705 = -759 for m. 8 Solve -43b + 66 - 26 = -132 for b. 4 Solve -60o = -736 + 556 for o. 3 Solve 328s + 303s = 156 - 787 for s. -1 Solve -11268 = -760l - 492l for l. 9 Solve -9j = 15j - 33j - 27 for j. -3 Solve -17p = -4729 + 4542 for p. 11 Solve 69y + 285 = 699 for y. 6 Solve -20t + 16240 - 16340 = 0 for t. -5 Solve 32 = 322v - 744 - 834 for v. 5 Solve 59n + 63 = 112 - 108 for n. -1 Solve 1489 = -10m + 1519 for m. 3 Solve 2257t - 2826 = 2414t for t. -18 Solve 0 = 18472d - 18454d - 18 for d. 1 Solve 116s - 76s - 176 = 144 for s. 8 Solve 6708 = 518y + 1139 - 12043 for y. 34 Solve 156 - 144 = -3i for i. -4 Solve 27199 = -3c + 27202 for c. 1 Solve -2x - 28 = -2x + 7x for x. -4 Solve -72y = 51 - 411 for y. 5 Solve -1702 + 422 = 160n - 32n for n. -10 Solve 0 = 161n + 285 - 607 for n. 2 Solve 0 = -60r - 4r for r. 0 Solve 122p - 3179 = -12p - 53p for p. 17 Solve 485 = 271r + 4821 for r. -16 Solve 2136 = -228w - 1968 for w. -18 Solve -235n = 173n - 11n - 9528 for n. 24 Solve -48i - 43 = -9i - 43 for i. 0 Solve -435j + 2755 = 951 - 3416 for j. 12 Solve 1357m - 1237m - 2280 = 0 for m. 19 Solve 0 = 589n - 565n - 72 for n. 3 Solve -371d - 42d - 32550 = 517d for d. -35 Solve -438k - 1039 - 1427 = -714 for k. -4 Solve 31m - 3031 + 2907 = 0 for m. 4 Solve -234g + 222g = -24 for g. 2 Solve 521 = -4j + 581 for j. 15 Solve 9444 = -435n - 2705 + 839 for n. -26 Solve 16x = 107 - 20 + 25 for x. 7 Solve 0 = 32q + 2990 - 3886 for q. 28 Solve 318h = 403h + 1105 for h. -13 Solve -12b = 15 + 134 - 5 for b. -12 Solve -231b = -596b - 4261 - 484 for b. -13 Solve -126o = -189o - 819 for o. -13 Solve 241l + 1547 = 122l for l. -13 Solve -104 = i - 109i + 220 for i. 3 Solve -19j - 73j = 84j - 2288 for j. 13 Solve 30g - 45g - 55g = 1190 for g. -17 Solve 264 - 204 = -26i - 200 for i. -10 Solve 1282 = 230l - 328 for l. 7 Solve 97c + 560 = 178c - 116c for c. -16 Solve -41k - 40k = 10k + 455 for k. -5 Solve 1432 - 360 = 67s for s. 16 Solve 66p - 1434 = -147p - 369 for p. 5 Solve 3m - 20m = 13m - 180 for m. 6 Solve 0 = 323g - 299g - 672 + 48 for g. 26 Solve -1659 + 3549 - 534 = 113h for h. 12 Solve -31b + 463 - 85 + 211 = 0 for b. 19 Solve 146z + 507 = 69 for z. -3 Solve 16d - 77 + 126 + 79 = 0 for d. -8 Solve 23t - 65t + 168 = 0 for t. 4 Solve 203c + 75c = -31c - 309 for c. -1 Solve -52s + 108s - 55s = -2 for s. -2 Solve 139p - 923 = 2135 for p. 22 Solve -92 = -24x + 244 for x. 14 Solve 291c - 1480 = 328c for c. -40 Solve 0 = 193q - 120q - 140q + 201 for q. 3 Solve -524 = -22q + 605 - 1261 for q. -6 Solve -40c + 12 = -183 - 5 for c. 5 Solve 108 = 70j - 32 for j. 2 Solve 303o + 2704 = 199o for o. -26 Solve 4077 - 10973 = 399v +	{ "pile_set_name": "DM Mathematics" }
derivative of v*2 - 5v*4 - 4v*2 + 4v*o wrt v. -120v Suppose -5v = -31 + 6. What is the third derivative of -9t*2 + 4t2 + tv - 2t3 + 2t*3 wrt t? 60t*2 Let a(v) be the first derivative of 4v*3/3 - 4v + 6. Find the first derivative of a(z) wrt z. 8z Let y(t) be the second derivative of -11t*5/20 + 19t*4/12 + 3t. Find the third derivative of y(s) wrt s. -66 Let s = 4 - 0. Find the second derivative of -8j + 3j*4 + 0j*s + 7j wrt j. 36j2 Let v be (4/3)/(4/6). What is the second derivative of -2i + vi + i + i2 + i wrt i? 2 Let z(y) = y3 + 9y*2 + 8y + 2. Let b be z(-8). Let h = 2 + b. Find the second derivative of -d4 - d4 + 2dh - 2d - 3d4 wrt d. -36d2 Let w(s) be the second derivative of s8/560 - s6/90 + s3/2 + 2s. Let i(f) be the second derivative of w(f). Find the third derivative of i(b) wrt b. 72b Let k be 6((3 - 7)/8 + 1). Let v(p) be the first derivative of -3p + 0p3 + k + 0p*2 + 3/4p*4. Differentiate v(o) with respect to o. 9o*2 Let q(s) = 4s. Let l(h) = -h + 1. Let a(i) = 9 + 4i + 2i - 5i. Let n be a(-7). Let f(j) = nl(j) + q(j). Find the first derivative of f(r) wrt r. 2 What is the derivative of 2s2 + 10s*4 + 7 + 2s*2 - 4s*2 wrt s? 40s*3 Suppose b - f - 17 = 4f, 9 = -3f. Suppose -t + b = -0t. Differentiate -2zt + 6 - 7 - z2 with respect to z. -6z Find the third derivative of -19s2 + 0s*3 - 5s*3 + 16s*2 wrt s. -30 Let f(o) be the first derivative of -55o7/7 + o3 + o*2 - 3. Find the third derivative of f(h) wrt h. -6600h*3 Let o(n) be the first derivative of -4n*2 + 2n - 8. What is the first derivative of o(x) wrt x? -8 What is the third derivative of -49d2 - 7d*3 + 2d*4 + 7d*3 - 14d*4 wrt d? -288d Find the third derivative of -4s2 + s4 - 5s*4 + 2s*4 wrt s. -48s What is the second derivative of 2l2 + 4l - 8l + 2l*2 - 12l wrt l? 8 Let f(k) be the third derivative of 0k4 + 0k*6 + 0k*3 + 1/336k*8 + 1/30k5 + k2 + 0 + 0k + 0k*7. Find the third derivative of f(s) wrt s. 60s*2 Let h(s) be the first derivative of 28s*2 - 25s + 8. Differentiate h(u) with respect to u. 56 Let o = 586 + -11717/20. Let w(b) be the second derivative of 0b4 + 1/2b*3 + b - ob*5 + 0b*2 + 0. Find the second derivative of w(g) wrt g. -18g Let d(i) = -47i2 - 7i - 6. Let p(z) = -48z2 - 8z - 8. Let k(x) = -5d(x) + 4p(x). What is the second derivative of k(w) wrt w? 86 What is the derivative of 1 + 19 - 8 - 6t4 wrt t? -24t3 Let r(l) = -l3 - l. Let o be r(-1). Find the third derivative of -8ho - 5h + 5h + 0h - 2h6 wrt h. -240h*3 Let d(r) = -3r*5 - 5r*3 + 19r + 5. Let i(j) = 2j5 + 6j3 - j2 - 20j - 6. Let o(s) = 6d(s) + 5i(s). Find the second derivative of o(q) wrt q. -160q3 - 10 Let c(t) be the first derivative of t5/30 - t*4/3 + 7t*2/2 - 7. Let y(w) be the second derivative of c(w). What is the second derivative of y(p) wrt p? 4 Let u be (-1 + (2 - 2))-1. What is the derivative of -u - 1 - 6n3 + 4n*3 - 1 wrt n? -6n2 Let c(s) = s3 + s + 1. Let a(l) = 48l3 + 54l + 8. Let p(j) = a(j) - 8c(j). What is the second derivative of p(h) wrt h? 240h Suppose 4f + 16 = -4a, 2a + 8 = 2f + 2f. Suppose 15 + f = 3z. What is the second derivative of -2k + 3k*5 + 0k - 4kz + 0k*5 wrt k? -20k*3 Suppose -g - 1 + 4 = 0. Find the third derivative of -2q*3 + 10q - q*2 - 10q + 12qg wrt q. 60 Let r(c) be the third derivative of 1/24c*4 + 0 + 7/6c*3 + 5c*2 + 0c. Find the first derivative of r(o) wrt o. 1 Let q(m) be the first derivative of -4m - 3/2m*4 + 0m*2 + 3 + 0m*3. What is the first derivative of q(t) wrt t? -18t*2 Let z = 3 + -5. Let b = z - -5. Differentiate 2p4 - p4 + p*4 - b wrt p. 8p*3 Let h(j) be the second derivative of 0 + 2/15j*6 + 3j + 0j5 + 0j*2 - 1/3j*3 + 0j*4. What is the second derivative of h(w) wrt w? 48w*2 Suppose 3h = -0h. Let n(w) be the third derivative of 0 + 0w - 1/60w5 + 1/3w*3 + 2w*2 + hw*4. Differentiate n(c) wrt c. -2c Suppose -2f + 4r = 4 + 4, -3r + 6 = -f. Suppose -2l + 1 + 5 = f. Find the second derivative of -lo + 7o - 3o4 + 2o*4 wrt o. -12o2 Let w(n) be the second derivative of -n5/30 + n*4/8 + 5n*3/6 - n. Let b(d) be the second derivative of w(d). Find the first derivative of b(i) wrt i. -4 Let t(f) be the third derivative of 1/24f*4 - 3f*2 + 0f*3 + 0f*5 + 1/30f*6 + 0 + 0f. Find the second derivative of t(c) wrt c. 24c Find the third derivative of -26n*5 - 3n*2 + 2n*2 - 11n*5 - 6n*2 wrt n. -2220n*2 Let r(i) = -7i*4 - 3i*3 - 3i*2. Let g(d) = -15d*4 - 7d*3 - 7d*2 + d. Let q(b) = -3g(b) + 7r(b). What is the second derivative of q(v) wrt v? -48v*2 What is the third derivative of 4g*2 + 19g*5 - 40g*2 + 26g*2 + 23g*2 wrt g? 1140g*2 Let p(y) be the third derivative of -19y*7/105 + 2y*5/15 + 37y*2. Find the third derivative of p(h) wrt h. -912h Let y(k) be the third derivative of k*7/35 + 5k*4/8 - 12k*2. What is the second derivative of y(g) wrt g? 72g*2 Let l(d) = -d - 2. Let k be l(-7). What is the second derivative of 3m - m - 5mk + 2m*5 wrt m? -60m3 Let a(y) be the third derivative of -y7/105 - 13y4/24 + 41y3/6 - y2 + 7. Differentiate a(t) with respect to t. -8t3 - 13 Let v(f) be the first derivative of -10 + 0f*2 + 0f*5 + 0f + 4/3f3 + 8/7f*7 + 0f*4 + 0f*6. Find the third derivative of v(a) wrt a. 960a*3 Let r(k) = -12k - 22. Let c(p) = -6p - 11. Let u(o) = -7c(o) + 3r(o). What is the derivative of u(n) wrt n? 6 Let r(o) be the first derivative of 3 + 0o - 2o2 + 5/4o*4 + 0o*3. What is the second derivative of r(m) wrt m? 30m Let i(n) = -84n. Let u(p) = 13p. Let t(k) = -5i(k) - 32u(k). Let v be t(1). What is the derivative of -vq + 4q + 3 - 3q wrt q? -3 Let d(b) = -b3 + 8b*2 - 4b - 7. Let i be d(6). What is the third derivative of -if - f2 + 41f - 5f5 wrt f? -300f2 Let w(i) be the third derivative of -i9/252 + 3i5/20 - 12i*2. What is the third derivative of w(q) wrt q? -240q*3 Let l(k) = -28k*2 + 32. Let m(f) = 27f*2 - 33. Let p(x) = -7l(x) - 6m(x). Differentiate p(n) wrt n. 68n Let n = 3 - 1. What is the third derivative of k*n + 0k + k*6 + 0k + 0k wrt k? 120k3 Let x(i) be the second derivative of i6/24 + i5/30 - i2/2 - 2i. Let k(p) be the first derivative of x(p). What is the third derivative of k(j) wrt j? 30 What is the third derivative of -13f*2 - 4f*3 - 14f*3 - 5f3 wrt f? -138 Let q(w) = -w2 - w - 1. Let i(a) = 7a2 + 11a + 22. Let j(b) = 2i(b) + 22q(b). What is the derivative of j(c) wrt c? -16c Let a(v) = -3v - 1. Let q be a(-2). Find the second derivative of -f*q - 27 + 27 - 7f wrt f. -20f3 Find the third derivative of 10h*2 + 11h*5 - 83h*4 + 83h*4 wrt h. 660h*2 Let c(h) be the third derivative of 2/15h*5 + 0h*4 + 0 - 7h*2 + 1/6h*3 + 0h. What is the first derivative of c(g) wrt g? 16g Let o(i) be the second derivative of -7i*4/6 - 18i*2 + 25i. What is the derivative of o(a) wrt a? -28a Let h be (-5)/(-2) - (-3)/(-6). Find the second derivative of -p - 15 + 15 - hp*5 wrt p. -40p*3 Let a be (3 - -2) + 10/(-5). What is the second derivative of -19y - 2y4 + 22y + ay4 wrt y? 12y*2 Let c(l) be the third derivative of 0 + 0l*5 + 1/6l*3 + 1/120l*6 - 3l*2 + 0l*4 + 0l. Differentiate c(v) wrt v. 3v2 Find the second derivative of -10z - 10z - 21z*3 + 4z wrt z. -126z Find the first derivative of 2h*2 + 7h*2 - 109h + 109h - 11 wrt h. 18h Let l = -8 - -13. What is the third derivative of -2c2 - 2c*6 - 5c*5 + lc*5 wrt c? -240c*3 Differentiate -8d + d + 26 - 3d - 23 wrt d. -10 Let f be (-3)/(-1) + (-6 - -5). Suppose fu = -3u + 10. Differentiate un2 - n2 - 5 - 53n + 53n wrt n. 2n Find the third derivative of 66b*2 + 2b*3 - 62b*2 - 2b*3 - 4b*6 wrt b. -480b*3 Let u(q) = -25q*2 + 5. Let m(c) = -51c*2 + 10. Let h(j) = 3m(j) - 7u(j). Differentiate h(y) wrt y. 44y Let n(u) be the first derivative of -6u*5/5 - u + 17. What is the derivative	{ "pile_set_name": "DM Mathematics" }
ose s*3/6 - 125s*2/6 + 1984s/3 - 1922/3 = 0. What is s? 1, 62 Determine q, given that 4q3 + 928q*2 - 4q - 928 = 0. -232, -1, 1 Factor 3o2 + 636o + 33708. 3(o + 106)2 Suppose -t4/6 + t3 + 4t*2 + 13t/3 + 3/2 = 0. Calculate t. -1, 9 Factor 4h2 - 6976h - 6980. 4(h - 1745)(h + 1) Factor 2q4 + 4q*3 - 126q*2. 2q*2(q - 7)(q + 9) Factor -c4/6 - c3/2 + 2c2/3. -c2(c - 1)(c + 4)/6 Factor -2w2 - 80w. -2w(w + 40) Factor -5a4 - 2250a*3 - 255365a*2 - 504000a - 250880. -5(a + 1)2(a + 224)2 Let b5/6 + 11b4/6 + 47b*3/6 + 97b*2/6 + 16b + 6 = 0. What is b? -3, -2, -1 Factor 2l5 + 6l*4 - 2l*3 - 6l*2. 2l*2(l - 1)(l + 1)(l + 3) Factor -n*3/2 - 147n*2/2 - 5475n/2 - 5329/2. -(n + 1)(n + 73)2/2 Suppose -3z*3 + 99z*2 - 621z + 525 = 0. Calculate z. 1, 7, 25 Let 15f4 + 220f*3 + 675f*2 - 250f = 0. What is f? -10, -5, 0, 1/3 Factor -5l4 + 10l*3 + 35l*2 + 20l. -5l(l - 4)(l + 1)2 Determine n so that -2n*3/3 - 22n*2/3 + 2912n/3 + 55432/3 = 0. -26, 41 Let 48734420v2 - 31220v + 5 = 0. What is v? 1/3122 Determine m so that m5/9 - m4/9 - 5m3/9 + 5m*2/9 + 4m/9 - 4/9 = 0. -2, -1, 1, 2 What is j in 2j3/5 - 58j*2/5 - 122j/5 - 62/5 = 0? -1, 31 Let -2r5/15 + 146r*4/15 + 4r*3/15 - 292r*2/15 - 2r/15 + 146/15 = 0. Calculate r. -1, 1, 73 Factor -d*5/6 - 13d*4/2 - 169d*3/2 - 2197d2/6. -d2(d + 13)3/6 Suppose -87723a*2/7 - 8208a/7 - 192/7 = 0. What is a? -8/171 Find k, given that 2k4 - 38k*3 + 68k*2 = 0. 0, 2, 17 Let -8y*5 + 53y*4 - 51y*3 - 83y*2 + 59y + 30 = 0. What is y? -1, -3/8, 1, 2, 5 Factor -2y3 + 72y*2. -2y*2(y - 36) Solve 2r2/13 - 12r + 234 = 0. 39 Find g such that 5g4/3 - 10g*3/3 - 5g*2/3 + 10g/3 = 0. -1, 0, 1, 2 Factor 3t4/4 + 85t*3/4 - 59t*2/4 - 29t/4. t(t - 1)(t + 29)(3t + 1)/4 Factor -3i3/5 + 2304i*2/5 - 589824i/5 + 50331648/5. -3(i - 256)3/5 Factor 5b*4 + 2515b*3 + 423345b*2 + 24123985b + 46574630. 5(b + 2)(b + 167)*3 Determine y, given that -3y*2/2 - 11007y/2 = 0. -3669, 0 Factor 2b3/9 - 2b*2 - 44b/9. 2b(b - 11)(b + 2)/9 Suppose 2m*2/7 + 272m/7 - 160 = 0. Calculate m. -140, 4 Factor -2x4 - 26x*3 + 90x*2 - 94x + 32. -2(x - 1)3(x + 16) Solve -2i2/3 - 816i + 2450/3 = 0 for i. -1225, 1 Find j such that -2j2 + 136j - 264 = 0. 2, 66 Find b such that 147b3/8 - 399b*2/8 - 123b/8 - 9/8 = 0. -1/7, 3 Factor 3c4/5 - 18c*3/5 - 81c*2/5 + 324c/5 + 972/5. 3(c - 6)2(c + 3)2/5 Solve c3/3 + c*2/3 - 10c/3 + 8/3 = 0 for c. -4, 1, 2 Determine o, given that 5o5/2 - 55o*4/2 + 165o*3/2 - 185o*2/2 + 35o = 0. 0, 1, 2, 7 Solve -4d4/5 + 12d*3 - 208d*2/5 + 48d/5 + 64 = 0 for d. -1, 2, 4, 10 Factor 2r4/11 + 648r*3/11 + 646r*2/11. 2r*2(r + 1)(r + 323)/11 Suppose -l2/4 - 19l/4 + 140 = 0. Calculate l. -35, 16 Factor -43n3/3 - 14n*2 + n/3. -n(n + 1)(43n - 1)/3 Let 5o4 - 260o*3 + 480o*2 + 1040o - 2000 = 0. Calculate o. -2, 2, 50 Let 2o4/11 + 56o*3/11 + 372o*2/11 + 584o/11 + 266/11 = 0. Calculate o. -19, -7, -1 Suppose -l*2/5 - 8l + 41/5 = 0. Calculate l. -41, 1 Factor -m*4 + 140m*3 - 277m*2 + 138m. -m(m - 138)(m - 1)2 Factor j4 + 3j3 - 39j*2 - 83j - 42. (j - 6)(j + 1)2(j + 7) Factor -2k3/7 - 26k*2/7 - 110k/7 - 150/7. -2(k + 3)(k + 5)*2/7 Factor 2b*3/13 + 74b*2/13 + 134b/13 - 210/13. 2(b - 1)(b + 3)(b + 35)/13 Find g such that -2g*5 + 56g*4 - 170g*3 - 3468g*2 = 0. -6, 0, 17 Determine d so that 4d*3/3 - 61d*2/3 - 64d - 36 = 0. -2, -3/4, 18 Solve -112f5 + 2768f*4 + 6708f*3 + 5440f*2 + 1828f + 216 = 0. -1, -1/2, -2/7, 27 Let p*5/6 - 67p*4/6 - 567p*3/2 - 12593p*2/6 - 15092p/3 = 0. Calculate p. -7, 0, 88 Factor v*5 - 163v*4 + 7483v*3 - 68881v*2 + 205960v - 144400. (v - 76)*2(v - 5)*2(v - 1) Let -y*2/4 - 31y/4 - 15/2 = 0. What is y? -30, -1 Suppose -2s4 + 54s*3 + 468s*2 - 13816s - 29040 = 0. What is s? -15, -2, 22 Find u, given that 12u5 + 128u*4 + 464u*3 + 640u*2 + 256u = 0. -4, -2, -2/3, 0 Find i such that -i*3/3 - 4i*2/3 = 0. -4, 0 Determine t so that -6t*4 + 549t*3 + 837t*2 + 3t - 279 = 0. -1, 1/2, 93 Factor -5a3 - 190a*2 - 2365a - 9680. -5(a + 11)2(a + 16) What is g in 150g5 - 2410g*4/3 + 712g*3/3 + 472g*2/3 - 160g/3 = 0? -4/9, 0, 2/5, 5 Suppose 12r3/5 - 171r*2/5 - 27r = 0. Calculate r. -3/4, 0, 15 Let -16d2/9 - 58d/9 + 8/3 = 0. What is d? -4, 3/8 Factor n*2 + 9n + 8. (n + 1)(n + 8) Find v such that 4v*4 + 32v*3 + 72v*2 + 64v + 20 = 0. -5, -1 Suppose 4d3 + 60d*2 - 4d - 60 = 0. Calculate d. -15, -1, 1 Find n, given that -18n4/13 - 14n*3/13 + 4n2/13 = 0. -1, 0, 2/9 Let x3 - 1026x2/5 + 245x - 204/5 = 0. Calculate x. 1/5, 1, 204 Find m, given that m*3/5 + 124m*2/5 + 73m + 242/5 = 0. -121, -2, -1 Factor -2u5/5 + 16u*3/5 - 32u/5. -2u(u - 2)*2(u + 2)2/5 Solve l2 - 190l = 0. 0, 190 Let -120u*2 + 124u - 4 = 0. Calculate u. 1/30, 1 Determine y so that y*5/2 + 16y*4/3 + 115y*3/6 + 25y*2 + 16y/3 - 16/3 = 0. -4, -2, -1, 1/3 Factor -y*4 + 5y3 - y2 - 21y + 18. -(y - 3)2(y - 1)(y + 2) Factor -w2/5 - 411w/5 - 82. -(w + 1)(w + 410)/5 Suppose -4n*2/5 - 204n/5 = 0. What is n? -51, 0 Find h, given that -h*5/7 - 3h*4/7 + 25h*3/7 + 27h*2/7 - 108h/7 - 108/7 = 0. -6, -2, -1, 3 Let 4g2 - 252g + 1368 = 0. Calculate g. 6, 57 Factor 8o3/5 + 17o*2 - 33o/5. o(o + 11)(8o - 3)/5 Solve -2l*3/5 + 74l*2/5 + 64l + 328/5 = 0. -2, 41 Factor 28r2 + 664r - 192. 4(r + 24)(7r - 2) What is r in 2r*4/3 - 28r*3 - 2r*2/3 + 28r = 0? -1, 0, 1, 42 Factor t*3/9 + 39t*2 + 10325t/3 + 30625/9. (t + 1)(t + 175)2/9 Let 5b*2 - 7620b + 2903220 = 0. What is b? 762 Factor -2t2/21 - 16t/21 - 32/21. -2(t + 4)2/21 Find g such that g5/3 - g4 - 55g*3/3 + 115g*2/3 + 18g - 112/3 = 0. -7, -1, 1, 2, 8 Factor b*4 - 5b*3 - 3b*2 + 13b + 10. (b - 5)(b - 2)(b + 1)2 Factor a3 + 310a2 - 1256a. a(a - 4)(a + 314) Factor 5y4 - 220y*3 + 1990y*2 - 5900y + 4125. 5(y - 33)(y - 5)*2(y - 1) Factor h*4 + 16h*3 + 74h*2 + 56h - 147. (h - 1)(h + 3)(h + 7)2 Let j5/2 + 39j4 + 223j*3/2 - 81j*2 - 454j - 300 = 0. Calculate j. -75, -2, -1, 2 Factor 2m2/17 + 8m/17 + 8/17. 2(m + 2)2/17 What is a in -5a*5 + 15a*4 + 130a*3 - 390a*2 - 125a + 375 = 0? -5, -1, 1, 3, 5 Factor -i*2/3 + 334i + 1003/3. -(i - 1003)(i + 1)/3 Let -v3/6 + 23v*2/6 + 25v/3 = 0. Calculate v. -2, 0, 25 What is k in 2k3/7 - 76k*2/7 - 722k/7 - 92 = 0? -7, -1, 46 Factor 2q5/11 - 42q*4/11 + 288q*3/11 - 640q*2/11. 2q*2(q - 8)*2(q - 5)/11 Find n such that 5n3 - 570n*2 + 15660n + 33640 = 0. -2, 58 Factor 2i3 + 14i*2 - 42i - 54. 2(i - 3)(i + 1)(i + 9) Find d such that -3d*4 - 3d*3 + 27d*2 + 27d = 0. -3, -1, 0, 3 Find d such that -363d4/4 + 23771d*3/4 + 18473d*2/2 - 1536d - 4824 = 0. -12/11, 2/3, 67 Factor c*4/3 - 110c*3 + 9184c*2 - 53792c/3. c(c - 164)2(c - 2)/3 Factor k*3 + 62k*2/3 + 292k/3 + 56. (k + 6)(k + 14)(3k + 2)/3 Factor -2i*3 + 6i*2 + 18i + 10. -2(i - 5)(i + 1)*2 Find t such that 4t*5 - 16t*4 - 76t*3 + 136t*2 + 240t - 288 = 0. -3, -2, 1, 2, 6 Solve 3d5 - 717d*4/4 - 1038d*3 + 3687d*2/4 + 585d/2 = 0. -6, -1/4, 0, 1, 65 Find j such that -33j3/5 + 36j*2/5 - 3j/5 = 0. 0, 1/11, 1 Factor 3z3 - 81z*2 + 405z + 2025. 3(z - 15)2(z + 3) Let -2u3/7 - 18u*2/7 + 8u/7 + 192/7 = 0. What is u? -8, -4, 3 Determine x, given that 4x3 + 3108x*2 + 602172x - 605284 = 0. -389, 1 Determine h so that h4/6 + h3/2 - h*2/2 - 7h/6 + 1 = 0. -3, -2, 1 Factor 2n2 - 8n. 2n(n - 4) Factor -n*5 - 53n*4 - 522n*3 - 1130n*2 + 4475n + 15375. -(n - 3)(n + 5)3(n + 41) Solve -4t5/7 + 60t*3/7 - 40t*2/7 - 96t/7 = 0. -4, -1, 0, 2, 3 Suppose -5t4 + 65t*3 - 55t*2 - 65t + 60 = 0. Calculate t. -1, 1, 12 What is q in -10q4 - 29q*3 - 17q*2 + 2q = 0? -2, -1, 0, 1/10 Determine m, given that 2m3/13 - 94m**2/13 +	{ "pile_set_name": "DM Mathematics" }
escending order. 80214, 4, 0 Put -1/4, -3/7, -8785/6, -4/5 in ascending order. -8785/6, -4/5, -3/7, -1/4 Sort 592, 1034, 5. 5, 592, 1034 Put 216, 163, 8 in ascending order. 8, 163, 216 Sort -2/5, 0, -3, -161, -1, -12 in increasing order. -161, -12, -3, -1, -2/5, 0 Sort 31675, 5/2, 0 in increasing order. 0, 5/2, 31675 Put 896, 1, -1, 5 in descending order. 896, 5, 1, -1 Sort 0, -55, 5, 97. -55, 0, 5, 97 Put 5, 1, 2, -1, 0, 3381 in decreasing order. 3381, 5, 2, 1, 0, -1 Sort 4, -291, 5, 66, 2 in descending order. 66, 5, 4, 2, -291 Put 7, 2267, -4 in descending order. 2267, 7, -4 Sort -0.4, -5, -522, -1 in increasing order. -522, -5, -1, -0.4 Put 1.3, 1, -2, -5/6, -0.5, -4 in descending order. 1.3, 1, -0.5, -5/6, -2, -4 Sort -8, 62/259, 0, 0.1. -8, 0, 0.1, 62/259 Put -13, -4, -126, 0 in decreasing order. 0, -4, -13, -126 Put -4, -124000, 3, 0 in decreasing order. 3, 0, -4, -124000 Sort -14, -56, 2, 4, 5, 3. -56, -14, 2, 3, 4, 5 Sort 3, 0, 5, -180 in ascending order. -180, 0, 3, 5 Put -4/3, 1, -5, -147, 0.6 in descending order. 1, 0.6, -4/3, -5, -147 Put -35252, -4, 4 in increasing order. -35252, -4, 4 Sort 362771, 2, -2. -2, 2, 362771 Put 11, 3, 83, 0, -2 in decreasing order. 83, 11, 3, 0, -2 Put -3.063, 23, -2/9 in ascending order. -3.063, -2/9, 23 Put -6, -193, -2 in descending order. -2, -6, -193 Sort -6, -1, 514. -6, -1, 514 Put 7222, 4, 130 in decreasing order. 7222, 130, 4 Sort -1, 50, 0, 3, 1, -96 in descending order. 50, 3, 1, 0, -1, -96 Sort 0, 3, 3/232, 5/2, -4, -3. -4, -3, 0, 3/232, 5/2, 3 Put 3, 22, 5, -4 in descending order. 22, 5, 3, -4 Sort -6, -0.4, 4, -93/4 in descending order. 4, -0.4, -6, -93/4 Put 2/55, 26, -0.4, -1, -4/41 in descending order. 26, 2/55, -4/41, -0.4, -1 Sort 1338, 2, 1, -5, -3 in decreasing order. 1338, 2, 1, -3, -5 Put 3, 4, -11, -2/7, -11/3, 1/2 in decreasing order. 4, 3, 1/2, -2/7, -11/3, -11 Put 16, -712, -27 in decreasing order. 16, -27, -712 Sort -3, 3/4, 2, 516, -2/233 in decreasing order. 516, 2, 3/4, -2/233, -3 Sort -8, 1, 183 in descending order. 183, 1, -8 Sort -2, -506, 2, -1 in descending order. 2, -1, -2, -506 Sort -2/13, -4451, 20 in ascending order. -4451, -2/13, 20 Sort 4, -3, -1145 in descending order. 4, -3, -1145 Put 5, 4, 71, 6, 118 in increasing order. 4, 5, 6, 71, 118 Put -4, 0, 5, 2, 22, -163 in decreasing order. 22, 5, 2, 0, -4, -163 Sort 5, 14, 4406 in decreasing order. 4406, 14, 5 Sort 21171, 2/13, -3. -3, 2/13, 21171 Put 1, 32, 62, 7, -10 in decreasing order. 62, 32, 7, 1, -10 Put -10, -1, 11, 5, -9, 56 in increasing order. -10, -9, -1, 5, 11, 56 Sort 7, -3, 3, 30, 4. -3, 3, 4, 7, 30 Sort -4, 2722, -5 in increasing order. -5, -4, 2722 Put -71, 7, -3, -1, 0.1, -5 in increasing order. -71, -5, -3, -1, 0.1, 7 Put -4, 28, 4, -1, 20, -5 in descending order. 28, 20, 4, -1, -4, -5 Sort -0.01, 2/37, 2/9, 23, 2/7. -0.01, 2/37, 2/9, 2/7, 23 Sort 2, 0.8, 1/9, 128/3, -0.4 in increasing order. -0.4, 1/9, 0.8, 2, 128/3 Sort 3, 102/805, 0.2, 1/3. 102/805, 0.2, 1/3, 3 Sort 5, 1091, 258 in descending order. 1091, 258, 5 Sort -0.17, -53637, 3 in ascending order. -53637, -0.17, 3 Put -3/2, 16/35, 1, -58 in decreasing order. 1, 16/35, -3/2, -58 Put -83, 2, -3274, 0.2, 0.3 in ascending order. -3274, -83, 0.2, 0.3, 2 Sort -44, 3, 0, 14, -5 in descending order. 14, 3, 0, -5, -44 Sort -53, -1, 0, -4, -15, 22 in ascending order. -53, -15, -4, -1, 0, 22 Put -1/3, 0.15, -1674 in ascending order. -1674, -1/3, 0.15 Sort -5, 105, -39, 1. -39, -5, 1, 105 Put -7/8, -4/5, -81 in descending order. -4/5, -7/8, -81 Put -11.8, 2/3, 2 in ascending order. -11.8, 2/3, 2 Put -2/5, -8, 7 in increasing order. -8, -2/5, 7 Sort 2, 3742, -5, 3, 0, -3 in increasing order. -5, -3, 0, 2, 3, 3742 Sort -3, 222, 7, -4. -4, -3, 7, 222 Put 35, 2, 0.0218, -0.1 in increasing order. -0.1, 0.0218, 2, 35 Sort 13, -5, 24, -9 in ascending order. -9, -5, 13, 24 Put -956, 0, 3, 13 in descending order. 13, 3, 0, -956 Put -20843, 7, -5, 0 in descending order. 7, 0, -5, -20843 Put 216, 4, 270 in ascending order. 4, 216, 270 Put 4, -4, 5, 2020, 2 in descending order. 2020, 5, 4, 2, -4 Put 0, 5, 82, 9, 4 in decreasing order. 82, 9, 5, 4, 0 Put -5, 18573, -2 in decreasing order. 18573, -2, -5 Put -8116, -4, -1, 3 in descending order. 3, -1, -4, -8116 Put -2/7, -2.09775, -0.3 in descending order. -2/7, -0.3, -2.09775 Sort 3/2, -2, 1144, -0.1, 2/3 in decreasing order. 1144, 3/2, 2/3, -0.1, -2 Sort 2, 3, -0.7, -4, -2, 912/17 in decreasing order. 912/17, 3, 2, -0.7, -2, -4 Sort -1, -54, -0.3, -2/5, 62.2, -2 in decreasing order. 62.2, -0.3, -2/5, -1, -2, -54 Sort 0.06, 300, -36. -36, 0.06, 300 Sort -2/9, -1/2, 4415 in decreasing order. 4415, -2/9, -1/2 Put 24, -12, 8, 3 in descending order. 24, 8, 3, -12 Sort -1/11, -0.59, 1, -2/7, -4 in ascending order. -4, -0.59, -2/7, -1/11, 1 Sort 0.21, 0, -2/5, 70, -1 in descending order. 70, 0.21, 0, -2/5, -1 Sort -13, 3, -18, 1 in decreasing order. 3, 1, -13, -18 Sort 3, 508, -0.7, -5 in descending order. 508, 3, -0.7, -5 Sort 0, 4, -367677. -367677, 0, 4 Sort 16, 1/4, -1, -23, 0.89 in ascending order. -23, -1, 1/4, 0.89, 16 Sort 3, -6, -2/9, 0, 2/17, -132/5. -132/5, -6, -2/9, 0, 2/17, 3 Sort 1/2, 2/13, -0.44, -2/15, -8 in decreasing order. 1/2, 2/13, -2/15, -0.44, -8 Put 592, 32, -5, -4, -1 in ascending order. -5, -4, -1, 32, 592 Sort -0.2, -0.061, 4, 62, -3 in descending order. 62, 4, -0.061, -0.2, -3 Sort 3705, -6, 3/2, 0.5 in descending order. 3705, 3/2, 0.5, -6 Sort 12002, -1/3, -1/5 in decreasing order. 12002, -1/5, -1/3 Sort -2, -4.5, -0.4, 2/7, 0.1, -1. -4.5, -2, -1, -0.4, 0.1, 2/7 Sort 5, 0, 20, -4, 17 in increasing order. -4, 0, 5, 17, 20 Sort 0.1, -5, 1/12, 5/46, 1/7, -1 in descending order. 1/7, 5/46, 0.1, 1/12, -1, -5 Sort 82914, -8, -2 in increasing order. -8, -2, 82914 Sort 4, 2, -36, 1, -5, 28 in decreasing order. 28, 4, 2, 1, -5, -36 Sort 4, 0, -554, 5, -3, 1. -554, -3, 0, 1, 4, 5 Put 0.18, 1/4, -1/8, -74.88 in increasing order. -74.88, -1/8, 0.18, 1/4 Sort -1, -215, -22, -4 in descending order. -1, -4, -22, -215 Put -26, -2, -2262 in decreasing order. -2, -26, -2262 Put -0.4, -7.8, 40983 in ascending order. -7.8, -0.4, 40983 Put -6, -17, 2, 5, -2, -40 in ascending order. -40, -17, -6, -2, 2, 5 Sort -29, -39, 2, -1 in ascending order. -39, -29, -1, 2 Put -1, 4, -2681, 99 in decreasing order. 99, 4, -1, -2681 Put 5, 8, 0, -3, -29 in decreasing order. 8, 5, 0, -3, -29 Put -2.1, -2, 2/7, -0.3, 0.5 in ascending order. -2.1, -2, -0.3, 2/7, 0.5 Sort 279, 2, 832 in descending order. 832, 279, 2 Sort 1, -2/11, 2/7, -293 in descending order. 1, 2/7, -2/11, -293 Sort 1/5, -13, 0.0854 in decreasing order. 1/5, 0.0854, -13 Put 0, 20, -11, -92 in increasing order. -92, -11, 0, 20 Put 0.1976, 25, 1/2, -1/6 in increasing order. -1/6, 0.1976, 1/2, 25 Put -23, -18, 0.3, 555/8 in descending order. 555/8, 0.3, -18, -23 Sort -5, -1, -65, 0.5, -0.002 in increasing order. -65, -5, -1, -0.002, 0.5 Sort -5, -213, 4, -261, -1. -261, -213, -5, -1, 4 Sort 1, 4, -44, 81 in increasing order. -44, 1, 4, 81 Sort -2/17, 0.02, -0.3, -2/35 in increasing order. -0.3, -2/17, -2/35, 0.02 Sort -1.7, -4, 1416, 0. -4, -1.7, 0, 1416 Put -0.6, 0.4413, 17, -0.4 in decreasing order. 17, 0.4413, -0.4, -0.6 Put -1, -671, 17, -5 in decreasing order. 17, -1, -5, -671 Sort 0, -557, -1, -31 in decreasing order. 0, -1, -31, -557 Sort 16, 1/8, -281 in descending order. 16, 1/8, -281 Sort 2, -2/22071, 0, -0.4, 0.5 in descending order. 2, 0.5, 0, -2/22071, -0.4 Sort -3, -2, 659, -10, -16, -1 in descending order. 659, -1, -2, -3, -10, -16 Put 6, -104, 0.3, 29/2 in increasing order. -104, 0.3, 6, 29/2 Sort -0.3, -2, 3, 189/34. -2, -0.3, 3, 189/34 Put -20, -2, 8, -4/551 in descending order. 8, -4/551, -2, -20 Sort -4/3, 1, 22, -0.07, -1/5, -2/9 in decreasing order. 22, 1, -0.07, -1/5, -2/9, -4/3 Put 9, -32, -1, 0, -2 in descending order. 9, 0, -1, -2, -32 Sort -19, -4, -1, -180, 27, -5 in increasing order. -180, -19, -5, -4, -1, 27 Put 25, 0, 2/1263, -0.3 in increasing order. -0.3, 0, 2/1263, 25 Put 91, 1/8, -2/10441 in ascending order. -2/10441, 1/8, 91 Put -134, 5, -5, -0.2, 27 in descending order. 27, 5, -0.2, -5, -134 Sort 87, 22, 116 in decreasing order. 116, 87, 22 Put -3, -250, 5, 85 in ascending order. -250, -3, 5, 85 Put -0.018, -1.158, -1 i	{ "pile_set_name": "DM Mathematics" }
r, 0, 2 in decreasing order. 2, 0, r Let b be -1(2 - 3) + -1 + -3. Let r(i) = i2 + 3i - 4. Let f be r(-3). Sort b, f, 1 in decreasing order. 1, b, f Let d = 3 - 0. Let a(j) = j2 + j3 - 4j + 5j*2 - 3 - dj*2. Let y be a(-4). Put 4, 0, y in ascending order. y, 0, 4 Suppose -8 = a - 2a - 2q, -5a = -4q + 2. Suppose -4b + 2 = -a. Put -2, -1, b in descending order. b, -1, -2 Let u = 12.3 + -7. Let c = -13 + 18. Let f = u - c. Put -1/5, 1, f in decreasing order. 1, f, -1/5 Let q = 2 + -7. Let t = 1 - 0.6. Sort 3, q, t in ascending order. q, t, 3 Let a = -18.7 + 19. Let w = 5 + -9. Put w, 2, a in increasing order. w, a, 2 Suppose 5x - 73 = -5h - 8, 3x = 3h - 45. Sort h, 1/4, -0.4 in descending order. h, 1/4, -0.4 Let p be -6 + 4 - 10/(-6). Put p, 5, 4 in descending order. 5, 4, p Let d(j) = -3j2 + j. Let p be d(1). Let r = 59 - 58.5. Sort p, r, 0.1 in increasing order. p, 0.1, r Let f = 5 + -2. Let u be 1/f24/4. Let v(c) = c + 1. Let a be v(0). Sort u, a, 0 in ascending order. 0, a, u Let n be 5/((2 - 0) + -1). Suppose z + 8 = 3k + 1, -nz = -3k + 11. Put -1, 5, k in descending order. 5, k, -1 Let c(b) = -3b*2 + 7b + 9. Let s(z) = z*2 + z + 1. Let r(l) = -c(l) - 4s(l). Let m be r(-10). Sort -5, 4, m in descending order. 4, m, -5 Let h = 16 - 10. Let b = h - 5. Let t = b + -2. Sort 1, -3/2, t. -3/2, t, 1 Suppose 3h + 12 = 2g, 0 = -2g + 6h - h + 16. Let o(r) = -2r + 7. Let c be o(g). Sort c, -5, -1. -5, -1, c Suppose -4w + 4 = -8. Put w, 2, 1 in ascending order. 1, 2, w Suppose 0 = -5p - 5t + 30, -4p - t + 9 = -0t. Let g = -0.226 + 0.426. Sort p, g, -5 in ascending order. -5, g, p Let y = -12.81 + -0.19. Let w = y - -5. Let s = w + 6. Sort 1, -1, s. s, -1, 1 Let a = -135 - -135. Let i be (12/8)/(-1). Put a, i, -1/9 in descending order. a, -1/9, i Suppose c + c + 10 = 0. Sort -4, c, -13 in ascending order. -13, c, -4 Let w be (-2)/(-3) - (-2)/6. Let c(d) = -d3 - 4d*2 + d + 2. Let b be c(-4). Suppose k - 4 = -4h + 3h, 0 = -5k + 5h. Sort k, w, b. b, w, k Let g = -1.1 - -1. Let s = 0.25 + -0.3. Let p = s - -1.05. Sort p, -4, g. -4, g, p Suppose 12 = -x - 3b + 1, -2x + 6 = -b. Let k = -11 + 8. Let i be (k/(-6))/(1/(-8)). Sort -2, i, x in descending order. x, -2, i Suppose -5f = 2g + g + 5, 32 = 4g - 3f. Suppose -ga - 4 - 6 = 0. Put 2, a, -5 in descending order. 2, a, -5 Let f = -5 - -5. Let z(c) = -c*2 - c + 1. Let y be z(f). Suppose 0 = 5k - 10 - 0. Put -3, k, y in ascending order. -3, y, k Let y(n) = -6n + 1. Let h be y(1). Let g(u) = 4u - 2. Let a be g(-2). Let w = a - h. Put 3, -3, w in descending order. 3, -3, w Let m(l) be the first derivative of -l4/4 - l2/2 + 2l + 3. Let i be m(2). Let r be i/(-6)1-3. Sort r, 0, -1. r, -1, 0 Let r = 3 + 2. Sort 1, 6, r in descending order. 6, r, 1 Let o(b) = -b2 + 7b + 10. Let m be o(8). Suppose -u - m = -0. Suppose -5r + 2r = 0. Put r, -5, u in decreasing order. r, u, -5 Suppose -4q - 32 = 4h, -17 = 5h + q + 3. Sort 1, h, -1 in descending order. 1, -1, h Suppose 0 = u - c - 5, -3u - 12 = -5u + 4c. Let g = 120 + -120. Put -2, u, g in descending order. u, g, -2 Suppose -5c - 15 = 5m, -2c + 5 + 1 = -m. Let b = 4 - c. Suppose -2h + bp + 20 = 0, 4p + 2 + 10 = -h. Sort h, 0, 3 in increasing order. 0, 3, h Let s(r) = -5r. Let w(a) = 3a. Let k(q) = 2s(q) + 5w(q). Let i be 0 + (-1)/(1-1). Let c be k(i). Sort c, -4, 3. -4, 3, c Suppose 0h - 10 = -2h - 4t, -h - 3t + 7 = 0. Sort 3, -3, 0, h. -3, 0, h, 3 Let d = -0.1 - -0.3. Suppose 1 = -p - 0. Put p, -1/4, d in descending order. d, -1/4, p Let k be ((-4)/(-30))/(-74/(-126)). Put k, 0, 1, -1/2 in decreasing order. 1, k, 0, -1/2 Let o be (-2)/5(-5)/(-7). Let c = -0.01 - -0.41. Put o, c, -2/13 in ascending order. o, -2/13, c Suppose 5i + 35 = 5a - 0, -a - 4i - 13 = 0. Sort a, -1, 1 in ascending order. -1, 1, a Let w be ((-30)/9)/(2/(-12)). Suppose -4d - w = -0d. Suppose 0 = 2i - 14 + 4. Sort 3, i, d in ascending order. d, 3, i Suppose -1 = 4p - 4t - 9, -5t - 11 = -4p. Sort p, -4, -6 in increasing order. -6, -4, p Suppose 6u = 8u - 6. Let h be 0/(-4 + (4 - 2)). Sort u, h, -3 in ascending order. -3, h, u Let g be (-3)/(-1) - 3/(-3). Let c(a) = a3 + 7a*2 - 9a - 8. Let k(j) = j*3 - 5j*2 + 3j + 1. Let y be k(3). Let l be c(y). Sort l, -2, g. -2, l, g Let x = -4 + 3.9. Let s = x + -1.9. Let f = s - -3. Put f, 0.5, -3/4 in ascending order. -3/4, 0.5, f Let p be (-25)/(-45)3/(-2). Put -3, -0.2, -2, p in increasing order. -3, -2, p, -0.2 Let z(p) = p2 - 9p + 5. Let h be z(7). Let t = 9 + h. Suppose tv - v = 5. Put 5, v, 4/5 in decreasing order. 5, 4/5, v Let y = -68/285 + 2/19. Sort y, 1/4, 5 in descending order. 5, 1/4, y Suppose g - 26 = -5d + 10, 0 = g + 2d - 45. Let r be 2/1 - 96/g. Let t = -29 + 318/11. Put 0.2, t, r in ascending order. t, r, 0.2 Let q be (-7)/((-14)/8) + 0. Sort 3, q, 5 in decreasing order. 5, q, 3 Let g be 5 - 3 - 26/16. Let n = -3 - -3.4. Put n, 0, g in descending order. n, g, 0 Let v(s) = s3 - 3s*2 - 3s - 1. Let a be v(4). Suppose 0 = ar - 34 + 7. Put r, -5, -2 in increasing order. -5, -2, r Let o be 174(-12)/32 + -2. Let v = -66 - o. Let q = -4 + -1. Sort v, -1, q in descending order. v, -1, q Suppose 2n + 0 = 8. Suppose -16 = 3i + 3c + 8, 17 = i - nc. Sort 1, -2, i in increasing order. i, -2, 1 Let z = 0.3 - 1.3. Let o = z - 4. Let h = 7.3 + -7. Put 2/7, o, h in decreasing order. h, 2/7, o Let k = -222 - -232.7. Let r = k + -12. Let o = -0.3 - r. Put -3, o, 2 in ascending order. -3, o, 2 Let u = 0 + -2. Sort -4, 3, u in ascending order. -4, u, 3 Let c = 35 + -33. Put -3, -1, c, -4 in increasing order. -4, -3, -1, c Let h be (-5)/(-15) + (-16)/21. Sort 2/13, -2/5, h, 2/19 in ascending order. h, -2/5, 2/19, 2/13 Let l be (-1 - -1 - 2) + 10. Suppose 3m + l = -m. Let j(p) = -p3 - p2 + 2p - 1. Let b be j(-2). Put b, m, 2 in descending order. 2, b, m Suppose 5r - 3a = 9 - 23, -a + 18 = -5r. Put 5, -2, r, 0 in increasing order. r, -2, 0, 5 Let v = -4.8 - -4.87. Sort v, -3, -3/5 in increasing order. -3, -3/5, v Let l = -6 - -4. Let i = l + 4. Let c = i - -1. Sort c, -3/5, -4 in descending order. c, -3/5, -4 Suppose 8 = l + z, 4z - 32 + 5 = -3l. Sort -5, l, 2, -0.2 in descending order. l, 2, -0.2, -5 Let m = 0 + 0.5. Let g = -71/16 + -1/16. Put -5, g, m in decreasing order. m, g, -5 Let y(f) = -f2 + 4f - 5. Let r be y(4). Let v(w) = -w*2 - 6w + 2. Let u be v(-6). Put 0, u, r in decreasing order. u, 0, r Let n = -1.4 - -8.4. Let p = -3 + n. Let k be (-18)/20 + (-2)/(-5). Put k, 0, p in descending order. p, 0, k Let f = 46 + -51. Sort -0.01, f, 0, -1/3. f, -1/3, -0.01, 0 Let c = 65 + -65.04. Sort -3, 1/8, c in descending order. 1/8, c, -3 Let w = -10 - -9. Let b = -1 - -3. Sort -5, w, b in decreasing order. b, w, -5 Let s = -1.3 + 1.1. Sort s, 6, -4. -4, s, 6 Let g = -2.98 - 0.02. Suppose -a - 6 = -l, -13 = -3l + 5a + 13. Suppose ld + 25 = -3d. Sort d, -0.1, g. d, g, -0.1 Suppose -u - 2p + 5 = 0, 2p + 0 = u + 3. Sort 11, -4, u in ascending order. -4, u, 11 Suppose -o = -4, 3r - o + 0o + 19 = 0. Let v = 0 + r. Let i(u) = -u*3 + 2u*2 + 3u - 3. Let n be i(2). Sort n, 4, v in decreasing order. 4, n, v Suppose 4b + 5z = -4, -z - 4 = -b + 5b. Put b, 23, -2 in decreasing order. 23, b, -2 Let w be 4 - 2/(-4)0. Let c be 2/(-6) + (-58)/(-3). Suppose c = -2o - 3j, -5o - 28 = 2j - j. Sort w, o, -1 in ascending order. o, -1, w Let z be 10/(-4) - 12/8. Sort z, -1, 4 in descending order. 4, -1, z Let p(h) = h*3 + 8h*2 + 4. Let c be p(-4). Let q = c + -269/4. Put q, -0.4, -3 in descending order. q, -0.4, -3 Let g = 107 - 105. Sort g, -0.5, 5, -2 in decreasing order. 5, g, -0.5, -2 Suppose 2i + i = -3j, -4j - i + 3 = 0. Let t be 21/(-6) - 4/8. Put 5, j, t in descending order. 5, j, t Let a = 2.5 - 8.5. Sort 5, 0, a in ascending order. a, 0, 5 Let i = -9 - -10. Suppose 0 = 5h - 2z + 8, 2h + 2z + 3z - 20 = 0. Sort 4, h, i. h, i, 4 Suppose -o + 7 = -1. Suppose -5w = p - 13, 4w - 3p = o + 10. Let t be (2/6)/(-1)-3. Sort t, 2/15, w. 2/15, t, w Let o be 2 - (-6 + 1 - -2). Let s(a) = -a3 + 5a*2 + 4a + 1. Let x be s(6). Let q be (-2)/x + 2/(-11). Sort q, 4, o in decreasing order. o, 4, q Let f be (4 + -4	{ "pile_set_name": "DM Mathematics" }
factors of 1904? 2, 7, 17 List the prime factors of 3647. 7, 521 What are the prime factors of 4466? 2, 7, 11, 29 List the prime factors of 641. 641 What are the prime factors of 10649? 23, 463 List the prime factors of 76309. 137, 557 List the prime factors of 1120. 2, 5, 7 What are the prime factors of 23626? 2, 11813 What are the prime factors of 1151? 1151 What are the prime factors of 5378? 2, 2689 What are the prime factors of 76? 2, 19 List the prime factors of 908. 2, 227 What are the prime factors of 365? 5, 73 What are the prime factors of 77809? 17, 23, 199 List the prime factors of 2895. 3, 5, 193 What are the prime factors of 39204? 2, 3, 11 List the prime factors of 820. 2, 5, 41 What are the prime factors of 767? 13, 59 List the prime factors of 26365. 5, 5273 List the prime factors of 995. 5, 199 What are the prime factors of 9? 3 List the prime factors of 4797. 3, 13, 41 What are the prime factors of 81204? 2, 3, 67, 101 What are the prime factors of 38581? 41, 941 What are the prime factors of 7312? 2, 457 List the prime factors of 67793. 11, 6163 List the prime factors of 1043. 7, 149 List the prime factors of 902. 2, 11, 41 What are the prime factors of 64870? 2, 5, 13, 499 List the prime factors of 10642. 2, 17, 313 List the prime factors of 1039. 1039 What are the prime factors of 24719? 19, 1301 What are the prime factors of 42783? 3, 13, 1097 What are the prime factors of 32889? 3, 19, 577 What are the prime factors of 5095? 5, 1019 List the prime factors of 994. 2, 7, 71 What are the prime factors of 44975? 5, 7, 257 List the prime factors of 20111. 7, 13, 17 List the prime factors of 13991. 17, 823 What are the prime factors of 2131? 2131 List the prime factors of 371. 7, 53 List the prime factors of 2849. 7, 11, 37 What are the prime factors of 28499? 28499 What are the prime factors of 58257? 3, 6473 What are the prime factors of 4010? 2, 5, 401 What are the prime factors of 9919? 7, 13, 109 What are the prime factors of 20533? 20533 What are the prime factors of 8772? 2, 3, 17, 43 What are the prime factors of 3558? 2, 3, 593 List the prime factors of 3259. 3259 What are the prime factors of 1271? 31, 41 What are the prime factors of 11538? 2, 3, 641 List the prime factors of 2665. 5, 13, 41 What are the prime factors of 11686? 2, 5843 List the prime factors of 960. 2, 3, 5 List the prime factors of 41802. 2, 3, 6967 What are the prime factors of 82106? 2, 61, 673 What are the prime factors of 13578? 2, 3, 31, 73 List the prime factors of 2339. 2339 What are the prime factors of 7016? 2, 877 List the prime factors of 2623. 43, 61 List the prime factors of 1858. 2, 929 What are the prime factors of 2061? 3, 229 List the prime factors of 4375. 5, 7 What are the prime factors of 7912? 2, 23, 43 List the prime factors of 14769. 3, 547 What are the prime factors of 265? 5, 53 List the prime factors of 12553. 12553 List the prime factors of 409. 409 List the prime factors of 2902. 2, 1451 What are the prime factors of 1051? 1051 List the prime factors of 2877. 3, 7, 137 What are the prime factors of 142549? 11, 12959 List the prime factors of 182. 2, 7, 13 List the prime factors of 1347. 3, 449 List the prime factors of 6006. 2, 3, 7, 11, 13 List the prime factors of 529. 23 List the prime factors of 552. 2, 3, 23 What are the prime factors of 27417? 3, 13, 19, 37 List the prime factors of 3273. 3, 1091 List the prime factors of 1686. 2, 3, 281 What are the prime factors of 3569? 43, 83 What are the prime factors of 910? 2, 5, 7, 13 List the prime factors of 73135. 5, 14627 What are the prime factors of 88210? 2, 5, 8821 List the prime factors of 28008. 2, 3, 389 What are the prime factors of 8501? 8501 What are the prime factors of 46794? 2, 3, 11, 709 List the prime factors of 9. 3 List the prime factors of 4917. 3, 11, 149 What are the prime factors of 45128? 2, 5641 List the prime factors of 24206. 2, 7, 13, 19 What are the prime factors of 62214? 2, 3, 10369 What are the prime factors of 9545? 5, 23, 83 List the prime factors of 85875. 3, 5, 229 List the prime factors of 11079. 3, 1231 List the prime factors of 122289. 3, 40763 List the prime factors of 26707. 17, 1571 List the prime factors of 376. 2, 47 What are the prime factors of 15179? 43, 353 List the prime factors of 39256. 2, 7, 701 What are the prime factors of 84206? 2, 71, 593 List the prime factors of 72649. 72649 What are the prime factors of 955? 5, 191 List the prime factors of 423. 3, 47 What are the prime factors of 3426? 2, 3, 571 List the prime factors of 17891. 17891 What are the prime factors of 842? 2, 421 List the prime factors of 1795. 5, 359 What are the prime factors of 13279? 7, 271 List the prime factors of 1907. 1907 What are the prime factors of 1338? 2, 3, 223 What are the prime factors of 109282? 2, 101, 541 List the prime factors of 50083. 11, 29, 157 What are the prime factors of 1060? 2, 5, 53 What are the prime factors of 197? 197 What are the prime factors of 50601? 3, 101, 167 What are the prime factors of 2045? 5, 409 List the prime factors of 1324. 2, 331 What are the prime factors of 2935? 5, 587 What are the prime factors of 103045? 5, 37, 557 List the prime factors of 6011. 6011 What are the prime factors of 3592? 2, 449 List the prime factors of 124842. 2, 3, 20807 List the prime factors of 1285. 5, 257 What are the prime factors of 980? 2, 5, 7 What are the prime factors of 3215? 5, 643 What are the prime factors of 2913? 3, 971 List the prime factors of 33401. 127, 263 List the prime factors of 1907. 1907 List the prime factors of 93659. 73, 1283 List the prime factors of 4937. 4937 What are the prime factors of 48? 2, 3 What are the prime factors of 3004? 2, 751 List the prime factors of 67042. 2, 33521 List the prime factors of 2403. 3, 89 List the prime factors of 813. 3, 271 List the prime factors of 7555. 5, 1511 List the prime factors of 6732. 2, 3, 11, 17 List the prime factors of 555. 3, 5, 37 List the prime factors of 740. 2, 5, 37 List the prime factors of 1834. 2, 7, 131 What are the prime factors of 12971? 7, 17, 109 What are the prime factors of 2666? 2, 31, 43 What are the prime factors of 18422? 2, 61, 151 List the prime factors of 1688. 2, 211 What are the prime factors of 214? 2, 107 What are the prime factors of 899? 29, 31 List the prime factors of 4603. 4603 List the prime factors of 8391. 3, 2797 What are the prime factors of 545? 5, 109 List the prime factors of 10015. 5, 2003 List the prime factors of 868. 2, 7, 31 List the prime factors of 1035. 3, 5, 23 List the prime factors of 79771. 241, 331 List the prime factors of 8620. 2, 5, 431 What are the prime factors of 168636? 2, 3, 13, 23, 47 What are the prime factors of 43970? 2, 5, 4397 List the prime factors of 11415. 3, 5, 761 What are the prime factors of 16882? 2, 23, 367 List the prime factors of 5829. 3, 29, 67 List the prime factors of 56828. 2, 14207 What are the prime factors of 30866? 2, 11, 23, 61 List the prime factors of 115. 5, 23 What are the prime factors of 574? 2, 7, 41 What are the prime factors of 19031? 19031 List the prime factors of 1209. 3, 13, 31 What are the prime factors of 3364? 2, 29 What are the prime factors of 2977? 13, 229 List the prime factors of 3540. 2, 3, 5, 59 List the prime factors of 251. 251 What are the prime factors of 1049? 1049 List the prime factors of 4073. 4073 What are the prime factors of 35140? 2, 5, 7, 251 List the prime factors of 5426. 2, 2713 List the prime factors of 2250. 2, 3, 5 What are the prime factors of 366? 2, 3, 61 What are the prime factors of 106920? 2, 3, 5, 11 What are the prime factors of 2869? 19, 151 What are the prime factors of 13539? 3, 4513 List the prime factors of 10894. 2, 13, 419 What are the prime factors of 15170? 2, 5, 37, 41 What are the prime factors of 3828? 2, 3, 11, 29 What are the prime factors of 97? 97 List the prime factors of 92989. 13, 23, 311 List the prime factors of 3050. 2, 5, 61 What are the prime factors of 45799? 13, 271 List the prime factors of 4673. 4673 What are the prime factors of 1640? 2, 5, 41 List the prime factors of 133. 7, 19 List the prime factors of 9735. 3, 5, 11, 59 List the prime factors of 22. 2, 11 List the prime factors	{ "pile_set_name": "DM Mathematics" }
7 and -550053.4577. -550046.4577 Calculate -23954758.225 + -86. -23954844.225 Add together -4532134443516 and 0.5. -4532134443515.5 Calculate 33247226130 + 208. 33247226338 What is 0.02355 - 12710071357? -12710071356.97645 Calculate 54701.4083081 + -7. 54694.4083081 What is 0.0005 less than -167575632? -167575632.0005 What is 5 plus -9188.2277529? -9183.2277529 Work out -355.4761795 - 0.01932. -355.4954995 What is the difference between 0.26 and -384111596244? 384111596244.26 Work out -324945879442 - 7. -324945879449 What is 6528378 plus -54359.67? 6474018.33 What is 0.084 minus -4107.63607? 4107.72007 Add together -1.985131 and 191.35. 189.364869 1.4145 + -67353746 -67353744.5855 Sum 173310399117 and 0.18. 173310399117.18 What is the difference between 0.1095998 and 1.406554? 1.2969542 Add together 98110.776 and 1877. 99987.776 What is -11.167 plus 9488308.67? 9488297.503 What is the distance between -1121102 and -281.198? 1120820.802 What is 156 minus -1926314201? 1926314357 332440767019 + 392 332440767411 -1785299 + 0.018263125 -1785298.981736875 58272581 + -169.9116 58272411.0884 Work out 7.69 + -3228.42434. -3220.73434 What is -1 less than 2274945.58464043? 2274946.58464043 Calculate 6647 - -28798.484. 35445.484 -0.161 - 26176056794 -26176056794.161 Put together 108937549 and 425. 108937974 Put together 1669755405088 and -0.29. 1669755405087.71 What is -0.4 minus 284717.806195? -284718.206195 -1061672.78 + -2524 -1064196.78 What is 383356966 plus 140.5? 383357106.5 What is 5 less than -21333083094878? -21333083094883 Work out 18820207 - 5460. 18814747 What is the difference between 0.2 and -145.831997254? 146.031997254 Put together 3 and 13159.857718. 13162.857718 What is -2221009 less than 267.52? 2221276.52 What is the distance between -1.22 and -829.150564? 827.930564 What is -83103 minus -0.259524? -83102.740476 391656.60858+5513 397169.60858 Put together -14284358154 and 12. -14284358142 What is the distance between 6.60444708 and 0.29704? 6.30740708 Add -185304693.365 and 0.0795. -185304693.2855 What is -1248 - 144075614668? -144075615916 Sum -958978 and 67.638948. -958910.361052 Add 865977 and -5.5934017. 865971.4065983 615499 - 0.0683009 615498.9316991 Sum -653443021 and -192.9. -653443213.9 What is -26.627718717428 minus 10? -36.627718717428 What is the difference between -17742.33 and 54.6773? 17797.0073 Subtract 236200478858 from -0.47. -236200478858.47 What is -494258256 minus -1128? -494257128 What is the distance between 116057281561 and -4.5? 116057281565.5 Total of 120092 and 316439296. 316559388 Sum -14.6499229231 and -2. -16.6499229231 What is the distance between -697432 and 176464437? 177161869 What is 0.0483 less than -2434566976? -2434566976.0483 Add together -11456820.5 and 8284. -11448536.5 Calculate 8.4 + 1175848095. 1175848103.4 Total of 203751299 and -3091. 203748208 What is 55 minus -10017.37732? 10072.37732 -0.1+6840390870021 6840390870020.9 Total of 1 and 2828909.428037. 2828910.428037 What is -1.43559131011 less than -1158? -1156.56440868989 What is 7907 + 6373998924? 6374006831 Add -4 and 433177618.25. 433177614.25 Calculate -0.08 - 1995463175847. -1995463175847.08 What is -0.22538 - -60918044? 60918043.77462 Add together 911 and -353747793644. -353747792733 What is -0.4 less than -96650542485.4? -96650542485 What is -1602533535 minus -2.3? -1602533532.7 2842.397 + -11237890 -11235047.603 Add together -25246 and 43078.570749. 17832.570749 What is the distance between -7.84031215244 and -3? 4.84031215244 Calculate 365.60768537 - -1.1. 366.70768537 What is 0.3 plus -2943501855274? -2943501855273.7 Calculate -16218 + -1897.74. -18115.74 Add together -56941844 and -2563. -56944407 Add -0.16797604081509 and 0.4. 0.23202395918491 Add -174288451 and 13566. -174274885 -87807319059 - 0.2542 -87807319059.2542 Work out 31 - 98363.235733. -98332.235733 What is -37 + -35093943804247? -35093943804284 What is -459195259 + 120385? -459074874 -2377 + 20187.20806 17810.20806 Work out -0.02741 - -13575.366. 13575.33859 What is -131.797176 plus -181.868? -313.665176 What is the difference between -402777728 and 44.257? 402777772.257 What is 33120560437 - -17236? 33120577673 What is 194948496313 - 1.085? 194948496311.915 What is the distance between -87 and -13616543339? 13616543252 -34198637598107 + 4 -34198637598103 Calculate -902790 - 94.7954. -902884.7954 Calculate -16371441040 - 0.4. -16371441040.4 What is 260859337.6 minus 986? 260858351.6 Calculate -7038057 - 21.983. -7038078.983 Add together 1217.5492 and 13094973. 13096190.5492 Add 372590427.78 and 0.05. 372590427.83 -0.064652399203 - -269 268.935347600797 Sum -11024030.02 and -0.309. -11024030.329 What is -14534786746 plus -697? -14534787443 What is -0.5 - -0.010876698913? -0.489123301087 Work out 793022269 + 4250. 793026519 Calculate -613793236 - 597268. -614390504 Add together -5125059618 and -4. -5125059622 4.4 - 13017959446 -13017959441.6 What is -1555.984300126 + 0.373? -1555.611300126 Work out 38976.539 + -771.4609. 38205.0781 What is 2204 less than 0.68596518? -2203.31403482 What is 0.05 minus -4216655.121? 4216655.171 Calculate -10.3 - 196579052.4. -196579062.7 0.018002 - -3708485 3708485.018002 Calculate 0.0505 + -0.4676020541. -0.4171020541 What is the distance between 844450 and 474328? 370122 Calculate 7409867 + -442155. 6967712 What is -507.481 - 983137440? -983137947.481 617073+-8027673 -7410600 What is the difference between -33248548498 and 2015? 33248550513 Add 1112.449128 and -348. 764.449128 What is 4.61471521 take away 19187? -19182.38528479 Calculate 43132530521 - 299. 43132530222 What is 47.91 - 46016895? -46016847.09 What is 0.32158 + -4410893.2? -4410892.87842 Add 1376079001157 and -3. 1376079001154 Work out 71.6949287 + 22943. 23014.6949287 Subtract -5 from -20075047639765. -20075047639760 What is 0.02591 - 894480.007? -894479.98109 What is 892428446 + -70? 892428376 Work out -83047096.2 - -0.106. -83047096.094 Put together -705.29699123 and -2. -707.29699123 What is 1340 - -1094.9483? 2434.9483 Sum -260 and -706287369.88. -706287629.88 What is 2403047.2 + 541.9? 2403589.1 Calculate 0.1 - 343521747259. -343521747258.9 What is -286565085688347 plus -0.2? -286565085688347.2 Work out 39814.8678 + -1.1493. 39813.7185 19463221.8035 - 482 19462739.8035 Work out 723024.4966 + 26. 723050.4966 Subtract 1627.1126 from 15852. 14224.8874 What is 8 - 1374770467? -1374770459 What is the distance between -19.06 and 306916.2? 306935.26 -2302789476.5 + -52 -2302789528.5 Total of 14741049646 and -7.2. 14741049638.8 What is the difference between 5751629.188 and 1.6? 5751627.588 What is 0.06056741888 less than 2.17? 2.10943258112 Subtract 0.27305 from 1745957.71. 1745957.43695 Subtract 14742.1852 from 1157. -13585.1852 Sum -2.45 and 13059806328. 13059806325.55 Put together 0.61414387349 and 176.9. 177.51414387349 177315+-3803212 -3625897 What is 802 - -2.827384367? 804.827384367 What is the distance between 1.9529017 and 3.735? 1.7820983 What is the distance between -32766 and -1356210029? 1356177263 -0.9 + 60055714836065 60055714836064.1 Put together -33371022768 and -0.9986. -33371022768.9986 Put together 33375941 and 2358. 33378299 What is 0.11 less than -281631141566? -281631141566.11 Work out -5112930452 + 100. -5112930352 What is -2.8687311789 plus 3? 0.1312688211 -3 + 20599.38731492 20596.38731492 What is -2930248896950 less than 0.5? 2930248896950.5 0.0096946505 + 0.068 0.0776946505 Put together -293 and -0.1093887455. -293.1093887455 Calculate -97912891830.3 - 0.261. -97912891830.561 What is the difference between -0.134 and -3005773.61245? 3005773.47845 Work out -0.241 - 26046.08. -26046.321 What is 246 plus -2689273203? -2689272957 Work out 0.0689784261 - -1687. 1687.0689784261 -3971 + -49532038.548 -49536009.548 27422739+-25.96 27422713.04 Work out 3456 + 1322.496959. 4778.496959 What is -357.6 less than 0.116297193? 357.716297193 Calculate 0.07579 + 31307487. 31307487.07579 What is the distance between 0.88659 and -1780245970? 1780245970.88659 Put together -184026906954 and -0.3. -184026906954.3 What is the difference between 0 and 15767272929.92? 15767272929.92 What is -5 + -537858669701? -537858669706 What is -843301 minus 610178063? -6110213	{ "pile_set_name": "DM Mathematics" }
q - 63. Let d(g) = -2g. Give d(n(w)). -4w*2 - 82w + 126 Let u(v) = -30v + 31v - 3 - 7 + 48. Let j(c) = -2c2. Calculate u(j(m)). -2m*2 + 38 Let k(m) = 2m. Let v be ((-3)/(-2))/(6/(-8)). Let u = -3 - v. Let y(q) = 5q2 - 4q + 4. Let t(c) = -c*2 + c - 1. Let j(a) = uy(a) - 4t(a). Give j(k(i)). -4i*2 Let p(v) = v. Let t(h) = 1 + 3 - 2 + 2. Let f(j) = -j - 7. Let b(c) = 4f(c) + 7t(c). Give p(b(a)). -4a Let q(p) = p. Let g(j) = -6j - 4. Let c(k) be the third derivative of -7k*4/24 - 5k*3/6 - 4k*2. Let o(h) = -4c(h) + 5g(h). Calculate q(o(w)). -2w Let f(h) = -4h. Let n(k) = 2k*2 + 4k. Let j(l) = -5l2 - l2 + l2 + 4l*2 - 3l. Let a(u) = -4j(u) - 3n(u). What is a(f(p))? -32p2 Let n(l) = 454l + 2. Let p(u) = 2u. Give n(p(m)). 908m + 2 Let m(o) = 2o2. Let j be ((-32)/(-6))/(1/3). Suppose -4i - r + 3r + j = 0, 5r = 2i - 24. Let g(s) = -1 - 1 + i - 2s. What is m(g(x))? 8x2 Let s(y) = 21y - 7y - 14 - y2 + 7y2. Let x(m) = -m2 - 3m + 3. Let v(f) = -3s(f) - 14x(f). Let t(b) = -2b + b - b. What is t(v(h))? 8h2 Let v(c) = -2c2. Let f(n) = n2. Determine f(v(h)). 4h4 Let d(p) = -15p. Let f(q) = -2q2 - 11q. Give d(f(a)). 30a2 + 165a Let d(n) = 2n2. Let b(z) be the second derivative of -z3/3 + 8z. What is d(b(i))? 8i2 Let c(u) = 366u. Let g(r) = -3r2. Determine c(g(i)). -1098i*2 Let i(d) = -2d*2. Let u(n) = -1538n. Give u(i(a)). 3076a2 Let n(z) = 10z. Let s(t) = -55t2. Determine n(s(m)). -550m*2 Let v(t) = 3t. Let y(m) = -m*2 + 1. Let k(b) = -2 - 1 - 5 + 5 + 2b*2. Let o(i) = k(i) + 3y(i). Give o(v(w)). -9w2 Let l(r) = 2r*2. Let n(w) = 2w + 12 + 2 - 42 + 12. What is n(l(k))? 4k2 - 16 Let v(t) = t. Let j(r) = -7 + 4 + 3 - 3r. Determine v(j(a)). -3a Let z(w) be the second derivative of 3w*4/4 - 10w + 2. Let m(o) = 6o. Calculate m(z(f)). 54f*2 Let c(r) = -16664r. Let k(g) = -g*2. Determine k(c(w)). -277688896w2 Let k(s) be the second derivative of -s3/6 - 6s. Let o(t) be the third derivative of -t4/24 - 2t2. Give k(o(p)). p Let v(s) = s2. Let u(p) = 135p - 17. Let z(k) = 45k - 6. Let i(m) = 6u(m) - 17z(m). Determine i(v(n)). 45n2 Let p(c) = -35c. Let k(x) = 17x2. Give p(k(d)). -595d*2 Let j(b) = -237b*2 + 9b + 11. Let z(d) = -118d2 + 5d + 6. Let g(m) = -6j(m) + 11z(m). Let i(a) = -a*2. Give g(i(h)). 124h4 - h2 Let i(w) be the first derivative of w*2 - 6. Let c(r) = -4r*2. What is c(i(x))? -16x2 Let w(j) be the first derivative of -j2 - 8j2 + 11j*2 - 3j*2 + 2. Let g(r) = 6r*2. Give w(g(q)). -12q*2 Let t(w) = 2w*2. Let y(l) = -6l - 5l + 4l + 3l. Give t(y(v)). 32v*2 Let p(l) = 9l + 5l2 - 9l. Let a(w) = w - 1. Let q(i) = i - 2. Let o(b) = 4a(b) - 2q(b). Give p(o(f)). 20f2 Let o(s) = -s. Let f(z) = z + 14. What is f(o(m))? -m + 14 Let k(p) = -79p*2. Let s(x) = 6x. What is k(s(v))? -2844v2 Let x(a) = 203a - a*2 - 203a. Let g(m) = 2m. Determine g(x(h)). -2h*2 Let m(h) = h - 1. Let q(u) = u - 2. Let t(j) = -2m(j) + q(j). Let a(k) = 29k - 14k - 17k. Determine a(t(g)). 2g Let u(v) be the first derivative of -2v3/3 - 1. Let k(s) be the third derivative of -s5/30 - 18s*2. What is k(u(c))? -8c*4 Let a(g) = -g. Let f = 3 + -2. Let n(q) = 1 - q - f. Give n(a(m)). m Let l(j) = -4j + 3j - 3j. Let r(u) = -7u2 + 2u*2 + 3u*2. Give r(l(k)). -32k*2 Let w(m) = 0m2 - m2 + 2m2. Let n(l) = -l + 1. Let h(y) = 18y - 15. Let f(q) = h(q) + 15n(q). Calculate w(f(k)). 9k*2 Let f(m) = -m. Let r(s) = 247s - 39. Let o(w) = -13w + 2. Suppose 0 = -5h + 2h - 117. Let l(p) = ho(p) - 2r(p). Give l(f(c)). -13c Let o(p) = 4p2. Let k(s) be the second derivative of 0s*3 + 1/12s*4 + 1/2s*2 - 2s + 0. Let a(j) be the first derivative of k(j). Give o(a(l)). 16l2 Let c(k) = 2k - 3. Let b(n) = -4n + 5. Let o(s) = -3b(s) - 5c(s). Let g(y) = 29 - 142y + 130y - 29. Calculate o(g(j)). -24j Let w(y) = -3y. Let m(d) = 7d*2 + 2d + 2. Let l(c) = -48c2 - 15c - 15. Let u(g) = 4l(g) + 30m(g). Determine w(u(o)). -54o2 Let j(h) = 0 + 1 - 2. Let g(k) = k + 11. Let m(w) = -4g(w) - 44j(w). Let v(a) = -2a. Give v(m(c)). 8c Let p(v) = -2v2. Let w(r) be the third derivative of -r7/420 + r4/8 + r2. Let y(x) be the second derivative of w(x). Determine p(y(n)). -72n4 Let f(w) = 4w*2. Let n(z) = -10z + 3. Let v(b) = -9b + 2. Let y(c) = 2n(c) - 3v(c). Give y(f(d)). 28d2 Let j(v) = 8 + v + 2 - 9. Let z(x) = x2 + 9x + 9. Let p(a) = 36j(a) - 4z(a). Let l(k) = -2 + 2 + 2k*2. Give p(l(s)). -16s4 Let t(x) = x2. Let z(q) = -3q2. Let j(n) = -9t(n) - 2z(n). Let y(i) = 3i*2. Determine y(j(v)). 27v*4 Let f(d) = 2d - 1397. Let x(g) = -5g. What is x(f(u))? -10u + 6985 Let b(k) be the second derivative of 5k3/6 + k - 9. Let g(h) = 2h. Determine b(g(a)). 10a Let x(i) = 2i. Suppose 9 = 3u - y, 2u + 2y + 2 = -0u. Let k(f) = -3f2 + 3f*2 - uf*2 + 3f*2. Calculate x(k(g)). 2g*2 Let m = 2 + -2. Let z = m + 2. Let h(w) = -3w*2 + 0w2 + wz + 0w2. Let b(g) = g. Determine h(b(o)). -2o*2 Let o(x) = 10x*2. Let w(a) = 2a. Let t(r) = 6r. Let l = 6 + -1. Let f(n) = lt(n) - 16w(n). What is f(o(m))? -20m*2 Let n(t) = -1385t. Let m(g) = -2g2. Determine m(n(a)). -3836450a*2 Let a(o) = -5o. Let z(f) be the first derivative of f*4/8 + 3f*2/2 + 3. Let v(x) be the second derivative of z(x). Give a(v(t)). -15t Let n(d) = -3d2. Let g(x) = -3x*2 + 283x - 283x. What is g(n(j))? -27j*4 Let z(r) = -13r. Let n(w) be the third derivative of w*4/12 - 10w*2. Determine z(n(d)). -26d Let l(q) = 3q2. Let x(i) = 4i + 448. What is l(x(r))? 48r2 + 10752r + 602112 Let f(k) = 4k + 7. Let s(v) = 2v + 4. Let u(i) = -4f(i) + 7s(i). Let c(a) be the third derivative of a*5/6 - 4a*2. Give c(u(x)). 40x*2 Let x(d) = -4d*2. Let s(k) = -5k + 6. Let t(q) = -q + 1. Let a be 2 - ((-8)/4 - -3). Let p(b) = as(b) - 6t(b). Give x(p(z)). -4z2 Let j(f) be the third derivative of 0 - 1/30f*5 + 0f*4 - 3f*2 + 0f*3 + 0f. Let m(u) = -5 - 3u2 + 5. Give m(j(t)). -12t*4 Let c(z) = -5z. Let m(g) = g - 3g + 3g. What is m(c(p))? -5p Let k(y) = -6y. Let b(h) = 7h. Let v(l) = 5b(l) + 6k(l). Let a(q) = -6q*2 + 2. Let p(j) = -25j*2 + 9. Let n(m) = -9a(m) + 2p(m). What is v(n(d))? -4d*2 Let o(g) = g. Let z = -4 - -6. Suppose 5u - 3w = -0w, -2u + 5w = 0. Let c(b) = -3 + 3 + u + bz. Calculate o(c(a)). a2 Let i(b) = 10b. Let c(n) = n2 - 4n. What is i(c(s))? 10s2 - 40s Let y(j) = 8j. Let z(w) = -381w. Calculate y(z(m)). -3048m Let o(k) = -4k. Let t(c) = 2c. Let b(h) = -6o(h) - 11t(h). Let v(a) be the third derivative of a4/24 + 2a*2. Calculate v(b(d)). 2d Let v(g) = 4g. Let z be 22(-3)/(-12). Let q(i) be the first derivative of -5 + 3 + i2 + z + 0. What is v(q(j))? 8j Let t(f) = -f. Let s(w) = 11w2 - 1. Calculate t(s(g)). -11g*2 + 1 Let a(w) = 4w. Let n = -9 - -11. Let o(i) = -i*n - 5i + 5i. Calculate a(o(k)). -4k*2 Let k(b) = -3b. Suppose x = 3x + 2. Let m(a) = -4a*2 + 6a - 6. Let t(u) = -u*2 + u - 1. Let l(p) = xm(p) + 6t(p). What is k(l(r))? 6r*2 Let l(d) = 4d + 3. Let v(w) = -9w - 7. Let s(a) = 14l(a) + 6v(a). Suppose -y + 6 = 2y. Let o(t) = 2t - 2t - yt. Give s(o(z)). -4z Let q(a) = -25a2 - 11a + 11. Let f(r) = 5r2 + 2r - 2. Let j(l) = 11f(l) + 2q(l). Let i(s) = 1 - 2s2 - 1. What is j(i(g))? 20g*4 Let x(q) = -2q*2 - 14q. Let g(n) = -n*2. Give g(x(y)). -4y*4 - 56y*3 - 196y*2 Let a(t) = -2t. Let o(x) = 139x2. Determine o(a(n)). 556n*2 Let u(j) = 14j. Let a(q) = 2q - 15q + 8q + 7q. Determine u(a(t)). 28t Let v(x) = 4x*2. Let w(z) = 7z + 10. Give v(w(d)). 196d2 + 560d + 400 Let u(d) = d2. Let f(k) be the third derivative of k7/2520 - k*5/60 - 4k*2. Let n(g) be the third derivative of f(g). Determine n(u(v)). 2v*2 Let r(d) = 4d*2 + 3d. Let k(z) = 5z2. Determine r(k(c)). 100c*4 + 15c*2 Let m(w) = 2w. Let c = 16 + -10. Let o(y) = 0y + cy - 4y. What is o(m(b))? 4b Let x(u) = -4u2 - 17. Let l(d) = 2d. Determine x(l(j)). -16*j	{ "pile_set_name": "DM Mathematics" }
alculate prob of sequence xtx when three letters picked without replacement from {x: 4, w: 2, t: 1}. 2/35 Two letters picked without replacement from {q: 1, y: 1, c: 2, v: 1}. Give prob of sequence yc. 1/10 Two letters picked without replacement from {b: 1, j: 1, c: 5, i: 6, s: 1}. Give prob of sequence si. 3/91 What is prob of sequence mo when two letters picked without replacement from olqllgimllmm? 1/44 What is prob of sequence vvv when three letters picked without replacement from {v: 6}? 1 Two letters picked without replacement from hhuohhhohuuuho. Give prob of sequence ou. 6/91 Four letters picked without replacement from momhwoommmywmmwhmmwo. What is prob of sequence yoho? 1/4845 Two letters picked without replacement from lflkl. Give prob of sequence fk. 1/20 What is prob of sequence aaoo when four letters picked without replacement from {d: 4, a: 3, o: 7}? 3/286 Two letters picked without replacement from lrllrll. Give prob of sequence rr. 1/21 Calculate prob of sequence tyty when four letters picked without replacement from {b: 2, t: 5, y: 7}. 5/143 What is prob of sequence psq when three letters picked without replacement from {s: 2, q: 1, z: 3, p: 1, b: 3, o: 1}? 1/495 Calculate prob of sequence yyv when three letters picked without replacement from yvyvyvyvvyyvjyyyyj. 15/136 Calculate prob of sequence gx when two letters picked without replacement from bxxbxbbbxggxx. 1/13 Three letters picked without replacement from fhn. Give prob of sequence fhn. 1/6 Calculate prob of sequence jg when two letters picked without replacement from gggj. 1/4 What is prob of sequence too when three letters picked without replacement from {m: 1, l: 6, d: 1, o: 3, t: 4, r: 1}? 1/140 What is prob of sequence aa when two letters picked without replacement from hhhhahhhhhhahhhahah? 2/57 Three letters picked without replacement from {b: 10, o: 9}. What is prob of sequence obb? 45/323 Four letters picked without replacement from {m: 3, o: 10, x: 2}. Give prob of sequence omom. 3/182 Calculate prob of sequence fkai when four letters picked without replacement from {a: 7, k: 3, u: 1, f: 2, i: 4}. 1/340 What is prob of sequence lar when three letters picked without replacement from nnllnnnrarrtl? 3/572 Two letters picked without replacement from rlvlh. Give prob of sequence rh. 1/20 Calculate prob of sequence yy when two letters picked without replacement from yyyyysyxyyy. 36/55 Three letters picked without replacement from {p: 3, v: 2, w: 2, n: 5}. What is prob of sequence wpw? 1/220 What is prob of sequence www when three letters picked without replacement from rwwrw? 1/10 Three letters picked without replacement from {m: 3, z: 1, f: 4, j: 3}. What is prob of sequence zmj? 1/110 Two letters picked without replacement from {v: 1, z: 1, a: 2, k: 1}. Give prob of sequence zk. 1/20 Four letters picked without replacement from fffvfvvfsfif. What is prob of sequence vfif? 7/660 Two letters picked without replacement from tdesttesdsjne. What is prob of sequence nt? 1/52 Three letters picked without replacement from {k: 9, i: 3}. What is prob of sequence iik? 9/220 Four letters picked without replacement from {e: 5, p: 8, m: 2, r: 2}. Give prob of sequence mrpm. 1/1785 What is prob of sequence vii when three letters picked without replacement from {u: 2, s: 2, i: 3, g: 6, v: 6}? 2/323 Calculate prob of sequence xx when two letters picked without replacement from {x: 4, g: 7, y: 3}. 6/91 Four letters picked without replacement from gddngo. Give prob of sequence ndod. 1/180 What is prob of sequence eeff when four letters picked without replacement from fffee? 1/10 What is prob of sequence qqqd when four letters picked without replacement from sdggsdkkdkdsssssqkss? 0 Two letters picked without replacement from cocc. Give prob of sequence co. 1/4 Calculate prob of sequence vu when two letters picked without replacement from {t: 2, u: 4, v: 1}. 2/21 What is prob of sequence yy when two letters picked without replacement from {y: 2, m: 2, v: 6, f: 1, r: 3, a: 1}? 1/105 What is prob of sequence ixi when three letters picked without replacement from {d: 1, c: 2, x: 2, w: 3, i: 4}? 1/55 Calculate prob of sequence gg when two letters picked without replacement from bggbbbbbbbbgbbbbgbb. 2/57 Four letters picked without replacement from {k: 1, f: 2, r: 1, o: 1, h: 2}. What is prob of sequence koff? 1/420 What is prob of sequence dgee when four letters picked without replacement from {e: 2, g: 2, d: 1}? 1/30 Four letters picked without replacement from {d: 1, g: 4, m: 2}. What is prob of sequence gdgg? 1/35 Calculate prob of sequence psl when three letters picked without replacement from splplplppllplp. 1/52 Three letters picked without replacement from wwrrrrmrrmrrrr. Give prob of sequence mww. 1/546 Three letters picked without replacement from {p: 2, q: 1, y: 2, n: 1, i: 2, g: 1}. Give prob of sequence ygy. 1/252 Calculate prob of sequence uuu when three letters picked without replacement from {r: 3, u: 5}. 5/28 What is prob of sequence qqi when three letters picked without replacement from qiqiqziqqiiiiiqzi? 9/136 Calculate prob of sequence bbp when three letters picked without replacement from {p: 4, z: 8, b: 8}. 28/855 Three letters picked without replacement from tptppttppttppptpttpp. What is prob of sequence ptp? 11/76 Three letters picked without replacement from tkttl. What is prob of sequence klt? 1/20 Three letters picked without replacement from {g: 2, f: 2, r: 5, p: 2, l: 1, q: 1}. Give prob of sequence qrg. 5/858 What is prob of sequence pxpx when four letters picked without replacement from ppxpppxpxpxx? 7/99 What is prob of sequence iiii when four letters picked without replacement from {i: 5}? 1 Calculate prob of sequence liyf when four letters picked without replacement from {l: 4, f: 1, t: 4, y: 1, i: 2, g: 7}. 1/11628 Four letters picked without replacement from {y: 3, m: 2}. Give prob of sequence ymym. 1/10 Two letters picked without replacement from bgbbbgoggbgoggggbgub. What is prob of sequence go? 1/19 Two letters picked without replacement from btghhhhtbhlhrbhhbglh. Give prob of sequence tr. 1/190 Calculate prob of sequence hj when two letters picked without replacement from jkjjjkkhjjk. 3/55 What is prob of sequence etn when three letters picked without replacement from {t: 5, n: 3, f: 1, e: 7}? 1/32 Calculate prob of sequence wsss when four letters picked without replacement from cfssswcsf. 1/126 What is prob of sequence qy when two letters picked without replacement from {r: 1, y: 2, k: 1, q: 1}? 1/10 Calculate prob of sequence tk when two letters picked without replacement from {k: 5, t: 11}. 11/48 What is prob of sequence go when two letters picked without replacement from gggalooooaoovo? 3/26 Four letters picked without replacement from gggg. Give prob of sequence gggg. 1 What is prob of sequence rfa when three letters picked without replacement from {f: 2, r: 2, a: 4, p: 1}? 2/63 Two letters picked without replacement from llsillgappisl. What is prob of sequence pl? 5/78 Calculate prob of sequence nn when two letters picked without replacement from {m: 13, n: 6}. 5/57 Two letters picked without replacement from oronnnonnnnr. Give prob of sequence rr. 1/66 Two letters picked without replacement from emvevvmvm. What is prob of sequence em? 1/12 Two letters picked without replacement from bbjbjbbvxbbxvlbllwlj. What is prob of sequence wv? 1/190 Calculate prob of sequence ozp when three letters picked without replacement from {l: 2, o: 1, z: 1, p: 2, y: 8}. 1/1092 Three letters picked without replacement from kjjnnnjnhjjnnfjt. Give prob of sequence jjt. 1/112 Two letters picked without replacement from {z: 1, m: 5, v: 4, t: 1, p: 3}. Give prob of sequence zv. 2/91 What is prob of sequence nk when two letters picked without replacement from llhllknnl? 1/36 Three letters picked without replacement from {e: 8, y: 2, k: 4, w: 1}. Give prob of sequence ywy. 1/1365 What is prob of sequence roo when three letters picked without replacement from {h: 1, o: 4, i: 1, t: 2, s: 2, r: 5}? 2/91 Four letters picked without replacement from tuuvybw. Give prob of sequence yuvb. 1/420 Calculate prob of sequence hvhv when four letters picked without replacement fro	{ "pile_set_name": "DM Mathematics" }
st common divisor of 303 and 18? 3 Calculate the greatest common factor of 476 and 136. 68 Calculate the greatest common divisor of 28 and 12. 4 What is the greatest common divisor of 10105 and 470? 235 What is the highest common divisor of 1666 and 68? 34 Calculate the highest common divisor of 1 and 5501. 1 Calculate the highest common factor of 78 and 12. 6 Calculate the greatest common factor of 456 and 15162. 114 What is the greatest common divisor of 3 and 269? 1 What is the greatest common divisor of 171 and 2223? 171 What is the greatest common factor of 4 and 19? 1 What is the highest common divisor of 1628 and 484? 44 Calculate the highest common factor of 425 and 935. 85 Calculate the greatest common divisor of 323 and 57. 19 Calculate the highest common factor of 108 and 32. 4 Calculate the highest common divisor of 30 and 9. 3 What is the greatest common divisor of 14 and 42? 14 Calculate the greatest common divisor of 6084 and 48. 12 What is the greatest common divisor of 32 and 12? 4 Calculate the greatest common factor of 464 and 64. 16 Calculate the highest common divisor of 528 and 594. 66 What is the highest common divisor of 328 and 80? 8 What is the greatest common factor of 1017 and 791? 113 Calculate the highest common divisor of 60 and 450. 30 Calculate the highest common factor of 175 and 50. 25 What is the greatest common divisor of 435 and 5? 5 Calculate the greatest common factor of 4459 and 98. 49 Calculate the highest common factor of 11 and 5841. 11 What is the greatest common divisor of 12035 and 29? 29 Calculate the highest common factor of 77 and 35. 7 Calculate the highest common divisor of 4 and 2744. 4 What is the highest common factor of 3950 and 2686? 158 Calculate the highest common factor of 29 and 1421. 29 What is the greatest common factor of 12204 and 108? 108 What is the highest common divisor of 5738 and 38? 38 Calculate the highest common divisor of 1296 and 24. 24 What is the highest common factor of 640 and 170? 10 Calculate the greatest common divisor of 174 and 232. 58 Calculate the greatest common factor of 936 and 396. 36 Calculate the greatest common factor of 126 and 30. 6 Calculate the highest common divisor of 32 and 844. 4 Calculate the highest common factor of 79 and 2449. 79 Calculate the highest common divisor of 738 and 533. 41 Calculate the highest common divisor of 16 and 848. 16 What is the highest common factor of 112 and 35? 7 What is the highest common divisor of 148 and 17834? 74 Calculate the highest common factor of 155 and 45. 5 What is the highest common divisor of 9730 and 140? 70 Calculate the greatest common factor of 784 and 49. 49 What is the highest common divisor of 90 and 30? 30 Calculate the greatest common factor of 192 and 60. 12 What is the highest common factor of 88 and 374? 22 Calculate the greatest common factor of 1419 and 33. 33 What is the highest common divisor of 1456 and 224? 112 Calculate the greatest common divisor of 4828 and 68. 68 Calculate the highest common divisor of 2380 and 84. 28 What is the highest common factor of 782 and 68? 34 What is the highest common divisor of 32 and 5216? 32 Calculate the highest common factor of 100 and 4580. 20 What is the greatest common factor of 110 and 11? 11 What is the greatest common factor of 224 and 10784? 32 Calculate the highest common factor of 65 and 10. 5 Calculate the greatest common divisor of 8 and 676. 4 Calculate the highest common divisor of 7975 and 77. 11 Calculate the highest common divisor of 3 and 34. 1 What is the highest common divisor of 868 and 28? 28 What is the greatest common factor of 20 and 175? 5 What is the highest common factor of 637 and 49? 49 What is the greatest common factor of 266 and 114? 38 Calculate the greatest common factor of 264 and 165. 33 What is the greatest common divisor of 186 and 403? 31 What is the highest common factor of 126 and 651? 21 What is the greatest common divisor of 119 and 85? 17 Calculate the greatest common factor of 24 and 276. 12 Calculate the highest common factor of 30 and 6410. 10 Calculate the greatest common divisor of 173 and 9. 1 Calculate the greatest common divisor of 89 and 7031. 89 What is the greatest common factor of 364 and 2197? 13 What is the greatest common divisor of 616 and 198? 22 Calculate the highest common divisor of 110 and 70. 10 Calculate the highest common divisor of 5 and 415. 5 Calculate the highest common factor of 77 and 3157. 77 Calculate the highest common divisor of 2096 and 6026. 262 What is the greatest common divisor of 112 and 266? 14 Calculate the greatest common divisor of 54 and 1026. 54 What is the highest common factor of 91 and 143? 13 Calculate the greatest common divisor of 51 and 408. 51 Calculate the greatest common divisor of 38 and 22. 2 Calculate the highest common divisor of 400 and 27100. 100 What is the highest common divisor of 977 and 3? 1 Calculate the greatest common divisor of 48 and 309. 3 Calculate the highest common factor of 20016 and 288. 144 Calculate the greatest common divisor of 3 and 12471. 3 Calculate the greatest common factor of 15712 and 32. 32 What is the highest common factor of 1413 and 314? 157 Calculate the greatest common divisor of 127 and 2286. 127 What is the highest common factor of 17 and 1003? 17 Calculate the highest common factor of 44 and 20. 4 Calculate the highest common divisor of 1596 and 285. 57 What is the greatest common divisor of 35 and 1050? 35 What is the highest common divisor of 16089 and 93? 93 What is the greatest common divisor of 1883 and 21? 7 What is the greatest common factor of 330 and 1430? 110 What is the greatest common divisor of 350 and 90? 10 Calculate the highest common factor of 140 and 3535. 35 Calculate the highest common divisor of 972 and 432. 108 Calculate the highest common divisor of 62 and 5177. 31 Calculate the highest common factor of 116 and 3654. 58 What is the greatest common divisor of 33814 and 106? 106 What is the greatest common factor of 45 and 190? 5 What is the highest common divisor of 5825 and 75? 25 Calculate the highest common factor of 68 and 850. 34 Calculate the highest common divisor of 351 and 378. 27 What is the highest common factor of 21 and 91? 7 What is the highest common factor of 112 and 35? 7 Calculate the highest common divisor of 243 and 18. 9 Calculate the highest common divisor of 3034 and 74. 74 Calculate the highest common factor of 616 and 2310. 154 What is the highest common factor of 12 and 588? 12 What is the greatest common factor of 25 and 575? 25 Calculate the highest common factor of 396 and 22. 22 What is the highest common factor of 264 and 312? 24 Calculate the greatest common factor of 165 and 2640. 165 What is the greatest common factor of 536 and 8? 8 What is the greatest common factor of 13 and 4849? 13 Calculate the greatest common factor of 24 and 42. 6 Calculate the greatest common divisor of 10 and 1160. 10 Calculate the highest common factor of 33 and 9. 3 Calculate the greatest common divisor of 84 and 546. 42 Calculate the greatest common factor of 47 and 1269. 47 What is the highest common divisor of 40 and 340? 20 Calculate the highest common factor of 1708 and 336. 28 What is the greatest common factor of 11 and 110? 11 Calculate the greatest common factor of 39459 and 21. 21 Calculate the greatest common factor of 56 and 5528. 8 What is the greatest common factor of 936 and 26? 26 What is the greatest common factor of 418 and 342? 38 What is the highest common divisor of 510 and 30? 30 What is the greatest common divisor of 4356 and 1012? 44 What is the highest common factor of 1010 and 10? 10 Calculate the highest common divisor of 140 and 875. 35 Calculate the greatest common factor of 32 and 4. 4 What is the greatest common factor of 498 and 12? 6 What is the highest common divisor of 45 and 330? 15 Calculate the highest common divisor of 253 and 46. 23 What is the greatest common divisor of 14 and 1918? 14 Calculate the highest common divisor of 12 and 5176. 4 What is the highest common factor of 63 and 5571? 9 What is the highest common divisor of 17 and 2363? 17 What is the greatest common factor of 9 and 7767? 9 What is the greatest common facto	{ "pile_set_name": "DM Mathematics" }
2 - 9. Calculate 3d(q) + 8h(q). q3 - 2q2 + 6 Let s(w) = -w2 - w + 1. Let h(x) = -x*2 - x - 4. Determine -h(r) + 2s(r). -r2 - r + 6 Let u(f) = f3 + f. Let k = 1 - 10. Let z(a) = a*2 + 7a - 12. Let d be z(k). Let h(j) = -2j3 - 3j. Calculate du(r) + 2h(r). 2r3 Let z = -7 + 11. Let j = 28 + -31. Let m(q) = 4q*3 + 3q*2 + 3q - 3. Let x(h) = 5h3 + 4h*2 + 4h - 4. Calculate jx(y) + zm(y). y*3 Let j(u) = -22u*2 + 6u + 31. Let v(a) = -15a2 + 4a + 21. Let m(g) = 5j(g) - 7v(g). Let s(h) = -4h2 + 2h + 7. Give -5m(x) + 6s(x). x*2 + 2x + 2 Let m(p) = p + 1. Let f(o) = -6o - 2. Give f(t) + 5m(t). -t + 3 Let v(g) = -g3 - g2 - g + 1. Let t(z) = -8z3 - 3z*2 - 4z + 5. What is -t(r) + 5v(r)? 3r*3 - 2r2 - r Let w(a) = -a2 - 3a + 4. Let j(y) = y2 + 2y - 3. Calculate 4j(h) + 3w(h). h*2 - h Let n = -185 - -186. Let j(c) = -c + 4. Let w(p) = -p + 5. Let h(b) = 5j(b) - 4w(b). Let y(u) = -u - 1. Calculate ny(l) - 2h(l). l - 1 Let g(x) = x + 1. Let l(h) = -6h + 4. Calculate -4g(j) + l(j). -10j Let l(k) = -k - 1. Let n be l(-5). Suppose 4x = t - 6t - 29, 3x + nt = -23. Let u(w) = -w + 3. Let p(h) = -1. Give xu(c) - 3p(c). c Let n(r) = 5r2 + 5r + 11. Let k(i) = -3i2 - 3i - 7. Suppose 30 = 7y - 5. What is yn(q) + 8k(q)? q2 + q - 1 Let u(x) = 7x*2 + 9x + 2. Let s(v) = -4v2 - 5v - 1. Determine -5s(g) - 3u(g). -g*2 - 2g - 1 Let d(l) = -7. Let k(q) = q + 8. What is 3d(b) + 4k(b)? 4b + 11 Let d(t) = t2 - 13t + 7. Let o(x) = 4x - 2. Let w be (-3)/(-9) + 124/(-3). Let a = 19 + w. Let v = 15 + a. What is vo(k) - 2d(k)? -2k*2 - 2k Let c(h) = h*3 + 7h*2 + 8h + 9. Let n be c(-6). Let y(s) = 5s. Let z = -4 + 6. Let a(j) = j + zj + j. What is ny(u) + 4a(u)? u Let i(k) = -3k2 - 4k + 4. Let z(h) = 21h2 + 27h - 27. Suppose 4r + 116 - 10 = o, -5r + 2o = 131. Calculate ri(n) - 4z(n). -3n2 Let k(i) = i3 - 7i2 - 6i - 18. Let o(g) = g*2 + g + 1. Determine k(u) + 6o(u). u3 - u2 - 12 Let y(o) = o*2 + 5o. Let p(z) = z*2 + 4z. Give -5p(d) + 4y(d). -d*2 Let l(s) = 4s*2 + 9s - 9. Let o be (-1 + 0/2)18. Let g(c) = c2 + 2c - 2. Determine og(q) + 4l(q). -2q2 Let a(n) = -2n2 + n - 9. Let x(v) = -v2 + v - 9. Calculate -3a(z) + 4x(z). 2z2 + z - 9 Let p(r) = -9r + 4. Let k(w) = 8w - 3. What is 7k(a) + 6p(a)? 2a + 3 Let d(o) = o - 1. Let l = -130 + 112. Let c(h) = 8h - 10. What is ld(f) + 2c(f)? -2f - 2 Let c(h) = -11h3 + 9h2. Let i(q) = -q3 + q*2. Give 2c(d) - 18i(d). -4d*3 Let f = -18 + 19. Let k(j) = j - 1. Let p(u) = 2u*3 + 5u*2 + u. Let t(i) = -2i*3 - 6i*2 - 2i + 1. Let c(o) = 6p(o) + 5t(o). Give fc(b) + 5k(b). 2b3 + b Let k(f) = -8f + 7. Let x(t) = -16t + 15. Determine 13k(s) - 6x(s). -8s + 1 Let r(d) = -5 - 7 + 3d + 9. Let v(o) = 1. Calculate -r(c) - 3v(c). -3c Let f(r) = r. Let j(y) = 2y*2 + 2y + 1. Suppose 4q + 0t + 3 = 3t, -2q = 5t + 21. Calculate qf(b) + j(b). 2b2 - b + 1 Let o(u) = -4u*3 - 2u*2 - 4u + 2. Let l(p) = 4p3 + p2 + 3p - 2. Give 4l(j) + 3o(j). 4j3 - 2j*2 - 2 Let g(p) = -4p + 4. Let l be (-42)/(-9) + 4/(-6). Let k(i) = i + 1. Let c(f) = 3f + 4. Let m(w) = lc(w) - 14k(w). Let v be 16/93. Give vg(r) - 5m(r). 2r - 2 Let d(k) = 1 + 6 - 2 + 2k - k. Let j be 1/(-1) - (4 - 6). Let x(y) = 1. Let h(n) = 5. Let w(p) = jh(p) - 6x(p). Give 2d(g) + 9w(g). 2g + 1 Let p(o) = 3o2 - o. Let n(v) be the first derivative of -v4/4 - 8v3/3 + v2 + 23. Give 3n(r) + 8p(r). -3r3 - 2r Let o(i) = -i*3 + 5i*2 + 4i + 2. Let q(m) = 2m3 - 6m*2 - 5m - 2. Calculate 4o(u) + 3q(u). 2u3 + 2u*2 + u + 2 Let d(l) be the third derivative of -7l*5/30 + 7l4/12 - l3/2 + 2l2. Let k(u) = -9u*2 + 9u - 2. Calculate -5d(t) + 8k(t). -2t2 + 2t - 1 Let c(r) = -r + 3. Let a(g) = -g. Let b(y) = -2a(y) + c(y). Let i(l) = -4l - 11. Calculate 22b(s) + 6i(s). -2s Let w(n) = n. Let k(x) = x2 - 6x. Let f be 34(-3)/(-36). Calculate fk(u) + 6w(u). u*2 Let t(r) = 3r + 4. Let a be t(-3). Let s = 6 + -12. Let j(w) = -4w2 + 5w + 5. Let c(f) = 5f2 - 6f - 6. Determine ac(n) + sj(n). -n2 Let c(d) = -d3 + d2. Let k(g) be the third derivative of g6/24 - g*5/15 - 3g*2. What is -4c(h) - k(h)? -h3 Let l(z) = z3 + 2z2 + 7. Let n(p) = -p2 + 1. What is -l(g) - 2n(g)? -g*3 - 9 Let i = 2 - 5. Let y(c) = 16c*3 + 4c - 10. Let a(s) = -s - 5. Let t be a(5). Let o(j) = -5j - 5j*3 + 2j + 4j + 3 - 2j. Give iy(f) + to(f). 2f3 - 2f Let b(z) = 7z3 - 3z*2 + 3. Let q(w) = -7w*3 + 4w*2 - 4. What is -4b(f) - 3q(f)? -7f*3 Let r(l) = -5l*2 + 2l - 5. Let s(i) = i*2 - i + 1. Let y(n) = n. Let h(o) = s(o) + y(o). Let k = 4 - 10. Let g = k + 12. Calculate gh(m) + r(m). m*2 + 2m + 1 Let n(m) = 2m + 9. Let w(t) = 3t + 10. Determine 5n(q) - 4w(q). -2q + 5 Let s(g) = g2 + 5. Let k = -17 + 63. Let j(x) = -x2 - 9x - 10. Let l be j(-7). Suppose -k = la + 2. Let v(z) = -2z*2 - 12. Determine as(m) - 5v(m). -2m*2 Let h(k) = 5k. Let o(c) = 3c. Let r(y) = -13y. Let n(w) = -12o(w) - 3r(w). Give -5h(l) + 8n(l). -l Let h(g) be the second derivative of -1/3g3 + 0 + g2 + 1/12g*4 - 3g. Let n(l) = 4l2 - 9l + 9. Determine -9h(k) + 2n(k). -k*2 Let k(v) = 14v*2. Let u(c) = 13c*2. Give -6k(x) + 7u(x). 7x*2 Let j(y) = -14y + 9. Let g(p) = -7p + 4. Determine 5g(i) - 2j(i). -7i + 2 Let t(i) = -2i - 6. Let u = 176 + -172. Let a(j) = 5j + 17. What is ua(n) + 11t(n)? -2n + 2 Let m(a) = -21a + 7 + 21a - a2. Let d(q) = 4q2 + q2 - 4q2 + 5 - 2q*2. What is 7d(n) - 5m(n)? -2n2 Let i(x) be the third derivative of -x4/6 - x*3/6 - 4x*2. Let w(a) = 9a + 2. Give 14i(s) + 6w(s). -2s - 2 Let l(g) = g2 + 2g + 2. Let z(q) = -3q - 3. Give 3l(m) + 2z(m). 3m*2 Let w(q) = 56q*2 - 21. Let i(o) = -11o*2 + 4. Determine 21i(k) + 4w(k). -7k2 Let j(n) = -n2 - 2n - 5. Let b(r) = -r2. Give -3b(f) + j(f). 2f2 - 2f - 5 Let n(v) = 7. Let f(d) = -4. Let l(t) = 5f(t) + 3n(t). Let j(c) = c2 - 3 + 5 - 4. Give -j(q) - l(q). -q2 + 1 Let v(f) = 25f2 + 9f - 5. Let u(j) = 13j2 + 4j - 2. Determine 9u(i) - 4v(i). 17i2 + 2 Let x(i) be the second derivative of -i4/12 + i3/6 - i2 + 3i. Let a(d) = d - 1. Determine -2a(p) + 2x(p). -2p2 - 2 Let u(c) = 6c2 - c + 1. Let x(f) = -f2. Suppose -s - 2 = s. Let z be ((-8)/24)/(s/(-3)). What is zu(j) - 4x(j)? -2j2 + j - 1 Let h = 24 + -11. Let x(t) = -19t. Let w(g) = 9g. Determine hw(k) + 6x(k). 3k Let g(h) = -h. Let u(x) be the first derivative of -4x2 + x + 76. Let v = -22 + 36. Give vg(c) - 2u(c). 2c - 2 Let f(x) be the third derivative of -x4/24 + x3/6 + 49x2. Let k(q) = -4q + 4. Give -9f(g) + 2k(g). g - 1 Let m(u) be the first derivative of u*4 + 16u*3/3 - 8u2 + 8. Let v(q) = -q2 + q. What is -m(w) - 16v(w)? -4w3 Let y(t) = -t2 - 4t. Let d(a) = -3a*2 - 11a. Suppose 4s + n = 33, -3n + 10 = s - n. What is sy(b) - 3d(b)? b*2 + b Let h be (3 + -1 - -4)-1. Let o(w) = -1. Let u be (1/2)/((-2)/(-4)). Let d(l) = -2l - 6. What is ho(y) + ud(y)? -2y Let v(d) = -2d2 + 3d - 9. Let j(s) = -3s2 + 4s - 10. Determine 5j(a) - 6v(a). -3a2 + 2a + 4 Let p(y) = -13y - 5. Let f(a) = 27a + 11. Let u(z) = -4f(z) - 7p(z). Let i(q) = -6q - 3. Calculate -11i(s) + 4u(s). -2s - 3 Let b(i) = -8i2 + i + 2. Let f(t) = 16t*2 - 3t - 5. Determine 5b(r) + 2f(r). -8r2 - r Let c(i) = 551i + 87. Let f(r) = 25r + 4. What is -4c(w) + 87f(w)? -29w Let d(p) = -26p2 - 9p. Let n(c) = 13c2 + 5c. Determine -4d(l) - 7n(l). 13l2 + l Let q(j) be the second derivative of j4/12 + j3/6 + j2/2 - 40j + 1. Let l(y) = y*3 + 3y*2 + 4y + 7. Determine l(u) - 3q(u). u3 + u + 4 Let r(o) = 3o*2 + 1. Suppose 2c + 0c + 4j = 30, -5j = -25. Let h(k) = 2 + 8k2 + k - k2 + 0. Determine cr(g) - 2h(g). g*2 - 2g + 1 Let y(n) = -2n + 2. Let r(o) = 4o - 3. What is 2r(t) + 5y(t)? -2t + 4 Let y(h) = 2h*2 + 11h + 11. Let s(i) = -i*2 - 6i - 6. Let g = 29 - 18. Calculate gs(u) + 6y(u)	{ "pile_set_name": "DM Mathematics" }
inutes are there between 8:55 AM and 6:33 PM? 578 What is 92 minutes after 8:23 AM? 9:55 AM What is 669 minutes after 9:15 PM? 8:24 AM What is 293 minutes before 9:16 AM? 4:23 AM What is 596 minutes after 9:32 AM? 7:28 PM How many minutes are there between 4:07 AM and 10:19 AM? 372 What is 584 minutes after 10:25 AM? 8:09 PM What is 628 minutes before 5:29 PM? 7:01 AM What is 36 minutes before 2:23 AM? 1:47 AM How many minutes are there between 4:30 PM and 5:22 PM? 52 How many minutes are there between 8:15 PM and 6:42 AM? 627 What is 689 minutes before 9:14 AM? 9:45 PM What is 76 minutes before 5:06 AM? 3:50 AM What is 689 minutes after 2:08 PM? 1:37 AM How many minutes are there between 11:27 AM and 8:33 PM? 546 How many minutes are there between 5:07 PM and 3:32 AM? 625 How many minutes are there between 3:01 AM and 11:56 AM? 535 How many minutes are there between 8:03 AM and 1:34 PM? 331 What is 270 minutes after 1:15 AM? 5:45 AM How many minutes are there between 8:39 PM and 8:38 AM? 719 What is 153 minutes before 6:51 AM? 4:18 AM How many minutes are there between 11:03 AM and 11:55 AM? 52 What is 170 minutes after 1:39 PM? 4:29 PM How many minutes are there between 4:20 PM and 12:48 AM? 508 What is 327 minutes before 11:54 AM? 6:27 AM What is 353 minutes after 11:17 AM? 5:10 PM How many minutes are there between 1:56 PM and 4:18 PM? 142 How many minutes are there between 3:13 PM and 3:27 PM? 14 How many minutes are there between 5:45 PM and 4:09 AM? 624 What is 305 minutes before 1:07 AM? 8:02 PM How many minutes are there between 10:12 AM and 5:02 PM? 410 What is 11 minutes before 5:59 AM? 5:48 AM How many minutes are there between 9:53 PM and 2:05 AM? 252 What is 139 minutes after 5:25 PM? 7:44 PM What is 631 minutes after 7:10 PM? 5:41 AM What is 88 minutes after 4:42 AM? 6:10 AM What is 679 minutes after 8:12 AM? 7:31 PM How many minutes are there between 4:38 AM and 4:22 PM? 704 How many minutes are there between 9:33 AM and 9:04 PM? 691 How many minutes are there between 5:29 AM and 7:12 AM? 103 How many minutes are there between 7:42 AM and 11:46 AM? 244 How many minutes are there between 3:49 AM and 6:39 AM? 170 What is 482 minutes after 5:02 AM? 1:04 PM How many minutes are there between 4:32 AM and 9:59 AM? 327 How many minutes are there between 11:12 PM and 2:36 AM? 204 How many minutes are there between 7:48 PM and 2:48 AM? 420 How many minutes are there between 7:49 AM and 4:23 PM? 514 How many minutes are there between 9:02 PM and 4:54 AM? 472 How many minutes are there between 2:51 AM and 1:34 PM? 643 What is 159 minutes after 3:31 PM? 6:10 PM What is 467 minutes before 10:41 AM? 2:54 AM How many minutes are there between 2:57 PM and 10:22 PM? 445 What is 524 minutes before 7:37 AM? 10:53 PM What is 14 minutes before 8:47 PM? 8:33 PM How many minutes are there between 10:03 PM and 5:07 AM? 424 How many minutes are there between 6:47 PM and 2:25 AM? 458 How many minutes are there between 3:03 PM and 2:58 AM? 715 What is 166 minutes after 5:45 PM? 8:31 PM What is 315 minutes after 2:34 PM? 7:49 PM What is 505 minutes before 7:03 AM? 10:38 PM How many minutes are there between 2:24 PM and 10:29 PM? 485 What is 63 minutes before 9:09 AM? 8:06 AM What is 538 minutes after 8:37 PM? 5:35 AM How many minutes are there between 2:38 PM and 10:59 PM? 501 How many minutes are there between 5:38 AM and 5:07 PM? 689 What is 481 minutes after 7:55 PM? 3:56 AM What is 665 minutes after 2:57 PM? 2:02 AM How many minutes are there between 1:28 AM and 12:11 PM? 643 What is 313 minutes before 3:53 AM? 10:40 PM What is 387 minutes after 2:00 PM? 8:27 PM What is 39 minutes before 8:24 PM? 7:45 PM What is 564 minutes before 3:28 AM? 6:04 PM How many minutes are there between 12:59 PM and 1:03 PM? 4 How many minutes are there between 5:05 AM and 9:17 AM? 252 How many minutes are there between 2:59 PM and 9:25 PM? 386 How many minutes are there between 8:06 AM and 7:45 PM? 699 How many minutes are there between 6:23 PM and 6:09 AM? 706 How many minutes are there between 12:16 PM and 2:50 PM? 154 What is 11 minutes after 2:42 PM? 2:53 PM What is 132 minutes before 5:39 AM? 3:27 AM How many minutes are there between 12:37 PM and 7:31 PM? 414 What is 277 minutes after 4:21 PM? 8:58 PM What is 260 minutes before 1:53 PM? 9:33 AM What is 490 minutes before 9:08 PM? 12:58 PM How many minutes are there between 9:45 PM and 3:26 AM? 341 What is 507 minutes before 11:20 PM? 2:53 PM How many minutes are there between 4:25 PM and 11:15 PM? 410 How many minutes are there between 12:45 AM and 10:54 AM? 609 What is 664 minutes before 1:45 PM? 2:41 AM What is 289 minutes after 9:35 PM? 2:24 AM How many minutes are there between 4:05 PM and 6:29 PM? 144 How many minutes are there between 8:04 PM and 9:42 PM? 98 What is 663 minutes after 6:51 PM? 5:54 AM What is 103 minutes after 9:37 PM? 11:20 PM How many minutes are there between 1:59 PM and 4:54 PM? 175 What is 244 minutes after 8:25 PM? 12:29 AM How many minutes are there between 10:23 PM and 9:06 AM? 643 What is 682 minutes after 4:36 PM? 3:58 AM What is 238 minutes before 11:14 PM? 7:16 PM What is 250 minutes before 4:13 AM? 12:03 AM How many minutes are there between 4:41 AM and 4:27 PM? 706 What is 585 minutes before 5:14 PM? 7:29 AM What is 547 minutes after 7:01 AM? 4:08 PM How many minutes are there between 4:23 PM and 3:28 AM? 665 What is 680 minutes after 5:45 AM? 5:05 PM How many minutes are there between 8:48 AM and 1:58 PM? 310 How many minutes are there between 2:00 PM and 4:40 PM? 160 How many minutes are there between 7:10 AM and 12:47 PM? 337 What is 173 minutes after 9:18 PM? 12:11 AM What is 77 minutes after 5:47 PM? 7:04 PM What is 502 minutes after 1:49 AM? 10:11 AM What is 538 minutes before 2:46 PM? 5:48 AM What is 52 minutes before 5:37 AM? 4:45 AM What is 120 minutes after 4:23 PM? 6:23 PM How many minutes are there between 1:05 AM and 3:21 AM? 136 How many minutes are there between 2:12 PM and 12:42 AM? 630 What is 374 minutes after 5:24 AM? 11:38 AM What is 611 minutes before 3:22 PM? 5:11 AM What is 141 minutes after 8:39 AM? 11:00 AM What is 480 minutes after 9:43 PM? 5:43 AM What is 610 minutes before 6:59 PM? 8:49 AM What is 679 minutes after 7:34 AM? 6:53 PM How many minutes are there between 6:19 PM and 12:30 AM? 371 How many minutes are there between 3:51 PM and 12:43 AM? 532 How many minutes are there between 7:19 PM and 10:12 PM? 173 What is 681 minutes after 9:42 PM? 9:03 AM What is 77 minutes before 7:12 AM? 5:55 AM What is 111 minutes before 4:55 AM? 3:04 AM How many minutes are there between 7:34 AM and 7:38 AM? 4 What is 152 minutes before 4:56 PM? 2:24 PM How many minutes are there between 7:51 AM and 6:18 PM? 627 How many minutes are there between 3:02 PM and 3:08 PM? 6 What is 399 minutes before 3:12 PM? 8:33 AM How many minutes are there between 12:19 PM and 2:16 PM? 117 What is 710 minutes before 5:29 AM? 5:39 PM How many minutes are there between 12:57 AM and 4:21 AM? 204 How many minutes are there between 12:29 PM and 3:01 PM? 152 How many minutes are there between 6:14 PM and 12:39 AM? 385 How many minutes are there between 4:34 PM and 3:21 AM? 647 How many minutes are there between 8:42 PM and 8:11 AM? 689 How many minutes are there between 11:09 PM and 4:29 AM? 320 How many minutes are there between 1:01 PM and 6:45 PM? 344 What is 702 minutes before 1:47 AM? 2:05 PM What is 677 minutes after 7:11 PM? 6:28 AM What is 300 minutes before 12:17 AM? 7:17 PM How many minutes are there between 2:45 PM and 12:15 AM? 570 What is 231 minutes after 8:39 AM? 12:30 PM What is 647 minutes before 8:58 AM? 10:11 PM What is 539 minutes before 7:31 AM? 10:32 PM What is 670 minutes before 1:47 AM? 2:37 PM How many minutes are there between 5:30 AM and 10:00 AM? 270 What is 652 minutes before 1:17 PM? 2:25 AM What is 388 minutes after 8:19 AM? 2:47 PM What is 643 minutes after 7:37 PM? 6:20 AM How many minutes are there between 7:42 AM and 8:23 AM? 41 What is 246 minutes before 5:45 AM? 1:39 AM What is 345 minutes after 2:24 AM? 8:09 AM What is 35 minutes before 6:25 AM? 5:50 AM What is 459 minutes after 6:02 PM? 1:41 AM How many minutes are there between 7:44 AM and 11:57 A	{ "pile_set_name": "DM Mathematics" }
(c) x c Let q = -6 + 6.06. Suppose 0 = -4u - 16 + 12. Which is the third smallest value? (a) -4 (b) q (c) u b Let o = 2 - 2.3. Let v = -1.5 + 1. Which is the second smallest value? (a) v (b) 1 (c) o c Let m be 4/7263. Which is the second biggest value? (a) -0.06 (b) 0 (c) m (d) 0.1 d Suppose -2u = 2u - 56. Suppose 4t + 12 = -2d, -5d - u = -4t + 2. Which is the smallest value? (a) d (b) -5 (c) -1/2 b Suppose -47 = 2b - b. Let k = -140/3 - b. What is the third smallest value in 5, -2/15, k? 5 Let w = -0.9 + 6.9. Let k = -7 + w. Let l = 7 + -4. Which is the biggest value? (a) l (b) 1 (c) k a Let k = 0.17 - -1.23. Let r = k + -1.2. What is the biggest value in -3, r, 1? 1 Let c = -126 - -131. What is the fourth smallest value in 11, -1, c, 1? 11 Let t = -1.7 - -1. Let u = -1 + 0.7. Let v = t - u. What is the second smallest value in v, -5, -0.05? v Let b = 29.1 + -29. Let a = 1.1 - 0.1. What is the second smallest value in a, 0.2, b? 0.2 Let z = -8 - -7.9. Let v = -204/5 - -41. Which is the smallest value? (a) -5 (b) v (c) z a Let s be (2/14)/(20/14). Let h(y) = 5y - 5. Let b be h(2). What is the third biggest value in s, -2/5, b? -2/5 Suppose -9 - 7 = 4j. Let i be (6/18)/(2/j). What is the smallest value in i, -1, -0.2? -1 Let j = -0.3 + 0.8. Let h = -1/51 + 55/204. Which is the second biggest value? (a) j (b) h (c) 0.1 b Let f = 86 - 86. Which is the third smallest value? (a) -1/4 (b) f (c) 11 (d) 2/3 d Let d = 3 - 2. Let s = -5.5 + -0.5. Which is the smallest value? (a) s (b) d (c) 0.5 a Let g = 175 - 173.4. Which is the fourth biggest value? (a) 2/7 (b) -1/8 (c) g (d) 3 b Let p = -16 - -15.7. What is the fourth biggest value in 7, 1/4, -5, p? -5 Let h be (-6)/(-20)(1 + -3). Suppose -7 = 4l + u, 0u - 28 = l - 5u. Which is the smallest value? (a) l (b) h (c) 2 a Suppose -12 = -4f, 8o - 12 = 3o + f. Suppose 3t - 5s + 19 = 0, 0 = 4t - os - 0s + 18. Let i = 81/2 - 39. What is the second smallest value in 2, t, i? i Let p = 3 + -3.01. Let x = 72/203 + -2/29. Which is the smallest value? (a) p (b) x (c) -1 c Let m be (-1)/(-1)(11 + -6). Suppose -mb + 28 = -12. Suppose 7g - bg - 3 = 0. What is the third biggest value in g, 3, 0.2? g Let z = 6 - -1. Let m = z - 6.9. What is the third smallest value in 4, m, -0.2? 4 Let b = -13 - -15. Let r = -379/2717 - 3/209. What is the third smallest value in r, 1/3, b? b Suppose 0 = -5x + 5 + 5. Let d = -2.99 + 3. Let k = 2.99 + d. What is the biggest value in 1, x, k? k Let o = -197 + 176. What is the second biggest value in -2/3, -4, o? -4 Let j = -43641816690 + 1649966163829523/37807. Let x = j - -1/491. Let r = -64/11 + x. Which is the third smallest value? (a) -2/5 (b) 3 (c) r b Let i = 81 + -165/2. Which is the third biggest value? (a) i (b) 0.1 (c) -2 c Let l = 0.6 - 1.8. Let k = -3.2 - l. Let j = 5 - 4.6. Which is the third smallest value? (a) j (b) k (c) 0.1 a Let n = -92 - -88. Let i = 5 + -8. Which is the second biggest value? (a) n (b) i (c) 0.5 b Let w be ((-15)/20)/((-1)/36). Let z be 2(w/(-42))/(-9). Which is the third smallest value? (a) z (b) 0 (c) 1/5 c Let v = -18 - -15.4. Let u = 0.6 + v. Which is the biggest value? (a) -0.4 (b) u (c) 4 c Let g = 9 + -3. Let n = 23 + -34. Let s = n + g. Which is the biggest value? (a) s (b) 2 (c) 0 b Let q be ((-8)/(-6))/((-16)/24). Which is the second smallest value? (a) -1/3 (b) q (c) -0.06 a Let p = -14.5 + 15. What is the biggest value in p, -2/9, -0.1? p Let x = 37 - 38. What is the second biggest value in -3, 3, x? x Let z be ((-148)/(-36) - 4)2. What is the third smallest value in -3, 3/4, z? 3/4 Let f = -0.436 - -0.036. Which is the third biggest value? (a) 22 (b) -2 (c) f b Suppose -7 = -2d + n, 0n - 7 = 4d + 5n. Which is the second smallest value? (a) 5/9 (b) d (c) 1 c Suppose -3u = -15 - 33. Let q be (-12)/u1/3. Which is the biggest value? (a) q (b) -0.3 (c) 2 c Let f = 1 - 0. Which is the biggest value? (a) -2 (b) f (c) -0.3 b Let z = 0.01 + 0.39. Which is the biggest value? (a) -5 (b) 2 (c) z b Let n = -1/46 + -11/23. What is the third smallest value in -2, -1, n, 0.5? n Let z = -1.3 + 0.3. Let i = -33 - -31.8. Let c = i - z. What is the second smallest value in c, 0.2, -5? c Let l = 88 - 617/7. Let f = 2 - 4. Which is the second smallest value? (a) l (b) f (c) 2 a Let c = 12 + -14. What is the second smallest value in -0.5, -3, c? c Suppose 0 = -9q - 80 - 37. What is the third biggest value in -2, q, -0.3? q Let l = -0.8 + -2.2. Let h = 5.37 + -0.37. Let a = l + h. What is the second biggest value in -5/2, -5, a? -5/2 Let w = 7 + -7.1. Let r = w - -0.5. Which is the third smallest value? (a) r (b) 2 (c) 1 b Let f be 3/15-2 - -1. Let m(g) = 3g - 7. Let h be m(5). Suppose -2p - h = -0. What is the second biggest value in -0.4, p, f? -0.4 Let j = 0.3 + -0.2. Suppose -5w + 38 = -4l - 0l, 5w - 3l - 41 = 0. Let c be w/4(-36)/(-30). What is the third smallest value in -2/15, c, j? c Let f be 4/14 - 8/28. Suppose fu + 2u + 38 = 4d, 4u + 5d = -11. Let v be ((-2)/(-9))/((-6)/u). What is the third biggest value in 0.1, 3/4, v? 0.1 Let v = -12 - -11.3. Let k = 0.7 + v. Which is the biggest value? (a) -2 (b) k (c) 2/9 c Let t be (-12)/(-4) + 58/(-18). Let o = -1.7 + -7.3. Let p = 6 + o. Which is the second biggest value? (a) p (b) t (c) 0.5 b Let r(v) = -v + 7. Let k be r(5). Let u = -7 + 7.44. Let j = u + -0.04. What is the biggest value in j, 5, k? 5 Let h = -35 - -30. Let j(i) = -i*3. Let n be j(1). What is the smallest value in n, 0.5, h? h Let l = 2/13 + 9/13. Let t = l - 73/117. Which is the second biggest value? (a) 3 (b) -2/9 (c) t c Let b = 0.85 + -0.05. Let n = -0.2 - b. What is the third biggest value in n, 3/2, 0.1? n Let w be 52/40 - 3/2. Which is the biggest value? (a) w (b) 5 (c) 0.5 b Let z = -5.2 + 9.11. Let m = 0.09 + z. What is the third smallest value in 3/7, m, -5? m Let r = 2 + -5. Let p be (0 + 6/(-15))/33. Let l = p - -674/1155. What is the third smallest value in l, 0.3, r? l Let q be 580/(-28) + (-4)/14. Let w = q + 22. What is the second biggest value in 2/5, w, -2/13? 2/5 Let o = -57.06 - -61. Let l = 0.06 + o. Let z = -9/16 + 3/16. Which is the second smallest value? (a) l (b) -0.4 (c) z c Let v be (-4)/(-12) - (-2)/12. Which is the third smallest value? (a) v (b) -3 (c) -1/7 a Let p be 6/42/(-3). What is the biggest value in p, -4, -0.2? -0.2 Let o = -1243/5 - -247. What is the third biggest value in 5, 4, -3, o? o Let w = -8 - -16. Let j(u) = 0u + 6 + 4 - u. Let y be j(w). Which is the third smallest value? (a) 1/7 (b) y (c) 4 c Let u = -79 - -83. Let v = -3.1 + 3. What is the third smallest value in -4, u, v? u Let v = 758/7 + -108. Let x = -1 - -1. Suppose -a = -xa + 3, 3o = -3a. What is the third biggest value in v, o, 0? 0 Let h(n) = n*2. Let o be h(-1). Which is the smallest value? (a) o (b) 0 (c) -1/4 c Let i(w) = w + 5. Let r(s) = -4. Let y(b) = 4i(b) + 5r(b). Let v be y(1). What is the second smallest value in -3, v, -2/5? -2/5 Let k be (-3 + 1 - -3)/2. Let y = -0.8 + 1. Let l = 700/9 + -78. What is the third smallest value in l, y, k? k Let z = 0.1 + -0.1. Let t = 3 - 2.9. Which is the third biggest value? (a) t (b) z (c) -1/5 c Suppose 0 = 2d - h + 5, 3d + 6h - 9 = 2h. Let s = 165 - 496/3. What is the second biggest value in d, s, 2? s Let g be (12/(-14))/((-42)/(-28)). Which is the biggest value? (a) 0.2 (b) g (c) -2 a Let a = -10 + -1. What is the third biggest value in a, 5, -3? a Let m = -0.007 - 0.093. Which is the second smallest value? (a) 0.4 (b) m (c) 21 a Let i = -0.3 - -0.5. Let m = 3.6 + -3.5. Let q = 578/3 + -191. Which is the third biggest value? (a) i (b) m (c) q b Let c = -42 - -6. Let g be 0 - (-3)/c3. What is the third smallest value in -8, 0.2, g? 0.2 Let h be ((-2074)/45)/((-298)/(-3)). Let o = 2/745 - h. Let p = 19/105 - o. Which is the third biggest value? (a) 0.5 (b) p (c) -4 c Let f = 32/13 + -217/104. Let d = -7/8 + f. Which is the third smallest value? (a) 2/7 (b) -3 (c) d a Let v = -63.14 - -63. What is the third smallest value in -1, 1, v, -0.1? -0.1 Let v = -7 + 10. Let z be (-11)/(-6) + -1 + -1. Wh	{ "pile_set_name": "DM Mathematics" }
s picked without replacement from {o: 2, n: 1, m: 6, r: 4}. Give prob of sequence oor. 2/429 Three letters picked without replacement from {k: 5}. Give prob of sequence kkk. 1 Three letters picked without replacement from zzzqzzlzzzzzzzzz. What is prob of sequence qzz? 13/240 What is prob of sequence xx when two letters picked without replacement from uuuuxxuxuxuuuuxu? 1/12 What is prob of sequence wm when two letters picked without replacement from wmmwwwmmwwwwmwww? 11/48 Four letters picked without replacement from {f: 1, i: 1, t: 1, c: 2, v: 1, a: 2}. What is prob of sequence ciac? 1/420 Calculate prob of sequence wwk when three letters picked without replacement from {w: 3, k: 3}. 3/20 Three letters picked without replacement from {b: 1, u: 5, t: 6, z: 4}. Give prob of sequence utu. 1/28 Four letters picked without replacement from jjcdejcgdcjcejj. What is prob of sequence degc? 2/4095 Four letters picked without replacement from {r: 4, a: 2, h: 1, k: 2}. Give prob of sequence krrk. 1/126 Four letters picked without replacement from {q: 1, z: 2, j: 2, b: 1}. What is prob of sequence bjzz? 1/90 Three letters picked without replacement from {m: 5, k: 2, n: 4}. Give prob of sequence mmk. 4/99 What is prob of sequence sgv when three letters picked without replacement from sgvvm? 1/30 Two letters picked without replacement from pppg. What is prob of sequence pg? 1/4 Three letters picked without replacement from {g: 2, r: 4, t: 6}. Give prob of sequence tgg. 1/110 Four letters picked without replacement from odgooopdpd. What is prob of sequence dogo? 1/140 Calculate prob of sequence hhw when three letters picked without replacement from hhhwhhhwww. 1/6 Four letters picked without replacement from {g: 6, c: 6, u: 1, r: 1, t: 1, q: 1}. What is prob of sequence qrcu? 1/7280 Four letters picked without replacement from {h: 3, q: 1, l: 6, v: 9}. Give prob of sequence vvhq. 3/1292 Four letters picked without replacement from uuuuuxuuxuuuxxux. What is prob of sequence xuxu? 55/1092 What is prob of sequence axxa when four letters picked without replacement from {a: 2, x: 11}? 1/78 What is prob of sequence cclz when four letters picked without replacement from lkkkkkczrlkcrkz? 1/4095 Four letters picked without replacement from {i: 3, g: 2}. Give prob of sequence iigi. 1/10 What is prob of sequence jdjj when four letters picked without replacement from jjjdjd? 2/15 Three letters picked without replacement from pppfpfppffffpffpffp. Give prob of sequence fpp. 40/323 Two letters picked without replacement from aawjace. What is prob of sequence wa? 1/14 Three letters picked without replacement from mrrbrrmrrrrbrr. What is prob of sequence brr? 15/182 What is prob of sequence an when two letters picked without replacement from jnhoyaayyaooojj? 1/70 Two letters picked without replacement from hfsshzbyhbsfbz. Give prob of sequence fs. 3/91 Calculate prob of sequence zz when two letters picked without replacement from ezezee. 1/15 Calculate prob of sequence fwgf when four letters picked without replacement from cflfgfwfcllflfwgbw. 1/408 Calculate prob of sequence qxp when three letters picked without replacement from {p: 1, r: 2, q: 1, g: 1, x: 1, z: 2}. 1/336 Calculate prob of sequence xot when three letters picked without replacement from {t: 4, o: 2, c: 1, x: 6}. 4/143 Three letters picked without replacement from ipzzpziipiisii. Give prob of sequence ipp. 1/52 Four letters picked without replacement from npnqp. What is prob of sequence qpnn? 1/30 Three letters picked without replacement from {l: 2, s: 2, g: 11}. What is prob of sequence lsl? 2/1365 Four letters picked without replacement from deddededeediiiiidiii. What is prob of sequence eded? 7/969 What is prob of sequence gc when two letters picked without replacement from {k: 2, m: 1, c: 3, g: 3, o: 1, z: 5}? 3/70 Calculate prob of sequence wjfg when four letters picked without replacement from {c: 1, g: 2, w: 1, f: 4, j: 2}. 1/315 Four letters picked without replacement from {n: 8, u: 2}. What is prob of sequence nunn? 2/15 Calculate prob of sequence olf when three letters picked without replacement from {z: 1, l: 2, u: 1, f: 5, a: 5, o: 1}. 1/273 Three letters picked without replacement from {w: 4, i: 2}. Give prob of sequence www. 1/5 Two letters picked without replacement from iiiicciciiciii. What is prob of sequence cc? 6/91 Four letters picked without replacement from nrnnaarnrnrr. What is prob of sequence rnrn? 10/297 Calculate prob of sequence cccc when four letters picked without replacement from ucuuccccucuuccuc. 9/130 Two letters picked without replacement from {l: 8, e: 2}. What is prob of sequence ll? 28/45 Four letters picked without replacement from ncnnnnnnnnccnc. What is prob of sequence nncn? 120/1001 What is prob of sequence ee when two letters picked without replacement from {a: 2, e: 3, m: 4}? 1/12 Calculate prob of sequence ff when two letters picked without replacement from {f: 6, a: 3, k: 4}. 5/26 Calculate prob of sequence rr when two letters picked without replacement from rrrrr. 1 Two letters picked without replacement from {k: 4, e: 3, j: 6}. Give prob of sequence je. 3/26 Calculate prob of sequence tru when three letters picked without replacement from {q: 1, t: 1, a: 1, f: 1, u: 2, r: 1}. 1/105 Three letters picked without replacement from {x: 1, t: 1, v: 1, z: 1, p: 1}. Give prob of sequence pzt. 1/60 Two letters picked without replacement from yybmymsjmkymmy. Give prob of sequence jm. 5/182 What is prob of sequence ef when two letters picked without replacement from {e: 9, f: 3}? 9/44 Calculate prob of sequence ls when two letters picked without replacement from sblsblblblslsbbb. 1/12 Calculate prob of sequence iip when three letters picked without replacement from ipipppippiii. 3/22 Two letters picked without replacement from {a: 3, e: 5}. Give prob of sequence ae. 15/56 Four letters picked without replacement from {a: 3, p: 2, s: 15}. What is prob of sequence ssas? 91/1292 What is prob of sequence lllf when four letters picked without replacement from {f: 3, l: 7, w: 4, s: 1, g: 3}? 7/816 Three letters picked without replacement from {t: 1, v: 1, g: 3, m: 2, r: 5}. Give prob of sequence gmg. 1/110 Calculate prob of sequence wi when two letters picked without replacement from xwxixwnwuhxnxxu. 1/70 Two letters picked without replacement from {i: 1, f: 1, g: 2, j: 1}. What is prob of sequence jg? 1/10 Three letters picked without replacement from {t: 4, h: 1, s: 3}. What is prob of sequence sss? 1/56 Three letters picked without replacement from zpmpp. What is prob of sequence pzp? 1/10 Two letters picked without replacement from bibbpbi. Give prob of sequence bi. 4/21 What is prob of sequence eo when two letters picked without replacement from {m: 1, o: 2, a: 1, e: 1}? 1/10 Calculate prob of sequence dd when two letters picked without replacement from mmddddmdmddm. 7/22 Three letters picked without replacement from {l: 4, w: 3, f: 5, b: 4}. What is prob of sequence ffb? 1/42 What is prob of sequence jrir when four letters picked without replacement from {i: 1, r: 4, j: 6, p: 3}? 3/1001 Calculate prob of sequence xxix when four letters picked without replacement from {i: 3, x: 8}. 7/55 Three letters picked without replacement from vvvvvvv. What is prob of sequence vvv? 1 Four letters picked without replacement from {f: 10, b: 4}. Give prob of sequence bbbb. 1/1001 What is prob of sequence oaa when three letters picked without replacement from oaaa? 1/4 Two letters picked without replacement from {i: 1, c: 1, h: 2, w: 2}. Give prob of sequence wh. 2/15 Three letters picked without replacement from {n: 3, a: 6, o: 8}. Give prob of sequence naa. 3/136 Two letters picked without replacement from {u: 3, m: 4, p: 3, n: 3, g: 6}. Give prob of sequence gp. 1/19 Two letters picked without replacement from ixvxnvui. Give prob of sequence vn. 1/28 Two letters picked without replacement from wywwywnwn. Give prob of sequence ww. 5/18 What is prob of sequence hpx when three letters picked without replacement from phpppxx? 4/105 Four letters picked without replacement from {l: 4, z: 4, i: 7, y: 4, f: 1}. What is prob of sequence fzyy? 2/4845 Calculate prob of sequence zccc when four	{ "pile_set_name": "DM Mathematics" }
83 a prime number? True Is 191233517 prime? True Is 784368157 composite? False Is 1205015795 a prime number? False Is 10557492667 composite? False Is 22880818 prime? False Is 1967624041 composite? True Is 794225827 prime? True Is 780013781 a composite number? False Is 1337613689 a prime number? False Is 590655521 prime? True Is 2146545193 a composite number? True Is 4422577837 prime? False Is 8557375733 a prime number? True Is 6254676569 prime? True Is 170042029 composite? False Is 81495119273 a prime number? True Is 18093578543 prime? True Is 2751886513 a prime number? False Is 1366053263 composite? True Is 389294617 a prime number? True Is 36631499015 a prime number? False Is 12521783 composite? True Is 4971358177 a prime number? False Is 172517615513 composite? True Is 6921687826 a composite number? True Is 1369061231 composite? True Is 64742566121 a prime number? True Is 282019601 prime? False Is 164614393 composite? True Is 375159683 prime? False Is 5588432347 a composite number? False Is 58204068647 a composite number? False Is 1394499637 a prime number? False Is 93040349 a composite number? False Is 377975513 composite? True Is 13006626658 composite? True Is 3087532607 composite? True Is 23944195943 prime? True Is 3628962859 a composite number? False Is 10058363 a prime number? False Is 47794741 a prime number? True Is 10281911 a prime number? True Is 326641729 a composite number? False Is 413469439 a composite number? True Is 80268507413 composite? False Is 1826399753 prime? False Is 6172524901 prime? True Is 603236167 prime? True Is 18463139521 a composite number? False Is 119498017 composite? True Is 8284370849 prime? True Is 63617559 a composite number? True Is 1200804329 a prime number? False Is 1436748949 a composite number? False Is 5794501109 composite? True Is 40048598879 a composite number? False Is 117627157069 a composite number? False Is 25654804886 a prime number? False Is 104141249 composite? True Is 36260495897 composite? True Is 2427706313 a composite number? True Is 24192881477 a prime number? False Is 58519871 prime? True Is 643097329 a prime number? False Is 54151537 composite? True Is 3237877193 a composite number? False Is 2124852689 a prime number? True Is 4477630555 prime? False Is 10701705431 a composite number? False Is 3472967063 composite? False Is 10088303851 prime? True Is 5591280785 a prime number? False Is 642477595 composite? True Is 301776901 a prime number? False Is 7856057059 prime? False Is 67279894849 prime? True Is 391049991415 composite? True Is 625524157 a prime number? False Is 15569820571 a prime number? False Is 2558321749 composite? True Is 408521017 composite? False Is 2135542447 prime? False Is 1535949509 a composite number? True Is 119002992283 a prime number? False Is 27189901799 prime? False Is 4710060809 composite? True Is 100079081437 prime? False Is 10102799153 composite? True Is 74655886909 a prime number? True Is 2119525699 prime? True Is 452832641 prime? True Is 9038576059 composite? False Is 7608111523 a composite number? False Is 266813597 composite? False Is 282281223779 composite? False Is 30796877093 composite? False Is 17939963 composite? False Is 1023515023 a prime number? False Is 16551468137 a composite number? True Is 30457605289 a prime number? True Is 2695846781 a composite number? False Is 1417910447 composite? True Is 250436177 a prime number? True Is 17735967881 prime? True Is 438340607 prime? False Is 52080815767 prime? True Is 82009400581 a composite number? False Is 238552817 a prime number? True Is 116195984863 prime? False Is 292039423 a prime number? False Is 38856557057 a composite number? False Is 282544993 prime? True Is 29916685891 a prime number? False Is 6154922779 composite? True Is 1380920201 a composite number? False Is 2559997321 a prime number? False Is 23290844957 a composite number? True Is 30576203 a composite number? True Is 64748182649 prime? False Is 23397252863 a composite number? False Is 3485114377 a prime number? False Is 371143007 a composite number? False Is 6854260493 composite? False Is 7057805753 a composite number? True Is 15333492061 a prime number? False Is 6055833241 a composite number? True Is 5674834531 composite? True Is 56040950903 a composite number? True Is 4372480045 composite? True Is 511577371 prime? False Is 33083880763 prime? True Is 989461741 composite? True Is 5383244179 composite? True Is 303457499 a composite number? True Is 401995627 a composite number? True Is 131945915 a composite number? True Is 429508397 composite? False Is 1244313647 a prime number? True Is 111268429 prime? True Is 21712099 prime? True Is 23143326509 a composite number? False Is 95124157 a composite number? False Is 121160700571 a prime number? False Is 4572500707 prime? False Is 1392195019 composite? False Is 13279887287 a composite number? True Is 6290248571 a prime number? False Is 11959785637 a prime number? True Is 31988863601 composite? True Is 39013681178 a prime number? False Is 17326301 composite? False Is 10489303987 prime? False Is 3565067323 composite? True Is 72363646813 a prime number? True Is 32979369029 composite? False Is 521663333 composite? True Is 16527369563 a composite number? True Is 946344599 composite? True Is 7505891377 prime? True Is 911405527 prime? True Is 8863607933 a composite number? False Is 4762387235 a prime number? False Is 16435091867 prime? True Is 27350418301 prime? True Is 18075775093 a prime number? False Is 3882331711 composite? True Is 19343961753 a composite number? True Is 18131928457 a prime number? True Is 1861632701 composite? False Is 126399050051 a composite number? False Is 2182456918 prime? False Is 7883022319 a prime number? False Is 54699923 a prime number? True Is 461949463 prime? True Is 5649623981 a prime number? True Is 1554739673 a composite number? True Is 3798191899 a prime number? True Is 36189280649 a prime number? True Is 483659131 composite? True Is 230871013 prime? True Is 4225181 a prime number? False Is 112939121683 prime? True Is 8767021171 a prime number? True Is 28422088269 a composite number? True Is 123432634433 a composite number? False Is 374820151 prime? False Is 8751985054 composite? True Is 20639184551 a prime number? False Is 308370883 a composite number? False Is 106489641317 prime? False Is 7236767183 a prime number? True Is 6303404119 prime? True Is 2609869789 composite? True Is 675444403 prime? False Is 330593507 composite? False Is 171347805137 a composite number? True Is 26241045637 composite? False Is 3794153197 a prime number? False Is 14348316133 composite? True Is 46332697111 a composite number? True Is 793146511 composite? True Is 519040859 a prime number? False Is 31507442683 prime? False Is 12874512179 composite? True Is 403742653 a prime number? True Is 1452593477 a prime number? True Is 183299512831 prime? False Is 356310671 prime? True Is 2366708713 a prime number? False Is 836622373 a composite number? False Is 5700521647 a composite number? False Is 10293024589 a composite number? False Is 2422949777 composite? False Is 8784148439 composite? True Is 146600939 a composite number? False Is 117517708037 prime? True Is 31266215443 a composite number? False Is 15872493061 a composite number? True Is 9181484801 composite? False Is 4137745511 a composite number? False Is 4619280119 composite? True Is 2083357205 a composite number? True Is 5979943607 prime? False Is 1092894029 composite? True Is 114060858359 composite? True Is 3853095949 composite? True Is 541968883 a composite number? False Is 171378705307 a prime number? False Is 28870175749 prime? True Is 9417582883 composite? True Is 277374095 a composite number? True Is 1390505539 a prime number? False Is 14373954943 prime? True Is 108144012533 prime? True Is 2096237281 composite? False Is 155390153 a composite number? True Is 7091739779 a prime number? False Is 96471539 composite? False Is 970840547 a prime number? False Is 1380010111 composite? True Is 5362808263 prime? False Is 28516353919 composite? True Is 47296343 composite? False Is 1130499313 a prime number? False Is 44253414587 composite? False Is 81102442237 composite? False Is 4620325081 a composite number? False Is 12946094463 composit	{ "pile_set_name": "DM Mathematics" }
sequence uuw when three letters picked without replacement from jwjwwjnjjxwuwj? 0 Four letters picked without replacement from {g: 1, n: 1, u: 1, o: 1, m: 1}. What is prob of sequence uoou? 0 What is prob of sequence vkk when three letters picked without replacement from kkkkkvkkkvkvkk? 55/364 Calculate prob of sequence hq when two letters picked without replacement from {h: 1, q: 1, r: 2}. 1/12 Three letters picked without replacement from {l: 4, y: 3}. What is prob of sequence lly? 6/35 What is prob of sequence yp when two letters picked without replacement from {e: 3, p: 1, n: 1, y: 4, f: 2}? 2/55 Two letters picked without replacement from {i: 2, o: 4, n: 1}. What is prob of sequence oi? 4/21 Four letters picked without replacement from {b: 12, u: 2, f: 1, a: 4}. Give prob of sequence afuu. 1/11628 Three letters picked without replacement from xxxyyxxxxxxxxxyxxx. Give prob of sequence xyy. 5/272 What is prob of sequence igiq when four letters picked without replacement from {i: 2, s: 1, g: 1, e: 1, w: 1, q: 1}? 1/420 Four letters picked without replacement from {y: 4, h: 1, r: 2}. Give prob of sequence yhhh. 0 Calculate prob of sequence jtt when three letters picked without replacement from {j: 2, t: 2}. 1/6 Calculate prob of sequence jpj when three letters picked without replacement from {j: 9, p: 3}. 9/55 Calculate prob of sequence ynhh when four letters picked without replacement from {h: 3, n: 1, p: 3, y: 3, l: 2, v: 1}. 3/2860 Calculate prob of sequence jbzb when four letters picked without replacement from zbzbzzbzbzbjj. 2/143 Calculate prob of sequence lc when two letters picked without replacement from {l: 5, c: 2}. 5/21 Two letters picked without replacement from {n: 6, h: 9, k: 4}. What is prob of sequence hn? 3/19 Four letters picked without replacement from {g: 2, d: 1, p: 4, w: 2, r: 1}. What is prob of sequence prgw? 1/315 Four letters picked without replacement from {g: 1, q: 3, z: 2, h: 1, f: 3, y: 5}. What is prob of sequence zgzf? 1/5460 Calculate prob of sequence dun when three letters picked without replacement from ntuntdutdttt. 1/165 Calculate prob of sequence vqr when three letters picked without replacement from xvvrqrxp. 1/84 Four letters picked without replacement from cncnp. Give prob of sequence pcnc. 1/30 Two letters picked without replacement from eseegeks. What is prob of sequence ss? 1/28 Calculate prob of sequence isf when three letters picked without replacement from {s: 1, f: 1, i: 1, x: 2}. 1/60 Calculate prob of sequence vjvv when four letters picked without replacement from {j: 3, v: 9}. 7/55 Three letters picked without replacement from irrrirrfcrvfcrr. What is prob of sequence vii? 1/1365 Four letters picked without replacement from {r: 1, s: 1, f: 1, d: 1, l: 2, b: 1}. What is prob of sequence sdfr? 1/840 What is prob of sequence gwg when three letters picked without replacement from yddgyjujwdjw? 0 Calculate prob of sequence fdpp when four letters picked without replacement from npindnffnnddpn. 1/2002 What is prob of sequence yggh when four letters picked without replacement from gghhygggy? 5/189 Two letters picked without replacement from rrorrrorrrrror. Give prob of sequence ro. 33/182 What is prob of sequence bbbb when four letters picked without replacement from bbbbbbbbmbbmbmbbbmmb? 91/323 Calculate prob of sequence dn when two letters picked without replacement from ddnddedrd. 1/12 What is prob of sequence wu when two letters picked without replacement from jwpwu? 1/10 Four letters picked without replacement from {w: 7, x: 4, r: 3}. Give prob of sequence wxrx. 3/286 What is prob of sequence ypg when three letters picked without replacement from phgigwwgwggwiigy? 1/560 What is prob of sequence hhh when three letters picked without replacement from {d: 2, q: 4, h: 3}? 1/84 Four letters picked without replacement from {i: 6, e: 2, h: 1, s: 2}. What is prob of sequence iiii? 1/22 What is prob of sequence yyy when three letters picked without replacement from ymmyymmmmyymmm? 5/182 Calculate prob of sequence pssn when four letters picked without replacement from nssnnpnpnspnpsnsnsn. 15/1292 Two letters picked without replacement from eoeeeooeeo. Give prob of sequence oo. 2/15 Two letters picked without replacement from vbbuvuuvuvvuu. What is prob of sequence uu? 5/26 Four letters picked without replacement from ssyyss. Give prob of sequence ysys. 1/15 Calculate prob of sequence fjj when three letters picked without replacement from {f: 9, t: 1, z: 1, j: 2}. 3/286 Calculate prob of sequence dkqd when four letters picked without replacement from {k: 8, q: 1, d: 8}. 2/255 Calculate prob of sequence zdz when three letters picked without replacement from {b: 1, d: 7, i: 4, a: 4, z: 2}. 7/2448 What is prob of sequence zqq when three letters picked without replacement from {l: 2, i: 1, z: 3, q: 4}? 1/20 Three letters picked without replacement from {v: 3, s: 2, t: 1, e: 1, l: 2, y: 3}. Give prob of sequence lvt. 1/220 Calculate prob of sequence hk when two letters picked without replacement from {k: 2, u: 1, h: 2}. 1/5 Two letters picked without replacement from nttttnnntttttttntt. Give prob of sequence tt. 26/51 Two letters picked without replacement from {e: 8, s: 2}. Give prob of sequence ss. 1/45 Calculate prob of sequence zk when two letters picked without replacement from {k: 1, z: 3, q: 1}. 3/20 What is prob of sequence dn when two letters picked without replacement from dddddnddddddddddddd? 1/19 Four letters picked without replacement from yppydyytypmtdypoy. What is prob of sequence yopp? 1/680 What is prob of sequence zzzg when four letters picked without replacement from {g: 3, z: 9}? 7/55 Calculate prob of sequence ovn when three letters picked without replacement from {n: 2, o: 7, v: 2}. 14/495 Four letters picked without replacement from {j: 2, u: 9, v: 4, n: 1}. What is prob of sequence vujv? 9/1820 Four letters picked without replacement from gdggtdddddgnddnddnnn. Give prob of sequence tddg. 1/323 Two letters picked without replacement from {d: 4, n: 4, k: 1, m: 1, y: 1}. Give prob of sequence kn. 2/55 Calculate prob of sequence dd when two letters picked without replacement from {t: 3, d: 3}. 1/5 Calculate prob of sequence wz when two letters picked without replacement from {w: 1, p: 2, z: 5, s: 2, t: 1, x: 2}. 5/156 Calculate prob of sequence wth when three letters picked without replacement from {q: 1, t: 1, z: 4, w: 3, h: 4}. 1/143 Three letters picked without replacement from {a: 1, y: 1, w: 1}. What is prob of sequence wwy? 0 Four letters picked without replacement from lzzzzzlzzlzzzzz. Give prob of sequence zlzl. 11/455 Four letters picked without replacement from gyjjjyyyy. What is prob of sequence jgjy? 5/504 Three letters picked without replacement from dfddffdfddd. What is prob of sequence ffd? 14/165 Three letters picked without replacement from qqqqlkqlqsslqqqqqsqq. Give prob of sequence ksq. 13/2280 Calculate prob of sequence ymsy when four letters picked without replacement from {m: 1, s: 1, y: 13}. 1/210 Three letters picked without replacement from saksx. Give prob of sequence sks. 1/30 Calculate prob of sequence xz when two letters picked without replacement from zxhjp. 1/20 Two letters picked without replacement from {w: 1, m: 4, x: 3}. What is prob of sequence mm? 3/14 Calculate prob of sequence jv when two letters picked without replacement from nbnbbnnjvnjnbj. 3/182 Two letters picked without replacement from {q: 6}. Give prob of sequence qq. 1 Calculate prob of sequence rdfr when four letters picked without replacement from {o: 2, f: 4, i: 1, d: 3, r: 4, k: 3}. 3/1190 Four letters picked without replacement from rddddqddrdrq. Give prob of sequence qdrd. 7/330 Two letters picked without replacement from {o: 4}. Give prob of sequence oo. 1 Calculate prob of sequence wt when two letters picked without replacement from {r: 3, z: 1, g: 6, w: 6, p: 1, t: 1}. 1/51 Two letters picked without replacement from lfpzplzplffkpppkppk. Give prob of sequence fk. 1/38 What is prob of sequence non when three letters picked without replacement from poppnnp? 1/105 What is prob of sequence dydb when four letters picked without replacement from bydb? 0 Four letters picked without rep	{ "pile_set_name": "DM Mathematics" }
(4/9) assuming k is positive. k(613/45) Simplify (t4/t(2/9))(-1/12) assuming t is positive. t(-17/54) Simplify g(-23)(gg*(-14)g)/g assuming g is positive. g(-36) Simplify ((b/((b/(((b8b)/b)/b))/b)b)/b)/(b/(b/((b*21b)/b))b) assuming b is positive. b(-14) Simplify i(-8)i/(i/(i/(iii((i(1/3)ii)/i)/i)))(i/(i/i*(1/3)))/iiii(-7)/i assuming i is positive. i(-17) Simplify (b*(-1/8)bb)/b(1/11) assuming b is positive. b(157/88) Simplify d(9/8)/(d(-31/2)dd) assuming d is positive. d(117/8) Simplify n(-6/17)/(nn/(n/(n/n*13)n)) assuming n is positive. n*(198/17) Simplify (cc/(c/c(-4)))/c6c/(c(-2/5)/c)c/c*(-5)c assuming c is positive. c(2/5) Simplify (f8)(5/8) assuming f is positive. f5 Simplify ((g/g(-3))/g(-3))(-5) assuming g is positive. g(-35) Simplify b*(-2/31)/(bb(bb/b*(3/13)b)/b)(bb1)(2/55) assuming b is positive. b(-83363/22165) Simplify (o(-6/7)o(oo(1/6))/o)/(o0)40 assuming o is positive. o(13/42) Simplify (u(-15)/uu)/uuu*(4/5)/uuu assuming u is positive. u(-66/5) Simplify (dd2)/d(-1/13) assuming d is positive. d(40/13) Simplify a(2/11)/aaa*17a assuming a is positive. a(200/11) Simplify a(4/5)(aaa9)/aa assuming a is positive. a*(59/5) Simplify (h(hh/(h/h(3/4))h)/h)/h15 assuming h is positive. h(-49/4) Simplify (u/((u*(4/3)/u)/u)u(-9))(-2/45) assuming u is positive. u(44/135) Simplify ((r(-5)/r)/r)/r(-1/6) assuming r is positive. r(-41/6) Simplify (y*0y)*15((yy(-1))/y)(3/20) assuming y is positive. y(297/20) Simplify vv*(26/5)v(2/35)/v assuming v is positive. v(184/35) Simplify (k(-5/6))38 assuming k is positive. k(-95/3) Simplify f(-2/11)f(2/5)((f(-1)/f)/f)(-2/21) assuming f is positive. f(194/385) Simplify (b4/b13)(4/11) assuming b is positive. b(-36/11) Simplify q(13/5)q/q20 assuming q is positive. q(-82/5) Simplify (a(-3)a(-1/7))(3/5) assuming a is positive. a(-66/35) Simplify (d(-2)/d)(-8/7)/(d(9/4)d6) assuming d is positive. d(-135/28) Simplify ((y(-1/2)/y)(2/29))50 assuming y is positive. y(-150/29) Simplify (o/((o/o(2/9)oo)/o))/((ooo12oo)/o) assuming o is positive. o(-142/9) Simplify ((g(-4/3)/g)/(ggg/(g(1/3)g)))5 assuming g is positive. g(-20) Simplify (i/i*(1/9)i(-7))(7/8) assuming i is positive. i*(-385/72) Simplify ((a/(aa*(-1/2)/aa))(22/9))(-6/29) assuming a is positive. a(-22/87) Simplify ((t/(t/(t(-4/7)t)tt))/tt*2/t)/((t/(ttt/(tt/(((tt(-4/3))/t)/t))t))/t(2/3)) assuming t is positive. t(-47/21) Simplify (vv(-2/7))30/(vv*1v(-2)) assuming v is positive. v(150/7) Simplify (w/w(2/17))20 assuming w is positive. w(300/17) Simplify q(-1/35)q/(qq/q(-5/6)) assuming q is positive. q(-391/210) Simplify (((jj(-5))/jj)/j(-3))12 assuming j is positive. j(-12) Simplify (u0uu)(5/2) assuming u is positive. u5 Simplify v/(v*(-1/15)vvv)vvvv(1/4) assuming v is positive. v(79/60) Simplify pp/((p/(p(-3/4)/p))/p)p(-15) assuming p is positive. p(-59/4) Simplify ((h((h(hh/h(-5/2)h)/h)/h)/hhh)/h)/h(3/14) assuming h is positive. h(37/7) Simplify k*(5/6)k(1/2) assuming k is positive. k(4/3) Simplify ((n(n/(n/(n/n10)n)n)/n)/(n(n(-2/19)/n)/n))/(n(-2/3)/(((nn/(n/n(-4/7)))/n)/nn)) assuming n is positive. n(-3112/399) Simplify (w/(((w6w)/ww)/www))/ww(2/9) assuming w is positive. w(-70/9) Simplify o(5/4)/(((oo(-1/10))/o)/o) assuming o is positive. o(47/20) Simplify g*27g/(g/g(-6)) assuming g is positive. g21 Simplify (g*(-3/7)/ggg/g(-2/5)g)(-4) assuming g is positive. g(-276/35) Simplify (xx(-6/7)xx)46 assuming x is positive. x(690/7) Simplify (yy/(((yy(2/5))/y)/y))(-11)y*6/yy(-4) assuming y is positive. y(-138/5) Simplify ((b/((b*(-17)b)/bbb))/(b/b*9b))(-47) assuming b is positive. b(-1081) Simplify (s(-1/27))(-6/31) assuming s is positive. s*(2/279) Simplify (xx(4/3))/x(2/49) assuming x is positive. x(337/147) Simplify (u6u)/u7uu/(u/(uu*(-5)))u(3/5) assuming u is positive. u(-12/5) Simplify (n/(((n/((n/n*21)/n)nn)/n)/n))/(n((n*(-44)n)/n)/n) assuming n is positive. n23 Simplify (q(-9)/(q/(qqq(-5/3))))/((q(-2/7)q)/q)(-1/24) assuming q is positive. q(-271/28) Simplify ((b/b(-1)b)/b)*(-5/6)(b(1/4))(-12/5) assuming b is positive. b*(-34/15) Simplify ss/(sss/(s/(s/s*(1/4)))s)sss(1/3)/s assuming s is positive. s(-5/12) Simplify (v(-2))(-13/3)/((v(-3)/vv)/(vv((vv(-3))/vv)/vvvv)) assuming v is positive. v(41/3) Simplify ((nn(2/13)/n)/(n1n))(-1/26) assuming n is positive. n(12/169) Simplify (q(-1))15q/q*(7/6)(q/(q/(qq3))q)/q assuming q is positive. q*(-67/6) Simplify (l/(ll1))(-2/49)/(l/((lll*(-1))/l)l)(2/13) assuming l is positive. l(-170/637) Simplify (c/c*(2/29))/(cc*7c) assuming c is positive. c(-234/29) Simplify z(-3/7)/(z/(z(zz*(-5))/z))(zzz*(3/8)z)/(zz/(z/z(1/8))) assuming z is positive. z(-89/28) Simplify (i/i(-11))(-49) assuming i is positive. i(-588) Simplify v/((v/v(-22/7))/v)vv/v(24/11)v assuming v is positive. v(-102/77) Simplify u(-2/5)uu*(4/11)uu(-3)(uu(-1/12))/u assuming u is positive. u(-739/660) Simplify (i0i)*(-4/35)i(1/6)/i(1/4) assuming i is positive. i(-83/420) Simplify (b7/b(-5/4))/((b(-4)/b)/b(-1/2)) assuming b is positive. b(51/4) Simplify m*(-14)/mm/((mmm(1/20))/m) assuming m is positive. m(-301/20) Simplify a*(-36/11)a(-4/35) assuming a is positive. a(-1304/385) Simplify d12/d(-13) assuming d is positive. d25 Simplify c(-2/9)c/c15 assuming c is positive. c(-128/9) Simplify ((ww/(w/(w/(ww(-10))))ww)/w)/(w(-28)ww) assuming w is positive. w38 Simplify ((w/(w/(w1www)w))(1/51))42 assuming w is positive. w(42/17) Simplify (s(1/12)/s(-1))/((s/s(1/4))/(ss*(-7)s)) assuming s is positive. s(-14/3) Simplify (f4/f)/(f(2/29)/f) assuming f is positive. f(114/29) Simplify ((t/((tt2)/tt))(-29))(3/19) assuming t is positive. t*(174/19) Simplify (jj*(-1)j)/jj(-12) assuming j is positive. j(-12) Simplify d(-8/3)d/(d/(d*28d)) assuming d is positive. d(79/3) Simplify (c(2/17)cc/(c(-2)/c))(-1) assuming c is positive. c(-87/17) Simplify (y(-3)yy(1/10))6 assuming y is positive. y(-57/5) Simplify (j(-2)j)(-4/7)((j*(2/19)j)/j)/(jj(-5)) assuming j is positive. j(622/133) Simplify (j(-1))44/((j((jj(-1))/j)/jj)/jj)(-1/20) assuming j is positive. j(-44) Simplify (pp*(-15)ppp(-1))(-2/23) assuming p is positive. p(26/23) Simplify (((h/(h/(h/((h8h)/hh)h)))/h)/h(-1/8))/(hh(-1/2))(1/17) assuming h is positive. h(-1075/136) Simplify (m/(m/m19))/(mm(6/7)) assuming m is positive. m(120/7) Simplify h2hh(-4)h assuming h is positive. 1 Simplify c*(1/3)c(-6/7) assuming c is positive. c(-11/21) Simplify w*(-40)ww(16/5) assuming w is positive. w(-179/5) Simplify ((mm(7/2))/(m/(m(-6)/m)))/(m7/(m(-2/5)m)) assuming m is positive. m(-99/10) Simplify ((d/(d/((d/d3)/d))d)/dd/d0)(-34) assuming d is positive. d68 Simplify f(-1/4)/fff/(f/(fff(-5)))f assuming f is positive. f(-9/4) Simplify (q/(q/q(-4)))/(qqq*12qq) assuming q is positive. q(-20) Simplify ((v3)(-2/63))(-24/11) assuming v is positive. v(16/77) Simplify ((b/(b/(bb/b*(1/8)bb)b))/bb)/(b(b*4/b)/b)((b(b/(bb*(2/7)))/b)/bbb)/(b/(b/(b(8/5)b))) assuming b is positive. b(-563/280) Simplify z(3/2)zz(-26) assuming z is positive. z(-47/2) Simplify q(q/((q/q(-7))/q)q)/qq45q assuming q is positive. q41 Simplify ((g(2/3)/gg)(-5))(3/11) assuming g is positive. g(-10/11) Simplify i5/(i/i(-7)) assuming i is positive. i(-3) Simplify (u(1/6)uu(-5))/(u(1/12)u/(u/(u/(u/((u*(2/15)u)/u))))) assuming u is positive. u(-81/20) Simplify n(-3/8)((n(-11)n)/n)/n assuming n is positive. n**(-99/8) Simp	{ "pile_set_name": "DM Mathematics" }
) - (sqrt(396) + -1))*2)-6 + 2. -2404 + 144sqrt(11) Simplify (((sqrt(54)-3-2)/sqrt(3))/(23sqrt(216)))2. 1/12 Simplify -2 + (5-1sqrt(275))2 + 4((sqrt(275) - ((sqrt(275)-2 - sqrt(275))2 - sqrt(275) - sqrt(275))) + 0) + 1. -3026 + 60sqrt(11) Simplify -1(sqrt(270) + 2sqrt(270))/(sqrt(10) - 1sqrt(1440)). 9sqrt(3)/11 Simplify sqrt(980) + sqrt(980) + -1 + (sqrt(2240)-2)/sqrt(7). -1 + 12sqrt(5) Simplify ((-3sqrt(144))/sqrt(8))241-1. -648 Simplify (sqrt(252) + (sqrt(252)-2 - sqrt(252)) + 0 + 2)2 + 4(sqrt(252) - sqrt(252)1) + -4. -48sqrt(7) + 1008 Simplify 2((sqrt(252)-1 - sqrt(63) - sqrt(63))/(sqrt(144)-6))2. 7/18 Simplify sqrt(240)/sqrt(300) - (5(sqrt(5) + 1) + sqrt(5) + 6sqrt(20)). -88sqrt(5)/5 - 5 Simplify ((-1-1(sqrt(13) + 1 + sqrt(13)) + -5)-2)2. -64sqrt(13) + 272 Simplify (5-5(-2sqrt(304) + sqrt(304) + 4 + 3sqrt(304)-5))2. -320000sqrt(19) + 48650000 Simplify ((sqrt(21) + 2sqrt(756))/(sqrt(14)/(sqrt(4)/sqrt(2)))2)*2. 2028 Simplify (-6sqrt(704))/sqrt(4) + ((sqrt(11) - (sqrt(11)-2 + 5))2)*2. -144sqrt(11) + 496 Simplify (sqrt(66) - (sqrt(66) + (sqrt(66) - -1sqrt(66))-2))/(sqrt(216)-2 + sqrt(6)) + 5. -4sqrt(11)/11 + 5 Simplify (-3 + 1 + (sqrt(1900) - -2sqrt(1900)) + sqrt(1900) + -4 + sqrt(1900) + 2sqrt(1900)5)2 + 5. -1800sqrt(19) + 427541 Simplify 2 + (sqrt(200) - (sqrt(200) + (1sqrt(200) - sqrt(200)) + sqrt(200)))/((sqrt(28)/sqrt(7) + sqrt(4))-2). 5sqrt(2)/4 + 2 Simplify -3 + -1sqrt(1900) + 3 + (5(sqrt(1900) - 6((sqrt(1900) + -1 + sqrt(1900) - sqrt(1900)) + sqrt(1900))))*2. -33010sqrt(19) + 5748400 Simplify (sqrt(88) + (-52sqrt(88) - sqrt(88)))/(-5(-2sqrt(8) - sqrt(8)) - sqrt(8)). -5sqrt(11)/7 Simplify ((sqrt(17) + 0)3 - sqrt(68)/(sqrt(36)/sqrt(9)))6. 12sqrt(17) Simplify -1(-1 + sqrt(147) + sqrt(147)-1 - sqrt(15)/(sqrt(5) + 1sqrt(5)-4))*2. -4/3 + 2sqrt(3)/3 Simplify (-6-4(-4sqrt(1100)1 + sqrt(1100) + (sqrt(1100) - (sqrt(1100) + 4(1 + sqrt(1100))))))2. 322560sqrt(11) + 31055616 Simplify (2sqrt(77)3 + sqrt(77) + sqrt(77) + -4(sqrt(77)1 + sqrt(77)))/(sqrt(700) + (sqrt(700) - 2(sqrt(700) - (sqrt(700) + (sqrt(700)-2 - sqrt(700)))))). 0 Simplify -4 + (1(4 + -6(sqrt(108) - (-1 + sqrt(108)))-2))2. 252 Simplify (sqrt(405) + (sqrt(405) - sqrt(405)-1))*2 + (sqrt(5) - (sqrt(20)/sqrt(4) + 1 + sqrt(5))) - (sqrt(55)/(sqrt(77)/sqrt(7)) + 0). -2sqrt(5) + 3644 Simplify (4(sqrt(208) - (-1 + sqrt(208)) - sqrt(208) - sqrt(208))-4)*2 + -1-4(sqrt(208) - (sqrt(208) - -2sqrt(208))). -4128sqrt(13) + 213248 Simplify ((sqrt(68)/sqrt(324) - 5(sqrt(2448) + -1)*2) + -4)1. -12249 + 1081sqrt(17)/9 Simplify (4(sqrt(2940)2 - sqrt(2940)))/((sqrt(84) + sqrt(84) + (sqrt(84)-2 + sqrt(84) - sqrt(84) - sqrt(84))4 + sqrt(84))/sqrt(7)). -28sqrt(5)/9 Simplify 4 + (-2 + 5(sqrt(684) + -2 - sqrt(684)) + 1)2. 125 Simplify ((sqrt(152) - (-3(1sqrt(152) + sqrt(152) + sqrt(152)) + sqrt(152)) - sqrt(152)) + sqrt(152) - sqrt(152))/sqrt(8) + (sqrt(171) + -1)1. -1 + 11sqrt(19) Simplify ((sqrt(70)/(sqrt(30)/sqrt(3)) + 3 + sqrt(7)2)31)*2. 162sqrt(7) + 648 Simplify (4 + (sqrt(15) - (sqrt(2160) + (sqrt(2160) - sqrt(2160)3)))/(1sqrt(125)))3. 12 + 39sqrt(3)/5 Simplify -1 + -5((sqrt(8) + 3sqrt(72))/(sqrt(4) - (sqrt(4) + sqrt(64)3)))2. -143/18 Simplify (-36(sqrt(33) + sqrt(66)/sqrt(2)))/((sqrt(24) + sqrt(24) + sqrt(2904)-1)/sqrt(8)). 4sqrt(11) Simplify ((sqrt(392)/(sqrt(14)/sqrt(2)))/sqrt(7))/(5(sqrt(64) + sqrt(4) - sqrt(4))6). sqrt(2)/120 Simplify ((-1sqrt(33))/sqrt(3)-2 - sqrt(275)-2-1)2. 704 Simplify 5 + (sqrt(1573) - -3sqrt(1573)) + (1sqrt(13) + -1)4. 1 + 48sqrt(13) Simplify 6(sqrt(143) + sqrt(143) + (sqrt(143) - (sqrt(143) - sqrt(143)25)))/(1-2sqrt(11)). -36sqrt(13) Simplify (2(sqrt(66) + sqrt(66)-1) + (sqrt(66) + 2sqrt(66))-4)/(-6-2sqrt(6) - (sqrt(6) - (sqrt(6) - (sqrt(18)/sqrt(3) + sqrt(6))))-5). -6sqrt(11)/11 Simplify (sqrt(675) + sqrt(27))2 - sqrt(30)/(sqrt(40)/sqrt(4) + sqrt(10)) - (4(1 + sqrt(243) + 3))*2. -3172 - 2305sqrt(3)/2 Simplify (sqrt(228)/((sqrt(84)-1)/sqrt(7)) - sqrt(57)/(sqrt(21)/(sqrt(49)/sqrt(7)))) + 1. -2sqrt(19) + 1 Simplify ((-5 + -3-3sqrt(363))1)2. -990sqrt(3) + 29428 Simplify 4(0 + -5((sqrt(68) + sqrt(68)-2 + sqrt(68) + 5 - sqrt(68)) + 3 + -2sqrt(68))). -160 + 120sqrt(17) Simplify 6((((sqrt(450) - (sqrt(450) - (sqrt(450) - (sqrt(450) - 1sqrt(450))) - sqrt(450))) + sqrt(450))2)/(sqrt(9) - 5sqrt(18)/sqrt(2)))2-4. -2700 Simplify 2 + (-3 + (sqrt(95)/(sqrt(5)3))2)3. -2/3 Simplify (-1(sqrt(77)/sqrt(7) + 5) - ((sqrt(11) - (sqrt(275)-2 + sqrt(275))) + sqrt(891) + 1sqrt(891)))2. 250sqrt(11) + 6900 Simplify (0 + (sqrt(350)/sqrt(112))/(sqrt(50)/(sqrt(15)/sqrt(3)) + sqrt(10)))*2. 5/64 Simplify ((sqrt(475) - sqrt(475)1)-6 - sqrt(475)) + sqrt(475) + (-1sqrt(475) + 3)*2 - (-4 + 2 + sqrt(475) + 0). -35sqrt(19) + 486 Simplify (((sqrt(520)1)/sqrt(10))/(4sqrt(4)-1) - (-1 + ((sqrt(26)/sqrt(2) + sqrt(13))-3 - 4sqrt(52))))2. 55sqrt(13)/2 + 39341/16 Simplify 5((-4-2sqrt(136) - sqrt(136) - sqrt(136)) + sqrt(136) - 1sqrt(136)2)/(sqrt(72) - (sqrt(72) + (sqrt(72) - sqrt(72)23))). 5sqrt(17)/3 Simplify (((sqrt(130) + 61sqrt(130))-4)/(sqrt(1440)1 + (sqrt(100)1)/sqrt(10)))2. 784/13 Simplify -2(4 + 1sqrt(363))2 + (sqrt(6)/sqrt(2) + 4 - (sqrt(192))2)4. -1510 - 172sqrt(3) Simplify -1(-4 + sqrt(19) + 0 + -5 + sqrt(171)/((2sqrt(36))/sqrt(4)) + 1). -3sqrt(19)/2 + 8 Simplify -3(0 + (-2(-1 + 1 + sqrt(972)))*2). -11664 Simplify ((6sqrt(42)/sqrt(7))/(2sqrt(288)))2. 3/16 Simplify (sqrt(972) - (1((sqrt(972) - 2sqrt(972)) + sqrt(972)) - sqrt(972)))/((sqrt(324) - (sqrt(324) - -1sqrt(324))) + sqrt(45)/sqrt(80)). -48sqrt(3)/23 Simplify (((sqrt(270) + (sqrt(270)-2 - sqrt(270) - sqrt(270)) + sqrt(270))/sqrt(9))/sqrt(10) + -4 + 3 + sqrt(12))*2. 1 Simplify (sqrt(17) + (-5sqrt(425))*2)1 - sqrt(136)/(sqrt(768)/sqrt(6)). 3sqrt(17)/4 + 10625 Simplify (5(5 + sqrt(252) + (sqrt(252) - sqrt(252)-2 - sqrt(252))))2. 4500sqrt(7) + 57325 Simplify (4 + 3 + ((sqrt(208) - (1 + sqrt(208) + -5 + sqrt(208))) + sqrt(208) + sqrt(208) - sqrt(208)) + sqrt(208))*2-2. -658 - 176sqrt(13) Simplify (sqrt(1500)2 - sqrt(120)/sqrt(2)-3)/((sqrt(60)-1-6)/sqrt(5)). 13sqrt(5)/6 Simplify sqrt(50)/(sqrt(810) + (-2sqrt(810) - sqrt(810))) - (6sqrt(20)-2)2. -2880 - sqrt(5)/18 Simplify (-1((sqrt(132) + sqrt(132) + -1sqrt(132) - sqrt(132))/sqrt(3))/(sqrt(4) - -12sqrt(4)))2. 0 Simplify (-5sqrt(243)2)/(4((sqrt(9) + (sqrt(9) + (sqrt(9)-2 - sqrt(9))-4 - sqrt(9)) - sqrt(9)) + sqrt(9))). -15sqrt(3)/26 Simplify -1((-1sqrt(343))2 - sqrt(343)) - (sqrt(252) - (sqrt(7) - (sqrt(7) - ((sqrt(63))2 + -2)) - sqrt(7))). -282 Simplify sqrt(18)-2 + 0 - sqrt(6)/sqrt(3)4-4. 10sqrt(2) Simplify (sqrt(144) + sqrt(144)-21)/((sqrt(8) - sqrt(512)-3) + sqrt(8) + sqrt(8)). -sqrt(2)/9 Simplify 3(-5 + 1 + -2 + (sqrt(500) - (1 + sqrt(500)))2 + -4 + sqrt(500)). -27 + 30sqrt(5) Simplify (2(0 + sqrt(539) + 0 + ((sqrt(539) + (1sqrt(539) - sqrt(539)))-4 - sqrt(539))) + 5)2. -560sqrt(11) + 34521 Simplify -3(2 + (sqrt(33)/(sqrt(44)/sqrt(4)))2) + 5(1sqrt(108) + (sqrt(9)/sqrt(3)2)*2). 45 + 30sqrt(3) Simplify -4 + ((2sqrt(91)-2)/(sqrt(336)/sqrt(3)) + 1)6. -6sqrt(13) + 2 Simplify ((sqrt(104) + 21sqrt(104))/sqrt(8) - (sqrt(117) + (sqrt(117) + 0)2 + (-1 + sqrt(13))26)) + -3. -204 + 12sqrt(13) Simplify (1sqrt(4719))/(2sqrt(75))1. 11sqrt(13)/10 Simplify ((sqrt(2057) + 2 - (0 + sqrt(17) + 2)) + (1 + sqrt(153) + 1)-4)2. 32sqrt(17) + 132 Simplify (2 + (3 + sqrt(27))2 + 1 + (sqrt(432))2 + 2)-6. -2838 - 108sqrt(3) Simplify (sqrt(209) + -1sqrt(209)-4 + -3(sqrt(209) + (sqrt(209)-2 - sqrt(209))))/(sqrt(1100) + -1(-1sqrt(1100) - sqrt(1100))). 11sqrt(19)/30 Simplify (-1 + sqrt(192) + -2 - sqrt(192) - (sqrt(192)-1 + sqrt(192) + -3 - sqrt(192))*2) + -1. -205 - 48sqrt(3) Simplify ((sqrt(416) + -2sqrt(416)-4 + sqrt(416))/(3sqrt(288) + sqrt(288)))2. 325/36 Simplify (1(sqrt(550) + -1sqrt(550) - sqrt(550)) - sqrt(550))/(sqrt(55)/(sqrt(50)/(sqrt(250) - sqrt(10)))). -5sqrt(2)/2 Simplify (6(sqrt(10)/sqrt(5) + sqrt(2)) - -1(sqrt(4)/sqrt(2))**2) + (-5 + sqrt(	{ "pile_set_name": "DM Mathematics" }
-six fifths of a gram? 5200 How many seconds are there in 1/4 of a minute? 15 Convert 1.438667 millimeters to centimeters. 0.1438667 Convert 582399.2 days to hours. 13977580.8 What is 11/2 of a decade in years? 55 What is 0.19265m in nanometers? 192650000 How many millilitres are there in 874.383 litres? 874383 What is seventeen sixths of a millennium in months? 34000 How many months are there in three fifths of a millennium? 7200 Convert 950.1537mm to meters. 0.9501537 What is 7/8 of a litre in millilitres? 875 How many centimeters are there in one quarter of a kilometer? 25000 How many nanograms are there in 2/125 of a microgram? 16 Convert 8475.904 decades to centuries. 847.5904 How many seconds are there in 10/3 of a hour? 12000 What is 13848.93 years in centuries? 138.4893 What is 6454.983 millimeters in micrometers? 6454983 How many years are there in 252747.06 months? 21062.255 What is 4.234194 months in decades? 0.03528495 What is seventy-seven halves of a microgram in nanograms? 38500 What is thirty-three fifths of a litre in millilitres? 6600 What is 3/5 of a day in minutes? 864 What is 1/20 of a microgram in nanograms? 50 What is 903.4041 nanometers in centimeters? 0.00009034041 What is nineteen quarters of a millennium in decades? 475 How many months are there in 5/8 of a century? 750 Convert 152293.9 litres to millilitres. 152293900 How many minutes are there in 11/10 of a hour? 66 How many micrometers are there in three sixteenths of a centimeter? 1875 How many centimeters are there in 75.68406um? 0.007568406 What is 7/3 of a year in months? 28 How many millennia are there in 2200090.2 months? 183.34085 How many decades are there in 27658.161 months? 230.484675 Convert 5.588029 nanometers to meters. 0.000000005588029 How many millilitres are there in eighteen fifths of a litre? 3600 What is 1/16 of a millimeter in nanometers? 62500 Convert 2914.18 litres to millilitres. 2914180 How many kilograms are there in 3/8 of a tonne? 375 Convert 0.7129673nm to kilometers. 0.0000000000007129673 How many hours are there in 806400.9 milliseconds? 0.22400025 Convert 4.2219ug to nanograms. 4221.9 How many microseconds are there in 9274.506 milliseconds? 9274506 How many years are there in 5245.05 millennia? 5245050 What is twenty-seven fifths of a microgram in nanograms? 5400 How many litres are there in 647.8863 millilitres? 0.6478863 What is 784.161 months in centuries? 0.6534675 How many litres are there in 4.05692ml? 0.00405692 What is 81/4 of a tonne in kilograms? 20250 What is 911231.9 tonnes in micrograms? 911231900000000000 What is 2464619.4 months in years? 205384.95 How many micrograms are there in 21/4 of a milligram? 5250 How many litres are there in 348.8767ml? 0.3488767 How many millimeters are there in one sixteenth of a kilometer? 62500 How many milliseconds are there in 7/8 of a minute? 52500 What is 21/5 of a week in minutes? 42336 What is 0.2766087 millennia in centuries? 2.766087 Convert 68.7545 days to hours. 1650.108 How many millilitres are there in 31/2 of a litre? 15500 What is 572.708 microseconds in nanoseconds? 572708 Convert 676.5692 micrometers to meters. 0.0006765692 Convert 53.04745mm to kilometers. 0.00005304745 How many months are there in seven thirds of a decade? 280 What is 27/5 of a gram in milligrams? 5400 What is 528.6906 centuries in years? 52869.06 How many micrograms are there in 883.8197mg? 883819.7 What is fourty-seven quarters of a millisecond in microseconds? 11750 How many centimeters are there in 25009.24 kilometers? 2500924000 What is 1/10 of a week in minutes? 1008 What is 0.1178638 tonnes in micrograms? 117863800000 What is one tenth of a week in seconds? 60480 How many minutes are there in 23456.295 nanoseconds? 0.00000039093825 Convert 968242.5 hours to minutes. 58094550 What is 53/5 of a millennium in centuries? 106 What is 3/32 of a kilogram in milligrams? 93750 How many minutes are there in 75.37374 nanoseconds? 0.000000001256229 How many centuries are there in 0.8087397 months? 0.00067394975 How many milligrams are there in 3/50 of a kilogram? 60000 Convert 221898.7 centuries to millennia. 22189.87 How many nanometers are there in five quarters of a micrometer? 1250 Convert 52325.15 days to minutes. 75348216 How many years are there in 399135.6 decades? 3991356 What is seven quarters of a microgram in nanograms? 1750 What is 1/10 of a litre in millilitres? 100 How many kilograms are there in seventeen quarters of a tonne? 4250 How many millimeters are there in 961.213nm? 0.000961213 How many milligrams are there in 911.1289kg? 911128900 How many months are there in 1/6 of a century? 200 Convert 0.173299 micrometers to meters. 0.000000173299 How many millilitres are there in seventy-nine halves of a litre? 39500 How many decades are there in nine tenths of a century? 9 How many grams are there in eleven halves of a kilogram? 5500 What is twenty-one fifths of a litre in millilitres? 4200 How many millilitres are there in 400534.5l? 400534500 Convert 0.0451093 meters to centimeters. 4.51093 What is 85927.48 micrometers in nanometers? 85927480 Convert 17769.05424 microseconds to weeks. 0.00000002938005 What is 95067.1ns in microseconds? 95.0671 What is 1/80 of a hour in seconds? 45 How many milliseconds are there in one fifth of a second? 200 How many kilometers are there in 8397.06cm? 0.0839706 What is twenty-one eighths of a kilogram in grams? 2625 How many hours are there in 74/3 of a week? 4144 What is 3/50 of a millisecond in nanoseconds? 60000 What is seven thirds of a year in months? 28 How many seconds are there in fifty-five quarters of a hour? 49500 Convert 13075.12ml to litres. 13.07512 What is 6.53533 tonnes in milligrams? 6535330000 What is 1/45 of a week in minutes? 224 How many seconds are there in 23/3 of a hour? 27600 How many nanometers are there in 2.979469 micrometers? 2979.469 Convert 205.5211 years to centuries. 2.055211 How many decades are there in 962.4044 centuries? 9624.044 How many nanometers are there in 447503.4m? 447503400000000 What is 11/10 of a litre in millilitres? 1100 What is 12/25 of a meter in centimeters? 48 How many nanometers are there in 30594.83 meters? 30594830000000 Convert 7.996186kg to nanograms. 7996186000000 Convert 11.45887 milligrams to nanograms. 11458870 What is 5.621529mm in kilometers? 0.000005621529 How many years are there in 21/4 of a millennium? 5250 How many millennia are there in 6262.263 centuries? 626.2263 What is 11/4 of a micrometer in nanometers? 2750 What is 5606.638 centuries in millennia? 560.6638 What is 13/5 of a centimeter in micrometers? 26000 Convert 20.73675 minutes to milliseconds. 1244205 How many millilitres are there in fourty-four fifths of a litre? 8800 How many seconds are there in 25/4 of a minute? 375 What is 85/6 of a year in months? 170 How many milligrams are there in 666.27ng? 0.00066627 Convert 87436.73 grams to milligrams. 87436730 What is 0.469895mm in nanometers? 469895 What is 18/5 of a gram in milligrams? 3600 How many nanometers are there in 38528.35 kilometers? 38528350000000000 Convert 45233.73 minutes to hours. 753.8955 What is 88/5 of a kilometer in meters? 17600 What is 1113.922l in millilitres? 1113922 How many kilograms are there in 29/2 of a tonne? 14500 What is 40076.8 millennia in months? 480921600 How many weeks are there in 3864.9219 days? 552.1317 What is 1/20 of a milligram in micrograms? 50 How many centuries are there in 182127.5 millennia? 1821275 What is 23.74252 hours in microseconds? 85473072000 Convert 601924.8ug to milligrams. 601.9248 Convert 90.85274 years to millennia. 0.09085274 How many millilitres are there in 3168.125l? 3168125 How many kilometers are there in 474155.2cm? 4.741552 How many minutes are there in 359.9019 microseconds? 0.000005998365 What is fifty-five sixths of a day in minutes? 13200 Convert 380.736 weeks to days. 2665.152 Convert 41.66666 days to nanoseconds. 3599999424000000 How many nanometers are there in 3/50 of a millimeter? 60000 What is one quarter of a litre in millilitres? 250 How many micrometers are there in fourty-eight fifths of a centimeter? 96000 Convert 0.5400273 hours to days. 0.0225011375 What is one tenth of a gram in milligram	{ "pile_set_name": "DM Mathematics" }
is the third derivative of 0r4 - 2r*4 - 4r*q + 2r*2 - 2r*2 wrt r? -48r Let w(h) = h*2 + 3h + 1. Let y be (6/(-5))/((-3)/(-10)). Let d be w(y). Find the third derivative of -v*5 + 3v5 - vd + 2v2 wrt v. 60v*2 Let k(g) = g + 25. Let m be k(0). What is the third derivative of -2p*2 - 25p*3 + mp*3 + 2p*4 wrt p? 48p Let u(g) be the second derivative of -g*4/2 - 5g*3/6 - 9g. Find the second derivative of u(l) wrt l. -12 Let h(s) = 22s3 + 4s*2 - 3s - 3. Let p(c) = -c*2 + c + 1. Let o(n) = h(n) + 4p(n). What is the second derivative of o(a) wrt a? 132a Find the third derivative of -51s*6 + 55s*6 + 6s*2 - 3s*2 wrt s. 480s*3 Let z be 1/((-3)/24-4). What is the second derivative of -8q + 11q + zq2 - 10q wrt q? 4 Let b(h) = 15h2 - 9h. Let j(k) = 15k2 - 8k. Let p(v) = 5b(v) - 4j(v). What is the second derivative of p(i) wrt i? 30 Let y(i) be the first derivative of 2i5/5 + 11i*3/3 + 4. What is the third derivative of y(d) wrt d? 48d Suppose 5a + 5w - 25 = 0, -5w + 2 = -5a + 7. Differentiate 7 - a + 0l - 2l with respect to l. -2 Let w(t) = -t*2 - 7t - 6. Let n(x) = -x*2 - 6x - 5. Let g be n(-6). Let v be w(g). What is the second derivative of 0f4 - 5f + f*v + 3f wrt f? 12f2 Suppose -3m + 7m = 20. Differentiate -u4 - 4u*4 + 4u*4 + 4 + mu*4 wrt u. 16u*3 Suppose 0 = -2l + 6l - 5p - 25, l - 6 = p. What is the second derivative of -118h + 117h + 0h5 - 2h*l wrt h? -40h*3 Let r(o) be the first derivative of 5o*4/4 + 4o*2 - 1. Find the second derivative of r(b) wrt b. 30b Let s(w) = w*2 - 8w - 2. Let i(o) = -4o2 + 31o + 9. Let k(a) = 2i(a) + 9s(a). What is the second derivative of k(x) wrt x? 2 Let d = 1/58 - -27/116. Let a(l) be the first derivative of -1 - dl4 + 0l + 0l3 + l2. What is the second derivative of a(t) wrt t? -6t Let b(g) = -2g - 9. Let w be b(-7). What is the second derivative of 3r*4 - r + r - 4r + wr4 wrt r? 96r*2 Let k(g) be the second derivative of 5g*7/42 - 11g*3/3 + 38g. Find the second derivative of k(s) wrt s. 100s3 Let k(o) be the third derivative of 7o6/120 + o4/8 + 2o2. Find the second derivative of k(z) wrt z. 42z Let j(r) be the second derivative of 1/2r2 + 1/6r*3 + 0 + 2r. Find the first derivative of j(b) wrt b. 1 Suppose -y - 3y + 12 = 0. Find the second derivative of -3j - j + yj - j3 wrt j. -6j Let s be (-4)/14 + 48/21. What is the third derivative of -3f5 + 4f*3 + 0f*2 - 4f*3 - 2f*s wrt f? -180f2 Let z(y) be the second derivative of -y4 + 25y2/2 + y. What is the first derivative of z(r) wrt r? -24r What is the third derivative of 4g2 - 6g*2 + 2g*3 + 9g3 + g2 wrt g? 66 Let d(v) be the first derivative of -7v4 - 20v*3/3 - 25. Find the third derivative of d(h) wrt h. -168 Suppose 49 = 4r + 5k, -8 = -5r + 3k + 7. Suppose -o - 4q + 5 + r = 0, q = -5o + 17. Find the second derivative of -l3 - lo - 3l + 2l wrt l. -12l Let y be 6/44/3. Let b = y + -1. Differentiate -b - 2w + 0 + 4w wrt w. 2 Let j(w) = w2 + 3. Let k be j(0). Let x(p) = -p + 7. Let f be x(2). What is the first derivative of -f + 2t*k + 2 + 2t3 - t3 wrt t? 9t2 Let x = -1 + 1. Let d = 4 + x. What is the derivative of -4b - db2 - 2 + 4b + 0b2 wrt b? -8b Let j(v) be the first derivative of -3/2v2 + 0v*4 - 2 + 3/5v*5 + 0v*3 + 0v. What is the second derivative of j(t) wrt t? 36t2 What is the second derivative of -26q + 5q + 12q - 4q4 wrt q? -48q*2 Let c(u) be the first derivative of 0u*2 + 0u*4 + 3/7u*7 + 2/3u*3 + 0u*6 + 0u + 3 + 0u5. Find the third derivative of c(p) wrt p. 360p*3 Let u = -11 - -18. Differentiate 0 + 8w*3 - 3 - 3w*3 + u wrt w. 15w*2 Let y(v) = 24v*4 - 14v*2 + 14v - 4. Let r(k) = -1 - 3k2 - 3k + 8k - 2k + 5k4. Let w(m) = -28r(m) + 6y(m). Differentiate w(d) wrt d. 16d*3 Let a(p) = -15p + 5. Let w(s) = 7s - 3. Let f(b) = 2a(b) + 5w(b). Differentiate f(z) wrt z. 5 Let v = 20 + -18. Differentiate -v + 141c*2 + 2 - 142c*2 - 1 with respect to c. -2c Let r(w) = -w + 4. Let s be r(0). Suppose i + 5j = 14, -i - 3i - 3j = -22. What is the third derivative of -5q4 - qs - q*2 + 4q*i wrt q? -48q Let s be 6 - 1/(5/15). Let d(y) be the first derivative of -y*s - 1/2y*4 + 0y + 2 + 0y2. Find the third derivative of d(p) wrt p. -12 Suppose 4j = 4m + 20, j + 2j - 4m = 18. Let w(c) be the second derivative of 1/6c*3 + 0 + 3/2c*2 + jc. Differentiate w(z) with respect to z. 1 Suppose -5u = -0 - 15. Suppose -ul = -5q - 2, -2l + q + 18 = 3l. What is the third derivative of -3j*l + 2j*4 + 2j4 - j2 wrt j? 24j Suppose 4g + 3h = -g + 29, -4g + 31 = 5h. Differentiate -2 + gq - 6q + 4q with respect to q. 2 Let v be (2/(-6))/(1/(-6)). What is the derivative of -4 + 0 - va4 + 9 wrt a? -8a*3 Let d(q) be the first derivative of -17q*6/6 - 8q*2 - 5. Find the second derivative of d(m) wrt m. -340m*3 Let i be (-133)/(-28) + 3/(-4). What is the second derivative of -il + 0l + 8l*5 + 6l wrt l? 160l3 Let n(i) be the second derivative of i8/168 - i6/36 - i3 + 8i. Let r(p) be the second derivative of n(p). What is the third derivative of r(j) wrt j? 240j Suppose 12 = -5q - 3. Let w be (3-2)/(q/2). Find the first derivative of 2 - fw - 4 + 3f*4 wrt f. 8f*3 Let o(h) = -2h*2 - 4h + 34. Let i(p) = p*2 + 5p - 33. Let x(b) = -3i(b) - 4o(b). Find the second derivative of x(j) wrt j. 10 Let d be 32/6 - (-4)/6. What is the third derivative of 3z3 + z5 - 3z*2 - 3z*3 + dz*2 wrt z? 60z2 Let v(h) = -h3 - h. Let p(z) = -9z - 2z3 + z3 + 3z - 5z*3. Let b(y) = -p(y) + 3v(y). What is the second derivative of b(m) wrt m? 18m Let w be -1 + 3 + 0/2. Find the second derivative of -2b*2 + 3b - 5b - b2 - wb wrt b. -6 Let v(m) be the second derivative of -m8/56 - m4 - m. Find the third derivative of v(t) wrt t. -120t3 Find the third derivative of -7u*4 - 3u*4 + 6u*2 + 5u*4 + 3u*4 wrt u. -48u Let n(f) be the first derivative of 24f5/5 + 23f*2/2 + 17. What is the second derivative of n(s) wrt s? 288s*2 Let x(i) be the first derivative of 5i*4/4 - 11i*2/2 - 1. Find the second derivative of x(m) wrt m. 30m Find the third derivative of 32p4 + p2 + 15p*2 + 2p*6 - 34p*4 wrt p. 240p*3 - 48p Let s be 6/(-4 - -2) - -8. What is the third derivative of 3n3 - sn*2 + 3n*2 - 4n3 + n2 wrt n? -6 Let n(k) be the first derivative of -k*5/5 - 31k*3/3 - 36. Find the third derivative of n(p) wrt p. -24p Let j = -30 - -50. What is the second derivative of -jb5 - 2b + 12b5 + 5b*5 wrt b? -60b*3 Let r = -2 - 1. Let d(p) = p. Let b(c) = 4c*3 + 6c. Let z(k) = rd(k) + b(k). What is the second derivative of z(y) wrt y? 24y Suppose 1 = 3o + 5p - 0, 0 = -p - 1. Suppose -q + 6q = -oc - 19, -q = 5. Differentiate 2 - 2bc + 2 - 3 with respect to b. -6b*2 Suppose 2w + 5s = s + 24, -4w = s - 20. What is the first derivative of -1 - wp2 + 0p*2 + 4p*2 - 4p*2 wrt p? -8p Let c(y) be the first derivative of -3y4/8 - y3 + y2/2 - 6. Let t(h) be the second derivative of c(h). What is the first derivative of t(u) wrt u? -9 Let c = 3 + 0. Suppose -2z + 4 = 2l, 4z + 2l - cl - 33 = 0. What is the third derivative of y*4 + 8y*2 - 2y*2 - zy*2 wrt y? 24y Let k(b) be the second derivative of 23b7/21 - 2b*3 - 45b. Find the second derivative of k(z) wrt z. 920z3 Let h = -6 + 8. Suppose 14r = 9r + 10. What is the derivative of 0 + 5p*h - 2p*r - 1 + 2 wrt p? 6p Find the second derivative of 4 + 4g3 - 9g - 4 + g wrt g. 24g Find the second derivative of -17 + 17 + 7n + 4n4 wrt n. 48n*2 Let a(o) = -o. Let z = -2 - -2. Let t be a(z). Find the third derivative of ts*4 - 2s*4 + 2s*2 + 0s*2 wrt s. -48s Let w(i) be the third derivative of 0i + 0 + 0i*4 + 0i*5 - 5/3i*3 + 1/70i*7 + 0i*6 - 7i*2. Differentiate w(n) wrt n. 12n3 Let i(j) be the second derivative of -j5/20 + j*3 - 5j. What is the second derivative of i(o) wrt o? -6o Find the third derivative of s3 + 8s*3 - 19	{ "pile_set_name": "DM Mathematics" }
5x + j - d for x. 0 Let b(l) = -3l3 - l2 - 6l + 2. Let q be b(-3). Solve 2m = 4z + 102 - q, -4m + 20 = 4z for z. 0 Let l be 80/(-360) + (76/(-18))/(-1). Solve -2p = ln + 6, 0 = n + 4n - 5p - 15 for n. 0 Let t = 5934 + -5931. Solve -5c = -tc - 3k + 18, -5c - 5k = -5 for c. -3 Suppose 0 = -2p - 3v - 6, 2p - 5v = -p + 10. Let x = 10 + -5. Solve -xm - 4k - 25 = p, 3m - k = 2k + 12 for m. -1 Suppose 4m = -3o + 83, -74 = -4o - 3m + 32. Let w be (3 + -2)/(1 - 0)o. Let t be (0 - (-8)/(-2))/(-2). Solve 5 = y + 3u, -u = 5y + tu - w for y. 5 Let t(o) = o + 40. Let m be t(-26). Let s(r) = -r*3 + 11r*2 + 25r + 27. Let c be s(13). Solve c = 5q + 3v, -v + m = 3q + q for q. 4 Suppose -47c + 65 + 311 = 0. Let w be (-6)/c(-72 + 68). Solve 2z + 5 = -t, 7 = -5t - wz - z for t. 1 Let l = -11657 + 11697. Solve 0 = 5q - 5s + l, 4q - 5q + 5s = 20 for q. -5 Let r be (-235)/20 - 12/48. Let s be 31/(-14)-2 + r/(-21). Solve -5a = sq + 10, -a = 3q - 0q - 2 for q. 2 Let q(j) = 15j + 37. Let i(v) = -31v - 77. Let k(l) = -2i(l) - 5q(l). Let m be k(-3). Solve -t - m = d + 3d, 2t + 4 = -4d for d. -3 Let d be (-1)/(3 + 2)0/(-444). Solve 5o + 2g + 25 = 0, 6g - 3g = d for o. -5 Let q be (-186)/(-38) - (168/(-152) - -1). Solve -2a - 2l = -2, qa - 2l - 13 + 1 = 0 for a. 2 Let d = 186 + -182. Suppose 5a = -5g + 15, -7 = dg + a - 19. Solve 2q = 2s - 3s, gq = 4s - 11 for q. -1 Let x(b) = -40 - 145 + 3b + 2b + 38 - b*3 + 32b*2. Let c be x(32). Let q = -1 + 1. Solve q = 3f - 2g + c, 0 = -g - 4g + 10 for f. -3 Let j(b) = 2b2 - 7b - 13. Let l(g) = -g*2 - 14g - 6. Let y be l(-14). Let t be j(y). Let a = t - 98. Solve -4h = -5o - 0h - 40, -ao - 27 = -3h for o. -4 Suppose 125 = -9d + 4d. Let g be d/125 + (-352)/(-10). Solve 0 = 5f - 5t - g, 1 = t + 4 for f. 4 Let w(a) = 3a*2 - 5a - 55. Let v be w(-4). Suppose 9y + vy = 4y. Solve 3s - 1 + y = -5m, 4 = 4m + 4s for m. -1 Let t = 97 + -109. Let m be t4/(-48)4. Solve d = -v + 3, 0v = -mv + 4d - 28 for v. -2 Let y(d) = -26d - 56. Let h(j) = -27j - 59. Let a(x) = 4h(x) - 5y(x). Let v be a(-2). Solve 0 = -5w + 3l - 25, v = -w - l + 4l - 17 for w. -2 Let p = -5280 - -5304. Solve o - 5t = -23, -4o + 4t + 12 = p for o. 2 Suppose 40l - 36l - 60 = 0. Suppose 9 = 3k + 4d, -2k - 4d - l = -7k. Solve -7 = -m + o, 2o - k = -3m - o for m. 4 Let v = 11137 - 11135. Solve -4n - 5o + 19 = -2n, -vn + 1 = -o for n. 2 Let d be (-2)/((4/98)/((-44)/308)). Solve 0 = z + 2n - d, -5z + 17 = 5n - 3 for z. 1 Let g = 912 + -907. Solve 104d + 16 = -3r + 99d, -r = gd + 22 for r. 3 Let v be (168/18)/1(-12)/8. Let k be (-4)/(-72) + v/252. Solve k = 2z + 6, 6z = 5p + 8z + 26 for p. -4 Let w = 14 + -6. Solve 0 = -g + 1, 5n + 34 = g + w for n. -5 Let d be (6 + -4)/((-7)/14). Let u be (-20)/(-8) - d/8. Solve 0 + 18 = o + 5s, -us + 15 = 2o for o. 3 Suppose -k + 15 = 4k. Suppose 0 = 2u + 3u + kb - 4, 5b + 6 = -2u. Let g be (-15)/(-12) + 1 + 3/(-12). Solve -15 = 3v, -gr - 2v - u = 10 for r. -1 Let r be 4 - -4(-5)/10. Let w(u) = -9u + 31. Let b be w(r). Solve 0 = -4n + f - b, -f = -5n - 3f for n. -2 Suppose 2c + 137 = -23c + 212. Suppose -4p + 171 = -5. Suppose -34 = -5m + 3a + 44, p = 2m + 2a. Solve 0 = 5j + 2t + m, -3t - 8 = -cj + j for j. -2 Let z be (-23)/(-1) - (20/(-60))/((-2)/54). Let k = 17 + -10. Solve -3y = -2s - z, 0 = -3y + ky + 2s for y. 2 Suppose 63 = 10w + 13. Suppose -2r + 5 = k, -4 = 4k + 8. Solve -2m = 2a - 2, wa - 8m = -rm - 22 for a. -2 Let g(s) = -2s*3 + 68s*2 + 6s - 199. Let b be g(34). Solve -3h + 2o - 45 = -63, o - b = -2h for h. 4 Let c = 147 + -147. Suppose -3 = 3z, c = 5s + 2z - z - 149. Solve -5g - 5k = -2g + s, -2g - 7 = -k for g. -5 Let x = -384 - -270. Let z = x - -127. Solve -5k + 3u + 7 = 0, 4u + z = -4k - 7 for k. -1 Suppose -r + 83 = 4h, -36h + 5r = -40h + 95. Let b(a) = 3a - 57. Let i be b(h). Solve 19 = -2c - 5k, c + ik = 5c - 27 for c. 3 Let q = 315 + -236. Suppose qh - 75h - 88 = 0. Solve 0 = 2p + r + 3r - h, -13 = -2p - r for p. 5 Let l(n) = 20n + 965. Let i be l(-48). Solve -u = -2t + i, -2t = -1 - 3 for u. -1 Let z = -72810 + 72813. Suppose -2u - 4n + 22 = 0, -6 = -5u + 5n + 4. Solve -4a - u + 24 = 5d, -zd = -5a - 4 for d. 3 Let m(c) = 2c*3 + 75c*2 - 202c - 75. Let t be m(-40). Solve 3z - 21v = -18v + 6, -2z + 25 = tv for z. 5 Let l = 25632 + -25620. Solve 179g - l = 183g - 5p, -2g = 5p - 24 for g. 2 Let j(o) = -260o - 5976. Let v be j(-23). Solve -vs = 2i + 8, -3i = -58s + 55s - 24 for i. 4 Let b be ((-956)/(-239))/(((-10)/68)/(-5)). Solve 0 = -2x + 4d + 8, x - 139d + bd = 6 for x. 0 Let u be (9 - (-126)/(-12))/((-2)/4). Suppose 92 - 317 = 5i. Let l be 10/i - 47/(-9). Solve 3q + 31 = lk + 10, uk = -3q + 3 for k. 3 Let i = 7703 - 7691. Solve g + 3g = -i, u - 3g - 9 = 0 for u. 0 Let d = -8241 - -8245. Solve 0 = dc - 7c - 3, 4c - 8 = -4w for w. 3 Let w = -143 - -143. Let t(x) = x3 + x2 - 6x + 7. Let g be t(-3). Solve -g = f + u - 2, 3f + 4u + 15 = w for f. -5 Let q be (6/(-8))/(1/(-16)). Suppose -2x + 3a = 13, -6x - a - 33 = -2x. Let h be (x - (-96)/14)/(2/(-7)). Solve -t + 22 = -hd, -2t - 2d - q = -3t for t. 2 Suppose -6d + 16 = -3l - 2d, 4d - 16 = l. Let p be 99/(-66)(-15 + l + -1). Let r be p/13 - (-14)/91. Solve -2y - i = -14, -ri - 9 = -y - 3i for y. 5 Suppose -351r + 7511 = 140. Solve -2w = 10, 0 = 5u + 2w + r + 9 for u. -4 Suppose -4n = -6 - 6. Suppose t + t - 8 = 2h, 2t - 5 = nh. Suppose b - 11 = -3r, 5b - 5 = 10b. Solve 2l - 6j - t = -j, 8 = rl - 4j for l. 1 Suppose 2 = 12j - 82. Let i(r) = -r*2 + 5r + 16. Let c be i(j). Let s be 15/(-10) + 7/c. Solve 2y + 7k = sk - 22, -20 = 5k for y. -1 Let i be -870/(-56) + (1 - 1). Suppose -4t = -2y - 3t + 3, -3y = 4t - i. Solve 0 = -2o - 0o - ym + 10, 4o + m - 11 = 0 for o. 2 Suppose -108 = -195n + 159n. Solve 10c + 5 = 5m + 5c, -nc + 13 = m for m. 4 Let o = 102 + -99. Suppose on - 5t = -1, n + 4n = t + 13. Suppose -5r + 2 = 3a + 9, a - 2r - 5 = 0. Solve f = -4k + 6, -2f - n = k - a for k. 2 Suppose -7 = 4h + 77. Let y = 27 + h. Suppose x = 5c - 3, 0x + y = -2c - 2x. Solve o - 2p + 6 = c, 1 = -p + 4 for o. 0 Let u(r) = r*3 - 21r*2 + 2r - 37. Let h be u(21). Solve 0 = 2w - 3a - 1, 4w - 28 - 7 = -ha for w. 5 Let w(m) = 26m - 197. Let i be w(15). Suppose -9n = i - 193. Let b = 58 - 36. Solve n = 5p - b - 3, 4h + 2p + 10 = 0 for h. -5 Suppose 5a + 24 = 4k, 182k - 181k - 17 = 4a. Solve -m = t + 2 - k, -4m = 2t + 10 for t. 3 Suppose 0 = 15t + 12 - 102. Let p be ((36/t)/1)/(2/(-15)). Let x = p + 45. Solve s + 5k = 21, 3s + xs - 23 = -5k for s. 1 Let v = 1841 - 1839. Solve -3c - 3b = -9 + 24, -vc = b + 5 for c. 0 Let f = -50 + 70. Let n = 137977 - 137973. Let b(i) = -2i. Let c be b(-1). Solve -p = -cp + x, -nx = p + f for p. -4 Suppose -3p - 2s = -32, 2p - 2s = 2s. Suppose -34 = pj + 78. Let k be -3 + (j/(-4))/(2/4). Solve -5t = -ka - 17, 2a - 5t + 3 = -18 for a. 2 Suppose -58p + 56p + 15 = -t, -p + 15 = -2t. Let c be (0 + 4/(-8))0. Suppose c = -0a - a + 5. Solve ar + 25 = -x - 4x, pr - 15 = 5x for r. -1 Let c be ((-6)/44)/(134/(-737)) - 13/(-4). Solve ci - 21 + 8 = -b, -4b - 53 = -5i for i. 5 Let q = 316 + -314. Let s be (-25 - 50)(q/3 - 1). Solve -3z = -b + s - 10, 3z = -4b for z. -4 Let v be (-27 + 29)/(1 + 0). Let z be (-3 - -6)/((-5)/4 + v). Solve k = 2x - 0k + 9, -2k - 22 = zx for x. -5 Suppose 3r = 0, -3t - 2r = -r - 15. Suppose l = 4x - 16, -3l + tx + 8 = 7x. Solve l = -2s - 4i + 2, 4i = s - 2 - 5 for s. 3 Suppose -3w - l + 851 = 0, 4w - 5l - 1160 = -0w. Let h = -279 + w. Solve h = -3p - 2o, -o + 0 = -3 for p. -4 Suppose 8j - 98t = 11j + 475, 5 = 2j + t. Let g(b) = -b3 + 6b*2 + 5b + 2. Let v be g(6). Solve 5r - 11 = -x, r = jr - 5x - v for r. 3 Let c(r) = -3r*3 - 2r*2 - 6r - 2. Let n be c(-1). Let w be 1/(2/41). Suppose nb = wu + 6, -b + 6 = 2b. Solve -2q = -4i - u, 1 = -4q - i - 13 for q. -3 Let u be 90/12 - (-1)/2-1. Suppose -a - m - 9 = -2a, 3a	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.