Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
vttvttz. What is prob of picking 3 v? 35/816 Calculate prob of picking 1 e and 1 s when two letters picked without replacement from {e: 2, h: 2, p: 1, k: 1, s: 4}. 8/45 What is prob of picking 1 b and 1 l when two letters picked without replacement from {i: 1, b: 1, l: 2, z: 2}? 2/15 Four letters picked without replacement from baobaaaab. What is prob of picking 1 o, 1 b, and 2 a? 5/21 Calculate prob of picking 2 x and 2 i when four letters picked without replacement from qxhhihhhihhhhhqqhhxh. 1/4845 Calculate prob of picking 1 t and 3 h when four letters picked without replacement from {x: 1, j: 2, h: 3, t: 1}. 1/35 Calculate prob of picking 1 a and 1 f when two letters picked without replacement from ecowwwfcacwoffecfff. 2/57 What is prob of picking 2 g when two letters picked without replacement from {g: 2, e: 1, p: 2, a: 4}? 1/36 What is prob of picking 1 i, 1 u, and 1 q when three letters picked without replacement from ikkiukqkiiiuuiuiriiw? 3/95 Calculate prob of picking 4 e when four letters picked without replacement from {p: 3, e: 4}. 1/35 Three letters picked without replacement from {r: 2, q: 2, j: 4, d: 11}. What is prob of picking 1 r, 1 q, and 1 d? 44/969 Calculate prob of picking 2 o when two letters picked without replacement from {v: 1, r: 6, o: 4, m: 1, u: 3}. 2/35 Three letters picked without replacement from jttwwjfftjwwjwtf. Give prob of picking 3 w. 1/56 Three letters picked without replacement from {k: 5, h: 2}. Give prob of picking 3 k. 2/7 What is prob of picking 2 f when two letters picked without replacement from {c: 1, f: 6, u: 1, b: 2, y: 3}? 5/26 Two letters picked without replacement from hhajbhjjhhahah. What is prob of picking 2 h? 3/13 Calculate prob of picking 1 a and 1 s when two letters picked without replacement from sssasassssaaa. 20/39 What is prob of picking 4 f when four letters picked without replacement from mttftmffftq? 1/330 What is prob of picking 1 j, 1 x, and 1 u when three letters picked without replacement from {p: 2, x: 1, u: 2, j: 1}? 1/10 What is prob of picking 1 a, 1 d, and 1 w when three letters picked without replacement from {w: 1, a: 1, q: 1, d: 1, v: 1}? 1/10 Calculate prob of picking 2 h when two letters picked without replacement from hhdhdididiiiioid. 1/40 Three letters picked without replacement from {n: 12, a: 4, t: 4}. Give prob of picking 1 n and 2 t. 6/95 Two letters picked without replacement from ezebzeeezeezzeeee. Give prob of picking 2 z. 5/68 Three letters picked without replacement from {y: 2, o: 6}. What is prob of picking 2 o and 1 y? 15/28 Two letters picked without replacement from {x: 3, t: 1, f: 2, j: 1}. Give prob of picking 2 x. 1/7 What is prob of picking 1 o, 1 t, and 1 n when three letters picked without replacement from {t: 2, o: 5, n: 5}? 5/22 What is prob of picking 4 w when four letters picked without replacement from {w: 12, u: 7}? 165/1292 Four letters picked without replacement from oldcjoo. Give prob of picking 1 c, 2 o, and 1 l. 3/35 Two letters picked without replacement from {t: 10, b: 10}. What is prob of picking 2 t? 9/38 Three letters picked without replacement from {u: 1, e: 1, m: 2, r: 1, j: 1, d: 1}. What is prob of picking 1 j, 1 d, and 1 m? 2/35 Calculate prob of picking 2 t when two letters picked without replacement from {l: 8, t: 2}. 1/45 Calculate prob of picking 1 w, 1 q, and 1 l when three letters picked without replacement from lwwlglwwwlwwmqswwgww. 11/285 Four letters picked without replacement from {c: 6, r: 2, u: 3, y: 3, e: 4, z: 1}. Give prob of picking 3 y and 1 u. 1/1292 What is prob of picking 1 i and 1 l when two letters picked without replacement from {l: 1, s: 1, w: 2, g: 1, y: 1, i: 1}? 1/21 Two letters picked without replacement from ibimibmipbvimbvi. What is prob of picking 1 m and 1 v? 1/20 Two letters picked without replacement from {z: 1, c: 2, h: 1}. Give prob of picking 1 c and 1 h. 1/3 Four letters picked without replacement from ysyryyryyy. What is prob of picking 2 y, 1 s, and 1 r? 1/5 Three letters picked without replacement from {q: 2, g: 8, w: 5, p: 4}. Give prob of picking 3 w. 10/969 What is prob of picking 1 x and 1 n when two letters picked without replacement from {p: 1, i: 1, s: 1, n: 1, z: 2, x: 2}? 1/14 Two letters picked without replacement from {e: 1, z: 4, q: 8, m: 1, t: 3}. Give prob of picking 1 m and 1 z. 1/34 What is prob of picking 1 s and 3 b when four letters picked without replacement from {b: 4, s: 7, l: 6}? 1/85 Two letters picked without replacement from {g: 10}. Give prob of picking 2 g. 1 Calculate prob of picking 1 d, 1 m, and 1 z when three letters picked without replacement from dzdzddmdmzzddddz. 9/56 Two letters picked without replacement from bbbztztbt. What is prob of picking 1 b and 1 t? 1/3 Calculate prob of picking 1 z and 1 h when two letters picked without replacement from mfkkhdzm. 1/28 What is prob of picking 2 t, 1 f, and 1 u when four letters picked without replacement from {s: 1, o: 3, f: 2, u: 1, j: 1, t: 4}? 4/165 Two letters picked without replacement from {a: 2, z: 1, m: 2, f: 1}. Give prob of picking 1 f and 1 z. 1/15 Calculate prob of picking 4 y when four letters picked without replacement from cyiiiiyyyciii. 1/715 Three letters picked without replacement from jttjjsjmmsmmjss. What is prob of picking 2 t and 1 j? 1/91 What is prob of picking 1 a, 1 d, and 2 l when four letters picked without replacement from {d: 1, r: 1, l: 2, a: 4, i: 1}? 2/63 Three letters picked without replacement from {d: 11, f: 5}. Give prob of picking 3 d. 33/112 Two letters picked without replacement from ggggctgcgggtgg. Give prob of picking 1 t and 1 c. 4/91 What is prob of picking 1 t and 1 y when two letters picked without replacement from {y: 1, p: 2, c: 1, t: 1}? 1/10 Calculate prob of picking 1 j and 1 k when two letters picked without replacement from {j: 2, k: 4}. 8/15 What is prob of picking 2 n when two letters picked without replacement from nunnonuoc? 1/6 What is prob of picking 1 o and 1 q when two letters picked without replacement from ovqbm? 1/10 Three letters picked without replacement from {h: 1, y: 7}. Give prob of picking 2 h and 1 y. 0 What is prob of picking 1 z and 2 i when three letters picked without replacement from aziiak? 1/20 What is prob of picking 1 m, 1 y, and 1 o when three letters picked without replacement from ydddoddmddddod? 1/182 Four letters picked without replacement from {i: 6, o: 5, w: 2}. Give prob of picking 3 o and 1 w. 4/143 Two letters picked without replacement from xxtscxzxstczhs. Give prob of picking 2 x. 6/91 Two letters picked without replacement from nfendnm. Give prob of picking 1 e and 1 m. 1/21 Calculate prob of picking 1 q and 1 c when two letters picked without replacement from feqfqcfqqqqxfefxqffc. 7/95 Four letters picked without replacement from ccisscciii. Give prob of picking 3 c and 1 i. 8/105 Two letters picked without replacement from {c: 5, q: 5, v: 6, j: 1}. Give prob of picking 1 q and 1 v. 15/68 Calculate prob of picking 1 h and 2 f when three letters picked without replacement from {f: 6, j: 2, h: 4}. 3/11 Three letters picked without replacement from zmzmzmm. What is prob of picking 3 m? 4/35 What is prob of picking 1 b and 1 q when two letters picked without replacement from {d: 2, b: 5, q: 9, p: 2}? 5/17 Two letters picked without replacement from baljbqj. Give prob of picking 1 b and 1 q. 2/21 What is prob of picking 1 t, 1 m, and 1 x when three letters picked without replacement from mgmxtmgmggtmtttmt? 9/170 Three letters picked without replacement from {f: 1, y: 1, o: 1, k: 1, g: 1}. Give prob of picking 1 o, 1 k, and 1 f. 1/10 Four letters picked without replacement from {j: 2, t: 3, w: 13}. Give prob of picking 3 t and 1 j. 1/1530 Calculate prob of picking 2 c when two letters picked without replacement from hchhhhcchcchhh. 10/91 Four letters picked without replacement from jggjzjjjggzjjg. Give prob of picking 3 g and 1 j. 10/143 Two letters picked without replacement from vvnvvnnv. What is prob of picking 2 v? 5/14 What is prob of picking 1 n, 1 i, 1 s, and 1 j when four letters picked without replacement from innisninsj? 4/35 Three letters picked without replacement from ymxllxyjyjyyxyx. What is prob of p	{ "pile_set_name": "DM Mathematics" }
nd derivative of -3m + 8m*4 + 2m + 0m - 5m wrt m. 96m2 What is the third derivative of -1 - 19a*2 + 20a*2 - 30a*6 - 6 wrt a? -3600a*3 Let x(z) be the first derivative of -3/2z*2 + 0z*3 - 3 + 0z - 1/5z5 + 0z*4. Find the second derivative of x(s) wrt s. -12s*2 Let r(m) be the third derivative of 1/20m*6 + 0 + 0m - 7m2 + 0m*5 + 5/6m*3 + 0m*4. Differentiate r(s) with respect to s. 18s2 Let r(p) = -p3 + 2p2 + 2p - 3. Let y(v) = 3v3 - 9v*2 - 9v + 13. Let x(w) = -9r(w) - 2y(w). Differentiate x(h) with respect to h. 9h2 Let c be 11/3 - (-4)/(-6). What is the second derivative of -19w + 6w + cw - 7w2 + 7w wrt w? -14 Suppose -1 + 5 = 2h. Let g be (-5 - -6)/(3 + 15/(-6)). What is the third derivative of 4r*6 - 3r*2 + gr*h - 3r*6 wrt r? 120r3 Let w(b) be the first derivative of b6/30 - b*2 + 3b - 1. Let n(a) be the first derivative of w(a). Find the first derivative of n(z) wrt z. 4z3 Let m(s) = 2s4 - s3 + s - 1. Let d(b) = b3 - b - 1. Let n(t) = -t3 - 12t2 + 1. Let w be n(-12). Let g(f) = wm(f) + d(f). Differentiate g(k) wrt k. 8k3 Suppose 2u = 4j - 0j - 130, -5u - 46 = -j. What is the first derivative of -l2 + l2 - 23 + j + 7l*3 wrt l? 21l*2 Let c(o) be the first derivative of 3o4/2 - o3/3 + 47o2/2 + 21. What is the second derivative of c(p) wrt p? 36p - 2 Let c(a) be the first derivative of 0a + 2/5a*5 + 0a*4 + 0a*3 + 1 + 2a*2. Find the second derivative of c(w) wrt w. 24w*2 Let j = -10 + 15. Find the second derivative of -7r + r*5 - 1 + 1 - 7r*j wrt r. -120r*3 Let o(p) = -14p + 17. Let l(u) = 13u - 16. Let d(n) = -4l(n) - 3o(n). Differentiate d(g) with respect to g. -10 Let p(t) be the second derivative of -19t5/20 + t2 + t. What is the derivative of p(v) wrt v? -57v2 Find the first derivative of 2h*2 - 6h*2 + 3h*4 + 4h*2 + 5 wrt h. 12h*3 Let w(x) be the third derivative of 0x*4 - 3x*2 + 1/210x*7 + 0x*5 + 7/6x*3 + 0x + 0 + 0x6. Find the first derivative of w(g) wrt g. 4g*3 Find the second derivative of 10l - 6l - 3l - 7l - 6l*2 wrt l. -12 Find the first derivative of 29 + 2w*4 + 2w*4 - 32 - 10w*4 wrt w. -24w*3 Find the third derivative of -d - 6d*2 - 12d*2 + 4d*3 + d wrt d. 24 Let j(a) = a + 8. Let d be j(-4). Let h = 1 + d. Find the second derivative of 2 + 3 + 4k - h + 3k4 wrt k. 36k*2 What is the third derivative of 235i - 3i3 - 235i + 8i2 wrt i? -18 Let r(v) = -3. Let y be -102/4. Let j be -2 - (1 - 1 - y). Let n(u) = u - 13. Let m(s) = jn(s) + 9r(s). Differentiate m(h) with respect to h. -2 Let m = 24 - 18. What is the third derivative of 0s*6 - 4s*6 - 2s*2 + 5s2 + sm wrt s? -360s3 Find the second derivative of 62q*4 - 26q - 123q4 + 31q*4 wrt q. -360q*2 Suppose -4l - 36 = 4b, -25 = 4l + l. Let s be (-62)/(-22) - b/22. Find the first derivative of 0a4 - 5 + 2 + sa*4 wrt a. 12a*3 Find the first derivative of -8r*4 + 13 + 19r*4 - 27r*4 wrt r. -64r*3 Let r(g) = 10g - 3 - 7 - g*2 + 3. Let x be r(9). What is the first derivative of -1 - 3 - y + x wrt y? -1 Find the first derivative of 6k + 6 - 7k + 2k wrt k. 1 Suppose -2y + 5y = -4a + 25, -2y - 4a = -14. Let o = y + -8. What is the second derivative of -s - 2s*4 - s + os wrt s? -24s2 Suppose -2x + 12 = x - 3z, 7 = x - 4z. What is the second derivative of 8w3 - xw*2 + 2w + 3w2 - 3w wrt w? 48w Let s(f) = 4f*4 + 6f*3 - 7f*2 - 6f - 6. Let i(q) = -q4 + q3 - q*2 - q - 1. Let b(y) = -6i(y) + s(y). What is the third derivative of b(w) wrt w? 240w Suppose 5m - 4 = 6. What is the third derivative of -2u2 + 3u*3 + 2um - u2 wrt u? 18 Let f(p) be the second derivative of p + 1/21p7 + 1/4p*4 + 0 + 0p*3 + 0p*6 + 0p*5 + 0p*2. What is the third derivative of f(k) wrt k? 120k*2 Let p be (-10)/(-4)6/5. What is the second derivative of 0b3 + 3b*3 + 2b*3 - 6b*3 - pb wrt b? -6b Let c(p) be the second derivative of 11p*3/6 - 7p*2 - 10p + 3. Differentiate c(g) wrt g. 11 Let c(q) = q*3 - 1. Let r(a) = -5a*3 + 9a - 3. Let b(o) = 3c(o) - r(o). Find the second derivative of b(h) wrt h. 48h Let p(s) = -5s2. Let l(r) = -r2 - r - 5. Let u be l(0). Let g(t) = -t. Let i(o) = ug(o) + p(o). What is the second derivative of i(a) wrt a? -10 Let k(t) be the first derivative of 5/4t4 + 0t2 + 2 + t3 + 0t. Find the third derivative of k(m) wrt m. 30 Let i = 7 + -4. Find the second derivative of -3 + 6 + if + 3f2 - 3 wrt f. 6 Let i be -1(-6 - (-2 - 0)). What is the third derivative of 3ui + 2u*4 - 2u*2 - 4u*4 wrt u? 24u Let o(s) = -s - 5. Let z be o(-7). Find the second derivative of -zg2 - g5 + 2g2 + g - g5 wrt g. -40g3 Let q(h) = h3 - 15h2 + 1. Let i(c) = -c4 - c*3 - 1. Let j(f) = -i(f) - q(f). What is the third derivative of j(g) wrt g? 24g Find the second derivative of -9u + 2u*5 + 0u - 2u + 0u wrt u. 40u3 Let a(k) be the first derivative of k6/72 + k5/40 - 8k3/3 - 2. Let x(m) be the third derivative of a(m). Find the second derivative of x(v) wrt v. 10 Let k(z) be the third derivative of z6/10 + 7z3/6 + 4z*2. Differentiate k(q) wrt q. 36q*2 Let a(f) be the first derivative of -25f*6/6 + 16f*3 - 46. What is the third derivative of a(u) wrt u? -1500u2 Let j(g) be the third derivative of -g8/48 - g4/8 + g2. Find the second derivative of j(p) wrt p. -140p3 Find the second derivative of -84 + 84 - 17n - 14n2 wrt n. -28 Let t(h) be the first derivative of 0h*4 - 3 - 4/5h*5 + 0h*3 + 0h*2 + 2h. What is the derivative of t(n) wrt n? -16n3 Let y(z) be the first derivative of -2z6/3 - z3 - 3. Find the third derivative of y(t) wrt t. -240t2 Let j(f) = f3 - 3f*2 - f - 1. Let z be j(3). Let s be 4/8 - 18/z. Find the second derivative of -2o*s - o - 3o + 3o + o5 wrt o. -20o*3 Differentiate -16f + 1 - 3f - 5f + f wrt f. -23 Let h(d) be the third derivative of 0d7 + 0d + 0d5 + 7/24d*4 + 0 + 1/168d8 - d2 + 0d6 + 0d*3. Find the second derivative of h(p) wrt p. 40p*3 Let b = -22 + 22. Let l(u) be the first derivative of bu4 + u2 + 0u5 + 0u + 0u3 + 1 + 1/3u*6. What is the second derivative of l(w) wrt w? 40w*3 Let q(o) = -3o + o + o - 6. Let b be q(-10). Differentiate 2 + 2xb - x3 + x3 with respect to x. 8x*3 Let y(x) be the first derivative of 13x*5/5 + 5x*2 - 5. Find the second derivative of y(h) wrt h. 156h*2 What is the third derivative of 3y*2 - 7y*2 + 2y2 - y2 + 4y5 wrt y? 240y*2 Find the second derivative of 5j - 26j5 + 10j*5 + 27j*5 wrt j. 220j*3 Let f(q) be the first derivative of 3q*4/2 + 14q*3/3 - 15. What is the third derivative of f(k) wrt k? 36 Let z(w) be the second derivative of -9w*5/20 - 3w*4/4 + w. What is the third derivative of z(l) wrt l? -54 Let p(y) be the first derivative of -5y*6/6 + 3y*2 + 1. What is the second derivative of p(x) wrt x? -100x3 Let m(o) be the first derivative of o5/20 - 5o4/24 + 2o*3/3 - 5. Let x(i) be the third derivative of m(i). What is the first derivative of x(p) wrt p? 6 Let n(i) = -2i*3 - 5i2 + 6. Let w(p) = -p2 - 1. Let q be w(-2). Let o(c) = 3c3 + 6c*2 - 7. Let x(s) = qo(s) - 6n(s). Differentiate x(d) wrt d. -9d*2 What is the derivative of -7 - 3 + 1 - 4 + 3b*2 wrt b? 6b Let c(p) = p*3 + p + 1. Let n(s) = 10s*4 - 4s*3 - 4s - 5. Let f(y) = 4c(y) + n(y). What is the first derivative of f(r) wrt r? 40r*3 Let z(h) be the third derivative of 1/30h*5 - 4h*2 + 0 + 1/3h*3 + 0h + 0h4. Find the first derivative of z(k) wrt k. 4k Let l(p) = p - 7. Let v be l(7). Let u(i) = i*3 + i + 5. Let z be u(v). Find the third derivative of -3y2 + y2 + 0y5 + yz wrt y. 60y*2 Let g(i) be the first derivative of -7 + 0i*3 + 5/2i*4 + 4i + 0i2. Differentiate g(m) wrt m. 30m*2 Let s(n) be the second derivative of -5n*3/3 - 19n*2 + 16n. What is the derivative of s(r) wrt r? -10 Let a(t) = -t*3 - t - 1. Let o be a(-1). Let m be (2 - o) + 0 + 1. Differentiate 0 + 4 - 2 + 2v**m with respect to v	{ "pile_set_name": "DM Mathematics" }
o - 16. What is the hundreds digit of h(x)? 1 Let u(l) = 5l + 30. Let o be u(-6). Suppose 4y - 2f - 436 = o, 9y - f - 434 = 5y. What is the units digit of y? 8 Suppose -8k + 124 + 252 = 0. Let t = k - 44. Let w = t - -67. What is the units digit of w? 0 Suppose -12j + 3j + 279 = 0. Suppose jw = -3k + 30w + 1351, 4k - 1801 = -w. What is the tens digit of k? 5 Suppose -69331 = -n + d, -89n = -92n - 4d + 207979. What is the tens digit of n? 2 Let o(m) = -m + 1. Let u be o(-10). Suppose u = -3q - 4. What is the units digit of (-848)/(-4) - q - 2? 5 Let h(y) = -y*3 + 3y*2 + 4y + 5. Let z be h(4). Let l = 1069 + -819. Suppose 0 = -zu - 4c + l, 2c + 22 = u - 42. What is the tens digit of u? 5 Suppose -3q = -4n + 18, -24 = -4n + 2q - 8. What is the units digit of (-171)/(-38)28/n? 2 Suppose 0 = 19q - 21q + 20. Suppose 0 = -qs + 2164 + 236. What is the tens digit of s? 4 What is the thousands digit of ((-200311)/(-8) - -2) + 0 - (-2)/16? 5 Let d be 164 + ((-3)/(-5))/(4/60). Let u(o) = -3o*2 + 2o + 1. Let q be u(4). Let x = d - q. What is the units digit of x? 2 Let v = -394 - -422. What is the units digit of (-873)/(-7) + 1 + (-20)/v? 5 Let a = 69 - 66. Suppose -ac = 0, -6 + 1 = s - 3c. Let f(u) = 5u2 - 2u - 8. What is the tens digit of f(s)? 2 Suppose -17w + 12 = -21w, 3p = 2w + 3. Let k be (-4)/(-14) - (-5)/7. What is the tens digit of 4 - ((k - p) + -75)? 7 What is the ten thousands digit of (-177056)/40(-21 + 11)? 4 Suppose 83 + 1237 = 6r. Suppose 4c = -5h + c - 655, 251 = -2h + c. Let k = r + h. What is the tens digit of k? 9 Let i(k) = 675k + 625. What is the units digit of i(47)? 0 Let f = 15 - 11. Suppose -5q + 190 = 5j, 4q - j = -fj + 150. What is the units digit of 2/8 + 4203/q? 7 Let v(m) = 2m3 - 9m*2 + 11m - 7. Let w be v(8). Suppose 80z - 99z + 5529 = 0. Suppose -5f + w = -z. What is the tens digit of f? 6 Suppose 4u - 351 - 349 = 0. Suppose -3v = 15, 0 = f - 4f - 4v + u. What is the units digit of f? 5 Suppose 5d + 651 = 2551. Suppose n + 138 = d. Let j = n + -110. What is the units digit of j? 2 Let m = 7577 + 8113. What is the thousands digit of m? 5 Let i = -151 + 703. Suppose 2h + 2g = i, g - 1092 = -4h - 0g. What is the units digit of h? 2 Suppose -4u - z = -19, -2u - z - 2z - 3 = 0. Suppose uq + 3 = 15. Suppose 4w - 852 = -3g, w = -w + qg + 412. What is the units digit of w? 0 Suppose 5b - 19b - 701856 = -30b. What is the units digit of b? 6 Suppose -8i + 145 + 31 = 0. What is the tens digit of ((-1676)/i)/((-4)/44)? 3 Suppose 0 = -2t - 5l + 59220, 13t - 9t - 118410 = 5l. What is the hundreds digit of t? 6 What is the hundreds digit of (-27496264)/(-602) - (-30)/105(-2)/(-4)? 6 Let q(j) = 541j*2 - 21 - 538j*2 + 0 - 6j. Let g(f) = -f*3 + 20f*2 + 20f + 17. Let s be g(21). What is the units digit of q(s)? 1 Suppose 3h - x = 6867, 17h + 4585 = 19h - 3x. Let m = h - 1604. What is the tens digit of m? 8 Suppose 4w + 270 = 4r + r, -3r + w + 169 = 0. Suppose -s + 4z + 8 = 0, -5s - 18 = -z - r. Let l(x) = 7x + 25. What is the units digit of l(s)? 1 Suppose 62t + 14 = 64t. Suppose tl + 75 = 47. What is the hundreds digit of (4/5)/(l/(-740))? 1 What is the ten thousands digit of (((-6615)/84)/35)/(3/(-21616))? 1 Let p = -34 - -39. Let c(a) = -4 + 2 + p - 1 - 13a. What is the tens digit of c(-4)? 5 What is the units digit of 10 + 1 + (9446 - 26)? 1 Suppose -409584 = -234n + 213n. What is the units digit of n? 4 Suppose 121f + 15 = 116f. Let g(a) = -a3 + a2 - 5a - 2. Let z be g(f). Let r = z + 65. What is the tens digit of r? 1 Let o be 23756/(-6)2/4. Let j = -165 - o. What is the hundreds digit of j? 4 Let w = -3825 + 5770. What is the hundreds digit of w? 9 What is the hundreds digit of (25 + 12642)/((-2)/(-10)5)? 6 What is the hundreds digit of (-15 - -31) + -17 + 22615 + (-1)/1? 6 Let f = -66 - -74. Suppose 2c + f = 0, -m = 4m + c - 1386. What is the units digit of m? 8 Let b(u) be the third derivative of 1/60u5 - 7/6u*3 + 17u*2 + 0u*4 + 0u + 0. What is the tens digit of b(12)? 3 Suppose 0 = -0n - n + 1, 2m - 1 = 3n. Suppose k - 162 = -k. Suppose -ma - 270 - 94 = -4y, y - 3a - k = 0. What is the tens digit of y? 9 Let b be (4263/(-15))/(-7)5. Let m = b - -543. What is the units digit of m? 6 Suppose -4p - 90 = -h - h, 15 = -p - h. Let v = p - -56. Suppose m = 56 + v. What is the units digit of m? 2 Let i(s) = 383s2 + 79s + 87. What is the hundreds digit of i(-6)? 4 Let f(z) = 3z2 - 23z + 83. What is the tens digit of f(42)? 0 Suppose g + 4s - 184 = 0, 4g - 204 = 2s + 496. Suppose -85 = -c + g. What is the units digit of c? 1 Suppose 0 = -4g - 3j + 35300, -g + 3j + 8825 = 8j. What is the hundreds digit of g? 8 Let t(c) = 7427c*2 - 123c + 125. What is the hundreds digit of t(1)? 4 Let s = -360 + 352. What is the tens digit of 3-1s/6 + 1074? 7 Let x(y) = 5y3 - 75y*2 + 33y - 183. What is the ten thousands digit of x(20)? 1 Let v(s) = s + 25. Let p be v(-23). Suppose -3z - pz - 195 = 5r, -5z + 45 = -r. Let w = 47 + r. What is the units digit of w? 7 Let s = 8836 - 131. What is the hundreds digit of s? 7 Suppose -18b - 130 = -23b. Suppose 16s - bs + 10660 = 0. What is the thousands digit of s? 1 Suppose 2d + 8391 = 9d - 4706. What is the hundreds digit of d? 8 Suppose -q = -10q + 27. Let n(w) = -92w + 2. Let p be n(-1). Suppose 505 = qj + s + p, -402 = -3j + 2s. What is the units digit of j? 6 Let u(x) = 2x*2 - 23x + 30. Let h be u(10). Suppose h = 3i + 7i - 1130. What is the tens digit of i? 1 Suppose 3o = 9, -3h - 282 = -3o - 918. Let l = 494 - h. What is the units digit of l? 9 Suppose -2f + 17 + 59 = 0. Let p = -6 + f. Suppose 0 = -23w + 25w - p. What is the tens digit of w? 1 Suppose 0l - 40 = -4l. Suppose -12r = -lr + 280. Let s = 244 + r. What is the units digit of s? 4 Let y = 897 + 32541. What is the thousands digit of y? 3 Suppose 5c - 4c - 1548 = 0. Let z = c - 712. Suppose -5n + z = 6n. What is the units digit of n? 6 Suppose -l - 6f + f + 15 = 0, -3l - 50 = -4f. Suppose 4c - c + 5j + 45 = 0, -4c - 3j = 49. What is the tens digit of (-128)/cl/(-4)? 3 Let k(n) = 5n3 + 24n*2 - 122n + 8. What is the ten thousands digit of k(14)? 1 Let l(w) be the second derivative of -156w3 - 18w*2 + 58w + 1. What is the units digit of l(-1)? 0 Suppose -3t = -3y - 57, -5t = 4y + y - 45. Suppose 460 = -10v + tv. What is the tens digit of v? 1 Suppose 0 = -y - 2s + 35427, -106257 = -697y + 694y - 2s. What is the ten thousands digit of y? 3 Suppose 2q - 4 = 4. Let c(g) = -g2 + 3g + 4. Let p be c(q). Suppose p = -y + 5y - 236. What is the tens digit of y? 5 Let s = 37 - 22. Suppose -9z + 30 = -s. Suppose zk + 100 = 505. What is the units digit of k? 1 Suppose -3s = -3h - 372, -s + 4h + 39 = -94. Suppose 27 = -q - s. Let t = q + 213. What is the tens digit of t? 6 Let b = -57 + 57. Let s(x) = -5x + 306. Let u be s(b). Suppose 6o = 264 + u. What is the tens digit of o? 9 Suppose 6q + p - 23291 = 7205, 0 = 3q - 5p - 15259. What is the units digit of q? 3 Let a = -3196 + 6499. What is the units digit of a? 3 Let k = 32 - 28. Suppose -24 = kv - 36. Suppose -4x = -5j + 182, -vj - 2x = 3x - 87. What is the units digit of j? 4 Let a(v) = -4v*3 - 22v*2 + 14v + 14. Let n be a(-6). Let z(r) = 169r2 + 3r - 9. What is the tens digit of z(n)? 7 Let v be 110/(-8)352/22. Let i = v + 49. Let m = i - -10. What is the tens digit of m? 3 Suppose 63 = 5t - 2h - h, -5h = 3t - 31. Let a(r) = -r*3 + 15r*2 - 25r - 14. Let i be a(13). What is the units digit of 1 + i - 2(-54)/t? 9 Suppose -4k + 20 + 4 = 0. Suppose -4j + kj = -3t + 3116, t = -j + 1040. What is the hundreds digit of t? 0 Let r(n) = n - 33. Let b(x) = 33. Let j(u) = 3b(u) + 4r(u). Let s be j(13). Suppose -so = -14o - 1085. What is the units digit of o? 7 Suppose -4q = 9 - 1. What is the tens digit of 115 - q/((-8)/(-4) + -4)? 1 Let x(r) = -r*2 + 7r + 8. Let i be x(8). Suppose i = 133k - 130k - 2463. What is the tens digit of k? 2 Let k = 161 + -162. Let n(m) = 683m2 - 6m - 6. What is the hundreds digit of n(k)? 6 Let w = -1264 +	{ "pile_set_name": "DM Mathematics" }
re there between 9:27 PM and 6:55 AM? 568 How many minutes are there between 10:25 AM and 7:15 PM? 530 How many minutes are there between 5:54 AM and 8:18 AM? 144 How many minutes are there between 6:42 AM and 12:58 PM? 376 How many minutes are there between 1:05 AM and 8:01 AM? 416 How many minutes are there between 1:21 AM and 6:30 AM? 309 What is 313 minutes before 3:11 AM? 9:58 PM How many minutes are there between 1:22 PM and 3:32 PM? 130 What is 444 minutes before 4:40 AM? 9:16 PM How many minutes are there between 12:54 AM and 9:53 AM? 539 How many minutes are there between 11:02 PM and 9:27 AM? 625 What is 588 minutes before 12:08 AM? 2:20 PM How many minutes are there between 7:00 AM and 4:51 PM? 591 What is 313 minutes before 9:17 AM? 4:04 AM How many minutes are there between 2:03 AM and 4:04 AM? 121 How many minutes are there between 7:14 PM and 9:48 PM? 154 What is 564 minutes before 9:43 AM? 12:19 AM How many minutes are there between 9:03 AM and 8:19 PM? 676 How many minutes are there between 8:51 PM and 6:33 AM? 582 What is 149 minutes before 3:11 AM? 12:42 AM What is 300 minutes before 5:21 PM? 12:21 PM What is 419 minutes before 5:52 AM? 10:53 PM How many minutes are there between 4:44 AM and 12:30 PM? 466 What is 355 minutes before 6:53 AM? 12:58 AM How many minutes are there between 8:52 PM and 6:34 AM? 582 How many minutes are there between 12:41 AM and 9:40 AM? 539 How many minutes are there between 5:31 PM and 10:48 PM? 317 What is 501 minutes before 3:00 AM? 6:39 PM How many minutes are there between 12:49 AM and 2:50 AM? 121 What is 204 minutes after 6:31 AM? 9:55 AM How many minutes are there between 12:48 AM and 2:26 AM? 98 How many minutes are there between 1:53 PM and 8:51 PM? 418 How many minutes are there between 12:08 PM and 9:14 PM? 546 What is 331 minutes after 5:46 PM? 11:17 PM What is 490 minutes before 4:16 PM? 8:06 AM What is 195 minutes after 6:37 PM? 9:52 PM How many minutes are there between 2:00 PM and 1:18 AM? 678 What is 6 minutes before 6:35 PM? 6:29 PM What is 508 minutes before 1:17 AM? 4:49 PM How many minutes are there between 8:28 AM and 12:38 PM? 250 How many minutes are there between 9:20 AM and 9:55 AM? 35 What is 353 minutes before 1:03 PM? 7:10 AM How many minutes are there between 10:22 PM and 4:47 AM? 385 What is 703 minutes after 9:41 AM? 9:24 PM What is 325 minutes after 11:06 PM? 4:31 AM How many minutes are there between 11:15 PM and 11:29 PM? 14 How many minutes are there between 6:48 PM and 7:36 PM? 48 How many minutes are there between 1:27 AM and 8:09 AM? 402 How many minutes are there between 9:49 PM and 3:55 AM? 366 What is 372 minutes before 12:16 PM? 6:04 AM What is 547 minutes before 11:00 PM? 1:53 PM How many minutes are there between 12:29 AM and 11:15 AM? 646 What is 223 minutes before 8:22 AM? 4:39 AM What is 443 minutes before 8:51 PM? 1:28 PM What is 667 minutes before 2:54 AM? 3:47 PM What is 345 minutes after 4:31 PM? 10:16 PM What is 560 minutes before 2:01 AM? 4:41 PM How many minutes are there between 7:39 PM and 3:50 AM? 491 What is 167 minutes after 1:45 AM? 4:32 AM How many minutes are there between 8:53 AM and 9:37 AM? 44 What is 92 minutes before 11:32 AM? 10:00 AM What is 630 minutes after 8:21 PM? 6:51 AM What is 520 minutes after 4:10 AM? 12:50 PM What is 448 minutes after 5:41 AM? 1:09 PM How many minutes are there between 7:23 PM and 9:56 PM? 153 What is 543 minutes before 10:30 AM? 1:27 AM How many minutes are there between 8:38 AM and 7:48 PM? 670 How many minutes are there between 8:22 PM and 1:46 AM? 324 What is 459 minutes after 9:21 PM? 5:00 AM How many minutes are there between 5:02 AM and 9:28 AM? 266 What is 171 minutes before 5:31 PM? 2:40 PM What is 204 minutes before 11:19 AM? 7:55 AM How many minutes are there between 12:52 PM and 1:43 PM? 51 How many minutes are there between 12:43 PM and 4:49 PM? 246 How many minutes are there between 10:33 PM and 10:19 AM? 706 What is 211 minutes after 11:54 AM? 3:25 PM How many minutes are there between 3:08 AM and 7:57 AM? 289 What is 616 minutes before 9:18 PM? 11:02 AM What is 92 minutes after 2:31 AM? 4:03 AM What is 283 minutes before 7:27 PM? 2:44 PM What is 35 minutes after 11:25 AM? 12:00 PM How many minutes are there between 9:29 PM and 2:57 AM? 328 How many minutes are there between 12:28 AM and 2:18 AM? 110 How many minutes are there between 3:56 PM and 1:42 AM? 586 What is 44 minutes after 2:08 PM? 2:52 PM What is 121 minutes before 1:05 AM? 11:04 PM How many minutes are there between 3:19 AM and 3:39 AM? 20 How many minutes are there between 1:59 AM and 10:23 AM? 504 What is 60 minutes before 7:28 AM? 6:28 AM What is 573 minutes after 2:03 AM? 11:36 AM What is 123 minutes before 8:17 AM? 6:14 AM What is 446 minutes before 2:10 PM? 6:44 AM What is 126 minutes before 11:50 AM? 9:44 AM What is 586 minutes after 11:17 PM? 9:03 AM What is 582 minutes after 10:20 AM? 8:02 PM How many minutes are there between 6:42 AM and 7:33 AM? 51 What is 191 minutes after 4:28 AM? 7:39 AM What is 677 minutes before 1:17 PM? 2:00 AM What is 585 minutes after 6:15 AM? 4:00 PM What is 373 minutes before 2:39 AM? 8:26 PM What is 56 minutes before 9:25 PM? 8:29 PM What is 42 minutes before 12:31 AM? 11:49 PM What is 313 minutes before 8:25 AM? 3:12 AM What is 708 minutes after 9:44 PM? 9:32 AM How many minutes are there between 3:05 PM and 1:16 AM? 611 What is 399 minutes after 4:46 PM? 11:25 PM How many minutes are there between 2:14 AM and 8:55 AM? 401 How many minutes are there between 8:14 AM and 5:47 PM? 573 How many minutes are there between 1:32 PM and 12:50 AM? 678 What is 581 minutes after 3:36 PM? 1:17 AM How many minutes are there between 7:26 PM and 9:33 PM? 127 How many minutes are there between 5:38 PM and 11:20 PM? 342 What is 266 minutes before 9:15 PM? 4:49 PM What is 458 minutes after 3:42 AM? 11:20 AM What is 337 minutes after 5:53 PM? 11:30 PM How many minutes are there between 5:45 PM and 9:09 PM? 204 What is 231 minutes before 11:26 PM? 7:35 PM How many minutes are there between 9:23 PM and 5:25 AM? 482 What is 67 minutes after 1:59 PM? 3:06 PM What is 132 minutes after 12:33 AM? 2:45 AM How many minutes are there between 9:13 AM and 9:03 PM? 710 How many minutes are there between 6:47 PM and 4:52 AM? 605 How many minutes are there between 8:54 AM and 5:19 PM? 505 What is 398 minutes after 12:48 AM? 7:26 AM What is 482 minutes before 3:11 AM? 7:09 PM What is 652 minutes after 3:17 AM? 2:09 PM How many minutes are there between 5:23 AM and 12:26 PM? 423 What is 628 minutes before 9:59 AM? 11:31 PM What is 176 minutes after 9:47 PM? 12:43 AM What is 428 minutes after 8:46 PM? 3:54 AM How many minutes are there between 7:47 PM and 5:39 AM? 592 How many minutes are there between 5:07 PM and 3:12 AM? 605 How many minutes are there between 1:01 AM and 12:31 PM? 690 How many minutes are there between 10:39 AM and 4:55 PM? 376 What is 367 minutes after 7:36 AM? 1:43 PM How many minutes are there between 6:40 AM and 5:26 PM? 646 What is 324 minutes after 5:40 AM? 11:04 AM What is 708 minutes after 5:33 AM? 5:21 PM How many minutes are there between 1:20 AM and 8:19 AM? 419 What is 680 minutes after 11:55 AM? 11:15 PM What is 508 minutes before 9:48 AM? 1:20 AM What is 453 minutes before 6:25 AM? 10:52 PM How many minutes are there between 2:43 AM and 8:37 AM? 354 How many minutes are there between 1:54 PM and 8:21 PM? 387 What is 556 minutes before 7:56 AM? 10:40 PM What is 202 minutes before 1:48 PM? 10:26 AM How many minutes are there between 7:08 AM and 1:52 PM? 404 How many minutes are there between 8:54 AM and 1:43 PM? 289 What is 236 minutes before 6:55 AM? 2:59 AM How many minutes are there between 3:38 PM and 11:03 PM? 445 What is 543 minutes after 4:23 AM? 1:26 PM How many minutes are there between 7:12 PM and 3:14 AM? 482 What is 448 minutes before 9:53 PM? 2:25 PM What is 121 minutes after 2:48 AM? 4:49 AM What is 11 minutes after 4:49 PM? 5:00 PM What is 547 minutes before 12:46 PM? 3:39 AM How many minutes are there between 11:21 AM and 1:57 PM? 156 What is 41 minutes before 3:15 PM? 2:34 PM How many minutes are there between 9:45 AM and 10:36 AM? 51 How many minutes are there between	{ "pile_set_name": "DM Mathematics" }
9 = 0. Find the third derivative of 8a4 + a2 + 6a*4 - ka*4 wrt a. 288a Let t(y) be the second derivative of -286y4/3 - 343y*3/6 + 3y + 27. What is the second derivative of t(o) wrt o? -2288 What is the first derivative of 129n + 232 + 586 + 4457 + 3822n wrt n? 3951 Let z be (-12)/(-30) - (1 + 519/(-15)). What is the second derivative of -34x5 + 29x*5 - x - zx*5 - 10 wrt x? -780x*3 Suppose -11v + 24 = -12v. Let u = -19 - v. What is the third derivative of -37f*2 + 4f*6 - 1401f*5 + 1401f*u wrt f? 480f*3 Suppose 3r = 4r - 6. Find the third derivative of -47d*r + 43d*6 - 37d*2 - 61d*6 wrt d. -7800d*3 Let a be 1170/35 + (40/(-14))/(-5). Find the second derivative of -60i - 13i + ai*2 + 32i - 3i3 - 20i wrt i. -18i + 68 Let o(q) = -10q + 20. Let j be o(4). Let n be (-16)/(-6)(-15)/j. Find the third derivative of -21b*2 - 14b*n - 19b*2 + 34b*2 + 22b*6 wrt b. 2640b*3 Let a(j) be the first derivative of 417j*7 + 2911j*3/3 - 558. Find the third derivative of a(z) wrt z. 350280z*3 Let h(o) be the first derivative of -631o*5/5 + 13o*2/2 + 38o + 919. What is the second derivative of h(z) wrt z? -7572z2 Let m(i) = i2 + 2i + 2. Let f be m(0). Let v be (-15)/((-1 - 0)/1) - -1. What is the first derivative of fc - 26 - v + 18 wrt c? 2 Let m(r) = 9r - 6. Let k be m(2). What is the second derivative of -2 - 19h3 + 195h - 3 - kh3 + 29h*3 - 78h*2 + 6 wrt h? -12h - 156 Let a(t) be the third derivative of 0t4 + 0t*6 + 11/30t*7 + 0 + 0t + 0t5 + 14t*3 - 34t*2. Differentiate a(m) with respect to m. 308m*3 Suppose 11066p = 11047p. Let l(s) be the second derivative of ps*4 + 0 + 0s*3 + 11s + 19/20s5 - 8s*2. Find the first derivative of l(t) wrt t. 57t*2 What is the derivative of -856 + 261a*4 + 2a*2 + 2a - a*4 - 325 - 2a wrt a? 1040a3 + 4a Differentiate 1020 - 4960v2 + 6400 - 3423v*2 with respect to v. -16766v Let c(a) = 5a3 + a2. Let x be c(1). Suppose 12 = 6g - x. What is the second derivative of -2lg - 15l*3 - 11l + 3l3 wrt l? -84l Find the second derivative of 2n3 + 3270n*4 - 34 - 9n - 3n3 - 3 - 3276n*4 + 6n*5 wrt n. 120n*3 - 72n*2 - 6n What is the derivative of -228t3 + 83t + 228t3 + 26167t*4 - 26179t*4 + 3875 - 229t wrt t? -48t3 - 146 Let i be 46 - (1 + (2 - 2) - -1). Suppose -5w - 4r = r - 60, 5w - i = -r. What is the third derivative of wa2 - 7a*2 + 2a*4 + 9a*2 wrt a? 48a Differentiate -398c - 689 - 530 - 110 + 219 + 1667c wrt c. 1269 Let o(x) be the third derivative of 1411x6/120 + x5/30 + 71x4/24 - x3/6 + x*2 + 99. What is the second derivative of o(q) wrt q? 8466q + 4 What is the second derivative of 4k + 34k - 4k2 - 1089k*4 - 2k*3 - 126k*4 + 4k*2 wrt k? -14580k*2 - 12k Let i be -7 + 7 + 6 + -2. What is the second derivative of 2 - 10 + i + 2 - 2w - 4w*2 wrt w? -8 Let y(k) = -108k*4 - 21k*2 - 80k + 4689. Let t(v) = -22v4 - 4v*2 - 16v + 938. Let h(a) = 21t(a) - 4y(a). Differentiate h(i) with respect to i. -120i3 - 16 Let j(s) be the second derivative of 5033s*5/20 - 451s*4 + 7s - 117. What is the third derivative of j(w) wrt w? 30198 Let x(w) = 49w - 145. Let q be x(3). Find the second derivative of 59z*2 - 95z*2 - 106z*q - 35z - 64z wrt z. -284 Let h(y) be the first derivative of 20y*6/3 + 2y5/5 - y4/4 - y3/3 + y2 + 8y + 13080. Find the third derivative of h(d) wrt d. 2400d*2 + 48d - 6 Let p(t) be the first derivative of -7t8/120 - t4/8 + 22t*3/3 + 123. Let u(o) be the third derivative of p(o). Differentiate u(c) with respect to c. -392c*3 Let y(z) be the first derivative of 218/3z*3 - 239 - 11/2z*2 - 9z. What is the second derivative of y(m) wrt m? 436 Let m(r) = 76r - 135. Let y(h) be the first derivative of -39h*2/2 + 67h - 73. Let d(o) = 6m(o) + 13y(o). What is the first derivative of d(b) wrt b? -51 Let f(n) be the first derivative of -28n3 + 61n*2/2 - 20n - 11. Let d(o) be the first derivative of f(o). Differentiate d(b) with respect to b. -168 What is the first derivative of -109k + 94k + 15k - 1682k*3 + 3559 + 178k*3 wrt k? -4512k*2 Suppose -39q + 48q - 118035 = 0. Find the third derivative of a5 + 13115a*3 + 3a*5 - 131a*2 - qa*3 wrt a. 240a*2 Let r = 14 - 11. Let h(x) = -56x - 53. Let b be h(-1). Find the second derivative of 23c - 13c*b - 2c*3 - rc*3 wrt c. -108c Differentiate -112w3 - 277 + 3287w*4 + 112w*3 - 1293 with respect to w. 13148w*3 Suppose 7f = f - 116 + 128. Let l(v) be the first derivative of 19/3v3 + 0v + 0vf + 15 + 0v4 + v5. What is the third derivative of l(x) wrt x? 120x Suppose 308g = -3g + 1555. Let k(v) be the third derivative of 0v + 0vg + 1/30v*6 + 0 - 14v*2 - 10/3v*3 + 0v*4. Differentiate k(w) wrt w. 12w*2 Let m(b) = 325b - 1103. Let x(c) = -4c + 7. Let p(d) = 2m(d) - 4x(d). Differentiate p(t) wrt t. 666 Let x(j) be the third derivative of 0j + 13/3j3 - 8/3j*4 - 25 - 2j*2. What is the derivative of x(a) wrt a? -64 Let j = 120 - 98. Let u(l) = 9l*5 - 79l - 11. Let t(c) = -2c5 + 16c + 2. Let a(q) = jt(q) + 4u(q). Find the second derivative of a(f) wrt f. -160f3 Suppose 10n + 5i - 61 = 8n, 4i = 2n - 16. What is the second derivative of ny - 8y - 11y + y5 + 10 + 12y*4 wrt y? 20y*3 + 144y*2 Let s(i) = 5i + 10. Let c be s(-2). Suppose 3q - 37 = 4m, 0 = -q - cm - 4m + 23. Differentiate -4 + 27w4 - qw*4 - 8w*4 with respect to w. 16w*3 Let f(g) be the first derivative of -12g*5/5 - 2g*4 - 110g*3/3 - 2g + 872. What is the third derivative of f(v) wrt v? -288v - 48 Let a(k) be the first derivative of 2969k*3/3 - 1292k*2 + 1157. What is the second derivative of a(p) wrt p? 5938 Let f(g) be the third derivative of 0g*6 + 0g*5 - 24g*2 + 0g + 8/35g7 + 0 - 3/4g*4 + 1/3g*3. Find the second derivative of f(c) wrt c. 576c*2 Let x be (1 - 7) + 3 + 9. Suppose -21 = -j - xj. What is the third derivative of -13w4 + 0wj + w3 - 28w2 - w3 wrt w? -312w Let c = -15 - -36. Let f(r) = 9r - 26r + cr - 14r2. Let l(y) = -y2 + y + 1. Let z(a) = -f(a) + 4l(a). Differentiate z(k) wrt k. 20k Let o(m) = -18970m2 - 7m - 18204. Let j(w) = 25293w2 + 9w + 24272. Let h(v) = -7j(v) - 9o(v). Differentiate h(q) wrt q. -12642q Let l = 155 - 33. Suppose -4f - 2u + 106 = 0, -5f = -u - 0u - l. Differentiate fi*3 - 29 - 32i + 32i with respect to i. 75i*2 What is the third derivative of -206l*3 + 30l*2 + 43l*4 + 73l*3 + 69l*3 - 40l*4 wrt l? 72l - 384 Let j(a) be the third derivative of 0 + 73a2 + 0a - 5/6a3 - 13/4a*4. Differentiate j(x) wrt x. -78 Let q(y) be the third derivative of -2953y*6/120 + 19y5/30 - y4/24 - 4y2 - 66. Find the third derivative of q(h) wrt h. -17718 Find the third derivative of 0f*6 - 405f*5 - 1172f*2 - 304f*5 - 3f*6 + 795f*5 wrt f. -360f*3 + 5160f*2 Let u = 2 + 11. Suppose -7 = 2g - u. Find the third derivative of 3m2 + 19m*2 + 9m*g + 0m*3 + 2m*3 wrt m. 66 Suppose b + b + 5i = 28, -2b - 4i = -30. Find the second derivative of 4s - 6s + bs5 - 16s wrt s. 380s3 Suppose 5d - 5x - 232 = -12, 5d - 212 = 3x. Find the second derivative of -92 + 7c*2 - 20c - dc2 + 95 wrt c. -66 Let c(j) = -4790j*2 - 4j - 1620. Let o(s) = 4790s2 + 3s + 1626. Let i(l) = 3c(l) + 4o(l). What is the derivative of i(z) wrt z? 9580z Find the second derivative of -17w + 67w2 - 503w*5 + 73w*2 + 249w*5 + 257w*5 wrt w. 60w*3 + 280 Find the third derivative of -2v*5 - 62v*6 - 26v*2 - 20 - 4v - 18 + 60 - 20 - 2v3 wrt v. -7440v*3 - 120v*2 - 12 Let p(j) = -j + 25. Let f be p(19). What is the third derivative of -3v*4 - 4v*4 + 2v*4 - 122v*6 - 126v*6 + 258v*f - 37v*2 wrt v? 1200v*3 - 120v Let g(w) = 2w3. Let i = 132 - 133. Let d(x) = 42x*3 + 4x - 5. Let j(r) = id(r) - 5g(r). Find the second derivative of j(o) wrt o. -312o Let g be 0 - -4 - (4 + -6). Suppose 4 = -4q, -q + 20 = 5y - gq. What is the derivative of -17 + 773b2 - 773b**2 +	{ "pile_set_name": "DM Mathematics" }
aluate (16/5 - (-240)/50)/(1 + (1 - 4)). -4 What is -21 + (-4406)/(-44) + 12/(-88)? 79 Evaluate (((-80)/(-240))/(-1))/(19 + -1)2. -1/27 What is 91(27/105)/(1392/145 - 9)? 39 What is the value of (47 + -36)(-74)/10 - (-19)/(-760)-16? -81 Evaluate (-189 - -194) + (-46 - 2). -43 Calculate (5320/(-1368))/((-28)/72). 10 (-83)/(1411/1326) + 36 -42 What is (-2583)/(-105) - (-1482)/(-570)? 22 Calculate (-6)/16 + (-189)/(-4)38478/(-20988). -87 ((-2)/(-7))/((-6)/(-61)) + 730/(-26718)-61 32/7 What is the value of 111384/(-7344) + -2 + (-28)/(-24)? -16 What is the value of (-19 + (-623)/(-35))/((-6)/(-50)) - 24737/(-2465)? 3/85 What is -1375/390 - (1845/6)/(-5)? 59 Calculate (-16568)/15884 - 6/(-19). -8/11 Calculate (-5001 - -5032)(-4)/63. -62 What is the value of 968626/(-38998) - 12/74? -25 What is the value of (8 + -11)/((-895)/(-35) + -23)? -7/6 (-16)/32(-554)/4 + (3 - 26/8) 69 What is -276(804/(-135) - -6) + (-3)/(-585)-13? -37/3 What is the value of (-45)/5 - -5 - 172/(2 + 2)? -47 What is 2774/46 - 39536/(-56833)? 61 Evaluate (-300720)/(-4296)2/14. 10 What is -1(-2)/(-24)(-53 + (30 - -37))? -7/6 (-105)/(-37)(-11389)/(-16270) - 2 -1/74 Calculate 286/13 + (850 - 943). -71 ((-330)/(-550) + 139/10)/((-19)/38) -29 Evaluate ((-15)/(-22))/((-62840)/103686). -9/8 What is the value of 2/(-38) - (198968/(-4332))/119? 1/3 What is the value of 12(-8 - -7) - (60 - 95)? 23 ((-37990)/5240)/(2/8)-1 29 Evaluate -47 - 4785/(-132) - (0 + (-6)/8). -10 Calculate (51/(-170))/((-735)/(-150) + (5/(-2) - -3)). -1/18 (-3)/(21/47) - (150/100)/((-18)/60) -12/7 7905/372 - 21 - 73/340 3/85 (264/80(-6)/9)/(14/42) -33/5 Calculate (-5388)/(-228990)5/(-9). -2/153 What is ((441/11235)/(-7))/((-3)/10)? 2/107 124/(-10) - (-1593864)/110685 2 (2/(-6)-3)/((-12)/4)-917 51 Evaluate (4099/528)/((-5)/(-6) - 18/54). 15 What is the value of (-2)/(-418)-211 + (3170/1268)/(5/2)? -2/209 What is (1203/4812)/(-2 - (0 - (-39)/(-20))) + -2? -7 (((-6)/11 + 0)(78 - (-2048)/(-24)))/(-9) -4/9 What is (3520/1638)/(3/(-21))? -20/3 What is -37 - (-4122)/108 - 4? -17/6 What is 7 - (-750)/(-55)((-10065)/198)/(-61)? -48/11 Evaluate (-3)/(-14150/(-26600)). -38 What is the value of (998/17964 + (-14)/12)(-12)/25? 8/15 Calculate (-1 + -22)((-78)/(-130))/((-66)/5 + 13). 69 What is the value of (-1151783)/165102 + (8 - (-1 - -2))? 1/42 Evaluate (((-7940)/720 - -11)/(6/18))/((-2)/(-8)). -1/3 Calculate 30/(-5)1611/358. -27 1/((-374)/156) - 138/(-3795)5 -4/17 Calculate (50148/57312)/((-161)/(-32)). 4/23 Calculate -3 + (3/27 - (-33 + (-24660)/405)). 91 What is -64 - (57 + 24375/(-200))? 7/8 What is the value of 11 + (-728)/78 + (-5 - (-80)/12)? 10/3 What is the value of (-39888)/6336040 + (26/22 - (2 + -1))? -25 What is the value of (338/(-10608)-564 - 18)/(2 - 3/2)? -1/17 Calculate 195/(-702)18 + -171. -22 (3 + 0 + (-3)/6102)(-29)/(-87) -16 Calculate (2/(-171))/(122/(-183))-18. -6/19 ((-32)/(-156)108/72)/(10/10) 4/13 Evaluate (18 + 2)/4 + 4/((-256)/704). -6 Evaluate ((-6)/(-150)30)/((-104)/130). -3/2 What is 2700/405099/(-6)11? -121 Calculate (-1)/(((-823)/117 - (-30)/27) + 6). -13 Calculate ((-115)/(-138))/(98/(-6972) - 0) + 9/7. -58 Calculate (-320)/8 + 4((-702)/(-24))/9. -27 Evaluate (6533/556)/((-29)/232). -94 Calculate (12 - 3/(144/112))/22. 3/11 What is the value of (-4)/4 + (-21 - (-868)/14)? 40 Evaluate -39 + 72846/648 - 74. -7/12 Calculate (105/28)/((-5)/((-4400)/(-66))). -50 What is -81 + 764779/9435 - (-1)/(-15)? -1/111 What is -107(-4927)/(-40553) + (-1072)/62(-9)/12? -1/31 10785/(-7909) + (-3720)/(-66) 55 Evaluate 4/6(-648)/32300/90. -45 Evaluate (220/935)/(5320/9690). 3/7 Calculate (-1)/3(-540)/((-255)/(-17)) - (-9 - -143). -122 44 - 59 - 3240/(-210) 3/7 Evaluate (-198)/65 - ((-19920)/312 - -64). -16/5 Evaluate ((-11800)/1120)/(-59)(-21)/30. -1/8 What is the value of ((-308)/35 - -5) + -33(10/(-3))/10? 36/5 What is (-1 - (-113)/111)/((-4028)/(-24168))? 4/37 Calculate (-85)/68(866/(-140) + 9/(-252)6). 8 What is (528/(-384) + ((-3)/8)/(-1))-43 + 4? 47 What is 177/182993/36? 1/4 What is ((-12)/872/84)/((-1)/(7/2))? 9/2 Evaluate (-2)/(-12)4(-143)/(60632/159). -1/4 What is -428 - -387 - (-4 + (-1480)/8)? 148 What is the value of ((-316)/(-12))/(0 + 48/(-144))? -79 What is the value of (20/6)/(1/(-15)(-27200)/(-8704))? -16 ((-12)/723)/((15/1500)/(0 - -1)) -50 What is (2881/172 + -17)(645/(-207) + 3)? 2/69 Evaluate -9 + 154/(-14) - (-12528)/144. 67 -310/315 + (-2893542)/34902 -83 What is (-13 - 1096/(-88))(-132)/18? 4 Calculate (28/252)/((-1991)/4887). -3/11 What is ((-17)/289 - 3192/357) + -10? -19 Evaluate 21/(672/160) - 22. -17 Calculate (-9994)/(-28633) + (-8)/(-35 + 27) + 15/(-11). -2/137 Calculate 7/((-7)/164)(477/1272)/(3/(-4)). 82 What is 2 - (2746 - 2728)(1 + 0 - 14/6)? 26 Calculate -32 + 80 + (42/14 - 30) + 8. 29 Evaluate 145/75 - (-28)/(-6)3/42. 8/5 (6293/10788)/((-21)/153) -17/4 Evaluate (-27)/756-24 - (-11 - (-26268)/2226). 3/53 44/495-955/462 -2/21 Calculate (114/14497)/(900/(-2100)). -2/109 What is the value of (3690/(-60) - -28)-2? 67 Evaluate (-120)/7218468/570. -54 Evaluate (33/(-88))/(((-1350)/(-680))/15). -17/6 (-1)/(-5)3(-823)/(155547/(-810)) 18/7 Evaluate 2/31 - (57784/1922 - -5). -35 What is the value of (-321)/(-17) + ((-378)/6426)/(1/(-2))? 19 (-152)/(-2)883/(-1766)3/6 -19 (-38)/12426/(-115235) 4/5 What is the value of 3431/(-4818) + 10/60? -6/11 Calculate (-14608)/(-2112)(-9)/6 - -11. 5/8 What is (-1 + 21/23)((-9)/(-150))/(516/(-1720))? 2/115 What is 3880/(-100) - (-7 + (-576)/(-80))? -39 ((-12)/4(-10)/15)/((-18)/927) -103 Evaluate (((-14)/(-15))/((-188)/235))/(280/(-60)). 1/4 What is the value of 3/((-12)/(-5)) - (-152724)/(-93984)? -3/8 What is ((-12)/10 - 0)/(-16 + 2856/180)1? 9 What is -10 + (-47620)/(-4620) + (-42)/98? -4/33 What is the value of -5(1764/(-120))/(-21)(78 - 62)? -56 Evaluate ((-241)/1446 - ((-4)/30)/(428/415))/(-2). 2/107 259/(31602/(-2666)) -37 289(-382)/(-2483)39/51 34 What is ((-1209)/(-217))/39 + -12 + 11? -6/7 Evaluate ((-3)/21 - (-1292)/1596)(-3)/(-2)-61. -61 What is 4((-2)/((-120)/9))/((-13)/975-9)? 5 What is 31 + 3 - ((-2196)/(-48) + -8)? -15/4 Calculate (-56)/870 + 252/(-3654). -2/15 Evaluate 7 + (-14)/7705051. -24/11 Evaluate (6/4 + (-231)/22)(123 + -120). -27 20008/11480 + 1/(-5)3 8/7 Calculate (-9 + -21 + 32)-43. -86 Evaluate 3/21122/357(-4760)/(-2720). 33/4 What is 148/((-4848)/(-3535))? 35 What is (-6 - -1)3166/102895? -2/13 (-257640)/2204 + 153 - (0 + 36) 3/29 What is the value of ((10125/24)/(-45))/(-1539/520)? 25/3 What is (28/203 - (-132449)/(-21489)) + (1 - -5)? -1/39 (-18)/(-18) + (-195)/(-117) 8/3 What is (-5475)/(-390) - (13 + 215/30)? 1/26 What is the value of (36/(-50643))/(2328/(-19788))? 2/331 Evaluate -26514/(-83125) + (-245)/4655. -1/125 What is -67 + -2 - (-2707 + 2626)? 12 What is the value of (3(-2)/(-12))/(-50 + 25916/288 + -40)? -36 What is -108 - 132/(49104/(-39370))? -13/6 What is ((-1800)/1400)/(6/(-266)) - -22/4? 58 What is the value of ((-12)/(-32))/((-17700)/641920)? -68/5 Evaluate 17 - (-319)/(-44)(56 + -52). -12 Calculate (-10008)/33360 - (3 - (-17756)/280) - 2/7. -67 What is 4/40-5(53 + 7)? -30 ((-177)/((-59472)/(-160)))/(30/28) -4/9 What is 48 - (-1026)/(-19) - 1505/(-250)? 1/50 Evaluate 52/(-63) - (-38)/3993325/285. 2/7 Calculate 21 - 8 - (-6707)/(-513) - (-160)/(-2214). -6/41 (15 - (3 + (-50)/(-4)))/(156/(-8)) 1/39 What is the value of -1(-28)/2 + 1088516/(-78023)? 2/41 What is 2(-54)/144(-46)/69-184? -92 Evaluate (40/31242/(-35))/((-460)/65). 1/46 (-42 - (-8 - (-848)/(-24)))81/(-102) -18/17 Calculate 7/14280/(-180)9. -7 What is (528 + -270)2((-147)/(-36) - 4)? 43 What is the value of -46(115 + -117) - ((9 - 8) + (-6)/(-2))? 88 Calculate (1 - (-62)/(-36)) + (13640/279)/220. -1/2 10/(-14) - (38633928/6265)/(-408) 72/5 Evaluate 28 + (-170)/165152/6440. 39/2 What is the value of ((-458)/(-12))/(-1) + 6057/36342? -38 Evaluate -44 - 5 - (3 - ((-91)/(22 + -9))/1). -59 What is -31 + 23 - (637/(-7) + 1)? 82 What is the value of -20 - ((-26610)/1110 - -30) - -26? -1/37 (8502/(-468))/(-109)172/(-2) - 40/24 -16 Evaluate 10/((-3)/(22 + 9704/(-440))). 2/11 Evaluate 392 + -439 + (-6 - 22264/(-420)). 1/105 What i	{ "pile_set_name": "DM Mathematics" }
249, -1093272, -1093295? -1093318 What comes next: -29042, -29958, -30874? -31790 What comes next: -23353740, -23353738, -23353734, -23353728, -23353720, -23353710, -23353698? -23353684 What is the next term in -428389214, -856778427, -1285167640? -1713556853 What is next in -6569754, -6569765, -6569776, -6569787, -6569798, -6569809? -6569820 What is the next term in 370617, 1482469, 3335555, 5929875, 9265429, 13342217? 18160239 What is next in -2473868, -2473881, -2473912, -2473973, -2474076, -2474233, -2474456? -2474757 What comes next: -387084, -774318, -1161552? -1548786 What is the next term in -76748065, -153496127, -230244189? -306992251 What comes next: 551880, 1104527, 1657174, 2209821? 2762468 What is the next term in -2478306, -4956635, -7434978, -9913341, -12391730, -14870151, -17348610, -19827113? -22305666 What is next in -63551, -63636, -63775, -63968, -64215, -64516, -64871? -65280 What is the next term in -1097, -4538, -10293, -18362, -28745, -41442? -56453 What comes next: -1178, -4355, -9542, -16745, -25970, -37223, -50510, -65837? -83210 What is next in 136806, 136864, 137030, 137358, 137902? 138716 What is the next term in 5320, 21175, 47558, 84469? 131908 What comes next: 15526, 15420, 15314, 15208? 15102 What is the next term in 2442849, 2442927, 2443057, 2443239, 2443473, 2443759, 2444097? 2444487 What is the next term in 22811789, 22811728, 22811667, 22811606, 22811545? 22811484 What is next in -76616, -306003, -688150, -1223057, -1910724? -2751151 What comes next: -252892, -505802, -758698, -1011574, -1264424, -1517242, -1770022, -2022758? -2275444 What is next in -37, 599, 2553, 6485, 13055, 22923? 36749 What is next in -1626783, -1626792, -1626801, -1626810? -1626819 What is next in -4928, -9841, -14754, -19667, -24580? -29493 What is next in -83037, -332155, -747347, -1328607, -2075929, -2989307, -4068735? -5314207 What comes next: -598426, -1196793, -1795160? -2393527 What is the next term in 24977, 24946, 24909, 24878, 24865, 24882, 24941? 25054 What is the next term in 593542, 1187121, 1780702, 2374285? 2967870 What is the next term in -244581, -244599, -244617, -244635? -244653 What is next in -73238, -73205, -73160, -73097, -73010? -72893 What is next in 456071, 1824235, 4104507, 7296887, 11401375? 16417971 What is the next term in -1529, -3567, -6131, -9215, -12813? -16919 What is the next term in -6401, -9153, -13741, -20165, -28425, -38521, -50453? -64221 What is next in 430, 795, 1398, 2245, 3342, 4695? 6310 What is next in -1214250, -2428497, -3642744, -4856991, -6071238, -7285485? -8499732 What is next in -49042, -196205, -441474, -784849? -1226330 What is next in 733616, 2936308, 6607460, 11747072, 18355144? 26431676 What comes next: -1281, -2582, -3883, -5184, -6485, -7786? -9087 What is the next term in -244431, -488862, -733305, -977760, -1222227? -1466706 What comes next: -87630, -174956, -262284, -349614? -436946 What comes next: -39168141, -39168139, -39168137, -39168135, -39168133, -39168131? -39168129 What is the next term in 226705, 453449, 680233, 907057, 1133921, 1360825? 1587769 What is next in -602, -466, -148, 442, 1394? 2798 What is next in 123318166, 123318165, 123318164, 123318163, 123318162, 123318161? 123318160 What is next in -7673, -30757, -69419, -123827, -194149, -280553? -383207 What is next in -62625154, -62625157, -62625160? -62625163 What comes next: 3187901, 3187838, 3187775, 3187712, 3187649, 3187586? 3187523 What is the next term in 58335, 116056, 173777, 231498, 289219, 346940? 404661 What is next in 1422047, 5688164, 12798367, 22752656, 35551031? 51193492 What comes next: 4200, 16905, 38084, 67743, 105888, 152525, 207660, 271299? 343448 What is next in 8546150, 8546109, 8546066, 8546021, 8545974, 8545925, 8545874? 8545821 What comes next: 112207035, 224414068, 336621103, 448828140? 561035179 What comes next: -1039, -5493, -13349, -24595, -39219? -57209 What is the next term in -7128, -14222, -21278, -28296, -35276, -42218? -49122 What comes next: 3614, 7055, 10326, 13427, 16358, 19119, 21710? 24131 What is the next term in 52603, 105109, 157621, 210145, 262687? 315253 What is the next term in 19370417, 19370425, 19370423, 19370405, 19370365, 19370297? 19370195 What comes next: -1474, -11743, -39582, -93775, -183106? -316359 What is the next term in 11330, 45445, 102350, 182045, 284530, 409805, 557870? 728725 What is next in -20495, -40913, -61329, -81743, -102155, -122565? -142973 What is the next term in 284994642, 284994641, 284994640, 284994639, 284994638, 284994637? 284994636 What is the next term in -2693, -21437, -72257, -171191, -334277, -577553, -917057, -1368827? -1948901 What is next in 33898, 67919, 101978, 136093, 170282? 204563 What is the next term in -4008, -7517, -11028, -14541, -18056, -21573, -25092? -28613 What is the next term in 159324, 159311, 159298, 159285, 159272? 159259 What is next in 60338, 120931, 181524? 242117 What is next in 12454, 22215, 32008, 41827, 51666, 61519, 71380? 81243 What comes next: -13228, -106944, -361318, -856678, -1673352? -2891668 What is next in -1536227, -3072554, -4608881, -6145208? -7681535 What comes next: -6196, -24442, -54738, -97084, -151480? -217926 What is next in -5456, -43501, -146776, -347915, -679552, -1174321, -1864856, -2783791? -3963760 What comes next: -37454, -75342, -113214, -151070, -188910, -226734, -264542? -302334 What is the next term in -3546, -3975, -4406, -4839? -5274 What is the next term in 1477967, 1477965, 1477963, 1477961, 1477959, 1477957? 1477955 What comes next: 5846237, 5846238, 5846239, 5846240? 5846241 What comes next: 2708245, 2708263, 2708281, 2708299, 2708317? 2708335 What is next in -14020, -112268, -378908, -898126, -1754108, -3031040, -4813108, -7184498? -10229396 What comes next: 1193, 3383, 7005, 12059, 18545? 26463 What is next in -246272, -985008, -2216212, -3939884, -6156024? -8864632 What comes next: -10282, -20736, -31370, -42184, -53178, -64352? -75706 What is the next term in 15362, 47024, 99794, 173672, 268658, 384752? 521954 What comes next: -257, 322, 1905, 4996, 10099, 17718, 28357? 42520 What comes next: 4084080, 4084064, 4084048? 4084032 What comes next: 31796, 29809, 27832, 25871, 23932, 22021, 20144? 18307 What comes next: 1978, 2267, 886, -2165, -6886, -13277? -21338 What comes next: 349917, 699951, 1049987, 1400025, 1750065? 2100107 What comes next: 4315, -9021, -22357, -35693, -49029, -62365? -75701 What is the next term in -9213, -74485, -251655, -596673, -1165489, -2014053? -3198315 What is next in 208431, 416904, 625377? 833850 What comes next: 1416, 2590, 3306, 3336, 2452, 426, -2970, -7964? -14784 What is the next term in 345925, 346099, 346375, 346747, 347209? 347755 What comes next: 11496, 46001, 103504, 184005, 287504, 414001, 563496? 735989 What is the next term in -1577801, -1577843, -1577911, -1578011, -1578149, -1578331, -1578563? -1578851 What is the next term in -33547270, -67094444, -100641616, -134188786, -167735954, -201283120, -234830284? -268377446 What is the next term in -2545023, -2545014, -2545005, -2544996, -2544987? -2544978 What is next in -3545465, -7090925, -10636383, -14181839, -17727293, -21272745? -24818195 What comes next: -1151, -1267, -1329, -1301, -1147, -831, -317, 431? 1449 What is the next term in -456, -1212, -2270, -3630, -5292, -7256? -9522 What is next in -1714905, -3429823, -5144741, -6859659? -8574577 What is next in -81, -179, -45, 561, 1879? 4149 What is the next term in 65636, 135087, 204540, 273995, 343452, 412911? 482372 What comes next: -236998, -948037, -2133092, -3792163, -5925250, -8532353, -11613472? -15168607 What comes next: 1030, 960, 842, 676, 462? 200 What is next in 4735, 19446, 44161, 78892, 123651, 178450, 243301? 318216 What is the next term in 42580834, 85161673, 127742512, 170323351, 212904190, 255485029? 298065868 What is the next term in 325, 80, -319, -872? -1579 What is the next term in -32325, -128727, -289377, -514269, -803397, -1156755, -1574337, -2056137? -2602149 What is the next term in 1163, -2672, -6507, -10342? -14177 What comes next: -67335, -67350, -67365, -67380, -67395? -67410 What is the next term in 257, 37, -263, -595, -911, -1163, -1303? -1283 What comes next: -986549,	{ "pile_set_name": "DM Mathematics" }
)x)/x)(-2/19)/(((xxx(-17/5)x)/x)/x(-9/5)) assuming x is positive. x(-1614/4085) Simplify p*(-6)p*(-15)(p*(-1/4)p)/((p*18p)/pp) assuming p is positive. p(-157/4) Simplify (k/(k/k(3/17))k)*(-7/6)/((((kk*(-1/12)k)/kk)/k)/k(4/7)) assuming k is positive. k(-2453/1428) Simplify ((g(-1))(-1/38)(g(-2))49)(-1/4) assuming g is positive. g(3723/152) Simplify (((c/((cc/(c/(c2/c)))/c))/c)(-2)(c0)26)35 assuming c is positive. c70 Simplify (m(m/(mm*(-15)))/mm)/(m/(m/(((mm(-13))/m)/m))m)(m/m(10/9))/m13 assuming m is positive. m(143/9) Simplify g(-1/16)/(g/g(1/19))g/(g/(gggg(-7)))g*(-2/51)g assuming g is positive. g*(-62777/15504) Simplify (ddd8dd)/(dd*(-3)d)(ddd(1/27))/(d/(d/(dd*(-26))d)) assuming d is positive. d(1108/27) Simplify (a1)*48/((aa6)/(a/a(-1/56))) assuming a is positive. a(2353/56) Simplify (w(-2))*25(w/(w(-4)/w))/w0 assuming w is positive. w(-44) Simplify ((d(1/21)dd)(-1/48))12 assuming d is positive. d(-43/84) Simplify (((o(-5)o)(-37))(8/15))(-2/145) assuming o is positive. o(-2368/2175) Simplify ((h/((h/h(-18))/h))/((h(-4/17)/hh)/hh))/(h16h/(hh/(h/(h(-2/17)h)))) assuming h is positive. h*(-542/17) Simplify ((ww(-16))/(w7/w))/(ww/(w0/w))(-48) assuming w is positive. w123 Simplify (((l/((l/l(-9)ll)/l)l)/l)/l)/(ll/(ll*(3/5)))(l*(-2/5)l)44 assuming l is positive. l15 Simplify ((hhh*1hh)(5/16)(((hhhh/(h/(h/(h((hh6/hhh)/h)/h))))/h)/h)/(h/(hh*(-1)/hh)))25 assuming h is positive. h(-1775/16) Simplify ((w/w2)(-29)/((w*2/w)/(ww(1/8))))(2/63) assuming w is positive. w*(233/252) Simplify (nn*(-3/10)n/(n(nn(13/3))/n))(-3/40) assuming n is positive. n(109/400) Simplify x(1/15)xx*(2/17)(x(1/12))11 assuming x is positive. x(2143/1020) Simplify x(1/5)/(xx(-1/30))x7/x(2/51) assuming x is positive. x(1053/170) Simplify (h1)(-3)/((h(-6/11)/h)/(hh/(((hhh0/hh)/h)/hh))) assuming h is positive. h(-5/11) Simplify ((w/(w(-13/4)w))/((w*26w)/w))28 assuming w is positive. w(-637) Simplify ((a*(1/2)/aaa)/((a(-23)/a)/a))/(a/a(-1/20))(2/33) assuming a is positive. a(1454/55) Simplify (j(-6/13))(-1/64)j/(jj/(jj*(-17))j)jj*6j assuming j is positive. j*(-4157/416) Simplify ((gg(1/2))7(g(-1/4))(1/5))(-6/7) assuming g is positive. g(-627/70) Simplify ((g1)(-9)(g((g/((((ggg/(g/((g/(ggg/g1g))/g)))/g)/gg)/gg)g)/gg)/g)7)(-32) assuming g is positive. g(-608) Simplify b4/(b/(b*(-1/5)bb))(b/(bb6)b)/b9 assuming b is positive. b(-46/5) Simplify (p8/p(-9/5))/(p(pp*0)/ppp(-2/29)) assuming p is positive. p(1141/145) Simplify (s(-1/6))(-37)(s(-1/3))(5/3) assuming s is positive. s(101/18) Simplify (m(-9))*(-2/15)m*(-2/43)mmm/(m(-20)/m) assuming m is positive. m(5408/215) Simplify (((m/m(2/3))/((m/(m(7/3)m))/mm))/(m*0/(m/((mm*5/m)/m)m)))(-23) assuming m is positive. m(-46/3) Simplify (t(t(-2/3)/t)/t)8(t(2/7))9 assuming t is positive. t*(-226/21) Simplify ((jj/(jj(1/9)jj))/(j(-6/11)/jj))/((j*7j)/j(-12/5)) assuming j is positive. j(-5428/495) Simplify (y*(-1/15)yy/((y(-12)yy)/y))/(y(2/7))(-3) assuming y is positive. y(1448/105) Simplify (qq*3/qq)*(-1/5)q*7q8 assuming q is positive. q(71/5) Simplify ((i/i(2/47))/i(32/3))/(iiii/i(-32)i((i/((i4/i)/i)i)/i)/ii) assuming i is positive. i(-6445/141) Simplify ((pp(-28))/p)/p(-5/4)p/(p/(p/p(-11/4))p)(p/p32)/p assuming p is positive. p(-56) Simplify (u2/(u(2/3)/uu)u1/(uu*3u))(-7/11) assuming u is positive. u(56/33) Simplify ((mm(m*(4/9)/m)/mmm)/(m/(((m(1/6)m)/m)/m)mm))/(m(m12m)/m)27 assuming m is positive. m(-6343/18) Simplify ((m*3m)*(-26)/((mm9)/m3))(-4/15) assuming m is positive. m(148/5) Simplify ((n*2n)*12n*8n(2/11)/n)3 assuming n is positive. n(1425/11) Simplify d(-1/4)/dd12dd(-1/12)d/d(-8/7) assuming d is positive. d(290/21) Simplify (k/(k/(k*(-12)k)))*1k/k*(-19)kk(k/(k/k(-14/5)))/k assuming k is positive. k(36/5) Simplify ((v*5/vvvv/((((vv0)/v)/v)/v)vv)12)(-30/7) assuming v is positive. v(-3960/7) Simplify (d4)41(dd/d(-1/5)d)(2/107) assuming d is positive. d(87772/535) Simplify ((z*(-3/4)z)*32/((zz(-1)/z)/z(-5)))(-50) assuming z is positive. z(-200) Simplify ((h(-1/3))(-4/17)(h/h(2/5))/(h2/h))40 assuming h is positive. h(-656/51) Simplify (m19)(-8)(m(-4/5))(-3/23) assuming m is positive. m*(-17468/115) Simplify (b/((bb*3)/bb))/(b*(1/3)b)b(7/3)b/b*6b assuming b is positive. b*(-6) Simplify ((dd8)/d)31/(d(-4))(1/60) assuming d is positive. d*(3721/15) Simplify t/(ttt(-7/2))t*12((t/t(-3))/t)(-1/46) assuming t is positive. t(332/23) Simplify y(3/4)yyyy*(-2/13)y(y/y(1/3))(-4) assuming y is positive. y(301/156) Simplify (xx*(-2)x*(3/4)x(xx(2/3))(21/2))(-1/8) assuming x is positive. x(-73/32) Simplify (v/(v/((v*(1/16)v)/v)))/(v(v(-1/10)/v)/v)(vv(3/4))45 assuming v is positive. v(6393/80) Simplify (o/o(-6)ooo/(o*(-25)/o))/((o(o/(o*(-27)/o))/oo)/(o(-1/20)/o)) assuming o is positive. o(99/20) Simplify (ww(3/11))48w16/(w(2/47)/w) assuming w is positive. w(40351/517) Simplify (c(3/2)/c)(-1/13)/(c(-2/15)/c)(2/11) assuming c is positive. c(719/4290) Simplify (((g(-4))(-36/11))(-14))11 assuming g is positive. g(-2016) Simplify (a4)*(4/7)/((aa*1)/aa(-6)/a) assuming a is positive. a(58/7) Simplify ((l/(l*(2/9)l))/l)*(-1/6)(l/(ll(-13)))/ll2 assuming l is positive. l(767/54) Simplify ((w*(4/9)w*(3/5)w)/(ww/w(-1/4)wwww)34)(-2/9) assuming w is positive. w(18941/405) Simplify (j(-29)/(j/(j(2/65)/j)))/(j/(jj/(jjj/j*(-4/3)))j((j(-2/13)j)/j)/j) assuming j is positive. j*(-6659/195) Simplify ((ff/(ff(-21)f)f)(-1/4))(2/19) assuming f is positive. f(-11/19) Simplify (jj(j(2/21)/j)/j)/j(-26/5)(j*29/jj)/(jj26) assuming j is positive. j(766/105) Simplify (q3/(qq*(1/9))q*3/(q/(qq*(2/7)q)))32 assuming q is positive. q(12448/63) Simplify (((kk11)/(k/(kk/((k*(-12)k)/k))))(-6/5))(-2/93) assuming k is positive. k(20/31) Simplify (g6)*(1/15)/(gg*1/gg(-1)) assuming g is positive. g(2/5) Simplify (t(-1)/t(-10))/(t*6/(t(t/(ttt*(-8)t)t)/t)) assuming t is positive. t10 Simplify (v7vv/(((v/((v/((v((vv(-4/3))/v)/v)/vv))/v))/vv)/v)v(-1/2)/(v/(v9v)vv))(1/12) assuming v is positive. v(101/72) Simplify ((ii/(ii/i(-3/5)))/i)(4/35)/(iii(-14/9)i*1/ii) assuming i is positive. i*(-2563/1575) Simplify (aa*14a/(a*(-3/5)aa))/(a/((a18/a)/a)(aa(5/8)aa)/a) assuming a is positive. a(1079/40) Simplify (q(-3/8)qq/q(-17)q)/(q(-5)/q(9/4)) assuming q is positive. q(215/8) Simplify ((g/g(-3/7))(-17))(-2/37) assuming g is positive. g(340/259) Simplify (((g/(g/g(2/15)))/(g*(3/2)g))/(g/(g*2/gg)g2))(-2/15) assuming g is positive. g(101/225) Simplify ((n/n(-7/4))/n(3/5))/(n/n5)(1/37) assuming n is positive. n(1671/740) Simplify ((bb*(-21))/(b/(b(bb9)/bb)))/(b/b*(-27)bb)(2/89) assuming b is positive. b(-950/89) Simplify g11/(g/g35)g*(1/30)ggg*10g assuming g is positive. g(1741/30) Simplify (p(-5))*(-29)p*(2/9)p(-1/10) assuming p is positive. p(13061/90) Simplify (i14/i(9/7))/(i*(-4/7)/iii(-19)/i) assuming i is positive. i(233/7) Simplify (q/(q/(qq*(1/10))))/(q/(qq*(-1/5))q)(q3)2 assuming q is positive. q(59/10) Simplify ((w/((ww0)/w))/w(-2/9))/(w/(w/w3))35 assuming w is positive. w(-934/9) Simplify (f0f)(-2/19)(ff/(ff/f*(-9)))/ff/(f/f2) assuming f is positive. f(-154/19) Simplify o(-2/15)/(o(-2/27)/o)oo*(-15)(oo(-1/2))/o assuming o is positive. o(-3661/270) Simplify ((u(-12/11))43)3 assuming u is positive. u(-1548/11) Simplify ((n((n/((nn*(-3	{ "pile_set_name": "DM Mathematics" }
5. -202214896 Sum 1500 and 372.7. 1872.7 Work out -11.2 - -17800. 17788.8 Subtract 34931625 from 23. -34931602 What is -3 less than -0.625204? 2.374796 Work out -2791098 - 0.005. -2791098.005 Calculate -58.6291 - -174. 115.3709 -21282383 - 51 -21282434 Total of -857043605 and -0.5. -857043605.5 -661 - 443803 -444464 Add 2400 and 0.11104. 2400.11104 What is -6 plus 251172836? 251172830 Total of 450579.54 and 1.1. 450580.64 What is 0.42 less than -0.07601567? -0.49601567 Calculate 703 - -678918. 679621 91+-51409394 -51409303 What is the difference between 113859 and -216? 114075 What is 3798.0176 take away 5? 3793.0176 Calculate -761 - 1261091. -1261852 What is the difference between 296.2 and 10058.27? 9762.07 What is 3 less than -1902.4871613? -1905.4871613 What is 23517136 - 7? 23517129 Work out 59.9 - -13.2486. 73.1486 Add together 11570 and -707. 10863 Subtract -9565 from -47.2. 9517.8 3 - -318293 318296 Work out 0.11 - -29733.5926. 29733.7026 What is -6079 less than -30.463? 6048.537 What is the difference between -296941 and 106? 297047 0.01877257+85 85.01877257 Work out 0.4 + -1557.14. -1556.74 Work out -9.22 - 1661. -1670.22 Work out -64300.9144 - -1. -64299.9144 What is -4.11679686 - -0.01? -4.10679686 -158197946620 - 3 -158197946623 Put together 5 and 18.708404167. 23.708404167 What is -4286447 + 0.011? -4286446.989 What is 82125 minus 0.29? 82124.71 Total of -21.824 and -564839. -564860.824 Work out 78631604.77 + -9. 78631595.77 5304.674 - 10 5294.674 -51 + 458550 458499 Put together 4.42 and -160001294. -160001289.58 Add together 0.0867 and -1.04978. -0.96308 What is -0.10818 plus -5043876? -5043876.10818 Calculate 0.01 - -339.59775. 339.60775 What is -76282 - 52595? -128877 What is -0.3 minus -7.119156277? 6.819156277 Work out -0.2 - 449044618. -449044618.2 Work out -0.05 - -1234997. 1234996.95 What is -1246 + 35239099? 35237853 What is -6102688809 - -7? -6102688802 What is 5256 plus -0.028303? 5255.971697 2463574633+0.02 2463574633.02 What is 0.12 minus -216894? 216894.12 4208133409 + -0.2 4208133408.8 Work out -1 - 374176776. -374176777 Put together -4233 and -759. -4992 What is 10809 - -6507? 17316 Work out -11884 - -4.74. -11879.26 Put together -5472 and 3.345. -5468.655 Subtract 1.52928025 from -4. -5.52928025 44.782 + 186.9 231.682 3436.2 - -3.1 3439.3 What is the distance between 2478.71994 and -0.2? 2478.91994 What is 0.2864 minus 7931? -7930.7136 What is -55.6 minus 220554? -220609.6 -10006357 - 0.3 -10006357.3 What is 174 + 361755? 361929 8031 + -9670 -1639 What is -8893795 less than 1.06? 8893796.06 What is 0.039076 take away 0.36? -0.320924 Put together 21106025 and 0.07. 21106025.07 What is 0.5 plus -41729.8596? -41729.3596 Sum 1877076560 and -0.6. 1877076559.4 0.11 - 9267492 -9267491.89 What is -533 plus 95801? 95268 What is 2012848 less than 42372? -1970476 -10+-486949 -486959 Sum -411211324 and 57. -411211267 Sum -5 and 361113339. 361113334 What is -23514653 less than -6? 23514647 Put together 1 and -0.0001839355. 0.9998160645 Subtract 13550669 from 0.0182. -13550668.9818 Work out 0.059514 + 384. 384.059514 What is -4962202819 less than -2? 4962202817 Add together 0.006446 and 75.3. 75.306446 What is 13 minus 2753250766? -2753250753 What is 0.11804 less than -15.522? -15.64004 -0.3+98397956 98397955.7 What is 337254141 + -0.3? 337254140.7 Calculate -18404058 + -0.892. -18404058.892 Calculate -0.4 + 12707234. 12707233.6 -21939.85 - -397 -21542.85 Add together 19 and 12588.66. 12607.66 What is 1721886720 - 0? 1721886720 Put together 0.3 and -2843236821. -2843236820.7 Put together 7 and -14.374943. -7.374943 Add -48804 and 553.4. -48250.6 Sum -1973721133 and 0.2. -1973721132.8 What is 121.03 take away 231.6691? -110.6391 Add together -0.51429 and 467. 466.48571 What is the difference between -0.07 and -2170271? 2170270.93 What is 1032385666 plus -0.3? 1032385665.7 What is 169 take away -6815.125? 6984.125 What is the difference between 2.879 and -5594549? 5594551.879 2868645.8 + -303 2868342.8 Total of 105.8613 and 0.28. 106.1413 What is -0.98944 minus 4822? -4822.98944 -91433 - -7568 -83865 What is -5.02161 less than -136952? -136946.97839 Calculate -3684 - 8.995. -3692.995 What is -8569476 + -0.5? -8569476.5 -1 - 22953224 -22953225 What is -3.57246 less than -79? -75.42754 Add 14 and 341584.395. 341598.395 What is the difference between -1009 and -0.0995? 1008.9005 Total of 10469669 and 1.5. 10469670.5 Add together -0.4 and 31611921. 31611920.6 Calculate -0.11048848 + 1310. 1309.88951152 Add together -181719 and 1.439. -181717.561 -0.08175+-119.69 -119.77175 Sum 1072.6799 and 0.12. 1072.7999 Add -60.16 and -22159. -22219.16 -8.06+16057 16048.94 Total of -100993934.8 and -0.06. -100993934.86 What is -3 take away 3193923.74? -3193926.74 -74612 - 20.318 -74632.318 What is the distance between 32 and -2411.116? 2443.116 Calculate 300080 + 0.68. 300080.68 -5.8293+-64653 -64658.8293 Sum 1.09 and -2112.4. -2111.31 What is the difference between -115.2 and 938014? 938129.2 Calculate 2577371045 + 0.1. 2577371045.1 -0.1+-53687315 -53687315.1 35+7400061 7400096 What is 3.1 less than -398951? -398954.1 Work out -0.5 + -28783.7661. -28784.2661 What is 0.03 plus -95372.799? -95372.769 What is the distance between -8.547 and 0.00091? 8.54791 Work out 666 + -33433. -32767 What is 0.5 - 0.35657834? 0.14342166 Total of -0.3 and -1199367262. -1199367262.3 What is -619 plus -3209.653? -3828.653 -26 - -11.825495 -14.174505 -33.28 + 992.453 959.173 Sum -21330.6 and 0.874. -21329.726 1012351 + -4 1012347 Add together 56.6 and -1002402. -1002345.4 Sum -0.35 and 8551588.5. 8551588.15 What is -6 less than -38.4713? -32.4713 -49385.94+21 -49364.94 What is the distance between -11563818 and -2.5? 11563815.5 What is 2 - 5805829? -5805827 What is 141 + -1.1159? 139.8841 What is 635531 take away -494.4? 636025.4 What is the difference between 251367996 and 1? 251367995 Work out -288925967 + -21. -288925988 What is the difference between 81 and 12638.4589? 12557.4589 What is -0.423189 + 0.0695? -0.353689 Calculate -1065950 - 53.6. -1066003.6 Sum -0.3786654 and 0.237. -0.1416654 Sum 4 and 1141.4922903. 1145.4922903 Subtract 2160 from -13328. -15488 What is the distance between 126077 and 11? 126066 Total of -16.4165 and -0.78. -17.1965 Add -1.3 and 8044.96. 8043.66 Calculate -13 + 2420920. 2420907 Work out -24569745 + -0.4. -24569745.4 6 - 1542077204 -1542077198 Add 1895107 and 4.04. 1895111.04 What is 13855.5 less than -56? -13911.5 0.07 - 3497648652 -3497648651.93 Total of 1781 and -2174.083. -393.083 -11 - 15072448 -15072459 What is -0.19177 - -4441.7? 4441.50823 Calculate -977 - 102.2. -1079.2 Calculate 362261 - 0.08823. 362260.91177 Calculate 5 - 0.732523907. 4.267476093 16.8501+-0.6913 16.1588 What is -10932740 minus 76? -10932816 -2904208.34 - -0.069 -2904208.271 What is -5194787 - -0.594? -5194786.406 Calculate -86 + 11021575. 11021489 3310.9 - 580 2730.9 Work out 25092.733 - 125. 24967.733 0.16+1080021 1080021.16 What is 1.524 less than -825542? -825543.524 -494725+-799 -495524 25 - 19345.74 -19320.74 What is 21622.27 less than -0.02? -21622.29 Calculate -294577 - 111.9. -294688.9 Calculate -2141.5395 - 0.0221. -2141.5616 Subtract 0.1 from -57565007. -57565007.1 Sum -71 and 50903.633. 50832.633 Add -3.4917 and 229737. 229733.5083 Work out -23853404 + -0.11. -23853404.11 Add together 0.068544979 and -0.1. -0.031455021 What is the distance between 1 and -1728290.18? 1728291.18 What is the difference between 0.63 and -250357.832? 250358.462 What is 0.684 + 4064.17? 4064.854 What is 32684.7 minus -0.0775? 32684.7775 What is the difference between 15134017 and 49? 15133968 What is -4740287 take away 0.4? -4740287.4 -21.4+38098.4 38077 Work out 1.9573 - 6336. -6334.0427 16 + -3633708 -3633692 -4.00882799 + 0.4 -3.60882799 What is -0.2597 minus -412069? 412068.7403 What is -47805 minus 60.47? -47865.47 Work out -0.158 - -611338. 611337.842 Put together -14751 and 16.0692. -14734.9308 What is -2685.0264 less than -30? 2655.0264 What is the distance between 89137 and -23563.5? 112700.5 Put together -181345 and -1466. -182811 What is -14218 minus 2385? -16603 -0.6+-133844.5805 -133845.1805 123329 - -24016 147345 Calculate 0.1 - -0.04059241464.	{ "pile_set_name": "DM Mathematics" }
in decreasing order. 5, v, n Let s = -743/6 + 124. Let d = 21 - 397/19. Put s, d, 0 in decreasing order. s, d, 0 Suppose -5w = p + 3p - 36, 40 = 4p + 4w. Suppose u + 2u = 2h - 39, 3h + 24 = -u. Let q = u + p. Put 3, -4, q in ascending order. -4, q, 3 Suppose 0 = -m - 3j + 17, -3j + 18 - 6 = 0. Put -1/16, m, -4 in descending order. m, -1/16, -4 Let t = -15914/6635 - 2/1327. Sort t, -1, 1. t, -1, 1 Let s = 17.73 - 20.73. Sort -93, s, -1/2 in descending order. -1/2, s, -93 Let o = 5 + -2. Let q be 6/2(3 + 14/6). Suppose -q = 6f - 22. Put f, -1, o in increasing order. -1, f, o Suppose -2m = -5q - 21, q - 3m = 4 - 3. Let s be 3 + 6/(-24)(q - -1). Sort s, 1, 3, -3 in decreasing order. s, 3, 1, -3 Let x = -5 + 11. Suppose -5j - 18 = p, 3j + 5p - x = 2j. Put -2, 4, j in descending order. 4, -2, j Let v(l) = 8l - 101. Let t be v(13). Sort 5, 6, t in increasing order. t, 5, 6 Suppose c - 3 = -i - 36, -5i = 2c + 75. Let b = c + 26. Let l = -3 - -1. Put b, 4, l in descending order. 4, l, b Let n = -36 - -32. Let x(q) = q*3 + 4q*2 - 4q - 11. Let t be x(n). Suppose -3g = 6, h + 0h + 2g = -3. Sort h, t, 4 in increasing order. h, 4, t Let m = 460/9 - 51. Let o = -154 + 214. Let a be (18/o)/(6/(-8)). Put m, -1/11, a in descending order. m, -1/11, a Let m(u) = u2 + 5u - 16. Let x be m(-7). Sort -1, x, -4, 0 in descending order. 0, -1, x, -4 Let s = -88 + 91. Suppose 2u = 4p - 3 + 15, sp = -u - 9. Sort -0.1, 1/12, p in decreasing order. 1/12, -0.1, p Suppose h + 6 = 4h. Suppose -m = 3s + 11, 3m - 4s = -6s - 19. Sort h, 1, -2, m in ascending order. m, -2, 1, h Let y(b) = b*2 + b - 15. Let o be y(-4). Sort 8, 3, -1, o in descending order. 8, 3, -1, o Suppose -2r - 3 = 3o, 2r = -6 - 0. Sort o, -8, 5, 2 in descending order. 5, 2, o, -8 Let q = -534.9 - -534. Put -1, -2, q in increasing order. -2, -1, q Suppose 2b + z + 157 = 0, 0 = -b - 3z + 2z - 80. Let w = b + 74. Sort w, -2, 5. w, -2, 5 Let m be (-1)/((-56)/(-26)) + 6/8. Let b = 0.01 - -0.09. Put b, 3/7, m, 8 in descending order. 8, 3/7, m, b Let c = -26 - -133/5. Let x be -2 + (-23)/(-4) + -3. Let n = x - 23/20. Put c, -3, n in descending order. c, n, -3 Suppose -o = -2o + 4. Let z = 1.319 - 1.619. Sort z, o, -0.2. z, -0.2, o Let m = 18.449 + 0.451. Let a = m + -19. Sort 12, a, 1 in decreasing order. 12, 1, a Let f(d) = -d*2 - 4d - 1. Let s be f(-3). Suppose si = 7i - 25. Put 1, 0, i in increasing order. 0, 1, i Suppose -5v - 2 + 12 = 0. Suppose 0 = -t - 3l - 7, 4l + 10 = -v. Suppose 5 + 10 = 5a. Put t, a, -4 in ascending order. -4, t, a Suppose 4i = -i. Let s(f) = -2f - 73. Let v be s(-36). Sort v, -5, i, 4 in descending order. 4, i, v, -5 Let v = 5 + -4.6. Let o = 13.028 + -12.958. Sort o, -0.5, v, -0.4 in descending order. v, o, -0.4, -0.5 Let h(z) = -z*2 + 26z - 51. Let b be h(24). Let q = 1515/7 + -216. Sort 0.5, 1/3, q, b in decreasing order. 0.5, q, 1/3, b Let r be 4/(1 - 4/(-4)). Let b be ((-1)/r)/(14/140). Sort b, 1, -1 in increasing order. b, -1, 1 Let z = -1 + 1. Let l be 330/4 - (-1 - z). Let j = 85 - l. Put j, -2/3, -1 in decreasing order. j, -2/3, -1 Suppose -33y - 585 = -20y. Sort y, -3, 4 in ascending order. y, -3, 4 Let q = 0.08 - -2.92. Let b be (-42)/(-525)(6 - 16). Sort q, 0.1, b in ascending order. b, 0.1, q Suppose 2z + 2x + 36 = -2z, 3x + 46 = -5z. Let n be 30 - z2/(-4). Let l = n - 30. Sort l, 1, 5 in decreasing order. 5, 1, l Let k = -250 + 249.6. Put k, -2, 2/7, 2/61 in increasing order. -2, k, 2/61, 2/7 Let s be (-10)/8272/(-170). Sort 3, s, 0.4, 1 in descending order. 3, s, 1, 0.4 Let l(v) = -v*2 + 12v - 14. Let x be l(11). Suppose 2a - 18 = -0a. Put -5, x, 0, a in descending order. a, 0, x, -5 Suppose 2b - 2 = 3b. Let o be b/4(5 + -15). Put -12, 1, o in descending order. o, 1, -12 Let i = -118/681 + 3/454. Sort 4.5, i, -3, 5. -3, i, 4.5, 5 Suppose -7z = -20z + 26. Let y be 6/(2 + -5) + z. Sort 2, 21/5, -3/5, y in increasing order. -3/5, y, 2, 21/5 Let y be 6/(-24) - (-11)/(-4). Let x = 9 - 44/5. Put y, 3, 4, x in increasing order. y, x, 3, 4 Let w = -203 - -205. Sort 77, 5, w, -3. -3, w, 5, 77 Let t be 3/(4 - 75/18). Let h be 2/t + (-299)/468. Sort -17, -0.5, h. -17, h, -0.5 Let v = -261 - -260.8. Sort v, 5/2, 31, 0 in descending order. 31, 5/2, 0, v Let m(f) = -6f + 16. Let k be m(3). Let a = 21 - 22. Sort -5, -8, k, a in descending order. a, k, -5, -8 Let l = 2.23 - 2.4. Let x = 483.83 - 486. Let u = x - l. Put u, 5, 3 in decreasing order. 5, 3, u Let j be 1/3 - 68/(-12). Suppose 1260 = -2z + jz. Let m be 0 - 1 - (-345)/z. Put m, -5/3, 2 in ascending order. -5/3, m, 2 Suppose 4b + 11 = -25. Let v = b + 11. Let i(f) = -f - 1. Let j be i(-4). Sort 1, v, j in ascending order. 1, v, j Let g = 3/16 - 59/144. Let s = 39.8 + -39.4. Put 4, -2, g, s in decreasing order. 4, s, g, -2 Let s be 15/(-10)(-40)/15. Let k = 0.23 - 9.23. Let x = k + 4. Sort x, 2/3, s in descending order. s, 2/3, x Let u be -2 + 2 + (4 - 2). Suppose -2t + 10 - u = 0. Sort -3, t, -5, 7 in descending order. 7, t, -3, -5 Let p(y) = -y3 - 8y - 9. Let s be p(-1). Sort 3, -1, s in decreasing order. 3, s, -1 Let p be ((-4)/(-42))/((-24)/56). Sort p, 3/2, -2, -4. -4, -2, p, 3/2 Let r = 412 + -412. Let z = 5.1 + -0.1. Sort r, -2, z. -2, r, z Let s = -9 - 2. Let z = s + 6. Let k be 8/16(0 + 2/2). Sort k, z, -3 in decreasing order. k, -3, z Let b be 5859/(-45) + 2/10. Let j be b/(-78)(-2)/20. Put -5, j, 4 in decreasing order. 4, j, -5 Let v = -153/5 + 30. Let p be (-1 + -1)2/(-1). Suppose -pj - 8 + 4 = 0. Sort v, 2/9, j in increasing order. j, v, 2/9 Let y be (45/210)/((-36)/(-14)). Let q = 9.5 - 9. Put 2/5, 7, y, q in increasing order. y, 2/5, q, 7 Let a = -676 + 1264. Suppose -4b + 496 = 4w, a = w + 4w - 3b. Let q = w + -603/5. Put q, -6, -1 in descending order. q, -1, -6 Let c = 37 + -65. Let p be 110/4 + 4/6. Let z = c + p. Sort z, 0.05, 4/3. 0.05, z, 4/3 Let c be (-3)/4 - 198/88. Suppose 11 = 3p + 2. Sort -4, c, p in ascending order. -4, c, p Let o = 18.8 - -2.2. Sort -5, o, -2, 0.5. -5, -2, 0.5, o Suppose 0 = -14g + 13g + 2. Suppose 0 = 3h + 6, 2k + h - 14 = 4h. Let l(x) = -x*3 - 3x*2 + 4x - 5. Let v be l(-4). Put k, v, g in ascending order. v, g, k Suppose -4l = q - 12, -l + 3l + 2q = 0. Put -5, 0.2, -0.3, l in increasing order. -5, -0.3, 0.2, l Let z be ((-36)/(-90))/(-21/(-55)). Put -1, z, -3 in decreasing order. z, -1, -3 Let y(r) = r - 74. Let s be y(32). Put -1, s, 5, -3 in descending order. 5, -1, -3, s Suppose 2 = -3c - 13. Let y = -21 - -127/6. Put -1/3, -0.11, c, y in decreasing order. y, -0.11, -1/3, c Suppose 3v = -5f - 59, -6v - 2f - 56 = -3v. Let w be 4 + 756/7 - 7. Let y be (-8)/14 - v/w. Put y, 0.1, -0.7 in decreasing order. 0.1, y, -0.7 Suppose -5y = -n, 4y + 3n + 9 = 2n. Suppose -k - 6j + 6 = -2j, 4k - 119 = 3j. Put 1, k, y in ascending order. y, 1, k Let p = 115 + -117. Sort p, -0.1, 0.005, -0.2. p, -0.2, -0.1, 0.005 Let n(g) = -g*3 - 15g*2 - 13g + 1. Let f be n(-14). Let q = f - -15. Sort 15, -3, q in increasing order. -3, q, 15 Let w = -597 - -601. Put -6, 1, w, -5 in descending order. w, 1, -5, -6 Let a = 46.76 + -47. Let s = -0.32 - a. Put 1, s, -0.1 in increasing order. -0.1, s, 1 Let w be 4/(-20) - (-156)/(-20). Let x = 36 + w. Let i = x - 24. Put i, -4, 5 in descending order. 5, i, -4 Let n = 1227.06 + -1227. Put 0.1, 3, n in decreasing order. 3, 0.1, n Let a = 3 - -8. Let o = a - 10.97. Let j = o - -4.97. Sort j, -0.4, 4 in ascending order. -0.4, 4, j Let g(h) = 2h3 - 2h*2 + 1. Let f be g(1). Let b be (-9)/(-3) - (-3 - 69). Suppose 12a - b = 27a. Put a, 4, f in decreasing order. 4, f, a Suppose 28 = -2a + 4l, l + 5 = 3a + 37. Let q be -118 + (-7 + 1 - -3). Let v be (-4)/a + q/440. Sort 4, 4/3, v in descending order. 4, 4/3, v Let f be 2849/945 - 6/2. Let d = f - 92/135. Let s = -8.8 + 8.7. Sort d, s, 2. d, s, 2 Let c = -0.31 - 40.69. Let i = c - -34. Sort 4/3, i, 1 in decreasing order. 4/3, 1, i Suppose 10 = -0s - 2s. Sort s, 3, 1 in ascending order. s, 1, 3 Suppose 5 - 3 = -2f. Let m = 1261 + -1256. Sort -6, 3, m, f in increasing order. -6, f, 3, m Let s be 69/6*(-17)/(-102). Put 2/13, s, -4, 3 in decreasing order. 3, s, 2/13, -4 Let y = 505 + -505.2	{ "pile_set_name": "DM Mathematics" }
b = 4 - 3.5. Sort -2, b, a, -3 in increasing order. -3, -2, b, a Let y(c) = 4c - 7. Let j be y(-2). Let b = 27 + -20. Suppose -4i = -bi - 12. Sort -2/11, j, 4, i in increasing order. j, i, -2/11, 4 Let r = 5283 - 5284. Let a = 3.87 - -0.13. Sort -1/26, 4/7, a, r in descending order. a, 4/7, -1/26, r Let l = 12.25 - 14. Let r = l + -0.25. Suppose -42 - 18 = -15f. Sort r, f, 1/2, -0.2 in ascending order. r, -0.2, 1/2, f Let x = 0.26 + 3.74. Let b(w) = -5w - 29. Let r be b(-5). Let k = -22/17 - -139/68. Put x, 2/3, r, k in increasing order. r, 2/3, k, x Let i = 206 - 238.9. Let v = -33 - i. Let q = 12 + 8. Sort 1, v, q, 2. v, 1, 2, q Let b = 506/7 + -72. Let c = -118.01 + 118. Put c, b, 3/2, 4 in decreasing order. 4, 3/2, b, c Let y = 6113 + -6091. Let l = 5 + -2. Sort y, l, -4 in descending order. y, l, -4 Let v(n) = n3 - 48n*2 + 58n - 521. Let a be v(47). Let k(c) = c*2 - 35. Let l be k(-6). Put a, 3, 4, l in increasing order. a, l, 3, 4 Let v be (0 - -2)/2 - 3/(-1). Let j(l) = 8l + 13. Let a(w) = 3w + 4. Let t(r) = -11a(r) + 4j(r). Let g be t(7). Sort -6, v, 3, g in increasing order. -6, g, 3, v Let k = -71 - -47. Let l(y) = 8y + 192. Let t be l(k). Put 4, 89, t in descending order. 89, 4, t Suppose 30n - 87 = 423. Suppose 0 = 3k - 6 + 105. Let o be (-6)/k + (-86)/110. Sort -2, -1/4, n, o in decreasing order. n, -1/4, o, -2 Let b be (-5)/(-1)136/340. Suppose 12 = -5t + bt. Put 4, t, 3, -8 in ascending order. -8, t, 3, 4 Suppose 5s = s. Suppose -h = -sh - 5z - 27, -3h - 3z = 9. Suppose 0 = -2n - 6 + 8. Sort h, 3, n in increasing order. n, h, 3 Let t be 2/11/1. Suppose v + 17 = -11v - 5v. Put -6, t, v in decreasing order. t, v, -6 Suppose 13r - 49 - 53 = 15. Put r, 2, -5, 4, -8 in descending order. r, 4, 2, -5, -8 Let p = -4 + 3. Let b = p - -2. Let n be (((-12)/(-30))/((-2)/9))/((-18)/60). Sort 5, n, b in decreasing order. n, 5, b Let u be 2 - (-5 + 4 - -5). Let n = -70.3 + 96.3. Put -0.3, n, u in increasing order. u, -0.3, n Let a = -5 - -8. Let s = -22481 - -22477. Sort s, 0, 39, a in descending order. 39, a, 0, s Let c = 302 - 255. Suppose -3b = 47 - c. Sort 2, -0.3, 0.06, b in increasing order. -0.3, b, 0.06, 2 Let d be ((-8)/(-20))/((-106)/(-40) - 20/16). Sort d, 3, -1/7, 5, 0.3 in decreasing order. 5, 3, 0.3, d, -1/7 Let j = -6919 + 6916. Sort -0.2, j, -8/9, 0.5, -3/2 in descending order. 0.5, -0.2, -8/9, -3/2, j Let o be (0 + -3)/(-18) - 418/(-12). Suppose o = -13z + 230. Put -3, z, 2, -4 in descending order. z, 2, -3, -4 Let n(f) = f3 - 11f*2 + f - 7. Let i be n(11). Let x(a) = 4a*2 - 8a - 2. Let q be x(1). Put q, i, -4 in ascending order. q, -4, i Let v = -0.15 + -0.05. Let r = -0.063 - 0.337. Let z be (90/(-105))/((-5)/((-70)/(-16))). Sort z, r, v, 1/6 in ascending order. r, v, 1/6, z Let z(k) = -k*2 - k + 22. Let g be z(-6). Let d = -11 - g. Put d, 3, -153 in increasing order. -153, d, 3 Suppose 3v - 20606 + 20603 = 0. Let m = 50 + -110. Put v, m, -1 in decreasing order. v, -1, m Let g be 12/(-5) + 2 - (-48)/20. Suppose -31 = -6w - 1. Put -1, g, w, 3 in ascending order. -1, g, 3, w Let v = -135.82 - -135. Let w = v - -0.52. Sort 0, w, 5/6 in decreasing order. 5/6, 0, w Let k = -2191 - -2191.5. Let t = 51/4 + -25/2. Sort 4/5, t, k, 0.96 in increasing order. t, k, 4/5, 0.96 Let i = -9207.204 + 9207. Sort i, 0.2, 6 in decreasing order. 6, 0.2, i Let n = 5574 + -5570. Sort 1, n, 282, -1, 0 in descending order. 282, n, 1, 0, -1 Suppose j - 4m - 15 = -2, 2j = -2m - 14. Let s = 4 + j. Suppose 6g + 4l = 10g + 4, 2l + 6 = 4g. Sort s, 3, g in descending order. g, 3, s Let c = -1152.6 - -1154.6. Put 0.5, c, 0.035, -3, 5 in ascending order. -3, 0.035, 0.5, c, 5 Let i = 1644 - 1649. Sort 0.1, 7.5, i in decreasing order. 7.5, 0.1, i Let h(x) = x3 + x + 1. Let g be h(0). Let u be (-1 - (6 - g)) + 3. Suppose -11z - 5 = 6. Put u, z, -35, 3 in decreasing order. 3, z, u, -35 Let y = 2738 - 2737. Let p(r) = r - 10. Let i be p(6). Sort i, 0, -0.22, y. i, -0.22, 0, y Let m(w) = w*3 - 7w - 71w2 - 14w + 52w2 + 20. Let u be m(20). Let v(f) = f2 + 3f - 8. Let r be v(-4). Sort u, r, -2. r, -2, u Let u be (35/(315/18))/((-6)/(-3)). Sort u, -4, -12, -7, 2 in decreasing order. 2, u, -4, -7, -12 Let d(u) = -8u + 1. Suppose s + 3s + 0s = 0. Let c be d(s). Sort -2, c, 5, 1/12 in descending order. 5, c, 1/12, -2 Let q = -2.7999 - 0.2001. Sort 25, -2/11, q, -0.07. q, -2/11, -0.07, 25 Suppose -48h + 28 = -72 - 44. Let c = 1 + 7. Sort 11, h, c in decreasing order. 11, c, h Let u = 7862 + -7530. Sort u, -4, -2, 5, -3. -4, -3, -2, 5, u Let k = 5 - 8. Let g(m) = -m*2 + 3m - 7. Let r be g(3). Suppose j + 1 - 19 = 4q, 2q + 14 = 3j. Put j, r, -4, k in increasing order. r, -4, k, j Suppose 99k + 1260 = 103k. Let b be 1190/k - (-2)/9. Let l = -2.9 - -3. Sort l, 0, b, 5 in decreasing order. 5, b, l, 0 Let q = -781/2 - -3919/10. Let s = 7.7 - 10.7. Put s, 0.2, q in decreasing order. q, 0.2, s Let n be (-525)/(-1375) - 4/20. Let c = -2.4 + 2.23. Sort -5, c, n. -5, c, n Let w = -1.4 + 1.7. Let x = 1538 + -1533. Put x, 1/6, -0.18, w in decreasing order. x, w, 1/6, -0.18 Suppose -2 + 1 = k. Suppose -11g = -338 + 338. Let w = 34 + -29. Sort w, k, g, -5 in descending order. w, g, k, -5 Let h = 30132 + -30118. Put -5, h, -25 in decreasing order. h, -5, -25 Suppose 5o - 40 + 110 = n, -3n = -4o - 177. Let s = n - 219/4. Let g be 60/90 - 52/42. Sort g, -3, s in descending order. s, g, -3 Let i(g) = 4g*2 + 43g + 67. Let j be i(-9). Sort -18, j, 40. -18, j, 40 Let u(n) be the first derivative of 17n2/2 + 30n - 178. Let j be u(-2). Sort j, 113, 5. j, 5, 113 Suppose -7h - 78 = -99. Let o be 3 + 1 - h - (-2)/(-6). Sort 0.13, o, -0.3, 2 in decreasing order. 2, o, 0.13, -0.3 Let k be (-11 + 402/36)12. Put -4, -42, k in decreasing order. k, -4, -42 Let y = 1/60 - -33/20. Let s = 2407 - 2406.5. Sort 2/21, y, -0.1, s. -0.1, 2/21, s, y Let s = 29485 + -29482. Put -123/16, 3/4, s in decreasing order. s, 3/4, -123/16 Let r be ((-9)/96)/((-144)/192). Sort -21, -96, r. -96, -21, r Let q be ((-1236)/(-144) + -9)4. Sort 1, 2/9, q in decreasing order. 1, 2/9, q Let y(d) = d2 - 19d - 119. Let q be y(-5). Put q, 37, -3 in ascending order. -3, q, 37 Let t = 882.35 - 882. Let k = -3.47 - -0.82. Let x = t - k. Sort 1/2, x, 1, 5 in decreasing order. 5, x, 1, 1/2 Suppose -4 = -k + 5k. Let z be (92/(-207) - 6/(-9))/(1/(-9)). Put 5, z, k, -5 in increasing order. -5, z, k, 5 Let a = 0.04 + 0.06. Let z = 13.87 + -14. Let l = z + -3.87. Sort -0.4, 4, l, a. l, -0.4, a, 4 Let x be -213/(-26)1. Put 30, x, 2 in descending order. 30, 2, x Let z = -253.37 + 253. Let l = -6 + 5.93. Let f = z - l. Sort 1/3, f, -5 in ascending order. -5, f, 1/3 Suppose -5q = 3p + 46, 33p - 37p = -2q + 18. Sort -1, q, -433, -2. -433, q, -2, -1 Let s = 2581 - 2584. Let u be (2/(-4))/(15/(-36)). Sort s, 0.3, u, 2. s, 0.3, u, 2 Let p = -34 - -39. Suppose 40 = 5k + pm, -2k = -0k + m - 16. Suppose 2h = -2j + 14, j - 3j + k = -4h. Sort 0, -2, j, -0.3. -2, -0.3, 0, j Let h(s) = -s*2 - 23s + 90. Let u be h(-26). Let m(i) = i*3 - 11i*2 - 10i - 23. Let g be m(u). Put 4, g, 2, -6/7 in decreasing order. 4, 2, g, -6/7 Let t = 356 - 855. Let q = t + 456. Sort 4, -2, q, 3 in decreasing order. 4, 3, -2, q Suppose 4 = w + 9. Let q = -225 - -225. Suppose 23o + 151 - 266 = q. Sort o, -2, w, 1 in ascending order. w, -2, 1, o Let g = 2048 + -2053. Put -7, g, 2/11, 0.1, 2/15 in increasing order. -7, g, 0.1, 2/15, 2/11 Let k(c) be the first derivative of -2c*2 + 8c + 4. Let p be k(4). Suppose -x + 2n + 5 = 0, 0x = 4x - 4n - 8. Put -3, -5, p, x in ascending order. p, -5, -3, x Suppose -916i = -904i - 1860. Put -2/9, i, 25 in increasing order. -2/9, 25, i Let v(c) = -c*3 - 22c*2 + 48c + 4. Let x be v(-24). Let o be (x - -1)/54. Put o, -1/2, 0.15 in ascending order. -1/2, 0.15, o Let o = 0 - -2. Let j = 14 - 10. Let q = 84508 + -84507. Put j, q, o in decreasing order. j, o, q Let q(v) = -v - 41. Let g be q(3). Let z be -10 + (-448)/g - 5/(-33). Sort z, -2, 12/31. -2, z, 12/31 Suppose 2q + 10 = -3q, 5x - 5q - 5 = 0. Let v = -2 - x. Let s(o) = o + 1. Let y be s(3). Sort v, -4, y in increasing order. -4, v, y Suppose 0 = 2g + 4*h + 16	{ "pile_set_name": "DM Mathematics" }
istance between -434412 and 2232.5287? 436644.5287 -31137927022607 + -4 -31137927022611 0.0867 + -37850317 -37850316.9133 Calculate 13 - 34000.7589847. -33987.7589847 Work out -52 + -12633004150. -12633004202 What is -0.3 plus -412876139701? -412876139701.3 Add 5.7 and -4.429913905. 1.270086095 What is -1304740.735618 - -3.3? -1304737.435618 What is 11 - 18549623380? -18549623369 What is 16.963 - 9.0815814? 7.8814186 Calculate 35117.155 - 81739. -46621.845 What is 16 plus -3698884549? -3698884533 What is 124494993 less than 92? -124494901 What is 53231099 + -998597.5? 52232501.5 What is -2604107 minus 7230556? -9834663 Put together -67612.91 and 4495910. 4428297.09 What is 42 less than 1815625647743? 1815625647701 Calculate 11127697192 - 5. 11127697187 What is 1.78 less than -108287076642? -108287076643.78 Work out -33694275 + 5691. -33688584 Work out 61510260 - 1.492. 61510258.508 -1123395+-13320981 -14444376 Calculate 3820 + -0.87935072994. 3819.12064927006 Calculate 66530997498 - -0.04045. 66530997498.04045 What is -0.03524 less than 489.520319? 489.555559 -35132521680 + 844 -35132520836 Add together -0.02 and -0.0704835633566. -0.0904835633566 What is 109.787753 take away -1.39919? 111.186943 Work out 30.4450607226 - 0.9. 29.5450607226 Work out 111961385 - 19709. 111941676 Total of -100.63716599 and 0.0416. -100.59556599 What is -2190193998 + 38.5? -2190193959.5 Add together 14421.965 and 15325. 29746.965 What is the distance between -117.8808 and -296.88733? 179.00653 What is the distance between -30000 and 94509.4? 124509.4 Work out -27456 + 9655.929. -17800.071 What is the distance between 63 and 233341926532? 233341926469 Sum -28 and -27774228.78. -27774256.78 Add -0.3 and 1023694576. 1023694575.7 What is 8744371403278 + -1? 8744371403277 Calculate -185235160 - 0.21285. -185235160.21285 What is -54 plus 13812135177094? 13812135177040 What is the distance between -14112875 and -562874.3? 13550000.7 What is 528.9069 less than -54000? -54528.9069 What is the difference between -125085 and 679535.44? 804620.44 What is -44229924 + 154707? -44075217 Sum 2864017484.088 and 0.5. 2864017484.588 -5738775 - -92727 -5646048 Sum -126.468478037 and 0.827. -125.641478037 413896626 + -21.4 413896604.6 Subtract 1277885887 from 64. -1277885823 What is 25 take away 25188270571? -25188270546 What is the distance between -0.844534944127 and 3.3? 4.144534944127 What is -4 plus 818075042.11928? 818075038.11928 What is -28.7 minus -16.1340231598? -12.5659768402 What is the difference between 3697.77466201 and 4? 3693.77466201 What is -2.533863692 less than -1.43? 1.103863692 -2468325+-2069895 -4538220 Add together 5590 and -192571.7023. -186981.7023 What is the distance between -26261.979562402 and -0.5? 26261.479562402 Subtract -2567254 from 25770369. 28337623 What is the distance between -636 and -62672193183? 62672192547 Work out -41421678427 - -5. -41421678422 Sum 148.09 and 302.68034. 450.77034 Total of -0.5 and -0.1173941330406. -0.6173941330406 Calculate -31903986345 + 0.3. -31903986344.7 Calculate 5428706.582 + 0.074. 5428706.656 Calculate -685 - 1291720592. -1291721277 What is -1 less than 8919849891.08? 8919849892.08 What is 0.68104403416914 - 0.5? 0.18104403416914 Put together 2593262 and -175435. 2417827 What is the distance between 5541571866039 and 4.8? 5541571866034.2 Work out 24436823 + 3456. 24440279 What is -37 plus -275091197177? -275091197214 Sum 69998 and 538625. 608623 Put together -0.283426675 and -4682976. -4682976.283426675 Calculate 2.166373 - -6.722114. 8.888487 Calculate 4 - 3180986405.3. -3180986401.3 -363754506654 + -16 -363754506670 Work out 2403684 + -273923. 2129761 What is -806075509254 take away -3.7? -806075509250.3 Subtract 831 from 1492892060. 1492891229 What is 2147 less than -14986602? -14988749 Put together -1.9826 and 640189.73. 640187.7474 Calculate 464 + 1941475.7477. 1941939.7477 Work out -2592.389053 - 0.3. -2592.689053 Put together 3.1755892750204 and 0.5. 3.6755892750204 Calculate 57.1561971 + 3224. 3281.1561971 What is 0 minus -4545.530081757? 4545.530081757 What is the difference between 0.306841210782162 and -3? 3.306841210782162 What is 2.19 minus -123237022731? 123237022733.19 Add together 190471 and 537804041. 537994512 Add -3.6709 and 0.8093067. -2.8615933 What is 0.647300538 + -1.304785? -0.657484462 Sum -736 and 37362879.1. 37362143.1 What is 2750286.036595 minus 0.4? 2750285.636595 What is 457403 minus -11086.97? 468489.97 Subtract -57610 from 753474100. 753531710 Add together 4 and 53075480815270. 53075480815274 What is -1043986 + 32938.75? -1011047.25 What is 0.12667857 - 665? -664.87332143 What is 0.02 plus -81256360234? -81256360233.98 Calculate -602 + 58415477. 58414875 Put together -85.8687 and -5.83093147. -91.69963147 -1290.3599841346 - 0 -1290.3599841346 What is 9.003 minus 3544.401946? -3535.398946 What is -0.65 + -306126061.05987? -306126061.70987 Work out -0.082329486869 - 0.4. -0.482329486869 What is -3 - 6000066120016? -6000066120019 Work out 0.8 + -338728719071. -338728719070.2 What is -4756 minus -89759178? 89754422 What is -258518102 minus -2.337? -258518099.663 0.7 - 11146215094 -11146215093.3 What is -113338632375 minus -2? -113338632373 What is -5450442054887.4 less than -0.04? 5450442054887.36 0.07347946606 - 5850 -5849.92652053394 What is 0.2 - 30903249295? -30903249294.8 Sum -163028 and -246447801. -246610829 What is the difference between 0.06857481 and 1509.1342? 1509.06562519 Calculate 49325 + 3.658453904. 49328.658453904 Total of -450720 and -114277581. -114728301 Work out 0.04731257 - 27887. -27886.95268743 What is -10780183 + -3.47? -10780186.47 Sum -1537.594854 and 143. -1394.594854 Sum -11196735.081913 and -14. -11196749.081913 13771.647886 + -1 13770.647886 Sum -457887312263 and 0.6. -457887312262.4 Subtract 2.13 from -699953657.5. -699953659.63 Sum 137806708.82 and 476. 137807184.82 5038.46+-4978998 -4973959.54 Calculate -0.2 + -24871523836.142. -24871523836.342 What is 10726336 + -10393? 10715943 Work out -3693800573.2 + 0.11. -3693800573.09 Calculate 41196304.23 + -7.86. 41196296.37 24.3968433 - -730 754.3968433 What is -4699552683189 less than 6? 4699552683195 What is 126.68583866 less than 0.316? -126.36983866 What is the distance between 2.8319183 and -0.6468? 3.4787183 Put together 1.94 and 491119.506515. 491121.446515 Add -134 and 79012989793. 79012989659 What is -0.10853 minus 0.229857812? -0.338387812 Subtract 1.21 from -269647634.1. -269647635.31 Sum -2807166.381684 and -5.5. -2807171.881684 What is 490959.65139 less than 2? -490957.65139 Add together 145 and 2807.813318. 2952.813318 What is -143880207541 take away -0.4? -143880207540.6 Work out 3815.51663496 + 236. 4051.51663496 Calculate 2871081.792 - 2.14. 2871079.652 What is 2175801403 minus -627? 2175802030 What is -1230946.5 less than -317557.8? 913388.7 What is the difference between 2515402 and 36.55823? 2515365.44177 What is 0.3 minus 128755445505638? -128755445505637.7 -30748+-12.020922 -30760.020922 Calculate -16890606 - -563248. -16327358 What is 0.01526 plus 2477975577? 2477975577.01526 1488129.9563 + 185.5 1488315.4563 Subtract 8040.78 from -77.14599. -8117.92599 What is -36317384545 + -1.3? -36317384546.3 Work out 637.5 + -9634560.27. -9633922.77 0.17855+-182978104.6 -182978104.42145 What is -383243291 less than 0.35146? 383243291.35146 What is 1.2 take away -51972343447? 51972343448.2 What is -1.648 minus 28912974? -28912975.648 Put together -305933054.63 and 1.838. -305933052.792 Total of -123 and 0.3304567994965. -122.6695432005035 Calculate 0 - -316.8810944071. 316.8810944071 Calculate -870.1850044 + 1446. 575.8149956 -92.2 - 1531205721 -1531205813.2 Work out -0.261 + 5780467.87. 5780467.609 What is -1066607 minus -18.05013? -1066588.94987 Work out -0.5 - 1370915405743. -1370915405743.5 Work out -58.796985916 - 0.06. -58.856985916 Sum 2 and -8801539831877. -8801539831875 What is 5077173.727313 + 285? 5077458.727313 What is 1215370321.0205 less than -0.2? -1215370321.2205 Total of 4 and 1454221333185. 1454221333189 Total of 8.03151 and 0.0608028. 8.0923128 Add -3188 and -0.7040622. -3188.7040622 Calculate 1.089358 + -737839. -737837.910642 -0.85701 - 804134 -804134.85701 What is -3713392	{ "pile_set_name": "DM Mathematics" }
- 34 = 0, -1 = 2f + 9. Let v be g(x). Does v = -3/7? False Suppose -g = -3c + 7, -3g = -c - 2c + 15. Let r = -7/6 + 5/3. Which is smaller: c or r? r Let g = 0 + -1. Let j be (3/6)/(126/(-24)). Which is greater: j or g? j Let r be 2 + 79 - (0 - -1). Let z be (-4)/(-10) - (-88)/r. Which is smaller: z or 3? z Suppose 5 = f + 2. Suppose 2v = b - 2, 2v + 0b + 2 = fb. Let y(q) = q*3 + 7q*2 - 9q - 8. Let r be y(-8). Which is smaller: v or r? v Let q = -82.3 + 80. Is -1 < q? False Suppose -y = -2, 6 = 4t - y - 2y. Let z = -10/3 + t. Which is smaller: 0.2 or z? z Let m = 14 + -6. Let d = m - 8. Is d bigger than 0? False Let l = -23 + 231/10. Is l at least as big as 0? True Let q be 6(0 + 3)/(-3). Which is bigger: q or -5? -5 Let x be 12/(-6) - (-8)/6. Which is greater: 0.119 or x? 0.119 Let z be ((-5)/(10/6))/8. Which is greater: z or -1? z Let f(t) = t2 - 8t + 16. Let n be f(4). Let i(u) = 2u3 - 2u*2 + 4u - 2. Let k be i(2). Let w be (-4)/k + 6/21. Is w >= n? True Let s = 0.2 + 0.1. Let o = s - 0.3. Let m = 1 - o. Which is smaller: m or 1/2? 1/2 Let g be 1/(-2 - (-3 + 0)). Is -2/21 greater than g? False Let z(m) = -3m - 3. Let i be z(-2). Let c = i - 3. Let b(q) = 2q*2 - q. Let o be b(1). Which is bigger: c or o? o Let v = -58.3 + 56. Which is bigger: 0.1 or v? 0.1 Let j be -1 + (2 - -2) + -2. Let i = 2 + j. Suppose il = 4l - r + 3, -4l - 10 = -3r. Which is bigger: 1/4 or l? 1/4 Suppose 8g - 6g - 14 = 0. Let a(d) = 2d*2 + 7 + 2d - 3d2 + 4d. Let w be a(g). Are -2 and w unequal? True Let g = -154 - -153. Let i be -1 + 0 + 0 + -1. Which is greater: g or i? g Let n = 29 + -31. Which is smaller: -22/13 or n? n Suppose -3n + 72 = 3y, -n = -5y + 40 + 80. Let t be 0/1(-8)/y. Which is smaller: 1/2 or t? t Let z = -1/3 + 0. Let h be 8/1020/8. Suppose 2q + hq = -20, -y - 14 = 3q. Which is bigger: y or z? y Let k = -10 - -9.9. Is 0 < k? False Let d(h) = h*2 - 6h - 8. Let q be d(7). Let z = 97/4 + -24. Is q >= z? False Let n = -10 - -4. Is -0.1 at least as big as n? True Let v = 4 + -1. Suppose 3f - v = -0f. Which is smaller: 1/4 or f? 1/4 Let d(m) = m*3 - 2m*2 - 5m + 3. Let c be d(3). Let y be ((-7)/3)/(c/(-18)). Let j be 2/14 - (-4)/y. Which is smaller: 1 or j? j Let p = 88 - 1057/12. Which is smaller: p or 0.1? p Let a(t) be the second derivative of -t + 0 - 3/2t3 + 5t*2 + 1/12t4. Let i be a(8). Are 2 and i non-equal? False Let y(p) = -p3 - 4p2 - p + 4. Let v be y(-3). Let o = 6/127 + 212/889. Which is bigger: v or o? o Let v(b) = -3b - 11. Let d be v(-9). Is d less than 31/2? False Suppose m = -5g + 452, 7g - 3g - 373 = 3m. Is 91 at least as big as g? True Let p = -20.07 - -0.07. Which is bigger: -2 or p? -2 Let j(s) = -18 - 5s3 - 15s2 + 6 + s3 + 3s3 - 15s. Let r be j(-14). Is 1 smaller than r? True Let u = 8 + -3. Let t be (-2)/u - 8/(-20). Which is smaller: 1 or t? t Let l = -0.005 - 0.095. Which is smaller: l or 1/3? l Let v(b) = -b*2 + 1. Let h be v(2). Let s = -4 - h. Which is smaller: -1/5 or s? s Let i = 0.63 + -6.63. Which is bigger: i or -3/2? -3/2 Let s be -1 - (0 + (-3)/(-3)). Which is smaller: -4/3 or s? s Suppose n - 2 = 11. Is 12 > n? False Let h = -32 - -95/3. Do h and -21 have different values? True Let t be (0/(-3) - 1) + 5. Suppose 0 = -3l + tx + 3, -3x = 2x. Let a be (-3)/(-9)(-3)/4. Do l and a have different values? True Suppose -f = 3h - 158, -13 = -h - 5f + 49. Which is bigger: h or 51? h Let h = 28 - 49. Let p be 2/(-5) + h/(-15). Let u be (6/9)/(p/6). Which is greater: u or -2/5? u Suppose -32 = 2k - f, -4k - 73 = k + f. Let u = -12 - k. Let q be (-1)/4 + (-13)/(-4). Is q at least u? True Let d(q) be the first derivative of -q4/4 - q3 - q*2 + q + 7. Let x be d(-2). Let s be (4/(-33))/(2/3). Which is smaller: s or x? s Let n(p) = -6p + 15p - 10 - 11p. Let j be n(-9). Is -3/4 at least j? False Suppose -l + 12 = 2l. Suppose -u - ln = -11, 3u - 2 = -2n + 1. Which is bigger: u or -2/5? -2/5 Let r = 3.98212 - -0.01088. Let s = r - 0.093. Let w = s - 4. Which is smaller: -1 or w? -1 Let z be -12 - (-56)/49. Which is bigger: -2 or z? z Let f = -2 - -2. Suppose 3i = -fi. Which is smaller: i or 1/5? i Suppose o + 1 = 5. Let w be (-30)/(-8) - 2/(-8). Does w = o? True Let m(z) = -10z - 4. Let a be m(-1). Is 9 at least a? True Let x = 251 - 489. Let z be (-20904)/x - 8/(-28). Let c = 88 - z. Are -1 and c unequal? True Suppose 5i = 3y + 243 - 92, 5i + 4y - 137 = 0. Are i and 29 unequal? False Let h = 2 + -4. Let t = -1 - h. Do -1 and t have different values? True Suppose 9 = -3s + 6. Is -12 equal to s? False Let v = -146 + 1600/11. Which is greater: -1 or v? v Let y = -284 + 1985/7. Let x be (-16)/(-6)(-15)/10. Let d be (x/(-12))/13. Which is greater: d or y? d Let l = 7 - 10. Let w(y) = -y - 4. Let x be w(-6). Let t = l + x. Which is smaller: -2 or t? -2 Suppose -8 = -0r - 4r. Let n be (1 - 7/3)/r. Let x be 26/(-24) + 28/21. Which is smaller: x or n? n Let h(b) = b2 + 19b + 30. Let f be h(-11). Which is smaller: f or -60? -60 Let r = -1 - -2. Let b = -14 + 15. Is b at most r? True Let f be ((-2)/(6/15))/1. Is f less than -16/3? False Let l be (15/12)/(6/22). Let s = 144935587/132 + -1098002. Let x = l + s. Is -1 at least x? False Suppose -5h - 5 = o - 15, o = 2h + 3. Suppose -4t - 17 = -o. Which is bigger: t or -2? -2 Let s be 4/6(-6)/(-4). Suppose -g + 6 - 3 = 0. Let m = 4 - g. Is s less than or equal to m? True Suppose 30 = -0t + 3t. Suppose -4j = j + t. Which is smaller: -3 or j? -3 Let h(x) = -x2 + 4x + 1. Let w be h(4). Let a be (-9)/6 + 2/4. Which is smaller: w or a? a Let l = -364 + 2544/7. Is 0 equal to l? False Let s = -82 - -84. Let o be ((-1)/(2/(-10)))/(-1). Let l = o - -9. Is l at most as big as s? False Let w = -0.3 + 0.3. Let b = -1.7 + -0.3. Which is bigger: w or b? w Suppose -20 = -5y + y, 4w = 3y - 11. Let l = 1 + 1. Is l greater than or equal to w? True Let z = 10.6 + -11. Are z and 1 nonequal? True Let q be 15/(-54) - (-2)/(-9). Let r = 7 + -1. Let i = r - 6. Which is smaller: q or i? q Let w be (3/27)/(2/3). Let n(x) = 3x*2 - 4. Let v(u) = 7u*2 + u - 8. Let m(r) = -9n(r) + 4v(r). Let s be m(-3). Which is smaller: s or w? w Suppose -2o - 3s - 15 = 0, -4s - 22 = o - 7. Let h be o/12/(-6). Which is smaller: 8/9 or h? 8/9 Let h(z) = -2z - 3. Let i be h(0). Which is greater: -4 or i? i Let c = 11 + -6. Suppose -l = -4w + 5, -w + 3w + cl - 19 = 0. Let k = 2 - 0. Is w greater than k? False Suppose -4i - 10 = 5c, 3i + 4 = -3c - 5. Which is bigger: -6 or i? i Suppose -3w + 2 = v, -3v = v + 5w - 8. Let n be (-22)/(-55) + 8/5. Suppose -13 = i + vz, -5i + n = -4z - 3. Is i equal to -3? True Let i = 5 + -9. Let d = i - -3.8. Let r = d + 0.5. Are -1 and r nonequal? True Let i(p) = p3 - 3p*2 - p + 3. Let r be i(3). Is -6/11 < r? True Let k be 3(-6)/(-4)2. Let i be 1(2 + 2) - -4. Is k at most i? False Suppose 3u = 5o - 23, -2u = 2o + u - 26. Is 6 greater than o? False Suppose 4y = 5y + 3, -2d - 5y = 11. Suppose 0f = 3o - 3f + 6, do + 1 = -f. Is o at most as big as -1? True Let j = -1.9 - 0.5. Let p = j + -0.6. Which is bigger: -0.4 or p? -0.4 Let t be (-4 + 4)/(-3)(-1 - -2). Is 1 less than t? False Let p be ((-3)/4)/((-1)/4). Suppose -16 = -4q - o + 2o, o - 4 = 0. Suppose -4f = 3g - 1, -7 = -qg + f - 5f. Do p and g have the same value? True Let s(t) = -t3 + 15t*2 + 16t. Let l be s(16). Let k be 1 + l + (-12)/15. Is k less than or equal to 0? False Let j = 1.46 - 23.41. Let d = j - -22. Let t = -1 + 0. Is t less than or equal to d? True Let m = -18 + 12. Does -8 = m? False Let g be 183/342 + 1/(2-1). Which is smaller: 1 or g? g Let v(a) = a2 - 9a - 1. Let f be v(9). Let o be 6 + 0/f + 0. Let h be (-75)/o(-1)/5. Is h bigger than 4? False Let p = 5.4 + -5.1. Which is bigger: p or 0.08? p Let i = 74 - 517/7. Let a = -0.2 - -0.1. Is i bigger than a? True Let n(y) = -2y*2 - 2y - 2. Let f be n(-2). Let q(d) = d*3 + 6d*2 + d + 6. Let x be q(f). Is x != -2? True Suppose 3d = c - 4 - 0, 1 = -c - 2*d. Is c less than 13/10? True Let o = -65.4 - -72.38. Let d = 0.02 + o. Which is greater: -0.1 or d? d Let v be (-2)/(((-1)/(-1))/2). Let y be 1 - (-2)/(v	{ "pile_set_name": "DM Mathematics" }
ulate the remainder when 360 is divided by 209. 151 Calculate the remainder when 14667 is divided by 2092. 23 What is the remainder when 13922 is divided by 6950? 22 What is the remainder when 40777 is divided by 300? 277 What is the remainder when 1510154 is divided by 223? 221 What is the remainder when 24707 is divided by 191? 68 Calculate the remainder when 2701322 is divided by 19. 16 Calculate the remainder when 981 is divided by 34. 29 What is the remainder when 24256 is divided by 504? 64 Calculate the remainder when 5982 is divided by 600. 582 What is the remainder when 1878 is divided by 70? 58 What is the remainder when 6797 is divided by 342? 299 What is the remainder when 7617084 is divided by 719? 717 Calculate the remainder when 7643 is divided by 3182. 1279 Calculate the remainder when 7038 is divided by 80. 78 Calculate the remainder when 63819 is divided by 25. 19 Calculate the remainder when 205010 is divided by 102500. 10 Calculate the remainder when 20957 is divided by 28. 13 What is the remainder when 11056 is divided by 28? 24 What is the remainder when 1823 is divided by 214? 111 What is the remainder when 189060 is divided by 628? 32 Calculate the remainder when 1712455 is divided by 1277. 1275 What is the remainder when 29102 is divided by 1531? 13 Calculate the remainder when 1026 is divided by 1014. 12 Calculate the remainder when 7783 is divided by 40. 23 Calculate the remainder when 97288 is divided by 465. 103 Calculate the remainder when 751692 is divided by 176. 172 What is the remainder when 7624 is divided by 158? 40 Calculate the remainder when 14362 is divided by 355. 162 Calculate the remainder when 3042 is divided by 92. 6 What is the remainder when 14604 is divided by 157? 3 Calculate the remainder when 198915 is divided by 255. 15 What is the remainder when 586 is divided by 177? 55 What is the remainder when 6256 is divided by 6213? 43 What is the remainder when 5636 is divided by 576? 452 Calculate the remainder when 5603 is divided by 2800. 3 What is the remainder when 1059 is divided by 86? 27 Calculate the remainder when 11312 is divided by 2822. 24 What is the remainder when 2217 is divided by 1537? 680 Calculate the remainder when 14771 is divided by 375. 146 Calculate the remainder when 73500 is divided by 9174. 108 Calculate the remainder when 1185 is divided by 91. 2 Calculate the remainder when 3158 is divided by 1038. 44 What is the remainder when 38480 is divided by 2? 0 What is the remainder when 14891 is divided by 201? 17 What is the remainder when 1143 is divided by 186? 27 Calculate the remainder when 28552 is divided by 9507. 31 Calculate the remainder when 2242 is divided by 120. 82 Calculate the remainder when 4257 is divided by 164. 157 What is the remainder when 21388 is divided by 10? 8 Calculate the remainder when 3026 is divided by 1373. 280 Calculate the remainder when 13345 is divided by 272. 17 What is the remainder when 250685 is divided by 224? 29 Calculate the remainder when 52994 is divided by 17633. 95 What is the remainder when 189909 is divided by 351? 18 Calculate the remainder when 2056 is divided by 1855. 201 What is the remainder when 23118 is divided by 1877? 594 Calculate the remainder when 2274 is divided by 20. 14 Calculate the remainder when 32519 is divided by 25. 19 What is the remainder when 32703 is divided by 155? 153 Calculate the remainder when 6411 is divided by 377. 2 What is the remainder when 2126887 is divided by 9? 7 What is the remainder when 30172 is divided by 85? 82 Calculate the remainder when 6536 is divided by 3265. 6 What is the remainder when 42975 is divided by 377? 374 What is the remainder when 19355 is divided by 807? 794 What is the remainder when 21354 is divided by 188? 110 What is the remainder when 397132 is divided by 112? 92 Calculate the remainder when 699 is divided by 79. 67 Calculate the remainder when 2460 is divided by 620. 600 What is the remainder when 1616714 is divided by 80? 74 Calculate the remainder when 254274 is divided by 309. 276 What is the remainder when 25560 is divided by 12777? 6 What is the remainder when 448305 is divided by 22? 11 Calculate the remainder when 122399 is divided by 4371. 11 What is the remainder when 2527913 is divided by 193? 192 Calculate the remainder when 125738 is divided by 41908. 14 What is the remainder when 5270 is divided by 725? 195 What is the remainder when 88754 is divided by 105? 29 What is the remainder when 17934 is divided by 309? 12 What is the remainder when 349414 is divided by 18? 16 Calculate the remainder when 5322 is divided by 7. 2 What is the remainder when 16679 is divided by 36? 11 Calculate the remainder when 793 is divided by 439. 354 What is the remainder when 8075 is divided by 138? 71 Calculate the remainder when 4879 is divided by 68. 51 Calculate the remainder when 2244 is divided by 746. 6 Calculate the remainder when 23542 is divided by 13. 12 What is the remainder when 53977 is divided by 7706? 35 What is the remainder when 18097 is divided by 110? 57 What is the remainder when 8623 is divided by 83? 74 What is the remainder when 9289 is divided by 2191? 525 Calculate the remainder when 66322 is divided by 1615. 107 What is the remainder when 93218 is divided by 46567? 84 Calculate the remainder when 1758 is divided by 88. 86 Calculate the remainder when 26026 is divided by 18. 16 Calculate the remainder when 60983 is divided by 60976. 7 What is the remainder when 1300 is divided by 101? 88 What is the remainder when 219925 is divided by 109957? 11 What is the remainder when 23404 is divided by 187? 29 What is the remainder when 1355 is divided by 277? 247 What is the remainder when 618615 is divided by 858? 855 What is the remainder when 573015 is divided by 23? 16 What is the remainder when 13197 is divided by 100? 97 What is the remainder when 1856 is divided by 830? 196 Calculate the remainder when 3808 is divided by 494. 350 What is the remainder when 154307 is divided by 313? 311 What is the remainder when 11553 is divided by 311? 46 Calculate the remainder when 43017 is divided by 16. 9 What is the remainder when 337582 is divided by 13? 11 Calculate the remainder when 239239 is divided by 550. 539 Calculate the remainder when 7213 is divided by 1159. 259 Calculate the remainder when 10717 is divided by 27. 25 Calculate the remainder when 1806 is divided by 337. 121 Calculate the remainder when 157889 is divided by 1104. 17 Calculate the remainder when 14994 is divided by 4993. 15 Calculate the remainder when 3898 is divided by 1170. 388 Calculate the remainder when 1491 is divided by 3. 0 What is the remainder when 1812 is divided by 20? 12 Calculate the remainder when 18181 is divided by 40. 21 What is the remainder when 163181 is divided by 54389? 14 What is the remainder when 10078 is divided by 2509? 42 What is the remainder when 2098 is divided by 59? 33 What is the remainder when 883 is divided by 130? 103 What is the remainder when 214128 is divided by 2612? 2556 Calculate the remainder when 1576931 is divided by 525641. 8 Calculate the remainder when 2351503 is divided by 4. 3 Calculate the remainder when 85047 is divided by 42523. 1 Calculate the remainder when 2604 is divided by 174. 168 Calculate the remainder when 110938 is divided by 42. 16 What is the remainder when 957 is divided by 60? 57 What is the remainder when 9856 is divided by 29? 25 Calculate the remainder when 3680 is divided by 241. 65 What is the remainder when 2852 is divided by 281? 42 Calculate the remainder when 1160 is divided by 643. 517 What is the remainder when 26040 is divided by 6509? 4 Calculate the remainder when 13324 is divided by 338. 142 What is the remainder when 181759 is divided by 878? 13 What is the remainder when 214278 is divided by 421? 410 Calculate the remainder when 7362 is divided by 189. 180 What is the remainder when 4452 is divided by 372? 360 Calculate the remainder when 2203 is divided by 221. 214 Calculate the remainder when 129004 is divided by 32251. 0 What is the remainder when 2149 is divided by 11? 4 Calculate the remainder when 276111 is divided by 40. 31 What is the remainder when 224270 is divided by 512? 14 What is t	{ "pile_set_name": "DM Mathematics" }
k(d). 4d Let k(f) = -11 - 4f2 + 2382f3 + f2 - f*2 - 2417f*3 + 5f. Let y(n) = 18n3 + 2n*2 - 3n + 6. Give -6k(l) - 11y(l). 12l3 + 2l*2 + 3l Let p(d) = 153d + 612. Let o(f) = -19f - 73. What is 17o(q) + 2p(q)? -17q - 17 Let j(i) = 4i - 927. Let p(d) = 8d - 1856. Determine -7j(v) + 4p(v). 4v - 935 Let z(q) = 989q3 + 10q*2. Let d(p) = -1979p*3 - 25p*2. Give 2d(y) + 5z(y). 987y*3 Let u(s) = 8s + 6. Suppose -p - 2y + 16 - 4 = 0, -22 = 4p - 2y. Let g(m) = 7m + 5. Give pu(t) + 3g(t). 5t + 3 Let c(f) = 11f*2 + 21f - 4. Let s(k) = 14k2 + 24k - 3. What is -3c(z) + 2s(z)? -5z2 - 15z + 6 Let u(o) = -42918o - 48. Let d(y) = 4518y + 5. Determine -48d(i) - 5u(i). -2274i Let m(t) = -t3 + 4t*2 - 67t - 4. Let w(x) = 2x3 - 5x*2 + 67x + 5. Calculate -5m(b) - 4w(b). -3b3 + 67b Let f(q) be the third derivative of q*6/3 - 5q*4/12 - 2q*3 - 313q2 - q - 2. Let p(x) = -x3 + x + 1. What is f(h) + 10p(h)? 30h3 - 2 Let l(g) = -g3 + g*2 - g - 1. Suppose -5 = -2q - 19. Let n = 46 + q. Let v(d) = -nd2 + 4d*3 + 38d*2 + d + 4 - 1. Give l(r) + v(r). 3r*3 + 2 Let j(f) = -27175f - 18. Let w(q) = 6796q + 4. What is -2j(r) - 9w(r)? -6814r Let a(t) = 10t2 + 9t - 10396 - 10424 + 20826. Let w(y) = -9y2 - 8y - 5. What is 5a(r) + 6w(r)? -4r2 - 3r Let v(p) = 8p3 + 6p*2 + 2p + 2. Let g(n) = -7 + 113n - 43n - 19n2 - 76n - 25n3. Give 2g(c) + 7v(c). 6c*3 + 4c*2 + 2c Let x(b) = -b2 - b. Let a(m) = m3 - 4m2 - 3m - 1. Let t be 58/551 - (-4176)/38. Let y be (3/((-18)/(-4)))/(t/(-165)). Calculate ya(w) + 4x(w). -w*3 - w + 1 Let m(j) = -13j - 3. Let x(n) = -7n - 1. Let i = -2692 - -2681. Determine ix(o) + 6m(o). -o - 7 Let q(g) = -7g*3 - 408g*2 - 24g - 6. Let s(l) = 68l2 - l + 1. Determine -q(x) - 6s(x). 7x3 + 30x Let h(l) = 3l2 - l + 2. Let a(b) = -b2 - b - 1. Let j(n) = 2n*2 - 34n + 35. Let u be j(21). Suppose 0 = 202z - uz + 1. Give zh(t) + 4a(t). -t*2 - 5t - 2 Let g(a) = a*2 - 348312538a*3 - 3 + 2a*2 + 348312539a*3 + 11a. Let p(n) = -n*2 - n + 1. Give g(q) + 3p(q). q*3 + 8q Let u(n) = -15590n - 6. Let s(v) = 654772v + 255. What is 2s(z) + 85u(z)? -15606z Suppose -2i - 3i = -5c + 155, 2i + c = -53. Let o(x) = -x - 3. Let l(h) = -4h - 14. Give io(m) + 6l(m). 4m Let k(a) = -a. Suppose 342 - 336 = -3w. Let m be (-232/(-12))/(1/(-6)). Let n = -29 - m. Let i(q) = q3 - 2q - 1. What is nk(x) + wi(x)? -2x3 + x + 2 Let m(c) = -27c*2 - 17c - 8. Let v(p) be the first derivative of 3p3 + 3p*2 + 3p + 2296. What is -4m(l) - 11v(l)? 9l2 + 2l - 1 Let x(c) = 3c - 2. Let o(k) = -4k + 2. Let f(i) = -2i + 1. Let r(h) = -f(h) + o(h). Calculate -8r(g) - 5x(g). g + 2 Let s(u) = -u3 + 24u*2 - 18u + 419. Let i be s(24). Let c(h) = -17h3 + 13h*2 + 4h + 2. Let l(a) = 8a3 - 6a*2 - 2a - 1. Give il(b) - 6c(b). -2b3 + 2b + 1 Let t(b) = b*2 + b + 3. Let g(d) = 418d*3 - 209d*2 - 209d - 627. Determine 2g(j) + 418t(j). 836j3 Let o(h) be the first derivative of -h2 + 3h - 2. Suppose -7j + 5g = -6j + 8, 3g = -3j - 6. Let a(p) = -2p + 3. Give jo(c) + 4a(c). -2c + 3 Let k(i) = 4i*3 + 8i*2 - 2135i + 4. Let h(q) = -3q3 - 12q*2 + 2136q - 6. What is -2h(w) - 3k(w)? -6w3 + 2133w Let b(i) = 14i + 24. Let d(x) = -11x - 19. Let u(g) = 4b(g) + 5d(g). Let m(t) = -2t2 + 5t + 4. What is -m(o) + 3u(o)? 2o*2 - 2o - 1 Let k(t) = -446706t3 + 415t*2 + 415t - 415. Let i(m) = -3237m3 + 3m*2 + 3m - 3. Give 415i(z) - 3k(z). -3237z3 Let t(u) be the second derivative of -u3/2 + 5u*2/2 + 7u. Let d(l) = 2391 + 0l - 4l - 2386. Give 4d(c) - 5t(c). -c - 5 Let g(s) = -172s3 - 3s*2 + 7s + 26. Let a(u) = 86u3 + 2u*2 - 4u - 13. Calculate -7a(j) - 4g(j). 86j3 - 2j*2 - 13 Let r(m) = -22m*3 + 221m*2 - 10m + 4. Let d be r(10). Let x(p) = -81p + 33. Let y(h) = 5h - 2. What is dx(t) + 66y(t)? 6t Let m(w) = 2w*2 + 6w + 4. Let k be ((-8)/32)/((11/(-110))/((-8)/(-5))). Let v(d) = -2d2 - 5d - 4. Determine km(b) + 5v(b). -2b2 - b - 4 Let f(n) = 7n*3 + 2n*2 - 2n - 2. Let y = 723 + -721. Let p(q) = -45qy - 643q*3 + 1215q*3 + 45q + 45 - 727q3. What is 90f(j) + 4p(j)? 10j*3 Let z(n) be the first derivative of -33n*4/4 + 4n*3/3 + 2n2 - 1045. Let l(j) = j3 + j*2 + j. Determine 4l(b) - z(b). 37b3 Let r(p) = 3p + 7. Let c(y) = -2y - 8. Suppose -3w + 2k + 16 = -5w, 0 = -2w - k - 11. Determine wr(m) - 4c(m). -m + 11 Let q(t) = -10005t + 0 - 10005t + 1 + 20009t. Suppose 0 = -3c + 2b - 6, 5c + 8 = c - 5b. Let v(h) = 6h - 2. What is cq(a) - v(a)? -4a Let d(z) = -128z2 + 4. Let s(h) = h2 + 1. Determine -8d(q) + 32s(q). 1056q2 Let g(q) = q2 - 3. Let c = 168 - 166. Suppose 0l + 10 = -cm + l, 2l = 0. Let f(o) = o*2 - 3. What is mg(w) + 6f(w)? w2 - 3 Let v(p) = -p3 - 2p*2 - 2p - 2. Let q(j) = 12j3 - 9j*2 - 22j - 8. Calculate -q(z) + 4v(z). -16z3 + z2 + 14z Let n(k) = 9k*2 + 7k + 7. Let x(l) = 0l2 - 2 + 0l - 3l2 - 2l. Let w(d) = 40d2 - 1920d - 2. Let o be w(48). Give on(f) - 7x(f). 3f2 Let x be 12/((-4)/42 + (-3 - 69/(-63))). Let f(n) = 19n*3 - 11n*2 + 2n. Let j(z) = -10z3 + 6z*2 - z. Determine xf(u) - 11j(u). -4u*3 - u Let g(m) = 38m*3 + 31m*2 + 4m + 34. Let s(z) = -32z3 - 32z*2 - 3z - 32. Give -5g(b) - 6s(b). 2b3 + 37b*2 - 2b + 22 Let u(h) be the second derivative of -2h3 - 13h*2/2 + 46h. Let m be u(-1). Let y(k) = k*2. Let t(q) = 3q*3 + 6q*2. What is mt(n) + 6y(n)? -3n*3 Let d(p) = p + 1. Let y(u) = 4u + 23. Let n be 38/(-95)(-5)/4-2. Calculate ny(s) + 5d(s). s - 18 Let c(p) = -520710p2 + 1021p + 1021. Let b(a) = -1021a2 + 2a + 2. Give 1021b(u) - 2c(u). -1021u2 Let r(v) = -17v*3 + 10v*2 + 88v. Let s(t) = 4t3 - 2t*2 - 22t. Determine 2r(f) + 9s(f). 2f3 + 2f*2 - 22f Let n(j) = 1. Let t(s) = 32s2 + 6. Suppose 2k = -5v + 45, 4k + 3v + 11 - 52 = 0. Give kn(r) - t(r). -32r2 - 1 Let p(j) = -9j - 44. Let f(s) = 40s + 178. Give 2f(u) + 9p(u). -u - 40 Let m(o) = -16o*3 + 49o - 11. Let u = 12105 - 12107. Let q(p) = -3p3 + 10p - 2. Determine um(c) + 11q(c). -c*3 + 12c Let r(x) = 2x2 - 3x. Let z(a) be the first derivative of -a + 5a2 + 277a*3 + 190 - 6 - 279a*3. Determine -7r(u) - 2z(u). -2u*2 + u + 2 Let i(p) = 2p + 2. Let t = 13701 - 13697. Let c(u) = 4u + 3. Calculate tc(q) - 7i(q). 2q - 2 Let w(k) = -352 - 320 - 11k - 31k*2 + 688. Let b(g) = 6g*2 + 2g - 3. Determine 11b(q) + 2w(q). 4q2 - 1 Let n(k) = 9k*2 + 9k + 11. Let o(w) = 44w2 + 46w + 55. Give -19n(y) + 4o(y). 5y2 + 13y + 11 Let b(u) be the second derivative of -7u5/10 - 2u*4/3 + 4u*3/3 + 4u*2 - 561u. Let o(i) = -i3 - i2 + i + 1. What is -3b(p) + 24o(p)? 18p3 Let n(t) = t2 + 2t + 1. Let h(d) = 24d2 + 8d + 24. What is h(s) - 5n(s)? 19s*2 - 2s + 19 Let v(j) = -2j2 + 56j + 16. Let l(f) = -f*2 + 30f + 7. What is -7l(q) + 3v(q)? q*2 - 42q - 1 Let l(m) = -m - 2. Let d be l(-6). Let s(i) = -6i3 + 6i - 4. Let j(v) = v3 + v2 - v + 1. Suppose 14 = -74r + 88r. Calculate dj(c) + rs(c). -2c3 + 4c*2 + 2c Suppose -s + 1 = -3t + 6t, -2t + 31 = 5s. Let u(b) = -b + 1. Let z(k) = 934 - 933 - k + 0k. What is sz(m) - 6u(m)? -m + 1 Let i(j) = -7311j*3 + 5j. Let r(c) = 3655c3 - 2c. Give 3i(s) + 7r(s). 3652s3 + s Let i(w) = -33w*2 + 6w + 10. Let c(j) = 33j2 - 9j - 15. Let x(t) = -2c(t) - 3i(t). Let o(b) = 34b2. Determine 5o(f) - 4x(f). 38f*2 Let t(u) = -8u*2 + 3u - 3. Let q(p) = -24p2 + 10p - 10. Let a be 16 - (2 + -15 + 23). Calculate aq(r) - 20t(r). 16r2 Let t = 6517 + -6505. Let g(s) = 8s + 12. Let f(v) = 4v - 7v + 6v + 5. What is tf(d) - 5g(d)? -4d Let z(d) = 9d + 15. Let m(t) = -19t + 37. Let w(l) = 7l - 14. Let c(h) = -3m(h) - 8w(h). Determine 30c(v) - 2z(v). 12v Let m be (-1)/(-5) + 38/10. Let y(i) = 7i2 + 12i - 7. Let g(o) = 3o2 + 6o - 3. Give my(x) - 9g(x). x*2 - 6x - 1 Let r	{ "pile_set_name": "DM Mathematics" }
and p. 14 Suppose -3k + 3286 - 3193 = 0. What is the greatest common divisor of k and 10509? 31 Let b(u) = 7u - 7. Let c be b(6). Let k = 328 + -339. Let y be k/((-55)/25)1. What is the greatest common divisor of y and c? 5 Let h be 166/(-4)(-4 - 2). Let o = -155 + h. Let j = -243 + 290. Calculate the highest common divisor of o and j. 47 Suppose 107 = 5j + 17. Let n(y) = 39y + 4. Let s be n(-1). Let r be ((-6)/(-10))/(s/(-2625)). What is the greatest common factor of r and j? 9 Suppose 2c - d = 456, -3c - 33d + 31d + 705 = 0. Calculate the greatest common divisor of 264 and c. 33 Let v = -106 + 12. Let n = v - -128. Suppose g + 5s = n, -3s + 45 = 4g - 6. Calculate the greatest common factor of g and 15. 3 Let x(j) = -2j*2 - 53j. Let v be x(-24). Suppose -4z - 5q = -27, -2q = -3z + 3 + 23. Calculate the highest common factor of z and v. 8 Suppose -2r - 80 = -u - 0r, -74 = -u - 4r. Suppose -u = -10f - 3f. Calculate the greatest common factor of 18 and f. 6 Let a = 2464 + -1344. Suppose 0 = -4q + 476 + a. What is the highest common divisor of q and 3? 3 Let i = 1320 + -1205. Suppose 0 = -3m - 2w - 1 + i, -w + 39 = m. Suppose 5h - 36 = 2h. What is the highest common factor of m and h? 12 Let w be -6 + 1 + 5 + -8 + -1. Let b be 4/(-3) - 129/w. Let l = -284 + 401. Calculate the greatest common factor of b and l. 13 Suppose 5c = b + 33, -4b - 5 + 13 = 0. What is the highest common divisor of 973 and c? 7 Suppose 0 = 5x + r - 207, 5r + 132 = 3x + 3r. Suppose -x = -2o + s - 6, 2s + 32 = 2o. Let v = 231 - 51. What is the greatest common divisor of o and v? 20 Let p(h) = -h2 - h + 8. Let r be p(0). Suppose -rd = -12d + 60. Let o be (-20)/6d/(-2). Calculate the highest common divisor of o and 25. 25 Let f(z) = -z*3 - 4z*2 + 3z - 8. Let l be f(-5). Suppose -2h = -4g + 51 + 61, 140 = 5g - lh. What is the greatest common divisor of 140 and g? 28 Let n = 100 + -101. Let c be (-1 - -12 - 5)n. Let s be 192/9(-27)/c. Calculate the greatest common factor of s and 24. 24 Let q = 36674 + -36498. Calculate the highest common divisor of 944 and q. 16 Let z(k) = -k*3 + 114k*2 - 101k + 122. Let c be z(111). Calculate the highest common factor of 17 and c. 17 Let n = 29904 + -29631. Calculate the greatest common divisor of 2145 and n. 39 Let h be (1-2)/(370/(-40) + 9). Suppose -4n = -h - 24. Calculate the highest common factor of n and 36. 4 Let v = 5562 + -5391. Let q be 100/4 + 2 + 0. Calculate the highest common divisor of v and q. 9 Let p(k) = -4k - 10. Let q be p(-4). Suppose 0 = -3a + q. Suppose 0 = 2r + 3x - 27, x - 14 = ar - 3r. Calculate the highest common divisor of r and 5. 5 Let o be -4 - -2 - 23-1. Let f(d) = 94d + 12154. Let u be f(-129). Calculate the highest common factor of o and u. 7 Suppose 0 = 21d + 33d - 0d - 317844. Calculate the greatest common divisor of d and 27. 27 Suppose -8g + 1865 = 2d - 9g, 4d - 3751 = -g. Calculate the greatest common divisor of 42 and d. 6 Suppose -11f - 12004 = -21739. Calculate the greatest common divisor of f and 1. 1 Let f = 93 - 105. Let b be (-1005)/f + (-6)/(-24). Calculate the highest common divisor of b and 36. 12 Let i be -9 - ((-1287)/26)/((-5)/(-50)5). What is the highest common divisor of i and 40? 10 Let k = 117 + -196. Let y = k + 177. Let z be (-2304)/(-54) + (-4)/6. What is the greatest common factor of y and z? 14 Suppose -4h + 2045 = 2t - 6373, 5h - 10512 = -4t. Calculate the highest common factor of 434 and h. 62 Let c(j) = 108j + 627. Let d be c(-4). Calculate the highest common factor of d and 1040. 65 Let q(p) be the first derivative of p*2 + 21p - 4. Let o be q(0). Let y = 1754 - 1740. What is the highest common divisor of y and o? 7 Let j be (-49)/(-14)(-170)/(-35). Let y be (4 + 119)4/6. Let g be 3y/3 - -3. What is the highest common factor of g and j? 17 Suppose 0 = 3b - 128n + 131n - 2550, 0 = -b - 3n + 860. Calculate the greatest common divisor of b and 5. 5 Suppose 5d - 2c = -56, 4c - 22 = d - 0d. Let x be ((-6)/15)/(2/d). Let w = -2965 - -2983. Calculate the highest common factor of x and w. 2 Suppose 0 = -p - 2i + 650, 2p - i = 320 + 965. Suppose -21u - 2u = -p. What is the highest common divisor of 490 and u? 14 Suppose t = -5k + 15, -3k - 2t + 31 = 3t. Suppose -3u + ku = -x + 77, -2x + 3u = -153. Calculate the highest common factor of x and 52. 26 Suppose 2x - 34z = -35z + 1011, -5z + 2031 = 4x. Calculate the greatest common divisor of x and 369. 9 Suppose 0 = 9g - 519 - 21. Suppose 22l - g = 18l. Let w(q) = 5q*3 - 6q*2 - q + 5. Let n be w(4). What is the highest common factor of n and l? 15 Let s be (-12)/(-21)(15897/14 - 5). Calculate the highest common divisor of s and 34. 34 Let x = -2290 - -2359. Calculate the greatest common divisor of 46 and x. 23 Suppose 226l - 8311 - 3239 = 76l. What is the greatest common factor of 350 and l? 7 Suppose j = z - 178, 5j + 3z + 840 = -2z. Let v = -141 - j. What is the highest common factor of v and 4? 4 Let s = 3792 - 3756. What is the highest common divisor of s and 3924? 36 Let z = -502 - -503. Let l be (z + -8)3(-4)/6. Let p = -7 + 35. What is the greatest common divisor of l and p? 14 Let j be ((-72)/14)/((-4)/14 - 0). Suppose -j = 3y - 2y + 4z, -y = z + 6. Let d be 1 + y - (-3 + -302). Calculate the highest common factor of d and 38. 38 Let i = -10727 - -10943. Calculate the greatest common divisor of i and 57. 3 Let q be (-4)/6 + (-5)/(75/410). Let t be (30 + q)(-4)/(-2). Suppose 0 = -5x - 20, 0 = tc - x - 53 - 55. Calculate the highest common divisor of 234 and c. 26 Let v(m) = -7m + 2 + 8 + 8 - 6m. Let z be v(10). Let p be 10/2z/(-5). What is the greatest common divisor of p and 14? 14 Let c be (-2 - -18) + -14 + 2-23. Suppose 3d - 12 = 36. Let u be (495/c)/((-6)/d). Calculate the greatest common divisor of u and 15. 15 Let p be (10/((-70)/1449))/(1/(-1)). Calculate the highest common factor of p and 135. 9 Suppose -2f + 98 = 5z, f = -9z + 6z + 59. What is the greatest common factor of z and 7170? 10 Suppose -71w = -3640 - 1046. Calculate the highest common divisor of 187 and w. 11 Let d(p) = -12p*3 - 6p*2 - 15p - 10. Let s be d(-1). Suppose x - 3m - 4 = -5m, 0 = -5x - 2m + 12. What is the highest common divisor of s and x? 1 Let g(n) = -8n2 + 3n + 36. Let h be g(-5). Let o = -137 - h. What is the highest common factor of o and 84? 42 Suppose 0 = n - 1, -7k + 10k + 5n - 8 = 0. Let u be ((9/2)/(-3))/(6/(-20)). Suppose 4 = -w + uw. Calculate the greatest common divisor of w and k. 1 Suppose 0 = 2n - 2x - 442, 5n + x - 516 - 613 = 0. Suppose -184b = -206b + 1980. Calculate the highest common divisor of b and n. 45 Let d = -5488 - -5576. Suppose -5p - 3q + 15 = 0, 0q + 15 = 2p + 3q. Suppose -b + 2b - 220 = p. Calculate the highest common factor of d and b. 44 Let g(q) = -q2 + 11q - 2. Let k be g(10). Suppose -k = -t - l, -2 = -l + 2. Suppose -ty = -18 - 2. What is the greatest common divisor of y and 55? 5 Let b be 1 + 27 - (0 - 3). Let w(r) = -r2 + 56r - 13r3 + 2 - 24r - br. Let s be w(-1). Calculate the greatest common divisor of 65 and s. 13 Let h = -41 + 181. Let y(a) be the second derivative of -37a*3/3 - 9a*2 - 40a. Let r be y(-1). What is the highest common factor of h and r? 28 Let i be (-11226)/(-33) - (-26)/(-143). Calculate the highest common divisor of 4 and i. 4 Suppose -65 = -4l - 41. Let w be (-5)/(((-8)/(-12))/((-8)/l)). Calculate the highest common factor of w and 8. 2 Suppose -1 = c + 3, 4a - c = 304. Suppose 22d = 17d - 15. Let q = a + d. Calculate the highest common factor of 18 and q. 18 Suppose -4p - m = -2m - 2550, -2p + 5m = -1266. Calculate the highest common divisor of 203 and p. 29 Let i be -641(-7 + 4). Let l = 63 + -141. Let j = l + i. Calculate the greatest common factor of j and 76. 38 Suppose 5m = -2o + 565, -4o + 12m - 6m = -1178. What is the highest common divisor of 8 and o? 2 Suppose 2z = -b - 6, 3z - z + 10 = -3b. Let o be (z/4)/(-1)*(3 + -5). Let n = 32 - o. What is the highest common factor of n and 11? 11 Let l be (-3 + 36/28)/(114/(-1064)). Calculate the greatest common factor of l and 7256. 8 Le	{ "pile_set_name": "DM Mathematics" }
et r(p) = 2p2 - 1379p + 8211. Determine r(6). 9 Let y(b) = b*2 - 1484b - 215094. Determine y(-133). -33 Let r(o) = -154o2 + 16803o + 229. Calculate r(109). 2082 Let z(s) = -6s2 - 5292s - 21079. What is z(-4)? -7 Let a(b) = -149b - 19987. What is a(-134)? -21 Let x(h) = -12340h + 234444. Give x(19). -16 Let g(r) = r*3 + 64r*2 + 65r - 73. Determine g(-63). -199 Let r(a) = -a*3 + 8084a*2 + 16150a - 39. Calculate r(-2). 5 Let c(u) = -104u2 + 4681u - 38. What is c(45)? 7 Let v(k) = -16246k - 1608392. Determine v(-99). -38 Let h(x) = 2x*3 - 88x*2 + 762x + 1297. Give h(31). -67 Let s(z) = 2z3 + 54z*2 - 326z - 7968. Determine s(-28). -408 Let g(r) = r*2 + 171r + 6388. Determine g(-117). 70 Let x(b) = -7038b - 22658. Calculate x(-4). 5494 Let r(i) = -4013i - 292979. Give r(-73). -30 Let x(l) = -l*2 + 1257l + 477. Determine x(0). 477 Let i(v) = -6v2 + 155v + 8637. Calculate i(53). -2 Let c(b) = -37b2 + 27877b - 150348. Give c(748). 0 Let y(x) = -2757x - 1695525. What is y(-615)? 30 Let a(q) = 2q*3 - 348q*2 - 163678q - 2956. Calculate a(-212). 12 Let f(b) = -5356b - 128520. What is f(-24)? 24 Let o(r) = 6r*2 + 1263r - 7755. Calculate o(6). 39 Let a(g) = -g*3 - 428g*2 + 28249g - 3521. What is a(58)? 17 Let a(n) = -2n2 - 515n - 29278. Give a(-173). -41 Let h(f) = -451296f - 4061664. What is h(-9)? 0 Let m(i) = -99361i - 1589821. Determine m(-16). -45 Let h(d) = -41d2 + 388d - 544. Calculate h(5). 371 Let q(n) = -5n3 - 720n*2 + 718n - 706. Calculate q(-145). 309 Let t(b) = -3b2 - 143b + 5282. Calculate t(-72). 26 Let t(w) = -955w2 - 6706w + 59. Give t(-7). 206 Let j(m) = 4m3 - 5m*2 - 36m - 184. What is j(-4)? -376 Let x(p) = p*3 + 197p*2 + 885p - 14548. Give x(-192). -148 Let b(q) = -q*3 - 33q*2 + 525q - 52. Give b(-45). 623 Let f(q) = -q*3 - 17q*2 + 124q - 195. Determine f(2). -23 Let s(z) = 3z3 + 14z*2 - 85z - 352. Determine s(-3). -52 Let w(u) = -23u3 - 984u*2 - 4175u + 181. Calculate w(-38). -9 Let t(a) = 2029a2 + 20590a + 3006. Give t(-10). 6 Let u(k) = k*3 - 96k*2 + 452k + 317. What is u(91)? 44 Let q(g) = 109g2 + 27488g + 32357. What is q(-251)? -22 Let l(b) = -5b3 - 854b*2 + 171b - 59. Determine l(-171). -59 Let w(a) = a*3 + 82a*2 - 69a - 5646. What is w(-82)? 12 Let m(y) = -4y3 - 52y*2 - 193y + 3. What is m(-8)? 267 Let r(c) = 176c2 - 49807c - 288. What is r(283)? -5 Let l(t) = -t*2 - 8648t + 112628. What is l(13)? 35 Let o(d) = -29d3 + 144d*2 - 1767d + 8869. Determine o(5). 9 Let d(c) = c*2 + 2517c + 187889. Give d(-77). 9 Let n(q) = 33q3 + 400q*2 + 22q - 351. Calculate n(-12). -39 Let j(c) = c*2 - 595179c - 1785533. Calculate j(-3). 13 Let g(j) = -j*2 + 930j + 229982. What is g(-203)? -17 Let q(u) = -118u + 3025. Calculate q(9). 1963 Let w(k) = 160k*3 + 84k*2 + 195k + 112. Calculate w(-1). -159 Let y(x) = x*2 - 22742x - 5678287. Give y(-247). -4 Let i(c) = 2c3 + 8c*2 - 2474c - 9885. What is i(-4)? 11 Let d(k) = 716k - 4952. Calculate d(7). 60 Let m(f) = f3 - 35f*2 + 11899f - 714939. Calculate m(55). 6 Let y(g) = g*2 + 26g - 163. Calculate y(-52). 1189 Let c(y) = 30232y - 786113. Calculate c(26). -81 Let b(w) = 354w*3 + 3889w*2 - 52w + 25. Determine b(-11). -8 Let l(a) = -10675a2 - 21345a + 16. Determine l(-2). 6 Let n(d) = 104256d - 6672390. Determine n(64). -6 Let h(i) = 212i - 1359. Determine h(16). 2033 Let d(v) = -1884v - 433392. Determine d(-230). -72 Let r(n) = -5n*3 - 27n*2 + 491n + 2844. Calculate r(-6). 6 Let n(a) = 2284a + 18251. Give n(-8). -21 Let c(m) = -7m*3 - 2m*2 + 3543m + 7082. Determine c(-2). 44 Let d(g) = -g*3 - 34g*2 - 55g + 26. Determine d(-33). 752 Let u(o) = -6o2 + 127o + 10215. What is u(-32)? 7 Let z(b) = -b*3 - 9b*2 - 29b + 43. Determine z(-6). 109 Let j(c) = 6c3 - 182c*2 - 521c + 76. What is j(33)? 307 Let l(b) = -b*3 + 34b*2 - 15b - 17. Calculate l(-5). 1033 Let s(h) = -h*2 - 5961h - 1394948. Calculate s(-244). 0 Let z(f) = 6783931f + 40703596. Calculate z(-6). 10 Let b(y) = -31929y + 95673. Give b(3). -114 Let j(c) = -c*3 + 69c*2 - 188c - 177. Give j(66). 483 Let b(t) = 17470t - 1677098. Determine b(96). 22 Let w(z) = 418z - 7794. Determine w(19). 148 Let x(i) = 8302i - 41498. Give x(5). 12 Let j(k) = 4k*3 - 75k*2 - 2029k - 52. Determine j(-15). 8 Let w(h) = -h*3 + 11h*2 - 237h + 3398. Give w(13). -21 Let f(d) = 10750d + 397755. Determine f(-37). 5 Let t(p) = p2 - 791p - 200588. What is t(-202)? -2 Let w(v) = 5726v - 1231097. Determine w(215). -7 Let o(p) = -2p*2 - 1486p - 113036. Give o(-86). -32 Let z(m) = -m*2 + 45392m + 590299. Calculate z(-13). 34 Let u(k) = 2400k2 - 50368k + 31. Determine u(21). 703 Let r(b) = -238397b - 4. Give r(0). -4 Let z(f) = f3 - 50f*2 + 490f - 155. Give z(37). 178 Let f(h) = -h*2 - 6681h + 33446. Determine f(5). 16 Let p(i) = -i*2 + 579i + 11309. What is p(-19)? -53 Let k(l) = 344l - 45032. Determine k(132). 376 Let i(g) = 3102g + 34074. Give i(-11). -48 Let t(f) = 6622f - 589364. Give t(89). -6 Let c(k) = -28k*2 + 25095k + 18834. What is c(897)? -3 Let u(y) = -y*3 + 14y*2 - 60y + 781. Determine u(14). -59 Let x(r) = 20r2 + 389r + 4210. Calculate x(-11). 2351 Let m(c) = -12987c + 13237. Calculate m(1). 250 Let a(h) = 2h*3 - 1033h*2 + 74053h - 621. What is a(86)? -19 Let v(c) = c*3 - 34c*2 + 276c + 198. Calculate v(16). 6 Let i(m) = m*3 - 114m*2 - 26m - 23483. Calculate i(116). 413 Let d(z) = -z*3 - 98z*2 - 9z + 8468. Calculate d(-97). -68 Let o(m) = -6m2 + 28m + 1273. What is o(-8)? 665 Let j(q) = -1568q + 1973. Give j(2). -1163 Let r(t) = -t3 + 60t*2 - 491t + 15. Calculate r(10). 105 Let d(z) = z*3 + 11z*2 + 73z + 144. Give d(-6). -114 Let b(l) = l*2 - 12507l - 3137232. What is b(-246)? 6 Let x(g) = 39g2 + 16g + 388. What is x(6)? 1888 Let n(s) = -s*3 + 34s*2 - 148s + 4145. Give n(32). 1457 Let b(d) = d*3 - 13d*2 - 173d + 641. What is b(20)? -19 Let c(i) = i*3 - 95i*2 + 1267i + 730. Determine c(79). 967 Let h(s) = -1033s2 - 2848s + 781. Determine h(-3). 28 Let y(k) = 28080k + 85889. What is y(-3)? 1649 Let a(y) = y3 + 79y*2 - 6456y + 498. Give a(50). 198 Let v(x) = 20x2 - 749x - 348. Give v(38). 70 Let w(g) = 462g + 430. What is w(-11)? -4652 Let p(x) = -x3 - 204x*2 + 417x + 1354. What is p(-206)? 324 Let o(a) = -20a2 + 9905a - 22177. Calculate o(493). 8 Let t(a) = -a*3 - 14a*2 + 129a + 1435. Calculate t(-12). -401 Let z(s) = -2s3 + 18154s*2 - 2s - 9. Determine z(0). -9 Let l(n) = 41n2 - 6588n - 72347. Determine l(171). -14 Let j(a) = -79a2 - 10349a + 200. Give j(-131). 200 Let c(q) = -2q3 - 3352q + 3351. Determine c(1). -3 Let v(i) = 88i2 + 233i - 10. What is v(-4)? 466 Let y(b) = -34319b - 480468. Calculate y(-14). -2 Let i(r) = -13r*2 + 162r - 113. Determine i(12). -41 Let t(b) = b*3 - 11b*2 + 361b - 3084. What is t(9)? 3 Let n(i) = 61i3 - 18i*2 + 1860i - 1860. Determine n(1). 43 Let p(a) = 4a3 - 13a*2 - 57a + 632. Calculate p(7). 968 Let f(d) = -71502d - 571960. What is f(-8)? 56 Let l(o) = -51o - 220. What is l(-5)? 35 Let t(f) = -118f2 + 3311f - 198. Give t(28). -2 Let d(i) = -3i3 - 50i*2 + 191i + 171. Calculate d(-23). 5829 Let s(a) = a*2 - 65a - 1584. Calculate s(-18). -90 Let f(n) = -n*3 - 27n*2 - 98n + 706. Calculate f(-10). -14 Let t(b) = 7b3 - 2438b*2 + 688b + 2757. Calculate t(348). -27 Let t(j) = -j*3 + 13j*2 + 182j - 22. Determine t(20). 818 Let k(n) = -3n3 + 97n*2 + 649n - 285. What is k(38)? -171 Let v(p) = 2p3 - p2 - 17769p - 279. Give v(-94). 3 Let y(u) = -61u2 - 23248u - 2231. Calculate y(-381). 436 Let c(q) = -8q3 - 276q*2 - 879q - 343. Calculate c(-31). -2 Let h(k) = 10k3 - 10k*2 + 918k - 916. Calculate h(1). 2 Let f(o) = o*3 - 260o*2 + 5036o - 4044. Calculate f(239). 19 Let h(o) = -2o2 + 3741o + 60365. Give h(-16). -3 Let u(t) = t*2 - 3210t + 170422. Calculate u(54). -2 Let o(h) = 60h2 - 169h + 484. What is o(3)? 517 Let r(h) = -162131*h + 4053268. Calculate r(25). -7 Let k(d)	{ "pile_set_name": "DM Mathematics" }
is the f'th term of -36415, -36395, -36361, -36307, -36227, -36115, -35965, -35771? f3 + f2 + 10f - 36427 What is the d'th term of -324, -2570, -8672, -20556, -40148, -69374, -110160? -321d*3 - 2d*2 + 7d - 8 What is the f'th term of 52894, 105796, 158706, 211624, 264550, 317484, 370426? 4f2 + 52890f What is the c'th term of 114, 251, 388? 137c - 23 What is the x'th term of 2, -87, -330, -805, -1590, -2763? -13x3 + x2 - x + 15 What is the w'th term of -3046, -6111, -9182, -12259? -3w2 - 3056w + 13 What is the q'th term of -2277364, -4554726, -6832088, -9109450? -2277362q - 2 What is the n'th term of -254, -988, -2208, -3914, -6106? -243n*2 - 5n - 6 What is the u'th term of 9994, 19995, 29996? 10001u - 7 What is the y'th term of 950, 649, 348, 47, -254, -555? -301y + 1251 What is the c'th term of 269919, 269917, 269915, 269913? -2c + 269921 What is the p'th term of 2481, 4930, 7383, 9840, 12301, 14766? 2p*2 + 2443p + 36 What is the k'th term of 38790, 77590, 116390, 155190, 193990, 232790? 38800k - 10 What is the v'th term of 313, 1283, 2907, 5185? 327v*2 - 11v - 3 What is the v'th term of 29, -20, -147, -358, -659, -1056, -1555? -v*3 - 33v*2 + 57v + 6 What is the v'th term of 6194, 6197, 6200? 3v + 6191 What is the a'th term of 645, 665, 697, 741, 797? 6a*2 + 2a + 637 What is the b'th term of -38570, -38580, -38590? -10b - 38560 What is the v'th term of -457, -3902, -13253, -31462, -61481, -106262, -168757, -251918? -492v3 - v2 + 2v + 34 What is the y'th term of -163, -1196, -3993, -9436, -18407? -147y*3 - 4y - 12 What is the i'th term of 29, 289, 771, 1517, 2569, 3969? 7i3 + 69i*2 + 4i - 51 What is the b'th term of 1892, 4449, 7006, 9563? 2557b - 665 What is the i'th term of 174, 1029, 3240, 7485, 14442? 113i*3 + 64i - 3 What is the y'th term of 9747, 9736, 9725, 9714, 9703? -11y + 9758 What is the g'th term of -651, -706, -761, -816? -55g - 596 What is the h'th term of -8468, -8466, -8462, -8456, -8448, -8438? h*2 - h - 8468 What is the l'th term of -173314, -173310, -173306? 4l - 173318 What is the s'th term of 7699, 7722, 7745, 7768, 7791, 7814? 23s + 7676 What is the i'th term of 28217, 28212, 28207, 28202, 28197, 28192? -5i + 28222 What is the r'th term of -4463, -4101, -3739, -3377? 362r - 4825 What is the v'th term of -781, -1662, -2645, -3724, -4893, -6146? v3 - 57v*2 - 717v - 8 What is the p'th term of 39760, 39748, 39736, 39724? -12p + 39772 What is the c'th term of 677, 2574, 5687, 9974, 15393, 21902, 29459, 38022? -7c*3 + 650c*2 - 4c + 38 What is the g'th term of -3000, -6097, -9290, -12579, -15964? -48g2 - 2953g + 1 What is the f'th term of -871, -791, -711, -631, -551, -471? 80f - 951 What is the v'th term of -10889, -10891, -10893, -10895, -10897, -10899? -2v - 10887 What is the t'th term of -25722, -51444, -77166, -102888, -128610? -25722t What is the k'th term of -1229970, -1229969, -1229968, -1229967, -1229966? k - 1229971 What is the z'th term of -78, -181, -272, -339, -370, -353? 2z*3 - 6z*2 - 99z + 25 What is the m'th term of -28023, -28026, -28029? -3m - 28020 What is the r'th term of -3008, -3002, -2996? 6r - 3014 What is the s'th term of 13411, 26828, 40249, 53674, 67103, 80536, 93973? 2s2 + 13411s - 2 What is the w'th term of 10489, 20971, 31453? 10482w + 7 What is the p'th term of 913, 3221, 7073, 12475, 19433, 27953, 38041? p3 + 766p*2 + 3p + 143 What is the h'th term of -103, 659, 1929, 3707, 5993, 8787? 254h2 - 357 What is the m'th term of -471, -698, -445, 528, 2461, 5594? 40m*3 - 507m - 4 What is the z'th term of 182, 376, 584, 812, 1066, 1352? z3 + z2 + 184z - 4 What is the x'th term of -1215, -352, 517, 1398, 2297, 3220, 4173, 5162? x3 - 3x*2 + 865x - 2078 What is the i'th term of 482, 2210, 6900, 16034, 31094? 247i3 - i2 + 2i + 234 What is the x'th term of -7244, -6944, -6642, -6338? x*2 + 297x - 7542 What is the f'th term of 170436, 340872, 511308, 681744, 852180? 170436f What is the l'th term of 26556, 26555, 26554, 26553? -l + 26557 What is the j'th term of 100624, 201247, 301866, 402481, 503092, 603699, 704302? -2j*2 + 100629j - 3 What is the k'th term of -562, -714, -968, -1324? -51k2 + k - 512 What is the g'th term of -1496044, -1496045, -1496046, -1496047, -1496048? -g - 1496043 What is the y'th term of 395, 849, 1333, 1841, 2367? -y3 + 21y*2 + 398y - 23 What is the v'th term of 1288, 1283, 1274, 1261, 1244, 1223? -2v2 + v + 1289 What is the z'th term of -80904, -161805, -242706? -80901z - 3 What is the l'th term of -28174, -56344, -84516, -112690, -140866, -169044, -197224? -l*2 - 28167l - 6 What is the u'th term of -598, -635, -692, -769? -10u2 - 7u - 581 What is the v'th term of -55, -461, -1547, -3649, -7103, -12245? -56v3 - 4v*2 - 2v + 7 What is the j'th term of 3796, 3749, 3670, 3559, 3416? -16j2 + j + 3811 What is the y'th term of 338867, 677733, 1016599, 1355465, 1694331? 338866y + 1 What is the v'th term of -1126, -3854, -8390, -14728, -22862, -32786, -44494, -57980? v*3 - 910v*2 - 5v - 212 What is the s'th term of 1036, 901, 764, 625, 484? -s*2 - 132s + 1169 What is the t'th term of 56, 57, 86, 155, 276, 461, 722? 2t3 + 2t*2 - 19t + 71 What is the y'th term of -2228, -2240, -2280, -2360, -2492, -2688? -2y3 - 2y*2 + 8y - 2232 What is the t'th term of -22662, -22665, -22666, -22665? t*2 - 6t - 22657 What is the r'th term of -2608121, -2608122, -2608123, -2608124? -r - 2608120 What is the q'th term of -61628, -61622, -61616, -61610, -61604? 6q - 61634 What is the i'th term of 13429, 26818, 40209, 53602? i2 + 13386i + 42 What is the c'th term of -383, -771, -1165, -1565, -1971? -3c2 - 379c - 1 What is the x'th term of -1429, -2733, -3787, -4465, -4641, -4189, -2983, -897? 21x3 - x2 - 1448x - 1 What is the n'th term of -692, -1054, -1456, -1916, -2452, -3082, -3824, -4696? -3n3 - 2n*2 - 335n - 352 What is the p'th term of 1337, 1255, 1161, 1049, 913, 747? -p*3 - 75p + 1413 What is the n'th term of -676, -687, -696, -703, -708, -711? n*2 - 14n - 663 What is the x'th term of 68, 167, 258, 341? -4x2 + 111x - 39 What is the u'th term of 44527, 89034, 133541, 178048, 222555, 267062? 44507u + 20 What is the b'th term of 6442, 6441, 6442, 6445? b2 - 4b + 6445 What is the s'th term of -1346, -2719, -4116, -5543, -7006, -8511? -s*3 - 6s*2 - 1348s + 9 What is the f'th term of 2115, 17152, 57967, 137448, 268483, 463960, 736767, 1099792? 2148f3 + f2 - 2f - 32 What is the b'th term of -384, -767, -1150? -383b - 1 What is the l'th term of -12456, -24887, -37318, -49749, -62180, -74611? -12431l - 25 What is the j'th term of -10937, -11098, -11259, -11420, -11581? -161j - 10776 What is the c'th term of -224693, -224691, -224689, -224687, -224685? 2c - 224695 What is the w'th term of -216, -235, -304, -447, -688? -4w3 - w2 + 12w - 223 What is the j'th term of -3934, -3934, -3942, -3964, -4006, -4074? -j*3 + 2j2 + j - 3936 What is the i'th term of -516, -468, -406, -324, -216? i3 + i*2 + 38i - 556 What is the u'th term of 353, 2830, 9545, 22616, 44161, 76298, 121145? 353u3 + u2 + 3u - 4 What is the v'th term of -56952, -114021, -171090, -228159, -285228? -57069v + 117 What is the t'th term of -34, -236, -776, -1822, -3542? -28t3 - t2 - 3t - 2 What is the d'th term of 1376, 1399, 1420, 1439, 1456, 1471? -d2 + 26d + 1351 What is the p'th term of 1096, 2184, 3270, 4354? -p*2 + 1091p + 6 What is the c'th term of 467, 863, 1237, 1589? -11c2 + 429c + 49 What is the k'th term of 25453, 50900, 76345, 101788? -k*2 + 25450k + 4 What is the f'th term of 9, 45, 137, 309, 585, 989? 4f3 + 4f*2 - 4f + 5 What is the n'th term of 235946, 471892, 707848, 943820, 1179814, 1415836, 1651892, 1887988? n3 - n2 + 235942n + 4 What is the i'th term of -11640, -11530, -11266, -10770, -9964, -8770? 13i3 - i2 + 22i - 11674 What is the o'th term of 760, 548, 194, -308, -964? -o3 - 65o*2 - 10o + 836 What is the c'th term of 423109, 423111, 423113, 423115, 423117, 423119? 2*c + 423107 What is the x'th term of 25, -92, -279, -530, -839, -1200, -1607, -2054?	{ "pile_set_name": "DM Mathematics" }
-15. Calculate the remainder when n(o) is divided by 14. 12 Let k(q) = 2 + 3q + 4q - 15q2 - 6q. Let i be k(2). Let y = -13 - i. What is the remainder when y is divided by 23? 20 Let y(t) = -t*3. Let p(v) = -2v*3. Let j(z) = 2p(z) - 5y(z). Let f be j(0). Suppose -2x + 8 + 18 = f. What is the remainder when 24 is divided by x? 11 Let u(b) = 9b + 346. Calculate the remainder when u(11) is divided by 4. 1 Let o = 44 - 146. Let r = o - -185. What is the remainder when r is divided by 25 - (-3 + 2 + (1 - 3))? 27 Let z be 1/5(-15)/(-3). Suppose i + 1 + z = 0. What is the remainder when (-4)/166i is divided by 2? 1 Let u be 42/(2/(8/6)). Let y = -38 + u. Let p(f) = -f*3 - 11f*2 - 12f - 6. What is the remainder when 54 is divided by p(y)? 12 What is the remainder when 1020 is divided by 8/92 + 2137/23? 90 Let x(f) = -1 + 4 + 5f + 5f - 5f. What is the remainder when x(6) is divided by 7? 5 Let y(p) = 32p*2 - 5p + 4. Calculate the remainder when y(3) is divided by 14. 11 Let m(t) = t*2 + 3t - 25. Let w be m(-7). Suppose 5k = 4i - 307, -2i + wk + 50 + 103 = 0. What is the remainder when i is divided by 10? 8 Let f = 329 - 26. Calculate the remainder when f is divided by 38. 37 Suppose -2q = 3q - 3r, 3q + 3r = 24. Let z(d) = -15d2 - d3 + 11 - 2d - 15d + qd. Calculate the remainder when 41 is divided by z(-14). 8 Let j(t) = -2t*3 - 14t*2 + t + 75. Calculate the remainder when j(-8) is divided by 66. 63 Let z be (-2 + 17)(-1 - (1 + -1)). Let p = -14 - z. What is the remainder when 3 is divided by p? 0 Let f = 22 - 22. Suppose b + 4 = 2p, 2b + 2 = -fb + p. Suppose -2y + by = -226. What is the remainder when y is divided by 29? 26 Suppose 513y - 505y = 2456. Calculate the remainder when y is divided by 158. 149 Suppose 2 = -k + 6. Suppose -kt - 36 = p - 128, 0 = -5p + 2t + 526. Suppose -5c + c + p = 0. Calculate the remainder when 50 is divided by c. 24 Suppose 2q + 3c = 5c + 194, -5q - 4c = -440. Calculate the remainder when q is divided by (-2)/(-5)(-1330)/(-28). 16 Suppose -3g + 2 = -16. Calculate the remainder when ((-2)/(-3))/(7/231) is divided by g. 4 Let j(s) = s - 6. Let f be j(8). Suppose -4u + fm + 150 = 4m, u = 2m + 35. Suppose -50 = w - 6w. Calculate the remainder when u is divided by w. 7 Let i(v) = v2 - 144v + 14. Let d = 153 - 57. Calculate the remainder when d is divided by i(0). 12 Let u(s) = 10s + 191. Calculate the remainder when 61 is divided by u(-16). 30 Suppose 0 = 3d - 5t - 51 - 1, -3d - 4t = -88. Suppose 4x + 84 - d = 0. Calculate the remainder when 23 is divided by (1 - 4)/(x/25). 3 Suppose 5x - j = 2x - 10, 5x + 30 = -5j. Let d(b) = -12b - 9. What is the remainder when d(x) is divided by 14? 11 Suppose -18o = -203 - 103. What is the remainder when 61 is divided by o? 10 What is the remainder when 2216/14 + 1 + (-154)/539 is divided by 27? 24 Let j = -1360 + 1443. Calculate the remainder when j is divided by 11. 6 Suppose -24 = 3k - 99. Suppose -5d - k = 0, 2b - 5d - 185 = -6d. What is the remainder when b is divided by 32? 31 Let y(i) = -i2 + 6i + 3. Let g(z) = -z*2 + 15z - 25. Calculate the remainder when g(8) is divided by y(5). 7 Let h(y) = 8y2 - 25y + 6. What is the remainder when h(4) is divided by 1? 0 Suppose 6n - 281 = 3n - t, 115 = n - 5t. Suppose 0i + n = 5i. What is the remainder when 37 is divided by i? 18 What is the remainder when 23 is divided by (-7)/(-2) - (7 - (-90)/(-12))? 3 Let z = -13 - -32. Suppose 3x - 2w = 35, 0 = 2x - w + 2w - 21. Calculate the remainder when z is divided by x. 8 Let f(x) = x2 + 2x + 3. Let o = 22 - 17. Let w = 8 - o. What is the remainder when f(-3) is divided by w? 0 Let t = -2 - 8. Let w = t - -38. What is the remainder when w is divided by 11? 6 Suppose -36w = -65w + 203. What is the remainder when 173/9 - 6/27 is divided by w? 5 Let g(k) = -k*2 + 3k + 3. Let d be g(4). Calculate the remainder when 41 is divided by (-90)/(-8) + d/4. 8 Let m(z) = 24z - 199. Let j(x) = x - 1. Let c be j(2). Let f = 9 + c. Calculate the remainder when m(9) is divided by f. 7 Let f = -11 + 53. What is the remainder when f is divided by (1 + -3)33/(-6)? 9 Suppose -2f + 29 = -c + 26, -2c = -5f + 11. Suppose 55 = 4o - 5. Calculate the remainder when o is divided by c. 1 Suppose 4227 = 2g + 2g - 5t, -4237 = -4g - 5t. What is the remainder when g is divided by 18? 14 Suppose 5y - 3y + 9 = -3v, -2y = 4v + 12. Suppose 3w - 141 = -yw. Calculate the remainder when w is divided by 12. 11 Let u(f) = 14f3 + 5f*2 - 7f + 1. What is the remainder when 44 is divided by u(1)? 5 What is the remainder when (0 + 1149/6)(8 - 6) is divided by 16? 15 Let l(d) = -8d*2 - 9d + 1. Let n be l(7). Calculate the remainder when (-8)/12 - n/6 is divided by 26. 23 Suppose -i - 4 + 1 = 0. What is the remainder when 29 is divided by -2 - (-15 + (-6 - i))? 13 Suppose 2v + 43 = 3x, 6v - 8 = -3x + v. Let n(o) = 2o - 29. Let m be n(13). Let z = 16 - m. Calculate the remainder when z is divided by x. 8 Let p = 36 + -26. Suppose a - 13 = -0a. Let k = a - p. What is the remainder when k is divided by 2? 1 Let w = -764 + 844. What is the remainder when w is divided by 29? 22 Let s(q) = -9q + 219. Calculate the remainder when s(14) is divided by 47. 46 Let s(b) = 2b - 7. Let u be s(5). Suppose -5z = -c + 15, -uc - z = -18 + 5. What is the remainder when (2-1)/(-2) - -11 is divided by c? 2 Suppose -1045x - 620 = -1047x. What is the remainder when x is divided by 13? 11 Suppose a + 2a + 12 = 0. What is the remainder when 17 is divided by a/(2 - 3) + 1? 2 Suppose 4s - 2b - 12 = 0, -s = 6b - 3b - 17. Suppose 16 = 3x + 2q, -q = -6q - s. What is the remainder when 27 is divided by (-7)/(-3)(-3 + x)? 6 Suppose 0b = -2g + 2b + 18, 0 = -4g + 3b + 37. Suppose 3i - 107 = -2o, 3i + 0i - 127 = 2o. Calculate the remainder when i is divided by g. 9 Let c(k) be the second derivative of -k5/10 + k4/12 - k*2 + 5k. Let o(l) = l*3 + 5l*2 + l - 2. Calculate the remainder when c(-2) is divided by o(-4). 8 Let t be (20/25)/(-2)5. Let c(w) = 4w2 + 2w - 1. Calculate the remainder when 43 is divided by c(t). 10 Suppose 2n = 4n - r - 3, -3r - 3 = -4n. Suppose 4h = -nj + 4j - 14, 3j = 2h + 72. Let v = 165 + -64. Calculate the remainder when v is divided by j. 23 Let l = 443 + -217. Let s = l - 99. What is the remainder when s is divided by 13? 10 Suppose f - 4j = 3f - 8, 2f = -j + 8. Suppose 0 = -ft - 2s + 196, 3t - 3s - s - 169 = 0. Calculate the remainder when t is divided by 18. 15 Let h(m) = 3m + 17. Let r be h(-5). Suppose 5o - 3 = -rv, -3o = -6o - 15. Calculate the remainder when 54 is divided by v. 12 Suppose -2n + 32 = 2n. Let o be 6((-78)/9)/(-2). Let c = o + -4. Calculate the remainder when c is divided by n. 6 What is the remainder when 14 is divided by 35/15 + (-8)/6? 0 Suppose -8i + 1272 = -2i. Let g = i + -118. Calculate the remainder when g is divided by 24. 22 Let x(s) = 4s - 18. Let m be x(8). Let f = m + -14. Suppose f = o + 1 - 19. What is the remainder when 52 is divided by o? 16 Let t = 478 - 467. Let y = 100 - 60. Calculate the remainder when y is divided by t. 7 Calculate the remainder when (102/(-24) - 1)-16 is divided by 29. 26 Let y(c) = -4c + 97. Calculate the remainder when y(10) is divided by 10. 7 Let c = -24 + 26. Suppose -co = o - 174. Calculate the remainder when o is divided by 12. 10 Let k be 52/(-10) - 4/(-20). Let r(d) = -7. Let y(o) = o. Let t(c) = -r(c) - 2y(c). Calculate the remainder when 32 is divided by t(k). 15 Let m be -1 - (-4 + 1 + -1771). What is the remainder when ((-3)/(-2))/(1/74) is divided by 2/(-14) + m/63? 27 Suppose 11k + 9 = 14k + 2u, -4k = -3u - 29. Let n = 38 - 19. What is the remainder when n is divided by k? 4 Let d(p) = -2p3 + 2p*2 + 6p - 7. What is the remainder when d(-3) is divided by (-2)/4-6 - -3? 5 Suppose 2x - 9 = -x - j, 4x - 13 = -j. Suppose -3f = 54 - 6. Let z(k) = -k - 3. Calculate the remainder when z(f) is divided by x. 1 Suppose -5v + 1100 = 375. Suppose 0 = 24k - 29k + v. Calculate the remainder when k is divided by 15. 14 Suppose 0 = 5q + 5, 4h + 5q = 46 + 9.	{ "pile_set_name": "DM Mathematics" }
*(-1/4)/h)/h)(h3)(-7/6) assuming h is positive. h(63/4) Simplify ((k(2/7))(1/18)/((k/k(-1/5))/(kkk*(-1)k)))12 assuming k is positive. k(1028/105) Simplify ((qqq/q*(-1/4)qq)(1/55)/(q(8/3)qq5))(-3/19) assuming q is positive. q(5657/4180) Simplify (b(-7/5))1/(b(-11/6)/(b(10/9)/b)) assuming b is positive. b(49/90) Simplify ((vv(v/(v(2/39)v))/v)/v)21/(v(-2/35)/v5) assuming v is positive. v(1811/455) Simplify (j/(j/(jj/j(3/4)))j*4(j*0j)14)(-24) assuming j is positive. j*(-462) Simplify (uuu14)/(u/(u/u(-3/17)))uu8(u/(uu/u(1/28)u))/u assuming u is positive. u*(10573/476) Simplify (o(oo(-22))/oo2)(-3/10) assuming o is positive. o*(57/10) Simplify pp/(pp(-19))p(ppp16)/p(p8)(-19) assuming p is positive. p(-114) Simplify ((h(2/85)/h)/(h/(hh/(h/h(3/14)))hh))38 assuming h is positive. h(-62453/595) Simplify (l8l4)/(l(2/15))(-7/9) assuming l is positive. l(1634/135) Simplify ((jj3)/(jj*10/jj))/((j*(2/21)j)/((jj(-1/2)jj)/j)) assuming j is positive. j(-277/42) Simplify ((a/(aa*(1/14))a(-2/9))/(a(-1/2)/a(-13)))(-2/35) assuming a is positive. a*(1612/2205) Simplify (yyy19y/(y*(-1/7)/y))/((y(yyyyy16)/y)/y0) assuming y is positive. y(22/7) Simplify (y/(y/(y/(y(9/5)/y)y)))/yyy/(y(-4)/y)y(yy*4/y)/(y(yy21)/y) assuming y is positive. y(-49/5) Simplify ((xxxx(-1))/(x19/x))(-5) assuming x is positive. x80 Simplify (uu(-1/15)u(2/5)/u)(2/49) assuming u is positive. u(2/147) Simplify (y(-1/4)((y(2/29)/y)/y)/y)/(y(-12)yy(-5)/y) assuming y is positive. y(1603/116) Simplify (((c/(c(1/16)c))/cc)/(cc(7/6)))/((c14c)/(c(-1/10)cc)) assuming c is positive. c(-3679/240) Simplify (o(-8/5)o)/o(oo*(-9)o)/o(o/(oo*(-3)o))0 assuming o is positive. o(-48/5) Simplify (((w8)(7/5))(2/103))(-27/2) assuming w is positive. w(-1512/515) Simplify (w(-4)www/(wwww2))/(w11/w(-1/2)) assuming w is positive. w(-35/2) Simplify (ii(1/4)iii)19/(i(-10)/i12) assuming i is positive. i(411/4) Simplify (v/(v/v(2/27)))(-23)v(1/37)/(vv/(v/((v*5v)/v))) assuming v is positive. v*(-7669/999) Simplify (((ww*(-5/3))/(ww/((w(-2)/w)/w)))(2/49))(-29) assuming w is positive. w(1160/147) Simplify ((o/o(-9/4))/(o(-3/10)o))/(o/o(-4/5)o)(-1/5) assuming o is positive. o(311/100) Simplify (f*0f(2/7))/((f/(f/(f/f26)))/(f(-21)/f)) assuming f is positive. f(23/7) Simplify aa(-7/9)aa18a*(2/11)a20 assuming a is positive. a(3901/99) Simplify ((d*14dd)/(dd(-3/2)))/(d(-8)/dd4d) assuming d is positive. d(41/2) Simplify ((u(2/9)u)/(u(-13)/u))/(uuu(1/2))(-2/53) assuming u is positive. u(7306/477) Simplify (b/b(1/4))(-4/15)/(b(-2/7)b)(-2) assuming b is positive. b(43/35) Simplify ((h1/h)(-43)/(h/(h/h*(-2/11))h*(-2/5)h))(5/7) assuming h is positive. h(-23/77) Simplify k/(kk(-9))k*(-3/14)(kk(-2/3))/kk(1/10)/k assuming k is positive. k(758/105) Simplify ((g/((gg11)/g))/(gg*0/g)((g(3/5)/g)/g)47)3 assuming g is positive. g(-1137/5) Simplify ((yy13)/yyy(-1/24))/(yyy(-1/2)y)(-12) assuming y is positive. y(1055/24) Simplify ((jj(2/3)j)(-1/4)/(j(8/7)j(-3)j))(5/4) assuming j is positive. j(5/21) Simplify (((x(-3/10)/x)46)(3/10))(9/5) assuming x is positive. x(-8073/250) Simplify j(-11)j(j*(2/19)j)/j(j/j(-4/7)j)/(j/(j/(jjj/((jj0/jjjj)/j))j)) assuming j is positive. j(-974/133) Simplify (k14)29/(((k/(k(-12)k))/k)/k)(-7) assuming k is positive. k476 Simplify (j/(j/(jj/(j/j(4/11)jj)))jj/(((j/(j/(j12/j)))/j)/j))/((j/j(1/23))/j(j/(jj(j*(-2/17)j)/jj))/j) assuming j is positive. j(-20260/4301) Simplify (u/(((u/u(-5))/u)/u)u*10u/u*(1/2)uuu(1/6))(-5/3) assuming u is positive. u(-145/9) Simplify (p(-1/5)/p*(-2)(p/((p/p(-2/3))/p))(45/2))42 assuming p is positive. p(1953/5) Simplify (h*(-8)/(h/(hh*(-4/3)h))((h/(hh*(-1)h))/hh)/h(-1/6))(-34) assuming h is positive. h(833/3) Simplify (z3)35z(z8z)/zzz/(z/z(-8)) assuming z is positive. z107 Simplify i*(-2/19)/((ii/(ii/i(1/9)i))/i)(i(1/2)/i)(-38) assuming i is positive. i(3554/171) Simplify (k(2/31)/k(-10))/(k/(k(k/(((k/(kk/(kkkk*(1/4))k))/k)/k))/kk))(-1/3) assuming k is positive. k(3527/372) Simplify g/(gg/g*(-2/3))g*(-6/5)g/(g*1gg)gg12/g assuming g is positive. g(107/15) Simplify (s(-9)/s(-8/5))/((s/s(-3/7))/(ss*(12/5)ss)) assuming s is positive. s(-24/7) Simplify (p(-4))(-6/17)/(p(-35)p/(p*(-1/2)pp)) assuming p is positive. p(1255/34) Simplify u(1/6)/u(-4)u/(u/u*(-1/8))(u/u(-2/37))/u assuming u is positive. u(3637/888) Simplify ((n/(n/n*29n))/n(3/7))/(n(-11)/(nnn(-2/93))) assuming n is positive. n(26398/651) Simplify (((bbb/(b/((b*(-12)bbb)/b)))/b(b0/b)/b)(1/11))(-1/15) assuming b is positive. b(1/15) Simplify a(2/5)a*(1/3)a*(-25)a27 assuming a is positive. a(41/15) Simplify (m/(m*(2/33)/m))/(m/(mm/(m*(3/4)m)))((m/m(3/13))/m)/m(1/2) assuming m is positive. m(787/1716) Simplify (z/z(2/13)z*(13/2))/(((z/((zz/z*(1/17))/z))/zz)/z((zz/z(-12))/z)/z) assuming z is positive. z(-1641/442) Simplify ((d*(-2/7)/d)/dd24/d)/(d8d)(-36) assuming d is positive. d(2413/7) Simplify (a/(a3a))(-2/135)/(a(2/3)a)(-30) assuming a is positive. a(2252/45) Simplify (w(-2/3))(-7)(ww/w(-2/13))/w19 assuming w is positive. w(-475/39) Simplify ((t6/(t(-2/9)/t))/(t6tt(-1/3)))(2/87) assuming t is positive. t(10/783) Simplify y(6/5)y*(-1/3)y*1yy/y(-8) assuming y is positive. y(178/15) Simplify (n/(n/(nn(10/3))))31n(-27)n29/n assuming n is positive. n(406/3) Simplify (v*12v)*(-3/19)/((vv*15)/vv)(-48) assuming v is positive. v(14553/19) Simplify ((w/w*0w((w12/w)/w)/w)27)(-1/2) assuming w is positive. w(-297/2) Simplify (a(1/38)/a3)/((a((a*14a)/aa)/a)/a)(-9) assuming a is positive. a(4675/38) Simplify ((r(-4/5)r*2rr)(-10))(-21/5) assuming r is positive. r(672/5) Simplify (s(-2))(-1/24)s*16/ss(2/65) assuming s is positive. s(11789/780) Simplify (((o(-2))(-9/2))(16/11))(-35) assuming o is positive. o(-5040/11) Simplify (v21)*(32/5)v*(-8)vv/(vvvv/(v/((vvv*(1/3))/vv))) assuming v is positive. v(1846/15) Simplify (i(-2/9)/iii(i23/i)/i)(-45) assuming i is positive. i(-980) Simplify (q/(q/q(-3/2)q)q)(11/5)q/(q*(-27)q)qq(-7/3)/q assuming q is positive. q(641/30) Simplify ((g(g/(g/(g(-4)g)gg)g)/g)/g(-2/5)((g/(g*(-1/4)g))/g)(6/11))14 assuming g is positive. g(-3087/55) Simplify ((l/l5)/l)/(l/(l((ll*(-1))/l)/lll))(l/l(2/3))(3/25) assuming l is positive. l(-124/25) Simplify (s(-3/7))*13ss7ss(-4)/s assuming s is positive. s(-11/7) Simplify (n(-1/3)/nn*(2/7)nn/(n/((n(-6)/n)/n))(nn2n)/n)(-2) assuming n is positive. n(212/21) Simplify (n(-7/4)/n(3/19))(2/31) assuming n is positive. n(-145/1178) Simplify (tt(1/7)t)/t*(1/7)t*(-13)t(-10) assuming t is positive. t(-21) Simplify (z12)(-3/14)/(z4)28 assuming z is positive. z(-802/7) Simplify (y/((y/y(-2))/y))*35y*12/(y/(((y/(y/(yy*(-10/11)yy))yy)/y)/yy)) assuming y is positive. y(-230/11) Simplify (g12/(g/(g/g*(-13)g)))/(((g/g5)/g)/g(-6)) assuming g is positive. g*25 Simplify (((ww42/w)/w)(-1/9))(-12) assuming w is positive. w(164/3) Simplify (hhh/(hh(-9)hh)h)/h*(-27)(((hh(2/9))/h)/h)/h(-3/17) assuming h is positive. h(5569/153) Simplify (p(-5/4)p/p*(-9/5))/((ppp/(p/(p(p/(p*(-6)/pp))/p)))/p(-20)) assuming p is positive. p(-549/20) Simplify (vvv*(-8)v)*(5/17)(v9)2 assuming v is positive. v(281/17) Simplify (l(-2/5)l/(l6/l))/(l(3/4)l4) assuming l is positive. l(-183/20) Simplify ((c*(-18)cc/(c(-2/3)/c)c)11)(-1/81) assuming c is positive. c*	{ "pile_set_name": "DM Mathematics" }
housands digit of 26737? 2 What is the tens digit of 789? 8 What is the tens digit of 764? 6 What is the thousands digit of 9211? 9 What is the tens digit of 538? 3 What is the tens digit of 156800? 0 What is the tens digit of 55586? 8 What is the units digit of 7560? 0 What is the units digit of 909? 9 What is the hundreds digit of 533? 5 What is the ten thousands digit of 38603? 3 What is the thousands digit of 7553? 7 What is the ten thousands digit of 134007? 3 What is the hundreds digit of 1012? 0 What is the units digit of 933? 3 What is the thousands digit of 1630? 1 What is the hundreds digit of 2725? 7 What is the hundreds digit of 21380? 3 What is the thousands digit of 38862? 8 What is the tens digit of 6746? 4 What is the hundreds digit of 33056? 0 What is the hundreds digit of 545? 5 What is the units digit of 20968? 8 What is the hundreds digit of 6230? 2 What is the hundreds digit of 11132? 1 What is the tens digit of 902? 0 What is the tens digit of 1706? 0 What is the thousands digit of 11671? 1 What is the thousands digit of 1825? 1 What is the units digit of 3084? 4 What is the hundreds digit of 380? 3 What is the hundreds digit of 63826? 8 What is the units digit of 9115? 5 What is the hundreds digit of 5104? 1 What is the hundreds digit of 9776? 7 What is the ten thousands digit of 12535? 1 What is the units digit of 223? 3 What is the hundreds digit of 563? 5 What is the ten thousands digit of 147741? 4 What is the hundred thousands digit of 111114? 1 What is the ten thousands digit of 20948? 2 What is the tens digit of 6037? 3 What is the units digit of 7591? 1 What is the hundreds digit of 2625? 6 What is the units digit of 239? 9 What is the hundreds digit of 61628? 6 What is the thousands digit of 2373? 2 What is the tens digit of 13245? 4 What is the hundreds digit of 2558? 5 What is the hundreds digit of 14967? 9 What is the hundreds digit of 15474? 4 What is the tens digit of 520? 2 What is the tens digit of 1029? 2 What is the thousands digit of 1552? 1 What is the hundreds digit of 18103? 1 What is the units digit of 439? 9 What is the hundreds digit of 4392? 3 What is the hundreds digit of 17382? 3 What is the tens digit of 2960? 6 What is the thousands digit of 22386? 2 What is the thousands digit of 2980? 2 What is the ten thousands digit of 13056? 1 What is the units digit of 42? 2 What is the tens digit of 1634? 3 What is the thousands digit of 3807? 3 What is the thousands digit of 3877? 3 What is the units digit of 1974? 4 What is the thousands digit of 2316? 2 What is the units digit of 271? 1 What is the hundreds digit of 1284? 2 What is the tens digit of 12398? 9 What is the hundreds digit of 32417? 4 What is the hundreds digit of 14244? 2 What is the hundreds digit of 671? 6 What is the tens digit of 47970? 7 What is the hundreds digit of 129? 1 What is the hundreds digit of 826? 8 What is the ten thousands digit of 92496? 9 What is the tens digit of 51994? 9 What is the ten thousands digit of 29677? 2 What is the hundreds digit of 322? 3 What is the tens digit of 35222? 2 What is the units digit of 13249? 9 What is the units digit of 2015? 5 What is the units digit of 3835? 5 What is the hundreds digit of 1807? 8 What is the tens digit of 8374? 7 What is the units digit of 5451? 1 What is the units digit of 26669? 9 What is the units digit of 963? 3 What is the tens digit of 983? 8 What is the thousands digit of 1172? 1 What is the units digit of 21271? 1 What is the units digit of 6982? 2 What is the thousands digit of 15678? 5 What is the hundreds digit of 448? 4 What is the units digit of 115435? 5 What is the tens digit of 11631? 3 What is the units digit of 66? 6 What is the units digit of 199? 9 What is the thousands digit of 3192? 3 What is the tens digit of 648? 4 What is the tens digit of 6700? 0 What is the hundreds digit of 59082? 0 What is the thousands digit of 7764? 7 What is the tens digit of 70? 7 What is the thousands digit of 12977? 2 What is the thousands digit of 15855? 5 What is the tens digit of 961? 6 What is the units digit of 2175? 5 What is the units digit of 516? 6 What is the thousands digit of 2595? 2 What is the hundreds digit of 25366? 3 What is the hundreds digit of 110941? 9 What is the hundreds digit of 45913? 9 What is the thousands digit of 45500? 5 What is the units digit of 59037? 7 What is the hundreds digit of 1078? 0 What is the tens digit of 25953? 5 What is the tens digit of 492? 9 What is the thousands digit of 93057? 3 What is the units digit of 303? 3 What is the tens digit of 10406? 0 What is the units digit of 587? 7 What is the units digit of 1059? 9 What is the units digit of 603? 3 What is the units digit of 11918? 8 What is the hundreds digit of 974? 9 What is the tens digit of 44223? 2 What is the thousands digit of 1611? 1 What is the tens digit of 785? 8 What is the ten thousands digit of 22808? 2 What is the tens digit of 3490? 9 What is the tens digit of 2707? 0 What is the units digit of 905? 5 What is the ten thousands digit of 67067? 6 What is the hundreds digit of 7506? 5 What is the thousands digit of 1030? 1 What is the hundreds digit of 2454? 4 What is the hundreds digit of 2233? 2 What is the thousands digit of 8485? 8 What is the thousands digit of 32427? 2 What is the tens digit of 4316? 1 What is the units digit of 2436? 6 What is the tens digit of 19908? 0 What is the units digit of 1581? 1 What is the thousands digit of 33783? 3 What is the hundreds digit of 3450? 4 What is the thousands digit of 103964? 3 What is the hundreds digit of 82337? 3 What is the thousands digit of 57651? 7 What is the hundreds digit of 2289? 2 What is the thousands digit of 1864? 1 What is the hundreds digit of 704? 7 What is the units digit of 216? 6 What is the ten thousands digit of 23002? 2 What is the tens digit of 3844? 4 What is the thousands digit of 3385? 3 What is the ten thousands digit of 48812? 4 What is the units digit of 56484? 4 What is the tens digit of 8088? 8 What is the thousands digit of 1081? 1 What is the hundreds digit of 20384? 3 What is the hundreds digit of 67606? 6 What is the units digit of 31074? 4 What is the hundreds digit of 55040? 0 What is the units digit of 1554? 4 What is the units digit of 33420? 0 What is the hundreds digit of 19480? 4 What is the thousands digit of 7195? 7 What is the units digit of 940? 0 What is the hundreds digit of 1402? 4 What is the hundreds digit of 123932? 9 What is the units digit of 2184? 4 What is the units digit of 1167? 7 What is the thousands digit of 1757? 1 What is the units digit of 868? 8 What is the units digit of 21? 1 What is the tens digit of 4701? 0 What is the units digit of 945? 5 What is the thousands digit of 58600? 8 What is the hundreds digit of 2110? 1 What is the thousands digit of 2204? 2 What is the ten thousands digit of 67474? 6 What is the tens digit of 23323? 2 What is the units digit of 432? 2 What is the hundreds digit of 8531? 5 What is the thousands digit of 47185? 7 What is the tens digit of 90383? 8 What is the hundreds digit of 153? 1 What is the tens digit of 2071? 7 What is the tens digit of 2674? 7 What is the units digit of 260? 0 What is the hundreds digit of 30634? 6 What is the hundreds digit of 81321? 3 What is the tens digit of 9528? 2 What is the thousands digit of 15079? 5 What is the thousands digit of 1179? 1 What is the thousands digit of 38451? 8 What is the hundreds digit of 10858? 8 What is the tens digit of 40? 4 What is the tens digit of 855? 5 What is the ten thousands digit of 15325? 1 What is the tens digit of 1713? 1 What is the tens digit of 938? 3 What is the hundreds digit of 36853? 8 What is the units digit of 25966? 6 What is the ten thousands digit of 51367? 5 What is the units digit of 29565? 5 What is the units digit of 492? 2 What is the units digit of 9178? 8 What is the hundreds digit of 39603? 6 What is the units digit of 157? 7 What is the units digit of 69203? 3 What is the units digit of 116? 6 What is the tens digit of 46287? 8 What is the units digit of 2251? 1 What is the hundreds digit of 4616? 6 What is the thousands digit of 1938? 1 What is the thousands digit of 11745? 1 What is the hundreds digit of 42452?	{ "pile_set_name": "DM Mathematics" }
+ 3436656129 = 0. -3, 19541 Suppose 2c3/15 - 1696c*2/15 + 13810c/3 + 9660 = 0. Calculate c. -2, 45, 805 Determine o, given that o*4 + 97o*3 + 1280o*2 + 4100o = 0. -82, -10, -5, 0 Find r, given that -2r5 + 70r*4 - 778r*3 + 3530r*2 - 5700r = 0. 0, 5, 6, 19 Solve 5l4 - 920l*3 - 2850l*2 + 8440l - 4675 = 0 for l. -5, 1, 187 Suppose -5k3 + 2520k*2 - 220915k = 0. Calculate k. 0, 113, 391 Let -785t4 - 11785t*3 + 131730t*2 + 2001860t + 25480 = 0. Calculate t. -14, -2/157, 13 Determine j, given that -10j4 - 8654j*3 - 1860980j*2 + 4907672j + 2260272 = 0. -434, -2/5, 3 Factor -d*2/3 + 1477624d/3 - 545843171344/3. -(d - 738812)2/3 Factor -m2/2 + 261m + 23400. -(m - 600)(m + 78)/2 What is p in p*2/7 + 39964p/7 + 399280324/7 = 0? -19982 Suppose -3h3 - 804h*2 - 5349h + 34452 = 0. What is h? -261, -11, 4 Determine v, given that -35v4 + 17v*3 + 89v*2 - 89v + 18 = 0. -9/5, 2/7, 1 Find c, given that -2c3/7 - 1612c*2/7 + 4850c/7 - 3236/7 = 0. -809, 1, 2 Factor -2k4 + 20266k*3 - 51288142k*2 - 256947610k. -2k(k - 5069)*2(k + 5) Determine o, given that -o*3/2 + 208335o*2/2 - 10850972223o/2 + 10850763889/2 = 0. 1, 104167 Factor -9p3/4 - 2373p*2/4 - 159919p/4 - 458643/4. -(p + 3)(3p + 391)*2/4 Factor -3w*3 + 9780w*2 - 19551w + 9774. -3(w - 3258)(w - 1)*2 Factor 12m*4/7 + 142m*3/7 + 318m*2/7. 2m*2(m + 3)(6m + 53)/7 Determine v, given that -16v2/11 + 254v - 5524/11 = 0. 2, 1381/8 Factor -2s3/9 + 109252s*2/9 - 1491999938s/9. -2s(s - 27313)2/9 Let -o3/3 - 68o2/3 + 361o/3 - 292/3 = 0. Calculate o. -73, 1, 4 Factor -4r3 - 1672r*2 - 14684r + 16360. -4(r - 1)(r + 10)(r + 409) Factor 4p*3 + 34320p*2 + 205796p + 171480. 4(p + 1)(p + 5)(p + 8574) Factor 3y*3/2 + 1053y*2/2 - 1593y. 3y(y - 3)(y + 354)/2 Suppose -x3/11 - 3615x*2/11 + 116448x/11 - 933632/11 = 0. Calculate x. -3647, 16 Find f, given that 6f5/11 - 322f*4/11 + 4404f*3/11 - 5372f*2/11 - 14010f/11 - 3906/11 = 0. -1, -1/3, 3, 21, 31 Factor -5c2/12 + 31127c/6 + 12451/12. -(c - 12451)(5c + 1)/12 Let -3d3/7 - 172d*2/7 - 1093d/7 - 1812/7 = 0. What is d? -151/3, -4, -3 Let -2y5 - 2640y*4 - 23658y*3 - 78748y*2 - 115416y - 62928 = 0. What is y? -1311, -3, -2 Factor 3k2/7 - 117903k/7 + 117900/7. 3(k - 39300)(k - 1)/7 Factor 17y2/3 - 158y/3 - 904/3. (y + 4)(17y - 226)/3 Determine k, given that 3k4 - 3414k*3 + 6807k*2 + 10224k = 0. -1, 0, 3, 1136 Let -s*3/7 + 1306s*2/7 - 407537s/7 - 1779556 = 0. What is s? -28, 667 Factor -n*4/2 - 31n*3/2 + 213n*2/2 - 333n/2. -n(n - 3)2(n + 37)/2 Factor -4k3/7 + 96k*2/7 + 204k/7 + 104/7. -4(k - 26)(k + 1)2/7 Find f such that -f3 + 128f2 + 2611f + 2482 = 0. -17, -1, 146 Factor c*3/5 + 57c*2/5 + 162c. c(c + 27)(c + 30)/5 Factor -x*4 + 3x*3 + 5x*2 - 3x - 4. -(x - 4)(x - 1)(x + 1)*2 Factor -5u*3 + 600u*2 + 10805u + 10200. -5(u - 136)(u + 1)(u + 15) Find g, given that 4g*5 + 784g*4 - 9816g*3 + 34736g*2 - 43180g + 17472 = 0. -208, 1, 3, 7 Find h, given that -3h5/2 - 4687h*4/2 + 13320h*3 - 12554h*2 - 15672h + 12544 = 0. -1568, -1, 2/3, 2, 4 Suppose 3f5/2 - 223f*4 - 157f*3/2 + 598f*2 - 298f = 0. What is f? -2, 0, 2/3, 1, 149 Factor -o*2/4 + 160785o/2 - 25851816225/4. -(o - 160785)*2/4 Find t, given that 176006322t*3 + 39015579t*2 + 1746660t + 22188 = 0. -1/6, -86/3127 Find l, given that l*4/9 - 170l*3/3 + 1523l*2/9 - 338l/3 = 0. 0, 1, 2, 507 What is z in z*5/10 + 4413z*4/10 + 2413214z*3/5 - 46695552z*2/5 - 9821312z = 0? -2216, -1, 0, 20 Find s, given that -100s3 + 6435s*2 - 14675s + 6510 = 0. 3/5, 7/4, 62 Find k, given that -3k3/4 - 12639k*2/4 - 37836k - 113427 = 0. -4201, -6 Find j such that -3j5/7 + 4443j*4/7 - 8817j*3/7 - 84219j*2/7 - 124200j/7 - 53244/7 = 0. -2, -1, 6, 1479 Solve d*5/3 - 145d*4/3 - 31d*3/3 + 4465d*2/3 + 1450d = 0 for d. -5, -1, 0, 6, 145 Suppose o*5/2 - 91o*4 - 6005o*3/2 - 12099o*2 + 15192o = 0. What is o? -24, -6, 0, 1, 211 Factor 2b5/13 - 118b*4/13 + 660b*3/13 - 1288b*2/13 + 848b/13. 2b(b - 53)(b - 2)3/13 Determine b, given that -b5/7 - 845b*4/7 + 4247b*3/7 - 2559b*2/7 - 7650b/7 = 0. -850, -1, 0, 3 Let r*3/4 + 1407r*2/2 - 12754r - 28320 = 0. What is r? -2832, -2, 20 Factor -3a3/8 - 297a*2/8. -3a*2(a + 99)/8 Factor 5l2 + 162580l + 162575. 5(l + 1)(l + 32515) Find r, given that -r*2 + 804126r - 161654655969 = 0. 402063 Let -2m5 - 23212m*4 - 67372826m*3 - 134676024m*2 - 67326408m = 0. What is m? -5802, -1, 0 Determine h, given that -2h5/3 + 2992h*4/3 - 439504h*3 + 149228992h*2/3 - 4975230752h/3 = 0. 0, 74, 674 Suppose 3c3 - 184c*2 + 2684c + 1872 = 0. What is c? -2/3, 26, 36 What is g in -15g3 - 2052g*2 + 27951g + 101916 = 0? -149, -3, 76/5 Solve w*4/4 - 17711w*3/4 - 53139w*2/4 - 53141w/4 - 8857/2 = 0. -1, 17714 Suppose -f*5/6 - 19f*4 - 1745f*3/6 + 85618f*2/3 + 734136f - 13006240/3 = 0. Calculate f. -52, 5, 37 Factor -2a2/3 + 1294a/3 + 2596/3. -2(a - 649)(a + 2)/3 Determine y so that y*2 + 26079y - 234792 = 0. -26088, 9 Suppose 4a5 + 376a*4 + 8524a*3 - 8904a*2 = 0. Calculate a. -53, -42, 0, 1 Solve -9k*5/4 + 5313k*4/2 - 7077k*3/4 - 885k2 = 0 for k. -1/3, 0, 1, 1180 Determine n, given that -n2/5 + 4366n/5 - 48272 = 0. 56, 4310 Suppose -2h*2/11 - 3720h/11 = 0. Calculate h. -1860, 0 What is d in -10d4 - 1785d*3 - 54410d*2 - 69735d + 233100 = 0? -140, -37, -3, 3/2 Find w, given that 4w3/7 + 3796w*2/7 + 668236w/7 - 16663740 = 0. -527, 105 Determine f, given that 2f3/7 + 1530f*2/7 - 4608f/7 = 0. -768, 0, 3 Determine z, given that -z*2/6 + 529z/2 + 12240 = 0. -45, 1632 What is w in -2w4 + 180w*3 - 286w*2 - 5988w + 15840 = 0? -6, 3, 5, 88 What is z in -2z2/5 + 16198z/5 - 109684 = 0? 34, 8065 What is s in 3s5/2 - 77s*4/4 - 2073s*3/2 - 19103s*2/4 + 11430s - 5600 = 0? -16, -8, 5/6, 1, 35 Solve -119r5/4 + 2735r*4/4 + 1927r*3/2 - 5339r*2 - 8658r - 144 = 0. -2, -2/119, 3, 24 Suppose -5p5/6 - 3p*4 + 148p*3/3 + 83p*2 + 63p/2 = 0. What is p? -9, -1, -3/5, 0, 7 Factor 2c3/7 - 64c*2/7 + 494c/7. 2c(c - 19)(c - 13)/7 Suppose 2a*4/11 - 1674a*3/11 - 3362a*2/11 + 5034a/11 = 0. What is a? -3, 0, 1, 839 Factor -z*2/4 + 2369z/4 + 11895/2. -(z - 2379)(z + 10)/4 Find o such that o5 - 13925o*4 + 64658406o*3 - 100220371520o*2 + 499874252800o - 599384064000 = 0. 2, 3, 4640 Solve 3z4 - 468z*3 - 23769z*2 + 48930z - 24696 = 0. -42, 1, 196 Factor 4u3/3 + 620u*2/3 - 2188u + 1980. 4(u - 9)(u - 1)(u + 165)/3 Solve -f5 - 148f*4 + 2585f*3 - 6400f*2 - 604f + 8528 = 0 for f. -164, -1, 2, 13 Find q such that 2q5/7 + 180q*4 + 7514q*3/7 + 16248q*2/7 + 14984q/7 + 4992/7 = 0. -624, -2, -1 Factor 5i2 + 10770i + 149800. 5(i + 14)(i + 2140) Factor a*4/6 + 10a*3/3 + 3a*2 - 10a/3 - 19/6. (a - 1)(a + 1)2(a + 19)/6 Factor -3y3 - 177894y*2 - 1067271y - 889380. -3(y + 1)(y + 5)(y + 59292) Determine w so that 2w*2/5 + 206w - 11572/5 = 0. -526, 11 Let -2c2/9 + 10c/3 + 20900/9 = 0. What is c? -95, 110 Solve 2q2 - 1698q - 15444 = 0. -9, 858 Find x such that x4 + x3 - 224x2 - 1884x - 4320 = 0. -8, -6, -5, 18 Let -7s4/3 + 30027s*3 - 874567s*2/3 + 664365s + 642950/3 = 0. What is s? -2/7, 5, 12859 Let 2d4 - 4d*3 - 86d*2 + 256d - 168 = 0. What is d? -7, 1, 2, 6 Factor 4o3 + 3936o*2 + 211008o + 2910208. 4(o + 28)2(o + 928) Determine c, given that -2c2/7 + 174060c - 26509773150 = 0. 304605 Factor -v*5/9 + 3061v*4/9 - 2347018v*3/9 + 7022698v*2/9 - 7016581v/9 + 2337841/9. -(v - 1529)*2(v - 1)*3/9 Factor -2b*5/3 + 78b*4 - 1530b*3 - 98838b*2 + 3183624b. -2b(b - 51)*3(b + 36)/3 Factor -374k2/13 - 1184k/13 - 186/13. -2(k + 3)(187k + 31)/13 Let -2q*4/15 + 386q*3/3 - 152932q*2/5 - 219672q - 944784/5 = 0. What is q? -6, -1, 486 Factor i*2 + 1768i + 8815. (i + 5)(i + 1763) Solve -3n*5 - 477n*4 + 8706n*3 - 47196n*2 + 57672n + 1140	{ "pile_set_name": "DM Mathematics" }
lculate g(i(b)). -6b2 Let l(d) = 8d + 6. Let n(r) = 17r + 13. Let j(h) = 5l(h) - 2n(h). Let z(k) = 5k + 3. Let q(m) = -3j(m) + 4z(m). Let f(i) = -8i2. What is f(q(v))? -32v*2 Let u(c) = -3c. Let h(j) = 7j2 - 6j. Let m(f) = -8f2 + 5f. Let k(q) = 5h(q) + 6m(q). Calculate k(u(i)). -117i2 Let k(x) = 4x*2. Let i(n) = 8n2 - n2 - 9n2. What is k(i(z))? 16z*4 Let z(w) = 6w. Let u(r) = -19r2 + 11r. Let t(n) = -2n2 + n. Let l(q) = -44t(q) + 4u(q). Determine z(l(j)). 72j*2 Let o(v) = 5v - 2. Let u(k) = 35k + 4 - 10 - 8 - 1. Let w(h) = 15o(h) - 2u(h). Let j(s) = -s2. Determine j(w(x)). -25x2 Let u(h) = h2 - 3h - 3. Let l(d) = 2d + 2. Let j(s) = -3l(s) - 2u(s). Suppose -5 + 15 = 5y. Let i(a) = 1 - 1 - ay. Give j(i(q)). -2q*4 Let y(x) = 2x. Let u(m) = -3m - 5m - 6m + 18m. Determine y(u(q)). 8q Let l(h) be the first derivative of 0h - 2/3h3 + 3 + 0h2. Let w(j) = j2. Give l(w(v)). -2v4 Let d(a) = -5a + 1. Let p(i) = -2i. Calculate p(d(h)). 10h - 2 Let b(m) = m. Let z(k) = 8k2 + 5. Give z(b(i)). 8i*2 + 5 Let a(q) = -2q. Let h(j) be the first derivative of -9j2/2 - 10. Calculate h(a(c)). 18c Let c be 2/(-5) - (-48)/20. Let j(l) = c - 2l2 - 2 + 0. Let s(h) be the first derivative of h3/3 + 1. What is s(j(t))? 4t*4 Let c(j) = -2j. Let y(v) = -465v. Give y(c(i)). 930i Let d(v) = -2v. Let p be 0 - -3 - (-6)/(-2). Let c(j) = pj - 3j + 0 + 0. Calculate d(c(y)). 6y Let n(w) = 8w. Let l(r) = 13r. Determine l(n(h)). 104h Let r(o) = o. Let i(y) be the third derivative of 2y*4/3 - 7y*2. What is r(i(w))? 16w Let p(d) = -14d2 + 1. Let c(b) = -7b. Give c(p(t)). 98t2 - 7 Let m(g) be the third derivative of -19g*4/24 - 23g2. Let u(k) = -k2. Calculate m(u(c)). 19c2 Suppose 2 - 6 = -2q. Let u(r) = -2r2 + r2 - rq. Let v(t) be the second derivative of -t4/3 - 3t - 1. Calculate u(v(c)). -32c4 Let g(z) = 3z*2. Let j(p) = -97p + 2. Calculate g(j(i)). 28227i2 - 1164i + 12 Let m(d) = -6d. Let w(v) = -17v*2. Give m(w(l)). 102l*2 Let v(q) be the second derivative of -5q*4/6 + 5q. Let j(o) = -9 - 2o + 4 + 5. Calculate v(j(w)). -40w*2 Let k(a) be the third derivative of 0a*3 + 0 + 0a - 1/24a4 - 9a*2. Let i(m) = 5m - 2m - 4m. Determine i(k(y)). y Let f(q) be the third derivative of 0q4 + 0 - 1/10q*5 + 0q + 2q2 + 0q*3. Let r(g) = 2g*2. Give f(r(w)). -24w*4 Suppose 7n - 10 = 2n. Let w(q) be the first derivative of 2q*2 - 1 - 3q*n + 3. Let c(m) = -2m*2. Calculate w(c(a)). 4a*2 Let q(u) = 3u. Let j(z) be the first derivative of 9z2/2 - 30. Determine q(j(m)). 27m Suppose 1 = -2a + 9. Let m(x) = 4 + 0x + x - a. Let d(f) = 5f. What is m(d(k))? 5k Let s(i) = 2i + 29. Let z(w) = -4w*2. Determine z(s(v)). -16v*2 - 464v - 3364 Let w(u) = 21u. Let o(k) = -2k. What is o(w(i))? -42i Let o(s) = -666s. Let f(d) = d. Determine f(o(b)). -666b Let n(o) = 2o + 6. Let i(w) = 9w2. What is i(n(a))? 36a*2 + 216a + 324 Let p be 1 + (-3)/(-6)2. Let u(q) be the first derivative of 1 - q2 - 2 + 2q*p. Let t(g) = -2g. Determine t(u(m)). -4m Let k be (-7)/1(-4)/14. Suppose -kr + 4c = 4, 5r - 2r - 3c = 0. Let x(w) = -4w + 4w - wr. Let g(j) = -3j. Determine x(g(l)). -9l2 Let u(y) be the third derivative of -y5/60 - 17y*2. Let h(s) = -6s*2 - s. Calculate h(u(f)). -6f4 + f2 Let o(s) = 4s2 - 29. Let p(q) = -q2. What is o(p(a))? 4a*4 - 29 Let a(m) = 2m2. Let q(f) = -f3 + 9f2 - 8f + 4. Let v be q(8). Let p(z) = 7z - 4 + v + 0. Calculate a(p(w)). 98w*2 Let w(r) = 1. Let c(p) = 8. Let v(m) = 3c(m) - 21w(m). Let x(a) = -a2 - 4. Let d(b) = -4v(b) - 3x(b). Let j(s) = 5s*2 - 3s*2 - 3s*2. Give d(j(h)). 3h*4 Let s(w) be the second derivative of 0w*4 + 2w*2 + 0 + 0w*3 - w - 1/60w*5. Let i(g) be the first derivative of s(g). Let t(a) = 3a. Give i(t(j)). -9j2 Let y(b) = -10b2. Let v(d) be the second derivative of d3/3 + 3d. What is y(v(u))? -40u*2 Let i(m) = 2m. Let c(l) be the first derivative of -l6/120 - l3/3 + 3. Let j(g) be the third derivative of c(g). Calculate j(i(k)). -12k2 Let j(w) = -386w*2. Let i(v) = -4v. Give j(i(u)). -6176u2 Let g(q) be the first derivative of q3/3 - 4. Let t(m) = 6m*2. Calculate t(g(u)). 6u*4 Let w(z) = -31z*2. Let j(a) = 479a - 1. Give j(w(f)). -14849f2 - 1 Let t(d) = -d2. Let k be (15/4)/((-2)/(-8)). Suppose 4s + 1 = -3j + k, 2s - 2j = 0. Let n(f) = -5f - f*s + 3f + 2f. Determine n(t(q)). -q4 Let q(x) be the first derivative of x2/2 - 9. Let w(o) = 0 + 0 + o. Determine q(w(f)). f Let z(b) = 2b*2. Let n(u) be the third derivative of 0 + 3u*2 + 0u*4 + 0u + 0u3 + 1/60u*5. Give n(z(q)). 4q*4 Let j(w) = -2w*2. Let t(u) = 22u + 16. Let c(y) = 6y + 7 + y - 2. Let f(i) = -16c(i) + 5t(i). Determine j(f(o)). -8o*2 Let f(h) = 7h - 4. Let q(c) = 22c - 11. Let x(s) = -11f(s) + 4q(s). Let r(m) = m + 3. Let w(k) = k + 2. Let i(j) = 2r(j) - 3w(j). Determine x(i(o)). -11o Let o(z) = z*2 + z. Let g(m) = -4m*2 - 5m. Let r(y) = -g(y) - 5o(y). Let x(b) = -5b. Calculate x(r(q)). 5q2 Let y(b) be the first derivative of 11b3/3 - 16. Let x(u) = -u2. Calculate y(x(c)). 11c4 Let p(h) = -10h. Let j(z) = -2z. Give j(p(l)). 20l Let i(f) = 115f. Let x(q) = -14q*2. What is x(i(s))? -185150s2 Let b(s) = s2. Let v(r) = r*2. Let z(l) = b(l) - 2v(l). Let a(h) = -6h. Give a(z(g)). 6g2 Let d(n) be the third derivative of -n5/30 + 37n2. Let s(q) = 19q*2. Determine s(d(l)). 76l*4 Suppose -q + 12 = 3. Let u(g) = 3g + 4g2 + 6g - qg. Let s(f) = 0f + 3f - 2f. Calculate s(u(p)). 4p2 Let v(g) = 2g*2. Let u(k) = 271k*2. Calculate v(u(m)). 146882m*4 Let x(o) = -2o + 5o2 + 2o. Let b(c) = 6c - 6c + 3 + 0 - c. Let s(t) = -t + 2. Let v(z) = 2b(z) - 3s(z). Determine x(v(a)). 5a2 Let t(r) be the first derivative of r4/8 - r2 + 3. Let j(c) be the second derivative of t(c). Let v(h) = -2h*2. What is j(v(d))? -6d*2 Let t(v) = 8 - 8 - 2v*2. Let z(j) = 18j*2 + 26. Let p(u) = 2u*2 + 3. Suppose 5h - h = -24. Let f(n) = hz(n) + 52p(n). Give t(f(s)). -32s4 Let k(x) = 5x*2 + 4x. Let u(c) = 126c2 + 99c. Let i(a) = 99k(a) - 4u(a). Let p(d) = -2d. Determine p(i(j)). 18j*2 Let k(v) be the first derivative of 2v*3/3 - 5. Let m(d) = 0 + 0 - 4d. Give k(m(h)). 32h2 Let m(o) = -o + o + 1 - o2. Let t(c) = -c2 + 1. Let u(b) = 2m(b) - t(b). Let w(r) be the first derivative of u(r). Let g(j) = 2j. Calculate g(w(x)). -4x Let j(c) = 3c2. Suppose 2u = 5u - 6. Suppose o + u = 2o. Let a(m) = -m*2 + 0m2 - mo. Determine j(a(z)). 12z4 Let o(z) = z2. Let s be 84/18 + (-2)/3. Suppose sn - 3u = -7, n = -u - 0 + 7. Let c(q) = -6q*2 + 5q*2 - 5q*n. What is o(c(j))? 36j*4 Let v(h) = -2h + 49. Let q(x) = x. What is q(v(p))? -2p + 49 Let z(j) be the first derivative of j3 - 17. Let d(g) = 22g. Determine d(z(x)). 66x2 Suppose 1 = 5a - 14. Let u(h) = h + ah - h. Let w(p) = -p2. Give w(u(d)). -9d*2 Let p(o) = -1. Let c(l) = -3l + 9. Let m(j) = c(j) + 9p(j). Let q be 14/6 - (-4)/(-12). Let z(h) = qh*2 - 2h + 2h. What is z(m(d))? 18d*2 Let c(j) = j. Let a = 20 + -17. Let y(m) be the second derivative of 0m*2 + 0 + 0m*3 + 1/12m*4 - am. What is c(y(p))? p*2 Let f(u) = 3u*2. Let k(o) = -3o*2 + 12. What is k(f(s))? -27s4 + 12 Let z(j) be the third derivative of -j5/30 + j*2. Let k(y) = -5y*2 + 11y + 11. Let p(g) = -g*2 + 2g + 2. Let m(w) = 2k(w) - 11p(w). Give m(z(f)). 4f4 Let b(l) be the third derivative of l5/60 + l2. Let v(u) = -u3 + 12u*2 - 11u + 3. Let k be v(11). Let p(d) = 2d - kd + d - d. Give b(p(z)). z*2 Let v(q) = -5q*2. Let y(r) = r + 2. Let i(t) = -3t - 9. Let p(z) = 2i(z) + 9y(z). Determine p(v(x)). -15x2 Let g(u) = 130u. Let o(p) = p. Give o(g(a)). 130a Let u(q) be the second derivative of -q3/3 - 4q. Let b(t) be the third derivative of -t*4/8 - 3t*2. Calculate u(b(k)). 6k Let u(s) = -173s. Let l(o) = -18o. Calculate u(l(y)). 3114y Let k(q) = -2q. Suppose 5*r - 12 - 3 = 0. Let z	{ "pile_set_name": "DM Mathematics" }
2u + u = -2s + v for u. 2 Suppose 5y = -120 + 135. Solve yr + w = 8, 0 = 3r - 6r + 4w - 2 for r. 2 Suppose 105q - 61q - 660 = 0. Solve -3m + p = -4m - 9, -5m - q = -p for m. -4 Let b(p) = -p*2 - 4p + 3. Let w be b(-4). Let z(h) = -h*3 - 10h*2 + 8h - 11. Let f be z(-11). Solve -5c + f + 8 = -3q, wc - 29 = 4q for q. -5 Suppose 0 = -y + q + 5, 0 = -2y + 3q - 24 + 36. Solve 5 + 1 = 2l - 2v, yl = -v + 5 for l. 2 Suppose -3n - 16 + 19 = 0. Suppose 6q = 5q - n. Let g = 1 - q. Solve -gm + 9 - 1 = -2z, -9 = -2m + z for m. 5 Let j(b) = -b3 + 7b*2 + 6b + 17. Let y be j(8). Let s be 284/4 - (5 - y). Suppose -4u = -13 - s. Solve 5a - 2a + 4v - u = 0, 2a - v = -5 for a. 0 Suppose 3u - 2p = 3, -4u - 4p = -18 - 6. Solve -2f - 3f + 5 = ui, -2f = 2i - 6 for i. 5 Let y = -58 + 46. Let a be 2(4 - 1) + y/4. Solve -6i + 2i + 2 = g, ag + 8 = 2i for g. -2 Suppose -n = -u + 6, 3n = 3u - n - 18. Suppose -10q = -8q - u. Solve -15 = -qc + m, c - 4c + 27 = -5m for c. 4 Suppose -x - 9 + 58 = 0. Let k = -43 + x. Solve -3s + 8 = -5z, 2z - 3s + k = s for z. -1 Suppose 3h - 16 - 5 = 0. Let v(l) = -2l + 19. Let p be v(h). Solve -4m - 3u - 2u = 5, 3u = -4m + p for m. 5 Let a = 8 + -5. Suppose 0 = h + 2f - 14, 10 = -f + 3f. Suppose -5d - 2p + 20 = -hp, 3d + 9 = -ap. Solve 2l = 5o + 7l + 30, -o + dl + 9 = 0 for o. -1 Let i(p) = -p*2 + 9p + 1. Let j be i(4). Suppose 5h - 128 = 4d - 92, -3d - 12 = 0. Solve 5q - 29 = -hs, 2q + 3q = 4s + j for s. 1 Suppose -29 = -11a + 4. Solve 4i + 2 = -2j, -ai + 6i + 19 = 2j for i. -3 Let p = -155 - -160. Solve 2u = pq - 9, -4u - q = -3q - 6 for u. 3 Suppose 10s + 12 = 22. Solve -5a + 11 = -2q + s, -2a + 4 = 0 for q. 0 Let c be 86/(-5)7 - 2/(-5). Let j = c + 123. Solve -2w - 5o + 15 = 0, -10 = 2w - jw - 3o for w. -5 Let o = -42 + 44. Solve -5j + 2l = -1, -1 + 6 = -oj - l for j. -1 Let x(z) = z3 + 17z*2 - 39z - 17. Let l be x(-19). Solve -5c = -lu + 14, 0 = 3u - 4u - c for u. 2 Suppose 4d = -10 + 46. Suppose 1 = -s + 2s + 4m, m - d = -2s. Solve -k - 7 = -st + 19, 25 = 5t for k. -1 Suppose -8x = 70 + 122. Let z be x/(-9)(-12)/(-16). Solve -1 = 5y - zb, y = 5y - 4b + 8 for y. 1 Suppose -9 = -4w + 2w + p, -5w + 35 = -5p. Solve 0 = 2y + 4b - 12, 0b = -wb + 6 for y. 0 Let b(w) = w - 7. Suppose -4d + d = -27. Let y be b(d). Let l = 65 - 62. Solve -lp + h = -2, h + 4 = yh for p. 2 Suppose -5w = -w - 8. Suppose -4t + 30 = t - 5x, 3t - 15 = wx. Solve -4q = 5l - 25, 2l - 1 = -tq + 16 for q. 5 Let r be (8/48-3)/((-4)/24). Let y be 15 - -1(0 + -1). Solve 2i = 2g + 16, -3i + y = -rg + 2g for i. 3 Let n be -75 - -79 - (0 - (-1 - -1)). Solve -4p + n = 5o - 4, -2o = -5p - 23 for o. 4 Let h be (-15 - 0)/((-1)/1). Suppose -c = 4c - h. Suppose 0q = -cq + 12. Solve 0 = 4u + 4i - q, -4i + 6i = -u for u. 2 Let g = -533 - -536. Solve y - 20 = -gf - 0y, f - 10 = -y for f. 5 Let h(x) = 4 + x*3 - 14x*2 + 18x*2 + 3x - 2x. Let l be h(-3). Suppose 3b - b = l. Solve -4g - br = 25, 0 = 3g - 0g + 4r + 20 for g. 0 Suppose -k - 2k + 51 = -c, -2c = 2k - 42. Let r = 14 + k. Suppose 10t = 12t - r. Solve 4m = -2s + 16, 2s + 2m = 5s + t for s. -2 Let v = 85 + -67. Solve -i - 3i - v = -m, 5i = -3m - 31 for m. -2 Let x = -54 + 56. Solve n = -3k - 7, -xn + 2k + 0k = -10 for n. 2 Let t be 41 - (2 - 3). Suppose n = z - 3 - 5, -z = 5n + 10. Suppose zh = 2h + 15. Solve q - tg = -0q - 5, -hq = 3g + 25 for q. -5 Suppose 3d - 5 = -17. Let p = d - -4. Suppose -4l + 5 + 11 = p. Solve -k - lq = 19, -4q - 27 = 3k - 2 for k. -3 Suppose 15z - 8 - 37 = 0. Solve zc - 30 - 7 = -5r, 4c + 4r - 36 = 0 for c. 4 Let b be (0/((-8)/4))/(-2). Let g(p) = -p. Let r be g(-1). Let n(x) = 2x2 - 4x + 2. Let m be n(2). Solve -2z + 3y - r = b, z + 4z - my - 3 = 0 for z. 1 Let q(a) = a + 1. Let s be q(4). Suppose 5v - 5z = 25, 4v + sz = -8 - 17. Let w be (-5)/(-4) - 2/8. Solve 4r = -r + 3p + w, v = 2r - 4p - 6 for r. -1 Let n(q) = -11 + q + 6 + 3. Let w be n(6). Solve 5l + 2d = -17, 8l - wl + 2d + 12 = 0 for l. -5 Let l(g) = 4g + 6. Let n = -11 - -6. Let z be l(n). Let r = 18 + z. Solve -3t + 27 = rv, t - v - 3 = -1 for t. 5 Suppose 0 = 25r - 5r - 140. Solve 5h - 2w + rw = 0, 3h - 2 = -2w for h. 2 Suppose 64f - 51 = 77. Solve -a = fb, -2b - a + 4 = a for b. -2 Suppose q = 4x - 6, 3q - x - 12 = -4x. Solve -v = 2g - 9, 4g = -g + qv + 27 for g. 5 Suppose v = -4, 3v + 0v + 77 = 5r. Let u = -9 + r. Solve uf + 28 = 5h, -2h + 2f = -7h + 16 for h. 4 Let v be 9/((-495)/(-670)) - (-8)/(-44). Let n be 1 + 0(-3)/v. Solve 3 = -u + 3g - n, 5u + 3g = 16 for u. 2 Let f = -382 + 393. Solve a = 4y - 16, 4a - 32 = -y - f for y. 5 Let c(h) = h*2 + 11h + 10. Let b be c(-10). Suppose b = 2n - 1 - 23. Solve -3r = n, -3r - 16 + 0 = -j for j. 4 Suppose -4z + 8 = 0, -15k + 11k + 3z + 10 = 0. Solve v - 15 + 4 = 5n, -kn = -5v - 8 for n. -3 Suppose -48 = -29l + 13l. Solve 4x + 0x - lq = -21, 5x + 9 = -2q for x. -3 Let t = 44 + -52. Let x be (-2 - -1 - -1) + (-1 - t). Solve 2y - x = -3n, 0n + 3 = 3y - 3n for y. 2 Let r = 53 - 46. Solve -19 = 5o - 4v, v + r = 3o + 17 for o. -3 Suppose 5q - 25 = 0, 3j + q - 225 = -2q. Suppose 4y + 10 = j. Solve n + 0n = -3, 4k - n - y = 0 for k. 3 Suppose -4h = 5p - 10, 2p = -h - h + 6. Let s be 0/1 - (p + 7). Let x be 25/s(-3)/3. Solve 20 = xw + 4g - 2g, 0 = -w - 3g + 17 for w. 2 Suppose 3h + 13 = 4o, -3o - h + 9 = -o. Solve oj - 5n + 1 = -0, -5j - 5n + 10 = 0 for j. 1 Let u be (2 - (-4 - -2)) + -12 + 13. Solve -ur + 0 = 4b - 3, 0 = 2r + 2 for b. 2 Let z(x) = x2 + 2x + 2. Let v be ((-1)/(-2))/(4/(-16)). Let s be z(v). Solve -5i = -4u - 9 + 2, -u = -5i - s for i. -1 Let a be 13 - (1 - (2 - 2)). Let y(n) = -4n*2 + 12n - 18. Let b be y(2). Let v = a + b. Solve 12 = 3h - h - w, -w = v for h. 5 Let b = -1328 - -1344. Solve -t - 3 = -2x, bx + 4t - 28 = 14x for x. 4 Suppose -2z + 3 = -z. Suppose 4i - 96 = 188. Let y be 48/(-32) - i/(-2). Solve -q - 4r - r = -22, 5r - y = zq for q. -3 Let l be (2 - 0)/((-2)/(-10)). Suppose 5t + 11 = -v - 0v, 4v = -4t + 4. Suppose vb - l = -b. Solve 5u - 3u + 4f + b = 0, -5u - f + 4 = 0 for u. 1 Let b be (2 + -1)/((-1)/(-5)). Let a(l) = -l2 + 11. Let r be a(3). Let x be (-1)/(-13)r + (-44)/286. Solve 2p + 5z + 11 = x, 1 = -bp + 2z + 17 for p. 2 Suppose -y + 4 - 11 = -2u, -3u + 3 = -3y. Suppose 3a - 1 = 14. Suppose -ad - 2x = -x - 12, d - u = x. Solve -59 = 5b - 5t - 19, db + t + 4 = 0 for b. -3 Let z(b) = b3 + 28b*2 + 49b - 73. Let o be z(-26). Solve -3m - 9 + 0 = -ot, -5m + 5t - 15 = 0 for m. -3 Let q be 16/6 - (-12)/(-18). Let m be 129/6 + (-3)/q. Suppose -20 = -ma + 19a. Solve -3y + 10 = -0y + 2j, 4j - a = -4y for y. 0 Suppose -7 = 2w + b, 5 = -5w + 5b - 5. Let n = 8 + w. Let g be (1 + -2)/((-1)/6). Solve -5o = 5v - 15, -4v - go + 9 = -no for v. 2 Let r = 578 + -574. Solve -3b - 2g = 3g - r, 0 = 3b - 5g - 14 for b. 3 Let x be (7/(14/(-32)))/(-6 - -5). Solve 4q = x, -n + q = -0n + 8 for n. -4 Suppose 72 = 26b - 6. Solve 0 = 2l - bl - 4y - 5, 0 = 4y for l. -5 Let q(v) = 2v - 12. Let m be q(7). Let p be -273m/(-18). Solve -4y = -3o + 17, 3o = -0o + p for y. -2 Let j(q) be the third derivative of q*6/120 - 13q5/60 + q3/2 - 25q2. Let r be j(13). Solve 0 = -rw + 4u - 28, 0w = w + 5u - 16 for w. -4 Suppose -3d + 6d + 5g = -53, 0 = -2d + 5g - 2. Let o(p) = -p + 5. Let n be o(d). Suppose q + q = n. Solve -2 + q = -3l - 3m, -3l = -m + 6 for l. -2 Let q = 13 + -10. Let y(h) = 1 + h2 - qh*2 - 21h - 14 + h. Let b be y(-9). Solve bg + 19 = -3t, -t - t = -2g + 2 for g. -2 Suppose -222y = -223y + 3. Solve -3w - 4v = y, -5w = -0v + v + 5 for w. -1 Suppose 0 - 13 = 3c + 4h, -11 = -3c + 2h. Let r be -3((-5)/3)/c. Solve -4o = -4y - 2o - 20, 5y = ro - 25 for y. -5 Let j = 0 + 4. Solve -2i - jw + 12 = 0, 4i + w = 26 - 9 for i. 4 Let t(h) = h*3 + 11h*2 - 81h - 13. Let s be t(-16). Solve 5n - 5 = 0, 2n - 9 + 1 = s*l for l. -2 Let z = -28 - -44. Le	{ "pile_set_name": "DM Mathematics" }
(10i + 8 - 8) + (-3i2 + 3i*2 - 3i*2)(3 - 2 - 3). -114i2 - 20i Expand (5v - 2 + v + 6v)(3v + v - 6v). -24v*2 + 4v Expand (x2 + x2 + x*2)(-3x + 3x + 5x) + 6x*3 - 4x*3 + 0x*3. 17x*3 Expand 32k*2 - 32k*2 + 4k*4 + (-5k*2 - 2k*2 + 2k*2)(-k2 + k2 + k2). -k4 Expand (3f3 - 6f*3 + 2f*3)(2f2 + 5f*2 - 4f*2)(3 - 8 - 4). 27f5 Expand -3o*2 + 3o*2 + 4o*5 - 6o*5 - 2o*5 + 4o*5 - 3o*3 - 2o*5 + 3o*3 + (0o*3 + 4o3 - o3)(o2 + 1 - 1). o5 Expand 11p*4 + 10p*4 - 4p*4 + (-2p - p + p)(2p*2 + 1 - 1)(0p + 3p - 4p). 21p*4 Expand (-1 + 1 - 1 - 4 + 0 + 6 + (1 + 3 - 2)(-2 - 1 + 4))(-n4 + 7n4 - n4). 15n4 Expand (a3 + 5a*3 - 4a*3)(2a - 2a - 2a2)(3 - 6 + 1)(3 - 5 + 1 + 4 - 3 - 3 + (-3 - 2 + 4)(0 + 2 - 1)). -32a5 Expand (-108a + 218a - 91a)(-4a*4 + 5a*4 + 4a*4). 95a*5 Expand (o - 5o + o + o + 4o + 3o + (0 + 0 + 1)(0 - 2o + 0) + 2o + 0o - o - 6o + 0o + 5o + 3o - 2o + o)(o - 12o2 - o). -60o*3 Expand (0a + a + a)(-9a - 21a - 16a) - a + 3a2 + 0a*2 - 4a*2. -93a*2 - a Expand (-6 + 2n*2 - 7 + 9)(2 - 1 - 5). -8n2 + 16 Expand ((-i - 4i + 3i)(-2i3 + 2i*2 - 2i*2) + 2i*4 - i + i - 4i*2 + 4i*2 - 3i*4)(-20 + 1 + 4). -45i4 Expand (-59x + 7x - x4 - 8x)(-2 + 2 - 1)(0 - 1 - 1). -2x4 - 120x Expand -t*4 + 4t4 - t4 + 3t4 - 8t*3 + 8t*3 + 2t*4 + 3t*2 - 3t*2 + (-4t + 0t + 0t)(t3 + 0t*3 - 2t*3). 11t*4 Expand (3w*2 - 2w*3 - 3w*2)(0w + 4w - 5w + (-3w - 3w + 4w)(0 + 3 - 4 + 2 - 4 + 0 + (2 - 1 + 1)(1 - 3 - 4))). -58w4 Expand ((-4 + 3 + 2)(2p + 0 + 0) - 2p + 5p + 5p + (2p + p - 2p)(-4 + 2 + 0) - 12p + 21p + 9p)(-3p + 7p - 3p). 26p2 Expand (72m*3 + 575 - 575)(-m*2 - 2m*2 + 2m*2). -72m*5 Expand (26q - 234q + 110q)(2q - 3q - q + (-2 + 2q + 2)(4 - 4 - 2) + 4 - q - 4 + 0q - 2q + 4q). 490q2 Expand ((-3q + 6q - 2q)(5 - 3 - 11) + 3q - 3 + 3)(-4q*3 + 0q*3 + 2q*3) + 5q*4 - 4q*4 - 3q*4. 10q*4 Expand (q + q + 2q)(-4 + 3 - 1) + (3q - 3q + q)(60 - 7 + 1). 46q Expand (0x + x + 0x)(24 - 11x + 34x - 22x). x2 + 24x Expand (-s + 3s - 3s)(0s - s + 2s) + 5s*2 + s - s + (-4s*2 - 4s*2 + 2s*2)(11 + 9 - 15). -26s2 Expand (-c + 0c - c)(1 - 1 + 3) - 7c + 6c - c - c + 0c - 3c. -12c Expand (-3 + 5 - 1 + (0 - 1 + 2)(-2 + 1 + 0) - 3 - 1 + 5 + 0 - 1 - 1)(-9o - 6o + 2o + (1 - 1 + 2o)(-4 + 5 + 0))(-3 + 7 - 3) + 4o - 2o - o. 12o Expand (-538b - 467b + 919b)(-3 + 3 - b). 86b*2 Expand ((-2c - c + 4c)(62 - 62 - 61c) + (c - c + c)(-2 - c + 2))(2 - 2 + 2c). -124c3 Expand (2 - 6 + 1 + (1 - 5 + 5)(0 + 2 - 1) - 5 - 1 + 5)(-2j*3 - 2j*3 + 2j*3). 6j*3 Expand (-8 + 47 + 30)(0o + 0o - 6o). -414o Expand 3c + 3 - 1 - c + ((-3 + 5 + 2)(-1 - 1 + 1) - 1 + 4 + 0)(-2c + 6c + 0c). -2c + 2 Expand (-1 - 1 - 2)((0 + 0 + 2)(r + r3 - r) + r2 - r2 - 4r*3 + 6r*3 - 3r*3 - 4r*3 + 4r*3 + 4r*2 - 4r*2). -4r*3 Expand -28b*3 - 57b*3 - 4b*3 + 7b - 7b - 2b*3 - 2b*3 + 5b3 - b3 + (-6b2 + 3b2 + b2)(2b + 0 + 0). -93b3 Expand (c2 - c2 + c2)(2c2 + 0c2 - c2)(-c + 0c + 3c)(1 + 1 - 1 + (-1 - 4 + 4)(2 + 0 - 3) - 13 - 17 + 24 + 3 + 3 - 4). -4c*5 Expand (-2h*3 + 3 - 3)(-4 - 4 + 4)(-11h + 6h - 17h). -176h4 Expand (-34i*2 - 6 + 4 + 28i*2)(33i + 16 - 16). -198i*3 - 66i Expand -2a + 0a + 31a + (0 - 5 + 2)(0a - 1 - a + 3). 32a - 6 Expand (-6 + 2 + 2)((-b - 2b + b)(-7 + 4 - 3) - 1 + 2b + 1). -28b Expand (-173 + 123 - 149 - 92)(-4l5 - 2l*5 + 5l*5). 291l5 Expand o3 + 2o3 - o3 - o3 + 0 + 0 + (o - 3o + 0o)(-50 + 50 - 4o2) - o + 0o + o*3 + 2o. 10o3 + o Expand (-35m*4 - 20m*4 - 8m*4)((0 + 0 + 1)(6 - 3 - 2) + 2 + 2 - 2). -189m*4 Expand -11413 + 11413 + 168u*2 + (u - 3u + 4u)(3u + 0u - 6u). 162u*2 Expand (-3 + 3 - 2)(-3 + 3 - 2i) + 60i - 109i + 55i. 10i Expand (10k + 16k - 20k)(-k - 2k + 7k)(-4k2 + k2 + 2k*2). -24k*4 Expand (-13 - 33 - 6)(m - 3m + 3m) - 15 + 3m + 11 - 5m. -54m - 4 Expand (-1 + 1 - d)(-29 + 1 + 8)(-2d2 + d2 - d*2). -40d*3 Expand 4q5 - q5 + q5 + q5 - q3 + q3 + (0q - q - q)(3q4 + 2q*4 - 7q*4) + 4q*5 - 6 + 6. 13q*5 Expand (2g - g + g)(-4g + 4g + 2g) - 3g2 + 3g*2 - 2g*2 + 54g*2 - 233g - 111g2 + 58g*2. 3g*2 - 233g Expand ((-33q - 4q - 60q)(1 + 1 - 1)(1 - 4 + 1) + 4q + q - 4q)(0 + 0 + 2). 390q Expand -7f*4 + 9f*4 + 11f*4 + (0f + 2f + 0f + (4f + 3f + 4f)(-2 + 0 + 0))(-f3 + 4 - 4). 33f*4 Expand (4 - 2 + 0)(-38 + 23b + 38)(1 - 3 - 1). -138b Expand (1 + 0 + 0)(5 - 5 - 2)(-3 - 5 + 6)(-t3 - t3 + 0t3). -8t*3 Expand (-3 + 3 + d)(-65 - 29 + 24 + d)(-1 - 4 + 3). -2d*2 + 140d Expand ((-1 + 3 - 1)(-1 + s2 + 1) - s2 - 7s*2 - 7s*2)(-1 + 1 + 1 + (0 + 1 + 0)(2 + 1 - 1) + 4 - 3 + 0)(-5s + 4s - 2s)(-3s + 6s - 9s). -1008s*4 Expand (-9p*2 + 5p - 5p)(6p + 2p - 3p)(-3p + 6p - p). -90p4 Expand (4 - 2 + 1)(-15f + 11 - 11) - 3f + 3f + 2f + 0f + 2f - 4f. -45f Expand (2c - c - 5c)(3 - 3 - 1)(-c + c - 2c)(-3 + 6 + 7)(-2 + 5 - 1). -160c*2 Expand (-3t*3 + 2t3 - t3)(0t*2 + 3t2 - t2) - 2t5 - 2t*5 + 2t*5 + (-5 + 5 + 5t*3)(5t2 + 5t*2 - 3t*2). 29t*5 Expand 5z*2 + 0z*2 - 4z*2 + (4 - 4 - 2z)(z + z - 4z) + (-64z + 30z + 23z)(0z + 0z + z). -6z2 Expand (-50b*3 + 60b*2 - 60b*2)(4 + 3 - b + 0b). 50b*4 - 350b*3 Expand 47t*2 - 10t*2 - 113t*2 + ((-2 + 1 + 3)(3 - 3 + 2) + 6 + 3 + 1)(-2t*2 + 0t*2 + 3t*2) + 5t*2 - 4t*2 + 0t*2. -61t*2 Expand (597l*3 + 603l*3 + 603l*3 - 1784l*3 - 72l)(0l - 4l + 2l). -38l4 + 144l*2 Expand 9c*3 - 10c*3 - 1 + 3 - 4c3 - c3 + c*3 + (3c - 2c2 - 3c)(16c + 39 - 39). -37c3 + 2 Expand (233z + 17 + 224z - 461z)(3 + 2 - 4). -4z + 17 Expand (4r3 - 3r*3 - 3r*3)(22r - r + 37r) + (r*4 + 4r - 4r)(-2 + 0 + 3) + 2r - 2r - 2r4. -117r*4 Expand ((0 + 1 - 2)(3 - 1 + 1) + 2 - 5 + 1)(-3 + 2 + 2)(-7q - 4q - 6q). 85q Expand (10r2 + 5r - 5r)(28r - 10r - 8r) - 2r*3 + 4r3 - r3. 101r3 Expand (-1315 + 488 + 623)(2 - 2 + a). -204a Expand (-16 + 2 + 3k*2 - 6k*2 + 2k)(k - 5k + 2k) + 0k*3 - 5k*3 + 4k*3. 5k*3 - 4k*2 + 28k Expand (-t + 2t - 2t)(-3t*4 + 3t4 - t4) + (-6t3 + 0t3 + t3)(-2t*2 + t - t) + 5t4 - t5 - 5t4 - t5 + t5 + 5t*5. 15t5 Expand -h4 + 0h4 + 3h*4 + (25h*3 + 2h*3 + 3h*3)(-5 - 2h + 5). -58h*4 Expand (3a + 3a - 5a)(-6 + 1 + 2)(23a + 855 - 853 - 80a). 171a2 - 6a Expand (2g - g - 2g)(-5g*4 - 4g*4 + 2g*4) + 11g*5 - 13g*5 + 33g*5. 38g*5 Expand -10o*3 + 6o*3 - 2o*3 + (0 - 2o + 0)(4o2 + o2 - 3o2) - o + o + 2o*3 + 2o*3 - 7o*3 + 12o3. -o3 Expand 14d + 17d*5 - 14d + (d*5 + 0d*5 - 3d*5)(0 + 0 + 1) - 4d4 + 4d*4 - 4d*5. 11d*5 Expand (3i - 3i + 3i - 1)(-273 + 228 + 225 - i). -3i*2 + 541i - 180 Expand (0k3 - 14k*3 - 2k*3)(3 - 2 + 0)(-4 + 2 + 5)(1 - 4 + 4). -48k3 Expand (2q*3 - 5q*3 + 6q*3)(2q2 + 1 - 1) - 4q*3 + 4q*3 + 10q*5. 16q*5 Expand (-36i - 12i2 + 36i)(1 + 1 + 3i - i) + (2i - 4i + 3i)(15i2 - 13i*2 - 20i*2). -42i*3 - 24i*2 Expand (0a - a + 2a)(2 + 1466a4 - 1392a*4 + 6a*2 - 7a2) + a5 + 0a5 - 2a*5. 73a5 - a3 + 2a Expand -4j3 + j3 + j*3 + (-8 - 4 + 3)(-6j2 - j3 + 6j*2). 7j*3 Expand (67y - y*2 + 670 - 670)((-2y2 + 0y*2 + 0y*2)(0y + y + 0y) - 3y3 + y3 + 0y*3 + 2y*2 - 2y*3 - 2y2 - y3 - y3 + y3). 7y5 - 469y*4 Expand (-5 - 435p - 254p + 5)(-7 + 1 + 2). 2756p Expand (-6r*2 + 2r2 - r2)(3r + r - 5r)(-630r + 630r - 28r2). -140r*5 Expand -142 + 142 - 21o*3 + 2o*3 - o + o + (4 - 1 - 2)(-3o3 + 2o*3 + 3o*3) - 4o + 2o3 + 4o - 4o + 4o + 2o3 - 2o*3 - 3o*3 + 4o*3. -14o*3 Expand (25c - 1	{ "pile_set_name": "DM Mathematics" }
(21 + -19). 1 (187/33)/((-782)/(-6762)) 49 What is -2(38/(-12) + 3)((-882)/(-7))/(-3)? -14 Calculate 93/(-33) - -3 - (2/22)/(643/927849). -131 Evaluate (-289 + 48912/168)(-21)/(-9)(-10 + 1). -45 What is (((-110)/1056)/((128/(-72))/(-16)))/(-3)? 5/16 What is 173 + -320 + 320/14 + (-128)/(-112)? -123 8/12249765/5402 1/6 What is the value of (-46)/(-483) + (-5)/(-10) + (-76)/24? -18/7 Calculate 3636 - 3591 - -7824/(-72). 14/9 What is the value of -14 - (24685/(-1175) - (35 + -42))? 2/235 What is the value of (0 + 112)/(2 + 2/8 + 2887/(-11548))? 56 Calculate (-35)/(-28)56/(-490)-245. 35 What is the value of (2 + (0/8)/(13 - 14))2/30? 2/15 What is the value of 11 + (456/114 - 28/206)? 33/5 Calculate (0 + (-72)/(-21600))/(4/16). 1/75 What is the value of (27222/8376)/(26/6)? 3/4 Evaluate (303/202)/((-6)/148). -37 Evaluate (8 - 0) + (-232752)/28348. -4/19 Evaluate ((-6)/(-16) + (93810/(-1200) - -82))(-75)/9. -35 What is (10/34)/(1638/1071)? 5/26 What is -1 + 40628/41272 - 34/1139? -1/22 What is 25/(-80) - 4654/17184? -7/12 Calculate (-3519)/(-714) - ((-6)/(-45) - (123/(-90) + 1)). 31/7 (-2870)/3280(-2 - 6/(-15))(11 - 8) 21/5 Evaluate 3016/145181/724. 26/5 Evaluate 40/(-210) - (-1)/3 - (43 + 133032/(-3108)). -2/37 What is the value of (-4)/78 - (((-143612)/(-546))/46)/(-531)? 3/53 Evaluate 72/(-8) + (-1958)/(-55) + 56/(-35). 25 Calculate (1/(-2))/(62678/107800 + 6(-6)/63). -50 Evaluate ((-3)/(-7) - 179415/1260) + (-863)/24164. -142 What is (-1)/15/(-25)120/153624? 3/8 What is 2/((-60)/(-2218)) - (-2)/36012? 74 What is (-16)/(-360)8235/5307? 2/29 Evaluate -5((-6)/(-4 + 1) - (-12 - (-858)/65)). -4 What is the value of 25/(-10)(1485/(-75) + 27)? -18 Calculate 21/42 - (88/(-64) - -2). -1/8 What is the value of ((-6)/(-8))/(-6 + 3731/(-104) - (59 + -81))? -2/53 Calculate (348/(-3132) + (-43)/99)/((-9)/330). 20 What is (-1676)/32 + -3 - ((-199)/(-1990))/((-8)/30)? -55 (-5)/4-38-2112/560 -19 What is ((-497)/((-1232063)/(-804)))/2? -6/37 (282 + -280)(11/2 + -3 - 0/1) 5 Calculate 2/17 - ((-4540430)/(-782))/95. -61 Calculate (-79046)/14372(-26)/(-11). -13 What is -97533 + 97402 + (1/(-3) - (2 + 16/6))? -136 Evaluate 14/1267623/(-308). -11/4 What is (0 - 10/(-24))(-1536)/960(-93)/(-2)? -31 Evaluate ((-1188)/(-99))/(-12)(0 + 27 - 1). -26 Calculate (-685)/(-3425)5/14. 1/14 What is (-36)/49147 + -349695/1755? -85 What is -9 + (-9 - (-3640)/203) + 1876/(-203)8? -74 Calculate (-128)/(-24)11691/166272. 3/8 Calculate (3/(-672))/(-102 + 44206/434). 1/32 Calculate (-1025)/(-4305)(-21)/(-3). 5/3 Evaluate 32/10 + (-68377)/21210. -1/42 Calculate (-2077)/490 + 4 + 122/((-10980)/(-27)). 3/49 (47 + (-6 - (-15 + 23)))/(-1) -33 (-4154)/6231 - (((-192)/27)/8)/(14/24) 6/7 Calculate (-2980)/(-22946)(-44)/140. -2/49 1620/(-117) + 30/(-195) - (-2600)/186 -2/93 Evaluate ((-75504)/(-58344))/((-1)/51). -66 6084/130 - (-60 + 108) -6/5 What is (-534 + 532)((-6)/5 + 1)/((-86)/(-1075))? 5 What is 59 - 116 - -142 - 45? 40 Evaluate 44/(-6)74016/(-2080672). 6/23 (-904)/(-70) - ((-226)/(-3842) + (205/595)/(-1)) 66/5 Calculate (-89 + 4561)/(-86) + 88. 36 What is ((-152)/627)/((-16)/176)(-1 + (-31)/20)? -34/5 What is the value of -3(-47 + (-14004)/(-288))? -39/8 ((-11 - -8)/(-9))/(18 - 3876/216) 6 What is (4 - 12/48)(-47)/141? -5/4 Calculate 4/((-28)/(-1120)-24 + (-55)/(-175)). -14 What is 11508/441 + 106/(-1113)? 26 Calculate (-330)/570-19 - 0(5 + (-14)/3). 11 Evaluate -16 + 0 + -3 + ((-28224)/(-1092) - 5). 24/13 Evaluate ((-6196)/306702)/(10/(-9)). 1/55 What is 7100/15975513/(-4)? -57 ((-416)/(-48) - 80/12) + -1 + (-717)/711 -2/237 (-66 - (-113 + 50))5 -15 What is the value of ((-8496)/3894)/((-136)/(-44))? -12/17 194/22 - (5/50 - -5(-2492)/(-1400)) -2/11 (-21320)/(-296) + -72 + (-386)/592 -5/8 What is the value of 5/(-20)(-144)/88-88? -36 Calculate 174/(-30)(-11 + -9 + 25). -29 363/(8712/816) - (-662)/(-20) 9/10 What is the value of 402/(-51) - (1442/2163 + (-1)/((-6)/(-52)))? 2/17 Calculate 54 + (-2376)/(8 + 36). 0 What is -30 - -7 - 4966/(-2600)12? -2/25 Calculate 330/15 - (-208)/(6 - 10). -30 What is the value of 47 + (740/74 - 41)? 16 Evaluate 247/(-282) + (-330)/120(11155/759 - 15). -2/47 What is ((-140)/(-6))/(28768/(-2784) + 77/7)? 35 Calculate 1424/208-13 + 92. 3 Calculate (15-1)/((7(-22)/770)/((-1)/(-1))). 75 Evaluate 35002/814 - (-9 - -4 - 52). 100 What is (-5850)/(-99) - (131 - 72)? 1/11 Evaluate 16 - (-15 + (-928)/(-435)) - 29. -2/15 What is the value of ((3 + (-516)/180)-3)/((-1)/65)? 26 Evaluate (150/444048/3680)/((-170)/(-88) + -2). -55 What is the value of ((-621)/276 + 2)/(7/16) - 4? -32/7 ((-45)/(-30) - ((-3344)/160)/(-19)) + 184/(-510) 2/51 (-273)/(-4485)-23-15 21 What is (183195/(-92))/45 + 27/(-4)? -51 What is ((-1308840)/(-58730))/((-26)/(-14))? 12 What is the value of ((-10611)/(-7074))/(270/(-8))? -2/45 (-15)/7 + (-385)/((-401555)/124266) 117 What is (-273)/(-15) - (1968/1599)/((-36)/(-585))? -9/5 Calculate (3/(-8))/((510/(-48))/(-85)). -3 Evaluate 976/1464261/(-6). -29 What is the value of (0 + -7 + (-1860)/(-264))(-10 - -12)? 1/11 75 + (-88)/(-176)-332 -91 What is ((-2)/(-44))/((-197)/3546)? -9/11 What is 10/(-16)(-6)/15295/((-150745)/(-5256))? 18/7 What is the value of (0 - 4) + -13 + 742/14? 36 Calculate 15(-16 + 204/(-54))30/(-100). 89 Calculate (1755/81 + -24)/(10/(-15))24/7. 12 ((-1341)/298)/(207/(-108) - -2) -54 Evaluate (2352/252)/((-20)/120). -56 What is the value of (-10317/(-7004))/((-1)/(-292))? 73 Calculate 3039/(-160) - (-11 - -2)13528/6408. 1/160 What is the value of (-105)/(43890/17936) - -38? -54/11 Calculate (6820/(-275))/(260/100 + -3). 62 What is -998/588-21112/8? 42 Calculate (-16)/(-208) - (-828)/52 - 7. 9 Evaluate (-58)/(-16)-3 - (-339 + 170 - -159). -7/8 What is (-2)/((-38)/(-551))(-20 + 19)? 29 Evaluate ((-26)/10 + 2)/(42 - (-127968)/(-3100)). -5/6 What is -10(-52)/120-3? -13 Evaluate (18/8 + 0)(11224/3036)/122. 3/44 Evaluate (115/(-15640))/(1469/1921). -1/104 Calculate (2 - (-5 + 66/12))(-564)/98559. -2/233 Evaluate (385/11)/(-9 - -2 - -6). -35 Calculate (-750)/1625 + (-4728)/572 + 8. -8/11 -24 + ((-25975996)/(-8874))/122 -1/153 (3375/1875)/(702/20) 2/39 Calculate 5487/2011911/(-2). -3/2 Evaluate ((-5)/(-4))/((-74)/2960) - (-1 + -4). -45 What is (28/22)/(24278/(-671) - -36)? -7 Calculate (-3616)/88 + ((-14)/462)/(4/36-3). -41 -11 + -8 + 1 + 19 + -14 -13 (988/(-56316))/(7/(42/(-24)) - (-6 - -1)) -1/57 ((33 - (-3990)/(-126)) + 41)3 127 What is the value of 440/30 + 337415/(-2685)? -111 Calculate (40/(-3))/(670/268). -16/3 ((-2)/156-3 + (-4510)/5720)(-35)/3 35/4 What is (54/(-153))/((83 - 113) + (-6116)/(-204))? 18 Evaluate 17/((-510)/(-4)) - (-235)/(-75). -3 (-3328)/(-1248)54/24 6 Calculate ((-111)/2220)/((-7)/(105/(-3)))(-14)/(-6). -7/12 Evaluate 120(9 + (-1350)/144). -45 What is the value of (320/25)/(120/(-100))(-24)/(-4)? -64 Calculate (-1)/((16408/1092 - 27) + (-12)/(-1)). -39 What is the value of 728/196 - 2 - (-12800)/(-280)? -44 What is the value of 1 + ((-1350)/(-525))/((-16)/7) - 239/8? -30 What is (722/361)/(56/(-1568))? -56 What is (-16 + 1035/63)(-52080)/(-360)? 62 What is the value of ((-30765)/(-36918))/((-75)/4)? -2/45 What is 5520/(-465) + (-152)/(-24) + 28/(-12) + 8? 4/31 (((-40)/(-60))/((-680)/23868))/(6/10) -39 Calculate -6(672/(-63) + 3/(9/21)). 22 What is 7/(-1) - (29 + (-21 - -225)/(-17))? -24 Calculate 13/(130/12)(-294000)/(-2400). 147 Evaluate (-1(-14)/846)/(3/(-228)). -76 What is the value of 1/((-246)/(-3204)) + (49 - 62)? 1/41 Evaluate -147074/1332 - (1/(-6))/(5/80). -79 What is 32(-2)/20 - 354/59? -46/5 Evaluate (32/(-114))/((-328)/164)(-2 - 49/(-14)). 4/19 Calculate (3586/220)/(4/(-5)) - (-12)/32. -20 What is 112/(-480)(139 - 133)? -7/5 What is (47528/(-2080) + 23)/(6/(-64))? -8/5 Calculate -1114/836 - -755/3876. 3/68 5(693/891 + 9060/675) 71 Evaluate (-70 + 221597/3161)/(3/2). 2/29 What is the value of ((8976/36)/17 - 8)504/140? 24 Calculate (-1 - -1 - (-8)/16)/(30 - (-5406)/(-180)). -15 Evaluate -9 - ((-1)/(-3))/(67 - (-276430)/(-4125)). 16 What is (-9788)/357262 - 728/5402? -6/37 Evaluate 644/(-7728) - (-606)/(-10)*((-15)/108)/5. 8/5 What is the value of ((0 - 15)/(-2 + 1))/(171108/(-48888))? -30/7 617	{ "pile_set_name": "DM Mathematics" }
te the remainder when m is divided by 40. 37 Calculate the remainder when 277 is divided by 8/(-24) - ((-584)/3)/2. 83 Suppose -125c = -134c + 900. What is the remainder when 396 is divided by c? 96 Let m(c) = -c*3 + 6c*2 + 6c + 10. Let q be m(7). Suppose -qo + 168 = 4o. What is the remainder when 119 is divided by o? 23 What is the remainder when -38(0 + (1 - 2)) is divided by (((-5)/(-3))/1)/((-5)/(-15))? 3 Let p(w) = 7w*2 + 19w + 22. What is the remainder when p(-12) is divided by 35? 32 Suppose 0 = 4y + 5t - 24, 3y - t + 1 = -0y. Let p = 41 + -42. What is the remainder when -1 + p - (-6)/2 is divided by y? 0 Let r = -2359 + 2385. Calculate the remainder when 803 is divided by r. 23 Let p = -18 - -20. Suppose 3u = -pu - 45. Let d = u - -13. Calculate the remainder when 13 is divided by d. 1 Let b = -4 - -13. Suppose 5l - 120 = -2j, 2l + 5j = 4j + 49. Calculate the remainder when l is divided by b. 4 Suppose -2q + 120 = 2x, -8 = 5q + 17. Calculate the remainder when x is divided by -2 + 0/1 - -19. 14 Suppose -52 = -5r + 13. Suppose 0 = -3u - 4y + 13, 0 = u + 4y - 7. What is the remainder when r is divided by u? 1 Let l = 11 + -6. Suppose -j + 30 = lz + 2j, -5z + 4j = -30. Suppose 7x = zx + 5. What is the remainder when 12 is divided by x? 2 Suppose 420 = -7b + 19b. What is the remainder when b is divided by 21? 14 Suppose 0 = 2z + 10, 3g - 82 = -0g + 2z. Calculate the remainder when g is divided by 14. 10 Let t = 27 - 14. Calculate the remainder when t is divided by 33/97. 6 What is the remainder when -1 + 1 + (1 - (-224)/4) is divided by 37? 20 Suppose 5w = 5, -1877w - 26 = -4t - 1875w. What is the remainder when (-10)/15-115 is divided by t? 3 Let z = 5 - 0. Suppose -z - 21 = -2k. What is the remainder when 64 is divided by k? 12 Let f = -33 - -23. What is the remainder when 9 is divided by -3 + (1 + -3 - f)? 4 Let v = 1 - -13. Let j = 112 + -44. Suppose 40 = 4r - j. Calculate the remainder when r is divided by v. 13 Let f(o) = -2o - 10o - 4 + 3 - o. Calculate the remainder when f(-3) is divided by 14. 10 Suppose 4d + 4 = 4z - 20, 0 = d. Suppose -zc = -0c - 66. Calculate the remainder when 30 is divided by c. 8 Let p = 2372 + -1479. What is the remainder when p is divided by 100? 93 Suppose 24m + 11m - 14945 = 0. Calculate the remainder when m is divided by 54. 49 Calculate the remainder when 7/(-2 + 22/10) is divided by 6 - 10/(30/(-9)). 8 Suppose -4f = 2u - 162, 0f = -3f + 2u + 139. Calculate the remainder when 51 is divided by f. 8 Suppose -9t = -7t + 14. Let j(y) = -y2 - 8y + 2. Let v be j(t). What is the remainder when (v + -8)/(1/14) is divided by 8? 6 Let c = -248 - -294. Calculate the remainder when 183 is divided by c. 45 Let t = -23 + 100. What is the remainder when t is divided by (-4522)/(-170) - (-2)/5? 23 Suppose 0 = -19g + 5g + 700. Calculate the remainder when 116 is divided by g. 16 Let u = 7 + -2. Suppose -3w + 4w = 5c - 24, 4c + w = 21. Calculate the remainder when (u - 4)171 is divided by c. 2 Let z(b) = 34b - 5. Let p = -32 - -33. What is the remainder when z(p) is divided by 16? 13 Suppose 34 = -9w + 277. Suppose 5d - 255 = -5j, 5j + 0 = 5. Calculate the remainder when d is divided by w. 23 Suppose -17f = -18f. Suppose fh - 45 = -h. Suppose 4x - 6 - 42 = 0. Calculate the remainder when h is divided by x. 9 Let p(o) be the second derivative of o3/3 - 4o*2 - 7o. Let i be p(6). Suppose -i = -2u + 8. Calculate the remainder when 29 is divided by u. 5 Suppose 5n + i - 18 = 0, n + i - 15 = -3n. Suppose -912 = -nl - 3l. Calculate the remainder when l is divided by 51. 50 Suppose 4y = 2f - 42, -2f = -y - 15 - 3. Let s be ((-30)/y)/(9/24). Suppose -s = 5i, 3r - 28 = 5i + 36. Calculate the remainder when r is divided by 10. 8 Let w = -387 - -458. Calculate the remainder when 210 is divided by w. 68 Let g = -41 - -66. Let n = 37 - g. Calculate the remainder when 19 is divided by n. 7 Calculate the remainder when 44 is divided by 9/(-6 - -2 - -5). 8 Suppose 541 = 32m - 323. What is the remainder when 44 is divided by m? 17 Suppose -5z - 2j + 425 = -0z, z = -5j + 108. Calculate the remainder when z is divided by 30. 23 Suppose 18z - 308 = -10z. What is the remainder when 19 is divided by z? 8 Suppose -z + 14 = 2. Let u(y) = 4y + 129. What is the remainder when u(-27) is divided by z? 9 Suppose 4f + 47 = 227. What is the remainder when f is divided by 26? 19 Suppose -4y = y. Suppose 0l + 4l - 44 = y. Suppose -1 = -g + l. Calculate the remainder when 21 is divided by g. 9 Calculate the remainder when 867 is divided by 174/(-5)(4 - (-195)/(-30)). 84 Let x(a) = -4a + 5. Suppose -2f + 6v - 3v + 145 = 0, 4f - 299 = -3v. Calculate the remainder when f is divided by x(-5). 24 Let x = 27 + -45. Let a = x - -66. What is the remainder when a is divided by 12/(-42) + (-177)/(-7)? 23 Suppose -55q + 301 = 5d - 58q, -5q - 171 = -3d. Calculate the remainder when 309 is divided by d. 61 Let o(x) = -x2 + 24x - 62. Let v be o(7). Let d be (2/4)/(2/92). Let t = v - d. Calculate the remainder when t is divided by 9. 7 Suppose 5n + 142 = 7n. What is the remainder when n is divided by 24? 23 Let n(f) = f - 7. Let k be 4/14 - (-14)/(-49). Let v be n(k). Calculate the remainder when 426/14 - 4/v is divided by 11. 9 Suppose -4m + 356 = 4i, -m - 70 - 123 = -2i. What is the remainder when i is divided by 5? 4 Suppose o - 5 = 0, -210 = 4g - 2o - 36. Let y = 68 + g. What is the remainder when ((-48 - 5)-2)/1 is divided by y? 25 Let s = -714 - -725. Calculate the remainder when 16 is divided by s. 5 Suppose 0 = -q + 5o - 3, q + o = -o + 25. What is the remainder when 150 is divided by q? 14 Suppose 5m + 0 + 65 = 0. Let r = 1 - m. Calculate the remainder when -5((4 - 2) + -13) is divided by r. 13 Let x = 569 + -154. What is the remainder when x is divided by 26? 25 Let n = -43 - -86. Let p = -49 + 54. Let o(x) = -2x + 21. Calculate the remainder when n is divided by o(p). 10 Let m = 314 - 292. Calculate the remainder when m is divided by 4. 2 Suppose 36m - 1394 - 910 = 0. Calculate the remainder when 211 is divided by m. 19 Let n be 20/(-25)(-10)/4. Let k = n + 0. What is the remainder when -1 - 63/(-3)k is divided by 22? 19 Suppose 0 = -s - 2 - 9. Let c = -5 - s. Calculate the remainder when 20 is divided by c. 2 Suppose 0 = -1861m + 1860m + 17. What is the remainder when ((-12)/(-10))/(2/110) is divided by m? 15 Suppose -4f + 5n + 76 = 7n, 4f - 104 = 5n. Calculate the remainder when 167 is divided by f. 20 Suppose -4r + 623 = 3r. What is the remainder when 266 is divided by r? 88 Let j be (-6)/((-6)/3 - 0). Suppose 280 + 422 = -ji. Calculate the remainder when (2/6)/((-2)/i) is divided by 10. 9 Let v(g) = g2 - 14g - 12. What is the remainder when 58 is divided by v(16)? 18 Let f(y) = 34y2 - 2y + 1. Let b = -30 - -66. Calculate the remainder when f(-2) is divided by b. 33 Let h(v) = 10v + 33. What is the remainder when 207 is divided by h(1)? 35 Let v be (-47)/((2/(-6))/(13/39)). Suppose 5n - 185 = -5c, c + 60 + v = 3n. What is the remainder when n is divided by 19? 17 Let a = 558 + -329. What is the remainder when a is divided by 8? 5 Let z(j) = j*3 - 20j*2 + 5j - 65. What is the remainder when 67 is divided by z(20)? 32 Suppose -5d - 3t + 0t = -12, 0 = -4t - 4. Suppose -2 = -p + d. Suppose pc - 65 = -5m, 5c = m - 2m + 77. Calculate the remainder when c is divided by 9. 7 Suppose -4v = -1 - 79. Suppose -4c + 2c + v = 0. Let z = 80 + -43. Calculate the remainder when z is divided by c. 7 Let o(h) = h2 - 9h - 10. Let x be o(9). Let a = x + 24. Calculate the remainder when 52 is divided by a. 10 Let o be (-30)/20176/(-6). Let r = 79 - o. Suppose -4p + 2 = -y - 75, 0 = -p + 2y + 21. What is the remainder when r is divided by p? 16 Calculate the remainder when 26/(104/420) - 0/(-2) is divided by 34. 3 Let b(w) be the third derivative of w6/30 - w4/8 + w3/2 - 3w*2. Calculate the remainder when b(2) is divided by 11. 7 Let n = 813 - 802. What is the remainder when 74 is divided by n? 8 Suppose 0 = -42s - 44*s + 15480. What is the remainder when s is divided by 105? 75 L	{ "pile_set_name": "DM Mathematics" }
. -4 Solve -4t = 20g - 12g + 100, -4t + 4g + 56 = 0 for t. 1 Solve -i + 3045m - 3041m = 21, 5i + 9 = -4m for i. -5 Solve 15 = -4x - 3t + 9, -2t = 5x + 4 for x. 0 Solve -3l - l = -5d + 36, d + 346l - 347l = 8 for d. 4 Solve 2a + 3a + 37 = -3b, 12 = 2b - 4a for b. -4 Solve -118g + 117g - 5d = 8, 2d + 41 = 5g for g. 7 Solve 362f - 360f = 5o + 12, 3f - 4o - 4 = 0 for f. -4 Solve 132v + 4c - 16 = 131v, 5v - 3c = -12 for v. 0 Solve 0 = -15q + 11q - 3s + 5, 0 = -q + 3s + 5 for q. 2 Solve 5r + 2l - 2 = 0, 4r - 2l = -603 + 619 for r. 2 Solve -18 = z - 5b, -b = -55z + 60z - 14 for z. 2 Solve 5j + 47 = -3h + 4, -29j - 231 = -h for h. -1 Solve -5d = -3u + 35, -8d = 2u - 5u + 47 for d. -4 Solve -929d - 18 = -932d + 3p, -4p - 12 = -2d for d. 6 Solve -5x - 2r = 6, -4 = 360x - 356x + 2r for x. -2 Solve 4f - 3l - 8 = 0, 3f - 17 = -2l - 45 for f. -4 Solve 2 = -2d + 4, -7l + 17 = -2d - 16 for l. 5 Solve -134z = -139z + k - 7, -z - 3k = -5 for z. -1 Solve j - 130r - 2 = -132r, -5j + 2r + 22 = 0 for j. 4 Solve 3x = 15, 0y + 10x + 20 - 73 = -0y + y for y. -3 Solve 2a - 2h - 11 = -9, 5a = 4h + 9 for a. 5 Solve 5p + 4 = 4q, -63 = 8p + 2q - 65 for p. 0 Solve 4p = -2t - 38, 10p = 5t - 0 + 35 for p. -3 Solve -5f = 135c - 138c + 26, -c - f + 6 = 0 for c. 7 Solve -3h = -4s + 23, -2h - 1183 = -4s - 1161 for s. 5 Solve -46i - 2q + 50 = -51i, -4q = -i - 28 for i. -8 Solve 11y = 16y - 4i + 41, -3i = -2y - 29 for y. -1 Solve 12d - 16d = -a + 54, 3a + 5d + 59 = 0 for a. 2 Solve 113d = 101d + 48, 16 = -4x - 2d for x. -6 Solve 57h - 5c - 33 = 60h, -2h = -2c - 26 for h. 4 Solve -3v = -n - 6, 2n = -4v + 11044 - 11036 for v. 2 Solve -3f = -4k + 11, 1 - 5 + 29 = 5k for f. 3 Solve -3l - 10d + 9 = -8d, 5 = 4l + 5d for l. 5 Solve 34k - 2y + 10 = 34k, -100 = -5k - 15y for k. 5 Solve -2q + 4w = 22, 5w + 13 = q + 9w for q. -3 Solve -30q + 16 = -5h - 27q, 3h + 4q - 2 = 0 for h. -2 Solve 28 = 11c + 2j, 4j - 12 = -21 - 23 for c. 4 Solve -3f - 174 = y - 173, -4y = 5f + 11 for f. 1 Solve 0m + 5m - 5 = 20b, 2b - m = 3 for b. -2 Solve 2q = -4g + 17 - 11, -5q + g - 29 = 0 for q. -5 Solve 0 = -4h + 24, -4h + 19 - 4 = 5u + 1 for u. -2 Solve 2h - 3c - 915 - 917 = -1880, 2c = 28 for h. -3 Solve -t = 3q + 7, -8038q - 35 = -8037q + 5t for q. 0 Solve f = -2y - 165 + 150, -3y = f + 24 for f. 3 Solve 8 = 4f, 5p - 1013f = -1015f + 14 for p. 2 Solve i = y, -139i = -141i + y - 3 for i. -3 Solve -3183c - 5y + 24 = -3186c, 4c = 2y - 4 for c. 2 Solve -52q = -c - 48q + 19, -2c - 3q - 17 = 0 for c. -1 Solve 4s - o + 1 = -4, -4s = 2o - 10 for s. 0 Solve -5y - 5 + 14 = -3w, 0 = -4w + y - 12 for w. -3 Solve -70c - 4u + 22 = -75c, -5c - 3u = 1 for c. -2 Solve -53m - 38 = -7r - 56m, 0 = -3r - 5m + 20 for r. 5 Solve -4 = 4r - 2v, -21872r + 21874r - 4v = -2 for r. -1 Solve -260 + 276 = 2h, 0 = 17z + h - 76 for z. 4 Solve 418f - 417f - 9 = 3y, -f + y = -3 for f. 0 Solve 988 - 979 = -k - 4z, 0 = -4k + 5z + 48 for k. 7 Solve 15 = -w, -3p + 5w = 3w - 30 for p. 0 Solve -v + 4d = 7, 4v - 29d + 42 = 1 for v. -3 Solve -2f = 7k + 22, 0 = -19k + 14k + 3f - 29 for k. -4 Solve 3s = 3o + 12, -29s = -3o - 27s - 10 for o. -2 Solve -16 = -5m - p, -216p - 8 = -3m - 217p for m. 4 Solve -6 = -4a - 2j, 21a - 18a + 3j - 12 = 0 for a. -1 Solve 4o + 8w - 69 = 5o - 97, -4o = -3w - 25 for o. 4 Solve 94 = j + s + 83, 0 = -7j - 2s + 102 for j. 16 Solve 0 = p - 2h - 13, -4p - 6h - 13h + 79 = 0 for p. 15 Solve 2 = -2359v + 2356v - 5w, 20 = -4v + 2w for v. -4 Solve -5d - 4w + 204 = 192, -d = 54w + 104 for d. 4 Solve 4g = -2h - 46, 3g - h + 26 = -21 for g. -14 Solve 3i + n = 11, -3i = -4787n + 4792n + 5 for i. 5 Solve -2d - 4m + 14 = 0, 13 = 337d - 335d + 5m for d. 9 Solve -4 = 2w + 183p - 182p, 5w = 4p + 68 for w. 4 Solve -30g + 3h + 53 = -28, 4g + h - 1 = 0 for g. 2 Solve 225665x = -4h + 225670x + 10, 0 = 4h - 2x - 4 for h. 0 Solve h + 14 = 6h - s, -11s = -2s + 36 for h. 2 Solve 2r - 5n = 372 - 392, 20 = 3r + 5n for r. 0 Solve 4i = -b - 17, 3b - 8 = 7b - 4i for b. -5 Solve -91 = -l + x - 95, -4x - 12 = 0 for l. -7 Solve u - 976r = -978r + 6, 4u + 24 = 4r for u. -2 Solve -5t - 5m - 125 = 0, t + 13620m - 13622m = -10 for t. -20 Solve -3c + z - 17 = 0, -5078z = -4c - 5075z - 26 for c. -5 Solve 0 = -z + 4i + 12, -1002z + 4i = 1008z - 2004z - 12 for z. 0 Solve 3y - 119 = 13m, 1321y - 1323y = -2m - 26 for y. 5 Solve 0 = -4l + z, -l + 8z - 4z - 15 = 0 for l. 1 Solve -125r = d - 126r - 23, 3d + 3r = -51 for d. 3 Solve -4m = 4d - 5369 + 5373, -2d - 2 = -4m for m. 0 Solve 4o + 28 = 4a, -5o - 839a + 838a - 17 = 0 for o. -4 Solve 18f = -2w + 86, 666 - 638 = 4f - 4w for f. 5 Solve 593q - 599q - 18 = 2h, 0 = 7q + 3h + 19 for q. -4 Solve 3u + 10 = 5j, u + 64j + 8 = 68j for u. 0 Solve -120a - 2i - 5 = -125a, 4i = 0 for a. 1 Solve -7 = -8a - 0a + u, 2a + 2 = 4u for a. 1 Solve -x - 6u - 25 = 0, 2u - 4 = -3x - 15 for x. -1 Solve 5u = 2u - a - 18, u - 2a = -6 for u. -6 Solve -q - 7 = -11016f + 11013f, 2f + q = -7 for f. 0 Solve 3s + 17 = z - 22, 33 = 3z - 2s for z. 3 Solve 11p + l = 6p + 33, 57 = 7p - 4l for p. 7 Solve 4y - 2x = -32, -5y - 229x + 226x = 51 for y. -9 Solve 94 = 2c - n + 98, 0 = -5n - 10 for c. -3 Solve r = -4k + 1, -4r + 55k = 51k + 16 for r. -3 Solve -4d + 56423z - 56422z + 21 = 0, 11 = -d - 3z for d. 4 Solve 4q + 5i - 13 = 0, -12014i + 12023i - 45 = 0 for q. -3 Solve 2516l - 2512l + 4x = 24, 4l + 2x = 22 for l. 5 Solve 22 = -3f - 5q, -109f + 7q - 4q + 17 = -107f for f. 1 Solve -5406 = 4m - 4x - 5474, 3 = 4m + x for m. 4 Solve 2o - 79 = -5z, 34o - 36o = 4z - 64 for z. 15 Solve -3p - 12 = -v, 4p - v = -3377 + 3362 for p. -3 Solve -5h - 33 = 2l, l + 1514 = -h + 1505 for l. -4 Solve r + 2 = 0, -3k = -0k - 0k - 2r - 7 for k. 1 Solve 0 = -5o + 5, 23 - 48 = 4m - 5o for m. -5 Solve 4g - 37 = 7c, -5c - 4220g - 7 = -4218g for c. -3 Solve -24r = 2z - 27r + 15, 0 = -2z - r + 5 for z. 0 Solve 4p + 4 = 4w, 24p - 11 = 28p + 3w for p. -2 Solve -r + 3l + 42 = 0, 0 = 1322l - 1317l + 75 for r. -3 Solve 0 = 2n - 4b + 6, 1370b + 12 = n + 1373b for n. 3 Solve -2p - 8 = 2p, 39 - 28 = -g - 4p for g. -3 Solve -5280 + 5274 = 2q, -x + 11 = -5q for x. -4 Solve 4 = 4y, 0 = -1391u + 1393u - 2y + 12 for u. -5 Solve -30m + 26m - 4 = 2u, -5u = -5m - 5 for u. 0 Solve -3n + 8 = 4g, 61g + 3n + 16 = -33 for g. -1 Solve -7w - 3 + 20 = -2x, w = 2x + 11 for w. 1 Solve 41 = -3j - 25z + 21z, -2j - 4z = 34 for j. -7 Solve -188u + 3s + 67 = -205u, 4s = 24 for u. -5 Solve -3z = -i, -24i + 42i = -3z + 20i - 4 + 7 for z. -1 Solve 0 = -3q + 381l - 385l + 19, -4q - 3l = -23 for q. 5 Solve 0 = 7z + 7, -3i + 4i + 2z = z - 7 for i. -6 Solve 2z + 1 = -313o + 310o, 0 = 6z + 5o + 23 for z. -8 Solve 3j = p - 19, -103j + 105j + 320 = -153p for p. -2 Solve -c - 3n = -3, 0 = -2c + 503n - 500n - 3 for c. 0 Solve 6s + 3180 - 3213 = 3r, 0 = -4s + 5r + 49 for s. 1 Solve -5x = -c, 34c - 32c - 5x = 5 for c. 5 Solve -4 = -4l - 6q + 2q, 23 = 23q for l. 0 Solve w - 4 = 0, -88763w = -u - 88767w + 8 for u. -8 Solve 3u = -2j - 27 + 12, 5u + 12j + 77 = 0 for u. -1 Solve 4w - 27g + 56 = -32g + 9g, 5w - 18 = -3g for w. -3 Solve -420b + 423b + 20 + 28 = 3x, b - x = -4x for b. -12 Solve -4l = -p - 15, -71l = 5p - 74l + 24 for p. -3 Solve 3i - 5n - 16369 = -16383, 3n = i + 6 for i. -3 Solve 0 = -u + 4g - 33, -6u + 394g + 27 = 395g for u. 3 Solve -2i - 5j - 23 = -0, -12i + 3j + 27 = 0 for i. 1 Solve 23n - h + 27 = -21 - 3, 2 + 3 = h for n. -2 Solve -19v - w = 2, 27w = 3v + 22w - 10 for v. 0 Solve 5w - 5k + 10 = 0, -w - 3k - 218 = -212 for w. -3 Solve -97b + 13 = -90b + 4u, -2u = 37 - 47 for b. -1 Solve -4q - 21 = 5r, -2q = -3635r + 3623r - 4 for r. -1 Solve 0 = 4l - 3v + 12, -4l + 13v = 7v + 12 for l. -3 Solve -5z - 2v = -21, 3z - 5*v = 182 - 157 for z. 5 Solve -w	{ "pile_set_name": "DM Mathematics" }
. 10 Let s(b) = b*3 - 11b2 - 11. Let h(v) = -v2. Let j be h(0). Suppose -3w + 8w - 15 = j. Suppose -33 = -wy - 0. Determine s(y). -11 Let d(u) = -u2 - 193u - 763. Let h be d(-4). Let i(y) = -3y + 23. Let b(o) = -o + 1. Let g(j) = -4b(j) + i(j). Determine g(h). 12 Let r(l) = l*3 + 8l*2 + 180l + 1017. Let w be r(-6). Let y(c) = -3c + 34. Determine y(w). 7 Let v = 67 + -82. Let i(d) = -64 - 145 - 2d + 179. Give i(v). 0 Let g(n) be the second derivative of n7/420 + n5/120 - 89n4/12 + 53n. Let b(w) be the third derivative of g(w). Give b(2). 25 Let a(t) = -t*2 - 7t - 1. Let w be 135/354/243. Suppose -10 = -k - 2p, 5k + 3p = -p + 26. Suppose -3f = -ki + 16, 0 = 5i - 5 + w. Determine a(f). 5 Let f(a) = 7a. Let h(j) = -13j. Let d(g) = 5f(g) + 3h(g). Suppose -127 = -37c - 16. What is d(c)? -12 Let q(t) = -727t + 2t*2 + 2186t - 734t - 724t - 81. What is q(0)? -81 Let m(y) be the second derivative of -y*3/2 + 6y*2 + 176y - 12. Calculate m(24). -60 Let n be (-2)/(6 - 8)(3 + -3). Let p(t) = -t2 - 10 - 10t + 12t + 1 + t3 - t. Give p(n). -9 Let s be -7 + (-40 + 4)/(-4). Let y(h) = 3h*s - 5h*2 - 126 + 64 + 7h + 70. What is y(6)? -22 Let a(p) be the first derivative of -11p4/2 + 2p*3/3 - p + 2. Let f be 4/4(-2 - -17). Suppose -2k + 12 = 5x, -5k + 10k - f = -5x. What is a(k)? -21 Let j(h) = 4h + 5. Let u be j(-5). Let z(o) be the third derivative of o*4/24 + 17o3/6 + o2 - 12105o. What is z(u)? 2 Let s(o) = -8 + 116o + 2 - 107o + 0. Let u(y) = 7y - 6. Let v(r) = 3s(r) - 4u(r). What is v(8)? -2 Suppose 0 = u + 3u - 8. Let s(l) = 0 + 1 - 2247398l + 2247408l. What is s(u)? 21 Let b(s) be the third derivative of -11s*4/24 + 10s2 - 330. Calculate b(0). 0 Let m(s) = s2 + 14s + 11. Let r be m(-12). Let f(g) = 28 - 60g*2 + 15g - 52g2 + 2g*2 + 111g*2. What is f(r)? 2 Let l be 2/(165/(-57) - 1-3). Suppose 0 = u - lu + 90. Let a(g) = -4g + 2. What is a(u)? -18 Let s(k) be the first derivative of -k*4/4 + 3k*3 - 3k*2/2 - 3k + 3178. Give s(4). 65 Let d(a) = 3a2. Let l(i) = 17i*2 - 6. Let c(h) = -5d(h) + l(h). Give c(3). 12 Let k(j) = -j*2 - 7j + 10. Let z(p) = p3 - p2 - 3p + 52. Let r be z(0). Suppose -80 = 2t - 4d, -2t + t - d - r = 0. Let l = -57 - t. Determine k(l). -8 Suppose -3b = 15, -b = 3y + y + 29. Let p(a) = 7a - 2 + 1 - 3 - 2 + 5 - 8a. Give p(y). 5 Let q = 8 + -5. Suppose 0 = o - 7j + 5j - 7, 18 = 4o - 3j. Let y(g) = -155g + q - go + 6g*2 + 149g - 3. Calculate y(4). 8 Let v be (19 + -16 - (1 - -2))/2. Let k(l) = -l*2 + 7l - 2. Let s be k(6). Let m(c) = -sc3 + 0c2 + c3 - c*2 + c - 4 + 2c*3. Calculate m(v). -4 Let i(p) = 4p*3 - 4p*2 + 5p + 4. Let t(l) = 3l3 - 4l*2 + 4l + 4. Let x(m) = -2i(m) + 3t(m). Let j = 583 + -551. Suppose 26c = 18c + j. Give x(c). 12 Let h = 230 - 135. Suppose 70 = -5f + h. Let l(k) = k - 4. Determine l(f). 1 Let h(c) = 4c*2 + 7c - 1. Let x be h(-4). Let u = x - 34. Let r(d) = 16d2 + 4d - 1. Let j(y) = -y. Let b(o) = 4j(o) + r(o). What is b(u)? 15 Let c(l) be the third derivative of -l6/120 + l5/4 - 7l*4/12 - 11l*3/6 - 696l*2. Calculate c(14). -11 Suppose 5t - 2 = -3c - 89, -4t - 2c - 70 = 0. Let i be 12/t(-129)/2. Suppose 5n + 18 = i. Let x(z) = 2z - 5. Determine x(n). 5 Let r = 400 + -393. Let d(n) = -35n2 + n + 31n2 - n3 + rn + 4. Determine d(-5). -11 Let m(l) = 27l + 4. Let k be m(-2). Let q be ((-18)/7 - -3) + k/(-14). Suppose 42 = -qu + 38. Let f(a) = -2a*3 - 2a*2 - a. What is f(u)? 1 Suppose 8k = 545 - 593. Let i(w) = w*2 + 2w + 1. Let z(o) = -7o2 - 17o - 8. Let r(q) = ki(q) - z(q). Let c = -13 - -9. Give r(c). -2 Suppose 4m = -2p + 88, -4m + 3p + 68 + 0 = 0. Suppose -m = 2r - 4. Let z(g) = -4g + 21. Let j(a) = 11a - 62. Let f(x) = rz(x) - 3j(x). Determine f(0). 18 Let n(c) = c*3 - 27c*2 - c + 22. Let j(i) = 11i*2 + 106i + 195. Let a be j(-2). Give n(a). -5 Let h(i) = 735i - 2924. Let b be h(4). Let p(r) = -r2 + 5r + 186. What is p(b)? 10 Let l(y) = -3y - 1754 + 1714 - 4y. Determine l(-9). 23 Let v(y) be the second derivative of 1/12y4 - 47y + 1/3y3 - 1 - 3/2y2. What is v(-3)? 0 Let h(r) = -r3 + r2 + r + 2. Let c be h(0). Let v(u) be the second derivative of u3/2 + 3u2/2 + 167u. Give v(c). 9 Let c(y) = 3y - 10. Suppose -5k + 14 = 4t + 107, 123 = -4t + 5k. Let q be (-542)/6 + (-9)/t. Let o be (-4)/22 + (-7)/(77/q). What is c(o)? 14 Let c(x) = 13x + 119. Let g be c(-9). Let w(q) = 2q2 + 8q - q*g - 2q2 - q2 + 6. Determine w(6). -18 Suppose -3l - 5m = -20, -4l - 160m = -163m + 12. Let b(i) be the first derivative of -i2 + 6i + 6. What is b(l)? 6 Suppose -5z + 15 = -5a, 3a + z = 21 - 6. Let p(l) be the third derivative of -1/12l*4 + 0 + 0l - 1/60l5 + 15l*2 - 2/3l*a. Calculate p(-3). -7 Let w(q) = 25q*2 - 16q - 8. Let t(b) = 71b2 - 47b - 22. Let i(c) = -6t(c) + 17w(c). Let o = 13 - 8. What is i(o)? 21 Let n(m) = 10456m - 5 + 0m*2 - 10451m - m*2. Let b = 17 - 14. Let u = b + 1. Determine n(u). -1 Let c = -389 + 419. Suppose -c = -12w + 2w. Let h(g) = 10g + 4. Give h(w). 34 Let v(q) be the first derivative of q - 9/2q2 + 22. Calculate v(1). -8 Suppose 4x = -2v + 7x - 85, -5v - 170 = x. Let a(s) = 4s + 144. Calculate a(v). 4 Let g be 26/(-4)(696/104 + -7). Let j(n) = -n2 - 2n. Give j(g). -8 Let h(r) = -11r - 318. Suppose 5t + 117v + 121 = 121v, 2t = -6v - 94. What is h(t)? 1 Let k(x) = -23x3 + 5x*2 - 22x - 4. Let w(d) = -112d3 + 27d*2 - 120d - 21. Let h(j) = 11k(j) - 2w(j). Determine h(-1). 30 Suppose 0 = -4x + 16, -2a + a - 3x = -14. Let i(y) = 2457y*3 - 2 - y + 0y*a + 3y*2 - 2455y*3. What is i(-2)? -4 Let r(x) be the first derivative of -1/180x*6 + 21 - 3x*3 + 0x*2 + 1/24x*4 - 1/60x*5 + 0x. Let m(i) be the third derivative of r(i). Calculate m(-2). -3 Let c(n) be the second derivative of -n*3/6 - 5n*2/2 + 160n. Give c(-8). 3 Let p(o) be the first derivative of -o*4/4 + 2o3/3 - o2/2 + 3o + 522. What is p(2)? 1 Let q(o) = -3o*3 + 4o*2 - 1. Let a = -86 + 89. Let r(n) = 3n*2 - 4n - 12. Let v be r(a). Calculate q(v). -46 Let m be 1/(-1) - 1 - (-11 + 6). Suppose 0 = 3s - 5v - 9, -s + 12 = ms - 5v. Suppose -9 + 0 = sb. Let f(r) = -r3 - 2r*2 + r - 2. Determine f(b). 4 Suppose -4f + 25x = 21x + 52, 2x + 64 = -13f. Let n(z) be the second derivative of -2z - 7/6z*3 - 1/20z*5 + 0 - 9/2z*2 - 7/12z4. Calculate n(f). -3 Let c(h) = h3 - 15h2 + 56h - 8. Let x be c(7). Let b(k) = 9k - 24. Calculate b(x). -96 Let d(u) = -u2 - 3u - 3. Let w = -20 + 13. Suppose 0 = -4h + 32 + 40. Let j be w/14 - h/4. Calculate d(j). -13 Let y(k) be the third derivative of k4/12 + 5k*3/6 + 2k*2. Suppose -8q = -30q + 66. Suppose -529 + 544 = -qu. Determine y(u). -5 Let q(d) = -13d3 + 19d*2 + 12d - 3. Let a(g) = -15g3 + 20g*2 + 12g - 6. Let c(i) = -6a(i) + 7q(i). Give c(14). -13 Let f(b) = -15b + 209 - 22b - 193 - 17b + 52b. Calculate f(-4). 24 Let c(j) = 2j3 - 4j*2 - 126j + 3. Let m be c(9). Suppose 0s + 30 = -5s. Let v(g) = 3g - 6. Let p(u) = u - 1. Let h(q) = sp(q) + v(q). Calculate h(m). -9 Suppose 0 = 3i + 2i - 10. Let f be (-2 - -7 - i)1. Let h(v) be the first derivative of -v3/3 + 2v*2 - v + 16. Determine h(f). 2 Let c(r) = -2r*2 - 7r + 9. Suppose 683 - 102 = -o. Let t = -588 - o. What is c(t)? -40 Let b = 254 + -252. Let s(a) = 17a + 14a - 30a + 6 - ab + 0. What is s(5)? -14 Suppose 3g - 6 = -12. Let h(z) = 8z - 4. Let k(q) = q - 1. Let r(p) = 3h(p) - 15k(p). Give r(g). -15 Let m be 5(-4(-5)/(-10) + 3). Suppose -24 = -h - mg - 6, -3g = 3h - 30. Let a(v) = v*3 - 7v*2 - 10v - 8. Give a(h). -24 Let b(q) = 11q2 + 2q + 1. Let j(i) = -51i + 1631. Let c be j(32). What is b(c)? 10 Let z(m) = -354 + 761 - 318 - 313 + 30m - m*2. Give z(13). -3 Let s(q) = -q - 15. Let x be (29 - 20)(2/6 - 0). Suppose xt - 42 = 17t. Let i be 19/t - -24/(-12). Give s(i). -8 Let p(s) = 13s*2 - 4. Let y(u) be the third derivative of 0u*4 + 0u - 23u2 - 1/6u*3 + 0 + 1/20u*5. Let a(h) = 2p(h) - 9*y(	{ "pile_set_name": "DM Mathematics" }
next: 4491, 6364, 8235, 10104, 11971? 13836 What is the next term in 12689, 25371, 38049, 50723? 63393 What is next in -153, -341, -557, -801, -1073, -1373, -1701? -2057 What comes next: 1753, 1912, 2067, 2212, 2341, 2448, 2527, 2572? 2577 What comes next: 545, 1098, 1655, 2216, 2781? 3350 What is next in -443, -886, -1325, -1760, -2191, -2618? -3041 What is next in -10581, -10568, -10543, -10500, -10433? -10336 What is the next term in 560, 871, 1182, 1493, 1804, 2115? 2426 What is next in -1102, -1145, -1188, -1231, -1274? -1317 What is the next term in 6157, 12304, 18449, 24592, 30733? 36872 What is the next term in 34630, 138554, 311762, 554254, 866030, 1247090, 1697434? 2217062 What is next in -273, 315, 1901, 4983, 10059, 17627? 28185 What comes next: 3840, 3847, 3858, 3873, 3892, 3915, 3942? 3973 What is next in -41, -145, -317, -557, -865, -1241, -1685? -2197 What comes next: -5327, -5283, -5197, -5057, -4851, -4567? -4193 What is next in 407, 438, 461, 452, 387, 242? -7 What comes next: 192, 375, 550, 717? 876 What is next in -486, -501, -516, -531, -546? -561 What is next in -6914, -13810, -20706? -27602 What is the next term in -241562, -241560, -241558, -241556, -241554? -241552 What is next in 313, 365, 417, 469, 521, 573? 625 What comes next: 898, 6725, 22530, 53299, 104018, 179673, 285250? 425735 What is the next term in -132544, -265074, -397582, -530056, -662484, -794854? -927154 What comes next: -7291, -7302, -7323, -7354, -7395, -7446, -7507? -7578 What is next in 22575, 45152, 67729, 90306, 112883, 135460? 158037 What is next in 329, 633, 905, 1145, 1353, 1529? 1673 What is the next term in -44955, -44970, -44985, -45000? -45015 What is next in -1118, -1115, -1112, -1109, -1106, -1103? -1100 What is next in -910, -927, -944, -961, -978? -995 What is the next term in -31179, -31173, -31167, -31161, -31155, -31149? -31143 What is the next term in 3988, 15926, 35822, 63676, 99488, 143258? 194986 What is the next term in -258, -255, -248, -237, -222, -203, -180? -153 What is next in 34443, 68882, 103333, 137802, 172295? 206818 What is the next term in 174036, 174037, 174038? 174039 What comes next: 1060, 4351, 9828, 17485, 27316, 39315, 53476, 69793? 88260 What is next in -1300, -1944, -2588, -3232? -3876 What comes next: 498, 458, 406, 336, 242, 118, -42, -244? -494 What is next in 1229, 1244, 1269, 1304, 1349, 1404? 1469 What comes next: 4074, 8155, 12240, 16329, 20422? 24519 What comes next: -342, -1087, -1830, -2571, -3310, -4047, -4782? -5515 What comes next: 2110195, 2110194, 2110193, 2110192? 2110191 What is next in -1098, -2401, -3702, -5001? -6298 What comes next: -1723, -6932, -15621, -27790, -43439, -62568? -85177 What is next in 355, 755, 1247, 1879, 2699, 3755? 5095 What is next in -9, 77, 165, 255, 347, 441? 537 What is the next term in -10015, -10007, -9993, -9973, -9947, -9915? -9877 What is next in -1450, -1471, -1506, -1555, -1618, -1695, -1786? -1891 What is next in -12, -48, -78, -102, -120, -132, -138? -138 What is the next term in 1142, 2284, 3436, 4604, 5794, 7012, 8264, 9556? 10894 What is next in 464, 3375, 8228, 15023? 23760 What is next in 5300, 5326, 5352? 5378 What is next in 873043, 873046, 873049? 873052 What comes next: -586506, -586507, -586508? -586509 What is next in -9519, -9474, -9429, -9384? -9339 What is next in 759, 537, 173, -333, -981, -1771? -2703 What is next in -91732, -91742, -91756, -91774, -91796, -91822, -91852? -91886 What comes next: -3086, -6146, -9206, -12266, -15326, -18386? -21446 What comes next: 2724, 2771, 2858, 2991, 3176, 3419, 3726, 4103? 4556 What comes next: 6154, 6330, 6508, 6688, 6870, 7054? 7240 What is next in -57503, -57504, -57505? -57506 What is next in 1368, 1308, 1232, 1134, 1008, 848, 648, 402? 104 What is next in 270, 1004, 2226, 3936, 6134, 8820? 11994 What is next in 9414, 18822, 28230? 37638 What is the next term in -33034, -66068, -99102, -132136? -165170 What is next in -8377, -16724, -25057, -33370, -41657, -49912, -58129? -66302 What is the next term in -49, -1310, -4749, -11458, -22529? -39054 What is next in -489, -867, -1245, -1623, -2001? -2379 What comes next: -5132, -5126, -5120, -5114, -5108? -5102 What comes next: 227, 216, 195, 164, 123, 72? 11 What is next in 3428, 13759, 30984, 55109, 86140? 124083 What is the next term in 276, 317, 382, 477, 608? 781 What comes next: -198, -413, -618, -813, -998? -1173 What comes next: 24437, 48879, 73323, 97769, 122217? 146667 What is the next term in 2530, 2509, 2442, 2305, 2074, 1725, 1234? 577 What is the next term in -3490, -3611, -3734, -3865, -4010, -4175, -4366, -4589? -4850 What is the next term in 1316, 1333, 1350, 1367? 1384 What is the next term in 1653, 3396, 5139, 6882, 8625, 10368? 12111 What is the next term in -3233, -3300, -3367, -3434, -3501, -3568? -3635 What is the next term in -2948, -2777, -2604, -2429, -2252, -2073, -1892? -1709 What comes next: 3421, 7604, 11787, 15970, 20153? 24336 What is the next term in 1026, 1169, 1314, 1455, 1586, 1701? 1794 What comes next: -651, -676, -701, -726, -751? -776 What comes next: 113, 434, 943, 1646, 2549? 3658 What is the next term in 13099, 26200, 39301, 52402, 65503, 78604? 91705 What comes next: -64, -219, -522, -1009, -1716, -2679, -3934, -5517? -7464 What is next in 727, 743, 769, 805, 851, 907? 973 What is the next term in 51154, 102309, 153464, 204619, 255774? 306929 What is the next term in 463, 1465, 3129, 5449, 8419, 12033, 16285? 21169 What is next in -1557, -2667, -3775, -4881, -5985, -7087? -8187 What is next in -63896, -127789, -191682, -255575, -319468? -383361 What is next in -27403, -54803, -82203, -109603? -137003 What comes next: 296, 300, 296, 284, 264, 236, 200? 156 What is the next term in 571, 877, 1183, 1489, 1795, 2101? 2407 What is next in 566, 1009, 1452? 1895 What is the next term in -108, -163, -254, -387, -568, -803, -1098? -1459 What is next in -387, -370, -341, -300, -247, -182? -105 What is next in -111, -18, 139, 360, 645, 994? 1407 What comes next: 1343, 2679, 4005, 5315, 6603, 7863? 9089 What comes next: 956, 1055, 1324, 1847, 2708? 3991 What comes next: 2804, 2810, 2822, 2840? 2864 What is next in 2831, 2822, 2809, 2792, 2771, 2746, 2717? 2684 What is next in 4459, 4296, 4143, 4006, 3891? 3804 What comes next: -49944, -49945, -49948, -49953, -49960, -49969? -49980 What comes next: 20303, 20125, 19937, 19733, 19507? 19253 What is next in 9012, 9018, 9028, 9042, 9060, 9082? 9108 What is the next term in -436, -426, -404, -364, -300, -206, -76, 96? 316 What is the next term in 4496, 9012, 13532, 18056, 22584? 27116 What comes next: -230, -340, -450? -560 What is next in -106458, -212931, -319418, -425919, -532434, -638963? -745506 What is the next term in 1928, 1948, 2004, 2114, 2296, 2568? 2948 What is next in -1856, -1842, -1802, -1724, -1596, -1406, -1142? -792 What is next in 18653, 18391, 18129, 17867? 17605 What is next in 10823, 10819, 10815? 10811 What is next in -645511, -1291017, -1936523, -2582029, -3227535? -3873041 What comes next: 68697, 68698, 68701, 68706, 68713, 68722, 68733? 68746 What is next in -4370, -8184, -12008, -15848, -19710? -23600 What is the next term in 2845, 2838, 2839, 2860, 2913? 3010 What is next in -35, 98, 291, 544, 857? 1230 What comes next: 59572, 59573, 59574, 59575? 59576 What is next in -152, -279, -508, -845, -1296, -1867, -2564? -3393 What is the next term in 1621, 1627, 1633, 1639, 1645, 1651? 1657 What is the next term in -195, -832, -1907, -3420, -5371, -7760? -10587 What is next in 327, 271, 241, 249, 307, 427, 621, 901? 1279 What is next in -1341186, -2682369, -4023552? -5364735 What comes next: 4370, 4337, 4256, 4103, 3854, 3485? 2972 What comes next: 1014, 992, 970, 954, 950? 964 What comes next: -79, -93, -103, -97, -63, 11? 137 What comes next: 1218, 1480, 1918, 2532, 3322, 4288, 5430? 6748 What is next in -306786, -306771, -306754, -306741, -306738, -306751, -306786, -306849? -306946 What comes next: -200, -352, -464, -518, -496? -380 What is the next term in 82, 105, 118, 121, 114, 97, 70? 33 What comes next: -6187, -12391, -18599, -24811? -31027 What comes next: -1382, -1394, -1416, -1454, -1514? -1602 What comes next: 7, 25, 53, 91, 139, 197, 265?	{ "pile_set_name": "DM Mathematics" }
nd the third derivative of -14938727p3 - 22798p*2 + 239. -89632362 Find the second derivative of 181480330f*4 + 3265f + 30024 wrt f. 2177763960f2 Differentiate 5177w*2 + 4654w + 714889 wrt w. 10354w + 4654 What is the third derivative of 442210362r*3t + 39176r2 - 700t wrt r? 2653262172t Find the second derivative of 41631o*5 - 5o*4 - 6o*3 - 44279012o. 832620o3 - 60o*2 - 36o Find the first derivative of -643233505y + 1583694835 wrt y. -643233505 Differentiate -24605r3 - r2 + 7r - 18749361 with respect to r. -73815r*2 - 2r + 7 Find the third derivative of -681392406n3 + 13109369n*2 + 2n - 2 wrt n. -4088354436 Find the third derivative of 540037669v3 + 22v*2 - 95v + 11617. 3240226014 What is the second derivative of 97964116w3 + 382w - 1708 wrt w? 587784696w What is the derivative of 13440626m*4 - 17250461? 53762504m*3 Find the second derivative of 4b*2x*3 + 604209b*2x*2 + 3b*2x + 186b2 - 1712 wrt x. 24b*2x + 1208418b2 What is the third derivative of 2870076o*3 + 947o*2 - 53o - 2 wrt o? 17220456 Find the second derivative of 12k4 - 456263k*3 - 283856k + 8. 144k2 - 2737578k Find the third derivative of 2261654t3u*2 + 204t*2u*2 - 2t*2 + 2t - 5u - 1 wrt t. 13569924u*2 Find the second derivative of -2h*3w - 358h3 - 8h*2w + 102h2 - 1796hw - 3077h wrt h. -12hw - 2148h - 16w + 204 Find the second derivative of 351499l5 + 8l*3 + 15442757l. 7029980l3 + 48l What is the first derivative of 75017723l - 99719495 wrt l? 75017723 What is the derivative of -14261hw2 - 15257455h - w*2 - 114w + 3 wrt w? -28522hw - 2w - 114 What is the third derivative of 5001d*3t*4 - 24d*3t + 651d2t*4 + 2d*2t*2 + 834dt2 + 4t*2 wrt t? 120024d*3t + 15624d2t Find the first derivative of 1045787070lm*3 - 311479966m*3 - 3 wrt l. 1045787070m*3 What is the first derivative of 65224632s - 15046361 wrt s? 65224632 What is the third derivative of 1289953574a4 - 1255a*2 - 3a - 1746? 30958885776a What is the second derivative of 10l*3r + 71198l3 - l2r + 5033lr + 699r wrt l? 60lr + 427188l - 2r Differentiate 8589634s*2 - 2488200 wrt s. 17179268s Find the second derivative of -86316612s4 - 404521069s wrt s. -1035799344s2 What is the third derivative of 265439py3 - 10py2 + 15p - 15y2 + 23y + 1 wrt y? 1592634p Find the first derivative of 106z*3 - 12808z*2 - z + 12843748 wrt z. 318z*2 - 25616z - 1 Find the third derivative of 60f6 + 136639f*3 + 1743f*2 - 40f - 33. 7200f3 + 819834 Differentiate -11022075cu2 + c - 13874218u*2 with respect to c. -11022075u*2 + 1 Find the first derivative of -19275099o*2 + 2066343 wrt o. -38550198o Find the second derivative of 16519116o5 + 2737o + 9489 wrt o. 330382320o3 Find the third derivative of 120227843i*3 + 2147843i*2 - 12i. 721367058 Differentiate -17827591a - 97139938 with respect to a. -17827591 Find the second derivative of -27617978h*2 + 43057251h wrt h. -55235956 What is the second derivative of -7480296b4 - 51123b - 3? -89763552b2 What is the second derivative of -429s*2t*3 - 1374s*2t*2 + 815st3 + 135s + 8 wrt s? -858t3 - 2748t*2 What is the second derivative of 113k*2m*2 - 2k*2m + 5074k2 + 1098km2 + 2km - 15m*2 + 3m + 88 wrt m? 226k2 + 2196k - 30 Find the first derivative of -163l3 + 2386l + 107136198. -489l2 + 2386 What is the second derivative of 5g*3 - 41797g*2 - 7613g - 114 wrt g? 30g - 83594 Find the third derivative of 9868727g*3sz3 - 30g*3sz2 + 36047gsz - 2sz wrt z. 59212362g3s What is the second derivative of -8652384s3 - 10s + 147124 wrt s? -51914304s Find the third derivative of 30993o*5 - 10o*4 - 123o*3 - 420o*2 + 7o + 10778 wrt o. 1859580o2 - 240o - 738 Differentiate -37v3 - 5411006v + 1149689705 wrt v. -111v2 - 5411006 Find the third derivative of 2801971i*5 + 548424i*2. 168118260i*2 What is the derivative of -282fh2x*2 - fx - 3f - 2h*2 - 16194hx - 15x*2 + x - 1498 wrt h? -564fhx*2 - 4h - 16194x What is the second derivative of bv*2w*2 + bv*2 + 49bw - 137b - 4479342v2w2 - v2w + vw + 12w3 + 269w + 1 wrt w? 2bv*2 - 8958684v*2 + 72w Find the third derivative of 643jt*4 + 1660jt3 + 5jt2 - 3jt - 191j + 6t4 + 7t*2 + t + 5 wrt t. 15432jt + 9960j + 144t Differentiate -3m*4 + 3340438m3 + m2 - 39744783 wrt m. -12m3 + 10021314m*2 + 2m Find the second derivative of 1400bk*3 + 79bk2s + 925bk + 3k2 - 298ks + k - 2s - 2 wrt k. 8400bk + 158bs + 6 Find the second derivative of -186c4 - 14184c*3 - 324911c + 9 wrt c. -2232c2 - 85104c Find the third derivative of -3529ad*6 - 5739ad3 - 5ad - a - 2d*3 - 753830d*2 wrt d. -423480ad3 - 34434a - 12 What is the third derivative of 10jl*4 + 8jl3 - 9jl2 + 36jl + 11j - 5011l4 - 5l*3 - 4l*2 + 7l - 1 wrt l? 240jl + 48j - 120264l - 30 What is the derivative of -27259796s + 6620496 wrt s? -27259796 What is the second derivative of -26305605l*2 - 8984408l + 1 wrt l? -52611210 What is the second derivative of -221949116g5 - 201261630g? -4438982320g3 What is the derivative of 234259893q*2 - 263254631? 468519786q Find the third derivative of 1013175794q3 - 80q*2 - 3770493 wrt q. 6079054764 Find the first derivative of -1425868d + 1590347. -1425868 Find the second derivative of -1050r3 + 86449r*2 + 132974539r. -6300r + 172898 What is the second derivative of -66815315h*2 + 7h + 1900706 wrt h? -133630630 Find the third derivative of 2d6 + 686d*5 + 82d*3 - 8764251d*2 wrt d. 240d*3 + 41160d*2 + 492 Find the second derivative of -161b*2c*2 - 654b*2c - 211b2 + 44bc2 + 2bc - b + 205c*2 + 2c + 2 wrt c. -322b2 + 88b + 410 Find the third derivative of 5523420w4 - 2w*3 - 2395184w*2. 132562080w - 12 Find the third derivative of -11732245c5j2 + c4 + 177c2j*2 - 2c*2 - 101j*2 + j + 1 wrt c. -703934700c*2j*2 + 24c Find the third derivative of -94341z5 - z4 - 3z*3 - 5744z*2 + 60z. -5660460z2 - 24z - 18 What is the first derivative of -620bi*2 - 12bij*2 + 4bj2 - 60773i*2 - 13ij2 wrt b? -620i*2 - 12ij2 + 4j*2 What is the third derivative of -2cn4 - 160cn2 - 3cn + c - 123433484n*4 + 738n*2 wrt n? -48cn - 2962403616n Find the first derivative of 8664668f3 - 10204969. 25994004f*2 What is the third derivative of -477223l*6p + 4l6 - 3753678l*2p + 2p wrt l? -57266760l*3p + 480l3 What is the third derivative of -3927234j3 - j2 + 3004102j wrt j? -23563404 What is the third derivative of 19037926r*3 - 48623528r*2? 114227556 What is the third derivative of -3796434x*3 - 26236439x*2? -22778604 Find the second derivative of -7657126q*2 - 7648q - 13. -15314252 What is the second derivative of -33r3 + 1234r*2 - 3560r - 606? -198r + 2468 What is the second derivative of 4114610s*2 - 41425s - 149 wrt s? 8229220 Find the third derivative of -130708735y3 + 16y*2 + 5081747y. -784252410 Find the second derivative of 43310014h2 - 113866014h. 86620028 What is the second derivative of -195577145m5 - m - 23624635 wrt m? -3911542900m*3 Find the first derivative of -8996456do2 + 6740o*2 + o + 201 wrt d. -8996456o*2 What is the second derivative of 44653335v*5 + 33341081v? 893066700v3 Find the third derivative of -16k*2ox3 - 10k*2ox2 + 3k*2ox - 12k*2o + k*2x*2 - 6k*2 + 400974kox*3 + 3ko + 2kx2 wrt x. -96k*2o + 2405844ko What is the third derivative of 1779k3n*2 - 23367k3 + k2n2 - 23k*2 + 3175kn2 - kn + 3k - 22 wrt k? 10674n*2 - 140202 Find the third derivative of -163809421nz3 + 2nz - 679z*2 + 27473z wrt z. -982856526n Differentiate 2643853g*2j - 10510510g2 wrt j. 2643853g*2 What is the second derivative of -30471354a*4 + 121657086a? -365656248a2 Find the third derivative of -240496h*4 + 2h*3 + 10364084h*	{ "pile_set_name": "DM Mathematics" }
1/5 c Let r = 10 - 6. Let m = 0.11 + -0.17. Let l = -1.94 + m. Which is the nearest to -1/8? (a) -0.5 (b) l (c) r a Let s = -48 + 43. What is the closest to 1/2 in -1, -1/5, s? -1/5 Let r = 0.2 + -0.1. Let o = 2 - 9. Let j = -11 - o. Which is the closest to r? (a) 4 (b) j (c) 0.5 c Let c = -1 + 0.53. Let w = c + -0.03. What is the nearest to 2/3 in w, 4, -2? w Let q be 32/(-72)2. Which is the closest to 0? (a) -2 (b) q (c) 6/11 b Let n = 12 + -11.8. Let h be 58(-1 + 0 + 0). Let x be (-6)/27 + h/(-18). What is the nearest to n in 2/7, x, -0.2? 2/7 Let h = 0.2 + -0.2. Let q = 0.15 - -0.25. Let a = -0.07 - -4.07. What is the closest to h in a, q, -1/3? -1/3 Suppose -v - 4v - 20 = 0. Let k = -2.4 + 2.6. Let h = k + 0. What is the closest to -1 in h, 0.5, v? h Let o = 0.2 + 0.3. Let q be (-22)/(-4) - 3/183. What is the nearest to 1 in 2, o, q? o Let l = -9.5 + 14.5. Which is the nearest to -2? (a) l (b) -1 (c) 0.5 b Let o = 1 - -7. Which is the nearest to 0.2? (a) 0.3 (b) -1 (c) o a Let w = -8 + 11. Let y = -3 + w. Let s = -2167/7 - -309. Which is the closest to 0? (a) y (b) -0.5 (c) s a Let u = 3 - -2. Let z = -0.16 - -7.16. Let v = z - 11. Which is the closest to 2/5? (a) 1 (b) u (c) v a Let u = 2.35 + -2.35. Let r = 1 - 0.8. What is the closest to u in 1, -2/9, r? r Let z = -1/15 + 19/60. What is the nearest to z in -5, 1/3, 0.1? 1/3 Suppose 0l - 180 = -3l. Suppose -5t + 330 = -l. Let x be ((-6)/4)/(t/8). What is the closest to -2 in x, 3, 0.1? x Let l = 9.13 + -9.8. Let o = -0.4 + l. Let x = 0.07 + o. What is the closest to x in -5, 1/4, -2? -2 Let d = -2/17 - -56/187. Let v = -2 + 1. What is the nearest to v in d, 0, -1? -1 Let o be (2/8)/(9/18). Which is the nearest to -2/5? (a) -1/6 (b) -4 (c) o a Let s = -71 - -66. Which is the nearest to -3? (a) 0.3 (b) -2/3 (c) s c Let i = -0.43 - -0.03. Let j = 3 + -3.1. Let r = -1.1 - -1.1. Which is the closest to r? (a) 0 (b) i (c) j a Let v = -0.2 - -0.3. Let n = -0.9 - -2.6. Let j = n + -2. Which is the closest to v? (a) -5/3 (b) -2/7 (c) j b Suppose 6l = 3l. Suppose -2i + 0i + d = 0, i - 3d = 0. Which is the nearest to i? (a) -0.4 (b) l (c) -4 b Let r = 2 + -2.1. Let c be (74/(-15))/(6/(-18)). Let v = 15 - c. What is the nearest to 0.1 in r, 0.5, v? v Let n = 0.06 - -0.04. Let p = 0.12 + -1.12. What is the nearest to p in n, 3, 0.4? n Let x = 0 + -1. Let d = -5 - -6. Let h = -0.5 - -1. Which is the nearest to x? (a) h (b) d (c) 5 a Let x = -16 + 11. Let q = 2 + x. Let n = 1.9 - -0.1. Which is the closest to -0.1? (a) -0.2 (b) q (c) n a Let k(v) = -v3 + 7v*2 + 8v + 5. Let d be (-7)/(-14) - (-15)/2. Let o be k(d). Which is the nearest to 4? (a) -5 (b) -4 (c) o c Suppose 0 = 3n - 15, 0 = k - 2n + 3n - 7. What is the nearest to 2 in 0.5, 4, k? k Let p = -0.15 - 0.05. Which is the nearest to -1? (a) -5 (b) -1/6 (c) p c Let d = 0.65 - 0.35. What is the nearest to -4 in -4, 1/4, d? -4 Suppose -16k = -14k + 4. Which is the closest to k? (a) 0.3 (b) -4/9 (c) 6/5 b Let q = 2/311 + -941/1244. What is the nearest to 2 in 3, q, -0.5? 3 Let r = -64 - -65. Which is the closest to r? (a) 0.5 (b) 11 (c) 3 a Let h = -0.1 - 0.9. Let k = h + 2. Let i be (-6)/93/17. What is the nearest to k in i, -4, 0.4? 0.4 Let t = -10.9 - -11. What is the closest to t in -3, -2/9, -4? -2/9 Let v be (-2)/(-10) - (-12)/15. Let m be 3v + (-3 - 0). Suppose -3k + 0k = 0. What is the closest to m in -0.4, k, 2? k Let u = 42 - 42. What is the closest to -2/7 in -2/5, u, 4? -2/5 Let o(q) = -q2 + 5q - 1. Let x be o(4). Let s be (-10)/(-8) + x/(-12). Let t be (5 - (1 + s))/(-7). Which is the nearest to 1? (a) t (b) -0.1 (c) 4 b Let h = -4 - -1. Let f = -3 - -3.1. Which is the nearest to f? (a) 2 (b) 0.4 (c) h b Let f = 5.87 + 0.03. Let h = 6 - f. Let d = -196/3 + 66. Which is the closest to h? (a) 0 (b) 2/5 (c) d a Let s(k) = 2k2 - 3k - 3. Let l be s(-1). Let n = 0.1 + 0.1. Which is the nearest to n? (a) -2/9 (b) -5 (c) l a Let n(s) = -s3 + s2 + s + 11. Let t be n(0). Suppose -14 - t = -5p. Let i = 3.1 + 0.9. What is the nearest to -0.1 in p, i, -0.3? -0.3 Let d be 9/156/(-9). Which is the closest to 0.1? (a) 3 (b) 2 (c) d c Let m = -0.8 - 1.2. Which is the nearest to 0? (a) 0.3 (b) 0.4 (c) m a Let d = -0.3 + 0.1. Let w be 8/6 - 180/54. Which is the closest to w? (a) 2 (b) 0.3 (c) d c Let v be 3 + (-2)/(-3)3. Let g = -3 - 0. Let i be (-4 + 5)(-2 - g). Which is the nearest to i? (a) -2 (b) 0.4 (c) v b Let n = 11.7 - 11.6. Which is the nearest to -0.8? (a) 5/3 (b) n (c) 1 b Let l = 20 + -19. Which is the nearest to 0.3? (a) l (b) -0.3 (c) 0 c Let k = -10 + 12. Let m = 0 + 0. What is the nearest to m in 3, -0.1, k? -0.1 Let m = -4 + 6. Let s = 6 - m. Let z be (-3)/(-18)(-8)/(-6). Which is the closest to -0.2? (a) -1 (b) s (c) z c Let o = 113/28 + -30/7. Which is the closest to o? (a) -2/5 (b) 5 (c) -5 a Let u = -0.04 - -0.12. Let p = u + -0.48. What is the closest to -1 in -1, p, 2/21? -1 Let m = 62 + -6. Let t = -225/4 + m. Let q be (-1)/(-4)-20. Which is the closest to q? (a) 0.4 (b) t (c) -4 b Let o be (-1 - 0)/(5/3). Let s = 109/2 + -55. Let v be ((-1)/(-10))/((-2)/4). Which is the closest to 1/2? (a) s (b) v (c) o b Suppose -2n + 5n = 0. Which is the closest to n? (a) 0.1 (b) -0.5 (c) 1/6 a Suppose 5 + 1 = 6c. What is the nearest to -3 in 3/8, c, 0? 0 Let r = -43/497 - 4/71. What is the nearest to 0.1 in 0.2, r, -2/15? 0.2 Let r be (-10)/378/65. What is the nearest to -2 in 2/3, r, -1/5? -1/5 Let g = -1/82 - -167/246. Let b = 35/72 + 1/72. What is the closest to 1/4 in g, -3, b? b Let g = -0.28 + -2.72. Which is the closest to g? (a) -1 (b) 1 (c) -3/4 a Let d = 7 + -6.9. Let r = -125/4 + 31. Let g = 77/3 + -26. Which is the closest to r? (a) g (b) d (c) 4 a Let i = -0.2 - -0.6. Let z = -0.4 + i. Let w = 149/4 - 37. What is the nearest to z in -3, w, -0.3? w Let l = -4 + 4.2. Let q = 14 - 14.1. Which is the closest to q? (a) l (b) -0.3 (c) -5 b Let v = 0.5 - 0.3. Let m = -1/6 - -11/18. What is the closest to 2/3 in v, 5, m? m Let x = 10.7 - 0.7. Let q = 15 - x. Let a = -1.95 - 0.05. What is the nearest to 0.1 in q, -0.1, a? -0.1 Let s = -0.15 - 0.21. Let z = -0.04 + s. Which is the nearest to 0? (a) -0.1 (b) -1 (c) z a Let w be -1(-22)/61. What is the nearest to -1 in w, 2, -2/9? -2/9 Let h = 190/3 + -64. What is the nearest to -4 in -6/11, h, -1/2? h Let p = 3 - 2.8. Let f = 0.7 - 1.2. Which is the nearest to 1? (a) -0.2 (b) p (c) f b Let g = -23.3 + 23. What is the closest to g in 1, -0.2, -0.3? -0.3 Let m = 0.34 - 0.3. What is the closest to m in -4/5, 0, -2? 0 Suppose 4w + 2d - 27 = d, 0 = 3w + 3d - 27. Suppose -w = y + 2y. Which is the closest to -2/3? (a) y (b) 1/3 (c) 2 b Let u be 1/33/10. Which is the closest to -2/11? (a) -2/9 (b) -4 (c) u a Let r = 1.37 - -0.33. Let z = -15 - -17. Let d = z - r. What is the closest to 0.1 in d, 4, -0.2? d Let q = 0.03 - -0.07. Let s = q + -0.2. Which is the nearest to s? (a) -5 (b) -2/7 (c) -0.2 c Let u = 77 - 153/2. Which is the closest to -1? (a) 12 (b) -3 (c) u c Let l be ((-1)/3)/(2/(-4)). Let y(p) = -p2 - p + 3. Let u be y(-3). Let f be 2(-1)/(-2)u. Which is the nearest to 2? (a) -2 (b) l (c) f b Let j = -0.17 + 0.27. Let y = 1/3 + 1/6. Which is the closest to j? (a) 4 (b) 5 (c) y c Suppose y - 6 - 2 = 0. Let j be (4/18)/(y/(-12)). Let n be 5(-1)/7 - -1. Which is the nearest to j? (a) -2 (b) 5 (c) n c Let j = 2 + -4. Let y be 3/j + (-10)/(-12). Which is the nearest to -2? (a) y (b) 4 (c) -3 c Let r(d) = d*3 - 6d*2 + 3d + 9. Let m be r(5). Which is the nearest to 0? (a) 5 (b) 4 (c) m c Let v = 2/21 - 25/42. Suppose 0 = 3r - 3l + 54, 4r - 4l + 69 = -l. Let w be ((-3)/(-8))/(r/10). Which is the nearest to -4? (a) 0.4 (b) v (c) w b Let m = -0.02 - 0.03. Let s = m + 0.15. Which is the closest to 0? (a) -0.5 (b) s (c) -0.4 b Let t = -11.9 - -9. Let r = t + 1.9. What is the nearest to r in 0.4, 1/3, -2? -2 Let k be 3/((-3)/(-6)*4). Let l = 77.3 - 77. Which is the nearest to 0.1? (a) l (b) k (c) 2/5 a Let p = -0.01 + -0.19. What is the closest to -0.1 in p, 1/8, -0.1? -0.1 Let u =	{ "pile_set_name": "DM Mathematics" }
36y4 Let z be -3 + (1 - 3)/2. Let y be ((1 - 0)z)/((-22)/11). Let k(b) = 3by + 24b - 24b. Let s(q) = -4q*2. What is k(s(u))? 48u*4 Let d(b) = 3379667b*2. Let i(w) = -63w*2. Calculate d(i(j)). 13413898323j4 Let d(i) be the second derivative of -i4/12 + 1625i2/2 - 306i. Let o(g) = -g. Determine o(d(t)). t*2 - 1625 Let x(v) = 41v*2. Let a(y) = 99950 + 34y - 99950. Give a(x(c)). 1394c2 Let x(b) = -2b + 126. Let z(v) = -15v - 6. Let i(s) = -34s - 15. Let u(g) = -2i(g) + 5z(g). Determine u(x(j)). 14j - 882 Let v(w) be the first derivative of -3w*2/2 + 96w + 527. Let i(c) = -6c2. Determine i(v(s)). -54s*2 + 3456s - 55296 Let h(z) = 5z - 173. Let j(i) = -40i - 50i + 120i - 2i2 - 30i. Determine j(h(g)). -50g2 + 3460g - 59858 Let x(u) = 746u2 + 676u*2 - 1415u*2. Let q(n) = 3n - 527. Give q(x(j)). 21j2 - 527 Let u(r) = 41r*2. Let b(d) = 2d - 1145084. What is b(u(t))? 82t2 - 1145084 Let z(h) = 2h - 3h - 374329 + 187164 + 187165. Let x(g) = g - 1. Let j(b) = 460b + 15. Let a(y) = -j(y) - 15x(y). Give z(a(t)). 475t Let u(b) be the first derivative of 0b2 - 33 + 0b + 2/3b3. Let n(i) = -3i*2. What is n(u(h))? -12h*4 Let c(z) = 30z - 2. Let p(a) be the first derivative of 0a + 0a*2 + 101 - 1/3a*3. Determine c(p(n)). -30n*2 - 2 Let q(k) = 4k*2. Let b(t) = -308t - 216t - 239t + 69t - 117t. What is b(q(a))? -3244a2 Let z(k) = 286 - 336k - 284 - 322k. Let h(p) = -3p. Give z(h(n)). 1974n + 2 Let f(n) = -2n*2. Let m be (-3)/(12/(-20)) - -68. Let k(g) = 64g - mg + 43g. Give k(f(j)). -68j2 Let d(o) = -14o*2 - 21o*2 - 5o*2 + 43o*2. Let w(j) = 43j - 1. Calculate w(d(s)). 129s2 - 1 Let c(s) = -4801346s2. Let w(b) = -b2. Calculate c(w(q)). -4801346q4 Let q(c) be the third derivative of c4/6 - 3c*2. Let a(g) = 13g + 41g + 38g - 31g + 17g. What is a(q(r))? 312r Let j(t) = -4t*2 + 4t. Let q(w) = w*2 - 2w. Let g(o) = -j(o) - 2q(o). Let b be 12 + (-2 - -1) - 1. Let i(m) = -m + bm - 2m. Determine i(g(y)). 14y*2 Let p(w) = 158w - 337w + 165w. Let t(g) = -30g + 25. Let f(b) = -b + 1. Let y(x) = 50f(x) - 2t(x). Determine p(y(q)). -140q Let t(w) = 12w2. Let i(p) = 3228935 + 4p - 3228935 + 625p2 - 4p. What is t(i(b))? 4687500b4 Let t(w) be the second derivative of -1 + 0w*2 - 42w - 31/6w3. Let c(f) = 4f*2. What is c(t(k))? 3844k*2 Let p(b) = 2b*2 + 45391 - 45391. Let i(s) = -6s + 527. Determine i(p(t)). -12t2 + 527 Let a(w) be the second derivative of w3 - 25w + 39. Let d(k) = 554k. Calculate d(a(t)). 3324t Let u(m) = m*3 + 10m*2 + m + 12. Let r be u(-10). Let k(q) = -2q*2 - 2q + 0q2 + rq. Let j(g) = 1724g2 + 1742g*2 - 3465g*2. Calculate j(k(t)). 4t*4 Let b(f) = 3f. Let c = 211 + -165. Let z(d) = -d + c - d + d - d. Give b(z(j)). -6j + 138 Let c(z) be the second derivative of 0 - 1/3z*3 - 6z + 0z2. Let u(a) be the second derivative of -2a*3/3 - 124a + 1. What is u(c(j))? 8j Let g(r) = 8r + 2. Let c(p) = -48792p - 11984. Let n(s) = -c(s) - 5992g(s). Let i(x) = -2x2. Give n(i(f)). -1712f*2 Let k(v) = 2v - 2. Let n(w) be the third derivative of -11w4/24 - 1885w*2. Calculate n(k(c)). -22c + 22 Let o(n) = -29n. Let f(j) = -34j*2 - 3j - 112. Let h(c) = 34c2 + 3c + 168. Let g(p) = -3f(p) - 2h(p). Determine g(o(t)). 28594t2 - 87t Let f(w) be the first derivative of w6/120 - w3/3 + 14w - 180. Let l(q) be the third derivative of f(q). Let y(a) = 63a. Give y(l(s)). 189s2 Let v(o) = -2 + 2 - 2o*2. Let x(a) = 19a + 947. Let i(d) = -22d - 1105. Let l(y) = 6i(y) + 7x(y). Determine v(l(u)). -2u*2 + 4u - 2 Let l(g) = 3g. Let m(c) = 2306735c*2. Calculate m(l(n)). 20760615n*2 Let y(r) = 2r*2. Let n be (3/(-9))/((-2)/174). Let w(i) = 57i + ni + 11i. Calculate y(w(b)). 18818b2 Let l(p) = 31p. Let x(a) be the third derivative of 0a4 + 0a3 - a2 - 1/15a5 + 0a - 54. Give l(x(w)). -124w2 Suppose -94v - 110v = -195v. Let y(q) be the third derivative of 0q4 + vq*3 - 1/20q*5 + 0 - 18q*2 + 0q. Let o(b) = -9b2. Determine o(y(a)). -81a*4 Let q(x) = x - 189. Let u(m) = 25m*2 + 31m. Determine q(u(k)). 25k2 + 31k - 189 Let l(z) = 4z2. Let q(t) = 5807t*2 - 2t + 20. Give q(l(i)). 92912i4 - 8i*2 + 20 Suppose 0 = -13c + 25 - 64. Let a(x) = 13x2 + 5x. Let k(w) = 12w2 + 4w. Let q(o) = ck(o) + 2a(o). Let l(b) = b. What is q(l(y))? -10y2 - 2y Let i(c) = 35c. Let d(w) = -504153w*2. Determine i(d(o)). -17645355o*2 Let r(o) be the second derivative of 3o*4/2 + 19952o + 4. Let a(g) be the second derivative of 0g2 - 1/3g*3 + 2g + 0. Determine r(a(f)). 72f2 Let u = 47 - 27. Let z(h) = -uh - 27h + 48h. Let g(f) = 8f - 2. Let w(y) = 8y - 3. Let r(o) = -3g(o) + 2w(o). Calculate z(r(k)). -8k Let j(b) = b2. Let x(c) = 4c*2 - 3c + 11248613. Give x(j(t)). 4t4 - 3t2 + 11248613 Let c(f) = f2 + 5f - 3. Let q be c(-6). Let o(a) = -a - qa + 3a. Let w(i) = 38i + 35. Let n(d) = 27d + 25. Let u(p) = 7n(p) - 5w(p). Calculate o(u(v)). v Let o(y) be the first derivative of -64y*3/3 - 10. Let c(s) = 6s*2 - 14s*2 + 6s*2. Determine c(o(z)). -8192z*4 Let a(t) = 1207t. Let i(s) = 12404s2. What is a(i(n))? 14971628n*2 Let f(c) = 1383970c. Let a(y) = -149y2. Calculate a(f(d)). -285390571174100d*2 Suppose 3b + 8b = 1133. Let y(q) = 46q*2 - bq*2 + 0q + 0q. Let k(v) = -5v*2. Determine y(k(c)). -1425c*4 Let c(t) = -28t2 - 3. Let l(s) be the first derivative of s3 - s*2 - 74. Let o(p) = 17p*2 - 11p. Let y(m) = -22l(m) + 4o(m). Calculate y(c(f)). 1568f4 + 336f*2 + 18 Let r(h) = -1101h - 1826h + 82h. Let d(n) = -2n2. Calculate d(r(y)). -16188050y*2 Let a(v) = 8v. Suppose -9r - 3s = -8r - 35, 0 = 5r + 3s - 79. Let l(k) be the second derivative of r + 3/2k*3 + k + 0k*2. Give l(a(t)). 72t Let s(b) = -6b2 - b2 + 4b*2. Let d = 108 - 105. Let k(m) = dm + 205 - 205. Calculate k(s(g)). -9g2 Let l(p) = -14p. Let n(h) = -3323h + 1592h + 1634h. Calculate n(l(m)). 1358m Let c(k) = -292k + 876. Let b(s) = -30s + 88. Let g(l) = -39b(l) + 4c(l). Let f(q) be the third derivative of q*4/24 + 5q*2. Calculate g(f(m)). 2m + 72 Let y(n) = 8n2 + 36n. Let q(b) = -5725b. Determine q(y(u)). -45800u*2 - 206100u Let j(q) = q*2 - 6752099. Let l(f) = 2f*2. Calculate j(l(y)). 4y*4 - 6752099 Let u(m) = 17m*2 + 3 + 28m*2 + 44m*2 - 68m*2. Let x(k) = 26k*2. Give u(x(s)). 14196s*4 + 3 Let k(c) = 195127c. Let x(a) = 26a2 + 1. Calculate x(k(i)). 989938199354i*2 + 1 Let k(m) = 2m*2 - 2m*2 - 2m*2. Let p(l) be the second derivative of 31l*4/12 - l - 15019. Give p(k(i)). 124i*4 Let s be (0 - 0)/(-1 - -4) + 188. Let t(r) = -186r - 1 + 1 + sr. Let y(p) = p - 9p - 3p. Give t(y(c)). -22c Let n(h) be the first derivative of 14h3/3 - 1479. Let u(p) = 206p. Determine n(u(v)). 594104v2 Let q(v) be the first derivative of -v2/2 + 4107. Let j(u) be the first derivative of 2 + 8/3u*3 + 0u*2 + 0u. Calculate q(j(l)). -8l2 Let z(u) be the first derivative of u3 - 164. Let t(s) = -8s + 33. Calculate t(z(v)). -24v2 + 33 Let c(b) = 31b. Let r(f) = -f*2 - 143. What is c(r(x))? -31x*2 - 4433 Let y be 2(-1 - -2818) + -3. Let t(s) = -5625s - 1 + ys + 1. Let w(n) = -7n2 + 21n. Let m(d) = 2d2 - 5d. Let x(h) = -21m(h) - 5w(h). Give t(x(o)). -42o2 Let u(q) = 2966 - 1463 - 22q - 1503. Let o(z) = -6z2 - 3. Calculate o(u(g)). -2904g*2 - 3 Let u = -107 + 121. Let v(c) = uc - 5c + 4c*2 - 9c + 27c2. Let p(o) = 2o. Give p(v(n)). 62n2 Let g(d) be the third derivative of -19d5/60 + d2. Let b(i) = 85950i2 + 85950i*2 - 257849i*2 + 85945i*2. Determine g(b(s)). -304s*4 Let h(b) be the first derivative of 5b*4/12 - 5b + 34. Let f(g) be the first derivative of h(g). Let z(w) = 7w2. Give z(f(n)). 175n*4 Let s(x) = -3x*2. Let a(b) = -11b - b*2 + 2 + 5b + 2b - 4. Let n(o) = -2o - 1. Let h(u) = 2a(u) - 4n(u). Give h(s(g)). -18g4 Let a(i) be the second derivative of -11i*3/6 - 17i. Let t(c) be the third deriva	{ "pile_set_name": "DM Mathematics" }
culate the highest common factor of 76058 and 1819. 17 Calculate the highest common factor of 11 and 12573. 11 What is the highest common divisor of 77 and 1981? 7 Calculate the greatest common factor of 316 and 99382. 158 What is the highest common factor of 100949 and 87? 29 What is the highest common factor of 182249 and 31? 31 Calculate the highest common factor of 84 and 606312. 84 Calculate the highest common factor of 28 and 25466. 14 Calculate the greatest common divisor of 44240 and 23800. 280 Calculate the greatest common factor of 811 and 43. 1 What is the highest common factor of 4341241 and 127? 127 What is the highest common divisor of 231 and 13552? 77 Calculate the greatest common factor of 364 and 38428. 52 Calculate the greatest common divisor of 83968 and 200. 8 Calculate the greatest common factor of 68784 and 6. 6 What is the highest common factor of 25440 and 192? 96 What is the greatest common factor of 6130 and 1318? 2 Calculate the highest common divisor of 26644 and 12. 4 What is the highest common factor of 117 and 205283? 13 What is the greatest common factor of 1836 and 10? 2 Calculate the highest common factor of 52 and 2842684. 52 Calculate the highest common divisor of 120 and 4880. 40 What is the highest common factor of 776100 and 15? 15 Calculate the greatest common factor of 632 and 115972. 316 Calculate the highest common factor of 78 and 4694. 2 Calculate the greatest common factor of 120987 and 54. 27 Calculate the highest common factor of 212 and 1014. 2 Calculate the greatest common divisor of 1652 and 10266. 118 Calculate the greatest common factor of 52810 and 70. 10 Calculate the greatest common divisor of 8 and 3936. 8 What is the greatest common factor of 3184 and 64656? 16 Calculate the highest common factor of 48262 and 236. 118 Calculate the greatest common factor of 10323175 and 1957. 1957 Calculate the greatest common factor of 34 and 145180. 34 What is the highest common factor of 7051 and 77? 11 What is the highest common factor of 1160557 and 23? 23 Calculate the highest common divisor of 232097 and 155. 31 What is the highest common divisor of 54557 and 11647? 613 What is the highest common divisor of 141612 and 24? 12 What is the greatest common divisor of 286 and 245245? 143 Calculate the greatest common divisor of 2400 and 11448. 24 What is the greatest common factor of 6 and 799830? 6 Calculate the greatest common divisor of 70468 and 58426. 446 What is the greatest common divisor of 242747 and 1? 1 Calculate the highest common factor of 22876 and 252. 28 Calculate the greatest common divisor of 13101 and 4. 1 Calculate the highest common factor of 1192 and 40. 8 Calculate the highest common divisor of 130 and 111605. 65 Calculate the greatest common divisor of 258977 and 1. 1 What is the highest common divisor of 416344 and 8063? 733 Calculate the greatest common factor of 519 and 6958925. 173 What is the greatest common factor of 48849 and 304? 19 What is the highest common divisor of 12939 and 38363? 227 What is the greatest common factor of 368 and 26588? 92 Calculate the greatest common divisor of 11322 and 1554. 222 What is the greatest common factor of 77 and 471383? 11 Calculate the highest common divisor of 2630 and 292193. 263 Calculate the greatest common divisor of 142 and 951755. 71 Calculate the highest common divisor of 126 and 77406. 42 Calculate the greatest common divisor of 2343 and 87543. 213 What is the highest common divisor of 101500 and 672? 28 Calculate the greatest common divisor of 136242 and 810. 162 Calculate the highest common factor of 926 and 2342780. 926 Calculate the highest common divisor of 123 and 1280553. 123 What is the highest common factor of 28 and 252? 28 Calculate the highest common factor of 183 and 4087. 61 What is the highest common divisor of 3120 and 443820? 780 What is the highest common factor of 60808 and 16? 8 What is the highest common divisor of 1749 and 69006? 159 Calculate the greatest common factor of 20970 and 855. 45 What is the highest common factor of 588 and 11364? 12 Calculate the highest common factor of 9707 and 10278. 571 What is the highest common divisor of 29136 and 48? 48 Calculate the highest common factor of 349255 and 115. 115 What is the greatest common divisor of 2656 and 92944? 16 Calculate the greatest common divisor of 100573 and 11. 11 What is the greatest common divisor of 15265 and 262730? 215 Calculate the highest common divisor of 103071 and 645. 129 Calculate the greatest common divisor of 194128 and 16. 16 Calculate the greatest common divisor of 470 and 18142. 94 What is the greatest common factor of 170 and 2563685? 85 Calculate the highest common factor of 13817 and 41. 41 What is the greatest common divisor of 446 and 1961062? 446 Calculate the greatest common divisor of 46620 and 135450. 630 What is the highest common factor of 12544 and 82712? 392 What is the greatest common divisor of 1946 and 24742? 278 What is the highest common divisor of 1960809 and 921? 921 Calculate the highest common factor of 25897 and 65569. 551 What is the greatest common divisor of 17160 and 696? 24 What is the greatest common factor of 12802 and 1591? 37 Calculate the highest common divisor of 75241 and 2479. 67 What is the greatest common divisor of 12971 and 57225? 763 What is the greatest common divisor of 14 and 42791? 7 Calculate the greatest common factor of 116625 and 2825. 25 What is the highest common divisor of 651864 and 384? 24 Calculate the greatest common divisor of 1280 and 240. 80 Calculate the highest common divisor of 72303 and 132. 33 What is the highest common factor of 64248 and 36? 12 What is the greatest common divisor of 134 and 34907? 67 What is the greatest common divisor of 668798 and 130? 26 What is the greatest common factor of 15322 and 470? 94 Calculate the greatest common factor of 464 and 124816. 464 What is the highest common factor of 42154 and 70? 14 What is the highest common factor of 5239 and 8897? 31 Calculate the highest common factor of 195 and 5109. 39 Calculate the highest common factor of 3621 and 28045. 71 Calculate the highest common factor of 1290 and 8550. 30 What is the greatest common divisor of 589535 and 2253? 751 What is the highest common divisor of 27974 and 2364? 394 Calculate the highest common factor of 6192 and 13287. 129 Calculate the highest common divisor of 14 and 45185. 7 What is the greatest common divisor of 20 and 13136360? 20 Calculate the highest common divisor of 28 and 42546. 14 What is the highest common divisor of 16 and 6604656? 16 Calculate the highest common divisor of 95091 and 174. 87 Calculate the greatest common factor of 9 and 27531. 9 Calculate the greatest common divisor of 58282 and 4416. 46 Calculate the greatest common divisor of 126209 and 61. 61 Calculate the highest common factor of 178592 and 768. 32 What is the highest common factor of 2116 and 4? 4 What is the highest common factor of 76336 and 6344? 104 What is the greatest common divisor of 28083 and 2035? 407 What is the greatest common divisor of 423 and 50948? 47 Calculate the greatest common divisor of 174 and 1598248. 58 Calculate the greatest common factor of 363460 and 8. 4 What is the highest common factor of 19500 and 2444? 52 What is the highest common factor of 1081 and 1034? 47 What is the highest common factor of 301 and 1694028? 301 What is the highest common factor of 25488 and 48? 48 What is the highest common divisor of 52 and 108966? 26 Calculate the highest common factor of 60 and 136140. 60 Calculate the highest common factor of 149299 and 18986. 863 What is the greatest common divisor of 619251 and 3171? 453 What is the greatest common factor of 886 and 240549? 443 What is the highest common factor of 13098 and 2886? 222 Calculate the highest common factor of 2156 and 4292. 4 Calculate the greatest common divisor of 8 and 1653208. 8 What is the highest common factor of 263424 and 2240? 448 Calculate the highest common divisor of 78 and 664044. 6 Calculate the greatest common divisor of 3717 and 7551. 9 Calculate the greatest common divisor of 4488 and 71368. 88 Calculate the highest common divisor of 25628 and 1892. 172 What is the greatest common	{ "pile_set_name": "DM Mathematics" }
? False Is 41379 a multiple of 12? False Is 10 a factor of 5646240? True Does 4 divide 29555? False Is 1436330 a multiple of 710? True Does 67 divide 100802? False Is 302095 a multiple of 31? True Is 239148 a multiple of 364? True Is 66 a factor of 340705? False Is 4 a factor of 57000? True Is 122259 a multiple of 249? True Is 2549652 a multiple of 26? False Does 152 divide 525702? False Is 166 a factor of 244020? True Is 7084881 a multiple of 477? True Is 246100 a multiple of 50? True Is 43 a factor of 2457189? False Is 107 a factor of 54463? True Is 321270 a multiple of 15? True Is 16 a factor of 205456? True Is 19 a factor of 183540? True Is 15 a factor of 717405? True Is 711 a factor of 344124? True Is 11 a factor of 1282337? False Is 11179334 a multiple of 22? False Is 12890654 a multiple of 352? False Does 254 divide 8816? False Is 73 a factor of 196154? False Is 15637 a multiple of 10? False Is 1088725 a multiple of 275? True Does 160 divide 688640? True Is 16511 even? False Is 108801 a multiple of 77? True Is 715280 a multiple of 20? True Does 9 divide 317214? True Does 13 divide 210177? False Is 85 a factor of 1945140? True Is 3253739 a multiple of 674? False Is 8 a factor of 525104? True Is 102 a factor of 664938? True Is 616 a factor of 795483? False Does 721 divide 205588? False Does 859 divide 570914? False Does 18 divide 132570? True Is 340255 a multiple of 17? True Is 32 a factor of 1363040? True Is 96968 a multiple of 391? True Is 776179 a multiple of 41? False Does 6 divide 1355580? True Is 305 a factor of 711870? True Does 355 divide 445880? True Is 11 a factor of 58443? True Is 105 a factor of 205905? True Is 26 a factor of 206011? False Does 5 divide 533919? False Is 6996612 a multiple of 8? False Does 91 divide 291543? False Is 156974 a multiple of 16? False Is 2344320 a multiple of 407? True Does 61 divide 29307? False Is 731 a factor of 1551182? True Is 120 a factor of 124973? False Is 15235779 a multiple of 86? False Is 312881 a multiple of 29? True Is 13 a factor of 1708285? False Is 191373 a multiple of 91? True Does 19 divide 463139? False Is 9339750 a multiple of 630? True Is 58 a factor of 106188? False Is 144 a factor of 240912? True Is 22 a factor of 826703? False Is 840573 a multiple of 50? False Does 33 divide 69657? False Is 1806018 a multiple of 15? False Is 22 a factor of 197852? False Does 4 divide 1217732? True Is 4980969 a multiple of 21? True Does 203 divide 420074? False Is 332757 a multiple of 11? False Is 204895 a multiple of 134? False Does 344 divide 1073280? True Is 1947 a factor of 2340294? True Is 35748 a multiple of 27? True Is 6 a factor of 37890? True Does 97 divide 232315? True Does 26 divide 132302? False Is 21 a factor of 928578? True Is 789184 a multiple of 118? True Does 56 divide 540149? False Is 49 a factor of 997770? False Does 3 divide 1139? False Does 29 divide 5593686? False Does 776 divide 4472864? True Is 4 a factor of 21357? False Is 1356790 a multiple of 19? True Is 15 a factor of 167985? True Does 13 divide 2214? False Is 9 a factor of 31469373? True Is 393468 a multiple of 640? False Does 141 divide 1878347? False Is 2435 a multiple of 194? False Is 399382 a multiple of 156? False Is 771429 a multiple of 1242? False Does 60 divide 618763? False Is 2152690 a multiple of 305? True Is 4588801 a multiple of 1203? False Is 92 a factor of 630864? False Does 13 divide 3143755? False Does 48 divide 173163? False Does 43 divide 12761841? True Does 309 divide 2205959? False Is 321706 a multiple of 22? True Does 39 divide 170688? False Is 3 a factor of 2478465? True Is 70783 a multiple of 16? False Does 179 divide 847744? True Does 322 divide 1630464? False Is 384308 a multiple of 116? True Is 10 a factor of 389270? True Does 18 divide 319356? True Does 104 divide 130892? False Does 8 divide 658192? True Does 95 divide 12737125? True Is 46 a factor of 97704? True Is 10 a factor of 4036590? True Is 7275471 a multiple of 1092? False Does 164 divide 217956? True Does 126 divide 192906? True Does 72 divide 62272? False Is 79739 a multiple of 7? False Is 31 a factor of 79259? False Is 5817468 a multiple of 34? True Does 13 divide 10481866? False Does 139 divide 18127306? False Is 12 a factor of 15300? True Is 2389539 a multiple of 69? True Does 38 divide 321077? False Is 2901749 a multiple of 997? False Is 27 a factor of 4307472? True Is 364658 a multiple of 21? False Is 47583 a multiple of 6? False Does 6 divide 137684? False Is 20 a factor of 225000? True Is 195384 a multiple of 14? True Is 431702 a multiple of 730? False Is 75 a factor of 75254? False Does 24 divide 10824? True Does 9 divide 144481? False Is 48114 a multiple of 81? True Does 33 divide 511222? False Is 546 a factor of 513239? False Is 282823 a multiple of 351? False Does 3 divide 3711? True Does 36 divide 11056058? False Is 1395786 a multiple of 14? True Is 423943 a multiple of 15? False Is 417131 a multiple of 331? False Is 17501 a multiple of 11? True Does 150 divide 3564315? False Does 5 divide 22156? False Is 124005 a multiple of 35? True Does 45 divide 654924? False Is 130468 a multiple of 193? True Does 13 divide 192264? False Is 41 a factor of 272960? False Is 10 a factor of 209188? False Is 49 a factor of 128331? True Does 100 divide 344000? True Is 25 a factor of 485173? False Is 7 a factor of 1099224? True Is 1266019 a multiple of 2? False Is 555 a factor of 8805630? True Does 78 divide 4135326? True Is 362142 a multiple of 22? True Is 36 a factor of 151992? True Is 8560 a multiple of 164? False Is 24639 a multiple of 65? False Is 1783122 a multiple of 44? False Does 252 divide 1417596? False Is 215947 a multiple of 229? True Does 13 divide 45720107? False Does 269 divide 626622? False Is 239544 a multiple of 24? True Is 531 a factor of 102717? False Does 33 divide 26023? False Is 1501550 a multiple of 19? False Is 852 a factor of 4055784? False Does 13 divide 175569? False Does 361 divide 12207777? False Does 39 divide 24445590? True Is 6394215 a multiple of 15? True Does 219 divide 21681? True Is 3574160 a multiple of 4? True Is 9 a factor of 50841? True Is 3744 a multiple of 468? True Is 15 a factor of 24959? False Is 14 a factor of 700442? False Is 1338147 a multiple of 783? True Is 331265 a multiple of 10? False Is 110 a factor of 3790613? False Does 220 divide 49570? False Does 5 divide 13530? True Is 768 a factor of 15722496? True Is 197 a factor of 16465? False Is 22666012 a multiple of 38? True Is 529926 a multiple of 141? False Does 47 divide 288251? True Is 13 a factor of 400478? True Does 249 divide 591015? False Does 9 divide 55999? False Is 1264 a factor of 5887712? True Is 10995 a multiple of 15? True Is 114 a factor of 10298874? True Is 809 a factor of 871293? True Is 57447 a multiple of 90? False Is 1098120 a multiple of 30? True Is 5099621 a multiple of 1017? False Is 39 a factor of 3146130? True Does 177 divide 4313519? False Is 114 a factor of 517953? False Is 45 a factor of 109080? True Is 108 a factor of 5907481? False Does 64 divide 4641024? True Is 3 a factor of 8026? False Does 13 divide 201705? False Is 9 a factor of 2111831? False Is 123 a factor of 104647? False Does 216 divide 135432? True Is 17 a factor of 5489398? False Does 18 divide 39384? True Does 281 divide 1704546? True Does 21 divide 61680? False Is 71 a factor of 169873? False Does 230 divide 364090? True Does 183 divide 142522? False Does 10 divide 1950790? True Does 5 divide 202390? True Is 8 a factor of 644512? True Is 548278 a multiple of 152? False Is 619987 a multiple of 8? False Is 2133721 a multiple of 313? True Is 1797563 a multiple of 41? True Is 145 a factor of 496625? True Does 152 divide 1235304? True Is 3802545 a multiple of 239? False Is 219 a factor of 556419? False Does 52 divide 185588? True Is 3290908 a multiple of 172? False Is 135135 a multiple of 189? True Is 335 a factor of 64655? True Does 71 divide 492314? True Does 59 divide 29736? True Is 8 a factor of 1784850? False Does 14 divide 247851? False Is 437065 a multiple of 305? True Does 89 divide 66839? True Is 425 a factor of 89636? False Is 63 a factor of 1469312? False Is 64 a factor of 274376? False Is 11473 a multiple of 2? False Is 195 a fac	{ "pile_set_name": "DM Mathematics" }
))? -18f4 Let l(j) = -14j. Let p(r) = 4r2 - 4r*2 - 3r*2 + 5r*2. Determine p(l(w)). 392w*2 Suppose p - 2f = 10, 5p - 4f = -0p + 38. Let d(a) = -a2 + pa*2 + 0a2. Let x(o) be the first derivative of o2 - 18. What is x(d(m))? 10m2 Let v(o) = 7o - 6o + o. Let w(y) = 0y + 7y + y. What is w(v(t))? 16t Let c(h) = -26h. Let v(z) = 24z*2. Determine v(c(k)). 16224k*2 Let f(r) = -4167r*2. Let p(u) = -u. Determine p(f(n)). 4167n*2 Let v(a) = 5a*2. Let q(h) be the second derivative of 0h*2 - h + 1/6h*4 + 0h*3 + 0. What is v(q(g))? 20g*4 Let x(j) = -j. Let g be (3/(-2))/(3/(-8)). Let t be (-1)/(14/(-6) - -2). Let m(i) = -2i - ti + gi. Calculate m(x(q)). q Let a(c) = 2c. Let w(z) = 68z*2. Calculate a(w(t)). 136t*2 Let y(k) = 47 + 2k - 47. Let f(v) = 15v2 + 5v + 5. Let u(s) = -14s2 - 4s - 4. Let h(i) = -4f(i) - 5u(i). What is h(y(a))? 40a2 Let q(x) = -x2. Let j be 0 + -1 + 4 - 3 - -2. Let z(o) be the third derivative of 0 + 3o*j + 0o*3 + 0o*4 + 1/60o*5 + 0o. What is q(z(v))? -v*4 Let n(g) = 11g. Let u(t) = -1. Let y(d) = -d - 1. Let b(a) = -u(a) + y(a). What is n(b(z))? -11z Let m(o) = -112o*2. Let l(f) = 33f*2. Calculate m(l(y)). -121968y*4 Let l(r) = 2r*2 - 63r - 6. Let m(j) = -j*2. Determine l(m(p)). 2p*4 + 63p*2 - 6 Let m(q) = 6q*2. Let w(u) = 3u*2 + 6u*2 - 7u*2. Give w(m(k)). 72k*4 Let x(h) = -3h - 6. Let m(a) = 19a. Give m(x(y)). -57y - 114 Let n(c) = 2c. Let j(s) = 5s*2 + 2. Let k(y) = 85y*2 + 35. Let r(x) = 35j(x) - 2k(x). Calculate n(r(i)). 10i*2 Let t(j) = 2j*2. Let m(s) = 1539s*2 - 57s + 57. Let b(x) = -55x2 + 2x - 2. Let r(f) = -57b(f) - 2m(f). Give r(t(c)). 228c4 Let y(m) be the second derivative of -2m*3/3 - 3m. Let k(a) = a - 1. Let q(b) = -5b + 4. Let l(c) = -4k(c) - q(c). Calculate y(l(z)). -4z Let v = -6 - -9. Let s(b) = 3 - 3 - vb + 2b. Let z(i) = 3i*2. What is z(s(y))? 3y2 Let v(k) be the second derivative of k3/6 - k. Let x(l) = 9 + 2l2 - 9. Give x(v(p)). 2p*2 Let n(p) = 8p. Let z(y) = 8y. Determine n(z(c)). 64c Let j(a) be the first derivative of 1/24a4 - 1 - 1/2a*2 + 0a*3 + 0a. Let d(l) be the second derivative of j(l). Let x(o) = -2o. Calculate x(d(m)). -2m Let k(q) = -8q. Let o(z) = -2z*2 + 5z + 5. Suppose 0 = -14h + 10h - 4. Let c(p) = -p - 1. Let a(s) = ho(s) - 5c(s). Calculate a(k(l)). 128l2 Let q(n) = -5n. Let h(y) be the third derivative of y*4/24 + 3y*2. Calculate h(q(w)). -5w Let k(j) = -49j2. Let c(p) be the second derivative of -p4/4 - 18p + 2. Give k(c(l)). -441l4 Let d(j) = -7j*2 + 11j*2 - 5j*2. Let u(v) = v - 3. Let q(n) = -2. Let r(m) = -3q(m) + 2u(m). Calculate d(r(a)). -4a*2 Let i(u) = 30u2. Let a(k) = -k2 - 1. Determine a(i(h)). -900h4 - 1 Let n(b) = 3b*2. Let m(i) be the second derivative of -7i*4/12 - 4i. Give m(n(j)). -63j4 Let s = 0 + 2. Suppose -y = -2y + s. Let q(r) = r*y - 10r + 10r. Let h(o) = -o. Give h(q(a)). -a2 Let l(w) = 27w. Let q(b) = 36b. Calculate q(l(p)). 972p Let a(u) = -2u. Let g(d) be the first derivative of d6/360 + d3 + 2. Let i(f) be the third derivative of g(f). What is i(a(o))? 4o2 Let q(h) = -h2 + 4h. Let b(z) = 4z. What is q(b(f))? -16f2 + 16f Let a(q) = 845q2. Let g(x) = 2x. Give g(a(l)). 1690l2 Let b(l) = 2l*2. Let v(i) = 6i - 11. Let n(z) = z - 2. Let f(x) = x*3 - 7x*2 - 8x + 2. Let w be f(8). Let g(q) = wv(q) - 11n(q). Calculate g(b(c)). 2c2 Let x(v) = -2v. Let q be 1/(2/123). Let c(r) = r - 4r + qr. Determine c(x(b)). 2b Let p(y) be the second derivative of -y*4/4 + 19y. Let b(o) = -6o2. Determine b(p(m)). -54m*4 Let a(v) = 2v*2. Suppose -4n + 2n = 0. Suppose n = -i + 2. Let y(d) = -5 - 2d*i + 5. Calculate y(a(s)). -8s*4 Let b(y) = 43y + 38y - 82y. Let r(z) be the first derivative of 3z2/2 - 1. Determine r(b(p)). -3p Let v(s) be the second derivative of s*3/3 - s. Let y(r) be the second derivative of 0 + 0r*2 - 13r - 5/12r4 + 0r*3. Determine y(v(q)). -20q*2 Let q(x) = -7x*2 - 6x. Let l(j) = 20j2 + 17j. Let u(b) = -6l(b) - 17q(b). Let k(d) = -5d2 + 4739 + 2d*2 - 4739. Give k(u(f)). -3f4 Let i(w) be the third derivative of -w5/12 - 16w2. Let q(r) be the third derivative of r4/12 - r2. Give i(q(g)). -20g*2 Suppose 0 = 2h - 2x + 2, -2h + 6h = 5x - 7. Let i(u) = 5 + u*2 - hu2 - 5. Let r(k) = -k. Give i(r(f)). -f2 Let h(l) = l*2. Let q(p) = -2p*2 + 21p*2 + 2p*2 + 15p*2. Calculate h(q(v)). 1296v*4 Let f(b) be the second derivative of -7b*4/12 + 2b. Let r(v) = v - 1. Let x(z) = 2z - 1. Let g(j) = -r(j) + x(j). Give g(f(m)). -7m*2 Let u(d) be the second derivative of 0d*2 + 0 + 1/6d*3 - 3d. Let j(i) = 3i - 3. Let a(l) = -6l + 7. Let r(w) = -3a(w) - 7j(w). Determine r(u(v)). -3v Let t(q) = q2. Suppose -5m = -3l + 1 - 38, 0 = 5m - 5l - 45. Let u(g) = 5g - mg - 3g. Determine t(u(r)). 9r2 Let h(x) = 4x. Let a(l) = -30l + 1. Calculate a(h(n)). -120n + 1 Let f(d) = -5d2 + 2d*2 - 2 + 2. Let y(c) = -3c*2. What is f(y(v))? -27v*4 Let o(t) = 2t. Let f be 0/((-1)/1 + 0). Let l = f - -2. Let m(a) = -a*l + 3a2 - a2. What is m(o(r))? 4r2 Let r(j) be the first derivative of 3j*2/2 - 3. Let g(z) = 1 - 1 - z. Give r(g(n)). -3n Let y(g) = 2g2. Let x = -1 + 3. Let k(s) = s - xs - 4 + 2s + 2s. Let h(w) = -7w + 9. Let b(c) = -4h(c) - 9k(c). What is y(b(r))? 2r*2 Let o(b) be the first derivative of -2b*3 - 1. Let f(d) = 3d. Determine f(o(v)). -18v2 Let p(n) be the first derivative of n2 + 2. Let d = 2 - 0. Let a(z) = dz + 0z + 2z. Determine a(p(b)). 8b Let z(m) = -7m. Let h(y) = 4y2 + 996y - 996y. Calculate h(z(t)). 196t*2 Let x(o) = -17o. Let k(d) be the first derivative of -d*3/3 + 30. Calculate x(k(s)). 17s*2 Let y(s) = -4s + s + 2s. Let l be ((-6)/4)/(6/(-8)). Let v(p) = p + 6p - 6p - lp. Give v(y(a)). a Let u(d) = -d. Let s(t) = 35t2 + 4. Determine u(s(i)). -35i2 - 4 Let i(n) = -n2. Let l(s) = s - 3. Calculate l(i(u)). -u*2 - 3 Let s(d) = -11d*2 - 5. Let c(t) = 5t*2 + 2. Let f(w) = -5c(w) - 2s(w). Let z(h) = 2h*2. Determine z(f(i)). 18i4 Let q(n) = n2. Let a(g) = -3g2. Let w(i) = 2a(i) + 5q(i). Let c(p) = -17p*2. Give c(w(o)). -17o*4 Let z(w) = -9892w*2. Let x(t) = -2t*2. Calculate z(x(n)). -39568n*4 Let p(w) = 17w*2 + 36w*2 - 42w*2. Let s(o) = 2o. Give p(s(g)). 44g2 Let t(g) = -g. Let q(u) = 295u. Determine q(t(m)). -295m Let u(h) be the first derivative of 2h*3/3 + 57. Let l(a) = 85a*2. Give u(l(g)). 14450g*4 Let f(x) = 2x*2. Let y be 43/6 + 13. Suppose -3h = i + 4i - 15, 5i = -h + y. Let d(l) = -il + 0 + 0. Determine d(f(u)). -6u2 Let i(z) = -2z*2. Let f(a) = 4a*2. Let y(m) = -6f(m) - 14i(m). Let h(x) = -x2. Determine y(h(b)). 4b*4 Let p(v) = -2v*2. Let z(w) = 9w*2 + 5w + 5. Let y(j) = 5j2 + 3j + 3. Let b(i) = 5y(i) - 3z(i). What is p(b(n))? -8n4 Let r(g) = -2g*2 - g + 1. Let m be r(1). Let f be (-3)/6 - 5/m. Let j(i) = -2i*f + 3i*2 + 0i*2. Let q(p) = 2p*2. Calculate q(j(l)). 2l4 Let v(i) be the third derivative of -i4/8 + 3i2. Let p(y) = -y2. Give v(p(k)). 3k*2 Let o(s) = -5s*2 + 2. Let h(f) = 10f*2. Determine o(h(t)). -500t4 + 2 Let s(r) = r2. Let p be (-1)/6 - 4/(-24). Suppose p = 4t - 10 + 2. Let n(q) = 3q - tq + q. What is s(n(j))? 4j*2 Let p(u) = 2u + 3. Let g(x) = -15x - 20. Let i(k) = -3g(k) - 20p(k). Let l(w) = -w2. Calculate i(l(t)). -5t*2 Let k be 10/(-15) - (-10)/6. Let m(l) = l - 1. Let z(n) = 4n - 2. Let f(g) = kz(g) - 2m(g). Let y(b) = 4b. Calculate y(f(q)). 8q Let y(n) = 2n. Let g be 4/1 + (1 - -9). Let f(u) = 4u*2. Let w(h) = 12h*2. Let c(k) = gf(k) - 4w(k). Calculate c(y(l)). 32l*2 Let n(l) = -l. Let h(i) = 818i*2. What is h(n(q))? 818q*2 Let h(x) = 0x*2 + 4x2 - x2 - 2x + 2. Let i(j) = 4j*2 - 3j + 3. Let o(s) = -3h(s) + 2i(s). Let d(k) = -12k2. Give o(d(b)). -144b*4 Let y(r) = 193r. Let w(i) = 11i2 - i. Determine y(w(g)). 2123g*2 - 193g Let j(c) be the second derivative of	{ "pile_set_name": "DM Mathematics" }
with respect to y. 11 Let h(q) be the third derivative of q6/60 + q4/4 - 7q2. What is the second derivative of h(u) wrt u? 12u Let k(x) be the second derivative of x*8/2 + 13x*4/12 + 8x. What is the third derivative of k(o) wrt o? 3360o3 What is the third derivative of 362h - 362h - 35h*2 + 4h*2 + 6h*5 wrt h? 360h*2 Let z = -11 - -13. Let v(c) be the second derivative of -2c - 1/12c4 - 1/3c*3 + 0cz + 0. What is the second derivative of v(k) wrt k? -2 What is the third derivative of w5 - w*2 + 0w5 - w2 + 8w5 wrt w? 540w*2 Suppose 3 = 6n - 3n. Let f be n5 + 1 + -2. What is the second derivative of r - 3r - 2r*f + 0r wrt r? -24r2 Let a(n) be the first derivative of 3n*7/7 - 5n*3/3 - 4. What is the third derivative of a(k) wrt k? 360k*3 Let p(v) be the third derivative of 0v*4 + 0v + 0v3 - 1/60v*5 + 0 + 1/120v*6 - 5v*2. Find the third derivative of p(d) wrt d. 6 Let p(l) = 6l*4 + 2. Let w(f) = 25f*4 + 2f*2 - 2f*2 + 7. Suppose 19 - 3 = 8i. Let v(x) = iw(x) - 9p(x). Differentiate v(d) with respect to d. -16d3 Suppose 0t + 4t = 16. Find the first derivative of -nt + 2 + n - 2n*4 - n wrt n. -12n*3 Let y(w) be the first derivative of 0w*4 - 3 + 0w*5 + 4/3w*3 + 0w*2 + 0w + 5/7w7 + 0w*6. What is the third derivative of y(q) wrt q? 600q3 Let m(j) be the third derivative of j2 + 0j5 + 0j*6 + 0 + 0j*7 + 1/24j*4 - 1/336j*8 + 0j*3 + 0j. Find the second derivative of m(d) wrt d. -20d3 Let f = 7 + -5. What is the second derivative of -4k*2 + k + 4k*2 - fk*3 wrt k? -12k Let r(k) be the first derivative of 4k6/3 + 14k*2 - 22. Find the second derivative of r(g) wrt g. 160g*3 Let l(r) = -4r - 29. Let i(k) = k + 7. Let t(s) = -18i(s) - 4l(s). Find the first derivative of t(n) wrt n. -2 Let s be (-7)/21 + 26/60. Let w(f) be the second derivative of -2f - 1/6f*3 + sf*5 + 0f*4 + 0 + 0f*2. What is the second derivative of w(i) wrt i? 12i Find the first derivative of 43 + 2c - 30 + 8c wrt c. 10 Let f = -16 - -22. Find the second derivative of -5a + 8a - fa - 3a*4 wrt a. -36a*2 Let h(p) = 30p*2 + 3. Let t(v) = 59v*2 + 6. Let a(w) = -5h(w) + 3t(w). What is the derivative of a(y) wrt y? 54y Suppose -c - 6 = 5d, 0 = -5c + 4d + 13 + 15. Suppose -5z + 7 = g + g, 6 = 2g + cz. Find the first derivative of -4t + t + 3t*3 + 3t - g wrt t. 9t2 Let c(t) be the first derivative of -3 + 0t*2 + 0t*3 + t - 1/2t*4. What is the derivative of c(m) wrt m? -6m*2 Let a(i) be the first derivative of -9i*5/5 + 15i*2/2 + 3. What is the second derivative of a(h) wrt h? -108h*2 Let s = 2 + -1. Find the first derivative of s + 2n + 6 + 0n wrt n. 2 Let x be 14/3 + (-1)/(-3). Suppose -3 - x = -m + 2c, 5m - 4c - 22 = 0. What is the third derivative of 12f - 12f + 2f2 - mf*3 wrt f? -12 Let h(k) = k - 1. Let u be h(4). Find the second derivative of 6d*3 - 4d*3 + 6d - 8du wrt d. -36d Let o(x) be the first derivative of x7/840 + x4/12 + 4x3/3 - 1. Let l(k) be the third derivative of o(k). Find the first derivative of l(g) wrt g. 3g*2 Let c(r) = -3r + 7. Let h be c(5). Let v be (3/2)/((-6)/h). What is the derivative of 5g4 - g4 - vg*4 - 2 wrt g? 8g*3 What is the first derivative of 7 + 30p - 3p2 - 30p wrt p? -6p Let q(b) be the second derivative of 0b*3 - 1/4b*4 + 0 + 1/4b*5 + 4b + 0b2. What is the third derivative of q(y) wrt y? 30 Let u(z) be the second derivative of z7/6 - 7z*4/4 + 17z. Find the third derivative of u(f) wrt f. 420f2 Let y(o) = 3o3 - o2. Let m be y(1). Let p be 16/7 - (-4)/(-14). What is the second derivative of -mi - 4i*3 + 4i*3 - pi*4 wrt i? -24i*2 Let c(u) = -29u*2 - 4u - 11. Let l(v) = 30v2 + 5v + 10. Let j(d) = 5c(d) + 4l(d). What is the derivative of j(o) wrt o? -50o Let o(t) be the second derivative of -3t*8/28 + 7t*4/12 - 5t. What is the third derivative of o(b) wrt b? -720b3 Let m(v) be the first derivative of -11v*4/2 + 7v*2 + 12. Find the second derivative of m(j) wrt j. -132j Let r(w) be the second derivative of 0 - 2w + 1/5w*5 + 0w*2 - 1/6w*4 + 0w*3. Find the third derivative of r(s) wrt s. 24 Let d(g) be the first derivative of 2/3g*3 + 0g*2 - g - 2. Differentiate d(a) wrt a. 4a Find the second derivative of 78n3 - 3n - 21n5 + 75n*3 - 153n*3 wrt n. -420n*3 What is the first derivative of 72 + 5f - f - 51 wrt f? 4 Let h(t) be the third derivative of -t*8/168 + 2t*5/15 + 18t*2. What is the third derivative of h(x) wrt x? -120x*2 Let z(r) be the second derivative of -2r*6/5 + 21r*2/2 + 6r. Differentiate z(u) with respect to u. -48u3 Let o = 11 + -7. What is the third derivative of 3u*6 + 2u*6 + 0u*2 - 6u*6 + ou*2 wrt u? -120u3 Let i(b) be the second derivative of b4/4 + b*3/2 - 7b*2 + 9b - 1. Find the first derivative of i(f) wrt f. 6f + 3 Let k = -2 + 4. Let s be (2/3)/(k/12). Differentiate 2 - 3 + 0h + 3 + sh wrt h. 4 Find the second derivative of 2l*2 - 16l - 2l2 + 9l*4 - 12l*4 wrt l. -36l*2 Suppose -13 = -4t - 1. Let z(f) be the first derivative of 1 - f*2 + 4f*3 - 2 - 5ft. Find the second derivative of z(j) wrt j. -6 Let g(c) be the first derivative of c7/14 - c*4/4 + 3c - 2. Let r(z) be the first derivative of g(z). Find the third derivative of r(o) wrt o. 180o2 Let j(v) = v - 13. Let d(b) = -6. Let q = -17 - -10. Let o(k) = qd(k) + 3j(k). What is the derivative of o(y) wrt y? 3 Let m(b) = b - 5. Let x be m(5). Let o(t) be the second derivative of -1/2t*2 + x + t + 1/6t*3. Find the first derivative of o(k) wrt k. 1 Let p = -27 - -22. Let z(i) = 14i4 + i2 - 5. Let a(x) = 15x4 - 6. Let j(t) = pa(t) + 6z(t). What is the third derivative of j(u) wrt u? 216u Let j(v) be the third derivative of -v*6/20 + 5v*3/6 + 2v*2. What is the derivative of j(w) wrt w? -18w*2 Let a be (-16)/(-10) - 20/(-50). Suppose 3x = 2x + a. Find the third derivative of -3w + 2w - wx - 4w*4 + w wrt w. -96w Suppose 0 = 3b - 6. Find the third derivative of 3q4 - qb + 3q2 - q2 wrt q. 72q Let m(a) be the second derivative of 22a6/15 - 8a*3/3 + 33a. Find the second derivative of m(n) wrt n. 528n2 Let j be (5/(-3))/(4/(-24)). Suppose 0 = 3t + 1 - j. Find the first derivative of 4 - 3 - tk3 + 0 wrt k. -9k*2 Find the first derivative of 15b - 19 + 0b + 1 - 14 wrt b. 15 Let w(r) = 6r*4 + 6r*2 - 7r + 6. Let x(d) = -d*2 - d - 1. Let k(t) = -w(t) - 6x(t). Find the second derivative of k(q) wrt q. -72q2 Let n(j) = -28j*3 - 7j*2 - 7j + 33. Let d(r) = -9r3 - 2r*2 - 2r + 11. Let f(p) = 14d(p) - 4n(p). Differentiate f(i) wrt i. -42i2 Let u(j) be the second derivative of 3j*5/10 + 2j*3/3 + 28j. Find the second derivative of u(o) wrt o. 36o Let x(p) = 10p + 25. Let d(q) = 2q + 5. Let l(y) = -11d(y) + 2x(y). Differentiate l(c) with respect to c. -2 Let v(k) be the second derivative of 0k*4 + 0k*5 - 3k + 0k3 + 7/30k*6 - 1/2k*2 + 0. What is the derivative of v(g) wrt g? 28g*3 Let u(r) = 7r*2 - 6r - 2. Let j = -7 - -12. Let h(o) = -15o2 + 13o + 5. Let g(y) = ju(y) + 2h(y). What is the second derivative of g(p) wrt p? 10 Let o(x) = -x3 + x2 - x - 1. Let q(r) = -4r3 - 28r*2 - 3r - 4. Let i(y) = -3o(y) + q(y). What is the third derivative of i(f) wrt f? -6 Find the third derivative of 2x*2 - 4x*2 - 8x*2 + 2x*6 wrt x. 240x*3 Let v(q) = 2q*2 + 4 - 14 + 8 - 7q*4 + 2q. Let b(i) = i - 1. Let x(m) = 2b(m) - v(m). Find the third derivative of x(n) wrt n. 168n Let m(f) = -3f2 + 4. Let p(n) be the third derivative of n5/20 - n3/2 + n2. Let a(g) = 2m(g) + 3p(g). Differentiate a(i) wrt i. 6i Let c(o) be the second derivative of 0o4 + o + 2/3o*3 + 0 + 1/30o*6 + 0o*2 + 0o*5. Find the second derivative of c(f) wrt f. 12f2 Let b(k) = -k3 + 3k2 + 20k - 3. Let y(d) = 3d3 - 7d*2 - 41d + 7. Let p(m) = -7b(m) - 3y(m). What is the second derivative of p(i) wrt i? -12i What is the second derivative of -30o*5 + 27o + 4o - o wrt o? -600o*3 Let k(t) = 19t - 8. Let b(	{ "pile_set_name": "DM Mathematics" }
hat comes next: -12918, -12919, -12920? -12921 What is next in -35, -24, 5, 58, 141, 260? 421 What comes next: 18, 123, 394, 915, 1770? 3043 What is the next term in 1021, 1018, 1015? 1012 What is the next term in 20, 45, 78, 119? 168 What is the next term in 102, 108, 118, 132, 150, 172, 198? 228 What is next in 2, 26, 82, 182, 338? 562 What comes next: -2603, -5205, -7807, -10409? -13011 What comes next: -29125, -29126, -29127, -29128? -29129 What is the next term in 1917, 3838, 5747, 7638, 9505, 11342, 13143? 14902 What is next in 17, 16, 5, -16, -47, -88, -139? -200 What is next in 25, 21, 13, 1, -15, -35? -59 What is the next term in 208, 300, 392, 484, 576? 668 What is next in -23, -29, -45, -77, -131, -213? -329 What is the next term in 207, 388, 577, 780, 1003? 1252 What comes next: 580, 1162, 1744? 2326 What is the next term in -120, -230, -342, -462, -596, -750, -930? -1142 What is next in 170, 340, 508, 674, 838, 1000? 1160 What comes next: 31, 65, 105, 151, 203? 261 What is the next term in -13, -77, -175, -301, -449, -613? -787 What is the next term in 11, 29, 47, 65, 83, 101? 119 What is next in 280, 593, 896, 1183, 1448, 1685, 1888? 2051 What comes next: 42673, 42684, 42707, 42748, 42813? 42908 What comes next: 39, 154, 345, 612, 955, 1374? 1869 What is the next term in 592, 593, 594? 595 What is the next term in -7, 14, 39, 68, 101, 138, 179? 224 What comes next: 575, 1149, 1723, 2297? 2871 What comes next: -307, -605, -889, -1153, -1391? -1597 What is the next term in -227, -303, -379? -455 What is the next term in 146, 323, 514, 725, 962, 1231, 1538, 1889? 2290 What comes next: 14, 22, 28, 26, 10, -26? -88 What is next in 1, 6, 11, 16, 21? 26 What comes next: 406, 806, 1206, 1606? 2006 What is the next term in 33, 41, 53, 69, 89, 113, 141? 173 What comes next: -2835, -2829, -2823, -2817, -2811, -2805? -2799 What comes next: -458, -914, -1370, -1826, -2282? -2738 What is the next term in 105, 112, 117, 120? 121 What comes next: 9, -13, -51, -105? -175 What is the next term in -5, -10, -19, -32, -49, -70? -95 What is the next term in -48, -45, -34, -9, 36, 107, 210, 351? 536 What comes next: 4, -3, -10, -17, -24? -31 What is next in 5, -4, -39, -112, -235, -420? -679 What comes next: -122, -482, -1080, -1916, -2990, -4302, -5852? -7640 What is the next term in 0, -13, -38, -81, -148, -245? -378 What comes next: 5566, 5572, 5580, 5590, 5602, 5616? 5632 What is next in -1053, -1064, -1077, -1092, -1109, -1128, -1149? -1172 What comes next: -2857, -2869, -2869, -2851, -2809? -2737 What is the next term in -105, -165, -227, -291, -357, -425, -495? -567 What is the next term in -125, -960, -3231, -7658, -14961, -25860, -41075, -61326? -87333 What comes next: 26, 66, 134, 230? 354 What is next in 138, 144, 154, 168, 186, 208? 234 What is the next term in 2317, 2316, 2325, 2350, 2397? 2472 What is the next term in -262, -502, -742? -982 What is the next term in 73, 51, 27, 1, -27, -57, -89? -123 What is next in -57, -78, -121, -192, -297, -442, -633, -876? -1177 What comes next: -22, -36, -38, -22, 18, 88, 194? 342 What is the next term in -63, -159, -287, -447? -639 What is next in 8, -1, -12, -19, -16? 3 What is the next term in 41, 131, 287, 515, 821, 1211? 1691 What is next in 79, 233, 491, 853, 1319, 1889? 2563 What is the next term in 5, 10, 27, 62, 121? 210 What comes next: -4497, -17967, -40425, -71877, -112329, -161787, -220257, -287745? -364257 What is next in -15, 31, 113, 237, 409? 635 What is next in 1101, 2197, 3297, 4401, 5509? 6621 What comes next: -127, -118, -97, -58, 5, 98, 227, 398? 617 What comes next: 1717, 1714, 1711, 1708, 1705? 1702 What comes next: -84, -154, -208, -240, -244, -214, -144? -28 What is the next term in -10, -63, -188, -415, -774, -1295, -2008? -2943 What is next in 1114, 1117, 1120, 1123, 1126, 1129? 1132 What comes next: 11, 21, 33, 47, 63, 81? 101 What is next in -1467, -2924, -4381, -5838, -7295? -8752 What is next in 29, 56, 81, 104, 125, 144, 161? 176 What is next in -121, -122, -131, -154, -197, -266, -367, -506? -689 What is next in -4415, -8830, -13245, -17660? -22075 What comes next: -13, 15, 81, 203, 399, 687, 1085? 1611 What is next in 61, 79, 97, 115, 133, 151? 169 What is the next term in 1, 15, 41, 79, 129, 191? 265 What is next in 37, 81, 125, 169, 213? 257 What is the next term in 37, 49, 85, 157, 277, 457, 709? 1045 What comes next: 32, 60, 86, 110, 132, 152, 170? 186 What is next in 259, 515, 769, 1021, 1271? 1519 What comes next: -333, -684, -1035? -1386 What is next in 16, 31, 44, 55, 64, 71, 76? 79 What is next in 1612, 1599, 1572, 1525, 1452, 1347, 1204, 1017? 780 What comes next: 663, 2665, 6003, 10677, 16687? 24033 What is next in -15, 7, 55, 141, 277? 475 What comes next: -35, -105, -175? -245 What is the next term in -35, -26, -11, 10? 37 What is next in 1464, 1460, 1456? 1452 What comes next: -1, -7, -23, -55, -109, -191? -307 What comes next: 34, 32, 32, 34, 38? 44 What is next in -557, -564, -575, -590? -609 What comes next: -1791, -1826, -1891, -1992, -2135, -2326? -2571 What is next in 76, 51, -14, -137, -336, -629? -1034 What is next in 34, 123, 302, 595, 1026, 1619, 2398? 3387 What is the next term in 19276, 38552, 57828, 77104? 96380 What comes next: 176, 193, 236, 317, 448? 641 What is the next term in -12, -20, -42, -84, -152, -252? -390 What is the next term in 50, 102, 158, 218, 282, 350? 422 What is the next term in -6677, -6673, -6669, -6665? -6661 What is next in 50, 73, 102, 131, 154, 165, 158, 127? 66 What comes next: -91, -96, -101? -106 What is next in -77, -50, 23, 166, 403, 758? 1255 What comes next: 781, 775, 771, 769? 769 What comes next: -120, -242, -360, -474, -584, -690? -792 What is the next term in 10, 22, 34, 46, 58? 70 What is next in 184, 166, 134, 82, 4, -106, -254, -446? -688 What is the next term in 4973, 4972, 4971, 4970, 4969, 4968? 4967 What comes next: 14, -47, -148, -289, -470, -691? -952 What is the next term in -17, -54, -115, -206, -333, -502? -719 What comes next: -2373, -4743, -7113? -9483 What comes next: 218, 211, 206, 203, 202? 203 What comes next: 16, 33, 50, 67, 84, 101? 118 What comes next: 1989, 1987, 1985, 1983, 1981? 1979 What comes next: -91, -155, -205, -235, -239, -211, -145? -35 What comes next: -4500, -4494, -4486, -4476, -4464, -4450? -4434 What is next in 162, 160, 156, 150? 142 What comes next: 445, 449, 453, 457? 461 What comes next: 20, 28, 22, 2, -32? -80 What is the next term in 205, 187, 157, 115, 61? -5 What comes next: 5526, 11047, 16568, 22089, 27610, 33131? 38652 What comes next: 75, 61, 47, 33, 19, 5? -9 What is the next term in 149, 297, 445, 593, 741, 889? 1037 What is next in 6511, 6512, 6511, 6508? 6503 What is the next term in -108, -214, -316, -414, -508? -598 What comes next: -68791, -68792, -68793? -68794 What is next in -45, -85, -125, -165? -205 What is next in 1551, 1556, 1563, 1572, 1583? 1596 What is next in -2, 1, 6, 13? 22 What is next in -24, -12, -10, -24, -60, -124? -222 What is next in 178, 176, 172, 166, 158, 148? 136 What is next in 2206, 4428, 6666, 8926, 11214, 13536, 15898? 18306 What is next in -58, -55, -54, -55? -58 What comes next: 59, 84, 113, 146? 183 What is next in 53, 48, 37, 20, -3, -32? -67 What comes next: -15, -17, -17, -15, -11, -5? 3 What comes next: -1608, -1607, -1606, -1605, -1604, -1603? -1602 What is next in 1, -15, -45, -89, -147? -219 What is next in 6, 14, 20, 18, 2, -34, -96? -190 What comes next: 1921, 1922, 1923, 1924, 1925? 1926 What is the next term in 469, 941, 1413? 1885 What comes next: -1061, -1059, -1057, -1055, -1053, -1051? -1049 What is next in 286, 1118, 2504, 4444? 6938 What is next in 545, 535, 509, 461, 385? 275 What comes next: 988, 978, 960, 934, 900, 858, 808? 750 What comes next: -399, -442, -471, -480, -463? -414 What comes next: 13, 6, -7, -26, -51, -82? -119 What comes next: -14, -14, -20, -38, -74, -134, -224, -350? -518 What is next in -65, -135, -205, -275, -345? -415 What comes next: 49, 181, 401, 709, 1105, 1589, 2161? 2821 What is the next term in -951, -968, -1009, -1086, -1211, -1396? -1653 What is the next term in -2028, -2024, -2018, -2010, -2000, -1988, -1974? -1958 What is next in 32, 61, 88, 113, 136, 157, 176?	{ "pile_set_name": "DM Mathematics" }
Is 20791816469 a composite number? True Is 9538733209 a composite number? True Is 2456939291 composite? True Is 21252971 prime? True Is 1913105447 composite? True Is 144376919 prime? False Is 27233873 composite? True Is 122816732095 prime? False Is 4202100923 composite? False Is 32221460753 composite? False Is 33467571421 a composite number? True Is 54665194183 composite? False Is 2101466207 composite? False Is 4647123277 composite? True Is 120749159 a composite number? False Is 861719297 prime? False Is 743322703 composite? False Is 3835876409 a prime number? False Is 10172090927 composite? False Is 382170812701 a prime number? True Is 1040259967 prime? False Is 6142198747 composite? True Is 1173902729 a composite number? False Is 745127347 prime? True Is 13621794059 a prime number? True Is 3330917783 a prime number? True Is 116952197 a prime number? False Is 21330228611 composite? False Is 398197529 composite? True Is 8838288817 a prime number? True Is 217353511 prime? False Is 2084310227 a prime number? True Is 319068239 prime? False Is 1502860907 prime? True Is 12598308161 a composite number? False Is 107554229 a composite number? True Is 17438192683 composite? True Is 14090399489 composite? False Is 764115691 composite? False Is 20396637785 a composite number? True Is 110555243 a prime number? False Is 1687841483 composite? False Is 8942203 composite? True Is 234892812137 a prime number? True Is 2418759631 a prime number? False Is 20060105623 composite? False Is 842369813 a composite number? False Is 2203350013 prime? True Is 20512960807 composite? False Is 2587061117 a prime number? True Is 2360485597 a composite number? False Is 5402225891 a composite number? False Is 3689462321 composite? False Is 84381506707 a composite number? False Is 3193748009 a prime number? False Is 78101287321 prime? False Is 3041599199 composite? True Is 3349577261 composite? False Is 86760851 prime? True Is 3814794077 composite? False Is 69769409 prime? True Is 8069726143 prime? True Is 1114998719 prime? False Is 28243195007 a prime number? False Is 120157441 prime? False Is 360326973337 a composite number? False Is 1797158333 prime? False Is 15857805727 composite? False Is 3613265827 composite? True Is 39974301613 a composite number? False Is 402382223 prime? True Is 4321443071 a composite number? True Is 99382951 prime? False Is 4570420537 prime? True Is 3106454539 composite? False Is 2786944943 a composite number? True Is 96196955 a composite number? True Is 27333659713 prime? False Is 4498355201 a composite number? True Is 739222469 prime? True Is 4397006773 prime? True Is 2566235423 a prime number? True Is 1712450287 composite? True Is 13637902513 a composite number? False Is 4827172159 a composite number? False Is 23993094641 prime? False Is 160147359583 a prime number? True Is 69045453989 prime? True Is 6969967379 a prime number? True Is 56914467089 prime? True Is 5458973899 composite? True Is 53336128319 a composite number? True Is 6229238441 prime? False Is 768861461 a prime number? False Is 467899277 a prime number? False Is 12330955029 composite? True Is 92945123669 a prime number? True Is 78491344901 composite? False Is 2815337249 composite? False Is 12508587037 prime? True Is 98112404729 prime? False Is 4760934119 composite? False Is 5664089647 prime? True Is 8499251671 a composite number? True Is 9023010693 composite? True Is 118721654411 composite? False Is 4065228703 a composite number? True Is 936977845 composite? True Is 17096787023 a prime number? True Is 6716311921 prime? False Is 9739187065 prime? False Is 497397767 a prime number? True Is 2158013227 prime? True Is 242018771 composite? True Is 130134157217 a prime number? False Is 58012391051 prime? False Is 18406319 a prime number? True Is 1750981273 prime? True Is 5614665799 prime? False Is 3348507971 a prime number? True Is 1745129467 a composite number? True Is 10484529127 prime? False Is 4987266749 composite? False Is 3651845731 prime? False Is 1758909013 a composite number? True Is 1307479373 prime? True Is 6828514543 prime? True Is 21651914131 a prime number? True Is 50321708681 a prime number? False Is 1315366763 a prime number? True Is 41621488561 prime? True Is 89639051 a prime number? False Is 10894073171 a composite number? False Is 2423217533 composite? True Is 105064901507 a prime number? True Is 4301885639 prime? True Is 6838295077 composite? False Is 2464210379 composite? False Is 220848959 a prime number? False Is 263919641 prime? False Is 651287699 prime? True Is 2142850403 prime? False Is 234352207 a composite number? False Is 8394493397 prime? True Is 2131594207 composite? True Is 335399594903 a prime number? True Is 727565889 prime? False Is 4314855151 composite? False Is 2020445671 composite? True Is 154338109 prime? False Is 14840570081 a prime number? True Is 2510588569 composite? True Is 905246359 composite? True Is 1618330121 prime? False Is 25852676549 prime? False Is 196268327639 a prime number? False Is 28363003121 a composite number? False Is 111092374433 a prime number? False Is 15533176019 composite? False Is 372948203 prime? True Is 16266202861 a composite number? True Is 329035253 composite? True Is 152530127 a prime number? False Is 40308283 prime? False Is 942033113 a prime number? False Is 8263964011 a composite number? False Is 180154869 a composite number? True Is 414813421 a prime number? False Is 356063797 prime? True Is 33524892613 prime? True Is 7430421907 a prime number? True Is 233173229 a prime number? False Is 1483075171 a composite number? True Is 2835601423 composite? False Is 10882492919 a prime number? False Is 10950900959 composite? True Is 220040594893 prime? False Is 386927509 composite? False Is 238001891 a prime number? False Is 58649702393 a composite number? False Is 1718902111 a composite number? True Is 8394678119 prime? True Is 375166481 prime? True Is 1150206347 a composite number? False Is 100158169927 composite? False Is 187027165547 a prime number? False Is 263442271 prime? False Is 15211783649 a composite number? True Is 1946998177 prime? False Is 2662139959 a prime number? False Is 79085719 a prime number? True Is 15379689463 prime? True Is 30715586339 prime? False Is 8219673937 a composite number? False Is 9924314203 composite? True Is 1188126029 composite? True Is 422405889241 prime? False Is 4423202507 composite? False Is 8742786079 composite? False Is 689197427 prime? True Is 1263272327 a composite number? False Is 303356953 a composite number? True Is 2856130861 a prime number? True Is 5109057769 composite? True Is 1492223651 a prime number? True Is 836458121 composite? False Is 353267099 a prime number? False Is 3532692991 a prime number? True Is 25019441911 composite? False Is 235167719 composite? False Is 2786458139 prime? True Is 618392657 composite? False Is 3041339687 a composite number? False Is 1056903971 a composite number? False Is 97009400213 prime? False Is 572356822 composite? True Is 115288898 a composite number? True Is 76069594297 a prime number? False Is 724466203 a prime number? False Is 7360853933 a composite number? True Is 230447731 prime? False Is 375799588753 a prime number? False Is 36688361 prime? False Is 45266395571 a prime number? False Is 470082479 a composite number? True Is 1686841901 a composite number? False Is 3200477741 composite? False Is 3453403583 prime? False Is 1318249039 prime? True Is 142458731537 prime? False Is 37406701 composite? True Is 181463879 prime? True Is 66268491341 prime? False Is 5094648719 prime? True Is 1769015161 a prime number? True Is 29632173715 a prime number? False Is 60040528337 a prime number? False Is 374238889 a composite number? False Is 1741104797 prime? False Is 289724569 a prime number? True Is 307061477 prime? False Is 22922589533 a prime number? True Is 38106153923 a composite number? True Is 149238153973 composite? True Is 16935828577 prime? False Is 3091936479 a prime number? False Is 28097722267 a composite number? False Is 563119481 composite? True Is 1805581889 composite? False Is 168262355 prime? False Is 80481211 prime? True Is 117758776279 a composite number? False Is 21795231743 a composite number? False Is 4976924587 a prime number	{ "pile_set_name": "DM Mathematics" }
late (34398/(-931))/26-19. 27 What is (-48)/(-5880)1-51? -2/49 Evaluate (513/(-540) + 1)/((0 - 4)/272). -17/5 Calculate 5/84536/(-1620). -7/4 What is the value of 29/(870/(-20))3(-10)/5? 4 What is (1/(-39))/((-48)/(-407 - 25))? -3/13 Calculate (-4)/12 + ((-15)/(-12))/((-63)/(-28)). 2/9 Evaluate 115/25 - (-4)/10. 5 Evaluate (124/8)/((-26)/52). -31 (((-78)/(-16))/13)/((-4)/(-96)) - -8 17 What is the value of (-44)/42 + 296/888? -5/7 What is the value of 25/(-90) - 33/(-66)? 2/9 (3270/(-480) - -8)-4 -19/4 246/(-61) + 264/8052 -4 What is the value of (-9)/(1701/(-159)) + -1 - 2/7? -4/9 Calculate (-6)/8 + 2 - (399/76)/3. -1/2 (-2)/9 + (-8 - (-11)/((-6138)/(-4552))) -2/31 What is (-1 + -1)12/24(9 + -22)? 13 What is the value of ((-342)/532)/(96/(-28))? 3/16 Evaluate (-6 - 117/(-26))(3 + -9) + 9. 18 What is the value of ((-4)/(-160)2)/(16/(-64))? -1/5 Evaluate 348/(-319) - (-196)/(-22). -10 What is the value of (-10)/14209/(-165) + 2/(-6)? 4/7 Calculate 68/(-72) + (-320)/24. -14 What is the value of -121/(-60) - 3/(4 + -1)? -4/5 Evaluate -1 + -4 + ((-81)/12 - -4 - -5). -11/4 Calculate 9/(45/100) + -13. 7 Calculate (903/(-63) - (-4 - -2))357/(-119). 37 Calculate -2 + (108 + 8)(36/208)/9. 3/13 What is the value of (-10)/20028 - (-32)/80? -1 Calculate ((-36)/(-10))/(5901/(-2810)). -12/7 What is the value of (-3710)/2756 + 2 + (-2)/4? 2/13 Calculate (-802)/62 - (-134)/(-2077). -13 (01/(-9) - -4)1/16 1/4 13 - (144/60 + 2/(-5)) 11 Evaluate 3536/(-10404) - (-4)/34. -2/9 What is the value of 62/8 - 120/(-96)? 9 Calculate (-1060 + 1061)(-5 - 2). -7 (-15)/(-10)(-6)/(-12)(-40)/6 -5 Calculate -6((-19)/9 + (-848)/(-1908)). 10 Calculate (5 - 60/25) + -1 + (-5 - -4). 3/5 -6285/225 - (-9 + 1) 2/5 Evaluate (-34)/4(-34)/(-153) - (-132 + 131). -8/9 Evaluate -2(2 - 3)27375/(-2190). -25 What is the value of ((-6)/(-6))/(122/(-2440))? -20 Calculate (-5)/((-1360)/16)(7 + -4). 3/17 What is 5510/570 - 30/3? -1/3 What is (0 + (-20)/14)/(5065/(-28364))? 8 ((-1)/2)/(1743/(-1162)) 1/3 What is (920/100)/23(-2 - (-22)/10)? 2/25 Calculate -2(2527/(-190) + 14). -7/5 (8 - (-78)/(-36)3)/((-9)/(-66)) 11 What is 1633/(-161) - (-5)/((-10)/(-18))? -8/7 (-9 + 0 - (12 - 43))(-1)/(-2) 11 What is the value of 24/30-1272/(-32)? 18/5 Evaluate ((6/24)/(15/228))/((-678)/1130). -19/3 Calculate ((-246)/1640)/((18/48)/((-6)/4)). 3/5 Calculate (-3)/((-291)/(-1550)) + (-1433 - -1449). 2/97 Evaluate 456/344(8 - (-1 + 3)) + -8. -2/43 (-41536)/6844 + 5 + 1 -2/29 What is -14 - -4 - (66 + -80)? 4 (-14(272/32 + -9))/((-10)/(-2)) 7/5 Calculate 1/((-21)/3 - ((-360)/32 - -4)). 4 Calculate 1(6 - (1 - (3 - 5))). 3 Evaluate -44 + 25 + 47 + -4. 24 (-2240)/380 - (-4)/(-38) -6 Evaluate 4 + -14 + 924/70. 16/5 (145/60 - (2 - 0))1152/1280 3/8 What is the value of (-7 - (-93)/9)(21/12 - 1)? 5/2 Evaluate 169/393 + 0. 13 What is the value of 6/9(8 + 2330/(-280))? -3/14 Calculate ((-4356)/(-264))/(10/(-20)). -33 (15/(-15))/((-6)/(-18)21/(-245)) 35 What is the value of (-4)/(-18)162/(-72)? -1/2 Evaluate (-340)/(-3570) - 16/(-273). 2/13 Calculate 3665/(-8796)((-32)/(-25) - 2). 3/10 ((-1650)/(-24))/5 - 13 3/4 What is the value of (((-2)/4)/(20/720))/(-3)? 6 What is 81/24(-24)/(-9)? 9 What is -13 - (7 - (11 - -30)) - (4 + 5)? 12 30/(27/12 + 10/(-40)) 15 Evaluate (28 + -31)/138-4. 2/23 Calculate (-27)/42651/93. -9/2 What is the value of (-6 - (9 + -12))(0 - (-102)/18)? -17 (-2645)/250 + 11 + (-2)/(-25) 1/2 -16 + (0 - (10/30 + (-14)/(-21))) -17 Calculate 54/48(-104)/39. -3 -37 - -35 - -4 - (-38)/(-2) -17 (2/5)/(40/75)2 3/2 What is ((-680)/(-80) + 2/(-1))/((-1)/(-2))? 13 What is (4968/1265 + -4)/(2 - (-11)/(-5))? 4/11 Calculate (-705)/(-1786) - (-6)/(-12). -2/19 Evaluate (-3)/(72/16)(-9)/30. 1/5 Evaluate (-255)/20 + 21 + -1 + -9. -7/4 What is the value of (2 + -5 - (7 + 32)/(-3))/6? 5/3 (-20)/((-320)/8)38 19 Calculate (-36046)/10050 + (-22)/(-6). 2/25 Evaluate (17/(340/(-8)))/(28/(-35)2). 1/4 ((-44)/55)/((1904/(-255))/14) 3/2 Calculate -22(-90)/(-1170)(-2)/413. 11 -4 + (735/350)/((-6)/(-10)) -1/2 Evaluate 18/(-8)16/42(-21 + 7). 12 Evaluate 7/(-42) + (-27)/(-243). -1/18 Evaluate -1((15 - -19) + -19). -15 Calculate (1225/119)/5 + (-1 - 4/4). 1/17 What is the value of ((-43)/43015/(-2))/(12/(-2))? -1/8 2/3(-447)/(-2980)(-20)/32 -1/16 Evaluate ((-10 - 8) + 5)-25/(-10). -13 What is the value of (13 + 36/(66/(-11)))-1? -7 (-3)/(27/(-171)) + -57/(-35) 20 What is the value of (20/12)/(75/630)? 14 What is the value of (-12)/352/1040? -1/5 What is the value of -4(-49)/28 + 5/(-5)? 6 Calculate 41 - (22 + 11) - (-1 + 210/23). -3/23 What is (33/99 + (-22)/(-6))27/(-12)? -9 Calculate 19/40 - 30/80. 1/10 Calculate (2/12)/((-2064)/576). -2/43 What is ((-10)/(-6) - 2)/((-375)/(-15) - 22)? -1/9 Evaluate 861/(-9471) + 65/(-11). -6 What is the value of (-9)/((-36)/(-14)) - (-55)/22? -1 Evaluate -5 + (-344)/(-32) - (12/4 - -2). 3/4 1025/(-82)(-66)/(-55) -15 What is the value of 8 + 177/(-12) - (-6)/1? -3/4 56/7 - (280/49 - -1) 9/7 Calculate (2/(-1))/2(684/84 - 8). -1/7 What is (1 - (-30)/(-39)) + (13101/351 - 37)? 5/9 What is 43168/(-2394) - 2/(-63)? -18 (-88)/(-616) - 312/1400 -2/25 (-46)/(-8) + (1 - (0 - -9 - 4)) 7/4 Evaluate 3/(-9(7/(-2) + 2242/708)). 1 (0 - 1)/((-18)/(-15 - -33)) 1 Calculate (-24)/(-660)-5 - (194/22 - -3). -12 What is (((-130)/70)/13)/((-45)/(-105))? -1/3 Calculate ((-12)/(-10))/((-84)/(-35)). 1/2 What is the value of (-2)/(-37) + (-18270)/2590? -7 What is 65/76 + (15000/74100 - 8/26)? 3/4 Evaluate (-56)/4(65/(-35) + 1). 12 What is the value of ((-1)/((-2)/1))/(2/2527)? 9 What is (9/99 + -1)(-11)/110? 1/11 -4 + 6 + -15 - 406/(-42) -10/3 ((-12 - (-19 - -10))(2 - 5))/1 9 Calculate (12 - -3)(680/60 + -11). 5 What is the value of 112/7 - -9 - -3(-5 + 6)? 28 What is (-65313)/(-11151) - 2/(-14)? 6 What is 17 - (0 - (-3 + 3))(-211)/422? 17 -42 + 10836/196 - 2/7 13 Evaluate ((-217)/(-682)-11)/(7/(-4)). 2 Calculate (3/6)/((-75)/903/45). -9 Evaluate 540/(-945) - (-27)/35. 1/5 Calculate 5/((-30)/64) - -6. -14/3 What is the value of 4 + (18 - 0) + (-15)/5? 19 What is the value of 2 - (226/20 - 10)(-10)/(-8)? 3/8 Calculate (-39 + 36)/(84/77) + 6/2. 1/4 15(5/5)/(-1) -15 Calculate 1 + (-48)/21 + 1 + (-6154)/22806. -5/9 ((-1502)/6759)/((-1)/(-2)) -4/9 Evaluate (-7 + 1)4/6 + 2. -2 Calculate (23 - 3) + (-6 - 4). 10 Calculate 360/(-42) + 24/42. -8 Calculate (2/(-8))/((-136)/(-340)). -5/8 What is (((-24)/6)/40)/((-1 + -1)/(-8))? -2/5 Evaluate (-192)/(-352) - (-111)/(-264). 1/8 What is the value of 77/735 - 3/((-252)/8)? 1/5 Evaluate (-437)/19 - 48/(-6). -15 What is the value of 41670/(-15279)(3/(-5))/3? 6/11 (-2)/42 + 1830/(-427) -13/3 What is (4/4)/(-3) + (-7285)/465? -16 6/2 + 201/18 + (-1209)/558 12 85(-36)/600 + (-18)/(-4) -3/5 Calculate 0 + 3 + (-651)/(-91) + (-4)/26. 10 Calculate (-8)/(-7) + 864/(-504). -4/7 What is ((-187)/(-154))/((-1)/(-14))? 17 Evaluate (14/(-20))/(224/(-128)) - 279/(-15). 19 What is the value of ((-50)/150)/((-120)/(-918) + (-1)/9)? -17 What is (((-40)/(-13))/((-244)/(-1586)))/(-2)? -10 Evaluate ((-15)/(-135)0)/(-2). 0 Calculate (2/(-12))/((-85)/(-102)). -1/5 Calculate 20/(-6)36/(-8)(-72)/(-180). 6 Calculate (2 - 2) + 18 + (-1928 - -1875). -35 What is the value of (-366)/(-244)44/(-6)? -11 Calculate ((-1)/(-8))/((((-1131)/26)/29)/1). -1/12 Evaluate (6 + 63/(-9))-91. 9 What is the value of -5(-6)/(-270)411/44? -1/9 Evaluate (-9000)/(-1200)(-1)/5. -3/2 What is (-528)/(-56) + (-279)/63 + 5? 10 Evaluate 81/84 - (0 + 3/21)7. -1/28 What is the value of (-330)/(-6105) - (-226)/(-74)? -3 Calculate -8(3 - 585/198). -4/11 Calculate -6 + 8 - (396/130 + 8/52). -6/5 What is 6 - 5 - (-12 + 1071/81)? -2/9 ((-615)/2337)/(25/10) -2/19 (4459/497 - 3) + 72/(-12) -2/71 What is the value of (1020/30)/(-340)(-1 + (-1)/4)? 1/8 Calculate (-4 + 3 - -1)/(0 - 12 - -9). 0 What is 3/30(-23 + 43) - (-5 - 3)? 10 What is (-51)/(-60) - 245/196? -2/5 Evaluate (-23 - 514/(-24)) + 4 + (-7)/4. 2/3 Evaluate (2 - -3)((-1698)/210 - (-7 - 1)). -3/7 Evaluate (2 - (4 - 10/(-2))) + 16. 9 What is 8848/1896(-6)/(-14)? 2 What is (150/(-72) - (-57)/76)/(8/54)? -9 Evaluate 12((-56)/(-12))/7. 8 What is (14/2 - -6)/1? 13 Calculate -1*(-105)/126 - 1/((-18)/(-105))	{ "pile_set_name": "DM Mathematics" }
r? (a) t (b) 4 (c) -3 a Let a = -0.09 - -7.49. Let f = 7 - a. Let t = f + 0.6. What is the closest to 1 in 4/9, 0, t? 4/9 Let v = 39.3 - 39. Which is the nearest to -2/27? (a) v (b) -0.1 (c) 5 b Let g = -0.52 - -0.08. Which is the closest to 2/3? (a) 0 (b) 3 (c) g a Let v = 102 + -106. Let n = 3 - 1. What is the closest to -3 in n, -0.3, v? v Let a = -0.09 + -3.31. Let u = a + 3. Let h = -0.6 - u. What is the closest to h in -2, 2, 2/13? 2/13 Let h be ((-2)/(-10))/(10/(-25)). Let v = 6.2 - 6. Which is the nearest to -1/3? (a) -1 (b) v (c) h c Let q = 0.1 + -0.1. Let u = 9 - 5. Let m = -1 + 2. Which is the closest to m? (a) u (b) 0.3 (c) q b Let p = 0 - 0. Let v = -5 - p. Let a be 2/8 + (-3)/(-20). What is the nearest to 0 in v, a, -4/7? a Suppose -5m + 9 = 4. Let a(v) = -2v*2 - 34v - 56. Let n be a(-15). What is the closest to m in n, -3, -4/5? -4/5 Let l = 4.2 + -0.2. Let q be (-2)/5872/(-28). Let t = 63/5 - q. Which is the nearest to -2/5? (a) l (b) t (c) -5 b Suppose 5x + 10 = -5l, l + 10 = -4l. Let o = 349/6 - 58. What is the closest to -1/5 in o, 1, x? x Let l = 76 - 305/4. What is the closest to 2 in l, 1/6, -0.3? 1/6 Let j = 2 - 2. Let n be (-4)/(-3)(-3)/(-2). Which is the nearest to -1? (a) j (b) n (c) -0.1 c Let u be 2/((-544)/(-220) - 2). Let s = 1356/1103 + -1359659/243763. Let x = s + u. Which is the nearest to -2? (a) -4 (b) -0.5 (c) x b Let p(v) = -v - 3. Let s be p(-4). Let y be -7 + s - (-4 - -1). What is the closest to 1 in -1, y, -2/11? -2/11 Suppose 0 = 3n - 4l + 16, 3n + 4l = 2n. Let x = 1 + -3. Let d = x + -1. Which is the nearest to 0? (a) d (b) n (c) 2/3 c Suppose -5l - 2h + 12 = 0, -3l - 3h + 7 + 2 = 0. Let s = -10 + 9.6. Which is the nearest to 1/3? (a) s (b) l (c) -5 a Let p = 56 + -56. Which is the nearest to p? (a) 2 (b) 0.6 (c) 0.4 c Let f = 3 - -9. Let z be (-9)/(-8)f/9. Let i = 1/3 + -1/2. What is the nearest to -2/3 in i, z, -0.4? -0.4 Let j = 0.2 + 0.3. Let i = 0.6 - j. Let o(z) = -z. Let v be o(3). Which is the nearest to i? (a) -0.1 (b) -0.2 (c) v a Let o = -5.1 + 5. What is the nearest to o in 4/9, -0.2, -2/19? -2/19 Let r = -14 - -14.5. Which is the closest to -1? (a) r (b) -3/8 (c) 0.09 b Let m be (14/35)/(2 - (-51)/(-30)). What is the closest to m in 0.2, 4, 3/5? 3/5 Suppose 5r + 15 = n + 2, 3n - 19 = 5r. Suppose 2v - 4 = nv. Let d = 0 - 0.2. Which is the closest to -1? (a) 3/2 (b) d (c) v b Let s = -17 + 139/8. Let m = 5.9 + 2.1. Let x = m + -6. Which is the nearest to 1? (a) 3 (b) s (c) x b Let h = 0.022 - -0.078. What is the nearest to -1/4 in 0.05, 4, h? 0.05 Let t = -13 + 13. What is the nearest to 0.4 in 0.1, t, -5? 0.1 Let j = -0.06 + -0.94. Let m = -2 - -1. Which is the closest to m? (a) -3/4 (b) 5 (c) j c Let b = -3 + 3.4. Let g = -18.8 + 16.8. Let i = -57 - -227/4. What is the closest to g in i, -2/3, b? -2/3 Let o = 3.6 - 0.6. Let t = -7/18 - 1/9. What is the nearest to o in 1/2, 0.4, t? 1/2 Suppose 0 = 2i - 10 + 22. Which is the nearest to -2/5? (a) 0.3 (b) i (c) 0.4 a Let q = 47/115 - -16163/690. Let m = q - 719/30. What is the closest to -0.1 in 1/6, 3, m? m Let f = -4 - -4. What is the nearest to -1 in -0.4, f, -3? -0.4 Let p = 183 + -181. What is the closest to 24 in -2, 3, p? 3 Let k be 4 + -8 + (-124)/(-30). Which is the nearest to k? (a) 0 (b) 0.3 (c) -0.2 a Let m = -0.7 - -1.2. What is the closest to 1 in m, 0.4, -3? m Let p = -33 + 33.1. What is the closest to p in 3, 0, -0.1? 0 Let s = 36 - 36.5. Which is the closest to -0.2? (a) 1/3 (b) s (c) -1 b Let s be -12/4-96. Let i be s/143 + (-6)/39. Which is the nearest to 0? (a) 1/4 (b) i (c) -2 b Let k = -12.5 - 1.5. Let g = k - -9. Let p be (1/3)/((-4)/(-6)). Which is the closest to p? (a) 3 (b) 2 (c) g b Let z = -40 - -161/4. Let g = 44 - 43.79. Let j = g - 0.01. Which is the nearest to -1? (a) -2/11 (b) z (c) j a Suppose 3h + 2h = 10. Which is the nearest to h? (a) -0.3 (b) 1 (c) 4 b Let i = 0.2 - 1.2. Which is the closest to 0.1? (a) i (b) 10 (c) 0.3 c Let v = -0.9 + 1. Let b = v - 0.2. Let u be 19/(-14) + 2 - 5/10. What is the nearest to -0.1 in 0.5, b, u? b Let v = -0.1 - -0.1. Let n = 30.1 - 26.1. Which is the nearest to v? (a) 5 (b) -0.1 (c) n b Let f = -33/4 + 8. Let n = -0.1 + -2.9. Which is the nearest to -2? (a) f (b) 2/9 (c) n c Let v be (-17)/(-4) - (-15)/20. Let r = -6 + 8. Which is the closest to 0? (a) -5/2 (b) v (c) r c Let x = 0.05 - 0.65. Which is the closest to x? (a) 0.4 (b) 3/8 (c) -1/2 c Suppose 0 = -y - 3y + 20. Suppose -2w + 7w = y. Which is the closest to w? (a) 1/11 (b) -1/5 (c) 5 a Let h be (4/(-3))/((-4)/(-18)). Let p be ((-3)/h)/(105/(-438)). Let g = 16/7 + p. Which is the closest to -0.1? (a) -7 (b) g (c) 1/2 b Let t be 12/72 + (-26)/12. What is the closest to -1 in -4, 2/9, t? t Let q = -0.4 + 0.7. Let w = -0.3 - -0.1. Let r = q + w. Which is the nearest to r? (a) 5 (b) 2/3 (c) -2/11 c Let y = 44 - 20. Let k be (-26)/y + 3/4. Which is the nearest to -1? (a) -0.3 (b) -5 (c) k c Let l be 6/21 + 64/(-126). Let h = 1.9 + -2. Which is the closest to -1? (a) l (b) 1/5 (c) h a Let x = -7/2 - -11/3. What is the closest to -7 in 0.5, x, -1/6? -1/6 Let z = -0.096 + -0.004. Which is the closest to z? (a) -0.5 (b) -0.4 (c) -3/5 b Let t be 4/(-6)18/42. Which is the nearest to 0? (a) -5 (b) -2 (c) t c Let v be (-8)/(-54)(-6)/4. Suppose 0 = 7g - 5g - 10. What is the nearest to 2 in -2, g, v? v Let o = -2.58 + -0.02. Let m = o + -0.4. What is the closest to -0.1 in m, 0.3, -2? 0.3 Let k = 0.4 - 2.4. Let v be -5 - ((-4)/(-6) + -4). Which is the closest to -2/5? (a) 1/4 (b) v (c) k a Let s = 22 + -15. Let y = 8 - s. Which is the closest to y? (a) -1 (b) -2 (c) 1 c Let y be (3 - 0) + (2 - 1). Let j = 4 + -7. What is the nearest to 1 in -2/5, j, y? -2/5 Let k be (6/(-4))/(-34). Let x = 1.2 + -0.9. Which is the closest to -1? (a) k (b) x (c) 0 c Let f = 228 + -2054/9. Let o = -36 - -35. Let a = 0.2 + -0.4. What is the closest to f in -4, a, o? a Let d = 0.8 - 0.74. Let r = 0.14 + d. Let u = 3 + -2.9. What is the nearest to u in 1, r, -0.5? r Let t = 145 - 147. Which is the closest to 1? (a) 1/6 (b) 11 (c) t a Let n be (-3)/(-15) + 912/(-15). Let a = 61 + n. Let c = -0.1 + 0.2. What is the closest to -0.1 in a, c, -4? c Suppose -2m - 8 = -j - 5m, 0 = 4j - 3m - 17. Let y be 3/(-7) + 0/2. Let q = 0 + 1. What is the closest to 0.1 in q, y, j? y Let y = -0.5 + 0.5. Which is the nearest to -1? (a) y (b) 0.1 (c) 1/8 a Let n = -80.8 + 81. What is the closest to -1/5 in n, 5, 1/4? n Let q = 0.04 - 1.04. Let o = -3 - q. Let u = 3 + o. Which is the closest to u? (a) -0.2 (b) 5 (c) 2 c Let m be 2/((-15)/(1 + -2)). Which is the nearest to 0? (a) 1 (b) m (c) 0.2 b Let u be 0/(-6)(-1)/3. Suppose 12 = 4r - 4. Suppose -5 = -ri - i. What is the nearest to i in -0.3, u, -4? u Let l = -4.9 + -0.1. Let m = 166 + -165.8. Let w = 0.08 - 4.08. Which is the nearest to 2? (a) m (b) l (c) w a Let z = 4.7 + -1.7. Which is the closest to 0? (a) z (b) 1/8 (c) 0.3 b Let d = 50 - 52. What is the nearest to -2/11 in 2, 4, d? d Let h be 15912/150. Let c = -481/45 + h. Suppose -3y = -y - 4. What is the nearest to y in c, 4, -4? c Let y = 11 - 9. Let m(w) = -w2 - 5w - 3. Let t be m(-3). What is the closest to -1/2 in y, t, -2/9? -2/9 Let u = -394/7 - -56. What is the closest to -4 in 0, u, 0.5? u Let o = 0.1 - -2.9. Let s = -0.28 - 0.02. Let k = s - -0.5. What is the nearest to 1/3 in o, -0.3, k? k Let x = 0.19 + -0.2. Suppose 2l - 26 + 26 = 0. Which is the nearest to l? (a) 0.3 (b) 0.4 (c) x c Let w = 22 + -17. Which is the closest to -6? (a) -3/8 (b) -4 (c) w b Let a be -6(-3 - -7) + 1. Let s = -47/2 - a. What is the nearest to s in 6, -0.5, 0? -0.5 Let r = 0.34 + -0.04. What is the nearest to -2/7 in r, 2/7, 3/8? 2/7 Let z = -5.7 - -6. Let i = 13 + -13. Which is the nearest to i? (a) z (b) 4/3 (c) -0.5 a Let x = 0.34 + -0.3. Let t = 3.04 - x. Let m = t - 7. What is the nearest to 1 in -5, -0.3, m? -0.3 Let l = -1.1 + 0.1. Let c = -0.5 - l. Let h = -1.1 + -2.9. What is the closest to 0 in h, 3, c? c Let l = -5 + 4. Let h = 0.7 - 0.8. Let u = 1/6 + 1/3. What is the	{ "pile_set_name": "DM Mathematics" }
for u. 1 Suppose 2x = 4, -2r - 539 + 543 = -3x. Solve 4i = -4i + ri for i. 0 Let z be (-50)/1521/70-4. Solve 0 = zd + 16 - 24 for d. 2 Let n = -3792 - -3797. Solve 18l = -nl + 23 for l. 1 Let x(h) = -h2 + 32h + 73. Let r be x(34). Suppose -5n + 2 = -8. Let g be 2/(-4 - ((-488)/60 - -4)). Solve -g = nk - r for k. -5 Let d be ((-600)/210)/(-10)5/((-5)/(-84)). Solve -8y = dy for y. 0 Let d be 3/2((-752)/(-6))/2. Let r = 101 - d. Suppose 14 = -j + ra - 2a, 4a - 20 = 0. Solve 9m = jm + 4 for m. -2 Suppose 2b - 1 = -7. Let d be b/24/(-3). Let q = 270300 + -270292. Solve dk - q = -2k for k. 2 Let p(b) = 87b - 9010. Let h be p(104). Solve -ho + 8o = 90 for o. -3 Suppose -4c + 2h + h = -701, h - 353 = -2c. Let t = -176 + c. Solve tj - 15 = 5j for j. -3 Let l(b) be the third derivative of -b5/60 - 7b*4/24 + 6b*2. Let y be l(-4). Let u be y/7 + (-4)/(-14). Solve -u + 6 = o for o. 4 Let b = 18901 - 18517. Solve 381w - bw + 3 = 0 for w. 1 Let a(j) = -7j*2 - 10j + j*2 - 6 + 3j + 5j2. Let q be a(-5). Solve 7 = qr - 1 for r. 2 Suppose -3k + 8c - 5c = -27, 0 = -5c + 10. Solve -72 = -kj - 116 for j. -4 Let a(j) = -11j + 207. Let d(w) = 22w - 414. Let l(n) = -13a(n) - 6d(n). Let b be l(19). Solve 0 = 7k - 30 + b for k. 4 Suppose 0b - 2b = 3d - 23, b + 3d - 19 = 0. Let g = 32 - 29. Suppose 0 = gl - u + 1, 0u + 5 = 5u. Solve 2i - bi - 6 = l for i. -3 Let q(a) = 9a + 68. Let r be q(-8). Let h be 46 + -35 + r(3 - 2). Solve 4i = hi + 6 for i. -2 Let u(q) = -5q*2 + 0q - 11 - 3q + 5q + 6q + 6q2. Let j(g) = g2 - 7g - 4. Let s be j(6). Let y be u(s). Solve 0 = -yc + 7c - 6 for c. -3 Let p be (34 + -6)-17 - -7. Let t be (-402)/p14/3. Solve -4 = tb - 4 for b. 0 Let r be -28((-42)/8)/(-7). Suppose 4g + 3d - 20 = -119, -2g - 44 = -4d. Let q = r - g. Solve w = 1 + q for w. 4 Let v(p) = -6p + 286. Let k be v(47). Let m be (14/k + 6)2 - 4. Solve -2g - g = m for g. -5 Suppose 37q - 42q + 490 = 0. Suppose 5a - q = -c, 5a = 13c - 17c + 92. Solve 10f - a = 5f for f. 4 Suppose -22r - 14r + 29124 = 0. Solve -829 = -5c - r for c. 4 Suppose 1 - 9 = -4p. Let b be (-1)/(10/(-44)) + 138/(-345). Suppose 0z - 2 = -z. Solve -p = -bh + z for h. 1 Suppose 0 = f - 3n + 3, 3f + 5n - 5 = -2f. Suppose -2a + fa = a. Solve a = -4t - 4 for t. -1 Suppose -4f + 6 = -f, 4f = -3v + 17. Suppose 28 = -10l + vl. Let d be 9/((13/(-26))/(2/l)). Solve 6t = 3t - d for t. -3 Let u = 65 - 109. Let n = 16 + u. Let d be (-19)/(-7) - (0 + 8/n). Solve -2 + 5 = db for b. 1 Let a = -145 + 159. Let z be (-4)/a - 777/(-147). Solve 0 = 4t - z - 11 for t. 4 Suppose 3g - 24 = -3p, -11p + 6p - 2g + 25 = 0. Suppose -pm = -3k - 2m + 15, 4m = 4k - 20. Solve 5d - 11d = -kd for d. 0 Suppose 5v = u - 209, -u - v - 11 = -178. Solve 100d - 592 = ud for d. -8 Let h(y) = y*2 - 9y + 8. Let s(o) = -o*2 + 9o - 6. Let g(k) = 3h(k) + 2s(k). Suppose -5i = 3 - 43. Let x be g(i). Solve -j + 2j = -x for j. -4 Let o = -131 - -134. Let q be o-2 - (60 - 68). Solve 5r = -qr for r. 0 Suppose -4y - 13 + 61 = 0. Let x = -915 + 917. Solve -xc - c - y = 0 for c. -4 Suppose -44 - 4 = -3u. Suppose -11o + 3o = -u. Suppose -3q + 15 = of - 8, -2q = -2. Solve 0d - f = 2d for d. -5 Let u(w) = 52w - 8w2 + 20w + 4w3 - w3 - 68w. Let h be u(2). Solve h = 5q - 2 - 18 for q. 4 Suppose 4w + 4n = 988, w + 253 = 2w - n. Let x = 250 - w. Solve -4i = -xi + 20 for i. -5 Let b(p) = -2p3 - 27p*2 + 14p + 2. Let n be b(-14). Suppose -14 = -nz - 14. Solve z = o - 0o - 5 for o. 5 Suppose 0 = -3227x + 3271x - 38676. Solve 890l - 44 = xl for l. 4 Let p = 4301 - 4297. Solve -155u + 157u = p for u. 2 Let g = 163 + -113. Let z = 64 - g. Solve 19 = w + z for w. 5 Let w(z) = z*3 + 4z*2 - 10z - 21. Let r be w(-5). Suppose 0 = -3m - 6, -rm - 31 + 8 = -5o. Solve -i + o = -0i for i. 3 Suppose 574 = -69891p + 69898p. Solve -49k = -pk - 264 for k. -8 Let w = -32828 - -32923. Solve -514 = -wq + 56 for q. 6 Let b be (-3)/(1(-2)/2). Let t(n) = -55n2 + n - 3. Let k be t(2). Let l = k - -223. Solve 0 = -bs - ls for s. 0 Let g be (17145/1080 + 1/162)2. Solve -40 = -gs + 24s for s. 5 Suppose 0 = 7d - 6d - 3i - 10, -2 = i. Let a(m) = -2m3 - 41m*2 - 22m - 40. Let k be a(-20). Solve -7j + dj - 9 = k for j. -3 Suppose -5b + 14 = -16. Let k = -63 - -63. Suppose -8 - 4 = -4u, k = 5g + 4u - 12. Solve g = -bc + c - 15 for c. -3 Let h = 3457 + -3448. Solve -31 - 5 = -hc for c. 4 Suppose -b + 2z + 14 = 0, 3z - 4 = -5b + 1. Suppose 0g + bd = -5g + 475, 307 = 3g - 2d. Let h = -95 + g. Solve -2 = -hp + 6 for p. 2 Let i(b) = 3b*2 - 90b - 89. Let y be i(31). Let j(n) = n*3 - 6n*2 + 3n + 25. Let g be j(y). Solve 0 = -gm + 8m - 9 for m. 3 Let g = 520 + -173. Suppose -133 - g = -12c. Solve 0q = 8q - c for q. 5 Suppose -4m + 16 = -c + 3c, 0 = 3c - 6. Let g = -97 - -94. Let y be 0/(m/(g + 2) + 6). Solve y = 4k + 3 - 15 for k. 3 Let q(p) = -p3 + 9p*2 - p + 11. Let g(l) = -8 - 6 + 9l*2 + 3l - 4 + 15. Let u be g(1). Let x be q(u). Solve -3j + 8 = x for j. 2 Let b(k) = -k2 - 5k + 7. Let a be b(6). Let n = a + 78. Solve -nq - 9 = -16q for q. -3 Suppose -5x = -5f - 270, 0 = -0x - 5x + 3f + 282. Solve 7g + 13g = -x for g. -3 Let t = 1379 + -1051. Solve t = 6l + 286 for l. 7 Suppose 4 = -4a - o, -o + 8 - 12 = a. Suppose -6m - 23 + 155 = a. Solve 8g - m = -62 for g. -5 Let m(k) be the second derivative of -k3/6 + 4k*2 - 2k. Let s be m(6). Let r(g) = -g*2 + 146g - 4703. Let f be r(98). Solve sl - f = -3 for l. -1 Suppose -j - 14 = -4n + 6, -3n + j + 16 = 0. Let r be n/1065/26. Let d be (-8)/(r/2-4). Solve -du + 7u = 0 for u. 0 Suppose -m + 79 - 1 = 0. Let s = -31 - -110. Solve m = a + s for a. -1 Suppose 55c - 2253 - 1212 = 0. Solve -co + 89o + 104 = 0 for o. -4 Let f = -45186 - -45194. Solve -85l - 93 = -f for l. -1 Let g(y) be the third derivative of y4/24 + 16y*3/3 - 13y*2 + 2y. Let a be g(-30). Solve ao + 0o = 10 for o. 5 Suppose 7n + 1756 = 2323. Solve 74j = -n - 67 for j. -2 Let u be (-15)/20 + (-44)/(-16). Let t be (1 + -41)/(u1/(-2)). Suppose 10i - t = -0i. Solve 3x - 4x = i for x. -4 Suppose -3k + 8 = 80. Let a be (-4)/10 + k/(-10). Suppose -2f + 5r = 18 + 5, -3f - 17 = -4r. Solve 3x + a + f = 0 for x. -1 Suppose 233q = 202q + 1581. Solve 80 = -35v + qv for v. 5 Let w(k) = 3k*3 - 15k*2 + 34k + 3. Let h be w(4). Solve 11 + h = 17t for t. 6 Let j(l) = l3 + l2 + 4. Let u be ((-44)/8)/110. Let c be j(u). Suppose 3o - c - 20 = 0. Solve 2w - o = 6w for w. -2 Let b be (40/28 - 2)/((-4)/14). Suppose 3x + 61 = bx. Let s = -59 - x. Solve 4 + s = -2c for c. -3 Let s = 7732 + -7681. Solve sc - 195 = 12c for c. 5 Let j be (2/(-3))/(8/(-300)). Let h be 5/j3(4 + 1). Suppose 5u + hw + 15 = 0, -5w = 3u + 7 + 18. Solve 4n = -un + 4 for n. 1 Let w = -398 + -267. Let o = 670 + w. Solve -1 = -oj - 21 for j. -4 Let s(v) be the third derivative of -v4/8 - 28v3/3 + v2 - 64v. Let i be s(-20). Solve -ib + 2 = 10 for b. -2 Suppose -8m + 123 = -37. Suppose h = -4t + 5, -38 = -2h - 28. Solve t = 4b - 8b - m for b. -5 Let y be (-2)/((-24)/30) + (-10)/(-20). Solve yt = -19t + 132 for t. 6 Suppose 4u = 23u - 152. Let i be 1/(((-1)/(-96)3)/1). Suppose 4v + 0k = -k + 12, 0 = -3v + 5k + i. Solve -vr = -ur - 16 for r. -4 Let q = -140 - -176. Let j be (1 + 1 + 0)/(q/162). Solve -4a = -j - 3 for a. 3 Let f(k) = -k3 + 9k*2 - 343k + 3549. Let w be f(10). Solve wa + 23 = 61 for a. 2 Suppose 0 = -b + g + 32, 4b - 5g + 25 = 156. Suppose 3c - b - 10 = 0. Suppose t - k = 13, 13 = t + k + 2. Solve -5i - t = c for i. -5 Suppose 3 = -3t - 3, 4b = t + 18. Let k(s) = s3 - 6s*2 + 6s + 10. Let m be k(b). Solve -1 = y + m for y. -3 Let u be 705/25 + 72/(-60). Let o(i) = -2i3 + 55i*2 - 26i - 23. Let d be o(u). Solve dl - l = -3 for l. -1 Let n(c) = c3 + 5c*2 + 3c - 2. Let p be n(-4). Let f be -22/(-2 - (p + -2)). Let m(h) = 3h - 3. Let x be m(f). Solve 6u - xu = 6 for u. 2 Let n(u) = 11u2 - 29u - 139. Let h be n(-4). Solve h + 99 = -42*q for q. -6	{ "pile_set_name": "DM Mathematics" }
hich is the smallest value? (a) 101 (b) 5 (c) x c Let s be (25/2 - 8) + 1-4. Suppose 4k = -k + 5. Let r be 2 + -1 - k5. Which is the second biggest value? (a) r (b) s (c) 0 c Suppose 19o - 21 = -2. What is the third biggest value in -1, -12, o? -12 Let r = 0 + -2. Let z = 225.36 + -225.46. What is the smallest value in 3/7, z, r, -4? -4 Suppose 64 = -2j - 3o, -j - 39 = 4o + 3. Let g be 4/(480/j) - -1. Let u = g + -8/15. What is the smallest value in 4, 1, u? u Let w be (-8)/6-3 + 207/(-54). Which is the third smallest value? (a) -1/6 (b) w (c) 1/4 (d) -1/4 b Let b(c) = -c*3 + 7c*2 - 5c - 1. Let x be b(6). Suppose -8d + 3r - x = -6d, 2r - 10 = 0. What is the second smallest value in d, -1, 1/4, 0.4? 1/4 Let f = 189 + -184. Which is the second biggest value? (a) 0.2 (b) f (c) 0.68 c Suppose 3l + 14 = -5t, -l - l = t + 7. Let i = -18.4 - -19. Let n = 1.6 - i. What is the second biggest value in -3, t, n? t Let f = -17 - -16.9905. Let w = f + 14.3595. Let h = 0.35 - w. What is the smallest value in -2, -1, h? h Suppose -4p + 4 + 1 = b, 5b - 5p - 25 = 0. Let l = b - 10. What is the third biggest value in 0.3, 0.4, l? l Let j(i) = -i2 - 7i + 40. Let u be j(-17). Let k = u - -1692/13. Which is the second smallest value? (a) k (b) -5 (c) 5 a Let k = -158 - -161. Which is the second biggest value? (a) -0.1 (b) 59 (c) k c Let m = -40.8 + 41. Which is the smallest value? (a) m (b) -43 (c) -5 b Let h = 2.05 + -0.05. Let w = -622/3705 + 4/285. Let g be (-1 - -2)/((-1)/5). Which is the third biggest value? (a) w (b) g (c) h b Let d = 386834077/380 - 1017985. Let m = d - 1/76. What is the biggest value in 10, m, -0.3, 1/4? 10 Let j = -0.59 - -0.53. Which is the smallest value? (a) -0.3 (b) -1/208 (c) j a Let t = -6.5 + 1.5. Let c = 2/113 - -107/339. What is the smallest value in 0.5, c, t? t Let h = 5 - 5. Let g = -112 + 113. Which is the fourth biggest value? (a) h (b) g (c) -3/2 (d) 5/2 c Let w be ((-38)/(-8) - 3) + -2. Let y = -1207 - -4823/4. Which is the biggest value? (a) y (b) 5/4 (c) w b Let c = 0.061 - -58.939. Let k = 64 - c. Let a = -1 + 0. What is the third smallest value in a, 4, k? k Let h = 91 - 77. Let w be (h/10 + -1)/((-80)/(-50)). What is the fourth biggest value in 0, -3, -0.07, w? -3 Let u = 2779 - 2783. What is the third biggest value in 2, -0.2, u, 49/6? -0.2 Let h be (8/60)/(2/(-6) + -1). Which is the fourth biggest value? (a) 5 (b) -1/5 (c) -2 (d) h c Let q = 0.1 + -0.4. Let c = 2763.88 - 2764. What is the smallest value in q, 0.3, c, -1? -1 Let f = -134 + 129. What is the third biggest value in -0.4, -1.27, f? f Let s = -17.7 - -18. Let j = -7 + 12. Which is the smallest value? (a) 1/9 (b) s (c) 2/11 (d) j a Let j = 11 - 15. Let o be 192/(-1296)((-6)/9 + (-13)/(-6)). What is the third biggest value in 5, o, 3/4, j? o Let c = 2764 + -8290/3. What is the smallest value in 0.1, c, 285? 0.1 Let a be (-82)/(-390) + 8/(-104). What is the third smallest value in 3, a, -0.04? 3 Let p = 239 - 1194/5. Which is the third smallest value? (a) -2/5 (b) -0.09 (c) p c Let m = -9/37 + 193/185. Let w = 1.5 + 2.5. Suppose 3 = -5n + 28. Which is the third smallest value? (a) w (b) m (c) n c Suppose 329 - 43 = -22n. Which is the second smallest value? (a) 1/5 (b) n (c) 2 (d) -0.2 d Let q = 26.7 + -30. Let l = q + -0.5. Let h = -4 - l. What is the smallest value in -2/3, -5, h? -5 Suppose 2f - 9 = -f. Let p(t) = 10t - 3. Let m be p(-1). Which is the second biggest value? (a) f (b) 4 (c) m a Let d be (-3)/(-5) + (102/10)/3. Let k be 4/6 - (-50)/6. Suppose 0 + k = -3o. What is the smallest value in 0, d, o? o Let g = -84.51 + 84. Let y = g + 0.11. Let o = 0.093 + -0.083. What is the biggest value in 2/9, o, y? 2/9 Let t = 3/47 - 62/235. Suppose 128 + 298 = -6x. Let s = x - -353/5. Which is the third smallest value? (a) 3 (b) t (c) s a Suppose -54o + 331 + 101 = 0. Let w = -6.8 - -7. Let q = -1 - 2. What is the second biggest value in q, w, o? w Let y = -106 - -106. Suppose 3z + 0z + 5u = -10, -z - 5u - 10 = y. Which is the third smallest value? (a) z (b) 0.27 (c) -0.3 b Let m be 8/(-6)(-2)/4. Suppose -28j - 23 = 257. Which is the smallest value? (a) 0.2 (b) m (c) j c Suppose -2v = -5j - 18, 2j - 8j = 24. What is the biggest value in -0.4, 0.12, 1/3, v? 1/3 Let z = 2.4 + -8.2. Let m = z + 5.4. Which is the third biggest value? (a) 0 (b) 1/10 (c) m c Let w = 4.0472 - 0.0472. Which is the second smallest value? (a) 3 (b) w (c) 0.7 a Let s = -70 + 28. Let x = -41.8 - s. Which is the third biggest value? (a) x (b) 0.09 (c) -3 (d) -2 d Let l = 0.074 - 0.524. Let v = l + 0.4. Which is the third biggest value? (a) v (b) -5 (c) 2 (d) 3 a Let s = -14.3 + 2.3. Let r = s - -11.87. Let n = r - 0.17. What is the second biggest value in 0.5, n, -1? n Let m = -1.3 + 2.5. Let w = m + -2.4. Let y = w + 6.2. Which is the smallest value? (a) -5 (b) 0.2 (c) y a Let n = 0.1388 - 3.9088. Let g = -0.008 - 0.222. Let z = n + g. What is the smallest value in 0.1, z, -2? z Let s = -1948.8 + 1949. Which is the third smallest value? (a) -21 (b) 10 (c) s b Let t = -39.1 - -39.05. What is the second smallest value in t, -0.1, 2/9, 2/7? t Let u = 6968/11 + -634. Let y = 1 - 1.1. Let w = y + 0.1. Which is the second smallest value? (a) w (b) u (c) -2/11 c Let j = 4.2 - -0.8. Suppose 3m = -5o - 3, 5m - 7 - 19 = 2o. Which is the biggest value? (a) j (b) m (c) 1 (d) -1 a Let m be 1/(-15) - ((-2587)/13930 - (-4)/14). Let h = 0 - -0.1. Which is the third smallest value? (a) -1/2 (b) -3 (c) m (d) h c Let k be 12/(-4)((-3765)/315 - -12). Let l = 0.2 - 0.6. Let u = -0.2 - l. What is the biggest value in u, k, -1? u Let p = -10.7 + 8. Let d = -1.9 - p. Let x = -0.2 - d. Which is the biggest value? (a) 0 (b) 0.1 (c) x b Let g = 1777/4696 - 2/587. Let n = -2.9 - -3. Which is the second biggest value? (a) -4 (b) g (c) n (d) -3/4 c Suppose -2o = -1 - 1, 0 = -4a + 2o + 6. Suppose -h = ah - 9. Suppose -118 = -21v - 57 - 40. What is the third biggest value in h, 2, v? v Let y = 9.94 + 0.06. Let o = y + -10.09. Let m = -0.49 - o. Which is the biggest value? (a) m (b) -1/6 (c) -1/3 b Let s = -194 + 193. Which is the third smallest value? (a) 4 (b) s (c) -2.1 a Let u = 560 - 559.9. What is the third smallest value in u, 0, -2/19? u Let k = -769/7 - -109. Which is the smallest value? (a) k (b) 3 (c) -1/4 a Let k = 496 - 500. Which is the smallest value? (a) k (b) 13 (c) 12 a Let m = 0.4 - -0.1. Which is the fourth smallest value? (a) m (b) 7 (c) 0.3 (d) 4 b Let y be (-2 + 1)1/5. Let d = 535/6 - 89. Let o = 10648/15 + -710. Which is the third smallest value? (a) d (b) y (c) o a Let l = -0.4 - -0.3. Let p(q) = 3q - 5. Let g be p(3). Let m be ((-6)/g + 1)6. What is the biggest value in m, l, 1/3? 1/3 Let h = 2 - 7. Let p = -637.6 - -638. Which is the second smallest value? (a) -4 (b) 0.5 (c) p (d) h a Let k = 43.85 - 44. Let g = 23 - 18. Which is the second biggest value? (a) k (b) 1/3 (c) 0.1 (d) g b Suppose 4z + p = 5z, -10 = -4z + 2p. Suppose -u + 2u - 8 = -zv, 2u + 2v = 8. Which is the third biggest value? (a) 0.2 (b) u (c) -0.1 (d) 2/5 a Let i = 2.62 + -2.52. What is the second smallest value in -21, i, 12/13, -3? -3 Let y = -0.288 - -0.388. What is the third smallest value in 5/8, -0.5, y? 5/8 Let g = 120.839 + -119.8. Let t = -0.039 + g. What is the biggest value in t, 0, -0.3? t Let s = -23 - -22. Let p(l) = 13l*3 - l - 1. Let z be p(s). Which is the smallest value? (a) z (b) 0.1 (c) 2/21 a Let l = -32 - -59. Let c = -27.3 + l. Let r = -0.1 + c. What is the third smallest value in r, -0.8, 1? 1 Let w = 3/52 - 125/364. Let y be ((-36)/(-120))/(12/10). Which is the second smallest value? (a) y (b) w (c) 2.2 a Let w = 13.73 - 11.73. Let r = 0.01 + 5.99. Which is the third smallest value? (a) -2 (b) r (c) w b Let x be ((-2)/1)/(1/32). Let o be x/112 - 80/(-42). What is the smallest value in 0.2, -0.2, o? -0.2 Suppose -4 = 4r - 8r. Let j be (r/2)/(1/34). Suppose 2o - 3h + 1 = 0, j = 3o + h + 2. What is the smallest value in 2, o, 0? 0 Let c = 82 - 82. What is the second biggest value in c, 5, 0	{ "pile_set_name": "DM Mathematics" }
ppose -sq + 6 - 1 = 0. Are q and -1/3 equal? False Let f be (-4)/(-22) + (-578)/1122. Is f bigger than 0.82? False Suppose -7 + 1 = -c. Suppose 7u - 12 = 4u. Suppose ud = 2d + c. Which is smaller: 1 or d? 1 Suppose l + 3l = 3y + 17, -5y - 7 = 4l. Is l greater than -1/2? True Let r be 2 + 0 - (-2)/2. Suppose -20 = ra - 4v, -21 = a - 5v - 7. Let b be (-69)/15 + (-4)/10. Which is smaller: b or a? b Let r(f) be the first derivative of 7f4/4 - f - 15. Let x be ((-2)/(-4) + 0)2. Let y be r(x). Is y <= 5? False Let j = 505/8 + -63. Is 1 at most j? False Suppose 14 - 20 = -3r. Which is smaller: r or 5/2? r Let z = 0.06 + -0.66. Let a = 0.48 - 0.08. Let f = z + a. Is f >= -2/5? True Let o be 3059/(-56) - (-2)/8. Let c = o + 54. Is c <= 1? True Let j be 4/(-6) - 4/12. Let w = -1 - 1. Which is bigger: w or j? j Let o be (3 + -4)/1-15. Which is greater: 16 or o? 16 Suppose -4v + 12 = 0, v + 1 = 4x - 4v. Which is smaller: x or 42/13? 42/13 Let w = -2.24 - -0.44. Which is smaller: -1/4 or w? w Let p be 0 - -1285/3. Let v = 12257/129 - p. Let m = -272/903 + v. Is -1 >= m? False Let m(b) = b3 - b2 - b. Let k be m(2). Suppose 0 = -5q + kq. Let y be 6/8(-2)/18. Which is greater: q or y? q Let g = 3 - 6. Let w = 8 + g. Let b(y) = -y + 1. Let a be b(-3). Is w > a? True Let l(x) = -x2 + 5x - 3. Let s be l(3). Let w(o) = -5o2 + os + 4 + 0o*2 + 0o*2 + 3o. Let z be w(4). Which is smaller: z or -0.2? -0.2 Let h = 1171 - 33955/29. Are h and -1 non-equal? True Let k = 11 + -11. Let g = -16992/29 - -586. Is k less than g? True Let w be ((-18)/12)/((-5)/(-4) - 2). Which is smaller: -4 or w? -4 Let o(a) = -a - 5. Let i = 1 + -5. Let m be o(i). Let s be ((-2)/(-12))/((-3)/4). Is m != s? True Let p = 37 + -26. Are p and 0 equal? False Suppose 35 = -8f + 3f. Let u(q) = -q*2 - 6q + 5. Let s be u(f). Let c be (10 + -9)s/4. Is -0.2 less than c? False Let d = 24 + -13. Is 10 >= d? False Let q be (-3 + 3)/(2/(-1)). Let y = 5 + -4. Is q greater than or equal to y? False Let f(l) = -l3 + 14l*2 + 16l - 16. Let k be f(15). Is -18 >= k? False Let q(a) = a*2 - 20a + 30. Let r be q(19). Suppose 20 = 2v - d, -2v + 34 = 5d + 2. Is r at most v? True Let z = 15 - 16. Which is smaller: z or -1/7? z Let c = 14 - -10. Which is smaller: c or 25? c Let x = 135 + -108. Is -1 at most as big as x? True Let m(g) = g + 10. Let j be m(-7). Suppose q - j = -4. Is q <= -1/10? True Let y be (6/(-15))/((-7)/(-315)). Let q be (-4)/3y/20. Is q smaller than 1? False Let v be 6/(-2) - (-6)/8-4. Which is bigger: v or -3? -3 Let c(r) = -r - 1. Let m be c(-1). Suppose m = -l + 2 + 2. Suppose 0 = ld + d. Which is bigger: -1/6 or d? d Let f(x) = x*2 + 5x - 7. Let o be f(-6). Let u(l) = -l*2 + 5l - 6. Let a be u(4). Which is smaller: a or o? a Let z(u) = u*3 + 10u*2 - 13u - 12. Let i be z(-11). Are i and 9 equal? False Let i = -1.3 - -1.1. Is -3 equal to i? False Let h be (-21)/(-9) + 3 + -6. Let y be 0/(-2) + 8/2. Suppose z - yz = 0. Do z and h have the same value? False Suppose 6 = 5t - 19. Let l be (3/2)/(t/(-10)). Is l at most -3? True Let c be ((-6)/(-24))/(18/(-184)). Let v = -35/9 - c. Let y = -7 + 5. Is v at most y? False Let v(j) = -3j - 11. Let p be v(-6). Is p at least 5? True Suppose 0 = 2k + 8, 6k = -4g + 2k + 56. Let i be ((-4)/6)/((-1)/g). Suppose 2c = 4o + i, -5o - 12 = -2c - 2c. Is c <= -3? False Let s be (-4)/14 - (-9)/7. Let o = 9847/25 - 394. Let q = o + 71/175. Is q at most s? True Let f be -4(3 + 10/(-4)). Let t(a) = a + 2. Let j be t(-2). Are j and f non-equal? True Let a(c) = c3 - 5c*2 + 4c + 1. Let r be a(4). Let u = 6 - r. Suppose 0 = -uj + 5, 6 = f + 5j - 1. Is 1 smaller than f? True Let i be (-196)/105 + (-6)/45. Are -13 and i non-equal? True Suppose -3r + 22 = 34. Is r > -14/3? True Let v = -111 + 152. Which is smaller: -0.1 or v? -0.1 Let y = -135/4 + 33. Is y smaller than 1? True Let o be (46/(-3))/((-12)/18). Suppose -5p + s - 10 = 0, 0 = 3p + 5s + 1 - o. Which is smaller: p or -1/6? p Let z = -2263/524225 - -2/1613. Let c = z - -27/325. Suppose -4r = 3v + 8, -r - 2 + 0 = v. Which is smaller: v or c? v Let p = 88 - 51. Which is bigger: p or 2? p Let d = -0.92 - 0.08. Let x = -3 - -2.6. Let p = -0.3 - x. Is p != d? True Let t = 11 - 6. Let f = 6 - 5.9. Which is bigger: t or f? t Suppose 15v = 20v - 5. Let y(c) = c*2 + 6. Let i(h) = -h + 1. Let w(g) = -5i(g) + y(g). Let d be w(-5). Is v bigger than d? False Let p be -1 + -1 - 3/(-1). Let n = -7/6 - -73/42. Are p and n non-equal? True Let z = 15 + -11. Let d = -8.2 - -4.1. Let m = z + d. Are 3 and m unequal? True Suppose 0 = -c + 3b + 1, -4b - 6 + 34 = -5c. Let p(f) = -f - 9. Let i be p(c). Which is bigger: 3 or i? 3 Let q = -93 - -931/10. Which is greater: -1 or q? q Let g = -0.22 - 0.18. Which is smaller: 2 or g? g Let t(y) = -y2 - 5y + 3. Let c be t(-6). Let x be (-1)/(26/(-4) - c). Is 2/11 at most as big as x? True Let d = -143 + 130.9. Let r = d - -12. Are r and 4/5 equal? False Let r(p) = 2p + 10. Let q be r(-5). Which is bigger: q or 2/7? 2/7 Let p(u) = -u2 - 2u - 1. Let i be p(-1). Let t(v) = -v*2 + 5. Let b be t(0). Let r = -3 + b. Is i greater than r? False Let n = 1 - 1.2. Let x = 30.6 + -31. Which is greater: n or x? n Let i be 98/(-4)(-5)/2. Let r = -61 + i. Is 0.1 at most r? True Let o = 203.9 + -203. Is o >= 6? False Let l be (-37)/3 + (-2)/(-2). Let a = -173/15 - l. Is -1 at most a? True Suppose 0 = 4c + 97 + 11. Is -27 < c? False Let j = -45 - -40. Is -1 smaller than j? False Suppose p - 2m - 3 = 0, -3m + 0m - 2 = -4p. Let c be (20/65)/(p - 1). Let i(l) = -l2 - 4l + 5. Let k be i(-5). Which is smaller: c or k? c Suppose 4v + 3 - 5 = 2b, 3v - 2b - 3 = 0. Let z = 737/15 - 145/3. Which is smaller: z or v? v Suppose x - 5x = -4. Is x bigger than 2/13? True Let v = -25 - -39. Which is greater: -1 or v? v Suppose -4a - 1 = -3m, -2m - 10 = -2a - 4m. Let p = 1 - 1. Suppose 3v = -i - 2i, -ai - v = p. Is i >= 1? False Suppose -20 = -5y + 6y. Let j be (-92)/y + (-2)/(-5). Which is greater: 1 or j? j Suppose -2l + j - 22 = -4l, -4l + 68 = -4j. Suppose -5f + 58 = -n, -3f - f + 3n + 42 = 0. Which is smaller: l or f? f Let h = -14 - -9. Suppose m - 4 = -2. Suppose 3o = 4o + i + m, 0 = 4o - 3i + 29. Is o <= h? True Let o = -6 + 4. Let k = o + 2. Suppose 4p + k = -8. Which is smaller: p or 0? p Let o = 0.4 - 0.36. Let p = 0.96 + o. Is p at most 0.07? False Let m be (-3)/260/18. Which is greater: m or -32/5? m Let v be 7178/504 + 4/14. Let w = 4995/4 - 2527/2. Let g = v + w. Is -1 < g? True Let j(r) = 10 - 6r - 10 + 4r. Let a be j(-1). Which is smaller: a or 1? 1 Let f = 69 + -74. Which is bigger: -15/4 or f? -15/4 Let a = 1.6 - 1. Let k = a + -0.6. Are 3/7 and k equal? False Let n = -18.07 + 18. Let x = n + 0.07. Is x != 0.1? True Let p = 96 + -478/5. Let r(o) = -o + 18. Let b be r(19). Which is smaller: b or p? b Suppose 4k + 32 = 2a, 5k = -a - 0k + 2. Suppose 2s - 7 = -3m, 3s + 3 - a = -3m. Suppose 0 = n + 2 + s. Is -5 greater than or equal to n? False Let r = 1.3 - 1. Let f(n) = n*2 - 6n + 4. Let t be f(6). Suppose -5i - 4k = 14, 5k = ti - 3i - 3. Which is smaller: r or i? i Let a = 42 + -17. Is a >= 24? True Let h(g) = g2 + 8g - 8. Let o be h(-9). Suppose -k - 8 = -2f - 0, 4k - o = -3f. Let a(w) = w2 - w - 4. Let x be a(f). Which is smaller: 1/2 or x? 1/2 Let a(l) = l - 20. Let q be a(12). Which is smaller: q or -7? q Let r = 12.97 - -0.03. Let g = r + -7. Which is bigger: -1 or g? g Suppose -4b - 16 = -3x + 30, -2x + 33 = -5b. Suppose -3g + 4j = -20, -2j + 4 = x. Which is bigger: -2/19 or g? g Let h be 2/4 + 51/(-14). Which is greater: h or -4? h Let h = 13 - 3. Let t be -11 + h + (-5)/(-3). Let a be 12/(-4)10/18. Is t at least a? True Let u = 2.1 - 6.1. Which is smaller: 1 or u? u Suppose -4r + 5u - 6u + 11 = 0, -3r - 3u = -6. Which is smaller: r or 9/4? 9/4 Let j = 16 + -18. Suppose 0 = -2v + 5 - 1. Which is smaller: v or j? j Let u(y) = -2y - 8. Let h be u(-5). Is h bigger than 9/4? False Let s = -3 + 8. Let i = s - 5.06. Which is smaller: -1 or i? -1 Let l = -26 - -29. Which is greater: 2 or l? l Let k be 3/(-14)*60/45. Which is bigger: k or	{ "pile_set_name": "DM Mathematics" }
q + 2 What is the w'th term of 107, 206, 301, 392, 479? -2w*2 + 105w + 4 What is the d'th term of 26, 58, 88, 116, 142, 166? -d*2 + 35d - 8 What is the g'th term of 114, 157, 228, 333, 478, 669, 912? g*3 + 8g*2 + 12g + 93 What is the x'th term of 2161, 4330, 6499, 8668? 2169x - 8 What is the x'th term of -598, -590, -576, -556, -530, -498? 3x*2 - x - 600 What is the b'th term of -37, -59, -59, -25, 55, 193, 401, 691? 2b3 - b2 - 33b - 5 What is the x'th term of -2327, -4655, -6983, -9311, -11639, -13967? -2328x + 1 What is the l'th term of -114, -80, -46, -12, 22, 56? 34l - 148 What is the v'th term of -26, -36, -70, -140, -258? -2v*3 + 4v - 28 What is the j'th term of 13071, 13070, 13069, 13068? -j + 13072 What is the z'th term of 37, 65, 93, 121, 149? 28z + 9 What is the b'th term of 379, 1509, 3393, 6031, 9423, 13569? 377b*2 - b + 3 What is the j'th term of -24, -96, -216, -384? -24j*2 What is the m'th term of 7179, 7182, 7185, 7188? 3m + 7176 What is the m'th term of 3310, 6625, 9952, 13297, 16666, 20065, 23500? m*3 + 3308m + 1 What is the l'th term of 76, 165, 254? 89l - 13 What is the x'th term of -3, -5, 3, 27, 73? x3 - x2 - 6x + 3 What is the y'th term of -99, -29, 39, 105, 169, 231, 291? -y*2 + 73y - 171 What is the g'th term of -616, -619, -622, -625, -628, -631? -3g - 613 What is the p'th term of 35835, 35837, 35839, 35841, 35843, 35845? 2p + 35833 What is the y'th term of 31, 27, 23, 19, 15, 11? -4y + 35 What is the t'th term of -13, 14, 89, 236, 479? 4t*3 - t - 16 What is the r'th term of 198, 202, 206, 210, 214? 4r + 194 What is the b'th term of 37, 75, 121, 175, 237, 307? 4b2 + 26b + 7 What is the t'th term of -159, -291, -385, -423, -387, -259, -21, 345? 3t3 + t2 - 156t - 7 What is the v'th term of -14, -46, -108, -212, -370, -594? -2v3 - 3v*2 - 9v What is the f'th term of -316, -333, -368, -427, -516, -641, -808? -f*3 - 3f2 - f - 311 What is the j'th term of 66, 82, 114, 168, 250? j3 + 2j2 + 3j + 60 What is the i'th term of 86, 78, 66, 50, 30, 6? -2i2 - 2i + 90 What is the u'th term of 96, 325, 706, 1239, 1924, 2761? 76u2 + u + 19 What is the a'th term of -60, -113, -162, -207, -248, -285? 2a*2 - 59a - 3 What is the w'th term of -50, 0, 52, 106, 162, 220, 280? w*2 + 47w - 98 What is the t'th term of -60, -127, -218, -345, -520? -2t3 - 53t - 5 What is the i'th term of 304, 314, 324, 334, 344, 354? 10i + 294 What is the k'th term of -3184, -3186, -3188, -3190, -3192? -2k - 3182 What is the n'th term of 1268, 1270, 1272, 1274, 1276, 1278? 2n + 1266 What is the b'th term of 23, 86, 237, 518, 971, 1638, 2561? 7b*3 + 2b*2 + 8b + 6 What is the i'th term of 278, 572, 866, 1160? 294i - 16 What is the v'th term of -31, -16, 3, 20, 29, 24, -1? -v3 + 8v*2 - 2v - 36 What is the z'th term of 127, 166, 203, 238? -z*2 + 42z + 86 What is the v'th term of -6, -4, -12, -36, -82, -156, -264, -412? -v3 + v2 + 6v - 12 What is the v'th term of -760, -759, -758? v - 761 What is the f'th term of -55, -32, -9? 23f - 78 What is the k'th term of 363, 742, 1125, 1512, 1903, 2298, 2697? 2k2 + 373k - 12 What is the o'th term of -7, -14, -43, -106, -215? -2o3 + o2 + 4o - 10 What is the o'th term of 142, 271, 390, 493, 574, 627, 646? -o3 + o2 + 133o + 9 What is the y'th term of 61, 58, 47, 22, -23, -94, -197, -338? -y3 + 2y*2 - 2y + 62 What is the h'th term of -75, -93, -113, -135, -159, -185, -213? -h*2 - 15h - 59 What is the v'th term of -10, -34, -54, -70, -82, -90, -94? 2v2 - 30v + 18 What is the b'th term of -1106, -2203, -3292, -4367, -5422, -6451, -7448? b*3 - 2b*2 - 1098b - 7 What is the d'th term of -49592, -49596, -49602, -49610, -49620, -49632? -d2 - d - 49590 What is the c'th term of -930, -918, -892, -846, -774, -670? c3 + c*2 + 2c - 934 What is the j'th term of 7, -65, -259, -635, -1253, -2173, -3455? -10j3 - j2 + j + 17 What is the r'th term of -29, -118, -267, -476, -745? -30r2 + r What is the d'th term of 37, -35, -109, -185, -263? -d2 - 69d + 107 What is the h'th term of -27, -16, 1, 24? 3h*2 + 2h - 32 What is the h'th term of -132, -124, -100, -54, 20, 128, 276, 470? h*3 + 2h*2 - 5h - 130 What is the o'th term of -863, -874, -909, -980, -1099, -1278, -1529, -1864? -2o3 + 3o - 864 What is the u'th term of -2308, -4617, -6926, -9235, -11544, -13853? -2309u + 1 What is the m'th term of 420, 862, 1304, 1746, 2188? 442m - 22 What is the f'th term of -251, -380, -601, -920, -1343? -f*3 - 40f*2 - 2f - 208 What is the w'th term of -31, -24, -17, -10? 7w - 38 What is the d'th term of -3300, -3301, -3302, -3303? -d - 3299 What is the o'th term of 4, -8, -26, -50, -80, -116? -3o*2 - 3o + 10 What is the c'th term of 26, 38, 50, 62, 74? 12c + 14 What is the o'th term of -12, -24, -38, -54, -72, -92, -114? -o2 - 9o - 2 What is the j'th term of -255, -247, -233, -213, -187, -155, -117? 3j2 - j - 257 What is the n'th term of 31, 53, 79, 109, 143, 181, 223? 2n*2 + 16n + 13 What is the n'th term of 7881, 7889, 7905, 7935, 7985, 8061, 8169? n*3 - 2n*2 + 7n + 7875 What is the v'th term of 3420, 6845, 10272, 13701, 17132, 20565? v*2 + 3422v - 3 What is the b'th term of -1, -5, -9, -13, -17, -21? -4b + 3 What is the y'th term of -8, -23, -50, -89, -140, -203? -6y*2 + 3y - 5 What is the h'th term of -8, 4, 18, 28, 28, 12? -h*3 + 7h*2 - 2h - 12 What is the f'th term of -213, -871, -1971, -3513, -5497, -7923, -10791? -221f2 + 5f + 3 What is the f'th term of -45, -49, -63, -93, -145, -225? -f3 + f2 - 45 What is the g'th term of -12, -80, -200, -372? -26g2 + 10g + 4 What is the k'th term of -16, -104, -250, -454, -716? -29k2 - k + 14 What is the a'th term of 29, 35, 55, 95, 161, 259, 395? a3 + a2 - 4a + 31 What is the y'th term of -5, 37, 113, 229, 391, 605, 877, 1213? y*3 + 11y*2 + 2y - 19 What is the t'th term of 5, -28, -123, -310, -619, -1080? -5t3 - t2 + 5t + 6 What is the j'th term of -8050, -8054, -8058, -8062, -8066, -8070? -4j - 8046 What is the a'th term of 60, 58, 54, 48, 40, 30? -a2 + a + 60 What is the s'th term of -1085, -1088, -1091, -1094, -1097, -1100? -3s - 1082 What is the a'th term of 46, 6, -44, -110, -198, -314, -464? -a3 + a2 - 36a + 82 What is the v'th term of 37, 31, 15, -17, -71, -153, -269, -425? -v3 + v2 - 2v + 39 What is the w'th term of 291, 579, 867, 1155? 288w + 3 What is the p'th term of -2253, -2256, -2261, -2268, -2277, -2288, -2301? -p2 - 2252 What is the i'th term of -152, -147, -140, -131, -120? i2 + 2i - 155 What is the s'th term of 18, 42, 68, 90, 102, 98, 72? -s*3 + 7s*2 + 10s + 2 What is the d'th term of 528, 527, 538, 567, 620? d*3 - 8d + 535 What is the k'th term of -12, -22, -30, -36? k*2 - 13k What is the l'th term of -13, -35, -63, -91, -113, -123? l*3 - 9l*2 - 2l - 3 What is the v'th term of 270, 552, 836, 1122, 1410, 1700, 1992? v*2 + 279v - 10 What is the p'th term of 6, -2, -24, -66, -134, -234, -372? -p3 - p2 + 2p + 6 What is the w'th term of -884, -868, -818, -716, -544? 3w3 - w2 - 2w - 884 What is the d'th term of 1357, 1356, 1355, 1354, 1353? -d + 1358 What is the x'th term of 47, 108, 169, 230? 61x - 14 What is the k'th term of -21, -13, -5, 3? 8k - 29 What is the z'th term of -38, -41, -54, -83, -134, -213, -326? -z3 + z2 + z - 39 What is the f'th term of 1219, 1214, 1207, 1198? -f2 - 2f + 1222 What is the c'th term of -1815, -3631, -5447, -7263, -9079, -10895? -1816c + 1 What is the w'th term of 58, 110, 164, 220, 278? w2 + 49w + 8 What is the r'th term of -15, -42, -81, -138, -219, -330, -477? -r*3 - 20r + 6 What is the g'th term of -123, -250, -389, -546, -727? -g*3 - 120g - 2 What is the g'th term of 2, 17, 34, 47, 50, 37? -g*3 + 7g2 + g - 5 What is the a'th term of 197, 197, 199, 203? a2 - 3a + 199 What is the s'th term of 504, 500, 496? -4s + 508 What is the w'th term of 14, 92, 228, 428, 698, 1044, 1472, 1988? w*3 + 23w*2 + 2w - 12 What is the m'th term of 11, 96, 347, 848, 1683, 2936, 4691, 7032? 14m3 - m2 - 10m + 8 What is the l'th term of 2, -1, -8, -19, -34, -53, -76? -2l2 + 3l + 1 What	{ "pile_set_name": "DM Mathematics" }
z(-12). Sort 0, o, 10, -0.4 in descending order. 10, o, 0, -0.4 Suppose 4f + 4c + 2 = 14, -3 = -f + 5c. Let l be 2-1(-6 + 2). Sort l, -1, f in decreasing order. l, f, -1 Let x be (-2)/7 - 168/(-245). Let u = -388/945 - -2/189. Let w = -6/13 + 80/117. Put u, x, w in decreasing order. x, w, u Let t = 5 - 3. Let b(v) = -3v*2 - 24v - 22. Let p be b(-2). Put t, 5, p in ascending order. t, 5, p Let i be 03(-2)/(-12). Suppose i = 2v + 1 + 3. Let o = -6.4 + 6. Sort o, v, 2/3. v, o, 2/3 Let c be (2/(-180))/(14/112). Let x = c + -23/45. Let u = -19 + 15. Sort u, 1/4, x in increasing order. u, x, 1/4 Suppose -47h = 41h + 352. Sort 3, h, 7, 0. h, 0, 3, 7 Let p be 1-4 + 1/(-1). Let y be (-5)/((-15)/(-12)) - -4. Suppose -5m - 10 - 5 = y. Sort m, 3, p. p, m, 3 Let m be (-45)/128/(-3). Suppose -4p - 78 = -mp. Suppose w - p = -10. Put w, 2, -1 in increasing order. -1, 2, w Suppose 2n = -0n + 8. Suppose m - nm - 45 = 0. Suppose 0 = 3o - 4s + 3s - 19, -5s = -3o + 35. Sort m, -2, o in ascending order. m, -2, o Let l be (-1920)/1540 + (-6)/(-14) + 1. Sort l, 4/3, 8, -4. -4, l, 4/3, 8 Let d = 0.11 - 5.11. Let f = -5.1 - d. Put -4, -1/4, -2, f in decreasing order. f, -1/4, -2, -4 Let y(x) = -7x - 38. Let k be y(-6). Let o be (-1 - k/(-6))/((-14)/210). Sort -1, -2, -4, o in decreasing order. o, -1, -2, -4 Let p = -1.85 + -2.15. Put p, 0.06, 1/4, 0.4 in decreasing order. 0.4, 1/4, 0.06, p Suppose 2l = -4 + 2. Let c(t) = 7t + 0t - 2 + 1 - 3t. Let r be c(l). Sort 3, r, -3. r, -3, 3 Let w be (-4)/11 + 885/165. Sort -3, -12, w, -5. -12, -5, -3, w Suppose 1873 - 1885 = 4g. Sort -29, g, 1 in decreasing order. 1, g, -29 Let b be (-26)/143 + (-10)/(-55). Sort 2, b, -6 in decreasing order. 2, b, -6 Suppose -90 + 14 = -4f. Suppose f = 7d - 16. Put 12, 4, d in decreasing order. 12, d, 4 Let g(v) = v*2 + 7v + 2. Let b(n) = -n*3 + 2n - 2. Let r be b(2). Let o be g(r). Sort o, -2, 2 in decreasing order. 2, -2, o Suppose -9 = -a - 3o, 3o = -4a + 4o + 62. Let h be ((-4)/(-95))/(6/a). Sort h, 2/3, -2 in descending order. 2/3, h, -2 Let q = 36 - 1. Let z = q + -34. Sort z, 2/7, -1/4, 2/3. -1/4, 2/7, 2/3, z Let h(f) = 2f + 24. Let p be h(-26). Put p, -2/7, 0.1, 4 in decreasing order. 4, 0.1, -2/7, p Suppose 0 = -g + 182 + 86. Let n = 3482/13 - g. Suppose -d = 2l - 5, d + 3d - 2l + 30 = 0. Put d, 1, n in decreasing order. 1, n, d Let n = -559 - -555. Put n, -16, 4 in ascending order. -16, n, 4 Let x = -5.2 - -5. Let k = -1.6 - x. Let z = k + 0.9. Sort 4, z, -3. -3, z, 4 Suppose -4g = g - 255. Suppose -t + 103 - 34 = 4n, -t + g = 3n. Suppose 15v = nv + 6. Sort 1, -3, v in ascending order. -3, v, 1 Let i = -0.5 + 0.41. Let a = 7.29 + -10.2. Let t = i + a. Sort t, 2, 0 in descending order. 2, 0, t Let t = -11 + 16. Let y = 63 - 58. Suppose 2l + 0c - 9 = -yc, 0 = -3l - tc + 6. Put -1, 5, l in descending order. 5, -1, l Let a be (((-48)/5)/3)/((-4)/(-10)). Sort a, 1, 2, 0.4. a, 0.4, 1, 2 Let w = -114.9 - -115.3. Sort 4, 41, w in ascending order. w, 4, 41 Let f = -2 + 48. Suppose 3x - 2 + f = -4h, 2x + h + 21 = 0. Sort x, 4, 2 in decreasing order. 4, 2, x Suppose -5l = -15, -q + 5l - 17 = -2. Suppose -i + 41 = -4f, qi + 15 = 3i. Sort -4, f, -3/4. f, -4, -3/4 Let u be (-96)/7 + 42/(-147). Put 5, 3, -2, u in descending order. 5, 3, -2, u Suppose 0 = -2b - h + 25, -14h = -b - 17h + 5. Put b, -1, -5, 4 in ascending order. -5, -1, 4, b Suppose 110s = 106s - 16. Let j = -1 - 2. Sort j, 2, -5, s in increasing order. -5, s, j, 2 Let a = 2878/99 - 260/9. Let c = -285 + 282. Put c, -2, a in ascending order. c, -2, a Suppose 15 = 3d, -4f + 2f - 2d = -2. Let l be (-2)/f(-14 + 10). Let o = -3 - -4. Sort o, l, 2 in ascending order. l, o, 2 Let b = 42 - 42. Let u be (2 - -1) + -3 + b + 3. Sort u, 0.08, 1 in increasing order. 0.08, 1, u Let i be (25 - 19)1/15. Let u = 2 + -2.2. Put i, u, 5 in ascending order. u, i, 5 Suppose 12 - 54 = 42t. Put t, 106, -2, -5 in decreasing order. 106, t, -2, -5 Let g(u) = -7u - 4. Suppose 0 = -7y - 36 - 13. Let i be g(y). Suppose 0 = 10q - q - i. Sort 0.5, q, 0. 0, 0.5, q Let p(d) = -d3 - 16d*2 + 18d + 42. Suppose 0 = -g + h - 36 + 14, g + 37 = 4h. Let l be p(g). Sort 4, -2, l in descending order. l, 4, -2 Suppose 54w = 49w + 10. Suppose 4 - 1 = -a. Sort -2, w, a in increasing order. a, -2, w Let f be (-5)/(-3(-3 - (-32)/12)). Suppose 0 = i + 3i - 16. Sort 2, -4, f, i. f, -4, 2, i Let c be (-2 + 0)/((-16)/(-32)). Sort -5, 32, -10, c in decreasing order. 32, c, -5, -10 Let w(f) = -f3 - f2 + 46f - 80. Let t be w(2). Suppose q + 26 = -q. Let k(a) = -a*3 - 6a*2 - a - 2. Let h be k(-6). Sort h, q, t in descending order. h, t, q Let z(k) = 5k + 25. Let v be z(-4). Sort 1, 0, v, 10. 0, 1, v, 10 Suppose 0 = 4i + 20, -3i - 1 + 2 = 4r. Suppose 0 = 5q + r - 54. Let t = q + -10. Sort -2, t, -5 in decreasing order. t, -2, -5 Let l(q) = -q*2 + q - 3. Let g be l(0). Let m = g - 1. Let f be (-1 + 26/24)/((-8)/16). Sort m, f, 4. m, f, 4 Let s = -1018 + 1025. Let o = -2 + -1. Sort s, 2, o in ascending order. o, 2, s Let b = 79395/14 - 5671. Let q(u) = u + 1. Let f be q(-6). Let v be 2/52(-8)/2. Sort b, v, f in ascending order. f, v, b Let v = -34 + 33. Suppose 0 = 5q - 3 - 2. Suppose -2d = -n - 4, -q = 3n + 5d + 22. Put 2, n, v in ascending order. n, v, 2 Let j(f) be the second derivative of -f3/6 + f2/2 + 4f. Let i be j(-2). Suppose 4p + 3k = -2, -ik = p - 4 + 9. Sort -1, p, -3 in decreasing order. p, -1, -3 Let p = -9 - -37. Suppose 5a - 2a = 5o - 89, -4a = -o + p. Let z be (3 + (-44)/o)/(-1). Put 5, z, -4 in decreasing order. 5, z, -4 Let u(d) be the first derivative of d*4/4 + 7d3/3 - d2/2 + 9d + 1. Let r be u(-7). Let t = r + -17. Put t, -3, 5 in descending order. 5, t, -3 Let z = -34 - -32. Let d = 5 + z. Suppose d = -2k + k. Sort 3, 2, k. k, 2, 3 Suppose -192 = 11j - 71. Sort j, 1/5, 3, -2. j, -2, 1/5, 3 Let y = -11.27 - -0.27. Let x = y - -16. Let t be ((-54)/(-9) - 8)(-1)/10. Sort t, 4, x in descending order. x, 4, t Suppose 27u = 22u + 20. Suppose -7c + 6 = -uc. Let m be (2/4)/(1/2). Sort c, m, 0. 0, m, c Let b = -52 - -113. Let d = -62 + b. Sort -10, -3, d in ascending order. -10, -3, d Let n = -19 - -19. Suppose n = -i - 7 + 8. Let s(w) = w*3 + w - 2. Let v be s(0). Sort -5, i, v in ascending order. -5, v, i Let h be ((-140)/(-8))/(-7)(-1 - 1). Put -3, h, 39, 2 in descending order. 39, h, 2, -3 Suppose 312c - 310c = 0. Let d = 12 + -7. Sort -1, c, d in decreasing order. d, c, -1 Let r = 0.0403 - -0.2597. Put -5, r, -6/11, 1/3 in ascending order. -5, -6/11, r, 1/3 Let m = 49 + -50. Suppose 0 = 3l + 4 + 11, -2l = 4b - 2. Suppose 2z - 3v + 4 = 0, 0 = -z - 4v + v - 2. Sort b, z, m in decreasing order. b, m, z Let a(f) = -f*3 - 8f*2 - 12f - 23. Let n be a(-7). Let y = n - 12. Sort y, -1, 4 in descending order. 4, y, -1 Let c be 4 + (3 - 4) + 2. Let p = 8 + -5. Suppose -9 = pj - 3k, j = 5j + 2k - 6. Put c, j, 2 in descending order. c, 2, j Suppose 0 = m - 0m + 5u - 32, 0 = -4m + 3u + 36. Suppose 6x - 12 = m. Sort -8, x, -5 in ascending order. -8, -5, x Suppose -4w + 22 = -2g, -4g - 2w - 6 = -12. Sort 1, g, 0, -2 in decreasing order. 1, 0, g, -2 Suppose 5f = -9 - 16. Let n(g) = g. Let s(k) = 4k + 8. Let z(i) = -3n(i) + s(i). Let v be z(-6). Sort 5, f, v in increasing order. f, v, 5 Let o = 1261 + -1261. Sort -5, o, -23 in descending order. o, -5, -23 Suppose n + n = -4k + 460, -3n = 4k - 464. Let z = 109 - k. Let c be ((-1)/1)/(2/(-4)). Put z, c, 0 in ascending order. z, 0, c Suppose 9i + 4 = 6i + 4f, -5f + 20 = 0. Suppose -u = -4 - 14. Let g be (-3)/(-8)8/u. Put i, -0.5, g in descending order. i, g, -0.5 Let y be (2/3 + -1)(-59 - -44). Sort y, -1, 3 in descending order. y, 3, -1 Suppose r - 6 = -3t, -4r - 12 = t + r. Suppose 7 + t = a. Suppose -3j - a = -8j. Put 1.4, j, 2/7 in ascending order. 2/7, 1.4, j Let f be 14/6 + 4/6. Let i be 3 - f/(12/8). Let a be ((0 - 3) + -1)1. Sort i, a, 3 in decreasing order. 3, i, a Let x(c) = 4c2 - 3c + 1. Let i be x(1). Suppose -4q - 3 = -q - 3t, 25 = 5t. Sort i, 14, q. i, q, 14 Suppose 2 = 2o + 12. Let h = 0.641 - 0.631. Put h, o, 1/2 in increasing order. o, h, 1/2	{ "pile_set_name": "DM Mathematics" }
1493284/3 = 0. What is t? -611, -4 Factor -4b4 + 172b*3 - 164b*2 - 172b + 168. -4(b - 42)(b - 1)*2(b + 1) Let 2a3/13 + 36a*2/13 + 94a/13 + 60/13 = 0. What is a? -15, -2, -1 Factor m*2/6 + 7m/3 - 16/3. (m - 2)(m + 16)/6 Factor -4w*2 - 152w + 320. -4(w - 2)(w + 40) Factor -p*2/2 + 110p - 219/2. -(p - 219)(p - 1)/2 Suppose -2z*3 + 138z*2 - 3024z + 21384 = 0. Calculate z. 18, 33 Factor -5t2 - 385t - 380. -5(t + 1)(t + 76) Find r such that 2r3/7 - 230r*2/7 + 4224r/7 + 148104/7 = 0. -17, 66 Find i such that 5i4 - 55i*3 + 25i*2 + 235i + 150 = 0. -1, 3, 10 Find i such that -5i4 + 20i*3 + 105i*2 + 20i - 140 = 0. -2, 1, 7 Let 7b4 + 12b*3 - 25b*2 + 6b = 0. What is b? -3, 0, 2/7, 1 Find s, given that -3s2 - 5790s - 5787 = 0. -1929, -1 Determine k, given that -k*4 - 9k*3 - 9k*2 + 41k + 42 = 0. -7, -3, -1, 2 Determine m, given that -30m5 - 8m*4 + 288m*3 + 68m*2 - 162m + 36 = 0. -3, -1, 1/3, 2/5, 3 Suppose 12t5 + 68t*4 + 36t*3 - 20t*2 = 0. Calculate t. -5, -1, 0, 1/3 Determine o, given that 2o*5/13 + 120o*4/13 + 2400o*3/13 + 16000o*2/13 = 0. -20, 0 Solve 26a*2 + 62a + 20 = 0. -2, -5/13 Suppose 72q5 + 48q*4 - 22q*3 + 2q*2 = 0. What is q? -1, 0, 1/6 Solve -4p*3 + 24p*2 - 32p = 0. 0, 2, 4 Let 4k2 + 364k - 368 = 0. Calculate k. -92, 1 Factor -4x2 + 1614x - 2412. -2(x - 402)(2x - 3) Let -51s*3 - 1539s*2 - 11745s - 2025 = 0. Calculate s. -15, -3/17 Determine m, given that m*5 - 25m*4/3 + 41m*3/3 + 13m*2/3 - 44m/3 + 4 = 0. -1, 1/3, 1, 2, 6 Determine g so that -2g5/19 + 28g*4/19 + 198g*3/19 - 3968g*2/19 + 12760g/19 - 11616/19 = 0. -12, 2, 11 Find m such that -2m2 + 322m - 320 = 0. 1, 160 What is c in -165c5/4 + 1271c*4/4 - 1751c*3/4 + 337c*2/4 + 80c - 3 = 0? -1/3, 2/55, 1, 6 Determine n so that 14n5/3 + 338n*4/9 + 520n*3/9 + 8n*2/3 = 0. -6, -2, -1/21, 0 Determine f, given that -6f*2 + 14f = 0. 0, 7/3 Suppose -4q4 + 24q*2 + 32q + 12 = 0. Calculate q. -1, 3 Find d, given that 11045d4 + 23030d*3 + 12945d*2 + 980d + 20 = 0. -1, -2/47 Determine g, given that g*5/2 - 3g*4 + 9g*3/2 + 2g*2 - 6g = 0. -1, 0, 2, 3 Determine u so that -3u3 + 12u*2 - 3u - 18 = 0. -1, 2, 3 Solve -i*5/3 + 7i*3/3 + 2i*2/3 - 4i - 8/3 = 0. -2, -1, 2 Solve s*5 - 11s*4 - 16s*3 + 44s*2 + 48s = 0. -2, -1, 0, 2, 12 Determine h so that -5h4 + 2045h*3 + 4105h*2 + 2055h = 0. -1, 0, 411 Solve 2h2 + 20h + 48 = 0 for h. -6, -4 Let 5p5 + 1765p*4 - 3550p*3 + 10p*2 + 3545p - 1775 = 0. What is p? -355, -1, 1 Find b, given that 5b4 - 160b*3 - 170b*2 + 160b + 165 = 0. -1, 1, 33 Determine i, given that -i*3 + 105i*2 + 324i = 0. -3, 0, 108 Find u, given that -u*2 + 62u + 639 = 0. -9, 71 Find k such that k*2/4 + 193k/2 + 37249/4 = 0. -193 Find g, given that -2g5/11 - 12g*4/11 + 6g*3/11 + 32g*2/11 - 24g/11 = 0. -6, -2, 0, 1 Let -z*3/3 - 11z*2/3 + 25z/3 - 13/3 = 0. What is z? -13, 1 Factor 8d3/5 - 10d*2 + 12d/5. 2d(d - 6)(4d - 1)/5 Factor -2o5/7 - 2o*4 + 4o*3/7 + 92o*2/7 - 130o/7 + 50/7. -2(o - 1)3(o + 5)*2/7 Solve 15a*3 + 39a*2 + 12a - 12 = 0. -2, -1, 2/5 Factor -2t2 + 332t + 334. -2(t - 167)(t + 1) Let -12f5 + 9f*4 + 183f*3 + 321f*2 + 189f + 30 = 0. Calculate f. -2, -1, -1/4, 5 Let 2f4/3 - 8f*3/9 - 298f*2/9 - 188f/9 + 32/3 = 0. What is f? -6, -1, 1/3, 8 Factor -361d2 - 57d - 9/4. -(38d + 3)2/4 Factor 50p*4/7 - 8460p*3/7 + 354458p*2/7 + 287640p/7 + 57800/7. 2(p - 85)2(5p + 2)2/7 Solve 3v*2 - 27v + 54 = 0 for v. 3, 6 Factor -8l2 - 56l - 98. -2(2l + 7)*2 Factor 4r*2 + 24r. 4r(r + 6) Factor -2h2/9 - 34h/3 + 104/9. -2(h - 1)(h + 52)/9 What is y in 10y5/9 + 14y*4 - 232y*3/9 - 448y*2/9 + 256y/3 - 224/9 = 0? -14, -2, 2/5, 1, 2 Factor -o*3/3 + 4o*2/3 + 11o/3 + 2. -(o - 6)(o + 1)2/3 Suppose 16d*5 - 56d*4 + 33d*3 + 28d*2 + 4d = 0. What is d? -1/4, 0, 2 What is h in -h*3/4 - 18h*2 + 73h/4 = 0? -73, 0, 1 Factor -3b2/2 - 3b/2. -3b(b + 1)/2 Factor -5x5 - 5x*4 + 5x*3 + 5x*2. -5x*2(x - 1)(x + 1)2 Let 3w*2/7 - 18w/7 = 0. Calculate w. 0, 6 Factor -d*3/2 + 69d*2 - 135d/2 - 137. -(d - 137)(d - 2)(d + 1)/2 Solve 2l5 - 2l*4 - 28l*3 + 48l2 = 0. -4, 0, 2, 3 Determine j, given that j3 + 13j2/2 + 23j/2 + 6 = 0. -4, -3/2, -1 Find s such that -5s3/2 - 1230s*2 + 2475s/2 + 2465 = 0. -493, -1, 2 Factor -g*3/5 + 52g*2/5 - 128g + 2304/5. -(g - 36)(g - 8)2/5 Let -4g*3 + 16g*2 + 12g - 72 = 0. What is g? -2, 3 Factor h*4/3 + 162h*3 + 25740h*2 + 1252350h - 13476375. (h - 9)(h + 165)3/3 Suppose l4/3 + l3/3 - l2/3 - l/3 = 0. Calculate l. -1, 0, 1 Solve -28x*5/5 + 316x*4/5 - 96x*3 - 224x*2 + 2368x/5 - 576/5 = 0 for x. -2, 2/7, 2, 9 Suppose j*2/3 - 146j + 872/3 = 0. Calculate j. 2, 436 Factor 5s4 + 40s*3 + 75s*2 - 20s - 100. 5(s - 1)(s + 2)*2(s + 5) Factor -2s2 - 22s. -2s(s + 11) Factor -3w3 - 12w*2 + 33w - 18. -3(w - 1)2(w + 6) Find j, given that -5j5 - 15j*4 + 25j*3 + 75j*2 - 20j - 60 = 0. -3, -2, -1, 1, 2 Let -5x4 + 45x*3 + 225x*2 - 565x + 300 = 0. Calculate x. -5, 1, 12 Determine q, given that q*5/7 + 10q*4/7 - 2q*3 - 32q*2/7 + 13q/7 + 22/7 = 0. -11, -1, 1, 2 Factor -f*3/2 + 3f*2/2 + 13f/2 - 15/2. -(f - 5)(f - 1)(f + 3)/2 Let o*2/6 + 457o + 626547/2 = 0. What is o? -1371 Find y such that 3y4/8 - 9y*3/4 + 15y*2/8 + 9y - 27/2 = 0. -2, 2, 3 Determine n, given that -n*3/7 + 2123n*2/7 - 1127843n/7 + 1125721/7 = 0. 1, 1061 Determine s, given that s*3/4 + 5s*2/4 - 17s/4 - 21/4 = 0. -7, -1, 3 Suppose -2t5/9 + 2t*4/9 + 20t*3/9 - 20t*2/9 - 2t + 2 = 0. What is t? -3, -1, 1, 3 Find r such that 5r5 - 70r*4 + 350r*3 - 780r*2 + 765r - 270 = 0. 1, 3, 6 Find s, given that -69s5/2 - 135s*4 + 219s*3 + 120s*2 - 369s/2 + 15 = 0. -5, -1, 2/23, 1 Let -5b5 - 5b*4 + 125b*3 + 125b*2 = 0. Calculate b. -5, -1, 0, 5 Factor 2j*3 - 1452j*2 - 2j + 1452. 2(j - 726)(j - 1)(j + 1) Factor -t3/4 + 6t*2 - 59t/4 - 21. -(t - 21)(t - 4)(t + 1)/4 Suppose -140p2 - 615p - 220 = 0. What is p? -4, -11/28 Factor -288o2 + 90o + 2. -2(3o - 1)(48o + 1) Factor r*4/4 - 13r*3/2 + 11r*2 + 26r - 48. (r - 24)(r - 2)2(r + 2)/4 Suppose p4/3 + p3/3 - 58p2/3 - 256p/3 - 96 = 0. What is p? -4, -2, 9 Let -3v5/4 + 15v*4/2 - 24v*3 + 57v*2/2 - 45v/4 = 0. What is v? 0, 1, 3, 5 Suppose 4p4 - 60p*3 + 104p*2 = 0. What is p? 0, 2, 13 Suppose -14s*4 - 144s*3 - 418s*2 - 360s - 72 = 0. Calculate s. -6, -3, -1, -2/7 Factor -a*5/3 + 196a*4/3 + 132a3. -a3(a - 198)(a + 2)/3 Factor -i*2/5 - 2i/5 - 1/5. -(i + 1)2/5 Find f such that f5/3 + 2f4/3 - 2f*3 - 8f*2/3 + 5f/3 + 2 = 0. -3, -1, 1, 2 Factor -t*2/3 + 49t/3 - 86. -(t - 43)(t - 6)/3 Factor 4s*2 + 9608s + 5769604. 4(s + 1201)2 Factor -4k*3 + 124k*2 + 696k + 864. -4(k - 36)(k + 2)(k + 3) Find f such that -2f*5/7 - 228f*4 - 319992f*3/7 - 633616f*2/7 = 0. -398, -2, 0 Find i, given that 16i*5 + 3i*4 = 0. -3/16, 0 Determine d so that 6d*5/5 - 51d*4/5 + 123d*3/5 - 18d2 = 0. 0, 3/2, 2, 5 Let b2 - 87b + 86 = 0. Calculate b. 1, 86 Suppose 3g*4 + 24g*3 + 60g*2 + 48g = 0. What is g? -4, -2, 0 Factor -g*4/5 + 3g*3/5 + 6g*2/5 - 8g/5. -g(g - 4)(g - 1)(g + 2)/5 Factor a4/6 - 5a*3/3 - 13a*2/6 + 11a/3. a(a - 11)(a - 1)(a + 2)/6 Let -a4/6 - 2a*3/3 + 7a*2/6 + 11a/3 - 4 = 0. Calculate a. -4, -3, 1, 2 Determine q so that -2q3/7 + 678q*2/7 - 59760q/7 + 55112 = 0. 7, 166 Determine l, given that -16l5/9 - 6l*4 - 2l*3 = 0. -3, -3/8, 0 What is g in 5g*4 + 125g*3 + 115g*2 - 125g - 120 = 0? -24, -1, 1 Factor -2l3 + 42l*2 - 144l - 864. -2(l - 12)2(l + 3) Factor -3l2 - 201l - 198. -3(l + 1)(l + 66) Solve g*5/7 - 38g*4/7 = 0. 0, 38 Suppose 42p*5 - 1598p*4 - 1594p*3 + 1286p*2 + 1552p + 312 = 0. What is p? -1, -2/3, -2/7, 1, 39 Factor -15l2 + 99l + 42. -3(l - 7)(5*l + 2) Determine l, given that 5	{ "pile_set_name": "DM Mathematics" }
3 + 2)) + 7 is divided by 6? 3 Let n be -1 + 2/(1-2). Let y = 0 - n. Suppose 5c - yc = 45. What is the remainder when c is divided by 8? 7 Suppose 0 = 4d - 16 + 8. Calculate the remainder when d is divided by 2. 0 Let v be (10 + -1)/(-3) - -9. Suppose -4j + vj - 96 = 0. Calculate the remainder when j is divided by 25. 23 Suppose 411 = 25t - 22t. What is the remainder when t is divided by 35? 32 Suppose 4u + 5m - 40 = 0, 0 = -u + 3m + 2m - 15. Let d = -9 - -16. Calculate the remainder when d is divided by u. 2 Suppose 0 = 3c - m - 6, 6c + 2m = c + 10. Calculate the remainder when 4 is divided by c. 0 Let c(y) = y3 + 6y*2 + 7y + 5. Let n be c(-5). Let p = 8 - n. Suppose -p = 2w - 3w. What is the remainder when 37 is divided by w? 11 Let a(c) = -c*3 - 2c*2 + c. Let t be a(-3). What is the remainder when t1/((-3)/(-18)) is divided by 19? 17 Let i(n) = 2n2 - 20n + 25. Suppose 27 = 4l - 69. What is the remainder when i(11) is divided by l? 23 Suppose 2a + 3v - 45 = 0, 2a = -0a - v + 35. What is the remainder when a is divided by 6? 3 Calculate the remainder when 284 is divided by 290/7 + (-9)/21. 38 Calculate the remainder when 5 + -2 + 42 is divided by 4. 3 Let x = 21 + 14. What is the remainder when x is divided by 19? 16 Let f(b) = 6b - 8. Let v be f(8). Suppose 0 = -a + m + 21, -3a + 23 = m - v. Suppose 7 = w - 4. What is the remainder when a is divided by w? 10 Suppose 78 = -3q + 3g, -6q + 2g = -q + 133. Let d be q/(-6)(-16)/(-12). What is the remainder when 50 is divided by d/33 + (-141)/(-11)? 11 Suppose 4g = -0g - 4x + 60, 2g + 3x = 34. Suppose -3r + g = -13. What is the remainder when 21 is divided by r? 5 Let m(s) = s2 - 9s + 4. Calculate the remainder when 9 is divided by m(9). 1 Let h = 111 + -45. Suppose 2f + k - 2 = 0, 4f - 8 = -f - k. Suppose -h + 18 = -fw. Calculate the remainder when w is divided by 13. 11 Suppose -n = -6n + 210. Suppose -q - 2q + n = 0. Suppose 0 = -y + 2y - 8. Calculate the remainder when q is divided by y. 6 Suppose g + 39 = 14g. Calculate the remainder when 16 is divided by g. 1 Let k be (6/4)/((-3)/(-8)). Suppose kr = 2 + 10. Calculate the remainder when (-1)/(-1 + 7/8) is divided by r. 2 Let t = -20 + 33. Calculate the remainder when 37 is divided by t. 11 Suppose -4d + 2d = -68. Calculate the remainder when 99 is divided by d. 31 Let w = 8 - 14. Let t(z) be the third derivative of -z*4/8 - 2z*3/3 - 6z*2. What is the remainder when 40 is divided by t(w)? 12 Let u(m) = 8m*3 - 4m*2 + 3m. Let i(k) = 2k2 + 3k. Let l be i(-2). Calculate the remainder when u(l) is divided by 19. 16 What is the remainder when 30 is divided by 1/(-2 - (-115)/55)? 8 Calculate the remainder when 4 is divided by 7/3 + (-1)/(-3)-1. 0 Let w(f) be the first derivative of 3 + 8f + 1/2f2. Calculate the remainder when w(8) is divided by 6. 4 Let i(c) = -c - 5. Let z be i(-7). Suppose -5h + 6b = b - 50, -zh + 18 = -3b. What is the remainder when 23 is divided by h? 11 Let w be ((-2)/3)/(2/12). Calculate the remainder when (-2)/(w/50) + -3 is divided by 6. 4 Suppose -5z = -3s - 51, 6z = z - 2s + 66. What is the remainder when z is divided by 8? 4 Suppose 3y - 15 = -a + 2, a = -5y + 19. What is the remainder when 38 is divided by a? 10 What is the remainder when 65 is divided by (-2)/11 - (-1128)/33? 31 Let n(o) = o2 + 10o - 6. What is the remainder when 13 is divided by n(-11)? 3 Let q(i) = -i*2 + 28i - 57. What is the remainder when 85 is divided by q(25)? 13 Let t(s) = -s*3 - 19s*2 - 19s - 8. Let n = -59 + 41. What is the remainder when (-201)/(-7) + 4/14 is divided by t(n)? 9 Let c = 25 - -1. What is the remainder when c is divided by -3 + (-6)/2 + 15? 8 Suppose 0 = -4v - 0v - 2g + 296, -3g = -2v + 132. Let z = v - -2. Calculate the remainder when z is divided by 19. 17 Let v be ((-4)/(-3))/(4/6). Let b = 16 - 11. Suppose -2l + 97 = vl - 3w, 5w = bl - 120. What is the remainder when l is divided by 13? 12 What is the remainder when (-44)/(-3) + (-12)/18 is divided by 5? 4 Let h = -5 - -7. Suppose -hj - m = -9, 3m + 26 - 3 = 4j. Calculate the remainder when 17 is divided by j. 2 Calculate the remainder when 15 - (-3 - 1) - 0 is divided by 9. 1 Let m(z) = 28z - 3. Suppose -3s + 7 = 4p - 17, 4s = 2p + 10. Suppose pk + u = 41, -u = -5k - 24 + 87. What is the remainder when m(1) is divided by k? 12 Let f = -5 + 8. Let h be (-1)/4 + f/(-4). What is the remainder when (-14)/(h + 5/7) is divided by 25? 24 Let j = 4 - 2. What is the remainder when (j - 2) + 55/5 is divided by 7? 4 Suppose -4 = -k - 1, 4f + 4k - 168 = 0. What is the remainder when 114 is divided by f? 36 Let q(f) = -4f + 0f3 - 2 - 5 + f3 - 1 + 7f2. What is the remainder when q(-7) is divided by 7? 6 Let b(k) = k2 + 3k - 4. Let l be b(-9). Suppose o - 5p = l, 39 = o - p + 1. Let z = o - 20. Calculate the remainder when z is divided by 8. 7 Let y(k) = 3k*2 + 7k + 6. Calculate the remainder when 76 is divided by y(-4). 24 Let w = 95 - 55. Let f be 3 - 1/2-2. Suppose fx + 6m = m + 52, -w = -3x - 4m. What is the remainder when x is divided by 5? 3 Let m(o) = o3 - 10o*2 + 14o - 14. What is the remainder when m(9) is divided by 16? 15 Let z be (-1)/(0 + 1/(-74)). Let h = z - 47. Let s(o) = o*2 + 2o - 1. Calculate the remainder when h is divided by s(3). 13 Calculate the remainder when 7 is divided by 12/1510/4. 1 Let a(r) = 24r - 2. Calculate the remainder when a(6) is divided by 12. 10 Let i(z) = 11z2 - 2z - 1. Let t = -6 - -9. Suppose t = -4p - 1. What is the remainder when 23 is divided by i(p)? 11 What is the remainder when 112 is divided by ((-145)/(-20))/((-3)/(-12))? 25 Let r = -1 + 4. Let q(p) = p2 + p - 1. What is the remainder when 43 is divided by q(r)? 10 Suppose -51 = 5n - i + 2i, 0 = 4n - 3i + 56. Let a = n - -15. Let f = a - -3. Calculate the remainder when 13 is divided by f. 6 Suppose 15 = p - 19. Calculate the remainder when 168 is divided by p. 32 Suppose 0 = -4x + 108 - 36. Suppose -x = -4o - 2. Let c(i) = i2 - 3i + 1. What is the remainder when c(o) is divided by 2? 1 Suppose -2t + 2 = 0, -4i = 5t - 71 + 10. Calculate the remainder when 165 is divided by i. 11 Let d(a) be the third derivative of a5/60 + a4/12 - a3/6 - 8a*2. What is the remainder when 44 is divided by d(-6)? 21 What is the remainder when 1/((3/(-1))/(-9)) is divided by 3? 0 Let x = 21 - 12. What is the remainder when 33 is divided by x? 6 Let a = 6 + 1. What is the remainder when (1 + -3)/((-1)/5) is divided by a? 3 Let j = -2 + 4. Calculate the remainder when 10 is divided by (-2)/(-2 - (-3)/j). 2 Let x be 3/2 - (-165)/(-10). Let y = x + 21. What is the remainder when 10 is divided by y? 4 Suppose 5c + 6g - 525 = 3g, -5c + 5g = -525. Suppose 0 = 7j - 2j - c. What is the remainder when 82 is divided by j? 19 Suppose 3s - 760 = 8s. Let x be (2 - -1)/((-6)/s). Suppose -x = -3q + q. Calculate the remainder when q is divided by 13. 12 Let c(d) = d2 + 2d + 1. Let h be c(-1). Suppose h = o - 6 - 22. Let w = 37 + -22. What is the remainder when o is divided by w? 13 Let j be (-8)/63/(-2). Calculate the remainder when j + 214 + 3 is divided by 12. 9 Let n(a) be the first derivative of a3 - a2/2 + a + 12. Suppose -4m + 10 = 2. Calculate the remainder when 41 is divided by n(m). 8 Suppose 183 = 6h - 45. Calculate the remainder when h is divided by (-1 - 9)/((-1)/2). 18 Let a = 32 - 11. Let u = -7 + a. What is the remainder when u is divided by 8? 6 Suppose -3d + 34 = 3s + d, 0 = -s + d + 16. Calculate the remainder when s is divided by 5. 4 Let a = 147 + -115. What is the remainder when 125 is divided by a? 29 Let a(t) = -t + 1. Suppose 5 = 2c - 3c. Let u be a(c). Suppose 0 = uw - 5w - 7. What is the remainder when w is divided by 3? 1 Suppose 2t + 3g - 60 = -3t, -25 = 5g. Suppose -t + 100 = -5c. Let a = 42 + c. What is the remainder when a is divided by 14? 11 Suppose -10 = -2z - 0z. Suppose 0 = zx - 38 - 27. What is the remainder when x is divided by 5? 3 Calculate the remainder when 145/6 + (-5)/30 is divided by 9. 6 What is the remainder when 21 + 1(0 - 2) is divided by 4? 3 Suppose -3b + 7*b +	{ "pile_set_name": "DM Mathematics" }
st value? (a) g (b) 0.3 (c) -2 a Let o be 4/(-18)(-1 - (-5)/2). Let u = -0.37 - -0.07. What is the second smallest value in u, o, 1/3? u Let k be (-8)/(-4)6 - 3. Let v be 8 + 5/((-15)/k). Which is the third smallest value? (a) v (b) 0.2 (c) 3 a Suppose 2p = 4k - 16, 0k = 4k - 3p - 20. Let i be (39/k)/(15/20). Let w = -53/2 + i. Which is the biggest value? (a) w (b) 3/5 (c) -0.2 b Let w = -20 + 23. Which is the second biggest value? (a) w (b) -3/4 (c) -2/7 c Let z be 0 - ((-9)/(-6) - 0). Suppose -7 = 3i + 2o, 3 - 11 = i - 5o. Let n be -1i/422. Which is the third biggest value? (a) 2/5 (b) z (c) n b Let k be (-3)/12 - 3/84. Let s = 0.2 + 0. Which is the smallest value? (a) 1/4 (b) k (c) s b Let t(y) = -19y3 + 3y*2 - 2y + 3. Let h be t(2). Let s be h/2 - (-1)/(-2). Let i = 496/7 + s. Which is the smallest value? (a) i (b) 0.1 (c) -1/8 a Let r = -120 - -124. Which is the biggest value? (a) -1 (b) r (c) -0.4 (d) 5/4 b Let y = -2.88 + 2.58. Let q = -0.3 + -0.2. Which is the smallest value? (a) -1 (b) q (c) y a Let k = -6 + 6.02. Let o = k - 0.02. What is the biggest value in 1/2, o, -3? 1/2 Let g(h) = h*3 - 3h*2 + 3h. Let i be g(2). Let l be (12/(-16))/(i/(-8)). Let b be 0 - -1 - 21. What is the third smallest value in b, l, -0.2? l Let y = 422.96 - 464. Let g = y + 37. Let q = 0.04 + g. Which is the biggest value? (a) 5/4 (b) 5 (c) q b Let y be (-6)/(-27) + 98551/360. Let t = 274 - y. Let z = -29/440 - t. What is the third smallest value in 2/5, 3/7, z? 3/7 Suppose -3y = l - 2y, 3l = 2y. Let j = -23 + 27. Which is the smallest value? (a) j (b) l (c) -2 c Let s be -3(24/117)/4. Let k be 1/12 - 3/9. Which is the biggest value? (a) s (b) -1 (c) k a Let u = -3 - 0. Let o = u - 0. Let p = o - -7. What is the biggest value in 3, 1, p? p Let i be ((-1341)/(-290))/((-45661)/1277). Let w = i - 16/20755. Let v = 3/58 - w. Which is the third smallest value? (a) v (b) -2/13 (c) 2/17 a Let q = -576/1967 - -2/281. Let f = -221.6 - -222. Which is the second biggest value? (a) 0.2 (b) f (c) q a Let z = -12.7 - -13. Let n be (-30)/24 - (0 + -1). Which is the third biggest value? (a) n (b) z (c) -4 c Let k be (3/(-4))/((-21)/(-12)). Which is the second smallest value? (a) -5 (b) k (c) 1 b Let f = -3.6 - -1.6. Suppose 0g - 2g - 4 = 0. Let o be (-1)/((0 - g) + -1). Which is the second smallest value? (a) o (b) f (c) 5 a Let f = -45/19 + 547/247. Which is the smallest value? (a) 0 (b) 1/4 (c) f c Let u = 0.22 + -15.22. Let s = 13 + u. Which is the third biggest value? (a) s (b) 3/7 (c) -2/11 a Let t = -0.07 + 0.1. Let g = -122 + 126. What is the second biggest value in t, 1/2, g? 1/2 Let t = -1066/189 + 25/27. Let q = 36/7 + t. Let u be -3 + 2/(12/15). What is the second biggest value in u, q, 1/5? 1/5 Let y = 7.3 - 7.8. Let n(o) = -o*3 - 5o*2 - 2o + 2. Let p be n(-4). What is the second smallest value in 0.2, p, y? y Suppose -4c + 32 = 12. Let g = c - 5. What is the third smallest value in -5/6, g, -0.1? g Let d = 0.21 + 0.19. Which is the smallest value? (a) 0.1 (b) d (c) 1 a Let f = -94 + 68. What is the third biggest value in 3, -4, -5, f? -5 Let r = -2.6 - -2.4. Which is the smallest value? (a) -5 (b) -4/7 (c) r a Let y = -2 + 1.9. Let x = y + 4.1. Which is the second biggest value? (a) -3 (b) -1/3 (c) x b Let r = 10 - 5. Let x(o) = -o3 - 8o*2 - 8o - 4. Let m be x(-7). Which is the second biggest value? (a) m (b) r (c) -0.5 a Let t = -9.96 + 10. Let g = t + -1.04. Let y = -0.6 - -0.9. Which is the second smallest value? (a) y (b) -0.1 (c) g b Suppose -4w - 136 = -h, 2w - 6w = 2h + 148. Which is the third biggest value? (a) w (b) 4 (c) -1/4 a Let z be (-20)/(-14) - (-3 + 5). Let q = 14/437 - -24797/3496. Let n = q + -423/56. Which is the biggest value? (a) -2/11 (b) n (c) z a Let q be (-4)/2 - 22/(-2). Let z = 10 + -5. Suppose 2b = -b + 3m - q, -4b - zm = 21. What is the second biggest value in 5, -2/5, b? -2/5 Let r = 39 - 35. Let m be 16/2 + (0 - -1). Let n be (-38)/m + (-4)/(-18). What is the biggest value in -1/4, n, r? r Let w = -377 - -371.78. Let p = w - -0.22. What is the third smallest value in p, 5, 2/7? 5 Let n = 0.81 - -4.32. Let j = n + -0.13. Which is the third biggest value? (a) j (b) -1/5 (c) -5 c Let w = -131/3 - -911/21. Let x be (-1)/(-2)(8 + -6). Let v = 0.39 - -0.01. What is the second biggest value in w, v, x? v Let a = -44525/153 - -291. Let j be 46/(-51) + 4/6. Let q = a - j. What is the second biggest value in 2/3, q, -1? q Let d = 97 - 483/5. Let g = -8 - -8.2. Let p = 3.8 + g. Which is the third smallest value? (a) p (b) d (c) -1 a Suppose 0g + 23 = 5g + 4i, 0 = -2g - i + 8. Let m = -5 + g. Let s = 17/2 - 35/4. Which is the second smallest value? (a) -0.4 (b) s (c) m a Let f be (-339)/272/13. Let n = f - -28/13. What is the third biggest value in n, 3, 0? 0 Let x(m) = -m*3 + 11m*2 + m - 6. Let n be x(11). Which is the third biggest value? (a) n (b) 4/3 (c) 1 (d) -3/4 c Let v = -6 + 6. Let a be ((-4)/(-102))/(3/(-9)). What is the biggest value in v, -5, a? v Let r(x) = -2x*2 - 8x. Let t(w) = w*2 + 4w. Let p(h) = -6r(h) - 11t(h). Let i be p(-2). Which is the third biggest value? (a) -2/11 (b) 2/3 (c) i c Let q = -9 + 23. Suppose -3m = q + 4. Which is the second biggest value? (a) -4 (b) m (c) -0.5 a Let a = -0.4 + -0.1. Let l(w) = -w + 4 - w3 - w2 - w2 - w - 3w*2. Let m be l(-4). What is the smallest value in m, a, 0? m Let f(i) = -7i + 1. Let k(n) = 3n. Let x(g) = -2f(g) - 5k(g). Let m be x(2). Which is the third smallest value? (a) m (b) -2 (c) 5 c Suppose 0w + 20 = 5w. Suppose 0 = n + w. Which is the biggest value? (a) -1 (b) n (c) 0 c Let h = 0.83 + -0.13. Let n = 4.3 + h. Let r = -0.08 + -0.22. Which is the third biggest value? (a) -0.5 (b) r (c) n a Let d = -359/7 - -51. Which is the second smallest value? (a) -0.2 (b) -5 (c) d c Let n = -134 - -133.9. Which is the second biggest value? (a) n (b) 0.3 (c) -6 a Let o = -0.3 + 0. Which is the second biggest value? (a) -0.2 (b) o (c) 3 a Suppose -12 = 7g - 4g. Let v = 7 + -57/8. Suppose 0 = w + 4w. Which is the second smallest value? (a) w (b) v (c) g b Let r be 6/18 + (-13)/3. What is the third smallest value in -3, r, 0? 0 Let m = 12 + 4. Suppose 6 = -3i, -6d + 2d = 4i + m. What is the third smallest value in 0.5, 2/7, d? 0.5 Let f = -10 - -5. What is the biggest value in -0.4, f, -2/3? -0.4 Let x = -90 - -90.2. Which is the biggest value? (a) 0.3 (b) -42 (c) x a Let i = -33 + 34. Let w(l) = l - 2. Let c be w(i). Let z = -6/5 + 27/10. What is the biggest value in 4, z, c? 4 Suppose -q + 41 - 38 = 0. What is the third biggest value in q, 0.3, -0.3? -0.3 Let p be 1/5 - (-22)/(-10). Let u = -1 - 1. Let s be u + 5 + (-37)/13. What is the third smallest value in s, p, 0? s Let g be (-6)/(-4)(-52)/12. Let r = g - -7. Let c = 59/12 + -14/3. What is the second smallest value in -0.1, c, r? c Let n = -1 + 0. Let k = n + 0.6. Let x be (2/3)/(26/6). Which is the second biggest value? (a) 4 (b) x (c) k b Let b = -5.047 + 0.047. What is the smallest value in -1/6, b, -2? b Let j be 2/(-1) - (-216)/84. Suppose 2y = y + 3p + 2, -4y = -4p + 8. What is the third smallest value in y, j, -1/7? j Let g(v) = -v2 + 4v - 1. Let j be g(3). Suppose 3u + 0p = -5p - 15, -4u + jp = 20. Let k be 6/48/54. What is the third biggest value in 0.4, u, k? u Suppose 8v = 6v - 4. Let l be (-5)/((3 + -1)/(-2)). Which is the biggest value? (a) l (b) -1/3 (c) v a Let s = 0.14 + -0.14. Let p = 0.05 - 1.45. Let r = p + 1. Which is the biggest value? (a) s (b) r (c) 1 c Let k = -1.9 - -2. Let f = -0.07 - -0.02. Let m = -2.05 - f. What is the second smallest value in -0.5, k, m? -0.5 Suppose 0 = v - 4v - 9. Let f = -2 - -2.3. Which is the smallest value? (a) v (b) f (c) 0.2 a Let h = 9 + -7. Suppose hu = -6 + 2. What is the third biggest value in 0.2, -0.5, u? u Let h = 18 + -17.7. Let n = 304 - 1514/5. Which is the third smallest value? (a) 1/8 (b) n (c) h b Suppose -9 = -5j + q - 4q, 5q = -j - 7. Let g = -0.21 + 0.28. What is the third biggest value in g, 2/9, j? g Suppose -5q = 3*n	{ "pile_set_name": "DM Mathematics" }
Let g = c - -5.42. What is the closest to -1 in 0.2, 1.4, g? 0.2 Let w = 5804 + -40632/7. What is the nearest to 2 in 2, w, 2/7? 2 Let w = -302.2 - -25.8. Let h = w - -276. Which is the closest to -2? (a) h (b) 0 (c) 7 a Let i be ((-63)/(-483))/(6/(-4)). What is the closest to i in 0.1, 3, 2, -0.5? 0.1 Let t be (207/6)/((-2)/(-5 + 3)). Which is the nearest to 1/3? (a) -3/8 (b) t (c) 0.5 c Suppose -154013r + 154032r = 19. Suppose 4p + s = -3s + 4, 0 = -3p + s - 9. Which is the nearest to -6? (a) p (b) r (c) -1/10 a Suppose -14 = 9s - 2s. Let j = 342 - 342. Let q = -271/10 + 27. What is the closest to j in q, s, -4? q Let d = 14 + -15. Let x be 0d/3 + 12/24. Which is the nearest to 1/3? (a) -4 (b) -1/6 (c) x c Let d = -0.06387 + -0.93613. Which is the closest to d? (a) 8 (b) -3 (c) 1.1 b Let p be 27/6 - 4 - (78/16 - 4). Which is the nearest to 7? (a) 106 (b) 1 (c) p (d) 2 d Let w = -32.5 + 38. Let i = -0.5 - w. What is the nearest to -0.1 in 0, i, 0.1? 0 Let c = 748/8141 + -491276/1701469. Let n = c - -2/133. Let k = 130 - 130. What is the nearest to -0.2 in n, -3, k? n Suppose 8 + 12 = 5o. Let m be (-1 - -9) + -1 + -2. Let p(l) = -2l*2 - 57l + 373. Let n be p(-34). Which is the nearest to n? (a) o (b) m (c) -1/6 c Let s = 119/40 + -19/8. Let x = 21.5668 + -16.5668. What is the nearest to 0 in s, x, -25? s Let j(q) = -15q - 382. Let n be j(-22). Let r = 2 + -5. Which is the nearest to -0.1? (a) r (b) n (c) -1/3 c Let k = -4165.88 + 4166. What is the nearest to 1 in -32, 1/6, k? 1/6 Let h = -26015 + 26024. Which is the closest to h? (a) -1/2 (b) -19 (c) -4 (d) 3 d Let n = 636.806 + -636. Let p = 0.406 - n. Which is the nearest to -1? (a) -5/4 (b) -0.1 (c) p a Let f = -6.3 + 1.4. Let y = 3.07 - -0.83. Let m = f + y. Which is the nearest to -1? (a) m (b) 0.1 (c) 0.2 a Let u(l) = 11l*2 + 44l + 33. Let w be u(-1). What is the closest to -45 in 0.1, -6/17, w? -6/17 Let r = 3 - 4. Let y = -78.8 - -15.8. Let g = y - -63. Which is the closest to -2/7? (a) 0.4 (b) r (c) g c Let i be (198/(-30))/(-11) - 4/(-10). Let s = 532.4 + -532. Which is the nearest to 13? (a) 1/2 (b) i (c) s (d) -0.4 b Let t = -61 + 94. Let k = 28 - t. Let x = 11.2 - 11.2. What is the closest to x in k, -0.4, 1/7? 1/7 Let k be 21 - (-24250)/(-1170) - (-2)/(-39). What is the closest to 0.3 in 5/6, k, 12/5? k Let l = -3787 + 3782. What is the closest to 0 in 0, 1, 36, l? 0 Let v = 1 + -0.6. Let z = -71 + 69.57. Let i = z - -0.43. Which is the closest to i? (a) 1 (b) 4 (c) v c Let i be 0 + (-297)/(-13) + 60/390. Let v(p) = -6p + 133. Let o be v(i). What is the closest to 0.2 in -0.3, 1, o? -0.3 Let d = 0.5 + -1. Let q = 18.38 + -15.38. Which is the closest to -1/2? (a) q (b) 0.13 (c) d c Let q = 1.91 - 0.29. Let b = 0.12 - q. What is the closest to 4 in -4, -0.1, b? -0.1 Suppose -3x + 2 = -2h, 4x + 0h + 4 = -4h. Let w = 9 - -24. Let o = -33.5 + w. Which is the closest to x? (a) 2/5 (b) o (c) 0 c Let d be (-8)/(-1 - (4 + -3)). Let h = -10.6 + 11.2. Let i = 0.6 - h. Which is the closest to i? (a) d (b) 5 (c) -2/11 c Let h be (-3)/(228/(-24) - 6/(-12)). Which is the closest to 11? (a) 10 (b) h (c) -3 a Let j = 49 + 7. Let g be (-35)/j(131/55 - -1). Let q = g + 26/11. Which is the nearest to 1? (a) q (b) 4 (c) -1/7 a Let s = 4341.1 - 4340. Which is the nearest to 2? (a) s (b) 5 (c) -3 a Suppose -3u + l = -1129, -3u + 2l + 2l + 1114 = 0. Let y = -4156/11 + u. What is the closest to 3 in 30, y, -0.5? y Let w = 670 - 1055. Let a = w - -1535/4. What is the closest to 1/4 in -1/5, a, -0.5, -7/5? -1/5 Let w be (-3)/(-20)(-845)/1014. Which is the nearest to 2.3? (a) -4 (b) -2/9 (c) w (d) 1/13 d Suppose -2281 = 9f - 31. Let y = 246 + f. Which is the nearest to -1? (a) 15/7 (b) 1 (c) y b Let y = -2/1301 + -2584/11709. Let h = 15.1 + -14.94. Which is the nearest to -1? (a) 2/11 (b) h (c) -0.02 (d) y d Let w = -13703 - -13766. What is the nearest to 1 in w, 2, -0.5? 2 Suppose 485 = 77r + 177. Which is the closest to -1? (a) 198 (b) r (c) 2/11 (d) 0 d Let m be -227(-42/12)/(-10). Let o = 74/5 + m. Let d = -10 - -7. Which is the closest to 0.1? (a) d (b) o (c) -0.1 c Let r = -147 - -145. Let o(k) = -k*2 - k + 5. Let v be o(0). Suppose -vw = -4 - 1. What is the nearest to -1 in w, r, 0.4? r Let w = 2864.7 - 3252. Let j = w + 387. What is the nearest to 1/2 in j, -14, 0? 0 Let j be 18/15(-100)/(-210)7. Which is the closest to 0.2? (a) -2/9 (b) -0.43 (c) j (d) -1/2 a Let k = 4819/12848 + -1/12848. Which is the closest to 1? (a) 7 (b) -2/5 (c) k (d) 3/14 c Let g = 93 + -96. Let z be 21 + -15 - (-13)/g. Which is the closest to 1? (a) 0.2 (b) -3/4 (c) z (d) -0.5 c Suppose 19i - 156 = 13i + 58i. Which is the nearest to -1? (a) i (b) 0 (c) 5 (d) 2.4 b Let d = -1/123 + -361/984. Let n = 184 - 189. Let h be 6/(-10) - 34/(-40). What is the nearest to h in -0.1, n, d? -0.1 Let f = -3368 + 3368.4. Let u = 6 + -6.5. Which is the nearest to f? (a) -3 (b) u (c) 2 b Let f be ((-986)/119)/297. Let n = -2.1 + 2. Which is the nearest to n? (a) -4 (b) 4 (c) f c Let d(p) = -2p - 2. Let w be d(21). Let j be ((-8)/w - 0) + (-4)/(-99). Let h = -51 + 56. Which is the nearest to -1/3? (a) j (b) -0.3 (c) h b Suppose -d + 4d = -5s + 22, -4s + 5d = -25. Let t be (-2)/(-10)(-6 + (-184)/(-24)). Let r = -98/3 - -33. Which is the nearest to t? (a) -6/5 (b) r (c) s b Let x = -1.9 - -2. Let n = 0.87 + -0.37. Let u be 79/(-474)(3 + -2 + -3). What is the closest to x in -3, u, n? u Let k = -65.752 + 63.752. Let d = -0.06 - 2.94. What is the nearest to 2/11 in 2, d, 1, k? 1 Let x = -2796 + 8386/3. Let l = 7 + -5.6. Let n = 1 - l. Which is the closest to -5/2? (a) -5 (b) n (c) x c Suppose 11 = a + 3v, -2a - v - 1 = -3. Let d be 14/49(-29)/(-2). Let t = 166/35 - d. What is the closest to -1 in -0.2, t, a? a Let t = 1778 - 1778.08. Which is the closest to 0.1? (a) t (b) -15 (c) -0.5 a Let f be (-102)/68((-22)/(-18) + -1). What is the nearest to -278 in f, -0.2, -4/3? -4/3 Let q = 1.9 - 2. Let l = -237 - -342. Let h = l + -101. Which is the nearest to 0.3? (a) -3 (b) q (c) h b Let q = 17.25 + -17.36. Let y = 10.79 - 11. Let w = y - q. Which is the nearest to w? (a) 1 (b) 0.3 (c) -2/7 c Suppose -4j + 4l = 308, 0l = -3j + 4l - 228. Let k be (-452)/j + -5 - 3/12. What is the closest to k in 5, 2, 0.1? 0.1 Suppose 262r = 265r + 954. Which is the closest to r? (a) -3 (b) 4 (c) 0.5 (d) 0 a Let s = -10075 - -10075.2. Which is the nearest to 0? (a) 5/2 (b) -9/5 (c) -4 (d) s d Let v = 4468/203 + -630/29. Which is the nearest to v? (a) -0.6 (b) -41 (c) -0.2 c Let w = -252 + 257. Let j = 0.4 - 0.6. What is the closest to -1 in -2, j, w? j Let x = -11648.7 - -11649. What is the nearest to -0.07 in 0, 12, x? 0 Suppose -4m + 6m = -10. Let g = 0.0284 - -5.3416. Let d = g - 0.37. What is the nearest to 0.2 in m, d, -4? -4 Let w be 20/(-1023)(-1944)/225. Let p = 2/155 + w. Which is the closest to -2? (a) p (b) 2 (c) 5 a Let t = 963 - 962.6. Let o be 4 - (-4)/(-2) - 2. What is the closest to o in -4, t, -3? t Let k = 50568 - 50573. Let j = 1.1 + 2.7. Which is the closest to 1? (a) -0.5 (b) j (c) k (d) 0 d Let u = 0.2254 + -0.4254. What is the closest to 0.8 in -0.1, 2, u, 1? 1 Let l = -52 + 309. Let f = -253 + l. Which is the nearest to -2/3? (a) -5 (b) -4 (c) 2 (d) f c Let v = -0.05 + 0.45. Let m = 4.0324 - 4.15. Let s = m - -0.0176. What is the nearest to s in v, -2/5, -1/4? -1/4 Let f = 12.008 - 12. Let v = f - -0.012. Let z = 3.02 - v. What is the closest to -0.1 in -3, -4, z? -3 Let f be (2/(-8)-10)/(645/516). Which is the closest to 1/5? (a) 63 (b) f (c) -2/33 c Let k = -1.98 + -0.02. Let v = -1.5 - k. Let t = -2.8287 + 1.8287. Which is the nearest to t? (a) 0.7 (b) v (c) -0.5 c Let n = 345 + -219. Let v = n + -127. Let k = 64/3 - 22. Which is the closest to v? (a) k (b) -0.22 (c) 5 a Let x = -1446.3 - -1446. What is the nearest to x in -7, -3/7, -5/2? -3/7 Let t = 4624 + -4628. What is the nearest to 0.04 in -0.4, t, -2/3? -0.4 Let v = -1483 + 1546. What is the nearest to -1 in v, -0.4, -1/3, -3/2? -3/2 Let x = -8.3 + 8. Let p = 14/5 + -103/	{ "pile_set_name": "DM Mathematics" }
What is the closest to -228/13 in -1, 3/2, -0.01? -1 What is the nearest to -53 in -1/5, -2, 0.4, -0.05, 2? -2 What is the closest to -1479 in -3, -9, 1/6, 3? -9 What is the nearest to -16 in 1/8, -4, -395/3? -4 What is the nearest to 17 in 415, 3/4, 0? 3/4 What is the closest to -2/9 in 6.2, 3, -105, 4, -3? -3 What is the nearest to -2 in -1, 0.02, 64/17? -1 Which is the nearest to 2/31? (a) 2/19 (b) -1/4 (c) -1/3 (d) -21 a What is the nearest to 1 in 0.5, -509438, 1? 1 Which is the nearest to -1? (a) 2/7 (b) 413 (c) 3 (d) 0 (e) -4 d What is the nearest to -1 in 4, -2/141, -2, -1/2, 5? -1/2 Which is the nearest to -1/2? (a) 0.3 (b) -1/2 (c) -0.004 (d) -1/14 (e) -2 b What is the closest to 5654 in 2, -4/5, -1/6, -1? 2 What is the nearest to -2.1 in -2, -2.8, 1? -2 What is the closest to -1 in -2/7, 24, 272, 8, -5? -2/7 What is the nearest to -37 in -2, -7/6, -1? -2 Which is the closest to 0.3? (a) 3/10 (b) -1 (c) -2/9 (d) 0.043 (e) -3 a Which is the nearest to -4/7? (a) -2 (b) -20 (c) -1.8 c Which is the closest to -1/3? (a) -1/10 (b) -0.4 (c) 150.735 (d) 3 b Which is the nearest to 1? (a) -4 (b) -0.015 (c) 35 b Which is the closest to 11/80? (a) 3 (b) -2/21 (c) -0.1 (d) -0.06 d Which is the closest to -2/3? (a) 1/4 (b) -7 (c) 21 (d) -4/7 (e) -1 d Which is the nearest to -0.3? (a) 19 (b) 167 (c) -2/35 c What is the closest to -0.1 in -7, -10, 14, -0.4? -0.4 Which is the nearest to 2264? (a) -11 (b) -5 (c) -3 c Which is the closest to -0.02? (a) -2 (b) 8719 (c) -0.3 (d) 0 d Which is the closest to 43/3? (a) 1/5 (b) 0.021 (c) 1/4 c What is the nearest to -1/3 in 6, -5, 0? 0 What is the nearest to -1.57 in -2, 1, -5, 0.5? -2 Which is the nearest to -1/3? (a) -0.093 (b) 2 (c) -2/5 (d) 7 (e) 1/4 c What is the nearest to 8.5 in -2, -2/15, 23, 0? 0 Which is the closest to 281? (a) -0.1 (b) 1 (c) -1/6 (d) -2/7 b Which is the closest to -1/3? (a) 166 (b) -3 (c) 3 (d) -1 (e) -1.5 d What is the nearest to -2/13 in 2/11, -3483, 5? 2/11 What is the nearest to 166/9 in 2, 2/11, -1/7? 2 Which is the nearest to 2/5? (a) 3104 (b) 3/4 (c) 204 (d) 0 b Which is the nearest to -1? (a) -72 (b) -2 (c) 7 (d) 5 b Which is the nearest to -3? (a) 3 (b) 1/3 (c) 62/47 (d) -0.2 d What is the closest to 3/7 in 0.3, 3, 228, -1/3, -2/5? 0.3 Which is the nearest to -48? (a) -3/4 (b) -3/2 (c) 2 (d) -2.5 d What is the closest to -2/11 in -4/5, 0, 3/23, 2/7? 0 Which is the nearest to 2/9? (a) -16 (b) 2/5 (c) 16 (d) 44 b What is the closest to 0 in 55/3, -2/5, 392? -2/5 What is the closest to -1 in -11, 136, -2, 0.27? -2 What is the closest to 0.1 in 4, 0.04, 13, -1? 0.04 Which is the nearest to -1? (a) -2/65 (b) -13 (c) -11 a Which is the closest to 303? (a) 2.13 (b) -3 (c) 5/4 a What is the closest to 0.08 in -1/3, -0.4, -2/7, -1/34, -5? -1/34 What is the closest to 27 in 23/5, 41, -2/7? 41 What is the nearest to 2/5 in -2286, -0.3, 2/5, -2/7? 2/5 What is the nearest to -3 in -18/11, 0.3, 7, -71/2? -18/11 Which is the closest to -2? (a) 3/7 (b) -1/38 (c) 11/7 (d) 0.1 b Which is the nearest to 5/3? (a) -0.3 (b) 2 (c) 0.2 (d) -2/15 (e) 31 b What is the nearest to -1 in -1/824, -2/19, 5, 2? -2/19 What is the nearest to -1 in -1.9, -3/2, -1764, 1? -3/2 What is the nearest to 9 in -0.1, 0.3, -0.06, -31, 5? 5 What is the closest to -15 in -0.1, 638, -3, 4? -3 What is the closest to 0.4 in -34, -13, 0, 3/7? 3/7 What is the closest to 2 in -270, -2, -0.1? -0.1 What is the nearest to 2/59 in 0.21, 2/15, -1/5? 2/15 Which is the closest to -2? (a) 7 (b) 8 (c) -4/7 (d) -1/4 c Which is the closest to -0.1? (a) 447 (b) -5 (c) -1 c What is the closest to -2 in 5, 11, 0.2, 3/8, -157? 0.2 What is the nearest to 15.8 in 0, 0.4, 1, 514? 1 What is the closest to -1/6 in -4, 15, 2, 0.21? 0.21 Which is the closest to -3? (a) 1/4 (b) 47 (c) -26 a Which is the nearest to -1/10? (a) -2/119 (b) -0.28 (c) -2 (d) -4 a Which is the nearest to 18? (a) 127 (b) 3 (c) 1 b What is the nearest to 2 in 42, -1.06, 11? -1.06 What is the closest to 1 in -0.1335, -1/4, 1/3, -17? 1/3 Which is the nearest to 1/9? (a) -5 (b) -2 (c) 0.05 (d) 2/1981 c Which is the nearest to 0? (a) -1/3 (b) 0.4 (c) 0.5 (d) -10 (e) 11/1118 e What is the nearest to 31 in 2, 0, -0.1, -3/13, 5? 5 Which is the closest to -9? (a) -10.9 (b) -0.037 (c) 2/9 (d) -3 a Which is the closest to -4? (a) -37 (b) -0.4 (c) -0.8 (d) -5 d What is the closest to 0.1 in -213, 1/2, -8, 22? 1/2 Which is the closest to 2/5? (a) 3 (b) 0.009 (c) 26 (d) 2/9 d Which is the closest to -1? (a) -0.1 (b) 1 (c) -212 a Which is the nearest to 1.2? (a) 2 (b) 1635 (c) 3 a Which is the closest to 8? (a) 0.5 (b) 3 (c) 0.33 (d) -2/15 b What is the closest to -3 in 149, -1/7, 1? -1/7 Which is the nearest to -1/2? (a) -3 (b) 116.2 (c) 30 (d) -7 a What is the nearest to -0.3 in 8, 0.37, 0.5, -0.7? -0.7 Which is the closest to -1/4? (a) -4 (b) 0.034 (c) -0.11 (d) 2 (e) 4 c Which is the nearest to 0.3? (a) -57 (b) 0.4 (c) 1 (d) 0.5 b What is the nearest to -1/258 in 1, 0.3, -1.7? 0.3 What is the nearest to -2 in 2/5, -1/46, 5, 1, -17? -1/46 Which is the closest to -1/3? (a) -1/8 (b) -54 (c) -0.2 (d) -124 c What is the closest to -121/4 in -16, 5/4, -0.3, -5, 21? -16 What is the closest to -537 in -517, -0.4, 0.2, 0.4? -517 Which is the nearest to -2/9? (a) 0.014 (b) 1 (c) 0.76 a What is the nearest to -0.05 in -4, -0.2, -0.5, 0.095? 0.095 Which is the nearest to 22? (a) 4/5 (b) 0 (c) 5 (d) -23 c Which is the nearest to -1? (a) -1 (b) 149 (c) 4 (d) -2/3 a Which is the closest to -0.3? (a) 25.6 (b) 5 (c) 9/37 c What is the closest to 328 in -3/5, 0.1, 2/11, 2/15? 2/11 Which is the nearest to 2? (a) -3 (b) 63 (c) 3 (d) 0.4 c What is the nearest to 0 in 2.8, 34, -0.2, -3/5, -1/8? -1/8 What is the closest to 1/7 in -2.3, 1, -16, -4? 1 What is the closest to -96/7 in 0, -5, 4, -0.5? -5 Which is the closest to 0? (a) 10/119 (b) -1/6 (c) -1 (d) -1/5 a Which is the closest to 10? (a) 3/7 (b) -1/3 (c) -3 (d) -1/10 (e) 5 e What is the closest to 0.096 in 4, -0.1, -98? -0.1 Which is the closest to -0.2? (a) 1/7 (b) -41 (c) 8 (d) 4 a Which is the closest to 1? (a) -51 (b) 1739 (c) 5 c Which is the nearest to -1? (a) -2/25 (b) 4/9 (c) 2 (d) -0.2 (e) -0.3 e Which is the closest to -6.404? (a) 3 (b) 0.5 (c) -0.2 (d) -27 (e) -2/13 c What is the nearest to -81 in 0, 2/3, 791? 0 What is the nearest to -1.5 in -1/7, 2/271, -6? -1/7 Which is the nearest to -3? (a) -1/9 (b) 6 (c) -0.08 (d) -1/2 (e) 2/13 d Which is the nearest to -0.3? (a) 4 (b) -1 (c) 0.0479 (d) -3/5 d Which is the closest to 858? (a) -35 (b) -1 (c) 1/4 (d) -0.1 (e) 2 e What is the closest to -1/3 in -0.06, -33/376, 1/7? -33/376 What is the closest to 0.5676 in -1, -10, -2/9? -2/9 Which is the closest to 2/5? (a) -125 (b) -1/2 (c) 0.2 (d) 2 c Which is the nearest to 0.1? (a) -11 (b) -0.506 (c) -3 b What is the closest to -1 in 73, -2026, -0.4? -0.4 Which is the closest to 11.6? (a) 34 (b) -4 (c) 3/43 c What is the closest to -0.08 in 2/17, -2666, 1? 2/17 What is the nearest to 0.2 in 0.4, -1/6, 1/7, -0.1, -1387? 1/7 What is the nearest to 942 in 2, 0.1, -3, -0.058? 2 Which is the closest to -0.1? (a) 5/9 (b) 9/97 (c) -0.1 c Which is the nearest to -3? (a) 1/3 (b) -16/3 (c) 0.5 b What is the closest to -10.2 in 5, -2, -0.4? -2 What is the nearest to -1 in 1.3, -1/9, 8, -1/5, 5/3? -1/5 Which is the nearest to -1? (a) 4/3 (b) -1/6 (c) -5162 (d) -5 b What is the closest to 0.2 in 11, 1/5, 5, 0.23? 1/5 What is the nearest to 0.1 in 4, 5, 133/3, 1/5? 1/5 Which is the nearest to -2/9? (a) 5 (b) -3 (c) -34 (d) 2 (e) 5/39 e Which is the nearest to -1? (a) 0.019 (b) -4 (c) -0.05 c Which is the closest to 1/2? (a) -0.1 (b) -3 (c) -953 (d) -1 (e) -2/9 a Which is the closest to -2/5? (a) -9 (b) -4/9 (c) -120 (d) -0.2 b What is the nearest to 0.2 in 2/3, 3, 385, -13? 2/3 Which is the nearest to 0.1? (a) -7 (b) -12706 (c) 4/3 c What is the closest to 10/3 in -12/19, 1/7, -0.5, 1/28? 1/7 Which is the closest to -16? (a) 5 (b) -4/9 (c) -1601 b What is the closest to 2 in -5, 26, -36? -5 W	{ "pile_set_name": "DM Mathematics" }
2 - 2 - 2a - a*2 + 5a*2 - 2a2 - a2 - a*2 + 3a*2 + (1 + 2 - 2)(5a2 - a2 - 3a*2). 73a*2 - 2a - 2 Expand (86 - 22x2 - 86)(2 - 3x - 1 + 0x). 66x3 - 22x*2 Expand (3w*3 - w + w)(-19 - 50 + 21 - 2w)(0 + w + 0). -6w5 - 144w*4 Expand 18g + 11g2 - 18g + (2g - 3g + 2g)(0 + 0 + 2g) - 2 + g2 + 8 + 3g - 3. 14g2 + 3g + 3 Expand (4 - 1 - 6)(-1 + 1 + 1)(-7 + 12y + 3y - 13y) - y - 2y + 0y. -9y + 21 Expand (10b2 + 108844 - 2b - 108844)(2 - b - 2). -10b*3 + 2b2 Expand (5 - 5 + o2)(-7o + 3o + 2o - 2)(-3o*2 - 2 + 2). 6o*5 + 6o*4 Expand (0w - 5 - 3w + 0)(2 - 2 - 4). 12w + 20 Expand 1 + t - 1 + (3 - 2 + 0)(-944t - 753t + 1084t). -612t Expand (11 - 4q2 - 130q + 130q)(-3q3 + 2q*3 + 2q*3). -4q*5 + 11q*3 Expand ((-2 - 4 + 2)(1 - 2c - 1) + 3c - 4c + 19c + 2 - 2 - c)(4c + c - 7c). -50c*2 Expand (-i + 2i + i)(0i + 0i + 3i) - 26i + 5i + 2i2 + 353 - 352. 8i*2 - 21i + 1 Expand (0 + 0 - a)(5a - 2a + 0a + (a + 0 + 0)(-2 + 0 + 1) - 16a + 14a + 6a + 1 - 1 + a). -7a2 Expand (-1 + 2 + 1)(-1 + 3 - 4)(4594w - 186 - 180 + 366). -18376w Expand (-1 - 28a + 10a - 8a)(-8 - 3 + 4). 182a + 7 Expand 10h2 + 8h*4 - 12h*2 + 4h*2 + (-1 + 3h + 1)(2h3 + h3 - h*3). 14h*4 + 2h*2 Expand (2d - d + 5d)(-3d + 6d + 8d). 66d*2 Expand (-2p - 2p + 5p)(-4p*3 + 3p3 - p3) + (11p2 - 7p*2 + 3p*2)(2p2 - 3p*2 - 10p*2 + 2). -79p*4 + 14p*2 Expand (-2196f*2 + 775f*2 - 6f*2)(-3f2 + 4f*2 - 2f*2). 1427f*4 Expand 2m*4 + 2m - 2m + (m2 + 3m*2 - 3m*2)(2m2 + 1 - 1) - 5m*4 - 18m + 17m + 18m. -m*4 + 17m Expand -2q5 + 2q5 + q5 + (q2 - q2 - 2q4)(3 - 3 - q) + 33q5 + 27q*5 - 27q*5. 36q*5 Expand (2t + t - t)(-2t3 - 1 + 1) + t3 + 74t + 230t - 431t + 2t*4. -2t4 + t3 - 127t Expand (-3z + 3z + 3z)((-1 - 3 + 9)(-2 + 8z + 2) - 2z + 7 - 7). 114z2 Expand (1 + 0 + 0)(18 - 12 - 7 + 28g)(2 - 2 + 2)(-g + 2g + g). 112g2 - 4g Expand 7b + 4b*2 - 7b + (5b + 8 - 8)((2b + 3b - 2b)(-4 + 6 - 4) + b + 2b - b) - b2 + 3b2 + b2. -13b2 Expand -2x + 5x - 2x + (2 + 2x - 2)(2 + 2 - 2) + 12x - 45x + 17x + 0x + 2x + 0x. -9x Expand (-781 - 216 + 350 - 1102)(4k - 3 + 3 - k + k + k + (3k - 2k - 3k)(-3 + 4 - 3) - k + k - 2k + 5 - 5 + k - 2k - k + k). -10494k Expand (8j + 22 - 22)(-4j + 2j - 3j + j - 4j + j - j + 5j - 5j + (-2j - 1 + 1)(-2 + 1 + 0) + 0j - 6j + 3j). -72j*2 Expand (-1 - 1 - 1)(c - c - c)(1 + 26 + 4). 93c Expand -2 - h*2 + 43h*4 - 36h*4 - 74h*4 + (2h*2 + 2h*2 - 5h*2)(-h + h - 2h2). -65h4 - h2 - 2 Expand 2d2 + 2d*3 - 2d2 - d3 - 2 + 2 + (0d + d2 + 0d)(d - 2d - d) + (-24 + 44 - 19 - 39d2)(4d - 5d - 9 + 10). 38d3 - 39d*2 - d + 1 Expand (-3l + l + 0l)(-10l + 1 - 13l + 5l) + 6l*2 - 3l2 + l2. 40l2 - 2l Expand -k2 - k2 + 3k2 + (-5k + 0k + 3k)(k + 2 - 2) - k2 - k2 + k2 + (-3k + 2k + 9k)(0 + 0 - k). -10k*2 Expand (3 - 3 - g)(2g + 0g - g)(1 - 1 - 2)(-149g2 - 85g*2 + 43g*2). -382g*4 Expand (-7n + 7n - 4n*3)(0 + 0 + n2 + n2 + 0n2 + n2 + (n + 0 + 0)(-4n - n + 4n) + 0n2 + 6n2 - n2). -28n5 Expand -3t + 4t - 2t + (-5 + 3 + 3)(-t - 3t + t) + (14t + 3t + 2t)(12 - 3 - 4) + t - t + t. 92t Expand 54g*2 + 23g*5 - 54g*2 + (13g*5 - 160g*4 + 160g*4)(-2 + 3 - 2). 10g5 Expand (-2 + 1 + 2)(z - 6z + 4z)(-1 + 0 - 1)(1 + 1 - 1). 2z Expand -5q2 - q2 + 5q2 + (q - 4 + 4)(-36q + 8q - 6q)(-3 - 2 + 3)(2 + 1 - 5). -137q*2 Expand (3p - 11p - 6p)(0 + 4 - 3 + (1 - 2 + 0)(0 + 0 - 1) - 2 - 4 + 4 - 4 - 2 + 5)((5p*2 + 3p - 3p)(4 + 0 - 2) + (1 + 2 - 1)(0 + 2p*2 + 0)). 196p*3 Expand (-6c*3 + 4c3 + c3)(-1 - c + 1) - 33c*3 - 17c*4 + 33c*3. -16c*4 Expand (p - 2p*2 - p)(0 + 0 + p) + (-3p - 3p + 4p)((36p + 12p*2 - 36p)(-3 + 3 - 1) - p2 - p2 + p2 + 4p - 4p + 2p*2). 20p*3 Expand (-18m - 11 + 11 + (0 - 2 + 3)(3m - m - 3m))(3 - 3 - m)(-10m - 8m + 11m). -133m3 Expand (24 + 111 + 16)(2i + 0i + 0i). 302i Expand (5c2 - 2c*2 + 13 - 10)(4 - 3 - 2). -3c2 - 3 Expand (-f5 + 3f*5 + 0f*5)(15 + 68 + 120). 406f5 Expand (0 + 1 - 2 + (3 + 0 - 1)(-5 + 1 + 2) + 0 - 1 - 1)(-41112i*3 + 41112i*3 + 13i*5). -91i*5 Expand 10s*2 + 6 - 6 - 83s + 83s + 8s*2 + (-s + s + 2s*2)(-1 + 4 - 2) + 2s2 + 0s + 0s. 22s*2 Expand 13 - 29 + 17 - 14m + (-3 + 4 - 3)(m + 5m - 4m) - 2m - 2m + 3m + m + m + 0m. -17m + 1 Expand 4u4 + 0u*4 - 3u*4 + ((-1 + 2 + 0)(2u - u - 2u) - 2u + 2u - u)(-2648009 - u2 + 2648009 - 4u*3). 9u*4 + 2u*3 Expand (13 - 37 - 1)(-3d - 2d + 3d)(3 - 2 - 2)(2d2 - d2 + d*2). -100d*3 Expand (0h*2 + 2h*2 + 0h*2)(3h - 13511 - h + 13232). 4h*3 - 558h*2 Expand (-2 + i + 2)(-3 + 3 - 2)(4i*2 - 14i*3 + 3i*3 + 5i*3). 12i*4 - 8i*3 Expand (-6u*2 - 23 + 8028u + 35 - 8027u)(-3u2 + 3u*2 - 2u*3). 12u*5 - 2u*4 - 24u*3 Expand (9 - 7c - 9)(2 - 3 + 40c*4 - 75c*4). 245c*5 + 7c Expand -29h3 - 607h*2 + 607h*2 - 5h2 - h3 + 5h2 + (-h2 - 3h*2 + 2h*2)(3h - 3h - 2h). -26h*3 Expand (3 - 1 + 0 + 0 - 5 + 3 + 2 - 2 + 1 + (-3 - 1 + 3)(-3 + 1 + 3) + 4 - 2 - 1 + 2 - 5 + 4 - 2 + 0 + 1 + 34 - 35 + 53)(-y + y - y4). -53y*4 Expand (318 + 29n - 30n + 55)(-n*3 + 0n*3 + 4n*3). -3n*4 + 1119n*3 Expand 532x*2 - 532x*2 - 14x*4 + (-5 - 4 + 0)(x*4 + 0 + 0). -23x4 Expand -j3 - 3j3 + 3j*3 + (-6j - 4j2 + 6j)(41 - 93 + 53 - 36j). 143j3 - 4j*2 Expand (-2k*3 + 3k3 + k3)(1 + 15 + 11)(1 - 5 + 2). -108k3 Expand (-1 + 2v + 1)(2 - 7 + 1)(0v + 5v + 0v) - 2v*2 + 0 + 0 + (-2 + 2v + 2)(0 + 0 - 2v) + 2v2 + 4v*2 - 4v*2 + 3v - 3v + v2. -43v*2 Expand (-645l*2 + 3l*3 + 5l*3 + 644l*2 - 5)(2l + 0l + 0l). 16l*4 - 2l*3 - 10l Expand (90o + 41 - 41)(0 + 3 - 2)(-3 + 0 + 2). -90o Expand (-1 + 1 - 2)(x - x + 2x*5) + 2x - 39x4 + 59x4 - x2 + 10x5 - 18x*4. 6x*5 + 2x4 - x2 + 2x Expand (-2 - 3q*2 - 2q*2 - 2q*2)(2q3 + 3q*3 - 4q*3 + (2q*3 + 3q*3 - 6q*3)(-1 + 2 + 1)). 7q5 + 2q*3 Expand -3 - 27g + 4g2 + 52g - 24g + 5g*3 - 3g*3 + 2g3 - g3 + (g - 3 + 3)(4g*2 - 2g*2 - 3g*2). 2g*3 + 4g*2 + g - 3 Expand (0p*2 - 2p*2 + 4p*2 + (-2p - 2 + 2)(0 + 2p + 0))(-4p + 2p + 4p)(309 - 309 + 15p). -60p4 Expand (24 - 14 + 20)(9 - 6 + 3n3 - 5). 90n*3 - 60 Expand ((-4 + 0 + 2)(-3 + 6 - 1) + 3 + 1 + 2)(18 - 18 + 5g). 10g Expand (-1 + 4 + 2r*2 + 0)(72r3 + 111r*3 - 54r*3). 258r*5 + 387r*3 Expand (-1 - 1 + 0)(2b2 - 2b2 + b3) + 221b3 + 385 - 385 + (0 + 0 + 2b)(-5b*2 + 3b*2 + 0b*2). 215b*3 Expand (-3 - 4 - 2)(43 - 15f - 43). 135f Expand (3 - 5 + 0)(8x - 966x2 + 1133x*2 - 6x). -334x2 - 4x Expand (9k - 7k + 19k + 2k + 3k - 7k + (4 + 2k - 4)(-3 - 1 + 3))(5k*2 + 0k2 + k2). 102k3 Expand (3o + 3o - 9o)(3o - 7o + 2o). 6o2 Expand (31s + 82 - 82)(s2 + 0s*2 - 2s*2 + (-s + s + 3s)(3s - 2s + s)). 155s*3 Expand 10 - 10 + 6m + (-5 - 2m + 5)(-1 + 2 + 1) + 3m + 2m - 4m + 2 - 2 - 2m + 11m + m + 8m. 21m Expand (-n + 0n + 0n)((-3 + n + 3)(-4 + 0 + 3) - n + 0 + 0) + 124n*2 + 290n*2 + 51n*2. 467n2 Expand (q - q - q2)(2 + 0 - 3) + (2 - 2 + q)(-6q + 5 - 5)(0 - 4 - 3). 43q2 Expand (0v - v + 3v)(-5771 + 2v2 - 114v*2 + 5771). -224v*3 Expand (0j*2 - 3j*2 + 2j*2)(-117j3 - 20j*2 + 14j*2 + 17j*2 + 77j*3). 40j*5 - 11j*4 Expand (2y*2 - 2y2 - y2)(-31y*3 + 38y*3 + 39y3) + (-y5 - 2y + 2y)(1 + 3 - 3) - 2y*5 - 8 + 8 + 5y*3 + 2y*5 - 5y*3. -47y*5 Expand (7 - 2 - 3)(-2u3 - 2u*3 + 8u*3) + (-21u*2 + 21u2 + u3)(-339 + 181 + 176). 26u*3 Expand (4 + 5 - 4)(7x4 - 46 + 46) + x4 + 3x*4 - 3x*4. 36x*4 Expand (-7l*2 - 10 + 10)(-35 - 2l3 + 35 - 23l - l*2). 14l*5 + 7l*4 + 161	{ "pile_set_name": "DM Mathematics" }
, 4? -4.7 Let z be (-5 + 8/2)6. Let y = 2420 + -2420. What is the second biggest value in 2, y, z? y Let n = -2677 + 2682. Let k = -0.5 + 0.2. Which is the second smallest value? (a) 3/8 (b) n (c) k (d) 0.2 d Let o(y) = -36 - y + 40y*2 + 2y - 49y2. Let w be o(0). Which is the second smallest value? (a) 3 (b) -1/4 (c) w b Suppose -38t + 660 = -8t. Suppose 0 = -tg - 2g - 96. Which is the third biggest value? (a) -1 (b) -3/2 (c) -12/11 (d) g b Let m = 2652.75 + -2190.3. Let j = m + -463. What is the fourth biggest value in j, 4, -0.3, 3/5? j Suppose -3 = -5d + 2b, 3b - 11 = -23. What is the biggest value in 5, -1/12, 47, -0.2, d? 47 Let o = 12043 + -12042.6. Let m = -5.03 + 5. Which is the fourth biggest value? (a) -1 (b) o (c) m (d) -3 d Let n be 1 + 8 + (3 - 0). Let m be 5 + n/(-88)(2 - -36). What is the third biggest value in 16, -3/8, -1, m? -3/8 Let f = -2154 - -1416. Let z = -740 - f. Which is the fourth smallest value? (a) -26/9 (b) 4 (c) z (d) -1/2 b Let d = -0.144 - 3.456. Let l = 0.44 + d. Let t = -3.1 - l. Which is the second biggest value? (a) 0.3 (b) t (c) 0.9 a Let h = 17.9 - 17.5. Let z(q) = -q2 - 9q - 5. Let c be z(-9). Let p be 23 - 22 - -2(-1)/5. What is the biggest value in p, h, c? p Let t = -9403.9 + 9404. Which is the smallest value? (a) -0.435 (b) t (c) 0 (d) 0.3 (e) -2 e Let u = -41060 + 41101. Which is the second biggest value? (a) u (b) 12 (c) 0.04 b Let r = 163 - 335. Let i = r + 171. What is the third smallest value in 3, 0, i, -7? 0 Let f = 9938.92 - 9939. Which is the second biggest value? (a) -0.4 (b) f (c) -5 (d) -0.8 a Let j be (-3 - (1 + -1))(-455)/(-273). What is the smallest value in 7, j, -0.1? j Let w = 13083.7 + -13084. Let g = 26/43 - 123/559. Which is the third smallest value? (a) g (b) w (c) 0 a Let l = -1515 + 1511. Suppose -5n = 3h + 4, 0h + 3h + 2n = 2. Let s be h/4 + 10/(-36). Which is the fourth biggest value? (a) -5 (b) -0.4 (c) s (d) l a Let r(g) = g - 2. Let f be r(3). Let h be 244/14 - (187 - 170). Which is the fourth biggest value? (a) h (b) f (c) 1/4 (d) 0.06 d Let n be -3 - (720/216 - 6/1). Let b = -8.1 - -8. What is the biggest value in b, 4/5, -7, n? 4/5 Suppose -653o + 3p = -649o + 257, 3o - 2p + 194 = 0. What is the second biggest value in 0.1, 0, -0.2, o? 0 Let o = -562.0269 - -0.0269. Let u = o + 562.5. What is the biggest value in -15, u, 11? 11 Let r = -0.577 + -2.423. Let p = -3.1 - 1.9. Which is the second biggest value? (a) r (b) p (c) -1/3 (d) 3 c Let g(u) = u*2 - 3u - 3. Let z be g(3). Let m = 15 - 33/2. Let f = 690.1 - 690.3. Which is the fourth smallest value? (a) m (b) 3 (c) z (d) f b Let b = -41 + 40.9. Suppose -u + 0y = 2y - 11, -5y = 2u - 27. Let q be 6/u(-32)/36. What is the third biggest value in b, -3/2, q? q Let a = -4470.1 - -4470. What is the second smallest value in a, -23, -6, -1/5? -6 Let v = -0.23 - 0.07. Let y = 88/4165 + -1278/4165. What is the fourth smallest value in v, y, 8, 4? 8 Let p be -3 + -2 + 3 - 2294/8. Let d = 289 + p. Suppose -4c - 20 = -2b, -5b - 3c - 2c - 25 = 0. What is the fourth biggest value in -1, b, d, -1/3? -1 Let m = 9019 - 9021. Let r = 3 + -3. Let t = r + -1. What is the second smallest value in 0, m, t? t Let d(x) = -x*2 + 4. Let t be d(3). Suppose -19l = -9l - 70. Let j be 7/(42/(-18)) - l/(-3). What is the second biggest value in t, -2/5, j, 2/11? -2/5 Let b be (-68098)/(-123) + (-10)/15. Let d = b + -553. Let m = d - -43/82. What is the biggest value in -5, -3, m? m Let c be -2 + 5 + (-6)/4. Let a be 6/(5 + -3 + -3)8/(-84). Let x = -8 + 11. What is the biggest value in a, x, c? x Let u be 5/((1/(-3))/((-12)/216) - 8). Let h be -1 + 2 - (-10)/4. Let l = -91 + 87. Which is the second biggest value? (a) l (b) h (c) u c Let p = 0.1628 - 0.4628. Let v = 5.4 - 0.4. What is the second smallest value in v, 0.1, p, 4? 0.1 Let r be 0 + (6 - (-1 - 34/(-5))). Suppose 0p + 4 = p. Let c be 2(-1)/p-8. What is the biggest value in r, -0.5, c? c Let y = -6.2 + 6.7. Let r = 7689/14 + -550. Let c = -9/7 - r. What is the second smallest value in -4/3, c, y? c Let x = 7942 + -7942. What is the smallest value in -1/3, 2/15, x, -4? -4 Let d = 37.8 + -35. Let m = 13255 + -13255.01. What is the second smallest value in d, -2, m? m Let n(j) = -j3 + 12j*2 + 131j + 39. Let l be n(19). What is the second biggest value in l, -2/3, 9? l Let z be 2/(-3)6/10. Let o be (2/(-5))/((-1)/10). Let j = -2854 - -2857. Which is the second smallest value? (a) o (b) z (c) j c Let r = 3265 - 22783/7. Let p = 10 - r. Let w be (282/54 - 5)/(-1). Which is the biggest value? (a) p (b) 10 (c) w b Let m = -8 - -87/11. Let n = 6.24 - 6.24. Which is the second biggest value? (a) m (b) n (c) -1 a Let o be (-1454)/(-3635)(-1)/2. Let i = -5.7 + 0.7. What is the smallest value in -2, 0.5, o, i? i Let r = 0.2 - 0. Suppose 189 = 9o - 207. Let k be 8/3969 + 14/o. What is the third biggest value in k, -1, r, -0.1? -0.1 Let h = -5.15 + 1.15. Let t = 3.329 - -0.331. Let y = t - -0.34. What is the third smallest value in y, -0.1, h? y Let l be (15(-15)/(-675))/1. Which is the second smallest value? (a) -2 (b) l (c) -179 (d) 2/7 (e) -3 e Let n = -31.96 + 31.88. Let h = -0.4 - 0.1. Which is the third smallest value? (a) h (b) -2 (c) n (d) 5 c Let d = -1.06 + 0.55. Let f = -45.5 + 45.3. Which is the smallest value? (a) 2/7 (b) d (c) f b Suppose 0n = 2n - 6. Let m be (n(-5)/(-40))/(12/(-8)). Let z = 1/26 - -23/78. What is the smallest value in 5, 2/9, z, m? m Let k = -0.09 - 0.11. Let s = -162.94 + 163. Let h = -49/30 - -3/2. What is the fourth smallest value in s, 3, h, k? 3 Let l = -27954 - -27946. What is the second smallest value in -2/7, 3, -0.03, -0.1, l? -2/7 Let u = -30423.7 + 30424. Let m = 4 + -6. Let k = -2.4 - m. What is the fourth smallest value in -3, u, 3, k? 3 Suppose -94t + 1431 = -85t. Let r = 156 - t. Suppose 2g - 3g = -4. What is the biggest value in g, r, -0.4, 1/4? g Let y = 49.144 - 3.144. What is the biggest value in y, -1, -0.3, 0.1, 5? y Let i be ((-8)/44)/((-88)/121). Let y = 0.19 - -0.17. Let f = -0.04 - y. Which is the biggest value? (a) f (b) 0 (c) i c Let v be (10 - 19) + 5/(15/12). What is the third smallest value in -6, 1, v, 3/7? 3/7 Let q be 6/(-8)2/(-6) - (-501)/(-7348). Suppose 2v + 2v = 92. Let p = -181/8 + v. Which is the fourth biggest value? (a) 0.4 (b) p (c) q (d) 4 c Let i = -63.1195 - -63.5195. Suppose 3p - q = 10, -5q - 12 = -p + 10. Let j = p - 3. Which is the fourth smallest value? (a) -2/11 (b) j (c) i (d) -0.4 c Let y be 17/30 + (-2)/5. Let t = -6.26 + 1155.26. Let n = t + -1146. Which is the second biggest value? (a) -2/5 (b) 0.1 (c) y (d) n c Let r = -41/12 - -320/93. Let u = -1013/868 + r. Which is the third biggest value? (a) -2 (b) u (c) 1/7 (d) 1 b Let g = 3547 + -603. Let l = g - 2936.996. Let w = -0.004 + l. Which is the third biggest value? (a) 1/4 (b) w (c) 0.4 a Let r = 92443/15 + -6163. Which is the third biggest value? (a) -5 (b) 4 (c) r (d) -17 (e) 2 c Suppose -20459s + 20486s + 108 = 0. What is the smallest value in 2, 4/187, s? s Suppose 4h - 445 + 437 = 0. Let t be -1 + (-1)/3-3. Suppose t = -10o - h + 12. Which is the second biggest value? (a) -1 (b) o (c) -7 a Let f = -3139/14571 - 11/1619. What is the second smallest value in f, 2775, -0.2? -0.2 Let j = 3750.4 - 3750. Which is the fourth smallest value? (a) 2.8 (b) 5 (c) j (d) 1/4 b Let t = 52.15 - 52.45. Which is the second biggest value? (a) 3/7 (b) -0.03 (c) 4 (d) t a Suppose 5 = -16u + 15u - 4f, 5u - 2f = 19. What is the fourth biggest value in 2/7, -0.5, -2, -1/21, u? -0.5 Let k = -8220 - -8102. What is the biggest value in -3, k, 1? 1 Let p = -36657 + 256597/7. What is the biggest value in -5, p, 6085? 6085 Let p = 316 - 304. Let q be (1 + -1p/10)/1. What is the fourth smallest value in 5, -3, 39, q? 39 Let j = -49985/38 - -2631/2. Let m = 0.3 + -4.3. What is the fourth biggest value in -1, j, m, 2? m Let v(o) = -o + 11. Let t be v(8). Suppose -i + 2 = j, -tj - 4i + 10 = 5. Which is the second smallest value? (a) j (b) 1 (c) -0.08 (d) -3 c Let w = 7199 + -7198.5. Which is th	{ "pile_set_name": "DM Mathematics" }
what is -1 + 2? 1 In base 8, what is -105 - 23? -130 In base 12, what is 2 + 25? 27 In base 5, what is 1213 - -1? 1214 In base 6, what is 1 + -20121? -20120 In base 10, what is -3 - 1653? -1656 In base 16, what is 2 + -6f4? -6f2 In base 6, what is -3 + 305? 302 In base 9, what is -138 + -23? -162 In base 11, what is 223a - 0? 223a In base 10, what is 285 - -5? 290 In base 14, what is -144 - 5? -149 In base 15, what is 10e3 + 3? 10e6 In base 11, what is -4 + 16? 12 In base 14, what is -11 + -2? -13 In base 2, what is -1110010101 - -10? -1110010011 In base 13, what is 551 + 9? 55a In base 16, what is 1aa - 3? 1a7 In base 11, what is -2914 - 0? -2914 In base 3, what is 0 - 211022? -211022 In base 8, what is -157 + 57? -100 In base 12, what is -5 - 18? -21 In base 3, what is -1 - -1012? 1011 In base 8, what is 44745 - -1? 44746 In base 9, what is -4818 + 4? -4814 In base 4, what is -11323 - -21? -11302 In base 16, what is 4 - f? -b In base 14, what is a + -3d6? -3ca In base 14, what is -3 - -33? 30 In base 11, what is -2 - 450? -452 In base 6, what is -15 + 2? -13 In base 3, what is 1 - 1202? -1201 In base 13, what is 9 + -24? -18 In base 4, what is 10 + -31123? -31113 In base 12, what is -1 + 88? 87 In base 12, what is 1 - 15a? -159 In base 2, what is 1011 - 10101101? -10100010 In base 11, what is 4 + -1833? -182a In base 13, what is 3 + 378? 37b In base 11, what is -1720 + 2? -1719 In base 7, what is -2 + -322? -324 In base 8, what is -606 - 15? -623 In base 5, what is -14320 - 4? -14324 In base 5, what is 13 + -1042? -1024 In base 14, what is 0 - 1549? -1549 In base 14, what is -3 - b9? -bc In base 15, what is -8 + 99? 91 In base 4, what is 1330202 - 3? 1330133 In base 8, what is -522 - 3? -525 In base 11, what is -16 + 6? -10 In base 4, what is 1003 + 2? 1011 In base 13, what is 7 - -37? 41 In base 11, what is 2 - 21? -1a In base 12, what is 3 + 175? 178 In base 7, what is 1326 + 2? 1331 In base 15, what is 2 + 50c? 50e In base 3, what is -10 + 0? -10 In base 16, what is 276 - -4? 27a In base 16, what is 2a3 + 2? 2a5 In base 6, what is 33124 + -4? 33120 In base 14, what is 2c - -2b? 59 In base 13, what is 0 - -17c9? 17c9 In base 11, what is 4 + 243? 247 In base 15, what is -1b + 2? -19 In base 3, what is -221 + -2110? -10101 In base 2, what is 101011 + -111? 100100 In base 14, what is -14a - 60? -1aa In base 11, what is 1513 + 0? 1513 In base 7, what is 4 + 1535? 1542 In base 15, what is 4 - 237? -233 In base 11, what is -17 + 19? 2 In base 7, what is -425 - -5? -420 In base 15, what is 6 + 2a? 31 In base 4, what is -11 - -13? 2 In base 2, what is 11010100 + 1000001? 100010101 In base 11, what is -76 + 5? -71 In base 16, what is 4b - -5? 50 In base 5, what is -1 - 4220? -4221 In base 10, what is -1 + 1115? 1114 In base 3, what is 2012202102 + 1? 2012202110 In base 2, what is 110101000 + -100? 110100100 In base 13, what is -41 + -a1? -112 In base 4, what is 12 + 22020? 22032 In base 8, what is 6 - -37? 45 In base 14, what is 5 - 227? -222 In base 12, what is 15 + a? 23 In base 11, what is 6 - 10? -5 In base 11, what is 3 + -352? -34a In base 2, what is 1111010011 - 11? 1111010000 In base 10, what is 1 + -41? -40 In base 4, what is -213 - -130? -23 In base 4, what is -3 + 2021? 2012 In base 14, what is 18 - 15? 3 In base 16, what is 1a - 131? -117 In base 12, what is 115 + 5? 11a In base 14, what is -3 - -4c? 49 In base 14, what is -d + -234? -243 In base 14, what is -1 - -2? 1 In base 9, what is -17 - -24? 6 In base 4, what is 0 - -1000? 1000 In base 10, what is 1 + 33? 34 In base 15, what is 6 - 40? -39 In base 10, what is 10 + 108? 118 In base 7, what is -2 - 3401? -3403 In base 15, what is 0 + ad8? ad8 In base 13, what is -a1 - -c? -92 In base 5, what is 401 - 101? 300 In base 3, what is 202111 + -12? 202022 In base 10, what is 3 + -3? 0 In base 9, what is -116 - 57? -174 In base 8, what is 36 + -107? -51 In base 5, what is 1 - 11102? -11101 In base 15, what is -4 + -3ec? -401 In base 12, what is 2 + -30a? -308 In base 8, what is 141 - 0? 141 In base 13, what is 2 + a02? a04 In base 13, what is 148 - 6? 142 In base 15, what is 4 + -36? -32 In base 2, what is 0 + -111110? -111110 In base 3, what is -2212 - -22220? 20001 In base 15, what is 559 - 2? 557 In base 13, what is 4 + 61? 65 In base 8, what is -2 - -1066? 1064 In base 8, what is -124 + 4? -120 In base 4, what is -10 - -122? 112 In base 10, what is -28 - -5? -23 In base 6, what is 4255 + -5? 4250 In base 6, what is 4311 - 1? 4310 In base 7, what is -4 - 431? -435 In base 16, what is 10a9 + 1? 10aa In base 10, what is -14 - -26? 12 In base 7, what is 5 + -3064? -3056 In base 8, what is -2 - 7? -11 In base 14, what is -16 + 56? 40 In base 14, what is 4 - -4c? 52 In base 5, what is -21430 - -4? -21421 In base 8, what is 5 - 504? -477 In base 13, what is 1559 - 2? 1557 In base 8, what is 16 + -717? -701 In base 7, what is -140 - 56? -226 In base 4, what is -10221 + -103? -10330 In base 7, what is 10162 + 3? 10165 In base 4, what is 210 - -1013? 1223 In base 16, what is -79 - 3? -7c In base 10, what is 13278 - -1? 13279 In base 12, what is -363 - -2a? -335 In base 4, what is 122 - 1201? -1013 In base 14, what is -4 + 221? 21b In base 13, what is -2 - 248? -24a In base 10, what is 3 - 526? -523 In base 15, what is 2 - -b4? b6 In base 10, what is -23 + 30? 7 In base 16, what is 7 - -216? 21d In base 11, what is -aa + -1? -100 In base 12, what is -5 + -240? -245 In base 4, what is -10123 + -100? -10223 In base 12, what is -1 + -67? -68 In base 4, what is 330021 + -11? 330010 In base 16, what is -5 - 5d? -62 In base 14, what is 19a + 16? 1b2 In base 9, what is 2 + -33? -31 In base 14, what is 5 + 321c? 3223 In base 5, what is 10 - -32433? 32443 In base 9, what is 35 - -1? 36 In base 4, what is -100 - 122? -222 In base 13, what is -1 + 44? 43 In base 9, what is 663 + 4? 667 In base 16, what is 156 - -39? 18f In base 6, what is -11 - -100? 45 In base 15, what is -2 - -13c? 13a In base 4, what is -121312 + 3? -121303 In base 2, what is 10010111 + 10? 10011001 In base 6, what is 204 + 33? 241 In base 14, what is a + -16? -a In base 13, what is -11 - 33? -44 In base 10, what is 2009 - -2? 2011 In base 11, what is 130 + 0? 130 In base 5, what is 33101 + -3? 33043 In base 15, what is 0 + 5d9? 5d9 In base 10, what is 1573 - 0? 1573 In base 16, what is -4 - -124? 120 In base 15, what is -17e + -1? -180 In base 9, what is -156 + 0? -156 In base 16, what is -1 + a0? 9f In base 9, what is 15 - -12? 27 In base 11, what is -191 + -4? -195 In base 15, what is -42 + 5? -3c In base 16, what is -c + 1? -b In base 16, what is 1 + 14? 15 In base 3, what is 1 - -22110020? 22110021 In base 11, what is 5140 + -2? 5139 In base 9, what is -137 - 0? -137 In base 3, what is 120002 + -11? 112221 In base 3, what is -2121222 - -2? -2121220 In base 5, what is 2 - -200? 202 In base 16, what is -2 + 70? 6e In base 12, what is -1a - 13? -31 In base 11, what is -29 - 4? -32 In base 6, what is -20 - 4? -24 In base 12, what is -1 + -a6? -a7 In base 10, what is -8 - -3? -5 In base 6, what is 2354 + 4? 2402 In base 3, what is 12012 - -20? 12102 In base 12, what is -6433 - 0? -6433 In base 12, what is 2 + 1216? 1218 In base 3, what is -1220 + 11100? 2110 In base 13, what is -bc + 20? -9c In base 16, what is -3 - -6b? 68 In base 15, what is -c9 + 16? -b3 In base 5, what is -3 - 40? -43 In base 2, what is -1011 + 10101? 1010 In base 15, what is 4 + -2b5? -2b1 In base 11, what is 2 - 19? -17 In base 12, what is 0 - a79? -a79 In base 11, what is 18 - -6? 23 In base 10, what is 14 - -42? 56 In base 5, what is 0 + 22141? 22141 In base 4, what is 113 - 313? -200 In base 16, what is 15 - 5? 10 In base 4, what is 2201120 - -11? 2201131 In base 11, what is -7 + -13? -1a In base 7, what is -2 + -1562? -1564 In base 16, what is -2e - -6? -28 In base 12, what is 2 + -40? -3a In base 12, what is 895 - 4? 891 In base 9, what is 4 - 430? -425 In base 7, what is -426 - -5? -421 In base 3, what is 10121 - 121? 10000 In base 13, what is -445 - -2? -443 In base 12, what is 1a9 + 0? 1a9 In base 7, what is 1 + 134? 135 In base 8, what is 1141 + 2? 1143 In base 3, what is -11111022 + -11? -11111110 In base 16, what is -832 - -1? -831 In base 7, what	{ "pile_set_name": "DM Mathematics" }
What is the nearest to h in -5, -0.4, w? -0.4 Let o be 9/12(120/(-36))/(-10). Which is the closest to 2/9? (a) o (b) 2.2 (c) -0.2 a Let s = -30.4 + 30.5. Let z = -0.3 - -0.3. What is the nearest to z in -4/5, s, -4? s Let k = 22.5 + -20.5. What is the closest to 0.4 in -3/2, 0, k, 3? 0 Let q be (2/6)/(6/(-162)). Let p(b) = b3 + 10b*2 + 10b + 7. Let w be p(q). Let x = 82 + -75. What is the closest to 2/3 in x, 0.5, w? 0.5 Let r = -0.139 - -0.789. Let q = -0.65 + r. Suppose 5j = j - 20. What is the nearest to 0 in j, 1, q? q Let o = 117 - 117. Let y = -103/52 - -16/13. What is the closest to o in -0.1, y, 0.4? -0.1 Let y be 35/(-14)(-2)/(-50). Let s = -0.13 + 5.13. Let z be (21)/(-1 - 1). Which is the nearest to z? (a) s (b) 3 (c) y c Let x = 5.09 - 0.09. Let j = -80 + 77. Which is the closest to j? (a) 0.2 (b) -2 (c) x b Let u = -0.548 - -0.488. Which is the closest to -0.1? (a) u (b) -5 (c) -1/3 (d) 0 a Let j = 0 + -1. Let s = j - -2.4. Let p = s + -1.7. Which is the closest to 0? (a) 3 (b) 1 (c) p c Suppose 687s = 689s - 126. Which is the closest to 2/5? (a) -0.2 (b) 1/3 (c) s b Let k(v) = -7v*2 + 2v + 5. Let b be k(-2). What is the closest to -1/4 in -4, b, -3? -3 Let b = -3.2 + 3. Let c = -1.7284 - 1.2716. What is the closest to b in c, 1/3, 0.17? 0.17 Let p be ((-46)/(-9))/((-42)/(-63)). Let s = 8 - p. Let n be 4/(-10) - 46/10. Which is the nearest to -4? (a) n (b) s (c) 4 a Suppose 0 = -2j - 3j - 25. Let y = -1753 + 7013/4. What is the closest to y in -1/2, j, 3? -1/2 Let w = 369 + -366. Which is the nearest to 0.04? (a) 6 (b) w (c) -0.3 c Let f = -28.1 - -32. Let q = f + -1.6. Let i = 2.5 - q. Which is the closest to i? (a) 0.5 (b) 0 (c) -5/3 b Let t = 21 + -41/2. Let s = -0.128 - 7.172. Let i = -7.4 - s. What is the nearest to 1 in i, t, -1/6? t Suppose 0 = 4k - 4m - 2 + 6, -5k - 13 = -m. Let i = -119 - -118.9. Let u = -1074/7 + 153. Which is the closest to i? (a) u (b) k (c) -5 a Let x = -0.1565 - 0.1435. Which is the nearest to 0? (a) 2/11 (b) x (c) -1 (d) -5 a Let d = 183/20 + -539/60. What is the nearest to -2/7 in -1/2, -100, d, -2? -1/2 Let k = 268.5 + -268. Let i = -6 - -5. What is the closest to -0.1 in k, i, 1? k Let x = 9.71 + -8. Let q = -0.21 + x. Let h = q - -0.5. Which is the nearest to h? (a) 3 (b) 0.3 (c) -1 a Let w be (-260)/39(30/(-4))/5. Which is the nearest to w? (a) 0.4 (b) -3 (c) 1 c Let b = 29.3 - 28.8. Let t = 17.8 + -12.1. Let g = -6 + t. What is the closest to -1/2 in -5, b, g? g Let l = 34 + 35. Let k = 344/5 - l. Let f be (-2)/(-8)(1 - 2). What is the closest to f in k, 3/2, 3? k Suppose 15 = -o - 2o. Let s be (-22)/88 + 386/8. Let m = -43 + s. Which is the nearest to -0.2? (a) -4/7 (b) m (c) o a Suppose -k + 20 - 14 = 0. Which is the closest to 1? (a) k (b) -3 (c) -0.1 c Let k = 39/28 - 8/7. What is the closest to k in 4, -0.5, -3/5? -0.5 Let m = 376.98 - 377. Let j = -3/83 - -104/581. Suppose -3f = -r - 0r - 14, 0 = 5r - 5f + 20. What is the closest to r in 1/2, j, m? 1/2 Let d = -67 - -64. Let a = 5 + d. What is the closest to -1 in 16, a, -0.1? -0.1 Suppose 5y - 2k - 242 = -6k, -2y = -5k - 77. Let u = y - 47. Which is the nearest to 6? (a) 5 (b) 1 (c) u a Let h = -18 - -53. Let s = -40 + h. Let l = 0.2 - 0.7. Which is the nearest to 0.2? (a) l (b) s (c) -5/2 a Let y = 71716/423 - 3540/47. Let d = -94 + y. Which is the closest to d? (a) -4 (b) -5 (c) 0.2 c Let q = 2.2 + -2.2. Which is the nearest to q? (a) 0 (b) -28 (c) 4 a Let z = -5.11 - -0.11. Let x = 59 + -59.54. Let k = x + 5.54. Which is the closest to 0.1? (a) z (b) k (c) -4 c Let v = -0.03 + 0.03. Let i = v + 1. Let f = -1.7 + 2. Which is the closest to i? (a) f (b) 0 (c) -0.3 a Let f = -22 - -3. Let p = f + 19.1. Which is the closest to p? (a) -0.1 (b) 1/11 (c) 3 b Let u = -190 - -121. Let g = -69 - u. Let l(t) = t - 2. Let m be l(3). Which is the closest to 1? (a) -0.1 (b) g (c) m c Let n = 190/11 + -1352/77. What is the closest to n in 1/7, -5, 5, 0.02? 0.02 Let r = 177 - 170. What is the nearest to -1 in 0.5, -5, r, -0.1? -0.1 Let d = -155 + 154. What is the closest to 3/5 in 7, d, 5? d Let n = -375 + 11251/30. Let p = 2/15 - n. What is the closest to -0.1 in 2/7, p, -1/2? p Suppose -24 = v - 5w, 10v = 9v - w + 6. Let f be 4/456/(-4). Which is the nearest to 2/5? (a) f (b) 5 (c) v a Let m = 25.977 + -26. Let r = m + 0.023. What is the closest to -1 in r, 0.3, -0.3? -0.3 Let j = 11/35 - 3/14. Let t(n) = -n + 4. Let k be t(2). Suppose 5r + 1 = 2f - 0, -kr + f = 1. Which is the closest to r? (a) j (b) -3/2 (c) 1/3 c Let r = 14 + -15. Suppose -k - 2 = 3j + 8, -3j = 4k - 5. Let v = 6.3 - 6. Which is the closest to v? (a) j (b) -2/5 (c) r b Let n be 1/((-44)/48 - -1). Let r be (20/8)/(15/n). Suppose -4o = -ro. Which is the nearest to 0? (a) -2/9 (b) o (c) 4/5 b Let i be 2 - -18 - -3(0 + -1). Suppose 19z + 10 = iz. What is the nearest to 0.1 in 3, -4, z? 3 Let o = -430 + 430.2. Which is the closest to 2? (a) 1 (b) -0.026 (c) o (d) 5 a Let d be -9 + (-185)/(-35) + 4. Let r = 4 - 6. What is the nearest to 1 in r, d, 2? d Suppose 2b = -10b - 12. What is the nearest to b in 1, -94, 0? 0 Let g = 5957 - 5956.3. Let i = -1/5 - -8/15. Which is the nearest to i? (a) 2/3 (b) 0.3 (c) g b Let m = -1.41 + -2.59. Which is the nearest to -2? (a) -1/4 (b) m (c) -9 a Let w = 45.5 - 44. Let p = w - 1.6. Which is the nearest to p? (a) -0.6 (b) -5 (c) -3/4 a Let i = -10.6 - -45. Let f = i - 34. Which is the closest to 0.2? (a) 0.2 (b) 0.3 (c) f a Let n = 303.6 + -304. Let q = 2 + 1. What is the closest to -3/8 in q, n, 1? n Let i(q) = 2q2 + 105q - 399. Let w be i(-56). What is the closest to w in -2, 0.5, 3, 4? -2 Let y = -5765/13468 - 1/1924. Which is the closest to -2? (a) -0.3 (b) 0.07 (c) y (d) 5 c Let y = 252.6 + -251.6. Let r(n) = n*2 - 3n + 4. Let i be r(-3). What is the closest to y in -1/6, i, -5/6? -1/6 Let w = 527 + -537. Let d = 3.91 + 0.09. Which is the nearest to 1/3? (a) d (b) 2/3 (c) w b Suppose -2m - 143 = 577. Let x be 723/m + 2/6. Let l = x - -15/8. What is the nearest to -0.1 in l, 1, 5? l Let w = -119.1 + 120.1. Let b = -81/20 - -13/4. What is the closest to w in 1/2, -2/5, b? 1/2 Let g = -524 - -521. What is the nearest to 1/3 in -0.1, -4, -127, g? -0.1 Let j(l) = l3 - 8l*2 + 16l + 1. Let n be j(3). What is the nearest to -2 in -2/3, 2/7, n? -2/3 Let p = 271.3 - 271. Which is the closest to -9/4? (a) -5 (b) -3 (c) p (d) -0.2 b Let i = 0.06 - -0.24. Let v = 1673 - 1672.8. Let w = -5 - -3. Which is the nearest to v? (a) w (b) 2/13 (c) i b Let t = -14.4 + 4.3. Let z = 8.1 + t. Which is the nearest to z? (a) 0.06 (b) -0.5 (c) -5 b Let n = -729 + 729. Which is the nearest to n? (a) -5/4 (b) -3/7 (c) 3 (d) 2/9 d Let a = 503 - 513. What is the closest to -2 in -0.1, a, -1? -1 Suppose -10 = 2t, 4t + 37 + 3 = -5v. Which is the nearest to -1? (a) -0.3 (b) -0.4 (c) v b Let j be (-16)/10030/12. What is the closest to j in -2/23, -5, 29, 4? -2/23 Let j be 2 - 184/20 - -7. Let f = 14 + -19. Which is the closest to 1/4? (a) 0.1 (b) f (c) j a Let r be (124/(-279))/((-2)/(-3)). What is the closest to 58 in -0.4, r, -3, 2? 2 Let p = -419.9 - -420. Which is the closest to -12/17? (a) p (b) -2/3 (c) -2/5 b Let k = -25 - -29. Let r = k - 4.1. What is the closest to 1/2 in 1/4, r, -0.5? 1/4 Let s = 2134.21 - 2146. Let w = s + 12. What is the closest to -0.1 in -3, w, 3? w Let h = 464 - 451. Which is the nearest to -2/3? (a) 3 (b) h (c) -9 a Let o = 279.3 + -279. Which is the closest to 4/9? (a) o (b) -4 (c) 6 a Let i = 1902 - 1901.7. Let d = -576/7 + 82. What is the closest to d in -2/7, i, 2/3? -2/7 Let j = 13 - -1. Let t = 14.996 + 0.004. Let q = j - t. Which is the nearest to q? (a) -1/7 (b) 1 (c) -4/3 c Let o be 2/(4/(-20)*-1). Let v be 0 + (24/o - 2). Which is the nearest to v? (a) -0.3 (b) 3 (c) -1/7 c Let s = -33 - -229/7. Which is the nearest to s? (a) 0.25 (b) 4 (c) 0.1 c Let t be 3 + ((-36)/6 - -8). Let x = 1.06 - 0.06. Let y = x + -5. Which is the closest to -2/9? (a) -1 (b) t (c) y a Let r be 1/(0 + 1/1). Let g = 9.6 + -1.6. Let n = g + -13. Whic	{ "pile_set_name": "DM Mathematics" }
5/60 + 5a4/6 - a2. What is the tens digit of z(14)? 8 What is the tens digit of -4(-4)/28 + 3741/7? 3 Suppose 5 = -4b - b + 4l, 3l - 3 = 4b. Suppose -h = 5m - 34, bm - 6h + 7h = 20. What is the units digit of m? 7 Suppose 4l + 3b - 8 - 2 = 0, -2l + 3b = 4. Let j be (1 + 0)/(l/(-1)). What is the tens digit of (j - -2 - 17)-1? 1 Let x(v) = -v*3 - 16v*2 + 8v + 26. What is the tens digit of x(-18)? 3 Let d = 61 - 41. What is the units digit of 156 - 5/(d/8)? 4 Let a(t) = -t + 1. Let q(v) = -4v - 2. Let l(d) = -5a(d) + q(d). Let k be l(10). Suppose -3p - ky = -63, 4y = -0y - 12. What is the units digit of p? 4 Suppose 0 = -3s - 2s + 10. Suppose 2p = -u - 24, -su - 51 - 7 = 2p. Let x = u - -58. What is the tens digit of x? 2 Suppose -3f + 3 + 6 = 0. Suppose -39 = -fn + 33. Let m = n - 10. What is the tens digit of m? 1 Suppose -19036 = -25s + 52714. What is the tens digit of s? 7 Suppose 4f = 903 - 659. What is the tens digit of f? 6 Let f = -94 + 98. Suppose -ft + 3t = -22. What is the units digit of t? 2 What is the units digit of (-4)/((-20)/10945) + -4 + -3? 2 Suppose -12 + 32 = 4u. What is the tens digit of 18/45 + 343/u? 6 Let c(q) = q*3 - 4q*2 + 3q + 4. Let w be c(3). Suppose 0r - r - w = 0. What is the units digit of -1 - (-28 + 2 + r)? 9 Suppose -28k + 9216 = -4k. What is the units digit of k? 4 Suppose 0 = -3k + k + 3p + 2337, 0 = 2k - 4p - 2340. What is the hundreds digit of k? 1 What is the tens digit of (-21)/14-2732(-6)/(-9)? 3 Let c be (4/2 + 1)(-15)/(-9). What is the tens digit of 22/55 - (-308)/c? 6 Let h = -512 - -737. What is the hundreds digit of h? 2 Suppose 5i - f - 3854 = 0, 30f + 758 = i + 33f. What is the tens digit of i? 7 Suppose 0 = -4w - 71 - 253. Let x = -57 - w. What is the units digit of x? 4 Let q(d) = -1 - 2d2 + 3d*2 + 34d*3 + d + 0d*2. Let x be q(1). Let h = -22 + x. What is the tens digit of h? 1 Let b be (-23 + 0)(-120)/20. What is the tens digit of (30/20)/(9/4)b? 9 Let f(x) = -418x + 778. What is the thousands digit of f(-4)? 2 Suppose 2l = -2l - 4, 5a = -3l - 288. Let y = a - -118. What is the units digit of y? 1 Let b(w) = 9w + 11. Let j be b(5). Suppose -2l + f + 107 = -0f, 0 = l - 3f - j. What is the tens digit of l? 5 Let i(z) = 132z - 104. What is the hundreds digit of i(2)? 1 Suppose a - z - 240 = 0, -2a + 3a + z = 240. Suppose -3y - 2y = a. Let k = -31 - y. What is the units digit of k? 7 Let i(l) = l3 - l2 - 9l + 3. Suppose -56o + 51o + 30 = 0. What is the units digit of i(o)? 9 Let u be 69 - (8/(-2) + 1). Suppose u + 19 = 7m. What is the tens digit of m? 1 Suppose -4c = -f - 15 - 3, 0 = 4f - 4c + 12. Let n = 2 + 1. Suppose -4s + 2r = -42, fr = nr - 1. What is the units digit of s? 1 Let w = -24 - -28. Suppose 2n + 96 = 4a, -2a = 2a - wn - 88. What is the tens digit of a? 2 Let i(g) = g3 + 26g*2 + 19g - 76. What is the hundreds digit of i(-15)? 1 Let h(q) = -q*3 + 5q*2 + 7q - 6. Let s be h(6). Suppose 2a + 4m - 4 = s, 4 = 5a + 4m - 0. Let o(u) = u + 31. What is the units digit of o(a)? 1 Let z = 133 - 134. Let q = 236 - z. What is the hundreds digit of q? 2 What is the hundreds digit of ((-952)/(-6))/((-6)/(-63))? 6 Suppose 6a - 7a + 91 = -4k, a - 3k - 91 = 0. What is the units digit of a? 1 Let f(b) = -2b - 3 + 15 + 11. What is the units digit of f(-12)? 7 Let z = -14 + 49. Let s be 185/z - 2/7. Let p = 28 + s. What is the tens digit of p? 3 Suppose i = -3y + 6, -3i = 4y + 2i - 8. Let x = -10 + 15. Suppose 2t + 5 + 23 = c, -yc = xt - 56. What is the units digit of c? 8 Let v = 1198 - 604. What is the hundreds digit of v? 5 Suppose -1902 = -5z + 3l, 0z = 3z + l - 1144. What is the units digit of z? 1 What is the tens digit of ((-144)/(-84))/(16/18536)? 8 Let a be (-2)/42-3. Suppose -aw = -5v - 6w + 504, 202 = 2v + w. Let d = -41 + v. What is the tens digit of d? 6 Let d = -4 + 10. Suppose 2l = dl. Suppose l = n - 70 + 4. What is the tens digit of n? 6 Let a = 4 - -1. Suppose -at - 1 = 3g - 12, 0 = -g + 5t + 17. What is the units digit of 3 - (-7)/(g/55)? 8 Suppose 0 = -t + 5. Suppose 0c = -tc - 170. What is the units digit of (-1377)/c - 2/4? 0 Let n = 256 - -794. What is the thousands digit of n? 1 Let g be (-29316)/14(-1 + 2). What is the tens digit of (-12)/(-96) - g/16? 3 Suppose -3p - 29 = -j, 115 = 5j - 4p - 41. Let v = -22 + j. What is the tens digit of v? 1 Suppose 5d + 0d + 0d = 0. Suppose -5b + 2n + 55 = 7n, d = -3n - 15. What is the units digit of b? 6 Let x(f) = 2f2 + 5f + 3. Let q be x(-4). Suppose -3c + 2w = -7, 3c - 8c - w + 3 = 0. Let y = q - c. What is the tens digit of y? 1 Suppose -2m + 5m - 7 = -5b, 0 = b + 3m + 1. Suppose ba - 4r = -3a + 595, 2r + 113 = a. What is the units digit of a? 3 Let k(h) = h*3 - 3h*2 + 4h - 1. Let y be k(2). Let f(n) = -n*y + 25n*2 - 7n*2 - 3n*2 - 4n*2 - 6n. What is the tens digit of f(10)? 4 Let j be (16/(-24))/(2/(-9)). Suppose -jf - 94 = -b - b, f + 168 = 4b. What is the units digit of b? 1 Let d be 27/(-18)46/3. Let z = d - -11. What is the tens digit of (-2 - -65)z/(-14)? 5 Let k(o) = 70o + 68. What is the thousands digit of k(21)? 1 Suppose -9 = -3c - 3. Suppose -138 = -cs + 2h, -6s - 3h + 231 = -3s. What is the units digit of s? 3 Suppose 10v + 840 = 5830. What is the tens digit of v? 9 Suppose 4a + 14a - 16704 = 0. What is the tens digit of a? 2 Let m = -7 - -11. Suppose -ms = s - 650. Suppose s = 2h + 3h. What is the units digit of h? 6 Suppose 5y - 68 = z, -2z + y - 32 = 59. Let i = -31 - z. What is the tens digit of i? 1 Let n = -194 - -352. Let c = n - 88. What is the units digit of c? 0 Suppose 0 = 4b - 6b + 3x + 3814, -2b = -4x - 3812. What is the tens digit of b? 1 Let f be (-349)/(-1) - (17 + -15). Suppose -5i + 173 + f = 0. What is the tens digit of i? 0 Suppose -3c + 306 = 69. What is the tens digit of c(-5)/10-2? 7 Let w be -43(-2)/12. Let r(f) = -f*2 + 7f + 5. Let i be r(6). Suppose 0 = -3d + wd + i. What is the tens digit of d? 1 Suppose 4o - 3h - 7 = -1, -3o + h = -2. Suppose 2u - 140 = -3z, -3u + ou + 196 = z. What is the units digit of u? 4 Let q = -44 + 40. What is the tens digit of (-2)/q + 266/4? 6 Let j = 90 + 102. What is the tens digit of j? 9 Suppose -y + 2y - t - 5 = 0, 3t - 10 = -2y. Suppose -2n + 274 = 2s, 2n - 3n = ys - 137. What is the hundreds digit of n? 1 Suppose r + 2c + 4 = -0r, -5 = 5r + 5c. Suppose -5x + 6y = ry - 244, -x = -2y - 50. What is the tens digit of x? 4 Suppose -2c + 2i - 7i - 17 = 0, c + i + 1 = 0. Suppose 5r + 35 = -cb, -3r = 3b - 2b + 21. What is the units digit of (0 - r)/(1/2)? 4 Suppose 37 = -u + 41. Suppose -n - un = -410. What is the units digit of n? 2 Let f be (1 + -3)/(2/34). Let s = 162 + f. Suppose -2j = 2j - s. What is the units digit of j? 2 Let w(b) = -433b3 + b + 12b*2 - 11 + 432b*3 + 0b. What is the units digit of w(7)? 1 Suppose 250 - 10 = 5r. Suppose r = 3h + h. What is the tens digit of (-3)/(-2) + 126/h? 1 Let l = -37 - -40. Suppose 0 = -3s - 15 - 0, lp - 35 = 4s. What is the tens digit of (-24)/30 + 124/p? 2 Let t(c) = -c2 - 40c + 8. What is the hundreds digit of t(-35)? 1 Suppose 0 = -35c - 19242 + 79267. What is the units digit of c? 5 Let i(n) = -n2 + 5n + 8. Let t be i(-7). Suppose c - w + 108 = 2c, 5w + 590 = 5c. Let a = c + t. What is the tens digit of a? 3 Suppose -24v = -20v + 112. Let l be 10/((-60)/v - 2). Suppose 5q = 7q - l. What is the tens digit of q? 3 Let i(m) = 106m*2 - 15m + 21. What is the units digit of i(2)? 5 Suppose -2r + 5 = -3k - 7, -3r = 5k - 56. What is the tens digit of 285/18 + 2/r + 3? 1 Let d = 126 + -76. Let n = 24 + d. What is the units digit of n? 4 Let n(u) = -u*3 - 8u*2 + 10u - 7. Let t be n(-9). Let v be 44/t-134. What is the units digit of v/5 - 5/(-25)? 7 What is the tens digit of -4525(80/(-50) + 1)? 1 Let o(a) = -a2 + 11a + 2. Let j be o(11). Suppose ju - 6z + 5z = 84, 2u = 4z + 78. What is the tens digit of u? 4 Let b = 2137 - -379. What is the units digit of b? 6 Suppose -q - 2 - 3 = 5u, -2q = 4u + 10. What is the units digit of (u	{ "pile_set_name": "DM Mathematics" }
2)))(-24) assuming o is positive. o(-1788/29) Simplify (oo(4/11))18 assuming o is positive. o(270/11) Simplify n(4/7)/(n(-6/7)/n) assuming n is positive. n(17/7) Simplify uu*(1/9)(uu(uu(-2/7))/uuu)/u(uuuu/(u/u2))16 assuming u is positive. u(5281/63) Simplify t15/t(-1/3) assuming t is positive. t(46/3) Simplify (xxx/(x/(xx*(1/2))xx)x(3/8))41 assuming x is positive. x(615/8) Simplify ((l2)(20/3))(-39/4) assuming l is positive. l(-130) Simplify c(-3/11)c/c41 assuming c is positive. c(-443/11) Simplify x(-1/20)x*(2/7)/xxx assuming x is positive. x(173/140) Simplify l9/l(-1)(lll(-1/2))4 assuming l is positive. l*16 Simplify (xx*(-26)x)/((xx/(x/x(1/31))x)/x) assuming x is positive. x(-776/31) Simplify w/(w(-2/11)/ww)w33 assuming w is positive. w(376/11) Simplify (o(5/3))(-45) assuming o is positive. o*(-75) Simplify (zz6)/(z/z(-1/20)) assuming z is positive. z(119/20) Simplify (b/b(-6)b/(bbbb/b*5bbb))(-12) assuming b is positive. b(-72) Simplify h*(-3)/(hhh(1/26)) assuming h is positive. h(-131/26) Simplify (r/(r(-1/8)r))(-43) assuming r is positive. r(-43/8) Simplify (t1/(t/((t/(t(-8)/t)t)/t)))/(t0/t)(1/70) assuming t is positive. t(701/70) Simplify ((u(u/u1)/u)/(u1u))/(u2)(-13) assuming u is positive. u24 Simplify (y3/y(-1/5))/((y/(y/(y/(y/y3))))/y)(1/59) assuming y is positive. y(934/295) Simplify ((oo*(-2/5)oo)(-24/13))28 assuming o is positive. o(-672/5) Simplify (ddd(-2/3))(-25)/(d(-6)/dd(d/(d(-1/2)d))/dd) assuming d is positive. d(-167/6) Simplify a(-4/7)/(aa/(aa(-21))aa) assuming a is positive. a(-172/7) Simplify ww(w/(ww*(-1/25)))/ww(w((www*(5/2))/w)/w)/ww assuming w is positive. w*(277/50) Simplify nn*9/nnnn*(-3)nn(n(3/4))(13/3) assuming n is positive. n(53/4) Simplify (c(1/2)/c)*22c(2/3)/c2 assuming c is positive. c(-37/3) Simplify (b(1/2)b)16bb/((b/(b/(b/(bb*4))))/b)b/b(3/8) assuming b is positive. b(253/8) Simplify (u(-1/4))(-16)(uu(1/2))/u(1/6) assuming u is positive. u(16/3) Simplify ((y/y(-1/2))/(yy(y(y/((yy*(-1/4))/yy))/y)/y))/((yy(-2))/(y/((yy/(yy0y))/yy)y)) assuming y is positive. y*(13/4) Simplify (bb*(-3)/b)/(b/(bb/b*(-4)b)b)(bb/b(-3))/(b/(((b(-10)/b)/b)/b)b) assuming b is positive. b(-8) Simplify (j/(j3/j)j5)3 assuming j is positive. j12 Simplify (p7)(-10) assuming p is positive. p(-70) Simplify z(-15)z(-25) assuming z is positive. z(-40) Simplify ((vv/(v(v/v*(2/3))/v))/(vv(-2/15)))(-47) assuming v is positive. v(-188/5) Simplify ((f(2/3))47)(-26) assuming f is positive. f*(-2444/3) Simplify (((z(zz/z(-1/4)z)/z)/zz)/z)(-1/37) assuming z is positive. z(-9/148) Simplify q(-3)qq/((qq(-6/13))/q) assuming q is positive. q(-7/13) Simplify (c/(cc(-6))c*8/cc)/((c*(-3/10)c)/c6) assuming c is positive. c(193/10) Simplify ((((ss6s)/s)/s)/(ss/(((s(-5)/ss)/s)/s)))/(s(-5)/s6) assuming s is positive. s8 Simplify (r(1/10)/r)(6/5) assuming r is positive. r(-27/25) Simplify (g(2/5))(2/67)/(((gg8/gg)/gg)/((gg(-4))/g)) assuming g is positive. g(-4351/335) Simplify (q/(qqq*(-2/19))((qq/(qq(-6)))/q)/q)6 assuming q is positive. q(468/19) Simplify ((q(-4/5)/q)/q)/(qq(-2/15)/qq) assuming q is positive. q*(-11/3) Simplify pp*20pp/p2 assuming p is positive. p21 Simplify d(((d*(1/9)d)/d)/dd)/dddd*2(((d*0d)/d)/d)/dd(3/4)d assuming d is positive. d(139/36) Simplify u(-2/49)u(-11)/uuu assuming u is positive. u(-492/49) Simplify (u((uu24uu)/u)/u)/(uu/u(-1/9)) assuming u is positive. u(215/9) Simplify ll/l(-1/5)l*(5/3)(l(-2/3))(-2/79) assuming l is positive. l(1534/395) Simplify t2t(-2/5)t*(3/5)t*(-6)t assuming t is positive. t(-14/5) Simplify (u(-6)u(-8/5))6 assuming u is positive. u(-228/5) Simplify (v2/v)(-36) assuming v is positive. v(-36) Simplify (o6/(oo(-2/3)))(3/2) assuming o is positive. o*(17/2) Simplify (g(g*(-3/8)g)/ggg*5gg)/((gg8/g)/(g/g9g)) assuming g is positive. g(-51/8) Simplify (j(-3/7))(-20) assuming j is positive. j(60/7) Simplify (w/w(-12))8 assuming w is positive. w104 Simplify (ppp/((p/p30)/p))/p(2/51) assuming p is positive. p(1681/51) Simplify (ll/(l*2l))/l*(-1)l/l*(-1/2)ll(-8)/l assuming l is positive. l(-13/2) Simplify (y/(y/y(2/7)))/(y/(y/(y/(y/y(-15))))) assuming y is positive. y(107/7) Simplify (q1)9((q/((q*0qq)/qq))/q)(-26) assuming q is positive. q61 Simplify ((z(1/4))(1/31))(-3/10) assuming z is positive. z(-3/1240) Simplify (n*(-1)nn)(-22)/((n(-1)n)/((n/n3)/n)) assuming n is positive. n(-25) Simplify ss4sss*(2/9)(((((((s/(s*(2/5)s))/sss)/s)/s)/s)/s)/s)47 assuming s is positive. s(-8981/45) Simplify (vv0/vv)*(29/2)(v(1/3))(2/71) assuming v is positive. v(6181/426) Simplify (h/(h11/h))/h(-11/3) assuming h is positive. h(-16/3) Simplify m*(-1/16)m1 assuming m is positive. m(15/16) Simplify (((x(3/5)/x)/x)/(x(2/3)x))(-2/35) assuming x is positive. x(92/525) Simplify f15/((f/f(-3))/f) assuming f is positive. f12 Simplify (q(-2/9)/q(1/2))/(q(3/7)/(qq/q(-2/3))) assuming q is positive. q(191/126) Simplify ((o(-1/5))(-49))(-2/21) assuming o is positive. o(-14/15) Simplify ww(-4/7)w(-14) assuming w is positive. w(-95/7) Simplify (q*(-12)q)24 assuming q is positive. q(-264) Simplify ((o/o(1/12))(5/6))(-2/5) assuming o is positive. o(-11/36) Simplify (nnn(-3/4))/(n/n(2/3)) assuming n is positive. n(11/12) Simplify (a(-3))*(-2/57)(a/a(-1/16))/(a(-1/3)a) assuming a is positive. a(457/912) Simplify (mm*(-13/5)/mm)/m6 assuming m is positive. m(-38/5) Simplify (n(-2/3))(-22)/((((n*(-1)/n)/n)/nn)/n(2/3)) assuming n is positive. n(55/3) Simplify ((ll1l)/lll*6)/((ll/(ll/l(-2/7)l))/l)(-25) assuming l is positive. l(-337/7) Simplify ((x(-1))21)(1/16) assuming x is positive. x(-21/16) Simplify (yy9y)/y4 assuming y is positive. y7 Simplify (n(2/7))(-1/6) assuming n is positive. n(-1/21) Simplify k(-2/17)(kk(k/(k(kk(-2/5))/k))/k)/kk*(-1/4)kkk(-1/10) assuming k is positive. k(657/340) Simplify d*(-4/9)d(-24) assuming d is positive. d(-220/9) Simplify b/b*(3/2)b13 assuming b is positive. b(25/2) Simplify (g/(g/(g/(((g*(-17)/g)/g)/g)ggg)))/ggg/g3 assuming g is positive. g22 Simplify (a3/a)(-14/11) assuming a is positive. a(-28/11) Simplify ((z(2/3)/z)/z)*(-1/34)(zz(-6/11))/(z/(zzz/(((zz*2z)/z)/z))) assuming z is positive. z*(277/561) Simplify (sss25)(2/65) assuming s is positive. s(54/65) Simplify ((rrr/r(-4/21))/r)/rr*6r assuming r is positive. r(172/21) Simplify (c(-1/7)/c)/c*5(c/((c(c/c(2/3))/c)/c))(-1/64) assuming c is positive. c(-8291/1344) Simplify ((w/(ww/(w*(-4/11)/w)))/(w/(w/(ww/(w/w*(-3/7)w)))w))1 assuming w is positive. w(-226/77) Simplify d(-4/7)d*9/d(dd(1/3))(-1/19) assuming d is positive. d(2936/399) Simplify ((((i(-5)i)/i)/i)/(i/i(-3)))/(((i/i(-4))/i)/(i/(i*(1/4)i))) assuming i is positive. i(-57/4) Simplify h(2/19)h18 assuming h is positive. h(344/19) Simplify (d(-4)d(1/8))39 assuming d is positive. d(-1209/8) Simplify (d/d(-11))/(dd(-8)) assuming d is positive. d19 Simplify (g(gg(-1))/g)(-2/35)/((((g/g1g)/g)/g)/((g/(g*(-1/4)g)gg)/g)) assuming g is positive. g(9/4) Simplify (j/(j(-2)/j)j)(13/3) assuming j is positive. j(65/3) Simplify (p(-14/3))(-2/35) assuming p is positive. p(4/15) Simplify ((k1/k)/k(-1/6))/(k(2/17)/(k/(k((k/(k/k*(-2/7)k))/k)/k))) assuming k is positive. k(2381/714) Simplify l(14/3)/(lll6/l) assuming l is positive. l(-7/3) Simplify ((t3/t)/t(-2/13))(-23) assuming t is positive. t(-644/13) Simplify (s(1/4))(-18)(s/s(-1/2))*(-1/11) assuming s	{ "pile_set_name": "DM Mathematics" }
nominator of d and 89/10. 60 Let m = -2114 - -23233/11. What is the common denominator of -5/1433 and m? 15763 Let i = -1/1070 + -5879/6420. Find the common denominator of i and (-32)/272 + (-378)/544. 48 Let c = 518 - 491. Calculate the lowest common multiple of 72 and c. 216 Let w = 18 + -3. Let t = w - 9. Suppose 2o = -2o + 80. What is the least common multiple of t and o? 60 Let g(n) = n*2 - 4n + 21. Let k be g(9). Suppose 0 = 8j - 30 - k. What is the least common multiple of 18 and j? 36 Suppose -5u = -n + 6n - 50, 0 = 5n - 3u - 34. What is the least common multiple of 20 and n? 40 Let p = 226 - 2203/10. What is the common denominator of p and 155/114? 570 Let b = -793/18 - -89/2. Let d = -557649023/511 - -1091289. Let j = d - 3/73. What is the common denominator of j and b? 63 What is the common denominator of 7/33 and (-14)/42((-106)/46 - -2)? 759 What is the common denominator of -17/18 and (-263)/116-2 - (-44 - -47)? 522 Suppose 0 = -0v + 3v - 4j + 1511, -3v + j - 1523 = 0. Let c be v/512 - 2/(-2). Let w = -1713/2560 - c. What is the common denominator of -107/6 and w? 120 Let z = 4714 - 212092/45. What is the common denominator of z and -67/45? 45 Let i be (-150)/84 + (-4)/(-14). Let m = 5 - i. What is the common denominator of ((-6)/2753)/(-4) and m? 18 What is the common denominator of ((-20)/105)/(0 - 135/(-595)) and -34/81? 81 Let a(x) = 3x - 12. Let c be a(5). Suppose ct - 2t = 0. Suppose -4p + t = -8. Calculate the least common multiple of p and 5. 10 What is the least common multiple of 42 and ((-378)/(-12) + -4)(-8)/(-10)? 462 Let p = -15312203/1414 - -10829. Let s = p + -77093/14140. Find the common denominator of s and -13/10. 20 Let p = -251 + 637. Suppose -5y - 235 = 5h + 735, 2y + p = -4h. Let m = y - -2717/14. Find the common denominator of 23/18 and m. 126 Let b(t) = t2 + 3t - 12. Let f be b(-6). Suppose f = -4c - 18. What is the smallest common multiple of 2/c - 19/(-3) and 11? 66 Find the common denominator of 8/(-6)1 + (-6)/28 and 43/63. 126 Let m = 18986 - 683393/36. Find the common denominator of m and 73/396. 396 Let h = -28761 + 1121600/39. Find the common denominator of -31/78 and h. 78 Suppose f + 4467 = -u + 3u, -3u + f = -6700. Let z = u - 17797/8. Let o = 40475/18 + -2251. What is the common denominator of o and z? 72 Let i = -23329177/1794 - -13004. Let w = i - 55603/19734. Calculate the common denominator of w and -4. 11 Let z = 263/51 - -1/102. Find the common denominator of 49/92 and z. 276 Let d(p) = -21p2 + 26p2 - p3 - 3p + 2 - 2 + 9. What is the smallest common multiple of d(4) and 0 + (1 + 1)/1? 26 Let o = 7556524 - 90818545/12. Let q = o + 11699. Calculate the common denominator of -125/36 and q. 36 Find the common denominator of -33/10 and -2 + 8 - 516750/85648. 4040 Let g(i) = -3i - 1. Suppose -3b - 5 = 7. What is the lowest common multiple of 64/6 + b/6 and g(-3)? 40 Let y = -115 - -119. Calculate the lowest common multiple of 86 and y. 172 Let m = -853366/231127 - 2/17779. Calculate the common denominator of ((-3)/(240/(-44)))/(1/12) and m. 65 Let h(f) = 2f*2 - f - 2f - 3f2 - 2f. Let w(n) = -n + 8. What is the lowest common multiple of h(-3) and w(-6)? 42 Let n be -129 + 16/(-8). Let p = n + 32. Calculate the lowest common multiple of p and 7. 7 Let t = 13 + 67. Calculate the lowest common multiple of t/243/2 and 36. 180 Suppose 78 = 4c + 2k - 0k, -4c + 84 = 4k. What is the least common multiple of 170 and c? 1530 Let g = 52130 - 4900265/94. Find the common denominator of -1 + (605/100)/11 and g. 940 Suppose 23n = 364 + 464. What is the lowest common multiple of n and 60? 180 Let g = -7102 + 426017/60. What is the common denominator of 41/87 and g? 1740 Let l be (-42)/(-4)16/6. Let v = l - 20. What is the lowest common multiple of v and 26? 104 Suppose 0 = -y + 396 - 344. Let o(h) = h2 - h - 3. Calculate the least common multiple of o(4) and y. 468 Let y be -1784(-57)/4770 + -4. Let l = y - -4/265. Find the common denominator of 64/9 and l. 9 Let t(i) = -2i - 12. Let q be t(-6). Suppose -y + qy - 46 = 0. Let u = y + 68. What is the smallest common multiple of u and 18? 198 Let n = 30 - 0. What is the smallest common multiple of 6 and n? 30 Let c = 1 - 0. Let j(p) = -3p + 60. Let o be j(18). Let v = o + c. What is the smallest common multiple of v and 20? 140 Suppose -100 = 4j - 4m, j + 4m = 2j + 16. What is the lowest common multiple of 24 and (-819)/j + (-9)/(-12)? 120 Suppose c = 4d - 48 - 24, 0 = -3c. Let p = d + -4. Suppose -60 = -2m - 3m. Calculate the smallest common multiple of p and m. 84 Calculate the common denominator of (335/45)/(4/363) and 10/27. 27 What is the common denominator of 61/6 and (8/288-3)/((-2)/572)? 6 Suppose 5c = -5q + 15, -3c - 12 = -5q - 37. Let r = -7/47 + -4075/94. Find the common denominator of r and c. 2 Let r be 3/(-8)((-808)/12)/(-2). Let b = r - 103/8. Find the common denominator of -71/2 and b. 2 Suppose f + 2c - 11 = 0, 5f = c - 2c + 46. Let j be 42 + (-4)/(-5)5. Let o = j + -35. What is the lowest common multiple of f and o? 99 What is the lowest common multiple of 9 and 5/(-30)(-9)/(-6)-8? 18 Suppose -z - 3z + 112 = 0. Suppose -27 = -5h - 5s + z, -4s = 3h - 34. Let u = 8 + 8. Calculate the smallest common multiple of h and u. 80 What is the common denominator of -51/220 and (-19)/((-6897)/44)87/(-10)? 220 Let v(w) = w + 10. Let d be v(-11). What is the least common multiple of -1 + (2 - (-3 + -1)) and 3/(-9) - d - (-7)/21? 5 Suppose 2g + 0n - 2n - 18 = 0, 2g = 4n + 14. Calculate the smallest common multiple of ((-35)/(-7))/(2/4) and g. 110 Suppose 0 = -9g + 13g - 96. Suppose -118f = -114f - g. Calculate the lowest common multiple of f and 5. 30 Let f = -22 + 67. Suppose 54 = 3k + 6. Calculate the least common multiple of (-10)/f - 38/(-9) and k. 16 Suppose -2y = 4s - 58, 0y - 3y = 2s - 19. Let f = 19 - s. Let v = -12 - -28. What is the lowest common multiple of v and f? 16 Suppose 0 = -3d - 7d + 80. Suppose -28 = -2x - d. Calculate the lowest common multiple of 10 and x. 10 Suppose -2l + 82 + 38 = 0. What is the smallest common multiple of l and 80? 240 What is the common denominator of 123/20 and 10/95 + (-3604)/(-1140)? 60 Let w be 4/(-6) - (-133)/(-3). Calculate the common denominator of ((-9)/w)/((48/105)/(-4)) and -45/8. 8 Suppose 832 = i + 7i. Calculate the smallest common multiple of 2 and i. 104 What is the common denominator of (5 - (-84)/(-30))/((-2)/15) and 101/4? 4 Suppose 34 + 26 = 4l - 5h, 3h + 22 = l. What is the smallest common multiple of l and 58? 290 Suppose -2i - z + 1 = -16, -15 = -5z. Let m = i + -2. Suppose -ml + 3l + 28 = 0. What is the lowest common multiple of l and 6? 42 Let b(a) be the first derivative of -a4/4 + 2a*3 + 7a + 7. Let t = -12 + 18. Calculate the lowest common multiple of 7 and b(t). 7 Let w = 2525 + -4951/2. Find the common denominator of -51/26 and w. 26 Suppose 4s - 12 = 4c, 4c + 5s = 3c + 9. Calculate the common denominator of -79/20 and (c/(-18))/(12/744). 180 Suppose -2p = 4273 - 23453. Let n = p - 5517. Let y = n - 16385/4. Find the common denominator of y and -29/13. 52 Let b = -2 + 1. Find the common denominator of (-5 - 3381/(-1260)) + 6/9 and 10-1b/12. 60 Let g = 334241/32 - 10448. What is the common denominator of -79/60 and g? 480 Let g = -59/86 - 4801/774. Find the common denominator of g and -71/597. 1791 What is the common denominator of 34/(-20) + 58 + -50 and -11/256? 1280 Let c(x) be the third derivative of -x4/6 - x3/3 + 10x2. Let l be c(6). What is the lowest common multiple of 4 and l/(-7) + (-14)/(-49)? 4 Calculate the smallest common multiple of (17 - 3)/(26/377) and 174. 1218 Let v = -14117/11825 + 16/473. Find the common denominator of v and (-1)/4-1 + -23. 100 Let t(l) = -l*2 + 8l + 16. Suppose -3b + 135 = -0b. Suppose 5d - b = 10. What is the lowest common multiple of t(9) and d? 77 Let c = 454/31 - 12481/558. Find the common denominator of -11/21 and c. 126 Suppose 3k = 1706 + 64. Suppose 5d - k = c, 7c - 3c = 4d - 472. What is the lowest common multiple of 22 and d? 1298 Let a = 109 - -111. What is the smallest common multiple of 2	{ "pile_set_name": "DM Mathematics" }
-14345. Suppose w = -4w + 25. Suppose 2l = 4, l + 41 + 42 = wv. What is the highest common divisor of v and j? 17 Suppose 0 = -13t - 899 + 10090. Calculate the greatest common factor of t and 189. 7 Suppose 2980 = -37n + 27n. Let f = -270 - n. Let p be (22 + -1)/(2/2). What is the highest common divisor of f and p? 7 Let z(h) = -3h. Let n = 1 + -4. Let o be z(n). Let q = 18854 - 18755. Calculate the greatest common factor of o and q. 9 Let z = 270 - 262. Let x(n) = 2n*2 - 6n - 17. Let q be x(z). Let c(g) = 2g - 3. Let v be c(6). Calculate the highest common factor of v and q. 9 Suppose -38c = -36c - f - 767, -1539 = -4c + f. Calculate the highest common factor of c and 6. 2 Suppose -245 = -z - 2y, 2z + 5y - 548 = -60. Suppose -5x - 2m = -1929, -z = 2x + m - 1021. What is the highest common divisor of 105 and x? 35 Suppose 5x + 54 = q, -23x = -2q - 21x + 60. Calculate the greatest common divisor of q and 567. 3 Let u(c) = -c*3 + 23c - 1. Let l be u(-5). What is the greatest common divisor of l and 7? 1 Let x(a) = -6a3 + 13a*2 + 28a - 2. Let t be x(-4). Calculate the greatest common factor of t and 2. 2 Let d(y) = -y*3 + 149y*2 + 490y + 136. Let k be d(152). Calculate the highest common divisor of 48 and k. 24 Suppose -2y - 421 + 451 = k, 3k = -2y + 46. Let h(n) = 484n*2 + n + 1. Let r be h(-1). What is the highest common factor of y and r? 11 Suppose -2u + 4 = 0, 5b - 9 - 91 = -5u. Suppose -a + 17 = 3h, a + h = b + 3. Let d = 30 - a. What is the greatest common divisor of d and 7? 7 Let w = -445 - -445. Let l be (208 + w)/(-42 + 44). What is the highest common factor of l and 16? 8 Let w be (328 + -315)/(1/11). What is the greatest common factor of w and 8437? 143 Suppose -w = -7w + 138. Let v = 26 - w. Suppose 0 = 18b - 17b - 24. Calculate the highest common factor of b and v. 3 Let r(h) = -8h2 - 125h - 102. Let t be r(-14). Let z(m) = -m3 + m2 - m + 64. Let i be z(0). What is the highest common divisor of i and t? 16 Suppose 244r - 2557 - 12344 = -3189. What is the greatest common factor of 496 and r? 16 Suppose -342y + 11175 = -1821. What is the highest common divisor of 7334 and y? 38 Let a be ((-1311)/1748)/((0 + 2)/(-2960)). What is the greatest common factor of a and 390? 30 Let q(s) = -1515s - 3774. Let a be q(-7). Calculate the highest common factor of a and 27. 27 Let j be 412 + -199 + 3(-4)/(-3). Suppose -t = -349 + 12. Let f = t - j. Calculate the greatest common factor of 48 and f. 24 Let f(m) = 7m - 287. Let r be f(41). Suppose r = -28n + 18n + 1480. Calculate the highest common divisor of n and 8. 4 Let k = 80 + -77. Suppose -2v + 0 = 10, -kn + 2v = -247. Let t = n - 51. Calculate the greatest common divisor of t and 308. 28 Let r(n) = -53n + 69. Let q be r(-9). Calculate the greatest common factor of 2548 and q. 182 Let t = 80 + -62. Let f = -62 + 178. Let w = 82 + f. Calculate the greatest common divisor of t and w. 18 Let a(b) = 77b*2 + 105b - 672. Let t be a(8). What is the greatest common factor of 1372 and t? 196 Suppose g + 0b = -2b + 36, -5g + 222 = -4b. Suppose -7q + 1297 = 219. Calculate the highest common factor of q and g. 14 Let u = -17 + 38. Let b be (u/(-4))/((-45)/600). What is the highest common divisor of 35 and b? 35 Suppose 2m + 3d = 3132, 6228 = -92m + 96m - 3d. What is the greatest common factor of 645 and m? 15 Let s be (-41)/(-2) - 24/(-16). Let h = -8 - -10. Suppose hy - 6y + 264 = 0. Calculate the greatest common factor of y and s. 22 Let t be (-38 + -1)2/(-2). Suppose -14j + 10 + 102 = 0. Let x be (-4)/j26-33. Calculate the highest common factor of t and x. 39 Let o = 445 - 411. Let b = 32 + 138. Calculate the greatest common factor of b and o. 34 Let g be 2 + (0 - -17) - (-2 + -1). Suppose 6k + 234 = 252. Calculate the greatest common divisor of g and k. 1 Suppose 2q + 2i + 30 = 0, -q + 42 = -3q + i. Let h be 3/(-12)-28 - q. What is the greatest common factor of h and 442? 26 Suppose 33r = -55r + 42240. Calculate the greatest common divisor of r and 165. 15 Let r = -2664 + 3220. Calculate the highest common divisor of 5977 and r. 139 Suppose 94y = 111y - 510. Calculate the greatest common factor of 340 and y. 10 Let x be 1-252(-7 + 72/(-16)). Calculate the greatest common divisor of x and 54. 18 Let q(i) = i + 12. Let g be q(-4). Let u = g - -31. Let y = 8 + 5. Calculate the greatest common divisor of u and y. 13 Let g be 42/((66/48)/(-11)-4). Let b(h) = h3 - h2 - 4h + 6. Let r = -15 + 18. Let o be b(r). Calculate the greatest common divisor of o and g. 12 Let r(n) = n3 - 2n*2 - 9n + 14. Let p = -64 + 48. Let q = 21 + p. Let v be r(q). What is the highest common divisor of 22 and v? 22 Let h be (28/(-63))/(72/(-8100)). What is the highest common factor of 290 and h? 10 Let p(d) = d + 475. Let u be p(0). Suppose -362z + 366z = 8, 3k - 7 - 40 = 5z. What is the greatest common factor of u and k? 19 Suppose -j + 2595 = -q, 1956 = 3j - 5q - 5821. Calculate the greatest common factor of 23 and j. 23 Let d = -38 + 22. Let u = d + 17. Suppose i = -u + 5. What is the greatest common factor of i and 20? 4 Suppose g = 5n + 11 + 13, 96 = 4g - 4n. Let l be (-20)/(-6)(27 - g). Let i be 78/1 + (1 - -1). Calculate the greatest common factor of i and l. 10 Let a be (6/7)/(-6(-8)/1680). Calculate the highest common factor of a and 1968. 6 Let w be (6 + 235/10)-2-1141. What is the highest common divisor of w and 57? 57 Suppose -l = -4f + 1952, -3f - 64l = -59l - 1487. Calculate the greatest common factor of 815 and f. 163 Let a(s) = -s*2 + 54s + 205. Let r(v) = -v*3 - 5v*2 + 8v + 8. Let k be r(-7). Let i be a(k). What is the greatest common divisor of i and 5? 5 Suppose -5t + 90 = -5o, -t + 30 = 6o - o. Let z be 12/(-18)(-104 - -14). What is the greatest common factor of t and z? 20 Let b be (1380/(-45))/((-4)/6). Suppose 0 = -5q + 3q + 230. What is the highest common factor of b and q? 23 Suppose 0 = -5b - 25, -z - 2b = 3b - 119. Calculate the highest common divisor of z and 27. 9 Suppose 24f = 2075 + 805. Calculate the highest common factor of f and 390. 30 Let j(i) = -i*3 + 8i*2 - 10i + 6. Let q be j(9). Let m be q(-3 + 28/12)/2. Calculate the greatest common divisor of 22 and m. 11 Let t = 78 + -76. Suppose 7 = -tx + 19. Calculate the greatest common factor of 63 and x. 3 Let w be (-9842)/(-49) + (-24)/28. Calculate the greatest common divisor of w and 1450. 50 Let u(m) = -m*2 + 16m + 647. Let d be u(-16). Calculate the greatest common divisor of 1005 and d. 15 Suppose 5n = 3l - 35, 0 = 2l - 5n - 25 + 5. Suppose 15t - 2550 = -15t. Calculate the highest common factor of l and t. 5 Let h be -65082/(-3366) - 1/17. Suppose 4m - 3m + 3 = 3k, 0 = -5m. Calculate the greatest common divisor of h and k. 1 Suppose 3q + 3g - 414 = -0q, -258 = -2q + 4g. Suppose -qp - 72 = -138p. What is the highest common divisor of 66 and p? 6 Let h(l) = 3l3 + 4l*2 - 15l + 19. Let f be h(3). Suppose 4t = -12, -3s - t - 31 = -f. Calculate the greatest common divisor of s and 3. 3 Suppose -u = 5s + u - 460, 0 = -5u + 25. Suppose -88o + so = 128. What is the highest common factor of 32 and o? 32 Let o be 95/(-13 + ((-187)/(-22) - 5)). What is the greatest common divisor of o and 1090? 10 Suppose 732z - 5 = 737z. Let x(q) = -198q*3 - 2q*2 + 2. Let u be x(z). What is the greatest common divisor of 18 and u? 18 Let n = -385 - -378. Let d(w) = -4w - 14. Let s be d(n). What is the highest common divisor of 14 and s? 14 Let a = -1223 + 1328. What is the highest common divisor of a and 75? 15 Let t be (((-100912)/(-21))/(-34))/((-4)/6). What is the highest common divisor of t and 22684? 212 Let d be (88/(-10))/(2/(-15)1). Let g = d - 36. Calculate the greatest common divisor of g and 50. 10 Suppose 4i - 5946 = -134a + 136a, 2953 = 2i + 3a. What is the highest common divisor of i and 2756? 212 Suppose 194h + 46h - 16354 = 19h. Let r = 75 - 1. Calculate the greatest common factor of r and h. 74 Suppose 3g + 1645p - 285 = 1643p, -5p - 380 = -4g. Calculate the highest common factor of 6745 and g. 95 Let g be (-3)/(((-1)/(-1))/(-36)). Calculate the highes	{ "pile_set_name": "DM Mathematics" }
Suppose 0m = -5m + t. Is 11/m(-1 - -3) a prime number? True Let o be (-6)/(-3)1/2. Let s(u) = -80u3 + 3u2 + u - 1. Let t(y) = y2 + y. Let w(f) = -s(f) + t(f). Is w(o) composite? False Let u be (2 - 3)/((-2)/10). Suppose -uy + 50 = -3y. Suppose -5a + y = 5x, x = -4x - 3a + 21. Is x a composite number? False Suppose 4l - 129 = 7l. Let w = -8 - l. Is w a prime number? False Let n be (222/4)/(2/(-4)). Let b = -64 - n. Is b prime? True Suppose 2v = 4t - 1322, 4t - 1327 = -5v + 2v. Is t a composite number? False Let u(s) = s2 - s + 2. Let b be u(0). Suppose -o = 3o - 5i - 56, 0 = 3o + 3i - 69. Is o - (-2 + b)/(-2) composite? False Let o(d) = -152d - 4. Let a be o(2). Let r = -117 - a. Is r a prime number? True Let v(s) = 9s2 + 2s + 1. Let y be v(-1). Suppose 2k + 3t = -0t + 3, -2t - y = -2k. Suppose -j + k + 7 = 0. Is j prime? False Suppose -a + 131 = 45. Is a a prime number? False Let a be (12/(-30))/((-1)/215). Let s be (a/6)/((-4)/(-72)). Is 2 + 1 - s/(-3) a composite number? False Is 27310/(-2)(3 - 4) a composite number? True Let u be (-3)/2(-8)/3. Suppose 5d = 4d, 2d - 476 = -us. Is s prime? False Suppose 0 = 4q - 5j - 85, 0 = 4q - q + 3j - 30. Suppose 2s + 5 - q = 0. Suppose 4v - 2d - 12 = 14, sd + 11 = v. Is v a prime number? False Let p(f) = 6f*2 + 8f - 11. Is p(5) a composite number? False Suppose 3133 - 922 = 3b. Is b a composite number? True Let z be -1 - -4 - 2/(-1). Let a be (-2)/z + 224/(-40). Is (-5742)/(-45) + a/10 a composite number? False Let y(i) = 2i*2 - 6i + 5. Let f be y(3). Suppose -4p + fd = -1244 - 820, -p = 4d - 537. Is p composite? False Let s be (-3 + 0)3/9. Let g = s + 1. Is (g + 5)(-26)/(-2) a composite number? True Let f = -15 + -12. Let q be 36/f-3. Suppose qi = 2r - 116, -6r + 240 = -r + 5i. Is r a composite number? False Suppose 15 = 3v - 27. Is 219/2 + (-7)/v prime? True Suppose 5x = -3w - 5, -2w + 2x - 4x - 2 = 0. Suppose w = 2s - 0s - 66. Is s a prime number? False Let v(m) = -3m - 3. Let g be v(-2). Suppose -k = -gk. Suppose k = 3a - 6, -i + 5a = 2a - 29. Is i a prime number? False Suppose -47 = -3f - 5. Is f prime? False Let z = -975 + 1864. Is z composite? True Suppose 8z - 764 = 4z. Is z a composite number? False Let l = 21 + 28. Let i = 88 - l. Is i prime? False Suppose -24 = -3h - 3v, 5h + 5v = 3h + 16. Suppose 2g - l = h, -2l = 3g - 0l - 12. Is (-114)/g2/(-3) composite? False Let x(g) = -g - 1. Let j be x(-2). Let r(s) = 0 + j + s + 4. Is r(5) a prime number? False Let z(b) = 3b*2 - 3b - 1. Let m be (10/(-4))/((-2)/4). Is z(m) a composite number? False Suppose 0h + h - 5691 = -5t, 0 = t - 3h - 1151. Is t prime? False Let l(d) = -d3 - 3d*2 + 3. Let y be l(-3). Let k be 3/(2/(4/y)). Suppose ku - c - 174 = 0, -5u + 545 - 132 = 3c. Is u composite? True Suppose 0k = k - 419. Is k composite? False Is 158 - (-3 - (-7 + 3)) a composite number? False Suppose 0 = 2c + 5i - 1793 + 6614, -5c + i = 12066. Let n = -1670 - c. Is n prime? True Suppose p - 2l = 1357, 4p - 5l = -p + 6795. Is p a prime number? True Suppose 0 = 5o - 3371 - 1224. Is o a composite number? False Suppose 7o = -5250 + 22309. Is o composite? False Let o(q) = 3q - q + 1 - q. Let u be o(4). Suppose -3a - 2w = -ua + 48, -73 = -3a + 4w. Is a composite? False Suppose -4q - 1 = -t + 2, -3q = -3t + 36. Is t a prime number? False Let q(i) = 298i. Let x be q(1). Let u = 485 - x. Is u prime? False Let u(q) = 9q*2 - 2 - 2q + 8q2 - 9q*2 + 7q*2. Is u(3) a prime number? True Let x(t) = -6t*2 - 4t + 8. Let m be x(-8). Let r = m + 564. Suppose 2o - r + 66 = 0. Is o a composite number? True Suppose 0j - 2j = -8. Suppose 4c + 5h + 174 = 1, -4c = jh + 168. Let w = c + 68. Is w a prime number? True Let z(n) = n + 2. Let w(m) = m + 12. Let f be -71(-3 + 4). Let d be w(f). Is z(d) composite? False Suppose 3f - 9 + 0 = 0. Suppose -262 = -fa + a. Is a composite? False Let x be 6050/90 - 2/9. Is x/(2/((-2)/(-1))) a composite number? False Let s(c) = 58c*3 - c + 1. Let r be s(1). Let i be 506/(-4)(0 + -2). Suppose -3n + i - r = 0. Is n composite? True Let v(f) = -f3 - 4f*2 + 5f + 5. Suppose 3w = -2 - 10. Let y be w/16 + (-46)/8. Is v(y) a composite number? False Let w(b) = -3b*3 + 2b*2 + b. Let l be w(-1). Suppose -2x + l = -0x. Is x + (-1 - (-2)/2) a composite number? False Let t = 1 + -2. Let u be -1 + -1 + (-1)/t. Is 81 + (-5 - u)/2 a composite number? False Let g = -8 + 12. Let z = 11 - g. Let i(p) = p2 - 4p + 10. Is i(z) prime? True Let m(w) = -w*2 + 14w - 2. Is m(12) a composite number? True Let b(l) = 38l. Suppose 3z + 2 - 9 = 2h, -2h - 8 = -4z. Is b(z) a prime number? False Suppose t + 2t - 2421 = 0. Is t prime? False Is 2876/8(2 + 0/2) a prime number? True Let b(z) = 98z + 3. Let y(t) = -393t - 13. Let s(d) = 9b(d) + 2y(d). Is s(1) prime? True Let p = 1401 - -308. Is p prime? True Let j(s) = -s3 - 8s*2 + 5s + 7. Let y be j(-9). Suppose 4z - 180 = u + y, 226 = 4z - 2u. Is z prime? False Let s(d) = -12 + 3d + 3d - 8d. Let v be s(9). Let p = v + 64. Is p a composite number? True Suppose 44 = 2z - 46. Let q be 6/21 + 4/(-14). Suppose 5r = -c + z, 5c - c - 4r - 228 = q. Is c composite? True Suppose -p + c - 8 = 0, 0p - 3p = c + 4. Let i = 56 + p. Is i composite? False Let v(f) = -f*3 + 7f*2 + 2f + 7. Let x = 2 + 13. Let i = x - 9. Is v(i) composite? True Suppose -11g + 3g = -25016. Is g a composite number? True Suppose c + 3c - 12 = 0, 3c = -3b + 240. Is b prime? False Let f = 4 - 2. Suppose 0 = 4c - fc - 2i - 36, 5i - 94 = -3c. Is c a composite number? False Let y be 5/(3/(3 + 0)). Suppose 3f + 2a = -1, -2f - 2a = -ya - 21. Suppose fi - 861 = 5o, i = -2o - o + 287. Is i a composite number? True Let l(j) = -j*2 - 23j + 7. Is l(-11) composite? False Let i(c) = c - 4. Let w = 9 + -5. Let d be i(w). Let m = 3 - d. Is m a prime number? True Suppose -8 - 8 = -4b. Suppose -by + 1605 = 545. Is y prime? False Suppose 2o - 5a + 13 = 0, 2a - 22 = -2o - 0a. Suppose n - 3n = 4q - o, -n = q. Is 56 + n + (-2)/(-1) a composite number? True Suppose 0x - 4x = 3r - 2025, 1370 = 2r - 4x. Let o = r - 480. Is o a prime number? True Is ((-10)/15)/((-4)/1986) composite? False Let d(o) be the third derivative of o5/15 + o3/6 - o*2. Let a be d(1). Let v(g) = 3g*2 - 5g - 3. Is v(a) a composite number? False Let a(m) = 213m + 2. Suppose -5x + 4g = -17, 0 = -5x - 0x - 3g - 4. Is a(x) a prime number? False Let m(w) = w*3 - 8w*2 + w - 8. Let t be m(8). Suppose t = l - 50 + 1. Is l a prime number? False Let n(s) be the second derivative of -1/2s*4 + 3s + 0 - 3s2 - 1/3s*3 - 1/20s5. Is n(-6) composite? True Let r(z) = z2 + 2z + 3. Let v(f) = 3f + 3. Let c(j) = 4r(j) - 3v(j). Suppose 4l - 2k - k + 28 = 0, -36 = 4l - 5k. Is c(l) prime? True Suppose -8r - 359 = -2i - 3r, -r = i - 190. Is i prime? False Let i be 4/(-8) - 33/(-2). Suppose -2k - 5m + i = 0, -6 = 5m + 4. Is k a composite number? False Let d = 2 - -3. Suppose -381 = -dl + 2l. Is l a prime number? True Suppose 2z - 3 = -3v - 5, -2z + 4 = 0. Is 34/5(7 + v) composite? True Suppose z - 3 = -0z. Suppose zu - 14 = -2d, d - 14 = -3u - 2u. Suppose up + 0 - 90 = -4q, 2p = 5q + 54. Is p prime? True Is 263 - (0/(-4))/4 a prime number? True Is (1 + 708/9)3 a composite number? False Let g(c) = 2c3 + 4c*2 + 22c - 7. Is g(6) a composite number? False Let a(l) = -l*3 - 5l*2 - 5l - 1. Let g be a(-4). Suppose -u = gu - 220. Is u a prime number? False Suppose 2p = -109 + 273. Is p a prime number? False Let c = 9 - 2. Suppose -ct + 1115 = -2t. Is t composite? False Is 141/(1 + -2 + 2) a prime number? False Suppose -5f - 2t - 606 = 0, 2t + 2t = -f - 114. Let v = -33 - f. Is v a prime number? True Suppose 0 = -33r + 29r + 10628. Is r a prime number? True Let z(d) = -40d + 3. Let n be 6/(-21) - 33/7. Is z(n) prime? False Suppose 3y = 2q - 502, 5q + y - 1269 = 5y. Is q a composite number? False Let a be -3 - 6/(-3) - -2. Let s = 2 + a. Is s composite? False Let g be 10/(-4)36/(-30). Let o(y) = 3y3 - 4y**2 + y - 2. Is o(g) a prime number	{ "pile_set_name": "DM Mathematics" }
late r. -11, -1 Let o(z) = 2z2. Let n(m) = -17m + 2 + 13m + 4. Let d be n(4). Let c(g) = -11g*2 + 2g. Let h(b) = do(b) - 2c(b). Factor h(k). 2k(k - 2) Suppose -6x + 10 + 14 = 0. Factor -4z*5 + xz*3 - 8z*2 + 8z*2. -4z*3(z - 1)(z + 1) Let y(a) be the first derivative of -22 + 2/15a*4 + 0a*2 + 2/75a*5 + 0a + 8/45a3. Factor y(x). 2x*2(x + 2)*2/15 Suppose -5j = -4b + 5, 3j - 2 = -5b + 5j. Suppose -4k + 8 + 0 = b. Let -2t*4 - 4/5t*5 - 2/5t*3 + 0 + 4/5t*k + 0t = 0. What is t? -2, -1, 0, 1/2 Let v = 9 - 5. Suppose 5k - 14 = 2i, -vk + 2i - 2 = -3k. Factor 0 - c + kc + 2 + c*2. (c + 1)(c + 2) Let d be (16/(-5) + 2)/((-9)/30). Let f be (-6)/((-180)/95) + 10/(-4). Find k such that -2/3kd + 0k - 2/3k3 + 0 + 2/3k*5 + fk*2 = 0. -1, 0, 1 Let a = 169/6 - 2618/93. Let v = a + 107/1054. Factor 4/17m*3 - 2/17m - 2/17m5 - 2/17m*4 + 4/17m*2 - v. -2(m - 1)*2(m + 1)3/17 Let m(t) be the third derivative of -t6/720 + t5/180 - t4/144 + 168t2. Let m(a) = 0. Calculate a. 0, 1 Suppose -5z + 5z - 6z = 0. Let c(w) be the first derivative of -1/18w3 + 6 + 0w + zw2. Factor c(i). -i2/6 Let u(x) be the first derivative of x5/25 + x4/10 - x3/5 - 2x*2/5 + 4x/5 - 518. Find s, given that u(s) = 0. -2, 1 Let q(z) be the second derivative of -z7/840 - z6/90 - z*5/40 - 7z*3/2 - 9z. Let s(g) be the second derivative of q(g). Suppose s(r) = 0. Calculate r. -3, -1, 0 Let z(b) be the third derivative of b9/3780 + b8/1680 - b7/630 - b6/180 + 17b4/24 - 11b*2. Let g(d) be the second derivative of z(d). Factor g(a). 4a(a - 1)(a + 1)*2 Factor 0u - 1/3u5 + 0 + 0u*2 + 1/3u*4 + 2/3u3. -u3(u - 2)(u + 1)/3 Factor 84x2 + 2x*4 - 33x*2 - 25x*2 + 28x*3. 2x*2(x + 1)(x + 13) Let -50q*3 - 1 + 31q*2 + 17q*3 - 76q*2 + 1 - 12q = 0. What is q? -1, -4/11, 0 Suppose o - 54 = -2o. Let l be (o/(-24))/(1/(-4)). Factor 18s*l + 3s*5 - 6s*4 - 3s*4 - 15s*3 + 17s*2 - 6s - 8s2. 3s(s - 2)(s - 1)*2(s + 1) Let y be 4 + (-2 - 3 - -4). Suppose 96/5 + 21/5by - 3/5b*4 - 96/5b - 18/5b2 = 0. Calculate b. -2, 1, 4 Suppose -10o = -7o. Find j such that -10 - 21j*4 - 15j*2 - 25j + 5j3 + 26j*4 + oj*3 = 0. -1, 2 Let m be (-2424)/45 + (-4)/30. Let v be ((-4)/m)/(4/12). Factor -2/3a - 2/9a3 - 2/3a*2 - v. -2(a + 1)*3/9 Let c(s) be the first derivative of -1/9s*4 - 2/3s*2 - 16/27s*3 + 0s - 19. Solve c(x) = 0 for x. -3, -1, 0 Let r = 35 - 35. Suppose -4v - 4i + 20 = r, -v + 2i + 0i = 4. Factor -6/13p + 0p*v + 4/13 + 2/13p*3. 2(p - 1)*2(p + 2)/13 Suppose 8 - 72 = 4m. Let k = m + 18. Solve -1 - a3 + 7a - ka4 - 3a*2 + 9a*2 + 3 = 0. -1, -1/2, 2 Let x(a) be the first derivative of -1/2a*4 + 0a + 17 + 0a3 + 2/5a*5 + 0a*2. Determine y, given that x(y) = 0. 0, 1 Factor 0 + 522/7t - 6/7t2. -6t(t - 87)/7 Let r(j) be the first derivative of -j4/28 + j3 - 21j*2/2 + 49j + 137. Factor r(m). -(m - 7)3/7 Let z(m) be the second derivative of m6/240 - m5/40 + m4/16 + 2m3/3 + 8m. Let i(a) be the second derivative of z(a). Solve i(o) = 0. 1 Let l(c) be the second derivative of -c*4/48 + 4c*3 - 288c*2 - 19c. Find h such that l(h) = 0. 48 Suppose -t = 1 - 4. Let 3m3 - 8m*3 + 3m*3 - tm2 + m3 - 3m - 1 = 0. What is m? -1 Let d(a) be the first derivative of a5/4 - 5a*3/6 + 5a - 18. Let h(i) be the first derivative of d(i). Let h(y) = 0. What is y? -1, 0, 1 Let o(d) = 18d - 18 + 13d*2 + 7d2 + d2. Let m(a) = 4a - 2. Let z be m(5). Let i(y) = 6y*2 + 5y - 5. Let v(h) = zi(h) - 5o(h). Factor v(r). 3r2 Let g(d) = -3d3 - d2 + 2d + 5. Let r = 25 - 29. Let v(q) = -2q*3 + 2q + 4. Let n(t) = rg(t) + 5v(t). Determine i so that n(i) = 0. -1, 0 Let l(d) be the first derivative of -3d3 + 11d*2/2 - 2d + 32. Factor l(m). -(m - 1)(9m - 2) Let b(m) be the third derivative of m7/84 + m6/40 - m5/30 - m4/8 - m*3/12 + 7m*2. Factor b(i). (i - 1)(i + 1)*2(5i + 1)/2 Let w(v) = -2v*2 - 3v. Let s(m) = -3m2 - 5m. Let d be ((-2)/(-4)-3)/((-1)/(-2)). Let r(l) = ds(l) + 5w(l). Factor r(k). -k2 Let b(w) be the third derivative of -w8/112 + w7/5 - 5w*6/8 + 3w*5/5 - 2w2 + 6. Suppose b(c) = 0. Calculate c. 0, 1, 12 Let d(g) be the third derivative of g6/780 - g*5/30 + 5g*4/26 + 101g*2. What is z in d(z) = 0? 0, 3, 10 Let l = -5 + 8. Suppose 4 = -x - x, lj + 5x + 1 = 0. Factor 0 - 1/2y*2 + 1/4y + 1/4yj. y(y - 1)*2/4 Let d(h) be the third derivative of -2h*7/35 - 13h*6/30 - 19h*5/15 - 11h*4/6 - 4h*3/3 - 27h*2. Let d(f) = 0. What is f? -2, -1, -1/3 Let h = -106 + 106. Suppose h - 2/15j*4 - 4/5j - 4/5j3 - 22/15j*2 = 0. Calculate j. -3, -2, -1, 0 Let b(i) = -48i*2 - 77i + 23. Let v(y) be the first derivative of y3/3 - y2/2 - y - 21. Let q(p) = -b(p) - 3v(p). Let q(s) = 0. Calculate s. -2, 2/9 Factor 64/7h*2 - 40/7h + 2/7h4 + 0 - 26/7h*3. 2h(h - 10)(h - 2)(h - 1)/7 Let q be 4/(-120)8 + (-6)/(-15). Let -4/15v - 2/5 + qv*2 = 0. What is v? -1, 3 Let k(w) be the first derivative of 0w - 4w2 + 23/5w*5 + 15/2w*4 + 5/6w*6 + 1 + 4/3w*3. Find j such that k(j) = 0. -2, -1, 0, 2/5 Let y = 191 + -185. Let c(t) be the third derivative of 0t*3 + 1/150t*5 + 0t + 1/300ty + 0t*4 + 0 - 7t*2. Factor c(u). 2u*2(u + 1)/5 Let l be 5/(975/30)(3 - 1). Let -2/13o + l - 2/13o2 = 0. Calculate o. -2, 1 Let m(z) be the second derivative of -z6/80 + z5/8 - 3z*4/16 - 23z*3/6 + 23z. Let n(t) be the second derivative of m(t). Factor n(p). -3(p - 3)(3p - 1)/2 Factor 1/4d*2 + 9/2d + 0. d(d + 18)/4 Suppose 3634k - 296 = 3486k. Let -2/3 - 1/3g4 + gk - 1/3g3 + 1/3g = 0. What is g? -2, -1, 1 Let i(l) be the first derivative of l6/720 - l5/40 + 5l4/48 + 2l*3 - 29. Let x(z) be the third derivative of i(z). Factor x(f). (f - 5)(f - 1)/2 Let p(t) be the first derivative of -t5/70 - t4/42 + 4t3/21 + 4t*2/7 + 8t - 15. Let c(h) be the first derivative of p(h). Solve c(m) = 0. -2, -1, 2 Let w(i) = -4i + 2. Let v be w(4). Let y = -8 - v. Find g, given that 0g4 + 10 - y + g4 - 5g2 = 0. -2, -1, 1, 2 Let i(t) be the third derivative of -t5/12 + 5t*4/8 - 242t*2. Factor i(h). -5h(h - 3) Let t(i) be the first derivative of -1/2i*3 - i - 5/4i*2 - 11. Factor t(g). -(g + 1)(3g + 2)/2 Suppose -3d = -d - 4. Suppose 0 = 4s + 4h + d - 34, 27 = 4s + 3h. Let -sy + 0 - 2 + y2 + 4y = 0. Calculate y. -2, 1 Let x(b) be the third derivative of 1/4b3 + 0 - 1/20b*5 + 1/16b*4 + 0b - 6b2. Suppose x(n) = 0. Calculate n. -1/2, 1 Let u(b) = -b2 + 10b - 8. Let y be u(9). Let g(n) = 6n - 2. Let z be g(y). Suppose i5 - 4i*5 - zi*4 + 2i*4 + 5i*4 = 0. What is i? 0, 1 Let v(a) be the third derivative of -7a*5/270 + 23a*4/108 - 2a*3/3 - 23a*2 - 2. What is w in v(w) = 0? 9/7, 2 Factor 198 + 195 + 58x - 84x2 - 357 - 10x*3. -2(x - 1)(x + 9)(5x + 2) Let t(w) = -86w*2 - 87w - 16. Let h(v) = -44v2 - 43v - 8. Let d(g) = -7h(g) + 3t(g). Suppose d(q) = 0. Calculate q. -2/5 Let p(x) be the second derivative of -x5/90 - x4/4 - 8x3/9 - 23x*2/2 + 10x. Let a(v) be the first derivative of p(v). Factor a(t). -2(t + 1)(t + 8)/3 Let d = -2/3 + 17/12. Let h be -1 - (54/(-12) - -2). Suppose 9/4b + h + db*2 = 0. What is b? -2, -1 Let p(o) be the first derivative of 2o*3/15 + 3o*2 - 89. Find n, given that p(n) = 0. -15, 0 Factor 16o*2 - 3 - 17 - 24o - 12o2 - 8o*2. -4(o + 1)(o + 5) Let v(u) be the second derivative of -u9/3024 + u8/1680 + u7/420 + 7u*3/6 + 26u. Let m(y) be the second derivative of v(y). Factor m(x). -x*3(x - 2)(x + 1) Let a = -107/22 + 59/11. Let u(o) be the first derivative of -2/5o*5 + 2/3o*3 + 6 - ao*4 + 0o + 1/3o6 + 0o*2. Suppose u(h) = 0. What is h? -1, 0, 1 Factor -32 + 2o*4 + 20o + 0 - 36o3 + 28o*2 + 2o*4 + 16o. 4(o - 8)(o - 1)*2(o + 1) Let q(o) be the second derivative of -5o7/42 - 2o*6/3 + 5o*5/4 + 6o - 2. Solve q(i) = 0. -5, 0, 1 Let p be 1(-1 - (-6 - -1)). Suppose 2m + 23 = 5j, -5 = 5j + 4	{ "pile_set_name": "DM Mathematics" }
. 2 Solve 1023 = -4x + 1035 for x. 3 Solve -40 = 440h - 448h for h. 5 Solve -262v + 272v = -40 for v. -4 Solve -34g - 176 = -78g for g. 4 Solve 104s = 106s + 8 for s. -4 Solve 0 = 6c - 23c for c. 0 Solve 88 = 6j + 100 for j. -2 Solve 7t + 0 = -28 for t. -4 Solve 4d - 15d = 44 for d. -4 Solve 0 = 137k - 142k - 5 for k. -1 Solve 0 = 2p + 108 - 114 for p. 3 Solve 77x + 3x + 720 = 0 for x. -9 Solve -849 + 777 = 12x for x. -6 Solve -24m - 138 = 30 for m. -7 Solve 86d - 130 = 816 for d. 11 Solve 10q - 196 = -18q for q. 7 Solve -2k + 2k - k = 0 for k. 0 Solve -i + 50 = 49 for i. 1 Solve -7y + 14y = 0 for y. 0 Solve -16k = -5k + 36k for k. 0 Solve -17 + 2 = -3o for o. 5 Solve 8k = 12k + 12 for k. -3 Solve o + 3 - 5 = 0 for o. 2 Solve -6x = -126 + 126 for x. 0 Solve -u = -2u + 3u for u. 0 Solve -4a = a + 15 for a. -3 Solve 0 = 19q - 28q + 18 for q. 2 Solve 3c = -5 + 8 for c. 1 Solve 6z = 19 + 11 for z. 5 Solve 0 = -32h + 95 + 65 for h. 5 Solve -4r + 4 = -6r for r. -2 Solve 13 + 5 = 6r for r. 3 Solve 86s + 60 = 98s for s. 5 Solve 0 = 8u - 16 - 0 for u. 2 Solve -6i + 13 + 5 = 0 for i. 3 Solve 4r + r = 4r for r. 0 Solve 0h + 6h + 5h = 0 for h. 0 Solve -36 = 6i - 6 for i. -5 Solve 0 = 33f - 68f + 105 for f. 3 Solve 19f + 198 - 65 = 0 for f. -7 Solve 6g - 10g - 16 = 0 for g. -4 Solve -7u - 2u = 8u for u. 0 Solve 9671w = 9670w + 11 for w. 11 Solve 0 = 25a + 210 - 260 for a. 2 Solve 0 = -6b + 2b + 20 for b. 5 Solve 107 = -18h - 19 for h. -7 Solve 20p - 51 = 3p for p. 3 Solve -2v + 22 = 24 for v. -1 Solve -3 + 3 = 6d for d. 0 Solve -45a + 7a = -190 for a. 5 Solve -395v + 380v + 120 = 0 for v. 8 Solve 4 = u + 1 for u. 3 Solve 0 = 32r + 50 + 46 for r. -3 Solve 2m + 26 = 24 for m. -1 Solve 114 = -l + 112 for l. -2 Solve -41g + 202 = -208 for g. 10 Solve -31t = 42t - 511 for t. 7 Solve 13w - 7 = 19 for w. 2 Solve 64c + 5 = 65c for c. 5 Solve 0 = -3o - 3 - 3 for o. -2 Solve -2t - 17t + 19 = 0 for t. 1 Solve i + 1 = -1 for i. -2 Solve 3r - 8 = -5 for r. 1 Solve -13c = -28 + 2 for c. 2 Solve -4j + 1465 - 1501 = 0 for j. -9 Solve -113 = -5c - 123 for c. -2 Solve -10a + a - 45 = 0 for a. -5 Solve 3v - 10v - 35 = 0 for v. -5 Solve -7o - 4603 = -4645 for o. 6 Solve 5 = 42m - 37 for m. 1 Solve 36 - 15 = -7x for x. -3 Solve 2f = 7f for f. 0 Solve 2o + 31o - 132 = 0 for o. 4 Solve -14 = 8p - 6 for p. -1 Solve 4 = 11n - 7n for n. 1 Solve 13i - 55 = -3 for i. 4 Solve 0 = -7u + 5u - 16 for u. -8 Solve 416q + 3 = 415q for q. -3 Solve 5s - s = 16 for s. 4 Solve -5c + c = 16 for c. -4 Solve 2o - 172 = -160 for o. 6 Solve 0 = -0y - 19y for y. 0 Solve -38 = -8h + 10 for h. 6 Solve 0 = -13i + 49i - 216 for i. 6 Solve -9r - 3 = -3 for r. 0 Solve -29f = -8f + 42 for f. -2 Solve 68b - 441 = 19b for b. 9 Solve -1723m = -1729m for m. 0 Solve 64v + 52 = 51v for v. -4 Solve -6 = -25g + 23g for g. 3 Solve -98a = -88a - 20 for a. 2 Solve 0y + 25 = 5y for y. 5 Solve -4w - 113 = -117 for w. 1 Solve -33l = -64l + 186 for l. 6 Solve 3o + 74 = 83 for o. 3 Solve -297 + 288 = 9w for w. -1 Solve -94 - 26 = -30l for l. 4 Solve 11i = -21i - 96 for i. -3 Solve 14 = 33x - 52 for x. 2 Solve 114m + 204 = -90m for m. -1 Solve -15a + 6 = -9a for a. 1 Solve -13y = -56 - 9 for y. 5 Solve 0 = 15f - 233 + 143 for f. 6 Solve 76s = -23s for s. 0 Solve -37m + 8m - 174 = 0 for m. -6 Solve 21z = 27z - 18 for z. 3 Solve 36n + 67 = -113 for n. -5 Solve 10v + 2v = 48 for v. 4 Solve 0l - 3l = 7l for l. 0 Solve 0 = 8i - 27 - 5 for i. 4 Solve -6q = -76 + 112 for q. -6 Solve 30n = -12 + 102 for n. 3 Solve -191 = -15d - 116 for d. 5 Solve 2b + 6 = -b for b. -2 Solve 8i + 32 = -0i for i. -4 Solve -8o - 9 = 31 for o. -5 Solve u + 14 = 14 for u. 0 Solve 0 = 13b - 5b for b. 0 Solve 5q + 4 = -31 for q. -7 Solve 17b + 5b = 154 for b. 7 Solve -2k + 19k = -34 for k. -2 Solve 194 = -66w - 268 for w. -7 Solve -10i + 12 = -13i for i. -4 Solve 28t + 9 = 65 for t. 2 Solve -13t - 532 = -519 for t. -1 Solve j + 64 = 66 for j. 2 Solve -456a = -455a - 2 for a. 2 Solve -33u + 133 - 34 = 0 for u. 3 Solve -124 = 7l - 138 for l. 2 Solve -45f - 39 = -58f for f. 3 Solve -34 + 13 = -7b for b. 3 Solve 5j = -23 + 48 for j. 5 Solve -5 - 30 = -7n for n. 5 Solve 13j + 40 = 5j for j. -5 Solve 2b = -b + 3 for b. 1 Solve 85r = 82r - 15 for r. -5 Solve -4 = 9i - 7i for i. -2 Solve -12a = 149 - 113 for a. -3 Solve 13q = -0q + 2q for q. 0 Solve -4u + 9 = -u for u. 3 Solve 6991 = -2b + 6997 for b. 3 Solve -424y + 428y - 8 = 0 for y. 2 Solve -94n + 3 = -95n for n. -3 Solve -181x = -185x for x. 0 Solve 0 = 2s + 1 - 11 for s. 5 Solve 39 = -10d - 3d for d. -3 Solve 2k - 23 + 7 = 0 for k. 8 Solve 235c - 22 = 224c for c. 2 Solve -4g = -15g for g. 0 Solve -294 = -9g - 195 for g. 11 Solve -32 = -2v - 50 for v. -9 Solve 5m + 5m = 3m for m. 0 Solve 65 - 9 = 28o for o. 2 Solve 0 = 115i + 84i - 995 for i. 5 Solve h = -16h for h. 0 Solve 10q - 9q + 4 = 0 for q. -4 Solve -27q = -26q - 2 for q. 2 Solve -113i = -101i for i. 0 Solve -155 + 47 = 36o for o. -3 Solve -21 + 1 = 4v for v. -5 Solve -10 - 5 = 5w for w. -3 Solve 7j + 4j = 44 for j. 4 Solve 33l - 3 = 34l for l. -3 Solve -6x = 2 - 20 for x. 3 Solve 32p + 4p - 216 = 0 for p. 6 Solve 3x = -2x + x for x. 0 Solve 19o - 1148 + 1129 = 0 for o. 1 Solve 39t = 13t + 78 for t. 3 Solve 2j = -14j + 96 for j. 6 Solve -11u = 14 + 41 for u. -5 Solve 7 = -9w - 56 for w. -7 Solve 5o + 0 + 0 = 0 for o. 0 Solve 0 = -19y + 18y + 4 for y. 4 Solve -42 = 276h - 262h for h. -3 Solve -32h = -8h + 24 for h. -1 Solve 0 = -4k + 14k - 10 for k. 1 Solve -3q + 8 = -1 for q. 3 Solve -17x + 8 = -15x for x. 4 Solve 1929 - 1923 = 6i for i. 1 Solve -206 = 9d - 287 for d. 9 Solve -26z = -35z - 27 for z. -3 Solve 159 = 46x + 7x for x. 3 Solve 0 = 11h - 572 + 484 for h. 8 Solve 13l - 7l + 30 = 0 for l. -5 Solve -83g = -80g + 12 for g. -4 Solve -36g = -8g - 84 for g. 3 Solve -4x - 4 = -3x for x. -4 Solve 0 = -9s + 56 - 11 for s. 5 Solve 2 = -15a + 14a for a. -2 Solve -19 - 59 = -13a for a. 6 Solve -5n - 5n = -20 for n. 2 Solve x + 2x = -3 for x. -1 Solve -3 = -51y + 52y for y. -3 Solve 144 = 130z - 106z for z. 6 Solve -21 = -3d - 6 for d. 5 Solve -17i = -13i - 16 for i. 4 Solve -185 = 28c - 65c for c. 5 Solve 0x - 14 = -7x for x. 2 Solve -5r - 21 + 11 = 0 for r. -2 Solve -3 = -13n + 10n for n. 1 Solve 40f = -299 + 59 for f. -6 Solve -2l - 17 + 9 = 0 for l. -4 Solve -35x = 18x - 53 for x. 1 Solve -26m = m + 81 for m. -3 Solve -k = 2k - 0k for k. 0 Solve 122k = 117k - 25 for k. -5 Solve 235a - 214a + 189 = 0 for a. -9 Solve 0 = -6m + 3m + 4m for m. 0 Solve 13q = 34 + 18 for q. 4 Solve -2 = 9q + 7 for q. -1 Solve -u + 14u - 39 = 0 for u. 3 Solve 0 = 37v - 33v + 20 for v. -5 Solve -2v - 56 = -56 for v. 0 Solve 50 - 10 = -20s for s. -2 Solve -144 = 3m - 120 for m. -8 Solve 969 = 5i + 939 for i. 6 Solve -3l - 15 = -6l for l. 5 Solve -4w = 2w + 48 for w. -8 Solve -16 = 8b - 4b for b. -4 Solve 0 = 44x - 256 - 140 for x. 9 Solve 0 = 38v - 44v - 30 for v. -5 Solve -33 - 17 = 10h for h. -5 Solve 24 = -0l - 8l for l. -3 Solve -4l - 790 = -798 for l. 2 Solve 3x - 4 = -16 for x. -4 Solve -76h + 98 - 706 = 0 for h. -8 Solve 0 = -5y - 0y - 15 for y. -3 Solve 38 - 128 = 18z for z. -5 Solve 0 = 11o - 4o + 28 for o. -4 Solve 0 = 4c + c - 15 for c. 3 Solve 0 = -6i - 58 + 34 for i. -4 Solve -804s = -805s + 1 for s. 1 Solve 21l = 64 - 1 for l. 3 Solve 13q = 16q + 15 for q. -5 Solve 5y - 11 = 19 for y. 6 Solve -3 = 3p + 6 for p. -3 Solve -7 + 52 = 9t for t. 5 Solve 2g = -2g + 8 for g. 2 Solve 0 = 50j - 10j + 240 for j. -6 Solve -25n = 8n - 198 for n. 6 Solve -4u = -5u + 5 for u. 5 Solve 6h = -27h + 33 for h. 1 Solve 0 = 6v - 3429 + 3417 for v. 2 Solve 29k + 31 + 56 = 0 for k. -3 Solve -10p - 28 = -14p for p. 7 Solve 0 = -12w - 16w - 196 for w. -7 Solve 232v = 198v - 170 for v. -5 Solve 17p + 132 = 50p for p. 4 Solve -14 = -3f - 2 for f. 4 Solve 0 = 13v - 37 - 2 for v. 3 Solve -29n + 12 = -17*n for n. 1 Solv	{ "pile_set_name": "DM Mathematics" }
+ 32 = -4o, -6i + 2i - 32 = 4o. Let b = o - 4. Let y = b + 47. Calculate the remainder when y is divided by 12. 11 Let i be 2/(-11) + (-53)/11. Let d = -3 - i. Suppose -dh + 46 = -0h. What is the remainder when h is divided by 8? 7 Let x = 44 - -15. What is the remainder when x is divided by 20? 19 Let q(s) = 5s2 + 3s - 3. What is the remainder when q(-3) is divided by ((-9)/(-12))/((-10)/(-120))? 6 Let i(t) = 40t2 + 1. Let x be i(1). Suppose -o - x = -4l - 0o, -2o = -4l + 42. Let a(w) = -7w - 1. What is the remainder when l is divided by a(-1)? 4 Let c(r) = -52r3 + r2 + 3r + 2. Let w = -15 + 14. Let h(s) = -s + 10. What is the remainder when c(w) is divided by h(-8)? 16 Suppose -2d - 1 = l + 13, 4d + 12 = 0. Let b = 8 + l. Suppose b = -o - 3o + 36. What is the remainder when 34 is divided by o? 7 Suppose -2m + 180 = -3u, m = 3m + 5u - 196. Suppose -4v + 11 = j - m, v - j - 31 = 0. Calculate the remainder when v is divided by 7. 6 Let j = 0 + 15. Suppose -9 = 3y + 3. Let p = j - y. What is the remainder when p is divided by 7? 5 Let t(u) be the first derivative of 2u*2 - 7u - 4. Suppose x + 3 = 5r - r, 5x + 3r = 31. What is the remainder when 25 is divided by t(x)? 12 Let h = -47 - -100. What is the remainder when h is divided by 19? 15 Suppose 0v + 18 = v. What is the remainder when 52 is divided by v? 16 Suppose -13h = -9h - 108. What is the remainder when h is divided by 11? 5 Let z(d) = -d*2 - 4d - 2. Let f be z(-3). Let x = 4 - f. Let y(b) = -b*2 + 6b + 5. Calculate the remainder when y(6) is divided by x. 2 Suppose -5m - 3s + 41 = 0, 5s = -5m - 0s + 35. What is the remainder when 28 is divided by m? 8 Let p = 3 + -2. Calculate the remainder when 18 is divided by 5 - ((3 - p) + -2). 3 Let u(n) = 0n + 10n2 + 3 + n + 2n. Let o be u(-3). Suppose 4j = 3j - r + 28, -o = -3j + 5r. Calculate the remainder when j is divided by 10. 8 Let b(c) = c + 5. Let t(h) = h + 1. Let r be t(3). Calculate the remainder when 44 is divided by b(r). 8 Suppose l - 96 = -2l. Calculate the remainder when l is divided by 7. 4 Let a(m) = -7m - 1. Let j be a(6). Let o = j - -60. What is the remainder when o is divided by 10? 7 Suppose 16 = 5u - 24. Let q be 0(2 + -5)/6. What is the remainder when (-3 + q)/(-6)44 is divided by u? 6 Let p = -76 - -140. Calculate the remainder when p is divided by 17. 13 Let t(o) = 19o*3 - 2o - 1. Let z be t(-1). Let c = -8 - z. Calculate the remainder when 19 is divided by c. 9 Let n = 6 - -2. Calculate the remainder when 29 is divided by n. 5 What is the remainder when (2 + (-14)/6)-186 is divided by 16? 14 Let v be 14/(0/(-2) + 2). Suppose -2b - v = 1. What is the remainder when 2/b + (-147)/(-14) is divided by 3? 1 Suppose -3a + 17 = -151. What is the remainder when a is divided by 15? 11 Let h be 4/(-18) + 101/9. Suppose 5w - 44 = -2g + 11, 2g - h = -w. What is the remainder when w is divided by 6? 5 Let g = 30 + -24. What is the remainder when g is divided by 4? 2 Suppose -3j + 4c = -6 - 8, 0 = -3j - 4c - 2. What is the remainder when 2 is divided by j? 0 Let k(c) = 7c2 + 1. Let g(f) = -f - 9. Let n be g(-10). Suppose -5 = -l + m - 2, -3l + m + 13 = 0. Calculate the remainder when k(n) is divided by l. 3 What is the remainder when 38 is divided by (-3)/(-4 + 37/10)? 8 Let i = 6 + -2. Suppose -1 = -y + i. Calculate the remainder when 13 is divided by y. 3 Let n(d) = d*3 - 4d*2 + 5d - 3. Let m be n(3). Let w be (-7 + -2)/m3. Calculate the remainder when (w - (-2 - -1))-1 is divided by 3. 2 Suppose 9j = 4j + 235. Suppose -5a + 34 = 4k - 110, 4a = -k + j. What is the remainder when k is divided by 17? 14 Let m(s) = 5s. Suppose -c + 25 = 8. Calculate the remainder when m(10) is divided by c. 16 Suppose -5b + 37 = -63. Calculate the remainder when 58 is divided by b. 18 Suppose 5x = 6x - 11. Suppose 2z - 2 = -2h, 3z - 4z + 7 = 4h. What is the remainder when (h/1)/((-1)/(-16)) is divided by x? 10 Let k(r) = r - 1. Suppose 0 = -4s + 4 + 4. Calculate the remainder when 1 is divided by k(s). 0 Suppose 3k = 32 + 22. What is the remainder when k is divided by 7? 4 Let v = 19 - 11. What is the remainder when 13 is divided by v? 5 Let j = 95 - 60. Calculate the remainder when 139 is divided by j. 34 Suppose g = -8 + 20. What is the remainder when -1 - (-4 + -411) is divided by g? 11 Let m = -6 - -27. What is the remainder when 81 is divided by m? 18 What is the remainder when 348/15 - 4/20 is divided by 12? 11 Suppose -f = -30 + 16. Calculate the remainder when 41 is divided by f. 13 Let q(v) = v3 + 4v*2 - 5v + 6. Calculate the remainder when 16 is divided by q(-5). 4 Suppose -s + 4j = 8, 3j + 2 = -3s + 4j. Suppose s = 3f + g - 9, 0 = -f + 2g - 2 + 5. Calculate the remainder when 23/(0 - f/(-6)) is divided by 16. 14 Let u = 5 + 21. What is the remainder when 64 is divided by u? 12 Suppose -l + 2 + 1 = 0. Let u = -13 - -20. What is the remainder when u is divided by l? 1 Suppose 3g - 91 = 3b - g, -163 = 5b - g. Let q = b + 55. What is the remainder when 86 is divided by q? 20 Suppose -4m + 2a + 22 = -0m, 0 = -m + 4a + 23. Let j be ((-6)/8)/(2/24). Let b = j - -14. Calculate the remainder when b is divided by m. 2 Let i(w) = -w + 14. Let g = -3 - -14. Calculate the remainder when g is divided by i(10). 3 Let j(d) = d2 - 22d - 1. What is the remainder when 46 is divided by j(23)? 2 Let t = -73 - -107. Suppose -2q - 72 = -6q. What is the remainder when t is divided by q? 16 Suppose 4 = 3r - 44. Suppose 4 = -y + 5f, -r = 2y - 4y - 2f. Calculate the remainder when 9 is divided by y. 3 Suppose -2j + 4j - 36 = 4o, 77 = 5j + 3o. Suppose 0p - 5p = -45. Calculate the remainder when j is divided by p. 7 Let k(p) = -p*3 + 8p*2 - 10p + 7. What is the remainder when 73 is divided by k(6)? 16 Let d = -64 - -134. Calculate the remainder when d is divided by 18. 16 Suppose 0 = 14r - 3140 - 52. Calculate the remainder when r is divided by 29. 25 Let f be 10/35 + 69/(-21). What is the remainder when (-3 + f)(-3)/2 is divided by 4? 1 Suppose -3i - 2i = 435. Let s = i - -129. Suppose s = 3p + 15. Calculate the remainder when 25 is divided by p. 7 Suppose 2k = -k + 186. Let f be 2 + -41/(-2). Suppose 0 = -c + fc - 63. Calculate the remainder when k is divided by c. 20 Let m(q) = -q + 4. Let j be m(0). Suppose -jd + 108 = -d. Let p = 63 - d. What is the remainder when p is divided by 14? 13 Let k = -2 - -9. Suppose 2z + 67 = 7z + t, 2z - 34 = -4t. Calculate the remainder when z is divided by k. 6 Suppose -4i = -42 - 58. What is the remainder when i is divided by 13? 12 Suppose 0w + w - 4 = 0. Suppose -4n = -5t + 347, -5t - wn = 13 - 336. Suppose -m = -t + 12. What is the remainder when m is divided by 19? 17 Let i(g) = g + 5 + 5g - g*2 + 4g - g. Suppose -3j + m = -0j - 72, 0 = -4j + 4m + 96. What is the remainder when j is divided by i(8)? 11 Let z = 0 - 3. Let b be -1 - (-1)/((-1)/z). Suppose d - 6 = bd + 5k, 0 = -5d - 5k + 50. What is the remainder when d is divided by 5? 4 Suppose -3n = 2h + 148 - 4, -4n + 8 = 0. Let w = h - -140. Suppose -5x = 3z - 2z - w, 0 = 2z + 4x - 100. What is the remainder when z is divided by 21? 19 Let r be 1/(-3 - (-58)/20). What is the remainder when 10 is divided by 25/r(-8)/5? 2 Let x(n) = n3 - 8n*2 + n + 5. Calculate the remainder when 36 is divided by x(8). 10 Let j = 40 - -8. What is the remainder when j is divided by 13? 9 Suppose -5x - 9 = -3c, -2x + 4c - 14 = -2. Calculate the remainder when 20 + 0 + (-6)/(-3) is divided by x/11 - -8. 6 Let g be 2/4 + (-35)/(-10). Suppose 20 = 2c + g. Calculate the remainder when 21 is divided by c. 5 Let q(o) = -o + 1. Let z be q(0). Let f be (-3 - (-1)/z)-13. Suppose -l = -3l + f. What is the remainder when 37 is divided by l? 11 Suppose 5y - 4 + 5 = -4o, -9 = -4o - 3y. Let m(w) = 2w*2 - 2w + 4. What is the remainder when m(o) is divided by 22? 20 Suppose 2p + 2p - 4j = 24, -3p + 5j + 16 = 0. Calculate the remainder when 26 is divided by p. 5 Let y be (7 - 2) + 2/2. Let o be (-2 - -1) + y/2. Suppose -5f + 20 = 0, -f = -o*u - 10 + 30. What is the remainder when 21 is divided by u? 9 Let	{ "pile_set_name": "DM Mathematics" }
*2)(-3 + 3 + 2i2) - 3i*4 + 2i*4 - 6i*4. 8i*4 Expand (-11r*2 + 2r*2 - 8r*2)(-3r - 4r + r)(1 + 0 + 3). 408r*3 Expand (27n - 54n + 29n)(0 - 3 + 0). -6n Expand (-66 - 113 + 74)(-3 + 3 - 2y). 210y Expand (2n*2 + 8 - 8)(0 + 1 - 4) + 2n2 - n2 + 6n2. n2 Expand (183 - 183 + 18n3)(4n + 0n - 6n) - 6n*4 - 23n + 23n. -42n*4 Expand (366t - 345t + 1 - 1)(4t - t + 0t). 63t2 Expand (2a3 - a3 - 6a3)(2 - 7 + 1) + 0a3 + 0a3 + a3 + (0a + 2a - a)(a2 + 0a*2 - 3a*2). 19a3 Expand -n5 - 3n5 + 2n*5 + 18n*4 + 0n*5 + 2n*5 - 3n*5 + (3 - 4 - 1)(3n5 - 3n5 + n5) + n*5 - 3 + 3. -4n*5 + 18n*4 Expand -39z - 2z3 + 25729 - 3z4 - 25729 - z4 - 4z4 + 4z*4 + (2z*4 + 0z*4 + 0z*4)(0 + 1 - 3) - z3 + z3 + 2z4 - 3z + z*4 + 3z. -5z4 - 2z*3 - 39z Expand (123 - 153 - 896 - 1016)(2f*2 - 2f2 - f2). 1942f2 Expand (d3 - 2d*3 + 2d*3)(4d + 0d - 3d + (2 - 2 + d)(4 - 3 + 1) - d + 5d - 2d - 1 - 3d + 1 - 6d + 3d - 14d). -15d4 Expand 1 - 1 - s3 - 2s*3 - 2 + 2 + (-53s - 15s + 226s)(-s2 - 2s*2 + 2s*2). -161s*3 Expand (-2i - 20 - 18 + 39 + 15i2)(4 + 6 - 4). 90i2 - 12i + 6 Expand (2i - 2i - i*2)(-3 - 4 + 2 - 3 - 5 + 4 - 3 + 6 - 1 + (1 + 2 - 1)(3 - 3 + 2) + 4 - 1 - 2). 2i*2 Expand 13h*2 - 4h2 + h2 + (-4h2 + 3h*2 + 3h*2)(-1 + 2 + 1) - 3h2 + 0h2 + h2 + (h*2 - 2h2 - h2)(0 + 1 - 2). 14h2 Expand (0 + 1 + j - j2 + 2)(29 - 19 + 28)(-2j + 4j + 0j). -76j*3 + 76j*2 + 228j Expand i*3 - 2i3 - i3 + (3i - 30i + 11i)(-i + 7i + 3i*2 - 3i). -50i3 - 48i*2 Expand ((3 - 5 + 3)(-5 - g + 5) + 2g - 3 + 3)(4 - 57g + 3 - 6). -57g2 + g Expand (z3 - 4z3 + 5z*3)(-2z - 4 + 4) + 19z*4 + 13z*4 - 9z*4. 19z*4 Expand (-13 + 1 - 23)(-4 + 4 + 3z3). -105z*3 Expand -38b3 + b4 - 184b3 - 13b*3 + (b + 3b - 6b)(0b2 + b3 + 0b2). -b4 - 235b3 Expand (3k*2 + 4k*2 - 5k*2 + 3)(-3 + 0 - 3)(-3k + 3k - k2)(4k + 5k - 6k). 36k*5 + 54k*3 Expand ((1 - 3 + 0)(3 - 5 + 3) + 154 + 131 - 69)(2 - 2 + b2). 214b*2 Expand -1 + 1 - 2k*2 + (-3 + 4 + 0)(-5k2 + 0k*2 + 3k2) + k2 + 0k2 - 2k*2 - 7k*2 + 2k - 2k + 18 - k2 - 18. -13k*2 Expand (0u - u + 2u)(87u + 3u*3 - 87u) + 0 + 0 + 3u4 + (1 + 2u - 1)(-2u*3 + 0u*3 + 4u*3). 10u*4 Expand (4 - 4 - 5)(-5q + 4q + 2q) + 4 - 4 + q + 0q - 2q - q + (3 + q - 3)(-4 + 1 + 2). -8q Expand 0v - 2v + 0v + 133v - 132v - 166v + (-1 + 2 + 0)(2v + 3v - 6v) - v + 3v - 4v. -170v Expand 2f4 + 1 - 1 + (3f - 2 + 2)(f3 - 2f*3 + 2f*3) + (-f - f + 0f)(2f + 2f3 - 2f) + 0f3 + 0f*3 + 9f4 - f4 + 2f4 - 2f*4. 9f*4 Expand (-5t - 8t + t)(-1 - 1 + 0)(-12 + 0 - 10). -528t Expand (2w + 0w - 4w + (w - 3w + w)(-3 - 2 + 7))(w + 10 - 10)(5w*3 + 2w*3 - 5w*3). -8w*5 Expand -2i - i + i + (-4 - 24 + 1)(5i - 2i + 0i). -83i Expand (-10 - 10l*2 + 10)(0l2 - 5l*2 + 2l*2) - 4l*4 + 3l*4 - 5l*4 + (-l - l + 0l)(-2 + l3 + 2) - 3l*4 - 4l*2 + 4l*2. 19l*4 Expand (-14x - 6x + 3x)(0 + 1 - 3)(0x3 + 0x*3 + 3x*3). 102x*4 Expand (-20w*3 - 45w*3 - 15w*3)(0w2 + 2w*2 - 4w*2) + (0w*2 + 0w*2 + 3w*2)(4w3 + 3w*3 - 5w*3). 166w*5 Expand (-18 + 28 + 11)(-11 - f*2 + 8 - 14). -21f*2 - 357 Expand (-6 + 6n*3 - 2n*3 - 1)(3n - 4n + 4n). 12n*4 - 21n Expand (2 - 2 + 4d2)(4 + 0 - 2) + (5 - 4 - 3)(-1 + 2d*2 + 1). 4d*2 Expand (9i - 9i - 5i*2)(-67 - 2 - 6). 375i2 Expand (-2r*2 + 2r*2 + 7r*3)(r + 3r - 3r) - 9r4 + r4 + 5r*4. 4r*4 Expand (-3b4 - b4 + 5b4)((-6 + 3 + 1)(0b + 2b + 0b) + b - 2b - b + 7b - 2b + 6b) + (5b4 - 5b*4 + 4b*4)(5b - 4b + b). 13b5 Expand -f3 + f4 - f3 + 2f*2 + 0f2 + f2 - f2 - f4 - 2f4 - 4f*4 + 4f*4 + (-4f + 2f + 3f)(-1 + 1 - 2f*3). -4f*4 - 2f*3 + 2f*2 Expand -4g*3 - 2g*3 + 4g*3 + 2g*3 - 2g*2 + 2g*2 + 3g*3 - 2g + 2g + (2g*2 + 0g + 0g)(-3g + 6g - g) - 5g3 + 2g*2 - 2g*2. 2g*3 Expand -3 + 3 - 2q*3 + (-4q*2 + 3q*2 + 3q*2)(-q - 3 + 3) - 3 - q*3 + 3 + 0q + q*3 + 0q - q*3 + 0q*3 - 6q*3. -11q*3 Expand (-313m + 338 - 678 + 338)(1 - 1 - 2). 626m + 4 Expand (-22f2 - 1 - 4f + 19f2 + 3f)(-f + 0f + 2f). -3f3 - f2 - f Expand ((0i + 5i - 6i)(-3i - i + 3i) - 5i2 + 3i*2 - 2i*2)(-3 + 4 + 4). -15i2 Expand (17253 - 2w*2 - 7w - 17253)(-w + 0w + 4w). -6w*3 - 21w2 Expand (-w4 - 2w5 + w4)(-2 + 1 - 1) + 5w5 - w5 - 2w*5 - 109885w*2 - w + 109885w*2 - 16w*5 + (4w*4 - 2w*4 - 3w*4)(2w - w - 3w). -8w5 - w Expand ((l - 1 + 1)(-l - 2l + 0l) + 3 + l*2 - 3)(7 + 2 - 6)(0 - 2 - 1). 18l*2 Expand (2x - 2x - x)(0x3 + x3 + 2x*3) + 86x*4 - 2x*4 + 19x*4. 100x*4 Expand (-2b - b + b + 3b - 3b - 2b + (2b - 1 + 1)(-2 + 0 + 1) - 2b + b + 4b)((1 + 4 - 7)(-5 - 1 + 4) + 1 + 1 + 0 - 11 - 15 + 2). 54b Expand (-80 + 72 - 32q - 22q)(q - 5 + 5). -54q*2 - 8q Expand (-2x2 + 17x + 0x2 + 4x)(x3 - 24x + 24x + 2x*2). -2x*5 + 17x*4 + 42x*3 Expand 2z4 + z4 - z*4 + (-135z*4 + 155z*4 + 3z - 2z)(5 - 4 + 5). 122z4 + 6z Expand -2t2 + 7t*2 + 3t*2 + (-3 - 3 - 2)(-7t2 - 12t*2 - 7t*2). 216t*2 Expand -2m*5 + 2m*4 - 2m*4 + (0 - 7m*4 - 2 + 0)(-m + 2m + 3m). -30m5 - 8m Expand (-2 + 2t + 2)(-38t - 34t + 21t). -102t*2 Expand (-3 + 0 + 5)(0b + 3b*2 - b - 2b*3 + 15b*2). -4b*3 + 36b*2 - 2b Expand -5f3 + 0f*2 + 0f*2 + 10f + 62f3 - 123f*3 + 63f*3 - 2 + (3f*2 - 5f*2 + 0f*2)(-3f - 2f + 3f). f3 + 10f - 2 Expand 5f + 26f - 117f2 + 121f*2 + (-2f + 4f - 4f)(1 - f - 1) - f2 - f2 + 4f*2 + 2f*2 - 6f*2 + 3f*2. 7f*2 + 31f Expand (-2 + 9 - 4)(-10x*2 + 10x*2 - 3x*5). -9x*5 Expand (0f - 3f - f)(-3f + 31 - 31) + (-3 - 3f + 3)(3f + 6f - 3f). -6f2 Expand (-4k - k + 3k)(213k2 - 113k*2 - 104k*2). 8k3 Expand i5 + 0i5 + 0i*5 + (4i*4 - 4i4 + i4)(2i - i + 0i). 2i*5 Expand (-4b - 2b2 + 4b)(-8b*2 - 110b + 108b - 22b*2). 60b*4 + 4b*3 Expand (-2t + 2t - 2t*2)(3 + 0 - 1) + (2t2 + 0t*2 + 0t*2)(21 + 1 + 5). 50t2 Expand -4d + d + 2d - 2d - 2d + 6d + (-2d - d + d)(0 - 3 + 5) + 0d + 0d + 2d - 3d + 5d + 0d. d Expand (3 + 1 - 3)(-72a*4 + 72a*4 + 3a*5) + 4a5 - a5 - 2a5. 4a*5 Expand -16d*4 + 4d*5 + 16d*4 + (-7d*3 + 5d*3 + 8d*3)(3d2 + 2d*2 - 2d*2). 22d*5 Expand 1 - 2v - 1 + (-11v + 5v + 10v)(-2 + 1 + 0) + 4 - 2 + 8v - 4v. -2v + 2 Expand (3 - 2 - 2)(s3 - s3 + 2s5) - 2s5 - s4 + s4 + (-s4 + 2s4 + s4)(0 - 4 - 2 - s) - 2s2 - 2s*5 + 2s*2. -8s*5 - 12s*4 Expand (3 - 2 + 39k - 16k)(15k3 + 0k*3 - 5k*3 + (2k + k - k)(-k2 + 2k2 + k2)). 322k4 + 14k*3 Expand (-2p + 2p + p)(0 + 4 - 3) + (51 - 51 + 10p)(1 + 1 - 1) - 8 + 8 + p. 12p Expand 0t - t + 2t + t - 3t + 4t + (-2 - t + 2)(1 - 1 + 1) + 17 + 22t - 17 + (0t - 2t + 4t)(0 - 1 + 2). 26t Expand p + 3p - 2p + (-122 + 229 + 214)((-1 - 3 + 2)(4p - p - p) - 1 + 1 + p). -961p Expand (-11 + w*3 - 4w*3 - 18w*3)(0w + 2w - w). -21w4 - 11w Expand (0m + 2m + 0m)(1 - 2 + 2)(2 + 0 - 4)(-3m2 - 6m*2 - 4m*2). 52m*3 Expand 2797o*4 + 2o*2 - 4o*2 - 2798o*4 - 43 + (-5 + o + 5)(0o3 - 3o*3 + 2o*3) - 3o + 3o - o4. -3o*4 - 2o*2 - 43 Expand (-15a + 4a - 7a - 1)(6 - 6 + 21a*2). -378a*3 - 21a*2 Expand (-3 - 3 + 5)(3 + b - 3) + 0 + 0 - b - 7 + 7 + 21b + 5b - 2b - b + 2. 21b + 2 Expand (-43y + 43y + 7y2)((3 + 4 - 1)(5 + 0 - 4) + 1 + 1 - 4 + 2 - 6 + 3 + 0 - 1 + 2) - 3y*2 + 4y*2 - 2y*2 - 4y*2 + 2y*2 + 3y*2. 28y*2 Expand (-30 - 2v - 210 + 33)(3 + v - 3). -2v*2 - 207v Expand (-15p - p - 5p)(-1 - 1 + 4)(0 - 2 - 7)(2p*4 + 0p*4 - 3p*4) + 3p4 + p5 - 3p4. -377p*5 Expand (6 + 1 + 9)(-3l + 3l + 2l*	{ "pile_set_name": "DM Mathematics" }
. List the prime factors of p. 2, 3, 359 Let r(p) = 24p2 - 2p + 1. Let w be r(1). Suppose -5l + w = -2. What are the prime factors of l? 5 Let f = 7 + -7. Suppose -7q + 3q + 28 = f. What are the prime factors of q? 7 Let l(f) = f2 + 10f + 5. Let z be l(-10). Suppose -zg + 10g = 535. What are the prime factors of g? 107 Suppose 4x = -4u + 68, 6u - 32 = -x + 2u. List the prime factors of x. 2, 3 Let s be 3 + -48(6 + -3) - -1. Let l = 236 + s. What are the prime factors of l? 2, 3 Let g(t) = -9 + 24t - t*2 + 18t - t. What are the prime factors of g(32)? 3, 31 Let r(i) = i + 17. Let b = 7 - 1. Let s be b/18(0 - 0). What are the prime factors of r(s)? 17 Let v(w) = 4w*2 + 4w - 3. Let n(m) = m - 11. Suppose 5g - 65 = 5r, -3r = -g + 14 - 1. Let b be n(g). What are the prime factors of v(b)? 3, 7 Suppose -109q + 114q + 20 = 0, -12068 = -3h + 5q. List the prime factors of h. 2, 251 What are the prime factors of 754/1211 - -3? 2, 139 Suppose -704 = -9w + 808. Suppose w = 6j - 2j. List the prime factors of j. 2, 3, 7 Let h = 4 + -2. What are the prime factors of (h - -2) + -1 + 69? 2, 3 Suppose n + 14 = 5u - 0, -3n = -5u + 12. Suppose -uc = 2c + 185. Let d = c - -53. List the prime factors of d. 2 Suppose -10 = b - 6b. Suppose 0h - bh = 3g, -4g - 14 = -2h. Suppose -2f = hf - 135. What are the prime factors of f? 3 Suppose -2n + 15 = -89. Let u = n + -12. What are the prime factors of u? 2, 5 Suppose o - 75 = -4f + 4o, 5f - 4o = 95. Let w = 16 - f. What are the prime factors of (0 - w)-58 - 0? 2, 29 Suppose 19v - 1275 = 14v. What are the prime factors of v? 3, 5, 17 Suppose 14j = 14154 + 8708. What are the prime factors of j? 23, 71 Let c(o) be the first derivative of -22o2 - 18o + 29. What are the prime factors of c(-2)? 2, 5, 7 Let r be 6((-28)/(-8) + -3). Suppose -325 = -4v - ro, -4o + 235 = 4v - v. Suppose 4l = p - 0l - 17, -5p + v = -4l. List the prime factors of p. 17 Let o = -85 - -158. Suppose 4p = 155 + o. List the prime factors of p. 3, 19 Let v be (134)/(4/(7 + 1)). Suppose 2g + 2q - v = -q, 222 = 5g - 2q. List the prime factors of g. 2, 23 Let k = -1081 - -1916. List the prime factors of k. 5, 167 Let n(g) = -g - 11. Let y be n(13). Let f be ((-54)/y)/(6/16). List the prime factors of 2/(-1 - (-7)/f). 2, 3 Let m(h) = 19h*2 - 25h + 15. List the prime factors of m(-5). 3, 5, 41 Suppose -44p + 2679 = -25p. List the prime factors of p. 3, 47 Let z(p) = 7p3 + 3p*2 + 10p + 18. List the prime factors of z(6). 2, 3, 283 Let a(c) = c3 - c2 - 2c + 3. Let y be a(2). Let n be 4 + 4 - 20/5. Suppose -nw + 24 = -yw. What are the prime factors of w? 2, 3 Let o = 3397 + -1988. List the prime factors of o. 1409 Let q(y) = 24y + 72. List the prime factors of q(16). 2, 3, 19 Let k(b) = b*3 - b + 1. Let c be k(0). Let t be c + 2 - (-7)/7. Suppose 0s = -2s + 4f + 60, 4f + 128 = ts. What are the prime factors of s? 2, 17 Let d = 42 - 49. What are the prime factors of 208 + (-24)/d + (-16)/(-28)? 2, 53 Let u(w) = -4w2 + 15w - 12. Let d(k) = 1. Let b(f) = -3d(f) - u(f). List the prime factors of b(6). 3, 7 Let n(u) = -9u. Let w be n(-1). Let d(q) = -q + 20. What are the prime factors of d(w)? 11 Let q be (0 - 30)4/10. Let w = -15 - -6. Let x = w - q. List the prime factors of x. 3 Suppose -6 = -4v + 6. Suppose -vi = -195 - 87. What are the prime factors of i? 2, 47 Let q(r) be the first derivative of -9 + 0r + 3r2 - 1/3r*3. List the prime factors of q(5). 5 Let o = -9 + 8. What are the prime factors of 6 + 49 - (o + 0)? 2, 7 Suppose 2f = -4, 0f + 2f = -3o + 284. Suppose 93 = 4b - j, -4b + o = -2j - 2. What are the prime factors of b? 2, 11 Let m(v) = 845v3 - 4v*2 + 5v - 2. List the prime factors of m(1). 2, 211 Suppose 3a = 6a. Let m be (a - -2)/((-2)/(-4)). List the prime factors of (22/8)/(m/16). 11 Let b(p) = p + 12. Let c be b(-10). Suppose 6z = cz + 292. Let d = z + -45. What are the prime factors of d? 2, 7 Let c(d) = -d*2 - 23d - 15. Suppose 20 = -2x + 4l, 4x - 2l = -47 - 23. What are the prime factors of c(x)? 3, 5 Let b(w) = -5w3 + 6w*2 - 23w - 1. Let c(r) = -2r3 - r - 4r + 2r2 - 3r. Let i(d) = -4b(d) + 11c(d). What are the prime factors of i(-3)? 2, 7 Let j = 26 + -33. Let y = j - -59. List the prime factors of y. 2, 13 Suppose -3g - 7 = 20. Let d = g + 13. Suppose -4h = 4r - 83 - 41, -dh + 120 = 5r. What are the prime factors of h? 5, 7 What are the prime factors of 4944 - ((-15)/((-75)/(-10)) + 3)? 4943 Suppose -5r = -9r - 120. Let l = -24 - r. What are the prime factors of l? 2, 3 Suppose -h = -4f - 847, -h - 5f = -6h + 4235. List the prime factors of h. 7, 11 Suppose -5 = -4v + 3. Suppose 4d - 50 = vd. Suppose -5 = -5l + d. What are the prime factors of l? 2, 3 Let k(m) = 2m - 15. Let j be k(10). Suppose s - 41 + 6 = -2a, j = s. What are the prime factors of a? 3, 5 Let m be 8/(-12)3/2. Let y be (m/1)/((-2)/6). List the prime factors of (-90)/(-12)4/y. 2, 5 Let h = 4193 - 2467. List the prime factors of h. 2, 863 Let p(w) = 13w2 - 8w - 14. List the prime factors of p(-4). 2, 113 Let f be -1 + 2 - -141. Suppose 43g - fg - 29 = 0. What are the prime factors of g? 29 Suppose -6p + 2p + 60 = 3a, -p - 4a + 15 = 0. Suppose -po = -16o + 3. Suppose -3n - 2n + ot = -67, 0 = -3n + 2t + 41. List the prime factors of n. 11 Let b be (-1)/2 - 10/(-4). Suppose -4l + l - 107 = -a, 3a = bl + 307. What are the prime factors of a? 101 Let t(f) = f3 + 27f*2 - 106f + 71. List the prime factors of t(-25). 11, 19 Let f = 992 + 450. List the prime factors of f. 2, 7, 103 Let s = -88 - -61. Let a be (-21)/s + (-2)/(-9). What are the prime factors of (-2 + a)-2 + 5? 7 Suppose 14i + 57376 = 58i. What are the prime factors of i? 2, 163 Suppose -3g + z = 2z + 12, 2g + z + 9 = 0. Let f(t) = 4t2 - 3t*2 + t - 4t - 3 + 0t. List the prime factors of f(g). 3, 5 Suppose -2p - 60 + 84 = 0. Suppose 0 = pw - 16w + 148. What are the prime factors of w? 37 Let t(l) = 484l2 - 4l - 2. What are the prime factors of t(1)? 2, 239 Let q(h) = 38h + 178. List the prime factors of q(6). 2, 7, 29 Let k(q) = q3 - q2 + q + 85. Let u be k(0). Let i = u - 40. What are the prime factors of i? 3, 5 Suppose -7r + 224 = -875. Suppose -3z - j = -3j - r, 2j + 108 = 2z. Suppose 2b - 5c = z, -b = -2b - 2c + 20. What are the prime factors of b? 2, 11 Suppose -5w = -7w + 1856. What are the prime factors of w? 2, 29 Suppose 0s - 20 = 5s. Let t(y) = -3y - 4. Let b be t(s). Suppose -b = -3a - a. List the prime factors of a. 2 Let b(a) = 3a2 + 7a - 10. List the prime factors of b(13). 2, 3, 7 Let t(l) = -l + 5. Let r be t(6). Let n be (1 - -3 - 1)/r. Let g = 27 + n. List the prime factors of g. 2, 3 Let j(t) = -131t - 20. What are the prime factors of j(-4)? 2, 3, 7 Suppose 0 = -26o + 19542 + 1102. What are the prime factors of o? 2, 397 Let i(j) = -j*3 - 6j*2 + 9j + 16. Let x be i(-7). Suppose 0 = 3q + xq + 3h - 72, 3q + 2h - 44 = 0. List the prime factors of q. 2, 3 Let f be 4264/143 - (0 + 4/(-22)). Suppose -140 + f = -z. What are the prime factors of z? 2, 5, 11 What are the prime factors of (69251/21)/13 - (-1)/3? 2, 127 Let l = 92 - 65. Suppose 4g + l = 99. Suppose 3b + 0b = 2t + g, 5b + t = 30. List the prime factors of b. 2, 3 Let r be 15/(-9) + (-80)/(-12). Let q = -13 - -18. Suppose qk + rv = 85, 2v + 16 = 6v. What are the prime factors of k? 13 Suppose 3g - 5s - 27 = 0, -3g + 21 = 2s - 5s. Let u be ((-4)/(-5))/(2/10). Suppose -gr + 4i = -24, 6r - 2r = -ui + 24. List the prime factors of r. 2, 3 Let b(v) = 3v + 4. Let h be b(-3). Let l be -3((-10)/(-3))/h. Let z(x) = 16x - 8. What are the prime factors of z(l)? 2, 3 Suppose 0 = 5r - 27 + 107. Let f(x) = -7x2 - 31x - 5. Let t(u) = -4u2 - 15u - 2. Let p(y) = 3f(y) - 5t(y). What are the prime factors of p(r)? 3 Let y be 4-1 - (-24)/8. Let t be y/(3/(422 + 1)). Let v = -85 - t. List the prime factors of v. 2, 7 Let a = -6 - -31. Let y = a - 0. List the prime factors of y. 5 Suppose 4o - 5n - 959 = -34, 2o - 5n = 455. Suppose -c + 93 = m, -m - 45 = 2c - o. List the prime fa	{ "pile_set_name": "DM Mathematics" }
-s*2 - 2171452s - 1178800947076 = 0. Calculate s. -1085726 Let 2k3 + 732k*2 + 7152k + 11392 = 0. Calculate k. -356, -8, -2 What is p in -p*3/8 - 117p*2/4 - 689p/8 + 231/2 = 0? -231, -4, 1 Factor 2y2 - 28y - 64. 2(y - 16)(y + 2) Let o*2/3 + 371o - 29700 = 0. Calculate o. -1188, 75 Factor -x*2 + 42352x - 84700. -(x - 42350)(x - 2) Factor -2h*2/13 + 196960h/13 + 393928/13. -2(h - 98482)(h + 2)/13 Find t such that -2t4 - 162t*3 - 2218t*2 + 36138t - 83916 = 0. -54, -37, 3, 7 Solve -2a3/3 + 399412a*2/9 - 6647214208a/9 + 4431298624/9 = 0. 2/3, 33284 Solve -2q5/11 - 30q*4/11 - 14q*3/11 + 66q*2 - 1280q/11 + 600/11 = 0 for q. -10, 1, 3 Factor -q*3/2 - 129q*2 - 1240q. -q(q + 10)(q + 248)/2 Determine r so that -3r4 + 312r*3 - 8307r*2 + 35802r - 40824 = 0. 2, 3, 36, 63 Determine b, given that -b*5 + 3882b*4 + 7771b*3 - 11648b*2 - 15540b + 15536 = 0. -2, 1, 3884 Factor -m*2 + 902m + 1808. -(m - 904)(m + 2) Factor 5o*2 - 252540o + 3188822580. 5(o - 25254)2 Determine w, given that w4/4 - 188685w*3/2 + 35601651853w*2/4 + 17801108955w + 8900601649 = 0. -1, 188686 Factor 2m2 + 69678m + 209016. 2(m + 3)(m + 34836) Factor 2x2/15 + 344x/15 + 14504/15. 2(x + 74)(x + 98)/15 Suppose -2d4/7 - 4506d*3 - 124377990d*2/7 - 124346450d/7 = 0. What is d? -7885, -1, 0 What is h in -4h3 + 1080h*2 - 12528h - 9446112 = 0? -78, 174 Solve n*5/2 + 88n*4 + 1467n*3/2 - 3006n2 = 0 for n. -167, -12, 0, 3 Let n3 - 307n2 + 306n = 0. What is n? 0, 1, 306 Let -32m4/7 - 254544m*3 - 24804771858m*2/7 - 5314878720m - 13951180800/7 = 0. Calculate m. -27840, -3/4 Solve -3j5/2 + 54j*4 + 465j*3 - 570j*2 - 927j/2 + 516 = 0 for j. -8, -1, 1, 43 Suppose 3c5 - 339c*4 + 10389c*3 - 104973c*2 + 180120c - 85200 = 0. What is c? 1, 20, 71 Factor 5i4 - 750i*3 + 31920i*2 - 31360i - 15805440. 5(i - 56)3(i + 18) Factor -4205f3/6 - 1704910f*2/3 - 345626410f/3. -5f(29f + 11758)2/6 Determine m, given that -4m*2/3 + 3103648m/3 - 602039431744/3 = 0. 387956 Factor h*2/3 - 66140h + 3280874700. (h - 99210)*2/3 Determine x so that 4x*5 - 10396x*4 + 31128x*3 + 62336x*2 - 83072x = 0. -2, 0, 1, 4, 2596 Determine q, given that -3q3/2 - 236493q*2/2 - 354726q = 0. -78828, -3, 0 Solve -x*5/3 - 50161x*4/3 - 209702237x*3 - 1886668091x*2/3 + 2515824964x/3 = 0. -25079, -4, 0, 1 Factor 4u3 + 332u*2 - 2116u + 1780. 4(u - 5)(u - 1)(u + 89) Let -16900m*4 + 153140m*3 + 869424m*2 - 53936m + 832 = 0. What is m? -4, 2/65, 13 Factor -q*3 - 1845q*2 - 29328q - 117056. -(q + 8)*2(q + 1829) What is m in 2m4/11 + 3072m*3/11 + 980928m*2/11 - 152616960m/11 + 4936204800/11 = 0? -828, 60 Let 2r5/9 + 38r*4/3 + 1372r*3/9 - 6848r*2/3 - 41216r = 0. Calculate r. -24, -23, 0, 14 Determine z so that -z*3 + 116912z*2 - 233821z + 116910 = 0. 1, 116910 What is l in 2l2 - 158128l + 3125558048 = 0? 39532 Factor 2b2/5 - 11960b + 89401000. 2(b - 14950)2/5 Find r such that 298909521r*2/2 + 86445r + 25/2 = 0. -5/17289 Factor 3z4/8 - 9609z*3 + 328384323z*2/4 - 234055612410z + 13074958991199/8. 3(z - 8539)3(z - 7)/8 Factor 4s3 + 832s*2 - 1676s + 840. 4(s - 1)2(s + 210) Suppose 2n2 + 21776n + 59274272 = 0. What is n? -5444 What is g in 3g5 + 83655g*4 + 583221741g*3 + 583054437g*2 - 583221744g - 583138092 = 0? -13942, -1, 1 Let -4u4 - 10416u*3 + 135908u*2 - 460464u + 334976 = 0. What is u? -2617, 1, 4, 8 Let 135v3 + 280v*2 + 20v = 0. What is v? -2, -2/27, 0 Let i*5/2 + 605i*4/2 + 45294i*3 - 139840i*2 - 184832i = 0. Calculate i. -304, -1, 0, 4 Determine l, given that -4l3/5 - 1136l*2/5 + 27228l - 27000 = 0. -375, 1, 90 Find w, given that -4w3/3 + 688w*2/3 + 14684w/3 - 10696 = 0. -21, 2, 191 Find p, given that 35p4 - 1665p*3 + 26525p*2 - 146115p + 75140 = 0. 4/7, 13, 17 Factor 2v3 - 580v*2 + 1726v - 1148. 2(v - 287)(v - 2)(v - 1) Factor -2u*3 + 204u*2 + 1958u + 4440. -2(u - 111)(u + 4)(u + 5) Determine z so that 3z*3 + 84z*2 - 35148z + 69936 = 0. -124, 2, 94 Factor -2p3 - 11544p*2 + 11546p. -2p(p - 1)(p + 5773) Find o, given that -2o*4/9 - 8150o*3/9 - 2766244o*2/3 + 8323192o/9 + 16613776/9 = 0. -2038, -1, 2 Factor 240l2 + 19160l + 4775. 5(4l + 1)(12l + 955) Let -n*2 - 50900n + 101804 = 0. Calculate n. -50902, 2 Factor 5a2 + 741120a + 27462942720. 5(a + 74112)2 Factor -4z*3 + 128z*2 - 1164z + 2448. -4(z - 17)(z - 12)(z - 3) Solve 50g*5 - 1882260g*4 + 17713760618g*3 + 14171911992g*2 + 2834442632g = 0 for g. -2/5, 0, 18823 Let l*5 + 10905l*4 + 29724302l*3 - 29746114l*2 - 29724303l + 29735209 = 0. What is l? -5453, -1, 1 Let -5g2 + 25g + 180 = 0. What is g? -4, 9 Let -h*5/4 - 41h*4/4 - 221h*3/4 + 569h*2/4 - 153h/2 = 0. What is h? -34, -9, 0, 1 Factor -2y4 + 36520y*3 - 166713800y*2. -2y*2(y - 9130)2 Factor u2/6 - 6292u/3 - 4195/2. (u - 12585)(u + 1)/6 Factor -v*4/4 + 219v*3/4 + 221v2/2. -v2(v - 221)(v + 2)/4 What is j in 5j5 - 10050j*4 - 234605j*3 + 1648430j*2 - 3457260j + 2358280 = 0? -29, 2, 2033 Let 4h3 + 3864h*2 + 23072h + 30720 = 0. Calculate h. -960, -4, -2 Solve 2b5/9 - 4b*4/9 - 14b*3/3 + 44b*2/9 + 80b/9 = 0 for b. -4, -1, 0, 2, 5 Factor q*4 - 1996q*3 + 973685q*2 + 22397782q. q(q - 1009)2(q + 22) What is o in 3o5 + 57o*4 - 330o*3 - 1302o*2 - 1401o - 483 = 0? -23, -1, 7 What is q in 2q2 - 41864q + 219074312 = 0? 10466 Factor -27f4/4 + 65367f*3/4 - 65349f*2/4 + 21781f/4 - 605. -(f - 2420)(3f - 1)*3/4 What is o in -2o*2 + 16200o - 16198 = 0? 1, 8099 Factor -13z2 + 2297z - 3850. -(z - 175)(13z - 22) Factor 1764g3 - 4025784g*2 + 766768g - 36512. 4(g - 2282)(21g - 2)2 Solve 5a*3 + 3230a*2 - 20a - 12920 = 0. -646, -2, 2 Factor -2i4 - 164i*3 - 2666i*2 + 2832i. -2i(i - 1)(i + 24)(i + 59) Let -1805q3 - 6271235q*2 + 3961320q - 625500 = 0. What is q? -3475, 6/19 Suppose w*4 - 59w*3 + 329w*2 - 589w + 318 = 0. What is w? 1, 2, 3, 53 Factor 3n2 - 4197n + 25074. 3(n - 1393)(n - 6) Factor t*2/9 - 12799t/9. t(t - 12799)/9 Solve -3y*2/5 + 723y/5 + 3990 = 0. -25, 266 What is z in 5z5/4 + 4933z*4/4 + 611553z*3/2 + 785232z*2 - 363096z = 0? -492, -3, 0, 2/5 Suppose 4b4 + 30792b*3 - 246596b*2 - 30792b + 246592 = 0. What is b? -7706, -1, 1, 8 Find b such that -2b4 + 1020b*3 + 1074b*2 - 26620b + 24528 = 0. -6, 1, 4, 511 Factor -3a4 - 5391a*3 - 2419209a*2 + 2424603a. -3a(a - 1)(a + 899)2 Solve -5t*2 - 120t + 4085 = 0. -43, 19 Determine h, given that 4h3 + 84h*2 - 3616h - 3696 = 0. -42, -1, 22 Factor -f*2 + 4611f + 9226. -(f - 4613)(f + 2) Factor -2o*2/9 + 10054o/9 + 3352/3. -2(o - 5028)(o + 1)/9 Factor d*3/2 + 13873d*2/2 + 6936d. d(d + 1)(d + 13872)/2 Solve -98i2/17 - 1296i/17 - 1440/17 = 0 for i. -12, -60/49 Factor y*3/3 - 1145y*2/3 - 11534y/3 - 6160. (y - 1155)(y + 2)(y + 8)/3 Factor 2y2 + 5412y/5 - 4336/5. 2(y + 542)(5y - 4)/5 Solve 2h*3/3 - 2988h*2 + 3345064h + 20106256/3 = 0 for h. -2, 2242 What is z in 3z4/5 - 171z*3/5 + 3249z*2/5 - 20577z/5 = 0? 0, 19 Let 5q4/2 + 1420q*3 + 301480q*2 + 28354560q + 996802560 = 0. Calculate q. -156, -128 Solve -3h2 - 3933h + 128928 = 0 for h. -1343, 32 Determine t so that t*5 + 27t*4/5 - 229t*3 + 2753t*2/5 - 804t/5 - 836/5 = 0. -19, -2/5, 1, 2, 11 Suppose 2k3/7 - 216k*2/7 - 1350k/7 - 2052/7 = 0. Calculate k. -3, 114 Let -3q3 + 55104q*2 - 220380q + 220368 = 0. What is q? 2, 18364 Suppose -2a5 - 7856a*4 + 7888a*3 + 117852a*2 - 70830a - 424332 = 0. Calculate a. -3929, -3, -2, 3 Solve -162o5 - 5472o*4 - 12422o*3 + 50696o*2 + 104704o + 47616 = 0. -31, -4, -8/9, 3 Factor 2f3/7 + 204f*2/7 - 5090f/7 + 9348/7. 2(f - 19)(f - 2)(f + 123)/7 Find d, given that -5d*3 - 26715d*2 - 26700d + 53420 = 0. -5342, -2, 1 Suppose 867b3 - 534582b*2 - 756000b - 266976 = 0. Calculate b. -12/17, 618 Find z such that -4z4/3 - 2836z**3 + 2840	{ "pile_set_name": "DM Mathematics" }
8)/(-3306))? 29 Evaluate 6/(-8)(-566)/3396. 1/8 (-36)/45(-210)/1122 3 Calculate (1/9)/((-22)/(-231))(-261)/812. -3/8 Evaluate (((-55)/(-25))/((-2)/5))/((-41)/(-82)). -11 What is 1728/(-3024)(-6)/(-8)? -3/7 Evaluate (9/60)/((-1503)/1336). -2/15 Calculate 255/30616/(-400). -1/30 What is 119/1023/14? 1/4 (-20)/(-8)40/25 4 What is the value of (((-7)/3)/((-455)/390))/(2/12)? 12 What is the value of (-1)/(-3)51/9324/(-18)? -34 What is (-2)/((42/(-112))/((-9)/(-12)))? 4 What is the value of (72/(-210))/(2/20)(-1078)/1155? 16/5 What is the value of (-7)/(-4)1(-734)/(-2569)? 1/2 What is (4572/(-20955))/(4/(-10))? 6/11 What is the value of 15/4-5-49(-30)/2625? -21/2 What is the value of ((1000/(-30))/25)/((-11)/(-66))? -8 What is the value of 2/((-24)/54)(90/9)/210? -3/14 Evaluate ((-46)/(-46))/((-1)/7). -7 What is the value of (165/495(-9)/(-4))/((-105)/28)? -1/5 What is the value of (264/16)/33(-6)/45? -1/15 What is ((3/(-27))/((-2)/(-3)))/((-288)/21600)? 25/2 What is ((-720)/7776)/(5/4)? -2/27 Calculate (2/4)/((-59)/(-6608)-7). -8 Evaluate ((-6)/(42/(-1)))/((-24)/(-42)). 1/4 (-12)/14(-41)/((-9225)/(-420)) 8/5 What is the value of 45/(-12)67/((-2010)/(-72))? -9 What is the value of 2(5/(-25))/(6/(-195))? 13 ((-5)/((-45)/3)-15)/((-15)/3) 1 What is the value of ((-2)/(2/1))/((-3555)/(-2133))? -3/5 (17/(1309/(-22)))/(121/77) -2/11 Evaluate (142/(-3266))/(4/(-12)-3). -1/23 What is the value of (-939)/12528/90? -1/15 What is the value of (((-280)/(-30))/(-7))/(4/(-30))? 10 (52/(-1716))/(4/24) -2/11 Evaluate ((-8)/1362)/((-204)/867). 1/2 Evaluate (2175/30)/(-5)(-2)/(-3)-3. 29 What is -356/(-150)(-20)/1190? -2/85 Calculate (((-6)/(-140))/(266/(-931)))/(18/(-10)). 1/12 Evaluate -15(-8)/162/(-3). -5 What is the value of -2((-2625)/(-1250))/((-1)/5-3)? -7 Evaluate (-4)/((9/63)/(62/217)). -8 What is (8/903)/(17(-120)/(-1700))? 2/9 What is the value of ((-3456)/640)/((-9)/(-30))? -18 Evaluate 5/3203/58012. 7 What is the value of 56/(-6)738/861? -8 3(-2)/(-15)525/(-275) -2/11 What is the value of (140/25)/(6/15)? 14 Calculate 20/(-125)-57/(-28)-1. 1/5 What is (39(-18)/117)/(-6)? 1 What is ((-9)/156)/((-822)/(-8768))? -8/13 Evaluate ((-72)/(-39))/(-2)11/33. -4/13 What is the value of 210/(-12)(-276)/(-3910)? -2/17 Calculate (((-15)/12)/(-5))/((-62)/62). -1/4 Evaluate (-25)/(202/303). -15 Calculate -2(39/18)/(2/6). -13 ((-16)/44-6)/(117/117) 24/11 Evaluate 124/589570/20. 6 (((-16)/4)/(1/(1/(-6))))/(-5) -2/15 Calculate (-1)/((-14)/(-98)2/2). -7 What is 1/((-4)/6)112/((-532)/(-19))? -6 Calculate (21(-2)/4)/(822/548). -7 Calculate 14/(-20)(-65)/(-728). -1/16 Evaluate ((2/2)/(-4)-21)/((-54)/(-72)). 7 What is the value of -4(-5)/6027/(-81)? -1/9 What is the value of ((-213/18)/(-1))/((-1)/2)? -7 (-7)/(7/(-5))1 5 2/((-25)/((-6050)/(-44))) -11 ((-124)/(-1705))/((-10)/75) -6/11 Evaluate (-65)/(-117)-6(-216)/(-30). -24 ((-225)/60-1-2)/((-3)/8) 20 Evaluate ((-66)/4)/((90/(-60))/(-1)). -11 Calculate (24/(-21))/(((-352)/(-154))/8). -4 What is the value of ((-152)/(-6))/(-16(-13)/156)? 19 ((-6)/2)/((-85)/68-41) -3/5 What is the value of ((-9)/(-15))/((-60)/(-10))? 1/10 What is (3/21)/((240/50)/((-56)/60))? -1/36 What is ((-9)/(-6))/((-3)/16)? -8 Calculate (390/13)/(-90)-93. 31 (11/11)/(5/(-35)) -7 What is the value of 23(-33)/(-154)(-6)/(-27)? 2/7 Evaluate (10/(-4))/((-9)/6)18/10. 3 What is 310/9132/330? 4/3 What is -32(-2)/205415/171? 19 What is the value of (384/352-4)/(4/(-22)1)? 24 Evaluate (550/15)/1110/(-5)-3. 20 What is (172/(-11696))/((-1)/(-4))? -1/17 What is the value of (((-1)/5)/1)/((-7101)/2367)? 1/15 (4/(-14))/(103/((-689997)/(-66))) -29 What is the value of (((-6)/7)/1)/((-17)/(2261/38))? 3 Evaluate (1826/(-5304))/(3/4). -2/17 What is the value of ((-8)/14)/((-686)/(-2401))? -2 (-119)/(-34)26116/504 29 What is ((-50)/(-4))/(715/(-286))? -5 What is (178/890)/((-1)/85)? -17 What is ((-15)/(-6))/((-30)/20)54/(-2115)? 2/47 Calculate (8/(-8))/(4/12). -3 Evaluate 556/396(-48)/(-2). 20 Evaluate ((-24)/(-1)2/(-20))/((-6)/40). 16 Calculate ((-972)/(-810))/((-8)/15). -9/4 What is (18(-16)/2280)/((-12)/(-30))? -6/19 Evaluate (-14)/(-1512)6-8. -4/9 (1/(6/(-8)))/(-38(-156)/(-741)) 1/6 What is the value of 1221160/1595? 16 Calculate (-56)/100832/8. -2/9 What is the value of (-3)/211217/(-5814)? 1/19 What is the value of ((-21)/3256/84)/((-48)/(-96))? -7/8 What is the value of ((99/78)/11)/(192/384)? 3/13 What is the value of ((-2)/(-5))/(((-7)/(-21))/((-7)/(-42)))? 1/5 16/(-3)(-1098)/(-976)3/6 -3 What is ((-2)/28(-40)/4)/((-295)/(-118))? 2/7 Calculate (1/(-1))/((-6)/(-16)(-672)/(-3276)). -13 ((-9)/30)/(777/(-2220)) 6/7 Evaluate ((-2)/(-2))/((-32)/(-640)-110). -2/11 Evaluate ((-5305)/(-2122))/(1/2). 5 Evaluate (0/(6/3))/(20/10-1). 0 Evaluate ((972/(-135))/(-2))/(4/(-20)). -18 Calculate ((-9)/(-3))/((-4)/(-19)(-120)/(-160)). 19 (-128)/(-288)(-60)/(-2)33/44 10 What is the value of 5/234(-6)/(-255)? 2 What is the value of (38(-8)/(-48))/(24/210)? 35 Evaluate 3766/24479((-286)/4)/(-1). 11 (21/2030)/((-15)/(-25))-4 -2/29 Calculate (3/96-2)/(-1(-41)/123). -3/16 What is the value of (-1125)/(-900)28/(-5)? -7 What is (6/(-14))/(1-7(-8)/(-1176))? 9 What is 9/(-6)(-238)/(-357)(-2)/(-6)? -1/3 What is the value of (-1)/((-2)/484)? 6 Calculate ((-1)/(-3))/((-8)/(-20)). 5/6 Evaluate ((-6)/2)/(110/550). -15 What is 10(-9)/75300/(-18)? 20 Evaluate ((-188)/(-376))/(2/(-32)). -8 Evaluate (-10)/(-5)1/((-5)/(-25)). 10 1-3(-16)/(-256)48 -9 Calculate ((-125)/25)/51/1. -1 Evaluate 2540/28575(-9)/2(-130)/18. 26/9 Calculate 28/60(-18950)/(-15918). 5/9 What is the value of 4(1131/(-52))/(-29)? 3 Evaluate (-15)/9(-873)/(-3395). -3/7 Calculate ((-2)/6)/(13/(-1248)-48). -2/3 Calculate 0((-1)/39)/((-9)/117). 0 What is (2/(-2)-2)/(13/((-312)/16))? -3 ((3/2)/(13/3909))/1 5 Calculate (((-200)/(-60))/(110/33))/((-1)/(-1)). 1 What is the value of 355/426(-3)/(-5)? 1/2 What is (50/7)/(28/(-98))? -25 What is 10512/8761/(-20)5/(-24)? 1/8 Evaluate (-392)/39216/(6/(-3)). 8 (((-16)/(-30))/(116/(-290)))/((-36)/(-270)) -10 ((55/33)/((-5)/30))/(2/(-2)) 10 (740/3885)/((3/3)/(-12)) -16/7 Evaluate (4/(-10))/(65/(34125/(-90))). 7/3 Calculate (-182)/23424/(-28). 2/3 Calculate (1/2)/(5/25(-5)/(-18)). 9 Evaluate (-69)/4605/15(-4)/(-9). -1/45 What is the value of ((1274/78)/49)/(2/(-24))? -4 Calculate ((-1)/(5/(-12)))/(((-1216)/(-800))/19). 30 Calculate 10/8(888/(-1036))/(18/(-56)). 10/3 What is the value of 126/(-14)(3/90)/((-3)/(-12))? -6/5 Calculate ((-18)/54)/(((-34)/(-24))/(-17)). 4 (4/10-1)/(30/(-7125)19) 5 What is the value of 525/(-100)(10/(-9))/5? 7/6 What is (680/(-2040))/((-1)/(-21))? -7 -2(1/2)/(9(-6)/(-36)) -2/3 What is ((-984)/(-82))/(1/(1/26))? 6/13 ((-2128)/(-3724))/((-8)/21) -3/2 Calculate (2/(-22))/((-488)/1342). 1/4 What is the value of 7/14(-8)/(8/(-1))-38? -19 Calculate 114/32492/(-69). -19 What is (-84)/(-168)8/(-4)? -1 Evaluate (202/3636)/((-2)/30). -5/6 Calculate (9/6)/((-5)/(-40)). 12 Calculate (8/(-3))/(38556/(-12393)). 6/7 Calculate (18879/124)/298/(-3). -14 What is the value of (2/(-8))/(177/708)? -1 (-13)/(-364)-126(-5)/(5/6) 27 Calculate -2(6840/36)/19. -20 Calculate 22(-2)/(-99)(-6)/(-2). 4/3 What is the value of (((-8)/70)/1)/(176/(-56))? 2/55 Evaluate ((-76)/19)/(8/(-30)). 15 What is the value of (24(-4)/160-4)/(40/(-400))? -24 Calculate (7/(196/80))/(((-240)/56)/(-15)). 10 Calculate (52/(-3))/(5/(105/(-28))). 13 What is ((1/(3/6))/1)/(300/(-2400))? -16 What is (-144)/277/((-896)/(-240))? -10 Calculate ((-220)/(-33))/((-8)/24). -20 Calculate (223/(-92))/(-1(-2)/12). -3 Calculate (-45)/1(-442)/3315. 6 Calculate -7(-84)/(-98)(-3)/387. 2/43 Calculate ((-32)/(-24))/(34/(-357)). -14 (3/228)/((-35)/(-210))40/30 2/19 What is 327/18(-12)/90? -3/5 Evaluate (-154/(-130))/(43/559). 6 Evaluate (6/8)/(67/(-1340)). -15 Evaluate (-60)/(-315)(66/77)/((-88)/(-14)). 2/77 What is (-39)/(-195)48/(-45)175/(-42)? 8/9 What is the value of (591/(-1576))/((-21)/(-112))? -2 (2/5)/((-4368)/(-9100)) 5/6 Evaluate (462/99)/((-12)/(-54)-15). -7/5 What is the value of (((-4)/(-72)6)/1)/((-3)/(-99))? 11 What is the value of ((-320)/48)/4*15? -	{ "pile_set_name": "DM Mathematics" }
13c2/5 + 4c/5 - 12. Solve a(b) = 0 for b. -2, -1, -1/4 Factor -1/2z2 + 0 + 0z. -z*2/2 Factor 5/3k - 2/3 + 1/3k3 - 4/3k*2. (k - 2)(k - 1)*2/3 Let t = 635 + -631. Solve 0 - 6/13x*t + 0x - 2/13x2 - 2/13x*5 - 6/13x3 = 0. -1, 0 Let c(v) be the first derivative of v7/84 + v6/15 + v5/15 - 5v3/3 - 4. Let x(n) be the third derivative of c(n). Factor x(t). 2t(t + 2)(5t + 2) Let h be 3(-895)/900 - -3. Let l(g) be the third derivative of 1/6g3 - 1/12g*4 + 0g + hg5 + 4g*2 + 0. What is j in l(j) = 0? 1 Let t be (1/3)/(((-40)/6)/(-5)). Factor -1/2 - 3/4u - tu2. -(u + 1)(u + 2)/4 Let k be 25(-4)/(-30) + -3. Factor -k - 1/3i*2 - 2/3i. -(i + 1)*2/3 Suppose 169s*3 + 76s*3 + 2062s - 2042s - 140s2 = 0. What is s? 0, 2/7 Let d(h) = -h3 - 5h2 - 3h. Let m be d(-4). Let z be 76/18 + m/18. Suppose -c*3 + zc*2 - 4c*2 = 0. Calculate c. 0 Factor -4u + 10 + 2/5u2. 2(u - 5)*2/5 Factor 0z*2 + 4z*2 - 4z*3 + 0z*3. -4z*2(z - 1) Suppose 3z - b = 1, 5 = 5z - 2b + b. Factor zy - 9y - y2 + 9y. -y(y - 2) Let r be (2 + -5)/(189/(-12)). Let c(o) be the first derivative of 1/7o*2 + 0o + 2 - ro3. Factor c(g). -2g(2g - 1)/7 Suppose 5u - 12 = f, u - 10 = 5f + 2. Let r be f + (2 - 4/(-16)). Solve -rx2 + 0 + 0x = 0. 0 Let m(q) be the first derivative of -q8/840 - q7/420 + q6/180 + q5/60 - 2q3/3 - 3. Let s(v) be the third derivative of m(v). Factor s(t). -2t(t - 1)(t + 1)*2 Let g be ((-11)/(-22))/((-27)/(-12) + -2). Factor 1/2m*g - m - 3/2. (m - 3)(m + 1)/2 Suppose -2n = -5n + 33. Let b(r) = 13r2 - 2r. Let u(v) = 7v2 - v. Let j(g) = nu(g) - 6b(g). Solve j(s) = 0. 0, 1 Factor 1/3 + 0w - 1/3w2. -(w - 1)(w + 1)/3 Let n(t) = 2t2 - 19t + 13. Let j be n(9). Factor -2/3 - 2/3kj - 2/3k - 2/3k5 + 4/3k*2 + 4/3k*3. -2(k - 1)*2(k + 1)3/3 Let k(s) be the third derivative of s6/360 - s*5/60 + 5s*3/6 - 3s*2. Let j(t) be the first derivative of k(t). Factor j(z). z(z - 2) Suppose -10f = -13f. Let u(q) be the first derivative of -2q + 4q*3 + fq*2 - 1 - 4q*4 + 6/5q*5. Factor u(s). 2(s - 1)*3(3s + 1) Let k be -1 - ((-15)/(-4))/(-3). Factor kb*2 + 0 + 0b. b*2/4 Let i(g) be the second derivative of -1/10g*5 + 0 + 6g + 0g2 + g4 - 3g*3. Factor i(k). -2k(k - 3)2 Factor 0x*2 - 36 - 3x*2 - 18x*2 - 48x - 3x3. -3(x + 2)*2(x + 3) Let p(f) = -3f2 + 9f - 3. Let n(w) = 3w2 - 10w + 2. Let z(x) = -3n(x) - 2p(x). Factor z(h). -3h(h - 4) Let x be 560/(-350)(-10)/8. Find w such that 1/2 + 1/2w*3 - 1/2w*x - 1/2w = 0. -1, 1 Let l(b) = 4b3 - 11b*2 - 17b + 27. Let z(c) = 4c3 - 10c*2 - 18c + 26. Let t(x) = -2l(x) + 3z(x). Factor t(a). 4(a - 3)(a - 1)(a + 2) Factor -2/19y + 8/19y4 + 8/19y*2 - 12/19y*3 + 0 - 2/19y*5. -2y(y - 1)4/19 Let u be -3 - (-2)/4-4. Let m be u/25 + 1/5. Find r, given that 0r4 + mr*2 + 2/9r + 0 + 2/9r5 - 4/9r*3 = 0. -1, 0, 1 Let i(v) be the first derivative of -3v*4/8 - 2v*3 - 9v*2/4 + 17. Factor i(m). -3m(m + 1)(m + 3)/2 Suppose -3r - 4 = -2v - 3v, -v - 2r + 6 = 0. Let b(j) be the third derivative of 1/60j5 + 0 + 1/60j*6 + 0j - vj2 + 0j*4 + 0j3. Factor b(f). f2(2f + 1) Let n be (-5)/((-150)/(-12))-2. Determine i, given that 0i*2 + ni*4 + 0 + 2i*5 + 0i*3 + 0i = 0. -2/5, 0 Let v(u) be the third derivative of 0 + 1/60u5 + 0u*3 + 0u + 1/8u6 + 1/48u*8 + 3u*2 + 19/210u*7 - 1/12u*4. Factor v(a). a(a + 1)*3(7a - 2) Find x such that -2x*2 + 24 + 27x - 12x - 7x = 0. -2, 6 Let w(c) be the second derivative of c*6/165 + 9c*5/110 + 16c. Factor w(k). 2k3(k + 9)/11 Factor -1/2j + 0 + 3/2j*2 + 1/2j*4 - 3/2j*3. j(j - 1)*3/2 Let s(j) be the first derivative of 2j5/5 - j4 - 8j3/3 + 2j*2 + 6j + 2. Factor s(u). 2(u - 3)(u - 1)(u + 1)2 Let -4/5h + 1/5h2 + 0 = 0. What is h? 0, 4 Let o(h) be the third derivative of h5/150 + h4/10 + 3h*3/5 + 5h*2. Factor o(v). 2(v + 3)*2/5 Let x(y) = 2y + 5. Let k be x(0). Let l(a) be the third derivative of -a*2 - 1/210a*k - 1/21a*3 + 0a + 1/42a4 + 0. Determine o, given that l(o) = 0. 1 Suppose -3q = -4q - f, 0 = -2q + 4f + 18. Suppose 0 = w - q - 1. Let -wr - 7r4 + 6r*2 + 0r + 21r4 + 24r*3 = 0. Calculate r. -1, 0, 2/7 Let s(b) = 32b*4 + 144b*3 + 66b*2 + 5b. Let v(g) = g. Let q(w) = -s(w) - 3v(w). Find u, given that q(u) = 0. -4, -1/4, 0 Suppose -p = 4t + 18, 3p = 21t - 22t + 1. Solve 2/7w*p + 8/7 + 8/7w = 0 for w. -2 Factor -5j2 - 2j*3 - 8j*2 - 2j + 17j2. -2j(j - 1)2 Let l(q) be the second derivative of q5/4 + 5q*4/4 + 5q3/3 + q. Suppose l(z) = 0. What is z? -2, -1, 0 Let u(x) be the first derivative of -x5/20 - x4/36 + x3/9 - x + 8. Let g(q) be the first derivative of u(q). Factor g(a). -a(a + 1)(3a - 2)/3 Factor 0 + 2/13s*3 - 6/13s*4 + 0s + 4/13s2. -2s*2(s - 1)(3s + 2)/13 Factor 4/5 - 2/5v2 + 2/5v. -2(v - 2)(v + 1)/5 Let b(n) be the second derivative of -n8/30240 - n7/11340 + n6/3240 + n5/540 - 5n4/12 + 3n. Let j(i) be the third derivative of b(i). Factor j(p). -2(p - 1)(p + 1)*2/9 Factor -2 - 19k*2 + 6k + 6 + 2k + 7k*3. (k - 2)(k - 1)(7k + 2) Suppose 20 = 4p - 0p. Let s(g) = g - 5. Let t be s(p). Factor 2/3k4 - 2/3k + 2/3k3 - 2/3k*2 + t. 2k(k - 1)(k + 1)*2/3 Suppose -2j = -n - 5, 0 = -3n - 0n - 3j + 21. Determine z, given that 2/7z*4 + 8/7z*n + 0 + 4/7z + 10/7z2 = 0. -2, -1, 0 Let w(r) be the first derivative of 1/20r*5 + 1 + 1/12r*3 - 3/16r*4 + 0r*2 + r. Let z(q) be the first derivative of w(q). Factor z(a). a(a - 2)(4a - 1)/4 Let a(c) be the first derivative of -1 - 1/12c3 + 0c + 0c2 + 0c*4 + 1/20c5. Factor a(k). k2(k - 1)(k + 1)/4 Let w be 380/(-800) + 1/2. Let o(z) be the third derivative of 0z3 - 3/140z*7 - 3z*2 + 0 - wz*5 + 1/224z*8 + 0z + 3/80z6 + 0z*4. Factor o(k). 3k*2(k - 1)3/2 Let t(x) be the third derivative of -x8/84 + 6x7/35 - 4x*6/5 + 16x*5/15 - 10x*2. Factor t(d). -4d*2(d - 4)*2(d - 1) Let c be (-26)/(-12) - (-2)/(-12). Let o(u) = -3u4 + 9u*2 - 4u + 2. Let d(q) = 6q4 - 18q*2 + 7q - 5. Let k(v) = cd(v) + 5o(v). Factor k(b). -3b(b - 1)*2(b + 2) Let q be 30/36(-5)/((-75)/6). Solve qv*2 + 1/3 + 2/3v = 0 for v. -1 Let v(a) be the third derivative of -1/4a4 + 0 + 1/168a*8 + 1/3a*3 + 1/30a*6 - 1/35a*7 + 1/15a*5 + 3a*2 + 0a. Suppose v(s) = 0. Calculate s. -1, 1 Suppose 3h + 27 + 2 = 4j, j - h - 8 = 0. Let y(o) be the second derivative of 1/18o3 + 0o*2 + 2o - 1/60oj + 0o*4 + 0. Find f such that y(f) = 0. -1, 0, 1 Let m(l) = -65l*3 + 330l*2 - 285l + 155. Let g(u) = -3u3 + 15u*2 - 13u + 7. Let y(j) = -45g(j) + 2m(j). Let y(h) = 0. What is h? 1 Let o(a) be the second derivative of -a*7/21 + 3a5/10 - a4/3 - 16a. Factor o(k). -2k*2(k - 1)*2(k + 2) What is m in 0m2 + 0m + 1/5m4 + 0 + 3/10m*3 - 1/10m*5 = 0? -1, 0, 3 Suppose 0 = -2b - 2o - 2 + 18, -b - 16 = -5o. Suppose 0 = -3x + bx - 2. Solve 0p - 15p*x - 1 + 1 - 6p = 0 for p. -2/5, 0 Let i be -1 - (-3 - 118/(-60)). Let d(s) be the third derivative of 0s - is*5 + 1/3s*3 + 7/24s4 + s2 - 7/120s6 + 0. Factor d(q). -(q - 1)(q + 1)(7q + 2) Let d(v) be the second derivative of 3v2 - 7/2v*3 + 0 - 2v + 2v4 - 9/20v*5. Factor d(f). -3(f - 1)*2(3f - 2) Let 6l*2 - 5l2 - l4 - 3l3 + 3l*2 + 0l*2 = 0. What is l? -4, 0, 1 Let o be -2 + (3 - -2)1. Let -9zo - 2z*2 - 5z*2 - 3z*4 - 2z*2 - 3z = 0. Calculate z. -1, 0 Let y = -34 + 511/15. Let o(v) be the second derivative of 2v2 - yv*6 + 1/2v*4 - 1/10v*5 + 2v + 5/3v3 + 0. Determine p, given that o(p) = 0. -1, 2 Let l(n) be the first derivative of -4 - 3/4n*2 + 1/2n*3 - 3/10n*5 + 0n + 3/8n4. Determine s so that l(s) = 0. -1, 0, 1 Let s(u) = 7u*2 + 11u + 4. Let m = 2 - 0. Let y(i) = -12i2 - im - 13i - 19i - 12 - 7i*2. Let c(w) = -14s(w) - 5y(w). Find d such that c(d) = 0. -2, -1 Suppose t + 0 = -4h + 6, 2t - 3h - 1 = 0. Fact	{ "pile_set_name": "DM Mathematics" }
. 7 + 2sqrt(13) Simplify -1(-54(-2(sqrt(3072) + sqrt(3072)2) + -2sqrt(3072) + 5 + -1))2. -78649600 + 819200sqrt(3) Simplify (-4 + (sqrt(228) + (sqrt(228) - -1sqrt(228))-5)/((sqrt(144)/sqrt(4))/sqrt(3)))1 + 4. -9sqrt(19) Simplify -4(-3 + 52sqrt(605) - (4-2sqrt(605) - (sqrt(605) + -1)6)*2)-52. -4744760 + 78320sqrt(5) Simplify (((sqrt(104)-1)/sqrt(8) + (sqrt(52)/sqrt(4) + 5 - sqrt(13)))-6 + 3(-4 + (sqrt(13) - (sqrt(13) + (sqrt(52)/sqrt(4) - sqrt(13)) + sqrt(13))))44)2. 18648sqrt(13) + 72216 Simplify (sqrt(432)/(sqrt(192) + sqrt(12)) - sqrt(216)/sqrt(6)6)/(sqrt(1200)-1 + (sqrt(24)/sqrt(2)-1 - sqrt(12))). 29sqrt(3)/60 Simplify (3 + 4(sqrt(243) + 1sqrt(243))-1 + -4 + (sqrt(243) - 1(1 + sqrt(243)) - -6(sqrt(243) + -1 - sqrt(243))))2. 1152sqrt(3) + 15616 Simplify -2 + -4((sqrt(80) + (sqrt(80) - (sqrt(80) + 1sqrt(80)) - sqrt(80)) + sqrt(80) - sqrt(80))-1 + -2sqrt(2695)/sqrt(11))*2. -2002 Simplify -2(sqrt(99) + -1)*255 - (((sqrt(704) - (sqrt(704) + 2 + sqrt(704)))6)*2 + (-2 + sqrt(704)-3)*2). -36828 - 948sqrt(11) Simplify -5(-2 + (5(6(5 + (sqrt(98) + -2 - sqrt(98)) + sqrt(98))-1 + -4))*2). -501490 - 231000sqrt(2) Simplify 2(4(-1 + -2 + sqrt(80) + sqrt(80)2 + 3 + -2)-4)*2. -24576sqrt(5) + 370688 Simplify ((-6(sqrt(119) + -3sqrt(119)) - sqrt(119))/((sqrt(175) - -3sqrt(175)) + sqrt(175))-5 + 2)*2 + -1. -44sqrt(17)/5 + 2132/25 Simplify 1(4 + sqrt(200)3 + 1 + (0 + sqrt(200)-3 - (2 + sqrt(200))4))*2. 240sqrt(2) + 3209 Simplify -3(((sqrt(1573) + sqrt(1573) + -1 + 4)2 - sqrt(1573)) + -1 - ((sqrt(1573)1-6)2 + -2)) + -2. -363sqrt(13) + 150976 Simplify -6((sqrt(320)-2)*2 + 1)6 - (-4 + (2 + sqrt(320) + -1 + 2)*2). -46441 - 48sqrt(5) Simplify 4 + (3(-2(sqrt(576) + sqrt(576)1) - sqrt(576))/(sqrt(12)/sqrt(4)1 - ((sqrt(3) - sqrt(12))3 + sqrt(3))))2. 4804 Simplify (2(-3 + 2 + sqrt(612) + sqrt(612) + (-2 + sqrt(612) - sqrt(612))-4 + (sqrt(1836)-2 + sqrt(51))/(sqrt(3) - (sqrt(3)2 - sqrt(3))2)))*2. 1288sqrt(17) + 36168 Simplify (2sqrt(1872) + sqrt(1872) + 0 + sqrt(1872) - (sqrt(1872) + sqrt(1872) + 1 + sqrt(1872) + -5)2) + (3 + sqrt(13) + 5 - sqrt(52)/sqrt(16)). -16856 + 673sqrt(13)/2 Simplify (4 + (1 + (-5 + sqrt(108) + sqrt(108) + -2 - (2 + sqrt(108) - sqrt(108) - sqrt(108))5))2)2. -2688sqrt(3) + 11104 Simplify 1(-4(sqrt(45) - sqrt(90)/sqrt(2)) + sqrt(2880)2)/(sqrt(9) + (sqrt(9) - sqrt(18)/(sqrt(2) - sqrt(2)-2)) - sqrt(72)/(1sqrt(8))). 24sqrt(5) Simplify (-2(-2 + 6(sqrt(704)-21 + -1 + -3sqrt(704))))*2. 15360sqrt(11) + 2534656 Simplify (6(3(1 + -2 + sqrt(3)) + -3 + (-1sqrt(24)/sqrt(4))/(sqrt(200)-2)))*2. -6588sqrt(3)/5 + 230067/100 Simplify (-3 + (sqrt(1980)/sqrt(11))*2 + ((sqrt(280)3)/sqrt(8))/sqrt(7))-2. -354 - 6sqrt(5) Simplify 2 + (-44sqrt(245) + -2 + (sqrt(245) - -5(sqrt(245) - sqrt(245)1) - ((2 + sqrt(245) + 5 - sqrt(245)) + sqrt(245) + sqrt(245) + sqrt(245))))*2. 2268sqrt(5) + 79463 Simplify 4 + 1 + (32sqrt(891))*2 + 4 + -5((sqrt(891) - sqrt(891)-2)2 + sqrt(891)) + 5. -8005 - 45sqrt(11) Simplify (sqrt(1331) - -3(2 + sqrt(1331)))25 - ((-2 + 2 + sqrt(1331))2 - (sqrt(1331) - (sqrt(1331) + -2)2)-3). 2475sqrt(11) + 109334 Simplify (sqrt(126)/sqrt(96))/(sqrt(7) + sqrt(14)/(sqrt(2) + sqrt(8)/sqrt(4))) - (3 + -4 + (sqrt(108) - (1 + 1sqrt(108))))2. -4 + sqrt(3)/6 Simplify 2 + (2 + 32(-3 + sqrt(243)) + (sqrt(243)-1 + 5 - (sqrt(243) + sqrt(243) + 1 + 3)))*2. -810sqrt(3) + 2414 Simplify (-4 + -6(2 + sqrt(833)) - (4 + sqrt(833) + 0 + sqrt(833) - (sqrt(833) - (sqrt(833) + -5 + sqrt(833) + 2sqrt(833)))))*2 + 2. 2310sqrt(17) + 101020 Simplify ((sqrt(480) + (2sqrt(480)5 - sqrt(480)) + sqrt(480))-5)/((sqrt(132)/(sqrt(44)/sqrt(4)))/(sqrt(6)/sqrt(3)5)). -1100sqrt(5) Simplify ((5-1sqrt(162))/(2sqrt(9)2))/(-6sqrt(108)/(1sqrt(48))). 5sqrt(2)/12 Simplify 5((sqrt(136) + sqrt(136)-1-6 + -1sqrt(136)-1)/((sqrt(8) + (3sqrt(648) - sqrt(8)) - sqrt(8))3))2. 1360/1521 Simplify -2sqrt(700)5 + 1 + sqrt(700) + sqrt(700)33 + 5 + 3 + 3. 12 Simplify 6(-3 + 3 + sqrt(304) + sqrt(304) + (sqrt(304) - (sqrt(304)4 + -2)) + 4)4 + 0. -96sqrt(19) + 144 Simplify ((4(sqrt(78) + sqrt(78)-2) + (sqrt(78)-23 - sqrt(78)))/((sqrt(72)-2)/(sqrt(27)/(-2sqrt(9)))))2. 1573/64 Simplify ((1 + sqrt(1539) + (sqrt(1539) - (-1 + sqrt(1539) + sqrt(1539))) + -5 + sqrt(1539) + 5 + (sqrt(1539) - (sqrt(1539) + -1)) + -4)4)*2-1. -24640 + 288sqrt(19) Simplify (-3-6(2 + sqrt(847) + (1sqrt(847) - sqrt(847)) + sqrt(847) + 2 + (0 + sqrt(847))-2 + -3))2. 324 Simplify ((sqrt(459) + sqrt(459)2)/sqrt(9) - (sqrt(459)2)/sqrt(9))/((sqrt(336)-5)/(2sqrt(112))). -2sqrt(17)/5 Simplify (-5(5 + 5 + -5 + ((-1 + sqrt(1700) - sqrt(1700)) + 3)5))*2. 5625 Simplify ((25sqrt(200)-3 + -1 + 4)-15)*2. -45000sqrt(2) + 4500225 Simplify (-2(sqrt(88) - (-3(sqrt(88)3 - sqrt(88)) - sqrt(88))))/((52sqrt(14))/(sqrt(28) + sqrt(252))). -128sqrt(11)/5 Simplify (-2sqrt(3078))/(sqrt(54)/sqrt(3) + sqrt(2)) - (((sqrt(152) + (2sqrt(152) - sqrt(152) - sqrt(152)) - sqrt(152))1)/(sqrt(40)/(sqrt(5)-2)))*2. -9sqrt(19)/2 Simplify ((-1sqrt(304) + sqrt(304) - sqrt(304)) + 1 + 1(sqrt(304) + 3 + sqrt(304)) + -3(2 + sqrt(304)25 + sqrt(304)) + 2)2. 311296 Simplify -4(-5(1 + sqrt(175)) + (sqrt(175) + (sqrt(175) + -1)2 - sqrt(175))5 + (2(sqrt(175) + -1))2-2)6. -120sqrt(7) + 12792 Simplify (-5(-5 + (1 + 2sqrt(275) - 2sqrt(275)-2 - (-1sqrt(275) + 1 - (sqrt(275) + 2sqrt(275))1))))23. -37500sqrt(11) + 2064375 Simplify ((sqrt(180) - (sqrt(180)2 - sqrt(180)))/sqrt(6))/(sqrt(90)-4) - (-4 + sqrt(3) + -5 + sqrt(3) + 4 + sqrt(147))2. -268 + 90sqrt(3) Simplify ((sqrt(400)-2 + (sqrt(250)/sqrt(5) + sqrt(50))/sqrt(2))-3)/((sqrt(150)/sqrt(125))/(sqrt(42)/sqrt(175))). 18sqrt(5) Simplify (-22(sqrt(104)5 - sqrt(104))-3)/(2sqrt(512) - sqrt(800)1). 8sqrt(13) Simplify ((sqrt(425) - (-1 + sqrt(425) + 0)) + 3 + 0 + sqrt(425) + -1 + -2((sqrt(85) - -2sqrt(85))-6)/(sqrt(125) + -1sqrt(125) - sqrt(125) - sqrt(5)))*2. -6sqrt(17) + 26 Simplify (3(-5 + 1 + 1 + sqrt(243)) - (sqrt(108) + sqrt(108) + -1 + -3 + (sqrt(300)-1 - sqrt(300))/sqrt(4)))*2. -250sqrt(3) + 1900 Simplify (((sqrt(112)-1-1)/(sqrt(64)/sqrt(2)))/((sqrt(4) + (sqrt(4) - sqrt(12)/sqrt(3))-5)/(-1sqrt(2)1)))2. 7/4 Simplify (1sqrt(55))/sqrt(5)6 + (-6sqrt(77)-2)/sqrt(7) + ((sqrt(66) + -11sqrt(66))/(sqrt(48)/(sqrt(24)/sqrt(3))))2. 18sqrt(11) Simplify ((1 + -4 + (sqrt(112)-1 + -5 - (sqrt(112) + 2 + -1)))-5 + -1)*2. 3520sqrt(7) + 13136 Simplify (-3 + sqrt(13) + -5 + 5)-2 - (2 + ((sqrt(104) - (sqrt(104) + (sqrt(104) - sqrt(104)5 - sqrt(104))4 + sqrt(104))) + sqrt(104))/sqrt(8)). -22sqrt(13) + 4 Simplify (sqrt(78) + 1(sqrt(78) - 1sqrt(78)) + (sqrt(78) - (sqrt(78) - -4sqrt(78)-5)))/((-4sqrt(726) - sqrt(726) - sqrt(726))6-2). 7sqrt(13)/264 Simplify ((sqrt(1008) + 1 + 1 + sqrt(1008) - (-2 + 0 + sqrt(1008)))*2 - (-4(sqrt(1008) + 1))*26) + 3. -95837 - 2208sqrt(7) Simplify sqrt(704) + sqrt(704) + (1sqrt(704)2)2 + (2sqrt(704))*2 + 3 + 3-5(5 + sqrt(11) + sqrt(55)/sqrt(5)). -14sqrt(11) + 5560 Simplify ((sqrt(3) - (2 + (sqrt(3) + 2)*2)) + -2)-6 - ((-1sqrt(75) + 4 - sqrt(75))2 + 5). -255 + 98sqrt(3) Simplify (-2sqrt(84)24)/((sqrt(504)2)/(-5sqrt(8))). 80sqrt(3)/3 Simplify (sqrt(272) + -5(sqrt(272) + sqrt(272) + 2) - (3 + 0 + sqrt(272)))2 - (-3 + -1sqrt(272)1 + 3). 1044sqrt(17) + 27369 Simplify -2 + ((sqrt(36) + sqrt(72)/sqrt(2))6)/(sqrt(768)2) + ((-1 + sqrt(3))*2-3 - sqrt(3)) + -1sqrt(3)-6. -14 + 47sqrt(3)/4 Simplify ((sqrt(440)/(3sqrt(250)))/(sqrt(20)/(sqrt(5) - sqrt(45)) + sqrt(16)-5))2. 44/99225 Simplify (4sqrt(648)-4-2)/(-4sqrt(150) + sqrt(600)5). 32sqrt(3)/5 Simplify ((4 + (sqrt(40)/(sqrt(48)/sqrt(588)))/(4sqrt(1152)))-3)2. 21sqrt(5)/4 + 147701/1024 Simplify (-2 + ((sqrt(396) - (0 + sqrt(396)) - sqrt(396)) + 2 - sqrt(396) - (sqrt(396) + 0 + 2)) - (2sqrt(396)-6 + (-1 + sqrt(396)2 - sqrt(396))))2. -96sqrt(11) + 25345 Simplify (-5(-1(sqrt(180) + -1) + (sqrt(180) + 0 - sqrt(180) - sqrt(180))-5 + 1 + -2 + 1 + -2))2. -1200sqrt(5) + 72025 Simplify -4*(-5 + (sqrt(4900) - (sqrt(4900) -	{ "pile_set_name": "DM Mathematics" }
n the form dv2 + jv*3 + g + iv and give d. -2 Rearrange 7u4 + 25u*2 + 4u*3 - 5u*3 - 2 - 11u*4 + 6u*3 - 4u*3 to the form zu*4 + cu + wu2 + s + hu*3 and give z. -4 Rearrange -184m + 348m - m2 - m3 - 166m + 100 to the form fm2 + im*3 + d + ym and give i. -1 Rearrange -4m2 + 2m*2 + 3m*2 + 2m*2 + 2m*2 - 2m*2 + (4m - 5m + 7m)(7m - 25m - 21m) to the form nm + um*2 + a and give u. -231 Rearrange -2 + 2 + 22v + 0 + 23v2 - 26v to the form gv + sv*2 + x and give g. -4 Rearrange 249t*2 + 811t*2 - 2898t*2 to the form at*2 + gt + f and give a. -1838 Express 2v3 - 13v - 19v - 45v*4 + 33v as tv4 + fv*2 + mv*3 + r + iv and give i. 1 Rearrange (-6a + 2a + 2a)(30 + 0a + 4a - 6a) to na + ma2 + t and give n. -60 Express 18v*2 - 17v*2 + 24 - 24 + 702v*3 in the form z + nv*2 + cv + dv3 and give d. 702 Express 44y*2 - 4y*4 - 18y*2 - 66y*3 + 5y*4 - 24y*2 in the form ay*3 + ny*4 + c + zy + gy2 and give a. -66 Rearrange (3 + 4c - 3)(4c - 4c + 7c3) - c3 + 4 - 8c3 - c4 + 18c3 + c2 to tc2 + wc + y + zc3 + sc*4 and give t. 1 Express (167h*2 + 200h*2 - 495h*2)((0 + 0 + 2)(-3h - h + 2h) + 4h - h - 5h - 7h + 3h - h) as bh*3 + oh + zh2 + i and give b. 1408 Express (-5k + 3k + k)(-5k3 + 2k*3 + 4k*3) - 2768k*4 + 1536k*4 + 1741k*4 in the form o + lk*3 + bk + rk4 + pk*2 and give l. 0 Express 21z*2 - 41z*2 + 15z*2 - 51z*2 in the form iz + az2 + n and give a. -56 Express -2742q + 3318q - 3 - 2774q + 3 as z + aq and give a. -2198 Rearrange (4 - 2 - 4 - 5m)(1 - 5 + 2)(-78 + 58 + 170)(4 + 2 - 5) to wm + c and give w. 1500 Express -910h2 - 4h*3 + 910h2 + h3 + h in the form dh3 + jh*2 + uh + i and give i. 0 Express -232 + 308t + 103t + 117t + 232 as ut + l and give u. 528 Express -7u + 11u - 22u2 - 4u as zu + vu*2 + l and give v. -22 Express 320330w*3 - 320338w*3 - 3w*2 - 50w + w*2 in the form b + nw + sw3 + qw*2 and give s. -8 Rearrange 79 - 156 + 79 - 2y2 - y3 - 17y3 to the form dy + oy3 + g + ny*2 and give n. -2 Express (5z*2 - 5z*2 - 2z*3)(-2 - 21 + 2)(-4 - 4 + 36) in the form hz*3 + r + fz + cz2 and give h. 1176 Rearrange -14g - 29g + 12g - 5g2 to zg*2 + d + yg and give y. -31 Rearrange (-f*2 + 3f2 - f2)(-28f - 39f - f) - 2f*3 + 4f*3 + 0f*3 to y + gf*2 + af + zf3 and give z. -66 Express 6037r - 6038r + 9r*2 + 49r*2 in the form or + p + yr2 and give o. -1 Rearrange -497w*2 + 500w*2 - 10w3 + w3 - 2w3 to the form y + sw*3 + hw + lw2 and give l. 3 Express -29t - 23t3 - 179t*2 + 36t + 179t2 as l + ut + ht3 + xt*2 and give h. -23 Rearrange 150h*2 + 88h*2 + 110 - 32h*2 - 110 to ah + c + mh2 and give m. 206 Rearrange 310n*2 - 1007n*2 - 463n*2 to r + xn + on2 and give o. -1160 Rearrange 38n - 5n + 53n + 2 to the form jn + u and give j. 86 Express (-964b + 454b + 381b - 2)(1 + 4 - 3) in the form lb + v and give v. -4 Rearrange -5b2 - 3b - 2b4 - 7b*2 - 4b*2 + 18b*2 - 2 to rb*4 + ab + sb3 + o + cb*2 and give o. -2 Express -158o*3 + 7o*2 - 259o*3 - 7o*2 - o + 121o*3 as wo + k + po2 + ho*3 and give k. 0 Express (-1 + 1 + p)(285 + 289 - 563 - 2p) in the form lp + sp2 + c and give s. -2 Rearrange (196i - 361i + 188i)(0i + 0i + 5i) + i*2 + 0 + 0 + 0i*2 + 0i2 - i2 to vi2 + xi + w and give v. 115 Rearrange 3x + 768x*2 - 2 - x - 779x*2 - 4x to fx + zx*2 + g and give z. -11 Express 81y*2 + 97y*2 + 88y*2 - 264y*2 - 6y*4 + 94 as sy + uy2 + z + my*3 + jy*4 and give s. 0 Rearrange -4d*3 + 2d*2 + 361d + 3d4 - 359d + 29d3 to the form ud*2 + n + md*4 + bd*3 + td and give t. 2 Rearrange ((-4 + 0 + 3)(0 - 1 + 0) + 0 + 4 - 1)(-20z2 - 3z*2 + 6z*2 - 3) to the form o + lz*2 + fz and give o. -12 Rearrange -98w - 273w + 123w to zw + o and give o. 0 Express (2w + 1 - 1)(3w2 + w2 - 5w*2) + 30w*3 - 173w*2 + 175w*2 - 7w*3 as sw + yw2 + kw*3 + q and give y. 2 Rearrange 27h*3 - 53h3 - h4 + 26h3 + h2 - 16 + h to uh*2 + fh + ih3 + q + ph4 and give u. 1 Rearrange w2 + 29 - 2w2 - 10w*3 - 5w - 29 to the form i + zw3 + aw*2 + cw and give z. -10 Express (972 - 693 + 1755)(2v - 2v - v) in the form dv + l and give d. -2034 Express -15 - 6 - 4511s2 + 4504s*2 in the form rs*2 + ps + b and give p. 0 Express -9j3 + 3 + 24j*4 + 0j*3 + 17 - 21 in the form gj*3 + nj + rj4 + o + xj*2 and give g. -9 Rearrange -10h - h*3 - 156 - 2h*2 + 314 - 157 to the form x + zh*3 + wh*2 + yh and give z. -1 Rearrange (-124 + 153 - 155)(-2d*3 + 3d3 + d3) - 2d + d3 + 2d to the form qd3 + hd + gd2 + n and give g. 0 Rearrange (t + 2t - 5t - 1)(2 - 1 + 2)(-2 - 3 - 3) to yt + x and give x. 24 Express (-3k - 4k - 24k)(3 - 5 + 0)(-9k - 2k + 7k) in the form bk + ck2 + i and give c. -248 Rearrange w2 + 45 + 4w4 - 80 - w + 34 to aw*2 + uw*3 + mw + zw4 + n and give z. 4 Express 11i + 15 - 5 - 109i2 - 11i in the form o + ui2 + ti and give u. -109 Rearrange -22r3 + r - 1 + 14r*2 - 50r*3 + 77r*3 - 1 - 6r to the form wr + nr*2 + t + or*3 and give t. -2 Rearrange (3s*2 + 18s*2 + 12s*2)(-10s - 1 - 5s + 18s)(3s + 3s - 4s)(0 + 1 + 1) to the form vs3 + r + ms + js4 + zs*2 and give j. 396 Express -1261 - 7g*2 - 2g*3 + 630 + 19g*2 + 633 as l + cg*2 + fg + jg3 and give c. 12 Rearrange (-2v*3 + 3v*3 - 2v*3)(162 + 226 + 501)(0v + 2v + 0v) to the form dv + c + fv*2 + sv*4 + zv*3 and give s. -1778 Rearrange (5s + 0s + 4s)(-s + s + s + 0 + s + 0 + (3 - 3 - 1)(2 - 2 + 4s)) to the form g + ws*2 + as and give w. -18 Rearrange -53 + 93 - 9m3 + 5m*3 to tm*2 + o + dm + pm3 and give p. -4 Rearrange -8i - 96 + 53 + 46 to a + vi and give v. -8 Rearrange -28f - 10f2 + 0f*2 + 0f*2 + 22f to the form o + hf2 + df and give h. -10 Express (0g3 - 3g*3 + 4g*3)(3 + 3g - 3) - 2g4 + g2 - g*2 + 20g*4 - 7g*4 - 6g*4 in the form ig*4 + dg*3 + kg + p + wg2 and give i. 8 Rearrange (-1 - 2c*3 + 1)(-5c + c + 0c)(-5 + 3 + 1) - 83c*4 - 47c*2 + 47c*2 to hc*4 + jc*2 + vc*3 + f + tc and give t. 0 Rearrange 273 - 136y - 40y - 271 to the form d + gy and give d. 2 Express -5 + 4 + 1 + 293a in the form g + ta and give t. 293 Rearrange -2d*2 - 7d4 - d3 + 9d + 27d*4 - 2d*4 - 9d*4 - 6d*4 to vd*2 + hd*4 + b + cd*3 + md and give h. 3 Express -18z4 + 1 + 34z*4 + 22z*2 + 1 - 15z*4 + z + 5z*2 in the form d + jz*3 + vz*4 + oz*2 + iz and give d. 2 Rearrange 2s - 51 + 41 - 3s + 29 to d + js and give d. 19 Rearrange 15c*3 - 16c*3 - 68c*3 - 3c + 2c3 + 3c + (-2c2 - 2c*2 + 6c*2)(-c + 6c - 4c) to the form lc + i + bc*2 + nc*3 and give l. 0 Express 21p - 72p + 2 + 14p + 19p + 16p + 95p3 in the form y + bp*2 + jp + qp3 and give j. -2 Rearrange -869 - 805n + 3n2 - 5n*2 + 805n to the form jn + v + ln*2 and give l. -2 Express k + 0k*2 - 555k*3 + 288k*3 + 0k*2 as gk*3 + u + hk + rk2 and give r. 0 Express 2b*4 + 11b - 32 + 21b3 - 2b3 + 34 + b2 - 8b in the form db*4 + jb + sb3 + xb*2 + q and give j. 3 Express (4 + 0 + 9z - 6)(z - 5 + 3 - 5z) in the form fz2 + cz + q and give f. -36 Express (-3 + 7 - 2)(12 - 12 + 3a) + 10 - 614a + 12 - 12 - 10 in the form ra + g and give r. -608 Rearrange -19r2 - 58r*2 + 17r*2 - 9r*2 to zr + ar2 + t and give a. -69 Rearrange 3n*2 - 26 + 2n - 22 + 44 to the form c + qn + zn*2 and give c. -4 Express (1499 - 105 - 151)(0i2 - 5i*2 + 3i*2 + (2 - 2i - 2)(-4i + 0i + 5i)) in the form q + gi + bi*2 and give b. -4972 Rearrange 86 - 100r - 86 - 1 + 1 - r + (1 + 3 - 2)(2r + 0 + 0) - 3r - 4r + 6r to yr + o and give y. -98 Rearrange 700x2 - 1405x*2 + 707x*2 - 10 - 2x + 2x3 + 12x*4 to cx*2 + bx + rx*4 +	{ "pile_set_name": "DM Mathematics" }
39. What is the nearest to -1 in -0.1, z, 0.1, -0.3? -0.3 Let x = 0.06 + 1.94. Let c be 1 - 4 - (-16 + 11). Let n be (-1)/c + (-243)/(-270). What is the nearest to -0.9 in 1, n, x? n Let f be -2(221/65 + (-3)/1). Let w = 75.3 - 69. Let r = -6.3 + w. Which is the nearest to 2/5? (a) -4 (b) r (c) f b Let j be 2/17 + 6/306(-10 + -251). What is the closest to 0 in j, 0.1, 0.4, 3? 0.1 Let l = 2945 + -2939. Let z(i) = -2i2 - 3i - 1. Let m be z(-3). Let w be -1 + (-2 - 22/m). Which is the closest to w? (a) l (b) -1 (c) 3 b Let f(r) = -r*2 - 3r + 10. Let o be f(-5). Suppose 4z - z - 3x = 0, x = 3. Suppose l - 2 + z = 0. Which is the closest to l? (a) -4 (b) -0.1 (c) o b Let g be 8/(-48) + (-2775)/(-18). Let p = -156 + g. What is the nearest to p in -1, 3, -8, -0.3? -1 Let d(q) = -q*3 + 13q*2 + 15q - 28. Let v be d(14). Let u be (-28)/126 + v/(-9). Let r = -4.2 + 4. Which is the nearest to u? (a) r (b) 0 (c) -4 b Let b = 7 + -5. Let z be 14/8 - 3/b. Let j be (-4)/38 - (555/(-760) - (-54)/(-144)). What is the closest to j in 1/13, z, -1/2? z Let j = 59792/15 + -14959/5. Let z = j - 994. Let u = 0.6 - 0.2. What is the nearest to -0.1 in 0, u, z? 0 Let i = -3 - -1. Let x be 2 - 4 - 24/(-10). Let l = -34016 + 34015.96. Which is the nearest to l? (a) i (b) x (c) -0.4 c Let i = -11 + 12. Let t = -0.43 - -1. Let n = t - 4.57. What is the nearest to 2/3 in i, 4, n? i Let n = 9038 - 9034. Which is the closest to -0.01? (a) 2/5 (b) -3 (c) n a Let i = -251351 - -28151533/112. Let p = -27/16 + i. What is the nearest to 1/2 in -0.3, p, -0.06? p Let q = 124.0001 + -0.0001. Let d = q - 124.1. Let n = -1 + 1.1. Which is the nearest to n? (a) 27/4 (b) 2/19 (c) d b Let l be 108/15 + -170/10. Let y = 44/3 + -15. Which is the closest to y? (a) -7 (b) 4/5 (c) l c Let m = -0.15 + -0.55. Let i = -0.3 - m. What is the closest to 1 in -102, 0.2, i? i Let s be ((-21625)/(-195) + -1)3/(-2). Let t = s - -165. Let v = 42 - 42. Which is the nearest to v? (a) -1 (b) t (c) 0.4 b Let q = 199/271 - 2062/2439. Let y = 0.9 - 1. Which is the closest to q? (a) y (b) 0.1 (c) -0.3 a Let q = 495 + -937. Let s = q + 443. Let c = 0.7 + 0.3. What is the closest to c in s, -1, 2? s Let s = -727 - -725. What is the closest to 1/6 in 3/7, s, 9? 3/7 Let f be (18/24)/((-99)/176). What is the closest to 0 in 1/8, f, 2, -1/4? 1/8 Let d be -1(-6)/2692/(-138). What is the nearest to 0 in 33, d, 4? d Let m = -7.3764 + -0.0236. Let q = 49.4 + m. Which is the closest to q? (a) 2 (b) -2 (c) 0 a Let o be (30/40)/(10/(800/15)). Which is the nearest to -0.2? (a) -29 (b) o (c) 2 c Suppose -5v = -5r + 2275, -r - 5v + 321 = -140. Let w = r - 2731/6. Let s be (-5)/(-2) - 2/(-4). Which is the closest to -0.1? (a) s (b) -0.05 (c) w b Let g = 0.9249 + 0.1121. Let f = 0.197 + -0.16. Let u = g - f. Which is the nearest to 1? (a) 4 (b) u (c) 2/7 b Let k = 239 + -238.6. Let t = -8.5 + 3.5. Which is the nearest to 1? (a) t (b) -0.5 (c) k c Let h = 6/1625 - -1613/3250. Which is the closest to 131? (a) 0 (b) h (c) 2 (d) -0.5 c Suppose -4j + 27 + 33 = 0. Let i be (-7)/j - 2/10. Let o = 78116/5 + -15624. Which is the nearest to i? (a) 4 (b) -0.5 (c) o c Let i = 327 + -329. Let v = -73/39 + 20/13. Which is the closest to v? (a) i (b) 0 (c) -1/3 (d) -7/9 c Let w be (-9)/((-9)/(-2))-1. What is the closest to w in -4, 1.6, 4? 1.6 Let h = -20475 + 20474.99. Let p = -0.2 - 0.1. Which is the nearest to -2? (a) -0.5 (b) p (c) h a Let t = -4.07 + 0.07. Suppose 267 = 12k + 219. Let w be (k + (-620)/150)5. What is the nearest to w in 2/7, t, 2? 2/7 Let s = -0.3 - -0.4. Let t = s + -2.1. Let q = -59576 - -59576.5. What is the nearest to 1/2 in q, -3, t? q Let u = 8.98 + -9.98. Let f = 261.5 + -245. Which is the closest to u? (a) -2 (b) 2/5 (c) f a Let m be (-20)/35(-2)/4. Let s = 1 - 1. Let j = 49710 - 49735. Which is the closest to s? (a) j (b) m (c) -2/3 b Let w be 13 + (1/(2/12))/(-2). Suppose 0 = -wx + 2x + 24. Suppose n + x = -2n. Which is the nearest to 2/7? (a) 9 (b) n (c) -4 b Let k(t) = -t3 + 3t + 2. Let i be k(-3). Let c = 0.98656 + 3.01344. What is the closest to i in -0.2, c, 0.1? c Let n = 1741 + -1777. What is the nearest to 2 in 0, 0.1, n? 0.1 Suppose 0 = -5r + 7r + 8t + 44, -2t = 10. Which is the closest to 29? (a) r (b) 0 (c) 1 c Let w = -249208/9 - -27690. Which is the nearest to -1? (a) -11/4 (b) -2 (c) w (d) -4 b Suppose 18s = 15s - 84. Let x be -5 + (3 - s/10). Let v(c) = c*3 - 4c*2 + 2c + 5. Let z be v(3). What is the nearest to -41 in z, 0, x? 0 Let j = 0.50266 + -0.00266. Which is the nearest to -4/13? (a) -0.5 (b) -5 (c) -1/3 (d) j c Let z = -228.8 - -229.1. Which is the nearest to 1? (a) 19 (b) -3 (c) z (d) -2 c Let n = -12005 - -12005. Which is the nearest to n? (a) 3 (b) 13/3 (c) 36 (d) 0.3 d Let p be (-3 - 28/(-12))18/(-114). Which is the closest to -7? (a) p (b) 3 (c) -22 a Let o be 10/15 + ((-120)/126)/1 + 0. What is the closest to o in 0.045, -3, 1/6, 3? 0.045 Let v = -115 - -131. Suppose l = -4u - v, -6l + u + 4 = -9l. Let r = -1.3 + 0.3. What is the nearest to r in -5, l, -4/7? -4/7 Let z = -4.95 - 0.05. Suppose -3t - 127 = v, -t + 85 = -3t - v. Let u = -72 - t. Which is the nearest to u? (a) -0.5 (b) z (c) 2 b Let w(y) = 30y - 129. Let z be w(6). Let f be 6/(-12) - z/(-78). Which is the closest to -3? (a) 0.5 (b) 3 (c) f c Let r be (-55)/14 + (-5)/(-10). Let v = -79/21 - r. Let h = -104 - -123. What is the closest to -1/2 in v, h, 2/11? v Let t = 10936.1 + -10936. Which is the nearest to -1? (a) 1/4 (b) t (c) -5 (d) 0.13 b Let a = 0.38 + 0.02. Let m = -972 + 1001. Let j be ((-2)/(-6))/(m - 28). What is the closest to 2/5 in 1, j, a? a Let u = 22697/390 - 583/10. Which is the closest to 0? (a) u (b) 1/4 (c) 4 (d) -5 a Let r(s) = -4s - 24. Let v be r(-1). Let a be 4/v - 0 - (-55)/150. What is the closest to 0.1 in 0.5, a, -5? a Let z(k) = -24k - 2. Let y be z(2). Let j be y/(-132) + (11/6)/11. Let n = -2.24 + -1.76. Which is the nearest to j? (a) 1/4 (b) n (c) -1/10 a Let g be -6121/77 - -9. What is the nearest to 9 in -0.2, -0.1, g? -0.1 Let c = -33 - -133/4. Let m = 28022.9 - 28023. What is the closest to -2/3 in -1/4, m, c? -1/4 Let z be (-1)/(-4) + 21 + (-83)/4. Let p be ((-14)/(-28))/(1/(-2)). What is the closest to 0.01 in 3, z, p? z Let y = 4078 + -4079. Which is the nearest to -1792? (a) -0.5 (b) y (c) 0.5 b Let j be 3111/(-915) + 38/10. What is the closest to -0.7 in j, 0.5, -2/3? -2/3 Let q = 76883.6 + -76884. Let n be 4/18(-3)/(-2). Which is the closest to n? (a) q (b) 1 (c) -3/5 b Let m be ((-49)/(-42))/(((-25)/10)/(-5)). What is the closest to 2 in 2, m, 1.1? 2 Let g = -107.27 - -102.2. Let y = -4.06 - g. Which is the nearest to 1? (a) -0.2 (b) y (c) -0.5 b Let f = 1.8635 - -0.1695. Let n = f + -0.033. What is the closest to -11 in -0.4, 1/8, n? -0.4 Let v = 6947 - 6946. What is the nearest to v in 7.2, -4, -5? -4 Let s = 0.541 - 0.251. Let h = s - 21.29. Which is the closest to -2? (a) -0.2 (b) h (c) 1 a Let f be ((-3)/9 - 2/(-3))/(62/93). Which is the nearest to 5.34? (a) f (b) 1/3 (c) 1/4 a Let z = -45/1178 - 319/7068. What is the nearest to 1/4 in -2/13, -18/7, z, 0? 0 Let l = 0.2 + -0.7. Let g = 2716 + -5433/2. Let a be ((-1)/12)/((-2)/9). What is the nearest to g in l, a, -4? l Let z be (-2)/10 + 12/1884/(-20). Let t = 1.8 + -2.9. Which is the closest to -2? (a) z (b) 3 (c) t c Let s = -2324 + 2323.6. What is the closest to 2/7 in 0.1, 0.03, 2/7, s? 2/7 Let z be -4 + 41/2. Suppose -3t = -6t - 4v - 8, -5t - 5 = 5v. Let k be 22/(-28) + (-6)/(-21). What is the closest to 0.1 in t, k, z? k Let s = 2/37 + 31/111. Suppose -35 + 5 = -5c. Let a be 15/36c/(-20). What is the closest to 1 in s, a, 0.13? s Let j(i) = i*3 + 19i*2 + 17i + 10. Let y be j(-18). Let b(m) = 10 + y - 12 + 19 - 3m. Let x be b(14). What is the nearest to 0 in 2/9, 0, x? 0 Let s = 15 - 15. Suppose -101i + 2i = -99. Which is the nearest to s? (a) 8/9 (b) -4/7 (c) i (d) 0.5 d Let o = 2043.6 - 2043.2. What is the nearest to 1/2 in -12/11, o, -96? o Let d be (-32)/10 - 1053/(-351). Suppose 0 = -2w + w + 1. Let f be 85/25 - 3*w. W	{ "pile_set_name": "DM Mathematics" }
t. What is the remainder when a is divided by 26? 23 Suppose -2j - 4 = -14. Let m be 5/(10/2)j. What is the remainder when 86 is divided by (69/15)/(1/m)? 17 Let d be (-7)/(-2) + 7/(-14). Suppose -67 = do + 4p, 3o = 3p + p - 107. Let q = 6 - o. What is the remainder when 102 is divided by q? 32 Suppose 2u = 5a + 32, 0u + 18 = u - 3a. Suppose uz - 2506 = -z. Calculate the remainder when z is divided by 40. 38 Suppose n = -2l + 3n + 162, -5n = 3l - 283. What is the remainder when 162 is divided by l? 76 Let p(t) = -t2 + 5t + 2. Let l(d) = 45d - 8. Let g be l(1). Suppose 4m + g = q, -5q - 4m + 235 - 26 = 0. What is the remainder when q is divided by p(4)? 5 What is the remainder when 575 is divided by (10/7512)/(286/(-290) + 1)? 111 Let p(b) = 1391b*2 + 13b. Let x be p(1). Suppose x + 656 = 10z. Calculate the remainder when z is divided by 9. 8 Suppose 3y = 3h - 0h + 18, 3h + 20 = 4y. Suppose -3k + 4k = y. Calculate the remainder when 26 is divided by (-39)/(-13) + 3k. 8 Calculate the remainder when 560/6 + 2(-38)/57 is divided by 17. 7 Suppose -46y - 1159 + 2539 = 0. Calculate the remainder when 896 is divided by y. 26 Let i = 2903 - 2523. Calculate the remainder when i is divided by 73. 15 Let b be ((1 - -2) + 1)/(98/49098). Suppose 6z - b = -6z. Calculate the remainder when z is divided by 8. 7 Let h = -604 - -629. Suppose 789 - 164 = hn. Let p(c) = 2c2 - 3c - 1. What is the remainder when n is divided by p(-2)? 12 Let z(f) = -5f2 + 4f + 6. Let d be z(2). Calculate the remainder when 43 is divided by (-63)/d80/70. 7 Suppose 474 = -22i + 19i. Let d = -113 - i. Suppose -10 = 5o - h - d, -5o - 2h = -50. What is the remainder when 22 is divided by o? 6 Let b = 170 - 153. Suppose -g = -5s, -bs = g - 18s - 12. What is the remainder when 44 is divided by g? 14 Let x(m) = 3 + m2 - 2m - 8m + 13. Let v be x(8). Suppose -39z + 37z + 122 = v. Calculate the remainder when z is divided by 21. 19 Suppose 138u - 449 = 61u + 244. Let s be -3(10/(-6) + 1). Suppose -3c = 3m - 81, -5m - 54 = -sc - m. What is the remainder when c is divided by u? 0 Suppose -2p + 1 - 3 = 0, 5a - 212 = 2p. Let x = a - 1. Suppose 0 = 3q - 33 - 9. What is the remainder when x is divided by q? 13 Let f(h) = -h*3 - 3h*2 + 3h - 4. Let c be f(-4). Suppose -q + 17 = -c. Calculate the remainder when q is divided by 11. 6 Suppose 13o = -9o + 154. Let v(w) = w*3 - 4w*2 - 19w + 52. Calculate the remainder when v(o) is divided by 25. 16 Let x(k) = 1136k + 1997. What is the remainder when x(3) is divided by 106? 105 Let d be 117/(-195) - 1396/(-10). Suppose d - 571 = -18w. Calculate the remainder when 157 is divided by w. 13 Suppose -34n + 33n + 9 = 0. Suppose -3u + n = -6. Calculate the remainder when 37 is divided by (-2)/u(-56 - -6). 17 Suppose 5j + 137 = -3b, -2 = 5b - 7. Let k = j + 48. Let z = -12 + k. Calculate the remainder when 45 is divided by z. 5 Let j(c) = 7c + 80. Let v be j(-11). Suppose -3o - 96 = -5b, 5b - 48 = 2b - vo. What is the remainder when 65 is divided by b? 11 Calculate the remainder when 694 is divided by ((-12)/(-12) + (-1 - 1))/(38/(-646)). 14 Suppose 0 = -4t + r + 613, 60r + 493 = 3t + 64r. Calculate the remainder when 1213 is divided by t. 128 Suppose 0 = -2m + 32 + 16. Let t be (4 - 1) + (-2 - 54). Let c = -11 - t. What is the remainder when c is divided by m? 18 Let j(g) = 2g3 - 13g*2 + 7g - 4. Let w be j(6). What is the remainder when (w/(-5))/((-3864)/350 - -11) is divided by 7? 3 Let k(s) = -s*3 - 121s*2 - 246s - 901. Suppose -i + 5490 = 4c + i, 5i = -3c + 4107. Calculate the remainder when c is divided by k(-119). 48 Suppose -40b + 7371 = -11789. What is the remainder when 1916 is divided by b? 0 Let h(t) = 7t2 - 17t + 66. Let i be h(8). Let r = 435 - i. Calculate the remainder when 455 is divided by r. 56 Let s = 38 + 0. What is the remainder when (-2)/(-49) - 1584072/(-14406) is divided by s? 34 Suppose 14w - 9w - 139 = 4j, -32 = 2w + 13j. What is the remainder when 772 is divided by w? 13 Suppose -3g - w + 0w + 546 = 0, 0 = w. Suppose 0 = 2s - 4r - 102, 2r - 140 = -5s + 91. Calculate the remainder when g is divided by s. 41 Suppose -161 = -5k - 6. Let f = 271 + -133. What is the remainder when f is divided by k? 14 Let j(y) = 108y + 3644. Calculate the remainder when j(-31) is divided by 24. 8 Suppose 3l + 6 = 3t - 9, t - 6 = 2l. Calculate the remainder when (-1 - 3 - 0)l + 170 is divided by 7. 6 What is the remainder when 1 + 14/(-8) - (5097/(-12) + -4) is divided by 13? 12 Let h(m) = m3 + 32m*2 - 14m + 116. What is the remainder when h(-32) is divided by 192? 180 Let o(l) = 815l2 - 45l - 85. What is the remainder when o(-2) is divided by 27? 25 Let w(c) = -12c - 76. Let g(n) = 12n + 76. Let x(l) = -3g(l) - 4w(l). What is the remainder when 49 is divided by x(-6)? 1 Let f be 9/6 + (-1)/2. Let y be (8 - 7)/(f/(-25)). Calculate the remainder when 79 is divided by 4/(-3)(y - -13). 15 Calculate the remainder when 429/(-33) - 9626/(-2) is divided by 98. 96 Let j(h) = 2h*2 + 9h - 1. Let m = 78 + -83. Suppose -4n + 0r + 3r + 8 = 0, 5n - 10 = 3r. What is the remainder when j(m) is divided by n? 0 Let a(y) = y3 + 2y*2 + 18y + 127. Let t be a(-5). Calculate the remainder when 569 is divided by t((-14)/7 + 1/2). 56 Let r be (1004/16)/((-4)/(-16)). Let f = r - 241. Calculate the remainder when 186 is divided by f. 6 Let z(j) = 102j*2 - 45j + 19. Calculate the remainder when z(9) is divided by 14. 8 Suppose 13g - 11002 = -2617. Calculate the remainder when 49 is divided by g/135 - 4/(-18). 4 Let u(y) = 357y - 193. Let z be u(3). Suppose 4j + 406 = z. What is the remainder when j is divided by 5? 3 Let o = 3408 + 229. What is the remainder when o is divided by 104? 101 Let z(n) = -n3 + 11n*2 - 8n - 13. Let d be z(10). Suppose 13 = 2g - 5o, -2o = -4g - 0 + 18. Calculate the remainder when g is divided by d/(21/6) + 1. 1 Suppose 2t - 4x - 114 = -6x, -t = 3x - 57. Let r = 1172 + -1192. Let d = t + r. What is the remainder when d is divided by 11? 4 Let j(n) = 12n + 101. Let m(l) = 25l + 202. Let g(d) = -11j(d) + 6m(d). Calculate the remainder when 274 is divided by g(-5). 10 Suppose 401 = 26o - 299 + 154. What is the remainder when 211 is divided by o? 1 Suppose 14y = -y - 28y + 86. Let f(j) = -2j*3 - 4j*2 - j + 1. What is the remainder when f(-3) is divided by y? 0 Let q(k) = 3k + 116. Suppose 55n - 57n = 0. Let z(g) = -g*2 + 77. Calculate the remainder when z(n) is divided by q(-32). 17 Let l(u) = 2u*3 + 12u*2 + 5u - 4. Let z be (-17 - 2) + (3 - -2). Let p be 2/z + (-136)/28. Calculate the remainder when l(p) is divided by 14. 7 Let z(i) = -27i - 1. Let b(h) = -80h - 3. Let g(c) = 6b(c) - 17z(c). What is the remainder when g(-1) is divided by 7? 6 Suppose -4w - 2w + 72 = 0. Let k(o) = o - 3. Let y be k(w). What is the remainder when 488/y - 24/108 is divided by 14? 12 Let o = -15 - -43. Calculate the remainder when ((-2)/(-10))/(3/(-9)75/(-8375)) is divided by o. 11 Let t be 3/(-24) + 46467/216. Let g = -120 + t. What is the remainder when g is divided by 14? 11 Suppose 272 - 13 = 7j. Let g(y) = 2y2 - 5y - 7. Let b be g(6). Let p = b - 25. Calculate the remainder when j is divided by p. 7 Calculate the remainder when 36 is divided by -316/(480/(-170)). 2 What is the remainder when 189 is divided by (0 + (-1)/2)1 - (-112893)/726? 34 Let w(j) = -5j - 25. Let c be w(-5). Suppose -p - 4p + 50 = c. Let t(s) = 2s2 - 16s - 7. Calculate the remainder when t(p) is divided by 12. 9 Let j(x) = 5x2 - 4x - 7. Let p be j(-2). Suppose pw - 17w = 924. Calculate the remainder when w is divided by 58. 57 Let f(b) = 330b - 5777. What is the remainder when f(23) is divided by 28? 21 Suppose -4t - k - 12 = 0, -30t + 2k = -28t + 16. What is the remainder when 2(-5 + 203 - t)/4 is divided by 17? 16 Calculate the remainder when 1515 is divided by (-1736500)/(-12500) - (-4)/50. 125 Suppose -115r + 92r = -598. Calculate the remainder when 117 is divided by r. 13 Let i(h) = -h*2 + 92h - 12. Let z be i(29). Suppose 0 = 19f - 4f - z. Calculate the remai	{ "pile_set_name": "DM Mathematics" }
3 - 256i + 256i)(-1 - 3 + 3)(0 - 3 + 0)(-2i + 1 - 1). -588i*4 Expand (6 - 31 - 16)(2b2 - 3b*2 + 21b*4 + 3b*2). -861b*4 - 82b*2 Expand 4k*4 + 2k*4 - 3k*4 + (2k*3 + 3k3 - k3)(2k - k - 3k + (3 - 1 + 0)(0 + 0 - 2k) + 0k + k - 2k - 79 - 4k + 79). -41k4 Expand (2r - r + 0r)(1 + 2r - 1) - 2r*2 + 4r*2 + 3r2 + r2 + 6r - 6r + (-3 + 3 - 2r)(2 - 2r + 3 + 3r). 6r2 - 10r Expand -5t5 - 12t*5 + 9t*5 + (2t*3 + 2t*3 - 3t*3)(0t2 + 5t*2 - 3t*2) - 9t*5 + 8 - 8. -15t*5 Expand (-6 - 2p + 5p - 2p)(-4p*4 - 4p + 4p + (3p*3 - 2p + 2p)(3p + p - 8p)). -16p5 + 96p*4 Expand (-7o*2 - 19o + 19o)(-35o3 + 73o*3 + 76o*3). -798o*5 Expand (-2r*2 + 3r - 3r)(-32r + 3r - 24r). 106r*3 Expand -1963q*3 + 1963q*3 + 118q*5 + (-4q2 - q4 + 2q2 - q4)(-1 + 1 + q). 116q5 - 2q*3 Expand -139g*5 - 245g*5 + 185g*5 + (3g4 + g4 - 6g4)(2g + 0g + 0g). -203g5 Expand (w3 + 3w2 - 3w*2)(3w + 0w + 965 - 962) + 3w4 - w4 + 0w*4. 5w*4 + 3w*3 Expand (-3w*2 + 2w*2 + 0w*2)(-1 + 5 - 3)((1 - 1 + 2)(2 - 2 - 2) - 2 + 10 + 1). -5w2 Expand (-292 + 89 - 120 + 2w)(0 + 0 + 3). 6w - 969 Expand 0u - 3u - u + (-1 + 0 + 3)(-4u - u + 3u) + 7u - 38u + 8u. -31u Expand (y5 + y - y)(-1 + 3 - 4) + (-y + y + 402y2 + 943y*2)(-2y3 - y3 + y3). -2692y*5 Expand (-2 + 3 - 3)(3 - 2s - 3 + (4 + 0 - 5)(-7s + 20s + 45s) + 1 - 1 + 2s). 116s Expand (-23o + 15o + 23o)(8 - 6 + 8o*4 + 4o*4). 180o*5 + 30o Expand (-4h + 0h + 6h)(-h*3 + 2h*3 + 0h*3) + 34h*2 + 3h*4 - 6h*2 - 6h*2. 5h*4 + 22h*2 Expand (0 + 2 - 1)(-1 - 4 + 2)(-b4 + b4 + 3b*4) + 0b4 + b4 - 2b4 + (0b*2 - 2b*2 + 0b*2)(-4b2 + 2b2 + b2). -8b4 Expand (-5 + 4 - 7)(-1926p + 1 + 1931p + 2). -40p - 24 Expand (v - 2v - v)(2v - 3 + 3) + 1 + 141v2 + 65v*2 - 644v + 647v. 202v*2 + 3v + 1 Expand -2j2 + 6j - 6j + (7j - 2j + j)(-3j + 3j + j + 2). 4j2 + 12j Expand -90 + 90 - 42f2 + (0f*2 + 3f*2 + 0f*2)(7 - 4 - 1) - 2f2 + 3f*2 - 3f*2. -38f*2 Expand (-1 + 0 + 0)(4u2 - 4u*2 - 2u*3) + 0u*3 + 2u*3 - 3u*3 + (3 - 4 + 2)(-142u3 + 3u*3 - 33u*3). -171u*3 Expand (1 + 0 + 1)(4 - 4 + 1)(0 + 0 + 3y + (-7 - 2 - 3)(3y - y - 3y))(0y - 2y + 0y). -60y*2 Expand 44f*4 + 2662f*3 - 2662f*3 - 2 + (0f*2 - 2f*2 - 6f*2)(3 - 3 + 2f2). 28f*4 - 2 Expand (19p - 61 + 61 + (0 - 2 + 0)(4p - p - 2p))(p + 0p + p). 34p*2 Expand (-11k*2 + 5k*2 - 13k*2)(8 + 4k - 8). -76k*3 Expand (0s + 6s - 5s)(104 + 98 - 398 + 99 + 102). 5s Expand (4 - 4 + 3v)(-2v2 - 2v + 2v + (37 - 7 + 4)(-v*2 + 2v*2 - 2v*2)(4 - 1 - 4)). 96v3 Expand 5w*3 + 1 + 26w*2 - 27w*2 - 3 + (2w2 - w2 - 3w2)(-3w + 12w + w). -15w3 - w2 - 2 Expand (3g*2 + 0g2 + g2)(2g2 + g2 - 6g2) + 2g*4 + 0g*4 + 0g*4. -10g*4 Expand -58u + 118u - 41 - 58u + u*2 + (0 + 6 - 3)(u*2 - 4u2 + u2). -5u2 + 2u - 41 Expand (-4 - 1 + 3)(165263k - 165263k + 748k*3). -1496k*3 Expand (2u + 2u - 3u)(-8u*4 + 218u*4 + 38u*4). 248u*5 Expand (-3 - 4 - 3)(v + 20 - 20)(3 - 5 + 4). -20v Expand 0l + 3l - 2l + (1 + 2 - 1)(-6l + 4l + l) + 0l + 4l - 6l + 2l + 20l - 4l + (5 - 3 - 3)(3l + 3l - 5l). 14l Expand (138l - 3 - 53l - 54l)(-2 + 2 - 2l). -62l2 + 6l Expand (-11 - 1 + 5w - 11w)(3w - 4w + 2w)(4 + 1 - 4). -6w*2 - 12w Expand (-265 - 36j + 21j + 17j)(0 + 0 - 2j2). -4j*3 + 530j*2 Expand (-2f*2 - 9f*3 + 13f3 + f2)(-49f - 14f - 14f). -308f4 + 77f*3 Expand (-1 + 6 - 2)(-4r + r + r) - 9r - 15 + 15 - 3r - 4r + 6r. -16r Expand (g - g - g*2)(2 - 2 - g3) - g5 - g*5 + 4g*5 - 6329g + 6329g + 53g*5. 56g*5 Expand (-6w*5 + 0w*5 + 4w*5)(-6 + 0 - 2 - 1 - 1 + 0 + (3 - 2 - 2)(1 - 1 - 1)). 18w*5 Expand 0g*2 + 3g*2 + 0g*2 + (-2g + 0g + 3g)(-g - 1 + 1) + (3 + 2 - 8)(2g - g2 - 2g). 5g2 Expand 2c2 + c2 - 5c2 + (2c + 3c - 4c)(0c + 0c - 2c) + 18c2 - 87 + 87. 14c*2 Expand (-3r + 2r + 3r)(5 - 3 + 1)(0 - 2 + 0)(6 + r - 6)(0r2 - 2r*2 + 0r*2). 24r*4 Expand 0a*2 - 5a*2 + 2a*2 + (-3a + 3a - a)(-2a + 0 + 0) + (-5 + 1 + 1)(7a2 + 16a*2 + 4a*2). -82a*2 Expand (l + 2 - 2)(-8l3 + 11l3 + l2 - 4l2) - 1 - 7l*2 + 13l*2 - 8l*2 - 2l4. l4 - 3l3 - 2l*2 - 1 Expand (4d*4 + 0d*4 - 2d*4)((4 + 2 - 4)(-1 - 1 + 4) - 1 - 3 + 3 - 12 - 18 - 52). -158d*4 Expand (4z2 - z4 - 4z2)(-22z + 6z + 30z) + 5z*5 - 25z*3 + 25z*3. -9z*5 Expand (-16k - 4k - 5k)(3k*3 + 4k*3 - 2k + 3k). -175k*4 - 25k*2 Expand (-1 + 1 + l)(-2l2 + 5l*3 - 857 + 423 + 425). 5l*4 - 2l*3 - 9l Expand 3j5 + 4j*5 - 2j*5 + (-2j3 + j4 + 2j3)(j + 0 + 0) + 2 - 2 - 2j5 + (j3 + 0j3 + j3)(-21011 + 21011 - 102j*2). -200j*5 Expand 3 - 2j3 - 3 - j3 - j3 - j3 + (-2 - j*3 + 2)(-2 - 1 + 5) + j*3 - 6j*3 - 14j*3 - 4j*3 + 2j*3 + 3j*3. -25j*3 Expand (-4s*3 + 2s*3 + 0s*3)((2s + 2s - 2s)(0 + 0 + 1) - 2s + 4s - 3s + 0s - 5s + 2s)(0 + 0 + 2s)(-5 + 3 + 7). 40s5 Expand (4 - 4 + 2 - s2)(0 - s2 + 0)(-32s + 139 - 139). -32s*5 + 64s*3 Expand (3g + 5g2 - 3g)(-5 - 13g + 8 + 16g). 15g*3 + 15g*2 Expand -5n3 + n3 + 6n3 + (4 + 7 - 3)(0n2 + n3 + n2 - 2n*2). 10n*3 - 8n*2 Expand (48z*5 - 79z*5 - 25z*5)(-4 - 4 - 4). 672z5 Expand (5p - 4p - 1 + 5)(p - 2 + 2)(-6 - 4 - 4). -14p*2 - 56p Expand 0k2 + 3k2 - k2 - k*2 + 0k + 0k + (-2k + 6k - 2k)(-k - k + 0k) + 2k2 - 6k*2 + 2k*2 - 4041k + 2019k + 1802k + k*2. -4k*2 - 220k Expand -w + 4w4 - 6w*3 + 6w*3 + (-23w*3 - 35w*2 + 35w*2)(w - 2 + 2). -19w4 - w Expand -4b5 - b5 - b*4 + 6b*5 + (-6 - 1 + 5)(5b5 - 37 + 37) + 4b*3 - 4b*3 - 4b*5. -13b5 - b4 Expand (-3r3 + 4r*3 - 2r*3)(0 - 7 + 1)(-5 + 3 + 3) + (0 - 1 + 2)(r2 - r2 + r*3) - 2r*3 - 2r + 2r. 5r*3 Expand (-3a*2 + 4a2 + a2)(-608 + 299 - 716a + 307 - 267a). -1966a*3 - 4a*2 Expand (-6 + 1 + 3)(5c - 10c + c)(4c4 + c2 + 3c4 - c4) - c5 + 0c + 0c + (c2 + 0 + 0)(-5 - 2c3 + 5). 45c*5 + 8c*3 Expand (-5l - 3l + 3l)(l + 4l - l) - 2l + 2l + 4l2 + l2 + l2 + 0l*2. -14l*2 Expand (-2c*2 - 4 + 4)(0c2 + c2 - 2c*2) - 14c*4 - 12c*4 + 8c*4. -16c*4 Expand (2787 - 23r - 2787)(3r - 3r - r - 6). 23r*2 + 138r Expand (-255 + 11u + 255)(6u - 3u - u) - 11u2 - 16 + 16. 11u*2 Expand (-103r + 257r + 117r)(0r*2 - 5r*2 + 4r*2). -271r*3 Expand (3a - 3a - 2a)(2a*2 + 0a*2 - 5a*2 - 2). 6a*3 + 4a Expand (1463 + 564 + 1462 + 186)(0a + 0a - a2). -3675a*2 Expand (-1 + 0 + 2 + (5 - 1 - 3)(3 + 1 - 2) - 4 - 1 + 6 - 16 + 6 - 12)(-22t*4 - 1 + 10t*4 + 10t*4). 36t*4 + 18 Expand 4u*4 - 2u*2 + 2u*2 + (-u + u - 2u*2)(5u2 - u2 - 2u*2) + (-u + u + u)(2u3 + 0 + 0) + 153u*4 - 321u*3 + 321u*3. 155u*4 Expand (13 - 37 + 15)(-k - 2k + 4k). -9k Expand (-y2 + 3y2 + y2)(63y + 135y + 138y). 1008y3 Expand (-40l + 48 - 48)(3 + 1 - 2)(-2l2 - 2l*2 + 3l*2). 80l*3 Expand -35l*3 + 71 - 71 + (l - 4l + 7l)(2l2 + 4l*2 - 3l*2). -23l*3 Expand -88s*4 + 31s*4 + 28s*4 + (-2 + 5 - 1)(0s4 + s4 + s4) - 1 - 2s*4 + 1. -27s*4 Expand (-3n - n*3 + 3n)(-3 + 3 + 2n*2) + 2n*4 - 2n*4 - 2n*5 + 2n*5 + 244n + 3n3 - 244n. -2n5 + 3n3 Expand (10 - i3 - 10)(10 - 5 + 9)(-2i + 5i + 0i). -42i*4 Expand (2 - 5 - 7 + (-4 + 2 + 0)(-4 + 0 + 3) - 1 - 1 + 0 + 1 - 2 + 0)(-4 + 0 + 0)(-5y + 0y + 3y). -88y Expand (9v3 - 2v*3 - 2v*3)(-5v2 + 5v*2 - 5v*2) - 3v*5 + 2v*5 + 0v*5 + (2v*2 - 2 + 2)(-v*3 - 4v*3 + 4v*3). -28v*5 Expand (38c5 + c2 - 15c5 - 24c*5)(-2 + 9 + 0). -7c5 + 7c*2 Expand (-2x*2 + 4x*2 + 0x*2)(-48x + 49x + 105x + 29x). 270x3 Expand (-4o - 52	{ "pile_set_name": "DM Mathematics" }
pose -2m + 0m = -60. Let r be 7/(-25) + (-6)/m. Let s = r + 134/175. Are s and 1 equal? False Let l(d) = d*3 + 7d*2 - d - 7. Let n be l(-7). Is n less than or equal to -10? False Let j = -10 + 14. Suppose -6 - 2 = -ji. Which is bigger: i or 3? 3 Let x = -5 + -4. Let k be ((-3)/x)/(1/1). Suppose 1 = -m + 3. Is m at most as big as k? False Let s = 0.7 - 0.61. Which is greater: s or -0.7? s Suppose 3x - x = 4. Is x at most 1? False Let w be ((-126)/(-12))/(-7)16/150. Which is smaller: -0.1 or w? w Let b be 57(-10)/(-15) - 3. Which is greater: 34 or b? b Let u = -0.8 - 0.2. Which is greater: 1 or u? 1 Let i = 1.09 - 0.09. Let b(t) = t - 1. Let n be b(3). Suppose -4o = -0o - 4s - 12, -3s = -no + 10. Is o != i? True Suppose 0f - 5f = -5. Is f at most as big as -12/5? False Let t = -39 - -50. Is 10 at least as big as t? False Let m be (-11)/22 - 2/4. Is -1/2 at least m? True Let t be (-4)/(-14) - 0/2. Suppose -4w + 24 = -0w. Suppose 5y - 10 = 4i, 0 = -3i + 4y - 2 - w. Is i equal to t? False Let v be (-4)/(-8) + (-1427)/2037. Let u = v + -4/291. Let b = -1/28 + u. Which is bigger: b or 1? 1 Let w(q) = q*2 - 12q - 15 - 33q + 58q. Let u be w(-13). Which is smaller: u or -16? -16 Let o = 183/4 - 46. Are -1/4 and o unequal? False Let d = -0.3 - -4.3. Let r = 2 - d. Which is smaller: 2/5 or r? r Suppose 5d = c - 14, c = 4d - 2c + 20. Let o = 3 - d. Which is greater: 6 or o? 6 Suppose 4k + 4 = 36. Suppose 3 = 5y + k. Let i be ((-1)/18)/((-2)/8). Which is smaller: i or y? y Suppose 4i + 8 = 24. Let r(n) = -5n2 + 5. Let k be r(i). Let g = k - -305/4. Which is smaller: 0 or g? 0 Let q(b) = -b - 10. Let z = 17 - 28. Let l be q(z). Is 1 less than or equal to l? True Let s(y) = y3 + 16y*2 - 2y - 17. Let w be s(-16). Let v be -3 + 4 - 19/w. Is v bigger than 0? False Let o = 85 - 763/9. Let k = -1 + 2. Let j be k - -1 - (-2)/(-2). Is j < o? False Suppose 0 = 9m - 4m - 65. Let w be (-3)/1 + m/5. Is w at least -7? True Let v = -0.34 + 0.3. Let u = v - -0.34. Let m = -0.7 - u. Which is greater: m or -3? m Let q(m) = -m*3 - 4m*2 - 4m + 4. Let w be q(-4). Suppose w = 3y + y. Suppose -4t - 22 = -3r, 0t + yt = -r - 18. Which is greater: r or 0? r Let n = 0 + -2. Let w = n + 3. Which is smaller: w or 2? w Let m = -47/2 - -23. Suppose -3f + 3 + 1 = 4y, -3y = -3f + 18. Which is smaller: y or m? y Let y be ((-1)/2)/((-8)/(-16)). Are -5/4 and y non-equal? True Let g(c) = -c + 5. Let x(y) = -2y - 11. Let w be x(-8). Suppose 6 = -wk + 31. Let j be g(k). Which is smaller: -0.1 or j? -0.1 Let u = 8/3 - 53/21. Let l(s) = 4s - 3. Let w be l(3). Let y = 10 - w. Does u = y? False Let r = -20.976 + -0.024. Let q = r + 29. Which is greater: q or 0.1? q Let z = -133 + 126. Suppose 12 = 7b - 3b, 2b + 26 = -4r. Which is smaller: z or r? r Let a(b) be the second derivative of b4/12 + b3/2 - 9b2/2 - 3b. Let o be a(-5). Is 1/9 smaller than o? True Let i be 2 + 9/(-3) + 1. Let c be (1/(i + -1))/1. Let p be 7 + 3/c + 1. Is 6 >= p? True Suppose 7 = 5z - 4w + 2, -2z = -w - 5. Suppose -u + 10 = u. Are u and z equal? True Let z be 4 - 6/((-6)/(-2)). Suppose n - zn = -3. Let m(j) = j*3 - 4j*2 + 2j + 3. Let c be m(n). Do c and 1/4 have the same value? False Suppose 1 = b - 2. Let m = -4 + 0. Let j = m + 6. Is b less than or equal to j? False Let o = 5.4 + -6. Suppose -y + 24 - 5 = 0. Suppose -yk = -17k + 2. Is k < o? True Let x = 333 + -3672/11. Is 0 < x? False Suppose 5m = -2x, 0 = -0x - 3x - 4m. Suppose 4p + 1 - 5 = x. Is p equal to 1/3? False Let j(i) = -i. Let s be j(-1). Let t be s/(38/70) - 2. Let h = t + -29/57. Are h and 0 nonequal? True Suppose 2l - 4 = -0. Suppose 0 = 6v - 9 + 3. Is v not equal to l? True Let b(x) be the third derivative of -x*4/24 - 5x*3/6 + 2x*2. Let d be b(-8). Suppose 1 + 0 = -4n - l, 3 = -dl. Which is smaller: n or 1? n Let c = -4 - -7. Let x = -0.12 - -5.12. Let y = c - x. Which is bigger: -1/4 or y? -1/4 Let c be (3 - 0) + (-3)/(-3). Let g be (c + -2)/(2/4). Which is smaller: g or -2/7? -2/7 Suppose 0g = -2g + 32. Suppose 31 = 2a - 3w + 11, 2a = 2w + g. Are a and 5 non-equal? True Let u = -42.6 - -48. Let y = u - 5. Let d = -8 + 9. Are y and d unequal? True Let t(r) = -5r - 10. Let w(y) = -y - 1. Let k(q) = -t(q) + 4w(q). Let b be k(-4). Suppose 6 = -bn + 4. Which is bigger: 0 or n? 0 Let y(n) = -n*2 - 4n - 4. Let c be y(-3). Suppose 15 = -5b, h = -b - b - 4. Let a be h - (c + 3)/2. Which is bigger: a or 1/3? a Let m = 517/1790 + 2/179. Let f = 6/5 + m. Is -0.1 > f? False Let r be 68/((-16)/3). Are -9 and r unequal? False Let y = -0.19 - -0.17. Let w = 0.02 + y. Is w at most as big as -8/7? False Let d = 152 + -157. Which is smaller: d or -32/7? d Suppose v - 4 = 5v. Let u = 1234/1143 + 4/127. Let r = 188/153 - u. Which is smaller: v or r? v Let r = 64/33 + -14/11. Which is smaller: -2/3 or r? -2/3 Suppose 0 = -7d + 2d + 45. Suppose -23 = 4u - 5z, -4u + u - d = -z. Let l be -1 - 1(-2)/10. Is l at least u? True Let p = -8 - -5. Let x be (p/14)/(6/12). Are 1 and x equal? False Let u = -6537/304 + 1/304. Let j = 22 + u. Let y be (-1)/(-3)(-3)/(-12). Which is smaller: y or j? y Suppose -2h - 20 = -7h. Is 0 >= h? False Suppose -8q - 105 = -11q. Is 33 greater than or equal to q? False Let w be (-2)/(-8) + 4475/20. Let c be w/522 - (-4)/(-18). Let h = 57/145 + c. Which is bigger: 1 or h? 1 Let d = 0.63 - -5.37. Which is greater: 1/9 or d? d Suppose 1 + 2 = -r. Suppose -9 - 19 = -4f. Let c = 6 - f. Which is smaller: c or r? r Let v = -1014 - -41577/41. Is v bigger than 1? False Suppose 52 = 4c + 5n, 24 = 2c - 2n + 4n. Let f = -8 + c. Are f and -2/7 non-equal? True Suppose 7 - 3 = s. Suppose 0 = 3t - 2g - 6 + 2, -sg = -16. Suppose -tm = -2m. Which is greater: 1 or m? 1 Let c(k) = 2k*2 - 4k - 2. Let y be c(4). Which is smaller: y or 12? 12 Let m be (68/(-8) - -4)(4 + 0). Which is smaller: m or -5? m Let r = -13.5 - -12. Let l = r + 1.4. Which is smaller: l or 1? l Let n = 4 + -3. Let f = 0 - -1. Is f equal to n? True Let c(f) = f2 - 2f + 2. Let n be c(2). Suppose j = -n, 0 = -p + 3j + 18 - 1. Suppose 4o = 3o + 3, 5o - p = -4t. Which is smaller: t or -2? -2 Let v = -84 - -250/3. Suppose 0 = 5a - 0b + 3b, -2b = 2a. Which is bigger: a or v? a Suppose 0 + 9 = 3m - 3f, 0 = -2f - 4. Which is greater: m or 3? 3 Suppose 3j = 5n - 25, 4n + 17 = -9j + 4j. Let y(z) = -z*3 + 6z*2 - 5z - 5. Let s be y(5). Are j and s equal? True Let v be (-2)/9 + 820/45. Is 18 >= v? True Suppose 0 = -3m + 7m + 24. Suppose 0 = -o - o + 8. Let s = o + m. Is -1/4 >= s? True Let u = 4 - 0. Suppose a - 4a = 0, 4g - ua = 4. Is 1/2 <= g? True Let d = 4 + -2. Let g(s) = s3 + 2s*2 - s. Let b be g(-2). Let i = b - d. Is 0 bigger than i? False Let a(d) = d + 14. Let g be a(-6). Suppose -l - 14 = n - 5n, g = -2l - 2n. Let q(v) = -v*2 - 7v - 5. Let y be q(l). Do -1 and y have the same value? False Let h be -2 + 1 + 3 + -2. Let p(r) = -r*2 + 4r + 1. Let x be p(3). Suppose -5z = 3t + 12, ht = -3z + xt + 16. Is z less than 0? False Let z be (-6)/8(-4)/(-12)-9. Which is bigger: 2 or z? z Let r be 7064/44 - (-18)/(-33). Is r at most 159? False Let b = 0 - 0.3. Let c(f) = f2 + 2f + 25. Let y be c(0). Suppose 10 = -k - k, 0 = 5m - 5k - y. Is m > b? True Let w = -37 - -37. Is 0.1 greater than or equal to w? True Suppose 9v - 5v - 120 = 0. Let j be 8/20v/(-2). Which is bigger: j or -5? -5 Let w be (181/(-2))/(-12). Let d = 46 - w. Let a = 2 - 0. Which is smaller: a or d? d Let l be 21-2 + 9/12-4. Is -45 greater than or equal to l? True Let g be (2 + -1)(-3 + 1). Let t = 0 - -2. Let u = t + -3. Is u greater than g? True Let q be 26/4 - 3. Which is smaller: -2 or q? -2 Let f = -39 - -39.17. Let x = -21.07 + 21. Let c = f + x. Which is smaller: 0.7 or c? c Let a(t) = -t*2 - 20t - 6. Let v = 8 - 17. Let w be a(v). Let r = w + -653/7. Does r = 1? False Suppose -9 = -3c - 4y + y, -5y + 19 = 3c. Let j(z) = -z3 + z2 + z + 15. Let x be j(0). Suppose 2r = 7r + x. Is r equal to c? False Suppose 38 = -0i - i + 5c, -4i = -4c + 120. Let b be (-4)/(-14) + 29/i. Which is smaller: -1 or b? -1 Let n be -3(-1)/(-21)-8. Which is big	{ "pile_set_name": "DM Mathematics" }
rt(1100) + 0 + sqrt(1100) + 2))-1)2. 120sqrt(11) + 1136 Simplify 5 + (sqrt(468) - (2sqrt(468)5 + sqrt(468))) - (sqrt(468) + 1 + -4 + sqrt(468) + 1 + -4). -72sqrt(13) + 11 Simplify (2 + sqrt(5))5 - (sqrt(60) + sqrt(60)2)/sqrt(12) - (-3sqrt(40)2)/(sqrt(56)/(sqrt(14)/sqrt(2))). 10 + 8sqrt(5) Simplify (-3-5sqrt(160))/(sqrt(32)-6) + -4. -5sqrt(5)/2 - 4 Simplify (-1sqrt(30)/sqrt(90))2 + 4 + -1sqrt(75). -5sqrt(3) + 13/3 Simplify (sqrt(175)/sqrt(5)5)/sqrt(5) - ((-2sqrt(7) + 3 + sqrt(7))2 + 5). -21 + 11sqrt(7) Simplify (sqrt(40) + sqrt(360) + sqrt(360)-1 - sqrt(1440)-2)/(sqrt(72) - -5(sqrt(72) + 1sqrt(72)))-6. -26sqrt(5)/11 Simplify (0 + -2 + sqrt(147) + sqrt(147) + sqrt(147)2 + 5 + 5(2 + 1 + sqrt(147)))*2. 2268sqrt(3) + 12231 Simplify 5 + (((sqrt(128)2 + 3)-6)*2 - (sqrt(128) + 5 + sqrt(128)-1 + (sqrt(128) + (sqrt(128) - (sqrt(128) + 2sqrt(128) + -1)))2)). 3472sqrt(2) + 18627 Simplify (-2sqrt(704) - (0 + sqrt(396)))2 - (sqrt(176) + 5 + sqrt(44)/sqrt(16)). -9sqrt(11)/2 + 5319 Simplify (-4 + (sqrt(1573)1 - sqrt(1573)) - ((sqrt(117)1 - sqrt(117)) + sqrt(117))-3)2 + 1. -72sqrt(13) + 1070 Simplify ((3(sqrt(35)1 - sqrt(35))-5)/((sqrt(63) + sqrt(63) + -1sqrt(252)/sqrt(4))/sqrt(9)))*2. 0 Simplify 4((-3 + (-5(sqrt(12)/sqrt(4) + -4))2)1 + -1). -800sqrt(3) + 1884 Simplify (((sqrt(176)2 - sqrt(176)) + sqrt(176))/sqrt(4) + (2sqrt(132)/sqrt(3) - sqrt(44))2)-3. -132 - 12sqrt(11) Simplify 3((5 + sqrt(5) - sqrt(5) - sqrt(5))6 - (sqrt(720) + 5)). -54sqrt(5) + 75 Simplify ((-2 + sqrt(5))-1)2 + (((0 + sqrt(5) - sqrt(5)) + sqrt(5))4)*2 + -2sqrt(720) + sqrt(5) + -3 + sqrt(5) + -2. -26sqrt(5) + 84 Simplify (4-4sqrt(187))/(sqrt(1100) + sqrt(1100) + (sqrt(1100) - sqrt(1100)-2)). -8sqrt(17)/25 Simplify ((sqrt(198)/(sqrt(11) + (sqrt(11) - sqrt(176))))/(sqrt(18)/(sqrt(21)/sqrt(7))))2. 3/4 Simplify (((5(sqrt(21) + sqrt(84)/sqrt(4)) + sqrt(21))5)/(2(sqrt(192) + sqrt(192)-2)))2. 21175/256 Simplify (sqrt(77) + -1sqrt(77) + sqrt(77))/sqrt(11) + (sqrt(847) - (0 + sqrt(847))) + sqrt(7) - (sqrt(7) + sqrt(567)-2 + (sqrt(112) + -2)2). -116 + 35sqrt(7) Simplify (sqrt(204) - (sqrt(204) + (sqrt(204) - 1sqrt(204)-1) + sqrt(204)))/(sqrt(768)2) + -2. -2 - 3sqrt(17)/16 Simplify (4sqrt(363)6 - (sqrt(363) + -4sqrt(363))4)*2. 470448 Simplify ((2sqrt(1100) - sqrt(1100))*2 + sqrt(1100) + 0)-5-4 + -2. 200sqrt(11) + 21998 Simplify (sqrt(475)-2 - sqrt(475))2-4 + sqrt(114)/((sqrt(864) - sqrt(54)) + sqrt(54)). -17100 + sqrt(19)/12 Simplify 2 + (-5 + -2 + sqrt(612) - (3 + sqrt(612) + sqrt(612)2 + sqrt(612))2) + -4. -9810 - 138sqrt(17) Simplify (-3(1sqrt(378))/sqrt(9))/(6(sqrt(96)2 - sqrt(96)) - sqrt(96)). -3sqrt(7)/20 Simplify 4 + ((sqrt(3500) + (sqrt(3500)1 - sqrt(3500) - sqrt(3500)))/(sqrt(42)/(sqrt(30)/sqrt(5))))*2. 4 Simplify -2 + ((sqrt(30) - 4sqrt(30)-5)/(-4sqrt(486)))*2. -43/144 Simplify ((-2sqrt(50)-3)/(sqrt(80)/(sqrt(8) - (sqrt(8) + 1sqrt(8) + sqrt(8))))-3)2. 6480 Simplify 0 + sqrt(2299) + (sqrt(171) - 3sqrt(171))/sqrt(9) + (2 + -1 + sqrt(475) + 0)*2. 19sqrt(19) + 476 Simplify (5sqrt(132)/sqrt(4) + (sqrt(165) + (sqrt(165) - (1sqrt(165) - sqrt(165))))/sqrt(5))/(-12sqrt(147)). -sqrt(11)/2 Simplify 1-6(-3(sqrt(19) - (sqrt(931) + 1)) + -5). -108sqrt(19) + 12 Simplify -4 + -34(1(sqrt(1584) + 1) - (-4 + sqrt(1584) + -1))2. -436 Simplify ((sqrt(117) - 4(sqrt(117) - -1sqrt(117)) - sqrt(117))/sqrt(3))/((1sqrt(6)-2)/sqrt(2)). 4sqrt(13) Simplify (sqrt(832) + ((3 + sqrt(832))4 - sqrt(832)) + -1)2-3. -40299 - 2112sqrt(13) Simplify (0 + (sqrt(1300) - (sqrt(1300) + 0)-1 - (1sqrt(1300) + 5)) + 4)2. -20sqrt(13) + 1301 Simplify (0 + (sqrt(13) - sqrt(156)/sqrt(588)) + -4 + sqrt(312)/sqrt(6) + sqrt(52))*2. -272sqrt(13)/7 + 15812/49 Simplify 4 + sqrt(13)1 + -5 + ((sqrt(1872) - (0 + sqrt(1872))) + sqrt(1872))-4. -47sqrt(13) - 1 Simplify 2-2(5 + 1 + sqrt(325) + 4). -20sqrt(13) - 40 Simplify (5 + (((sqrt(468) + 1)-3)2 - (-2 + sqrt(468))2-1) + -5)5. 420sqrt(13) + 23465 Simplify 2(sqrt(8) + (4(sqrt(8)-1 + sqrt(8)) - sqrt(8)))/(sqrt(12)/(sqrt(3)3))-3. 0 Simplify ((2 + sqrt(567))3-6 - (sqrt(567) + sqrt(567)-22 + sqrt(567) + (sqrt(567) + 0 + 4 + sqrt(567) - sqrt(567))))2. 12240sqrt(7) + 165463 Simplify (3sqrt(275) + -3 - (4 + (-1 + sqrt(275) - sqrt(275))))23. -540sqrt(11) + 7533 Simplify 3 + sqrt(3) + 2 + sqrt(300) - ((sqrt(300)-1)/sqrt(4))*2. -70 + 11sqrt(3) Simplify (sqrt(405) + (sqrt(405) - (sqrt(405) + 1 + 0)) + -3sqrt(180)-2)*2. -90sqrt(5) + 10126 Simplify (-2 + -1(2sqrt(304) + 0 - -1sqrt(304)-2))*2-4. -16 Simplify (5 + (((sqrt(11) - sqrt(11)1 - sqrt(11)) + 5 - sqrt(11))2 - sqrt(11)) + sqrt(11) + sqrt(99) + 0)5 + -4. -85sqrt(11) + 366 Simplify -3(-3 + sqrt(1700) + -5 + 3 + (sqrt(102)/sqrt(6))*2). -30sqrt(17) - 36 Simplify 3 + (sqrt(425) + (sqrt(425) - (-1 + sqrt(425)))*2 + -2 - (sqrt(85)/(-1sqrt(5)) - (sqrt(17) + -1 + sqrt(17) + -4)*2)). -14sqrt(17) + 95 Simplify (2 + sqrt(153) + 1 - (sqrt(153) - (-2sqrt(153) + 0) - sqrt(153)))2 + (sqrt(34) + -11sqrt(34))/(sqrt(8) + sqrt(32)). -18sqrt(17) + 162 Simplify (-3 + (1sqrt(484) + sqrt(144)/sqrt(9))/(sqrt(288) + sqrt(288) + sqrt(288) + (sqrt(288) - (sqrt(288) + -3-2sqrt(288)))))2. 13sqrt(2)/6 + 6001/648 Simplify (1 + -1sqrt(2299) + 0 + (-1 + (sqrt(2299) - sqrt(2299)-1) - (sqrt(2299) + sqrt(2299) + sqrt(2299)-2 + 0)))2. 2299 Simplify (sqrt(243) - (1 + sqrt(243))2)2 + -4 + ((sqrt(30)/sqrt(2))/sqrt(5))2. 36sqrt(3) + 246 Simplify ((-4 + (sqrt(108)1 + 5 - (-1 + 0 + sqrt(108))))-4)2-6. -384 Simplify -1(4 + (-1sqrt(65)-6)/(sqrt(15)/sqrt(3)6))*2. -29 - 8sqrt(13) Simplify 0 + (sqrt(288) - (3 + sqrt(288)))-4 + -3. 9 Simplify -5 + ((sqrt(88) - 1sqrt(88))2)/sqrt(8) + (sqrt(11) - (-1 + sqrt(1100) + sqrt(1100) - sqrt(1100) - sqrt(1100)))-4. -4sqrt(11) - 9 Simplify (-1sqrt(480)-2)/(sqrt(486) + (3sqrt(486)1 - sqrt(486))). 8sqrt(5)/27 Simplify ((sqrt(121) - (sqrt(121) + sqrt(121) + 2sqrt(121))1)/(-5sqrt(1100))1 + -5)*2. -3sqrt(11)/5 + 62599/2500 Simplify 4 + (-2 + 1sqrt(720))2 + -4 + sqrt(500)1. -38sqrt(5) + 724 Simplify 1((5 + sqrt(1300))*2 + sqrt(117)/sqrt(9)5). 105sqrt(13) + 1325 Simplify (-2sqrt(65)1)/sqrt(5) - ((-2 + sqrt(117) + sqrt(13))2 - (-4 + sqrt(39)/sqrt(3))). -216 + 15sqrt(13) Simplify (1(2 + 4sqrt(539))2)2. 448sqrt(11) + 34512 Simplify (sqrt(12)/(sqrt(16)/sqrt(4)) + sqrt(147)1 + ((sqrt(36)1)/sqrt(12) - sqrt(147)-1) + -4)2. -128sqrt(3) + 784 Simplify (-1sqrt(70)-4 + (sqrt(70) - sqrt(70)25))/(sqrt(10) - sqrt(110)/(1sqrt(11)) - sqrt(80)/(sqrt(8) - -2sqrt(8))). 15sqrt(7) Simplify (-3 + (sqrt(9)/sqrt(3)6 - (0 + sqrt(3))6))-4. 12 Simplify ((1 + sqrt(637) + (sqrt(637) - (sqrt(637) + sqrt(637) + 1)) + -4)1)2 + -2. 14 Simplify -5 + ((sqrt(133) - 6(sqrt(133) + -5sqrt(133)))/(sqrt(49)/sqrt(63)))2. 106870 Simplify 2(sqrt(39) - sqrt(2496))/sqrt(3) + (((sqrt(1872) + 1 + sqrt(1872))-6)2 - sqrt(1872)). 1702sqrt(13) + 269604 Simplify ((sqrt(27))*2-3 - -4sqrt(6)/sqrt(2)) + (sqrt(27) + sqrt(54)/(1sqrt(2)) - sqrt(27)). -81 + 7sqrt(3) Simplify (((-62sqrt(324))/sqrt(9))/(sqrt(432)14 + sqrt(432)) + -3)2. 12sqrt(3)/5 + 237/25 Simplify 1 + (sqrt(1440) - (sqrt(1440) + -5(2sqrt(1440) - sqrt(1440) - sqrt(1440))))/(2sqrt(15)/(sqrt(15)/sqrt(5))). 1 Simplify (-3(sqrt(85) - sqrt(85)3-1))/((sqrt(100)/sqrt(4))/sqrt(5) + 3-2sqrt(5)). 12sqrt(17)/5 Simplify ((2 + 1 + sqrt(1700) + 1)4 + -5)*2. 880sqrt(17) + 27321 Simplify 5 + (4(sqrt(405)-3 + 2))*2 + -2. -1728sqrt(5) + 58387 Simplify ((4 + sqrt(3)-2 + (sqrt(33)1)/sqrt(11))*2 - (sqrt(192)-25)2)-4 + 4. 32sqrt(3) + 76728 Simplify (5 + -3(sqrt(2156) - sqrt(44)))*2 - (1 + (1sqrt(704))*2). -360sqrt(11) + 13576 Simplify (0 + (-2 + sqrt(1331) + 1)1 + 5)2. 88sqrt(11) + 1347 Simplify -46-2(2 + 0 + sqrt(833))4. 384 + 1344sqrt(17) Simplify -4 + ((sqrt(192) - ((sqrt(192) - (sqrt(192) + -1)) + sqrt(192)))26 - sqrt(192) - ((sqrt(33)/(sqrt(11) + -2sqrt(11)))2 + 1)). -8sqrt(3) - 2 Simplify -4(-5 + -5(-1sqrt(110)/sqrt(10))23). 680 Simplify (0 + sqrt(28)/(-3sqrt(4)))2 - (sqrt(567)3 + 2). -27*sqrt(7)	{ "pile_set_name": "DM Mathematics" }
.46. Let k = g - -3.25. Let x = -0.3479 - k. What is x rounded to three decimal places? 0.002 Let w be 4673750/(-7 + 54/8). Round w to the nearest one million. -19000000 Let f = -22 + 15. Let z = f - -7.2. Round z to 1 dp. 0.2 Let p = -0.0251996218 - -0.0252. What is p rounded to seven dps? 0.0000004 Let m be -24 + 0/(-5) + 2. Let g be m/55 - (242999976/(-15) + -2). Round g to the nearest one million. 16000000 Let d = -0.0354 - 0.0015. What is d rounded to three dps? -0.037 Let v = -8189.930003 + 8190. Let s = 0.144 - 0.074. Let b = s - v. Round b to 5 dps. 0 Let g = 777.18 - 771. What is g rounded to zero decimal places? 6 Suppose 9b = 11b - 2, -4b = 5w + 1092496. What is w rounded to the nearest 10000? -220000 Let x = -70 + 69.57. Let y = x + 0.4368. What is y rounded to three decimal places? 0.007 Let j = -0.8 + 0.901. Let b = -34.399 - j. What is b rounded to the nearest 10? -30 Suppose -3z + 1 = -8. Suppose 3o + 6 = -5m - z, -o - 1 = m. Suppose -s - ot + 61 = -8, -2t = 2s - 146. What is s rounded to the nearest ten? 80 Let y(x) = x*3 + 11x*2 + 7x - 8. Let j be y(-10). Let o = -33 + j. Round o to the nearest ten. -10 Let n(y) be the second derivative of -y4/12 + y3/3 + 3y2/2 + 4y. Let l be n(-2). Let c be (-5)/l104/2. What is c rounded to the nearest ten? 50 Let c be -11(-3)/3. Let t be 3/c - (13 - 1900). Round t to the nearest 100. 1900 Let g = -4.425753827 - -22.425753417. Let n = 167 + -149. Let f = n - g. What is f rounded to 7 dps? 0.0000004 Let j = -360493.1 + 360542.09966. Let y = 49 - j. What is y rounded to 4 dps? 0.0003 Let t = 760364 - 541264. What is t rounded to the nearest 10000? 220000 Let b = -2.033954 - -2.036. Round b to 5 dps. 0.00205 Let o = 0.552 + -0.265. Let b = o + 166.713. Let r = b + -167.0067. What is r rounded to 3 decimal places? -0.007 Let i = -146 - -131.7. Let a = i - -14.153. Round a to 2 decimal places. -0.15 Let p = 190 - 189.8. Let l = 667 - 666.8044. Let v = l - p. Round v to 3 dps. -0.004 Let f = -511.451 - -511. Let a = f - -0.46. Round a to 2 dps. 0.01 Let q = -0.1026988 + 0.1031. Round q to five dps. 0.0004 Let k = -283 - -197. Let n be -2870k/4 + -5. What is n rounded to the nearest 10000? 60000 Let x = 11 - 3. Suppose 30 - 2 = 4s - 4r, 4s + r = x. Suppose 5l - 4l = -h - 120004, sh = l + 119988. Round l to the nearest one hundred thousand. -100000 Let y = 1021 + -1020.99999047. What is y rounded to 6 dps? 0.00001 Let k = -14 + 19. Suppose -3h + 86500012 = -kq - 6h, h = 2q + 34599996. Round q to the nearest 1000000. -17000000 Suppose 5l + 20 = 45. Let k be 2(29 + 1)l. What is k rounded to the nearest one hundred? 300 Let n = -1119.4357 + 1119.9. What is n rounded to two decimal places? 0.46 Let c = -1026 + 703. Let j = -30517.8394759 + 30840.83946. Let x = c + j. What is x rounded to 6 dps? -0.000016 Let o = -0.15836 + 0.213248. Let w = o - 0.055. What is w rounded to five dps? -0.00011 Let v = -3.9 + 1.9. Let i = 2.00133 + v. Round i to 4 decimal places. 0.0013 Let z = 0.23 - 0.212. Let h = 2.882 + z. Let p = -2.90008 + h. Round p to 4 decimal places. -0.0001 Let c = 0.128 + -2.458. Let i = c - 106.67. Let r = -109.00000071 - i. What is r rounded to 7 decimal places? -0.0000007 Let v = -1.9 + -27.1. Let y = -45 + v. Let c = y - -73.99949. What is c rounded to four dps? -0.0005 Let i = -28.9204 + 29. Let v = -0.04928 - i. Let q = v - -0.13. Round q to four decimal places. 0.0011 Let i = 131 - 23. Suppose -v + 2o = -98, -o + i - 1 = v. Let u = 189 - v. Round u to the nearest 10. 90 Let c = -6080 + 6079.994846. Let r = 36.946154 + c. Let k = 37 - r. Round k to two decimal places. 0.06 Let x = 78 - 44. Let t = x + -37.8. What is t rounded to 0 dps? -4 Let p = -362.4 - -525. Let l = p - 123. Round l to 0 decimal places. 40 Let s = -7.6 + -1.4. Let c = 554777 + -554786.000008. Let n = s - c. Round n to 6 dps. 0.000008 Let j = 7.7399273 - 7.74. What is j rounded to 5 decimal places? -0.00007 Let o = 23 + -31. Let z be (o - -7) + 491. What is z rounded to the nearest ten? 50 Let x(h) = h2 - 8h + 2. Let p be x(8). Let j be p/(-7) + 13104128/56. Suppose -3q + j = -2w, -5q + 20895 = -4w - 369109. Round q to the nearest 10000. 80000 Suppose -3z + 8548 = 2p + 1330, -7227 = -3z + p. Suppose 4w + 3230 = -4m + 46, -3m + 2w = z. What is m rounded to the nearest 100? -800 Suppose 0 = -21c + 11647839 - 36049839. Round c to the nearest 100000. -1200000 Suppose 0 = 3f - 8f + 60. Let m be (-12124)/f - 2/(-6). Round m to the nearest 100. -1000 Let m be (1 + -3)-3 + -3. Let u be (-174600012)/(-9) + (-4)/m. What is u rounded to the nearest one million? 19000000 Let v = -6399.03 - -6327. What is v rounded to the nearest ten? -70 Let n = -1.691 - -0.031. Let b = 6 - 5.6. Let j = b + n. What is j rounded to one dp? -1.3 Let x = -553 + 889. Let u = x + -335.99687. Round u to four decimal places. 0.0031 Let j = -4.6546 - -4.66. What is j rounded to 2 dps? 0.01 Let u = 5035 - 5108.17. Round u to the nearest integer. -73 Let q = 10496949 - 2549949. Round q to the nearest 100000. 7900000 Let b(h) = -885h + 1. Let l be b(1). Round l to the nearest ten. -880 Suppose 0 = -2l - 5x - 7, 2x - 4x = 5l - 14. Let y be 209992/14 - l/(-7). Round y to the nearest 10000. 20000 Let i(d) = 1782d + 13. Let h = -17 - -23. Let m be i(h). Suppose -2q = m + 149295. Round q to the nearest 100000. -100000 Let k = -0.16 + 0.06. Let s = 0.7 - k. Round s to the nearest integer. 1 Let m(j) = 523j*2 + j + 9. Let z be m(3). Let i = z + -8919. Round i to the nearest 1000. -4000 Let w = -28.7 - -28.2225. Let k = w + 0.5. What is k rounded to three decimal places? 0.023 Suppose 0 = -0v + 4v - 132288. Suppose 2n + x + 0x = 13227, 5n - v = -4x. Let p = 18312 - n. Round p to the nearest one thousand. 12000 Suppose -4s + 1797996 = -2b, -2b = -0b + s + 1798001. Round b to the nearest 100000. -900000 Suppose -4n = -593939 - 1314861. Round n to the nearest ten thousand. 480000 Let h = 5.1496 - 0.0596. What is h rounded to the nearest ten? 10 Let v = -19600352 - -10609352. Round v to the nearest one million. -9000000 Suppose 0 = v - 3m + 14590003, 5v - 3v - 5m + 29180005 = 0. Round v to the nearest one hundred thousand. -14600000 Suppose 1 = -p, -5p + 11803391 = 3i - 34486604. Round i to the nearest one million. 15000000 Let r = -139.4 + 139.400000108. Round r to 7 decimal places. 0.0000001 Let l = -438 - -443.43. Let r = -6 + l. Let f = 4.47 + r. What is f rounded to one dp? 3.9 Suppose -n + 3n = 6. Let r be (-1)/(-2) + n/(-6). Let h(t) = -t + 20000. Let b be h(r). Round b to the nearest 100000. 0 Let k(a) = -a + 3. Let o be k(-3). Suppose b = ob - 25. Suppose 25479806 = -bg - 5520194. What is g rounded to the nearest one million? -6000000 Let g = 2.58210419 + -12.58210267. Let b = 2 + -12. Let y = b - g. Round y to 7 decimal places. -0.0000015 Let p = -834 - -794.3. Let d = p + 39. What is d rounded to the nearest integer? -1 Let w(j) = -j. Let p(v) = v2 - 4v - 1. Let o(a) = p(a) + 2w(a). Let x be o(7). Let c be x/(-8) - (-260015)/20. What is c rounded to the nearest 1000? 13000 Let b = 0.2 - 10.2. Let v = 10.03 + b. What is v rounded to two decimal places? 0.03 Let m = 2.057 + -2.069. What is m rounded to 2 decimal places? -0.01 Let n(d) = -516d - 56. Let u be n(-17). Let l = u + 13384. What is l rounded to the nearest 1000? 22000 Let l = 23 + -23.26. Let m = l + -11.74. Let o = m + 12.00024. Round o to 4 dps. 0.0002 Let r = 43.8 + -26. Let g = r - 21. Let s = -0.6 + g. What is s rounded to 0 dps? -4 Let u = -12.985 + 12.9850005989. Round u to 7 decimal places. 0.0000006 Let c(u) be the first derivative of -6u3 - 7u*2/2 + 6u - 1. Let j be 54/(-24)(-16)/(-6). Let v be c(j). Round v to the nearest one thousand. -1000 Let k = 63 + -43. Let g = -26329.27473 - -26309.27473023. Let o = k + g. Round o to seven decimal places. 0.0000002 Suppose 5l - x + 17 - 52 = 0, -5l + 35 = -5x. Suppose lc + 0c = -13720. What is c rounded to the nearest one thousand? -2000 Let h = 62 + -62.74. What is h rounded to one decimal place? -0.7 Let n = 10.92 + 0.28. Let u = -2.2 + n. Let g = 9.00008 - u. What is g rounded to 4 decimal places? 0.0001 Let c = 425935.21 - 112475.210016. L	{ "pile_set_name": "DM Mathematics" }
hat is the remainder when 4937258 is divided by 239? 235 Calculate the remainder when 1115626 is divided by 38467. 83 What is the remainder when 3851986 is divided by 41? 36 What is the remainder when 3197817 is divided by 20? 17 Calculate the remainder when 909949 is divided by 454941. 67 Calculate the remainder when 6824902 is divided by 3412447. 8 What is the remainder when 1360359069 is divided by 70? 69 Calculate the remainder when 5908711 is divided by 2102. 2091 Calculate the remainder when 52520097 is divided by 10504006. 67 What is the remainder when 34991 is divided by 1059? 44 What is the remainder when 417430 is divided by 46380? 10 Calculate the remainder when 9918787 is divided by 11. 10 Calculate the remainder when 116552 is divided by 2429. 2389 What is the remainder when 806780 is divided by 1449? 1136 What is the remainder when 94744 is divided by 11839? 32 What is the remainder when 11506948 is divided by 42? 40 What is the remainder when 45178141 is divided by 11294532? 13 What is the remainder when 84724124 is divided by 3902? 3900 Calculate the remainder when 638947 is divided by 9820. 647 What is the remainder when 100444 is divided by 960? 604 Calculate the remainder when 152499 is divided by 2051. 725 What is the remainder when 9668028 is divided by 172643? 20 What is the remainder when 208082528 is divided by 21? 17 What is the remainder when 526785 is divided by 2925? 285 Calculate the remainder when 35127 is divided by 4992. 183 What is the remainder when 7950906 is divided by 567921? 12 Calculate the remainder when 71222 is divided by 23683. 173 What is the remainder when 12130027 is divided by 4043341? 4 What is the remainder when 10405122 is divided by 867087? 78 What is the remainder when 71156 is divided by 4475? 4031 What is the remainder when 2336661 is divided by 557? 46 What is the remainder when 932199 is divided by 161? 9 What is the remainder when 683335320 is divided by 33? 30 Calculate the remainder when 558537 is divided by 92919. 1023 What is the remainder when 35163 is divided by 2636? 895 What is the remainder when 6803215 is divided by 425199? 31 What is the remainder when 266509405 is divided by 44? 41 Calculate the remainder when 488463910 is divided by 6285. 6280 Calculate the remainder when 1075165 is divided by 10971. 7 Calculate the remainder when 199370 is divided by 296. 162 What is the remainder when 1010761 is divided by 2241? 70 Calculate the remainder when 610309 is divided by 2219. 84 What is the remainder when 1184757 is divided by 38216? 61 Calculate the remainder when 4953 is divided by 4581. 372 Calculate the remainder when 4638 is divided by 4209. 429 What is the remainder when 61243 is divided by 7362? 2347 Calculate the remainder when 1530693 is divided by 102. 81 What is the remainder when 635893 is divided by 79486? 5 Calculate the remainder when 142064784 is divided by 47354922. 18 Calculate the remainder when 29116812 is divided by 218923. 53 Calculate the remainder when 2265599 is divided by 126. 119 Calculate the remainder when 61857 is divided by 8733. 726 What is the remainder when 48623 is divided by 9683? 208 What is the remainder when 20591 is divided by 3409? 137 What is the remainder when 23206 is divided by 10916? 1374 Calculate the remainder when 139439 is divided by 4808. 7 What is the remainder when 3436157 is divided by 13065? 62 Calculate the remainder when 62957377 is divided by 576. 1 Calculate the remainder when 3579271 is divided by 3023. 39 What is the remainder when 1001591 is divided by 964? 959 Calculate the remainder when 47736 is divided by 36. 0 What is the remainder when 59667 is divided by 7966? 3905 Calculate the remainder when 48233 is divided by 45401. 2832 What is the remainder when 17463023 is divided by 51819? 20 What is the remainder when 29797170 is divided by 333? 330 What is the remainder when 914125 is divided by 1439? 360 Calculate the remainder when 1130992 is divided by 611. 31 Calculate the remainder when 16669 is divided by 5292. 793 What is the remainder when 12299858 is divided by 453? 2 Calculate the remainder when 8553059 is divided by 1783. 8 What is the remainder when 164042 is divided by 2215? 132 Calculate the remainder when 3290085 is divided by 22081. 16 What is the remainder when 8584036 is divided by 21? 13 What is the remainder when 80091 is divided by 8921? 8723 Calculate the remainder when 3188952 is divided by 872. 48 Calculate the remainder when 4151751 is divided by 218494. 365 Calculate the remainder when 322635 is divided by 439. 409 What is the remainder when 25316545 is divided by 601? 21 What is the remainder when 971655 is divided by 242908? 23 What is the remainder when 12761158 is divided by 290? 288 Calculate the remainder when 982943 is divided by 447. 437 Calculate the remainder when 47727 is divided by 987. 351 What is the remainder when 6496745 is divided by 13313? 1 What is the remainder when 2220582 is divided by 23623? 20 What is the remainder when 5999968 is divided by 7472? 7424 Calculate the remainder when 1774810 is divided by 195. 115 Calculate the remainder when 457723583 is divided by 11. 9 What is the remainder when 13478126 is divided by 2695590? 176 What is the remainder when 23394753 is divided by 880? 833 Calculate the remainder when 26781465 is divided by 182. 165 What is the remainder when 395420 is divided by 144? 140 What is the remainder when 348601 is divided by 1599? 19 Calculate the remainder when 1170242 is divided by 1145. 52 What is the remainder when 4243860 is divided by 2250? 360 Calculate the remainder when 82801230 is divided by 4375. 4355 What is the remainder when 2920621 is divided by 1460309? 3 Calculate the remainder when 217870 is divided by 26. 16 What is the remainder when 185884116 is divided by 123? 120 What is the remainder when 36173904 is divided by 4524? 0 What is the remainder when 2403389 is divided by 113? 105 Calculate the remainder when 7014605 is divided by 41. 38 Calculate the remainder when 6098479 is divided by 6098469. 10 Calculate the remainder when 112907024 is divided by 495. 494 Calculate the remainder when 2311342 is divided by 466. 448 Calculate the remainder when 1300692 is divided by 1147. 1141 What is the remainder when 609075 is divided by 42? 33 Calculate the remainder when 1575415 is divided by 197. 6 What is the remainder when 11286352 is divided by 163570? 22 Calculate the remainder when 3125385 is divided by 520897. 3 Calculate the remainder when 1661472 is divided by 15101. 362 Calculate the remainder when 2058396 is divided by 254. 234 What is the remainder when 943967 is divided by 49682? 9 Calculate the remainder when 2795841 is divided by 78. 9 Calculate the remainder when 13767113 is divided by 239. 235 What is the remainder when 196466 is divided by 1804? 1634 What is the remainder when 59637 is divided by 200? 37 Calculate the remainder when 831699 is divided by 72. 27 What is the remainder when 84251 is divided by 1558? 119 What is the remainder when 63841599 is divided by 9305? 9299 What is the remainder when 2485173 is divided by 355015? 68 What is the remainder when 32037054 is divided by 20? 14 Calculate the remainder when 469115 is divided by 156338. 101 Calculate the remainder when 1440754 is divided by 72037. 14 What is the remainder when 73510 is divided by 1880? 190 Calculate the remainder when 18372671 is divided by 1837267. 1 Calculate the remainder when 2634565 is divided by 10. 5 What is the remainder when 380618704 is divided by 25374580? 4 What is the remainder when 912950 is divided by 33? 5 What is the remainder when 12869 is divided by 5490? 1889 What is the remainder when 180232 is divided by 44575? 1932 Calculate the remainder when 47223998 is divided by 72. 62 Calculate the remainder when 15778841 is divided by 279. 275 Calculate the remainder when 1167831 is divided by 3. 0 Calculate the remainder when 1145431 is divided by 17. 5 Calculate the remainder when 7561304 is divided by 4. 0 What is the remainder when 491164 is divided by 3929? 39 Calculate the remainder when 46749 is divided by 7787. 27 What is the remainder when 3099780 is divided by 1257? 18 Calculate the remainder when 1214 is divid	{ "pile_set_name": "DM Mathematics" }
2/53? (a) -0.222 (b) 37/2 (c) 19 (d) -2 (e) -1 a What is the nearest to -1.17 in 25/6, -12, -9, 5/6? 5/6 Which is the nearest to 214? (a) 2/11 (b) -302 (c) -2.5 a What is the nearest to -1 in 0.991, 1/8, 2/5, 74, -0.2? -0.2 What is the closest to 2/15 in 3/8, -1541, -440, 5? 3/8 Which is the closest to -0.1? (a) 0.0447 (b) 5 (c) -236/3 (d) -0.3 a Which is the nearest to 4? (a) 17 (b) -2 (c) 1196.6 b Which is the closest to 1/3? (a) 13 (b) 30 (c) -1 (d) 8 c What is the closest to -52 in -2/3, 0.5, 3, 1, 0.02, 494? -2/3 What is the nearest to -2/11 in -2/3, -4, -1, 17961, 1/29, 1/3? 1/29 What is the nearest to -25 in -1, -2/19, 19968? -1 What is the nearest to 545 in -325, 1/3, 1? 1 What is the closest to -23 in -0.3, -2/3, 2272? -2/3 Which is the nearest to 15? (a) 4.6 (b) -2 (c) 10 (d) 0 (e) -1/4 c What is the nearest to -0.06 in -4.07, -0.01, 12, -31? -0.01 What is the nearest to 2 in 2, -0.06, -0.1, 1/1772, 3? 2 What is the closest to -19 in -3/7, -13, -5/3, 3/5? -13 What is the closest to -233 in 4, 1/150, -33? -33 What is the nearest to 1/3 in -23/21, -3/29, 44? -3/29 What is the closest to -1 in -2/169, -31, -0.1, 0.2, 2/5? -0.1 What is the nearest to 1/2 in 2490, 2, 0, -1/70? 0 What is the closest to 1/30 in -1, 3, -42, -0.3, 0.06? 0.06 Which is the closest to 0? (a) 2 (b) 8 (c) -1/11 (d) -17 (e) -2/93 e Which is the closest to 0.457? (a) 0.48 (b) -1 (c) 0 (d) -5.3 a What is the closest to 0.05 in -466, 1106, -2/15, -5? -2/15 Which is the closest to -0.07? (a) -111 (b) -8/107 (c) -0.05 b Which is the closest to -1? (a) -6 (b) -3 (c) 90 (d) 1/5 (e) 102 d What is the nearest to 2/23 in -3, -3834, 0.1? 0.1 What is the nearest to 4/3 in -3, 0.08, 25585? 0.08 What is the nearest to -0.4 in -2/3, -2, -3994.6? -2/3 Which is the nearest to 2104? (a) -6 (b) 3/4 (c) 2/3 (d) -5 (e) 0.4 b What is the nearest to 2/65 in -0.8, 6, -6/89? -6/89 Which is the nearest to 0.174? (a) 0.5 (b) -2/11 (c) -343 (d) 3 (e) -1/2 a What is the nearest to -16/3 in -0.1, 4/9, 756.96? -0.1 What is the closest to 0 in -3392, -0.2, 1/2, 19.41? -0.2 What is the closest to 275 in 5280, 2/3, 4/7? 2/3 Which is the nearest to -54199? (a) -3 (b) 1 (c) -0.24 a Which is the closest to 1? (a) -4 (b) 0.42 (c) 0 (d) -782 (e) 3/4 e Which is the closest to -1? (a) -163 (b) -3796 (c) -1/8 c What is the closest to -54853/3 in -5, 1/5, 15? -5 What is the closest to -151 in 59.3, -0.14, -3, -4, -2/5, 4? -4 Which is the nearest to 3? (a) 1.3 (b) 3 (c) 0.87063 b What is the nearest to -2 in -495, -3/499, 1? -3/499 What is the closest to 1/3 in -1/6718, 2/17, -1/8, -1/6, -3/5? 2/17 Which is the nearest to 1/2? (a) 0.3 (b) -0.4 (c) 3099966 (d) 0.4 (e) 5 d Which is the closest to 0? (a) 4/7 (b) -0.16767 (c) 1/4 (d) -2/13 d Which is the closest to 57426? (a) 3 (b) 0 (c) 962 c What is the nearest to -15 in -2/127, -4/5, 0.01, -39, -0.1? -4/5 Which is the closest to -347? (a) -0.484 (b) -0.3 (c) 5 (d) -5 (e) 1/8 d What is the nearest to 132 in -2, 0.5, -2/21519? 0.5 What is the closest to -3/5 in -6, -5, 0.0383, 0.05, 0.2? 0.0383 Which is the closest to 10? (a) -2/11 (b) 2/7 (c) -3.3 (d) 34/5 (e) -3/7 (f) -3 d Which is the closest to 6? (a) -55/4 (b) 5 (c) 1 (d) -2.09 (e) -0.06 b What is the closest to -3 in 2, 3/2, -109/70, 6.3? -109/70 Which is the nearest to -0.3? (a) 17 (b) 3 (c) 41 (d) -13 b Which is the nearest to -1199? (a) -1/4 (b) 9 (c) -4 (d) 0.1 (e) 1/4 (f) 14/37 c Which is the closest to 0.1? (a) 1282 (b) 1/3 (c) -2/1151 (d) -5 (e) -2/11 c What is the closest to -12 in 41, 109, -37/2, 0.4? -37/2 Which is the nearest to -0.1? (a) 43 (b) -1.5 (c) -5/2511 (d) -2/7 (e) 0 c What is the nearest to 0 in -1/3, -0.63, -0.11, 4, -4/13? -0.11 Which is the nearest to 0.028? (a) 0.19 (b) -2/17 (c) -88/9 (d) -4 b What is the nearest to 90 in 12, 5, 2923? 12 What is the nearest to 2/3 in 0.12, -5103, -9, 0, 0.5, -1? 0.5 What is the closest to -5 in 2, -26, -6/13, -5, -4/7? -5 What is the closest to 2 in -38, 10, 0.5, 19.2? 0.5 What is the closest to 4 in -2/83, -44997, 1? 1 What is the closest to -0.0256 in -0.08, -4/5, 59? -0.08 Which is the closest to -2.95? (a) 1/8 (b) -4 (c) -0.05 b Which is the nearest to 2? (a) 469 (b) 0.4 (c) -2/81 (d) -0.8 (e) 0.3 b Which is the closest to -4? (a) -2 (b) 0.025 (c) 212 (d) -5 (e) 0.27 (f) -1/6 d Which is the nearest to -3? (a) 0.2 (b) 2 (c) 3135 (d) 133 a Which is the closest to -2/7? (a) -12 (b) -33 (c) 0 (d) -869 (e) 3/7 (f) -30 c What is the nearest to -9/5 in -19, 2/43, 0.4, -1, -0.2? -1 What is the nearest to 2/7 in -0.3, -1019/3, -3, -1/4, -4, -1? -1/4 What is the closest to 329447 in -0.4, 0, -1398? 0 Which is the nearest to 13? (a) -7 (b) 14532/19 (c) 0.2 (d) 1/3 d Which is the nearest to 2732? (a) -2/3 (b) 1/4 (c) -2 (d) 21 (e) -3/4 d What is the closest to -0.1 in -1/71, -3, -0.4, -0.0005, -2.1? -1/71 What is the nearest to -0.1 in -13, 2186, 109? -13 Which is the nearest to 1388? (a) -2 (b) -27 (c) 1.37 (d) 4 d What is the nearest to 42 in -4.67, -0.5, 0.4, 2/3, 6? 6 Which is the closest to 0.1? (a) 0.0277 (b) -7/17 (c) -6 (d) 6 a Which is the nearest to -0.1? (a) -15.974 (b) 14 (c) -2/9 (d) 3 c What is the closest to -2/7 in 3, 2/4091, -5713, -2/11? -2/11 Which is the closest to 1/7? (a) -211 (b) 0.5 (c) -21 (d) 1 (e) 20 (f) -0.5 b Which is the nearest to 0? (a) -1/2 (b) 16 (c) 66 (d) 6 (e) 0.3 (f) -0.07 f Which is the nearest to 601? (a) -0.01 (b) -1/6 (c) 3 (d) -4 (e) 4 e Which is the closest to 99.754? (a) -5/3 (b) 5.6 (c) -4 b What is the closest to 0.1 in -4, -477, 50, 1/14? 1/14 Which is the closest to -2.15? (a) -2 (b) 19/5 (c) -3/7 (d) 2/7 (e) 4 a What is the closest to 1 in 0.4, -39.87, -273? 0.4 What is the nearest to -0.1 in -0.3, 1.4, 0.4, -2, -648/11? -0.3 Which is the closest to -1? (a) -0.4 (b) 0.02 (c) -1/4 (d) 0.5 (e) 48351 a What is the nearest to -15.4 in -2, -52, -0.9, -5? -5 What is the nearest to -8 in -2/5, -34, -0.09, 2, -659? -2/5 What is the closest to 19/3 in -10.4146, 3, 2/3, -0.4? 3 Which is the nearest to 2/7? (a) 0.4 (b) -1/4 (c) 2/17 (d) 2/11 (e) -3148.3 d Which is the nearest to 0? (a) 3/23 (b) 0 (c) -3.89 (d) -2/5 (e) -318 (f) -4 b Which is the nearest to 19? (a) 1/14 (b) -96 (c) -3 (d) -2.3 a Which is the nearest to -162? (a) -985/6 (b) -0.2 (c) -0.1 a Which is the nearest to -3/1003? (a) 5 (b) -4 (c) -1 (d) 0.12 (e) 0.3 d Which is the closest to -0.1? (a) -10 (b) 0.2 (c) 709647 (d) -1/3 d Which is the nearest to 1? (a) -493 (b) -4 (c) 2.22 c What is the nearest to 2/9 in -9, -3, -0.4, -5, -1746? -0.4 What is the nearest to 441/5 in -4, 2, -1, -3, 1.962? 2 Which is the nearest to -1361? (a) -19 (b) 12/61 (c) -0.1 (d) 3/8 a Which is the closest to 3/5? (a) 0.17 (b) -7/6 (c) -14 (d) 2/555 a What is the closest to -0.08 in 1, 3/8, 1/6, 25606? 1/6 Which is the closest to 1457? (a) 142 (b) -1.1 (c) -7 (d) 5 a Which is the closest to 0.2? (a) -15/4 (b) 0.046 (c) 4 (d) 0.3 (e) 0.02 d What is the closest to -3 in 0.004, 0.01303, -1? -1 What is the closest to -1/2 in -0.04, -5, 34, -0.5144? -0.5144 What is the nearest to 152 in -0.1, -3/1790, -5, -4, 0.4? 0.4 What is the closest to 0.2 in -0.4, 1/2, -38, -348, -1/7, 19? 1/2 What is the closest to 0.5 in -1/1205, -2/309, -2, -5? -1/1205 Which is the closest to 15? (a) -0.06 (b) -9 (c) -9.63 a Which is the nearest to -2/3? (a) -387883 (b) 1 (c) -9 b What is the nearest to 1/2 in -4/13, -0.1, 0.1, -0.5, 1/7? 1/7 What is the closest to -49 in -2, -3/8, -0.0163? -2 What is the nearest to -2 in 1/6, 2294180, -0.1? -0.1 Which is the nearest to 3/7? (a) 4/9 (b) -71/3 (c) -16 a What is the closest to 1 in -4, -3/313, 968, -2/3? -3/313 Which is the nearest to 27? (a) 4 (b) 53.5 (c) 0.8 (d) 2/3 a Which is the nearest to -0.3? (a) 194 (b) 1 (c) 0.1 (d) 4 (e) -49 (f) -28/9 c What is the closest to 24 in 1, -3739, 11/2? 11/2 Which is the closest to 0.549? (a) -0.948 (b) -0.2 (c) -16 b What is the closest to -1/2 in -29/12, -29.8, -0.2, 0.08, 0.2? -0.2 What is the nearest to 5 in -1, 2, 4, -5/611, 0.03? 4 What is the nearest	{ "pile_set_name": "DM Mathematics" }
a factor of p(c)? False Let c(r) = r - 10. Let y be c(-22). Is 5 a factor of (12/(-6))/(y/4320)? True Let h = -452 - -470. Does 4 divide h? False Suppose 4w = 10 + 18. Let z(h) = 4h - 14. Is 10 a factor of z(w)? False Is 8 a factor of -10 + 10 - (-1941 - (-3 - 2))? True Let n(t) = -t3 - 7t*2 + t + 12. Let j be n(-7). Suppose 0 = -jy + 4c - 44, 3y = -2y - 2c - 38. Let m = y - -16. Is m a multiple of 8? True Suppose 0 = m - 4b - 96, 2b + 0b = -m + 114. Does 3 divide m? True Let h(d) = 15d - 12d - 12d - 10 - 9d. Is h(-3) a multiple of 11? True Let n(r) = -2r*2 - 7r - 17. Let v be n(-8). Let c = v + 180. Does 20 divide c? False Let d be 10/2(-42)/(-35). Suppose -5q - 3l + 155 = 0, -dl - 54 = -q - 2l. Is q a multiple of 15? False Let k = 115 + -119. Is 10 a factor of ((-14)/(-4))/((-906)/228 - k)? False Let w = 66 + 354. Does 6 divide w? True Let g = 567 - 156. Is g a multiple of 24? False Suppose 6n - 17774 - 724 = 0. Is n a multiple of 34? False Is (10 + -12)/((-2)/1226) a multiple of 59? False Let l(r) = 2r2 + 9r - 48. Does 19 divide l(8)? True Suppose 0 = -23g + 6660 + 5714. Does 21 divide g? False Let r(v) = 47v3 - v2 + 4v + 3. Let c be r(-2). Let b = c + 581. Is 14 a factor of (b/(-21))/(1/(-3))? True Suppose -11f - 2922 = -13845. Does 72 divide f? False Suppose 2j = -2 - 14. Suppose l - 5l - 4y = -1184, 0 = -y - 1. Does 4 divide 6/j - l/(-12)? True Suppose -g = -5, 0 = 3p + g - 26 + 6. Suppose -m - 13 = -5u, 5u + 4m + p = -m. Suppose -3k + 6 + 9 = 0, -uq + 4k + 20 = 0. Is q a multiple of 4? True Let x = -167 + 88. Let q = x - -314. Suppose 2z = 3h + h + 84, -5z + 5h + q = 0. Does 27 divide z? False Let c(i) = -i*3 + 2i*2 + 3i. Let h(f) = -f - 9. Let v be 1-5 + 4 + -6. Let q be h(v). Is c(q) a multiple of 10? True Suppose 0s - 676 = 4s. Suppose 2a + 4g = 5a + 717, a = -3g - 252. Let d = s - a. Is 13 a factor of d? False Suppose 3w - 2 = 3g - 2g, 2g + 10 = 4w. Let l(d) = -d*3 - 11d*2 + 2. Let x be l(g). Suppose xf = -3k - 1, -3k = 3f - 1 - 5. Is f even? False Is -4(-4 + 0 + (-43)/2) a multiple of 6? True Suppose -i - 2i = -5p + 30, -4p = -3i - 27. Suppose 0 = j - 5a - 15, -3a = -j - a + p. Does 8 divide (-2)/j + (-228)/(-30)? True Suppose 9n - 2249 = 1513. Is n a multiple of 13? False Suppose 4b - 8 = 2b, -b + 232 = 2j. Suppose j + 6 = 6l. Suppose l = 3x - 22. Is x a multiple of 14? True Is 40/(-50) + 1108/10 a multiple of 3? False Let h = 81 + -115. Suppose -4q = -14 + 34, 4q = j - 105. Let p = j + h. Is 17 a factor of p? True Suppose 1159 = 5l + 489. Suppose 0b + 291 = -3v - 3b, 0 = 3v + 5b + 295. Let g = l + v. Is 13 a factor of g? True Let n be (-2)/3 - 8355/(-30). Suppose -98 = -2o + n. Is o a multiple of 48? True Let y(w) = -2w2 + 9w + 24. Let n be y(7). Let d(v) = -v*3 - 9v*2 + 14v + 9. Does 46 divide d(n)? False Let i(v) = v + 7. Suppose 2 + 5 = p - 3d, 21 = -5p + d. Let n be i(p). Suppose 2c = -nc + 48. Is c a multiple of 4? True Let r(o) = o + 6. Let z(s) = -4s - 17. Let v(h) = -7r(h) - 2z(h). Let x(n) = n2 + 4n + 7. Let j be x(-5). Does 4 divide v(j)? True Let t(c) = c*2 - 12c - 14. Let j be t(13). Is 12/(j2/(-12)) a multiple of 14? False Let n(d) = -7d + 1. Let l be n(-1). Let b(j) = j*3 - 7j*2 - 4j + 8. Let f be b(l). Suppose -4v + f = -8. Is v a multiple of 5? False Let p(j) = -4j - 33. Let q be p(-9). Suppose o = qo - 16. Is o a multiple of 5? False Let t be (-16)/(-10)(-15)/(-2). Let o be (132/30 - 4)/(2/(-60)). Is (-27)/ot/9 even? False Suppose 3j + 6 = 0, -n + 0n = 4j + 6. Suppose -x + 4x = nw + 104, -180 = -5x + 5w. Suppose m + 2b - 34 = 0, 2m - x = b + 21. Does 10 divide m? False Suppose 4398 = 6o - 360. Is o a multiple of 79? False Let p(h) = 8h*2 + 6h - 31. Is p(-6) a multiple of 10? False Suppose 2b = 5l, 5l = b - 2b + 30. Suppose -8p = -38 - b. Is p a multiple of 2? True Let s(u) = -28u*2 + 3u. Let d be s(2). Is (d/5 - 2)/(22/(-55)) a multiple of 33? False Suppose -4u = -9u - 80. Let g = u + 20. Suppose 3x - 167 = o - 52, 0 = -2o + g. Is x a multiple of 13? True Suppose 5d = 3f + 1019 + 1405, -492 = -d + 3f. Is 18 a factor of d? False Suppose 0 = 6z - z - 3s - 1495, 2z - s - 599 = 0. Suppose -3u - z = -5u. Is u a multiple of 22? False Let u(z) = -z*3 + 47z*2 + 99z + 4. Is u(49) a multiple of 4? False Does 15 divide (71176/49)/8 - 8/14? False Let r(l) = -l*3 - 11l*2 + 11l + 5. Suppose 17 + 3 = -4y + 5o, 3y + 5o = -15. Let c be y/20 + (-94)/8. Is 10 a factor of r(c)? False Suppose -5x = -4u + 29 + 8, -1 = -2u - x. Suppose -ua + 4a + 3c - 33 = 0, 3c = 3a - 111. Does 9 divide a? True Let b = 1336 + -115. Is b a multiple of 20? False Suppose -q + 23 = -7. Suppose 0 = -qa + 23a + 1225. Is 9 a factor of a? False Let q be 16/(-12)(-3)/2. Suppose -5l + l = -20. Suppose -lj + 138 = qx - j, 3x - 174 = 5j. Does 21 divide x? True Let f = 81 - -354. Does 5 divide f? True Let c = -14 - -23. Let h = c + -11. Is 33/7 - h/7 a multiple of 3? False Is 47 a factor of 2(47/2 + 0)? True Let y = 596 - 459. Is y a multiple of 4? False Let k(a) be the first derivative of a7/105 - a6/360 + a4/24 + 4a3/3 + 3. Let x(j) be the third derivative of k(j). Is x(1) a multiple of 8? True Let m = -107 - -90. Let n = 121 - m. Is 6 a factor of n? True Let n(l) = l3 - 2l2 + 3. Let w be n(3). Let v(c) = -7c + 7. Let t be v(2). Let h = w - t. Does 9 divide h? False Suppose 6w = 4w + 384. Suppose -1 = u, 0r + 4r - 4u - w = 0. Is r a multiple of 11? False Let q(m) = -2m*3 - 5m*2 - 5m + 5. Does 24 divide q(-6)? False Let t = 136 + 198. Does 53 divide t? False Suppose -1038 + 224 = -2m. Let s = 660 - m. Is s a multiple of 43? False Suppose -80u + 4 = -82u. Is 45152/238 + u/(-7) a multiple of 13? False Let n(i) = -i3 - i2 + 123. Let d be n(0). Suppose -2p = -3j + 178, 2p + 31 = -3j - d. Let w = p + 124. Is w a multiple of 12? False Let i(l) be the second derivative of 3l5/10 - l4/12 + l*3/6 + 27l. Is 27 a factor of i(3)? False Suppose -u = u. Suppose 2d - 306 = -k, 0 = -uk + 4k + d - 1224. Suppose -3f = -k + 108. Does 12 divide f? False Let u(h) = 394h + 33. Does 13 divide u(1)? False Suppose -5958 = -11a + 4261. Is 51 a factor of a? False Let p = 2098 + -1877. Is p a multiple of 4? False Let n(s) = 4s2 + 12s + 2. Let g = -144 - -137. Is 17 a factor of n(g)? False Let o(d) = -d*2 - 3d - 2. Let z be o(-3). Let l be 2 + ((-2)/1 - z). Is 12 a factor of (-5)/l84/(-15)? False Let g(y) = y3 + 11y*2 + 2y. Is g(-10) a multiple of 40? True Suppose -23v = -19v + 40. Does 7 divide (v/(-4))/(17/170)? False Let d(f) = -f - 12. Let v be d(-20). Let b(u) = u*3 - 7u*2 - 1. Does 17 divide b(v)? False Suppose 6l - 2m - 5 = l, 3l - 17 = 4m. Is -4 - 8/l - -121 a multiple of 27? False Let a(v) = v2 - 4v + 5. Suppose -n - 2x + 7 = 0, -24 = -9n + 4n + x. Is a(n) a multiple of 2? True Suppose -4u + 5s + 6 = 0, -5u - 5 - 2 = s. Let w be (1 + u)/4 + -52. Let j = w - -88. Is 11 a factor of j? False Suppose -14 = -6r + 10. Suppose -rg + 3 = -g. Is 3 a factor of 2/(g/((-9)/(-2)))? True Let f be (11 - 12)/((-2)/4). Suppose p = fs - 121, s + 307 = 6s - 4p. Is 25 a factor of s? False Let a = -12 + 58. Let w(m) = m2 - 9m + 1. Let q be w(8). Let k = q + a. Is 13 a factor of k? True Let h = -1548 + 2955. Is h a multiple of 33? False Let n(l) = l3 + l2 - 2l + 6. Let j be n(3). Is (-4)/((-16)/j) - 2 a multiple of 7? True Suppose 0 = r + 2r - 15. Suppose 2s + m - 220 = 110, -rm + 830 = 5s. Is 11 a factor of s? False Let s(w) = -w - 2. Let h be s(-2). Suppose h = 4z - 5j + 52, 4z = -0z - 5j - 12. Is 11 a factor of (76/z)/((-2)/8)? False Let c be 5/(-20) - 3963/(-12). Suppose 54p = 56p - c. Is p a multiple of 55? True Suppose -6w + 0w = -192. Suppose -17m + w = -9m. Does 4 divide m? True Suppose 4o = 1422 - 314. Suppose 5s + n - o = 165, -5s + 5n = -430. Suppose 8h = 4h + s. Is h a multiple of 22? True Suppose 6m + 1386 = 17m. Is m a multiple of 15? False Suppose 663 = 2v + 3o, -51v + o = -48v - 1000. Does 5 divide v? False Let n(z) = z3 - z2 - z + 8. Let h be n(0). Let v be (-13 - -26) +	{ "pile_set_name": "DM Mathematics" }
n) = 1229385n2. Let g(d) = 615d*2. Let l(i) = -7995g(i) + 4y(i). Calculate l(u(a)). 2460a*4 Let s(u) = 7652u*2. Let m(p) = -15p*2. Determine s(m(d)). 1721700d*4 Let b(k) = 8k*2 + 3k. Let v(r) = 2r + 22. Give v(b(t)). 16t*2 + 6t + 22 Let x(s) = 14s2 - 106. Let r(h) = -36h. Give x(r(f)). 18144f2 - 106 Let x(m) = 3m. Let j(l) = -6351l2. Determine x(j(a)). -19053a*2 Let q(v) be the second derivative of 0 + 1/12v*4 + 0v*2 - 21v + 0v3. Let u(k) = -28k*2. Give u(q(b)). -28b*4 Let o(m) = -882m. Let t(n) = 30n2. What is t(o(c))? 23337720c*2 Let t(b) = -7b*2. Let w(o) = 14782o*2 + 1 - 14778o*2 - 1. What is w(t(i))? 196i*4 Let p(q) = 19q. Let k(b) be the first derivative of 3b2 - 192. Give p(k(u)). 114u Let j(g) = 7g. Suppose 15u - 32 = 11u. Let y(p) = -up*2 + 7p*2 - 6p*2. Calculate y(j(r)). -343r*2 Let s(v) = 2v*2. Suppose 0 = -a + 46 + 38. Let q = 120 - a. Let f(y) = -19y - 19 - 17 + q. Give f(s(c)). -38c2 Let c(y) be the first derivative of -y2 - 168. Let k(v) be the third derivative of 0v*3 + 0v4 + v2 + 0v + 0 + 1/20v*5. What is k(c(i))? 12i*2 Let z(p) = 37842p*2. Let w(m) = -6m. Calculate w(z(c)). -227052c2 Let k(r) = -12r - 32. Let x(v) = -v - 3. Let l(p) = 3k(p) - 32x(p). Let c be l(-4). Let w(z) = z + c + 3z - 16. Let u(a) = 2a. Give u(w(d)). 8d Let r be 5/(-3) - 120/(-18). Let n(p) = -6 - 4 + 10 + rp. Let z(d) be the second derivative of d*3/6 - d. Calculate n(z(v)). 5v Let a(v) = v. Let g(n) = 278n - 573n - 583n2 + 295n. Calculate a(g(q)). -583q2 Let t(m) = -5177m. Let n(u) = 4u2 + 23u. Determine t(n(h)). -20708h2 - 119071h Let x(j) = -9884j2. Let c(g) = -107g. Determine c(x(v)). 1057588v2 Let c(p) = 2p. Let k(n) be the second derivative of -9n4/2 + 2n - 120. Determine c(k(a)). -108a2 Let h(t) = 19t. Let s be ((-36)/(-54))/((-4)/(-18)). Let i(c) = 2c + sc - 4c. Give h(i(q)). 19q Let a(g) = -128g2 - 1. Let b(k) = -206k. Determine a(b(u)). -5431808u2 - 1 Let c(n) = 11n*2. Let h(d) = -65d*2 - 35d + 35. Let z(m) = -11m2 - 6m + 6. Let p(u) = 6h(u) - 35z(u). What is c(p(g))? 275g4 Let f(i) = 8i + 18i - 28i. Let y(u) be the first derivative of -16u2 + 21. Calculate f(y(p)). 64p Let y(k) = 19 - 41 + 22 + 4k2. Let u(s) = -25s + 4. Determine y(u(v)). 2500v2 - 800v + 64 Let k(v) = 2v. Let w(u) be the second derivative of 349u*4/12 + 143u. Calculate w(k(o)). 1396o2 Let o(c) = -78c*2 - 88c*2 + 328c*2 - 72c*2 - 78c*2. Let q(l) = l - l + 0l*2 - 6l*2. Determine o(q(y)). 432y*4 Let r(i) = -497157i. Let j(l) = -4l. Calculate r(j(d)). 1988628d Let r(s) = -50s2. Let x(l) = 107l*2 - 214l*2 + 106l*2. Calculate x(r(i)). -2500i*4 Let x(o) = -24o. Let i(v) = 15 + 19v + v - 4v - 15. What is i(x(r))? -384r Let g(x) = -12x2. Let c(p) be the third derivative of p4/4 + p*2 + 36. Determine c(g(f)). -72f*2 Let s(w) be the second derivative of -3w*3/2 + 9w. Let r(n) be the third derivative of -n*4/24 - 2n*2. Give r(s(h)). 9h Let a(f) = -4f2. Let t(y) = 14 + 7 - 2y - 18 + y*2 + 0y. Let c be t(0). Let n(r) = 2r2 - 3r + cr + 0r*2. What is a(n(m))? -16m4 Let j(n) = n2 + 2n - 6. Let f be j(2). Let x(v) = -fv + 2v - 77v*2 + 78v*2. Let c(d) = 12d. Calculate x(c(g)). 144g2 Let k(t) = 2t. Let w(y) be the first derivative of -y*3/3 - 35. Determine k(w(i)). -2i*2 Let y(z) = -11z*2 + 5. Let t(f) = 6f*2 - 3. Let c = -62 + 65. Let b(o) = cy(o) + 5t(o). Let m(v) = -1 + 1 + 7v*2 + 0. What is m(b(g))? 63g*4 Let z(m) = -m + 6. Let s(a) = -2a + 11. Let l(w) = -6s(w) + 11z(w). Let j(x) be the third derivative of 11x5/60 + 536x*2. Give j(l(k)). 11k2 Let t(f) = -f2 - 9f - 10. Let k be t(-7). Let x be 4 - ((k - 3) + 1). Let w(h) = 0 - x - 5h + 2. Let u(n) = 2n2. What is u(w(o))? 50o*2 Let y(t) = -28t2. Let s(d) = -d2 + 24. Determine s(y(n)). -784n4 + 24 Let d(u) = 2u + 5. Let l(i) = 3i + 4. Let j(r) = 4d(r) - 5l(r). Let s(b) = -3b - 1. Let h(v) = -32v - 12. Let x(w) = h(w) - 12s(w). Give x(j(c)). -28c Let w(i) = -962i*2. Let o(n) = -1831n. What is o(w(c))? 1761422c2 Let s(l) = l + 14. Let p(i) = i + 21. What is s(p(o))? o + 35 Let t(u) be the third derivative of -7u*4/8 + 123u*2 - 10. Let c(x) = -x + 2x*2 + x. What is c(t(l))? 882l*2 Let g(j) = -32j - 3 + 33j + 2. Let b(n) = 35n - 28. Let r(p) = -b(p) + 28g(p). Let v(m) = 3m*2. Determine r(v(u)). -21u*2 Let b(f) = 4f - 3. Let o(k) = 0k + 2 + 5k - 4 - 2k. Let c(s) = 4b(s) - 6o(s). Let z(g) = -7g2 - g2 - 4g2. Calculate z(c(n)). -48n*2 Let u(j) = -8j - 9j + 5j. Let z(t) = -2t2 - 5t + 1. Let g be z(-3). Let v(c) = c. Let i(f) = gu(f) - 27v(f). Let o(r) = 3r. Determine i(o(m)). -9m Let p(k) be the first derivative of 7k3/3 - 3k*2/2 + 37. Let g(h) = 2h*2 - h. Let x(a) = -6g(a) + 2p(a). Let w(f) = -24f*2 - 1. Determine x(w(r)). 1152r*4 + 96r*2 + 2 Let q(p) = 40p*2 - p. Let w(k) = 2k - 17k + 19k. Give q(w(m)). 640m2 - 4m Let u(d) = 2d. Let t(x) = 6419x. Calculate u(t(r)). 12838r Let z(s) = s2 + 98s - 16. Let u(m) = 2m2. Give z(u(k)). 4k*4 + 196k*2 - 16 Let x(p) = -4p. Let c(b) = 30b - 148. Let j be c(5). Suppose -45 = 3g - 327. Let n(r) = gr - 4r*j - 94r. Determine n(x(w)). -64w2 Let k(j) = 3j. Let u(p) be the first derivative of -p*6/180 - 14p*3/3 + 3. Let x(n) be the third derivative of u(n). What is x(k(f))? -18f*2 Let p(l) = 158l. Let z(b) = 34b. Let i(g) = -3p(g) + 14z(g). Let u(q) = -3 + 3 + 24q. Determine i(u(y)). 48y Let w(h) = -4h. Let v(z) = 2z - 40z - 10z - 3z. Calculate w(v(o)). 204o Let f(w) be the third derivative of w5/30 + 7w*2. Let q(c) = 7c - 5. Let m(x) = -10x + 8. Let b(y) = 5m(y) + 8q(y). Calculate b(f(n)). 12n*2 Let m(p) = -2p. Let d(x) = -3x - 21063. Give d(m(n)). 6n - 21063 Let p be 7/(-28) - 7/4. Let f be ((-2)/(-4))/(p/(-12)). Let u(b) = 8b + 2b*2 - 5b - fb. Let j(h) = -4h. Give u(j(m)). 32m2 Let g(a) = a2. Let d(l) be the second derivative of 19l*6/360 + 11l*3/6 - 19l. Let o(b) be the second derivative of d(b). Give g(o(x)). 361x4 Let f(u) be the second derivative of -2u*3/3 - 2u*2 - 6u - 1. Let s(j) = 2j2. What is s(f(t))? 32t*2 + 64t + 32 Let x(l) = -l. Let a(u) be the second derivative of -u*3/3 + 44u*2 - 166u. Give x(a(i)). 2i - 88 Let o(c) = 5c. Let m(d) be the second derivative of -4d3/3 - 11d. Calculate m(o(j)). -40j Let d(o) = -4o*2 + 5. Let a(t) = -2t*2 + 2. Let j(x) = -5a(x) + 2d(x). Let b(l) = 227 - 114 - 113 + l. Calculate j(b(m)). 2m2 Let p(f) = f. Let i(r) be the second derivative of -r6/360 + 3r4/4 - 17r. Let x(h) be the third derivative of i(h). Calculate p(x(u)). -2u Let h(d) = -4d*2. Let l(i) = -i + 2. Let y(r) = 12 - 11r + 8 - r. Let z(q) = 10l(q) - y(q). Calculate h(z(f)). -16f*2 Let r(j) be the first derivative of -74 - 76 + 2j*3 + 145. Let s(m) = 2m*2. Calculate s(r(i)). 72i4 Let j(q) be the second derivative of q4/6 + 126q. Suppose 4f = -5g + 33, -2f + 7 = -f + g. Let m(l) = -2 - 15l + f - 22l. Determine m(j(a)). -74a2 Let l(g) be the first derivative of -g4/12 - 12g + 2. Let b(u) be the first derivative of l(u). Let z(c) = 6c2. Give z(b(v)). 6v4 Let o(b) = -b2. Suppose -u - 5q + 413 = 0, -2092 = -u - 4u + 2q. Let k(s) = -660 + u + s2 + 327 + 0s2. Give o(k(j)). -j4 - 170j2 - 7225 Suppose -1473 = -5m + 292. Let r(f) = -701f2 + 350f*2 + mf*2. Let q(g) be the second derivative of -4g*3/3 - g. What is q(r(x))? -16x*2 Let b(p) = 12p*2. Suppose -12q = -8q - 1144. Let o(m) = m2 + qm - 286m. Determine o(b(w)). 144w*4 Let m(a) = -a. Let c(r) = 309014r. What is m(c(n))? -309014n Let g(t) = -8t. Let i = -26 + 28. Let z be (-2)/(i/4-2). Let c(y) = -2y*z - 32 + 32. Determine c(g(o)). -128o*2 Let q(x) = 3x - 5. Let v be q(3). Let h(s) = -24s + 2s + v - 4. Let t(r) = r. Calculate h(t(m)). -22m Let j(k) = 39k + 1. Let w(h) be the third derivative of -h*5/20 + 3h*2 - 40. Give j(w(v)). -117v*2 + 1 Let c(b) = -2b. Let k(g) = -204 - g + 202	{ "pile_set_name": "DM Mathematics" }
-4k + 62 + 20 + 2 for f. -4 Solve 4i - 28 = -618u + 617u, 1876 = -2i + 52u for i. -2 Solve -5u - 3t = -722197 + 722189, -3u = 3t for u. 4 Solve 1166c - 1169c = x + 3, 27c + 2x - 135 = -34c - 2x for c. 3 Solve -3465 + 3515 = -5m - 5i, -m + 4i = -60 for m. 4 Solve -3t + 6t - 63 = 6s, -2s + 3t = 31 for s. -8 Solve 5 = 3d - 5s, 695 = 5730d - 5658d - 5s for d. 10 Solve 4o + o - 102p + 64 - 184 = -105p, -o + 3p + 42 = 0 for o. 27 Solve 3z - 13 = -2n, 3747n - 3749n = -5z - 5 for n. 5 Solve -2751v + w - 24 = -2755v, 0v = 4v + 6w - 224 for v. -4 Solve -4f - 5f - 4o = -4f + 23, 62f - 4o - 90 = 0 for f. 1 Solve i + 3b + 41b = -3i - 140, 49i - 51i = -5b - 11 for i. -2 Solve 13708r - 13713r + x = 22, -r + 4x + 7 = 0 for r. -5 Solve 4c - 23 = -3n + 28 + 11, -155 = c - 7n for c. -1 Solve 7i - 339 = -k + 4i - 334, k - 5i = -11 for k. -1 Solve 4s = -2g + 2s - 14, 9g + 6s + 7 = 11s for g. -3 Solve -5w = -4i + 52, w - 163i - 4 = 2w - 167i for w. -12 Solve 0 = -2i + 3p - 19, -415p + 419p = -15i + 96 for i. 4 Solve -70g + 34g + 3p + 72 = -33g, 0 = 6p + 18 for g. 21 Solve -2j - 5k - 27 = 0, 23k - 25k - 65 = 74j - 19j for j. -1 Solve i + 3y = 19367 - 19350, -5i - 2y + 11 = -9 for i. 2 Solve 3g + 35136i = 35140i - 64, 3i - 31 = -2g for g. -4 Solve 0 = -3j + 77c - 73c - 159, 12j - 3c = -9j - 63 for j. 3 Solve 0 = -5u + r - 150, -328u + 325u = -r + 88 for u. -31 Solve -2041209m + 2041211m = 5k - 55, -3m - 44 = -4k for m. 0 Solve -4h - 3j - 33 = 3j + 1, 5j + 30 = -5h for h. -1 Solve 4u + x - 13 = 20, 0 = 882u - 881u + 4x - 162 for u. -2 Solve -4m + 4 = -y, -11y - 2m + 354 = 306 for y. 4 Solve 250 = 9y - 3j + 103, -3y - 33j + 37j + 36 = -y for y. 16 Solve 2f - 1773m = -1779m + 32, -2 = -2f - m for f. -2 Solve 20d - 24d = 5o + 43, -7o + 4d - 12 = -67 for o. 1 Solve -4p - 22 = 2t, 5t + 0t + 54 - 15 = -8p for t. 5 Solve 488u - 497u - 18 = 4p, 20u = 4p + 76 for u. 2 Solve l + 3 = 0, 1006 = 5g - 4l + 1044 for g. -10 Solve 0 = 3n + 2t + 140, -2t + 65 = -733n + 729n + 2t - 135 for n. -48 Solve 0 = -10f - 8l - 8l + 13l - 273, 5f + l - 53 = 7f for f. -27 Solve 4q - 2r - 18 = 0, 18q - 14q - 2r = 48r - 222 for q. 7 Solve -13j + 272 = 4c + 295, 6j = -3c - 6 for c. 4 Solve -37 = 3d - 5i, -24i = 3d - 20i + 22 - 30 for d. -4 Solve -2p - 19 = 5o, -8p + 0p - 2p = -7p + 24o + 111 for p. 3 Solve -658 = -29i - 4s, i - 2i - 10s + 7 = -13s for i. 22 Solve 4h + 0 = -5i - 56, -3i - 719813h - 26 - 22 = -719809h for i. -4 Solve -17372x = -17367x + 3k + 28, 0 = -x + 10k + 111 for x. 1 Solve 25 = 3k - 2w, 14k - 64 = -32k + 38k + w + 7w for k. 9 Solve 3j = -5b + 8, -5j - 435355 + 435375 = 5b for b. -2 Solve 4t + 49 + 41 = -12i + 15i, -11i + 426 - 109 = -19t for t. 3 Solve 17q - 303g = 21q - 298g + 9, 4g = -5q for q. 4 Solve 20 = -329z + 327z + 4u, 15u = 5z + 12u + 22 for z. -2 Solve p - 50 = t, -2356920p + 2356921p - 4t - 41 = 0 for p. 53 Solve b + 4d = 5896 - 5949, -4b - 97 = -7d for b. -33 Solve 2692u = 2690u - 4c + 18, -9 = 2u - 5c for u. 3 Solve -4q + 4q + 3 = -q - z, 0 = 40q - 10q - z - 34 for q. 1 Solve m - 4o = -18, -39 + 23 - 206 = -74o for m. -6 Solve -5a = 3g - 28, -a - 11g + 81 = 13 for a. 2 Solve 35737c - 35739c + 3h - 34 = 0, 4c + 2h = 4c + 16 for c. -5 Solve 4m + 168 = 6r, 3r + 0m = 3m + 2m - 16 + 109 for r. 26 Solve 17x + 0p - 2p = -86, 5x + x + 68 = -2x + 4p for x. -4 Solve 0d + 74m + 21 = -d + 77m, 33m - 135 = -5d for d. -6 Solve -2l + 5 = 44o - 41o, -2o = -130l - 660 for o. 5 Solve 3d - 3i = -d + 55, -182d = -195d - 5i - 13 for d. 4 Solve 0 = -4s + 24, 0 = -0c - 2c - 5c + 3c - 3s - 2 for c. -5 Solve -4s = 57j + 18, 20 = 2s + s + 4j - 44 for s. 24 Solve 13710t - 35 = 5f + 13725t, 5f + 5t - 5 = 0 for f. 5 Solve 3m = 5y - 218, 716y + 134 = -m + 719y for m. 4 Solve 4k = 450s - 453s - 82, 17s - 99 = 7k for s. -2 Solve 5 = -4k + 13j - 23, -j + 98 - 206 = -112 for k. 6 Solve -w = 23, w + 3 = 16293y - 16289y for y. -5 Solve -1370839p + 1370834p - 25 = f, 5p - f + 15 = 0 for p. -4 Solve 2d + 3249z - 3254z - 17 = 0, -11 = d + 4z for d. 1 Solve 4q + 162y + 153 = 163y, -3q - 4y = 129 for q. -39 Solve 3g = 2n - 18, 18n + 3g = 28n - 5n - 36 for n. 6 Solve t = 2t - 2p - 2 + 8, -4p = 60t + 112 for t. -2 Solve 4j + 4i = 1 - 2 - 15, 27 = 2j - 5j - 8i for j. -1 Solve -318 = 4b + u - 380, 7b + 13u = 86 for b. 16 Solve -646m - 647m + 1295m + t + 3 = 0, m + 41t + 447 = 0 for m. 4 Solve -79 = 14d + 3g, -4d + 31 + 56 = g + 114 for d. 1 Solve -2l = 18, 587h - 586h + 8l = -71 for h. 1 Solve -5z - m = -10z - 24, 4z - m - 388 = -814 + 406 for z. -4 Solve -59i - 457u + 453u = -155i - 1144, 3i = -5u - 46 for i. -12 Solve 14s + 42i - 45i + 114 = 0, 3i + 5 = -s - 16 for s. -9 Solve 16 = -11x + 8x + 100, 230y + 7x = 228y + 192 for y. -2 Solve -464 = -7z - 4a, -5z - 6a - 264 = -982 for z. -4 Solve 4q = 0, 0q + 0q = 5k - 2q + 22 - 51 + 19 for k. 2 Solve -i + 14 = -4t, 53716t = 4i + 53714t for i. -2 Solve -4090h + z = -4086h + 33, -65z + 325 = 0 for h. -7 Solve 4y = 3y - 111d + 110d - 21, 3d + 23 = 5y for y. -5 Solve -10415o + 66 = -10417o + 4v, -2v = -7o - 231 for o. -33 Solve -3y + l + 4l = -31 + 54, -4y - y - 6l + 19 = 0 for y. -1 Solve 120q + b + 2758 = 0, 36 - 67 - 36 = 3q + b for q. -23 Solve 283 = 6w - 2o + 3o, 5w - 4o + 239 = 7w + 3w for w. 47 Solve -5o + 31 - 216 - 5 = 12d, 12o - 9o + 3d + 51 = 0 for o. -2 Solve 4i - 17547672o = -17547668o + 48, 6 = 4i + 3o for i. 6 Solve 5h + 5 = 5w, -5w + 7w + 2 = -12h - 10 for h. -1 Solve -6x - 10i - 65 = -3x, 53x - 52x + 5i = -30 for x. -5 Solve 2a - 62 = -0g - 0g, 17a + 68 = 3g - g + 19a for g. 3 Solve -25 = 5x + 4u + 11, 159u - 156u = 4x + 4 for x. -4 Solve 0 = -r - 3f + 5f + 23 - 32, 50r + 7f = -450 for r. -9 Solve -3n - 10b + 66 + 36 = 38b, -n - 952b + 4 = -951b for n. 2 Solve 0p = -0p + 7p + 28, 0j + 2j + 318p - 322p - 4 = 0 for j. -6 Solve -3734m - g = -3738m - 6, 15m - 96 = -16g for m. 0 Solve -p + p + 140 = 4p + 5t, -4t + 71 = -5p for p. 5 Solve -54 = 12i - 3a, -5i + 5a + 19 = 5a + 2a - 69 for i. 4 Solve 3d = -5o - 226, -990 = -o - o - 127d - 199d - 106 for o. -47 Solve 495o - 2b = 492o - 61, 8b - 125 = 5o for o. -17 Solve 11v = 2u + 8, -16443u = 2v + v - 16448u - 20 for v. 0 Solve -4c = -70c + 62c + 3y + 8, -7y = 4c - 2y + 56 for c. -4 Solve 47921 = n + 4c + 47901, -6n - 7c = -3n - 80 for n. 36 Solve -3o = 2o + 4o - 10o - 3x - 10, -6x = 12 for o. -4 Solve -4b - 14q + 54 = -b - 13q, 0 = 5b + 22q - 29 for b. 19 Solve 142k + 26 = 17t + 143k - 59, -5k + 105 = 2t - 320 for t. 0 Solve -6n = 6663d - 6662d - 47, 5d - 95 = -2n for n. 5 Solve 2q + t + 3 = 0, -2q + 105 = -3q + 2t + 101 for q. -2 Solve -90 = -2m + 1056f - 1054f, 2m + 28 = -57f for m. 43 Solve 6i = 2i + 104, -3m - 219 = -4i - 0i - 5i for m. 5 Solve -5h - p = 41, -69p + 36 = 68p - 128p for h. -9 Solve 13f + 5v = -16, 57f + v + 51 = 32f + 31f - 2v for f. 3 Solve -5g + 29805h - 81 = 29807h, -198 = -2g + 4h for g. 3 Solve 0 = 25j + 160j - 183j - h + 9, 0j - 2h = 2j + 18 for j. -6 Solve 0 = -b + 2z - z + 3z + 21, -415z + 414z = b + 9 for b. -3 Solve f = -8, 0 = 4k - 2597f + 2595f - 36 for k. 5 Solve -12 = 2n, 84t - 175t - 21n = -95t + 110 for t. -4 Solve 4q - 5u = 28, 12q - 2u + 4u - 14 = -q - u for q. 2 Solve 0 = 6v - 119b + 123b + 118, -4v = -5b + 48 for v. -17 Solve 2k + 5h + 12 = 0, 22h + 46 = 43k - 14k - 12k - 19k for k. -1 Solve -2u = -9j - 55, -u + 13j + 3840 - 3770 = 0 for u. 5 Solve -3v - 6 = 3k, 149664v - 149668v = 3k + 13 for v. -7 Solve -3x + 449 = 2x + v, 3x - 27 - 102 = -6v + 135 for x. 90 Solve -3121d - 316 = -3120d - 5q, 12d - 304 = -4q for d. 4 Solve 2c - 26 = -6s - 68, -5s = 3c + 51 for s. -3 Solve -57472n + 11 = -57469n + 5h, -5n - 3 = -3h + 6h for n. -3 Solve b - 9 + 17 = 10l + 10, -l = 4b -	{ "pile_set_name": "DM Mathematics" }
In base 8, what is 5 + -622564? -622557 In base 13, what is -7 - -93ab? 93a4 In base 9, what is -23814 - 11? -23825 In base 15, what is 2e8e + -1? 2e8d In base 4, what is -1121 - -13300? 12113 In base 8, what is -6 + 72515? 72507 In base 6, what is -1 + -14011? -14012 In base 3, what is -1112101120 - 0? -1112101120 In base 5, what is -140 + -143342? -144032 In base 3, what is 2201211101 + -10? 2201211021 In base 4, what is 3012131320 + 3? 3012131323 In base 2, what is -10111010101110000 - 11? -10111010101110011 In base 11, what is -3a53 + -1? -3a54 In base 9, what is 1 - 146821? -146820 In base 12, what is 29 - -3458? 3485 In base 2, what is 1001 - -1100001011101? 1100001100110 In base 15, what is -490cdb - 1? -490cdc In base 11, what is -213 + 3a95? 3882 In base 9, what is 1 + -552717? -552716 In base 16, what is 4fd6 + -4? 4fd2 In base 8, what is 3 - 20622? -20617 In base 7, what is -3 + -16450621? -16450624 In base 14, what is -3 - 2966? -2969 In base 2, what is 1000111 - 10111010001010? -10111001000011 In base 16, what is a372 - -d? a37f In base 6, what is -1115535 + 42? -1115453 In base 4, what is 11 - 1312? -1301 In base 2, what is 100011 + -1100010? -111111 In base 12, what is -1 - 1b51? -1b52 In base 16, what is 2f41 - 35? 2f0c In base 3, what is 12 - -12120012? 12120101 In base 9, what is -5 - -34025? 34020 In base 9, what is -15142 - -8? -15133 In base 16, what is -2 + -451c? -451e In base 6, what is 5 + -2031143? -2031134 In base 15, what is -c1da + c? -c1cd In base 10, what is -85 + -1818? -1903 In base 16, what is -10 + 26? 16 In base 6, what is -20 - 25422? -25442 In base 3, what is -1021202020020 - -2? -1021202020011 In base 15, what is 6a2 - -a? 6ac In base 13, what is -523 + -6b3? -c06 In base 11, what is -537 - 57? -593 In base 5, what is -3 - -20022023? 20022020 In base 8, what is -7204 + -62? -7266 In base 14, what is 2b2 + -18? 298 In base 12, what is b56a8 - 4? b56a4 In base 13, what is -51293 + 0? -51293 In base 15, what is -a7e366 + -1? -a7e367 In base 3, what is 1220011122 + 11? 1220011210 In base 10, what is 73368 - -3? 73371 In base 6, what is 45 + -1541? -1452 In base 4, what is -10 - -20010132? 20010122 In base 4, what is 3311 + -10120? -203 In base 15, what is 730 - -e? 73e In base 3, what is 102 - -122220101? 122220210 In base 3, what is -201 - -2200210120? 2200202212 In base 2, what is 10010 - 110101011111001111? -110101011110111101 In base 11, what is -145a - 93? -1542 In base 13, what is -b529a - 4? -b52a1 In base 3, what is -101000211220200 - -12? -101000211220111 In base 9, what is 116411 - -1? 116412 In base 12, what is 5857 + 4? 585b In base 15, what is 35 + -3013? -2ecd In base 2, what is -1 + -10010001101? -10010001110 In base 11, what is -3829 - 101? -392a In base 11, what is 3130a6 - -2? 3130a8 In base 6, what is 42 - -31505? 31551 In base 8, what is -22415 - 75? -22512 In base 6, what is 10 - -44450? 44500 In base 8, what is -2707 + 202? -2505 In base 14, what is -2 + -384? -386 In base 10, what is -91381 - 49? -91430 In base 9, what is 6282 - 116? 6165 In base 11, what is 34 - 3961? -3928 In base 7, what is -23 - 22262? -22315 In base 12, what is 122226 - 4? 122222 In base 5, what is -44101422 + 14? -44101403 In base 14, what is 20c - -75a? 968 In base 15, what is 2997 + -35? 2962 In base 10, what is 1 + -18961? -18960 In base 11, what is 7 + -104293? -104287 In base 4, what is -20020233 + -1032? -20021331 In base 12, what is 28 - -2b490? 2b4b8 In base 5, what is 3243422402 + 10? 3243422412 In base 9, what is 13451 + -5? 13445 In base 7, what is -11232545 + 4? -11232541 In base 16, what is -3 + 8433? 8430 In base 8, what is -3037 + 3? -3034 In base 15, what is -5ec - ca? -6c7 In base 7, what is -136 + -41450? -41616 In base 9, what is -700326 + -1? -700327 In base 10, what is 22356 + -8? 22348 In base 16, what is 79 - 14a2? -1429 In base 9, what is 51 + -13360? -13308 In base 15, what is -254 + -11d? -372 In base 11, what is -40340 - 3? -40343 In base 7, what is -22461 - 22? -22513 In base 11, what is -3 + -5645? -5648 In base 4, what is 1 + -2031300? -2031233 In base 6, what is 323155 + -2? 323153 In base 9, what is -2 + 227603? 227601 In base 6, what is -3 + -511? -514 In base 8, what is -52506 - -26? -52460 In base 3, what is -110011020 + -120? -110011210 In base 4, what is -113222 - 1001? -120223 In base 9, what is 4 + 2034405? 2034410 In base 7, what is 1230 - 1556? -326 In base 12, what is a + 22050? 2205a In base 9, what is -2 + 207227? 207225 In base 7, what is 11 + -10310? -10266 In base 15, what is -13 - 26843? -26856 In base 7, what is 3 - -561211? 561214 In base 14, what is -5 + -1d9b? -1da2 In base 7, what is 12652 - -65? 13050 In base 14, what is -5 + 41bdd? 41bd8 In base 5, what is 34343 + -3? 34340 In base 7, what is -3205 + 25? -3150 In base 6, what is -4 + 1344124? 1344120 In base 2, what is 100010000011 + -1111? 100001110100 In base 7, what is -4005 + -64? -4102 In base 9, what is -514075 + -2? -514077 In base 9, what is 714 - 606? 107 In base 7, what is -5 + 1223111? 1223103 In base 15, what is -380 - -1e4? -18b In base 8, what is 1174 + 701? 2075 In base 6, what is -13311 - 22305? -40020 In base 3, what is 2111 + -222111? -220000 In base 15, what is -1 + 689a? 6899 In base 3, what is -102020 + -110200? -212220 In base 6, what is 5 - 42352? -42343 In base 5, what is -100420 + 204? -100211 In base 11, what is 1354a43 - 5? 1354a39 In base 14, what is 6 + 2073? 2079 In base 5, what is 141 + 10441421? 10442112 In base 4, what is -10310 - -2221113? 2210203 In base 16, what is 9 + -f52? -f49 In base 8, what is -114 + -35723? -36037 In base 14, what is 26a0 - -97? 2757 In base 10, what is -68 + -121? -189 In base 12, what is 12 + -42a? -418 In base 16, what is 23 + -7d76? -7d53 In base 16, what is -1881 - 62? -18e3 In base 5, what is -240012 + 42? -234420 In base 3, what is -2 + -2111022221011? -2111022221020 In base 6, what is 421455450 - 3? 421455443 In base 13, what is 25 + -26? -1 In base 2, what is -10001110011 - -1100? -10001100111 In base 16, what is 40637 + 4? 4063b In base 8, what is -2344 + -3? -2347 In base 16, what is -28e - 24? -2b2 In base 10, what is -68800 + 1? -68799 In base 2, what is 1100101000100011 - -11? 1100101000100110 In base 7, what is -320131 - 5? -320136 In base 12, what is -169a17 - 2? -169a19 In base 10, what is -1 - 167895? -167896 In base 5, what is -2101 + -40201? -42302 In base 4, what is 10103 + -221? 3222 In base 4, what is 130223 - 2003? 122220 In base 13, what is -38161 - -4? -3815a In base 11, what is -1931 + 3? -1929 In base 7, what is -1024202 - 16? -1024221 In base 9, what is -31185 + 37? -31147 In base 2, what is 100 + 10111010011100? 10111010100000 In base 9, what is -17460 - -56? -17403 In base 6, what is -1515 - -2020? 101 In base 6, what is -3342 + 554? -2344 In base 6, what is 5 - 10035522? -10035513 In base 7, what is -3 + -443024? -443030 In base 12, what is 1b0b0 - 3? 1b0a9 In base 8, what is -433407 + 4? -433403 In base 11, what is -3 + -19388? -19390 In base 13, what is -4a135 - 4? -4a139 In base 16, what is -4 - 25e1? -25e5 In base 13, what is -7278 - -16? -7262 In base 6, what is 2243231 - 3? 2243224 In base 10, what is 58 - -9925? 9983 In base 16, what is 2c4 + -22? 2a2 In base 6, what is 525 - 1142? -213 In base 6, what is -4435011 - -2? -4435005 In base 2, what is -10101 - -1011101011111? 1011101001010 In base 11, what is -2 + 4285a? 42858 In base 4, what is 3 + -1203203021? -1203203012 In base 5, what is 3104302 - -144? 3110001 In base 2, what is -11000100101111 - -100000? -11000100001111 In base 16, what is 0 + 18fca? 18fca In base 4, what is 133 + -123210? -123011 In base 7, what is -413 + -15? -431 In base 11, what is 45a93 + 5? 45a98 In base 8, what is -16 - 201374? -201412 In base 2, what is 10100110110000 + -101110? 10100110000010 In base 3, what is -12 - 10000211001020? -10000211001102 In base 3, what is 20001 + 2020112? 2110120 In base 7, what is 104 - 1022? -615 In base 15, what is a8 - 12d8? -1230 In base 14, what is -47 - -5a90? 5a47 In base 11, what is -31891 + -15? -318a6 In base 6, what is 10321 + -405? 5512 In base 12, what is 45a2 - 3? 459b In base 4, what is -201121 - -130212? -10303 In base 2, what is 101	{ "pile_set_name": "DM Mathematics" }
e s + 8 = 3c - 4s, -3c - 2s = -22. Suppose cb - 46631419 = 7848581. Round b to the nearest 100000. 9100000 Let c = -154954 - -154955.51741. Round c to two decimal places. 1.52 Let n = -34825 + 34818.72864. Let f = 6.27 + n. What is f rounded to four dps? -0.0014 Let w = 194206.9 - 183481. What is w rounded to the nearest 1000? 11000 Let m = -975 + 978. Suppose 4i - 2 = 2o, -2i - o + 3 + 0 = 0. Suppose -m = -n - i, -2n - 2459996 = -3v. Round v to the nearest one hundred thousand. 800000 Let h(j) = -300989j - 1379. Let f be h(-11). Round f to the nearest 10000. 3310000 Let n = -120.207 - -0.207. Let m = n - -121.66. Let a = -1.881 + m. Round a to two decimal places. -0.22 Let d = 57.3 - -13.7. Let c = d + -71.00000232. Round c to seven decimal places. -0.0000023 Let s = -0.173 - -472.173. Let o = s + -472.000004. Round o to five decimal places. 0 Let l be -3 + (20/(-4) - -7). Let t be -2 - 2652004/(-4) - l. What is t rounded to the nearest 10000? 660000 Let v = 93.59 + -198.01. Let p = -1.42 - v. Let w = 102.999448 - p. What is w rounded to four dps? -0.0006 Let a = -958.1 - -875. Let p = -83.0352 - a. What is p rounded to 2 dps? 0.06 Let t = 7467.5452094 - 7534.79256. Let v = t + -0.0983494. Let c = -67.3 - v. What is c rounded to 3 dps? 0.046 Let k = -29 - -81. Let p = k + -51.885. Let w = 0.091 + p. Round w to 2 decimal places. 0.21 Let k = 39 - 35. Suppose ko = -2o + 14301162. Suppose -4v - 28000008 = 4m, -v = -m + 9383525 - o. What is v rounded to the nearest 1000000? -7000000 Let q = -14.02656 - -14.074. Round q to one dp. 0 Let i = 5946 + -5798.6. What is i rounded to the nearest ten? 150 Let y(z) = -2z*2 + z. Let a(i) = 89i*3 + 9i*2 - 8i. Let s(f) = 2a(f) + 10y(f). Let m be s(-4). Round m to the nearest 1000. -11000 Suppose -v + 6 - 14 = 5m, 5m = 0. Let t(n) = -615193n2 - 28n - 1. Let s be t(v). Let u = 5172129 + s. What is u rounded to the nearest one million? -34000000 Let a = 3685.000002434 + -3685. Round a to six decimal places. 0.000002 Let w(z) = 210z3 - 5z*2 - 46z - 15. Let v be w(-15). What is v rounded to the nearest 10000? -710000 Let p = 133.706545 - 133.7. Let y = -0.0054 + p. Round y to four decimal places. 0.0011 Suppose -k + 6263992 = -4h, 0 = -2k + 4k + 2h - 12528004. Suppose -k = 35r + 10r. Round r to the nearest ten thousand. -140000 Let s = -1669 - 271. Let a = s + 1954.07. What is a rounded to 0 dps? 14 Let o(b) = -2331b + 306. Let v be o(-2). What is v rounded to the nearest one thousand? 5000 Let b = 76760.30398 + -76761. What is b rounded to 1 dp? -0.7 Let y = 92.6 - 11.1. Let f = y - 61. Let s = 25 - f. Round s to zero dps. 5 Let d = 30912 - 30956.284. Round d to the nearest 10. -40 Let t = 0.030408 - -0.011958. What is t rounded to 2 dps? 0.04 Let c = 16 + -16.067. Let f = 0.437 + c. Let d = f + -0.3684. What is d rounded to four decimal places? 0.0016 Let w = -75.19 + 75.82. Round w to the nearest integer. 1 Let m = 220.618 + 0.382. Let f = m - 221.679. What is f rounded to two dps? -0.68 Let u(a) = -12a - 8 + 193a2 + 9 - 4 + 259a*2 - 3a. Let b be u(-1). Round b to the nearest 100. 500 Suppose 9y + 14y - 54413831 + 179280831 = 0. What is y rounded to the nearest 10000? -5430000 Let h = 80542.0000046203 + -80542. Round h to 7 dps. 0.0000046 Suppose -39 = -z - 0. Suppose z = p - 9209. Let c = p - 16388. Round c to the nearest one thousand. -7000 Let s(w) = -1360w + 324. Let o be s(7). Let f = o + 3239. Round f to the nearest 100. -6000 Let a = -0.08708 - -169.56708. Let o = -0.48 + a. Let j = o - 169.0000178. Round j to 6 dps. -0.000018 Let q = -30233.86 - -29727. Let i = 518 + q. What is i rounded to one dp? 11.1 Let y(o) = 4299o*2 - 9o - 14. Let j = 49 + -51. Let u be y(j). What is u rounded to the nearest ten thousand? 20000 Let i = 115 - 51. Let b = -64 + i. Suppose 0 = 4f - a + 800005, -399975 = -bf + 2f + 5a. What is f rounded to the nearest 100000? -200000 Let o = -49.34 + 67.8. Let t = 19.7 - o. What is t rounded to 1 decimal place? 1.2 Let b(w) = 1496w + 156. Let p(f) = -f2 - 12f - 68. Let l be p(-8). Let u be b(l). Round u to the nearest ten thousand. -50000 Let y = -0.3891 + 0.741. Let k = -0.28 + 0.62. Let x = y - k. What is x rounded to 3 dps? 0.012 Let g = -369670.9776 - -369974. Let v = 303 - g. Round v to 2 decimal places. -0.02 Let b = 2693403514 - 2693403386.00000424. Let x = 14111 + -14239. Let m = x + b. What is m rounded to seven decimal places? -0.0000042 Let b be -5 + (-28)/(-12) - 4/(-6). Let g be 28/6 + b/(-6). Suppose -11920 = -gl + 33080. What is l rounded to the nearest 10000? 20000 Let b = -2797776171140788814 - -2797776133180543259.00000527. Let x = -37960244979 - b. Let h = 576 - x. What is h rounded to 6 decimal places? 0.000005 Suppose 0g + g + 4f + 8 = 0, 0 = -4g + 3f - 51. Let y(o) = -o*2 - 19o - 14. Let i be y(-14). Let m = g - i. What is m rounded to the nearest 10? -70 Suppose -715688 - 988712 = 2u. What is u rounded to the nearest 100000? -900000 Let n = -2.43 + -3.29. Let j = 0.63 - n. What is j rounded to zero dps? 6 Let x = -14.8933 - 1080.7767. What is x rounded to the nearest 10? -1100 Let b = -29003 + 30237.7. What is b rounded to the nearest one hundred? 1200 Let i = 10.9919 - 3.865. Let z = i - 7.19. Round z to 3 decimal places. -0.063 Let t = -2560.81358 + 0.01358. Round t to the nearest 100. -2600 Let s = 304 + -306.687. Let y = -2.57 - s. Let p = y + 0.823. Round p to one decimal place. 0.9 Let y = 756.1 - 756.29045. What is y rounded to two dps? -0.19 Suppose 0 = 7g - 3122 - 2464. Suppose 4m - g = 6m. Round m to the nearest 100. -400 Let t = 41488242699 - 41488046637.199765. Let r = 196061 - t. Let q = r - -0.8. Round q to five decimal places. -0.00024 Let q = 332499 - 333207.114. Let y = 704 + q. Round y to the nearest integer. -4 Let t(i) = -2i2 + 46i + 3. Let m be t(24). Let k be ((-5994)/m)/(3/1070). Suppose 0s = -2s - 8, -5n = -2s - k. Round n to the nearest 1000. 10000 Let q(y) = 530y - 296. Let b be q(11). Suppose 103h = 101h - b. What is h rounded to the nearest 100? -2800 Let d = -1325837076.2400394 + 1326329375.23. Let g = d - 492301.7. Let h = -2.71 - g. Round h to 5 decimal places. 0.00004 Let m be 5 + 2 - (18 + 14). Let p be 2/10 - (-36125005)/m. What is p rounded to the nearest 1000000? -1000000 Let s = -7037.9899146 - -7038. What is s rounded to 4 dps? 0.0101 Let w = 19364 - 19363.956745. Let d = w + -0.043. Round d to 5 decimal places. 0.00026 Let n = -0.38825 - 5.30575. What is n rounded to the nearest integer? -6 Let l be (2750/825)/(((-2)/(-1440))/(586750/(-6))). What is l rounded to the nearest 1000000? -235000000 Let z = 0.048 - 2.328. Let v = -2.279999551 - z. Round v to seven dps. 0.0000004 Let f(g) = -148g - 14 - 18 - 680g. Let x be ((-9)/4)/((-3)/8). Let q be f(x). What is q rounded to the nearest 1000? -5000 Let f be 0 + 67364 - (-224)/(-16). Round f to the nearest 1000. 67000 Let m = -32.93 + -0.07. Let g = -110 - m. Let o = -77.0000032 - g. Round o to 6 dps. -0.000003 Let i = 560 + -312. Let x = 180 + i. Let q = 428.000602 - x. Round q to four dps. 0.0006 Let z = 16.32 + -0.32. Let f = -14.44 + z. Let s = f + -1.560129. Round s to five dps. -0.00013 Suppose -92q + 1413206 = i - 93q, 5q = 3i - 4239610. What is i rounded to the nearest one hundred thousand? 1400000 Suppose -4p + 5u = -28, 2p + 5u + 16 = -0. Suppose m + a - 469 = -pm, 5m = -4a + 784. Let o = 232 - m. What is o rounded to the nearest ten? 80 Let v = -16.6 + -73.4. Let n = -46 - v. Let a = n + -63.2. Round a to 0 dps. -19 Let l = 16.9 - -3.1. Let w = l + -20.29. Let f = -0.2900104 - w. What is f rounded to six dps? -0.00001 Let p be ((-5020800)/3)/(192/1632). What is p rounded to the nearest one hundred thousand? -14200000 Let d = -43906427960395202 - -43906427999332899.176500577. Let l = d - 38937868.1765. Let i = 171 + l. What is i rounded to seven decimal places? 0.0000006 Let j = 2449.4564 - 2449. Let x = -0.1246 - j. Let c = -0.5810347 - x. What is c rounded to five decimal places? -0.00003 Let w = 178 + -169.1. Let j = -10 + w. Let a = j + 1.09744. Round a to 4 dps. -0.0026 Suppose -8 = -2f + 4. Let b be f/(-21) + 1 + (-60)/(-14). Suppose -7h + b*h = -1500. What i	{ "pile_set_name": "DM Mathematics" }
Let m(f) = 2f + 5. Let a(g) = 6g + 15. What is wm(i) - 4a(i)? -2i - 5 Suppose -5 = -2w - 1. Let n be w - ((1 - 3) + -3). Let o(h) = -7h + 7. Let a(i) = 8i - 8. Give no(r) + 6a(r). -r + 1 Let x be -22(-42)/28. Let r(f) = -14f. Let v(d) = -2d. Determine xr(c) - 44v(c). 4c Let b(a) = -5a*3 - 3a*2. Let c = 16 - 13. Let p(h) = 6h*3 + 4h*2. Determine cp(q) + 4b(q). -2q*3 Let s(h) = 9h*2 + 4h - 9. Let p be 1/((-3)/(-27)3). Let l(f) = 3f + 5. Let r(q) = q*2 + 4q + 5. Let b(t) = 6l(t) - 5r(t). Calculate ps(o) + 5b(o). 2o2 + 2o - 2 Let w(o) = 5o2 - 4o + 1. Let f(k) = 11k2 - 9k + 2. Let g be 30/(-4)(-20)/6. Let p be 10/g - 134/10. Give pw(v) + 6f(v). v2 - 2v - 1 Let f(v) = 10v. Let i(n) = -217n - 63. Let b(o) = 7o + 2. Let u(h) = -63b(h) - 2i(h). Give -5f(q) - 7u(q). -q Let a(h) = -3h - 1. Let k(u) = 4u + 1. Let p(z) = -3a(z) - 4k(z). Let w(l) = -6l - 1. What is 4p(q) - 5w(q)? 2q + 1 Let a(x) = -3x*3 + 9x*2 - 8x. Let g(r) = -2r3 + 8r*2 - 7r. Calculate 4a(l) - 5g(l). -2l3 - 4l*2 + 3l Let k(y) = 6y3 - 7y*2 - 36y. Let s(q) = 4q3 - 5q*2 - 24q. Determine 5k(z) - 7s(z). 2z3 - 12z Let p(f) = -4f3 - 4f*2 - 3f + 7. Let d(x) = -9x3 - 9x*2 - 7x + 15. What is -6d(n) + 14p(n)? -2n3 - 2n*2 + 8 Let u(s) = 2s*2 - 10s + 5. Let r(w) = 1. Calculate -6r(d) + u(d). 2d*2 - 10d - 1 Let p(h) = 12h3 - 5. Let m(f) = -13f*3 + 6. Calculate -5m(y) - 6p(y). -7y*3 Let a(g) = 9g*3 - 7g*2 - 5g - 9. Let d(c) = -13c3 + 10c*2 + 7c + 13. Determine -7a(o) - 5d(o). 2o3 - o2 - 2 Let n(g) = 12g*2 - 7g + 4. Let i be 3 + 13 + -1 + 2. Let v(h) = 6h*2 - 4h + 2. Calculate iv(l) - 4n(l). -6l2 - 2 Let v = -6 + -1. Let x(m) be the third derivative of m4/8 - 2m*3/3 - 2m*2. Let n(h) = -h + 1. Give vn(g) - 2x(g). g + 1 Let g = 2 + -2. Let y = 2 + g. Let a(v) = 4 - 6 + vy + 4. Let p(c) = 6c*2 + 11. What is -22a(o) + 4p(o)? 2o*2 Let z(i) = 4i - 1. Let g(w) = 5w - 1. Calculate -4g(b) + 3z(b). -8b + 1 Let t(k) = -2k - 7. Let l(a) = -4a - 15. Let o(d) = 3d - 1. Let x be o(2). Let m be 2 + -5 + (x - 8). Determine ml(u) + 13t(u). -2u - 1 Let a(g) = 30g3 - 5g + 5. Let y(c) = 15c3 - 3c + 3. Give 3a(z) - 5y(z). 15z3 Let k = 111 + -119. Let f(n) = 4n*3 - 8n - 8. Let h(y) = -3y3 + 5y + 5. What is kh(j) - 5f(j)? 4j3 Let w(r) = r2 + 1. Let g(t) = -7t3 - t2 - 2. Give g(f) + w(f). -7f3 - 1 Let s(w) = 2w*2 + 6w - 3. Suppose 6 = j + 2b, 5j - 3b + 0b - 30 = 0. Let z(a) = 4 + 0a - a - 3a2 + a2 - ja. What is -6s(h) - 5z(h)? -2h*2 - h - 2 Let j(a) = -7a + 6. Let s(n) = -n + 2. Let u(c) = j(c) - 6s(c). Let i(k) = 2. Suppose -21 = -2l - 5y, 5y = -3l - 3 + 22. Calculate lu(w) - 5i(w). 2w + 2 Suppose -p = 3p + 4. Let k(m) = 2m*2 - 5. Let y(l) = 1. Calculate pk(t) - 3y(t). -2t*2 + 2 Let m be (-1)/((-2)/(-1 + 15)). Let q = -5 + 11. Let g(k) = 0k - 2k2 - 3k*2 - 6 - qk. Let a(h) = -6h2 - 7h - 7. Calculate mg(x) - 6a(x). x*2 Let n(g) = -5g*2 + g + 2. Let t = 12 + -18. Let u(x) = -3 - 19x + 1 + 18x + 4x*2. Calculate tn(j) - 7u(j). 2j*2 + j + 2 Let u(o) = 21o*2 + 8o + 25. Let y(k) = -5k2 - 2k - 6. Determine 2u(z) + 9y(z). -3z2 - 2z - 4 Let u(d) = d + 1. Let p(y) = -6 + 3 + 4 + 0. Give p(l) - u(l). -l Let l(a) = 6a3 - 4a*2 - 6a - 1. Let h(r) = 7r3 - 5r*2 - 7r - 2. Determine -4h(n) + 5l(n). 2n3 - 2n + 3 Let h(w) = 7w - 4w - 2w + 1. Let y(n) = -2n*2 - n - 4. Calculate 3h(u) + y(u). -2u2 + 2u - 1 Let f(a) = 3a - 2. Let d(x) = -30x + 16. Let p(o) = -30o + 17. Let k(n) = 4d(n) - 5p(n). Determine 21f(h) - 2k(h). 3h Let r(w) = w + 2. Let z(u) = u. Let m(q) = 2q - 5. Let x(i) = m(i) - 4z(i). Give 7r(p) + 3x(p). p - 1 Let r(s) = -4s2 - 3. Let a(m) = 29m*2 + 34m*2 - 64m*2. Give 3a(k) - r(k). k2 + 3 Let s(q) = -q2 - 4q - 3. Let p(n) = n2 + 7n + 7. Calculate 4p(j) + 7s(j). -3j2 + 7 Suppose 5h = -5, f + 3h = 5h + 19. Let c(s) = 4s3 + 7s*2 - 5s - 6. Let y(x) = -11x3 - 20x*2 + 14x + 17. Give fc(t) + 6y(t). 2t3 - t2 - t Let u(d) be the first derivative of -d3/3 + d2/2 - d + 2. Let t(a) = -2a*3 - 2a*2 + 3a - 3. Suppose 11 + 34 = -15f. What is fu(g) + t(g)? -2g3 + g2 Let a(r) = 7r*2 + 4r - 4. Let s(l) be the second derivative of l4/3 + l3/3 - l*2 + 7l. Calculate -3a(z) + 5s(z). -z*2 - 2z + 2 Let l(x) = -x + 11. Let n be l(9). Let t(g) = g - 1. Let m(d) = 2d - 2. Give nt(u) - 2m(u). -2u + 2 Let k(y) = -18y2 + 5y. Let w(v) = v*2 - v. Give -k(z) - 5w(z). 13z2 Let c(x) = -x + 2. Let p(q) = -3. Let u(g) be the first derivative of -g2/2 - 2. Let l(r) = -p(r) + u(r). What is -5c(t) + 3l(t)? 2t - 1 Let v(p) = -8p3 + 2p*2 + 5p - 7. Let d(l) = -7l3 + l2 + 4l - 6. Determine -5d(m) + 4v(m). 3m3 + 3m*2 + 2 Let t(i) = -13i*3 + 3i - 3. Let p(o) = -12o3 + 2o - 2. What is 3p(r) - 2t(r)? -10r3 Let j(a) be the second derivative of -7a4/12 - a3/6 + 2a2 + 2a. Let p(b) = -8b2 - b + 5. Suppose -13 = -5v + 17. Give vp(w) - 7j(w). w*2 + w + 2 Let d(z) = -6z2 - 2 + z2 + 4z3 + 4. Let a(o) = -2o*3 - 2 - 4o*2 + 1 + 6o*2. Let b be (-13)/(-78) - (-34)/12. What is bd(c) + 7a(c)? -2c3 - c2 - 1 Let h(y) = y2 - 123 + 123 + y3. Let w(a) = -7a3 - 7a*2 - a. Determine -5h(m) - w(m). 2m3 + 2m*2 + m Let s(p) = -4p*2 - 5p + 5. Suppose 2u = -4u + 30. Let l(y) be the first derivative of -5y3/3 - 3y*2 + 6y + 1. Give ul(v) - 6s(v). -v*2 Let s(w) = 168w + 64. Let n(v) = 13v + 5. Give -64n(i) + 5s(i). 8i Let n(h) = h*2 + 7 + 3h*3 - 7 + 2h. Let b be ((-18)/5)/((-4)/10). Let g(a) = -2a2 + 6a*2 + 0a*2 + 13a*3 + ba. Give 4g(p) - 18n(p). -2p3 - 2p*2 Let t(s) = 5s + 8. Let z(a) = -5a - 7. Calculate -5t(m) - 6z(m). 5m + 2 Suppose -3r = 3n + 12, -r - 3n - 2n = 12. Suppose 0 = 5y + 41 + 14. Let d(x) = -26x*2 + 11x. Let u(w) = 5w2 - 2w. Calculate rd(l) + yu(l). -3l2 Let t(d) = 2d*2 - 4d + 2. Let m(x) = -x*2 - 37x + 5. Let j(k) = -7k + 1. Let g(n) = -11j(n) + 2m(n). Give 3g(q) + 2t(q). -2q*2 + q + 1 Let z(y) = 65y. Let u(f) = 64f. What is -6u(a) + 5z(a)? -59a Let x(u) be the first derivative of u*2/2 - 3. Let w be (-2)/(-4) - (-3)/2. Let r(f) = 4f + w - 2. What is -2r(c) + 10x(c)? 2c Suppose 2y + 6 = b, 2y - y - 2 = -2b. Let r(i) = i2 + i. Let q(a) = -a2 + 9a - 5. Let k be q(8). Let x(h) = h2 + h - 1. Give kr(j) + yx(j). j2 + j + 2 Let t(q) be the first derivative of -7q*2/2 + 2q + 2. Let u(h) = -h. Let w(z) = -z*2 - 4z + 6. Let k be (0 + -3)12. Let b be w(k). What is bu(s) + t(s)? -s + 2 Let c(r) = 21r - 5. Let f(x) = -x. Let u(n) = -n - 1. Let y(m) = -5f(m) + u(m). Suppose 3h + h - 44 = 0. What is hy(s) - 2c(s)? 2s - 1 Let o(u) = u - 4. Let y(a) = -5a + 5. Let s(r) = 9r - 10. Let d(w) = 4s(w) + 7y(w). What is 2d(t) - 3o(t)? -t + 2 Let u(m) = m3 + 4m*2 + 5m + 4. Let x be u(-3). Let t(g) be the first derivative of 2g2 + g + 1. Let p(j) = -3j - 1. Calculate xt(v) - 3p(v). v + 1 Let d be 9/18 + 30/(-4). Let m(o) = -5o2 - 7o + 2. Let a(j) = -3j2 - 4j + 1. Calculate da(f) + 4m(f). f*2 + 1 Let x(p) = -4p*2. Let m(y) = 5y + 13. Let b(i) = 2i + 4. Let r(a) = -8b(a) + 3m(a). Let c be r(9). Let n(j) = 5j*2. Determine cn(f) - 3x(f). 2f*2 Let b(x) = -5x. Let c(r) = r + 1. What is -b(g) + 2c(g)? 7g + 2 Let n(l) = 8l3 + 4l*2 - 4l + 4. Let f(o) = -7o3 - 3o*2 + 3o - 3. Suppose 33 = -5m + 13. Determine mf(z) - 3n(z). 4z*3 Let a(v) = -2v2 - 3. Let r(d) = d2 + 1. Let o = -8 - -11. Let m be r(o). Let i(f) = 7 - 1 + 3f2 - 1. What is ma(c) + 6i(c)? -2c*2 Let l(h) = 5h + 1. Let o(q) = 6q. What is -3l(w) + 2o(w)? -3w - 3 Let y(z) = 5z2 + 13. Let c(x) = 2x*2 + 7. Let m(w) = 5c(w) - 3y(w). Let a(o) = 14o*2 + 11. Let i(s) = -3s - 4. Let d be i(-5). Give dm(f) + 4a(f). f*2 Let t(b) = 2b + 1. Let f be t(1). Let d(u) = -5 - 1 + 6u3 - fu*3 + 2u3. Let o(x) = x3 - 1. Let v be 1(0 - (-2)/2). Determine vd(i) - 6*o(i).	{ "pile_set_name": "DM Mathematics" }
ppppcpppppppcppcpp? 455/816 Calculate prob of sequence huw when three letters picked without replacement from {h: 5, u: 7, w: 4}. 1/24 Calculate prob of sequence ga when two letters picked without replacement from gnngnaggnngngnngnnn. 7/342 Calculate prob of sequence xxxx when four letters picked without replacement from {f: 5, x: 8, s: 2}. 2/39 What is prob of sequence ggrg when four letters picked without replacement from gjrgjgrjjgzgjrjj? 3/728 Two letters picked without replacement from jjjjjjjfjjjjj. Give prob of sequence fj. 1/13 Four letters picked without replacement from {r: 7, m: 1, a: 2, d: 3, v: 1}. What is prob of sequence rvam? 1/1716 Calculate prob of sequence nxnr when four letters picked without replacement from xrnnuzn. 1/140 Two letters picked without replacement from {z: 1, s: 7, d: 2, t: 10}. What is prob of sequence ds? 7/190 Three letters picked without replacement from ynyjynnbbynyyuynnn. What is prob of sequence yjn? 49/4896 Three letters picked without replacement from {u: 1, e: 2, m: 4}. What is prob of sequence eem? 4/105 What is prob of sequence eerh when four letters picked without replacement from {r: 3, e: 2, w: 3, h: 1, d: 1, z: 1}? 1/1320 Calculate prob of sequence rsrv when four letters picked without replacement from {r: 4, s: 1, z: 1, v: 4}. 1/105 Three letters picked without replacement from {c: 3, h: 5, s: 2}. What is prob of sequence sch? 1/24 What is prob of sequence gppf when four letters picked without replacement from fgfppgff? 1/105 Two letters picked without replacement from {i: 3, b: 5, y: 4}. What is prob of sequence ii? 1/22 Calculate prob of sequence rbb when three letters picked without replacement from {b: 2, r: 10}. 1/66 Four letters picked without replacement from nnfninknn. What is prob of sequence iknn? 5/504 Four letters picked without replacement from {d: 5, z: 3, s: 2, e: 7, o: 3}. Give prob of sequence dzoo. 1/1292 What is prob of sequence rv when two letters picked without replacement from uririviirumi? 1/44 Three letters picked without replacement from {o: 1, f: 12}. What is prob of sequence fof? 1/13 Two letters picked without replacement from mammamqaamqqcmcqfw. What is prob of sequence mw? 1/51 Four letters picked without replacement from xxqxxxxqqxx. Give prob of sequence xxqx. 7/55 Calculate prob of sequence jjff when four letters picked without replacement from fttjftjjjjjjfjjjjjj. 13/1292 What is prob of sequence re when two letters picked without replacement from qevvvqivivrvvvvv? 1/240 Three letters picked without replacement from {b: 2, z: 1}. Give prob of sequence bbz. 1/3 Two letters picked without replacement from yqyqyqyyxyyyqy. What is prob of sequence yq? 18/91 Two letters picked without replacement from {s: 3, g: 7}. What is prob of sequence ss? 1/15 What is prob of sequence tj when two letters picked without replacement from {n: 2, p: 1, j: 1, t: 1}? 1/20 Two letters picked without replacement from {o: 1, h: 7, j: 2, t: 8, s: 1}. What is prob of sequence th? 28/171 Two letters picked without replacement from ninninr. What is prob of sequence ii? 1/21 What is prob of sequence vhnn when four letters picked without replacement from gvhgvfhgfnffnhffhn? 1/1530 Four letters picked without replacement from {f: 1, o: 2, m: 1, s: 3}. Give prob of sequence ooss. 1/70 Three letters picked without replacement from ifmmycpyycff. Give prob of sequence iff. 1/220 Two letters picked without replacement from mrkns. Give prob of sequence rk. 1/20 Calculate prob of sequence pz when two letters picked without replacement from {z: 5, o: 2, f: 1, x: 1, k: 5, p: 2}. 1/24 Three letters picked without replacement from {z: 1, y: 1, t: 9, g: 4}. What is prob of sequence zgg? 2/455 Three letters picked without replacement from {s: 2, y: 9}. What is prob of sequence sys? 1/55 Calculate prob of sequence kc when two letters picked without replacement from ccccdccdkdcdc. 2/39 Three letters picked without replacement from vsvssssssvsvvvscvvvv. What is prob of sequence svv? 9/76 Calculate prob of sequence kkox when four letters picked without replacement from {o: 4, x: 1, k: 2}. 1/105 Two letters picked without replacement from {h: 4, w: 1, z: 5}. What is prob of sequence hz? 2/9 Two letters picked without replacement from {w: 6, y: 12}. What is prob of sequence yy? 22/51 Two letters picked without replacement from {r: 11, m: 3, n: 1}. Give prob of sequence nn. 0 Calculate prob of sequence ps when two letters picked without replacement from mmsppmpsmm. 1/15 Four letters picked without replacement from hemihiihiiiohmhii. What is prob of sequence iiom? 1/510 Calculate prob of sequence dy when two letters picked without replacement from ddmymmf. 1/21 Three letters picked without replacement from {o: 1, f: 1, y: 2, n: 1, w: 2}. Give prob of sequence fww. 1/105 Two letters picked without replacement from oooowawawooow. What is prob of sequence ao? 7/78 What is prob of sequence ul when two letters picked without replacement from {l: 17, u: 3}? 51/380 Calculate prob of sequence hp when two letters picked without replacement from pwppppuphhphh. 7/39 Four letters picked without replacement from cgcuoccicgucu. What is prob of sequence oggi? 1/8580 Calculate prob of sequence sxsb when four letters picked without replacement from snswxwsbs. 1/252 Two letters picked without replacement from {k: 11, w: 1}. What is prob of sequence ww? 0 Two letters picked without replacement from {e: 1, w: 2, h: 1, y: 2, i: 1, g: 1}. Give prob of sequence ih. 1/56 What is prob of sequence tx when two letters picked without replacement from tttttttxxxxx? 35/132 Calculate prob of sequence vp when two letters picked without replacement from vvpvvppppbp. 12/55 Two letters picked without replacement from oaaoooaooaoaoaaaoaao. What is prob of sequence ao? 5/19 Two letters picked without replacement from jdjkjjjkjjkjjkkkjj. What is prob of sequence dj? 11/306 Four letters picked without replacement from {d: 5, w: 3, h: 2, f: 7}. Give prob of sequence ddwd. 3/952 Three letters picked without replacement from lkkflflnffnknknf. What is prob of sequence kfk? 1/56 Four letters picked without replacement from riggprirrp. Give prob of sequence pprr. 1/210 Four letters picked without replacement from {g: 4, n: 14}. Give prob of sequence nggn. 91/3060 Two letters picked without replacement from {q: 2, j: 7, k: 8, u: 3}. Give prob of sequence uq. 3/190 Three letters picked without replacement from iiiiiiiviiviiiiiivii. Give prob of sequence ivi. 34/285 What is prob of sequence mxd when three letters picked without replacement from {s: 4, d: 2, x: 2, m: 1}? 1/126 Four letters picked without replacement from ewewdwdwdwedewwwd. Give prob of sequence ewdd. 4/357 What is prob of sequence iici when four letters picked without replacement from cciciiiiiiciii? 120/1001 Two letters picked without replacement from {h: 1, r: 12, u: 7}. What is prob of sequence uh? 7/380 Calculate prob of sequence mmym when four letters picked without replacement from ymyhyyhyyyymymy. 1/546 Calculate prob of sequence wru when three letters picked without replacement from rnurncnxwnwnc. 1/429 Two letters picked without replacement from {m: 4, v: 2, l: 1}. Give prob of sequence mv. 4/21 Three letters picked without replacement from iiiiii. What is prob of sequence iii? 1 What is prob of sequence rgnn when four letters picked without replacement from nrnngngnrrgng? 3/143 Three letters picked without replacement from {u: 2, o: 5, a: 2}. Give prob of sequence oaa. 5/252 Two letters picked without replacement from njnna. Give prob of sequence nj. 3/20 Three letters picked without replacement from {x: 1, u: 14}. Give prob of sequence xux. 0 Three letters picked without replacement from {n: 2, r: 1, g: 1, j: 2, f: 1}. Give prob of sequence gjn. 2/105 What is prob of sequence uccc when four letters picked without replacement from {c: 16, u: 2}? 14/153 Two letters picked without replacement from iiuuiiinnunn. What is prob of sequence ni? 5/33 Calculate prob of sequence qozq when four letters picked without replacement from {q: 3, o: 3, z: 2}. 3/140 Calculate prob of sequence kssu when four letters picked without replacement from {v: 3, u: 1, k: 1, s: 2}. 1/420 Three letters pick	{ "pile_set_name": "DM Mathematics" }
. -5 Let h be (9 + -15)2/(-4). Solve hr = -17 + 14 for r. -1 Let l(q) = 3q2 - 1. Let j be l(1). Suppose 3c - jc + i = -16, -2i = 0. Let m be (-12)/(-16) - (-12)/c. Solve g - 5 = -mg for g. 5 Let c(h) = -20h - 895. Let k be c(-47). Solve -3p - k = -33 for p. -4 Let o be ((-231)/42)/(1/2). Suppose -3 = d + 2, -3v - 3d - 36 = 0. Let q = v - o. Solve -qi = i + 10 for i. -2 Let k be 272/28 - 2/(-7). Suppose 0y - 2 = y - 4q, y - k = -2q. Solve 16 = yd - 2d for d. 4 Let x = 48 + -36. Suppose 4v = 56 + x. Solve 5r - 3 = v for r. 4 Let q = 69 - 70. Let h(o) = o + 5. Let v be h(q). Solve 0 = -vf + 3f for f. 0 Suppose -16f = -14f - 4. Solve fs - 5 = 5 for s. 5 Suppose -5f + m = -13, -2m + 19 = 5f - 5m. Solve 0 = -fv + v - 5 for v. -5 Suppose 218 = 21c - 13. Solve -14v = -3v + c for v. -1 Let v(p) = p3 + p2 + p + 1. Let j be v(-1). Suppose -4h - 4a + 116 = 0, j = -5h - 3a + 2 + 135. Suppose -2b + h = 3b. Solve -3w = -bw for w. 0 Let h be 4(3 + -1 + 1). Let w = 366 - 361. Solve -v - h = -wv for v. 3 Let l be (-5)/20 + 54/(-8). Let r(h) = h + 8. Let w be r(l). Suppose w = -3d + 4. Solve -d = -2s + 1 for s. 1 Suppose -8k - 7k + 150 = 0. Solve -2y + 0y = k for y. -5 Suppose -8n + 13n - 25 = 0. Suppose -ny + 128 = 18. Let q = y - 14. Solve 0 = j + j - q for j. 4 Let r be (-1)/(1 - 2) + 7. Let t(x) = -x2 - 4x - 3. Let o be t(-3). Solve o = -5i + i - r for i. -2 Suppose -54 = -4n + 5w, -n + 5w + 15 = 3w. Solve -59 = 16u - n for u. -3 Suppose 70 = 5t - 0t. Let s = t - 14. Suppose -3k - k = s. Solve k = 2p + p - 12 for p. 4 Suppose -i = y - 37, 3y - 5 = -4i + 107. Let l = 69 - y. Let w = l - 33. Solve -4g + wg + 8 = 0 for g. 2 Let a = 29 + -69. Let g = a - -42. Solve 25 = -3u - gu for u. -5 Let x = -14 + 19. Suppose -a - 7y - 26 = -3y, -4y = -5a - 106. Let s = a - -26. Solve -su + x = -5u for u. -5 Let p(u) = u*3 + 11u*2 - 41u + 24. Let g be p(-14). Let d be (-1 + 0)/(-1)1. Solve d = -3k + g for k. 3 Let n(p) = -44 - 5 + 7 + 6p - 3p. Let d be n(15). Solve do - 4 = 2 for o. 2 Let y(u) = u + 11. Let v be y(-7). Solve -v + 12 = -4q for q. -2 Let n(x) = x*3 + 9x*2 + 18x + 40. Let z be n(-7). Solve -8i - 12 = -zi for i. 3 Let l(k) = k*2 - k - 3. Let b be l(3). Let q = 6 - 6. Let o be q/(1 - 2 - 0). Solve o = -d - b + 2 for d. -1 Let z(r) = 4r - 25. Let m be z(15). Suppose m = -x + 8x. Solve 0 = -xn - 7 + 32 for n. 5 Let p(u) = -2u - 12. Let s be p(-7). Solve -4 = sa + 4 for a. -4 Let i = -34 - -37. Suppose 3o - 5v - 39 = 0, o + iv + 0v = -1. Solve 0 = -0u - 4u + o for u. 2 Let c(h) = -4h2 - 72h + 2. Let o be c(-18). Solve 0f - 2 = of for f. -1 Suppose 13 = 4z + a, 2z - 2a + 3 = 7. Suppose -2s = -w, 9s = zw + 4s - 3. Solve 0 = 2k - wk - 12 for k. -3 Let b = -290 - -296. Solve f - 4f = b for f. -2 Let u = 22 + -18. Suppose j - uj - 69 = -3r, -2r + j + 41 = 0. Let o = r + -15. Solve 0 - o = -h for h. 3 Let s = -8 + 10. Suppose 3g - sr = -21, -1 = 2g + 2r + 3. Let i be (-9)/g + 1/5. Solve iw - w = -3 for w. -3 Suppose 0 = -2y + 18. Let h = y + -6. Suppose o - 1 = h. Solve -o - 4 = 2g for g. -4 Let s be (-44)/66 - 106/(-6). Suppose f = x - s, 5x = 3x + 5f + 25. Solve 2v + 2v = x for v. 5 Let z(v) = -6v + 2. Let i(p) = p + 1. Let d(f) = 5i(f) + z(f). Let w be d(5). Let n(h) = -h3 - 8h*2 + 3h - 34. Let l be n(-9). Solve 6a - l = wa for a. 5 Let b(h) = -h*2 + 13h. Let r be ((-3)/(-12))/(-1) - (-53)/4. Let c be b(r). Solve -f - 3 = -c for f. -3 Suppose t = -10 + 12, -y + 15 = 5t. Solve -7k + y + 16 = 0 for k. 3 Let p(q) = 3q + 1. Let g be p(5). Suppose 5b + t - 3t = 14, g = 3b - 5t. Suppose -2h = 3r + 1, -r + b = 3r + h. Solve -d = -0d + r for d. -1 Suppose -15l - 43l = -174. Solve -13q + lq - 40 = 0 for q. -4 Let h = 24 - 21. Suppose 6v = hv. Solve v = -6s + s + 15 for s. 3 Let y be 4/8 - (-117)/6. Let j be y/816/10. Solve -j = 2a + 2 for a. -3 Let o(l) = l*3 + 6l*2 + 2l. Let i be o(-5). Let v(c) = -c*3 - 12c*2 - 10c + 15. Let f be v(-11). Suppose -i = -fn - n. Solve -nk + 8 = k for k. 2 Let o(q) be the first derivative of -q*2/2 - 24q - 39. Let v be o(-24). Solve -2j + 3 + 3 = v for j. 3 Suppose 3i + 4a = 2a - 10, -a = -2i + 5. Let w be i/(6/(-3) + 4). Solve 2b + 2b - 4 = w for b. 1 Let y(x) = x2 - 5x + 4. Let r = -24 + 26. Suppose -3d + d - 2i + 4 = 0, 4d - 16 = -ri. Let n be y(d). Solve 0 = q + q + n for q. -5 Let o be 3 - ((4 - 2) + -3). Let d(j) be the third derivative of -j5/60 + j4/4 - j3 + j2. Let r be d(o). Solve 10 = rx - 0x for x. 5 Let k = -320 + 346. Solve k = -12z - 34 for z. -5 Let g be (-5)/(-10)(-348)/21. Let w = g + 87. Solve -4y + 2 + 14 = w for y. 4 Suppose -56 = -26a + 18a. Solve 2s = -a + 1 for s. -3 Suppose -2 = 3l - 4i, 3l - 5i + 3 = -1. Suppose -7 = la - 3. Let d be (2 - 1)/((-1)/a). Solve 2k - d = k for k. 2 Let m = 251 + -251. Solve m = 8n + 2 + 22 for n. -3 Let c(o) = -o*2 + o. Let s = 11 - 11. Let w be c(s). Solve g + 3g - 8 = w for g. 2 Let y be (-5 - -9 - 7)/((-2)/6). Solve 0u = -yu for u. 0 Let s be (-792)/(-77) + -10 - 1984/(-14). Solve 145i - 15 = si for i. 5 Suppose -5d - p = -134, 4p - 19 = -d + 23. Suppose b + 16 = d. Solve b = h + h for h. 5 Let h = 6 + -4. Let i be 1/4 - (-285)/76. Solve -l - i = -h for l. -2 Let b be 9310/30 - 2. Solve 29 = -7o + b for o. 0 Suppose -12 = r - 2n - 3, -3n - 19 = 5r. Let m = r + 8. Suppose -3h + 13 = 2h + mk, -h + 4k - 2 = 0. Solve o - h = -1 for o. 1 Let d be (-28390)/(-1785) - 1(-4)/42. Solve -dm = -18m for m. 0 Suppose 23j - 19j - 8 = p, 5p = -3j + 6. Solve p = -2t + 9t - 14 for t. 2 Let a(q) = q*2 + 3q - 42. Let c be a(-10). Suppose 5s = -0s + 4v + c, 4s + v = 14. Solve 5r - 4r = s for r. 4 Let t be (56/32)/((-1)/4). Let o(p) = p*2 + 6p + 7. Let a be o(-3). Let m = a - t. Solve 4f - 1 = -m for f. -1 Suppose 3w + 73 = 5k, 4k = -w + 43 + 29. Let j(f) = -f*3 + 18f*2 - 17f + 8. Let a be j(k). Let o be 0/((-2)/((-2)/(-2))). Solve 5g - 3g - a = o for g. 4 Let k be 184(-10)/(-16). Solve -2u - k + 37 = 0 for u. -4 Suppose 4s = z + 4z + 209, 5z = -s - 204. Let f = z - -44. Solve -k + fk = 10 for k. 5 Suppose 12t + 53 = 209. Solve -9z = -tz - 16 for z. -4 Let r(w) = -2w3 + 2w*2 + 4w - 5. Let b be r(-3). Solve 15u = 26u + b for u. -5 Suppose 3x = -b, -4x - 83 - 12 = -5b. Let c(i) = i2 + 9i + 8. Let o be c(-6). Let d = b + o. Solve dg - g = 8 for g. 2 Let t(g) = -2g. Let n be -1 - (-4)/(-4) - 1. Let q be t(n). Solve 5u - 3u = q for u. 3 Let u = -16 - -16. Suppose -5m + 2m + 27 = u. Suppose -3d + 24 = -4q, -d = -5q - 28 + m. Solve 0 - d = -4x for x. 1 Let h be (-20 - -20) + -1 + -4 + 2. Let j(i) = 1 + 3 + 2i2 + 2i + 2i. Let t be j(h). Solve t = -l - 4l for l. -2 Let h = -36 - -79. Let x = h + -38. Let z = -4 + 4. Solve xf + 4 + 1 = z for f. -1 Let h(r) = -41r - 368. Let t be h(-9). Solve -7z = -8z - t for z. -1 Let l = 12 + -6. Suppose -l = 2j + 4b, 3j + b - 3b - 23 = 0. Suppose z + 0f + 3 = f, 3z + jf = 31. Solve 4v - z = 2v for v. 1 Let k be (-88)/(-24) + (-2)/(-6). Suppose -8i + ki + 12 = 0. Solve 0 = -s + i + 1 for s. 4 Let s be (420/(-45))/(4/42). Let g = -96 - s. Solve -5t = -3 - g for t. 1 Let g = -72 - -72. Let a(t) = 8t2 - 2t - 3. Let w be a(-1). Solve g = 4r - 15 + w for r. 2 Let m(v) = 34 + v - 32 + 2v*2 + 3v. Let t be m(-2). Solve -4 = -tq + 6 for q. 5 Suppose 0 = -11z + 6z. Let o = 182 + -177. Solve -o = c - zc for c. -5 Let z(u) = -u*3 - 4u*2 + u + 7. Let i be z(-4). Suppose it + 3t = 18. Suppose 4k - 25 = -9. Solve -ko = -o - t for o. 1 Suppose -2s + 0m + 4m + 22 = 0, 2m = -5s + 19. Suppose -4r = 4v, 2v = 4v + r - s. Let o be ((-54)/45)/((-2)/v). Solve -oy - 4 = -y for y. -2 Let n be -5 - (-1 + -1) - 12. Let z be ((-4)/(-5) - 1) + (-48)/n. Solve -1 = -zj + 5 for j. 2 Suppose -j + 10 = -4w - 0, -6 = j + 4w. Let d = -6 + 4. Let o = d + j. Solve 2 = 2g - o for g. 1 Let b(i) be the first derivative of -i2/2 + 6i - 2. Let y be b(-6). Let a(f) = -f*2 + 11f + 16. Let m be a(y). Solve -d = -md for d. 0 Let y = 351 - 347. Solve 17 + 3 = yl for l. 5	{ "pile_set_name": "DM Mathematics" }
0.8600214. Let h = 0.86 + o. What is h rounded to five decimal places? -0.00002 Let p = -0.197 + 116.197. Let r = p + -116.000000186. What is r rounded to 7 decimal places? -0.0000002 Suppose 0 = -37l + 39l + 3734. Let i = -2707 - l. Round i to the nearest one hundred. -800 Let h = 0.072 + 33.928. Let t = 33.9999958 - h. Round t to six decimal places. -0.000004 Let h = 1.23 - 16.83. Let p = h + 15.60000138. Round p to 7 decimal places. 0.0000014 Let g(u) = -u*3 - 3u*2 - u - 10. Let m be g(-4). Let c(l) = 1741l*3 - 10l*2 + 2l - 20. Let a be c(m). What is a rounded to the nearest 100000? 1700000 Suppose 0 = 2d + 5o + 276357, -2d + 414552 = -5d - 2o. Let t = d + 275186. What is t rounded to the nearest ten thousand? 140000 Let y = -9492160 - -6174905. Let c = y + 417255. What is c rounded to the nearest one million? -3000000 Let k = 18 - -116. Let t = k - 76. Round t to the nearest ten. 60 Let o = 4.5 + 23.5. Let v = 2948640.000072 + -2948668. Let p = o + v. What is p rounded to 5 decimal places? 0.00007 Let j = 172.41 - 174. Let r = -20.24747 + 0.03747. Let m = r + j. What is m rounded to the nearest integer? -22 Let t = 22892576 + -11360576. Round t to the nearest 1000000. 12000000 Let h = 2055.5 - 2803. What is h rounded to the nearest ten? -750 Let r = 85.066 + -0.066. Let m = 6106299.13500083 + -6106384.135. Let v = m + r. What is v rounded to seven decimal places? 0.0000008 Let c = 63 + -63.2315. What is c rounded to 2 dps? -0.23 Let y = -110.9 - -109.891. Let a = 0.125 - y. Round a to 1 decimal place. 1.1 Let q = -1.91 - -1328.91. Let k = 1326.8426 - q. Let f = k + 0.172. What is f rounded to 3 dps? 0.015 Let o = 2 + 3. Suppose -2 - 1 = -3f - c, 0 = -5c + 15. Suppose om + 8 = -4s - f, 5m = -2s - 4. What is s rounded to zero decimal places? -2 Let v = -0.1138 + -15.7562. Let k = v + 19.9. Let s = 7.44 - k. Round s to 1 decimal place. 3.4 Let y = -0.0934 + 0.09339387. Round y to six decimal places. -0.000006 Let c = -93.2263 + 93.2. What is c rounded to three dps? -0.026 Let j = 224 + -160. Let z = j - 78.9. Round z to the nearest integer. -15 Let l = -9 - -8.32. Let s = l + -4.92. What is s rounded to the nearest integer? -6 Let c be 534/36 - (-1)/6. Let m be (-1091)/(c/150). Round m to the nearest 100. -1100 Let z = 633.0167 + -633. Round z to three decimal places. 0.017 Suppose 0 = -2s - 2s + 1391776. Suppose -5m - s = -0m + 2k, -278348 = 4m + 4k. Let a = m - 21410. Round a to the nearest 10000. -90000 Suppose 231090 + 377710 = 8i. Round i to the nearest one thousand. 76000 Let o(n) = 57407n3 - 9n - 38. Let h be o(-3). Round h to the nearest 100000. -1600000 Let g = 0.0189 - 0.0215. What is g rounded to 2 decimal places? 0 Let y = 0.115 + -0.12088. Round y to 3 decimal places. -0.006 Let i(k) = 580k + 20. Let f be i(-3). Round f to the nearest 100. -1700 Let k = -75 - -75.081. Let c = -5394868.91900077 + 5394869. Let y = c - k. Round y to seven dps. -0.0000008 Let r = -401 + 114. Let o = 167 + r. Let i = o - -120.071. Round i to two decimal places. 0.07 Let s = -226 + 225.88. What is s rounded to zero dps? 0 Let h = -393 - -393.713. Round h to one dp. 0.7 Let y be 1-7 + 1 - (-316 - -7087310). What is y rounded to the nearest one hundred thousand? -7100000 Let q be (-1458000020)/(-150) + 4/(-30). Round q to the nearest one hundred thousand. 9700000 Let x = 9914324753437 + -9914323290483.50000225. Let z = 1462958.5 - x. Let b = 5 - z. Round b to seven decimal places. -0.0000023 Let g = -18.68 - 0.32. Let i = g + 21.3. What is i rounded to one decimal place? 2.3 Let x = 22633 - -39624. Let g = -32257 + x. Round g to the nearest one hundred thousand. 0 Let v = 0.374 + -0.25. Let r = v - 0.053. What is r rounded to two decimal places? 0.07 Let t = -5793903 + 5793169.0997. Let f = t + 734. What is f rounded to two dps? 0.1 Let n = 1229 + -704. Let v = 524.999779 - n. Round v to five decimal places. -0.00022 Let p = 0.301 + -0.300185. What is p rounded to five decimal places? 0.00082 Let q = -978.96 + 969. What is q rounded to the nearest ten? -10 Let f = -5 - -4.99. Let o = -1.89 + f. Round o to zero decimal places. -2 Let q = -331.72 - -53.62. Let b = q + -12.9. Let n = 290.9859 + b. Round n to 3 dps. -0.014 Let s = 192 + -208.3. Let x = -21347401 - -21347417.300181. Let q = x + s. Round q to five dps. 0.00018 Let o(t) = 299t - 7. Suppose 20 - 6 = -2g. Let c be o(g). What is c rounded to the nearest 1000? -2000 Let m = -0.13 - -0.28. Let l = m + -0.150034. What is l rounded to five dps? -0.00003 Let h = 17 - 15. Suppose hw - 1411603 = 448397. Suppose -4y = -9y + w. What is y rounded to the nearest ten thousand? 190000 Let k = -160 + 105. Let f = k - -54.998. What is f rounded to 2 decimal places? 0 Let c = 0.07 + -0.05. Let a = c + 1.08. Let i = 1.10005 - a. What is i rounded to 4 decimal places? 0.0001 Let u = 466 + -270. Let z = u - 196.00278. Round z to 3 dps. -0.003 Let i = 0.045 - -0.04. Let g = i + -0.0764. Round g to three dps. 0.009 Suppose 6g - 73900006 = g - 3h, 2g - 29559992 = 4h. Round g to the nearest one million. 15000000 Let r = 19.76 + 0.24. Let u = r - 5. Let t = u - 14.48. What is t rounded to 1 decimal place? 0.5 Let m be (-472163)/3 + (-5)/15. Let k = m - -246396. Suppose -2v - 40992 = k. Round v to the nearest 10000. -70000 Let x = -1825 - -1825.9995. Let d = 1076 - 1077. Let p = d + x. What is p rounded to 4 dps? -0.0005 Let m = -62.99953 + 63. Round m to three decimal places. 0 Let j = 5333 - 5419.78. Round j to the nearest ten. -90 Let a = 0.17 + -0.170044. Round a to 5 dps. -0.00004 Let g(u) = 105u + 9110. Let v be g(0). Round v to the nearest 1000. 9000 Suppose -6j = -5j - 5. Suppose 3t - y = -5y - 3472, -jy = t + 1150. What is t rounded to the nearest one hundred? -1200 Suppose 53i - 59i = -696. What is i rounded to the nearest 100? 100 Let m be ((-32)/(-6))/((-2)/(-9)). Let a be -6 + (m/4)/3. Let n be (-1)/(-1) - a/(-4). Round n to the nearest one hundred thousand. 0 Suppose 2645 + 15831 = 2o. Suppose 2v - o + 23038 = 0. Round v to the nearest one thousand. -7000 Let d = 14.300015 - 14.3. Round d to six decimal places. 0.000015 Let j = 5803 + -5792.8446. Let t = -0.8534 - j. Let u = t + 11. What is u rounded to three decimal places? -0.009 Let k = 552 + -498.5. What is k rounded to the nearest 100? 100 Let j = -579.00828 + 579. Round j to four dps. -0.0083 Let c = -145.86 - -149. Let g = c - 3.14000187. What is g rounded to seven decimal places? -0.0000019 Let d = 0.51 - 0.46. Let z = 0.0499373 - d. What is z rounded to 5 dps? -0.00006 Let w = 0.072 - 0.0718525. Round w to 5 dps. 0.00015 Let m = -107.13 + 0.13. Let p = m + 106.917. What is p rounded to two dps? -0.08 Suppose 5f + 145790 = u - 0u, -2u = 4f - 291608. What is u rounded to the nearest ten thousand? 150000 Let c = -5.769 + 5.71566. Round c to three decimal places. -0.053 Let k = 1.14 - -558.36. What is k rounded to the nearest 10? 560 Let c = -51026 - -27382. Let m = c - -23619.999. Let f = -24 - m. What is f rounded to 3 decimal places? 0.001 Let v be 32/(-6) - 16/24. Let d be (-4 - v)25-98. Round d to the nearest 1000. -5000 Suppose -2i = 2w - w - 1236002, -5i = 2w - 3090004. Round i to the nearest 10000. 620000 Let f = -3.85 + -6.75. Round f to 0 decimal places. -11 Let m = -26914.7 - -26915.199962. Let q = 0.5 - m. What is q rounded to five decimal places? 0.00004 Suppose 4b = 13b - 7650. Suppose -2g + b = 2320. What is g rounded to the nearest one hundred? -700 Let f = -2.41 - -2.41135. Round f to three decimal places. 0.001 Let o be 725996/(-22) - (-6 - 204/(-33)). Round o to the nearest 100000. 0 Let y = -6.12 - -3.61. Round y to the nearest integer. -3 Let f = 34310.35982 - 34310. Let k = 0.36 - f. Round k to five decimal places. 0.00018 Let z = -19 + 61. Let u = z - 41.9995. What is u rounded to four dps? 0.0005 Let w = -331.11 - -329. Round w to one dp. -2.1 Let h = -11.6018 - 0.1682. What is h rounded to the nearest integer? -12 Let v = -287.532947 + 285.498. Let t = -2.029 - v. Let o = t - 0.006. Round o to five decimal places. -0.00005 Suppose -4z - 30 = -6*z. Let i be (6 - z)/(6/8). Round i to the nearest ten. -10 Let g = 34359.8 + -34388.7906. Let k = -51 - -22. Let	{ "pile_set_name": "DM Mathematics" }
he k'th term of 188686, 377235, 565784, 754333? 188549k + 137 What is the w'th term of -20776711, -41553427, -62330143, -83106859, -103883575, -124660291? -20776716w + 5 What is the m'th term of -1011, -3914, -8707, -15390? -945m2 - 68m + 2 What is the x'th term of 1748067, 1747984, 1747903, 1747824, 1747747, 1747672, 1747599? x*2 - 86x + 1748152 What is the l'th term of -865, -3266, -6961, -11698, -17225, -23290? 42l3 - 899l*2 + 2l - 10 What is the t'th term of -100, -312, -554, -730, -744, -500, 98? 16t3 - 111t*2 + 9t - 14 What is the r'th term of 138, 276, 412, 564, 750, 988? 3r3 - 19r*2 + 174r - 20 What is the t'th term of -15748, -22918, -30088, -37258, -44428? -7170t - 8578 What is the i'th term of -12609, -25313, -38017? -12704i + 95 What is the h'th term of 8800640, 8800646, 8800656, 8800670? 2h2 + 8800638 What is the q'th term of -7463, -29801, -67021, -119111, -186059, -267853? 2q*3 - 7453q*2 + 7q - 19 What is the a'th term of 15311, 61216, 137721, 244826, 382531, 550836? 15300a2 + 5a + 6 What is the g'th term of 5016, 4552, 3732, 2556, 1024, -864? -178g2 + 70g + 5124 What is the i'th term of -850206, -1698995, -2547782, -3396567, -4245350? i*2 - 848792i - 1415 What is the x'th term of 1366834, 1366707, 1366566, 1366405, 1366218, 1365999, 1365742? -x3 - x2 - 117x + 1366953 What is the m'th term of 596941, 597326, 597711, 598096, 598481, 598866? 385m + 596556 What is the n'th term of 5445, 9966, 14487, 19008? 4521n + 924 What is the p'th term of 168, 957, 1962, 3291, 5052, 7353, 10302? 18p*3 + 663p - 513 What is the u'th term of 5948, 5938, 5898, 5810, 5656, 5418, 5078? -3u3 + 3u*2 + 2u + 5946 What is the z'th term of -6090, -11670, -17278, -22920, -28602, -34330, -40110? -z*3 - 8z*2 - 5549z - 532 What is the c'th term of 213025, 213555, 214085? 530c + 212495 What is the g'th term of 1104214, 2208434, 3312654? 1104220g - 6 What is the a'th term of -717198, -1434627, -2152056, -2869485, -3586914? -717429a + 231 What is the z'th term of 884, 203, -500, -1237, -2020? -2z3 + z2 - 670z + 1555 What is the d'th term of -780707, -1561482, -2342257, -3123032, -3903807, -4684582? -780775d + 68 What is the y'th term of -1135758, -1135809, -1135860, -1135911, -1135962, -1136013? -51y - 1135707 What is the o'th term of 120, 251, -132, -1287, -3472, -6945, -11964, -18787? -43o3 + o2 + 429o - 267 What is the l'th term of -4482, -8872, -13262, -17652? -4390l - 92 What is the u'th term of -7195, -6671, -6147, -5623, -5099? 524u - 7719 What is the p'th term of -1689, -3867, -6527, -9669? -241p*2 - 1455p + 7 What is the m'th term of 3996084, 15984345, 35964782, 63937395, 99902184? 3996088m2 - 3m - 1 What is the z'th term of 1711600, 3423193, 5134786, 6846379, 8557972, 10269565? 1711593z + 7 What is the z'th term of -2874, -2474, -1410, 648, 4030? 55z*3 + 2z*2 + 9z - 2940 What is the w'th term of 75675, 75660, 75645, 75630, 75615? -15w + 75690 What is the i'th term of -484872, -484880, -484894, -484914, -484940, -484972, -485010? -3i*2 + i - 484870 What is the h'th term of 15443, 30921, 46415, 61925, 77451, 92993? 8h*2 + 15454h - 19 What is the l'th term of -5928, -24539, -55794, -99693, -156236, -225423? -6322l2 + 355l + 39 What is the w'th term of 45240, 60599, 75958, 91317? 15359w + 29881 What is the h'th term of -67408, -67374, -67304, -67186, -67008, -66758, -66424? 2h*3 + 6h*2 + 2h - 67418 What is the k'th term of 156006, 155947, 155890, 155835? k*2 - 62k + 156067 What is the o'th term of 625277, 1250365, 1875499, 2500703, 3126001, 3751417? 4o3 - o2 + 625063o + 211 What is the b'th term of -2562, -10393, -23448, -41727, -65230? -2612b2 + 5b + 45 What is the l'th term of 836523, 3346110, 7528761, 13384482, 20913279, 30115158, 40990125, 53538186? l*3 + 836526l*2 + 2l - 6 What is the b'th term of 25084466, 25084463, 25084460, 25084457, 25084454? -3b + 25084469 What is the v'th term of -357359, -357566, -357773, -357980? -207v - 357152 What is the f'th term of 681, 2667, 5867, 10185, 15525, 21791, 28887? -16f3 + 703f*2 - 11f + 5 What is the g'th term of -496394, -992660, -1488926, -1985192, -2481458? -496266g - 128 What is the f'th term of 115747, 115235, 114383, 113191, 111659, 109787, 107575? -170f*2 - 2f + 115919 What is the r'th term of 6023, 11889, 17775, 23681, 29607, 35553? 10r2 + 5836r + 177 What is the n'th term of -796576, -796561, -796536, -796501, -796456, -796401, -796336? 5n2 - 796581 What is the a'th term of -3771221190, -3771221189, -3771221188? a - 3771221191 What is the m'th term of -345600, -345551, -345512, -345489, -345488, -345515? -m3 + m2 + 53m - 345653 What is the y'th term of 25615, 43450, 61287, 79126, 96967, 114810, 132655? y*2 + 17832y + 7782 What is the d'th term of 141663, 282773, 423887, 565005? 2d2 + 141104d + 557 What is the j'th term of 200, 105, -82, -379, -804, -1375, -2110? -3j3 - 28j*2 + 10j + 221 What is the g'th term of -7201079, -14402159, -21603239, -28804319? -7201080g + 1 What is the g'th term of -351513, -1406034, -3163569, -5624118, -8787681, -12654258? -351507g*2 - 6 What is the b'th term of -16917, -13765, -8511, -1155, 8303, 19863, 33525? 1051b2 - b - 17967 What is the i'th term of -7259, -5111, -1553, 3409, 9769? -i3 + 711i2 + 22i - 7991 What is the k'th term of -13041, -26147, -39275, -52437, -65645, -78911, -92247, -105665? -2k3 + k2 - 13095k + 55 What is the x'th term of 5152, 4652, 4150, 3646, 3140? -x*2 - 497x + 5650 What is the v'th term of 8062540, 16125087, 24187634? 8062547v - 7 What is the j'th term of 4373659, 4373658, 4373659, 4373662, 4373667, 4373674, 4373683? j2 - 4j + 4373662 What is the l'th term of 39135402, 39135396, 39135390? -6l + 39135408 What is the i'th term of 23559, 21702, 18613, 14298, 8763? i3 - 622i*2 + 2i + 24178 What is the u'th term of 64223, 256907, 578061, 1027691, 1605803, 2312403, 3147497, 4111091? u*3 + 64229u*2 - 10u + 3 What is the s'th term of -15116292, -60465168, -136046626, -241860666, -377907288, -544186492, -740698278? -15116291s2 - 3s + 2 What is the a'th term of -10343, -40730, -91369, -162260, -253403, -364798, -496445? -10126a2 - 9a - 208 What is the l'th term of -1851804, -1851802, -1851800? 2l - 1851806 What is the c'th term of -10865045, -21730089, -32595135, -43460183, -54325233, -65190285? -c2 - 10865041c - 3 What is the l'th term of -29949, -119624, -269083, -478326, -747353, -1076164? -29892l2 + l - 58 What is the h'th term of -376798247, -376798249, -376798251, -376798253? -2h - 376798245 What is the i'th term of 67537, 134921, 202305, 269689, 337073, 404457? 67384i + 153 What is the x'th term of 3648, 3698, 3734, 3756? -7x*2 + 71x + 3584 What is the c'th term of 2109, 4234, 6357, 8490, 10645, 12834? 2c3 - 13c*2 + 2150c - 30 What is the x'th term of -38097, -38093, -38089, -38085? 4x - 38101 What is the i'th term of -986365, -986327, -986289, -986251, -986213, -986175? 38i - 986403 What is the d'th term of -233457, -466584, -699709, -932832, -1165953, -1399072, -1632189? d*2 - 233130d - 328 What is the y'th term of -23838800, -47677606, -71516412, -95355218, -119194024? -23838806y + 6 What is the q'th term of 1456, 1362, 1338, 1384, 1500, 1686? 35q*2 - 199q + 1620 What is the l'th term of -45787825, -45787829, -45787823, -45787801, -45787757, -45787685, -45787579, -45787433? l3 - l2 - 8l - 45787817 What is the x'th term of -5285, -8626, -11967, -15308, -18649? -3341x - 1944 What is the y'th term of -41, -399, -1009, -1889, -3057, -4531, -6329, -8469? -3y3 - 108y*2 - 13y + 83 What is the k'th term of 42012, 41993, 41960, 41913? -7k2 + 2k + 42017 What is the v'th term of 407761, 407717, 407643, 407539, 407405, 407241, 407047? -15v2 + v + 407775 What is the z'th term of 6109734, 6109732, 6109730, 6109728, 6109726, 6109724? -2z + 6109736 What is the n'th term of -1390309, -1390301, -1390293, -1390285, -1390277, -1390269? 8n - 1390317 What is the w'th term of 11680, 11503, 11324, 11143, 10960, 10775, 10588? -w2 - 174w + 11855 What is the y'th term of 792347, 792424, 792499, 792572, 792643? -y*	{ "pile_set_name": "DM Mathematics" }
46k2 + 145k*2 in the form vk*2 + n + ok and give v. 44 Rearrange (3z - 6z + z)(4z3 + z3 - 4z3) + (3 - 3z*3 - 3)(2z - 4z + 3z)(-3 - 2 + 9) to the form nz + dz*3 + qz*4 + s + mz*2 and give n. 0 Rearrange (3v - 4v - v)(0v + 0v + v)(16v + 18v2 - 16v) to the form bv2 + dv*4 + uv + sv3 + y and give d. -36 Express d + 3d - 2d + (-2 + 0 + 1)(4 - 5 + 0)(2d - 4d + 6d)(8 + 3 - 5) as u + jd and give j. 26 Rearrange 40t4 + t3 - 39t*4 - t + 0t2 - t2 to the form bt + it*2 + xt*3 + s + dt4 and give d. 1 Express -h2 - 2h3 - 3h*2 + 5h + h*3 + 0h*2 + 2 as rh + c + vh3 + ah2 and give c. 2 Express o3 + 2o2 - 11o*2 - 22o + 7o2 as mo*3 + t + po + yo2 and give m. 1 Express 0b*2 - 5 + 7b + b*2 + 3b*3 + 4 + 0b*2 as qb*2 + xb + ub3 + k and give k. -1 Rearrange (-4j + j + 22j)(7j2 - j2 - 2j*2) to tj*2 + sj*3 + y + nj and give y. 0 Rearrange 48x3 - x2 + 18x*4 + 1 - 49x*3 - 3 to the form b + nx*3 + px + wx2 + jx*4 and give j. 18 Rearrange (k - 5k + 2k)(1 + 0 + 38) + (1 - 2 - 1)(0k + 4k - 2k) to jk + u and give j. -82 Express 8k*2 + 11k*2 - 16k*2 in the form sk + j + fk2 and give f. 3 Express 230 - 9f - 230 in the form hf + s and give h. -9 Express (7v*2 + 0v - 3v + 3v)(-7v*2 + 0v*2 - 3v*2) as fv + g + cv3 + tv*4 + qv*2 and give t. -70 Rearrange (-1 + 6 - 1)(2c2 + 0c + 0c) + (-2c - c + c)(-1 - 2c + 1) to m + oc + kc*2 and give k. 12 Express 1 - 5 - 17u + 4 in the form bu + m and give b. -17 Express b4 + 3b*4 + 0b*4 + (3b - 3b - 2b)(38b*3 + 27b*3 - 19b*3) - 2b*4 + 0b4 + b4 as yb4 + wb*2 + f + rb*3 + gb and give f. 0 Rearrange -3g2 - 2g*2 + 4g*2 + (-3g + 2g - 4g)(25g + 400 - 400) to x + jg2 + lg and give j. -126 Express -21 - 56y2 + 10 - y + 11 as ry + g + by2 and give r. -1 Express -62y + 2y4 + 5y*2 - 2y*3 - 3y*4 + 60y + 1 in the form ny4 + oy*3 + r + ly + gy2 and give g. 5 Express t + 3t + 7t + 2t as a + qt and give q. 13 Rearrange (-2 - 32q*2 - 9q*3 + 32q*2)(1 - 2 + 3) to the form a + fq + sq*3 + uq*2 and give a. -4 Express (-11 + 7 + 2m - 4m + (2 + m - 2)(-4 - 2 + 5) - 2m + 0 + 0)(2 - 2 - 2m)(2 - 1 + 0) in the form om2 + lm + g and give o. 10 Rearrange -56o3 - 5 + 4 + 58o*3 + 11o to the form g + jo2 + ro*3 + mo and give r. 2 Rearrange -4b3 - 2b*4 + 2 + 5b*3 + b - 3 + 2 to the form wb + xb2 + o + nb*3 + sb*4 and give o. 1 Rearrange (-4 + 4 - 4)(-i - 2i + 4i) + (-4 + 2 + 8)(0i + 3i - i) to ti + g and give g. 0 Express -h2 + h2 + 2h3 + (-3 + 1 + 1)(0h3 + h3 + 0h3) + (h2 + h*2 + 0h*2)(-70 - 9h + 70) as ph*2 + yh + v + th3 and give t. -17 Rearrange (-3 + 5 + 1)(0 + 2 - 1)(-4 + 4 - n) to the form tn + s and give t. -3 Express 111d4 + 117d*4 + 2d + 2d3 + d3 - 226d*4 as h + ad*2 + td + rd3 + xd*4 and give h. 0 Rearrange 13i*2 - 2i*3 - 2i4 - i3 + 4i4 - 2 - 11i*2 to ki*2 + pi*4 + oi + t + ci3 and give t. -2 Express (1 + 1 + 0)(-3j2 + 2j*2 + 3j*2)(-5j + 0j + 3j) as gj + cj3 + pj*2 + y and give c. -8 Express -9y - 4y - 12y as c + fy and give c. 0 Express 6 - 7 + 1 - 85t in the form x + lt and give l. -85 Rearrange (-2p + p + 3p)(p*2 + 4p*2 - 4p*2) + 7p*3 - 13p*3 - p - 9p*3 to the form wp + tp2 + kp*3 + z and give w. -1 Rearrange (-1 + 4 - 4)(-2 + 0 + 0)(0o*4 + 0o*4 - 2o*4) - 7o*4 + 3o*4 - 8o*4 to the form qo*4 + i + xo + vo2 + go*3 and give q. -16 Express (-6g + g + g)(-57 + 57 - 7g) as hg + z + ng*2 and give n. 28 Rearrange 12n - 9n - 9n to the form an + q and give a. -6 Rearrange (2i - 3 + 3)(2 + 0 + 0) + (-7i + 3i + 2i)(-1 + 3 - 3) + 43 + 7i - 43 to the form pi + j and give p. 13 Express -k + 0k + k + 8 + 3k in the form tk + o and give t. 3 Rearrange -11x + 14x - 35x to the form vx + d and give v. -32 Express (q*2 - 4q*2 + 2q*2)(-2q2 + 2q*2 + 2q*2) + 2q - 3q + 3q + q*4 + 13 as mq*3 + zq + l + nq4 + kq2 and give z. 2 Rearrange -p - 1 - p3 - 63p2 + 36p*2 + 29p*2 + 5p*4 to the form n + cp*2 + ap*3 + ip*4 + lp and give c. 2 Rearrange (14u + 13u - 21u)(2u - u - 3u) to bu + lu*2 + j and give l. -12 Rearrange -t + 8t*3 + 37t*2 - 36t*2 + 0t to yt3 + ft*2 + ct + z and give y. 8 Rearrange -26u3 - 4 + 11u*3 + 16u*3 to the form hu*3 + gu + v + du2 and give v. -4 Rearrange j2 - j2 + j - 8j*2 to i + vj*2 + oj and give v. -8 Express 8d2 - 6d*2 - 53d*3 + 9d - 8d as id + rd2 + od*3 + b and give o. -53 Express 2q*2 - 28q*2 - 12q*2 + (2 + 2q - 2)(-q - q + 0q) as zq2 + p + gq and give z. -42 Rearrange (5 + 1 - 4)(0a + 15a - a) - 6 + 2 + a + 2 to fa + h and give f. 29 Rearrange -a*2 - 30a + 7a3 + 30a to g + ia2 + va*3 + ua and give i. -1 Rearrange (-7g + 12g - 3g)(g - 1 + 1) to the form t + yg + wg*2 and give y. 0 Rearrange 6 + 5n + 2n - 6n - 2 to the form a + gn and give g. 1 Rearrange -2w*2 - w + 3w - 27w3 + 34w*3 to the form fw*3 + dw + bw2 + i and give f. 7 Rearrange (-f - 2f*2 + f)(-8 + 14 + 0) + (0 + 2f + 0)(-f - 1 + 1) - 4f2 + 2f*2 + 0f*2 to nf*2 + hf + i and give n. -16 Rearrange 0n2 + 0n*2 + 2n*2 + (0n - n + 2n)(3n + 0 + 0) + (n2 + 2n2 - n2)(0 - 1 + 5) to jn + s + vn2 and give v. 13 Rearrange -2x3 + x3 - 2x3 + (6x*3 - 14x*2 + 14x*2)(-4 + 2 + 0) + 3x3 - 6x*3 + 2x*3 to sx*3 + rx*2 + w + jx and give s. -16 Express (2c + 4c - 4c)(4c3 + 2c*3 - 4c3) + (0 + 0 - c3)(-28c - 43c - 18c) in the form mc3 + w + dc*4 + gc*2 + zc and give d. 93 Rearrange ((-2 + 0 + 0)(-5 + 1 + 2) + 1 - 2 + 0 + 0 + 0 + 2)(37x - 72x - 108x) to the form q + ix and give i. -715 Rearrange 6 + 6 - 86o2 + 84o*2 + (0o + o + 0o)(0 + 0 - o) to the form to + vo*2 + y and give v. -3 Express (-2s - 3s + 4s)(1 - 1 - 1) - s + 0s + 2s - 1 - 6 - 51s + 53s in the form cs + u and give u. -7 Express (7c - 2c*3 - 7c)(-4c + 5 - 5)(0 + 0 - 2) in the form r + fc*4 + pc*3 + oc*2 + uc and give f. -16 Express 3j4 + j3 + j4 + j2 - 3j*4 + 1 in the form k + lj + wj3 + xj*4 + vj*2 and give v. 1 Express -25u - 15u - 3 + 26u - 11u in the form fu + o and give o. -3 Express -78c + 44c + 36c in the form kc + j and give k. 2 Express -57m2 + 58m2 + 2 + m3 - 3m4 + 0m*3 in the form nm*4 + xm*2 + ym + f + bm3 and give b. 1 Rearrange (26f - 9 + 10 - 7f)(-4f2 - 4f*2 + 5f*2) to the form t + gf*2 + zf + rf3 and give r. -57 Rearrange 24y*2 + 26y*2 - 78y*2 to z + sy*2 + py and give s. -28 Rearrange (-3 + 8 - 1)(-5n*2 + 5n*2 - 2n*3) to the form cn*3 + an*2 + w + un and give c. -8 Rearrange (2 - 7 + 2)(-2 + 1 + 3 + (2 - 1 + 1)(-2 + 3 - 2) + 0 - 1 + 0)(-2 + 0 + 4)(-5o + 3o - 2o) to the form i + po and give p. -24 Express 4h - 3h - 3h + 3h as r + sh and give s. 1 Rearrange 3f - 3f3 + 2f*2 - 5 - 2f4 - f2 + f*4 + 3 to pf + of2 + qf*4 + yf*3 + x and give q. -1 Rearrange -4r*2 - 10r*2 - 4r*2 + 3r*2 to the form qr*2 + cr + f and give q. -15 Rearrange -4 - 3 + 43b + 7 to the form n + tb and give n. 0 Express m*4 + 1 + 11m*3 - 2m*3 - 10m3 - m2 as vm3 + cm*4 + am + f + jm2 and give f. 1 Express 2x*2 + 6x*3 + 14x*3 - 6x*3 + 0x*2 as mx + q + ox3 + tx*2 and give o. 14 Express (0 - 3 + 5)(0m + 2m - m) - 1 + 1 + 2m - 2m + 3m + m in the form om + i and give o. 6 Rearrange -5u2 - 2u - 4u2 - 3 + 7u*2 to bu + i + ju2 and give j. -2 Rearrange -4b + 13b - 3b - 4b - 14b*2 to n + yb*2 + jb and give y. -14 Rearrange 6 - 9h - 12h - 3 + 19h to the form oh + k and give k. 3 Rearrange 1 + 39p - 65p + 26p + 2p*3 + 24p*2 to jp*2 + tp + r + np3 and give r. 1 Rearrange 66 - 66 + 33s + (-1 + 3 - 1)(s - 3 + 3) to the form q + ls and give l. 34 Rearrange (d - 6d + 3d)(-137 + 137 + 31d)*(3 - 1 +	{ "pile_set_name": "DM Mathematics" }
b. Suppose 5g - 55 = 5x, 43 = 5g + x - bx. Let i = g + -5. List the prime factors of i. 3 Suppose 5a - 7w = -2w + 20, a + w + 4 = 0. Suppose 2 = 2z - 4u, 5z + az = -2u + 65. What are the prime factors of z? 11 Let t(s) be the first derivative of 14s3/3 - s2/2 + s + 4. List the prime factors of t(1). 2, 7 Let l(q) = -q3 + 8q*2 - 7q + 6. Let p = 23 - 16. List the prime factors of l(p). 2, 3 List the prime factors of -314(-7)/14. 2, 31 Suppose -3a - b + 2 - 30 = 0, -2a + 3b = 37. What are the prime factors of (-126)/(-33) + (-2)/a? 2 Suppose 4 = -2x - 0. Let u(w) = -3w3 - w2 + w - 2. List the prime factors of u(x). 2 Suppose a - 54 = -2a. Let j = a - 4. What are the prime factors of j? 2, 7 Let s be ((-9)/6)/(1/(-6)). Let o = s + 17. Suppose -2a - 3a - o = -3z, -2a - 18 = -5z. List the prime factors of z. 2 Let b = 28 - 26. What are the prime factors of b? 2 Let x = 8 + 1. Let j = x + 5. List the prime factors of j. 2, 7 Suppose -s + 2 + 3 = 0. Suppose -sz = 26 + 24. Let c(f) = f*2 + 8f - 8. List the prime factors of c(z). 2, 3 List the prime factors of (32/(-6))/((-1)/6). 2 Let v(z) = -z*2 + 2z - 2. Let d be v(2). Let q(m) = -m*2 + 8m - 7. Let j be q(7). What are the prime factors of j + 0 - 14/d? 7 Suppose 14r - 10r = -20. Let o = r + 30. What are the prime factors of o? 5 Suppose 4n = 0, 3j + 39 = 4j - n. List the prime factors of j. 3, 13 Suppose -5u = -2r - 23, 0 = -3u + u + r + 9. Suppose -2h + c + 32 = 0, -uh + 67 = -0h + 4c. List the prime factors of h. 3, 5 Suppose 0 = 2y + 3q - 89, -4y = -3q - 269 + 64. List the prime factors of y. 7 Let i = -13 - -14. Suppose c = -i + 11. List the prime factors of c. 2, 5 Let o = 8 - -2. Suppose o = 2w - 36. List the prime factors of w. 23 Let o = 4 - 4. Let h(v) = -v3 + v2 - 4. Let a be h(o). List the prime factors of 6/(-9)66/a. 11 Let r = 217 + -130. What are the prime factors of r? 3, 29 Let j(x) = 0x3 - 2x*2 - 3 - 3x*3 + 5. Let n be j(-2). Suppose 3s = -0s + n. List the prime factors of s. 2, 3 Let t(r) = -r + 1. Let x(o) = -o3 + 5o*2 + 3o - 3. Let s(k) = -5t(k) - x(k). Let h = 17 - 12. What are the prime factors of s(h)? 2 Let j = -19 + 28. List the prime factors of j. 3 Suppose 0 = 4v + 5j - 25 + 8, 0 = v + 5j - 8. Let n = 95 - 20. Suppose 2g = -2r + 30, -5r - g + vg = -n. What are the prime factors of r? 3, 5 Let l(h) be the third derivative of 0 + 0h + 2h*2 - 5/24h*4 + 1/60h*5 - 2/3h*3. What are the prime factors of l(6)? 2 Let l = 16 - -73. What are the prime factors of l? 89 Let j = -19 - -3. What are the prime factors of (1/2)/((-1)/j)? 2 Let m(o) = 2o + 27. Let j = 5 + -5. What are the prime factors of m(j)? 3 Let q(l) = 3l2 + 6l - 6. List the prime factors of q(-5). 3, 13 Suppose -22 = -o + 2c, 2o - 5c + 89 = 4o. Suppose 2f - o = 3t - 7t, 3f - 30 = -3t. What are the prime factors of t? 2, 3 Let a(s) = 2s + 3. What are the prime factors of a(8)? 19 List the prime factors of 292/6 - (-4)/(-6). 2, 3 Let t(i) = -i*2 - 5i + 1. Let v be t(-5). Let r be 3/v(-5 + 3). Let m = 11 + r. What are the prime factors of m? 5 Let m = -212 + 319. List the prime factors of m. 107 What are the prime factors of 203 + 1 - (24/4 + -2)? 2, 5 Let h be 2/(-3)(-27)/2. Let j = 18 - h. Let t = j + -1. List the prime factors of t. 2 Let a = 35 + -18. Let y = a + 19. What are the prime factors of y? 2, 3 Suppose -27 - 5 = -4s - 3b, 5s - 40 = -2b. List the prime factors of s. 2 Suppose 24 = 4z + 3r, 3z + 5r + 2 = z. List the prime factors of z. 3 Suppose -2a + 191 = 3j, -4a - j + 355 = -4j. List the prime factors of a. 7, 13 Let a(i) = i*2 - 6i - 1. Let l be a(-7). Suppose 5d + 2h - 6h = l, -85 = -5d + 3h. List the prime factors of d. 2, 7 List the prime factors of (-2)/(-9) - ((-18886)/63 + 3). 3, 11 List the prime factors of (-1)/5 + (-15216)/(-80). 2, 5, 19 Let o(j) = j3 - 2j*2 + 2. Let x be o(2). Suppose -3 = -s + x. List the prime factors of s. 5 Suppose 11m = 753 + 6. List the prime factors of m. 3, 23 Let t be ((-280)/(-12))/((-4)/(-6)). Suppose t + 111 = 3q + 5h, q - 4h - 26 = 0. What are the prime factors of q? 2, 3, 7 Let c(m) = m2 + 3m. Let j be c(-3). Suppose -5x = -5v - 50, -x - v + 6 = -jx. Suppose -x = -2l + 2. List the prime factors of l. 5 Let l be 0 + 1 - 2/(-2). Let v be 2 - 0 - 0/l. Suppose -a + 11 = -vi, -2a + 2i + 16 = -0i. List the prime factors of a. 5 Let o(s) = s*3 + 4s*2 + 3s + 3. Let b be o(-3). Suppose -5q = 5, f = bq + 6 + 12. What are the prime factors of f? 3, 5 Suppose a + 4k = -19, -k - 28 = -3a + 4k. Suppose -a = -4c + 3. Suppose 3b - 20 = 5y - c, 4y + 20 = 3b. What are the prime factors of b? 2 Let s = 17 + -26. Let t = s - -23. List the prime factors of t. 2, 7 List the prime factors of (-55)/10(0 + -4). 2, 11 Let c be (6/5)/((-2)/10). Let l = c + 10. Suppose -n = -3q - 1, -2n - 5q = -20 - l. List the prime factors of n. 7 Suppose -126 = -6o + 2o - 2j, 5o - 5j = 135. List the prime factors of o. 2, 3, 5 Let h = -2 + 23. What are the prime factors of h? 3, 7 Let s(h) = h2 - 2h - 1. Let g be s(-1). Suppose 2b + gn - 8 = 0, -5b + 5n = -3b - 15. What are the prime factors of b? 5 What are the prime factors of (93/12)/(5/20)? 31 Let c = 146 - 20. List the prime factors of c. 2, 3, 7 Let c(j) = 17j + 7. List the prime factors of c(4). 3, 5 Suppose -i - 2z = -25, -5z = 3i - 4i + 32. What are the prime factors of i? 3 Suppose 3x + 3u - u - 762 = 0, 3u = 4x - 999. What are the prime factors of x? 2, 3, 7 Let g(v) be the first derivative of -v*2 - 7. What are the prime factors of g(-6)? 2, 3 Suppose 14 = 4u + 2. Suppose -ud + 128 = -d. Suppose k - 3a - 16 = 0, -4k + 3a = 4a - d. List the prime factors of k. 2 Suppose 3d = y - 2y + 8, -2y + 8 = 2d. Suppose -6 = 4k + y. Let m = k - -12. What are the prime factors of m? 2, 5 Suppose 0v = 5h - 5v - 140, -v = 0. What are the prime factors of h? 2, 7 Suppose -2p - 1560 = -10p. List the prime factors of p. 3, 5, 13 Suppose 3t - 15 = -j, -2j + 20 = 4t - j. Let k(i) = -2i2 - 10. Let m(b) = 5b*2 - b + 21. Let y(n) = 7k(n) + 3m(n). What are the prime factors of y(t)? 3 Let c = 19 - 10. What are the prime factors of (-171)/6(-6)/c? 19 Suppose -5u - 194 = -7u. What are the prime factors of u? 97 Let d = -79 - -208. What are the prime factors of d? 3, 43 Suppose 4v + j - 208 = 0, -j + 208 = 4v + 2j. What are the prime factors of v? 2, 13 Let u be (3/3)/(2/34). Let w = u + -11. Suppose g - w = -0g. What are the prime factors of g? 2, 3 Suppose 7 = 3r + 3j - 8, 2j - 18 = -4r. Suppose 3q = 35 + r. What are the prime factors of q? 13 Let v be (-3)/9 + (-25)/(-3). Let u(r) = 3r - 11. Let d be u(v). Let z = d + -6. What are the prime factors of z? 7 Suppose -9k + 96 = -6k. What are the prime factors of k? 2 Let q be 20/((-3)/((-3)/2)). Let o be q - ((-3)/1)/(-3). List the prime factors of (-169)/(-9) - (-2)/o. 19 Suppose -k - 4k - 20 = -5n, 3k = -2n + 13. What are the prime factors of n? 5 Suppose 31f - 43f = -5292. What are the prime factors of f? 3, 7 Let i = 157 - 94. List the prime factors of i. 3, 7 Let d = 48 - 69. Let g = -15 - d. List the prime factors of g. 2, 3 Let v be -41/2 - -10. Let l = v - 8. Suppose ly + 45 = 5y. List the prime factors of y. 3 Let k be (4 - -11) + 0/(-3). Suppose 5f - 6 = 44. Suppose b - 14 = -5g + k, 0 = -2g + f. What are the prime factors of b? 2 List the prime factors of 87/228/42. 29 Suppose 0 = 5p - 125 - 20. List the prime factors of p. 29 Let s = 140 + -9. What are the prime factors of s? 131 List the prime factors of 1 + (904/18 - (-12)/(-54)). 3, 17 Let f = -32 + 95. What are the prime factors of f? 3, 7 Let f be -48(2 - 10/4). Let q = 13 - f. Let h(n) = -2n - 12. What are the prime factors of h(q)? 2, 5 Suppose -h = -35 + 10. Suppose 5u = 4u + h. List the prime factors of u. 5 Suppose -q + 3j - 8 = -3, -q - 3j + 1 = 0. Let b be q - ((-99)/(-3))/(-3). Suppose -v = -t - 1, 4 = -t + b. What are the prime factors of v? 2, 3 Let i be 1 + 218 - 1. Suppose 4m = i + 48. List the prime factors of m. 3, 7 Suppose -5i + 204 + 41 = 0. Suppose 5o + i - 164 = 0. Suppose 2	{ "pile_set_name": "DM Mathematics" }
.79. Let g = 3.18 - i. Let k be -1 - (1/7 + -1). Which is smaller: g or k? g Suppose 16 + 50 = -2d. Let i = -381 - -261. Let h = i + 86. Which is bigger: d or h? d Let s = 54 - 66. Let p be s/8 + 14/4. Which is smaller: 2/45 or p? 2/45 Suppose 2s - 29 = -3m + 3s, -2m - 2s = -6. Let v be (-2)/m(9 + -5). Let x = -396 - -30097/76. Which is greater: x or v? x Suppose -9j + 81 + 9 = 0. Let f = j - 7. Suppose -2w + fo - 14 = -3w, -13 = -w - 4o. Is 17 at least w? True Suppose -49 = -10t + 41. Suppose 0 = -u - 0u - t. Let n be ((-6)/u)/((-18)/(-1539)). Is 57 >= n? True Let c = -1 - 0. Let p = -103.310641 - -0.310641. Is c smaller than p? False Let c = -4.7715 - 0.1185. Let y = c - -0.89. Is y less than or equal to -2? True Let r(l) = l*3 + 4l*2 - 11l + 6. Let h be 84/(-15) + 6/(-15). Let z be r(h). Let x = -188374/65 + 2898. Which is smaller: x or z? x Let a = -33.02 - 5.48. Let k = -38.51 - a. Is k at most as big as 9? True Let z be ((-80)/(-32) + 9/6 + -2)/2. Which is greater: 8/1659 or z? z Let q be (-16 + 17)/(20/(-16) - 5/(-20)). Which is smaller: q or -1/6165? q Let s(l) = l*3 + 5l*2 - 7l - 32. Let d(i) = 10i + 46. Let o be d(-5). Let z be s(o). Which is smaller: z or 23/2? 23/2 Let b be ((-3523)/26)/(2/(-4)). Suppose -16r - 31 + b = 0. Suppose 2y = 3j + 17, 3y - 4y + 7 = -2j. Which is smaller: y or r? y Let u(v) = -150v - 1800. Let f be u(-12). Which is bigger: 5057/4 or f? 5057/4 Let i be (14/(-4))/(58 + (-23625)/420). Let a = 1.643 - 1.87. Which is smaller: i or a? i Let b(c) be the third derivative of 7c4/12 + 35c*3/3 + 2c*2 - 3. Let j be b(-5). Which is greater: j or 2/43? 2/43 Let l be 8273/624 - (-121)/(-86). Is l at most as big as 2? False Let t be 3/((-9)/12) + 15. Let h(z) = -z*2 - t + 30z - 39z + 4. Let b be h(-8). Which is greater: -7 or b? b Let j(a) = 13a*3 - 17a*2 + 7a + 70. Let g(m) = -2m3 + m - 1. Let k(h) = 6g(h) + j(h). Let q be k(16). Which is greater: 0 or q? q Let o be 12/(-14)(-42)/12. Suppose s - q = -3, -2s - 2q = -3s - 5. Let z be 9(-1)/3s. Is z at most o? True Let s be -6(302/(-15) + 23/(-115)). Suppose 2b - 2u = u - 249, 0 = -b + u - s. Which is smaller: -118 or b? -118 Let r = 296 - 293. Let d be 2 + (12/(-2))/(-6) - r. Which is bigger: d or -1/371? d Let h be -332 - -334 - -981-11. Which is smaller: h or -1077? -1077 Let a = 62 + -62.16. Let u = 126 - 69. Let r = u + -56.9. Is a < r? True Let a = -54.08951 + 0.08951. Is a at most as big as 0.018? True Let t = 2062 - 2065. Is t less than 2/99? True Let f = 432.017 + -3.017. Are f and 2/9 non-equal? True Let o be (12/(-84))/(2/4). Suppose 0 = -15p + 41 + 64. Let k = 20/3 - p. Is k greater than o? False Let d = -2858 + 2859. Which is smaller: d or -1/1549? -1/1549 Let b = 9267 + -9348. Do -24 and b have the same value? False Let d(x) = x*3 - 5x*2 + 6x + 2. Let h be (2 - -5) + 4 + -6 + -2. Let r be d(h). Do 2 and r have different values? False Let g = -950 - -950. Which is bigger: -42/5 or g? g Suppose -4v + 2b = 6, 3b - 9 = -0b. Suppose -27u - 3532 - 3866 = v. Which is greater: -0.1 or u? -0.1 Let n(y) = -33y + 44y2 - 20 + 31y - 9y. Let p be n(-2). Are p and 178 non-equal? False Let s = -164 + 168. Let u = 720.51 + -721. Is s < u? False Suppose -2t = -y + 1158, -2y = 9t - 14t - 2319. Is 1153 at least as big as y? True Let o = 4051 - 2596. Which is smaller: -0.1 or o? -0.1 Let k be (-2)/(-8) + (-6590)/(-40). Suppose 4f + l = 5l + 156, k = 4f - l. Let n be ((-14)/105)/(f/10). Which is smaller: 0 or n? n Let l = -15541 + 16066. Is 521 greater than or equal to l? False Let x be (-1)/(-3(-3 + (-64)/(-24))). Is x <= 1.55? True Suppose -4x = -0x + 3b - 328, 2b = -4x + 328. Is x > -10? True Let a = -4129/6 + -5281/6. Is -1567 < a? False Suppose -515 = 3i + 2c, 2i + 3c + 144 + 206 = 0. Let k = i - -236. Is 69 greater than or equal to k? True Let j = 2916 + -3624.5. Let u = j - -709. Which is bigger: 2/55 or u? u Suppose 2b - 4b = 104. Let y = -48 - b. Suppose yh - 10h + 264 = 0. Which is smaller: h or 0.1? 0.1 Let v = 14.3 - -41.6. Let i = -53.9 + v. Is -10.2 greater than or equal to i? False Let k = 1 + -1. Let b = -9.14 - -13.31. Let m = 4.37 - b. Are k and m equal? False Suppose -4u = -8, p + 2u - 12 = -0. Suppose 5s - 16 = -4n + p, n = -5s + 21. Let l be (18/(-5))/(((-19)/(-5))/(-1)). Is n at least as big as l? True Suppose 0 = -2k - 12 + 6. Let r be k/(-12) - 301/(-28). Is r less than 2? False Let w(p) = -19p + 75. Let a be w(4). Suppose -4d + 61 = -59. Let h be (-594)/d - a/(-1 + -4). Is -20 less than h? False Let z(h) = -56h + 11. Let j be z(2). Let m = j - -113. Is m not equal to 16? True Let p = 0 + 1. Let a be ((-2)/(260/30))/((-24)/32). Is a < p? True Let i = 2.11 - -41.09. Let b = i + -43.1. Is b at most as big as -31.3? False Suppose 247x - 251x + 30 = 5o, 0 = 5x - o - 23. Let q(m) = m. Let r be q(0). Suppose 5d + 39 = -p - 3p, r = -xd + 4p - 31. Is d < -46/7? True Let n be ((-528828)/1735)/((9/(-10))/(-3)). Do 2 and n have different values? True Suppose -24w = 1297 - 12529. Let a = w + -471. Let v be (2/(-4))/((-2)/(-4)). Which is smaller: a or v? a Let r be 288/7(-1498)/321. Suppose 0 = 5t - 4t + 192. Is t bigger than r? False Suppose -i + 20 + 12 = 0. Let p = i + -57. Let k(n) = -n3 + 23n*2 + 26n - 1746. Let l be k(20). Is p less than or equal to l? False Suppose b + 108 = 3t + 2b, 2t + 3b - 79 = 0. Let x = 49 - t. Suppose q - 3g + x = 0, 4g = 5q + 9 + 6. Which is smaller: q or -3/7? -3/7 Suppose -4v = -w + 6w + 5, 5v = 4w + 4. Which is smaller: v or 9/34? v Suppose -3f - 48 = -2j, 46f - 4j - 32 = 48f. Let a be 6(0 - (-12)/8). Let l be (-142)/a + (-2)/9. Is l less than or equal to f? True Let u be (-64)/(-4) + 96/(-6). Is u bigger than 8/3787? False Let m be (-27)/6(-552)/(-105570). Suppose -5i = -2 - 8. Which is bigger: i or m? i Let t = 471127/138 + -3414. Which is greater: 1 or t? 1 Suppose -q = -u + 87, -27q = -24q - 5u + 255. Which is smaller: q or -87? q Let b be (-16260)/75 - 2/202. Which is smaller: b or -216? b Suppose l - 86 = h, 5 = -2l + h + 172. Let p = -97 + l. Let q be 0 + -3 + (-36)/p2. Which is greater: 1 or q? q Let l(j) = j2 + 30j + 144. Suppose -12u = 27 + 273. Let v be l(u). Is 8 <= v? True Let m = -18458 - -18454. Are 163.6 and m non-equal? True Suppose 0 = 5k - 0k - 30. Suppose -4w = -kl + l + 16, -2w = 8. Let b = -242 - -2180/9. Is l greater than or equal to b? False Suppose -8 = -4f + v, 0f + 5v + 21 = f. Suppose a = -5n - f + 6, -3a = -n + 1. Let y be n/(-4)(-96)/56. Is y equal to 1? False Let u(w) = 4w3 + 16w*2 - 5w - 4. Let h be u(-4). Suppose -hz - 54 = -25z. Which is greater: 14/3 or z? z Suppose -2a - 2b = -3a + 21, 0 = -a - 3b + 6. Suppose -5j + 18 = 28. Let p be ((-2)/5)/(j/60). Which is smaller: p or a? p Let y(a) = -5a*2 + 2a + 389. Let n be y(9). Is 45/74 at least as big as n? False Let i be (-10)/6 - (-9454)/87. Suppose -it + 144 = -113t. Which is greater: -74/3 or t? t Suppose 9331 = 2q - 8147. Let c be (-2 - q/48) + 2. Let d = 182 + c. Which is smaller: d or -0.1? -0.1 Let f(w) = w2 + 42w - 189. Let u be f(11). Which is greater: u or 397? 397 Let y be (-6)/10 - ((-141)/(-15) + -6). Let c be (2/y + -3)(-18)/63. Which is smaller: c or -1/3? -1/3 Let j = 47290 - 47237. Let d(c) = 2c + 1. Let i be d(-1). Does j = i? False Let g be (0 + (-4102)/(-4))(-3336)/(-1946). Which is bigger: 1760 or g? 1760 Let i be (-409)/(-649) - (4 - (-76)/(-22)). Let q = -173/649 + i. Which is greater: 20 or q? 20 Let w be 4((-16)/11 + 3). Let f(z) = 6z + 13. Let q be f(-1). Which is smaller: w or q? w Let b be 2275/(-13)4/(-310). Let s(g) = 29g + 1567. Let p be s(-54). Which is smaller: p or b? p Let f be 0 + 0 + 1 + -117. Let c be -7 + (-1 - 94)/(-1). Let j = f + c. Is j not equal to -28? False Suppose -w + 5 = 2p, -4w + 2p + 2 = 12. Let u = -296 - -289. Let o be (0 - (u + 6))-1. Do w and o have the same value? True Suppose h = 4y + 21, -2h + 0h = y - 6. Suppose -hx + 7 = 2x. Let a be ((-3)/78)/(18/(-8)). Which is smaller: a or x? a Let m = 700 - 367. Let q = m - 276. Let b = 128 - 71. Is b less than q? False Let i be (-35)/490*(2 + 12). Which i	{ "pile_set_name": "DM Mathematics" }
integer? 9 What is the fourth root of 738819979 to the nearest integer? 165 What is 23746158 to the power of 1/3, to the nearest integer? 287 What is the fourth root of 102624077 to the nearest integer? 101 What is the square root of 249068641 to the nearest integer? 15782 What is 83184436 to the power of 1/3, to the nearest integer? 437 What is the square root of 6975529215 to the nearest integer? 83520 What is the cube root of 356103687 to the nearest integer? 709 What is 97245060 to the power of 1/3, to the nearest integer? 460 What is the third root of 474497279 to the nearest integer? 780 What is 714384225 to the power of 1/3, to the nearest integer? 894 What is 73395612 to the power of 1/6, to the nearest integer? 20 What is the third root of 68297435 to the nearest integer? 409 What is 2076475025 to the power of 1/2, to the nearest integer? 45568 What is 1745045776 to the power of 1/6, to the nearest integer? 35 What is the cube root of 38992471 to the nearest integer? 339 What is the square root of 1762584 to the nearest integer? 1328 What is the cube root of 422246933 to the nearest integer? 750 What is the third root of 53504597 to the nearest integer? 377 What is 249690698 to the power of 1/6, to the nearest integer? 25 What is 105179284 to the power of 1/3, to the nearest integer? 472 What is 2252356788 to the power of 1/10, to the nearest integer? 9 What is the cube root of 6496795161 to the nearest integer? 1866 What is 596369361 to the power of 1/9, to the nearest integer? 9 What is 406080276 to the power of 1/4, to the nearest integer? 142 What is 48597290 to the power of 1/6, to the nearest integer? 19 What is the cube root of 38572211 to the nearest integer? 338 What is 548328207 to the power of 1/2, to the nearest integer? 23416 What is 79413355 to the power of 1/9, to the nearest integer? 8 What is the fifth root of 140785548 to the nearest integer? 43 What is 364326672 to the power of 1/8, to the nearest integer? 12 What is the seventh root of 890077394 to the nearest integer? 19 What is 151593281 to the power of 1/9, to the nearest integer? 8 What is the fourth root of 17600382 to the nearest integer? 65 What is the eighth root of 2247812075 to the nearest integer? 15 What is the third root of 115290817 to the nearest integer? 487 What is 137415349 to the power of 1/3, to the nearest integer? 516 What is 2404930124 to the power of 1/2, to the nearest integer? 49040 What is 127309710 to the power of 1/3, to the nearest integer? 503 What is 575436858 to the power of 1/2, to the nearest integer? 23988 What is the fourth root of 499523201 to the nearest integer? 149 What is 6049680435 to the power of 1/2, to the nearest integer? 77780 What is 252433660 to the power of 1/3, to the nearest integer? 632 What is 879294259 to the power of 1/2, to the nearest integer? 29653 What is 165388786 to the power of 1/7, to the nearest integer? 15 What is 212053195 to the power of 1/7, to the nearest integer? 15 What is 332641097 to the power of 1/4, to the nearest integer? 135 What is 49621881 to the power of 1/7, to the nearest integer? 13 What is 1029237566 to the power of 1/8, to the nearest integer? 13 What is 326585060 to the power of 1/3, to the nearest integer? 689 What is 68190882 to the power of 1/2, to the nearest integer? 8258 What is 5237675163 to the power of 1/3, to the nearest integer? 1737 What is the third root of 1943646055 to the nearest integer? 1248 What is the eighth root of 18829563 to the nearest integer? 8 What is the tenth root of 250780741 to the nearest integer? 7 What is 444989587 to the power of 1/2, to the nearest integer? 21095 What is the cube root of 84762192 to the nearest integer? 439 What is 5959392789 to the power of 1/10, to the nearest integer? 9 What is the square root of 85914392 to the nearest integer? 9269 What is 222504662 to the power of 1/10, to the nearest integer? 7 What is 3705489 to the power of 1/3, to the nearest integer? 155 What is 4716579 to the power of 1/10, to the nearest integer? 5 What is 1407991289 to the power of 1/3, to the nearest integer? 1121 What is the cube root of 2793008151 to the nearest integer? 1408 What is 4239300975 to the power of 1/2, to the nearest integer? 65110 What is 7547272051 to the power of 1/2, to the nearest integer? 86875 What is the square root of 48226223 to the nearest integer? 6945 What is the third root of 844402295 to the nearest integer? 945 What is the square root of 1165674127 to the nearest integer? 34142 What is the cube root of 4006743138 to the nearest integer? 1588 What is the square root of 4908839848 to the nearest integer? 70063 What is 264245571 to the power of 1/3, to the nearest integer? 642 What is the cube root of 3171427 to the nearest integer? 147 What is the eighth root of 380558262 to the nearest integer? 12 What is 204285821 to the power of 1/6, to the nearest integer? 24 What is 2255460211 to the power of 1/8, to the nearest integer? 15 What is 291030639 to the power of 1/4, to the nearest integer? 131 What is 917322638 to the power of 1/2, to the nearest integer? 30287 What is the cube root of 86746639 to the nearest integer? 443 What is the cube root of 1020897959 to the nearest integer? 1007 What is 589108251 to the power of 1/8, to the nearest integer? 12 What is the square root of 1055058777 to the nearest integer? 32482 What is 193197235 to the power of 1/2, to the nearest integer? 13900 What is the square root of 1348307978 to the nearest integer? 36719 What is 1758056560 to the power of 1/7, to the nearest integer? 21 What is 1195922181 to the power of 1/2, to the nearest integer? 34582 What is the cube root of 1793166291 to the nearest integer? 1215 What is the cube root of 280703274 to the nearest integer? 655 What is 223272584 to the power of 1/3, to the nearest integer? 607 What is 16651401 to the power of 1/6, to the nearest integer? 16 What is 265635572 to the power of 1/3, to the nearest integer? 643 What is 532645517 to the power of 1/4, to the nearest integer? 152 What is the fourth root of 697900350 to the nearest integer? 163 What is the square root of 76424476 to the nearest integer? 8742 What is 297983227 to the power of 1/3, to the nearest integer? 668 What is 52630204 to the power of 1/2, to the nearest integer? 7255 What is 3120068886 to the power of 1/4, to the nearest integer? 236 What is 107334398 to the power of 1/3, to the nearest integer? 475 What is the cube root of 123227324 to the nearest integer? 498 What is the cube root of 370289815 to the nearest integer? 718 What is 22050463 to the power of 1/8, to the nearest integer? 8 What is the cube root of 875688758 to the nearest integer? 957 What is the third root of 231351758 to the nearest integer? 614 What is 42346293 to the power of 1/3, to the nearest integer? 349 What is the cube root of 658413998 to the nearest integer? 870 What is the third root of 2464073741 to the nearest integer? 1351 What is the square root of 477335520 to the nearest integer? 21848 What is the third root of 1195451100 to the nearest integer? 1061 What is 686869146 to the power of 1/5, to the nearest integer? 59 What is the third root of 262965565 to the nearest integer? 641 What is 36459935 to the power of 1/2, to the nearest integer? 6038 What is 133158168 to the power of 1/5, to the nearest integer? 42 What is 498620087 to the power of 1/2, to the nearest integer? 22330 What is 1381562687 to the power of 1/9, to the nearest integer? 10 What is 32389318 to the power of 1/2, to the nearest integer? 5691 What is the ninth root of 5453525132 to the nearest integer? 12 What is 25703052 to the power of 1/3, to the nearest integer? 295 What is 70086192 to the power of 1/3, to the nearest integer? 412 What is 96883095 to the power of 1/2, to the nearest integer? 9843 What is the square root of 7569348 to the nearest integer? 2751 What is the square root of 63394392 to the nearest integer? 7962 What is 1091549799 to the power of 1/3, to the nearest integer? 1030 What is the fourth root of 76477545 to the nearest integer? 94 What is the third root of 304242627 to the nearest integer? 673 What is 1462595702 to the power of 1/3, to the nearest integer? 1135 What is the t	{ "pile_set_name": "DM Mathematics" }
142. Let y(x) = -2x + 283. Determine -11t(a) - 6y(a). a - 136 Let q(r) = -1416r - 4r2 + 3r*2 - 6 + 1421r. Let x(l) = l - 1. Determine -2q(z) + 11x(z). 2z2 + z + 1 Let u be (-42)/7((-9)/(-6) - 3). Let i(s) = -4s3 + 2s*2 + 2s. Let a(k) = 9k2 - 7k*3 + 5k + 3k - 10k*3. Give ui(l) - 2a(l). -2l*3 + 2l Let h(y) = 8y3 - 8y*2 - 6. Let r(o) be the second derivative of 3/4o*4 + 0o*3 - 17o - 9/20o5 + 0 + 7/2o*2. Calculate -7h(c) - 6r(c). -2c*3 + 2c*2 Let h(v) = 9 + 10 + 5v*2 - 34 - 4v + 11. Let u(j) = -4j2 + 3j + 3. Calculate 3h(g) + 4u(g). -g2 Let d(k) = k3 - 4k2 + 18k - 4. Let b(i) = i*3 - 5i*2 + 18i - 5. Give 5b(f) - 6d(f). -f3 - f2 - 18f - 1 Let r(n) = n3 + 9n2 + 3. Let c(h) = -h3 - 8h2 - 2. Calculate 6c(k) + 4r(k). -2k*3 - 12k*2 Let j(n) = -n + 2. Let i(t) = 4t + 1. Let l(q) = i(q) - 2j(q). Suppose -v + 4 - 7 = 0. Let d(r) = 11r - 5. Give vd(f) + 5l(f). -3f Let i(g) = -660g*2 + 8g - 3. Let m(h) = 1318h2 - 18h + 7. Give -7i(k) - 3m(k). 666k2 - 2k Let x(a) = 5a + 5. Let i(m) be the second derivative of -m3/2 + 9m*2/2 - 11m. Let c(f) = -f + 1. Let q(s) = -6c(s) + i(s). What is 7q(t) - 4x(t)? t + 1 Let z(a) = -9a - 106. Let s(j) = 3j + 36. Determine 11s(y) + 4z(y). -3y - 28 Let t(r) = -r*2 - r - 1. Let g(b) be the second derivative of -3b5/20 + b4/2 + 2b3/3 + 3b*2 + 2b. Let a = 3731 + -3732. What is ag(o) - 6t(o)? 3o3 + 2o Let x(w) = 7w2 - 7. Let p(j) = 2j3 - j3 + 7 - 13 + 6j2. Give -7p(m) + 6x(m). -7m*3 Let g(b) = -2b - 4. Let a(p) = -p - 1. Let k = 184 - 186. Calculate kg(d) + 6a(d). -2d + 2 Let y(k) = 0k + 5k + 6 - 8k2 + k2. Let w(h) = 23 - 5h2 - 38 + 3h + 18 + h*2. Let d = -129 - -134. Calculate dw(u) - 3y(u). u2 - 3 Let y(k) = -590k + 8. Let j(h) = 43071h - 586. Determine 4j(u) + 293y(u). -586u Let v(b) = -20b2 + 15b + 1. Let k(q) = -5q2 + 4q. Give 9k(o) - 2v(o). -5o2 + 6o - 2 Let v(d) = d*2 - 8d - 3. Let f(u) = -u*2 - 8u + 1. What is 4f(c) + v(c)? -3c*2 - 40c + 1 Let c(u) = -u3 + u2 + 2u - 1. Let v(w) = 2w*3 - 11w*2 - 3w + 3. Determine 3c(o) + v(o). -o3 - 8o*2 + 3o Let g(v) = v - 4. Suppose -6p + 16p = 50. Let m(n) = -n + 5. Give pg(o) + 4m(o). o Let a(v) = -v3 + v2 - 1. Let g(p) = p*2 + 155p - 1. Give a(t) - g(t). -t*3 - 155t Let k(v) = 23v3 - 12v*2 - 6v - 14. Let z(j) = 8j3 - 4j*2 - 2j - 5. Determine -6k(q) + 17z(q). -2q3 + 4q*2 + 2q - 1 Let k(f) = -f - 3. Let u(p) = 1. Let i(a) = 1. Suppose 3h + 2h = -3y + 13, -5y + 13 = 4h. Let r(s) = yu(s) - 2i(s). Calculate 4k(c) - 12r(c). -4c Let b(g) = -9g2 - 13g - 58. Let h(n) = 4n2 + 6n + 29. Give 3b(j) + 7h(j). j*2 + 3j + 29 Let h(n) = -11n2. Let v(g) be the third derivative of 7/60g*5 - 11g*2 + 0g + 0g3 + 0g*4 + 0. Calculate 5h(b) + 8v(b). b2 Let g(t) = -507t - 24. Let n(r) = -27886r - 1314. Determine -219g(s) + 4n(s). -511s Let z(f) = -190f + 6. Let y(q) = -379q + 13. Determine -4y(l) + 9z(l). -194l + 2 Let n(m) = -15m*2 + 13m. Let g = 2 + 5. Let f be 5/(70/(-12))g. Let h(o) = -5o + 0o + o + 7o*2 - 2o. What is fn(q) - 13h(q)? -q*2 Let i(q) = 3q2 + q + 4. Let x(c) = c2 + c. Suppose 8n + 19n = -54. Determine nx(b) + i(b). b2 - b + 4 Let b(s) = 5s + 7s2 - 2s*2 + 3476 + 3s*3 - 3477. Let x be ((-9)/5 + 1)-5. Let h(d) = 2d3 + 4d*2 + 4d - 1. Give xb(k) - 5h(k). 2k3 + 1 Let n(m) = -m2 + 9m + 39. Let r be n(12). Let x(t) = 11t2 + 0t*2 + r - 2t*2 - 5t2. Let z(b) = -b2 - b - 1. Give -x(w) - 2z(w). -2w*2 + 2w - 1 Let i(h) = 740h + 7. Let s(f) = -368f - 3. Calculate -2i(y) - 5s(y). 360y + 1 Let t be (-120)/9(12/8 + -3). Let g(r) = 1 - 21r - 8 - t. Suppose -5x - 5l + 5 = 0, 0x + 31 = 4x - 5l. Let f(b) = 3b + 4. What is xg(y) + 27f(y)? -3y Let b(j) = -2j3 - 5j*2 + 3j. Let z(i) = -2i3 - 5i*2 + 3i. Determine -5b(m) + 4z(m). 2m3 + 5m*2 - 3m Let r(y) = 402y - 3. Let t(j) = 33j. Let u(n) = r(n) - 12t(n). Let b(p) be the second derivative of 7p*3/6 - 3p*2/2 - p. Calculate 4b(q) - 5u(q). -2q + 3 Let r(l) = 239l - 2. Let q(h) = -718h + 7. Give 2q(f) + 7r(f). 237f Let p(z) = 25z - 8. Let o(m) = 12m - 4. Determine 7o(w) - 3p(w). 9w - 4 Let m(y) = 8y3 - 7y*2 + 5y. Let z(o) be the second derivative of 9o5/20 - o4/2 + 2o*3/3 + 30o. What is -4m(s) + 5z(s)? 13s3 - 2s*2 Let s(h) be the first derivative of 0h + 4/3h3 + 0h*2 - 7 - 1/4h4. Let d(q) be the third derivative of q6/120 - q*5/60 + 2q*2. Give 3d(l) + s(l). 2l3 + l2 Let n(y) = -11y - 3. Let h(i) = 4i2 + 2i + 5. Let d(l) = l. Let o be d(-2). Let b be h(o). Let g(j) = -4j - 1. Calculate bg(q) - 6n(q). -2q + 1 Let j(m) be the second derivative of -3m3/2 + 5m*2/2 - m. Let x(r) = 11r - 17. Let q be x(2). Let t(y) = qy - 3 - 1 + 1. Give 6j(n) + 10t(n). -4n Let w(g) be the second derivative of -g3/6 + g2/2 + 19g. Let m(h) = -5h + 7. Calculate m(o) - 6w(o). o + 1 Let l(q) = -869q - 6. Let m(j) = 506625j + 3500. Give -1750l(y) - 3m(y). 875y Suppose -2h = 2h - 16. Let q = -1 + 16. Let x(d) = 1 - q + 13. Let y(u) = u - 1. Determine hx(v) - 3y(v). -3v - 1 Let c(w) = 4w3 + w2 - 32w + 21. Let v(n) = -n3 + 11n - 6. What is 2c(q) + 7v(q)? q*3 + 2q*2 + 13q Suppose 5u - 10 = -0u. Suppose 4q + u - 6 = 0. Let r(g) = g2 - 1. Let i(x) = 5x*2 - 2x - 5. Determine qi(k) - 3r(k). 2k2 - 2k - 2 Let u(w) be the third derivative of w6/120 + w5/60 - w*3/3 - 5w2 - 8. Let i(k) = k3 + 2k2 - 2. Give 2i(s) - 3u(s). -s3 + s2 + 2 Let i(u) = 242u + 7. Let o(p) = 483p + 12. What is -7i(j) + 4o(j)? 238j - 1 Let n(j) = j*3 - 554j*2 - 7j - 9. Let l(a) = a*3 - 555a*2 - 8a - 11. Give -5l(o) + 6n(o). o*3 - 549o*2 - 2o + 1 Let a = 2 - 8. Let q(t) be the third derivative of -t*5/12 + 6t*2 + t. Let u(y) = 7y*2. Give aq(n) - 5u(n). -5n2 Let n(k) be the third derivative of -k6/30 - k*5/60 - 7k*4/24 - 5k*3/6 + 23k*2 + 3k. Let i(r) = -2r3 - 3r - 2. What is -5i(d) + 2n(d)? 2d3 - 2d*2 + d Let j(s) = -s - 1. Let a(b) = -6b - 601. Determine -a(k) + 5j(k). k + 596 Let m(x) = 2. Let f(v) = -v2 - 22. Let w be 221 - (-6 + 6). Let d(n) = -w + 41n2 - 41n2 + n3. Let t be d(0). What is tm(h) - 2f(h)? 2h2 Let c(q) = 17q*2 - 48q. Let r(j) = -15j2 + 37j + 1. Let t(h) = 4c(h) + 5r(h). Let v(y) = 4y2 + 4y - 3. Calculate 3t(l) + 5v(l). -l*2 - l Let l(r) = -3r*2 + 8r + 1. Let c = -10 - -13. Let w be l(c). Let a(s) = -3s2 + s + 2. Let p(q) = -q2 + q. What is wp(j) + a(j)? -j2 - j + 2 Let s(h) = -h2 + 2h + 67. Let l be s(9). Let z(m) = -7m3 + m2 + 4. Let f(a) = 13a3 - a2 - 7. What is lf(y) + 7z(y)? 3y*3 + 3y*2 Let g(v) = -5v*2 + 80v + 4. Let n(w) = 11w2 - 161w - 9. Calculate -9g(i) - 4n(i). i*2 - 76i Let v(n) = -8140n - 198. Let j(s) = -1163s - 27. Give -22j(m) + 3v(m). 1166m Suppose 0 = -4r - 14 + 62. Suppose 0 = rz - 7z + 130. Let x = z - -30. Let b(v) = 3v2 - 7v - 4. Let k(l) = 3l2 - 6l - 3. Determine xb(p) - 5k(p). -3p2 + 2p - 1 Let v = 1547 + -1544. Let a(y) = y - 1. Let c(h) = -8h + 6. Give vc(l) + 21a(l). -3l - 3 Let o(m) = -4. Let y(p) = -p + 21. Give -o(g) + y(g). -g + 25 Let q = -25 + 26. Let j(m) = -13m - 18m - 5 - m*3 + 28m - 2m3. Let s(o) = o + 1. Give qj(x) + 3s(x). -3x*3 - 2 Suppose -5b + 4s + 53 = 0, -5b + 5s - 34 = -89. Let m(z) = -4z*3 + 9z*2 - 21z. Let f(g) = -g*3 + 2g*2 - 5g. Calculate bf(d) - 2m(d). -d*3 - 3d Suppose 16 = 4n, h = -3h - 3n + 16. Let g = -2 - h. Let z(y) = 15y - 4y + 3y - 5. Let q(i) = 5i - 2. Calculate gz(t) + 8q(t). -2t - 1 Let d(s) = 15s2 + 13s + 11. Let g(p) = -p + 2p - 6433 - 2p + 6428 - 7p2 - 5p. Calculate 6d(n) + 13g(n). -n*2 + 1 Let i(a) = 5a + 5. Let u(z) be the third derivative of -1/24z4 - 15z*2 + 0 + 0z - 1/6z3. What is -i(r) - 4u(r)? -r - 1 Let f(b) be the second derivative of -19b4/12 - 3b*2/2 + 15b + 18. Let n(c) = 96c*2 + 16. What is	{ "pile_set_name": "DM Mathematics" }
is the tens digit of l(-8)? 4 Suppose -18 = -0n - n. What is the units digit of 4/n - (-424)/36? 2 Let p(h) = h2 + 9h - 1. What is the tens digit of p(-12)? 3 Let z be ((-25)/(-10))/(2/4). Suppose -zr + 12 = -33. What is the units digit of r? 9 Let f(t) = 2t - 6. Let r(j) = -j*2 + 4j - 1. Let i be r(5). Let k = 0 - i. What is the units digit of f(k)? 6 Let b(l) be the first derivative of l4/24 + l3/3 + l*2/2 - 2. Let i(k) be the second derivative of b(k). What is the units digit of i(-1)? 1 Suppose 3z + 21 = 96. What is the units digit of (-42)/(-5) - 10/z? 8 Let s be (-1)/(84/(-81) + 1). Suppose 4x - 3d - 2d = s, -d = 4x - 9. What is the units digit of x? 3 Let b(x) = x + 5. Let r be b(-3). Suppose -w + rm = -2w + 5, 2w = m + 5. What is the units digit of w? 3 Let i(f) = 22f - 20. What is the tens digit of i(7)? 3 Let u = -12 - 0. Let m be 6/240/u. What is the units digit of 2/4 - 15/m? 2 Let f be ((-8)/6)/(8/(-12)). Suppose -3d = -0d + fh - 42, 0 = 5d - 2h - 86. What is the tens digit of d? 1 Let m(a) = -5a2 - 30a - 17. Let w(u) = -3u2 - 20u - 11. Let i(b) = 5m(b) - 8w(b). What is the units digit of i(10)? 3 Let g = -6 - -8. Let y(a) = 0 - 1 + 3a2 + 4a - 4a2. What is the units digit of y(g)? 3 Let s(m) = -m - 4. Let j be s(-6). Let y be (1/j)/(3/12). Suppose -p + yo = o - 11, -2p + 4o = -16. What is the tens digit of p? 1 Let d = -18 + 46. What is the tens digit of d? 2 Let r(w) = -w*2 - w + 2. Let i be r(-2). Suppose i = 6o - 3o - 6. Suppose x - 38 = -5z - 0x, 3x = z + o. What is the units digit of z? 7 Let y = -8 - -1. Let n = 10 + y. Suppose -4w = d - 12, 0 = d + nd. What is the units digit of w? 3 Suppose -5l - 5k + 175 = 0, 0 = 2k - 6. What is the tens digit of l? 3 Let h(d) = -7d*2 + d + 7. Let z(m) = -13m*2 + m + 13. Let y(b) = -11h(b) + 6z(b). Let k = 35 - 39. What is the units digit of y(k)? 5 Suppose -3j + 4 = j. Let p(c) = c*2 - c + 1. Let d be p(j). Suppose w = -d + 17. What is the tens digit of w? 1 Suppose 287 = -3a - d + 3d, 3a + 322 = -5d. Let g = -71 - a. What is the tens digit of g? 2 Let p = 5 + -1. Suppose 0 = -0a - pa + 12. Suppose 0 = -ak + k + 14. What is the units digit of k? 7 Let y = -15 - -27. What is the tens digit of y? 1 Let o = 0 - -3. Let v = -7 - -31. Suppose -u - ou + v = 0. What is the units digit of u? 6 Suppose -7y + 1834 = -0y. What is the hundreds digit of y? 2 Suppose 5i = 4p - 3p - 8, i + 7 = 2p. Suppose 0b = -pb + 3. What is the units digit of b? 1 Let d(s) = -s + 4. Let u be d(2). Let b = u + 2. Suppose -2g = -bn + 2g + 48, -g = -3n + 30. What is the units digit of n? 9 Let m(d) = -d2 + 10d - 2. What is the tens digit of m(7)? 1 Let l(p) = p*2 - 2p - 3. Let i be l(-5). Let w = i + -7. What is the units digit of w? 5 Let s be 2/(-1) + 0/(-1). Let p = 7 + s. What is the units digit of p? 5 Suppose -5r + 135 = -2p, -4r + 2r + p + 55 = 0. What is the tens digit of r? 2 Let p(n) = 2n2 - 5n + 4. Let r(u) be the first derivative of u*2/2 + 4u - 3. Let m be r(0). What is the tens digit of p(m)? 1 What is the tens digit of 860/10 + 3(-8)/(-6)? 9 Let k = -65 + 119. What is the units digit of k? 4 Let o(h) = -2h*3 - 7h*2 - 7h - 3. What is the units digit of o(-5)? 7 Suppose 0d - 2a = 4d + 100, 4d - a = -106. Let x = -12 - d. Let h = x - 9. What is the units digit of h? 5 Suppose 2f - 4i + 7 = -i, -f = -5i + 21. Suppose -6 = -2d, -d - 3d - 84 = -fu. What is the units digit of u? 4 Let m(k) = 4k + 16. What is the units digit of m(11)? 0 Let g(n) = n3 + 7n*2 - 9n + 2. What is the tens digit of g(-8)? 1 Let p(f) = -3f. Let s be p(-4). Suppose -s = -5b + 2b. What is the units digit of b? 4 Let l = 13 + -11. Let v = l + 5. Let c = v - -11. What is the units digit of c? 8 Let j be 1/(33/15 + -2). Suppose 2f + 2d - 186 = -2f, -129 = -3f - jd. Suppose 0 = -5i + i + f. What is the tens digit of i? 1 Let a be ((-1)/(-2))/(20/40). Let s = a + 0. What is the units digit of s? 1 Let a = -5 + 1. Let h be 2 + -502/a. What is the units digit of (h(-2)/(-3))/2? 9 Let t = 11 - 11. What is the units digit of 20 + t + -3 + 0? 7 Suppose y + 0y = 37. What is the units digit of y? 7 Let m = 52 - 31. What is the units digit of m? 1 Suppose 10 = 4p + 3s - 4, -6 = -3s. Suppose x - 1 = 2x, -4v = -4x. Let i = p + v. What is the units digit of i? 1 What is the tens digit of -1(-27 - -1) - 1? 2 What is the units digit of (0 + -3)2/(-3)? 2 Let n = 7 + -5. Let r(f) = 2fn - 5 - f2 + 1. What is the units digit of r(3)? 5 Let d(k) = k3 + k2 - 4k + 3. Let j be d(2). Let b be (-8)/4 - 6/(-1). Suppose -bo - j + 39 = 0. What is the units digit of o? 8 Let x(m) = -m3 + 7m*2 + 12m - 5. What is the hundreds digit of x(6)? 1 Suppose -5 = -5x + a - 0, 2a = 0. Let t be x33/9. What is the units digit of t/(1 + (-12)/15)? 5 Suppose 5h = 20, -2d + 67 + 81 = -3h. Let p be (-4)/(-8) - 2/4. Suppose pm = 5m - d. What is the tens digit of m? 1 Let l(k) = -k3 + 6k*2 + 9k - 2. Let i = 6 + 1. What is the units digit of l(i)? 2 Let c(v) = v + 12. Suppose -3j = -1 - 11. Suppose -5a = 41 + j. What is the units digit of c(a)? 3 Suppose 5w = -a + 20, 2a + 5w = 3w + 40. Let o = a - 7. What is the units digit of o/4 + 2/(-8)? 3 What is the units digit of ((-140)/16 - -4)/((-2)/56)? 3 Let c = -21 - -31. Let p(s) = cs - 5 - 6s - 2s. What is the units digit of p(6)? 7 Let z = -152 - -232. Let o be (-7)/21 - z/(-6). Let j = 26 - o. What is the tens digit of j? 1 Let z be 1/4 - (-19)/4. Suppose -zc + 19 = -a, a + a - 22 = -5c. What is the tens digit of 14 - (a - (0 - 0))? 1 Let p(o) = o3 - 10o*2 + 8o - 23. What is the units digit of p(10)? 7 Let y be (-6)/(-2) + (-7)/7. Suppose -ym + 6 = -2c, c + 6 = 3m - 7. What is the units digit of c? 2 Let x(z) = z3 + z2 + 3. Let u be x(-3). Let w be (-5)/u - 2/6. Let m(c) = -c + 9. What is the units digit of m(w)? 9 Suppose -2y = r + 4, -y = 3r - 5y - 28. Let j(l) = -l*3 + 4l*2 + 2l + 2. What is the units digit of j(r)? 0 Let h = 101 + -69. What is the units digit of h? 2 Let l(x) = -x*2 + 6x + 2. Let c(j) = j*2 - 2j - 2. Let z be c(-2). What is the units digit of l(z)? 2 Suppose 8q - 340 = 12q. Let p = -41 - q. What is the tens digit of p? 4 Suppose 5c + 5 = -5. Let b(p) = -p2 + p - 1. Let a be b(c). Let t = -5 - a. What is the units digit of t? 2 Suppose 2n = -0n - 5s + 241, -4n + 3s + 443 = 0. What is the hundreds digit of n? 1 Let r = -28 - -30. What is the units digit of r? 2 Suppose -2c = -2 - 4. Suppose -2o = co - 60. What is the tens digit of o? 1 Let i(f) be the third derivative of 2f*2 + 0f + 0f3 + 1/24f*4 + 0. What is the units digit of i(7)? 7 Suppose -4i - k + 616 = 3k, k - 312 = -2i. What is the units digit of i? 8 Let o be (2 + -1)/(3/6). Suppose ou - 184 = -2u. What is the units digit of u? 6 Suppose 2o = -2o + 60. Suppose o = 5k - 15. What is the units digit of k/(-4)2/(-3)? 1 Suppose -2q + 4 = -3w + 13, 0 = -w - q + 3. Suppose wz = 8z. Suppose 5h - 20 = -zh. What is the units digit of h? 4 Suppose -i + 3q + 7 = -3, -4i = 3q - 10. What is the units digit of i? 4 Let s = -17 + 33. What is the units digit of (s/12)/(2/3)? 2 Let u(l) = -l3 + 8l*2 - 2l. What is the units digit of u(3)? 9 Let k(z) = -z + 11. Let i(j) = j*3 + 8j*2 + 7j + 3. Let c be i(-7). Suppose -4y + 7y + 2m - 27 = 0, 0 = y - cm - 9. What is the units digit of k(y)? 2 Let k(u) = -5u + 11. What is the units digit of k(-6)? 1 Let b be -62/(-1 + 5). Let i be (-9)/(-18) + 9/(-2). Let p = b - i. What is the units digit of p? 1 Suppose 155 + 190 = 5x. What is the tens digit of x? 6 Let x(f) = -10f. Suppose 12 = 5u - 2u. Suppose -d - 3d = u. What is the units digit of x(d)? 0 Let n(s) = -s3 - 20s*2 - 9s + 17. What is the hundreds digit of n(-20)? 1 Suppose 0 = -4c - 2d + 10, -2c - 16 = -5d - 51. Let f = 7 - c. Suppose 0m - m - f = 2k, m - 4k = 28. What is the units digit of m? 8 Let x(d) be the second derivative of d3/6 + 4d*2 + 13d. Suppose 5q = -3p + 41, -2p = -7p - 3q + 47. What is the units digit of x(p)? 5 Suppose n - 6 = 1. Let z be 4 + -1(0 + 0). Let u = n - z. What is	{ "pile_set_name": "DM Mathematics" }
2 + 2k + 3. Let h be x(-3). Let t be (h/90)/((-4)/(-6)). Which is the third smallest value? (a) 0.2 (b) s (c) t a Let k = 3.2 + -6.2. Which is the third smallest value? (a) -0.4 (b) -0.3 (c) k b Let m = -0.1 - -1.1. Let v = -0.249 - -0.049. What is the second smallest value in 5, m, v? m Suppose -5d - 20 = -5r, 20 = 4r + 2d - 7d. Suppose 7o - 3o - 4 = r. Let p be 2/3(-6)/14. Which is the second smallest value? (a) o (b) -2/3 (c) p c Let z be ((-4)/30)/((10 + 1)/33). Let t = -422/321 + -2/107. What is the biggest value in t, 2/11, z? 2/11 Suppose -z + 4t + 12 = -5z, 0 = z - 5t - 21. Let k be 12/21z/4. What is the second biggest value in k, 0.4, 3? 0.4 Let u be 4/(-10) + (-244)/15. Suppose 0 = -2d - 2d + 68. Let k = u + d. Which is the third smallest value? (a) k (b) -3 (c) -4 a Let p be 21 - (-36)/4. What is the third biggest value in -2, 1, p? -2 Let m be 4/14 - 160/364. Which is the second biggest value? (a) -1/4 (b) m (c) 0.2 b Let y = 2.2 + 1.3. Let g = 0.5 + y. Which is the second biggest value? (a) 3 (b) 1/2 (c) g a Let p = 10.9 - 12. Let h = p + 1. Let l = 4 - 9. What is the second biggest value in 5, l, h? h Let m be (-2)/9 + (-244)/36. Let t be 0 + (-1)/(m/(-2)). Which is the biggest value? (a) 0.4 (b) 5 (c) t b Let m = -88 + 88.1. Which is the fourth smallest value? (a) m (b) -12 (c) -0.5 (d) 3 d Let l = 0.6 + -0.1. Let m = l + -0.4. Which is the third smallest value? (a) -5 (b) -3 (c) m c Let l(r) = 3r*3 + 3r*2 - 2. Let h be l(-1). Let y = 2 - 2. What is the smallest value in y, h, 4? h Let t = -31 - -65. Let m be 1 + (-106)/t + 2. Which is the second biggest value? (a) m (b) -1 (c) -0.4 c Let b = -6 - -41/7. Let f = -0.7 + 0.6. What is the smallest value in f, b, 1? b Let m = -13 + 13.1. Which is the second biggest value? (a) m (b) 2/15 (c) 0.4 b Let m = 4 + -7.7. Let b = m + 1.7. What is the second biggest value in b, 0, 2/3? 0 Let b = 5 - 4.9. Let s = 0.3 - 0.1. What is the biggest value in 0.3, b, s? 0.3 Let q = 0.04 - 0.03. Let n = q - 0.31. Which is the third biggest value? (a) -1/5 (b) n (c) 2/3 b Let t = -0.5 + 0.3. What is the smallest value in t, 0.4, 1? t Let k = 0.09 - 10.09. Let q = 11 + k. Which is the second biggest value? (a) 2/3 (b) -3 (c) q a Let j = -0.1 + 0.6. Let v = 4/25 - 14/25. Which is the smallest value? (a) v (b) j (c) 2/11 a Let a = 9 + -12. Let t = a - -3.5. What is the second biggest value in t, 5, -2? t Let j = -3 - -4.4. Let n = j - 0.4. Let c = -397/3 - -131. What is the second biggest value in n, -1, c? -1 Let b = 16 - 17. Let k = 8 + 4. Let j be k/(-9)(-6)/4. What is the third smallest value in j, -4, b? j Let u = -0.6 - 2.4. Let s be (-4)/(-8) + 39/(-54). Which is the second smallest value? (a) -2 (b) s (c) u a Let w = -15 + 24. Let f = w + -6. Let m = f - 4. What is the smallest value in -0.3, 0.3, m? m Let p = 3 + -7. Let y = 0.38 + -0.3. Let t = y + -0.04. What is the third biggest value in t, 0, p? p Let q be 2/((-52)/(-20) + -3). Suppose -4v = -3k, 5k - v = 2v + 11. Which is the third biggest value? (a) k (b) -3 (c) q c Let y = 4.05 + -4.45. Let u = -1 + 1.04. Which is the third smallest value? (a) u (b) 0.5 (c) y b Let m = -5 + 2. Let c be (-30)/(-4) + (-15)/10. Suppose -c = -2n + 2. What is the second biggest value in m, n, 1/6? 1/6 Let h = -127/4 + 32. Let v = 0.04 - 0. Let d = 4.96 + v. What is the second smallest value in h, 3, d? 3 Let g = 2.52 + -0.02. Let w = g + -3. Which is the second smallest value? (a) 1/3 (b) w (c) -1 b Let h = -0.4 - -0.2. Let a = h + -0.8. Let p = -2.616 - 0.384. What is the second smallest value in a, 1, p? a Let u be (-2 + 5 + -2)-17. Which is the second smallest value? (a) 3 (b) -2/3 (c) u b Let r = -3.93 - 0.07. Let o = 0.16 + -0.26. Let y = -1 + 1.1. Which is the second biggest value? (a) r (b) y (c) o c Let r = 3.01 + -0.01. What is the biggest value in -5, 1, r? r Let y be (-2)/5 - (1 + -2). Let c be (0/((-1)/(4/12)))/2. What is the biggest value in c, y, -4? y Let f be 2 - (-1)/(10/(-24)). Let x = -2 + 2.1. Let g = -3.1 + x. Which is the third biggest value? (a) g (b) 0.3 (c) f a Let n = -0.2 - -0.2. Let j(f) = f*2 + f - 10. Let d be j(-4). Which is the third smallest value? (a) -1 (b) d (c) n b Let y be (-13)/78 + (-622)/(-300). Let b = 6/25 - y. Let w be (-3)/((-2)/(-2) - 0). What is the third smallest value in w, -4, b? b Let o be 236/(-5) + 1/5. Let x = 425/9 + o. Let v = 0.49 + 0.01. What is the third smallest value in x, v, 0.3? v Let m = 4 + -2. Suppose -2w = -6w + 12. Suppose -v - 16 = wv. Which is the second smallest value? (a) 3 (b) m (c) v b Let m be (-6)/(-15) - (-2)/(-30). Let d = 48 + -45. What is the third biggest value in d, m, -1/3? -1/3 Let w = 27 + -21.6. Let z = w + -1.4. Let f = 15/2 + -7. What is the smallest value in 0.4, z, f? 0.4 Let n = 1.2 - 0.9. Let s = 0.58 - -0.12. Let x = n + s. Which is the smallest value? (a) -1/4 (b) 2/11 (c) x a Let t = 19 + -9. Let v = 6 - t. What is the third biggest value in 1/4, v, 0? v Let u(b) = b*3 - 5b*2 - 7b - 8. Let f be u(6). Let k = f - -4. Let y = -19/2 - k. What is the biggest value in y, 1, 0.3? 1 Let a = 0 - 5/4. What is the second smallest value in 0, a, -1/3, -4? a Let j = -5.99 - -0.99. What is the smallest value in 3, j, 2/21, -2/5? j Let h = 0.03 - 0.01. Let q = h - -1.98. Let w be ((-2)/(-4))/(2/4). What is the second biggest value in -5, q, w? w Let v(j) = 2j - 1. Let x be (-4)/(-2) + (-8 - -4). Let u be v(x). What is the third smallest value in u, 4, 1? 4 Let k be 18/(-16)16/12. What is the second smallest value in k, -5, 0.3, 2? k Suppose r + 3q = -0r + 14, -9 = -3q. Let l = -9 + r. Let m = 0 + 1. Which is the biggest value? (a) l (b) m (c) 1/5 b Let x = 13.4 - 13. Which is the biggest value? (a) 4 (b) -3/4 (c) x a Let k be 21/147 + 1/(-7). Which is the biggest value? (a) 4 (b) 5 (c) k (d) -4 b Let o(r) be the first derivative of -r2 - r + 3. Let s be o(-2). What is the smallest value in -3, s, -1/9? -3 Let b = -0.053 + -0.347. What is the smallest value in b, 0, -0.3, 5? b Let q = 91.2 + -91. Let n be ((-4)/6)/(1/(-6)). Which is the third biggest value? (a) n (b) 3 (c) q c Let a = -13.13 + 0.13. Let f = a - -11. What is the smallest value in f, -0.1, 1.3? f Suppose -4i - 8 = -3i. Let t(o) = 12o - 9. Let q be t(6). Let n be q/12 + 2/i. Which is the biggest value? (a) -1 (b) n (c) -4 b Let p be 9/((-81)/(-6))-3. What is the smallest value in -3, p, -0.2? -3 Let r = -4.7 + -2.3. What is the fourth biggest value in r, 0.1, 2, 0? r Let j = -0.15 + 0.2. Let h be (21/9 - 4) + (-2)/(-12). What is the smallest value in 2/5, h, j? h Let z = -1887/13 + 145. What is the second biggest value in 3, z, -0.9? z Let y = 3/11 - 1/44. Which is the second smallest value? (a) -4 (b) y (c) 2/13 (d) -16 a Let s = 109/3 + -36. Let m = -14 - -15. What is the third biggest value in s, -3, m? -3 Let o = 3.89 + -3.8. Let v be (6/3)/(7/1). Which is the smallest value? (a) 1 (b) v (c) o c Let o be (-22)/6 - 4/(-6). Suppose 4b - 46 = 10. Let i = b + -27/2. What is the third biggest value in -4, o, i? -4 Let q = -4 + -5. Let l = q + 8.6. Suppose 5j + 4d = 3d + 25, -2j + 10 = -3d. Which is the second biggest value? (a) l (b) j (c) 4 c Suppose w + n = 6w + 67, 3*n = -9. Let j be w/(-7) + 7/(-1). What is the biggest value in 0.4, j, -13? 0.4 Let f = -16.1 + 0.1. Let g = f + 15.8. Which is the biggest value? (a) g (b) -4 (c) 5 c Let y = -34.2 - -34. What is the second biggest value in -5, y, -2? -2 Let i = 4 + -6. Let q = i - -1.8. Let y be (-26)/(-10) - 2/1. What is the third smallest value in y, 0.3, q? y Let d = 12433 + -1616313/130. Let i = 8/65 - d. What is the biggest value in 1, -3, i? 1 Let m = 157/596 - 2/149. Which is the smallest value? (a) m (b) 1 (c) 4 a Let d = 23 - 21. What is the second smallest value in d, -1, 0.4? 0.4 Let c = -14 - -15. Let p be (-10)/7 + 1/1. What is the biggest value in c, 0.5, p? c Let m = 6 - 5.5. Let y = -9 + 14. Let h = -1 + y. What is the third biggest value in 0.1, h, m? 0.1 Let k = 0.4 - 0.6. What is the second biggest value in 0.1, k, -3/17? -3/17 Let c = 1.9 - 9.9. Let m = -8.4 - c. What is the second small	{ "pile_set_name": "DM Mathematics" }
. Let f be (-1)/b + 6 + -5. Calculate the remainder when 40 is divided by ((-168)/18)/(f/(-3)). 12 Let n = 51 + -11. Suppose -2h - 3j = 22 - 66, 0 = 2h + j - n. What is the remainder when 74 is divided by h? 17 Let s(z) = -3z - 12. Let u be s(-6). Suppose 4p - up = -6. Let f = p + 7. Calculate the remainder when 37 is divided by f. 7 Suppose 9l - 43 - 2 = 0. Suppose -3x + lp + 41 = -41, 3p = -2x + 42. What is the remainder when x is divided by 10? 4 Let a be 4/(-3)21/14. What is the remainder when a/(-8) - (-286)/8 is divided by 19? 17 Let p be 2/(-6) - (-143)/(-3). Let y = 97 + p. Let j = 17 + -7. What is the remainder when y is divided by j? 9 Suppose -5u + 173 = -457. Suppose 5n - 9 = u. What is the remainder when n is divided by 10? 7 Suppose 0 = 3l + 5x - 15, 5l + 0l - 25 = x. Let k = 9 - l. What is the remainder when 42/8 - 1/k is divided by 4? 1 Let b(v) = 3v2 + 45v - 17. What is the remainder when 245 is divided by b(-16)? 28 Let a be (0/(-1))/(0 + -1). Suppose -f + af + 3 = 0. What is the remainder when 3/(-4 - -5) + 0 is divided by f? 0 Calculate the remainder when (-258)/(-4) + 3/6 + -1 is divided by 30. 4 Suppose -3c + 210 = -0c. Calculate the remainder when c is divided by 15. 10 Suppose 4w + 127 = 6w + z, 259 = 4w - 3z. Suppose k - 5r = 13, -5k = -r - 2 - 63. Calculate the remainder when w is divided by k. 12 Let o(q) = -57q - 2. Let u be o(-3). Let j = 519 - u. Suppose -380 = -5s - 2v, 5s + 0s - j = 4v. What is the remainder when s is divided by 19? 17 Let u(k) = -91k + 500. What is the remainder when u(5) is divided by 10? 5 Let m = -391 + 963. What is the remainder when m is divided by 48? 44 Suppose 412 = 6q + 16. What is the remainder when q is divided by 9? 3 Let f(k) = k2 - 108. What is the remainder when f(-14) is divided by 45? 43 Calculate the remainder when (22 - 27) + (45 - -1) is divided by 16. 9 Suppose -p - 83 = -2u, -2u - 4p = -5u + 127. What is the remainder when 490 is divided by u? 39 Let k(q) = -q2 + 9q + 14. Let g be k(10). Let y(n) = n*2 + 3n + 7. Let a be y(-2). Suppose -a = -gz + 27. What is the remainder when 14 is divided by z? 6 Suppose -3v + 2f = -2v - 14, -2f + 96 = 4v. What is the remainder when 97 is divided by v? 9 Let t(c) = -9c. Let g be t(-1). Suppose 0 = -gk + 5k + 52. Suppose 4y = -16 + 48. What is the remainder when k is divided by y? 5 Let i be (45/(-12))/(12/(-32)). Let m be (-13)/(-5) - i/(-25). Calculate the remainder when (-3)/((-5)/(20/m)) is divided by 3. 1 Let c be (9/(-18))/(2(-3)/60). Suppose 0 = -2y - 3x + 279, 0x = cy - 4x - 755. Calculate the remainder when y is divided by 30. 27 Suppose -2t - 1 = 3. Let z(o) = -47o. Suppose 96 = 4m - k, -11m + 8m - 4k + 72 = 0. What is the remainder when z(t) is divided by m? 22 Suppose -n - 3p + 74 = 0, 4n - 309 = 2p - p. Calculate the remainder when (-1 - 0) + n + -6 is divided by 19. 13 Suppose -2h + 1415 = 5p, 9h - 10h - 849 = -3p. What is the remainder when p is divided by 37? 24 Suppose 2d = 4b + 10, -2d = -2b - 3b - 10. Suppose w + bw - 38 = 0. Calculate the remainder when w is divided by 20. 18 Let j = 109 + -105. Suppose -2v - 111 = -5f + 4f, 454 = jf - 3v. Calculate the remainder when f is divided by 29. 28 Let i(q) be the third derivative of -q4/4 - q3/2 + 4q*2. What is the remainder when i(-11) is divided by 33? 30 Let w(o) = -o + 5. Let b be w(5). Let h be 1/(3/(-8))3/(-2). Suppose -hc + bc = -48. What is the remainder when 33 is divided by c? 9 Suppose -2z + 5l = -505, -2z - 4l = -5l - 493. Suppose 5b + 5y = -0y + z, -b = -5y - 55. Calculate the remainder when b is divided by 16. 2 What is the remainder when (-14 + 368/24)/(2/252) is divided by 90? 78 Suppose 0 = 5i + 3g - 43, 5i - 3g = 20 + 17. Suppose 43w - 32w = 209. Calculate the remainder when w is divided by i. 3 Let f(x) = x3 - x2 + 13. Suppose -11n + 114 + 645 = 0. Suppose -126 = -4l + 2c - 40, 3l + 3c = n. Calculate the remainder when l is divided by f(0). 9 Suppose 0 = -2p - 2, 5q + 2p + 2 = 20. Suppose -15 = -5h + 2g, 0g + qg - 15 = -5h. Calculate the remainder when 54/4(-6)/(-9) is divided by h. 0 Suppose 0 = 3b - 7x + 2x + 57, -4x = -4b - 68. Let f = 59 + b. Suppose -f = -5n + 3w, -n + 9 = 4w - w. What is the remainder when 24 is divided by n? 6 Suppose 0 = 29x - 32x + 69. What is the remainder when x/(-4)104/(-13) is divided by 24? 22 Suppose 5z - 7j = -11j + 108, 4z + 4j = 84. What is the remainder when 260 is divided by z? 20 Suppose -11 + 116 = 5q. Let a(h) = -h*2 + 23h - 34. What is the remainder when 15 is divided by a(q)? 7 Suppose 6 = 3s - 6. Let g(l) be the second derivative of -l4/12 + 5l3/6 - l2/2 + 3l. Calculate the remainder when 9 is divided by g(s). 0 Let i = 51 - 35. Let x = -78 - -207. Suppose -6 = -3f + x. What is the remainder when f is divided by i? 13 Let z(c) = c*3 + 71c*2 - 140c + 467. Suppose 53 = d - 62. Calculate the remainder when d is divided by z(-73). 28 Let n(y) = y*3 + 2y*2 - 8y + 21. What is the remainder when 80 is divided by n(0)? 17 What is the remainder when 65 is divided by (-135)/(-10) + 4 + (-2)/4? 14 Suppose 2c - 30 = -5n, -2c - 3n + 1 + 25 = 0. Suppose 5g = 2g - 354. Let s = g - -135. What is the remainder when s is divided by c? 7 Suppose 0 = 2u + 2q - 300, -1 = -5q + 4. Calculate the remainder when u is divided by 22. 17 Let m = -130 - -234. Let g = 151 - m. Suppose 0 = -2y + 4j + 24, y - 12 = -0y - 4j. What is the remainder when g is divided by y? 11 Suppose -104 = -2o + 4j, -o + j = 3j - 44. Let s be ((-3)/(-2))/30. What is the remainder when o is divided by (s - -25)(2 - 1)? 23 Let d = -2 - -11. Suppose 0y = y + d. What is the remainder when 15 is divided by 2/3 + (-48)/y? 3 Let t(h) = -3h*3 - 4h*2 - 5h - 15. Calculate the remainder when 142 is divided by t(-3). 7 Suppose -5j - 79 = -4d, 0 = -3j - d - 29 - 32. Let p = -16 - j. Let x = -1 + 3. What is the remainder when p is divided by x? 1 Let b(p) = -p3 - 10p*2 - 15p + 10. Let o be b(-8). Suppose 3l - 2l - 71 = 0. Calculate the remainder when l is divided by 2((-26)/(-4) - o). 8 Suppose 5200 = 16f + 34f. Calculate the remainder when 726 is divided by f. 102 Suppose -100z = -105z + 385. Let y = z - 52. What is the remainder when 124 is divided by y? 24 Suppose 2m + 22v - 151 = 21v, -93 = -m - 4v. What is the remainder when 277 is divided by m? 58 Let w = -183 + 220. Calculate the remainder when 108 is divided by w. 34 Let p = -2561 + 2684. Calculate the remainder when p is divided by 6/(-4)(-64)/3. 27 Let s = -174 - -294. What is the remainder when s is divided by 26? 16 Suppose -v - 85 = -2b, -4v = v + 5. Let p(z) = -3z - 9. Calculate the remainder when b is divided by p(-8). 12 Suppose 2y - 32 = 5n, 4n - 25 = y - 4y. Suppose -2l - 102 = -0l - 2h, -67 = 2l + 5h. Let k = -14 - l. What is the remainder when k is divided by y? 10 Let w be 1900/153/2. Suppose -o + w = 4o. Let c = -11 - -25. Calculate the remainder when o is divided by c. 10 Suppose 3z - 112 = -s, -z - 3s + 63 = z. Suppose z = 5t + 2j, 0 = 5t - 0t - 3j - 29. Calculate the remainder when 25 is divided by t. 4 Let r = -31 + 36. Suppose 3g - 77 = rp, g = 4g + p - 53. What is the remainder when 67 is divided by g? 10 Let a(q) = 10q - 5. Let j be a(4). Suppose -s = 4l - 5s - 56, 0 = -2l - 5s + j. Let v(n) = n2 + 7. Calculate the remainder when v(7) is divided by l. 11 Suppose -7c + 3c + 24 = 0. Let r = 27 + c. What is the remainder when r is divided by 18? 15 What is the remainder when 18945/24 + (-33)/88 is divided by 79? 78 Suppose 2d = -3y + 29, 5d - 5y - 15 = -y. Let r = -55 - -59. Suppose 5f - 79 = -3m, 0m - 82 = -2m + rf. What is the remainder when m is divided by d? 5 Suppose 62l = 66l - 5w - 76, 5w = 0. What is the remainder when 58 is divided by l? 1 Let k(p) = p*2 - 13p + 2. Let j be k(13). Let s be 4/(0 - j/12). Calculate the remainder when 22 is divided by (s/18)/(2/(-18)). 10 Suppose -1060h + 1067h = 98. What is the remainder when 53 is divided by h? 11 Let i = -72 + 41. Let n = 42 + i. Calculate the remainder when n is divided by 7. 4 Le	{ "pile_set_name": "DM Mathematics" }
(i) = -2i. Let u be r(-4). Suppose u = 2p - 4t, -t - 3t = p - 4. Let k(n) = -3n - 6. Determine pc(q) + 11k(q). -q + 2 Let p(i) be the second derivative of i3/3 + 2i*2 - 2i. Let m(r) = 8r + 17. Determine 2m(o) - 9p(o). -2o - 2 Let v(p) = 8p2 - 5p. Let d(w) be the second derivative of -5w4/4 + 3w*3/2 + 7w. What is -5d(l) - 9v(l)? 3l2 Let h(t) = 330t - 121. Let a(r) = -11r + 4. What is -121a(l) - 4h(l)? 11l Let j(l) = 11l3 - 3. Let d(q) = 100q*3 - 28. Give 3d(w) - 28j(w). -8w*3 Let l(r) = -r - 1. Let h(j) = 2j*2 + 3j + 8. Let v(p) = h(p) + 3l(p). Let u(k) = -k2 - 1. Calculate -4u(m) - v(m). 2m2 - 1 Let m(i) = 4i*2 - 25i. Let h(f) = -3f2 + 24f. Give 5h(p) + 4m(p). p*2 + 20p Let c(d) = -3d2 - d + 4. Let p(m) = -2m*2 - m + 5. Determine -6c(r) + 5p(r). 8r*2 + r + 1 Let s = 2 - 1. Let k(g) = 1 - 3g*2 + g + 3g*2 - 5g*2 + 4g2. Let o(r) = -r2 - 3r - 2. Give sk(w) + o(w). -2w2 - 2w - 1 Let g(s) be the third derivative of s*4/6 + 2s*3/3 + 2s*2. Let n(v) = 13v + 13. Let z be (-1)/((-2)/6) - 5. Let q = z + 9. What is qg(k) - 2n(k)? 2k + 2 Let f(w) = w + 5w + w - 6w. Let m(z) = 5z + 1. Give 9f(q) - 2m(q). -q - 2 Let d(o) be the third derivative of o*5/15 - 13o*4/24 + 2o*3/3 - 28o*2. Let i(h) = 2h*2 - 7h + 2. What is -4d(b) + 7i(b)? -2b2 + 3b - 2 Let q(r) be the second derivative of r3/6 + r2/2 + 3r. Suppose v - 6 = -v. Let c(y) = v + 3y + 2 - 1. Give -c(t) + 2q(t). -t - 2 Let x(j) = -1. Let l(c) = c2 - 2c - 5. Let n = -91 - -161. Suppose -m - m + n = 0. Suppose -5 = w, v - m = -4v + 4w. What is vx(u) - l(u)? -u2 + 2u + 2 Let f(c) = -4c3 + 5c*2 + 5c + 3. Suppose -3s + 9s = -30. Let l(n) = -5n3 + 6n*2 + 6n + 3. Give sl(k) + 6f(k). k*3 + 3 Let n(b) = -6b*2 - 2b - 2. Let d(z) = -13z2 - 5z - 4. Determine -4d(a) + 9n(a). -2a2 + 2a - 2 Let m(h) = 8h2 + h + 3. Let d(t) = -5t*2 - t - 2. Determine -7d(j) - 5m(j). -5j*2 + 2j - 1 Let k(u) = 864u3 - 80u*2 - 80. Let n(a) = 32a*3 - 3a*2 - 3. Determine -3k(j) + 80n(j). -32j*3 Let m(a) = -4a. Let q(x) = 4x - 1. Let s(j) = 2m(j) + 3q(j). Let v be (0 + -3)/((-3)/2). Let t(i) = 3i - 2. Determine vs(o) - 3t(o). -o Let g(h) = -3h + 7. Let f(o) = 7o - 13. Determine 4f(t) + 7g(t). 7t - 3 Let u(g) = g3 + 155g - 1 + 158g - 314g. Let r(v) = 3v3 - v + 1. Calculate r(k) - u(k). 2k*3 + 2 Let f(x) = -3x*3 + 2x*2 + 4. Let q be (-5)/(-10) + 2/(-4)5. Let g(a) = -a3 + a2 + 2. Give qf(j) + 5g(j). j3 + j2 + 2 Let n(g) = 3g3 + 3g*2 - 5g - 4. Let v(o) = 2o3 + 2o*2 - 3o - 2. Suppose t - 11 = -3r, -t - 4 = 2r - 6t. Give rn(z) - 5v(z). -z3 - z2 - 2 Let o(k) = -9k*3 + 2k + 3. Let u(a) = -8a3 + 3a2 + a + 2. Let v(s) = s3 - s*2. Let x(f) = -u(f) - 3v(f). What is 3o(t) + 5x(t)? -2t3 + t - 1 Let o(g) = -1. Let t(q) = 4 + 1 - 2q - 5. Let l = -6 + 4. Calculate lo(m) + t(m). -2m + 2 Let o(z) = 12z2 - 10z + 8. Let c(u) = -u*2 - 9u - 10. Let d be c(-7). Suppose d + 1 = 5y. Let k(b) = -b2 + b - 1. Calculate yo(a) + 10k(a). 2a2 - 2 Let u(h) = h - 1. Let q(r) be the third derivative of -r4/4 + r*3/6 + 12r*2. Give -q(g) - u(g). 5g Let k(l) = 5l2 - 4l + 13. Let u(m) = 16m + 15m + 11m - 43m + 3 + m*2. Determine 2k(c) - 9u(c). c2 + c - 1 Let c(t) = -4t*3 + 6t*2 - 6t. Suppose 0 = -5v + 3v + 10. Suppose 0 = -0l + l + 6. Let x(q) = -3q*3 + 5q*2 - 5q. Calculate lx(d) + vc(d). -2d3 Let d(b) = b3 - b + 4. Let h(i) = -4i*3 + 5i - 17. Calculate -9d(s) - 2h(s). -s*3 - s - 2 Let j(q) = 54q*2 - 1 - q - 29q*2 - 24q2. Let n(i) be the first derivative of -i4/4 + 3i3 - 9i*2/2 - 9i - 1. Give -18j(m) + 2n(m). -2m3 Let y(n) = -n2 - n + 2. Let l(z) = 1 + 6z*2 - 7z*2 - 1. Let x(h) = -2h*2 + h - 1. Let r(v) = 3l(v) - x(v). Calculate -5r(j) + 3y(j). 2j2 + 2j + 1 Let y(p) = 5p3 - 2. Let x(j) = -81j*3 + 33. Suppose 3k - 6 = -3q, 18 = k - 0q + 5q. Determine kx(f) - 33y(f). -3f*3 Let k(x) = -7x*2 - 17x + 11. Let y(i) = 6i2 + 18i - 10. Let t(a) = -5k(a) - 4y(a). Let f(q) = 5q2 + 6q - 7. Calculate 13f(w) - 6t(w). -w*2 - 1 Let l(b) = -6b*3 + 17b. Let s be 2 + 32 - 0/1. Let d(i) be the second derivative of -i5/20 + i3/2 - i. Suppose -3p + 2p = 6. Give pl(k) + sd(k). 2k3 Let x(w) = 32w + 3. Let l(r) = -11r - 1. Calculate 8l(j) + 3x(j). 8j + 1 Let p(d) be the third derivative of -d*5/60 - 5d4/24 + d3/3 - 21d2. Let u(n) = n2 + 6n - 2. Calculate 5p(i) + 4u(i). -i*2 - i + 2 Let a(x) = -11x*2 - 9x - 2. Suppose -3i - 5k + 49 = 12, -3i + 3k + 21 = 0. Let d(b) = -5b2 - 4b - 1. What is id(s) - 4a(s)? -s*2 - 1 Let l(a) = -2a*3 + 7a*2 - 2a - 4. Let x(d) = -20d + 0d*3 + 4d*2 + 19d - 2 - d*3 + 0. Determine 4l(z) - 7x(z). -z3 - z - 2 Let z(p) = p - 1. Let s(u) = -2u + 4. Give s(c) + 5z(c). 3c - 1 Let p(a) = 1 - 1 - 2a - 3. Let b(h) = -5 + 2 + 3 + 1. Give 3b(s) + p(s). -2s Let n(w) = 4w - 6. Let l be -1 + -92/(-3). Let s(a) = 8a - 10. Let g(k) = 7k - 9. Let c(x) = -5g(x) + 4s(x). What is ln(d) + 6c(d)? 2d Let k(t) = 2t2 + 4t - 1. Let u(j) = j*2 + j. Let y = 21 - 24. Let q be y/1832. Determine qk(p) + 4u(p). 2p*2 + 1 Let u(j) = -3j - 4. Let f(a) = -4a + 11a + 5 + 4. Calculate -2f(d) - 5u(d). d + 2 Let y(h) = 4h2 + 7h + 7. Let b(x) = -x*2 - 2x - 2. Let q = -9 - -13. Suppose -16 = -qs - 4d, 3s - 3d = 29 + 1. What is sb(w) + 2y(w)? w*2 Let v(m) = 3m - 1. Let k(d) = 0d + 4d - d - 2d. Calculate 9k(q) - 2v(q). 3q + 2 Let c(g) = g2 + g - 1. Let r(u) = u3 + 2u2 + 2u + 7. Let t(x) = x*2 + x + 1. Let a(n) = r(n) - 5t(n). Let w = -16 + 10. Calculate wc(q) - 2a(q). -2q3 + 2 Let u(c) = 2c*2 - 4c - 6. Let p(y) = -y - 1. Suppose 0 = -l - 2l - 3. Give lu(k) + 6p(k). -2k*2 - 2k Let o(l) = -11l - 2. Let i(j) = 5j + 1. Give 7i(n) + 3o(n). 2n + 1 Let t(x) = 6x*2 - 3x + 5. Let z(d) = 7d2 - 4d + 6. Give -4t(o) + 3z(o). -3o2 - 2 Let s(g) = 7g*3 + 7g*2 - 1. Let h(n) = -252n*2 + 263n*2 + 0n*3 - 2 + 11n*3. Calculate 5h(q) - 8s(q). -q3 - q2 - 2 Let b(w) = 1. Let d(a) be the third derivative of 2a*3/3 - 2a*2. Let k(o) = -7b(o) + 2d(o). Let j(x) = x2 + 6. Give -j(f) + 6k(f). -f*2 Let x(f) = -3f*2 - 4f. Let p(b) = -2b2 - 8b*2 + 2b*2 - 11b. What is 4p(v) - 11x(v)? v*2 Let s(y) = -19y - 8y - 5 + 5y - 5. Let g(j) = 7j + 3. Determine 16g(a) + 5s(a). 2a - 2 Let h(k) = -5k3 - 6k*2 - 4k - 6. Let w(g) = 4g3 + 5g*2 + 3g + 5. Suppose 12 = -4u + 2r, -3u - u + 4r - 4 = 0. What is uh(i) - 6w(i)? i*3 + 2i Let p(b) = -2b2 + b. Let u(j) = j2 - j. Let c(a) = -a3 + 8a*2 + a - 11. Let m be c(8). Calculate mu(h) - p(h). -h*2 + 2h Let g(o) = -2o. Let f(l) be the second derivative of l3 + 14l. Give -4f(h) - 11g(h). -2h Let w(l) = -4l + 4. Let n(f) = -9f + 7. Give -2n(q) + 5w(q). -2q + 6 Let n(q) = 9q2. Let v(h) = h2. What is 3n(y) - 24v(y)? 3y*2 Suppose s = 59 - 58. Let g(r) = -1. Let d(l) = 0l - l + 0 + 2. Determine sd(c) + 2g(c). -c Let a(m) = 2m3 - 9m*2 + m - 1. Let l(k) = -4k*3 + 19k*2 - 3k + 2. Determine -13a(b) - 6l(b). -2b3 + 3b*2 + 5b + 1 Let c(r) = -6r3 - 6r*2 - 10r. Suppose -2o - o = 9. Let v(t) = 2t*3 + 2t*2 + 3t. Let q = 80 + -90. Give oc(l) + qv(l). -2l3 - 2l*2 Suppose 8i = -9 - 7. Let l(t) = -t*2 + 3t - 3. Let f(u) = -u*2 + 2u - 2. Give il(n) + 3f(n). -n*2 Let g(d) = -184d + 1. Let t(i) = 61i. Give -2g(x) - 7t(x). -59x - 2 Let h(v) = v*3 - 5v2. Let a be 50/(-4) - 6/(-4). Let c(w) = w2 - 2w3 + 4w*2 + 4w*2. What is ah(k) - 6c(k)? k3 + k2 Let f(u) = u2 + u. Let l(a) = -2a*3 + 5a*2 + 5a - 15. Calculate -5f(m) + l(m). -2m*3 - 15 Let z(l) = 21l*2 + 8l + 6. Let n(f) = 14f2 + 5f + 4. Determine 8n(a) - 5z(a). 7a2 + 2 Let d(q) = -10q - 12. Let c(o) = -4o - 5. Let f(u) = 6u - 22. Let l(r) = -2r + 7. Let x(g) = 4f(g) + 11l(g). Let y be x(8). Determine yd(m) - 12c(m). -2m Let z(i) = -36i - 21. Let n(f) = 7f + 4. Dete	{ "pile_set_name": "DM Mathematics" }
es after 7:16 PM? 8:59 PM What is 315 minutes after 4:28 AM? 9:43 AM How many minutes are there between 10:16 PM and 7:36 AM? 560 How many minutes are there between 5:03 PM and 4:10 AM? 667 How many minutes are there between 5:36 AM and 2:54 PM? 558 How many minutes are there between 1:02 AM and 3:41 AM? 159 How many minutes are there between 9:06 AM and 5:31 PM? 505 How many minutes are there between 7:11 AM and 4:18 PM? 547 How many minutes are there between 2:09 PM and 9:52 PM? 463 What is 517 minutes before 3:40 PM? 7:03 AM How many minutes are there between 4:54 AM and 6:32 AM? 98 What is 420 minutes before 3:03 AM? 8:03 PM What is 69 minutes before 7:21 AM? 6:12 AM How many minutes are there between 6:43 PM and 7:50 PM? 67 How many minutes are there between 5:32 PM and 2:41 AM? 549 What is 153 minutes after 9:41 AM? 12:14 PM How many minutes are there between 6:20 PM and 1:24 AM? 424 What is 641 minutes after 5:14 AM? 3:55 PM What is 82 minutes after 10:26 PM? 11:48 PM How many minutes are there between 9:07 AM and 8:04 PM? 657 How many minutes are there between 5:05 AM and 8:16 AM? 191 How many minutes are there between 11:08 AM and 10:27 PM? 679 How many minutes are there between 6:28 PM and 6:12 AM? 704 What is 286 minutes after 4:37 PM? 9:23 PM What is 186 minutes after 9:52 AM? 12:58 PM How many minutes are there between 7:34 PM and 11:25 PM? 231 What is 50 minutes before 7:57 PM? 7:07 PM What is 104 minutes before 1:17 AM? 11:33 PM What is 616 minutes before 1:39 PM? 3:23 AM How many minutes are there between 5:21 PM and 3:02 AM? 581 What is 33 minutes before 6:30 AM? 5:57 AM What is 293 minutes before 3:55 PM? 11:02 AM What is 366 minutes after 10:06 AM? 4:12 PM How many minutes are there between 6:52 PM and 7:54 PM? 62 How many minutes are there between 9:54 PM and 4:44 AM? 410 What is 120 minutes before 5:15 PM? 3:15 PM How many minutes are there between 12:40 PM and 12:52 PM? 12 How many minutes are there between 6:37 PM and 4:07 AM? 570 What is 141 minutes before 8:28 PM? 6:07 PM What is 641 minutes before 9:24 PM? 10:43 AM What is 493 minutes after 9:03 AM? 5:16 PM What is 295 minutes before 8:33 PM? 3:38 PM What is 400 minutes after 5:30 PM? 12:10 AM How many minutes are there between 9:15 PM and 12:02 AM? 167 What is 127 minutes after 5:24 AM? 7:31 AM What is 279 minutes before 5:57 PM? 1:18 PM What is 581 minutes after 10:51 PM? 8:32 AM What is 249 minutes before 3:14 AM? 11:05 PM How many minutes are there between 7:14 AM and 7:34 AM? 20 What is 463 minutes before 3:27 PM? 7:44 AM What is 549 minutes before 2:55 AM? 5:46 PM What is 468 minutes after 11:20 AM? 7:08 PM What is 570 minutes after 2:46 PM? 12:16 AM What is 120 minutes before 5:13 AM? 3:13 AM What is 416 minutes after 10:57 PM? 5:53 AM How many minutes are there between 6:04 PM and 8:38 PM? 154 What is 439 minutes after 3:59 AM? 11:18 AM What is 661 minutes before 4:03 PM? 5:02 AM How many minutes are there between 9:10 PM and 2:12 AM? 302 How many minutes are there between 5:18 AM and 10:35 AM? 317 What is 687 minutes before 5:23 AM? 5:56 PM What is 625 minutes before 4:26 PM? 6:01 AM What is 130 minutes after 2:04 AM? 4:14 AM How many minutes are there between 2:30 PM and 10:23 PM? 473 How many minutes are there between 2:54 PM and 10:22 PM? 448 What is 416 minutes after 11:51 AM? 6:47 PM What is 374 minutes before 12:36 PM? 6:22 AM How many minutes are there between 8:18 AM and 3:27 PM? 429 How many minutes are there between 3:25 PM and 1:06 AM? 581 How many minutes are there between 1:13 PM and 10:41 PM? 568 What is 652 minutes after 2:15 AM? 1:07 PM How many minutes are there between 11:24 AM and 6:57 PM? 453 How many minutes are there between 12:36 AM and 5:27 AM? 291 What is 609 minutes after 3:38 AM? 1:47 PM How many minutes are there between 3:38 AM and 4:31 AM? 53 What is 414 minutes after 4:45 AM? 11:39 AM What is 446 minutes before 4:21 PM? 8:55 AM How many minutes are there between 4:54 PM and 7:45 PM? 171 How many minutes are there between 1:18 PM and 3:05 PM? 107 How many minutes are there between 7:00 PM and 10:06 PM? 186 How many minutes are there between 5:59 PM and 5:42 AM? 703 How many minutes are there between 9:15 PM and 9:21 PM? 6 How many minutes are there between 9:58 AM and 4:39 PM? 401 What is 56 minutes before 4:19 AM? 3:23 AM What is 331 minutes after 3:11 AM? 8:42 AM How many minutes are there between 1:44 AM and 5:08 AM? 204 How many minutes are there between 3:18 PM and 8:14 PM? 296 How many minutes are there between 5:45 AM and 9:58 AM? 253 How many minutes are there between 1:33 PM and 12:20 AM? 647 How many minutes are there between 2:29 AM and 2:12 PM? 703 What is 185 minutes before 10:40 AM? 7:35 AM How many minutes are there between 2:35 PM and 5:31 PM? 176 What is 67 minutes before 2:18 PM? 1:11 PM How many minutes are there between 4:17 AM and 9:03 AM? 286 How many minutes are there between 12:56 AM and 3:36 AM? 160 How many minutes are there between 8:48 PM and 11:39 PM? 171 What is 107 minutes before 2:36 PM? 12:49 PM What is 237 minutes after 5:44 AM? 9:41 AM What is 585 minutes before 6:32 PM? 8:47 AM How many minutes are there between 12:27 AM and 2:37 AM? 130 What is 493 minutes after 3:16 PM? 11:29 PM What is 274 minutes after 5:25 PM? 9:59 PM What is 292 minutes after 7:15 PM? 12:07 AM What is 321 minutes before 1:31 PM? 8:10 AM What is 302 minutes before 3:43 AM? 10:41 PM What is 481 minutes after 4:45 AM? 12:46 PM What is 592 minutes before 3:25 AM? 5:33 PM What is 493 minutes before 12:39 PM? 4:26 AM How many minutes are there between 2:44 AM and 8:12 AM? 328 What is 172 minutes before 12:37 PM? 9:45 AM How many minutes are there between 9:37 PM and 12:22 AM? 165 How many minutes are there between 5:36 AM and 7:53 AM? 137 What is 89 minutes before 4:24 AM? 2:55 AM How many minutes are there between 3:34 AM and 3:45 AM? 11 How many minutes are there between 11:41 PM and 11:28 AM? 707 How many minutes are there between 12:33 AM and 9:40 AM? 547 What is 40 minutes before 1:29 AM? 12:49 AM What is 669 minutes after 2:26 AM? 1:35 PM What is 323 minutes after 6:46 AM? 12:09 PM How many minutes are there between 3:15 AM and 6:21 AM? 186 What is 588 minutes after 9:47 PM? 7:35 AM How many minutes are there between 2:47 PM and 12:38 AM? 591 What is 589 minutes before 8:32 PM? 10:43 AM What is 126 minutes before 11:01 AM? 8:55 AM How many minutes are there between 11:44 PM and 1:00 AM? 76 What is 592 minutes before 8:13 PM? 10:21 AM What is 48 minutes before 3:28 AM? 2:40 AM What is 664 minutes after 4:31 PM? 3:35 AM What is 39 minutes after 4:39 PM? 5:18 PM What is 345 minutes after 7:28 PM? 1:13 AM How many minutes are there between 1:17 AM and 7:43 AM? 386 What is 156 minutes after 5:52 AM? 8:28 AM How many minutes are there between 6:15 AM and 7:43 AM? 88 How many minutes are there between 3:04 PM and 1:40 AM? 636 How many minutes are there between 10:03 AM and 11:05 AM? 62 How many minutes are there between 6:56 AM and 11:39 AM? 283 What is 660 minutes after 10:34 AM? 9:34 PM What is 38 minutes before 11:56 AM? 11:18 AM How many minutes are there between 7:12 PM and 5:01 AM? 589 How many minutes are there between 5:51 PM and 6:58 PM? 67 How many minutes are there between 6:46 PM and 8:37 PM? 111 What is 373 minutes after 4:08 AM? 10:21 AM What is 291 minutes before 10:45 PM? 5:54 PM How many minutes are there between 6:56 AM and 1:37 PM? 401 How many minutes are there between 11:54 AM and 4:04 PM? 250 How many minutes are there between 1:21 PM and 10:38 PM? 557 What is 6 minutes before 5:27 PM? 5:21 PM What is 557 minutes after 7:31 AM? 4:48 PM What is 39 minutes after 7:31 PM? 8:10 PM How many minutes are there between 3:29 PM and 6:04 PM? 155 What is 264 minutes after 6:03 AM? 10:27 AM How many minutes are there between 5:20 AM and 3:25 PM? 605 How many minutes are there between 11:34 AM and 7:47 PM? 493 How many minutes are there between 3:51 PM and 9:33 PM? 342 How many minutes are there between 10:41 AM and 4:36 PM? 355 What is 585 minutes before 9:41 PM? 11:56 AM How many minutes are there between 10:58 AM and 5:59 PM? 421 How many minutes are there between 3:16 AM and 3:36 AM? 20 What is 559 minutes afte	{ "pile_set_name": "DM Mathematics" }
77j + 1745j. -663j4 - j Expand 4l + l - 3l + (2 - 7 + 3)(2l + l - 6l - l + 4l - l + (-l - l + 0l)(-3 + 0 + 1) + 5l - 2l - 2l + (0 - 1 + 0)(l - 3l + l) - l - 2l + 0l). -2l Expand (-26h + 234 - 234)(1 + 5 - 1). -130h Expand -n + 2n2 + 0n*2 + 2n*3 + 2n + 2093 - 2093 + 75n3 + (2 - 2 - 1)(n3 - n3 - 2n3). 79n*3 + 2n*2 + n Expand (4a*5 + 6a*4 - 6a*4)(66 + 75 - 53). 352a5 Expand 697 - 3c + 707 - 1374 + (0 - 1 + 2)(0c + c - 2c). -4c + 30 Expand (2d + 0d - 3d)(-2d - d + 4d) + (d - 2d + 2d)(-19d + 75d + 16d). 71d2 Expand (-q3 + 2q3 + q3)(0q + 3q - 2q) + 30 + 6q4 - 20 - 2q*4. 6q*4 + 10 Expand (1 + 2 - 1)(-2c2 + 0 + 0) - 3c*2 - 5c*2 + 5c*2 + 6196c - 72c2 - 6196c. -79c2 Expand (444 + 102d*3 - 444)(0d + 5d*2 + 0d). 510d5 Expand 342x*5 + 79x*5 - 66x5 + x5 + 0x5 + x5 + (2x*2 - 2x*4 - 2x*2)(2x + 0 + 0) + x5 + 3x*5 - 3x*5. 354x*5 Expand (9 - 9 - 4b*2)(-b + 2b + 2b) + 0b3 - b3 + 3b*3. -10b*3 Expand (-2r*4 + 4r4 - r4)(-3r + 2r + 2r) + r*5 - 5r*5 + 2r*5 + 2r5 - r3 + r*3 - 4r + 3r5 + 4r - 7r3 - 12r*3 - 7r*5 + 13r*3. -3r*5 - 6r*3 Expand (-k - 3k - 3k)(20k - 20k - 15k3 + (-k - k + k)(1 - 1 - 2k2) + 6k*3 - 3k*3 + 0k*3). 70k*4 Expand (-841 + 1702 - 1499)(0 - 2 + 3 - 3j)(4j + 0j - 3j). 1914j*2 - 638j Expand (17 + 7 + 5)(0n*5 + 4n*5 + 0n*5). 116n*5 Expand (-2a*3 - 3a*3 + 6a*3)(84 + 226 - 119) + (4a - a - 2a)(2a*2 + 1 - 1). 193a*3 Expand (2m + 2m - 3m)(0 - m2 + 0) + m3 - 2m*3 + 10m*3 + (6m - 2m - 3m)(-2m + 2m - m2) - m2 + m2 + 2m*3. 9m*3 Expand (-1782 + 1154 + 924)(1 - 1 + c)(c + 2c - 2c). 296c*2 Expand (-45 - 12 - 3a + 100)(2a + 2a - 2a). -6a2 + 86a Expand (73m - 189m + 2m)(3m - 4m + 2m). -114m*2 Expand (-8v*2 + 32v*2 + 6v*2)(4v2 - 2v*2 + 0v*3 - 5v*3). -150v*5 + 60v*4 Expand (-31b - 12 + 12)(-b + 0b + 2b). -31b*2 Expand -3g*3 + 4g*3 + 0g3 + (-g2 - 3 + 3)(g - 5g + 2g) + 11g*3 - 13g*3 + 14g*3 + (-3 + 3 + g)(-3 - g*2 + 3). 14g*3 Expand (3 + 1 - 2)((-v*4 - 5v*2 + 5v*2)(-1 + 3 - 1) - 2v4 + 6v*4 + 13v*4) + 3v4 + 3 - 2 + v4. 36v4 + 1 Expand (-7 + 5 + 5)(-10x + 59x + 8x). 171x Expand (3346m - 3346m - 218m3)(1 - 1 + m + (4 - 3 + 1)(0m + 4m - 2m)) + 0 + 0 + 2m4. -1088m*4 Expand (3 - 4 - 2)(-13g3 - 38 + 38)(-2g + 6 - 6). -78g*4 Expand (2y + y + 0y)(-212 + 37 - 37). -636y Expand (2 - 2 - 2d)(0 + 0 + 2)(2 - 3 + 2)(1 + 11 + 7). -76d Expand (2a4 + 8a*5 - 2a*4)(0 + 2 - 3)(0 + 1 + 2). -24a*5 Expand -22 + 3m*2 - 11 + 30 + 8m*4 + (1 - 1 + 2m*3)(-1 - 2m + 1) + 2 - 2 + m4 - m4 + 0m + 0m + 5 + m4 - 5 - 2m + 2m + 2m*4. 7m*4 + 3m*2 - 3 Expand (3 + 8 - 3k - 12)(-9k + 3k + 5k). 3k2 + k Expand (-3c*2 + 3c2 - c2)(-1 - 1 + 4)(-30c2 + 98c*3 + 30c*2). -196c5 Expand (1 + f2 - 1)(-20 + 20 + 29f). 29f3 Expand (6609m - 6609m - 319m3 - m2)(6 - 4 - 4). 638m*3 + 2m*2 Expand (2j*2 - 2j*2 - 2j*2)(0j2 - 2j2 + j2)(999 - 1993 + 89j + 1001). 178j5 + 14j*4 Expand (-24 - 55 - 67)(-2 + 0 - 1)(2c - 2 + 2). 876c Expand (23f + 899 - 899)(-4f*2 + 4f*2 + 2f*2) - 6f*3 + 2f3 - f3 + f*3 + 6f*3 - 2f*3. 46f*3 Expand (20u - 17 + 17)((1 - 1 + 1)(-2u - u + 2u) - 3u - 2u + 4u + (-u - 3u + 2u)(3 - 2 + 2)). -160u2 Expand -o5 + 5o*5 - 2o5 + 2 + o5 - 2 + (-2o4 + 4o*4 - 4o*4)(-2o + 3 - 3) - 3o*5 + 0o5 + o5 - 711o2 + 711o2 - o5. 4o5 Expand (1 + 8 - 3)(-3 - 2 - 1)(s - 3s + 4s + 7s - 2s - s + (5 - 2 - 1)(2 - 2s - 2) + s + 0s + 0s - 3s + s + 4s). -180s Expand (-4 + 4 + 2h2 - h2 - 3 + 3 + (2h + 0h - 4h)(0h - 6h + 3h) - 5h2 + 5h*2 + 2h*2)(5h3 + 5h*3 - 12h*3). -18h*5 Expand (93y*2 - 68y*3 - 93y*2)(4 - 4 - 4) + (4y2 - y2 - 5y*2)(0y + 4y - 3y). 270y*3 Expand (f + 0f + f - 2f + 0 + 0 + (0 + 3 - 1)(4f - 2f - f) - f - 2f + 5f - 2f - 2f + 6f + 2f - 2f - 2f + 0f - f + 2f)(-95 + 85 + 90). 400f Expand (9n - n + 3n)(1 - 3 + 7)(n*4 + 0n4 + n4). 110n5 Expand 2h + 0h - 4h + (-3 + 0 + 1)(-h - 2h + h) - 2h - 3 + 3 + h - 3h + h + (0 + 0 - 5)(20h - 9h - 21h). 49h Expand -13j - 13j + 7j + (-3j + 0j + 2j + (-5j + j + 2j)(4 - 1 + 1) - 2j + 1 - 1)(1 - 3 + 0). 3j Expand (-20o - 5o + 0o)(6o - 3o - 2o)(o + 2o + 0o). -75o*3 Expand (30 - 30 + 39m)(1 + 0 - 2 + (0 - 1 - 1)(2 - 5 + 1)). 117m Expand (-4x + 2x + 3x)(4x - x - 4x) + (2x + 4x - 4x)(812x - 649x - 441x). -557x2 Expand (51n + 49n - 29n)(n - 4n - 2n). -355n*2 Expand 2 - 2q*2 - 2 + (6q - 3q - q)(2q - 5 + 5) + 6q*2 + 6q*2 - 6q*2 - 3 + 0 + 1 - 10q*2. -2q*2 - 2 Expand (s - s - 5s*4)(-2 + 7 + 0 + 1 - 3 + 0 + (5 - 4 + 1)(-5 + 4 + 2) + 2 - 2 - 1 + 3 - 7 - 2). 10s*4 Expand (30 - 30 - 5r*2)((0r3 + r3 + r3)(3 - 2 - 3) + (-1 + 1 + r*2)(6r - r - 3r) + r - r - 5r3). 35r5 Expand (a4 + 2a3 - 2a*3)(-106 - 260 - 201 - 42). -609a4 Expand (-56x + 24x + 23x)(-5 + 2 + 2)(x*2 + 0 + 2 + 5). 9x*3 + 63x Expand (0 - 3 + 1 + (-4 + 2 + 1)(-4 + 0 + 0) - 1 + 5 - 3 + 2 + 3 - 3)(-3 + 3 + 3q2). 15q*2 Expand (3c + 2c - 7c + (c - c - 2c)(-4 + 5 + 1))(3c + 3 - 3) + (2 - 2 - 2c)(0c + c + 0c) + 3c2 - c2 - 3c*2. -21c2 Expand (1 - 1 - d4)(0 - 2 + 5) - 4d*4 - 7d4 + d4 - 4d4. -17d4 Expand (p - p - p2)(2 - 6 + 2) + (1 + 4 - 3)(-25p + p2 + 29 + p2 - 28). 6p*2 - 50p + 2 Expand (5 + 2 + 1)(1 - 3 - 1)(1 + 2 - 1)(3p*2 + 4p*2 - 6p*2). -48p*2 Expand (34 - 15c - 34)(3c - c - c) - 5c2 + 0c*2 + 3c*2. -17c*2 Expand (3s*2 + 1 - 1)(13s + 3s - 2s)(15s2 - 4s*2 - 3s*2). 336s*5 Expand ((0 + 0 + n)(1 + 3 - 3) - 7n - 296 + 353 + 17n)(-2n2 + n4 + 2n2). 11n*5 + 57n4 Expand (x2 + 4x2 - 4x*2)(0 + 0 + 7x)(0 - 3 + 5 - 3 - 1 + 3 - 1 + 2 + 0 + 2 + 0 - 4 + (0 + 0 + 1)(-2 + 1 - 1) - 1 + 3 - 1 + 2 - 1 - 5). -35x*3 Expand (-5o - 2o2 + 5o)(o3 + 8o*3 - 6o3 + (-o2 - o*2 + 3o*2)(0 + o + 0) - 7 + o*3 + 7). -10o*5 Expand 18779l + 796l3 - 18779l + (2l2 + 0 + 0)(-1 + 1 + 2l). 800l*3 Expand (-84b*2 + 60b*2 - 74b*2)(18 - 18 + 2b). -196b*3 Expand (-2 + 1 + 2)(1 + 1 + 0)(3k - k - 4k)(-3 - 1 - 2) - 2k - 42 + 42. 22k Expand 0v4 + 2v4 - v4 - 2v4 + 8v*4 - 2v*4 + (3v + 5v2 - 3v)(v2 - v2 + v2). 10v*4 Expand (8 - 2 + 1)(-4t + t + 2t)(457t - 48t2 - 459t - 7t2)(-3t2 + t2 + 3t*2). 385t*5 + 14t*4 Expand (3 + 1 - 6)((-5 + 0 - 2)(2k*2 + 4 - 4) - 6k*2 + 2k - 3k + 7k*2). 26k*2 + 2k Expand 2p3 - 3 + 3 + 9p - 9p - 2p*3 + 80p*3 - 27p*3 - 36p*3 + (-2p - 3 + 3)(-3p2 - p2 + 2p2). 21p*3 Expand (116 + 29 - 37)(3 + 2d - 3)(0 + 0 + 3). 648d Expand ((1 + 1 - 1)(m + 2 - 2) + 3m - 1 + 1)(231m3 + 101m*3 - 154m*3). 712m4 Expand (w3 - w3 - w3)(-2w2 - w2 + 5w2) + 195 + 33w*5 + 210 - 407. 31w*5 - 2 Expand (1 + 4b - 1)((-3 + 0 + 7)(-b - b - b) + 0 - 2b + 0). -56b*2 Expand 287q2 - q3 - 43q4 - 287q*2 + (-3q*3 + 5q*3 - 4q*3)(2q - 5q + 2q). -41q4 - q3 Expand (4t - 3 + 3)(-4 + 4 - 3)(-9 + 8t + 9). -96t2 Expand (1 - 1 - 1)(-20 + 3 + 4)(f - 2f - f + (3 - 3 + 2f)(-1 - 1 + 5)). 52f Expand (c2 + 0c + 0c + (4c - 6c + 3c)(-3c + 0c + c) + 0c - c*2 + 0c + c*2 + 1 - 1 + 9c*2 - 67c*2 - 25c*2)(1 - 1 + 2c2). -168c*4 Expand (-2 + 4 - 1)(-2w3 - 4w*3 + 4w*3) + (-18 + 18 - 28w)((w + w - 3w)(7w - 2w - 3w) - 3 - w*2 + 3). 82w*3 Expand (0 + 2 - 1)((-3i3 - 3 + 3)(4 - 6i - 4) + 2i4 + i4 - 4i4). 17i*4 Expand (71j*3 + 5j*3 - 7j*3)(4 - 3 + 1) - 5j3 - 3j*3 + 4j*3. 134j*3 Expand -12 + 27 + 4o - 29 - o + 2o + 0o + 4o + o - 3o + (-3 + 0 + 1)(-4 - 2o + 4) + o + 5 - 5. 12o - 14 Expand (3 + 2 - 3)(-6b + 6b + b*3 + 0b - 2b3 + 0b + 3	{ "pile_set_name": "DM Mathematics" }
the value of 3195/7455(-16)/3? -16/7 ((-8)/36)/((770/(-504))/55) 8 723/(966/(-18)) -3 What is ((-51)/(-340))/(36/40-2)? -1/12 What is (-1)/(36/216)-5? 30 Evaluate 2/(8/18-6)-16. 12 Evaluate ((-4)/(-110))/(((-408)/170)/2). -1/33 What is the value of 15/10((-213)/142)/(6/16)? -6 What is (-54)/180-125/3? 6 Evaluate ((-128)/(-1872))/(7/((-189)/(-6))). 4/13 What is the value of ((-8705)/10446)/((-70)/6)? 1/14 15((-190)/(-228))/(15-1) -5/6 What is the value of -46(-5)/30(-282)/94? -23 (-2)/(40/(-195))(-12)/9 -13 What is ((-392)/(-68110))/((-8)/(-20))? 2/139 2/(-5)(-50)/350-455 -26 ((-50)/20-1)/55-1 -1/22 ((-117)/((-169)/(-13)))/(2/(-2)) 9 What is the value of ((-1)/(5/5))/((-29)/(-551))? -19 Calculate (-6)/((-72)/(-30))(-2)/(-1). -5 Evaluate -51/(-11)3270/8175. 2/11 What is the value of (2/(-135))/((-468)/(-1170))? -1/27 Evaluate (3794/(-1355))/(21/(-15)). 21 2(-2)/2418/12-3 3/4 Evaluate (-1)/1(-8)/(-2)759/276. -11 6/(45/((-4050)/(-36))) 15 Calculate (-9)/828/436826. -3/16 Calculate 22/60(-674)/(-3707). 1/15 What is the value of (-28)/(-2)((-18849)/122)/(-103)? 21 Calculate (((-42)/15)/2)/(-5(-12)/(-300)). 7 16/(-88)176/24 -4/3 What is ((-12636)/(-104))/81(-3)/((-6)/(-4))? -3 Evaluate (((-81)/(-30))/9)/((-26)/(5824/84)). -4/5 What is the value of (18/(-2))/((-53)/((-1484)/42))? -6 What is 6/(-5)1/(54/(-10))? 2/9 Calculate 1/((-11)/(-66))-88/(-24). 16 Calculate (-48)/(-72)6/(-10)-5. 2 Calculate ((-78)/(-9))/(6/(-8)(-304)/(-342)). -13 Evaluate (5/3)/((224/(-240))/(-14)). 25 Evaluate -8(-2)/8(-192)/(-32). 12 What is ((-308)/70)/(164/410)? -11 220/1608-1 -11 What is the value of (3012/2259)/(((-624)/(-9))/2)? 1/26 Calculate (19/171)/((-1)/63). -7 ((-340)/(-595))/((-2)/(-14)) 4 ((-15)/12)/(1635/40548) -31 What is (-11)/((-429)/72)39/6? 12 What is the value of -56/6(99/(-9))/(-11)? -5 Evaluate ((-273)/52)/((-9)/(-24)-1). 14 What is (((-200)/24)/(-5))/(-5(-6)/(-450))? -25 Calculate 0/6(-4)/(-4)2/6. 0 Calculate ((3/(-15))/(3/6))/((-176)/(-400)). -10/11 What is 4/1689((-160)/(-12))/(-8)? -5/14 Calculate 28/3684/98. 2/3 Calculate 3((-368)/1932)/((-36)/(-14)). -2/9 Calculate (-4)/((3/(-2))/((-21)/(-14))-2). -2 What is the value of (36(-27)/432)/((-3)/(-16))? -12 What is 0/((1-1)/((-84)/(-252)))? 0 What is 21/3(-240)/(-560)? 3 Calculate (952/(-84))/(22/(-33)). 17 What is 2/2(0/21)/7? 0 Evaluate ((-8)/(-240))/1(-1)/((-8)/(-20)). -1/12 What is the value of ((-14)/(10/(-5)))/(((-1)/(-1))/(-1))? -7 (-41)/(1230/(-270))(-2)/2 -9 What is (-15)/(-2)(-28)/35? -6 Evaluate 10/6(2002/65)/(-22)1. -7/3 What is (186/(-465))/((22/8)/((-255)/204))? 2/11 What is the value of ((-42)/35)/((-2784)/(-435))? -3/16 Calculate (48/(-64))/((-36)/(-32)). -2/3 What is the value of 6/9-221/42? -2/3 What is (-3857)/(-4959)(-5)/((-5)/(-9))? -7 Evaluate (147/(-8624)22)/(1/6). -9/4 What is the value of 9/(-2)260/117? -10 Calculate 19/3834/(-51). -1/3 What is (-12)/(-28)-428/(-96)38? 19 Evaluate (49/(-18))/(2/1). -1 10/15-127/171 -2/19 ((-1045)/396)/(-19)18/(-45) -1/18 Evaluate 1508/1041120/580. 28 Evaluate (50/24)/(((-2090)/44)/(-19)). 5/6 What is ((3/(-15))/((-12)/5))/((-59)/118)? -1/6 Calculate (5244/20976)/((-1)/(-128)-1). -32 What is the value of (1/2)/(-1)-20? 10 Evaluate (((-12)/85)/3)/(-8(-1)/20). -2/17 What is the value of 12/10(-15)/(-45)(-5)/13? -2/13 Calculate (1/(-18))/((-7)/355/(-4)). -2/9 What is 51/51(-1)/1? -1 -28/(-3)(1026/72)/(-19) -4 Evaluate -64(39/(2223/(-38)))/((-8)/(-3)). 16 -11623/16198 -1/26 Evaluate (63/(-45))/((-2)/(-60)-28). 3/7 (12/30)/((-27)/((-12150)/36)) 5 What is 11/886124/(-3)? -6 What is (1040/494)/(-10)1(-1)/(-2)? -2/19 What is (14/105)/((27/3)/(-45))? -2/3 18/54(-8)/(-80)-114 -19/5 What is 34/510(-50)/12(-16)/(-10)? -4/9 Evaluate (108/90)/((-16)/(-40)). 3 What is the value of ((-105)/40)/(-7)(-904)/(-2034)? 1/6 Calculate 16/10(-27)/(-108). 2/5 Evaluate (-912)/608(-8)/(-9). -4/3 What is the value of (33/(-11))/(((-92)/6)/(4/(-9)))? -2/23 -1(-8)/(-5)(-2735)/(-1094) -4 What is the value of -10((-212)/530)/(2/(-52)-4)? 26 What is 7/((-175)/(-4))210/(-28)? -6/5 6/3((-6)/(-9))/(16/(-204)) -17 What is the value of ((-11)/((-462)/(-12)))/(327/(-49))? 1/16 Evaluate (-37)/((-185)/(-80))(-3)/(-12). -4 What is (4/1614/21)/((-14)/21)? -1/4 (66/(-45))/((-13)/(-260)) -16 Evaluate (2(-3)/(-21))/((-4104)/2394). -1/6 What is the value of ((-252)/882)/(26/(-14))? 2/13 ((-10)/(35/7))/(20/14) -7/5 12/(-22)(-20)/30 4/11 What is ((-1(-7)/(-14))/(-3))/((-2)/4)? -1/3 Evaluate ((3/(-63))/(3/6))/((-27)/63). 2/9 Evaluate ((-4)/1814)/(338/(-1521)). 14 What is the value of (-109590)/(-1124)4/30? 13 What is the value of (-1)/(150/9)((-680)/16)/17? 3/20 What is 1/2(-240)/(-8)(-10)/(-50)? 3 Evaluate ((-23)/(-207))/((-3)/(-900)-4). -25/3 Evaluate ((((-9)/(-7))/(-9))/((-2)/(-2)))/1. -1/7 (-1)/(10/(-480)-24) -2 What is (2(-14)/16)/((-1)/(-20)-5)? 7 20/270-32322/(-43) 12 Evaluate (6/12)/(-6(-11)/12). 1/11 Evaluate (89/((-12460)/24))/((-1)/(5/1)). 6/7 Evaluate 56/17836137. 2/7 What is the value of (6930/1925)/(((-1)/(-10))/((-2)/8))? -9 3(-8)/(-30)-5 -4 What is (-96)/(64/8)18/27? -8 Calculate ((-5)/(-5))/((-75)/120-12). 2/15 Calculate 1/(((-1785)/(-6))/(-35)). -2/17 -5900/625(-30)/(-12) -18 What is (-7)/(126/(-24))2/6-6? -8/3 Calculate 2/(-24(-34)/(-408)). -1 (-38)/13(-4390)/41705 4/13 Evaluate (-3)/((16/20)/(-4))22/(-22). -15 (-4)/(-22)-132(-14)/14280 2/85 Evaluate ((-8)/(-12))/(60/(-990)). -11 ((-110)/(30/3))/(1/((-1)/(-1))) -11 ((9-2)/(-3))/(60/(-60)) -6 What is ((-3)/(-9))/((-9)/(1080/(-24)))? 5/3 What is the value of (-12)/(-14)1/(28/294)? 9 18/(-104)(-1376)/1548 2/13 ((-4)/2)/(84/462) -11 Calculate ((-1)/(-4))/((-28)/336). -3 What is (19/((-532)/(-21)))/(27/8)? 2/9 What is (-2)/(-16)9/(-36)80/(-20)? 1/8 Calculate (((-10)/(-40))/((-3)/126))/((-6)/(-8)). -14 Calculate (((-2)/12)/((-1)/(-17)))/(116/696). -17 12/60(-1190)/(-14) 17 Calculate 28/18(-173)/(-2422)9. 1 Calculate ((-4)/18)/((-18)/(-4374)-9). 6 What is the value of (-7)/(-574)(-2)/3-6? 2/41 What is the value of (((-6)/(-63))/(520/140))/((-14)/(-21))? 1/26 ((-85)/(2720/(-192)))/((-12)/4) -2 Evaluate ((-7)/((-21)/2))/((-178)/2937). -11 What is the value of (-10)/(19/((-216)/60))? 4 What is the value of (32/(-20))/4(-6210)/(-108)? -23 What is the value of ((-442)/(-65))/(-17)2/(-4)? 1/5 What is the value of ((-6)/(-14))/((-113)/(12656/(-480)))? 1/10 What is the value of ((-20)/(-105))/((((-448)/24)/(-14))/(-2))? -2/7 What is -3272/(-340)(-5)/(-66)? 2/11 1224/(-5712)8/6 -2/7 What is the value of 1/((-2)/4(-8)/(-26))? -13/2 (-1)/((-140)/42)2 3/5 What is 16/(((5/5)/((-5)/20))/2)? -8 Evaluate (41/(287/(-4)))/((-2)/(-112)4). -8 What is the value of (12152/(-21))/(-62)(-6)/(-2)? 28 What is the value of (1012/16)/(19/(608/24))? 10 Evaluate (-21)/((780/(-102))/65). 17 What is the value of -714/3789? -7/3 Calculate ((-50)/(-2150))/((-4)/(-8)). 2/43 What is ((-208)/(-40))/((20/60)/(10/(-12)))? -13 ((-15)/4)/(((-132)/1232)/(4/(-14))) -10 Calculate (95/1045)/((-11)/((-1452)/(-8))-6). 1/4 Calculate 12(-52)/(-624)21/(-1). -21 What is 14/((-52)/(-130)-35)? -1 What is (-1)/3-9(-1232)/(-168)? 22 Calculate (-3)/677/14. -11/4 What is the value of (-9)/(-2)172/86? 9 Evaluate ((-5)/(-105))/((3/27)/((-1)/3)). -1/7 Calculate (-12)/21(-826)/1416. 1/3 (9/90)/((-10)/100) -1 ((-1)/(-12))/(11/(44/(-3))) -1/9 Evaluate 16/2288-13-33. 3 What is the value of (12/28)/(14/(-98))? -3 What is (-137/555)/((-4)/(-50))? -5/6 What is the value of (250/(-175))/(((-40)/(-14))/(-5))? 5/2 What is the value of (-4)/(216/621)2? -23 What is ((-9)/4)/((-408)/(-136))? -3/4 ((-884)/187)/(-13)(-2)/(-4) 2/11 (198/8580-13)/(6/5) -1/4 What is the value of -6(672/(-18))/14? 16 What is the value of (-39)/(-143)264/84? 6/7 What is 175/(-105)216/1140? -6/19 Evaluate 342/(-2052)(-18)/4. 3/4 What is (1110/2331)/(45/(-42))? -4/9 Calculate (19/38)/(5/(-270)). -27 What is the value of ((-155)/124)/((-55)/2)? 1/22 Calculate 232359/2022. 7 What is (32/(-72))/((-12)/54)? 2 8/(-168)(-3)/(-3)-6 2/7 What is the value of -11(-42)/385((-880)/12)/11? -8 ((30/10)/92)/((-6)/(-252)) 28 Calculate ((24/(-10))/4)/(	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.