Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
actors of 611968. 2, 7, 683 List the prime factors of 3840915. 3, 5, 13, 19697 What are the prime factors of 825555? 3, 5, 47, 1171 What are the prime factors of 59620? 2, 5, 11, 271 What are the prime factors of 1924193? 151, 12743 List the prime factors of 786764. 2, 11, 17881 List the prime factors of 6411718. 2, 3205859 List the prime factors of 982722. 2, 3, 13, 43, 293 What are the prime factors of 16203810? 2, 3, 5, 7, 73, 151 List the prime factors of 23422550. 2, 5, 468451 What are the prime factors of 3071437? 3071437 List the prime factors of 2646650. 2, 5, 43, 1231 What are the prime factors of 7338652? 2, 1834663 What are the prime factors of 2293? 2293 What are the prime factors of 5119782? 2, 3, 73, 11689 List the prime factors of 108941. 7, 79, 197 What are the prime factors of 3091905? 3, 5, 37, 619 What are the prime factors of 1896376? 2, 101, 2347 What are the prime factors of 36328? 2, 19, 239 List the prime factors of 1816391. 677, 2683 What are the prime factors of 417569? 211, 1979 What are the prime factors of 2717946? 2, 3, 7, 11, 37, 53 What are the prime factors of 11917208? 2, 71, 20981 What are the prime factors of 32199259? 32199259 List the prime factors of 435632. 2, 19, 1433 What are the prime factors of 291080? 2, 5, 19, 383 What are the prime factors of 384174? 2, 3, 7, 3049 What are the prime factors of 182636? 2, 45659 List the prime factors of 23839416. 2, 3, 467, 709 List the prime factors of 254872. 2, 31859 What are the prime factors of 214190? 2, 5, 21419 List the prime factors of 274758. 2, 3, 11, 23, 181 List the prime factors of 665403. 3, 293, 757 What are the prime factors of 1546946? 2, 773473 List the prime factors of 534201. 3, 178067 List the prime factors of 8586737. 8586737 What are the prime factors of 181590? 2, 3, 5, 6053 List the prime factors of 2862123. 3, 11, 43, 2017 List the prime factors of 102553. 11, 9323 List the prime factors of 7567414. 2, 17, 23, 9677 What are the prime factors of 12031993? 37, 325189 What are the prime factors of 504689? 23, 21943 List the prime factors of 943638. 2, 3, 157273 What are the prime factors of 122264? 2, 17, 29, 31 What are the prime factors of 1308265? 5, 7, 37379 List the prime factors of 3570159. 3, 827, 1439 What are the prime factors of 78462? 2, 3, 1453 List the prime factors of 207726. 2, 3, 89, 389 List the prime factors of 5749323. 3, 1223, 1567 What are the prime factors of 5262962? 2, 17, 19, 8147 What are the prime factors of 268237? 268237 List the prime factors of 6970837. 37, 188401 List the prime factors of 3345689. 179, 18691 List the prime factors of 984786. 2, 3, 11, 43, 347 List the prime factors of 1073985. 3, 5, 11, 23, 283 What are the prime factors of 1919500? 2, 5, 11, 349 List the prime factors of 1297562. 2, 7, 92683 List the prime factors of 4845198. 2, 3, 59, 13687 List the prime factors of 11324286. 2, 3, 863 What are the prime factors of 149197? 149197 What are the prime factors of 1889771? 13, 17, 503 What are the prime factors of 988297? 988297 What are the prime factors of 9497821? 2879, 3299 What are the prime factors of 4289389? 13, 17, 1493 What are the prime factors of 34211? 34211 What are the prime factors of 47465? 5, 11, 863 List the prime factors of 10980734. 2, 29, 83, 2281 List the prime factors of 2751301. 7, 56149 List the prime factors of 18018317. 17, 89, 11909 List the prime factors of 705181. 705181 List the prime factors of 9869430. 2, 3, 5, 328981 List the prime factors of 1798752. 2, 3, 41, 457 List the prime factors of 881285. 5, 43, 4099 List the prime factors of 508229. 508229 List the prime factors of 1530390. 2, 3, 5, 139, 367 What are the prime factors of 780942? 2, 3, 23, 5659 What are the prime factors of 434592? 2, 3, 503 List the prime factors of 10390316. 2, 109, 23831 List the prime factors of 1173594. 2, 3, 195599 What are the prime factors of 20790431? 20790431 List the prime factors of 109635. 3, 5, 7309 What are the prime factors of 3646228? 2, 17, 29, 43 What are the prime factors of 147305? 5, 17, 1733 List the prime factors of 428837. 97, 4421 List the prime factors of 3289432. 2, 17, 19, 67 List the prime factors of 8875498. 2, 4437749 List the prime factors of 775682. 2, 31, 12511 What are the prime factors of 19120142? 2, 9560071 What are the prime factors of 261969? 3, 87323 What are the prime factors of 5339589? 3, 19, 113, 829 List the prime factors of 817429. 281, 2909 List the prime factors of 1897364. 2, 7, 67763 What are the prime factors of 234415? 5, 173, 271 List the prime factors of 2870886. 2, 3, 478481 What are the prime factors of 136646? 2, 17, 4019 What are the prime factors of 31473? 3, 13, 269 List the prime factors of 609024. 2, 3, 13, 61 What are the prime factors of 1095362? 2, 547681 What are the prime factors of 6933068? 2, 1733267 List the prime factors of 220087. 7, 23, 1367 What are the prime factors of 8519070? 2, 3, 5, 7, 113, 359 List the prime factors of 2020044. 2, 3, 13, 23, 563 List the prime factors of 11467603. 7, 1171, 1399 List the prime factors of 254025. 3, 5, 1129 List the prime factors of 3024782. 2, 67, 22573 What are the prime factors of 10760921? 10760921 List the prime factors of 20140. 2, 5, 19, 53 List the prime factors of 183045. 3, 5, 12203 List the prime factors of 10627793. 11, 87833 List the prime factors of 307929. 3, 102643 List the prime factors of 3920166. 2, 3, 17, 23, 557 List the prime factors of 462983. 462983 What are the prime factors of 624777? 3, 19, 97, 113 What are the prime factors of 10141? 10141 What are the prime factors of 4728702? 2, 3, 11, 71647 What are the prime factors of 325793? 13, 19, 1319 List the prime factors of 701203. 227, 3089 What are the prime factors of 587900? 2, 5, 5879 What are the prime factors of 31345323? 3, 43, 193, 1259 What are the prime factors of 226937? 226937 List the prime factors of 17630829. 3, 337, 5813 What are the prime factors of 13478239? 19, 709381 What are the prime factors of 9998015? 5, 1999603 What are the prime factors of 913259? 913259 What are the prime factors of 34176? 2, 3, 89 What are the prime factors of 2556675? 3, 5, 11, 1033 List the prime factors of 3842063. 73, 52631 What are the prime factors of 778587? 3, 109, 2381 What are the prime factors of 878903? 29, 30307 List the prime factors of 646387. 7, 107, 863 What are the prime factors of 123899? 19, 6521 List the prime factors of 1490466. 2, 3, 43, 53, 109 What are the prime factors of 54045? 3, 5, 1201 What are the prime factors of 1840743? 3, 17, 53, 227 What are the prime factors of 4853781? 3, 539309 What are the prime factors of 4770573? 3, 79, 20129 List the prime factors of 1286351. 11, 10631 What are the prime factors of 7641430? 2, 5, 764143 List the prime factors of 79216. 2, 4951 List the prime factors of 285420. 2, 3, 5, 67, 71 What are the prime factors of 141963? 3, 79, 599 What are the prime factors of 491306? 2, 245653 List the prime factors of 80786. 2, 31, 1303 List the prime factors of 4045542. 2, 3, 131, 5147 What are the prime factors of 964100? 2, 5, 31, 311 What are the prime factors of 17028726? 2, 3, 11, 13, 89, 223 What are the prime factors of 7065976? 2, 883247 What are the prime factors of 314997? 3, 104999 List the prime factors of 163772. 2, 7, 5849 List the prime factors of 489440. 2, 5, 7, 19, 23 What are the prime factors of 15498? 2, 3, 7, 41 What are the prime factors of 288159? 3, 96053 What are the prime factors of 2870226? 2, 3, 159457 What are the prime factors of 2343972? 2, 3, 31, 6301 List the prime factors of 406241. 11, 36931 List the prime factors of 115384. 2, 14423 List the prime factors of 3005292. 2, 3, 250441 List the prime factors of 166900. 2, 5, 1669 List the prime factors of 232761. 3, 77587 List the prime factors of 1125279. 3, 71, 587 List the prime factors of 936877. 37, 25321 What are the prime factors of 438586? 2, 219293 List the prime factors of 3659935. 5, 107, 6841 List the prime factors of 23257690. 2, 5, 97, 23977 What are the prime factors of 9002975? 5, 131, 2749 What are the prime factors of 1796328? 2, 3, 61, 409 What are the prime factors of 140026? 2, 53, 1321 What are the prime factors of 1721607? 3, 17, 33757 List th	{ "pile_set_name": "DM Mathematics" }
rivative of -3l5 - 4l*2 + 11l*2 + 0l*5 wrt l. -180l2 Let o be (-1 - (-1 + 0)) + 0. Let w = 2 - o. Find the first derivative of -3 + s + w + 0 wrt s. 1 Let l(i) be the third derivative of i4/12 + 4i3/3 - 5i*2. Let d(z) = z + 4. Let w(h) = -9d(h) + 4l(h). Differentiate w(g) with respect to g. -1 Suppose -19 = -2y - 6k + 3k, -4y + 2k + 14 = 0. Suppose -yr + 0u - u + 5 = 0, -u - 7 = -r. What is the first derivative of -5v + 2 + v + rv wrt v? -2 Let r be 2/(-10) - (-55)/25. What is the second derivative of 14a - 3a*r + 0 - 20a + 0 wrt a? -6 What is the derivative of 0x4 + 6 - 1 + 2x*4 + 8x*4 wrt x? 40x3 Let g(y) be the second derivative of -y6/30 - 29y5/10 + 17y*2/2 - 3y - 7. Find the first derivative of g(n) wrt n. -4n3 - 174n*2 Let j be 2 - 0 - (2 + -2). Differentiate -f + 0 + 0f - j - 1 wrt f. -1 Suppose 26 = 4i + 14. Let b(f) be the first derivative of -1 - 2/3f*3 + 0f*2 - if. What is the first derivative of b(r) wrt r? -4r Let m(f) = f5 - f3 - f - 1. Let n(z) = 16z*5 - 5z*3 + 2z - 5. Let s(i) = 5m(i) - n(i). Find the second derivative of s(h) wrt h. -220h*3 Let q(v) be the third derivative of 7v*6/24 + 2v*4 + 29v*2. What is the second derivative of q(b) wrt b? 210b Let s be 6-1(-2)/4. Find the second derivative of v - 2v + sv*2 + 2v wrt v. 6 Let g be (-2)/(-3) - (-9)/27. Find the first derivative of -d*2 + 3 + g - 7 wrt d. -2d Let s be 13/5 + (-4)/(-10). Let p be 18(1/3 - 0). Find the third derivative of 0k6 + k6 - 4k2 - sk6 - kp wrt k. -360k3 Suppose 2f + 2 = f. Let h be (f + 0)(-2 + 1). What is the third derivative of 0d*2 - 4d*h + 7d*3 - 5d*3 wrt d? 12 What is the second derivative of -3m - 2m + 141m*5 - 150m*5 wrt m? -180m*3 Let j(f) = 11f*2 - 4f - 9. Let g(v) = 12v2 - 3v - 10. Let r(i) = -4g(i) + 3j(i). Find the first derivative of r(u) wrt u. -30u Let a(c) = 40c*5 - 22c*2 - 10c + 10. Let t(j) = 13j5 - 7j*2 - 3j + 3. Let u(k) = -3a(k) + 10t(k). What is the third derivative of u(n) wrt n? 600n2 Let s(g) be the first derivative of g8/210 - g6/90 - 8g*3/3 - 4. Let r(i) be the third derivative of s(i). Find the third derivative of r(q) wrt q. 192q Let z = 1 - -2. What is the first derivative of 0 + zn4 + 4 - 4n*4 wrt n? -4n*3 Let g(b) be the third derivative of -1/70b*7 + 0b*3 + 0b*6 - 4b*2 + 0b*4 + 1/30b*5 + 0 + 0b. Find the third derivative of g(h) wrt h. -72h Find the first derivative of -11u*4 - 3 - 3 - 2 wrt u. -44u*3 Let f be (-44)/(-16) - 1/(-4). What is the derivative of -3 - 5s3 - sf + s*4 + 6s*3 wrt s? 4s*3 Let y(m) = 9m*4 - 3m3 - m2 + 3. Let r(x) = x4 - x3 + x*2 + 1. Let v(n) = -3r(n) + y(n). What is the third derivative of v(c) wrt c? 144c Find the second derivative of -7p - 9p3 + 0p - 6p - p wrt p. -54p Suppose 3p + 4d - 4 = 0, 4d = 3p - 28 + 8. Differentiate 4l2 + 0l2 - 3 + lp - 4l2 with respect to l. 4l*3 Let i(k) = 22k + 6. Let o(q) = 43q + 12. Let h(t) = -13i(t) + 6o(t). Differentiate h(z) with respect to z. -28 Suppose -i = 2 - 1. Let k be (i/2)/(6/(-36)). Find the second derivative of -kw - 4w2 + 4w*2 + 4w - w*4 wrt w. -12w2 Let r(z) be the first derivative of z7/210 - z4/24 - z2/2 - 2. Let l(w) be the second derivative of r(w). What is the second derivative of l(v) wrt v? 12v2 Let r = -5 + 7. What is the second derivative of -r + u2 + 3u + 2 - 4u2 wrt u? -6 Find the second derivative of 67a*3 + 10a*5 + 15a + 68a3 - 135a*3 wrt a. 200a*3 Let t(l) = -26l*5 + 6l*2 - 8l + 8. Let q(p) = 17p5 - 4p*2 + 5p - 5. Let b(s) = 8q(s) + 5t(s). What is the third derivative of b(c) wrt c? 360c2 Suppose 4 - 2 = p. Let g be (0 - 0)(p + -1). What is the third derivative of 0d - d2 - 2d*3 + gd wrt d? -12 Let h be ((-24)/(-20))/(-3)-5. Find the second derivative of -m4 + 0m*h - 4m - 3m4 + 0m*2 wrt m. -48m*2 Let u(n) be the third derivative of 0n*4 - 2n*2 + 1/70n*7 + 0n + 0n6 + 0 + 0n*3 - 1/60n*5. What is the third derivative of u(b) wrt b? 72b Suppose -2r - r + 253 = 5o, 2o + 4r - 104 = 0. Find the first derivative of -49 + v*3 - 2v*3 + o wrt v. -3v2 Let y(h) be the third derivative of h7/120 - h6/45 + h3 + 5h2. Let m(s) be the first derivative of y(s). What is the third derivative of m(u) wrt u? 42 Let y(m) = -m2 + 9m - 10. Let v be y(7). What is the third derivative of -4 + l2 + v + l3 wrt l? 6 Suppose -k - 5l + 19 = 2k, 3l - 3 = k. What is the second derivative of j + 0j3 + j3 + 0j + jk wrt j? 12j Let s(t) = -18t2 - 6t - 6. Let z(f) = f. Let g(o) = -s(o) - 6z(o). Differentiate g(i) wrt i. 36i Let l(b) = -b - 4. Let u be l(-5). What is the first derivative of u + 0t - 2t - 2t + t wrt t? -3 Let r(n) = 4n*3 + 6n2 - 11. Let o(x) = x3 + x*2 - 3 + 0x*2 + 2 - 1. Let a(y) = 11o(y) - 2r(y). Find the third derivative of a(m) wrt m. 18 Let t(d) be the third derivative of -d6/120 + 11d*3/3 - 20d*2. What is the first derivative of t(q) wrt q? -3q*2 Let w(z) = -z + 2. Let h(u) = -2. Let v(t) = -3h(t) - 2w(t). Differentiate v(o) wrt o. 2 Let w(k) be the second derivative of k7/21 + k3/3 - 13k. What is the second derivative of w(l) wrt l? 40l3 Let q(g) = 4g*2 - 2g + 5. Let k = -21 + 12. Let c(x) = -17x2 + 9x - 21. Let s(i) = kq(i) - 2c(i). What is the first derivative of s(z) wrt z? -4z Let j(z) be the second derivative of z5/20 - z4/12 + 8z3/3 + z2 - 31z + 2. Find the second derivative of j(i) wrt i. 6i - 2 Suppose -2r - 6 = -5r. Suppose 5m - 16 = 2c - 4, 13 = 4m - 5c. What is the first derivative of -r + 4f - f - mf wrt f? 1 Let a(f) = -f*3 + 5f*2 + 6f. Let t be a(6). Let u(j) be the first derivative of 3 - j - 1/4j4 + 0j*2 + tj*3. Find the first derivative of u(i) wrt i. -3i2 Let k(t) be the first derivative of 2 + t2 + 2/5t5 + 0t + 0t4 + 0t*3. What is the second derivative of k(q) wrt q? 24q*2 What is the third derivative of 9d*4 - 119d*6 + 22d*4 + 19d*2 + 118d*6 wrt d? -120d*3 + 744d Find the first derivative of 4j - 7j + 8 + 3j + 7j*4 wrt j. 28j*3 Let t(l) be the first derivative of 8l*3/3 + 4l*2 - 11. What is the second derivative of t(k) wrt k? 16 Let t(b) be the third derivative of -1/6b3 + 0 - b2 - 1/12b5 + 0b + 0b4. What is the first derivative of t(n) wrt n? -10n Let d(h) be the third derivative of h9/756 - h5/120 - h3/3 + h2. Let q(i) be the first derivative of d(i). Find the second derivative of q(r) wrt r. 80r3 Let g(s) = -25s*3 + 6s*2 - 4s - 12. Let l(f) = 50f3 - 13f*2 + 9f + 23. Let y(d) = -13g(d) - 6l(d). Differentiate y(q) wrt q. 75q2 - 2 Let w(i) be the first derivative of 3/4i*4 + 7/3i*3 + 0i - 4 + 0i2. What is the third derivative of w(q) wrt q? 18 Suppose 3f - 20 = -f. Suppose 3r = -5g - 19, -fr + 2g - g = -15. Find the second derivative of 5d - 4d + 0dr - d2 wrt d. -2 Differentiate -20 + 2 + 8 + 8h wrt h. 8 Differentiate 4b + 29b*2 - 46b*2 - 22 + 16b*2 + 14b*2 wrt b. 26b + 4 Suppose -15c + 23c = 0. Let l(m) be the first derivative of 2/5m5 + 0m*4 + 0m - m*3 + cm*2 + 3. Find the third derivative of l(f) wrt f. 48f Let z be 6/(-21) - (-60)/14. Suppose y - zy = -9. Find the third derivative of yc2 - c + c3 + c wrt c. 6 Let h(x) = 3x - 3. Let p be h(2). Suppose -2v - p = -9. Find the third derivative of 9jv - 5j3 - j6 - j*2 - 4j*3 wrt j. -120j3 Let o(v) be the third derivative of -v6/60 - 7v5/60 - 5v*2. Find the third derivative of o(j) wrt j. -12 Let y(m) be the third derivative of 11m*6/120 - 7m*3/3 + 14m*2. Find the first derivative of y(t) wrt t. 33t*2 Suppose -9p + 4p + 10 = 0. What is the third derivative of -3w*2 + pw*2 + 0w*2 + 7w*6 wrt w? 840w*3 Suppose 2d + b + 1 = 0, -3d + 3b = 7b + 9. Differentiate d - 6y*4 + 10y*4 - 2y*4 wrt y. 8y*3 Let l(n) = -2n - 35. Let k be l(-19). Let g(a) be the first derivative of -a*4 + 4 + 0a + 2/3ak + 0a**2. Find the third derivative of g(t) wrt t. -24 Let p = 8 - 3. Let	{ "pile_set_name": "DM Mathematics" }
nearest integer? 1623 What is the tenth root of 814713 to the nearest integer? 4 What is 865618 to the power of 1/3, to the nearest integer? 95 What is 1131991 to the power of 1/4, to the nearest integer? 33 What is 5524616 to the power of 1/2, to the nearest integer? 2350 What is the square root of 590150 to the nearest integer? 768 What is the ninth root of 2476997 to the nearest integer? 5 What is 9262709 to the power of 1/5, to the nearest integer? 25 What is the cube root of 1183405 to the nearest integer? 106 What is the fifth root of 3362160 to the nearest integer? 20 What is the third root of 36010 to the nearest integer? 33 What is 138610 to the power of 1/2, to the nearest integer? 372 What is 5875477 to the power of 1/8, to the nearest integer? 7 What is 190757 to the power of 1/5, to the nearest integer? 11 What is 1745817 to the power of 1/8, to the nearest integer? 6 What is 308301 to the power of 1/7, to the nearest integer? 6 What is 1169629 to the power of 1/10, to the nearest integer? 4 What is the seventh root of 11426409 to the nearest integer? 10 What is 278977 to the power of 1/2, to the nearest integer? 528 What is the square root of 113930 to the nearest integer? 338 What is the third root of 5159030 to the nearest integer? 173 What is 54348 to the power of 1/3, to the nearest integer? 38 What is 40248973 to the power of 1/10, to the nearest integer? 6 What is the ninth root of 3463094 to the nearest integer? 5 What is the cube root of 4482437 to the nearest integer? 165 What is 5065438 to the power of 1/8, to the nearest integer? 7 What is the square root of 15519114 to the nearest integer? 3939 What is the cube root of 119134 to the nearest integer? 49 What is 220544 to the power of 1/3, to the nearest integer? 60 What is the sixth root of 176323 to the nearest integer? 7 What is 3977477 to the power of 1/6, to the nearest integer? 13 What is the tenth root of 1842881 to the nearest integer? 4 What is the square root of 105404 to the nearest integer? 325 What is the sixth root of 1778479 to the nearest integer? 11 What is 5212 to the power of 1/2, to the nearest integer? 72 What is 388293 to the power of 1/2, to the nearest integer? 623 What is 720927 to the power of 1/3, to the nearest integer? 90 What is 10374204 to the power of 1/2, to the nearest integer? 3221 What is the ninth root of 28487277 to the nearest integer? 7 What is the fifth root of 2307706 to the nearest integer? 19 What is the third root of 6392690 to the nearest integer? 186 What is the sixth root of 5186150 to the nearest integer? 13 What is the square root of 707847 to the nearest integer? 841 What is the cube root of 4223213 to the nearest integer? 162 What is the third root of 26365792 to the nearest integer? 298 What is 526288 to the power of 1/2, to the nearest integer? 725 What is the ninth root of 206441 to the nearest integer? 4 What is the third root of 14734337 to the nearest integer? 245 What is the third root of 468498 to the nearest integer? 78 What is 12205842 to the power of 1/6, to the nearest integer? 15 What is the cube root of 9437002 to the nearest integer? 211 What is 291551 to the power of 1/2, to the nearest integer? 540 What is the square root of 624585 to the nearest integer? 790 What is the sixth root of 1309169 to the nearest integer? 10 What is the third root of 661240 to the nearest integer? 87 What is the third root of 1309136 to the nearest integer? 109 What is the third root of 2106120 to the nearest integer? 128 What is 479674 to the power of 1/2, to the nearest integer? 693 What is 22942919 to the power of 1/2, to the nearest integer? 4790 What is the square root of 4941688 to the nearest integer? 2223 What is the square root of 150971 to the nearest integer? 389 What is the eighth root of 1261850 to the nearest integer? 6 What is 1381979 to the power of 1/2, to the nearest integer? 1176 What is 585348 to the power of 1/3, to the nearest integer? 84 What is 2878698 to the power of 1/4, to the nearest integer? 41 What is 2455 to the power of 1/7, to the nearest integer? 3 What is 1470642 to the power of 1/3, to the nearest integer? 114 What is 34718821 to the power of 1/7, to the nearest integer? 12 What is 578542 to the power of 1/4, to the nearest integer? 28 What is 217436 to the power of 1/5, to the nearest integer? 12 What is 2156465 to the power of 1/2, to the nearest integer? 1468 What is the fifth root of 50679 to the nearest integer? 9 What is the square root of 2909404 to the nearest integer? 1706 What is 291628 to the power of 1/3, to the nearest integer? 66 What is the eighth root of 710010 to the nearest integer? 5 What is 1849503 to the power of 1/2, to the nearest integer? 1360 What is 249516 to the power of 1/2, to the nearest integer? 500 What is 8601475 to the power of 1/2, to the nearest integer? 2933 What is 223593 to the power of 1/4, to the nearest integer? 22 What is the cube root of 381748 to the nearest integer? 73 What is 8850993 to the power of 1/2, to the nearest integer? 2975 What is 3760564 to the power of 1/3, to the nearest integer? 156 What is 253924 to the power of 1/2, to the nearest integer? 504 What is 671962 to the power of 1/2, to the nearest integer? 820 What is 25709056 to the power of 1/2, to the nearest integer? 5070 What is 146930 to the power of 1/8, to the nearest integer? 4 What is the cube root of 2149771 to the nearest integer? 129 What is the square root of 20217953 to the nearest integer? 4496 What is the square root of 187115 to the nearest integer? 433 What is 204295 to the power of 1/3, to the nearest integer? 59 What is the ninth root of 10080523 to the nearest integer? 6 What is the square root of 1710487 to the nearest integer? 1308 What is the fifth root of 4943793 to the nearest integer? 22 What is 1451625 to the power of 1/9, to the nearest integer? 5 What is the square root of 21273625 to the nearest integer? 4612 What is 641217 to the power of 1/2, to the nearest integer? 801 What is 1979102 to the power of 1/2, to the nearest integer? 1407 What is the third root of 270850 to the nearest integer? 65 What is 2121077 to the power of 1/2, to the nearest integer? 1456 What is 1594233 to the power of 1/7, to the nearest integer? 8 What is 947833 to the power of 1/3, to the nearest integer? 98 What is the square root of 30739854 to the nearest integer? 5544 What is 407803 to the power of 1/3, to the nearest integer? 74 What is 14581014 to the power of 1/2, to the nearest integer? 3819 What is 12736 to the power of 1/3, to the nearest integer? 23 What is the cube root of 8088925 to the nearest integer? 201 What is 295067 to the power of 1/3, to the nearest integer? 67 What is 1903476 to the power of 1/3, to the nearest integer? 124 What is the sixth root of 5691211 to the nearest integer? 13 What is 62431 to the power of 1/2, to the nearest integer? 250 What is 490171 to the power of 1/10, to the nearest integer? 4 What is the sixth root of 563064 to the nearest integer? 9 What is the seventh root of 99778 to the nearest integer? 5 What is the ninth root of 518006 to the nearest integer? 4 What is 709397 to the power of 1/6, to the nearest integer? 9 What is the square root of 563827 to the nearest integer? 751 What is the seventh root of 345463 to the nearest integer? 6 What is the seventh root of 15333227 to the nearest integer? 11 What is 1374030 to the power of 1/10, to the nearest integer? 4 What is 206455 to the power of 1/5, to the nearest integer? 12 What is the fourth root of 310313 to the nearest integer? 24 What is 7498025 to the power of 1/9, to the nearest integer? 6 What is 21744 to the power of 1/3, to the nearest integer? 28 What is 1497764 to the power of 1/2, to the nearest integer? 1224 What is 58977 to the power of 1/3, to the nearest integer? 39 What is 290961 to the power of 1/9, to the nearest integer? 4 What is the third root of 2505217 to the nearest integer? 136 What is 441797 to the power of 1/2, to the nearest integer? 665 What is the square root of 2992888 to the nearest integer? 1730 What is 3300375 to the power of 1/2, to the nearest integer? 1817 What is 25535085 to the power of 1/2, to the nearest integer? 5053 What is the	{ "pile_set_name": "DM Mathematics" }
-37, -110, -231, -412, -665, -1002? -2z3 + z + 14 What is the h'th term of 362, 1432, 3214, 5708, 8914, 12832, 17462? 356h*2 + 2h + 4 What is the d'th term of -5807, -5806, -5805, -5804, -5803, -5802? d - 5808 What is the i'th term of -63, -110, -159, -210? -i*2 - 44i - 18 What is the x'th term of -349, -699, -1049? -350x + 1 What is the q'th term of 153, 234, 313, 390, 465? -q2 + 84q + 70 What is the y'th term of 1736, 1734, 1732, 1730, 1728, 1726? -2y + 1738 What is the d'th term of -12, -63, -148, -267? -17d2 + 5 What is the h'th term of -154, -146, -126, -88, -26? h3 + h - 156 What is the n'th term of -96, -190, -282, -372, -460, -546? n*2 - 97n What is the l'th term of -146, -271, -406, -557, -730, -931, -1166, -1441? -l3 + l2 - 121l - 25 What is the g'th term of 509, 1016, 1523, 2030, 2537, 3044? 507g + 2 What is the c'th term of -11138, -22276, -33424, -44588, -55774, -66988, -78236? -c3 + c2 - 11134c - 4 What is the w'th term of 140, 139, 138? -w + 141 What is the x'th term of 233, 220, 193, 146, 73, -32, -175? -x3 - x2 - 3x + 238 What is the f'th term of 226, 452, 676, 898, 1118, 1336, 1552? -f*2 + 229f - 2 What is the u'th term of 34, 46, 58, 70? 12u + 22 What is the z'th term of -765, -766, -767, -768, -769, -770? -z - 764 What is the q'th term of 42, 82, 116, 144, 166, 182, 192? -3q*2 + 49q - 4 What is the o'th term of -742, -741, -750, -775, -822, -897, -1006, -1155? -o3 + o2 + 5o - 747 What is the c'th term of 54, 120, 294, 630, 1182, 2004, 3150, 4674? 9c*3 + 3c + 42 What is the p'th term of -2, -63, -182, -365, -618? -p*3 - 23p*2 + 15p + 7 What is the t'th term of 52, 37, 18, 1, -8? t*3 - 8t*2 + 2t + 57 What is the n'th term of 0, -4, -8, -12? -4n + 4 What is the u'th term of -29, -102, -231, -422, -681, -1014, -1427, -1926? -u3 - 22u*2 - 6 What is the n'th term of 890, 892, 894, 896, 898, 900? 2n + 888 What is the c'th term of -10566, -21130, -31694, -42258? -10564c - 2 What is the r'th term of 11, 30, 63, 116, 195, 306, 455, 648? r3 + r2 + 9r What is the n'th term of 6, -2, -14, -30, -50, -74, -102? -2n2 - 2n + 10 What is the k'th term of -151, -627, -1419, -2521, -3927? k*3 - 164k*2 + 9k + 3 What is the n'th term of 585, 1162, 1739, 2316? 577n + 8 What is the w'th term of -951, -959, -969, -981, -995? -w2 - 5w - 945 What is the i'th term of -2, 8, 4, -20, -70? -i3 - i2 + 20i - 20 What is the q'th term of 16, 48, 80, 112, 144? 32q - 16 What is the p'th term of -19, -88, -203, -364, -571, -824, -1123? -23p2 + 4 What is the f'th term of -2123, -4250, -6379, -8510, -10643? -f2 - 2124f + 2 What is the m'th term of -17, -30, -41, -50, -57, -62? m*2 - 16m - 2 What is the l'th term of -630, -629, -624, -615, -602, -585? 2l2 - 5l - 627 What is the g'th term of 0, -19, -42, -69, -100, -135, -174? -2g2 - 13g + 15 What is the i'th term of -11, -32, -57, -86, -119, -156, -197? -2i2 - 15i + 6 What is the t'th term of 2, 11, 14, 5, -22? -t*3 + 3t*2 + 7t - 7 What is the i'th term of -87, -91, -107, -141, -199, -287, -411? -i*3 + 3i - 89 What is the i'th term of 183, 629, 1365, 2385, 3683, 5253? -i*3 + 151i2 + 33 What is the t'th term of 6521, 6519, 6515, 6509, 6501, 6491? -t2 + t + 6521 What is the o'th term of 1330, 2665, 4000? 1335o - 5 What is the k'th term of -28, -59, -90, -121, -152? -31k + 3 What is the i'th term of 1006, 997, 966, 901, 790? -2i3 + i2 + 2i + 1005 What is the s'th term of 16, 41, 66? 25s - 9 What is the u'th term of 42, 76, 110, 144, 178, 212? 34u + 8 What is the n'th term of -14810, -14811, -14812, -14813, -14814, -14815? -n - 14809 What is the q'th term of -1796, -1798, -1800, -1802? -2q - 1794 What is the p'th term of 233, 307, 381, 455, 529, 603? 74p + 159 What is the b'th term of 47, 45, 43, 41, 39? -2b + 49 What is the p'th term of -542, -541, -540, -539, -538, -537? p - 543 What is the p'th term of 131, 269, 407? 138p - 7 What is the r'th term of -185, -182, -183, -194, -221? -r*3 + 4r*2 - 2r - 186 What is the o'th term of 33, 63, 93? 30o + 3 What is the q'th term of 16, 42, 70, 100, 132, 166? q2 + 23q - 8 What is the s'th term of -488, -971, -1454? -483s - 5 What is the q'th term of -561, -2278, -5139, -9144, -14293, -20586? -572q*2 - q + 12 What is the t'th term of 14, 58, 126, 218, 334, 474? 12t*2 + 8t - 6 What is the p'th term of -108, -219, -330, -441? -111p + 3 What is the u'th term of -35718, -35721, -35726, -35733, -35742, -35753, -35766? -u2 - 35717 What is the b'th term of 74, 181, 288? 107b - 33 What is the s'th term of -47, -52, -57? -5s - 42 What is the n'th term of -11, -24, -57, -122, -231? -2n*3 + 2n*2 - 5n - 6 What is the p'th term of 119, 122, 125, 128? 3p + 116 What is the l'th term of -505, -1009, -1513, -2017, -2521? -504l - 1 What is the s'th term of -19, -15, -9, -1, 9, 21, 35? s*2 + s - 21 What is the t'th term of 457, 917, 1377, 1837, 2297, 2757? 460t - 3 What is the w'th term of 53, 60, 75, 104, 153? w*3 - 2w*2 + 6w + 48 What is the f'th term of -271, -532, -793, -1054, -1315? -261f - 10 What is the n'th term of -6, -52, -136, -264, -442? -n3 - 13n2 + 8 What is the c'th term of 175, 163, 151, 145, 151, 175, 223? c3 - 6c2 - c + 181 What is the m'th term of 142, 166, 180, 178, 154, 102, 16, -110? -m3 + m2 + 28m + 114 What is the l'th term of -465, -463, -461, -459, -457? 2l - 467 What is the p'th term of 1034, 1058, 1082, 1106, 1130? 24p + 1010 What is the z'th term of 1398, 1397, 1396, 1395? -z + 1399 What is the g'th term of 42, 44, 46, 48? 2g + 40 What is the d'th term of -66, -169, -314, -507, -754, -1061, -1434? -d3 - 15d*2 - 51d + 1 What is the g'th term of -252, -244, -236, -228? 8g - 260 What is the a'th term of 7026, 7024, 7022? -2a + 7028 What is the w'th term of -222, -418, -614, -810? -196w - 26 What is the n'th term of -360, -719, -1078, -1437? -359n - 1 What is the y'th term of 0, -2, 4, 24, 64, 130, 228, 364? y*3 - 2y*2 - 3y + 4 What is the p'th term of -580, -582, -584, -586, -588? -2p - 578 What is the i'th term of -370, -359, -334, -289, -218, -115, 26, 211? i3 + i2 + i - 373 What is the i'th term of -1108, -1113, -1116, -1117, -1116, -1113? i2 - 8i - 1101 What is the r'th term of 11, 25, 47, 77, 115? 4r2 + 2r + 5 What is the k'th term of -1752, -3506, -5260, -7014? -1754k + 2 What is the z'th term of -10, -12, -18, -28, -42? -2z*2 + 4z - 12 What is the o'th term of -666, -670, -678, -690? -2o2 + 2o - 666 What is the t'th term of -29, -32, -35, -38, -41, -44? -3t - 26 What is the a'th term of 66, 123, 192, 279, 390, 531, 708? a3 + 50a + 15 What is the b'th term of 137, 157, 185, 227, 289, 377, 497, 655? b*3 - 2b*2 + 19b + 119 What is the m'th term of 124, 188, 242, 280, 296? -m3 + m2 + 68m + 56 What is the t'th term of -10, -15, -16, -13, -6? 2t*2 - 11t - 1 What is the n'th term of 60, 102, 144? 42n + 18 What is the x'th term of -2972, -5943, -8914, -11885, -14856, -17827? -2971x - 1 What is the d'th term of -538, -544, -554, -568, -586, -608, -634? -2d2 - 536 What is the g'th term of 126, 128, 130, 132, 134, 136? 2g + 124 What is the k'th term of 26, 78, 214, 476, 906, 1546? 7k3 + 3k + 16 What is the k'th term of 151, 148, 143, 136, 127? -k2 + 152 What is the m'th term of 306, 301, 284, 249, 190, 101, -24? -m3 + 2m + 305 What is the p'th term of -91, -384, -909, -1696, -2775, -4176, -5929, -8064? -5p*3 - 86p*2 What is the x'th term of -3607, -3612, -3621, -3634, -3651, -3672, -3697? -2x2 + x - 3606 What is the x'th term of -11, -6, 1, 10, 21, 34, 49? x2 + 2x - 14 What is the r'th term of 290, 1177, 2658, 4733, 7402, 10665, 14522? 297r*2 - 4r - 3 What is the y'th term of -7, -10, -25, -58, -115? -y*3 + 4y - 10 What is the z'th term of -4, 5, 38, 107, 224, 401, 650? 2z3 - 5z - 1 What is the j'th term of 1, 14, 41, 88, 161? j3 + j2 + 3j - 4 What is the j'th term of 4, 29, 70, 127, 200, 289, 394? 8j*2 + j - 5 What is the w'th term of 1, 8, 37, 100, 209, 376, 613? 2w3 - w2 - 4w + 4 What is the o'th term of -502, -1003, -1504, -2005, -2506, -3007? -501o - 1 What is the h'th term of -3359, -335	{ "pile_set_name": "DM Mathematics" }
5315. Round h to the nearest 10. 380 Let s = -3160.41 + 32.41. Let y = s - -3125.4723. Let v = y - 0.0623. What is v rounded to zero dps? -3 Suppose -88 = 3h + g - 2g, 2h + 36 = -5g. Let l be (h/10)/(14/(-70)). Suppose lq + 189600000 = 8q. Round q to the nearest 1000000. -32000000 Let t = -23584 - -23584.047515. Round t to 3 decimal places. 0.048 Let m = 163 + -163.006029. What is m rounded to four dps? -0.006 Let v = -0.139 - -0.203. Let d = -0.063917 + v. What is d rounded to four decimal places? 0.0001 Let k = 255.03064 + -254.9. Round k to three decimal places. 0.131 Let d = 91.120427 - -0.011573. Let j = d + -91. Let h = -0.13199555 + j. Round h to seven decimal places. 0.0000045 Let p = -10368 + 10367.0686. What is p rounded to two decimal places? -0.93 Let s = 0.0961 - 0.09613925. What is s rounded to 5 dps? -0.00004 Let o = 7984.0010686 + -7984. Round o to 4 decimal places. 0.0011 Suppose -2k = -2i + i, -k + 3i = 0. Let f(t) = t3 - t2 + 6. Let y be f(k). Let s be (-3)/y - 379/2. Round s to the nearest 100. -200 Let u(g) = -g2 + 3g + 6. Suppose -28 = 12c - 19c. Let n be u(c). Suppose s + d - 548178 = 68826, 0 = -ns - 4d + 1234016. Round s to the nearest 100000. 600000 Let o = 225.4 + -247. Let s = -21.6095 - o. What is s rounded to 3 dps? -0.01 Let o = -189.982 - 2.118. Let v = o + 34.1. Let x = v - -158.00612. Round x to 3 decimal places. 0.006 Let i = -3379 + 2270. Let n = i + 1108.99998999. Round n to seven decimal places. -0.00001 Let t = -153.22 - -151. Let m = 139.3 - 143. Let p = t - m. What is p rounded to 1 dp? 1.5 Let t = -2029725 - 1865275. Round t to the nearest 10000. -3900000 Let d = 5221.45972 + -5222. What is d rounded to 1 dp? -0.5 Let r = 135.4044 - 22.3014. Let s = 113 - r. Let w = -0.07 - s. What is w rounded to two decimal places? 0.03 Let r = -0.266985 + 0.2597. What is r rounded to 3 decimal places? -0.007 Let r = -0.43 - 240.47. Let a = r + 225. Let g = a - -15.8485. What is g rounded to three dps? -0.052 Suppose 0 = 4g + 5 - 53. Suppose 4o + 2o - g = 0. Suppose -4i - 3b + ob - 22804 = 0, -i - 5696 = -b. What is i rounded to the nearest one thousand? -6000 Let l(h) = -49h2 - 3h + 11586. Let v be l(0). Round v to the nearest 1000. 12000 Let r = 281 - 17. Let t = r - 239.6. What is t rounded to the nearest integer? 24 Let q = 3703109059.129915 - 3703097624. Let y = q - 11435.6. Let n = 0.47 + y. Round n to five dps. -0.00009 Let m = 1581 - -5608. Let r be (-40)/20 - (m - (3 - 2)). Round r to the nearest 1000. -7000 Let j = 101.12 - -0.88. Let w = 47 - j. Let o = -54.99804 - w. What is o rounded to 4 dps? 0.002 Let u be (-5 - (-8 + 3))(-3)/3. Suppose -14g + 13g - b + 1588005 = u, 7940020 = 5g + 4b. Round g to the nearest one hundred thousand. 1600000 Let d = 42.9 + -7.9. Let l = -35.16 + d. Let o = 0.132 - l. Round o to 2 dps. 0.29 Let l(c) = 35867c*2 - 116c - 331. Let d be l(-13). Round d to the nearest 1000000. 6000000 Let r = -604.4004 - 0.0196. What is r rounded to the nearest integer? -604 Let v = 5095 + -3138. Let r(d) = 315d + 3. Let f be r(-2). Let k = f + v. What is k rounded to the nearest one hundred? 1300 Let u = -121 + 121.0922. Let k = u + -0.07744. Round k to three dps. 0.015 Let f = 0.0154 + 0.0355. Let z = f - 0.050901351. Round z to seven decimal places. -0.0000014 Let b = 16.9 + -16. Let x = -14.1 - b. Let a = x + 14.982. Round a to two decimal places. -0.02 Let m = 94131982797551181 + -94131983874428500.49999741. Let a = m - -1076877306. Let q = -13.5 - a. Round q to six decimal places. -0.000003 Let t = 14103.5988575 + -13980.599. Let n = t - 123. What is n rounded to 5 dps? -0.00014 Suppose 5j = 2z + 1227305, 12j - 11j = 4z + 245443. Let u = -154863 + j. What is u rounded to the nearest ten thousand? 90000 Let x = -51.2695331 + 51.27. Round x to four decimal places. 0.0005 Suppose -3j - 2j + 81725 = 0. Suppose -5q + 3c - 353 + 20738 = 0, 5c - j = -4q. Round q to the nearest one thousand. 4000 Suppose 2f + 71107992 = 4y, -5y - 15f + 88884996 = -16f. Round y to the nearest one hundred thousand. 17800000 Let b(y) be the second derivative of 0 - 33/2y*4 + 0y*2 - 2/3y*3 + 2y. Let a be b(2). Round a to the nearest one thousand. -1000 Let n = -112 + 64. Let d = 111 + n. Let u = d - 63.00000143. What is u rounded to seven dps? -0.0000014 Let y = -0.0569238042 - -0.05692. Round y to 6 decimal places. -0.000004 Let j = -3.029 + 3.035072. Round j to 3 decimal places. 0.006 Let v = -138242747.00817 + 138243769. Let x = -1022 + v. Round x to 4 dps. -0.0082 Let m = 1373.9043 + -1374. What is m rounded to three dps? -0.096 Let z = -89747 + 89691.267. Round z to the nearest 10. -60 Let b(i) = 20 + 3 - 7654i + 24 + 5. Let k be b(3). Round k to the nearest 1000. -23000 Let i = 128115 + -10405. What is i rounded to the nearest one thousand? 118000 Let k = -60514762559010.8999954 + 60514749009869. Let a = 13549090.9 + k. Let j = a - -51. What is j rounded to six dps? 0.000005 Let k = -266.295 - -0.295. Let d = 482 + k. Let t = d - 215.652. Round t to two dps. 0.35 Let v = 1983998 + -1983946.03292. Let r = -0.10208 + v. Let j = r - 52. What is j rounded to two decimal places? -0.14 Let g = -191068 - -191051.5127. Let d = g + 101.3843. Let z = -85 + d. What is z rounded to two decimal places? -0.1 Let s = 255471.0559 - 255445. Let k = -25.95 + s. What is k rounded to three decimal places? 0.106 Let b = -10.465007284 + 10.465. Round b to seven dps. -0.0000073 Let h = -27 - -26.48. Let j = 118405 - 118405.52021. Let x = j - h. Round x to four dps. -0.0002 Let k = 10259.28 - 10079. Round k to the nearest ten. 180 Let j(n) = -156229n + 458. Let y be j(2). Round y to the nearest one hundred thousand. -300000 Let v(b) = 15524b - 800. Let a be v(-5). Round a to the nearest ten thousand. -80000 Let q = 69.2 - 69.2. Let l = 1.1 - 1.10026. Let z = l + q. Round z to 4 decimal places. -0.0003 Let a = -67 + 69. Let x be ((-4)/10-5)/a. Let r be 2984/6 - x/93. What is r rounded to the nearest one hundred? 500 Let r = 10901.000010874 - 10901. What is r rounded to five decimal places? 0.00001 Suppose -5s - 16 = -2p, -s = -2p - 0s + 8. Suppose 2u = pm - 60003, u + m + 24419 = -5580. Round u to the nearest ten thousand. -30000 Let a = -4.5 - -36. Let n = 23.64 - a. What is n rounded to the nearest integer? -8 Let n(v) = 11v + 90. Let i be n(-8). Suppose 4x = 2d - 2x + 2146, id - 4x + 2150 = 0. What is d rounded to the nearest 10? -1080 Let n = 805 - 826.076. Let l = -0.2045 - -21.2045. Let z = l + n. Round z to 2 decimal places. -0.08 Let y = -63.8 + 136. Let c = -70.8183 + -0.1817. Let r = c + y. What is r rounded to 0 dps? 1 Suppose 2c - k + 6k = -189, -3k - 288 = 3c. Let j = -96 - c. Suppose -5i - j + 10 = -p, 0 = -3p + 2i - 66. What is p rounded to the nearest ten? -20 Let s = 199.1 + 1057.9. Let v = s - 1257.00001053. What is v rounded to 6 decimal places? -0.000011 Let j = 1006.66 + -355.62. Let i = j + -637. What is i rounded to the nearest integer? 14 Let x(q) = 309q3 + 4q*2 + 3q + 2. Let f = -17 - -16. Let r be x(f). What is r rounded to the nearest 100? -300 Let x = 24.48 + -0.98. Let t = x - 23.5257. Let i = t - -0.0257527. What is i rounded to six decimal places? 0.000053 Let h(i) = 3i3 - i2 + 4i + 10. Let k(o) = o*3 + 4o*2 + 0o*3 + 2o*2 - 1 - 2o - 6. Let a be k(-6). Let s be h(a). Round s to the nearest 100. 400 Let w = -4061 - -4068.494. Round w to zero decimal places. 7 Let t = 272362.93399354 + -272363.33. Let v = t - -0.396. What is v rounded to 7 dps? -0.0000065 Suppose 81 - 29 = -26n. Let y be (-475 + -20)/(n/(-80)-1). Round y to the nearest 100000. 0 Let l = 1334 + -3150. Round l to the nearest one hundred. -1800 Let u = 88083419 + -56263419. Round u to the nearest 1000000. 32000000 Let v = -43.72964694641 - 5248100.07055405359. Let f = v + 5248140. Let z = f - -3.8. Round z to 5 dps. -0.0002 Let d = 123557.99 - 124605. Let z = d - -25.01. Let c = z + 1022.000553. What is c rounded to 4 decimal places? 0.0006 Let l = -2.695112 + 2.689. What is l rounded to 4 decimal places? -0.0061 Let q = -1007287.82644 - 173.27356. Let d = 1007461.19199723 + q. Let n = 0.092 - d. What is n rounded to seven dps? 0.00000	{ "pile_set_name": "DM Mathematics" }
alse Does 12 divide 1405435? False Does 1518 divide 863401968? True Is 854 a factor of 3000044704? False Is 69359853 a multiple of 26? False Is 31 a factor of 451045598? True Does 27 divide 251828973? True Is 92 a factor of 310083332? True Does 217 divide 34345588? False Is 32993903 a multiple of 670? False Is 5692665 a multiple of 11? True Is 382 a factor of 21231942? True Is 46883011 a multiple of 180? False Is 24 a factor of 14115199? False Is 4771062 a multiple of 162? True Is 1821656848 a multiple of 16? True Is 121 a factor of 197833163? False Is 253 a factor of 8206835? False Does 458 divide 391003217? False Is 564779726 a multiple of 36? False Is 108 a factor of 30379867? False Does 1017 divide 28166832? True Is 13 a factor of 196110993? True Does 16 divide 1187952720? True Is 247 a factor of 3600568647? True Is 427 a factor of 5510862? True Is 74 a factor of 46462380? True Does 387 divide 1847301543? True Is 1656601536 a multiple of 71? True Is 2972919404 a multiple of 364? True Is 173 a factor of 82139189? True Does 33 divide 399468465? True Is 851015803 a multiple of 457? True Does 52 divide 1850628? True Is 1433427488 a multiple of 38? True Is 214 a factor of 38839018? False Is 3 a factor of 28630719? True Is 158294119 a multiple of 77? False Does 465 divide 104808675? True Does 18 divide 222279008? False Is 87576291 a multiple of 1089? True Is 229 a factor of 26618273? True Is 26 a factor of 22796037? False Is 441499910 a multiple of 13? False Does 6 divide 32679493? False Does 7903 divide 3483640638? False Is 943907220 a multiple of 10? True Is 2270848 a multiple of 261? False Is 1010 a factor of 914764070? True Is 52 a factor of 154020? False Does 540 divide 92006052? False Is 359059320 a multiple of 188? True Is 229128425 a multiple of 1826? False Is 25033084 a multiple of 10? False Is 22 a factor of 4382782? False Does 6342 divide 149861460? True Does 12 divide 147751326? False Is 90860528 a multiple of 176? True Is 5898539 a multiple of 68? False Is 1366496768 a multiple of 5908? True Does 85 divide 62675005? True Does 38 divide 296309484? True Does 181 divide 455835678? False Is 3861576243 a multiple of 65? False Does 27 divide 10584702? True Is 1165 a factor of 9644439? False Is 4339650388 a multiple of 811? False Is 26 a factor of 140741054? False Is 15 a factor of 15352755? True Is 141015002 a multiple of 19? False Does 1369 divide 369621525? False Is 9194580 a multiple of 540? True Is 8 a factor of 396772088? True Is 317833713 a multiple of 584? False Is 203 a factor of 133712165? False Is 618747668 a multiple of 28? True Is 169 a factor of 88198396? True Does 46 divide 24478672? False Is 506 a factor of 334846512? True Is 200 a factor of 38950373? False Is 61 a factor of 96402082? True Is 9241312 a multiple of 7? False Is 49 a factor of 83309917? False Is 39419676 a multiple of 4? True Does 81 divide 1300769032? False Is 6 a factor of 228774678? True Is 5 a factor of 25602874? False Does 43 divide 454361? False Is 1492819090 a multiple of 206? False Is 6230603520 a multiple of 45? True Is 124350265 a multiple of 65? True Is 1290 a factor of 96777631? False Is 22613060 a multiple of 31? False Is 63437570 a multiple of 39? False Is 4 a factor of 809769? False Does 59 divide 420353202? False Does 272 divide 2099152? False Does 19 divide 23265979? False Is 98727394 a multiple of 1296? False Does 4160 divide 151892415? False Is 256088754 a multiple of 9? True Is 99964596 a multiple of 1170? False Is 20691912 a multiple of 263? False Is 160924 a multiple of 3? False Is 31 a factor of 374764668? False Does 21 divide 1111923512? False Is 8 a factor of 1518016168? True Is 596184603 a multiple of 19? True Does 1394 divide 1230256? False Is 3653309 a multiple of 34? False Is 113265908 a multiple of 359? False Is 2637458921 a multiple of 265? False Does 9 divide 1997721709? False Does 4123 divide 18689559? True Is 29 a factor of 178440886? True Is 449 a factor of 3757935? False Is 379 a factor of 3833027595? False Is 304 a factor of 295451824? True Does 6 divide 43566234? True Is 48601148 a multiple of 332? True Is 2185175 a multiple of 10? False Is 570774009 a multiple of 39? True Is 60686076 a multiple of 44? True Is 142 a factor of 113887834? True Does 2 divide 3178259? False Is 52 a factor of 172731728? True Does 9 divide 178301284? False Is 630618265 a multiple of 7809? False Is 14 a factor of 285851553? False Is 6 a factor of 30605823? False Does 49 divide 496654451? False Is 1045506576 a multiple of 24? True Is 713 a factor of 901550895? False Does 82 divide 1486134? False Is 585458920 a multiple of 8? True Does 105 divide 1008198356? False Does 618 divide 1148672274? True Is 2430361 a multiple of 1410? False Is 84 a factor of 18133584? True Does 208 divide 596098464? True Does 589 divide 42639308? False Is 5 a factor of 50631110? True Does 7 divide 79702346? False Does 47 divide 20221327? True Is 532 a factor of 43646486? False Is 109 a factor of 399121882? False Is 339 a factor of 32809124? False Does 43 divide 62793600? False Does 6 divide 456136314? True Is 311 a factor of 149256986? True Is 9 a factor of 3869271? True Is 42 a factor of 1214867562? False Is 1811113459 a multiple of 13? False Is 1708200840 a multiple of 84? False Is 62 a factor of 17287150? True Is 23 a factor of 3614628871? True Is 26 a factor of 13537290? True Is 900 a factor of 34190100? True Is 477 a factor of 103084489? False Is 1733547479 a multiple of 1007? True Is 4961615 a multiple of 12? False Is 2371 a factor of 92144771? False Is 29866954 a multiple of 55? False Does 429 divide 146228969? False Does 1255 divide 583720527? False Is 1247012554 a multiple of 206? True Does 3 divide 954232150? False Does 155 divide 7081020? True Is 5 a factor of 626078415? True Is 572 a factor of 638517880? True Is 159 a factor of 539736849? False Is 989792067 a multiple of 1054? False Is 4019860494 a multiple of 663? True Is 28 a factor of 2427748754? False Is 1831 a factor of 69217619? False Is 110543258 a multiple of 7? True Is 65142944 a multiple of 14? False Is 1713 a factor of 84510855? True Is 3306137933 a multiple of 371? True Does 15 divide 1118639786? False Is 58982343 a multiple of 9? False Is 38375784 a multiple of 71? True Does 136 divide 264786832? True Is 49316162 a multiple of 22? False Is 1251 a factor of 150932670? False Does 13739 divide 5697151130? True Does 547 divide 8497072? False Does 1187 divide 63666634? False Does 336 divide 103014576? True Is 23 a factor of 342617798? True Does 121 divide 3592273168? True Is 39 a factor of 429957411? True Does 57 divide 7381075? False Is 56913691 a multiple of 5? False Is 9 a factor of 449867026? False Is 1445 a factor of 956977260? True Is 68 a factor of 883042656? False Does 351 divide 175208076? False Is 6609 a factor of 2207649088? False Does 295 divide 361669468? False Does 1154 divide 38389067? False Is 1302 a factor of 5887360028? False Does 914 divide 192976476? True Is 33456099 a multiple of 69? True Is 90009260 a multiple of 1436? False Does 888 divide 333770784? True Does 1762 divide 341251826? True Is 1714 a factor of 51525563? False Is 1046184945 a multiple of 1412? False Is 155935166 a multiple of 19? True Is 41 a factor of 8943509600? False Is 881014149 a multiple of 27? False Does 3223 divide 415879015? False Is 190 a factor of 29594780? True Is 7 a factor of 1052880893? False Is 495 a factor of 263229120? True Does 2268 divide 289027116? True Does 171 divide 47892141? True Does 105 divide 5130930? True Is 29 a factor of 194027146? False Is 1054498866 a multiple of 494? False Does 105 divide 38327310? True Does 369 divide 453834945? True Is 68 a factor of 38918872? False Is 4159801 a multiple of 55? False Is 3133071 a multiple of 75? False Does 17 divide 113830962? False Is 53965335 a multiple of 15? True Is 338374440 a multiple of 2685? True Does 13 divide 184295623? False Is 42 a factor of 144041477? False Is 7974535 a multiple of 569? True Is 20399392 a multiple of 416? True Is 40171828 a multiple of 45? False Does 177 divide 24818055? True Is 826592601 a multiple of 16? False Is 34243824 a multiple of 376? True Is 24855179 a multiple of 608? False Is 4 a factor of 845376911? Fal	{ "pile_set_name": "DM Mathematics" }
- 1 Let i(k) = -4k + 11. Let b = 11 + -15. Let g(f) = 4f + 5. Let m(y) = -3y - 3. Let c(o) = -5g(o) - 7m(o). Calculate bi(j) - 11c(j). 5j Let j(h) = -6h - 90. Let c(o) = -4o - 91. Determine 4c(y) - 3j(y). 2y - 94 Let v(w) = 7w2 - 6. Let u(k) be the third derivative of k3/6 + 129k2. Determine -6u(m) - v(m). -7m2 Let r(x) = x2 + 2. Let q = -8 + 6. Let f(p) = -15p*2 - 7p - 6. Let k(v) = -13v2 - 6v - 5. Let t(o) = -6f(o) + 7k(o). Determine qt(l) + r(l). 3l*2 Let o(f) = -393f*2 - 6f + 2. Let x(p) = p*2 + 3p - 2. Determine -o(j) - 2x(j). 391j2 + 2 Let y(s) = -s + 1. Let a(u) = u2 + 6u + 5. Let x be a(-6). Let o(l) = -2 - 2l + xl - 2l. Let q be (0 - (-3)/21) + 44/(-14). What is qy(g) - o(g)? 2g - 1 Let i(v) = 2v2 - 19v - 1. Let a be i(0). Let f(l) = 7l3 + 7l. Let d(g) = 0g3 - g + 0g3 - g3. What is af(r) - 6d(r)? -r*3 - r Let b(v) = -14v*2 + 15v - 4. Let x(r) = -28r2 + 29r - 9. Determine -9b(j) + 4x(j). 14j2 - 19j Let f(l) = l3 + l2 - 2. Let v(r) = 2r3 + 2r2 - 5. Let d(i) = -i3 + 6i2 - 2i - 5. Let x = -46 + 51. Let y be d(x). Calculate yf(h) - 4v(h). 2h3 + 2h*2 Let u(g) = -345g + 2069. Let a be u(6). Let p(f) = -f2 - 1. Let k(i) = -i2 - 3. Suppose 0 = 3w - 4 - 5. Suppose 4n - w = 5. Calculate ak(z) + np(z). -z*2 + 1 Let s(a) = 2 + 2a - 4 - 1 - 5 + 3. Let t be 0 - 1 - (0 + -1). Suppose -2p + 0p - 12 = -2w, t = -5p - 5. Let u(m) = -2m + 4. What is wu(l) + 4s(l)? -2l Let y(c) = 408c3 + 15c*2 - 5c - 5. Let s(t) = -2449t3 - 93t*2 + 31t + 31. Give 5s(p) + 31y(p). 403p3 Let q(d) = -3. Let g(l) = -l - 10. Calculate -g(b) - 3q(b). b + 19 Let t(u) = -2u - 25. Let s(g) = 4g + 26. What is -4s(f) - 5t(f)? -6f + 21 Let g = 44 - 32. Let q be ((-4)/g)/(3/9). Let i(j) = j3 - 2j*2 + 2j + 4. Let x(p) = p3 - p2 + p + 1. What is qi(b) + 2x(b)? b3 - 2 Let c(i) = i + 3. Let y(g) be the second derivative of -g3/3 - 5g2 - 334g + 1. Calculate 7c(t) + 2y(t). 3t + 1 Let p(t) = 16t*3 + 6t*2 - 10t. Let v(w) = 100w2 + 3w - 102w2 + 25w*3 - 30w*3. What is -3p(k) - 10v(k)? 2k*3 + 2k*2 Let p(t) = -9t + 2. Let l(m) = -m*2 + 18m - 5. Calculate 3l(w) + 7p(w). -3w2 - 9w - 1 Let f(l) = 2l + 4. Suppose -4 = 3d - 13. Let w(o) = d + o + 3 - 3. Let n(c) = 2f(c) - 3w(c). Let y(q) = -2q. Determine n(s) + y(s). -s - 1 Let r(u) be the second derivative of -u3/3 + 7u*2/2 - 70u. Let q(y) = -y + 3. What is -7q(z) + 3r(z)? z Let s(a) = 362a - 21. Let h(q) = -73q + 4. Determine 11h(r) + 2s(r). -79r + 2 Let u(v) = 495 - 5v - 164 - 169 - 161 + 3v. Let z(d) = -6d - 2 + 4 + 2d. Calculate -5u(j) + 3z(j). -2j + 1 Let s(a) be the second derivative of -3a2 + 2/3a*3 + 0 - 21a. Let w(y) = -8y + 13. What is -13s(l) - 6w(l)? -4l Let g(z) = 23z + 1 + 14z + 0 - 38z. Suppose -2u = 7 - 1. Let n(w) be the first derivative of w*2/2 - 2w - 2. Determine ug(q) - 2n(q). q + 1 Let a(i) = -i - 9. Let t = 124 - 122. Let v(r) = -r - 4. Determine ta(k) - 5v(k). 3k + 2 Let r(j) = -11j + 9. Suppose -2v - 4k = -22, -5k - 8 = -v - 6k. Let f(q) = 2q - 6q - 6q + 4q + v. Calculate -7f(p) + 4r(p). -2p + 1 Let j = 181 + -65. Let h = j - 167. Let c(n) = -8n - 17. Let g(t) = t + 2. What is hg(r) - 6c(r)? -3r Let i(z) = 14z*3 - 29z - 3 - 12z2 - 6z*2 + 3 + 10z*2. Let s(t) = 5t*3 - 3t*2 - 10t. What is -3i(f) + 8s(f)? -2f3 + 7f Let k(z) = 23z - 108. Let v(o) = 2o - 10. Let y(j) = -4k(j) + 44v(j). Let d(r) = 7r + 3. Let g be d(-2). Let u(w) = -7w - 15. Determine gy(f) + 6u(f). 2f - 2 Let r(h) = 8h + 7. Let n(d) = -19d - 14. What is -3n(f) - 5r(f)? 17f + 7 Let k(s) = 2s + 1. Let w(j) = 3j*2 - 56j + 4. Determine -4k(t) + w(t). 3t*2 - 64t Let k(a) = -39a. Let z(v) be the second derivative of -19v*3/6 - 93v. Give 6k(p) - 13z(p). 13p Let n(x) = 27593x*3 - 205x + 205. Let t(j) = -541j3 + 4j - 4. Determine 4n(u) + 205t(u). -533u3 Let r(o) = 3o + 1. Let b be 4/(-6)1/2-6. Let x(q) = -2q - 1. Give bx(s) + 3r(s). 5s + 1 Let a(b) = -5b3 - 2b*2 - 4b + 2. Let q be -1 - (9 + 2 + -3). Suppose 4x + 16 = -4. Let s = q - x. Let m(d) = -d3 - d2 - d. What is sm(p) + a(p)? -p*3 + 2p2 + 2 Let q(j) = j2 + 3j + 3. Let u(g) = 7 + 6g + 4g + 2g*2 - 3g. Let k(b) = -b - 8. Let i be k(-4). Let c = -12 + 22. What is cq(p) + iu(p)? 2p2 + 2p + 2 Let a(b) = -5b2 - 5b*3 + 4b*2 - 5b*3 + 9b*3 + b + 2b*3. Let c(i) = -5i3 + i2 - 4i - 1. Determine 4a(k) + c(k). -k*3 - 3k*2 - 1 Let b(y) = 3y*3 + 4y*2 - 6. Let u be b(-2). Let j be 5/((-12)/4 - -2). Let p(o) = 7o - 2. Let d(v) = -20v + 6. Calculate jd(w) + up(w). 2w - 2 Let g(d) = 9d3 + 5d*2 - 5d - 5. Let p(m) = 4m3 + 6m - 10705m2 + 6m + 10693m2 - 26m*3 + 12. Determine 12g(x) + 5p(x). -2x*3 Let q(t) = 12t*2 + 17. Let b(l) = 12l*2 + 18. Calculate -6b(g) + 7q(g). 12g*2 + 11 Let v(r) = 14r*3 + 7r*2 + 3r + 10. Let z(q) = 21q3 + 10q*2 + 4q + 14. Give 7v(j) - 5z(j). -7j3 - j2 + j Let t(j) = 13j - 5. Let u be (71/(-5) - (-32)/(-40))-1. Let q = u - 33. Let l(r) = -3r + 1. Determine ql(c) - 4t(c). 2c + 2 Let p(f) = f3 + 36f*2 + 35f - 6. Let j be p(-35). Let a(y) = y*2 - y + 1. Let t(x) = 4x*2 - 7x + 2. What is ja(m) + t(m)? -2m*2 - m - 4 Let j be (-171)/(-72) + (-3)/8. Let x(y) = 3y - 5. Let i(v) = 10v - 16. Let s = -21 - -14. Determine ji(w) + sx(w). -w + 3 Let q(i) = -2i*2 + 3i. Let g(h) = -3h2 + 5h. Let l = -2454 + 2449. Let t be 4/16 - 11/(-4). Give lq(d) + tg(d). d2 Let j(q) = -q2 - 5q + 117. Let m(d) = -4d*2 - 17d + 352. Determine -14j(c) + 4m(c). -2c2 + 2c - 230 Let c(d) = 71d2 + 11d + 5. Let p(g) = 36g2 + 6g + 3. Give 3c(m) - 5p(m). 33m2 + 3m Let p(g) = -7g + 5. Let l(q) = 2q - 3. Let x(k) = -15k + 20. Let c(j) = -35l(j) - 6x(j). What is 3c(u) + 8p(u)? 4u - 5 Suppose 0 = -10q - 253 - 27. Let w(v) = -5v*3 + 7v. Let x(k) = k*3 - k. Give qx(z) - 4w(z). -8z*3 Let u(i) = -2i + 155. Let s(c) = -1. Calculate -2s(r) + u(r). -2r + 157 Let g(s) = 145s - 2. Let y(n) = 72n - 1. What is 3g(m) - 5y(m)? 75m - 1 Let o(p) = 2p*2 - p + 9. Let v(d) = 2d*2 - d + 8. Let x be 67/(-28)(-152)/6. Let n be (-22)/209 + (-224)/x. Give no(c) + 7v(c). 2c*2 - c + 2 Let r(c) = -3c + 2. Let b(a) = 22a - 10. Let o(j) = b(j) + 6r(j). Let l(v) = -5v - 1. Give -5l(k) - 6o(k). k - 7 Let p(n) = 38n*2 - 17n - 12. Let m(o) = 13o2 - 6o - 4. Give -11m(h) + 4p(h). 9h2 - 2h - 4 Let j(o) = -3o2 + 7o. Let a be (-48)/14 + 76/(-133). Let x = 60 + -42. Let y be a/x - (-376)/72. Let t(l) = 2l2 - 5l. Determine yj(c) + 7t(c). -c*2 Let y(b) = -3b*3 - 5b*2 + 12b + 11. Let s(k) = -4k3 - 7k*2 + 18k + 16. Determine -5s(p) + 7y(p). -p*3 - 6p - 3 Let u(y) = 116y. Let w(d) = 37698d. Calculate -976u(b) + 3w(b). -122b Let g(x) = 7x + 6. Suppose 0 = 4w - 36 + 4. Let y be 2/w22. Let n(a) = -17 + a + 9 + 0 + 9. Calculate yg(r) - 6n(r). r Let x(s) = 6s*2 + 0 - 3s - 1 + 6s + 9. Let p(d) = -d2 + d. Let i(t) = 2p(t) - x(t). Let q(a) = -2a2 - 2. Calculate 2i(w) - 9q(w). 2w*2 - 2w + 2 Let u(l) = -5l2 + 1. Let j be (-141)/(-6) + 3/(-2). Suppose 7v + 55 = -j. Let c(x) = -x*2. Calculate vc(m) + 2u(m). m2 + 2 Suppose 0 = 4t + 5g + 25 - 9, t + 25 = 4g. Let h(c) be the third derivative of c*4/24 + 13c*3/6 + 6c*2. Let u(n) = -3. What is tu(v) - 2h(v)? -2v + 1 Suppose z - 3z = -2. Suppose 4d - 2 = 2g, 0 = 4g - 3g - 4d + z. Let b(x) = x. Let s(h) = -4h - 2. Determine gs(j) - 6b(j). -2j + 2 Let j(z) = -9 + 19 - 4z - 10. Let k(m) = 20m. Determine 14j(u) + 3k(u). 4u Let p(z) = z. Let s = -81 + 84. Let d(l) = 5 - 10l - 5 + s - 4. Give 2d(x) + 22p(x). 2x - 2 Let w(s) = -365s*3 - 10s*2 - 24s + 3. Let u(q) = -121q3 - 4q*2 - 9q + 1. Give 8u(l) - 3w(l). 127l3 - 2l*2 - 1 Let t(i) = -i - 4. Let d(b) = 5b - 4. Let g(v) = 9v - 8. Let n(u) = -11d(u) + 6g(u). Calculate 2n(q) - 3t(q). q + 4 Let f(k) = k3 + 2k*2 - 22k - 2. Let a(o) = 2o3. Give 2a(h) - f(h). 3*	{ "pile_set_name": "DM Mathematics" }
- 3ho*3 - ho - 2o3 + 5o*2 + 58 wrt h? -6ho + 928704o*3 What is the third derivative of 156619f*3o*2 - 5f*3o - 9842f2o + 45fo*2 wrt f? 939714o*2 - 30o Find the third derivative of 43129s3 + 38335s2 wrt s. 258774 Find the second derivative of b5 - 7b4 - 7283b*2 - 137788b wrt b. 20b3 - 84b*2 - 14566 Find the second derivative of 123q*2x*2 - 246q*2x - 76221q - x2 wrt q. 246x*2 - 492x Find the first derivative of 204078a2 + 3as2 + 4s*2 - 2861 wrt a. 408156a + 3s2 What is the third derivative of 132br5 - 682br4 + 2br2 - 2r*2 + 1685 wrt r? 7920br2 - 16368br What is the first derivative of 1974l*2o*3 - 60l*2 + 2o*3 + 97o*2 + 31o + 2 wrt l? 3948lo*3 - 120l What is the second derivative of -137rv*2x*2 + rv*2x + 2rvx2y + 2rvx2 - 160rvxy - 9rx2y + 523v2xy wrt v? -274rx2 + 2rx + 1046xy What is the second derivative of -1823g*3z*2 + 3g*3 + 2g*2z*3 + 25gz3 - 3g + 137z3 wrt g? -10938gz2 + 18g + 4z3 Find the second derivative of -158223x*2 + 197290x wrt x. -316446 Find the third derivative of -q*6 + 771q*5 + 32201q*2 wrt q. -120q*3 + 46260q*2 What is the second derivative of 5b*2l*5 - 18311b*2l + 16774bl*5 wrt l? 100b*2l*3 + 335480bl3 What is the first derivative of -732520d*3t + d*3 + 50d*2 + 639 wrt t? -732520d*3 Find the second derivative of 4b*5z - 3289b3z - 10583bz wrt b. 80b3z - 19734bz Find the third derivative of -1053w6 + 2w*5 - 28w*3 + 1776355w*2 wrt w. -126360w*3 + 120w*2 - 168 What is the second derivative of -13034o*2 - 3312o - 6 wrt o? -26068 Find the second derivative of -806l3 - 203l*2 - 6771l + 14 wrt l. -4836l - 406 Find the second derivative of 195s*3 - 1913s*2 - 5021515s. 1170s - 3826 Find the second derivative of 2132308n*3 + 515n - 1313. 12793848n Find the first derivative of 144cv2 + 11cvy*3 + 2cy2 + 2v*2y*3 - 135v*2y*2 + 2v*2y + 3v2 - 285vy3 wrt c. 144v*2 + 11vy3 + 2y*2 Differentiate 94055n*3y*2 - 5n*3 + 5194n with respect to y. 188110n3y What is the first derivative of -5617n2 + 75n - 308475? -11234n + 75 What is the derivative of -558g*2r*2 - 3g*2 - 3gr2 + 45231r*2 wrt g? -1116gr2 - 6g - 3r2 Differentiate -1254851v + 263090. -1254851 Differentiate -119b3s - 56178b3 - 57b*2s with respect to s. -119b3 - 57b*2 Differentiate 160g*3v*4 + 3325g*3v*2 + 1920g*3 - 14g + 4 with respect to v. 640g3v*3 + 6650g*3v Find the third derivative of -12943o3sz3 + 2o*3z*2 - 2o*3z + 24o2sz3 - 6o*2sz + 2osz*2 - 2oz2 + 703sz2 wrt z. -77658o*3s + 144o2s What is the first derivative of -91r2 - 115r + 28648 wrt r? -182r - 115 Find the third derivative of 117312r*6 + 3r*5 - 460618r*2 wrt r. 14077440r*3 + 180r*2 Find the third derivative of -13567a*6 - 11a*4 + 1209374a*2 wrt a. -1628040a*3 - 264a What is the third derivative of -78381p3 - 2p*2 + 15p + 179 wrt p? -470286 What is the second derivative of 4215az*2 - az - 3z + 2320 wrt z? 8430a What is the second derivative of 2u4 - 5120u*3 + 306u + 27 wrt u? 24u2 - 30720u Find the third derivative of 2p5 + 20742p*4 + 28p*2 + 346p. 120p2 + 497808p What is the derivative of -42050ht*3 + h - 714t*3 + 11 wrt h? -42050t*3 + 1 What is the derivative of -2q*3 + 2q*2 - 3576q + 46737 wrt q? -6q2 + 4q - 3576 Differentiate -73553b4 + 189913 wrt b. -294212b*3 Differentiate -35754y*3 - 39563 with respect to y. -107262y*2 Find the second derivative of -358426aw2 - 1448602aw wrt w. -716852a Differentiate -62626x + 149859 wrt x. -62626 What is the second derivative of 16w*4 - 5888w*3 - 2w*2 - 182752w + 5 wrt w? 192w2 - 35328w - 4 Find the first derivative of 611830i - 12354 wrt i. 611830 What is the second derivative of -8r*2y*3 + 1515r*2y*2 - ry*3 + r - 23y wrt r? -16y3 + 3030y*2 Find the third derivative of -487031n*3 + 16n*2 + 164n - 75. -2922186 Differentiate 45020l4 - 449 wrt l. 180080l*3 Differentiate 17555m*2u*3 + 181046m2 - u3 with respect to u. 52665m2u*2 - 3u*2 Find the first derivative of -90gux + 11379gu + 176929gx + 2g + 5 wrt u. -90gx + 11379g Find the first derivative of 3v4 + 823v*2z + 39419z wrt v. 12v*3 + 1646vz What is the second derivative of -110j*3p + 3j3 - 24j*2p - 15j2 - 3jp + 3j + 692p - 9 wrt j? -660jp + 18j - 48p - 30 Find the third derivative of -13t*5 - 268t*4y + 5t2y + 7857t2 wrt t. -780t*2 - 6432ty What is the third derivative of r5 + 21159r*4 - 2r*3 - 8398r*2 + 9r wrt r? 60r2 + 507816r - 12 What is the derivative of 42442a2y2 - a2 + 11072a wrt y? 84884a*2y Differentiate -17911p4 - p + 18992 with respect to p. -71644p*3 - 1 What is the derivative of -1392cl - 11145c + 17l4 wrt l? -1392c + 68l3 What is the second derivative of 37l*3 - 834l*2 + 518l - 25? 222l - 1668 Find the first derivative of -5607v*4 - 10v + 183965. -22428v3 - 10 Find the second derivative of -m2w*2z + 374620m2w*2 + 65mw2z + 3mw*2 + mwz + 9mw - 6mz + 3z wrt m. -2w2z + 749240w2 What is the second derivative of 91108n*3 + 353566n wrt n? 546648n Find the first derivative of 249l*4 - 2l*3 + 14l*2 + 4l + 3413355 wrt l. 996l3 - 6l*2 + 28l + 4 Find the second derivative of 4n4 - 10n*3t - 56n3 - 3nt - 512n - 3t wrt n. 48n*2 - 60nt - 336n What is the derivative of 2r3v*2 + 2r*3 + 10r*2 - 1399v*2 + 100 wrt v? 4r*3v - 2798v Find the third derivative of 104241c*3 - 137531c*2 wrt c. 625446 Find the third derivative of -12464doz*3 - 14doz*2 + 3do + 52dz + d + 10o*2z3 - o2 wrt z. -74784do + 60o2 Find the first derivative of 67b*4 - 17b*3f - bf - 9b + 4f + 39780 wrt b. 268b*3 - 51b*2f - f - 9 Find the third derivative of -4c3g*3 - 2004c*3g*2 + 11c*3 + 664c*2g*3 + 16cg3 + 5cg wrt c. -24g*3 - 12024g*2 + 66 Find the second derivative of 6413c*4 - 39c3 + c2 + 36747c + 7 wrt c. 76956c*2 - 234c + 2 What is the second derivative of -128426au*4 - 9au2 + 2au + 20a - 19643u wrt u? -1541112au2 - 18a Find the second derivative of -81922f3 - 246141f. -491532f What is the third derivative of 4114f*5 - 55f*3 + 2074f*2 - 76? 246840f*2 - 330 What is the second derivative of 36527u*2 - 21363u wrt u? 73054 What is the derivative of 5bntv*2 + 104btv*2 + 8btv + bt - 3ntv - 1481nv*2 - 5tv wrt n? 5btv*2 - 3tv - 1481v*2 Find the second derivative of -573271k*2 + 771k - 349 wrt k. -1146542 Find the third derivative of -1347047u4 - 965713u*2. -32329128u Find the third derivative of 204o4 - 2227o*3 + 73o*2 + 6o + 254 wrt o. 4896o - 13362 Find the first derivative of -121846j*3 + 375855. -365538j*2 What is the second derivative of 1286869l*3 + 6l + 54960 wrt l? 7721214l What is the third derivative of 2a*3n*3 + 2a*3 + 253a*2n*3 + 15a*2n + 17302a + 552n3 - n2 - n wrt n? 12a3 + 1518a*2 + 3312 What is the third derivative of 61f*2n*3 + 2f*2n*2 + fn*2 - 1875n*3 + 9n + 1568 wrt n? 366f2 - 11250 What is the first derivative of 252283v*2 + 1100440 wrt v? 504566v Find the second derivative of -4797792t5 + 5362793t wrt t. -95955840t3 What is the third derivative of 34849a*6 - 2a*2 - 2a - 35142 wrt a? 4181880a3 What is the second derivative of 6m*2u*2 + 35m*2 + 25544mu2 + 727mu + m - 2u + 5 wrt u? 12m2 + 51088m Find the second derivative of 23426w4 + 2w*2 - 7546w - 3 wrt w. 281112w2 + 4 Find the third derivative of -188b*3p*2 - 282b*3 - 654b*2p2 + b2p - 13b wrt b. -1128p2 - 1692 Find the third derivative of 35282f*2w5 + f2w2 + f2w + fw2 + w5 - 731 wrt w. 2116920f*2w*2 + 60w*2 What is the third derivative of -203446d5 - d2 + d - 344612? -12206760d*2 Fi	{ "pile_set_name": "DM Mathematics" }
-111/20. 4460 What is the smallest common multiple of 126 and 558? 3906 Calculate the common denominator of 67/108 and -121/24. 216 Calculate the common denominator of 49/1976 and -75/104. 1976 Calculate the common denominator of 59/123 and -187/30. 1230 Calculate the common denominator of -65/266 and 49/5. 1330 What is the least common multiple of 7 and 146? 1022 Calculate the least common multiple of 82 and 20. 820 What is the common denominator of 49/15 and 43/141? 705 What is the common denominator of -67/42 and 101/102? 714 What is the smallest common multiple of 8 and 1038? 4152 Calculate the smallest common multiple of 121 and 22. 242 Find the common denominator of -41/19 and -12/67. 1273 Calculate the common denominator of 155/264 and 115/1344. 14784 Find the common denominator of -89/14 and -95/522. 3654 Calculate the lowest common multiple of 7 and 73. 511 Find the common denominator of 149/12 and -3/28. 84 Calculate the smallest common multiple of 116 and 36. 1044 What is the smallest common multiple of 30 and 3714? 18570 What is the common denominator of 32/3 and -101/12? 12 Calculate the lowest common multiple of 5010 and 2004. 10020 Calculate the lowest common multiple of 6 and 54. 54 Calculate the common denominator of 79/12 and -41/16. 48 What is the least common multiple of 709 and 2? 1418 Calculate the least common multiple of 12 and 320. 960 What is the common denominator of 61/63 and 5/6? 126 Calculate the least common multiple of 11 and 4. 44 Find the common denominator of 68/99 and 181/30. 990 Find the common denominator of -31/40 and 71/72. 360 What is the least common multiple of 14 and 14? 14 What is the common denominator of -48/199 and 13/3? 597 What is the common denominator of -25/138 and 17/161? 966 What is the common denominator of -37/336 and 103/2376? 33264 Calculate the lowest common multiple of 16 and 2860. 11440 What is the least common multiple of 4174 and 4? 8348 What is the common denominator of -83/758 and -83/16? 6064 What is the common denominator of -49/69 and -67/696? 16008 What is the least common multiple of 904 and 24? 2712 What is the common denominator of -107/528 and 61/672? 7392 What is the smallest common multiple of 60 and 600? 600 What is the common denominator of -37/5436 and -67/3624? 10872 Calculate the common denominator of -57/82 and -58/123. 246 What is the common denominator of 43/28 and -59/336? 336 Find the common denominator of -3/80 and 137/18. 720 Calculate the common denominator of 103/22 and -97/22. 22 Calculate the least common multiple of 2 and 78. 78 Find the common denominator of -3/28 and 123/140. 140 What is the lowest common multiple of 24 and 153? 1224 What is the lowest common multiple of 184 and 4? 184 What is the least common multiple of 2970 and 40? 11880 Find the common denominator of 89/56 and -145/714. 2856 Calculate the common denominator of 85/458 and -89/2. 458 What is the common denominator of 4 and -17/101? 101 Calculate the smallest common multiple of 322 and 460. 3220 What is the smallest common multiple of 785 and 628? 3140 What is the common denominator of -191/990 and 59/30? 990 What is the smallest common multiple of 39 and 87? 1131 Calculate the least common multiple of 360 and 495. 3960 Find the common denominator of 107/168 and 91/60. 840 Calculate the lowest common multiple of 812 and 98. 5684 What is the common denominator of -75/2068 and 7/88? 4136 Calculate the lowest common multiple of 74 and 18. 666 Calculate the lowest common multiple of 16 and 308. 1232 Find the common denominator of -71/54 and 26/243. 486 Find the common denominator of 101/2460 and 35/2706. 27060 Calculate the least common multiple of 4182 and 246. 4182 Calculate the lowest common multiple of 4 and 172. 172 Calculate the common denominator of -49/54 and 97/48. 432 What is the least common multiple of 4360 and 24? 13080 What is the common denominator of 25/4 and 43/46? 92 Calculate the least common multiple of 60 and 5076. 25380 Find the common denominator of -107/1218 and 24/203. 1218 What is the lowest common multiple of 7488 and 1152? 14976 What is the smallest common multiple of 6 and 543? 1086 Calculate the lowest common multiple of 4004 and 1232. 16016 Calculate the common denominator of 47/5187 and 14/15. 25935 What is the smallest common multiple of 170 and 51? 510 What is the smallest common multiple of 12 and 522? 1044 What is the common denominator of 43/2144 and -65/2412? 19296 What is the common denominator of 17/710 and 91/4? 1420 Calculate the least common multiple of 88 and 264. 264 What is the lowest common multiple of 1 and 14? 14 What is the lowest common multiple of 645 and 30? 1290 What is the common denominator of 35/24762 and -123/20? 247620 What is the least common multiple of 2030 and 1160? 8120 What is the common denominator of 4/3245 and 69/50? 32450 What is the least common multiple of 2642 and 11? 29062 Find the common denominator of -31/50 and -24/5. 50 Find the common denominator of 37/14 and -5/7. 14 What is the lowest common multiple of 2085 and 1112? 16680 Calculate the common denominator of -67/160 and 17/160. 160 Calculate the smallest common multiple of 6 and 7. 42 Find the common denominator of -31/329 and -15. 329 Calculate the common denominator of -3 and -69/1358. 1358 What is the least common multiple of 14 and 16196? 113372 What is the least common multiple of 174 and 8? 696 Find the common denominator of 71/1224 and 67/648. 11016 What is the smallest common multiple of 20 and 158? 1580 Calculate the least common multiple of 550 and 715. 7150 Calculate the smallest common multiple of 1800 and 96. 7200 What is the common denominator of 89/10 and 47/15? 30 What is the common denominator of 42/13 and -35/9? 117 What is the least common multiple of 2 and 312? 312 What is the common denominator of -53/4 and -23/11? 44 Find the common denominator of 50/7 and 19/27. 189 Calculate the least common multiple of 3 and 12. 12 What is the smallest common multiple of 60 and 132? 660 What is the lowest common multiple of 4 and 77? 308 Find the common denominator of 95/24 and -103/834. 3336 What is the common denominator of 107/440 and -7/180? 3960 Calculate the common denominator of -25/66 and -39/176. 528 Calculate the smallest common multiple of 150 and 165. 1650 Calculate the common denominator of 5/392 and -5/196. 392 What is the least common multiple of 242 and 11? 242 What is the smallest common multiple of 2310 and 630? 6930 What is the common denominator of 53/1710 and 43/22? 18810 Calculate the common denominator of 91/36 and -2/81. 324 Calculate the lowest common multiple of 1304 and 1304. 1304 Calculate the common denominator of 17/56 and -95/294. 1176 Find the common denominator of -97/12 and 37/192. 192 Calculate the smallest common multiple of 128 and 18. 1152 What is the lowest common multiple of 96 and 164? 3936 Calculate the least common multiple of 615 and 615. 615 What is the lowest common multiple of 2244 and 6? 2244 What is the lowest common multiple of 760 and 120? 2280 What is the common denominator of -101/2940 and 37/490? 2940 Calculate the common denominator of -47/14 and 68/117. 1638 What is the common denominator of 29/24 and 37/256? 768 What is the smallest common multiple of 70 and 25? 350 What is the least common multiple of 48 and 732? 2928 Calculate the lowest common multiple of 40 and 2. 40 What is the common denominator of 77/1836 and 119/108? 1836 Find the common denominator of -67/1540 and -41/840. 9240 What is the common denominator of -13/64 and -61/8? 64 What is the common denominator of -33/32 and -137/240? 480 Calculate the lowest common multiple of 45 and 45. 45 What is the least common multiple of 6 and 222? 222 Find the common denominator of 179/30 and -53/147. 1470 Calculate the smallest common multiple of 288 and 240. 1440 What is the common denominator of 71/9424 and -83/10? 47120 What is the common denominator of -47/12 and -1/260? 780 Calculate the common denominator of 37/171 and -28/81. 1539 Calculate the smallest common multiple of 48 and 80. 240 Calculate the lowest common multiple of 8 and 2. 8 Find the common denominator of 103/112 and -33/208. 1456 Calculate the common denominator of 4	{ "pile_set_name": "DM Mathematics" }
n 345187901n3 + 7n*2 - 345187902n*3 - 7n2. -n3 Collect the terms in 15870899r - 241r*2 - 15870899r. -241r2 Collect the terms in -18164512v*3 + 36328958v*3 - 18164478v*3. -32v*3 Collect the terms in 39 + 18 + 9 + 21s + 35 - 3. 21s + 98 Collect the terms in 617d - 5d2 + 148d - 765d + 1. -5d*2 + 1 Collect the terms in -74 + 20 + 26 - 2275s + 21. -2275s - 7 Collect the terms in -6p*2 + 503p*3 - 257 + 2p*2 - 501p*3 - 45. 2p*3 - 4p*2 - 302 Collect the terms in -5730620o*3 - 5730644o*3 + 11461263o3. -o3 Collect the terms in -l*2 - 107 + 108l - 338l + 230l. -l*2 - 107 Collect the terms in -3710g - 3702g + 11113g + 33g2 - 3703g - 15g3. -15g*3 + 33g*2 - 2g Collect the terms in -12n2 - n3 + 2 + 7 - 13n*3 - 47n*2. -14n*3 - 59n*2 + 9 Collect the terms in 3z - 10z - 244 - 2z + 296. -9z + 52 Collect the terms in -16y - 50y + 15y*2 + 82y - 12y - 16y2. -y2 + 4y Collect the terms in 153933i*2 - 307829i*2 + 153895i2. -i2 Collect the terms in -65724 - 73l3 + 65724 + 893l*3 - 462l*3. 358l*3 Collect the terms in 6190576t - 35 + 68 - 33 - 6190580t. -4t Collect the terms in 36713756r + 36713919r - 73426610r. 1065r Collect the terms in 11999v2 + 12028v*2 - 23918v*2 + v - 4v. 109v2 - 3v Collect the terms in -94032q + 607416q + 316184q. 829568q Collect the terms in -2 - 5t + 2t*2 + 256t + 262t. 2t*2 + 513t - 2 Collect the terms in 6361r3 + 6047r*3 - 12359r*3. 49r*3 Collect the terms in -2301488r*3 - 1891306r*3 + 1666697r*3. -2526097r*3 Collect the terms in -1230 - 1227 - 1224 + 4905 - 1225 - 865d. -865d - 1 Collect the terms in 5466h*2 + 5790h*2 - 10130h*2. 1126h*2 Collect the terms in -687045v + 343530v + 343519v. 4v Collect the terms in -10q*2 + 5118646q - 11q3 - 5118646q. -11q3 - 10q*2 Collect the terms in -7y*2 + 62118937205050y*3 + 7y*2 - 62118937205053y*3. -3y*3 Collect the terms in 2r*2 - 841857r + 1685759r - 843902r. 2r2 Collect the terms in -111211d*3 + 194447d*3 + 226379d*3 - 16725d*3. 292890d*3 Collect the terms in -655j*3 - 153j + 43j - 57j. -655j3 - 167j Collect the terms in 2m2 - 8039 - 10029 + 2854. 2m*2 - 15214 Collect the terms in -175g - 1624g - 340g + 39g - 5g*2. -5g*2 - 2100g Collect the terms in 111w2 + 90w*3 + 78w*3 + 101w*3 + 100w*2 - 213w*2. 269w*3 - 2w*2 Collect the terms in 435v - 12 + 12 - 1517v2 - 435v. -1517v2 Collect the terms in 3 - 50555p - 4 + 49795p + 1. -760p Collect the terms in -566 - 32p - 569 - 540 + 2266 + 29p - 591. -3p Collect the terms in -1560b - 1305b + 446b - 440b. -2859b Collect the terms in -189659 + 3m + 94764 - m + 94874. 2m - 21 Collect the terms in 6390g - 12779g + 12 + 6389g - 11g*3. -11g*3 + 12 Collect the terms in -56f*3 + 183f*3 - 3f*2 - 119f*3 - 2f*2 + 5f*2. 8f*3 Collect the terms in -562r*2 + 7841248r - 7841248r - 740r*2. -1302r*2 Collect the terms in -157b + 265b - 2b*2 - 209b*3 + 2b*2 - 317b*3. -526b*3 + 108b Collect the terms in -994s - 971s + 3960s - 1003s - 992s - 24s*2. -24s*2 Collect the terms in -757a*2 - 13a*3 + 0a*3 + 21a*3 - 6a*3. 2a*3 - 757a*2 Collect the terms in 66g - 34g - 138g + 78g. -28g Collect the terms in 1670q2 + 139 - 2q - 141 + 16681q2. 18351q*2 - 2q - 2 Collect the terms in -40x - 109x + 71x - 203x - 207x. -488x Collect the terms in 47z - 105z*2 - 85z + 33z + 5z + 559z2. 454z*2 Collect the terms in 4730m - 4292m - m3 + 0m3. -m3 + 438m Collect the terms in -1237t + 4965t - 1239t - 3 - 1246t - 1240t. 3t - 3 Collect the terms in 2562080 - 2562080 - 67m*3. -67m*3 Collect the terms in -17742 + 17718 - 20b - 13b. -33b - 24 Collect the terms in -3807x + 11960x - 2618x - 3868x. 1667x Collect the terms in 66d*2 - 90d*3 + 174d*3 - 125d*2 + 59d*2 - 97d*3. -13d*3 Collect the terms in 2 - 130439q + 18565q - 2. -111874q Collect the terms in -361m + 2 - 106m - 126m - 2 + 75m. -518m Collect the terms in -49141i*3 + 1 + 10845i*3 - 1. -38296i*3 Collect the terms in 80468483d*3 - 160936961d*3 + 80468481d*3. 3d*3 Collect the terms in -3 + 0 - 221926f*2 + 221926f*2 + 3 - 2f - 2f3. -2f*3 - 2f Collect the terms in 8c3 - 30c*3 - 24933 + 24933 - 59c*3. -81c*3 Collect the terms in 2130k*3 - 2128k*3 - 689 + 92k + 693. 2k3 + 92k + 4 Collect the terms in -204i3 - 80542 - i + 80542 + 240i*3. 36i*3 - i Collect the terms in 102238l*3 + 102242l*3 - 195l - 204482l3. -2l*3 - 195l Collect the terms in -12312 - 5j + 2j + 13050 + 87163. -3j + 87901 Collect the terms in 42t + 19t - 112t + 69t + 82t - 11t. 89t Collect the terms in 60 - 58 + 1662j + 1583j + 156j. 3401j + 2 Collect the terms in 15569929z - 7784969z - 7784966z. -6z Collect the terms in 9 + 1 + 20k - 33k - 513k2 + 11k - 10. -513k2 - 2k Collect the terms in 1997z + 198z + 3735z + 3048z. 8978z Collect the terms in -175k*2 - 104287k + 52143k + 52144k. -175k2 Collect the terms in 4633980208 - 4633980208 + 387o*3. 387o*3 Collect the terms in 879y*2 - 3501y*2 + 895y*2 + 878y*2 + 873y*2. 24y*2 Collect the terms in 91 + 59 - 323 + 468b + 83 + 90. 468b Collect the terms in 4 - 7 - 387r*2 - 948r*2 + 2. -1335r*2 - 1 Collect the terms in 10a*2 + 48 - 83 + 35 - 4a*2. 6a*2 Collect the terms in -39s + 216s2 - 22s*2 - 55s - 38s + 181s - 43s. 194s*2 + 6s Collect the terms in 100k2 + 2 - 138k*2 + 139k*2 + 247k*2. 348k*2 + 2 Collect the terms in 196 + 7n*2 + 4n*3 + 4n*2 - 3n*3 - 11n2 - 517. n3 - 321 Collect the terms in 15254788x - 15254788x + x3. x3 Collect the terms in 4482m + 1415m + 2393m + 160m. 8450m Collect the terms in 1065 + 67516z - 1065. 67516z Collect the terms in 2076z*3 - 28z*3 - 2044z*3 - 31z*3. -27z*3 Collect the terms in y - y + 392y*2 + 1718y*2 + 3 - 11y*3. -11y*3 + 2110y*2 + 3 Collect the terms in -1239l*2 + 2570l - 1255l2 - 1272l - 1297l. -2494l*2 + l Collect the terms in 160 - 160 - 17450p*2 + 17420p*2. -30p*2 Collect the terms in 52p - 17p + 26p - 28p2 + 35. -28p*2 + 61p + 35 Collect the terms in -2442j3 - 3189 + 3189 + 807j*3 + 814j*3 + 818j*3. -3j*3 Collect the terms in -64c*2 + 9 - 9 - 424c - 423c + 847c. -64c2 Collect the terms in 0 - 62n*2 - 238n + 237n + 0. -62n*2 - n Collect the terms in -195d - 58d - 8 + 6 + 111d. -142d - 2 Collect the terms in 16663621854 + 486v*2 - 16663621854. 486v*2 Collect the terms in 203465u*3 - 407013u*3 + 203490u*3. -58u*3 Collect the terms in 17055 + 13j + 34508 - 10j - 6j. -3j + 51563 Collect the terms in 49728m + 49727m + 49727m + 49719m + 49729m - 248628m. 2m Collect the terms in 20y - 250y*2 + 1547y*3 + 250y*2 + 2y. 1547y3 + 22y Collect the terms in -12r - 9r + 18r + 10r*2 - 7r + 0r2 + r + 7r. 10r2 - 2r Collect the terms in -75097i - 75099i + 225288i - 75092i - 2i3 + 6i*3. 4i*3 Collect the terms in -277414994901503h + 2h2 + 277414994901503h. 2h2 Collect the terms in -380i - 631i + 204i - 60i. -867i Collect the terms in -295g2 + 5g + 1135g2 - 301g*2 - 293g*2 - 245g2. g2 + 5g Collect the terms in -23 - m2 - m2 + 154 + 4m*2 + 741 + 96. 2m*2 + 968 Collect the terms in -2 - 935630447w + 9 + 935630449w. 2w + 7 Collect the terms in -271636w3 + 90545w*3 + 90542w*3 + 90548w3. -w3 Collect the terms in -37n2 - 527n + 1014n + 22n*2 - 490n. -15n2 - 3n Collect the terms in 1034v3 + 2099v*3 + 300v*3. 3433v*3 Collect the terms in -713081266 - 8y + 2y + 713081266. -6y Collect the terms in 6871x - 13365x + 6473x. -21x Collect the terms in -5068c + 7837c - 5059c + 2277c. -13c Collect the terms in -5973w*2 - 137113w*2 - 239444w*2. -382530w*2 Collect the terms in -181 + 3m + 819 - 93 - 180 - 192 - 173. 3m Collect the terms in 47d - 2475 + 42d - 89d + 7d2. 7d*2 - 2475 Collect the terms in -14z**3 - 1	{ "pile_set_name": "DM Mathematics" }
of picking 1 a and 1 p when two letters picked without replacement from vplplpvpljppavlp? 7/120 Calculate prob of picking 1 a, 1 f, and 1 w when three letters picked without replacement from {f: 1, r: 1, t: 2, a: 2, w: 1, j: 1}. 1/28 Two letters picked without replacement from ltiiiilwpiitliiwi. What is prob of picking 1 p and 1 l? 3/136 Calculate prob of picking 3 s when three letters picked without replacement from bbsssbsbbbbbssbsss. 7/68 Three letters picked without replacement from {k: 2, u: 2, m: 9}. Give prob of picking 1 m and 2 k. 9/286 Three letters picked without replacement from wuucuwcuuccuuu. Give prob of picking 3 u. 2/13 What is prob of picking 1 x and 1 k when two letters picked without replacement from {u: 5, x: 8, k: 3}? 1/5 Three letters picked without replacement from {l: 5}. Give prob of picking 3 l. 1 Three letters picked without replacement from eeeueeueueee. Give prob of picking 2 u and 1 e. 27/220 What is prob of picking 1 a and 1 c when two letters picked without replacement from {a: 3, c: 4}? 4/7 Three letters picked without replacement from ttte. Give prob of picking 3 t. 1/4 Calculate prob of picking 4 t when four letters picked without replacement from {a: 7, t: 4}. 1/330 Three letters picked without replacement from qqniss. Give prob of picking 1 q and 2 s. 1/10 Two letters picked without replacement from {c: 2, s: 11, v: 2}. Give prob of picking 1 c and 1 v. 4/105 Calculate prob of picking 1 f and 3 t when four letters picked without replacement from {t: 12, g: 1, f: 3}. 33/91 Three letters picked without replacement from {m: 9, j: 2}. Give prob of picking 3 m. 28/55 Calculate prob of picking 3 t when three letters picked without replacement from ttttjj. 1/5 Four letters picked without replacement from {t: 5, y: 3, v: 3}. What is prob of picking 1 t and 3 y? 1/66 What is prob of picking 1 w and 3 o when four letters picked without replacement from ooooowoooow? 28/55 Calculate prob of picking 1 d and 1 o when two letters picked without replacement from {d: 3, e: 2, b: 1, a: 5, m: 7, o: 2}. 3/95 Calculate prob of picking 1 q, 1 y, 1 v, and 1 f when four letters picked without replacement from vqnnynqqyfnyyqyq. 5/364 Three letters picked without replacement from vvqqqvvvqqqqv. Give prob of picking 3 q. 35/286 Two letters picked without replacement from {k: 3, d: 4}. Give prob of picking 1 k and 1 d. 4/7 Three letters picked without replacement from asssgggvsgsss. Give prob of picking 1 a and 2 g. 3/143 Four letters picked without replacement from {j: 10, r: 2}. What is prob of picking 2 r and 2 j? 1/11 Three letters picked without replacement from {c: 1, o: 3}. What is prob of picking 3 o? 1/4 What is prob of picking 1 o, 1 y, and 1 a when three letters picked without replacement from {a: 8, z: 1, u: 4, y: 3, o: 1}? 3/85 Calculate prob of picking 2 e and 1 f when three letters picked without replacement from {p: 7, f: 4, e: 2}. 2/143 Two letters picked without replacement from {q: 1, x: 9, m: 1, r: 4, p: 2}. What is prob of picking 1 x and 1 q? 9/136 What is prob of picking 2 e when two letters picked without replacement from llleeeleeelelleellel? 9/38 Calculate prob of picking 1 w and 1 q when two letters picked without replacement from zzzxkzzzzzzxqzzxzqwz. 1/95 What is prob of picking 1 j, 1 d, and 1 y when three letters picked without replacement from hjghdhyjddghdhgg? 1/70 Three letters picked without replacement from aaaa. What is prob of picking 3 a? 1 Three letters picked without replacement from emeemue. What is prob of picking 1 m, 1 e, and 1 u? 8/35 Calculate prob of picking 2 x and 1 g when three letters picked without replacement from {m: 1, g: 1, s: 1, n: 2, x: 2, h: 2}. 1/84 Calculate prob of picking 1 h and 1 p when two letters picked without replacement from {p: 1, h: 2, j: 4, u: 1}. 1/14 Calculate prob of picking 1 g and 1 v when two letters picked without replacement from {v: 12, g: 7}. 28/57 What is prob of picking 1 c and 3 n when four letters picked without replacement from {n: 5, c: 3}? 3/7 What is prob of picking 1 q and 1 f when two letters picked without replacement from {f: 4, u: 6, z: 2, q: 1, r: 3}? 1/30 Two letters picked without replacement from iiiiii. What is prob of picking 2 i? 1 Four letters picked without replacement from {e: 3, n: 1, p: 2, o: 2, l: 1, k: 8}. Give prob of picking 2 o and 2 k. 1/85 Two letters picked without replacement from xxbxxxbxxxxxbxxxbx. What is prob of picking 2 b? 2/51 Two letters picked without replacement from {q: 1, r: 1, u: 3, g: 7, f: 4}. What is prob of picking 2 r? 0 Two letters picked without replacement from {j: 2, s: 2, o: 1}. Give prob of picking 1 o and 1 j. 1/5 Two letters picked without replacement from jzzujunjjo. Give prob of picking 2 u. 1/45 Calculate prob of picking 1 s and 1 f when two letters picked without replacement from {d: 8, e: 1, f: 2, x: 1, s: 6}. 4/51 Three letters picked without replacement from {t: 2, q: 5, a: 5}. Give prob of picking 2 q and 1 t. 1/11 Three letters picked without replacement from {w: 3, b: 6, t: 2, i: 2}. What is prob of picking 1 b and 2 w? 9/143 What is prob of picking 1 t and 1 m when two letters picked without replacement from {m: 1, t: 2}? 2/3 Calculate prob of picking 2 c when two letters picked without replacement from {u: 12, c: 7}. 7/57 What is prob of picking 1 b and 3 f when four letters picked without replacement from mbbbbmfmffmmffffmff? 28/323 Two letters picked without replacement from zzdbzfgzazgzdz. Give prob of picking 1 b and 1 g. 2/91 Three letters picked without replacement from {d: 2, o: 5, q: 2, t: 1, h: 6}. What is prob of picking 1 o and 2 d? 1/112 What is prob of picking 1 j and 1 f when two letters picked without replacement from ljjlljllflllljffflf? 20/171 Four letters picked without replacement from qeqttqqfftqefeeqtfte. Give prob of picking 3 e and 1 f. 8/969 Calculate prob of picking 2 x and 1 r when three letters picked without replacement from {r: 5, x: 4, u: 10}. 10/323 What is prob of picking 1 j and 2 v when three letters picked without replacement from {j: 17, v: 2}? 1/57 What is prob of picking 1 p and 3 j when four letters picked without replacement from jkkjckvkjkkp? 1/495 Two letters picked without replacement from aararrjarjrrjr. Give prob of picking 1 r and 1 j. 3/13 Two letters picked without replacement from ggqgqggg. Give prob of picking 1 q and 1 g. 3/7 Calculate prob of picking 1 q, 2 c, and 1 p when four letters picked without replacement from bccprcrcrcrcpccqr. 2/85 Two letters picked without replacement from {p: 1, s: 1, j: 1, x: 1, v: 2, d: 1}. Give prob of picking 2 v. 1/21 What is prob of picking 1 e and 2 j when three letters picked without replacement from ygyyyjjjeyyjyjj? 3/91 What is prob of picking 1 v and 1 p when two letters picked without replacement from {x: 3, p: 3, v: 7}? 7/26 Two letters picked without replacement from dddfff. What is prob of picking 1 d and 1 f? 3/5 What is prob of picking 2 u and 1 a when three letters picked without replacement from luauuujejuuqajj? 6/91 Calculate prob of picking 1 b and 1 c when two letters picked without replacement from {b: 1, c: 1, o: 2, m: 1, x: 1, s: 1}. 1/21 Four letters picked without replacement from {h: 8, o: 5, l: 5}. What is prob of picking 1 l and 3 h? 14/153 Three letters picked without replacement from {f: 1, o: 3, s: 2, z: 1}. What is prob of picking 1 s, 1 f, and 1 o? 6/35 Calculate prob of picking 3 k when three letters picked without replacement from kukkkukukukuuuuukkk. 40/323 What is prob of picking 1 t and 1 i when two letters picked without replacement from itiwiqwiqt? 8/45 Two letters picked without replacement from vxvxv. Give prob of picking 2 v. 3/10 Three letters picked without replacement from {q: 4, g: 2, l: 4, k: 1, r: 5}. What is prob of picking 3 l? 1/140 Two letters picked without replacement from {l: 4}. What is prob of picking 2 l? 1 Calculate prob of picking 3 u and 1 i when four letters picked without replacement from {i: 2, u: 7}. 5/9 Two letters picked without replacement from mcccmqcq. What is prob of picking 2 m? 1/28 What is prob of picking 1 b and 2 k when three letters picked without replacement from kbbrrkbrr? 1/28 What is prob of picking 1 x and 1 j w	{ "pile_set_name": "DM Mathematics" }
+ 5q = 10. Suppose 2f - 30 = -3f - qj, j = 4f - 29. Suppose 0 = -2m - 4s - 2, 3m = -2m + 4s + 23. Solve f = mi + 19 for i. -4 Let n be 3/(84/8)7. Suppose -np + 5v - 4 = -0p, 2v = 4p - 8. Solve -pu - u + 16 = 0 for u. 4 Let s = -6 - -3. Let o be (-2)/2(-6)/(-2). Let d = o - s. Solve d = -c + 2c for c. 0 Let g(x) = x*3 + 4x*2 + 3x. Let i be g(-3). Suppose -2 = a - 12. Suppose 0c + 5c - a = i. Solve -5y = 12 - c for y. -2 Let n(c) = -c - 2. Let m be n(-4). Let d(k) = -5 - k + 4 + 4k. Let h be d(m). Solve -i - 1 + h = 0 for i. 4 Suppose -5 + 2 = -5o + 3p, 0 = -3o + 3p + 3. Suppose -3a + oa = -15. Solve 6k + a = k for k. -1 Let c be 4-515/(-100). Solve 0x - c = -x for x. 3 Suppose 3m = -0m - 9. Let i = 3 + m. Solve -6o + 5o + 4 = i for o. 4 Suppose 0 = -5t + 6 + 4. Solve -tg = -10 - 0 for g. 5 Suppose 143 = 5v + 2m, 3v + 53 = 5v + 5m. Suppose -5z = -4w, -10 = 2z - 4w + 2. Solve -zr + v = 9 for r. 5 Let j be 0-2(-2)/4. Suppose 3o = 3x + 12, 0 - 16 = 4o + 4x. Suppose 5t = -ot + 10. Solve -tw - 8 = -j for w. -4 Let n = 2 + 5. Suppose n = 5s - 8. Solve -m = -sm for m. 0 Suppose -11v + 6 = -9v. Solve 0 = -vo - o + 16 for o. 4 Let c be (1 + (1 - 2))/2. Solve c = 2z + 6 for z. -3 Let h(p) = -p3 + 3p*2 - 2p + 3. Let r be h(2). Suppose -11 = -rz - 5. Solve 0 = -za + 10 - 2 for a. 4 Suppose 0d - 1 = -d. Solve -2g + 7 = d for g. 3 Suppose 10 = -2r, 3r + 4 + 1 = -2i. Let g = 2 - -13. Suppose g = 7d - 2d. Solve -dx - i = 4 for x. -3 Suppose -2v - 15 = -5v. Suppose 5 = vc - 5. Solve 3t + c = -4 for t. -2 Let g be -5 + (-2)/(-6)3. Let v(y) = 15y - 19. Let w(k) = 8k - 10. Let b(t) = -6v(t) + 11w(t). Let m be b(g). Solve 0 = 2f + f - m for f. 4 Let p(m) = -m*3 - 9m*2 - m - 8. Let j be p(-9). Let a(c) = 2c*2 + c - 1. Let b be a(j). Solve b = -3l - 4 for l. -2 Let s = 5 - 7. Let r be s/(-1) - -1 - -16. Let h = -4 + r. Solve -3q - h = 2q for q. -3 Suppose -2p - v + 8 = -0v, 4p - 6 = 3v. Suppose -4x - 1 + 3 = -2b, 5x = -b + 20. Solve x = pc - 4c for c. -3 Let m(y) = y2 - 9y + 2. Let x(j) = j*3 - 2j*2 - 6j + 1. Let r be x(4). Let u be m(r). Solve 5 - 3 = uf for f. 1 Suppose -5n - 6a + a = 20, 0 = -5n - 4a - 16. Solve 3p + 2p - 25 = n for p. 5 Let i(l) = l3 + 2l*2 - 2l - 3. Let w be i(-2). Let u be -7(-2 + -2 - -1). Let t = 22 - u. Solve 0 = d - w - t for d. 2 Let q = 74 + -74. Solve -y = -q - 3 for y. 3 Let d = 0 - -3. Suppose 5s + 9y - 4y = 20, dy = 0. Suppose -2o - a = -8 - 7, 5o = sa + 5. Solve -of + 3f = 0 for f. 0 Let r = -10 + 13. Let q be 0/(2 + -3 - r). Solve q = k + k - 2 for k. 1 Suppose b + 0 = 1. Let t = 3 - b. Suppose 2s - 44 = -ts. Solve -1 = -3u + s for u. 4 Let f(k) = k2 - k. Let t(o) = 7o. Let x(y) = -f(y) - t(y). Let q be x(-6). Solve -5z + q = 10 for z. -2 Let v(i) = 3i*2 - i + 2. Let w be v(1). Solve 10 = -wr + 2r for r. -5 Suppose 5d - 28 = 2. Solve -4 = -5u + d for u. 2 Let g = -25 - -31. Suppose -gv = -v + 5m, -3v = 4m. Solve -5y + y = v for y. 0 Let n(k) = 2k3 - 4k*2 - 5k - 3. Let i be n(3). Solve ic - 1 = c for c. -1 Let a = 11 + -8. Let m = 5 - a. Solve 0 = -5p - 3 - m for p. -1 Let j be 128/(-6)(-18)/8. Let x be 12/(-42) + j/21. Solve 2 = -xt + 6 for t. 2 Let b be 1/(4/402). Suppose 8 = -4d + bj - 8, -d - 11 = -3j. Solve i - d = -0 for i. 1 Let t = 19 + -16. Solve 2o + to + 20 = 0 for o. -4 Let h = -111 - -118. Solve -ho = -10o + 6 for o. 2 Let o be (-13)/(-5) + 27/(-45). Let u be (-1)/((-1)/8o). Solve -uc = c for c. 0 Suppose -q + w - 2w = -3, -4w - 24 = -5q. Suppose qi - 3r + 2r = 2, -5r = 10. Solve ic = -2c - 10 for c. -5 Let k(v) = v + 3. Let r = 1 + -1. Suppose -4l + c + 5 + 16 = r, l + c + 1 = 0. Let z be k(l). Solve 0 = zg - 2g + 25 for g. -5 Let y(i) be the third derivative of 3i2 + 0i + 0 - 1/24i4 + 1/2i*3. Let g be y(3). Solve -w = -g - 4 for w. 4 Suppose 0 = 3s + 2y - y - 1, 23 = -s - 5y. Suppose 5f = sf + 18. Let u = f + -1. Solve 12 = uw - 2w for w. 4 Let v(a) = -2a2 + 4 - 2a*3 + 5a*2 + 3a*3 - 5. Let z be v(-2). Solve 1 = -2g - z for g. -2 Suppose 5o = 2o + 36. Suppose -2c = 2c - o. Solve -2y - cy + 15 = 0 for y. 3 Let z = 13 + -12. Solve -o = -z - 4 for o. 5 Let q(z) = -z - 1. Let j be q(-4). Let u be (-688)/(-144) - (-2)/9. Solve u = -4n + jn for n. -5 Let o = 25 + -25. Solve -2 + o = 2h for h. -1 Let h = -21 - -22. Suppose 0 = -5x - 3a - 12, 0 = -4a - h - 15. Solve -3f + 5f - 2 = x for f. 1 Suppose -3m = -0k + 2k - 8, -2m + k + 17 = 0. Solve -19 = -5h + m for h. 5 Let w = -2 - 2. Let x be (-9)/2w/6. Let h be 10/(-15) - (-26)/x. Solve -3c = -c + h for c. -4 Let n be 3 + -2 + 0 + 3. Suppose 0 = -f + 3g, -g - 11 = -nf - 0g. Suppose -4x + 21 = 3m, 3m = 5x + 2m - 31. Solve x = fc - 0 for c. 2 Let h = -35 - -36. Solve -3a - 4 = -h for a. -1 Suppose 0 = -o + 4 - 1. Solve 0 = -2g + o + 5 for g. 4 Suppose -1 = -4y + 71. Let x = -19 + 21. Suppose y = 4j - x. Solve q + 4q = -j for q. -1 Let g(p) = -2p*3 - 4p*2 - 4p - 4. Let f be g(-2). Solve -fo - 27 = -7 for o. -5 Let d be 5 - (-2 + (-10)/(-2)). Solve -dz + 15 = -5z for z. -5 Let x be (-1 + 1/4)-4. Suppose xp = -2p + 15. Solve 5a - 4a = -p for a. -3 Let a(p) = -p*3 + 4p*2 - 2p + 2. Let i be a(3). Suppose -3l = l - q + 18, 4l + iq = -6. Let b be l/6(-2 - 1). Solve 4v + b = 2v for v. -1 Let g be 1 - 1 - (-2 - 9). Suppose -2z - z = -4i - 18, -g = -4z + i. Solve zf = 4 - 0 for f. 2 Suppose n - 2q - 9 = 0, q - 42 = -3n + 2q. Suppose -2 = -5b + 3. Suppose b - 6 = -j. Solve jg + n + 10 = 0 for g. -5 Suppose -4v = 5b + 2 - 18, 2b = -v + 4. Solve 8 = -4x + v for x. -1 Suppose -2d = 5d. Solve -2m = -dm for m. 0 Let b = 24 - 22. Solve 3 = bf - 1 for f. 2 Let k(d) = -3d + 3d + 21d3 - d. Let u be (1 - 2) + 2 + 0. Let b be k(u). Solve -p - 4p = b for p. -4 Let p(l) = l*2 - 3l + 1. Let x = -3 + 7. Let s be p(x). Suppose 0 = 5u - 2 - 23. Solve s = uy - 10 for y. 3 Let z(g) = -g*3 - 8g*2 - 8g + 2. Let j be z(-7). Let o be 0/((-9)/(j/(-3))). Suppose 0 = -5d + 2h + 19, d = -5h + 1 - 8. Solve -m + dm + 4 = o for m. -2 Let k be 6/(-15) - 2/(-5). Suppose k = -o - 0o + 4. Suppose -5l - 2p = -22, l + 4p = -p + 9. Solve 2u - ou = l for u. -2 Suppose 0 = -4t + 29 - 17. Suppose -3d + 7d = 8. Solve x = -d - t for x. -5 Let y be 3/(-4) + 93/12. Let u = y + -3. Suppose 70 = 5a - 5n, 7n - 65 = -ua + 2n. Solve 4l = -l + a for l. 3 Let p = 76 - 71. Solve 10a = pa + 25 for a. 5 Let g(h) = h2 - 2h. Let k be g(2). Let v be 6/4 - (-3)/2. Solve k = -vc - c for c. 0 Let n(y) = -y2 + 7y + 4. Suppose -5m = 15, -12 = 3z + 5m + 39. Let c = z - -19. Let p be n(c). Solve -10 = 2o - p for o. -3 Let c be (-35 + 35)/(1 + -12). Solve 2n = -cn for n. 0 Let c(d) = d3 + 5d*2 - 2d - 7. Let f be c(-5). Solve fh - 12 + 3 = 0 for h. 3 Suppose 6 = c - 4c. Let i = c + 4. Solve -ib = b for b. 0 Let x = 18 - 30. Let l be (-32)/x(-6)/(-4). Suppose -5d + lw = -d - 32, -3w = 6. Solve -b = -db for b. 0 Let s(j) = -j*3 + 11j*2 + j - 4. Let b be s(11). Solve -2m - b = 3 for m. -5 Let x = -2 - -8. Suppose 5s + 20 = 5z, -3z + xs = 5s - 10. Solve z + 2 = 5u for u. 1 Let v(p) = p*2 - 3p - 8. Let g be v(5). Solve 2j + gj = 16 for j. 4 Let l(h) = -h*2 - 4h - 3. Let x be l(-2). Let r be 2/6 - 221/(-39). Solve r = c + x for c. 5 Let s(o) = o*2 + 7o - 5. Let p be s(-8). Let i = 5 + -3. Solve -i - p = -5t for t. 1 Let c(n) = -n + 5. Let k be c(3). Solve -kz - z = 0 for z. 0 Suppose 0 = -2i - 5t + 78, 4i - 121 = t + 79. Let c = i - 29. Solve 10w = 5w + c for w. 4 Let v(o) = 3o + 4. Let p be v(-3). Let t = 7 + p. Solve -th = -6h + 16 for h. 4 Let a = 9 + -5. Let d = a + -3. Let y be d + -2 + 2 + -1. Solve yx + 2 = -x for x. -2 Let j be 18 + 8/((-8)/3). Solve 0 - j = 5t for t. -1 Let p be (-5 - -8)(-4)/6. Let f = p + 4. Let s be -3 + (24 - -1) - f. Solve 4k = -0k - s for k. -5 Suppose -a + 2a - 5 = 0. Suppose 4z + 21 = o, 0 = o - 0o - az - 25. Suppose -3n = -on + 40. Solve -6m = -2m - n for m. 5 Suppose -b = -5 - 4. Solve -2j - b = -1 for j. -4 Suppose -2r - 2*r = -12.	{ "pile_set_name": "DM Mathematics" }
8885/307 Calculate 96079527 divided by -6. -32026509/2 What is -19 divided by -1816863? 19/1816863 What is -14630760 divided by -6? 2438460 Calculate -110286550 divided by -26290. 4195 Divide 2252634 by -750878. -3 Calculate -4 divided by 1190875. -4/1190875 Divide 143 by 802989. 13/72999 Divide -40 by -145773. 40/145773 -32742342 divided by 7746 -4227 2867056 divided by -6179 -464 3 divided by -7369174 -3/7369174 Calculate 462 divided by 10155. 154/3385 338550480 divided by -90 -3761672 Divide 162 by -98346. -27/16391 Calculate 0 divided by -29920. 0 -21919050 divided by 6 -3653175 147344960 divided by 131558 1120 -7521074 divided by 341867 -22 -57939168 divided by 177184 -327 Calculate -2127456 divided by -1494. 1424 Calculate -65447892 divided by -3635994. 18 Divide -11081436 by 3. -3693812 Divide -104842040 by -207608. 505 309345144 divided by -12 -25778762 Divide -4565 by -3065. 913/613 44989230 divided by 2145 20974 Calculate -251512400 divided by -5030248. 50 -2623099 divided by 1 -2623099 1 divided by 198937014 1/198937014 What is 1265 divided by -103559? -1265/103559 Divide -4568964 by -32404. 141 -109566823 divided by 5 -109566823/5 Calculate -45 divided by 330187. -45/330187 -31010420 divided by -7180 4319 1140773808 divided by -1814 -628872 Calculate -5262712 divided by -2. 2631356 Calculate -566 divided by -7153. 566/7153 Calculate -10898808 divided by -699. 15592 Calculate 420950880 divided by 8. 52618860 What is -4 divided by 23070339? -4/23070339 Divide 638253 by -3. -212751 -1230 divided by 3165 -82/211 Calculate 4 divided by 698176. 1/174544 What is 172962900 divided by 900? 192181 What is 7 divided by -141689391? -7/141689391 What is -22624 divided by -1913? 22624/1913 11 divided by -4995290 -11/4995290 What is 4 divided by 67164616? 1/16791154 Calculate 2251 divided by 13852. 2251/13852 293079717 divided by -63 -4652059 Calculate 12 divided by 2686838. 6/1343419 Calculate 70023496 divided by -652. -107398 Calculate -78383465 divided by -5. 15676693 Calculate -17936490 divided by -2486. 7215 Divide 13781400 by -3090. -4460 Divide -16324089 by 1. -16324089 -12 divided by 817335 -4/272445 Divide 26588496 by 359304. 74 What is 3698979 divided by -1479? -2501 566593 divided by -15 -566593/15 What is 3768 divided by -68427? -1256/22809 Divide -191573064 by -6. 31928844 17675700 divided by -1329 -13300 What is 13 divided by 155943? 13/155943 What is -41195113 divided by 4? -41195113/4 Divide -282596000 by -33325. 8480 -53508293 divided by 30 -53508293/30 -6603800 divided by 1650950 -4 19297 divided by -461 -19297/461 Calculate -20 divided by 112775. -4/22555 What is 9 divided by -213252? -3/71084 What is -8 divided by -2433532? 2/608383 Divide -122144870 by 13165. -9278 Calculate 8179 divided by 1483. 8179/1483 What is -10283 divided by -2189? 10283/2189 What is 1609 divided by -109920? -1609/109920 Calculate 21 divided by -22769154. -7/7589718 13993585 divided by 37 378205 What is -121617183 divided by 1? -121617183 Divide 860 by 8800. 43/440 What is 1588 divided by 9919? 1588/9919 Divide 490188539 by 1. 490188539 Divide -41136270 by 14. -2938305 -11061577 divided by 5 -11061577/5 34 divided by -621521 -34/621521 Divide -39905224 by 8. -4988153 Calculate 209147220 divided by 34857870. 6 -3 divided by 12347414 -3/12347414 Calculate -54713 divided by 219. -54713/219 Calculate 5869732 divided by -6. -2934866/3 What is -116882272 divided by 6? -58441136/3 What is -4 divided by 1122703? -4/1122703 Calculate -2851644 divided by -142. 20082 Calculate 1826524 divided by 4. 456631 What is -4478218 divided by 2? -2239109 Calculate 845658 divided by -422829. -2 Calculate -9245680 divided by -2. 4622840 -1350981 divided by 450327 -3 Divide 5513 by 730. 5513/730 What is -30107322 divided by 2150523? -14 What is 239 divided by -31366? -239/31366 Divide -8015 by 905. -1603/181 Calculate 104160384 divided by -6. -17360064 -110904 divided by 1115 -110904/1115 -19 divided by 850005 -19/850005 62783076 divided by -6 -10463846 Calculate 65509876 divided by -16377469. -4 -26795665 divided by 5 -5359133 Calculate 10450845 divided by 6. 3483615/2 Calculate -1152752360 divided by -4. 288188090 -11835351 divided by -3945117 3 Calculate -97451640 divided by -49218. 1980 -28845400 divided by -5769080 5 Divide 67415868 by -13. -5185836 Divide -332227758 by -3. 110742586 Divide 1592381 by -109. -14609 Calculate 18836 divided by -2055. -18836/2055 Divide 172904 by 415. 172904/415 Calculate -108076458 divided by -4. 54038229/2 -3731 divided by 6882 -3731/6882 Calculate 100503564 divided by -2. -50251782 What is 7413041 divided by 17? 7413041/17 What is -977019876 divided by -27139441? 36 Divide -700007528 by 33976. -20603 -15481195 divided by 15481195 -1 Divide -200438199 by -13. 15418323 Divide 1894268 by -10. -947134/5 136 divided by 94594 68/47297 Divide 1752944 by 2. 876472 0 divided by -2014256 0 Calculate 4503616 divided by -3. -4503616/3 Calculate 2 divided by 44302470. 1/22151235 Calculate -60190 divided by 153. -60190/153 What is 704957384 divided by -5260876? -134 Divide 26782256 by 13391128. 2 What is -3 divided by 3597399? -1/1199133 What is -71296416 divided by -1383? 51552 2166212 divided by 506 1083106/253 Divide -2771 by 3463. -2771/3463 -984456 divided by 72 -13673 -1477891950 divided by -5 295578390 Divide -135297812 by -3. 135297812/3 Divide 575028480 by -39. -14744320 Divide 26 by 2013947. 2/154919 What is 105569607 divided by 738249? 143 -1933176 divided by -7 276168 What is 3 divided by 21223035? 1/7074345 What is 10968368 divided by -20932? -524 Calculate -19078942 divided by -35201. 542 What is -9049233 divided by 6? -3016411/2 Divide 5787 by -2861. -5787/2861 What is 855730 divided by 166? 5155 -305552 divided by 9 -305552/9 What is 186577069 divided by -1831? -101899 Divide -5 by -23458798. 5/23458798 3 divided by 3149331 1/1049777 What is 33688232 divided by -33688232? -1 640631430 divided by 8649 74070 Calculate 52056 divided by 36. 1446 772856 divided by 20888 37 2993398 divided by -28 -1496699/14 Divide 1393082535 by -3495. -398593 What is -29 divided by 257095? -29/257095 -10057 divided by -3214 10057/3214 -927254 divided by 463627 -2 What is -1189530 divided by -138? 198255/23 Divide 17591386 by 204551. 86 What is -207475550 divided by 41495110? -5 12388812 divided by 269322 46 Divide -923598 by 461799. -2 Divide 62968671 by 9. 6996519 What is 21424872 divided by -5356218? -4 Divide 156670280 by -130. -1205156 -9039 divided by -124 9039/124 -945120 divided by -110 8592 What is -49 divided by 95920? -49/95920 What is -27119 divided by -6482? 27119/6482 Divide -3843136 by -6592. 583 636801 divided by -7 -636801/7 Calculate 6327488 divided by -5. -6327488/5 Divide 35518296 by -7081. -5016 What is 50357 divided by 23891? 50357/23891 Calculate -1073322 divided by 119258. -9 What is -22004025 divided by -4400805? 5 -34299678 divided by 3 -11433226 What is 931 divided by -2022? -931/2022 Divide 6963480 by 773720. 9 Calculate 16769925 divided by 45945. 365 Divide -6 by -948911. 6/948911 -333 divided by -6458 333/6458 Divide 6 by 555866. 3/277933 Divide 26675768 by -2. -13337884 Divide -51535 by 220. -937/4 What is 9 divided by 7166640? 3/2388880 76677855 divided by -5 -15335571 Divide -2411793 by 3. -803931 6768329 divided by 731 9259 What is -4681903 divided by 3? -4681903/3 Divide 67901465 by -1. -67901465 What is -583908 divided by 99? -194636/33 -37233058 divided by 12566 -2963 5 divided by 3651881 5/3651881 What is 1304 divided by 6078? 652/3039 What is -92 divided by 376586? -46/188293 290685584 divided by 7 41526512 Calculate 2 divided by -4083299. -2/4083299 Divide -45 by -798473. 45/798473 Calculate 583147 divided by -152. -583147/152 Divide 684564435 by -136912887. -5 What is 105206064 divided by -816? -128929 Calculate 7609017 divided by 3. 2536339 Calculate 15346152 divided by -111204. -138 Divide 18649218 by 21. 888058 Divide 66236200 by 331181. 200 Calculate -7 divided by -2108235. 7/2108235 Calculate 7462596 divided by -1243766. -6 Divide -5278928 by -1468. 3596 Calculate 119052216 divided by 3. 39684072 What is 6153867 divided by -3051? -2017 Divide -137678023 by 5986001. -23 What is -373577291 divided by 2? -373577	{ "pile_set_name": "DM Mathematics" }
t is the square root of 1277 to the nearest integer? 36 What is the cube root of 6360 to the nearest integer? 19 What is the eighth root of 130 to the nearest integer? 2 What is the square root of 7620 to the nearest integer? 87 What is 976 to the power of 1/10, to the nearest integer? 2 What is 3751 to the power of 1/8, to the nearest integer? 3 What is the square root of 265 to the nearest integer? 16 What is 1547 to the power of 1/2, to the nearest integer? 39 What is the third root of 1316 to the nearest integer? 11 What is 32318 to the power of 1/3, to the nearest integer? 32 What is the sixth root of 96451 to the nearest integer? 7 What is 1110 to the power of 1/2, to the nearest integer? 33 What is the square root of 260 to the nearest integer? 16 What is 60877 to the power of 1/2, to the nearest integer? 247 What is the cube root of 1436 to the nearest integer? 11 What is the cube root of 2003 to the nearest integer? 13 What is 70044 to the power of 1/5, to the nearest integer? 9 What is the ninth root of 1496 to the nearest integer? 2 What is 3671 to the power of 1/5, to the nearest integer? 5 What is the eighth root of 22534 to the nearest integer? 4 What is the third root of 933 to the nearest integer? 10 What is the square root of 22850 to the nearest integer? 151 What is 28500 to the power of 1/3, to the nearest integer? 31 What is 12759 to the power of 1/3, to the nearest integer? 23 What is 3080 to the power of 1/4, to the nearest integer? 7 What is 18161 to the power of 1/7, to the nearest integer? 4 What is the seventh root of 5550 to the nearest integer? 3 What is the cube root of 1680 to the nearest integer? 12 What is the fourth root of 3135 to the nearest integer? 7 What is 65938 to the power of 1/3, to the nearest integer? 40 What is the seventh root of 1789 to the nearest integer? 3 What is the third root of 18158 to the nearest integer? 26 What is 4487 to the power of 1/4, to the nearest integer? 8 What is the ninth root of 254 to the nearest integer? 2 What is the cube root of 14292 to the nearest integer? 24 What is 2081 to the power of 1/6, to the nearest integer? 4 What is 10080 to the power of 1/2, to the nearest integer? 100 What is the third root of 687 to the nearest integer? 9 What is the square root of 3740 to the nearest integer? 61 What is 33985 to the power of 1/2, to the nearest integer? 184 What is 1171 to the power of 1/2, to the nearest integer? 34 What is the square root of 1394 to the nearest integer? 37 What is 29064 to the power of 1/2, to the nearest integer? 170 What is 2771 to the power of 1/3, to the nearest integer? 14 What is 83368 to the power of 1/6, to the nearest integer? 7 What is the cube root of 9598 to the nearest integer? 21 What is the seventh root of 109 to the nearest integer? 2 What is 13466 to the power of 1/6, to the nearest integer? 5 What is 6004 to the power of 1/2, to the nearest integer? 77 What is 655 to the power of 1/2, to the nearest integer? 26 What is 98 to the power of 1/9, to the nearest integer? 2 What is 57931 to the power of 1/3, to the nearest integer? 39 What is 21886 to the power of 1/3, to the nearest integer? 28 What is the fifth root of 11739 to the nearest integer? 7 What is the square root of 2079 to the nearest integer? 46 What is the tenth root of 3348 to the nearest integer? 2 What is 2434 to the power of 1/3, to the nearest integer? 13 What is 850 to the power of 1/8, to the nearest integer? 2 What is the third root of 28000 to the nearest integer? 30 What is the square root of 1736 to the nearest integer? 42 What is 78378 to the power of 1/2, to the nearest integer? 280 What is the third root of 6089 to the nearest integer? 18 What is the square root of 21115 to the nearest integer? 145 What is the square root of 5866 to the nearest integer? 77 What is the third root of 3724 to the nearest integer? 16 What is the third root of 59799 to the nearest integer? 39 What is 1073 to the power of 1/3, to the nearest integer? 10 What is the third root of 4070 to the nearest integer? 16 What is 1361 to the power of 1/3, to the nearest integer? 11 What is 2583 to the power of 1/2, to the nearest integer? 51 What is 13406 to the power of 1/7, to the nearest integer? 4 What is the square root of 35972 to the nearest integer? 190 What is the sixth root of 1381 to the nearest integer? 3 What is 867 to the power of 1/2, to the nearest integer? 29 What is 4593 to the power of 1/2, to the nearest integer? 68 What is 3729 to the power of 1/9, to the nearest integer? 2 What is 119974 to the power of 1/2, to the nearest integer? 346 What is 2717 to the power of 1/8, to the nearest integer? 3 What is the seventh root of 3095 to the nearest integer? 3 What is the tenth root of 12628 to the nearest integer? 3 What is the third root of 1233 to the nearest integer? 11 What is 11238 to the power of 1/2, to the nearest integer? 106 What is the ninth root of 4523 to the nearest integer? 3 What is the square root of 1270 to the nearest integer? 36 What is 7616 to the power of 1/2, to the nearest integer? 87 What is 4370 to the power of 1/8, to the nearest integer? 3 What is the fourth root of 1993 to the nearest integer? 7 What is 15283 to the power of 1/2, to the nearest integer? 124 What is 7424 to the power of 1/3, to the nearest integer? 20 What is 64102 to the power of 1/8, to the nearest integer? 4 What is the square root of 3805 to the nearest integer? 62 What is the third root of 7170 to the nearest integer? 19 What is 95340 to the power of 1/2, to the nearest integer? 309 What is the square root of 2382 to the nearest integer? 49 What is 148 to the power of 1/2, to the nearest integer? 12 What is 7630 to the power of 1/10, to the nearest integer? 2 What is the cube root of 80573 to the nearest integer? 43 What is the square root of 17488 to the nearest integer? 132 What is the cube root of 46066 to the nearest integer? 36 What is the third root of 53 to the nearest integer? 4 What is the sixth root of 4646 to the nearest integer? 4 What is 33436 to the power of 1/2, to the nearest integer? 183 What is the cube root of 11492 to the nearest integer? 23 What is 64187 to the power of 1/2, to the nearest integer? 253 What is 941 to the power of 1/2, to the nearest integer? 31 What is 4034 to the power of 1/10, to the nearest integer? 2 What is 657 to the power of 1/2, to the nearest integer? 26 What is the sixth root of 75693 to the nearest integer? 7 What is the third root of 125113 to the nearest integer? 50 What is 1504 to the power of 1/2, to the nearest integer? 39 What is the third root of 10905 to the nearest integer? 22 What is the third root of 27814 to the nearest integer? 30 What is the eighth root of 3358 to the nearest integer? 3 What is the third root of 1585 to the nearest integer? 12 What is the eighth root of 16737 to the nearest integer? 3 What is 2675 to the power of 1/3, to the nearest integer? 14 What is 12498 to the power of 1/3, to the nearest integer? 23 What is the fourth root of 912 to the nearest integer? 5 What is 1698 to the power of 1/3, to the nearest integer? 12 What is the eighth root of 2381 to the nearest integer? 3 What is 5034 to the power of 1/3, to the nearest integer? 17 What is the cube root of 24670 to the nearest integer? 29 What is the tenth root of 1973 to the nearest integer? 2 What is 1175 to the power of 1/3, to the nearest integer? 11 What is the cube root of 6398 to the nearest integer? 19 What is the square root of 37 to the nearest integer? 6 What is 21663 to the power of 1/3, to the nearest integer? 28 What is 119120 to the power of 1/2, to the nearest integer? 345 What is 4624 to the power of 1/2, to the nearest integer? 68 What is the third root of 39619 to the nearest integer? 34 What is the cube root of 20292 to the nearest integer? 27 What is the third root of 697 to the nearest integer? 9 What is 3025 to the power of 1/10, to the nearest integer? 2 What is 27848 to the power of 1/2, to the nearest integer? 167 What is 15926 to the power of 1/2, to the nearest integer? 126 What is 9106 to the power of 1/2, to the nearest integer? 95 What is the cube root of 55196 to the nearest integer? 38 What is the seventh root	{ "pile_set_name": "DM Mathematics" }
AM and 6:18 PM? 588 How many minutes are there between 1:30 AM and 12:16 PM? 646 How many minutes are there between 12:54 PM and 2:49 PM? 115 What is 331 minutes after 6:57 AM? 12:28 PM What is 298 minutes before 6:52 PM? 1:54 PM What is 605 minutes before 10:28 PM? 12:23 PM How many minutes are there between 4:06 AM and 12:30 PM? 504 How many minutes are there between 9:28 AM and 7:51 PM? 623 What is 481 minutes after 10:07 AM? 6:08 PM What is 689 minutes after 10:21 AM? 9:50 PM What is 298 minutes before 12:18 PM? 7:20 AM What is 11 minutes after 11:57 PM? 12:08 AM What is 185 minutes after 1:44 PM? 4:49 PM What is 706 minutes before 2:06 PM? 2:20 AM How many minutes are there between 1:20 PM and 12:03 AM? 643 How many minutes are there between 7:28 AM and 5:33 PM? 605 How many minutes are there between 6:29 AM and 11:06 AM? 277 How many minutes are there between 6:47 AM and 10:45 AM? 238 How many minutes are there between 7:40 PM and 10:02 PM? 142 How many minutes are there between 9:00 AM and 8:20 PM? 680 What is 318 minutes after 9:12 PM? 2:30 AM How many minutes are there between 8:28 PM and 6:16 AM? 588 What is 538 minutes before 9:02 PM? 12:04 PM What is 524 minutes after 5:25 AM? 2:09 PM What is 246 minutes before 5:07 AM? 1:01 AM How many minutes are there between 9:08 PM and 5:58 AM? 530 How many minutes are there between 9:10 PM and 11:34 PM? 144 How many minutes are there between 4:14 AM and 5:17 AM? 63 How many minutes are there between 7:56 AM and 3:30 PM? 454 What is 647 minutes before 10:08 PM? 11:21 AM What is 97 minutes before 2:25 PM? 12:48 PM What is 685 minutes after 6:24 PM? 5:49 AM How many minutes are there between 1:45 PM and 1:16 AM? 691 How many minutes are there between 12:09 AM and 5:12 AM? 303 How many minutes are there between 9:44 AM and 6:34 PM? 530 What is 524 minutes before 6:51 AM? 10:07 PM How many minutes are there between 4:15 PM and 11:48 PM? 453 How many minutes are there between 10:28 AM and 9:14 PM? 646 What is 699 minutes before 1:02 AM? 1:23 PM How many minutes are there between 3:21 AM and 1:38 PM? 617 How many minutes are there between 1:19 PM and 3:53 PM? 154 How many minutes are there between 10:33 PM and 5:57 AM? 444 How many minutes are there between 2:29 AM and 2:23 PM? 714 How many minutes are there between 7:32 AM and 5:13 PM? 581 How many minutes are there between 7:59 AM and 2:57 PM? 418 What is 587 minutes before 2:19 PM? 4:32 AM How many minutes are there between 7:54 AM and 1:04 PM? 310 How many minutes are there between 3:08 PM and 12:26 AM? 558 What is 286 minutes after 3:54 PM? 8:40 PM How many minutes are there between 2:18 PM and 7:07 PM? 289 How many minutes are there between 6:30 PM and 8:31 PM? 121 How many minutes are there between 6:22 AM and 4:33 PM? 611 What is 669 minutes after 12:47 AM? 11:56 AM How many minutes are there between 2:50 PM and 5:45 PM? 175 What is 630 minutes before 8:24 AM? 9:54 PM How many minutes are there between 4:53 PM and 4:20 AM? 687 What is 371 minutes before 8:54 PM? 2:43 PM What is 578 minutes after 10:38 PM? 8:16 AM How many minutes are there between 11:00 AM and 9:52 PM? 652 What is 705 minutes before 3:26 PM? 3:41 AM How many minutes are there between 8:27 PM and 6:58 AM? 631 What is 688 minutes after 12:43 AM? 12:11 PM How many minutes are there between 7:11 PM and 4:20 AM? 549 What is 203 minutes after 12:22 PM? 3:45 PM How many minutes are there between 4:15 AM and 6:53 AM? 158 How many minutes are there between 4:44 AM and 3:14 PM? 630 What is 543 minutes after 8:23 AM? 5:26 PM How many minutes are there between 2:13 PM and 7:37 PM? 324 How many minutes are there between 4:15 PM and 4:09 AM? 714 What is 394 minutes after 5:37 AM? 12:11 PM How many minutes are there between 5:17 AM and 10:08 AM? 291 How many minutes are there between 10:07 PM and 9:26 AM? 679 What is 682 minutes before 6:38 PM? 7:16 AM How many minutes are there between 8:31 PM and 3:29 AM? 418 How many minutes are there between 8:29 AM and 11:19 AM? 170 How many minutes are there between 11:52 PM and 2:45 AM? 173 How many minutes are there between 8:20 PM and 2:27 AM? 367 What is 56 minutes before 2:57 AM? 2:01 AM How many minutes are there between 3:26 AM and 5:27 AM? 121 What is 165 minutes after 5:53 PM? 8:38 PM What is 630 minutes after 3:50 PM? 2:20 AM What is 60 minutes before 10:06 PM? 9:06 PM How many minutes are there between 3:59 PM and 12:54 AM? 535 What is 539 minutes before 12:34 PM? 3:35 AM How many minutes are there between 5:31 PM and 5:41 PM? 10 What is 355 minutes before 9:41 AM? 3:46 AM How many minutes are there between 3:20 PM and 9:04 PM? 344 What is 332 minutes after 7:13 AM? 12:45 PM How many minutes are there between 12:50 PM and 3:41 PM? 171 What is 406 minutes before 3:49 AM? 9:03 PM How many minutes are there between 6:06 AM and 6:57 AM? 51 What is 289 minutes before 5:06 AM? 12:17 AM What is 296 minutes before 7:56 AM? 3:00 AM How many minutes are there between 9:19 AM and 5:40 PM? 501 How many minutes are there between 8:50 AM and 9:30 AM? 40 How many minutes are there between 10:12 PM and 7:25 AM? 553 How many minutes are there between 7:54 AM and 9:41 AM? 107 How many minutes are there between 10:49 PM and 12:06 AM? 77 How many minutes are there between 1:14 PM and 1:34 PM? 20 What is 41 minutes after 11:39 AM? 12:20 PM What is 581 minutes before 11:50 PM? 2:09 PM What is 4 minutes before 8:12 AM? 8:08 AM How many minutes are there between 6:22 PM and 5:39 AM? 677 How many minutes are there between 3:03 PM and 12:39 AM? 576 What is 704 minutes after 4:35 AM? 4:19 PM How many minutes are there between 9:52 AM and 9:46 PM? 714 What is 130 minutes after 3:25 AM? 5:35 AM What is 470 minutes after 5:33 AM? 1:23 PM What is 315 minutes before 8:44 PM? 3:29 PM What is 332 minutes after 7:38 PM? 1:10 AM What is 709 minutes before 9:41 PM? 9:52 AM What is 33 minutes after 3:07 AM? 3:40 AM What is 625 minutes before 4:12 PM? 5:47 AM How many minutes are there between 6:39 PM and 9:19 PM? 160 How many minutes are there between 1:57 AM and 10:31 AM? 514 How many minutes are there between 7:51 PM and 9:51 PM? 120 How many minutes are there between 3:21 PM and 1:51 AM? 630 What is 420 minutes before 1:50 PM? 6:50 AM What is 402 minutes after 11:22 AM? 6:04 PM What is 719 minutes before 12:03 AM? 12:04 PM How many minutes are there between 12:24 PM and 1:13 PM? 49 What is 706 minutes after 2:55 AM? 2:41 PM How many minutes are there between 7:17 PM and 7:57 PM? 40 How many minutes are there between 1:05 AM and 1:00 PM? 715 What is 155 minutes after 7:40 AM? 10:15 AM What is 293 minutes after 5:56 PM? 10:49 PM What is 82 minutes before 5:18 AM? 3:56 AM What is 665 minutes before 2:58 PM? 3:53 AM How many minutes are there between 7:58 PM and 9:41 PM? 103 What is 327 minutes before 8:26 AM? 2:59 AM What is 685 minutes after 12:56 PM? 12:21 AM What is 496 minutes after 7:38 PM? 3:54 AM What is 421 minutes after 1:07 AM? 8:08 AM How many minutes are there between 10:03 PM and 11:20 PM? 77 What is 77 minutes before 4:08 AM? 2:51 AM How many minutes are there between 6:40 AM and 10:54 AM? 254 What is 616 minutes after 5:22 AM? 3:38 PM What is 617 minutes before 10:42 PM? 12:25 PM What is 374 minutes after 8:46 PM? 3:00 AM What is 520 minutes before 7:19 AM? 10:39 PM What is 110 minutes before 5:11 AM? 3:21 AM How many minutes are there between 11:53 AM and 9:36 PM? 583 How many minutes are there between 2:19 AM and 9:04 AM? 405 How many minutes are there between 7:49 AM and 10:41 AM? 172 What is 158 minutes after 9:26 PM? 12:04 AM How many minutes are there between 1:24 PM and 4:14 PM? 170 What is 689 minutes after 5:43 PM? 5:12 AM What is 708 minutes after 5:28 PM? 5:16 AM What is 209 minutes after 8:55 AM? 12:24 PM What is 400 minutes after 2:25 AM? 9:05 AM What is 317 minutes after 5:13 PM? 10:30 PM How many minutes are there between 4:39 PM and 6:21 PM? 102 What is 298 minutes before 12:17 PM? 7:19 AM How many minutes are there between 6:33 AM and 5:25 PM? 652 How many minutes are there between 2:44 PM and 12:28 AM? 584 How many minutes are there between 5:17 PM and 3:40 AM? 623 How many minutes are there between 2:23 AM and 12:09 PM? 586 What is 702 m	{ "pile_set_name": "DM Mathematics" }
y 47? 12 What is the remainder when 8030 is divided by 7341? 689 Calculate the remainder when 76574292 is divided by 22. 14 What is the remainder when 629522 is divided by 28603? 256 Calculate the remainder when 924888 is divided by 29. 20 What is the remainder when 60222 is divided by 2259? 1488 Calculate the remainder when 30041005 is divided by 172. 1 Calculate the remainder when 456361 is divided by 313. 7 Calculate the remainder when 212434 is divided by 199. 101 Calculate the remainder when 4710142 is divided by 23. 18 What is the remainder when 170344 is divided by 27740? 3904 What is the remainder when 1188700 is divided by 456? 364 What is the remainder when 21310425 is divided by 53011? 3 What is the remainder when 8334 is divided by 4022? 290 What is the remainder when 27032 is divided by 3373? 48 Calculate the remainder when 357921 is divided by 39769. 0 Calculate the remainder when 20010141 is divided by 14. 11 Calculate the remainder when 19637 is divided by 6176. 1109 What is the remainder when 7222000 is divided by 332? 4 Calculate the remainder when 17347752 is divided by 1562. 180 What is the remainder when 16884417 is divided by 1482? 1473 What is the remainder when 262700 is divided by 3941? 2594 What is the remainder when 165196184 is divided by 27532693? 26 What is the remainder when 3272098 is divided by 1636015? 68 What is the remainder when 1311575 is divided by 790? 175 Calculate the remainder when 2893390 is divided by 14. 10 Calculate the remainder when 54797429 is divided by 885. 884 What is the remainder when 10830 is divided by 83? 40 What is the remainder when 34730368 is divided by 359? 349 Calculate the remainder when 100465 is divided by 33266. 667 What is the remainder when 740390 is divided by 10? 0 What is the remainder when 5539985 is divided by 504? 17 Calculate the remainder when 128824966 is divided by 21470826. 10 What is the remainder when 28817 is divided by 4103? 96 What is the remainder when 6590852 is divided by 48821? 17 Calculate the remainder when 218744 is divided by 1682. 84 Calculate the remainder when 41917866 is divided by 357. 354 What is the remainder when 59387767 is divided by 1746699? 1 What is the remainder when 235053 is divided by 58722? 165 Calculate the remainder when 680704 is divided by 594. 574 Calculate the remainder when 11080447 is divided by 211. 204 What is the remainder when 6711541 is divided by 38? 19 What is the remainder when 128782 is divided by 608? 494 What is the remainder when 369650 is divided by 303? 293 Calculate the remainder when 2481726 is divided by 1261. 78 Calculate the remainder when 203341973 is divided by 1044. 5 Calculate the remainder when 6442558 is divided by 199. 132 What is the remainder when 63503025 is divided by 81? 78 What is the remainder when 609186 is divided by 9984? 162 What is the remainder when 698814 is divided by 20? 14 What is the remainder when 114114164 is divided by 5321? 5319 Calculate the remainder when 12487546 is divided by 274. 270 Calculate the remainder when 27307530 is divided by 322. 320 Calculate the remainder when 415943 is divided by 372. 47 What is the remainder when 651733 is divided by 4048? 5 What is the remainder when 135809961 is divided by 1610? 21 Calculate the remainder when 1525702 is divided by 508566. 4 Calculate the remainder when 335723 is divided by 66585. 2798 Calculate the remainder when 9080116 is divided by 94. 92 What is the remainder when 202446 is divided by 100991? 464 What is the remainder when 672152 is divided by 2870? 572 Calculate the remainder when 277796 is divided by 138496. 804 What is the remainder when 1279174 is divided by 521? 119 What is the remainder when 125006691 is divided by 2631? 2619 What is the remainder when 5454216 is divided by 215? 96 What is the remainder when 1196203 is divided by 56957? 106 Calculate the remainder when 601056959 is divided by 42. 41 What is the remainder when 2186963 is divided by 3165? 3113 Calculate the remainder when 4925870 is divided by 2884. 2882 What is the remainder when 201801 is divided by 100859? 83 Calculate the remainder when 29586 is divided by 4775. 936 What is the remainder when 25298 is divided by 1113? 812 Calculate the remainder when 3020823 is divided by 3365. 2418 What is the remainder when 425085 is divided by 70846? 9 Calculate the remainder when 18002163 is divided by 198. 3 Calculate the remainder when 86574 is divided by 21525. 474 Calculate the remainder when 270413 is divided by 444. 17 Calculate the remainder when 18615 is divided by 17. 0 Calculate the remainder when 107583793 is divided by 57. 55 Calculate the remainder when 222584 is divided by 31796. 12 Calculate the remainder when 242561759 is divided by 22. 11 What is the remainder when 588863 is divided by 30? 23 Calculate the remainder when 198849983 is divided by 1509. 1508 What is the remainder when 816165 is divided by 61? 46 Calculate the remainder when 430618 is divided by 1180. 1098 What is the remainder when 44315 is divided by 8628? 1175 Calculate the remainder when 39302811 is divided by 1403670. 51 Calculate the remainder when 33768 is divided by 1054. 40 What is the remainder when 9234275 is divided by 88? 83 Calculate the remainder when 7331311 is divided by 84. 43 Calculate the remainder when 860744 is divided by 250. 244 Calculate the remainder when 22422108 is divided by 429. 423 What is the remainder when 117520 is divided by 319? 128 What is the remainder when 1647091 is divided by 1647082? 9 What is the remainder when 227671 is divided by 7? 3 What is the remainder when 13208 is divided by 5137? 2934 Calculate the remainder when 3932037 is divided by 372. 369 Calculate the remainder when 164050 is divided by 2200. 1250 What is the remainder when 23001 is divided by 417? 66 Calculate the remainder when 3138979 is divided by 116257. 40 Calculate the remainder when 6024518 is divided by 2008170. 8 What is the remainder when 1951363 is divided by 911? 1 What is the remainder when 29351851 is divided by 3898? 3809 What is the remainder when 32507 is divided by 347? 236 Calculate the remainder when 4365818 is divided by 297. 215 What is the remainder when 40251203 is divided by 844? 843 Calculate the remainder when 17713053 is divided by 2969. 2968 What is the remainder when 573417 is divided by 1239? 999 What is the remainder when 34860607 is divided by 9? 7 Calculate the remainder when 41294354 is divided by 3441196. 2 Calculate the remainder when 14663705 is divided by 5908. 49 Calculate the remainder when 1479598 is divided by 493168. 94 What is the remainder when 16616480 is divided by 155? 15 Calculate the remainder when 606169827 is divided by 690. 687 Calculate the remainder when 168911 is divided by 6254. 53 Calculate the remainder when 5644 is divided by 1221. 760 Calculate the remainder when 427614 is divided by 20325. 789 Calculate the remainder when 31532 is divided by 15459. 614 Calculate the remainder when 316415 is divided by 100. 15 What is the remainder when 5319225 is divided by 1329779? 109 Calculate the remainder when 5836885 is divided by 291844. 5 What is the remainder when 1422042 is divided by 6349? 6215 What is the remainder when 204966628 is divided by 990? 988 What is the remainder when 57661399 is divided by 29? 3 What is the remainder when 2843584 is divided by 341? 326 What is the remainder when 319340 is divided by 5806? 10 Calculate the remainder when 6228114 is divided by 3497. 3454 Calculate the remainder when 3427829 is divided by 18. 17 Calculate the remainder when 7665 is divided by 1676. 961 Calculate the remainder when 12861 is divided by 3184. 125 Calculate the remainder when 15312885 is divided by 228550. 35 What is the remainder when 19999 is divided by 1121? 942 Calculate the remainder when 553827 is divided by 110755. 52 What is the remainder when 22013079 is divided by 1417? 1401 Calculate the remainder when 957740 is divided by 6276. 3788 Calculate the remainder when 4135357 is divided by 14875. 107 Calculate the remainder when 12249 is divided by 5670. 909 Calculate the remainder when 2771472 is divided by 17. 13 Calculate the remainder when 6882243 is divided by 50. 43 What is the remainder when	{ "pile_set_name": "DM Mathematics" }
et z = 1.067 + o. What is z rounded to 1 decimal place? 1 Let l(k) be the third derivative of -k*2 + 0k + 1/6k3 + 0 + 1/60k*5 + 19/40k*6 - 1/24k*4. Let r be l(1). Round r to the nearest 10. 60 Let d = 5.1 - 0.1. Let o = d - 4.6. Let k = o - 0.40197. What is k rounded to four dps? -0.002 Let p = -0.035 + 22.035. Let y = -12 + p. Let d = 10.0036 - y. Round d to 3 decimal places. 0.004 Let c = -0.8 - -1.1. Let b = c + -4.3. Let h = b + 4.00000001. What is h rounded to seven dps? 0 Let r = 11.4833 - -1.3107. Let p = 12.9 - r. Let l = p + 10.294. Round l to zero dps. 10 Let r be 2000/(-6)(-13 - 44). What is r rounded to the nearest 10000? 20000 Let s = -2200344 - -15736698. Suppose 5f + 22009047 = 3b, 8b + 3f - 29345425 = 4b. Let m = b - s. What is m rounded to the nearest 1000000? -6000000 Let m = -641 - -512.4. What is m rounded to the nearest 10? -130 Suppose -10 = u - 5, -5w + 4u = -52520. Round w to the nearest 1000. 11000 Let i = 6.3 - 6.2959. Round i to three dps. 0.004 Let d(p) = -4 - 7p + 5p2 - 2 + 13p*3 - 2 + p. Let s be d(-6). What is s rounded to the nearest one thousand? -3000 Let l(q) = -7545q. Let a be l(-1). Let y = a + -2945. What is y rounded to the nearest one thousand? 5000 Suppose 0 = -b + 6b. Suppose 4d - 1999980 = -j, -4j + 4d + 1673309 + 6326711 = b. What is j rounded to the nearest 1000000? 2000000 Let p = 8 + -3. Let a(z) = -z - 77z2 + 4 - 3 - p. Let q be a(3). What is q rounded to the nearest one hundred? -700 Let w = -46381.188 + 46458. Let q = w - 77. Let v = 0.2 + q. Round v to two dps. 0.01 Let v = 1.664 - 2.4. What is v rounded to 1 decimal place? -0.7 Let f(r) = 2720r3 + r2 + 6r + 5. Let j(m) = m3 + 5m*2 + 6m + 3. Let w be j(-4). Let q be f(w). Round q to the nearest one hundred thousand. -300000 Let g = 240.782 - 242.8. Let i = g - -1.9. What is i rounded to 2 dps? -0.12 Let l(j) be the second derivative of -220j3/3 - 3j. Let p be l(-5). Suppose a + 4a = -p. Round a to the nearest one hundred. -400 Let m = -0.55 + 3.65. Let o = 3.10062 - m. Round o to 4 decimal places. 0.0006 Let b = 208926 - 377926. Round b to the nearest ten thousand. -170000 Let i = 32.38 + 0.62. Let s = -721.3 + 753. Let d = s - i. Round d to the nearest integer. -1 Let k = 0.121 - 18.341. Let x = 21.1 + -3.1. Let d = k + x. What is d rounded to one dp? -0.2 Let h = 60.01 - 40.6. Let n = h + -19. Let i = n + -0.4100043. What is i rounded to 6 dps? -0.000004 Suppose -3i = u + 4, -5u = -0i - i + 20. Suppose -4l + 4p - 11343390 - 7456626 = 0, -5l + p - 23500004 = i. Round l to the nearest one million. -5000000 Let p(o) = 21177107o + 2. Let n be p(-2). Let u = -25954212 - n. Round u to the nearest 1000000. 16000000 Let n = -0.00264 + 1.00276. Let b = 6 + -5. Let c = n - b. What is c rounded to 4 dps? 0.0001 Suppose -h + 55447 = -3a - 115557, -2a - 113988 = 3h. What is a rounded to the nearest 10000? -60000 Let x be (-105)/30(-2)/7. Let s = x + 16. What is s rounded to the nearest ten? 20 Let f(j) = -3788j - 28. Let c be f(19). What is c rounded to the nearest ten thousand? -70000 Let c = 26 + -9. Let s = c + -17.32. Let h = s - -0.31999969. What is h rounded to 7 dps? -0.0000003 Let t = 0.2215 + -0.5026. Let r = -0.27 - t. What is r rounded to three decimal places? 0.011 Suppose m + 3229 = -4f + 11213, -5m + 5f + 40020 = 0. Suppose -m = -0c - 4c. Round c to the nearest one thousand. 2000 Let v(c) = c*2 + 11c + 1. Let u be v(-11). Suppose -4 = j - o, -4j - 4o + 7 = -u. Let t be j/3 - 349/(-3). What is t rounded to the nearest ten? 120 Let t = 454 + -452.07. Round t to 1 decimal place. 1.9 Let t = -0.08 - 0.78. What is t rounded to 1 dp? -0.9 Let d = -137395.87079 - -137477.87. Let k = -209 + 127. Let i = d + k. What is i rounded to 4 decimal places? -0.0008 Let m = 36423157 - 10576417. Let k = -25846714.0000168 + m. Let b = k - 26. Round b to 6 decimal places. -0.000017 Let d = -1.93 - -2.1. Let u = -0.1 + d. What is u rounded to 1 decimal place? 0.1 Let c = -6.000021 + 6. Round c to 5 decimal places. -0.00002 Let s = -375.283 - -375. What is s rounded to one dp? -0.3 Let t(u) = 6481u - 5. Let h(w) = 2w - 1. Let c be h(3). Let g be t(c). Suppose 5p = p + g. What is p rounded to the nearest one thousand? 8000 Let r = 0.08 - 0.248. Let o = 0.17 + r. Round o to two decimal places. 0 Let l = -30.75 - -31.7476. Let k = 1 - l. What is k rounded to 3 dps? 0.002 Let v = 82.999963 + -83. Round v to five dps. -0.00004 Let z be (-1)/(-4) + (-9)/4. Let c be (z - 2/(-1)) + -4. Let y(p) = -999p*2 + 5p + 4. Let s be y(c). Round s to the nearest ten thousand. -20000 Let o be 3/(-3 + 2) - -1203. Round o to the nearest 1000. 1000 Let b = -19 + 29. Let x = 10 - b. What is x rounded to 1 dp? 0 Let j be (-1014)/(2 - (-122284)/(-61144)) + 4. What is j rounded to the nearest one million? -16000000 Let u = 15.81 + -16. Let v = -0.190009 - u. Round v to 5 decimal places. -0.00001 Let r be (1 + -3)/(-4)0. Suppose -15 = 5l - rl, 4700 = 4n - 4l. Suppose -i - 388 = -p, -4i - n = -i + p. What is i rounded to the nearest 100? -400 Let p = 239 - 253.1. Let u = -0.33 + -16.67. Let y = u - p. What is y rounded to the nearest integer? -3 Suppose 0 = -2o - 10o + 72000000. Round o to the nearest one million. 6000000 Let p = 226292729.999909 - 226292571. Let t = 159 - p. What is t rounded to five dps? 0.00009 Let z = 7984 - 7983.4993. Let w = z + -0.5. What is w rounded to four decimal places? 0.0007 Let f = -9.5999893 - -9.6. What is f rounded to 5 decimal places? 0.00001 Let o = -46.9 + 43.13. Let z = -0.17 - o. Round z to 0 dps. 4 Suppose -a - 4820 + 1418 = -k, -a - 3392 = 4k. Round a to the nearest 1000. -3000 Let h = -0.165 - -0.16377. Round h to 4 dps. -0.0012 Let i = 45 - 76. Let l = -30.99999953 - i. Round l to seven decimal places. 0.0000005 Let i = -0.09976 - -0.1. What is i rounded to 4 dps? 0.0002 Let k = 283 - 174. Let h = -104.3 + k. Round h to 0 decimal places. 5 Let k be (-6)/(-21) - (-66)/14. Suppose -kq + 60000 = -2q. Round q to the nearest 100000. 0 Let h = 1063.197 - 1064. Let i = 20 - 20.72. Let s = i - h. Round s to 2 decimal places. 0.08 Let o = -1988779 + 1988770.99999. Let f = o + 8. What is f rounded to 6 dps? -0.00001 Let k be 1583996/(-18) - 6/27. What is k rounded to the nearest 10000? -90000 Let v = 8 - 13. Let y = v + 5.00000025. What is y rounded to 7 decimal places? 0.0000003 Let k = 8442284 + -4485729. Let d = k - -4543445. Round d to the nearest one million. 9000000 Let c(k) = 14k*3 - 3k + 9. Let o be c(-8). Let n = o - -12170. Suppose n = -5i - 1965. What is i rounded to the nearest 1000? -1000 Suppose r + 3u = -222 + 55, -2u + 801 = -5r. Round r to the nearest ten. -160 Let o = -0.027 + -4.073. Let p = o + 4.10000095. Round p to seven decimal places. 0.000001 Let x = -0.66 + 102.66. Let j = x + -47. Let u = j + -55.063. Round u to two dps. -0.06 Let j = 5914208 - 5914208.32000052. Let v = j - -0.32. Round v to seven dps. -0.0000005 Let s = 45415 - -26585. Round s to the nearest ten thousand. 70000 Let u = -22 + 20.98. What is u rounded to 1 decimal place? -1 Let x be 0/(-121). Let z be 0 - (-1 - x - -2). Let v be (2z)/(1/11500). Round v to the nearest ten thousand. -20000 Let y be 0/((-6)/15-5). Let l(m) = m*2 + m + 8300. Let w be l(y). What is w rounded to the nearest one thousand? 8000 Suppose 4d = f - 0f + 4, 0 = f - 3d + 2. Suppose 2y = 4y + 3n - 59994, fn + 90008 = 3y. What is y rounded to the nearest 10000? 30000 Let y = -33 - -18. Let g = y - -14.999993. Round g to five decimal places. -0.00001 Let u = -0.22 - -23.22. Let z = 426578378 - 426578400.9999937. Let r = z + u. Round r to six dps. 0.000006 Let i = -84 + 54. Let a = i - -56. Let m = 25.999951 - a. What is m rounded to 5 dps? -0.00005 Let k be -59200 + (0/(-1)1)/(-2). What is k rounded to the nearest 10000? -60000 Let y = -13.00000115 - -13. What is y rounded to 7 decimal places? -0.0000012 Let p = 4.9 - 0.7. Round p to the nearest integer. 4 Suppose 0 = -o - o - 584626. Let k = o + -2523691. Let h be (-4)/(-22) - k/(-22). What is h rounded to the nearest 10000? -130000 Let v = -44.368143805 + -52280.551837195. Let y = v + 52329.62. Let r = y - 4.7. Round r to five dps. 0.00	{ "pile_set_name": "DM Mathematics" }
Suppose -2f - 7 + 2 = n, n - 4 = f. Sort y, n, 5 in decreasing order. 5, y, n Suppose 4k + 3q = 2, -3q = -4k + 2q + 18. Let r = -31 + 28. Let v be k/r33/88. Put v, -2, -0.2 in descending order. -0.2, v, -2 Let m = 0.55 + -0.65. Put 0, m, -2, 0.01 in ascending order. -2, m, 0, 0.01 Let n be (0 - (-335)/(-10))/((-1)/(-2)). Let c = 71 + n. Let u = 6 - 3. Put 5, u, c in descending order. 5, c, u Let r = -5.0065 + -0.9935. Let a = 0.2 - 0.4. Let w = 5.3 + -5. Sort r, a, w in decreasing order. w, a, r Let k = -36 + 39. Suppose -4a - kt = -8t - 4, 0 = 4a - t + 12. Let o be (2 - 0) + 2/(-2). Sort o, -5, a. -5, a, o Let n(h) = 5h3 - h2 - 2h - 1. Let k be n(-1). Let z(j) = j - 7. Let g be z(0). Let o(v) = 127v - 131. Let y be o(1). Sort k, y, g. g, k, y Let y = 13 + -11. Suppose -ym - 18 = -5t, 3m - 3t = -4t + 7. Let a = m + -5. Put a, -1, 5 in decreasing order. 5, -1, a Suppose -6 = -2n + 3d + 4, 3d = 3n - 9. Let t = 27 + -21. Let r(x) = x3 - 5x*2 - 5x - 5. Let p be r(t). Sort p, -2, n in descending order. p, n, -2 Let m = -3 - -2. Let r = m - 3. Let s be (8/(-304))/((-2)/(-8)). Sort -2, r, s in decreasing order. s, -2, r Let m = -5 - -2. Let g = 1465.8 - 1466. Put 0.1, g, m, -5 in increasing order. -5, m, g, 0.1 Let m(q) = -6q - 110. Let x be m(-18). Put x, 6, -4 in increasing order. -4, x, 6 Let f = 22 - 17.8. Let a = 3.7 - f. Let k = -8 - -8.3. Sort a, -5, k in ascending order. -5, a, k Let v be 15/(-3) - ((-4 - -5) + -4). Let w(m) = -2m*2 - 11m + 32. Let p be w(-8). Sort p, 2/5, v in decreasing order. 2/5, v, p Let h be (-12)/42(-56)/(-96). Let p = 9/5 - 23/10. Sort p, h, 2 in decreasing order. 2, h, p Let r = 0.9157 - -0.0843. Sort 4, r, -3/25 in decreasing order. 4, r, -3/25 Let b(c) = 12c*3 - 143c*2 - 11c - 12. Let m be b(12). Let v be 2 + (4/2)/2. Put v, -3, 13, m in decreasing order. 13, v, m, -3 Let n be -13/11. Let v = -39 - -42. Suppose 5t - 33 = -3x - 14, -3t - vx = -9. Sort n, 0, t. n, 0, t Let h = 0.1 - 0.2. Let v = 1.6 - 4.6. Let c = v - -3. Sort h, -3, c. -3, h, c Suppose -39 = 4u - 19, 4j + 4u = -40. Sort 2, -50, j in ascending order. -50, j, 2 Let n = -9 - 11. Let b = 10 + n. Let q = 15 + b. Put 2/3, -2/7, q in descending order. q, 2/3, -2/7 Let h(s) = 7s*3 + 11s*2 - 4s - 2. Let g(l) = 3l3 + 5l*2 - 2l - 1. Let x(o) = 5g(o) - 2h(o). Let d be x(-2). Sort d, 4, 3. 3, 4, d Let t be (((-8)/6)/(-1))/(48/72). Sort 13, 5, t in ascending order. t, 5, 13 Let j = -0.0287 + -0.4713. Let b = 4 - 6. Sort j, b, 1/3, 0. b, j, 0, 1/3 Let d(m) = 3m + 3m + 12 - 4m + 4. Let b be d(-9). Let q(c) = c3 - 9c*2 + 9c - 8. Let j be q(8). Sort 4, j, b in decreasing order. 4, j, b Suppose -15 = -5f, a - 3f - 3 = -f. Put a, 2, -4 in increasing order. -4, 2, a Let v be (2 - 3) + (-23)/(-1). Let g be v/55(0 - -5). Sort g, -4, -5, 4. -5, -4, g, 4 Let a(y) = y3 - 10y*2 - 7y + 11. Let d be a(11). Suppose -d = 5o - 16o. Sort -5, o, 1, 2 in ascending order. -5, 1, 2, o Let n(i) = i - 12. Let g be n(9). Let h(p) = p - 2. Let a be h(-2). Let c = 261 - 262. Put a, c, g in ascending order. a, g, c Let l = 196 - 216. Suppose -5w - 9 = 1. Put w, 3, l in ascending order. l, w, 3 Let y(g) be the second derivative of 2g*3/3 + 4g. Let w be y(-4). Let r = -26 - w. Sort -2, r, 1 in decreasing order. 1, -2, r Suppose 2d - 25 - 2 = -5a, -a = -5. Let q = 6 - 3. Put d, -1, q in decreasing order. q, d, -1 Let j be ((-2)/5)/((-74)/185). Put -4, 27, 5, j in ascending order. -4, j, 5, 27 Let o = -7028 - -21083/3. Let u = 0.3 + -0.32. Put 1, u, 1/4, o in decreasing order. 1, 1/4, u, o Let b be ((-2)/5)/((-1)/5). Let h be ((-1)/3)/(2/(-18)). Let u = -615 + 613. Put u, b, h in decreasing order. h, b, u Let c = -1.35 - -0.15. Let z = c - -1.4. Let r = -0.15 - -0.55. Sort z, -1/8, r in decreasing order. r, z, -1/8 Suppose 59u + 13 = 46u. Let f = -2/37 - 33/74. Sort f, 3/2, u in ascending order. u, f, 3/2 Let l be (-8 + 7)/(1/(-5)). Let j = -1443 - -1442.8. Put 0.2, 4, j, l in decreasing order. l, 4, 0.2, j Let d be (-8(-1)/8)/((-1)/3). Suppose t - 13 = -5m, -21 = 5m - 10m + 3t. Put d, m, 5 in descending order. 5, m, d Let i = -4 + 5. Let g = 4.08 - 4.1. Let j = g - 0.18. Sort j, -2/7, i in increasing order. -2/7, j, i Let d be 3/(-5) - 3/(-15). Let k be (532/(-2660))/((3/10)/1). Sort 2, d, k in decreasing order. 2, d, k Suppose 13c = 12 + 14. Sort c, 21, -4, 5 in descending order. 21, 5, c, -4 Suppose -6m = -11 - 13. Put 41, -1, m in descending order. 41, m, -1 Let g(x) = x3 + 4x*2 + 4x - 1. Let z be g(-3). Let q be (-1)/((-3)/6)-1. Let d(j) = j3 - 18j*2 + 31j + 18. Let k be d(16). Sort k, q, z. z, q, k Let n(j) = -519j - 1555. Let l be n(-3). Suppose w = 6w + 4a - 37, -25 = -2w - 5a. Let h = 1 - 1. Sort h, w, l in increasing order. h, l, w Suppose 8 = 4w - 0, -3t + 4w - 89 = 0. Let z = 44 + t. Let m = z + -22. Put m, 1, -10 in descending order. 1, m, -10 Suppose 3b = 2s - 25, 0 = 4s + b + 2b - 59. Let a be 9/(-2) - 7/s. Sort 4, -3, a. a, -3, 4 Let o(t) = t - 1. Let f be o(1). Let l = 4 - -2. Suppose -3k + c + 5 = -3, -k - 4c - l = 0. Sort -2, k, f. -2, f, k Let g be (1 + -1)(33 + -34). Sort 1, g, 2. g, 1, 2 Suppose -82f + 60f - 110 = 0. Let x be ((-5)/(-2))/(1/2). Let n = 0 + x. Put n, f, -1 in descending order. n, -1, f Let l = -23 + 35. Suppose -l = 3f, 16 = -0b + 3b - 4f. Let p = 2 - 1. Sort b, -3, p. -3, b, p Let k(v) = -v2 + 25v - 24. Let n be k(24). Suppose -4r + 2y + 10 = n, -2r = 5y + 39 - 14. Put r, -1, 5 in descending order. 5, r, -1 Let a = -18.1 + 17.8. Sort 3, 9, a. a, 3, 9 Suppose 7j + 18 = -5h + 3j, -8 = -h + 5j. Put 2/7, h, 4, -0.06 in decreasing order. 4, 2/7, -0.06, h Let v be 4356/(-5940) - ((-39)/60 + 2/8). Let z = 6 + -1. Sort z, -4, 3, v in increasing order. -4, v, 3, z Let w = -206 - -161. Let d be 2/13 - w/(-39). Suppose n + 4n = 10. Sort n, d, 3 in decreasing order. 3, n, d Let u be ((-4)/52)/(-12 + 13)-2. Sort -1.1, -0.2, 0.06, u in ascending order. -1.1, -0.2, 0.06, u Let y be (-21)/35 - 49/35. Sort 4, -4, y. -4, y, 4 Let i = 0.5 - -6.5. Let o = i + -7. Let m = 52.9 - 53. Put o, -1, m in decreasing order. o, m, -1 Suppose -3g + 8g - 25 = 0, -4g = 2l - 44. Let y = -10 + l. Suppose n - y = 1. Sort 5, n, 2 in ascending order. 2, n, 5 Let i = -14 - -13.91. Let n = i - -0.34. Let j = 0.15 - n. Sort -1/3, 1, j. -1/3, j, 1 Let s = -7.9 - -0.9. Let u = s - -12. Sort 5/6, u, 3/4, 2/5. 2/5, 3/4, 5/6, u Let r = -2 - -12. Suppose r - 8 = 2v. Suppose -5m + 16 = v. Sort m, 5, -2 in ascending order. -2, m, 5 Suppose 2o + 21 = -5z, -z - 11 = o - 4o. Put -2/11, z, -2/13, 0.5 in ascending order. z, -2/11, -2/13, 0.5 Let a = 18 - 17. Let g = 574/153 - 60/17. Sort -4, g, a, 3. -4, g, a, 3 Let u = 294 - 293.5. Let i be (-2 - -1) + 5 + 1. Suppose -il - 30 = -0l. Put 4, u, l in decreasing order. 4, u, l Let u = -2898 - -2898. Sort 3, -4, u, 4 in descending order. 4, 3, u, -4 Suppose f = 5 - 4. Let t = 24.2 - 24.2. Put -3, -4, f, t in decreasing order. f, t, -3, -4 Suppose 9v - 2v - 49 = 0. Let k be 1 + -1 - (v - 9). Sort 5, 1, k in decreasing order. 5, k, 1 Let m = -151 + 169. Sort 6, -4, m, 3. -4, 3, 6, m Suppose 5l = 304 - 299. Put l, -2, -6, -4 in descending order. l, -2, -4, -6 Let h(i) = -2i3 + 2i2 + i. Let n be h(-1). Let b(q) = q + 1. Let w be b(-5). Sort w, n, -3, 7 in descending order. 7, n, -3, w Let p = 49 + -48.954. Let r = p + -0.546. Sort 3, 1/4, r. r, 1/4, 3 Let g = 128 - 642/5. Let n(j) = j3 - 12j2 + 15j - 40. Let o be n(11). Sort o, g, 1 in decreasing order. o, 1, g Suppose 0 = -5h + 10, -3h - 11 + 3 = -r. Let o = -146 - -147. Sort o, r, 5, -0.2. -0.2, o, 5, r Let d(g) = g*2 + 11g + 14. Let z be d(-9). Let t be (-40)/(-15)6/z. Sort 2, 3, t in descending order. 3, 2, t Suppose 4w = w + 12. Let c = -340 - -343. Put -2, w, c in descending order. w, c, -2 Let o be (-40)/(-15) - (-1120)/48. Sort 5, o, -4 in ascending order. -4, 5, o Let s = -976/7545 + -2/503. Let l = -6 - -4. Let z be l/(-4) - (-6)/(-4). Put s, -3/5, z in ascending order. z, -3/5, s Let n = 1.1 + 1.9. Let x = 4693/2 - 86769/37. Let o = -4/37 - x. Sort o, 1, n in decreasing order. n, 1, o Let f = -1.28 + 97.28. Let j = -98 + f. Suppos	{ "pile_set_name": "DM Mathematics" }
8d - 16, zd + i = s for s. 4 Let f(w) = -2w + 4. Let u be f(6). Let x(n) = 3n + 24. Let v be x(u). Suppose -3b - 5 + 38 = v. Solve -2q - 5o - b = 2q, -4o - 14 = -2q for q. 1 Let k be 0/((-1)/(-2)-10). Suppose -12 = -86i + 82i. Solve kl + i = -3l - 2g, -3g + 15 = -2l for l. -3 Let h be (-115)/23 + 185. Let j = h + -68. Suppose 0 = 12u - 8u - j. Solve uk + 2m + 13 = -0m, 5 = -3k + 2m for k. -3 Let g = 3970 - 3942. Solve -5l - g + 14 = 3f, -3f + 18 = -3l for l. -4 Let y = 8 + -3. Suppose 0 = -25b + 18b - 3521. Let p = b - -514. Solve p = 3o - 1, 5v - yo + 30 = 0 for v. -2 Suppose 7l + 187 = 24l. Suppose 11 = ln - 11. Solve m - 21 = 4q, 8 = -q + nm + m for q. -5 Suppose -7 = 4o - 3i, -3i = o - 19 + 17. Let f(m) = 6m*2 + 2m - 2. Let x be f(o). Solve -5z + 15 = a, xa + 0a + 4z = 12 for a. 0 Let w(x) = -x*2 + 7x + 18. Suppose 5s = 2s + 15. Suppose -4r + 0h + 16 = sh, r + h = 5. Let p be w(r). Solve pu + 10 = -a - 4u, 2u + 2 = -2a for a. 2 Suppose 2w = -0w + 3x + 166, 0 = 2w - x - 170. Let h = 74 - w. Let a be (-12)/(-7) - h/42. Solve -5j - 2n = 8, j - 4 - 4 = an for j. 0 Suppose 0 = 616n - 641n. Solve -4y + 27 = h + 7, n = 5y - 3h - 25 for y. 5 Let f be (-1)/((-20)/12)-5 + 6. Suppose -fb - 14b + 255 = 0. Solve -2n - 20 = -4a - 0a, 3n - b = -3a for a. 5 Let r be 1 + 2 + 406/(-29). Let a be r/(-55) - 3/15. Solve -z - 2 = -a, 0 = -f - z - 5 for f. -3 Let l = -27 - -29. Suppose 6t = -lt + 32. Suppose o + o - 12 = 2a, 3o + ta + 3 = 0. Solve 4u + 9 = m, 11 = m - ou + 4 for m. 1 Suppose -2o + 51 = -1. Let n be (-4)/((-3460)/(-120) + -28 - 11/6). Solve 0q + 4q = 2i - o, -i - 17 = nq for q. -5 Suppose -2u + 19 = -18 + 27. Solve 0 = b - 2, -10b + 10 = 3w - ub for w. 0 Let b(o) = -o3 + 7o*2 - o + 11. Let k be b(7). Let w = -3985 - -3988. Let v be ((-1 + 1)/1)/(-2). Solve 0 = -wt + 3a + 9, -ka + 4 = -va for t. 4 Let t = -561 + 579. Solve -4x = 3p - 4, -17x + 18x - 4p + t = 0 for x. -2 Let h = 1157 - 561. Let f = -592 + h. Solve -5l + f = 4q + 1, 0 = -4l - 4q for l. 3 Suppose -3g = -8g - 100. Let l be -7 + 5 - (1 + 1 + g). Suppose 0 = a - 2s - 6, a = -2a - 5s + 18. Solve -ay + 2y - 2h = 8, -2h + l = -2y for y. -4 Let s(n) = -n*3 - 15n*2 - 9n + 12. Let g be s(-14). Let h = 10 + g. Let i = h + 50. Solve -5o + 4d = 4, id - 1 - 3 = 3o for o. -4 Let y = -35 - -36. Suppose y = -3m + 4. Let s be -10 + 18 - (5 - m). Solve v + 0v = -d + s, -2d = 3v - 8 for d. 4 Suppose 5 - 1 = 2g - 5z, 2g = -z + 28. Solve 3h + 4w - 15 = 0, 2h + w = g - 2 for h. 5 Let c(b) = -2b3 + 50b*2 + 104b + 122. Let f be c(27). Solve 2z - 12 - f = -5r, 0 = -2z - 2r + 14 for z. 3 Let n be (-472)/(-34) + (96/102)/8. Solve 0i = 2i + 4v + 10, -5v - n = 3i for i. -3 Let c be ((-1)/(-5) + 1)/(120/400). Suppose -15x + 4 = -13x. Solve -l + 5 = 5p + xl, -l = -4p + c for p. 1 Suppose -3f - 8 = -5f. Let x(r) = 800r + 280 - 389r - 386r. Let g be x(-11). Solve -5d - gp - 9 = 1, 5d - fp + 19 = 0 for d. -3 Suppose 0n - n + 34 = 0. Suppose no - 95 = 15o. Solve -2q = -2s - 4, q + 10 = -os - q for s. -2 Let p = 7329 + -7309. Solve 3k + pg = 17g + 3, 0 = -2g + 10 for k. -4 Let f(x) = 3x*3 - 11x*2 - 125x + 490. Let n be f(4). Solve 0 = 2v - 4c + 10, nv = v + c + 11 for v. 3 Let g be 0 + 1/(1/4). Suppose -2u + 2 = 0, -89u + 93u - 1 = -2w + 3. Solve -4 = gr + 2f, 5r + 0f - 3f - 17 = w for r. 1 Let g be -2 - 144/(-68) - (-3136)/1088. Solve 19u + go = 20u + 10, -3o + 6 = 0 for u. -4 Suppose -3 - 13 = -4a. Suppose 82s + 207s - 2233 = -30s. Solve s = 2r - z, 0 = -4r - az - 4 - 0 for r. 2 Suppose -3 = -2r + r. Let x(q) = 34q - 98. Let k be x(4). Suppose -4 = 38j - 34j, -k = -2d + 2j. Solve 2v + v - d = -3h, -2v = -rh - 7 for v. 5 Let x = -20 + 26. Let z be (-2)/3(-3 - 45/x). Suppose 3w - 2 = z. Solve 0 = 4p + 2v - 3v + 21, wp + 2v + 2 = 0 for p. -4 Let k = -4091 - -4091. Solve c + 4q - q + 4 = 0, k = -q for c. -4 Let w be 11/2 - (-3)/(-6). Suppose 5d = 43z - 38z - 65, z + 5d - 7 = 0. Solve -v = -3s + 14, -3v + wv = -2s + z for v. 1 Suppose 2b - 5f = 17, 5f - 12 + 5 = -2b. Let o be 96 + (-1 - b/2). Let s = o - 89. Solve -3q - 6 = 0, sv + 9 = q + 2q for v. -5 Let f be (-2)/4(23 + 591). Let y = 309 + f. Solve -5r = 2s - 10, 5r - 35 = ys + s for r. 4 Let g(w) = -w3 + 6w*2 - 5w + 26. Let d be g(6). Let q be -1(11 + 5)/d. Let v = -6 - -11. Solve -j - m - v = qm, -4j - 2m - 20 = 0 for j. -5 Suppose d + 2c = 20, -2d + 3c + 107 = 130. Suppose -4y - 8 = -8y. Let v be 4 + ((-3)/5 - (-8)/5). Solve -4r - 23 = vk, -dr - 14 = yr + 2k for r. -2 Let d(j) be the second derivative of -j5/20 + j4 + 5j3 - 14j*2 + 39j. Let a be d(14). Solve ab + 9 = -5r + 2b, 2r = 4b - 10 for r. -1 Let u = 35 + -25. Suppose -3v = -5t + 40, -v + 14 + u = 3t. Suppose -4m = -6m + t. Solve -4k - 28 = -my, 10 = 4y - 2y - k for y. 3 Let u = 7429 + -7423. Solve 5g = 3b + 19, -ub - 7 = -g - 7b for g. 5 Let n be -189 + 194 + -1 + 5. Solve 0 = -4q + 174x - 170x, -3x = n for q. -3 Let j = -253 + 266. Suppose 3s - 4f - j = 0, -5s - 5f = -4s + 2. Solve -sy - 12 = 2y + 2i, 0 = -5y + 4i - 36 for y. -4 Suppose 3f - 18 = -6. Suppose 4g + 7a - 3a = 204, -5a - 5 = 0. Let p be ((-39)/g)/(1/(-4)) + 7. Solve -ft + 0t = 2h + p, 13 = -2h - 5t for h. 1 Let j(t) = -6t3 + 10t*2 - 2t - 2. Let g be j(1). Solve -3m + 5d = 7d + 21, 4m - d + 17 = g for m. -5 Let c = 65 - 63. Suppose 5f - 5h - 160 + 485 = 0, -ch = 8. Let t = f + 83. Solve n - 5n + 21 = 5i, 2i - 4n + t = 0 for i. 1 Suppose 3w - 10 = -2n, 10w - 10n = -6n + 44. Suppose -5x + 5b = -10, 3x - 10 = 5x + 5b. Solve -5h = 2j + 12, xj + wj + 3h = 4 for j. 4 Let r = 8180 - 8175. Solve rf + 1 = 2m, -m + 4f - 5 + 7 = 0 for m. -2 Let v = -331 - -333. Suppose 4z = 3o - 7 - v, -o + 3 = 5z. Solve 4r - 4 = z, -5w - r = -5r + 14 for w. -2 Let v = -3105 + 3113. Solve 4p + 225l - 229l = -v, -2l = -p - 1 for p. -3 Let o(t) = 2t*3 - 115t*2 + 55t + 118. Let n be o(57). Solve -5j + 3w = 31, 6j - j - nw = -33 for j. -5 Let j = 3453 - 3451. Solve -5o = -5t - 6 + 1, -3t = jo + 23 for t. -5 Suppose k - 11 = -4j, -5j - 42k + 5 = -39k. Solve -5s = -2u + 7, js - 9s - 23 = 2u for s. -3 Let m(l) = -6l + 3. Let j(t) = -17t + 8. Let x(s) = 3j(s) - 8m(s). Let g be x(8). Let d = g - -24. Solve 3y - 2y - 5o = -13, d = -5o + 10 for y. -3 Suppose 252h - 256h = 5m - 101, -2m + 242 = 10h. Solve 0 = 5c - 4y + 8, -3c + 2y = 30 - h for c. -4 Suppose -329 = -b - 330, 4a - 4b = 20. Solve 6z - 9z = -ap + 15, 11 = 4p + z for p. 3 Let z be 21/56 + 84/32. Suppose -s - 10 = 3i, 3s + 2s - 26 = 4i. Solve 0 = st - a - z, 5t + a + 0a = 11 for t. 2 Let t(q) = -4q - 27. Let b be t(-9). Solve 5i = s + 15, -91s = -96s + 3i - b for s. 0 Suppose -f = 3n - 807, 2f = -4n + n + 1617. Let c = f - 810. Solve -3m - i - 11 + 1 = c, 0 = 5m - 2i + 2 for m. -2 Suppose -177 = -14a + 439. Suppose 0 = -10y + 104 - a. Solve 3c = x + 2, -5c = -7x + 3x + y for x. 4 Let c(g) = -g*3 + 16g*2 - 12g - 221. Let j be c(14). Solve h - 4 + 1 = 2w, -3w - jh = 0 for w. -1 Let w(r) = 14r + 16. Let q be w(-1). Suppose -4h = -qm, -4m - 12 = -3h - 22. Solve -3s + 5o - 4 = -4s, 5s = -o - m for s. -1 Let b be 12/(-8) - (-18)/12. Suppose -6j - j = b. Solve -2w = j, 2w = 3l - l for l. 0 Let f = 162 - 167. Let v(y) = y*3 + 7y*2 + 12y + 16. Let l be v(f). Solve -2b + 4p = -l, -b + p - 4p = -8 for b. 5 Let h be 4/12 - 185/(-3). Suppose -h + 476 = -3p. Let x = -118 - p. Solve -x = -5r + 4d, -6d = -3d + 15 for r. 0 Suppose t + s = 13, -t + 4s + 0s = 12. Suppose -20k + 1167 = 311k + 174. Solve 3m + kn - 24 = 0, 0m + 4m - 2n - t = 0 for m. 4 Suppose 47s - 32 = 63s. Let m be ((-312)/(-52))/((-4)/s). Let w be (7/21)/(1/15). Solve -wo + mj + 5 = 0, -4o - 2j = 4 + 14 for o. -2 Let r(n) = 56n - 29. Let z be r(9). Suppose 7x = -370 + z. Solve -5g + 5 = -5k, 4g - 5g - x = -5k for g. 5 Suppose 4541 = -f + 5i + 4550, -i + 21 = f. Solve 5 = -w - 12j + 15*j, -f	{ "pile_set_name": "DM Mathematics" }
000174 - 100. Round o to seven dps. 0.0000017 Let q = 3.35 - 3.349999737. What is q rounded to seven dps? 0.0000003 Let o = -358 - -246. Let f = -111.863 - o. What is f rounded to two dps? 0.14 Let j = 3246 + -3241.966. Let l = 4 - j. What is l rounded to 2 dps? -0.03 Let l = -34.94 + -0.06. Let y = l + 29.8. Let h = y - -2.8. Round h to the nearest integer. -2 Let l = -6854.323 + 702.064. Let n = -6146 - l. Let c = n + -6.3. Round c to 2 dps. -0.04 Let d = 2.38 + -2.37869. Round d to four dps. 0.0013 Let p = -7.18 - -0.18. Let h = p + 6.9999981. Round h to seven decimal places. -0.0000019 Let t = 12.1 - 0.3. Let k = -2.4 - -13.4. Let g = k - t. Round g to one decimal place. -0.8 Let y = -1285303466 - -1285303546.0000059. Let h = -80.23 + 0.23. Let r = y + h. What is r rounded to 6 dps? 0.000006 Let h = 15 + -13.71. Let x = 2.234 - h. Let p = x + -1. Round p to two dps. -0.06 Let u = -44 + 43.36. Round u to one dp. -0.6 Let l = 3070 - -12330. Round l to the nearest 1000. 15000 Let j = 23352402 - 23352354.000043. Let k = j - 48. Round k to five dps. -0.00004 Suppose -5 = 2d - d. Let g be d(-2 - -1 - 0). Suppose -2999985 = 5u - gq, -q = u + 292111 + 307892. Round u to the nearest 100000. -600000 Suppose -5c = -1 - 19. Let p be (-1)/c - 7/4. Let y be 0 - (1 - (3 + p)). What is y rounded to the nearest one million? 0 Let r = -12.87 + 13. Let a = r + 18.07. Round a to the nearest integer. 18 Let f = 5 + -9. Let w = 0 + f. Let n be (-1759998)/w + (-4)/(-8). Round n to the nearest one hundred thousand. 400000 Suppose -7 - 8 = -3v. Let c be (-2)/(-5) + 2198/v. What is c rounded to the nearest one hundred? 400 Let b = 508263.998 + -507635. Let y = b - 627. Let h = 2 - y. Round h to three decimal places. 0.002 Let x be ((-1)/(-4)6)/(3/(-692)). Round x to the nearest ten. -350 Suppose 5z = c + 19, -2c = -3z + c + 21. Suppose 0s - z = -4w - 5s, 2w = s + 5. Suppose 0 = -wm + 75968 + 4032. What is m rounded to the nearest 10000? 40000 Suppose 4c - 8 = 12. Suppose 376 + 1174 = -cd. Round d to the nearest 100. -300 Let y = -1.85096 - -0.050908. Let v = -1.8 - y. What is v rounded to five decimal places? 0.00005 Let c = -0.17 - -0.1699364. Round c to 6 decimal places. -0.000064 Suppose -n = n + 264000. What is n rounded to the nearest 10000? -130000 Let t = -2357.2 + 2355.5809. Let h = -1.63 - t. What is h rounded to three decimal places? -0.011 Let k = -0.16 + -0.04. Round k to zero decimal places. 0 Let u = -15.66 - -20.1. Let f = -46 - -46.46. Let r = u + f. What is r rounded to 0 decimal places? 5 Let x be 6/550/20. Suppose 4p + 6c - 1185 = c, -5c = -xp + 845. What is p rounded to the nearest 100? 300 Suppose 0 = y - 5 + 19. Let u be ((-405558)/21)/(2/y). Suppose -r + 15814 + u = 0. What is r rounded to the nearest 10000? 150000 Let m = -1040 - -950.8. Let i = 180.8 + m. Let o = -106 + i. What is o rounded to the nearest integer? -14 Suppose 3p - 111 = 3d, -2d = 3 + 5. Let w = p + -47. Let u be (-32204)/w - (-10)/(-35). Round u to the nearest one thousand. 2000 Let z = -42.1 + 40. Let o = -1.987 - z. Round o to two dps. 0.11 Let w(u) = 38815u*2 - 4u - 4. Let v be w(4). Let i = -219020 + v. Suppose 2z - i = 5z. What is z rounded to the nearest 10000? -130000 Let g = -51688 + 51674.9985. Let y = g + 13. What is y rounded to three decimal places? -0.002 Let q be 4/18 - 292270/18. Let y = 8237 + q. Round y to the nearest 10000. -10000 Let a(f) = -f*3 - 3f*2 - 4f - 1. Let x be a(-3). Let i(s) = -6086s3 + 4s*2 - 2s + 4. Let u be i(x). Round u to the nearest one million. -8000000 Let r be 1/((-21)/(-12)) + 26596/7. What is r rounded to the nearest one thousand? 4000 Let q = -62 - -61.951. Let g = q + 0.04900054. Round g to 7 dps. 0.0000005 Let j = -7.3 - 74.7. Let x = j + -16. Let o = 98.00000043 + x. What is o rounded to seven dps? 0.0000004 Let b = -188.54707783 + 73.5470788. Let o = b - -115. Round o to seven dps. 0.000001 Let o = -2.97 - 0.43. Let w = o - -3.40033. What is w rounded to 4 dps? 0.0003 Let h = 0.17000101 - 0.17. Round h to seven decimal places. 0.000001 Let y = -58709 + -6591. Round y to the nearest 10000. -70000 Suppose -s - 3121 - 18381 = 5p, -5p - 21498 = -s. Round p to the nearest 1000. -4000 Let h be ((-4)/2)/(1/(-7)). Let j be (-1332)/(-7) - 4/h. Round j to the nearest ten. 190 Let o(j) = 86586j2 + 3j + 2. Let h be o(-2). Let b = h - 142340. Round b to the nearest ten thousand. 200000 Let v = 29184081338.3999936 + -29184156984. Let w = 75646 + v. Let m = 0.4 - w. What is m rounded to 6 decimal places? 0.000006 Let a = -40.57 + 40. Let f = 3.27 + a. What is f rounded to the nearest integer? 3 Let t = -22.991 + -0.009. Let m = 23.00000009 + t. What is m rounded to seven dps? 0.0000001 Let r = -25.5 - -25.619. Let w = r - 0.012. Round w to two decimal places. 0.11 Suppose 790636 = 4y - 16809364. What is y rounded to the nearest one million? 4000000 Let t(p) = -10533p*3 - 6p*2 + 2p - 5. Let q be t(-5). Let v = -26460 + q. What is v rounded to the nearest one hundred thousand? 1300000 Let h = 0.21095 + 0.0927. Let g = h + -0.3933. Let c = -0.09 - g. What is c rounded to four dps? -0.0004 Let f = -1039.3 + 1031.2952. Let d = 8 + f. What is d rounded to 3 dps? -0.005 Suppose -1912 = -3m - 2k, -2544 = -0m - 4m - 4k. Round m to the nearest one hundred. 600 Suppose j = 3p - 2p - 1295, 2p = -2j - 2570. Round j to the nearest one hundred. -1300 Let d be (-12 - 1)/(-1) + 2. Suppose 2p + d = 5p. Let n be 3198/p - (-2)/5. Round n to the nearest 100. 600 Let a = 8602.29 + -8654. Let d = 52 + a. Let w = -0.3 + d. Round w to three dps. -0.01 Let r = 304608 - 182308. Let f = 122354.0043 - r. Let g = 54 - f. Round g to 3 decimal places. -0.004 Let b = 0.24 + 14.76. Let k = 7 - b. Let m = 8.056 + k. Round m to 2 dps. 0.06 Let m = -1.011 + 1. Let n = 0.072 - m. Round n to 2 dps. 0.08 Suppose 4t - i = 7, t + 4i - 4 = 2i. Suppose j + tj - 18106443 = 0. Suppose 2q + 8364519 = -j. What is q rounded to the nearest one million? -7000000 Let r = 71.1 - 74. Let u = -1.1 + r. Let c = u + 3.961. What is c rounded to two decimal places? -0.04 Let z(p) = -p*3 - 4p*2 + 3p*2 + 2p*3 - p + 2 + 0p*3. Let o be z(2). Suppose -oy = -5610924 - 11989076. What is y rounded to the nearest one million? 4000000 Let q = -163.3 + 154. Let t = -8 - q. Round t to one decimal place. 1.3 Let h(c) = c*3 - 11c*2 - 15c + 8. Let r(a) = 2a2 - 4a - 4. Let f be r(4). Let d be h(f). What is d rounded to the nearest ten? -30 Let h be -1 + -3 + 1 + -149997. What is h rounded to the nearest one hundred thousand? -200000 Let n = 0.228 + -0.16. Let a = n - 6.168. Let v = -6.100078 - a. What is v rounded to five dps? -0.00008 Suppose -u - 5x = -13924765, -4x = -6u + u + 69623854. Let z = 19524770 - u. What is z rounded to the nearest one million? 6000000 Let i = 10.88 - -0.12. Let j = i + -10.826. Round j to two dps. 0.17 Let g be (-11)/((-11)/(-48))2. Round g to the nearest 10. -100 Let c = -289.93 + 277. Let q = -13 - c. What is q rounded to 2 decimal places? -0.07 Let b = -35.4 - -73.8. What is b rounded to the nearest 10? 40 Let k(l) = l*2 - l - 30263482. Let f be k(0). Let c = -8363482 - f. Suppose -m + c = 2m. Round m to the nearest one million. 7000000 Let g be -2 + 1/(-2)-8. Suppose 0 = gd - 318551 - 24917. Suppose -d - 338266 = -o. Round o to the nearest 100000. 500000 Let l = 0.4 + -1.7. Let w = -1.29946 - l. Round w to 4 decimal places. 0.0005 Let r(s) be the first derivative of -s*2/2 - 4s + 1. Let v be r(-5). Let c be -2v + 21/(-3). Round c to the nearest ten. -10 Let s = 49.4 + -88.7. Let a = s + 31. Let o = 8.29999857 + a. Round o to seven decimal places. -0.0000014 Let k = -105.40936 + 107.309. Let b = k - 1.9. What is b rounded to four dps? -0.0004 Let s = -106 + 105.881. Let a = s - -0.1190053. What is a rounded to 6 decimal places? 0.000005 Let j(l) = -l3 - 11l*2 - l - 11. Let h be j(-11). Round h to five decimal places. 0 Let o = 6 - 4. Suppose -ot - 6 = 0, 3i + i = 3t - 402687. Let a = i - -143674. What is a rounded to the nearest ten thousand? 40000 Let u = 18.9 - 19.009. Let z = 0.10809 + u. Round z to four dps. -0.0009 Let r = 40.99929 - 41. Round r to four decimal places. -0	{ "pile_set_name": "DM Mathematics" }
20 Sort -3231, 5, -100, 3, 0, -2. -3231, -100, -2, 0, 3, 5 Sort 1.15, -5, 2, -738, -3, -0.3 in descending order. 2, 1.15, -0.3, -3, -5, -738 Sort -5/6, 58/11, -1, 48 in descending order. 48, 58/11, -5/6, -1 Put 8, -1, 3138248 in decreasing order. 3138248, 8, -1 Put 0.4, 4/7, -7, -0.08, -1/2, -9 in decreasing order. 4/7, 0.4, -0.08, -1/2, -7, -9 Sort -184, -762, 12 in increasing order. -762, -184, 12 Sort 80, 5, -6522 in decreasing order. 80, 5, -6522 Sort -1.51, -980, -0.01, -3 in decreasing order. -0.01, -1.51, -3, -980 Sort 0.3, 15, 1/7, 49, 14, -1, -4/3 in increasing order. -4/3, -1, 1/7, 0.3, 14, 15, 49 Put 8, -0.014, 2/9, -0.51 in decreasing order. 8, 2/9, -0.014, -0.51 Sort -74591, -2, 247 in decreasing order. 247, -2, -74591 Sort -408, 208, 2/15, -0.1, 0, -5 in ascending order. -408, -5, -0.1, 0, 2/15, 208 Put 135, 24.59, 1/88 in descending order. 135, 24.59, 1/88 Sort -35, 4, 2, -269, -4. -269, -35, -4, 2, 4 Sort 13/4, 1125, -115 in decreasing order. 1125, 13/4, -115 Sort -3, -0.5, -143, -7/5, -9 in increasing order. -143, -9, -3, -7/5, -0.5 Sort 812, 2588, 4. 4, 812, 2588 Put 36755390, 4, -5 in ascending order. -5, 4, 36755390 Put 1, -3, 0.2, 2, 26228/7, -16 in descending order. 26228/7, 2, 1, 0.2, -3, -16 Put -49780, 0, -35, 4 in decreasing order. 4, 0, -35, -49780 Sort 2, 3/2, 0.2489, -0.273 in ascending order. -0.273, 0.2489, 3/2, 2 Sort 45428, -5, -2, 2 in decreasing order. 45428, 2, -2, -5 Sort -148223, 189, 3 in descending order. 189, 3, -148223 Sort 218635, -0.3, 0.01 in ascending order. -0.3, 0.01, 218635 Sort -5, 31573, -115, 1, -1, 8 in descending order. 31573, 8, 1, -1, -5, -115 Sort 632.3, -3/4, -0.5, -12/13, 2 in decreasing order. 632.3, 2, -0.5, -3/4, -12/13 Put 10, -3, -6, -230, 13, 1 in ascending order. -230, -6, -3, 1, 10, 13 Sort 0, -170, 5, -1, 9, 4, 14 in ascending order. -170, -1, 0, 4, 5, 9, 14 Sort -1, 0, -25, -327, 4, -13. -327, -25, -13, -1, 0, 4 Sort 0.1685, -2/5, -2/687, 1/4, 3 in ascending order. -2/5, -2/687, 0.1685, 1/4, 3 Put 614, -13, 4, 10, 3 in increasing order. -13, 3, 4, 10, 614 Sort -12, 3, -3, -70, -152, -1, -5 in descending order. 3, -1, -3, -5, -12, -70, -152 Sort 26, 19, -20, 3, 5, 9. -20, 3, 5, 9, 19, 26 Put 0.53938, 0.3, -3/377, -1/5 in decreasing order. 0.53938, 0.3, -3/377, -1/5 Sort 20, -2/13, -1, 1, -0.2, 12 in increasing order. -1, -0.2, -2/13, 1, 12, 20 Sort 0, -6, 19, 5, -357 in decreasing order. 19, 5, 0, -6, -357 Sort -3, -6605860, -1 in decreasing order. -1, -3, -6605860 Put -4325072, 12, 5 in increasing order. -4325072, 5, 12 Put -12, 7, 5, 4, 1/4, 33 in decreasing order. 33, 7, 5, 4, 1/4, -12 Put -56, 2, 1, -4, 12, 5, -15 in descending order. 12, 5, 2, 1, -4, -15, -56 Sort -19, -18, 3, -7, 545 in decreasing order. 545, 3, -7, -18, -19 Put 3, 534, 5, -379, -5, 2 in descending order. 534, 5, 3, 2, -5, -379 Sort -7287, -1, -2, 5, -5, 8, 23. -7287, -5, -2, -1, 5, 8, 23 Sort -21, -14, -5, 5, -4, 84, 0 in decreasing order. 84, 5, 0, -4, -5, -14, -21 Sort 52, 2, -451, 4, -4 in descending order. 52, 4, 2, -4, -451 Put -73, 8/9, -2, 4228 in decreasing order. 4228, 8/9, -2, -73 Sort -1111, -1, -4, -2, -15002. -15002, -1111, -4, -2, -1 Put -144, 5, -64208 in decreasing order. 5, -144, -64208 Sort -0.9, 1/3, 895827. -0.9, 1/3, 895827 Put -37.6668, -0.2, 2, 0, -2, 17 in decreasing order. 17, 2, 0, -0.2, -2, -37.6668 Put -2376, -0.4, 20/27, 0 in descending order. 20/27, 0, -0.4, -2376 Put -2607, -5, 789 in ascending order. -2607, -5, 789 Put -0.001, 236, 102, 2/5, -1.2 in descending order. 236, 102, 2/5, -0.001, -1.2 Put -148, 4, -5, -4, 20, 47 in ascending order. -148, -5, -4, 4, 20, 47 Put 0.4, -167, -7279 in descending order. 0.4, -167, -7279 Put 199325, -26, -6 in descending order. 199325, -6, -26 Sort 9, 2, -3/4, -3/14, 34, 1/3, -2 in descending order. 34, 9, 2, 1/3, -3/14, -3/4, -2 Put 1510/7, 2, 4, -3/16, -30 in ascending order. -30, -3/16, 2, 4, 1510/7 Put 0.023, 177, 4, -1/6, 1.63 in ascending order. -1/6, 0.023, 1.63, 4, 177 Sort -4, -3, 155257, 2 in ascending order. -4, -3, 2, 155257 Sort 15, 0, 5, -97, -1, -408, 3. -408, -97, -1, 0, 3, 5, 15 Put 214, 1/4, -1001, 5 in ascending order. -1001, 1/4, 5, 214 Put -0.1, 0.3, 5, -1/4122, -2/13 in decreasing order. 5, 0.3, -1/4122, -0.1, -2/13 Put 2, 3, -1041888, -1 in ascending order. -1041888, -1, 2, 3 Sort -0.1, 78056, -30/13, -1 in ascending order. -30/13, -1, -0.1, 78056 Sort -2, 41108, 5, 0, 4 in descending order. 41108, 5, 4, 0, -2 Sort 0, -3, 4, -6149, 3, -4 in ascending order. -6149, -4, -3, 0, 3, 4 Sort -3, -172, 2, -64, 43 in descending order. 43, 2, -3, -64, -172 Sort 12, 0, 4, -7, 10, -10. -10, -7, 0, 4, 10, 12 Put -34, 5, -7/6, -0.3, 22/7 in ascending order. -34, -7/6, -0.3, 22/7, 5 Put 2, -2, 4, 7, 0 in decreasing order. 7, 4, 2, 0, -2 Sort -24, -10, -34, 0. -34, -24, -10, 0 Sort -3, 6, 1/25, 4/105, 7/5. -3, 4/105, 1/25, 7/5, 6 Sort -588, -1, 284, 0, -2. -588, -2, -1, 0, 284 Put 2, 5, -2, -1, -5, -3, 3103 in descending order. 3103, 5, 2, -1, -2, -3, -5 Put -247.49, -2/357, 3/2 in decreasing order. 3/2, -2/357, -247.49 Sort -5, 0, 4298, -3, -41, 1, 2. -41, -5, -3, 0, 1, 2, 4298 Put 4, -2697, -7, 12 in descending order. 12, 4, -7, -2697 Sort -2, -86/415, -5, 0. -5, -2, -86/415, 0 Sort 26, -4, 188339, 3 in decreasing order. 188339, 26, 3, -4 Sort 6, 3/5, 0.01, 1, -2, -1/2, 0.3 in decreasing order. 6, 1, 3/5, 0.3, 0.01, -1/2, -2 Sort -11.1, -227893, 1. -227893, -11.1, 1 Sort 3, 2, 5, -5, 39860. -5, 2, 3, 5, 39860 Put 2064, 1091, -1 in descending order. 2064, 1091, -1 Sort -333, -5, 8639 in decreasing order. 8639, -5, -333 Sort 15, -23, 1335209 in descending order. 1335209, 15, -23 Sort -4, -1, -2, 1, 3/74, 1/4 in increasing order. -4, -2, -1, 3/74, 1/4, 1 Put -3, 389, -9, -64, 0 in increasing order. -64, -9, -3, 0, 389 Put 47, 1.3, 4, -0.2, 242 in descending order. 242, 47, 4, 1.3, -0.2 Sort -5, 4673, -63, -2, -4. -63, -5, -4, -2, 4673 Sort 93, -12/5, 3/8, 3, -4 in decreasing order. 93, 3, 3/8, -12/5, -4 Put 366, 77, -116 in descending order. 366, 77, -116 Put -150, 2, 47, 5, 0, -4, -2 in increasing order. -150, -4, -2, 0, 2, 5, 47 Put -5, -4, -77, 2, 3, -324 in ascending order. -324, -77, -5, -4, 2, 3 Sort 4, 1, -1054, 37683 in descending order. 37683, 4, 1, -1054 Put 0, 14, 278, 1862, 1 in increasing order. 0, 1, 14, 278, 1862 Sort 19, 6328, 667 in decreasing order. 6328, 667, 19 Sort 18, 0, -8, 3/8, -791 in decreasing order. 18, 3/8, 0, -8, -791 Put -23, 7, -1, -3, -13, 37, -6 in ascending order. -23, -13, -6, -3, -1, 7, 37 Put -434, 7, -5, 3, 175, 5 in increasing order. -434, -5, 3, 5, 7, 175 Sort -1/6, 64, -0.0923, -5, 3 in ascending order. -5, -1/6, -0.0923, 3, 64 Sort -3, 4, -20, 1, 702, 3, -56. -56, -20, -3, 1, 3, 4, 702 Sort 663, 77, 4 in descending order. 663, 77, 4 Sort -4, -2, 30, -3, -1371621 in descending order. 30, -2, -3, -4, -1371621 Sort 4, -4, 6, 5, -5, 5725, 1 in descending order. 5725, 6, 5, 4, 1, -4, -5 Put 3, 209537, 2 in increasing order. 2, 3, 209537 Put 2/11, -71, 2, 1521 in descending order. 1521, 2, 2/11, -71 Put 5, 1768066, -2, -6 in decreasing order. 1768066, 5, -2, -6 Put 39, 2, -16, -657, -1 in decreasing order. 39, 2, -1, -16, -657 Put -2, 0, -5, 2304, 3, 2 in decreasing order. 2304, 3, 2, 0, -2, -5 Sort -310, -18, -2, -1, 21, -4 in increasing order. -310, -18, -4, -2, -1, 21 Put -3, -1, 71550, -7, 2 in increasing order. -7, -3, -1, 2, 71550 Put -1/8, 1625, -17, 0.6, -16, 0.5 in descending order. 1625, 0.6, 0.5, -1/8, -16, -17 Put -1810, -4, -16918 in decreasing order. -4, -1810, -16918 Sort 0, -1, -6953, -5, 6, -22 in descending order. 6, 0, -1, -5, -22, -6953 Sort -1/5, -23, 9, -5.02 in descending order. 9, -1/5, -5.02, -23 Put -2, 2, -8, 99356 in ascending order. -8, -2, 2, 99356 Sort 2345, 116, 790 in descending order. 2345, 790, 116 Sort -440, 2, -15718 in ascending order. -15718, -440, 2 Put 2734/7, 4, 10/1971 in descending order. 2734/7, 4, 10/1971 Sort 12.5444, 1.6, 0.4 in ascending order. 0.4, 1.6, 12.5444 Sort 7, -4413, -10 in decreasing order. 7, -10, -4413 Put -0.3, 0.2, 116764, -42 in decreasing order. 116764, 0.2, -0.3, -42 Put 1/38, -5, -139613, 5 in ascending order. -139613, -5, 1/38, 5 Sort -27, 2, -1, -7, -2, 3, -1765 in increasing order. -1765, -27, -7, -2, -1, 2, 3 Put 21, -	{ "pile_set_name": "DM Mathematics" }
= 4k, -q = -k + 5o. Suppose 11u - 4 = ku. Put -1, u, 0 in descending order. u, 0, -1 Suppose -12 = -2r + 14q - 12q, 0 = 3q + 6. Sort -4, r, -25 in ascending order. -25, -4, r Let z = -7/2 - -4. Let s be (-17)/2 + (2 - 0). Let a = s + 8. Put z, -4/5, a in decreasing order. a, z, -4/5 Let w = -292 - -291. Let y = -12 + 15. Let z be 2 + -4 + y + 2. Put 0, w, z in decreasing order. z, 0, w Let j = 11 - 14. Put 3/5, -4/13, j in descending order. 3/5, -4/13, j Let y be (9/6)/(27/(-72)). Let u be (-10)/66 + 6/(-33). Put 0.3, y, u, -1 in decreasing order. 0.3, u, -1, y Let g = 298 - 294. Put -44, g, -2 in ascending order. -44, -2, g Suppose 0 = 3y + 6, x - 5y = 13 - 0. Put -4, 2, x, -2 in ascending order. -4, -2, 2, x Suppose 4c = -b + 2, -b = 5c - 5 + 3. Let a = -145 - -146.08. Let x = a + -1.09. Put x, c, -4/3 in ascending order. -4/3, x, c Let q be 3/(8/3266/(-1)). Suppose -k = -c + 2k - 3, 4k - 4 = -5c. Sort c, q, 19 in ascending order. q, c, 19 Suppose s = 10 - 8. Put s, 0.5, -0.03, 4 in descending order. 4, s, 0.5, -0.03 Let y = 1207 - 1274. Put 5, y, -1/2 in increasing order. y, -1/2, 5 Let n = -825 - -832. Put 0.05, n, 2/9 in decreasing order. n, 2/9, 0.05 Let u be 304/(-4)(-3)/6. Let a = u + -39. Put 7, a, 1 in increasing order. a, 1, 7 Let s = 2/169 - 173/338. Let y be (-6)/(-21) - 2/(-42). Put s, y, -2 in ascending order. -2, s, y Let y be (-29)/4 + (-42)/(-168). Put 5, y, -3 in decreasing order. 5, -3, y Let l = 10 + -7. Suppose 2t = lj - 3 - 32, -t - 17 = -2j. Let v be (-5)/25 + t/(-20). Sort v, -3/2, -1 in descending order. v, -1, -3/2 Suppose -6 = -u - u. Suppose 0q + 4q - 80 = 0. Let m be 1/(-16)2 - (-5)/q. Sort 0, u, m in increasing order. 0, m, u Let u be ((-78)/18 + 3)-3. Sort -3, u, -2, 5 in increasing order. -3, -2, u, 5 Let y(h) = h*3 - 11h*2 + 23h + 1. Let p be y(3). Put p, 86, -5 in ascending order. -5, p, 86 Suppose -22u + 18u - 96 = 0. Let a(c) = 3c + 69. Let w be a(u). Put 0.3, w, -7 in descending order. 0.3, w, -7 Let x = -92 + 56. Let k = x + 29. Put k, -5, 0.5 in decreasing order. 0.5, -5, k Let i(o) = o - 3. Let g be i(4). Let j(y) = y. Let p be j(2). Suppose -297 = 41q - 174. Put q, g, p in ascending order. q, g, p Suppose l + l = -2, -4z = 3l - 5. Let q = 4 + -3. Suppose -j + w - 15 = -4w, 3w - 11 = j. Sort q, z, j. j, q, z Let k be (2/42)/(6/(-324)). Let a = -49 - k. Put -3, a, -4 in decreasing order. a, -3, -4 Suppose 0 = -6x - 2x + 24. Suppose 0s = xs + 3, 0 = 4o + 3s - 5. Suppose oq - 4p = 10, 4q = -7p + 4p - 35. Put q, 0, 4 in decreasing order. 4, 0, q Let o(z) = 18z2 - 14z*2 - 1 + 3z - z + z*3. Let t = -10 + 8. Let x be o(t). Sort -7, x, 5. -7, x, 5 Let w be (175/30 + -6)4. Let f = 0.55 + -1.61. Let l = -0.06 - f. Put -4, w, l in decreasing order. l, w, -4 Let o be (-2 - 0)/(3/6). Let k(c) = c*3 + 3c*2 - 4c - 4. Let i be k(o). Suppose 2d + 32 - 12 = 0. Put d, 3, i in descending order. 3, i, d Let q be (-516)/86 - 20/(-3). Sort q, -0.006, 1/4, -4 in decreasing order. q, 1/4, -0.006, -4 Let d = 14.72 + -14.79. Sort d, 4/5, -4, -0.1 in increasing order. -4, -0.1, d, 4/5 Let j = 5 - 3. Let y = 1616 - 1615.2. Put 2/13, y, 0.3, j in descending order. j, y, 0.3, 2/13 Let y = -17 - -24. Let d = -7 - y. Let m = d + 14. Put -3, m, -2/7 in increasing order. -3, -2/7, m Let w = -0.03 - -1.03. Let a be (-22)/35 - 8/(-40). Put a, -2, w, -1 in ascending order. -2, -1, a, w Let n be (6/11)/(78/(-1144)). Let b = 0 - 0. Sort n, 5, 2, b in ascending order. n, b, 2, 5 Let v = 2546 + -12731/5. Let f = 281 - 5899/21. Sort 0.4, -5, v, f in ascending order. -5, v, f, 0.4 Let s = 70 + -10. Let z be (0 - (-8)/6)s/48. Put 0.2, -2/3, z in decreasing order. z, 0.2, -2/3 Let h(z) = z*2 + 2. Let w be h(2). Let b be 2/1421/w. Let j be ((-10)/((-550)/33))/(0 - -3). Sort -1/5, j, b. -1/5, j, b Let f = 230 - 229.7. Put f, -3, 0.69 in increasing order. -3, f, 0.69 Let a(s) = s*2 - 3s - 1. Let m be a(4). Let w be 15/(-6)8/20. Sort m, w, -3, 5. -3, w, m, 5 Let w = -17 - -12. Sort w, -4, 1. w, -4, 1 Let z = -0.34 - -0.04. Let j = z + 0.2. Let x = 577.8 - 578. Put j, -0.3, x in ascending order. -0.3, x, j Let w = 7 - 4. Let x = -733 + 732.94. Sort x, -1/6, w, 4/3 in decreasing order. w, 4/3, x, -1/6 Suppose 8 = u - 2x - 0, 3x = 3u - 21. Let r be 27/u + (-3)/2. Suppose 2 + 4 = -rg. Sort 2, -3, g in decreasing order. 2, g, -3 Let x = -1080 + 1080. Put x, -0.5, 2/13, 18 in descending order. 18, 2/13, x, -0.5 Let b = -1 + 5. Suppose s - 9 = bs. Put s, -1, 19 in decreasing order. 19, -1, s Let f = 18 - -46. Let n = -53 + f. Sort 3/2, n, -2 in descending order. n, 3/2, -2 Let g be (-1)/(-5) - (-12)/40. Suppose 72 + 72 = -8h. Let m(o) = -o - 22. Let k be m(h). Sort 4, g, k in increasing order. k, g, 4 Let k be (-140 + 1)2/6. Let p = k - -46. Let h = 149 + -149. Sort -3, p, h. -3, p, h Suppose 0 = -z - m + 10, 6m - 3m - 36 = -4z. Put 5, z, 3 in decreasing order. z, 5, 3 Let s be 73/4 + (-12)/(-16) + -1. Let v = -22 + s. Sort 0.5, v, 0, 5 in decreasing order. 5, 0.5, 0, v Let s(n) = -n3 - 7n*2 + 9n + 8. Let v be s(-8). Sort 4, -4, v, 5 in descending order. 5, 4, v, -4 Let l = -9 + 88. Let s = l + -80. Let o = -2 - -2. Sort 1, s, o. s, o, 1 Suppose 4y - 3k = -4, 3y - y - 2k = -4. Let x(u) = -u*3 + 4u*2 - 2u - 2. Let v be x(2). Let d be (4 - (v + y)) + -2. Sort d, 5, 1. d, 1, 5 Let a be (1/(-3))/(10/(-120)). Let m be ((-63)/28)/((-1)/a). Suppose 3z = -m + 3. Put 0, 3, z in ascending order. z, 0, 3 Suppose 2c = -c - 3. Suppose 0 = -3d + 2d - 1. Let t = d + 7. Sort c, t, 2 in decreasing order. t, 2, c Let x(g) = -g3 - g2 + g - 2. Let p be x(-2). Suppose -2n + 10 = -3k - 6n, 4k + 4n = -16. Sort -4, -3, k, p in decreasing order. p, -3, -4, k Suppose 3j + h + 3 = 0, -2h + 7h = -15. Suppose -9y - 2 = -47. Put j, 4, y in decreasing order. y, 4, j Let u = 2509 + -2504. Put -4, -36, u in decreasing order. u, -4, -36 Let t be (-11)/(-4) - (-2)/8. Suppose -110 + 740 = -10l. Let w be (-3)/242/l. Put w, -4, t in increasing order. -4, w, t Let m = 1.3 - 1.8. Suppose -20 + 14 = -3b + 2j, -2b + 4 = -3j. Sort -0.4, b, 2/35, m in increasing order. m, -0.4, 2/35, b Let p(h) = h3 - 2h*2. Let y be p(1). Let x = -1006 + 1004. Let f be 2(-1)/((-2)/(-3)). Sort y, f, x in increasing order. f, x, y Let j = 83 - 83.2. Let h = 124/171 + -18/19. Put 8, h, j in ascending order. h, j, 8 Suppose 0o = -2w - 5o - 22, -w + 7 = -2o. Sort 45, w, -0.4, 0.2. w, -0.4, 0.2, 45 Let u = -1599 + 1602. Put 2, -3, -6, u in increasing order. -6, -3, 2, u Suppose -5 = -3a + 8a. Suppose -3t - 7 = -19. Sort a, t, 5 in descending order. 5, t, a Let p = -101.7 + 94. Let h = p - -5.7. Sort h, 4, 3, 0.3 in decreasing order. 4, 3, 0.3, h Suppose 0 = -12t + 9t - 3. Let a be 5 - (6/(-2))/t. Let f be (-4)/(-6)6/(-4). Sort 5, a, f. f, a, 5 Let m = 2.3 - 2.8. Let r = m - 2.5. Put r, -2, 1 in ascending order. r, -2, 1 Let n = -0.97 - -39.97. Let l = 38.7 - n. Sort l, 0.1, -5, 3. -5, l, 0.1, 3 Let h = 390 + -397. Suppose 0 = 3y - 5x, -4 - 1 = -4y + 5x. Put h, y, -4 in ascending order. h, -4, y Let t(z) = -z. Let v be t(-4). Let y(k) = -3k3 + 25k*2 - 9k + 10. Let j be y(8). Let g be -3 - j2/v. Sort -3, g, -1/4 in increasing order. g, -3, -1/4 Let w = 0.19 + 0.11. Suppose 0 = -12z + 21 + 3. Sort 0.01, z, w. 0.01, w, z Let v be 100/(-26) + 0 + 226/(-1469). Let c be (6/12)/((-2)/(-80)). Suppose -2w = w + i + c, 0 = i + 2. Put w, v, -5 in descending order. v, -5, w Let r = 18 - 12. Let f be (4/(-5))/(r/15). Let y be (0 - f)3/(-9). Put 2/25, y, -0.4 in descending order. 2/25, -0.4, y Suppose -29 = -k - 2k - 4t, 5k = -2t + 25. Let c(a) = a*2 - 13a - 8. Let r be c(14). Suppose -rd = -11d. Sort d, k, -4. -4, d, k Let o(y) = 121y - 14. Let l(w) = w3 - 7w*2 - 7w - 1. Let q be l(8). Let n be o(q). Let z be (-14)/4(-28)/n. Sort z, -2/3, 2 in descending order. 2, z, -2/3 Let h(g) = -g3 - 7g*2 - 7g - 4. Let x be h(-6). Let c(j) = j*3 - 27j*2 - 89j - 37. Let i be c(30). Put 3, x, i in descending order. 3, x, i Suppose -3c - 31 = -5b - 19, 0 = 3b - 2c - 7. Sort b, 0, -4 in descending order. b, 0, -4 Let g = 858 - 860. Sort -1/11, -1.5, g. g, -1.5, -1/11 Suppose 0 = 3*p	{ "pile_set_name": "DM Mathematics" }
hat is the common denominator of -7/24165 and -21/5? 24165 What is the smallest common multiple of 66 and 398? 13134 Calculate the common denominator of -95/49408 and -85/2316. 148224 Find the common denominator of -93/472 and 77/8142. 32568 Calculate the common denominator of -73/11358 and -47/20192. 181728 Find the common denominator of 21/10187 and 5/2623. 438041 Calculate the common denominator of -1/517892 and -52/129. 1553676 Calculate the least common multiple of 99 and 12496. 112464 Calculate the common denominator of 77/1593 and -73/7776. 458784 What is the smallest common multiple of 1246 and 174? 108402 Find the common denominator of -61/148800 and -97/280. 1041600 What is the lowest common multiple of 181773 and 9567? 181773 Calculate the least common multiple of 67620 and 1035. 202860 Find the common denominator of -57/15650 and 99/626. 15650 What is the common denominator of 43/5104 and -43/56144? 56144 What is the least common multiple of 102 and 62316? 1059372 Calculate the common denominator of 139/300 and 79/578040. 2890200 Find the common denominator of -145/18318 and -47/1917. 164862 What is the common denominator of -61/288 and 9/24688? 444384 What is the smallest common multiple of 440 and 2040? 22440 Find the common denominator of -149/6720 and 131/25200. 100800 What is the common denominator of 145/21042 and -23/1134? 189378 What is the lowest common multiple of 6816 and 6248? 74976 What is the common denominator of 145/72 and 169/20064? 60192 What is the common denominator of -29/468 and -71/2184? 6552 Calculate the least common multiple of 109450 and 49750. 547250 Calculate the common denominator of 83/12 and -25/749217. 2996868 Calculate the least common multiple of 560 and 224. 1120 Find the common denominator of -113/72 and 117/19096. 171864 Find the common denominator of 48/29 and 24/19. 551 Calculate the common denominator of -53/9 and 77/226070. 2034630 Calculate the smallest common multiple of 99144 and 110160. 991440 What is the common denominator of 14/764997 and 22? 764997 What is the common denominator of 3/22220 and 55/42? 466620 Calculate the common denominator of 62/3215 and 26/3215. 3215 Calculate the least common multiple of 118944 and 36. 118944 Find the common denominator of -115/6 and 7/47109. 94218 What is the common denominator of -85/8 and 151/1124280? 1124280 Calculate the common denominator of 111/11816 and -115/136728. 957096 What is the least common multiple of 179838 and 2781? 539514 What is the common denominator of -79/2744 and 89/108? 74088 What is the smallest common multiple of 1053 and 1380? 484380 What is the least common multiple of 7110 and 10? 7110 Calculate the lowest common multiple of 105 and 22785. 22785 What is the smallest common multiple of 45 and 46746? 233730 Find the common denominator of -43/2 and 63/40394. 40394 What is the common denominator of 43/95 and -77/1780? 33820 What is the least common multiple of 484 and 6468? 71148 Calculate the smallest common multiple of 1340984 and 1843853. 14750824 What is the common denominator of 13/5274 and 2/14943? 89658 Find the common denominator of 26/99 and -179/337194. 337194 Calculate the smallest common multiple of 275 and 33600. 369600 Calculate the common denominator of -33/3316 and -61/37305. 149220 What is the common denominator of -83/11408 and 43/39928? 79856 Calculate the least common multiple of 558 and 1881. 116622 Calculate the smallest common multiple of 3825 and 275. 42075 Find the common denominator of -109/126144 and 113/5256. 126144 What is the lowest common multiple of 5670 and 132? 124740 Calculate the smallest common multiple of 546 and 9741. 1772862 Calculate the smallest common multiple of 146 and 657. 1314 Calculate the lowest common multiple of 3712 and 1568. 181888 What is the lowest common multiple of 2078 and 61? 126758 What is the common denominator of -193/3120 and 47/13507? 3241680 Find the common denominator of -179/30 and -121/25722. 128610 Calculate the common denominator of 7/5548 and -119/10. 27740 What is the common denominator of -19/1020 and 65/128928? 644640 What is the lowest common multiple of 33672 and 216? 303048 Calculate the common denominator of -97/204 and 55/58752. 58752 What is the least common multiple of 18504 and 216? 55512 What is the common denominator of 79/5119862 and -119/20? 51198620 What is the common denominator of -109/1028526 and -20/999? 9256734 Find the common denominator of -187/15570 and -149/150. 77850 What is the common denominator of 119/7620 and 25/381? 7620 Calculate the smallest common multiple of 312 and 7254. 29016 What is the common denominator of -81/2120 and -81/21200? 21200 What is the least common multiple of 5918 and 9684? 106524 Find the common denominator of -31/95939 and -44/487. 95939 Calculate the lowest common multiple of 490 and 8575. 17150 Find the common denominator of 67/400 and -53/2944. 73600 Find the common denominator of -47/296 and 103/592. 592 What is the smallest common multiple of 6 and 131475? 262950 Calculate the lowest common multiple of 1767 and 155. 8835 What is the lowest common multiple of 43200 and 14850? 475200 Calculate the common denominator of 121/320 and -127/32352. 323520 Calculate the common denominator of -107/144 and 39/162352. 1461168 Calculate the least common multiple of 90 and 24750. 24750 Calculate the lowest common multiple of 2313 and 12. 9252 Calculate the smallest common multiple of 453888 and 114. 8623872 Calculate the common denominator of -25/1116 and 37/3348. 3348 Calculate the smallest common multiple of 35145 and 19170. 210870 What is the least common multiple of 71560 and 2218360? 2218360 Calculate the lowest common multiple of 120370 and 48148. 240740 Calculate the smallest common multiple of 19746 and 4388. 39492 Calculate the lowest common multiple of 3 and 319395. 319395 What is the common denominator of -121/14820 and -127/2964? 14820 Calculate the lowest common multiple of 1788 and 492. 73308 What is the common denominator of -41/81 and -10/723? 19521 Find the common denominator of 11/36106 and -17/84. 216636 What is the least common multiple of 17985 and 25? 89925 Calculate the smallest common multiple of 10 and 2766836. 13834180 Calculate the common denominator of 39/13538 and 5/81228. 81228 Find the common denominator of -19/169778 and 23/970160. 6791120 What is the common denominator of 163/29304 and 13/38? 556776 Calculate the common denominator of 187/1680 and -199/30240. 30240 Calculate the least common multiple of 1226324 and 2. 1226324 Calculate the lowest common multiple of 100 and 3860. 19300 What is the lowest common multiple of 1075 and 67252? 1681300 Calculate the common denominator of -87/51614 and 53/74. 1909718 Calculate the common denominator of -7/139770 and 23/1910190. 5730570 Find the common denominator of 1/163762 and 13/243430. 9006910 What is the least common multiple of 56 and 5464? 38248 Calculate the common denominator of -79/200 and 71/52450. 209800 Calculate the least common multiple of 266 and 1472. 195776 Calculate the common denominator of -29/10296 and 46/273. 72072 What is the least common multiple of 24 and 576? 576 Find the common denominator of -35/1438636 and 21/40. 14386360 Find the common denominator of 64/987 and 45/53956. 161868 What is the smallest common multiple of 95294 and 524117? 1048234 Calculate the least common multiple of 2140 and 10807. 216140 What is the least common multiple of 6 and 73240? 219720 What is the least common multiple of 534 and 2916? 259524 What is the smallest common multiple of 102 and 220? 11220 Find the common denominator of -15/994 and -33/406. 28826 What is the common denominator of 47/4832 and 99/722384? 1444768 Find the common denominator of 51/2470 and 27/52858. 264290 Calculate the common denominator of 76/417 and -55/669. 92991 What is the common denominator of 37/7414 and 97/6066? 66726 Calculate the lowest common multiple of 6422 and 1118. 276146 Calculate the least common multiple of 21729 and 132. 956076 Calculate the least common multiple of 194040 and 5880. 194040 Calculate the smallest common multiple of 304 and 332. 25232 What is the smallest common multiple of 219925 and 275? 2419175 What is the smalle	{ "pile_set_name": "DM Mathematics" }
et k be (-6 + -60)/(-6) - 7. Suppose -kp + 26p = -15p. Solve -12x + 14x + 6 = p for x. -3 Suppose 2160 = -10r + 14r - h, 1620 = 3r + 5h. Solve -535o + 5 = -ro for o. -1 Let u(k) = 153 - k + 2k*2 - 152 - 3k*2 + 7k*3. Let o be u(1). Suppose x + o = 7x. Solve x = -t + 4 for t. 3 Suppose -5o + 66 = 5m - 244, 0 = -m - 5o + 66. Solve 0 = -35v + 376 - m for v. 9 Suppose 0l - 4l - 4 = -4r, r - 3l = -1. Let x be (-6 - (-515)/35) + r/7. Solve -5t = -14t + x for t. 1 Let d(o) = -o*2 + 31o - 117. Let y be d(24). Suppose 13x - y = -25. Solve -5 = xp - 9 for p. 2 Let p(c) = 178c - 2492. Let x be p(14). Solve x = 4m + 29 - 5 for m. -6 Let s(d) = d*2 + 4d - 13. Let l be s(-7). Suppose 40 = la - 6a. Suppose 5o - 33 = -2h, -o = -5o + 5h. Solve -op = -p + a for p. -5 Suppose 12s = 20s - 24. Suppose -21 = -3p + 2g, 0 = -sp - 4g - 16 + 19. Solve 0 = pi + 10 + 10 for i. -4 Suppose -50k + 147 = -43k. Suppose 3y - 2t - k = 0, 0y - 5t = -3y + 12. Solve -16z = -13z - y for z. 3 Let c = 128 + -76. Suppose cy = 55y. Solve y = -0d + d for d. 0 Let w(s) = -3s2 + 1. Let o be w(7). Let h = o - -155. Solve -3p + 3 + h = 0 for p. 4 Let x = 104 + -96. Let j(i) = -i*3 + 8i*2 - i - 2. Let k be j(x). Let v be ((-12)/k)/(4/10). Solve -1 - v = c for c. -4 Suppose 180 = 81z - 42 - 1155. Solve 0 = -8h - z + 49 for h. 4 Let d(u) = -7u + 105. Suppose 3g = 4r - 72, 2g - 14 = -2r + 8. Let x be d(r). Solve 3 = -3k - x for k. -1 Let b(o) = -11o*2 - 15o - 11. Let l(i) = -4i2 - 5i - 4. Let v(y) = -3b(y) + 8l(y). Let p be v(-6). Let n = -4367 - -4367. Solve n = pu - 5u for u. 0 Let v = 1010 + -900. Solve vk = 103k for k. 0 Let o = 2026 - 2017. Solve 6a = 9a - o for a. 3 Let i(p) = p*3 + 7p*2 + 7p - 15. Let n = 226 + -231. Let q be i(n). Solve 6x - 3x = q for x. 0 Suppose -3r + 4r = 38. Suppose 5t - z - r = -0z, -10 = -t + z. Suppose -4s + t = -9. Solve 0 = sa - a + 12 for a. -4 Let g(v) = -133v + 3327. Let z be g(25). Solve -4j + z = -10 for j. 3 Let z(i) = -2i2 - 31i + 9. Let j be z(-11). Let q be ((-54)/j)/((-1)/72). Solve -39r = -qr - 15 for r. 5 Suppose 4m = 32r - 34r + 48, 0 = -3m + 4r + 14. Let v be 6/9m(-150)/(-125). Solve 2j - v = -4 for j. 2 Suppose 1627d + 3 = -2 + 5. Let c = -2 - -2. Let p be (-1 + 0 + 0)/(-1). Solve d = -l - c + p for l. 1 Suppose -3q + 30 = 3y, 4y + 0 + 5 = 5q. Suppose 1 + 13 = 2s + 4j, j - q = -s. Let m be (s + -4)/((-2)/2). Solve -p + m - 2 = 0 for p. -1 Let t(d) = -504d3 + d2 + 10d - 10. Let l be t(1). Let w = l + 511. Solve 0 = 2m + w - 6 for m. -1 Let w = -10 - -12. Let l(a) = -a + 4a2 + 2a - 26a3 + 5a + 25a3. Let k be l(5). Solve -ky + wy = 9 for y. -3 Let c(m) be the third derivative of -m4/8 - 3m*3/2 + 34m*2. Let u be c(-12). Suppose uk - 24k - 18 = 0. Solve -kg = -5g for g. 0 Suppose -3l - 4n - 7 = 0, 0 = 3l - 3n - 16 - 5. Let y be (20/(-6))/(6/(-9)). Suppose 5b + y = 10. Solve 0 = li + b + 8 for i. -3 Suppose 2s - 725 = -3r - 655, 0 = 3r - 5s - 77. Solve 2b - r + 28 = 0 for b. -2 Suppose 9o = -2v + 12o + 9, 0 = 4v + 4o + 12. Solve -140 = -vi - 28i for i. 5 Suppose 0 = 4y - 0 - 8. Suppose 5m = 1735w - 1732w + 19, -m = w - 7. Suppose -wt + 5x = yt - 64, -t - 2x = -16. Solve 4 + t = 5j for j. 4 Let v(y) = -y - 81. Let z be v(15). Let n be (z/(-80))/((-9)/(-15)). Solve -5 = -nw + 3w for w. -5 Let k(v) be the second derivative of -v*5/20 + 11v*4/12 + 25v*3/6 + 8v*2 - 21v. Let j be k(13). Solve jc = 4c for c. 0 Let c(b) = b*3 + 6b*2 - 13b + 2. Suppose -8q + 34 = 9q. Let t be c(q). Solve tx - 5x = -12 for x. -4 Suppose 36q - 20q = -224. Let m = q + 16. Solve -ma = 5 + 1 for a. -3 Let m(n) = -n2 - 93n - 1557. Let u be m(-22). Let j(i) = -i - 5. Let d be j(0). Let a be (4 - 2)/((-2)/d). Solve -25 = -ac - u for c. 4 Let m(u) = u2 + 10u + 42. Let i be m(-7). Suppose -ih + 18h = -15. Solve -hp + 7 = 2 for p. 1 Suppose -4c + 254 = 2k, 10k + 39c - 1137 = 38c. Solve -37y + 456 = -ky for y. -6 Suppose -5n = 0, -22g - 5n = -27g + 90. Let m = 48 - 42. Solve -gx + 15x = -m for x. 2 Suppose 22j = -8j + 120. Let w = 8 - j. Solve -13p + 12p - w = 0 for p. -4 Let j = 6819 - 6783. Solve -7h + 6 = -j for h. 6 Let w(f) = 145f + 11. Let j be w(0). Solve 0 = 10d + jd + 63 for d. -3 Suppose 3v + r = -v + 21, 0 = -v - 5r - 9. Solve vf - 2 = 16 for f. 3 Let z(v) = 8v - 24. Let q(a) = 2a - 8. Let j be (6/(-4) - 2)/((-2)/(-4)). Let i(f) = jq(f) + 2z(f). Let r be i(-3). Solve -2x + 4 = rx for x. 1 Suppose 28175 = -63s + 224s. Solve s - 164 = 11v for v. 1 Let k be 251/(-4 + (-8 + 4 - -9)). Let n = 277 - k. Solve nu - 28u = -6 for u. 3 Let u be 3(5 + (7/(-42))/(6/(-852))). Solve -30p - 4 = u for p. -3 Suppose 6g - 539 = -5. Let a = 96 - g. Suppose 15 = 2p + 5q, -3p - 4q + 5 = -a. Solve t - 1 - 1 = p for t. 2 Let p(r) = 8r - 21r + 4r + 7r - 14. Let q be 46/(-7) - (-3)/(-7). Let m be p(q). Solve -k + mk = -1 for k. 1 Let m(b) = -b*2 - 4b - 1. Let c be m(-3). Suppose -f + n = -14, 83n - 86n = 24. Suppose -4d + 0z + 12 = 4z, 4d + 15 = 5z. Solve f = -dy - cy for y. -3 Let u(g) = -47 - 23g + 2g2 + 8g + 18g. Let x be u(5). Solve 0 = 2c - 8c + x for c. 3 Suppose -224k - 776 = -232k. Solve -25 = 12d - k for d. 6 Let l = 1979 - 1952. Solve -l = -14o + 1 for o. 2 Let h(b) = b3 + 15b*2 - b - 21. Let g be h(-15). Let r be (0/g - 3) + 11 + -1. Suppose 5u + 2m = 21, 2 = u + 2m - r. Solve 0 = -2q - 5 - u for q. -4 Let b be 6/(-4) + -2 + 7/(112/56824). Solve bq = 3557q for q. 0 Suppose 3330 + 5790 = 240g. Solve -21w + g = -25 for w. 3 Let s(m) = m3 - 3m*2 - 2m - 5. Let y(j) = -j + 26 - 17j + 9j - 12j2 - j3. Let l be y(-11). Let t be s(l). Solve -5q = -tq - 4 for q. 2 Let q be (-40)/25 - 18/45. Let g be (-6)/1248/q. Solve 0 = -9f + 12f - g for f. 4 Let r(f) = f*2 + 5f + 1. Let t be r(-7). Suppose -96 + 12 = 7j. Let q be (-3 + (-45)/j)/(2/8). Solve -qc - 3 = -t for c. 4 Let t = -25079 + 25081. Suppose -2j - j = 0. Solve j = 2v - 3v + t for v. 2 Let x(t) = 7t - 154. Let f be x(28). Solve z + 6z = -f for z. -6 Let k(f) = -6f - 13. Let o be k(-3). Suppose -4d - 2b + 6 = 0, -od + 0 = -2b - 12. Solve d = 2m - 0 for m. 1 Let n = 361 - 360. Let v be (n - (3 - 5)) + -1. Solve -3a = va for a. 0 Let i = -443 - -452. Solve -i + 17 = 2v for v. 4 Suppose -4i = 16, 21y = 17y - 3i + 80. Solve -yc + 12c + 77 = 0 for c. 7 Let y be (-6)/(-9) + ((-4891)/(-3))/(-73 + 74). Solve 1626u = yu + 25 for u. -5 Let g = 15 + -3. Suppose 3w - g = -4p + w, 3p = 4w - 2. Let d be (-258)/(-172)8/4. Solve 0 = pl + dl for l. 0 Suppose 211v = 186v + 550. Solve -vo = -13o + 27 for o. -3 Let x be (1008/(-2940))/((-4)/(-10)) - 69/(-7). Solve 82h + xh = 637 for h. 7 Let t be 27/(-54) + 3(-346)/4. Let y = -256 - t. Solve 3m - 4 = ym for m. -4 Let g = 7524 - 7498. Solve -g = -5o + 18o for o. -2 Let d = -118 + 123. Suppose 0 = -dg + 2l + 81, 26g = 23g + 2l + 51. Solve 2k + k = g for k. 5 Let x = 4 + -12. Let a be x/1095/(-38). Solve 0 = aq - q for q. 0 Let p be ((-12)/9)/2 + 33/9. Suppose 0 = 4z + 4h - 12, ph - 4h + 8 = 2z. Solve -9t = -zt for t. 0 Let m(g) = 8g + 90. Let f(j) = -j + 1. Let o(n) = -6f(n) + m(n). Let q be o(-6). Solve 5x - 3x = q for x. 0 Let r(d) = -2d*3 - 6d*2 - 20d + 16. Let p be r(-8). Let k = p + -807. Solve -f - 4 = -k for f. 5 Suppose -2y = -6, y - 6 = -5q + 142. Solve -5l - ql = 34 for l. -1 Let o(t) = t*2 - 10t + 15. Let h be o(10). Suppose -11 = -21d + 52. Let f(v) = -v2 - 4v - 2. Let g be f(-2). Solve -gi - di = h for i. -3 Suppose 0 = 10k - 17k + 148 + 83. Solve -22a - k = 99 for a. -6 Let t = -553 + 623. Suppose -tk + 96 = -62k. Solve 8 - k = x for x. -4 Let r = 513 + -511. Let v be -1(-5 + -1 - 2). Suppose -v = -6w + 2w. Solve 0 = -4p + wp + r for p. 1 Suppose a - 5v - 2 = 25, -5a + 15 = -v. Let s(m) = 13m - 3. Let w be s(a). Suppose -5o - x + w = 0, o = -o + 5x + 20. Solve -o = -2l - 1 for l. 2 Let w(d) = -d*2 - 14d + 161. Let b be w(-21). Solve -144 = -bq + 50q for q. -4 Suppose -13 = 3d + l, -d + 0l + l	{ "pile_set_name": "DM Mathematics" }
1sqrt(132)5 + sqrt(132) - sqrt(132) - sqrt(132))/(sqrt(300) - (sqrt(300) - sqrt(300)2)). -3sqrt(11)/5 Simplify 5 + ((sqrt(588)-1)/sqrt(12))/sqrt(7). -sqrt(7) + 5 Simplify (1(sqrt(110) - (2sqrt(110) + sqrt(110) + sqrt(110))))/(sqrt(1440)-1 - sqrt(1440)). sqrt(11)/8 Simplify -2(-4sqrt(300))*2 + 0. -9600 Simplify (-1sqrt(104)-3)/((sqrt(8) + sqrt(8) + sqrt(128))1 + sqrt(8)). 3sqrt(13)/7 Simplify 3(0 + sqrt(75)). 15sqrt(3) Simplify (-3 + sqrt(539)-1 - sqrt(539)) + 5. -14sqrt(11) + 2 Simplify (3 + sqrt(637) + -3)2. 637 Simplify -4 + (-2sqrt(72))*2 + sqrt(8) + -5 + -2. 2sqrt(2) + 277 Simplify -5(-4sqrt(180))*21. -14400 Simplify (4 + -1sqrt(468) + 4(sqrt(468) + -2) + sqrt(468))*2. -192sqrt(13) + 7504 Simplify -5 + (sqrt(931)4 + 0 - sqrt(931)). -5 + 21sqrt(19) Simplify -3(sqrt(128) + (sqrt(128) + 2)-4 - sqrt(128)). 24 + 96sqrt(2) Simplify (((sqrt(162)-1 - sqrt(162)) + sqrt(162))/sqrt(9))/(sqrt(18)/(-1sqrt(3))). sqrt(3) Simplify sqrt(363)-4 + sqrt(363) + -3 + sqrt(33)/sqrt(11). -32sqrt(3) - 3 Simplify -2 + 6((sqrt(108) + 1)*2 + 4). 72sqrt(3) + 676 Simplify (sqrt(76)/sqrt(4))*2-2 + (sqrt(95)3)/sqrt(5). -38 + 3sqrt(19) Simplify ((1 + sqrt(208) + 4sqrt(208))4)*2. 640sqrt(13) + 83216 Simplify ((sqrt(110)/sqrt(2) + sqrt(55))-6)/(1sqrt(20)). -6sqrt(11) Simplify (5(3 + sqrt(68)2))2. 600sqrt(17) + 7025 Simplify (sqrt(17) + (sqrt(425) + -3)*2)-1. -434 + 29sqrt(17) Simplify (-2 + -1 + sqrt(34)/sqrt(2) + (sqrt(17) - 2sqrt(17))-2)2. -18sqrt(17) + 162 Simplify ((sqrt(36) - sqrt(144)/sqrt(4))/sqrt(12))*2 + 0 - (0 + (-2sqrt(3) + sqrt(3) + -1 - sqrt(3))). 1 + 2sqrt(3) Simplify (sqrt(180)/(sqrt(12)2))/(sqrt(55)/sqrt(176)). 2sqrt(3) Simplify (3 + (-2sqrt(110))/sqrt(10) + sqrt(11))5. -5sqrt(11) + 15 Simplify (sqrt(44)-4 + 1)2. -16sqrt(11) + 705 Simplify ((sqrt(60)-1 + sqrt(60))5 + sqrt(60))/(sqrt(12) + sqrt(1452)-2). -sqrt(5)/21 Simplify sqrt(117) - (-1sqrt(117) + 5) - 6sqrt(156)/sqrt(3). -6sqrt(13) - 5 Simplify (sqrt(77)/(-2sqrt(7)))2 + (2sqrt(55)/sqrt(5))*2. 187/4 Simplify 3(sqrt(2057)2 + -5)2. -660sqrt(17) + 24759 Simplify (sqrt(272) + -1sqrt(272)-3 - 2sqrt(272)-5)*2. 53312 Simplify (sqrt(28) - -62sqrt(28))/((sqrt(4) - sqrt(64))6). -13sqrt(7)/18 Simplify ((sqrt(65)-31)/(-1sqrt(245)))*2. 117/49 Simplify (sqrt(19) - sqrt(76)) + 1 + 1. -sqrt(19) + 2 Simplify -1(-5 + sqrt(99) + (sqrt(1331) + 0)*2). -1326 - 3sqrt(11) Simplify 2 + sqrt(27)-1 - (-5 + (2sqrt(108) + sqrt(108))*2). -965 - 3sqrt(3) Simplify (sqrt(11) + (sqrt(88)/sqrt(8))*2)1 - (2 + (sqrt(11) - (sqrt(88)/sqrt(8))2)). 20 Simplify sqrt(4)/(sqrt(6)/sqrt(3)) - (0 + sqrt(8))2. -8 + sqrt(2) Simplify (1 + (1 + sqrt(432))*2)6. 144sqrt(3) + 2604 Simplify -2-2sqrt(704). 32sqrt(11) Simplify (-1sqrt(720)-3)*2. 6480 Simplify (sqrt(8) + -4)-6. -12sqrt(2) + 24 Simplify sqrt(143)/((sqrt(99) + sqrt(99)2)/sqrt(9)) + (sqrt(13)-14 + sqrt(13) - (sqrt(832) + 0 + sqrt(832) + sqrt(832))). -80sqrt(13)/3 Simplify (sqrt(36)/(-1sqrt(12)))*2 + -1. 2 Simplify (sqrt(1078)-2)/sqrt(2). -14sqrt(11) Simplify sqrt(117)/(sqrt(18)/sqrt(8)) + 5 + sqrt(130)/sqrt(90). 5 + 7sqrt(13)/3 Simplify 5(5 + sqrt(13)-1)*2. -50sqrt(13) + 190 Simplify -5((sqrt(15)/sqrt(5) - sqrt(3)) + -2) + -5. 5 Simplify 5(5 + sqrt(13) + 1 + -1 + sqrt(1573))*2-1. -9485 - 600sqrt(13) Simplify (sqrt(350)/(sqrt(20)/sqrt(2) + sqrt(10) + sqrt(10) - sqrt(10)))/sqrt(5). sqrt(7)/2 Simplify (sqrt(152)/(sqrt(8)-2) - (5 + sqrt(95)/sqrt(5))) + 0. -3sqrt(19)/2 - 5 Simplify ((sqrt(70) + (sqrt(70) - (sqrt(70) + sqrt(70)1)) + sqrt(70) - sqrt(70))1)/sqrt(10). 0 Simplify (5 + 2sqrt(612))*2. 120sqrt(17) + 2473 Simplify 2 + 1(sqrt(343) + 0). 2 + 7sqrt(7) Simplify (((sqrt(96) - 1sqrt(96)) + sqrt(6))/sqrt(3)-4)*2. 32 Simplify (-5sqrt(12)/sqrt(4)-4)2. 1200 Simplify 5 + (-4 + -1 + sqrt(2057))2. -110sqrt(17) + 2087 Simplify (5 + (sqrt(8)/sqrt(4))*2 + sqrt(36)/sqrt(2))4. 12sqrt(2) + 28 Simplify sqrt(343)-4 + -5. -28sqrt(7) - 5 Simplify sqrt(77)/(sqrt(49)/sqrt(7)-3). -sqrt(11)/3 Simplify (-4 + -1 + 2 + -1 + sqrt(11))*2. -8sqrt(11) + 27 Simplify (3(sqrt(99)-2 - sqrt(99)) + sqrt(99))/(((1sqrt(108) - sqrt(108)) + sqrt(108))/sqrt(12)). -8sqrt(11) Simplify sqrt(40)/(sqrt(48)/sqrt(6) + sqrt(8) + sqrt(8) + sqrt(8)) - sqrt(20)/sqrt(4)-5. 21sqrt(5)/4 Simplify (4sqrt(85)2)/(sqrt(5) + sqrt(45)/(sqrt(81) + sqrt(9))). 32sqrt(17)/5 Simplify (sqrt(17) + sqrt(17)1 + 1 + 5)*2 + 4. 24sqrt(17) + 108 Simplify (sqrt(252)/sqrt(4)-2 + sqrt(63) + -2)2. 12sqrt(7) + 67 Simplify 6(sqrt(96)/sqrt(3) - 1(sqrt(2) + -2)). 12 + 18sqrt(2) Simplify (3sqrt(68) + 1)*2. 12sqrt(17) + 613 Simplify ((sqrt(114) - sqrt(114)-1)-2)/sqrt(6). -4sqrt(19) Simplify 2(4 + sqrt(1331) + ((2sqrt(1331))2 - sqrt(1331) - sqrt(1331)))4. -88sqrt(11) + 42624 Simplify (sqrt(171) + (sqrt(171) - -2(sqrt(171) + sqrt(171)-1)) - sqrt(171))/(sqrt(144)-6). -sqrt(19)/24 Simplify (5(sqrt(110) + -2sqrt(110)) - sqrt(110))/(sqrt(80)/sqrt(32)). -12sqrt(11) Simplify (2sqrt(980))/(sqrt(50)/((3sqrt(5) - sqrt(5)) + sqrt(5))). 42sqrt(2) Simplify ((sqrt(539) - (sqrt(539) + -1sqrt(539))) + 2 - sqrt(539)) + 2 + (sqrt(539) - sqrt(539)-3). 4 + 28sqrt(11) Simplify ((sqrt(9072)2)/((sqrt(315)/sqrt(5))/sqrt(7)))*2. 4032 Simplify sqrt(26)/sqrt(2) + 0 + 4 + -2sqrt(13). -sqrt(13) + 4 Simplify (sqrt(1920)-2)/(1sqrt(160)). -4sqrt(3) Simplify sqrt(1584) - ((sqrt(1584) - sqrt(1584)2) + 3). -3 + 24sqrt(11) Simplify (4(1 + sqrt(75)-2))2. -320sqrt(3) + 4816 Simplify sqrt(45)/(-5sqrt(27)/sqrt(3)). -sqrt(5)/5 Simplify ((sqrt(1300)-1 - sqrt(13)) + (sqrt(52) + 1 - sqrt(52)) + sqrt(52) + ((-2sqrt(143) + sqrt(143) + sqrt(143) + sqrt(143))-1)/sqrt(11))*2. -20sqrt(13) + 1301 Simplify (-4(0 + sqrt(27))-2)*2. 1728 Simplify (sqrt(187) + sqrt(187) + (3-1sqrt(187) - sqrt(187)) + sqrt(187))/sqrt(11) + -4. -sqrt(17) - 4 Simplify (sqrt(40)/sqrt(2))/sqrt(4) - (-2sqrt(80) + sqrt(5)). 8sqrt(5) Simplify ((sqrt(700) - (2 + sqrt(700) + 0 + sqrt(700) - sqrt(700) - sqrt(700)))-3 + -1)*2. -300sqrt(7) + 6325 Simplify 1 + sqrt(32) + 0 + (sqrt(160)/sqrt(20) - sqrt(32)). 1 + 2sqrt(2) Simplify 3(6(sqrt(99))2 - (sqrt(11) - -1sqrt(44))). -9sqrt(11) + 1782 Simplify -2 + -2 + sqrt(13) + sqrt(468)/sqrt(4) + -1. -5 + 4sqrt(13) Simplify -4 + sqrt(77)/(sqrt(11) - (1sqrt(176) - sqrt(176))). -4 + sqrt(7) Simplify ((22sqrt(132))/(sqrt(768) + 1sqrt(768)))*22. 11/8 Simplify 6(sqrt(25)/sqrt(5) - sqrt(5))2-4. 0 Simplify ((sqrt(10) - sqrt(30)/sqrt(3))-6)/sqrt(5). 0 Simplify sqrt(33)/sqrt(396) - sqrt(36)/(sqrt(96)/sqrt(8)). -5sqrt(3)/6 Simplify sqrt(49)/sqrt(7)3 - (sqrt(56)/(sqrt(8) + sqrt(200)))2. -7/36 + 3sqrt(7) Simplify (sqrt(20)6)2 + 4sqrt(80) + sqrt(5). 17sqrt(5) + 720 Simplify -1((-1 + sqrt(11) + -1)*2 + (sqrt(88)1)/sqrt(8)). -15 + 3sqrt(11) Simplify -5sqrt(35)/(sqrt(7)2). -5sqrt(5)/2 Simplify (-5-1sqrt(65))/(sqrt(245) + (-2sqrt(245) - sqrt(245))). -5sqrt(13)/14 Simplify (sqrt(17) + 1 + sqrt(17) + sqrt(17))-1 + 4. -3sqrt(17) + 3 Simplify (4 + (sqrt(18) - (2 + sqrt(2178) + sqrt(2178) - sqrt(2178))))*2. -120sqrt(2) + 1804 Simplify (sqrt(12)/(2sqrt(4)-2) - sqrt(24)/(sqrt(128)/sqrt(4)))*2. 27/16 Simplify (-2 + sqrt(180)-2)*2. 48sqrt(5) + 724 Simplify (-3 + sqrt(17) + -1 + sqrt(17))*21. -16sqrt(17) + 84 Simplify ((sqrt(209)-1 + sqrt(209) + sqrt(209) + sqrt(209))-1)/(6sqrt(44)). -sqrt(19)/6 Simplify ((sqrt(180) + -1)2 + -3 - (sqrt(180) + 1 + sqrt(180) + 2)2)-1. 84sqrt(5) + 551 Simplify 4(1 + sqrt(147) + 3). 16 + 28sqrt(3) Simplify (sqrt(2) - -1(sqrt(2) + -1)) + 5. 2sqrt(2) + 4 Simplify sqrt(24)/(sqrt(12)-4) + 1 + -1. -sqrt(2)/4 Simplify -5-4sqrt(2)1 + (0 + sqrt(200))*2. 20sqrt(2) + 200 Simplify (-5 + sqrt(18)/sqrt(6))*2-2. -56 + 20sqrt(3) Simplify 4(sqrt(7) + 4) + (6sqrt(42)/sqrt(6))2. 4sqrt(7) + 268 Simplify 2sqrt(5)2 - -1sqrt(5)-1. 3sqrt(5) Simplify sqrt(76)/(sqrt(8)/sqrt(2)5 + sqrt(4)). sqrt(19)/6 Simplify 6sqrt(153) + (sqrt(102) + (sqrt(102) + sqrt(102) + sqrt(102)-1 - sqrt(102)))/sqrt(6) + (sqrt(2448) + 0)*24. 19sqrt(17) + 9792 Simplify (sqrt(2) + 2)4 + (-2(sqrt(2) + 2) - sqrt(2))2. 28sqrt(2) + 42 Si	{ "pile_set_name": "DM Mathematics" }
- 75913470m + 50609016 = 0. -937204, -6, -3, 1 Let 2l*3/7 - 2479550l*2/7 + 84302966l/7 - 716570298/7 = 0. What is l? 17, 1239741 Suppose -z*2/2 + 6917z/2 - 563625 = 0. What is z? 167, 6750 Solve 5k5 + 28225k*4 - 1508560k*3 + 8034180k2 = 0 for k. -5698, 0, 6, 47 Let u4/4 - 6353u3/2 - 16475547u*2/4 + 90270024767u + 201896789303521 = 0. Calculate u. -3029, 9382 Let -3022640b3 - 61963000b*2 - 317543155b + 117670 = 0. Calculate b. -41/4, 14/37783 Determine w, given that 12180w3 - 82844w*2 + 58600w - 96 = 0. 1/609, 4/5, 6 Factor -3q2 - 925290q - 2775843. -3(q + 3)(q + 308427) Find g, given that -3g5/4 + 129g*4 - 3957g*3/4 + 834g*2 + 4455g - 4428 = 0. -2, 1, 3, 6, 164 Solve -3b2/4 - 3229401b/4 = 0. -1076467, 0 Suppose 4m5/5 - 25688501m*4/5 - 147708971m*3/5 - 269729482m*2/5 - 128442628m/5 + 51377048/5 = 0. What is m? -2, 1/4, 6422131 Factor n*2/4 - 43733n/4 - 393759/2. (n - 43751)(n + 18)/4 Factor 4r*3 - 676r*2 - 28324r - 245180. 4(r - 205)(r + 13)(r + 23) Let 4v*4 - 40592v*3 + 1134100v*2 - 6677400v - 18216000 = 0. What is v? -2, 15, 10120 Find j, given that 5j4/4 + 3844575j*3/2 + 739043613360j*2 + 4434192478080j = 0. -768912, -6, 0 Let m*3/4 + 37498m*2 + 4348897m/4 - 2249445/2 = 0. What is m? -149963, -30, 1 Factor -c*3/5 + 30438c*2/5 + 66983c + 730776/5. -(c - 30449)(c + 3)(c + 8)/5 Solve 2m3/7 - 32502m*2/7 + 18568m = 0. 0, 4, 16247 Factor -w*5 - 12048w*4 - 1529856w*3 - 48824320w2. -w2(w + 64)2(w + 11920) Factor -5u2 + 203811610u - 2076958618539605. -5(u - 20381161)2 Factor -j2/4 + 10883j/4 - 1327488. -(j - 10371)(j - 512)/4 Let 2h*2/9 - 136502492h/9 + 2329116290276258/9 = 0. What is h? 34125623 Let 4s3 - 5087776s*2 = 0. What is s? 0, 1271944 Let 4g*5/7 - 1028g*4/7 - 10564g*3/7 - 30844g*2/7 - 34128g/7 - 12816/7 = 0. Calculate g. -6, -2, -1, 267 Factor -v*2/5 + 19218426v/5 - 92336974479369/5. -(v - 9609213)*2/5 Let -4o*4 - 305600o*3 - 5816142208o*2 + 795239654400o - 27086278984704 = 0. What is o? -38268, 68 Suppose -36q4 + 1110q*3 + 386936q*2 - 1103102q + 563108 = 0. What is q? -91, 2/3, 13/6, 119 Solve -3v4 - 2769v*3 - 21981v*2 - 19215v = 0 for v. -915, -7, -1, 0 Factor -h*3/4 - 37955h*2/4 + 531517h/4 - 1860481/4. -(h - 7)*2(h + 37969)/4 Factor -3g3 - 35442288g*2 + 70884588g. -3g(g - 2)(g + 11814098) Let -2h*3/7 - 3020156h*2/7 - 162880248958h + 651527899064 = 0. What is h? -755041, 4 Find l such that -l*5/4 + 4491l*4/4 + 35971l*3/4 + 94457l*2/4 + 49485l/2 + 8998 = 0. -4, -2, -1, 4499 Factor -4t4 + 6609080t*3 - 39654384t*2 + 79308704t - 52872448. -4(t - 1652264)(t - 2)*3 Suppose -2n*4/13 + 30612n*3/13 - 611354n*2/13 - 1314552n/13 - 672584/13 = 0. What is n? -1, 22, 15286 Find w, given that 1995w5 + 35554535w*4 - 77442565w*3 + 48391785w*2 - 6683990w + 178240 = 0. -17824, 2/57, 1/7, 1 Determine b, given that -733b3/5 + 13232b*2/5 - 4828b + 1216/5 = 0. 38/733, 2, 16 What is b in -4b4/9 + 178316b*3/9 - 220898820b*2 + 17876581300b/9 + 19864849000/9 = 0? -1, 10, 22285 Determine w so that -5w5 - 109430w*4 - 8514840w*3 - 212039370w*2 - 1430527635w + 6438702960 = 0. -21808, -27, 3 Factor 2r3/9 + 1295264r*2/9 + 209713603712r/9. 2r(r + 323816)*2/9 Solve 4d*4 + 1904d*3 + 206540d*2 - 4819136d + 12546816 = 0 for d. -248, 3, 17 What is i in -9281086923i3 + 55686855264i*2 - 2002359i + 18 = 0? 1/55621, 6 Find d such that 4d2 - 186563592d + 2175373366246404 = 0. 23320449 Find l such that -3l5 + 1545l*4/4 - 10329l*3 + 120891l*2/4 + 259749l - 207576 = 0. -4, 3/4, 8, 31, 93 Factor -3i3 - 9102i*2 - 63597i - 90810. -3(i + 2)(i + 5)(i + 3027) Find h such that 3h*4 + 4446h*3 - 568845h*2 + 4336584h - 8530128 = 0. -1601, 4, 111 Find z such that -4z5/7 - 105z*4 + 22492z*3/7 + 93063z*2/7 + 50940z/7 - 2700 = 0. -210, -3, -1, 1/4, 30 Determine u so that 5u4 + 3142675u*3 - 5u*2 - 3142675u = 0. -628535, -1, 0, 1 Determine i, given that 4i5/7 + 1132i*4/7 - 309668i*3/7 + 1528900i*2/7 - 2436128i/7 + 173680 = 0. -455, 1, 2, 167 Solve -p*5/3 + 175298p*4/3 - 44460665p*3/3 - 89447228p*2/3 - 14937088p = 0 for p. -1, 0, 256, 175044 What is r in -r*5 - 1245r*4 - 13272r*3 + 372404r*2 - 326352r - 710784 = 0? -1234, -24, -1, 2, 12 Find u, given that u*4 + 182u*3 + 241u*2 - 22008u - 105840 = 0. -180, -7, 12 Suppose -4c3 + 4424296c*2 + 8848604c + 4424304 = 0. Calculate c. -1, 1106076 Factor -5x3 - 175465x*2 + 3159585x - 14219955. -5(x - 9)2(x + 35111) Let 2f2/9 + 4232f/9 + 1474880/9 = 0. What is f? -1676, -440 Factor 5z2 - 66446975z - 863811520. 5(z - 13289408)(z + 13) Suppose r*3 + 16719r*2 + 5424758r + 5408040 = 0. What is r? -16388, -330, -1 Let -391536449798400x2 + 79149120x - 4 = 0. Calculate x. 1/9893640 Suppose -3z2/7 + 80750988z/7 - 543393505248012/7 = 0. Calculate z. 13458498 Find q, given that -2q3/5 - 42816q*2/5 - 2876808q - 243546080 = 0. -21068, -170 Determine l, given that 5l5/3 + 2644l*4/3 + 32935l*3/3 - 45988l*2/3 - 10980l + 14448 = 0. -516, -14, -1, 1, 6/5 Factor v*2/3 + 18560546v/3 + 18560545/3. (v + 1)(v + 18560545)/3 Determine x, given that x4/3 - 385x*3 + 11449x*2/3 + 385x - 11450/3 = 0. -1, 1, 10, 1145 Suppose 4567n4/8 + 26947n*3/8 + 26037n*2/4 + 7769n/2 - 455 = 0. What is n? -2, 455/4567 Factor 428275c3 + 855890c*2 + 426955c - 660. 5(c + 1)2(85655c - 132) Factor -2l*2/11 + 654l/11 - 51220/11. -2(l - 197)(l - 130)/11 Factor 2r2/9 - 400154r/9 + 2000720/9. 2(r - 200072)(r - 5)/9 Determine h so that -22h4/7 - 20h*3/7 + 180202h*2/7 + 344000h/7 + 23400 = 0. -90, -1, -10/11, 91 Factor 2u2/3 + 28360928u + 301628338882944. 2(u + 21270696)2/3 Find z, given that z4 - 5869199z*3 + 8611877159999z*2 - 8611871290801z = 0. 0, 1, 2934599 Factor j*2/5 - 696j/5 + 113879/5. (j - 433)(j - 263)/5 Factor g5/6 + 6235g*4/6 - 590548g3/3. g3(g - 184)(g + 6419)/6 Factor -33p3/7 - 3311358p*2/7 - 83069178336p/7 - 15103377504/7. -3(p + 50172)2(11p + 2)/7 Let 40l*2 - 1672602l + 83630 = 0. Calculate l. 1/20, 41815 Factor 2w3/3 - 202466w*2/3 + 269944w. 2w(w - 101229)(w - 4)/3 Factor 5o*3 + 1398565o*2 + 1398530o - 8391360. 5(o - 2)(o + 3)(o + 279712) Find a such that 29433a*2/2 + 353178a - 432 = 0. -24, 12/9811 Let 2s3/5 - 469512s*2/5 - 21132002s/5 - 20662488/5 = 0. What is s? -44, -1, 234801 Factor 2u2/7 + 1962006u/7 - 11772108/7. 2(u - 6)(u + 981009)/7 Solve -3f2 - 893985f - 8045622 = 0. -297986, -9 Let 4c4 - 65176c*3 + 781484c*2 + 846664c = 0. Calculate c. -1, 0, 13, 16282 Solve -2r4 + 64912r*3 - 778602r*2 - 1751948r - 908432 = 0 for r. -1, 14, 32444 Solve 4b2 + 82303808b + 423369800706304 = 0 for b. -10287976 Factor -r*2/7 + 267471r + 3744598/7. -(r - 1872299)(r + 2)/7 Suppose -2r*3 - 1251474r*2 - 1251472r = 0. Calculate r. -625736, -1, 0 Determine b, given that -5b4 - 97870b*3 - 479513385b*2 - 5737338980b + 13393514540 = 0. -9781, -14, 2 Factor -2n3/3 + 56576122n*2/3 - 133369056427266n - 133369075285974. -2(n - 14144031)2(n + 1)/3 Solve 3b5 - 153b*4 + 1530b*3 - 4974b*2 + 2115b + 8775 = 0 for b. -1, 3, 5, 39 Find f, given that f*5/3 - 38117f*4/3 + 114344f*3/3 - 76228f*2/3 = 0. 0, 1, 2, 38114 Let 2k*5 + 432k*4 + 14854k*3 + 81288k*2 - 1195776k + 2419200 = 0. What is k? -175, -24, 3, 4 Find x such that -x*3/4 + 621720x*2 + 14921307x/4 + 11190987/2 = 0. -3, 2486886 Suppose -2o4 - 1174o*3 - 26022o*2 + 2315150o - 26280800 = 0. Calculate o. -560, -65, 19 Solve 5f3 + 239135f*2 + 5020150f + 24859120 = 0. -47806, -13, -8 Determine l, given that 3l5/4 + 207l*4/4 + 1281l*3/2 - 4923l*2/2 - 2565l/4 + 9639/4 = 0. -51, -21, -1, 1, 3 Factor -2k3/7 + 3581236k*2/7 - 229023367630k + 916085284856. -2(k - 895307)2(k - 4)/7 Solve -2f4 - 19292f*3 - 46599634f*2 - 370638928f + 2229385056 = 0. -4819, -12, 4 Find g such that -4g2 + 247436g - 1979232 = 0. 8, 61851 Let -3y*4 - 7	{ "pile_set_name": "DM Mathematics" }
w = -2l + 89, -2 = -2w. Let o = l + q. Is o a multiple of 16? True Let r = 10 - -3. Is 5 a factor of r? False Let s(o) = 4o3 + 4o*2 + 3o + 4. Let y(r) = -r3 + r2 - r. Let m(d) = s(d) + 3y(d). Let x be m(-7). Suppose -5 + 21 = xw. Does 2 divide w? True Let o = -4 - -4. Suppose o = 5a - 112 - 23. Is a a multiple of 15? False Let n(s) = s - 6. Let q(x) = x - 3. Let j(l) = 6n(l) - 13q(l). Is j(-3) a multiple of 8? True Let y(z) = -z3 + 2z*2 + 8z - 4. Let f be y(5). Let s = f - -68. Does 29 divide s? True Let y be (3/(-3) - -62)/(-1). Let s = y + 19. Let k = s + 66. Does 10 divide k? False Suppose 4m = 2t - 182, -2t + 276 - 70 = 2m. Is t a multiple of 33? True Let u be (-3)/((-9)/(-3) + -4). Suppose -144 + 45 = -ui. Suppose -4r + 75 = -i. Is r a multiple of 8? False Suppose 0 = 3u + 3f, 5u + 4f = 2u. Let d = -3 + 5. Suppose -s + d = -us. Is s even? True Suppose -2z = 2z + x - 137, 2x = -5z + 169. Suppose 4u - z = -u. Does 3 divide u? False Suppose -4j - 3o = -2o - 480, -j + 4o + 120 = 0. Is j a multiple of 15? True Suppose -4y = -2n - 3n + 14, -7 = -n + 5y. Does 4 divide (-3 + n + -4)/(-1)? False Let a(l) = l - 5. Let g be a(10). Suppose 0 = -2p - 2y + 80, -2p - gy = -0p - 86. Suppose -h + p = -w, -2h - h + w = -106. Is 17 a factor of h? True Let s = 0 - 9. Is 6 a factor of s/2(-12)/9? True Let j(g) = -g*2 - g - 2. Let b be j(3). Let i be (0 + b)/(2 + -3). Let c = i - -26. Is c a multiple of 14? False Let l(x) = 3x - 18x - 2 - 1. Is 9 a factor of l(-2)? True Suppose 2s = -3s + 1545. Suppose 306 = 5o + 3g, -o + 6o + 2g - s = 0. Does 19 divide o? False Is 1/3(13 + 2) a multiple of 4? False Suppose -4n - n = -5. Let v(w) = w + 4. Let q be v(2). Suppose -q = -j - n. Is 5 a factor of j? True Is 9 a factor of ((-15)/10)/(3/(-164))? False Suppose -3a - 95 = -2b, 2a + 2b + 71 = 1. Is ((-4)/6)/(11/a) even? True Let t(a) = -2a + 10. Let d be t(-10). Suppose -2x - d = 2u - 132, u = 2x - 87. Is 12 a factor of x? False Let z(p) = 4p*3 + 2p*2 - 1. Let l be z(-1). Is l74/(-3) a multiple of 14? True Let a be (-3 - -2)/((-2)/(-16)). Let i = a + -11. Let w = i - -32. Does 13 divide w? True Let r(b) = -b + 1. Let d be r(1). Suppose d = -3w + 5 + 1. Suppose 2o + wo = 28. Does 3 divide o? False Suppose 108 = 5f - 2f - 3j, 2f = -4j + 90. Is f a multiple of 13? True Let y = 4 + -4. Suppose 5 = x - 0x, -t + 3x - 39 = y. Let b = 42 + t. Is b a multiple of 14? False Suppose s = 2i + 19, -s + 13 = 2i - 2. Suppose 5v - s - 13 = 0. Is 16 a factor of (16/v)/(3/18)? True Let v = 44 - -52. Suppose 0w = -3w + v. Is w a multiple of 12? False Suppose -4 = f + f, 169 = 3v + 4f. Does 17 divide v? False Let h(u) = -5u2 + 8u - 1. Let v(c) = -11c2 + 17c - 3. Let r(n) = -7h(n) + 3v(n). Suppose -3w + 25 - 7 = 0. Does 14 divide r(w)? False Let w(y) = -16y3 - y2 - y. Let p be w(-1). Does 8 divide (-16)/3(-72)/p? True Let m(k) = 4k + 3. Let l(w) = w - 1. Suppose 4i = -2c + c, 2i + 2 = -c. Let x(v) = im(v) + l(v). Does 4 divide x(2)? True Let l(m) = 2m3 - 3m*2 + 4m + 1. Let r be l(3). Suppose 0 = -7w + 5w + r. Is 10 a factor of w? True Suppose u - 7 + 3 = 0. Suppose -s + us = 0. Suppose s = -w + 9 - 1. Is w a multiple of 8? True Suppose 0 = r - 1, r - 85 = -4k - 0k. Does 3 divide k? True Let s(k) = k2 - 18k + 26. Is s(20) a multiple of 33? True Let x(i) be the third derivative of -i*5/60 + 3i*4/8 + 2i3/3 + i2. Let t be x(9). Is 14 a factor of 2/t + 135/6? False Suppose 4x = 301 - 61. Does 10 divide x? True Let q(s) = s3 + 8s*2 - 4s - 6. Let j be (-3)/1(-42)/(-18). Is 18 a factor of q(j)? False Let t(v) = -2v - 2. Let u be t(-5). Is 8 a factor of (u/5)/(15/75)? True Let v(x) = 2x2 - 2x - 1. Let h be v(2). Suppose -u + 4d - 4 = 0, hu - 3 - 3 = 3d. Suppose 3n - 7 = -2s, un - 40 = 5s - 0s. Does 4 divide n? False Let b be 6/15 + 107/(-5). Is (3/(-9))/1b a multiple of 7? True Suppose 0j - 1091 = -5j + 3b, -426 = -2j - 4b. Does 12 divide j? False Let f(b) = 7b3 - b2 + b. Let o be f(1). Suppose o = c - 38. Is c a multiple of 13? False Let p be (-1 + -2)2/(-3). Let i = p + -2. Suppose 3a - 27 - 33 = i. Is 10 a factor of a? True Let n be (-13)/(-3) + 2/3. Suppose 26 = -2t - 0t + 4h, h - n = 0. Is 4 a factor of 32/6t/(-2)? True Suppose 0 = -u - 1, -902 = -5f + 5u - 3u. Is f a multiple of 20? True Suppose -4h + 27 - 167 = -3r, 2r + 2h = 112. Suppose -3o = o - r. Is 8 a factor of o? False Let o(s) = -s2 + 29s - 27. Is o(26) a multiple of 17? True Is (-10)/((-12)/90 - 2/10) even? True Suppose 3f + 4d = 404, f - 4f + 5d = -440. Does 22 divide f? False Let n = 39 - 20. Is 7 a factor of n? False Let t(j) = -j*3 + 4j*2 + 8j + 5. Is 5 a factor of t(5)? True Let z = 0 + -3. Let h be (-18)/(z/(9/6)). Suppose 4n - 47 = h. Is 4 a factor of n? False Suppose 5i - 44 = -2f - 19, 29 = 3i + 4f. Let v be (-33)/(-9) - (-2)/6. Suppose 0 = -ix + vx - 15. Is 14 a factor of x? False Suppose -2y + 169 = -167. Is y a multiple of 42? True Let g(t) = 4t3 - t2 + 2t - 2. Suppose v + v - 12 = -4b, 3v - 16 = -5b. Does 15 divide g(b)? True Suppose 0k = 3k + 3. Let n be (-3)/(((-6)/(-20))/k). Suppose 2s = -3s + n. Is s a multiple of 2? True Let v(y) = -5y + 3. Let o(w) = 14w - 9. Let h(m) = -2o(m) - 7v(m). Suppose -3k = -4j + 20, 2k - 6k - 26 = -5j. Is h(j) a multiple of 4? False Let o(u) = u*3 - 11u*2 - 9u + 30. Is o(14) a multiple of 21? False Suppose 6v = 1086 - 192. Is 17 a factor of v? False Let c = -16 + 15. Let h = c - -48. Is 28 a factor of h? False Suppose 0 = -k + 4, 3o - 7 = 3k - 7k. Let y(w) = w*3 - 2w*2 + 2w - 4. Let j be y(3). Let p = j + o. Is 4 a factor of p? True Let i = -12 + 17. Suppose -20 = -4l - 3g, l - 2g + ig - 14 = 0. Suppose 5h + 78 = 4p, -h + 0 = -l. Is p a multiple of 8? False Let y be 3/(-12) - 41/(-4). Suppose -3i = -y - 26. Is i a multiple of 12? True Suppose 0 = r - 4k - 5, 0r = r - 2k - 11. Does 4 divide r? False Suppose 147 = 5u - 33. Does 2 divide u? True Suppose -4j - 3p + 4 = -16, 15 = 3j - p. Let q = 6 + j. Is 4 a factor of q? False Let w(b) = b*3 + 6b*2 - 7b + 9. Is w(-7) a multiple of 9? True Suppose j = 4j. Suppose 3n + 0n = j. Suppose -3f - 9 - 3 = n, -2a - f = -10. Does 2 divide a? False Suppose -j + 5k = -3j - 24, 2j - 4k + 6 = 0. Let g = j + 20. Is 5 a factor of g? False Suppose 2i = -0i - 3s - 39, -14 = 2i - 2s. Let o = 25 + i. Is o a multiple of 6? False Suppose p = 2h + 4 + 17, -h = -5p + 69. Does 13 divide p? True Suppose -5f = -5p - 45, 3f - 5 = 4. Let y = p + 9. Suppose -5 = l, -z - 4 - y = 3l. Is 8 a factor of z? True Let i(o) = 4o2 - 4. Let b be i(3). Let u = b - 8. Is 8 a factor of u? True Let n(z) = 7z - 1. Let r be n(1). Suppose 0 = 3o + 3h - 42, -2o + 29 = 3h + 1. Suppose ry - o = 5y. Does 14 divide y? True Suppose 47 = -9k + 263. Does 24 divide k? True Suppose -3p + 4p = -61. Let o = p + 90. Does 29 divide o? True Suppose j - 2t - 2t - 128 = 0, -3t = 4j - 531. Let w = j - 69. Is 21 a factor of w? True Suppose 7t = 10t - 87. Is 11 a factor of t? False Suppose -13m + 17m - 2j = 510, 0 = -4m + 5j + 507. Is m a multiple of 16? True Suppose -4k = -k - 246. Suppose -q + 8c + k = 3c, -122 = -2q - 4c. Suppose q - 23 = 4u. Is u a multiple of 6? False Let q be 26/(-10) - (-6)/(-15). Does 22 divide (14/q)/(2/(-12))? False Let h = -2 + 4. Suppose hd - 3p = 16, -3d + 0p + 18 = -3p. Let g(y) = -y3 + 4y*2 - 2y + 3. Is g(d) a multiple of 3? False Does 21 divide (-4313)/(-57) + 1/(-3)-1? False Let u = -15 - -48. Does 33 divide u? True Let p(v) = v3 + 10v2 + 18. Is p(-8) a multiple of 12? False Let p(u) = -u2 - 11u - 2. Let c(t) = 2t*2 + 23t + 5. Let v(s) = 4c(s) + 9p(s). Suppose 0 = -3n, 15 = -7m + 4m + 2n. Is v(m) a multiple of 6? True Let k(o) = -o3 - o2 + o + 10. Suppose 2a - 4 = -2s, -a - 2s - 2 = -3s. Suppose r = -ar. Is 10 a factor of k(r)? True Suppose 21b = 18b + 63. Does 9 divide b? False Suppose 0u - 4u + 32 = 4w, 4w - u - 7 = 0. Suppose 2 = -wr - 1. Is 40(-1 - 2/r) a multiple of 16? False Let w(q) = q2 - 8q + 9. Let s be w(7). Suppos	{ "pile_set_name": "DM Mathematics" }
ve 0 = 444u + 1175u - 67998 for u. 42 Solve 0 = -597z + 9282 + 8001 + 20925 for z. 64 Solve -2540 = 173c - 4237 - 2974 for c. 27 Solve 527u - 17066 = -2837 for u. 27 Solve -1341c - 209c + 411c + 2360 - 18306 = 0 for c. -14 Solve 4230p = 32255 + 1585 for p. 8 Solve 41742c - 31584 = 40990c for c. 42 Solve -1839a + 3632a - 315 = 1828a for a. -9 Solve 0 = 321z - 26 - 33358 for z. 104 Solve -419y + 84 = 180y - 235y - 2100 for y. 6 Solve 32137045k - 32136767k - 19194 = 18336 for k. 135 Solve 3426 = 65m + 56m - 3209 + 222 for m. 53 Solve 6d = -11d + d - 49d + 2080 for d. 32 Solve -2646f - 940f - 671f = -76626 for f. 18 Solve 362108n - 364559n = 240198 for n. -98 Solve 177w + 1963 + 3661 = 39w - 10w for w. -38 Solve 24505 - 4147 = -70h - 164h for h. -87 Solve -676o - 100o - 14317 = 171o + 10305 for o. -26 Solve -381i + 20874 = -807i for i. -49 Solve -605q + 934165 = -1811q - 3957q + 293953 for q. -124 Solve -2566l - 2412l = 2299l + 480282 for l. -66 Solve 31687d + 3247 = 31613d + 583 for d. -36 Solve -1941g - 1416g + 118008 - 223323 = 314310 for g. -125 Solve 845m = 999m - 4928 for m. 32 Solve 565v + 14005 = 16830 for v. 5 Solve -102m + 1480 = 58m + 71m - 46m for m. 8 Solve 87u + 3688u = 56771 + 211254 for u. 71 Solve 0 = -10414n - 95n - 735630 for n. -70 Solve 599t + 19611 = -20969 - 14528 for t. -92 Solve -6536n + 6547n + 11 = 0 for n. -1 Solve -851 = -36h - 311h + 25868 for h. 77 Solve 593930n + 5960 = 594079n for n. 40 Solve 0 = -14x + 420x - 19160 - 3982 for x. 57 Solve 388z = 640z - 388z + 7480 for z. 55 Solve -69i = 185i - 239i + 1230 for i. -82 Solve -4421 - 14963 = 293z - 3855 for z. -53 Solve 4067j = -4109j + 12228j - 4109j + 4332 for j. 76 Solve -3837g + 1544g + 158236 - 16070 = 0 for g. 62 Solve -29j = -586 - 400 for j. 34 Solve -2884r - 46516 + 180232 = -5181 - 60099 for r. 69 Solve 1366q + 4852q = 1276q + 291578 for q. 59 Solve -192875 + 42973 - 34275 = -3432u + 268847 for u. 132 Solve -81v = 82v - 2800 - 5350 for v. 50 Solve 324314 + 79428 = 4637x - 13588 for x. 90 Solve 172d + 1260 = 382d - 182d for d. 45 Solve 7884 + 4289 + 9188 = 234b + 4279 for b. 73 Solve -11242 + 40229 + 22199 = -898v for v. -57 Solve -10u - 47u = 51u - 7u - 2424 for u. 24 Solve -22989i + 22923i + 4290 = 0 for i. 65 Solve -467b + 9b - 23496 = 112b + 56304 for b. -140 Solve -138k - 139411 = -155695 for k. 118 Solve 11130m + 9016 = 10934m for m. -46 Solve -23536 = 924m + 20952 - 1984 for m. -46 Solve 3167y + 2874y + 3278 = 6339y for y. 11 Solve 15039 - 5514 = 198i - 10077 for i. 99 Solve 1997o - 3760o = 3313o + 116748 for o. -23 Solve 4783 = 904m + 1077m - 22951 for m. 14 Solve 28537 = -2539a + 900a - 889a - 9383 for a. -15 Solve 1946w + 140352 = -349w - 629w for w. -48 Solve 54145 = -911y - 35133 for y. -98 Solve -780g + 1385g - 162680 = -1355g for g. 83 Solve -59j = -136j - 117j + 5044 for j. 26 Solve 1605m = -975m - 198660 for m. -77 Solve -8381o + 389131 = -261596 - 296326 for o. 113 Solve 54h - 50322 = -50268 for h. 1 Solve -2124l = 5743l + 1684l + 457614 + 96344 for l. -58 Solve 0q + 53427 = -20q + 51767 for q. -83 Solve 1828r = 23770 + 1822 for r. 14 Solve 974o + 3048 = 2074 for o. -1 Solve 259v - 4455 = 3990 - 652 - 1059 for v. 26 Solve -409b - 754b - 512b + 252b = 49805 for b. -35 Solve 3403v + 4047 = 6700v - 3368v for v. -57 Solve 194 = -445h + 594h + 45 for h. 1 Solve -73w - 1796 = 473 + 359 for w. -36 Solve 102415z + 4088 = 102561z for z. 28 Solve -8809c = 475540 + 146 for c. -54 Solve -13870 - 98927 - 35541 = -1107c for c. 134 Solve -8s + 16112 = 188s + 108s for s. 53 Solve 117f - 219f = 185f + 22385 - 5452 for f. -59 Solve 0 = -682x - 382x + 198x + 85x + 23430 for x. 30 Solve 2575f - 54024 + 112844 = -16695 - 86710 for f. -63 Solve 0 = 2835x - 2824x - 990 for x. 90 Solve 204f - 15196 - 42979 = 875f + 224f for f. -65 Solve -33p - 2931 + 2367 = -1686 for p. 34 Solve 3328q + 89497 = -8651q - 221957 for q. -26 Solve -770 = -344i - 6033 + 103 for i. -15 Solve -435w - 539w - 47560 = 22w + 1382w for w. -20 Solve -8169r = -5204r + 12890r - 443940 for r. 28 Solve -2891 = 100l + 509 for l. -34 Solve 165g - 16g + 4940 = 56g - 154g for g. -20 Solve 91z + 103 = -1224 - 2040 for z. -37 Solve -1335i = -674i - 618i - 172 for i. 4 Solve 69k - 173k + 35k = 4416 for k. -64 Solve 2287 = -3w + 24w + 7w + 3267 for w. -35 Solve 348v + 12807 = -1461 for v. -41 Solve -154o + 5o + 470 = -1169 for o. 11 Solve 80l + 83l - 4l = 2862 for l. 18 Solve -233r + 590 = -454r + 280r for r. 10 Solve -878 - 2603 + 889 = -48g for g. 54 Solve 6760 = -99c + 7208 + 4601 for c. 51 Solve 36v - 4067 = -51v - 14v + 781 for v. 48 Solve -3283z + 183z - 179109 - 12183 = 256z for z. -57 Solve 402i + 2220 - 4 + 1804 = 0 for i. -10 Solve 12843 - 13599 = -108h for h. 7 Solve -49059 = 58r - 48827 for r. -4 Solve 15918 - 1054 = -2f - 402f - 8972 for f. -59 Solve 1186o = -1672o - 69437 - 6590 - 81163 for o. -55 Solve -95g + 188 = -1241 - 7881 for g. 98 Solve -767991 + 666890 = -1001t for t. 101 Solve 63x + 93x = 64 - 286 + 1158 for x. 6 Solve 11937 + 1204 + 3390 = 295x + 1781 for x. 50 Solve -100t - 870 = -5970 for t. 51 Solve 194y - 4y + 74y = 13y + 10040 for y. 40 Solve 71j - 663 - 558 = 128 for j. 19 Solve -1110k - 46529 = 1610k + 1155k - 1138k for k. -17 Solve -3117 = 33b - 708 for b. -73 Solve 488b - 1491 = 13b - 4051 - 5515 for b. -17 Solve 304b + 167b - 119b + 29925 = -313b for b. -45 Solve 2l - 1960 + 376 = 50l for l. -33 Solve -295p - 58p - 7245p - 607840 = 0 for p. -80 Solve 97282h - 48688h = 48639h + 2250 for h. -50 Solve 0 = -4665a + 5001a - 336 for a. 1 Solve -21d + 14d = 39d - d - 2250 for d. 50 Solve 260y - 638y - 363y - 367y = -49860 for y. 45 Solve 0 = 78c - 637 + 13 for c. 8 Solve 0 = -471k + 210 + 5884 + 4771 + 4678 for k. 33 Solve -250l - 11411 = 9839 for l. -85 Solve -1169c - 4240 = 4248 + 12554 for c. -18 Solve 503q - 1454q + 2533q + 75449 = -2389q for q. -19 Solve 623579 = -82o + 622841 for o. -9 Solve -1108j - 1499j = -348j - 206j - 28742 for j. 14 Solve -30c - 2445 = 264c + 2847 for c. -18 Solve -1242c - 8218 = -77770 for c. 56 Solve 6355 - 9995 = 264w + 12200 for w. -60 Solve -20480 = -16926g + 47224 for g. 4 Solve 453i + 2084i - 8693 = 29362 for i. 15 Solve 41f + 66f - 50625 = 482f for f. -135 Solve -5685 - 283 = -746a for a. 8 Solve 412f - 61639 + 1646 = -1357f + 106293 for f. 94 Solve -491l - 8l + 10212 - 232 = 0 for l. 20 Solve 289r = -33r - 54r + 1128 for r. 3 Solve 559t + 1417t = -338t - 178178 for t. -77 Solve 0 = -10258g + 2825g + 728434 for g. 98 Solve 258 - 401 - 468 = 13r for r. -47 Solve 169y + 2566147 - 2551275 = 0 for y. -88 Solve -83h - 19332 = -318h - 302h for h. 36 Solve 4230 = 12o - 131o + 65o - 87o for o. -30 Solve 4969a = 4947a + 1213 - 377 for a. 38 Solve -1764 = 5580923y - 5581119y for y. 9 Solve 121p + 896p + 6990 = -369p + 221p for p. -6 Solve -109m - 2671 + 750 - 1785 = 0 for m. -34 Solve 1684 = 36k - 148 - 976 for k. 78 Solve 947x = -791x + 1706x + 2912 for x. 91 Solve 0 = 7y + 3598 - 3752 for y. 22 Solve 187f + 8832 + 6083 = 2199 for f. -68 Solve 1653x - 4581x + 20990 = 1270x for x. 5 Solve 107p + 4437 - 21129 = 0 for p. 156 Solve -8235 = -168q - 118q + 6874 - 1095 for q. 49 Solve 42709g - 55 = 42764g for g. -1 Solve 50t - 315 = 503 - 68 for t. 15 Solve -34m - 1156 - 395 = 69m - 2066 for m. 5 Solve 34z + 7688 + 11899 - 2413 = 311z for z. 62 Solve 2087h - 7831h - 499728 = 0 for h. -87 Solve 3585z - 1806 = 3627z for z. -43 Solve 311 + 182 = -310o + 339o for o. 17 Solve 1095 - 195 = -20f - 42f - 2448 for f. -54 Solve -16h + h - 26h + 8964 = 42h for h. 108 Solve -2584 = -121693y + 121761y for y. -38 Solve 23y + 21y - 15405 = 281y for y. -65 Solve 255k + 6575 + 10064 = 1084 for k. -61 Solve -295730 = -9378q + 145036 for q. 47 Solve -36y - 2501004 + 2521332 = 206y for y. 84 Solve 6415m = 6231m + 2576 for m. 14 Solve -2937x - 54548 = -839x for x. -26 Solve -4332008v - 2828 = -4332109v for v. 28 Solve -4	{ "pile_set_name": "DM Mathematics" }
-5x - a = 3n, 2x = 2n - 10 + 4. Solve n = -3d + 8d for d. 0 Suppose 2k + 5j = -k + 45, 30 = 2k - 5j. Solve 8f - k = 3f for f. 3 Suppose 4m + 2452 - 2460 = 0. Solve -ms = 3s + 15 for s. -3 Suppose 9k - 4k - 15 = 0. Suppose -6510 + 6496 = -14g. Solve 7 = -kv + g for v. -2 Suppose 2 = 4w - 6. Suppose 5q + wn + 3n = 70, 2 = q - 3n. Let h be (1/(-3))/(2/(-12)). Solve -3 = ho - q for o. 4 Let n(u) = -2u + 16. Suppose -6j = -7j - 7. Let h be n(j). Let d = -26 + h. Solve 0 = -dt + t + 9 for t. 3 Let c = 4 - 3. Suppose u = a - c, 3u - a + 1 - 4 = 0. Solve 2z + u = 4 for z. 1 Let l = 222 - 218. Let c = -20 - -14. Let g be (-124)/c - 6/9. Solve lo + o + g = 0 for o. -4 Let x(y) = -14y + 16y*2 + 9y - 36y2 + 21y*2 + 3. Suppose -2v = 5n, 5n = v + v - 20. Let z be x(v). Solve 5 = zl - 4l for l. -5 Let s(f) = 11f + 46. Let x be s(-4). Solve xh - 8h = 6 for h. -1 Let d(k) = k + 2. Let t be (-2 + 0 + 2)/(-1). Let s be d(t). Suppose 39 = -sm + 5m. Solve 5w = -3 + m for w. 2 Suppose -12v - 32 = -4v. Let b(p) = p*3 + 4p*2 - p. Let a be b(v). Solve 0 = 2u - 6 - a for u. 5 Suppose 0 = 3372q - 3377q + 40. Let h be 114/10 - 3/(-5). Solve -5u - h = -qu for u. 4 Suppose 5o - 3u - 51 = 134, 0 = 5o + u - 205. Solve -26a = -18a + o for a. -5 Let c(k) = -3k*3 + 44 + 46 + 2k - 82 - 6k2. Let a(x) = 4x*3 + 7x*2 - 2x - 8. Let t(o) = -2a(o) - 3c(o). Let h be t(-4). Solve 0 = -hd - d for d. 0 Let m(n) = -3n*2 + 20n + 36. Let p be m(8). Solve pa + 1 = -11 for a. -3 Suppose 5r - 58 = 3r. Let o = 25 - r. Let l be 6/o(-8)/12. Solve 3z = -l + 13 for z. 4 Let l = -163 + 178. Solve 0 = 3r - l for r. 5 Let w = 65 + -156. Let g(q) = q*2 + 5q - 157. Let n be g(10). Let b be (-2)/n + (-1521)/w. Solve -5x + b = -3 for x. 4 Let f = 3 + 4. Let w be (-4)/(-8)(-2 + 4). Let k be ((4 - 3) + 1)w. Solve 0 = kv + f - 1 for v. -3 Let n = 5 - 7. Let s = 0 - n. Suppose -976 + 960 = -8g. Solve g = w - s for w. 4 Let u = 13 + -6. Suppose 4w - 18 - 2 = 0. Solve -u = -wl + 18 for l. 5 Let o(l) = -l2 - l - 17. Let j be o(0). Let f = j + 8. Let u = f - -10. Solve 2i + 1 = -u for i. -1 Let v be (-7)/(-14) - (-18)/4. Suppose -vn - 15 = -6n. Solve n = -6m + 9m for m. 5 Let a = 65 + -65. Let o(q) = -q + 8. Let s be o(6). Solve sx + 6 = -ax for x. -3 Suppose -10 = -5a - 5k, 3k = -5a + 6k - 6. Solve -5h + 0h - 15 = a for h. -3 Let x = -29 - -30. Let g = -12 + 14. Suppose -gs - 3u - 11 = 0, -u - 3 - 2 = 0. Solve n + x = s for n. 1 Let k(u) be the second derivative of -1/3u*3 + 0 + 9u + 8u2. Let d be k(5). Solve -d = 2j + j for j. -2 Suppose 0 = -7g - 6 + 48. Suppose 2z = z + 6. Suppose -zy + g = -3y. Solve 8 = yo - 0o for o. 4 Let t = -17 - -22. Suppose -f - 50 = -6f - tb, -3f - 10 = -5b. Suppose 3 = 2o - fy - 7, 20 = 4o - 3y. Solve 2w + 3w = o for w. 1 Let m = -45 + 43. Let b(h) = -h*3 - 3h*2 - 2h + 2. Let f be b(m). Solve -1 - 3 = fp for p. -2 Let o(p) = p + 1 - 6p2 - p3 + 2p3 - 5. Let c be o(6). Suppose -41n + 42 + 40 = 0. Solve n + c = -t for t. -4 Let i = -3078 - -3094. Solve 21a - 5a - i = 0 for a. 1 Let q be (-1 - -5) + (0 - 0 - -1). Let h(g) = -g*3 + 6g*2 - 7g + 12. Let c be h(q). Solve 7b = cb - 5 for b. -1 Let b be 2(3 + 0)105/45. Solve -bx + 52 = -x for x. 4 Let r be 18/(-297) - 2320/(-165). Solve 26 = -8v - r for v. -5 Let t be (30 + -27)4/3. Let o(z) = 3z. Let s be o(2). Solve -a = -ta + s for a. 2 Suppose l = -2x + 6, -4l + 24 = 2x + 3x. Let b = 11 - l. Let f be 3/(0 + 3/4). Solve f = br - 1 for r. 1 Let z be (-2)/4 + (-1)/(-2). Suppose c + 0c + 4s - 17 = z, 4c - 23 = -s. Let r = 6 - c. Solve 7 - r = 3b for b. 2 Let j be 29/4 + (-18)/(-24). Solve -4 = -jx + 9x for x. -4 Let x(r) = 5r3 + r2 + 18r - 20. Let u(o) = -2o3 - o2 - 9o + 10. Let k(p) = -7u(p) - 3x(p). Let v be k(5). Solve 6w = 8w - v for w. 5 Let x = 6 - 2. Suppose 144 = xg + 2g. Let n = g - 24. Solve 4 = -nb - 2b for b. -2 Suppose 8b = -4b + 48. Solve bj = -0j + 20 for j. 5 Let c = 47 + -19. Let r be 20/6 + 4/6. Let q(a) = -a3 - a2 - 28a - 52. Let b be q(-2). Solve ry + c = b for y. -5 Let k = 321 + -311. Let c(h) = h - 4. Let b be c(4). Solve b = 2z - k for z. 5 Let q = 60 - 28. Let c be 2/(-5)(27 - q). Suppose -4r + 40 = -0r. Solve 0z + r = -cz for z. -5 Suppose -35 = -3z - 4z. Suppose -z + 1 = -v - n, 4n - 9 = 3v. Solve 7 + v = -4w for w. -2 Suppose -4y = -w + 12, 0 = -5w + w + 3y + 61. Solve 3a - w + 1 = 0 for a. 5 Let k = -41 + 28. Let r = -11 - k. Solve 0l + 4 = rl for l. 2 Let f = 44 + -33. Suppose 4a + 3p - f = -a, -5p + 13 = 3a. Solve -1 - a = l for l. -2 Let i(q) = q3 + 30q*2 + 3q + 96. Let f be i(-30). Let l = -8 - -8. Solve l = 11j - fj for j. 0 Suppose 0 = -0s - s. Let z(i) = -i2 + i. Let t be z(s). Suppose t = -2r - 5j + 45, 2r + 5j = j + 40. Solve -4b = b + r for b. -2 Let h(o) be the third derivative of o*4/8 - 8o*3 + 11o*2. Let u be h(19). Solve -6 = -3g - u for g. -1 Suppose -44 = -3z + 2t - 3t, -z + 4t = 7. Suppose -5r + 5b = -16 + 6, 5r - z = 4b. Solve 0 = n - 0 + r for n. -5 Let f be (-1 - -21)12/15. Suppose -13i + fi = 12. Solve iw + w = -20 for w. -4 Let j(q) = -7q - 45. Let p be j(-7). Suppose pm + 7 = f - 3, 2f - 11 = -m. Solve x = 3x + f for x. -3 Let z(l) = -3l + 29. Let d be z(-18). Suppose -5q = -d + 23. Solve 6n - q = 2n for n. 3 Suppose 5d = d + 140. Let t = -34 + d. Let k be 6/t - (7 - 4). Solve g + kg + 4 = 0 for g. -1 Let b = 163 + -124. Solve 27a - 14a = -b for a. -3 Let w(q) = -11q + 46. Let x be w(4). Solve j + xj = -15 for j. -5 Let n be -89 + 2 + -3 + 1. Let u = 89 + n. Solve 0 = -f - uf - 1 for f. -1 Let o(g) = -g2 + 8g + 16. Let w be o(8). Suppose -8b + w = -0b. Let d = -8 - -11. Solve bc + dc = 0 for c. 0 Let u(t) = 6t2 - t - 1. Let r = 18 - 18. Suppose r = -6k + 2k, n - 2k + 1 = 0. Let p be u(n). Solve -p = -2d - 0 for d. 3 Let t be (3 + -6)/3 - -5. Suppose -36 = -a - 3a + 4n, -4n = -t. Let x = a - 8. Solve -x = -w - w for w. 1 Let t(k) = -k*3 - 7k*2 - 19k - 43. Let c be t(-5). Solve cq = 5q for q. 0 Let k(i) = -31i - 589. Let o be k(-19). Let n be (-4)/(-2) - 2-1. Solve ow = w + n for w. -4 Let l(k) = 13k - 260. Let d be l(20). Solve 86j - 85j - 3 = d for j. 3 Let h = 22 + -31. Let u = h + 11. Solve -u + 1 = l for l. -1 Let o(t) = -t*2 - 5t - 2. Suppose 0 = -3a + 10 + 14. Suppose z + c = 5c + a, -2z = -2c + 2. Let j be o(z). Solve -w = -j + 1 for w. 1 Suppose -4m - 2n = -88, 5m + 21 - 105 = 4n. Solve -m = 4i - 28 for i. 2 Let i be (1/4)/((-140)/48 - -3). Suppose 1 = ix + n, -x - 5 - 3 = 2n. Solve xq = 5 - 3 for q. 1 Let w(o) = 15o - 69. Let f be w(5). Solve 7p - 10p = -f for p. 2 Suppose -2f - 8 = -3f. Suppose v + 5y + 20 = 0, 68v + 12 = 64v - 3y. Solve vu = -4u - f for u. -2 Suppose -15a + 2a = -78. Suppose -f - 24 = -4f. Suppose -2 = 2c + o - 4o, -3c = -3o. Solve -cm - f = -am for m. 2 Let d be -1 - 0 - (-8 + 3). Let o = -5 + 5. Suppose -2v + 54 = -c + 5c, 2c - v - 17 = o. Solve -3x - d = c for x. -5 Let y = 13 + -16. Let o be (-1 + 1)/(-5 - y). Suppose q - 2 = w, 2w - 3q - q + 8 = o. Solve w = 4r - 4 for r. 1 Let v(q) = -2q*3 - 14q*2 - 2q - 9. Let l be v(-7). Suppose c + 3c = 8. Let t be c - ((5 - 2) + -1). Solve ld - d = t for d. 0 Let c be ((-2)/((-12)/14))/((-70)/(-180)). Solve -g = -cg for g. 0 Let y = 45 + -42. Let l(w) = -2w*2 + 2w + 8. Let v be l(4). Let t = 21 + v. Solve -th = y + 17 for h. -4 Let f be 0 + 4/((-12)/(-9)). Suppose 0 - 6 = -fm. Let q be m - (-3 + 1)-1. Solve q = -2x - 3 - 1 for x. -2 Let l = 36 + -24. Let c = 36 + -34. Solve l = -cv - v for v. -4 Suppose 5c - 3c - 159 = -5j, 4c + 177 = 5j. Solve 0 = 5p + 6p - j for p. 3 Let x = 14 - 12. Let l = 2 + x. Let g be (24/(-16))/((-2)/l). Solve 2j + g - 9 = 0 for j. 3 Suppose -3h = 15, 0 = -5w - h + 3h + 15. Suppose 4f - 22 = -2q, -f = -2q - w + 3. Solve o = -qo - 12 for o. -3 Let m(g) = -g*3 - 10g*2 - 18g + 11. Let r be m(-8). Let s = 47 - r. Solve -2t - 3t = s for t. -4 Let i(m) = -m*3 - 9m*2. Let s be i(-9). Let y be s/(5(-5)/(-25)). Solve -	{ "pile_set_name": "DM Mathematics" }
t of 22116? 6 What is the hundreds digit of 36849? 8 What is the units digit of 43114? 4 What is the units digit of 5113? 3 What is the units digit of 5497? 7 What is the tens digit of 3816? 1 What is the hundreds digit of 3215? 2 What is the tens digit of 956? 5 What is the hundreds digit of 4303? 3 What is the ten thousands digit of 69150? 6 What is the tens digit of 39829? 2 What is the thousands digit of 17226? 7 What is the thousands digit of 4327? 4 What is the hundreds digit of 40239? 2 What is the tens digit of 570? 7 What is the units digit of 79663? 3 What is the tens digit of 1281? 8 What is the thousands digit of 3667? 3 What is the tens digit of 3108? 0 What is the hundreds digit of 151? 1 What is the ten thousands digit of 43723? 4 What is the tens digit of 1434? 3 What is the thousands digit of 15287? 5 What is the thousands digit of 5661? 5 What is the hundreds digit of 19100? 1 What is the thousands digit of 47625? 7 What is the thousands digit of 3011? 3 What is the thousands digit of 8407? 8 What is the thousands digit of 8793? 8 What is the thousands digit of 17674? 7 What is the units digit of 551? 1 What is the thousands digit of 1332? 1 What is the units digit of 2354? 4 What is the tens digit of 5978? 7 What is the hundreds digit of 1611? 6 What is the ten thousands digit of 12300? 1 What is the tens digit of 10428? 2 What is the tens digit of 668? 6 What is the hundreds digit of 62869? 8 What is the thousands digit of 23662? 3 What is the thousands digit of 1619? 1 What is the thousands digit of 1705? 1 What is the hundreds digit of 123? 1 What is the hundreds digit of 1201? 2 What is the thousands digit of 10307? 0 What is the hundreds digit of 959? 9 What is the ten thousands digit of 12003? 1 What is the hundreds digit of 1479? 4 What is the tens digit of 1860? 6 What is the hundreds digit of 1120? 1 What is the units digit of 2545? 5 What is the thousands digit of 3513? 3 What is the tens digit of 743? 4 What is the tens digit of 25388? 8 What is the units digit of 4518? 8 What is the thousands digit of 6191? 6 What is the thousands digit of 22364? 2 What is the thousands digit of 1305? 1 What is the units digit of 440? 0 What is the thousands digit of 3550? 3 What is the ten thousands digit of 41373? 4 What is the hundreds digit of 1188? 1 What is the thousands digit of 5587? 5 What is the tens digit of 13910? 1 What is the hundreds digit of 407? 4 What is the ten thousands digit of 39006? 3 What is the tens digit of 52078? 7 What is the hundreds digit of 5015? 0 What is the thousands digit of 26922? 6 What is the hundreds digit of 51442? 4 What is the tens digit of 386? 8 What is the ten thousands digit of 16236? 1 What is the units digit of 1054? 4 What is the hundreds digit of 2675? 6 What is the tens digit of 2379? 7 What is the hundreds digit of 1940? 9 What is the hundreds digit of 298? 2 What is the tens digit of 2630? 3 What is the thousands digit of 74238? 4 What is the tens digit of 410? 1 What is the hundreds digit of 43396? 3 What is the tens digit of 382? 8 What is the tens digit of 742? 4 What is the units digit of 34422? 2 What is the tens digit of 988? 8 What is the tens digit of 775? 7 What is the units digit of 870? 0 What is the tens digit of 892? 9 What is the units digit of 31458? 8 What is the tens digit of 9012? 1 What is the units digit of 1145? 5 What is the hundreds digit of 2428? 4 What is the thousands digit of 21181? 1 What is the units digit of 18633? 3 What is the tens digit of 40126? 2 What is the tens digit of 8115? 1 What is the tens digit of 968? 6 What is the hundreds digit of 2224? 2 What is the hundreds digit of 277? 2 What is the hundreds digit of 1080? 0 What is the hundreds digit of 956? 9 What is the hundreds digit of 4737? 7 What is the thousands digit of 4510? 4 What is the thousands digit of 7944? 7 What is the hundreds digit of 492? 4 What is the units digit of 1356? 6 What is the thousands digit of 73691? 3 What is the thousands digit of 13301? 3 What is the thousands digit of 21347? 1 What is the tens digit of 23? 2 What is the units digit of 35463? 3 What is the units digit of 450? 0 What is the hundreds digit of 72231? 2 What is the hundreds digit of 1090? 0 What is the tens digit of 263? 6 What is the tens digit of 19166? 6 What is the ten thousands digit of 15900? 1 What is the hundreds digit of 2000? 0 What is the thousands digit of 4040? 4 What is the hundreds digit of 2776? 7 What is the hundreds digit of 15976? 9 What is the units digit of 24836? 6 What is the hundreds digit of 11951? 9 What is the units digit of 55554? 4 What is the tens digit of 132179? 7 What is the units digit of 90737? 7 What is the hundred thousands digit of 114289? 1 What is the hundreds digit of 1454? 4 What is the thousands digit of 3876? 3 What is the thousands digit of 33767? 3 What is the tens digit of 46998? 9 What is the tens digit of 4812? 1 What is the tens digit of 367? 6 What is the thousands digit of 9883? 9 What is the ten thousands digit of 31217? 3 What is the units digit of 6359? 9 What is the units digit of 583? 3 What is the thousands digit of 27353? 7 What is the thousands digit of 18858? 8 What is the hundreds digit of 3308? 3 What is the thousands digit of 26463? 6 What is the units digit of 926? 6 What is the tens digit of 924? 2 What is the units digit of 12? 2 What is the hundreds digit of 48736? 7 What is the tens digit of 182371? 7 What is the tens digit of 4137? 3 What is the thousands digit of 1811? 1 What is the ten thousands digit of 47475? 4 What is the tens digit of 49987? 8 What is the units digit of 772? 2 What is the hundreds digit of 4944? 9 What is the ten thousands digit of 31272? 3 What is the units digit of 9081? 1 What is the tens digit of 847? 4 What is the units digit of 788? 8 What is the tens digit of 10? 1 What is the units digit of 33539? 9 What is the units digit of 1865? 5 What is the units digit of 670? 0 What is the units digit of 1401? 1 What is the units digit of 5228? 8 What is the hundreds digit of 2386? 3 What is the thousands digit of 1567? 1 What is the tens digit of 4858? 5 What is the hundreds digit of 80335? 3 What is the tens digit of 1630? 3 What is the units digit of 35417? 7 What is the hundreds digit of 54044? 0 What is the thousands digit of 6206? 6 What is the units digit of 8355? 5 What is the hundred thousands digit of 193011? 1 What is the ten thousands digit of 11633? 1 What is the ten thousands digit of 31663? 3 What is the tens digit of 916? 1 What is the tens digit of 4852? 5 What is the units digit of 1569? 9 What is the hundreds digit of 879? 8 What is the hundreds digit of 9993? 9 What is the tens digit of 739? 3 What is the hundreds digit of 26973? 9 What is the units digit of 594? 4 What is the tens digit of 5967? 6 What is the ten thousands digit of 26228? 2 What is the tens digit of 139899? 9 What is the hundreds digit of 242? 2 What is the units digit of 169? 9 What is the units digit of 46850? 0 What is the hundreds digit of 952? 9 What is the hundreds digit of 25709? 7 What is the thousands digit of 8912? 8 What is the tens digit of 2560? 6 What is the units digit of 144? 4 What is the hundreds digit of 7084? 0 What is the thousands digit of 1131? 1 What is the hundreds digit of 10570? 5 What is the units digit of 266? 6 What is the units digit of 95598? 8 What is the thousands digit of 10636? 0 What is the units digit of 4257? 7 What is the thousands digit of 122790? 2 What is the units digit of 3535? 5 What is the tens digit of 21? 2 What is the hundreds digit of 5710? 7 What is the tens digit of 839? 3 What is the tens digit of 1270? 7 What is the units digit of 987? 7 What is the tens digit of 124? 2 What is the units digit of 8540? 0 What is the tens digit of 12361? 6 What is the tens digit of 68765? 6 What is the hundreds digit of 1848? 8 What is the thousands digit of 9581? 9 What is the thousands digit of 1902? 1 What is the thousands digit of 4079? 4 What is the units digit of 15387? 7 What is the units digit of 4931? 1 What is the thousands digit of 2668? 2 What is the hundreds digit of 13442? 4 What is the units digit of 6848? 8 What is the tens digit of 1261? 6 What is the units digit	{ "pile_set_name": "DM Mathematics" }
uppose -u - 2u - 21 = 0. Let f(o) = o + 10. Let g be f(u). Find the second derivative of -g + 3 + 3x - x*2 - x wrt x. -2 Let i = 7 - 10. Let g(v) = -v. Let w be g(i). What is the second derivative of -p + 6 + 2p*4 - w - 3 wrt p? 24p2 Let g(c) = c. Let z(u) = u3 + 4u2 - 6u + 3. Let l(x) = g(x) + z(x). Let j be l(-5). Differentiate -j - y*3 - 1 - 5y*3 + 3 wrt y. -18y*2 Let l(c) be the first derivative of -35c*4 - 44c*2 - c - 56. What is the second derivative of l(s) wrt s? -840s Let g(w) = -738w2 + 207w + 225. Let n(v) = -v + 5. Let u(c) = -g(c) + 45n(c). What is the second derivative of u(i) wrt i? 1476 Let f be (7/2 + 1)/(1/2). Differentiate 20h*4 - 4 - fh*4 - 12 + 1 with respect to h. 44h3 Let w(k) = -k3 + k - 3. Let i be w(0). Let z be 4 - (-3)/i - 3. What is the derivative of -4x + 3x + 1 + zx + 2x wrt x? 1 What is the second derivative of 2q2 + 25q*2 - 3q - 7q2 - 2q*5 - 3q wrt q? -40q3 + 40 Let u(a) be the second derivative of 19a*7/7 - 5a*3/6 - 31a*2 + 298a. Find the second derivative of u(t) wrt t. 2280t3 Let z(s) be the third derivative of -2/5s*5 - 3/70s*7 + 0s*4 + 0s + 0 + 0s3 + 0s*6 - 23s*2. What is the third derivative of z(d) wrt d? -216d Let c(p) = -2p2 - 8p + 5. Let s be c(-4). Find the first derivative of -4g - sg - 6 + 5g wrt g. -4 Let l = -47 - -61. What is the second derivative of 0q*3 + 6q + lq + 9q*3 wrt q? 54q Let i(c) = -c + 1. Let f(p) be the first derivative of 5 + 4p - 3p*2 - 4 + 0p*2 + 2p2 - p3. Let n(w) = f(w) - 2i(w). Differentiate n(t) wrt t. -6t Let o(q) = -33q3 - 11q*2 - 20q - 247. Let h(s) = -11s3 - 4s*2 - 7s - 82. Let d(k) = -11h(k) + 4o(k). Differentiate d(r) with respect to r. -33r2 - 3 Let t(f) be the second derivative of 0f*2 + 0 + 0f*4 + 5/3f*3 - 13f + 0f5 + 17/30f*6. What is the second derivative of t(v) wrt v? 204v2 Let a(i) = i4 - i*2 + 1. Let x(l) = -126l*4 - 207l*2 + 3. Let p(t) = 3a(t) - x(t). Find the third derivative of p(d) wrt d. 3096d Let f = -10 - -6. Let q be f(1 - (-9)/(-6)). What is the derivative of 5 - 2 + 5dq - 7 wrt d? 10d Let i(o) be the first derivative of -107o4/2 - 277o + 33. Differentiate i(k) with respect to k. -642k2 Find the second derivative of 27j*3 - 105j*3 - 29j + 136j + 137j wrt j. -468j Let k(r) be the second derivative of -65r*8/56 + 7r*4 + 2r - 27. Find the third derivative of k(d) wrt d. -7800d3 Let l = 54 + -51. What is the first derivative of 4m*3 - 6m*l + 3 - 13 wrt m? -6m*2 Let f(u) be the first derivative of 2 + 0u + 3u3 + 0u*5 - 4/3u*6 + 0u*4 + 0u*2. Find the third derivative of f(y) wrt y. -480y*2 Let m(h) be the second derivative of 1/10h*5 + 4/3h*4 + 0h*2 - 15h + 0h3 + 0. Find the third derivative of m(p) wrt p. 12 Let w(l) = l + 12. Let i be w(-11). Let f(k) = -k. Let r(x) = x4 + 3x + 16. Let v(o) = ir(o) + 3f(o). What is the derivative of v(g) wrt g? 4g3 Suppose 0 = -16l + 13l + 36. What is the third derivative of 37j*5 - 33j*2 - 52j*5 + lj*2 wrt j? -900j*2 Let q(m) be the third derivative of 1/3m*3 + 0m*4 + 0 + 3m*2 - 1/6m*5 + 0m. What is the derivative of q(v) wrt v? -20v Let n(d) be the second derivative of -365d*3/6 - 158d*2 + 46d. Differentiate n(b) wrt b. -365 Find the third derivative of -7o2 - 75o*4 - 14o*2 + 11o*2 wrt o. -1800o Find the second derivative of -298m + 280m*2 + 300m + 82m2 wrt m. 724 Suppose 38w - 2 + 2 = 0. Let h(x) be the third derivative of 0x3 + 1/12x5 + x2 + 0 + 1/30x6 + 0x*4 + wx. Find the third derivative of h(s) wrt s. 24 Let c(j) = -2j2 - j3 + 3j + 4 + 0j3 + j2 - 2j2. Let v be c(-4). What is the third derivative of o2 - 6o5 + vo*5 - 3o*2 wrt o? 120o*2 Suppose -3b + 12 = 0, a - b + 2 = -0a. Differentiate -12 + q - 97q*a + 94q*2 - 5q wrt q. -6q - 4 Let o(h) = -66h*5 + 3h*2 - 6h + 4. Let a(m) = 198m5 - 8m*2 + 20m - 11. Let u(c) = -3a(c) - 8o(c). What is the second derivative of u(d) wrt d? -1320d3 Let m be ((-2)/(-6))/(175/(-90) - -2). What is the derivative of mg*2 - g + 26 + 24 + 20 - 71 wrt g? 12g - 1 Let q(d) be the first derivative of d*6/6 - 21d3 - d2/2 - 5d - 14. Find the second derivative of q(s) wrt s. 20s*3 - 126 Let t(m) = -7m*3 + 2m*2 + 4m - 8. Let h(k) = -15k3 + 5k*2 + 6k - 17. Let a(y) = 2h(y) - 5t(y). Differentiate a(d) with respect to d. 15d2 - 8 Let q(x) = x3 - 20x*2 + 36x + 2. Let c be q(18). Find the third derivative of p*2 + 1292p*6 + 2p*c - 1298p*6 wrt p. -720p*3 Suppose 5y = -3s + 75, 0 = 5s + 16 + 9. Suppose 0 = 8o - 10o + y. Find the second derivative of -p - op + 8p*2 - p wrt p. 16 Let c(y) be the first derivative of 149y*6/6 + 50y3 + y2/2 - 47. Find the third derivative of c(s) wrt s. 8940s2 Let p(s) = -s - 3. Let g be p(-7). Suppose 8 = 3q + gi, -3q + 4i + 6 = -10. Find the second derivative of o - 10o*4 - 5o + 8oq wrt o. -24o*2 Suppose 5c = c - 4w + 12, 0 = 5c - 3w - 23. Suppose -2i = -5i + cb + 43, 4b = -4i + 76. What is the derivative of -3d3 - 1 + id - 17d - 4 wrt d? -9d*2 What is the second derivative of -3x + 12 - x*2 + 51x*3 + 26x*3 - 3 wrt x? 462x - 2 Let n(s) be the third derivative of -s8/24 - s5/60 - s*4/8 + 63s*2. Find the third derivative of n(h) wrt h. -840h*2 Suppose 2h - 8 = -0. What is the derivative of 9b4 + 24b*h + 28 - 6 wrt b? 132b*3 What is the derivative of -36u*4 + 709 + 39u*4 + 42u3 - u2 - 42u3 - u2 wrt u? 12u*3 - 4u Find the third derivative of -252b3 - 3b*4 + 500b*3 + 6b + 7b2 - 225b*3 wrt b. -72b + 138 Let a(j) = 3j - 20. Let z(n) = -4n + 29. Let r(c) = -7a(c) - 5z(c). Differentiate r(x) wrt x. -1 Let b(g) be the third derivative of 0g5 + 0g*3 + 0g + 0 + 1/4g4 + 0g*6 + 11/105g*7 - 8g*2. What is the second derivative of b(u) wrt u? 264u*2 What is the third derivative of -10 - 14m*2 - 61m*3 + 2m*2 + 9 + 3 wrt m? -366 Let u = 15 - 11. Let d be (0 - -14)((-15)/6)/(-5). Find the third derivative of -2o2 - 3o*2 - 2o*2 + 0o*2 - do*u wrt o. -168o Let k(v) be the second derivative of 509v5/20 - 173v*4/4 - 636v. What is the third derivative of k(g) wrt g? 3054 Find the second derivative of -233u2 + 258u - 30 - 30u + 54 - 24 wrt u. -466 Let w(u) = 51u*3 - 7u*2 + 332u. Let h(t) = -26t3 + 3t*2 - 167t. Let s(v) = 7h(v) + 3w(v). Find the second derivative of s(c) wrt c. -174c Let r be -15/(-15)(1 + 8). Let w(p) be the first derivative of 0p*2 + 0p - 5 - 4/3pr - 1/2p*4. Find the third derivative of w(u) wrt u. -12 Suppose 2x - 5x + 51 = 0. Suppose -5o = -x - 3. Find the third derivative of oc6 + 22c*2 - 4c + 4c - 25c*2 wrt c. 480c*3 Let z(j) be the first derivative of -52j7/7 - j6/6 + j*3/3 + 135j*2/2 + 544. Find the third derivative of z(b) wrt b. -6240b*3 - 60b*2 Let i(f) be the second derivative of 3f*8/56 - 109f5/20 + f4/6 - 54f2 + 260f - 1. Find the third derivative of i(a) wrt a. 360a3 - 654 Let z(y) be the third derivative of -299y*6/120 - 68y*5/15 + 202y2. Find the third derivative of z(b) wrt b. -1794 Let m(f) = f4 + f + 1. Let y(q) = -3q4 + 15q*3 + 65q*2 - q + 1. Let x(d) = -m(d) - y(d). Find the third derivative of x(v) wrt v. 48v - 90 Let s(f) be the third derivative of 0 + 0f3 + 0f*4 + 0f*6 + 1/30f*7 + 0f + 8/15f5 + 29f*2. What is the third derivative of s(d) wrt d? 168d Let b(a) = -172a4 - 3a*2 - 2. Let v(s) = -344s*4 - 5s*2 - 4. Let y(j) = 5b(j) - 3v(j). What is the derivative of y(k) wrt k? 688k*3 Let y(w) be the third derivative of 0 - 11/20w*5 + 0w + 0w3 + 21w*2 - 5/8w*4. What is the second derivative of y(z) wrt z? -66 Suppose -y + 15 = 2y. Suppose -m - ya = -21, 4m - 3a + 6 = -2. Find the first derivative of -5x*2 + m + 1 - 4 - 1 wrt x. -10x Let b = -19 - -23. Differentiate -31 + 28m4 + 4m*4 - 11m*b with respect to m. 84m*3 Find the second derivative of 21n*3 - 4n*3 - 26n*3 - 264n - 23n3 wrt n. -192n What is the second	{ "pile_set_name": "DM Mathematics" }
d) = 25d3 + 5d*2 - 5d. Give vs(q) + 16p(q). 30q3 Let y(x) = -21x*2 + 13x - 13. Let z(m) be the second derivative of -1/2m3 + 3/2m*2 + 4m + 0 + 5/12m4. Let l be 6/33 + 284/11. Give lz(v) + 6y(v). 4v*2 Let x(j) = -6j*3 - 11j*2 + j - 2. Let b(g) = -3g*3 + 2g*2 - g - 2. What is -b(h) + x(h)? -3h*3 - 13h*2 + 2h Let c(l) = 4808l2 - 3l. Let s(a) = 7726460a2 - 4820a. Calculate 4820c(f) - 3s(f). -4820f2 Let c(a) = -636a*2 - 7a - 1. Let s(j) = -319j2 - 3j. Determine 2c(q) - 5s(q). 323q2 + q - 2 Let k(v) = 7v*3 + 1456v*2 + 4v + 35. Let t(f) = 2f3 - f2 + f + 8. What is k(z) - 4t(z)? -z*3 + 1460z*2 + 3 Let n(m) = m + 14. Suppose -14x = 7x + 210. Let u be n(x). Let s(b) = 4b*3 - 3b. Let j(k) = 4k3 - 4k. Calculate us(g) - 3j(g). 4g3 Let u(t) = -1. Suppose 3n - 2390 = -7n. Let r = -238 + n. Let x(p) = -p + 2. Calculate ru(i) + x(i). -i + 1 Let a(t) = 29t3 + 11t*2 - 57t + 30. Let q(x) = 7x3 + 3x*2 - 15x + 8. Determine 4a(w) - 15q(w). 11w3 - w2 - 3w Let s(j) = 7j2 + 348j + 242. Let y be s(-49). Let g(t) = -4t3 - 11t*2 + 3t - 3. Let w(l) = -7l3 - 21l*2 + 5l - 5. Calculate yw(d) + 5g(d). d*3 + 8d*2 Let a(g) = 3g - 1. Let k(p) = 13p + 812. Determine -4a(n) + k(n). n + 816 Let x(w) = -6w3 - 32w*2 - 54w - 130. Let a(f) = -f*3 - 6f*2 - 11f - 25. What is 16a(s) - 3x(s)? 2s3 - 14s - 10 Let v(t) = -19t3 - 5t + 2. Let f(h) = -h*3 - 28556h + 57118h - 28563h. Give 3f(o) - v(o). 16o*3 + 2o - 2 Let a(c) be the first derivative of 18 - 1/4c4 + 0c*2 + 0c*3 - c. Let x be 0 + -6(-1)/3. Let y(b) = -4b3 - 2. Determine xy(h) - 7a(h). -h3 + 3 Let w be (-4760)/1050(-30)/4. Let x(a) be the first derivative of 3a2 - 11a - 3. Let p(c) = c - 2. Determine wp(i) - 6x(i). -2i - 2 Let x be (-21 - -33)2/(-6). Let v(p) = -p*2 - 4p + 24. Let o(i) = -i*2 - 5i + 25. Calculate xo(y) + 5v(y). -y*2 + 20 Let l(x) = -21854x*2 - 1. Let c(g) = 32810g*2 + 1. Determine -5c(t) - 7l(t). -11072t2 + 2 Let k(w) be the third derivative of w6/8 + w5/30 - w3/3 + 1165w2. Let a(m) = m3 + m2 - 1. Calculate -4a(i) + 2k(i). 26i*3 Let x(j) be the second derivative of -3j*3/2 - 2113j. Let p(a) = -4a. What is -11p(q) + 6x(q)? -10q Let p(s) = 15s2 + 211s + 3. Let f(n) = -5n2 - 69n - 1. Give 8f(m) + 3p(m). 5m2 + 81m + 1 Let y(m) = m*3 + 6m*2 + 3m + 6. Let f(g) = g*2 + g. Let r be 110/18 + (-4790)/4311. What is rf(z) - y(z)? -z3 - z2 + 2z - 6 Let f(l) = -10l*2 + 3 - 3. Suppose 42b - 675 = 795. Let p be (-6)/((-18)/15(-20)/16). Let a(y) = -y2. Calculate ba(c) + pf(c). 5c*2 Let i(a) = -2a - 2. Let p(j) = j*2 + 4j + 4. Suppose -4s - 4v + 84 = 0, -5s + 4v - 22 = -118. Let z = s - 26. Let g = z - -11. Give gi(t) + 2p(t). 2t2 - 2t - 2 Let y(x) = 254x - 25. Let d(z) = 85z - 7. Determine 7d(r) - 2y(r). 87r + 1 Let u(i) be the second derivative of 3i*5/20 - 5i*4/12 - 2i*3 - 3i*2/2 - 110i - 4. Let o(h) = 4h3 - 7h*2 - 18h - 4. Calculate -5o(k) + 7u(k). k*3 + 6k - 1 Let q(p) = 568p2 - 9p + 11. Let m(c) = -142c2 + 2c - 3. Calculate 9m(j) + 2q(j). -142j2 - 5 Let u(s) be the second derivative of 7/2s*2 + 5/6s*3 + 202s + 0. Let g(k) = 9k + 13. Determine -3g(o) + 5u(o). -2o - 4 Let y(s) be the third derivative of s4/3 + s3/2 - 5469s2. Let g(a) = -a + 1. What is 4g(v) - y(v)? -12v + 1 Let x(f) = 10f*2 + 7f - 13. Let y be ((-4)/6)/((22/(-279))/11). Let q = y - 100. Let v(s) = -3s2 - 2s + 4. Give qv(m) - 2x(m). m*2 - 2 Let l(d) be the third derivative of 0d*4 + 0 - 1/15d*5 + 0d + 114d2 - 1/6d*3. Let b(f) = 5f*2 + 1. Suppose -12 = 4v + 4. Give vl(h) - 3b(h). h*2 + 1 Let g(t) = -240t*3 + 2t*2 + 2t - 2. Let j(a) = 10801a3 - 91a*2 - 91a + 91. What is 273g(d) + 6j(d)? -714d3 Let u(z) = -32z - 6. Let d(q) = -10q + 1. Determine -2d(f) + u(f). -12f - 8 Let v(q) = -100q*3 - 67q*2 - 11q + 8. Let i(r) = -33r3 - 23r*2 - 4r + 3. Determine 11i(n) - 4v(n). 37n3 + 15n*2 + 1 Let o(k) = 8k*2 + 90k - 244. Let v(d) = 4d2 + 45d - 132. What is -6o(m) + 11v(m)? -4m2 - 45m + 12 Let k(c) = -10c + 6. Suppose -5o = 0, 6 = g + 2g - 2o. Let v be 7/3198/231. Let p(b) = -8b + gb + v + 4b - 1. What is 3k(i) - 16p(i)? 2i + 2 Let t(i) = 18i + 22. Let h(r) = 6r - 1. Calculate -4h(u) + t(u). -6u + 26 Let g(d) = 2d3 + d2 + 1. Let a(v) = -6v3 - 94v*2 + 2v - 4. Determine -a(s) - 2g(s). 2s*3 + 92s*2 - 2s + 2 Let k(w) = w3 - w2 - w + 1. Let z = 9498 - 9500. Let f(t) = -13t3 + 11t*2 + 11t - 9. Determine zf(d) - 22k(d). 4d3 - 4 Let n(a) = 14a*3 - 32a*2 + 4a - 12. Let r(g) = -12g3 + 31g*2 - 3g + 10. Calculate 5n(b) + 6r(b). -2b3 + 26b*2 + 2b Let k(t) = -5t. Let h = -320 - -383. Let g = 65 - h. Let j(o) = o - 1. Determine gj(f) - k(f). 7f - 2 Let h(b) = 2b*3 - 3b - 2. Let z(o) = 2o3 - 4o - 3. Let j = -134 + 99. Let g(c) = 4c + 12. Let v be g(5). Let i = v + j. Give ih(l) + 2z(l). -2l*3 + l Let q(f) = 179f*3 + 61f*2 + 3f. Let h(o) = 8o3 + 2o*2 + o. Let m(b) = -3h(b) + q(b). Let a(z) = -11z3 - 4z*2. Determine -55a(n) - 4m(n). -15n*3 Let a(i) = -7i*3 + 2i*2 - 2i + 2. Let d(v) = 890v + 3562. Let l be d(-4). Let s(y) = 36y*3 - 11y*2 + 11y - 10. Calculate ls(r) + 11a(r). -5r3 + 2 Let n(p) = -5p*2 + 3. Let y(g) = 2g - 31. Let v be y(17). Let h(r) = -1 - r*2 + 11 - 6 - v. What is 6h(a) - 2n(a)? 4a*2 Let g(w) = 30w. Let u(n) be the first derivative of -59n2/2 + 705. What is -11g(h) - 6u(h)? 24h Suppose 4t + 4989 - 4965 = 0. Let s(l) = -14l. Let j be (39/4)/((-3)/(-4)). Let v(h) = -7h. Calculate jv(o) + ts(o). -7o Let l(h) = -22h2 + 4h - 15. Let c(t) = 23t2 - 3t + 11. Determine -3c(f) - 2l(f). -25f2 + f - 3 Let g(r) = 1248r*2 + 7r - 17. Let j(c) = 835c2 + 5c - 12. Determine -5g(v) + 7j(v). -395v2 + 1 Let t(k) = -84 + k - 62 + 204 - 77. Let g(j) = -3j + 56. Determine 3g(i) + 8t(i). -i + 16 Let z(q) = -4q - 6. Suppose 21j - 14j = -16j - 92. Let n(a) = -4a - 7. Give jn(k) + 5z(k). -4k - 2 Let d(k) = -k + 9. Let j(w) = -w + 1. Let l(q) = -d(q) + 6j(q). Let c(n) = -14n - 8. Suppose 25x = 30x + 1260. Let f = 249 + x. Calculate fc(a) + 8l(a). 2a Let n(u) = u2 + 34u - 3. Let b(s) = -2s3 - 10s*2 + 74s + 21. Let i be b(-9). Let a(r) = -2r2 - 33r + 4. Determine ia(m) + 4n(m). -2m2 + 37m Let z(n) = -37128n + 214. Let d(y) = 4125y - 23. Give -28d(v) - 3z(v). -4116v + 2 Suppose 7k - 4k - 3 = 0. Let v(y) = 7. Let z(n) = -8. Let p(i) = -7v(i) - 6z(i). Suppose q + 29 = 25. Let t(b) = b - 3. Determine kt(u) + qp(u). u + 1 Suppose 66h + 215 = -49. Let x(u) = 4u2 + 3u - 4. Let m(p) = p*2 + p - 1. Give hx(k) + 14m(k). -2k*2 + 2k + 2 Let b(y) = -3y - 2. Let i(p) = -p. Let r(q) = -b(q) + 4i(q). Let u(f) = -f + 1. Let t(n) = r(n) - 2u(n). Let o(m) = 4m - 4. Calculate o(a) - 3t(a). a - 4 Let h(n) be the third derivative of -n4/24 + n3/6 + 2n*2 - 81. Let v(g) = 2g + 6. Give -5h(q) + v(q). 7q + 1 Let m(r) = 3r3 + 4r*2 - 277r - 557. Let i be m(-2). Let h(q) = -81q2 + 7q. Let l(b) = -41b2 + 4b. What is il(n) + 6h(n)? -35n2 - 2n Let f(t) = 10t - 1. Let o(r) = -9r. Let h(i) = -115i - 227. Let y be h(-2). What is yo(q) + 2f(q)? -7q - 2 Let b(f) = f + 2. Let v(w) = 4w - 56. What is 2b(t) + v(t)? 6t - 52 Let s be (-120)/(-10)-12/(-6). Let d = -1189 - -1196. Let l(w) = w - 3. Let k(g) = -g + 2. Give dk(i) + sl(i). -3i + 2 Let n(a) = 6138a + 14. Let o(y) = -2047y - 4. What is -2n(m) - 7o(m)? 2053m Let u(f) = -26786f*2 + 8927f*2 + 8925f2 + 2 + 3 + f3 + 4f + 8932f2. Let y(d) = -d3 + d*2 - 3d - 4. What is -2u(m) - 3y(m)? m3 + m2 + m + 2 Let y(p) = 5p - 95. Let z(f) = -f + 8. Determine 3y(g) + 24z(g). -9g - 93 Let a(d) = 102d - 301. Let u(n) = -19n + 60. What is 2a(f) + 11u(f)? -5f + 58 Suppose -54o - 42o - 201 = -29o. Let a(t) = -341t - 55. Let d(r) = 19r + 3. What is oa(g) - 55d(g)? -22g Let w(i) = -2i*3 - 7i**2 +	{ "pile_set_name": "DM Mathematics" }
60 + -54. Let h(m) = m*2 - 3m - 2. Let n be h(8). Let j(a) = a*3 + 67a*2 + 1 - na*2 + 4a - 36a2. Give j(l). -11 Let v(f) = f + 1. Let n = 54 - 46. Let r = n + -4. Suppose -r = -74x + 78x. Determine v(x). 0 Let y = -1246 - -1253. Let j(t) = t - 14. Let i(d) = d + 1 + d + 40 - 5d. Let u(v) = 4i(v) + 11j(v). Give u(y). 3 Let u(y) = 2y3 + 2y*2 + 1. Suppose -16b + 93 = 3b + 55. Give u(b). 25 Let t(m) be the first derivative of 5m*2/2 - 24m + 3333. Calculate t(16). 56 Let o(j) = j*2 + 33j + 36. Let z = -30668 + 30667. What is o(z)? 4 Suppose 0 = 8j + 698 - 1898. Let i = j - 159. Let a(g) = g. Give a(i). -9 Let v(i) = -9i*2 - 9i + 4. Let b(x) = 27x2 + 30x - 9. Let j(l) = -3b(l) - 10v(l). What is j(-4)? 131 Let d(v) = -71v2 + v - 1. Suppose 603n - 584n - 19 = 0. What is d(n)? -71 Let y(z) = -103z + 508. Let i(s) = -s + 132. Let v(q) = 6i(q) - y(q). Calculate v(-3). -7 Let s = -257/19 - -1561/114. Let b(g) be the second derivative of -sg*3 + g + 15/2g*2 + 0. Give b(0). 15 Let x be 14(-237)/(-316). Let q(r) = -1 + 3 - 2r + 3r - 2r*2. Give q(x). -13 Let l(b) be the third derivative of 5/6b*3 - 1/120b*6 - 1/12b*4 + 1/12b*5 + 0 - 80b*2 + 0b. Determine l(5). -5 Suppose 3h - 29 = 5i, 6h - 5h = -2i - 5. Let u(p) = p + 0p + hp - 3p + 346 - 342. Suppose 0 = -5j - 25, 20 = 5d - 2j - 20. Give u(d). 10 Suppose -108 - 156 = 120u + 96. Let t(z) = 3z + 7. Let q(i) = -6i - 14. Let a(s) = 3q(s) + 7t(s). Calculate a(u). -2 Suppose -17m - 49 - 431 = -47m. Let j(d) = d*2 - 16d - 2. Determine j(m). -2 Let i(x) = -6x + 735 - 363 - 366 + 6x*2 - 5x2. Let w be (-1)/3 + (-44)/(-6). What is i(w)? 13 Let q(f) be the second derivative of -f5/20 - 11f4/4 - 17f*3/3 - 75f*2/2 - 2399f. Determine q(-32). -11 Let s(v) = v - 10. Let b be (42/(-56))/(4/(-48)). What is s(b)? -1 Let d(t) be the first derivative of t*4/4 - 10t*3/3 + 8t*2 - 7t - 6207. What is d(8)? -7 Suppose 480 = 26o + 134o. Let k(p) be the second derivative of p - 1/2p2 + 0 + 1/12p*4 - 4/3po. What is k(7)? -8 Let o(h) be the second derivative of -h5/20 + h*4 - 16h3/3 + h2/2 - 94h - 7. What is o(4)? 1 Let a = -17065 - -17036. Let t(y) = -y2 - 30y + 63. Determine t(a). 92 Let r(k) = -71k + 5803. Let o be r(81). Let w(t) = 3t*2 - 158t + 109. Calculate w(o). 5 Let c(l) be the second derivative of l*5/10 - 5l*4/12 - 11l*3/6 + 5l*2/2 + 3l + 10. Determine c(4). 9 Let z be (-45)/(-30) - 3/(-2). Let w(i) = i*2 + 5 + 17i + i*z - 17i. Let c = -1 + 1. Calculate w(c). 5 Let f(m) = 10m2 + 19m - 59. Let w(j) = 17j2 + 38j - 119. Let b(t) = 5f(t) - 3w(t). Calculate b(-22). -4 Let w(t) = -t - 9. Let o(c) = -c*2 - 17c + 38. Let i be o(-19). Calculate w(i). -9 Let j(u) = 1269u + 5082. Let k be j(-4). Let h(l) = -l2 + 10. Determine h(k). -26 Let r(h) = 3h*3 + 2h*2 - h + 2. Suppose -u - 5 = 0, 21u + 19 = 2t + 18u. What is r(t)? 32 Let f(a) be the third derivative of 1/60a5 + 11/24a*4 - 118 + 0a + 5/6a3 - a2. Determine f(-10). -5 Let u be -4 + 1 + -6(-3)/9. Let i(n) be the second derivative of 17n4/12 - n3/6 - n2/2 - 61n - 11. Calculate i(u). 17 Let b(o) = -8o2 - 8113 + 16218 + 8o - 8096 + o3. What is b(7)? 16 Let q(b) = b3 - b2 + b + 1. Let x(m) = -m3 + 14m2 + 8m - 4. Let k(p) = 2q(p) + x(p). Give k(-11). 9 Let q(y) = 5y - 5. Let k = 14 + -5. Let s(i) = -i + 1. Let z(x) = ks(x) + 2q(x). Suppose 0 = 5g + 2u, -3u + 4u - 1 = -3g. What is z(g)? 1 Let o be 4 - (5 + -11 - -7). Let n(g) = 1172g*2 + 1 - 6g - 1174g2 - go - 7. Give n(-2). 6 Let r(d) = -d2 - 69d - 65 - 53d - 57d + 195d. Give r(5). -10 Let z = 4444 + -4438. Let l(w) = -w3 + 8w*2 - 12w - 11. Give l(z). -11 Let n(y) = -y*2 - 2y + 3. Let t(u) = -u*2 + 6u - 4. Let o(w) = -6w2 + 31w - 22. Let j(m) = -2o(m) + 11t(m). Let a be j(-4). Determine n(a). 3 Let x(i) = 11i2 - 8i + 18. Let k(v) = -4 + 0v2 + 4v - 5v2 - 5. Let u(r) = 13k(r) + 6x(r). Suppose -3n = -5n + 5q + 6, -n - 11 = q. What is u(n)? 12 Suppose -32g + 138 = 48g - 182. Let v(w) = -11w + 52. Give v(g). 8 Let z be (-2)/(-6) - 28/(-6). Let j(h) be the third derivative of -h5/30 + 5h*4/24 - 42974h*2. What is j(z)? -25 Let x(o) = -2o + 30. Suppose -169 = -4m + 12y - 101, -m + 9 = -5y. Determine x(m). -28 Let z be ((-63)/35 + 3)/((-6)/20). Let x(k) = 3k3 - k2 + 2k + 5. Let o(u) = -u3 - u2 + 1. Let w(v) = zo(v) - x(v). Give w(-5). 1 Let v = -2123 + 2114. Let a(h) = -9h - 77. Calculate a(v). 4 Let y(a) = a2 + 7a - 3. Let t be y(-8). Suppose -2s + 2g - 4 = 0, -s + 3s - tg + 13 = 0. Let q(m) = -4m2 + 6m - s - 4 + 5m2. Determine q(-4). -13 Let r(q) be the third derivative of -q4/8 - 17q3/6 + q2. Let b(l) = 2l2 - 39l + 173. Let w be b(12). Calculate r(w). 4 Suppose -y + 4 = 0, 6j - j = -2y + 33. Let i(c) = -2c + 1. Let t(h) = h + 1. Let q(d) = -i(d) + t(d). Determine q(j). 15 Let a(h) = -13h*2 + 1. Suppose 5m - 283 = 2m - 5u, 5m - 479 = -u. Let y = m + -95. What is a(y)? -12 Suppose -3a - 9 = 3j, 51 = j + 12a - 17a. Let m(g) = -g3 + 5g2 + g - 11. Give m(j). -41 Let u(s) = s2 + 12s + 26. Let k be u(-9). Let h be 19/7 + (-6)/21k. Let d(j) = 20jh - 40j3 + j2 + j + 16j3. Calculate d(-1). 4 Suppose 4 - 7 = 2x - 5y, -6 = 2y. Let k(q) = q*2 + 2q - 55. Determine k(x). 8 Let g(s) be the third derivative of -s*5/60 + 2s*4/3 - 55s*3/6 + 2s2 - s + 1490. Calculate g(6). 5 Let i(m) be the second derivative of m2 + 22m + 1 - 1/2m*3. Let q be 2/(-6) + 8/(-3). Determine i(q). 11 Let k = -10 - -4. Let f(r) = -300r*3 - 2r*2 + r. Let u(b) = -1501b*3 - 15b*2 + 11b + 2. Let n(y) = 5f(y) - u(y). What is n(k)? -2 Suppose 49o - 64 = 41o. Suppose f - o = -5j, 0 = -2f - 44j + 40j + 10. Let b(a) be the first derivative of -a4/4 + 5a*2/2 - 2a + 2. Give b(f). -14 Let r(l) = 21l2 + l. Suppose -a = -j + 6, 2j + 3 = 6j + 3a. Suppose -3h - h = -v, -5h + j = -2v. Calculate r(h). 20 Let w(q) = 2q - 28. Let m(d) = 8d + 83. Let b be m(-21). Let o = -72 - b. What is w(o)? -2 Let l(b) = b + 1. Let w(o) = -25o*2 + o - o + 27o*2. Let h be w(0). Suppose -4q + 3f + 26 = h, f + 36 = 5q - f. Calculate l(q). 9 Let p = -717 + 720. Let w(m) = 806m - 404m - 5 + m*2 - 405m. Determine w(p). -5 Suppose 5f = 0, 2f = 2v + f - 42. Let w = v + -19. Let s(r) = -r3 - 2 - 8r*w + 5r*2 - 4r + 8r2. Determine s(4). -2 Let b(k) be the second derivative of k4/6 - 5k*3/6 - 2k*2 - 3k - 1469. Suppose -j = 3r - 11, 4j - 3 + 7 = 0. Give b(r). 8 Let w(u) = 5u3 - 13u*2 - 13u + 5. Let n(f) = 14f3 - 37f*2 - 37f + 14. Let t(c) = -6n(c) + 17w(c). Calculate t(-2). -5 Let x(i) = i - 4. Let q be x(4). Let j be -12 + -1(-3 + q). Let u(c) be the first derivative of c2/2 + 7c + 117. Give u(j). -2 Suppose 47s - 6s - 164 = 0. Let l(h) = 21h - 79. Give l(s). 5 Let r(o) be the first derivative of -4o*2 - 54o + 3355. Give r(-7). 2 Let g(l) = -3l - 21. Let f = 55 - 62. Let x be g(f). Suppose 5w - 27 = -5v + 3w, x = 3w + 12. Let r(t) = t3 - 7t*2 + 4. Calculate r(v). 4 Let p(v) = 8v*2 + 23v. Let h(i) = -i3 + i2 - i - 1. Let r(u) = -h(u) - p(u). What is r(11)? 1 Let t(f) be the second derivative of -4f2 + 6f - 1/6f3 + 0. Let g be (-14)/10 - -1 - 14/(-35). What is t(g)? -8 Let x be (-5)/(-3) - 5/(-15). Let c = -713 - -718. Suppose -3t + cg = 15 - 2, 0 = -2t + xg - 10. Let n(z) = z3 + 8z*2 + 9z + 4. Calculate n(t). 22 Let n(b) be the first derivative of -4b3/3 - 9b*2/2 + 12b + 2733. Calculate n(-4). -16 Let b(f) = -f*2 + 42f + 3044. Let n be b(80). Let o(k) = -3k2 + 29k - 70. Determine o(n). -2 Let h(i) = 101i2 + 2i - 45. Let m(c) = 177c2 + 5c - 89. Let k(s) = -7h(s) + 4m(s). Calculate k(5). 14 Let m(u) = -269u3 + 270u*3 - 23 + 9 + 10 + 10u*2 + 2u. Determine m(-5). 111 Let g(r) = r*2 + 9r + 7. Suppose 2q - 434 = -12q. Let v(f) = -2f - 7. Let u be v(-6). Suppose 9 = -un - q. Determine g(n). -1 Suppose 0 = r + 662c - 658c + 20, -5c = -3r - 9. Let q(d) = d*2 - d + 1. Let z(b) = -4b*2 - 5b + 8. Let v(n) = -3*q(n) - z(n). Dete	{ "pile_set_name": "DM Mathematics" }
= 126 - 122. Give ob(k) + 5h(k). -8k2 Let o(x) = 7x*3 + 16x*2 + 5x + 2. Let q(h) = -15h3 - 33h*2 - 11h - 4. Calculate 13o(b) + 6q(b). b*3 + 10b*2 - b + 2 Let t(a) = -3a + 605. Let c(m) = -m + 202. Give 11c(g) - 4t(g). g - 198 Let b(k) = -157k + 6. Let q(a) = 316a - 15. Calculate 10b(d) + 4q(d). -306d Let t(g) = 21 - 5 - 8 - 7. Let w(d) = 3d. Determine 5t(l) + w(l). 3l + 5 Let j be (-8)/40 - ((-93)/15 - 0). Let l(f) = 42f. Let c(r) = 7r. Give jl(m) - 35c(m). 7m Let y(z) = -21z*2 + 27z + 27. Let q(p) = 10p2 - 13p - 13. Let i(f) = 13q(f) + 6y(f). Let m(b) = b*2 - 2b + 10 + 8 - 20. Calculate -2i(d) + 7m(d). -d*2 Let k(j) = -71j*2 + 4. Let s(r) = 143r*2 - 9. What is 5k(i) + 2s(i)? -69i*2 + 2 Let l(j) = 4j*2 - 4j - 7. Let t(u) = -19u2 + 22u + 36. What is 11l(h) + 2t(h)? 6h2 - 5 Let y(i) = -1. Let h be ((-1)/7)/(22/(-154)). Let n(l) be the second derivative of -l4/3 - l2/2 - 2l. Calculate hn(g) - y(g). -4g*2 Suppose 0 = 5c - 14 - 21. Let u(z) = c + z + 7 - 12. Let o(l) = 5l + 9. Calculate 4o(j) - 18u(j). 2j Let l(j) = -2j3 + j + 1. Let k(i) = -2i3 + i2 - 17i + 1. What is -k(f) + 3l(f)? -4f3 - f2 + 20f + 2 Let u(t) = 9t - 13. Let r(w) = -w3 - 14w*2 - 11w + 25. Let m be r(-13). Let s be (17 - -5)m/2 - 0. Let p(c) = -5c + 7. Calculate sp(v) - 6u(v). v + 1 Let h(o) = o*3 + 8o*2 + 8o. Let b(n) = 2n3 + 14n*2 + 17n. Calculate 4b(w) - 7h(w). w*3 + 12w Let a(o) = -3o - 4. Let b(x) = -5x - 7. Let r(j) be the first derivative of 7j4/4 - j3/3 - j2 - j + 1. Let d be r(-1). Determine da(f) + 4b(f). f Let t(l) = -2l + 22. Let s be t(10). Let n be (((-8)/2)/1)/(s/3). Let b(x) = -x*2 - 4x. Let i(k) = -k*2 - 5k. Determine nb(r) + 5i(r). r*2 - r Let t(z) = 9z*2 + 5. Let v(y) = -2403y*2 - 15 + 2304y*2 - 39. Determine 54t(n) + 5v(n). -9n2 Let w(u) = u2 + u - 9. Let x(o) = -2o3 - 17o*2 - 8o - 7. Let q be x(-8). Let j(p) = -p*2 - p + 13. Determine qw(a) - 5j(a). -2a*2 - 2a - 2 Let m(l) = -30l2 + 8l - 908. Let x(v) = 19v2 - 5v + 605. Determine 5m(o) + 8x(o). 2o2 + 300 Let o(u) = 4u*3 + 30u*2 + 10u + 6. Let r(l) = 5l3 + 31l*2 + 12l + 6. Determine 6o(b) - 5r(b). -b*3 + 25b*2 + 6 Let g(t) = 5t*3 - 24t*2 - 6t - 6. Let y(u) = 11u3 - 49u*2 - 13u - 13. What is -13g(n) + 6y(n)? n*3 + 18n*2 Let z(h) = -9h + 6. Suppose 93 + 61 = -11n. Let k(b) = 4b - 3. What is nk(x) - 6z(x)? -2x + 6 Let u be 0 - 1 - 1 - -4. Let s(r) be the first derivative of 3r*2/2 - 2r + 8257. Let l(j) = 2j2 + 2j - j*2 + 0j - 2. Calculate us(o) - 3l(o). -3o2 + 2 Let i(u) = u2 - 1. Let k(z) = z2 + 9z + 4. Let c be k(-6). Let t(w) be the third derivative of -w*5/12 + 7w*3/6 + 5w*2. What is ci(v) - 2t(v)? -4v*2 Let l(s) = -7s - 1. Let u(c) = 1. Give -l(h) - 3u(h). 7h - 2 Let b(l) = 1. Let k = -510 + 512. Let v(n) = -n + 5. Determine kv(z) - 11b(z). -2z - 1 Let f(n) = 7n + n - 8n - n. Let x(r) = -3r - 3. Give 5f(z) - x(z). -2z + 3 Let t(a) = 2a2 + 3a - 2. Let n(u) = 7u2 + 12u - 9. Let v be (-4)/3 - (-23)/(483/(-14)). Determine vn(k) + 9t(k). 4k2 + 3k Let z(f) = -12f3 + 15f*2. Let q be 36/10 + (-3)/5. Suppose 18 - q = -j. Let v(r) = 3r*3 - 4r*2. Calculate jv(s) - 4z(s). 3s*3 Let i(x) = -2x + 0x - 4456 - x + 4455. Let o(g) be the first derivative of g2/2 - 1. Let s(q) = 2q. Let l(a) = 7o(a) - 3s(a). Calculate -2i(r) - 5l(r). r + 2 Let v(w) = 11w2 + w + 2. Let g(h) = -13h*2 - h - 3. Determine -4g(b) - 5v(b). -3b*2 - b + 2 Let p(b) = -483b - 9. Let s(l) = l - 5. Determine p(r) - 2s(r). -485r + 1 Let r(g) be the first derivative of -5g2/2 - g + 13. Let w(a) be the first derivative of -a2/2 + 5. What is -2r(z) + 9w(z)? z + 2 Let l(x) = -x3 - 2x - 4. Let a(r) = r*3 - 4r*2 - 5r - 16. Let y(c) = -3c3 + 9c*2 + 9c + 32. Let v(m) = 9a(m) + 4y(m). What is -9l(b) + 2v(b)? 3b3 + 4 Let s(t) = -5t*3 - 12t*2 + 2t + 2. Let p(z) = 24z3 + 60z*2 - 11z - 11. What is 2p(o) + 11s(o)? -7o3 - 12o*2 Let o(i) = -964i*3 - 9i*2. Let l(f) = -2486157f*3 - 23208f*2. Give 3l(q) - 7736o(q). -967q*3 Let f(d) = 6d*3 + 4d + 0d - 4 + 5 + 4d*2 + 2d*2 + 0. Let q(w) = 17w*3 - 2w*2 + 0 + 3 + 11w + 19w2. What is -11f(u) + 4q(u)? 2u*3 + 2u*2 + 1 Let k(p) = -p. Let d(z) = -24z + 78. Let y be d(3). Suppose -3b = -b - s + 74, b + 5s + 59 = 0. Let l(t) = -6t. What is bk(f) + yl(f)? 3f Let h(s) = 2s - 3. Let l(q) = -3q - 9. Let m(a) = 15h(a) - 5l(a). Let i(x) = -11x. Determine 9i(v) + 2m(v). -9v Let n(p) = 4p - 4. Let d(l) = -4l - 3246 + 3258 - 8l. Give -3d(c) - 8n(c). 4c - 4 Suppose 2s + 6 - 32 = 0. Suppose -7z + s = -29. Let t(f) = -4f + 3. Let b(m) = -7m + 11 - m - 7m + 0m. What is zb(n) - 22t(n)? -2n Let g(z) = z + 1. Let c(w) = -w2 + 8w + 7. Suppose 7f - 10 = 11. Let b be (f - 1)52/8. Suppose b + 5 = -3r. Calculate rg(j) + c(j). -j*2 + 2j + 1 Let x(i) = 37i2 + 10i - 7. Let p(q) = -39q2 - 12q + 9. Give 4p(t) + 5x(t). 29t2 + 2t + 1 Let d(s) = -10s3 + 3s + 7. Let n(t) = 9t3 - 2t - 6. Suppose -252f + 72 = -264f. Give fd(c) - 7n(c). -3c3 - 4c Let x(a) = -35a2 - 11a - 60. Let s(y) = -23y2 - 7y - 41. What is -8s(r) + 5x(r)? 9r2 + r + 28 Suppose -3w + 4 = -5w. Let f(t) = -58 - t + 58. Let v(b) = -2b*2 - 4b. Calculate wf(p) + v(p). -2p*2 - 2p Let v(m) = 3m3 - 3m*2 + 7m + 2. Let n(w) = -w*2 + w + 2. Give -3n(p) + v(p). 3p3 + 4p - 4 Let r(t) = -4t3 - 2t*2 - t. Let b(a) = 6a*3 + 3a*2 + a. Suppose 24 = -3n + 2l, 2n + 24 - 8 = 5l. Calculate nr(u) - 5b(u). 2u3 + u2 + 3u Let a be (-4)/(-14) - (-240)/(-56). Let s(g) = 5g - 57 + 29 - 4g2 + 27. Let p(b) be the first derivative of b3 - 2b*2 + b + 1. Give as(t) - 5p(t). t2 - 1 Let d(o) = 10o*2 - 10o + 23. Let k(y) = -4y2 + 6y - 11. Let z(f) = 3d(f) + 5k(f). Let t(a) = 2a2 + 3. Calculate 16t(w) - 3z(w). 2w*2 + 6 Let d(c) = -9c*3 + 6c*2 + 9c. Let b(h) = 14h3 - 9h*2 - 14h. Suppose 12 = 17y - 124. Calculate yd(o) + 5b(o). -2o*3 + 3o*2 + 2o Let c(d) = 2d + 4. Let l be 4 + -721. Let u = l + 15. Let o(w) = 7 - 5 + uw + 7. Calculate -7c(q) + 3o(q). q - 1 Let y(q) = -12q2 - q + 3. Let h(k) = 12k*2 + k - 2. Give 6h(j) + 7y(j). -12j*2 - j + 9 Let w(t) = -42273t*3 - 462. Let k(g) = 457g*3 + 5. Calculate -462k(r) - 5w(r). 231r3 Let q(v) = v3 + v*2 - v. Let m(u) = 2u*3 + 6u*2 - 3u. Suppose -2 = l + 5h, -4h + 0 = -3l + 13. Give lq(g) - m(g). g*3 - 3g*2 Let n(r) = 45r3 - r2 - r + 1. Let k be n(1). Let g = k + -35. Let c(z) = -4z - 2. Let h(l) = 2l + 1. Give gh(u) + 4c(u). 2u + 1 Let a(u) = 1. Let k(b) = b - 6. Let n = -7 + 9. Let i be (3 - (3 + -1))/(n/(-22)). Calculate ia(f) - 2k(f). -2f + 1 Let i = 2 - 6. Let b(v) be the third derivative of -v6/120 - v5/30 + v*4/6 - 21v*2. Let m(x) = 2x*3 + 4x*2 - 7x. Determine im(g) - 7b(g). -g*3 - 2g*2 Suppose 4b = -5c + 1 - 5, -4b - 2c = -8. Suppose 2 = bh + 10. Let a(u) = 4u2 + u. Let l(w) = -w2 + 1. Calculate hl(j) - a(j). -2j2 - j - 2 Let o(g) = -2g. Let u(l) be the second derivative of 0l2 - 1/6l*3 + 0 + 6l. Suppose -3f = -x - 0 + 7, 4x + 17 = -3f. Give fo(n) + 5u(n). n Let p(o) = -8o - 2. Suppose 0 = -3r - 1 - 5. Let w(a) = -15a - 5. What is rw(i) + 5p(i)? -10i Let j(c) = -10c*2 - 2c - 6. Let t(u) = 19u2 + 4u + 11. Determine -5j(p) - 3t(p). -7p2 - 2p - 3 Let w(c) = -c + 1. Let m(a) = -a + 1. Let l be (3 - (1 - 0)) + -1. Suppose 9d + 7 = 52. Let v = d + l. What is vm(z) - 7w(z)? z - 1 Let c(h) = -3h + 30. Let b be c(9). Let l(y) = by - 7 + 13 - 9y. Let t(j) = -j + 1. Suppose 4 = -3k - 8. What is kl(g) + 22t(g)? 2g - 2 Let r(p) = -39p + 39. Let f(q) = 39q - 44. Give 3f(n) + 4r(n). -39n + 24 Let n(y) = 1. Let d(p) = p - 100 + 55 + 60. Give -d(k) + 6n(k). -k - 9 Let q(d) = -1. Let t(p) be the first derivative of -3 + 0p2 + 2/3p*3 + 2p. Determine -4q(j) - 2t(j). -4j2 Let y(i) = -18 - 22 - 17 + 3i*3 - 5i*2 + 52 - 5i. L	{ "pile_set_name": "DM Mathematics" }
- 7n + 1. Calculate h(-8). -7 Let d(t) = t3 - 13t*2 - 18t + 46. What is d(14)? -10 Let q(g) = 20g + 212. Give q(-10). 12 Let k(v) = -v3 + 3v*2 + 55v + 9. What is k(-6)? 3 Let d(v) = -2v2 + 9v - 2. What is d(6)? -20 Let b(k) = -k*2 - 16k + 141. Determine b(6). 9 Let y(l) = -49l - 142. What is y(-3)? 5 Let v(k) = -k2 - 12k - 20. Determine v(-9). 7 Let t(k) = k*2 - 2k - 14. What is t(3)? -11 Let c(q) = -54q - 53. What is c(-1)? 1 Let g(l) = 4l3 + l2 + 2l + 4. What is g(-2)? -28 Let z(c) = -c3 + 9c*2 + 23c - 5. Give z(11). 6 Let z(y) = -5y2 + 19y - 1. What is z(4)? -5 Let o(y) = y*2 + 12y + 13. Calculate o(-12). 13 Let d(i) = 21i2 + i - 4. Determine d(-2). 78 Let z(v) = 5v2 + 2. What is z(-2)? 22 Let v(s) = -s3 - 2s2 + 5s + 12. Calculate v(-3). 6 Let x(h) = h2 + h + 4. Calculate x(-4). 16 Let h(m) = m3 + 3m2 - 13m - 3. Determine h(-5). 12 Let g(k) = -17k3 + k2 - 2k. What is g(1)? -18 Let d(c) = c*2 - 3c - 80. Determine d(11). 8 Let f(l) = 2l2. Calculate f(-3). 18 Let p(y) = -y3 - 43y*2 - 45y - 128. What is p(-42)? -2 Let w(s) = 7s - 16. Determine w(3). 5 Let v(n) = -11n - 80. Calculate v(-7). -3 Let k(l) = -l3 + l2 - 3l + 1. Give k(2). -9 Let i(n) = -n2 + 9n - 3. What is i(8)? 5 Let w(s) = 41s - 370. Determine w(9). -1 Let j(t) = t2 - 5t - 4. What is j(-4)? 32 Let u(b) = -9b2 - 55b - 4. Give u(-6). 2 Let t(d) = -4d - 100. What is t(-24)? -4 Let q(n) = -n3 - 4n*2 + 5n + 6. What is q(-5)? 6 Let v(w) = -w*3 - 4w*2 + 7w + 3. Calculate v(-6). 33 Let c(q) = 74q - 144. Calculate c(2). 4 Let h(o) = -4o - 121. What is h(-31)? 3 Let y(l) = -l*3 - 5l*2 - 4l + 9. Determine y(-3). 3 Let v(m) = -m*3 + 9m*2 - 3m + 36. Calculate v(9). 9 Let z(v) = -v*3 + 11v*2 + 10v + 8. What is z(12)? -16 Let z(q) = -q*3 + 9q*2 + 4q + 30. Calculate z(10). -30 Let u(g) = -g*2 - 15g - 35. Calculate u(-4). 9 Let d(b) = -b*2 + 4b - 3. Calculate d(3). 0 Let a(g) = -g*3 + 6g*2 + 2g - 8. Determine a(6). 4 Let x(q) = -7q - 12. Give x(-6). 30 Let d(k) = -k2 - 8k - 5. Determine d(-6). 7 Let u(x) = -x*2 - 17x + 10. What is u(0)? 10 Let y(j) = -2j2 + 38j - 24. Calculate y(17). 44 Let s(h) = 4h3 - h2 - 6h - 5. Calculate s(-2). -29 Let d(i) = 6i - 115. Give d(15). -25 Let v(k) = k3 + 2k*2 - 4k + 5. What is v(2)? 13 Let k(z) = 105z + 636. Give k(-6). 6 Let v(u) = 4u*2 + 11u + 30. Give v(-3). 33 Let c(y) = -7y - 6. What is c(4)? -34 Let g(j) = 13j*3 - 1. What is g(-1)? -14 Let o(u) = 2u*2 - 45u - 26. What is o(20)? -126 Let k(u) = u*3 + 21u*2 - 46u - 33. Calculate k(-23). -33 Let f(v) = -v*2 + 20v + 101. Determine f(-4). 5 Let w(j) = j*3 + 8j*2 - 8j - 2. What is w(-9)? -11 Let c(a) = a*2 + 7a - 7. Calculate c(-9). 11 Let i(u) = -8u3 + 1. Calculate i(-1). 9 Let x(f) = 13f + 560. Give x(-43). 1 Let n(d) = 2d + 8. What is n(-5)? -2 Let i(c) = -c3 + 7c2 + c - 2. Give i(7). 5 Let l(j) = -j2 - 27j + 128. What is l(4)? 4 Let s(l) = -9l + 43. Calculate s(5). -2 Let c(z) = z + 11. Determine c(0). 11 Let z(y) = y*2 - 3y - 5. Calculate z(6). 13 Let r(j) = 2j2 + 13j - 16. Calculate r(-7). -9 Let k(c) = -34c + 418. What is k(12)? 10 Let b(k) = -k2 + 4k + 8. Determine b(-6). -52 Let c(h) = h*2 + 9h - 30. Calculate c(-14). 40 Let p(g) = 2g2 - 7g + 4. Calculate p(3). 1 Let f(m) = m*2 + 11m + 3. Determine f(-10). -7 Let l(u) = -u*3 + 27u*2 + 32u - 45. Give l(28). 67 Let k(a) = 6a + 15. Give k(-6). -21 Let n(u) = 38u + 198. Give n(-5). 8 Let v(w) = w*2 - 25w + 71. Calculate v(25). 71 Let n(g) = -3g3 + 3g - 2. What is n(-2)? 16 Let t(i) = -i*3 + 11i*2 - 2i + 16. Give t(11). -6 Let k(f) = f*3 + 7f*2 - 10f - 22. Determine k(-8). -6 Let a(c) = c*3 - 27c*2 + 29c - 39. Calculate a(26). 39 Let r(n) = n*3 + 5n*2 - 6n - 30. Determine r(-5). 0 Let d(i) = 4i2 + 2i - 1. Calculate d(-2). 11 Let u(o) = 6o3 - 2o*2 + o. What is u(1)? 5 Let q(i) = 4i3 + i2 - 3i - 3. Calculate q(-2). -25 Let l(q) = -3q - 47. Give l(-29). 40 Let n(w) = -w*2 - 25w + 5. Determine n(-25). 5 Let m(h) = 24h - 30. Determine m(-4). -126 Let s(t) = -t3 + 12t*2 - 7t + 6. Give s(11). 50 Let u(x) = x*2 - 18x - 46. Determine u(19). -27 Let l(s) = s2 - s - 4. What is l(-7)? 52 Let l(o) = o2 - o + 8. Determine l(6). 38 Let d(k) = 3k + 26. Give d(-17). -25 Let g(u) = u - 14. Give g(15). 1 Let n(z) = 20z. What is n(1)? 20 Let q(b) = b*2 - b - 20. Calculate q(5). 0 Let m(f) = 8f + 174. Determine m(-23). -10 Let x(n) = 3n2 + 34n + 85. What is x(-7)? -6 Let n(v) = -v + 13. Give n(0). 13 Let q(d) = 5d2 + 4d + 5. What is q(4)? 101 Let f(a) = -a*3 + 6a*2 - 5. Give f(6). -5 Let y(d) = 13d*2 - 35d - 3. Calculate y(2). -21 Let c(m) = -4m + 7. Determine c(15). -53 Let r(n) = -9n - 21. Determine r(-6). 33 Let m(i) = -i*3 + 9i*2 - 8i - 5. Determine m(8). -5 Let z(f) = 2f - 2. What is z(2)? 2 Let g(l) = l3 - 4l*2 - 1. Give g(2). -9 Let u(i) = 20i + 214. Determine u(-11). -6 Let p(n) = -n - 3. Give p(-6). 3 Let k(i) = -i*2 - 14i - 29. Calculate k(-3). 4 Let j(w) = -w*3 - 12w*2 - 12. Calculate j(-12). -12 Let m(w) = -15w - 98. Calculate m(-7). 7 Let q(h) = -h - 17. What is q(-7)? -10 Let g(z) = 3z2 - 31z + 11. Give g(10). 1 Let t(j) = 86j2 + 5j - 6. What is t(1)? 85 Let v(w) = -w*3 - 5w*2 - 2w - 4. What is v(-4)? -12 Let k(v) = -19v + 18. Determine k(2). -20 Let z(k) = -k3 + 19k*2 + 23k - 54. Determine z(20). 6 Let n(j) = -j*3 - 3j*2 + 4j - 5. What is n(-4)? -5 Let z(s) = 142s - 3. Determine z(-1). -145 Let x(w) = 38w + 3. What is x(2)? 79 Let w(b) = -b*3 + 26b*2 + 57b - 22. Calculate w(28). 6 Let s(y) = 7y - 24. Give s(-9). -87 Let p(d) = -d3 + 9d*2 - 17d + 16. Determine p(7). -5 Let z(g) = -g + 26. Calculate z(8). 18 Let c(x) = x + 5. Calculate c(-15). -10 Let a(b) = 11b2 - 15b - 31. Determine a(-2). 43 Let a(o) = 2o3 - 50o*2 - 52o - 21. Calculate a(26). -21 Let y(m) = m - 25. Determine y(15). -10 Let h(f) = f*2 + 11f + 7. Give h(-4). -21 Let x(r) = -r*3 + 17r*2 + 3r - 2. Determine x(17). 49 Let w(u) = 14u - 6. What is w(-3)? -48 Let p(b) = 27b*2 - 296b - 11. Calculate p(11). 0 Let v(z) = -z*2 + 15z + 6. Calculate v(16). -10 Let y(m) = -7m + 1. What is y(5)? -34 Let o(c) = c2 - 2c + 3. Calculate o(2). 3 Let o(d) = d*2 - 6d + 3. Calculate o(4). -5 Let x(u) = u*3 - 11u*2 + 9u + 4. What is x(10)? -6 Let c(v) = -4v + 12. What is c(5)? -8 Let u(h) = h3 - 5h - 4. Determine u(3). 8 Let o(y) = -26y3. Determine o(1). -26 Let j(b) = 40b - 2. Calculate j(1). 38 Let y(d) = -d + 15. Determine y(18). -3 Let v(p) = p*3 - 3p*2 - 13p + 1. Determine v(-3). -14 Let r(j) = 3j2 + 54j - 14. Calculate r(-18). -14 Let n(d) = 5d + 128. Give n(-26). -2 Let k(b) = 49b - 48. What is k(5)? 197 Let j(d) = d*2 + 31d + 109. Calculate j(-4). 1 Let q(s) = -2s2 - 29s + 12. Calculate q(-15). -3 Let y(v) = 11v - 108. What is y(19)? 101 Let x(r) = -31r*2 + 3r. What is x(1)? -28 Let w(b) = -b*2 + 8b + 8. Determine w(6). 20 Let q(z) = -z*2 + 7z - 6. Calculate q(10). -36 Let o(h) = -h*2 + 9h - 4. Calculate o(6). 14 Let o(u) = u*3 + u - 18. Calculate o(0). -18 Let c(x) = 7x*2 - 3x + 2. What is c(1)? 6 Let g(a) = 4a - 3. What is g(-5)? -23 Let g(o) = o - 36. Calculate g(-6). -42 Let a(l) = -l2 - 18l - 11. What is a(-13)? 54 Let g(y) = y*2 + 2y - 9. What is g(-3)? -6 Let m(s) = s*2 + 5. Calculate m(-4). 21 Let j(t) = -2t*3 + 27t*2 + 14t - 2. Determine j(14). -2 Let p(m) = 14m + 17. Give p(-11). -137 Let g(j) = j2 + 21j + 35. What is g(-15)? -55 Let p(t) = t3 - t2 + t - 1. Determine p(0). -1 Let b(y) = y*2 + 25y + 45. Determine b(-23). -1 Let g(c) = -2c2 - c. Give g(-1). -1 Let q(c) = 25c3 - c2 + 5c - 4. What is q(1)? 25 Let r(f) = -4f - 25. Give r(-8). 7 Let y(o) = 5o - 18. What is y(16)? 62 Let n(x) = -x - 4. What is n(-7)? 3 Let b(i) = i3 - 8i*2 + 2i + 9. Calculate b(8). 25 Let g(p) = 2p3 - 12p*2 - 9p + 52. Determine g(6). -2 Let a(v) = -27v + 6. Calculate a(0). 6 Let u(w) = -w3 + 5w*2 + 7w + 7. Give u(5). 42 Let a(p) = p - 3. Determine a(-3). -6 Let z(o) = -o**3 -	{ "pile_set_name": "DM Mathematics" }
olve -981t + 41211 - 56907 = 0 for t. -16 Solve 3883 = 67j + 466 for j. 51 Solve -292o - 15359 = -3747 + 4740 for o. -56 Solve 2604 = 1655h - 871h - 846h for h. -42 Solve -201s = 243s + 2664 for s. -6 Solve -411 + 14119 = 160s + 131s - 1424 for s. 52 Solve -1531 + 43969 = -9589o + 8946o for o. -66 Solve -2662 = 283k + 597k + 18458 for k. -24 Solve 29163 + 8750 = 318x + 685x - 14243 for x. 52 Solve 148760p = 149263p + 12575 for p. -25 Solve 739k + 244k = -19630 - 5928 for k. -26 Solve 88963 + 93848 = 78z + 189909 for z. -91 Solve 0 = -141s - 7815 + 342 for s. -53 Solve 2550n - 18552 = 80898 for n. 39 Solve 0 = 1190h - 67 + 8435 + 5912 for h. -12 Solve 80v + 5859 = 74v - 33v - 24v for v. -93 Solve 222m + 266m - 8308 = -49m + 9950 for m. 34 Solve -35602 - 41554 = 573h - 16991 for h. -105 Solve 1089 - 2601 = 56j for j. -27 Solve 9c + 1218 = c + 1058 for c. -20 Solve -2980z - 5999z = 808110 for z. -90 Solve -1617s - 95206 + 16266 - 73116 = -9760 for s. -88 Solve 34612 = 115647v - 114629v for v. 34 Solve 13852y + 3800 = 13662y for y. -20 Solve -320c + 5289c + 283233 = 0 for c. -57 Solve -98p + 23472 = 527p - 278 for p. 38 Solve 0 = -145928l + 146120l + 7937 + 5695 for l. -71 Solve -201u + 79392 = 1967u - 514u for u. 48 Solve 878l - 378 + 144 = 644 for l. 1 Solve -43i + 676 = -231 + 199 - 754 for i. 34 Solve 3271o - 53871 = 220893 for o. 84 Solve 79l + 323l + 19050 = 50l - 29l for l. -50 Solve 10409 + 9890 + 8856 = -619l - 28412 for l. -93 Solve -39 = 174z - 2643 - 6 for z. 15 Solve -7744 - 663 - 18457 = 1168g for g. -23 Solve 843 = -215j + 554j - 70j - 1309 for j. 8 Solve -452d + 49393 + 2482 = -1859d - 12847 for d. -46 Solve 1007w + 1631w - 239940 = -152w for w. 86 Solve 0 = -9048n - 131735 - 40177 for n. -19 Solve -752j - 39255 - 1933 = 719j for j. -28 Solve -10289g - 109017 + 160462 = 0 for g. 5 Solve 0 = -2275j + 2357j - 410 for j. 5 Solve 328j - 10745 = 1719 for j. 38 Solve -24960z + 97853 = -29324z - 452011 for z. -126 Solve 142128 = -158q + 139126 for q. -19 Solve -176i - 13191 + 2455 = 0 for i. -61 Solve -4698 - 548 = -86c for c. 61 Solve -1491k - 166 = -1639k - 18 for k. 1 Solve 506259a - 506910a = 0 for a. 0 Solve -395q - 47397 - 61341 = -1134q - 987q for q. 63 Solve 39g - 1362 + 1930 = 1426 for g. 22 Solve -25674x + 25319x + 58703 - 7583 = 0 for x. 144 Solve 627y + 333y = -140y - 490y + 90630 for y. 57 Solve -855 = -9895d + 29876 - 149471 for d. -12 Solve -2903y = -2618y + 8974 - 15072 - 23827 for y. 105 Solve -887m + 1684m + 1620 = 857m for m. 27 Solve 1832f - 10f + 82798 + 31988 = 0 for f. -63 Solve 6052p = 52601 + 20023 for p. 12 Solve 113t - 26t = 45t + 45t - 180 for t. 60 Solve -149244u - 9036 = -150248u for u. 9 Solve 50d = 97d + 534d + 96d + 44005 for d. -65 Solve 0 = 1387y - 114534 - 18618 for y. 96 Solve -646u - 744203 + 710611 = 0 for u. -52 Solve 232827 = 4734c + 6353c for c. 21 Solve -8212f = -268f - 355f - 857557 for f. 113 Solve 185318 + 417881 + 186228 = 8550a + 62677 for a. 85 Solve -367k = 225k + 301k - 1160k + 30438 for k. 114 Solve -92x + 16x + 1748 = 0 for x. 23 Solve -6475k + 5683k + 42768 = 0 for k. 54 Solve 2722 + 1973 = -112t - 6519 + 126 for t. -99 Solve -6409k + 4397 - 883 = -15713 for k. 3 Solve 145t + 3789 = 10t + 144 for t. -27 Solve -298q - 1187 = -85 + 8136 for q. -31 Solve 0 = -32h - 9h + 36480 - 37136 for h. -16 Solve -2756u - 1807u + 1626u - 38181 = 0 for u. -13 Solve -94v = 277v - 57v + 5795 + 9277 for v. -48 Solve -16536 = -651p - 17187 for p. -1 Solve 7575n = 7469n + 8480 for n. 80 Solve -8222 - 226 = 264o for o. -32 Solve 362y - 219y - 1804 = 99y for y. 41 Solve -662l = -703 - 2664 + 6459 + 12134 for l. -23 Solve -2168290v + 2168378v - 6600 = 0 for v. 75 Solve 103812 = -3520t - 37747 - 168544 + 63703 for t. -70 Solve 359c - 137436 = 935c + 1186c for c. -78 Solve 131c - 273c - 1102c = -28612 for c. 23 Solve 2189923d - 2190005d + 4592 = 0 for d. 56 Solve -153b + 4199 - 6740 = 4650 for b. -47 Solve 0 = 580h - 3539 - 808 - 6093 for h. 18 Solve 0 = 12645a - 12617a + 476 for a. -17 Solve 19l - 1137 - 1022 = 146l for l. -17 Solve -235h = -211h - 264 for h. 11 Solve 22q - 182q - 1360 + 5200 = 0 for q. 24 Solve 413z = 1141z - 511z + 1881z - 104900 for z. 50 Solve -1588823u + 8736 = -1588919u for u. -91 Solve 437 = -1063u + 627 + 873 for u. 1 Solve 62w - 4761 + 2715 = 0 for w. 33 Solve -63455l + 2788 = -63496l for l. -68 Solve 6931 = -934c + 24086 + 11799 for c. 31 Solve 1435c - 19980 - 28733 = 77 for c. 34 Solve 637l + 18769 = -377l - 40043 for l. -58 Solve -1804y = 1253 - 8469 for y. 4 Solve -675 = 92j + 119j - 42 for j. -3 Solve 8778k - 3774 = 8889k for k. -34 Solve 217513 + 325506 = 8782b - 19029 for b. 64 Solve -566z = 643z + 520z + 57057 for z. -33 Solve -2091i - 28057 + 120061 = 0 for i. 44 Solve 1360t + 32806 + 20113 - 1239 = 0 for t. -38 Solve -419l + 2781 = -696l + 380l for l. 27 Solve 0 = 363a + 21a + 282a - 35298 for a. 53 Solve 1144 = 1515342x - 1515254x for x. 13 Solve -1512f = -4839f + 60379 + 129260 for f. 57 Solve -1715d + 3304d = 1732d + 6864 for d. -48 Solve 39296 + 150489 - 66734 = -11884f - 257237 for f. -32 Solve 3444 = -6311z + 6229z for z. -42 Solve 1375h + 42199 = 61659 + 112540 for h. 96 Solve -642329u = -642145u - 7728 for u. 42 Solve 3119d + 1721d + 7741 = -200379 for d. -43 Solve -867c + 18583 = 348c - 13007 for c. 26 Solve -200u + 150724 = 1474u - 136u for u. 98 Solve 306 = 377d - 383d for d. -51 Solve 319i = 358i + 117 for i. -3 Solve -5i + 4398 = -i + i + 4243 for i. 31 Solve -788r + 57303 = -914 + 5421 for r. 67 Solve 95m = 13505096 - 13509941 for m. -51 Solve -2489p + 2538p = 479 - 189 + 788 for p. 22 Solve -1666c - 102682 - 22579 - 18015 = 0 for c. -86 Solve 193j + 9j - 95 = 495j + 491 for j. -2 Solve 3679l = 3733l - 972 for l. 18 Solve -996l + 1051l = -2200 for l. -40 Solve -3116p + 6288p = 3137p + 210 for p. 6 Solve 596q - 68540 + 72712 = 0 for q. -7 Solve 1398q = -4q - 63316 - 40277 - 33803 for q. -98 Solve 0 = 4369y - 164445 - 455953 for y. 142 Solve -5210g + 119459 = -172301 for g. 56 Solve -567 = -51u - 1824 - 681 for u. -38 Solve -1681v - 1525v = -2592v - 41138 for v. 67 Solve 33t - 473 - 158 + 339 = 401 for t. 21 Solve 262z - 135z - 128 = 123z for z. 32 Solve 65f - 355 = 308f + 2561 for f. -12 Solve 452m = 366m + 2433 - 197 for m. 26 Solve 7475835 = -60p + 7472835 for p. -50 Solve -4189435 = -77o - 4185508 for o. 51 Solve 114j - 13j + 11872 = -66j - 57j for j. -53 Solve 8083l + 621016 + 236586 = 97800 for l. -94 Solve -3679i - 5725i - 722696 = -2455i for i. -104 Solve 4714 + 34270 = -2002x - 95150 for x. -67 Solve -89280 = 36285t - 33405t for t. -31 Solve -48a + 216a + 324a = 7872 for a. 16 Solve -133o = 324o + 69o - 72062 for o. 137 Solve 162r + 54756 - 55200 = 14r for r. 3 Solve 26153j - 26019j = 0 for j. 0 Solve -202i + 23250 = 34158 for i. -54 Solve -4203 = -484n + 637 for n. 10 Solve 7979 = 93c + 9002 for c. -11 Solve 0 = 109q - 1359q - 40000 for q. -32 Solve 371k + 486 = -333k + 752k - 1578 for k. 43 Solve -33f = 270f - 141f - 6804 for f. 42 Solve -50v - 44 = 95v - 479 for v. 3 Solve 126s + 2189 - 5618 = -3743 - 3718 for s. -32 Solve 12w = -162 - 107 - 127 for w. -33 Solve 0 = -220p - 1446 - 15274 for p. -76 Solve -5487 = -142p + 1329 for p. 48 Solve 300k - 7218 = 3582 for k. 36 Solve -1490856s + 2825 = -1490969s for s. -25 Solve 0 = -87j + 38094 - 39051 for j. -11 Solve 180r + 2812r = -196r + 111580 for r. 35 Solve 0 = 18912l - 23328l - 251712 for l. -57 Solve 4078r - 118689 = -1924r + 121391 for r. 40 Solve -12m - 387 = 331 - 250 for m. -39 Solve 1212z - 30298 = -4846 for z. 21 Solve -1605 + 2068 + 1780 = -769y - 3140 for y. -7 Solve 0 = 607l + 8322 - 1038 for l. -12 Solve 159m + 938m - 66888 = 168m for m. 72 Solve -525327u + 525149u = 14418 for u. -81 Solve -52n = -16n - 148n - 104n - 2592 for n. -12 Solve -4256 + 10608 + 12528 = -295y for y. -64 Solve -392c + 599c + 800c + 12084 + 29203 = 0 for c. -41 Solve 1371s - 44112 = 1015*s -	{ "pile_set_name": "DM Mathematics" }
h = 156 + -156.26. Let l = h + 0.26. Which is smaller: l or n? n Let j = -993 + 550. Let q be ((-7144)/(-266))/(6/(-98)). Let r = j - q. Is r greater than -5? True Suppose 744 = -4a + 3z, -25a + 5z = -26a - 209. Let s be (-27)/a + (-59)/(-28). Is -0.7 at least as big as s? False Let x be (-435)/10(-4)/6. Let v = -23 + x. Let c be (v - 7/1) + (-5)/(-3). Which is bigger: 1 or c? 1 Let t be (-6)/(150/20 - 8). Suppose -t + 12 = 11q. Which is smaller: q or -2/903? -2/903 Suppose 118 = 10d - 162. Suppose -2 = -5t + d. Which is smaller: 0.1 or t? 0.1 Let c(k) = k3 - 7k*2 - 14k + 5. Let u be c(9). Suppose -2f = -99 - 19. Suppose -q + u = -5h + 3, -f = -3q + 4h. Is q at most as big as 14? True Suppose -44r - 74376 = 120324. Does r = -4424? False Let p = 454 + -457. Let g be (-1)/(74/(-76) + (2 - 1)). Which is smaller: p or g? g Suppose 1540 = 13d + 903. Is 55 greater than d? True Let l be 2301/69 - (-2)/(-4). Let v = 67/2 - l. Is 0 less than or equal to v? True Suppose h = -1 + 9. Let p = 249192 - 249181. Which is smaller: h or p? h Let w = 35.0611 - 0.0411. Let n = w - 2.42. Let z = n + -4.6. Does z = -2/9? False Let l = 4/101 - 19/13231. Suppose 0 = p, p = 3i + 149 - 146. Is l less than i? False Let d = -1249.242 + 1249.4. Let l = 3.1 - 3. Which is bigger: l or d? d Let h be (27/(-18))/((-2)/12). Suppose 7j + 12 + 2 = 0. Let x be j/(-3) + 0 - 6/h. Which is bigger: x or 2/3? 2/3 Suppose 3p + 70 = 4w + 230, -2p - 3w + 67 = 0. Which is smaller: 48 or p? p Let m = -16 - -10. Suppose -x + 13 = 0, 314x = -0g + 4g + 311x + 75. Is g greater than or equal to m? False Let u = 9/4004 - 14977/8444436. Which is bigger: u or -1? u Suppose 40 = -s + 4m, -34 = 5m - 14. Let q be 0 - 9/6(-4)/3. Let i be q/(-14) + 104/s. Is 0.02 greater than or equal to i? True Let o(j) = j3 + 10j*2 + 5j - 11. Let w(k) = k*2 - 13k + 15. Let m be w(11). Let p be o(m). Do 101 and p have the same value? True Let z be (-31974)/(-5) + 1746/1455. Do 6394 and z have different values? True Let b(s) = s*3 - 9s*2 + 9s - 7. Let i be b(8). Let h = 0 - i. Let v = -6/11 + -4/33. Is h bigger than v? False Let a be ((-93)/(-12))/(16/192). Let v = a + -92. Which is smaller: 1/320 or v? 1/320 Let v = -1559 - -1560. Does v = 1.709? False Let k = 2 - 3. Let x be 1314/8344/129. Let r = x - 8330/19. Which is bigger: k or r? r Let j be (-538603)/(-244790) + 99/(-45). Is j less than 1? True Let u = -667 - -683. Let h be (0 + 1)/((-1)/(-6)). Suppose u = s + h. Which is smaller: 11 or s? s Let b = 97263 - 10601670/109. Let y be 3/4 + (-2)/(-8). Which is bigger: y or b? y Let q = 2739 - 2549. Do -0.2 and q have the same value? False Let b be (-4 - -52) + 3 - 6. Is b > 48? False Let q = -2416 + 719. Is q not equal to -1697? False Suppose 3k = 5k - j - 2, -3j - 2 = -2k. Let s(b) = -b2 + 3b - 3. Let v be s(k). Let l be 18/(-15)3/12. Which is greater: v or l? l Let z = 1141877/11158 - 1433/14. Let w = 18269/870324 + z. Is w at most 1? True Let d(v) = -119v*3 + 4v*2 - 7v + 10. Let h be d(2). Let r = h - -936. Which is bigger: r or -3? -3 Let d = -33 - -35. Suppose 20t = 22t + d. Let q be (03/(-6))/t. Is -1/32 at least as big as q? False Suppose 7g + 3 = 10g. Let y(v) = -10v + 64. Let q be y(7). Which is smaller: g or q? q Let y = 3857 + -3971. Which is smaller: y or -1? y Let l = -3031 - -2591. Is -440 at most as big as l? True Let j = -73195/6 + 12191. Which is greater: j or -13? j Let l = -7/3 + 19/12. Let s be (-2109)/60 - (-4)/10. Let i = s - -35. Does i = l? False Let u = 1308 - 1281. Let b = -5 - 4. Let y(a) = -4a - 10. Let q be y(b). Does q = u? False Suppose 12r - 482 + 122 = 0. Let x be 202/(-6)(-252)/56. Is r at least x? True Let r = -45 - -93. Suppose 0 = -50m + 58m + r. Let s = -272/1143 + 2/127. Are m and s non-equal? True Suppose -2l + 3t - 8 = 0, -5l - 3t = -0l + 41. Let b be 34/l56/(-24). Let a(x) = -2x + 2. Let c be a(-5). Is b at least c? False Let g = -6.3 - -1.3. Let l = 4.7 + g. Does l = 0.08? False Suppose -5m - 2l - 11091 = 11186, 2m = l - 8918. Which is smaller: m or -4458? -4458 Let c(p) = 2p - 10. Let n be c(6). Suppose 24 = 2x + n. Let o be ((-69)/x - -3) + 3. Which is smaller: o or -2/9? o Suppose 13i - 11 = 24i. Let q(k) = 20k + 15. Let h(z) = 13z + 10. Let w(o) = 8h(o) - 5q(o). Let p be w(i). Which is smaller: p or 1/21? 1/21 Let q(g) = -70g3 - 9g*2 + 4g - 4. Let f be q(2). Which is smaller: f or -1780/3? -1780/3 Let j = 4513 - 14410010/3193. Which is smaller: -1 or j? -1 Let n(x) = -x*3 + 21x*2 - 27x - 23. Let k = 16 - -3. Let h be n(k). Let r be ((-190)/h - -1)/(3/9). Which is bigger: 0 or r? 0 Let z = -62.39 + 62. Let t = 0.404 + z. Let b = 0.586 + t. Which is smaller: b or 1? b Suppose 4c - 30 = 7c. Let x = c + 12. Suppose 5l + xh = 46, 7l - 49 = 2l - 3h. Is 8 != l? False Suppose -11 - 13 = -6l. Suppose 4v + 2 - 6 = -lm, 0 = -5v - 4m + 4. Suppose -2b = -0 - 4. Is v smaller than b? True Let c = 4 - 5. Let r be 5/((-25)/(-3))c. Suppose 21l = 20l. Which is greater: l or r? l Suppose -15x + 9792 = -33x. Which is greater: -562 or x? x Let a be (1/(-193))/((-61)/(-305)). Which is smaller: a or -1? -1 Suppose 22 = 2k + 3g + 5, 0 = -4g + 20. Let b be (0/1 + k)/(3/(-27)). Let j be ((-15)/b + -1)-18. Which is smaller: j or -11? j Let p = 0.02 + 0.08. Let g = -0.05 + -15.35. Let f = g + 20.4. Which is greater: p or f? f Suppose 3d + 4656588 = 2z, 7z = 4z - 2d + 6984856. Let u be (-4)/(-18) - z/2376. Let c = u + 980. Is -1 equal to c? False Let q = 3833 + -3833. Are 625.3 and q non-equal? True Let g be ((-1928)/15)/2 - (-12 + 171/15). Is -63 less than g? False Let x(p) = -6p + 171. Let y(a) = -3a + 85. Let n(g) = -6x(g) + 14y(g). Let t be n(25). Do t and 9 have the same value? False Let q = -11 - -10.84. Let n = q - -0.07. Let k = -9.24 - -9.44. Which is smaller: k or n? n Let g be ((-8448)/(-759) - 11)(2 - (-2 + 24)). Is g equal to -2/39? False Suppose -r = -21 - 3. Suppose -ry = -16y - 8. Which is smaller: y or 115? y Let x(m) = m - 7. Let u be x(11). Suppose b - 8 = 2v, 8 = 4b + 2v - uv. Suppose -3q - 11 = -2j, 5q - 7j + 3j + 21 = b. Is q at least 2/17? False Let s = 630 + -25832/41. Let o = 2.3 + 14.7. Let v = -17 + o. Is s < v? True Suppose 5s - 2 = 4s. Suppose 2b + b + 71 = 5y, 5y = sb + 49. Is b greater than or equal to -20? False Let w = 39 - 38. Let b be 7 - (-4)/((-2)/w). Suppose -3l + 55 = bf, -l - 25 = -6l. Are 6 and f unequal? True Suppose 4w - 8028 = 4w - 4w. Which is smaller: 2008 or w? w Let w = -498.4629 - -532.474. Let v = w + -0.0111. Is 1 < v? True Let q(x) = 0x + 4x + 0x - 3x. Let c be q(-6). Let u(b) = -b3 - 7b*2 - 6b + 2. Let a be u(c). Is a bigger than 11/6? True Suppose 1478 = 6r + 212. Let u = r + -196. Which is smaller: 49/3 or u? u Let v be -1 + 0 - (-2505552)/2562. Let s = v - 977. Which is greater: s or 1? 1 Let w(l) = l2 + 12l - 3. Let q(b) = -b*3 + 4b*2 + 9b - 3. Let z be q(5). Let u be w(z). Let i be (3/u)/(54/72). Is -1 >= i? False Let v = -47 + 55. Let t(f) = vf + 22f*2 - 30f*2 + 7f*3 - 8 - 6f*3. Let a be t(7). Is a < -4/25? True Suppose -5n - 5 = 5c, -5 = 16c - 19c - n. Suppose 502 = 4d + ch + 155, -4d + 357 = 5h. Which is greater: 84 or d? 84 Let q = -34796 + 34797. Let f = 82.9 - 77. Is q at most f? True Let a(j) = 9j + 5j - 17 + 3j. Let v be a(5). Let r = 60 - v. Which is greater: -9 or r? r Let j = -163.8 - -155.8. Which is bigger: -0.94 or j? -0.94 Suppose -2o - 447 = -86z + 87z, -1932 = 4z - 10o. Is z <= 5? True Suppose 73s = 74s - 5x - 2729, 0 = 5s + 2x - 13726. Do 2744 and s have the same value? True Let r(i) = 911i + 4239. Let u be r(-7). Is 2/9 at most u? False Let j be -1140 + -8 - (0 + -5). Let a be j/62 - 0. Does a = -381? True Suppose 227b + 374 = 229b. Let a be (b/22)/(3/6). Is a greater than 15? True Let v = 0.098 + -53.098. Let l = v + 83. Let p = l - -24. Which is smaller: p or 1? 1 Let i = -2676.05 + 2741. Let v = i - -0.05. Let a = v - 68. Is a bigger than -2? False Suppose -6h = h - 23h + 6960. Which is smaller: h or 441? h Let c = -0.1986 + -0.0951. Let q = -0.0363 + c. Do 6 and q have the same value? False Let r = 63 - -192. Let	{ "pile_set_name": "DM Mathematics" }
olve p - 15 = kp for p. -5 Suppose -4z - 3u = -5z + 582, 4z - 2u - 2358 = 0. Let f = z - 581. Solve -2b + 40 = -fb for b. -5 Suppose -3x = -k - 132, 195x - 4k = 193x + 108. Solve 33v - x = 26v for v. 6 Let v = 615 + -585. Suppose vb = 16b. Solve bz = -z - 3 for z. -3 Let o(q) = q3 + 10q*2 + 19q - 11. Let j be o(-7). Suppose 12l + 5i = 17l - 5, -4l = ji + 3. Solve l = 16w - 9w + 14 for w. -2 Let d = 13723 + -13690. Solve -32j - 97 + d = 0 for j. -2 Suppose 10l + 49 = -41. Let d(s) = -s2 - 4s + 46. Let h be d(l). Solve 4i - h = 7 for i. 2 Suppose -4p = -5a - 102, -2a + 3p + 10 - 55 = 0. Let t(c) = -2c - 35. Let v be t(a). Solve -2j = -j + v for j. -1 Let y(o) = -o3 + 5o2 + o - 1. Let w be y(5). Let a(s) = -s2 - 107s + 560. Let l be a(-112). Solve 7g - wg - 15 = l for g. 5 Suppose -5a = 4t - 36, 0 = a + t - 0t - 8. Let z be 0/(a(-7)/(-14)). Solve -4p + 0p + 16 = z for p. 4 Let c(j) = j3 + 14j*2 - 19j - 52. Let p be c(-15). Solve 77h - 75h = -p for h. -4 Suppose 39i - 41i = 0, -4h = -h - 4i - 423. Solve 100 = -ha + 161a for a. 5 Suppose -3h - l + 95 = 2h, 3h - 5l = 29. Suppose -3p + 38 = 5w, 4w = -p + w + h. Solve pi - 4i = 8 for i. 4 Let y = 55 + -52. Suppose yv + 5k = 5v, -2v = -k. Let q(t) = t2 + 3t + 6. Let x be q(-3). Solve 3f + vf - x = 0 for f. 2 Let o(f) = 31f + 994. Let i be o(-32). Solve 0 = -ia + 4 + 6 for a. 5 Let k = -35 + 35. Let o(j) = 6j - 15. Let y be -47/(-6)15/10. Let a be o(y). Solve k = -5d + a - 2 for d. 5 Let o = -280 - -284. Suppose 5 = 2u - 5, -4r - ou = -20. Solve 10t - 7t = r for t. 0 Let p(f) = -13f*2 + 0f3 - 2 + 3 + f3 + 4f2. Let z be p(9). Suppose -5m + 4l + 12 = -12, 3m - 2l = 14. Solve mg = -z - 3 for g. -1 Let c be (-14)/(-3) - (-15)/(-9). Suppose ca - 11 = -2n - 2n, -a = 3n - 2. Suppose 2h + 2h - 2 = -2d, -3d + 3h = -12. Solve dm = 4m - a for m. 5 Let c(j) = -j3 + j - 259j*2 + 244j*2 + 8 + 9. Let y be c(-15). Suppose yg - 6 = -0. Solve gt = -t for t. 0 Suppose 61a = 2p + 66a + 14, -2p - a + 2 = 0. Suppose n + 2u = 6, n = -3u + 4 + p. Solve -nr + 3r = -2r for r. 0 Let q = 7004 - 6993. Solve 0 = 14y - 59 - q for y. 5 Let g(m) = 28m + 320. Let j be g(-10). Suppose -4w = -b + 58, b - w - 53 = 2w. Let p = j - b. Solve -x + p = 4 for x. -2 Let b = -6 + 8. Let k(d) = 9d2 + 17d + 34. Let w be k(-3). Suppose -7m - w = -85. Solve 2t = mt - b for t. 2 Let x = -17463 - -17468. Solve -556 + 531 = -xj for j. 5 Let j be (-2)/(((-22)/1144)/((-6)/(-16))). Suppose 0 = 4z - 29 - j. Solve g = 22 - z for g. 5 Let c(b) = -b2 - 16b - 48. Let d be c(-12). Let i be d/((-2)/(-16)46). Solve 0 = 3j - ij - 6 for j. 2 Let x be (17 - -3)/(-4) + 6. Suppose l + 4 = 5q, 3q + 8l = 10l + x. Solve -2m + q = 3 for m. -1 Suppose -26o - o - 12420 = 0. Let i = -455 - o. Solve -ik + 9 = 34 for k. -5 Let u(q) = -q3 - 12q*2 - 7q - 10. Let y be u(-11). Suppose -112 = 4n - 4f, -3f = -2n - 2f - 52. Let r be (y/n)/(3/8). Solve -m + rm - 20 = 0 for m. 4 Suppose 59 = 10f + 19. Suppose 3i + p = 5i - 21, -fi + 17 = 3p. Solve 0 = -5g + g + i for g. 2 Let v be 4/(-1(-6)/207). Suppose f = -5f + v. Suppose -4b - 16 = y, -3b = -2y - 0b + f. Solve 0 = t + y for t. -4 Let g(t) = -t*2 - 24t - 125. Let k be g(-12). Solve ks = 25s + 24 for s. -4 Let p(j) = 8j - 1. Let g be p(1). Suppose 4z - 31 = -5s, -2z + 11 = -4s + 15. Suppose -sr + 0f + 2f - 7 = 0, -f = 2r - g. Solve 0 = 4x - r + 5 for x. -1 Let g(k) = k*3 - 6k*2 - 13k + 83. Let i be g(8). Solve -is + 98s = -27 for s. 3 Let z(n) = n*2 - 9n + 8. Let x(y) = -1. Let g(u) = -4x(u) + z(u). Let r be g(9). Solve 3a + a = r for a. 3 Let f be 780/(-270) - 1/9. Let n(t) = -t*3 - 10t*2 - 24t - 6. Let y be n(f). Solve 1 = 2w + y for w. -1 Suppose -374 = 3h - 4i + 1, -5h = -4i + 633. Let v = 137 + h. Solve 3z = vz + 5 for z. -1 Suppose 0 = -0z + 7z - 882. Let q = z + -113. Solve 0 = 9h - qh + 20 for h. 5 Suppose -5z + 5a + 92 = -108, -2z - 4a + 80 = 0. Suppose -4k = u - z, 3u - 87 - 33 = 3k. Let g be ((-19)/(-76))/(2/u). Solve 16 = gm - m for m. 4 Suppose 4c = c + 6c. Suppose -2q = -10, -3n + cq = q - 23. Suppose -4s = -s - n. Solve sj + 4 = j for j. -4 Suppose -858 - 17 = -35j. Solve 0 = jp + 21 + 29 for p. -2 Let j(w) = w*3 + 10w*2 + 314w + 2771. Let k be j(-9). Solve 0 = kd - 81 + 3 for d. 3 Let z be (-2 - 52/(-22)) + 3726/2277. Solve -5 = zh - 9 for h. 2 Let f be (30/(-9) + 4)11748/88. Solve -23i + f = 20 for i. 3 Let v(b) = -b*2 - 5b + 8. Let p be v(-4). Suppose -2f - 11 = -5m, -4m = -f - 5m + p. Solve -o - f = -8 for o. 1 Let l be 2637/126 - 5/(-70). Solve 0 = lv - 11v - 10 for v. 1 Let d be (-2 + 15 - 16) + 6/2. Solve d = -4g - 81 + 77 for g. -1 Let i = -2602 + 2611. Solve -i = -21v + 33 for v. 2 Suppose -29f - 42f + 2487 = 499. Solve fl + 100 = -68 for l. -6 Suppose -5q - 3v = -376, -155 = -3q + 4v + 59. Suppose -3l + 5i - 20 + 43 = 0, q = 4l + 2i. Solve -lo + 13o - 12 = 0 for o. -4 Let o(x) = 2x*2 - 221x + 3557. Let l be o(91). Solve 139c - 137c = -l for c. -4 Let u(g) = -5g2 + 2g - 28. Let w(v) = -14v2 + 5v - 84. Let n(k) = -17u(k) + 6w(k). Let o be n(-4). Solve 12 + 4 = -os for s. -4 Let i(v) = -v + 12 + 31 - 2v - 8. Let h be i(8). Suppose 3z + 0z - 2r = 4, r = -5z + h. Solve 5a - 3 = z for a. 1 Suppose -2d = 3n + 78 - 67, 0 = 5d + 5n + 10. Solve -ds - 24 = 19s for s. -1 Suppose 0 = n - 10 - 7. Let i be -11 + 25 + 164/(-14) + (-46)/161. Solve 0 = iy + 7 - n for y. 5 Let t be ((-143)/(-715))/((-2)/(-210)). Solve 80 = 5w - tw for w. -5 Let m(a) = a*3 + 33a*2 + 48a + 516. Let h be m(-32). Suppose -22 = -5y + 18. Solve -8z = -hz + y for z. -2 Let p be 618/10(-1270)/(-381). Solve -p = -y - 204 for y. 2 Suppose -5046 = -12c + 5s, c - 9s + 7s - 411 = 0. Solve -c = 4b - 427 for b. 1 Let d(w) = w3 + w2 - w + 3. Let g(v) = -v2 + 17v + 38. Let l be g(19). Let n be (l/(7 + -3))/3. Let i be d(n). Solve -io + 7 = 22 for o. -5 Suppose -4d - 4s + 56 = 0, s = -4s + 25. Suppose -5o + do = 48. Solve 3w + 3w + o = 0 for w. -2 Suppose -6m + 12 = -9m. Let q = 40 + -38. Let p be ((4 + m)/q)/2. Solve y = -p + 1 for y. 1 Suppose -y - 7 = -9. Let b(q) = -yq - 2q + 6q - 11 + 3q. Let s be b(7). Solve -1 = -5i + s for i. 5 Let u(c) = -6c + 3. Let h(g) = 6g - 4. Let z(v) = 6h(v) + 5u(v). Let a be z(10). Let r = -51 + a. Solve r = -3i - 10 - 5 for i. -5 Suppose -3j = -3c - 15, 0 = 6c - 7c. Solve jz - 328 = -308 for z. 4 Let v = 23 - -28. Let h be -5 - v/(-2 - 1). Solve h = -0a - 4a for a. -3 Let i be (-6 + 9)/(-36) + 657/108. Solve 5t = -it for t. 0 Suppose -4x + 170 = 5b, -5x + 63 - 188 = -5b. Let f be 4/(-42) - 233/(-21). Solve b = -fs + 5s for s. -5 Suppose 17m - 47 = 89. Let t(h) = 3h3 - 24h*2 - h + 8. Let i be t(m). Solve -5 = -iv - 5v for v. 1 Suppose 0 = p - 2, 4h - 374 = -p. Solve -23q = 8q - h for q. 3 Let q be 160/85 - 16/(-136). Suppose -9j = z - 4j - 8, -4j - 16 = -qz. Solve -zw + 6 = -10w for w. -3 Let p = -781 - -1331. Let a be (-2)/18 + p/90. Solve a = 3x - x for x. 3 Let j = 1184 - 1182. Solve -54 = js + 7s for s. -6 Let c(x) = -11x*2 - 28x + 139. Let j be c(5). Let f = j - -320. Solve -f = -8r - 4 for r. 5 Let h(d) = 7d + 45. Let f = 87 + -93. Let w be h(f). Solve wm = -m + 12 for m. 3 Suppose -3a - 506 = -5z, 4z = 3z + 5a + 110. Let q be ((-225)/z)/(1/(-4)). Solve q = 2s + 3 for s. 3 Suppose -2p - 3h = h - 56, -p - h + 23 = 0. Suppose -pf + 5 = -23f. Let w be (40/(-15))/(f/3). Solve -7c + w = -3c for c. 2 Let u = 9444 - 9444. Solve 33w + 198 = -uw for w. -6 Let n = -3108 + 3112. Solve -nw - 504 = -528 for w. 6 Suppose 5l - 43 = -2w, 4w + 4l - 7l = 73. Solve -25f - 6 = w for f. -1 Suppose 2k - 132 = -9k. Suppose 10z = kz - 46. Solve 0 = zl - 24l for l. 0 Let p be (153 - 8 - 11) + -6. Solve 8 = -132t + pt for t. -2 Let w(b) = 23b2 - 16b - 15. Let q be w(-1). Let p be (-1)/(-3 - (-66)/q). Solve p = 2m - m for m. 4 Let j(f) = -75f + 908. Let m be j(12). Solve -1410 + 1450 = -mg for g. -5 Let g = 1 + 3. Suppose 11a	{ "pile_set_name": "DM Mathematics" }
4, -25 Put 13, 20, 0, 5 in decreasing order. 20, 13, 5, 0 Put -4, -0.05, 1.0879 in descending order. 1.0879, -0.05, -4 Put 2, 1, -37795 in decreasing order. 2, 1, -37795 Sort -1/11, 95, -2/15, 3, 0.2. -2/15, -1/11, 0.2, 3, 95 Sort 4809, 0.2, -0.09, -5 in increasing order. -5, -0.09, 0.2, 4809 Sort -14, 33, -16, 3 in descending order. 33, 3, -14, -16 Sort -6/7, 207, 2/21, 5, -180 in descending order. 207, 5, 2/21, -6/7, -180 Sort -18, -2, -6, -4, 1, 244 in increasing order. -18, -6, -4, -2, 1, 244 Put 5, 7599, 0, 12 in descending order. 7599, 12, 5, 0 Put 5, 2, 37, 27, -1, -3 in ascending order. -3, -1, 2, 5, 27, 37 Sort -2, 8, -689 in increasing order. -689, -2, 8 Put 5, -1.9, 5/6, 8/5, 33, 4 in increasing order. -1.9, 5/6, 8/5, 4, 5, 33 Sort 23, 3, 8, 5, -10, 2 in ascending order. -10, 2, 3, 5, 8, 23 Put 9, -4, -2, -1, -94, 12 in descending order. 12, 9, -1, -2, -4, -94 Sort 47/44, -3, 1, -1 in descending order. 47/44, 1, -1, -3 Sort 0.02, -18.3, -3 in increasing order. -18.3, -3, 0.02 Put 3, 0, 13, -3, 18, 1 in increasing order. -3, 0, 1, 3, 13, 18 Put 3/340, 9, 1/3 in decreasing order. 9, 1/3, 3/340 Sort -3954, 0, -22 in descending order. 0, -22, -3954 Sort 4/3, -74, -2, 1/5 in increasing order. -74, -2, 1/5, 4/3 Sort -4, 159, 14, -1/2, 10 in decreasing order. 159, 14, 10, -1/2, -4 Put -3/5, -1, -26, 0.085 in ascending order. -26, -1, -3/5, 0.085 Sort -7, -4/7, -10.5. -10.5, -7, -4/7 Sort 8, -2909, 0.2 in descending order. 8, 0.2, -2909 Put -1, 131, 22, 1 in descending order. 131, 22, 1, -1 Sort -2, 55, 2, -3, 10. -3, -2, 2, 10, 55 Sort 0.2, 2, -51, 68, 0. -51, 0, 0.2, 2, 68 Sort -0.4, 66, 99.7. -0.4, 66, 99.7 Put 3, -3984, 36, 4 in decreasing order. 36, 4, 3, -3984 Put -3, -9, -4, 1, 69 in ascending order. -9, -4, -3, 1, 69 Sort 3, 1944, 5, -3, -1, 4. -3, -1, 3, 4, 5, 1944 Sort 1, -626, 3, -4, 0. -626, -4, 0, 1, 3 Sort -1, -0.01, -66/7, 0.45. -66/7, -1, -0.01, 0.45 Sort 3, -2, -5, -12, 1, 780. -12, -5, -2, 1, 3, 780 Sort 4/7, -121.1, 2 in decreasing order. 2, 4/7, -121.1 Sort 1/4, 16293, 310. 1/4, 310, 16293 Put 4, 0, 37, 4375 in descending order. 4375, 37, 4, 0 Put -10, -15, -92 in decreasing order. -10, -15, -92 Sort -1/5, 0.5, -1, -1/41, -102 in increasing order. -102, -1, -1/5, -1/41, 0.5 Sort 0.3, 0.5, -1/5, -2, 6 in descending order. 6, 0.5, 0.3, -1/5, -2 Put 0, 23.3, 3/2, 10, -2/3, 5/3 in descending order. 23.3, 10, 5/3, 3/2, 0, -2/3 Put 4247, -3, 3/80, -1, 0.2 in descending order. 4247, 0.2, 3/80, -1, -3 Sort -1, 856, -4 in descending order. 856, -1, -4 Sort -4, 2, -33, 56, -4/7, 4/3 in decreasing order. 56, 2, 4/3, -4/7, -4, -33 Sort -20/7, -4, -1/8, 5, 188/9. -4, -20/7, -1/8, 5, 188/9 Sort -2, 5, 1048, 2. -2, 2, 5, 1048 Sort -1, 115, 0.0277, -0.4 in increasing order. -1, -0.4, 0.0277, 115 Sort -177, 251, -32. -177, -32, 251 Sort -0.1, -2/3, 3, -4/425 in descending order. 3, -4/425, -0.1, -2/3 Put 2, 1, -4, 4 in increasing order. -4, 1, 2, 4 Put 4, 30, 48, 3 in increasing order. 3, 4, 30, 48 Sort -1/3, 0.5, -0.64, 98. -0.64, -1/3, 0.5, 98 Sort 2, -1, -2, 403, 24 in decreasing order. 403, 24, 2, -1, -2 Put 106, 3, 0.0067 in descending order. 106, 3, 0.0067 Sort -4, 0, -56, -22, 3 in ascending order. -56, -22, -4, 0, 3 Sort -4/9, 33537, 2 in ascending order. -4/9, 2, 33537 Put 0.8, 6709/4, -0.4, -2/17 in increasing order. -0.4, -2/17, 0.8, 6709/4 Put -3, 736, -126, 2/19 in descending order. 736, 2/19, -3, -126 Sort 4, 1, -9555 in ascending order. -9555, 1, 4 Put -5, -9, 446, -4, 2, -1 in decreasing order. 446, 2, -1, -4, -5, -9 Put -2/11, 0.4, -1755, 0, -2/7, -5 in increasing order. -1755, -5, -2/7, -2/11, 0, 0.4 Sort 5, 502603, 0, -1 in descending order. 502603, 5, 0, -1 Sort -66, 5, -1094 in decreasing order. 5, -66, -1094 Sort -0.4, -4, 5, -2/10985, 0, 3. -4, -0.4, -2/10985, 0, 3, 5 Sort 6, -8, -15, -0.3, 0.1 in descending order. 6, 0.1, -0.3, -8, -15 Sort 0, -396, -170/27 in increasing order. -396, -170/27, 0 Sort 9, 3, 251, -29 in decreasing order. 251, 9, 3, -29 Put 427844, 3, 2 in ascending order. 2, 3, 427844 Put -5, -13, 0, 188, -3, 3 in descending order. 188, 3, 0, -3, -5, -13 Sort -6, 5, -61, 18, -4 in decreasing order. 18, 5, -4, -6, -61 Sort 5, -4, 520, 1 in increasing order. -4, 1, 5, 520 Put -268, 37, 14 in increasing order. -268, 14, 37 Sort -1, 1347, 2, -5, -2 in increasing order. -5, -2, -1, 2, 1347 Sort -22, -8, -1/6, -4, 3 in ascending order. -22, -8, -4, -1/6, 3 Sort 137, 18, 5, 3, -3 in decreasing order. 137, 18, 5, 3, -3 Put 151, -8, -9, -5 in decreasing order. 151, -5, -8, -9 Put 21, 0, -24086, 3 in ascending order. -24086, 0, 3, 21 Put 3, 5, 424 in descending order. 424, 5, 3 Sort -3, 2, 1717, 1 in decreasing order. 1717, 2, 1, -3 Sort -2/11, 2/5, 5, -4, -1/3, -1 in increasing order. -4, -1, -1/3, -2/11, 2/5, 5 Put 0.042, 89, -1 in increasing order. -1, 0.042, 89 Sort -3, -2, 18184 in decreasing order. 18184, -2, -3 Sort 2, 268, 24, 4. 2, 4, 24, 268 Sort 16, 4, 11, -5/2, -0.1, -0.8. -5/2, -0.8, -0.1, 4, 11, 16 Put 3/16, 0.146, -5 in descending order. 3/16, 0.146, -5 Put -5, 4, 11, -133 in ascending order. -133, -5, 4, 11 Put -3/7, -16, 17, 2, -0.9 in decreasing order. 17, 2, -3/7, -0.9, -16 Sort 16, 2, 5, -6, -0.07, -2 in descending order. 16, 5, 2, -0.07, -2, -6 Sort 6, -3, 41, 7. -3, 6, 7, 41 Sort 0.9, -1/7, -1/37, 3, -2/7, 53 in decreasing order. 53, 3, 0.9, -1/37, -1/7, -2/7 Put 4/59, 10, 16, -6 in descending order. 16, 10, 4/59, -6 Sort 7, 11, 1/2, -98/5. -98/5, 1/2, 7, 11 Sort 266, -0.1, 9/11. -0.1, 9/11, 266 Sort 4, 6, 0, 5, 3. 0, 3, 4, 5, 6 Sort -5, 583, -8, -20. -20, -8, -5, 583 Sort -5, 3, 12, 1437 in increasing order. -5, 3, 12, 1437 Sort -3, 44, -6, 164, 0 in increasing order. -6, -3, 0, 44, 164 Put -0.1, -1, 419 in ascending order. -1, -0.1, 419 Sort 0.0104, 0.4, -0.1, -0.3, 0.6 in decreasing order. 0.6, 0.4, 0.0104, -0.1, -0.3 Put -17, -0.5, -1, -0.2, 8/5, 0.2 in increasing order. -17, -1, -0.5, -0.2, 0.2, 8/5 Put 1.41, -1, 0.2, -137 in ascending order. -137, -1, 0.2, 1.41 Sort 8, 4, -49 in descending order. 8, 4, -49 Sort -0.87, 4/3, -1/6. -0.87, -1/6, 4/3 Sort 3, 127/34, -0.4. -0.4, 3, 127/34 Put 12, -2, -3, 493 in increasing order. -3, -2, 12, 493 Sort -3/8, 2/13, 3.11. -3/8, 2/13, 3.11 Put 4, -5, 143, -1, -9 in decreasing order. 143, 4, -1, -5, -9 Sort 2/459, 191, -2/17, 5/4 in descending order. 191, 5/4, 2/459, -2/17 Sort -6/7, 4886, 5. -6/7, 5, 4886 Put -1, 5, 2389, 4 in decreasing order. 2389, 5, 4, -1 Put 0.6, 4, 0.89 in descending order. 4, 0.89, 0.6 Put 9, 166, -0.1, -6, -0.4 in decreasing order. 166, 9, -0.1, -0.4, -6 Put -4, 81, 6 in ascending order. -4, 6, 81 Sort -7, 2, -2, -5, 6, 4 in increasing order. -7, -5, -2, 2, 4, 6 Put 151, -1, -3, 5, 4 in increasing order. -3, -1, 4, 5, 151 Sort 1, 1/2, -20784 in decreasing order. 1, 1/2, -20784 Put -3/8, -0.04, -1/19, -3.07 in ascending order. -3.07, -3/8, -1/19, -0.04 Sort 0, 4141, -4, 1 in increasing order. -4, 0, 1, 4141 Sort 38, -75, -5, 5. -75, -5, 5, 38 Sort 0, 6, 4, 15596, -3. -3, 0, 4, 6, 15596 Put -1, -124, 10, 5 in ascending order. -124, -1, 5, 10 Sort 4/179, 6, -1/8 in decreasing order. 6, 4/179, -1/8 Sort -639, 10, 2, -5, 5, -3. -639, -5, -3, 2, 5, 10 Sort -4, -1492, 3, -5 in descending order. 3, -4, -5, -1492 Sort 177, -14, 0, -4, -0.1 in increasing order. -14, -4, -0.1, 0, 177 Put -4, 150604/5, -2/7, -1, 5 in descending order. 150604/5, 5, -2/7, -1, -4 Sort 1, 338012, 3. 1, 3, 338012 Put 3, -3, 0, 6459 in descending order. 6459, 3, 0, -3 Put 126, 297, 2, -4 in decreasing order. 297, 126, 2, -4 Sort 26, 1, -1, 685. -1, 1, 26, 685 Sort 2, -29, -5947 in increasing order. -5947, -29, 2 Put 382, 1, 5, -0.3, 0 in increasing order. -0.3, 0, 1, 5, 382 Sort -86/5, -2, -13/6 in descending order. -2, -13/6, -86/5 Sort 7, 5, -4, 8, -5, -9 in descending order. 8, 7, 5, -4, -5, -9 Sort 3, -241, -3, -2, 2, -5. -241, -5, -3, -2, 2, 3 Sort -0.2, 707, -0.14 in descending order. 707, -0.14, -0.2 Sort 23, -2235, 5, -4 in decreasing order. 23, 5, -4, -2235 Put 3, -5/2, -1/338, 2/3, -0.2 in decreasing order. 3, 2/3, -1/338, -0.2, -5/2 Put 2, -3, -1, 1128, 3 in decreasing order. 1128, 3, 2, -1, -3 Put 37, -1/11, 113, -1 in descending order. 113, 37, -1/11, -1 Put 11, 0, 37, 2, -3 in increasing order. -3, 0, 2, 11, 37 Put 0.5, 3, -16, 1/36, 0	{ "pile_set_name": "DM Mathematics" }
is the millions digit of 11336786? 1 What is the ten thousands digit of 57100? 5 What is the millions digit of 7627128? 7 What is the millions digit of 1369261? 1 What is the units digit of 2471821? 1 What is the units digit of 4638267? 7 What is the hundred thousands digit of 2411168? 4 What is the thousands digit of 863585? 3 What is the units digit of 35994? 4 What is the tens digit of 665708? 0 What is the units digit of 641687? 7 What is the thousands digit of 292603? 2 What is the tens digit of 2120593? 9 What is the ten thousands digit of 164549? 6 What is the units digit of 363250? 0 What is the ten thousands digit of 88218? 8 What is the tens digit of 583745? 4 What is the tens digit of 388012? 1 What is the millions digit of 1845961? 1 What is the thousands digit of 687537? 7 What is the ten thousands digit of 2708341? 0 What is the hundred thousands digit of 440934? 4 What is the hundreds digit of 433808? 8 What is the hundred thousands digit of 417667? 4 What is the thousands digit of 5183440? 3 What is the thousands digit of 43959? 3 What is the ten thousands digit of 13087483? 8 What is the tens digit of 160573? 7 What is the tens digit of 1071026? 2 What is the ten thousands digit of 432683? 3 What is the thousands digit of 698183? 8 What is the ten thousands digit of 4424280? 2 What is the hundreds digit of 146754? 7 What is the thousands digit of 921231? 1 What is the hundreds digit of 5586? 5 What is the millions digit of 3584336? 3 What is the hundreds digit of 12818419? 4 What is the hundred thousands digit of 3773973? 7 What is the hundred thousands digit of 891342? 8 What is the units digit of 244269? 9 What is the hundred thousands digit of 21896941? 8 What is the hundreds digit of 110337? 3 What is the millions digit of 1954760? 1 What is the tens digit of 191810? 1 What is the hundred thousands digit of 16818212? 8 What is the hundred thousands digit of 106675? 1 What is the thousands digit of 1174380? 4 What is the ten thousands digit of 262567? 6 What is the ten millions digit of 18739722? 1 What is the ten thousands digit of 859219? 5 What is the tens digit of 1411032? 3 What is the units digit of 3743438? 8 What is the tens digit of 4460057? 5 What is the thousands digit of 8353441? 3 What is the tens digit of 129002? 0 What is the hundreds digit of 968343? 3 What is the thousands digit of 12924? 2 What is the thousands digit of 1107998? 7 What is the hundreds digit of 54876? 8 What is the hundred thousands digit of 546739? 5 What is the hundreds digit of 8416033? 0 What is the tens digit of 355629? 2 What is the thousands digit of 5590048? 0 What is the ten thousands digit of 233049? 3 What is the hundred thousands digit of 144545? 1 What is the hundreds digit of 231023? 0 What is the hundred thousands digit of 1687721? 6 What is the hundred thousands digit of 1055836? 0 What is the units digit of 603183? 3 What is the tens digit of 484129? 2 What is the hundred thousands digit of 10495817? 4 What is the units digit of 330430? 0 What is the hundreds digit of 2563537? 5 What is the hundreds digit of 8442661? 6 What is the ten thousands digit of 6836416? 3 What is the hundreds digit of 55078? 0 What is the hundred thousands digit of 256910? 2 What is the hundreds digit of 2640159? 1 What is the millions digit of 7975446? 7 What is the units digit of 9591428? 8 What is the units digit of 4113359? 9 What is the ten thousands digit of 1267603? 6 What is the ten thousands digit of 7085289? 8 What is the ten thousands digit of 2322908? 2 What is the hundreds digit of 829363? 3 What is the tens digit of 14793349? 4 What is the units digit of 9433663? 3 What is the thousands digit of 7416949? 6 What is the units digit of 7296504? 4 What is the thousands digit of 484746? 4 What is the tens digit of 1374947? 4 What is the ten thousands digit of 8280816? 8 What is the hundred thousands digit of 6277233? 2 What is the hundred thousands digit of 1985812? 9 What is the tens digit of 129423? 2 What is the millions digit of 1067643? 1 What is the thousands digit of 1013004? 3 What is the hundreds digit of 300436? 4 What is the ten millions digit of 16880038? 1 What is the tens digit of 13190726? 2 What is the thousands digit of 6796467? 6 What is the millions digit of 4461119? 4 What is the tens digit of 905800? 0 What is the thousands digit of 7095360? 5 What is the thousands digit of 164611? 4 What is the tens digit of 9723? 2 What is the hundreds digit of 441013? 0 What is the hundreds digit of 422751? 7 What is the hundreds digit of 68150? 1 What is the thousands digit of 407572? 7 What is the ten thousands digit of 231834? 3 What is the thousands digit of 304341? 4 What is the thousands digit of 430152? 0 What is the tens digit of 2402359? 5 What is the hundred thousands digit of 3594900? 5 What is the units digit of 2880377? 7 What is the thousands digit of 4389782? 9 What is the hundred thousands digit of 243574? 2 What is the hundred thousands digit of 3580027? 5 What is the hundreds digit of 851921? 9 What is the ten thousands digit of 564097? 6 What is the thousands digit of 1405192? 5 What is the ten thousands digit of 13898889? 9 What is the ten thousands digit of 3169262? 6 What is the tens digit of 2384475? 7 What is the ten thousands digit of 120305? 2 What is the units digit of 1501263? 3 What is the thousands digit of 770357? 0 What is the thousands digit of 8310654? 0 What is the hundreds digit of 12847345? 3 What is the hundred thousands digit of 155177? 1 What is the hundred thousands digit of 152780? 1 What is the thousands digit of 3117217? 7 What is the units digit of 93258? 8 What is the hundreds digit of 110109? 1 What is the hundreds digit of 21574273? 2 What is the tens digit of 3137225? 2 What is the units digit of 1091612? 2 What is the thousands digit of 359030? 9 What is the thousands digit of 15546472? 6 What is the hundred thousands digit of 248991? 2 What is the ten thousands digit of 4544642? 4 What is the thousands digit of 5407153? 7 What is the ten thousands digit of 225621? 2 What is the hundred thousands digit of 1021852? 0 What is the units digit of 3774893? 3 What is the hundred thousands digit of 6300599? 3 What is the ten thousands digit of 250805? 5 What is the hundred thousands digit of 1679080? 6 What is the thousands digit of 817862? 7 What is the units digit of 72586? 6 What is the ten millions digit of 22698289? 2 What is the tens digit of 976011? 1 What is the ten thousands digit of 6084087? 8 What is the tens digit of 815225? 2 What is the tens digit of 8877728? 2 What is the ten thousands digit of 1187379? 8 What is the units digit of 618260? 0 What is the thousands digit of 56479? 6 What is the units digit of 2646387? 7 What is the units digit of 456152? 2 What is the tens digit of 4700803? 0 What is the tens digit of 57805? 0 What is the ten thousands digit of 9583700? 8 What is the thousands digit of 143023? 3 What is the tens digit of 4376219? 1 What is the hundreds digit of 2490071? 0 What is the tens digit of 663381? 8 What is the ten thousands digit of 511896? 1 What is the tens digit of 289448? 4 What is the units digit of 5605389? 9 What is the hundreds digit of 216327? 3 What is the hundreds digit of 758892? 8 What is the ten thousands digit of 179523? 7 What is the hundred thousands digit of 223941? 2 What is the hundred thousands digit of 146862? 1 What is the units digit of 43331? 1 What is the tens digit of 3197438? 3 What is the hundreds digit of 373184? 1 What is the tens digit of 3199600? 0 What is the hundreds digit of 4706? 7 What is the hundred thousands digit of 2978818? 9 What is the ten thousands digit of 4041141? 4 What is the units digit of 71303? 3 What is the units digit of 325717? 7 What is the hundred thousands digit of 478062? 4 What is the tens digit of 1216893? 9 What is the thousands digit of 278783? 8 What is the ten thousands digit of 53756? 5 What is the hundred thousands digit of 6213110? 2 What is the thousands digit of 1271633? 1 What is the ten thousands digit of 6207817? 0 What is the hundred thousands digit of 260997? 2 What is the units digit of 2175507? 7 What is the tens digit of 4655007? 0 What is the tens digit of 2161437? 3 Wh	{ "pile_set_name": "DM Mathematics" }
e highest common divisor of y and 16? 8 Let x(b) = b*3 + 4b*2 - 6b. Let k be x(-5). Calculate the highest common factor of 20 and k. 5 Let t be 12 - 5/((-10)/6). Suppose -5n + 0n = 0, -4n = -5b + t. Suppose 17 = 2v + b. Calculate the highest common divisor of v and 14. 7 Let s be 3/(32/36). Suppose 8t - 3t = -20, 0 = -r - 3t + 89. Let f = -11 + r. Calculate the greatest common divisor of f and s. 18 Suppose 5j - 49 = -2n - n, -4n = -j - 4. What is the greatest common divisor of j and 32? 8 Let l = 484 + -343. Let k = -81 + l. Suppose -p = 2h - 332, -h - k = 5p - 208. Calculate the greatest common factor of h and 24. 24 Let b = -2 + 2. Suppose i - 5g - 2 = b, -3i = i - 2g - 44. Let o = -53 - -89. Calculate the highest common factor of i and o. 12 Let i be (4 - (-3 + 3)) + 0. Let f(m) = 2m. Let n(w) = 3w - 3. Let t(o) = -2f(o) + 2n(o). Let s be t(4). Calculate the greatest common factor of s and i. 2 Let l be (4/3)/(4/402). Suppose 3u + 18 - 282 = -2k, -k - 2u + l = 0. Suppose 0 = -3c - 2 + 44. Calculate the highest common factor of k and c. 14 Let r = -8 - -11. Suppose rj - u - 23 = 11, -4u - 16 = -2j. What is the greatest common factor of j and 4? 4 Let f(y) = y*3 + 7y*2 + 3y + 3. Let o be f(-3). Suppose 4w - 8 = -0w. Let a be 1 - -1 - (-16)/w. What is the greatest common divisor of o and a? 10 Let d be -1 + (-105)/(-3) + 0. What is the highest common factor of 17 and d? 17 Let v(d) = 84d2 + d - 1. Let b be 2/4 + (-3)/(-6). Let r be v(b). Calculate the greatest common divisor of 12 and r. 12 Suppose 3r = -5a + 4a, 3r = -2a - 3. Let o be (r/5 - 1)-35. What is the greatest common divisor of 4 and o? 4 Suppose -3o = -2d - 1 + 55, 3o - 90 = -4d. Let w = 38 - d. Suppose 947 = 4h + 331. Calculate the greatest common divisor of w and h. 14 Suppose 7c - 2c + 50 = 0. Let k be ((-16)/c + -1)5. Suppose -2x - x = 4r - 5, 0 = -kr - 3x + 3. What is the greatest common divisor of 18 and r? 2 Suppose 78 = 4w - s, -w - 4s + 11 = -17. Calculate the greatest common factor of 60 and w. 20 Suppose 74 = -4w + 6. Let b = w - -31. Let c = 22 - b. Calculate the highest common divisor of 40 and c. 8 Suppose w = -22 + 39. Suppose 7r - 2r = k - 158, -k + 150 = 3r. What is the greatest common divisor of w and k? 17 Let w(t) = t3 - t2 - t + 51. Let u be w(0). Suppose 5m - 49 = 36. What is the highest common factor of u and m? 17 Suppose -8g + 380 - 84 = 0. What is the highest common factor of g and 111? 37 Suppose -32 = -5i + 8. Let s(q) = -10q. Let j be s(-2). Calculate the greatest common divisor of i and j. 4 Suppose 5b - 13 + 3 = 0. Suppose -b = -f - f. Suppose 5h - 44 = -4. Calculate the greatest common factor of f and h. 1 Suppose -640 = -23y + 18y. What is the highest common divisor of 16 and y? 16 Suppose 3o + 37 = q - 10, -90 = -2q + 2o. Calculate the highest common factor of q and 110. 22 Let j = -7 - -11. Let q be (100 - (2 - j)) + -3. Suppose -g = -1, -2p + 5g = 2p - 31. Calculate the highest common divisor of q and p. 9 Let j = 50 - 32. What is the greatest common factor of 2 and j? 2 Suppose 0a - 4m = -3a + 259, 8 = -2m. What is the highest common factor of 9 and a? 9 Suppose 124 = 4v + 2o, 3v + 4o - 91 = 2o. Calculate the greatest common divisor of 264 and v. 33 Let g be (-2 - -97) + (0 - -1). What is the greatest common divisor of g and 12? 12 Let p be (0 - (-88)/(-10))-10. Let i be (-2 - -1)/(6/(-66)). What is the greatest common divisor of i and p? 11 Let p be ((-1)/(-3))/((-2)/(-36)). Let i = -4 + p. Calculate the greatest common divisor of i and 5. 1 Let i be 2 - 12/(-2). Let d = 4 + -4. Suppose 0 = -dh - h + 24. What is the highest common divisor of h and i? 3 Let b = 223 + -390. Let z = 555 + b. Let o be 2/(-5) + z/20. Calculate the highest common divisor of 95 and o. 19 Let n be (10/(-3))/2-3. Let j be 2/(-4)(-16)/2. Let h be (-162 - -2)/j-1. What is the highest common divisor of h and n? 5 Suppose 0 = -2a + 10 - 4. Suppose -144 - 468 = -5u - 4m, -au + 354 = -2m. What is the greatest common factor of u and 15? 15 Let x(m) = -m2 - 2m + 9. Let n be x(0). Let s(p) = p - 9. Let h be s(10). Calculate the greatest common divisor of h and n. 1 Let m(p) = -p3 + p2 + p + 9. Let d be m(0). What is the highest common factor of d and 36? 9 Let l be (9 + 3)(-5)/(-2). Let y be (18/(-15))/(1/(-5)). Calculate the highest common divisor of y and l. 6 Let l = 18 - 7. Let r = 35 - l. Calculate the highest common divisor of 72 and r. 24 Let t(j) = j2 + 3j. Let n be t(-4). Suppose na - 43 = 125. Let m be 281 - (2 - 2). What is the highest common factor of m and a? 14 Let d be ((-209)/(-2))/((-2)/(-4)). Suppose -j - 3t + 28 = 0, j = 3j - 3t - 29. What is the highest common divisor of d and j? 19 Let g be (-3)/4 + 140/16. What is the highest common factor of 4 and g? 4 Let i(d) = 3d*3 - d + 1. Let x = -8 - -13. Let m = x - 4. Let t be i(m). Calculate the greatest common divisor of 3 and t. 3 Let u be -51/(0 - 1). Let s = 26 + -14. Suppose y - 64 = -3y - 4w, 3w + s = y. Calculate the highest common divisor of u and y. 5 Let m = 103 + -73. What is the greatest common divisor of 6 and m? 6 Let p = -1 + 6. Suppose 0 = -0o - po + 50. Let r = 261 - 181. Calculate the highest common divisor of r and o. 10 Let p(s) = -s2 + s + 1. Let u be p(2). Let j be (-5)/u114/10. What is the highest common divisor of 19 and j? 19 Let o = -7 - -9. Suppose -5x + ox - 6 = 3d, 0 = 2d + 8. What is the greatest common divisor of x and 22? 2 Let g be 2106/42 + 1/(-7). What is the greatest common factor of 10 and g? 10 Let m(n) = 26n - 10. Let q(h) = 5h - 2. Let r(p) = -2m(p) + 11q(p). Let o be r(7). Calculate the greatest common factor of 190 and o. 19 Let u = 12 + -7. Suppose 4j - 12 = -ua, -a - a = -5j + 48. What is the highest common factor of 2 and j? 2 Let z(o) = o + 42. Let p be z(-18). Suppose 0 = h + 6 - 42. Calculate the highest common divisor of p and h. 12 Suppose -5h = 5t - 35, -2t + 30 = 5h + 4. Let c = -3 + h. Suppose c = -2l + 3. Calculate the highest common factor of l and 1. 1 Suppose -216 = -0g - 4g. Suppose 30 - 6 = 4f. Calculate the highest common factor of f and g. 6 Suppose -2j + 10 = -0j. Let z(f) = 10f*2 + 3f + 1. Let l be 8/(-20) - (-8)/(-5). Let q be z(l). Calculate the greatest common divisor of j and q. 5 Let p be (-2)/(-14) - 118/(-7). Calculate the highest common factor of p and 153. 17 Let v = -112 - -167. Suppose -4s - 4s = -176. What is the highest common divisor of s and v? 11 Let n(a) = a*2 + a + 12. Let v be n(-5). What is the highest common factor of 4 and v? 4 Let j = 12 + -9. Suppose 15 = -ju, 5m = -0m - 5u + 575. Calculate the highest common divisor of m and 15. 15 Suppose 17 = 3f - 145. Let c be f/(-24) - 2/(-8). Let k be 4/c - (-3 - 7). What is the greatest common factor of 12 and k? 4 Let u(d) = 5d2 - 11d + 2. Let k be u(5). Suppose 5o - r - 75 = -6r, -5o + 5r = -105. Calculate the highest common factor of o and k. 18 Suppose d + 11 + 7 = 0. Let x = d - -26. Calculate the highest common divisor of 4 and x. 4 Suppose r - 2m = -1001, 4r + m + 4024 = -m. Let h be r/(-18) - 3/(-18). Calculate the greatest common factor of 8 and h. 8 Let w(c) = -c*3 - 5c*2 - 4c + 4. Let l be w(-4). Let t be (3 - 2)/((-1)/l). Let z be (t/10)/(2/(-50)). What is the greatest common factor of z and 2? 2 Suppose 3 = k + 2v + 9, 0 = -3k + 2v + 6. Suppose k = 5m - 6 - 34. Suppose i = 22 - m. Calculate the greatest common factor of i and 154. 14 Suppose -4k + 15 = 7. Calculate the greatest common factor of k and 14. 2 Let g be ((-1)/(-1))/(10/90). Calculate the highest common factor of g and 99. 9 Suppose 4l = -25 + 241. Let n(s) = s*2 + 3s - 1. Let d be n(-4). Let j be 54/d1/3. What is the highest common divisor of l and j? 6 Let u be (-19)/(-7) - (-14)/49. Suppose uy - j - 2 = -3j, 0 = 2y - 3j + 3. Let k be (y + -8)3/(-3). What is the highest common divisor of k and 8? 8 Let r = 681 - 481. Suppose 5u = -0u + r. What is the greatest common divisor of 5 and u? 5 Let x = -5 - -10. Suppose -b + xw + 14 = 2, b = 4w + 10. Suppose -2y + 56 = by. Calculate the greatest common divisor of 112 and y	{ "pile_set_name": "DM Mathematics" }
(b) 14 (c) -4 c Which is the nearest to 0? (a) -1 (b) -4 (c) 11 (d) -0.5 d Which is the closest to 9? (a) -1/6 (b) 4 (c) -3 b Which is the closest to -2? (a) -5 (b) 0.7 (c) 0.135 (d) 2 c What is the closest to 0 in -5, 2/5, 0, -2? 0 What is the closest to 1/4 in 5/4, -0.2, -47? -0.2 What is the nearest to -6 in 0, -3, 4, 3? -3 What is the closest to -4 in 1/4, 1/10, 3/8, -23? 1/10 What is the nearest to -0.084 in 0.3, -6, -0.5, -2/5? -2/5 What is the nearest to 3/2 in -2/3, -5, 2, -3? 2 Which is the closest to -123? (a) -2 (b) -0.5 (c) -12 (d) 3/4 c What is the nearest to -1 in -437, 3, 2/15, -1/10? -1/10 What is the closest to -0.2 in -2, 11, 1/5, -4? 1/5 Which is the closest to -1? (a) 0.1 (b) 1 (c) 1.2 a What is the nearest to 83.1 in 1, -0.5, -2/7, -2? 1 Which is the nearest to -0.1? (a) -40 (b) -1/6 (c) 1 b What is the closest to -2 in 0.1, 3/4, 8? 0.1 Which is the nearest to -2? (a) -4/5 (b) 2 (c) 5 (d) 0.14 a What is the nearest to 6 in 0.02, -1/4, 2/121? 0.02 What is the nearest to -0.1 in -2, 5, -3/5, -5? -3/5 Which is the nearest to 0? (a) -3 (b) 0.74 (c) 1/6 c What is the closest to 2 in 0, -35, -2/5, 2? 2 Which is the closest to 0? (a) 4/3 (b) 0.5 (c) -57 (d) 0.8 b What is the closest to -0.3 in 2, -4, 3/5, -0.5? -0.5 What is the nearest to 0.2 in -4/3, 5, 51, -3? -4/3 Which is the nearest to -1? (a) -24 (b) 0.05 (c) -3 b What is the nearest to 1/2 in -43, 2, -0.3, 4? -0.3 Which is the nearest to -0.1? (a) 2/3 (b) -3 (c) -4 (d) 5 a Which is the closest to 1/2? (a) 70 (b) 0.05 (c) -2 b What is the nearest to 1 in 4/5, 4, 0.01? 4/5 Which is the closest to 1? (a) 42.58 (b) 2 (c) -0.5 (d) -2/13 b What is the closest to 6 in -10, -8/7, 0.5? 0.5 What is the closest to 0.4 in -2/7, -6/7, 1/2, 0? 1/2 What is the nearest to 2/3 in 1/6, -3, 2, 0.2? 0.2 What is the nearest to 3 in 4, -2/5, -0.08? 4 Which is the closest to 2/15? (a) 24 (b) 2 (c) -2 b Which is the closest to 2/3? (a) 2 (b) 19 (c) -1/3 (d) 3/7 d Which is the closest to 1? (a) -0.2 (b) 2 (c) -3 b What is the closest to 2.33 in 2/5, -1, 2/17, 2? 2 Which is the nearest to -2? (a) -19 (b) -0.2 (c) 0.14 (d) -0.5 d What is the nearest to 4 in 3, -14, -2/5? 3 Which is the closest to -0.1? (a) 0 (b) -114 (c) 4 (d) 3 a Which is the nearest to 19/4? (a) 1 (b) 0.3 (c) -4 (d) -3 a Which is the nearest to -0.3? (a) -2/3 (b) 0.03 (c) 2/73 c Which is the closest to 0.2? (a) -10 (b) 1/4 (c) -1/2 (d) -2 b What is the closest to -123 in -0.3, 1, 0.2, 4? -0.3 What is the nearest to 0.4 in -3, -2/19, 0.5, -1? 0.5 Which is the closest to 2/7? (a) -0.2 (b) -5 (c) 5 (d) -3 a What is the closest to 0.5 in 0.196, 4, 0.5, -0.5? 0.5 Which is the closest to 6? (a) -1 (b) 2/9 (c) 6/7 c What is the nearest to -2/7 in -5, 4, -0.29, -1/4? -0.29 What is the closest to -2/5 in 4, 0.12, -3? 0.12 Which is the closest to 2? (a) -1/24 (b) -6 (c) 0.2 (d) -5 c What is the nearest to -2 in 2/9, -1.14, 4, -0.1? -1.14 What is the nearest to 0.6 in -3, 0.0171, -0.1? 0.0171 Which is the closest to 0.3? (a) 2/7 (b) -0.11 (c) 0.03 a Which is the closest to 3? (a) -1/2 (b) 0.4 (c) -0.002 b Which is the closest to -2/9? (a) -4 (b) -0.5 (c) 4/117 c Which is the nearest to 3? (a) -5/3 (b) 0 (c) -4 (d) 1 d What is the nearest to 0 in -0.1, -1, -0.38, 3? -0.1 What is the nearest to 6 in -3/7, -4, -0.1, -6? -0.1 What is the nearest to 0.2 in 0.4, 2, -0.5, 0.33? 0.33 What is the closest to -0.1 in -27, 1/4, -5? 1/4 Which is the closest to 2? (a) -2 (b) -5 (c) -4 a What is the nearest to 2/3 in -0.06, 0.1, -4/3? 0.1 What is the closest to -0.9 in 4/3, -0.5, -2, 0? -0.5 What is the closest to 0 in 0, -1, 2/5? 0 What is the closest to -8 in -0.2, -14, 0.1? -14 Which is the nearest to -0.03? (a) -0.4 (b) 0.08 (c) -3 b What is the closest to 2 in -1/2, 0.1, -5? 0.1 Which is the closest to 1.5? (a) -4 (b) -0.3 (c) -2 b What is the closest to -1 in -3/4, -3, -8, 0.04? -3/4 What is the closest to 3 in -1/4, -15, -0.3? -1/4 What is the closest to -2/15 in -1/6, 0.9, -5? -1/6 What is the closest to -0.07 in 2/5, -0.3, 0, 2? 0 What is the nearest to -2/3 in -0.2, 0.1, -14, 0? -0.2 What is the nearest to 2/13 in -1, -1/4, -2? -1/4 What is the closest to 2 in 1/3, -1, -1/3, -2? 1/3 Which is the nearest to 0.6? (a) -0.1 (b) 0.04 (c) -5 b Which is the nearest to -1/7? (a) 3/2 (b) 0 (c) -2 b What is the nearest to 0 in -74, -0.4, 2/3, -3? -0.4 Which is the nearest to -2? (a) -1/2 (b) 0.5 (c) -3/49 a Which is the nearest to 13? (a) 2/21 (b) 2 (c) 2/11 (d) -3/2 b What is the nearest to 0.5 in 0.1, 0.4, -5, -6/11? 0.4 Which is the nearest to 4? (a) -2/5 (b) -12.5 (c) 2 c Which is the nearest to -2? (a) -13 (b) -0.06 (c) 4 (d) 2/9 b What is the closest to 1/488 in 0, -0.4, -2/7? 0 What is the nearest to 2/5 in -0.021, 46, -5? -0.021 What is the closest to -3/5 in -2/93, -4/7, 1? -4/7 What is the nearest to 0.7 in -1/6, 4, -0.2, -15? -1/6 Which is the closest to 3? (a) -15 (b) -4 (c) -2 (d) -0.4 d What is the nearest to 2 in 1/3, -10/9, 2/5? 2/5 Which is the nearest to 2/7? (a) 19 (b) -1 (c) 2/3 c What is the nearest to -5 in 3/14, -0.2, 0, -2/5? -2/5 What is the nearest to 1/3 in -3, -2, 1, -46/5? 1 Which is the nearest to -1? (a) 1/8 (b) 161 (c) 4 (d) 0.4 a What is the closest to 5 in -1, 6, -1/2? 6 Which is the closest to 5/4? (a) 1 (b) -6 (c) -4/5 a What is the closest to -1.3 in -0.3, 5, -2, -4? -2 Which is the closest to 0.3? (a) -0.4 (b) -31 (c) 0 (d) -0.1 c Which is the nearest to 0.1? (a) -2 (b) -11 (c) 0.3 (d) 7 c Which is the closest to 1? (a) 2/5 (b) 0.2 (c) -2/3 (d) 2/11 a Which is the nearest to 1/4? (a) -25 (b) -4 (c) -2/43 (d) 3 c What is the nearest to 0.3 in -1, -6, -8/5, 4? -1 Which is the closest to 4/7? (a) -0.9 (b) -40 (c) 2 c Which is the nearest to 0.01? (a) -23 (b) -0.1 (c) -0.3 b What is the closest to -3 in 63, 0, 1/2, 0.4? 0 Which is the nearest to -2? (a) -1/374 (b) -1 (c) 0.1 b What is the closest to 0.3 in 2/5, 0.6, -3? 2/5 What is the nearest to -2/5 in 10, -1, -2? -1 What is the nearest to -2 in -5, -18/11, -12? -18/11 Which is the nearest to 1/3? (a) -4 (b) 3 (c) -16 b What is the nearest to -1 in 0.4, -5, 1/6, 8? 1/6 What is the nearest to -6/5 in 5/4, 4, 0.1, -0.5? -0.5 Which is the nearest to -1? (a) -0.06 (b) -5 (c) -1.4 c What is the nearest to -2 in 5, 1/15, 0.1? 1/15 What is the nearest to -2 in -9, 2, -2/13? -2/13 What is the nearest to 0 in -0.101, 3, 0.1? 0.1 What is the closest to 42 in 7, -4/5, -0.1, 2/3? 7 Which is the nearest to 1? (a) 0.5 (b) -5 (c) -2/23 (d) -3 a What is the nearest to -8 in -0.3, -1, 5? -1 What is the closest to 32 in 0.4, 1/3, 1/7, 1? 1 Which is the nearest to -2? (a) 4 (b) 5 (c) -1/6 (d) -0.3 d Which is the nearest to -2? (a) 0 (b) -4/5 (c) -1 (d) -1.1 d What is the nearest to -0.1 in -5.9, 0.3, 3/7? 0.3 What is the nearest to 0.2 in 4, 0.1, 0.044, -1? 0.1 Which is the closest to 1? (a) 0.4 (b) 1 (c) 61/2 b Which is the closest to 0? (a) -1/4 (b) -2 (c) 7 (d) -10 a What is the closest to 0.1 in -16, -0.2, -3? -0.2 Which is the nearest to 0.1? (a) -4 (b) 24 (c) 0.1 c What is the closest to -1 in 0.1, 8, 11.7? 0.1 Which is the closest to -2? (a) -3 (b) 4 (c) 69 a Which is the closest to 0.1? (a) -3/5 (b) -4 (c) -7.2 (d) -16 a What is the nearest to 1 in -2/217, -2, 6/7? 6/7 Which is the closest to 0.03? (a) -1 (b) -1/9 (c) -0.04 c What is the closest to 15 in -1, 40, -0.3? -0.3 What is the nearest to -0.1 in -0.2, -36, 3/5? -0.2 What is the nearest to 2 in 0.5, 4, 1, 0.2? 1 What is the closest to 2/7 in 32, -3/5, 4, 15? -3/5 Which is the closest to 58? (a) -3/5 (b) -5 (c) 2/9 (d) 0.13 c Which is the nearest to 6/19? (a) -5 (b) -3 (c) 9 b Which is the closest to -1? (a) -0.02 (b) -2/19 (c) -2 b What is the nearest to -0.4 in -0.8, -1/7, -2/9, -2? -2/9 Which is the nearest to -1/100? (a) -5/4 (b) -0.5 (c) 2 b What is the nearest to -0.11 in -0.5, -2/9, -6? -2/9 Which is the closest to -3? (a) -1/11 (b) -16 (c) -3 (d) -0.2 c What is the closest to -2 in 3, -0.2, 1/2, -4? -0.2 What is the closest to -0.1 in 3, 2, 4, 0.9? 0.9 What is the nearest to -0.08 in -2, 71, -0	{ "pile_set_name": "DM Mathematics" }
2? 18 Calculate the remainder when 621514 is divided by 302. 300 Calculate the remainder when 9359 is divided by 124. 59 What is the remainder when 2531 is divided by 43? 37 What is the remainder when 5811 is divided by 1404? 195 Calculate the remainder when 73 is divided by 20. 13 What is the remainder when 14766 is divided by 124? 10 Calculate the remainder when 47722 is divided by 80. 42 Calculate the remainder when 178686 is divided by 23. 22 What is the remainder when 109044 is divided by 252? 180 What is the remainder when 4821 is divided by 48? 21 What is the remainder when 19144 is divided by 3815? 69 What is the remainder when 1583674 is divided by 18? 16 Calculate the remainder when 223477 is divided by 14. 9 Calculate the remainder when 182385 is divided by 24. 9 What is the remainder when 675 is divided by 267? 141 What is the remainder when 1508 is divided by 119? 80 What is the remainder when 294 is divided by 181? 113 What is the remainder when 43848 is divided by 86? 74 Calculate the remainder when 2999 is divided by 20. 19 Calculate the remainder when 163875 is divided by 5284. 71 What is the remainder when 6914 is divided by 401? 97 Calculate the remainder when 8240 is divided by 1719. 1364 Calculate the remainder when 104311 is divided by 34769. 4 Calculate the remainder when 2570 is divided by 1835. 735 Calculate the remainder when 1253951 is divided by 18. 17 Calculate the remainder when 122854 is divided by 24570. 4 What is the remainder when 19489 is divided by 342? 337 What is the remainder when 12820 is divided by 986? 2 What is the remainder when 116384 is divided by 38752? 128 Calculate the remainder when 1677127 is divided by 1261. 1258 Calculate the remainder when 64221 is divided by 238. 199 What is the remainder when 4006 is divided by 209? 35 What is the remainder when 95702 is divided by 229? 209 Calculate the remainder when 133887 is divided by 125. 12 What is the remainder when 51013 is divided by 7? 4 What is the remainder when 24010 is divided by 772? 78 Calculate the remainder when 42140 is divided by 19. 17 What is the remainder when 292085 is divided by 54? 53 What is the remainder when 14309 is divided by 1562? 251 What is the remainder when 22421 is divided by 65? 61 What is the remainder when 3634 is divided by 857? 206 What is the remainder when 48810 is divided by 48? 42 What is the remainder when 22649 is divided by 77? 11 Calculate the remainder when 5264 is divided by 2631. 2 What is the remainder when 1147 is divided by 73? 52 Calculate the remainder when 18670 is divided by 48. 46 Calculate the remainder when 3919 is divided by 100. 19 What is the remainder when 8129 is divided by 80? 49 Calculate the remainder when 5981 is divided by 153. 14 Calculate the remainder when 20515 is divided by 20407. 108 What is the remainder when 13683 is divided by 111? 30 What is the remainder when 56787 is divided by 61? 57 Calculate the remainder when 21163 is divided by 19. 16 Calculate the remainder when 59616 is divided by 445. 431 What is the remainder when 231528 is divided by 845? 843 What is the remainder when 353854 is divided by 85? 84 What is the remainder when 39903 is divided by 9972? 15 Calculate the remainder when 1776 is divided by 28. 12 What is the remainder when 754 is divided by 207? 133 Calculate the remainder when 13066 is divided by 37. 5 Calculate the remainder when 220793 is divided by 460. 453 Calculate the remainder when 31053 is divided by 17. 11 What is the remainder when 357382 is divided by 754? 740 What is the remainder when 817 is divided by 679? 138 What is the remainder when 6898 is divided by 12? 10 Calculate the remainder when 195838 is divided by 204. 202 What is the remainder when 17234 is divided by 1736? 1610 What is the remainder when 21307 is divided by 234? 13 What is the remainder when 837 is divided by 265? 42 What is the remainder when 4535 is divided by 73? 9 What is the remainder when 53332 is divided by 133? 132 Calculate the remainder when 593 is divided by 52. 21 Calculate the remainder when 5032 is divided by 597. 256 Calculate the remainder when 885 is divided by 148. 145 What is the remainder when 965280 is divided by 557? 556 What is the remainder when 50465 is divided by 16800? 65 What is the remainder when 5142 is divided by 1697? 51 What is the remainder when 47644 is divided by 1061? 960 What is the remainder when 1447 is divided by 600? 247 Calculate the remainder when 9969 is divided by 687. 351 What is the remainder when 126012 is divided by 32? 28 What is the remainder when 15149 is divided by 28? 1 Calculate the remainder when 246729 is divided by 103. 44 Calculate the remainder when 244576 is divided by 81515. 31 What is the remainder when 66573 is divided by 152? 149 What is the remainder when 76285 is divided by 19063? 33 What is the remainder when 10830 is divided by 310? 290 Calculate the remainder when 12988 is divided by 380. 68 Calculate the remainder when 864385 is divided by 30. 25 Calculate the remainder when 1159 is divided by 235. 219 What is the remainder when 459 is divided by 67? 57 Calculate the remainder when 1999147 is divided by 10. 7 Calculate the remainder when 3815 is divided by 3808. 7 What is the remainder when 43817 is divided by 7300? 17 Calculate the remainder when 34584 is divided by 30. 24 What is the remainder when 18010 is divided by 6002? 4 Calculate the remainder when 7502 is divided by 7387. 115 What is the remainder when 5893 is divided by 121? 85 What is the remainder when 617 is divided by 88? 1 Calculate the remainder when 4533 is divided by 76. 49 Calculate the remainder when 59055 is divided by 133. 3 What is the remainder when 759 is divided by 259? 241 Calculate the remainder when 1319 is divided by 1273. 46 Calculate the remainder when 242364 is divided by 18. 12 What is the remainder when 4506503 is divided by 263? 261 What is the remainder when 1653 is divided by 320? 53 Calculate the remainder when 658 is divided by 93. 7 What is the remainder when 7332 is divided by 7317? 15 Calculate the remainder when 53087 is divided by 13270. 7 Calculate the remainder when 136413 is divided by 56. 53 What is the remainder when 8158 is divided by 84? 10 What is the remainder when 223460 is divided by 44? 28 What is the remainder when 3387 is divided by 264? 219 Calculate the remainder when 207 is divided by 138. 69 Calculate the remainder when 25027 is divided by 455. 2 What is the remainder when 54189 is divided by 135? 54 What is the remainder when 23434 is divided by 2111? 213 What is the remainder when 32159 is divided by 59? 4 What is the remainder when 3814 is divided by 1178? 280 Calculate the remainder when 555 is divided by 1. 0 Calculate the remainder when 32257 is divided by 381. 253 What is the remainder when 7233 is divided by 522? 447 Calculate the remainder when 37733 is divided by 503. 8 What is the remainder when 234086 is divided by 405? 401 What is the remainder when 4116 is divided by 17? 2 Calculate the remainder when 402 is divided by 234. 168 What is the remainder when 24137 is divided by 239? 237 Calculate the remainder when 145357 is divided by 184. 181 What is the remainder when 3146 is divided by 3046? 100 Calculate the remainder when 7581 is divided by 217. 203 What is the remainder when 30238 is divided by 14962? 314 Calculate the remainder when 6106 is divided by 134. 76 Calculate the remainder when 1521 is divided by 72. 9 What is the remainder when 897597 is divided by 136? 133 Calculate the remainder when 4787 is divided by 4777. 10 What is the remainder when 130718 is divided by 43? 41 Calculate the remainder when 6168 is divided by 199. 198 Calculate the remainder when 33899 is divided by 8471. 15 What is the remainder when 331806 is divided by 18? 12 Calculate the remainder when 728 is divided by 152. 120 What is the remainder when 571490 is divided by 1143? 1133 What is the remainder when 1397 is divided by 23? 17 Calculate the remainder when 16303 is divided by 1652. 1435 What is the remainder when 8465 is divided by 11? 6 Calculate the remainder when 270482 is divided by 1288. 2 What is the remainder when 8764 is divided by 162? 16 What is the remainder when 193439 is d	{ "pile_set_name": "DM Mathematics" }
9)f)/f)32(f/f*(-6)f)/fff(-3/4) assuming f is positive. f(517/36) Simplify (j/(jj(jjjjj*(1/4))/jj)j(-2))(-3/25) assuming j is positive. j(87/100) Simplify (bbb(-11))/b(2/17) assuming b is positive. b(-155/17) Simplify ((y(2/5)yyyy)/(y/y4))/(y(-1/4)/(yy(-4)/y)) assuming y is positive. y(73/20) Simplify ((m(1/12)/m)15)(-22) assuming m is positive. m(605/2) Simplify v/(v*(2/3)/v)vv(-7)v(v(v/v(1/4))/v)30 assuming v is positive. v(113/6) Simplify (f12f)(11/2) assuming f is positive. f(143/2) Simplify (m(1/3))(-2/37)/(m(-4)/m(m/(m/m7))/m) assuming m is positive. m(-113/111) Simplify b(bb/b*(-18))/bb(2/17) assuming b is positive. b(342/17) Simplify s(8/7)/(s(-22)/sss) assuming s is positive. s(155/7) Simplify ((d/(d/d(-4/3)))/d)/(d(-8)/d) assuming d is positive. d(20/3) Simplify (p*(-1/5)/(p/((ppp/p(-8))/p)))/((pp*(-3/2))/(p(p(-1)/p)/p)) assuming p is positive. p(73/10) Simplify (m12)(-2/83) assuming m is positive. m(-24/83) Simplify ((w(2/31)w)/w7)/((w/(w/w10))/(www(3/13))) assuming w is positive. w(-5523/403) Simplify ((c(-2/5))(4/39))(-6/11) assuming c is positive. c(16/715) Simplify d8d*1d*(-1)/(dd/(d*(2/5)ddd)) assuming d is positive. d(47/5) Simplify (j/j(1/8))26 assuming j is positive. j(91/4) Simplify ((kk/(k8k))/k(4/9))/(k2)(-3/2) assuming k is positive. k(-40/9) Simplify (g/(gg(-3/10)))/(g/((g(-1/25)/g)/g)) assuming g is positive. g(-137/50) Simplify (a(-26))(2/81) assuming a is positive. a(-52/81) Simplify v(-2/5)v/v*(-4)v/(v*5/v)vvvv/v(-7/3)vv assuming v is positive. v(149/15) Simplify ((c/(((c9/c)/ccc)/c))/(c/((c(2/17)/c)/cc)))/(((cc(1/6))/c)/(cc/(c*(-3/14)/cc))) assuming c is positive. c(-2440/357) Simplify f2/(ffff(ff(-5))/fff)(fff/(f*(-1)/f)f)31 assuming f is positive. f187 Simplify (p*0p6)(-1/31) assuming p is positive. p(-6/31) Simplify b(-11)/b(3/14) assuming b is positive. b(-157/14) Simplify (q*(-1)qq(q/(q/((qqq*(-1/5))/q)))/qqqq)(-3/29) assuming q is positive. q(-57/145) Simplify (j/j(-4/17))(-4/7) assuming j is positive. j*(-12/17) Simplify (uu/(u(-2/5)/u))(1/4)(u(-2/9)uuu)(-1/76) assuming u is positive. u(1391/1710) Simplify (h5)43 assuming h is positive. h*215 Simplify (m/(m/(m/(mm*(-2/5)))m))/(m/((m(mm*(-1)/m)/mm)/m)) assuming m is positive. m(-13/5) Simplify ((z/(z(1/10)z))/zzz(-2/7)/z)45 assuming z is positive. z(-873/14) Simplify (hh/h(-1))(-29)/(h/(hh(-8/7))h/(hh/(h(h*(-2/3)/hh)/h))) assuming h is positive. h(-1816/21) Simplify (o(-2/5)o(-3/4))(-42) assuming o is positive. o(483/10) Simplify k1/kk*(-3)k assuming k is positive. k*(-2) Simplify ((uu/(u/u*1)u)/u)*(-21)(u*4u)/(u/(u/u*(2/11)u)) assuming u is positive. u(-398/11) Simplify (y/(y1/y))42 assuming y is positive. y42 Simplify ((bbb(-2/39))/b)/b(-4/3) assuming b is positive. b(89/39) Simplify (a(-2/5)a6/aa)(6/11) assuming a is positive. a(168/55) Simplify d*(-17/5)dd(-8/9)d assuming d is positive. d*(-103/45) Simplify (((t/(tt*11))/t)/tt17)(16/3) assuming t is positive. t*(64/3) Simplify hh/(h*(-2/117)/h)h(-1) assuming h is positive. h(236/117) Simplify (j(8/7))(-8/19) assuming j is positive. j(-64/133) Simplify (f/f30)/ffff(-7/4)/ff assuming f is positive. f(-119/4) Simplify l(4/9)/((ll(-4)/ll)/l) assuming l is positive. l(40/9) Simplify z(-14/5)/z(z(-1/6)/z)/z assuming z is positive. z(-179/30) Simplify (zz*1/zz)/(zzz/(z*(4/7)z)z)z/(z*(-3)/zz)z/z2 assuming z is positive. z(18/7) Simplify ((a(-2/7))(-5/7))(-7/6) assuming a is positive. a(-5/21) Simplify o(6/5)(o/(oo/o(-5)oo))/oo*(-1/10)o(-6) assuming o is positive. o(-139/10) Simplify (s/s*(-5)s/s(-1/2))(-45) assuming s is positive. s(-675/2) Simplify (m(1/2))(3/13)/(m(-1)/((mmm/(m*(2/3)m))/m)) assuming m is positive. m(113/78) Simplify ((u/(u/(u/(u(-4)/uuu)u)))/((u(-7)/u)/u))(-2) assuming u is positive. u(-28) Simplify (j/j(9/5))/((j/j(-8/5))/j) assuming j is positive. j(-12/5) Simplify y1/y(-11) assuming y is positive. y12 Simplify (f(1/2)/f)(-7/11)(f/(f*1f))4 assuming f is positive. f(-81/22) Simplify (g/g*(-3/8))/gg(-5) assuming g is positive. g(-37/8) Simplify (t0)33/(tttt(1/4)t)(5/6) assuming t is positive. t(-85/24) Simplify (b(-1/4)/b3)/(b*(-3)b*(-2/5)bb) assuming b is positive. b(-37/20) Simplify h(-22)/hhh/h(2/13) assuming h is positive. h(-275/13) Simplify ((((g/(g3g))/g)/g)/((gg(-2/7)g)/g))/((g/(g*(-1)/g))/(gg/(g/g(3/5)))) assuming g is positive. g(-249/35) Simplify (d(1/2)/(d(-5)/dd))(-3/23) assuming d is positive. d(-33/46) Simplify g(3/4)gg/g(-1) assuming g is positive. g(15/4) Simplify (((j/j0)/j)/(jj/(j/(j/j*(-1/6))j)j))/(j(-2/5)j)(2/19) assuming j is positive. j(-1271/570) Simplify ((vv6)/v)(5/3) assuming v is positive. v10 Simplify (u4/u)/(u(9/5)u)(u/u9)/uuu(3/10) assuming u is positive. u(-15/2) Simplify c/(c/c(-6))c/(c*(2/17)cc) assuming c is positive. c(-121/17) Simplify ((q/(q(2/7)qqqqq))/q)*(1/6)(qq(2/7)qq)/(q/(q(-3/7)q)) assuming q is positive. q(83/42) Simplify (((b/b(2/5))/bbbb)(-27))(2/7) assuming b is positive. b(-702/35) Simplify (gg*(1/6)g5)44 assuming g is positive. g*(814/3) Simplify dd((d/(d(-1/22)/d)d)/d)/ddd(d/(d/d(1/17)))/d assuming d is positive. d(1535/374) Simplify ((y/(y(-3/5)y))/(y/(y/y(-5/3))))(3/2) assuming y is positive. y*(17/5) Simplify j/(j/((jj*(2/15))/j))j1/j assuming j is positive. j(2/15) Simplify x(-1/6)/x(-9) assuming x is positive. x(53/6) Simplify (w3w/((w/(ww*(-9)/w)w)/w))/(w*(-2/3)(ww/((w/(w/((w(www*(2/9))/w)/w))w)/w))/w) assuming w is positive. w(-46/9) Simplify ((h10h)/h(-2/21))(2/71) assuming h is positive. h(466/1491) Simplify (k(-1/3)/kk)/(k/k(-4/11)) assuming k is positive. k(-56/33) Simplify p*(-20)/(pp/(p/(p(ppp/(p(-7/5)p))/pp))) assuming p is positive. p(-127/5) Simplify (c/(c/(cc(-9))))(-19/2) assuming c is positive. c*76 Simplify ((kk(-2/3))(-6/7))(8/11) assuming k is positive. k(-16/77) Simplify b*(4/11)((bb(6/11))/b)/b assuming b is positive. b(-1/11) Simplify ((w(2/13)w)/w)(-45) assuming w is positive. w(-90/13) Simplify s*(-16)s(-2/3) assuming s is positive. s(-50/3) Simplify (u*(-2/3)/u((u/(uu(-2/5)))/u)/u)(1/21) assuming u is positive. u(-7/45) Simplify h(-14/5)/h(-21) assuming h is positive. h(91/5) Simplify (j/j(-6/7))/(j/(j/((j(1/4)/j)/jj))j)(jj/((j8/j)/j))/j(-1/10) assuming j is positive. j(-321/140) Simplify w(-12/5)((w/w*(-4/3))/w)/ww assuming w is positive. w(-16/15) Simplify ((s/s0)/(s*(-1/3)/ss))(-20) assuming s is positive. s(-80/3) Simplify (s(s/(ss*(5/2)s))/ss(-7))/((ss(-2/5))/s)40 assuming s is positive. s(11/2) Simplify (z/z2z(2/5))(-3/37) assuming z is positive. z(9/185) Simplify (i(13/3))43 assuming i is positive. i(559/3) Simplify (r/r1)(-17)/(rr/(r/(r/r*(-1))r)rr)(3/41) assuming r is positive. r(-12/41) Simplify (r*(-19/5)/rr*(-5/8)/rr)(-26) assuming r is positive. r(2821/20) Simplify d*(-2/11)/ddd1 assuming d is positive. d(9/11) Simplify ((h0)(-47))30 assuming h is positive. 1 Simplify jj*(-1/20)/jjj(12/5) assuming j is positive. j(67/20) Simplify (o(-1/3))(-39)/(ooo0o)(-28) assuming o is positive. o97 Simplify t*(2/31)(tttttt(-15/11)tttttt)/t assuming t is positive. t(2967/341) Simplify sss/s5s/(s/s*(-8))(s*(-2)/ss)(-4/17) assuming s is positive. s(-162/17) Simplify xx(-4)xx/((x/x(-1/2))/xx)(xx*(2/5)xx)(-1/66) assuming x is positive. x(-421/165) Simplify ((ii*(-16))/((ii/i8)/i))(3/10) assuming i is positive. i(-12/5) Simplify (g/g(-4))/((g*(-38)g)/g*g) assum	{ "pile_set_name": "DM Mathematics" }
Let v(t) = 3t + 4. Calculate 6a(c) - v(c). 3c + 2 Let x(t) = 11t + 5. Let c = 57 - 53. Let i(q) = -5q - 2. Calculate cx(l) + 9i(l). -l + 2 Let c(j) be the third derivative of 1/12j*4 + 0 - 1/2j*3 + 0j + 1/30j5 - 4j*2. Let d(u) = 2u*2 + 2u - 4. Calculate -6c(q) + 5d(q). -2q2 - 2q - 2 Let z(l) = l*3 - 21l*2 + 8l + 6. Let r(n) = -n*2 + n + 1. Calculate -6r(w) + z(w). w*3 - 15w*2 + 2w Let u(a) = -3. Let z(v) = -v + 2. Let r(k) = -4u(k) - 3z(k). Let d(j) = 2j + 5. Give 6d(h) - 5r(h). -3h Let y(r) = -r2 - r. Let l(s) = s3 - 5s2 - s. Let d(k) = 3k*2. Let p be d(1). Suppose p = -2h + h. What is hy(i) + l(i)? i3 - 2i*2 + 2i Let l(v) = -31v2 - 2v + 2. Let u(t) = -2387t2 - 155t + 155. What is 155l(i) - 2u(i)? -31i2 Let w(t) = 3t*3 + 18t - 18. Let r(n) = -2 + 137n - 138n + 2 + 1. Determine -18r(x) - w(x). -3x*3 Let q(y) = -1. Let o(h) = -44h - 3. Give o(m) - 2q(m). -44m - 1 Let s(c) = 6c. Let u(k) = -77k. Give -78s(l) - 6u(l). -6l Let y(v) = 4v3 - v2 - 5. Let r(l) = 2l3 - l2 - 3. Let s(b) = b2 + 6b - 5. Let h be s(-6). Give hr(c) + 3y(c). 2c3 + 2c2 Let u(p) = -p2 + p + 1. Let s(l) be the second derivative of -l*3/3 - 5l*2/2 - l. What is -s(v) - 2u(v)? 2v2 + 3 Let b(h) = -2h + h*2 - 2 - 2h + h. Let m(s) be the second derivative of 0 - 1/2s4 + 11/2s*2 + 8/3s*3 + 2s. Calculate -22b(l) - 4m(l). 2l2 + 2l Let q(b) = 9b - 1. Let t(w) = -13w + 2. Give -7q(c) - 5t(c). 2c - 3 Let m(o) = 3o*2 - 4o - 9. Let k(w) = 7w2 - 9w - 19. Let h(j) = 4k(j) - 9m(j). Let d be (2/3)/(3/9). Let q(u) = 1 + d - 4. What is h(v) + 5q(v)? v2 Let u(w) = 7w + 7. Suppose 3o - 12 - 6 = 0. Let i(r) = 8r + 8. Give oi(j) - 7u(j). -j - 1 Let y(d) = -d3 + d2 + 1. Let i(s) = -2s3 - 8s*2 - 6. Give i(p) + 6y(p). -8p3 - 2p2 Let q(i) = i3 - i*2 + i - 1. Let x(l) = 11l*3 + 5l*2 - 9l - 2. Let y(v) = 2q(v) - x(v). Let k(b) = 5b*3 + 4b*2 - 6b. Calculate -7k(m) - 4y(m). m*3 - 2m Let f(x) = x*3 - 5x*2 - 3. Suppose 0 = -8y + 4y - 16. Let s(z) = z3 - 4z*2 - 2. What is yf(g) + 5s(g)? g3 + 2 Let r(s) = 6s*2 + 5s. Let m = -3 + 5. Let t(v) = -5vm - v2 - 6v - v*2. Suppose h - 2 - 1 = -w, -4w + 24 = -2h. What is wt(f) + 6r(f)? f2 Let v = 6 - 17. Let b(j) = 14j. Let a(n) = n. Let p(c) = -3c. Let l(x) = 2a(x) - p(x). What is vl(s) + 4b(s)? s Let u(d) = -d*2 + 4d + 4. Let h(r) = -3 - r + 23r2 - 2r - 22r2. Calculate 5h(x) + 4u(x). x2 + x + 1 Let h(n) = -5n*2 - n - 2. Let l(t) = 4t*2 + 2t + 2. Calculate 3h(j) + 4l(j). j*2 + 5j + 2 Let q(b) = 8b2 - 1. Let m be q(1). Let k(r) = 7r*2 - 6. Let a(v) = -8v*2 + 7. Give mk(y) + 6a(y). y2 Let p(d) be the first derivative of -4d*2 + 7d + 2. Let q(b) = 15b - 13. Give 11p(o) + 6q(o). 2o - 1 Let h(l) = 4l3 + 2l2 - 2. Let p(y) = y3. Determine h(c) - 6p(c). -2c*3 + 2c*2 - 2 Let p(j) = j + 1. Suppose -g - 5 = -2g. Let b(q) be the second derivative of q*4/12 + 5q*3/6 + 7q*2/2 + 3q - 2. Calculate gp(x) - b(x). -x2 - 2 Let a(u) = -u2 - 2. Let c = 120 - 130. Let w(x) = 4 + 1 + x2 + 2x*2. Calculate ca(s) - 4w(s). -2s*2 Let i(u) be the first derivative of -11u*3 - 21u - 1. Let k(l) = 18l2 - 15l*2 - 11l*2 - 5. Calculate 5i(q) - 21k(q). 3q*2 Let j(g) = 1. Let l(m) = 10m*3 - 10. Give -10j(o) - l(o). -10o3 Let m(k) = -k - 1. Let u(v) = -4v*2 + 3v - 3. Give -m(s) + u(s). -4s2 + 4s - 2 Let u(z) = -6z2 + z + 1. Let r be (-2)/6 - 55/(-3). Let i be ((-20)/3)/(4/r). Let q be 4/6 - i/9. Let b(a) = -a2. Calculate qb(t) - u(t). 2t2 - t - 1 Let o(w) = -4w*3 + 13w*2 + 7w. Let s(g) = 2g3 - 7g*2 - 4g. Calculate -4o(y) - 7s(y). 2y3 - 3y*2 Let s(u) = 6u*2 + 2u - 4. Let v(z) = 6z2 + 3z - 5. Determine 6s(a) - 5v(a). 6a2 - 3a + 1 Let q(h) = 19h + 10. Let m(n) = 56n + 29. What is 6m(y) - 17q(y)? 13y + 4 Let d(w) = -2w*2 - 3w - 7. Suppose c = 3 + 1. Let o(m) = m*2 + 2m + 6. Give co(r) + 3d(r). -2r2 - r + 3 Let f(i) = 154i*2 - 11i + 6. Let h(w) = 51w2 - 4w + 2. Calculate -4f(r) + 11h(r). -55r2 - 2 Let q(b) = 13b2 + 5. Let m(c) = c2 + c + 1. Calculate 5m(o) - q(o). -8o*2 + 5o Let v(d) = 4d3 - 2d*2 - 3d + 2. Let g(s) = -5s3 - 3 + 2s + 4s - 2s + 3s2. Suppose 0 = 32x - 27x - 10. Determine xg(i) + 3v(i). 2i*3 - i Let h(x) = -15x*3 + 9x*2 + 13x + 9. Let b(m) = 7m3 - 4m*2 - 6m - 4. Determine -9b(a) - 4h(a). -3a3 + 2a Let h(t) = t*2 - 2t + 1. Let s be h(2). Suppose -2f - 10 = a, -4a = -5f + 3f. Let b(q) = 0 - q + 0. Let i(g) = -6g. What is fb(j) + si(j)? -2j Suppose 0 = p - 3p + 4. Suppose o + 3y = -4, 5 = -py + y. Let m(i) = -13i*2 - 11i - 15. Let f(j) = -7j2 - 6j - 8. Calculate of(b) - 6m(b). b*2 + 2 Let v(i) = -2i - i - 3i3 + i - 2i*2. Let l(t) = -54 + 3t*2 + 3t + 54 + 4t3. Determine -2l(y) - 3v(y). y3 Suppose -5t = 2x - 31, -5x + 9x = 12. Let d(s) = -7s - 5. Let h(r) = 5r + 6 + 5r - 2r + 0. Let m be (3/(-2))/(2/(-8)). Determine md(i) + th(i). -2i Let p(w) = 2w. Let d(j) be the second derivative of -j3/3 - j2/2 + 7j. Suppose -5i - 4a = 2 + 1, -4i + 3a - 21 = 0. Determine ip(h) - 2d(h). -2h + 2 Let m = -16 - -10. Let y be (6/4)/(m/8). Let c(s) be the second derivative of -5s3/6 + s2/2 - s. Let r(w) = 4w - 1. Give yc(k) - 3r(k). -2k + 1 Let v(a) = 10a2 + 10a - 1. Let q be (-12)/(-42) - 47/(-7). Let m(s) = -3s2 - 3s. Give qm(p) + 2v(p). -p*2 - p - 2 Let l(a) = -a + 1. Let k be (1-5)/(3/(-3)). Let h(t) = 4t + 3t - 1 - kt. Let s = -3 - -5. Give sh(i) + 3l(i). i + 1 Let y(r) = -r + 4. Let q(c) be the third derivative of -c3/6 - 7c2. Let d(a) = a3 - 8a2 + 6a + 3. Let b be d(7). Calculate bq(n) - y(n). n Let h(o) = o3 + o. Let r(i) = 15i*3 - 11i*2 + 15i + 17. Let y(w) = 5h(w) + r(w). Let v(f) = 7f*3 - 4f*2 + 7f + 6. Determine -17v(n) + 6y(n). n*3 + 2n*2 + n Let s(f) = -5f*2 - 3. Let o(w) be the second derivative of -5w*4/4 - 4w*2 + 36w. What is 3o(r) - 8s(r)? -5r2 Let b(h) = -11h - 5. Let y(z) = 33z + 16. Let g(m) = -8b(m) - 3y(m). Let v(q) = 7q + 5. Determine 5g(n) + 8v(n). n Let q(d) = -3d + 6d - 2d2 + 3d*2. Let k(y) = 2y. Let h = 0 + 2. Suppose z - hz = -3. Determine zk(i) - 2q(i). -2i*2 Let f(p) = 17p - 5. Suppose 0w + 2w = 4j + 2, 0 = j - 2w + 8. Let a(t) = 4t - 1. Let c(g) = -g2 + 3g + 1. Let y be c(5). Determine jf(h) + ya(h). -2h - 1 Let b(g) be the third derivative of 7g*4/24 + 5g*3/6 - 4g*2. Let d(l) = -6l - 4. Give 4b(v) + 5d(v). -2v Let o(j) = 7 - j - 3j - 10j - 11j*2 + 7j. Let a(s) = 6s2 + 4s - 4. Give 7a(v) + 4o(v). -2v2 Let q(h) = -13h*2 - 21h - 17. Let r(z) = 3z2 + 5z + 4. What is 2q(v) + 9r(v)? v*2 + 3v + 2 Let z(s) = -2s + 47s*2 + 1 - 49s*2 - 3s*3 + 1. Let c(x) = -25x*3 - 17x*2 - 17x + 17. What is -6c(w) + 51z(w)? -3w3 Let q(r) = 2r*3 + 5r + 2. Let k(w) = 3w3 + 6w + 2. Suppose x + 25 = 4t, -4x - 10 = -4t + 3t. What is tq(h) - 5k(h)? -3h3 + 2 Let v(o) be the second derivative of -o5/20 + o4/4 - o3/2 - 5o. Let j(b) = -2b3 + 5b*2 - 5b. What is -3j(y) + 5v(y)? y*3 Let j(s) = -4s*2 + s - 5. Let q be -5(-2 - -1)-1. Let r(t) = -2t*2 - 7. Let n(a) = -2a*2 - 6. Let c(z) = -5n(z) + 4r(z). Determine qc(d) - 2j(d). -2d*2 - 2d Let a(w) = -w2. Let s(l) = -l3 + l*2 - l. Let k be 2/9 - (-21)/27. Give ka(p) - s(p). p*3 - 2p*2 + p Let w(t) = 4t + 1. Let s = 24 + -26. Let l(f) = 3 + 2 + f*2 + 0 + 21f. Determine sl(c) + 11w(c). -2c2 + 2c + 1 Let g(l) = 0l2 - 6 + 6 - l2 - 1. Let r(x) = x2 - x. Let o(w) = -4w*2 + 4w + 1. Let d(n) = o(n) + 5r(n). What is d(y) + 3g(y)? -2y2 - y - 2 Let h(z) = -10z*2 + 3z - 1. Let m(t) = 11t2 - 4t + 1. Determine 6h(s) + 5m(s). -5s2 - 2s - 1 Let w(v) = 1. Let i(x) be the third derivative of x*4/12 + 7x*3/6 - 8x*2. Give i(b) - 4w(b). 2b + 3 Let i(b) be the first derivative of -11b*4/4 + 4b - 15. Let r(x) = -133x3 + 49. Give 49i(y) - 4r(y). -7y**3 Let	{ "pile_set_name": "DM Mathematics" }
st derivative of u(v) wrt v? -216v2 What is the third derivative of -93a*2 + 343a*2 + 119a*4 - 2a + 6a4 + 62a*4 wrt a? 4488a Find the first derivative of 50088 - 24610 - 24485 + 2267z3 wrt z. 6801z*2 Let r(x) = 466x3 + x2 - 7x + 238. Let w(f) = 4f*3 - f. Let u(n) = r(n) - 8w(n). Find the second derivative of u(s) wrt s. 2604s + 2 Suppose 72 = 4w - w. Let i = -16 + w. Find the second derivative of iu + 12u*5 - 315u*2 + 315u*2 wrt u. 240u*3 Let u(l) be the second derivative of -5531l*5/20 - 517l*2/2 + 4396l. What is the derivative of u(w) wrt w? -16593w2 Let v(f) be the second derivative of f6/6 + 17f*5/20 - 112f3/3 + f2 - 2f - 331. Find the second derivative of v(x) wrt x. 60x*2 + 102x Let p(a) = 62a3 - 170a*2 + 70a - 35. Let z(i) = 76i3 - 171i*2 + 68i - 36. Let u(s) = 6p(s) - 5z(s). What is the second derivative of u(r) wrt r? -48r - 330 Let t(u) be the second derivative of 37u + 0u5 + 0u*3 + 35u*2 + 0u*4 + 11/10u*6 - 2. Differentiate t(a) with respect to a. 132a*3 Let v(a) be the first derivative of -12/5a*5 + 0a*3 + 48a + 1/2a2 + 63 + 0a*4. Differentiate v(w) wrt w. -48w*3 + 1 Suppose 5h = 7h - 24. Let d = 14 - h. What is the third derivative of 128q*d - 57q*2 - 57q*2 - 19q*4 wrt q? -456q Let n = 1 + 0. Let k be n1/((-2)/(-6)). Find the third derivative of 12g*2 + 7g2 - g2 - 19gk wrt g. -114 Let k(u) be the second derivative of 0u*5 - 1/6u*6 + 0u*3 + 320u + 1/6u4 + 0u*7 - 44u*2 + 0 + 1/14u*8. Find the third derivative of k(v) wrt v. 480v*3 - 120v Suppose -6 = -4g + y, 5y - 4 = 3y. Suppose -11f - 440 = -15f. Find the second derivative of 21a*3 - 14a - 4a3 - fa*2 + 110a*g wrt a. 102a Suppose -40k = 24k - 256. Let h(y) be the second derivative of -4y2 + 0y*k + 4y + 0 + 0y3 - 1/4y*5. Find the first derivative of h(f) wrt f. -15f2 Let n(m) be the first derivative of -155 + m2 + 0m5 + 28/3m*3 + 27/2m*4 - 1/3m*6 + 0m. Find the third derivative of n(k) wrt k. -120k2 + 324 Let p(j) be the second derivative of 30 - 2/15j*6 + 0j*3 - 3j + 1/2j4 + 0j5 - j2. Find the third derivative of p(t) wrt t. -96t Find the first derivative of 3676 + 3694 + 3g*4 - 6g*2 - 7387 wrt g. 12g*3 - 12g Let w(u) be the second derivative of 897u8/28 + 10915u*4/12 - 50u + 22. What is the third derivative of w(v) wrt v? 215280v3 Let o(v) = 33158v + 3051. Let z(g) = -8270g - 763. Let y(s) = 2o(s) + 9z(s). Differentiate y(r) wrt r. -8114 Let v(q) = 3q*2 + 2q + 9. Let k be v(-3). Suppose 0 = -s + 6s - k. Find the third derivative of 9a*s + 39a + 10a2 + 40a - 79a wrt a. 1080a*3 Let i = -3 + 23. Let f(b) be the first derivative of 13b*5 - 6b*5 - i - 8b - 10b. What is the derivative of f(l) wrt l? 140l*3 Suppose -2g - r = r + 38, 0 = 4g + 3r + 71. Let i be (-5470)/g - (60/42)/(-5). What is the second derivative of i + 28o2 - 18o - 391 wrt o? 56 Suppose -4a = 17 - 25. Let w(t) = 3t + 14. Let d be w(a). Find the first derivative of dl4 - 4 + 3 - 1 - 9l*4 wrt l. 44l*3 Let v(x) = -77x*2 + 74x - 7. Let k(a) = -233a2 + 221a - 20. Let u be (119/21)/13. Let j(l) = uv(l) - 6k(l). Find the second derivative of j(r) wrt r. 178 Let u(t) = t2 - 21t + 47. Let d be u(19). Suppose 5h = -5, g + 0h + 5h - d = 0. Find the first derivative of 19 - 56 + g - 27n*3 wrt n. -81n*2 Find the third derivative of -2049y*3 - 5529y*3 + 3248y*3 - 2280y*2 - 4302y*3 wrt y. -51792 Let d(h) be the second derivative of 0h*3 + 14/3h*4 + 0h*2 - 1/4h*5 + 2h + 2/5h6 - 51. Find the third derivative of d(y) wrt y. 288y - 30 What is the third derivative of 418f2 + 0f*6 + 387f*2 - 445f*2 + 123f*6 wrt f? 14760f*3 Find the second derivative of -15l2 + l3 - 30l2 + 100 - 310 - 50l*2 + l wrt l. 6l - 190 Let q(v) be the first derivative of -5v7/21 - v4/12 + v3/3 - 44v - 120. Let h(a) be the third derivative of q(a). Differentiate h(l) wrt l. -600l2 Find the third derivative of 792h*3 + 57h*3 + 596h*2 + 279h*3 + 230h*3 + 1086h*2 wrt h. 8148 Let z(c) be the second derivative of -3c*7 + 3c*5/20 - 529c*3/3 + c - 348. Find the second derivative of z(x) wrt x. -2520x*3 + 18x Let j(h) be the second derivative of 15h8/14 + 13h*6/30 - 20h*4/3 + 3h*2/2 - h + 601. What is the third derivative of j(m) wrt m? 7200m*3 + 312m What is the third derivative of -39w + 2321w*3 + 150w - 52w - 1432w*2 - 59w wrt w? 13926 Let c(m) be the third derivative of 305m9/168 + m6/60 - 2947m*5/60 + 5m*2 + 105m. Find the third derivative of c(l) wrt l. 109800l3 + 12 Let a(u) be the third derivative of -u9/252 - 63u6/10 + u5/60 + 13u4/24 + 77u*3/6 - 3330u*2. Find the third derivative of a(v) wrt v. -240v*3 - 4536 Suppose -12 - 5 = -l + 5y, l = -5y - 13. Differentiate w2 + 0w*l + 396 - 22w*3 - 196 - 198 with respect to w. -66w*2 + 2w Let n(q) be the third derivative of -13q6/8 + q5/60 - q4/8 + 30q*3 - 470q*2. Find the second derivative of n(j) wrt j. -1170j + 2 Let o = 38 + -38. Let b be o/((-7)/(-1))2/6. Differentiate 0t - 41 + 38t3 + bt + 25 wrt t. 114t2 What is the second derivative of -62s*2 + 1103s*3 + 61s2 + s2 + 272s3 + 994s wrt s? 8250s Let g(u) be the third derivative of -83u6/120 - u5/3 + 781u4/24 - u3/6 - 4u*2. What is the second derivative of g(c) wrt c? -498c - 40 Let w be 0(60/(-25))/12. Let b(k) be the second derivative of 0k*4 + 0 + 8k + wk3 + 10k*2 + 1/5k*5. Find the first derivative of b(j) wrt j. 12j*2 Suppose w - m - 3 = 0, 6w + 5m = 2w + 30. Suppose wu - 8u = -60. What is the third derivative of 5j2 - 15j*3 + 0j*2 + uj*2 wrt j? -90 What is the third derivative of -63 + 124 + 5u + 2u3 - u2 - 1123u*4 - 1860u*4 wrt u? -71592u + 12 Let q be ((-4)/(-18))/((-10)/(-90)). What is the second derivative of 58 - 47rq - 45r - 29r - 58 wrt r? -94 Let r(m) = -m3 - 5m*2 - 5m - 21. Let v be r(-5). Differentiate -36ov + 5 + 4 - 1 with respect to o. -144o*3 Find the second derivative of 102w*4 - 223w*4 + 108w*4 + 8w*2 + 18w*5 + 1486w + 9w3 - 9w*3 wrt w. 360w*3 - 156w*2 + 16 Let d(c) be the second derivative of 3799c*8/28 - 1051c*4/2 + 994c. What is the third derivative of d(h) wrt h? 911760h3 What is the second derivative of 1224c - 653c + 493c - 10c3 + 4c*2 wrt c? -60c + 8 Let p(y) be the third derivative of -2893y7/105 - y5/30 - 451y*4/24 - 2y*2 + 4659. What is the third derivative of p(z) wrt z? -138864z What is the second derivative of 10 + 221v - 2 + 72v + 175v3 + 4 - 13 wrt v? 1050v Let m(v) be the third derivative of v*8/336 - 223v*7/210 + 3v*6/40 - 4205v*4/12 + 19v*2 - v + 14. Find the second derivative of m(b) wrt b. 20b*3 - 2676b*2 + 54b Let p(b) be the first derivative of -20b - 2/3b*3 + 1/2b*2 + 4. Differentiate p(m) with respect to m. -4m + 1 Let o = 223 + -221. What is the derivative of 3b2 + 4b*2 - 5b2 + 24 - bo + 7b wrt b? 2b + 7 What is the second derivative of 1215p + 1004p*3 - 1705p*3 - 1129p*3 + 129p wrt p? -10980p Suppose 158 = -5i - 2q, 0i + 4q = 2i + 44. Let l = 33 + i. Find the third derivative of 5g3 + 6g*l + 7g*2 - 2g*2 + 4g*3 wrt g. 90 What is the second derivative of 144t*2 - 139t*2 + 23t*5 + 2 + 28t + 8t4 + 1 - 187t - 2 wrt t? 460t3 + 96t*2 + 10 Let p be 3 - -1(-2 + 2). Find the second derivative of 285 - 285 + 7d2 + 5dp - d2 + 93d wrt d. 30d + 12 Let n(s) = -s3 + s2 - 8s. Let k(o) = -4139o*3 - 5o*2 + 40o + 8221. Let q(d) = k(d) + 5n(d). Differentiate q(y) wrt y. -12432y*2 Let o(c) be the second derivative of -72c + 0c5 + 0c*7 + 0 - 5c*4 - 41/28c*8 + 0c*3 + 0c*6 + 0c*2. Find the third derivative of o(r) wrt r. -9840r*3 Find the second derivative of -247m + 446m + 162m + 170m3 + 92m3 - m2 - 3 + 238m wrt m. 1572m - 2 Let i(x) be the third derivative of 715x8/336 + 2x*4/3 + 17x*3/3 + 4x*2 - 8x. Find the second derivative of i(g) wrt g.	{ "pile_set_name": "DM Mathematics" }
re the prime factors of 2959446? 2, 3, 7, 31, 2273 List the prime factors of 758142. 2, 3, 7, 11, 547 What are the prime factors of 1209024? 2, 3, 2099 List the prime factors of 416791. 163, 2557 What are the prime factors of 8742426? 2, 3, 7, 11, 127, 149 What are the prime factors of 115802? 2, 57901 What are the prime factors of 496340? 2, 5, 13, 23, 83 What are the prime factors of 59074? 2, 29537 What are the prime factors of 164213? 7, 23459 What are the prime factors of 2028565? 5, 7, 11, 479 What are the prime factors of 6365578? 2, 41, 149, 521 What are the prime factors of 8009191? 29, 31, 59, 151 List the prime factors of 19023971. 29, 211, 3109 List the prime factors of 891863. 7, 43, 2963 List the prime factors of 884194. 2, 442097 List the prime factors of 634869. 3, 23, 3067 What are the prime factors of 7377207? 3, 2459069 What are the prime factors of 5249555? 5, 389, 2699 List the prime factors of 1080677. 13, 97, 857 What are the prime factors of 360036? 2, 3, 73, 137 List the prime factors of 357743. 191, 1873 List the prime factors of 65074. 2, 32537 What are the prime factors of 1002962? 2, 61, 8221 List the prime factors of 256333. 7, 11, 3329 What are the prime factors of 2360167? 2360167 List the prime factors of 11048826. 2, 3, 29, 63499 What are the prime factors of 1350312? 2, 3, 56263 What are the prime factors of 683373? 3, 19, 631 List the prime factors of 736425. 3, 5, 1091 What are the prime factors of 72187? 37, 1951 What are the prime factors of 1609628? 2, 17, 23671 List the prime factors of 4740331. 17, 278843 What are the prime factors of 5034322? 2, 2517161 List the prime factors of 874337. 874337 List the prime factors of 7086053. 13, 397, 1373 List the prime factors of 4098623. 19, 23, 83, 113 What are the prime factors of 1390061? 43, 32327 List the prime factors of 203063. 7, 29009 What are the prime factors of 2810552? 2, 257, 1367 List the prime factors of 1732298. 2, 43, 20143 List the prime factors of 4219324. 2, 1054831 List the prime factors of 212722. 2, 31, 47, 73 List the prime factors of 3805597. 239, 15923 List the prime factors of 2374596. 2, 3, 7, 349 What are the prime factors of 2624727? 3, 7, 124987 List the prime factors of 77930. 2, 5, 7793 List the prime factors of 1836514. 2, 918257 List the prime factors of 12465656. 2, 7, 222601 What are the prime factors of 382985? 5, 76597 List the prime factors of 13439. 89, 151 List the prime factors of 124913. 23, 5431 What are the prime factors of 404424? 2, 3, 41, 137 List the prime factors of 2621120. 2, 5, 8191 List the prime factors of 223183. 53, 4211 List the prime factors of 2418770. 2, 5, 241877 List the prime factors of 3902930. 2, 5, 277, 1409 List the prime factors of 3191. 3191 List the prime factors of 1703048. 2, 212881 What are the prime factors of 13672? 2, 1709 What are the prime factors of 10198740? 2, 3, 5, 43, 59, 67 What are the prime factors of 530903? 29, 18307 List the prime factors of 1707443. 1707443 What are the prime factors of 1340798? 2, 670399 What are the prime factors of 25198? 2, 43, 293 What are the prime factors of 89912? 2, 11239 What are the prime factors of 47805? 3, 5, 3187 List the prime factors of 269993. 109, 2477 What are the prime factors of 2121359? 23, 92233 What are the prime factors of 5944242? 2, 3, 990707 List the prime factors of 506581. 587, 863 What are the prime factors of 619041? 3, 206347 What are the prime factors of 1267396? 2, 13, 24373 List the prime factors of 1389919. 1389919 What are the prime factors of 316460? 2, 5, 15823 What are the prime factors of 4291601? 59, 72739 List the prime factors of 1109782. 2, 554891 List the prime factors of 173045. 5, 53, 653 What are the prime factors of 42174236? 2, 13, 29, 27967 List the prime factors of 339399. 3, 43, 877 What are the prime factors of 559772? 2, 139943 List the prime factors of 19685613. 3, 6561871 List the prime factors of 2225819. 2225819 What are the prime factors of 928062? 2, 3, 47, 1097 List the prime factors of 602680. 2, 5, 13, 19, 61 List the prime factors of 121700. 2, 5, 1217 What are the prime factors of 140652? 2, 3, 3907 List the prime factors of 3722127. 3, 1240709 What are the prime factors of 531839? 7, 11, 6907 What are the prime factors of 993485? 5, 23, 53, 163 List the prime factors of 646909. 646909 What are the prime factors of 2151506? 2, 7, 227, 677 List the prime factors of 11057880. 2, 3, 5, 43, 2143 What are the prime factors of 38544? 2, 3, 11, 73 What are the prime factors of 19182186? 2, 3, 1065677 What are the prime factors of 708334? 2, 11, 2927 What are the prime factors of 7629? 3, 2543 List the prime factors of 6222045. 3, 5, 414803 List the prime factors of 13750992. 2, 3, 139, 229 What are the prime factors of 2249546? 2, 13, 31, 2791 List the prime factors of 12514422. 2, 3, 2085737 List the prime factors of 2230856. 2, 431, 647 What are the prime factors of 1026377? 11, 93307 What are the prime factors of 9613555? 5, 7, 39239 List the prime factors of 1080687. 3, 360229 List the prime factors of 1505418. 2, 3, 17, 14759 List the prime factors of 4184960. 2, 5, 13, 503 What are the prime factors of 21832? 2, 2729 List the prime factors of 913076. 2, 67, 3407 What are the prime factors of 110726? 2, 7, 11, 719 What are the prime factors of 1685114? 2, 71, 11867 What are the prime factors of 197737? 79, 2503 What are the prime factors of 17812? 2, 61, 73 What are the prime factors of 739930? 2, 5, 61, 1213 What are the prime factors of 1953204? 2, 3, 11, 14797 List the prime factors of 56590. 2, 5, 5659 What are the prime factors of 2455017? 3, 818339 List the prime factors of 730666. 2, 365333 What are the prime factors of 59256? 2, 3, 823 List the prime factors of 4374035. 5, 874807 What are the prime factors of 728113? 728113 List the prime factors of 41615. 5, 7, 29, 41 What are the prime factors of 139200? 2, 3, 5, 29 List the prime factors of 443546. 2, 221773 List the prime factors of 7140516. 2, 3, 595043 List the prime factors of 15834791. 7, 89, 3631 What are the prime factors of 44014? 2, 59, 373 List the prime factors of 5865541. 11, 31, 103, 167 List the prime factors of 2140969. 2140969 List the prime factors of 7675. 5, 307 What are the prime factors of 62072? 2, 7759 What are the prime factors of 8389? 8389 List the prime factors of 338363. 563, 601 List the prime factors of 168276. 2, 3, 37, 379 List the prime factors of 620672. 2, 13, 373 What are the prime factors of 5421781? 101, 53681 What are the prime factors of 481448? 2, 11, 5471 List the prime factors of 1236575. 5, 49463 List the prime factors of 2357054. 2, 7, 31, 5431 List the prime factors of 121703. 17, 7159 What are the prime factors of 545921? 17, 1889 List the prime factors of 8546567. 467, 18301 List the prime factors of 737226. 2, 3, 7, 5851 What are the prime factors of 24201140? 2, 5, 61, 83, 239 List the prime factors of 2804137. 7, 23, 17417 List the prime factors of 10291905. 3, 5, 13, 73, 241 What are the prime factors of 974481? 3, 137, 2371 What are the prime factors of 309917? 79, 3923 List the prime factors of 2352432. 2, 3, 49009 List the prime factors of 2880710. 2, 5, 7, 5879 List the prime factors of 18394560. 2, 3, 5, 2129 What are the prime factors of 6439227? 3, 31, 69239 List the prime factors of 161372. 2, 40343 What are the prime factors of 183858? 2, 3, 30643 List the prime factors of 54752. 2, 29, 59 List the prime factors of 954653. 7, 136379 List the prime factors of 4966980. 2, 3, 5, 19, 4357 List the prime factors of 2661767. 19, 23, 6091 List the prime factors of 551455. 5, 110291 List the prime factors of 2085471. 3, 231719 What are the prime factors of 350060? 2, 5, 23, 761 List the prime factors of 978223. 978223 List the prime factors of 603096. 2, 3, 13, 1933 What are the prime factors of 206924? 2, 17, 179 What are the prime factors of 50912? 2, 37, 43 List the prime factors of 4103225. 5, 7, 23447 What are the prime factors of 660580? 2, 5, 33029 What are the prime factors of 339133? 17, 19949 List the prime factors of 290400. 2, 3, 5, 11 What are the prime factors of 304514? 2, 7, 21751 What are the prime factors of 6541774? 2, 683, 4789 What are the prime facto	{ "pile_set_name": "DM Mathematics" }
nearest 10000. -7960000 What is 55199.1 rounded to the nearest one thousand? 55000 Round -0.007751653 to 4 dps. -0.0078 Round -0.00007648423 to six decimal places. -0.000076 What is 0.000014182421 rounded to 7 dps? 0.0000142 Round -0.0003965578 to five dps. -0.0004 What is -2.86278 rounded to two dps? -2.86 Round 3.33677 to 0 dps. 3 Round -12371970 to the nearest one hundred thousand. -12400000 Round -1237.815 to the nearest one hundred. -1200 What is 0.1889488 rounded to 2 dps? 0.19 What is 0.252611 rounded to 3 decimal places? 0.253 Round -0.4273507 to four decimal places. -0.4274 What is -0.00016526 rounded to six decimal places? -0.000165 What is 1.8955 rounded to 1 dp? 1.9 Round -848.76606 to 0 dps. -849 What is 0.000966582 rounded to six dps? 0.000967 Round -24777.4 to the nearest ten. -24780 Round 0.0758959 to 4 decimal places. 0.0759 What is 1.002615 rounded to 1 dp? 1 What is 0.000061262 rounded to five dps? 0.00006 What is 56905.1 rounded to the nearest ten thousand? 60000 Round -0.118971373 to 4 dps. -0.119 What is 192.226 rounded to the nearest 10? 190 Round 367324000 to the nearest 1000000. 367000000 Round 1284933200 to the nearest one million. 1285000000 Round 744.6 to the nearest 10000. 0 What is 35227200 rounded to the nearest 100000? 35200000 What is 0.002074102 rounded to five dps? 0.00207 What is 0.00017106045 rounded to six decimal places? 0.000171 Round 0.00009885623 to seven dps. 0.0000989 What is -19.450099 rounded to the nearest integer? -19 What is 4.050908 rounded to one dp? 4.1 What is 111.64354 rounded to the nearest 10? 110 What is -333.3448 rounded to the nearest 100? -300 What is -37046320 rounded to the nearest one million? -37000000 What is 616002.27 rounded to the nearest one hundred? 616000 What is -0.00001940306 rounded to five dps? -0.00002 Round -0.16454327 to four dps. -0.1645 What is -32758.87 rounded to the nearest one hundred? -32800 What is 131003 rounded to the nearest one thousand? 131000 What is 4893.672 rounded to the nearest 1000? 5000 What is 6555.91 rounded to the nearest 100? 6600 Round -0.00001199834 to six decimal places. -0.000012 What is 71200 rounded to the nearest one hundred thousand? 100000 What is 2593694000 rounded to the nearest 1000000? 2594000000 What is -1667586400 rounded to the nearest 1000000? -1668000000 Round 7962350 to the nearest one hundred thousand. 8000000 Round -381.187 to the nearest 1000. 0 What is 3411145 rounded to the nearest one million? 3000000 Round -0.00000044113 to 7 decimal places. -0.0000004 Round 387605.47 to the nearest one hundred. 387600 What is 0.04237306 rounded to 4 decimal places? 0.0424 What is 650657.5 rounded to the nearest ten thousand? 650000 Round -0.27179 to 3 dps. -0.272 Round 1765190 to the nearest 10000. 1770000 What is -265447.35 rounded to the nearest 10000? -270000 What is 27403.62 rounded to the nearest one hundred? 27400 What is -244419600 rounded to the nearest one million? -244000000 Round -107.3164 to the nearest ten. -110 Round 2.136509 to zero decimal places. 2 Round -2330124 to the nearest 100000. -2300000 What is 1478.77 rounded to the nearest 10? 1480 Round 4.7833 to the nearest integer. 5 What is -68.079387 rounded to one decimal place? -68.1 Round -0.0000377898 to 6 dps. -0.000038 What is -3209.56 rounded to the nearest one thousand? -3000 Round 551.19792 to one decimal place. 551.2 Round -0.0000611533 to 6 decimal places. -0.000061 Round 0.001197832 to six dps. 0.001198 Round 6272.229 to the nearest ten. 6270 What is -4021.291 rounded to the nearest 100? -4000 What is -174.3496 rounded to 0 decimal places? -174 Round -0.000005018413 to seven decimal places. -0.000005 What is 10620340 rounded to the nearest 100000? 10600000 What is -157001 rounded to the nearest 100? -157000 Round 453340500 to the nearest 1000000. 453000000 Round 814.1991 to 0 dps. 814 What is -7.21992 rounded to 2 decimal places? -7.22 Round 3492930 to the nearest one million. 3000000 Round -0.000012806 to seven dps. -0.0000128 What is 0.00000164016 rounded to seven dps? 0.0000016 What is -17.40117 rounded to zero dps? -17 What is -7122140 rounded to the nearest 1000000? -7000000 Round 0.1174031 to three decimal places. 0.117 What is -257.17692 rounded to 1 decimal place? -257.2 Round 0.0000015695 to 7 decimal places. 0.0000016 What is -0.00004439904 rounded to 6 decimal places? -0.000044 What is 33.42603 rounded to 2 decimal places? 33.43 What is -51.642 rounded to 1 dp? -51.6 What is 5.33431 rounded to 2 dps? 5.33 Round 218140.39 to the nearest 100. 218100 What is 0.08690104 rounded to two dps? 0.09 Round 0.006365498 to three dps. 0.006 What is -3.0019 rounded to 2 dps? -3 What is 7.95652 rounded to 0 decimal places? 8 Round 159275.14 to the nearest one hundred. 159300 Round -13261620 to the nearest one hundred thousand. -13300000 Round 0.00030834087 to 7 dps. 0.0003083 What is -376997000 rounded to the nearest one hundred thousand? -377000000 What is 0.000966157 rounded to three decimal places? 0.001 Round 234585000 to the nearest 1000000. 235000000 Round 0.000002171311 to seven dps. 0.0000022 Round -0.0000007983791 to seven dps. -0.0000008 What is -611495.89 rounded to the nearest 10000? -610000 What is -0.19486766 rounded to 5 decimal places? -0.19487 What is 0.0716969 rounded to 3 dps? 0.072 Round -1293.6237 to the nearest 10. -1290 What is -0.09487557 rounded to five decimal places? -0.09488 Round 274.989 to one dp. 275 Round 2118636 to the nearest 100000. 2100000 What is -414.2163 rounded to 1 dp? -414.2 What is -0.0134937 rounded to four decimal places? -0.0135 What is 0.7591625 rounded to 4 decimal places? 0.7592 What is -0.000029758632 rounded to five dps? -0.00003 What is -0.00002269201 rounded to 6 dps? -0.000023 What is -2524040 rounded to the nearest ten thousand? -2520000 What is -6.48851 rounded to the nearest integer? -6 Round 0.0027892994 to 5 dps. 0.00279 What is 0.000005713689 rounded to 6 dps? 0.000006 What is 7189104 rounded to the nearest 100000? 7200000 Round 0.28816 to two decimal places. 0.29 What is -117550101 rounded to the nearest 1000000? -118000000 Round -0.449689 to 3 decimal places. -0.45 What is 0.0000014755 rounded to seven decimal places? 0.0000015 What is 0.5493223 rounded to one dp? 0.5 Round 0.00000362162 to 6 dps. 0.000004 What is -0.4080958 rounded to three decimal places? -0.408 Round -7573.552 to the nearest 10. -7570 Round 20501.9 to the nearest ten. 20500 What is -0.00031252528 rounded to seven decimal places? -0.0003125 What is -87.619 rounded to the nearest integer? -88 Round 121551.318 to the nearest 10. 121550 What is -0.082569161 rounded to 2 dps? -0.08 Round 12885210 to the nearest one million. 13000000 What is -69.64184 rounded to one dp? -69.6 Round 17772190 to the nearest one hundred thousand. 17800000 What is -130.023 rounded to the nearest integer? -130 What is -120685.2 rounded to the nearest one hundred? -120700 What is 0.00053038123 rounded to 5 dps? 0.00053 What is -0.00021508693 rounded to six dps? -0.000215 What is 2.36513 rounded to 1 decimal place? 2.4 Round -63137.6 to the nearest one thousand. -63000 What is -3.2507658 rounded to three decimal places? -3.251 Round 0.198357 to 2 dps. 0.2 What is -0.592582 rounded to 1 dp? -0.6 What is 0.0000005966517 rounded to seven dps? 0.0000006 What is 0.0000011884004 rounded to six decimal places? 0.000001 Round -0.0004214466 to 4 decimal places. -0.0004 Round -2567.68 to the nearest 1000. -3000 Round -83045 to the nearest 1000. -83000 What is 195002970 rounded to the nearest 100000? 195000000 What is 0.0507805 rounded to four decimal places? 0.0508 What is 0.1109171 rounded to 4 dps? 0.1109 What is -0.000040279564 rounded to 6 decimal places? -0.00004 Round -0.997222 to 2 decimal places. -1 What is 0.0006407173 rounded to 6 decimal places? 0.000641 Round -14337.596 to the nearest 100. -14300 Round 10.51975 to the nearest ten. 10 What is 240528 rounded to the nearest one hundred? 240500 Round -1.014188 to two dps. -1.01 What is -0.2742629 rounded to three decimal places? -0.274 Round -437268.1 to the nearest ten thousand. -440000 Round 1832320 to the nearest 10000. 1830000 Round 13505823 to the nearest one hundred thousand. 13500000 Round -0.0000003	{ "pile_set_name": "DM Mathematics" }
-4x - 5u. Let z(k) = 4 - 2k + 4k + 4k - 3k*2 + 4k2. Determine z(x). -1 Let f(q) = -q3 - 4q2. Let k(h) = h2. Let d(a) = -f(a) - 3k(a). Let w(g) = -2g - 16. Let b be w(-8). Determine d(b). 0 Let s(u) = -u3 - 3u*2 + u - 6. Let l be s(-3). Let k(o) = 3o + 11. Give k(l). -16 Let q(g) = g*3 + 5g2 - 4. Let p = 12 - 17. Calculate q(p). -4 Let r(h) = -h3 + 3h2 + h - 4. Let f be ((-8)/(-6))/((-40)/(-90)). Calculate r(f). -1 Let u be 32/6 - (26/6 - 5). Let x(s) be the first derivative of -s4/4 + 2s3 - s2/2 - 7s - 2. Determine x(u). -13 Let l(m) = -m - 9. Suppose -i = 3i. Suppose i = 8d - 3d + 20. Give l(d). -5 Let k be 1(-1 - -2 - -1). Let o(s) = -3s*2 - 4 - s + 7s + 4sk. Give o(-6). -4 Suppose -3v + 7 = -11. Let p(l) = l*2 + 3l - 3. Let z(u) = u*2 + 4u - 4. Let s(r) = vp(r) - 5z(r). Determine s(2). 2 Let b = -4 - -6. Let o(w) be the second derivative of -w5/20 + w4/12 + w*2/2 + 10w. Determine o(b). -3 Let k(j) = -j*2 - j. Let d be -1(0 - 1)4. Suppose -3a + a = d, -2a - 12 = 2i. Let g(l) = -l - 5. Let q be g(i). Give k(q). 0 Let h be ((-2)/4)/(1/(-2)). Let x = 3 + h. Let l(q) = -3 - q*2 + q + 2 + x. Calculate l(-3). -9 Let q(b) = 8b*2 + 8b + 13. Let y(f) = 2f2 + 2f + 3. Let o(u) = 2q(u) - 9y(u). Suppose 0s = -3s - 6. Determine o(s). -5 Suppose 4d + 3 = 4g + 31, -5d - 1 = 4g. Let i(x) = 2x2 + dx - 4 - 2x - 3x*2. Calculate i(0). -4 Let s(a) = -4a + a2 + 6 + 10 + 7 - 28. Give s(4). -5 Let t be -1 - (6 - (3 - 2)). Let u(l) = l2 + 8l + 1. Let g be u(t). Let n = g - -7. Let i(j) = j2 + 3j + 5. Give i(n). 9 Let l(d) be the second derivative of -d4/12 + d3 - d*2 - 9d. What is l(5)? 3 Suppose -t - 6 = -3t. Let z(m) = -m + 3. Determine z(t). 0 Let i(n) = 3n*3 - 2n*2 + 2n + 2. Let x(f) = f3 + f2 - f + 1. Let h(l) = i(l) - 2x(l). What is h(3)? 3 Let j(x) = -x2 + x + 1. Let p be j(0). Let z(l) = 2l*2 - 5l + 3. Let w(s) = s*2 + s - 1. Let c(k) = pz(k) - w(k). What is c(4)? -4 Let x(q) = 3q - 3. Let g(u) = -u + 1. Let v(h) = -2g(h) - x(h). Let d = 1 - 0. Suppose -a = -m - 4, -3a + 7 = -m + d. Give v(m). 4 Suppose -5k = 3z - 4z - 11, -2z - 4 = -k. Let u(p) = 2 + 5p - 7p2 + 7p*2 + 0p2 - pk. Give u(6). -4 Let a(p) = -2p + 4. Suppose 56 = 2q + 50. Give a(q). -2 Let a(g) be the second derivative of 0g4 - g + 0 - 1/20g*5 + 1/6g*3 - 3/2g2. Let r(n) be the first derivative of a(n). Give r(-1). -2 Let h(n) = n3 - 5n2 - n + 3. Suppose r - 3f = -f - 3, -2r = 2f - 18. Give h(r). -2 Let o be (4 + -3)(4 + -3). Let q(s) = -6s*2 + 1. What is q(o)? -5 Let y(l) = -1 - 81l*2 - l + 1 + 83l2 - l3. Give y(2). -2 Suppose 4 - 10 = 3f. Let h = -1 + f. Let x(d) = -7d*2 - 6d + 9. Let s(u) = -15u2 - 13u + 19. Let t(v) = 6s(v) - 13x(v). Determine t(h). 6 Let t(q) be the third derivative of 0 - 1/3q4 + q3 + 2q*2 + 1/60q*5 + 0q. Determine t(5). -9 Suppose 5t - 2l - 3 = -8, 0 = -5t - l + 10. Let u(m) = -4m*2 - 2m. Let k(o) = -2o2 - o. Let j(z) = -5k(z) + 3u(z). Determine j(t). -3 Let t = -30 - -27. Let n(p) = p2 - 7p + 6. Let r be n(7). Let v(o) = -2o3 - 1 - 3o*2 + 3o*3 + ro*2. What is v(t)? -1 Let f(n) = 11n + 3. Let h = 91 + -93. Determine f(h). -19 Let f(g) = g*2 - 4g - 7. Let m be (-4 - (-33)/15)/((-3)/10). Give f(m). 5 Suppose -4c = -0c. Let q(z) = -z*2 + 0 + 3 + c - 3z. Give q(-4). -1 Suppose f + 4y = y + 13, -22 = -4f - 2y. Let x(o) = -3o + 3. What is x(f)? -9 Let t(u) = u2 - u - 2. Let z(x) = -x2 - 9x - 8. Let v = 6 - 14. Let b be z(v). Suppose -i + 4i - 6 = b. Determine t(i). 0 Let h(g) be the second derivative of -g5/20 + g4/12 + g*3/6 + 5g*2 - 8g. What is h(0)? 10 Let i(j) = -2j + 4j + 0j + 7 - 10 - 5j2 + j3. Let k = 1 - -4. Determine i(k). 7 Let a(h) = -2h2 - 5h + 3h2 + h2 - 3. Let r be a(4). Let q(y) = -ry + 3y + 0 - y2 - 1. Calculate q(-5). 4 Let g(y) = 5y*2 - 11y + 4. Let a(o) = -o*2 + o. Let h(j) = -4a(j) - g(j). Let p be (-10)/15(-18)/4. Determine h(p). 8 Let a(q) = 75q*3 + 5q*2 - 5q - 16. Let w(g) = 15g3 + g2 - g - 3. Let k(r) = -2a(r) + 11w(r). What is k(-1)? -14 Let j be 26/205. Let t(f) = 5f - 6. Let y(b) = 4b - 6. Let w(c) = 3t(c) - 4y(c). Determine w(j). 3 Let s = 11 - 26. Let m(r) = 21r - 57. Let f(w) = -3w + 8. Let j(t) = sf(t) - 2m(t). Calculate j(5). 9 Let s(k) be the first derivative of -3k*3/2 + 2k - 2. Let j(n) be the first derivative of s(n). Let d be 5/10 - (-6)/(-4). Give j(d). 9 Let o(c) be the third derivative of 1/24c4 + 0c + 2/15c5 - 1/6c*3 + 4c*2 + 0. Calculate o(1). 8 Suppose 10 = -2w - y - 6, -4y + 8 = 0. Let b(p) = -p - 1. Let s(c) = c2 + 3c - 12. Let d(g) = -5b(g) + s(g). What is d(w)? 2 Let d(k) = k3 - 2k*2 + 1. Let y be d(2). Let b be 24/15 - (-4)/10. Let i(f) = -y - f + 0f - bf. Give i(-2). 5 Suppose 3a + 2d - 4d + 28 = 0, d = -2a - 7. Let s(w) = -w3 - 7w*2 - 7w - 4. Calculate s(a). 2 Let b(j) = -4j3 - j + 1. Let h = 8 - 5. Suppose 4v + 2q - hq + 13 = 0, 0 = 4v + 2q + 22. Let c be v/(-18) - (-21)/27. What is b(c)? -4 Let s = 101 + -94. Let x(t) = t - 8. What is x(s)? -1 Let y(a) = a*3 + 6a*2 + 5a + 1. Suppose t - 2 + 27 = -4u, -4u = 5t + 45. Calculate y(u). 1 Suppose 4h - 5a + 7 = 0, 2a - 7a + 15 = 0. Let i(v) = 0v + 2 + 0 - 6v + hv - v*2. Determine i(-5). -3 Let d be ((-1)/2)/(2/(-12)). Let u(h) = 7 + 12 + dh - 17. Give u(2). 8 Suppose -4 = -a - 15. Let w = a + 15. Let g(d) = -d - 1. What is g(w)? -5 Let b be 0/1 + 6/(-1). Let t(r) = r + 4. Let m be t(b). Let l = -3 - m. Let y(i) = -5i2 - 2i - 1. Give y(l). -4 Let i(f) = f*2 - 2f - 1. Let t(z) = z*2 - z. Let q(x) = 6i(x) - 7t(x). What is q(-4)? -2 Let k(x) be the first derivative of -x3/3 + 3x*2 - 3x + 17. What is k(6)? -3 Suppose 4n - 18 = 2. Suppose 0 = -4i + nh + 20, i + 4i = -4h + 25. Let q(u) = u2 - 3u - 2. Determine q(i). 8 Let j(h) = h*2 - 5h + 4. Let b(a) = -a*3 + 9a*2 + a - 5. Let z be b(9). Suppose 0 = -zf + 3p + 15, 4f = 2f - 5p + 1. Determine j(f). -2 Suppose -u - 2u - 3o = 6, 5o = 3u - 2. Let j(v) = -15v3 + 2v2 + v. Calculate j(u). 16 Let y be (-2)/(-4) - 2/(-4). Let a be (-2)/(-6) - y/3. Let m(v) be the second derivative of -v5/20 - v*4/12 + 5v*2/2 + 8v. Calculate m(a). 5 Let w(s) = -26s - 15. Let m(h) be the first derivative of 5h*2/2 + 3h + 4. Let a(q) = 11m(q) + 2w(q). Give a(-3). -6 Let j(i) = i + 1. Suppose 5n = -2p, n - 5p = 6n. What is j(n)? 1 Let f(s) = s*2 - 6s + 3. Let z(c) = c + 9. Let k be z(-4). Calculate f(k). -2 Let c(l) = 5 - 3l + 4l - 6l2 + 7l*2 - 2l. Let w(x) = -x*3 - 4x*2 - 3x + 3. Let s be w(-3). Let n = s - 3. Give c(n). 5 Let n(x) be the second derivative of x4/12 - x3/3 + x*2/2 + 2x. Let u(d) = 5d - 1. Let o be u(1). What is n(o)? 9 Let o(z) = z2 - 1. Let n(s) = -1. Let d(v) = n(v) - 2o(v). Give d(1). -1 Let p(x) be the first derivative of -x*3/3 - 5x*2/2 - 6x + 53. Calculate p(-5). -6 Let r(v) be the second derivative of -5v3/6 + v2 + 4v. What is r(2)? -8 Let i(y) = -4y - 9. Let l(n) = 5n + 9. Let p(j) = -4i(j) - 3l(j). Give p(-9). 0 Let n(k) = -2k - 11. Let r(q) = -4q - 21. Let j(w) = 5n(w) - 3r(w). Calculate j(-6). -4 Let p(n) = -4n - 6 - 3n + n*2 - 3n2 + n2. What is p(-6)? 0 Suppose 0 = -2w - 12. Let f(k) = k3 + 6k*2 + 2k + 9. What is f(w)? -3 Let a be (-3 - 1)/((-22)/55). Let p(d) = d*3 + 2d*2 + 2 + ad - 10d. Calculate p(-2). 2 Let y(u) = -u + 8. Let m(z) = -1. Let k = 3 + 0. Let t(h) = km(h) - y(h). Suppose -5c + 25 = -2v, 2v + 15 = v + 3c. Give t(v). -11 Let z(l) be the third derivative of -l7/840 + l5/30 - 2l2. Let x(t) be the third derivative of z(t). Let y = -63 - -64. Calculate x(y). -6 Let n(r) = -r3 + r2. Let i(m) = -3m*3 - 1 - 2m - m + 0m3 + 2m*2 + 4m*3. Let v(l) = -i(l) - 2n(l). What is v(3)? 1 Let j(w) = 1. Let t(x) = 2x - 7. Let k(l) = 14j(l) + 2t(l). Determine k(2). 8 Suppose k + 16 = 5k. Suppose 3b + 0b + 12 = 0, 0 = -3v - 5b - 14. Let g(j) = j*v + 4j*2 - 6 - 6j*2 + 5j. Give g(k). -2 Let d(p) = 5p - 15. Let i(y) = -3y + 8. Let v(a) = -6*d(a) -	{ "pile_set_name": "DM Mathematics" }
t value in z, 0, -6, -24? z Let i = 8 + -21. Let r = i + 12. Let q be ((-1)/((-28)/(-4)))/((-16)/(-28)). Which is the third smallest value? (a) 9 (b) r (c) q a Let v be ((-8)/(-24)-2)/2. What is the third biggest value in -2/9, -0.4, 1, v, -2.11? v Let j = 372 + -372.5. Which is the third biggest value? (a) -0.2 (b) -2/9 (c) j (d) -3 (e) -0.19 b Let z = -291 + 287. Suppose 5p = -4x - 15, -x + 2p + 18 = -5x. Let r = 1 + -1. What is the third biggest value in x, r, z, 0.03? z Let i = 847.26 - 925.4. Let w = i - 1.86. Let g = w - -79.7. What is the biggest value in -4, -6/7, g, 1.3? 1.3 Let i = 4.599 + -4.599. Which is the third biggest value? (a) -0.15 (b) 70 (c) i a Let g = 296 + -256.2. Let f = -32.8 + g. Which is the second biggest value? (a) 2 (b) f (c) 13 b Let s = -23.1 + 21.1. Let w = -0.786 - -3.786. What is the third smallest value in w, -2/9, 2, s? 2 Let b = -0.08192 + -0.09808. What is the third biggest value in -23, -1/7, b? -23 Let t = 28731.7 - 28732. What is the second smallest value in 1, -2193, t? t Let y = -229/4 - -56. Let v = -12987.1 + 12983.3. What is the third biggest value in y, -0.4, v? v Let q = 0.19 - -0.31. Let z = -1920.5 + 1920. Which is the second smallest value? (a) 1/49 (b) q (c) z a Let f = -2 + 1.8. Let l = -13304 + 13302. Which is the smallest value? (a) 1.3 (b) f (c) l c Let g = -56.7 + 4.7. Let y = 2.5217 + -2.1217. What is the third smallest value in g, 3/5, y, -1/5? y Let y = -291 - -289. Which is the fourth biggest value? (a) -5 (b) y (c) -4 (d) -10.9 (e) 0.3 a Let j = 0.2375 - -8.7625. What is the biggest value in -2/9, 2/3, j? j Let u = 32.1 + -32. Suppose -4n - 2z + 60 + 10 = 0, 0 = -4n + 2z + 58. Let l be (n/160)/((-5)/((-50)/4)). What is the smallest value in l, u, -3? -3 Let w(z) = -2z*3 + 46z*2 + 5z - 44. Let f be w(23). Let u = -353/5 + f. Which is the second biggest value? (a) 2/3 (b) -8 (c) u c Let f = 61.927 - -0.073. Let j = 87 - f. Let c = -3.0197 - -0.0197. What is the third smallest value in j, c, -2? j Let m(g) = 39g + 1045. Let l be m(-23). What is the third biggest value in 5, -0.1, l, -1? -0.1 Let h = 7 - 9. Let u be 4 + h - -1 - (-290)/(-90). What is the third smallest value in 0.5, -1/5, -6, u? -1/5 Let c be -4((-15)/6)/5. Let s(h) = -20h - 1350. Let k be s(-67). Let d = c - k. What is the third biggest value in 0.2, d, 5? 0.2 Let s = -361.5 - 0.5. Let c = 365 + s. What is the third smallest value in -0.2, 2/17, c, -4? 2/17 Let z = -112709/1336 + 675/8. Let d = 0.169 + -103.169. Let l = 102.8 + d. Which is the biggest value? (a) -2/5 (b) l (c) z c Let u(g) = 12g - 30. Let i be u(2). Let j be 2(-4)/i(-17)/68. What is the fourth biggest value in 4, 0.4, 0.03, j? j Let z = 8.6816 + -2.6816. What is the biggest value in z, -7, -20? z Let n = -45.6 + 66. Let r = 987 - 983.6. Let v = n - r. Which is the smallest value? (a) v (b) -0.1 (c) -2/7 c Let l = 26824/40245 + 2/13415. What is the biggest value in l, -47, -5, 0.2? l Let m = 0.52 - 0.22. Let q = 67/3 + -21. Let l = 18364.3 + -18363.8. Which is the second smallest value? (a) 0 (b) m (c) q (d) l b Let u = -23.4 + 23.9. Let o = -33 + 32.6. Which is the second biggest value? (a) 68 (b) u (c) o b Let h = -1.9 - 1.1. Let u = 13137 - 13133. Which is the third biggest value? (a) h (b) -0.1 (c) 1 (d) u b Let f = -0.05872 + 3.05872. What is the second biggest value in -101.5, f, -0.4? -0.4 Let l be (-12 - 376/(-32))-5. Which is the second biggest value? (a) 7/8 (b) 0 (c) l a Let w = -0.025 + -140.975. Let u = 141.2 + w. What is the smallest value in 1, 4, 3, u? u Suppose 0 = 5o + 76 - 1. Let q be (-15)/18 + (25/o)/(-5). Let h = 0 - -1. Which is the second biggest value? (a) h (b) 17 (c) q (d) 0.2 a Let f = 149785/11 - 13617. Let p be (-61)/(1 - 0). What is the smallest value in -2/3, p, f? p Let p = 0.1 + 1.2. Let t = -1 + p. Let o = 359914/3 + -119971. What is the third biggest value in o, 0.04, t, -1? 0.04 Let y = 0.27 + 167.73. Let l = -171.4 + y. Which is the third biggest value? (a) 0.3 (b) l (c) 5 (d) -4 b Let v be (-94)/(-18) - 4/18. Let o = -38472 + 38475. What is the biggest value in -48, v, o? v Let g = 2702 + -2699. Which is the third smallest value? (a) -0.21 (b) g (c) -0.27 (d) -2 a Let l = -2957 + 2945. Which is the third smallest value? (a) -4/5 (b) l (c) -0.3 (d) -0.04 (e) -0.2 c Let d be 1044/54 + -20 + (-2)/(-21). What is the smallest value in -10/33, -2, d, 0? -2 Let w = 6 - 9. Suppose 13k = 15k - 5v + 14, -2v - 2v = -16. Let d = -2 + 1.8. What is the third smallest value in k, w, d, -5? d Let o = -89.9 + 86.23. Let k = 1.33 - o. Let u = -6/5 + 32/35. What is the third biggest value in k, u, 4, 2/3? 2/3 Suppose z + 2s = 6z - 1903, -12 = -2s. Which is the fourth biggest value? (a) -6/11 (b) -2/5 (c) 6/11 (d) z a Let r = 597 - 558.9. Let v = -36.9 + r. Which is the fourth smallest value? (a) v (b) -7 (c) -4 (d) 4 d Let y = -25.474 - -25.514. Let l be (-1)/(-4) - 9/4. Which is the second biggest value? (a) y (b) l (c) -2/3 (d) -1 c Let x = 34 + -35. Let i = -1657.6 - -1658. What is the smallest value in 9, i, x? x Let q = -5 + 5.7. Let p = -738079/9 + 81928. Let l = p - -81. What is the third biggest value in l, 0.1, q? 0.1 Let h = -92 + 89.6. Let t = -1.9 - h. What is the second smallest value in t, -0.2, 0, -4? -0.2 Let r = 6210.9 - 6211. Which is the second biggest value? (a) 2/5 (b) -2.5 (c) r (d) 1 a Suppose 2i = 10i + 680. Let q = -75 - i. Let l be (-10)/(-20) - 7/q. Which is the smallest value? (a) 7 (b) l (c) -4 c Let d = 5894 - 5869. Let j = -0.29 + 0.29. Which is the biggest value? (a) 5 (b) j (c) d c Let n = 0.6344 + -1.1344. What is the second biggest value in 19/6, 3, n? 3 Let q = -1178 - -1183. Which is the fifth biggest value? (a) -1/4 (b) -3 (c) q (d) 20/3 (e) -2/3 b Suppose 41 = 6o + 77. Let u be 0 - 0 - (-8 + 2)/o. Which is the second biggest value? (a) u (b) -10 (c) 0.3 a Let w = 17466/5 - 3493. Which is the smallest value? (a) 34.8 (b) w (c) -0.5 c Let i = 2978/10325 - 4/1475. What is the second smallest value in 333, i, -1/3, 0.1? 0.1 Suppose -22l - 492 = 278 + 220. Which is the second biggest value? (a) -0.2 (b) 1 (c) -2/15 (d) 0.3 (e) l d Let v = 10149 + -10149. What is the third biggest value in -1.1, 1/7, 1/2, -1/4, v? v Let z = 3079 + -3084. What is the third smallest value in z, 6/11, 5? 5 Let m = 1808 + -1803. Which is the third biggest value? (a) 0.01 (b) 1/74 (c) m a Let o = 4/119 + -55/119. Let c = -25.7 - -25.9. What is the biggest value in o, 4, c, -0.035? 4 Let n = -297.215 - -0.215. Let j = n + 294.1. Let l = -0.9 - -0.5. Which is the second biggest value? (a) -0.2 (b) l (c) j b Let x = 6 + -6.4. Suppose -7z = 11z. Suppose -n + 2q + 2 - 12 = z, -2q = 3n - 10. Which is the smallest value? (a) x (b) -6 (c) n (d) 1/4 b Let q = -2.7071 + -0.0629. Let y = 0.77 + q. Which is the fourth biggest value? (a) 1/4 (b) 18 (c) 1 (d) y d Let p = 3.68465 + -3.72465. Let x = -0.2 + 0.1. What is the third smallest value in 0.1, x, -9, p? p Let k = -25603 + 76810/3. Which is the third biggest value? (a) k (b) 3 (c) 1/38 c Let w be (-15)/(-45) - (-66)/18. What is the smallest value in -3, w, -0.45, 0.02, 0.2? -3 Let o = 560.65 + -0.65. Let g = 566 - o. Which is the third smallest value? (a) g (b) -2/11 (c) -2/3 (d) 4 d Let l = 72.12 - 71.72. What is the second smallest value in l, -0.3, 1, -2/3, -3/5? -3/5 Let q = 127 + -126.927. Let x = -0.169 - q. Let g = -0.042 - x. What is the biggest value in 16, 1/2, g? 16 Let v = -27240739/74200 - -8/9275. Let q = 367 + v. Which is the third smallest value? (a) 1/4 (b) 0.3 (c) q b Let x = 0.0301 + -177.7301. Let h = -178 - x. Which is the third smallest value? (a) h (b) 0 (c) -37 b Suppose -19o = 16o + 15o - 250. Which is the biggest value? (a) -4 (b) o (c) -345 b Let n = 30 + -29.887. Let t = n - 2.113. Which is the second biggest value? (a) -0.4 (b) 3 (c) -0.2 (d) t c Let x = -2.5396 + -0.4604. What is the biggest value in 0.08, x, -55, -4, 1? 1 Let l = -707 + 707.5. Let g = 19.2 + -22.2. Let h = 0 + -0.2. What is the fourth biggest value in h, -1/4, g, l? g Let s(g) = -201g - 177. Let f be	{ "pile_set_name": "DM Mathematics" }
= b*3 - 3b2 + 3. Give u(z). 3 Let q(u) be the first derivative of u2/2 + u + 1. Give q(3). 4 Suppose 0i - 4i + 36 = 0. Let x(k) = 9k + 13. Let t(c) = 10c + 13. Let w(u) = -5t(u) + 6x(u). Let n(b) = b + 3. Let p(v) = in(v) - 2w(v). Give p(4). 5 Let n(z) = -z*3 + 5z*2 + 4. Suppose -5 = -16f + 15f. What is n(f)? 4 Suppose 5x - 36 = -4x. Let b(d) = d - 1. What is b(x)? 3 Let o(i) be the second derivative of -7i*3/6 + 2i*2 + 3i. Let g(w) = 8w - 5. Let t(f) = 6g(f) + 7o(f). Give t(-6). 4 Let i(p) = 3p - 4. Let a(n) = 12n - 15. Let w(b) = 2a(b) - 9i(b). Determine w(-5). 21 Let d(a) = 8 + 5a - a + 0 - 3a. Suppose -3f = -0f + 6, o + 2f = -4. Determine d(o). 8 Let f(w) = -w*2 + 5w - 2. Let k(j) = -j*2 + 7j - 3 - 3j2 + 3j*2. Let g be k(6). Calculate f(g). 4 Let l(g) = 5g*2 + 2g + 2. Let u be (-96)/567/(-2). Let n(d) = -4d*2 - d - 2. Let j(x) = un(x) + 5l(x). Calculate j(-3). -5 Let i(w) be the second derivative of w4/12 + 4w*3/3 + 3w*2 - 4w. Calculate i(-5). -9 Let y(g) = g*3 + 8g*2 + 7g + 4. Let a be y(-7). Let o(z) = 2 + az + z - 2z - 1. What is o(1)? 4 Let r(t) be the third derivative of t*5/60 - 2t*3/3 - 4t2. Calculate r(0). -4 Let j(o) = o2 - 4o. Let y be j(3). Let c(k) = -4k. Let z(q) = 3q - 1. Let i(v) = -2c(v) - 3z(v). What is i(y)? 6 Let p be (7 + -4)4/2. Let q(m) = m - 7. What is q(p)? -1 Let z(a) = -4 + a + 1 + 4a3 + 3. Let g = -7 - -12. Suppose -4n + gn = 1. What is z(n)? 5 Let w(v) = v2 + 1. Let i(o) = 5o - 1. Let f be i(-1). Let c be 23/f1. Let x = 3 + c. Determine w(x). 5 Let c = 15 + -11. Let p(y) = 6y - cy + 5y. Suppose -3 = 2t + 4b - 3b, t + 4b + 5 = 0. Calculate p(t). -7 Let b(j) = -j3 + 11j*2 + 12j + 2. Let k(n) = 3n3 - 22n*2 - 25n - 3. Let v(u) = -5b(u) - 2k(u). Determine v(-10). -4 Suppose -3k - 4z = -3, 0 = 2k + 2z - 3z - 13. Let v(d) = 0 - 2d + 1 + kd3 + 4d. Suppose 3j - 4t + 19 = 0, j = -0j + 3t - 13. What is v(j)? -6 Suppose 0 = 3r - 7 - 5. Suppose 3d = -rk - 8, -2d + 3k = -6d - 6. Suppose d = -5g + 21 - 6. Let z(l) = -l2 + 3l - 4. Determine z(g). -4 Let u(q) = -2q + 2. Let s be u(2). Let h(l) be the second derivative of l4/4 + l3/6 - l2/2 - 12l. Calculate h(s). 9 Let j be (-344)/(-480) - 6/9. Let x(w) be the second derivative of w*2 + 1/6w*4 + 0 + 3w + jw5 + 2/3w3. What is x(-2)? -6 Let m(h) be the first derivative of h3/3 + 3h2 + 4h - 21. Determine m(-6). 4 Let t(o) = o*2 + 7o - 4. Let s(l) = -l*2 - 8l + 5. Let a(i) = -2s(i) - 3t(i). Suppose -5v - 10 = x, 0v + 1 = -x + 4v. Calculate a(x). 2 Let b(v) = 2v - 1. Suppose -24f = -17f + 28. What is b(f)? -9 Let x(f) = -f + 1. Let n be x(1). Let k(z) be the third derivative of -z6/120 + z5/60 - 5z3/3 - z2. Determine k(n). -10 Let r(j) = j + 21. Let n be r(-16). Let k(c) = -4c + 7. Give k(n). -13 Let y(h) be the third derivative of h6/20 - h5/60 + 5h2. Let d be y(1). Let j(s) = -2s + 4. Calculate j(d). -6 Let r(c) = -c*2 - 7c - 4. Let d be r(-7). Let f(x) = -x*2 - 5x - 4. What is f(d)? 0 Suppose -2u + 1 = -3. Let m(l) = -6 + 2 - 5lu + l + l3 - 2. Determine m(5). -1 Let v(h) = h + 3. Suppose -t = -6t. Suppose t = -o - 7 - 2. Let l be (-21)/o - 2/(-3). Calculate v(l). 6 Let x = 13 + -18. Let p(d) = 3d*2 - 3d + 8. Let a(i) = 2i2 - i + 4. Let b(f) = 5a(f) - 3p(f). Give b(x). 1 Let a(f) = f2 + 6f + 1. Let n(g) = 15g2 + 1. Let y be n(-1). Suppose 2r - 6r - y = 5d, -4r + 4 = 0. Give a(d). -7 Let m be 0/2 + -4(-25)/20. Let q(c) be the third derivative of -c*5/60 + 5c4/24 + c3/6 + c*2. Calculate q(m). 1 Let j(t) = -2 + 7 + 0t2 + t2 + 4t - 2. What is j(-2)? -1 Let n(r) = 5r*2 - 4r2 + r3 + 0r3. Suppose 3w - a + 1 = 0, -5a + 4 + 1 = 0. Give n(w). 0 Let j(t) = -t - 1. Suppose -9 = r - 4r. Let a be (4/(-12))/(r/9). Give j(a). 0 Let p(a) = a*3 - 3a*2 - 2a + 3. Suppose 0 = -12d + 13d. Suppose -4o + 2o + 6 = d. Determine p(o). -3 Let p(y) be the second derivative of y4/12 + y3/6 - 3y2/2 - 3y. Give p(-3). 3 Let o(p) be the first derivative of 2p3/3 - 3p*2/2 + 9p + 2. Let f(b) = b*2 - 2b + 4. Let y(m) = -7f(m) + 3o(m). What is y(3)? 5 Let u be -66/(-72)-12. Let p(v) = v*3 + 6v*2 + 6. Give p(u). 6 Suppose -2w = 4i + 2w - 12, -4i - 2 = -3w. Let h(s) = -6s2 - 4s - 1. Let m(v) = v*2 + v + 1. Let n(b) = -h(b) - 2m(b). Calculate n(i). 5 Let t(k) = k - 2. Let i(h) = -h + 1. Let d(z) = 5i(z) + 2t(z). What is d(-2)? 7 Let w(a) = -a*2 + 10a + 3. Let r be w(12). Let d = r - -20. Let s(q) = 6q3. Calculate s(d). -6 Let l = 83 - 86. Let c(z) = z3 + 3z*2 + 3z. Give c(l). -9 Suppose -3b - 9 = 0, 44 = -3l - 5b - 31. Let t = l - -15. Let f(u) = u2 + 6u - 1. What is f(t)? -6 Let a(j) = 4j - 3. Let o(s) = 3s - 2. Let g(i) = -2a(i) + 3o(i). Determine g(-3). -3 Let c(r) = 1 - 7 - 2 - 3r + 0. What is c(-7)? 13 Let c(b) be the first derivative of 0b*4 + 3/10b*5 - b + 1/2b*2 - 1 - 1/3b3. Let g(u) be the first derivative of c(u). What is g(1)? 5 Let i(t) = -t2 + t + 1. Let c(g) = g*3 - 2g*2 - 1. Let o(y) = c(y) - i(y). Let z = 10 - 8. Determine o(z). 0 Suppose -4r + 4 = 4o - 2o, 5o = -5r - 5. Let y(w) = -w + 1. Let x(t) = 3t - 14 + 3t - 2t. Let d(c) = -x(c) - 5y(c). Give d(o). 5 Let l(y) = -4y - 8 + 6y - y - 2y. Let s(q) = 3 + 0q2 + q2 + 0q2 - 6q. Let f be s(3). Give l(f). -2 Let g(w) be the third derivative of -w4/24 - w3/3 + w*2. Let v be ((-180)/70)/((-6)/28). Suppose -5q + 2 = v. Give g(q). 0 Let d(f) = 10f3 + f2 - 1. Suppose 5h + 3s - 2s = 0, 3h - 5s = -28. What is d(h)? -10 Let t(b) be the second derivative of -b*4/12 - 2b*3/3 + 3b*2/2 - 13b. Let h be (-6)/(-27) + (-32)/(-18). Give t(h). -9 Let p(i) = i*2 - 3i - 1. Suppose 0u - 2u - 2 = 0, 5r - 61 = u. Suppose 2k + 2k = r. Calculate p(k). -1 Let d(u) = 11u*2 - 3u - 1. Let r(x) = -10x2 + 2x + 1. Let l(p) = 4d(p) + 5r(p). Give l(1). -7 Let t = 1 - 2. Let x be (-3)/(-2 + t)-2. Let j(a) = 2a*3 + 2a*2 - 2a - 2. What is j(x)? -6 Let n be (-34)/12 + (-4)/24. Let i = 7 + n. Suppose 3j - 5h + 6 = -5, 0 = ij + 5h - 32. Let o(z) = z*2 - z - 3. Give o(j). 3 Suppose -7m + 4m = -6. Suppose -8h = -6h - m. Let q(l) = -5l. Give q(h). -5 Let m(w) = -1 - 32w + 31w + 8. Give m(0). 7 Let f = -4 - -6. Suppose 5z = fz + 9. Suppose z = -5u - 7. Let v(i) = i3 + 2i2 + i - 2. What is v(u)? -4 Let t be (1 + -3)/(-2) - -6. Let a(b) = 1 + t - 9 + b2 + 4b. Give a(-4). -1 Let z(o) be the first derivative of o3/3 - o2 + o - 19. Determine z(2). 1 Let a(d) = -d + 11. Let v(z) = z. Let m(s) = a(s) + 2v(s). Let w be (1 - 1)/(0 + 1). Determine m(w). 11 Let g(q) = q*2 - 8q. Let w(a) = -2a2 + 8a + 1. Let i(o) = 3g(o) + 2w(o). Calculate i(-8). 2 Let s(r) = r*3 + 4r*2 - 5r - 4. Suppose -2z - 2n - 11 = -n, 14 = -2z - 4n. Calculate s(z). -4 Let m = 0 - -2. Suppose 2f = mz + 14, -z = -4f + 5f + 3. Let h(c) = -c3 + c2. Give h(f). -4 Let c(x) = 9x3 - 1. Suppose -5u + 0u = -5. Calculate c(u). 8 Let k = 2 - -6. Let x = k + -5. Let n(t) = t - 3. Calculate n(x). 0 Let j be 25/10(-1 + 3). Let m(i) be the first derivative of i2 + i + 2. Determine m(j). 11 Let t(h) be the second derivative of -h3/3 - 3h. Let l = 6 + -6. Suppose v - 4f = l, -3f + 16 = 5v - 7f. What is t(v)? -8 Let g(x) = x - 8. Let y be (-36)/(-8)4/3. Calculate g(y). -2 Suppose 2k = k - 1. Let o = 2 - k. Suppose 8 = ow - w. Let f(v) = v*2 - v - 5. Give f(w). 7 Let x = -8 + 10. Suppose o = -2 + 8. Let a be x((-15)/o + 2). Let s(f) = -9f2 + f + 1. Determine s(a). -9 Suppose -3h = -h - 5n + 7, -2h = -4n + 4. Let g(k) = -k2 + 4. What is g(h)? -12 Let u(t) = -3 - 11t*2 + 0 + 10t*2 - 5t. Give u(-3). 3 Suppose -y - 1 = -3. Suppose k = -yk - 15. Let s(d) = -d2 - 4d + 4. Determine s(k). -1 Let d(p) = -p - 3. Let k be d(-6). Let i(z) = z*2 + 4z*2 + z + 0z2 - zk - 4. Let a be ((-10)/4)/(2/(-4)). Give i(a). 1 Let a(m) = -m*3 + 16m*2 - 20m + 23. Let l(n) = n*3 - 16n*2 + 19n - 22. Let j(f) = 3a(f) + 4l(f). Calculate j(15). -4 Let c = 212 + -211. Let w(i) be the first derivative of	{ "pile_set_name": "DM Mathematics" }
. Suppose -2c = sr + 3r - 9, 5c = -3r + 13. Let h(p) = -5p - p*2 + 7p - cp. Let t(f) = -f2. Calculate t(h(q)). -q4 Let h(f) = -2f*2. Let t(m) = 141132m. Determine h(t(g)). -39836482848g2 Let t(m) = -21m. Let q be (24/(0 - 4))/(-1). Let s(v) = -5v2 - 6. Let g(w) = 4w*2 + 5. Let h(k) = qg(k) + 5s(k). Give h(t(p)). -441p*2 Let h(f) = 13f*2. Let q(i) = -3i - 69. Calculate q(h(l)). -39l2 - 69 Let g(u) = u. Let y(q) = -15419508q*2. Give y(g(a)). -15419508a*2 Let h(j) = -j - 16j + 14j. Let b(w) = -4w*2 + 3w. Let s(v) = -4v2 + 4v. Let q(f) = 4b(f) - 3s(f). Calculate q(h(n)). -36n2 Let o(n) be the first derivative of 3n*2 - 2668. Let c(m) be the third derivative of 0m + 0m3 - m2 - 1/12m*4 + 0. Give c(o(d)). -12d Suppose 113d = 126d. Let n(m) be the second derivative of d + 1/12m4 + 0m*3 - 5m + 0m2. Let a(y) = -11y. Give a(n(l)). -11l2 Let g(a) = -182a - 23. Let v(y) = -182y - 15. Let q(r) = -2g(r) + 3v(r). Let h(i) = -2i. Determine q(h(p)). 364p + 1 Let x(c) = 2c*2 - 2c. Let g(h) = -h*2. Let p(z) = -5g(z) - x(z). Let t(v) be the first derivative of 2v3/3 + 4. Determine p(t(l)). 12l*4 + 4l*2 Let q(p) = -35019p. Let s(c) = -23c2. Give q(s(v)). 805437v*2 Let o(r) = -8. Let x(l) = -l - 4. Let z(u) = 2o(u) - 4x(u). Let p(c) = -268c. What is z(p(q))? -1072q Let v(z) = -2z*2. Let h(y) be the second derivative of 2y*4/3 - 5y*2 - y + 161. What is h(v(k))? 32k*4 - 10 Let z(m) = -400m*2. Let b(y) = 9y - 2y - y - 8y + y. Determine b(z(n)). 400n2 Let r(l) = 2l*2. Let c(b) be the second derivative of -13b*3/3 + 75b. Calculate c(r(n)). -52n2 Let w(b) = -6b. Let v(i) be the first derivative of 11i3 + 187. Calculate w(v(t)). -198t*2 Let f(p) = 470p. Let l(b) = -39b. Calculate l(f(u)). -18330u Let g(t) = -6t. Let v(o) be the first derivative of -6 + 0o - 7/2o2. Give g(v(h)). 42h Let d(f) = 6789f. Let w(z) = 12z*2. What is w(d(j))? 553086252j2 Let b(x) = x2. Let z(u) = 3u2. Suppose 0 = -6t + t. Suppose -4l + 4 = -tl. Let c(j) = lz(j) - 4b(j). Let f(a) = -a. Give f(c(d)). d*2 Let c(n) be the first derivative of -5n*3/3 + 91. Let y(h) = -2h. Determine y(c(s)). 10s2 Let g(h) = 21h. Let t(w) = 638w + 2. Determine t(g(k)). 13398k + 2 Suppose -5l - 6z + z + 135 = 0, -2z - 101 = -3l. Suppose -2u + 10 = -4f, 5f - 10 = 15. Let s(j) = -uj - 16j + lj + j2. Let m(r) = -r. Give s(m(g)). g2 Let c(z) be the third derivative of z*5/20 + 2z*2 - 69z. Let x(v) = -6v. Let f(p) = -5p. Let r(i) = 4f(i) - 3x(i). Determine c(r(d)). 12d2 Let y(g) = g2 - 196. Let x(o) = 417o + 2. What is y(x(n))? 173889n2 + 1668n - 192 Let t(p) = 15p. Let b(a) = 457a*2. What is b(t(g))? 102825g2 Let q(l) = l2 - 21. Let o(a) be the first derivative of -a2/2 - 34. What is q(o(u))? u2 - 21 Let t = 9 - 7. Let q(p) = 0p2 - 7p*2 + 6p*t. Let l(n) = -3n + n + 0n + 3n. Determine l(q(x)). -x*2 Let x(p) = -3p. Let j(u) be the second derivative of 0 - 7u + 0u*2 + 11/6u*3. Give j(x(y)). -33y Let c(z) = 273568z. Let x(m) = -m2. Determine c(x(r)). -273568r*2 Let x(g) = 45g - 9. Let o(l) = -3l - 34. Calculate o(x(z)). -135z - 7 Let k(c) = -2c2 - 7 + 23 - 16. Let w(s) be the second derivative of 4s*3/3 - 9s. Calculate w(k(z)). -16z2 Let q(l) = -7 + 21 - 2l - 4 - 10. Let m(p) = -3p + 6. Determine q(m(c)). 6c - 12 Let j(h) = -2h. Suppose 0 = -28b + 61b. Let o(q) be the third derivative of 0q*3 + 4q*2 - 1/8q*4 + 0 + bq. What is o(j(c))? 6c Let x(p) be the first derivative of p2 - 384. Let r(m) = -m - 54. Calculate r(x(q)). -2q - 54 Let h(k) be the first derivative of -20k2 + 454. Let w(j) = 34j. Determine w(h(u)). -1360u Let w(d) = 20d - 10d - 12d. Let j(v) = 10v2 + 6v. Calculate j(w(y)). 40y2 - 12y Let h(k) = -4k2. Suppose 44 = 35w - 61. Let v(u) be the second derivative of 3u + 0 + 0u*2 - 1/6u*4 + 0u*w. Calculate h(v(a)). -16a*4 Let v(h) = -6h - 8h + 13h. Let a(p) be the third derivative of -13p7/5040 + p5/20 + 7p*2. Let r(q) be the third derivative of a(q). Calculate r(v(u)). 13u Let r(u) = -6078u + 6078u - 3u2. Let g(v) = -2v*2. Determine r(g(l)). -12l*4 Let a = 4 + 2. Let i(r) = -464 + 464 - ar. Let n(x) = -x*2. Give i(n(q)). 6q*2 Let m = -61 + 94. Let r(v) = -mv + 18v + 13v. Let n(d) = -61d2. Calculate n(r(o)). -244o*2 Let i(z) = 3z*2. Let n(t) be the third derivative of 0t*4 - 1/15t*5 - 21t*2 + 0t + 0 + 0t3. Determine n(i(u)). -36u*4 Let n(l) = -43l*2. Let d(m) = 2m - 17m + 5m + 3 + 5m. Let a(r) = -14r + 8. Let z(o) = -3a(o) + 8d(o). Calculate n(z(t)). -172t2 Let q(h) = -8h*2 + 2h*2 - 2h2. Let g(i) be the third derivative of i4/24 + 131i2. Determine q(g(j)). -8j*2 Let d(o) = 705166o. Let u(j) = j. Give u(d(p)). 705166p Let i(p) = -2p + 142 - 2p - 5p - 142. Let a(z) be the second derivative of 7z4/12 - 2z. Determine i(a(x)). -63x2 Let i(w) be the third derivative of 2/3w*3 + 0 + 12w*2 + 0w - 1/24w4. Let y(l) = l2. Give y(i(k)). k2 - 8k + 16 Let d(z) = 164z - 2z*2 + 7 - 85z - 79z. Let y(h) = -4h*2 - 3h - 3. Let v(c) = -c*2 - c - 1. Let o(q) = -3v(q) + y(q). Give d(o(u)). -2u4 + 7 Let q(k) = k + 2. Let p(d) = 5d + 7. Let l(i) = -9i - 13. Let s(t) = -6l(t) - 11p(t). Let o(u) = -3q(u) + 6s(u). Let c(a) = -3a*2. Determine o(c(r)). 27r*2 Let f(j) = -6j + 3. Let b(v) = 35v2 + 1. Calculate f(b(z)). -210z*2 - 3 Let l(j) = 2j*2. Let o(a) = -48865a. Calculate l(o(c)). 4775576450c2 Let j(h) be the first derivative of -2h*3/3 + 3857. Let g(a) be the third derivative of -4a4/3 - a2. Give g(j(k)). 64k2 Let o(m) = 2m*2. Let a(t) = t + t - 3t + 124 + 0t + 6t. Calculate a(o(j)). 10j2 + 124 Let b(a) = 6a*2 + 3. Let p(l) = -2046l. Calculate p(b(d)). -12276d2 - 6138 Let b(j) = -5j*2 + 5j - 5. Let m(n) = -7n2 + 8n - 8. Let p(l) = 8b(l) - 5m(l). Let c(u) = -35u + 11u - 4u2 + 24u. What is p(c(s))? -80s4 Let t(z) = -10z*2. Let h(j) be the second derivative of 13j + 1/12j4 + 0j*3 + 0j*2 + 0. Determine h(t(f)). 100f*4 Let t be (-10)/(-6) + (-1)/(-3). Suppose -4 = -tm - 2r - 2, -3m - 2r + 5 = 0. Let f(k) = 6k - mk + 0k. Let j(h) = -4h. Give f(j(z)). -12z Let u(s) = -4395420s. Let a(r) = -2r. Calculate u(a(h)). 8790840h Let l = 339 + -337. Let t(y) be the first derivative of -6 + 0y + 5/2yl. Let z(j) = 4j. What is t(z(x))? 20x Let t(j) = 2j. Let r(o) = -757706o. Determine r(t(v)). -1515412v Let p(i) = -239i2 + 115i*2 + 122i*2. Let q(h) be the third derivative of -29h*4/24 - 2h*2. Calculate q(p(v)). 58v2 Let b(x) = x2. Let l(z) = 247642z. Calculate b(l(c)). 61326560164c*2 Let z(s) = 4s + 2s + s - 36s + 30s. Let h(d) be the third derivative of d4/12 - 13d3/6 - d2. Determine z(h(f)). 2f - 13 Let l(q) = -2q*2 + 229q - 199. Let g(i) = -i*2. What is l(g(x))? -2x*4 - 229x*2 - 199 Let q(g) be the third derivative of 0g*3 + 31/24g*4 - 9g*2 + 0g + 0. Let z(d) = 2d2. Give z(q(c)). 1922c*2 Let o(c) = -2c. Let p(r) = -1. Let d(i) = 2i2 + 14. Let m = -7 + 2. Let a(v) = -2v - 6. Let z be a(m). Let t(q) = zd(q) + 56p(q). Give o(t(y)). -16y2 Let l(y) = -y. Let q(r) = -196r*2 + 11. Calculate q(l(c)). -196c*2 + 11 Let w(d) be the third derivative of 0d + 0d3 + 0 - 1/24d*4 + 5d*2. Let j(o) = 3o*2. What is w(j(k))? -3k*2 Let k(i) = 11i - 1. Let j(t) = -16398t. Give k(j(z)). -180378z - 1 Let q(f) = -4 + 9f + 4 - 10f. Let x(t) = 2t. Let p be 4/2(-2)/4. Let y(h) = px(h) - 4q(h). Let d(o) = -8o2. Give y(d(g)). -16g*2 Suppose -14 + 2 = -6l. Let u(r) = -3r2 + 12r*2 - 10r*l. Let g(n) = 12n*2. Give g(u(j)). 12j*4 Let u(i) = -5i2. Let a(d) be the third derivative of -d7/5040 + d*5/5 + 12d*2. Let f(l) be the third derivative of a(l). What is u(f(x))? -5x*2 Let f(i) = 970i. Let u(s) = -27s. Calculate f(u(r)). -26190r Let w(i) = -i2. Let d(j) be the first derivative of j6/12 + 6j3 - 4. Let b(t) be the third derivative of d(t). Give w(b(x)). -900x4 Let w(y) = -y2	{ "pile_set_name": "DM Mathematics" }
derivative of r(o) wrt o. -5176 Let v(p) be the third derivative of 581p6/24 - 11p*4/24 + 5p3/3 + p2 - 6p - 119. Find the second derivative of v(h) wrt h. 17430h Let z(d) = -d*2 + 8d - 7. Let b = 85 + -83. Let y be z(b). Find the third derivative of 19ay - 4a*2 - 60a*5 + 15a*5 - 4a*2 wrt a. -1560a*2 What is the third derivative of 6493037u - 2u2 - 1688 - 1793u*3 - 6493037u wrt u? -10758 Let b = -11140 - -11175. Let d be 0 + -3(-4)/3. Find the third derivative of 4l + 55l3 - bl*3 - 26l*2 - dl wrt l. 120 Suppose -3d = 2o - 8, 4o - 6 = -4d - o. Differentiate -3208z3 + 6z + 3208z3 + 11z*d - 55 with respect to z. 44z*3 + 6 What is the first derivative of 28497v*2 - 14823v*2 - 14638v*2 + 801 wrt v? -1928v Let y(b) be the second derivative of -b*8/56 + 37b7/42 + b6/10 + b*4/6 + 35b*3/6 + 7b*2/2 - b + 2927. What is the third derivative of y(p) wrt p? -120p*3 + 2220p*2 + 72p Let t = -243 + 251. Let v(b) = 51b + 94. Let k(p) = -152p - 279. Let m(l) = tv(l) + 3k(l). Differentiate m(c) wrt c. -48 Let r(t) be the second derivative of -1/2t2 - 3t*3 - 5/12t*4 - 53t - 1/5t5 + 0. What is the second derivative of r(o) wrt o? -24o - 10 What is the third derivative of -7774502y2 + 5556y*5 - y - 5y + 7774503y2 + 243 wrt y? 333360y*2 Find the second derivative of -5v*3 + 568v*4 + 1 - 4282v + 339v4 + 7782v wrt v. 10884v2 - 30v Let y(k) be the third derivative of -869k4/3 - 1639k*3/6 - 11831k*2. What is the derivative of y(m) wrt m? -6952 Find the second derivative of 2337c*2 - 1 - 5413c + 1 + 440c - 1273c wrt c. 4674 Find the third derivative of 3s2 - s3 + 631s*5 - 631s*5 + 5 - 2 - 1002s*6 wrt s. -120240s*3 - 6 Let j(b) be the second derivative of 0b*2 - 80b - 41/20b5 - 1/12b*4 - 10/3b*3 + 0. What is the third derivative of j(d) wrt d? -246 Let o = 519 - 457. Find the second derivative of -13d*2 - 4d*3 + 30 - 3d*2 - od - 52 + 21 wrt d. -24d - 32 Let k(w) = w4 + 10w*2 + w - 1. Let r(x) = -535x*4 - 4x*3 - 61x*2 - 6x - 2055. Let b(d) = 6k(d) + r(d). What is the derivative of b(j) wrt j? -2116j*3 - 12j*2 - 2j Let t be (-30)/70 + (-188)/(-14). Let z(i) = i*2 + 4i - 3. Let l be z(-5). Find the third derivative of 13j2 - tjl - j2 - 11j3 wrt j. -66 Let z(j) be the third derivative of -1/10j*5 + 0j6 + j2 - 1/168j8 + 47/210j*7 + 0j + 0j3 - 32 + 0j*4. Find the third derivative of z(s) wrt s. -120s*2 + 1128s Let h(s) = 7004s2 + 4s + 1962. Let a(y) = -21011y2 - 11y - 5893. Let b(o) = -3a(o) - 8h(o). What is the second derivative of b(c) wrt c? 14002 Let m(a) = -70a + 76. Let r(q) = -211q + 227. Suppose -48t = 62 + 610. Let k(s) = tm(s) + 4r(s). Find the first derivative of k(v) wrt v. 136 Suppose 8n = 7n + 3. Let w(b) = -5b + 26. Let a be w(n). Find the third derivative of -3q6 - 50q*6 + aq*6 - 38q*2 wrt q. -5040q*3 Let x(g) be the second derivative of -2416g*4/3 - 2g*3/3 + 11g*2 + 8377g. What is the second derivative of x(u) wrt u? -19328 Let f(r) be the first derivative of -103/2r2 + 0r*5 - 79/6r*6 + 0r + 0r3 + 33 + 0r*4. Find the second derivative of f(a) wrt a. -1580a*3 Let m = -13 + 17. Differentiate -20v*3 + 16v*3 + 2v*4 - 12 - 4v*m with respect to v. -8v*3 - 12v*2 Let f = -7 + 26. What is the third derivative of 12o*6 - 63o*2 + 13o*6 - 24o*6 - fo*4 wrt o? 120o*3 - 456o Let s = 53 + -39. Let b = -14 + s. Find the second derivative of 4i2 + 2i - i + bi2 wrt i. 8 Let w(t) be the first derivative of 7/6t*6 - 55/3t*3 + 0t*2 + 7 + 0t + 0t5 + 0t*4. What is the third derivative of w(q) wrt q? 420q2 Let n(d) be the third derivative of d8/84 - 649d6/120 + 41d*5/15 - 5d*3/3 - 4745d*2. Find the third derivative of n(i) wrt i. 240i*2 - 3894 Let l = -5313/124 - -1398/31. Let z(g) be the second derivative of 0 + 0g*3 - lg*4 - 6g - 14g2. Differentiate z(d) with respect to d. -54d What is the first derivative of -42x3 + 92569x*2 - 9022 - 92567x*2 + 562x*3 + 3x wrt x? 1560x2 + 4x + 3 Find the first derivative of 248k3 + 17 + 20 + 43k*3 + 147k*3 + 473k*3 wrt k. 2733k*2 What is the second derivative of 3s*3 - 643s*2 - 22s*3 + 1292s*2 - 68s*3 - 645s*2 - 3895s wrt s? -522s + 8 Let a(r) be the first derivative of -1929r*5 - 2r*3/3 + 9r*2 - 143r + 5954. What is the third derivative of a(p) wrt p? -231480p What is the derivative of -6 - 38c - 10881c2 + 713 + 38c wrt c? -21762c Let n = 38 + -32. Suppose -10 = b - nb. Find the second derivative of 15v + 10v*4 + 2v*4 + 0v*4 + bv*4 wrt v. 168v*2 Let d(j) be the first derivative of 264j*6 - 91j*2/2 - 3j - 473. What is the second derivative of d(p) wrt p? 31680p3 Let p(r) = 147r*2 - 150r - 2. Let a(h) = -8h2 + h - 1. Let k(f) = 6a(f) - 2p(f). What is the second derivative of k(v) wrt v? -684 Let i(k) be the second derivative of -1267k*4/6 - 303k*3 + 1749k. Find the second derivative of i(h) wrt h. -5068 Differentiate -38r3 + 1422 - 186r*4 + 198r*4 - 127r*4 with respect to r. -460r*3 - 114r*2 Let i(x) = 2x*2 + 5x + 5. Let u be i(-1). Differentiate -3r3 - 10r*2 + 7r*u + 3r*3 + 29 + 7r*4 with respect to r. 28r*3 - 6r Suppose 0 = 11f - 24f + 93379. What is the first derivative of -fs + 52s*3 - 46 + 7183s wrt s? 156s2 Suppose -16 = -2p + 4l, -3l - 10 = -4p + 12. Let i(w) = w3 - w2 + w + 6. Let t be i(0). Differentiate -8 + 9 - 11a*p + 6 + t wrt a. -44a*3 Let s(c) = -2488c + 6123. Let h(k) = -4984k + 12242. Let w(q) = 6h(q) - 13s(q). What is the first derivative of w(v) wrt v? 2440 Let b(h) = -2h*4 - 37h*2 + 1741h - 21. Let v(y) = y*4 + 25y*2 - 1161y + 15. Let l(g) = 5b(g) + 7v(g). Find the second derivative of l(n) wrt n. -36n2 - 20 Let o(b) be the second derivative of -195b*5/4 - 403b*4/12 - 2484b. What is the third derivative of o(a) wrt a? -5850 Let f(p) = 4p - 3. Let g be f(5). Suppose g = x + 14. What is the first derivative of -4k - 4k + xk - 13 + 0k wrt k? -5 Let g = 224 - 221. Let f = 1 - 1. Differentiate 3m - 2m - 18 + fm - gm wrt m. -2 Let d be 1/6 + (-58)/(-12). Suppose 3c = -dm + 51, -3c + 7c + 2m = 68. Find the second derivative of -cw + 16w*3 - 15w + 41w wrt w. 96w Let f(p) = p*3 + 7p*2 - 12p - 4. Let b be f(-5). What is the third derivative of 143 - br2 - 71 + 182r*3 - 72 wrt r? 1092 Let y be (-18)/(-24)-4 - -13. What is the third derivative of -137x3 + 16x*3 + 8x*2 - 182x*3 + 134x*2 + yx*2 wrt x? -1818 Let y(i) be the second derivative of -43/2i*2 + 0i*3 - 71/12i*4 - 6i - 2. Differentiate y(u) with respect to u. -142u Let h(x) = 7863x*3 - 2x*2 - 982x. Let n(o) = 15720o3 - 5o*2 - 1962o. Let y(p) = -5h(p) + 2n(p). Find the second derivative of y(i) wrt i. -47250i What is the derivative of -3924 + 14813u3 + u2 + 104u - 14814u*3 - 1968u + 0u2 wrt u? -3u*2 + 2u - 1864 Find the third derivative of -9y + 41y + 515y5 - 3y*2 + 0y*4 - 1902y*5 + 0y*4 wrt y. -83220y*2 Let z = 102 + -102. Let f be (11 + -7)(z + -1 + 3). Find the second derivative of 9 - 17 + f + 18y + y3 wrt y. 6y Suppose -2w + 4z + 122 = 0, 2w + 5z = 4w - 123. Let p = w + -54. What is the second derivative of -25f + 39fp - 7f + f wrt f? 780f3 Let d(v) be the first derivative of -67 + 0v*3 + 0v*5 + 0v + 15v6 + 0v*4 + 29/2v*2. What is the second derivative of d(o) wrt o? 1800o*3 Let u(j) be the second derivative of 66j - 1/15j6 + 0j*3 + 1/12j*4 + 0 + 11j*2 - 9/20j*5. What is the third derivative of u(n) wrt n? -48n - 54 Let n(j) = 86j - 36. Let k(v) = 4v - 59v - 21v - 10v + 33. Let w(d) = 4k(d) + 3n(d). Differentiate w(i) wrt i. -86 Let t(z) be the first derivative of 8z*7/7 - 9z*4/4 + 358z3/3 + z2 + 2z - 2728. What is the third derivative of t(m) wrt m? 960m*3 - 54 Let d(v) be the second derivative of 0v*5 - 245/12v*4 + 0v*3 + 0v*2 + 0 + 295v - 5/21v7 + 1/15v*6. What is the third derivative of d(x) wrt x? -600x*2 + 48x Let	{ "pile_set_name": "DM Mathematics" }
0148 divided by -75037 4 3499865 divided by -699973 -5 Calculate 11016 divided by 6. 1836 What is -408084 divided by 68014? -6 Calculate -1461810 divided by -15. 97454 Calculate 10359 divided by -3. -3453 Divide 19 by -30461. -19/30461 Divide -222831 by 917. -243 What is 33523 divided by -4? -33523/4 Divide 1929 by 54. 643/18 Divide 741582 by 370791. 2 Divide -66807 by 117. -571 Divide -1299657 by 4. -1299657/4 27086 divided by -13543 -2 What is -2 divided by -1047798? 1/523899 -262816 divided by 2 -131408 What is 3442425 divided by 15? 229495 -1973364 divided by 657788 -3 What is 7481 divided by -194? -7481/194 Divide -2886468 by 721617. -4 Divide 808907 by -5357. -151 0 divided by -2251 0 What is -154424 divided by 1? -154424 Divide 501128 by -2. -250564 Divide 33124 by 364. 91 Calculate -50374236 divided by 6. -8395706 What is -2276540 divided by 16261? -140 -211888 divided by 304 -697 -296140 divided by -20 14807 Calculate 7585 divided by 34. 7585/34 Calculate -36740 divided by 835. -44 Calculate 97200 divided by 3. 32400 85928 divided by 92 934 What is 2175516 divided by -6? -362586 Calculate -4 divided by -39826. 2/19913 What is 23370 divided by -7790? -3 What is -3093378 divided by -1? 3093378 Divide 10 by -20870. -1/2087 Divide 58420 by -1. -58420 What is -1642317 divided by -267? 6151 -38 divided by 8879 -38/8879 60300 divided by 134 450 What is 2112845 divided by 119? 17755 368788 divided by -92197 -4 What is -6 divided by -10856? 3/5428 Divide -5 by 5185. -1/1037 Divide -31690 by -15845. 2 Calculate 234900 divided by -3915. -60 30 divided by 1299 10/433 Divide 49644 by -16548. -3 Divide -16 by -56. 2/7 66780 divided by 22260 3 Divide 1972614 by 6. 328769 Calculate -44880 divided by 44880. -1 6364 divided by 2 3182 -30 divided by 12243 -10/4081 What is 363402 divided by 18? 20189 What is -917 divided by 36? -917/36 What is -26660 divided by 6665? -4 What is -571857 divided by -18447? 31 Calculate -4987 divided by 96. -4987/96 Divide 216930 by -210. -1033 -130250 divided by 6 -65125/3 -19 divided by -22454 19/22454 What is 429 divided by -113? -429/113 Calculate -738639 divided by -3. 246213 Calculate -19 divided by 36059. -19/36059 Calculate 766784 divided by -1. -766784 Calculate 50463 divided by 7. 7209 What is -688605 divided by 3? -229535 Calculate -1332560 divided by -10. 133256 -25520 divided by -319 80 Divide 0 by -31819. 0 Divide 80150 by 11450. 7 Divide 172872 by 343. 504 -59583 divided by -2 59583/2 -8 divided by -19141 8/19141 Calculate -37112 divided by 4. -9278 Calculate -18870 divided by -1258. 15 Calculate 9 divided by -149217. -3/49739 72054 divided by -3 -24018 Divide -9693 by -1077. 9 What is -27920 divided by -3490? 8 Calculate -6 divided by 687. -2/229 10927 divided by 119 1561/17 -1625 divided by 65 -25 Divide -2773 by -41. 2773/41 Divide -10908 by -214. 5454/107 What is -125490 divided by 141? -890 Calculate 198827 divided by 12. 198827/12 What is 1 divided by 8402? 1/8402 Divide 59460 by -30. -1982 -31 divided by -8361 31/8361 -127 divided by 2274 -127/2274 Divide 527 by -61. -527/61 16 divided by -1363 -16/1363 What is 273891 divided by -6? -91297/2 Calculate -11549094 divided by 6. -1924849 What is 1194868 divided by -4? -298717 Calculate 17 divided by 867. 1/51 -546144 divided by 32 -17067 Divide -17112 by -23. 744 Calculate 3765 divided by -14. -3765/14 Calculate 33784 divided by 206. 164 Calculate 1011997 divided by 53263. 19 2496 divided by -25 -2496/25 What is 35970 divided by -327? -110 Calculate 428200 divided by 17128. 25 Divide 8327 by -2. -8327/2 Calculate -16826 divided by -358. 47 What is -24515 divided by -114? 24515/114 What is -549776 divided by 4? -137444 Divide -1363804 by 340951. -4 Calculate -46 divided by 228. -23/114 What is -15112 divided by -10? 7556/5 -71371 divided by 149 -479 Divide 114260 by -145. -788 94228 divided by -23557 -4 Divide 82507 by -3. -82507/3 What is 1514104 divided by -424? -3571 Calculate 289933 divided by 427. 679 What is 967724 divided by 4? 241931 -2541402 divided by 6 -423567 Divide 3160 by -11. -3160/11 20328 divided by -28 -726 What is 29374 divided by -1? -29374 Calculate 9140 divided by -47. -9140/47 What is -52874 divided by -2? 26437 -354620 divided by -177310 2 Calculate 11501 divided by 53. 217 Calculate 143472 divided by 10248. 14 98934 divided by 6 16489 -101822 divided by -14546 7 Calculate 4573 divided by -90. -4573/90 What is 803663 divided by -114809? -7 13702 divided by -42 -6851/21 What is -4223694 divided by -2? 2111847 Calculate 169 divided by -11. -169/11 -2 divided by 345706 -1/172853 Divide 9 by -1740. -3/580 Divide -3 by 5353. -3/5353 What is -75780 divided by 8? -18945/2 Calculate 24 divided by 2674. 12/1337 Divide 253534 by -2326. -109 Divide -39563 by 1. -39563 5576 divided by 28 1394/7 Calculate -8309600 divided by 3. -8309600/3 2094 divided by -14 -1047/7 Divide 911043 by 43383. 21 Divide -126265 by 126265. -1 -1375 divided by 2589 -1375/2589 Calculate -539 divided by -131. 539/131 Divide -264218 by 132109. -2 Calculate 3 divided by 4995. 1/1665 Divide 3270400 by 4. 817600 Calculate -171717 divided by -777. 221 What is 52132 divided by -13033? -4 17 divided by 215 17/215 Calculate -68900 divided by -4. 17225 Divide -505 by -27. 505/27 Divide 96 by -17. -96/17 -49680 divided by -360 138 177250 divided by -25 -7090 What is -198 divided by 1284? -33/214 Divide -12212 by 9. -12212/9 What is 1097 divided by 72? 1097/72 What is 128940 divided by -5? -25788 Calculate 2713932 divided by -6. -452322 Divide 3789 by -20. -3789/20 Calculate 358610 divided by 1. 358610 What is 35798 divided by 17899? 2 What is 54642 divided by 7? 7806 Calculate 4245 divided by -108. -1415/36 What is -5 divided by -16549? 5/16549 -46056 divided by -57 808 What is 502120 divided by -5? -100424 -7955 divided by -24 7955/24 136746 divided by -4 -68373/2 -13 divided by -30914 1/2378 What is 3641696 divided by 16? 227606 Divide -54956 by -4. 13739 Divide -3 by 1171. -3/1171 Divide 3948522 by 1316174. 3 Divide -3244090 by -5. 648818 What is 1500 divided by 39? 500/13 0 divided by 51616 0 Calculate 113045 divided by -23. -4915 Divide -77372 by 46. -1682 Divide 0 by -509816. 0 Calculate -12294 divided by 3. -4098 Divide 4862 by 24. 2431/12 Calculate 3777180 divided by 944295. 4 Divide -3163666 by -34. 93049 What is 125850 divided by 5? 25170 -4 divided by -9618 2/4809 Divide -10 by -293661. 10/293661 What is 14913 divided by -19? -14913/19 What is -2993 divided by 320? -2993/320 Divide -26408 by 8. -3301 1 divided by -252093 -1/252093 Calculate 10052 divided by 182. 718/13 Calculate 155032 divided by 2. 77516 What is -37734 divided by 331? -114 Calculate -5382663 divided by 6. -1794221/2 117866 divided by -8419 -14 -31135 divided by 2 -31135/2 -132760 divided by -53 132760/53 -1007 divided by -5 1007/5 Divide -12397 by 539. -23 What is 80960 divided by 2530? 32 -208215 divided by -5 41643 -5 divided by -6337 5/6337 33176 divided by -1 -33176 1965 divided by -393 -5 Divide -352383 by -69. 5107 Divide 17 by -292. -17/292 What is -1 divided by 18368? -1/18368 Calculate 2170 divided by 8. 1085/4 Calculate -1 divided by 23651. -1/23651 Divide 72 by -651. -24/217 What is 25652 divided by 242? 106 Calculate 7 divided by -46218. -7/46218 Calculate 21 divided by -2195. -21/2195 Divide -76916 by -67. 1148 Divide -5 by -14894. 5/14894 -6695 divided by 16 -6695/16 Divide 77154 by 11022. 7 -1974 divided by -84 47/2 Calculate 264136 divided by -2. -132068 Calculate -1641312 divided by -24. 68388 Divide -5 by 42498. -5/42498 Calculate -6 divided by -35397. 2/11799 -32519 divided by -3 32519/3 Calculate -575340 divided by -143835. 4 Calculate -5 divided by 82084. -5/82084 What is -2 divided by -18300? 1/9150 -5 divided by 31593 -5/31593 Divide 1113735 by -5. -222747 30 divided by 5060 3/506 What is -467 divided by 5365? -467/5365 -832545 divided by 1 -832545 Calculate 61 divided by 309. 61/309 Divide -289121 by 401. -721 Divide 8 by 48281. 8/48281 Calculate -17347 divided by -11. 1577 Calculate -316480 divided by 688. -460 Calculate -26364 divided by 13182. -2 What is -1 divided by -10762? 1/10762 What is 5 divided by 54439? 5/54439 What is 1042636 divided by -46? -22666 What is 28644	{ "pile_set_name": "DM Mathematics" }
/(-6) + (-1)/(-3). Let i be 2/18 + 1712/(-3960). Let z = 4/33 + i. Which is the second smallest value? (a) z (b) w (c) 0.3 c Let i = -48.9 - -48.7. Which is the fourth biggest value? (a) i (b) -1/2 (c) -1 (d) -0.1 c Let q = -124/3 + 42. Let c = -126.5 + 127. What is the second biggest value in q, -1/4, c, -1/7? c Let x = 4.41 + -8.434. Let z = x - -0.024. Which is the third biggest value? (a) -1/12 (b) z (c) -5 c Let f = -177.7 - -178. Let q = -0.49 - -0.69. What is the biggest value in q, 0.19, 3/4, f? 3/4 Let o = 783 + -783.4. Let p = -9 + 4. What is the biggest value in o, 0.3, p, 0.4? 0.4 Let z = -22.4 + 21. Let m = 0.39 + -0.69. What is the smallest value in m, z, 2? z Let d = 3/127 + -281/1143. Suppose 1 = -3i - 2. What is the third biggest value in 5, d, i? i Let v be (-20)/(-3) - (-1 + 35/21). Suppose vr + 5 = 7r. What is the second biggest value in r, -2/37, 2? 2 Suppose p - 2 = 9. Suppose 0m = -pm - 22. Let u = 1.2 - 0.2. Which is the second smallest value? (a) u (b) -5 (c) m c Let d = -12626 + 12625.5. Suppose 0 = 3c - 16 - 185. Let g = c + -466/7. What is the third smallest value in g, d, -2/5? g Let h = -0.09 + 5.09. Let k = -1 + h. Let y be (-40)/25 + (-6)/15. Which is the smallest value? (a) k (b) -1/4 (c) y c Let h = 0 + 5. Let p be (-1(1 + 0))/(-22 + 27). Suppose -3m + 4 + 2 = c, c = 3. What is the second biggest value in m, h, p? m Let i(h) = -4h3 + 2h + 1. Let n be i(-1). Let q be 14/(-98) - 416/(-1050). Let k = q + -4/75. Which is the smallest value? (a) -0.2 (b) k (c) n a Suppose 1 = -4s - 7. Let f = -0.095 - -0.049. Let h = f + 0.246. Which is the second biggest value? (a) s (b) -0.6 (c) h b Let p = -11/2997 + -115519/371628. Let g = 2/31 + p. Which is the third biggest value? (a) g (b) -1 (c) -1/8 b Suppose -2k - 10 = -4k. Let m = -221 - -191. Let g be k/m4/(-1). What is the third biggest value in 0, g, -0.5? -0.5 Let j = 14 + -9. Let s be 44-1 + j + -6. Let y be (-8)/s - (-6)/27. What is the smallest value in y, -1/2, 0.5? -1/2 Let z = 3.01 - 3.31. What is the third biggest value in z, -29/3, 4? -29/3 Let s = -4/25 - -94/275. Let i = -79.95 + 76. Let w = i + -0.05. What is the smallest value in s, -5, w? -5 Let l = 0.1 - 0. Let j = -800/731 - -42/43. What is the second smallest value in -3, l, -2, j? -2 Let o = -45 - -38.8. Let y = o + 6. Let v = 0.6 - 0.5. What is the smallest value in y, v, 2? y Let p = -253/318 + -2/53. What is the second biggest value in -0.4, -223, p, -3? p Let q = 0.36 - 2.36. Let x = q - -1.9. Let m = -1/27 + -8/27. What is the third biggest value in m, x, 0? m Let a = -3045/19708 + 1/1516. What is the third smallest value in 4, a, -0.1, 14? 4 Suppose 0x = x. Let r(n) = 2n3 + 2n*2 - n. Let b be r(1). Let w be 4/b + 30/(-45). What is the second biggest value in -5, x, w? x Let g = -1981 - -1981. What is the second biggest value in 6, -10, g? g Let h be 1/(-10)(-2 + 36). Let f = h - -148/45. Let o = -1/3 + -1/15. What is the third biggest value in -1/5, o, f? o Let u = 7.4 + -7. Which is the third smallest value? (a) 0.2 (b) u (c) 0.5 (d) -0.06 b Suppose 0 = -0a - 2a. Let q be a(5/2 - 3). What is the second biggest value in -1, -4, q? -1 Let o(q) = q2 - 3q - 3. Let w be o(5). Let b be ((-2375)/950)/(-110/2). Suppose -2 + 1 = -l. What is the second biggest value in w, b, l? l Let h = -579 + 580. Which is the biggest value? (a) 27 (b) 2/5 (c) h (d) -1 a Suppose 11 = 4y - 3n, 74y - 69y - 4n = 13. Which is the third smallest value? (a) -172 (b) 3 (c) y c Let y = -1.6 + 0.1. Let i = 1.4 + y. Let g(n) = -n - 6. Let r be g(-5). Which is the biggest value? (a) i (b) 5 (c) r b Let c = 1283/6 - 213. What is the fourth biggest value in 0.1, 4, -1/4, c? -1/4 Let y be ((-5)/(-2)156/455)/2. Which is the second biggest value? (a) -4 (b) y (c) 0.6 (d) 3 c Let j = 52.4 - 52.3. Which is the smallest value? (a) j (b) -5 (c) 3 (d) -0.028 b Let n = -371.7 + 388. Let u = n + -16. Which is the second biggest value? (a) -1/26 (b) -1 (c) u a Suppose y + 8 = -2m, 2y - m = 2m + 5. Let w = -4 + 3. What is the third biggest value in y, -1/9, w? y Suppose 0 = 4z + 4t + 16, -z = -2z + 4t + 21. Suppose -1 = -4q - z. Which is the second smallest value? (a) -2 (b) 0.4 (c) -0.3 (d) q c Let j = -1.6 + 0.6. Suppose -59x + 20 = -63x. Which is the third smallest value? (a) x (b) 0.1 (c) j b Let n = -0.09 - -0.79. Which is the second biggest value? (a) 8 (b) -4/5 (c) n c Let w = 0.169 - 76.869. Let l = w - -80. Let z = 0.7 + l. Which is the second biggest value? (a) -1/3 (b) z (c) -4 a Let z be (-3)/(-5) - (-35)/(-70). Which is the third biggest value? (a) z (b) -2/7 (c) -4 c Let u = 3 - -12. Suppose -f - 3 = -r - 6, -3r + u = 5f. Which is the biggest value? (a) f (b) -0.27 (c) 0.3 a Let v(s) = -6s - 150. Let z be v(-25). Let q = -4 - -2. Let x = -0.06 + -3.94. Which is the biggest value? (a) q (b) x (c) z c Let d = 1 + 1. Let y be 6(-1)/d - 2. Let k be (2/2)/(3 - -1). What is the biggest value in k, y, -1? k Let y = 6320/13 - 486. Let v = 1.3 - -2.7. Which is the fourth biggest value? (a) v (b) 2/9 (c) y (d) -2/9 d Let o = 828 - 5786/7. Let z = -58/21 + o. What is the biggest value in -0.033, z, 2? 2 Suppose 2r = 2k + 14, 22k = 21k + 2r - 9. Which is the smallest value? (a) 0.098 (b) k (c) 1 b Let s = 7 + -11. Let c = 9.8 - -0.2. What is the second smallest value in 3, c, s? 3 Suppose 10 = 5s - 10s. Let o be (-6)/10s/(-3). Let z = 5 + -5.1. Which is the smallest value? (a) 4 (b) o (c) z b Let w = -0.13 + 8.13. Let j = -5 - w. Let l = 13 + j. What is the biggest value in -2/9, l, 5? 5 Suppose -4c = 4j - 12, c + 2j = -3c + 8. Let g = -38989.5 - -38989. Let o = 1.9 + -2. What is the third biggest value in c, o, g? g Let o(l) = -l3 + 5l2 + 3. Let g be o(5). Let j = 0.05 - -0.15. Let v = -59 - -63. Which is the smallest value? (a) g (b) j (c) v b Let z(i) = i2 - 9i + 10. Let v be z(8). Suppose 0 = -3p + v + 13. What is the third biggest value in 4/9, -0.07, p? -0.07 Suppose 30 = -v + 5b, 2 = -4v - 3b - 3. What is the second smallest value in -3/4, v, 0? -3/4 Let g = 180.3 - 181.3. What is the smallest value in g, 3/5, 216? g Let w be -1 + 2(1 + 0 + -2). Which is the third biggest value? (a) -2/3 (b) w (c) 3/2 (d) 1/7 a Let z = -4.3 - -1.3. Let m = z - -2.5. Which is the second smallest value? (a) -3 (b) -0.3 (c) 5 (d) m d Let w = 658 + -666. Which is the third smallest value? (a) w (b) -5 (c) 3/4 c Let h = -5 - 31. Let f be (h/16)/(2/(-144)). Let q be 3/5 + f/(-120). Which is the biggest value? (a) -5 (b) q (c) 2 c Let p be (-2)/(-6) - (-32)/(-6). Let q be 1/41(-84)/21. Let v be 1/4 - q/28. Which is the second smallest value? (a) v (b) p (c) -2/7 c Let b = -2.348 - -0.048. Let p = b - 9.7. Let h = 7 + p. What is the second smallest value in -1/6, h, -1/3? -1/3 Let s be (-8)/1 + (-14 - -18). Let r be (4 - 2) + -5s/10. Which is the second smallest value? (a) 0.2 (b) 0 (c) r a Let y = 4.08 - 0.08. Let x = 3.1 - 2.4. Let n = 1.3 + x. What is the second biggest value in n, 1/8, y? n Suppose 5r + 24 = 3x, -4x + 30 = -3r + 9. What is the smallest value in -16, x, 5, 2? -16 Let s(n) = -5 - 3n2 + n2 + 0n2 + 13n + 4n2. Let y be s(-7). Which is the biggest value? (a) y (b) 0.03 (c) -0.3 (d) -1/7 a Let j = 19/33 - 2/3. Let k be (-2 + 0)/(-2) - 5. What is the third smallest value in j, 0.3, k? 0.3 Let f = -19 - -18. What is the biggest value in -5, f, -3, 7? 7 Let j = -5723 + 5726. Let o = 3 + -5. What is the second smallest value in 2, o, j? 2 Let x = -6.03 - -0.03. Let y be (2 - (-45)/(-21)) + (-171)/(-315). Which is the second biggest value? (a) 0.3 (b) x (c) y (d) -0.5 a Let t = -847 - -847. Which is the second biggest value? (a) t (b) 16 (c) 2/9 c Let k be (-8)/28 + 2/7. Suppose k = 3j + 3 - 0. Let r be j1 + 221/187. What is the third smallest value in 2/7, -5, r? 2/7 Let f = -2312 + 2315. What is the smallest value in -58, 1/3, f? -58 Let f be (-1 + 6)(-3)/75. Which is the smallest value? (a) f (b) 10 (c) 4/5 a Let t = 43/42 - 6/7. Suppose -1334d + 300 = -1359d. What is the smallest value in d, 1, t? d Let w = 5.4 + -5. Let s be	{ "pile_set_name": "DM Mathematics" }
36g2/5 - 174g/5 - 4/5. -2(g + 1)2(83g + 2)/5 Let -h3/6 - 665h*2/6 + 1339h/2 - 2013/2 = 0. Calculate h. -671, 3 Factor -5h2 + 15h. -5h(h - 3) What is d in -2d2/5 - 744d/5 - 69192/5 = 0? -186 Let 6d5 + 10d*4 - 8d*3 - 8d*2 = 0. What is d? -2, -2/3, 0, 1 Suppose 5c*5 - 5c*4 - 335c*3 - 475c*2 + 2250c = 0. Calculate c. -5, 0, 2, 9 Factor -2w3/9 - 92w*2/3 - 182w/3 - 272/9. -2(w + 1)2(w + 136)/9 Determine g so that 4g3 + 76g*2 + 448g + 768 = 0. -8, -3 Solve -g*2/3 + 878g/3 - 192721/3 = 0. 439 Solve -4q2/7 - 24q/7 + 108/7 = 0 for q. -9, 3 What is h in -2h2/3 + 22h/3 - 20 = 0? 5, 6 Solve -q*4/3 + 61q*3/3 - 420q*2 + 9200q/3 - 8000/3 = 0. 1, 20 Factor -t*4/6 + 112t*3/3 + 679t*2/6 + 227t/3. -t(t - 227)(t + 1)(t + 2)/6 Let 2g*4 + 12g*3 - 600g*2 + 3892g - 6762 = 0. What is g? -23, 3, 7 Factor 4v5 - 188v*4 + 1312v*3 - 2496v*2. 4v*2(v - 39)(v - 4)2 Factor -4p*2/3 - 208p/3 + 212/3. -4(p - 1)(p + 53)/3 Factor g*3 - 5g*2 + 3g + 9. (g - 3)*2(g + 1) Factor b*3/9 + 119b*2/9 + 77b/3 - 39. (b - 1)(b + 3)(b + 117)/9 Solve 98m5 + 252m*4 + 218m*3 + 72m*2 + 8m = 0. -1, -2/7, 0 Suppose 35l5/2 + 11l*4/2 - 115l*3 + 74l*2 - 12l = 0. What is l? -3, 0, 2/7, 2/5, 2 Suppose 2d5/5 + 2d*4/5 - 76d*3/5 - 44d*2 - 214d/5 - 14 = 0. Calculate d. -5, -1, 7 Let 3d5/7 + 15d*4/7 - 81d*3/7 - 33d*2 + 366d/7 + 72 = 0. What is d? -7, -3, -1, 2, 4 Factor 388i2/7 + 780i/7 + 8/7. 4(i + 2)(97i + 1)/7 Let u5 - 433u*4 + 46655u*3 + 47089u*2 = 0. What is u? -1, 0, 217 Let -2x*5/15 - 2272x*4/15 - 857288x*3/15 - 21257504x*2/3 + 87102080x/3 - 87795200/3 = 0. Calculate x. -380, 2 Let -3d2 - 39d/2 - 9 = 0. What is d? -6, -1/2 Factor 5r5 + 15r*4 - 115r*3 + 165r*2 - 70r. 5r(r - 2)(r - 1)2(r + 7) Determine v so that -4v4 + 836v*3 - 57960v*2 + 1313200v + 1372000 = 0. -1, 70 Factor 2v3/3 - 4v*2/3 - 2v/3 + 4/3. 2(v - 2)(v - 1)(v + 1)/3 Factor z5/4 + 11z*4/4 + 9z*3/2 - 19z*2 - 62z - 48. (z - 3)(z + 2)3(z + 8)/4 Determine f, given that -3f3/7 - 117f*2/7 - 312f/7 + 432/7 = 0. -36, -4, 1 Factor 3x5/8 - 3x*4 + 15x*3/8 + 75x*2/4. 3x*2(x - 5)*2(x + 2)/8 Factor -5f4/3 + 40f*3/3 - 110f*2/3 + 40f - 15. -5(f - 3)2(f - 1)*2/3 Suppose -3u*3/5 + 19u*2/5 - 21u/5 + 1 = 0. What is u? 1/3, 1, 5 Determine w, given that w*4/3 + 42w*3 + 1720w*2 + 62866w/3 - 79507 = 0. -43, 3 Factor -3k2/7 - 6k/7 - 3/7. -3(k + 1)2/7 Factor v2 - 36v. v(v - 36) Solve -7d*3/3 + 380d*2/3 + 676d/3 - 224/3 = 0. -2, 2/7, 56 Find y, given that -4y3 + 92y*2 - 316y + 228 = 0. 1, 3, 19 Factor -4r5/3 - 16r*4/3 - 4r*3/3 + 40r*2/3 + 16r/3 - 32/3. -4(r - 1)2(r + 2)*3/3 Factor -2w*2/7 - 296w/7. -2w(w + 148)/7 Factor -5p4 - 530p*3 - 9845p*2 + 222600p - 882000. -5(p - 7)2(p + 60)*2 Solve -10t*2 - 966t + 388 = 0. -97, 2/5 Let -3a5/4 + 3a*4/4 + 6a*3 - 9a*2 = 0. What is a? -3, 0, 2 Determine w, given that 2w*4 + 10w*3 + 10w*2 - 10w - 12 = 0. -3, -2, -1, 1 Determine x, given that 2x2/7 - 8x/7 + 8/7 = 0. 2 Factor w*4 + 5w3 - w2 - 17w + 12. (w - 1)2(w + 3)(w + 4) Factor 5q*2/2 - 39q/2 + 29. (q - 2)(5q - 29)/2 Solve -2p2/19 + 492p/19 - 4266/19 = 0 for p. 9, 237 Factor 5d3/4 - 21d*2/4 - 21d/4 + 5/4. (d - 5)(d + 1)(5d - 1)/4 Suppose -242h*5 + 8316h*4 + 5954h*3 - 19924h*2 + 6456h - 560 = 0. What is h? -2, 2/11, 1, 35 What is h in -2h5/5 + 82h*4/5 - 1216h*3/5 + 7856h*2/5 - 20832h/5 + 14112/5 = 0? 1, 6, 14 Find n such that 3n2 - 3n - 18 = 0. -2, 3 Factor -o*3/6 - 1027o*2/6 + 2060o/3 - 2062/3. -(o - 2)*2(o + 1031)/6 Determine n so that n*2 - 75n + 74 = 0. 1, 74 What is c in 2c5/17 - 74c*4/17 - 240c*3/17 = 0? -3, 0, 40 Let 2r*2 - 32r + 120 = 0. What is r? 6, 10 Find x such that -3x3 - 684x*2 - 45900x - 749088 = 0. -102, -24 Factor x*5 - 92x*4 + 2692x*3 - 20864x*2 - 118784x - 131072. (x - 32)*3(x + 2)*2 Factor 30k*2/7 + 352k/7 - 824/7. 2(k - 2)(15k + 206)/7 Find o, given that -35o*4 + 355o*3 - 855o*2 + 605o - 70 = 0. 1/7, 1, 2, 7 Find a such that 9a5/2 - 681a*4/2 - 819a*3 - 6a*2 + 468a = 0. -2, -1, 0, 2/3, 78 Suppose 9y2 + 255y - 174 = 0. Calculate y. -29, 2/3 Suppose -5z3 + 5z = 0. What is z? -1, 0, 1 What is f in 4f4 + 568f*3 - 4132f*2 + 5960f = 0? -149, 0, 2, 5 Find g such that 5g2 + 270g + 520 = 0. -52, -2 Factor 2q4 - 36q*3 + 144q*2 + 64q - 768. 2(q - 12)(q - 4)*2(q + 2) Factor -4r3 - 1056r*2 - 69696r. -4r(r + 132)*2 Solve 2h*5/7 - 32h*4/7 + 58h*3/7 - 4h2 = 0. 0, 1, 14 Find b, given that b3/4 - 17b2/4 - b/4 + 17/4 = 0. -1, 1, 17 Find o such that -o4/6 + 67o*3/6 + 455o*2/2 + 1791o/2 - 1134 = 0. -9, 1, 84 Suppose -4h2 + 128h + 132 = 0. Calculate h. -1, 33 Let 3w4/4 - 33w*3/2 + 63w*2 + 513w/2 - 1215/4 = 0. What is w? -3, 1, 9, 15 Determine k so that -25k3 + 65k*2 + 280k + 100 = 0. -2, -2/5, 5 Factor -4t5 + 68t*4 + 152t*3. -4t*3(t - 19)(t + 2) What is j in -12j*2 + 93j/2 - 45 = 0? 15/8, 2 Factor 4r3/3 - 13r*2/3 + r. r(r - 3)(4r - 1)/3 Solve -3t5/7 + 54t*4/7 + 24t*3/7 - 432t*2/7 - 48t/7 + 864/7 = 0. -2, 2, 18 Find r, given that -245r4/2 + 12985r*3/2 + 6625r*2 - 530r - 540 = 0. -1, -2/7, 2/7, 54 Find f such that -3f4/7 + 18f*3/7 - 3f*2 - 18f/7 + 24/7 = 0. -1, 1, 2, 4 Factor -3n3/2 - 259n*2/6 - 421n/3 + 100/3. -(n + 4)(n + 25)(9n - 2)/6 Suppose 39h*3 - 80h*2 + 4h = 0. Calculate h. 0, 2/39, 2 Factor t*4/3 + 85t*3/3 - 87t*2 + 263t/3 - 88/3. (t - 1)*3(t + 88)/3 Find l such that l*3/3 - 2l*2/3 - 12l + 24 = 0. -6, 2, 6 Factor -3y3 + 22y*2 + 127y + 102. -(y + 1)(y + 3)(3y - 34) Determine f so that -5f*3 - 65f*2 + 700f = 0. -20, 0, 7 Factor 3v4/7 + 96v*3/7 - 213v*2/7 - 306v/7. 3v(v - 3)(v + 1)(v + 34)/7 Factor 3c4 - 39c*3 + 54c*2 + 480c + 384. 3(c - 8)2(c + 1)(c + 2) Find u, given that -10u*4 - 25u*3 - 20u*2 - 5u = 0. -1, -1/2, 0 Factor -14t4 + 88t*3 - 150t*2 + 36t. -2t(t - 3)*2(7t - 2) Solve -k4/5 - 9k*3/5 - 5k*2 - 27k/5 - 2 = 0. -5, -2, -1 What is f in -2f5 - 164f*4 + 172f*3 + 496f*2 - 170f - 332 = 0? -83, -1, 1, 2 Factor 10n4/3 + 28n*3/3 + 26n*2/3 + 8n/3. 2n(n + 1)*2(5n + 4)/3 Factor 3i*3 - 15i*2 + 12i. 3i(i - 4)(i - 1) Suppose 12y*5 + 123y*4 + 462y*3 + 780y*2 + 552y + 96 = 0. What is y? -4, -2, -1/4 Factor -3f2 + 132f - 480. -3(f - 40)(f - 4) Factor 21a3/8 + 1581a*2/8 + 501a/2 + 111/2. 3(a + 1)(a + 74)(7a + 2)/8 Factor i*4/10 - 4i*3/5 - 2i2. i2(i - 10)(i + 2)/10 Solve -9g4 + 29g*3 + 138g*2 + 76g - 24 = 0 for g. -2, -1, 2/9, 6 Suppose c*5/8 + 3c*4/2 + 41c*3/8 + 15c*2/4 = 0. What is c? -6, -5, -1, 0 Factor -4k*2 - 20k + 24. -4(k - 1)(k + 6) Solve -2c3/17 - 56c*2/17 - 506c/17 - 1452/17 = 0 for c. -11, -6 Solve -8z5/3 - 7z4 + z3/3 + 9z2 + 7z/3 - 2 = 0 for z. -2, -1, 3/8, 1 Factor t*4/2 - 5t*3/2 + 3t2. t2(t - 3)(t - 2)/2 Find n, given that 4n2 + 1644n + 1640 = 0. -410, -1 Let -2z2 + 56z - 150 = 0. What is z? 3, 25 Factor -2u3/25 - 6u*2/25 - 6u/25 - 2/25. -2(u + 1)3/25 Factor l3/5 - 31l*2/5 + 6l. l(l - 30)(l - 1)/5 Factor -i*2/6 + 218i/3 - 23762/3. -(i - 218)*2/6 Factor -2m*2/7 - 496m/7 + 1000/7. -2(m - 2)(m + 250)/7 What is s in -3s2/5 + 174s/5 - 1071/5 = 0? 7, 51 Solve 2t2 + 22892t + 65505458 = 0 for t. -5723 Factor -36n3 + 68n*2 - 32n. -4n(n - 1)(9n - 8) Suppose 2k5/3 + 2k*4 - 4k*3/3 - 8k*2 - 16k/3 = 0. What is k? -2, -1, 0, 2 Factor -j*3 - 22j*2 + 4j + 88. -(j - 2)(j + 2)(j + 22) Factor -147c3 - 63c*2 + 135c + 75. -3(c - 1)(7c + 5)2 Factor -2k*4/19 - 4988k*3/19 - 3115002k*2/19 - 6215048k/19 - 3105032/19. -2(k + 1)2(k + 1246)*2/19 Find t such that 27t*4/8 + 507t*3/4 + 1485t*2/8 - 507t/4 - 189 = 0. -36, -14/9, -1, 1 Factor -t*4 + 792t*3 - 155224t*2 - 630432t - 633616. -(t - 398)*2(t + 2)**2 Determine	{ "pile_set_name": "DM Mathematics" }
biggest value in o, -3, z? -3 Let o = 1127 + -1101. What is the smallest value in 2/7, -1, o? -1 Suppose -8 = -3b - w, -5b - w = -4w - 18. What is the third smallest value in -0.14, 0.5, b? b Let i = 112 - 112.1. Let f = -1.8 + -0.2. Which is the third biggest value? (a) i (b) -5 (c) f b Let m = -0.43 + -0.07. Suppose q + 12 = -2q. Let s be (q/(-8))/((-20)/8). Which is the third smallest value? (a) m (b) s (c) -2/17 c Let f = 18 - 18. Let k = -99/2 + 1093/22. Which is the biggest value? (a) -0.03 (b) 3 (c) f (d) k b Suppose 3z - z = -24. Let s be -47 + (-1 + -2 - 1). Let t = s + 49. Which is the second biggest value? (a) t (b) z (c) 1/4 a Let v = -2449 - -4897/2. Which is the second biggest value? (a) v (b) 2 (c) -1/139 c Let q = -32.88 - 4.42. Let h = 38 + q. Which is the third biggest value? (a) h (b) -0.4 (c) 1 b Suppose 3z = -5m, m + 5 = -4z - 4m. What is the second smallest value in -0.3, -2/15, 2/5, z? -0.3 Let m be -5 - (-6 + 33/77). What is the third smallest value in m, -0.2, -7? m Let d be (-537)/150 + 3 + (-8)/(-16). What is the second biggest value in -6, d, 4? d Let m = 2 + -1. Let y be (-250)/(-40) + 1/(-4). Let w be (4/6)/(y/45). Which is the biggest value? (a) 3/8 (b) w (c) m b Let n be -913(0 + -3 + 4). Let m = -1765/2 - n. Let i = -30 + m. Which is the biggest value? (a) i (b) 0.2 (c) -5 a Let q = 11.5 - 8. Let x = q - 3.33. Let h = 0.13 + x. What is the third smallest value in 0.5, h, -2/5? 0.5 Let f = -1059.5 - -1060. Let r = 0 - -0.2. What is the smallest value in f, -1, r, 0.1? -1 Suppose -a - 2a + 4m = 6, -5m + 23 = 4a. Let z be (a/45)/((-3)/(-15)). Let u = 9.9 - 10. What is the third smallest value in u, z, 0.2? z Suppose -4 - 2 = 3f - 3m, 4m - 5 = f. What is the third biggest value in -2/23, f, -2/19, 0.5? -2/19 Let x = 1316 - 1315.6. Let h = 2 + -1. Let w = h - 0. Which is the second smallest value? (a) w (b) 3 (c) x a Let l = 10.02 + -0.02. Let k = -0.095 + -0.005. Which is the second biggest value? (a) l (b) k (c) 3 c Let i = -0.3 - -0.1. Let x = -2.28 - 0.72. Which is the second smallest value? (a) i (b) 0 (c) x a Let s = 79.703 - 74.55. Let w = -0.153 + s. Which is the second smallest value? (a) 3 (b) 0.3 (c) w (d) -0.01 b Let g = -3.6 - 1.4. Which is the third smallest value? (a) -2/7 (b) 0.77 (c) g b Let o = 7.44 + -3.44. Let t(c) = c2 - 2c - 2. Let j be t(3). Let y = 0.4 - -0.1. What is the smallest value in o, y, j? y Let z = 12 - 5. Let g = z - 4. Let n = 0.875 + 0.125. Which is the second biggest value? (a) n (b) 5 (c) g c Let p = 0.01 + -0.07. Let j = 8.06 + p. Let w = 8 - j. What is the second biggest value in -0.5, 1, w? w Let h = -51.8 - -7.8. What is the third smallest value in h, 0.1, 3? 3 Let z = -1693 + 1693.2. What is the smallest value in z, -0.3, 61/5? -0.3 Let p be 2/(-5)2/1. Let n = -381/4700 - -1/940. What is the second smallest value in p, -0.5, -5, n? p Let n be ((-6)/(-126))/(5/(-45)). Which is the second biggest value? (a) 1.1 (b) -3.2 (c) n c Let h be (15/(-20))/(3/2). Let y = -0.103 - -0.303. Which is the second smallest value? (a) y (b) -1 (c) -3 (d) h b Let y = -16 - -15. Let x = -0.1 + 0.3. Let k = 0.2 + -0.4. What is the second smallest value in y, k, x? k Let n = 0.21 - -11.79. Let h = -126 + 114.1. Let o = n + h. Which is the third smallest value? (a) -0.4 (b) 1/7 (c) o b Let k = 11.9 - 13.7. What is the third biggest value in k, -3, -3/5? -3 Let y = 593 - 594. Which is the biggest value? (a) -3/37 (b) 0 (c) y (d) -4 b Let a = -12 + 14. Let v = -75 + 72. What is the third smallest value in 0.13, 0.3, a, v? 0.3 Suppose -2n + 16 = 2b - 0b, -3b = n - 14. What is the second biggest value in -3, n, -8? -3 Let i = -696 + 1387/2. Which is the biggest value? (a) -2/19 (b) i (c) -5 (d) 0.3 d Let q = 1 - -3. Let m = 179.89 - 180. What is the third smallest value in q, 0, m? q Suppose -4x - 8 = -24. Let j be 28/12x/(-14). Let a = -1.97 + -0.03. What is the second smallest value in a, 1/4, j? j Suppose 0 = -r - 5x, 4r - 2x - 3x = -25. Let k = 14.4 + -13.8. What is the second biggest value in k, -1, r? -1 Let y = -0.01 + 3.01. Let v = 1.2 + 0.3. Let l = v + -1.5. Which is the biggest value? (a) l (b) y (c) -4 b Let n = -50.6 + 51. Let d = -0.6 - -3.6. Which is the smallest value? (a) n (b) -1 (c) d b Let t(z) = z2 + 9z + 3. Let y be t(-9). What is the second smallest value in 5, -62, y? y Let a be (1 - 0)(1 + 2). Let v be ((-3)/9)/(a/2). Let s = 48258 + -48254. What is the second biggest value in v, s, -5? v Let o = 5/83 + -98/249. What is the fourth biggest value in -12, o, 1/10, 2/5? -12 Let y = 22.9 - 17.9. Which is the second biggest value? (a) y (b) -5 (c) 1/8 c Let w be 4/5 + (-22)/10 + 2. Let t = 17 - 35/2. What is the smallest value in w, 10, t? t Let a be ((-6)/7)/(34/14). What is the smallest value in -1/2, -2/9, a, 4? -1/2 Let j = -0.502 + -2.567. Let g = j - -0.069. Which is the third biggest value? (a) -1/2 (b) g (c) -1/6 (d) -1 d Let c = 25 - 24.73. What is the second biggest value in c, -2/9, 1/2, 0.3? 0.3 Let r = -2.95 + 3. Let u be ((-618)/(-5))/3 + 1. Let y = u + -3577/85. Which is the third smallest value? (a) -1/3 (b) r (c) y c Let k = -284 - -284.08. What is the third smallest value in 3, -3/2, k, -1? k Let g = -1.04 - 1.96. Let d = -0.08 - -0.58. What is the biggest value in d, -8, g? d Let h = -0.1 - -0.08. Suppose -2 = 2z - 2f, -9f = -5z - 10f - 11. Which is the smallest value? (a) -3/8 (b) h (c) z (d) -5/6 c Let x = 698 - 698.08. Let l be 117/(-7)-1. Let v = l - 241/105. Which is the second smallest value? (a) x (b) -0.5 (c) v a Let b = 667/4 - 2003/12. What is the smallest value in b, 1, -97? -97 Let i = -4.38 + 15.3. Let t = i - -0.08. Let k = t + -9. Which is the third smallest value? (a) -2 (b) 5 (c) k b Let v(c) = c*2 - 9c + 23. Let j(l) = -l*3 - 2l*2 + 3l + 10. Let p be j(-2). Let a be v(p). Let h = -4 + 4.4. What is the biggest value in 0.1, h, a? a Suppose -d - v - v + 10 = 0, 0 = 3v - 6. Suppose 5 + 1 = dt. What is the third biggest value in t, 0, 0.5, 4? 0.5 Let z = 3.01 - 0.01. Suppose 3l + 122 = -3j + 107, 0 = 3j - 4l - 20. Which is the second biggest value? (a) j (b) z (c) 0.2 c Suppose 5l = -2o - 1, -4l + 4o = -4 - 12. Let n = 583 + -848. Let q = n + 3443/13. Which is the third biggest value? (a) 2 (b) q (c) l b Let p = -6/55639 + -481444243/222556. Let t = -2217 - p. Let z = t - -1943/36. What is the biggest value in z, 2, -3? 2 Suppose 0 = -4l - 0l + 112. Let q be ((-6)/15)/(l/(-10)). Let m = -5 - -2. What is the second smallest value in q, m, -0.4? -0.4 Let m = 23 + -13. Let a = m + -6. Suppose -4t = -r - 15, -ar - 4 = -0t - 2t. What is the second smallest value in 0.3, -2, r? 0.3 Let n = -93.1 - -91.1. Which is the third biggest value? (a) n (b) 2 (c) -0.1 (d) 7 c Let o = -16 + 8. Let n be o/2 + 5/2. Let g = -1 + 5. Which is the third smallest value? (a) n (b) g (c) -0.3 b Let y = 0.5 - -5.5. Let n = 976 + -4878/5. Which is the second biggest value? (a) n (b) -5 (c) y a Let t = 0.13 + 15.87. Let r = -127 + 110.93. Let n = t + r. Which is the third biggest value? (a) 1 (b) n (c) -2 c Let g = 235.8 + -236. Which is the second smallest value? (a) 6 (b) g (c) -2 b Let s be ((-18)/15)/((-483)/(-70)). Let x = s - -31/46. What is the smallest value in x, 5, -4? -4 Let t = -203.4 + 204. What is the third smallest value in -1.1, -0.4, -3, t? -0.4 Let c = -43 + 173/4. Suppose -3g + 30 = -b - b, 0 = b - 4g + 15. Let h be 2/8 - b/4. What is the third smallest value in 5, c, h? 5 Let y be (-3)/(-12) + (-10)/(-24). Let t = -3.25 - -3.75. What is the third smallest value in -5, y, 6/11, t? 6/11 Let j = 0.07 - -35.93. Let s = j - 34. What is the second biggest value in 0.1, s, -2/3? 0.1 Let f = -177.58 - -179. Let j = f - -0.58. Which is the second smallest value? (a) j (b) -2/3 (c) -29 b Let j = -1 + 1. Let g = -0.1 - j. Let x = 13/581 - -153/581. What is the third biggest value in -4, x, g? -4 Let f = 35 + -38. Suppose -9 - 21 = 5*d. Let s = d - -1. What is the second smallest value in f, s, 0.2? f Let k = 927 - 929. What is the second biggest value in 1, k, -0.3, 0.098? 0.098 Let o(z)	{ "pile_set_name": "DM Mathematics" }
3 (d) 4 (e) -2 b What is the nearest to -0.01 in 5/4, 21, -0.06, -2, 25? -0.06 What is the nearest to -172 in -2/7, 56, 1/9, 4? -2/7 Which is the nearest to -3.9? (a) -0.2 (b) 3 (c) 2/47 (d) -4 d Which is the closest to -0.2? (a) 2.243924 (b) 1 (c) -0.03 c What is the nearest to -1/5 in -20, -3/77, -1370/9? -3/77 Which is the nearest to 17/9? (a) 1.6 (b) -3/2 (c) 238.2 (d) -4 a What is the nearest to 2/7 in 0.128, -23, 3/13, -2/625? 3/13 What is the nearest to 2/5 in 7/3, 136, -6.7? 7/3 Which is the nearest to 9? (a) 0.11 (b) 0.05 (c) 0.27 (d) 0.071 (e) -0.39 c What is the nearest to -321/2 in -2, -64, 0, -0.5, -0.1? -64 What is the closest to 1/4 in 0, -15822882, 3? 0 What is the nearest to -0.2 in -2, 8086, 1/6, 3? 1/6 Which is the closest to 8? (a) 0.0822 (b) 210 (c) -5 (d) 3/5 d Which is the nearest to -0.4? (a) 3 (b) 8.09 (c) 2/3 (d) 0.4 (e) -7/4 (f) -2/33 f Which is the nearest to -19/18? (a) -4/5 (b) -27 (c) -2/11 a Which is the closest to 5? (a) 7 (b) 0.1 (c) -72/43 (d) -3/5 a What is the closest to 0 in -4/11, -0.34, -0.2, -14, 2, -9/2? -0.2 What is the closest to 0.1 in -2, -52, -0.4, 5, 0.1726? 0.1726 Which is the closest to 1? (a) 0 (b) -2.714 (c) 21 a Which is the closest to 110? (a) -0.9 (b) -1 (c) -332 (d) -94 a What is the closest to 538 in 8/3, -114, 0.4? 8/3 Which is the nearest to -0.1577? (a) 7 (b) 31 (c) 9 a Which is the closest to 0? (a) -0.5 (b) -0.057 (c) 0.69133 b Which is the nearest to -218/3? (a) -0.4 (b) 0.4 (c) 1.8 (d) -2/17 a Which is the closest to -0.1? (a) -1738 (b) -1/3 (c) 5/7 (d) -3 b Which is the closest to 0.01? (a) 2 (b) -3 (c) 2606 (d) 2/3 d Which is the nearest to 0.1? (a) -484 (b) -26 (c) 2/9 (d) 0.03 (e) -24 d What is the closest to -2/7 in 0, 0.5, 57, -3/2, 3/74? 0 What is the nearest to 0.01 in -5, 2, -365, -15, -3? 2 What is the closest to -0.2 in -0.5, -7.4, -195818/9, 5? -0.5 What is the closest to -1/16 in -75, 4, -21, -3? -3 Which is the closest to -11/5? (a) 1.9 (b) -0.2 (c) 48667 b Which is the nearest to 2? (a) 5449 (b) 1/13 (c) -2/3 (d) 15/4 d Which is the closest to -3? (a) 1/11 (b) 0.08 (c) -2.3 (d) -6 c What is the closest to -7 in 0.09, -0.3, -4, -0.5388? -4 Which is the closest to -150? (a) -1/6 (b) -4 (c) 33.7 b What is the closest to 1 in -3/2, -25837, 4, 391? -3/2 What is the closest to 11 in -5, -0.08, -0.1, 0, -6318, 5/2? 5/2 What is the closest to 2/3 in 7, 3/166, 331, 3, -0.1? 3/166 Which is the nearest to 3/73? (a) -3 (b) -2/5 (c) -0.78 (d) -10/11 b Which is the nearest to -4? (a) 791 (b) 2 (c) 0 (d) 89 c Which is the nearest to -14? (a) 182 (b) -1/14 (c) 4 (d) -0.049 (e) -0.2 e Which is the nearest to 2.6? (a) -0.2 (b) 0.4 (c) 0 (d) 1/7 (e) 18.227 b What is the closest to 0.4 in -2.05, -1/2, -1236, 5? -1/2 What is the closest to -2/5 in 1.397, 0.01, -7/3? 0.01 Which is the nearest to -2? (a) -159 (b) -5.67 (c) 3 (d) 1 d What is the closest to -15978 in 0.3, -4, -2/9, 78? -4 What is the nearest to 4 in 0.3, -2/9, -2.43, -0.001, 1/6? 0.3 Which is the nearest to -4? (a) -2/5 (b) 2 (c) 631/2 (d) 17 (e) 0.2 a What is the closest to -368 in 10, 185, 1/7? 1/7 Which is the nearest to -250? (a) 98 (b) -2/15 (c) -25.1 c Which is the nearest to 1? (a) 3 (b) 2/5 (c) 5/4 (d) 627 c Which is the nearest to -4? (a) -2/3 (b) 1 (c) -71 (d) -3.72 (e) -0.04 d What is the nearest to 0.6 in 1/7, -50111, -1, 4, -0.2? 1/7 What is the nearest to 1 in -0.4, 2/9, 3/5, 1/3, 0.2, -3747626? 3/5 Which is the closest to 106? (a) -3/4 (b) -63 (c) -7 (d) -2/7 d Which is the closest to -1022.98? (a) -1 (b) -0.2 (c) 0.2 (d) 4 (e) -10 e Which is the nearest to 0.2? (a) 9 (b) -44 (c) 13407 a Which is the nearest to 2? (a) 1/26 (b) 2 (c) -3/5 (d) -1462 b What is the nearest to 1/4 in -2, 4/13, 1/5590? 4/13 What is the nearest to 857 in 261/2, 1, -2, 3? 261/2 Which is the nearest to 15/11? (a) -5 (b) -66 (c) 4/9 c What is the closest to 10649 in 1/9, -5, -0.2, 1063? 1063 Which is the nearest to 1/4? (a) -1/3 (b) 6 (c) 0.4 (d) 2 (e) 41871 c What is the closest to -0.02 in 1, 3, -93, -233, 9? 1 Which is the closest to 0.23? (a) 10/99 (b) 1/3 (c) -1030 (d) 2 b Which is the nearest to -2/55? (a) -0.1 (b) 981 (c) 3 (d) -1 (e) 0.199 a Which is the closest to -8? (a) 1/8 (b) 3/7 (c) 0.3 (d) 8.4 a Which is the nearest to -7? (a) -2/19 (b) -1/7 (c) -9 (d) 4 (e) 138 c What is the closest to 1/4 in -5/2, 0.5769, -12, 0.5? 0.5 What is the nearest to -1/93624 in -2/3, 2.3, 5? -2/3 Which is the closest to -2? (a) 2/31 (b) -3 (c) 8.5002 (d) -0.2 b Which is the nearest to -1? (a) -2/331 (b) 2021/11 (c) -2 a What is the nearest to -3/5 in 10483/45, 3, 2/3? 2/3 What is the closest to 3 in 3, -858, -0.2, 0.05, -0.5? 3 Which is the closest to -0.1? (a) 264.63 (b) -3 (c) -828 b Which is the closest to -1/3? (a) -240 (b) -2 (c) 0.187 c What is the nearest to -1 in 1/423, 18, -16? 1/423 Which is the closest to 2/7? (a) 0.1 (b) 0 (c) -14962476 a Which is the closest to -0.933? (a) 4 (b) 676 (c) 2 c What is the closest to -0.5 in 6, 0.8, -19, 486/11, 4, 0? 0 Which is the closest to 116? (a) 1 (b) 0.203 (c) -1.7 (d) 5 d Which is the closest to 1/12? (a) 4 (b) 1236 (c) -8/3 c Which is the closest to -612? (a) -11/5 (b) 4.613 (c) -2/7 a What is the nearest to 2/17 in -3/11, -1755014, -0.3? -3/11 Which is the closest to -2? (a) 0.2 (b) -2/11 (c) -204 (d) 702 b Which is the nearest to 638? (a) 1/4 (b) -62 (c) -4/13 a What is the closest to -0.2 in 810, -1/12, -5, -4, -0.18? -0.18 What is the nearest to -0.7 in 1/30, 1, 7.1, -19.7? 1/30 What is the closest to -8.7 in 0.5, 3/7, -4058/7, 4, -3/4? -3/4 What is the nearest to 5 in 6, -3/5, 1372, 3, 2/5, -21? 6 What is the closest to -0.29 in 8, 2/11, -0.5, -1.298, -0.1? -0.1 What is the closest to -39/5 in -1, 0, -11181, -4, -2/3? -4 Which is the nearest to -2.2? (a) 22 (b) -4686 (c) -3 c Which is the closest to 0.1133? (a) -56 (b) -4 (c) -31 (d) 1/5 d Which is the closest to -0.057? (a) 21.6 (b) 2860 (c) -5 c What is the closest to -3/10 in 8, 0.99, 22, -3? 0.99 What is the nearest to 1 in -254, 923, -0.3, 0.8, 3/7? 0.8 Which is the closest to 0.173? (a) -0.025 (b) 0.3 (c) 3 (d) 1 b What is the closest to 28 in -2, 550, 5, 3? 5 What is the nearest to 7030815 in 0, 3, 0.07, -3/7, -5? 3 Which is the closest to -265/7? (a) -45 (b) 2 (c) 0 (d) -1/4 a Which is the nearest to -20? (a) 40988 (b) -2/13 (c) 0.2 b Which is the closest to -2? (a) 0.066 (b) 0 (c) -5/3 (d) -30 (e) -123 (f) -0.4 c Which is the closest to 4/25? (a) -2/153 (b) 4 (c) 248 (d) 5 a Which is the nearest to 5? (a) 1/9 (b) -0.1 (c) -2/723 (d) 0.3 (e) 0.2 d Which is the closest to -4? (a) 8/311 (b) -98 (c) 1/6 a Which is the closest to -1/2? (a) -1072 (b) 5 (c) -10/7 (d) 9 c Which is the closest to 1? (a) -5/4 (b) -47 (c) 4 (d) -10.4 (e) -779 a What is the closest to 0.12 in 15, 2, -2/5, 0.09, 2/13, -122? 0.09 What is the nearest to 0 in 10, 11, -6, -52? -6 What is the closest to 2/39 in -1/9, -192, 4/7, -130? -1/9 What is the closest to -387 in 22, -2/13, 121? -2/13 Which is the nearest to -474? (a) -3 (b) 0.5 (c) -5 (d) 78 (e) 0.14 (f) -0.2 c What is the nearest to 8 in 3, 151, 10, -0.1, -5/4, 5? 10 What is the nearest to 8 in -0.17, -1/5, 51/2, 4/5, 5/2, 0.14? 5/2 Which is the nearest to -1? (a) -5 (b) -1.3817 (c) 1/10 (d) 5 (e) 26 b What is the nearest to -289 in 146, 39, -5/3? -5/3 Which is the nearest to -1/3? (a) -1/4 (b) 1/3 (c) -8/9 (d) 0 (e) -0.1 (f) -28158/5 a Which is the closest to 67? (a) -1 (b) -1/29 (c) -4 (d) 0.1 (e) -0.045 d Which is the closest to 6? (a) 2 (b) -0.3 (c) 26 (d) -4 (e) -2069 a What is the closest to 14/27 in 2/23, -16/19, 4? 2/23 Which is the nearest to 0.1? (a) -5/341 (b) 8 (c) -1/3 a Which is the nearest to 1? (a) 70 (b) 4/7 (c) -0.1 (d) -17363 (e) 0.03 b What is the nearest to -0.1 in 2, -1, 2/7, -2/5, -628536? -2/5 Which is the closest to -0.3? (a) 68 (b) -4/9 (c) -0.2433 (d) 0.4 (e) 13 c What is the nearest to -7 in 1, 0.18, 0, -0.12, 5? -0.12 What is the nearest to -0.1 in -0.025, -0.3, 0.1563054, -4? -0.025 What is	{ "pile_set_name": "DM Mathematics" }
places. 46.97 What is 0.11099587 rounded to 4 decimal places? 0.111 Round 3792.41636 to the nearest one thousand. 4000 What is -0.1770066466 rounded to 3 decimal places? -0.177 What is 0.03095259998 rounded to 6 dps? 0.030953 Round -384694.35 to the nearest 1000. -385000 Round 187.915804 to two decimal places. 187.92 What is -6548302870 rounded to the nearest one hundred thousand? -6548300000 What is -72.313877 rounded to two dps? -72.31 Round 0.324081514 to two dps. 0.32 Round 472719251 to the nearest 1000000. 473000000 Round -405410.5466 to the nearest 10. -405410 What is -155840.0663 rounded to the nearest 100? -155800 Round 0.000097186256 to 6 dps. 0.000097 What is -2.60952227 rounded to 4 decimal places? -2.6095 Round 18810764200 to the nearest 1000000. 18811000000 Round -264045.719 to the nearest 100000. -300000 Round -0.0470371248 to 3 dps. -0.047 Round 0.0976305298 to 3 decimal places. 0.098 Round 6.78635972 to one decimal place. 6.8 What is 7857976450 rounded to the nearest one million? 7858000000 Round -874960.6 to the nearest 1000. -875000 What is -0.111413733 rounded to five dps? -0.11141 Round -0.0000061281824 to 6 decimal places. -0.000006 Round 20.052858 to the nearest 10. 20 What is -23751807.16 rounded to the nearest one million? -24000000 What is -0.000344370318 rounded to 6 decimal places? -0.000344 What is -2151.34501 rounded to the nearest 10? -2150 What is 11281747.6 rounded to the nearest ten thousand? 11280000 Round 109354203 to the nearest ten thousand. 109350000 Round 3171518.286 to the nearest 100000. 3200000 Round 0.0002599115892 to 5 dps. 0.00026 Round 12.7228647 to two dps. 12.72 What is -14102494.8 rounded to the nearest ten thousand? -14100000 Round -16609705.78 to the nearest 100. -16609700 What is 3136.4524 rounded to the nearest 10000? 0 Round 3384443.13 to the nearest 10000. 3380000 Round 1018916.08 to the nearest 100. 1018900 Round -0.0000790116446 to 7 dps. -0.000079 Round -0.0316433672 to three dps. -0.032 Round -0.0007152261 to four decimal places. -0.0007 What is -0.007994300665 rounded to 3 dps? -0.008 Round -122709859 to the nearest ten thousand. -122710000 Round 91795450800 to the nearest 1000000. 91795000000 Round -1402.3502108 to the nearest 10. -1400 What is -0.64793714 rounded to three dps? -0.648 Round -17284.30135 to the nearest ten thousand. -20000 Round 0.284145505 to 1 decimal place. 0.3 What is -5853.107721 rounded to one decimal place? -5853.1 What is 0.000001047194026 rounded to 7 dps? 0.000001 Round 0.0000116502721 to seven decimal places. 0.0000117 Round 5289.162476 to the nearest 1000. 5000 Round -0.0105412609 to 6 dps. -0.010541 What is 0.002146673673 rounded to 4 dps? 0.0021 What is 1.710155105 rounded to three decimal places? 1.71 Round 71552.577 to the nearest one hundred. 71600 What is -1988.82927 rounded to zero decimal places? -1989 Round -458382.1 to the nearest 1000. -458000 Round 0.0000262108434 to 5 dps. 0.00003 Round 0.9727111371 to 5 decimal places. 0.97271 What is -4297153239 rounded to the nearest 100000? -4297200000 Round 0.1700189817 to 4 decimal places. 0.17 Round -0.00000659687872 to 7 dps. -0.0000066 What is -0.001031665936 rounded to five decimal places? -0.00103 What is 454.0023276 rounded to the nearest 10? 450 Round -0.00066480186 to 6 decimal places. -0.000665 What is -4.75977588 rounded to the nearest 10? 0 What is 0.000000115033812 rounded to seven dps? 0.0000001 Round 0.000165624965 to seven dps. 0.0001656 Round 3268162740 to the nearest 1000000. 3268000000 What is 0.1929885541 rounded to three decimal places? 0.193 Round 43.2459764 to the nearest ten. 40 What is 0.00306626527 rounded to four decimal places? 0.0031 Round 0.00173749662 to 7 decimal places. 0.0017375 What is 2667823.74 rounded to the nearest 1000? 2668000 Round -15248322530 to the nearest 1000000. -15248000000 What is -326.1541192 rounded to 2 dps? -326.15 Round 4682208.185 to the nearest ten thousand. 4680000 What is -2432430.844 rounded to the nearest one hundred? -2432400 Round -0.002641103947 to seven decimal places. -0.0026411 Round -2581865.09 to the nearest one hundred thousand. -2600000 Round 0.26751906 to 3 decimal places. 0.268 Round -143.8880461 to two dps. -143.89 What is 0.000034507865 rounded to six dps? 0.000035 Round 62149.4764 to zero dps. 62149 Round -0.00153898305 to five decimal places. -0.00154 What is 0.000000261004992 rounded to seven dps? 0.0000003 Round -10527770.6 to the nearest 100000. -10500000 Round 13368489.7 to the nearest one thousand. 13368000 Round -0.000131622761 to six dps. -0.000132 What is -0.0039583769 rounded to 4 dps? -0.004 What is 9563508500 rounded to the nearest 1000000? 9564000000 Round -330.3701119 to 2 decimal places. -330.37 Round 0.000066762391 to seven decimal places. 0.0000668 Round -128.1252532 to the nearest ten. -130 What is -3173.166156 rounded to the nearest 10? -3170 What is 2.568023146 rounded to 3 decimal places? 2.568 Round 2585633.19 to the nearest 1000. 2586000 What is -0.004473813619 rounded to 5 decimal places? -0.00447 Round -0.01924685472 to three dps. -0.019 Round 330337062.2 to the nearest 10000. 330340000 Round 6901561.6 to the nearest one hundred thousand. 6900000 What is 1.204806645 rounded to two decimal places? 1.2 What is 0.01292920977 rounded to 3 decimal places? 0.013 Round -0.0001854407702 to 7 decimal places. -0.0001854 What is -0.00698000626 rounded to three dps? -0.007 What is -24.571658429 rounded to two dps? -24.57 What is -117259940 rounded to the nearest one hundred thousand? -117300000 Round -24518.735 to 0 decimal places. -24519 Round -0.0054750184 to 4 decimal places. -0.0055 Round -218.028972 to two decimal places. -218.03 Round -0.373213737 to five dps. -0.37321 What is -0.4053758979 rounded to two dps? -0.41 What is -107.45287698 rounded to two dps? -107.45 What is -5.78439408 rounded to three decimal places? -5.784 Round -1297976.444 to the nearest one hundred thousand. -1300000 What is -0.003925367796 rounded to three dps? -0.004 What is -0.00327195414 rounded to 4 dps? -0.0033 Round 1109.11323 to zero decimal places. 1109 Round 0.000000228746893 to seven decimal places. 0.0000002 Round -0.0278863117 to 3 decimal places. -0.028 Round -1061582789 to the nearest one million. -1062000000 Round -0.593273208 to 2 dps. -0.59 What is -3000547050 rounded to the nearest 1000000? -3001000000 What is -790698.346 rounded to the nearest 100? -790700 What is 0.0265439633 rounded to 3 decimal places? 0.027 What is 274616.703 rounded to the nearest 10? 274620 Round 311166.1291 to the nearest 10. 311170 What is -802.9128 rounded to the nearest integer? -803 What is -8244.03757 rounded to the nearest 10? -8240 What is -1946.154153 rounded to the nearest 1000? -2000 Round -720.802029 to the nearest one thousand. -1000 What is -21291.1676 rounded to the nearest one hundred? -21300 Round -33186770.85 to the nearest 1000. -33187000 Round -0.044124339 to 4 dps. -0.0441 Round -6122656.695 to the nearest one hundred thousand. -6100000 What is 0.38209717 rounded to four decimal places? 0.3821 Round 386632.4247 to the nearest 10000. 390000 What is 0.0000040769927 rounded to six decimal places? 0.000004 Round -1194037100 to the nearest 1000000. -1194000000 What is -0.00000106972415 rounded to 7 dps? -0.0000011 What is -0.24104806 rounded to 3 decimal places? -0.241 What is 5621075.3 rounded to the nearest 100? 5621100 Round 1789.29929 to the nearest ten. 1790 What is -40.77913881 rounded to the nearest integer? -41 What is 2.06880097 rounded to one decimal place? 2.1 Round -0.05525529564 to six dps. -0.055255 What is 0.042237129 rounded to four decimal places? 0.0422 What is -240843.476 rounded to the nearest one thousand? -241000 What is -22.93644997 rounded to 1 dp? -22.9 What is -1.1926528 rounded to 4 dps? -1.1927 Round 57667396 to the nearest 100000. 57700000 Round 115029.019 to the nearest 10. 115030 Round 2073599.46 to the nearest 1000. 2074000 What is 0.000321772129 rounded to 6 dps? 0.000322 Round 130.2713367 to zero decimal places. 130 What is -0.00001923835434 rounded to six dps? -0.000019 Round -1487682840 to the nearest 100000. -1487700000 What is -22.207448 rounded to 3 decimal places? -22.207 What is 34.18401	{ "pile_set_name": "DM Mathematics" }
, c? 0.4 Suppose -n = -3i - i - 17, 5n + 11 = -4i. Let g = -1 + i. Suppose 2m = 6m - 4. What is the second smallest value in g, m, 0.5? 0.5 Let y = -90.27 + 90. Which is the third biggest value? (a) y (b) 2 (c) -5 c Let w = 149 - 599/4. Which is the smallest value? (a) 0.5 (b) -3 (c) w b Let i be (1/(-5))/(7/(-14)). What is the fourth biggest value in i, -4, -2/7, 10? -4 Let h = 0.137 - 0.027. What is the fourth smallest value in -1, 5, 2, h? 5 Suppose 0z + 5z = -130. Let u be z/12 + (-4)/(-2). Which is the third biggest value? (a) -2 (b) 4 (c) u a Let h be (8/20)/((-2)/(-20)). Let o be (-2)/(-8) - (-1)/h. Let q be (1/5)/(3/5). What is the third biggest value in 3, o, q? q Let v = -62 - -67. Let k = -5.1 - -1.1. What is the second smallest value in 2/17, v, k? 2/17 Let l = 55 + -54.4. What is the third biggest value in -3/4, -3/7, -5, l? -3/4 Let w = -0.09 - -0.1. What is the smallest value in -4/3, w, -4? -4 Let y be (-1)/(2/3 - 1). Which is the third biggest value? (a) 5 (b) y (c) 0.1 c Let m = -0.1 - 1.9. Let y = 19 + -19.3. What is the biggest value in m, -2/15, y? -2/15 Suppose 0 = 6k + k + 7. Which is the smallest value? (a) 5/2 (b) 2/9 (c) k c Let m = 1166.169 - 0.169. Let t = m - 1161.03. Let p = -0.03 - t. Which is the second smallest value? (a) -4 (b) 0.5 (c) p a Let n = 25 + -13. Let z be (-2)/(-5) - n/(-45). What is the third smallest value in -1, 2/5, z? z Let p = 2 - 2.1. Let k = 0.01 - 0.03. Let j = k + -1.98. Which is the third smallest value? (a) 5 (b) j (c) p a Let x be ((-7)/(175/10))/(12/(-5)). What is the second smallest value in x, 0.5, 0.3? 0.3 Let v = 0 - 0.2. Let o be ((-4)/(-2))/(-2 - -1). Let a be ((-4)/8)/(o/(-16)). What is the third biggest value in 0.1, a, v? a Let m = 3.7 + 1.3. Let g = m + -5.17. Let l = -0.03 + g. What is the biggest value in l, -0.3, 0.2? 0.2 Let g = -230 + 2072/9. Which is the third smallest value? (a) g (b) 4 (c) 0 b Let r(d) = -2d2 + 14d + 17. Let q be r(8). Let l = 21 + -62/3. Which is the biggest value? (a) q (b) l (c) 2 c Let k = 53 + -476/9. Which is the third smallest value? (a) k (b) -0.4 (c) 2 c Let c be 5143/24 + 7/21. Let k = 215 - c. What is the second biggest value in 1, k, -3? k Let b be ((-21)/(-9) - 4)-3. What is the third smallest value in b, 4/7, 3/11? b Let l = 15 + -9. Let t = -4 + l. What is the second smallest value in t, -2, -2/5? -2/5 Suppose -3t - 2 = 10. Let g = -0.1 + -0.24. Let k = g - -0.04. Which is the second biggest value? (a) -1 (b) t (c) k a Let g = -3.8 + 0.8. Let x = g + 0. What is the smallest value in -4, 0, x? -4 Suppose -4t - 13 + 3 = -q, 0 = 5t + 2q + 19. What is the biggest value in 0.2, t, -2/11, 1? 1 Let b = 3 - 10. Let d be b/(-3) + 6/9. Let v = -5 + d. What is the second smallest value in 3, -0.4, v? -0.4 Let p = -0.7 + 0.2. Let z be 8/(-48) + (-898)/12. Let o be z/(-126) - (-2)/(-4). Which is the second smallest value? (a) o (b) 0.1 (c) p a Let p be 2/(-3) - 11/(-3). Let n be ((-3)/(-24))/((-4)/(-8)). What is the second smallest value in n, p, -3? n Let z be (-1)/(-2)8/12. Let y(f) = -f*3 + 5f*2 + 8f - 12. Let d be y(6). Which is the biggest value? (a) z (b) 0.4 (c) d b Suppose 26 = -5q + 3l, -2q + 3q + 2l = 0. Let k = 1.29 - -0.01. Let d = k + -0.3. Which is the second biggest value? (a) -5 (b) q (c) d b Let a = -2.9 + 3. Let k = 16 - 13. What is the smallest value in -1/3, a, k? -1/3 Let n be 324/33 - 4/(-22). Suppose -5c - 2t = n, 0 = 3c - 0t + t + 6. Let j be 0/c + 3/12. What is the biggest value in 1/7, -2/7, j? j Let s = -0.8 + -4.2. Let d = -0.9 - 3.1. Which is the third smallest value? (a) s (b) 4 (c) d b Let r = -839/8 - -105. Which is the third biggest value? (a) -0.5 (b) -11 (c) r b Let y = -1.06 - -0.06. Which is the third biggest value? (a) -1/14 (b) y (c) -0.1 b Let m = 34 - 25. Let k = 6 - m. Which is the second biggest value? (a) -1 (b) k (c) 0 a Let w = 28 - 47.6. Let s = -20 - w. Let g = -1 - -6. What is the third biggest value in s, g, -1/4? s Let y = 9 - 8.2. Let c = y + -0.9. What is the biggest value in -5, c, -1? c Let o = 0.27 - 7.37. Let l = o + 7. Which is the second biggest value? (a) 5 (b) -4 (c) l c Let x = -0.01 - -0.12. Which is the third smallest value? (a) 0.5 (b) -0.1 (c) x a Let u = 5 - 5.4. Suppose 3 = -4o + v, 4o - 3o + 4v + 22 = 0. Which is the third biggest value? (a) 3 (b) o (c) u b Suppose 15 - 40 = -5s. Let a be ((-18)/12 - -2) + -2. What is the second biggest value in a, 0.3, s? 0.3 Let t = -5 - -8. Let z = 28.44 + -28. Let q = z + -0.04. What is the biggest value in q, -1, t? t Suppose 0 = 3f - 0 + 3. Which is the third smallest value? (a) 1 (b) 7 (c) f b Let w = 0.09 - -0.21. Which is the second biggest value? (a) 0.1 (b) w (c) 0 a Let c = -6 - -5.95. Let h = c + 0.55. What is the biggest value in h, -1/4, -0.1? h Let d = 0 - -1. Suppose -5 - d = -3y. Let l be (-8)/28 - 5/7. What is the biggest value in l, y, -0.1? y Let j = -0.16 - -0.31. Let d = j - 5.15. What is the biggest value in d, -0.1, 0.1? 0.1 Let z = 0.1 - -0.1. Let f be 40/40 + 0 + (-3)/2. What is the third biggest value in z, -1, f? -1 Let u = -2 + 0. Suppose -3l - 6w + w + 5 = 0, -2 = -2w. Let p = -2.5 + 3.5. Which is the second smallest value? (a) l (b) p (c) u a Suppose -w = -0w - 4. Let i = 0 + w. Which is the third biggest value? (a) 0 (b) i (c) 0.1 a Let h = -35 - -31. What is the smallest value in 2, h, -0.5, -0.3? h Let j = 39 - 39.5. Which is the second biggest value? (a) -0.7 (b) -2/17 (c) j c Let d be (1 - -2) + (144 - 10). Let v = 681/5 - d. Let l = -1/4 + -1/12. Which is the smallest value? (a) 3/2 (b) l (c) v c Let u = 911/10 + -91. Suppose 2q = 12 - 4. Which is the second smallest value? (a) u (b) q (c) -1 a Let y = -3.1 - -2.6. What is the third biggest value in 0.2, -6, 4, y? y Let t be -1 - (-37)/7 - 4. Which is the smallest value? (a) t (b) -0.1 (c) 0 b Let c = 42 - 212/5. Let g = -3.8 + 4. Let b = 5278/15 + -352. What is the third biggest value in c, b, g? c Let u = -24 - -35. Let n = u - 6. Which is the third biggest value? (a) -2/5 (b) n (c) 1 a Let d = 7 + -41/6. What is the smallest value in -5/6, d, 5? -5/6 Let f be 1-26/4. Let b = 3.3 + -3. Let v = -2 - -3. What is the third biggest value in f, b, v? f Let g = -19 + 17. What is the smallest value in 2/11, 0, g? g Let u = 3 - 2.8. Let q = -0.3 - u. Let z = -5 - -9. What is the smallest value in q, z, 3/2? q Let v = -0.188 + -0.012. Which is the second smallest value? (a) -0.15 (b) -4 (c) v c Let z = 14 - 9. What is the second biggest value in 0.4, 2/9, z? 0.4 Let q = -26 + 30. Suppose 0 = 4g + 16, g - 1 = 3b + 1. What is the biggest value in q, b, -1? q Let s = 9959/9 + -1103. What is the third smallest value in 5, -5, s? 5 Let p = 8 - -1. Suppose -2h + h + 14 = -5f, 0 = 3f + p. What is the second biggest value in 2, h, 0.1? 0.1 Let z = -61.9 - -62. What is the third biggest value in z, 3, -2, 3/2? z Let y = 3 + -3.2. Let a be (8 + -9)1726/(-18). Let p = a + -96. What is the second smallest value in y, 4, p? p Let z = 66 - 328/5. Let j = 0.1 + -0.1. Which is the smallest value? (a) z (b) -0.1 (c) j b Suppose -6 = 2c - 3t, -7c - 5t - 15 = -2c. Let b = -2 + 3. What is the smallest value in 0.3, b, c? c Let m be (4 - -1)8/(-10). Let u = 23 + -22.7. What is the third smallest value in u, m, 2/5? 2/5 Let z be -1 + 57/15 + -2. Let b(i) = -i2 + 4i. Let w be b(5). What is the second biggest value in z, -0.1, w? -0.1 Let c = 1.01 + 2.99. What is the biggest value in 1/3, 6/5, 1, c? c Let u = 5.6 + -6. Suppose 3r + 1 = 4r. What is the second biggest value in u, r, 0.3? 0.3 Let u = 0.06 + -12.06. Let x = 11.6 + u. Which is the second biggest value? (a) 4 (b) x (c) 0.5 c Suppose -5x - 3 = 7. Let u be (-4)/x + 4/(-4). Which is the third smallest value? (a) -2/7 (b) 3 (c) u b Let z = 0.18 + -0.2. Let i = z - 0.28. Let r = -0.07 + 0.47. What is the second smallest value in r, 1, i? r Let v be 8/(-20) + (-84)/(-135). Let y = -369 + 5537/15. Let h = -3.3 - -3. Which is the third smallest value? (a) y (b) v (c) h b Let l = -5 + 5. Suppose -4o = -l*o + 12. What is the second biggest value in o, 3, -4? o Let i = -	{ "pile_set_name": "DM Mathematics" }
-5 What is -55 divided by -73? 55/73 Divide 528 by 57. 176/19 What is -4 divided by -25502? 2/12751 Divide 9032832 by -9. -1003648 -3 divided by 1271 -3/1271 What is -307350 divided by -2? 153675 What is 15 divided by 5159? 15/5159 Divide -2693326 by -70877. 38 1135023 divided by 2859 397 What is -49005 divided by -11? 4455 Divide -3 by 570784. -3/570784 Divide -36605 by 7321. -5 What is 92 divided by -9320? -23/2330 Divide 673 by 449. 673/449 Divide 76908 by 12. 6409 Divide -2029820 by -740. 2743 Calculate -624588 divided by 4. -156147 What is 10959 divided by -15? -3653/5 72032 divided by -4 -18008 Calculate 160 divided by -592. -10/37 Calculate 25278 divided by 3. 8426 -3957700 divided by 4166 -950 What is 19350 divided by 1075? 18 Calculate 199062 divided by 1. 199062 -4936792 divided by 5 -4936792/5 90483 divided by 5 90483/5 What is -8534040 divided by 40? -213351 What is 543444 divided by 6? 90574 Divide -157752 by -78876. 2 Calculate 52417 divided by 989. 53 Divide 25235 by -5. -5047 24733 divided by 2 24733/2 Divide 0 by -128113. 0 What is -5375 divided by -5? 1075 -14 divided by -214032 1/15288 -71724 divided by 258 -278 What is -9 divided by 4220? -9/4220 Calculate -179 divided by -917. 179/917 What is 149260 divided by 8780? 17 Calculate 714376 divided by -178594. -4 Divide 8 by 4490. 4/2245 Calculate -6388480 divided by 5. -1277696 Calculate -70 divided by 143. -70/143 Calculate 4405988 divided by 1. 4405988 What is -6852 divided by 6852? -1 Divide 26 by -60197. -26/60197 Calculate 7 divided by -7702. -7/7702 -94956 divided by 47478 -2 What is 28308 divided by -4? -7077 Calculate 2 divided by -18034. -1/9017 Calculate 27979 divided by 3997. 7 What is -88 divided by -1103? 88/1103 Calculate 5 divided by 192138. 5/192138 What is -4 divided by -13423? 4/13423 -121878 divided by -1998 61 Calculate -1764 divided by -1016. 441/254 -344 divided by -165 344/165 What is -397152 divided by -28368? 14 What is -9781 divided by 172? -9781/172 What is -824502 divided by -2051? 402 Calculate 5708 divided by -11. -5708/11 Divide 156230 by 17. 9190 99 divided by 42 33/14 10127 divided by 779 13 Calculate -3 divided by 171143. -3/171143 Calculate -101248 divided by -32. 3164 What is 114972 divided by 38324? 3 Calculate 78289 divided by -5. -78289/5 -75293 divided by -1751 43 Divide 861440 by 4. 215360 -648180 divided by 129636 -5 8 divided by -240373 -8/240373 -805 divided by 8 -805/8 -538 divided by -50 269/25 Divide -632058 by -2. 316029 -286665 divided by 9885 -29 -3282120 divided by 91170 -36 -2093 divided by 6 -2093/6 453250 divided by 6 226625/3 What is -12084 divided by -159? 76 Calculate -1954720 divided by 977360. -2 -2 divided by 1781110 -1/890555 Divide 8859 by -3. -2953 0 divided by -174758 0 3669 divided by -274 -3669/274 Calculate -28700 divided by -2050. 14 What is 441024 divided by -6? -73504 -464436 divided by -171 2716 Divide 2695760 by -10. -269576 Calculate 175 divided by -214. -175/214 Calculate 2575878 divided by -6. -429313 7164 divided by -6 -1194 Calculate 4 divided by 170066. 2/85033 Calculate -40403 divided by -3673. 11 What is -2092770 divided by -7751? 270 14391 divided by -14391 -1 Calculate -9 divided by -71482. 9/71482 -2799798 divided by 17 -164694 -55 divided by 6890 -11/1378 Calculate 59568 divided by -82. -29784/41 Calculate 5057 divided by -389. -13 Divide -1860 by -465. 4 Divide -8136 by 5. -8136/5 What is -376578 divided by -188289? 2 Divide 1 by -1860. -1/1860 Calculate -101352 divided by -2. 50676 Divide 62000 by 400. 155 Calculate 355716 divided by -4. -88929 Divide 72 by 1879. 72/1879 5100 divided by -127 -5100/127 What is 89829 divided by 1109? 81 -4115 divided by 590 -823/118 What is 12298 divided by -22? -559 1045541 divided by -4 -1045541/4 Divide -23561 by 6. -23561/6 Divide 130780 by 5. 26156 Divide -2 by 13574. -1/6787 Calculate 24223 divided by -9. -24223/9 What is 1282531 divided by -75443? -17 -4 divided by -21123 4/21123 5328 divided by -4 -1332 -51758 divided by 7394 -7 Divide 1444426 by -2. -722213 Calculate 78 divided by 2614. 39/1307 Calculate 147594 divided by 3. 49198 What is -21417 divided by 4? -21417/4 230750 divided by 46150 5 Calculate -50 divided by 801. -50/801 Divide -70680 by 372. -190 -693030 divided by -69303 10 Divide 13880 by -10. -1388 Divide 3770 by -58. -65 Divide 146300 by -1540. -95 What is 143793 divided by -47931? -3 Calculate 8410 divided by -5. -1682 What is 378856 divided by -47357? -8 Divide 21 by -48. -7/16 What is -3652720 divided by -456590? 8 -11153 divided by 6 -11153/6 15 divided by 805 3/161 Calculate 11529 divided by -3843. -3 What is 1161400 divided by -5? -232280 Calculate 90948 divided by 90948. 1 0 divided by -250064 0 Calculate 372932 divided by -4. -93233 What is -6281 divided by 172? -6281/172 What is 2 divided by -42329? -2/42329 Calculate 264 divided by 1238. 132/619 Calculate 4 divided by 4977. 4/4977 -18 divided by 1161 -2/129 0 divided by 3834 0 2 divided by 77061 2/77061 What is -30535 divided by -3? 30535/3 What is -4057104 divided by 1352368? -3 Divide 350416 by 87604. 4 17840 divided by -40 -446 -6400 divided by -21 6400/21 Calculate 1645016 divided by -2. -822508 350655 divided by 116885 3 Calculate 132841 divided by -1. -132841 What is 2872 divided by -8? -359 30084 divided by 4 7521 9 divided by 5173 9/5173 Divide -840123 by -289. 2907 -277656 divided by 1 -277656 Calculate 18 divided by -8242. -9/4121 What is -41 divided by 467? -41/467 What is -17654 divided by -13? 1358 -118827 divided by -118827 1 123075 divided by 41025 3 What is 2003160 divided by -4? -500790 What is 2688 divided by -24? -112 Divide -68649 by 68649. -1 -5 divided by 224876 -5/224876 Calculate -36675 divided by -815. 45 88800 divided by -7400 -12 What is 44939 divided by -3? -44939/3 Calculate 5 divided by 757201. 5/757201 Divide 75945 by -15189. -5 Calculate -5452 divided by -1. 5452 Calculate -403437 divided by -134479. 3 Divide -979015 by 103. -9505 Divide 120 by 1890. 4/63 Calculate -258 divided by -100. 129/50 1 divided by -102681 -1/102681 -15110 divided by -1 15110 What is 58168 divided by -7271? -8 What is 406 divided by -165? -406/165 What is -121998 divided by -1? 121998 2304 divided by -59 -2304/59 Calculate -413472 divided by -6. 68912 What is -136476 divided by -11373? 12 Divide 78 by -11026. -39/5513 What is 14 divided by 3864? 1/276 106216 divided by 3 106216/3 Divide 13716 by 6. 2286 What is 2 divided by -403490? -1/201745 Divide 3 by -602922. -1/200974 What is 9375 divided by -3? -3125 -1858590 divided by 5 -371718 What is 112 divided by -1409? -112/1409 Divide 2473007 by 2. 2473007/2 Divide -3037 by -20. 3037/20 What is 354131 divided by -354131? -1 Divide 428400 by -1275. -336 Divide -1 by 95770. -1/95770 What is -3555299 divided by -187121? 19 Divide -43501 by -22. 43501/22 126294 divided by -9021 -14 What is -4443220 divided by -888644? 5 Calculate 691875 divided by -9225. -75 Divide -375 by -15581. 375/15581 Divide 66304 by -16. -4144 69176 divided by -17294 -4 -1059576 divided by -3 353192 What is 13 divided by -17914? -1/1378 Calculate 82181 divided by -2. -82181/2 Divide 17594 by 6. 8797/3 What is -186276 divided by 4902? -38 Divide 627556 by 6. 313778/3 What is 103716 divided by -5762? -18 Calculate -3911904 divided by 12784. -306 What is 196 divided by -89? -196/89 -67041 divided by -2483 27 116 divided by -353 -116/353 70784 divided by -4 -17696 Divide -2918104 by -729526. 4 Calculate 25550 divided by 7. 3650 Divide -238788 by 5427. -44 1731 divided by 1 1731 Calculate 4335 divided by 1. 4335 Calculate 4521 divided by 130. 4521/130 Divide -39249 by -9. 4361 What is -309 divided by -46? 309/46 What is 82296 divided by -4572? -18 Divide 21 by 7838. 21/7838 Divide -24727 by 8. -24727/8 What is -992 divided by -58? 496/29 1 divided by 57471 1/57471 Calculate 6898804 divided by -68. -101453 What is 33868 divided by -8467? -4 Calculate 108735 divided by -9885. -11 Calculate 124249 divided by 6. 124249/6 Divide 463870 by -92774. -5 Calculate -5110 divided by 5. -1022 -75330 divided by -155 486 Divide 42 by -4618. -21/2309 -7836 divided by -5 7836/5 Divide -235820 by -18140. 13 Calculate -711807 divided by 237269. -3 What is -109986 divided by	{ "pile_set_name": "DM Mathematics" }
mmon multiple of f and 10? 10 Suppose -3 = -4t - n, 0 = t - 5t + 4n + 28. Suppose tz - 3q = 33, 3q - 13 = -2z + 2. Calculate the lowest common multiple of (4/(-12)22)/(2/(-6)) and z. 132 Let k(x) = 7x - 4. Calculate the smallest common multiple of 13 and k(2). 130 Suppose -4q - f + 4f = -143, 155 = 4q + f. What is the lowest common multiple of q and 16? 304 Let h = 25 - 26. Find the common denominator of -41/2 and 260/15 + h/2. 6 Suppose q + 27 = 3t, 0 = -5q + 14 + 1. Calculate the smallest common multiple of 10 and t. 10 Suppose -3p + 24 + 3 = 0. Suppose 2 = s - p. Let f(a) = a3 + 17a*2 + a + 22. Calculate the smallest common multiple of s and f(-17). 55 Suppose i = g - 6g + 3, -3g = -3i - 9. Let p(w) = -w*2 + 5w + 2. What is the lowest common multiple of p(5) and 69/9 - i/6? 8 Let m = 795711/2959 + -2258215401/7764416. Let q = m - -951/41. Calculate the common denominator of q and 59/4. 64 Let t(x) = 4x + 18. What is the lowest common multiple of t(-2) and 10? 10 Suppose 2s + m = -2m + 2, 4 = 2m. Let n be 24/(-2)s/4. What is the lowest common multiple of 2 and 1-2n/(-12)? 2 Let a(s) = 3s*3 + 2s*2 - 1. Let p be a(-1). Calculate the lowest common multiple of 172/24 + p/12 and 10. 70 Let c be 4754/(-16786) + (-10)/(-35). Let k = 51572/5995 - c. Let o = 1406 - 5689/4. Find the common denominator of o and k. 20 What is the least common multiple of ((-152)/(-95))/((-2)/(-25)) and 12? 60 Let r = 7 + -3. Let d(v) = 7v*2 - 7v + 4. Let q be d(r). Suppose l = 5l - q. Calculate the least common multiple of 18 and l. 198 Suppose 33 = 4h - 95. Suppose 2f + 0f = 4r + 16, -4f - 5r + h = 0. Calculate the least common multiple of f and 0 - (-13 - (-3)/(-3)). 56 Let d = 224265/439 + 254987973/9658. Let v = d - 26908. Let b = 5/24 + -1/3. What is the common denominator of b and v? 88 What is the least common multiple of 1484/126 - (1 + (-11)/9) and 27? 108 Find the common denominator of ((-24)/14 - -2)/(0 + 1) and 19/2. 14 Suppose -3z - 19 = -v, -v + 1 = -2z - 18. Calculate the common denominator of (-3 + 0)/21v and -49/2. 14 What is the common denominator of 1 - 111/9 - 4 and 16/11? 33 Let u = -3 - 2. Let o be ((-70)/(-4))/(u/10). Let f = -15 - o. Calculate the lowest common multiple of 10 and f. 20 Let w(n) = n*3 + 2n - 1. Let m be w(3). Suppose 3x - 34 = o, 2x + 0x = 3o + m. Suppose -3 = 2r - 9. Calculate the smallest common multiple of x and r. 30 Let p = -1343/66 - -307/15. Let d be (-1318)/(-396)(-14)/10. Let q = d - p. Calculate the common denominator of q and -23/11. 99 Let o(n) = -n*2 - 3n + 14. What is the lowest common multiple of o(-5) and 41? 164 Suppose -u - u = -3x + 1649, 4u = 3x - 3283. Let l = u + 1693/2. What is the common denominator of -43/5 and l? 10 Let p = 95455/36 + -10637/4. Find the common denominator of 73/12 and p. 36 Let p = 701 + -14017/20. Let k = 46547/14 - 3331. Find the common denominator of k and p. 140 Let d = -18 + 30. Let s = 2 + -1. What is the common denominator of 127/6 and ((-2)/d)/s149? 6 Let o = -65 - -42. Let q = -3 - o. What is the smallest common multiple of (-4)/10 + 128/q and 8? 24 Let a(p) = 5p - 48. Suppose 4n + 22 = 3m + 73, -4n + 4m + 52 = 0. Calculate the lowest common multiple of a(14) and n. 132 Let q = -5945/18 + 647/2. What is the common denominator of q and 125/6? 18 Let k = -37/10 + 13/15. Find the common denominator of -67/10 and k. 30 Suppose -4a + 5b = -0b - 57, 3a = -5b - 1. What is the smallest common multiple of a and 8? 8 Let t be -19(-2 - (-6)/(-3)). What is the smallest common multiple of 10 and (-2)/(-5) - t/(-10)? 40 Let i = 12173 - 145979/12. What is the common denominator of i and 31/30? 60 Suppose -116 = -4t - t - 3f, -4f + 8 = 0. Calculate the least common multiple of 20 and t. 220 Let f = -122995/12 + 10241. Calculate the common denominator of f and 19/22. 132 Let x = 32569/327957 - -1/14259. Let o = x - -3221/1610. Let r = -21653/6 - -3599. Calculate the common denominator of r and o. 30 Find the common denominator of -62/3 and 3 + 41/6 - 3. 6 Let d = -5 + 15. Calculate the smallest common multiple of 2 and d. 10 Let i = -158213/20 + 7907. Let h = 11396 + -114073/10. Find the common denominator of i and h. 20 Suppose -77 = -3p - 11. Calculate the smallest common multiple of p and (-180)/(-15) - (0 - -4). 88 Suppose 21 = -5k - 4c, 5k - 1 = 2k + c. Let q(v) = v2 + v. Let w be q(k). Suppose w = 5u - 10u + 20. What is the smallest common multiple of u and 22? 44 Suppose 4s + 72 = 2s. Calculate the common denominator of s and -27/14. 14 Let t be 1 + -1 + 2/2. Calculate the common denominator of (9/(-6) + t)23 and 29/16. 16 Let p = 4 + -4. Suppose p = -4w + 2a + 2a + 20, -15 = -3w - 5a. Suppose 4 = -o + 1, -4y = -wo - 31. Calculate the least common multiple of 12 and y. 12 Let s = 8679/4 + -2159. Find the common denominator of s and 27/2. 4 Let p = -9 + 6. Let v be (2 + 0)/(p/9). Find the common denominator of (-10)/(-4)v/(-27) and -11/6. 18 Let b = -419/53 - -9862/1643. Let s = 963/341 - b. Find the common denominator of s and 234/8 + 2/8. 22 Let x = 5549/5175 - -8/1035. Find the common denominator of x and -64/3. 75 Let t = -9 + -12. Let z = -29 - -41. What is the lowest common multiple of 8(-1)/(z/t) and 20? 140 Calculate the smallest common multiple of (12/8 + -4)-4 and 6. 30 Let h = 8 + -2. Suppose 6d - 3d + 6 = -2i, 8 = -5i - 4d. Suppose 2y - u - 1 = i, -5y - 5u + 2 = -8. What is the lowest common multiple of y and h? 6 Let g be 3481/1739 + -3 + 1. Let s = -81697/20868 - g. What is the common denominator of s and 75/2? 12 Let l be (-10)/(-25) - (-4089)/40. Let t = -103 + l. What is the common denominator of t and 73/2? 8 Suppose 3312 = -4b + 4n, 1834 = -5b + 2n - 2309. Let r = 179478/5 + -35072. Let s = b + r. Find the common denominator of s and 83/10. 10 Let d(y) = 2y2 + 2y - 2. Let b be d(-2). Suppose 4a + b = 26. Suppose -3l = -a - 3. What is the smallest common multiple of 4 and l? 12 What is the least common multiple of 3 and 25/15 - 1/(-3)? 6 What is the lowest common multiple of (-8)/(-10)((-1338)/(-12) - -6) and 5? 470 Suppose 4f + 24 = 4a, a - 3 = 1. Calculate the smallest common multiple of ((-1)/f)/(4/16) and 4. 4 Let r(j) = 2j*2 + 3j - 2. Suppose 0 = -5s - 2a + 15 + 4, -5s - 4a + 23 = 0. Calculate the least common multiple of s and r(-3). 21 Let p(i) = 10i2 - i. Suppose 10a - 7 = 3a. What is the smallest common multiple of p(a) and 5? 45 Let o be 3(-3)/(-9) + 1. Let b(m) = -m*2 + 3m. Let v be b(o). Calculate the common denominator of (-79)/22 + (v - 3) and -29/18. 198 Let u = -46 - -55. What is the lowest common multiple of 6 and u? 18 Let v = -90 - -104. What is the smallest common multiple of v and 2? 14 Find the common denominator of 123/20 and (20/30)/(52/17). 780 Calculate the common denominator of 24/(-18) + (-87)/36 and 26/11. 44 Let l be -2 - -2 - 1596/65. Let y be (-1)/(-2) - 453/1170. Let q = l - y. What is the common denominator of q and 55/8? 24 Let h = -81 - -85. What is the lowest common multiple of h and 32? 32 Suppose -a + 3r = -41, 0a = 2a - 3r - 76. Suppose 2o - 10 = 3h + h, 5o - 5h = a. What is the least common multiple of o and 10? 90 Let v be (-160390)/(-132) - (-2)/(-12). Let d = -1216 + v. Calculate the common denominator of d and 19/5. 55 Let v be -1 + (-5 - (2 - 1)). Let r = v - -9. Suppose -w + 1 = -1. Calculate the smallest common multiple of w and r. 2 Suppose 774 = 4b - 5t, -394 = -2b - 0b - t. Suppose b = 4m - 12. Calculate the lowest common multiple of 10 and m. 260 Let b = -8311/4960 + -152/155. What is the common denominator of (-11)/(-22) + 178/(-16) and b? 32 Let q = 2/1075 + 39771/2150. Let c = 4156 + -49957/12. What is the common denominator of q and c? 12 Find the common denominator of 5/8 and (118/64)/((-9)/18). 16 Suppose -8 = -2z - 2b, 2z - 4b = -2z + 8. Let c = z - -1. Calculate the smallest common multiple of ((-16)/6)/(2/(-6)) and c. 8 Let b be (-6)/10 - 5107299/(-15). Let m = b - 8446436204/24807. Let x = 1083247/99228 + m. Find the common denominator of 81/8 and x. 24 Let j(r) = -9r + 1. Suppose -4g = -v - 18, -5v = 2g - 4g. Suppose vt = 11 + 7. Calculate the smalles	{ "pile_set_name": "DM Mathematics" }
0.2, -3/5? -0.2 What is the nearest to -41/5 in -2.8, 11, -8, 5/6? -8 What is the closest to -2/9 in -2/15, -1452, -7/4? -2/15 Which is the closest to 1/4? (a) 0.1 (b) 1 (c) 0.07 (d) -4/5 (e) -185 a Which is the nearest to -4? (a) -2 (b) -242 (c) 3 (d) 20 a Which is the nearest to -16? (a) 0.3 (b) 0.64 (c) 1 a What is the closest to -3/8 in 129, 1/6, -1/2? -1/2 Which is the nearest to 194/17? (a) -3/2 (b) 0.4 (c) -2/7 b Which is the closest to 272? (a) -2/11 (b) -3 (c) -1/4 (d) -3/28 d What is the nearest to -1/3 in 0.5, 27567, 3? 0.5 What is the closest to 9 in 0.1, 3, -1/10, -0.4, -32? 3 Which is the closest to -0.2? (a) 0.2 (b) 4 (c) -3 (d) -2/11 (e) 0 d What is the closest to -1 in -4.42, -10/7, 0.3? -10/7 Which is the closest to -1? (a) -0.2 (b) 43/14 (c) 0.1 a What is the closest to -1338 in 5, -0.4, -8? -8 Which is the closest to -4? (a) -0.16 (b) 2445 (c) -1 (d) -4 d What is the nearest to 1 in 0.4, -42/43, -2/3? 0.4 Which is the nearest to 0.3? (a) -1/9 (b) -63 (c) 0 (d) -4/5 (e) 46 c What is the closest to -122 in -0.5, 2/5, 2/11? -0.5 Which is the nearest to 1? (a) -0.8 (b) -4 (c) 5/2 (d) -18 c What is the nearest to -13.5 in -3, -0.12, 0? -3 Which is the closest to 185.2? (a) 5 (b) 4 (c) 0 (d) 2/3 (e) -0.1 a Which is the closest to 0? (a) -3/8 (b) -1154 (c) -2/9 c What is the closest to 0 in 7, 28883, -2? -2 What is the nearest to -8 in 16, 5, -234? 5 Which is the closest to 1? (a) 0.41 (b) 12 (c) 5 a What is the nearest to 1 in -29, 0.01, 19, 1? 1 Which is the nearest to 73? (a) -6 (b) 2 (c) 4/9 (d) 6/7 b Which is the closest to 0.3? (a) -2.42 (b) -0.1 (c) 2/19 (d) -1 (e) -4.02 c Which is the closest to -23? (a) 2/13 (b) 0.4 (c) -5/7 (d) -2 (e) -4.1 e Which is the closest to -477/5? (a) -8 (b) -2 (c) 28 a What is the closest to -180776 in 0.3, 1/3, 5? 0.3 Which is the nearest to 1? (a) -3/7 (b) -24 (c) 5 (d) 0.2 (e) 0.7 e Which is the nearest to 61/9? (a) 12/13 (b) -5 (c) -4 (d) 1 (e) -0.2 d Which is the closest to 20? (a) -0.5 (b) 2/7 (c) -0.3 (d) 22/7 (e) 4 e Which is the nearest to -1/4? (a) -0.2 (b) 2 (c) 1 (d) -7/50 a Which is the closest to 0.1? (a) 5/2 (b) -4 (c) 271/17 (d) 2 d Which is the nearest to -289? (a) 0.27 (b) -4 (c) -5 (d) -4/5 c What is the nearest to 2 in -59, 14, 26, 3/10, 2? 2 Which is the nearest to 9? (a) 4 (b) 2/5 (c) 0.18 (d) 24 a Which is the nearest to 1/3? (a) -184 (b) -1/7 (c) -17 (d) 0.04 d Which is the closest to -1.1? (a) -2/7 (b) 2/233 (c) -0.03 (d) 12 a Which is the closest to 171? (a) 1 (b) -9/5 (c) 2/9 a Which is the nearest to -0.142? (a) 0 (b) -10 (c) 5 (d) 3 a Which is the nearest to -183? (a) 2/5 (b) 2/13 (c) -0.4 (d) 1/7 (e) 7 c Which is the nearest to -2/3? (a) -4 (b) 0.7 (c) 1 (d) -128 b Which is the closest to 7? (a) -4/13 (b) 3 (c) -608 b Which is the closest to 2/821? (a) 1/2 (b) 2/3 (c) -0.4 (d) 0.09 d Which is the nearest to 1/4? (a) 32 (b) 3 (c) -0.04 c What is the nearest to 7 in -0.07, 0.16, -2/3, 0.1, -1/5? 0.16 What is the closest to 0 in 875, 3/25, 0.2? 3/25 Which is the closest to -0.1? (a) -1/2 (b) -5 (c) 154 (d) 2/71 d What is the nearest to 0 in -1.8, 4/3, 11, 1? 1 Which is the nearest to 0.2? (a) -15 (b) -0.3 (c) 3/4 (d) 2 b Which is the nearest to -1/4? (a) -0.5 (b) -0.6 (c) -2.6 (d) 0.0435 a Which is the nearest to 3? (a) 19/5 (b) 0.1 (c) -112 (d) -0.1 a Which is the closest to 0? (a) 4 (b) 2 (c) 0.2 (d) 1/1083 d What is the closest to -7.097 in 2/11, -1/7, -1? -1 Which is the closest to 2/9? (a) 5 (b) -3 (c) 13 (d) -2/57 d What is the nearest to 1.4 in -47, 1/2, 1/13, -0.5? 1/2 What is the closest to -3 in 1, -1, -83, -4? -4 Which is the closest to 74/25? (a) -15 (b) 3/8 (c) 5 c What is the nearest to 1 in 2/17, -0.4, 3, -4/77? 2/17 Which is the nearest to 3849? (a) 3 (b) 0.1 (c) 6 (d) -2 c Which is the closest to 2/5? (a) 8 (b) -4/13 (c) -0.1 c Which is the nearest to -2/3? (a) 3 (b) -2 (c) -342 (d) 2/11 (e) -1.29 e What is the closest to 1 in 2/19, -0.09, -0.3, 1/4, 15? 1/4 Which is the nearest to -0.02? (a) 568 (b) 1/3 (c) 8/3 b What is the closest to 0.55 in 3/25, -3, 2/5? 2/5 Which is the closest to -1/3? (a) 119 (b) -0.16 (c) -4 (d) -16 (e) 0.1 b What is the closest to -0.07 in -1, 7764, 1/3, -2? 1/3 Which is the closest to -2/5? (a) -5 (b) 2/7 (c) -1/5 (d) -1/4 (e) 0.7 d Which is the closest to -9.7? (a) 4 (b) -4 (c) 1/3 (d) 2 b Which is the nearest to 4? (a) 0.5 (b) -117 (c) 0.03 (d) -2 (e) 4 e What is the nearest to -8 in 0.0207, 2/3, 4/3, -1.4? -1.4 Which is the closest to -0.6? (a) 1.4 (b) -2 (c) 38 (d) 0.2 (e) 3 d What is the closest to 2/3 in -0.0073, 0.1, 5, 0, -4? 0.1 Which is the nearest to 10? (a) -1960 (b) 5 (c) 0.1 b Which is the nearest to -0.044? (a) -4 (b) 1533 (c) -0.3 (d) -5 c What is the nearest to -0.2 in 2/13, -0.3, -93, 1? -0.3 What is the closest to -1/13 in -5/4, -518, 6? -5/4 Which is the closest to 0.1? (a) 103 (b) 9 (c) -5 c What is the closest to -0.1 in -43, -14, 30, 3? 3 Which is the nearest to 15? (a) 12 (b) -0.3 (c) -2 (d) 17.5 d What is the nearest to 57 in -2, 18, 0.5, 2? 18 What is the nearest to -0.1 in 0.5, 141, 0, -1/30, -0.4? -1/30 What is the closest to 0.5 in 0, -4/9, 0.3, 31, -5? 0.3 Which is the closest to 0? (a) 3/2 (b) 0 (c) 2607.5 b What is the nearest to -1 in 3, 3/14, -79, 0.3, -2? -2 Which is the nearest to -3/5327? (a) -4 (b) -0.4 (c) 2/11 (d) 2/9 (e) 1/4 c Which is the nearest to 1? (a) 0.08 (b) -1 (c) -2843 a What is the nearest to -1/4 in -2/21, 0, -0.1, -10.91? -0.1 Which is the nearest to 13.7? (a) 4 (b) -0.1 (c) -5.19 a Which is the nearest to 0.1? (a) 0.5 (b) -0.2 (c) 3226 b What is the nearest to 0 in -1, -5, 2322417? -1 What is the closest to -0.1 in 0.01, -1/249, 0.4, 1? -1/249 What is the closest to -21.7 in -0.05, 0.2, -3/4, 18? -3/4 What is the nearest to 2/5 in 0, -12/11, -0.2, 66? 0 Which is the nearest to 0.6? (a) -2/9 (b) -19 (c) 0.1 (d) -2 (e) -2/13 c What is the closest to -2/5 in -8, 3, -512? 3 What is the nearest to -6/5 in 0.2, -1/5, -5/2, 0, 1.6? -1/5 What is the nearest to -0.1 in 2, 20, 4, -4, 3/7? 3/7 Which is the closest to -10? (a) -0.4 (b) 0.4 (c) 17 (d) -2/29 (e) 1 a What is the closest to -146 in -4, -3/7, 5, -0.4, 3? -4 Which is the nearest to 0.1? (a) 0 (b) -3/7 (c) 349 a What is the closest to -0.2 in -0.1, -4, -2, -336? -0.1 What is the nearest to -33 in -44, 5, 3, -1, 0? -44 What is the closest to 7/3 in -13, -22, -1/7? -1/7 Which is the nearest to -0.1? (a) -1/202 (b) 2/11 (c) -2/5 a What is the nearest to -0.1 in 0.3, 2/9, 1, 123, -2/13? -2/13 What is the nearest to -1 in 4, -341, 0.3, 5, 0? 0 What is the closest to -2/9 in 1, 3, 2, -538103? 1 Which is the nearest to 6? (a) 2/5 (b) 17/2 (c) -0.074 (d) -0.2 b What is the nearest to -0.02 in -5, 4, -1, 0, -8? 0 What is the closest to -0.3 in -33, 3/37, -0.4, -0.13? -0.4 What is the nearest to -1 in 2/13, -3, 5, 1/5, -195? 2/13 Which is the closest to 1182? (a) 6/5 (b) -2/3 (c) 2 c What is the nearest to -1 in 5, -1/3, 0, -15179? -1/3 Which is the closest to -0.05? (a) -18 (b) 1 (c) -4 (d) 8 b Which is the closest to 1/2? (a) 1/6 (b) 19/9 (c) 3/5 (d) 0.01 c Which is the nearest to 0.5? (a) 0 (b) 254 (c) -10 a Which is the closest to -142/7? (a) 4/13 (b) 2/9 (c) -2 (d) -11 (e) 0.4 d Which is the closest to 1/2? (a) -4 (b) 2 (c) -6 (d) 3 (e) -1/4 e What is the closest to 124 in -1/11, -0.064, -2, -0.5? -0.064 What is the nearest to -2 in -2/3, 5, 2, 1/9, -1371? -2/3 What is the closest to 154 in -2/7, 11, 3/5, 1/7? 11 What is the nearest to 0.2 in -135, 0.2, 3, 1/3, 2/7? 0.2 Which is the nearest to 0? (a) -4 (b) 9/5 (c) -2 (d) -20 (e) -0.5 e What is the nearest to -1 in -1.1, 8, -88, 4, -4? -1.1 What is the closest to -3/2 in -1/3, -0.05, -0.07, 0.9, -2/5? -2/5 Which is the nearest to -0.4? (a) -5/14 (b) 2/5 (c) -5 (d) -5.1 a What is the closest to 17/3 in 18/5, -5/6, 303, 2/11? 18/5 Which is the closest to -6/11? (a) 231 (b) -6 (c) -52 (d) -4 d What is the closest to 27 in 0.9, -7, -1/2? 0.9 What is the nearest to -13 in 1, -52, 3, -2/17? -2/17	{ "pile_set_name": "DM Mathematics" }
5). Suppose -n - 49 = -3i, 10 = 5n - 0n. What is the highest common divisor of m and i? 17 Let a = -120 - -142. Calculate the greatest common divisor of a and 55. 11 Let m be (-15)/25 + 5936/35. Calculate the greatest common divisor of 13 and m. 13 Suppose 165g = 162g + 273. What is the highest common divisor of 7 and g? 7 Let o = -602 + 1008. Suppose 3p + 666 = 5m, 3m + 3p = 8p + o. What is the highest common factor of m and 12? 12 Suppose 102k + 3976 = 110k. What is the highest common factor of 21 and k? 7 Suppose -122i + 84i + 1064 = 0. Calculate the greatest common divisor of i and 8. 4 Let s = 57 + -39. Suppose 3t - t + a = 136, 2a - 338 = -5t. Let k = t - 21. What is the highest common divisor of k and s? 9 Let a be (-24)/(-9) - (-2)/6. Suppose -ab = 3w - 87, -5w + 3b + 105 = -0b. Suppose -x + 3x - 384 = 0. What is the greatest common factor of w and x? 24 Let j = -30 - -35. Suppose -67 = -4q + j. Calculate the greatest common factor of 45 and q. 9 Suppose 54 = 3f - 24. Let x = f + 0. Calculate the greatest common factor of 26 and x. 26 Let w(r) = 5r - 5. Suppose -2u + 28 = 2u. Let s be w(u). Let p be 20(1 - (0 + 0)). Calculate the highest common divisor of s and p. 10 Suppose -9l = -8l - 2. Suppose la - 51 - 155 = -2f, 5a - 305 = -3f. Calculate the greatest common factor of 21 and f. 21 Let b(j) be the second derivative of 1/2j*3 + 3j + 1/4j4 - 1/20j*5 + 0j*2 + 0. Let s be b(3). What is the greatest common factor of s and 1? 1 Let z(m) = 85m - 2. Let c be z(2). Suppose 2r = 5u - 132, 16r - 17r = u - 18. Calculate the highest common divisor of c and u. 24 Suppose -2f + 2x - 4 = 4x, -4x = 12. Let p be (-6)/(-12) - 76/(-4). Calculate the highest common divisor of p and f. 1 Suppose -5p + 5 = -4f, 2p + 4f = 4 - 30. Let n = 6 - p. Let r(z) = 4z*2 + 16z + 6. Let y be r(-7). Calculate the highest common factor of y and n. 9 Suppose 155 = 2f + 1. Suppose 0 = 4h - o + f, 0 = 2h - o + 1 + 36. Let g = h - -56. What is the highest common factor of g and 18? 18 Let a be ((-3)/(-5))/(-3) - (-917)/35. Let i = 228 + -137. Calculate the greatest common divisor of i and a. 13 Suppose -4c = 48 - 76. Suppose 9o - 56 = co. Calculate the greatest common divisor of 252 and o. 28 Let w = -659 - -693. Calculate the greatest common factor of 136 and w. 34 Let w(g) = -12g - 9. Let s be w(1). Let o be (-14)/s(-75)/(-2). Calculate the highest common divisor of 75 and o. 25 Suppose 14w = 81w - 737. What is the greatest common factor of w and 1375? 11 Let d = -54 - -118. Let o be ((-30)/(-25))/((-9)/(-60)). What is the greatest common factor of d and o? 8 Let f = -13 + 16. Suppose -14 = fj + 1, -4o = -5j - 421. What is the highest common factor of o and 11? 11 Let l(r) = -15r + 3. Let z be l(-4). Let x be 4/26 - 115/(-13). What is the highest common divisor of z and x? 9 Let l(q) = -13q3 - 17 + 21 + 9q3 + q2. Let y be l(-2). Calculate the greatest common divisor of 100 and y. 20 Let z(g) = -106g3 + 3. Let v be z(-2). What is the greatest common factor of v and 23? 23 Suppose -h + 21 = 5l - 0l, -4h - 41 = -5l. Calculate the highest common divisor of 85 and l. 5 Suppose 110i - 10944 = 72i. What is the greatest common divisor of i and 45? 9 Let f(a) = 6a + 115. Let q be f(-13). Calculate the highest common factor of q and 296. 37 Let p(a) = a*3 - 3a*2 + 2a + 11. Let n be p(4). Let m = -21 + n. Let b = 38 - m. Calculate the greatest common factor of 264 and b. 24 Suppose 5w = -2z - 249, 2z + 155 = -3w - 2z. Let q = w + 81. Calculate the highest common factor of q and 160. 32 Let q = -1392 + 1504. What is the greatest common factor of 812 and q? 28 Let c be -21 + 24 - (1-2 - 1). Calculate the greatest common factor of c and 8. 2 Let u = 33 - 15. Suppose -m - m = u. Let o(i) = -i*3 - 7i*2 - i - 11. Let g be o(m). Calculate the highest common factor of g and 20. 20 Let q = 97 - 91. Calculate the greatest common factor of 33 and q. 3 Let m = 168 + -146. Calculate the greatest common divisor of 11 and m. 11 Suppose 0 = -17c + 15c + 18. Let z(i) = i2 - 3i - 3. Let r be z(4). What is the highest common divisor of c and r? 1 Suppose 0 = -5w - 4c + 28, 2c = w + 4c - 8. Suppose wa = 2a, -a = -b + 5. Calculate the highest common factor of b and 25. 5 Let v(a) = -a*3 - 21a*2 + 2a + 33. Let k be v(-21). Let h be (-2 - (3 + k)) + 434. Calculate the highest common divisor of 56 and h. 28 Let h(w) = w + 1. Let o(c) = 2c*2 + 5c - 2. Let j(u) = -6h(u) + o(u). Let f be j(-4). Calculate the greatest common factor of f and 42. 14 Suppose -72 = 1590a - 1592a. What is the highest common factor of 1170 and a? 18 Let w(p) = 32p*2 - 15p + 2. Let a be w(1). What is the highest common factor of a and 304? 19 Let p(i) = i*3 + 13i*2 + 4i - 13. Suppose -18y + 45 = -21y. Let q = -24 - y. Let u be p(q). What is the highest common divisor of u and 25? 25 Suppose 7n - 4o - 68 = 4n, -5o = 5n - 55. What is the greatest common factor of n and 40? 8 Suppose 2x = 5f - 8f + 143, -3f + 67 = x. What is the highest common divisor of 114 and x? 38 Let z(a) = 3a + 76. Let q be z(5). Let t be 20/(-6)(-6)/4. Suppose 36 = -tg + q. What is the highest common factor of 1 and g? 1 Suppose 3o + 2q + 147 = 4o, -3o + 437 = -4q. What is the greatest common factor of 11 and o? 11 Let d(l) = -7l*3 - 3l*2 - 8l - 22. Let n be d(-3). Calculate the greatest common divisor of n and 41. 41 Let h(f) = 0f2 + 8 + f3 - 8f + f*2 + 12f*2. Let x be h(-13). Calculate the highest common factor of 16 and x. 16 Suppose f - 4h = 7 + 15, h + 3 = -f. Suppose fr - 4q = r - 4, -12 = -4q. Calculate the greatest common divisor of 72 and r. 8 Let n(z) = z3 - 5z*2 + 5z + 5. Let c be n(4). Suppose -4s + cs - 180 = 0. Let q = -120 + 210. Calculate the highest common factor of q and s. 18 Let h(d) = -10d + 429. Let p be h(31). What is the highest common factor of p and 42? 7 Let f(n) = 6n + 132. Let v be f(-12). Calculate the greatest common factor of v and 20. 20 Let n(v) = 3v - 15. Let r be n(10). Let a be (6/r)/(3/30). Suppose 4d + 232 = aq, -328 = -4q - 4d - 56. Calculate the highest common divisor of q and 7. 7 Let j be 8/44 + 4/(-22). Suppose g - 3 - 8 = j. Calculate the greatest common divisor of g and 44. 11 Suppose 5j + 12 = 2f, -5f = j - 2j - 53. Let m be 328 + -342 - (-134 + -1). Calculate the highest common divisor of m and f. 11 Suppose 64 = 3l - 107. Suppose -5z + 8 = -l. What is the highest common divisor of z and 130? 13 Let z be (-2)/(-9) - (-313)/9. Suppose -4x = -233 - 187. Let f = x - z. What is the highest common factor of f and 14? 14 Suppose -5n + 145 + 85 = 0. Let g be 28/7(-206)/(-4). Suppose 346 = 8m - g. What is the greatest common divisor of n and m? 23 Let u be 2/(-3)(-109 + -5). Suppose -9o = -11o + u. Suppose l = 4l - 285. What is the highest common divisor of o and l? 19 Let y be 1035/6 - (-168)/48. What is the highest common factor of y and 11? 11 Let d = 77 + -230. Let h = 257 + d. What is the highest common factor of 26 and h? 26 Let a = 3321 - 2277. Calculate the highest common divisor of a and 36. 36 Let d be (-996)/(-21) + (-12)/(-21). Calculate the greatest common divisor of 128 and d. 16 Let j(u) = -u2 + 99u - 902. Let y be j(11). What is the greatest common factor of y and 78? 6 Let i(u) = 16u2 - 5u - 3. Let y be i(-1). Calculate the highest common divisor of 738 and y. 18 Suppose 0a - l = -a - 7, -a - 5l - 19 = 0. Let z = -4 - a. Let r(y) = 6y + 129. Let q be r(-14). Calculate the highest common divisor of z and q. 5 Suppose 0 = 4b + 3k + k - 1440, 2k + 354 = b. Suppose -4u - 42 = b. Let a = -56 - u. Calculate the greatest common factor of 110 and a. 22 Let r(z) = -6z*3 - 10z*2 - 9z. Let m be r(-4). What is the greatest common factor of 5 and m? 5 Let l = 786 - 739. Calculate the greatest common factor of l and 517. 47 Suppose -3q + 87 = 33. Let l(t) = 0t*2 - 13 - 3t + t*2 + 25 - 21. Let x be l(9). Calculate the highest common factor of x and q. 9 Let f = -126 + 204. Let g be (-1)/(-3)39*1. Calculate the highest common factor of f and g. 13 Let c be 698/22 + 189/693. What is the greatest	{ "pile_set_name": "DM Mathematics" }
tor of (1 - -5)/(1/(-5)) and n? 8 Suppose -2v - 30 - 36 = 0. Let d = v - -45. What is the lowest common multiple of 2 and d? 12 Let y be 6/66832/15702. Let q = -672165142/45889095 - y. Let n = q - 2/105. What is the common denominator of -21 and n? 3 Let y(i) = -i*2 - 11i - 8. Let g be y(-10). Let q be 17(2 + -3 + g). Suppose -t = 1, -5p - q + 64 = 3t. Calculate the smallest common multiple of p and 8. 40 Let f = -4 - -3. Let h(z) = z2 + 1. Let x be h(f). Suppose -3u = -5g + 5, -xg + 5u - 1 = -3. What is the least common multiple of g and 5? 5 Suppose 4q = 4x + 119096, -q - 25971 + 145061 = -4x. Let o = -327720/11 - x. Let f = -2159/110 - o. Calculate the common denominator of f and 49/22. 110 Let s = 0 + -95. What is the common denominator of -5 + s/10 - (-2 - 1) and -19/5? 10 Suppose -30q = -21q - 729. Calculate the least common multiple of q and 4. 324 Let q = -531 + 315. Let r be ((-4)/q)/(2/75). Let n = -4/9 + r. Calculate the common denominator of n and -53/6. 12 Let k = -187/14 + 153/7. Let b = -112 - 74. What is the common denominator of k and ((-11)/(-66))/(4/b)? 4 Let c = 58 - 56. Suppose 0o + 5o + 86 = 4i, -5i = o + 23. Calculate the common denominator of -28/5 and (c/o)/((-2)/114). 15 Suppose 32c - 27c - 1165 = -5t, 0 = c + 5t - 221. What is the smallest common multiple of 6 and c? 708 Suppose -2t + 6t - 12 = 0. What is the least common multiple of (-292)/(-20) + ((-18)/(-15))/t and 21? 105 Let i be 44-92/(-8). Let g = i + -71. What is the smallest common multiple of 36 and g? 252 Let i(y) = y*3 + 6y*2 + 3y + 6. Suppose 3z - 2z = -3. Let l be i(z). What is the common denominator of -67/6 and (l/(-28))/(4/(-25))? 42 Let l = -81020 + 9965513/123. Calculate the common denominator of 56/205 and l. 615 Let u = -58 - -21. Let i = -53 - u. What is the common denominator of (54/(-8))/((-14)/i) and -50? 7 Let k(v) = 1150v - 3. Let g be k(2). Let h = 32139/14 - g. What is the common denominator of h and 97/12? 84 Let b be 2/(-10) + 2/10. Suppose -4g + 2g + 4k = -126, b = 2k. Calculate the lowest common multiple of 4 and (-156)/(-7) + (-18)/g. 44 Let x = -326 + 665/2. Calculate the common denominator of -119/160 and x. 160 Let w = -241876/21 + 332107/14. Let b = w + -12207. What is the common denominator of -64/3 and b? 42 What is the common denominator of (-8)/(-72) + 4294/(-2520) + 2 and 111/70? 140 Suppose 4a = 4l + 8, -4a + 6 = 4l - 10. Suppose -af = -2f - 9. What is the smallest common multiple of (-14)/(-10) + 2/(-5) and f? 9 What is the common denominator of ((-15)/(-8))/((-6)/(-44)) and (-36)/27 - ((-1465)/180 - -8)? 36 Let a = -8005/5068 + -5/181. Find the common denominator of a and 22/3. 84 Find the common denominator of (7/(490/(-371)))/(-1) and ((-12)/8)/(-3)(-102)/(-38). 190 Suppose 5v + i - 82 + 19 = 0, -5i = 3v - 51. Suppose 8f + 5 = 181. What is the least common multiple of v and f? 132 Let m(u) = -u*2 + 22. Let g be m(0). Suppose -h - 5c - 5 = 9, g = -5h - c. What is the common denominator of 42 and (2/h)/(55/(-946))? 5 Let y be 76/8(-142364)/(-18). Let u = y - 227210/3. Let q = u + 601. Find the common denominator of q and 22. 9 Find the common denominator of (159/14840)/((-6)/244) and 3/98. 980 What is the common denominator of 12/(-5)(240/(-9))/10 and (46/5)/(72/(-40))? 45 Let q(x) = 0x - 5x - 8 + x - 6x - x*2. Let c be q(-7). Suppose -1 = t, -3j + 3 + c = -4t. Calculate the lowest common multiple of 6 and j. 12 Let d = -742/15 - 10291/30. Let w = d - -384. What is the common denominator of w and -55/18? 18 Let c(f) = f2 + 10f - 13. Let b be c(-11). Find the common denominator of (81/(-8))/((-1)/(-4 - b)) and 17/32. 32 Suppose 0 = 2j + 3j + 20. Let r be 2 - (-112 + (3 - 3)). Calculate the lowest common multiple of j/10 + r/10 and 8. 88 Calculate the common denominator of 55/42 and 1/(-4) - (5 - 639/108). 42 Suppose -15 = 14w - 43. Suppose 4g = -3q + 5 - 3, 9 = 4q - g. Calculate the smallest common multiple of w and q. 2 Suppose -3l - 5q = -8q - 63, -5l + 99 = -3q. Calculate the least common multiple of 10 and l. 90 Suppose v - 8 = -r, 4v = -3r + 34 - 6. What is the smallest common multiple of 1 + 0/1 + 2 and v? 12 Let s(j) = j2 + 4j + 5. What is the lowest common multiple of s(-5) and 4/10 - (-336)/60? 30 Suppose 2q = 5r - 293, r - 2q - 56 = 9. Let v be (-16)/152 - (-6)/r. Let j = v - -7. Calculate the lowest common multiple of j and 10. 70 Let l be (121108062/760)/(444247218/43918). Let g = 3/123402005 - l. Let c = -1/285 - g. Calculate the common denominator of c and 3/35. 140 Let c(b) = 2b*3 - 4b*2 + 65. What is the smallest common multiple of 10 and c(0)? 130 Suppose 0 = g + 5h + 60, 0 = g - 4g - 5h - 220. Calculate the smallest common multiple of 16 and 7/(-2)g/14. 80 Suppose -9u = 8u + 51. Find the common denominator of 9/4 + u + (-399)/(-180) and 89/12. 60 Let r be 15/(-1) + (-4 - -7). Suppose -5d - 38 = -4t + 44, -2t + 42 = -3d. Let o = r + t. What is the lowest common multiple of 70 and o? 210 Suppose 0 = -45i + 2491 + 209. Calculate the smallest common multiple of 120 and i. 120 Let k(w) = -5w2 + 10w - 9. Let h(c) = c*2 + 1. Let x(j) = -3h(j) - k(j). Let n be x(4). Calculate the common denominator of -85/8 and (36/(-20) - n)-43. 40 What is the common denominator of 1/2 - (2295/(-62))/(-27) and -139/12? 372 Let i be 6/(-9)(-147)/2. What is the common denominator of -35/12 and -2 + i/(-20) + 1? 60 Let i be 12/(-10)-106/9. Suppose 0 = 3k + 3p - 39, 19 = 2k + p - i. Calculate the lowest common multiple of 12 and k. 84 Find the common denominator of 54/81 + 788/726 + -2 and -65/66. 726 Let c be (-24)/(-384)6/1627. Let d = c - 172489/117144. Calculate the common denominator of 1/12 and d. 36 Let z be (-3)/3-49(3 - 4). Let f = -29 - z. Calculate the least common multiple of f and 4. 20 Let l = -242971/18 + 13490. Find the common denominator of l and (2/18)/(304/(-38760)). 18 Suppose 3z + 2s = 57, 2s - 99 = -10z + 5z. Calculate the smallest common multiple of z and 15. 105 Let r be 22/8 + (-2)/(-8). Suppose 0 = -rw + 1 + 2. What is the smallest common multiple of w and 2/4 - (-144)/32? 5 Suppose 2k = -0h - 3h - 3216, -5h - 3220 = 2k. What is the common denominator of 1/((-6)/19) + 1 and 4/88-4 - k/(-66)? 6 Suppose 5 = -3a + 29. Let s(g) = -g2 + 6g - 3. Let i be s(5). Suppose 3w - 24 = -4f + 7f, 3w - 9 = -if. What is the lowest common multiple of w and a? 40 What is the common denominator of -17/10 and 424/1080 - (3 - 2)? 270 Let l = 2 - 1. Let u(y) = 2y*2 + 10y + 4. Let a be u(-7). What is the least common multiple of l and 8/a - (-75)/20? 4 Calculate the common denominator of -55/14 and -1 - ((-135)/(-91))/(-3). 182 Suppose 87b + 704 = 95b. Calculate the least common multiple of 80 and b. 880 Let k be (-1)/((-2)/14) + -1. Let d be (-4)/k - (-96)/9. Suppose 2z - 8 - d = 0. What is the lowest common multiple of z and 9? 9 Let p = -4/559 + -7235/4472. Let v = -56515/8 - -7073. Find the common denominator of v and p. 8 Let l = -14 + 20. Let v = -2261 - -2273. Calculate the least common multiple of v and l. 12 Let r(s) be the second derivative of s4/6 - 3s*3/2 + 5s*2 - s. Let o be r(7). Calculate the common denominator of 43/8 and 27/o - 124/15. 24 Suppose -57 = -5l + 88. Let y = l - 17. What is the least common multiple of 18 and y? 36 Let b = 11000173 - 2442027175/222. Let j = -10/111 + b. Find the common denominator of (-64)/6 + 1/(-2) and j. 6 Find the common denominator of 797/561 + 48/(-408) and 19/66. 66 Suppose 3 = -2j - 3c + 1, c + 2 = -j. Let x = -106 + 114. Calculate the smallest common multiple of x and j110/(-4). 40 Calculate the smallest common multiple of 123 and (-2 + -33)(-12)/20. 861 Let l(v) = v2 - 19v + 24. Let k be l(18). Suppose kb = 10b - 80. Calculate the least common multiple of 6 and b. 60 Let o = -41009797/12 - -3415170. Let g = -2307 - o. Find the common denominator of g and -1 + 1 - 4 - 825/(-1210). 132 Let s = 69979 + -9657145/138. Calculate the common denominator of s and 19/48. 1104 Let f(m) = m*3 + 5m*2 - 1. Let z be f(-4). Let b(v) = -v + 8. Let w be b(z). Calculate the common denominator of 63/20 and ((-21)/48)/w51. 80 Supp	{ "pile_set_name": "DM Mathematics" }
604, -1328253? -1593900 What comes next: -19283, -35738, -52197, -68660, -85127, -101598, -118073? -134552 What comes next: 69919594, 139839194, 209758792, 279678388, 349597982, 419517574? 489437164 What comes next: 277075, 2216582, 7480973, 17732692, 34634183, 59847890? 95036257 What is next in -17613522, -17613524, -17613526, -17613528, -17613530, -17613532? -17613534 What is the next term in 39299, 66521, 93743, 120965? 148187 What is the next term in 383256, 383352, 383448, 383544, 383640? 383736 What is next in 5797, 12471, 20027, 28465? 37785 What is the next term in -890120, -1780125, -2670130, -3560135, -4450140, -5340145? -6230150 What comes next: -5715, -11905, -18447, -25341, -32587, -40185, -48135? -56437 What is the next term in 2691855, 2691815, 2691775, 2691735, 2691695? 2691655 What comes next: -288, -356, -458, -606, -812, -1088, -1446? -1898 What comes next: -1268779, -2537526, -3806251, -5074948, -6343611, -7612234, -8880811, -10149336? -11417803 What is the next term in 14520, 58092, 130712, 232380, 363096, 522860, 711672? 929532 What is next in 5480408, 5480439, 5480470? 5480501 What is next in -194202, -388337, -582472, -776607? -970742 What is next in -775, -1739, -2883, -4207, -5711, -7395? -9259 What is next in 11014, 17225, 23460, 29719, 36002? 42309 What is next in -9132, -8055, -6252, -3717, -444, 3573, 8340? 13863 What comes next: -754890, -1509813, -2264736, -3019659, -3774582? -4529505 What comes next: -13098, -34130, -69184, -118260, -181358? -258478 What is next in -2439, -6773, -13005, -21135, -31163? -43089 What is the next term in 909, 3802, 8579, 15204, 23641, 33854? 45807 What comes next: -3755702, -15022827, -33801360, -60091295, -93892626? -135205347 What is next in -96790, -96975, -97174, -97393, -97638, -97915? -98230 What is the next term in 5821, 7847, 9839, 11785, 13673, 15491, 17227? 18869 What is next in 83860, 83869, 83898, 83959, 84064, 84225, 84454? 84763 What is the next term in 594536, 1189111, 1783706, 2378321? 2972956 What is next in -3622371, -7244729, -10867083, -14489433? -18111779 What is next in -40190, -40185, -40186, -40199, -40230, -40285? -40370 What is next in 9128, 17709, 26290? 34871 What is the next term in 240, 586, 1230, 2322, 4012, 6450? 9786 What is next in -375697, -751428, -1127157, -1502884? -1878609 What comes next: -236338, -236346, -236360, -236380? -236406 What is next in -5628, -11748, -18346, -25422, -32976, -41008, -49518? -58506 What is next in -34575, -138068, -310517, -551922, -862283, -1241600, -1689873? -2207102 What is the next term in 1162998, 2325997, 3488996, 4651995, 5814994, 6977993? 8140992 What comes next: -4164562, -4164561, -4164560, -4164559, -4164558? -4164557 What is next in -365687, -1462864, -3291485, -5851544, -9143035, -13165952, -17920289? -23406040 What is the next term in 48208919, 48208920, 48208921, 48208922? 48208923 What comes next: -8625, -34357, -77083, -136671, -212989? -305905 What is the next term in -73576072, -73576080, -73576088, -73576096, -73576104, -73576112? -73576120 What is next in 21705, 52057, 82409, 112761? 143113 What comes next: -9845, -79277, -267703, -634619, -1239521, -2141905, -3401267, -5077103? -7228909 What is the next term in 532669, 1065305, 1597927, 2130529, 2663105, 3195649, 3728155? 4260617 What is next in -195166, -780701, -1756606, -3122881, -4879526, -7026541? -9563926 What is the next term in 514948466, 514948468, 514948470, 514948472, 514948474, 514948476? 514948478 What is next in -9154, 10449, 58812, 135935, 241818? 376461 What comes next: -3396604, -3396610, -3396616? -3396622 What is next in -2563, -13239, -31031, -55939? -87963 What is next in 404781, 810070, 1215359? 1620648 What is next in 895048, 895046, 895044, 895042, 895040, 895038? 895036 What is the next term in 3960995, 31687975, 106946919, 253503809, 495124627? 855575355 What is next in -3735726, -7471452, -11207178, -14942904, -18678630, -22414356? -26150082 What is next in 53507, 428097, 1444841, 3424817, 6689103, 11558777, 18354917? 27398601 What is next in 37586, 95026, 152464, 209900, 267334? 324766 What comes next: -46328642, -46328639, -46328636, -46328633? -46328630 What comes next: 29105460, 29105455, 29105448, 29105439? 29105428 What is the next term in -1425044, -5700140, -12825284, -22800464, -35625668, -51300884? -69826100 What is next in -2207, -2031, -1741, -1337, -819, -187, 559? 1419 What is next in -2848143, -2848142, -2848141, -2848140, -2848139, -2848138? -2848137 What is the next term in 16482, 16454, 16344, 16116, 15734, 15162, 14364, 13304? 11946 What is next in 5636, 5229, 4826, 4427, 4032, 3641? 3254 What is next in -9042, -18116, -27194, -36276, -45362, -54452? -63546 What is the next term in 40911, 81809, 122705, 163599? 204491 What is next in -24, 36, 270, 780, 1668? 3036 What is next in 39388, 157502, 354396, 630082, 984572, 1417878, 1930012? 2520986 What is next in 285195, 570333, 855471? 1140609 What is next in -213, -552, -1063, -1740, -2577, -3568, -4707? -5988 What is the next term in -6105, -24224, -54413, -96672? -151001 What comes next: -13441, -14519, -15607, -16711, -17837? -18991 What is next in 1452578, 1452575, 1452576, 1452581, 1452590, 1452603, 1452620? 1452641 What comes next: -6471, -25566, -57301, -101682, -158715, -228406, -310761, -405786? -513487 What is next in -181856, -181781, -181706, -181631, -181556? -181481 What is the next term in 248, 1653, 5334, 12431, 24084? 41433 What is the next term in 3234, 6461, 9708, 12975? 16262 What comes next: 733024, 732981, 732934, 732883, 732828? 732769 What is the next term in -104, -241, -662, -1529, -3004, -5249, -8426, -12697? -18224 What is next in -171574796, -171574795, -171574794, -171574793? -171574792 What comes next: -665803, -2662906, -5991411, -10651318, -16642627, -23965338, -32619451? -42604966 What comes next: -185067, -184931, -184793, -184653, -184511, -184367, -184221? -184073 What comes next: 175157, 175055, 174953, 174851? 174749 What is next in -56325, -56752, -57433, -58374, -59581, -61060, -62817, -64858? -67189 What is next in -37765972, -75531942, -113297912? -151063882 What comes next: -1397, -3092, -5047, -7268, -9761, -12532, -15587? -18932 What is next in -6075, -20941, -44577, -76983? -118159 What is the next term in -172584, -345083, -517476, -689751, -861896? -1033899 What is next in -117298, -117418, -117566, -117700, -117778, -117758, -117598, -117256? -116690 What comes next: -14022, -56100, -126256, -224490? -350802 What comes next: 1561, -192, -1945, -3698, -5451? -7204 What comes next: -2054, -4151, -6306, -8549, -10910? -13419 What comes next: 1262, 663, -960, -4117, -9318, -17073? -27892 What is the next term in 67295, 69776, 73911, 79700, 87143, 96240, 106991? 119396 What is next in 10294, 1315, -7668, -16655, -25646, -34641? -43640 What is the next term in -9786, -14507, -19228? -23949 What comes next: 8911, 14152, 19393, 24634? 29875 What comes next: 18415025, 18415023, 18415021? 18415019 What comes next: -922755897, -922755898, -922755899, -922755900, -922755901, -922755902? -922755903 What is the next term in -3928641, -3928552, -3928463, -3928374, -3928285, -3928196? -3928107 What comes next: -1767, -787, 839, 3105, 6005, 9533, 13683, 18449? 23825 What comes next: 9049, 32943, 71697, 125311? 193785 What is next in 8434, 33728, 75884, 134902, 210782? 303524 What comes next: -2440, -4471, -6112, -7363, -8224, -8695? -8776 What is the next term in 601727, 1203451, 1805173, 2406887, 3008587, 3610267, 4211921, 4813543? 5415127 What comes next: 12230, 10314, 8430, 6578, 4758? 2970 What is next in 399834, 1599321, 3598464, 6397263, 9995718? 14393829 What is the next term in 406, 716, 894, 928, 806, 516, 46? -616 What is next in -35118025, -35118027, -35118029, -35118031, -35118033? -35118035 What comes next: -26336, -105162, -236556, -420512, -657024, -946086, -1287692, -1681836? -2128512 What comes next: 15279172, 30558330, 45837490, 61116652, 76395816? 91674982 What comes next: -9873, -30330, -50785, -71238, -91689? -112138 What is next in 1502, 6382, 14640, 26276? 41290 What is the next term in 93000761, 93000745, 93000729, 93000713, 93000697? 93000681 What comes next: -1239, -11394, -39063, -93036,	{ "pile_set_name": "DM Mathematics" }
-33. Suppose a = -2f - 1, -a + 3f + 34 = 4a. Sort a, z, -4. -4, z, a Let p be 1/1 - (-62)/4. Let v = 167/10 - p. Sort 2/21, 2, v in descending order. 2, v, 2/21 Let d = -4/11 - -3/11. Let j(s) = s2 + 12s + 30. Let o be j(-5). Put 5, o, d in decreasing order. 5, d, o Let c = 23 + 2. Let t be (2 - 0)c/10. Let d be ((-2)/(-5))/(5/50). Put d, t, -4 in descending order. t, d, -4 Let a = -0.31 + -2.69. Suppose 17 = 5v - 3. Sort -3/4, v, a in increasing order. a, -3/4, v Let j be 0/(-2) - 0/1. Let y be ((-10)/6)/((-4)/12). Let z(u) = u*2 - 3u - 5. Let g be z(y). Sort g, j, -3 in descending order. g, j, -3 Let g(p) = -p - 3. Let r be g(-9). Let n = 2 - r. Sort n, 3, -1 in ascending order. n, -1, 3 Let u(x) = -x*3 + 9x*2 - 6x + 5. Let j(a) = -2a3 + 18a*2 - 13a + 10. Let p(t) = 6j(t) - 13u(t). Let o be p(9). Sort 3, o, 1 in increasing order. o, 1, 3 Suppose -3x = 2b + 16, b = x + 2b + 7. Let t(h) = -h + 6. Let c be t(6). Sort x, c, 2 in descending order. 2, c, x Let u = -11 + 1. Let i = 9 + u. Put i, 3, 0.3 in ascending order. i, 0.3, 3 Let w be (-2)/13 + (-84)/(-39). Put -5, 0, w in descending order. w, 0, -5 Let x = 5 - 4.7. Let u = -0.2 - x. Let i = 14/39 - 1/39. Sort i, u, 0.1. u, 0.1, i Let h(k) be the second derivative of k3/3 - 2k*2 + 3k. Let j be h(4). Suppose 13 = 5w + 3. Sort j, -1, w in increasing order. -1, w, j Let s be 54 + -3 - (-1 - -4). Suppose 4l + 0l = s. Suppose 4b = -0 + l. Sort -5, -4, b in increasing order. -5, -4, b Let o(u) = u - 8. Let y be o(7). Let t = 0 - y. Let s = -19 - -19. Put 2/3, t, s in decreasing order. t, 2/3, s Let c be (-2)/8 - (-3)/8. Suppose 2o - 3w - 1 = -15, -o - 5w = -6. Let n be 34/(-28) - o/(-14). Sort -2/3, n, c in descending order. c, -2/3, n Let b = 5.995 + 0.005. Sort 0, 3, b in decreasing order. b, 3, 0 Let j be 3/(-35) - -45/70. Put 6, 0.4, j in increasing order. j, 0.4, 6 Let v(u) be the third derivative of -u*6/120 + 2u*5/15 + 3u*4/8 - 2u*2. Let c be v(9). Sort -4, -1, c in descending order. c, -1, -4 Let h be 9/(-2)(-2)/3. Sort -1, h, -2. -2, -1, h Let v = -28 + 41. Let p = v - 12.6. Let q = 11 + -7. Put p, q, -5 in ascending order. -5, p, q Suppose -3g - 56 = 13. Let a = 22 + g. Sort a, 3, -4 in descending order. 3, a, -4 Let q = 12 - 14. Sort q, -3, 3. -3, q, 3 Suppose 0i + 25 = -2i - 3b, 3b + 20 = -i. Let j = -26 + 24. Suppose 0 = -2q + q - 4. Sort i, q, j in descending order. j, q, i Let v(l) = -l - 2. Let u be v(-6). Let n(g) be the second derivative of g*3/6 - 5g2/2 + g. Let f be n(0). Put u, f, -2 in descending order. u, -2, f Let a = 8 - 11. Let d(m) = m3 + 10m2 - 6m - 1. Let p be d(-9). Let t = 1205/9 - p. Put t, a, 4 in increasing order. a, t, 4 Suppose 3v - 39 = -3f - 2f, 2v + 6 = 2f. Sort 3, 0, f. 0, 3, f Let a be ((-4)/3-1)/(10/(-15)). Put 1, -33, a, -1 in ascending order. -33, a, -1, 1 Let w be (-72)/(-5) - (-10)/(-25). Sort -3, -2, w in decreasing order. w, -2, -3 Suppose -2o - 3v + 19 = 0, -3o = -3v + v + 4. Sort o, 0, -8, 5 in increasing order. -8, 0, o, 5 Suppose -5z + 42 = -38. Put z, 3, 2 in ascending order. 2, 3, z Let i = -150 - -155. Put -2/29, -4/5, 0.3, i in descending order. i, 0.3, -2/29, -4/5 Let d(j) = j2 - 15j + 16. Let q be d(14). Let f be (-24)/(-90) - q/5. Sort 5, f, 2 in descending order. 5, 2, f Suppose a + 10 = -a. Suppose -3o = 4x + 24, 0x = o - 2x - 2. Put a, 5, o in descending order. 5, o, a Let h = 311/966 + -5/138. Let j = -10 - -6. Sort h, j, 1/3 in descending order. 1/3, h, j Let h = -7.79 + -0.21. Let n = h + 13. Let r = 0.1 - -0.3. Sort 2/3, r, n. r, 2/3, n Let d = 0.6 - 1. Let v = d - 0.1. Sort -2/15, 6/7, v in increasing order. v, -2/15, 6/7 Let d = 4.3 - 4. Let t = 16 - 16.18. Let h = t - 0.12. Sort -0.5, d, h in ascending order. -0.5, h, d Suppose -20 = -v + 5v. Suppose 2n - 25 = -2l - 3l, -5n = 4l - 20. Let f = 0 + -1. Put l, f, v in increasing order. v, f, l Let a(q) = -q*3 + 28q*2 - 26q - 24. Let b be a(27). Put b, 6, -1, -8 in descending order. 6, b, -1, -8 Let l(f) = -3f - 5. Suppose -4 = -4v + 8w - 4w, 2v + 3w + 18 = 0. Let y be l(v). Sort -0.2, y, 7 in decreasing order. 7, y, -0.2 Let q be (-1)/(2/2 + 1). Let f be (112/26)/2 + (-154)/77. Sort 1, f, q in descending order. 1, f, q Let v = 6 + -2. Let q(y) = y*3 - 4y*2. Let p be q(v). Put -3, p, 5 in decreasing order. 5, p, -3 Let b be -3 + 1 + (2 - 4). Let x = 0 - -4. Put x, 1, b in decreasing order. x, 1, b Let r = 595/4 + -148. Let z = -1526 - -1528. Let u be (2/5)/((-14)/10). Put z, u, r in increasing order. u, r, z Suppose 3h - 9 = -0h. Sort 1, h, -4. -4, 1, h Let s = 13.22 - 13.2. Sort 2, s, 0.2, 0.5 in increasing order. s, 0.2, 0.5, 2 Let h = 0.04 + -0.44. Let i = -0.8 + 0.9. Sort -1, h, i in decreasing order. i, h, -1 Let u be (21/(-63))/((-1)/(-15)). Put u, -1, 0 in increasing order. u, -1, 0 Let x = 8.3 - -1.7. Let v = x - 9. Let j = -3 + 2.5. Sort v, j, -3 in descending order. v, j, -3 Let l = 0.13 + 1.07. Let n = l - 0.7. Sort -3, n, 2/5 in increasing order. -3, 2/5, n Let m = 31 - 30. Sort 6, -1, -6/11, m in increasing order. -1, -6/11, m, 6 Let r(g) = g2 + 9g. Let p be r(-8). Sort 3, p, 1 in increasing order. p, 1, 3 Let o = 1.45 - -0.55. Let l = 5 - 4.6. Let g = -0.2 - 0. Sort o, l, g in descending order. o, l, g Let s = -554/45 + 112/9. Let k = -1 + 17.5. Let z = -17 + k. Sort z, s, -2 in decreasing order. s, z, -2 Let i = 5.68 - 4.68. Let t = -7 + 6.4. Let m = t + -1.4. Put i, m, 2 in descending order. 2, i, m Let f(y) = y*2 - 9y - 5. Let m be f(10). Put -2, m, -34 in descending order. m, -2, -34 Let v be ((-30)/2)/3 - -1. Suppose -6 = 4l - 2. Let x be (1 + 0)/(3/9). Put x, v, l in increasing order. v, l, x Let m = 59 - 34. Suppose 26q - 4 = mq. Let a = 0 + 0. Sort 5, q, a in decreasing order. 5, q, a Let o be 31/(-4) + (-4)/16. Let b be (15/(-70))/((-6)/o). Sort b, -5, 3 in decreasing order. 3, b, -5 Let b(k) = -k2 - 8k - 2k2 + 2k*2. Let d be b(-8). Suppose 2o + 14 = -3y, -4y - 5o + do = 21. Put -2, 3, y in decreasing order. 3, -2, y Let c(f) = f*3 - 4f*2 - 5f - 4. Let q be c(5). Let v be (4/(-3))/(20/(-30)). Put q, v, -3 in decreasing order. v, -3, q Suppose 2i - l + 7 = 0, -3l + 3 = 4i + 32. Put i, 5, 0, 3 in ascending order. i, 0, 3, 5 Let j be 4(-2 + 27/12). Suppose 4a = 5m - 16, a - j = -0a. Suppose -3u + 8x = 3x, 0 = u + x + 8. Put u, m, -2 in decreasing order. m, -2, u Let d = -1.3 + 0.4. Let q = d - -0.5. Let i = -2.5 - -2. Put q, 5, i in ascending order. i, q, 5 Suppose -4y + 25 = y. Let r be (1 + 1)(-10)/4. Sort 1, y, r in descending order. y, 1, r Let v be 11 - -1 - (1 + 1). Suppose -4k - v = -5l - 5, 4k = 0. Suppose -4h + 2x + 21 = h, -3x - 9 = -3h. Put l, -5, h in increasing order. -5, l, h Let l = -45 - -48.6. Let z = l - 5.7. Let i = z + 0.1. Put i, -0.4, 0.3 in descending order. 0.3, -0.4, i Let y = -1.1 + 1. Let v be ((-15)/(-10))/(0 + (-63)/12). Sort y, 1, v. v, y, 1 Let w be 5 + ((-330)/(-14))/(-5). Put w, -1/3, 4/3, 7 in increasing order. -1/3, w, 4/3, 7 Suppose -5 = -16j + 15j. Sort -4, 3, -5, j in descending order. j, 3, -4, -5 Let o(q) = 4q*3 - 5q*2 + 14q - 11. Let j(r) = r3 + r2 + r + 1. Let u(l) = 5j(l) - o(l). Let f be u(-11). Put 0, f, 4 in decreasing order. 4, 0, f Suppose 3r - b - 18 = -2r, 5b + 12 = -r. Sort r, -9, -5. -9, -5, r Let o = -3 + 4. Let y = 2 - 2. Let p be (-12)/8 + 124/72. Put y, o, p in decreasing order. o, p, y Let u = 7 + -2. Suppose ug - 1 = -2w, 0 = g - 4w + 5w - 2. Put g, 0, -5 in decreasing order. 0, g, -5 Let n = 1/25 - 16/25. Sort -0.4, -2/7, n, -1/5 in descending order. -1/5, -2/7, -0.4, n Let z = -2.7 + 2.3. Let u = 0.2 + 0. Let j = u - 0.2. Sort z, j, 1 in ascending order. z, j, 1 Let o = 15.8 + -6.6. Let r = -9 + o. Let a = r + -0.3. Sort a, -1/3, 0.4. -1/3, a, 0.4 Let q = -12 + 18. Let d be (-3)/q-6 + 1. Let l be 6 + 1 + (-6 - -4). Sort l, 0, d in descending order. l, d, 0 Suppose 4 + 6 = 5w. Let x = 0 + 4. Let i(t) = -t*2 + 2t + 3. Let s be i(x). Sort -1, w, s in decreasing order. w, -1, s Suppose -3b = 4f - 9, 15 = -3f - 2b + 7b. Let h = -3 + 7. Suppose -7 - 1 = hl. Put l, f, 1/10 in decreasing order. 1/10, f, l Let p = -0.1 - -0.3. Let r = -31	{ "pile_set_name": "DM Mathematics" }
Divide 23146 by -48. -11573/24 What is -95 divided by 7381? -95/7381 Divide 910 by 905. 182/181 Calculate 19117 divided by -3. -19117/3 -2612 divided by -2 1306 Divide 8071920 by 540. 14948 -2490234 divided by 2 -1245117 Divide 760646 by 40034. 19 Calculate -804934 divided by 402467. -2 What is 461200 divided by 10? 46120 14 divided by -51710 -7/25855 -12093 divided by -417 29 Divide -800 by -3122. 400/1561 What is 140 divided by 293? 140/293 Divide 60 by 6167. 60/6167 What is 13872 divided by -1? -13872 Calculate -30083 divided by 4. -30083/4 What is -14797 divided by -7? 14797/7 Divide -3734582 by 2. -1867291 Divide -1183281 by -394427. 3 Calculate 41010 divided by 10. 4101 -24136 divided by 7 -3448 What is -1 divided by 386524? -1/386524 What is -876 divided by -438? 2 -1139 divided by -3 1139/3 15198 divided by 5066 3 -13098 divided by -59 222 What is -23 divided by -2945? 23/2945 353680 divided by -88420 -4 Divide 1314810 by -20870. -63 What is -5 divided by -434669? 5/434669 Divide -68080 by 184. -370 Calculate 2 divided by 1596. 1/798 Calculate 5824 divided by 14. 416 Divide 3 by -48034. -3/48034 Divide 0 by 71153. 0 Divide 218500 by -54625. -4 Divide -44 by 251. -44/251 What is -63180 divided by 12? -5265 Divide -37 by 281. -37/281 What is -12 divided by 7105? -12/7105 What is -677729 divided by 481? -1409 Divide -45 by -10067. 45/10067 29 divided by -195582 -29/195582 Divide -897426 by -2. 448713 Divide -1340807 by 3. -1340807/3 Calculate 1089 divided by 8. 1089/8 What is 163830 divided by 1290? 127 Divide 818100 by -27. -30300 What is 71225 divided by 55? 1295 Calculate -280782 divided by -7389. 38 Divide -291252 by 11202. -26 Divide -11924 by -101. 11924/101 Divide -322 by 3839. -322/3839 Divide 5 by 53097. 5/53097 Divide 32365 by 5. 6473 Divide -8469 by 7. -8469/7 65105 divided by 29 2245 -4 divided by -20540 1/5135 364440 divided by 40 9111 What is -198166 divided by -99083? 2 Calculate 191 divided by -42. -191/42 Calculate 4 divided by -35126. -2/17563 Divide 120 by 378. 20/63 Calculate -1 divided by -134020. 1/134020 Calculate 568 divided by 40. 71/5 What is -26618 divided by 4? -13309/2 Divide -235062 by -6. 39177 -1213 divided by 611 -1213/611 What is 603902 divided by 301951? 2 What is 72632 divided by -7? -10376 Calculate 9535 divided by 5. 1907 14380 divided by 719 20 Calculate -203 divided by 106. -203/106 Calculate -118504 divided by -7. 118504/7 -10965 divided by 3 -3655 Divide -1032660 by 68844. -15 Divide -3 by -981. 1/327 Calculate -808275 divided by 325. -2487 Calculate 65784 divided by 21928. 3 What is -57826 divided by -57826? 1 Calculate -388972 divided by 94. -4138 Calculate -17958 divided by 6. -2993 What is 0 divided by 76024? 0 Divide 1834096 by -26972. -68 Divide -71981 by -5537. 13 Divide -3163880 by -380. 8326 20904 divided by -804 -26 What is 670 divided by -211? -670/211 Calculate -1360 divided by -272. 5 -2 divided by 10331 -2/10331 -4 divided by -13396 1/3349 Divide 2 by -58258. -1/29129 Divide -292 by 1895. -292/1895 What is 134880 divided by 13488? 10 Divide 0 by 106106. 0 Calculate -256594 divided by -128297. 2 Calculate 2299464 divided by 3. 766488 What is -13310 divided by 683? -13310/683 Divide -4352 by 17. -256 What is 7938 divided by 3? 2646 0 divided by -26684 0 What is -348128 divided by -172? 2024 18847 divided by 5 18847/5 What is -1 divided by -298012? 1/298012 Calculate 183232 divided by 32. 5726 -1 divided by -83817 1/83817 Divide -10722 by 3574. -3 1590 divided by -105 -106/7 What is 155 divided by 395? 31/79 What is 5 divided by 241607? 5/241607 Calculate 264 divided by 215. 264/215 Divide 743 by -96. -743/96 Calculate -4 divided by 233501. -4/233501 Divide -1797 by 29. -1797/29 What is -1803510 divided by -360702? 5 Divide -104710 by 370. -283 -33464 divided by -376 89 Calculate 8575 divided by -49. -175 Divide 4 by -212159. -4/212159 Divide -432180 by -9. 48020 Divide 175800 by 58600. 3 -644 divided by -65 644/65 Calculate -95211 divided by -31737. 3 Divide 3796 by -11. -3796/11 What is 0 divided by 54952? 0 Divide -6265720 by -10. 626572 4 divided by 209144 1/52286 Calculate 2 divided by -24454. -1/12227 1109 divided by 105 1109/105 Calculate 104611 divided by -13. -8047 Divide -242 by -620. 121/310 Divide 2412 by 128. 603/32 Divide -349 by 782. -349/782 What is 103 divided by 69? 103/69 -266250 divided by -426 625 Calculate 4 divided by 47391. 4/47391 Divide 107 by -675. -107/675 Divide 334884 by -83721. -4 5 divided by -17186 -5/17186 What is -2 divided by 51053? -2/51053 What is -12960 divided by -20? 648 Divide 5129 by -23. -223 What is -195138 divided by -666? 293 Calculate -61144 divided by 7643. -8 Divide 139968 by -243. -576 What is -11080 divided by 19? -11080/19 Divide -3604 by -2. 1802 What is 12441 divided by 957? 13 What is -144096 divided by -48? 3002 What is -4228 divided by -29? 4228/29 Calculate 4050 divided by -1. -4050 -202 divided by -127 202/127 6511 divided by 13 6511/13 27675 divided by -9225 -3 Calculate 52480 divided by -8. -6560 What is 5 divided by -395930? -1/79186 16 divided by 592240 1/37015 Calculate 15769 divided by 2. 15769/2 Divide 3 by -7775. -3/7775 Calculate 8314 divided by -94. -4157/47 Calculate -175 divided by -2115. 35/423 Calculate -123099 divided by -3. 41033 What is -1 divided by 241887? -1/241887 What is -552170 divided by 5? -110434 -230808 divided by 1416 -163 What is 31096 divided by -7774? -4 Calculate 3010880 divided by -4. -752720 Calculate -3 divided by 530009. -3/530009 What is -38580 divided by 2? -19290 What is 48768 divided by 384? 127 567555 divided by 2355 241 What is -2536 divided by 65? -2536/65 Calculate 3 divided by -11026. -3/11026 Calculate -3 divided by -50689. 3/50689 Divide -13348 by 23. -13348/23 What is -5 divided by 208? -5/208 Divide -4 by 266547. -4/266547 Divide 182022 by 2. 91011 Calculate -2980650 divided by -6. 496775 Calculate 5 divided by -106372. -5/106372 What is -32752 divided by 17? -32752/17 Calculate 5 divided by -50161. -5/50161 170596 divided by -42649 -4 -27424 divided by -3428 8 674 divided by -2 -337 Divide 7 by 10334. 7/10334 What is -3 divided by 1311465? -1/437155 Divide -63745 by -671. 95 43418 divided by -21709 -2 Divide -513484 by 202. -2542 Calculate -52580 divided by -10516. 5 Divide 3606400 by 50. 72128 Divide -9745 by 5. -1949 What is 1124 divided by 21? 1124/21 Divide -4722072 by -1180518. 4 What is -618151 divided by -3? 618151/3 -41 divided by 2620 -41/2620 40537 divided by 5791 7 Divide 180875 by -2. -180875/2 What is -4882 divided by 510? -2441/255 347 divided by 1564 347/1564 What is -631554 divided by -210518? 3 -151501 divided by -5 151501/5 What is -405 divided by -55? 81/11 Calculate -1683 divided by 866. -1683/866 -1083954 divided by -21254 51 Divide 45806 by 37. 1238 Divide 67 by 16. 67/16 -34255 divided by -1105 31 What is -51296 divided by 112? -458 What is 493 divided by 1168? 493/1168 Calculate -22568 divided by 93. -728/3 4 divided by 477433 4/477433 9030 divided by 3 3010 -413264 divided by 17968 -23 Calculate -951855 divided by 5. -190371 Divide -26972 by -2. 13486 Calculate -135909 divided by 45303. -3 Divide -3080 by 140. -22 Divide -110000 by 20. -5500 Divide -4671 by -4671. 1 -301 divided by 1377 -301/1377 Divide 3 by -2955. -1/985 What is -22281 divided by -7427? 3 Divide 136098 by 7561. 18 0 divided by 1087 0 82368 divided by -624 -132 Calculate -2790155 divided by 90005. -31 -1240 divided by 2235 -248/447 Calculate -3 divided by -109202. 3/109202 3505830 divided by 350583 10 Calculate 957 divided by -9. -319/3 -936 divided by 164 -234/41 What is 2 divided by 13868? 1/6934 What is -16302 divided by 1254? -13 Divide -29295 by 63. -465 Calculate -1324 divided by 57. -1324/57 Divide 386862 by 9211. 42 237188 divided by 602 394 Calculate 34417 divided by 1. 34417 352 divided by -8 -44 -56704 divided by 7088 -8 Divide -5 by -64197. 5/64197 Divide 1258689 by 4. 1258689/4 Divide -3439165 by 5. -687833 What is -7630 divided by 9? -7630/9 Divide 802 by 2322. 401/1161 Divide -5 by 3259. -5/3259 What is 20152 divided by 88? 229 Divide -8 by -4431. 8/4431 58 divided by 5693 58/5693 -162 divided by -7908 27/1318 -593952 divided by -37122 16 Divide 1992680 by 12856. 155	{ "pile_set_name": "DM Mathematics" }
hen 3276166 is divided by 829. 787 What is the remainder when 9885051 is divided by 3035? 56 What is the remainder when 2275810 is divided by 758306? 892 Calculate the remainder when 512976 is divided by 512807. 169 Calculate the remainder when 23738132 is divided by 305. 287 What is the remainder when 226774 is divided by 5150? 174 Calculate the remainder when 117188 is divided by 6112. 1060 Calculate the remainder when 1624503 is divided by 406052. 295 Calculate the remainder when 6146299 is divided by 5105. 4984 What is the remainder when 3422 is divided by 2757? 665 What is the remainder when 137906 is divided by 45568? 1202 Calculate the remainder when 126647149 is divided by 543. 1 What is the remainder when 942361 is divided by 3331? 3019 Calculate the remainder when 89170 is divided by 89064. 106 Calculate the remainder when 5069302 is divided by 253464. 22 Calculate the remainder when 5253249 is divided by 14432. 1 What is the remainder when 478461 is divided by 156? 9 Calculate the remainder when 46299329 is divided by 91. 76 What is the remainder when 153721 is divided by 1704? 361 What is the remainder when 14113422 is divided by 1028? 10 What is the remainder when 16308619 is divided by 159? 148 Calculate the remainder when 90115 is divided by 8176. 179 Calculate the remainder when 908183 is divided by 1983. 1952 Calculate the remainder when 3025768 is divided by 20. 8 What is the remainder when 62518778 is divided by 57? 38 What is the remainder when 83878 is divided by 81971? 1907 What is the remainder when 2384342 is divided by 1101? 677 Calculate the remainder when 47732112 is divided by 30172. 8 What is the remainder when 251572 is divided by 193? 93 What is the remainder when 1438714 is divided by 36? 10 What is the remainder when 77402446 is divided by 3870122? 6 What is the remainder when 24867220 is divided by 8787? 10 What is the remainder when 57865 is divided by 1243? 687 Calculate the remainder when 874520 is divided by 578. 6 Calculate the remainder when 1979168 is divided by 52081. 90 Calculate the remainder when 18657507 is divided by 13. 11 Calculate the remainder when 43117 is divided by 12409. 5890 What is the remainder when 22480499 is divided by 763? 230 What is the remainder when 396908 is divided by 5521? 4917 Calculate the remainder when 13190945 is divided by 2717. 2627 What is the remainder when 1473996 is divided by 5361? 5082 Calculate the remainder when 19379867 is divided by 12. 11 What is the remainder when 74557327 is divided by 74557325? 2 Calculate the remainder when 33310281 is divided by 82. 77 Calculate the remainder when 693755 is divided by 589. 502 Calculate the remainder when 2332723 is divided by 83311. 15 Calculate the remainder when 939226 is divided by 421. 396 What is the remainder when 378832 is divided by 102? 4 Calculate the remainder when 213394 is divided by 210295. 3099 What is the remainder when 51165164 is divided by 491? 18 Calculate the remainder when 2740923 is divided by 6024. 3 Calculate the remainder when 20043034 is divided by 40. 34 What is the remainder when 38328 is divided by 299? 56 Calculate the remainder when 10464620 is divided by 78. 62 What is the remainder when 13821349 is divided by 6025? 6024 What is the remainder when 69362 is divided by 36? 26 What is the remainder when 582858 is divided by 11203? 302 What is the remainder when 19217 is divided by 9092? 1033 Calculate the remainder when 54377319 is divided by 1001. 997 What is the remainder when 2627936157 is divided by 10? 7 What is the remainder when 393043 is divided by 26191? 178 Calculate the remainder when 8312939 is divided by 2251. 2247 Calculate the remainder when 277816 is divided by 787. 5 What is the remainder when 47377826 is divided by 4902? 4898 What is the remainder when 4127037 is divided by 179436? 9 Calculate the remainder when 5654298 is divided by 1354. 1348 Calculate the remainder when 16674371 is divided by 11. 10 What is the remainder when 51699 is divided by 708? 15 Calculate the remainder when 264549 is divided by 292. 289 What is the remainder when 18008839 is divided by 157? 154 What is the remainder when 9890915 is divided by 2776? 27 Calculate the remainder when 690371 is divided by 172584. 35 What is the remainder when 467072 is divided by 93412? 12 What is the remainder when 78340291 is divided by 28? 15 What is the remainder when 2705573 is divided by 807? 509 What is the remainder when 157856274 is divided by 286? 4 Calculate the remainder when 92971765 is divided by 3618. 19 What is the remainder when 174673 is divided by 87290? 93 Calculate the remainder when 523083 is divided by 9. 3 Calculate the remainder when 2422390 is divided by 346055. 5 Calculate the remainder when 49572941 is divided by 271. 266 Calculate the remainder when 408066 is divided by 14071. 7 What is the remainder when 1583927 is divided by 395976? 23 What is the remainder when 177464339 is divided by 1305? 1304 Calculate the remainder when 9249493 is divided by 237166. 19 Calculate the remainder when 3950290 is divided by 41. 22 Calculate the remainder when 20696848 is divided by 53. 30 What is the remainder when 39906558 is divided by 589? 41 What is the remainder when 243712833 is divided by 12? 9 Calculate the remainder when 3973373 is divided by 201. 5 What is the remainder when 178949 is divided by 4? 1 What is the remainder when 43587743 is divided by 463? 460 What is the remainder when 390411 is divided by 2914? 2849 Calculate the remainder when 117641556 is divided by 21. 18 What is the remainder when 3460593 is divided by 692055? 318 What is the remainder when 7325147 is divided by 125? 22 What is the remainder when 46972 is divided by 15491? 499 Calculate the remainder when 556329 is divided by 111049. 1084 What is the remainder when 87871 is divided by 3778? 977 What is the remainder when 275400 is divided by 38? 14 Calculate the remainder when 10772 is divided by 2717. 2621 What is the remainder when 438514 is divided by 583? 98 What is the remainder when 41374020 is divided by 1436? 1424 Calculate the remainder when 2503864 is divided by 119221. 223 What is the remainder when 1583400 is divided by 897? 195 Calculate the remainder when 6485 is divided by 2891. 703 What is the remainder when 44463513 is divided by 123? 120 What is the remainder when 24563039 is divided by 16? 15 What is the remainder when 13991 is divided by 4549? 344 What is the remainder when 18601 is divided by 18332? 269 What is the remainder when 2886297 is divided by 1656? 1545 What is the remainder when 26617077 is divided by 42? 39 Calculate the remainder when 2975744 is divided by 5460. 44 Calculate the remainder when 115222 is divided by 4214. 1444 Calculate the remainder when 3859846 is divided by 7509. 220 Calculate the remainder when 501329 is divided by 373. 17 Calculate the remainder when 13406007 is divided by 154. 153 What is the remainder when 5262556 is divided by 122385? 1 Calculate the remainder when 28183710 is divided by 79615. 0 Calculate the remainder when 844136678 is divided by 970. 968 Calculate the remainder when 3398262 is divided by 700. 462 What is the remainder when 32034932 is divided by 32034932? 0 Calculate the remainder when 333878 is divided by 2878. 30 Calculate the remainder when 137355 is divided by 135. 60 Calculate the remainder when 286859 is divided by 1782. 1739 Calculate the remainder when 1748064 is divided by 58. 2 Calculate the remainder when 50313 is divided by 12577. 5 What is the remainder when 438872 is divided by 59? 30 Calculate the remainder when 17718110 is divided by 3286. 3284 What is the remainder when 866309 is divided by 374? 125 Calculate the remainder when 1119951 is divided by 170. 161 Calculate the remainder when 46150277 is divided by 227. 42 What is the remainder when 764486 is divided by 921? 56 What is the remainder when 15295 is divided by 956? 955 What is the remainder when 140013 is divided by 9920? 1133 What is the remainder when 2808401 is divided by 828? 653 Calculate the remainder when 13649 is divided by 704. 273 What is the remainder when 225599 is divided by 778? 757 Calculate the remainder when 114829 is divided by 22964. 9 Calculate the	{ "pile_set_name": "DM Mathematics" }
+ 55. Suppose sj - 1922 = j. Calculate the highest common divisor of 217 and j. 31 Let v = -5324 - -5939. What is the greatest common factor of v and 2091? 123 Suppose 5m = -5g - 555, 3g + 4m + 341 = -m. Let f = g - -164. Suppose 9k - 33 = f. What is the highest common factor of k and 80? 10 Let z = 49 + -34. Suppose 3b = 2b + 3u - z, 2b + 4u = 20. Suppose h - 4 - 20 = b. Calculate the greatest common factor of h and 3. 3 Let y be ((-175)/20 - -5)/(10/(-32)). What is the highest common divisor of 1824 and y? 12 Suppose -97839 = -52r + 121185. Calculate the highest common factor of 243 and r. 81 Let f be 0 + (-5 - -117 - -4). Suppose -8 = 2a, 5a - 19 = 5x - 184. Calculate the greatest common factor of x and f. 29 Suppose 4k + 4k = 0. Suppose k = 19d - 21d + 14. Calculate the highest common factor of 21 and d. 7 Suppose -31v - 324 = -9j - 28v, -4j = -v - 143. Suppose -10z + 1893 = -1257. What is the highest common factor of z and j? 35 Suppose -2w + 12 - 90 = 0. Let g = w - -43. Let v(j) = -j2 + 9j - 12. Let o be v(g). What is the greatest common divisor of 32 and o? 8 Let z = -25776 + 29866. What is the greatest common divisor of z and 80? 10 Suppose -7b - 24548 = -19b - 64b. Calculate the highest common factor of b and 1377. 17 Let v be (126/(-30))/(356/120 + -3). Suppose 0a - 3a = -4o - v, 0 = 2a - 3o - 83. What is the highest common divisor of a and 46? 46 Suppose 45q - 12436 = 31484. Calculate the highest common divisor of q and 549. 61 Suppose -s + 1962915 = 76s + 244s. Calculate the highest common divisor of 10 and s. 5 Suppose 3d + 81 = 7d - 3c, -140 = -5d - 4c. What is the greatest common divisor of d and 120? 24 Let k be (4 - 2 - 0) + 3. Let b be 3((-15)/k)/(-3). Let x be b + 0 - (-11 + -161). Calculate the greatest common factor of 25 and x. 25 Suppose -2 = -5o + 13. Let a be 232 - (-40)/(-15)o/2. Suppose 5v + 12 = -8, -5p + v = -194. What is the greatest common factor of a and p? 38 Let g be (-2)/10 - (-11 - 284/20). Let k(z) = -475z. Let b be k(-1). What is the highest common factor of b and g? 25 Suppose -4p + 11s = 8s - 98, 0 = 3p - 2s - 74. Suppose 23i + 795 = pi. Calculate the highest common divisor of 106 and i. 53 Suppose 0 = 5z - 5, -i + 6i - 8322 = 3z. Calculate the highest common factor of 74 and i. 37 Suppose -32 = -2m - 40, m - 21767 = -3l. What is the highest common factor of 531 and l? 177 Suppose 91t - 84t - 1491 = 0. What is the greatest common factor of 15 and t? 3 Suppose 2 = -h + 2a, -365h - a = -360h - 45. What is the greatest common factor of 206 and h? 2 Suppose -3w + 394 - 79 = 0. Let o = -28 + 49. What is the highest common divisor of o and w? 21 Let m(h) = -27h - 180. Let q be m(-7). Calculate the highest common divisor of 351 and q. 9 Suppose -3f + 41 = -94. Let i be (717/12)/(468/208) - 12/(-27). Calculate the greatest common divisor of f and i. 9 Let u(d) = -2d3 - 128d*2 + 13d + 1712. Let c be u(-64). What is the highest common divisor of 1210 and c? 110 Let g = 532 - 311. Suppose -2v - 3v + g = -c, 4v + 3c = 192. Let r be 2305/v - (-4)/(-18). Calculate the greatest common factor of 17 and r. 17 Let m be (1 + -5)(-26 + 21). Let h be (6 - 0)(-1 - 58/(-3)). What is the highest common factor of m and h? 10 Let r(q) = q*3 - 42q*2 - 90q + 196. Let z be r(44). Suppose -3c - 156 = -4p, c = p - c - 44. What is the greatest common divisor of p and z? 36 Let j(f) = 106f - 1264. Let r be j(12). Calculate the greatest common factor of 2636 and r. 4 Let f(g) = -g3 + 13g*2 + 16g - 24. Let j be f(14). Suppose -jo + 1 = 9, 816 = 5z - 3o. Calculate the highest common divisor of 36 and z. 18 Let x = 16 + -8. Let q = 330 - 330. Suppose 5i - 310 + 30 = q. Calculate the highest common divisor of x and i. 8 Let y = 753 + -527. Let z = 362 - y. What is the greatest common factor of z and 102? 34 Suppose -67y + 287y = 37400. What is the highest common factor of y and 90? 10 Suppose 1940 = -260m + 289m + 55. Calculate the highest common divisor of 481 and m. 13 Suppose -2q + 2u + 8562 = q, 2q + u = 5715. What is the highest common divisor of q and 42? 42 Let c = -4830 + 4838. Calculate the highest common divisor of 2696 and c. 8 Let p(x) = x3 + 27x*2 + 52x + 64. Let h be p(-25). Let w be ((-18404)/7)/(-4) + (-4)/h. What is the greatest common factor of 9 and w? 9 Let r = -21375 + 36800. What is the greatest common divisor of r and 25? 25 Suppose 525 = 931c - 928c. What is the highest common factor of 75 and c? 25 Let n(u) = -3u2 - 13u - 2. Let d = -85 + 92. Let t be n(d). Let z be (6/15)/((-2)/t). Calculate the greatest common divisor of 12 and z. 12 Suppose 16k + 147 - 522 = 345. What is the highest common divisor of k and 2370? 15 Suppose 7j + 2 - 51 = 0. Let x be (j/21)/(1/36). Let z be (-4)/16-130x/15. What is the highest common divisor of 208 and z? 26 Suppose 6a = 239 + 385. Suppose 0 = 9w + 5 - a. Calculate the greatest common factor of w and 1. 1 Suppose 4a + 3w = 35, -a = -6a - 4w + 45. Suppose -141 = -am + 2d, -d = 2m + 2d - 45. What is the greatest common factor of 63 and m? 9 Suppose 482j - 480j - 9078 = 0. Calculate the highest common factor of 51 and j. 51 Let d(m) = -15m + 7156. Let j be d(-170). What is the highest common factor of j and 46? 46 Let f(d) = -4d*3 + 8d + 26. Let u be f(-4). Let r be 14 + 8/(4 + (2 - 8)). What is the greatest common factor of u and r? 10 Let g(v) = -65v - 30. Let r be g(-4). Let y = r + -216. What is the highest common factor of y and 21? 7 Let s(y) = -y3 + 6y*2 + 3y - 4. Let z be s(6). Let i = 24 - 24. Suppose i = 3c - 3g - 116 + 38, 10 = -2g. What is the highest common divisor of c and z? 7 Let r(b) = -13b*3 - 8b*2 - 19b - 5. Let t be r(-4). Calculate the highest common divisor of t and 62. 31 Let a be (128/896)/(5/(-7))(-55 + 0). Let s(b) be the first derivative of -b2/2 + 17b + 1. Let w be s(a). Calculate the greatest common factor of w and 66. 6 Let i = 62 + -52. Suppose -4r + i = 10. Let g be -3 + -3(-6 - r). Calculate the greatest common factor of g and 45. 15 Let y = -11811 - -13883. What is the highest common factor of 32 and y? 8 Let s(o) = -974o - 2586. Let m be s(-6). What is the greatest common factor of m and 18? 18 Suppose 0 = 22t + 42t - 14t - 12900. Let p be (18/(-15))/((-1)/15). What is the highest common divisor of p and t? 6 Let a be 1832/12 - (-2 - (-5)/3). Suppose -5b + 1 = 4m - 1, 5m - b = 17. Let g be (28 + -1)2 - m. Calculate the greatest common divisor of g and a. 51 Suppose -71v = -503 - 49372 - 25527. Calculate the greatest common factor of v and 72. 18 Let g be -8 - -5 - 667/(-1). Suppose -b - q = -6b + g, 131 = b - 2q. Calculate the greatest common factor of b and 19. 19 Let a = -2761 - -2803. Suppose 9x = 2670 + 354. What is the greatest common factor of x and a? 42 Let l(x) = -x*2 - 16x + 34. Let i be l(-8). Let d = 17 - -11. Calculate the highest common factor of i and d. 14 Suppose 5z - 2i = 8z - 2409, 0 = -2z + 4i + 1590. What is the highest common factor of z and 178? 89 Let o be 81 - (-5 - (-6)/(-4)(-4)/(-3)). What is the highest common divisor of 248 and o? 8 Suppose -5x - 5n + 1525 = -0n, 4n = -x + 320. Let s be (-75)/(3/(-9)3). Calculate the highest common factor of x and s. 75 Let b be 6/(-8 - (-226)/28). Let h be (-220)/(-66)(-12)/(-10). Suppose 78 = 2l + 2l + 3q, -94 = -hl + 5q. Calculate the highest common divisor of l and b. 21 Let s = 9 + -15. Let r be (2 + 21/s)-4. Let p be 1/(-4)6 - (-255)/r. What is the greatest common factor of 246 and p? 41 Let m = -42 - -5. Suppose 2x = 5u + 129, -u + 4x = 2u + 69. Let z = u - m. Calculate the highest common divisor of 10 and z. 10 Suppose -36 = 3m - 18. Let g be (-4 - (-148)/m)-3. Suppose 5r + 5j + 26 - 661 = 0, -r + 121 = 4j. Calculate the greatest common factor of g and r. 43 Let u = -5184 - -5340. Calculate the greatest common divisor of u and 372. 12 Suppose -2d - 5u - 60 = -268, 3u - 6 = 0. Calculate the greatest common factor of d and 1353. 33 Let d = -994 - -996. Let y be (-3)/(-6)-40(-43)/d. What is the highest common factor of 10 and y? 10 Let u(o) = 16o*2 + 44o - 501. Let h be u(11)	{ "pile_set_name": "DM Mathematics" }
st value? (a) 1.7 (b) -3 (c) -11/4 (d) -2/7 b What is the second smallest value in 1/4, 232, 4? 4 Which is the third biggest value? (a) -4 (b) -3606/11 (c) 3/10 b What is the third biggest value in 0.3, 21904, -4? -4 What is the third biggest value in -1143.1, -5/3, 74? -1143.1 Which is the second biggest value? (a) -3 (b) -0.1 (c) -0.04734 (d) 1 (e) 0.5 e What is the smallest value in -45, 1, -5, 0.3, -3? -45 What is the second biggest value in 2/3, 0.1, 0.592? 0.592 Which is the smallest value? (a) -4 (b) -2/9 (c) 103 (d) 0.1 (e) -1 a What is the fourth smallest value in 1, 48/11, -0.2, -27/14? 48/11 What is the second smallest value in -2, -2/11, 2, 653? -2/11 Which is the third biggest value? (a) -0.2 (b) 48 (c) 13 (d) -2 a What is the fifth biggest value in -98, -1/4, 3, -2, -66? -98 What is the third smallest value in -1358, -1/2, -1.7, 2/11? -1/2 What is the fourth smallest value in 3/8, 0.1, 22, 2.1? 22 What is the third smallest value in 8/57, 11, 0.7? 11 What is the smallest value in -1/9, 5, -1, 1.6? -1 What is the second biggest value in 3/4, 1, -604/15, 3/8, -1/4? 3/4 Which is the biggest value? (a) 2673 (b) -0.1 (c) 0.1 a What is the fourth biggest value in 22/19, 5, -20, 2/7? -20 What is the second smallest value in 1/5, -0.14499, 0.1, 4, 2, 5? 0.1 What is the fourth biggest value in 0.2, 383, -1, 0.7? -1 What is the third biggest value in 8, -5, -24, 4, -1.4? -1.4 What is the third smallest value in -6, 2/29, -0.1, 3, -10, 4? -0.1 What is the third smallest value in 5, -2, -20, -0.3, -0.2, -0.5? -0.5 Which is the fourth smallest value? (a) 3/5 (b) -13/67 (c) -1/8 (d) 0.06 (e) 5 (f) 0.2 f Which is the fourth smallest value? (a) 0.148 (b) 0.28 (c) -3 (d) -49 (e) 0.1 (f) 0.3 a Which is the sixth smallest value? (a) -5/4 (b) 0 (c) -0.1 (d) 5 (e) 2/3 (f) -2/17 d What is the second biggest value in -2/7, 1/14, 922? 1/14 What is the biggest value in -4/9, 0.1, 13/9, -2, -2.52? 13/9 What is the third biggest value in 3/8, -4, 1, -43, 6, -1/8? 3/8 What is the biggest value in 1/6, -29, -0.3, -3? 1/6 Which is the fourth smallest value? (a) 4 (b) -1/7 (c) -1 (d) 7 (e) -31 a What is the biggest value in -7, -18/71, 6/7? 6/7 What is the third smallest value in 51, 2/21, 1.2? 51 What is the third smallest value in 64/5, 5, -3, 17? 64/5 Which is the second biggest value? (a) -5 (b) -25613 (c) 2/3 (d) -0.2 (e) 1 (f) 0.4 c What is the biggest value in 5, 4.1, 0, -5/13, -3/7, -0.3? 5 What is the biggest value in -0.4, 6/17, 2736/103? 2736/103 Which is the third biggest value? (a) -3/5 (b) 1/3 (c) 0.1 (d) -49/25 (e) 2 (f) -33 c Which is the fifth biggest value? (a) 4 (b) -2 (c) 2/5 (d) -4 (e) -378.3 e Which is the second smallest value? (a) -12 (b) -2 (c) -4/3 (d) 27/2 (e) 0.2 b Which is the fifth smallest value? (a) -0.3 (b) -0.094 (c) -7 (d) 12 (e) 2 d What is the smallest value in 1/4, -565, -2/7, 0.2, -2/967, -3/2? -565 What is the smallest value in -1/4, 7/134, -2? -2 What is the third biggest value in 5/6, -0.03, 13058, -3? -0.03 What is the fourth biggest value in 1/2, -1/2, 233, -3/5? -3/5 Which is the fourth biggest value? (a) -0.21 (b) -2/3 (c) 1388 (d) 4/5 b Which is the fifth smallest value? (a) -1 (b) -40 (c) -2/11 (d) -1/5 (e) 0 (f) -102 c Which is the third biggest value? (a) 10/11 (b) 0 (c) 4/9 (d) -1 b What is the third smallest value in 0.5, 7, -0.043501? 7 What is the third smallest value in 0.12, 1/68, 2, -0.2? 0.12 What is the second smallest value in -23, -1336, -1/3? -23 What is the fourth biggest value in 176, -4, -0.5, -2/3, 4? -2/3 Which is the second smallest value? (a) -1/13 (b) -49/29 (c) -0.1 (d) -2/5 d Which is the third biggest value? (a) -1/51 (b) -3/2 (c) -3 (d) -2/9 (e) 1.829 d Which is the smallest value? (a) -5 (b) 5 (c) 9926 (d) 3/11 a Which is the third smallest value? (a) 0 (b) 1/9 (c) -2/7 (d) 47 (e) 5/3 (f) 8/51 b Which is the third biggest value? (a) 247/6 (b) 5 (c) 10/9 (d) -1/2 c What is the third smallest value in -2/7, -4, 62/7, -2/13? -2/13 What is the biggest value in 0, -2/9, 108? 108 Which is the third biggest value? (a) 2/37 (b) -2/29 (c) -30 c What is the biggest value in 0, -4/5, 370, -2? 370 What is the fourth biggest value in 2/335, 0.2, 1.3, 0.03? 2/335 Which is the sixth smallest value? (a) 5 (b) -4.9 (c) -22 (d) 0.2 (e) -0.9 (f) -1/9 a Which is the smallest value? (a) 0.5 (b) 123/5 (c) 2/13 (d) 5 (e) 5/2 c Which is the second smallest value? (a) 0 (b) 4.94 (c) 0.1 (d) -300 a Which is the smallest value? (a) 11/545 (b) 1 (c) 2/5 (d) 3 a What is the biggest value in 0, -0.5, -1, 1, -35885? 1 What is the second biggest value in 2, 0.2, -0.8, -0.15, 129? 2 What is the smallest value in -0.3, 12, 2585, 1? -0.3 Which is the third biggest value? (a) -27 (b) -3 (c) 1.2 (d) -2 b Which is the second biggest value? (a) 5 (b) 17099 (c) -1 a Which is the fifth biggest value? (a) -1 (b) -0.2 (c) -4 (d) -1/21 (e) 4 (f) -0.0127 a What is the third biggest value in -6, -5, -5/4, 0.9, 62? -5/4 What is the third smallest value in 4, 0.4, -4, 10, 0.66, -3? 0.4 What is the biggest value in 53, -1359, 4? 53 Which is the smallest value? (a) -5 (b) -46 (c) 0.3 (d) 3 (e) 2 b Which is the fourth smallest value? (a) -3 (b) 0.02 (c) 0 (d) -11 (e) 50 b What is the third biggest value in 2/3, 10, 0, 234? 2/3 What is the second biggest value in -27, -3, -1155? -27 Which is the second smallest value? (a) -0.1 (b) 26 (c) -1/2 (d) 2054 a What is the second smallest value in -2/15, 2/3, -0.06, 0.737? -0.06 Which is the fifth biggest value? (a) -247 (b) -4/5 (c) 0.03 (d) 4 (e) -3/5 a Which is the third biggest value? (a) -0.1 (b) -2 (c) 0 (d) 5 (e) 0.2745 c Which is the smallest value? (a) 3/17 (b) 25 (c) 17/41 a What is the fifth smallest value in 1, -0.5, 20, -7/2, -2/7? 20 Which is the smallest value? (a) -0.7 (b) -1.9 (c) 761 b What is the second smallest value in -14, 0.53, -58, 0.06? -14 What is the third smallest value in -1936, -1/17, 0.3? 0.3 What is the fourth biggest value in -8, 67, 1/7, 17? -8 What is the smallest value in 2, -11, 48778? -11 What is the biggest value in -1/6, -2/7, 0.6, -1/487? 0.6 What is the second biggest value in 2, 1/4, 5, -64/5, -0.2? 2 Which is the fourth smallest value? (a) 44 (b) -37 (c) -0.3 (d) 2 a Which is the second biggest value? (a) 17 (b) 12.7 (c) -1/4 b What is the second smallest value in 2/5, -1.1, -0.5, 39, 1? -0.5 What is the sixth smallest value in 2, -2/21, 3/7, -0.5, -0.359, -11? 2 What is the smallest value in -13, 565, 3, 0.4, 12/5, -1? -13 What is the third biggest value in -0.3, -1/10, -1, -83/2, -0.047? -0.3 What is the biggest value in 0.0186, 2/3, 5/2, -42, 1/5, -0.2? 5/2 What is the biggest value in 1, 0.45, -212? 1 Which is the third biggest value? (a) 0 (b) -746 (c) 16 b What is the second biggest value in 0, -7/2, -0.3, -1, -0.5, -5.5? -0.3 What is the second smallest value in 1/7, 3, 2/13, -0.01915? 1/7 What is the biggest value in 1, 0.48461, 4? 4 What is the fifth biggest value in 2/17, -277, 15, -0.4, -2, -3? -3 What is the biggest value in 11, -644, 1/5? 11 Which is the smallest value? (a) -168/11 (b) 55 (c) 1/4 (d) 0.01 a Which is the third biggest value? (a) 0.3 (b) 23 (c) 2 (d) -147 a What is the fifth biggest value in -0.83, 10, -1/5, -0.1, 0, 5? -1/5 Which is the biggest value? (a) 2/1549 (b) -5 (c) -125 (d) -0.4 a What is the second biggest value in -0.3, 5, -3, 0.6, -3/2, -11? 0.6 What is the second smallest value in -4059, -1/37, -1/3? -1/3 What is the second smallest value in 0.2, 1/8, -2254, -0.4? -0.4 What is the fourth biggest value in 2, -42, 7/33, 0, -5? -5 Which is the second smallest value? (a) 3/1630 (b) -2/7 (c) 5 a What is the third biggest value in 0.6, 5, 0.1, -1.75, 4/3? 0.6 What is the fifth biggest value in -0.4, 3/5, 5, -4/3, 27, -10/9? -10/9 What is the smallest value in 1/11, -4709, 4, -3/5? -4709 Which is the fourth smallest value? (a) 15 (b) -8 (c) -2 (d) 7 (e) 0.2 d What is the biggest value in 0.04956, -12, 3, 0, 1/8? 3 What is the sixth smallest value in 0.4, 2/14499, -2, 1/4, -0.1, -5? 0.4 What is the second smalles	{ "pile_set_name": "DM Mathematics" }
186? 171 Calculate the remainder when 159697 is divided by 22. 21 Calculate the remainder when 2221 is divided by 390. 271 Calculate the remainder when 1222 is divided by 60. 22 Calculate the remainder when 28259 is divided by 1177. 11 Calculate the remainder when 59074 is divided by 14766. 10 Calculate the remainder when 1262419 is divided by 470. 469 Calculate the remainder when 7063 is divided by 1409. 18 Calculate the remainder when 73378 is divided by 15. 13 Calculate the remainder when 541399 is divided by 609. 607 What is the remainder when 272 is divided by 30? 2 What is the remainder when 3197 is divided by 67? 48 What is the remainder when 21479 is divided by 2526? 1271 Calculate the remainder when 382484 is divided by 191224. 36 Calculate the remainder when 6247 is divided by 1233. 82 What is the remainder when 510492 is divided by 40? 12 Calculate the remainder when 723 is divided by 176. 19 Calculate the remainder when 762 is divided by 444. 318 What is the remainder when 5475 is divided by 1819? 18 Calculate the remainder when 1413 is divided by 351. 9 What is the remainder when 3641 is divided by 48? 41 What is the remainder when 4361 is divided by 104? 97 What is the remainder when 93386 is divided by 247? 20 What is the remainder when 115908 is divided by 28971? 24 What is the remainder when 26978 is divided by 284? 282 Calculate the remainder when 221352 is divided by 61. 44 Calculate the remainder when 24492 is divided by 1959. 984 Calculate the remainder when 13641 is divided by 25. 16 Calculate the remainder when 64173 is divided by 21. 18 What is the remainder when 32219 is divided by 201? 59 Calculate the remainder when 52092 is divided by 23. 20 Calculate the remainder when 28009 is divided by 9330. 19 What is the remainder when 63396 is divided by 45? 36 What is the remainder when 47973 is divided by 2517? 150 What is the remainder when 7997 is divided by 725? 22 Calculate the remainder when 3280 is divided by 494. 316 What is the remainder when 983 is divided by 934? 49 What is the remainder when 5600420 is divided by 58? 56 Calculate the remainder when 69449 is divided by 25. 24 Calculate the remainder when 46663 is divided by 57. 37 Calculate the remainder when 16043 is divided by 255. 233 What is the remainder when 157932 is divided by 39480? 12 Calculate the remainder when 181533 is divided by 390. 183 What is the remainder when 795 is divided by 405? 390 Calculate the remainder when 59174 is divided by 749. 3 Calculate the remainder when 787854 is divided by 2251. 4 What is the remainder when 124421 is divided by 2393? 2378 Calculate the remainder when 4167 is divided by 2073. 21 Calculate the remainder when 9906 is divided by 107. 62 What is the remainder when 9982 is divided by 251? 193 What is the remainder when 17954 is divided by 881? 334 Calculate the remainder when 494508 is divided by 23548. 0 What is the remainder when 1141485 is divided by 46? 41 Calculate the remainder when 331107 is divided by 17426. 13 What is the remainder when 2629 is divided by 382? 337 Calculate the remainder when 207050 is divided by 11. 8 What is the remainder when 13507 is divided by 6753? 1 What is the remainder when 131884 is divided by 255? 49 What is the remainder when 1520 is divided by 1074? 446 Calculate the remainder when 1553105 is divided by 9300. 5 Calculate the remainder when 385 is divided by 95. 5 What is the remainder when 2805 is divided by 572? 517 Calculate the remainder when 114438 is divided by 1638. 1416 What is the remainder when 67546 is divided by 92? 18 Calculate the remainder when 1523 is divided by 215. 18 What is the remainder when 8271 is divided by 192? 15 Calculate the remainder when 10614 is divided by 5307. 0 Calculate the remainder when 1599 is divided by 50. 49 Calculate the remainder when 8629 is divided by 1. 0 What is the remainder when 2942 is divided by 954? 80 What is the remainder when 10698 is divided by 790? 428 Calculate the remainder when 162331 is divided by 16233. 1 Calculate the remainder when 10161 is divided by 29. 11 Calculate the remainder when 18527 is divided by 113. 108 What is the remainder when 2280 is divided by 560? 40 Calculate the remainder when 5580 is divided by 2751. 78 Calculate the remainder when 41335 is divided by 2486. 1559 Calculate the remainder when 2119 is divided by 193. 189 What is the remainder when 633182 is divided by 376? 374 Calculate the remainder when 697876 is divided by 1007. 25 Calculate the remainder when 24661 is divided by 42. 7 Calculate the remainder when 1772 is divided by 103. 21 Calculate the remainder when 41974 is divided by 16. 6 Calculate the remainder when 2853 is divided by 2241. 612 Calculate the remainder when 19757 is divided by 521. 480 What is the remainder when 17281 is divided by 2849? 187 Calculate the remainder when 2205 is divided by 2104. 101 Calculate the remainder when 8962 is divided by 635. 72 What is the remainder when 2489 is divided by 115? 74 Calculate the remainder when 1990 is divided by 494. 14 Calculate the remainder when 45885 is divided by 11468. 13 What is the remainder when 139441 is divided by 142? 139 Calculate the remainder when 31592 is divided by 46. 36 Calculate the remainder when 458932 is divided by 705. 682 Calculate the remainder when 5811 is divided by 5810. 1 Calculate the remainder when 7213 is divided by 31. 21 Calculate the remainder when 35922 is divided by 3989. 21 Calculate the remainder when 853 is divided by 14. 13 What is the remainder when 398 is divided by 375? 23 What is the remainder when 1864 is divided by 55? 49 What is the remainder when 3011 is divided by 998? 17 What is the remainder when 204628 is divided by 570? 568 Calculate the remainder when 122580 is divided by 42. 24 Calculate the remainder when 190223 is divided by 510. 503 Calculate the remainder when 6742 is divided by 402. 310 What is the remainder when 8376 is divided by 927? 33 Calculate the remainder when 209998 is divided by 75. 73 Calculate the remainder when 2374 is divided by 33. 31 Calculate the remainder when 21150 is divided by 1410. 0 Calculate the remainder when 10277 is divided by 69. 65 Calculate the remainder when 116 is divided by 23. 1 Calculate the remainder when 4735 is divided by 165. 115 What is the remainder when 10781 is divided by 13? 4 Calculate the remainder when 1169903 is divided by 79. 71 What is the remainder when 3891 is divided by 389? 1 Calculate the remainder when 14947 is divided by 935. 922 What is the remainder when 38684 is divided by 87? 56 What is the remainder when 4022 is divided by 1852? 318 Calculate the remainder when 100352 is divided by 186. 98 What is the remainder when 1530 is divided by 344? 154 Calculate the remainder when 168289 is divided by 1850. 1789 Calculate the remainder when 7025 is divided by 1401. 20 What is the remainder when 23171 is divided by 11572? 27 Calculate the remainder when 735 is divided by 122. 3 What is the remainder when 595 is divided by 10? 5 What is the remainder when 4050 is divided by 3785? 265 What is the remainder when 69675 is divided by 711? 708 What is the remainder when 1539 is divided by 67? 65 Calculate the remainder when 4796 is divided by 651. 239 What is the remainder when 4183 is divided by 1998? 187 Calculate the remainder when 211677 is divided by 247. 245 Calculate the remainder when 29093 is divided by 23. 21 What is the remainder when 369963 is divided by 591? 588 Calculate the remainder when 430246 is divided by 312. 310 What is the remainder when 48619 is divided by 125? 119 Calculate the remainder when 11681 is divided by 1293. 44 Calculate the remainder when 2929415 is divided by 1128. 1127 What is the remainder when 8455 is divided by 2444? 1123 What is the remainder when 3090 is divided by 1021? 27 What is the remainder when 16154 is divided by 28? 26 What is the remainder when 1759 is divided by 439? 3 What is the remainder when 241226 is divided by 15? 11 What is the remainder when 630884 is divided by 776? 772 Calculate the remainder when 197577 is divided by 6. 3 What is the remainder when 575098 is divided by 405? 403 Calculate the remainder when 3724224 is divided by 38. 34 Calculate the remainder w	{ "pile_set_name": "DM Mathematics" }
m: 2, q: 4, x: 5, w: 4}. What is prob of picking 2 q and 1 w? 8/323 What is prob of picking 1 y, 1 p, and 1 b when three letters picked without replacement from {p: 3, v: 1, y: 1, s: 1, b: 1}? 3/35 Two letters picked without replacement from {c: 1, m: 3, e: 2, k: 1}. Give prob of picking 1 e and 1 c. 2/21 What is prob of picking 1 u, 1 m, 1 e, and 1 t when four letters picked without replacement from {t: 2, m: 1, k: 1, u: 1, e: 2}? 4/35 Calculate prob of picking 3 t when three letters picked without replacement from vtmmmmtmttmmmtmv. 1/56 Three letters picked without replacement from {t: 3}. What is prob of picking 3 t? 1 What is prob of picking 2 n and 1 l when three letters picked without replacement from {l: 2, n: 7}? 1/2 Calculate prob of picking 2 f when two letters picked without replacement from {f: 4, a: 1, q: 2}. 2/7 Two letters picked without replacement from umtutututpkuutm. Give prob of picking 2 u. 1/7 What is prob of picking 1 h and 2 d when three letters picked without replacement from {h: 5, d: 5}? 5/12 Three letters picked without replacement from tcactaoctcccoqs. What is prob of picking 2 a and 1 t? 3/455 Three letters picked without replacement from kkkmkkkkkmkkkm. Give prob of picking 3 k. 165/364 Two letters picked without replacement from pmnckcmcc. What is prob of picking 1 n and 1 c? 1/9 Four letters picked without replacement from {z: 6, c: 3, a: 8}. What is prob of picking 1 a, 2 c, and 1 z? 36/595 Calculate prob of picking 1 e and 2 x when three letters picked without replacement from {a: 3, x: 2, e: 5}. 1/24 Three letters picked without replacement from {m: 2, r: 2, y: 2, s: 3}. What is prob of picking 1 y, 1 s, and 1 r? 1/7 Two letters picked without replacement from bcckk. What is prob of picking 1 c and 1 k? 2/5 What is prob of picking 2 l and 1 e when three letters picked without replacement from {l: 15, e: 4}? 140/323 What is prob of picking 3 i and 1 l when four letters picked without replacement from {l: 7, k: 4, i: 4}? 4/195 Four letters picked without replacement from hrhrhhhhhhhhh. Give prob of picking 2 r and 2 h. 1/13 Three letters picked without replacement from vkclllkchlhcclkvvcvv. Give prob of picking 1 v and 2 h. 1/228 Calculate prob of picking 3 w and 1 b when four letters picked without replacement from {b: 2, w: 4}. 8/15 What is prob of picking 1 o and 1 s when two letters picked without replacement from owooooossodw? 7/33 Two letters picked without replacement from {a: 1, x: 3, z: 4, t: 3, y: 2, e: 2}. Give prob of picking 1 t and 1 x. 3/35 Two letters picked without replacement from {t: 4, h: 2, f: 1, q: 7, o: 2, e: 1}. What is prob of picking 1 q and 1 o? 7/68 What is prob of picking 4 f when four letters picked without replacement from {v: 1, f: 1, w: 1, k: 2, h: 2, m: 1}? 0 Calculate prob of picking 2 z and 1 q when three letters picked without replacement from {q: 2, z: 11}. 5/13 Two letters picked without replacement from {m: 4, w: 1, b: 3}. Give prob of picking 2 b. 3/28 Three letters picked without replacement from {y: 4, g: 1, w: 1, u: 1, t: 2, c: 6}. Give prob of picking 1 g and 2 y. 6/455 Calculate prob of picking 1 r, 1 s, and 1 i when three letters picked without replacement from {u: 4, r: 2, s: 3, i: 10}. 20/323 Calculate prob of picking 1 i, 1 d, and 2 w when four letters picked without replacement from piypwdwi. 1/35 What is prob of picking 1 f and 3 a when four letters picked without replacement from {a: 5, f: 8}? 16/143 Four letters picked without replacement from {u: 1, d: 1, w: 1, m: 3, f: 5, n: 2}. What is prob of picking 1 m, 1 d, 1 n, and 1 w? 6/715 What is prob of picking 1 y and 1 q when two letters picked without replacement from qyyyqyy? 10/21 What is prob of picking 1 g and 2 q when three letters picked without replacement from rgnqnqqganqqaqn? 6/91 What is prob of picking 1 w and 1 m when two letters picked without replacement from uwjcm? 1/10 What is prob of picking 3 t when three letters picked without replacement from xtttxxtxttxxxxxxxtx? 35/969 Two letters picked without replacement from {g: 2, r: 2}. Give prob of picking 2 g. 1/6 What is prob of picking 2 y when two letters picked without replacement from ssssyyssysssysys? 1/12 What is prob of picking 1 k and 1 g when two letters picked without replacement from kubgdkkbkkgdsbk? 4/35 Three letters picked without replacement from dbdh. What is prob of picking 1 d, 1 b, and 1 h? 1/2 Two letters picked without replacement from hqxhhhqhhqhc. Give prob of picking 2 q. 1/22 What is prob of picking 1 r and 1 l when two letters picked without replacement from ylrybblyblllybyylyly? 7/190 Four letters picked without replacement from {m: 6, c: 9, v: 2}. What is prob of picking 2 c and 2 m? 27/119 What is prob of picking 1 n, 1 k, and 2 s when four letters picked without replacement from {k: 5, e: 1, n: 1, p: 1, s: 3, x: 1}? 1/33 Calculate prob of picking 2 s when two letters picked without replacement from {s: 3, k: 12}. 1/35 What is prob of picking 1 m, 1 v, and 1 c when three letters picked without replacement from mecmgcyevmc? 3/55 Calculate prob of picking 2 a, 1 p, and 1 e when four letters picked without replacement from eaeeaeaapepsee. 12/143 Four letters picked without replacement from {e: 4, i: 2, r: 5}. What is prob of picking 2 r, 1 e, and 1 i? 8/33 Calculate prob of picking 2 f when two letters picked without replacement from {f: 6, i: 2, z: 1, a: 4}. 5/26 Calculate prob of picking 2 m and 2 s when four letters picked without replacement from {s: 7, w: 4, m: 6, c: 1}. 7/68 Two letters picked without replacement from {p: 4, r: 2, l: 2}. What is prob of picking 2 r? 1/28 Three letters picked without replacement from {j: 2, m: 1, y: 1, g: 1, e: 1, p: 1}. Give prob of picking 1 g, 1 y, and 1 e. 1/35 Calculate prob of picking 4 r when four letters picked without replacement from {r: 4, z: 2}. 1/15 Three letters picked without replacement from eeheeeheeeeheheeee. What is prob of picking 3 e? 91/204 Two letters picked without replacement from xdxijd. Give prob of picking 2 x. 1/15 Calculate prob of picking 1 g, 1 c, and 1 r when three letters picked without replacement from hrccchrhgchrrhrhcrr. 35/969 Three letters picked without replacement from {t: 19, v: 1}. What is prob of picking 3 v? 0 Three letters picked without replacement from {g: 4, c: 16}. What is prob of picking 1 g and 2 c? 8/19 Calculate prob of picking 2 g when two letters picked without replacement from {z: 3, g: 4}. 2/7 What is prob of picking 2 v, 1 a, and 1 h when four letters picked without replacement from {b: 4, h: 2, a: 2, f: 6, x: 1, v: 2}? 1/595 Calculate prob of picking 1 m and 1 l when two letters picked without replacement from dttmlm. 2/15 Two letters picked without replacement from {n: 2, g: 3, b: 1, w: 1, a: 1, y: 5}. Give prob of picking 1 b and 1 n. 1/39 Four letters picked without replacement from {b: 4, a: 10, k: 2}. What is prob of picking 3 a and 1 k? 12/91 Calculate prob of picking 1 g and 1 z when two letters picked without replacement from {z: 2, o: 1, i: 1, s: 1, g: 1, e: 2}. 1/14 What is prob of picking 2 v when two letters picked without replacement from {v: 2, m: 4}? 1/15 Two letters picked without replacement from asaaassaaaasaaaaaa. Give prob of picking 2 s. 2/51 Two letters picked without replacement from eiaaapp. What is prob of picking 2 p? 1/21 Calculate prob of picking 2 f and 1 a when three letters picked without replacement from ffhaaaafh. 1/7 Two letters picked without replacement from sdssddjsdd. Give prob of picking 1 s and 1 d. 4/9 Calculate prob of picking 2 l and 1 e when three letters picked without replacement from rrlllrreerrlrrer. 9/280 Two letters picked without replacement from iffvpqvqvvf. Give prob of picking 1 i and 1 v. 4/55 Two letters picked without replacement from {u: 1, t: 1, j: 1, z: 2}. What is prob of picking 1 u and 1 j? 1/10 Three letters picked without replacement from {y: 4, t: 2}. What is prob of picking 2 t and 1 y? 1/5 Calculate prob of picking 1 z and 2 f when three letters picked without replacement from {f: 4, g: 2, c: 1, z: 2}. 1/7 Calculate prob of picking 2 a and 2 h when four letters picked without replacement from {h: 2, a: 18}. 3/95 Two letters picked without replacement	{ "pile_set_name": "DM Mathematics" }
, 23473 List the prime factors of 48475776. 2, 3, 41, 3079 What are the prime factors of 1072283127? 3, 41, 8717749 List the prime factors of 1466777. 13, 17, 6637 List the prime factors of 312131829. 3, 19, 5475997 List the prime factors of 38086591. 47, 810353 What are the prime factors of 48720439? 683, 71333 List the prime factors of 306994942. 2, 17, 311, 29033 What are the prime factors of 905958307? 571, 1586617 List the prime factors of 1386630013. 19, 107, 191, 3571 List the prime factors of 1233079434. 2, 3, 3917, 17489 List the prime factors of 3993338243. 19, 2711, 77527 What are the prime factors of 634287254? 2, 317143627 List the prime factors of 1551529339. 41, 2777, 13627 List the prime factors of 103709673. 3, 17, 13291 List the prime factors of 46811092. 2, 11702773 List the prime factors of 42859955. 5, 83, 139, 743 List the prime factors of 501144810. 2, 3, 5, 389, 42943 List the prime factors of 808258441. 337, 1009, 2377 What are the prime factors of 1539921390? 2, 3, 5, 7, 7332959 What are the prime factors of 40762947? 3, 13587649 List the prime factors of 436652017. 137, 3187241 List the prime factors of 132082088. 2, 16510261 What are the prime factors of 30068039? 30068039 List the prime factors of 654419678. 2, 11, 1979, 15031 What are the prime factors of 11227283? 11227283 What are the prime factors of 31379562? 2, 3, 64567 List the prime factors of 2965590267. 3, 71, 691, 20149 List the prime factors of 169009577. 11, 67, 229321 What are the prime factors of 26109434? 2, 13, 1004209 List the prime factors of 177199067. 177199067 List the prime factors of 101263744. 2, 157, 5039 What are the prime factors of 104882945? 5, 17, 19, 101, 643 What are the prime factors of 1502443168? 2, 23, 2041363 List the prime factors of 348894223. 348894223 What are the prime factors of 1184434007? 1184434007 What are the prime factors of 76198200? 2, 3, 5, 13, 9769 What are the prime factors of 634552108? 2, 158638027 What are the prime factors of 1687912237? 11, 153446567 List the prime factors of 538808589. 3, 11, 5442511 List the prime factors of 1299491235. 3, 5, 7, 61, 22543 List the prime factors of 59762795. 5, 11952559 What are the prime factors of 7475358950? 2, 5, 4903, 30493 What are the prime factors of 875841255? 3, 5, 720857 List the prime factors of 2490205006. 2, 37, 1601, 21019 What are the prime factors of 1633022331? 3, 544340777 List the prime factors of 18353907. 3, 11, 13, 1097 What are the prime factors of 4415958796? 2, 19, 58104721 What are the prime factors of 138491671? 23, 261799 List the prime factors of 139384780. 2, 5, 2621, 2659 What are the prime factors of 2107311873? 3, 702437291 What are the prime factors of 952068901? 7, 17, 8000579 What are the prime factors of 567395763? 3, 11, 23, 747557 What are the prime factors of 3101528648? 2, 387691081 List the prime factors of 29296917. 3, 13, 19, 23, 191 List the prime factors of 1298089263. 3, 4219, 102559 What are the prime factors of 1489051350? 2, 3, 5, 337, 1091 List the prime factors of 551352778. 2, 275676389 What are the prime factors of 1616121? 3, 13, 19, 727 List the prime factors of 134517822. 2, 3, 22419637 List the prime factors of 74356919. 7, 13, 89, 9181 What are the prime factors of 3845904933? 3, 13, 98612947 What are the prime factors of 301769906? 2, 83, 1817891 List the prime factors of 37570191. 3, 2753, 4549 List the prime factors of 1707176442. 2, 3, 284529407 List the prime factors of 59018630. 2, 5, 11, 536533 List the prime factors of 1530749436. 2, 3, 127562453 What are the prime factors of 120840062? 2, 7, 43, 200731 List the prime factors of 4314475610. 2, 5, 97, 4447913 List the prime factors of 358162735. 5, 7, 10233221 What are the prime factors of 991271711? 523, 1895357 List the prime factors of 322127909. 322127909 List the prime factors of 87930081. 3, 19, 23, 79, 283 List the prime factors of 4997128. 2, 67, 9323 List the prime factors of 2067080977. 13, 2281, 69709 List the prime factors of 283776187. 821, 345647 What are the prime factors of 280598244? 2, 3, 23383187 What are the prime factors of 38273919? 3, 17, 467, 1607 What are the prime factors of 127475348? 2, 7, 11, 13, 31, 79 What are the prime factors of 185981953? 185981953 List the prime factors of 2028541732. 2, 7, 313, 231463 List the prime factors of 56439187. 7, 307, 26263 What are the prime factors of 873223588? 2, 11213, 19469 What are the prime factors of 391667707? 29, 13505783 List the prime factors of 587302310. 2, 5, 7, 197, 42589 List the prime factors of 7655121. 3, 227, 1249 What are the prime factors of 199477797? 3, 66492599 What are the prime factors of 214053585? 3, 5, 2339, 6101 What are the prime factors of 2202676158? 2, 3, 73, 401, 12541 List the prime factors of 48647496. 2, 3, 71, 28549 List the prime factors of 312677762. 2, 156338881 List the prime factors of 168846922. 2, 2927, 28843 What are the prime factors of 2160149047? 7, 17, 18152513 List the prime factors of 353525009. 353525009 List the prime factors of 1244102174. 2, 7, 88864441 List the prime factors of 19676976. 2, 3, 11, 83, 449 What are the prime factors of 302935205? 5, 59, 1026899 List the prime factors of 1725061733. 3167, 544699 List the prime factors of 527932698. 2, 3, 87988783 List the prime factors of 4799879845. 5, 19, 599, 84349 What are the prime factors of 684005797? 3989, 171473 What are the prime factors of 464164029? 3, 7, 1847, 3989 List the prime factors of 2265600569. 449, 5045881 List the prime factors of 8125638761. 383, 21215767 What are the prime factors of 474047395? 5, 8111, 11689 What are the prime factors of 40793521? 163, 250267 List the prime factors of 463385478. 2, 3, 151, 511463 What are the prime factors of 2606472389? 449, 5805061 List the prime factors of 909239. 909239 What are the prime factors of 64489545? 3, 5, 1433101 What are the prime factors of 1437023180? 2, 5, 71851159 List the prime factors of 33374120. 2, 5, 13, 4937 What are the prime factors of 98472409? 7, 1249, 1609 What are the prime factors of 500304952? 2, 7, 8934017 List the prime factors of 286242820. 2, 5, 23, 349, 1783 List the prime factors of 61322704. 2, 29, 283, 467 List the prime factors of 422060161. 89, 233, 20353 List the prime factors of 4811049986. 2, 37, 619, 105031 List the prime factors of 111506990. 2, 5, 7, 23, 69259 What are the prime factors of 486647370? 2, 3, 5, 11, 379, 1297 What are the prime factors of 343431302? 2, 2269, 75679 What are the prime factors of 281350138? 2, 19, 71, 104281 List the prime factors of 93965885. 5, 13, 17, 85037 List the prime factors of 40028546. 2, 41, 488153 List the prime factors of 1984225848. 2, 3, 11, 73, 149, 691 What are the prime factors of 790383436? 2, 83, 2380673 List the prime factors of 302909590. 2, 5, 19, 1594261 What are the prime factors of 64257789? 3, 37, 47, 109, 113 What are the prime factors of 201886234? 2, 11, 9176647 What are the prime factors of 84861729? 3, 3143027 What are the prime factors of 929027553? 3, 19, 16298729 What are the prime factors of 351843535? 5, 23, 3059509 What are the prime factors of 172209204? 2, 3, 4783589 What are the prime factors of 5903116498? 2, 19, 59, 101, 131, 199 List the prime factors of 62622527. 11, 5692957 List the prime factors of 327391874. 2, 12197, 13421 What are the prime factors of 42435888? 2, 3, 11, 179, 449 List the prime factors of 20235331. 23, 879797 List the prime factors of 1583292919. 13, 10303, 11821 What are the prime factors of 97714615? 5, 19542923 List the prime factors of 80263111. 127, 631993 What are the prime factors of 370311221? 7, 17, 41, 71, 1069 List the prime factors of 28826715. 3, 5, 1921781 What are the prime factors of 930888610? 2, 5, 93088861 What are the prime factors of 119933051? 7, 3347, 5119 List the prime factors of 147644900. 2, 5, 13, 137, 829 What are the prime factors of 536317306? 2, 7, 2411, 15889 What are the prime factors of 76748712? 2, 3, 3197863 List the prime factors of 1582666. 2, 17, 46549 What are the prime factors of 11560329? 3, 11, 23, 5077 What are the prime factors of 4631039041? 4631039041 What are the prime factors of 32154427? 32154427 What are the prime factors of 29298	{ "pile_set_name": "DM Mathematics" }
275463 composite? False Is 5484165395 a composite number? True Is 788434235 composite? True Is 830228783 composite? True Is 15986237483 composite? False Is 98550471 a composite number? True Is 10379633057 prime? True Is 394007321 composite? False Is 2691083287 a composite number? False Is 9573467039 composite? False Is 379737479 a composite number? True Is 293299597 a prime number? True Is 3531668453 a composite number? True Is 22864443779 composite? True Is 106760915 composite? True Is 7210241413 composite? False Is 3211278467 a composite number? True Is 25457545843 a composite number? True Is 1597737565 prime? False Is 2025824793 a prime number? False Is 76958358143 a prime number? True Is 16665608753 a composite number? False Is 1015757503 a prime number? False Is 31270296503 composite? False Is 37467366659 a prime number? False Is 257887963 a composite number? False Is 1248249133 a composite number? True Is 23150964829 a prime number? True Is 110287928321 a composite number? False Is 22694193461 a prime number? True Is 15466387253 a prime number? True Is 14876522857 a composite number? True Is 3181030147 a prime number? True Is 10195902373 a composite number? True Is 1110801823 a prime number? True Is 6213890489 prime? True Is 740604923 composite? False Is 1458027643 a composite number? True Is 75838449719 prime? True Is 93643731173 a prime number? False Is 1832549793 a prime number? False Is 12502236443 a composite number? True Is 13530492061 a composite number? False Is 69852394151 prime? True Is 396681041 prime? False Is 857174743 prime? True Is 28418684837 prime? True Is 751485563 prime? False Is 1065604079 composite? False Is 523563361 a composite number? True Is 4507480777 composite? True Is 1708784899 a composite number? True Is 126881759 prime? True Is 376804380655 prime? False Is 24960413 composite? True Is 38384426643 composite? True Is 25983367033 prime? False Is 330728883461 a prime number? True Is 4187656141 composite? True Is 1011272029 prime? True Is 305452711 prime? True Is 243919201483 a prime number? True Is 2621792549 a composite number? False Is 21862795001 prime? True Is 4235245129 a composite number? True Is 3231990079 a composite number? True Is 2561114441 composite? False Is 99873965 prime? False Is 735284399 prime? True Is 30614099 a composite number? True Is 101902081 prime? False Is 316894321 composite? False Is 247319731 a composite number? False Is 21282386123 composite? False Is 2164883987 prime? False Is 3449163701 composite? False Is 34705125187 a prime number? True Is 1583112449 a prime number? False Is 5525916527 prime? True Is 4906996561 prime? True Is 11116655371 composite? False Is 930127021 prime? True Is 25363011815 prime? False Is 21185966129 a prime number? False Is 124870248949 prime? False Is 442377821 prime? False Is 725391691 a prime number? True Is 951507679 composite? True Is 815875283 a prime number? True Is 20916415937 prime? True Is 157941473 a composite number? False Is 5564847649 prime? True Is 42646805 a composite number? True Is 112256947 a composite number? True Is 14658019319 a composite number? True Is 4996783677 prime? False Is 124367474171 composite? False Is 9334484039 a composite number? False Is 4360858181 prime? False Is 3712268983 prime? False Is 261256001 a composite number? True Is 915884141 composite? True Is 390625832165 a prime number? False Is 137887374967 a prime number? True Is 77577077 a composite number? True Is 1470454823 a prime number? False Is 736359071 a prime number? False Is 2260834207 composite? False Is 72097596355 a composite number? True Is 79677989 a prime number? False Is 9840966347 a prime number? True Is 39575925283 a composite number? False Is 9247448479 a prime number? False Is 35073625777 prime? False Is 412016903 prime? True Is 3626722459 a composite number? True Is 1231891679 composite? True Is 316641739 prime? True Is 23069126503 a prime number? True Is 647888929 a prime number? False Is 36640616245 a prime number? False Is 2499899587 a composite number? False Is 39911381929 composite? False Is 8527867171 prime? True Is 22545548117 composite? False Is 294095093 composite? True Is 206918311 composite? True Is 20615841751 prime? True Is 15619276481 a prime number? True Is 1123216489 a composite number? False Is 147592217 a composite number? True Is 4183413919 composite? False Is 2039412863 a composite number? True Is 13281329 a composite number? False Is 7299854461 a prime number? True Is 446968279 a composite number? False Is 51756323111 a prime number? True Is 78645653693 a composite number? True Is 8735144267 a composite number? False Is 1076506043 prime? True Is 42517622677 a composite number? False Is 48227301811 a composite number? True Is 1208007001 a composite number? False Is 9517651111 composite? True Is 40554029291 a composite number? True Is 42893026601 a prime number? True Is 522710807 a composite number? True Is 7452418555 a prime number? False Is 2371580345 a prime number? False Is 154729987 a prime number? False Is 5857771111 prime? True Is 1531027903 a prime number? True Is 1825188739 composite? True Is 126240378347 a composite number? False Is 167513196791 a composite number? False Is 22288110391 a prime number? True Is 1385828819 a prime number? True Is 31053665159 a composite number? True Is 44690117 prime? False Is 574471217 a prime number? True Is 712860667 prime? True Is 2994586351 a composite number? False Is 870836753 composite? False Is 237253607 a prime number? True Is 833758223 prime? True Is 2833636849 a composite number? True Is 3203121961 composite? True Is 8445470143 a composite number? True Is 240676711 composite? True Is 1026763391 a prime number? True Is 96535559723 prime? True Is 473201063 prime? False Is 8984478227 a prime number? True Is 1485019187 composite? False Is 2033609183 a composite number? False Is 5571423661 a composite number? True Is 566813815373 a composite number? True Is 4765117627 a composite number? True Is 926123969 prime? True Is 519712967 prime? False Is 890793793 a prime number? False Is 40995449681 a composite number? False Is 145264751 prime? True Is 2489143385 prime? False Is 337450727 a composite number? False Is 13991914969 prime? False Is 1757673179 a composite number? True Is 1813773977 a prime number? False Is 114244052099 a composite number? False Is 75398204807 prime? True Is 54005267 a composite number? False Is 3008245679 prime? True Is 107464859143 a composite number? False Is 1837553215 a composite number? True Is 601215179 a composite number? False Is 941833213 composite? False Is 9580422251 composite? False Is 3666850559 prime? False Is 385468154 prime? False Is 3455846759 prime? False Is 33023167745 prime? False Is 104204395651 prime? True Is 70256418209 prime? True Is 1283751431 a composite number? True Is 8836082831 composite? False Is 2546767553 a composite number? True Is 4663910839 a prime number? False Is 753305561 prime? True Is 8629442543 prime? True Is 1732623073 a prime number? False Is 7461750697 a prime number? False Is 280797983 a prime number? False Is 322753055647 prime? False Is 352356842 prime? False Is 1758702251 a composite number? False Is 25377198259 a composite number? True Is 5750860409 a composite number? True Is 23578635011 prime? True Is 359353387 composite? False Is 3414978919 a composite number? True Is 54430037474 composite? True Is 1278212073 a prime number? False Is 615279757 prime? False Is 1799607163 a prime number? True Is 283139192629 a composite number? False Is 5621698297 composite? False Is 679085981 composite? True Is 275010319 a composite number? False Is 3512178127 composite? True Is 2406715939 composite? False Is 536080681 composite? False Is 209985177397 prime? True Is 65194273 composite? True Is 4619698619 composite? False Is 388543997 a composite number? True Is 75101049403 composite? False Is 20404129 prime? False Is 6689668081 prime? False Is 67127216129 a composite number? False Is 879563579 composite? True Is 13759349371 prime? True Is 71111269 a prime number? True Is 30602608573 prime? False Is 41759329823 a composite number? False Is 1129628111 a prime number? True Is 8201554657 a composite number? False Is 3252196151	{ "pile_set_name": "DM Mathematics" }
sqrt(100)-1)))/(sqrt(9) - sqrt(63)/(sqrt(7)5) - sqrt(1296)4). sqrt(5)/708 Simplify ((3sqrt(76)-3 + 2sqrt(76)2)/((sqrt(484) - 4-3sqrt(484))-3))*2. 475/184041 Simplify -6-1(sqrt(500)-4 + 5 + sqrt(500)1-2) + -5. -360sqrt(5) + 25 Simplify (-2 + -6-2sqrt(3) + -2 + (sqrt(60)/sqrt(4)4)/(-2sqrt(180) + sqrt(180)) + 4)2. 1156/3 Simplify (5 + -5 + sqrt(800) + 1)2 + (sqrt(48)1)/(-2sqrt(54) + sqrt(6)) + 5. 198sqrt(2)/5 + 806 Simplify (-3sqrt(825) - sqrt(99)/(sqrt(75) - sqrt(3)))/(-3-4(sqrt(891) - sqrt(891)2)). 61sqrt(3)/432 Simplify -4 + -1((3sqrt(120)/sqrt(3))/sqrt(8))2 + (4sqrt(720) - (sqrt(605) - 2sqrt(605))). -49 + 59sqrt(5) Simplify -1 + 0 + ((sqrt(136) + ((sqrt(136)2 - sqrt(136)) + sqrt(136))-6)1)/((sqrt(24)3)/sqrt(3)-6). -1 + 11sqrt(17)/18 Simplify 2 + (sqrt(612) - (sqrt(612) + 2 + 0 + sqrt(612))) - ((sqrt(17)-2 - sqrt(17))-1 + -4 + -1 + sqrt(17) + -3). -10sqrt(17) + 8 Simplify ((sqrt(7488) - (6sqrt(7488)2 + sqrt(7488) - sqrt(7488)) - sqrt(7488))-1)/(-6(sqrt(16)1 + sqrt(4)-13)). 24sqrt(13) Simplify (-6(3(sqrt(20)/sqrt(2)3)/(sqrt(6)/(2sqrt(3)))1)*2 + 5)5. -48575 Simplify (4(5sqrt(27)-2 + sqrt(243)2))/(6(62sqrt(576) + sqrt(576))). -sqrt(3)/39 Simplify 5(-5 + ((3 + 5(sqrt(243)3-4 - sqrt(243)))-3)*2). -157950sqrt(3) + 46200755 Simplify (sqrt(550)/((2sqrt(55))/sqrt(5)) + (sqrt(50) - (sqrt(50) + sqrt(800) + sqrt(50) + 5) - (sqrt(7200) + -1sqrt(7200))))*2. 225sqrt(2) + 2075/2 Simplify ((5(sqrt(17) + 2 + sqrt(17) + sqrt(17))-5-1 - (-5 + sqrt(102)/sqrt(6) + sqrt(833) + -3)) + 2)2. 8040sqrt(17) + 79913 Simplify (sqrt(140)/(sqrt(448) + sqrt(7))-3)/((sqrt(400) - (sqrt(400) + sqrt(400) + (-4sqrt(400) - sqrt(400)) + sqrt(400)))/sqrt(4))-3. sqrt(5)/15 Simplify (2(6(sqrt(126) - ((2sqrt(126) - sqrt(126)) + sqrt(126))))/sqrt(6))/(sqrt(132)/(sqrt(66)/(sqrt(12)/sqrt(2)))). -6sqrt(7) Simplify -2 + (-1sqrt(25)-1)/((sqrt(5) + sqrt(20)/sqrt(4))4) + (-5 + (-4sqrt(5)5)*2)3. sqrt(5)/8 + 5983 Simplify ((-4sqrt(162))/(sqrt(2) + (sqrt(14) - sqrt(224))/sqrt(7)))/(sqrt(36)/(sqrt(12)-1) - sqrt(36)/sqrt(48)). -4sqrt(3) Simplify ((3 + sqrt(3888)2 - sqrt(3888)12) + sqrt(48)4 + 1sqrt(3) + 1 + 4 + 3)*2. 374sqrt(3) + 988 Simplify (5 + 5 + -3-32sqrt(99)5 + 4 + -4)*2. 5400sqrt(11) + 802000 Simplify ((5(sqrt(400) - (sqrt(400) - (sqrt(400)21 + sqrt(400))))/sqrt(8))/(sqrt(250) + (sqrt(250)4 + sqrt(250) - sqrt(250)) - -1sqrt(640)))2. 125/121 Simplify 2 + (-5((-3sqrt(171)-1 - sqrt(171) - sqrt(171)) + -1(sqrt(171) + 1))-1)*2 + -5. 22 Simplify (sqrt(147)-2 + 1 + sqrt(147) + 2sqrt(147) + 1 + (5sqrt(120))/(1sqrt(160)))2 + 1. 38sqrt(3) + 1103/4 Simplify 1 + 2((sqrt(425) - 5(-1 + sqrt(425)))*2 + 2 + ((sqrt(425)1 + sqrt(425) + sqrt(425) + -2)*2 - (-1sqrt(425) + -1)))5. -2550sqrt(17) + 106571 Simplify (sqrt(110)/((sqrt(22) - sqrt(1782))/sqrt(11)))/(((-4-3sqrt(121) - sqrt(121)) + sqrt(121) + sqrt(121))/sqrt(11)). -sqrt(5)/104 Simplify (sqrt(20)/(sqrt(45)/(sqrt(54)/sqrt(6))))/(-4(sqrt(2) - sqrt(50)) + sqrt(2) - -4sqrt(2)-2). sqrt(2)/9 Simplify -3 + (-2sqrt(152)3)/(sqrt(800)3) + -1 + -4 + 3. -5 - sqrt(19)/5 Simplify -4(-4 + (-1sqrt(117)-1 - sqrt(117))/sqrt(9) - (-1-6(2 + sqrt(637)))2)2. 8064sqrt(13) + 184640 Simplify ((-3sqrt(85)4)/(sqrt(5) + -5sqrt(180)) - (1 + -4(5(sqrt(17) + 0) - sqrt(17)) + 0))*2. -952sqrt(17)/29 + 3852633/841 Simplify -3(sqrt(245) + 5-3sqrt(245) + ((sqrt(245) + 0)2 - sqrt(245)))*2 + 4 + 3. -124208 Simplify (6(sqrt(104) - sqrt(104)3)3)/(sqrt(72)-3 - -2sqrt(200))4. -144sqrt(13) Simplify (-2(-4 + -6-3sqrt(539)-2-5))22. -80640sqrt(11) + 139708928 Simplify (1 + (3 + (0 + sqrt(3888))-2)*2-1)1. -15560 + 432sqrt(3) Simplify 3(sqrt(931)2 + 3 + (-5 + sqrt(931) + 1)2 - (-2 + (sqrt(931) - (sqrt(931) + -1 + sqrt(931))2))3). -441sqrt(19) + 36393 Simplify (-2 + (sqrt(224)/sqrt(32) - sqrt(224)/(sqrt(56)/sqrt(7))))-5. 10 + 5sqrt(7) Simplify (-3sqrt(7056)-3 - (6sqrt(7056)2 + sqrt(7056)))/(sqrt(49)/sqrt(28) + sqrt(7) + sqrt(63)2). -32sqrt(7)/5 Simplify (-5(sqrt(6) + sqrt(96)) - (2sqrt(726) + sqrt(6)))/(sqrt(242) - (sqrt(242) + 5(sqrt(242)1 - sqrt(242))) - sqrt(242)). 48sqrt(3)/11 Simplify 4(sqrt(63)-2 - -1(-3sqrt(7) + sqrt(7)) - sqrt(35)/((2sqrt(15))/sqrt(3))-2) + 1. -28sqrt(7) + 1 Simplify 1(5((sqrt(304)2 + -2 - sqrt(304) - (sqrt(304)1 + 1)) + 3 + (2 + sqrt(304))-5))2. 10000sqrt(19) + 192500 Simplify sqrt(36)/(sqrt(240)/sqrt(5))4 - -6(((sqrt(12) + sqrt(3) + -3)*2 - (-1 + sqrt(432) - sqrt(3))) + -2). -172sqrt(3) + 210 Simplify (((sqrt(119) - -2(sqrt(119)2 - sqrt(119)) - sqrt(119))4-6)/((1sqrt(63)-2 - sqrt(63))/(1sqrt(900))))2. 435200 Simplify ((2sqrt(1960) - -4sqrt(480)/sqrt(12))/(((2sqrt(96))/sqrt(3))/(6(sqrt(4) + sqrt(8)/sqrt(2)) + sqrt(4) + sqrt(4))))2. 79380 Simplify (sqrt(240)-5)/(sqrt(192)4) + -3. -3 - 5sqrt(5)/8 Simplify -4 + 5 + ((-1 + sqrt(192))*2 - sqrt(48)-26 - (sqrt(576)/(sqrt(588)3))*2). 32sqrt(3) + 28502/147 Simplify ((sqrt(240)/(-2sqrt(8)))/(sqrt(9)/sqrt(3)1))/((-5sqrt(4)/sqrt(2) + 6(sqrt(6)/sqrt(3) - sqrt(2)))5). sqrt(5)/50 Simplify sqrt(325) + 1 + 4 + sqrt(52)/sqrt(4) + sqrt(13) + (-1(-2 + 1sqrt(52)))2. -sqrt(13) + 61 Simplify (1sqrt(684)2)2 - (-1sqrt(684)-5)2 - (-4 + (sqrt(684) - (sqrt(684)-1)*2-2 - (sqrt(684) - -6(1 + sqrt(684)))2)). 498sqrt(19) + 17824 Simplify (4sqrt(5103)3-1 + 3((sqrt(5103) + 2 + sqrt(5103) + sqrt(5103) - sqrt(5103)) + 1))*2-1. -183789 + 2916sqrt(7) Simplify (-1(-21sqrt(2673) + sqrt(2673)))/((sqrt(216)-1)/(sqrt(64)/(sqrt(8) - sqrt(8)-2))). -sqrt(11) Simplify (3((sqrt(208)2 + sqrt(208) - sqrt(208)) + sqrt(208)) - (2 + (sqrt(208) - 1sqrt(208))) - (5 + 5 + 6(sqrt(208) + -2)))*2. 1872 Simplify (sqrt(68)4-5-2 + -3 + -1(0 + sqrt(68)))2 + 3. -468sqrt(17) + 103440 Simplify (4 + (1 + -5 + sqrt(300) + 1 + sqrt(18)/sqrt(54))*2)2. -124sqrt(3) + 2000/3 Simplify (1-41sqrt(153)6)/(-1sqrt(1296)34). sqrt(17)/6 Simplify -2((sqrt(2299)-2)*2-3 + -2 - 1(sqrt(2299) + sqrt(2299) + (sqrt(2299) - (sqrt(2299) + (sqrt(2299) + 1sqrt(2299))2 + sqrt(2299))))2)-3. -289686 Simplify (-42sqrt(256))/(((sqrt(128) - -1(sqrt(128)2 + sqrt(128)) - sqrt(128) - sqrt(128)) + sqrt(128) + sqrt(128) + sqrt(128) - sqrt(128))-4). sqrt(2)/2 Simplify -3 + -3(3 + 2 + -2(sqrt(1331) + 2) + -5). 9 + 66sqrt(11) Simplify (4 + sqrt(832)2-3 + 5 + 2sqrt(832) + -4 + sqrt(832)-2 + 5)*2. -960sqrt(13) + 30052 Simplify 2(-6(sqrt(833) - ((sqrt(833) - (sqrt(833) + 0) - sqrt(833)) + sqrt(833))*2 - sqrt(833)) - sqrt(833) - ((sqrt(833) + sqrt(833)1)*2 + -4))-3 + -1. 42sqrt(17) + 19967 Simplify (((sqrt(18) + (sqrt(72) - -2sqrt(72)))/(-6sqrt(6)-2 - sqrt(6)) - (5 + sqrt(18)/(sqrt(12)/sqrt(2)) + 1))2)2. 192sqrt(3)/11 + 17616/121 Simplify ((sqrt(180) + (-1 + sqrt(180) - sqrt(180)) + 0 + -4(sqrt(180) - sqrt(180)-1))5 - -5(sqrt(180)1 + 0 + (1 + sqrt(180))-3))*2. 10800sqrt(5) + 364900 Simplify (sqrt(450)/sqrt(5))/(6sqrt(2)2) + -4(-4 + sqrt(320)3)*2. -11584 + 3073sqrt(5)/4 Simplify ((sqrt(450)/sqrt(40))/(sqrt(3) - (sqrt(108)-1 - sqrt(108))))/(((-2sqrt(240))/sqrt(8))/sqrt(6)3). -sqrt(3)/156 Simplify (5((sqrt(1377) - (sqrt(1377)2 + -2)) + (sqrt(1377) - (1 + sqrt(1377) + 1)) + sqrt(1377) + 1 + 0)5)*2. 625 Simplify 5 + (5 + (3sqrt(343) + 1)*2 - -2((3 + sqrt(343))4 - sqrt(343) - sqrt(343))). 70sqrt(7) + 3122 Simplify -1-1(-2 + sqrt(68)/sqrt(4))*26 + ((sqrt(357) + sqrt(357)-2 - sqrt(357))/sqrt(7))/(sqrt(9)/(sqrt(6)/sqrt(2))). -26sqrt(17) + 126 Simplify 2 + (-5((5sqrt(187)-1 - -5((-1sqrt(187) + sqrt(187) - sqrt(187)) + sqrt(187)))/(sqrt(88)/((sqrt(40)2)/sqrt(5))) + 1))*2. -500sqrt(17) + 42527 Simplify -5((-5sqrt(1100)-1 - sqrt(1100)) + -2)2 - ((sqrt(1100) - (-2sqrt(1100))*2) + sqrt(1100) + 5 - (sqrt(110)/(1sqrt(10)))*24). -83581 + 780sqrt(11) Simplify -5 + -2sqrt(832) - (-5(sqrt(143) - (sqrt(143)1 - sqrt(143))))/(sqrt(110)/(sqrt(20)/sqrt(2))). -11sqrt(13) - 5 Simplify (-3(0 + 1 + -62sqrt(98)-1-31))2. -4536sqrt(2) + 1143081 Simplify (-4(1(-3 + (4sqrt(3)5 - (3 + (sqrt(27) + sqrt(3) - sqrt(3))))) + 1))*2-2. -28544 + 5440*sqrt(3	{ "pile_set_name": "DM Mathematics" }
-57/20 + 13/4. Let t be (-1)/(-2((-28)/16 + 2)). Let 0 + 0s*t + 0s - os4 + 2/5s*3 = 0. What is s? 0, 1 Let n = 35533/1822 - 2/911. Find t, given that -nt*3 - 6t*4 - 3/2 - 21/2t - 45/2t2 = 0. -1, -1/4 Let t(q) = -6q*5 - 9q*4 + 12q*3 - 6q + 9. Let g(i) = -3i5 - 5i*4 + 6i*3 - 3i + 5. Let l(x) = 9g(x) - 5t(x). Factor l(w). 3w(w - 1)*2(w + 1)*2 Suppose -1 = -a - 4, 3k = -5a - 3. Suppose -n + k = 1. Solve 5p4 - p4 + 2p4 - 2p*5 + 2p*2 - 6p*n = 0 for p. 0, 1 Let d(v) be the first derivative of 3v*4/16 - 7v*3/4 + 6v*2 - 9v - 32. Factor d(u). 3(u - 3)(u - 2)*2/4 Let i(z) be the first derivative of 0z - 3/5z2 - 2/15z3 + 10. Solve i(n) = 0. -3, 0 Let f(v) be the second derivative of v10/105840 - v9/52920 - v8/23520 + v7/8820 + v4/12 - 2v. Let n(c) be the third derivative of f(c). Factor n(d). 2d*2(d - 1)*2(d + 1)/7 Let j(r) be the second derivative of r6/36 + r5/8 + 5r4/36 - 29r. Determine a, given that j(a) = 0. -2, -1, 0 Let d(h) be the first derivative of -h*6/15 - 3h5/10 - h4/2 - h3/3 + h - 3. Let r(v) be the first derivative of d(v). Find n such that r(n) = 0. -1, 0 Let i(c) be the third derivative of -c5/30 + c4/18 - c3/27 - 13c2. Factor i(w). -2(3w - 1)2/9 Let a(b) = 5b*3 + 3b*2 - 2b + 7. Let o(k) = -k3 - k2 - 1. Let h(z) = 2a(z) + 14o(z). Factor h(t). -4t(t + 1)*2 Suppose -4k = -5b + 12, 0 = -0k - k - 3. Let a = 23 - 68/3. Factor bx - 1/3 + ax*2. (x - 1)(x + 1)/3 Let j be (-1)/(-4) - (-47)/4. Suppose 0 = 5i - 2i - h - j, -i + 5h + 18 = 0. Find g, given that g + g2 - 4g2 + 3 - gi + 4g2 - 4 = 0. -1, 1 Let t be 0/((-3)/1 - -5). Let b(q) = q + 5. Let r be b(t). Suppose -2w2 - wr + 0w5 - w + 2w*5 + 2w*4 = 0. What is w? -1, 0, 1 Let v be -22((-5)/2 - -2). Factor -161/4s2 + vs + 49s3 - 1. (4s - 1)(7s - 2)2/4 Let k(p) be the third derivative of p8/13440 + p7/2520 - p4/12 + 5p2. Let y(j) be the second derivative of k(j). Factor y(q). q2(q + 2)/2 Factor 7t3 + t3 - 10t*2 - 3t*3 + 5t. 5t(t - 1)*2 Let m = 15 - 11. Factor -6j*4 - mj + 4j5 - 5j*2 + 3j + 5j4 - 3j*3 + 6j*4. j(j - 1)(j + 1)2(4j + 1) Suppose 2 = 2m - m. Suppose a + m = 2a. Factor 3y*2 - 2y2 + ya. 2y2 Let t = 41 - 41. Let 2/5z*2 + t - 6/5z*3 + 4/5z = 0. Calculate z. -2/3, 0, 1 Let a(u) be the third derivative of u*7/10 - 2u*6/5 + 11u5/20 - u4/4 + 4u2. Determine p so that a(p) = 0. 0, 2/7, 1 Let s(b) be the third derivative of b5/12 - 5b*4/24 - 5b*3 - 8b*2. Factor s(c). 5(c - 3)(c + 2) Let t(d) = d2 + 7d + 3. Let a be t(-8). Suppose a = 2q - 1. Factor qm*4 + 2/3m*2 + 8/3m*5 + 4m*3 + 0 + 0m. 2m2(m + 1)*2(4m + 1)/3 Let l(s) be the second derivative of -s7/112 + 3s*6/80 - 9s5/160 + s4/32 + 3s. Factor l(g). -3g*2(g - 1)*3/8 Let z(t) = 4t*5 + 14t*4 - 16t*3 - 16t*2 - 6t - 10. Let x(c) = c5 - c3 - c*2 - c - 1. Let j(b) = -20x(b) + 2z(b). Factor j(n). -4n(n - 1)3(3n + 2) Let k = 30 - 25. Suppose -2l + 3 = 5g, 0g - 1 = l + kg. What is h in -2/7h*2 + 0h + 0 + 0h3 + 2/7h*l = 0? -1, 0, 1 Let q be (-5)/5020/(-16). Let o(w) be the first derivative of -2w + 2w*2 + 2 + qw*4 - 5/6w3. Factor o(k). (k - 2)2(k - 1)/2 Let v(k) be the third derivative of k10/15120 - k9/3780 + k8/3360 + k4/8 + 2k*2. Let a(q) be the second derivative of v(q). Factor a(u). 2u*3(u - 1)2 Let h(f) be the second derivative of f6/60 - f5/15 + f4/12 - f*2 + f. Let l(v) be the first derivative of h(v). Solve l(x) = 0 for x. 0, 1 Find d, given that 2d*2 + 2/3 - 2/3d*3 - 2d = 0. 1 Let j(z) = -250z5 + 2304z*4 - 270z*3 - 1728z*2 + 956z - 148. Let g(i) = -i4 + i2 - i + 1. Let o(y) = -4g(y) - j(y). What is k in o(k) = 0? -1, 2/5, 9 Suppose 0 = -y - 2y + 6. Let b be (-10)/14 + (8 - 7). Factor bc + 2/7c*y - 2/7 - 2/7c*3. -2(c - 1)*2(c + 1)/7 Let i be (1 - 4 - -2) + 3. Let n(p) be the second derivative of 0pi + 0 - 1/42p*4 - p + 1/21p*3. Factor n(q). -2q(q - 1)/7 Factor 1/7v*5 - 3/7v + 3/7v4 + 2/7v*3 - 1/7 - 2/7v*2. (v - 1)(v + 1)*4/7 Let i = 45 - 44. Let m be 34/10 + (-6)/15. Factor 9/4g*2 + i + mg. (3g + 2)2/4 Let t = -7/100 + 449/700. Factor 0w*3 + 0w*2 + tw*5 + 4/7w*4 + 0 + 0w. 4w4(w + 1)/7 Let r be 2 + -1 - (9 - 0). Let o be 16/r - (1 + -3). Let o + 2/3f - 1/3f*2 = 0. Calculate f. 0, 2 Let k(p) = -2p + 5p3 - 4p*3 + 4p*2 + 2 + 0. Let j be k(-3). Let -6d - 4 + 16d + jd*2 - 3d*2 = 0. Calculate d. -1, 2/7 Let a be (-48)/64 - (-1697)/(-20). Let j = a - -86. Factor -6/5l*3 - 4/5 + 8/5l*2 + jl. -2(l - 1)2(3l + 2)/5 Let m(w) = w3 - 10w*2 - 10w - 11. Suppose 8p - 6p = 22. Let o be m(p). Factor o - 1/2n2 - 1/2n. -n(n + 1)/2 Let c(m) = m. Let h be c(3). Let s(w) be the first derivative of 1/2w*4 + 2w*3 + hw*2 + 2w - 2. Factor s(o). 2(o + 1)3 Let y = -23 + 13. Let u be 0 - (-1)/y-2. Determine w so that 1/5w - 1/5w*3 - 1/5 + uw*2 = 0. -1, 1 Suppose 0 = -5r - 3t + 12, 16 = -0t + 4t. What is i in 8/13i + r - 6/13i3 + 0i*2 + 2/13i*4 = 0? -1, 0, 2 Factor -2/3w*4 + 0 + 2/3w*3 + 4/3w*2 + 0w. -2w2(w - 2)(w + 1)/3 Let w(q) = -q2 + q - 1. Suppose 7l - 20 = 2l. Let y(h) = -2 - lh*2 + 7h - 7h. Let p(v) = -2w(v) + y(v). Factor p(k). -2k(k + 1) Let u be (-5)/((-15)/(-14))144/(-168). Let z(o) be the third derivative of 0 + 0o*3 - 2o*2 + 1/30o*5 + 0o - 1/6ou. Determine n so that z(n) = 0. 0, 2 Let f(y) be the first derivative of y9/13608 + y8/2520 + y7/1890 + 2y*3/3 + 5. Let b(h) be the third derivative of f(h). Factor b(p). 2p*3(p + 1)(p + 2)/9 Let w(c) be the third derivative of 1/24c4 + c2 + 0c3 + 0c + 0 - 1/60c5. Factor w(n). -n(n - 1) Let g(f) be the first derivative of -3f6/5 - 32f5/25 - f4/2 + 4f3/15 + 15. Let g(n) = 0. Calculate n. -1, 0, 2/9 Suppose 0m - 5l = 3m - 20, 4l = 4. Let w(z) = z3 + 2z*2 - z + 10. Let p be w(-3). Factor -4g*4 - 2g5 - g3 + mgp + g5 - 3g4. -g3(g + 1)2 Factor 6m*2 + 7m*5 - 16m*2 - 2m*5 - 15m*3. 5m*2(m - 2)(m + 1)2 Let w(b) be the third derivative of 1/840b*8 + 2/75b*5 - 2/15b*3 + 1/60b*4 - 2b*2 - 1/150b*6 - 2/525b*7 + 0b + 0. Determine c so that w(c) = 0. -1, 1, 2 Let y(p) be the first derivative of 2p5/65 - 2p*4/13 + 10p*3/39 - 2p*2/13 + 6. Factor y(n). 2n(n - 2)(n - 1)2/13 Let k(n) be the second derivative of n7/336 - n*6/80 + 3n5/160 - n4/96 - n. Factor k(g). g*2(g - 1)3/8 Let l(t) be the third derivative of -t8/168 + t*7/105 + 3t*6/20 + 11t5/30 + t4/3 - t*2. Factor l(w). -2w(w - 4)(w + 1)*3 Suppose 4q - 4c = 16, -3q - q = 3c - 2. Let y(r) = r2 + 5r - 1. Let x(j) = j*2 + 2j - 1. Let h(z) = qy(z) - 5x(z). Find s such that h(s) = 0. -1, 1 Let f(q) be the first derivative of -q8/3360 + q7/560 - q6/720 - q5/80 + q*4/24 + 8q*3/3 + 2. Let t(a) be the third derivative of f(a). Factor t(o). -(o - 2)(o - 1)*2(o + 1)/2 Let d(a) = a*2 - 2a + 1. Let x(q) = 3q2 - 7q + 4. Let t be (((-8)/1)/2)/1. Let o(s) = tx(s) + 14d(s). Factor o(v). 2(v - 1)(v + 1) Let n(b) = -b*2 - b. Let h(a) = -3a*2 - 3a. Let m be (40/28)/((-3)/(-21)). Let u(z) = mn(z) - 4h(z). Factor u(d). 2d(d + 1) Let n(x) be the third derivative of -x10/75600 + x8/10080 + x*5/15 + 4x*2. Let t(h) be the third derivative of n(h). Find w, given that t(w) = 0. -1, 0, 1 Suppose 4/7j - 2/7j2 + 0 = 0. Calculate j. 0, 2 Let z(b) be the first derivative of 2b - 3 - 5b2 + 8/3b3. Suppose z(d) = 0. What is d? 1/4, 1 Let y(u) be the third derivative of u8/448 - 3u7/280 + u6/80 - 16u*2. Factor y(n). 3n*3(n - 2)(n - 1)/4 Factor 0 + 9/2v*2 - 3v - 3/2v3. -3v(v - 2)(v - 1)/2 Suppose -3f + 1 = -4b - 6, -2b - 5f = -29. Let l be 4/(4 - b) - -1. Suppose -2p2 + 0p*2 - 6p + 2pl + 4p + 2 + 0p2 = 0. Calculate p. -1, 1 Let m(k) = k3 - 9k*2 + 8k + 5. Let v be m(8). Factor -w + 2w2 + 4w*4 - 5w*2 - vw*4 - 3w*3 + 0w. -w(w + 1)*3 Let p(b) be the second	{ "pile_set_name": "DM Mathematics" }
f*2 + 2f + 10. What is d(z(o))? 1500o2 + 4o + 10 Let f(b) = b*2. Let j = -194 + 203. Let z(v) = 1 + 0v*2 - jv2 + 2 + v2. Give f(z(p)). 64p4 - 48p*2 + 9 Let q(v) = -v. Let r(i) = 21i*2 + 83i - 441. Determine r(q(c)). 21c2 - 83c - 441 Let a(z) = 5z2 - 66z - 54. Let t be a(14). Let d(h) = 249 - 490 + 241 + h*t + 19h*2. Let y(l) = 0 - l + 0. Give y(d(p)). -20p*2 Let w(q) = 2q. Let a = 639 - 637. Let g(c) = -7c + 8c - 19 - c + ac + 0c. Determine w(g(o)). 4o - 38 Let k(m) = 4m2. Let h(o) be the first derivative of -o6/180 - 3o3 + 44. Let q(u) be the third derivative of h(u). What is q(k(r))? -32r*4 Let w(u) be the first derivative of -2u*3/3 - 1. Let i(o) = 124 - 424 + 9o + 157 + 143 - 2o. Determine w(i(n)). -98n*2 Let r(t) = -137 + 418 + 0t*2 - 3t*2 - 138 - 143. Let k(o) be the third derivative of 0o - 3o2 - 1/2o*4 + 0 + 0o*3. Calculate k(r(s)). 36s*2 Let w(o) = -2o. Let x(t) = -t - 10. Let h(a) = a + 573. Let p(f) = -h(f) + 3x(f). Calculate p(w(m)). 8m - 603 Let b(x) = 41x. Let o be 5527/13 + (-44)/286. Let k be 424 - -1(2 - 1). Let m(q) = q*2 - k + o. What is b(m(i))? 41i*2 Let m(u) = -2u. Let w(k) = -996198158k. Give w(m(v)). 1992396316v Let c(g) = 4g + 0g - 6g. Let y(x) = -12x*2 + 5x - 15. Let q = -332 + 327. Let z(h) = -119h2 + 49h - 147. Let u(n) = qz(n) + 49y(n). Give u(c(l)). 28l2 Let n(u) = u3 + 17u*2 + 29u + 44. Let d be n(-15). Let r(f) = -183 + 6f + d + 59 + 60. Let c(i) = 2i*2. Determine c(r(x)). 72x*2 - 120x + 50 Let f(b) = 28299b + 1. Let d(j) be the first derivative of -j2/2 - 1378. Determine d(f(g)). -28299g - 1 Let l(q) = 128 - 128 - 23q2 + 8q*2 + 9q*2. Let k(b) = -130b*2 - 3b. Determine k(l(z)). -4680z4 + 18z*2 Let u(z) be the first derivative of 32z + 0z2 + 1/3z*3 + 13. Let j(w) be the first derivative of u(w). Let a(b) = -11b. Determine a(j(t)). -22t Let w(a) = a2. Let n(l) = 1091792625l + 1. Determine n(w(j)). 1091792625j2 + 1 Let x(m) = -5288m. Let c(p) = -320p. Determine x(c(b)). 1692160b Let g(i) = 121i - 2992. Let h(r) = 2r - 48. Let v(m) = -6g(m) + 374h(m). Let s(l) = 11l. Calculate s(v(p)). 242p Let h(c) = -36c2. Let b(o) = -10 - 5o + 13o + 10 + 2o. Give h(b(t)). -3600t2 Let k(h) = -3h*2. Let r(a) be the first derivative of 52a*3 - 2330. Determine r(k(m)). 1404m*4 Let s(i) = -9618i. Let g(a) = 2959a2 + 1. Give s(g(t)). -28459662t*2 - 9618 Let y(u) be the second derivative of 149u*4/12 - 569u. Let f(h) = -4h2. Determine y(f(q)). 2384q*4 Let c(d) be the second derivative of 0 + 0d*2 - 62d + 0d3 + 7/6d*4. Let h(y) = -3y + 3y - 2y. What is c(h(r))? 56r2 Let r(b) = 4b*2. Let z(h) be the third derivative of 0h - 1/30h5 + 0h*4 + 2 + 0h*3 + 106h*2. Determine z(r(m)). -32m*4 Let z(v) = -901633 + 901633 - 316v*2. Let t(i) = -27i*2. Determine t(z(x)). -2696112x*4 Let y(j) = 5j - 2. Let s(a) = 2a + 1. Suppose 4l = 5f - 21, 22 = 3l + 34. Let c(r) = fy(r) + 2s(r). Let k(q) = q*2. Give c(k(o)). 9o*2 Let v(m) = 271m*2 - 3m + 46. Let a(g) = -g + 7. Determine a(v(y)). -271y2 + 3y - 39 Let l(i) = -16779894i2. Let h(u) = -6u. What is l(h(j))? -604076184j2 Let m(i) = 91i. Suppose -7q + 2r = -12q + 21067, -21083 = -5q + 2r. Let j(k) = 4215 - q + k. What is j(m(c))? 91c Let k(t) = -35t. Let f be (-6897)/(-198) + ((-13)/(-6) - 2). Let x(b) = fb - 64b + 27b. Determine x(k(z)). 70z Let i(v) = -783v. Let s(b) = 2b2 + 6b - 85. What is s(i(h))? 1226178h2 - 4698h - 85 Let h(d) = -11d. Let o(b) = 8444b*2 - 86. Calculate h(o(t)). -92884t*2 + 946 Let o(n) = -8n. Let p(l) = 2l2 + 4577108l. Give o(p(r)). -16r2 - 36616864r Let j(m) = -21m + 1. Let b(o) = 2o*2 - 8o - 119464. Give j(b(l)). -42l2 + 168l + 2508745 Let j(c) = -5c - 6. Let z(x) = 45x + 55. Let i(t) = 55j(t) + 6z(t). Let m(q) = 2972 - 2972 + 17q2. Give m(i(y)). 425y*2 Let k(z) = 7z2. Let j(f) be the first derivative of -f5/10 - 4f2 - 4f + 45. Let h(i) be the second derivative of j(i). Determine k(h(u)). 252u4 Let x(m) = 44m*2. Let f(i) = 32i - 5i2 + 3 + 0i*2 - 17i + 4i2. Let b be f(15). Let q(p) = b - 24p - 3 + 22p. What is q(x(h))? -88h*2 Let q(l) = -4l*2. Let r(m) = 546m + 527. Determine r(q(x)). -2184x2 + 527 Let m(j) = 7j + 22. Let o(b) = -11. Let f(t) = m(t) + 2o(t). Let w(v) = 339v*2 - v. Calculate f(w(a)). 2373a*2 - 7a Let q(t) = -22t - 2. Let m(l) = 153641 - 153641 + 567l*2 - 228l*2. What is q(m(a))? -7458a*2 - 2 Let y(k) = -7k*2. Let s(u) = 41u*2. Let a(j) = s(j) + 6y(j). Let r(d) = 193d2 + 23d*2 + 53d*2. What is a(r(x))? -72361x4 Let s(c) = c2. Let q(l) be the first derivative of 1721l2/2 + l + 725. Give q(s(i)). 1721i*2 + 1 Let f(r) = -1061r*2. Let t(q) = 209q + 215q - 830q + 205q + 203q. Determine f(t(h)). -4244h2 Let u(w) = 1164w - 1916. Let s(r) = -r*2. What is u(s(h))? -1164h*2 - 1916 Let s(a) = 1564560982a. Let r(d) = -2d. What is r(s(t))? -3129121964t Suppose -5h = -4g - 17 + 19, -3h = 4g - 18. Let u(n) = 24 - 2 - 41 - gn + 5n - 45. Let r(d) = -d. Give u(r(q)). -2q - 64 Let l = 5 - 7. Let d(a) = 2a*2 + 3a. Let n(g) = 2g + g2 + 5g*2 - 2g*2 - 2g2 - g2. Let h(i) = ld(i) + 3n(i). Let p(k) = -16k2. Give p(h(f)). -16f*4 Let m(l) = 27892546l - 1. Let d(g) = -g. Calculate d(m(k)). -27892546k + 1 Let j(w) = -4w. Let c(x) = -x*3 + 8x*2 + 6x - 10. Let m be c(8). Let n(l) = -12l2 + m - 15 - 23. Determine j(n(d)). 48d*2 Let l(u) = 3u*2. Let q = 13 + -4. Let t = -1 + q. Let y(g) = 2030 - 2030 + tg*2. Give l(y(p)). 192p*4 Let d(p) = -37p. Let s(t) = 15t + 4. Let q(m) = 44m + 14. Let u(g) = 2q(g) - 7s(g). Let y(a) = 6d(a) - 13u(a). Let v(h) = 164h2. Calculate y(v(r)). -164r*2 Let z(k) be the second derivative of 0k*3 + 1/4k*4 + 0k*2 - 2k + 0. Let n(b) be the third derivative of 13b5/60 + 109b*2. What is z(n(v))? 507v4 Let v(s) be the third derivative of s5/6 + 650s2 + 5. Let p(u) = -1 + 1 - 4u*2. Give p(v(h)). -400h*4 Let u(m) = -2m*2 - 24m. Suppose -54 = -2r - 0r. Let l = r + -22. Let t(i) = -8 - 2i + l + 3. Calculate u(t(h)). -8h*2 + 48h Let s(a) be the first derivative of -3a2 + 242. Let t(l) = 4l + 2. Give s(t(o)). -24o - 12 Let g(j) = 10j*2. Suppose -35 + 26 = -3l. Suppose -4u = f - 3, 0 = lf + 2u - 33 - 6. Let a(b) = b - f + 27 - 12. Determine g(a(w)). 10w*2 Let j(z) be the third derivative of -1053z*5/20 - 97z*2 - 7z. Let s(m) = m*2. Calculate s(j(n)). 9979281n*4 Let q(h) = -191h. Let k(f) = 81f - 6. Let b(m) = 337m - 25. Let p(z) = -6b(z) + 25k(z). Determine q(p(n)). -573n Let s(w) = -1306w - 2. Let r(l) = 352l. Let k(y) = 151y. Let j(i) = -14k(i) + 6r(i). What is j(s(o))? 2612o + 4 Let h(l) = -4224l. Let y(q) = 6904q2. Calculate h(y(x)). -29162496x*2 Let s(g) = g. Let z(f) = -12f. Let n(l) = -63s(l) - 6z(l). Let a be (-3)/9 + (-7)/(-3). Let p(x) = 2 - 2x - a + 0x. What is p(n(d))? -18d Let n(q) = -7332q + 481 - 7329q + 14659q. Let j(u) = -19u2. What is n(j(c))? 38c*2 + 481 Let i(y) = 34185y. Let z(t) = 48t. Determine z(i(k)). 1640880k Let q(u) = -187 + 189 - 269u + 141u. Let n(z) = -z*2. Calculate q(n(g)). 128g*2 + 2 Let h(p) = 889p*2 + 13829. Let m(i) = 5i. Give m(h(d)). 4445d2 + 69145 Let z(p) be the first derivative of -87p*2/2 - 93174. Let i(g) = 2g + 2. Let h(w) = -10w - 11. Let r(b) = 2h(b) + 11i(b). Give r(z(y)). -174y Let w(r) = -3. Let z(v) = v + 1. Let n(o) = -4w(o) - 12z(o). Let c be (-23 + 7)(-1560 - (4 - 3)). Let x(t) = -4t*2 + c - 24976 + 7t*2. What is n(x(l))? -36l*2 Let p(q) be the second derivative of -3q*4/4 + 2q. Let n(k) be the third derivative of -k*5/60 + 18k*2 - 20k + 3. Calculate p(n(r)). -9r4 Let l(k) = -3k*2. Let p(f) = 5f*2 + 51f + 20132. What is p(l(c))? 45c4 - 153c*2 + 20132 Let s(r) = -3r. Let x(f) = -2f2 - f + 10. Let q(p) = 369p*2 - 7p + 60. Let v(c) = -q(c) + 6x(c). What is v(s(i))? -3429i*2 - 3i Let k(c) = -2c. Let g(x) = -259663582x. Give k(g(o)). 519327164*o Let f(v) be the	{ "pile_set_name": "DM Mathematics" }
7i - 60. Let p be (3/10)/(i/(-10)). Which is the third biggest value? (a) p (b) -3 (c) z b Let x(d) = -2d*2 - 7d + 2. Let g be x(-4). What is the second smallest value in -1/5, g, 1? -1/5 Let i = -7 - -9. Let q = -4 + i. Let l = -3 - q. Which is the third biggest value? (a) l (b) 1/3 (c) -1/4 a Let h = -11 - -13. Which is the third biggest value? (a) -1/2 (b) -3 (c) 3 (d) h a Let z = 0.1 + 0. Let l be (3/7)/((-20)/(-35)). What is the second biggest value in l, z, 4? l Let g = 18 + -17.8. Which is the smallest value? (a) -0.1 (b) 2/9 (c) -4 (d) g c Let c be (-2)/(-2 + 2(-8)/(-4)). What is the biggest value in -2/9, 5, c? 5 Let a = -0.8 - 0.2. Let w = -71/21 + 11/3. Let c = 0 + 1. What is the second smallest value in w, a, c? w Let y be (3 - (-344)/(-114))/((-1)/6). What is the fourth smallest value in -0.3, -3/5, y, 0.3? 0.3 Let i = -3 + 2.6. Let n = 178 - 887/5. What is the biggest value in i, n, -1? n Suppose 2h + 30 = -4h. Which is the third smallest value? (a) -2 (b) 6 (c) h b Let n = -2.97 - -3. Let j = 7.97 - 8. Let y = n + j. Which is the second smallest value? (a) -1 (b) 0.1 (c) y c Suppose -4t + 19 = t + y, -5t + 3y + 3 = 0. Which is the second smallest value? (a) -5 (b) -2/7 (c) t b Let n = 0 - 1/4. Let w be 4/18 - 6/108. What is the third biggest value in n, w, 2/5? n Let n = 0 + -0.1. Let r = -0.1 + 0.3. Which is the second biggest value? (a) -1 (b) n (c) r b Let q = 1.5 - 1. Let o = 10.6 + -3.8. Let l = o - 7. Which is the biggest value? (a) l (b) q (c) -1/4 b Let i = -3.1 + 3. Let l = i - 3.9. Which is the third smallest value? (a) -3/2 (b) -3 (c) l a Let v = -56 + 52. Let b = 39/5 - 181/20. What is the third smallest value in v, b, 5? 5 Let d(n) = n*3 + 8n*2 + 5n - 9. Let m be d(-7). Suppose -5z + 25 = -p + mp, -4p = z - 5. Which is the third smallest value? (a) 0.5 (b) p (c) 0.2 a Let v = 0.56 + -0.23. Let p = v - 0.03. What is the third smallest value in p, 3, 4? 4 Suppose -18j + 10 = -20j. Let h = -9 + 5. Which is the second biggest value? (a) h (b) j (c) -1 a Let l be 6/(-20)60/45. Which is the third smallest value? (a) 0.5 (b) l (c) 1 (d) -2 a Let l = 0.1 - 0.02. Let z = l + -4.08. Which is the third smallest value? (a) 3/5 (b) -5/6 (c) z a Let c be (-5)/(-6)(-627)/15. Let s = c + 35. Let j = 3.2 + -3. What is the third smallest value in s, j, 1/2? 1/2 Let l = -0.02 - -3.02. Let s = -0.38 - -0.08. Let k = 1/2 - 4/3. What is the second biggest value in l, k, s? s Let h = -1.9 + 2. Let p = -3.4 - -3. What is the second biggest value in 0.2, h, p? h Let v = 0.12 + 1.88. Which is the second smallest value? (a) 3 (b) -0.1 (c) v c Let c be 2 - 399/198 - -1. Let b = 9/11 - c. What is the second biggest value in -0.5, -0.2, b? -0.2 Suppose 3w = -1 + 4. Suppose 3z = -z - 3m + 26, -z + 11 = 3m. Let n = -1/50 - -109/450. What is the biggest value in w, z, n? z Let h = 31 + -17. Let c = h + -4. Let s = -6 + c. What is the third smallest value in s, -1/5, 0? s Let w be 7/(-8) + 1 + 0. Let s be (-24)/(-10)(-30)/(-12). Let i be 4/6 - (-2)/s. Which is the biggest value? (a) w (b) 2 (c) i b Let m = -11 + 11.1. Which is the smallest value? (a) 2 (b) m (c) -3 c Let t = 4.6 + -5. Let m = -138 + 686/5. Let v be (-7 + 6)1/(-6). What is the biggest value in v, m, t? v Let y = -1.02 + 3.02. What is the second biggest value in -0.2, 15, y, 1? y Let d = -3.3 + 3. Which is the biggest value? (a) 5/4 (b) 2/3 (c) d a Let x = 31.7 - 32. What is the second smallest value in -4/3, 3, x? x Let n = -0.1 - -0.1. Let d = -11.3 + -3.7. Let u = d - -19. Which is the smallest value? (a) -5 (b) u (c) n a Let p = 15.37 - 0.37. Let c = p - 13. What is the biggest value in -1/4, c, 0.1? c Let v = 0.8 - 0. Let j = 3.6 - -1.2. Let b = v - j. What is the third smallest value in 0, 6, b? 6 Let h = 0.97 - 0.17. Let s = -2.8 - -4. Let o = s + h. What is the second biggest value in 2/13, o, -5? 2/13 Let m = 13 + -9. What is the second biggest value in m, 1/3, -1? 1/3 Let u = 136 + -140. Which is the smallest value? (a) 2 (b) 2/5 (c) u c Let t = 1252/369 - 48/41. Let s = 17/9 - t. Let q be 3/(-5) - 36/15. Which is the second biggest value? (a) s (b) -5 (c) q c Let w = -25/49 - 3/49. Which is the smallest value? (a) -0.2 (b) -5 (c) w b Let q = 289 + -285. Let p = -0.2 + 1. Which is the second biggest value? (a) p (b) 0.2 (c) q a Let c(o) = o3 - 5o*2 + 5o - 3. Let t be c(4). Let j be t/(-1 + 2 + -8). Suppose 0a = 4a - 12. What is the third smallest value in 0, a, j? a Let a = -17 - -18. What is the second smallest value in 0, 0.4, a? 0.4 Suppose -9 = -5x + 16. Which is the biggest value? (a) -2 (b) x (c) -7 b Let u = -25 + 27. Which is the fourth smallest value? (a) -3 (b) 0.3 (c) 0.2 (d) u d Let j = -890 - -894.99. Let a = j - -0.01. What is the second smallest value in a, 1, 0? 1 Let u = -3.04 + 0.04. Let c be (4 + -3)1/4. What is the second smallest value in c, u, -0.3? -0.3 Let k = 0.4 - 0.3. Let h = k + 0.1. Let q = 12/97 - 230/291. What is the third smallest value in -6, h, q? h Let t = 1.43 - 1.53. Which is the smallest value? (a) t (b) -32/3 (c) 0.2 b Let u = -0.5 - 0. Let f = -481 - -476. Which is the biggest value? (a) u (b) -3 (c) f a Let o = 1240/9 - 138. What is the smallest value in 1.2, 4, o? o Let k = 2.86 - -0.14. Let r(t) = t*3 - 5t*2 - 3t + 5. Let f be r(4). Let w = f - -67/3. What is the second smallest value in k, 1, w? 1 Let p be (-8)/(-14)(-3)/(-2). Which is the biggest value? (a) p (b) -5 (c) 2 c Suppose -13 = -4g - 1. Which is the third biggest value? (a) -0.4 (b) g (c) 2/45 a Let l be (-6)/(-9) - (-2)/(-3). Let y(r) = -r*2 - r + 3. Let f be y(l). Which is the second biggest value? (a) f (b) 2 (c) -0.5 b Let q = -13 + 13.1. Let m = 11 + -16. What is the third smallest value in -2/3, q, m? q Let t = 0.68 + -0.18. Which is the third smallest value? (a) t (b) 0.4 (c) -4 a Suppose 4t = -t. Let x be 1 + (t/2)/(-2). Which is the second biggest value? (a) -2/13 (b) x (c) 5 b Let q = 533/6 - 89. What is the second smallest value in -0.4, 2/11, q? q Let k = 0 + -2. Let o be 261/186/(-2). Let l = o + 42. Which is the third smallest value? (a) 1/2 (b) l (c) k a Let y = -49/2 + 23. Let a be 218/(-234) - 2/9. Let x = a - -101/65. What is the third biggest value in x, y, -1? y Let h(s) = s3 + 7s*2 + 6s - 2. Let r be h(-6). Let q be ((-11)/(-55))/((-8)/5). Which is the second biggest value? (a) q (b) -1 (c) r b Let o = -51.5 + 52. What is the fourth biggest value in -1/3, o, -0.5, 6? -0.5 Let z = -1487/9 - -165. Which is the biggest value? (a) z (b) 5 (c) -9 (d) 2 b Suppose 0 = -3z + 8z - 20. Suppose 2q - 11 = -v, 1 = -7v + 2v + zq. Let o = -0.49 + -0.01. Which is the third smallest value? (a) o (b) v (c) 2 b Let q be (((-3)/1)/(-15))/(5/(-15)). Let s = 4 + -1. Which is the third biggest value? (a) q (b) s (c) -4 c Let k(v) = -v*3 + 5v*2 - 5v + 2. Let y be k(4). Let u = -0.14 - -4.14. Which is the biggest value? (a) y (b) u (c) 1 b Let m = -20 + 24. What is the second smallest value in m, -0.3, 6? m Let t = -38 - -37.6. Which is the third smallest value? (a) 1 (b) 0.2 (c) t a Let s = -5.1 + 0.1. Which is the third smallest value? (a) s (b) 5 (c) 0.2 b Suppose -3d - 5i = 16, -5 = i - 0i. Suppose 0 = -0v + dv - 120. Let j = v + -77/2. Which is the smallest value? (a) -2 (b) 0.5 (c) j a Let a = 92 + -91.9. What is the second smallest value in -5, 0.2, 0.05, a? 0.05 Let r = 0.05 + -0.15. Which is the second biggest value? (a) -2 (b) r (c) 2/51 (d) 3 c Let n(g) = -3g. Let w be n(1). Suppose d = -2d - 3. Let r = w - d. Which is the third biggest value? (a) -3 (b) -4 (c) r b Let z be 10/15 - (0 + 2 + -1). Which is the second smallest value? (a) 2 (b) z (c) -0.4 b Let m be (2/4)/(2/6). Which is the smallest value? (a) m (b) 0.2 (c) -2/23 c Let g be (-12)/10 + (-1 - -2). Let s = 0 + 0.1. Which is the third biggest value? (a) 0.4 (b) g (c) s b Suppose -5w - 3 = -18. Let x be (12/(-117))/((-2)/w). Which is the smallest value? (a) x (b) -1 (c) 8 b Suppose 2h = -0h - 6. What is the smallest value in -2/7, 2/5, h? h Let j = 0.41 + 0.09. Let m be -1 - (-2)/((-4)/	{ "pile_set_name": "DM Mathematics" }
(-8) composite? True Suppose -4t + 24 = 16. Let y(q) = -102q*2 + 1783q*2 + 16 - 17 + q + 372q*t. Is y(1) a prime number? True Let s(z) = 5z*2 + 10z + 7. Suppose 2i = v - 11 - 12, 4v - i - 78 = 0. Let y be (-3)/(-9) - v/3. Is s(y) a prime number? True Let p(q) = -3q2 - 22q - 4. Let k be p(-7). Suppose 0 = d - 4y - 9959, 3d - ky = -2889 + 32784. Is d prime? True Let k = 179 - 164. Suppose -ky + 6y + 3411 = 0. Is y prime? True Let u = 128212 - 81899. Is u a composite number? True Let s be (4 + -3)/(6/30). Suppose -j - 1305 = -2l, -sl - 2j + 2084 = -1183. Is l prime? True Let k(a) = 3a3 - a2 - 19a - 1. Let n be k(4). Suppose -g - 4g = -4750. Let f = g + n. Is f a composite number? False Let x be (-8)/(-12)6/41486. Let k = x + -443. Is k prime? False Is 864562/8 + 12/(-48) - (-8 - -7) a composite number? True Let x(t) = 2t*2 + 13t + 9. Let i be x(-9). Let u = i + 1060. Suppose -u = -10a + 21736. Is a prime? False Let c(y) = -4 - 8y - 65y2 + 0 + 8 + 11. Let m be c(4). Let k = m + 1970. Is k composite? True Suppose 0 = -2a - 2, -25y - 3a + 23 = -23y. Suppose yu - 17u = -3z - 15868, 0 = -5z. Is u a prime number? True Let k(q) = 222q*2 + 31q - 164. Let o be k(32). Suppose -27s + o = -238215. Is s a prime number? False Let s(q) = -2q - 19. Let c be s(-9). Let y be (-3)/6(c + 0 - 3). Is (-3 - -2)(-1570)/y composite? True Suppose 0h - 2h = 2m - 3896, -4 = m. Let d = h - 981. Is d a composite number? False Suppose -1 = -i, -4q - 2i + 14 = -q. Suppose g - 2 = -s, -qg = g + s + 10. Is g(3565/(-15) + -2) prime? True Let f = 10446 - -53521. Is f a composite number? True Suppose 4 = -4o, 3o = 5z - 1 - 12. Is z/(-4)(-1771 + -3) a composite number? False Let i(c) = 17c + 33. Suppose 269 = 14a - 753. Suppose 37 = 5k - a. Is i(k) a prime number? False Let i(o) = 2o3 - 2o*2 - 4. Let g be i(2). Suppose -4y = -gc + 11536, 0 = -3c - 0y + y + 8642. Is c a prime number? True Let p = 432 - 385. Suppose -17095 = -ph + 42h. Is h composite? True Is 170/2975 + (-7075283)/(-35) + 0 composite? True Is 4/12-329163-5(-6)/(-30) a composite number? False Let k be (-8)/(-64)8 + 1 + 1. Suppose -14000 = kl - 13l. Suppose -3355 = -5w - l. Is w a composite number? True Suppose 40i = 37i. Let m be 6 + 2 - (3 - i). Let t(x) = 12x2 + 6x - 11. Is t(m) a composite number? True Let f be ((-3724)/4 - -6)105. Is f/(-4) - 3/12 a composite number? False Let l be (8/18)/(-2) - (-13432)/18. Let t = 3785 - l. Is t prime? False Is (-961407)/(-1) + (-13 - (-12 - 7)) a prime number? False Suppose -y - 5 = 14i - 18i, 0 = 2y - 6. Suppose 5p + ib - 3153 = 4b, 3p + b - 1894 = 0. Is p prime? True Let v(y) = 2y2 + y - 84. Let g be v(0). Let z = 98 + g. Suppose 7k - 672 + z = 0. Is k prime? False Suppose -129a + 3849 = -132a. Let y = a - -3144. Is y a prime number? True Let v = 4421 + 6085. Suppose -1505 = -3o + 5n + 8983, n = -3o + v. Let s = o + -2020. Is s a composite number? False Suppose 25 = -18w + 13w, -3w + 134997 = 4p. Suppose 0 = -13i + 16i - p. Is i prime? True Suppose 4c + 2b = 7b + 5, 3c = -3b - 3. Suppose 4256 = 5n + 2j - j, 4n + 2j - 3406 = c. Is n a composite number? True Let i(a) = -246a2 + 9a + 24. Let x(y) = -y*2 + 3. Let n be x(-3). Let j be i(n). Is (3/91)/((-2)/j) a prime number? True Suppose -m = -2u - 286661, 0 = -3m + 5u + 862460 - 2482. Is m a prime number? True Let t = 21 + 4. Suppose -8w + 3w + t = 0, -15 = -5f + 2w. Let c(b) = 6b*3 + 6b + 7. Is c(f) composite? False Suppose 10d = -51917 + 361627. Is d prime? True Let g(t) = 367t + 1222. Is g(51) a composite number? True Suppose 12q - 42q = -1003931 - 7085239. Is q a prime number? False Let b(w) = -w*2 + 2w - 19. Let i be b(10). Let j = -182 - -177. Is i/(-2 + 1) + j composite? True Let w = -745 + 2814. Suppose 9s = 10s - w. Is s a composite number? False Let u be (-4)/((-12)/(-72) - (-5398)/(-32316)). Is (-5)/(-30)-2 - u/(-6) composite? True Let c = 103 - 95. Is (-14)/3(-50748)/c a composite number? True Suppose 0 = -5x + 39x - 102. Suppose xl = -3s + 12612, 4s + 6724 = -3l + 19339. Is l prime? True Suppose 0 = -2t - 2y - 16450 + 89706, 0 = 5y + 5. Is t prime? True Let d = 141 + -202. Let z = 63 + d. Suppose 3t + zo = o + 8999, 5t - 14987 = 4o. Is t a composite number? False Suppose -2p + 3k = 3, -5p = 6k - k - 5. Suppose -5t + v + 159 = -v, 5t + 5v - 180 = p. Is t composite? True Let y = 43805 + -19208. Suppose -23a = 4a - y. Is a prime? True Let r(i) = 34i - 121. Let k(j) = 35j - 121. Let n(z) = -2k(z) + 3r(z). Is n(34) a prime number? True Let u(b) = b*3 - 9b*2 + 11b + 15. Let h be u(6). Let p = -27 - h. Suppose 2j + 5483 = 3c, p = -0c - 4c + j + 7319. Is c a composite number? False Suppose 6 = -5o + 21, 19504 = v - 2o. Let f = v + -12903. Is f a composite number? False Suppose -32f - 20f + 7690171 = -35f. Is f composite? False Let h = 3409 + 400. Is h composite? True Is 1/(5 + 639882/(-127977)) a prime number? False Let w be (3 + 76/(-24))-6. Is (w - 3415)/(-29 + 27) composite? True Suppose 2s - 4y - 232678 = 0, -9y = 5s - 12y - 581660. Is s composite? False Let i(m) = m3 - 1. Suppose -7 = -7j + 7. Let a(l) = -14l3 - 5l*2 + 5. Let k(p) = ji(p) + a(p). Is k(-2) prime? True Let u be (-2000910)/(-20) - (-9)/(-6). Suppose 4648 = -28s + u. Is s a composite number? False Suppose 4c + 5 - 17 = 0. Suppose ca - 18145 = -16a. Is a prime? False Suppose 0 = 2746r - 2715r - 12761677. Is r a composite number? False Let c(n) = 9n2 - 114n - 1576. Is c(99) prime? True Suppose -12l - 30 + 102 = 0. Suppose -2i = -l - 0. Suppose -2j - 2j = 2y - 438, -iy = -3j - 621. Is y composite? False Suppose -3u + 4141952 = 7t, -97u + 96u - 5t = -1380632. Is u prime? False Let v be 2/(-9) + (-3 - (-116)/36). Let c = -2697 - -4544. Suppose -z + 2z - c = v. Is z prime? True Suppose 85n - 5900116 = -14n + 5440037. Is n a prime number? True Is 129754 - (-12)/(4 + 0) composite? False Let c(j) = -3j + 72. Let p be c(22). Let g = -3580 + 8434. Suppose pt = 3t + g. Is t prime? False Suppose -26d + 16 = -22d. Suppose -dh = -h - 1011. Let u = h - 218. Is u prime? False Let p(n) = -268n + 59. Let u(w) = 267w - 59. Let q(v) = -5p(v) - 6u(v). Is q(-9) a prime number? True Let q be ((-108)/243)/((-1)/9). Suppose -6o + 11o - 9489 = qs, 3s = 12. Is o composite? False Let i = 377411 - 147274. Is i a composite number? False Let o(z) = -35z*3 + 12z*2 - 16z - 16. Let u(r) = -r*2 + 3r + 47. Let f be u(-6). Is o(f) composite? False Is (-2 - -5490770) + (-357)/(-391) + 4/46 composite? False Let k(l) = -7l3 - 22l*2 - 5l - 13. Let a(q) = q*3 + q - 1. Let d(g) = -6a(g) - k(g). Is d(9) a composite number? False Let a(c) = 170070c3 + 2c*2 + 49c - 50. Is a(1) a composite number? True Let n be (-2)/((-18)/(-15)(-1)/(-21)). Let u = 1 - 11. Is 24962/n(0 - u/(-4)) composite? False Suppose 181k = 248k - 4224551. Is k prime? False Suppose -44819956 = 270n - 562n. Is n prime? False Let q(g) be the second derivative of 3g5/4 + 13g*4/24 + 3g*3/2 - 31g*2/2 - 16g. Let u(i) be the first derivative of q(i). Is u(-5) prime? True Let w(q) = -307q - 1. Let f be w(-3). Let c = f + -1306. Let s = 1357 + c. Is s composite? False Suppose 47t + 163898 = 50t + 5z, -491789 = -9t + 4z. Is t prime? False Suppose 18 = 19f - 17f. Suppose 5u - 4 = fu. Is ((-4)/(-4) - u) + 147 a prime number? True Let n be (-46)/(160/(-24) + 6). Suppose nu - 3812 = 67u. Is u a composite number? True Let p(j) be the third derivative of j*5/60 - 7j*4/24 - 11j*3/6 + 17j*2. Suppose 4 = -3i - 47. Is p(i) a composite number? False Let x be ((-10)/25)/(-1(-6 + (-3604)/(-600))). Suppose 5u - 5l - 4 = 1, 17 = 2u + 3l. Suppose x = 5p - n - 13, 2n + 56 = up. Is p a composite number? True Suppose -190164 - 7271580 = -48w. Is w prime? True Suppose 58o = 5k + 56o - 783353, 3o = -4k + 626710. Is k composite? True Let z be -3(-12)/126 - 2/7. Suppose -2y = -zy + 6484. Is y/(-6) + (-4)/(-6) prime? True Is (-18)/(-60) + 3514302/60 - 5 a composite number? False Let u = -7928 - -16261. Suppose 8k - u = 18683. Is k prime? False Let m =	{ "pile_set_name": "DM Mathematics" }
.3 (b) -1.4 (c) 10.42 (d) 0.3 a Which is the nearest to 0.7? (a) -0.2 (b) -1.7 (c) -0.06 (d) 3/2 c What is the closest to -4/11 in 1, -1/703, 5? -1/703 What is the nearest to -1 in 4, -0.7, -11.783? -0.7 Which is the closest to 0? (a) 25 (b) -0.5 (c) -2/17 (d) 0.075 (e) -2/13 d What is the nearest to -0.4 in -0.109, -2/7, -0.1, 2/3? -2/7 What is the nearest to -156 in 2/3, 4, -2/197, 3? -2/197 What is the nearest to 244 in -3, -0.2, -0.104? -0.104 Which is the closest to 0? (a) -12/7 (b) 3 (c) 1/20 (d) 1/4 c What is the closest to -2 in -1, -992, 9? -1 What is the nearest to 3 in -0.4, 626/19, -1, -1/2? -0.4 What is the nearest to -5 in 4, 0.1, -0.4, -113? -0.4 What is the closest to 31.5 in -0.3, 1/22, 0.2? 0.2 What is the nearest to -1 in -1/4, 1/12, -0.101, 0.7? -1/4 Which is the nearest to -76? (a) -32/7 (b) 2 (c) -2 (d) -4/3 (e) -4/7 a Which is the closest to 1? (a) 3 (b) 313 (c) -2/13 (d) 4 c Which is the nearest to 3/2? (a) -0.2 (b) 0.2 (c) 1.2 (d) 8 c Which is the closest to 5? (a) 1/4 (b) 1 (c) 317 (d) 3 d Which is the closest to 3? (a) 4 (b) -0.4 (c) 308 (d) 0.1 (e) 14 a What is the closest to 0 in -3/2, 3, -2330? -3/2 What is the nearest to -67 in 3.3, -4, 0? -4 What is the nearest to -0.6 in -7, -2, -1, 2/23? -1 What is the closest to -3 in 54/29, 1/4, 3, -2/11? -2/11 Which is the closest to 21? (a) -2 (b) -0.263 (c) -1 b Which is the closest to 7? (a) -1 (b) -62 (c) 0.1 (d) -0.05 c What is the nearest to 0.1 in 3, 0.8, -0.01, -5? -0.01 Which is the closest to 0.2? (a) 2/29 (b) 0.31 (c) 2/11 (d) -0.5 c Which is the nearest to -0.05? (a) -3 (b) -71 (c) 13 a Which is the closest to -1? (a) 8.4557 (b) -2/3 (c) -0.3 (d) 4/9 (e) -2/7 b Which is the nearest to 2/253? (a) 1 (b) -0.12 (c) 3 b Which is the closest to -7/13? (a) 11/3 (b) 1 (c) 1.9 (d) 0.3 (e) 0 e What is the closest to 1 in 1, -1, -8, 1.9478? 1 What is the closest to 0 in -8, 1, -42? 1 Which is the nearest to -0.1? (a) -0.4 (b) -10 (c) -2/23 c Which is the closest to 6? (a) 2/7 (b) -0.078 (c) -0.4 a What is the closest to -1 in -0.1, 8/5, 7/4, -0.168? -0.168 Which is the closest to -2? (a) -2 (b) 9 (c) -3/230 a Which is the nearest to 3? (a) 13 (b) 77 (c) 0.6 (d) -1/4 c What is the nearest to -7 in 2/9, 0.394, -0.2? -0.2 What is the closest to -1/4 in -4/9, -1/10, 82? -1/10 Which is the nearest to 10.91? (a) 4 (b) 9/2 (c) -0.5 b What is the nearest to 0.065 in -0.35, -5, 1, 3/2? -0.35 What is the nearest to -14 in -0.09, -0.4, 0.19? -0.4 What is the nearest to 0.05 in 1/7, 0.1, -13.7, 7? 0.1 Which is the nearest to -0.1? (a) 1/4 (b) 3 (c) 2/49 (d) 4/9 c What is the closest to 0 in -2/7, -0.04, -147.44? -0.04 Which is the nearest to -11? (a) -0.4 (b) 6/11 (c) 867 (d) 3/4 a Which is the closest to -1.62? (a) -0.2 (b) 0 (c) -65 a What is the closest to 0.9 in -3/7, -74, 2, -2? 2 Which is the closest to -554? (a) 2 (b) -3 (c) 0.4 (d) 12 b Which is the nearest to 24? (a) -71 (b) -1 (c) -0.4 c Which is the nearest to 1? (a) 14 (b) -46/11 (c) -3 c Which is the nearest to 0.77? (a) -5 (b) -461 (c) 3/2 c What is the closest to -31/5 in 0.1, 2/7, 2, 23? 0.1 Which is the closest to -4? (a) -0.4 (b) -4/13 (c) -0.2 a What is the nearest to 2 in -0.27, -2/9, 1/22, 0.1, -1508? 0.1 What is the closest to 0 in 5, -1, -263.8, 0.1? 0.1 What is the closest to -0.2 in 0.3, -2, 1/4, 1/15? 1/15 What is the nearest to 34 in 3, 0.3, -6/11? 3 What is the nearest to 1 in 0.4, -120, 0.2842? 0.4 What is the closest to -0.05 in 33, 0.0336, 2/5? 0.0336 What is the nearest to 0.1 in -0.4, -54/259, 0.5, 5? -54/259 What is the nearest to 1/3 in -1/395, 7, 0.1? 0.1 What is the nearest to 4 in -1/8, 58, 0? 0 Which is the nearest to 2? (a) 0.4 (b) -2/17 (c) -82 (d) 0.03 (e) -0.22 a What is the nearest to 74 in -2, 3, 1/9, 3/5? 3 What is the closest to -2/3 in 1, -0.29, -13, -4? -0.29 Which is the nearest to 2/9? (a) 63 (b) 4/5 (c) -0.02 c Which is the closest to -2/3? (a) 0.3 (b) 5 (c) -55 (d) 1 (e) 14 a Which is the closest to 3? (a) -1418 (b) 0.2 (c) 3/13 (d) 5 d What is the nearest to -7 in 2, 4/13, 0, -3/20? -3/20 Which is the closest to -9? (a) -1/3 (b) -5 (c) -0.2 (d) -0.7 (e) 5/2 b Which is the closest to -0.4? (a) -11052 (b) 3 (c) -5/2 (d) 4 c Which is the nearest to 7? (a) -2/15 (b) -0.4 (c) 25 a What is the closest to 2/13 in 5, -4, -2/3, 1/1422? 1/1422 Which is the nearest to 2/13? (a) -5/6 (b) 1.5 (c) 0.07 c What is the nearest to 1/2 in -0.5, 7, 3, -0.05, -6/11? -0.05 What is the nearest to 0.4 in 2/11, -13, -53, 1? 2/11 Which is the nearest to 0.249? (a) 3 (b) 2/11 (c) 1/4 (d) -172 c Which is the closest to 2/3? (a) -1 (b) 0.2 (c) 3/4 (d) -1118 c Which is the nearest to -63/4031? (a) -4 (b) -3/5 (c) -3 b Which is the closest to 2/9? (a) -18 (b) -1/4 (c) 0 c What is the closest to -5.1 in 2/5, 0.03, -0.2, 26? -0.2 What is the nearest to -3/4 in -3, 0.65, 3/8, -169? 3/8 What is the closest to -0.23 in -3, -4, -1, 0.506? 0.506 Which is the nearest to 9/34249? (a) -1/3 (b) -2 (c) 5 (d) -1/2 a What is the nearest to -0.6 in 0.3, -25/28, -17/7? -25/28 What is the nearest to 12 in 2, -2/5, -0.2, -1/17? 2 Which is the closest to -113/5? (a) 0.7 (b) 0.1 (c) 2 (d) 1 b Which is the nearest to 0.0389? (a) 3 (b) -0.2 (c) -1 (d) 2/47 d What is the nearest to -1 in -2/9, -20308, -0.14? -2/9 Which is the closest to 0? (a) 5 (b) -5/2 (c) -93 (d) 0 d What is the nearest to -11/32 in 0.1, 0.12, -70? 0.1 What is the closest to -1/2 in -0.23, 0, 4, 36/7? -0.23 Which is the nearest to -0.1? (a) 2/13 (b) 870 (c) 0.06 c Which is the nearest to 2? (a) -26/67 (b) 2/7 (c) -4 (d) 4 b Which is the nearest to 16? (a) -4/7 (b) 51 (c) 1/3 c Which is the closest to 1? (a) 629 (b) -6 (c) -1 c Which is the nearest to -5? (a) 1/4 (b) -1.96 (c) 15 (d) 0.4 b Which is the nearest to 7/5? (a) -0.06 (b) 1/3 (c) -2 (d) -0.4 (e) 3/10 b What is the closest to 2 in 1/4, 0, 1/7, -70, 3? 3 Which is the nearest to -236.69? (a) 1/5 (b) -0.5 (c) -2 c Which is the nearest to -2? (a) -60 (b) -1.1 (c) 1 b What is the closest to -337 in 1/6, -2, 116/7? -2 What is the nearest to 5/6 in 0.5, 20, 1? 1 What is the nearest to -218 in 2/7, -5, -1, -0.1, -14? -14 What is the nearest to -5/2 in 0.08, 0.5, 0.1098? 0.08 Which is the nearest to 2? (a) 5 (b) 2190 (c) 4/5 (d) 0 (e) -47 c Which is the nearest to 1? (a) -2/3 (b) 20 (c) -33 (d) 2/7 d Which is the nearest to 3? (a) -3 (b) 1/6 (c) -7 (d) 2/165 b Which is the closest to -2/15? (a) -42 (b) 2 (c) -1/2 (d) 8 (e) 3 c What is the closest to -94 in 0, -0.43, 10, 0.2? -0.43 What is the nearest to 6 in 0.3228, 5/8, -0.1? 5/8 Which is the closest to -6? (a) -0.4 (b) 0.03351 (c) -0.2 a Which is the nearest to -8? (a) 1/11 (b) 1/6 (c) -25/4 (d) -4 c Which is the closest to -3? (a) -3 (b) -31 (c) 1 (d) 9 a What is the nearest to -3 in -41/7, -0.3, -8, 2/3? -0.3 Which is the nearest to -650/7? (a) 0.3 (b) -0.5 (c) -12/5 (d) -2/9 c Which is the nearest to -824? (a) -0.15 (b) 0 (c) -2/3 c What is the nearest to -0.08 in -63, -2, 34? -2 What is the closest to -2/9 in -75, -6, -5, 1/8? 1/8 What is the nearest to 1/11 in -3, -1.12, 0.2, 1, 2? 0.2 What is the nearest to -2/5 in -3, 11, -7/12? -7/12 What is the closest to -0.05 in -2/7, -2/13, 0.02, -7.3? 0.02 What is the closest to -7 in -0.4, 0, 2/7, 108? -0.4 What is the closest to -0.12 in 2/11, 405, -0.4? -0.4 Which is the nearest to -11? (a) -56.1 (b) -2 (c) -3 c Which is the closest to 3/11? (a) -0.07 (b) -0.04 (c) -4/9 (d) -8 b What is the nearest to 1/4 in 0, -40/13, 2, -3? 0 What is the closest to -2 in -0.06, -8, -3/8? -3/8 What is the nearest to -1/3 in -3/7, -1/6, 1/3, -2/19, 0.11? -3/7 What is the closest to 8 in 19, 0, 35/13? 35/13 Which is the nearest to -70? (a) 0 (b) 2/5 (c) 1/578 (d) 2 a What is the nearest to -1 in -2/5, -8, 0.06, -1/2? -1/2 Which is the closest to -1? (a) -0.1 (b) 2 (c) 0.04 (d) 25 (e) 0.4 a What is the closest to -6 in 1/3, -6/5, 2, -5, 3? -5 What is the nearest to 11 in -0.59, 4, 0.015? 4 Which is the nearest to 28/179? (a) -6 (b) 0 (c) 5 (d) 2/13 (e) -9 d What is the nearest t	{ "pile_set_name": "DM Mathematics" }
m + (-m3 - 3m*3 + 6m*3)(-2m + 3m + m). 19m4 Expand (-2l + 0 - 3 + 5)(6l + 6 - 6). -12l2 + 12l Expand -2s2 + 7s*2 - 2s*2 + (-2s + 3s + 0s)(-6s + s + 3s) - 2s*2 + 6s*2 - 3s*2. 2s*2 Expand 3 - 2n - 3 + (3 - 5 - 2)(-5 + 5 + 2n). -10n Expand 0t5 + t5 + t*5 + (3 - 3 + 1)(-3t5 + t5 + 4t*5) - 28t*3 + 28t*3 + 18t*5 + (-3t + 2t + 3t)(-4t*3 - 2t*4 + 4t*3). 18t*5 Expand 0r*5 - 4r*5 + 0r*5 + (0r - r + 4r)(r*3 - 4r*3 + 4r*3)(-3r + 0r + 4r). -r5 Expand 4d*2 - 4d*2 + 2d*4 + (5d*2 - 4d*2 + 0d*2)(5d + d - 3d)(-3d + d - d). -7d4 Expand (-2x + 0x + 4 + x)(2x - 4x - 2x). 4x*2 - 16x Expand -3w5 + 3w*5 + 2w5 + (w5 + 3w - 3w)(-3 + 5 - 5). -w5 Expand (1 + 3 - 6)(-2b - 2b*2 + 2b) + b*2 + 0b2 + b2 - 4b2 + 3b*2 + 0b*2 + (-13b + b - 5b)(0b + 0b - 2b) - 2b + b*2 + 2b. 40b2 Expand ((0 + 1 + 1)(-3 - 1 + 1) - 1 + 1 - 2)(-3h + 0h + h). 16h Expand ((-3v + 2v + 2v)(-3 + 3 + 3) - v - v + 0v)(2v3 - 2v3 - v4 + (-3v3 + 0v3 + v3)(-1 - 5v + 1)). 9v5 Expand (m + 0 + 0 + 2 - 2 + m + (2m + 0 + 0)(1 - 2 + 3) + m + 0 + 0 + 3 - 3 - 2m)(-7 - 23 + 7). -115m Expand (3 + 2 - 7)(-1 + 1 + w) + 1136 - 95w - 1136. -97w Expand (5x + 2x - 6x)(-3 + 2 + 0) + (0 + 3 - 5)(0x - 8x + 4x). 7x Expand (0 + 5n + 0)(3 + 3 - 4) + (0n + 0n + n)(-4 + 2 + 0). 8n Expand 0 - i + 0 + (0 - 1 + 2)(-5i + 0i + 3i) + 5i - 3i - 7i. -8i Expand (-2 + 3 + 1)(-3 + 3 + 9q). 18q Expand -22s*5 - 39s + 39s + (0s*4 + 0s*4 + 2s*4)(-3s + s + 4s). -18s5 Expand (-3k + 3k + k)(k + 2k3 - k)(1 + 1 + 2)(0k + k + 0k). 8k*5 Expand 0v*2 + 5v2 - v2 - v - v*2 + v + (0v2 + v2 - 2v2)(3 - 3 - 2) - 3v2 + 6v2 - v2. 7v2 Expand (3 - 6 + 0)(-3 + 1 + 3)(4p4 + p2 - p*2) + (-4p*3 + 5p*3 + 0p*3)(-4 + 4 + 2p). -10p*4 Expand (-3x*2 + 2x*2 + 3x*2)(3x3 + 3x*3 - 3x*3) + (4x*3 + 0x*3 - 3x*3)(x2 - x2 - 3x2). 3x*5 Expand (-4 + 3 + 3)(181 - 3m2 - 180 + 7m + m*2). -4m*2 + 14m + 2 Expand -w - w + 3w + (-4 + 0 + 3)(0w - 2w + w) - 3 + 3w - 2w + 5 + (0w - w - w)(0 + 1 - 2). 5w + 2 Expand (-4a - 4a - 10a)(-3 + 4a + 7 - 3). -72a2 - 18a Expand (2 + 1 - 1)(249 - 17g - 249). -34g Expand (-2g + 5g - g)(-g + 0 + 0)(8g + 2g - 4g). -12g3 Expand (17 - 13 - 15)(2 - 2 - t*2). 11t*2 Expand (-f + 4f - 4f)((1 + 1 - 5)(-3f3 + f3 + 4f3) + 40f*3 - 16f*3 - 15f*3). -3f*4 Expand (-n + 0n - n)(314n*2 + 2n*4 - 314n*2 + 2n). -4n5 - 4n*2 Expand (0s*2 + 0s*2 + 2s*3)(2 + 18s - 31s + 4s). -18s*4 + 4s*3 Expand (2 + 0 - 1 + (6 - 3 - 2)(1 - 1 - 2))(0i + 3i - i)(-1 + 4 - 2). -2i Expand (4s*2 + 4s*2 + 0s*2)(-5 + 3 + 0)(-4s + 8 - s*2 - 8). 16s*4 + 64s*3 Expand (-5a + 5a + 8a*2)(a*3 - 2a*3 + 2a*3). 8a*5 Expand (232 - 232 - 6q)(-4 + 3 - 1) + (2 - 2 - 2q)(-2 + 6 - 3) + 0q + 0q - 2q. 8q Expand -n3 - 3n*3 + 2n*3 + (2n - 1 + 1)(-5 + 2 + 2)(1 + 4n2 - 1). -10n*3 Expand (0 - 1 + 3)(2 - 2v - 2 + (4 - 1 - 1)(2v + 4v - 4v) - 3v + 4 + 6v - 2v). 6v + 8 Expand -387 + 387 + 125z*4 + (0z*2 - 2z*2 + 0z*2)(-2z2 + z2 + 3z*2). 121z*4 Expand (4 - 1 - 4)(0 + 0 - 3y)(4 - y - 4). -3y2 Expand (0j - 2j2 - 3j + 5j)(-4j3 - 10j*3 + 5j*3). 18j*5 - 18j*4 Expand (0g2 + g2 + 3g2)((g - 3 + 3)(-5 + 4 - 1) + 3g + 0g + 0g) - 4g3 + 4g3 - g3. 3g3 Expand ((0 - 2w + 0)(1 - 1 + 2w*2) - 2w3 + w3 - w*3)(3w - 2w - 2w). 6w*4 Expand (-31c - 2 + 2)(-2 - 1 + 2). 31c Expand (6 + 9 + 0)(3 + 0 - 2)(1 + 2 - 4)(1 - 1 - y). 15y Expand (-4o + o + 0o)(-7o*2 + 6o*2 + 2o*2). -3o*3 Expand (1 - 2s - 1)(-3s + 2s + 3s)(0s - 4s + 2s + 2). 8s3 - 8s*2 Expand (-2 + 3 + 4)(-3t3 + 5t*3 + 0t*3). 10t*3 Expand (15 - 15 + 12a + (4a - 3a + 0a)(3 - 2 - 3))(-4a*2 + 2a2 + a2). -10a3 Expand 26r*2 - 2r - r*3 - 26r*2 + (-2r*2 - 4 + 4)(r + 0 + 0). -3r3 - 2r Expand (4r - 3r + 2r)(-12 - 2 - 10). -72r Expand -5p*3 + 3p*5 + 5p*3 + (4p*4 + 0p*4 - 2p*4)(2p - 2p + p). 5p5 Expand ((0s + 0s + 2s*2)(-2s + 0 + 0) - s3 + 0s*3 + 0s*3)(3s2 - 9s*2 + 2s*2). 20s*5 Expand 0a + a + 2a + 4a - 2a + 0a + (a - 2a + 0a)(1 - 2 - 1) - 1 + 1 - 3a + (-2a - a + 4a)(-1 + 0 - 1). 2a Expand (-1 + 1 - 1)(-2h + 2h + 2h)(2 - 1 + 2). -6h Expand ((0 - 2 + 0)(-5 + 2 + 1) - 1 - 3 + 2 - 5 + 4 + 3 - 3 + 2 + 2 - 2 + 5 - 1 - 2 + 4 + 1 + 2 + 1 - 5)(-j + j2 + j) + 3 - j2 - 3. 7j2 Expand (-1 - 6 + 3)(-2w - 2w - 3w). 28w Expand (-p - 2p + 4p)(-2 + 2 - p) + (2p - 2p - 2p)(3p - p - 3p) + 3p*2 - 2p2 + p2. 3p2 Expand -g2 - g2 + 3g*2 - 6g*2 + 4 - 4 + (2g - 3g - g)(0 - 2g + 0). -g2 Expand (-11 - 4 - 1)(-3 - 1 + 2)(-u3 - u3 + 0u*3). -64u*3 Expand (c + 2c + 6c)(c - 4c + 4c + 2c + 4c - 4c + (-c - 2 + 2)(-6 + 4 + 3) + 2c + 1 - 1 + 1 - 1 + c). 45c*2 Expand -8x*2 + 8x*2 - 4x*3 + (3x*2 + 0x + 0x)(0x - 3x + 4x). -x3 Expand -4x*4 + 5x*4 - 2x*4 + (5x3 - x3 - 3x3)(-3 - 2x + 3) - x + x - 2x4 + x2 + 2x2 + 11x*4 - 17x*4. -11x*4 + 3x*2 Expand -12m*3 - 4 + 14m*3 + 3 + (-3m*2 + 3m2 - m2)(-m + m - m). 3m*3 - 1 Expand 3h*3 + 0h*3 - 5h*3 - 5h*3 + 4h - 4h - 3h2 + h3 + 3h2 + (-1 + 1 - 1)(-h2 + h2 + 2h3) - 4h*3 + 2h*3 + 0h*3. -10h*3 Expand (-2p*2 + 2p2 + p3)(0 - 2p + 0) + 12p4 + 23p*4 + 15p*4. 48p*4 Expand 2h*3 + 9h*3 - 3h*3 + (5h*2 + 5h*2 - 3h*2)(2 - 2 - h). h*3 Expand (0n*2 - 3n*2 + 4n*2)(0n - 4n - n) + n*2 + 4n3 - n2 - n*3 + 0n3 - n3. -3n3 Expand (i5 + 1 + 3i*4 - 3i*4)(-4 + 3 - 4). -5i5 - 5 Expand 3 - 3 + b4 + (-5 - 8b*2 + 6b*2 + 6)(-b*2 + 0b*2 + 2b2). -b4 + b*2 Expand (-3 + 2m + 3)(0m + 4m - 3m) + (2m - 1 + 1)(-4m - 2m + 7m) + 4m*2 - 2m2 - m2. 5m2 Expand (-2x*2 - 3 + 3)(-x - 5 + 5 - x - 5x + 4x + 5x - x - 6x + (2x - x - 2x)(-2 + 1 + 3) + x + 2x - x + 4x - 3x - 2x). 12x*3 Expand (-10a*2 + 0a2 - a2)(-2a - a + 2a)(a + 1 - 1). 11a4 Expand (0p + 2p - p)(-p*2 + 3 + 0 - 1 + 2p*2 - 1 + 1 + (-3 + 0 + 2)(p*2 + 0p*2 - 2p*2)). 2p*3 + 2p Expand (-4x2 + 4x*2 - 2x*2)(-1 + 1 - 2x2) + 3x4 - x4 - 3x4 + (-2x + 0 + 0)(-x3 - 2x3 + x3) + (-2x2 + 0 + 0)(-x*2 + 2 - 2). 9x*4 Expand (5j*4 + 2j*4 - 6j*4)(j + 0 + 0) + (2j2 - 2 + 2)(-2j + 2j*3 + 2j) + 2j5 - j5 + 2j*5 - 2j + 2j - 2j5 - j - j5 + j. 5j5 Expand (5 - 4 + 0)(16 - 16 - 8r) + 3r - r - r. -7r Expand -m4 + 6m*4 - 4m4 + (m2 + 2m2 - 4m*2)(-4m2 + m2 + 2m*2). 2m*4 Expand (-8v*4 + 5v*4 + 5v*3 - 4v*4)(-4v + 3v + 2v). -7v*5 + 5v*4 Expand (c + 2c - 4c - 6c*2)(3c3 + 3c*3 - 4c*3). -12c*5 - 2c*4 Expand (6 - 33 + 18)(-2n2 - 3 + 3). 18n*2 Expand ((3 - 5 + 0)(0 + 1 - 3) + 0 + 1 + 0)(4p - 4p4 - 4p). -20p4 Expand (-4 + 0 - 4)(3i - 4 + 4). -24i Expand (-1 + 2z2 + 1 + 2 - 2 + z2 + (4z - 4z + z)(4 - 4 + 2z) + (2 + 4 - 5)(2z2 + 0z2 - z2))(4z + 5 - 5). 24z3 Expand -3p*2 + 3 - 1 + 4p*2 + (-p - p + 0p)(2p - 3p + 2p). -p*2 + 2 Expand (-5k*2 + 2k*2 + 4k*2)(18k + 106 - 106). 18k*3 Expand (17k*2 - 2k*3 + 14k*2 - 5k - 32k2)(-k*2 + 1 - 1). 2k5 + k4 + 5k3 Expand -99n + 99n + 36n*3 + (3 - 2n - 3)(-n2 - 3 + 3) - n + n + 3n*3. 41n*3 Expand 5 - 5 + 6l + (0 + 0 + 1)(-1 - 2l + 1) + 6 - 6 + l. 5l Expand (-4 + 0 - 1)(0a - 4a + 2a)(-2 - 1 + 2). -10a Expand (-d + 0d + 2d)(-4 + 3 + 0) + 0d - 2d - 5d. -8d Expand -3s + 3s + 2s2 + (3 - 3 + s)(3s + s - 2s). 4s2 Expand (19y - 13y + 26y)(2y - 3y + 2y). 32y2 Expand (-3w5 - w5 + 2w5)(21 + 0 - 1) + 3w - 3w - 2w5 + (6w*2 - 3w*2 - 4w*2)(-w2 + w2 - w*3). -41w*5 Expand (i + 0i - 2i)(0 + 1 + 1 + (1 - 5 + 2)*(5 - 1 - 2) - 4 + 1 + 1 + 4	{ "pile_set_name": "DM Mathematics" }
et i(f) = 205488f. Let n(u) = 2u*2. What is i(n(x))? 410976x*2 Let h(j) = 17j. Let l(q) = 4q. Let a = 31 + -33. Let p(u) = u. Let m(t) = ap(t) + l(t). Determine h(m(f)). 34f Let u(g) = -g. Let j(p) be the first derivative of 77p*2/2 + 9p - 429. Give u(j(t)). -77t - 9 Let o(d) be the second derivative of d3/6 + 6d - 9. Let g(b) = -25b2 - 23b*2 + 4b*2. Give g(o(y)). -44y*2 Let y(h) = 868h - 9. Let g(r) = -27r2. Determine y(g(i)). -23436i*2 - 9 Suppose -2z + 358 = p + 132, p - 3z - 236 = 0. Let c(s) = 230s - ps - 2s*2. Let m(r) = 3r. What is c(m(k))? -18k2 Let f(r) = 4r - 150. Let q(g) = -6g. Calculate f(q(c)). -24c - 150 Let g(d) = -d*2. Let j(o) = 145o + 4 - 101o + 46o - 2 + 0. Determine g(j(v)). -8100v2 - 360v - 4 Let w(t) be the second derivative of 0t3 + 0t*2 + 2t + 0 - 1/12t4. Let z(o) be the first derivative of -14o*3/3 + 144. What is w(z(l))? -196l*4 Let q(a) = -5 + a + 5 + 6a. Let x(t) = -50t. Let m(s) = 15q(s) + 2x(s). Let o(d) = d2. Calculate o(m(w)). 25w*2 Let f(p) = 69p - 137p + 71p. Let r(m) = -5m2. Determine f(r(g)). -15g*2 Let a(d) = 5d*2. Let g(o) = 60o*2 - 110o - 110. Let s(u) = -u - 1. Let k(f) = 2g(f) - 220s(f). What is a(k(w))? 72000w4 Let k(j) = -2887 + 2887 - 6j*2. Let g(p) = 1. Let q(a) = 1. Let o(u) = 3g(u) - q(u). Let y(s) = -s + 5. Let b(v) = 5o(v) - 2y(v). Determine b(k(n)). -12n2 Let z(d) = 3d. Let k(h) = -h. Let m(q) = -8k(q) - 3z(q). Let p(r) = -r*2 - 1. Let g(a) = 50a*2 + 25. Let l(y) = g(y) + 25p(y). What is m(l(s))? -25s2 Let k(c) = 10c - 3c + 29c*2 - 19c*2. Let z(l) = 7l*2 + 5l. Let b(q) = 5k(q) - 7z(q). Let d(y) = -10y. Determine d(b(r)). -10r*2 Let a(y) = -7y*2 - 1. Let p(u) = -19u*2 + 42u - 14. Let k(f) = 10f2 - 24f + 8. Let l(b) = 7k(b) + 4p(b). Determine a(l(w)). -252w4 - 1 Let c(w) = w. Let n(p) = -98p*2 + 2p - 4. Let v(g) = 196g2 - 5g + 10. Let i(x) = -5n(x) - 2v(x). Determine c(i(d)). 98d2 Let j(s) = 200s. Let c(z) = 9z2 + 5z. Let v(k) = -11k2 - 6k. Let m(f) = -6c(f) - 5v(f). Give j(m(o)). 200o2 Let z(n) = -n2 - 9n - 6. Let f be z(-8). Let c(t) = 2 - 11t2 - f + 15t*2. Let o(j) be the first derivative of 3j*2/2 + 2. What is c(o(x))? 36x2 Let p(w) be the second derivative of w3/3 - 8w. Let o(a) be the third derivative of -a5/30 + 3a*2. Give o(p(q)). -8q2 Let y(d) = -d2 + 0 + 6 - 2d - 5 + d3. Let p be y(2). Let n(v) = -6v - v + p - 1. Let x(q) = q. What is x(n(l))? -7l Let t(u) be the second derivative of -u3/6 - u - 27. Let m(g) = -6g*2. Give m(t(y)). -6y2 Let n(i) be the third derivative of -i5/20 + 3i2. Suppose -13 - 5 = -2h. Let t(o) = 10o - 29o + 13o + ho. Calculate n(t(s)). -27s2 Let w(u) = -u. Let g be 0/((-9)/(-3) - 1). Suppose -p = -gp - 2. Let o(c) = 3c + 0c - pc. Determine o(w(l)). -l Let m(f) = -2. Let l(y) = -y + 9. Let h(p) = 3p - 27. Let a(n) = 2h(n) + 7l(n). Let b(x) = -2a(x) - 9m(x). Let d(w) = 5w2. Calculate d(b(s)). 20s*2 Let x(f) = -36f - 2. Let p(r) be the second derivative of -r*4/6 + 2r - 99. Give p(x(t)). -2592t2 - 288t - 8 Let o(f) = -2825f + 1. Let i(c) = 3c. Give i(o(j)). -8475j + 3 Let u(a) = 3a. Let l(z) = -4z. Let k(w) = 2l(w) + 3u(w). Let r(s) be the first derivative of -5s*2 - 4. Determine k(r(f)). -10f Let t(d) = 4d2 + 14014d + 2. Let h(q) = -8q. Give t(h(k)). 256k*2 - 112112k + 2 Let d(j) = 2j. Let w(y) = -42y - 28773. What is d(w(s))? -84s - 57546 Let w(s) = 25 + 23 - 100 + 52 + 3s. Let p(j) = -191j. What is p(w(y))? -573y Let q(g) = 10g - 5g + 4g - 3g. Let p(w) = -4w2 + 3. What is q(p(x))? -24x*2 + 18 Let m(p) = -24p. Let v(g) = 98g - 14. Give m(v(o)). -2352o + 336 Suppose -3r - 14 = -26. Let v(j) = 3j - 5j + 3j - rj. Let g(q) = -3q. Calculate v(g(k)). 9k Let w(q) = q2. Let c(r) = -37556r. Calculate c(w(k)). -37556k2 Let i be (4/7)/(14/49). Let f(d) = 3d + 0d - id. Let h(b) = -20b. Calculate h(f(m)). -20m Let c(z) = 177z2. Let h(u) = 3u - 3. What is h(c(l))? 531l2 - 3 Let k(n) = 17n*2. Let p = -6 + 8. Suppose -pv - 12 = -3a + 2a, 5v = 5a - 35. Let o(w) = -w*a + 0w - 4w + 4w. Give o(k(z)). -289z4 Let z(g) = g2. Let v(r) be the first derivative of r5/20 - r3 + 10. Let t(y) be the third derivative of v(y). Give t(z(a)). 6a2 Let s(x) = x2. Let r(b) = 1886b2 + 2b + 1. What is r(s(h))? 1886h4 + 2h*2 + 1 Let q(h) = -24h + 6h + 8h + 12h + 13h. Let i(p) = -32p2. Give i(q(s)). -7200s*2 Let l(q) = -2q - 1. Let z(g) = -2g2 + 16g + 8. Let o(n) = 8l(n) + z(n). Let m(y) = 1373y. Give m(o(f)). -2746f2 Let a(q) = q2. Let c(h) = 5 - 2 + 43h - 3. Give c(a(g)). 43g2 Let w(z) be the second derivative of 7z*4/12 - 2z. Let r(t) = 23t2 + 4. Let m(f) = 6f*2 + 1. Let i(y) = -4m(y) + r(y). What is i(w(d))? -49d4 Let c(u) be the second derivative of 3u*4/4 + 216u. Let o(t) be the third derivative of t4/12 - t2. What is o(c(m))? 18m2 Let z(v) = -19 - 17 + 5v + 36. Let y(k) = -k + 1. Let u(m) = -7m + 6. Let w(o) = -u(o) + 6y(o). What is w(z(g))? 5g Let f(b) be the first derivative of -b2 - 1. Let p(i) be the third derivative of -i4/3 - 1052i*2. Calculate f(p(r)). 16r Let a(b) = -b*2. Let r(p) = -90p. Let v(j) = 89j. Let l(c) = -2r(c) - 3v(c). Determine a(l(m)). -7569m2 Let n(r) = -r2. Let t = 50 + -25. Let a(h) = -3h2 - 12 - th*2 + 11 + 5h*2. Calculate a(n(q)). -23q*4 - 1 Let y(f) = -2f - 8. Let i(w) = w + 3. Let d(v) = -10i(v) - 3y(v). Let n(q) = q*2. Determine n(d(a)). 16a*2 + 48a + 36 Let p(n) = 2n. Let q(c) = 483c - 678c + 457c. Give q(p(g)). 524g Let q(k) be the first derivative of k3/3 + 115. Let w(j) = -73j*2. Determine q(w(i)). 5329i*4 Let i(j) = -j. Let x(u) = u. Let b(w) = i(w) + 2x(w). Suppose -y - 2c + 7 = 0, 0 = 3y - 4c - 14 - 7. Let o(d) = -12d + yd + 9d. Calculate o(b(q)). 4q Let c(d) = 4d. Let m(y) be the second derivative of -13y4/4 - 2y - 28. Calculate c(m(w)). -156w2 Let l(a) be the third derivative of -a5/60 + 2a*2. Let c(v) = -69v*2 - 34. Let s(h) = 23h*2 + 12. Let q(n) = 6c(n) + 17s(n). Determine l(q(d)). -529d4 Let p(j) be the second derivative of j3/3 + 2j2 + j. Let n be p(0). Let b(a) = -1 + 11a - n + 5. Let z(u) = -2u. Calculate z(b(q)). -22q Let h(b) = 19b - 21b + 31b. Let i(f) be the second derivative of -f3/3 + 3f. Calculate h(i(o)). -58o Let y(c) = -13c. Let p(r) be the third derivative of -r5/30 - r2 + 73. Calculate p(y(u)). -338u2 Let w(p) be the first derivative of -p6/360 + 23p*3/3 - 6. Let b(c) be the third derivative of w(c). Let j(z) = -25z*2. Give b(j(m)). -625m4 Let q(w) be the third derivative of w5/60 - w2. Let b(t) be the third derivative of -t4/2 - 21t2 - 2t - 18. Determine b(q(u)). -12u2 Let k(l) = 110117l. Let v(m) = 28m. Calculate v(k(n)). 3083276n Let l(s) = -6s. Let r be 6/(-2)-1-1. Let b be (-1)/(r/91). Let a(c) = b - 3c2 + 0c*2 - 3. Determine a(l(q)). -108q*2 Let i(t) = -3t. Let s(y) be the third derivative of y*5/15 - 5y*4/24 + 428y*2. What is s(i(w))? 36w*2 + 15w Let k(y) = -y*2. Let q(i) = 99952i*2 - 2. Give q(k(d)). 99952d*4 - 2 Let i(o) = -8o. Let k(j) = 4j2. Suppose h = -5y - 17, 2h = 2y - 4y - 10. Let v(d) = d2. Let c(b) = hk(b) + 7v(b). What is i(c(u))? 8u*2 Let b(r) = 182r - 2. Let j(u) = -528u. Give j(b(l)). -96096l + 1056 Let o(k) = -5k. Let d(n) = 27n. Let i(f) = -4d(f) - 22o(f). Let s(y) = -y - 1. Let b(g) = g*2 - 6g - 6. Let c(x) = -b(x) + 6s(x). Give i(c(r)). -2r*2 Let x(g) = 3g. Let y be ((-72)/84)/(2/(-14)). Let l(t) = 11t2 + 5. Let s(d) = 12d*2 + 6. Let w(o) = yl(o) - 5s(o). What is x(w(r))? 18r*2 Let s(j) = 10j + 2 - 2 - 7j. Let p(d) = 16d. Let g(o) = -4p(o) + 22s(o). Let l(q) = 19q. Calculate g(l(b)). 38b Let p(b) = -16 + 4b2 + 16 - 5b*2. Let k(o) = -6o*2 + 8o - 8. Let h(f) = f*2 - f + 1. Let d(x) = -24h(x) - 3k(x). Give p(d(w)). -36w*4 Let u(h) = -22h*2. Let b(j) = -166j*2 + 84j*2 + 81j*2. Calculate u(b(p)). -22p*4 Let i(o) = -14161o. Let l(c)	{ "pile_set_name": "DM Mathematics" }
ue Suppose 4d - 465 = -65. Is 10 a factor of d? True Let w(x) = -8x - 11. Let d(i) = 9i + 12. Let q(j) = -5d(j) - 6w(j). Let v be q(-4). Is 28(v/8)/(-3) a multiple of 3? False Suppose 2r + 0l = 4l + 128, 3l - 245 = -4r. Let c = -31 + r. Does 10 divide c? False Let a(v) be the second derivative of -v3/3 - v2 + v. Let b be a(-3). Suppose -br + o + 104 = 3o, -r + 26 = -2o. Does 13 divide r? True Suppose y = -4i - 15, 2y - 2i = y + 15. Suppose d - s = 6, 28 = 4d - 0d - ys. Suppose -f - 5w = f - 70, -df = 4w - 72. Is f a multiple of 20? True Let c be 0(0 + 2/4). Suppose -p + 5x - 18 = 0, 2p + cp = -4x - 92. Let o = p + 56. Is o a multiple of 18? True Suppose 0 = 5c + 4 - 109. Is 3 a factor of c? True Suppose -b = -21 - 15. Does 9 divide b? True Let h(t) = t2 - 8t + 6. Let q be h(7). Let c be 93((-2 - -2) + q). Is 4 a factor of 3/12 - c/12? True Let r(u) = -u + 11. Does 2 divide r(7)? True Suppose -3p + 4p - 2 = -r, 0 = 4r + 2p - 18. Suppose 5b = 33 + r. Is b a multiple of 6? False Suppose -4i + 2o - 1 = -o, -3i - 3o = -15. Does 12 divide 35 - i(-6)/4? False Let m = -2 - -4. Suppose -4d = 2g - 16, 2d - 2g = 3g - 4. Suppose 96 = 2l + 2x, -242 = -ml - 3l - dx. Is l a multiple of 20? False Let s be ((-86)/(-6))/(4/12). Suppose s = 4t - 149. Suppose 32 = 4a - t. Does 10 divide a? True Suppose -x = 4b + 5, 4x - 3b = -0b + 75. Is x a multiple of 9? False Suppose -5t = -l - 417, t + 5l = 3l + 90. Does 12 divide t? True Let u = 80 - -4. Does 5 divide u? False Suppose 4m + 10 = 50. Is 5 a factor of m? True Let j = 192 - 120. Is 10 a factor of j? False Let x = 249 + -127. Does 17 divide x? False Suppose 0 = 2t - 44 - 0. Suppose w = t + 18. Is w a multiple of 10? True Suppose -2o = -0o - 3k - 54, 0 = 2o - k - 46. Does 7 divide o? True Let a = -23 - -34. Does 8 divide a? False Suppose 5c + 2 = 37. Is 18 a factor of (c - 8)/((-2)/116)? False Suppose -27 + 187 = 3a - 2c, -3a + 172 = c. Suppose -2v - 2h - 18 = -6v, -4v - 3 = 5h. Suppose -a = -i - vi. Is i a multiple of 14? True Suppose 3x = y - 2x - 1, -4y - 4x + 28 = 0. Is 3 a factor of y? True Let r(w) = 10w + 8. Let x(h) = 3h + 3. Let a(z) = 4r(z) - 11x(z). Suppose -4 = -v - v. Is a(v) a multiple of 12? False Let m = -16 - -51. Is (8/10)/(2/m) a multiple of 3? False Suppose 0 = -z - 4c + 4, -4z + c + 37 = 4. Is 6 a factor of z? False Let b(l) = -l + 6. Suppose -4h + 3y - 3 = 1, 2h - 5y = -16. Suppose 0 = hp - 6p. Is 6 a factor of b(p)? True Does 18 divide 59 + (-4 - 0) - -4? False Let k(t) = 580t. Let a be k(-3). Is a/(-35) - (-4)/14 a multiple of 20? False Let h = -99 - -37. Is (-5 - h)/(3/2) a multiple of 27? False Let p(v) = -v2 - 7v + 6. Let l be 4/(-2)10/4. Is 4 a factor of p(l)? True Suppose 0 = 2g - 5 + 1. Suppose gu = -2u - 104. Let m = u + 42. Is 7 a factor of m? False Let b be ((-1)/(-2))/(4/(-16)). Is b - (-2 + 2) - -7 a multiple of 4? False Let k(x) = -2x3 - 3x*2 + 13x + 7. Let s(t) = t*3 + 2t*2 - 6t - 3. Let m(i) = -2k(i) - 5s(i). Is 12 a factor of m(-6)? False Suppose 2b + 4 = 4b. Suppose -30 = bp - 108. Is p a multiple of 18? False Let j be (-1 - 0)/((-4)/(-28)). Let a = -46 - j. Let y = a - -73. Is 17 a factor of y? True Suppose -13 = -5h + 7. Suppose -88 = i - 3i + 2n, 224 = 5i - hn. Is 14 a factor of i? False Let w be (-2 + 1)(-1 - (-3 - -2)). Let j be 1 + -1(-8)/(-2). Is 12 a factor of w + 36 - (6 + j)? False Suppose 4z = 6z + 2c + 50, 2z + 4c + 40 = 0. Let h = -18 - z. Suppose -36 = -3d + h. Is d a multiple of 16? True Let q(b) = b*2 - b - 3. Does 3 divide q(-2)? True Let z be (2/4)/(3/18). Suppose -zw = -6, 0 = 5n + 5w - 29 - 16. Is n a multiple of 6? False Suppose -3c + 9c = 318. Is 17 a factor of c? False Suppose 13 = 2h + 3. Is h a multiple of 5? True Suppose 2v - v - 58 = 0. Suppose 5a - v = 2. Is 9 a factor of a? False Suppose 13 = -4q - 8f + 3f, 4f = -2q - 14. Suppose p - qp = -6. Suppose 2l = 10, -pu + 2l + 0l = -44. Is 10 a factor of u? False Let p(x) be the first derivative of x4/4 + 7x*3/3 - 4x*2 + 4x - 2. Is 24 a factor of p(-7)? False Let b = 30 + 2. Does 25 divide b? False Let q = -17 + 14. Is 12 a factor of q/((-3)/1322)? False Let f(p) = 4p - 81. Is f(24) a multiple of 4? False Let s = 26 - 19. Suppose -2 = -3y + s. Does 3 divide y? True Let i = 305 + -218. Let r be i + (0 + -2)/(-2). Suppose -3s - r = -7s. Is 11 a factor of s? True Let l = -310 + 215. Let v = 43 - 109. Let n = v - l. Is n a multiple of 10? False Let y = -70 - -134. Suppose 2u - y = -2u. Does 8 divide u? True Let o be 110/6 + (-12)/(-18). Let c = o + -13. Does 6 divide c? True Suppose -3m + 5f - 2f + 12 = 0, 3f + 5 = -4m. Let d be 2/(-4)(m - 73). Let v = d - 14. Does 10 divide v? False Let v be 0/((-13)/11 - (-4)/22). Suppose 4u + 7 + 15 = 2d, 3d - 12 = -u. Let b = v - u. Is 3 a factor of b? True Suppose -4f - 180 = -6f. Does 29 divide f? False Let u be 159 + (2 + 1)/3. Suppose 3q + 4b = -0q + 121, -4q - 4b + u = 0. Does 14 divide q? False Is (2/(-4))/(4/(-1352)) a multiple of 49? False Suppose 2f - 21 = 5f. Let o = f - -15. Is 8 a factor of o? True Suppose -72 = -o - o + 4h, -235 = -5o - h. Is 29 a factor of o? False Suppose -i + 4c = -176, 3i + i - 5c = 715. Is 36 a factor of i? True Let b(r) = 3r + 8. Let k be b(-10). Suppose -3i + 4i = 45. Let n = i + k. Does 19 divide n? False Suppose -c = -5u - 6c - 15, -2c + 18 = -2u. Does 12 divide ((-4)/u)/(4/78)? False Let g(c) = c3 + 8c*2 - 10c + 3. Let p be g(-9). Is 5 a factor of 6/((-9)/p - -1)? False Let d = 18 - 13. Suppose 0k + 16 = 2k. Suppose -3p = dw + 2p - 35, 4p = 2w - k. Is 6 a factor of w? True Let h = -5 + 8. Let c(g) = -g2 + hg - 7 + 2g + 3g. Does 8 divide c(5)? True Suppose 4l = -4c + 60, l + 0 = -1. Suppose -2j = 2h - c, 0 = -2h - 3 - 1. Is j a multiple of 9? False Let d(x) = -28x. Suppose -4h - 2a + 14 = 0, -4h + a = -20 + 3. Let z be (0 + 2)(-2)/h. Is d(z) a multiple of 14? True Suppose 4o - 3o = -6. Let j = 11 + o. Suppose -10 = jn - 75. Is 5 a factor of n? False Let n = -3 + 12. Let z(k) = 3k + 7. Let o be z(n). Suppose -g + 0g = -o. Does 13 divide g? False Let r(i) = -8i + 3. Let z be r(-6). Suppose z = c - 2h + 5h, c + 2h = 53. Does 15 divide c? False Let b be (-30)/(-9) - 16/12. Suppose 2k + 2k = 12. Suppose bq - kq + 6 = 0. Is 3 a factor of q? True Let q = 14 - 0. Is q a multiple of 14? True Let c(g) be the second derivative of g3/3 - g2/2 - g. Let o be c(-2). Let u = 8 + o. Does 3 divide u? True Is (672/(-4))/(4/(-6)) a multiple of 18? True Suppose o + 6 = -o. Let m(z) = -z3 - 8z*2 - 7z - 9. Let q be m(-7). Is 16 a factor of (-47)/(-1) - q/o? False Let y = 85 - 23. Is y a multiple of 16? False Suppose -3x = -0x + m - 9, -x = m - 3. Suppose r + 52 = xr. Does 16 divide r? False Let q(f) = -f - 1 + 23f*2 + f. Does 11 divide q(1)? True Suppose -17 = -5p - 2. Suppose 0 = -b + p. Suppose -2j = bj - 25. Is j a multiple of 3? False Let k(s) = 5s3 + 5s*2 + 2 + 0s*2 - 4s*3 - 5s. Suppose -15 = -10w + 13w. Is 9 a factor of k(w)? True Let r = 15 - 10. Suppose 0 = rg - 0g - 215. Let s = 0 + g. Is s a multiple of 15? False Suppose 0 = -2a - 0a. Let s = 9 - a. Is 9 a factor of s? True Let z(j) = -j*2 + 18j - 42. Does 19 divide z(10)? True Suppose 0 = -2g + c + 45, 0g - 4c = 3g - 95. Let b = -5 - g. Let l = -18 - b. Does 4 divide l? True Suppose 2x - 7 = -5c, -3x - 8 = 2c - 2. Is 14 a factor of (40/3 + -2)c? False Let d(n) be the second derivative of -n5/20 - n4/4 + n3/3 - 3n*2/2 + 6n. Does 5 divide d(-4)? True Suppose i - 3p = 3, 3i - 2p + 5 = -0. Is 1-323/i a multiple of 18? False Suppose -2c = -11 - 13. Suppose -12t + 2p = -7t + 50, -t - 10 = -p. Let f = t + c. Does 2 divide f? True Suppose 6q = 4q - 2. Let r(p) = 1 - 2p - 2 + 0p + 11p*2 - 2p*2. Is 10 a factor of r(q)? True Let h(r) = -27r - 12. Does 24 divide h(-3)? False Let c = -67 + -277. Is 6/(-18) + c/(-6) a multiple of 19? True Let y = 54 - 14. Does 4 divide y? True Suppose u - 3 = 2u. Let f be ((-3)/u)/(2/6). Let s = 9 - f. Is s a multiple of 3? True Let j(g) = g2 - 12g - 1. Let x be	{ "pile_set_name": "DM Mathematics" }
s 1989.21333 rounded to the nearest integer? 1989 What is -3640659170 rounded to the nearest one million? -3641000000 Round 81226003.5 to the nearest one million. 81000000 What is 42.30500734 rounded to the nearest ten? 40 Round -0.0000442317352 to 6 dps. -0.000044 What is -653.250207 rounded to one decimal place? -653.3 What is -4414.109 rounded to the nearest one thousand? -4000 Round 228.1861783 to zero decimal places. 228 What is 0.01166024031 rounded to five dps? 0.01166 What is -31686690.95 rounded to the nearest 1000? -31687000 Round -1826.1357 to one decimal place. -1826.1 Round 123.859522 to two decimal places. 123.86 Round 65449356.9 to the nearest 1000. 65449000 Round 132.6032651 to one dp. 132.6 Round 716624438 to the nearest ten thousand. 716620000 What is -0.011168294607 rounded to five dps? -0.01117 What is -5969.06713 rounded to the nearest 10? -5970 What is 635.8686734 rounded to the nearest integer? 636 What is -28384.102 rounded to the nearest 100? -28400 Round 0.551954059 to 1 decimal place. 0.6 What is -93084270 rounded to the nearest one million? -93000000 What is -9.2142563 rounded to three decimal places? -9.214 What is -0.090862903 rounded to two decimal places? -0.09 What is 1116063.195 rounded to the nearest one hundred thousand? 1100000 What is -0.03363518323 rounded to six decimal places? -0.033635 Round 42.85719257 to the nearest 10. 40 Round 0.0582657484 to four dps. 0.0583 Round 1329.505214 to one dp. 1329.5 What is 0.00044867036 rounded to five dps? 0.00045 What is -0.1009832493 rounded to five decimal places? -0.10098 What is -26688.1277 rounded to 0 dps? -26688 Round -2662.74882 to the nearest 10. -2660 What is -4284.206 rounded to the nearest 100? -4300 What is 40.9315449 rounded to the nearest integer? 41 What is 804812.684 rounded to the nearest 1000? 805000 What is 3476.554148 rounded to 1 decimal place? 3476.6 What is 389412.941 rounded to the nearest 10000? 390000 What is 0.000111520592 rounded to 4 dps? 0.0001 What is -0.005299688 rounded to three dps? -0.005 What is 8227597.6 rounded to the nearest 1000? 8228000 What is -8.3576481 rounded to one dp? -8.4 Round -1815972.024 to the nearest one hundred thousand. -1800000 Round -415283.6566 to the nearest one hundred. -415300 Round 3886.15783 to the nearest ten. 3890 Round -93352238 to the nearest 100000. -93400000 What is -0.000618689364 rounded to four decimal places? -0.0006 What is 2.17476472 rounded to 1 decimal place? 2.2 Round -0.0000093443763 to 7 decimal places. -0.0000093 What is -471054507 rounded to the nearest one million? -471000000 What is -67798.5942 rounded to the nearest 1000? -68000 Round 0.10357708 to three decimal places. 0.104 What is 0.00028306871 rounded to 5 decimal places? 0.00028 What is 1025543170 rounded to the nearest 1000000? 1026000000 Round -0.008252118599 to seven decimal places. -0.0082521 What is -114.4860683 rounded to 1 dp? -114.5 What is -9.14870705 rounded to 2 dps? -9.15 Round -67.293957 to 1 decimal place. -67.3 Round -13.95324864 to 2 decimal places. -13.95 What is 0.0943394196 rounded to 5 decimal places? 0.09434 What is -30555145.87 rounded to the nearest 1000? -30555000 What is -6168938569 rounded to the nearest 1000000? -6169000000 Round 327039.9394 to the nearest 10. 327040 What is 127.7283446 rounded to 0 dps? 128 What is 1693.3119959 rounded to the nearest one hundred? 1700 What is 0.00000704853 rounded to 7 dps? 0.000007 What is -0.00000246426714 rounded to seven decimal places? -0.0000025 What is -1.90110929 rounded to 3 dps? -1.901 Round 0.0000913208 to 5 dps. 0.00009 What is 29781709.227 rounded to the nearest 100000? 29800000 Round -47588.636 to the nearest 1000. -48000 What is 0.827908469 rounded to 5 dps? 0.82791 What is -2198829.23 rounded to the nearest one hundred thousand? -2200000 Round 6.34853896 to 2 decimal places. 6.35 Round -0.00036371001 to five decimal places. -0.00036 What is -27226.392 rounded to the nearest one hundred? -27200 What is 595757568 rounded to the nearest 100000? 595800000 Round 4243019080 to the nearest 1000000. 4243000000 Round -862523090.3 to the nearest one million. -863000000 What is -0.0000658583132 rounded to 6 decimal places? -0.000066 What is -42.3059176 rounded to the nearest 10? -40 What is -356718.69 rounded to the nearest one thousand? -357000 Round -82.4915751 to three decimal places. -82.492 Round -681.7488915 to zero decimal places. -682 What is -0.0151224381 rounded to three decimal places? -0.015 Round -3.0405801155 to two decimal places. -3.04 What is -4049043.707 rounded to the nearest one hundred thousand? -4000000 What is -1093227.36 rounded to the nearest one thousand? -1093000 What is -0.000048225641 rounded to 7 decimal places? -0.0000482 What is 182309694.5 rounded to the nearest 100000? 182300000 What is 854932.109 rounded to the nearest ten? 854930 What is -5192590.252 rounded to the nearest 100000? -5200000 Round 0.0300838699 to 3 decimal places. 0.03 Round -27457935.5 to the nearest one hundred thousand. -27500000 What is -556.0941865 rounded to 1 dp? -556.1 Round -0.03355157204 to three decimal places. -0.034 Round -55.481178 to two decimal places. -55.48 Round -41468271 to the nearest one hundred thousand. -41500000 What is -2676856.067 rounded to the nearest one hundred thousand? -2700000 Round -22193795.01 to the nearest 100000. -22200000 What is -0.01443482852 rounded to two dps? -0.01 What is 1437637.2 rounded to the nearest 10000? 1440000 What is 0.00000201456462 rounded to seven dps? 0.000002 Round 0.1100213039 to four dps. 0.11 Round -23167.15202 to the nearest ten. -23170 Round -524.06936 to the nearest integer. -524 What is -82.788364 rounded to two dps? -82.79 Round 0.053554766 to 3 dps. 0.054 What is -51.648443 rounded to the nearest ten? -50 What is 0.001397921815 rounded to 4 dps? 0.0014 What is 10958.9747 rounded to the nearest 1000? 11000 Round 10.27539049 to 0 dps. 10 Round 0.0280613442 to 3 decimal places. 0.028 Round 3304.801498 to one decimal place. 3304.8 Round -0.0000000680573089 to seven decimal places. -0.0000001 What is 2429.453324 rounded to the nearest 10? 2430 What is -27995451.1 rounded to the nearest 1000000? -28000000 What is 114979867 rounded to the nearest 10000? 114980000 Round -13.1544196 to three decimal places. -13.154 Round -0.0069283348 to 4 dps. -0.0069 Round -0.00332569016 to 4 decimal places. -0.0033 Round 3.447175953 to 3 decimal places. 3.447 What is -0.003009188609 rounded to 3 decimal places? -0.003 Round -0.000741294907 to 5 dps. -0.00074 What is 38279.5551 rounded to the nearest 10? 38280 What is -0.01490787188 rounded to 5 decimal places? -0.01491 What is 37636.6444 rounded to the nearest ten? 37640 What is 3424566.31 rounded to the nearest ten thousand? 3420000 Round 33784883.2 to the nearest 100000. 33800000 What is -0.0007340652 rounded to four decimal places? -0.0007 Round 0.836209885 to the nearest integer. 1 What is 59.2303838 rounded to the nearest integer? 59 What is -884048.1508 rounded to the nearest 1000? -884000 Round -241615.365 to the nearest ten thousand. -240000 Round 0.000042237413 to seven dps. 0.0000422 What is -44.506525 rounded to zero dps? -45 Round 9.37889351 to zero dps. 9 Round 0.1245276665 to 5 dps. 0.12453 Round 27102097.04 to the nearest 100000. 27100000 Round -2650722768.4 to the nearest one hundred thousand. -2650700000 Round 232.3872865 to the nearest 10. 230 Round 21024884.5 to the nearest one hundred thousand. 21000000 Round -0.135104879 to five decimal places. -0.1351 What is -0.0000323671258 rounded to seven dps? -0.0000324 Round -808.4861617 to two decimal places. -808.49 What is -0.000010287394 rounded to 6 dps? -0.00001 Round -5205.1873 to the nearest integer. -5205 What is -35363.563 rounded to the nearest 100? -35400 Round 277.38654249 to three dps. 277.387 Round -0.00088580017 to 5 decimal places. -0.00089 Round -0.28848 to 1 decimal place. -0.3 Round -0.02823789 to 2 dps. -0.03 Round 8809.62535 to the nearest 100. 8800 What is -10323.6137 rounded to the nearest 10? -10320 What is 0.00149288543 rounded to six decimal places? 0.001493 What is 99.6475377 rounded to 3 dps? 99.648 What is -227753076 rounded to the nearest one million? -228000000 What is	{ "pile_set_name": "DM Mathematics" }
r - 48. Suppose d + 5j + 17 = -12, 0 = -d - 3j - 27. Let n be k(d). Which is greater: 1/46 or n? 1/46 Suppose 228 = -92f + 86f. Is f bigger than -402/11? False Suppose 7q = 8q - 11. Suppose -3b + 7 = -q. Is b > 4? True Suppose -5u = -9 - 1. Let o = -4 + 5. Suppose uj = -o - 1. Is 1/17 less than or equal to j? False Let z = 1381/117 + -139/13. Which is greater: z or -1? z Suppose -32i = -23i + 54. Let c be (i/10)/((-4 + 8)/(-180)). Is c equal to 28? False Let l be 16(-110)/(-920) - (-6)/69. Let w be (-1)/(1/(-3)) + 0. Which is greater: w or l? w Let v be ((-8)/(-30))/(8 + -14). Suppose -s = -1, 0 = f - 0s + 4s - 5. Do f and v have the same value? False Let s = -0.95 - -10.95. Is 0.26 <= s? True Let q be 4/(-6) - (-6)/(-36). Let y be 12 - 2/621. Which is greater: q or y? y Let k be (3 + 17/(-3))(0 - -9). Is k less than or equal to -27? False Let i(n) = -3n2 - 85n - 33. Let y be i(-28). Which is bigger: y or -39? y Let f be (14/35)/((-2)/50). Let w(n) = -4n + 8. Let s be w(f). Let c be (s/36)/(2/3). Is c less than 12/13? False Suppose 3g = 4v - 0 - 1, g - 17 = -3v. Suppose -36 = -vz + 2j, -5j = 2z - 2 + 8. Let i be -52 - (6 - z). Are i and -10 nonequal? True Let m be -1(2 - 129 - -4). Let s = -123 + m. Which is greater: -3/77 or s? s Let l be (-219)/(-13) - (49 - 56). Which is greater: 23 or l? l Suppose -55z - 14700 = -34z. Is z at least as big as -699? False Suppose -4t - 1512 = 5j, 33j - 36j = 0. Which is smaller: -379 or t? -379 Let c be -15(-8 + 906/108). Suppose 2q + 9 = k, 7k = -3q + 2k - 33. Which is smaller: q or c? q Let m = -2345 + 2301. Which is greater: m or -40? -40 Suppose -58572 + 21186 = -31s. Is 1206 at most as big as s? True Let y = -0.039 - -0.14. Let w = y - 0.001. Is 0 greater than or equal to w? False Let d = 2354/975 + -30/13. Is -1 <= d? True Let x(i) = -24i2 + 16i - 21. Let v be x(3). Is -1322/7 greater than v? True Let s = -36 + 41. Suppose -1 + 1 = -sg. Which is bigger: -5/7 or g? g Let b = -17 + 27. Suppose -4d + b = 118. Is d greater than -27? False Let j(o) = 17o - 25. Suppose -16g = -14g - 6. Let u be j(g). Which is smaller: 28 or u? u Let v = -44 - -52. Suppose -vu = 32 + 24. Which is bigger: u or -8? u Suppose 0o + 1425 = -25o. Which is smaller: o or -53? o Suppose 21r - 26 = 16. Let m be 0 + (53 - -1) + 0. Let t be (6/m)/(r/(-4)). Which is smaller: -1 or t? -1 Let s = 5 + -6. Let c be 8/36 + (-1)/((-5)/(-10)). Is c < s? True Let d be (4/(-3))/(4/(-6)). Let x be 2/3 + (-286)/33. Let z be (-3 - x/d) + 0. Which is smaller: -1 or z? -1 Let s = -20246/5 - -4036. Let m(k) = -k2 - 3k + 4. Let i be m(3). Is s at least i? True Let t = 35.7 - 5.7. Let a = t - 12. Let d = -18.6 + a. Is d < 0? True Let a = -10 - -1. Let f = 23 + a. Let c = 14.2 - f. Which is bigger: c or 3/7? 3/7 Let p = -253/6 + 128/3. Let j be 54/(-10) + 2/5. Which is greater: p or j? p Let k be (-4)/7 + 75888/(-476). Which is smaller: 1 or k? k Let x = -0.064 - -1.064. Let v = 79 + -82. Which is smaller: v or x? v Let a = -59 - -90. Let d = a + -31.11. Does d = -1? False Let l = -356 - -371.1. Let u = -16 + l. Which is smaller: 7 or u? u Suppose 26c = 21c + 160. Suppose 0 = -3f + 34 + 59. Which is greater: f or c? c Let i = 4 - 2. Suppose -1 = 3y + i. Let v be 0/(y/((-2)/4)). Which is greater: v or -5? v Let p = -2303 + 3848. Which is smaller: 1546 or p? p Let u = -0.41 + 0.376. Let c = u - 0.166. Is c equal to -2/7? False Suppose 4r - 93 = -3q, -4q = 2r - 5r + 76. Suppose r = -5m - 16. Let p be 56/140145/(-4). Is p != m? True Let v = 2/3243 - -42139/32430. Let z = v - 121/70. Is z greater than 1/4? False Suppose -4r + 3u - 29 + 147 = 0, u - 95 = -3r. Let t(l) = 39l + 188. Let i be t(-4). Which is bigger: r or i? i Let f(u) be the third derivative of -5u4/24 - 22u*2. Let s be f(0). Which is greater: s or 1/153? 1/153 Let c = 89 + -85. Suppose -6r = 2s - 7r, 2s + cr - 10 = 0. Let u be ((-6)/22)/(-1 + 0). Which is bigger: s or u? s Let s be 36/30270/12. Are s and 18 equal? False Let g be (-4)/10(-2 + (3 - 6)). Let s be ((-4)/10)/(2/(-10)). Let z = g - s. Does z = 1/5? False Let x be (-155562)/(-1910) + 2 - 3. Let p = x + 144/191. Let k = -82 + p. Which is smaller: k or 1/4? k Let i be (6/9)/(1/3). Let u be 9/27/(21/2). Suppose 2 = -uj - 4b + 22, 0 = -2j + 5b - i. Is j at most as big as 5? True Let w be 30/10646790/168. Let q = w + 1/304. Let z be 2/42/1. Which is smaller: z or q? z Let k(j) = -j3 + 7j*2 - 8j + 4. Let x be k(5). Let l = -178 - -193. Is x greater than or equal to l? False Let a = -2.3 + 0.1. Let x = 2.5 + a. Let t = x + 21.7. Which is smaller: 0.1 or t? 0.1 Let z = 412 + -410. Which is greater: z or -147? z Let x = -2.4 + 2.46. Let b = 3 - -5. Let f = b - 8. Is f <= x? True Let q be 1/(-5) - 1148/(-190) - 5. Which is bigger: -6 or q? q Let f(s) = s - 1. Let k be f(6). Suppose ky + 14 = 2g, y + 2g + 0g = 2. Let q be (-1 + y + 3)/(-2). Is q at most as big as -1/5? False Let m = -8075/3 - -2691. Let g(r) = r. Let n(a) = -a - 2. Let d be n(0). Let v be g(d). Which is smaller: v or m? v Let v(j) = j*2 - 1. Let n(f) = 2f*2 - 4. Let r(d) = -n(d) + v(d). Let h be r(0). Is -0.4 greater than h? False Suppose -3q + 18 = z, 7z - 3z - 37 = -5q. Suppose -5r + 2r - 390 = zf, -4f = 12. Let h = r + 891/7. Which is smaller: -6 or h? -6 Let f = -3357 - -3356.7. Let s = 1 + 0. Which is greater: f or s? s Let h = 2/1441 + 1385/40348. Do h and 0 have the same value? False Suppose -51 + 1 = 5q. Which is greater: q or -15? q Let v = 49.5535 + -49.5. Do v and -0.1 have different values? True Let u be 1632/(-72) + (-1)/(-1). Which is smaller: u or -22? -22 Suppose 6f = 5x + 3f - 20, -4 = -x - 2f. Suppose 0 = -3g - 2j + 5, -g - 4g - xj + 9 = 0. Let q be (-24)/(-28) + (-1)/g. Are q and -1 non-equal? True Let o(p) = -p3 + p2 - p. Let r be o(0). Let k be (-28)/(-740)147/(-18). Let b = k - -1/111. Which is greater: r or b? r Let v(u) = 46u*2 - u. Let w be v(1). Suppose 17c + 163 = 911. Do w and c have the same value? False Let x be (6/9 + -1)-9. Suppose 2c = -z + 3c, -xc + 8 = -5z. Are z and -20/7 equal? False Let f be (-11)/((-374)/(-4)) - (-2544)/(-51). Let r = 75 - 124. Is f smaller than r? True Suppose 0 = r - 2 - 0. Let g = 27 - 24. Suppose -3u + 5f = -14, -4u + u = -gf - 12. Is u less than r? False Let i be 30/(-12)(-8)/2410. Which is greater: i or 1? 1 Suppose 3t = -1 + 7. Let g be -1 + (t + -4 - -5). Suppose 11 = f - 3a - 2, 4f = 2a + g. Is -3 greater than or equal to f? False Suppose t + 3t - 192 = -5h, -3t = -3h + 99. Is h greater than or equal to 44? False Suppose -4q - 56 = 36. Are -22 and q non-equal? True Let t(f) = 2f*2 - 8f - 5. Let v(o) = 3o2 - 15o - 10. Let a(z) = -5t(z) + 3v(z). Let l be a(-5). Let i = -1.9 - -1.9. Which is greater: i or l? i Let v be -2 + -2 + (-18)/(-4). Let n be (12/10)/((-4)/(-10)). Let m be 15/(3 - -2) - n. Is m at most v? True Let w = 2280 - 2279. Suppose 3f - 69 = -5q + 55, -184 = -5f + 3q. Let s be f/(-3)(-3)/2. Which is smaller: s or w? w Let h = -85 - -343/4. Let p = -130 + 23. Let g = 106.9 + p. Is h bigger than g? True Suppose 10x + 4x = -280. Is x equal to -131/7? False Let b = -91 - -79. Let x be (-2)/2-1-1. Is x <= b? False Let y = 108/161 + -5/7. Is y equal to -0.4? False Let o = -939 + 944. Is -7 <= o? True Let y be 4 + 1 + -3 + 3. Let p be ((-2)/(-3))/(2/15). Suppose -pf + 4a - 56 - 29 = 0, -3f - ya - 14 = 0. Which is smaller: -14 or f? -14 Suppose 0h + 4h + 4q = 20, 0 = 3h - 4q - 43. Is 130/17 < h? True Let y(c) be the first derivative of c*2 - 15c + 326. Suppose 3g - 12 = g. Let v be y(g). Which is greater: -9/4 or v? -9/4 Let c = -29.48 + -0.52. Let q = -17 - c. Let h = q - 13.1. Does -6 = h? False Suppose -7 = -3b + 3u + 2u, b - 4u = 0. Let n be -5 - ((-2)/(-5 + b))/2. Suppose -41 = 3i + 4k, 4k + 5 = 2i - 1. Is n bigger than i? True Suppose 0 = 4t + 2h - 746, 10t - 9t = -5h + 191. Is t less than 185? False Let v be -1 - (-5)/2085411. Is v less than or equal to 0? True Suppose 4c - 2c = -8. Let d be ((-4)/(-6))/(c/(-6)). Let x = -2/3003 + 3019/24024. Is d bigger than x? True Let a be (-2)/5 - (-4)/10. Let h(u) = 53 + 2	{ "pile_set_name": "DM Mathematics" }
k) assuming k is positive. k(150/7) Simplify ((((h(-21)/h)(2/39))24)(-2/11))(42/5) assuming h is positive. h*(2688/65) Simplify (ff/f*(2/13))/(ff/f*(-1/7))(ff/((fffff(-5))/f)ff)/f(2/23)(f/(ff(-1/6))f/(f/(fff*(-4))ff)f)(-6) assuming f is positive. f(47336/2093) Simplify (bb/((b/b(7/3))/b)bbb(1/2))21(b(-1/4)b/((b*(-3)b)/b)bb)/((b/(bb/b(-1/6)b))/(b/(bbb*(-2/9)b))) assuming b is positive. b(5387/36) Simplify ((s/(s18/s))/ss(-5/11)/s)/(ssss(2/137))(-35) assuming s is positive. s(131194/1507) Simplify ((l(2/5)/l)(2/49))(-1/9)((ll/l(1/5))/l(1/11))/((l/(l(l/(((l/l4)/l)/ll)l)/l)ll)/(l1l)) assuming l is positive. l*(10853/1617) Simplify (((ii/(i*(-12)i))/i)/(i*0i)iii/(ii*(1/12))i(3/8))(21/5) assuming i is positive. i(2233/40) Simplify ((z/(((z/z(1/7))/zz)/z))/z(-5)(z*(3/7)z)/(zz/z(1/14)z))/((z*7z)/(zz7/z)z*(-1/2)zzz0) assuming z is positive. z(15/7) Simplify (((m/(m(m24/mm)/mmm))/(m/((m(m(-3/25)/m)/mm)/m)))/(m/m*(-2/11)m*(-16/3)mm))(-2/23) assuming m is positive. m(41198/18975) Simplify ((tt/(t*(-17/4)/t)t)/((t*(-8)/t)/t)(tt/(t(-1)t)t)(-34))(2/23) assuming t is positive. t(-335/46) Simplify (y34(y/y(-2/47))/y)/((y/(y(-26)/y))/y)7 assuming y is positive. y(-7283/47) Simplify (g*22/(gg/(gg/(g/g8))g))/(g7)(-29) assuming g is positive. g231 Simplify ((p(-1/4)p)/(p(-6/19)/p))/(((pp(-16/11))/p)/p)(-41) assuming p is positive. p*(-82405/836) Simplify ((cc*(-1/10)c(c(-2)/cc)/c)/(c/c(-2/7))(-27))/((c(-1/3))42/(c2/c(-1/8))) assuming c is positive. c(13927/280) Simplify (q/(q/(q(-18)/q)))*(-39)q*36q(-2/7) assuming q is positive. q(5437/7) Simplify (h*(1/4)hh/((h/(hhh/h4h)h)/h))(-3/4)/(h6h(-2/3))(-6/19) assuming h is positive. h(227/304) Simplify (((c/c1c/(c/c(1/5)))(-1/7))(-19/3))(8/5) assuming c is positive. c(152/525) Simplify (((((jj(1/23))/j)/(j8j))/(j(-1/2)j)(-33))(-3))(-9) assuming j is positive. j(9369/46) Simplify ((t/(t/t*(-1/22)t))/tt(-10/9))/((t(2/3)/t)/(tt(-2/23))) assuming t is positive. t(-8699/4554) Simplify (((ll/l(2/3)l)/l)*12(l*(-1)l)*(-2/75))/((ll*(-1/5))/ll*5l)(-19/5) assuming l is positive. l(951/25) Simplify ((x/(x/x0))(-30)/((xxxxxx(-1/6)x)/(xx(-2))))/((x0/x)/((x/(x(-2)/x))/x)((xx(-5/3))/x)/xxxx/x(1/6)) assuming x is positive. x(-3) Simplify ((aa(-3))(2/15)/(a(8/5)/(a/a(3/5))))(5/9) assuming a is positive. a(-22/27) Simplify ((t/((t1t)/t))*45(t*(2/3)/tt)50)/(t(-6)/t*(-1/10)t*(-2/3)t*(-5)tt) assuming t is positive. t(429/10) Simplify ff*(-7)f*3ff/(ff*1f)f(-2)f((f(-2/5)f)/fff(-1/2))/(f(-2/19)f/(ffff*(-4)f)) assuming f is positive. f(-1101/190) Simplify (b/b(5/9)b/(b/(bb*8b)bb))/(((bb(1/3)/b)/bb)/b44) assuming b is positive. b(469/9) Simplify (y(5/9))(-2/27)/((y/(y*(-1/25)/y))/(y(yyyy/y(-42)y)/yy)) assuming y is positive. y(278957/6075) Simplify ((w/(w/(w18w))w((w/(w*0ww)www)/w)/w)/(((((www/w*(-1/2)w)/ww)/ww)/w)/w)(-3/35))6 assuming w is positive. w(849/7) Simplify ((c(-9)/c)*(-47)((cc(-2/5))/c)(-38))(-2/21) assuming c is positive. c(-4852/105) Simplify (x(-1/22)x(x/(x/x(7/3)))/xx)29/(x(4/3)/x(5/3))(-12/7) assuming x is positive. x(43787/462) Simplify ((j(1/2))(-1))6/(j/(j*(-5)/j)j*(-1)j*(1/2)j(-4)/j) assuming j is positive. j(-9/2) Simplify ((((t*(-1)/t)/tt)/(tt(-1)t))/((t*6ttt)/(t/(t/t3))))/((t(-2/5))*4(tt(-3)/t)/tt*(-2/17)t) assuming t is positive. t*(-364/85) Simplify ((m/(mm/((mmm/(mm2)m)/m)))21/(m/m(2/7))50)/(((m/(m1m))/m)(2/29))(-50) assuming m is positive. m(-12913/203) Simplify (r1/r)(-5/2)((rr1)/r)31r*(-5/4)r*5/rr/r*(-2/5)rrr(-1/2) assuming r is positive. r(733/20) Simplify (i(2/5)/i5)/(i(ii/i1)/i)(5/2)(i/i(-7)i(-4))37 assuming i is positive. i(1409/10) Simplify ((((q1q)/qq)/(q/(q(q/q0)/q)))/((q2/q)/(qqq(1/10)q)))/(((qq1q)/q)(-1/20)/(q(2/7))14) assuming q is positive. q(41/5) Simplify ((((g(1/4))(-44))(2/179))(-46))(-12/17) assuming g is positive. g(-12144/3043) Simplify ((j/j(-1/7))(-10)/((jjj*7j)/jj/j(1/32)))(7/2) assuming j is positive. j(-4793/64) Simplify (mm*7m4)(-40)/((m(1/3)/m)3m(m/(mm(1/3)m)mm)/mm(m/(m(mm*7)/mm))/mm) assuming m is positive. m(-1415/3) Simplify (k(-3)/(((kk*(3/2)kk)/k)/k))/(k/k4kkk*(-2/15))(k*2/kkk(-2))41 assuming k is positive. k(-131/30) Simplify ((www/(w/w(-9))w/(w*(-1)/w))/(ww*(-2/9)www)(-3/8))(-5) assuming w is positive. w*(155/12) Simplify ((((tt*(-1)t)/t)/t)(-32))(-43)/(((((t/(t*(3/2)/t)t)/t)/t)/tt)/ttt4)8 assuming t is positive. t(-1404) Simplify (l(2/35)l*(7/4)l*(-2/37)/(ll/((ll(-2/13)ll)/l)ll))(-23) assuming l is positive. l(620701/67340) Simplify ((q(-2/13)/q)/qq/(qq(-13)))4/(q9q(-10))(9/4) assuming q is positive. q*(2373/52) Simplify ((((l/((ll4)/l))/l)/(l(-28)ll))/((l/((ll(-2/7)l)/l)l)/ll26))(2/9) assuming l is positive. l(-20/21) Simplify ((i13/i(2/47))/(i(-41)/((i*(-2/29)/i)/ii)))(-2/41) assuming i is positive. i(-144174/55883) Simplify (s(1/4)/(s/s(-3))s((s/((s/s*(1/3))/ss))/s)/ss/s(-2))/((s/s(-1/6))/(ss/s*(-6))s*(-1/2)s/((ss(-1)/s)/s)) assuming s is positive. s(35/12) Simplify (l2)38/(l/l(-6)l*1/l)(l/(l/((l*(-7)l)/ll))l(-1/3))(-1/8) assuming l is positive. l(1675/24) Simplify ((k/(k/(k2kk)))(-15))(2/69)(k7/kk*8k)50 assuming k is positive. k(17210/23) Simplify (((k*1/k)/((k/(k/(k/((k/(k/((k/(k(k*(-1/5)kk)/k))/k)))/kk))))/k)k(6/7)k*5k)34)(-27/5) assuming k is positive. k(-162486/175) Simplify v(2/5)v(3/5)v(vv(2/5))(-6/13)((v/v(-1))(-3))(-40) assuming v is positive. v(15688/65) Simplify (p(-3/2)/p0)(-7)(p*0p)/p*1(((ppp0/p)/p)/p)(1/6) assuming p is positive. p(31/3) Simplify (h(-13)/h(7/5))(-34)(hh(h/h(-1))/h)/h(-1/4)(h/(h/((hhh*(1/3)h)/h))h)/hh(2/3) assuming h is positive. h(9917/20) Simplify (k*5/(kk*12k)(k/(kk(-2)/k))2)(-2/71) assuming k is positive. k(6/71) Simplify ((c/c*(-4/11))/(c(c(c(-2/5)/c)/c)/c)c(-2/33)/((c0c)/c))/((c1c)9/((c(2/5)/c)/c)43) assuming c is positive. c(-13876/165) Simplify (r*(-6)r*3/r(rr(-2/7))(-36))/(rr*(2/17)/rrr(r/r*(-4))/r(rr(-3/2))/(r/(r3/r))) assuming r is positive. r(-8647/238) Simplify (((hhhh*(-2)/hh)*(1/12)h(2/43)/(h4h))(-5/7))(-29) assuming h is positive. h(-52055/516) Simplify t15/(t/t(-43))t*(-2/131)tt/t(3/25)t assuming t is positive. t*(-85593/3275) Simplify (((ss(-1))/s)23/(s(1/4))(-14))/(s(-5)/s(-5)s1/s(-4)) assuming s is positive. s(-49/2) Simplify (r(5/6)/r(-5)(r/r(-7))5)(-7/9) assuming r is positive. r(-1925/54) Simplify ((d/(d/d*(-1/14)d))/((d/(d/(d/((dd/(d11d))/d))d))/d)d*14d(2/11))(-1/64) assuming d is positive. d(-479/9856) Simplify (l/l(-1/2))(-46)/(l(-2/3))*(-24/5)(l0)(-28)/(l/(ll(1/4)))(7/8) assuming l is positive. l(-11517/160) Simplify (i(-1)/(i(iii*(-6/5))/i)i*(6/11)/ii12)(-37) assuming i is positive. i*(-19832/55) Simplify (ttt/(t(-2/3)t)ttttt/(t(t*(-7)t)/t))6/(t(-4)t2/tt*(-6/5)t/(t*2/ttt)t) assuming t is positive. t*(436/5) Simplify ((((uu(2/79))(-44))(1/10))(-9))(-12) assuming u is positive. u(-192456/395) Simplify (g*31g*24)/(g(g/(g/((g/(g(gg*(5/9))/g))/g)))/gg(-40)) assuming g is positive. g(869/9) Simplify (qq/q0q)*(2/99)(q*(1/4)q)*(-37)((q/(qq/(q/(qq*(-1)))q)qq)(2/13))(-8) assuming q is positive. q(-81373/1716) Simplify (j9/(j/(jj/(j(2/7)/j))))/(j(j*1j)/jj(j/j*6j)/j)(j(6/7)/(j/j(1/5)))/(j1j)(-3/38) assuming j is positive. j(8598	{ "pile_set_name": "DM Mathematics" }
1/3, 9 Put -11, -5, -3 in descending order. -3, -5, -11 Put 0, -2/7, 1/5 in decreasing order. 1/5, 0, -2/7 Put 4, -3, 108, -22, 5 in descending order. 108, 5, 4, -3, -22 Put 2, 0, -5, -1 in decreasing order. 2, 0, -1, -5 Put 2/2453, 0.3, 2 in decreasing order. 2, 0.3, 2/2453 Sort -65, 3, -2, -4, -1 in decreasing order. 3, -1, -2, -4, -65 Sort 4, 20, 2, 9. 2, 4, 9, 20 Put -6, 4, 588, -3, -2 in increasing order. -6, -3, -2, 4, 588 Put 16, -2, 3 in increasing order. -2, 3, 16 Put 4, 0, 60 in increasing order. 0, 4, 60 Sort -3, -2, 3. -3, -2, 3 Put -18, 5, 50 in descending order. 50, 5, -18 Put 1/5, -0.3, -90/13 in descending order. 1/5, -0.3, -90/13 Put -0.08, 3, 0.5, 10, -1/2 in increasing order. -1/2, -0.08, 0.5, 3, 10 Sort -74, -5, 2, -15, -2 in increasing order. -74, -15, -5, -2, 2 Put 1, 4, -3, 5, 10 in decreasing order. 10, 5, 4, 1, -3 Put -8, -5, 45, 5 in ascending order. -8, -5, 5, 45 Sort -2/47, -0.5, -6, 2, -0.1 in ascending order. -6, -0.5, -0.1, -2/47, 2 Sort 0.9, -4, -0.2, 1, 0. -4, -0.2, 0, 0.9, 1 Sort -0.4, 0.5, 0.31 in descending order. 0.5, 0.31, -0.4 Put 4, 5, -3, -1/2 in ascending order. -3, -1/2, 4, 5 Put -115, 3, -2 in descending order. 3, -2, -115 Sort -5, 0, -8, 3 in decreasing order. 3, 0, -5, -8 Sort -0.4, -7, 3/7, -4/7. -7, -4/7, -0.4, 3/7 Sort -5, 5, -4 in ascending order. -5, -4, 5 Put 0.12, 1/19, 2, 2/3 in ascending order. 1/19, 0.12, 2/3, 2 Sort -0.17, 0.4, 2, 0.1, 3 in ascending order. -0.17, 0.1, 0.4, 2, 3 Sort 12, 21, 0.2, -0.4 in descending order. 21, 12, 0.2, -0.4 Put -2/55, -0.12, 1 in decreasing order. 1, -2/55, -0.12 Put 8, 6, 2 in increasing order. 2, 6, 8 Sort 1, -3, -4, 28 in increasing order. -4, -3, 1, 28 Sort -3, 5245, 5, -1. -3, -1, 5, 5245 Put -32, 5, 3 in ascending order. -32, 3, 5 Sort 17, -0.1, 3/11. -0.1, 3/11, 17 Put 5, -2, 11403 in ascending order. -2, 5, 11403 Sort 7, -16, 3, 5, -4 in ascending order. -16, -4, 3, 5, 7 Put 1/15, -3, -4 in decreasing order. 1/15, -3, -4 Put -12.59, -0.2, -0.3 in descending order. -0.2, -0.3, -12.59 Sort 0, 9, 3, 12, -4 in ascending order. -4, 0, 3, 9, 12 Sort 1, -2, 16 in descending order. 16, 1, -2 Sort -1.2, 0.3, 0.5, 2/3 in increasing order. -1.2, 0.3, 0.5, 2/3 Sort -49, 1, 6, 0, -1 in decreasing order. 6, 1, 0, -1, -49 Sort -4, 3, -6, -12 in increasing order. -12, -6, -4, 3 Sort -3, 13, 2, 7. -3, 2, 7, 13 Sort 12, -4, -69, 1, -5 in increasing order. -69, -5, -4, 1, 12 Put -9, 104, 5 in descending order. 104, 5, -9 Sort 9, 1, 12, 0 in descending order. 12, 9, 1, 0 Put -1, -2, 301 in decreasing order. 301, -1, -2 Put -1, -2, -11, 3 in ascending order. -11, -2, -1, 3 Put 3, 1/2, -1/4, -3, -3/7 in ascending order. -3, -3/7, -1/4, 1/2, 3 Sort -5, -103, 0 in decreasing order. 0, -5, -103 Sort 28, 2, 66. 2, 28, 66 Sort -11, 5, 2, 1. -11, 1, 2, 5 Put -4, 7, 189, 0 in decreasing order. 189, 7, 0, -4 Sort 0, 0.5, 5, -3/5, 0.3 in decreasing order. 5, 0.5, 0.3, 0, -3/5 Sort 13, -85, 1/6 in ascending order. -85, 1/6, 13 Sort -13, 3, -1, -3 in increasing order. -13, -3, -1, 3 Sort -2, 4, -7.5 in ascending order. -7.5, -2, 4 Put -11, -16, 21 in increasing order. -16, -11, 21 Sort 18, -2, -23, 2/17, 0.5 in ascending order. -23, -2, 2/17, 0.5, 18 Sort -1, 3, -3, -169, -4 in ascending order. -169, -4, -3, -1, 3 Sort 2, -1, -6, 5 in decreasing order. 5, 2, -1, -6 Sort -3, 2, 11, -45, 1 in ascending order. -45, -3, 1, 2, 11 Sort 17, 15, -9 in decreasing order. 17, 15, -9 Sort 45, 5, -1, 2/9 in descending order. 45, 5, 2/9, -1 Put 0.4, 0.2, -4, -0.4, 54 in increasing order. -4, -0.4, 0.2, 0.4, 54 Put 2, -4, 50, 30, -5 in decreasing order. 50, 30, 2, -4, -5 Sort 5, -2/9, -0.5, -739 in increasing order. -739, -0.5, -2/9, 5 Put -3, 0, 40 in descending order. 40, 0, -3 Sort -14, -5, 4 in descending order. 4, -5, -14 Put 2, 0.1, -5, -1 in ascending order. -5, -1, 0.1, 2 Sort -5, -8, 15 in ascending order. -8, -5, 15 Put -255, -5, 1, 5 in descending order. 5, 1, -5, -255 Put 0.4, 34/21, 2 in decreasing order. 2, 34/21, 0.4 Put -22, -2, -5 in decreasing order. -2, -5, -22 Put -5, -2, -4, -1, -11/20 in ascending order. -5, -4, -2, -1, -11/20 Sort 5, -5, -4, 8 in descending order. 8, 5, -4, -5 Put -2, 0, -4, 133 in ascending order. -4, -2, 0, 133 Sort -57, -4, 3/4, 0. -57, -4, 0, 3/4 Sort -1, -4, -80. -80, -4, -1 Put 2, 1, -4, -3, 45 in decreasing order. 45, 2, 1, -3, -4 Put 4, 5, 14, 8, -5 in increasing order. -5, 4, 5, 8, 14 Sort -505, -3, -0.03 in ascending order. -505, -3, -0.03 Sort -53, -2, -11, -0.2 in increasing order. -53, -11, -2, -0.2 Sort -1, -5/2, 16, -1/4. -5/2, -1, -1/4, 16 Sort -4, 3, 66, 1. -4, 1, 3, 66 Sort 0, 5, 20, -5 in decreasing order. 20, 5, 0, -5 Sort -5, -2, -22, -1, 5 in decreasing order. 5, -1, -2, -5, -22 Put 2, 3.8, 15, 3 in decreasing order. 15, 3.8, 3, 2 Put -30, 2/7, 5 in ascending order. -30, 2/7, 5 Put 0, -2, 32, -11 in descending order. 32, 0, -2, -11 Sort 0, 4, -5, 2398, -4 in decreasing order. 2398, 4, 0, -4, -5 Put 5, 0.3, 1.2, 2 in ascending order. 0.3, 1.2, 2, 5 Put -2, 5, 0, 1 in descending order. 5, 1, 0, -2 Sort -3, 4, 7, -2, 5 in decreasing order. 7, 5, 4, -2, -3 Put 4, 0, 841 in ascending order. 0, 4, 841 Put -209, -11, -3 in ascending order. -209, -11, -3 Sort -3, -4, -2, 14 in increasing order. -4, -3, -2, 14 Put -2/15, -18, 2/17, 0.4 in decreasing order. 0.4, 2/17, -2/15, -18 Put 0, -10, 10, -7, 5 in descending order. 10, 5, 0, -7, -10 Put 16, 0.2, -3, -6 in descending order. 16, 0.2, -3, -6 Sort 37, 5, -4, 10 in decreasing order. 37, 10, 5, -4 Put -4, 1, 297 in descending order. 297, 1, -4 Sort -2, 1/5, 14, -130 in ascending order. -130, -2, 1/5, 14 Sort -1.8, -0.2, -0.05. -1.8, -0.2, -0.05 Sort 0, 63, 2, 1 in descending order. 63, 2, 1, 0 Sort 4, 2, 0.2. 0.2, 2, 4 Put -1/4, 1/3, 5, -62/3, -0.4 in decreasing order. 5, 1/3, -1/4, -0.4, -62/3 Put -11, -29, -5 in decreasing order. -5, -11, -29 Sort 0.5, 124, 3/4 in descending order. 124, 3/4, 0.5 Sort -59, 6, -16 in descending order. 6, -16, -59 Sort -11, 2, 3. -11, 2, 3 Sort 5, -31, -2 in descending order. 5, -2, -31 Sort 4.61, 0, 1. 0, 1, 4.61 Sort 0.2, -5, -3/2, 0.16, 0.8 in increasing order. -5, -3/2, 0.16, 0.2, 0.8 Put -4/7, -1/9, 15/2, 0.1, 4 in increasing order. -4/7, -1/9, 0.1, 4, 15/2 Sort -0.5, 7, 0, -2/15, 1.8. -0.5, -2/15, 0, 1.8, 7 Sort -4, -23, -0.5, -36 in descending order. -0.5, -4, -23, -36 Sort 3, 38, 129 in decreasing order. 129, 38, 3 Sort 63, -5, 3, -8, 2. -8, -5, 2, 3, 63 Sort -11, -3, 5, -5, 0. -11, -5, -3, 0, 5 Put 4, 5, -12 in descending order. 5, 4, -12 Put -49, 2, 4, 3 in descending order. 4, 3, 2, -49 Put -0.3, -5, 69 in descending order. 69, -0.3, -5 Sort 5, 0, -8, 2 in increasing order. -8, 0, 2, 5 Put -2/7, -0.03, 1/5, 1, -1.62 in increasing order. -1.62, -2/7, -0.03, 1/5, 1 Sort -80, -1, 1, 5 in ascending order. -80, -1, 1, 5 Put 4, -2, 15, 2, -6 in decreasing order. 15, 4, 2, -2, -6 Sort 4, -67, 0 in ascending order. -67, 0, 4 Put -1, 4, -3, 1 in descending order. 4, 1, -1, -3 Put -6/547, 2, -0.2 in ascending order. -0.2, -6/547, 2 Put -0.13, -2/335, -2/5 in descending order. -2/335, -0.13, -2/5 Sort 13, -39, 0, 4 in decreasing order. 13, 4, 0, -39 Sort -0.1, 0.2, 0 in ascending order. -0.1, 0, 0.2 Put -3, -1/4, -2/3, -1/2, -0.2 in ascending order. -3, -2/3, -1/2, -1/4, -0.2 Sort 5, 10.6, -1/2, 2, -0.2 in decreasing order. 10.6, 5, 2, -0.2, -1/2 Sort 42, 0, -3 in increasing order. -3, 0, 42 Sort 2, -3, -1, 3 in decreasing order. 3, 2, -1, -3 Sort 11, -25, 1, -1 in decreasing order. 11, 1, -1, -25 Put 1, -3, -25 in increasing order. -25, -3, 1 Put 4, -1/19, 3, -2 in increasing order. -2, -1/19, 3, 4 Sort 18, -2, 5, 2 in increasing order. -2, 2, 5, 18 Sort -7, -5, 5, -2 in increasing order. -7, -5, -2, 5 Sort -0.4, -5, 165 in increasing order. -5, -0.4, 165 Sort -22, 0, 5, 4, -2 in descending order. 5, 4, 0, -2, -22 Sort -5, -4, -1, 85 in decreasing order. 85, -1, -4, -5 Sort -3, -2/9, 42/13, -4/3. -3, -4/3, -2/9, 42/13 Put -36, -3, 4, 1 in increasing order. -36, -3, 1, 4 Put -4/7, 3, 1.6, 1 in decreasing order. 3, 1.6, 1, -4/7 Put 273, 4, 0 in descending order. 273, 4, 0 Put 0.09, -0.5, -0.475 in ascending order. -0.5, -0.475, 0.09 Sort 1/4, 2, 7, 4, -6. -6, 1/4, 2, 4, 7 Sort -2, 12, 4 in ascending order. -2, 4, 12 Sort -4, -1, 1, 0. -4, -1, 0, 1 Sort -1.	{ "pile_set_name": "DM Mathematics" }
0) + -13 -1 Calculate -5 + (11 - 6) - 5. -5 Evaluate (-5 + 85/15)(-3)/2. -1 Calculate (-636)/(-120) - 9/30. 5 What is (26/(-20) + (-3)/15)2? -3 What is the value of -2 - (-1740)/156 - 4/26? 9 What is the value of 2/(-3)39/(-234)? 1/9 Evaluate (2 - 6 - -1) + 3. 0 Calculate 6/(-4)84/(-18). 7 Evaluate ((-76)/16 + 5)/((-6)/(-8)). 1/3 18/(-11 + 5)(-1)/(-13) -3/13 Evaluate (-2)/(-3)2/(44/99). 3 What is the value of (0 + 3/2)-2? -3 Evaluate (-2)/13-1 + 1584/858. 2 2(912/180 - 5) 2/15 (-1258)/6512 - (-1 - 10/(-16)) 2/11 What is 7 - 11/(77/45)? 4/7 Evaluate (-4 - (-2 + -2))/2. 0 Calculate ((-160)/(-25) - 6)(-10)/(-14). 2/7 Calculate 1 - 28/(-42)-9. -5 What is 330/(-88) - (-3)/4? -3 9/27 + (-1)/(-3) 2/3 (-2)/(((-2)/(-15))/((-1)/(-5))) -3 What is the value of (-3)/(-12)(-352)/(-110)? 4/5 What is (13 + 189/(-14))(-2)/(-7)? -1/7 Evaluate (2/7)/(6 + 581/(-98)). 4 Calculate 3-1(7/(-21) - -1). -2 Calculate 10(24/(-15))/8. -2 Evaluate (-1)/(-5)(4 - (4 - 3)). 3/5 What is the value of 4 + (2/(-1) + 4)-1? 2 Evaluate (11 - (-68)/(-6))(3 + 0). -1 Evaluate (-18)/2432/(-8). 3 What is the value of ((-192)/(-960))/((-4)/(-10) + -1)? -1/3 8/(-24)(-2 + 17) -5 0/37 - (5 - 0) -5 (22/(-1254))/(1/6) -2/19 Calculate ((-18)/(-48))/(15/4). 1/10 What is (-15)/10 - 11/(-2)? 4 Calculate -23 + 19 + (-30)/(-8). -1/4 Evaluate ((-25)/(-250))/((-8)/(-20)). 1/4 What is (-5)/((-100)/108) + (-4)/10? 5 2 + 3 + (-16)/3 -1/3 What is 5/(-9) + (-154)/63? -3 Evaluate (20/5 + -2)(-2)/4. -1 What is the value of 9/(9/2)-2? -4 Evaluate (-9 + 10)-11. -1 Evaluate -2(-2 + (-4)/(-8))-1. -3 What is 5/(0 + 1)(-150)/(-125)? 6 What is the value of (-2)/((-4)/2)1? 1 Calculate -5 + -5 + 350/30. 5/3 Calculate (-6(-2)/15)/(76/10). 2/19 Calculate (0 - (-9)/(-4))/(9/(-6)). 3/2 Evaluate 0/(12/4) - 0. 0 Evaluate (-1)/4 + (-3)/4. -1 Evaluate (-5)/(-12) - (-24)/(-144). 1/4 Calculate (-33 - -29) + (-13)/(-3) + 0. 1/3 What is -2 + (-60)/(-27) - 100/(-36)? 3 Calculate 380/(-65) - (8 - 14). 2/13 (-1)/((-6)/(-36) - 2/4) 3 What is 2/3(-72)/162? -6 What is 6/(-135) + 26/18 + -1? 2/5 Evaluate (-24)/1280-16 - 18/10. -3/2 Calculate 4 + (-1556)/380 + (-3)/(-15). 2/19 Calculate 10/8 - 1 - (-102)/(-216). -2/9 What is the value of (12/(-15))/((-84)/315)? 3 What is 4/(-56)-4 + 32/84? 2/3 What is the value of (10/(-6))/((-50)/3603)? 4 (16/(-12) - (-1)/3) + -2 -3 Evaluate (1 + (-2)/(-6))(-36)/8. -6 (-3 - (7 + (5 - 10))) + 4 -1 0 + -3 + (1 - (-13)/7) -1/7 What is the value of 5 + (-95)/(-105) - 4/(-42)? 6 What is the value of ((-3)/10)/(-1 - 14/(-8))? -2/5 Evaluate (-2)/4(-38)/133. 1/7 Calculate -8 - ((-28)/2 + 8). -2 Calculate (0 - -31) + (-35)/15. 2/3 Evaluate 9/(-30) + 187/990. -1/9 Evaluate (-27)/(189/196)(-3)/12. 7 What is the value of (56/84)/(2/6)? 2 Calculate 164/350 - 61/1525. 3/7 Evaluate 4((-15)/(-18) - 1). -2/3 What is the value of 550/(-220)(-16)/(-70)? -4/7 26/(-247) + 165/665 1/7 What is the value of ((1/(-2))/(-1))/(32/(-320))? -5 Calculate (-60)/75 - (-11)/(-5). -3 (0 - 88/24) + 3 -2/3 Calculate 22 + -24 - (0 - 3). 1 Calculate 33/(131670/(-112)) + 4/30. 2/19 What is 6((-1)/3)/((-42)/63)? 3 What is the value of 12/72 + (-25)/6? -4 183/1220 - (12/(-10))/(-3) -1/4 Calculate (4/8 + -1)-10. 5 What is the value of 1 + (2/(-10) - 88/110)? 0 Calculate (96/42 + -2)/(24/14). 1/6 (28/(-18) + 1)(-14)/(-35) -2/9 6/4(-6 - 34/(-6)) -1/2 (-22)/(-10) + 36/(-6) -4/5 ((-6)/3)/(22/88) -8 Calculate 3(-1)/30. 0 Evaluate (4/3)/((-32)/8). -1/3 ((-90)/160)/((-12)/(-16) + 0) -3/4 What is the value of (121/(-22) + 4)2/1? -3 (4/(-18))/((-24)/72) 2/3 Calculate -4 - -6 - (-1)/((-12)/30). -1/2 What is -5 + (0/(15/3))/(-2)? -5 Calculate (9/3 - 5)48/24. -4 (-112/(-88))/(23/(-46)) -3/11 What is the value of 6/(-15) - (-2)/704? -2/7 Evaluate ((48/(-18))/(8/(-12)))/(-1). -4 What is the value of ((-3)/4)/(73/146)? -3/2 Calculate (-92)/562 + 4/14. -3 (-28)/(-11) + -518/165 2 What is 156/(-315) + (44/10)/11? -2/21 Calculate 1/210/(-1) + 0. -5 Evaluate (-24)/(-8)(1 + (-2)/6). 2 Evaluate ((-6)/45)/((-8)/(-12)). -1/5 What is the value of ((-186)/24 - -8)-3? -3/4 Calculate (-2)/(-2)16/(-4). -4 ((-72)/180)/(4/(-30)) + -1 2 Calculate 64/14 + (99/(-63) - -2). 5 Calculate (-1 - -5)-2(-4)/(-240). -2/15 What is 2/(-42) + 16/48? 2/7 What is the value of (-17 - 3)10/(-25)? 8 What is (0 - 10/5)/(-1)? 2 Calculate (-2)/12 + 44/264. 0 Evaluate 448/44 - (-8 + 18). 2/11 Calculate (-2)/(-1)((-6)/(-4) - 4). -5 Evaluate -7 + (-13)/(-11) - -6. 2/11 What is the value of -3 + -4(-3)/6 + 1? 0 (9(-2)/(-4))/((-75)/(-25)) 3/2 Evaluate (-27)/(-78) - 51/102. -2/13 What is 0 - 1-2 - 3280/1558? -2/19 Evaluate 2/(-28) - (-14)/(-20384)8. -1/13 Calculate 2-13/63-3. 2/7 Evaluate 5 - 1 - (-11 - -11)/9. 4 Calculate -5521/(-140) + -8. 1/4 Evaluate (-15)/(-10)16/(-24). -1 5/(15/6)1 2 What is 4 - (8/28 - 26/(-7))? 0 ((-12)/(-15))/(18/15)3 2 Calculate (64/(-70))/((-156)/364) + -2. 2/15 ((-36)/(-189))/((-10)/30) -4/7 What is 6 + (-5 - 9) + 10? 2 Evaluate 1(-6 + 0)/(-24). 1/4 What is -1 - 8/3 - (-28 - -24)? 1/3 Calculate (8/(-48))/(28/378). -9/4 Calculate 14/(-21)(-5)/(-15). -2/9 Evaluate 3/(-2)(0 + 16/12). -2 What is (-102)/2805(-6 + 1)? 2/11 Calculate 2 - 5 - (-125)/40. 1/8 Calculate (-15)/6 + 2/4 - -1. -1 104/(-5 + 13) - 8 5 (-7)/(-35) - (-2)/(80/(-28)) -1/2 Evaluate -8 - -7 - ((-7)/3 - 0). 4/3 What is the value of 14/21 + (-26)/6 + 3? -2/3 What is the value of 1((-23)/(-7) + -3)? 2/7 Evaluate -15((-51)/9 + 5) - 1. 9 Evaluate ((-8)/(-8)-1)/(1/3). -3 Calculate ((-5)/2)/(35/(-30)). 5 Evaluate (-1692)/(-696) - 6/(-87). 5/2 ((-12)/8)/((-21)/28) 2 Calculate 16/(-4) + 9/((-108)/(-56)). 2/3 What is the value of -5 + 26/4 + 132/24? 7 Calculate (-21)/(-15)(-4)/7. -4/5 What is the value of (-1)/5315/42? -3/2 Calculate -27 + 8 - -9 - -7. -3 What is the value of ((-2)/(-7))/(((-286)/14)/11)? -2/13 Calculate (0 + (-25)/325)(1 - 2). 1/13 What is (-14)/16 - -2 - (-153)/(-204)? 3/8 Calculate (5 - 1)/(4/2). 2 (-3)/(-6) - 55/70 -2/7 101/(-72)-12 5/3 Calculate (-60)/(-144) + 2/(-3). -1/4 Evaluate (1/(21/14))/(4/6). 1 What is (-3 + 6)3/(-45)? -1/5 (-1)/(0 + -2 + 4 + 0) -1/2 Evaluate (4 + -3)((-330)/35 + 9). -3/7 What is the value of -2 - 4 - 765/(-120)? 3/8 97/19 + -12 + 7 2/19 Calculate (-28)/(-24) + (-7)/42. 1 What is the value of -21(156/(-702))/((-2)/(-3))? 7 ((-4)/8)/(7/2) -1/7 Calculate 848/(-60) + 14 - 32/(-15). 2 36/60 - (-56)/(-180)3 -1/3 What is the value of (-6)/4 + ((-3)/2 - -2)? -1 Calculate 0 + (-1001)/195 + 5. -2/15 What is 2/(-33)(21 - 22)? 2/33 3(-4)/(-54) - 96/216 -2/9 Calculate -3 + 7 + (-24)/4. -2 What is the value of ((-124)/44 - -3) + 3/165? 1/5 (-55)/(-44) - (-3)/(-4) 1/2 What is ((-4)/(-7))/((-1448)/(-3801))? 3/2 Calculate (-2)/(-6) - 1220/(-183). 7 (6 + -7)/((3/(-3))/(-3)) -3 Evaluate (-2 + 15 - 5) + -6. 2 What is the value of -1 - ((-30)/8)/5? -1/4 What is the value of (22 + -12)16/(-20)? -8 What is the value of 29/(-9) - (-24)/108? -3 Evaluate 9/(-3) + (2 - 0). -1 What is the value of (-1)/((-15)/(-6) + -2) + -2? -4 What is the value of 66/(-4)-4(-14)/(-84)? 11 Calculate (6/46)/((-15)/(-10)). 2/23 What is 9/24 + (-47)/40? -4/5 ((-3)/6 + 1)/(9/4) 2/9 Evaluate 16/(-40) - (-8)/10. 2/5 What is the value of (-1)/(-5) - (-114)/380? 1/2 Evaluate 3/(-6)(85/(-15) - -5). 1/3 What is the value of (-1)/(-7 + (-7)/(-2))? 2/7 30/40(2 + 0 + 2) 3 Evaluate (-4)/14 + -1 + 126/294. -6/7 What is the value of -1 - ((-12)/(-16) + (-1)/4)? -3/2 What is (2/(-6))/(1/55)? -1/3 1/(-1) - 1 - (-51)/51 -1 What is the value of 20/(-6)(-2 + 1)/5? 2/3 (16/10)/4 - 207/230 -1/2 Evaluate (-2)/(1-6)54/(-153). -2/17 Calculate 350/(-100)12/14. -3 7 + -9 - (-22 + 17) 3 Evaluate (-6)/(-57) - (-50)/(-114). -1/3 What is (-5)/(-50)-61 + 0? -3/5 Evaluate ((-18)/12)/(4/(-8)-1). -3 Evaluate 18/15 - 7/35. 1 What is (-2)/4-1(-1 - 7)? -4 What is the value of (-550)/100 - (-5 - 0)? -1/2 Calculate (180/(-54))/((-4)/(-6)). -5 -1 + (-49)/(-35) - -1 7/5 What is (21/(-9))/((-49)/126)? 6 (510/(-35) - -16)1-7 -10 Calculate -4 - -5 - (1 + 2 + -3). 1 Evaluate -4 + 18/15 - (-8)/10. -2 (-8)/(-12) + (-19)/15 -3/5 What is the value of (-2982)/213 + (-124)/(-9)? -2/9 What is 4/30 + 87/(-90)? -5/6 Evaluate 1 + -1 - 12/6. -2 What is 14/3 - 2	{ "pile_set_name": "DM Mathematics" }
creasing order. -4, -3, 0, 6401 Sort -7, 14, -5, -4 in decreasing order. 14, -4, -5, -7 Sort 2, -2/139, -219, 0.5 in decreasing order. 2, 0.5, -2/139, -219 Sort 7464, -5, -157 in descending order. 7464, -5, -157 Put -3, 6, -2, 1.5, 0.4, -2/17 in descending order. 6, 1.5, 0.4, -2/17, -2, -3 Sort 2, 0, -95, 4, 13 in ascending order. -95, 0, 2, 4, 13 Put 2/13, 1, -41, 28/13 in descending order. 28/13, 1, 2/13, -41 Sort 13.77, -1, -0.1, 3/4. -1, -0.1, 3/4, 13.77 Put 3849, 4, 1, -3 in decreasing order. 3849, 4, 1, -3 Put 2, 484, 4 in increasing order. 2, 4, 484 Put 1, -0.01, 4, -0.1, 6.329 in increasing order. -0.1, -0.01, 1, 4, 6.329 Sort -1148, -1, -4, 3 in increasing order. -1148, -4, -1, 3 Put -14, -4, -15, 14, -6 in ascending order. -15, -14, -6, -4, 14 Sort 4, -2, -3, -178. -178, -3, -2, 4 Put 45, -14, 4, -2, 34 in increasing order. -14, -2, 4, 34, 45 Put -344, 173, 5 in ascending order. -344, 5, 173 Sort 1, 27, -988, 0 in ascending order. -988, 0, 1, 27 Sort 70, 9, -4, -5 in descending order. 70, 9, -4, -5 Sort -5, 4, -244, -12, 7, 0 in increasing order. -244, -12, -5, 0, 4, 7 Sort -3535, -20, -2 in ascending order. -3535, -20, -2 Sort -3, -704, -1 in increasing order. -704, -3, -1 Put -7165, 0, 177 in descending order. 177, 0, -7165 Put 43113, -2, 4, 1, 0 in increasing order. -2, 0, 1, 4, 43113 Sort -1, 5, -26, 1, 66 in descending order. 66, 5, 1, -1, -26 Put 0, 4, 2, -2, 20, 112 in descending order. 112, 20, 4, 2, 0, -2 Sort 64, 1, -0.117, -0.3, 0.7. -0.3, -0.117, 0.7, 1, 64 Sort 504, 0, 0.4, -1, -11, -0.5 in decreasing order. 504, 0.4, 0, -0.5, -1, -11 Put -74, -1, -2, 1, -29 in descending order. 1, -1, -2, -29, -74 Put -0.25, -3, 4/693, 3 in increasing order. -3, -0.25, 4/693, 3 Put 9, 1, 49, 5, -4, 827 in descending order. 827, 49, 9, 5, 1, -4 Sort 22, 43, -23. -23, 22, 43 Sort 11, 1, -14, -23 in decreasing order. 11, 1, -14, -23 Put 86, -0.3, -9/23 in increasing order. -9/23, -0.3, 86 Sort -4, -84, 3, 147. -84, -4, 3, 147 Sort -12, -5, 2, -140, -2 in descending order. 2, -2, -5, -12, -140 Sort 0.02, -2/15, -1/2, 0.0411, -2 in increasing order. -2, -1/2, -2/15, 0.02, 0.0411 Sort -20, -3082, -5 in ascending order. -3082, -20, -5 Put 0, 8, -340 in ascending order. -340, 0, 8 Put -32, -5, -2, 0, 2 in decreasing order. 2, 0, -2, -5, -32 Sort -1, -3, -7, 121 in increasing order. -7, -3, -1, 121 Put 3, 0.3, -319, -3/7, 0.4 in increasing order. -319, -3/7, 0.3, 0.4, 3 Sort 2, 1/3, 1.267, -4 in decreasing order. 2, 1.267, 1/3, -4 Sort -4, 0.4, 20392.6 in decreasing order. 20392.6, 0.4, -4 Sort 1229, 0.2, -2/19 in ascending order. -2/19, 0.2, 1229 Put -3/2, 2/89, -1/460 in ascending order. -3/2, -1/460, 2/89 Sort -3, 395, 3, -2. -3, -2, 3, 395 Put -6, -2/5, -0.2, 13.7 in descending order. 13.7, -0.2, -2/5, -6 Sort 4, 0, -1, -14, 32 in decreasing order. 32, 4, 0, -1, -14 Sort 33/16, -7, 0.1, 84 in decreasing order. 84, 33/16, 0.1, -7 Sort 0.3, -2/11, -0.2, 23.6, -0.3 in decreasing order. 23.6, 0.3, -2/11, -0.2, -0.3 Sort 0, -3, -14, -5, -245 in increasing order. -245, -14, -5, -3, 0 Sort 5/4, -18, -0.1, -0.3, -0.5, 84. -18, -0.5, -0.3, -0.1, 5/4, 84 Sort -7/68, 9/4, -10 in descending order. 9/4, -7/68, -10 Put -10, -0.3, 1.3, -8 in ascending order. -10, -8, -0.3, 1.3 Sort 3418, 1/2, 17, -0.1 in decreasing order. 3418, 17, 1/2, -0.1 Sort 301, -12, -14/11, -2/11 in descending order. 301, -2/11, -14/11, -12 Put 5, -4, -3, -85, 9, 2 in ascending order. -85, -4, -3, 2, 5, 9 Sort -3, -10, 2, -2, -1 in increasing order. -10, -3, -2, -1, 2 Put -26, 2, 56, 5, 4 in decreasing order. 56, 5, 4, 2, -26 Sort -43, -636, 4, -2 in ascending order. -636, -43, -2, 4 Put -7/3, -5, -1, 5, -3/4 in increasing order. -5, -7/3, -1, -3/4, 5 Sort 0.2, -2/9, 42, -1/2, -0.08 in decreasing order. 42, 0.2, -0.08, -2/9, -1/2 Put 5, -58, 42, -12, -4 in decreasing order. 42, 5, -4, -12, -58 Put 3, 4, -3, 1/2, -4816 in decreasing order. 4, 3, 1/2, -3, -4816 Put 0.1, -29888, -3 in decreasing order. 0.1, -3, -29888 Sort -3, 98, -41, -1 in ascending order. -41, -3, -1, 98 Sort 1465, -1, -2, 0, 58. -2, -1, 0, 58, 1465 Put 2, 1, -17, 56/29 in descending order. 2, 56/29, 1, -17 Sort -1/118, 4, -0.05, -2/9, 0.03 in ascending order. -2/9, -0.05, -1/118, 0.03, 4 Sort 87, 4, 25, 10 in decreasing order. 87, 25, 10, 4 Put -3.7, 61/5, -7 in decreasing order. 61/5, -3.7, -7 Put 7, 5, 28, 2, 1, -1 in descending order. 28, 7, 5, 2, 1, -1 Sort -0.5, 2.851, -2/5 in ascending order. -0.5, -2/5, 2.851 Sort 1, 10, -643, 3. -643, 1, 3, 10 Sort -71, 0.2, -29, 23 in decreasing order. 23, 0.2, -29, -71 Put 4, 1, 3, 577, -8 in increasing order. -8, 1, 3, 4, 577 Sort 0.06, 7, -0.13, -5, 1, 0.2 in decreasing order. 7, 1, 0.2, 0.06, -0.13, -5 Sort 8, -15, -9, 2 in ascending order. -15, -9, 2, 8 Sort 1, -69735, 0. -69735, 0, 1 Sort -4, 1, -10, -538. -538, -10, -4, 1 Sort 3, 0.023, 361. 0.023, 3, 361 Put -66, -4, 5, 531 in descending order. 531, 5, -4, -66 Put 3, 21193, -5 in decreasing order. 21193, 3, -5 Put -29, -11, -1/16, -3, 10 in descending order. 10, -1/16, -3, -11, -29 Put -4, -3/2, 7, -3, 45 in decreasing order. 45, 7, -3/2, -3, -4 Sort 6, -5, -105, -6, 0 in descending order. 6, 0, -5, -6, -105 Sort -6, -7, -2, 2, -3, 3. -7, -6, -3, -2, 2, 3 Sort 0.2, -32, -2/11, 239/3, -2/3 in decreasing order. 239/3, 0.2, -2/11, -2/3, -32 Sort -3, -14, -13, -5, 14, -1. -14, -13, -5, -3, -1, 14 Sort -2/217, -1, -2/7, -0.0681. -1, -2/7, -0.0681, -2/217 Put 1/3, 1149, -0.4 in decreasing order. 1149, 1/3, -0.4 Sort 0, 4, 7, -6739 in increasing order. -6739, 0, 4, 7 Sort 2/5, 66, 0.13, 2/9, 2/13, 0 in increasing order. 0, 0.13, 2/13, 2/9, 2/5, 66 Sort 1, -441, 5 in descending order. 5, 1, -441 Put -4, 3, 17, 4 in decreasing order. 17, 4, 3, -4 Sort 12, -1, -24, 2 in decreasing order. 12, 2, -1, -24 Sort 112359, -8, 2/13 in decreasing order. 112359, 2/13, -8 Put -153, -8, 6, -3 in increasing order. -153, -8, -3, 6 Sort -5, 23, 5, -39, 8 in ascending order. -39, -5, 5, 8, 23 Sort 13, -4, 2683. -4, 13, 2683 Put -9, -11, -4059 in descending order. -9, -11, -4059 Sort 76, -4, 9, -2, 3, 0 in ascending order. -4, -2, 0, 3, 9, 76 Sort -105, 3, -11, -1. -105, -11, -1, 3 Sort -4, -3, 6, -1, -2/127 in ascending order. -4, -3, -1, -2/127, 6 Sort 1, -10/3, 0.3, 4905 in increasing order. -10/3, 0.3, 1, 4905 Put -1/3, 77.7, -6, -1, -0.2 in ascending order. -6, -1, -1/3, -0.2, 77.7 Put -31, 2.46, 0 in ascending order. -31, 0, 2.46 Put 16, 5/6, -475 in increasing order. -475, 5/6, 16 Sort 10801, -4, 2. -4, 2, 10801 Sort 1141, 34, 6 in descending order. 1141, 34, 6 Sort 6, 45, -21 in increasing order. -21, 6, 45 Put -3/7, -348, 7/6 in ascending order. -348, -3/7, 7/6 Sort 0, 1, 7, -1619/8, -2/7, 3 in increasing order. -1619/8, -2/7, 0, 1, 3, 7 Sort 41, -2, 22/9, 5, -2/7, -3 in descending order. 41, 5, 22/9, -2/7, -2, -3 Put -1/77, -0.5, -5, -3, 1, 1.9 in ascending order. -5, -3, -0.5, -1/77, 1, 1.9 Sort -65, -5, 3, -10, -32 in decreasing order. 3, -5, -10, -32, -65 Sort -60, 3, 4, 6, -4, 77 in descending order. 77, 6, 4, 3, -4, -60 Sort -860, 4, -1, -2 in decreasing order. 4, -1, -2, -860 Put -164, -44, -1 in decreasing order. -1, -44, -164 Put 3, 0, -2, -8, 4, -6 in increasing order. -8, -6, -2, 0, 3, 4 Sort -18, 11, 2, -1, 14, 5 in decreasing order. 14, 11, 5, 2, -1, -18 Sort 53.75, -8, 0 in ascending order. -8, 0, 53.75 Sort -0.5, 1/7, -71, 0.6 in descending order. 0.6, 1/7, -0.5, -71 Sort -2, 2, 169219 in descending order. 169219, 2, -2 Sort 5, 42, 1, -41, -3, -4 in decreasing order. 42, 5, 1, -3, -4, -41 Sort 5, 76639, 2 in descending order. 76639, 5, 2 Sort 4, 265, 1, -3 in ascending order. -3, 1, 4, 265 Sort -2/597, 1, -5, 2, 0.06, 4 in descending order. 4, 2, 1, 0.06, -2/597, -5 Sort 5, 1/1989, -1, -17. -17, -1, 1/1989, 5 Put -3, 130, 1, -7 in increasing order. -7, -3, 1, 130 Sort 14, -3, -76, 5, -4, 1. -76, -4, -3, 1, 5, 14 Sort -2, 4, -1282 in increasing order. -1282, -2, 4 Sort 0, -1, 514 in increasing order. -1, 0, 514 Put -47, -4, 2, -11 in descending order. 2, -4, -11, -47 Put -1/5, 0.05, -5, -22.588 in increasing order. -22.588, -5, -1/5, 0.05 Put -1, 0, 4, 3, -40, 2 in increasing order. -40, -1, 0, 2, 3, 4 Sort -7, 1, 4, -4, -6792 in decreasing order. 4, 1, -4, -7, -6792 Put 0, -2/35, -1612, -0.2 in decreasing order.	{ "pile_set_name": "DM Mathematics" }
is f? -2, 0, 1 Let w be (-10)/(-45) - 104/(-18). Determine i, given that 5i3 - w - 9i - 2i3 - 3i*2 + 3i*2 = 0. -1, 2 Let z(y) be the first derivative of 2y*2 - 5/2y4 + y6 - 2/5y5 + 3 + 2/3y*3 + 0y. Solve z(j) = 0. -1, -2/3, 0, 1 Suppose -2x + 2 = -x. Suppose 0k - 2kx + 5k*2 - 3k = 0. What is k? 0, 1 Let k be 4 + 2 + (-276)/28 - -4. Let 1/7 + kc2 + 2/7c = 0. What is c? -1 Let u(o) be the third derivative of -o8/1008 - o7/630 + 2o2. Factor u(n). -n4(n + 1)/3 Let u(j) be the second derivative of j*4/66 + 2j3/33 + j2/11 + 4j. Suppose u(y) = 0. Calculate y. -1 Let u(x) = 1 - 2 + 2x*2 - 3x + x. Let s be u(-1). Factor 2b2 + 2 - 3 + s - 4. 2(b - 1)(b + 1) Let u be 3/9-73. Let n(a) = -5a*2 - a - 3. Let l(p) = -3p*2 - p - 2. Let q(z) = ul(z) + 4n(z). Factor q(c). (c + 1)(c + 2) Let v(z) = -2z2 - 1. Let d(t) be the third derivative of -7t5/60 - t4/24 - t*3/2 - 2t*2. Let m(u) = -6d(u) + 22v(u). Factor m(c). -2(c - 2)(c - 1) Let p(v) = -v3 + 2v*2 + 3v + 3. Let r be p(3). Find g such that g - 9 - g*r + 9 = 0. -1, 0, 1 Let h(o) be the first derivative of -3o*4/4 + 15o*3 - 72o*2 - 192o - 29. Find k, given that h(k) = 0. -1, 8 Factor -13 + 18 + 11 + 24y + 12y*2 + 2y*3. 2(y + 2)*3 Suppose 0 = -j - 5b - 7 + 16, 0 = -4j - 2b + 18. Factor -u*4 + 4u*5 - ju5 + u5. u*4(u - 1) Let o(i) be the third derivative of i7/2520 + i6/240 + i5/60 - i4/6 + 4i2. Let m(x) be the second derivative of o(x). Solve m(v) = 0. -2, -1 Let -20/3b + 0 - 4/3b2 = 0. Calculate b. -5, 0 Let z(i) be the third derivative of 0 + 1/108i*4 + 0i + 3i2 + 0i*3 - 1/270i*5. Suppose z(k) = 0. What is k? 0, 1 Let u(r) be the first derivative of -1 + 4/3r*3 + 0r + 1/2r2. Factor u(i). i(4i + 1) Let k(v) be the second derivative of v6/75 - v4/15 + v2/5 - 5v. Solve k(o) = 0 for o. -1, 1 Let q(b) = -4b2 + 2b - 1. Let x be q(1). Let l = 5 + x. Let -lr4 + 8r*3 - 4r - r*5 + 2r*3 + 2r*2 - 5r*5 = 0. Calculate r. -1, 0, 2/3, 1 Let m(g) be the first derivative of 1/2g*6 + 0g*2 - 9/5g*5 + 9/4g*4 + 0g - g*3 - 7. Factor m(s). 3s*2(s - 1)*3 Let s = 1/86 - -35/688. Let r(g) be the first derivative of -g - 5/12g*3 + sg4 + g2 - 3. Factor r(n). (n - 2)*2(n - 1)/4 Let a(t) be the third derivative of t8/1344 + t7/210 + t*6/120 + 5t2. Factor a(q). q3(q + 2)2/4 Let k be (-18)/(-2) + -4 + 3. Let b be k + -8 - 2/(-3). Factor 2/3n - 2/3n3 + 2/3n*2 + 0 - bn*4. -2n(n - 1)(n + 1)*2/3 Find c, given that 2/9c*2 + 28/9c + 98/9 = 0. -7 Factor 0 + 2/7c5 - 4/7c*4 + 4/7c*2 + 0c*3 - 2/7c. 2c(c - 1)*3(c + 1)/7 Let p(b) be the first derivative of -1/12b3 - 3/8b*2 - 1/2b - 2. Find k, given that p(k) = 0. -2, -1 Let u be 203/42 - 2/(-12). Suppose -uf + 62 - 47 = 0. Find l such that 3/5l*f - 3/5l*4 - 6/5 + 9/5l*2 - 3/5l = 0. -1, 1, 2 Let c be 16/10 - (-4)/10. Let a = 2 + c. Factor as2 + 4s*2 - 2 - 6s*2. 2(s - 1)(s + 1) Factor 36c*2 + 31c - c + 5c3 + 13c*3 + 9 + 3c*4. 3(c + 1)*3(c + 3) Let p be 3(5 + -6) - 90/(-4). Factor -pa*2 - 9a - 6a4 - 18a*3 - 3/2. -3(a + 1)*2(2a + 1)2/2 Solve 1 + 2c - 6 - 14c - 3c*2 - 7 = 0. -2 Let b(f) be the first derivative of 12f*5/5 + 3f*4 - 3f*3 - 3f*2 + 3f + 12. Factor b(g). 3(g + 1)2(2g - 1)2 Let 6 + 3/2x*2 - 6x = 0. Calculate x. 2 Suppose -6c + 48 = -3c. Suppose -c = -3w - 7. Suppose -6o*3 + 3o*3 + 2o*w + 2o*3 = 0. Calculate o. 0 Solve 9/4k + 27/4 - 15/4k2 + 3/4k*3 = 0. -1, 3 Let w = -678 + 1062. Let y be (w/100)/((-6)/(-20)). Determine r, given that -yr - 2/5r4 - 16/5r*3 - 48/5r*2 - 32/5 = 0. -2 Let h be (-1 - 0)/(-9)(-108)/(-18). Factor 1/3w2 + 0 + 2/3w*3 - 1/3w*4 - hw. -w(w - 2)(w - 1)(w + 1)/3 Let d = 11 + -11. Let u be 2 + 0/(-2) - d. Factor 0p + 2/7pu + 0 + 4/7p*3 + 2/7p*4. 2p*2(p + 1)*2/7 Let o(s) be the second derivative of 0 - 3/2s*2 - 4s + 1/240s5 + 0s*3 + 0s4. Let c(j) be the first derivative of o(j). Factor c(p). p2/4 Suppose 3a + a - 5y - 28 = 0, -14 = -5a + y. Suppose -s + aj = -4, 4s - 2j - 3 = 1. Factor -2/9l + 0l*2 + s + 2/9l*3. 2l(l - 1)(l + 1)/9 Solve -2u2 + 71u + 0u2 - 66u*2 - 7u + 20u3 - 16 = 0 for u. 2/5, 1, 2 Let r(v) be the third derivative of -v8/1848 + v7/385 - v6/330 - 28v*2. Suppose r(o) = 0. What is o? 0, 1, 2 Suppose 6/5l - 2/5 + 8/5l2 = 0. What is l? -1, 1/4 Let g = -175 + 177. Suppose 2/5z*g + 12/5z + 18/5 = 0. What is z? -3 Let d = -115/3 + 39. What is c in 0 - 2/3c + dc*4 - 2/3c*2 + 2/3c*3 = 0? -1, 0, 1 Factor 0q*3 + 0 + 2/5q - 2/5q5 - 4/5q*4 + 4/5q*2. -2q(q - 1)(q + 1)*3/5 Let t(y) be the second derivative of 0 + 0y*2 + y - 1/40y*5 + 1/12y*4 - 1/15y*6 + 0y*3 + 1/28y*7. Find p, given that t(p) = 0. -2/3, 0, 1 Let t be -1(-4 - -1) + -3. Let tl + 0l*2 - 1/2l*3 + 0 + 1/2l4 = 0. What is l? 0, 1 Let q(j) be the second derivative of -j7/42 - j6/15 - j5/60 + j4/12 + j2 + 2j. Let r(k) be the first derivative of q(k). Factor r(c). -c(c + 1)*2(5c - 2) Let k(x) be the first derivative of x6/45 + x5/15 + x4/18 + x + 3. Let l(y) be the first derivative of k(y). Factor l(w). 2w*2(w + 1)*2/3 Let y be (-2)/12 + (-6)/(-30). Let a(v) be the third derivative of 0v + 0v3 + 0 + v2 + 1/120v*6 + yv*5 + 1/24v*4. Factor a(s). s(s + 1)2 Let q(b) be the second derivative of b7/70 + b*6/25 + 3b*5/100 - 26b. Find n, given that q(n) = 0. -1, 0 Factor 20/3p - 50/3 - 2/3p*2. -2(p - 5)2/3 Let q(m) be the second derivative of m7/105 - m6/25 + m5/25 + m4/15 - m3/5 + m*2/5 + 4m. Factor q(d). 2(d - 1)4(d + 1)/5 Let i(z) be the second derivative of -z6/315 - z5/210 + 2z4/63 + 4z*3/63 - 8z. What is a in i(a) = 0? -2, -1, 0, 2 Determine g so that 5/4g + 11/8 - 1/8g*2 = 0. -1, 11 Suppose 3/4t*2 + 1 + 3t - 5/4t3 = 0. What is t? -1, -2/5, 2 Suppose 0 = w - 15 - 9. Factor -2a + 7a3 + 8a*3 + wa*2 + 2a4 + a4 + 14a. 3a(a + 1)(a + 2)2 Let f = 1 - -4. Let g(l) = -l3 + 5l2 + l - 1. Let k be g(f). Factor -1/3m*5 + 1/3m*k + 0 + 1/3m*3 - 1/3m*2 + 0m. -m*2(m - 1)*2(m + 1)/3 Let s = -10 - -8. Let r(q) = q*3 + 4q*2 + 2q - 1. Let o be r(s). Solve 4uo - 3u*3 + 2u*3 = 0 for u. 0 Let m be (-1)/1 + -9 + 2. Let u = m - -13. Find r such that -6r*2 + 8r*u + 0r*4 + 2r - r*4 + 7r*4 - 10r3 = 0. -1, 0, 1/4, 1 Let b(v) = v2 - 4v - 6. Let r be b(6). Find k, given that -r + 0k3 - k3 + 4k + 4k4 + 14 - k5 - 10k2 = 0. -1, 2 Suppose 59m - 54m - 15 = 0. Factor -2/11d - 6/11d5 - 12/11d*2 + 0 - 24/11d*m - 20/11d*4. -2d(d + 1)3(3d + 1)/11 Let s(n) be the second derivative of n5/50 - n4/2 + 21n*3/5 - 49n*2/5 - n + 5. Factor s(o). 2(o - 7)*2(o - 1)/5 Let v(r) = -2r3 - 5r2. Let u = -6 - 0. Let l be ((-2)/6)/((-2)/u). Let p(o) = o2. Let d(s) = lv(s) - 3p(s). Determine w so that d(w) = 0. -1, 0 Let q be ((-80)/36)/4 - 4/(-6). Let i(c) be the second derivative of 1/27c4 - 1/135c*6 - qc*2 + 0c*5 + 0c*3 + 0 + 4c. Factor i(w). -2(w - 1)2(w + 1)2/9 Let o(t) be the third derivative of t8/952 + 4t7/1785 - t6/255 + 6t*2. Factor o(n). 2n*3(n + 2)(3n - 2)/17 Factor 2 - a*3 + 4a*3 + 2a - 5a3 - 2a*2. -2(a - 1)(a + 1)2 Let v = 211/5 - 42. Suppose -vb*2 + 0 + 0b = 0. What is b? 0 Factor -63f2 - 43f - 27f3 - 6f + f - 7 - 5. -3(f + 1)(3f + 2)2 Let j(c) = 4c*5 + 3c*4 - 5c*3 - 2c*2 + 2c + 1. Let w(u) = -u*2 - u - 1. Let r(z) = j(z) + w(z). Determine p, given that r(p) = 0. -1, 0, 1/4, 1 Let y(o) be the first derivative of 8o*5/5 - 7o*4 + 12o*3 - 10o*2 + 4o + 18. Factor y(q). 4(q - 1)3(2q - 1) Let n be ((-8)/(-6))/(4/6). Suppose -6 = -na + 4. Solve 10xa - 3x*5 + 5x*4 + 2x*3 + 4x*4 = 0. -1, -2/7, 0 Let o = -25/6 - -9/2. Find p, given that -p + 0p*2 + op*3 + 2/3 = 0. -2, 1 Let b(h) = -4h - 68. Let q be b(-18). What is o in 1/5o2 + 0 - 1/5o*q + 1/5o - 1/5o3 = 0? -1, 0, 1 Let w(h) = 12h*3 - 8h*2 + 18h + 10. Let y(q) =	{ "pile_set_name": "DM Mathematics" }
6, 2725820189, 2725820258, 2725820359, 2725820498? o3 + o2 - o + 2725820113 What is the u'th term of 3010616, 6021273, 9031930, 12042587, 15053244, 18063901? 3010657u - 41 What is the l'th term of 98742795, 98742797, 98742799, 98742801, 98742803, 98742805? 2l + 98742793 What is the w'th term of -16867, -32481, -48077, -63655, -79215, -94757, -110281? 9w2 - 15641w - 1235 What is the w'th term of -2918, -5373, -9464, -15191, -22554? -818w2 - w - 2099 What is the f'th term of -76167, -609514, -2057223, -4876476, -9524455? -76197f3 + f2 + 29f What is the u'th term of -2046989, -4094001, -6141015, -8188031? -u2 - 2047009u + 21 What is the n'th term of 4000, 16123, 36364, 64723? 4059n2 - 54n - 5 What is the q'th term of 14322746, 14322748, 14322750, 14322752, 14322754, 14322756? 2q + 14322744 What is the j'th term of 2241, 17784, 59889, 141816, 276825, 478176, 759129, 1132944? 2210j*3 + 21j*2 + 10j What is the w'th term of 697564, 1395123, 2092706, 2790319, 3487968, 4185659? w*3 + 6w*2 + 697534w + 23 What is the n'th term of -65110, -130411, -195712, -261013? -65301n + 191 What is the m'th term of 302, 1205, 2730, 4895, 7718, 11217, 15410? 3m*3 + 293m*2 + 3m + 3 What is the l'th term of -6832043, -13664083, -20496123, -27328163? -6832040l - 3 What is the s'th term of -58, -141, -340, -733, -1398, -2413, -3856? -13s*3 + 20s*2 - 52s - 13 What is the t'th term of 179, 583, 1683, 3821, 7339, 12579, 19883? 57t3 + 6t*2 - 13t + 129 What is the u'th term of 283077182, 566154364, 849231546, 1132308728? 283077182u What is the h'th term of 1467409, 1467409, 1467423, 1467457, 1467517, 1467609? h3 + h2 - 10h + 1467417 What is the i'th term of -206104, -412205, -618300, -824389? 3i2 - 206110i + 3 What is the s'th term of 17944975, 35889950, 53834925, 71779900? 17944975s What is the l'th term of 1117832993, 2235665987, 3353498981, 4471331975, 5589164969? 1117832994l - 1 What is the z'th term of -18295, -19443, -20591, -21739, -22887? -1148z - 17147 What is the m'th term of 12756756, 12756763, 12756790, 12756849, 12756952, 12757111? 2m*3 - 2m*2 - m + 12756757 What is the n'th term of 486, 894, 1326, 1782, 2262, 2766, 3294? 12n*2 + 372n + 102 What is the t'th term of -677684, -2710672, -6098968, -10842572, -16941484, -24395704? -677654t2 - 26t - 4 What is the m'th term of 324598, 647560, 970522, 1293484? 322962m + 1636 What is the o'th term of 253139141, 253139140, 253139139, 253139138, 253139137, 253139136? -o + 253139142 What is the y'th term of -1047950, -1047972, -1047996, -1048022, -1048050, -1048080? -y2 - 19y - 1047930 What is the g'th term of 1063070, 2126130, 3189180, 4252214, 5315226, 6378210, 7441160, 8504070? -g3 + g2 + 1063064g + 6 What is the c'th term of -13287, -26453, -39503, -52437, -65255, -77957, -90543? 58c*2 - 13340c - 5 What is the c'th term of -8269, -32971, -74113, -131701, -205741? -c*3 - 8214c*2 - 53c - 1 What is the u'th term of 995, 4438, 11033, 21482, 36487, 56750, 82973, 115858? 117u3 + 874u*2 + 2u + 2 What is the c'th term of 28411, 57311, 86215, 115123? 2c2 + 28894c - 485 What is the j'th term of 168791, 168774, 168741, 168692, 168627, 168546, 168449? -8j2 + 7j + 168792 What is the m'th term of -47319, -75266, -103215, -131166, -159119, -187074, -215031? -m*2 - 27944m - 19374 What is the q'th term of -550127, -550100, -550055, -549992, -549911? 9q2 - 550136 What is the v'th term of 2146, 8694, 19620, 34924, 54606? 2189v*2 - 19v - 24 What is the a'th term of -243, -76, 753, 2250, 4421, 7272, 10809, 15038? a*3 + 325a*2 - 815a + 246 What is the k'th term of -20524, -83239, -188144, -335233, -524500, -755939, -1029544? k*3 - 21101k*2 + 581k - 5 What is the s'th term of -1417134, -5668386, -12753804, -22673388, -35427138, -51015054, -69437136? -1417083s2 - 3s - 48 What is the q'th term of 4779, 7070, 9361? 2291q + 2488 What is the s'th term of 1752300, 3504569, 5256838, 7009107? 1752269s + 31 What is the c'th term of -4939, -6085, -7231, -8377, -9523? -1146c - 3793 What is the j'th term of 3723001, 3723002, 3723005, 3723010, 3723017, 3723026, 3723037? j2 - 2j + 3723002 What is the w'th term of 20817070, 20817053, 20817050, 20817067, 20817110, 20817185? w3 + w2 - 27w + 20817095 What is the a'th term of -1708, -7115, -16098, -28633, -44696? 4a*3 - 1812a*2 + a + 99 What is the w'th term of -26351124, -52702252, -79053386, -105404526, -131755672? -3w*2 - 26351119w - 2 What is the a'th term of -2262, -2257, -2240, -2193, -2098? 3a3 - 12a*2 + 20a - 2273 What is the o'th term of 252835, 1011352, 2275541, 4045396, 6320911, 9102080? -o*3 + 252842o*2 - 2o - 4 What is the b'th term of 13245226, 13245204, 13245182? -22b + 13245248 What is the d'th term of -12877, -14047, -15215, -16381, -17545, -18707, -19867? d2 - 1173d - 11705 What is the z'th term of 77480, 150558, 223636, 296714, 369792, 442870? 73078z + 4402 What is the a'th term of 53284, 61118, 74176, 92458? 2612a*2 - 2a + 50674 What is the j'th term of 860869, 860849, 860829, 860809, 860789, 860769? -20j + 860889 What is the y'th term of 482068, 964224, 1446378, 1928530, 2410680, 2892828, 3374974? -y2 + 482159y - 90 What is the t'th term of 1062185, 2124373, 3186551, 4248713, 5310853, 6372965? -t3 + t2 + 1062192t - 7 What is the x'th term of -15269120, -30538237, -45807354, -61076471? -15269117x - 3 What is the p'th term of -221235, -221237, -221239, -221241? -2p - 221233 What is the z'th term of -34829, -69967, -105105? -35138z + 309 What is the l'th term of -3125550, -6251096, -9376640, -12502182, -15627722, -18753260, -21878796? l*2 - 3125549l - 2 What is the p'th term of -325869, -325830, -325791? 39p - 325908 What is the x'th term of 426598, 1706205, 3838822, 6824449, 10663086, 15354733? 426505x*2 + 92x + 1 What is the r'th term of 1235, 2180, 2833, 3194, 3263, 3040, 2525? -146r2 + 1383r - 2 What is the d'th term of 2385818, 4771638, 7157458, 9543278, 11929098, 14314918? 2385820d - 2 What is the g'th term of -1061, -2933, -6075, -10505, -16241, -23301, -31703? -3g*3 - 617g*2 - 441 What is the z'th term of -286917, -286941, -286965, -286989, -287013? -24z - 286893 What is the w'th term of 17942790, 17942787, 17942784? -3w + 17942793 What is the x'th term of 42036, 36457, 30878, 25299, 19720? -5579x + 47615 What is the k'th term of -378, -1613, -3716, -6705, -10598, -15413, -21168? -3k3 - 416k*2 + 34k + 7 What is the p'th term of 16112, 62710, 139790, 247352, 385396, 553922? 15241p2 + 875p - 4 What is the q'th term of 14618794, 14618844, 14618898, 14618956, 14619018, 14619084? 2q2 + 44q + 14618748 What is the y'th term of 5302988, 10606035, 15909142, 21212315, 26515560? y*3 + 24y*2 + 5302968y - 5 What is the l'th term of 4300201, 8600422, 12900643, 17200864, 21501085? 4300221l - 20 What is the b'th term of -679, 1251, 3181? 1930b - 2609 What is the a'th term of -55882115, -55882113, -55882111, -55882109? 2a - 55882117 What is the b'th term of -24637, -98808, -222463, -395596, -618201? b3 - 24748b*2 + 66b + 44 What is the r'th term of 6793, 6773, 6757, 6745, 6737, 6733, 6733? 2r2 - 26r + 6817 What is the i'th term of -4447, -4253, -4059, -3865, -3671? 194i - 4641 What is the r'th term of -486122797, -972245594, -1458368391, -1944491188? -486122797r What is the v'th term of 115044, 114984, 114908, 114810, 114684, 114524? -v*3 - 2v*2 - 47v + 115094 What is the w'th term of -12, 130, 718, 2010, 4264, 7738, 12690? 43w3 - 35w*2 - 54w + 34 What is the v'th term of -1414, -1676, -1976, -2332, -2762, -3284, -3916? -3v3 - v2 - 238v - 1172 What is the v'th term of 240882775, 240882773, 240882771? -2v + 240882777 What is the m'th term of 25453, 25573, 25693, 25813, 25933? 120m + 25333 What is the w'th term of -17138, -68949, -155430, -276581? -17335w2 + 194w + 3 What is the j'th term of 191707, 382696, 573685? 190989j + 718 What is the u'th term of 7771, 7961, 8151, 8341, 8531? 190u + 7581 What is the g'th term of -293525, -2348199, -7925175, -18785603, -36690633, -63401415, -100679099? -293525g3 - g2 + 4g - 3 What is the g'th term of -171121, -	{ "pile_set_name": "DM Mathematics" }
t as big as b? True Let i = -74 + 29. Let n = 105 - 106.012. Let x = 0.012 + n. Are x and i equal? False Let z be (-30)/(-9)45/(-6). Let l = -27 - z. Let h be (-3 + (-5)/l)-2. Does h = 2/71? False Let h(u) = -3u2 + 8u - 3. Let t be h(2). Are t and 3/199 unequal? True Let v(s) = 9s2 + 2. Let d(m) = 11m*2 + m + 2. Let w(p) = -5d(p) + 6v(p). Let t be w(-4). Suppose 5n = 4x - t, -3n - 6 = x - 16. Is n > -3? True Suppose -24d + 19d - 2v + 80 = 0, -d - 4v = -16. Suppose 3o + d = -i, 0 = -3i + 2o + 2o + 17. Which is greater: 18/55 or i? 18/55 Let d = -5.7 + -28.3. Let c = -34.3 - d. Let t = -16/9 + 130/63. Which is greater: c or t? t Let o be (-15470)/30930 - 1/(-2). Is o >= 0? False Suppose -75 = 2f + 13. Let c = 272 - 616. Let y be 13/11 - (8 - c/f). Which is smaller: y or 3? y Let a be 16344298/438928 - 16. Is 1 smaller than a? False Suppose -2g - 41 = 3. Let r be (-74)/(-132) + 11/g. Let h = 3068 + -3068. Which is greater: h or r? r Let v = 204.0478 + -0.0478. Let f = v - 211. Is 0.01 > f? True Let a(x) = 41x*2 + 5x - 14. Let c be a(2). Let m(o) = -o*3 - 31o*2 - 67o - 100. Let l be m(-29). Is l at most c? False Let d = -21 - 44. Let h = d + 109. Let m = -43 + h. Which is smaller: 4/7 or m? 4/7 Suppose 0 = 7i - 2i, 0 = 3k + i + 3. Let a = 4351 + -504719/116. Let z = -8/29 - a. Is k at most as big as z? True Let m = 40725.5 - 42227. Which is smaller: 2 or m? m Let g = 1386 - 1385. Is g at least as big as 7953? False Let q(b) be the third derivative of -5b*4/8 + 10b*3 - 208b*2. Let k be q(4). Which is greater: 4/171 or k? 4/171 Suppose -2p = -3l + 260 + 169, 5p + 420 = 3l. Suppose 2k + 2d - 8 = 0, 2k + 3d = 16 - 3. Which is smaller: l or k? k Let x(j) = -2j - 74. Let q be x(-33). Let v(o) = o - 16. Let a be v(q). Let s = a + 23. Which is smaller: s or -6/29? s Let w be (1 - 1)/(3 + -1). Suppose 6d + 25 - 1 = w. Let r be (-12)/(-7) + (-1)/14d. Which is greater: 1 or r? r Let k = -9.76 + 6.77. Let n = k - 0.01. Let p be 72/8190/600. Which is bigger: p or n? p Let n = -9790 - -9790. Are 7/9 and n non-equal? True Suppose 5j + 47i - 52i = 20, 0 = 2j - 5i - 17. Is j at most -2495? False Let y = 219 + -289. Let p = y + 66. Suppose 0 = -b - 8. Is b less than p? True Let i = -128 - -84.6. Let u = i + 44. Let m = 44 + -43.9. Do m and u have different values? True Let u = 7853 + -7843. Is 55/12 greater than or equal to u? False Let s = 0.20434 + -0.10434. Let m be (-2)/10 + (-6)/45. Which is bigger: s or m? s Let u = 301 + -295. Suppose -5r + 244 = 8s - us, -2r + 91 = 3s. Is 51 less than r? False Let l(s) = -18s + 52. Let f be l(6). Let z be (-6)/(-9)402/4. Suppose -3a = 101 + z. Are a and f unequal? False Suppose -2k = 4r - 82, 0k - k = -r + 10. Is r bigger than 318/19? True Let j be (37/(-7) - -5) + (352/(-14))/(-4). Let d(w) be the third derivative of 5w*4/24 - 31w3/6 + w2. Let o be d(j). Is o < 2/75? True Let c = -3/7738 - 1933/3869. Are 133.95 and c equal? False Let a be 11/4 + (-9)/(-36). Let q be -2 + (-3)/(-7)a. Let l = -96 - -94. Are l and q equal? False Let h(w) = -w2 - 7w - 6. Let n be h(-5). Let y(f) = 2f + 6. Let x(a) = a. Let k(q) = -12x(q) + 3y(q). Let s be k(n). Is s less than -7? False Let w = -9/5624 + 14616803/16872. Does w = 866? False Let w(r) = 9r - 633. Let l be w(60). Which is greater: -472/5 or l? l Let q be (-32)/57 - (-2)/3. Let a = -517 - -506.38. Let r = a + 12.62. Is q at most r? True Suppose 9u - 5q + 3080 = 6u, -1015 = u - 4q. Are u and -1036 equal? False Let x(t) be the third derivative of t*4/6 + 13t*3/3 + 2t*2. Let n be (-34)/((-1 - -7) + -5). Let j be x(n). Are -21 and j nonequal? True Let w be 2/1(9108/18018 - (-3)/(-7)). Are w and -5/1162 equal? False Let n be 15726/(-84) - 4/14. Let f(t) = -7t*2 + 65t + 306. Let l be f(-5). Let g = l - n. Is 1/4 greater than g? True Let b = -122/83 + 26884/18177. Which is smaller: b or -3? -3 Let q = 0.156 + -8.156. Let r = q + 1.7. Is r greater than 0.1? False Let b be ((-2)/((-32)/(-12)))/(-96). Let t(p) = -24p + 1. Let f be t(0). Is b > f? False Let o = 244445/13 + -18804. Which is greater: o or -2? o Let f = 190285.96 - 190286. Let a = 0.76 + -0.6. Is f >= a? False Let t = 13346 - 13356. Is t less than -808? False Suppose -7p + 4p = 2p. Suppose p = -255z + 253z - 616. Is -308 less than z? False Let s = -1.1 + -0.7. Let x = 2.5289 - 0.5289. Let u = s + x. Is 1 not equal to u? True Let m = -1694 - -22046/13. Suppose 0 = -44a + 19 + 25. Do m and a have the same value? False Let s = 0 - -1. Let j = 2164/7 - 10063/28. Let h = j - -51. Is h >= s? False Suppose -24s - 27424 = -8s. Is s <= -1715? False Let b be ((-3151718)/4609)/((-4)/22). Is b greater than or equal to 3761? True Suppose -2m = -4s + 95 - 41, 3m + 36 = -3s. Let b = 0 + -12. Which is bigger: m or b? b Let s = 1952404/317 - 6159. Which is smaller: s or -1? -1 Let v be -2 + 1 - (-1 - 0). Let o = -101603 + 103127047/1015. Is o at least v? True Let a = -7836 + 21337429/2723. Which is bigger: a or 0? a Let o(v) = -40v + 2761. Let k be o(69). Is -2/6715 smaller than k? True Let p = 0.5987 - -0.4013. Is p at most 1957? True Suppose 5p = 2n + 259, 4p = 4n + 309 + 215. Which is bigger: -155 or n? n Suppose -5z - 56 = 49a - 53a, -28 = 3z - a. Suppose 0 = -2m + m - 11. Is m less than z? True Suppose 5p = 2v + 14, -13 = -5p + v + 4. Let j be 1 + 7 + -4 + 4. Is j equal to p? False Let a = -35.34 + 36.34. Let o = -0.047 - 3.053. Which is smaller: a or o? o Let h = 3.05 - 3. Let t(w) = -2w2 - 49w - 72. Let c be t(-23). Let o be -8 + c + 8 - 6. Which is bigger: o or h? h Suppose 0 = -4a - 5w + 9 - 3, a - 6 = w. Let m be (0 + 1)a(-4)/(-16). Which is bigger: 4/15 or m? m Let w = -0.7 + 0.89. Let l = 0.22739 - -0.06261. Let k = w - l. Which is smaller: k or -28? -28 Let p = -29 + 34. Suppose pl - 17 - 3 = 0. Let k be (l/24)/((-2)/(-4)). Which is smaller: -1 or k? -1 Let z = 0.13 + -74.13. Let f = -114 - z. Are 0.03 and f equal? False Let w be (2 + -1)-15/15. Let h = -121 + 249. Which is greater: h or w? h Suppose 2f + 7 = k, 4k = 8k - 5f - 28. Let u be (2 + k - 0)/(0 + -1). Let y be 4/1(u/6 + -2). Which is smaller: y or -18? -18 Let b(a) = -a*3 + 74a*2 - 138a - 856. Let g be b(72). Which is greater: g or -425? g Let q(r) = 2r2 + r - 91. Let t be q(-7). Which is smaller: -26/57 or t? -26/57 Let u be (-39)/(-65) + (-41)/85. Suppose -40 = -12c + 17c. Let t be (-7 - c)/(-1 - 0). Which is smaller: t or u? t Let k be 4 + (-14 - -13)/((-1)/(-10)). Let z be (k/4)/(2/(-112)). Is 85 bigger than z? True Let c be 3/(-77)(5 - (-1038372)/(-54)). Let w = -749 + c. Are 1 and w equal? False Suppose -4t + 20484 = -4a, 19t - 18t = 4a + 20469. Which is greater: -5118 or a? a Let s = 240 - 141. Let x = s - 113. Let t(z) = -z3 - 14z*2 + 2z + 30. Let h be t(x). Is -18 at least h? False Let z(g) = -7g + 3. Let n be z(-25). Suppose 3m + 4r - n = 0, -6r - 112 = -2m - 2r. Which is bigger: 57 or m? m Suppose 0 = 5i - r - 49, -5r - 3 = i + 8. Suppose 4s = -2x + 20, 12x - 57 = ix + 3s. Is 15 at most as big as x? True Suppose 140 = -5z - 91l + 96l, 0 = -3l - 24. Which is bigger: -1.1 or z? -1.1 Let z be (-108)/(-234) + 12/(-26). Is 1768 smaller than z? False Let n = 2043 - 2086. Let t = -61 - -104. Let j = t + n. Which is greater: j or 0.4? 0.4 Let w = -56 - 91. Suppose 2o = 38j - 33j - 749, 0 = -o - 7. Let r = j + w. Do r and 1/61 have the same value? False Let z = -57 + 81.6. Let y = z + -24.7. Is y not equal to -53? True Let y be 7(-24)/(-42) - 24. Is 1 at most y? False Let u be (-34)/9 + (-9)/(162/4). Let p be u + 155/40 - (-81)/8. Let s be 65 - ((-12)/p)/((-6)/(-20)). Which is bigger: 68 or s? s Suppose -c + 5o + 1192 = 0, -4o + 8o - 3576 = -3c. Let a be (-62)/93 + c/1770. Is a < 1? True Let c be 304/(-19)1/2. Let k be (124)/(c - -7). Let p be 33(-4)/k1/(-1). Is p != -7? True Let t be 7/(-3 - 32/(-12)). Let a be (t/9)/7-54. Suppose -m = 3q - 7, -2m = 3m - 3q + 1. Which is smaller: m or a? m Suppose 4t - 3r = 2r - 29, 3t + 4r + 14 = 0. Let s be 2/6 + (-545)/105. Which is smaller: s or t? t Let b = -3 - -2. Let p be 3/2(-800)/(-48). Let z be (-1)/(47/(-92)) - (-23 + p).	{ "pile_set_name": "DM Mathematics" }
- 1190 = 0. 14, 17 Let g(r) be the third derivative of -r*7/1260 + 11r*6/240 + 17r*5/180 - 11r*2 - 27. Find z such that g(z) = 0. -1, 0, 34 Let z(o) be the second derivative of -3o*5/20 + 7o*4/4 + 17o*3/2 + 27o*2/2 - 3818o. Determine w, given that z(w) = 0. -1, 9 Let g(w) be the first derivative of -48/11w3 - 36/11w + 7/22w4 + 83/11w*2 - 17. Suppose g(y) = 0. What is y? 2/7, 1, 9 Let l = 387 - 384. Suppose g + l = -4y, -13y - g - 3 = -8y. Factor 0i2 - 3/8i + y - 3/8i5 + 3/4i*3 + 0i*4. -3i(i - 1)2(i + 1)*2/8 Suppose -8l + 6l + 6 = 0. Factor 3q*2 - 462q3 - q4 - 36 - 12q + 464q*l + 8q2. -(q - 3)2(q + 2)2 Let y(h) be the second derivative of 3h*5/160 - 171h*4/16 + 29241h*3/16 + 181h. Find q such that y(q) = 0. 0, 171 Let d(y) = -8y + 2. Suppose 5h = 5q - 4q + 5, -3h - 3q = 15. Let w be d(h). Factor 8/11 + 0m - 2/11m*w. -2(m - 2)(m + 2)/11 Let l(z) be the first derivative of -5z*6/6 + 11z*5 - 105z*4/2 + 340z*3/3 - 100z*2 + 1051. Suppose l(a) = 0. What is a? 0, 2, 5 Solve -1131a*3 + 10a2 + a4 + 1648a3 - 510a3 = 0 for a. -5, -2, 0 Let p(d) be the second derivative of d4/4 - 14d3/3 - 17d*2/2 - 3d + 1. Let w be p(10). What is m in 4/3m4 + 0 + 4m*2 - 4/3m - 4mw = 0? 0, 1 Let z(m) = -1 + 3m - 9 - 2. Let a be z(6). Solve -9h2 - 28h*2 + 14h*2 - 124h*2 + 51h - 63h4 - a + 165h*3 = 0. 2/7, 1/3, 1 Let b(z) = -z + 25. Let n(a) = 2a*2 - 5a + 10. Let i be n(4). Let p be b(i). Factor -8s2 + 4s*2 - 3s*3 + 3s*4 + 6 - 8s*2 + ps + 3s2. 3(s - 2)(s - 1)(s + 1)*2 Factor -37x*2 + 19x*2 - 332x + 2x3 - 42x*2 - 3x*3 - 432. -(x + 2)(x + 4)(x + 54) Let t(g) be the third derivative of -1/80g*6 + 0 - 1/280g*7 + 0g + 61g2 + 0g*5 + 1/8g*3 + 1/16g*4. Factor t(f). -3(f - 1)(f + 1)3/4 Let i(o) be the first derivative of -5o4/12 - o3/2 - 185o - 203. Let a(z) be the first derivative of i(z). Factor a(q). -q(5q + 3) Let i(m) be the third derivative of -m6/1260 - m5/140 - 12m*3 + 2m*2 - 51. Let d(k) be the first derivative of i(k). Factor d(a). -2a(a + 3)/7 Let o be -1((-156)/27 - (-18)/(-81)). Let c(b) = b*3 - 2. Let v(n) = -5n*3 + 18n*2 + 60n - 188. Let m(i) = oc(i) + v(i). Let m(f) = 0. Calculate f. -10, 2 Suppose 19 = 25l - 131. Let y(t) = 2t3 - 28t*2 + 38t + 6. Let g(x) = -x*3 - x - 1. Let v(h) = lg(h) + y(h). Factor v(w). -4w(w - 1)(w + 8) Let x(y) = -2y*2 - 22y + 100. Let v be x(10). Let t be v/(-48)6/8. Factor 0o + 0 + 2/7o4 - 2/7o*t + 4/7o*3 + 0o*2. -2o*3(o - 2)(o + 1)/7 Let k(g) be the third derivative of g5/100 + 101g*4/40 - 3g*2 + 5g. Determine q, given that k(q) = 0. -101, 0 What is v in -288/7v + 60v*2 + 24/7v*3 - 9/7v*4 + 0 = 0? -6, 0, 2/3, 8 Suppose -1 - 31 = -19u + 6. Let b be 1/((-3)/27-3). Find f such that -63/5f*u - 18/5f*4 - 27/5f - 57/5fb - 3/5 = 0. -1, -1/6 Let j(w) be the third derivative of 11/5w*5 + 66w*2 - 1/30w*6 - 36w*4 - 648w3 + 0 - w. Let j(x) = 0. Calculate x. -3, 18 Let n(t) be the third derivative of -t6/540 + 29t5/270 + 1546t*2. Suppose n(k) = 0. Calculate k. 0, 29 Let y(z) = 7z*3 - 588z - 2747. Let c(i) = 22i3 - 1764i - 8242. Let x(s) = 3c(s) - 10y(s). Solve x(h) = 0 for h. -7, 14 Find t, given that 16/7t2 + 0t + 1/7t4 + 0 + 10/7t*3 = 0. -8, -2, 0 Suppose 5y + 8j - 194 = 6j, 108 = 3y + 4j. Let k = y - 16. Factor k - 69t + 73t + 5t3 - t3 - 16t*2. 4(t - 3)(t - 2)(t + 1) Let b be 159/(-2067) + 53/13. Let p be (-102)/(-136)(48/26)/1. Determine m, given that -pm*2 - 4/13 - 2/13m*b - 10/13m*3 - 14/13m = 0. -2, -1 Let q(u) = -21u - 942. Let a be q(-45). Let c(k) be the first derivative of 0k*a + 2/3k*6 + 0k + 0k5 - 2k*4 + 2k*2 - 7. What is d in c(d) = 0? -1, 0, 1 Suppose 9y + 2m = 12y - 44, -y = 4m - 10. Find a such that -1 - ya*2 + 98a + 1 - 104a - 8a*3 = 0. -1, -3/4, 0 Let y = -465 + 463. Let g be (((-21)/14)/(1/y))/5. Factor -gp + 2/5p2 + 1/5. (p - 1)(2p - 1)/5 Let g be ((56/(-3696))/(3/(-18)))/(4/11). Let 0 + 1/2b*3 - 1/4b*2 + 0b - gb4 = 0. What is b? 0, 1 Suppose -4b + 16 = -2y + 3y, -19 = -5b - y. Suppose 3 - 7 = -4w - 4k, 5k + 11 = bw. Factor 2j*4 + 6j*3 + 4j + 41 - 2j5 - 19 - 22 - 10j*w. -2j(j - 1)3(j + 2) Let d(z) be the second derivative of 4z7/21 + 71z*6/15 - 189z*5/20 + 5z*4/3 + 19z*3/6 - 30z + 20. What is o in d(o) = 0? -19, -1/4, 0, 1/2, 1 Let j(r) be the third derivative of 1/30r4 + 0r - 4r2 + 8/15r*3 - 1/150r*6 - 4/75r*5 + 0. Suppose j(w) = 0. What is w? -4, -1, 1 Let r(c) be the first derivative of 1/13c*2 - 4/39c*3 + 0c - 53 + 1/26c4. What is k in r(k) = 0? 0, 1 Let u = 31 + -29. Suppose 11 = 3d - q, -2d - uq - 18 = -12. What is c in 6/7cd - 6/7c + 2/7 - 2/7c3 = 0? 1 Let d be (5/35-9 + 1)/(36/(-21)). Let y(w) be the third derivative of -dw4 + 0w + 0 + 0w3 - 18w*2 + 1/60w*6 - 1/30w*5. Factor y(b). 2b(b - 2)(b + 1) Suppose -3i = 3u + 21, -340 = -4i + 2u - 314. Factor 0 + 3/2g4 - 3g*3 - 1/4g*5 + 0g + ig2. -g2(g - 2)*3/4 Suppose -5k + k - j + 50 = 0, 0 = 4k + 4j - 44. Let y be k/917/3. Determine t so that -7/3t + 0 - yt2 = 0. -7, 0 Let r(f) be the first derivative of 0f - 83 - 8/7f4 + 2/5f*5 + 0f*2 + 8/7f*3 - 1/21f*6. Factor r(k). -2k*2(k - 3)(k - 2)2/7 Let x(w) be the third derivative of w7/1680 + w6/160 + w5/96 - w4/16 - w2 + 363w. Suppose x(k) = 0. Calculate k. -4, -3, 0, 1 Let u(n) be the first derivative of -n*6/20 + 9n*5/40 - 3n4/8 + n3/4 - 77n - 20. Let o(d) be the first derivative of u(d). Factor o(l). -3l(l - 1)3/2 Let o(t) be the third derivative of t5/75 + 401t*4/15 + 321602t*3/15 + 4111t*2. Solve o(f) = 0 for f. -401 Determine v so that -328v - 1/6v2 - 161376 = 0. -984 Let d(f) be the second derivative of -f5/30 - 3f*4/2 - 50f*3/9 - 3827f. Factor d(n). -2n(n + 2)(n + 25)/3 Let p = 6801 - 6799. Factor -11/8s*p - 1/8s*3 - 4s - 7/2. -(s + 2)*2(s + 7)/8 Suppose 5t - 4a - 43 = 0, 5a = -t + 45 - 19. Let v be (-38)/(-8) + 1/4. Suppose -8r*v - 8r*5 - 10r*4 + tr*5 = 0. What is r? -2, 0 Let d(g) be the first derivative of -47g5/10 - g4/4 + 47g3/6 + g2/2 + 2535. Let d(s) = 0. What is s? -1, -2/47, 0, 1 Let j(l) be the third derivative of -l6/420 + 11l*5/105 + 109l*4/84 - 130l*3/21 - 1161l2. Determine f, given that j(f) = 0. -5, 1, 26 Let l(x) be the third derivative of x5/60 + x*4/4 + 4x*3/3 + 14x*2 - 4. Factor l(v). (v + 2)(v + 4) Find l such that -3/4l2 - 435483/4 - 1143/2l = 0. -381 Let a = 254 - 162. Let t = a + -274/3. Factor -ts3 + 4/3s*2 + 0 - 2/3s. -2s(s - 1)*2/3 Let s = -1560 + 35873/23. Let f = s + 109/207. Find m such that fm*5 - 8/9m*3 + 8/9m*2 + 0 + 0m - 2/9m4 = 0. -2, 0, 1, 2 Let b(p) be the first derivative of -p4/4 + 67p*3/3 + 105p*2 + 4297. Factor b(m). -m(m - 70)(m + 3) Let k(n) = -n3 + 70n*2 - 43n - 87. Let q(g) = -4g3 + 289g*2 - 173g - 349. Let w(b) = 26k(b) - 6q(b). Factor w(u). -2(u - 42)(u - 2)(u + 1) Let r(t) = 2t*4 + 34t*3 - 81t*2 - 10. Let z(d) = 2d*4 + 34d*3 - 82d*2 - 12. Let p = 36 - 41. Let n(x) = pz(x) + 6r(x). Factor n(y). 2y*2(y - 2)(y + 19) Let g(i) be the first derivative of -2i*6/27 - 10i*5/9 - 7i*4/18 + 122i3/27 + i2 - 8i + 4600. Solve g(b) = 0 for b. -12, -3/2, -1, 1 Suppose -101 + 101 = -13x. Let k(b) be the second derivative of 1/3b4 + xb*3 - 8b*2 + 0 - 2b. Factor k(a). 4(a - 2)(a + 2) Let p = -9280 + 278401/30. Let z(v) be the third derivative of 23v2 + 0v + 0v3 + 1/3v*4 + 0 - pv*5. Find u, given that z(u) = 0. 0, 4 Let c = 18485/42952 + -11/6136. Solve -cs*2 + 15/7s - 12/7 = 0. 1, 4 Let s be -18 - -16 - (4 + 109/(-18)). Let c(g) be the first derivative of -1/24g4 + 1/6g - 10 + 1/12g2 - sg*3. Find l, given that c(l) = 0. -1, 1 Suppose 6k + 6037 = 6181. Let b be (-30)/(-144) - (-3)/k. Factor -1/3s3 - 1/3 + bs + 1/3s2. -(s - 1)2(s + 1)/3 Let q(j) = 15j2 + 48j + 190. Let m(p) = 2p*2 - p - 2. Let r	{ "pile_set_name": "DM Mathematics" }
and give i. -2 Express (-13d + 26d - 5d)(1 - 2 + 0) in the form hd + a and give h. -8 Express 0 + 2 + 1 + 2r2 - r2 in the form o + dr2 + br and give d. 1 Rearrange 2v4 - 259v + 258v + 4 + 4v*2 - 4v2 - v3 to zv3 + b + gv*4 + tv + jv2 and give g. 2 Rearrange -8c - c - 2c to the form hc + l and give h. -11 Rearrange 86 + 9z - 86 + 70z to the form v + bz and give b. 79 Express 11 + 2h - 2h4 + 0h3 - 49 - h3 as l + mh2 + fh + ph4 + kh*3 and give p. -2 Express (-88 + 88 + 30b)(-1 + b - 4 + 0) as xb + ib2 + o and give x. -150 Express (-233i*2 + i + 9i + 237i2)(1 - i - i + 0) as ai + ji*2 + s + bi*3 and give a. 10 Rearrange 0h - 3h + 0h + (-5 + 4 + 3)(-2h + 2h - 2h) - 5h + 10h + 8h to t + mh and give m. 6 Express (-4 + 0 + 3)(2 + 0 - 4)(4h + h - 3h) as lh + f and give l. 4 Rearrange (0y + 0y - 2y)(-3y*2 - 3y2 + y2) to u + vy2 + wy*3 + oy and give w. 10 Rearrange -2z3 + 17z + 4z4 - 5z - 9z to the form bz*2 + nz*4 + r + vz*3 + sz and give v. -2 Rearrange (154o2 + 48o*2 - 39o*2)(-6o + 2o + 3o) to the form to*3 + po + a + zo2 and give t. -163 Express -2o*2 + 1 + 4o2 - 3 + o2 - 2o + 2o + (-1 + 1 + 2o2)(-2 - 1 + 5) as zo2 + l + to and give z. 7 Rearrange (2k - 4k - k)(1 + 1 - 3) to gk + z and give g. 3 Rearrange -8s3 + 13s + 10s3 + 0s3 + s2 to xs3 + ts + gs2 + w and give w. 0 Express (-2l + 2l + 2l)(3 - 1 + 1) in the form d + al and give a. 6 Rearrange (-1 + 1 + 1)(-46k - 56k + 90k) - 3k - 1 + 1 to the form g + ok and give o. -15 Express p*2 + 3p*2 - 536 + 556 in the form k + jp + vp2 and give k. 20 Express -23 + 11 + 12 - 17x*2 as sx*2 + j + px and give s. -17 Rearrange -51 - 53 + 104 + 180z2 to oz + sz2 + c and give o. 0 Express 88h*3 + 50h + 48h - 98h + (-h + h - 2h)(0h2 - 3h*2 + 2h*2) in the form sh*2 + y + lh + oh3 and give o. 90 Rearrange (3y - y - 3y)(-8y - 6 + 6) + (-3 + 2 + 3)(y*2 - 5y*2 + 2y*2) + 2y*2 - 2y + 2y - 3y*2 + 4y*2 + 0y*2 to oy + jy2 + x and give j. 7 Express -n + 4 - 4 - 3n - 3n + 5n + (-2 - 1 + 4)(0n - n - n) + (-n + n - 2n)(0 + 7 - 14) as yn + f and give y. 10 Express -368 + 19c + 368 in the form rc + v and give r. 19 Rearrange 5 + 2c4 + 1 + c2 + c*3 - 5c*2 - 4 to nc + fc2 + tc*4 + a + hc*3 and give f. -4 Express i + 28i*2 - 5i*2 - 2i as si2 + f + qi and give q. -1 Rearrange 2 - 2 + 3f + 2f*2 - 14f to the form df + of*2 + v and give d. -11 Rearrange -5a*2 + 29a + 2 - 29a to the form qa + m + ya2 and give m. 2 Express (2 + 1 - 1)(2i + 0i + 4i - 2i + 6i - 5i + 0i - 11i + i + (4 - 2 - 1)(-2 + 2 - 2i)) as vi + b and give v. -14 Rearrange (2m*3 - 4m3 + m3)(4 - 4 - 2) - 9m*3 - 2m - 2 + 0m3 + 5m*3 to the form sm*2 + wm + a + dm3 and give a. -2 Rearrange (-3 - 4 + 4)(-83v - 46v + 38v) to pv + k and give p. 273 Rearrange -9i + 6 - 19 + 13 to m + di and give d. -9 Express (-2z + 2z - z)(6 + 1 - 3)(30 + 16 - 27) in the form n + az and give a. -76 Express 4o*4 - o - 6o4 + o4 - 13o3 + 2 + 14o*3 in the form qo*4 + lo*2 + do*3 + h + ao and give q. -1 Express -n - 4n3 + 2n*3 + 0n + (n - n - n)(18n*2 + 38n*2 + 70n*2) as m + pn + on3 + an*2 and give o. -128 Rearrange (8a*2 + 2 - 5a*2 + 1)(-2 + 1 + 3)(4a + a - 3a) to z + ya*3 + ra + ka2 and give r. 12 Express s + s - s - 3s + s + s + (2s - 1 + 1)(1 + 1 - 4) + 3s + 2s - 4s - 5 + s + 5 + 4s + 0s - 3s + (1 + 0 + 0)(s - 2s + 0s) as rs + f and give r. -2 Express -12n2 + 124 + 8n*2 + 2n*2 in the form d + jn*2 + sn and give d. 124 Rearrange s + 82s2 + 67s*2 - 161s*2 to us + hs2 + x and give u. 1 Express (-4 + 1 - 7)(-3h + 0h + 4h + (4 - h - 4)(-1 + 0 + 0) + 5h + h - 5h)(-3h + 2h + 4h) in the form mh + r + fh*2 and give m. 0 Rearrange 6 - 6i*3 - 1 + 3i*3 + 0 to the form q + mi*2 + vi*3 + gi and give m. 0 Express 5f2 + 4f*2 + 42f - 77f + 37f as l + pf + rf*2 and give r. 9 Express -122f*2 + 58f*2 + 28f + 2 + 62f2 + (2f - 2 + 2)(-4f + 6f + 0f) in the form wf + df*2 + j and give d. 2 Express -28 - 21 + 50 + 2y*2 + 2y*3 as iy*3 + ly*2 + uy + d and give l. 2 Rearrange 24u + 29u - 40u to su + m and give s. 13 Express -2m4 + 4m + m - 4m + 2m*3 in the form tm + a + gm3 + wm*4 + pm*2 and give w. -2 Rearrange 3q - q + 23q to d + gq and give g. 25 Express -47b - 4b*2 + 5b*3 + 48b - b*3 in the form tb*3 + sb + ub2 + f and give u. -4 Express 11o + 5 - 18o - 9 as l + mo and give m. -7 Express (2 + 2g - 2)(-4 + 4 - 2) - 13 - g + 13 + 0 + 6g - 1 - 3g as ug + a and give u. -2 Rearrange (0l + 5l - 3l)(20 + 24 - 11) + 0l - 2l + 0l to the form pl + o and give p. 64 Rearrange 109 - k4 - 109 + 2k - k*4 - 8k*3 to the form uk*4 + o + xk + rk2 + bk*3 and give b. -8 Rearrange -12l + l + 7l - 22l to jl + z and give j. -26 Express 89 + 2m - 30 - 39 as d + pm and give d. 20 Express (-3 + 3 + 2t)(-8 + 9 - 8) in the form o + dt and give d. -14 Express -9s3 + 61s*2 - 16s*2 - 23s*2 - 21s*2 as ts + ns2 + u + ls*3 and give t. 0 Express -r - 5r - 5r - 2r in the form o + qr and give q. -13 Rearrange (0 + 1 - 3 - f)(6 - 84 - 70) to v + bf and give b. 148 Rearrange (70n + 0n - 5n + 42n)(-2 + 0 + 4) to the form zn + i and give z. 214 Express 19m*2 - 12m*2 - 6m*2 - 5m*2 + 5m in the form tm + f + ym*2 and give y. -4 Rearrange (5p - 3p - 4p)(-2 + 2 - 1 + (-2 - 1 + 2)(4 - 2 + 0))(-4 - 3 + 1) to xp + v and give x. -36 Express 5 - 4 + 13x2 + 1 in the form f + ix + ux2 and give f. 2 Rearrange -30a - 2a + 10a to da + x and give d. -22 Express (-9 - 5 - 3 + (2 + 0 - 1)(1 - 5 + 3))(3b + b + b)(4b - 4b + 2b) in the form vb2 + db + g and give v. -180 Rearrange 5 - 3r + 2r*2 - r - 4 - 3r*2 to qr*2 + d + wr and give w. -4 Express (-24g + 24g - 32g3)(2 + 2g - 2) in the form ug*3 + dg*4 + w + fg + og2 and give d. -64 Rearrange (-3h - h + 5h)(7 - 97h3 + 50h*3 + 45h*3) to the form yh*4 + xh*3 + vh + rh2 + n and give v. 7 Rearrange 0f + 2f - 65f*4 + 3 + 63f*4 + 2 to the form if*4 + l + kf + cf2 + tf*3 and give k. 2 Rearrange 3r*3 + 2r3 + r3 + 2r4 + 15 - r2 - 5r*3 to the form c + ir*3 + fr*2 + hr*4 + lr and give c. 15 Express 20 - 2o - 13 - 7 - 3o*2 in the form zo*2 + do + x and give d. -2 Rearrange 12 - 25 - 148m + 13 to the form bm + l and give b. -148 Express 5b4 + 4b*3 - 6b - 2b3 - b2 - 4b*4 as yb*4 + pb*3 + db + w + ab2 and give a. -1 Rearrange 8x + 4x3 - x2 - 2x*3 - 6x to the form tx + f + ax*2 + dx*3 and give d. 2 Rearrange 6m - 1 - 1 + 2 to qm + b and give q. 6 Rearrange (-2d*2 - 5 + 5)(-17 + 1 - 3) + 5d2 + 4d*2 - 6d*2 to the form o + vd*2 + cd and give v. 41 Rearrange (2x + x2 - 2x)(5 - 1 + 0)(x - 3x + 3x) to jx3 + s + ux + yx2 and give j. 4 Rearrange (4b - 4b + 3b)(-2b*2 + 3b2 + b2) + b*3 - 4b3 + b3 to yb2 + ub + sb3 + c and give s. 4 Express 10m*4 + 105m*2 - 105m*2 + (2 - 4 + 4)(m4 - m2 + m*2) + 2m*4 + 2m*4 + 0m*4 as n + sm + gm3 + rm*2 + tm*4 and give t. 16 Rearrange (l - l + l)(-4l + 4l + 3l + (4l + 2l - 7l)(-2 - 1 + 4) - 808l - 2 - 807l + 1645l) to the form xl2 + tl + v and give x. 32 Express -5 - 8p - 7p - 6p + 26p in the form s + jp and give s. -5 Express (-5n + 15n2 - 8n*2 - 3n*2)(-n - 4 + 4) in the form xn + gn*3 + sn*2 + d and give g. -4 Express -3 + 2j*3 + 3 + (2j*2 + 12j*2 - 4j*2)(-2j + 2j - j) - 3j2 + 6j*3 + 3j*2 as r + wj + xj2 + ij*3 and give i. -2 Express -3 - 27h*2 + 1 + 9h*2 in the form zh*2 + f + uh and give z. -18 Rearrange 4x2 - 5x4 - x3 - 3x2 - 3x + 2 - x*2 to the form a + qx*3 + ux*2 + ox*4 + px and give a. 2 Rearrange 0i3 + 10i + 3i2 + 7i*3 - 10i to ri + ni*3 + b + fi*2 and give f. 3 Express -2d - 4 + 4 + (-82*	{ "pile_set_name": "DM Mathematics" }
7/4200 + t6/600 + t5/200 + t*4/6 - 7t*3 - 28t. Let f(c) be the third derivative of u(c). What is z in f(z) = 0? -1 Let i = 619361/13 - 47643. Suppose -8/13z - iz*2 + 0 = 0. Calculate z. -4, 0 Let f(w) = 41w + 576. Let s be f(-14). Factor 0 + 54/7g3 + 24/7g - 72/7gs. 6g(3g - 2)2/7 Let k(n) = -n3 + 9n2 + 2n - 13. Let m be k(9). Suppose -4c = -u - 0u + 24, -m = c. Determine y, given that 6y2 - uy - 7y2 - 3 + 0y = 0. -3, -1 Suppose 8 = 9f - 8f. Factor -29z3 - f - 62z*2 + 10z*2 - 46z + 45z3. 2(z - 4)(2z + 1)(4z + 1) Let z(d) = -8d - 18. Let v be z(-3). Let f(q) = -2q*3 + 7q*2 + 16q - 9. Let c(t) = -t*2 - 2t - 1. Let s(w) = vc(w) + 2f(w). Factor s(u). -4(u - 3)(u - 1)(u + 2) Suppose 0 = 14b + 112 - 560. Suppose -10d + b - 12 = 0. Factor -2/7t - 2/7td + 0. -2t(t + 1)/7 Suppose -16p + 2133 - 2101 = 0. Let -3t3 - 3/2 + 0t*p + 3t + 3/2t4 = 0. Calculate t. -1, 1 Factor 2/5c*3 - 4/5 + 0c*2 - 6/5c. 2(c - 2)(c + 1)*2/5 Let b(v) be the first derivative of 0v*2 - 13 - 1/5v*5 + 1/2v*4 - 1/3v*3 + 0v. Factor b(s). -s*2(s - 1)*2 Factor 3d*4 + 25d*2 + 39d - 6d3 - 4d*4 + 16d*2 - 40 + 0d*2 - 33d3. -(d - 1)2(d + 1)(d + 40) Let k(r) = r*2 - 93r + 94. Let q be k(92). Factor -2/7vq + 2/7 + 2/7v - 2/7v3. -2(v - 1)(v + 1)2/7 Let n(z) be the third derivative of -1/735z*7 + 1/2352z*8 + 0 + 0z4 + z2 + 0z - 1/280z*6 + 0z*3 + 0z5. Factor n(r). r3(r - 3)(r + 1)/7 Determine p so that -10/3 - 2/3p2 + 4p = 0. 1, 5 Let l(v) = -9v + 14. Let b be l(-7). Let o = 80 - b. Factor -1/3h*2 - 1/6h*o - 1/6h + 0. -h(h + 1)2/6 Suppose 0 = -r - 4v + 16, 4r - 2v = 101 - 19. Solve 102j - 54j*4 + 16j*3 - 26j + 40j3 + 50j*4 - 4j*5 - 104j*2 - r = 0 for j. -5, 1 Suppose -6/5i*4 - 2/5i - 6/5 - 2/5i5 + 4/5i*3 + 12/5i*2 = 0. What is i? -3, -1, 1 Let m(t) = 4t - 4. Let f be (-2)/4 + (-6)/(-4). Let v be m(f). Factor -3l3 - 1/2l*2 + v + 0l - 2l5 - 9/2l4. -l2(l + 1)2(4l + 1)/2 Let w(o) = -o2 + 6o + 4. Let n(p) = 6p - 3p*2 + 21 + 18p - 6. Let f(h) = 4n(h) - 15w(h). Determine r so that f(r) = 0. -2, 0 Let q(f) be the third derivative of f5/20 + f4/4 - 13f2 + 2f. Determine t, given that q(t) = 0. -2, 0 Let p = -46 + 49. Factor -651t + 306t + 3tp + 27 + 21t*2 + 294t. 3(t - 1)2(t + 9) Factor -100/3 - w*3 - 35/3w + 26/3w2. -(w - 5)2(3w + 4)/3 Let z(c) be the first derivative of c4/8 + 29c*3/6 + 303. Suppose z(a) = 0. What is a? -29, 0 Let p(j) be the first derivative of 16/3j - 4/3j2 - 17 + 1/9j3. Factor p(x). (x - 4)2/3 Let n(x) be the second derivative of 10x + 0 + 10/3x*3 - 10x*2 - 5/12x4. Suppose n(p) = 0. What is p? 2 Let g(f) be the third derivative of -f7/504 + f5/24 - f4/4 + 13f2. Let d(w) be the second derivative of g(w). Factor d(a). -5(a - 1)(a + 1) Suppose -13o + 13o = 47o. Let i(t) be the third derivative of ot3 - t2 - 1/15t*5 + 0 + 0t + 1/3t4. Solve i(s) = 0 for s. 0, 2 Find y, given that -9/2 + y + 1/6y*2 = 0. -9, 3 Let m(p) be the first derivative of 3p*6/19 - 12p*5/5 + 61p*4/38 + 272p*3/57 - 44p*2/19 - 96p/19 - 286. Find d such that m(d) = 0. -2/3, 1, 12 Let o(y) be the third derivative of 2y7/945 + y6/90 - y5/15 - y4/2 - 56y*2. Factor o(k). 4k(k - 3)(k + 3)*2/9 Suppose -146j = -191j + 135. Factor 2/7l*4 + 0 + 2/7l - 2/7l2 - 2/7l*j. 2l(l - 1)2(l + 1)/7 Let c(r) be the first derivative of -r*4/36 - 2r*3/27 + 2r*2/9 + 8r/9 - 25. Factor c(h). -(h - 2)(h + 2)2/9 Let r(l) be the first derivative of 4l*3 + 3/4l*4 + 19 - 9/2l*2 - 54l. Determine j, given that r(j) = 0. -3, 2 Let p be (-1 + (-13)/(-3))/(24/36). Let h(n) be the third derivative of 0 + 4n2 - 1/132n*4 - 1/55n*p + 2/33n*3 + 0n. Suppose h(r) = 0. Calculate r. -2/3, 1/2 Suppose 2b - 3y - 19 = 33, -b = 5y. Suppose 0 = -4g + 24 + b. Factor 13s + gs*3 + 98s*4 + 45s*3 - 8 - 65s*2 - 69s - 25s2. 2(s - 1)(s + 1)(7s + 2)2 Let i be 12 - (15 - -129)/16. Factor 0 - 1/4q*i + 1/4q*2 + 0q. -q*2(q - 1)/4 Let o be ((-5 - -2)/(-6))/(18/108). Let m(x) be the first derivative of 5 - 1/8x4 + 3/2x + 5/6xo - 7/4x*2. Factor m(g). -(g - 3)(g - 1)2/2 Let u(l) be the third derivative of l8/14 + 11l7/15 + 91l*6/40 + 71l*5/60 - 11l*4/8 - 3l*3/2 - 150l*2. Suppose u(b) = 0. Calculate b. -3, -1/2, -1/4, 1/3 Let d be (8/1)/(4 + -2). Suppose 3k - w - 9 = 0, dw - w + 9 = 0. Factor -3i*2 + 3i3 + i4 + 2 - i - k + 2 - 2i3. (i - 1)2(i + 1)(i + 2) Let m(d) = 2d + 20. Let r be m(-9). Factor -10w + r - 3w*2 + 16w + 4 + 11w. -(w - 6)(3w + 1) Let f = -258 + 258. Let m(q) be the second derivative of -1/2q*3 + 9/20q*5 + f + 0q*2 + 1/2q*4 + 2q. Factor m(c). 3c(c + 1)(3c - 1) Let b(o) = 15o3 - 214o*2 - 75o. Let x(j) = -15j3 + 216j*2 + 75j. Let c(t) = 2b(t) + 3x(t). Factor c(d). -5d(d - 15)(3d + 1) Let -97969/7g2 - 1/7g*4 + 0 + 0g - 626/7g3 = 0. Calculate g. -313, 0 Let p be 2/19 + 330/114. Let t be (-9)/676/(-6). Determine z so that 12z3 - 4z*4 - 8z + t - 15 - 4zp = 0. -1, 1 Let c(o) be the second derivative of -o6/90 - 8o*5/5 - 96o*4 - 3072o*3 - 55296o*2 + 57o. Suppose c(z) = 0. What is z? -24 Let f = -114 + 315. Let q = f + -197. Solve 9/4 + 14m3 + qm*4 + 21/2m + 73/4m2 = 0. -1, -3/4 Let q(u) = u2 + 1. Let l(n) be the second derivative of 0 - n3 + n + 4n*2 + 5/6n*4. Let r(h) = -l(h) + 8q(h). Factor r(f). -2f(f - 3) Let s(u) = -u*3 + 6u*2 - 6u + 2. Let r be s(5). Let g be 10 + 0 - -3 - r. Determine i so that 1 + 17i2 - 2i + 0i - 4 - gi2 = 0. -1, 3 Let n(i) = -i3 + 2i2 - i + 1. Let q(y) = -5y4 + y3 + 228y2 + 886y + 634. Let x(u) = 6n(u) + q(u). Find t, given that x(t) = 0. -4, -1, 8 Let s be (7 - 9)3/(-2). Factor 3w + sw2 - w2 - 10 - 3w3 + 0w*2 + 8. -(w - 1)(w + 1)(3w - 2) Let v(o) = 5o4 - 3o*3 - 5o*2 + 3o - 4. Let g(u) = -81u4 + 48u*3 + 81u*2 - 48u + 66. Let q(m) = 2g(m) + 33v(m). Factor q(c). 3c(c - 1)*2(c + 1) Factor -99 - 164v + 65v*2 + 51v*2 - 85 + 24v*3 + 208. 4(v - 1)(v + 6)(6v - 1) Let d(v) be the first derivative of -v8/112 + 11v7/630 - v6/180 - 5v2 - 13. Let r(f) be the second derivative of d(f). Let r(g) = 0. What is g? 0, 2/9, 1 Let d(u) be the first derivative of -2/5u - 8 + 8/15u3 + 3/5u*2. Factor d(x). 2(x + 1)(4x - 1)/5 Let v be (138/(-9))/((-5)/15). Let vp4 + 2p*3 - 49p*4 - 5p*3 = 0. What is p? -1, 0 Suppose -j + 6 = 5m, -7m - 28 = -15m + 3j. Let y = -30 + 121/4. Factor -yn*4 + 3n + 2 - 3/4n3 + 1/2n*m. -(n - 2)(n + 1)(n + 2)2/4 Let x(a) be the second derivative of -2a6/255 + a5/10 - 15a4/34 + 9a*3/17 + 27a*2/17 - 2a + 2. Determine t, given that x(t) = 0. -1/2, 3 Let f(u) = u5 + u4 + 36u3 + 26u*2 - 34u - 6. Let t(b) = 3b5 + 3b*4 + 73b*3 + 53b*2 - 67b - 13. Let h(y) = -13f(y) + 6t(y). Factor h(z). 5z(z - 2)(z - 1)(z + 2)*2 Let w be (-25)/(-88)2 - (-1)/112. Factor 1/4g*3 - wg*4 + 0 + 0g + 0g2. -g3(3g - 1)/4 Let o(z) = 20z*3 + 8z*2 - 24z + 12. Let x(h) = -2h3 + 2h - 1. Let k(r) = o(r) + 12x(r). Find i such that k(i) = 0. 0, 2 Suppose 0 = u + 2i, 4u + 0i - 18 = i. Let k be ((-1)/u)/((-585)/108 + 5). Factor -6/5 + 9/5j - 9/5j*3 + 3/5j*4 + kj*2. 3(j - 2)(j - 1)2(j + 1)/5 Suppose -13c + 268 = -525. Let y = -61 + c. Factor 0h*2 - 4/3h + y + 4/3h3. 4h(h - 1)(h + 1)/3 Let t(o) = 3o2 + 18o + 18. Let a(b) = 2b2 - 1. Let j(k) = 3a(k) - t(k). Factor j(v). 3(v - 7)(v + 1) Let g(i) be the second derivative of -i*5/140 - 4i*4/21 - 32i*3/21 + 56i - 1. Factor g(d). -d(d + 8)2/7 Let z(o) = -7o*2 + 168o - 25. Let g(s) = 33s2 - 840s + 123. Let t(b) = 4g(b) + 21z(b). Factor t(c). -3(c - 11)(5c - 1) Let h(u) be the second derivative of -1/6u*4 + 6u*2 + 30u + 0 - 5/3u3. Factor h(l). -2(l - 1)(l + 6) Let f(q) = q3 - 57q*2 + 111q - 52. Let i be f(55). Factor 0 + 0g + 3/4g*5 + 9/4g*2 + 21/4g*i + 15/4g*4. 3g**	{ "pile_set_name": "DM Mathematics" }
less than -3.786? -1.786 3.03 + 57 60.03 What is the distance between -0.3 and -1350.5? 1350.2 Calculate 2 + -28588. -28586 What is 52.9267 take away -5? 57.9267 What is 660 less than -0.06502? -660.06502 Subtract 20.626 from 7. -13.626 -136+14 -122 What is 162 - 0.8? 161.2 What is 0.06381 minus -5? 5.06381 0.166816+-1 -0.833184 Calculate 972 - -57.4. 1029.4 -1.656+-31 -32.656 Total of -0.24 and 0.015. -0.225 -149.32 - 5.1 -154.42 What is 0.7704 + -42.5? -41.7296 What is the difference between 96 and -0.02361? 96.02361 What is -13.57 minus 0.0248? -13.5948 Add -3 and -1.5. -4.5 What is -2 plus -2648? -2650 What is -2799631 - -5? -2799626 Calculate 0.078 + 31764. 31764.078 Put together -3 and -71.5. -74.5 Total of -2 and -0.894. -2.894 2.2 - -3723 3725.2 What is 1.139 - -0.176? 1.315 Calculate -0.1 - 0.33325. -0.43325 What is -2 plus 90? 88 What is the difference between -56.12 and 1? 57.12 30+-455 -425 What is 2 less than -0.77352? -2.77352 What is 2.83 minus 12? -9.17 What is the difference between 21483 and 3? 21480 Total of 1.1522 and -3. -1.8478 Add 0.036 and 3337. 3337.036 What is -14 - 41375? -41389 Add together -0.05 and 0.208. 0.158 What is -10.0746 plus 14.8? 4.7254 Work out -28 + -3.26. -31.26 What is the difference between 26.4245 and 2? 24.4245 -5187211 - -4 -5187207 Add together -0.3 and -0.1707. -0.4707 Work out -1465 + 12. -1453 Put together -4.99 and 19. 14.01 Work out 67 - 2719. -2652 What is 2 - -179.7? 181.7 What is the distance between -0.36 and -8766? 8765.64 Sum -0.1514 and 60. 59.8486 What is 9.363 - -3? 12.363 What is 0.03205 plus -2? -1.96795 Add 596 and 32. 628 What is 913 - 4710? -3797 Total of 18 and 0.07. 18.07 What is the difference between -169 and -18.38? 150.62 Work out -144 - -22.6. -121.4 What is 197 + -0.01? 196.99 Work out -104075 + -1.7. -104076.7 0.246+-22 -21.754 -0.6306+-0.11 -0.7406 What is -107.544 minus 0? -107.544 Total of 11044 and 4. 11048 Subtract -0.1 from -102983. -102982.9 What is 8 minus 101? -93 Calculate -854 + -0.454. -854.454 Subtract -0.3 from -2.0552. -1.7552 What is 1332 plus 1429? 2761 Add -141.8 and -0.921. -142.721 What is -6 minus -37714? 37708 -1816+0.3 -1815.7 What is -1204 take away 925? -2129 What is -824 take away -1615? 791 What is the distance between 0.03 and -2625.7? 2625.73 Sum 953 and 2929. 3882 0.006+-12 -11.994 Add -1.7397 and -0.5. -2.2397 What is the difference between 0.1 and -13759? 13759.1 Add 0.3164 and 0. 0.3164 What is 75 + 1722? 1797 What is -0.018 less than -8? -7.982 Work out -6398 + -16. -6414 Put together -96.89 and 0.7. -96.19 What is the difference between 121 and -6.4? 127.4 -3 - -37260 37257 -6 + -7.54 -13.54 What is -0.6706 take away 0.112? -0.7826 What is the difference between -16.13 and 0.05? 16.18 Subtract 1834 from -0.101. -1834.101 What is 0.2 - 0.5556? -0.3556 What is -14 + 0.124? -13.876 -8 + 78 70 What is -1.1 minus 15.7? -16.8 Total of -0.044 and 9438. 9437.956 Total of 8.2 and -430. -421.8 What is 4499 less than 0.3? -4498.7 Calculate 4968 + -0.5. 4967.5 -0.1448+-0.041 -0.1858 What is the distance between 34.9 and -5? 39.9 Put together 448 and 50. 498 What is 735798 less than 2? -735796 What is 1370 + -1544? -174 Add 0.2 and 10882. 10882.2 Work out -130609 + 2. -130607 What is the distance between -1.43916 and -0.4? 1.03916 Put together 11.24 and -1. 10.24 Sum 5 and -124. -119 Sum -11.901 and 3. -8.901 What is 24699 less than 7? -24692 What is 8.5 plus -6.82? 1.68 -2 - -0.0196 -1.9804 -0.1+35474 35473.9 Add together -9.4 and -539.4. -548.8 What is 0.13531 plus 332? 332.13531 Calculate 4 - -1537. 1541 4151 - -385 4536 What is 5 plus -34022? -34017 Total of -0.60122 and -0.01. -0.61122 Total of 0.54 and 9126.6. 9127.14 What is 157 take away 155? 2 What is -0.11 + 0.056176? -0.053824 What is the distance between 5 and -1438? 1443 Add together 7 and 21924. 21931 Total of -6 and -0.0988. -6.0988 0.4+686 686.4 What is 0.05 minus -6222? 6222.05 What is -3086110 plus -2? -3086112 Subtract -15.5 from 14202. 14217.5 -4 - -54688 54684 What is 4 plus 36573.6? 36577.6 604812 - 4 604808 Calculate -275 - -0.056. -274.944 What is 0.03 plus 1451.7? 1451.73 Total of 0.07 and -1308. -1307.93 What is the distance between -0.04 and 22.3? 22.34 Work out -1.5 - 10520. -10521.5 Calculate -4039693 + 4. -4039689 What is -0.072 - 5? -5.072 Work out -0.21 + 40453. 40452.79 Work out 4 - 60.66. -56.66 Calculate -48761 + -4. -48765 Add -562 and 4. -558 Subtract 16029 from 2. -16027 Work out -4979993 - 0. -4979993 -89.06+129 39.94 Work out -169 + 6. -163 Work out 19943 - 0.1. 19942.9 Add together 84 and 0.12. 84.12 What is -3.7907 take away -0.5? -3.2907 -0.4 + -0.127837 -0.527837 What is 3.1 + 2752? 2755.1 Calculate -1 + 72.8. 71.8 -189.491+-1 -190.491 Put together -0.27 and 77.876. 77.606 Work out -47.2 + 9. -38.2 Subtract 0.4 from 791098. 791097.6 Work out -4 - 2428. -2432 Work out 95 - -2.1. 97.1 What is 0.146 less than -122.5? -122.646 What is -77 less than -2.5788? 74.4212 0.08076 + -0.12 -0.03924 Calculate 0 - 814. -814 What is 55 minus -6716? 6771 Add together -0.2 and 0.10374. -0.09626 62 + 1761 1823 22+319.1 341.1 Work out 9.35 - 88. -78.65 Work out -6360488 - -0.4. -6360487.6 What is the distance between 4093 and -0.5? 4093.5 Calculate -155 + -1. -156 What is -28 take away 100764? -100792 What is 3807 less than 0.7? -3806.3 Calculate -31 - 84008. -84039 What is -62.81 - -0.07? -62.74 1.1+-109218 -109216.9 Work out 0.0176 + -10. -9.9824 What is the difference between 0.0785 and -45? 45.0785 What is 1496 take away 4? 1492 122.14 + 0.04 122.18 What is -131458.68 + 2? -131456.68 Work out -1121834 + 0.3. -1121833.7 What is -0.28 - 0.051? -0.331 Work out 0.028 - 7. -6.972 Put together 0 and 11296. 11296 What is -197 - -0.18? -196.82 4 - 0.2937 3.7063 Work out 0.1087 + 152. 152.1087 Add together 4 and 43.06. 47.06 Put together 0.12 and 855. 855.12 Work out 3 + 85.2. 88.2 What is the distance between 2674 and 228? 2446 Add together 107 and 266.9. 373.9 What is -128 minus 262? -390 What is 0.113 + 1317? 1317.113 Add -53647 and -4. -53651 -653 - -2 -651 Work out -751995 + -5. -752000 Calculate 4 + 793095. 793099 Add 56 and 0.2. 56.2 -4416+-3 -4419 What is the distance between -3.5836 and 0.2? 3.7836 Work out -7.7 - 0.35. -8.05 0.03 - -11724 11724.03 What is 2 - 681? -679 What is 2.16 less than -0.6? -2.76 Work out -0.01 + 0.22039. 0.21039 Sum -13 and 816.84. 803.84 574.4 + 1.08 575.48 Subtract -180 from -0.5. 179.5 Subtract 1136 from -66. -1202 Calculate 1790 + -186. 1604 What is the distance between 142 and -0.0086? 142.0086 What is 9.1 take away 12? -2.9 -6+0.67 -5.33 Calculate 9.31 + -0.3. 9.01 Sum -3 and -2.009. -5.009 Sum -5 and -234. -239 Put together -10325 and -11.48. -10336.48 49 + 8476 8525 What is the difference between -4 and -535.7? 531.7 What is -292 minus 387? -679 What is the difference between -20 and 0.079? 20.079 What is -47730 take away -4? -47726 Sum 452 and 6.26. 458.26 0.0789227+-0.05 0.0289227 Sum 1 and -852. -851 Subtract -0.3 from 1639967. 1639967.3 Calculate -11941 + -15. -11956 Add together -0.34 and -0.006. -0.346 Sum -5.78 and 123. 117.22 Work out -0.047 - -118. 117.953 Sum 2580 and 0.121. 2580.121 What is -0.4 take away -3.4422? 3.0422 What is -185 less than -8114? -7929 Total of -1.2 and 245963. 245961.8 Calculate 2.4 - 6767. -6764.6 Sum 14.4 and 197. 211.4 Work out -16 + 40. 24 -1383 + 3 -1380 Calculate 2 + 45259. 45261 Work out -0.239 - -4905. 4904.761 Add together -116.5 and 0.324. -116.176 Subtract -1 from -92.2. -91.2 What is the difference between -0.3146 and -4? 3.6854 What is 0.01 less than -0.321? -0.331 What is -22.6 minus -8? -14.6 0.5+7235.75 7236.25 What is the difference between -4 and -2039? 2035 What is 0.09 take away 127326? -127325.91 Total of 0.3 and -2503612. -2503611.7 Calculate 0.0874442 + -0.3. -0.2125558 What is -0.05 + 8.1? 8.05 What is the difference between -1522 and 16.3? 1538.3 Total of 118035 and 0. 118035 What is the difference between -0.012 and 884? 884.012 Work out 2540 - -791. 3331 Sum 54415 and -0.4. 54414.6 -5174 + -0.1 -5174.1 0.072 - 10.5 -10.428 What is 32.3 take away -359? 391.3 Total of -18692 and 717. -17975 Add -0.4 and 0.08292. -0.31708 Total of 0.021 and 13976. 13976.021 What is the distan	{ "pile_set_name": "DM Mathematics" }
d smallest value? (a) o (b) 4 (c) d b Let h = -363.2 + 363. What is the second biggest value in 0.15, 0.06, h? 0.06 Let o = 4.6 + 31.4. Let b = o - 35.8. What is the smallest value in -1/2, -12, b? -12 Let q = 25.22 - 25. Let h = q - 5.22. Which is the second smallest value? (a) h (b) 10 (c) 5 c Let f = -816 - -811. Which is the fourth smallest value? (a) f (b) 4 (c) -7 (d) 0.1 b Let k = -1212 - -1211.8. Let m = 5/16 + -77/144. What is the smallest value in m, -9, k? -9 Let i(y) = y*2 - 6y + 6. Let u be i(5). Let n = u - -1. Suppose np + 4 = 6. Which is the second biggest value? (a) 0.1 (b) -5 (c) p a Let v be (-336)/57 - (-22)/(-209). Let p be (-2)/v36/60. What is the second biggest value in p, 2/47, 3? p Let n = 11 + -15. Let x = 0.07 - 0.09. Let s be (34/12 - 3) + (-44)/(-48). Which is the smallest value? (a) s (b) n (c) x b Let y be 6/15 + 0 - 56/90. Which is the fourth smallest value? (a) 2/149 (b) 2/7 (c) 2 (d) y c Suppose 10d - 8d - 10 = -4u, -3u + 25 = 5d. What is the biggest value in -5, u, 0.4? 0.4 Let r(s) = -9s + 287. Let u be r(32). What is the second biggest value in 7, u, 0.2, -5? 0.2 Let k = -0.6768 + -0.0232. Which is the third smallest value? (a) -3/4 (b) 1 (c) -2 (d) k d Suppose 2v + 1 = -3o - 4, v = -4. Which is the biggest value? (a) o (b) 0.5 (c) 5 c Let w be (24/60)/(24/(-18)). Let x = -15 - -10. What is the fourth smallest value in w, 3, 0, x? 3 Let s = 71 - 72.12. Let m = s + -1.88. Let f = 0.2 - -0.1. What is the second smallest value in f, 0.9, m? f Let i = -26/45 - -4/5. Let p = 8.12 - 0.12. Let w = p - 7.5. Which is the second biggest value? (a) -0.3 (b) i (c) w b Let j = 1.2 - 5.2. Which is the second biggest value? (a) j (b) -3 (c) -0.5 (d) 9 c Let t = 67/19 - 565/171. What is the third smallest value in 0.3, 1/23, t? 0.3 Let r = -415 + 3739/9. Let o = 3.2 - 2.8. What is the third biggest value in r, -8, o? -8 Let h = -6.6 - 0.4. Let n = 6.7 + h. Suppose k - 7 = 4o + 10, 6 = -3o + 3k. What is the second biggest value in n, o, 4? n Suppose 0 = -5r + 3 + 97. Suppose -h - r = 3h. Suppose -i + 0 = -m + 7, -4m + i = -16. Which is the biggest value? (a) 1 (b) h (c) m c Let n be 44/70 + 3/(-15). Let d = -0.103 - -0.053. Let i = 8 + -5. What is the biggest value in i, n, d? i Let z be ((-2)/12)/(8/(-36)). What is the third biggest value in -2, 2/3, z? -2 Suppose -708 = -0l - 2l + 4u, -2l + 5u = -713. Let g be l/(-72) + -1 + 6. Which is the third smallest value? (a) -23 (b) -0.5 (c) g c Let z = 0.1 - 0.4. Let n = 0.3548 - 0.0548. Which is the third smallest value? (a) z (b) -11 (c) -1 (d) n a Let g = -34 - -34.13. Let f = -0.33 + g. What is the fourth biggest value in f, 2, -0.1, 1/5? f Let b(h) = h*2 - 53h - 208. Let l be b(53). What is the smallest value in 1/6, l, -0.5? l Suppose -158w = -173w - 180. Which is the biggest value? (a) 0.08 (b) -3 (c) w a Let w be 0 - (-4)/((-20)/25). Let u be -3(((-340)/(-18))/w + 4). Let o = -0.4 + 0.1. Which is the second smallest value? (a) 4/3 (b) u (c) o c Let c = 18 - 15. Let b = -68 + 68. What is the third biggest value in b, -3, c? -3 Let s(r) = -r2 - r + 3. Let z be s(-2). Let u = -41 - z. Let o be -1 + (u/4)/(-3). What is the third smallest value in 0, o, 4? 4 Let c = -61/20 - -13/4. Suppose 3z = t - 0t - 16, -2t = -2. What is the third smallest value in 0, c, z? c Let p = 16.8 - 16.3. Which is the third smallest value? (a) 0.2 (b) p (c) 18 c Let o = -1817/10 - -365/2. Which is the third biggest value? (a) -4/23 (b) -4 (c) o (d) -1 d Suppose 3u = -u - 8. Let m = 221/4 + -55. Let r = 17/22 + -295/154. What is the smallest value in r, m, u? u Let m be 2/(-16) - 19/(-160)-4. Let f = 1 - 1.1. Let d = f + 0.2. Which is the third biggest value? (a) 4 (b) d (c) m c Let i be (-1)/(2 - 3) - 5/4. What is the biggest value in i, 0.02, -48? 0.02 Suppose -3a + 2 = g, 5a = -14g + 10g - 6. What is the second smallest value in g, -1/4, 0.061? -1/4 Let y(t) = t*3 + 7t*2 - 15t. Let b be y(-9). Let o be 5/20 - b/(-28). What is the third biggest value in 2/9, 0.1, -0.1, o? -0.1 Suppose 0m + g = 4m - 25, 0 = 2m + 4g + 10. Suppose -6l - 11 = -3l + u, mu + 4 = 2l. What is the third biggest value in -2, 1, l? l Let u = 0.3 + -0.6. Let c = -584.6 - -585. What is the third smallest value in u, c, 5? 5 Let k = -0.1584 + 0.4584. Which is the biggest value? (a) -3 (b) -2/37 (c) k (d) 0.2 c Suppose 3d - d - 54 = 0. Let k = d + -80/3. What is the biggest value in 1, 0, k? 1 Let d = -2 + 4. Let g(f) = -f3 - 10f*2 - 4f - 8. Let u be g(-8). Let v = u + 522/5. Which is the biggest value? (a) v (b) d (c) -2/9 b Suppose 6l = l + 15. Suppose -3g - 2u = 6 - 15, -2g = -lu + 7. Suppose 0 = i + y + 2, -g = y. What is the second biggest value in 0.1, -4, i? i Let o be 4808/1360 - (0 - -4). Let t = o - 3/85. Let i(a) = a + 5. Let p be i(-4). What is the third biggest value in 0.1, t, p? t Let v = -2/7349 - -8069/2645640. Which is the second smallest value? (a) 2 (b) -0.4 (c) 5 (d) v d Let n(h) = -2h*2 - 2h + 12. Let z be n(5). Let c = z - -48. What is the third biggest value in 7, c, 0.4? c Suppose s - 4l = 4s - 32, l = 3s - 7. Let w = -0.55 + 0.05. Let k be 1(-6)/422. What is the biggest value in w, s, k? s Let n = -0.0745 + -12.3555. What is the second biggest value in 5, -1, n? -1 Let x(q) = -q3 - 30q*2 + 65q + 32. Let i be x(-32). Which is the third biggest value? (a) -1/3 (b) i (c) -3 (d) -5 c Let q = 15 + -15. Suppose q = -5x - 3 + 43. What is the second biggest value in x, 0, 0.5? 0.5 Let k be ((-45)/(-30))/((-7)/2). Let m = -14 + -4. Let u = m - -14. Which is the second biggest value? (a) k (b) u (c) 5 a Suppose -2x - 2p - 2p = -12, -4x - 4p + 12 = 0. Suppose x = 4f - 3 - 13. Let v = -4 + 7. What is the smallest value in f, v, -7? -7 Let u be (0/(-2) - 1)140/(-2170). Which is the third biggest value? (a) -31 (b) u (c) 4 a Suppose -231k = -229k + 8. What is the biggest value in -3/5, 0.3, 1, k? 1 Let n(o) = -3o2 + 2o + 16. Let q be n(-2). Which is the third smallest value? (a) q (b) 17 (c) -2/21 (d) 0.1 d Let s = 2218.1 - 2220. What is the third biggest value in -5/3, s, -3? -3 Suppose 2v + 2 = 6, 0 = 3t - 5v + 7. Let w = 0.8 - -2.2. Let u = w - 7. Which is the biggest value? (a) 4 (b) u (c) t a Let u be (3/15-2)/(96/(-40)). Which is the fourth biggest value? (a) 0.36 (b) 2/13 (c) u (d) 1/5 b Let k(y) be the second derivative of y*3/2 - 13y*2/2 - 2y. Let s be k(4). Let d be 0/(-1) + (-4)/(-10). What is the second biggest value in -4, s, d? s Let v = 0.21 + -0.12. Let m = -0.91 - v. Let p = -4 + m. Which is the smallest value? (a) p (b) 2/11 (c) 2 a Let i = -2 - -1.8. Let g = -3/11 + 45/44. Let j = 25 - 28. What is the smallest value in j, i, g? j Let v = -0.276 + 0.306. Let s(q) = -q*2 + 2. Let l be s(2). Which is the second biggest value? (a) 3 (b) v (c) l b Let r(l) = 21l - 123. Let m be r(6). Which is the third biggest value? (a) -0.8 (b) 0.4 (c) m a Let x(v) = v*2 + 3v + 3. Let s be x(-3). Let q = -5.27 - -5.23. Let t = 5 + -4.6. Which is the third smallest value? (a) t (b) q (c) s c Let x = -0.122 + 0.622. Let q be 8/(-6)27/(-48). Suppose 3y - 4f + 6f + 23 = 0, 4f = 3y + 17. What is the third biggest value in y, q, x? y Let v = -389/88 + 31/8. Let z = -3.2 + 0.2. Let l = z - -3.3. Which is the second biggest value? (a) -0.1 (b) v (c) l a Let z(a) = 2a2 + 17a + 9. Let n be z(-8). What is the fourth biggest value in 5, n, -1.5, 3? -1.5 Let b be 8/6(-15)/(-2). Let o be b/8 - 3/2. Let n(k) = k3 + k2 - 4. Let g be n(0). What is the third biggest value in g, o, 3? g Let f = -19.4 + 19.352. Let s = -1.152 + f. Let u be (3/1)/((-81)/(-6)). Which is the biggest value? (a) 1/6 (b) u (c) s b Suppose 4f + 0 + 12 = 0. Let d be (-28)/54f - 2. Let m = 2/675 - 1388/12825. What is the smallest value in 5, m, d? d Let o = -4/135 - 23/135. Let y = -76803/91 + 844. Let n = y + 171/1001. What is the third biggest value in n, -0.11, o? o Let m be (2/8)/(3/(-6)). Let r be (10/(-10))/(2/(-34)). Let x = r - 15. What is the third biggest value in x, 2/5, m? m Let v be (-2 + 3 + -3)30/(-4). Let m be 2/(-21	{ "pile_set_name": "DM Mathematics" }
3 - 2. Let j be -2 - (-2)/x - -3. Find the third derivative of 0dj - 3d*4 + 0d*3 - 2d*2 wrt d. -72d Suppose -4j + 2j - 4 = 0. Let a = j + 6. What is the second derivative of 0o3 + ao*3 + 3o + 4o3 - 4o*3 wrt o? 24o Let y(g) be the first derivative of -12g7/7 + 2g*3/3 + 14. What is the third derivative of y(w) wrt w? -1440w*3 Suppose -3h - 22 = -4q - h, q + 3h = 2. Let g = 6 - q. Find the first derivative of -3a4 + 3a*4 + 3a*4 + g wrt a. 12a*3 Let m(c) = -1 + 0c2 + c2 + 4c2. Let y(b) = -10b*2 + 1. Let k(w) = -5m(w) - 2y(w). Differentiate k(z) wrt z. -10z Let z(w) = -3w + w3 + w2 - w2 - 2w2. Let y(d) = d2. Let m(c) = -2y(c) - z(c). Find the second derivative of m(s) wrt s. -6s Suppose -12 = -4k - 0. Suppose 4 = 2n - 6. Find the second derivative of -2c5 + cn - c + kc wrt c. -20c3 Suppose -15 = 3i, -2j + j - 17 = 4i. What is the third derivative of 5v2 - 3v*j + 3v3 - v3 wrt v? -6 Let u(q) be the second derivative of q3/6 - q2/2 - 5q. Let g(p) = -3p - 4. Let z(d) = g(d) - u(d). Differentiate z(l) wrt l. -4 Suppose -60 = -2g - 2g. Find the second derivative of -24k4 + 6k + 11k4 + gk*4 wrt k. 24k*2 Suppose 4h - 6 = -5s + 7, s + 5 = 3h. What is the third derivative of hv2 - 2v + v*4 + 2v wrt v? 24v What is the third derivative of -18w*3 + 3w*2 + 10w*2 - 2w*2 wrt w? -108 What is the third derivative of -8g*3 + 37g*2 - 27g*2 - 21g3 wrt g? -174 Let m(b) = b2 - 4b - 7. Let i be m(6). What is the second derivative of -4r*5 - 2r + 3r5 - r + 2r*i wrt r? 20r*3 What is the third derivative of -18l*2 + 15l*2 - 12l*6 + 23l*2 wrt l? -1440l3 Let r(v) be the third derivative of v4/4 - v*3 + 7v*2. Differentiate r(q) with respect to q. 6 Let z(j) be the first derivative of 2j + 2 + 0j2 + 1/4j*4 + 0j*3. Differentiate z(t) wrt t. 3t*2 Let h(b) = -b + 2. Let g be h(2). Suppose g = -2v + 7 - 3. Find the third derivative of -2a3 - a2 + va3 + a4 wrt a. 24a What is the first derivative of -q4 + 0q*4 + 3 - 1 - 3q*4 wrt q? -16q*3 Suppose -r + 0 = -c - 4, 4r + 24 = -4c. Let u = 4 + r. What is the second derivative of f5 + f + f5 - uf*5 wrt f? -20f*3 Let x(z) = 4z*6 + 13z*2 + z + 4. Let f(r) = -8r*6 - 25r*2 - 2r - 7. Let o(k) = -4f(k) - 7x(k). Find the third derivative of o(q) wrt q. 480q3 Let m(r) be the second derivative of -r6/5 - r4/3 - 5r. Find the third derivative of m(h) wrt h. -144h Let j(w) be the first derivative of 10w3 + w2 + 2w - 32. What is the second derivative of j(v) wrt v? 60 Let a(t) be the third derivative of -3t*8/56 + 5t*4/24 + 3t*2. Find the second derivative of a(l) wrt l. -360l*3 What is the third derivative of -2n*3 - 41n*4 + 29n*4 + 13n*2 - 30n*4 wrt n? -1008n - 12 Let q(s) be the third derivative of 0 - 2s2 + 1/12s*4 - 1/2s*3 + 0s. Differentiate q(m) with respect to m. 2 Let n(x) = 5x3 + 3x*2 - 3x - 1. Let z(c) = 9c3 + 5c*2 - 5c - 3. Let y(j) = -10n(j) + 6z(j). What is the first derivative of y(g) wrt g? 12g2 Let y(x) be the third derivative of 0x*5 + 0 - 1/3x*3 - 1/120x*6 + 0x + 2x2 + 0x*4. Differentiate y(u) wrt u. -3u2 Let i(t) = t3 - 10t2 + 8t + 11. Let s be i(9). Differentiate w*4 + 3w4 + w4 + s wrt w. 20w3 Let h(q) = -q2 - 3q + 12. Let t be h(-5). Suppose -8 = -4k + 12. Find the second derivative of -2p*k + 2p*2 - 2p*t - 3p wrt p. -40p3 Let x be (-138)/(-24) - (-1)/4. Differentiate -5 - 2h*3 + xh*3 - 2h*3 with respect to h. 6h*2 Let y = -4 - -6. Find the third derivative of -2py - p4 - 5p + 10p - 5p wrt p. -24p Let d be -1 + 3 + 12 + -14. Let u(l) be the second derivative of -3l - 1/20l*5 + d + 1/6l*4 + 0l*3 + 0l*2. Find the third derivative of u(f) wrt f. -6 Let p be ((-474)/(-150) + -3)/((-4)/(-10)). Let x(b) be the first derivative of pb*5 + 1 + 0b*4 + 2b + 0b3 + 0b*2. Differentiate x(d) wrt d. 8d*3 Suppose -15k - 11k = -6k. Let p(l) be the third derivative of 4l2 + 0l*3 + 0l + k - 1/8l4 + 1/60l5. Find the second derivative of p(s) wrt s. 2 Let h(w) be the second derivative of w6/6 - 2w4/3 + 4w. Find the third derivative of h(u) wrt u. 120u Let c(z) be the third derivative of 0 + 1/20z*5 + 6z*2 + 0z4 + z3 + 0z. Find the first derivative of c(h) wrt h. 6h Find the second derivative of 51m5 - 14m*5 - 4m - 8m wrt m. 740m3 Let c(z) be the second derivative of z8/168 + z*4/24 + 3z*2/2 + 3z. Let m(b) be the first derivative of c(b). Find the second derivative of m(r) wrt r. 40r3 What is the second derivative of 52 - 52 + 51b + 4b2 + 0b*3 + 5b*3 wrt b? 30b + 8 Let l = 71 - 71. Let c(s) be the second derivative of 0s2 - 1/12s*4 + 0s*5 + ls*3 + 0 + 2s + 2/15s6. Find the third derivative of c(b) wrt b. 96b Let q(y) = -y*2 + 3y + 2. Let m be q(3). Let c = -9 + 15. Find the first derivative of -c + 3 + 1 + v*m wrt v. 2v Let m(c) be the second derivative of 5c6/6 + 3c*2 - 19c. Differentiate m(z) with respect to z. 100z3 Let d(h) = -h2 - 7h - 4. Let z be d(-6). Let u be (9/6 + 1)(2 - 0). Find the third derivative of -uc*4 + 5c*2 + zc*4 - 3c*2 wrt c. -72c Let u be ((-16)/5)/((-2)/5). Find the first derivative of -x - 2x - ux + 3x - 1 wrt x. -8 Let i(c) be the second derivative of 23c*5/20 + 7c*4/6 - 21c. Find the third derivative of i(v) wrt v. 138 Let s(k) = k2 - k - 5. Let d be s(0). Let r(b) = b3 + 5b2 - b - 4. Let y be r(d). Differentiate 5v*2 - 2v*2 - 6v*2 - y wrt v. -6v Differentiate -a*2 + 9 - 404a + 404a wrt a. -2a Let u(z) be the third derivative of -5z8/56 - 29z*5/60 - 12z*2. What is the third derivative of u(b) wrt b? -1800b*2 Let q(i) be the first derivative of 0i - 6 + 0i3 + i2 + 1/4i*4. Find the second derivative of q(k) wrt k. 6k Let y be 0/((4/(-2))/(-2)). Suppose y = 4h - 7h. Find the first derivative of hk2 + 1 - 2k*2 - 2 wrt k. -4k Let i(c) be the first derivative of 0c2 + 0c*3 + 3 + 5c - 4/5c5 + 0c*4. Differentiate i(s) with respect to s. -16s3 Let c(i) = i4 - 2i3 - 2i*2 - 4. Let x be (24/9)/(-4)3. Let f(o) = o3 + o2. Let v(s) = xf(s) - c(s). Find the first derivative of v(q) wrt q. -4q*3 Let m(o) = -4o - 10. Let r be m(-3). Suppose 3i + 10 = 8i. Find the third derivative of -a + ra - a + 2a*i + 3a*4 wrt a. 72a Suppose 2p = 3p - 1. Let i be p + (1 - 3)-1. What is the second derivative of m - 3m*3 + 5m*i + m wrt m? 12m Suppose 5b + 2 = 3u, -u - 2 - 2 = -4b. Suppose -5y - 4d + 11 = 0, 4d + 13 = 4y + 3d. Find the third derivative of -y + 1 + b - 4k4 - k2 wrt k. -96k Let g(f) = 2f3 - 4f*2 + f + 2. Let k be g(2). What is the third derivative of 6p*k + 249 + 6p*2 - 249 wrt p? 144p Let x(f) be the first derivative of -f*3 + 8f*2 - 7 - 7f*2 - 4f*2. What is the second derivative of x(g) wrt g? -6 Let x be (-80)/(-14) - (-6)/21. Find the first derivative of 6g + 3g - 6 - xg wrt g. 3 What is the third derivative of 2z4 - 3z*4 + 10z*2 - 3z*4 wrt z? -96z Let y(h) be the first derivative of 0h2 + 0h + 2/3h3 + 3/4h*4 + 4. What is the third derivative of y(t) wrt t? 18 Let n = 10 - -2. Suppose 0 = 5i - n - 13. What is the third derivative of 6k5 - k2 - 3k5 - ki wrt k? 120k2 Suppose -4n + r + 43 = 0, -2n + 2r + 34 = 4r. Let z = n - 8. Find the first derivative of -4 + 3 - i4 - 1 + z wrt i. -4i*3 Let m be (-2)/(-1) + (1 - 2). Let w be m/((-1)/(-3))1. Find the third derivative of 3i3 + 2i3 - i2 - 3iw wrt i. 12 Find the second derivative of -5v*3 - 3v - 2v - 2v*3 + 2v*3 wrt v. -30v Let d(b) = 8b3 - 5b*2 - 14b - 5. Let x(q) = 8q3 - 4q*2 - 13q - 4. Let n(l) = 4d(l) - 5x(l). What is the second derivative of n(p) wrt p? -48p Differentiate 7 - 37c + 59 + 2c2 + 37c + 12c3 wrt c. 36c*2 + 4c Let t(w) = -3w3 - w2 + w + 1. Let n be t(-1). What is the second derivative of 0y*2 - 5y - 16y3 + 13y*3 + 0y*n wrt y? -18y Let r(m) = m + 2. Let u be r(2). Let y(k) = -k*3 + 5k**2 - 2	{ "pile_set_name": "DM Mathematics" }
noseconds are there in twenty-seven halves of a microsecond? 13500 How many seconds are there in eight fifteenths of a minute? 32 How many centimeters are there in 1/20 of a kilometer? 5000 Convert 0.4171297 years to centuries. 0.004171297 What is 5/4 of a litre in millilitres? 1250 How many millilitres are there in five quarters of a litre? 1250 How many millimeters are there in thirty-one halves of a meter? 15500 Convert 33.58464nm to kilometers. 0.00000000003358464 What is one tenth of a microgram in nanograms? 100 What is 11/2 of a gram in milligrams? 5500 What is 1/5 of a kilometer in centimeters? 20000 How many milligrams are there in one quarter of a gram? 250 What is twenty-five halves of a kilogram in grams? 12500 How many years are there in 25/2 of a millennium? 12500 How many millilitres are there in 11/10 of a litre? 1100 Convert 0.1293685 millilitres to litres. 0.0001293685 How many micrometers are there in thirteen eighths of a millimeter? 1625 What is 9.6111l in millilitres? 9611.1 What is three fifths of a hour in minutes? 36 How many millilitres are there in 33/5 of a litre? 6600 What is 1/10 of a litre in millilitres? 100 Convert 852.4893 millilitres to litres. 0.8524893 How many meters are there in 76/5 of a kilometer? 15200 How many seconds are there in 17/4 of a hour? 15300 How many hours are there in 24675.237 milliseconds? 0.0068542325 How many millilitres are there in seven halves of a litre? 3500 What is 3/8 of a litre in millilitres? 375 Convert 42869.16 milliseconds to seconds. 42.86916 What is 5/8 of a day in minutes? 900 What is 28.19844 weeks in seconds? 17054416.512 Convert 1445.8824 microseconds to hours. 0.000000401634 Convert 0.7985826um to nanometers. 798.5826 What is 7/4 of a meter in millimeters? 1750 What is 1/30 of a day in minutes? 48 How many micrometers are there in 23/8 of a millimeter? 2875 What is three eighths of a century in months? 450 What is 4.674672 kilometers in meters? 4674.672 What is twenty-five quarters of a kilometer in meters? 6250 What is 0.25985 nanoseconds in seconds? 0.00000000025985 How many micrograms are there in twenty-six fifths of a milligram? 5200 What is one tenth of a kilometer in centimeters? 10000 How many days are there in 283.59342s? 0.00328233125 How many centuries are there in one tenth of a millennium? 1 What is three tenths of a kilometer in meters? 300 How many micrograms are there in fourty-two fifths of a milligram? 8400 What is 410.2736 millilitres in litres? 0.4102736 How many weeks are there in 1549.85313 hours? 9.22531625 Convert 15283.47 decades to centuries. 1528.347 What is 0.951283 millilitres in litres? 0.000951283 Convert 460786.59s to hours. 127.996275 Convert 7.159473 decades to millennia. 0.07159473 What is 69/2 of a kilogram in grams? 34500 How many kilograms are there in 55181.17t? 55181170 What is three eighths of a kilometer in centimeters? 37500 Convert 15062.9193ms to days. 0.00017433934375 What is three tenths of a litre in millilitres? 300 How many micrometers are there in 27/2 of a millimeter? 13500 Convert 18.77261ml to litres. 0.01877261 How many seconds are there in one fifth of a day? 17280 How many millimeters are there in 3/5 of a centimeter? 6 Convert 147664.6um to meters. 0.1476646 How many micrograms are there in fourty-eight fifths of a milligram? 9600 What is 4/75 of a millennium in months? 640 What is 5/6 of a century in months? 1000 What is 79.4305nm in centimeters? 0.00000794305 What is seven thirds of a decade in months? 280 Convert 5672.583 minutes to days. 3.93929375 How many centuries are there in 77.05385 years? 0.7705385 How many kilometers are there in 0.0353755 meters? 0.0000353755 Convert 0.3209745t to nanograms. 320974500000000 How many months are there in seven thirds of a year? 28 Convert 263205.99 minutes to days. 182.7819375 What is 41127.15g in milligrams? 41127150 How many centimeters are there in 0.6237787mm? 0.06237787 What is 84905.7 milligrams in kilograms? 0.0849057 What is fifty-seven fifths of a millennium in decades? 1140 How many nanograms are there in 61/4 of a microgram? 15250 What is 17/2 of a litre in millilitres? 8500 What is three fifths of a millennium in months? 7200 Convert 380.9577 seconds to nanoseconds. 380957700000 What is 74437.52 decades in months? 8932502.4 What is 803.7109 millimeters in meters? 0.8037109 What is 3/50 of a tonne in kilograms? 60 Convert 18.327816 nanoseconds to minutes. 0.0000000003054636 What is 0.2432712 months in decades? 0.00202726 What is 3/32 of a milligram in nanograms? 93750 How many nanometers are there in nineteen quarters of a micrometer? 4750 How many litres are there in 0.9207237 millilitres? 0.0009207237 Convert 7.563376 litres to millilitres. 7563.376 How many minutes are there in one quarter of a week? 2520 What is 0.7792231 weeks in hours? 130.9094808 Convert 7095.4 meters to millimeters. 7095400 How many millennia are there in 25.39143 months? 0.0021159525 Convert 0.0344749kg to micrograms. 34474900 How many months are there in seven sixths of a century? 1400 What is 143.242 minutes in milliseconds? 8594520 Convert 347834.7l to millilitres. 347834700 How many tonnes are there in 70764.17 kilograms? 70.76417 How many millimeters are there in 86986.9m? 86986900 How many millilitres are there in one quarter of a litre? 250 How many years are there in three fifths of a century? 60 How many millennia are there in 4704.364 centuries? 470.4364 How many months are there in thirteen quarters of a year? 39 What is 44/5 of a millennium in decades? 880 What is 3/32 of a meter in micrometers? 93750 Convert 1024.845 months to decades. 8.540375 How many micrograms are there in 48.82261mg? 48822.61 How many minutes are there in one tenth of a week? 1008 How many micrometers are there in seven sixteenths of a centimeter? 4375 What is 4.197404 weeks in seconds? 2538589.9392 How many micrometers are there in three fifths of a millimeter? 600 Convert 116.46219 months to millennia. 0.0097051825 What is three eighths of a kilometer in centimeters? 37500 Convert 19.15879 millennia to centuries. 191.5879 Convert 6023.71mm to centimeters. 602.371 How many grams are there in five quarters of a kilogram? 1250 How many seconds are there in 0.0840547 days? 7262.32608 How many grams are there in five quarters of a kilogram? 1250 How many millilitres are there in eleven eighths of a litre? 1375 What is 305910.2 millilitres in litres? 305.9102 What is three eighths of a kilometer in meters? 375 How many centimeters are there in 7/8 of a kilometer? 87500 How many centuries are there in 69403.2 millennia? 694032 Convert 2070014.13 nanoseconds to days. 0.000000023958496875 How many weeks are there in 76565449.8ms? 0.1265963125 How many milliseconds are there in one twentieth of a minute? 3000 How many litres are there in 0.9187232ml? 0.0009187232 What is 1330.107 nanometers in meters? 0.000001330107 What is 86.27746 kilograms in grams? 86277.46 Convert 25.35219ms to seconds. 0.02535219 How many millilitres are there in 0.7808794 litres? 780.8794 How many centuries are there in six fifths of a millennium? 12 What is sixty-nine halves of a kilometer in meters? 34500 How many days are there in 35166.1 weeks? 246162.7 What is 0.9585814 nanograms in micrograms? 0.0009585814 How many centimeters are there in 3/5 of a meter? 60 What is three fifths of a minute in milliseconds? 36000 What is 5/4 of a decade in months? 150 How many minutes are there in four sevenths of a week? 5760 What is 17/2 of a litre in millilitres? 8500 What is 1/16 of a gram in micrograms? 62500 Convert 15.39866 millimeters to nanometers. 15398660 What is 9.378885 milliseconds in minutes? 0.00015631475 What is 4.019654 millimeters in centimeters? 0.4019654 How many kilometers are there in 692262.7 centimeters? 6.922627 How many micrograms are there in 616948.2mg? 616948200 What is 1/10 of a centimeter in millimeters? 1 How many meters are there in 3/25 of a kilometer? 120 How many milligrams are there in 307083.1 micrograms? 307.0831 How many seconds are there in 1/9 of a day? 9600 What is 13/5 of a milligram in micrograms? 2600 What is 24.6697353 minutes in weeks? 0.002447394375 How many micrograms are there in 4.39	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.