Split (1)

train · 100k rows

text stringlengths 270 8.19k	meta dict
? 484r2 Let i(f) = 2f*2 + f. Let t(m) = -43m. What is i(t(y))? 3698y2 - 43y Let b(q) = 2q + 2 - 2. Let l(j) be the third derivative of -j4/3 + 264j*2. Give b(l(u)). -16u Let c(r) = -r*2 - 2r + 2. Let g be c(-2). Let l(y) = -y - gy + y. Let k(q) be the third derivative of q4/12 + q2. What is l(k(a))? -4a Let k(v) = -v. Let i(h) = -h. Let d(f) = 5i(f) - 6k(f). Let y(l) = -2l2 - 31. Calculate d(y(x)). -2x*2 - 31 Suppose 4u - 2q - 28 = 0, 0q - 6 = -2u - 3q. Let p(a) = -5a + ua + 3 - 3. Let n(i) be the third derivative of -i5/60 + i2. What is n(p(x))? -x*2 Suppose -4g - 4v + 2v = -12, -4g + 12 = -v. Let m(j) = -6j - 8. Let o(a) = 2a + 3. Let q(f) = gm(f) + 8o(f). Let k(u) = -17u*2. Determine k(q(p)). -68p2 Let b(c) = c. Let y(z) be the first derivative of -z2/2 + z - 1. Let w(f) = 4f2 + 3f - 3. Let t(i) = w(i) + 3y(i). What is b(t(r))? 4r*2 Let i(a) = 4a. Let b = 10 + -7. Let j(w) = -bw + 4w - 3w2 - w. What is j(i(c))? -48c*2 Let u(r) = -3r. Let q(t) = 3t2 - 36. What is u(q(j))? -9j*2 + 108 Let n(o) = 7o + 6. Let j(y) = -13y - 11. Let v(u) = -6j(u) - 11n(u). Let x(m) = -m. Let g be x(-2). Let s(k) = 6k - k*g - 6k. Determine s(v(t)). -t*2 Let f(v) = -500v*2. Let o(g) = 2g*2. Give o(f(k)). 500000k4 Let v(k) be the third derivative of k6/360 - k3/3 + k2. Let q(x) be the first derivative of v(x). Let z(m) = -m2. Calculate q(z(f)). f4 Let j(y) = -2358y2. Let k(b) = 2b*2. What is j(k(z))? -9432z*4 Let w(r) = 6r. Let n(h) be the third derivative of h*4/3 - 11h*2. What is w(n(l))? 48l Let z(k) = -2k2 + 2k. Let m(c) = 7c2 - 9c. Let v(i) = 4m(i) + 18z(i). Let g(x) = -2x2. What is v(g(q))? -32q*4 Let z(r) be the first derivative of 3/2r*2 - 4 + 0r. Let u(a) = 3a2. Give z(u(w)). 9w*2 Let p(c) = -2c*2. Let u(y) = -3903y. What is u(p(m))? 7806m2 Let l(p) = -3p. Let q(j) be the third derivative of -j7/2520 - j5/30 + 6j2. Let o(u) be the third derivative of q(u). Calculate l(o(v)). 6v Let f(t) = -6t2. Let c(v) = 12v - 1. Calculate c(f(d)). -72d2 - 1 Let b(x) be the second derivative of x4/12 - 8x. Let t(i) = -2i. Give t(b(q)). -2q*2 Let a(b) = 4b*2 - 7b - 10. Let o(l) = 2l2. Give a(o(s)). 16s*4 - 14s*2 - 10 Let l(i) = -2i*2 - 2. Let o(c) = 2c*2 + 3. Let m(r) = -6l(r) - 4o(r). Let y(d) = 2d*2. What is y(m(f))? 32f*4 Suppose 5k - 14 = -2v, 3k = 2v + v. Let z(u) = -uv + 5u*2 + 2u - 2u. Let i(q) = q2. Determine i(z(g)). 16g4 Let i = -17 - 1. Let k be 2/(-8) + i/(-8). Let n(t) = -t2 + kt2 + 0t2. Let y(q) = -q2. What is n(y(g))? g*4 Let y(q) = -2q*2. Let t(n) = -4 + n + 4 - 16n. Calculate t(y(d)). 30d2 Let j(b) = 2b*2. Let z(c) = -41c. Calculate j(z(x)). 3362x2 Let r(o) be the third derivative of 19o*5/60 + 14o*2. Let a(x) = -x. Give r(a(k)). 19k*2 Let z(t) = -47t. Let x(y) = -8 + 8 + 5y - 6y. What is x(z(q))? 47q Let a(r) = -472r + 3. Let c(l) = 2l2. Determine c(a(h)). 445568h*2 - 5664h + 18 Suppose 4w - 37 = -5. Let b(c) = -8 + w - c. Let x(u) = -5u. What is b(x(h))? 5h Let g(y) = -y2. Let c(k) be the second derivative of k4/2 - k. Determine g(c(z)). -36z*4 Let w = -6 - -4. Let d(l) = 3l. Let z(m) = -10m. Let x(a) = wz(a) - 7d(a). Let c(b) = -3b. Determine x(c(v)). 3v Let m(c) = -35c*2. Let d(g) = -22g. What is m(d(z))? -16940z2 Let t(b) = -3b*2. Let g(r) = 3r + 2. Let p(i) = -10i - 7. Let a(h) = 21g(h) + 6p(h). Determine t(a(k)). -27k*2 Let b(j) be the first derivative of 2j2 - 2. Let n(q) be the second derivative of -q4/12 - 6q. What is b(n(s))? -4s*2 Let b(x) = 5x*2. Let r = -13 + 17. Let u(f) = -rf*2 - 4f*2 + 4f*2 + 2f*2. Calculate u(b(i)). -50i*4 Let j(q) = 3q*2 - 453. Let c(h) = -2h. What is c(j(y))? -6y2 + 906 Let u(r) = -305r. Let m(n) = 28n2. Calculate u(m(k)). -8540k*2 Let j(m) = -3m + 41. Let u(k) = 3k. Calculate j(u(c)). -9c + 41 Let m(s) = -4s2. Let o be ((-108)/8)/(2/4). Let u = -19 - o. Let q(i) = -6i. Let l(b) = 2b. Let d(y) = ul(y) + 3q(y). What is m(d(g))? -16g*2 Let o(c) = 2c. Let x(l) = -17l2 - 14l. What is o(x(b))? -34b2 - 28b Let q(z) be the first derivative of z*2 - 5. Let a(y) = -5y. Give a(q(m)). -10m Let y(s) be the second derivative of -3s*4/4 + 24s. Let p(i) = -2i. Give p(y(t)). 18t*2 Let x(n) = 8n. Let g(w) be the second derivative of w*4/6 - 17w. Give x(g(p)). 16p2 Let w(x) = 2x*2. Let v(d) = -d - 5 + 5d - d. Let l(j) be the second derivative of j*3/3 - 3j*2/2 - 6j. Let a(f) = 10l(f) - 6v(f). Calculate w(a(z)). 8z2 Let k(v) be the third derivative of v4/24 - 3v*2. Suppose -4 = -4z + 2z. Let p(b) = -3 + 3 - zb. What is k(p(w))? -2w Let s(a) = -a2. Let q(k) = -6k*2 - 46. What is s(q(n))? -36n*4 - 552n2 - 2116 Let m(o) = -o3 - 8o2 + 2o + 11. Let f be m(-8). Let y(p) = 7p. Let s(i) = 6i. Let n(d) = fy(d) + 6s(d). Let c(v) = 4v. Calculate c(n(w)). 4w Let m(s) = 7s2. Let z(v) = -4v + 5181 - 5181. Calculate m(z(y)). 112y2 Let p(v) = -3v + 8. Let s(i) = 1. Let h(m) = 3p(m) - 24s(m). Let t(x) = -x. Determine t(h(g)). 9g Let w(g) = 2g*2. Let h(b) = 45b - 9. Let u(o) = -11o + 2. Let r(p) = 2h(p) + 9u(p). Give r(w(q)). -18q*2 Let s(h) = -2h. Let q(g) = 1. Let b(d) = -d + 2. Let w be (-3)/(-6) + (-3)/(-2). Suppose -n + 0 + w = 0. Let f(k) = nq(k) - b(k). What is f(s(v))? -2v Let v(w) = -2w2. Let n(h) = -38h - 5. Let m(l) = -495l - 66. Let j(i) = 5m(i) - 66n(i). Determine v(j(x)). -2178x*2 Suppose 2c - 37 = -1. Suppose -c = 5v - 8v. Let t(q) = 2q - 2q + 8q2 - vq2. Let p(i) = i2. What is t(p(x))? 2x4 Let j(t) = 9t*2 - 28t. Let f(x) = -x*2. Give f(j(v)). -81v*4 + 504v*3 - 784v*2 Let c = -15 - -15. Let q(z) be the first derivative of -3/2z*2 - 1 + cz. Let u(m) = m. Give q(u(x)). -3x Let t(i) = -3i - 4. Let u(m) = 2m + 3. Let o(z) = 3t(z) + 4u(z). Let s(n) be the third derivative of 0n*3 - 1/24n*4 + 0 - 2n*2 + 0n. Give o(s(l)). l Let u(s) = 5s2. Let g(n) = 900n*2. What is g(u(o))? 22500o*4 Let x(j) = 64j. Let n(f) = 25f2. Calculate n(x(r)). 102400r2 Let q(x) be the second derivative of -x4/12 - 3x. Let t(v) = 21v. Determine q(t(k)). -441k2 Let i(z) = z. Let w(b) = b2 - 1. Let a(l) = 1. Let h(x) = -3x*2 + 10. Let r(p) = 6a(p) - h(p). Let o(c) = -3r(c) + 12w(c). Determine i(o(j)). 3j2 Let q = 6 + -4. Let d be q - 1/20. Let m(i) = -6i2 - 2i. Let s(x) = -13x2 - 5x. Let v(z) = ds(z) - 5m(z). Let n(r) = -r*2. Calculate n(v(t)). -16t*4 Let u(v) be the third derivative of 0v*3 + 0 + 5v*2 + 0v + 1/10v5 + 0v4. Let j(k) = k2. Calculate u(j(z)). 6z4 Let u(c) = -3c + 19c + 42 - 15 - 18c. Let s(g) = -3g. Calculate s(u(m)). 6m - 81 Let u(d) = 16d2 - 20d. Let m(w) = -20w. Let x be m(-1). Let g(y) = y2 - y. Let c(i) = xg(i) - u(i). Let o(s) = -2s. Calculate o(c(f)). -8f*2 Let n be ((-16)/28)/((-2)/7). Let p(c) = 23c - 23c + cn. Let t(h) = 3h*2. What is t(p(j))? 3j*4 Let t(o) = 25o*2. Let u(j) = 58j*2. What is u(t(v))? 36250v4 Let v(o) = -o2 - o - 1. Let k(c) = 24c2 + 16c + 16. Let w(q) = k(q) + 16v(q). Let t(s) = -2s. What is w(t(x))? 32x2 Let w(v) = 10v2 + v2 - 5v2 - 4v*2. Let m(s) be the first derivative of -2s*3 + 1. Give m(w(a)). -24a*4 Let o(j) = 9 - 20 - 3j + 11. Let x(h) = -4h2. What is x(o(v))? -36v*2 Let z(w) = 5w2. Let u(a) be the second derivative of a4/12 - a*2/2 - a. Let b(h) be the first derivative of u(h). What is b(z(j))? 10j*2 Let a(t) = 5t*2 - 4t + 4. Let q(s) = 11s2 - 9s + 9. Let g(d) = -9a(d) + 4q(d). Let p(o) = -4o + 5o + 7o. Calculate g(p(x)). -64x*2 Let h(k) = 11k*2 - 3k. Let j(a) = 11a. Calculate h(j(n)). 1331n*2 - 33n Let l(n) = 3 - n*2 - 3. Let a(h) = 0h + 9h - 7h. What is a(l(p))? -2p2 Suppose 5w = -b - 0b + 14, 5b + 4w = 28. Suppose -b = s - 2s. Let u(h) = h - sh + h. Let t(f) = 2f. Determine t(u(c)). -4c Let t(c) = -c2. Suppose 0 = o - 5o. Let j(a) = -2a2 + oa*2 + 4a2 - a2. What is j(t(i))? i*4 Let q(w) = 2w**2. Let d	{ "pile_set_name": "DM Mathematics" }
s picked without replacement from zgbbbjjjbbgbggfj. Give prob of sequence gg. 1/20 What is prob of sequence rx when two letters picked without replacement from dddrx? 1/20 Two letters picked without replacement from {o: 1, f: 12, p: 5}. Give prob of sequence ff. 22/51 What is prob of sequence wwo when three letters picked without replacement from jijwiowzk? 1/252 Two letters picked without replacement from {u: 1, i: 1, q: 5, e: 4, w: 3}. What is prob of sequence uw? 3/182 Two letters picked without replacement from {b: 1, q: 2, o: 2, d: 2, s: 1}. What is prob of sequence so? 1/28 What is prob of sequence ekkf when four letters picked without replacement from {f: 2, e: 3, k: 2, c: 13}? 1/9690 Three letters picked without replacement from {p: 3, r: 4}. Give prob of sequence prp. 4/35 What is prob of sequence cucu when four letters picked without replacement from uccccuccccccccccccc? 1/171 Two letters picked without replacement from dthtxrv. What is prob of sequence rh? 1/42 Four letters picked without replacement from dppddpddppdp. What is prob of sequence dppp? 2/33 What is prob of sequence ooyv when four letters picked without replacement from kkokvvvuuyuykovkvvvv? 4/14535 Three letters picked without replacement from {m: 4, p: 3, j: 4, u: 7}. What is prob of sequence jjj? 1/204 What is prob of sequence nne when three letters picked without replacement from neneueea? 1/42 Four letters picked without replacement from mdleddwdmlejdddwd. What is prob of sequence jwew? 1/14280 Three letters picked without replacement from cadacdaaccacqccda. Give prob of sequence qaa. 1/136 Two letters picked without replacement from {a: 6, o: 2, f: 2, b: 2}. Give prob of sequence ff. 1/66 What is prob of sequence qbd when three letters picked without replacement from {d: 9, h: 4, q: 2, i: 1, b: 1}? 3/680 What is prob of sequence kshs when four letters picked without replacement from kkkskhkkskhsh? 21/2860 What is prob of sequence jqnq when four letters picked without replacement from {c: 4, j: 2, n: 2, q: 3}? 1/330 Two letters picked without replacement from {r: 1, a: 1, k: 1, o: 2, l: 1, h: 2}. Give prob of sequence oh. 1/14 Four letters picked without replacement from {h: 5, n: 3, l: 3}. Give prob of sequence hlnh. 1/44 Calculate prob of sequence rsx when three letters picked without replacement from ttrrsstsrtsssex. 3/455 Two letters picked without replacement from {r: 5, z: 2, d: 1, g: 2, p: 2, s: 1}. What is prob of sequence rd? 5/156 Three letters picked without replacement from pidtuwt. What is prob of sequence pdi? 1/210 Calculate prob of sequence ce when two letters picked without replacement from pevzveuuueeceuu. 1/42 Four letters picked without replacement from {a: 15, e: 4}. Give prob of sequence eaea. 35/1292 Calculate prob of sequence my when two letters picked without replacement from {v: 4, m: 3, l: 4, y: 5, z: 3}. 5/114 Three letters picked without replacement from {l: 1, x: 3, e: 4, r: 9, y: 1}. Give prob of sequence lyx. 1/1632 Three letters picked without replacement from {c: 2, r: 9, h: 1, d: 1, o: 1, e: 6}. What is prob of sequence eeo? 1/228 What is prob of sequence uqe when three letters picked without replacement from qkueeoouuekeuk? 2/273 What is prob of sequence rfr when three letters picked without replacement from rrrfffrrrr? 7/40 Two letters picked without replacement from okocrermrmm. Give prob of sequence co. 1/55 Three letters picked without replacement from {i: 2, c: 2, a: 2, m: 6}. What is prob of sequence cmm? 1/22 Three letters picked without replacement from {x: 1, e: 2, o: 5, i: 8}. Give prob of sequence oeo. 1/84 What is prob of sequence ao when two letters picked without replacement from wmwowjmwa? 1/72 Calculate prob of sequence or when two letters picked without replacement from oooorr. 4/15 What is prob of sequence tpt when three letters picked without replacement from egvgtptzvgt? 1/165 Two letters picked without replacement from {g: 7, i: 5}. What is prob of sequence gi? 35/132 Three letters picked without replacement from {l: 4, c: 2, z: 1}. Give prob of sequence lll. 4/35 Four letters picked without replacement from vzzvvzvzzzzzzzzzzzz. What is prob of sequence zzvz? 455/3876 Three letters picked without replacement from immmmnn. What is prob of sequence nmn? 4/105 Two letters picked without replacement from lrrlbzbrrlrz. What is prob of sequence rb? 5/66 Two letters picked without replacement from fyhflll. What is prob of sequence hy? 1/42 Three letters picked without replacement from {f: 1, i: 1, s: 6, a: 6, m: 4}. Give prob of sequence fis. 1/816 Four letters picked without replacement from llljjljjljjjl. Give prob of sequence jjll. 21/286 Three letters picked without replacement from {f: 1, d: 2, q: 2, x: 1, z: 1}. Give prob of sequence xzf. 1/210 Three letters picked without replacement from {s: 8, x: 3}. Give prob of sequence ssx. 28/165 Four letters picked without replacement from {u: 9, n: 2}. Give prob of sequence nuun. 1/55 Two letters picked without replacement from yjxyyxxytjgyyxxl. Give prob of sequence tx. 1/48 Calculate prob of sequence jb when two letters picked without replacement from {j: 1, y: 5, b: 2, f: 8}. 1/120 Calculate prob of sequence bnpp when four letters picked without replacement from {b: 1, j: 1, q: 1, z: 1, p: 2, n: 1}. 1/420 Two letters picked without replacement from {x: 5, d: 5}. What is prob of sequence dd? 2/9 Calculate prob of sequence vxf when three letters picked without replacement from {f: 1, x: 1, v: 1, a: 1, k: 1}. 1/60 What is prob of sequence uiu when three letters picked without replacement from uuiuuiu? 4/21 What is prob of sequence uqqq when four letters picked without replacement from {q: 3, u: 3}? 1/20 What is prob of sequence lc when two letters picked without replacement from {l: 1, p: 4, c: 2, k: 2}? 1/36 Two letters picked without replacement from mimmidtsstsmfmm. What is prob of sequence fs? 1/70 Three letters picked without replacement from {m: 1, q: 5, d: 1, f: 2}. What is prob of sequence mdf? 1/252 Calculate prob of sequence wdd when three letters picked without replacement from yyyywydddwdyyyyd. 1/84 Three letters picked without replacement from {z: 12, p: 6, i: 1}. Give prob of sequence zzp. 44/323 Three letters picked without replacement from ukmucyuycymmokm. What is prob of sequence yym? 4/455 Two letters picked without replacement from {s: 3, e: 5}. What is prob of sequence se? 15/56 What is prob of sequence dhh when three letters picked without replacement from {d: 13, h: 6}? 65/969 Calculate prob of sequence lgj when three letters picked without replacement from {g: 1, l: 1, j: 1}. 1/6 Three letters picked without replacement from vfvvvvvvvvvvvvvffv. Give prob of sequence vfv. 35/272 Two letters picked without replacement from spmmlnslltsnlpp. What is prob of sequence lm? 4/105 Three letters picked without replacement from vvvywwksswwwkvvvs. Give prob of sequence kvs. 3/340 What is prob of sequence yssy when four letters picked without replacement from sasassysssyyy? 21/715 Three letters picked without replacement from {i: 3, z: 4, b: 1, w: 5, n: 1, v: 1}. What is prob of sequence nbw? 1/546 Two letters picked without replacement from {x: 4, a: 4, m: 3}. What is prob of sequence ma? 6/55 Two letters picked without replacement from bbbabasabebaeeue. What is prob of sequence ab? 1/10 Calculate prob of sequence ki when two letters picked without replacement from iikiikiiki. 7/30 Three letters picked without replacement from qyqqqyqmrqqrmqqqrqrq. Give prob of sequence qqr. 22/285 Three letters picked without replacement from xlwxtlltlwttwlxqwwxw. What is prob of sequence wlx? 1/57 Two letters picked without replacement from {e: 3, m: 2, l: 4, w: 1, s: 3, d: 2}. Give prob of sequence ml. 4/105 Two letters picked without replacement from {u: 2, e: 3}. What is prob of sequence ee? 3/10 Four letters picked without replacement from {j: 3, r: 2, a: 1, z: 3, u: 6}. Give prob of sequence zrju. 3/910 Calculate prob of sequence kjjx when four letters picked without replacement from {j: 5, k: 7, x: 3, n: 2}. 1/136 Three letters picked without replacement from azkwaaawzk. What is prob of sequence wka? 1/45 Two letters picked without replacement from lzllrzwzwllw	{ "pile_set_name": "DM Mathematics" }
)x)/x assuming x is positive. x(193/3) Simplify ((x/x(2/15))/x(3/11))/((x20x)/(x/(xxxx(-1/26)xxx))) assuming x is positive. x(-108827/4290) Simplify (p(-1/9)p/p(3/7)p*(-4)/(p/(pp*0pp)p))(-20) assuming p is positive. p(3200/63) Simplify (k*6(k(k/(kk*(-1/8))k)/k)/k)/((k/k(-5))/(k6/kk)) assuming k is positive. k(49/8) Simplify ((s5s(s/(s/s(2/7)))/ss)/(ss/(s(2/21)s)ss1))(-20) assuming s is positive. s(-1420/21) Simplify (x/(x/(x32x)))(-2/65)(x/x*(-33))/(xx(-14)) assuming x is positive. x(2989/65) Simplify ((y*(-9/4)y*(3/13)y)(3/38))(4/5) assuming y is positive. y(-159/2470) Simplify (g(24/5)g(17/2))/(g(9/5)g(3/4)) assuming g is positive. g(43/4) Simplify (s*(-3/5)ss(1/5))/(s(-2/9))(-38) assuming s is positive. s(-353/45) Simplify (ii*(-2/51)i/i(1/14))/((i/(i13/i))/i(2/5)) assuming i is positive. i(47443/3570) Simplify (g/g(4/5))/((g(-1/9)g)/g)gg11gg(g*(-12)g)/g assuming g is positive. g*(104/45) Simplify ((((oo(6/19))/o)/o)/((o/(o/o(-20)))/o))/(o*(5/8)(o/(o/(o(oo*(1/7))/o)o)o)/o) assuming o is positive. o(20799/1064) Simplify ((a(-1)a)/a)(-3/26)/(a/a(-3/2)a(4/7)) assuming a is positive. a(-269/91) Simplify (x(4/9)/x)(2/13)/((x(-1/2)/x)/(xx*(-21)/xx)) assuming x is positive. x(-4349/234) Simplify y4y(-4/5)(yy(-3))(3/17) assuming y is positive. y(242/85) Simplify (g/g(5/3)g/(gggg(2/5)g))/(g*19/gg/g(-22)) assuming g is positive. g(-676/15) Simplify (ccc(cc*0)/c)/(c/(cc/c*(-14)c))(c(7/4)c)/c(-24) assuming c is positive. c(183/4) Simplify ((t*(-2/9)/tt((t/t1)/t)/t)/(tt*8t(t(-2/17)t)/tt))(2/13) assuming t is positive. t(-4010/1989) Simplify (p(-3))(-2/33)(pp(-9))/p(-10) assuming p is positive. p(24/11) Simplify (j/j(-3/22)j(j/(jj*18/j))/jj)(1/10) assuming j is positive. j(-327/220) Simplify mm(-8)(mm(-10)m)/mm(-8)/m(3/7) assuming m is positive. m(-171/7) Simplify ((q/q(2/13))/(qq*10))/(qq3)47 assuming q is positive. q(-2576/13) Simplify (m(9/7))(-47)/(m(-22)/(m/(m21/m))) assuming m is positive. m(-402/7) Simplify (a5)(-7)(a/a39)/a28 assuming a is positive. a(-101) Simplify (j/(jj(5/3)))30/(j*(-18/7)/jj(2/29)) assuming j is positive. j(-9439/203) Simplify dd(-18)d*(3/11)(dd(-2/61))/(d(11/4)/d) assuming d is positive. d(-46997/2684) Simplify (cc*(-20)c)/(c*26/cc)(cc/(cc(-4/7)))/c(-11/3) assuming c is positive. c(-814/21) Simplify (jjj(-2/3))(12/11)/(j(-2/3)j10) assuming j is positive. j(-260/33) Simplify (((jj(2/7))(-37/3))(5/7))(-4) assuming j is positive. j(2220/49) Simplify ((s(2/5)s(-3/4))/(s0s)(3/10))(5/11) assuming s is positive. s(-13/44) Simplify (f(1/36)/f(ff/(ff*(-2/41)))/f)/(ff/(f/f(-2/27)))18 assuming f is positive. f(-25963/1476) Simplify (w(-2/23)(ww/w*(1/6))/www)/(w11w(-11)) assuming w is positive. w(379/138) Simplify (i/(((i/(((i*(-2/31)/ii)/ii)/i))/i)/ii))*(-8/3)/(iii(-4/25)i(-2/9)) assuming i is positive. i(-10084/6975) Simplify (k*(2/41)/(kk*(1/16)k))/(k(1/4))(-47) assuming k is positive. k*(6387/656) Simplify (((aa*(11/4)a)/aa)/a)(-50)(a(-6/5))(5/11) assuming a is positive. a(-4137/22) Simplify ((f5/(f/(ff(-2))))(-1/10))(-1/24) assuming f is positive. f(1/80) Simplify ((oo*(-5/17)o)/oo(-2/3))(-10) assuming o is positive. o(-20/51) Simplify (((a/(a/(aa/a*15)a))/a)/(a*28a))/((a/a(-1))/a)(-6) assuming a is positive. a(-38) Simplify (p23/p(11/5))(-39) assuming p is positive. p(-4056/5) Simplify o(-2/13)o(-30)/ooo(-1/5)o(o/(oo/(o*(1/11)o)o)o)/o assuming o is positive. o(-21638/715) Simplify (i/i(4/5))*(2/83)i(2/17)/((i/(i(-2/47)i))/i) assuming i is positive. i(358083/331585) Simplify (s/s(1/11))/(s/s2)ss/(s(-12)/s)ss(1/5)s assuming s is positive. s*(1051/55) Simplify (g/(g/((g/(gg*2/g))/gg))gg)*(-23/5)((ggg(ggg10g)/gggg)/g)/g8 assuming g is positive. g(22/5) Simplify (p/p2p)(-1/14)/((p/p20)/(pp/((p/p(-7/4))/p))) assuming p is positive. p(77/4) Simplify (((f(f*(6/7)f)/ff)/f)/f)/(f15f)(ff(-13))/f(9/2) assuming f is positive. f(-443/14) Simplify (m(-2/7))*(-1/5)(m/m*1m)(3/19) assuming m is positive. m(143/665) Simplify (z*(-1)/zz/(zz(-18/11)))(3/29) assuming z is positive. z(-12/319) Simplify (r(-3)r)*(7/10)(r*(-6)r)(-3) assuming r is positive. r(68/5) Simplify (o(oo(-1/3))/o)(-42)o11ooooo7/o assuming o is positive. o(-7) Simplify ((b/(b/(b/(b/(((b/(b/((bb(-2/5)/b)/b)bb))/bb)/b)bb)b))b)*(-2/43)b(-5/2)/b(4/5))(5/6) assuming b is positive. b(-1331/516) Simplify (a/(a*0aa)a(1/7))/(a6/aa(-3)) assuming a is positive. a(-20/7) Simplify (z(-2/11)/z)/z(-20/3)(z(3/4))(3/5) assuming z is positive. z*(3917/660) Simplify ((qq/(q/(q(qq/(q/(q*(-5/3)/q)))/qq))q/(q/q(4/7)))/(q/q(4/9)qq/q(3/10)))(-20) assuming q is positive. q(1702/63) Simplify (h/(h/(h/(hh/h*12)))hh(-11))/(h(2/33))(-1) assuming h is positive. h(35/33) Simplify (k7/k)(-2/17)/(k/(k(8/5)k)k/((k(-20)k)/k)) assuming k is positive. k(-1709/85) Simplify (k(-4/7)/(k*9k))/(k(-3/8))26 assuming k is positive. k(-23/28) Simplify (u(-2))*39(u/u12)(-21) assuming u is positive. u153 Simplify m3/(m/m*9)(m*(-1/9)/mm)/m(-2/7) assuming m is positive. m(704/63) Simplify (y/y(-2/3))5(y(-2/9))(-48) assuming y is positive. y19 Simplify ((j(-3)/(jj/((jj(1/2))/j)))(-8))(-41) assuming j is positive. j(-1476) Simplify (q/q(1/18)qq/(q/q(3/23)))/(q39q(-6)/q) assuming q is positive. q(-12389/414) Simplify (u(-2))(-1/37)(u/(u5u))/(u/u*(5/7)u) assuming u is positive. u(-1614/259) Simplify (x/(x(3/5)/x)x)/(xx*16x)(x/(xxxxx(-11)x))/x(-1) assuming x is positive. x(-38/5) Simplify ((k*(-40)/kk)/k)/k(k(1/29)/k)/k(kkk(-8)/k)/k(-5/2) assuming k is positive. k(-2811/58) Simplify (g/g6)*(3/14)/((gg*15)/(gg/g18)) assuming g is positive. g(-463/14) Simplify (((ii0)(20/9))4)31 assuming i is positive. i(2480/9) Simplify (j1)(15/11)(j(1/4))35 assuming j is positive. j(445/44) Simplify (((z/z18)/(z*(-4/3)zz))40)(-46) assuming z is positive. z(97520/3) Simplify g(-3/11)/(g/(g/((gggg/(g*(2/11)/g)gg)/g)g)ggg)(gg(1/11))/(g/g(-8/7)g) assuming g is positive. g(-71/7) Simplify ((t/t22t)/ttt6)/(t13t(tt0)/t) assuming t is positive. t(-28) Simplify a/((a/a*22)/aaa)a/(a/a*(-3/4))a(a6)(2/127) assuming a is positive. a(10843/508) Simplify qqqq/q*(-1/29)q*(-20)/qq*(-3/2)qq(-18)q assuming q is positive. q*(-1999/58) Simplify (oo(-4/15)/o)(-1/7)/(o(-23)/o(-1/34)) assuming o is positive. o(82141/3570) Simplify (((q(-1))(-2/37))(-24))(-13) assuming q is positive. q(624/37) Simplify (t(t/(t(-2)/tt))/tttt)(-2/7)/(t4/t)(-21/5) assuming t is positive. t(381/35) Simplify ((vv(-3/11)/v)(-12/13))39 assuming v is positive. v(108/11) Simplify (((k/(k*(-5)/k))/k)/(kk(-3/20)))(-10/7) assuming k is positive. k(-103/14) Simplify (g/g1)*26(g/(g/g(3/7)))(-35) assuming g is positive. g(-15) Simplify (k(4/21)k14)/((k/(k(-2/19)/kk))/(k/k*(-1)k)) assuming k is positive. k(6418/399) Simplify (d1)*(2/81)/(ddd7d37) assuming d is positive. d(-3724/81) Simplify a/(aa/(a/a(-4/9)))aaa*(5/8)a*(-18)(aa/a11a)/a assuming a is positive. a(-1723/72) Simplify (((d/(d1dd))/(dd/d(-5)))/(dd*5d/d(-1/2)))(-3/2) assuming d is positive. d(99/4) Simplify (w(-7)(w(3/14)w)/w)/(w*(1/15)w/(w(-5)/w)) assuming w is positive. w(-2909/210) Simplify (((d/(d(-2/5)/d))/(d3/d))/(dd(-1/6)d)36)(-46) assuming d is positive. d*(15088/5) Simplify (((q/(qq/(q/q(-1))))(1/42))17)9 assuming q is positive. q(51/14) Simplify ((l/(l/((((l/((l(-13)/l)	{ "pile_set_name": "DM Mathematics" }
02945u3 - 14062665u*2 - 508511795u - 382888650 = 0. Calculate u. -1437, -73, -10/13 Factor 3g2 + 246876g - 22985415. 3(g - 93)(g + 82385) Find z, given that -25z4 - 21370z*3 - 13975z*2 + 2660490z + 7532280 = 0. -854, -49/5, -3, 12 Solve m*3/4 - 1459m*2/4 + 18379m - 123816 = 0. 8, 44, 1407 Determine r, given that -r*4/4 - 375515r*3/2 - 35253066563r*2 - 70505382098r = 0. -375514, -2, 0 Let 4p5/3 + 20854p*4/9 - 361066p*3/9 + 818840p*2/9 + 7927000p/9 - 1092000 = 0. What is p? -1755, -4, 7/6, 10 Solve 6z2 + 14283z - 2269410 = 0. -2530, 299/2 Suppose -w*5/2 - 347w*4 + 666717w*3 - 7965902w*2 + 59660615w/2 - 33125175 = 0. Calculate w. -1557, 2, 5, 851 Solve -2g2/19 + 8368508g/19 - 8753990768258/19 = 0 for g. 2092127 Factor -h*2 + 1625224h + 1625225. -(h - 1625225)(h + 1) Let 3n*2 - 80359692n + 538140008194572 = 0. What is n? 13393282 Find z, given that -63z5 - 546222z*4 - 1184014215z*3 - 225506700z*2 = 0. -4335, -4/21, 0 Let 3z*2 - 55582899z + 55582896 = 0. Calculate z. 1, 18527632 Solve -2d4/9 - 374690d*3/9 + 2623058d*2/3 - 37098710d/9 - 45342572/9 = 0 for d. -187366, -1, 11 Factor c*3 + 165762c*2 + 3646257c - 3812020. (c - 1)(c + 23)(c + 165740) Suppose 3s4/5 - 43104s*3/5 + 1376343s*2/5 - 1247046s/5 - 2666496/5 = 0. What is s? -1, 2, 31, 14336 Factor 2z2/3 - 2260724z/3. 2z(z - 1130362)/3 Factor -3l2 - 4252737l + 93561666. -3(l - 22)(l + 1417601) Factor -4r2 - 2448r - 108288. -4(r + 48)(r + 564) Factor 3y3 - 76437633y*2 + 305750496y - 305750484. 3(y - 25479207)(y - 2)*2 Suppose -42g*2/13 + 189880g/13 - 379592/13 = 0. Calculate g. 2, 94898/21 Factor 3m5 + 3633m*4 + 735534m*3. 3m*3(m + 257)(m + 954) Solve 2g*5/15 + 1096g*4/5 + 1281868g*3/15 + 5071712g*2/15 - 85458g - 1015000/3 = 0 for g. -1015, -625, -4, -1, 1 Factor 3n2 + 1605324n + 27289641. 3(n + 17)(n + 535091) Find c, given that -2c4/3 - 39264c*3 - 14125232c*2 + 170916352c/3 - 57129184 = 0. -58534, -366, 2 Factor g*3/11 + 439g*2/11 + 21350g/11 + 19600. (g + 14)(g + 40)(g + 385)/11 Factor 2j3/17 - 96j*2 - 21482j/17 - 59688/17. 2(j - 829)(j + 4)(j + 9)/17 Factor 5f*2/2 - 2510745f/2 + 3766095. 5(f - 502146)(f - 3)/2 Find k such that -4k4 + 43672k*3 - 15876960k*2 + 1953490048k - 80429026816 = 0. 124, 10546 Determine a so that -60a3 + 944944a*2 - 3720055500a - 3472875000 = 0. -14/15, 7875 Solve -3z2/4 - 33543z/4 + 837540 = 0. -11280, 99 Suppose 2m4 + 24386m*3 - 244106m*2 - 561362m - 292872 = 0. Calculate m. -12203, -1, 12 Solve -4g2/9 + 8409776g/3 + 25229332/9 = 0 for g. -1, 6307333 Factor -h*2/2 + 377h/2 - 2888. -(h - 361)(h - 16)/2 Suppose b2/9 + 1616377b/9 - 14008826/3 = 0. Calculate b. -1616403, 26 Factor r*2/3 + 53584r/3 - 679212. (r - 38)(r + 53622)/3 Suppose 2x*3 - 21340x*2 + 24096450x + 195738516000 = 0. Calculate x. -2320, 6495 Find z such that z*4/3 + 309362z*3/3 + 4021523z*2/3 - 4330886z/3 = 0. -309349, -14, 0, 1 Suppose -k*4/2 - 711k*3 - 643617k*2/2 - 45251136k - 132876288 = 0. Calculate k. -576, -267, -3 Solve 3b4/2 + 13359b*3/4 + 1806522b*2 - 61324848b - 2832326784 = 0 for b. -1128, -53/2, 56 Let -2s2 - 1565486s - 32874324 = 0. What is s? -782722, -21 Factor -2a2/3 - 385064a/3 + 3851240. -2(a - 30)(a + 192562)/3 Factor 3p3 + 22494p*2 + 3672327p - 3694824. 3(p - 1)(p + 168)(p + 7331) Suppose 4i*3 + 6426352i*2 + 494805692i + 488379344 = 0. What is i? -1606511, -76, -1 What is v in -v*3/2 - 17680v*2 + 353822v + 778360 = 0? -35380, -2, 22 Factor 2j3/9 + 9230j*2/9 - 4190500j. 2j(j - 2610)(j + 7225)/9 Determine n, given that -4n*3/7 - 9096268n*2/7 - 5171367076060n/7 + 15514183094700/7 = 0. -1137035, 3 Suppose -7h2/3 + 7084610h/3 + 2024176 = 0. What is h? -6/7, 1012088 Factor w*2/9 - 563673988w/9 + 79432091186956036/9. (w - 281836994)*2/9 Determine x, given that -2x*4/21 + 9350x*3/21 - 203372x*2/7 + 7970752x/21 - 29497600/21 = 0. 8, 50, 4609 Suppose k*2/2 - 219433k/2 - 7023904 = 0. What is k? -64, 219497 Suppose 5n3/4 - 57565n*2/4 + 574555n/4 + 6844285/4 = 0. Calculate n. -7, 17, 11503 Factor z*2 + 36726z + 3626073. (z + 99)(z + 36627) Let 8q*5 + 14610q*4 - 667108q*3 - 23567226q*2 + 18205796q + 6013920 = 0. What is q? -1870, -24, -1/4, 1, 67 Determine o, given that o*3/2 - 4556294o*2 + 18225170o - 18225168 = 0. 2, 9112584 Find m, given that m*3/2 - 6659m*2/2 + 6665975m/2 - 1821413125/2 = 0. 575, 5509 Factor 2d3 - 147668d*2 - 147670d. 2d(d - 73835)(d + 1) Let -2i*5/13 + 9494i*4/13 - 12039164i*3/13 + 1829351124i*2/13 - 66785846274i/13 - 68627246058/13 = 0. What is i? -1, 59, 111, 2289 Let 25j4 + 336655j*3 + 1135752430j*2 + 16060813620j + 3166735320 = 0. Calculate j. -6726, -14, -1/5 Solve -5u3/2 + 12845005u*2/2 - 4124882737360u + 37123424415360 = 0 for u. 9, 1284496 Solve s*3/5 + 161248s*2/5 + 2579776s/5 + 10318848/5 = 0 for s. -161232, -8 Find v, given that -v*2/7 + 13128v/7 - 4621292/7 = 0. 362, 12766 Solve -3f2/4 + 475869f/2 + 13326684 = 0. -56, 317302 Factor 3s2 + 288453s - 298521600. 3(s - 1024)(s + 97175) Solve -3n3/4 - 12071919n*2/4 - 12144238848693n/4 + 60721496041815/4 = 0 for n. -2011989, 5 Let -3t4/4 + 1782t*3 + 366963t*2/2 + 710730t + 2116125/4 = 0. What is t? -95, -3, -1, 2475 Factor 2060524449o3 + 30908048307o*2 + 2723584o + 60. (o + 15)(45393o + 2)*2 Determine f, given that 2f*3/13 - 724640f*2/13 + 25360082f/13 - 47821620/13 = 0. 2, 33, 362285 Determine r so that -3r5 + 27628902r*4 - 63612991181556r*3 - 127226092878744r*2 = 0. -2, 0, 4604818 Determine i so that -3i*2/7 + 4061595i/7 + 6962796 = 0. -12, 1353877 Determine j so that -j*5/2 + 7347j*4 + 191339j*3/2 - 1088238j*2 - 1176560j = 0. -20, -1, 0, 8, 14707 Determine y so that -y*2 - 5224883y + 10449770 = 0. -5224885, 2 Determine c, given that -c*4/2 - 1066c*3 + 191262c*2 + 997935840c = 0. -1506, 0, 880 Let 4y2/3 - 145133408y/3 = 0. What is y? 0, 36283352 Let -2v3/9 - 1655534v*2/9 - 342596619830v/9 + 342601586450/3 = 0. Calculate v. -413885, 3 Find c such that 5c5 + 3575c*4 + 508235c*3 - 1034395c*2 - 508240c + 1030820 = 0. -518, -199, -1, 1, 2 Factor s*3/3 + 435455s*2 + 142215575041s - 426648031489/3. (s - 1)(s + 653183)2/3 Find u, given that -5u*3 + 15727600u*2 + 47182845u = 0. -3, 0, 3145523 Factor z*2/3 + 9373z/3 + 4777292. (z + 1924)(z + 7449)/3 Factor 3v*3/7 - 267v*2/7 - 9435v/7 + 53475/7. 3(v - 115)(v - 5)(v + 31)/7 Let -4a*2/5 + 41073004a/5 - 8214600 = 0. What is a? 1, 10268250 Factor 2g2 - 12101856g + 18306864830592. 2(g - 3025464)2 Suppose 162t*3 + 190t*2 - 6776t - 1176 = 0. What is t? -7, -14/81, 6 Suppose 2k4/5 + 85122k*3/5 + 1682802k*2 + 277518582k/5 + 3051913788/5 = 0. Calculate k. -42462, -33 Factor 2q2/3 - 109651892q/3 + 1502942177397458/3. 2(q - 27412973)2/3 Find m such that 2m*2 - 4373218m = 0. 0, 2186609 Determine s so that s*2/6 - 7433s/2 - 33462 = 0. -9, 22308 Determine u, given that -2u2/3 - 48520u/3 + 533962/3 = 0. -24271, 11 Find k, given that 4k2 - 19520k + 10360176 = 0. 606, 4274 Determine g, given that 200g5/17 + 404480g*4/17 - 3489142g*3/17 + 8483454g*2/17 - 4191696g/17 + 584928/17 = 0. -2031, 3/10, 4 Find o such that 22o4/3 - 74452o*3/3 + 19756992o*2 + 2127839040o - 387532800 = 0. -96, 2/11, 1740 Factor -l*3 + 742l*2 - 9760l - 55725696. -(l - 488)*2(l + 234) Factor -b*2/2 - 1757901b/10 - 35158. -(b + 351580)(5b + 1)/10 Factor 98j3 + 1713978j*2 - 12736464j + 23655944. 2(j + 17497)(7j - 26)2 Let -26c*5/7 - 50884c*4/7 + 87042c*3 - 2156528c*2/7 + 2944952c/7 - 189024 = 0. What is c? -1969, 12/13, 2, 7 Determine z so that 4z5 + 3242z*4 - 258204z*3 + 1649000z*2 + 135568624z + 67339584 = 0. -884, -18, -1/2, 46 What is b in 174824b4/3 - 16673388b*3 + 11724149b*2/6 + 88228b + 858 = 0? -3/164, 2/13, 286 Factor 3r2/5 + 747141r/5 - 4482954/5. 3(r - 6)(r + 249053)/5 Solve -3v5/4 + 3189513v*4/4 + 75v*3/2 - 79737825v**2/2 - 1875	{ "pile_set_name": "DM Mathematics" }
648493935. Round m to the nearest one million. -36000000 Let u = 0.08455 - 27.08205. Let l = 14 + -41. Let n = u - l. Round n to three decimal places. 0.003 Let i = 176 + -261. Let k = 84.99837 + i. What is k rounded to 4 dps? -0.0016 Let u = 159 - 158.9999961. What is u rounded to six decimal places? 0.000004 Let t(i) = i*2 + i - 6. Let g be t(-3). Suppose -10a + 3a + 12257 = g. Suppose -21751 + a = -5d. What is d rounded to the nearest ten thousand? 0 Let g(r) = 360001r - 5. Let q(o) = 3o*2 - 19o - 6. Let p be q(8). Let x = p + -29. Let c be g(x). Round c to the nearest 1000000. 2000000 Let b = 7.61 - -1.69. Let v = 5.4 - b. Round v to the nearest integer. -4 Suppose 2i + 382 = -4a, i + 2i = -4a - 381. Let b = a + 16. What is b rounded to the nearest 100? -100 Let v(j) = -662j2 + 6j - 20. Let s be v(-7). What is s rounded to the nearest 10000? -30000 Let f = 19777 - -48223. What is f rounded to the nearest ten thousand? 70000 Let i = 806.01025 - 806. What is i rounded to three decimal places? 0.01 Let k = -433 - -441.06. Let i = -8 - 0. Let v = i + k. Round v to one dp. 0.1 Let u(t) = 26915t - 395. Let m be u(5). Round m to the nearest one thousand. 134000 Let u = 25.5168 + -25.99. What is u rounded to one dp? -0.5 Let h = -2.9 + -0.7. Let d = -10.9521065 + 14.55211. Let x = d + h. Round x to 6 dps. 0.000004 Let p = -11.52 - -4.29. Round p to one dp. -7.2 Suppose 5t + 49 - 244 = 0. Let a be (-27)/(-4)(-104)/t. Let x be (a/15)/(6/140). Round x to the nearest 10. -30 Let s = -14 + 14.297. What is s rounded to 2 decimal places? 0.3 Let x be (-6 - 2 - -3)(0 - -4300). What is x rounded to the nearest 10000? -20000 Let s = -30 + 10. Let r = s - -21.48. Round r to one dp. 1.5 Suppose -l - 2541292 = 12l. Suppose 3m + 18775 + 24677 = 0. Let j = l - m. Round j to the nearest ten thousand. -180000 Suppose 276 = -4p - 48. Round p to the nearest ten. -80 Let r = 73.9985 - 74. What is r rounded to 4 dps? -0.0015 Let o(v) = 646112v*2 + 5v - 2. Let c be o(-6). What is c rounded to the nearest one million? 23000000 Let h = 3.61 - 62239.61. Let k = 62234.94228 + h. Let n = k + 1.06. What is n rounded to 4 decimal places? 0.0023 Let s(i) = -3i3 + i2 - i - 2. Let u be s(2). Let k = u + 26. Suppose -16608 = -r - kl, -5l + 49820 = -r + 4r. Round r to the nearest 1000. 17000 Let l = -0.0766982527587 - 7475663.9222417472413. Let p = 7475560 + l. Let x = p - -104. What is x rounded to 4 decimal places? 0.0011 Let t(h) = -h*3 - h - 5. Let k be t(0). Let u(p) = 170001p. Let f be u(k). Let z be f/(-10) + 2/(-4). Round z to the nearest 10000. 90000 Let w = -23.9108 - -24. Round w to three decimal places. 0.089 Let l be (66981/2)/((-14)/(-28)). Let w = 83019 + l. What is w rounded to the nearest 100000? 200000 Let r = 205 - 275. What is r rounded to the nearest 100? -100 Let h(i) = 13i3 + i2 - i - 8. Let m be h(-4). Let x = 180 + m. Round x to the nearest 100. -600 Let l = -533 + 377. Let b be 2/7 + l/(-91). Suppose -3q - bs = -6s + 23699992, 0 = -5s - 10. Round q to the nearest 1000000. -8000000 Let k = -388026 - -388033.000036. Let a = -24 - -17. Let f = a + k. Round f to five decimal places. 0.00004 Let m(c) = -72c*2 - 14c + 16. Let y be m(6). Let l be (y/21)/((-3)/((-126)/(-4))). What is l rounded to the nearest 100? 1300 Let f = 20 - 54.3. Let r = f - -4.3. Let j = r - -16.4. What is j rounded to 0 dps? -14 Let p = 104.18 - 2.48. What is p rounded to the nearest integer? 102 Suppose -4j = -t + 5t + 23192, 28950 = -5j + 5t. Let x = j - -3427. Let f = 487 + x. Round f to the nearest 100. -1900 Let j = -28.3 - -2.3. Let f = j - -22.4. Let m = f - -3.600121. What is m rounded to 5 decimal places? 0.00012 Let o = -2016 + 2015.9997481. Round o to five dps. -0.00025 Let o = 112 + -86. Let d = -1643284.99981 + 1643311. Let y = o - d. What is y rounded to four decimal places? -0.0002 Suppose 4x = 2 - 18. Let s = x - -2. Let g be 1604(s - 3). Round g to the nearest one thousand. -3000 Let r = -0.01009252951 + -80.98990821049. Let d = r + 81. What is d rounded to seven dps? -0.0000007 Let m(f) = -6f*3 - 9f*2 + f - 10. Let t(y) = 8y*2 - y - 2. Let s be t(-1). Let x be m(s). Let n = x - -892. Round n to the nearest one hundred. -1600 Let h = 61330.5 + 5398.5. Let i = 66846.134 - h. Let a = -117 + i. What is a rounded to two decimal places? 0.13 Suppose -5p - 4d - 35620 = 0, -4p + 7p = -2d - 21370. What is p rounded to the nearest one thousand? -7000 Let j = 64 - 64.2390099. Let f = j + 0.239. What is f rounded to 6 decimal places? -0.00001 Suppose -16o - 10876935 = 44483065. What is o rounded to the nearest one hundred thousand? -3500000 Let a = -12750 + 12739.018. What is a rounded to 1 decimal place? -11 Let p = 11 + -12.1. Let c = 1.08 - 0.69. Let i = p + c. Round i to 1 dp. -0.7 Let t = 10 - 9.1. Let h = t - 5.5. Let x = h + 7. Round x to zero decimal places. 2 Let w = -5345.991348 + 5346. What is w rounded to 3 decimal places? 0.009 Let d = -2589 - -2592.094. Round d to 1 dp. 3.1 Let q(m) = -1954m*3 + 20m*2 + 19m - 35. Let c be q(15). Round c to the nearest one million. -7000000 Let h = 106793582964186 + -106793648281259.9999915. Let t = -65317038 - h. Let u = -36 + t. What is u rounded to six dps? -0.000009 Let k = -14772588028.08403298381 - -14772588028. Let o = -45.91596734619 + k. Let v = o + 46. Round v to 7 dps. -0.0000003 Let s = 2.9 - 0.7. Let n = 46.2 - s. Let d = n + -43.921. What is d rounded to two decimal places? 0.08 Let g = 0.56 - -32.44. Let n = 405 + -367.4. Let o = g - n. What is o rounded to 0 dps? -5 Let q be (-1100004)/(-20) + -2(-4)/(-40). Let k be (q/(-6))/((-19)/(-4560)). What is k rounded to the nearest one million? -2000000 Let d = 2064.413 - 2063. What is d rounded to 1 decimal place? 1.4 Suppose 2s = -2i + 8, -3i + i = 5s - 14. Let u be 36/21 + (-6)/(-21). Let r be 7400 - (0 + (i - u)). What is r rounded to the nearest 1000? 7000 Let l = 60.52 + -52.1. Round l to the nearest integer. 8 Let d = 94.1031 + -80085.5031. Let j = d - -79987.299865. Let a = -4.1 - j. What is a rounded to five dps? 0.00014 Suppose 4r = 4u + 644400, -4r - 2u + 387623 = -256777. Round r to the nearest ten thousand. 160000 Let n = -0.2 + 0.4. Let y = n - 0.1999974. Round y to 6 dps. 0.000003 Let h be (1017/21)/(20/140). Round h to the nearest ten. 340 Let x = 231.403 - 212.69. Round x to 1 decimal place. 18.7 Suppose 8u + 372 = -124. Let j be (-2920000 - 0)/(u/(-155)). Round j to the nearest 1000000. -7000000 Suppose -4r - 2 = -5m - 17, 5m = r - 15. Let a be (-28498)/5 - (34/10 + m). Round a to the nearest one thousand. -6000 Let n = 1.0925835 + -2.8925831. Let c = 1.67 + 0.13. Let g = n + c. Round g to six decimal places. 0 Let q = -5220 - -5634.76. Let u = q - 423. Let z = 9.7 + u. Round z to one decimal place. 1.5 Let d = 7.92 - 8.1. Let m = d + 5. What is m rounded to the nearest integer? 5 Suppose 3209250 = 12k - 27k. What is k rounded to the nearest one thousand? -214000 Let q = 109225 - 109173.9955. Let u = q - 51. What is u rounded to three decimal places? 0.005 Suppose -5v - 256 = q - 32, -4q = 2v + 860. Let h = q - -52. What is h rounded to the nearest ten? -160 Let d = -356 + 358.39. Round d to 1 decimal place. 2.4 Suppose c = 6c - 8970. Suppose -8y + 6y = -c. Let i = -207 + y. What is i rounded to the nearest 100? 700 Let n = -270255.0015 + 270168. Let u = n + 87. What is u rounded to three decimal places? -0.002 Let c be 6-5(-1)/15. Suppose 2t = p - ct - 38, -p = 2t - 8. Suppose 7j + 3o + p = 4j, -2o = -j + 6. Round j to the nearest integer. -2 Let j = 3908.7 - 3669. What is j rounded to the nearest 10? 240 Suppose -3t + 10919991 = 4d, d - 2t = 149487 + 2580519. What is d rounded to the nearest 100000? 2700000 Let p = 14216 + -1616. Round p to the nearest 1000. 13000 Let l = -536.8995 + -0.1005. Let c = l + 536.96994. Let m = c - -0.03. Round m to 5 decimal places. -0.00006 Let t(z) = -1. Let o(c) = 265c + 4. Let j(i) = o(i) + 4t(i). Let u be j(-1). Round u to the nearest one hundred. -300 Let n(d) = 2d*3 + 9d*2 - 7d - 8. Let v(q) = -8 - q*3 + 7q*2 + 0q*3 - 12q*2 - 3q. Let w be v(-5). Let p be n(w). Round p to the nearest 100. 1100 Let a	{ "pile_set_name": "DM Mathematics" }
4797218861912 Subtract 441 from -0.258963551. -441.258963551 What is -0.1 - 11669943381154? -11669943381154.1 Add together -0.19 and 539.7797766234. 539.5897766234 Add together -976454 and -602616. -1579070 Sum 79085014006.5 and 0. 79085014006.5 Add -141993987 and 2750. -141991237 Add 6 and 0.223064871036. 6.223064871036 What is 60.406 plus 40553.9995? 40614.4055 What is 4233550 + 10.166783? 4233560.166783 Subtract 2509 from -6537062. -6539571 What is 8308.2 less than 151797130? 151788821.8 What is -1196342 - -4061.582? -1192280.418 210 + -59244140906 -59244140696 What is 68.96 - 9271921? -9271852.04 Work out 1621796482416.7 + -15. 1621796482401.7 What is -4001923.0101 minus 0.01? -4001923.0201 0.06136329 - 6.0257 -5.96433671 What is the distance between 35 and 94817690079? 94817690044 Sum 217665402 and 325. 217665727 1.986 + -1.17936793011 0.80663206989 What is 124022.119 plus -1.08? 124021.039 Total of -9 and 1463011766750. 1463011766741 Add together -0.6 and -21186376192409. -21186376192409.6 What is 0.8871 less than -383.2340876? -384.1211876 Subtract 1519.13 from -776209. -777728.13 What is -313955647.71 less than 25? 313955672.71 -3+107707008759 107707008756 Calculate 0.01966 - 0.21207234. -0.19241234 What is the distance between 2642 and 3577256? 3574614 What is 206625375 less than 31188? -206594187 What is 1342304480285239 - 0.4? 1342304480285238.6 Add -12667832.6 and -188124. -12855956.6 What is 22562180403917 less than -0.5? -22562180403917.5 Total of -712463792.66 and -77. -712463869.66 What is the difference between -227.41 and 0.230073? 227.640073 What is -2 take away 20915.53215393? -20917.53215393 Total of 1717.5820776738 and 2. 1719.5820776738 Sum -4 and 1380556931860. 1380556931856 16.945 + 12540.704095 12557.649095 Add -466224804134566 and -0.2. -466224804134566.2 Calculate 229.31982 - -5287255. 5287484.31982 -3.47+1293347918224 1293347918220.53 Work out -4 - -290973996.45816. 290973992.45816 Work out -27460.751 - 0.44334. -27461.19434 Calculate 20991486235 - 220. 20991486015 What is -4 + 32929954.727? 32929950.727 Total of -6551001481 and 134. -6551001347 What is -187956424.42975 - -2.3? -187956422.12975 What is -5786.9233835 - 1.1? -5788.0233835 What is 8457 + 803544407? 803552864 Work out 1.3 + -3092074573493. -3092074573491.7 What is -51072241 take away 0.2997? -51072241.2997 Add 17850.6220062 and -1.2. 17849.4220062 Add -23.56 and -53363711. -53363734.56 Calculate 3278 + 255055425405. 255055428683 1976105958+-171.711 1976105786.289 What is the distance between 27 and -122427197272? 122427197299 What is the distance between -0.062 and 8689444635.7? 8689444635.762 Work out 4591332725 + -0.332. 4591332724.668 Add -0.1 and -12646181752652. -12646181752652.1 Calculate -11317314 - -18.6894. -11317295.3106 What is 2350093 plus 0.002562609? 2350093.002562609 Put together -254018.830526 and -22. -254040.830526 What is -3053 - 32540454? -32543507 What is -2430 less than -45185117295? -45185114865 Subtract 291.789991047 from 33. -258.789991047 What is 826460 plus -0.13924873? 826459.86075127 What is the distance between 14618635 and -18.07? 14618653.07 Work out -160.228 + -325594684.5. -325594844.728 What is the distance between 28458346805.803 and 0.3? 28458346805.503 Add -12 and -943429864617. -943429864629 -252.44051+-109.8091 -362.24961 Subtract -2165142 from -0.30923. 2165141.69077 Add together 11173135706086 and 4. 11173135706090 Work out 97779469.292226 + -5. 97779464.292226 What is 6365711.59 minus -6.1? 6365717.69 Total of 0 and 237.2406071. 237.2406071 -1606435924 - -1.7916 -1606435922.2084 What is -12180 plus 268.6123456? -11911.3876544 -301.3552+-1525.1 -1826.4552 Sum 149106 and -2.40146143. 149103.59853857 Calculate -4.83 - 4217145282. -4217145286.83 What is 1 take away -818966054323? 818966054324 What is the distance between 0.163445 and 20608.08? 20607.916555 What is 7530.18 + 263933? 271463.18 -66213+2432144 2365931 Total of 105673752712 and 2.089. 105673752714.089 Add -106.869 and -0.0452515. -106.9142515 What is -463302837121 plus 147? -463302836974 3756637 - 234079 3522558 What is -240632205993841 plus -0.2? -240632205993841.2 Work out -340389993827 - 0.0034. -340389993827.0034 Calculate -5027611269 - -1.4. -5027611267.6 What is 5.721 take away 995432730? -995432724.279 What is 0.2591 less than 36.545143979? 36.286043979 What is 25.5742 + -289014? -288988.4258 What is 464.707 plus -0.1183377? 464.5886623 What is the difference between -9403743989258 and 0.1? 9403743989258.1 -0.09844799152 + -3673.7 -3673.79844799152 Calculate 25555.036245 - -27. 25582.036245 What is -2.9 minus 49535300597? -49535300599.9 What is -1294.203035127 plus -3? -1297.203035127 Work out 9.3907576 - 26297.74. -26288.3492424 Add together 74 and -108359668. -108359594 Add together -10651964099 and -0.08. -10651964099.08 Sum -110489283960 and 5. -110489283955 Total of 121126.6 and 7086633. 7207759.6 What is -0.1 less than 92274371456776? 92274371456776.1 What is 54.8 minus 0.082765961541? 54.717234038459 Calculate 0.036085983 - -3307. 3307.036085983 What is the difference between -0.03002991 and 904.57? 904.60002991 Calculate 0.09 - 4189630072. -4189630071.91 175043240 - 0.05527 175043239.94473 210598600661 - 3 210598600658 Subtract 1159.07189 from -54315.4. -55474.47189 What is -198169.03827 minus -87? -198082.03827 Calculate -13268.3591211 + 15. -13253.3591211 Subtract 2908521 from -57.509. -2908578.509 What is the distance between 105.044 and -6346591209? 6346591314.044 What is 84.521984506 take away 0.29? 84.231984506 337+16682385664 16682386001 What is the difference between -5349987990155 and 0.3? 5349987990155.3 Put together 2692419570854 and -0.1. 2692419570853.9 Subtract 139 from 105.58954406543. -33.41045593457 Calculate 24973 + -2405896256. -2405871283 -2893058026.599 - -0.9 -2893058025.699 Add -108776241566 and 2. -108776241564 Total of 16.05486777139 and -0.01. 16.04486777139 Sum -5674313573700 and 0.5. -5674313573699.5 -1439.15+-10778693.5 -10780132.65 Calculate -0.3361764626 + -1.157. -1.4931764626 Put together 106419 and 509589. 616008 Total of 180064266 and 21428.6. 180085694.6 -239552380894884 - -0.1 -239552380894883.9 Calculate 15839 + -0.056354512. 15838.943645488 Work out 5592397158360 - -5. 5592397158365 What is 2.12350557715263 take away 3? -0.87649442284737 Total of 5562800163.75 and 5. 5562800168.75 Put together -1.6373 and 152353860.48. 152353858.8427 What is 1.76 less than -60176250? -60176251.76 What is 1276107 + 755.124? 1276862.124 Add together -9 and -6937122141. -6937122150 Calculate 6912547 + 0.0599746. 6912547.0599746 Work out -28 - -7945774294137. 7945774294109 Work out -0.0633 + 6.70939952263. 6.64609952263 Work out 3 + 24.7272664192907. 27.7272664192907 0.038415483923 + 233 233.038415483923 Add -4690 and -865014168. -865018858 Subtract 0.5 from -36520935773729. -36520935773729.5 What is the difference between 180630 and -737062? 917692 Work out 14022781585904 + -7. 14022781585897 Sum -3400605104 and -26558. -3400631662 Total of 0.07 and 3893063510817. 3893063510817.07 What is the difference between 14490757 and 45.122? 14490711.878 -650943+9996476 9345533 Subtract -286488569 from 27.84837. 286488596.84837 Work out -0.1 - 16541081241263. -16541081241263.1 What is the difference between 1.5204007 and -94.88? 96.4004007 Work out 12763698371 + 14.19. 12763698385.19 Calculate -107 - -153881447. 153881340 Work out -177778.96 - 196.4654. -177975.4254 What is -105365 take away 29690.51? -135055.51 Work out -0.011 - -3195567540538. 3195567540537.989 Calculate -0.9974 - 49.461802. -50.459202 Add together -0.40065 and -5076925. -5076925.40065 0.3081526 - -0.02981 0.3379626 33323 - -0.1020683922 33323.1020683922 What is -3506 plus 0.127041717? -3505.872958283 What is -1787.5581879012 take away -1.3? -1786.2581879012 -0.1 + 0.0470083265847 -0.0529916734153 What is 243.96 less than -2231395.475? -2231639.435 148817+9.95302372 148826.95302372 Calculate -770989904 - -45907. -770943997 Add together 59848388 and 31.984. 59848419.984 Subtract -19565 from 696.148903. 20261.148903 -2701 + 22539.171 19838.171 What is -0.005078 + -178842916? -178842916.005078 Put together -5497828938 and 14187. -5497814751 Calculate 254270.	{ "pile_set_name": "DM Mathematics" }
-3273 + 8097 = -134y for y. -36 Solve -36878u = -442307 + 4277619 for u. -104 Solve 0 = 634s - 29183 + 34889 for s. -9 Solve 83n - 183n = 377n - 15741 for n. 33 Solve 284y + 394y - 45y - 24054 = 0 for y. 38 Solve 0 = -45133q + 48785q + 423632 for q. -116 Solve 4834z + 33441 = 141805 - 64588 + 168920 for z. 44 Solve 144w + 6w = -238w + 32w + 32396 for w. 91 Solve 10580 = 15504m - 15389m for m. 92 Solve 387714 = 1549i + 4986i - 1156i + 1423i for i. 57 Solve 346h + 1864h + 10193 + 27377 = 0 for h. -17 Solve -4532r - 37796 = 225060 for r. -58 Solve -706 - 372 = 17x - 1639 for x. 33 Solve -10517 = -791y + 17168 for y. 35 Solve -281u - 86u = -103u - 15048 for u. 57 Solve 0w + 323 = 6w + 2w - 25w for w. -19 Solve -745z + 12026 = -8089 for z. 27 Solve 2164b + 118456 = -1320b for b. -34 Solve -30785 = -1930l + 85388 + 32437 for l. 77 Solve -2261 = 1242b - 51941 for b. 40 Solve -1854r + 52315 = 57113 + 78222 + 63446 for r. -79 Solve 86n - 312n + 864 = -97n - 4167 for n. 39 Solve 311t = -17651 + 5522 for t. -39 Solve -2247p - 38807 - 76153 = -12643 - 3449 for p. -44 Solve 152o - 56o - 79 + 3631 = 0 for o. -37 Solve 1575k = 1303k - 12512 for k. -46 Solve -18208z - 176 = -18197z for z. -16 Solve 265l + 16321l = 2487900 for l. 150 Solve 15l + 154l = -239l + 148l + 24440 for l. 94 Solve -479h + 16062 = -5014 for h. 44 Solve -4317z + 2697z = 4173z + 431z - 267632 for z. 43 Solve 70754w = 70818w - 1408 for w. 22 Solve 85m + 1555 = -7m - 1941 for m. -38 Solve 1942f = -16396 - 98182 for f. -59 Solve 335767 = 48w + 336823 for w. -22 Solve 15x - 1760 = -16x - 5x - 44x for x. 22 Solve -169t + 266 = -342t + 306t for t. 2 Solve -1759p - 485598 = -464490 for p. -12 Solve -716i + 5270 = 604i - 1382i for i. -85 Solve -19780 = -1564d + 204d + 3340 for d. 17 Solve -513u - 22091 + 4969 - 5918 = 3123 for u. -51 Solve 1930s - 27066 + 27982 = -6269 - 239855 for s. -128 Solve -4626 = 521z + 5794 for z. -20 Solve 1909w + 691218 = -1800w - 3273w for w. -99 Solve -108y + 359y = 4396 - 11675 for y. -29 Solve 60s = -561s - 247s - 65100 for s. -75 Solve 18557 + 6406 = 447j + 53j - 29j for j. 53 Solve -1180 - 959 = 793w + 2326 - 1293 for w. -4 Solve 6407l = -7181l + 1195744 for l. 88 Solve 317l + 82137 = 68506 for l. -43 Solve -433b - 16016 - 137540 = 7427b + 569564 for b. -92 Solve -6933i = 741i + 2936i + 509280 for i. -48 Solve -890c + 2032 - 12738 = -231c + 7087 for c. -27 Solve 229265 = 11512b - 81709 - 356722 for b. 58 Solve 131h - 233 = -341h + 115h + 124 for h. 1 Solve 409d + 371d = 1475d - 433d - 30130 for d. 115 Solve -452z = -1026z - 17220 for z. -30 Solve 63970 = -39d + 60889 for d. -79 Solve -28501m + 2639 = -28410m for m. 29 Solve 10101 + 4460 + 1481 = -124b + 1038 for b. -121 Solve 7376o = 6164o - 48480 for o. -40 Solve 1579v = -114007 - 29885 + 19151 for v. -79 Solve 5989s + 205216 = 1325s for s. -44 Solve 0 = 714h - 1019h - 2798h + 98961 + 15850 for h. 37 Solve 5870389u = 5870422u + 198 for u. -6 Solve 85v + 7800v + 616v + 222700 + 176847 = 0 for v. -47 Solve 15m + 25 = 462 + 28 for m. 31 Solve -8466 - 48319 - 60521 = -2394i for i. 49 Solve -5476w - 2325214 = -31602w for w. 89 Solve 8395q - 7351q + 105761 - 22241 = 0 for q. -80 Solve -53581 + 2031 = -1085s + 49355 for s. 93 Solve 1143m = 4101m + 56202 for m. -19 Solve 0 = -1967t + 15568t + 598243 + 201 for t. -44 Solve 88 + 44 = 12m - 132 for m. 22 Solve -72j - 47j - 136j = -9435 for j. 37 Solve -691521 = -7015v + 126521 - 153301 + 184074 for v. 121 Solve 87y + 2y + 76y - 484 = 286y for y. -4 Solve 3370x - 55110 = -2141x for x. 10 Solve 0 = -23114h + 23384h - 4590 for h. 17 Solve -438m - 870m + 67m + 4043 = -49320 for m. 43 Solve 108d - 204249701 + 204247217 = 0 for d. 23 Solve 32160 = 3674j - 3004j for j. 48 Solve -1585w - 520798 + 2792 = 3446w + 6230w for w. -46 Solve 3489h - 3544 - 475 = 6995 + 6431 for h. 5 Solve 3073 - 1211 = 98b for b. 19 Solve 1297f = -95664 + 46378 for f. -38 Solve 341d - 62745 = 1547d + 15645 for d. -65 Solve -11995x + 462444 - 17226 = -206825 - 247582 for x. 75 Solve -918 = -166u - 16854 for u. -96 Solve 263c = 41c - 26c - 7688 for c. -31 Solve -99678 = 61s - 95835 for s. -63 Solve -310041 = -7274n + 177317 for n. 67 Solve 16r - 52 - 38 = -170 for r. -5 Solve 178 = -23v - 362 + 149 for v. -17 Solve 742a + 14413 = -536a + 1481a for a. 71 Solve 0 = -514n - 370349 + 360583 for n. -19 Solve 0 = -2124779i + 2124907i - 9472 for i. 74 Solve -38506y - 19242 + 1127747 = -8543y - 1168683 for y. 76 Solve -363s - 23 - 10533 = 1786 for s. -34 Solve -243k + 421k - 308 = 189k for k. -28 Solve 15449 - 14081 = -684w for w. -2 Solve -1393 + 508338 = -6209z - 60416 + 2342 for z. -91 Solve 1091t - 1150 = 1045t for t. 25 Solve 24036 = -1771c + 98418 for c. 42 Solve -1807x + 25992 = -439x for x. 19 Solve 101356 + 10708 = 3296h for h. 34 Solve -213h + 1863h - 206151 = -4597h for h. 33 Solve 14x + 184x - 1672x - 10318 = 0 for x. -7 Solve 337v + 2757 = 10119 + 4030 + 2425 for v. 41 Solve 25320l - 25217l - 4532 = 0 for l. 44 Solve -51n - 176n - 1114 - 4650 = 7402 for n. -58 Solve 13903t + 2643396 = 849909 for t. -129 Solve -20365o - 47056 = -18981o for o. -34 Solve 10122x + 4518 = 9620x for x. -9 Solve 121j = 517j - 184j - 9328 for j. 44 Solve 0 = 39365a - 39701a + 15456 for a. 46 Solve 0 = 1850v - 1332 + 689 - 121 - 1086 for v. 1 Solve -5453 = -222y + 2353 - 9804 for y. -9 Solve -142l = -96l - 46 for l. 1 Solve -2184n - 1836 - 3399 + 1257 = -1878n for n. -13 Solve 576f + 10435 + 11534 = 4113 for f. -31 Solve 857u + 2078u + 850u - 19544 + 61179 = 0 for u. -11 Solve -18855 - 24240 = -283265d + 283928d for d. -65 Solve -72447 = -28o + 200o - 951o for o. 93 Solve 902r + 2646r = 329r - 93351 for r. -29 Solve 177w - 14697 = -70w + 34w for w. 69 Solve 151h + 210963 = 210057 for h. -6 Solve 8310u + 117052 = -6191u + 3401u - 1248248 for u. -123 Solve 408u + 69u = -1208u + 139855 for u. 83 Solve 0x = -40x + x + 858 for x. 22 Solve 303 = 168f + 59 - 92 for f. 2 Solve -103845n = -103919n + 3108 for n. 42 Solve 625c + 20158 = 12033 for c. -13 Solve 7880c + 259459 - 231527 = -302291 - 197737 for c. -67 Solve 19l + 159609 = 161319 for l. 90 Solve -610j - 1218 + 2675 = -12015 - 26788 for j. 66 Solve 0 = -3349o + 1392o - 1389o - 755o - 20505 for o. -5 Solve -204c - 160c - 87 + 2 = 1735 for c. -5 Solve 0 = -3020673g + 3020647g + 546 for g. 21 Solve 1071b + 315 = -1068b + 2148b for b. 35 Solve -5519m = 1068m - 19761 for m. 3 Solve -362x - 1975x + 12364 + 14378 = 8046 for x. 8 Solve -498u - 9291 + 6303 = 0 for u. -6 Solve -2227f + 42799 = -725f - 65879 - 17490 for f. 84 Solve 1178u + 2590u - 1457u + 198702 = -2918u for u. -38 Solve -238q - 603q + 94192 = 0 for q. 112 Solve 5040 = -1188z + 1398z for z. 24 Solve 138351 - 137415 = -24l for l. -39 Solve 61452 - 91525 = -493g for g. 61 Solve -679o + 496o - 1041 = -7446 for o. 35 Solve 771y = 59425 + 30782 for y. 117 Solve -1410c - 6071 = 21613 + 86526 for c. -81 Solve -1326x - 800x - 40515 = 140195 for x. -85 Solve 500s - 1072s - 2370s = 114738 for s. -39 Solve -194752j + 194551j = -3417 for j. 17 Solve -129s + 3623 = 4s - 3825 for s. 56 Solve 3146 - 343 = 38n + 485 for n. 61 Solve 432 - 100881 = 1193m + 30781 for m. -110 Solve -191o - 9574 + 2823 = 6237 for o. -68 Solve 24c = 107 + 127 + 6 for c. 10 Solve -44 - 58691 = -3209a + 30465 + 13488 for a. 32 Solve 63u + 221u - 709 = 8095 for u. 31 Solve 152i - 52174 = -60078 for i. -52 Solve 228226 = -511d + 34465d - 43406 for d. 8 Solve 267h = -264h + 282h + 3446 + 6265 for h. 39 Solve -11041 = 80115u - 80593u - 2437 for u. 18 Solve -10t - 132 + 355 = -439 - 78 for t. 74 Solve -61q - 7q + 1179 + 1405 = 0 for q. 38 Solve -503m - 16198 = -9659 for m. -13 Solve -505p + 10429 = 33659 for p. -46 Solve 10147a = -5559a + 1012a - 34923 + 828399 for a. 54 Solve 149v + 340v + 441v = 4650 for v. 5 Solve -30215375c - 1632 = -30215324c for c. -32 Solve 91z = -292z + 7277 for z. 19 Solve -132b + 14100 = 8424 for b. 43 Solve 0 = 2	{ "pile_set_name": "DM Mathematics" }
n(3). Let w(t) = 6t + 1 + 7t - 19t - 2t*3 + 0t*3. Let p(m) = -2m*3 - 5m. Determine op(s) - 5w(s). -2s3 - 5 Let o(j) = -1. Suppose 0 = -l + 2k + 9, 3k + 5 = -l - 2k. Let x(z) = -785z - l + 0 + 784z. What is 3o(w) - x(w)? w + 2 Let y(u) = -9u - 12. Let o(k) = -k - 1. Let r(c) = -20c - 286. Let s be r(-14). Give so(d) + y(d). -3d - 6 Let k(q) = 13q - 316. Let n(o) = 16o - 315. What is -3k(s) + 2n(s)? -7s + 318 Suppose 4158 = 22p - 4p. Suppose -28r - p = -17r. Let w(k) = -36k3 - 21k. Let b(c) = -7c3 - 4c. Determine rb(d) + 4w(d). 3d3 Let d = -537 - -660. Suppose 53 = 2k + d. Let x(n) = -4n3 + 6n*2. Let o(h) = 25h*3 - 35h*2. Calculate kx(s) - 6o(s). -10s*3 Let z(f) = -88368f - 768. Let s(j) = 4651j + 40. Determine 96s(u) + 5z(u). 4656u Let o(z) = -13z + 164. Let x(u) = -5u + 82. Give 4o(f) - 7x(f). -17f + 82 Let f(o) = 3o*2 + o - 1. Let y(m) = 485m*3 - 22m*2 - 11m + 8. What is 8f(v) + y(v)? 485v*3 + 2v*2 - 3v Let d(w) = 6w3 + 7w*2 + 11. Let m(f) = 11f*2 + 3f*3 - 7f2 - f2 + 5. Let s = -15952 - -15945. Determine sm(o) + 3d(o). -3o3 - 2 Let d(p) = -1. Let h(n) = -3n - 69. Let l be h(-23). Let m(q) = l + 2q2 - q + 0q*2 - 4 + 2q. Calculate 3d(w) - m(w). -2w*2 - w + 1 Let c(d) = 6d - 9. Let y be (-2 - -7)/(18/(7 + 11)). Let f(l) = 4l - 6. What is yc(i) - 7f(i)? 2i - 3 Let y(m) = -2m2 - 11m + 6. Let j(r) = r*2 + 6r - 3. Suppose -11 + 510 = 48q - 29. Give qj(x) + 6y(x). -x2 + 3 Let z(y) be the third derivative of y5/60 - y3/6 + 9y*2 + y. Let p(j) = 2j*3 + 6j*2 - 6. Let m be (-78)/6520/(-3). What is mz(r) - p(r)? -2r*3 + 2r*2 - 2 Let l(r) = 305r*3 - 22r*2 - 15r - 4. Let k(x) = 76x3 - 6x*2 - 4x - 1. Determine -22k(w) + 6l(w). 158w3 - 2w - 2 Let g(m) = m2. Let v(q) be the second derivative of -q4/6 + 10q2 - 1145q. Calculate -3g(u) - v(u). -u2 - 20 Let g(m) = 45m*2 + 8m + 15. Let w(h) = 23h2 + 4h + 9. What is -3g(r) + 5w(r)? -20r2 - 4r Let i(k) = 7185k3 - 39k*2 - 78k + 39. Let u(p) = 898p3 - 5p*2 - 10p + 5. Determine 10i(g) - 78u(g). 1806g3 Let c(u) = -5u*2 - 10u + 10. Let y be 61674/21 + 23/161. Let b(r) = -1469r2 - r - 1469r*2 + 1 + yr*2. What is -10b(q) + c(q)? 5q2 Suppose -887k + 48 = -895k. Let i(l) = 2l*3 + 6l + 15. Let q(n) = 6n3 + 17n + 45. Determine kq(f) + 17i(f). -2f3 - 15 Suppose -19a = 27 - 141. Let g(u) = 11u - 8. Let c(w) = 11w - 7. Give ag(m) - 7c(m). -11m + 1 Let m(g) = -5g*2 - 2g - 18. Let j(o) = o*2 + 3o + 1. Determine -6j(z) - m(z). -z2 - 16z + 12 Let o(n) = -120n3 - 9n*2 - 23n - 26. Let c(z) = 30z3 + 2z*2 + 6z + 6. What is 9c(s) + 2o(s)? 30s3 + 8s + 2 Let n(j) = -25j2 + 527j - 1. Let o(x) = -21x2 + 531x - 1. Calculate 4n(t) - 5o(t). 5t2 - 547t + 1 Let o(a) = -4a3 + 2a*2 - 429a - 1. Let z(r) = 5r3 - 3r*2 + 431r + 1. Give 3o(i) + 2z(i). -2i3 - 425i - 1 Let o(k) be the first derivative of -95 - 3k - k2 - 1/3k*3. Let s be 4((-3)/(-2) - 1). Let c(w) = -w*2 + w + 1. What is sc(l) + o(l)? -3l2 - 1 Let r(z) = -z2 + 12z + 2. Let a(s) = -6s2 + 35s - 52. Give -a(q) + 3r(q). 3q*2 + q + 58 Let k(i) = 10i*3 + 166i*2 + 2i - 8. Let w(g) = -16g3 - 331g*2 - 3g + 14. What is 5k(j) + 3w(j)? 2j3 - 163j*2 + j + 2 Let h(w) = 20w + 14. Let s(d) be the second derivative of 2/3d3 - 2d - 7 + 3/2d2. Calculate 3h(x) - 14s(x). 4x Let k = 12 + -9. Let l(d) = 0d3 + 0d + 3dk + d - 2d*3. Let t(c) be the second derivative of -7c5/20 + c4/6 - c3 - c2 + c. Give -6l(o) - t(o). o3 - 2o*2 + 2 Let m be 3 + 374/110 + 3/5 - 3. Let s(q) = 1. Let x(u) = -5u + 3. Give ms(l) - x(l). 5l + 1 Suppose -34c - 33 + 171 = 35c. Let i(n) = -n3 - n2 + n. Let d(q) = 3q3 - 2q + 2. Give ci(b) + d(b). b3 - 2b*2 + 2 Let q(h) = 187h*2 - 104h. Let j(v) = -63v2 + 34v. What is -7j(s) - 2q(s)? 67s2 - 30s Let r(m) = 95m2 + 6m + 76. Let k(u) = 1232u2 + 77u + 980. Give -6k(z) + 77r(z). -77z2 - 28 Let b(t) = 15t*2 + 706. Let x(n) = -11n*2 - 471. Determine -5b(v) - 7x(v). 2v*2 - 233 Let w(l) = -8l*2 - 31l + 68. Let n(a) = -3a2 - 10a + 22. Determine -11n(m) + 4w(m). m*2 - 14m + 30 Let c(k) = -5k3 - k2. Let u(p) = 10p3 + p2. Let h be 0 + (-6)/(-14) - (-3484)/364. Suppose 5 + h = 5v. Calculate vu(g) + 5c(g). 5g*3 - 2g*2 Let t(q) = 6861650q*3 + 7418q*2 - 3709q. Let s(g) = -3701g3 - 4g*2 + 2g. Determine -3709s(a) - 2t(a). 3709a3 Let b(y) = -51y - 38. Let q(n) = -4n - 7. Let j(k) = -b(k) + 6q(k). Let s(x) = 26x - 3. Give 2j(f) - 3s(f). -24f + 1 Let g(f) = 5f2 - 2f - 55. Let u(y) = -y*2 - 2y - 1. Give 3g(z) - 3u(z). 18z2 - 162 Let i(x) = 2x*2 - 10x + 32. Let t(k) = k*2 + k - 25. What is -i(y) - 6t(y)? -8y2 + 4y + 118 Let h(s) = -1 - 1 - 8s - 3. Let f(c) = -6505c + 10. Let r(n) = -53664n + 84. Let l(w) = -33f(w) + 4r(w). Give -5h(q) - 4l(q). 4q + 1 Let n(w) = -w. Let i(g) = -6g - 6. Suppose 0 = -5t + 4z + 15, 85z - 80z = 3t - 22. Give ti(j) + 5n(j). j + 6 Let f(g) = -g*2 + 7g + 51. Let c(p) = -2p2 + 20p + 151. What is 4c(k) - 11f(k)? 3k2 + 3k + 43 Let l(i) = -6i3 + 2i*2 - 4i. Let y(a) = 189a + 5. Let p(r) = -151r - 4. Let d(v) = 5p(v) + 4y(v). Give -5d(j) - l(j). 6j*3 - 2j*2 - j Let d(i) = 4i + 2. Let a(v) = -78 + 64v - 32v + 81 - 28v. Let l(m) = m - 3. Let b be l(6). What is bd(z) - 2a(z)? 4z Let v(n) = 2819n2 - 4n + 4. Let h(a) = -5634a2 + 7a - 7. Determine -4h(b) - 7v(b). 2803b2 Let n(j) = -26j*3 - 7j*2 - 2j. Let q(z) = 9z2 - 65z - 5. Let k(x) = -2x2 + 13x + 1. Let c(y) = -5k(y) - q(y). Determine -6c(a) - n(a). 26a3 + a2 + 2a Let p(g) = 9g + 24. Let q(z) = 34z - 6. Let a(i) = -148i + 24. Let h(r) = -6a(r) - 26q(r). What is -14h(m) + 6p(m)? -2m - 24 Let b(y) = -20y3 - 18y. Let a(f) = -f*2 - 21f + 105. Let i be a(4). Let m(z) = 3z + 2z*3 + 6z + iz3 - 2z - z. Give -6b(t) - 17m(t). t*3 + 6t Let a(c) = -4c - 7. Let v(h) = -46h + 1234 - 1230 + 48h. Determine -4a(d) - 7v(d). 2d Suppose -165n + 5w + 45 = -164n, 3w = -n - 19. Let c(j) = -6j3 + 4j*2 + 14. Let d(f) = 7f*3 - 5f*2 - 14. Calculate nc(a) + 4d(a). -2a*3 + 14 Let k be 4/12-9 + 20. Let c(a) = -3a - 9a + ka - 11 + 1. Let w(d) = 14d - 29. Calculate 11c(q) - 4w(q). -q + 6 Let w(g) = 9g - 4044. Let z(k) = -5k + 2020. What is -3w(j) - 5z(j)? -2j + 2032 Let v(z) = -2z*2 - 2z - 3. Suppose 3n = -14n + 204. Suppose g + m = -n, 0 = g + 3m - m + 15. Let x(j) = 8j*2 + 9j + 12. What is gv(w) - 2x(w)? 2w2 + 3 Let v(r) = -39r + 2. Let m(t) = -138t + 6. Let z(o) = 2m(o) - 7v(o). Let i(d) = -6d - 4. Give -3i(u) + 5z(u). 3u + 2 Let j(c) = -10c*2 + 899c - 46. Let m(p) = -3p2 + 449p - 18. Calculate -2j(q) + 5m(q). 5q2 + 447q + 2 Let n(y) = 297y2 - 17y - 37. Let v(l) = -198l2 + 12l + 26. Give -5n(r) - 7v(r). -99r2 + r + 3 Let z(g) = -7g + 14. Let f(i) = 82i + 48. Let b(v) = -31v - 15. Let d(l) = 11b(l) + 4f(l). Suppose 0 = 5o - 46 - 9. Give oz(j) - 6d(j). j - 8 Let f(w) = 29w*2 + 63w - 52. Let b(k) = -21k2 - 49k + 40. Let t(p) = 18b(p) + 14f(p). Let r(i) = 19i2 - 5. Let m = -9 + 14. Give mt(s) - 8r(s). -12s*2 Let j(f) = 1. Let p be ((-1)/4)/(34/(-408)). Suppose -u = 4w - 4 - 1, 5u - 8 = -pw. Let l(k) = -3k2 + 3. Give ul(t) - 3j(t). -3t*2 Let l(v) = -v - 1. Let h(w) = -2w*2 - 2w - 8. Let z be (36/8)/(132/(-48) - -2). Determine zl(u) + h(u). -2u*2 + 4u - 2 Let o(w) = 101 + 94 + 95 + 101 - 17w2 - 374 - w3. Let n(l) = 1 + 0l*2 + 0l2 - l2. Determine 102n(p) - 6o(p). 6p3 Let o(d) = d2 - 4d + 6. Let l(x) = -2x2 + 9x - 13. Let p be ((-6)/(-9))/((-4)/522-3). Suppose -6n + 2n + p = s, 10 = 2n. What is so(r) + 4l(r)? r*2 + 2 Let q(x) = -7x*2 - 89x + 2910. Let h(j) = 2j2 + 28j - 970. Determine -19h(c) - 6q(c). 4c2 + 2c + 970 Let j be 1/4 + (-81)/(-12). Let c(u) = -5u - 8. Let q(n) be the first derivative of 2n*2 + 7n - 34228. What is	{ "pile_set_name": "DM Mathematics" }
66 - 654. Solve 0 = 3j - 4t + 25, -t + f = 2t for j. -3 Let p be ((-4)/(-18))/(122/2745). Let g be 32/3 - 0. Let i be 3/(1/71). Solve pn + gc = i, -3n + c + 19 = -c for n. 5 Let k be (5/(-10))/((-3)/(-18)). Let j be -1 - (-3 - -15)/k. Solve -jb + 5 = -a - 6, 3a = 4b - 13 for b. 4 Suppose 22 + 18 = 4t - 4o, 0 = -3t + 4o + 32. Suppose 0 = -2s - 0 + t. Solve -2r - 6 = -sx, -3r - 4 = 3x + 5 for r. -3 Suppose 4u - 3q = 21, 2u + 9 = -9q + 4q. Solve -uc - j + 6 = 0, 4c = 6c + j - 3 for c. 3 Let j(d) = 0d - d2 - 10 - 15d + 47. Let s be j(-17). Solve -5u - n - 11 = 0, 4n - 4 = sn for u. -3 Suppose 0 = -4o - 2m + 106, 27 = 4o - 4m - 85. Suppose -o - 13 = -8z. Solve 7v - w - 27 = 2v, 0 = zw + 10 for v. 5 Let w(n) = n2 - 15n - 32. Let u be w(-2). Solve l + 4 = -d, -2d + l = 7 - u for d. -3 Suppose 5l - 150 = -4a, -a - 2l - 124 = -4a. Let v = -19 - -23. Solve -vx = -5n - 12, 4n + 4x + a = 16 for n. -4 Suppose 4c - 45 = -2b - 3b, -4c = 3b - 35. Suppose -h = -5h + 16. Let z be (-3)/(-33/27). Solve -bm - 18 = p - 0m, m = hp + z for p. -3 Let v be (1 + -2 + 4)24/18. Let h be 9/(81/6)(-1 + v). Solve -3f - 5r = -5, hf - 4r = -r - 22 for f. -5 Suppose 4m - 2m - 5f - 10 = 0, -4m + 5f = -20. Suppose 0 = mp + 2q - 42 + 10, -q = -1. Let d = p + -2. Solve 0 = 9i - di + 5, 5b = -5i + 5 for b. 2 Let p be (76/(-190))/(-1 - (-38)/40). Suppose h = 5n + 6, -5h + p + 0 = -3n. Solve 3f - 4b = -h + 18, -20 = 4b for f. -1 Let g be (-7)/((-42)/16) + 8/(-12). Solve -2d + 18 = 3c - g, -2d = -2c for c. 4 Suppose 9 = 5s - 2u, -5s - 2u - 5 = -6. Solve 0h = -3h - 3n + 15, 0 = h - 5n + s for h. 4 Suppose 12w - 10w = 26. Suppose 33 = wu + 7. Solve a + a = -2c - 4, -ua - 3 = 3c for c. 1 Suppose 45 = 2x + 13. Suppose x = 3n + n. Let z be 0 + (-2)/20. Solve 6 = 5i + 2t - 10, z = ni + 4t - 20 for i. 2 Suppose 10j - 64 = -24. Solve 0 = 5s - 2x + 33, js - x = -16 - 8 for s. -5 Let f be (-27)/(-2)(-11 - -5). Let l = -56 - f. Suppose -2d + l = 3d. Solve 0 = -5k + 3h + 11, -h = 2k - 6 - d for k. 4 Suppose 0 = w - 7. Suppose -w + 31 = -3f. Let l = f - -11. Solve -l = 4y - 2p + 3, 3p = 4y + 11 for y. 1 Suppose -4f + 88 = -3a, -4a - 67 = f + 63. Let p = a + 33. Solve -5o - 3h = -10, -2h + 6 = 3o - p for o. -1 Let m = -24 - -14. Let a = 10 - m. Let i be 48/a - 2/5. Solve -ic - 5n = -9, 3n + 3 = -5c - n for c. -3 Let f(k) be the first derivative of -k3/3 - 5k*2/2 + 16k + 4. Let z be f(-7). Solve -v + zq + 6 = -7, -4v + 5q + 37 = 0 for v. 3 Let o be ((40/15)/(-8))/((-4)/60). Solve 0 = oz - 3a + 16, 5z + 5a + 40 = -0a for z. -5 Suppose -k = 2b + 3 - 2, -2k + 5b = -16. Solve 0f = f - 2x, 0 = f + kx for f. 0 Suppose 0 = 25d + 39d - 192. Solve 3r = 2r - ds - 2, 2r = 3s - 13 for r. -5 Suppose -177r - 32 = -185r. Solve -3k - 5 = rf - 14, 4f = -k + 11 for f. 3 Suppose 69 = 8f - 11f. Let r = 22 + f. Let n be (78/(-18))/(r/3). Solve -5b + 2 = -o - 0, 0 = -b - 4o + n for b. 1 Let r = 282 - 277. Solve 0 = 4b - rt - 18, 4b + 0t = t + 10 for b. 2 Let g(d) = -d + 16. Let p be g(0). Suppose 4a = -20 - 60. Let f be (-14)/(-3) - 4 - a/6. Solve -fz + p = 2w - 4w, -w - 12 = -3z for w. 0 Let m be 3 - 1/226. Let w = m + 18. Suppose wj = 13j - 100. Solve -5g = -g - 2r + 16, -5g = 5r + j for g. -4 Let u be (0 - 5)/(-5)(-7 - -12). Solve ux + z = -25, 2x + 5z = -0z - 10 for x. -5 Let o = -221 + 337. Let u be (o/(-8))/((-3)/(-6)). Let a = u + 33. Solve 4r + 2p - 7 = 1, -2r = ap - 16 for r. 0 Let y(q) = 3q - 2. Let u be y(2). Suppose -4j = -18 - 2. Let h(a) = -a3 - 8a*2 + 8a - 6. Let m be h(-9). Solve -uo - jt - 3 = -3o, 0 = -3t - m for o. 2 Suppose 5v = 4n + 9 - 3, 0 = 3v - n - 5. Solve 0q - 4q - 16 = -2u, 0 = 4u - vq - 20 for u. 4 Let y = -560 + 562. Solve -yc = 2n + 4, -n - 5 = -4c - 3 for n. -2 Suppose -3g + 2u = -u - 66, -3g + 42 = 5u. Let h be (-9)/(-6)(-20)/(-6). Suppose 5 = -hl + 60. Solve g = -2i + 3v - 2, 2i + l = v for i. -3 Let k(m) = -m*3 + 9m*2 - 7m - 7. Let x be k(8). Solve 21 = -5h - 4c, 2h + 5 = -4c - x for h. -5 Let i be (-3 + (-52)/(-12))3. Suppose 3g - iy - 4 = 0, 0g + 24 = 4g + 4y. Suppose 4 - 12 = -gw. Solve -3b - a - 21 = 2b, -2a = wb + 10 for b. -4 Suppose -5a = -0a - 20. Let f be (-1 - a)80/50. Let w = f - -13. Solve -5d = wu + 40, d = 2u + 2u + 17 for u. -5 Let v(a) = a*2 + 7a + 1. Let n be (-1219)/115 - (-3)/5. Let y be v(n). Let m = 31 - y. Solve r + 1 = -2o - 2, 4r + 4o + 4 = m for r. 1 Let f = 503 + -499. Solve 3i - f = -0z - z, 3i - 5 = -2z for i. 1 Let c be (1/(-6))/((-56)/1008). Solve 4v - 14 = 2f + 9v, cv + 15 = f for f. 3 Let o = 5 - 0. Let m be 30/2 - (2 - 3). Let w = 5 + m. Solve -n + oz - 9 + w = 0, 0 = 5n - 3z + 6 for n. -3 Suppose -t - 3 = 2w - 10, -3t + 12 = 3w. Let g = -1961 - -1963. Solve gx + 5 + 15 = -4c, 0 = -4x - wc - 25 for x. -4 Let a be 88/18 - (-62)/558. Solve -4r = ac + 18, 3r + 0r + 8 = -c for r. -2 Suppose -44 = m - 2. Let d = m - -47. Solve 8 = -2t + 2c, 2c + 2c = dt + 21 for t. -5 Let o(b) = -20b + 224. Let y be o(11). Solve 2c - 3c + 5 = ya, -2a = -c - 1 for a. 1 Suppose 4u - 15 = 3f, 2u + u = f. Let l be (-2)/(-6) - (-12)/f-14. Solve 2m = -0m - 8, 4m + l = 3i for i. 1 Let q = 448 + -435. Solve f + h + 6 = 0, 3f + q = -5h - 9 for f. -4 Let y be 14/4 + -22. Let n be (-99)/y + (-8)/(-28). Solve -no - 19 = -2p, -2p + 0o = -4o - 14 for p. -3 Let u = -95 - -99. Suppose 0 = 4g - 5c - 5, ug + 3c = -g + 34. Solve 0 = 3h + gk + 19, 4k + 22 = -5h - 1 for h. -3 Suppose p - 41 = -s, -2s + 154 - 60 = -p. Let u = s + -30. Solve -3r = u, -5a = 2r + 15 + 5 for a. -2 Suppose 2u - 6 = -4x - 0, -x = 5u - 6. Suppose x = i + k, -2i - k = -6k - 23. Solve 5g = -ip + 4 - 23, 2p - 4g - 10 = 0 for p. -1 Suppose 0 = 5y + 4f - 21 - 7, -3f + 15 = 3y. Let m be 2 - (y/(-12) + (-4)/(-6)). Solve 3r = -2u - 2, 6r = r + mu + 18 for r. 2 Suppose -5k = -0k. Suppose -t - t - 4r - 4 = k, 0 = 5t + 5r. Solve -ti - 2i + 32 = 4c, -i + 20 = 4c for c. 4 Suppose 5g - 5n = 15, -4n - 28 = 5g - g. Suppose 10 = 2t + 2, 2x - 28 = -5t. Let h be (5 - x)(g + 7). Solve -12 + 37 = w + ha, 0 = w + a - 5 for w. 0 Let o(i) = i - 9. Let s(t) = t - 8. Let z(q) = -4o(q) + 3s(q). Let x be (0 - 1)16/(-2). Let k be z(x). Solve -y = 4y + m - 25, 0 = ky + 3m - 20 for y. 5 Let p(h) = -h*2 + 17h - 39. Let j be p(3). Solve 5v + 7 = -3i - 10, -ji - 3v - 9 = 0 for i. 1 Let o be -1 + (-24)/(-28) + (-2)/(-14). Solve -2n + 20 = -4c + 2n, o = -3c + 4n - 20 for c. 0 Let a(k) = 6k - 1. Let p be a(1). Let i = 24 - 10. Let b = i + 4. Solve v + o = -p + 1, 0 = -3v + 3o - b for v. -5 Suppose 10 = 3j + j - 2t, 20 = j - 4t. Suppose l = 4y - 2 + 32, j = 2l - 3y - 50. Solve 0 = -5a + 3u - l, -a - 5u = -2a for a. -5 Let m be ((-42)/(-4))/(9/90). Let v = -54 + m. Let w = 79 - v. Solve -3o + 15 = 0, a - 2o = -7o + w for a. 3 Let r(a) = 4a*2 + 1. Let b be r(1). Suppose 5k - 102 = -4x, -2x + 59 = x - bk. Solve -3v - 1 = 2z, z + x = 3z - 5v for z. 4 Let b be (255/34)/(3/2). Solve 5k = -2s - 14, bk - 4 = 5s + 2k for s. -2 Let q(k) = -38k - 184. Let t be q(-5). Solve 5d + 2v = t, 4d - 5v + 15 = -d for d. 0 Let l be ((-2)/(-6))/(11(-3)/(-198)). Solve 2m + 5z = 10, 3m + lz - 4z = -23 for m. -5 Suppose -3u + 14 = 3h - 1, 3h = u + 11. Suppose 18 = hw + 2t, 2w - t + 2 - 1 = 0. Solve -5 = f + wi, 1 = f - 0f - i for f. -1 Suppose 3m + 3 = 0, -3m = p - 0 - 2. Let v = p + -2. Suppose 4o - f = 2f + 14, -vf = 6. Solve -2a + h - o = -h, -3h = -2a for a. -3 Suppose -280 + 25 = -51q. Solve 2b = 6, -qk + 3b = -4 + 3 for k. 2 Suppose 13d = 11d - 8. Let v(t) = -t2 - 5t - 1. Let y be v(d). Solve 3o + 7 = k, 2o + 1 = -yo - k for o. -1 Let t = -4 + 6. Let w be (-1)/(10/36)(-135)/54. Suppose -3f - w = -18. Solve 0c + fc = -2x + 12, -13 = -tc - 3x for c. 2 Let w be (-2 + 48/9)/(6/36). Solve -3m - w = 4n - 4, 0 = 2n - m + 8 for n. -4 Let s = -13 - -9. Let t be (-33)/s + 1/(-4). Let k(f) = f3 + 7f*2 + f + 10. Let x be k(-7). Solve -2	{ "pile_set_name": "DM Mathematics" }
inutes after 9:06 AM? 1:09 PM How many minutes are there between 10:55 PM and 3:05 AM? 250 How many minutes are there between 5:43 PM and 12:44 AM? 421 How many minutes are there between 9:49 AM and 4:43 PM? 414 How many minutes are there between 2:07 AM and 8:23 AM? 376 How many minutes are there between 1:02 PM and 11:33 PM? 631 What is 552 minutes before 9:14 PM? 12:02 PM How many minutes are there between 3:34 AM and 2:59 PM? 685 How many minutes are there between 4:39 AM and 6:58 AM? 139 What is 524 minutes before 3:24 AM? 6:40 PM How many minutes are there between 1:59 AM and 1:54 PM? 715 How many minutes are there between 6:43 AM and 10:00 AM? 197 What is 676 minutes after 4:59 PM? 4:15 AM How many minutes are there between 12:38 PM and 11:17 PM? 639 What is 665 minutes before 11:21 AM? 12:16 AM What is 641 minutes before 7:03 PM? 8:22 AM How many minutes are there between 11:16 PM and 6:40 AM? 444 How many minutes are there between 7:38 PM and 6:12 AM? 634 How many minutes are there between 6:45 PM and 10:36 PM? 231 How many minutes are there between 4:27 PM and 1:11 AM? 524 How many minutes are there between 7:50 AM and 7:18 PM? 688 What is 186 minutes before 8:52 PM? 5:46 PM How many minutes are there between 11:45 AM and 10:16 PM? 631 How many minutes are there between 3:57 PM and 4:59 PM? 62 What is 33 minutes before 10:14 AM? 9:41 AM What is 185 minutes after 9:34 PM? 12:39 AM How many minutes are there between 3:06 AM and 9:40 AM? 394 How many minutes are there between 8:26 PM and 3:16 AM? 410 How many minutes are there between 9:44 PM and 4:18 AM? 394 How many minutes are there between 6:24 AM and 7:55 AM? 91 What is 493 minutes after 8:38 AM? 4:51 PM How many minutes are there between 1:14 PM and 3:54 PM? 160 How many minutes are there between 4:50 PM and 9:10 PM? 260 How many minutes are there between 5:29 PM and 2:19 AM? 530 What is 141 minutes after 10:15 AM? 12:36 PM What is 667 minutes before 12:14 AM? 1:07 PM What is 525 minutes before 4:22 PM? 7:37 AM What is 142 minutes before 3:45 AM? 1:23 AM What is 186 minutes before 5:58 AM? 2:52 AM How many minutes are there between 9:24 PM and 1:48 AM? 264 What is 25 minutes before 8:27 AM? 8:02 AM What is 589 minutes after 10:07 PM? 7:56 AM What is 328 minutes after 12:49 PM? 6:17 PM What is 524 minutes after 12:27 AM? 9:11 AM How many minutes are there between 9:37 PM and 4:23 AM? 406 What is 20 minutes before 10:29 PM? 10:09 PM How many minutes are there between 9:15 PM and 2:25 AM? 310 How many minutes are there between 5:36 AM and 8:47 AM? 191 What is 398 minutes before 10:47 AM? 4:09 AM What is 331 minutes after 12:43 PM? 6:14 PM What is 453 minutes before 11:19 PM? 3:46 PM How many minutes are there between 1:25 PM and 6:34 PM? 309 How many minutes are there between 3:01 PM and 1:31 AM? 630 How many minutes are there between 10:24 AM and 11:56 AM? 92 How many minutes are there between 6:33 PM and 5:20 AM? 647 How many minutes are there between 6:52 PM and 5:55 AM? 663 What is 416 minutes after 4:50 AM? 11:46 AM How many minutes are there between 9:21 PM and 10:17 PM? 56 What is 394 minutes after 1:54 PM? 8:28 PM What is 439 minutes before 1:06 AM? 5:47 PM What is 144 minutes before 4:00 AM? 1:36 AM How many minutes are there between 2:15 PM and 10:28 PM? 493 How many minutes are there between 3:40 AM and 3:26 PM? 706 What is 560 minutes after 12:28 PM? 9:48 PM What is 557 minutes before 7:36 AM? 10:19 PM How many minutes are there between 4:47 PM and 4:30 AM? 703 How many minutes are there between 1:59 PM and 11:37 PM? 578 What is 337 minutes before 7:13 AM? 1:36 AM How many minutes are there between 7:39 PM and 9:09 PM? 90 What is 139 minutes before 1:03 AM? 10:44 PM How many minutes are there between 12:33 PM and 9:18 PM? 525 How many minutes are there between 1:18 AM and 1:00 PM? 702 How many minutes are there between 4:50 AM and 12:15 PM? 445 How many minutes are there between 2:40 PM and 6:31 PM? 231 How many minutes are there between 11:40 AM and 8:58 PM? 558 What is 254 minutes after 4:49 AM? 9:03 AM How many minutes are there between 7:26 AM and 6:35 PM? 669 What is 303 minutes after 10:15 PM? 3:18 AM How many minutes are there between 7:39 PM and 12:05 AM? 266 What is 596 minutes before 8:16 AM? 10:20 PM How many minutes are there between 11:15 PM and 4:08 AM? 293 How many minutes are there between 12:02 PM and 8:12 PM? 490 How many minutes are there between 4:48 PM and 4:50 PM? 2 How many minutes are there between 3:22 PM and 10:12 PM? 410 How many minutes are there between 1:46 PM and 8:30 PM? 404 What is 354 minutes before 6:19 PM? 12:25 PM What is 376 minutes after 1:33 AM? 7:49 AM What is 501 minutes after 3:10 AM? 11:31 AM What is 685 minutes before 6:07 AM? 6:42 PM What is 327 minutes after 3:55 PM? 9:22 PM What is 41 minutes after 9:24 AM? 10:05 AM What is 708 minutes before 6:48 PM? 7:00 AM What is 283 minutes after 12:25 PM? 5:08 PM How many minutes are there between 11:55 AM and 12:43 PM? 48 What is 195 minutes after 1:12 AM? 4:27 AM What is 82 minutes after 8:04 PM? 9:26 PM What is 141 minutes before 8:28 PM? 6:07 PM How many minutes are there between 7:53 PM and 5:52 AM? 599 How many minutes are there between 3:55 AM and 4:14 AM? 19 What is 41 minutes after 7:13 AM? 7:54 AM How many minutes are there between 5:22 PM and 6:18 PM? 56 How many minutes are there between 8:18 PM and 5:27 AM? 549 How many minutes are there between 10:33 AM and 3:43 PM? 310 What is 300 minutes before 2:45 AM? 9:45 PM How many minutes are there between 12:58 AM and 1:52 AM? 54 How many minutes are there between 9:21 PM and 8:41 AM? 680 What is 636 minutes before 9:44 AM? 11:08 PM What is 344 minutes after 9:08 PM? 2:52 AM What is 82 minutes after 11:45 AM? 1:07 PM How many minutes are there between 1:12 AM and 3:20 AM? 128 How many minutes are there between 9:44 PM and 5:07 AM? 443 What is 145 minutes after 1:51 AM? 4:16 AM How many minutes are there between 8:26 AM and 7:41 PM? 675 What is 572 minutes before 12:44 AM? 3:12 PM How many minutes are there between 2:51 PM and 12:35 AM? 584 How many minutes are there between 1:49 PM and 12:36 AM? 647 How many minutes are there between 8:43 AM and 1:47 PM? 304 What is 130 minutes before 2:45 PM? 12:35 PM How many minutes are there between 2:20 PM and 2:06 AM? 706 What is 620 minutes before 2:06 PM? 3:46 AM What is 547 minutes after 5:38 AM? 2:45 PM How many minutes are there between 5:10 AM and 11:17 AM? 367 What is 270 minutes after 1:06 AM? 5:36 AM What is 132 minutes before 3:51 AM? 1:39 AM How many minutes are there between 1:32 AM and 6:56 AM? 324 How many minutes are there between 10:11 AM and 12:23 PM? 132 What is 123 minutes before 5:03 PM? 3:00 PM What is 19 minutes after 8:23 AM? 8:42 AM What is 501 minutes after 2:48 AM? 11:09 AM What is 345 minutes after 12:13 PM? 5:58 PM What is 646 minutes before 8:55 PM? 10:09 AM How many minutes are there between 12:53 AM and 11:24 AM? 631 How many minutes are there between 9:00 AM and 1:15 PM? 255 What is 371 minutes before 10:17 PM? 4:06 PM What is 309 minutes after 3:11 PM? 8:20 PM What is 152 minutes after 11:42 PM? 2:14 AM What is 617 minutes before 1:57 PM? 3:40 AM What is 171 minutes before 11:38 PM? 8:47 PM How many minutes are there between 4:20 AM and 4:08 PM? 708 What is 148 minutes after 12:28 PM? 2:56 PM What is 491 minutes after 3:00 PM? 11:11 PM How many minutes are there between 12:02 PM and 5:04 PM? 302 What is 706 minutes before 1:05 AM? 1:19 PM How many minutes are there between 8:20 AM and 9:02 AM? 42 How many minutes are there between 2:02 PM and 7:27 PM? 325 How many minutes are there between 4:54 PM and 8:21 PM? 207 How many minutes are there between 9:50 AM and 2:43 PM? 293 How many minutes are there between 6:18 AM and 5:37 PM? 679 How many minutes are there between 2:11 PM and 12:00 AM? 589 How many minutes are there between 7:46 AM and 2:12 PM? 386 What is 463 minutes after 7:55 AM? 3:38 PM What is 573 minutes before 5:20 AM? 7:47 PM How many minutes are there between 10:30 PM and 3:58 AM? 328 What is 504 minutes after 7:47 PM? 4:11 AM What is 448 minutes after 8:42 AM? 4:10 PM How many minutes are there between 12:36 AM and 4:13 AM? 217 What is 410 m	{ "pile_set_name": "DM Mathematics" }
qrt(5) + (sqrt(5)2 - sqrt(5)) + sqrt(5))5)). 0 Simplify (1 + (-2sqrt(825)-6)/(-52-2sqrt(11)))-2. -6sqrt(3) - 2 Simplify 2 + ((1 + ((sqrt(1100) - ((sqrt(1100) - sqrt(1100)1-6) + sqrt(1100)) - sqrt(1100)) + (0 + 2sqrt(1100) - sqrt(1100)) + 2)-4)3)*2. -35280sqrt(11) + 7762043 Simplify ((4sqrt(385)-1)/sqrt(7))/(3(sqrt(125) + sqrt(125) + sqrt(125)-3)). 4sqrt(11)/15 Simplify ((4sqrt(140)-2)/(sqrt(140)/sqrt(5) + sqrt(7)))/(sqrt(1000)1-2 + (sqrt(1000) - (-6sqrt(1000)2 + sqrt(1000)))) + 2. -2sqrt(2)/75 + 2 Simplify 34((-6(sqrt(98) + 0) - (sqrt(98) + 4 + sqrt(98)1 + sqrt(98) + sqrt(98) - sqrt(98))) + -2). -756sqrt(2) - 72 Simplify (4sqrt(315)16)/(sqrt(45)1 + sqrt(180)2). 24sqrt(7)/5 Simplify ((sqrt(96) - 6sqrt(96)1) + sqrt(96) + sqrt(96) - 5(sqrt(96)2 + sqrt(96)))/((sqrt(147) - (sqrt(147) + sqrt(147)3) - sqrt(147))-3-1). 6sqrt(2)/7 Simplify 3 + ((sqrt(243) + sqrt(243) + -3 + sqrt(243) + sqrt(243) + sqrt(243) + 0 - sqrt(243)) + 4 + -4 + sqrt(243)-36)2. 756sqrt(3) + 47640 Simplify ((sqrt(252) + -4sqrt(252)6)1 - (0 + 4(sqrt(252) - (3 + sqrt(252)))))*2-2. -266904 + 6624sqrt(7) Simplify (sqrt(352)/(sqrt(8) + sqrt(24)/sqrt(3) + sqrt(8)) + (sqrt(528)1)/sqrt(12))/(sqrt(48)/(sqrt(12) + sqrt(48)/sqrt(16)))3. 6sqrt(11) Simplify -3 + sqrt(28)/(-43sqrt(4)) - ((sqrt(448) + sqrt(7))-5 + sqrt(7) + (sqrt(7) - (2 + sqrt(112)))). -1 + 563sqrt(7)/12 Simplify (sqrt(5929)-3 + -3sqrt(441))/((sqrt(567) + (2sqrt(567) - sqrt(567)) - -1sqrt(63))-4). sqrt(7)/2 Simplify (((-22sqrt(70) - sqrt(70) - sqrt(70)) + sqrt(70)14 + sqrt(70))-2)/((sqrt(120)-2)/sqrt(12) - -3sqrt(90)) + -5. -5 + 2sqrt(7)/7 Simplify (5 + ((1sqrt(700) + -3 - sqrt(700)) + -5)3 + -1sqrt(700)6-4-4)2. 36480sqrt(7) + 6451561 Simplify 3(((4(sqrt(99)-1 - sqrt(99)) + sqrt(99) - sqrt(99)) + 1 + -5(sqrt(99) - -2sqrt(99))4)-1)2. -1224sqrt(11) + 1373331 Simplify 1(-1 + (0 + (sqrt(245) - (2 + sqrt(245))) - (-1 + -1sqrt(245))) + 2)*2 + 3. 248 Simplify ((-2sqrt(153)2 + sqrt(153) - (-1sqrt(153) - sqrt(153))1)/((sqrt(1089) - (sqrt(1089) + 2sqrt(1089)-4)) + sqrt(1089)12))2. 17/12100 Simplify (sqrt(91) + sqrt(91)24 + (sqrt(91) - 3sqrt(91)-1))/((-1sqrt(1225))/((sqrt(7) + sqrt(28))-2)). 78sqrt(13)/5 Simplify -1 + sqrt(11) + 2 + (sqrt(396) + 2)*2 - (1sqrt(539)1 + sqrt(539))4. -31sqrt(11) + 401 Simplify (sqrt(245)1)2 - (sqrt(3200)/sqrt(10))2 - (5 + (sqrt(180) - (sqrt(180) + -2)) - (((sqrt(180) - (sqrt(180) + 0 + -3))*2 - sqrt(180)) + sqrt(180))). -73 Simplify (((sqrt(480) + 1sqrt(480))5)/(3sqrt(16)/sqrt(2)))/(sqrt(12) - sqrt(108)/sqrt(9)2 - sqrt(84)/(sqrt(77)/sqrt(11))). -5sqrt(5)/3 Simplify -2(2-1sqrt(882) - sqrt(882))/((sqrt(882) + (sqrt(882) - sqrt(882)-2) + sqrt(18))/sqrt(2)). 42sqrt(2)/29 Simplify (((-6sqrt(168)/sqrt(3) - 2sqrt(224))2)/(sqrt(32)4 + (sqrt(24)3)/sqrt(3)))*2. 2800/121 Simplify (-5 + -1 + sqrt(200)/(sqrt(8)/sqrt(2)-3)-5)2-6. -3148/3 + 600sqrt(2) Simplify ((3sqrt(84)1)/(-2sqrt(343)))/(3sqrt(196)-1-5). -sqrt(3)/490 Simplify (-1 + 1 + -1 + sqrt(468) + -4)2 - ((sqrt(468) - (sqrt(468) + -1sqrt(468)))*2 + -4 + sqrt(468) + (-5(sqrt(468) + 1))*2 + -4). -11692 - 366sqrt(13) Simplify (6(sqrt(90)16 - sqrt(90)))/((sqrt(5) - (-2sqrt(180) - sqrt(5))) + sqrt(5) + sqrt(5) + sqrt(5) + sqrt(245)2 + sqrt(5))-4. -45sqrt(2)/4 Simplify (sqrt(450)-3-1)/((sqrt(1210) + (sqrt(1210) + -3sqrt(1210) - sqrt(1210)))6)-3. 9sqrt(5)/44 Simplify 4 + (sqrt(272) - (2 + 2 + sqrt(272))) + 4 + (1 + (sqrt(272) - (sqrt(272) + 2)-1))1. 7 + 8sqrt(17) Simplify 1 + ((-1 + sqrt(242) - (sqrt(64)/sqrt(2) - sqrt(2))) + (sqrt(22)-2-6)/(sqrt(11)-22))*2. -10sqrt(2) + 52 Simplify -4(sqrt(117)35 + sqrt(117) + (sqrt(117)2 + sqrt(117))-4)/((sqrt(5400)-2 - sqrt(5400))/sqrt(6)). 8sqrt(13)/15 Simplify (4((sqrt(66)-3-5 - sqrt(66)) + sqrt(66)))/(2(3sqrt(726) + sqrt(726))) + 0. 15sqrt(11)/22 Simplify (0 + -3((sqrt(512) - (sqrt(512) + -1sqrt(512) + -2)) + (-1 + sqrt(512))1)-4)2. 9216sqrt(2) + 295056 Simplify ((2(sqrt(45) - 1sqrt(45))-5)2 + ((5 + (sqrt(5) - -2sqrt(15)/sqrt(3)))-6)2)4. 4320sqrt(5) + 10080 Simplify (1 + (-5 + -2(sqrt(252)2 - sqrt(252)) + -2(-2 + sqrt(252)))*2)2. 96sqrt(7) + 8068 Simplify 1 + -1 + (sqrt(637) - (5 + sqrt(637)2)*2) + (sqrt(13) + -3)-44 + -4. -2529 - 149sqrt(13) Simplify ((sqrt(340) + sqrt(340) + -4-2sqrt(340))/(sqrt(90)1))/(4sqrt(8)/sqrt(4)52). sqrt(17)/12 Simplify (-2sqrt(800))2 + 2 - -4(sqrt(800) - (-2 + sqrt(800)) - sqrt(800))*2. -320sqrt(2) + 6418 Simplify (-3(6(2sqrt(192) + sqrt(192)))/sqrt(12))/(sqrt(8) + sqrt(288)3 + (sqrt(288)/sqrt(6))/sqrt(6)). -27sqrt(2)/10 Simplify (1 + (-1 + -3-4(1 + 2(sqrt(99) + -1)))*2)-1. -57194 + 1872sqrt(11) Simplify ((2(sqrt(3000) - ((sqrt(3000)-1 - sqrt(3000))-6 + sqrt(3000))))/((1sqrt(450))/(sqrt(10)/sqrt(2)-4)))*2. 307200 Simplify (((sqrt(162) - (1 + sqrt(162))) + 1 - (5 + sqrt(162) + -1)) + 4 - ((sqrt(162) - (3 + sqrt(162))) + 2 - (-2 + sqrt(162)2 + sqrt(162))))*2. -36sqrt(2) + 649 Simplify (-3 + 6sqrt(72) + sqrt(72) + sqrt(72) + 3 + 5)2-56. -138990 - 14400sqrt(2) Simplify (-1 + (3 + 4(sqrt(931) + (-2sqrt(931) - sqrt(931))) + -2 - -4(-2sqrt(931)-3 + sqrt(931) - (-5 + (1 + sqrt(931) - sqrt(931))))))2. 4480sqrt(19) + 372656 Simplify (-5(-2 + (sqrt(539) + 0)-4 + -1)6 + 4)21. 157920sqrt(11) + 7770436 Simplify ((5 + sqrt(704) - sqrt(704))-56)2 + 5 + (2(-1 + sqrt(704)))*2. -64sqrt(11) + 25325 Simplify (((sqrt(5103) - (sqrt(5103) - 5sqrt(5103)))1 + sqrt(5103))-1)/((sqrt(63) + (sqrt(63) - (-2sqrt(693))/sqrt(11)))/(sqrt(28)-1 - sqrt(7))). 81sqrt(7)/2 Simplify -2 + ((sqrt(468) - (1sqrt(468) + sqrt(468))2 - (sqrt(468)-2 + 5))2 - 3(-4 + -1sqrt(468))2). -961 - 84sqrt(13) Simplify (-2(0 + (1 + sqrt(700) + -4)4 + (sqrt(700) - (2 + sqrt(700)))-2-5))*2. -10240sqrt(7) + 48896 Simplify -6(2 + (-4(sqrt(125))*2 - sqrt(5))) + 6sqrt(35)/(sqrt(28)/sqrt(4))-6 + 4. -30sqrt(5) + 2992 Simplify ((-5(-4 + sqrt(128)) - sqrt(128)) + -2)2 - (sqrt(128) - -5(sqrt(128) + -2sqrt(128)) - -6(sqrt(128) + sqrt(128)2))2. -20156 - 1728sqrt(2) Simplify (sqrt(153) + -22sqrt(153) + (sqrt(153) - (sqrt(153) - (sqrt(153) + sqrt(153) + -2sqrt(153)5 - sqrt(153)))))/(-6sqrt(144) + -3sqrt(9)-3). 4sqrt(17)/5 Simplify (1(4sqrt(70)2 + (1sqrt(70) - sqrt(70))6 + sqrt(70)))/((sqrt(360) - (sqrt(360) + 4(sqrt(360) - -1sqrt(360))))3). -sqrt(7)/16 Simplify (sqrt(48)-6 - (sqrt(432) + -1sqrt(432)))/(-5(sqrt(144) - 3(sqrt(144) + (sqrt(144) - 1sqrt(144)))))-1. sqrt(3)/5 Simplify 4(2 + 0 + sqrt(252) + 5) + (-4 + (sqrt(252) - (3 + sqrt(252))) - -2(-4sqrt(252))2). 24sqrt(7) + 8085 Simplify (-2sqrt(2430)5 + sqrt(2430) + sqrt(2430) + sqrt(2430) + sqrt(2430) + -2sqrt(2430)-2)/((sqrt(216) - sqrt(216)1-2)-6)-3. -sqrt(5)/2 Simplify 1((3 + sqrt(80) + 4 + sqrt(80))3 - (sqrt(80)-1 + 4 + sqrt(80) + -12sqrt(80))2). -315 + 88sqrt(5) Simplify ((4 + (1 + sqrt(800) + sqrt(800))-1 + -1 + 1)2)*2. -960sqrt(2) + 12836 Simplify (sqrt(16)/(sqrt(4)/sqrt(2)) - (sqrt(8) + (-2sqrt(968) - sqrt(968))))/(-1sqrt(144)1 + (-1(sqrt(144) - -2sqrt(144)) - sqrt(144)))-1. 11sqrt(2)/10 Simplify ((sqrt(150)/(-1sqrt(10)) + sqrt(120)/(sqrt(8)-1))/(2sqrt(363)2))2. 5/484 Simplify ((sqrt(192) + -1 + sqrt(192))6 + (-4 + sqrt(192) + -2 - sqrt(192)))*2 - (3(sqrt(192) + sqrt(192)2) - (-5(sqrt(192) + 2))*2). -1576sqrt(3) + 32692 Simplify ((sqrt(72) + sqrt(72) + sqrt(72)1 + -2 + 3 - (3 + sqrt(72) + 4 + 5))-3)*2. -2376sqrt(2) + 3681 Simplify (-5sqrt(243)1 + 1 + sqrt(243) + -5 - (-5 + 2 + (sqrt(243)1 + sqrt(243) - sqrt(243)) + 5))2. 540sqrt(3) + 6111 Simplify ((-2 + -1-4(sqrt(153) + 1) - (5 + 5-5-1sqrt(153))) + -4)2. 882sqrt(17) + 67522 Simplify (((sqrt(187) - -5sqrt(187)1) + sqrt(187) - (sqrt(187) + 2sqrt(187)5))3)/((-1sqrt(121)5)/(1sqrt(1584) + sqrt(1584) - sqrt(1584))). 144sqrt(17)/5 Simplify ((4 + sqrt(2736) + sqrt(19))2 - sqrt(19)-12) + 2((-1sqrt(684) - sqrt(684) - sqrt(684)) + 4(sqrt(19) + 2 + sqrt(19)))*2 + 2. -214sqrt(19) + 7157 Simplify (-1 + -1sqrt(192)-5 + 2 - (-5 + sqrt(192) + -1 - (sqrt(192)*	{ "pile_set_name": "DM Mathematics" }
allest value in 2, n, -4? 2 Let y = 25 - 28. What is the smallest value in -4, y, -2/15? -4 Let m = -1.78 - -1.58. What is the biggest value in m, -2/9, -4, 0.1? 0.1 Let w = -2.1 - -4.1. What is the biggest value in -4, w, 1/5? w Let x = -3.94 + -0.06. What is the biggest value in -3, x, 2/9? 2/9 Let o = 4 - -1. Let l(j) = j*2 + 7j + 9. Let y be l(-6). Suppose -yr = r. Which is the smallest value? (a) r (b) 2/7 (c) o a Let m = -15 + 15.4. Which is the smallest value? (a) -12 (b) -2 (c) m a Let x = 3 - 2.95. Let j be ((-4)/33)/((-4)/6). Which is the second smallest value? (a) -0.4 (b) j (c) x c Let i = 0.7 + -0.2. Let r = 2.98 - -0.02. Which is the third biggest value? (a) -5 (b) r (c) i a Let r(l) = l - 3. Let v be r(3). Let b(p) = -p3 + 1. Let u be b(v). Let g be u/(-3) + 2/18. What is the second smallest value in -4, g, 0.1? g Let i be 16/(-154) + (-4)/(-14). What is the third smallest value in i, 0.2, 0.5? 0.5 Let q = -74 + 70.1. Let u = q + 4. Let y = -1 - -1.5. Which is the biggest value? (a) -4 (b) u (c) y c Let q = -10 + 15. Let u be (-2 + 1)/(3 + -4). Let z be 9/(-7) - (-1)/u. Which is the second smallest value? (a) -0.5 (b) z (c) q b Let l = -20.5 - -21. Which is the smallest value? (a) l (b) -0.3 (c) -0.5 c Let j = -110026 - -6931858/63. Let w = j - 34/9. Which is the biggest value? (a) 2/5 (b) -3 (c) w a Suppose -3w - 3j = -12, -5j + 15 = -0j. Let v be ((-20)/(-25))/(w/(-5)). Which is the smallest value? (a) v (b) 2 (c) -2 a Let g be 215/10 + (-2)/(-4). Let t be 2/9 + g/(-18). Let y be (2-1)/(t - -2). Which is the second smallest value? (a) 0.5 (b) 1 (c) y a Let u = -5 + 0. Let j = 0.79 + -0.29. What is the third biggest value in -1, u, j? u Let s(n) = -2n2 - 3n - 1. Let l be s(-2). Let g = -13/10 - 1/5. Let z = -3.6 - -3.4. What is the smallest value in g, l, z? l Let v = -3/4 + 1/2. Let s be (7/((-21)/(-30)))/2. Suppose -8 = sc - 3. What is the second biggest value in 0.4, v, c? v Let o = 1 + -2. Let f = 0.11 - 1.51. Let m = -0.4 - f. Which is the biggest value? (a) 0.3 (b) o (c) m c Let n be (-3)/(7/5 + -2). Which is the fourth smallest value? (a) 0 (b) -2/15 (c) n (d) 1/6 c Let b = 6.03 + -0.03. Let c = b - 5. What is the third biggest value in -5, c, 0? -5 Let g = -1.17 + 0.17. Which is the third smallest value? (a) -3 (b) 0.2 (c) g b Let d = -2108/13 + 162. What is the fourth biggest value in 0.4, -2/3, 1, d? -2/3 Let j = -110 + 110.5. Let y be (11/4)/(2/(-8)). Let f be 2 - y(-1)/4. What is the third smallest value in -1/10, f, j? j Suppose -3x = -15, 5h - 3x = -4x - 10. Let f be ((-10)/(-4) + h)-1. Let k = 2.7 - 3. What is the smallest value in k, f, 0.3? k Let k = 22 - 20.03. Let s = -0.03 - k. Which is the smallest value? (a) -1/2 (b) s (c) -3 c Let z = -3/1192 - 174905/8344. Let k = z - -85/4. Let d = -10 + 8. What is the biggest value in k, d, -1? k Let w = -2 - -1.98. Let n = 4.53 - 0.55. Let a = n - w. What is the smallest value in a, -0.5, 3/4? -0.5 Let i = 0 - -3. Let m = 0 + i. Which is the second smallest value? (a) -4 (b) m (c) 0 c Let p = -293396/107 - -2742. Let w = 244/1605 + p. What is the second smallest value in w, 3/5, -0.1? w Let t = -0.09 - 0.91. Which is the biggest value? (a) t (b) 3 (c) -7 b Let f = -14.11 - -0.11. Let q = f + 15. Which is the smallest value? (a) -2/7 (b) q (c) -0.1 a Let w = 6 - 6.4. Let u = -283 + 284. Which is the second biggest value? (a) -2 (b) w (c) u b Let i = 2 + -4. What is the third biggest value in -0.1, 5, i? i Let t be ((-8)/(-84))/(15/(-35)). What is the smallest value in t, -4, 3.2? -4 Let g = 15.5 - 13. Let t = g - 0.5. Let l = 1 - 0.8. Which is the smallest value? (a) l (b) 4 (c) t a Let p = -25 + 14. Let j = p - -8. What is the biggest value in -5, j, 0.2? 0.2 Let z = -16 - -31/2. What is the biggest value in 3, -0.4, z? 3 Let g = -6 - -6.11. Let i = g - -0.19. Which is the smallest value? (a) i (b) 4 (c) 0.1 c Let f = -0.1 + -0.4. Which is the third smallest value? (a) 2 (b) -0.1 (c) f a Let q = -4 + 8. Let l = 0.157 - -0.043. Which is the second biggest value? (a) 2 (b) q (c) l a Suppose -15 = 2c - 5. Let q be 5/(-4) - c/20. What is the biggest value in q, 3, 2? 3 Suppose 3 = 4p + 2o - 1, -p + 3o = -1. Which is the smallest value? (a) -0.5 (b) p (c) -1/3 a Let y = 2961/11 + -269. Which is the smallest value? (a) 3 (b) 0.03 (c) y (d) 0.1 b Let a = -0.19 + 0.69. What is the third smallest value in 2, -2, a? 2 Let t be 1/3825(-2259804)/(-1028). Let j = -6/4369 + t. Let d = 6/25 - j. Which is the third smallest value? (a) 0.5 (b) -2/9 (c) d a Let h = 237 - 447. Let i = h - -1677/8. Which is the second smallest value? (a) 0.4 (b) 1 (c) i a Let g = -738 - -93727/127. Let z = 261/889 - g. Which is the second smallest value? (a) z (b) 1/3 (c) 0.5 b Let l = -10 - -5. Let r = 3 - 2.5. Let n = -39 + 39. Which is the second biggest value? (a) n (b) r (c) l a Let g = -59/5 - -12. Let h(q) = q*2 + 16q + 5. Let x be h(-16). Suppose -5j + 5b + 15 = 0, xb - 8 = -3. What is the third biggest value in j, -4, g? -4 Let b = 6157059/80 - 76962. Let n = 7/16 - b. What is the biggest value in n, -2, -2/7? -2/7 Let n = -21 + 6. Let q = -15.4 - n. What is the second smallest value in q, 4, -3? q Suppose -4j + 8 = 2k, k + 3k - 29 = 5j. Let y be 6/(-15)10/k. Which is the third biggest value? (a) y (b) 0.1 (c) 0.3 a Let v = 0.9 + -1.2. Which is the smallest value? (a) -6/5 (b) v (c) 2 a Let d = 2.86 - -0.14. Let p = 1 - 3. Let f = p + 2.02. What is the third smallest value in f, -1, d? d Let i be (-21)/(-54) - (-2)/(-9). What is the second smallest value in i, -4/7, 4? i Let p = 67/6 - 11. Let x be (11/132)/(3/(-6)). What is the smallest value in 2, x, p? x Let y be 316/84 - (-1)/1. Let p = y + -13/3. What is the smallest value in 0.5, p, 0.4? 0.4 Suppose 5 - 15 = -2u. Which is the smallest value? (a) u (b) -0.1 (c) 5/3 b Let h = -2.5 + 2. What is the second biggest value in 0, -2/9, h? -2/9 Let p be (-28)/13 - (2 + -4). Let y be 30/(-4)(-4)/(-3). Let s = y + 6. What is the third biggest value in p, s, 4? s Let v be (-8)/624/(-64). Let h = -21.7 - -22. Which is the third smallest value? (a) h (b) 0.4 (c) v c Let j = -16.7 + 17. What is the third biggest value in 1/3, -3/4, j? -3/4 Let b be 2/(-6) - 28/6. Suppose 13y = r + 9y - 20, 2y = 2r - 16. What is the biggest value in b, 0.4, r? r Let o = 13 - 7. Let i = -6 + o. Which is the third biggest value? (a) 3 (b) i (c) -0.2 c Let m(i) = i3 - 2i*2 + i - 1. Let k be m(2). Suppose -2t = 2 + 4. Which is the second biggest value? (a) -0.5 (b) k (c) t a Let v = 1.9 + -0.2. Let g = -6.7 + v. Let j = 1.8 - 2. Which is the third biggest value? (a) 4 (b) g (c) j b Let t = 94 + -91. Which is the second biggest value? (a) -0.2 (b) -2/3 (c) t a Let f = -1.76 + -0.14. Let j = f - -0.9. Which is the second biggest value? (a) -13 (b) j (c) 4 b Let u = -1.61 + -0.39. Let p = 1.02 + -0.02. What is the third smallest value in p, -1/8, u? p Let i = -78.79 - -78. Let y = -0.7 - i. Let r = y - 0.09. What is the second biggest value in 4/7, -2/5, r? r Let t be (-4)/302/((-8)/(-6)). Which is the third biggest value? (a) 0.3 (b) t (c) -0.3 (d) 0.1 b Let p = -38 + 35. What is the second biggest value in p, 5, -2? -2 Let y = -6 - -6.5. Let k be -5 - (1 - 2)3. What is the second biggest value in 5, y, k? y Let w = 6 - 5.4. Let k = w + -0.5. What is the second smallest value in k, -0.3, 4? k Let i(u) = 2u2. Let r be i(1). Suppose r = -5d - 3. What is the biggest value in d, -4/7, -6/7? -4/7 Let g be 9/6 + 2 + -2. Let m = g + 1. Which is the smallest value? (a) m (b) -1/3 (c) -0.1 b Let d = -4.7 + 1.7. What is the third biggest value in 2, d, 10? d Let y = -4.5 + 4.3. What is the biggest value in y, -2/5, 2, 1/3? 2 Let u = 3 - 1. Suppose 5o = -ug + 27, -4g + 19 = 5o - 2*o. Let k be ((-6)/8)/(1/4). Which is the biggest value? (a) k (b) 2/13 (c) o c Let q = -1.5 - -2. Let v = -12 - -12.5. Let k = q + v. Which is the biggest value? (a) k (b) -0.5 (c) -3/8 a Let i = -1.97 + -0.03. Let b be ((-3)/(-4))/((-15)/60). What is the second biggest value in b, i, 3? i Let m = -16 + 31. Let g = m + -15.5.	{ "pile_set_name": "DM Mathematics" }
q(o) = -3o + o2 + 0o - h + 3o - 3o. What is q(b)? -2 Let k(d) = -138d - 15 + 5 + 137d - 6. What is k(-11)? -5 Let i(c) = c*3 + 6c*2 - 3c + 21. Let t be i(-7). Let o(y) = y*2 + 8y - 10. Determine o(t). -17 Let n(l) = l + 2. Let q(r) = r - 6. Let h be q(1). Let f be 19 + h + (4/(-2) - 2). Calculate n(f). 12 Let r(x) = -x - 1. Let o(f) = -f*3 + 20f*2 + 2f - 32. Let l be o(20). Let z be l + -3(4 + -3). Calculate r(z). -6 Suppose 263q = 285q - 88. Let t(k) be the second derivative of 10k - 5/3k3 + 0 + qk*2 + 1/12k*4. Calculate t(6). -16 Let s(y) = -6y - 45. Let n be s(-8). Let q(v) = 11vn + 0 + 1 + 2626v - 2625v. Determine q(-1). -11 Let w(i) be the second derivative of -i4/12 + 2i*3/3 + 5i*2/2 - 22i + 2. What is w(5)? 0 Let y(v) be the second derivative of -5v3/6 + 5v*2/2 + 98v. Give y(3). -10 Let y(u) = -8u + 1. Suppose -4 = -4o + 2o, -5g - 161 = -3o. Let d = g + 64. Let h = d - 32. Determine y(h). -7 Let q(k) = -k3 - 14k*2 - 13k - 2. Let r(s) = s*2 + 2s - 61. Let t be r(-8). What is q(t)? -2 Let u(t) = -t*3 - 3t*2 - t - 1. Let b be 205/7 + 18/(-63). Let c = 26 - b. Give u(c). 2 Let k(b) = 7b*2 + 2b + 2. Let r(x) = 11x2 + 3x + 3. Let o(i) = 7k(i) - 5r(i). Let w = 773 - 774. Give o(w). -6 Let r(x) be the third derivative of -x4/12 - x3/2 + 6x2. Let y = -6 - -15. Let w be 6/4(-12)/y. Give r(w). 1 Let h(k) = -5k2 - 3k - 4. Let z(g) = -2g2 - 2g - 2. Let y be -228/162. Let w(a) = yz(a) + 3h(a). Let f = 9 - 3. Give w(f). -4 Let t(q) = -q*2 + 19 - 11 - 110q + 114q. What is t(6)? -4 Suppose 3n + 2q + 17 = 0, -4n = -q + 3q + 26. Let f be n/122/36. Let g(h) = -h - 7. Determine g(f). -4 Let t(w) = 0 - 2 + w + 3 - 9w2. Let u(v) = -v3 - v*2 + 7v + 2. Let l be u(-3). What is t(l)? -9 Let d(t) = -t*3 + 10t*2 - 18t + 8. Suppose 0 = 5a - a - o - 36, 4a - 52 = 5o. Let y be d(a). Let z(w) = -w + 4. What is z(y)? 12 Let r(x) = x3 - x2 + x + 1. Let v be 5/(-16)-4 - 50/40. Calculate r(v). 1 Let t(h) be the first derivative of 5/2h2 - h + 21. What is t(-3)? -16 Let k(f) be the second derivative of f3/6 + 8f*2 - f - 36. Give k(-7). 9 Let g be ((-10)/165)/(10/(-110))-3. Let v(d) be the second derivative of d4/12 + d2/2 - d. Determine v(g). 5 Let s = -222 + 225. Let z(g) = -g3 + g2 + 2g - 3. Determine z(s). -15 Let m(t) be the second derivative of t3/3 + 7t*2/2 + 2t - 3. Determine m(6). 19 Let s = 187 + -187. Let w(c) = -c - 5. What is w(s)? -5 Suppose 6m + 8m - 70 = 0. Let r(k) = -k*3 + 5k*2 + 3k + 9. Calculate r(m). 24 Suppose 0 = -12t + 38t. Let b(y) be the second derivative of t - y*2 + 7y + 1/6y3. What is b(3)? 1 Let p(g) be the third derivative of -g6/180 + g5/40 - g4/24 - 3g3/2 + g2. Let w(v) be the first derivative of p(v). What is w(2)? -3 Let s(i) = -5i2 + 5i - 2. Let p(k) = -11k2 + 11k - 5. Suppose -2v - 41 = 5b, 2v = 3v - 2. Let z = 18 + b. Let c(y) = zs(y) - 4p(y). Give c(-2). -4 Let o(w) be the first derivative of 3w2 - 24. Calculate o(1). 6 Let k(o) be the first derivative of 0o*2 - 7 + 1/60o*5 + 0o4 - o3 + 0o. Let w(t) be the third derivative of k(t). Give w(-3). -6 Let l(m) = -m3 + 3m*2 - 7m + 2. Let x(u) = 49u - 242. Let y be x(5). Give l(y). -19 Let g(f) = -f2 + f - 1. Let d(o) = o2 + 2. Let t(q) = d(q) + 4g(q). Let r be (-2)/(-11)(-2 + 13). Give t(r). -6 Let x(k) = 53k - 57. Let u be x(1). Let w(l) = -3l2 - 2 - l3 - 2 - l2. What is w(u)? -4 Let f(u) = 2u*2 - 4u - 10. Let v be f(4). Let i(j) = -j*3 + 8j*2 - 6j + 5. Give i(v). 41 Suppose -7d + 642 = 621. Let n(u) = -3u2 - u - 9 + 6 + u3 + 5u - 3u. Give n(d). 0 Let q be (-10)/(-45) + 470/(-9). Let n = q + 17. Let o be 20/n + 24/(-7). Let h(y) = -y*3 - 4y*2 - 3. Give h(o). -3 Let c(w) = 9 + 6 - 1 + 12w. Let k be c(6). Let m(s) = -ks3 - 3 + 1 - 4s*2 + 87s*3 - 4s. Give m(5). 3 Let y(c) be the first derivative of 3c + 2c*3 - 1/2c*2 - 2 + 1/4c*4. Determine y(-6). 9 Let s be 0 + -1 - (-21)/7. Suppose sr = 4 - 0. Suppose -3c = -rc - 1. Let p(d) = -13d - 1. Give p(c). -14 Let y(j) = 9j + 164j2 + 3 - 163j2 + 7. Calculate y(-5). -10 Let r(w) = -w2 - 21w + 21. Suppose 4n + 94 = 2a, 4n + 132 = -a + 47. Give r(n). -1 Let t(r) = r + 13. Suppose 0 = 8l - 5l + 5v + 16, 2l = -3v - 12. Calculate t(l). 1 Let d(x) be the second derivative of -x5/20 + x4/12 + x3/6 - 2x*2 - 105x. Determine d(0). -4 Let j(i) = -8i2 + 3i + 4. Let h be j(-1). Let f(x) = -x*3 - 8x*2 - 8x - 8. Determine f(h). -1 Let f(b) = b*2 + 4b - 3. Let z be -8 + 11 - (0 - -28). Let p = z - -50. Suppose 0 = -4c + 9c + p. Calculate f(c). 2 Let j(k) = k*3 - 10k*2 + 18k - 17. Let z(d) = d*3 - 4d*2 - 13d - 48. Let y be z(7). Determine j(y). -1 Let l be -4 + 1089/15 + 4/10. Let r = 62 - l. Let v(h) = -h*3 - 6h*2 + 5h - 10. Determine v(r). 4 Suppose -a + 0a + 3 = 0, c = 4a - 31. Let o = c + 24. Let p(z) = 2z - 5. Give p(o). 5 Let n be 60/(-70) - 202/(-7). Let h be (0 + 24)/((-9)/(-12)). Let p = n - h. Let j(q) = -q2 - 2q + 5. What is j(p)? -3 Let c be (-4558)/(-946) - 4/(-22). Let y(a) be the third derivative of 3a2 + 0a - 1/8a4 - 5/6a*3 - 1/15a*5 + 0 + 1/120a*6. Determine y(c). 5 Let s be (-274)/(-8) - 24/(-32). Let w(c) = 3c + 29 + 0c - s. Let m be 10/312/10. What is w(m)? 6 Let m(v) = v. Let n(x) = 2x - 1. Suppose -u + 0u - 3l = -6, 0 = u - 5l + 2. Let z(q) = un(q) - 5m(q). What is z(3)? 0 Let l be (0 + 16)/(3 + -2). Let o = 21 - l. Let f(r) = -r + 7. Calculate f(o). 2 Let g(n) = n*3 - 7n*2 + 7n - 6. Let f = 4 - 1. Suppose -2p - i - 15 = -5p, -3i = -2p + f. What is g(p)? 0 Let s(g) be the third derivative of g5/10 - g4/8 - g*3/3 + 34g*2. What is s(3)? 43 Let v = 19 + -15. Suppose -24 = -2m + vw, 0 = 5m + 6w - 2w - 18. Let j(a) = -2a2 + 5a*2 - 1 - ma3 - a3 - 2a - 4a*2. Calculate j(-1). 7 Let o(n) = n - 4. Let a(k) = k - 17. Let t(w) = a(w) - 3o(w). Determine t(-3). 1 Let c(z) = z. Let h be c(3). Let g(d) = -7 - d - 6 + hd - d. Determine g(11). -2 Let z(j) = 3j*2 + 0j + 3j - 2j. Let v = 39 + -27. Let q = v + -11. Calculate z(q). 4 Let r = 24 - 22. Let d(u) = -2 + 2u - r + 3. Give d(-2). -5 Let b(y) be the first derivative of -y3/3 + 4y*2 + 2y - 415. Give b(5). 17 Let r(q) be the second derivative of q5/20 + q4/2 + 2q3/3 + 3q*2 + 216q + 2. Calculate r(-5). 11 Let s be 16/6 - 8/(-24). Suppose sw = -2d + 5d, 4 = -d - 3w. Let o(a) = -3a3 + a2. Calculate o(d). 4 Let o(r) = 53r*3 + 1 - 34r*3 - 3r*2 - 20r3. Calculate o(-2). -3 Let m(y) be the third derivative of -y6/360 + y5/40 + y4/8 - y*3/2 - 5y2. Let b(c) be the first derivative of m(c). Give b(4). -1 Let x(u) = -u2 - 6u - 7. Suppose c - 77 = -3m + m, -4m + 160 = 4c. Let y be m/(-7) - 12/(-7). Calculate x(y). -2 Let z(s) = -7s*2 + 23s + 13. Let g(r) = -4r2 + 14r + 7. Let b(p) = 5g(p) - 3z(p). Calculate b(3). 8 Let x = 9 - 5. Let q(s) = 7s2 - 12s + 3. Let t(b) = -2b + 1 + 0b + 0b + 4b*2 - 4b. Let o(u) = -3q(u) + 5t(u). What is o(x)? 4 Let y(x) be the first derivative of -x*3/3 - 4x2 + x + 10. Let k(q) = -q2 - q. Let l(p) = -4k(p) + y(p). What is l(3)? 16 Let p(q) = -q3 - 3q*2 + q + 7. Let d(a) = 5a*3 + 15a*2 - 4a - 36. Let r(g) = 2d(g) + 11p(g). What is r(-4)? 9 Let n(q) be the first derivative of -q*2/2 - 7q + 12. Let g(x) = 4x2 + 5x + 3. Let a be g(-3). Suppose 0 = 2h - 6h + a. Calculate n(h). -13 Suppose -2d = 18 - 28. Let s(g) = -g3 + 10g*2 + 11g - 10. Let p(q) = 2q3 - 21q*2 - 23q + 21. Let l(i) = -6p(i) - 13s(i). What is l(d)? 4 Let q(v) = -2v - 4. Let g be -42(0 - -7 - 817/114). What is q(g)? -18 Let f(l) = 3 + 2l + l - 4l + 2. Suppose -8 + 0 = -2r. Suppose -2d + 3n + 4 - 16 = 0, -rd - 2n = -8. Determine f(d). 5 Let w(u) = -u3 - 14u*2 - 38u - 48. Let s be w(-11). Let a(x) = -2x2 + 5x - 8. Let j(q) = q2 + q + 1. Let c(b) = -a(b) - j(b). Calculate c(s). 14 Let u(z) be the third derivative of z5/60 - z*4/3 + 3z*3/2 - 6z*2 - 3z. Suppose 4m - 4d = -2 + 34, 2d = -3m + 24. What is u(m)? 9 Let w(x) = -x*3 + 3x*	{ "pile_set_name": "DM Mathematics" }
4q - 3n. Which is bigger: h or q? h Suppose 0 = 9o - 1959 + 1968. Does o = 2/4567? False Suppose 0 = 8s + 5s - 7s. Let y be 0(-1 + 3/2). Let v = y + s. Is v smaller than 2/3? True Let q = 0.434 + 0.166. Which is bigger: 20 or q? 20 Let o(s) = -6s + 66. Let q be o(8). Is q not equal to 15? True Let y = 7039/5 - 1407. Is -202 at most y? True Suppose 0 = 2w + 2w - 100. Let q be 76/(-80) - (-5)/w. Let y = -5/4 - q. Is y less than or equal to 1.4? True Let j = 430 + -25368/59. Let h = -2 + 2. Does h = j? False Let t = 26.001 - 0.001. Let m = 25.7 - t. Are m and -3 equal? False Let v = 735 - 891. Which is bigger: -164 or v? v Let b = 0.1937 + -0.0937. Which is greater: b or -3? b Let m be (-10 - (-90)/10) + (-6)/(-8). Which is greater: -145 or m? m Let o be ((-163)/249)/(-2 + 1). Let b be -17 + 19 - 2/166167. Let t = o - b. Are t and 2 equal? False Let d = -75 - -78. Let z be (2/(d + -5))/(-1 + 2). Which is smaller: 1 or z? z Let u be 40/100(8 - 3). Is 30/13 greater than or equal to u? True Let s = -17 - -5. Suppose -8 = 2f - f - 2l, -3l - 43 = 4f. Which is greater: f or s? f Let x be (-2)/(-4) + 136/16. Suppose -3d + 13 = -v - x, 1 = -3v - 4d. Which is smaller: v or -1? v Let a be 4/(8 - 636/81). Is a < 24? False Suppose 0 = 7u - 25 + 4. Suppose 21 = 5a - 2a. Let l = 12 - a. Which is greater: u or l? l Let g = -5179/4 - -1317. Let m = 79/4 - g. Are -4 and m equal? False Let l = -32 - -18. Let z = l - -20. Suppose 0 = 3h - 4a - 14, -za + 2a - 30 = 5h. Which is smaller: -7/3 or h? -7/3 Suppose -9u = 5u + 700. Let d be (-2)/51u/(-35). Is d >= -1? True Let q(l) = 16l - 26. Let t(b) = -3b + 5. Let g(o) = -2q(o) - 11t(o). Let w be g(6). Suppose wx - x - 18 = 0. Which is smaller: 10 or x? x Let h be (10 + -9)(-140 - -3). Which is bigger: -136 or h? -136 Let p be 3/4(-16)/(-3). Let k be 8/(-12) - (-16)/6. Suppose -3d - 16 = -kz - 3z, 3d = 3z - 6. Is z less than p? False Let z = -125 - -125. Let k be (1/27)/(10/6). Is k less than z? False Let q = -21.5 - -14.5. Let j be (1 - 2)(-28)/182. Is j greater than or equal to q? True Let o = 2169/3808 - -1/544. Let n(r) = -r*3 - 3r*2 - r. Let t be n(-2). Let a(p) = -2p - 2. Let j be a(t). Which is bigger: o or j? j Let j be (-4 + 10)/(-3) - -4. Let l be j812/(-240)2. Let i = -40/3 - l. Do i and -0.6 have the same value? False Let r be 6(-1 - 3/(-2)). Suppose -rw + 15 + 12 = 0. Suppose -7q = -i - 2q + 15, -3q = -3i + w. Do -2/11 and i have different values? True Let j = -42 + 32. Let q be (4/(-185))/((-4)/j). Which is smaller: q or 0? q Let k be (-90)/20 - (-1)/2. Is k bigger than 11? False Let h = -33.518 + 0.518. Is h at least 28? False Suppose 40 = 3726h - 3734h. Which is smaller: h or -8? -8 Let f be (4 - 40)/((-3)/8). Let v be ((-4)/f)/((-5)/((-90)/4)). Which is smaller: v or 0? v Let u(v) = v. Let j(w) be the third derivative of w*4/6 + 17w*3/6 - 13w*2. Let p(o) = -j(o) + 5u(o). Let k be p(14). Which is smaller: -15/7 or k? k Let i = 3507573766/3245 - 5404583/5. Let k = i - -1/295. Is k less than or equal to 1/2? True Let z(g) = g*3 - 11g*2 - 24g + 39. Let k be z(14). Which is smaller: k or 292? k Let q(x) = 22x + 154. Let d be q(-7). Let v = 200 - 5603/28. Which is smaller: d or v? v Suppose -u + m + 0m + 11 = 0, -3m + 12 = 0. Is u at most as big as 15? True Let r = -26 + 31. Suppose 0s + 65 = -rs. Which is smaller: -12 or s? s Let j be -6 + (-2 - 0) - -6. Suppose 4m + 2 = -3k, -3m - 9 = 5k - 2. Which is smaller: m or j? j Let p = 52 + -48. Let f be 58/(-136) + (-2)/(-4 - p). Which is bigger: f or 1? 1 Let x(h) = -73h - 510. Let z be x(-7). Let t be (-2)/(-6) - 22/(-6). Suppose 8 = 4j - 4, tj = g + 26. Is z greater than g? True Suppose 4l - a + 1 = 17, -l - 5a - 17 = 0. Let j(n) = -6n2 - 3 - n3 + 0n*3 - 3n*2 - l. Let g be j(-9). Does -6 = g? True Let g be -3(4/10 + 102/45). Let a be ((-7)/4)/(g/(-32)). Is -7 smaller than a? False Let l(n) = -n*2 - 2n - 6. Let h be l(-6). Let q be h/(-225)2/(-4). Suppose 0 = -3i + 4g + 20, -4i - 8 - 2 = 2g. Is i <= q? False Let w be 4/(-12) - (-4)/3. Let f be -1 + (0 - (w + 0)). Let c be f1/3-12. Is 8 at most c? True Let n be (-12)/48 - (-118)/(-8). Let u = n - -14. Which is smaller: u or 1/4? u Let p be 2/7 - (-5 - (-51)/7). Suppose 0 = -i + 2 + 1. Let q be i/p(-48)/198. Is -1 at most as big as q? True Let r be (-3)/(-24)(1 + 55)/7. Is r greater than or equal to -5/31? True Suppose -5r - 26 - 54 = 0. Let i = r - -14. Do i and -3 have the same value? False Let k = -1193 - -1193. Is k at least as big as -24/19? True Let h = 776 + -753. Is h less than or equal to -1/5? False Suppose -24w = -25w + 16. Is w != 19? True Suppose 4r + 324 = 10r. Is 54 smaller than r? False Suppose 21h = -2q + 23h + 20, 24 = 4q + 4h. Is q equal to -2? False Suppose -a + 2v - 10 = -2v, 3a - 3v + 21 = 0. Let d be (-64)/a - 6/(-18). Suppose -3 = -8r + dr. Which is greater: r or -1/9? -1/9 Let a = -1/549 + 65/2196. Let r = a - -2/9. Which is smaller: r or -3/13? -3/13 Let g = 372 + -719/2. Let x be (-5 + (-210)/(-18) + -6)/(20/390). Which is smaller: g or x? g Let v = 323.3 + -323. Is 38 < v? False Let n be (-9)/212/9. Let y be (330/(-1155))/(4/98). Is n equal to y? False Let t = 167/10 + -33/2. Suppose 4k = -k + 20. Suppose -2c + 2q = -0q - 2, 4c + 4q = -k. Is c < t? True Let s = -35 - -14. Let l = s - -20.69. Let a = -0.01 - l. Which is smaller: a or 6? a Let l = -7981/7410 + 11/285. Is l at most as big as -1? True Let p = -23927/33 + 725. Suppose 5a + 4a = -27. Let u = a + 5. Which is smaller: p or u? p Let w = -39 - -42. Let r be (5/(-25)-1)/(1/w). Which is smaller: r or -0.3? -0.3 Let f be ((-12)/(-5))/6 - (-3777)/(-5). Is f not equal to -1? True Let a = -76 + 21. Let c be 4/a10/(-36). Which is smaller: 1 or c? c Let w(b) = -b*3 - 76b*2 + 79b + 155. Let z be w(-77). Let o be 1/(-4) - 3112/35. Let m = -357/4 - o. Which is greater: m or z? z Suppose 0 = 3u + 2f - 15 - 16, 3u - 36 = -3f. Suppose 31y - 319 = -71. Which is smaller: u or y? u Let r(c) = -7c*3 + c. Let o be r(2). Let i = o + 29. Is -24 greater than or equal to i? True Let d = 35 - 176/5. Let u = 3/5 - d. Suppose w = -2w. Which is bigger: u or w? u Let i(g) = g*3 - 5g*2 + 2g - 2. Let r be i(5). Suppose -3v + 2l = 85, -v - r - 15 = 2l. Let j = -26 - v. Are 2/27 and j unequal? True Let d = 0.064 + -0.064. Which is greater: -3.5 or d? d Suppose 29k - 32k = -9. Let b be (-12)/9 + k - (-2 - -4). Which is smaller: b or 13? b Let y = 117.92 + -120. Let o = y + 2. Let f = 0.98 - -0.02. Which is greater: o or f? f Let a = 3 + -2. Let h = 497 - 4465/9. Is a > h? True Let z be -2 + -123(-6)/(-9). Let o be 4 - z/(-18) - (-4)/6. Is o at least as big as 4/15? False Let c = -559 + 14537/26. Let l = -2 - -3. Which is bigger: c or l? l Let u be 376/(-126) + 1 + 2. Let t = -43/63 + u. Is -0.4 at least t? True Let o = -246 + 252. Is 27/4 >= o? True Let l(f) = 0f2 - 29f + 24 + 24f - f2. Let b be l(-8). Which is smaller: 1/35 or b? b Suppose 5d - b - 28 = 0, -2d - 2d + 17 = b. Suppose 2o = 4v - 0o + 68, dv + 5o + 70 = 0. Is -15 at least v? True Let n = 94 + -62. Let v = n + -38. Let d be (6/(-9))/(32/v). Is 0 != d? True Let z = -12.4 - -12. Let j = -17.14 + 17. Let y = 0.04 + j. Which is smaller: z or y? z Let q(g) = -g + 24. Let i(k) = -k2 - 7k. Let h be i(-3). Let n be q(h). Which is smaller: 10 or n? 10 Let h = 514 + -514.807. Let b = 0.137 + h. Are b and -1 equal? False Let m(s) = 5s - 50. Suppose h = j + 9, -7 = -3h - 2j - 5. Let b(a) = -a + 10. Let f(v) = hm(v) + 22b(v). Let d be f(10). Is 1/3 <= d? False Let l be (-832)/48(-3)/158. Which is bigger: 0 or l? l Let u = 1.7 + 0. Let x = 212.9 - 222. Let v = -9 - x. Which is bigger: u or v? u Suppose 0 = -m - 4, 23f - 5m = 22f + 21. Is f at most 2? True Let b = 169 - 151.3. Let y = -5.7 + b. Which is greater: -0.2 or y? y Let k be -1(0 - (2 - 2)). Suppose -642 = -3i - a - 0a, i - 214 = -5a. Let l = i + -10056/47. Are k and l equal? False Let j(x) = -7x + 3. Let a be j(-1). Let z be a/25 - (-6)/(-15). Suppose -2v - 8 = -i, i - 3v = -z*i + 12. Do i and 0.02 have different values? True Let g = -175.5 + 176. Is 21 < g? False Le	{ "pile_set_name": "DM Mathematics" }
t*3 + 2t + 2t3 + t + 1 as kt + nt2 + vt*3 + f and give v. -4 Rearrange (182r - 182r - 17r*3 + 2)(0r + r + r) to or*4 + fr + pr3 + u + qr*2 and give f. 4 Express 101 - 103 + 2i - 2i2 + 4i*2 as ci + v + ti2 and give c. 2 Rearrange (r3 + 0r + 0r)(r + 2r - 5r)(0 + 0 + 8) to the form qr*2 + hr*3 + yr + zr4 + m and give z. -16 Express (-5k + 8 - 8)(3 + 1 + 2 + (-3 + 0 - 1)(2 + 1 - 2))(1 - 4 + 1) in the form t + gk and give g. 20 Rearrange -2f3 + 0f*2 + 0f*2 + (-4f + 3f + 2f)(0f*2 + 0f2 - f2) - 5f3 + 0f3 + f3 to the form lf2 + zf + w + xf3 and give x. -7 Express 4 - b2 - 6 + 1 - 22b + 0b2 in the form y + ib*2 + lb and give i. -1 Rearrange -2r - 14r - 4r - 2r to d + fr and give f. -22 Rearrange m + 0m - 3m + (-3 - 3 + 4)(-6m + 3m + m) - 2m + 11m - m - 2 + 2 - m to the form f + bm and give b. 9 Express 3g*2 + 3 - 6 + 3 - 2g + 5 as cg + f + qg*2 and give q. 3 Express 117 - 30b - 117 as xb + h and give x. -30 Express -2m*4 + 3m*4 - 3m*4 + (2 - 2 + 2m)(2 - 1 - 5)(m - 2m3 - m) as xm*2 + jm*4 + pm + fm3 + g and give j. 14 Express -10j - 2 - 1 + 3 in the form g + tj and give t. -10 Rearrange 11o*2 + 31 - 31 to the form mo + u + vo2 and give v. 11 Express (0 - 1 + 2 + (-2 - 2 + 6)(-3 + 1 + 0))(10c + 5 - 5)(0 + 1 - 3)(-5 + 11 - 11) in the form pc + n and give p. -300 Express (0l2 + l2 + 0l2)(11l + 4 - 2 + 6l) as ol2 + b + ql + jl3 and give j. 17 Express -17m - 7m - 33m - 16m in the form f + jm and give j. -73 Express (-3 + 0 + 1)(o2 - 7o*2 + 2o*2) + 0o*2 + 5o2 - o2 + (0 + o + 0)(-1 + 1 - 2o) in the form a + xo + io*2 and give i. 10 Rearrange -6i + 19i + 5i + i*2 to the form di*2 + ci + a and give c. 18 Rearrange (-3k - 2k + k)(0k + k + 2k)(-1 - 2k2 + 1) to nk*2 + u + lk*4 + wk + gk3 and give l. 24 Rearrange -3q*2 - 1 - 4q*4 + 5q*4 - 2q + 8q2 to yq*2 + m + wq + sq3 + hq*4 and give w. -2 Express (9 + 17r*2 - 9)(-3r + 3r - 2r2) + r4 + 4r*4 - 3r*4 in the form or*4 + f + ir*2 + mr*3 + kr and give o. -32 Rearrange 2 - 18q + 1 + 4 - 5 to the form x + mq and give x. 2 Express 0b - 3b*2 - b + 0b + 2b2 as m + xb + wb2 and give x. -1 Express (-3q + 4q - 7q)(1 + 2q - 1) + (-2q - 5q + 4q)(-4 + 4 - 2q) + 4q*2 - 2q*2 - 3q*2 as g + jq*2 + oq and give j. -7 Express 7t - 5 + 16 - 4t + (-3 - 1 + 5)(-2t + 0t - 4t) in the form rt + x and give x. 11 Express -4a2 + a3 - 2a2 + 2a*2 + 2 as sa*2 + xa*3 + ba + p and give x. 1 Express 885 - 925 + b - 3b in the form vb + d and give d. -40 Express 0 + 2 + z - 1 + 2 in the form n + sz and give n. 3 Rearrange 4i*2 - 4i2 + i2 + (-2i + 3 - 3)(2i - i + 0i) + (-2i + 25i - 4i)(0i - 2i + 3i) to zi + yi2 + b and give y. 18 Express (0 + o + 0)(-16o + 48o + 25o + 2o + 2o - 6o + (-4o - 3o + 5o)(4 + 1 - 3)) in the form y + ko2 + mo and give k. 51 Rearrange (-r + 3r - 4r)(2 + 1 + 4 - 2 - 2 + 2 + (3 + 2 - 4)(2 - 3 + 0) + 4 - 3 + 0) to the form g + lr and give l. -10 Express 286 + 2z + 289 - 573 + 2z2 - 2z*3 as h + az*2 + bz + oz3 and give a. 2 Express (4 - 4 + 1)(-1 + 0 + 0)(-2w + 3w - 9w) + 3w - 3w - w as cw + q and give c. 7 Express 4l + 2l3 + 21 - 2l2 - 42 + 21 - l4 in the form pl2 + hl + ul4 + cl3 + i and give i. 0 Express (-w2 + w*2 - 9w*4)(-2 + 5 - 2 + (-3 + 5 - 4)(-1 + 1 - 2) - 5 + 2 + 5) in the form y + nw*3 + ow*4 + rw*2 + pw and give o. -63 Express -3 - 47 - 7n2 + n2 + 4n*2 as z + rn + wn2 and give z. -50 Rearrange 7f*2 + 2f*2 + 6f*2 - 2 to qf + s + yf2 and give y. 15 Rearrange (-2 + 4 - 1)(3a + 4a*3 + 3a*2 - 3a*3 + a) to the form k + ma*3 + sa + ha2 and give m. 1 Express (-3p - 5p + 2p)((-1 + 3 + 0)(0 - 1 + 3) + 1 + 3 - 5 + 2 - 3 + 0 + 0 - 1 - 3) in the form up + g and give u. 12 Rearrange 6b*2 - 12b - 25b2 + 8b*2 + 10b*2 to r + sb + nb2 and give n. -1 Express 19y + 4y + 2y - 8y in the form qy + g and give q. 17 Express (-1 + 2 + 0)(3y + 0 + 0)(-7 + 4 - 9) in the form ly + g and give l. -36 Express 26r2 - 7r*3 - 13r*2 - 11r*2 - 5r*3 as zr + or3 + d + fr*2 and give o. -12 Express (3 - 9 - 3)(-7x + 1 - 5x + 26x) in the form r + fx and give f. -126 Express 35 + 4l - 35 - 2l - 32l2 in the form y + bl + gl2 and give b. 2 Rearrange (-2 + 5 - 1)(-32u2 - 485 + 485)(u + 0 + 0) to ju3 + g + ku*2 + ru and give j. -64 Rearrange (3d + d3 - 3d)(-11 + 13 + 33) to the form qd*3 + bd*2 + jd + y and give y. 0 Express -57i - 48i + 75i in the form d + bi and give b. -30 Express (0v - 5v + 2v)(5v + 10v + 7 - 5) as dv2 + n + wv and give d. -45 Express (-5s2 + 2s*2 + 4s*2)(-7 + 6s - 3s - s) in the form m + as2 + xs*3 + ds and give x. 2 Rearrange 103 + 3b - 102 + 3b*2 + 0b*2 to ub + lb2 + k and give k. 1 Express m3 - 4 + 2 + m3 + 1 - 17m as am2 + xm + v + wm3 and give v. -1 Express (3i - 3i - 3i)(-1 + 0 + 0) - 2i + 4i - i as r + gi and give g. 4 Express 12n3 + 1 + n3 + 176n*2 - 176n*2 in the form jn*3 + g + qn + wn2 and give j. 13 Express (3 - 2 - 3)(19 - 19 + 7d) + (-1 + 3d + 1)(-2 + 4 + 0) as nd + y and give n. -8 Express (0 + 3 - 1)(-3m - 14m + 3m)(m + 2m - 2m - 1) as s + om*2 + xm and give x. 28 Express -3 + 16x2 + 4x*2 + 3 as ix + yx2 + m and give y. 20 Express -1 + k - 5k + 1 as xk + i and give x. -4 Rearrange -5x + 3x - 1 - 2x*2 + 2x to y + ux2 + bx and give y. -1 Express 162w - 162w + 5w2 + 1 + 0w*3 + 2w*3 as yw + cw3 + s + tw*2 and give t. 5 Express -23s - 43s - s + 4s in the form p + zs and give p. 0 Rearrange (14 - 14 - 8g)(63g - 63g - 37g*2) to the form qg*2 + kg*3 + cg + b and give k. 296 Rearrange -k - 1 - 2 + 8 + 2k + 4k - 5k + (-3 + 0 + 1)(-2 + 2 + k) to ik + p and give p. 5 Express -116 - 2j + 116 + 6j2 - 4j*3 in the form xj*2 + d + vj*3 + lj and give x. 6 Express -4a - 9 + 8 + 5a + (-2 - a + 2)(0 + 2 - 3) as ia + y and give i. 2 Express 15x + 3x*2 + 1 - 15x + 3x3 in the form ix*3 + d + rx*2 + jx and give r. 3 Express 20b3 - 2b*2 - 7b*3 - 11b*3 - 7b*3 - 3 - b as rb*3 + yb*2 + m + cb and give c. -1 Rearrange (-1 - 3 + 3)(-348o + 460o - 220o)(o2 + o2 + 3o - o) to w + co3 + xo*2 + to and give c. 216 Rearrange 4c2 + 5c*2 + 2c2 + c2 to rc2 + jc + i and give r. 12 Rearrange -12 + 12 + 3k3 - 3 + 2 to the form sk*2 + uk*3 + ak + g and give s. 0 Express c2 + 322 + c3 - 325 - c*2 as b + wc + oc3 + vc*2 and give o. 1 Rearrange ((-2 + 3 - 3)(2s + 5s - 2s) + 2s + 5s + 0s)(-2s*2 + 1 - 1)(-1 + 1 + 2s) to ys*2 + ps*3 + r + cs*4 + ds and give c. 12 Rearrange 6d - 7d - 10d - 11d to z + xd and give x. -22 Express (4 + 1 - 3)(4d - 5d + 3d) - 3d + d + 13d in the form c + qd and give q. 15 Rearrange (4 - 9 - 3)(2 - 1 + 2)(-2 + 2 - 2d) to h + ad and give a. 48 Rearrange 1 + 0u - 1 + 30u to au + l and give a. 30 Rearrange -4w - 18w + 3w - 7w to o + sw and give s. -26 Rearrange (-3 + 8 + 0)(-2j - j + 5j + (1 + 2 - 1)(-2 + 2 + j) + 0j + 0j + j - j + j + 2j + 3j - 7j + 2j) to the form o + ij and give i. 25 Express (-3z + 13z - 8z)(z + 3z - 7z) + 3z*2 + 2z*2 - 3z*2 as kz*2 + g + hz and give k. -4 Express (21p + 5 - 5)(4p - 3p + p + 3p - 3p - 2p + (2 - 2p - 2)(5 - 3 - 1)) in the form ap*2 + z + tp and give a. -42 Express -22k + k + 11k as bk + r and give b. -10 Rearrange 2a*3 + 135a - 9a2 + 2a4 - a3 - 139a to the form ia*2 + qa*4 + r + xa + da3 and give x. -4 Express 2m*3 - 2m3 + m3 + (-2m - m + m)(4 - 4 - m*2)(2 - 8 - 2) in the form bm3 + x + fm*2 + tm and give b. -15 Rearrange -4a2 - a2 + 2a*2 + (-3 + 2a + 3)(-a + 3a + 0a) + a2 - a2 + 2a*2 - a + a + 3a*2 to the form j + ba*2 + qa and give q. 0 Express -3 + 1 + c + 2 in the form wc + y and give y. 0 Rearrange 3y*4 - 2y*4 - 2y**4 +	{ "pile_set_name": "DM Mathematics" }
59i2 + 137i*2 + 3 - 1 - 342i*2. What is n(y(x))? 8192x*4 - 640x*2 - 28 Let g(d) = -140d - 135. Let z(p) = -2873p. Determine z(g(t)). 402220t + 387855 Let v(x) = 3x. Let n = -1528 - -1530. Let y(p) be the first derivative of 1/2p*n + 12 + 0p. Determine y(v(a)). 3a Let t(a) = -a2 - 17a - 55. Let u be t(-12). Let h(g) = 5g + 9g + ug - 8g. Let p(l) = -l*2. What is p(h(b))? -121b*2 Let f(b) = 5b. Let k(t) = 2039190t2 + 4038t - 2019. Let h(m) = -2021m2 - 4m + 2. Let r(g) = 2019h(g) + 2k(g). Calculate r(f(i)). -50475i2 Let t(n) = -21874n*2 - 845n. Let p(s) = 6s2. What is t(p(x))? -787464x*4 - 5070x*2 Let i(n) = -20n. Let s(k) = 3k2 - 21k + 26. Let j be s(7). Let z(a) = ja - 16a - 15a. Calculate i(z(o)). 100o Let u(a) = 6a. Let v(x) = -48x*2 + 9x - 9. Let q(j) = j - 1. Let y(p) = -45q(p) + 5v(p). Give y(u(w)). -8640w2 Let n(z) = z + 3. Let p(s) = -3s - 8. Let i(b) = -b*3 + 13b - 9. Let m be i(3). Let h(f) = mp(f) + 8n(f). Let t(r) = -32r - 3. What is t(h(g))? 32g - 3 Let m(b) = -94b. Let o = 47622 + 83. Let f(h) = o - 3h - 47705. Determine f(m(r)). 282r Let j(q) = -4q. Suppose 5h = v + 390, -20 = -h + v + 54. Let c = h + -75. Let y(p) = 8p*2 + cp*2 + 2p*2 + 4p*2. What is y(j(i))? 288i*2 Let i(h) = h - 8325. Let g(t) = -10496t. Determine g(i(c)). -10496c + 87379200 Let h(r) be the first derivative of 1/12r*4 - 3r*2 - 14 + 0r + 0r3. Let i(z) be the second derivative of h(z). Let u(q) = 17q*2. Determine i(u(l)). 34l*2 Let r(f) = -f + 2. Let l(s) = 3418391s*2. Determine r(l(u)). -3418391u*2 + 2 Let d(q) = -2q*2 - 15q + 12462. Let o(t) = 16t2. Give d(o(n)). -512n*4 - 240n*2 + 12462 Let n(x) = -22x*2. Let u(k) = -97723k - 3. Calculate u(n(h)). 2149906h2 - 3 Let o(b) = 382b. Let s(j) = -5j - 8j + 1233 + 1240 - 2473. What is s(o(p))? -4966p Let g(v) = 2v. Let d(p) = 3p + 70. Let i(x) be the second derivative of x3/3 + 35x*2/2 + 67x. Let w(z) = 3d(z) - 5i(z). What is w(g(b))? -2b + 35 Suppose 0 = -2o + s + 2, -4o = -4s + 78 - 86. Let u(p) be the third derivative of 0 + 0p3 + 1/8p*4 - 38p*2 + op. Let b(a) = 3a. Calculate b(u(l)). 9l Let w(o) = -22092529o. Let u(t) = -2t. Calculate u(w(d)). 44185058d Let z(s) = -27346469 - 3s + 27346469. Let b(y) be the first derivative of -13y3/3 - 2. Determine z(b(h)). 39h*2 Let u(q) = 4378027q. Let h(m) = -5m2. What is u(h(w))? -21890135w*2 Let i(s) = -16s - 20s + 64s - 26s. Let g(f) = 23f - 5. Let l(m) = 45m - 9. Let d(z) = 9g(z) - 5l(z). What is d(i(j))? -36j Let z(y) = 8y + 1. Let l(r) = -405r - 54. Let o(c) = l(c) + 54z(c). Let v(k) = -2k + 3k - 2k. Determine o(v(i)). -27i Let j(w) = 63w*2. Let r(z) = -4z*2 - 178z + 10. Let q(x) = x*2 + 55x - 3. Let s(a) = 10q(a) + 3r(a). What is s(j(u))? -7938u4 + 1008u2 Let x(w) be the third derivative of -w5/15 - 4w2 - 2w + 7. Let z(o) = 119o2. Determine z(x(a)). 1904a*4 Let v(b) = 7b*2. Let a = 360 - 364. Let y(w) = 50w + 5. Let s(g) = 4g + 1. Let u(x) = as(x) + y(x). Calculate u(v(m)). 238m2 + 1 Let m(o) = -15291811o. Let a(c) = 3c. Calculate m(a(v)). -45875433v Let s(d) = 2d. Let y(k) = -2k*2 - 2114k + 944. Calculate y(s(t)). -8t2 - 4228t + 944 Let d(k) = -4k. Let u(r) = 3r*2 - 210r + 210. Let j be u(1). Let b(c) be the second derivative of -1/6cj + 0 + 0c*2 + c. Determine b(d(h)). 4h Let i(q) = 19q2. Let p(a) = 168a - 47923. What is p(i(k))? 3192k2 - 47923 Let u(m) = -27m. Let q(j) be the second derivative of 0j2 + 0 + 119j + 13/6j3. What is u(q(v))? -351v Let j(p) = -2488949p2. Let n(i) = -3i*2. Calculate j(n(z)). -22400541z*4 Let r(p) = p. Let c(m) = 109575m - 920. Let w(a) = 8429a - 69. Let j(l) = -3c(l) + 40w(l). Give j(r(d)). 8435d Let q(n) = 21n - 67. Let s(u) = -24u - 9u - 30u + 60u. Give q(s(l)). -63l - 67 Let l(x) = -x*2 - x. Let s = 54 - -62. Let j(p) = 119p - 236p + sp. What is l(j(b))? -b*2 + b Let f(c) = -c. Let k(a) = -6a - 395. Let m(l) = -13l - 649. Let q(w) = -7k(w) + 4m(w). Determine q(f(g)). 10g + 169 Let j(k) = -281k2. Let c(q) = 7q - 20. Let t(f) = -15f + 44. Let a(u) = -11c(u) - 5t(u). Calculate j(a(d)). -1124d*2 Let y(q) = -47q*2. Let u(z) = -13z*2 - 2z - 4. Let p(i) = 132i2 + 21i + 42. Let l(s) = 2p(s) + 21u(s). Determine l(y(x)). -19881x4 Let z(q) = -3q. Let b(y) = 1516432y. Calculate b(z(j)). -4549296j Let n(f) = -f + 4. Let s be -25(-5)/25 - 11. Let v(m) = 10m - 28. Let r(b) = sv(b) - 42n(b). Let t(j) = -3j. What is r(t(a))? 54a Let f(p) = -8p - 1. Let a(t) = 14t - 55t + 39t. What is a(f(d))? 16d + 2 Let o(c) = -2c. Let x(p) = -27p2 + 101. What is o(x(q))? 54q2 - 202 Let a(q) = -q2. Let t = 74 + -86. Let u be 0 - (3 - 0)8/t. Let w(h) = 7h + 6h - 15h - 18hu. Give w(a(n)). -18n*4 + 2n*2 Let f(b) = 6b - 70. Let n(o) = 8758o2 + 2o. Determine f(n(r)). 52548r2 + 12r - 70 Let g(q) = 1604q. Let x(b) = 107b + 6. Let a(i) = 303i + 17. Let c(u) = 6a(u) - 17x(u). What is g(c(p))? -1604p Let g(x) = 124x. Let y(z) = 14369z + z*2 - 7184z - 7185z + 2z*2. Give g(y(b)). 372b*2 Suppose -3j + 2v - 4 = 0, 4j - 4v + 4 = -8. Let d(i) be the second derivative of -27i - 2/3i3 + 3i*j + 0. Let s(b) = -b. Determine d(s(k)). 4k + 6 Let a(i) = i*2. Let z(u) = 670u - 222u - 191u - 228u. Give z(a(g)). 29g*2 Let s(j) = -3j*2. Suppose 6t - 21 = 15. Let y(a) = -7a2 - 3a + 3. Let f(i) = i*2 + i - 1. Let h(n) = tf(n) + 2y(n). Calculate h(s(r)). -72r4 Let w(n) = n2 - 49n. Let k(v) = -7529v. What is k(w(d))? -7529d2 + 368921d Let q(h) = -2h2. Let a(j) = 8449j*2 + 10266j. Calculate a(q(b)). 33796b4 - 20532b*2 Let l(u) = 17001975u*2. Let f(z) = -6z. Calculate f(l(k)). -102011850k2 Let o(b) be the first derivative of 1/3b*3 + 0b + 0b2 - 8. Let r(y) = -11y + 165. Let m(u) = 3. Let h(j) = -55m(j) + r(j). Give o(h(w)). 121w*2 Let d(h) = -30h - 3. Let s(r) = -796r2 + 2r + 3. Determine d(s(c)). 23880c2 - 60c - 93 Let t(h) = 4h + 5. Let s(w) = -4w - 4. Let i(d) = -5s(d) - 4t(d). Let x(a) be the second derivative of -a*4/4 - 4523a. Calculate i(x(f)). -12f2 Let g(f) be the first derivative of -52f*3/3 + 96f + 7687. Let b(r) = 2r. Give b(g(y)). -104y*2 + 192 Let l(r) = 8r*2 + 49. Let u(o) = 588o*2. What is l(u(t))? 2765952t*4 + 49 Let l(i) = 30 - 15 - 15 - 8i*2 - 3i*2. Let n(b) = -2b - 8. Let w(y) = 2y - y + 3 + 0. Let u(s) = -3n(s) - 8w(s). Give l(u(q)). -44q*2 Let k(d) = 2d*2 - 9d + 109. Let p(q) = 216q. Calculate p(k(t)). 432t*2 - 1944t + 23544 Let w(y) = 4y2 + 20. Let h(k) = -5k*2 - 30. Let p(d) = 2h(d) + 3w(d). Let j(o) = -o2 + 92o. Calculate j(p(v)). -4v4 + 184v*2 Let w(l) = 36l - 114 - 2l2 + 114 + 16l - 33l. Let m(n) = -5n. Calculate m(w(r)). 10r2 - 95r Let n(p) = 430p + 25360. Let t(c) = 3c*2. Calculate n(t(f)). 1290f*2 + 25360 Let z(w) = -34w*2 - 17w + 4w + 7w + 9w + 108w*2. Let s(k) = 12k - 7k - 6k. Give s(z(h)). -74h2 - 3h Let t(h) = 17h2. Let m be t(-1). Let n(g) = -9g - mg - 4g + 3g. Let l(o) be the third derivative of -o4/24 - 3512o*2. What is l(n(i))? 27i Let j(w) = -2w + 66. Let a(v) = -28v + 880. Let m(z) = -3a(z) + 40j(z). Let g(f) = 0f2 + f2 + 6f*2. Give g(m(t)). 112t*2 Let o(w) = 808 - 2449 + 812 - 13w + 814. Let d(k) = 41k. Give d(o(u)). -533u - 615 Let s(y) be the second derivative of -667y4/12 + 22437y. Let u(q) = q + 1. Let l(f) = -3f - 2. Let i(h) = l(h) + 2u(h). Calculate s(i(n)). -667n2 Let h(r) = -1919r. Let u(p) = -738p - 25. Give u(h(t)). 1416222t - 25 Let v(k) be the first derivative of -53k2/2 + 4. Let d(c) = 230c + 6. Let b(t) = -75t - 2. Let s(f) = -3b(f) - d(f). Determine s(v(x)). 265x Let f(t) = -4t*2. Let u(h) = -9010h*2 + 4452h + 636. Let z(i) = 99i2 - 49i - 7. Let d(n) = -7u(n) - 636z(n). Calculate d(f(q)). 1696q4 Let z(y) = 6519945y. Let f(r) = -4r. Calculate z(f(i)). -26079780i Let s(q) = -669q - q2 + 1344q - 675q + 2q*2. Let u(h) = -113h*2 - 16h - 2. Give u(s(o)). -113o*	{ "pile_set_name": "DM Mathematics" }
m + 2n, 4m - 3n - 1102 = 0. Is m a composite number? True Let x be 11/(-3)(-6)/1. Let g = 61 + x. Is g prime? True Let d = -15 - -23. Let k(p) = -p3 + 8p*2 + p - 6. Let m be k(d). Suppose q = mb + 45, -b - 3b = 16. Is q prime? True Let u be 2/(-6) + 1547/51. Suppose -3x = 2x - u. Is x a composite number? True Let s = -2591 - -4134. Is s a prime number? True Let s = 2 + 725. Is s a prime number? True Let h = 364 - 237. Is h a composite number? False Suppose -2a - 1 = -5. Suppose -3l - an = -4n + 124, -2l - 79 = -5n. Is (1/3)/((-2)/l) a composite number? False Suppose 0 = 2j + 2p - 4712, -j - j + 2p = -4716. Is j prime? True Let a(p) = 2p3 - 11p*2 + 7p - 11. Is a(10) composite? True Suppose 5x + 18 = -7. Let i = -3 - x. Is (1/1)/(i/20) a prime number? False Suppose 0n - 3n = -699. Is n a prime number? True Suppose 2l = -5b + 505 + 90, -b = 2l - 607. Let o = l + -138. Is o a prime number? True Let a(g) = 15g2 + 6g + 5. Is a(-4) a prime number? False Suppose 3 = -3m + 21. Let d(c) = -c2 + 7c + 4. Is d(m) composite? True Suppose 2k + 10 = 4f, 2k - 4 = -6. Suppose -fv + v = -2. Suppose 0 = vz - 4 - 2. Is z prime? True Let b = 48 + -17. Is b prime? True Let z be (-2)/515/3. Is -2 + (z + 4 - -25) composite? True Is (0 - -158) + (-3 - -3) + 3 a prime number? False Let u(t) = t*2 - 4t + 2. Let k be u(4). Let f be 0 + -101 - k/2. Let p = -25 - f. Is p composite? True Suppose 4i - 66 = 26. Let c be -5 - (2 + 0)-1. Is 6/(-9) - i/c a prime number? True Let t = -22 + 1089. Suppose 0 = 3v - 0v + 3, 4s - 3v = t. Let o = s + -177. Is o a composite number? False Let t = 83 + -150. Let f = 122 + t. Suppose -6x + x = -f. Is x prime? True Let r be 30/8 - (-24)/(-32). Suppose -3x + 4x + 1121 = rk, x = -2. Is k composite? False Let l(b) = -b*2 - 5b - 1. Let d be l(-5). Let u(k) = 8k3 + 2k + 1. Let c be u(d). Let j(w) = w*3 + 10w*2 + 7w + 5. Is j(c) a composite number? False Let x(k) = 4k + 3. Is x(4) prime? True Let o(b) = b2 + b + 119. Let d be o(0). Is d(-1)/3-3 a composite number? True Suppose -2x + j + 8 = -4x, 3x - 4j = -1. Is (-103 + 1)/x - -1 composite? True Is (-330)/(-4) + (-5)/(-10) prime? True Suppose 2m = 5s + 107, -4s + 2m - 89 = -3m. Let d = 132 + s. Is d composite? True Suppose 2758 + 9849 = 7p. Is p prime? True Let r(h) = h2 - 11h + 2. Suppose 0 = -g + 3g - 24. Is r(g) a composite number? True Let f(w) = 5w*2 - 3w + 1. Let x be (14 + -2)/4 - 0. Is f(x) prime? True Is 2 + 1 + -1 + 209 a composite number? False Suppose 510 = -3v - 111. Let d = v - -474. Is d prime? False Let b = 533 + -372. Is b composite? True Let v(h) = -14h + 4. Let n(r) = -r - 11. Let j be n(-6). Is v(j) a prime number? False Let j(s) = -s + 7. Let y be j(6). Let p be (15/4)/(y/4). Suppose -2z = -o + z + p, o = -z + 7. Is o composite? True Let r(c) = 9c*2 - 5c - 3. Suppose 0y + a = y - 3, 4a = y. Is r(y) a prime number? False Let n = 290 - 156. Is n composite? True Suppose -4 = -5o - 9. Let q be ((-1)/3)/(o/18). Let g(f) = 3f*2 + 3f + 1. Is g(q) a prime number? True Let t be 292(-4)/16-2. Let r = t - 81. Is r prime? False Let x(h) = 28h2 + 2h - 2. Let s be x(2). Let l = s - -112. Is l prime? False Is 4179/28 + 3/(-12) prime? True Let l(x) be the second derivative of -x5/5 + x4/4 - x*3/6 - 2x*2 + 31x. Let y = -6 + 3. Is l(y) composite? True Let b(h) = -h*3 - 4h*2 - 5h + 4. Let f be b(-6). Suppose -3q + 2 = 8, -q = -2a + 192. Suppose -3x + f = -a. Is x composite? False Suppose -4 = 3m - 10. Suppose 3d = -m + 59. Is d a composite number? False Let r be 3560/30 - (-4)/(-6). Suppose 87 = 4d - d. Let a = r - d. Is a composite? False Let y(d) = 7d + 1. Let u be y(3). Let v = 33 - u. Is 585/11 - 2/v prime? True Let u(m) = 2m*2 - 1 + 3m + 0 - 3m2 + 3m3. Is u(4) a prime number? False Let j(n) be the second derivative of n3/6 + 18n2 + 8n. Is j(-15) a prime number? False Let i(b) = 11b + 6. Let z(f) = f3 + 8f*2 - 2f - 9. Let h be z(-8). Is i(h) composite? False Let g be 0 + (6/3 - -4). Suppose -4d + 66 = -g. Suppose d = 5u - 57. Is u composite? True Suppose 13 = 3v - 0v + 2f, 14 = 2v + 4f. Let g be 12(-1)/4v. Is g(0 - 9) + -2 composite? False Let v = -178 - -513. Suppose -3b + v = -19. Is b a composite number? True Let h(j) = j2 - j + 1. Let k(p) = 2p*2 - 6p - 12. Let b(n) = -h(n) + k(n). Let v be (6/(-8))/(11/(-132)). Is b(v) composite? False Let v(h) = -h*3 - 6h*2 - 4h + 4. Let j be v(-5). Let f(x) = -40x + 1. Let u(m) = 81m - 2. Let o(a) = 9f(a) + 4u(a). Is o(j) a composite number? False Suppose 5l + 5g = 20, -g = 4l - 3 - 1. Suppose l = -w + 122 + 39. Is w composite? True Let f = 2 - -1. Suppose -8y = -fy - 10. Let j = y - -1. Is j a composite number? False Let y = 1 - -480. Is y a composite number? True Suppose 12 = 5k + w, -k = 2w + 3w + 12. Suppose -3s = 2c - 17, -s - k = -2s. Is (-1)/(-4) + 523/c a composite number? False Let i(j) = -j3 + 7j*2 - 3j - 5. Suppose -3y = -4y + 6. Is i(y) a composite number? False Suppose 3j - 515 = 112. Is j prime? False Is ((-1)/3)/((-3)/6759) composite? False Is 2/(-4) - (-766)/(-8)-2 a prime number? True Suppose 189 = -0k + k. Let o = -83 + k. Is o prime? False Is 1 + -2 + 1401 a prime number? True Let h(k) = -4k + 10 - 2k + 3k + 4k. Let v be h(-10). Suppose -3d + 100 = 5m, d + 2m + vm = 33. Is d composite? True Let g(u) = -u*3 + 8u*2 - 6u - 10. Let j be g(7). Let o be (j/(-2))/((-1)/(-2)). Suppose 5p = op + 38. Is p composite? False Suppose 4v + 35 = -v. Let f(q) = -q2 - 6q + 10. Let a be f(v). Suppose -al + 7 = -2l. Is l composite? False Let z be 141/27 + 4/(-18). Suppose zq = -9 - 6. Is q/6 - (-117)/2 a prime number? False Let c(i) = -3i*2 + 17i + 5. Let p(l) = 2l2 - 16l - 5. Let d(v) = 3c(v) + 4p(v). Is d(-10) a prime number? False Let a = -5 + 44. Is a a composite number? True Let d(m) = 5m2. Let t be d(1). Let j = t - 4. Suppose -2q + j = -49. Is q a prime number? False Suppose 3m = -0m + 1611. Suppose 121 = 2f - m. Is f a prime number? False Suppose 0 = -3w + 3 - 18, 0 = -2c - 4w + 3782. Is c composite? False Let m = -13 + 19. Suppose -mf + 3f + 534 = 0. Is f a composite number? True Suppose 176 = 5w - 4. Suppose o = -c - 23, c = 3o - 2o - 29. Let p = w + c. Is p prime? False Is (-268/8)/(3/(-15)) prime? False Suppose 3a - 2973 = -0a. Is a composite? False Let x(k) = 23k2. Let r be x(-4). Let n = r - 177. Is n a prime number? True Let o(q) = -14q*2 + 2q + 2. Let s be o(-2). Let v = -20 - s. Is v prime? False Suppose -3o - 247 + 982 = 0. Suppose 27 = -2b + o. Is b a prime number? True Let d = -92 + 213. Is d a prime number? False Let i(d) = 167d3 - 3d*2 + 2d - 2. Let k be i(2). Let p = k + -545. Is p composite? True Let g(h) = 5h3 - 2h*2 + 2h + 4. Let x = -3 - -4. Let d be (x + -4)/((-3)/3). Is g(d) a composite number? False Suppose 5q = -4t + 2901, -3t = -0q + 2q - 1159. Is q a prime number? False Suppose 2s - 3 = s + 5f, f = -3. Is ((-8)/s)/((-4)/(-1110)) a composite number? True Let r = -4 + 4. Suppose 0h - 2h + 6 = r. Suppose 183 = hq + 24. Is q a composite number? False Suppose 2y - 4p = 159 + 75, -y - p = -129. Let h = -6 + 6. Suppose y = 5z - hz. Is z composite? True Suppose 11 + 4 = 3d, -3f = -2d - 761. Suppose -5c = 2q - f, -c + 4c - 2q = 167. Is c prime? True Suppose 4p - 637 = 5a, -7a + 133 = p - 3a. Suppose 0 = -j + p + 178. Is j a composite number? False Let h = 0 + -15. Let k be h/6 - (-6)/4. Is 57 + 2 + k + 1 a prime number? True Suppose 14 = 5m - 61. Let a = m - 10. Suppose -av = 5r - 2v - 5, -5v - 21 = r. Is r composite? True Suppose 6k = k + 380. Suppose 2h - k = -2q - 0h, 32 = q - h. Let z = -20 + q. Is z a prime number? False Let j(g) = 5g3 - g2 - g + 1. Let y be j(1). Suppose -5s + 1 = -ys, 3s = -2m + 121. Is m composite? False Let o = -55 + 182. Is o a prime number? True Is ((-2201)/(-4) - -4)/(12/16) composite? False Suppose -3x + 13 = -3h - 5, -2x + 15 = -5h. Suppose 5l - 41 = -0l - 4i, 3l + x = 5i. Suppose -lt = -3t - 46. Is t a composite number? False Let u(i) = i*3 + 5i*2 + 3i - 5. Let q be u(-4). Is	{ "pile_set_name": "DM Mathematics" }
- h = 6 for a. -1 Let r be 2/7 - (-18)/(-14). Let f = 6 + r. Suppose -v = 5t - 5v - 21, -3t + 17 = 2v. Solve 2i - 5n = 0, 0 = -i + tn - 0n + f for i. -5 Let x(h) = 46h + 94. Let m be x(-2). Solve -2i = w + mw - 16, 0 = -5i - w + 27 for i. 5 Let a = 479 - 476. Solve 10 = t + 3s, as - 7s + 17 = 5t for t. 1 Let w = -2 + 6. Suppose 5x - 27 = -4o, -6 = 2o - 8x + wx. Suppose 0 = -om - 2m + 55. Solve -f - 3f = -k + 8, -3k - f + m = 0 for k. 4 Let g be (-11 + (-4 - -16))/(1/4). Solve 10 = 4l + 4b - 6, g = -3l + b for l. 0 Let k(o) = 11o - 2o - 43 - 7o. Let u be k(24). Solve 3b = -0b + a - 11, 0 = -2b + ua - 29 for b. -2 Let x(d) = -d3 + 31d*2 - d + 57. Let p be x(31). Solve -l = 2r + 4, r = -4l + 10 - p for l. -4 Suppose b - 4b + 9 = 0. Solve -2x = 4o - 16, -bx = 2o - 5o + 3 for x. 2 Suppose p + 60 = 4p. Let o(h) be the first derivative of h*2 + 5h - 3. Let r be o(0). Solve 5m + 8 = 3m - 4c, -5c + p = -rm for m. -4 Suppose 4a = 4n + 44, -12 = -5a - 4n + 52. Let q = -4 - -7. Solve qs + a = 0, 2 = d - s - 0 for d. -2 Let n be (-4)/6 + (-16)/(-24). Let t(h) = -h + 7. Let d be t(10). Let o be 6 + d - 0/1. Solve -of = -5c - 7, 2c - 5f + 18 = -nc for c. 1 Suppose -y = -3q + 9, -4y + 17 + 27 = 4q. Solve 4v = 4g + 16, 4v + yg - 2g = 0 for v. 2 Suppose -5b + 0 = -15. Suppose -14 = -4n - 3v, 4n + v = 8 + 10. Let y = -540 + 540. Solve bd + 5a = y, d = -2d + na for d. 0 Let j(q) = -8q*2 + 29q - 15. Let z be j(3). Suppose 2m - 1 - 3 = 0. Solve -1 - 3 = 2r + 2n, z = mr + n + 3 for r. -1 Suppose o = -4 - 9. Let b(z) = z*3 + 12z*2 - 12z + 19. Let w be b(o). Let g be ((-1)/(-2))/(1/10). Solve -gi - 4j - 21 = 0, 4 = -2j + wj for i. -5 Let h(g) = -g - 9. Let y be h(-9). Suppose -s + 21 - 3 = y. Let x = -18 + s. Solve 0d + 4 = -4d, x = 2f - d - 7 for f. 3 Suppose 0 = 7f - 11f - 28. Let i be (7/f)/(2 + 15/(-6)). Solve -h + 7 = 2a, -ia - 5h + 23 = 4 for a. 2 Suppose 0 = -9k + 4k + 75. Let q be 32/(-20) - 6/k. Let c be (-14)/28 - q/4. Solve -5o - 3x + 5 = c, -7x - 1 = -o - 3x for o. 1 Suppose -11 = 3t - 119. Suppose -t = -15c + 9. Solve n - 5 = -0, -3f = cn - 15 for f. 0 Let m(r) = 3r2 - 5r + 3. Suppose o - 3 = 4i, -o = 5i - 6i - 3. Let z be m(o). Solve 0b + z = -b - 2a, 5 = -3b + 2a for b. -5 Let i = -351 + 353. Solve v - 25 = -5q, iq = 2v + 3q - 5 for v. 0 Suppose x - 352 + 349 = 0. Let m = -16 - -16. Suppose -3v + 0v + 27 = m. Solve 2o + o = -3b - 9, -v = -b + xo for b. 0 Suppose 2k + 5t + 2 = 4t, -5k - 4t = 11. Solve k + 0 = -p, 5f - 4p = 29 for f. 5 Let b(p) = p2 + 41p + 269. Let g be b(-33). Suppose 0 = -2t - 2, -4n - t + 5t = -4. Solve -3i + gu - 35 = n, 5u = 3i + 2u + 27 for i. -5 Suppose -3h = p - 10, -4p - 3 = 3h + 2. Suppose ha - 6 = 4. Let l be 1 + (-1)/(-1) + a. Solve 4q + 4 = -lf + 16, -2q + f = 3 for q. 0 Suppose 145 = -q - 2s, q + s + 143 = -0s. Let g = -125 - q. Solve -3b - 1 = 3j - g, 0 = j - 1 for b. 4 Let l(y) = -4y*2 + 26y - 12. Let x be l(6). Solve s - b = -3s, x = 5b - 20 for s. 1 Let p = 321 - 318. Solve 5h + 2f = 22, -ph + 9 = -0h - 3f for h. 4 Suppose 5d - 5k = 45, -2k - 3k + 11 = 2d. Let s = -197 - -197. Suppose s = -f + 5f - d. Solve 4l - b = fl + 1, 3b + 9 = 3l for l. -2 Let v = 3 - -2. Suppose 6 = 3u + 2l, -4u + 5u + v = -3l. Solve 3a + uh + 18 = a, -4a - 16 = 3h for a. -1 Suppose -2s + 8 = -4c, 0 = 3s + 2c - 45 + 9. Solve g - 3j = -4 - s, -20 = 5g - 5j for g. 1 Suppose -j + 5v - 4 - 4 = 0, -3j + v + 4 = 0. Solve -5k = -4r + 4, 1 = jr - r + 4k for r. 1 Suppose -13q = -18q + 35. Solve c - 3m - q = 1, m = -1 for c. 5 Let o be 8 - (-2)/(2/(-3)). Let h = o + -4. Solve -j + 16 = -3l, -3l + 2l - h = 4j for l. -5 Let u(s) = -9s - 6. Let j be u(-1). Suppose b + 5 = y, jy - b - 7 = -2b. Solve -4g = -ym - 18, -g = -1 - 2 for m. -2 Let c(n) = n - 3. Let w be c(4). Suppose w = -4f + 5. Let i be (f + -2 + -1)-1. Solve 0 = -3y - 3a + 15, 0 = y + a - ia - 1 for y. 3 Suppose 8u - 3u + 3h - 117 = 0, -4u - 5h + 91 = 0. Let m(o) = -2o + 52. Let y be m(u). Solve -5d - yc = 0, -2c = -d + c for d. 0 Let r be -1(0 + (4 - 5) + -3). Solve r = d + 5v, 2d = 5v - 3 - 4 for d. -1 Let k(l) = -7l - 7. Let a be k(-1). Solve -4f + 2t + 16 = a, 0f - 4t = f - 4 for f. 4 Let i be 8/3 - 13/(-39). Let o be (-3 + (9 - 4))i/2. Solve 0 = -4s, -ok - 5s = -s + 12 for k. -4 Suppose g - 15 = -2g. Suppose 0 = -2v - 4h + 8, gv - 4h - 4 = v. Solve -2u + l = 4, vl + 8 = 5u + 4l for u. 0 Let c(s) be the second derivative of -s5/20 + s4/12 + s3 + 3s*2/2 - 18s. Let i be c(3). Solve -ib + 4 = -4x, b - 5x - 5 = -0 for b. 0 Let t be 2/6 - (-392)/12. Suppose -28o + to = 60. Solve -4k = 4u, 5k + o = 2k for u. 4 Suppose -5d + 4d = 5b + 3, -5d - 15 = b. Let c be (((-20)/3)/(-5) - 1)b. Solve c = -4i - 5a + a + 8, -4a + 8 = 5i for i. 0 Let s = -29 - -29. Suppose s = -5p + 7 + 13. Let y(q) = -q3 - 4q*2 + 3q - 7. Let m be y(-5). Solve -pd - 4r = -24, md + 2r + 0r - 14 = 0 for d. 2 Suppose -6u + 26 = 2. Solve c + 1 = -4d + 11, -d - 6 = -uc for c. 2 Let u(m) = 6m - 2. Let l(y) = 11y - 3. Let r(b) = -3l(b) + 5u(b). Let s be r(-2). Let x be 3 - ((s - 2) + -16). Solve z = 4t + 3, 4z + t = x - 4 for z. 3 Let s = 15 - 11. Suppose -o + 80 = so. Suppose i - 2i + o = 0. Solve -2 - i = -5u - 4l, 10 = 5l for u. 2 Let k be (-7)/14 + 35/(-2). Let o be (-3768)/54 + 4/k. Let t be 20/o - 65/(-7). Solve -2q - 2 = 2z, z - 2q + 5q = -t for z. 3 Suppose -37c + 68 = -20c. Solve 3y - 9 = 0, -cy + 0y = -k - 17 for k. -5 Let x be 20/22(-165)/(-30). Solve q + d + 0 = -3, 2q + 3d + x = 0 for q. -4 Let s = 27 - 27. Solve k = -u - 1, 0 = -sk + 2k - 5u - 12 for k. 1 Let w be ((-96)/(-216))/((-6)/(-27)). Solve 10 = 5d, wh - d - 6 = d for h. 5 Suppose 20j + 30 = 90. Solve 4d + 16 = -jp - 1, -d + 3p = 8 for d. -5 Let b = -627 + 629. Solve -5k - b + 0 = 4n, 2k - 3n + 10 = 0 for k. -2 Let d = 32 + -29. Suppose 7u = du + 4. Let h be 1 + (5 - 2) + u. Solve -4r = -hn + 30, 3n + 2n + r - 5 = 0 for n. 2 Let q = 20 - 13. Suppose 6v = qv - 5. Suppose 3g + 4m = 11, -vm = g - 15 + 4. Solve 9 = 5a + 34, 0 = -2c - a - g for c. 2 Suppose -18 = -2q + 5n - 23, 0 = -3n + 9. Solve 4 = -k - i, -i = 3k - qk + 4 for k. 0 Let r be (-6)/(-2) + (-1 - -3). Let h(q) = -q*2 + 6q - 3. Let v be h(r). Suppose -d = -vd + 12. Solve 5c + 4g - 7 + 2 = 0, c + 3g - d = 0 for c. -3 Suppose 0 = -0s + 3s - 9. Suppose 27 = 3c + 3x, -c + sx + x - 16 = 0. Solve 3d = cn - 12 - 10, 4n = 4d + 24 for d. -2 Let j(b) = -b3 + b2 + 2. Let r be j(5). Let t = 57 + r. Let q = -27 - t. Solve 5 = 2w + x + q, 0 = -x - 3 for w. -3 Let k(w) = -107w3 + 7w*2 + 0 - 2 + w + 106w*3. Let a be k(7). Solve -2b = 4x + b + 3, -ax - 4b = 5 for x. 3 Let r be 6/4 + 7/14. Suppose -3x = -7x - ri + 54, 2x - 2i - 18 = 0. Solve 3a - 2t = 4, 0 = -4a + 2t - t + x for a. 4 Let l(p) = -7p3 + 2p*2 + p. Let g be l(-1). Suppose -gx + 15 = -17. Solve xd + t + 6 - 20 = 0, 0 = -3d - 4t + 17 for d. 3 Let p = -223 - -225. Solve -11 = -4z - 5t - p, -4z - 2t = -6 for z. 1 Let n = -22 - -19. Let d be 1/((1/n)/(-1)). Solve -c - 7i = -di + 4, 4i = -4 for c. 0 Let y(o) = 10o2 + 25o + 1. Let k be y(-3). Solve -3d = b - 11, 3b = 4d + 4b - k for d. 5 Let w be -108/(-160)6. Solve -3t + 2v + 4 = 0, -3t + 8 = -wv + 5v for t. 2 Suppose -2z + a - 4a = 6, 2a + 4 = 2z. Solve 3k = -3r + 21, z = 4k - 0r + 5r - 32 for k. 3 Suppose -32 = -425c + 417c. Solve -2w + 2f = -2f - c, 0 = -2w + 2f + 2 for w. 0 Let f be (14/(-2))/(49/(-14)). Solve -f + 0 = i, d = -3i - 5 for d. 1 Let x = -68 + 69. Suppose 2b - x - 3 = 0. Solve 0 = 3q + n - 4, -5q + 2 = -5n + bn for q. 1 Suppose -3c + 2 = -2x, -3x + 8x - 21 = c. Suppose 10 = 7s - xs. Let k = 40 + -12. Solve 0 = -a + sz - k, 3z = a + 2a + 24 for a. -3 Let m be ((-268)/(-2))/(1 - (5 + -3)). Let o = -120 - m. Solve 0 = 2l + 4s + o, 5s - s = -l - 15 for l. 1 Suppose 3x - 4 = 5c + 7, 0 = -4x + 4c + 12. Solve -15 = 5j, -6a + 4a - 4*j = x for a. 5 Let c b	{ "pile_set_name": "DM Mathematics" }
ivative of -45091g5u*3 - 36g*2u*3 - 4640g + 86u3 wrt g? -901820g*3u*3 - 72u*3 What is the second derivative of -3484o*4 + 51o*3 + 209o + 1119 wrt o? -41808o2 + 306o Find the second derivative of 2u2z*3 - 3884u*2z - 16u2 + 147uz3 - z3 + 2877z wrt u. 4z3 - 7768z - 32 Find the second derivative of -18u3 - 588u*2 - 129806u wrt u. -108u - 1176 What is the second derivative of 4u*3 + 2635u*2 - 20224u wrt u? 24u + 5270 Find the third derivative of -29128jr3 + 1170jr + 13r*2 wrt r. -174768j Find the third derivative of 7rx*3 + 6010rx2 + 615x6 + x2 wrt x. 42r + 73800x*3 Find the third derivative of -465323u*3 + 1347475u*2 wrt u. -2791938 Find the third derivative of 145g*3t*3z*3 - 153g*3t*3 - 2g*2t*2z + 102gt*3z*3 - 2gt3 - 15gtz*3 wrt g. 870t*3z*3 - 918t*3 Find the third derivative of -13a*3kq - 17888a*3q - 71a2 - 9ak - kq + 84k - 2q wrt a. -78kq - 107328q What is the derivative of 1242h*2z - 12594h2 - 253z*4 + 50 wrt z? 1242h*2 - 1012z*3 What is the first derivative of -22010w + 22690? -22010 Differentiate 1285660pz*2 + 2085826z*2 with respect to p. 1285660z*2 What is the derivative of -26n*3 + 65n*2v*2 - 7v*2 + 4209v - 2 wrt n? -78n2 + 130nv2 What is the derivative of -45299k + 11046? -45299 Differentiate 4319uz*3 - 9uz2 - 15z*3 - 1317z*2 with respect to u. 4319z*3 - 9z*2 Find the third derivative of -2q*3s*3 + 2q*3 + 40q*2s*3 + 2qs2 - 4072s*3 - 101408s wrt s. -12q3 + 240q*2 - 24432 What is the second derivative of -273973s*3 + 1340428s? -1643838s Find the second derivative of 568084n*3w*2 + 72n*3 + 4281n*2w wrt w. 1136168n3 What is the third derivative of z6 - 2z*5 - 7764z*3 + 6z*2 - 9904 wrt z? 120z*3 - 120z*2 - 46584 What is the third derivative of 487137g*4 + 5g*3 - 1564281g*2? 11691288g + 30 What is the first derivative of 2cj*3 + 18cj2 + 2cj - 152c - 897j3 - 10j - 30 wrt c? 2j3 + 18j*2 + 2j - 152 Find the third derivative of -309v5 + 13v*4 + 2v*3 + 993944v*2 wrt v. -18540v*2 + 312v + 12 Find the third derivative of -2419508d6j*2 - 3848d*2j - d*2 + dj*2 - d - 5 wrt d. -290340960d*3j*2 Find the third derivative of bc*5 - 454bc2 - bc + 2b - 53c*5 - 669c3 - c2 + 17 wrt c. 60bc*2 - 3180c*2 - 4014 What is the third derivative of 329298q*3r*3 + 214q*2r*2 - 4q*2 + qr*3 + 57r*2 wrt q? 1975788r*3 What is the third derivative of 2186a*4 - 39807a*2 wrt a? 52464a Find the first derivative of -f*3 + 31f*2 + 14f + 81117 wrt f. -3f2 + 62f + 14 Differentiate 984946t3 + 684738 with respect to t. 2954838t*2 Find the second derivative of 15313k*4 + 16k*3 + 182k - 2266. 183756k2 + 96k What is the second derivative of -205p2x*2 - 24836p*2x wrt x? -410p2 What is the second derivative of 3m*3r*2 - 823m*3 - 28m*2r + 30131r3 wrt r? 6m*3 + 180786r Differentiate 3048382m + 1295405 wrt m. 3048382 Find the third derivative of 2no3t - 105no*3 + no*2 - 10nt - 17o*3 - 1118o*2t wrt o. 12nt - 630n - 102 Find the first derivative of 50514t*2 - 47485 wrt t. 101028t What is the second derivative of 2k3v3 + k3v + 665k*2v*2 + 7kv3 - k - 13v*3 - 2 wrt k? 12kv3 + 6kv + 1330v*2 What is the first derivative of -235976q*3 - 1112660? -707928q*2 Differentiate -11c*3s*2 - 13c*3 - 5c*2 - c + 32405s*3 - 44 wrt s. -22c*3s + 97215s2 Find the third derivative of 1595134p*2s*3 + 96p*2s*2 - 5794s*2 wrt s. 9570804p*2 What is the derivative of 11h*4o*3 + 355h*4 - 281614o*3 wrt h? 44h*3o*3 + 1420h*3 Find the second derivative of 1782456t*2 - 1482756t. 3564912 What is the second derivative of -119999ly*2 - 4627ly - 46l + 8y2 wrt y? -239998l + 16 Find the second derivative of 1565d5 - d - 3538 wrt d. 31300d*3 What is the second derivative of 436j*2x*3 + 8j*2x*2 + 2j*2 - j + 47x*3 + 6x - 3 wrt j? 872x3 + 16x*2 + 4 Differentiate 1353x*2 + 7x - 218662. 2706x + 7 What is the first derivative of -530n*2v2 + n2v - 10nv2 + 2v*2 + 2v + 59489 wrt n? -1060nv*2 + 2nv - 10v*2 Differentiate -3k*3 - 8k*2 - 46k - 121752. -9k2 - 16k - 46 Find the second derivative of 2276j2q*2 + 5j*2q - 20jq*3 - 44jq + 104j wrt q. 4552j2 - 120jq Find the third derivative of -15z*4 - 11135z*3 - 84z*2 - 335 wrt z. -360z - 66810 Differentiate 49p3s - 2p3 - 11p*2s + 2ps + 3s - 32745 with respect to s. 49p*3 - 11p*2 + 2p + 3 Find the third derivative of -3g6 - 636g*5 - 26578g*2. -360g*3 - 38160g*2 Find the third derivative of -79966l*3 - 7l*2 - 346. -479796 What is the third derivative of -2pv4 + 221pv3 - 136pv2 - 2pv + 345p - 35v4 + v3 - 2v*2 - 15v wrt v? -48pv + 1326p - 840v + 6 What is the second derivative of 39145i2 + 62861i? 78290 Find the first derivative of -2u4 - 97604u - 2304329. -8u3 - 97604 Find the second derivative of -114f*3u + 46f3 + f2u*2 + 50fu2 - 3fu + 5f + 3u2 wrt f. -684fu + 276f + 2u2 What is the third derivative of -70956m*4 + 52501m*2? -1702944m Find the second derivative of 22310u2 + 9u + 5868 wrt u. 44620 Find the third derivative of -29k3n*3 + 2k*3n*2 + 17k3 - k2n + 4kn + 38n*3 - 4n*2 wrt k. -174n*3 + 12n*2 + 102 Find the second derivative of -17839s*5 + 8s*2 + 4420579s. -356780s3 + 16 What is the second derivative of 58718s*5 - 4s + 4312? 1174360s3 Differentiate 3j*4 - 8j*3 - 682j*2 - 3j + 4680290. 12j3 - 24j*2 - 1364j - 3 Find the third derivative of -26607y5 + 40515y*2 wrt y. -1596420y*2 What is the third derivative of -119434z*6 + 1203176z*2? -14332080z*3 What is the third derivative of 112c*6 + 40c*3o - 10c2o - 3co - o + 41 wrt c? 13440c3 + 240o What is the third derivative of -35k5 - 1309k*4 - 92720k*2 wrt k? -2100k*2 - 31416k Find the third derivative of -2671884f3 - 2f*2 + 67235f + 2 wrt f. -16031304 Find the third derivative of -3bns3 - 354bns*2 - bs*3 + 11bs + 126ns3 + ns*2 - 2n - 5s3 wrt s. -18bn - 6b + 756n - 30 Differentiate -38107y*2 - 36046. -76214y What is the third derivative of -11cov4 + 2cov*2 + cov - 2cv4 + 29000cv3 + 11cv2 - 211ov2 + v2 wrt v? -264cov - 48cv + 174000c Find the third derivative of 55f*4u*2 - 18f*4u - 4f3u - 23f2u2 - f2u + 49fu2 - 2f + 16u2 wrt f. 1320fu2 - 432fu - 24u Find the third derivative of -48528d6 - 9d*2 + 2758 wrt d. -5823360d*3 Find the second derivative of 2p*3 + 73449p*2 - 557027p. 12p + 146898 Find the first derivative of -39f*3 + 6f*2 + 8f - 36710 wrt f. -117f2 + 12f + 8 What is the second derivative of -305175m2t + 62mt - 430m + 2t wrt m? -610350t What is the second derivative of 2l*3p*4 + 2l*3 + 137l*2p*5 + 21076lp wrt p? 24l*3p*2 + 2740l*2p*3 Find the third derivative of 47892x*6 + 20x*4 - 508837x*2 - 2x wrt x. 5747040x3 + 480x Find the second derivative of -35925u3 - 2014u + 7 wrt u. -215550u Find the first derivative of 3h*2k*2 + 4633h*2q*3 - 22k*2 - 214kq3 + 9q*3 wrt k. 6h*2k - 44k - 214q*3 What is the third derivative of -259170j*3s*2 + 38929j*2s*2 wrt j? -1555020s*2 What is the second derivative of -20d*2h*3 - 542d*2h + dh3 - dh*2 - 9769h*3 wrt d? -40h*3 - 1084h What is the first derivative of -4k3 - 129712k - 210961? -12k2 - 129712 What is the second derivative of 45420n*2 + 27442n - 2 wrt n? 90840 Find the third derivative of q*4 + 14307q*3 + 218208q*2. 24q + 85842 What is the third derivative of 349027r5 - 7r*2 - 3492r? 20941620r2 Find the second derivative of 70578g*4 - 2g*3 - 3g*2 - 25383g + 27 wrt g. 846936g2 - 12g - 6 What is the third derivative of -7y5 + 225439y*4 - 3y*2 - 362849y? -420y2 + 5410536y Find the third	{ "pile_set_name": "DM Mathematics" }
(g) be the first derivative of -g*2 + 6g - 749. Let l = 16 + -11. Determine k(l). -4 Suppose -5i = -2m + 49, -4m + 5i = -21 - 52. Let s(v) = -v*3 + 16v*2 - 49v + 17. Calculate s(m). 5 Suppose 0 = 6p - 5p - 9. Let z = p - 3. Let n(m) be the second derivative of m*5/20 - 7m*4/12 + 2m*3/3 + 2m*2 + 12m. Give n(z). -8 Suppose -26 = -f + k, k + k + 29 = f. Let v = 16 - f. Let h(d) = -d*2 - 6d + 9. Determine h(v). 2 Let l = 54 + -55. Let r be ((0 + 0)/l)/(4 - 2). Let z(m) = -m. Calculate z(r). 0 Suppose 3i = z, 4z = -i - i. Suppose z = -0x - 2x + 6. Suppose 4a - a + xq = -6, -a = -5q - 16. Let b(l) = 3l - 1. Calculate b(a). 2 Let j(l) be the first derivative of l*3/3 + 11l*2/2 + 4l + 32. Give j(-12). 16 Let n(w) = -w*3 - 54w*2 - 107w - 162. Let i be n(-52). Let o(z) = z*3 + 4z*2 - 11z + 4. What is o(i)? -2 Let o = 9 + -6. Suppose 2h + 5 = -oh. Let m(d) = 11d2 - 5. Let q(g) = -g2 + 1. Let a(y) = -m(y) - 6q(y). What is a(h)? -6 Let o(f) = f - 13. Let x be (37/(-148))/(1/(-20) + 0). Suppose 2c - xc - 8 = 4i, -5c - i - 2 = 0. Calculate o(c). -13 Let v(w) = -5w2 + 8. Let l(n) = -2n*2 + 1. Let p(r) = 3l(r) - v(r). Determine p(-4). -21 Let x(d) be the second derivative of -d*4/12 + 13d3/6 - d2 + 71d - 3. Calculate x(9). 34 Let x(j) = j2 + 4j. Let q be x(-2). Let l(i) = 3i2 + 6i - 20. Let y(r) = -r*2 - 2r + 7. Let f(p) = -4l(p) - 11y(p). Determine f(q). -5 Let a(b) = -b + 22. Let u be a(-12). Let p = 30 - u. Let h(r) = -r*3 - 6r*2 - 7r - 4. Give h(p). -8 Let f(o) = -3o - 5. Let p(r) = -r. Let t(i) be the first derivative of 3i*2/2 + 6. Let z(a) = 4p(a) + t(a). Let u be z(4). Determine f(u). 7 Let z(m) be the second derivative of 35m4/12 + m3/6 + 266m. What is z(-1)? 34 Let x(j) be the first derivative of j*3/3 - 4j*2 + 9j + 31. Let p be (-3 + 2)/((-1)/6). Let b(k) = -k*3 + 6k*2 + 8. Let d be b(p). Give x(d). 9 Let x be 21(0 + (-6)/(-2)). Let z = 63 - x. Let c(d) = -d*2 - 4. What is c(z)? -4 Let a(m) = 169m + m*3 + 168m - 499m + 166m + 4m2 + 4. Calculate a(-3). 1 Let h(l) = l2 + 3l - 2. Let j be h(1). Suppose -jy + y = 0. Let a(z) = -z - z3 + 2 - 3z - 3 + 5z. Determine a(y). -1 Let s(b) = 3b + 2. Let n(u) = -14u - 7. Let y(g) = n(g) + 5s(g). Give y(10). 13 Let h(c) = -c*3 + 4c*2 + c - 5. Let i be (5/2)/((-4)/(-16)). Let j be 38/i + 9/45. What is h(j)? -1 Suppose 0 = -2a + 12 - 22. Let d(h) = h + 3. Calculate d(a). -2 Suppose -4g + 3s = -82, -s + 18 = g + 1. Suppose -ga + 15a = -8. Let v(h) = -2h3 + 2h2 + 1. Give v(a). -7 Let n(r) = r3 + r*2 - r - 3. Let s be 0(-1 - -4)3/(-9). Determine n(s). -3 Let v(w) = -w3 - 5w*2 + 7 - 7w - 1 + 2w3. Let x(p) = -p3 - 5p*2 - 6p - 2. Let s be x(-4). Calculate v(s). 0 Let g(f) = f*3 + 9f*2 + 9f + 2. Let q be ((-8)/24)/(11/24). Calculate g(q). -6 Let p(z) = -2z*3 - 3z*2 + 3z - 3. Let v(l) = -4l3 - 7l*2 + 7l - 8. Let o(g) = -5p(g) + 2v(g). What is o(-1)? -1 Suppose z - 5 + 45 = 0. Let k = 300 + z. Let h be k/(-39) - 1/3. Let w(t) = t - 1. Give w(h). -8 Let w be 2/(-2) - 3 - -8. Let q(y) = y*3 - 4y2 + y - 6. Calculate q(w). -2 Let w(a) = -a3 - 4a2 + 6a + 7. Let k be (2 + 1)/(-6 + 27/5). What is w(k)? 2 Let v(d) be the first derivative of 13 - 1/3d3 + 2d*2 - 4d. Give v(6). -16 Suppose 9i - 1 = -19. Suppose -4w + k - 4k = -8, 3k - 2 = -w. Let a(z) = z - z - 3 - wz + 1. What is a(i)? 2 Let q = 1 - -3. Let n(v) = -4v - 1. Let f(s) = -11s - 3. Let m(y) = -3f(y) + 8n(y). Let a(o) = o2 - 2o. Let p(g) = a(g) - 3m(g). Give p(q). -7 Let k be (-24)/(-9)9/6. Suppose 7 - 3 = kt. Let v(y) = 2 + t + y + 5 - 3y. What is v(6)? -4 Let p(a) = a*3 - 10a*2 - 6a + 12. Let s(i) = -i*2 + 1. Let j(b) = p(b) - 6s(b). Determine j(5). 1 Let f(u) = u*2 + 2u*3 + 2 + 5u - 5u + 2u*3 - 3u*3. Calculate f(0). 2 Let g(o) = 4o*2 - 2o*2 + 11 + o - 2o*3 - 6 - 7. Calculate g(1). -1 Let f(r) be the first derivative of -4r + 1/20r5 + 8 - 4r*2 + 7/12r*4 + 7/6r*3. Let y(l) be the first derivative of f(l). Determine y(-6). -14 Suppose 0 = 4d - 2t - 26, 5d + 2t - 25 = -6. Let k(a) = a - 3. Let n be k(d). Let u(o) = 5o - 1. Calculate u(n). 9 Let x(z) be the second derivative of z*4/12 + 4z*3/3 + 3z*2 - 2z - 14. What is x(-9)? 15 Suppose -o - 11 = -3m, 4m - 10o + 15o = 40. Let a(c) = -c*3 + 4c*2 + c + 7. What is a(m)? -13 Suppose 5d + 4s = -0 - 5, 23 = d - 4s. Suppose dj = 3 - 12. Let x(c) = c2 + 6c + 4. Give x(j). -5 Let z be (2 - 0) + (-6 - 0). Let d(j) = j3 + j2 - 5j + 1. Let m be d(2). Let o(a) = 2a2 - a2 + 2 - a*3 - 3 + ma - 4a2. What is o(z)? 3 Let j(t) be the first derivative of -t3/3 + 3t*2 - 3t + 1. Suppose 3f = 4f - 3. Suppose -h + 4v + 8 = 0, 0 = -fv - 3 - 0. Determine j(h). 5 Let p(g) = -g - 2. Let o(h) be the third derivative of h*5/30 + 3h*4/8 - 3h*3/2 + 12h2. Let a be o(-5). What is p(a)? 2 Let g(s) be the second derivative of -s5/20 + s4/4 + s3/3 + s*2 - 7s. Let p = 22 - 18. What is g(p)? -6 Let d(h) = h - 3. Let c be ((-10)/6)/((-925)/60 - -15). Suppose -j + 8 = j. Suppose cl = 3l + j. Give d(l). 1 Let r(v) be the first derivative of -v*4/24 - 7v3/6 - v2 - 9. Let s(g) be the second derivative of r(g). What is s(-7)? 0 Let i(v) = -3v3 - 91v*2 + 92v + 142. Let f(h) = h*3 + 31h*2 - 31h - 47. Let u(z) = 8f(z) + 3i(z). Give u(-26). -2 Suppose 4t - 6t = -14. Let p(n) = -4n2 - 3n*2 - tn*2 + 15n*2. Suppose -2z + 0 + 4 = 0. Determine p(z). 4 Let t(b) be the third derivative of -b6/180 + b4/6 + b*2. Let d(l) be the second derivative of t(l). Calculate d(-2). 8 Let f(h) = 8h + 9. Let c = -609 - -607. Determine f(c). -7 Let j(y) = y*2 + 35 - 62 + 2y + 26 + 13y2 - 31y2. Determine j(1). -16 Let w(u) = u3 - 6u2 + 8u + 5. Let r(y) = y*2 + 2y + 4. Let g be r(-2). Give w(g). 5 Let u(w) = 14w2 - 25w - 2. Let t(h) = -3h2 + 6h + 1. Let p(v) = 9t(v) + 2u(v). What is p(-4)? 5 Let j(h) = h*2 + 2h*3 - 12h*2 + 13h*2 + 0h2 - h. Give j(2). 22 Let y(z) be the first derivative of z3/3 - 9z2/2 + 7z - 117. Calculate y(6). -11 Suppose -5l - 4c - 30 = -10l, 0 = 3c + 15. Suppose 0 = -2u + 5d + 21, -2u + d + 2 + 7 = 0. Let s(v) = -4 + u - 1 - 2v + 3. Determine s(l). -3 Let m(i) be the first derivative of 3i2/2 + i + 4. Let y(p) = 2 - 1 - 3p*3 - 12p*2 + 2p*3. Let z be y(-12). Determine m(z). 4 Let r(o) = -o + 9. Let q be r(7). Suppose 0 = -qi - 2j + 18, 3i + 3j = 5j + 2. Let w be ((-3)/i)/(2/16). Let d(p) = -p*2 - 7p - 2. Give d(w). 4 Suppose -5t = -4o - 4, 5t - 4t - 2o + 4 = 0. Let h(n) = -4n + 1 - 3 - 4. Let z(m) = m. Let r(c) = h(c) + 6z(c). Determine r(t). 2 Let s(q) = 37 - 28 - 4q - 2q2 + 3q*2 - 19. Determine s(5). -5 Let z(p) = -176p - 179p + 357p - 6. What is z(-6)? -18 Suppose 14 = 72t - 70t. Let r(k) = 8k - 2 + 3k*2 - tk*2 + 2k2. Determine r(6). -26 Let g(q) be the second derivative of q3/6 + q*2/2 + 59q. Calculate g(7). 8 Let p(g) be the first derivative of g4/4 - g3 + g2 - 11. Let x(f) = -f3 - 8f2 - 6f + 9. Let i be x(-7). Give p(i). 0 Let v(d) = -d - 18. Let s(y) = -9. Let o(r) = 10s(r) - 4v(r). Calculate o(8). 14 Suppose -4v = -3n + 3 + 8, -5n + 4v = -29. Let c(z) = z*3 - 10z*2 + 10z. What is c(n)? 9 Suppose -3b + 3n + 18 - 3 = 0, -22 = -5b + 4n. Let u be 4 + (0 - b - -2). Let i(t) be the third derivative of t5/60 - t4/6 + 35t2 - 2. What is i(u)? 0 Let q(h) = -28h2 + 8. Let a(i) = -i2. Let r(j) = 20a(j) - q(j). Let y(n) = 9n*2 - 7. Let u(z) = -6r(z) + 7y(z). What is u(1)? 14 Let b be 0/1(-6)/(-72)6. Suppose bi = 4i, 4h + i = 20. Let y(g) = g - 7. What is y(h)? -2 Let r(k) = 3k2 + 26k - 25. Let y(n) = 5n2 + 51n - 50. Let m(z) = 7r(z) - 4y(z). Let o be m(21). Let t(l) = 2l + 1. Give t(o). 9 Let a(d) = 7d*2 + 2d - 1. Let q(t) = -3t + 2 + 139t*2 + 0 - 150t*2. Let u(n) = 8a(n) + 5q(n). Give u(-2). 4 Suppose 8f + 3s - 7 = 4f, -29 = 2f - 5s. Let o(r) = r3 - r2 - r + 1. Let p(c) = 2c3 - 7c*2 - 4c + 5. Let z(h) = 4o(h) - p(h). Determine z(f). -5 Let m(h) = 2h**3 + 1. Let o be m(1	{ "pile_set_name": "DM Mathematics" }
65621 + 484304 = -7534b for b. -67 Solve -8891v + 8721v - 2092 = 121 + 2207 for v. -26 Solve -175286 = 41s - 172252 for s. -74 Solve -4021h - 23291 - 45825 - 55703 = -16252 for h. -27 Solve 0 = -690d - 1726d - 140128 for d. -58 Solve -93w - 94w + 4968 + 7385 = 385 for w. 64 Solve -56831p + 1386 = -56930p for p. -14 Solve -8226d + 1918d - 157700 = 0 for d. -25 Solve 4038t = 167963 + 115859 - 98074 for t. 46 Solve -62g + 429g - 1520 = -393g for g. 2 Solve 151n + 24350 = -175n - 107n - 54n for n. -50 Solve -c + 654 - 671 = 0 for c. -17 Solve -1171530 = 29j - 1173299 for j. 61 Solve -600330 + 564330 = 240b for b. -150 Solve -136l - 3578 + 18933 = -583l + 32l for l. -37 Solve -80y - 44 = 77y + 78y - 233y for y. -22 Solve 0 = 454t + 150t + 111t + 15t + 85410 for t. -117 Solve -277j - 5352 = 259j + 14480 for j. -37 Solve 574084l + 899 = 574259l - 1201 for l. 12 Solve -89334 = -68d - 86138 for d. 47 Solve -2022l - 91589 = -25979 + 13248 for l. -39 Solve 65641q = 66022q - 11430 for q. 30 Solve -105i = -159i - 83i + 3973 for i. 29 Solve 1402l + 2273l + 440l + 483l = 147136 for l. 32 Solve 1472o + 643o - 78613 - 305549 = -863o for o. 129 Solve 9421m - 9447m - 806 = 0 for m. -31 Solve 301 = -80z + 1807 + 734 for z. 28 Solve 388l - 49l - 47l + 8768 = 155l for l. -64 Solve 67638 = 738o + 2958o - 13674 for o. 22 Solve 481k + 1272k + 163020 = 37k for k. -95 Solve 98g - 511g - 25g - 348g = -32226 for g. 41 Solve -25955 = -1005i - 1656 + 16906 for i. 41 Solve 0 = -391m + 7218 + 15069 for m. 57 Solve -1171h = -700h - 689h + 48 + 388 for h. 2 Solve 638j - 18533 + 4497 = 0 for j. 22 Solve -223x - 1432 = 371 - 185 + 166 for x. -8 Solve -60260 = -2125h + 69365 for h. 61 Solve -501l + 14378 = -795l - 2213l + 72039 for l. 23 Solve 101561 = 467i - 2688i - 45025 for i. -66 Solve -825j - 27649 = -9499 for j. -22 Solve -2622h + 104532 = -65898 for h. 65 Solve 285x + 807x - 118976 = -52x for x. 104 Solve -1193p - 4968 + 70168 = 111p for p. 50 Solve -739p = 12997 + 6217 for p. -26 Solve -1041n = 442n - 15580 - 28910 for n. 30 Solve -889m + 367m - 306m - 58310 = 887m for m. -34 Solve -33p - 536 + 171 = 74p + 812 for p. -11 Solve 1165y + 1062 = 11730 + 38262 for y. 42 Solve 78517 + 65303 = 3995m for m. 36 Solve 11822p + 11832p - 560 = -11827p + 35471p for p. 56 Solve 0 = -6827l + 5960l + 22511 + 25184 + 7793 for l. 64 Solve 322g = 1309g + 32571 for g. -33 Solve 96i - 11i + 68i = 19i + 2412 for i. 18 Solve 0 = -79a - 89359 + 93546 for a. 53 Solve 0g + 21654 = 206g + 160g - 11286 for g. 90 Solve -38909g + 892136 = -1304430 - 2355787 for g. 117 Solve 397u = 25294 - 49908 for u. -62 Solve 151y + 74y + 143 = -1067 + 85 for y. -5 Solve 423m - 32448 = -384m + 183m for m. 52 Solve 0 = 143719i - 148250i + 448569 for i. 99 Solve -370n - 4356 = 113n + n for n. -9 Solve 0 = 895l + 142740 - 71140 for l. -80 Solve 14899j = 29716j - 14937j - 12240 for j. -102 Solve -99y + 23391 - 28737 = 0 for y. -54 Solve 280s - 4349 = 3079 - 71 + 3283 for s. 38 Solve 299c - 235c + 236c - 12600 = 0 for c. 42 Solve -699237 = -18l - 699741 for l. -28 Solve -23205 + 60328 + 76799 - 14172 = -6650i for i. -15 Solve 0 = -1098f - 9529f - 25090f - 5571852 for f. -156 Solve -58r + 148r = 37r - 185r + 24276 for r. 102 Solve 171h = -18h + 3969 for h. 21 Solve 408p - 390p + 808p + 27258 = 0 for p. -33 Solve 242 - 3431 = -357j + 1095 for j. 12 Solve 0 = 4332b - 5158b - 27258 for b. -33 Solve 323z - 15345 = -700z for z. 15 Solve 0 = 2723w + 5693w - 681696 for w. 81 Solve 3893 = 87l + 23l + 1461 - 3508 for l. 54 Solve -4527k + 921k - 324540 = 0 for k. -90 Solve 852d = 920257 - 849541 for d. 83 Solve -13116 - 195 = -138p + 7113 for p. 148 Solve -6058895 + 6057641 = -22a for a. 57 Solve 25905s - 25983s = -2418 for s. 31 Solve 6491 - 8149 = -629y + 12571 + 8415 for y. 36 Solve 0 = 16u + 27u + 736u + 49303 + 15354 for u. -83 Solve 10b - 926 = -89b + 175 + 3849 for b. 50 Solve -668n - 4922 - 1540 = 886 for n. -11 Solve 116p - 1869 - 1605 - 231 - 1167 = 0 for p. 42 Solve -34622h + 34547h = -5775 for h. 77 Solve 32a - 12267 + 2605 = 227a + 7108 for a. -86 Solve 226f - 29171 = -774f + 11829 for f. 41 Solve 0 = 4343n - 50n + 3479n for n. 0 Solve -25k - 24k = -11k - 2157 + 143 for k. 53 Solve -1363t + 2942 - 58192 - 20285 = -570 for t. -55 Solve 300u - 827u - 20026 = 0 for u. -38 Solve -1310v + 864v + 7211v = -3823v for v. 0 Solve -78g - 167g - 79g = 201g - 7350 for g. 14 Solve -15566 = 2271i - 81745 - 120043 for i. 82 Solve -1206k + 51767 - 669 = 1195k - 639k for k. 29 Solve -313716 = 4431g + 62919 for g. -85 Solve 0 = -203p - 1703p + 323p - 3166 for p. -2 Solve 140c - 38 - 32 = 33c + 37 for c. 1 Solve -38o = 106o - 209 - 367 for o. 4 Solve 1739 + 913 = -704g + 755g for g. 52 Solve 446h + 79524 = -697h + 297h for h. -94 Solve -7563 = -10u - 6963 for u. 60 Solve 0 = 1251l + 820l + 2148l + 41l + 276900 for l. -65 Solve 390t - 100 = 95t - 690 for t. -2 Solve 190890j - 191536j + 14858 = 0 for j. 23 Solve -17746 = 3028j - 108586 for j. 30 Solve 170v + 4v + 11562 = 600 for v. -63 Solve -440v + 16338 + 7483 = 3141 for v. 47 Solve 4577v = 4928v - 27729 for v. 79 Solve -757x = -413x - 26144 for x. 76 Solve -125f - 173f + 2349 = 4f - 41f for f. 9 Solve 40o = -22o - 5339 + 2301 for o. -49 Solve -1522x + 612x + 4550 = 0 for x. 5 Solve -112f + 9000 = 64f - 53f + 57f for f. 50 Solve 88b + 131b = 355b - 82b - 5238 for b. 97 Solve 1340 + 894 = 111h + 14h - 2641 for h. 39 Solve -641h + 101811 = -1429h - 1733h - 36844 for h. -55 Solve 1672 = 36765168c - 36765124c for c. 38 Solve 328323 = 192m + 356931 for m. -149 Solve 6344 = 383h + 295h - 556h for h. 52 Solve -5042 - 10433 + 178327 = 2127s - 83880 for s. 116 Solve 25009l - 5754 = 24872l for l. 42 Solve 100200 = -1162v - 842v for v. -50 Solve 1253m = -51780 - 2168 + 3828 for m. -40 Solve 204704 = 11946k + 37460 for k. 14 Solve -72521 = 353j + 153j - 4717 for j. -134 Solve 779837 = -8u + 779525 for u. -39 Solve 53400 = -53x + 28211 + 27256 for x. 39 Solve -33y + 1159 = 796 for y. 11 Solve -2604432o = -2604449o - 1021 + 137 for o. -52 Solve 24876 = -126b + 22986 for b. -15 Solve -174q + 79667 = 90977 for q. -65 Solve 4o - 218o - 2313 = 43o for o. -9 Solve 7582 = -5986o + 14318 - 31649 - 82835 for o. -18 Solve 236a + 307a + 111a - 1413 = 183a for a. 3 Solve -6653r = 453r - 220286 for r. 31 Solve 94y + 2530 = 18y - 39y for y. -22 Solve -211d + 4445 + 1872 - 157 = -35d for d. 35 Solve 0 = 2382x - 1634x + 2992 for x. -4 Solve 2134q - 330q = -2504 - 30932 - 4448 for q. -21 Solve 878d - 1916 = 418d + 420d + 764 for d. 67 Solve -26z - 31z + 29z = 56 for z. -2 Solve 371m + 7680 = -169m + 28m for m. -15 Solve 208097 = -2461y + 3430 - 14362 for y. -89 Solve -416s - 14 = 783 + 35 for s. -2 Solve -974j = -758j - 5832 for j. 27 Solve 1920j + 157143 - 43863 = 0 for j. -59 Solve -511u + 2874 = -160u - 2515 - 1982 for u. 21 Solve 726j + 465j + 387j - 187j - 26429 = 0 for j. 19 Solve 19428g + 7870g = -1528688 for g. -56 Solve 500h + 2255 = -1859h - 2463 for h. -2 Solve 260q - 23008 = 486q + 91q + 402q for q. -32 Solve -731v - 53157 = 632v for v. -39 Solve 0 = 578s + 7300 + 12499 - 7083 for s. -22 Solve 2377h - 92 = 2426h + 6 for h. -2 Solve 0 = 2o - 44721 + 44799 for o. -39 Solve 4991 = 601f - 28665 for f. 56 Solve -23348k + 23376k = 1176 for k. 42 Solve 0 = -15731q + 15951q - 440 for q. 2 Solve 5178 - 49981 = -7074o + 17697 + 22388 for o. 12 Solve -10k + 25k + 2k = -442 for k. -26 Solve -14187l - 757584 = 732051 for l. -105 Solve -104t + 185 = -25t - 4081 for t. 54 Solve 0 = -297i - 306i + 48i + 33204 + 19521 for i. 95 Solve -55v - 205v - 245v - 505 = 0 for v. -1 Solve -10x = -311x + 54x - 58x - 610 for x. -2 Solve -898 + 35866 = 372x for x. 94 Solve 367y + 181y + 189y = -456y - 9544 for y. -8 Solve 1591d + 10439 + 3243 = 1494 - 5313 for d. -11 Solve 0 = 8u - 5u - 23u + 946 - 606 for u. 17 Solve -199x - 191x + 782x + 42978 = -710x for x. -39 Solve 128n -	{ "pile_set_name": "DM Mathematics" }
-234g2 Differentiate -1119h*3 + h - 627 wrt h. -3357h2 + 1 What is the second derivative of a4 + 257a3 - 582a wrt a? 12a2 + 1542a Find the third derivative of 40i3r*3 - 236i*2r*2 + ir*3 wrt i. 240r*3 What is the third derivative of 5v*5 + 3v*4 + 149v*3 + 2v*2 - 26? 300v*2 + 72v + 894 Find the second derivative of -25o2q*3y + o*2q*2y - 22o2qy + 64oq3y - 4oq*2y - 3q3 wrt o. -50q*3y + 2q2y - 44qy Differentiate -78hvz2 + 1427hz3 + 3vz3 + vz with respect to v. -78hz*2 + 3z*3 + z What is the second derivative of 44foy*2 - fo - 3fy*2 + 2fy + 2o + 2y wrt y? 88fo - 6f Find the second derivative of -72n4 - 2n*2 + 161n - 4. -864n2 - 4 What is the derivative of 5dg - 9dq + d - 2g*2 + 14gq wrt g? 5d - 4g + 14q Find the first derivative of 12407w4 + 10087 wrt w. 49628w*3 Differentiate 22n*3 + 11n + 334 wrt n. 66n2 + 11 Find the first derivative of -30a*2 + 7ao + 4o - 102 wrt a. -60a + 7o What is the third derivative of -cr4 - 465cr3 - 5cr2 - c + 4r*2 wrt r? -24cr - 2790c Find the second derivative of -17f3g - 13f2s*2 + 3fg + 164gs + s2 wrt f. -102fg - 26s*2 Find the first derivative of 3096z*2 - 163 wrt z. 6192z Find the second derivative of -2cg*2j + 3cg*2y*2 - cg*2 + 4cgjy2 - 16cgj + 3g2y*2 + 2gjy wrt y. 6cg*2 + 8cgj + 6g2 Differentiate -15q*2 - 3q + 234. -30q - 3 What is the third derivative of -2c*4 + 161c*3 + 314c*2 + 2c? -48c + 966 Find the second derivative of -6048a*4 + 108a + 34. -72576a2 Find the first derivative of 65z*3 - 65. 195z*2 Differentiate 37c*4 + 1108 with respect to c. 148c*3 Differentiate 112bd2o + 2bo - 4d2 + 49do + 2d with respect to b. 112d2o + 2o Differentiate 3u*4 + 4u*3 + 13u - 20388 wrt u. 12u3 + 12u*2 + 13 What is the first derivative of -138j*2 + 239 wrt j? -276j What is the second derivative of 9m2s*3 + 4m*2s*2 - 38m*2s - 78ms*3 - 3ms2 + s3 wrt m? 18s*3 + 8s*2 - 76s Find the second derivative of 15g4r + 3g2r*2 - 2g*2r + 13gr*2 + 12g wrt g. 180g2r + 6r2 - 4r What is the second derivative of -2a3v*3 - 39a*3 + 93v*4 + 3v wrt v? -12a3v + 1116v2 What is the derivative of 6sx3 + sx*2 - 1184s + 233x3 wrt x? 18sx2 + 2sx + 699x*2 What is the second derivative of 3m*4 + 29m*3 + 2m - 89? 36m2 + 174m What is the third derivative of 9196cu*3 - 3292cu2 wrt u? 55176c What is the third derivative of 39km*3 - 2km2 + 160k - 18m4 wrt m? 234k - 432m Differentiate -571z*3 + 194. -1713z*2 Differentiate 8m3 + m2s - 14m + 10349s wrt m. 24m*2 + 2ms - 14 Find the second derivative of 26f*5 + 46f*2 + 2f + 113 wrt f. 520f3 + 92 Find the second derivative of 345c*5d + 3cd - 17d wrt c. 6900c*3d What is the third derivative of -1704d4 - 42d*2 - 5d wrt d? -40896d Find the third derivative of 4i*3l*4 - 4i*3 - 43i*2l*5 - 41i*2l*2 wrt l. 96i*3l - 2580i2l*2 What is the second derivative of 229o*5 - 85o? 4580o3 Find the third derivative of 242b*4 + 12b*2 + 2b. 5808b Find the third derivative of 82a3 - a2 + 118a. 492 What is the second derivative of 112g*3h*2 + 4g*3h + g*2h - 4gh wrt h? 224g3 What is the second derivative of -4q*4 - 105q*2 - 659q? -48q2 - 210 What is the third derivative of 13b*6d + 2b5d2 + b2d - 89bd2 - d2 wrt b? 1560b*3d + 120b2d*2 What is the third derivative of 2n*3v*3 + 31n*3v*2 - 32n*3 + 241nv6 wrt v? 12n*3 + 28920nv3 Differentiate -4w*2 + 298w - 374 with respect to w. -8w + 298 Find the first derivative of -286h*2 + 2h + 338 wrt h. -572h + 2 Find the second derivative of -1286v*5 - 359v + 2 wrt v. -25720v3 What is the third derivative of 3fr6 + 23fr2 + 3f + 16r6 wrt r? 360fr3 + 1920r*3 Find the third derivative of 14w*6y - 3w3y*2 + 724w*2y2 + w2y wrt w. 1680w*3y - 18y2 What is the second derivative of -9693p*3 + 7740p wrt p? -58158p What is the second derivative of -3483l*4 - 63l - 109? -41796l2 What is the second derivative of 650k*2 + k - 63? 1300 What is the third derivative of 295h*3y*3 + 132h*3 - 6hy2 wrt y? 1770h3 What is the third derivative of h3z - 45h*3 + 567h*2z wrt h? 6z - 270 Differentiate -13756p - 1014 with respect to p. -13756 What is the second derivative of 4304h2 + 2h + 110 wrt h? 8608 Differentiate 252b2d - bd2 - 1036d*2 with respect to b. 504bd - d2 What is the second derivative of -5g*2r*2 - 14g*2r + gr5 + 5gr - r2 wrt r? -10g*2 + 20gr3 - 2 Differentiate 3hory2 + 4hor - 93hry2 - 2h + 2ory + 4or + o with respect to y. 6hory - 186hry + 2or What is the second derivative of 15bs*2z + 2bsz2 + bsz + 2b - 167s2z*2 - sz*2 - 902s wrt s? 30bz - 334z2 Find the third derivative of -2h*4jm - 4h*4m + 4h3jm2 + 8h*2jm2 + 5h*2m + m*2 wrt h. -48hjm - 96hm + 24jm*2 Find the third derivative of 156b*6o + 2b5os - b2os + 29b*2 - os wrt b. 18720b3o + 120b2os Find the second derivative of 7l*4 + 363l3 - l2 - 3367l. 84l*2 + 2178l - 2 Find the second derivative of v*3w*4 - 5v*3w2 + v3w - 43v*3 + 10w*3 wrt w. 12v*3w*2 - 10v*3 + 60w What is the third derivative of -h*6 - 2h*4 + 2h*2 - 29h? -120h3 - 48h What is the second derivative of -55f2p - 7f2 + 86fp + 2f + 19p wrt f? -110p - 14 What is the second derivative of 2g4 - 824g*2 - 19g - 134? 24g2 - 1648 Differentiate -3tv - 416t - 44v wrt v. -3t - 44 What is the derivative of 21h2 - 2h - 26? 42h - 2 Find the second derivative of 29j*4 + 184j wrt j. 348j2 What is the second derivative of 42h*4 + 13h*3 + 595h - 3? 504h2 + 78h Find the second derivative of -2t5x + 234t5 + 39tx + 4 wrt t. -40t*3x + 4680t3 What is the third derivative of 4768h*4 - 10h*2 + 10? 114432h Find the second derivative of -832p4x + p*3x - p*2x - 2px + 2p + x + 68 wrt p. -9984p*2x + 6px - 2x Find the second derivative of 2393k*5q*3 + 3k*5 + 2kq + 3q*3 - 6q*2 + 37q wrt k. 47860k3q*3 + 60k3 What is the second derivative of t3y3 - 1052t*3y*2 + 6t*3y + 3t3 + t2 + 6ty wrt y? 6t*3y - 2104t3 What is the derivative of -9d*2n*4 - 8d*2n - 3d2 + 24d wrt n? -36d2n*3 - 8d*2 What is the second derivative of -3876f*3o*2 - 104f*3o - f*2o + 2fo wrt o? -7752f3 What is the third derivative of -10f*3l4 - f3l2 + 101f*3 - 29fl4 + 3l*2 wrt l? -240f*3l - 696fl What is the third derivative of 1057m3 + 1655m*2? 6342 Differentiate -1358o*2 + 5o - 13599 with respect to o. -2716o + 5 Differentiate -2w*4 - 4w*2 - 66w + 8891 with respect to w. -8w3 - 8w - 66 What is the first derivative of -3ku*2w + 67ku*2 + 2k + 3213u2w wrt w? -3ku*2 + 3213u*2 What is the second derivative of 524m*3t*2v - 2m3v + mt2 - 317mtv + mv wrt m? 3144mt2v - 12mv What is the third derivative of 2q4y*3 + 6q*4 - 149q*3xy + 2q*2x + 11qx + xy3 wrt q? 48qy3 + 144q - 894xy What is the second derivative of -4mw*3 - 2mw2 + 20023mw + 147w*2 wrt w? -24mw - 4m + 294 What is the second derivative of 21g2r*2 - 334g*2r - 5r4 wrt r? 42g*2 - 60r*2 What is the derivative of 27gsz*3 - 162gs + 60gz + g + sz*3 - 4 wrt z? 81gsz*2 + 60g + 3sz*2 What is the second derivative of 927w*4 + 829w - 2 wrt w? 11124w2 Find the third derivative of -3419b*3u3 - b2u3 + 18b*2u*2 - 20b*2 wrt b. -20514u*3 What is the first derivative of 2i*3z - 150i3 - 2i*2y*2z - 2i2y*2 + iy*2 - yz*2 wrt z? 2i*3 - 2i*2y*2 - 2yz Differentiate 14z*4 - 3z + 6273. 56z3 - 3 Find the third derivative of -835z5 - z2 - 11 wrt z. -50100z2 Differentiate -12q*	{ "pile_set_name": "DM Mathematics" }
e Is 412 a factor of 47247485? False Is 744 a factor of 7127618208? True Is 54 a factor of 918081186? False Is 183831056 a multiple of 83? True Is 361577840 a multiple of 13? True Does 11 divide 11053655? False Is 1124 a factor of 120804148? True Does 418 divide 71270948? False Does 221 divide 38299742? True Is 21 a factor of 26803243? False Is 156 a factor of 1483546550? False Does 1337 divide 1539304144? True Does 3 divide 755235473? False Does 561 divide 23185569? True Is 27 a factor of 1343851765? False Is 520033570 a multiple of 98? True Is 8313435 a multiple of 99? False Does 34 divide 13497797? False Is 111 a factor of 92911329? True Is 15 a factor of 235544850? True Is 54372912 a multiple of 134? True Is 88 a factor of 74719480? True Is 877 a factor of 30934421? True Does 12 divide 12825120? True Is 16 a factor of 290084833? False Is 938 a factor of 2161469044? True Is 19801496 even? True Is 2799544 a multiple of 11? True Does 119 divide 86822757? True Is 57211439 a multiple of 3191? True Does 45 divide 964784970? True Is 707 a factor of 13686153? False Does 23 divide 2449809877? False Is 2555370576 a multiple of 9416? True Does 50 divide 481087700? True Does 257 divide 61690023? True Is 55183885 a multiple of 1055? True Is 455597541 a multiple of 63? True Is 1079 a factor of 162991317? False Is 6983379 a multiple of 13? True Is 28270224 a multiple of 548? True Is 90 a factor of 236719090? False Is 11413549 a multiple of 31? True Does 1127 divide 597231790? False Is 95 a factor of 1291620? True Is 68880855 a multiple of 164? False Does 339 divide 9919140? True Is 2355 a factor of 252248352? False Does 76 divide 157243899? False Is 1281505870 a multiple of 7127? True Is 16407617 a multiple of 7? False Is 79 a factor of 160281125? True Is 72378200 a multiple of 1160? True Does 93 divide 65464746? True Does 7150 divide 393956789? False Is 22 a factor of 3896811050? True Is 3301 a factor of 69832655? True Is 20946288 a multiple of 11? True Is 14975 a factor of 3334707006? False Is 79258037 a multiple of 504? False Is 43 a factor of 3732712? False Does 82 divide 3523269236? True Is 75808031 a multiple of 3? False Is 54 a factor of 9723763? False Is 221276726 a multiple of 11? True Does 8 divide 2225712? True Does 66 divide 11088068? False Does 2 divide 43995584? True Is 98581718 a multiple of 1229? False Is 3507620457 a multiple of 1767? True Is 69926529 a multiple of 35? False Does 11 divide 11115214? True Does 9 divide 385301025? True Is 1448 a factor of 7588968? True Does 971 divide 14319337? True Is 259785041 a multiple of 40? False Is 75991682 a multiple of 7? False Is 19054074 a multiple of 227? False Does 149 divide 159833661? False Is 822108625 a multiple of 212? False Is 47 a factor of 2744377? True Is 242930100 a multiple of 350? True Is 77 a factor of 46268761? True Is 1282211401 a multiple of 23? False Is 600 a factor of 43240993? False Is 4 a factor of 3824753? False Is 36963571 a multiple of 259? False Is 112706931 a multiple of 175? False Does 826 divide 247701706? True Is 113600381 a multiple of 2338? False Is 131218578 a multiple of 18? True Does 3399 divide 2430709875? True Is 168670736 a multiple of 272? True Is 554 a factor of 78585454? True Is 214 a factor of 24475867? False Is 276 a factor of 1168536991? False Does 500 divide 872749390? False Does 3 divide 87926126? False Is 7 a factor of 317525554? False Does 88 divide 121152011? False Does 292 divide 104116688? True Does 421 divide 148066121? True Is 59 a factor of 380692871? False Does 1837 divide 1116488418? False Does 409 divide 34800289? False Does 81 divide 1248998535? True Is 429642250 a multiple of 190? True Is 139 a factor of 2505379302? False Is 134237795 a multiple of 102? False Is 7 a factor of 517818296? False Is 584 a factor of 6362680? True Is 32144882 a multiple of 286? False Is 9 a factor of 189321867? True Is 626404901 a multiple of 1473? False Is 18 a factor of 105091776? True Is 90769812 a multiple of 1284? True Does 5145 divide 571496310? True Is 12870927 a multiple of 46? False Is 334788448 a multiple of 16? True Is 54 a factor of 119334762? True Is 38025083 a multiple of 136? False Is 729 a factor of 8281750? False Does 52 divide 27431040? True Is 614 a factor of 246880506? False Does 107 divide 7328030? False Does 117 divide 67376132? False Is 483 a factor of 66761226? True Is 437531318 a multiple of 397? True Is 3850 a factor of 445052300? True Is 74579133 a multiple of 6? False Is 139884529 a multiple of 1605? False Does 3537 divide 252100271? False Is 146936784 a multiple of 48? True Is 44328008 a multiple of 408? False Is 541992983 a multiple of 150? False Does 9 divide 28662912? True Is 287544784 a multiple of 126? False Is 43532762 a multiple of 38? True Is 1717 a factor of 103526515? True Is 73 a factor of 3485685? False Does 96 divide 306648960? True Does 51 divide 5206624? False Is 500 a factor of 2463463760? False Does 132 divide 8819316? True Is 448069482 a multiple of 354? True Is 781 a factor of 22570980? False Is 72 a factor of 26858038? False Is 23224574 a multiple of 19? True Is 25 a factor of 162461143? False Does 278 divide 1454577? False Is 20 a factor of 30993720? True Is 1172093398 a multiple of 14? True Is 30 a factor of 146258610? True Is 63 a factor of 97282416? False Does 13 divide 1021770547? False Is 7 a factor of 106133352? False Is 67909667 a multiple of 57? False Is 22 a factor of 39689119? False Is 122 a factor of 930445029? False Is 8018050 a multiple of 38? False Is 95862080 a multiple of 133? False Does 2935 divide 2768195145? True Does 27 divide 1999215? True Is 1843 a factor of 24797565? True Is 2746212591 a multiple of 5174? False Is 122169936 a multiple of 381? True Is 12342606 a multiple of 201? True Does 13 divide 54753751? True Does 114 divide 2280374490? True Does 611 divide 32840639? True Is 604512801 a multiple of 29? True Does 6 divide 30083? False Is 17957856 a multiple of 875? False Does 91 divide 81426601? False Is 6604 a factor of 683401732? True Does 40 divide 58569280? True Is 3485635419 a multiple of 7146? False Is 333202506 a multiple of 7? True Does 19 divide 316266226? False Is 14 a factor of 47976391? False Is 757706170 a multiple of 1079? True Is 133 a factor of 61765447? False Does 3134 divide 247525587? False Does 564 divide 2965688722? False Is 157113715 a multiple of 4100? False Is 10585000 a multiple of 1250? True Does 195 divide 74356815? True Does 10 divide 905604817? False Does 18 divide 41333256? True Is 279 a factor of 246701565? True Is 2925398375 a multiple of 41? False Does 229 divide 23974468? True Does 200 divide 3183126000? True Is 937 a factor of 26909703? True Is 550 a factor of 7501941? False Does 6 divide 43682754? True Is 170 a factor of 19111113? False Is 12456 a factor of 2657836368? True Is 897 a factor of 942665780? False Does 62 divide 190840964? False Does 490 divide 3645767058? False Does 1187 divide 60992808? True Does 516 divide 18338564? False Is 98 a factor of 431528523? False Is 58825224 a multiple of 5? False Is 26 a factor of 256166170? True Is 128 a factor of 198609792? True Is 35 a factor of 113264760? True Does 536 divide 41941464? True Is 13133116 a multiple of 775? False Does 1734 divide 63394626? False Does 3848 divide 125408350? False Does 321 divide 8341506? True Is 206754273 a multiple of 1089? True Is 59543224 a multiple of 13? True Does 9 divide 20833866? True Is 18 a factor of 10156255? False Is 16486558 a multiple of 4? False Is 8 a factor of 169422521? False Is 28693480 a multiple of 11? False Is 233427350 a multiple of 552? False Does 1325 divide 31431650? True Is 2609766467 a multiple of 49? False Is 273221064 a multiple of 5529? True Is 1402 a factor of 1406453619? False Is 47 a factor of 71037791? False Is 75 a factor of 1254423274? False Does 69 divide 271035519? True Is 27 a factor of 171252291? False Is 249651684 a multiple of 36? True Is 46998036 a multiple of 222? False Does 15 divide 109464891? False Does 34 divide 97911957? False Is 487794262 a multiple of 219? False Does 4 divide 136595742? False Is 136 a factor of 1595813468? False Is 583844464 a multiple of 28? True Does 41 divide 3486066? True Does 953 divide 473516004?	{ "pile_set_name": "DM Mathematics" }
closest to 0? (a) o (b) 0 (c) -5 b Let h be (-10)/3(-21)/28. Let r = h + -2. What is the nearest to 0 in 0.2, r, -1? 0.2 Let k = -0.1 + -0.9. Let y = -1.3 + 0.94. Let u = y - 0.04. Which is the nearest to k? (a) 1 (b) u (c) 0.5 b Let g be 1(-5 - -4) - 2. Let p = 6 - 5.6. What is the nearest to g in p, -4, -3? -3 Let m = -45 - -47.3. Let y = m - 2. Let o = y - -0.7. What is the nearest to 0.1 in 0.5, o, -4/7? 0.5 Let d = -0.6 - -0.6. Suppose -14 = -3z - y, 5z - 32 + 6 = -3y. Let h be 1/(-4) + (-19)/z. What is the closest to d in 1/2, 0.2, h? 0.2 Let s = 72 + -215/3. Which is the nearest to -1? (a) -0.2 (b) s (c) 5 a Let d = 4 - 4. Which is the nearest to -1/3? (a) -1/2 (b) d (c) 4 a Let h = -4 + 4.1. Let t = 0.1 - 1.1. What is the closest to t in -0.4, -0.3, h? -0.4 Let h be 2 - 25/7 - -2. Let x = 0 + 0. Let w = 4.6 + -0.6. Which is the nearest to 2/3? (a) h (b) x (c) w a Let s = -1 + 22. Let d = -21.5 + s. Which is the closest to 0? (a) -3/4 (b) 0.1 (c) d b Suppose 0 = 4j + 52 + 228. Let o be -2 + (j/(-17) - 2). Which is the nearest to 1/4? (a) 3 (b) -0.3 (c) o c Let a = 187/3 - 63. Let n = -10.5 + 5. Let y = 0.5 + n. What is the closest to a in -3, y, 0.3? 0.3 Suppose 5u - 11 = -2d - 66, -61 = 4u + 5d. Let i be 1/u(2 - 5). What is the nearest to 1 in -3/7, 2/3, i? 2/3 Let s = 0.05 - -2.95. Let j = s - 1. Let n be (-1)/(-2)(-12)/(-30). Which is the nearest to j? (a) n (b) 2 (c) 0 b Let w(l) = l*3 + 6l*2 - l - 8. Let h be w(-6). Let t = 0.8 + 1.2. Which is the nearest to t? (a) h (b) 2/11 (c) -2/5 b Let m be (-41)/(-5 + -13). What is the nearest to -1 in 0.4, m, 0? 0 Let u be 5/26/(-9). Let g = 4 + 20. Let p = g + -25. What is the nearest to 0 in u, p, -2/3? -2/3 Let f be 3/(-10) - 1/(-2). Which is the closest to 0? (a) 1 (b) 0.3 (c) f c Let i = -4 - -7. What is the nearest to -1/2 in i, 3/7, 0.4? 0.4 Let w be ((-5)/(-110))/((-1)/(-4)). What is the nearest to 0.1 in -1, 4, w? w Let q = -2 - -1. Let m = -0.1 + -3.9. Let u = 184 + -1469/8. What is the closest to 0 in q, u, m? u Let q = -1.524 - 0.026. Let i = 0.05 + q. Let p = 1 + i. What is the nearest to -0.1 in -1, -2/5, p? -2/5 Let m = -4 + 8. Suppose -q = -2n, 2n - mq = -q. Which is the nearest to n? (a) 2 (b) 0.3 (c) -5 b Let t(x) be the first derivative of 3x2/2 + 2x + 3. Let r be t(6). Let g be 32/r + 1-2. Which is the closest to g? (a) -1 (b) -2/5 (c) -1/12 b Let p = -24.6 - -25. Which is the closest to 0? (a) -5 (b) 1 (c) p c Let y be 1 + (0 - 1)-1. Let r be (y/6)/((-4)/(-3)). Let m = -0.08 + -2.92. Which is the closest to r? (a) -4 (b) 1 (c) m b Let j = -25 - -25.3. Which is the nearest to -6? (a) j (b) 3 (c) 1/3 a Let f = 120 + -602/5. Let a be (2/24)/(1/2). What is the closest to -0.1 in a, f, -4? a Let a = -20 + 16. What is the nearest to 1 in 4, a, -2/7? -2/7 Let i = 0.9 + -0.9. Let l be 1 - (-1 - 21/(-15)). Let v = 0.2 + 0.3. Which is the nearest to i? (a) -3/2 (b) v (c) l b Let x = 13 + -8. Let v = -5.2 + x. Let d = 0.1 - -0.1. Which is the nearest to 0.1? (a) d (b) -1 (c) v a Let a be -5(46/(-50) + 1). Suppose 3q = -l + 122, -2l = -3q - 4l + 124. Let u be (-2)/(-8) + q/(-32). What is the nearest to 2/7 in a, 3, u? a Suppose 2v + g + g - 12 = 0, -5v = -g. Let z = 12.17 + -0.17. Let j = z - 10. Which is the nearest to v? (a) -4 (b) 5 (c) j c Let v = -71/24 + 31/12. What is the nearest to 1/4 in 0.3, -5, v? 0.3 Let s be (-8)/(-2) + (1 - 2). Let h(y) = 2y + 4. Let j be h(-5). Let p = s + j. Which is the nearest to 0.1? (a) 2 (b) -2 (c) p a Let k = 12 + -14. Let q be 1/(-1) + k + 3. What is the nearest to -3 in -3, -1, q? -3 Let j be (((-15)/6)/(-1))/((-12)/(-8)). Which is the nearest to -1/2? (a) 2/3 (b) 0 (c) j b Let z = -7 + 12. What is the closest to -1 in -7/6, 0, z? -7/6 Let k = -0.07 + 0.14. Let h = 2.93 + k. Let r be 4/96/4. Which is the closest to r? (a) 5 (b) h (c) -1/4 c Let m = -9/13 - -76/91. Which is the closest to -0.1? (a) 4 (b) -3 (c) m c Let k = 2072 + -10324/5. Let y = 262/35 - k. Let i = -25 + 25.3. Which is the nearest to -1? (a) i (b) y (c) 4 b Let l = 0 - 0. Let z = 15 - 10. Which is the nearest to l? (a) -2 (b) -3 (c) z a Let z = 0.14 + 0.86. What is the nearest to z in 0.1, -0.3, 1? 1 Let v be (-9)/21 + 10/105. Let n = 0.3 - 2.3. What is the nearest to -1/2 in -1, n, v? v Let t be (-22)/8 + (-3)/(-1). Let r = 7 - 7.3. Let k = -523/6 - -87. Which is the nearest to t? (a) k (b) 3/2 (c) r a Let c be 2/(((-2)/4)/(9/(-9))). What is the nearest to -1 in c, 0.4, -0.5? -0.5 Let p = -85.5 - -85. What is the closest to 1 in p, -0.03, 2? 2 Let t = 0 + 0.2. Let s be 1/6 - 3/234. What is the nearest to 0 in t, 0.1, s? 0.1 Let u = 0.002 + 3.998. What is the closest to 0.1 in -0.1, u, 0.4? -0.1 Let j = 67 + -66.7. What is the closest to 0 in -0.4, -4/3, j? j Suppose -3g + 15 = 0, -2g = -l - 7g + 35. What is the nearest to 0.2 in l, -1/2, 0? 0 Let p = -66 + 63. What is the closest to -0.1 in -2/7, -1, p? -2/7 Let h(k) = k*2 + 4k + 7. Let o be h(-5). Let p be (3/o)/(6/(-4)). Let m be (-2)/4 - 30/(-44). Which is the closest to 0? (a) -4 (b) m (c) p c Let d = -2.28 + 0.28. What is the nearest to d in 1, 8, -0.3? -0.3 Let q(u) = -u*2 - 6u - 4. Let l be q(-5). Let m(f) = -f - 8. Let p be m(-5). Which is the closest to l? (a) 1 (b) -0.5 (c) p a Let a be (-4)/16 - (-33)/84. What is the nearest to 0 in 5, -1/3, a? a Suppose 32 = 5p - u - 2u, 0 = u + 4. What is the nearest to 0.2 in p, -1, 0? 0 Suppose -3x = -2g + 435, 4g - 891 = -0x - x. Let q = -1773/8 + g. Let v = -11 + 7. Which is the nearest to -2/5? (a) v (b) 1/3 (c) q b Let p = -6 - -23/4. Let r = 0.2 + 0. Which is the closest to p? (a) 5 (b) -2/7 (c) r b Let x = -1 - -0.8. Let g = 1779/7 - 255. Let k = -32/21 - g. What is the nearest to x in k, -2/19, -1? -2/19 Let v = 15 + -11. Let l = v + -3. Let r be (35/(-21))/((-1)/3). What is the nearest to -0.1 in -0.2, l, r? -0.2 Let s = -3 + 4. Let x be (22(-1)/(-3))/34. Let h = x - -2/17. Which is the nearest to s? (a) h (b) -0.1 (c) 3/2 c Let p = 3.3 - 3.2. Which is the closest to p? (a) 4 (b) -1/6 (c) -1 b Let x be 5/7 + (-2)/(-7). Let t = -2 + 1.8. Let o be (-3 - 1) + (-352)/(-66). Which is the closest to -1? (a) x (b) t (c) o b Let l = 7 - 8. Let x be (l/5)/(6/(-15)). Which is the nearest to 1? (a) 3 (b) x (c) 0.2 b Suppose 4 = 3g + 7. Suppose 3w - w + 6 = -2d, 0 = d - 3w - 13. Which is the nearest to d? (a) -0.2 (b) -4 (c) g a Suppose 50 - 17 = -3c. Let o = 16 + c. Suppose -ob = -b. What is the nearest to b in 1, 3, 0.2? 0.2 Let u = 1.9 - 1.5. Let o = -0.2 + u. Which is the closest to o? (a) 1/2 (b) 4/3 (c) 0.2 c Let r(p) = p3 + 2p*2 + p + 10. Let x be r(0). Let z be 1/(-2)x/15. What is the nearest to 1/4 in z, 0, 4/3? 0 Let m = -0.2 + -1.8. Let p = -0.99 + -0.01. Which is the closest to p? (a) 0.5 (b) m (c) 2/13 b Let j = 0.01 + 4.99. Let m = 28 + -28.2. What is the nearest to -2/3 in m, j, 2/3? m Suppose -2g = 5p - 21, -4p + 5 + 22 = 5g. Let k be (g/30)/((-3)/18). Let n = 0.5 + -4.5. What is the nearest to -1/3 in k, n, 0? k Let p = -4 - -2. Let g = p + -4. Let h = 11 + g. Which is the closest to 1? (a) -4/7 (b) -5 (c) h a Suppose 3d - 2n = -8, 2d - 3d + 5n = 20. Suppose z + 2 + d = 0. Which is the closest to -1/4? (a) 2 (b) z (c) -4/7 c Let l be ((2 - 3) + 0)/1. Let t = 67 - 199/3. Let n be 2/(-5) + 11/40. Which is the nearest to t? (a) -0.4 (b) l (c) n c Let j = -2 - -1. Let i = -4 + 3.5. Let v = 3.5 - i. Which is the closest to j? (a) 1 (b) -1 (c) v b Let z be (-3)/(-21)4/4. What is the nearest to 0.1 in 0.3, z, 0.1? 0.1 Let o = -25 - -13. Let k be 8/o + (-16)/(-42). Which is the nearest to k? (a) 0.1 (b) -1 (c) 4/5 a Let p = 5.1 + -5. Suppose -z - 5i = -2z + 19, -2z + 45 = -3i. Suppose 0 = 2j + 2q - 3q - 9, 5j = q + z. What is the closest to 1/4 in p, -1/3, j? p Let j be ((-12)/(-18))/((-2)/9). Let q = j - -1. Let v = 0.1 - 0.2. What is the nearest to v in q, 2, -0.4? -0.4 Let y = -2 + 11. Which is the nearest to 1/4? (a) 4 (b) -3/2 (c) y b Let t = 6 - 5. Let m be 16/(-6)*(-24)/(-16). What is the closest to -2 in t, m, 4? m Let z be 2/(-7 + (2 - (-2 + 5))). Which is	{ "pile_set_name": "DM Mathematics" }
*3 and give n. -2 Rearrange (-3 - 1 + 2)(-8 + 8 + u) + 3u + u - u to the form gu + a and give g. 1 Express -c*4 + 5c - 2c + c + 0c*3 + 11c*3 + 7 as wc*2 + xc + jc4 + kc3 + a and give w. 0 Rearrange m2 - 3m3 + 2m*4 - 106 - 4m*4 + 2m + 105 to the form um3 + d + jm*2 + am*4 + rm and give d. -1 Rearrange (-x + x + 5x)(-x + 0x + 4x) + (-5 - 3x + 5)(1 - 4 + 2)(8 - 2x - 5 + 0x) to the form y + tx + ix2 and give t. 9 Rearrange -113 + 38 + 44 + 30 + 83n + (-3n + 2n - 2n)(-1 - 3 + 6) to the form un + b and give u. 77 Express 24 - 37 - 50 - q as lq + r and give r. -63 Express (-49 + 27 + 27)(0w - 4w - 1 + 2) in the form bw + l and give b. -20 Rearrange (0 + 0 - 5)(-3 + 6 + 0)(0l2 - l2 + 2l*2)(0l + 11l - 2l) to the form xl*2 + o + bl + il3 and give i. -135 Express 370v + 1687 - 1687 in the form wv + o and give w. 370 Rearrange 6j*3 - 4j*3 - 2j*3 - 18j*2 + 4j*3 + 15j*2 to the form pj + ij3 + gj2 + f and give f. 0 Rearrange -p4 + 1 + 100p - 201p - p*3 + 100p - 4p2 to mp*4 + gp + qp3 + l + np*2 and give q. -1 Express (-3t + 0t3 - t2 - 2t*3 + 3t*2)(122t - 236632 + 236632) in the form st*4 + yt*3 + m + xt*2 + ht and give m. 0 Rearrange 4j + 12j + 861 - 18j to u + qj and give q. -2 Express 206r2 + 2 - 411r*2 + 12r*3 + 205r*2 - 3r in the form zr + hr*3 + o + xr*2 and give z. -3 Express (671s*2 + 366s*2 + 127s*2 + 763s*2)(0s + 0s - 3s) as ps + xs2 + us*3 + o and give p. 0 Rearrange (-f + 0f - f)(0 - 1 + 3)(-46 - 169 + 16) to p + wf and give w. 796 Express 138k - 2k4 + 3k*3 - 68k + 2k2 + 2 - 6 - 67k in the form ik4 + zk + jk2 + uk*3 + m and give u. 3 Express 195 - 2w - 46w4 - 382 + 189 + w2 in the form ow*3 + xw + a + uw2 + jw*4 and give a. 2 Rearrange -116n + 72 - 112n + 229n to j + bn and give j. 72 Express (0y - 3 + 2y - y)(-5 - 82 - 7) in the form h + oy and give h. 282 Express (-3x - x + 2x + (0x - 3x + 6x)(6 - 5 + 0) + 4x + 2x - 2x)(-3x + 3 - 3) in the form g + bx2 + hx and give b. -15 Rearrange 6b4 + 449b*3 - 447b*3 + 0 - 1 - 6b + 3 to mb4 + lb*2 + db*3 + x + cb and give d. 2 Express -8k3 + 2077k*4 - 3 - 2078k*4 - 7k*3 as fk*2 + uk*3 + mk + ck4 + y and give u. -15 Rearrange (0 - 8 + 0 + (0 + 3 - 1)(3 - 5 + 3))(3x - 3x2 - 1 + 10x + x) to o + yx2 + rx and give o. 6 Express 4l - 58l*2 + l - 4l - 4 + 4 - 3l2 + (0 + 2 - 1)(-2l2 - l2 + l2) as x + ul*2 + ol and give x. 0 Rearrange (3s - s + 0s + (4 + 0 - 1)(0s + s + s))(7s - 20 + 20)(-21 + 1 - 2) to ks*2 + us + l and give k. -1232 Rearrange -5x + x2 - 2x + 15x - 2x + 2x3 to the form fx*2 + kx + jx3 + r and give f. 1 Express (3g*2 - 2 + 10 + 2)(-3g - 1 + 1) - 2g*3 - 2g + 2g + 2 as og*2 + mg*3 + f + wg and give w. -30 Rearrange 136z + 173z - 36z to the form gz + f and give g. 273 Express -27 - 17 + 6k + 59 - 3k*2 - 30 as pk + y + rk2 and give y. -15 Express (-2u - 4 + 4)(6 - 6 - 5u*3) - 9u*4 - 14u*4 - 4u*4 as zu*4 + vu*3 + l + pu + yu2 and give z. -17 Express (4 - 1 - 2 + (-3 + 3 + 1)(4 - 5 + 2))(2687n*4 - 461n*4 - 1216n*4) as on*3 + un + fn2 + in4 + b and give i. 2020 Rearrange h4 - 3h4 + 7h*2 - h - 2h*2 - 3h*3 to the form jh*2 + v + xh*3 + oh + kh4 and give x. -3 Rearrange (-q + 4q - 2q)(-18q3 + 705q - 705q) - 26q*3 + 2q*4 + 9q*3 + 15q*3 - 2q to the form yq3 + cq*4 + u + iq + lq2 and give i. -2 Rearrange 4h - 5h3 - h3 - 6h + 9h3 + 20h*2 to the form sh*3 + lh + qh2 + z and give s. 3 Rearrange -98 + 53 + 45 + 346x to the form qx + w and give q. 346 Rearrange (316 + 315 - 630 + 25x)(0 + 0 + 2x)(2 - 2 + 1) to the form tx + ax2 + f and give a. 50 Rearrange -81 + 187x*2 + x - 11x*2 + 81 to the form s + fx + tx2 and give t. 176 Rearrange 5y*3 + 366y + 1 - 3 - 364y to the form f + gy*2 + iy*3 + ky and give i. 5 Express (3i3 + 23i*2 - 23i*2)(-2 + 0 + 0)(-4i + i - 5i) as g + xi*3 + vi + bi2 + ki*4 and give k. 48 Rearrange -3m + 4m - 5m + 0m + 0m - 2m + (1 - 3 + 1)(-3 + m + 3) - 1 + 2m - 2 + 0 to gm + q and give g. -5 Express (-573 + 2 - 29 + (3 - 2 + 0)(-1 + 0 + 0))(g - 1 + 1)(-3g + g + g) in the form pg + cg*2 + s and give c. 601 Express (-169h + 5010 - 5010)(-4 + 5 + 1)(0 - 2 + 4)(0h3 + h3 + 0h3) in the form yh*3 + uh*4 + ah + rh2 + q and give u. -676 Rearrange 272c*2 - 273c*2 + 0c + 490c to the form u + dc*2 + zc and give z. 490 Express 3527 - 3q - 3567 - 2q as z + gq and give z. -40 Express 48z*2 - 2886z*3 - 10744z*3 - 37z*2 - 11z*2 + (2z + 0z + 0z)(-2 + 2 - 2z*2) as wz + sz3 + az*2 + x and give s. -13634 Express 14150 - 169x - 14150 + (-x + x + 2x)(0 + 2 - 6) as w + sx and give s. -177 Rearrange 2x*3 + 33x*2 - 32x*2 + 14x*4 - 17x*4 + 1 + 0x*3 to the form ox*3 + vx*4 + l + nx*2 + ux and give v. -3 Express (-3a3 + 7a*3 + 8a*3)(-6 + 7 + 7a + 4) as ya*4 + c + ja*3 + qa + fa2 and give j. 60 Express 32j + 149j + 110j - 17j as r + nj and give n. 274 Express 65 - 105919b2 - b3 + 105919b*2 as x + jb*2 + sb*3 + ob and give o. 0 Rearrange (3w + 0w - 2w)(-w + 0 + 0) - 3w2 - 8196w + 8196w - 100 to the form hw*2 + p + aw and give p. -100 Express (7 + 4 - 12)(5m*3 - 39m*3 - 11m*3) as pm*3 + qm*2 + a + zm and give p. 45 Rearrange -46f + 37f + 8f2 - 11f*2 to the form uf + k + lf2 and give l. -3 Rearrange (-19k + 17k + 11k)(k + 0 + 0) - k - 8k*2 + 16 + 5 + 7k*2 to ck + hk2 + n and give h. 8 Express -15b + 9b - 5b*2 + 21b + 22b as cb*2 + x + ub and give c. -5 Express (184 - 184 + 11l)(60l - 5l + 7l) as ml*2 + k + bl and give m. 682 Express k*3 - 6 + 8k*4 - 7k*4 + 9 in the form mk + a + lk2 + qk*3 + tk*4 and give t. 1 Express 10f - 25f - 316 + 8f + 9f in the form df + j and give d. 2 Rearrange -74q - q4 + q3 - q4 - 109q + 34q + 4q*4 to oq*3 + xq*4 + pq + v + wq2 and give p. -149 Rearrange (-28 + 28 + 4h*2)(-109 - 9 - 67 + 6) to i + zh + sh*2 and give s. -716 Rearrange (1062 - 1062 - 44n)(-72n + 72n + 12n*2) to ln*3 + gn + f + tn2 and give l. -528 Express 26 + 23 - 5z + z*2 + 412z - 49 in the form q + fz + yz*2 and give f. 407 Rearrange -6078o + 3 - 3 + 6078o - 65o*2 to p + vo*2 + ko and give v. -65 Express (7h4 - 4h*4 + 16h*4)(-1 + 4 + 0 + 3 - 1 - 4 + 5 + 0 - 3 + (-3 + 0 + 2)(0 + 0 - 1)) in the form xh + zh2 + jh*3 + p + rh*4 and give r. 76 Rearrange 77d - d*2 + 94d - 171d + 1461 to sd + gd2 + r and give g. -1 Rearrange -5 - 75n - 115n - 342n + 150n to a + on and give a. -5 Express u*2 - 28 + 121u - 2u2 - 119u as x + tu + gu*2 and give x. -28 Express 0s*2 + 0s*2 + 22 - 280s*4 + 2s*3 + 283s*4 as is + us4 + fs*2 + b + ts*3 and give b. 22 Rearrange -2p*4 + 1 - p + 161p*3 - p + 5 - 156p*3 to the form mp*2 + w + up*3 + cp*4 + hp and give w. 6 Rearrange -n + n*2 + n + (2n - 4n + 0n)(2 - 2 - n) + 231n*2 - 221n*2 - 145n*2 to jn + z + kn2 and give k. -132 Rearrange 574r + 953r - 136r to d + wr and give w. 1391 Express (3l*2 - 2l2 + l2)(2697l - 1349l - 1349l + 63) in the form sl + ml*3 + fl*2 + u and give m. -2 Express -147k + 394k + 613k + 683k - 13k in the form ok + g and give o. 1530 Rearrange (-1 + 4 - 1)(-4u + 6u - u) + 1228u - 33628 + 33628 + 2u - 5u + u + (4u + 0u - 5u)(-1 + 5 - 3) to the form lu + p and give l. 1227 Rearrange 132h - 28h + 21h to the form nh + v and give v. 0 Rearrange 2d4 + 2 - 1 + 37d3 + d2 + 50d - 22d - 28d to w + od*3 + hd*2 + ud*4 + rd and give w. 1 Express 18 - 17 + 0y2 - 2y + 7 - 2y2 as a + qy*2 + jy and give j. -2 Rearrange (-36678 + 36678 - 339r)(3r + r + r) + 3r*2 - 3r2 + r - r2 to the form kr2 + cr + s and give k. -1696 Express 7q - 5q - 2q - 2q in the form mq + w and give w. 0 Express 58x2 - x3 - 1	{ "pile_set_name": "DM Mathematics" }
+ 336t2/5 - 9408t/5 = 0. 0, 56 Factor -4l4/3 - 7l3/3 - l2. -l*2(l + 1)(4l + 3)/3 Factor 2f3/3 + 8f*2 + 24f + 64/3. 2(f + 2)2(f + 8)/3 Let -5f4 - 70f*3 - 360f*2 - 810f - 675 = 0. Calculate f. -5, -3 Factor -2m2/7 + 1024m - 917504. -2(m - 1792)2/7 Let -4i*2/3 - 64i - 768 = 0. Calculate i. -24 Suppose 2u4/3 - 26u*3/3 + 92u*2/3 - 8u - 48 = 0. Calculate u. -1, 2, 6 Factor -121x3/4 + 154x*2 - 141x + 36. -(x - 4)(11x - 6)*2/4 Determine s so that -25s*4 + 47s*3 + 31s*2 - 47s - 6 = 0. -1, -3/25, 1, 2 Find t such that 2t2/11 + 204t/11 - 416/11 = 0. -104, 2 Factor 2k2/9 - 116k/9 + 38/3. 2(k - 57)(k - 1)/9 Factor -5b2 + 85210b - 363037205. -5(b - 8521)2 Solve -2w*4 + 624w*3 - 1240w*2 = 0. 0, 2, 310 Factor 3w*4 + 9w*3 - 69w*2 + 99w - 42. 3(w - 2)(w - 1)*2(w + 7) Determine h, given that 5h3 - 5h*2 - 80h + 80 = 0. -4, 1, 4 Suppose 6k5/11 + 20k*4/11 - 52k*3/11 + 46k/11 - 20/11 = 0. Calculate k. -5, -1, 2/3, 1 Factor 3w5/4 + 15w*4/2 + 27w*3 + 81w*2/2 + 81w/4. 3w(w + 1)(w + 3)3/4 Solve -2j*4/13 - 4j*3/13 + 14j*2/13 + 16j/13 - 24/13 = 0. -3, -2, 1, 2 Determine x so that -4x5/3 - 103x*4/3 - 566x*3/3 - 1028x*2/3 - 130x + 57 = 0. -19, -3, -1, 1/4 Determine b so that -2b3/7 + 2b*2 + 36b/7 = 0. -2, 0, 9 Factor -3j3/4 + 153j*2/4 - 2025j/4 + 1875/4. -3(j - 25)2(j - 1)/4 Solve 2a4/5 - 24a*3/5 + 94a*2/5 - 24a = 0. 0, 3, 4, 5 Factor f*2/2 + 519f/2 - 260. (f - 1)(f + 520)/2 Factor y3/3 + 8y*2/3 - y/3 - 8/3. (y - 1)(y + 1)(y + 8)/3 Factor v3 + 404v*2 + 40397v - 82418. (v - 2)(v + 203)2 Let -4d*4/3 + 60d*3 - 644d*2 - 2116d/3 = 0. What is d? -1, 0, 23 Suppose -2d3 - 168d*2 - 3840d - 12800 = 0. Calculate d. -40, -4 Factor 3l2 - 21l + 18. 3(l - 6)(l - 1) Factor -b*3/8 - 1035b*2/4 - 1071225b/8. -b(b + 1035)2/8 Factor 27h*4 - 78h*3 + 75h*2 - 24h. 3h(h - 1)*2(9h - 8) Solve -5n*4 - 90n*3 - 400n*2 + 90n + 405 = 0 for n. -9, -1, 1 Suppose -6d2/5 + 48d/5 = 0. Calculate d. 0, 8 Factor -50s3 - 4s*2 + 50s + 4. -2(s - 1)(s + 1)(25s + 2) Factor 3o4 - 30o*3 - 36o*2 + 30o + 33. 3(o - 11)(o - 1)(o + 1)2 What is m in 12m*5 - 68m*4 - 72m*3 + 272m*2 + 96m = 0? -2, -1/3, 0, 2, 6 Factor 2q2/3 - 2020q/3 + 510050/3. 2(q - 505)2/3 Factor 10q*2/7 + 122q/7 + 24/7. 2(q + 12)(5q + 1)/7 Let 2q*3/3 - 2074q*2/3 + 178882q + 179574 = 0. What is q? -1, 519 Solve 396h3 - 72h*2 - 44h + 8 = 0 for h. -1/3, 2/11, 1/3 Suppose -3h3 + 438h*2 + 3h - 438 = 0. Calculate h. -1, 1, 146 Find y, given that -3y3 - 378y*2 - 1476y - 1464 = 0. -122, -2 Determine x, given that -x*2/5 + 1162x/5 - 337561/5 = 0. 581 Suppose s4/2 - s3 - 9s2/2 + s + 4 = 0. What is s? -2, -1, 1, 4 Factor -4a*3/7 + 336a*2 - 49392a. -4a(a - 294)*2/7 Solve 4l*3/9 + 332l*2/9 + 2240l/3 - 784 = 0 for l. -42, 1 Factor 3b2 - 177b - 8736. 3(b - 91)(b + 32) What is g in -110450g5 - 272130g*4 - 219621g*3/2 - 15028g*2 - 1317g/2 - 9 = 0? -2, -1/5, -3/94 Let -p*2/5 - 8p/5 = 0. What is p? -8, 0 Factor -5a4/3 + 115a*3/3 - 110a*2/3. -5a*2(a - 22)(a - 1)/3 Factor 5l*4 - 300l*3 + 1140l*2 - 1120l. 5l(l - 56)(l - 2)2 Factor -2j*2 - 14j + 36. -2(j - 2)(j + 9) Factor -q*3 + 30q*2 - 188q + 264. -(q - 22)(q - 6)(q - 2) Factor 4q4 - 5460q*3 + 16356q*2 - 16348q + 5448. 4(q - 1362)(q - 1)*3 Suppose 5p*3 - 80p*2 = 0. Calculate p. 0, 16 Suppose -12u*5 - 12u*4 + 309u*3 - 294u*2 + 72u = 0. What is u? -6, 0, 1/2, 4 Factor 4r3/5 + 888r*2/5 + 65712r/5 + 1620896/5. 4(r + 74)3/5 Factor -3r*2/4 - 57r/4 - 27/2. -3(r + 1)(r + 18)/4 Factor 4j4/3 - 23072j*3/3 + 16634912j*2 - 47975086208j/3 + 17295018577984/3. 4(j - 1442)4/3 Determine a so that -2a*5/3 - 32a*4/3 - 18a*3 + 32a*2/3 + 56a/3 = 0. -14, -2, -1, 0, 1 Suppose -4d3/3 + 16d*2/3 = 0. What is d? 0, 4 Factor 3u*4 - 33u*3 - 117u*2 + 1377u + 1458. 3(u - 9)2(u + 1)(u + 6) Factor -v4/2 + 2v3 - v2 - 2v + 3/2. -(v - 3)(v - 1)*2(v + 1)/2 Factor 5t4 + 940t*3 + 44175t*2 - 940t - 44180. 5(t - 1)(t + 1)(t + 94)2 Determine h, given that -2h*5/11 - 222h*4/11 - 8400h*3/11 - 123088h*2/11 - 559776h/11 + 691488/11 = 0. -42, -14, 1 Suppose 2u5 - 12u*4 - 56u*3 + 12u*2 + 54u = 0. What is u? -3, -1, 0, 1, 9 Factor 8c2 + 1940c + 968. 4(c + 242)(2c + 1) Suppose 2x*5 + 24x*4 + 76x*3 - 32x*2 - 270x + 200 = 0. Calculate x. -5, -4, 1 Find k such that k*4/4 - 3k*3/2 + 9k*2/4 - k = 0. 0, 1, 4 Determine b, given that -2b*5 - 12b*4 - 18b*3 + 8b*2 + 24b = 0. -3, -2, 0, 1 Factor -5s3 - 95s*2 - 575s - 1125. -5(s + 5)2(s + 9) Suppose 5r4 + 35r*3 + 40r*2 - 140r - 240 = 0. Calculate r. -4, -3, -2, 2 Factor 4s2 + 48s + 140. 4(s + 5)(s + 7) Factor -5b4/3 + 2503b*3/3 - 500b2. -b2(b - 500)(5b - 3)/3 Solve 2c*5/7 - 2908c*4/7 + 1411346c*3/7 - 229573784c*2/7 + 454925152c/7 - 226759808/7 = 0. 1, 484 Let -40a5 - 70a*4 - 15a*3 + 20a*2 + 5a = 0. Calculate a. -1, -1/4, 0, 1/2 Factor -20u5 + 52u*4 - 44u*3 + 12u*2. -4u*2(u - 1)*2(5u - 3) What is r in -r3/4 - 63r*2/2 - 1323r - 18522 = 0? -42 Factor -5p3 - 35p*2 + 50p + 80. -5(p - 2)(p + 1)(p + 8) Determine v so that v4 + 17v*3/3 - 8v*2/3 - 4v = 0. -6, -2/3, 0, 1 Factor d*4/4 - 105d*3/4 + 751d*2 - 3225d + 2500. (d - 50)*2(d - 4)(d - 1)/4 Find f such that 3f*5/8 + 3f*4 - 15f*3/8 - 15f*2 + 3f/2 + 12 = 0. -8, -2, -1, 1, 2 Factor 15z2 - 138z + 27. 3(z - 9)(5z - 1) Factor -t3/5 - 37t*2/5 - 323t/5 + 361/5. -(t - 1)(t + 19)2/5 Let 5c*3 - 145c*2 + 275c - 135 = 0. What is c? 1, 27 Factor y*4 + 1803y*3 + 1083603y*2 + 217081801y. y(y + 601)3 Factor 25m*4/3 + 35m*3/3 + 11m*2/3 + m/3. m(m + 1)(5m + 1)*2/3 Suppose 3b*2/8 - 123b/4 + 432 = 0. What is b? 18, 64 Factor -3v2 - 150v - 1875. -3(v + 25)2 Factor -2m*4/13 + 8m*3/13 - 6m*2/13. -2m*2(m - 3)(m - 1)/13 Find q such that -q2/4 + 519q/4 = 0. 0, 519 Suppose 5b3 + 365b*2 + 6840b + 6480 = 0. What is b? -36, -1 Suppose -c*2 + 3c + 18 = 0. Calculate c. -3, 6 Factor 48l3/5 - 24l*2 - 861l/5 - 882/5. 3(l - 6)(4l + 7)2/5 Find j such that -j3/10 - 11j*2/10 - 7j/10 + 147/10 = 0. -7, 3 Determine q, given that -q*3/4 + 11q*2/4 - 8q + 7 = 0. 2, 7 Factor 2c2/5 + 504c + 158760. 2(c + 630)2/5 Determine a so that 2a*3 + 32a*2 + 118a + 88 = 0. -11, -4, -1 Determine j, given that j*3/4 + 4j*2 - 35j/4 + 9/2 = 0. -18, 1 Let 3p5 + 27p*4 + 30p*3 - 108p*2 - 168p = 0. Calculate p. -7, -2, 0, 2 Factor -3n4 - 27n*3 + 30n*2. -3n*2(n - 1)(n + 10) Determine p so that -p3/4 - 111p*2/4 - 55p/2 = 0. -110, -1, 0 Suppose -a*3 - 14a*2 + 385a - 1450 = 0. What is a? -29, 5, 10 Let -5p5 + 75p*4 - 360p*3 + 540p2 = 0. Calculate p. 0, 3, 6 Factor x2 + x. x(x + 1) Factor -2o*3 - 142o*2 - 1238o - 1098. -2(o + 1)(o + 9)(o + 61) Solve 3r*4/2 - 24r*3 + 96r*2 = 0 for r. 0, 8 Factor 3b*3/4 + 7489b*2/4 + 1168752b + 389376. (b + 1248)*2(3b + 1)/4 Suppose 4a*3 - 368a*2 + 724a - 360 = 0. What is a? 1, 90 Factor -h*2/8 + h/2 + 35/2. -(h - 14)(h + 10)/8 Factor 2b4/7 + 10b*3/7 + 12b*2/7 - 8b/7 - 16/7. 2(b - 1)(b + 2)*3/7 Solve 27s*5/5 + 66s*4/5 + 51s*3/5 + 12s*2/5 = 0 for s. -1, -4/9, 0 Factor 729c*5/4 + 486c*4 - 783c*3/4 - 2219c*2/2 - 49c + 686. (c - 1)*2(9c + 14)3/4 Suppose y4/3 + 13y*3/3 - 119y*2 + 1715y/3 - 1372/3 = 0. Calculate y. -28, 1, 7 Determine l, given that -2l2 + 50l + 1800 = 0. -20, 45 Factor 2f4 - 92f*3 + 962f*2 + 2208f + 1152. 2(f - 24)2(f + 1)*2 What is y in 2y*5/5 - 132y*4/5 + 256y*3/5 + 4y*2/5 - 258y/5 + 128/5 = 0? -1, 1, 64 Factor 3k2/5 + 438k/5 + 15987/5. 3(k + 73)2/5 Solve 2g*5/11 - 18g*4/11 + 16g*3/11 = 0 for g. 0, 1, 8 Solve -3y*3 - 3411y*2 = 0 for y. -1137, 0 Factor 3m*4 - 84m*3 + 297m*2 - 216m. 3m(m - 24)(m - 3)(m - 1) Find y such that 3*	{ "pile_set_name": "DM Mathematics" }
mine b(-9). -13 Let d(m) = -16m + 40. Let n(r) = -3r + 8. Let t(o) = -2d(o) + 11n(o). Suppose 3v - 57 = -42. Give t(v). 3 Let h(o) = o. Let m(u) = -u - 1. Let t(y) = 5h(y) + m(y). Let z = 697 - 699. Determine t(z). -9 Let k(s) = -s*3 - 6s*2 - 2s + 2. Suppose 0 = -7v + 2v + 280. Suppose 2m + v = 6m. Let b be 105/(-49) + 2/m. Give k(b). -10 Suppose -4 = -2y + 6y. Let a(p) = p3 - p2 + p - 1. Let h(j) = -j3 + j2 + 2j. Let n(z) = yh(z) + a(z). Calculate n(2). 5 Let q(u) = -u2 + u. Let n be (5/10)/(1/(-4)). Let p(f) = -f3 + 7f - 2. Let z(c) = nq(c) + p(c). Let y = -224 + 227. Calculate z(y). 4 Let p = 2121 + -6361/3. Let b(w) be the second derivative of 11w + 0w*2 + pw*3 + 1/4w*4 + 0. Calculate b(-3). 15 Let r(p) = -8p3 - p2 + p - 2. Let s(t) = 31t3 + 4t*2 - 4t + 9. Let q be 36/21 - 2/(-7). Let c(o) = qs(o) + 9r(o). Let z = 2 + -1. What is c(z)? -10 Let f(h) be the third derivative of 0 + 0h + 1/6h*3 + 1/120h*6 - 1/20h*5 - 1/8h*4 + 21h*2. What is f(2)? -9 Suppose -7 = 2g - 13. Let p(n) = -3n2 - 4n + 2. Determine p(g). -37 Let p(b) be the first derivative of b*3/3 + 3b*2/2 - 2b - 3. Let k be p(-4). Let h(g) = g + 1. Let c(m) = -3m. Let f(s) = c(s) + 2h(s). Calculate f(k). 0 Let m(n) = -n + 7. Let p be (15(-6)/9)/(-2). Suppose 5b + 0b = -pc - 20, 5b + 16 = -4c. Suppose b = -11w + 9w. Determine m(w). 7 Let g(p) = p*3 + 7p*2 - 6p + 11. Let s be (-6)/1414/4-2. Suppose -12 = -t + 14. Suppose -sq = -2x - 31, 0x + 2x - 2q + t = 0. Calculate g(x). -5 Let g(u) = 19u + 6 - 12 - 5. Let y be g(1). Let a(w) = -w*2 + 8w - 1. Calculate a(y). -1 Let v(s) = -12s + 3. Let k(h) = 11 + 7h*2 + 11h - 9h2 - 3. Let d be k(6). Give v(d). -21 Let d(n) = -n3 + 5n*2 + 2. Let x be d(5). Let h(l) = 8l*2 - 5l + 3. Give h(x). 25 Let h be 6/((-6)/5) + (-3 - -2). Let k(z) = z*2 + 5z + 9. Calculate k(h). 15 Suppose q = 3q - 12. Let c(f) = 21. Let w(g) = g + 62. Let l(t) = -7c(t) + 2w(t). Let o(k) = k - 11. Let a(s) = ql(s) - 13o(s). Calculate a(0). 5 Let u be 1/((-3)/(-11)) - (-28)/21. Suppose l = -4f - 9, 3f - ul + 11 + 13 = 0. Let q(n) = 5n + 2. What is q(f)? -13 Suppose -5m + 86 + 9 = 0. Suppose 0 = -5v + 4 - m. Let i(h) be the third derivative of -h6/120 - h5/20 + h4/12 + h3/6 + 45h*2. Give i(v). -5 Suppose 304r = 292r. Let u(t) = t3 - t2 - t + 18. Determine u(r). 18 Suppose 4n + 3k = 2n - 12, -3n + 4 = -k. Let a(j) = -28 + 14 - 2j + nj. What is a(-11)? 8 Let q(i) = 2i*3 + i - 7i + 6 - 3 + 4i + 3i*2. What is q(-3)? -18 Let d be -6((-11)/(-3) - 3). Let x be d/(-3)(-24)/(-16). Let w(r) = 0r*2 + 2r - 5r3 - r2 + 1 - x. Give w(1). -5 Suppose 14p = -49 - 7. Let l(t) = 5t2 + t - 11. Let u(o) = -4o*2 + 10. Let q(r) = 5l(r) + 6u(r). Give q(p). 1 Let x(t) = t3 + 9t*2 + 7t - 6. Let f = -1126 - -1118. What is x(f)? 2 Let m(f) be the third derivative of -2 - 31f2 + f3 + 0f - 1/12f4. Let x = 13 + -8. Give m(x). -4 Suppose -3v - 21 = -3c, -5v - 27c = -31c + 32. Let t(j) = -j*3 - 3j*2 + 3j - 3. Give t(v). 1 Let r(g) be the third derivative of 0 + 12g2 + 0g*3 + 0g - 1/24g4. Determine r(0). 0 Let c(y) = -7y*2 - 3y + 4. Let s(n) = -n*2 + n - 1. Let a(k) = c(k) + 3s(k). Determine a(-1). -9 Let t(a) = -a*3 + 6a*2 - 6. Suppose 4i - 45 = 3. Suppose -j = -6j - 30. Let m = i + j. What is t(m)? -6 Let n(a) be the second derivative of -2a5/15 + a3/6 + 6a2 - 9a. Let m(g) be the first derivative of n(g). What is m(1)? -7 Let r(f) = -9f - 7. Let t(k) = -12k - 10. Let m(u) = 7r(u) - 5t(u). What is m(6)? -17 Suppose 0o - 6 = -o. Let y(q) be the third derivative of -q4/24 - q3 + 2q*2. Let w(g) = -g - 7. Let p(l) = -4w(l) + 5y(l). What is p(o)? -8 Let d(k) = k2 + 4k - 63. Let v be d(-10). Let r(p) = -p*2 - 2p - 1. What is r(v)? -4 Let t be 1/(-6) + (-3 - (-2596)/24). Let c(v) = -6 + 2v2 - 3v*2 + tv - 97v. Suppose 0 = -0y - 2y + 14. Determine c(y). 1 Let y(x) = x3 - 11. Let h be (-2)/10 + (-11)/(-5). Let q(t) = -ht + 0t - 4t + 5t + 11. Let r be q(11). What is y(r)? -11 Let v(j) = 12j. Suppose -g + 13 - 9 = 0. Suppose -gh - 4 = -0h - c, 5c - 20 = h. Suppose 3y - 6y + x + 8 = 0, -2y - x - 3 = h. What is v(y)? 12 Let p = -391 + 387. Let w(j) = -j2 + j + 3. Give w(p). -17 Let h(o) = o3 - o. Let r(t) = 2. Let f(c) = h(c) - r(c). Give f(0). -2 Let o(k) = 2k2 - 2k + 4. Suppose 12 = -5b + m + 36, 2b - m = 12. Give o(b). 28 Let p = -19 - -10. Let k = 10 + p. Let r(a) = 2a + 11a - 4a - 8a + k. Give r(2). 3 Let c = 15 + -10. Let s(d) be the second derivative of -d5/40 + d4/4 + 4d3/3 - 15d. Let o(p) be the second derivative of s(p). Calculate o(c). -9 Let m(j) = 2j + 2. Let h = 57 - 22. Let l be 2/(-8) + h/(-20). Determine m(l). -2 Suppose -4y = 3a - 11 - 1, -15 = -5y + 5a. Let r(b) be the first derivative of -3b*2 - 4b + 1 - 1/3by. Give r(-6). -4 Let b(v) = -v - 1. Suppose -3i + 6i - 12 = 0. Suppose 0 + 3 = c + n, c - in = 3. Suppose 0d + cd - 15 = 0. Determine b(d). -6 Let u = -13 - -13. Let o(b) = -b*3 - 3b*2 + 5b + 3. Let w be o(-4). Let h = w - u. Let v(d) = 8d3 - d2. Determine v(h). -9 Let y(a) = a2 - 9a + 9. Let d(g) = -g*3 - 3g*2 + 2g - 2. Let m(s) = -2s2 + 18s - 4. Let t be m(9). Let i be d(t). Give y(i). -9 Suppose -2h + 1 = 3u, -h = -2u - 1 - 3. Let n(x) = x3. Let j(k) = 5k3 - k2 - 1. Let l(f) = -j(f) + 4n(f). Calculate l(h). -3 Let f(d) = 2d*3 + 16d*2 + 13d - 10. Let j be f(-7). Let x(h) = 2h + 3. Determine x(j). -3 Let n(w) = -w + 4. Let g be n(-6). Let z = -6 + g. Let k(m) = 48m*3 - 6m*2 + 5m + 4 - 1 - 47m3. Determine k(z). -9 Suppose -4w + 78 = 14. Let f = -21 + w. Let i(y) be the second derivative of -y*3/6 - 3y*2/2 + 3y - 1. Calculate i(f). 2 Let s(p) = -13 - 10p2 - 11p*2 - 3p*2 + 10p + 25p2. Give s(-11). -2 Let c(k) = k2 - 3k - 14. Suppose -l + 2 = f, -5 + 47 = 5f - 3l. Calculate c(f). 4 Let t(u) = -15u2 - 1. Let w(d) = d3 - 6d*2 + 4d + 21. Let v be w(5). Let n be (-18 + v)(-1)/(-4)2. Determine t(n). -16 Let f(z) = -z - 12. Let r = -650 + 657. Calculate f(r). -19 Let b(i) be the second derivative of -i5/30 - i4/12 - i3/6 - i2 + 9i. Let n(s) be the first derivative of b(s). What is n(-1)? -1 Let a(p) = p3 + 8p*2 + 10p + 1. Let b be a(-7). Let n(h) = -3h + 52. Let d be n(23). Let o = d - b. Let w(j) = -2j*2 + 5j - 2. Give w(o). -5 Let y be ((-4)/3)/((-6)/27). Let l(x) be the third derivative of -x6/120 + x5/10 + x*4/24 + 2x*2 + 450. Calculate l(y). 6 Let y(h) = h. Suppose -4q + 20 = 0, -5i - 2q = 2q - 130. Let x = i + -19. Suppose -xa - a = -16. Determine y(a). 4 Let a = 1 + -6. Let t(z) = z*2 + 24z + 10z2 + 6z*3 + 7z*3 + 4z*2 + 7. Let d(w) = 3w*3 + 4w*2 + 6w + 2. Let h(n) = 9d(n) - 2t(n). Give h(a). -1 Let z(r) = -r*3 + 3r*2 + 5r - 6. Let g(y) = y*2 - 8y - 5. Let u be g(9). Let h(m) = -m*3 + 5m*2. Let x be h(u). Suppose -24 = -2o - x. Calculate z(o). -2 Suppose -5j - t = -0t - 35, 5j - 35 = 5t. Let u(z) = -7z - 1. Let d(a) = 8a + 1. Let c(o) = 6d(o) + 7u(o). Determine c(j). -8 Let s(h) = 2h2 + 5h + 3. Suppose 0 = -3l + 6, -j + l = -0l. Let f be -4 + 4 - 1 - j. Determine s(f). 6 Suppose -4d + 33 = 3s + 3, -4s - 4d + 36 = 0. Let g(v) = v*3 - 5v*2 - v - 6. What is g(s)? 24 Let w(q) = 2q*2 + 5q - 4. Let t(p) = -2p2 + 4p - 5. Let y be t(0). Calculate w(y). 21 Let p(t) = 2t + 27. Suppose 3o = -4w - 28 - 18, -o - 37 = 3w. Give p(w). 1 Let t(y) = 3y + 2. Let a(x) = -x2 + 24x + 5. Let z(o) = -a(o) + 6t(o). Let d = -1 - -7. Calculate z(d). 7 Let l(r) = r - 7 + 9 + 0r. Let k(y) = -y*2 + 12y - 12. Let a be k(9). Suppose -2i + a = i. Calculate l(i). 7 Suppose 200i - 195i = 10. Let h(c) = 2c*2 - 6c + 6. Determine h(i). 2 Suppose -19 = -4w - 11. Let a(p) = -2p*3 - 2p*2 + 2p*w - 4p*2 + 3p*2 + 1. Suppose -2h = 2o - 8, 21 = 2h - 3h + 4o. Determine a(h). 2 Let z(t) = -11t2 + 2t - 5. Let g(d) = 10d2 - 2d + 4. Let q(i) = 5g(i) + 4z(i). What is q(1)? 4 Suppose -7f + 27 + 155 = 0. Let w = -21 + f. Let t(k) = -k3 + 5k**2 - k - 3.	{ "pile_set_name": "DM Mathematics" }
t3 + t2 + t - 1. Let h be y(1). What is the nearest to h in g, 5, -2? -2 Let a(x) be the second derivative of -5x*3/6 - 9x*2 - 14x. Let u be a(-4). Let w be (4 - 58/14)/(u/(-4)). What is the nearest to 0.3 in w, 4, -1/5? w Let i be (-4)/6 - (-1262)/48. Let x be 8/(-4)((-34671)/(-240))/(-13). Let w = i - x. Which is the closest to w? (a) -3 (b) -2/11 (c) 2 c Let w = 95.901 + -96. Let y = -2.099 - w. Let h = 0.3 + -0.1. Which is the closest to -1? (a) y (b) h (c) -5 a Let s = -5648 - -16943/3. Let j = 47/2 + -24. What is the nearest to s in -2.9, 0.1, j, -3/7? -3/7 Let v = 6 - 1. Let y = 4.5 - v. Let p = -1524.2 + 1524. Which is the closest to y? (a) 0.4 (b) -0.5 (c) p b Let r be 2/(-10) - (6 + (-4264)/(-455)). Let c = r - -115/7. What is the closest to -1 in 1, c, 3, 3/4? 3/4 Let z = 924 - 923. What is the nearest to z in 1.06, -36, -2? 1.06 Let k = 0.5944 - 0.8944. What is the closest to -0.6 in k, 0, 2/15? k Let m = 14.4 + -14. Let o = -772 + 777. Which is the closest to 0.1? (a) o (b) -4 (c) m c Let d = 14/5 - 51/20. Let q = -15 + 14. Let k = 8.6 + -9. Which is the nearest to d? (a) q (b) k (c) 3/7 c Let f = 37623 + -149715/4. Let i = -194 + f. Suppose 5k = 0, -2z + 3k - 2 + 0 = 0. What is the closest to i in 2/13, 0.2, z? 0.2 Let v = -48157 + 47859.945. Let x = 294 + v. Let k = -0.055 - x. What is the closest to -1/4 in -0.03, -0.1, k? -0.1 Let g = -74.202 - -11.202. What is the nearest to -1 in g, -0.4, 2, 3/7? -0.4 Let u = 0.4 - 0.3. Let n = -251 - -59. Let f = n - -193. Which is the closest to -2/5? (a) -4 (b) u (c) f b Suppose -5 = v + 3. Let s be 1 + 0 - 2/v. Suppose 0 = -5m - a + 7, -41m + 43m + 35 = 5a. What is the nearest to m in -1/12, s, -1? -1/12 Let i = 101/3 + -33. Let v = 134 - 133.946. Let u = v - 1.054. Which is the closest to i? (a) -7 (b) 2 (c) u b Let o = -5484 + 27422/5. Which is the closest to o? (a) 0.1 (b) -0.3 (c) 82 (d) -0.5 a Let k = 16726 + -150532/9. What is the nearest to 281 in k, 1, -5? 1 Suppose -3m + 5k + 75 = 0, -5m + 2k + 21 + 66 = 0. What is the closest to 9 in -2/5, m, -9? m Let t(z) = -10003z + 20006. Let k be t(2). Let m = -125/4 - -30. Which is the nearest to 0? (a) 4/5 (b) k (c) m (d) 5 b Suppose 26m + 1857 = 1857. What is the closest to m in 5/4, 0.011, 36? 0.011 Let d = -85.4 - -98. Let v = d + -12.8. Which is the closest to 1? (a) -5 (b) 8 (c) v c Let y = -6144 + 6143. Let t = 239/9 - 79/3. What is the nearest to 0 in t, -6, y, 0.4? t Let x be (-1)/(-1 - 0)(-38 - -39). What is the closest to -1/4 in x, 1/4, -21, 0.1? 0.1 Let k = -103614 + 103614.1. Suppose 0 = p + 3p. Let z be p + 4/(-3) + 2. What is the closest to k in z, -1, -0.7? z Let m be 3 - (42/10 - 1). Let x = 396467/1649 - 2/11543. Let l = x - 241. Which is the nearest to -2? (a) l (b) m (c) 1/4 a Let f = -268 + 267.24. Let k = f + 0.86. Let v = 3.1 - 3. Which is the closest to k? (a) v (b) 0.4 (c) 0.5 a Let s = 3970 - 4019. Let m = -133 - -130. Which is the nearest to 2? (a) m (b) 5 (c) s b Let z = 8453/3 + -2818. What is the nearest to 1/4 in -3/7, z, 5/3, 4? z Let q be -1(-629)/340 + (-60)/(-25) + -2. Which is the nearest to q? (a) 0.55 (b) 1 (c) -2/17 b Let u = 23717 - 23712. What is the nearest to -0.1 in -1.2, -0.12, u? -0.12 Let t(o) = o2 + 6o. Let u be t(-5). Let k = 103135 + -103135. What is the closest to u in 3, k, 6? k Let i be 6 - (2 + 10)(-6)/(-8). Let w be (-115)/22-1. Let r be 0 - (i - w/(-40)). Which is the nearest to r? (a) -2 (b) -1 (c) 1/4 c Let s be 24/327/756. Which is the nearest to 0.7? (a) -222 (b) -0.1 (c) 0.2 (d) s d Suppose 5d + 9 = 2d, k - 2d - 7 = 0. What is the closest to 0.2 in 1/2, k, 1/7, -2/13? 1/7 Let o = -3.8 + 0.8. Let h = -48855.8 + 48856. Let z be ((-2)/7)/(-2)2. Which is the closest to h? (a) z (b) -2 (c) o a Let t = -12.79 - 0.21. Let u = t - -8. Suppose 34 = -4q - 5s - 2, 2q + 5s + 28 = 0. What is the closest to 2/5 in u, 0.2, q? 0.2 Let l = -0.00891 - -0.14891. What is the closest to -0.1 in 4, l, 1.1? l Let l be -3 - (-872)/(-763)7/(-3). What is the nearest to l in 1/8, 2/3, 2, 2/15? 1/8 Let b = 249.829 - 250. Let s = 0.171 + b. Suppose 0 = -4j - 20, 0 = 2r + j + 3. What is the nearest to s in r, 2/11, 1/2? 2/11 Let f = 4703 - 42329/9. Which is the closest to -0.2? (a) 0 (b) 2 (c) f (d) 1/3 c Let v = 1/14666 + 3665/21999. Which is the closest to -86? (a) v (b) 4 (c) 1.8 a Let j = -5384 + 5383.7. Let s = 0.74 - -0.06. Let w = s - 0.8. Which is the nearest to w? (a) j (b) -0.5 (c) -2 a Let m = -0.1 + 0. Let n = -1.69 - 9.01. Let l = n + 10.7. Which is the nearest to m? (a) l (b) 0.4 (c) -2 a Let c be 1(0 - (-15)/(-9)). Let x be ((-2)/(-216)6)/(12/(-16)). What is the nearest to -1 in x, c, -1/4? c Let v = 3787.8 + -3788. Which is the closest to 0.43? (a) 0 (b) 1/3 (c) v (d) 0.8 b Let i = 0.34 - 8.34. Let r = i - 30. Let u = r - -37. What is the closest to u in 0, 1/3, -3? 0 Suppose -w - 3y = 378, -7w + 2w + 5y = 1810. Let q = 2561/7 + w. Which is the nearest to -5? (a) 0.4 (b) q (c) -2 c Let i = 34.5 + -34.7. What is the closest to i in -2, -3/4, 5? -3/4 Let z = -35.7 - -35.5. Let u be (-1)/(-2) + 7/(-8). Let t = 41.6 + -42. What is the closest to z in t, 3, u? u Let p be -2 + 1/(-4)(-372)/(-15). Let i = p + 43/5. Let u be 2(-9)/24 - 18/8. What is the closest to i in u, 0.01, -2/7? 0.01 Let o = -227/41 + 1217/205. What is the nearest to -1/4 in 31, 5, o? o Let y = -0.234 + -113.766. Let k = 113 + y. Let p = 6.5 - 7. What is the nearest to k in 0.2, p, -6/5? -6/5 Let m = 596.52 - 598.52. Let z be (-22)/80 - (-4)/10. Let n = -11 - -10.8. Which is the nearest to n? (a) -4 (b) z (c) m b Let k = 4627 + -4431. Which is the nearest to k? (a) -1 (b) -2 (c) -5 a Let j = 2 - 2.4. Let g = -126 + 126. Which is the nearest to g? (a) j (b) -1/3 (c) 1 (d) 0.5 b Let t = -171/5 + 103/3. Let y = -4469 + 4468.9. What is the closest to y in t, 0, -2/7? 0 Let c = -1435/5741 + -1/22964. What is the closest to 1 in c, 0.4, -2, 3? 0.4 Let r = -4.88 + -0.12. Let n = -11.1 + 45.4. Let y = n + -34. Which is the closest to 0.1? (a) -2/7 (b) y (c) r b Let y = -1 - 12. Let z(h) = 2h*3 - 11h*2 + 17h - 55. Let q be z(5). Let v(n) = -n + 9. Let x be v(7). Which is the nearest to -0.1? (a) y (b) x (c) q b Let d = -2645 - -2665. What is the nearest to d in -4, -5, -2/5? -2/5 Let r be -2 - 1/(-3)(-1547)/(-259). Let a = 38/111 + r. What is the closest to a in 2/3, 2/9, -7/4? 2/9 Let o = -141.2 - -141. Let l = 1055 + -1055.1. What is the closest to -0.1 in l, 1, o? l Let t = 1 + -3. Let v be ((-3)/(-4))/((-2)/(-4)). Let s be (-489)/630 + 1 + (-85)/6 + 14. What is the nearest to -2/3 in s, t, v? s Let h = 4293.9 + -4254.846. Let s = h - 39. Let g = s + -1.054. Which is the nearest to g? (a) 0.4 (b) -0.3 (c) 0 b Let j = 753/8 + -94. Let r = -62 - -62.1. Which is the nearest to r? (a) -1 (b) 3 (c) j c Let d be (0 - 2/(-9))15/(-2). Let f = -1.112 - -0.112. What is the closest to 0 in 0.2, f, -0.13, d? -0.13 Let w(v) = 2v2 + 51 + 52 - 8v - 107. Let o be w(8). Let j be (10/(-8))/((-15)/o). What is the closest to 2/7 in j, 3, -1? -1 Let z be 4/6(0 - -1). Let w = -47921 + 47915. Which is the nearest to -0.1? (a) -2/9 (b) w (c) z a Let f = 0.02 + -0.08. Let x = -21485 + 21487. What is the nearest to x in f, -3/7, -3, -2/7? f Let y = 2/781 + -1588/10153. Let n = -5.8 + 6. Which is the nearest to -2/23? (a) y (b) 3 (c) n a Let k = -0.58 - -0.68. Let f(m) = -m2 + 5m - 6. Let v = -22 + 26. Let r be f(v). Which is the closest to k? (a) -0.4 (b) 1 (c) r a Let n = 0.3 - 0.4. Let s be (235 - 236)(-11 + 6). Which is the nearest to n? (a) s (b) 4 (c) 0.4 c Let i = -0.322 + 0.722. Let a = 52 + -157/3. What is the closest to a in 5, 1, i? i Let h = 75 - 71. Let s be h/(-8)(-15 - -7). Let y = -91 + 91.3. Which is the closest to 4? (a) y (b) s (c) -2 b Let t = -0.19315 - -0.29315. Let m = 1.1 - 0.1. Let p(n) = -n*2 - 6n + 2. Let u be p(-6). Which is the nearest to m? (a) -0.2 (b) u (c) t c Let o = -2/857 + 1728/5999. What is the nearest to 1 in o, 358/7, -0.2? o Let z = -1283478.06 - -1272501. Let k = z - -11080. Let b = k + -103. What is the closest to -2/3 in -2/9, b,	{ "pile_set_name": "DM Mathematics" }
List the prime factors of d. 7 Let c = 6 + -3. Suppose 2k - 26 = -q - k, k - 62 = -cq. Suppose 0 = -2h + 5j + q + 6, 3h + 2j - 1 = 0. List the prime factors of h. 3 Suppose -g + 3n = 6, 4g + 0g + 2n = 32. List the prime factors of g. 2, 3 List the prime factors of 8/16 + 13/2. 7 Suppose 4 = 4i - 2i. Suppose 10 = 3t - i. Suppose -2y = -ty + 3c + 27, -4y = -3c - 57. List the prime factors of y. 3, 5 Suppose -4l + 40 = 8. Suppose -3s - l = -26. List the prime factors of s. 2, 3 Suppose 5c - b = c + 24, 4b - 24 = -4c. List the prime factors of c. 2, 3 Suppose 7l = -5l + 24. What are the prime factors of l? 2 Let d(q) = -q3 - 3q2 + q + 1. Let h(l) = l2 + 2l. Let g be h(-4). Let m be (g/6 + -2)6. List the prime factors of d(m). 13 Let r(b) = 0b + 2b - 8 - 3b. Let f be r(7). Let k = 21 + f. What are the prime factors of k? 2, 3 Let j(d) = 2d*2 + 20d + 22. List the prime factors of j(-15). 2, 43 Let w = 0 - 2. Let q = 3 - w. Suppose qn - 7s - 5 = -2s, -19 = -n - 5s. What are the prime factors of n? 2 Let x(u) be the first derivative of 3u2/2 - 5u + 3. List the prime factors of x(5). 2, 5 Let b(j) = -j*3 + 5j*2 + 8j - 9. Let c be b(6). Let l = 14 + c. What are the prime factors of l? 17 Let a be (12 - 0)/((-9)/6). Let r(o) = 2o - 17. Let h(n) = -n + 16. Let j(s) = -6h(s) - 5r(s). List the prime factors of j(a). 3, 7 Let i be 0 + (5 - 2 - 15). Let q be (-80)/i - 4/6. Let d = 3 + q. List the prime factors of d. 3 Let b(f) = 41f. List the prime factors of b(1). 41 Suppose 5z - 1 - 1 = -m, -4m + 8 = -3z. Suppose 3b + 30 = -mb. Let t = b + 10. What are the prime factors of t? 2 Suppose 2c = -3i + 11 - 2, -2c + 17 = -5i. Let x be 140/18 + 4/18. Suppose -4w = -cw + x. What are the prime factors of w? 2 Suppose -16f - 408 = -19f. List the prime factors of f. 2, 17 Let i(w) = w2 + 3w - 2. List the prime factors of i(3). 2 Suppose c = -5c + 120. What are the prime factors of c? 2, 5 Suppose -4 = s + 8. Let z be -51s/15. Suppose h - 30 = -zh. List the prime factors of h. 2, 3 Suppose 3 = 4x - 5. List the prime factors of x. 2 Let r(o) be the second derivative of 1/6o*3 - 3/2o*2 + 0 + 1/20o*5 + 5/12o*4 - o. What are the prime factors of r(-3)? 2, 3 Suppose 2k - 4o = -12, 4k + o - 4o = -19. Let n(c) = -c + 3. List the prime factors of n(k). 7 What are the prime factors of (0 + ((-4)/(-8) - 0))234? 3, 13 Suppose -2x = -5 - 11. Let g(j) be the second derivative of -j4/12 + 4j*3/3 + 5j*2 + 2j. List the prime factors of g(x). 2, 5 Let i(h) = -h2 - h + 2. Let n be i(0). Let a(g) = g2 - 2g - 11. Let t be a(5). Suppose nk - tk = -24. What are the prime factors of k? 2, 3 Let r(h) = 35h*2 + 7h + 2. What are the prime factors of r(2)? 2, 3, 13 Let o be 4/10 + 9/15. Let y be 9 + -1 + -4 + o. Suppose yn + 2k - 80 = -3k, -n + 10 = -5k. List the prime factors of n. 3, 5 Suppose 1069 = 7o - 695. What are the prime factors of o? 2, 3, 7 Suppose 18 = s - 10. What are the prime factors of s? 2, 7 Suppose 2b + 58 = t, 2b = 4t - 243 + 41. What are the prime factors of t? 2, 3 Let s(g) = 15g + 2. List the prime factors of s(9). 137 Let l(b) = -b - 2. Let j be l(-5). Suppose 7 = -4q + 27. Suppose 0 = -qa - jx + 37, -3a - 3x = 2x - 19. List the prime factors of a. 2 Suppose -n + 17 = -2. Suppose -4k + n + 25 = -5z, -z = -k + 8. List the prime factors of (9/z)/(3/(-12)). 3 Let x = -11 + 12. Let s(j) = 1 + 8j + 0 + 2j. What are the prime factors of s(x)? 11 Suppose 8 = -2s, 16 = 3k - 4s - 18. List the prime factors of k. 2, 3 Suppose 2i - 15 = -3i. Suppose -f + 2v = 3v - 15, -3v = -i. List the prime factors of f. 2, 7 Let v(s) = s2 + 8s - 1. List the prime factors of v(-12). 47 Let n be 70 + 11 + 6 + -3. Let z(h) = h*3 + 4h*2 + 3h + 3. Let m be z(-2). Suppose ma - n = a. What are the prime factors of a? 3, 7 Let p = -54 - -76. List the prime factors of p. 2, 11 Let z(q) = 3q*2 - 5q - 25. List the prime factors of z(7). 3, 29 What are the prime factors of (121)/(3/9)? 2, 3 Let x = -150 + 210. Suppose x = 4l - 4. List the prime factors of l. 2 Let a(m) = m*3 - 13m*2 - 12m - 3. Let j be (-2)/3(1 + -22). What are the prime factors of a(j)? 5 Suppose -l + 3l = 2f + 26, 5l = 2f + 74. What are the prime factors of l? 2 Let m be (-358)/12 - 2/12. Let a = 21 + m. Let y = a + 17. List the prime factors of y. 2 Let q(u) = -u3 + 2u*2 + 2u - 2. Suppose r - 4 = -2. List the prime factors of q(r). 2 Suppose 0 = -4p + 5x + 8, -4p = -2x + 4x - 8. Suppose o + 4 = 6o - 3a, pa - 2 = o. List the prime factors of o. 2 Let f = 507 - 313. List the prime factors of 8/44 + f/22. 3 Suppose -5x - 1 = -21. What are the prime factors of 21/x12? 2, 3 Let j be (1 + 2)/((-3)/(-12)). Suppose -5z - 53 = -5l + j, -4l = 2z - 34. What are the prime factors of (l/(-8))/(4/(-48))? 3, 5 Let j = -80 + 91. List the prime factors of j. 11 Let j(y) = y + 1. Let v be j(0). List the prime factors of v/((-2)/(-6)) + 1. 2 Let w(n) = -n3 - 3n*2 + n + 1. Suppose -11 = 3m - u, -5u - 16 - 9 = 5m. What are the prime factors of w(m)? 13 List the prime factors of (14/(-5))/((36/210)/(-3)). 7 Let v(k) = k*3 - 2k*2 + 1. Let i be v(1). Suppose 11 = -4l - 3q - 0q, -3l + 2q + 13 = i. Let n = 2 + l. List the prime factors of n. 3 Let x = 1 + 1. Let w = x - -10. What are the prime factors of w? 2, 3 Suppose 0f - 12 = 4f. Let k be (3 - 4)4/(-2). List the prime factors of (30/f)/(k/(-4)). 2, 5 Let g(i) = -i3 - 4i*2 + 2i - 2. Let w be g(-4). Let b(n) = n + 5. Let u(c) = -c - 1. Let l(k) = b(k) + 2u(k). What are the prime factors of l(w)? 13 What are the prime factors of ((-143)/22)/((-1)/4)? 2, 13 Suppose 165 = 5n - 4g, -g - 4g = n - 62. Suppose 5d = 2q + 17, -9 = 2q + 4d - n. Suppose 5f - 3f - q = 0. List the prime factors of f. 2 Let h(a) = 0 + a*3 + 6 + 3a*2 - 2. Let u be h(-3). Suppose -ur + 9r = 35. What are the prime factors of r? 7 Suppose -4n = -6n + 16. Let h(l) = -l3 + 8l*2 + 7l - 12. What are the prime factors of h(n)? 2, 11 What are the prime factors of 64/(4 + 6/(-2))? 2 Suppose 0 = -13w + 11w - 20. Let o = 52 + w. List the prime factors of o. 2, 3, 7 Suppose 0 = v - 12 - 35. List the prime factors of v. 47 Suppose 3s - 58 = -g, -3g + 202 = -4s - s. What are the prime factors of g? 2 Let r = 47 + 16. What are the prime factors of r? 3, 7 List the prime factors of (-3)/(-5) + 224/10. 23 Suppose 6q = 349 + 215. What are the prime factors of q? 2, 47 Let m(v) = 2v2 - 9v - 4. List the prime factors of m(11). 139 Suppose -62 - 46 = 4h. Let w = -4 - h. List the prime factors of 6/(-12) + w/2. 11 Let i(u) = -u3 + 13u*2 - 10u - 14. Let p be i(13). What are the prime factors of (p/27)/(2/(-12))? 2 Let r(o) = o. Let v be r(1). Let m be v/(-5) - 21/(-5). Suppose -my + 19 - 3 = 0, 4w = -5y + 56. List the prime factors of w. 3 Suppose 11 = 5v - 19. Suppose 3l = -2l. Suppose 0 = -3f - 2b + 12, -5f + b - vb + 25 = l. What are the prime factors of f? 2 Suppose -4q + q = 0. Suppose q = 5u - 3u - 32. List the prime factors of u. 2 Let y(t) = 18t*2 + t - 1. Let c be y(1). Let o be c - (-2 + 0 + 2). Suppose 4p + 2 - o = 0. List the prime factors of p. 2 Let r = -21 - -43. Suppose 5q + r = 7q. Let i = q - 7. List the prime factors of i. 2 Suppose -n - 4 - 2 = 0. What are the prime factors of (-4)/n(-180)/(-8)? 3, 5 Suppose a - 18 = -n + 2a, 5a - 130 = -5n. List the prime factors of n. 2, 11 Let n = -2 - -4. Suppose -nt = -b - 4t + 14, 23 = b - t. What are the prime factors of b? 2, 5 Let c(w) = -3w - 4. Suppose 0 = -5j - 5f - 25, -2j - 23 = -j - 5f. What are the prime factors of c(j)? 2, 5 List the prime factors of 7/((-84)/8)-18. 2, 3 Let i(u) = u*2 + u - 2. Let f be i(-3). Suppose fy = 3n - 4, -6y - 3n = -y - 22. What are the prime factors of 10 + -2(y + -1)? 2 Let o = -9 - -16. Suppose -d - 11 = 3b, -b = 4d + 15 + o. List the prime factors of b/(-8) + 71/4. 2, 3 Let c be 4 + -3 + 2 - -1. Suppose 3j = 2i - 24, -4i - cj + 0j = -8. List the prime factors of (i/4)/(1/4). 2, 3 Let b(o) = 3o + 7. Let q(r) = 6r + 13. Let t(p) = 7b(p) - 4q(p). Let h be t(-2). Suppose -hm = -0*m -	{ "pile_set_name": "DM Mathematics" }
. Let w be 2/8 + 14/72. Sort q, w, 0.2 in increasing order. q, 0.2, w Let y(f) = f*2 + 5f - 6. Let r be y(-6). Let u(a) = -a2. Let q be u(r). Let i = 72 - 75. Put i, q, -2 in descending order. q, -2, i Let y(t) = -t3 + 8t2 + 8t + 10. Let r be y(9). Sort 7, r, -3. -3, r, 7 Suppose -3i + 2 + 10 = 5b, b + 4 = i. Put i, 0, 2 in decreasing order. i, 2, 0 Let m(h) be the first derivative of h3/3 - h2/2 - 2. Let b be m(0). Let g = b + 3. Sort 4, g, -2 in ascending order. -2, g, 4 Suppose 4g = 2g, -3h = -2g + 15. Suppose 0 = -2c - 3f + 21 + 1, -5f + 25 = c. Let t = 7 - c. Put 3, h, t in decreasing order. 3, t, h Suppose 4v + 13 = -3. Let l(q) = q + 6. Let s be l(-6). Let i(f) = f*2 - f + 2. Let m be i(s). Sort m, v, 0.3. v, 0.3, m Let q be 3 + 0 + 0 + -2. Put q, -3, 5 in decreasing order. 5, q, -3 Let c = 6944/23 + -302. Put 2, c, -0.3 in descending order. 2, c, -0.3 Let g = 0.3 - 0.2. Suppose 29 = 5f + 5i - i, 3f - 10 = 5i. Let d be f/((-25)/9) + 3. Put -1/10, d, g in ascending order. -1/10, g, d Let u = 2.945 - -0.055. Let z = -3 + 2.5. Let q = z + 0.3. Put q, -2, u in descending order. u, q, -2 Let v(z) = z3 + 2z*2 - 4z. Let n be v(-3). Sort 1, n, -5. -5, 1, n Let m = -4.3 - -4.8. Put -0.5, -0.4, m in increasing order. -0.5, -0.4, m Let u be 15/6 + 1/(-2). Let d(o) = -o2 + 1. Let c be d(2). Put -5, c, u in descending order. u, c, -5 Let f = -0.2 - 0.2. Let a = 0.2 + -0.2. Let l = f - a. Sort 0, l, 5 in descending order. 5, 0, l Let x = 2 - 2. Sort x, 3, 1. x, 1, 3 Let l(h) = -h3 + 9h - 4. Let b be l(-3). Suppose 2q - 2t - 8 = 0, -4q - 5t + 24 = -t. Put 0, q, b in decreasing order. q, 0, b Let a(r) = 11r*3 + 2r*2 - 2r + 1. Let v be a(1). Let x be (-3)/v + (-33)/12. Let k(c) = c*3 + 3c*2 + c + 3. Let j be k(-3). Sort j, x, -5. -5, x, j Suppose -4b = -14 + 6. Let g be b/(-5) + (-68)/(-20). Sort -2, -3, g in increasing order. -3, -2, g Let i be (-12)/(-3) - (-12)/(-4). Put 5, i, -3 in decreasing order. 5, i, -3 Suppose -5 - 7 = 4b - 4g, 4g - 20 = 0. Suppose 0 = -bz - 0z + 2. Sort 4, 0, z in descending order. 4, z, 0 Let z(b) = b - 4. Let v be z(2). Put 1/6, 2/3, 0.2, v in decreasing order. 2/3, 0.2, 1/6, v Let x be 1 - 1 - (-16)/(-315). Let g = x + -6/35. Sort 6, -2, g. -2, g, 6 Let a = 5 - 9. Let v = -2.4 + 2. Let h = 8/15 + -17/60. Put v, a, h in decreasing order. h, v, a Let m = 2 + 2. Let z = 2.85 - -0.15. Put z, m, -2/21 in descending order. m, z, -2/21 Let v = -3310.9 + 3110. Let s = 191 + v. Let x = s + 10. Put -1, -6/5, x in descending order. x, -1, -6/5 Let p be (-11)/(-33) + 8/3. Suppose 5n = -0n + 40. Suppose 2j + 0j + n = 0. Sort p, j, -2 in increasing order. j, -2, p Let c be (-6)/(-4)(-92)/6. Let m = -89/4 - c. Put 1, m, -5 in ascending order. -5, m, 1 Let s = 0.5 - 2.5. Sort s, 1, 2. s, 1, 2 Let p(t) = 2t2 - t - 1. Let s be p(1). Put 3, 4, s in decreasing order. 4, 3, s Let n be 2 - 5/(40/298). Let t = n - -36. Sort 1/4, 2, t in decreasing order. 2, t, 1/4 Let j(b) = 2b + 5. Let x(h) = -9h - 26. Let k(f) = 11j(f) + 2x(f). Let c be k(-2). Suppose -3m + 1 = 13. Put c, 3, m in increasing order. c, m, 3 Let w(y) = -y*2 + 14y + 11. Suppose -41 = -3s - 4d, 0 = -3s + 8s + 2d - 73. Let h be w(s). Sort -3, h, 2 in descending order. 2, -3, h Let u be ((-1)/12)/(12/(-32)). Put 1/7, u, 2/11 in decreasing order. u, 2/11, 1/7 Let l(g) = -g + 1. Let u be l(0). Suppose -3o - 5 = -2o. Let m = -8 - -13. Put m, u, o in descending order. m, u, o Let t = -0.06 + 1.06. Let g = -2 + 5. Let u = 0.2 - 0.7. Put t, u, g in decreasing order. g, t, u Suppose 0 = -7h - 2h + 36. Let c(g) = 2 + 6g - 3g - 2g. Let v be c(-2). Put -2, v, h in decreasing order. h, v, -2 Let r = -6.5 + 0.5. Sort r, -3, -5. r, -5, -3 Suppose 4d + 3l - 7 = -19, -3d - 4l = 16. Suppose -5t + t + 4 = d. Let s be 12/10 + (t - 3). Put -2/11, -1, s in descending order. -2/11, s, -1 Suppose -k = -2j, -3j = 3k - 4 - 5. Suppose 0 = -2h - 3 - 3. Put h, j, -2 in decreasing order. j, -2, h Suppose -8q + 9q + 4 = 0. Sort -3, 4, q in increasing order. q, -3, 4 Let w = 1551/110047 + -2/1393. Let q = w - -75/316. Sort -1/3, q, -1/4 in increasing order. -1/3, -1/4, q Suppose -s = -4h - 5s + 32, -5h + 8 = -3s. Sort -0.06, 1, 0.2, h in descending order. h, 1, 0.2, -0.06 Let u = -1.6 - -2. Let q = 5 - 4.9. Sort -0.3, q, u. -0.3, q, u Let h be (-26)/(-7) + 4/14. Let m = 3 - h. Let t be (-1 - 7)(-3)/12. Sort m, t, -4. -4, m, t Let j(t) = t2 + t - 1. Let z be j(-2). Put 5, z, 2, -2 in increasing order. -2, z, 2, 5 Let q(c) = -c2 + 6c + 6. Let i(n) = n2 - 7n - 7. Let b(s) = -5i(s) - 6q(s). Let z be b(0). Sort 3, z, -3. -3, z, 3 Let v be -2 - (1 + 3)-1. Suppose -25 = -5j + 2p, -p - 20 = 3p. Sort 1, v, j. 1, v, j Let x = -42 - -37. Sort 1, 8, 2, x in decreasing order. 8, 2, 1, x Let j = -11 - -8. Let l = 2 - j. Sort l, 0.2, 0. 0, 0.2, l Let x = -28.2 - -28. Let g = -3869/34 - -113. Let k = -12/17 + g. Sort x, 0.2, k. k, x, 0.2 Let q = -3 + 3. Let h be ((-3)/(-2))/(3/2). Let l = -3 + h. Sort l, -4, q in increasing order. -4, l, q Suppose -t - 5 = 4t. Sort 1, t, -7. -7, t, 1 Let h = 9 - 4. Put h, 2/17, 2 in descending order. h, 2, 2/17 Let o = 9.73 + 0.27. Let q = 10.2 - o. Sort -0.3, q, 4 in decreasing order. 4, q, -0.3 Let x be 2 - (-3 + 2 + -1). Suppose 2y = 6y - xv - 28, -y - v = 1. Put y, 1, -1 in decreasing order. y, 1, -1 Let o = 0.3 - 0. Let g = -0.6 + o. Let b = -9 - -5. Sort g, b, 0.1 in descending order. 0.1, g, b Let i = 106 + -105. Sort 4, -6/5, i. -6/5, i, 4 Let r = 7.06 - 7. Sort r, 5, -1/9. -1/9, r, 5 Let x(d) = -3d - 1. Let z be x(-1). Suppose 0 = -3k - 3o + 18, -zk = 3k + 2o - 21. Put 1, k, 0 in decreasing order. k, 1, 0 Let a be 1 - 4(-2)/2. Suppose f - 7 = -0y - ay, 5y = 3f + 19. Put 4, -5, y in increasing order. -5, y, 4 Let z = 28 + -28.38. Let g = z - 0.02. Let s = g - -0.6. Put 0.3, -2/5, s in increasing order. -2/5, s, 0.3 Suppose 0 = 4k + 4, -q - 3k + 2 = 6. Let c(y) = 4y*2 + 2y + 2. Let f be c(-1). Put f, q, 0 in ascending order. q, 0, f Let p be (1 - (0 - -4)) + 7. Let q(d) be the first derivative of d*2/2 - 5d + 1. Let s be q(5). Put s, 3, p in increasing order. s, 3, p Suppose -3c = 4i + 13, -2c - c = -3. Put 5, 0, i in descending order. 5, 0, i Let t = -7 - -12. Let v be 1 - (0 + 1)-25. Suppose -5j = x + v - 2, 4x = 4j. Sort t, 3, x in descending order. t, 3, x Let m = 2.21 + -0.21. Sort -3, m, -0.2 in increasing order. -3, -0.2, m Let l(v) = v - 5. Let z be l(4). Suppose -7m = -4m - 15. Sort z, -3, m. -3, z, m Suppose -c + 1 = -2. Let f be c(2 - 2 - -1). Suppose -3m - 10 = p, 6p - 3p = -fm - 12. Sort 2/9, 0, p in increasing order. p, 0, 2/9 Suppose -32 = -3a - 5g, -2a = 3g - 4g - 4. Let m = -35 + 38. Sort m, -0.2, a in increasing order. -0.2, m, a Suppose -p + 6 = 2p. Suppose -i - p = -0i. Sort -3, 2, i in decreasing order. 2, i, -3 Let a = 652/5 - 131. Let b = 0.9 - 0.4. Let m = -0.5 + 0.2. Sort m, a, b in descending order. b, m, a Let f(d) = d2 - 5d - 4. Let n be f(6). Suppose -3o = -3v - 9, v = 4o + nv + 8. Let u be o/12/6. Put u, 0.2, -2 in decreasing order. 0.2, u, -2 Suppose 3d + x + 12 = d, 5d - 2x + 12 = 0. Let f(o) = -2o2 - 1. Let k be f(-1). Sort k, d, -5 in increasing order. -5, d, k Let s = -1 + 3. Suppose 0 = -5c + 4c + sj + 15, j = 2c - 15. Suppose -m + 1 = 0, 2q + m + 6 - 13 = 0. Put q, c, 0 in increasing order. 0, q, c Let r be (-4)/615/5. Sort r, -3, 3 in decreasing order. 3, r, -3 Let r = 91 + -97. Sort 9, 0, r, -5. r, -5, 0, 9 Let f(g) = g2 + 2g. Let y be f(-3). Let l be (-1)/(y/(-18)) + -3. Let j be 3/(9/(-6)) + 6. Sort l, -1, j in decreasing order. j, l, -1 Let h(x) = 3x - 21. Let w(s) = 2s - 11. Let z(k) = -3h(k) + 5w(k). Let g be z(-10). Put 1, g, 0 in descending order. 1, 0, g Let b be ((-3)/6)/(5/(-130)). Let c(u) = u*3 - 12u*2 - 13u. Let n be c(b). Sort 1, -1, n in increasing order. -1, n, 1 Let b(z) = -z*3 + 6z*2 - 4z - 3. Let g be b(5). Let l = g + 0. Suppose -lt + 10 = -4t. Put t, 5, 4 in descending order. 5, 4, t Let f be ((-2)/6)/((-5)/15). Put 0, 4, f in descending order. 4, f, 0 Let z = 7 - 6.7. Put z, -5, 2/9 in descending order. z, 2/9, -5 Let t(b) = -b**2 -	{ "pile_set_name": "DM Mathematics" }
(y) = -65y - 718. Let o be g(-47). What is the highest common divisor of 57 and o? 57 Let o = 28 + -28. Suppose -3m - 7 + 262 = o. What is the greatest common factor of 17 and m? 17 Let m = 235 - 588. Let l = 239 + m. Let x be l/(-18) + 3/(-9). Calculate the greatest common factor of x and 3. 3 Suppose 3j = 3 - 21. Let u = -3 - j. Suppose ui = 3h + 93, 3i = -2i + 2h + 152. What is the greatest common divisor of i and 6? 6 Suppose 0f + 36 = 6f. Let k(a) = a*3 - 7a*2 + 8a - 6. Let g be k(f). What is the greatest common divisor of g and 30? 6 Suppose r = -3r, -90 = -3z - 3r. What is the greatest common factor of z and 25? 5 Let s(j) = 2j*2 + 10j + 83. Let t be s(-6). What is the greatest common factor of 152 and t? 19 Let y be (13 - 7) + (-8)/2. Suppose -2c - k = 6, -12 = yc - 3k + 10. Let f = c - -15. Calculate the highest common divisor of 10 and f. 10 Let b(q) = -15q + 180. Let w be b(-20). Calculate the greatest common factor of 16 and w. 16 Let v = 78 + -45. Let n = 27 - 5. Calculate the highest common divisor of n and v. 11 Suppose 4 - 2 = 2y, y - 575 = -2z. Suppose -289l + zl + 66 = 0. What is the highest common divisor of 88 and l? 11 Let r = 51 - 42. Let b(m) = -m*2 + 13m - 1. Let d be b(r). What is the greatest common factor of 14 and d? 7 Let j be ((-22)/(-1))/((-27)/(-162)). What is the greatest common factor of j and 24? 12 Suppose -5l + 0l - 3w = -156, -4l + 141 = -3w. Calculate the greatest common divisor of 9 and l. 3 Let b = 2073 - 1237. Calculate the greatest common divisor of 88 and b. 44 Let u(r) = 5r*2 - 40r + 17. Let j be u(8). What is the highest common factor of 850 and j? 17 Let q be ((-162)/135)/(3/(-70)). What is the greatest common divisor of q and 20? 4 Suppose 0 = 4z - 33 + 9. Let s = -647 - -655. Calculate the greatest common factor of s and z. 2 Let b be 8 + -2 + (-2 - 2). Calculate the greatest common divisor of b and 5. 1 Let k(b) = 2 + b2 - 4 - 2b - 2 - 2b2. Let t be k(0). Let n(q) = -q3 - 2q*2 + 6q - 3. Let m be n(t). What is the highest common divisor of m and 2? 1 Let k = 1414 - 1386. Calculate the highest common divisor of k and 434. 14 Suppose d - 8d = 49. Let c = 8 + d. Calculate the greatest common factor of 3 and c. 1 Let h be -330/27-3. Suppose -r - 3b + 8b = 25, h = 5r + 2b. Suppose -p - 3 = 0, rn - p = -5n + 18. What is the highest common factor of n and 33? 3 Let t(w) = -w + 4w*2 - 1 - 2w*2 + 9w*2 - 2w2. Let d be t(-1). Calculate the greatest common factor of 72 and d. 9 Let n(v) = -v3 - 15v2 - 26v + 30. Suppose -13 = -8i + 9i. Let j be n(i). Calculate the greatest common factor of 6 and j. 6 Let n(b) = 8b2 + 2b - 1. Let g be 4 - (-3)/6-2. Suppose -t - g = -4t. Let u be n(t). Calculate the highest common divisor of u and 1. 1 Suppose 4z + 358 = -842. Let c be (z/(-36))/((-1)/(-6)). Let u(t) = t3 - 2t*2 - 4t + 4. Let f be u(4). What is the highest common factor of f and c? 10 Let j(y) = -y*2 - 17y + 62. Let u be j(-20). Calculate the greatest common divisor of u and 29. 1 Let f(v) = v*2 - 8v - 2. Let d be f(8). Let m be -2 - d - (-5)/1. What is the highest common divisor of m and 40? 5 Let l be (1 - -109) + -37 + 32. Calculate the highest common divisor of 75 and l. 15 Let w(c) = -32c3 + c2 + 2c + 1. Let k be w(-1). Suppose 5206 - 726 = 20g. What is the greatest common divisor of g and k? 32 Let w(z) = 4z*2 - 6z - 4. Let b be w(4). What is the greatest common factor of b and 12? 12 Let l be (-20)/3(-63)/(-42). Suppose -48 = -3y - 6. Let k be (-12)/(-42) - l/y. What is the greatest common divisor of 5 and k? 1 Let v be 1818/(-12)(-4)/6. Let z(a) = 6a - 44. Let o be z(v). What is the highest common divisor of 16 and o? 16 Let h = 7 + 124. Suppose -5j = -h + 1. What is the highest common divisor of 26 and j? 26 Suppose -3x + 3 = 2f, 3f + 11 - 2 = 0. Let k(y) be the first derivative of 4y*2 - 6y + 1. Let s be k(x). What is the highest common factor of s and 18? 18 Let r(i) = 4i3 - i2 - 1. Let h be r(2). Suppose 5c = -112 + h. Let y = 30 + c. Calculate the highest common divisor of 91 and y. 13 Let o = -445 + 447. Let y(u) = -u*3 + 5u*2 + 4u. Let m be y(5). What is the greatest common factor of o and m? 2 Let v be (-4)/30 + (-7)/(630/(-6312)). Calculate the highest common factor of v and 385. 35 Suppose 4s = 2s + 4, 52 = 4b - 4s. Calculate the greatest common divisor of b and 20. 5 Suppose -3h - 27 = -5t, 7t + 3h - 27 = 3t. Suppose 2z = -5y + 1297, 5z = -3y + tz + 776. What is the greatest common factor of y and 37? 37 Let c(u) = -u*3 - 5u*2 + 2u + 9. Let p be c(-7). Calculate the highest common factor of p and 341. 31 Let k be -2 + 6/(8/4). Let v be k/(-1) - (3 + -44). Suppose -4b = -3b - v. Calculate the greatest common divisor of b and 10. 10 Let y(t) = 2t3 + 4t*2 - t + 1. Let m be y(4). Calculate the greatest common factor of m and 441. 63 Let d = -983 - -1024. What is the greatest common factor of 1025 and d? 41 Let y = -14 + 40. Suppose -l + h + 14 = 6h, -2h - 88 = -2l. Calculate the highest common divisor of l and y. 13 Suppose 0 = 2x - 5i - 276, 2x + 2i - 198 = 64. Calculate the highest common factor of 35 and x. 7 Let j be 3/4 - (-7)/28. Let m = j - -4. Let u = 93 - 88. Calculate the greatest common divisor of u and m. 5 Suppose -13m = -28m + 495. What is the highest common divisor of m and 869? 11 Suppose 0f + 3f = 6. Suppose -2n = n - 192. Suppose 16m - n = 12m. What is the highest common factor of f and m? 2 Let h be -451 + (2 - (7 - 4)). Let p = h + 62. Let u be -2(p/(-4))/(-5). What is the highest common factor of u and 26? 13 Suppose -3z - 4 - 2 = 0. Let m be (z/2)/1 + (-84)/(-6). What is the highest common factor of m and 13? 13 Let v(q) = -23q*2 - 121q - 28. Let g be v(-5). Let m be (1 - 2) + 14. Calculate the highest common factor of m and g. 1 Let o be ((-1)/(-3))/((-2)/(-2148)). Suppose 4g + 74 = -4p + o, 2g - 3p = 147. Calculate the highest common factor of 54 and g. 18 Let u = 43 - 23. Suppose 1 = -2q - 5z - 3, -2q = -3z - 28. What is the greatest common divisor of u and q? 4 Suppose 19n + 63 = 22n. Calculate the greatest common divisor of n and 1092. 21 Let n(i) = 33i + 3. Let c be n(-2). Let m = c + 102. Suppose -3p + v = 2p - 129, 0 = -p + 4v + 22. Calculate the highest common factor of p and m. 13 Let h(i) = 3i - 6i - 7i. Let l be h(-6). Let s(m) = 3m2 + 35m + 116. Let z be s(-4). What is the greatest common divisor of z and l? 12 Suppose -20a + 726 = 13a. Calculate the highest common factor of 418 and a. 22 Let j be (-11)/22384/(-2 - 2). Calculate the highest common factor of j and 496. 16 Let f be (13-1)/((-1)/1). Let v be ((-4030)/93)/(8/(-12)). What is the highest common factor of v and f? 13 Let f be (-250)/(-50)(-4)/(-10). Let r(m) = -m2 + 7m - 3. Let q be r(6). Calculate the highest common factor of f and q. 1 Let p(s) = -2s + 515. Let z be p(-47). Calculate the greatest common factor of z and 21. 21 Let u be 0 - 2 - (1 - 276). Let z be 13((-6)/8)/((-4)/16). What is the highest common divisor of u and z? 39 Let q(u) = -2u3 - u2 - 7u. Let f(b) = b*2 - 2b - 1. Let y(s) = -3f(s) + q(s). Let t be y(-3). What is the highest common factor of t and 30? 6 Suppose -8 - 5 = s. Let k be 32/1 - (-39)/s. Suppose 0 = -3r - r - 4q + 368, -3q - 246 = -3r. What is the greatest common factor of k and r? 29 Suppose 0 = -30k - 21k + 663. Let s be (-4)/(-10) - 323/(-5). Calculate the greatest common divisor of s and k. 13 Let f = -699 + 794. What is the greatest common divisor of 5 and f? 5 Let x(q) = -q2 - 17q + 24. Let m be x(-18). Suppose my = y + 70. What is the greatest common factor of 35 and y? 7 Suppose 2n = -3 + 7. Let i = 57 - 57. Suppose -47 = -nc + 3f + 49, 2f = i. What is the highest common divisor of 6 and c? 6 Let l(c) = 7 + 0 + 4 + 3c - 3. Suppose -3z + 5k = -11, -8 = -z - 2k + 14. Let v be l(z). What is the highest common factor of v and 4? 4 Let i(s) be the second derivative of 0 + 4s - 1/3s3 - 1/2s*2 + 1/3s*4. Let y be i(-7). What is the highest common divisor of y and 19? 19 Suppose 151 - 102 = 7a. What is the greatest common divisor of a	{ "pile_set_name": "DM Mathematics" }
e fourth smallest value in l, k, 1/5, 2? l Suppose 96r - 621 = -82r - 29r. What is the biggest value in 0.07, -2/5, -0.05, r, 2? r Let r = 109 + -109.233. Let n = r + 0.533. Let v(u) = -u2 - 5u + 5. Let o be v(-6). Which is the second biggest value? (a) n (b) o (c) 1 a Let m = -71987.967 + 72049. Let x = 61 - m. Let j = 0.333 + x. What is the second smallest value in 0, 3, -2, j? 0 Let q = -296 + 295.684. Let k = q - -0.116. Which is the fourth biggest value? (a) 2/3 (b) -3/4 (c) k (d) -5 d Let y(s) = -2s - 8. Let k be 8/(-3 + -1) + -2. Let r be y(k). Suppose r = -n + 10 - 3. What is the smallest value in -2/5, 0, n? -2/5 Suppose 2n - 8 = -0n. Let f = 80 - -19. Let h = f - 104. What is the second smallest value in 1.2, n, h, 0.1? 0.1 Let w be -18(-4)/120(-10)/9. What is the second smallest value in 12, -1, -2/11, w, -0.2? w Let d = 96 + -670/7. Let n = 0.238 - -0.262. What is the third smallest value in 4, d, n, -0.1? n Suppose 41i - 12 = 37i. Suppose in = -0f + f + 7, -5f = 5n - 25. What is the fourth smallest value in 2, n, 1/9, -24? n Let k = -22.36 - -22. Let q = 0.36 + k. Let z = -32 + 32.2. Which is the biggest value? (a) q (b) z (c) 8/7 c Let l = 26.0873 - 0.0873. Let f = -0.12 - 26.38. Let o = l + f. Which is the fourth biggest value? (a) -5 (b) o (c) 4 (d) 0 a Let v = 54.08 + -54.58. Which is the fourth smallest value? (a) -50 (b) -5 (c) v (d) 5 d Let k(i) = 2i + 3. Let l be k(0). Let n be 27/(-54)(-2)/l + 1. What is the biggest value in -0.3, n, -0.02, 3/5? n Let n be 1/(-1 + (-4)/(-5)). Let y = 293 - 329.9. Let r = y + 36.5. What is the smallest value in n, r, 0? n Let n = 0.43 - 0.03. Let x = 258 + -624. Let y = x + 366.5. Which is the second biggest value? (a) n (b) y (c) -0.3 (d) 0.1 a Let q = 2.0771 - 23.0771. Which is the fifth smallest value? (a) 2 (b) 3 (c) q (d) -1/11 (e) -0.3 b Let p = 4.9 + -6.9. Suppose -2s - 4n + 94 = 0, -2s - 3s + 217 = 4n. What is the third smallest value in 0.4, s, p, 3? 3 Let g = 507/700 - -9/350. Which is the second biggest value? (a) 1/5 (b) g (c) -191/9 a Suppose 0 = -4t - 0 + 28. Let p be 8/10(-90)/(-108). What is the second smallest value in t, 0, p? p Let o = -105689 + 2430113/23. Let h = -32 - o. Let g = 1.17 + 3.83. Which is the second smallest value? (a) 1 (b) 2/7 (c) h (d) g b Let z = 16.1 + -80.1. Let h = -0.24 + -0.06. Which is the second smallest value? (a) z (b) -1 (c) h b Let j = -437.4 - -427. Let z = -7.4 - j. What is the third smallest value in z, -2/15, -16, -4? -2/15 Suppose -11 + 8 = 4i + u, -5u = -4i - 33. Suppose -89 - 11 = -4p. What is the biggest value in 0.5, p, i? p Let y = -92310.1 + 92310. Let f = -0.7 + 4.7. What is the smallest value in y, 2/11, 0.5, f? y Let k = -2881 + 2877. Which is the second smallest value? (a) -0.4 (b) 6/7 (c) k (d) 3 (e) 5 a Let c be (-5)/(-2(-2)/2). Let n = -1073/7 + 153. Let y = 32341.5 - 32342. What is the third smallest value in c, y, n, -7? y Let l be (3 - 55/18)/(270/24 + -11). Which is the second biggest value? (a) l (b) -0.4 (c) 1/380 a Let f = -53437 - -53437.4. Let n = -13 - -8. Which is the smallest value? (a) -2/7 (b) 0.1 (c) f (d) n d Let l = 1081 - 1081.09. Which is the biggest value? (a) 0.09 (b) 2 (c) 5 (d) l c Let u = -418.0769 - -0.0769. Let w = 464 + u. What is the third biggest value in w, -2, 1? -2 Suppose 6j - 5j = -2. Let k = -3.5378 + -0.4622. What is the second biggest value in 1.3, j, k, 0.5? 0.5 Let f = -12/659 - 1066/13839. Which is the third biggest value? (a) 2 (b) f (c) -4 (d) -0.5 (e) 0.3 b Let v be ((-24)/(-320))/(99/(-44)) + (-4)/(-24). Let t(x) = x - 2. Let m be t(6). What is the third biggest value in m, -2/9, v? -2/9 Let j = -342.4 - -379. Let m = j + -34.6. Which is the second biggest value? (a) m (b) -0.3 (c) -6/11 (d) 0.3 d Let b = 940.5 - 1362. Let o = b + 421. What is the third biggest value in -2, -0.1, o? -2 Let a(y) = y3 + 11y*2 - 12y + 7. Let w be a(-12). Let q be w/14 - 1/(2/1). What is the fourth biggest value in 1, q, 13, 2/9? q Let g be 2/(42) + 2163/(-412). Let s = 2/569 + -1721/3983. What is the second smallest value in 0.1, g, s, 4? s Let u(x) be the third derivative of -x6/120 + x5/30 - x3/6 - 2x*2. Let v be u(1). Let c = 231 - 230.8. What is the second biggest value in v, -1/4, c? v Let i = 3.03 + -3. Suppose 0 = 1871g - 1860g. Which is the second smallest value? (a) 0.4 (b) g (c) 3 (d) i d Let t = -188.83 - -189. Let m = t + -8.17. Which is the biggest value? (a) m (b) -5 (c) -2 c Let u = 0.104 + 0.396. Let w be (-4)/(-7) + (9 + -2 - 8). Which is the third biggest value? (a) -3 (b) w (c) u a Let g = 11 - 7. Suppose 575f - 567f = -320. Let x be -6 - 344/f - 3. What is the smallest value in g, x, -0.01? x Let y be 2/(-13) + 1088/(-26). Let u be (y/28)/(6/(-20)). Let l = -5240 - -5244.1. What is the second smallest value in l, 0.1, 0.3, u? 0.3 Suppose 583 = 4m - 15m. Let t = -158/3 - m. Let s be 2/9 - 16/234. What is the biggest value in t, 4, -1/5, s? 4 Let t = -320 - -319.673. Let b = -0.347 - t. What is the third biggest value in -1/4, -1/7, b? -1/4 Let v = -1.04669 - -2.04669. Let i = -67/4 - -17. What is the biggest value in v, 0, i, -21? v Let w(t) = 142t + 9966. Let l be w(-70). What is the fourth smallest value in 13, 1, -1/7, l? l Let h = -4 + 3. Let u = 11.438 - 8.15. Let r = u - 0.288. Which is the smallest value? (a) -3 (b) h (c) r a Let d(c) = 173c + 1383. Let a be d(-8). What is the smallest value in a, 8, 10, 0.3? a Let d = -6 - -2. Let u = -4275 - -12826/3. Which is the third biggest value? (a) 0.11 (b) d (c) u b Let z = -3073.5 + 3073. Which is the smallest value? (a) z (b) -0.2 (c) -2 (d) -2/23 (e) 0 c Let q(n) = n3 + n2 - 112n + 21. Let w be q(0). Let u = 1 + -1.1. Which is the fourth biggest value? (a) w (b) 0.5 (c) 0.1 (d) u d Let a = -222.821 + 223. Let o = -2.179 + a. Let v = -7 - -7.07. What is the second biggest value in o, 1, 1/4, v? 1/4 Let n be -1 - 31/(-7). Suppose -3b = q + 3q + 517, -346 = 2b + 3q. Let g = -170 - b. What is the second smallest value in -1/6, -2, g, n? -2 Let c = -3027 + 3025. What is the second smallest value in 14, 0, c? 0 Let g = 4.24 - 3.24. Let m = -0.257 + 0.157. What is the second biggest value in g, 0.054, m? 0.054 Suppose -3u - w + 15 = 0, 15u = 11u + 2w + 10. Which is the third smallest value? (a) u (b) -66 (c) -4 a Let d = 9661 + -9657. What is the third biggest value in -0.22, d, -6.9? -6.9 Let v = 7 + -36/5. Suppose -5n + 0n - 50 = 0. Let y be 7/(-35)n/(-8). Which is the biggest value? (a) y (b) 1/2 (c) v b Let s(u) = -u*3 + 16u*2 - 56u - 50. Let f be s(7). Which is the fourth smallest value? (a) f (b) 1 (c) -0.051 (d) -43/3 b Let p(n) = n*2 - 241n + 14515. Let q be p(120). Which is the third smallest value? (a) -262 (b) q (c) -9/7 c Let w = 99.16 - 99.06. Let g = 2.14 - 0.14. What is the smallest value in -1/5, g, 3, w? -1/5 Let d = 33461 + -33429.954. Let g = d + -31. Let x = -0.156 + g. Which is the third smallest value? (a) 0.1 (b) 5 (c) x b Let n = 0.7 - 0.9. Let i = -26211.5 - -26211. Which is the fourth smallest value? (a) 8 (b) i (c) n (d) -2 a Suppose 3k = s - 0k - 22, 0 = 4s - 3k - 115. Suppose 15v - 16 = sv. What is the second smallest value in 1, -3, -5, v? -3 Let i = -543.4 + 544. Let o = -0.134 - -0.034. What is the second biggest value in o, -3/8, i? o Let o(n) = -6*n + 130. Let g be o(6). Let z be (623/30)/7 + g/(-705). Which is the second biggest value? (a) 5 (b) -1/6 (c) z c Let s = -2694 - -2688. Which is the second biggest value? (a) s (b) 0 (c) -2/5 (d) 1 b Let g = -534 + 534.0388. Let r = g - 3.0388. Let w = -0.2 - -0.25. What is the third biggest value in r, 0.3, w, 0.4? w Let n = -1 + -2. Let k = 2.015637 + -0.015637. What is the second biggest value in -2.3, -1/2, k, n? -1/2 Let p = 2563 + -2563.075. Which is the smallest value? (a) -0.5 (b) p (c) -3 c Let t = 11.47 - 0.47. Let k be 13/(-21) + 4/14. Which is the third smallest value? (a) 0 (b) t (c) k b Let o = 122999.192 - 123754. Let z = o - -740.9. Let u = -0.092 + z. Which is the second smallest value? (a) 5 (b) 1 (c) u b Let v be 3570/17700 - 2/10.	{ "pile_set_name": "DM Mathematics" }
80 Find the common denominator of -31/65667 and 1/18. 394002 Calculate the lowest common multiple of 3108 and 19684. 59052 Calculate the lowest common multiple of 36564 and 24. 73128 Calculate the smallest common multiple of 21372 and 260. 106860 Find the common denominator of -19/8140 and 43/19240. 211640 What is the smallest common multiple of 4760 and 4284? 42840 What is the smallest common multiple of 84796 and 1972? 84796 What is the common denominator of 57/1610 and 101/10810? 75670 Find the common denominator of -31/106660 and 51/53330. 106660 Calculate the lowest common multiple of 48070 and 330. 144210 Calculate the common denominator of -8/52429 and 58/20165. 262145 Calculate the common denominator of 1/93 and 20/483817. 1451451 What is the smallest common multiple of 935550 and 18? 935550 What is the smallest common multiple of 19544 and 24? 58632 Calculate the common denominator of -48/1248377 and 47/4. 4993508 Calculate the common denominator of 64/278285 and -19/556570. 556570 What is the smallest common multiple of 1850 and 596625? 1193250 Calculate the common denominator of 117/380 and -3/156260. 2968940 Find the common denominator of 51/50 and -163/880800. 880800 What is the least common multiple of 6996 and 112? 195888 Calculate the common denominator of -81/148 and 61/118. 8732 What is the least common multiple of 12628 and 4510? 63140 Calculate the least common multiple of 41923 and 77. 461153 Calculate the common denominator of -31/78970 and -97/15794. 78970 Calculate the lowest common multiple of 16 and 709300. 2837200 Find the common denominator of 43/996 and 19/22. 10956 What is the lowest common multiple of 24 and 1444914? 5779656 Calculate the lowest common multiple of 2027 and 2027. 2027 Calculate the common denominator of 54/5753 and 19/7062. 3693426 What is the common denominator of -98/13515 and 53/102? 27030 What is the least common multiple of 2 and 99900? 99900 What is the least common multiple of 2760 and 1001052? 10010520 Find the common denominator of -77/2 and 31/266306. 266306 What is the common denominator of -139/16830 and 199/4950? 84150 Calculate the smallest common multiple of 1 and 865. 865 Find the common denominator of -65/11818 and 3/2488. 47272 Calculate the least common multiple of 5190 and 6920. 20760 Calculate the lowest common multiple of 135 and 56214. 281070 What is the smallest common multiple of 3382 and 9063? 1613214 Calculate the smallest common multiple of 12922 and 13419. 348894 What is the least common multiple of 67318 and 1552? 538544 What is the smallest common multiple of 30 and 563125? 3378750 Calculate the lowest common multiple of 69 and 512. 35328 Calculate the lowest common multiple of 899 and 2059. 63829 What is the common denominator of 103/341220 and -6/275? 1706100 What is the common denominator of 101/2912 and 157/234? 26208 What is the common denominator of 55/20212 and 3/38? 384028 Calculate the least common multiple of 168 and 12390. 49560 Find the common denominator of -41/4680 and 71/1035. 107640 Calculate the common denominator of -64/7689 and -53/45. 115335 Calculate the smallest common multiple of 960 and 148440. 1187520 What is the common denominator of 37/75888 and 35/25296? 75888 Find the common denominator of -5/68666 and -36/11. 755326 Calculate the smallest common multiple of 831 and 704411. 2113233 Calculate the smallest common multiple of 355295 and 5. 355295 What is the smallest common multiple of 4288 and 1064? 570304 Calculate the common denominator of -14/69201 and -40/621. 1591623 What is the lowest common multiple of 30 and 3192? 15960 Calculate the lowest common multiple of 36432 and 176. 36432 Calculate the common denominator of -32/327 and -25/6152. 2011704 Find the common denominator of 69/8842 and -95/6. 26526 What is the common denominator of -19/14910 and -103/280? 59640 What is the common denominator of -42 and 13/7304? 7304 Find the common denominator of 47/45804 and 89/175582. 1053492 What is the common denominator of 29/27 and -36/113875? 3074625 What is the smallest common multiple of 2720 and 8432? 84320 Find the common denominator of 103/6 and 91/119424. 119424 What is the common denominator of 19/106 and 9/905081? 1810162 What is the lowest common multiple of 319254 and 117? 957762 What is the least common multiple of 200 and 200? 200 Find the common denominator of 131/12 and -5/114174. 228348 What is the common denominator of -13/30704 and 11/304? 30704 What is the smallest common multiple of 55 and 24855? 273405 Calculate the least common multiple of 10272 and 240. 51360 Calculate the common denominator of -49/152793 and -119/108. 611172 What is the common denominator of -101/420 and -74/35385? 141540 What is the lowest common multiple of 419342 and 7? 419342 What is the smallest common multiple of 945 and 4725? 4725 What is the lowest common multiple of 4266 and 52? 110916 Find the common denominator of -131/7050 and 151/493500. 493500 Calculate the common denominator of 77/32 and 47/9392. 18784 Find the common denominator of 37/306 and 37/93. 9486 What is the lowest common multiple of 884 and 4930? 128180 What is the common denominator of 17/6144 and -101/38400? 153600 Calculate the least common multiple of 4590 and 81090. 243270 Calculate the smallest common multiple of 183960 and 4. 183960 What is the lowest common multiple of 138 and 46? 138 Find the common denominator of -67/74385 and 143/216. 595080 Find the common denominator of -41/52 and -53/984. 12792 What is the lowest common multiple of 8 and 19630? 78520 What is the smallest common multiple of 3435 and 7860? 1799940 What is the smallest common multiple of 43056 and 37440? 861120 Find the common denominator of 49/56092 and 107/6822. 504828 What is the least common multiple of 759567 and 2538? 13672206 What is the least common multiple of 76557 and 25519? 76557 What is the common denominator of -67/3240 and 193/62370? 249480 Calculate the smallest common multiple of 4669 and 22678. 158746 Calculate the lowest common multiple of 25520 and 261. 229680 What is the smallest common multiple of 500 and 22600? 113000 What is the least common multiple of 17374 and 1267? 3144694 Find the common denominator of 5/9 and -40/23451. 70353 Calculate the smallest common multiple of 792 and 7128. 7128 Calculate the smallest common multiple of 7560 and 2079. 83160 Find the common denominator of 9/2 and 80/48621. 97242 Calculate the lowest common multiple of 106869 and 441. 320607 Calculate the lowest common multiple of 465 and 7905. 7905 What is the lowest common multiple of 280 and 55392? 1938720 Find the common denominator of -97/672 and 97/1328. 55776 Calculate the common denominator of 77/8814 and 16/177749. 1066494 Calculate the smallest common multiple of 395 and 15727. 6212165 Calculate the lowest common multiple of 1935870 and 10. 1935870 What is the lowest common multiple of 266 and 551? 7714 What is the common denominator of 34/50255 and -37/5? 50255 What is the common denominator of 47/49664 and -95/32? 49664 Calculate the smallest common multiple of 1296 and 10. 6480 What is the lowest common multiple of 1972 and 357? 41412 What is the least common multiple of 6 and 42798? 42798 What is the common denominator of 83/9184 and 19/1456? 119392 What is the least common multiple of 32920 and 520? 427960 Calculate the smallest common multiple of 3311 and 184212. 2026332 Calculate the common denominator of 23/1814 and 53/3352. 3040264 What is the lowest common multiple of 16 and 38496? 38496 What is the least common multiple of 27864 and 108? 27864 Calculate the least common multiple of 522698 and 1265. 2613490 What is the smallest common multiple of 20 and 6884? 34420 Calculate the lowest common multiple of 198750 and 1590. 198750 Calculate the least common multiple of 40 and 8544. 42720 Calculate the lowest common multiple of 5620 and 562. 5620 What is the common denominator of -51/342860 and 7/107756? 3771460 What is the least common multiple of 1070253 and 118917? 1070253 What is the smallest common multiple of 52780 and 82940? 580580 What is the common denominator of 70/12207 and -103/624? 195312 What is the least common multiple of 1829058 and 665112? 7316232 Calculate the	{ "pile_set_name": "DM Mathematics" }
Let u = -84 - -86. Suppose -3d - 5n = -1000, -3n + 330 = d + un. What is the hundreds digit of d? 3 Let u(i) = 157i3 - 2i*2 - 11i - 8. What is the tens digit of u(4)? 6 Let w(r) = -169r + 70. Let n = 612 + -622. What is the thousands digit of w(n)? 1 Let z = -385 + 391. Suppose -3s = -2l + 1310, 666 = l - zs + 10s. What is the units digit of l? 8 Let h = -2434 + 1272. Let p = -627 - h. What is the tens digit of p? 3 Suppose -5t + 94 = 24. Suppose ty - 9y = -10, 4y + 1637 = 3o. What is the tens digit of o? 4 Suppose 2d = -b + 3d + 17, 0 = -4b - d + 43. Suppose -15o + bo + 609 = 0. Let x = o + -149. What is the units digit of x? 4 Let m(z) = -382z - 16. Let j be m(4). Let p be (1/(-2))/(0 - (-4)/j). Suppose -4s = -139 - p. What is the tens digit of s? 8 Let k(x) = 63x*2 - 3x - 4. Let r be k(7). Suppose 14f - 2034 = r. What is the tens digit of f? 6 Let d(l) = 1829l - 49. What is the ten thousands digit of d(6)? 1 Suppose -4m = z - 3830, 2m + 22876 = 59z - 53z. What is the hundreds digit of z? 8 Suppose 270m = 291m - 356505 - 344475. What is the tens digit of m? 8 Let l(q) = -q - 4. Let z be l(-13). Let x be ((-15)/1)/(z/(-6)). Let c = 34 - x. What is the tens digit of c? 2 Suppose 15 = -3o, d + 144o - 149o = 29674. What is the tens digit of d? 4 Suppose -107a = -2a - 272607 - 592908. What is the units digit of a? 3 Let j = -2350 - -17743. What is the tens digit of j? 9 Let n(s) = 10s*2 - s - 2. Let o be n(-1). Suppose ob = 4b + 20. Suppose -bz - 3q + 183 = 2, -2z + q + 83 = 0. What is the units digit of z? 3 Suppose -1582 = -k + 4t + 1750, -4k - t + 13226 = 0. What is the hundreds digit of k? 3 Suppose -2s + 20 = -9w + 13w, 5w - 22 = -s. Suppose -f - 3f = si - 516, 2i + 3f = 521. What is the units digit of i? 8 Let p = -1717 + 2631. What is the hundreds digit of p? 9 Suppose 23j - 200661 = 18j + 2a, 120391 = 3j - 4a. What is the units digit of j? 3 Let j be (22/33)/(2/2404). Suppose -jh - 7608 = -28h. What is the tens digit of h? 5 Suppose 57f - 9f = 96. Suppose q - 575 = -4s, 2q + 39 - 1239 = fs. What is the units digit of q? 5 Let a = 118034 + -84099. What is the thousands digit of a? 3 Let j = 44029 + -9575. What is the units digit of j? 4 Suppose -43w = -37368 - 23090. What is the tens digit of w? 0 Let z be 1/((-6)/(-12)6/9). Suppose -o - zt + 4t = -543, -t - 1087 = -2o. What is the units digit of o? 4 Let p(s) be the third derivative of -s6/24 - s5/30 + s*4/24 + 19s*2. Let b = -202 + 200. What is the units digit of p(b)? 0 Let o be (51/(-6))/(3/(-6)). Suppose oq = 13q - 1116. What is the tens digit of q/(-4) - 12/(-48)? 7 Suppose -2 = 6x + 10. What is the hundreds digit of -4x/(4/258)? 5 Suppose 10o + 1120 = -4l + 7o, 3l - 5o + 811 = 0. Let b = -97 - l. What is the tens digit of b? 8 Let o be 3560/12(-2)/10-6. Let x = 512 - o. What is the tens digit of x? 5 Let s = 39178 + 3072. What is the tens digit of s? 5 Let o be 30 - -2(-1)/2. Let h(b) = b3 - 24b*2 + 37b + 151. Let l be h(22). Let a = l + o. What is the units digit of a? 6 Suppose -10w + 4h - 32186 = -16w, -w - h + 5365 = 0. What is the thousands digit of w? 5 Let q(t) = t2 - 11t + 42. Let g be q(12). What is the units digit of g + 16/(-56)(0 + -7)? 6 What is the units digit of (-7790024)/(-132) - (-40)/(-12)? 2 Let f = 17482 + -9994. What is the thousands digit of f? 7 Let q(y) = -2y3 - y2 + 3y + 7775. What is the thousands digit of q(0)? 7 What is the units digit of ((-3564)/330)/((-2)/7 - 80312/(-281680))? 8 Suppose 4217 = -12g + 413. Let o = g + 508. What is the tens digit of o? 9 Suppose -5c + 4y + 8 = 0, 4c - 5y = 9c - 35. Suppose -3j + 4j = 2h - 168, 8 = -cj. What is the tens digit of h? 8 Suppose -22q = 130 - 218. Suppose -2180 = -qv + 4s, -3s + 158 + 942 = 2v. What is the units digit of v? 7 Let q(r) = -3r3 + 3r2 + r + 256. What is the thousands digit of q(-10)? 3 Let l(q) be the second derivative of -q3/3 + 27q2/2 + 15q. Let b be l(12). Suppose 6v - v - 70 = -t, bt + 2v = 158. What is the tens digit of t? 5 Let r be 8/168119283 - 3/21. Suppose 0 = -4f + 2d + r, -2d + 16 = 2d. What is the thousands digit of f? 1 Let s = 24542 - 14550. What is the units digit of s? 2 Let m(u) = u*3 + 4u*2 - 12u + 7. Let z be m(3). Suppose -2s - d + 323 = 0, -zs + 2d + 159 = -33s. What is the tens digit of s? 6 Suppose 2 = -4l - 18. Let d be 4 - (10/l + 2). What is the units digit of 51 - ((-5)/1 + d)? 2 What is the tens digit of (-63 - -71) + ((-182)/(-6))/(2/588)? 2 Suppose 356d = 340d + 12704. Let h = 798 + d. What is the units digit of h? 2 Suppose 472 = 15w - 13w. What is the hundreds digit of w/7(1 - 20/(-8))? 1 Let v(u) be the third derivative of u5/20 + u4/6 + 79u3/6 + 250u*2. What is the tens digit of v(-16)? 8 Let g be 3 - (-2 + 11) - -3. Let x = -77 + 78. What is the tens digit of (x - -29)(-21)/g? 1 Let m be (174/4)/((-69)/(-92)). Suppose -5t + 2f + m = -t, -4f = t - 10. Suppose 4i + 2390 = ti. What is the tens digit of i? 3 Suppose -122t = -412454 - 1756462. What is the hundreds digit of t? 7 Suppose 2 = 2w - 2k, 5w + 0 = -3k - 3. Let z(b) = 5b + 1. Let q be z(w). Suppose 3m + 3s = 4m + q, 3 = 3s. What is the units digit of m? 2 Let j = 230 - 200. Suppose j = 13c + 4. What is the units digit of c? 2 Let q(r) = -r*3. Let p be 8/1 - (-12)/(-3). Let n(x) = 7x3 - x2 - x + 4. Let j(v) = pq(v) + n(v). What is the tens digit of j(2)? 2 Let y(f) = -472f + 8. Let h be y(-7). Let b = -2179 + h. What is the thousands digit of b? 1 Suppose -1600 = 19v - 346. Let u = v + 725. What is the hundreds digit of u? 6 Let b = -29 - -40. Suppose 9v + 240 = bv. Suppose f - 57 = -m, -4m + v = 2f + 12. What is the units digit of f? 0 Let m(j) = 46j*2 + 13j - 371. What is the thousands digit of m(-29)? 7 What is the hundreds digit of (-4 - -2)/(78/(-120120))? 0 Let k = 6311 + 27012. What is the ten thousands digit of k? 3 Let h = 8340 - 7462. What is the hundreds digit of h? 8 Let f be (-4 - 38/(-10)) + 52044/20. What is the hundreds digit of 3 + 1/2f? 3 Let m = 2759 - 31. What is the units digit of m? 8 Let s(r) be the third derivative of r5/60 - 31r*4/24 + 43r*3/2 + 181r*2. What is the units digit of s(0)? 9 Suppose -3j + j = -4c + 50710, -5c - j = -63370. Suppose -335z + 322z = -c. What is the tens digit of z? 7 Let o(t) = 528t + 204. What is the ten thousands digit of o(59)? 3 What is the hundreds digit of (-2030)/(-8)((-736)/(-32) - 11)? 0 Let n(i) = -16i - 19. Let j be n(-4). Suppose jy = 18y + 7776. What is the tens digit of y? 8 Let q(v) = -v3 - 52v*2 + 93v + 327. What is the units digit of q(-55)? 7 Let h = -58 + 57. What is the tens digit of 1433/9 - (56/(-72) - h)? 5 Let n be 17/(3/(-2)(-3)/(-27)). Let t = n + 220. What is the units digit of t/(-5)(-1)/((-4)/(-10))? 9 Suppose 12c - 71 = -23. Suppose 4y = w - 94, -cy = -3w - 2y + 312. What is the units digit of w? 6 Suppose 27323 = 3v - 5t, -2v + 18257 = 17t - 12t. What is the hundreds digit of v? 1 Suppose 0g + 4 = 4y + 2g, 5 = -y - 2g. Suppose -2f + 12 = 2j - 0, yj - f = 14. Suppose -2o + jo - 471 = 0. What is the tens digit of o? 5 Let l = 284 - 262. Suppose 52j - lj - 10410 = 0. What is the units digit of j? 7 Let t = 36 + -31. Suppose -3p + 4p + 654 = k, tp + 5k = -3270. What is the units digit of (p/(-15))/(14/35)? 9 Let o(s) = 17s*2 - 6s + 191. What is the tens digit of o(17)? 0 Suppose 4z + 11c = 8c + 605, 0 = -10z - 5c + 1525. What is the hundreds digit of z? 1 Let j(q) = 3q*2 - 90q + 38. Let l be 6/(-240)-8 + (-507)/(-15). What is the hundreds digit of j(l)? 4 Suppose 11l = 7l + 68. Suppose 208 = lv - 13v. Let a = v - 42. What is the units digit of a? 0 Suppose 5g = 5c + 6475, 5c = 3g + g - 5183. Suppose -4o - g = 5f, 0 - 4 = -f. What is the tens digit of (-4)/6 - o/6? 5 Suppose -30r + 7r = -6051 + 1865. What is the tens digit of r? 8 What is the thousands digit of 19707 + (4 - ((-171)/(-33) + 8/(-44)))? 9 Let k be (1 - 3) + (-20 - -22). Suppose 3w - h - 2297 = k, -2h = 6w - 2*w - 3076. What is the hundreds digit of w? 7 Let r be 0/(-1) - -1 - (12 + -2	{ "pile_set_name": "DM Mathematics" }
earest one hundred? -1500 Let k = -86.7 - -94. Round k to zero dps. 7 Let x = 0.09999966 + -0.1. Round x to seven dps. -0.0000003 Let t = 27.74 + 0.26. Let h = t + -28.000043. Round h to 5 decimal places. -0.00004 Let a = -128012624100807.07000022 - -128012632276683. Let z = a + -8175876. Let b = z + 0.07. Round b to seven decimal places. -0.0000002 Let s(y) = -23525y + 5. Let i be s(5). Let x = 265632 + i. Suppose -b - 37015 = -2b + 5d, -4d - x = -4b. Round b to the nearest ten thousand. 40000 Let v(i) = -287895i*2 - 5i + 4. Let c be v(3). Let f = 574351 - c. Let d = 9665417 - f. Round d to the nearest one million. 7000000 Let u = -21.6 - -5.7. What is u rounded to the nearest integer? -16 Let h(z) = 199z3 + 6z*2 + 4z - 9. Let b be (3/3)/((-2)/14). Let g be h(b). What is g rounded to the nearest ten thousand? -70000 Let c = 605343 - -504649. Let f = 13 + -9. Suppose -2j - 740008 = -0j - 4d, 3j + fd = -c. Round j to the nearest one hundred thousand. -400000 Let s = -3 - -3.05. Let z = s + 2.95. Let x = z - 2.999999. Round x to five dps. 0 Let g(l) = 1128l3 + l2 + 4l - 5. Let f be g(-5). What is f rounded to the nearest ten thousand? -140000 Let i = 1071 + -898.9. What is i rounded to the nearest ten? 170 Let f = -0.093 + -3.607. What is f rounded to 0 decimal places? -4 Suppose -6n = -4n + 192. Let x be (n/(-9))/(-2)-178125. Round x to the nearest 100000. 1000000 Let b(s) = -7799s3 + 10s*2. Let t be b(-10). Round t to the nearest one million. 8000000 Let y(w) = -2925w*3 - 24w*2 + 52w - 25. Let k be y(23). Round k to the nearest one million. -36000000 Let q = 2691847 - 2691905.00043. Let s = q - -58. Round s to four dps. -0.0004 Let m = -0.91 - -1.1. Let p = 73.63 - 74. Let o = m - p. What is o rounded to one dp? 0.6 Let b = -20 + 20.7. What is b rounded to zero dps? 1 Let j = -6.2 - -1.2. Let l = 24492013 - 24492008.0000015. Let g = l + j. What is g rounded to six dps? -0.000002 Let w be 320/((-2)/400-2). Suppose -2n + 3n - w = 0. Round n to the nearest 10000. 30000 Let u = -1.00000032 - -1. What is u rounded to seven decimal places? -0.0000003 Let n be (-421)/(-6) - 3/18. Round n to the nearest 10. 70 Let x = 6.3 - 6.30086. What is x rounded to 4 dps? -0.0009 Let d = 1.43 - 1.5. What is d rounded to one dp? -0.1 Let a = -27.3 - -34. Let t = -708001769 - -708001762.30000102. Let h = a + t. What is h rounded to seven dps? 0.000001 Let b = 150.999799 + -151. What is b rounded to five decimal places? -0.0002 Let c(u) = -1000u + 5. Let q(r) = 2001r - 9. Let n(h) = -11c(h) - 6q(h). Let k be n(1). Let a = k - -677. What is a rounded to the nearest 100? -300 Let a(f) = -f3 - 5f*2 + 4f - 7. Let u be a(-6). Suppose -4n + 11 = -u. Let v be (n/(-3))/(1/12750). What is v rounded to the nearest 10000? -20000 Let d = 29079821949 - 29079822161.00000107. Let m = d + 212. Round m to seven dps. -0.0000011 Suppose -3x + 3g = -1875662 - 3420220, 2x - 5g - 3530591 = 0. Let u = x + -1255293. Suppose p - u = 4p. What is p rounded to the nearest 100000? -200000 Let k = 8 + 43. Let c = k - 80. What is c rounded to the nearest ten? -30 Let s(r) = -150000r2 - r + 8. Let f be s(8). Round f to the nearest one million. -10000000 Let y = -16 + 16.0364. What is y rounded to 3 decimal places? 0.036 Let m(p) = 3459p - 28. Let t be m(-8). What is t rounded to the nearest 1000? -28000 Suppose -3p + 72 = -0p. Let k be 150p(-105)/(-6). Suppose z = 4z + k. Round z to the nearest 10000. -20000 Suppose 2q + 3q - 5u = -214985, 0 = 5q + 2u + 215006. What is q rounded to the nearest 10000? -40000 Let m = -0.07 - -1.57. Let s = 33.5 - m. Let o = -38.4 + s. Round o to the nearest integer. -6 Let p = -8 + 16. Let j be 2/p + (-97995)/(-20). What is j rounded to the nearest 1000? 5000 Let j = -0.0985 - 0.3205. What is j rounded to one dp? -0.4 Let s = 23 + -22.3. Let k = -19959322.30000004 - -19959323. Let r = s - k. What is r rounded to 7 decimal places? 0 Let x = 785.85984 - 786. Let w = x + 0.14. What is w rounded to four dps? -0.0002 Suppose -4j = b + 385, 4b - 3j = -0j - 1502. Let p = -724 - b. Let h = p + 747. What is h rounded to the nearest 100? 400 Let i = -19 + 2. Let u = 11.8 + i. Round u to the nearest integer. -5 Let a = -2.494 + 2.5. Round a to three decimal places. 0.006 Suppose 0 = 5r + 31 + 109. Let s be (-7)/r - (-3799)/4. Round s to the nearest one hundred. 1000 Let q = -2.45847 - 0.14533. Let n = -2.6 - q. Round n to 3 dps. 0.004 Let n = 1.43999881 - 1.44. What is n rounded to seven dps? -0.0000012 Let r = -212 - -216.04. Let l = r - 4. Let y = -0.0400046 + l. What is y rounded to six decimal places? -0.000005 Let i = -844.7772 - -845. Let r = i - -0.586. Let x = -0.8 + r. Round x to three dps. 0.009 Suppose 2700025 = 3v + 6q - q, -3v = 2q - 2700010. What is v rounded to the nearest 1000000? 1000000 Let l = -31972.34766495 - 16.51250505. Let p = -31989 - l. Let t = -0.14 - p. Round t to four dps. -0.0002 Let d = -10.712 + 0.304. Let b = 2.502 - d. Let p = b + -13. Round p to one dp. -0.1 Let u = 106.00000178 - 106. What is u rounded to seven dps? 0.0000018 Let x = 0 - 10. Let j = -85 - x. Let o = -75.0037 - j. Round o to 3 decimal places. -0.004 Let q = 150980 - 66118. Suppose 0 = -i - 157138 - q. What is i rounded to the nearest 10000? -240000 Let d = -513 + 513.000001373. Round d to 7 dps. 0.0000014 Suppose 2k = 3k - 3799999. Suppose -u = -3r - 11399999, k = -0r - r + u. What is r rounded to the nearest 1000000? -4000000 Let d = 55 - 86. Let r = -27.1 - d. What is r rounded to zero dps? 4 Suppose 0s = 5s - 25. Suppose -3y = -4b + 254, -sy + 4b = 540 - 130. Let p be (-1000)/3(-3 - y). What is p rounded to the nearest ten thousand? -30000 Suppose 4r + 1 = 5. Let s be (-3 + 2 - r)-2. Suppose -sa + 5u = a - 149990, 2u - 90004 = -3a. Round a to the nearest one hundred thousand. 0 Let t be (48/28)/((-2)/(-7)). Let b be -2 - (3 + 2)-1. Suppose -bq - 5100 = -tq. What is q rounded to the nearest one thousand? 2000 Let r = -10.39913 - -10.4. Round r to four decimal places. 0.0009 Let g = 0.45745 + -55.52995. Let x = -55 - g. Let a = x + -0.08. Round a to three decimal places. -0.008 Let d = -338.9594 + 339. What is d rounded to three decimal places? 0.041 Let h(y) = -8y*3 + 2y*2 - 3y + 7. Let q be h(3). Round q to the nearest 10. -200 Let d(q) = -362q3 - 11q*2 + 8q + 24. Let f be d(12). Round f to the nearest 100000. -600000 Let r = -70 - -70.0000155. What is r rounded to five dps? 0.00002 Let p = 0.7 + -9.7. Let j = p - -9.00000013. What is j rounded to seven decimal places? 0.0000001 Suppose -4t - 8 = 5x, 2x - 5x - 21 = -3t. Suppose -ta - 61000 = -8a. What is a rounded to the nearest one thousand? 12000 Let d = -0.27 + 0.14. Let g = 144.63 - 142. Let j = g + d. What is j rounded to the nearest integer? 3 Let i = -0.69 + 0.7. Let s = 4.89025 - 4.9. Let h = i + s. Round h to four decimal places. 0.0003 Suppose -j = 3 - 2. Let a be j/1-6 + -1. Suppose -9310850 - 24189150 = as. What is s rounded to the nearest 1000000? -7000000 Let g(v) be the first derivative of -v2/2 + 3300000v + 3. Let n = -1 + 1. Let y be g(n). Round y to the nearest one million. 3000000 Let w = -4 - -4.035. Let h = w + 3.265. Let c = h - 2.2. Round c to 0 dps. 1 Suppose 5i = -5k, 2i + i - 3 = -2k. Suppose -400 = -2p - 4j, -p - 2p - ij = -606. Suppose -2m - m + p = 0. Round m to the nearest ten. 70 Let v = -5.97936 - -6. Let p = -5.98 - -6. Let d = p - v. What is d rounded to 4 decimal places? -0.0006 Let a be -3534(50 - 1)/(-1). Let o = 27834 + a. Round o to the nearest 10000. 200000 Let z = -286 - -653. Let m = -368.73 + z. What is m rounded to one decimal place? -1.7 Let t be (-9)/3 + 0 + -3. Let f(h) = 2890h2 + 9h + 3. Let k be f(t). Suppose k + 356011 = -j. What is j rounded to the nearest 100000? -500000 Let a(l) = -20277l2 + 6l + 8. Let s be a(-6). Round s to the nearest 100000. -700000 Let k = 0.045 - 0.04705. What is k rounded to 4 dps? -0.0021 Let u = 0.06 + -7.86. Let j = 7.80000082 + u. Round j to 7 decimal places. 0.0000008 Suppose -3d + 8500000 = -8d. What is d rounded to the nearest 100000? -1700000 Suppose 5n - 24 = -3p, 0n = -3n + 2*p + 22. Suppo	{ "pile_set_name": "DM Mathematics" }
wrt r? -33760r3 Let h(u) be the second derivative of -7/2u*3 + 47u + 0 - 22u2. Find the first derivative of h(r) wrt r. -21 Let s be 15(2 + 1 + -2). Suppose -15 = -4p + 3h, 2p + 0h - s = 3h. Find the second derivative of 9u + 4u + pu*5 + 4u*5 wrt u. 80u*3 Suppose -54 + 24 = -10r. Let a = -42 - -45. Find the first derivative of -22 - 8hr + 15h*a - 7h*3 - 21h*4 wrt h. -84h*3 Let n(y) = -54y*3 - 108y*2 - 54y + 54. Let r(f) = -2f2 + 1. Let c = -134 - -133. Let l(a) = cn(a) + 54r(a). Find the second derivative of l(i) wrt i. 324i Differentiate -f - 64f2 - 569 + 708 - 2415 + 3f wrt f. -128f + 2 What is the third derivative of 99h*6 - 5694h*2 + 2h*4 + 425h*6 + 5525h*2 wrt h? 62880h*3 + 48h Let l = -127 - -133. Let b(c) = -7c2 + 3c - 14. Let m(z) = 28z2 - 11z + 56. Let t(u) = lm(u) + 22b(u). Differentiate t(d) wrt d. 28d Let c(i) = i3 - 2i*2 - 9i + 9. Let t be c(4). Find the second derivative of -p*5 + 50p + 6p3 + tp*3 + 95 - 93 - 2p*3 wrt p. -20p*3 + 54p Let g(u) = u*2 + 4u + 31. Let d be g(23). Find the second derivative of 368j - dj + 373j + 69j*4 wrt j. 828j*2 Let y = 30 + -25. Let t be (15/y - 0)/(1/2). What is the third derivative of -28o*6 + 26o*t + 4o*2 - 6o*2 wrt o? -240o*3 Let k(m) be the second derivative of 2 + 1/6m*4 + 12m - 1/15m6 + 0m*5 - 33/2m*2 + 0m*3. Differentiate k(x) wrt x. -8x*3 + 4x Let f = 583 - 581. What is the third derivative of 675t5 - 682t*5 - 145t*2 + 17t*3 - 44t*f wrt t? -420t*2 + 102 Let h = -213 - -216. Find the second derivative of -d - 5 + 139d*3 - 100d*3 - 96d*h wrt d. -342d Let i(u) be the first derivative of u - 237/4u4 + 0u*3 + 9/2u*2 - 260. What is the second derivative of i(l) wrt l? -1422l Let r(i) = -3846i2 + 5240i + 270. Let u(n) = -3847n2 + 5239n + 216. Let k(j) = 4r(j) - 5u(j). What is the second derivative of k(v) wrt v? 7702 Let g(j) = 93j2 + 1484j - 4111. Let q(s) = -17s2 - 297s + 822. Let h(b) = -2g(b) - 11q(b). Differentiate h(o) wrt o. 2o + 299 Let b(l) = -34l*2 + 3l + 41. Let q = -10 + 14. Let u be (78/104)/(1/4). Let n(j) = 35j2 - 4j - 41. Let r(s) = qb(s) + un(s). Differentiate r(f) wrt f. -62f Let j = 16 - 13. Suppose 3x - z = 151, jx + z - 166 = -z. Find the second derivative of xp*4 - 33p*4 + 10p + 7p wrt p. 228p2 Let t(c) be the third derivative of c5/60 + 979c4/24 - 6475c*3/3 - 321c*2 + 9c - 1. Find the first derivative of t(m) wrt m. 2m + 979 What is the third derivative of -373405 + 1639h*3 + 1215h*2 + 373405 wrt h? 9834 Let q(c) = -1 - 2c - 5c2 - c3 - 1 + 2c*2 - 2. Let p be q(-3). Find the third derivative of -15y*4 + 166y*p - 77y*2 - 79y*2 wrt y. -360y Let h(k) = -k*2 + 484k - 2866. Let m be h(6). Let o(a) be the first derivative of 0a + 33/2a*m + 12a*3 - 33. What is the second derivative of o(v) wrt v? 72 Find the second derivative of 1000g*2 + 29g + 24g + 13 - 15g + 9g + 7g wrt g. 2000 Let h(o) be the second derivative of -5o5/4 + 201o*4/4 + 1577o. What is the third derivative of h(t) wrt t? -150 Let z(c) be the second derivative of -13c6/30 - 31c5/10 + c4/12 + 2119c2/2 - 4109c - 1. What is the third derivative of z(s) wrt s? -312s - 372 Let o(m) be the first derivative of -308m*3/3 - 2m*2 + 80m - 726. Find the second derivative of o(k) wrt k. -616 What is the third derivative of -6700a4 + 270a*4 - 592a*3 + 592a*3 + 3341a*2 wrt a? -154320a Let z(b) be the third derivative of b*6/40 - 37b*5/6 - 463b4/8 - b3/3 + 1576b2. What is the second derivative of z(x) wrt x? 18x - 740 Let m(a) be the first derivative of -61/3a3 - a + 23/2a*2 + 45. Find the second derivative of m(u) wrt u. -122 Let l be 10/(-3)51/(-17). Suppose -2v + 0 = l, f + 3v = -13. Find the third derivative of 31q3 + 6q*f - 4q*2 + 11q*2 wrt q. 186 Find the second derivative of -4p - 343p2 + 6p - p + 3p3 + 1500 - 1447 wrt p. 18p - 686 Let z(q) be the second derivative of -3437q5/10 + 4039q*2 + 2978q. Differentiate z(r) with respect to r. -20622r2 Let z(s) = -81s - 52. Let j(p) = 82p + 51. Let x be (-12 - (-2 - -2))/(-10 + 12). Let d(f) = xz(f) - 5j(f). Differentiate d(r) with respect to r. 76 Let x(k) be the first derivative of 97k5/5 + k4/2 + 317k2/2 - 669. What is the second derivative of x(o) wrt o? 1164o*2 + 12o Let q(s) = 363s2 + 2s - 138. Let v(f) = 2177f2 + 13f - 830. Let r(h) = 39q(h) - 6v(h). What is the derivative of r(o) wrt o? 2190o Let u = 123 + -121. Find the third derivative of 23o*3 + 14o*u + 0o*3 - 1 + 7o*3 + 48o*2 wrt o. 180 Let p(c) = -24c - 67. Let v be p(-3). Find the third derivative of -16 - t*2 - 8327t*4 - 171t*v + 8327t*4 wrt t. -10260t*2 Let m(n) be the second derivative of 0n*4 + 0n*5 + 3/2n*2 + 2 + 11/15n*6 + 0n*3 - 4n. Differentiate m(c) wrt c. 88c3 Let g(h) = 4h*2 + 24h + 3. Suppose k = -2c - 11, -k - 23 = -c + 5c. Let l be g(c). Differentiate -3b3 - bl - 6b*3 - 11 wrt b. -30b*2 Differentiate -8y*4 + 1077 - 26y*2 + 27y*2 - 3711 - 3217 + 23y with respect to y. -32y3 + 2y + 23 Let d(s) be the first derivative of -17 + 8s5 - 12 + 10s + s*5 + 3s*5. What is the derivative of d(t) wrt t? 240t*3 Let o(a) = -230a*2 - 68. Let v(l) = 76l*2 + 23. Let u = 95 - 81. Let r(g) = uv(g) + 5o(g). Differentiate r(f) wrt f. -172f Suppose 14 = 11r - 8. Let o be (-75)/10r-35. What is the derivative of 493 - o - 45a + 13a wrt a? -32 What is the third derivative of 4z + 342z5 - 4z*5 + 14z + 248z5 - 4z*2 wrt z? 35160z*2 Let y(h) be the first derivative of -280h*3 + 15h*2/2 + 9h + 676. Find the second derivative of y(v) wrt v. -1680 What is the second derivative of -313 - 2c2 - 72c - 2c4 + 201c + 367c3 - 59c - 74c wrt c? -24c*2 + 2202c - 4 Let g(y) = -257y3 + 4619y*2 + 9y. Let a(j) = -511j3 + 9239j*2 + 21j. Let q(r) = -3a(r) + 7g(r). Find the third derivative of q(n) wrt n. -1596 Let s(y) = 3302y4 - 28y*3 + 7y - 103. Let r(f) = -1650f4 + 12f*3 - 4f + 51. Let z(c) = 7r(c) + 3s(c). Find the second derivative of z(n) wrt n. -19728n2 Let a(d) = 1459d*2 + 585d - 121. Let k(t) = -730t2 - 293t + 56. Let h(g) = 6a(g) + 13k(g). Find the second derivative of h(j) wrt j. -1472 What is the third derivative of -1431d3 - 2704d*3 - 4598d*2 - 1451d*3 + 341d*2 - 3606d3 wrt d? -55152 Let w(r) be the second derivative of r6/15 - 6099r5/20 + r4/4 - 17r*3/2 + 12107r. Find the third derivative of w(k) wrt k. 48k - 36594 Let s = -296 + 303. Find the third derivative of -s + 8 + 58u*2 + 106u*3 - 1 wrt u. 636 Let a(p) = 13p*2 - 92. Let f(h) = -5h*2 + 6222h + 17h2 - 91 - 6222h. Let n(k) = 3a(k) - 4f(k). What is the first derivative of n(g) wrt g? -18g Let m(l) be the first derivative of -l6/6 - 1795l*4/4 - 7l*3/3 + 211l*2 + 9224. What is the third derivative of m(v) wrt v? -60v*2 - 10770 Let k = -87 - -123. Let u = 39 - k. Find the third derivative of -4f*2 - 23f*2 - 25f*6 - 129f*u + 129f*3 wrt f. -3000f*3 Let q(i) = 4560i - 4127. Let v(u) = -913u + 825. Let j(a) = 2q(a) + 11v(a). Find the first derivative of j(c) wrt c. -923 Suppose 2v + 36 = 24. Let o be 7/((-35)/v)5. What is the third derivative of -7r6 - ro + 19r2 - 23r*2 wrt r? -960r*3 Let q(f) be the third derivative of -409f5/15 + f4/12 - 8f3/3 + 2667f*2. What is the second derivative of q(i) wrt i? -3272 Suppose -140 = 7j - 21j. What is the third derivative of -j + 9 + 4 + 10x*2 + 216x*3 - 2 wrt x? 1296 Find the first derivative of 254u + 634u + 1398 + 468u + 139u wrt u. 1495 Let o(c) = -4c*3 - 121c*2 - 84c - 2. Let n(r) = -4r3 - 130r*2 - 85r - 2. Let i(s) = 3n(s) - 4o(s). Find the second derivative of i(l) wrt l. 24l + 188 Let u(r) = 10r - 77. Let a be u(18). What is the second derivative of a + 3j3 + 8j*3 - 54 - 47 + 6j*2 - 109j wrt j? 66j + 12 Let j be ((-150)/(-20) - 8) + (-27)/(-6). Find the third derivative of 3 + q3 - 214q*2 - 171qj - 3 - q3 wrt q. -410	{ "pile_set_name": "DM Mathematics" }
-2/9)h)h(-9)/((h/(h9hh))/h)((h0)(2/3))(-38) assuming h is positive. h(20/9) Simplify ((b20b)(-1/15)/(((b/b(-17/5))/b)/((bb(-1/37)b)/b)))(-47) assuming b is positive. b(33276/185) Simplify (((q(4/5)/q(1/21))(-44))(2/15))(16/11) assuming q is positive. q(-10112/1575) Simplify (((o/(oo(-1/43)o))(7/11))(-3/7))(2/23) assuming o is positive. o(252/10879) Simplify ((l*2/(ll/l2))/((l(1/10)/l)/l(-1)))/((l(-1))*25l/l*5l*(-2/5)lll) assuming l is positive. l(283/10) Simplify (y3y4y*3y(yy/y*(2/15))/y)/((y/(yyy/(y/(y/(yy(-1/4))))))(-12)/(y*(1/10)/yyy(-5))) assuming y is positive. y(-241/30) Simplify (r(rr(-1)r)/rr)(-50)(rr(1/2)/rr)/r*1(r(-3)/r(-9))35 assuming r is positive. r(221/2) Simplify (g(2/3))36/(g/g*2gg5/g)(g*(-3)ggg(-3/10))(-3/17) assuming g is positive. g*(3439/170) Simplify ((rr*9/rr)/r*(-2/3)r(-14)/r(-4))(-2/59) assuming r is positive. r(-4/177) Simplify (((k/((k/k(-18))/k))/(k/k(-2)))/(k*(-2/57)k/k(-9)))(-47) assuming k is positive. k(80276/57) Simplify (n1/(nn/((n(n*(-1/9)/n)/nn)/n)))/(n*(-2/9)n/n*(-2/11)n)nnnn*(1/3)nn/n(-8)n*5/nnn(-3) assuming n is positive. n(1115/99) Simplify (a(1/4))14/((a/(aaa(-4)))/(a/(a/(a/(aa(aa*(-5))/aaa))a)))(a(1/4)/(a(-1/4)a))(-12/7) assuming a is positive. a(33/14) Simplify (s*(-24)sss(s(-15)/s)/s)/(s/(s(9/8)s)s9) assuming s is positive. s(-367/8) Simplify o(-3/2)ooo*1oo3o*6ooo*(-2/9)oo/o(-1)o(o/o(-1/4))(-6) assuming o is positive. o(88/9) Simplify ((((t/(tt/(tt(2/61))))/t)/t)(-27/2)/(t/t(-19)t/(t/(ttt*(-3/7)ttt)t)t))(14/9) assuming t is positive. t(1696/549) Simplify (xx/(((x0/x)/xx)/x))34/((x/x(-2/11))/(xx(2/11)))((x(-2/3))(3/7))(-8/7) assuming x is positive. x(6680/49) Simplify (f*(-1)f*(4/3)ff)(9/5)((f/((f*(1/2)/f)/ff))22)(-1) assuming f is positive. f(-144/5) Simplify (n33nnnn/(n/(n*(3/5)/n))(n*(-1)n)/(nn(-3/14)))(-12) assuming n is positive. n(-14622/35) Simplify ((cc/c(2/5))/c)43/(c/(c/(c/c*(-2)))cc(-2/19))((c*(-2/3)c)/c)*(-39)c(-4)/(c/c(-5)) assuming c is positive. c(3601/95) Simplify ((((k/k(2/5))/k)*50/((k/(kk*(-1)))/(k/(kk*(3/4)k))))(-2/19))(9/10) assuming k is positive. k(819/380) Simplify (z(-2)z(-3/5))(-6/7)/(((zz0)/z)(1/4)((z(-1)z)/zzzz)(2/77)) assuming z is positive. z(838/385) Simplify ((((ccc(-2/15)c)/(cc(10/13)c))(-2/9))29)18 assuming c is positive. c(-2204/195) Simplify (((p(1/7)/p(1/18))(-2/105))(-24))(-5) assuming p is positive. p(-88/441) Simplify ((y*(2/3)y)*(12/11)y*(2/9)y(3/16))(-32/7) assuming y is positive. y(-7058/693) Simplify ((q1)(-21))(7/6)(q0)37(q(-2/7))(-2/31) assuming q is positive. q*(-10625/434) Simplify (ff/((ff(11/4))/f)ff(4/9)(f/((f/(f/f(3/7)))/f))/f(2/9))(-1) assuming f is positive. f(-515/252) Simplify (((r/(((r/(r/r*3r)r)/r)/r))/r)/(r((rr(-1/4))/r)/rr))*(4/5)/(rr/r*(-4/5)rr(1/6)r(-2/15)/r5) assuming r is positive. r*(-7/30) Simplify (((n/(nnn/(nn*(-2/5)/n)n))/n)/n*(-2)n/n*(-2/7)nn/(nn/(n*(4/9)n)))(9/10) assuming n is positive. n(52/175) Simplify ((t*(-2/3)/tt25/t)/(t/t(-1/28)t4))(-10) assuming t is positive. t(-7265/42) Simplify (h/(h/(h/h(-2))))(-12)/(hh/(h*(-1)hh)hhh*(-8/5)h)((h/((hh(-6/7))/h))/h7)/((hh(3/5))/h4) assuming h is positive. h(-288/7) Simplify (((x/(xx/x(4/9)))/x)/(x/(x/x9)))*(-1/20)/(x/(x(x*(1/2)xx)/x)x(-9))(8/11) assuming x is positive. x*(3233/396) Simplify (((((g((g*12g)/g)/ggg)/g)/g(-1/3))/(g/g3g)(-2/143))29)(-37) assuming g is positive. g(-6131122/429) Simplify ((zz/(z(z(-1/7)/zz)/z))/z)/(zz(-4)z)(z1)15z*(-1/7)z/(z(zz*(-2/3)zz)/z)(z(-2/7)/z)(-28) assuming z is positive. z*(158/3) Simplify ((ll/(ll/(l/(ll/l*(-19)l))l))/lll(l/(l/l*24))/lll(-2/45)l/l0)(-26) assuming l is positive. l*(-4628/45) Simplify ((b(b*(-8)b)/b)/(b/b(-6)))(-5/6)((b/b(1/3))(-41))(5/3) assuming b is positive. b(-305/9) Simplify ((((c(-1/3)c)43)(-38))(-4/23))5 assuming c is positive. c*(65360/69) Simplify ((((k/(kk/k1))(-10/13))(-2/85))(-9))*(1/19) assuming k is positive. 1 Simplify (zz*(2/3)/zzz(z/(((z/z*4z)/z)/z))/z)/(z(-1))(-7/5)(z/((zz/z(2/7))/z))47/(z*(-3/7)z(1/13)) assuming z is positive. z(25999/1365) Simplify (l(-5/3))(-2/5)ll*(-1/13)l/l(3/8) assuming l is positive. l(691/312) Simplify (hh/h(5/8))(-1/40)(h(5/3))(-45) assuming h is positive. h*(-24011/320) Simplify (g/(gg/(g/(gg/(g(2/9)g))))g9/g(g/(g(-3/14)/g))(7/3))(1/4) assuming g is positive. g(223/72) Simplify ((bbb13)/b)/b(3/29)b32bb(-6) assuming b is positive. b(1186/29) Simplify (c20/c(1/13)((c(c/(c/c6c))/c)/c)(-2/57))(-4/15) assuming c is positive. c*(-58636/11115) Simplify (vv*(2/7)/vvvv3)/(v(-1/4))*(-5/8)(((v/(vv/(vv*(-2/7)))v)/vv)(8/5))14 assuming v is positive. v(4733/224) Simplify ((x/(xx*(3/4)x))/((x(xx/(xx(-12/5)))/x)/x)(x/x*7)/xx(-20/7))(-21/5) assuming x is positive. x(5883/100) Simplify (z(1/3)z6)(-8/17)/((zz/((z/(z*2/z)z)/z)zz/(zz4zz))/(z1z/z4)) assuming z is positive. z(-101/51) Simplify (((o/(o/o(-1/3)))31(o(-3/7)/o)/(oo/(o*(-3)o)))(-2/15))32 assuming o is positive. o(21184/315) Simplify (p(-3)/pp(-1/5))/(p/(pp(pp(ppp(-1/3))/p)/pp)pp)*(-21)(p/p*(-7)pp/((p(p*(-7)/p)/pp)/p))/(p(-1))(-17) assuming p is positive. p*(-191/5) Simplify pp*(1/12)/pp*7(p1)(-8/5)(p(-4)/(p(-2/7)pp))4 assuming p is positive. p(-7297/420) Simplify (w(-1/4))26/(w/(ww*(2/3)/w)w*6)(w(www0/ww)/ww3)/(w(2/7)w*(-3)w) assuming w is positive. w(-257/42) Simplify ((l(-7)/(ll(l*4l)/ll)(l/((l/l(-1))/l))(-1/3))(-7/2))(-7/3) assuming l is positive. l(-343/3) Simplify ((d(-1/2)/d)40/((d/d(2/21))/dd(dd/d2)/d))/(((d/d(1/8))/d)/(dd*(1/2)/d)(dd(-3))/(d1d)) assuming d is positive. d(-9287/168) Simplify (j(-1/5)((j(-36)j)/j)/j)/(j/(j(-2/13)/j))(-1/2) assuming j is positive. j(-2348/65) Simplify (((k/(k/k(-3/7)))/kk)15/(k(4/5))(7/8))(-36) assuming k is positive. k(8982/35) Simplify ((d/((dd*(-2/43))/d))/(dd/d*11dd)d/(d*(-11)/d)dd(-6/11))(-15) assuming d is positive. d(-152550/473) Simplify (o(-9)o*(-3/5))/(oo*(-37)oo(1/7)o) assuming o is positive. o(849/35) Simplify j/(j/j(-5))j/(((jj*1/j)/j)/j)j*4jj(-1)(((j4/j)/j)/((j/(j(1/4)/j))/jj))(-22) assuming j is positive. j(-9/2) Simplify ((s(-2)s)/(s/s(6/19)))/(s47ss*(-30)s) assuming s is positive. s(-393/19) Simplify ((t(-6)/(t/t(5/4)))/(t(-2/5))7)(7/6) assuming t is positive. t(-413/120) Simplify (((b(1/3)/b)*(-2/29)/(bbb0)(18/7))(2/133))(2/17) assuming b is positive. b(-12416/1376949) Simplify (o/o0)(3/11)/(o/o(2/3)oo(-5)o)(oo*5oooo/(oo*(-2/5)o)ooo)/((((o/(ooo(-2/9)oo)o)/o)/o)/o5) assuming o is positive. o(11443/495) Simplify m*0m*(3/5)m*5m/m*(1/15)(m*(-1)m)*(-6)(mm(2/3)/m)/m(2/7) assuming m is positive. m(242/35) Simplify (i(2/19)/((i/(ii(-12)))/i))(-7/3)(ii*(-2/23)i)/(i/(ii/i1))(i(ii*9)/ii)/(ii/((i/(i4/i))/i)) assuming i is positive. i(14567/437) Simplify ((n(1/4)n)(2/55))(-15)/((n*(-1)nn)/(n13/n))(2/33) assuming n is positive. n(-1/66) Simplify (((s/(s/((ss*(6/7)s)/ss)))/ss*(-4))/(sss0sss(-2)))/((s(-1)s(-3))/(s(1/5)s(1/11))) assuming s is positive. s(57/385) Simplify (((((bb37)/b)/b)/b)(-1/17)/(b(-9/5)bb(-9/5)))(-46) assuming b is positive. b(-2116/85) Simplify (c(-1/7)c)/cc0(c(2/5))(-12/5)((c1/cc)/c)*(-10)(c/(c/c(-2/3)))13 assuming c is positive. c(-5129/525) Simplify (((f/(f2/ff))/f)(1/3)(f**2	{ "pile_set_name": "DM Mathematics" }
at least p? False Suppose 3i = z + 15, 17z + 2i - 10 = 19z. Is z bigger than 2/653? False Let u = 8 + -10.068. Let n = 0.068 + u. Which is greater: n or 1? 1 Let j = 0.9404 - -0.0596. Which is smaller: j or -0.0068? -0.0068 Suppose 10 + 12 = -2q - 4u, -7 = 2q + u. Is 5/33 less than q? False Let k = 1/71 - 147/355. Let d = 8.3 + -22.2. Let n = 14 + d. Is n less than k? False Suppose 0l + 2l + 3326 = -u, l + 9963 = -3u. Let p be (-1)/(-6) + u/48 + 4. Which is bigger: p or -64? -64 Suppose -4h - g + 52 = -h, h = 2g + 8. Which is greater: 69/4 or h? 69/4 Suppose -5 = -0g - 5g. Let h be ((2 - 3) + g)/1. Which is smaller: 3/16 or h? h Let n be ((-4)/(-5))/(121254/28765). Let k = n + 2/2887. Which is bigger: k or -1? k Let c be (46/69)/((-35)/3). Suppose 5d + 58 = 158. Suppose 2q = 4m + d, -4q - 4m + 3m - 5 = 0. Which is smaller: c or q? c Let j be (5 + 31/(-8))4. Is 5 at most as big as j? False Let g be 612/(-360) - (-1774)/8770. Which is greater: -1 or g? g Let m = -112 + 101. Is 46 less than m? False Let u be (228/24 + -12)-2. Which is bigger: u or -5? u Suppose -25 = -5i, -5i + 39 = 2f - 3f. Let q be 6/(-9) + f/(-3). Let h = 18 + -16. Do h and q have different values? True Let l = 256 - 266. Which is smaller: l or -9? l Let s(u) = u3 + 5u*2 + 2u - 1. Let v be s(-4). Let j = v - 10. Let r be j/(-10)150/(-36). Is r greater than or equal to -1? False Suppose 0 = -2i + 3y - y + 12, i + 4y = -4. Suppose 111 = ir - 17. Suppose 5f + 13 = -r. Which is bigger: f or -8? -8 Let o be 2/6 - 4/3. Let u be 9/o1 + 1. Let c = -7 - u. Are c and 2/15 equal? False Let t = -775 - -5413/7. Suppose -28 = q + 7. Let f be 14/q + 6/(-10). Is t < f? True Let h = -157 + 158. Do h and -1/10 have the same value? False Suppose -8a + 11 = -3c - 9a, 4c + 4a + 4 = 0. Are c and -18 equal? False Let p = 29768/117 + -2290/9. Let q be (-1 + 1)/((-4)/(-2)). Is q greater than p? True Let f be (-6826)/3896 + 2 - (-1)/(-4). Which is bigger: 1 or f? 1 Let i(y) = y*3 - 12y*2 + 9y + 31. Let l be i(11). Let v be (0(-2)/4)/(-1). Suppose -3h - 2a = a - 39, a - 4 = v. Is h not equal to l? False Let d be 5/(-1)(-2)/505. Which is smaller: 4/75 or d? 4/75 Suppose 9 = b + 2m - 5, -3b - 2m = -34. Which is smaller: b or 12? b Let k = -0.1 - 0.6. Let b = 6.7 + k. Let n = b - 6. Is 1 bigger than n? True Let k(b) = 3b - 3. Let m be k(2). Suppose -6 = 3p - 0, 2p - 29 = mx. Let z = 70 - 81. Is x at least z? True Let s = -594 - -24356/41. Is s equal to 0? False Suppose -5l + 0l = -5. Let p be ((1/(-2))/1)/(150/20). Which is bigger: p or l? l Let c = -1/1143 + -58286/8001. Which is smaller: -6 or c? c Let y = -275/4 - -143/2. Let l = -1 + 3. Which is smaller: y or l? l Let x(c) = -2c2 - 2c - 1. Let z(a) = a*2 + 5a - 14. Let g be z(-7). Let i be x(g). Are 2/61 and i equal? False Let y = -17 - -24. Let q = y + -24. Let z = q - -14. Is -12/7 smaller than z? False Let l be (-1)/(-5) + 142/(-35) + 9. Is l at most as big as 6? True Suppose 0 = -14q + 18q + 72. Let x be ((-6)/4)/(3/(-414)). Let k be (-257)/q + 46/x. Which is greater: 16 or k? 16 Suppose g + 4j = 3g - 16, 2g - 16 = -5j. Let l = 7 - g. Let z = 19/10 - 533/270. Is l < z? True Let k = -4 + 3. Let y be (-1631)/(-1470) - k/(-1). Let c = y - -2/35. Are 0 and c equal? False Let k(p) = 0 - 2 + 7p - 12p*3 + 11p*3 + 4p*2. Let l be k(5). Suppose -l = -4u - 4g, -5u + 4g = -3u + 14. Which is bigger: u or 4/9? 4/9 Suppose m + m - 10 = 0. Suppose 5u + 7 + 10 = -3y, 0 = 3y - mu - 23. Let p = 3289 + -3290. Which is smaller: y or p? p Let t(a) = 3a3 + 7a*2 + 11a - 22. Let i be t(-6). Is i at most as big as -483? True Suppose 3i = 13 + 26. Let g be (-41)/3 + (30/(-9))/(-5). Let r = g + i. Which is smaller: 1/7 or r? r Suppose 1968 = 37y - 29y. Which is smaller: y or 244? 244 Let u(a) = a2 - 2a + 1. Let h be (-1 + -3 - -4) + 1 + -1. Let p be u(h). Suppose -s + 6s = 15. Which is smaller: s or p? p Let q(r) = 5r*2 + 2r - 2. Let f be q(2). Do 26 and f have the same value? False Let o = -4 + 4.1. Let q(y) = 3y + 19. Let w = -71 + 63. Let r be q(w). Which is smaller: o or r? r Let z = -41 - -49.2. Let g = z + -24.2. Which is bigger: g or -1? -1 Let f(m) be the second derivative of -m3 - 21m*2 + 2m. Let v be f(-8). Which is smaller: v or 7? v Let f = 365 + -363. Are f and 29/15 equal? False Let a be 1932/(-385) + (-45)/(-9). Which is smaller: a or 0.1? a Let i = -1/11822258 + -358728685603/236445160. Let w = i + 1517. Let x = 2/15 + w. Is x less than -1? False Let u be (-12)/(-10)7360/(-96). Is -93 bigger than u? False Let h = -29 + 31. Let a be 22/18 - (3 + (-4)/h). Let s = 3.07 - 0.07. Which is smaller: s or a? a Let f = -14.33 - -12.712. Let z = -30.678 - f. Let x = -29 - z. Which is smaller: x or -2/5? -2/5 Let a = 0.08 + -0.98. Let s = 58 + -57. Let f = s + a. Is f equal to -0.5? False Let o(n) = -n + 5. Let r be o(3). Suppose 22 - 18 = rl. Which is greater: l or 4/5? l Let o = 19 - 65/3. Let n = -15952 - -15950. Is n at least o? True Suppose 3y = y + 2h + 18, -4y + 36 = 3h. Is 6 greater than or equal to y? False Let f be ((-168)/20)/((-52)/30) - 3. Is -2/7 greater than f? False Suppose -2q + 3m = -0q - 16, 0 = -5q - 2m + 21. Let d be ((1/(-5))/(2/q))/(-2). Which is smaller: -8 or d? -8 Let z = 102.9 - 103. Let x = -2/4955 + -59426/84235. Is x less than or equal to z? True Let u be (6/(-10))/(6/4). Suppose 0 = -5f - 3a - 326, -4a - 3 = -4f - 251. Let l be (-1 - 1) + (f/(-7))/4. Which is smaller: u or l? u Let u = -0.142 - 60.858. Let v = u - -59. Which is greater: 0 or v? 0 Let a = 17/36 + -1/4. Let n = 0 - -6. Suppose -q + nq = 0. Which is smaller: a or q? q Let a = 908 - 11807/13. Which is smaller: a or 0? a Let t(r) = -2r3 - 21r*2 + 8r - 32. Let n be t(-11). Is -15/32 >= n? False Let v = 367.88 + -376. Let x = -1.42 - v. Let i = x + 1.3. Is -2/5 smaller than i? True Let o be (2/(8/(-25)))/((-7)/(-28)). Is o not equal to -22? True Let b(u) = -13u + 1. Let q be b(-1). Let n(i) = i2 + 1. Let g(v) = 5v*2 + 13v + 20. Let p(c) = g(c) - 6n(c). Let t be p(q). Is -1/69 less than t? True Suppose -2u - u = -p + 13, -4u - 28 = 4p. Let x be (28/(-12) + -4)p - 3. Which is bigger: x or 11? 11 Let i be (1/2)/(14/(-8)). Let w be ((162/(-15))/3)/(1204/4220). Let m = w - -88/7. Is m not equal to i? True Let s = -689 - -689. Let c = -48 + 30. Which is smaller: c or s? c Let u = -30.47 + -1.53. Is -7 greater than u? True Let k = 13 + -10. Suppose 0 = -kz + 3r + 39, 2r + 23 = 3z + 3r. Let t = z - 14. Is -11/2 at most t? True Let o = 50.753 + -50.3. Let h = o - -19.447. Let b = 20 - h. Which is smaller: -7 or b? -7 Let a be (189/(-84))/((-1)/88). Suppose 11r - 5r - a = 0. Are r and 34 unequal? True Let p = -0.78 - -0.98. Which is smaller: p or -2/13? -2/13 Let q(u) = u*2 + 5u - 9. Let d = 2 + 9. Suppose 5i - 24 = 2x - 0i, -5i = 3x + d. Let v be q(x). Is 4 at least v? False Let b = 77013/73 + -1055. Is 1/2 >= b? True Let m = -368 + 339. Let z be (-82)/3 + (-4)/6. Which is smaller: z or m? m Let h = 2132/36915 - 7/115. Which is smaller: h or 0? h Suppose -5n + w - 2w = 5, -2n = -2w - 10. Suppose 5b - s - 8 = n, -b + 4b + 9 = -4s. Let o be (b/(-3))/(9/27). Is -3/10 less than or equal to o? False Let p be 1/(-5)0 - -3. Let l be (-9)/6 + -4 + p. Is 1 < l? False Let j = -3.28 + 9.28. Which is greater: j or 5/12? j Let x(u) = -2u - 2. Let b(r) = -r - 1. Let h(g) = -2g - 2. Let n(i) = -3b(i) + h(i). Let a(p) = -8n(p) - 3x(p). Let z be a(-5). Which is smaller: 6 or z? 6 Let h(o) = -o*3 + 20o*2 - 19o - 5. Let y be h(19). Let i be (-45)/y - (-2)/1. Is 0.2 greater than or equal to i? False Let k be (-14 - 289)(-8)/(-12). Is -202 at most as big as k? True Let h(l) = l3 + l2 + l + 1. Let g(p) = -2p*3 + 3p*2 - 3p - 7. Let a(u) = g(u) + 3h(u). Let j be a(-6). Let d = -175 - -171. Does d = j? True Let f be 48/27((-15)/36)/(-5). Which is bigger: 1 or f? 1 Let i = -0.18 - -4.18. Let g = -2.8 + 2.61. Let r = g + 0.09. Which is smaller: i or r? r Let j be (1 - (1 - 1)) + -114. Let n = j + 58. Let l = n + 1263/23. Is l less than or equal to 0? True Let s = -415 - -416. Is s > -36/7? True Suppose -5*a + 249 = 764. Let n =	{ "pile_set_name": "DM Mathematics" }
in descending order. r, 1/4, -2, n Let d(i) = -4i + 1. Let s be d(1). Let q be -2 + (-4 + 2 - 4) + 10. Sort 4, q, s, 0 in decreasing order. 4, q, 0, s Let z be (-4)/3 - ((-910)/15)/14. Suppose -3 = -3p - 0p + 3x, 4p = -4x - 12. Put p, 1, z in descending order. z, 1, p Let y be (-3)/12 + 623/28. Suppose 0 = -5a + 4j, -4a = 2j - 4 - y. Sort 26, a, 0 in decreasing order. 26, a, 0 Let p be (-2)/(-3)(-81)/(-12). Let x = p - 6. Suppose 0a - a - 5 = 0. Put -4, x, a in increasing order. a, -4, x Suppose 2c - 3y = 4c + 11, -c - 3y = 7. Put 14, 0, c, 2 in ascending order. c, 0, 2, 14 Let l be 4/2 + -4 + (-15)/(-5). Let p be l - (-25)/(-20) - 30/8. Let i(s) = -2s + 6. Let m be i(4). Sort m, p, 3 in decreasing order. 3, m, p Suppose -21 = v - 2f, 3v - 2f = f - 63. Suppose -25 - 200 = 5b. Let t = -50 - b. Put v, 0, t in decreasing order. 0, t, v Let y = -0.1 - 0.4. Let u = -13 + 13.2. Let k = -50 - -52. Put y, k, u in descending order. k, u, y Let a(c) = c2 + 8c + 20. Let f be a(-3). Put -7, 16, f in descending order. 16, f, -7 Let b = 24.7 - -1.3. Let f = b - 25.6. Suppose 0 = 2q - 0q. Put q, -4, f in descending order. f, q, -4 Let w be -6 + (28/8 + -3)18. Put -6, w, -24, 4 in descending order. 4, w, -6, -24 Suppose -2h - 1262 + 1254 = 0. Suppose 0b + 16 = 4w - 2b, 2w + 2b - 8 = 0. Suppose 0 = 5a - w - 1. Put h, a, -0.3 in increasing order. h, -0.3, a Suppose -4o + 16 = 2r, -4o - 5r = -6o + 20. Let c be -5(40/25 - 2). Suppose 0d - 5 = -5d. Sort c, o, d in ascending order. d, c, o Suppose -2h - 16 + 48 = 0. Put -1, h, 3 in decreasing order. h, 3, -1 Let h = 3.9 - 6.9. Let d = -29 + 24. Sort d, -0.1, h. d, h, -0.1 Let s(i) = -i. Let d = 0 - -1. Let k be s(d). Suppose -5n + 7n = 8. Sort 1, n, k in descending order. n, 1, k Let a = -142 - -111. Sort -1, 3, a in decreasing order. 3, -1, a Let s = 29 - 317/11. Let a = -0.087 + -0.013. Put s, a, -5, -1.7 in descending order. s, a, -1.7, -5 Let u be 88/(-20) + 4/10. Let t(o) = -2o + 8. Let g be t(0). Let w be ((-5)/(-2))/((-2)/4). Sort g, u, w. w, u, g Let k = -0.575 + 0.505. Sort 11, 3, 2, k. k, 2, 3, 11 Let p = -0.0626 - 0.9374. Put 24, p, 1 in decreasing order. 24, 1, p Suppose 3o = -86 - 10. Let y be ((-2)/8)/((-28)/o)7. Suppose -2 = x + x. Sort y, x, -2/7 in increasing order. y, x, -2/7 Let g(u) = 3u - 30. Let n be g(11). Put 27, n, -3 in decreasing order. 27, n, -3 Let x(y) = -2y*2 + 14y + 8. Let g be x(8). Suppose -12 = 4m - 0. Put 0, g, m in descending order. 0, m, g Let b = 28.9 - 29.3. Put b, 0.5, -1/6, 3 in increasing order. b, -1/6, 0.5, 3 Let b = 0.56 - -0.14. Let q = 3.8 + -1.1. Let n = q - b. Sort 1/7, n, 5/4 in ascending order. 1/7, 5/4, n Suppose 5d = 12d - 21. Suppose -2n + 2 = -dn - 5y, 5y = -4n - 8. Sort 2, 1, n, -4 in decreasing order. 2, 1, n, -4 Let g = 0.15 - 0.05. Let c = 2.7 - 3.3. Let o = c - 3.4. Sort g, o, 4. o, g, 4 Let b be 174/(-9) - 3/(-9). Let i = b + 15. Let o be 6i/(-252) + 0. Put 0.4, 4/9, o in descending order. 4/9, 0.4, o Let u(b) = -4b + 37. Let n be u(5). Suppose -2 = ns - 87. Let q be 52/(-14) - (-4)/(-14). Put q, 2, s in increasing order. q, 2, s Let a = 230 - 228. Sort 1, a, -9 in descending order. a, 1, -9 Let z(g) = -g2 + 4g - 4. Let p be z(4). Suppose 2h - 3o + 3 + 1 = 0, 5o = -4h + 36. Suppose 2d - 4 = h. Sort p, 5, d in decreasing order. 5, d, p Suppose 371r + 34 = 388r. Sort -4, 5, r, 75. -4, r, 5, 75 Let u = -50.3 + -24.7. Put -2, u, 1/9 in increasing order. u, -2, 1/9 Suppose 4u = m + 8, 4 = 5u + 5m - 31. Suppose 3v - 41 + 112 = 5n, -4n - v + 67 = 0. Sort u, n, 4 in decreasing order. n, 4, u Let w(d) = d2 + 2d - 5. Let p be w(-3). Let l be (11 + -13)/((-1)/p). Let q be l3(-3)/(-36). Put q, -2, 7 in decreasing order. 7, q, -2 Let s(t) = t - 3. Let k be s(5). Suppose 4a + 52 = 4b, 6a - 14 = -kb + 4a. Put -3, b, 0 in increasing order. -3, 0, b Suppose -3y - y = z - 5, -2z + 10 = y. Suppose y = -5t - 497 - 53. Let g be (-1)/(-5) + (-33)/t. Sort g, -3, -0.06 in ascending order. -3, -0.06, g Let g = -28.38 + 28.78. Let u = -2 - -4. Suppose ub - 2 = -4. Put g, b, 0.3 in descending order. g, 0.3, b Suppose -4l - 1 = n, 2n + 9l = 11l - 12. Put 12, n, 13 in ascending order. n, 12, 13 Let a be 1/(-5)4 - 0. Let l be (-14)/36(-88)/(-154). Put 1, -0.07, l, a in descending order. 1, -0.07, l, a Let t = 18/31 + -41/124. Sort t, -2.7, 1/3, 4 in descending order. 4, 1/3, t, -2.7 Let x = 1.9 - 2. Let p be (-10)/(-7) + (-6 - -4). Let s = p + 22/63. Sort -3, x, s in decreasing order. x, s, -3 Suppose -4z + 4 = 2u, 3z + u = -96 + 97. Sort z, 2, -4, 43 in ascending order. -4, z, 2, 43 Let t = 7 - 5. Let o = 8.6 - 1.6. Let f = t - o. Sort f, -0.3, -3 in decreasing order. -0.3, -3, f Let g = -1645/6 + 275. Let o = -0.932 + 0.032. Sort o, -2/7, g. o, -2/7, g Suppose a - 2 = i - 4, 0 = 2i - 3a - 5. Let f be (-18)/81 - (-220)/18. Let m = f - 14. Sort m, 0, i in increasing order. m, 0, i Let s be 4/(-3)(-3)/2. Suppose 10 - 4 = sy. Suppose -5 - 4 = -yf. Put f, -8, -2 in increasing order. -8, -2, f Let a(s) = 3s - 4. Let t be a(5). Sort -2, 5, t in descending order. t, 5, -2 Let b(u) = u*2 - 19u + 30. Let o be b(17). Sort 5, -0.02, 3/5, o. o, -0.02, 3/5, 5 Let w = 35.7 - 36. Let n = -25/26 - -6/13. Put 4, n, w in decreasing order. 4, w, n Let m = -68 + 71. Put m, 30, -2 in decreasing order. 30, m, -2 Let s(b) = -b*2 + 17b - 61. Let n be s(5). Sort 7, n, -4. -4, n, 7 Let p = 764 - 763. Sort 30, p, 3, -5 in decreasing order. 30, 3, p, -5 Let c be 1 + -7 - (-40)/4. Sort 5, c, 3, -5 in descending order. 5, c, 3, -5 Suppose -5b + 2a = -20, 3a + 14 = 2b + a. Let h(t) = -7t - t3 + 10t + 5 + 0t3 - 5t*b - 18. Let r be h(-6). Sort r, 4, -4. -4, 4, r Let v(w) = 63w - 185. Let g be v(3). Sort -4.8, 0.2, g in decreasing order. g, 0.2, -4.8 Suppose 4r = 3k + 18, -r - 2r - 5k = 1. Suppose -rg = 3i - 6, -2g - 38 = -4i - 0g. Let p = 612.5 - 612. Put p, 5, i in increasing order. p, 5, i Let g = 72 - 68. Put 1, g, 0, -3 in increasing order. -3, 0, 1, g Let w be 2/(-3) + 56/21. Let p be (-3)/(w/(-6)-3). Let f be (-6)/(-234)13 - 16/(-6). Put p, 7, f in ascending order. p, f, 7 Let a = -344 + 345. Let z be (6/(-10))/((-1)/5). Sort -4, a, z in decreasing order. z, a, -4 Let v be 6 - (-1)/(-4 + 3 - 0). Let n be (-8)/v + 14/(-35). Sort 0, n, 4, -7. -7, n, 0, 4 Let j = -2 - -5.4. Let b = j + -3.7. Let c = 5 - 4.7. Sort b, -5, c in increasing order. -5, b, c Let n be -2 + 0 - (-1 + 4). Let h(t) = t3 - 23t*2 - 26t + 50. Let k be h(24). Suppose 0 = -j - j - 8. Sort n, j, k in descending order. k, j, n Let q(l) = -7l + 3. Let i(m) = m3 + 19m*2 + m + 24. Let d be i(-19). Let b be q(d). Put b, -2, 1 in ascending order. b, -2, 1 Let u(d) = 5d*2 - 1. Let n(l) = -5l*2 - l. Let f(g) = 3n(g) + 2u(g). Let z be f(-1). Sort 6, 0, -3, z in ascending order. z, -3, 0, 6 Suppose -s + 68 + 85 = 5a, 4s + 39 = a. Put -8, a, -2/7 in ascending order. -8, -2/7, a Suppose -66u = -64u + 6. Sort u, 0.3, -1 in ascending order. u, -1, 0.3 Let b(h) = -3h + 1. Let n be b(-5). Let d(z) = 2z3 - z. Let j be d(1). Suppose 528v - 497 - 545 = 542. Sort j, v, n. j, v, n Suppose 0 = 2f - k + 2, 2k - 2 = -5f + k. Suppose -3m = -5b - 7 + 26, -4b - 4m + 28 = f. Suppose -b = 5a, -2z + 2a = -2a - 4. Sort 2, z, -1. -1, z, 2 Let p be (-8)/(17/5 - 3). Let z be (-10)/p16. Suppose -1 = -5n + 5l - 6, 5l - 21 = -zn. Put n, 0.4, 5 in descending order. 5, n, 0.4 Suppose -4f = 3q - 42, -q - 6f + 15 = -5f. Suppose 0 = -12m + q - 6. Sort 2, 4, m in decreasing order. 4, 2, m Let f = 332.4 - 332. Sort 16/9, 2/3, 0.3, f in increasing order. 0.3, f, 2/3, 16/9 Let r = -898 + 900. Sort -5, 0, 11, r in ascending order. -5, 0, r, 11 Suppose -3y = 3, 4y = t - 25 - 7. Sort t, 4, -5 in ascending order. -5, 4, t Let g = -0.1 + -3.9. Suppose 245 = -9h + 4h. Let n be (14/h)/(8/(-35)). Put n, g, 3/4 in descending order. n, 3/4, g Let x = 0.04 - 0.55. Let r = x + 0.31. Put -5, 1, r in descending order. 1, r, -5 Let q = -304/5 + 61. Suppose 4r + 498 = 3j - 438, 0 = -r - 5j - 211. Let b be (-1)/7 + (-47)/r. Sort b, q, 5 in decreasing order. 5, q, b Suppose u + 0u + 4a + 16 = 0, a = 2u + 5. Suppo	{ "pile_set_name": "DM Mathematics" }
rmine -y(b) + 5z(b). -3b*3 - 23 Let k(r) = -2r*2 + 6r + 9. Let b(y) be the third derivative of y4/24 + y3/6 + 819y2. Give -6b(q) + k(q). -2q2 + 3 Let g(t) = t + 1. Let z be 6/(((-12)/3)/(-24)9). Suppose -i = -0u + 4u - 7, 2i + z = u. Let c(k) = 4. What is ug(m) + c(m)? 2m + 6 Let p(i) = 7i + 4. Let u(d) = 3d2 + 90d - 2027. Let k be u(-45). Let j(y) = 8y + 4. Calculate kj(f) + 3p(f). 5f + 4 Let u(g) be the third derivative of -2g5/15 + g4/4 + 23g3/6 - g2 - 1365. Let v(a) = -9a2 + 7a + 22. Give -7u(r) + 6v(r). 2r2 - 29 Let v(z) = 992z*2 - 40z + 20. Let k(l) = -331l2 + 14l - 7. Determine 17k(n) + 6v(n). 325n2 - 2n + 1 Let u(c) = 11c - 6. Let l = 1538 + -1555. Let g(i) be the first derivative of -16i*2 + 17i - 1. What is lu(d) - 6g(d)? 5d Let u(a) = 77a + a*2 - 18 + 20 - 75a - 7a2. Let t(n) = n2. Give 4t(q) + u(q). -2q2 + 2q + 2 Let a(c) = 6c3 - 2c*2 - 2. Let q(f) = 11f*3 - 5f*2 + f - 5. Let m(d) = 89d + 885. Let y be m(-10). What is ya(w) + 2q(w)? -8w3 + 2w Let l(r) = -83r3 + r2 + 228r + 59. Let y(z) = 7z3 - 19z - 5. What is 2l(p) + 25y(p)? 9p3 + 2p*2 - 19p - 7 Let n(f) = -42f + 12. Let r(v) = 34v - 35. Let m(o) = -51o + 55. Suppose -11x = 85 - 30. Let j(s) = xm(s) - 8r(s). Calculate 12j(k) - 5n(k). 6k Let m(j) = 2j*2 - 3j - 3. Let p(o) = 36o2 + 36o + 46. Let n(v) = 9v2 + 12v + 15. Let g(b) = 7n(b) - 2p(b). What is 6g(i) + 26m(i)? -2i2 - 6i Let o(x) = -5x - 11. Let v(s) = -2s - 4. Let a(w) = -3o(w) + 8v(w). Suppose 27 = 12p + 3m, -1 = 156p - 157p + m. Let n(j) = 4j - 1. Give pa(k) + n(k). 2k + 1 Let q(z) be the third derivative of -5z4/3 - z3/3 - z*2 - 400. Let l(o) = 41o + 2. Determine 5l(w) + 6q(w). -35w - 2 Suppose 159l + 163 = -63l - 59. Let o(y) = 3y - 7. Let s(t) = 1. Give lo(g) - 5s(g). -3g + 2 Let t(r) = 24r*2 - 23r + 9. Let m(l) = 9l2 - 12l + 4. Give -9m(z) + 4t(z). 15z2 + 16z Let o(p) = 3p + 70. Let l(i) = -i2 - 66i - 194. Let m be l(-3). Let j(x) = -2x - 47. Give mo(b) - 7j(b). -b - 21 Suppose 0 = -2i + 17 + 5. Let g(j) be the first derivative of 11j - 4j*2 + i - 8j + j. Let v(d) = -9d + 5. What is -5g(l) + 4v(l)? 4l Let q(c) = -23c - 2. Let u(s) = -7s - 18. Let g(h) = h + 3. Let r(j) = -6g(j) - u(j). Determine -q(l) - 6r(l). 17l + 2 Let h(i) = -29i - 3278. Let y(a) = -63a - 6552. Give -13h(d) + 6y(d). -d + 3302 Let g(b) = 2b*2 - 1. Let p(u) = -5u*2 - 9. Let x(f) = g(f) - p(f). Let l(a) = -13a*2 - 15. Calculate 4l(w) + 7x(w). -3w*2 - 4 Let x(v) = 2v*3 - 7v*2 + 4v - 5. Suppose 9b = -0b - 9b - 90. Let z(f) = 2f*3 - 8f*2 + 3f - 6. Calculate bz(j) + 6x(j). 2j3 - 2j*2 + 9j Let f(n) = -7n3 + 4n*2 - 17n + 11. Let o(r) = 2r3 - r2 + 3r + 1. Calculate -f(i) - 5o(i). -3i3 + i2 + 2i - 16 Let v(t) = 7t*3 + 158t*2. Let s(i) = 8i*3 + 154i*2. Calculate 3s(c) - 4v(c). -4c*3 - 170c*2 Suppose 3l - 19 = 23. Let a(c) = -3c + 2. Let t(z) = -23z + 3 + 58z - 45z + 0 + 4. Determine la(w) - 4t(w). -2w Let u = -1225 + 2078. Let h = -847 + u. Let v(w) = 11w - 9. Let c(s) = 7s - 4. Let j(i) = 22i - 12. Let d(y) = -7c(y) + 2j(y). What is hv(p) + 14d(p)? -4p + 2 Let r(d) = 38d*2 - 41d + 6. Let f(l) = 38l2 - 39l + 4. Give -3f(n) + 2r(n). -38n2 + 35n Let h(p) = p*2 - 2p + 2. Let q(a) be the first derivative of -2a3/3 + 3a*2/2 - 2a + 8049. Determine -3h(r) - 2q(r). r*2 - 2 Let d(x) = x + 41. Let k(j) = 445j - 4448. Let t be k(10). Let w(u) = -4u - 122. Determine tw(v) + 7d(v). -v + 43 Let u = 5730 + -5747. Let s(d) = -d + 0 + 6d*2 - 3d*3 + 0. Let m(x) = -8x*3 + 17x*2 - 3x. What is us(i) + 6m(i)? 3i3 - i Let t(m) = 4m + 12. Let w(k) be the second derivative of k*3/2 + 4k*2 + 9k + 12. Calculate 5t(n) - 7w(n). -n + 4 Let d(q) = -4q + 9. Let c(r) = -10r + 1. Let a(j) = 43j + 12. Let o(w) = -a(w) - 5c(w). Give 11d(s) + 6o(s). -2s - 3 Let v(l) = -472l + 19. Let y(j) = -1415j + 63. What is 10v(d) - 3y(d)? -475d + 1 Let o(l) = -l*2 + 7l - 3. Let u(m) = -14m2 + 21m + 2. Let g(h) = 17h2 - 26h - 2. Let b(v) = 5g(v) + 6u(v). Give -5b(i) - 3o(i). -2i2 - i - 1 Let l(g) = 4g*2 + 486g - 8. Let z(v) = 3v2 + 488v - 7. Calculate -5l(c) + 6z(c). -2c2 + 498c - 2 Let h(l) = -17l2. Let q(t) = -4t - 645t2 + 1248t*2 - 680t*2 + 4t. Calculate -22h(b) + 5q(b). -11b2 Let o(f) = 4186f + 1. Let k(w) = 16749w + 4. Determine -3k(b) + 11o(b). -4201b - 1 Let s(z) = 3z3 + 6z*2 - 3z - 3. Let f(k) = k*3 + 3k*2 - 3k - 1. Give 5f(l) - 2s(l). -l*3 + 3l*2 - 9l + 1 Suppose 3w + 12o - 13o = -20, 2w = 5o - 9. Let k(f) = 30f*2 - 16. Let j(q) = -10q*2 + 5. What is wj(b) - 2k(b)? 10b*2 - 3 Let f(k) = -4k*2 - 69k + 16. Let j(n) = -3n2 - 63n + 13. Determine 5f(h) - 6j(h). -2h2 + 33h + 2 Let o(s) = 32s2 - 45s + 16. Let u(q) = 160q2 - 225q + 90. Give -11o(t) + 2u(t). -32t2 + 45t + 4 Let z(o) = 7o3 - 1244o*2 - 4o - 9. Let l(q) = -3q3 + 630q*2 + 2q + 4. Calculate -9l(h) - 4z(h). -h*3 - 694h*2 - 2h Let m(p) = -1823p2 - 2p - 4. Let u(d) = 5469d2 + 7d + 14. What is 7m(q) + 2u(q)? -1823q2 Let u(d) = -d2 + 1. Let t(x) = -21x*2 + 35. Suppose 2446 + 1957 = -118z + 273. What is zu(h) + t(h)? 14h*2 Suppose 2u = -4r + 50, 2u + 90r = 93r + 85. Let w(n) = -21n3 - 3. Let k(o) = 252o*3 + 35. Calculate uw(h) + 3k(h). 21h*3 Let q(h) = 59h*3 - 8h*2 + h - 3. Let n(p) = 177p*3 - 23p*2 + 3p - 8. What is 3n(u) - 8q(u)? 59u3 - 5u2 + u Let i(q) be the second derivative of -q3/6 - 7q2/2 + 5q. Let a(f) = 2f + 11. Calculate 5a(w) + 8i(w). 2w - 1 Let b(s) = 12s2. Let p(l) = 121l*2 + 3l + 3. Determine 6b(f) - p(f). -49f*2 - 3f - 3 Suppose 4 = 2f - 0. Let u(d) = 15d*3 - 139d*3 - 5d - 2 - 7d2 + 95d*3 + 20d*3 - 2d. Let t(h) = 3h3 + 2h*2 + 2h + 1. What is fu(c) + 7t(c)? 3c3 + 3 Let k(a) = -18805a + 5. Let y(c) = -94018c + 28. Give 11k(f) - 2y(f). -18819f - 1 Let p(h) = 83235 - 166443 + 83222 - 4h2. Let n(f) = -17f*2 + f + 56. What is 2n(s) - 9p(s)? 2s*2 + 2s - 14 Let p(k) = -3k2 + k. Let y(f) = 30f*2 - 55f - 1. Determine -6p(j) - y(j). -12j*2 + 49j + 1 Let b(h) = -h - 6. Let n(d) = 112d + 11. Let s(o) = 134o + 12. Let f(l) = 6n(l) - 5s(l). Suppose 3w - 6 = -0. Give wf(u) + 3b(u). u - 6 Suppose 169y = 255y + 516. Let n(z) = 4z*2 + 20z + 6. Let i(d) = -5d2 - 21d - 7. What is yi(h) - 7n(h)? 2h2 - 14h Let q(x) = -x*3 - 9x. Let v(t) = t*3 + 14t. Let n = -178 + 176. Let w be (n/(-2))/(52/(-416)). Give wq(r) - 5v(r). 3r3 + 2r Let d = 21 - 16. Let v(o) = -o + 1 - 4o + 10o - o - 4. Let r(k) = 2k - 1. What is dr(t) - 2v(t)? 2t + 1 Suppose 16m + 68 = 20m. Let h(b) = -5b2 - 6b - 10 - 6 + m - 4. Let q(j) = j*2 + j + 1. Give h(u) + 3q(u). -2u2 - 3u Let l(d) = -1436d2 + 26d + 13. Let w(b) = 359b2 - 6b - 3. Give -2l(q) - 9w(q). -359q2 + 2q + 1 Suppose -12x = -27x + 30. Let w(h) = 2 - 1 + 5 - 7h - 1 - 8h*x. Let a(j) = 7j*2 + 6j - 4. Give 6a(n) + 5w(n). 2n2 + n + 1 Let l(d) = -5d*3 + 3d*2 + 3. Let p(h) = 4h*3 - 4h*2 - 4. Let x be (102/(-30) - -3)/(3/(-45)2). Calculate xp(z) + 4l(z). -8z3 Let x(i) = i3 + i2 - 1. Let f(y) = 1852y*3 + 3 + 1858y*3 - 3706y*3 - 2y + 2y2 - 4. Calculate f(b) - 2x(b). 2b3 - 2b + 1 Let i(c) = 11c3 - 5c*2 - 99c + 6. Let z(j) = 20j3 - 9j*2 - 194j + 11. Determine 5i(q) - 3z(q). -5q3 + 2q*2 + 87q - 3 Let m(l) = 88l3 - 16l*2 - 11l - 4. Let h(z) = -30z3 + 6z*2 + 4z + 1. Give -11h(y) - 4m(y). -22y3 - 2y2 + 5 Let z = -246 + 133. Let q = z - -146. Let u(l) = l2 + 2l + 2. Let r(f) = -15f*2 - 33f - 33. Give qu(g) + 2r(g). 3g2 Let y(h) = h2 + 2. Let g(b) = -19. Let q(k) = -3 + 10 - 8 - 12. Let l(x) = -2g(x) + 3q(x). Determine 6l(j) + y(j). j*2 - 4 Let p(u) = u. Suppose 28y - 24y - 36 = -4j, -2j + 3y = 2. Let d(f) = -2f. Let c(h) = -h + 8. Let b be c(6). What is bd(k) + jp(k)? k Let a(x) = 10x*	{ "pile_set_name": "DM Mathematics" }
/(i/((i/(ii(-4)))/i))i))ii(i(5/2)i)/ii)(-12) assuming i is positive. i(-2614/23) Simplify (((n/n9n)/n)/n*(-5/2)(n/n*6n)/(nn(n/((n/(n/(n/n*(-1/2)n)))/n))/nn))(-50) assuming n is positive. n550 Simplify ((n24)(-4/41))(-5/3) assuming n is positive. n(160/41) Simplify (v/((v/v5)/v)v)/v*(-2/17)(v(-6))(-3/7) assuming v is positive. v(1153/119) Simplify (a/((a(-13)aa)/a))/(a*20/a)a(a(-16)/aa)/aaaa28a assuming a is positive. a9 Simplify ((u/u(2/7))*35(u(uuuu(1/2))/u)(6/11))(-2/89) assuming u is positive. u(-592/979) Simplify ((mm(-1/3)m*(5/4))/((mm/m(3/11))/(m(-1/5)/m)))(-48) assuming m is positive. m(2668/55) Simplify (w*5w)*(-1/27)w*26/(ww28) assuming w is positive. w(-29/9) Simplify p(1/7)/(p/(p(-1/16)/p))p1/p(-7) assuming p is positive. p(681/112) Simplify (n/(nnn/(n/n0n)n)n)(-1/77)/(n(2/23)n/(nn(-10))) assuming n is positive. n(-232/23) Simplify (j(-2))(-1/13)j/(j(1/2)/j)j(-10) assuming j is positive. j(-217/26) Simplify (h*1h/h(-16/3))49 assuming h is positive. h*(1078/3) Simplify (xx*(1/3)xx)(-29/2)/(x/(x(2/13)x)x(-9)) assuming x is positive. x(-1528/39) Simplify (((dd(-19))/d)/d7)(-49) assuming d is positive. d1274 Simplify (a*(-16)a(-22)/a)(-1/4) assuming a is positive. a(39/4) Simplify o(2/25)/((o/(oo(2/21)))/o)oo(5/2)/ooo2 assuming o is positive. o(7009/1050) Simplify (j(-2/11)/j)/j11(j(2/9))(-43) assuming j is positive. j*(-2152/99) Simplify ((qq/q*6)/qq*4q*(-6)q/((qqqq(2/7))/qq))(1/5) assuming q is positive. q(-13/7) Simplify (a*(1/6)/(aa(9/7)))(-3) assuming a is positive. a(89/14) Simplify q24q(2/37)((q/(qq(-11/2)/qq))/q)/q(-36) assuming q is positive. q(4777/74) Simplify (s(1/4))(-11)s/(ss*(-7)s)ssss*4s assuming s is positive. s(45/4) Simplify (u(-7/2)/((uu/(u(-15/2)/uu)u)/u))/(u(1/4))(7/4) assuming u is positive. u(-215/16) Simplify (l(1/4)l/((lll*(-14)l)/l))/((ll(-1/7))/lll(-4)l) assuming l is positive. l(431/28) Simplify ((k(2/11)/(k/(k(7/4)/k)))/(k0)(4/25))15 assuming k is positive. k*(-45/44) Simplify (mmm(1/2))(-20)((m/m(2/13))/m)(-4/13) assuming m is positive. m(-8442/169) Simplify (k(1/2))*(-13/4)((k/(k/(((kkk*(6/7)k)/k)/k)))/kk)/(k/(k8/k)) assuming k is positive. k(349/56) Simplify (nn*7nn0n*(-2/9)n*(2/27)nn)42 assuming n is positive. n(4102/9) Simplify ((((h/(hhh/h(-2/11))h)/h)(-2/69))(-1/4))(-1/8) assuming h is positive. h(1/506) Simplify (y/(yyy/(y*(-1/5)/yyy)yy))(29/4)/(y(2/37)/y(-23)) assuming y is positive. y(-8557/185) Simplify (oo(-2/3))45/(((oo(6/7))/o)/oo)(-23) assuming o is positive. o(243/7) Simplify ((jj(-26))(-7/2))(-21) assuming j is positive. j(-3675/2) Simplify ((u(-2/9)u)*(2/7)u(-5)/u12)(3/13) assuming u is positive. u(-151/39) Simplify ((d((d/d(11/2))/d)/d)/d)/dd*14(d/(dd(-23)))/(dd/(dddd(-3))) assuming d is positive. d(55/2) Simplify (v2vvv(v(3/7)/v)/v((v*(1/4)vv)/v)(1/39))(8/7) assuming v is positive. v(7558/1911) Simplify (n(1/5)/nn)/n*(-5/4)(n13/n)(-15/4) assuming n is positive. n(-871/20) Simplify ((n/n(2/7)n(-1)n)/(n*(6/7)nn(7/2)))(3/5) assuming n is positive. n(-39/14) Simplify t(-1)/t(tt(-2/35)/t)/t(tt(-2/5)tt)(48/5) assuming t is positive. t(3833/175) Simplify (x/x6x*(-1)(x/(x/x*(-1/6)))/(xx/(x/x*0)x))9 assuming x is positive. x(-147/2) Simplify (cc(-17)c)/(cc(c/(c*(-1/10)/c))/c)(cc(2/5))(8/11) assuming c is positive. c(-1879/110) Simplify ((h/((h/h(-2))/h))/(h(-1/14)/hh))/((h*(4/17)hh)/((h(-15)/hh)/h)) assuming h is positive. h(-4561/238) Simplify (d(10/7)/d)(2/41)/(d12(d(-2/53)d)/d) assuming d is positive. d(-181640/15211) Simplify ((y(-1/10))27)(-2/87) assuming y is positive. y(9/145) Simplify ((a(-1/9)a(-6)/a)/(a/(a/(((a/((a/a(-3)a)/aa))/a)/a))aa(-7)/aaa))(-10) assuming a is positive. a(-350/9) Simplify (f/((f/(f(-2/29)/f))/f))(6/11)/(f/(ff*9ff))(1/2) assuming f is positive. f(3485/638) Simplify (((s(-15)s)/(sss(-2/65)/s))3)(-8/15) assuming s is positive. s(7784/325) Simplify ((z/((z/(z*11/z))/zz))/(z*(1/10)z))/((zz/(z/(z/z5)))/(zzz(-20))) assuming z is positive. z(-61/10) Simplify ((l(-3/11)/lll/l(3/14))(2/3))30 assuming l is positive. l(790/77) Simplify (w(4/3)/(www(3/5)w))/(w(-16)/w(-2)) assuming w is positive. w(176/15) Simplify (h(-5/3)h/h(1/11))/(hh/((hh(-1/5))/hhh))(-5/6) assuming h is positive. h(-13/22) Simplify ((gg*26g)/(g(g0/g)/gg))(-18) assuming g is positive. g(-504) Simplify k(-11/5)/(k/k(2/51))((k10/k)/k)(-15) assuming k is positive. k(-31406/255) Simplify (bb/(b/b*(-1/4))b)(-22)/((b(-1/5)b)/(((b14/bb)/b)/b)) assuming b is positive. b(-273/10) Simplify ((j(-3/11))(9/5))2 assuming j is positive. j*(-54/55) Simplify ((((xxx(-15)x)/x)/xx)/((x(x(x(7/2)xx)/x)/x)/x))/((x/(x(-18)x))/(xxx*(5/14)/xx)) assuming x is positive. x*(-232/7) Simplify (ppppp(-6/13))(-1/10)/((p(p/(p*(-17)/p)p)/p)/(p/(p/(p/(p(((p/((p(-13)p)/p))/pp)/p)/ppp))))) assuming p is positive. p(-2233/65) Simplify (f(4/15)f)*(-3/4)f*(-1/2)/(ff(2/21)) assuming f is positive. f(-1069/420) Simplify (ttt*(-5)tt(-3/32))/((t(2/57)t)/t(5/3)) assuming t is positive. t(-889/608) Simplify s*(2/3)ssss/(ss*(-1/4))ss/s(-1/4)s10 assuming s is positive. s(97/6) Simplify (m*(1/26)mmm/(m/m*(1/4)m)mmm)(1/9) assuming m is positive. m(223/468) Simplify d(-3)/ddd31dd(d/(dd(-21)/d))(-36/5) assuming d is positive. d(-642/5) Simplify (s/s(-2/3))/(s((s*(-8)/s)/s)/s)(s/((ss/((s(-1)s)/s)ss)/ss))38 assuming s is positive. s(-421/3) Simplify ((nn*(-14)nn)/n0)(4/7) assuming n is positive. n(-44/7) Simplify (r(rr(-3/8)/rr)/rr)/rrrr*1(r/r*18r)/r19 assuming r is positive. r(-251/8) Simplify (j/j*(-17))/(j/(jj*(-12)))j*(-11)jj/(jj(-2/61)/j) assuming j is positive. j(-181/61) Simplify (b/(b(b/(b/(b/b(-7))))/b))/(((((b/b4b)/b)/b)/b)/b)(b(2/21))14 assuming b is positive. b(1/3) Simplify ((c(-2/5))41(c/(c/c*5)c)/cc(-2))(-5/14) assuming c is positive. c(67/14) Simplify (b1b/b*16b)(-2/15) assuming b is positive. b(26/15) Simplify (yy(-6)yyy*(-1/34))/((((yy*(-9/7))/yy)/y)/((yy(6/5))/y)) assuming y is positive. y(-647/1190) Simplify (u(-4)/u)(-1/54)(u/(uuuu(-1)uu))(1/4) assuming u is positive. u(-71/108) Simplify (h(-11)h/(hh/(h/((hh*(4/11))/h))h))/(hh1(h*(-15)/hh)/h) assuming h is positive. h(18/11) Simplify ((a(-28)aa)/((a/(a/((a*(-22)a)/aa)a))/a))/(a/a*(1/22)aa/a(-14)a) assuming a is positive. a(-461/22) Simplify (j(-8/3)j(-11)j)/((jjj(-1/9))/j3) assuming j is positive. j*(-104/9) Simplify ((ss1)(-48)s(-1/8)/s(-2/5))21 assuming s is positive. s(-80409/40) Simplify ((z(-2)/zz(-12))/(z(-12)zz*(-13)z))(-11/6) assuming z is positive. z(-44/3) Simplify (oo/o(-1/13))/o(-1/8)(oo(4/11))(2/77) assuming o is positive. o(197083/88088) Simplify d(2/3)/d13(dd/(dd(-7/3)))/d0 assuming d is positive. d*(-9) Simplify (xx(-1/5))(7/4)xx*(-5/8)x/((x/(xx(1/2))xx)/x) assuming x is positive. x(91/40) Simplify (s(2/11)/s)(3/34)s*(2/3)sss(2/7) assuming s is positive. s(22621/7854) Simplify (vv/(v/(v/(vv*(4/11)v)v))v)/v*(-5/4)((v(-5)/v)/v)/v11 assuming v is positive. v(-665/44) Simplify ((f(-1/4))(9/4)/(f(1/14)f/f(-2)))(-42) assuming f is positive. f(1221/8) Simplify ((bb*(-1)bb)(-42)((b/b2)/b)43)(1/11) assuming b is positive. b(-170/11) Simplify ((y*(-2/3)yyy(-2/3))/((y/(y(-1/3)y))/y)(2/19))(-4/23) assuming y is positive. y(-56/437) Simplify (ww/w*2w/w*(-14))/(w/(((ww*(-3)/w)/w)/w)w**18/w) as	{ "pile_set_name": "DM Mathematics" }
ers picked without replacement from kypnnlc? 1/105 Calculate prob of sequence lll when three letters picked without replacement from {c: 3, l: 13}. 143/280 Two letters picked without replacement from {k: 1, s: 1, e: 1, l: 2}. What is prob of sequence ke? 1/20 Two letters picked without replacement from {d: 1, p: 7, f: 11}. Give prob of sequence fd. 11/342 Calculate prob of sequence pzz when three letters picked without replacement from jyyzpz. 1/60 Two letters picked without replacement from {f: 2, r: 8, d: 6, n: 1, v: 1}. What is prob of sequence dn? 1/51 Calculate prob of sequence tn when two letters picked without replacement from {t: 1, k: 6, n: 5, f: 1, l: 1, x: 2}. 1/48 Two letters picked without replacement from {k: 10, y: 9}. What is prob of sequence ky? 5/19 Two letters picked without replacement from iisiinsiijsssisssiji. What is prob of sequence nj? 1/190 Two letters picked without replacement from igiggg. What is prob of sequence ii? 1/15 Calculate prob of sequence nil when three letters picked without replacement from {w: 2, t: 1, l: 1, i: 2, n: 2}. 1/84 Two letters picked without replacement from {l: 4, r: 1, s: 4, x: 1, q: 3}. Give prob of sequence ss. 1/13 Calculate prob of sequence tmi when three letters picked without replacement from {i: 3, t: 1, d: 2, m: 1}. 1/70 What is prob of sequence qi when two letters picked without replacement from {i: 5, q: 15}? 15/76 What is prob of sequence mrt when three letters picked without replacement from mthrh? 1/60 Four letters picked without replacement from uyybtautyyttyyta. Give prob of sequence butu. 1/4368 Calculate prob of sequence qqq when three letters picked without replacement from yqyfofoyqqoqkoqrroq. 20/969 Two letters picked without replacement from {l: 4, g: 15}. Give prob of sequence ll. 2/57 Three letters picked without replacement from ikikk. Give prob of sequence kik. 1/5 Calculate prob of sequence aal when three letters picked without replacement from alllljallllallllj. 3/170 What is prob of sequence jljt when four letters picked without replacement from lltttjjtj? 1/63 What is prob of sequence uux when three letters picked without replacement from {x: 9, u: 7}? 9/80 Calculate prob of sequence ee when two letters picked without replacement from {e: 3, u: 1, z: 4}. 3/28 Calculate prob of sequence vn when two letters picked without replacement from {v: 2, n: 1}. 1/3 Calculate prob of sequence dbb when three letters picked without replacement from ddbddadadadaidaddbd. 11/2907 Calculate prob of sequence nna when three letters picked without replacement from tnnmmma. 1/105 Three letters picked without replacement from {g: 1, r: 2}. Give prob of sequence rgr. 1/3 Three letters picked without replacement from rrrrbubhrhrb. What is prob of sequence hrr? 1/22 Calculate prob of sequence eq when two letters picked without replacement from hehihmq. 1/42 What is prob of sequence uu when two letters picked without replacement from {l: 1, t: 5, p: 1, r: 1, u: 3}? 3/55 Two letters picked without replacement from zrarzzeazreq. What is prob of sequence ez? 2/33 Calculate prob of sequence xx when two letters picked without replacement from xxcxcxxcxcxcx. 14/39 Three letters picked without replacement from {g: 1, y: 1, p: 1, l: 2, s: 1, c: 1}. Give prob of sequence lgc. 1/105 Calculate prob of sequence mm when two letters picked without replacement from jjjhmdjmdjhhjjhjjh. 1/153 What is prob of sequence bd when two letters picked without replacement from ixxdibdxbbhbbbdxh? 9/136 Two letters picked without replacement from msaavvmmvmip. What is prob of sequence vm? 1/11 Two letters picked without replacement from {y: 2, r: 2, i: 2}. What is prob of sequence rr? 1/15 Calculate prob of sequence ge when two letters picked without replacement from {g: 3, e: 8, c: 2, y: 2}. 4/35 Four letters picked without replacement from {f: 4, t: 2, p: 2, b: 3, o: 6, v: 1}. Give prob of sequence fptf. 1/1530 Three letters picked without replacement from {k: 4, w: 10}. What is prob of sequence kww? 15/91 Three letters picked without replacement from wfkwf. What is prob of sequence wfw? 1/15 Three letters picked without replacement from {j: 17, w: 2}. Give prob of sequence jwj. 16/171 Four letters picked without replacement from ddddd. What is prob of sequence dddd? 1 What is prob of sequence vsp when three letters picked without replacement from psvtf? 1/60 Three letters picked without replacement from vpvphpnphpvhvvhhp. What is prob of sequence pnp? 1/136 Four letters picked without replacement from vvvzzwqvvvw. What is prob of sequence zwvq? 1/330 Two letters picked without replacement from {b: 2, z: 5, t: 6, s: 3, f: 1}. Give prob of sequence sz. 15/272 What is prob of sequence qkk when three letters picked without replacement from {k: 4, q: 2}? 1/5 Four letters picked without replacement from {t: 2, s: 5, r: 3}. What is prob of sequence rsrr? 1/168 Calculate prob of sequence xfw when three letters picked without replacement from {f: 1, x: 5, m: 1, w: 1, r: 4}. 1/264 Calculate prob of sequence hrz when three letters picked without replacement from {r: 1, n: 13, z: 2, h: 1, a: 1, t: 2}. 1/3420 Four letters picked without replacement from yyyynyooonon. What is prob of sequence ynyo? 2/99 Three letters picked without replacement from neeeenneeeneneeeene. Give prob of sequence ene. 52/323 Calculate prob of sequence lu when two letters picked without replacement from {v: 4, u: 1, e: 8, l: 4, f: 2}. 2/171 Three letters picked without replacement from ubbbbubu. Give prob of sequence bbu. 5/28 Two letters picked without replacement from xixixxxxxxxxxxixxx. Give prob of sequence xx. 35/51 Four letters picked without replacement from jzxziizxxzxnix. Give prob of sequence zxix. 10/1001 What is prob of sequence ap when two letters picked without replacement from aplbbfpasbpblbl? 1/35 Calculate prob of sequence ccf when three letters picked without replacement from ffccffffbbffffffcbbf. 13/1140 Calculate prob of sequence cluq when four letters picked without replacement from qacqqqlqluqaiq. 1/1716 What is prob of sequence su when two letters picked without replacement from {b: 5, u: 3, s: 5}? 5/52 Four letters picked without replacement from pppppppooopooppopp. Give prob of sequence opoo. 1/51 Calculate prob of sequence pc when two letters picked without replacement from {p: 5, a: 1, m: 4, r: 5, c: 1, s: 1}. 5/272 Two letters picked without replacement from {p: 3, k: 2, e: 5, t: 10}. Give prob of sequence kt. 1/19 What is prob of sequence bgx when three letters picked without replacement from ixibixiiggixiix? 4/1365 What is prob of sequence qt when two letters picked without replacement from wwtwtwtqw? 1/24 What is prob of sequence ggk when three letters picked without replacement from ggkggggg? 1/8 Two letters picked without replacement from iixxddxxiixxiidiix. What is prob of sequence xd? 7/102 What is prob of sequence vv when two letters picked without replacement from jvjvjjv? 1/7 Calculate prob of sequence eevv when four letters picked without replacement from {e: 8, v: 3}. 7/165 What is prob of sequence ta when two letters picked without replacement from {t: 2, m: 4, l: 5, a: 2}? 1/39 Two letters picked without replacement from yloppopprlpo. Give prob of sequence ro. 1/44 Two letters picked without replacement from hhuhhhuurzuhhhzrhuhh. What is prob of sequence uz? 1/38 Two letters picked without replacement from djajjdy. Give prob of sequence yj. 1/14 Two letters picked without replacement from {v: 1, w: 2, y: 2, x: 1, h: 1, l: 1}. Give prob of sequence wy. 1/14 Calculate prob of sequence eec when three letters picked without replacement from {y: 4, g: 2, e: 2, c: 1}. 1/252 What is prob of sequence cqcc when four letters picked without replacement from {c: 3, j: 4, l: 8, k: 2, q: 2}? 1/7752 What is prob of sequence kq when two letters picked without replacement from zekkklkgzzglkzgqgk? 1/51 Two letters picked without replacement from oqmqommoomqmm. Give prob of sequence qq. 1/26 Calculate prob of sequence edz when three letters picked without replacement from teeddtzdet. 1/80 Calculate prob of sequence ka when two letters picked without replacement from kakrjkjkkmmjakj. 2/35 Calculate prob of sequence ln when	{ "pile_set_name": "DM Mathematics" }
e Suppose -75177 = -3o - 29262. Is o a prime number? False Suppose 3u = 3y - 66, 3y = 2y. Let k = -22 - u. Suppose 3h + 2h - 485 = k. Is h composite? False Suppose -94k + 69990 = -88k. Is k prime? False Let o be 3 + (-1 - 1) + -1. Suppose 5c - 3h - 504 - 94 = o, -h = -4. Is c a composite number? True Suppose 4m = -20m + 120. Is m/(-10)-412 + -3 a composite number? True Let r(o) be the third derivative of o5/60 - o4/6 + 7o3/2 + 2o2. Is r(6) a composite number? True Let s = -2843 - -9196. Is s a composite number? False Let o(a) be the first derivative of a4/2 - 8a3 + 7a*2/2 - 13a - 32. Is o(16) composite? True Suppose 6 = 8j - 6j. Suppose w - 2u - 313 = -u, u + 947 = jw. Is w a composite number? False Suppose -r - 4c = 12278, 2c - 12 = -c. Let x be (r/(-12))/(6/8). Suppose -4t + 5m + x = -3t, -3t + 4086 = -3m. Is t composite? False Suppose 0 = 590m - 591m + 5227. Is m a composite number? False Let k(o) = -4o - 8. Let l be (1 + (-2)/(-4))-2. Let u be k(l). Suppose 2a + uw - 1594 = -0w, 5w + 797 = a. Is a composite? False Suppose -32k = -27k - 745. Is k a composite number? False Let d = 45 + -14. Is -3d/(-3)(-1 + 2) a composite number? False Let n = 46983 + -23794. Is n a prime number? True Suppose -2y + 66172 = 3b, 4b = -y - 0b + 33091. Is y prime? True Let z = 20387 + -13924. Is z composite? True Is -31465/(-60)4 a composite number? False Let x(i) = 15386i*2 + 21i - 40. Is x(2) a composite number? True Suppose 2j + 2z = -2, -2 = -j - 2j - 2z. Suppose -2 = 5c + 8, 0 = jn + 4c - 14180. Is n a prime number? True Let l(h) = -h2 + 11h - 8. Let z be l(10). Suppose 14 + 10 = zj - g, -5j = -g - 60. Is (-6 + 2)(-249)/j a composite number? False Let j(p) = 4p + 19. Let n be j(-4). Is (-4)/8 + ((-2223)/(-6))/n composite? True Suppose -12756 + 4099 = -11k. Is k prime? True Let y = -5 + 15. Suppose 2z = -3z - y. Is 33 - (0/1 + z) a composite number? True Suppose 12 = -3k, -4k + 24 = 4w - 0w. Let a = w + -7. Suppose q - 2p - 377 = -0p, ap - 1475 = -4q. Is q a prime number? False Let t be -7-1(-6)/(-21). Suppose -h - th = -561. Suppose 0 = -2n + 4a + 146, 4n - 2a = 7n - h. Is n a composite number? True Let w(q) = q2 - 7q + 9. Let c be w(6). Suppose -5r + 3r + 4h = -140, 2h - 226 = -cr. Is r a composite number? True Is 4494 + (1 - 0 - -4) a prime number? False Let x = -3952 + 9305. Is x a prime number? False Let w(j) = j2 - 7j + 14. Let f be w(4). Suppose -z - 1559 = -3y, -3y + fz - 1050 = -5y. Is y composite? False Suppose -m + u = -361 + 75, -u - 4 = 0. Let s = 834 - m. Suppose -s + 165 = -3n. Is n composite? True Let f = 189 - -784. Is f composite? True Let k(y) = 6y*2 - 6y - 17. Is k(16) a composite number? False Let a = -273 - -470. Let u = 182 + a. Is u a prime number? True Let g be (-316)/(-36) - (-4)/18. Let c(j) = -9 + 868j - 3 - g + 22. Is c(1) a prime number? False Let a be (9 + -18)2/6. Is 1226/(22/10 + a/15) prime? True Let g be (5/(-2))/50. Suppose g = 2b + 2b + 32. Is (194/(-4))/(4/b) a composite number? False Let b(r) = 4r*2 + 45 + 10r*3 - 56 - 10r - 2r3. Is b(5) composite? False Suppose 47d - 44d = 0. Suppose di + 1058 = 2g + 2i, -1046 = -2g + 2i. Is g prime? False Is 41723/226/3 composite? False Let b(c) be the second derivative of 13c4/6 + c3/3 + c*2/2 + 6c. Let j be b(2). Suppose 0 = 4r - 383 - j. Is r composite? True Let d(y) = 7y*2 - y + 1. Let f = 59 - 67. Is d(f) a composite number? False Let u be (-2 - -23)1/3. Let q(y) = -y*2 + 8y - 3. Let t be q(u). Suppose ti = 2i - 2, 0 = 2b + 3i - 155. Is b prime? True Let j = 28859 - 9420. Is j a prime number? False Suppose 37840 = 2y + w, 0 = -5y + 19w - 16w + 94589. Is y prime? True Suppose -2p - 3p = -75. Suppose 3s + 2s = -p. Is (0 - (3 - 209)) + s composite? True Let s(a) be the third derivative of a*5/20 + 5a*4/12 - 3a3 + a2. Let f be s(-10). Suppose 8o - 10o = -f. Is o a prime number? False Is (-399831)/(-45) - 4/30 composite? True Let r = -64 + 321. Let x be (-206)/(1 - 6/4). Let p = x - r. Is p prime? False Suppose 0 = 4n + 25 + 27. Let x(c) = -15c + 16. Is x(n) composite? False Suppose 2i = 4g + 122, -5g + 214 = 3i + 64. Let a = i - 4. Is a composite? True Let r(p) = -404 - 14p + 423 - p. Is r(-6) a composite number? False Let r(f) = -f3 + 12f*2 - f + 6. Let k be r(12). Is (-5530)/k + (-4)/(-12) a prime number? False Let v = -5 + 4. Let k be (v - 0)1900/(-5). Suppose 3u + 69 + 315 = 4i, -4i + 2u + k = 0. Is i a composite number? True Let i(v) = 1478v + 39. Is i(8) composite? False Suppose 0 = -5o + 37o - 15520. Is o prime? False Let v(t) = -119t + 43. Is v(-14) composite? False Let m(u) = 13u - 7. Let s be m(9). Suppose -j + 4 + 121 = -2h, h - s = -j. Is j a composite number? True Suppose 99h - 110h = -219769. Is h a prime number? True Let r(s) = 73s3 + 11s*2 - 37s + 9. Is r(4) composite? True Let o(x) = 47x - 6. Let j be o(7). Let w(l) = 65l - 1. Let r be w(7). Let i = r - j. Is i prime? True Let k be (2/1 - -11) + -1. Suppose 0 = 3z + z - k. Suppose -zo - 11 = -4o. Is o composite? False Suppose h = 2h - 3k - 34, -122 = -5h - k. Suppose 0 = -5q + h - 5. Suppose i - 905 = -qi. Is i prime? True Suppose 0 = 2w - 3k + 6k - 19048, -2w = k - 19052. Is w a prime number? False Let y(u) = 173u2 + 10u + 79. Is y(-6) composite? False Suppose 42p = 11p + 2449961. Is p a composite number? False Let n = 2814 + 14041. Is n a prime number? False Suppose -5b + 20 = 2g, 2g = 4g + 2b - 14. Suppose 15574 = gq + 3909. Is q prime? True Let l(r) = r*2 - 11r + 15. Let m be l(8). Is (-1892)/(-3) + 3(-1)/m a prime number? True Suppose 2b = -3b. Suppose -3l + 354 + 3 = b. Is l prime? False Let u = 461 - 650. Let t = u + 316. Is t a prime number? True Is 85/180 + 687506/18 composite? True Let h(u) = -5u3 - u2 + 15u + 13. Is h(-12) composite? False Let g(d) = 7d2 + d - 1. Let x(k) = k2 + k + 1. Let l be x(-1). Let b be g(l). Suppose 5t = bt - 1038. Is t a composite number? True Let p be ((-84)/10)/(4/(-20)). Let d = 103 + p. Is d composite? True Let b be -158(-2)/12-21. Is (-3 - 4 - -3)b/4 composite? True Let l be 2/7 - (-1984)/112. Suppose -5h + l = -2h. Let b = 13 - h. Is b a prime number? True Suppose 2f + 168472 = 10f. Is f a prime number? True Suppose -7b - j = -11b, -5j + 20 = 0. Let y(x) = 512x3 - 1. Is y(b) a prime number? False Let y(i) be the second derivative of i3/6 + i2/2 + 5i. Let d be y(11). Is 153 + d/(-3)-1 a composite number? False Let t = -116 - -63. Let c = -12 - t. Suppose 3g + c = y, -5g + 99 = -4y + 249. Is y composite? True Let n = 502 + 1719. Is n a prime number? True Let q = 86 - 86. Let h(v) = -2v2 + 681. Is h(q) composite? True Is (3/9)/(-3 - 231744/(-77247)) prime? False Let z(v) = v2 + 7v + 4. Let u be z(-7). Suppose -x + 4c - 3613 = -ux, 2x - 2386 = 3c. Is x composite? True Suppose 9f - 7215 = -4f. Let d(s) = 2s2 + s - 4. Let r be d(12). Let g = f - r. Is g prime? False Let j = 9 - 14. Is 116-4j/40 composite? True Suppose -3t = -3 - 18. Suppose 552 = 5k - tk. Let y = k + 453. Is y composite? True Let z be ((-5)/10)/(3/(-72)). Suppose -5w + z = -w. Suppose -125 - 283 = -3q - 3u, 0 = -q - wu + 142. Is q a composite number? True Let w = -41 - -26. Let k(p) = -67p + 13p*2 - 14p*2 + 43p + 6. Is k(w) prime? False Let c(t) = 114t2 + 7t - 11. Let n be c(3). Suppose d - 79 = n. Is d a prime number? False Let a = 105 - 321. Let v = a + 303. Is v a prime number? False Suppose -2f - f = -z - 4, -z = -2f + 4. Let s be 2443/63 - z/18. Let n = s - -28. Is n prime? True Let r be 2/(6/3) - 1. Suppose r = -2s + 5s + 36. Is (-58)/(-4)(2 - s) composite? True Suppose -o + 5w + 52 = -0w, -o = -4w - 52. Let a(x) = x*2 - 11 - 17 + o - 8x. Is a(-11) composite? False Suppose 8d - 5u = 9d - 1303, -2645 = -2d + 3u. Is d a prime number? False Suppose 4t - 40 = 3y - 455, -2y = -5t - 272. Is y prime? False Is (7467/(-76))/(3/(-52)) a prime number? False Suppose -2x + 3c + 21670 = 0, 14c - 9c = 20. Is x composite? True Let l be (200/(-28))/((-3)/21). Suppose -j - 24 = 3a, 2j + 3a + l = 5	{ "pile_set_name": "DM Mathematics" }
74884? 2, 1318721 List the prime factors of 66317. 17, 47, 83 What are the prime factors of 15309428? 2, 3827357 List the prime factors of 3696304. 2, 231019 What are the prime factors of 1159269? 3, 23, 53, 317 What are the prime factors of 4047421? 7, 578203 What are the prime factors of 533776? 2, 73, 457 What are the prime factors of 9001742? 2, 4500871 List the prime factors of 54222. 2, 3, 7, 1291 List the prime factors of 23011983. 3, 19, 23, 5851 What are the prime factors of 2525208? 2, 3, 7, 15031 List the prime factors of 607553. 307, 1979 List the prime factors of 4674011. 1063, 4397 List the prime factors of 4754219. 1129, 4211 What are the prime factors of 286447? 7, 151, 271 List the prime factors of 209768. 2, 13, 2017 List the prime factors of 6456451. 181, 35671 What are the prime factors of 591781? 113, 5237 What are the prime factors of 1595312? 2, 99707 What are the prime factors of 16769348? 2, 71, 137, 431 List the prime factors of 534921. 3, 178307 What are the prime factors of 1684149? 3, 61, 9203 What are the prime factors of 57798? 2, 3, 13, 19 List the prime factors of 382142. 2, 191071 List the prime factors of 6301125. 3, 5, 1867 What are the prime factors of 4604369? 7, 11, 59797 List the prime factors of 76660. 2, 5, 3833 List the prime factors of 53671. 191, 281 List the prime factors of 172107. 3, 13, 1471 What are the prime factors of 126688? 2, 37, 107 List the prime factors of 4910493. 3, 7, 19, 31, 397 List the prime factors of 188844. 2, 3, 15737 List the prime factors of 656263. 656263 What are the prime factors of 2438640? 2, 3, 5, 1129 What are the prime factors of 885709? 11, 73, 1103 List the prime factors of 312975. 3, 5, 13, 107 What are the prime factors of 361587? 3, 43, 2803 List the prime factors of 618251. 29, 21319 What are the prime factors of 228579? 3, 13, 5861 What are the prime factors of 609155? 5, 23, 5297 List the prime factors of 6529779. 3, 725531 What are the prime factors of 407870? 2, 5, 40787 What are the prime factors of 12359884? 2, 17, 181763 What are the prime factors of 14955330? 2, 3, 5, 13, 31, 1237 What are the prime factors of 2813563? 2813563 List the prime factors of 250496. 2, 19, 103 What are the prime factors of 25547036? 2, 211, 30269 List the prime factors of 11264724. 2, 3, 37, 2819 List the prime factors of 197266. 2, 53, 1861 List the prime factors of 1399196. 2, 499, 701 What are the prime factors of 474457? 541, 877 What are the prime factors of 17871452? 2, 4467863 List the prime factors of 112046. 2, 11, 463 What are the prime factors of 6005498? 2, 113, 26573 What are the prime factors of 4881741? 3, 1627247 What are the prime factors of 27397? 27397 List the prime factors of 578683. 7, 19, 229 List the prime factors of 402102. 2, 3, 89, 251 List the prime factors of 38422327. 251, 153077 What are the prime factors of 895599? 3, 191, 521 What are the prime factors of 1195253? 17, 70309 What are the prime factors of 106134? 2, 3, 7, 19 List the prime factors of 265217. 17, 15601 What are the prime factors of 1899517? 67, 28351 List the prime factors of 11823745. 5, 277, 8537 What are the prime factors of 3488779? 7, 498397 What are the prime factors of 34392774? 2, 3, 13, 19, 23, 1009 What are the prime factors of 14684766? 2, 3, 1523, 1607 What are the prime factors of 1488417? 3, 7, 70877 List the prime factors of 175587. 3, 107, 547 What are the prime factors of 181895? 5, 7, 5197 List the prime factors of 19655406. 2, 3, 363989 What are the prime factors of 13526852? 2, 23, 147031 List the prime factors of 2472708. 2, 3, 7, 29437 What are the prime factors of 39138162? 2, 3, 7, 239, 557 List the prime factors of 200116. 2, 7, 1021 List the prime factors of 241713. 3, 107, 251 What are the prime factors of 1229439? 3, 409813 List the prime factors of 111866. 2, 55933 What are the prime factors of 209430? 2, 3, 5, 13, 179 What are the prime factors of 1784451? 3, 179, 3323 List the prime factors of 9360672. 2, 3, 281, 347 List the prime factors of 8676363. 3, 59, 49019 List the prime factors of 5353517. 13, 411809 List the prime factors of 198748. 2, 11, 4517 What are the prime factors of 2457384? 2, 3, 17, 19, 317 List the prime factors of 2610144. 2, 3, 19, 53 What are the prime factors of 654797? 11, 13, 19, 241 List the prime factors of 1674576. 2, 3, 29, 401 What are the prime factors of 291198? 2, 3, 48533 What are the prime factors of 639301? 13, 49177 What are the prime factors of 45832? 2, 17, 337 What are the prime factors of 17348466? 2, 3, 17, 283, 601 What are the prime factors of 49155? 3, 5, 29, 113 What are the prime factors of 1450839? 3, 13, 37201 List the prime factors of 1175892. 2, 3, 29, 31, 109 What are the prime factors of 485001? 3, 11, 23, 71 What are the prime factors of 431692? 2, 107923 List the prime factors of 19953642. 2, 3, 1787, 1861 What are the prime factors of 990272? 2, 15473 What are the prime factors of 6499407? 3, 43, 50383 List the prime factors of 207543. 3, 7, 9883 List the prime factors of 1392418. 2, 227, 3067 What are the prime factors of 17045488? 2, 1065343 List the prime factors of 1390954. 2, 695477 What are the prime factors of 2287859? 7, 46691 List the prime factors of 4159140. 2, 3, 5, 103, 673 What are the prime factors of 359825? 5, 37, 389 What are the prime factors of 2317901? 31, 74771 What are the prime factors of 26532853? 26532853 What are the prime factors of 314835? 3, 5, 139, 151 What are the prime factors of 8768433? 3, 2922811 What are the prime factors of 8922626? 2, 4461313 List the prime factors of 1018376. 2, 127297 What are the prime factors of 164479? 7, 23497 List the prime factors of 2499726. 2, 3, 416621 List the prime factors of 3197670. 2, 3, 5, 7, 15227 What are the prime factors of 114578? 2, 59, 971 What are the prime factors of 20359? 20359 List the prime factors of 20860. 2, 5, 7, 149 List the prime factors of 515791. 79, 6529 List the prime factors of 789957. 3, 7, 12539 What are the prime factors of 97543? 23, 4241 What are the prime factors of 26586? 2, 3, 7, 211 What are the prime factors of 329886? 2, 3, 41, 149 What are the prime factors of 470431? 13, 36187 What are the prime factors of 324618? 2, 3, 7, 59, 131 What are the prime factors of 5434? 2, 11, 13, 19 List the prime factors of 585123. 3, 7, 11, 17, 149 What are the prime factors of 1670179? 7, 397, 601 What are the prime factors of 2163441? 3, 7, 71, 1451 List the prime factors of 27006036. 2, 3, 2250503 List the prime factors of 318514. 2, 7, 22751 What are the prime factors of 652763? 23, 101, 281 What are the prime factors of 932126? 2, 13, 35851 List the prime factors of 9128972. 2, 2282243 What are the prime factors of 10025015? 5, 7, 11, 13, 2003 What are the prime factors of 1187796? 2, 3, 31, 103 List the prime factors of 894447. 3, 23, 29, 149 List the prime factors of 3093001. 1109, 2789 What are the prime factors of 4124397? 3, 619, 2221 List the prime factors of 369751. 369751 List the prime factors of 1408456. 2, 7, 3593 What are the prime factors of 858344? 2, 19, 5647 List the prime factors of 142300. 2, 5, 1423 What are the prime factors of 15811933? 19, 67, 12421 List the prime factors of 11922737. 157, 75941 What are the prime factors of 7210? 2, 5, 7, 103 What are the prime factors of 14489933? 17, 41, 20789 List the prime factors of 1758054. 2, 3, 113, 2593 List the prime factors of 8050987. 7, 1150141 List the prime factors of 10408764. 2, 3, 867397 What are the prime factors of 23677? 23677 What are the prime factors of 100180? 2, 5, 5009 List the prime factors of 167896. 2, 31, 677 What are the prime factors of 464821? 7, 66403 List the prime factors of 5344240. 2, 5, 11, 6073 What are the prime factors of 405482? 2, 7, 11, 2633 List the prime factors of 453452. 2, 113363 List the prime factors of 1752035. 5, 29, 43, 281 List the prime factors of 17103526. 2, 11, 777433 What are the prime factors of 8041948? 2, 1019, 1973 What are the prime factors of 91680? 2, 3, 5, 191 What are the prime factors of 660947? 7, 94421 List the prime factors of 574137. 3, 63793 What are the prime factors of 35174? 2, 43, 409 List the prime factors of 1755733. 7, 19, 43, 307 What are the prime fact	{ "pile_set_name": "DM Mathematics" }
Let x(t) = -t - 3. Let o(i) = 16i + 131. Determine 2o(u) + 26x(u). 6u + 184 Let u(j) = -5j - 9. Let p(l) be the first derivative of -5l*2 - 19l - 366. Calculate 6p(c) - 13u(c). 5c + 3 Let s(j) = -64j*2 - 97j + 19. Let h(t) = -16t2 - 21t + 5. What is 9h(m) - 2s(m)? -16m2 + 5m + 7 Let g(x) = -29x - 10x*2 - 69x + x*2 - 3 + 87x. Let z(c) = -4c2 - 6c - 2. Give -4g(l) + 7z(l). 8l2 + 2l - 2 Let p(d) = 4d3 + 6d*2 + 6d + 5. Let u be 8(-5)/(-17 - 3). Let l(q) = -q3 + 3q*2 - 1 + 5q*2 - 8q2 - q - qu. Determine 6l(x) + p(x). -2x*3 - 1 Suppose -j + 9j + 174j + 182 = 0. Let b(o) = -o2 - o. Let l(f) = 4f*3 - 5f*2 - f. Determine jl(m) + 4b(m). -4m3 + m2 - 3m Let p(h) = 7h + 31. Let u be p(-4). Suppose 51 - 57 = -ub. Let t(f) = -f. Let l(r) = -4r + 1. Give bl(s) - 6t(s). -2s + 2 Let k(r) = -349500r*2 - 3728r - 3728. Let m(c) = -937c2 - 10c - 10. What is -5k(q) + 1864m(q)? 932q2 Let s(q) = 3q - 2q + 0q + 7 - 5q - 2q. Let n(j) = -j - 9j - 7j + 14 + 6. Give -4n(a) + 11s(a). 2a - 3 Let p(v) = v - 2. Let k(g) = 233g + 15. Calculate 3k(f) + 21p(f). 720f + 3 Let d(h) = 1019h - 26. Let q(g) = -1016g + 29. Calculate 9d(c) + 8q(c). 1043c - 2 Let x(d) = -38d3 + 5d*2 + 9d - 19. Let w(a) = 10a3 - a2 - 2a + 4. Determine -9w(k) - 2x(k). -14k3 - k2 + 2 Suppose -2t - 130 = -4j - 230, 0 = 5t - 5j - 230. Let i(a) = 654a. Let c(v) = -77v. Calculate tc(w) + 5i(w). 36w Let a = 3574 - 3569. Let t(y) = 51y. Let d(n) = -26n. Calculate at(g) + 9d(g). 21g Let u(w) = -w + 8. Let l(b) = -8b + 792. Give l(g) - 10u(g). 2g + 712 Let i(r) = 11r - 5. Let x(c) be the first derivative of 5c*2/2 - 2c + 2579. Calculate 4i(m) - 9x(m). -m - 2 Let t(o) be the third derivative of o*5/12 + 3o*4/8 - 1385o*2. Let s(n) = -9n*2 - 17n. Give 4s(c) + 7t(c). -c*2 - 5c Let r(a) = 7a2 - a - 1. Suppose -3f + 7 + 11 = -4b, -5 = -4f - b. Let o(y) = 14y2 - y - 2. Give fo(w) - 5r(w). -7w*2 + 3w + 1 Let a(s) = 6s2 + 5s - 12. Let x(o) be the first derivative of o*3 + 3o*2/2 - 6o + 2263. Give -3a(f) + 5x(f). -3f2 + 6 Let q(z) = -22z*2 + 4z - 22. Let r(i) = 5i2 - i + 5. Let j(f) = -2q(f) - 9r(f). Let c(h) = 13h*2 - 5h + 3. Calculate c(n) + 5j(n). 8n*2 - 2 Let x(c) = -255c - 33. Let s(l) = -12l - 34. Let a(u) = 10u + 50. Let d(y) = -2a(y) - 3s(y). What is -33d(r) - 2x(r)? -18r Let o(d) = 67d + 35. Let y(a) = 205a + 104. Give -7o(h) + 2y(h). -59h - 37 Let c(d) = -2 - 3 - 2d + 6d - 5d2. Let x(q) = -12 + 5q + 7 - 6q2 - 1. Let o = 82 + -86. What is oc(w) + 3x(w)? 2w2 - w + 2 Let t(d) = -d2 + d - 1. Let k(p) be the second derivative of -7p4/12 + p3/2 - p2/2 + 1994p + 1. Give k(y) - 2t(y). -5y*2 + y + 1 Let j(r) = 2893r*3 + 1315r*2 + 1315r + 7890. Let f(s) = -2s3 - s2 - s - 6. Determine 5260f(b) + 4j(b). 1052b*3 Let m(c) = -109c - 428. Let n(y) = 28y + 107. What is -6m(h) - 23n(h)? 10h + 107 Let v(g) = 17382g2 - 9g - 18. Let b(j) = 11224425j2 - 5812j - 11624. Calculate 9b(l) - 5812v(l). -4359l2 Let s(a) = 46a*2 - 65a + 11. Let l(n) = -18n2 + 22n - 4. Give -11l(x) - 4s(x). 14x2 + 18x Let r(f) be the second derivative of -f4/12 + f2/2 + 2f - 2548. Let p(y) = -y2 - 11. Calculate -2p(j) + 4r(j). -2j*2 + 26 Let g(h) = -412h*2 - 209h - 7. Let v(r) = 190r2 + 104r + 3. Calculate 6g(w) + 13v(w). -2w2 + 98w - 3 Let y(i) = 80i + 11. Let d(u) = 162u + 25. Give -4d(m) + 9y(m). 72m - 1 Let t(i) = -9i3 + 3. Let a = -318 - -324. Let q(f) = -f2 - 3f. Let g be q(-3). Suppose -w + g = a. Let s(r) = 10r*3 - 4. Give wt(k) - 5s(k). 4k3 + 2 Let m(k) = k2 - 38k + 2. Let s(u) = 2u*2 - 304u + 404. Give -8m(v) + s(v). -6v*2 + 388 Let j(t) = 16t*2 - 3t + 4. Let i(l) = 33l2 - 7l + 9. Let m be (-1620)/330 - (6 + (-130)/22). What is mj(g) + 2i(g)? -14g2 + g - 2 Let g(f) = 9f. Let y(n) = 2n. Let p = 105 - 106. Let w be (3 - 1) + (p - -1). Suppose -2z = -0z + 22. Calculate wg(m) + zy(m). -4m Let f be ((-5)/14 + 1128/1316)/(2/(-8)). Let k(t) = 5t2 - 10t + 16. Let r(c) = c*2 - 2c + 3. What is fk(a) + 11r(a)? a*2 - 2a + 1 Let g(m) = -5m2 + 3m - 1. Let c(i) = 38i2 - 283i + 10. Determine c(q) + 8g(q). -2q*2 - 259q + 2 Let t(l) = l*2 - 1. Let c(v) = 39 - 47 + 12 - 4v*2 + 6v. Calculate c(f) + 6t(f). 2f*2 + 6f - 2 Let o(a) = 12a2 - a. Let u(v) = 38v*2 - 3v - 1424. What is -3o(r) + u(r)? 2r*2 - 1424 Let u(j) = -9j*2 - 2j - 2. Let p(v) = -v. Let c be (2/4(-30 - -38))/(0 - 4). What is cu(d) + 4p(d)? 9d*2 - 2d + 2 Let g(d) = d*3 - 46d*2 + 7d + 3. Let k(q) = q*3 - 25q*2 + 4q + 1. Give -5g(j) + 9k(j). 4j3 + 5j2 + j - 6 Let q(s) = s2 + s - 2. Suppose -c = 0, -37u + 39u - 4 = c. Let p(i) = -912i2 + 4i - 915i2 + 1830i*2 - 5. Calculate up(b) - 7q(b). -b2 + b + 4 Let n = 563 - 537. Let l(v) = 32v - 25v + n - 33v. Let c(h) = 5h - 5. Determine 16c(q) + 3l(q). 2q - 2 Let y be (-1)/((-1)/13)1. Let s(i) = 2i*2 - 6i - 6. Let a(t) = 4t2 - 13t - 13. Let n be 76/(-8)-62. Suppose 0d + n = -19d. What is da(j) + ys(j)? 2j2 Let o(p) = -7p*2 + 7p - 5. Let i be o(1). Let a(z) = -2z3 - 5z*2 - 7z + 1. Let n(d) = 3d3 + 8d*2 + 11d - 2. What is in(x) - 8a(x)? x*3 + x + 2 Let h(a) = -49a + 4. Let x(z) = 99z - 9. Give 5h(p) + 3x(p). 52p - 7 Suppose 31 - 7 = 3z. Let g(h) = 12 - 5 - 5h + 6h2 - 7 - 3 - 3. Let o(j) = -3j*2 - 12j + 6j + 4j - 2 + 5j2. Calculate zo(l) - 3g(l). -2l*2 - l + 2 Let t(o) be the third derivative of 0 - 1/2o*3 + 19o*2 + 0o. Let s(i) = -i + 13. Let b(z) = 1. Let m(f) = 6b(f) - s(f). Determine -2m(j) + 5t(j). -2j - 1 Let r(n) = 5n3 - 6n - 3n2 - 1 - n3 - 5 + 2. Let v(m) = -3m*3 + 3m*2 + 5m + 3. Calculate -5r(l) - 6v(l). -2l3 - 3l*2 + 2 Let i(v) = -v + 2. Let k(q) = -301q*2 + 5q - 14. What is 6i(j) + k(j)? -301j*2 - j - 2 Let k(o) = 44o - 1. Let t(p) = -334p + 1. Let w(h) = 412h - 1. Let r(f) = 5t(f) + 4w(f). Determine 3k(a) + 5r(a). 22a + 2 Let n(z) = 103z + 3. Let w(b) = 32242b + 940. Calculate -940n(y) + 3w(y). -94y Let k(y) = 11y3 - y2 + 16y - 17. Let u(j) = -33j3 + 3j*2 - 44j + 48. What is 11k(v) + 4u(v)? -11v3 + v2 + 5 Let c be -6 - -7 - (-2 - 0) - -219. Let q = -227 + c. Let i(s) = -s - 4. Suppose 0 = -5x + 48 - 148. Let a(n) = 1. What is qi(g) + xa(g)? 5g Let n(f) = -f2. Let x = 410 - 412. Let l be 1 + 0 + -1(1 + x). Let m(z) = -32z2. What is lm(y) - 56n(y)? -8y*2 Let c(l) = -5l - 4. Let z(o) = 5o + 5. Let s(f) = 10f + 12. Let b be s(2). Suppose 107p = 111p - b. Let n be (-3 + 1)(p - 6). What is nz(h) - 5c(h)? 5h Let o(z) = -4z3. Suppose 22x + x - 138 = 0. Suppose -55 = xj + 41. Let r(s) = -s3. What is jr(b) + 5o(b)? -4b*3 Let n(j) = 27j*2 - 66j - 8. Let v(a) = -5a2 + 13a + 1. Determine 2n(b) + 11v(b). -b*2 + 11b - 5 Let l(u) = 50u2 - 5u. Let m(g) = -11302g + 3g*2 - 54g*2 + 11308g. What is -6l(f) - 5m(f)? -45f2 Suppose 714c - 36 = 732c. Let d(h) = -h + 1. Let p(a) = -8a + 9. Determine cp(z) + 14d(z). 2z - 4 Let t(o) = -o3 + 96o*2 + o + 6. Let l(s) = 96s*2 + s + 5. Calculate -7l(m) + 6t(m). -6m*3 - 96m*2 - m + 1 Let r(x) = 5x - 3. Let w(j) = -j*2 + 1. Suppose 0 = 4t - 5z + 3z - 404, -z = t - 95. Let p = 98 - t. Calculate pr(k) - 2w(k). 2k2 - 5k + 1 Let p(b) be the third derivative of -b4/3 + b3/6 - 6b2. Let w = -17 + 27. Let a(n) = -w - n + 10. What is 4a(r) - p(r)? 4r - 1 Let l(c) = -53c*2 - 27c - 10. Let h(n) = -46n2 - 25n - 8. Give -6h(w) + 5l(w). 11w2 + 15w - 2 Let v(f) = -4f3 - 2f*2 + f - 3. Suppose 2u = -4x - 40, -6 = 56x - 55x. Let s(a) = 3a - 3a2 - 11a*3 - 2a*2 + 0 - 8. What is uv(l) + 3s(l)? -l3 + l2 + l Let u(g) = 6g*2 - 4g + 4. Let o(p) = 3 + 5p2 + 934p - 1172p + 234p. Give -5o(k) + 4u(k). -k*2 + 4k + 1 Let k(l) = -4l2 + 2l - 2. Suppose -z + 26 = 22. Let w(f) = 2f2 - f + 1. Calculate zk(v) + 7w(v). -2v**2 + v - 1 Let l(o) be the first derivat	{ "pile_set_name": "DM Mathematics" }
4j(l). 2l + 8 Let q(a) = 3a - 1. Let f(i) = -36i + 6. What is -f(r) - 4q(r)? 24r - 2 Let l(v) = -22v2 + v - 3. Let y(k) = -k2 - 1. Determine -l(j) + 3y(j). 19j2 - j Let l(i) = i - 1. Let n(a) = -4a*2 + 5a*2 + 47 - 47. Let s(d) = -5d*2 - 3d. Let f(q) = 6n(q) + s(q). Give -f(j) - 2l(j). -j2 + j + 2 Let s(j) = 119 - j2 + 7j2 - 2j*2 - 5j2 - 120. Let z(u) = -u3 - 5u2 + u - 6. Determine -6s(r) + z(r). -r3 + r2 + r Let g(s) = -2s2 - 5s - 7. Suppose -2 = -0y - 2y, -4n - 4y = -216. Let z = 48 - n. Let p(b) = -2b2 - 4b - 6. Calculate zg(a) + 6p(a). -2a2 + a - 1 Let w(p) = 3p. Suppose 4u + 19 = 35. Suppose 15 = a + ua. Let x(d) = -14d. Suppose -6z + 15 = -5z. Determine ax(m) + zw(m). 3m Let h(f) = 2f2 + 0f*2 - 4f*2 + 3f*2 - 7f*2 + 2f. Let c(s) = 2s2 - s. Give 8c(b) + 3h(b). -2b*2 - 2b Let t(s) = -s*2 + 29s + 5s2 - 16s - 20s + 4. Suppose -4j - 5 + 1 = 0. Let a(u) = u*2 - u + 1. Calculate jt(v) + 5a(v). v2 + 2v + 1 Let c(d) = -d + 4. Let v(n) = -122n + 17. What is -4c(l) + v(l)? -118l + 1 Let z(n) = 3n - 2. Let h(y) = -2 - 8y + 21y - 11y. Give 5h(v) - 4z(v). -2v - 2 Let t be 14/3 - 2/(-6). Let i(u) = u - 1. Let d be i(t). Let o(v) = 3v - 6. Let z(y) be the first derivative of y2 - 5y + 611. Calculate dz(x) - 3o(x). -x - 2 Let u(k) = 1 - k + 2k + 2k2 - k2. Let f(y) = -4y2 - 3. Let d be 4/(1/(-3 - 28/(-8))). Determine du(o) + f(o). -2o2 + 2o - 1 Let r(t) = -11t + 5. Let s(y) = -11y + 5. Let p(k) = -2r(k) + 3s(k). Let v(q) = -4q + 2. Calculate -3p(z) + 8v(z). z + 1 Let u be (1/(-2))/(2/88). Let i be 128/u - (-4)/(-22). Let r be (-6)/(-2 - 1) - 1. Let a(w) = -w3 - 1. Let h(v) = -7v*3 - 6. Calculate ia(b) + rh(b). -b3 Let s(y) = 4. Let v(x) = -5. Let c(j) = -4s(j) - 3v(j). Suppose -5a - 27 = -3w + 4, 5a + 21 = -2w. Let m(r) = r3 + 8. Give wm(o) + 18c(o). 2o3 - 2 Let r(o) = -o3 + o + 1. Let s be 2/((28/7)/(-4)). Let x(y) = -7y3 - 2y*2 + 2y + 2. What is sr(z) + x(z)? -5z*3 - 2z*2 Let y(a) = -116a*2 - 4a + 6. Let m(n) = -347n2 - 12n + 17. Calculate 4m(w) - 11y(w). -112w2 - 4w + 2 Let o(x) = 4x2. Let y(d) = 21d*2 + d. Suppose -v + 184 = 5q - 2v, 2q = -3v + 77. Let u = q + -26. Give uo(b) - 2y(b). 2b*2 - 2b Let z(s) = -33s2 + 7s - 5. Let p(l) = -16l2 + 3l - 2. Give 5p(y) - 2z(y). -14y2 + y Let u(q) = -110q - 2. Let b(g) = 5g. What is -6b(p) - u(p)? 80p + 2 Let z(s) = -s2 + 33s. Let u(q) = -q*2 + 1. Give 3u(p) - z(p). -2p2 - 33p + 3 Let f(h) = 3h. Let q be f(1). Let k(r) = 53 - qr - 53. Let s(v) = -v. What is k(b) - s(b)? -2b Let s(z) = -782z*2 - 15. Let n(b) = 781b*2 + 18. Determine -5n(p) - 6s(p). 787p*2 Let k(m) = 6205m. Let x(z) = 53z. Give 5k(h) - 584x(h). 73h Let c(u) = 329u + 74. Let p(y) = 55y + 13. Determine -6c(i) + 34p(i). -104i - 2 Let p(i) = -7i*2 + 11i. Let h(a) = -6a2 + 11a. Let w be (5/3)/(-1 - 16/(-12)). Determine wh(z) - 4p(z). -2z2 + 11z Let b(l) = 2l3 + 23l*2 + 2l. Let p(c) = 4c3 + 23c*2 + 3c - 1. Determine -3b(i) + 2p(i). 2i3 - 23i*2 - 2 Let r(p) = -2p*2 - 2. Let m(f) be the first derivative of -3 + 0f - 1/2f2. Give -3m(y) - r(y). 2y2 + 3y + 2 Let j(h) = 4h3 + 85h*2 - 7h + 7. Let u(s) = 2s3 + 42s*2 - 4s + 4. Calculate -4j(a) + 7u(a). -2a3 - 46a*2 Let v(b) = -13b + 4. Let t(w) = -54w + 16. Let h(d) = 2t(d) - 9v(d). Let z(x) = -19x + 9. Give 13h(f) + 6z(f). 3f + 2 Let b(u) = u - 1. Let p(r) = -1. Suppose 4v = -3q + 1, -5q = -7v + 10v + 13. Determine vp(d) - 6b(d). -6d + 2 Let g(i) = 4i - 78. Let x(d) = 3d - 76. Determine 2g(h) - 3x(h). -h + 72 Let f(b) = -1895b*2 - 758b - 758. Let j(z) = -2z2 - z - 1. Determine f(q) - 758j(q). -379q2 Let i(x) = -14x*3 + 8x*2 - 83x - 9. Let s(l) = -9l3 + 5l*2 - 55l - 6. What is -5i(j) + 8s(j)? -2j3 - 25j - 3 Let p(m) = 18m - 12. Suppose -2v = -5v + 27. Let x(u) = 7u - 8 - 8u + v. What is p(h) + 12x(h)? 6h Let p(l) = 3l*2 - 2l - 4. Let d(t) = -10t2 + 6t + 12. Let c = -1535 + 1528. Determine cp(j) - 2d(j). -j*2 + 2j + 4 Let q(h) = -8h3 + 7h*2 + 101h - 6. Let a(s) = s3 - s2 - s + 1. What is -6a(t) - q(t)? 2t3 - t2 - 95t Let a(r) = 8r*3 + 5r*2 - 5r + 5. Let s(l) = l - 1. Let b be s(4). Let v(o) = -5ob - 1 + 34o - o*2 + 4o*3 - 33o. What is a(u) + 5v(u)? 3u*3 Let s(v) = 12v - 45. Let h(z) = 6z - 23. What is 7h(f) - 4s(f)? -6f + 19 Let z(a) = 7a - 36. Let t(s) = 6s - 36. Determine 4t(m) - 3z(m). 3m - 36 Let r(n) = 3n*3 - 4n*2 + 444n - 1. Let v(o) = -o3 + o2 - 148o. Determine 2r(z) + 7v(z). -z3 - z2 - 148z - 2 Let g(v) = 133v3 + 49v*2 + 49v - 49. Let s(d) = -16d + 15. Let x be s(4). Let y(w) = -11w*3 - 4w*2 - 4w + 4. Give xy(a) - 4g(a). 7a3 Let z(o) = 5o*2 + 6o. Let a(k) = -5k2 - 5k + 1. What is 4a(n) + 3z(n)? -5n2 - 2n + 4 Let l(p) = -3p2 - 5p + 5. Let t(s) = s*2 + 2s - 2. Suppose -21f + 17f = -20. What is ft(g) + 2l(g)? -g*2 Let z(g) = -9g + 1. Let r(n) = -3n2 + 12n - 4. Let l(u) = r(u) + 2z(u). Let f(w) = -3w*2 - 5w - 2. What is -6f(j) + 5l(j)? 3j2 + 2 Let h(c) = -c3 - c2 - 1. Let n(v) = 6v*3 + 4v*2 + 2v + 4. Let t = 49 + -45. Determine th(k) + n(k). 2k*3 + 2k Let l(a) = -63a3 - 40a*2 + 17a + 6. Let c(g) = 21g3 + 14g*2 - 6g - 2. Determine -17c(b) - 6l(b). 21b3 + 2b*2 - 2 Let t(z) = -39 + 19 + 6z + 118. Let v be t(-20). Let i(f) = 0 + 0 - f*3. Let c(g) = -10g*3. What is vi(y) + 2c(y)? 2y*3 Let j(i) = -3i + 13. Let d(o) = -5o + 23. Let l(s) = 4d(s) - 7j(s). Let x(f) = -6f - 2. Calculate 6l(w) + 3x(w). -12w Let y(w) = 379w + 1. Let i(c) = 2c. Give 30i(p) + 2y(p). 818p + 2 Let h = -69 + 71. Suppose 0 = -2k + a - 9 - 1, -h = a. Let t(u) = 7u - 1. Let n(b) = b. Determine kn(y) + t(y). y - 1 Let m = -1280 + 1283. Let g(h) be the first derivative of 1/3h*m - 2h*2 - 7h - 6. Let n(r) = 2r + 3. What is -2g(v) - 5n(v)? -2v*2 - 2v - 1 Let l(j) = 239j - 4. Let y(h) = -239h + 5. Give -5l(t) - 4y(t). -239t Let q(n) = -45n*3 + 55n. Let o(m) = -5m3 + 6m. Determine -55o(b) + 6q(b). 5b3 Let r(c) = -1672c*3 + 77c - 77. Let t(s) = -44s3 + 2s - 2. Determine 6r(v) - 231t(v). 132v3 Let z(j) = -383j - 2. Let n(x) = -x - 1. Calculate 3n(f) - z(f). 380f - 1 Let h(b) = 7 - 11b3 + 8b*3 - 432b - 7b2 + 425b. Let r(q) = 3q3 + 6q*2 + 6q - 6. Determine 6h(j) + 7r(j). 3j3 Let i(y) = -353y*2 + 12y - 1. Let q(l) = -707l2 + 27l - 2. Give 9i(v) - 4q(v). -349v2 - 1 Let w(d) = 3d*2 - 2d + 2. Let k(v) = 21v2 - 15v + 15. Suppose 9l = 8l - 5z - 17, 4z = -3l - 18. Calculate lk(f) + 15w(f). 3f*2 Let k be (1/(-2))/(5/(-10)). Let i(r) = -4r*3 + 7r*2 - 3r. Let l(z) = z3 - z2 + z. Determine ki(g) + 5l(g). g*3 + 2g*2 + 2g Let l(i) = -148188i2 - 583i. Let v(c) = -1015c2 - 4c. What is -4l(t) + 583v(t)? 1007t2 Let o(n) = 6n*3 + 3n*2 - 3n + 6. Let s(b) = 13b3 + 7b*2 - 7b + 13. Suppose -4p + 16 = 2y - 0y, 0 = -5p + 3y + 9. Give ps(r) - 7o(r). -3r*3 - 3 Let l(k) = 26k - 262. Let m(o) = -15o + 130. Determine -4l(w) - 7m(w). w + 138 Let u(y) be the second derivative of -3y*4/4 - 7y*3/6 + 2y*2 + 9y. Let b(z) = 14z2 + 11z - 6. Let o be -15((-4)/42)/6. What is ob(h) + 8u(h)? -2h2 - h + 2 Suppose -9185 = 6g - 9155. Let k(u) = -5 + 6u + 2u + 2u2 - 8u. Let j(t) = 2t2 - 6. Let i be (-1 + -7)6/(-8). Give gj(c) + ik(c). 2c2 Let r(d) = d3 + d2. Let b(y) be the first derivative of y4 + 4y*3/3 - 2y - 249. Calculate b(x) - 5r(x). -x3 - x2 - 2 Let q(l) = -9l + 162. Let r(j) = 14j - 244. Determine -8q(d) - 5r(d). 2d - 76 Let w(q) = -4q - 1. Let s(y) be the second derivative of 5/6y*3 + 0 - 5y + 1/2y2. Let i = 2 - -1. Determine iw(c) + 2s(c). -2c - 1 Let g(n) = 22n2 - 5n*2 + n - 18n*2. Let f(v) = -3v*3 - 8v*2 + 8v. Determine 3f(l) - 24g(l). -9l3 Let h(y) = 5y + 1 + 3y + 1 - 10y + 4y. Suppose 7w - 4*w - 9 = 0. Let r(z) be the fi	{ "pile_set_name": "DM Mathematics" }
6)(zzz(2/7)z)/(zz8z)) assuming z is positive. z(-9959/105) Simplify (x(2/31)xx3/x)(-21)/((x/x*8xxx*(-3/7)x)/(x(x/(x(x*2x)/x))/x)(-4/29)) assuming x is positive. x(-375380/6293) Simplify ((b/b(-1))(-3/13)/(bb(-2/3)bbb)34)8 assuming b is positive. b*(-35504/39) Simplify (ss/s*6s/(s*(6/5)/s)s)*3/((ss*(-1/5))/(ss*(-2/5)s))(-18) assuming s is positive. s(-21) Simplify (f4/f(-4))/(f*(-2/11)f*2)f/f*(-1/9)ff/f(1/4)(f/(f*(-1/2)/ff))/(f/(((f*(-1)ff)/f)/f)) assuming f is positive. f(3383/396) Simplify ((l3/ll(l/(l/(l/l(3/7)))l)/l)/((l/(l5/l))/l(-3/4)))/((l*(-2/27)l(ll*(-4/9))/ll)/(l(1/3))23) assuming l is positive. l*(9077/756) Simplify (yy*(-13)((y*(-13)/yy)/y)/yy(-9/5)y(3/5))46 assuming y is positive. y(-6486/5) Simplify (k(-2/7)k)(27/5)/(k/k(-4/7))21 assuming k is positive. k(-204/7) Simplify (((c(-13/4)/cc)/cc(-2/5)/c)/(c(1/9)((c*19c)/c)/cc))5 assuming c is positive. c(-4457/36) Simplify ((qq*(-1)q*4)/(qqq(1/7)qq/(qq*(-7)/qq)))(2/31) assuming q is positive. q(-86/217) Simplify ((((ll(-5)l)12)(30/13))(-3/20))(12/5) assuming l is positive. l(1944/65) Simplify (((s(-5)s/(s/(s/(s(-1)s))))17)(1/8))26 assuming s is positive. s(-221) Simplify ((c*(-14/9)cc)/(c/(c(-14)c))ccc8cc(-9))(17/3) assuming c is positive. c(-1768/27) Simplify (i(-2)i/(i/(i/(((ii(2/3))/i)/i))))46/((i(-1/4))45)48 assuming i is positive. i(1528/3) Simplify (((k/k(3/5)k*(3/4))/((kkk(1/2)k)/(kk1kkkk)))(8/9))(-14) assuming k is positive. k(-2044/45) Simplify ((mmm(-34))/(m/((m/(mm((m/m(3/38))/mm)/m))/m))m(5/4)/((mmm(-13/5))/m))(-7) assuming m is positive. m(85309/380) Simplify (d/(d/d(-2/9))dddd(1/4)d)/((d*(2/3)d)/dd1)(d/d(-2/9))/d(-1/5)d(-4/7)/d(-1) assuming d is positive. d(1769/420) Simplify (g/(g/((g/(gg*5))/g))g*(1/6))/(g(g/g(2/3))/g)35((ggg(-2/5)/g)/g)/(ggg(1/3)gg)g*(1/3)g/g(-4) assuming g is positive. g(-169/10) Simplify ((c/c12)/c(4/9)(c(-3/8)/c)(-49))(-29) assuming c is positive. c(-116783/72) Simplify ((((o(-14)o)/ooo)/o(3/2))(-45))41 assuming o is positive. o(49815/2) Simplify (((xx/(x(-1)/x))/x)(-1))(-34)/(xx*(-2)xx(-1)(xx(5/3))/((x(2/19)x)/x)) assuming x is positive. x(5725/57) Simplify ((c/c(1/4))(-16))30/((c/(c(cc/(cc(-1)))/c))(-13))(-26) assuming c is positive. c(-22) Simplify ((t4t(2/11)/t)/(t0/t)32)/((t/t(-1))*(-12)/((t/(tt/(((tt(-1)t)/t)/tttt)t))/t)5) assuming t is positive. t(596/11) Simplify ((z(2/3))40)(-15)/((z(2/3))*(10/13)z/(z*(2/3)z)zz*2z) assuming z is positive. z(-5250/13) Simplify ((s(-1/9)/ss/(ss*(1/6))((s/(sss/((s*2s)/s)))/s)45)(-38))(-20/9) assuming s is positive. s(-316540/81) Simplify ((((ll/l(2/9))/(l(-3)/l))(-34))0)(2/33) assuming l is positive. 1 Simplify ((c(-1))(-3/7))15(((cc(-6))/c)/(ccc(1/4)))/(c(-3/2)/c(6/5)) assuming c is positive. c(123/140) Simplify ((ww(7/4))(4/29)/(w/(w*26/w)w*(-1/14)w))(26/3) assuming w is positive. w(123773/609) Simplify (((q(q4/q)/qq)/(q(-14/11)/q))19)44 assuming q is positive. q5244 Simplify ((x(-1))(-3/10)/(x/x(-2/7))(-15))/((x*(-1/4)x)(-2)/(x(-4)/x(2/9))) assuming x is positive. x(5312/315) Simplify ((d(-1)/d)(2/3))*(-18)(d*(-2/7)d6)(5/14) assuming d is positive. d(1276/49) Simplify ((b/((b/b(1/12)b)/b)b)/b*(-3/2)b*(4/3)/b(bb(2/7))/b)48 assuming b is positive. b(1076/7) Simplify ((f4/f(4/5)f*(-3/16)/(ff8))(-38))(3/7) assuming f is positive. f(27303/280) Simplify ((p*(-14)/p)/(pp6))(-3/13)/(((pp3)/p(2/3))/(p/(ppp2p))(-7/2)) assuming p is positive. p(614/39) Simplify (xx(-1))42(xx(2/9)/x)/xx(x/(x/(x(xx(2/11))/x))x)/x(x/(x(x/(x*(-2/3)x))/x))*22x/(xx/x6x)x1 assuming x is positive. x(1360/99) Simplify ((b(-3/5))15/(b9/b(7/5)))(-2/5) assuming b is positive. b(166/25) Simplify (k(-1)k1)/(((k/(k(-1/2)/k))/k)/k*(-1/5))((k/(k/k*(-8)))/kk(-3))24 assuming k is positive. k(-2897/10) Simplify ((c/c(-1/2))(5/4))(-37)/(cc(-1/2)/ccc0(c/(c/(c/((c/(c(c((c/c*4c)/c)/c)/ccc))/c)c)))/c(-4)) assuming c is positive. c(-599/8) Simplify ((c/c(1/4)c)(-48))(2/85)cc/(c*(-2/3)/c)cc(-1/11)c/c*(1/2)ccc(-2/3) assuming c is positive. c(8289/1870) Simplify (z/(z/(((z/(z/(zz(-1/12))z))/z)/z)))*(2/35)(zzzz/((z(2/13)/z)/zz)z)(-1/9) assuming z is positive. z(-1259/1638) Simplify (v(-2/5))(-37)/(v(-1))(-11)v*(1/6)/vv*0v*(-2/13)/(vv(-2/3)) assuming v is positive. v(967/390) Simplify ((i*(-28)/i(i/(i/i*34i))/i)/((i/((ii(-7/4))/i))/i8))18 assuming i is positive. i(297/2) Simplify ((s(-5)(s/(s*5ss))/s)/(s/s(-6)sss*7))/((ss*(2/7)s)/s*(-3/4)((s0/s)/s)7) assuming s is positive. s*(-477/28) Simplify ((yy*(-2/3)yy)18/(y/(y(-2/29)/y)(y*(-3)y)/y))41 assuming y is positive. y(51045/29) Simplify (o*1o*6/oo)*26(o*1(o/(o4/o))/o)(2/35) assuming o is positive. o(6366/35) Simplify (x(-4)x17x(x(-3/5))(-47))(-2/139) assuming x is positive. x(-422/695) Simplify g(-2/65)ggg*(-2/5)g(gg*(-2/13)gg)/(g/g1) assuming g is positive. g(352/65) Simplify (((mm9)/m)/(m(13/2)m)m(-2/5)/m(3/2))(1/11) assuming m is positive. m(-2/55) Simplify ((oo/(o/(ooooo(2/21))o)o/(oo/o*18))/(oo(-4))(-10))40 assuming o is positive. o(-7480/21) Simplify (((y*(-2/7)/y)/yyy)(-15/7)y*(1/3)/yy*(-5/6)yy)/(y1/y(-6)((y/y(-1/4))/y)7) assuming y is positive. y(-1497/196) Simplify (l7l(-3)(l*(-2/9)/l)/l(l/(l/l*2)l)/l)/((l*(4/3)/(lll(-1)))/(l7ll(-2))) assuming l is positive. l(85/9) Simplify ((i(-7)/iii)48(i*(1/2)ii)(-15))(2/11) assuming i is positive. i(-651/11) Simplify ((w/(www(-1)/w))/w)2w*(-3)w/w*(1/5)w/(w/w*(2/13)w)w(-2)w*4w(-8) assuming w is positive. w(-588/65) Simplify (yy1/yy)(6/5)/(y/y(-2/3))*(-2/121)y*0/(y/((yy/y*(1/3))/y))y(-4)/y(-2) assuming y is positive. y*(57/605) Simplify (((((u/(uuu(3/7)u)u)/u)/uuuu1/u)/(u(1/3)u(-7)))50)(-14) assuming u is positive. u(-11000/3) Simplify ((r/r(1/3))(4/3))(4/5)/(r/(r(-2/15)r)r(-2/5)/rr/(((rr2rr)/r)/rr)rr(-2)) assuming r is positive. r(269/45) Simplify f(2/3)/f1(f/f(1/4))(-4/15)(f*2f)*21/((ff/(f/(((f(ff*(1/8))/f)/f)/f)))/(ff(2/3))) assuming f is positive. f(7681/120) Simplify (h(-36))(-1/12)(h/(h9h))(-15/4) assuming h is positive. h(147/4) Simplify ((((l/(l/(l*(-2/7)l)))/ll)/l5((ll/(ll*(6/5)))/l)/(l/(lll/(((l2/l)/l)/l))))21)43 assuming l is positive. l(-11223/5) Simplify (((ww*(-1/4)/ww)(3/8))(11/2))(34/7) assuming w is positive. w(1683/224) Simplify (u*(-5/9)u(-30))/((u/(u0u))/(u/u(-12/7))) assuming u is positive. u(-1754/63) Simplify (b(-1)/((b/(b/(b(-3)/b))b)/b))*(-7)(b/b*(-1)b3/b)/(b(-2/13)/(bb/(b/(bb(bbb/((b/b(2/9))/b))/bb)))) assuming b is positive. b*(-1243/117) Simplify u(u*(-4/7)/u)/uu*(3/2)u*2u*(-1)(u/u*(-1))/(u((uu/u(1/3))/u)/u)(u(2/3))(-2/27) assuming u is positive. u(2509/1134) Simplify (h(-5)/(h3/h))/(h6/h*(-2/5))h6/(h(-3)/hh)h/h*(1/4)h(2/13) assuming h is positive. h(-909/260) Simplify ((s1)(-8))(6/7)/((s(-4)/(s/(((s/(s*(1/12)/s))/s)/s)s))/(s*(-2/11)s(-1/2))) assuming s is positive. s(-1345/924) Simplify ((i(-1)/((i(3/4)i)/i))/(i1i)*(-14))/(((i(i(ii/i*4i)/i)/i)/ii(-2/13))/(iii1)(1/52)) assuming i is positive. i(370/13) Simplify (k/(k/(k2/k))(kkk*(2/3)kk)/k(k3/k)/k2)/((k*(-1/3)k(-2))/(k1/(((k*(-3)k)/kk)/k))) assuming k is positive. k11 Simplify (z(1/5)z(-3))(-22)/(z*(-2/3)z/(z*0z)z(-4)/(z1/z)) assuming z is positive. z(994/15) Simplify ((c/(c/(c*	{ "pile_set_name": "DM Mathematics" }
-1 + 20/a). Solve 19 = 4u + b for u. 3 Suppose 0 = -4x + 3w + 52, 37 = 3x - w + 3. Suppose 0 = 2i + 6 - x. Suppose -2v + 3m + 3 = 0, -7v = -iv - 3m - 12. Solve 2 = -va + 5a for a. 1 Let q(u) be the second derivative of -u*5/5 - 5u4/12 - u3/2 + 2u2 - 15u. Let z be q(-2). Let r = z - 18. Solve 2 = -rp + 5p for p. 2 Suppose 2n = -4m + 16, -m = 3n - 0m - 44. Suppose 5o - 104 = -21a, -8o + 10o - 12 = -a. Solve oc + 8 = n for c. 2 Suppose 0 = -5k + 44 + 1. Suppose 5u = -y + 4, 4y - 7 = 3u + k. Let l = 10 + u. Solve -3r - l = -r for r. -5 Let t = 366 - 354. Suppose -t = 3x - 4x. Solve -7c + x = -10c for c. -4 Suppose 124t = -29t + 21t + 25212. Solve 14b = -107 + t for b. 6 Let k(o) = 2o2 + 9o + 31. Let h be k(-7). Let d = 70 - h. Suppose 4q + du = 2u + 10, -5q + 3u = -29. Solve m = -3 + q for m. 1 Let i(h) = h3 - 2h*2 - 15h + 39. Let j be i(4). Solve 0 = -15l - j - 4 for l. -1 Suppose -2 = -5y - 4f, 42f = -2y + 46f + 12. Suppose 6i - 40 = i. Solve -10k - y = -ik for k. -1 Suppose -9 = -r + 1. Let t = -11 + 13. Suppose -r + 6 = -tu. Solve -uy = 2y + 20 for y. -5 Let o be (-1)/3(-10 - (-4 + 6)). Let k(v) = 2v - 8. Let g be k(o). Let r be 18/(4 + -1) - 3. Solve rt - 3 + 6 = g for t. -1 Suppose 2o = -2o, -3j + 5o + 15 = 0. Suppose -t - 4w - 5 = 0, -w = jt - 0 - 13. Solve x - tx + 10 = 0 for x. 5 Suppose -32d + 2 = -30d. Let b be 124/(3 + d) - 2. Let o = -25 + b. Solve 1 = -oz + 9 for z. 2 Let z be (-342)/81 + (-4)/(-18) - -10. Let p be z/54 + 132/27. Solve m = -4m - p for m. -1 Suppose 5t - 39 = -3u - 17, u = 4t - 4. Suppose -5s + 5c = -22 - 18, -37 = -5s + tc. Solve s + 2 = 9l for l. 1 Let y be (0 - (-6)/(-4)) + (-3)/(-2). Solve y = 110m - 108m + 2 for m. -1 Let s = -64 - -135. Suppose -4t + 124 = 4o, 5o - 80 = -t + s. Let g be (o/(-4))/(6/(-12)). Solve l + 2l = g for l. 5 Let q(p) = p*3 - 32p*2 - 7p + 224. Let b be q(32). Solve 0w - 4w - 28 = b for w. -7 Suppose 2a + 12 = 3a. Let g be 8 + -1 + a - 8. Solve -3 = 7c + g for c. -2 Suppose 2t - 8 = -0u - 3u, 5t - 13 = -4u. Let d be (74/(-72) + 4/(-18))(82 + -86). Solve -d + u = -o for o. 3 Suppose -2j + 9 = 3 - 2. Solve 6u + j = 10u for u. 1 Suppose -d = 4a - 2a - 10, 2a + 2d - 14 = 0. Let p(o) = -9o + 23. Let s be p(a). Let f be 0 + s + (-13)/(-1). Solve 0u + f = 3u for u. 3 Suppose 6j - 4k = 9j - 32, 5k = 3j - 14. Suppose jx + 5x = 0. Solve xy = 3y + 9 for y. -3 Let u be 61 - 0 - (-16 - -14). Let o = -69 + u. Let j be ((-2)/6)/(o/90). Solve -2 + 17 = -jz for z. -3 Let q = -343 - -343. Suppose -5 = 3t + 1. Let r be (q/(t/(-2)))/2. Solve 5j - 4j - 2 = r for j. 2 Suppose -5 = -6x + 13. Suppose -v + s + 2 = 0, 4v - 10 = -0v + 2s. Solve -3b = v + x for b. -2 Let r(t) = 6t + 146. Let a = -57 + 36. Let y be r(a). Solve 8b - yb - 12 = 0 for b. -1 Suppose 0 = -q + 2c + 827, -5c + 3269 = 5q - q. Let p = 825 - q. Solve -5d + pd + 2 = 0 for d. 2 Suppose -5t - 6 = -2m, -t = 41m - 43m + 6. Suppose -10y - 23y = t. Solve y = -7f + 10f for f. 0 Let u = 5923 - 5923. Solve u = 5x + 4x - 4x for x. 0 Let w(k) = -k*3 - 45k*2 - 164k + 10. Let z be w(-41). Solve 76 = -zn + 29n for n. 4 Suppose -4g + 5 + 7 = 0, 141 = 5d + 2g. Suppose 0 = -ds + 79 + 83. Solve -sq = 8 + 10 for q. -3 Let o(k) = 6k - 59. Let b be o(11). Suppose 108 + 88 = bp. Solve 14z = 7z + p for z. 4 Suppose 12 = -4p, -5 = 3l - 5p - 32. Suppose -lb = 5r - 46, -3b - 10r = -15r - 52. Solve 17 = -3q + b for q. -1 Suppose 8 = -p, 42u - 47u + 25 + 17 = -4p. Let o be 24/15170/4. Solve -ul = -78 + o for l. 5 Suppose -r + 9x + 361 = 5x, -5x = 2r - 735. Let c = -363 + r. Solve 19 = -ck + 9 for k. -5 Suppose -2g = 12 - 24. Let f be 25/45g36/10. Let s be ((-10)/(-6))/(4/f). Solve 14 + 6 = sh for h. 4 Let q = -3488 + 3554. Solve -2i = 20i - q for i. 3 Suppose 4l - 36 = -4. Let n be ((-48)/(-36))/((-2)/(-3)). Suppose 2m - l = 4i, 2m - ni - 28 = -2m. Solve 8a = 4a + m for a. 2 Suppose -6r + 2r - 5q + 22 = 0, 0 = -q - 2. Suppose 9k + r = 10k. Solve x - kx = 14 for x. -2 Let b be ((-50)/(-15))/(2/(-9)). Let z be (-6)/b - (-146)/10. Suppose 0 = -5o - y + 36, -4o + 4y + 9 + z = 0. Solve -on + 2n = -20 for n. 4 Let o(r) = -r2 + 10r - 3. Let k be o(1). Solve 48b = 42b + k for b. 1 Let g be 0/(-410/40). Solve g = -30r + 26 - 176 for r. -5 Let h(b) = -31b3 + 13b - 30b3 + 60b*3 + 12b*2 + 2. Let d be h(13). Solve -w = -dw for w. 0 Suppose 6l - 2l + 36 = 0. Let x = 9 + l. Suppose -2i + 9i - 14 = x. Solve 0u = u - i for u. 2 Let s(b) = b2 - 51b + 12. Let a be s(-7). Let z = a - 418. Solve 4u - 1 - 7 = z for u. 2 Let w be (-17)/((-289)/1666) + 7/((-14)/16). Solve -84c + 18 = -wc for c. -3 Suppose 0 = -2d - 74 + 90. Let k = 11 - d. Let i(v) = v*3 - 2v*2 + v - 4. Let o be i(k). Solve -1 = -3m + o for m. 3 Suppose 3f + 4 = -q, -3f = 5q - 13 - 3. Suppose -42 = r - q. Let b = -37 - r. Solve b = -m + 2 - 3 for m. -1 Let l be 99((-20)/(-15))/2. Suppose m = 7m - l. Solve -3u + m = -1 for u. 4 Let x = 2796 - 2766. Solve 47d = 62d + x for d. -2 Let g(t) = 3. Let b(l) = -18l + 108. Let i(a) = b(a) + 6g(a). Let k be i(7). Solve 0 = 3c - 15 - k for c. 5 Let p be (-21)/35 + (-746)/(-10) + -11 + 14. Solve 7s + p = -4s for s. -7 Let u(v) = 2v*3 - 12v*2 + 3v + 9. Let d be u(5). Suppose -g - 13 = -3. Let z = g - d. Solve 6l - z = 2l for l. 4 Suppose 20 = 5b + s, 4b - s - 25 = -9. Suppose -l - 9 = -f + 3f, -5l - 17 = -4f. Let r be ((-3)/f)/((-33)/220)-2. Solve bc + r = -c for c. -4 Suppose -4s + 32 + 92 = 0. Let l = -25 + s. Suppose -lb = -2b. Solve b = -0z + 2z for z. 0 Let k = -3063 + 3249. Solve -190b + 8 = -kb for b. 2 Let j(m) = m*2 - 56m - 165. Let o be j(-3). Solve 22 = -ol + 34 for l. 1 Let t be (0 - -216) + 0/(-15). Suppose -t = m - 236. Solve -m = q - 6q for q. 4 Let s(g) = -g*2 - 44g - 435. Let q be s(-29). Solve -b + 2 = -qb for b. 2 Suppose -506 - 313 = -9t. Let w be 26/t + (-40)/(-7). Solve -2b + w = 2 for b. 2 Suppose 0 = 2t + 53 - 69. Solve -tj + 10j + 10 = 0 for j. -5 Suppose -5f + 2 = c, -36f + 4c + 11 = -37f. Suppose -3r = -a - 2 - 4, -3a + 3r = -12. Solve -2d = -f + a for d. -4 Suppose -x = -5b + b + 16, 4x - 4 = -b. Solve ba - 40 = -4a for a. 5 Let h = 10203 - 10153. Solve 0 = -ht - 15t - 455 for t. -7 Let i = 2 + 0. Let z(f) = -f*2 + 15f - 78. Let u be z(26). Let a = 367 + u. Solve -a = -im + 3 for m. 3 Let k(o) be the second derivative of -o4/12 + 7o*3/3 - 17o*2 - 64o. Let i be k(5). Solve -2h = -ih + 9 for h. 1 Let t be 0/2-104/(-40). Solve t = -39m + 11m + 112 for m. 4 Let t = 864 - 864. Solve t = 7v + 5 + 30 for v. -5 Let u(k) = 5k + 77. Let b be 1100/(-77) + (-4)/(-14). Let x be u(b). Let m(l) = 3l - 11. Let p be m(5). Solve ph = xh for h. 0 Let g be (-56)/2454/(-63). Solve -6d = gd + d for d. 0 Let l(i) = i - 2. Suppose m - 28 = -0m. Let g = m - 19. Let d be l(g). Solve -4s - 3 + d = 0 for s. 1 Suppose -2231j + 2244j - 208 = 0. Solve -18t = 20 + j for t. -2 Suppose -84r - 440 = -94r. Let z be (6/4)/(28/24 - 1). Solve zx - r = 1 for x. 5 Let x = -56 - -80. Suppose o - 14 = -4u, -8u + 5o + 30 = -3u. Solve -4 = -uh - x for h. -5 Let k = -11 + 8. Let i be ((-6)/93)/(k/6). Suppose -3j = -iz + 70, -z - j + 18 - 4 = 0. Solve 12 = -w + z for w. 4 Let n be 3242/16 - 48/(-128). Let h = n - 197. Solve 0 = hx - 8x for x. 0 Let v(u) = 7u3 - u2 - 2u + 3. Let n be v(2). Suppose 14 = 5i - n. Suppose -32l = -45l + 65. Solve -lw = -7 - i for w. 4 Suppose 0 = -2w + 4w - 6, p - 5w = 5. Let s = 26 - p. Solve -s = 4z + 10 for z. -4 Suppose -3z = i - 43 - 67, 2z - 12 = 0. Solve 0 = ip + 16p - 324 for p. 3 Let m be 28/(-6)(-3)/2. Suppose -34z + z = -1221. Suppose z = 25s - 38. Solve -m = 5o + s for o. -2 Suppose -5u = 3h - 12, -2h - 4u + 8 = -u. Suppose -ho + 95 - 83 = 0. Solve 7n - o = -24 for n. -3 Let j = -979 + 981. Suppose 2g - f - 11 = 0, -6g + 3g + 5f + 34 = 0. Solve -g = jw - w for w. -3 Let i be ((-95)/(-285))/(2/9 - 7/36). Solve 0 = ir + 22r - 34 for r. 1 Suppose 2c = -2*c - 8. Let f = 33 - c. Let m = f	{ "pile_set_name": "DM Mathematics" }
)? 2 Let g(j) = j*3 + 21j*2 + 8j + 2. Let c be g(-21). Let r = -55 - c. What is the tens digit of r? 1 Let l = 1986 - 1347. What is the hundreds digit of l? 6 Suppose -10q - q = -2783. What is the tens digit of q? 5 What is the hundreds digit of 521/((-1)/(-25))? 2 Suppose q = -7 - 5. Let b be (-80)/q(-108)/10. Let d = 105 + b. What is the units digit of d? 3 Let n(t) = t*3 + 4t*2 + 13t + 5. Let f be n(-5). Let w = 152 + f. What is the units digit of w? 7 Suppose -2t - t + 6 = 2r, -4t = r - 3. Let s be 0 + (-29)/(-1) + -1. Let n = s - t. What is the units digit of n? 8 Let y be 2((-27)/6 - -4). Let v be (y + -2 - -2)-5. Suppose -5 = -0t - 2t + vu, -45 = -4t + 3u. What is the units digit of t? 5 Let w(a) = 7a3 - 5a*2 + 6a - 60. What is the units digit of w(5)? 0 Suppose -3o - 2z + 23 = 0, z - 5 - 1 = -o. Let l(w) = -w*2 + 4w - 6w + 2 - ow. What is the units digit of l(-13)? 2 Suppose n + 30 = 6n. Suppose 120 = 9k - nk. What is the tens digit of k? 4 Suppose -5c + 6m + 1093 = 2m, m = -4c + 887. Let f = 374 - c. What is the tens digit of f? 5 Let i = 767 - 630. What is the units digit of i? 7 Let b be (-10)/(-2) - (11 - 9). Suppose -4o - q - 215 = -7o, bo - 5q - 223 = 0. What is the units digit of o? 1 What is the hundreds digit of ((-237)/12-2)/(13/182)? 5 What is the tens digit of (0 + -113)/(1 + -2)? 1 Suppose 50 = -6o + 8. What is the tens digit of (-558)/o - (-34)/119? 8 Suppose -8p + 6948 = p. What is the units digit of p? 2 Let w be (-6)/15 - 240/25. What is the tens digit of -3 + (1 - w) + 2? 1 Let l = -114 - -291. Suppose -l - 168 = -3h. What is the tens digit of h? 1 Let d(n) be the third derivative of -n5/30 - 29n*4/12 - 4n*3 + 25n*2 + 2. What is the tens digit of d(-28)? 3 Suppose 2t + 5 = 3s, -8t - 2s - 60 = -3t. Let l be (t/6)/(1/57). Let p = -23 - l. What is the tens digit of p? 7 Suppose -6b + 25 = -11b, -5b - 25 = -5v. Suppose v = -2q - 4n + 72, 10q = 8q + 2n + 48. What is the tens digit of q? 2 Let i be (2/(-4))/((-1)/10). Suppose 146 = 5y - ix + 3x, -9 = 3x. Suppose 2v = -0v + y. What is the units digit of v? 4 Let a be -4 + 2 - 1-3. Let u be a - -3 - (2 - 0). Let z(h) = 3h - 1. What is the units digit of z(u)? 5 Suppose -10j = -15j - 45. Let b(f) = -5f + 9f2 - f + 5f + f*3 - 3. What is the units digit of b(j)? 6 Suppose 44 + 8 = 4r - 2v, 8 = 2v. Suppose -5u - j + r = j, 2u - 22 = -4j. What is the units digit of u? 1 Let x(v) = -v2 - 5v + 13. Let j be x(-8). What is the tens digit of (94 - 0) + (-44)/j? 9 Let u = 397 - 209. What is the tens digit of u? 8 Suppose 5q + 2a = 33, a = -5q + 4a + 13. Suppose -3t = 0, -qm = -2t - 76 + 31. What is the units digit of m? 9 Suppose -l - 200 = -2f + 544, 375 = f - 2l. What is the tens digit of f? 7 Let y = 39 - 2. Let i be (-54)/7 - (-4)/(-14). Let d = i + y. What is the tens digit of d? 2 Suppose 0u = 50u - 75350. What is the thousands digit of u? 1 Let x(v) = v2 - 6v - 12. Let h be x(10). Let t = h + -24. Suppose -td + 84 + 172 = 0. What is the tens digit of d? 6 Suppose -107 = q - 5x, q + 87 = -2x - 27. What is the units digit of 9/(-18)(q - -2)? 5 Suppose 2y = 5h - 3y - 415, 0 = 4h + 5y - 296. Suppose 7u - 310 = -h. What is the units digit of u? 3 Let u(l) be the third derivative of 47l6/120 - l5/30 + l4/24 + l2. What is the tens digit of u(1)? 4 Let y(x) = x + 5. Let i be y(-2). Suppose 2l = il - 36. What is the units digit of l? 6 Let t(f) = -3f - 67. Let w(s) = s. Let u(x) = -t(x) - 2w(x). What is the units digit of u(0)? 7 Suppose -13r - 3r = -6736. What is the hundreds digit of r? 4 Let b = -8 + 34. Suppose -m + 3q - 6q - 13 = 0, 4q + b = 3m. What is the units digit of m? 2 Let h(z) = 16z + 18. Let u be h(18). Suppose 0 = -15a + u + 219. What is the units digit of a? 5 Let d(b) = -3b - 32. Let i be d(-12). Suppose 66 = -iv + 6v. What is the units digit of v? 3 Let l(d) = 8d - 4. Let v = 6 - 7. Let z = v - -4. What is the units digit of l(z)? 0 Let s(i) = 5i*2 - 4i + 9. Let t(d) = -d*2 - d + 1. Let l(a) = -s(a) - 6t(a). What is the units digit of l(-16)? 1 Let j(h) = h - 1. Let o(q) = -22q + 22. Let u(s) = -5j(s) - o(s). Let g be u(9). Suppose 3x - a - 108 = 0, 4a + g = 3x + x. What is the tens digit of x? 3 What is the hundreds digit of (312/(-16)2)/(9/(-381))? 6 Let y(v) = 52v - 2. Suppose 3a - 12 + 6 = 0. What is the units digit of y(a)? 2 What is the units digit of (74412/416 + 1/8)2? 8 Let a be 10/(-6) - 2/(-3). What is the hundreds digit of (6/(-12))/(a/204)? 1 Let z = 705 - 327. Suppose -6i + z = -0i. What is the units digit of i? 3 Let s = 43 - 92. Let z = 289 + s. What is the tens digit of z? 4 Let b = -57 - -97. Let j(z) = -2z*3 + 2z*2 - z - 1. Let g be j(-3). Let q = g - b. What is the units digit of q? 4 Suppose -4j + 9 + 3 = 0. Suppose 8s + 2t = 3s + 218, 41 = s + jt. What is the units digit of s? 4 Suppose -108z - 67872 = -136z. What is the hundreds digit of z? 4 Let g(l) = 68l - 7. Let v be g(-2). Let o = v + 209. What is the tens digit of o? 6 Let y(w) = w2 - 14w - 47. Let v be y(-8). Suppose -v = -5q + o, -q + 0 = 4o - 9. What is the tens digit of q? 2 Let v be 6/33 + 62/22. Let y be v/2 - (-3)/6. Suppose -5q - 117 = -4k, yk = -2k - 4q + 72. What is the units digit of k? 3 Suppose 2n - 57 = -n. Suppose 0 = -2c + 3h - 6h + n, -4h + 12 = c. What is the tens digit of (-188)/(-16) + 2/c? 1 Suppose 4c = 5c - 14. Let j = 12 - c. Let a(b) = -9b - 3. What is the units digit of a(j)? 5 Suppose 5a = -3t - 15, -a - 4t = -5 + 25. Suppose 2f = -4m + m + 38, -3f + m + 57 = a. What is the tens digit of f? 1 What is the tens digit of (44/(-33))/(9231/3078 + -3)? 6 Suppose -x = 3m - 462, -3x + 1347 = -6m + 2m. What is the hundreds digit of x? 4 Suppose 0 = 2t - 5t + 9. Suppose 0k = -tk - 5u + 172, 0 = 3k - 4u - 208. What is the units digit of k? 4 Let k be -121(-13)/((-117)/(-6)). Suppose x - 101 = k. What is the units digit of x? 9 Let g be (23 + -23)/(1-1). Suppose 0 = -3w - gw + 183. What is the units digit of w? 1 Suppose 0 = -2x + 2, 2m - 5m + 4x = 94. Let q = 125 + m. What is the units digit of q? 5 Let d(j) = -45j*3 - 3j*2 + 2j + 1. What is the units digit of d(-2)? 5 Let p be (-1 - -2 - (-4)/6)3. Suppose -3o + 532 = -pt, o - 151 - 13 = -t. What is the hundreds digit of o? 1 Suppose 0 = 4f, 18130 = 170v - 165v + 2f. What is the units digit of v? 6 Let o(t) = 2t*2 + 4t - 2. Let r(j) = -j - 1. Let y(f) = o(f) + 3r(f). What is the tens digit of y(-6)? 6 Let w be (17/(-34))/((-1)/898). Suppose 6z = z + 2p + w, -z + 97 = 2p. What is the tens digit of z? 9 Let w(l) = 5l2 - 14l + 118. What is the tens digit of w(10)? 7 Let x = -9 + 36. Let i = x + -23. Suppose 4v = -q + 21, -iq + 71 = v + 2v. What is the tens digit of q? 1 Let n(c) = -23c*3 - 5c*2 + 5. What is the tens digit of n(-2)? 6 Let r(i) = 6i*3 - 11i*2 + 10i. Let z(q) = -7q3 + 12q*2 - 10q. Let w(o) = 4r(o) + 3z(o). What is the units digit of w(5)? 5 Let k = -23 + 23. Suppose ks - 6s = -36. What is the units digit of s? 6 Suppose -3i + 9 = 0, -n - i + 99 = n. Let a = 84 - n. Let m = 26 + a. What is the units digit of m? 2 Let o = -57 - 53. Let q = -36 - o. What is the tens digit of q? 7 Let f(g) = -g2 + g + 4. Let p be f(0). Suppose 4t - 3c = 8, -t + pt + c = 19. Suppose 8b - tb = 192. What is the units digit of b? 4 Let j be ((-1)/2)/((-1)/(-2)). Let r = -563 + 669. What is the tens digit of j/(r/54 + -2)? 2 Let a(q) = 372q - 582. What is the hundreds digit of a(13)? 2 Let s(b) = -5b*2 - 16b + 14. Let g(x) = -x*2 + 1. Let r(m) = -4g(m) + s(m). What is the units digit of r(-12)? 8 Suppose 64 = p - 2p. Let w = 139 + p. What is the tens digit of w? 7 Let y(z) = 4z*2 - 2z - 10. What is the units digit of y(-7)? 0 Suppose 181s = 188s - 4207. What is the tens digit of s? 0 Let s(d) = 3d + 6. Let u be s(-2). Let x(g) = -4g + 11. What is the units digit of x(u)? 1 Let d = -141 - -274. What is the tens digit of d? 3 Suppose h + 2b = 2104, 5h - 4*b = 8740 + 1780. What is the hundreds digit of h? 1 Let y = -5 + 4. Let t be (y/(-2))/((-6)/(-48)). Sup	{ "pile_set_name": "DM Mathematics" }
h that 1/4r2 + 0 + 1/4r = 0. -1, 0 Let i be (-3)/(4 - 1) + 1. Factor a + 5a2 + 2 + ia - 6a2. -(a - 2)(a + 1) Let w(m) be the second derivative of m*8/168 - 2m7/105 + m6/60 - 3m2/2 + 3m. Let a(q) be the first derivative of w(q). Find k such that a(k) = 0. 0, 1 Suppose -4v + 2v = -6. Factor -2wv + 2w5 + w5 + 2w4 + w5. 2w*3(w + 1)(2w - 1) Let x = 16/17 - 110/153. Suppose -3n = -2n. Find z such that -xz3 + nz + 0 - 2/9z2 = 0. -1, 0 Let n(s) be the second derivative of -s7/21 - 3s*6/10 - 4s*5/5 - 7s4/6 - s3 - s2/2 - s. Factor n(q). -(q + 1)4(2q + 1) Let a(f) be the third derivative of f6/120 - f5/20 + f*4/12 + 5f2. Suppose a(j) = 0. Calculate j. 0, 1, 2 Let s(o) be the first derivative of -o4/18 - 2o3/9 - o2/3 + 4o + 2. Let x(i) be the first derivative of s(i). Determine l, given that x(l) = 0. -1 Let a(l) = -l + 7. Let z be a(4). Let 12/5wz + 0w - 3/5w2 + 0 - 9/5w*4 = 0. Calculate w. 0, 1/3, 1 Factor 0v*3 + 0v + 0v4 + 1/3v*5 + 0v2 + 0. v5/3 Let i(b) be the third derivative of 0b - 4/27b*3 - 1/27b*4 - 1/270b*5 + 0 + 2b*2. Find w such that i(w) = 0. -2 Let n be ((-12)/(-462))/((-3)/(-42)). Find i such that ni - 2/11 - 2/11i2 = 0. 1 Let j = 4 - 0. Factor -5z*2 - 3z - 2z3 + 6z*3 - 3z*4 + 5z + 2zj. -z(z - 2)(z - 1)2 Let 172s*3 + 36s*2 - 56s*3 + 12s + 3s5 + 18s*4 - 77s*3 = 0. Calculate s. -2, -1, 0 Let j(a) = -3a*2 - 12a. Let c(v) = -v. Let q(t) = 6c(t) - j(t). Determine l so that q(l) = 0. -2, 0 Let d(t) be the third derivative of -t9/211680 - t8/70560 + t7/8820 + t5/60 - t2. Let h(y) be the third derivative of d(y). Let h(n) = 0. Calculate n. -2, 0, 1 Let x(o) be the third derivative of -o5/100 + o3/10 - 14o*2. Let x(q) = 0. Calculate q. -1, 1 Let k = 11 - 11. Let p(l) = l. Let a be p(k). Factor 0v + a - 1/2v2 + 1/2v*4 + 0v3. v2(v - 1)(v + 1)/2 Let z(x) be the first derivative of x5/50 - x4/30 - x3/15 + x2/5 + x + 2. Let d(p) be the first derivative of z(p). Factor d(n). 2(n - 1)2(n + 1)/5 Let j(x) be the first derivative of 5x3/3 - 20x - 12. Solve j(r) = 0. -2, 2 Let k(r) be the third derivative of r5/15 - r4/24 + r*3/6 + 3r*2. Let s be k(1). What is j in 8j*3 + 2j*5 + 4 + 4j*2 - 8j*s - 5 + 5 - 10j = 0? -1, 1, 2 Let w(i) be the second derivative of 2i5/75 + i4/30 - i3/45 - 10i. Determine o, given that w(o) = 0. -1, 0, 1/4 Let i(v) be the first derivative of -v5/5 - v4/4 + v3/3 + v2/2 - 1. Let i(h) = 0. What is h? -1, 0, 1 Let t(y) = 2y - 4y + 0 - 6. Let u be t(-4). Find x, given that -5 - 2x3 + 3 - 6x*2 - 4x - ux = 0. -1 Let o(c) be the second derivative of 0 - 2/7c*2 - c - 1/105c*6 - 1/21c*3 + 1/70c*5 + 1/14c*4. Suppose o(v) = 0. What is v? -1, 1, 2 Let u(s) = -2s*2 + 10 - 16 + 2s*2 + 7s2 + s. Let d(c) = c2 - 1. Suppose 0k - 1 = -k. Let v(x) = ku(x) - 6d(x). Find q such that v(q) = 0. -1, 0 Suppose 2f + 5c = -2f + 17, 4f = -4c + 16. Determine p, given that 0p2 - 3 + 3p + fp2 - p + 3p*3 - 5p = 0. -1, 1 Let a(l) be the third derivative of l*8/420 + 3l*7/140 + 11l6/180 - l4/3 - 5l3/6 - 5l*2. Let o(x) be the first derivative of a(x). Factor o(n). 2(n + 1)(n + 2)2(2n - 1) Determine m so that 2/3m*3 + 4/3m*2 - 14/3m + 8/3 = 0. -4, 1 Suppose c = -4q - 3c + 16, -3q + 12 = -2c. Let y be q/(-9)15/(-10). Factor -2/3x*2 - yx + 0. -2x(x + 1)/3 Let c be 10/6 - 59/(-59). Factor 0j + c - 2/3j*2. -2(j - 2)(j + 2)/3 Suppose 4p + 2 = 22. Let g(b) be the first derivative of 0b - 2 - 1/8b*2 + 1/12b*3 - 1/20b*p + 1/16b*4. Determine r, given that g(r) = 0. -1, 0, 1 Let h(p) = 7p*5 + 7p*4 - 9p*3 - 7p*2 + 6p + 4. Let r(b) = -6b5 - 6b*4 + 9b*3 + 6b*2 - 6b - 3. Let y(z) = -3h(z) - 4r(z). Factor y(d). 3d(d - 1)*2(d + 1)(d + 2) Let a = -35/4 + 119/12. Factor 3/2n - an2 - 1/3. -(n - 1)(7n - 2)/6 Let c(p) be the second derivative of 0 + 1/3p*4 - 6p + 8p2 - 8/3p*3. Suppose c(a) = 0. Calculate a. 2 Let a(r) = -15r*2 - 105r. Let m(g) = -10g2 - 70g. Let z(w) = -5a(w) + 7m(w). Factor z(u). 5u(u + 7) Let z(s) be the first derivative of -s5/40 + s4/24 + s*3/6 - 4s + 3. Let x(d) be the first derivative of z(d). Find h such that x(h) = 0. -1, 0, 2 Let p(f) be the second derivative of -f8/1680 + f7/420 - f6/360 + f3 - f. Let c(u) be the second derivative of p(u). Factor c(a). -a*2(a - 1)*2 Let h = 274/3 - 90. Factor 10y*3 - 2/3y*2 + 0 - hy - 38/3y4 + 14/3y*5. 2y(y - 1)3(7y + 2)/3 Suppose 0v - 1/6v2 + 0 = 0. What is v? 0 Let c be 6/51 + 868/714. Factor u3 - 5/3u + cu2 - 2/3. (u - 1)(u + 2)(3u + 1)/3 Let f(h) be the second derivative of -h7/3360 + h6/480 - h5/160 + h4/96 + h*3/2 - 2h. Let d(s) be the second derivative of f(s). Factor d(c). -(c - 1)*3/4 Let g be (-3)/2 + -7 + 153/18. Find m, given that -2/3m*2 + gm + 0 = 0. 0 Let u be 6/(-21) + 86/(-140) + 1. Let h(r) be the second derivative of -ur2 + 0 - 1/15r*3 - 1/60r*4 - 4r. Factor h(b). -(b + 1)*2/5 Let a(j) = 2j*2 + 22j - 6. Let w(k) = 5k2 + 65k - 19. Suppose 3b + 10 = -5g - b, 4b - 38 = 3g. Let v(t) = gw(t) + 17a(t). Factor v(m). 4(m - 3)(m - 1) Suppose -b + 19 = 4h, 3b + 1 = 4h - 6. Suppose -q - 1 = -2f - 6, -7 = -hq - 5f. Factor 3/4 - 3/4s2 - 3/4s*q + 3/4s. -3(s - 1)(s + 1)2/4 Let f(p) = p5 + p3 + p2 + p + 1. Let w(n) = 33n5 - 9n*4 - 9n*3 + 3n*2 + 6n + 6. Let z(y) = -6f(y) + w(y). Factor z(m). 3m*2(m - 1)(3m + 1)*2 Suppose -13q*4 + 5 + 3q*5 - 3q*2 + 17q*3 + 598q - 1 - 606q = 0. Calculate q. -2/3, 1, 2 Let m = 1915/14 - 273/2. Find p such that 2/7p*5 - 8/7p*2 + mp + 0 - 8/7p4 + 12/7p*3 = 0. 0, 1 Let v(m) be the third derivative of 0 + 0m - 2m2 + 0m*4 + 0m*3 - 1/120m*6 + 0m5. Factor v(j). -j3 Let f(c) be the second derivative of 11c4/3 + 26c*3/3 + 4c*2 - 7c. Factor f(t). 4(t + 1)(11t + 2) Suppose 0x + 12 = -x - 5t, 3 = -t. Suppose 0 = xy + 5o + 19, 5y - o - 17 = -2. Determine w, given that -3 + 1 - w*4 + 5wy - w2 - w*4 = 0. -1, 1 Suppose h - 15 = 3r, -2h + 15 = -0h - 3r. Let hc - 3/2c2 + 0 = 0. Calculate c. 0 Factor -4/3 - 34/9i + 14/9i3 + 32/9i*2. 2(i - 1)(i + 3)(7i + 2)/9 Suppose -3 - 6 = -3u. Let w(j) be the first derivative of -2/3j3 - u - 1/3j*6 + 2/5j*5 + 0j + 1/2j4 + 0j*2. Factor w(p). -2p*2(p - 1)*2(p + 1) Let r(f) be the second derivative of -f6/120 - f5/40 - f*4/48 + 6f. Let r(h) = 0. Calculate h. -1, 0 Let c(i) = -i*2 + 9i - 9. Let o be c(8). Let s be (-6)/(-3) - (o - -3). Find b, given that 1/4b4 + sb + 0 + 1/4b2 - 1/2b3 = 0. 0, 1 Let m(f) be the first derivative of -f7/84 - f6/60 + f5/40 + f*4/24 - 3f + 2. Let v(g) be the first derivative of m(g). Factor v(y). -y*2(y - 1)(y + 1)2/2 Let s(u) be the third derivative of u7/504 + 7u6/1080 + u5/180 + u3/3 + u2. Let f(w) be the first derivative of s(w). Factor f(y). y(y + 1)(5y + 2)/3 Let f(c) be the second derivative of c7/168 - c5/40 + c3/24 + 11c. Find k such that f(k) = 0. -1, 0, 1 Let q(n) = n*2 + 1. Let o(z) = -5z*3 + 9z*2 + 20z - 6. Let j(t) = o(t) + 6q(t). Find s, given that j(s) = 0. -1, 0, 4 Let g = 7 - 5. Factor 2 + 8p*g + 2 - 3p - 2p3 - 7p. -2(p - 2)(p - 1)*2 Let f(k) = 2k*2 + 4k. Let w be f(-2). Suppose 1/2v2 + v + w = 0. What is v? -2, 0 Let z(i) be the first derivative of i5/10 - 5i4/24 + i3/18 + i*2/12 + 16. Factor z(f). f(f - 1)*2(3f + 1)/6 Solve -9/5c*3 - 4/5c*5 + 11/5c*4 + 1/5c*2 + 0 + 1/5c = 0 for c. -1/4, 0, 1 Factor 0 + 2d + 1/2d*3 - 5/2d*2. d(d - 4)(d - 1)/2 Determine b, given that 2b + 4b + 0b*2 - 3b2 = 0. 0, 2 Let u be (-2)/1 - (-11 - -4). Let h = u + -3. What is m in m2 + m - hm + 0 - 2 = 0? -1, 2 Let a = 23 + -16. Let -3 - 8i*2 - 3i + 1 + ai + 6i = 0. Calculate i. 1/4, 1 Let i(u) be the third derivative of 1/36u4 - 1/18u*3 - 1/180u*5 + 0 + 0u - 2u*2. Let i(b) = 0. Calculate b. 1 Let n = 3 + -3. Let a be -4 + ((-18)/(-2) - (5 + -2)). Let	{ "pile_set_name": "DM Mathematics" }
89, 779, 1007, 1279? m3 + m2 + 88m - 1 What is the i'th term of -56, -55, -56, -59, -64, -71? -i2 + 4i - 59 What is the p'th term of 23, 56, 117, 212, 347, 528? p*3 + 8p*2 + 2p + 12 What is the f'th term of -1357, -1353, -1349, -1345? 4f - 1361 What is the i'th term of 5, -13, -57, -139, -271? -2i3 - i2 - i + 9 What is the a'th term of -17, 5, 63, 175, 359, 633, 1015? 3a3 + a - 21 What is the m'th term of 1173, 1187, 1193, 1185, 1157, 1103, 1017, 893? -m3 + 2m*2 + 15m + 1157 What is the t'th term of -62, -128, -196, -266, -338, -412? -t*2 - 63t + 2 What is the h'th term of -954, -956, -962, -972, -986, -1004, -1026? -2h2 + 4h - 956 What is the k'th term of -277, -550, -823? -273k - 4 What is the m'th term of -241, -259, -289, -331, -385, -451, -529? -6m2 - 235 What is the u'th term of 3091, 3085, 3077, 3067, 3055, 3041, 3025? -u2 - 3u + 3095 What is the k'th term of -46, -59, -72, -85, -98? -13k - 33 What is the n'th term of 1080, 1093, 1104, 1113, 1120? -n*2 + 16n + 1065 What is the y'th term of -95, -179, -263? -84y - 11 What is the w'th term of 0, 3, 6? 3w - 3 What is the c'th term of -71, -80, -89, -98, -107? -9c - 62 What is the t'th term of -210, -205, -198, -189, -178, -165? t2 + 2t - 213 What is the c'th term of -2130, -4223, -6302, -8361, -10394, -12395, -14358, -16277? c3 + c2 - 2103c - 29 What is the y'th term of 659, 2650, 5967, 10610, 16579? 663y*2 + 2y - 6 What is the w'th term of -209, -409, -597, -773, -937, -1089? 6w2 - 218w + 3 What is the p'th term of -69, -96, -111, -108, -81, -24, 69, 204? p*3 - 34p - 36 What is the c'th term of -116, -433, -960, -1697, -2644, -3801, -5168? -105c2 - 2c - 9 What is the g'th term of -8, -2, 4, 10, 16, 22? 6g - 14 What is the n'th term of 21, 35, 39, 27, -7, -69, -165? -n3 + n2 + 18n + 3 What is the c'th term of 64, 135, 210, 289? 2c2 + 65c - 3 What is the n'th term of 585, 584, 583, 582, 581, 580? -n + 586 What is the v'th term of -19, -31, -77, -175, -343, -599, -961? -3v3 + v2 + 6v - 23 What is the u'th term of -96, -193, -290? -97u + 1 What is the a'th term of -4, -52, -142, -280, -472? -a3 - 15a*2 + 4a + 8 What is the z'th term of 51, 116, 203, 324, 491, 716, 1011? 2z3 - z2 + 54z - 4 What is the v'th term of -37, -47, -63, -85, -113, -147? -3v2 - v - 33 What is the x'th term of 40, 55, 74, 97, 124, 155, 190? 2x*2 + 9x + 29 What is the b'th term of 27, 32, 41, 54, 71, 92, 117? 2b2 - b + 26 What is the u'th term of -40, -115, -190, -265, -340? -75u + 35 What is the o'th term of 57, 64, 71, 78, 85, 92? 7o + 50 What is the r'th term of -260, -192, -74, 100, 336, 640, 1018, 1476? r3 + 19r*2 + 4r - 284 What is the k'th term of -90, -183, -286, -405, -546, -715, -918? -k3 + k2 - 89k - 1 What is the b'th term of 78, 313, 704, 1251, 1954, 2813, 3828? 78b*2 + b - 1 What is the w'th term of 153, 313, 477, 645, 817, 993? 2w*2 + 154w - 3 What is the q'th term of -13545, -13549, -13555, -13563, -13573, -13585, -13599? -q*2 - q - 13543 What is the w'th term of 40, 186, 560, 1276, 2448? 19w*3 + 13w + 8 What is the s'th term of 2156, 4315, 6474, 8633, 10792? 2159s - 3 What is the s'th term of -254, -515, -782, -1055, -1334, -1619, -1910? -3s*2 - 252s + 1 What is the f'th term of -1171, -2332, -3469, -4570, -5623, -6616, -7537? 2f3 - 1175f + 2 What is the l'th term of -154, -162, -184, -226, -294? -l3 - l2 + 2l - 154 What is the p'th term of 2492, 2494, 2496, 2498, 2500? 2p + 2490 What is the m'th term of -9, -25, -43, -63, -85, -109, -135? -m*2 - 13m + 5 What is the h'th term of -13985, -27972, -41959, -55946, -69933? -13987h + 2 What is the g'th term of 4, 16, 30, 46, 64? g2 + 9g - 6 What is the z'th term of 366, 733, 1100, 1467, 1834, 2201? 367z - 1 What is the x'th term of -22, -20, -18, -16? 2x - 24 What is the w'th term of 40, 87, 136, 187? w*2 + 44w - 5 What is the v'th term of 399, 381, 363, 345? -18v + 417 What is the o'th term of 221, 434, 635, 818, 977? -o3 + 220o + 2 What is the z'th term of -8, -10, -12, -14, -16? -2z - 6 What is the g'th term of 94, 95, 98, 103, 110, 119, 130? g2 - 2g + 95 What is the i'th term of 4460, 4458, 4456, 4454? -2i + 4462 What is the p'th term of 96, 106, 132, 180, 256, 366, 516, 712? p3 + 2p*2 - 3p + 96 What is the a'th term of 761, 763, 765? 2a + 759 What is the a'th term of 4, 31, 90, 193, 352, 579, 886, 1285? 2a*3 + 4a*2 + a - 3 What is the f'th term of -660, -2639, -5934, -10545, -16472? -658f*2 - 5f + 3 What is the s'th term of 5378, 10758, 16138, 21518, 26898? 5380s - 2 What is the z'th term of -47, -53, -61, -71, -83, -97, -113? -z2 - 3z - 43 What is the k'th term of -54, -225, -510, -909? -57k2 + 3 What is the l'th term of -9, -39, -111, -243, -453, -759? -3l*3 - 3l2 - 3 What is the a'th term of 29, 18, 5, -10, -27, -46, -67? -a2 - 8a + 38 What is the n'th term of -40, -147, -326, -577? -36n*2 + n - 5 What is the w'th term of -4, -42, -96, -166? -8w*2 - 14w + 18 What is the b'th term of -37, -49, -61, -73, -85, -97? -12b - 25 What is the x'th term of 1, -9, -29, -65, -123, -209, -329, -489? -x3 + x2 - 6x + 7 What is the w'th term of 146, 585, 1320, 2351, 3678, 5301, 7220? 148w2 - 5w + 3 What is the p'th term of -88, -115, -174, -277, -436, -663, -970, -1369? -2p3 - 4p*2 - p - 81 What is the q'th term of -25, -154, -369, -670, -1057, -1530, -2089? -43q*2 + 18 What is the d'th term of -4, 8, 42, 110, 224, 396, 638? 2d3 - d2 + d - 6 What is the h'th term of -324, -636, -948, -1260, -1572? -312h - 12 What is the o'th term of -1838, -1839, -1840, -1841, -1842, -1843? -o - 1837 What is the c'th term of -2546, -5093, -7638, -10181, -12722, -15261, -17798? c2 - 2550c + 3 What is the v'th term of 599, 597, 595, 593, 591? -2v + 601 What is the c'th term of 83, 162, 241, 320, 399? 79c + 4 What is the f'th term of 66, 107, 176, 273, 398? 14f2 - f + 53 What is the l'th term of -284, -554, -824, -1094, -1364, -1634? -270l - 14 What is the q'th term of 208, 415, 622, 829? 207q + 1 What is the o'th term of 78, 156, 232, 306, 378, 448? -o2 + 81o - 2 What is the l'th term of 95, 176, 245, 296, 323, 320? -l*3 + 88l + 8 What is the f'th term of -187, -117, -47, 23? 70f - 257 What is the j'th term of -58199, -58197, -58193, -58187? j2 - j - 58199 What is the l'th term of 5, -1, -27, -85, -187, -345? -2l*3 + 2l*2 + 2l + 3 What is the c'th term of 9, 6, -11, -48, -111, -206, -339? -c3 - c2 + 7c + 4 What is the o'th term of -3777, -7553, -11329, -15105? -3776o - 1 What is the x'th term of 38, 67, 98, 131, 166? x*2 + 26x + 11 What is the j'th term of 30972, 61942, 92914, 123888? j*2 + 30967j + 4 What is the b'th term of -13005, -13006, -13007? -b - 13004 What is the q'th term of 898, 890, 882, 874, 866? -8q + 906 What is the y'th term of -21, -67, -89, -81, -37, 49? y3 + 6y*2 - 71y + 43 What is the q'th term of -72, -138, -192, -228, -240? q*3 - 73q What is the h'th term of -44, -101, -162, -227, -296, -369? -2h2 - 51h + 9 What is the z'th term of -913, -1827, -2741? -914z + 1 What is the s'th term of -30, -21, 12, 81, 198, 375? 2s*3 - 5s - 27 What is the g'th term of -957, -959, -961, -963, -965? -2g - 955 What is the h'th term of -7, -79, -223, -445, -751, -1147, -1639? -h3 - 30h*2 + 25h - 1 What is the v'th term of -175, -173, -169, -163, -155? v2 - v - 175 What is the w'th term of 145, 155, 175, 211, 269? w3 - w*2 + 6w + 139 What is the o'th term of 149, 148, 147? -o + 150 What is the c'th term of -670, -1337, -2004, -2671, -3338, -4005? -667c - 3 What is the g'th term of -340, -675, -1004, -1327? 3g*2 - 344g + 1 What is the v'th term of -17, -38, -65, -98, -137, -182, -233? -3v2 - 12v - 2 What is the w'th term of -26, -125, -224, -323, -422, -521? -99w + 73 What is the w'th term of -40, -50, -66, -88, -116, -150, -190? -3w*2 - w - 36 What is the q'th term of 42, 40, 38, 36? -2q + 44 What is the h'th term of -1169, -1167, -1161, -1151? 2h2 - 4h - 1167 What is the c'th term of -56, -300, -708, -1280, -2016, -2916, -3980? -82c2 + 2c + 24 What is the n'th term of -161, -149, -133, -113,	{ "pile_set_name": "DM Mathematics" }
135 - y. Factor -aj2 + 2/9 - 8/9j*3 + 8/9j. -2(j - 1)(j + 1)(4j + 1)/9 Let m(z) = -z*2 + 8z - 4. Let k be m(7). Let w = 8 - 15/2. Factor wj2 + 0j + 0 - 1/2jk. -j2(j - 1)/2 Let n(d) = 2d2 + 4d + 2. Let v(y) = -4y2 - 8y - 4. Let a(b) = -5n(b) - 3v(b). Factor a(j). 2(j + 1)2 Let d = 49/39 - -1/13. Solve dn + 0 + 49/3n3 - 28/3n*2 = 0 for n. 0, 2/7 Suppose 0 = 5y - 25 - 0. Solve 1/2l2 - 1/2l*y + 1/2l*3 + 0 - 1/2l*4 + 0l = 0 for l. -1, 0, 1 Let t(n) be the third derivative of -1/4n4 + 2/3n*3 + 0n + 1/60n6 + 0n*5 + 0 + 6n*2. Solve t(c) = 0. -2, 1 Let q(l) = 4l + 2. Let s be q(-2). Let d be 2/s - 50/(-15). Factor -2t4 - t2 + 0t*3 + dt*2 - 2t*3 + 2t*5. 2t*2(t - 1)*2(t + 1) Suppose 0 = -4s + r + 13, s = -0s - 3r - 13. Let i = -1 - -3. Factor 0u*s - 2ui + u2 - u. -u(u + 1) Let r(l) be the third derivative of l10/15120 + l9/2520 + l8/1120 + l7/1260 - l5/30 + 4l*2. Let q(s) be the third derivative of r(s). Factor q(y). 2y(y + 1)2(5y + 2) Let v(n) be the second derivative of n7/98 + n6/70 - 3n5/70 - n4/14 + n*3/14 + 3n*2/14 + 15n. Let v(h) = 0. Calculate h. -1, 1 Let g = 7 + -5. Solve -6n2 - n + 7n*2 - gn*2 = 0 for n. -1, 0 Let b(x) be the second derivative of 3x*5/100 - 3x*3/10 - 3x*2/5 + 14x. Factor b(p). 3(p - 2)(p + 1)*2/5 Suppose 3b = 4z + 5, 5z + 5b = 33 - 13. Let f(x) = x2 - 1. Let p(s) = 20s*2 - 21s + 1. Let k(m) = zp(m) - 5f(m). Suppose k(n) = 0. What is n? 2/5, 1 Let n(k) be the second derivative of k7/42 - k6/10 + k5/10 + k4/6 - k3/2 + k2/2 - 7k. Find c such that n(c) = 0. -1, 1 Let r(q) be the third derivative of 0q + q*3 + 0 + 1/8q*4 + 5q*2 - 3/20q*5. Let r(f) = 0. Calculate f. -2/3, 1 Factor -2/9t*3 + 0t + 0 + 0t2. -2t3/9 Let k(h) = h3 + 2h2 + 3h + 2. Suppose 0o = -2x - o + 1, -2o + 10 = 0. Let u(y) = 3y*3 + 5y*2 + 7y + 5. Let s(z) = xu(z) + 5k(z). Factor s(l). -l(l - 1)(l + 1) Let n(y) = 227y4 + 283y*3 + 66y*2 + 2y. Let r(c) = -c4 + c3 - c*2 + c. Let l(i) = -n(i) - 2r(i). Factor l(f). -f(f + 1)(15f + 2)2 Factor -3/2w2 + w4 - 3/2w3 + 0 + w. w(w - 2)(w + 1)(2w - 1)/2 Let k = -383 - -257. Let b be (-2)/(-8) + k/(-264). Factor -2/11x*3 - 16/11x + b + 10/11x2. -2(x - 2)*2(x - 1)/11 What is b in 0b - 11b*2 + 3b + 8b2 = 0? 0, 1 Let h = -236/7 + 34. What is g in -2/7g*2 + 4/7g - h = 0? 1 Let x(q) = -q*2 + 3q - 2. Let f(d) = -2d2 + 1. Let o be f(2). Let n(u) = 3u*2 - 10u + 7. Let k(j) = ox(j) - 2n(j). Factor k(c). c(c - 1) Let s(l) be the third derivative of -1/36l*4 + 1/9l*3 + 1/180l*6 + 0l + 0 - 5l2 - 1/90l5. Let s(y) = 0. Calculate y. -1, 1 Let r(d) be the first derivative of -d6/12 + 3d4/8 + d3/3 + 24. Factor r(q). -q2(q - 2)(q + 1)2/2 Let p(q) be the third derivative of -q7/420 + q6/240 + q5/60 - 2q*2. Suppose p(v) = 0. What is v? -1, 0, 2 Let u(n) be the third derivative of 0n + 0 + 1/40n5 + 0n*3 + 1/24n*4 + 1/240n*6 + 7n*2. Factor u(x). x(x + 1)(x + 2)/2 Let p(s) be the first derivative of -2/3s*2 + 4 - s - 1/9s*3. Factor p(i). -(i + 1)(i + 3)/3 Factor -1 - 1/4q2 + q. -(q - 2)2/4 Let z(w) be the third derivative of w7/105 + w6/20 - w5/10 - 11w*4/12 - 2w*3 - 17w*2. Factor z(j). 2(j - 2)(j + 1)2(j + 3) Let c(t) be the second derivative of 0 + 1/12t4 + 1/21t*3 + 4t - 2/105t6 - 1/28t*5 + 0t*2. Factor c(v). -v(v - 1)(v + 2)(4v + 1)/7 Let j be 6 + -3 + 9 + 406/(-35). Solve ji*4 - 3/5i*3 - 1/5 + 3/5i - 1/5i2 = 0. -1, 1/2, 1 Let i be (92/(-10))/(152/2185). Let s = i - -133. Factor -sq*2 + 3/4 + 0q. -3(q - 1)(q + 1)/4 Let w(a) be the first derivative of a3/15 + a2/5 + a/5 + 20. What is d in w(d) = 0? -1 Let j(m) be the third derivative of -9m8/56 + 3m7/7 - m6/10 - 2m5/3 + 2m*4/3 - 8m*2. Suppose j(w) = 0. What is w? -2/3, 0, 2/3, 1 Let w = -13 - -24. Let y = -7 + w. Find z such that -4z*5 - 9z*y - 15z*2 + 7z*5 + 12z*2 + 9z3 = 0. 0, 1 Let c(h) be the second derivative of -h5/20 - 3h4/4 - 4h3/3 + h2 - h. Let a be c(-8). Suppose -2/9la + 0 + 0l + 2/9l3 = 0. What is l? 0, 1 Let n(q) be the second derivative of -1/3q*2 - 1/36q*4 + 5q + 0 + 1/6q3. Factor n(c). -(c - 2)(c - 1)/3 Let w(n) be the third derivative of -n8/1008 + n6/180 - n4/72 - n2. Factor w(m). -m(m - 1)2(m + 1)2/3 Let b(d) be the third derivative of -d8/1176 + d6/140 - d5/105 - 4d2. Find o, given that b(o) = 0. -2, 0, 1 Let h = 8 - 7. Let q(f) = -7f*2 - 9f - 8. Let k(o) = -o*2 - o - 1. Let g(w) = hq(w) - 6k(w). Suppose g(d) = 0. What is d? -2, -1 What is o in 1/8o + 0 + 1/8o2 = 0? -1, 0 Suppose 0 = 4y - 2 - 2. Let o be 2 - (y + -1)-1. Factor w - w - 2w*o. -2w*2 Let c(w) be the second derivative of 8/15w*3 + 7/50w*5 + 1/50w*6 + 2/5w*2 - 7w + 23/60w4 + 0. Factor c(g). (g + 1)2(g + 2)(3g + 2)/5 Let p = 2645 + -555449/210. Let y(w) be the third derivative of 0 - 3w2 + 0w + 1/6w4 - pw*7 - 1/24w*6 - 1/10w*5 + 4/3w*3. Factor y(d). -(d - 1)(d + 2)*3 Let p(a) = 6a - 7. Let g(l) = 5l - 6. Let s(r) = 5g(r) - 4p(r). Let j be s(4). What is i in -2i*3 + 0 + ji*2 - 1 + 2i - 1 = 0? -1, 1 Let q = -1615/7 + 231. Determine l, given that ql + l2 + 5/7l*4 + 9/7l*3 + 0 + 1/7l5 = 0. -2, -1, 0 Let s(f) be the third derivative of -f8/336 - 2f7/105 - f6/30 + f5/30 + 5f4/24 + f3/3 - 10f2. Factor s(o). -(o - 1)(o + 1)*3(o + 2) Let a(b) be the first derivative of -5b6/12 - 17b*5/10 - 21b*4/8 - 11b3/6 - b2/2 + 4. Find i such that a(i) = 0. -1, -2/5, 0 Let f = 4 + -3. Let t be (-1 + f - -2)1. Determine x so that -2x*2 + 4x*2 - 2x*3 - 4xt = 0. -1, 0 Let d(v) be the first derivative of v7/420 + v6/45 + v5/12 + v4/6 - v3 + 1. Let i(o) be the third derivative of d(o). Let i(q) = 0. What is q? -2, -1 Suppose 3m - 3u = 42, 2u + 2 + 56 = 4m. Factor -36l4 + 14l*3 + 17l*3 + ml*5 - 6l*2 - 4l*3. 3l*2(l - 1)*2(5l - 2) Factor -244n*3 - 78n*2 - 42n + 188n3 - 16n*4 - 9 + 5n2. -(n + 1)2(4n + 3)*2 Determine d, given that 224/3d + 2/3d4 + 128/3 + 26/3d*3 + 40d2 = 0. -4, -1 Let t(x) be the first derivative of x6/180 - x5/20 + x4/6 + 4x3/3 + 4. Let l(v) be the third derivative of t(v). Suppose l(w) = 0. What is w? 1, 2 Let c(v) be the second derivative of -1/5v*5 + 1/3v*3 + 0v*2 - 1/6v*4 - v + 0. Factor c(j). -2j(j + 1)(2j - 1) Let s(a) be the first derivative of 3 + 0a - 2/21a3 + 0a*2. Factor s(w). -2w*2/7 Suppose 5k = -c - 2c + 14, 15 = 3k + 4c. Let y be (k/(-6))/(2/(-16)). Let -4/3o + 1/3 + 1/3o4 - yo*3 + 2o2 = 0. What is o? 1 Let r(b) be the first derivative of b5/5 - b4/2 + 10. Factor r(x). x3(x - 2) Let b(n) be the second derivative of -2n*7/21 + 2n*6/5 - 2n*5/5 - 5n. Factor b(f). -4f3(f - 2)(f - 1) Factor p2 - 1/4p*3 + 0 - p. -p(p - 2)*2/4 Let p(q) be the first derivative of 5q*3/18 - 19. Factor p(z). 5z2/6 Let a(n) = n5 - n*4 + 1. Let y(r) = 10r*5 - 7r4 - r3 - 2r2 + 9. Let w(d) = -18a(d) + 2y(d). Solve w(u) = 0. -2, -1, 0, 1 Solve -2/5l*2 - 12/5l - 18/5 = 0. -3 Suppose -5c + 15 = -5r, 3c - 12 = -2r + 7. Let m = 13 - 10. Determine u, given that u*2 + 3ur - u + u3 - mu2 - u4 = 0. -1, 0, 1 Let z(u) be the third derivative of u8/56 - u7/15 - u6/6 + 14u*5/15 - 2u*4/3 - 2u*2 - 11. Solve z(n) = 0. -2, 0, 1/3, 2 Determine u so that -10u*2 + 8u - 2u3 + 0u*4 + 2u*2 + 2u*4 = 0. -2, 0, 1, 2 Let j be (-1 - -4 - -1) + -2. Suppose 4l + j = -3a - 5, -3l = 4a + 14. Solve 3t*3 + 2t*5 - 2t*4 - 3t*3 + 2t*2 - lt*3 = 0. -1, 0, 1 Let n(o) be the first derivative of -5o*4/6 + 4o*3/9 + 5o*2/3 - 4o/3 + 11. Factor n(h). -2(h - 1)(h + 1)(5h - 2)/3 Let a(n) = n*2 + 3n + 6. Let h be a(-5). Let o be (8/h)/(2/16). Find c such that 1/2c5 - 1/2 + c2 - c3 + 1/2c - 1/2co = 0. -1, 1 Let l(u) be the third derivative of -1/36u*6 + 0u + 1/90u5 + 5/36u*4 + 2u*2 + 0 - 1/9u**3. Solve l(i) =	{ "pile_set_name": "DM Mathematics" }
1127t2 + 4 - 6049143t)(-2t - t + t). 2254t3 + 6t2 Expand -u2 + u*2 - 2u*2 + (-1446 + 2922 - 3u - 1433)(3 - 4u - 3). 10u2 - 172u Expand -3445v - 5253v + 709 - 357 - 352 + (2v - v - 3v)(-4 - 1 + 4) - 3v - 2v + 6v. -8695v Expand -2936k*5 - 7824k*5 - 7337k*5 + (-5k*4 + 3k*4 + 3k*4)(1 + k - 1). -18096k5 Expand (-14u*4 - 27u*4 + 0u*4)(59u - 65u - 84u). 3690u*5 Expand (5 - 4 - 8)(0r + 2r + 0r) + (-r + 1 - 1)(1 + 4 + 4) + (5r - 4r - 3r)(0 - 1 + 2). -25r Expand ((4 - 6 + 0)(-3 + 3 - b) + b + 2 - 2 + 3 - 3 + 3b)(1 - 4 + 1)(2 - 16 + 2)(-4 - 1 + 3). -288b Expand f + 9 - 3 - 2 + (32 + 154 - 1019)(-1 - 1 + 1)(0 + f + 0). 834f + 4 Expand (0s - 15s + 9s)(0s3 - 6s*3 + 4s*3) + (-2 + 2 + 2s*2)(2s2 + 11 - 11). 16s*4 Expand -2r*3 + 2r*3 + 2r3 + r2 - r*2 - 2r*3 + (-452r*2 + 5150r - 5150r)(-4r + 3r - 2r). 1356r*3 Expand (4q*4 - 2q*2 - 5q*4 + 2 + 0q4 + (q3 + 1 - 1)(0q + q - 3q) - q4 - 5q*4 + 4q*4)((-15q + 11q - 13q)(4 + 0 - 3) + 30 + 41q - 30). -120q*5 - 48q*3 + 48q Expand (17 + 44 - 12)(1 - s - 1 - 3s - 1 - 1). -196s - 98 Expand (-c2 + 2c - c*2 + 9c)(-c3 - c3 - 2c*3 + (2 + 2c*2 - 2)(2c - 5c - 5c)). 40c*5 - 220c*4 Expand -1 + 1 + 3s*2 + (-3s + 2s + 3s)(505s - 854944 + 854944 + 1 - s - 1 + (-2s + s + 3s)(-1 - 1 + 3)). 1015s*2 Expand (3 - 1 + 3)(0 - 6 + 0)(-3 + 74d - 113d + 82d). -1290d + 90 Expand (5h - 287 + 287)(0h*2 - 3h*2 + 0h*2) - 4 + 0h2 - h2 - h*3 + 2. -16h3 - h2 - 2 Expand (-2 + 2 + 1)(13q + q*2 - 13q) - 8q + 8q + 3q2 - 735 - 48q*2 + 735. -44q*2 Expand ((3 + 1 - 2)(-1 + 0 - 1) + (0 + 3 + 0)(-2 - 1 + 5))(20 - 8c + 74 - 95). -16c - 2 Expand 2x + 2x + 2x + (-1 + 3 - 4)(0x - x + 3x) - 13x - 48x + x. -58x Expand 12346g - 24670g - 23g*4 + 12350g + (-4 + 5g + 4)(2g2 + g2 - 2g*2)(-5g + 3g + 0g). -33g*4 + 26g Expand (-2c + c + 3c)(-3c + c - 2c)(-523 + 523 - 121c). 968c*3 Expand (-13d*3 + 1113d*2 - 1113d*2)(-3 - 1 - 3 + 3 - 5 + 0 + (0 + 0 - 2)(-1 + 0 - 1) - 1 - 4 + 3) + (0d*2 - 2d2 + d2)(4d + d - 3d). 89d*3 Expand (324 + 23t - 324)((1 - 1 + 4)(1 + 0 - 2)(-1 + 2 - 4) + (1 - 4 + 1)(2 - 3 - 1) - 5 + 3 + 0). 322t Expand 13y - 18y - 13y + (-3 + 3 - 3)(-y + 0y + 3y) + (0y - y - y)(0 + 0 - 2) - 4 + 4 - 2y + (2 - 4 + 0)(-1 + 1 + y) - 2y + 4y + 0y. -22y Expand (-1 - c2 - 4c*2 + 7c*2)(2 - 2 - 2c3 + 27 - 6c*3 - 27 + (1 - 1 + 2c)(3c*2 - 2c*2 - 3c*2)). -24c*5 + 12c*3 Expand (15c + 99 - 99)(c3 - c3 + c3) + 8c*4 + 6787c - 6787c + 4c + 2c4 - 4c. 25c4 Expand (-3120r + 12 - 23 - 4039r - 1397r + 13)(2r*4 - 2 + 2). -17112r*5 + 4r*4 Expand 215w - 22w3 - 215w + (49 - 15w2 - 49)(-w - 2w + 2w) + 0 - 7w3 + 0 - w3 + w - w. -15w*3 Expand 46253y - 94846y + 46434y - 2y + y + 0y + (2 + 3 - 6)(2 - 2 + y) + 0y + 0y - y. -2162y Expand (-4u2 - 4u*2 + 6u*2)(0u + 0u + 2u2) + (u - 3u + 3u)(0u3 + 3u*3 - 4u*3) - 2u*4 + 5u*4 + 3u4. u4 Expand -4018u2 - 2000960u + 2000960u + (-1 - u + 1)(-4u - 2u + 4u) - 2 + 2u*2 + 2 + 5u*2 - 2u*2 - 4u*2 + 2u*2 - 4u*2 + 0u*2. -4017u*2 Expand -2f*2 + 0 + 0 + (-2 - 4f*2 + 2)(3 - 3 + 1) - 7f + 7f + 10f2 + (53 - 112f*2 - 53)(0 + 1 + 1). -220f2 Expand (43y + 176y3 - 43y + 16y3)(-228 + 512 - 101). 35136y3 Expand (248w*3 - 2844w + 2844w)(24w2 - 310w + 310w). 5952w*5 Expand -12i - 2 + 2 + (-2i + i - 2i)(-4 + 0 + 2) + 0i + 3i - i - 10i + 10i + 39i. 35i Expand (-3 - 2 + 4)(6c + 0c - 3c)(-28c2 - 11c*2 + 23c*2). 48c*3 Expand (-3q - 3 + 3)(-3951q - 3896q + 7971q). -372q2 Expand (-144 + 336 - 160 - z)(-9z + 14z - 6z). z2 - 32z Expand (4k2 - k2 - 5k*2)(921 - 1008 + 3930). -7686k2 Expand -4m*4 - 3m*4 + 5m4 + (-m2 + 0m2 + 2m*2)(-431m2 + 387m*2 + 1558m*2). 1512m*4 Expand -2s*5 - 2s*3 + 2s3 + (s4 + 0s4 - 2s*4)(2s - s + 0s) + 17 - 2s5 - 17 - 30393s*4 - 49s*5 + 30393s*4. -54s*5 Expand (160 - 312 - 146 - r)(2r3 - r2 + r2)(8r + 6r + 2r). -32r*5 - 9536r*4 Expand (-2 - 4 + 3)(28 + 23 + 18)(2p + 3 - 3). -414p Expand (-1 - 3 + 2)(-100b + 177b - 93b)(-1 + 0 + 2). 32b Expand 0b*2 - 12b + 8b + 5b*2 + b + 3b*2 - b + (0b - b - 2b)(3b + b - 3b) - 7b2 + 7b*2 - 9b*2. -4b*2 - 4b Expand (0 - 4f2 + 0)(-69f2 - f2 + 16f*2) + 2f*4 - 2f4 - f4 + 3f4 - 21f*3 + 21f*3. 218f*4 Expand (-896 + 2080 - 1058)(-17c4 - 21c*4 + 18c*4). -2520c*4 Expand (4r + 10 - 10)(-6322 - 8632 - 2149 + 9800) - r + 0r - r. -29214r Expand (-2 + 4 + 4)(-2o2 + 2o*2 + 2o*3) + 316o*3 - 5o*2 - 340o3 + o2 + 0o3 - 4o*3 + 5o*3 + (1 - 1 - o)(-o*2 - 5o + 5o). -10o*3 - 4o*2 Expand (-5 + 3d*2 + 5)(-4d - 294d*3 + 155d*3 + 150d*3). 33d*5 - 12d*3 Expand (w - 3 + 3)(-3 - 1 + 5) - 3 + 4w + 3 + (-2w - 2 + 2)(59 - 128 - 341). 825w Expand (-l3 + l3 - l*3)(-284l2 - 12797l + 12797l) - 3 + 2l5 + 3 + (l - l + l5)(0 + 6 - 3). 289l*5 Expand (6 - 6 - 5g)(-5g + g + 6g + (5 - 2 - 2)(4g - g - g) - g + 6 - 6) + (4g2 + g2 - 3g2)(1 - 2 + 19). 21g2 Expand (-2z + 0z + 3z + (2 - 2z - 2)(2 - 5 + 1) - 3z - z + 2z - 49z - 10 + 10)(174 - 255 + 139)(2z - 3z - z). 5336z*2 Expand (3w + 0w - w)((-2w - w + 2w)(-6w + 16w + 14w) + 6w - 3w*2 - 6w) - 3 + 2w3 + 3 + (-4w2 + w2 + 0w2)(-w - 2w + w). -46w*3 Expand (3n*4 + 3n*4 - 5n*4)(-n + 19 - 19) - 4n5 - 4n*5 + 5n*5. -4n5 Expand (-f4 - 4f4 + 4f*4)(9f - 388 + 769 - 382 - 2f - 2 + 2 + (-2f + 2f + 2f)(-2 + 2 - 3)). -f5 + f4 Expand (-2 + 2 - 1)(-20 + 0f + 4f - 5f) + (-6 + 16 + 3)(0f - 4f + 3f). -12f + 20 Expand (-5d - 18d + 11d + 3)(2078 - 86d - 2078). 1032d2 - 258d Expand (-n*5 + 2n*5 - 3n*5)(11563 + 16754 - 1614 - 79438 - 53874 - 34852). 282922n5 Expand (-2u*3 + 10u*3 + 15u*3)(u + u - 3u) - 8u*4 - 3 - 765u*2 + 765u*2 + 0u*4 - 2u*4 - 3u*4. -36u*4 - 3 Expand (2v - 5v - 3v)(-4 + 4 - 5)(8v - 5v - 4v) + (0v + 0v - v2)(-8 + 8 + 6). -36v2 Expand (16 + 9 + 54c - 55c)(-340147 + 340147 + 17c2 - 12c). -17c3 + 437c*2 - 300c Expand -46z3 - 72z*3 + 31z*3 + 0z3 - z3 - 2z3 + 2z*3 + 2z*3 - 3z*3 + (-3z2 + z2 + 4z2)(0z + z + z). -85z*3 Expand -3m*3 + 2m3 + m4 - m*3 + (-2m - 1 - 1 + 3m)(0m2 - 4m*2 - 2m*2)(4m + 15 - 15). -23m*4 + 46m*3 Expand (-24j - 30j + 65j + 1)(-31j*2 + 5j*2 - 46 + 44 + (-2j + 5j - 4j)(0j + 0j + j)). -297j*3 - 27j*2 - 22j - 2 Expand -b*2 + 31b*5 + 82b*4 - 70b*5 + 37b5 + (b - b + b4)(-2b - 2 + 2). -4b5 + 82b4 - b2 Expand (4v - 2v - 3v)(0v - 2v + v)(10741v*2 + 9830v*2 - 12520v*2) + 4v*4 - 2v*4 - 3v*4 + (4 - 2v - 4)(2v - 2v + 2v*3). 8046v*4 Expand (-l + l - l)(-8078l3 + 1651091 - 1651091). 8078l*4 Expand (3 + 2 - 1)(-f*4 + 0f*4 + 0f*4) + (2f*3 - 2f*3 + 2f*3 + 2f)(1 - 5 + 1)(-3f + 12f + 6f). -94f*4 - 90f*2 Expand (12 - 12 + 5y*5)(-214 - 1515 - 969 - 1104). -19010y5 Expand (4m - 4m - m2)(0m2 + 0m2 - m2) + (917m - 917m - 90m3)(-3 - m + 3). 91m4 Expand (-12 + 12 - 6r*3)(16268r - 16268r - 149r2). 894r*5 Expand (-13 + 11 - 6)(123 - 80 + 20)(-2b2 - b3 + 2b2). 504b*3 Expand (562 + 28x*2 - 562)(578 + 8x - 578)(-5x + 2x - 2x). -1120x*4 Expand (4 - 1 - 2)(-2 - 5 - 8)(-x + 3x - 3x)(-162x - 81x + 73x). -2550x*2 Expand -3h*2 + 3h*2 + 2h*5 + (2 - 2 + 2h*2)(-2h3 + 0h*3 + 0h*3) - 4h5 + h5 + h*5 + 2252h + 2h5 + 365h + 498h - h2. -2h5 - h2 + 3115h Expand (-128o*2 + 49832 + 49813 - 99628)(-2o2 - 2o*2 + 5o*2). -128o*4 + 17o*2 Expand ((2 - 1 + 1)(13w - 2w - 2w) + 0w - 3w + w)(26w + 20w - 36w). 160w*2 Expand (-3w2 - w2 + 0w2)(-2828 + 1111 + 1088)(-4 + 3 + 0)(0 + 2 - 1). -2516	{ "pile_set_name": "DM Mathematics" }
? False Does 36 divide 1908? True Is 49 a factor of 1127? True Is 124 a factor of 9554? False Is 99 a factor of 1901? False Is 53 a factor of 8328? False Is 621 a multiple of 9? True Is 40 a factor of 77599? False Is 15 a factor of 18105? True Is 4 a factor of 49? False Is 9975 a multiple of 52? False Does 5 divide 450? True Is 450 a multiple of 20? False Does 249 divide 38489? False Does 6 divide 905? False Does 173 divide 2768? True Is 7650 a multiple of 85? True Does 27 divide 783? True Does 94 divide 8636? False Is 7298 a multiple of 33? False Does 18 divide 6189? False Is 20400 a multiple of 240? True Is 352 a multiple of 11? True Is 19 a factor of 2755? True Is 12 a factor of 743? False Is 45011 a multiple of 223? False Is 17 a factor of 73? False Does 18 divide 3150? True Is 31 a factor of 2759? True Is 29 a factor of 30740? True Does 12 divide 1155? False Is 20 a factor of 1989? False Is 47076 a multiple of 69? False Is 1056 a multiple of 22? True Is 470 a multiple of 2? True Is 3410 a multiple of 102? False Is 1218 a multiple of 29? True Is 1123 a multiple of 20? False Is 2632 a multiple of 9? False Is 13 a factor of 832? True Does 161 divide 9703? False Does 18 divide 19704? False Is 2226 a multiple of 58? False Is 15 a factor of 343? False Does 113 divide 5085? True Is 1628 a multiple of 94? False Is 572 a multiple of 17? False Is 14 a factor of 92988? True Is 27 a factor of 172? False Is 15 a factor of 1798? False Is 54 a factor of 71? False Does 14 divide 504? True Does 29 divide 3507? False Does 9 divide 5562? True Is 724 a multiple of 12? False Does 18 divide 11214? True Is 4532 a multiple of 11? True Does 72 divide 1728? True Does 10 divide 550? True Does 75 divide 1200? True Is 84 a factor of 1008? True Is 10673 a multiple of 13? True Is 43 a factor of 169? False Does 8 divide 13896? True Is 22 a factor of 926? False Does 26 divide 24650? False Is 448 a multiple of 112? True Is 907 a multiple of 7? False Is 107 a factor of 7155? False Is 3104 a multiple of 10? False Is 551 a multiple of 6? False Is 6 a factor of 139? False Is 639 a multiple of 7? False Does 17 divide 1731? False Does 315 divide 45360? True Is 8700 a multiple of 30? True Does 4 divide 2664? True Is 14 a factor of 14913? False Is 90 a factor of 11365? False Does 5 divide 7314? False Is 630 a multiple of 118? False Is 150 a factor of 19098? False Is 1494 a multiple of 12? False Is 32175 a multiple of 33? True Does 2 divide 1053? False Does 9 divide 114? False Is 927 a multiple of 9? True Does 28 divide 336? True Is 95 a factor of 1425? True Is 83 a factor of 100513? True Is 27 a factor of 513? True Is 25 a factor of 200? True Does 3 divide 53? False Does 65 divide 8932? False Is 2175 a multiple of 27? False Is 6 a multiple of 6? True Is 15 a factor of 23835? True Is 24426 a multiple of 138? True Is 6 a factor of 144? True Is 100 a multiple of 26? False Does 160 divide 41760? True Is 76 a factor of 9652? True Does 19 divide 3677? False Is 1576 a multiple of 8? True Is 119 a factor of 8361? False Does 14 divide 2336? False Does 8 divide 2455? False Is 163 a factor of 978? True Is 340 a multiple of 10? True Does 9 divide 775? False Is 22 a factor of 16192? True Is 45 a factor of 2602? False Does 15 divide 5317? False Is 10 a factor of 30220? True Is 3537 a multiple of 131? True Does 53 divide 265? True Does 21 divide 1722? True Is 5940 a multiple of 55? True Does 56 divide 137? False Is 95 a factor of 1995? True Is 61557 a multiple of 71? True Is 115 a factor of 3082? False Is 80 a factor of 26276? False Is 6392 a multiple of 94? True Is 21 a factor of 1722? True Does 48 divide 768? True Is 77 a factor of 10542? False Is 35 a factor of 455? True Does 4 divide 628? True Is 24102 a multiple of 103? True Does 21 divide 420? True Does 200 divide 4451? False Is 16 a factor of 256? True Does 99 divide 1188? True Is 93 a factor of 4185? True Does 52 divide 10088? True Is 2088 a multiple of 58? True Is 532 a multiple of 72? False Does 17 divide 1545? False Is 96 a factor of 10368? True Is 21 a factor of 139219? False Is 850 a multiple of 10? True Is 10 a factor of 30? True Is 15 a factor of 1807? False Is 5 a factor of 166? False Is 845 a multiple of 12? False Does 58 divide 290? True Is 738 a multiple of 20? False Is 11 a factor of 51? False Is 834 a multiple of 31? False Is 36 a factor of 3024? True Is 4704 a multiple of 112? True Does 20 divide 6460? True Is 15 a factor of 4305? True Is 209 a multiple of 25? False Does 24 divide 96? True Is 36359 a multiple of 16? False Does 2 divide 324? True Does 15 divide 1020? True Does 71 divide 497? True Does 9 divide 848? False Is 1264 a multiple of 20? False Is 2144 a multiple of 21? False Is 70 a factor of 12307? False Is 42 a factor of 1182? False Does 13 divide 17537? True Is 77366 a multiple of 157? False Does 14 divide 490? True Is 63 a factor of 2142? True Does 4 divide 4448? True Is 27 a factor of 14499? True Does 10 divide 131? False Is 9 a factor of 11565? True Is 35592 a multiple of 16? False Is 15 a factor of 26490? True Is 2103 a multiple of 13? False Does 52 divide 2831? False Is 31 a factor of 2077? True Is 95 a factor of 6745? True Is 7 a factor of 171? False Does 64 divide 4460? False Does 18 divide 5166? True Is 15594 a multiple of 69? True Does 13 divide 61? False Is 26215 a multiple of 245? True Is 36 a factor of 36? True Does 12 divide 1656? True Is 51092 a multiple of 16? False Is 151 a factor of 14796? False Is 7 a factor of 77? True Is 1125 a multiple of 25? True Is 7 a factor of 10010? True Is 3072 a multiple of 33? False Does 71 divide 2272? True Is 10 a factor of 5474? False Does 10 divide 791? False Is 967 a multiple of 34? False Is 11330 a multiple of 11? True Does 73 divide 4526? True Is 119 a multiple of 70? False Does 26 divide 742? False Is 777 a multiple of 21? True Is 20629 a multiple of 48? False Is 870 a multiple of 30? True Does 13 divide 3495? False Is 45 a factor of 225? True Is 28 a factor of 308? True Does 6 divide 569? False Is 20 a factor of 4160? True Is 65 a factor of 3904? False Is 1734 a multiple of 51? True Does 49 divide 2705? False Does 55 divide 5060? True Does 11 divide 763? False Is 7 a factor of 15? False Does 10 divide 16190? True Is 357 a multiple of 11? False Is 25 a factor of 600? True Does 12 divide 330? False Is 28368 a multiple of 18? True Is 244 a multiple of 35? False Is 22 a factor of 967? False Is 190 a factor of 50540? True Does 76 divide 16188? True Is 7 a factor of 89? False Is 14 a factor of 910? True Is 10 a factor of 3500? True Is 10 a factor of 2138? False Is 225 a multiple of 45? True Is 10890 a multiple of 121? True Is 56 a factor of 2016? True Is 3500 a multiple of 10? True Is 3024 a multiple of 126? True Is 299 a factor of 48438? True Is 853 a multiple of 3? False Does 162 divide 60716? False Does 12 divide 1089? False Is 6224 a multiple of 189? False Is 16 a factor of 11354? False Does 12 divide 113? False Is 4 a factor of 86? False Is 33 a factor of 4620? True Does 14 divide 1916? False Is 13 a factor of 1008? False Is 1763 a multiple of 164? False Is 21030 a multiple of 15? True Does 18 divide 69940? False Does 16 divide 45744? True Is 3185 a multiple of 65? True Does 74 divide 3382? False Is 35578 a multiple of 11? False Is 75 a factor of 33450? True Does 6 divide 25389? False Does 8 divide 4952? True Does 3 divide 527? False Does 139 divide 131911? True Is 3 a factor of 5387? False Is 1848 a multiple of 28? True Does 50 divide 1400? True Is 4842 a multiple of 52? False Does 12 divide 9471? False Is 54 a factor of 11788? False Is 22178 a multiple of 6? False Is 193 a factor of 119660? True Is 38306 a multiple of 289? False Is 6021 a multiple of 9? True Does 2 divide 2487? False Is 2560 a multiple of 10? True Is 220 a multiple of 2? True Does 74 divide 6395? False Is 66 a factor of 7722? True Is 12528 a multiple of 54? True Is 187 a multiple of 13? False Is 62 a factor of 284? False Is 15394 a multiple of 9? False Is 1241 a multiple of 15? False Is 34068 a multiple of 68? True Is 10 a multiple of 2? True Is 5600 a multiple of 25? True Is 589 a multiple of 31? True Is 138 a factor of 3864? True Is 658 a multiple of 13? False Is 39 a factor of 505?	{ "pile_set_name": "DM Mathematics" }
128, 14164, 20304, 27542? -p*3 + 567p*2 - 6p + 144 What is the w'th term of 1831, 1821, 1807, 1789? -2w2 - 4w + 1837 What is the l'th term of -1765, -3525, -5279, -7027, -8769, -10505? 3l2 - 1769l + 1 What is the a'th term of -4809, -4832, -4827, -4782, -4685? 2a3 + 2a*2 - 43a - 4770 What is the d'th term of -9, -749, -2939, -7305, -14573? -121d3 + d2 + 104d + 7 What is the z'th term of 186679, 373363, 560049, 746737, 933427, 1120119? z*2 + 186681z - 3 What is the y'th term of -2230, -3973, -5716? -1743y - 487 What is the g'th term of -8713, -8715, -8717? -2g - 8711 What is the f'th term of 76, 134, 180, 214, 236, 246? -6f2 + 76f + 6 What is the f'th term of -5365, -10469, -15555, -20617, -25649? f*3 + 3f*2 - 5120f - 249 What is the j'th term of 10140, 10145, 10162, 10197, 10256, 10345? j*3 - 2j + 10141 What is the v'th term of -15485, -30968, -46451, -61934, -77417? -15483v - 2 What is the l'th term of -43232, -43224, -43216? 8l - 43240 What is the f'th term of -74, -151, -246, -365, -514, -699, -926? -f*3 - 3f*2 - 61f - 9 What is the r'th term of 1195689, 2391378, 3587067, 4782756, 5978445, 7174134? 1195689r What is the u'th term of -73926, -147852, -221778, -295704? -73926u What is the p'th term of 7848, 31462, 70796, 125832, 196552, 282938, 384972, 502636? -3p3 + 7878p*2 + p - 28 What is the v'th term of -11357, -11360, -11367, -11378, -11393? -2v*2 + 3v - 11358 What is the q'th term of 1029, 1790, 2549, 3306? -q*2 + 764q + 266 What is the z'th term of 23369, 46744, 70133, 93542, 116977? z3 + z2 + 23365z + 2 What is the i'th term of -1765, -3531, -5315, -7117, -8937, -10775, -12631? -9i*2 - 1739i - 17 What is the u'th term of 262, 659, 1340, 2317, 3602? 2u3 + 130u*2 - 7u + 137 What is the x'th term of -1916, -1922, -1946, -1994, -2072, -2186, -2342? -x*3 - 3x*2 + 10x - 1922 What is the y'th term of -111, -400, -885, -1566, -2443, -3516, -4785? -98y2 + 5y - 18 What is the o'th term of 47, 43, 27, -1, -41? -6o2 + 14o + 39 What is the c'th term of -11873, -11875, -11877, -11879, -11881, -11883? -2c - 11871 What is the k'th term of 3543, 2977, 2033, 711, -989, -3067, -5523? -189k2 + k + 3731 What is the r'th term of -476, -461, -430, -377, -296? r3 + 2r2 + 2r - 481 What is the n'th term of 101061, 101058, 101055? -3n + 101064 What is the m'th term of -153794, -615163, -1384110, -2460635? -153789m*2 - 2m - 3 What is the a'th term of -70, -1685, -3300, -4915, -6530, -8145? -1615a + 1545 What is the j'th term of -1514, -3036, -4558, -6080? -1522j + 8 What is the o'th term of -718, -701, -678, -643, -590? o*3 - 3o*2 + 19o - 735 What is the i'th term of 513, 316, 119? -197i + 710 What is the z'th term of 830, 770, 710, 650? -60z + 890 What is the k'th term of -54756, -109515, -164274, -219033, -273792? -54759k + 3 What is the o'th term of 116990, 116995, 117002, 117011, 117022, 117035, 117050? o2 + 2o + 116987 What is the s'th term of -1610, -1649, -1686, -1721? s*2 - 42s - 1569 What is the t'th term of 430, 934, 1480, 2074, 2722, 3430? t*3 + 15t*2 + 452t - 38 What is the o'th term of -118582, -237166, -355750, -474334, -592918, -711502? -118584o + 2 What is the d'th term of -47637, -47639, -47641, -47643, -47645, -47647? -2d - 47635 What is the d'th term of -27190, -108669, -244460, -434557, -678954, -977645, -1330624? d*3 - 27162d*2 - 29 What is the t'th term of -2380, -9504, -21376, -37996? -2374t*2 - 2t - 4 What is the m'th term of 3031, 3114, 3211, 3328, 3471, 3646, 3859, 4116? m3 + m2 + 73m + 2956 What is the h'th term of 4596, 4573, 4556, 4551, 4564? h3 - 3h*2 - 21h + 4619 What is the i'th term of -2228, -2165, -2102, -2039, -1976, -1913? 63i - 2291 What is the k'th term of -262, -480, -638, -724, -726? 2k*3 + 18k*2 - 286k + 4 What is the a'th term of 612, 573, 516, 441, 348, 237, 108? -9a2 - 12a + 633 What is the y'th term of 521006, 1042012, 1563018? 521006y What is the g'th term of -167133, -334264, -501395, -668526? -167131g - 2 What is the g'th term of -6959, -27846, -62659, -111398? -6963g2 + 2g + 2 What is the m'th term of -97, -189, -449, -961, -1809, -3077, -4849, -7209? -14m3 + 6m - 89 What is the m'th term of 33, 92, 159, 234, 317, 408, 507? 4m2 + 47m - 18 What is the s'th term of -393, -332, -255, -156, -29? s*3 + 2s*2 + 48s - 444 What is the v'th term of 745, 3026, 6817, 12106, 18881, 27130, 36841, 48002? -2v3 + 767v*2 - 6v - 14 What is the x'th term of -539, -1093, -1673, -2285, -2935? -x*3 - 7x*2 - 526x - 5 What is the c'th term of -2266, -2224, -2178, -2128? 2c2 + 36c - 2304 What is the q'th term of -1723, -1716, -1709, -1702, -1695? 7q - 1730 What is the z'th term of -8633, -8664, -8717, -8792, -8889, -9008? -11z*2 + 2z - 8624 What is the l'th term of 185, 369, 519, 617, 645, 585, 419? -3l3 + l2 + 202l - 15 What is the p'th term of 261003, 522014, 783025, 1044036, 1305047, 1566058? 261011p - 8 What is the a'th term of -57527, -57526, -57525, -57524, -57523, -57522? a - 57528 What is the k'th term of 1789, 1764, 1719, 1648, 1545? -k3 - 4k*2 - 6k + 1800 What is the g'th term of -873, -1439, -2005, -2571? -566g - 307 What is the p'th term of -735, -1354, -1973? -619p - 116 What is the a'th term of 4, -172, -464, -872, -1396, -2036, -2792? -58a2 - 2a + 64 What is the o'th term of 366, 379, 414, 483, 598, 771, 1014, 1339? 2o3 - o2 + 2o + 363 What is the i'th term of -46, 24, 518, 1748, 4026, 7664, 12974, 20268? 52i3 - 100i*2 + 6i - 4 What is the h'th term of 639704, 639701, 639696, 639689, 639680? -h2 + 639705 What is the y'th term of 4785, 4781, 4775, 4767, 4757, 4745, 4731? -y2 - y + 4787 What is the i'th term of 812, 795, 780, 767, 756, 747, 740? i*2 - 20i + 831 What is the h'th term of 559, 681, 803? 122h + 437 What is the y'th term of -1462, -5531, -12312, -21805? -1356y*2 - y - 105 What is the f'th term of 70, 74, 20, -122, -382, -790, -1376? -5f3 + f2 + 36f + 38 What is the t'th term of 229764, 229763, 229762, 229761, 229760? -t + 229765 What is the w'th term of -33140, -132579, -298310, -530333? -33146w*2 - w + 7 What is the z'th term of -1186, -4010, -8716, -15304, -23774? -941z*2 - z - 244 What is the q'th term of 35685, 142759, 321219, 571065, 892297, 1284915? 35693q*2 - 5q - 3 What is the c'th term of 219, 174, 129, 84, 39? -45c + 264 What is the a'th term of -252, -569, -1112, -1887, -2900, -4157? -a3 - 107a*2 + 11a - 155 What is the w'th term of 12443, 12436, 12423, 12404, 12379? -3w2 + 2w + 12444 What is the q'th term of -9677, -19357, -29037, -38717? -9680q + 3 What is the w'th term of -1, -106, -279, -520, -829? -34w*2 - 3w + 36 What is the n'th term of -8869, -8881, -8893? -12n - 8857 What is the u'th term of -109, -746, -2465, -5806, -11309? -90u3 - u2 - 4u - 14 What is the s'th term of 546, 251, -550, -2109, -4678, -8509, -13854? -42s3 - s2 + 2s + 587 What is the s'th term of -708049, -708044, -708039, -708034, -708029? 5s - 708054 What is the c'th term of 1680, 1685, 1690, 1695, 1700, 1705? 5c + 1675 What is the p'th term of -389429, -389363, -389259, -389123, -388961? -p3 + 25p*2 - 2p - 389451 What is the w'th term of -133, -220, -307, -394, -481? -87w - 46 What is the j'th term of -45222, -45230, -45252, -45294, -45362? -j3 - j2 + 2j - 45222 What is the z'th term of 2412, 2413, 2416, 2421, 2428, 2437, 2448? z*2 - 2z + 2413 What is the t'th term of -11210, -22370, -33480, -44540? 25t2 - 11235t What is the u'th term of 8365, 16731, 25097? 8366u - 1 What is the v'th term of -442, -831, -1194, -1519, -1794? 2v3 + v2 - 406v - 39 What is the x'th term of -663, -1555, -2447, -3339, -4231, -5123? -892x + 229 What is the s'th term of -5622, -5621, -5620, -5619? s - 5623 What is the u'th term of -334, -1585, -3734, -6781, -10726? -449u2 + 96u + 19 What is the n'th term of -1448, -1445, -1442, -1439, -1436? 3n - 1451 What is the o'th term of 1253, 1243, 1223, 1193, 1153, 1103, 1043? -5o*2 + 5o + 1253 What is the k'th term of -4877903, -4877902, -4877901? k - 4877904 What is the w'th term of 402, 697, 1000, 1311, 1630, 1957? 4*	{ "pile_set_name": "DM Mathematics" }
p(-3). Solve rd + 6 = -6 for d. -4 Let a be ((-3)/6)/((-2)/60). Solve -4q - q + a = 0 for q. 3 Let k(q) = -q*3 + 9q*2 - 8q + 4. Let s be k(8). Let n(u) = -4 + 0u - 2u - su3 - 3u*2 + 5u*3. Let p be n(4). Solve pz = -0z + 20 for z. 5 Suppose -z - z = -12. Suppose 3s = s + z. Let x be (3/(-6))/((-3)/6). Solve 0 = 4i - s - x for i. 1 Let t(q) = -2q - 2. Let o be t(3). Let z = 2 - o. Solve w = -w - z for w. -5 Let r = 5 - 4. Let m = r + 2. Solve 0 = -2k - mk - 15 for k. -3 Let d be -3 - (3 + 0 + -6). Suppose -3b - h = -4b, d = b + h. Solve -u - u = b for u. 0 Suppose p + 0n = 3n, 2p - 4n = 2. Let y be -4 + 23 + p + -1. Let b be y/64/2. Solve b = v + 3 for v. 4 Suppose 2 + 22 = 4f. Solve fx + 8 = 4x for x. -4 Suppose -l = -6l - 45. Let z(n) = n2 + 5n - 2. Let o be z(l). Let a be o/4 + (-2)/4. Solve 3c + a = c for c. -4 Let i be 2 + 4 - (4 + -1). Suppose -7 = -c + l, -c - 13 = -2c + il. Solve 2y = -2 - c for y. -3 Let j(i) = -i*2 + 6i - 3. Let w be j(4). Let v(l) = l*3 - 14l*2 + 16. Let u be v(14). Solve -wa + 1 = u for a. -3 Let g(s) = 3s - 54. Let n be g(19). Let c(x) = x3 + x2 - 1. Let q be c(1). Solve n = -h + q for h. -2 Let u be (-96)/(-54) + (-2)/(-9). Let g = -2 + u. Solve x + 4x = g for x. 0 Suppose -5w + 20 = d - 6d, 0 = -4w - 5d + 7. Suppose 2m = -3f + 4, 8f - 12 = wf + 2m. Solve 0 = -fs - 8 for s. -4 Suppose 45l - 50l + 45 = 0. Solve lv = 6v - 12 for v. -4 Let d = -7 + 12. Suppose -16 = w - dw. Solve wz - 4 = 4 for z. 2 Let r(x) = x*2 + x - 2. Let c be r(-2). Solve -20 = -cq - 4q for q. 5 Suppose -20u = -22u + 26. Solve -u = 5p + 2 for p. -3 Suppose -3c - 16 = -40. Solve 0 = 3b - c - 4 for b. 4 Suppose 6 + 2 = 4a. Suppose -m + 2m = a. Let t(k) = 5k - 1. Let r be t(1). Solve mo = ro + 8 for o. -4 Suppose 0 = 5z - 22 - 23. Let b = z - 9. Solve -2o - 6 = -b for o. -3 Suppose -z + 3 + 2 = l, -2 = z. Let b(y) = y - 7. Let k be b(l). Solve k = -a + 3 - 0 for a. 3 Let z = -22 + 18. Let n be (28 - 4)(-3)/z. Solve -3 = 3a - n for a. 5 Let a be 19 - (0 - (2 - 1)). Suppose 0 = -5j + 21 - 1. Solve jl - a = -0l for l. 5 Suppose 5o + 1 - 6 = 0. Solve 3n + 11 + o = 0 for n. -4 Let r = 3 + -11. Let u(g) = -g - 4. Let l be u(r). Solve -3s = l + 5 for s. -3 Let v(a) = a2 + 6a + 11. Let m be v(-6). Solve 3 = 2d + m for d. -4 Suppose u - 5 = 1. Solve -uq + 16 = -10q for q. -4 Suppose -5p - 4 = 3h - p, -p = h + 1. Suppose -4g + 20 - 4 = h. Suppose 2o + g = 4o. Solve 3q - oq + 5 = 0 for q. -5 Let g be (-1 - (-42)/30) + (-18)/(-5). Solve -gk + 2 = -2 for k. 1 Suppose 5 = 2f - s, 25 = -2f + 6f - 5s. Solve fj + j = -3 for j. -3 Let r(f) = -3f2 + 35f + 17. Let k be r(12). Solve 25 = -ks - 0s for s. -5 Let o(j) be the first derivative of j*3/6 + 3j + 3. Let m(y) be the first derivative of o(y). Let q be m(3). Solve p + 2 = q for p. 1 Suppose -4b = -5a + 29, -b - 14 = -2a + 3b. Solve 4r = -25 + a for r. -5 Let y be 3/93 - -1. Suppose 2l = 5l + 3c + 6, 0 = yl + 4c + 12. Solve -8 = -lr + 4r for r. -4 Let w(g) = -g2 - g + 35. Let n = 4 - 4. Let c be w(n). Suppose -3k - 5m = -2m - 27, -3k + c = 5m. Solve 7u = 2u + k for u. 1 Let a = -17 - -27. Let o = -6 + a. Let b be (5/(-4))/(2/(-40)). Solve -of + b - 9 = 0 for f. 4 Suppose -8x = -7x - 2. Solve 0 = -q - xq for q. 0 Suppose -3o + 9 = n - o, -2o = -3n + 3. Suppose 5u + 12 = nu. Let q = 9 + u. Solve -20 = 2b + qb for b. -4 Suppose -4i + 2a = 4, -3i - a + 0 = -2. Suppose 4y + 2w - 24 = 0, -3y + w + 13 = -0w. Suppose yp = 5, 3v + 6 - 27 = 3p. Solve -4f + v = -i for f. 2 Let f = 7 + -4. Suppose -k = -2k + f. Suppose -v = 2s - 17, 0 = 5s - v - 12 - 13. Solve w = -s + k for w. -3 Let h be 4(-10)/(-8) + 0. Solve -3d + hd = 0 for d. 0 Let c(a) = 5a - 7. Let x(h) = h - 1. Let k(t) = -c(t) + 4x(t). Let f(z) = z*2 + 4z + 3. Let i be f(-4). Let b be k(i). Solve -l - 2 + 3 = b for l. 1 Suppose -2q = -7q - 5a + 80, 0 = -q - 2a + 20. Suppose -5h + 2t = -2t - 25, -4h + 20 = -5t. Solve hs = s - q for s. -3 Let k(i) be the third derivative of -i*6/120 - 7i*5/60 - 5i*4/24 + 4i*3/3 - 2i*2. Let d be k(-6). Suppose 20 = dp + 2. Solve 0 = -o - 2o + p for o. 3 Suppose 4z + 15 = -z + 5p, 5z = 3p - 9. Suppose -4m + 2g = -11 - 5, z = -2m - 3g. Solve 5l + 4 = ml for l. -2 Let t = 7 - 2. Suppose -ta + 4 = -3a. Solve -4q - 6 = -aq for q. -3 Let y = 3 - 4. Let p be (2/2)/y-4. Solve -7s + 3s - p = 0 for s. -1 Let p(r) be the third derivative of r5/60 + r4/12 + r*3/6 + 2r*2. Let h be p(-3). Solve 1 = -3m + h for m. 1 Let r = -6 + 8. Suppose -15 = -3i + 3x, -3i + i + 5x - 5 = 0. Let a be r/5 - (-36)/i. Solve ap = -p for p. 0 Let k = -42 + 17. Let i = k + 25. Solve ic + 20 = -4c for c. -5 Let u = 160 - 40. Let k be u/21 - 4/(-14). Suppose 0 + k = 2d. Solve db = -b + 16 for b. 4 Suppose 5h = 3w + 48 + 21, 0 = -3h - 3w + 27. Suppose -3v + 3o + h = 0, -10 - 6 = -4v + 5o. Let y be (-20)/(-10) - 3 - (-2 - 0). Solve -a + v = y for a. 3 Suppose u = -2r + 7r + 26, -24 = u + 5r. Let l = -4 + 15. Solve l = -4p - u for p. -3 Let p(d) = d - 4. Let g be p(3). Let r be 3/(-9)(g - -1). Suppose -2c = 6, 3x - 2c + 0c = 15. Solve rj = -j + x for j. 3 Suppose -2w = 3w - 30. Let g be (-2 - -4)/(4/w). Suppose -5u = -gu - 8. Solve 3 + 1 = -ux for x. -1 Let t(v) = -v + 11. Let j be t(0). Let b = 11 - j. Solve 3f + 10 + 2 = b for f. -4 Let v(u) = 5u + 48. Let i be v(-7). Solve -3w + i + 2 = 0 for w. 5 Let v(z) = -2z*2 + 17z - 17. Let q be v(7). Solve -qp = p + 5 for p. -1 Let u be (0 - 4)/(1 - 0). Let r be (-24)/(-10) + u/10. Solve 9 = -ra - a for a. -3 Suppose f = -4, -2j + 2f + 2 = -6. Suppose 0h + h - 2 = j. Solve -o - 15 = ho for o. -5 Let f(o) = 2o - 2. Let d be f(3). Suppose 2a - 48 = -3p - 6, p = -a + 14. Suppose -3b + 56 = p. Solve 6 = -dt - b for t. -5 Suppose 10v - 208 = 2v. Solve -4s + v = 6 for s. 5 Let r be ((-1)/(-1))/((-3)/(-9)). Let v = r - 1. Solve 0w - 4 = -vw for w. 2 Let q = 30 + -19. Suppose 3g = 1 + q. Suppose -h - 42 = -gh. Solve -5u - h = 6 for u. -4 Suppose 3n = 2n. Suppose n = -4l - 0l. Let w(m) = m2 + m + 4. Let z be w(l). Solve -zf + 0f = 4 for f. -1 Let v(x) = 7 + x - 4x3 - x3 + 6x3 + 6x*2. Let t be v(-6). Let o(k) = 6k*3 - k. Let r be o(t). Solve rq - 4q - 4 = 0 for q. 4 Let v(k) = -k2 + 5k + 3. Let q be v(5). Let f be 3q/97. Let r be (1 - 2)(2 - f). Solve 3w = 2w - r for w. -5 Suppose -2w = 4, 4w = -2f + 5f - 20. Suppose -2b = -fb - 10. Let u be 4/b(-10)/2. Solve z = uz for z. 0 Let q = 17 - 15. Solve qc - 4 = -2 for c. 1 Let i(p) = -4p2 + 8p + 12. Let m(c) = 5c2 - 7c - 11. Let b(s) = 6i(s) + 5m(s). Let t be b(-12). Solve -tv + 15 = -0v for v. 3 Let y(v) = v*3 - 6v*2 + 2v + 4. Let p be y(6). Suppose 5l - p = 4. Let m = -1 + l. Solve -mx = -2x - 3 for x. 3 Let a = -11 - -14. Suppose -14 = -x - ax + 2q, -q + 7 = 5x. Solve 0m + 2m + x = 0 for m. -1 Let y = -91 - -91. Solve -2n + 10 = -y for n. 5 Let c = 125 - 123. Let g(p) = -p3 + 2p*2 + 4p - 2. Let y be g(3). Solve n + c = y for n. -1 Let y = -58 - -70. Solve 4u + 0 = y for u. 3 Suppose 4q - q = 0. Let f(k) = 2k3 - 1. Let v be f(2). Suppose -4g + v = -9. Solve gs - 3s + 6 = q for s. -2 Suppose -3n + 9 + 0 = 0. Suppose -29 = -3z - 2r, 2z - nr = -0z + 15. Suppose -o - 4f + z = -3f, 5f = 25. Solve -2q - 6 = -oq for q. 3 Let c be ((-24)/(-28))/((-48)/(-21) + -2). Solve -c - 9 = -4b for b. 3 Let h = 35 + -25. Solve -c + h = c for c. 5 Suppose -2n + 4 = -6n. Let a(f) = -2 + 4 - 2 - f + 1. Let t be a(n). Solve -g + 1 = t for g. -1 Let y be 39/26 + (-3)/(-2). Let a be (-34)/(-6) + 1/3. Solve b + a = yb for b. 3 Suppose 3t - 5 = -2t. Suppose -t + 3 = 2a. Solve a = 5d - 4 for d. 1 Let v = 8 - 5. Solve -4c = -5c + v for c. 3 Suppose -k + 5l + 79 = 2k, 2k - 52 = 4l. Suppose k = 2c + 8. Suppose q + 0q = 4. Solve -qo - o = -c for o. 2 Let d(f) = -2f - 1. Let x be d(6). Let y be x/(-4) - (-9)/(-36). Solve 0 = b + 1 + y for b. -4 Let n = -6 + 18. Solve -n = -3c - 0c for c. 4 Suppose -3r + 3 = -z, -4z + 16 = 4r - 2r. Solve 3k + 1	{ "pile_set_name": "DM Mathematics" }
2571484cs*5 - 2cs - 3s - 3 wrt s? 2c3 + 251429680cs3 What is the third derivative of 734263y*3 - 16y*2 + 136290y? 4405578 Find the second derivative of -371200203o2 + 268701137o wrt o. -742400406 What is the third derivative of -877m4 - 134008m*3 - 8m*2 + m - 94030 wrt m? -21048m - 804048 What is the second derivative of 467191237y2 + 193294323y + 1 wrt y? 934382474 Find the first derivative of -5926825s + 11743741. -5926825 What is the derivative of -f2l*2 + 89979434f*2l - 929l2 - 10l + 621 wrt f? -2fl*2 + 179958868fl What is the third derivative of -14081406k*5 - 21k*4 + 2k*2 + 479859k + 8 wrt k? -844884360k2 - 504k What is the derivative of -9n4 + 33470n*3 + 3n + 23942207 wrt n? -36n3 + 100410n*2 + 3 What is the derivative of -13gt2 + gt - 409044g + 1007997t*2 wrt g? -13t*2 + t - 409044 Find the second derivative of 158an2x - 148351anx3 + 131an + 4002n*2x*3 + 43n*2x*2 + nx - 3x2 + x wrt n. 316ax + 8004x*3 + 86x*2 Find the third derivative of -2r*3x*3 - 2395807r*3x - 56r2x*2 - 84485319x*3 wrt x. -12r*3 - 506911914 What is the third derivative of -6832m*3w*2 + 3m*3w + 835m3 + m2w*2 - 1030mw - 13300w wrt m? -40992w2 + 18w + 5010 What is the first derivative of -h*2r*2 - 68h*2 - 374074h + 5074127r2 wrt r? -2h*2r + 10148254r Find the second derivative of -74568086i*5 + 39753575i wrt i. -1491361720i3 What is the first derivative of -3b*4 + 69192573b*2 - 186604764 wrt b? -12b*3 + 138385146b What is the second derivative of 9300515tw*2 - 1919tw + 11t + 36w + 2 wrt w? 18601030t Find the second derivative of 32q4 - 184q*3 + 5q*2 - 152724q - 148 wrt q. 384q2 - 1104q + 10 Differentiate 46646412lt + 55073t - 77 wrt l. 46646412t Differentiate -7i2 + 65845i - 1856714 wrt i. -14i + 65845 Find the second derivative of -86408994x*2 - 142x + 1273617. -172817988 What is the second derivative of -5467x3 + 169x*2 - 1218273x - 4? -32802x + 338 Find the first derivative of 541970392x*2 - 18162314. 1083940784x Find the second derivative of 1295252q5 - 13q*3 - 253452932q wrt q. 25905040q3 - 78q What is the second derivative of 1085131at*4 + 5at + 88340a - 3t4 + t + 2 wrt t? 13021572at2 - 36t*2 Find the second derivative of 8200s*2 - 9396908s wrt s. 16400 What is the second derivative of 109121313w3 + 13291601w? 654727878w What is the second derivative of -15148288w*3 + 28936w - 120 wrt w? -90889728w Find the first derivative of 12854693n*2u - 7365n2 + nu*2 - 102 wrt u. 12854693n*2 + 2nu What is the second derivative of -54k*3s*2 - 832k*3s + 2k3 - 51345ks3 - 855ks - s wrt s? -108k*3 - 308070ks What is the derivative of -4240862px - 46p - 35x - 535153 wrt p? -4240862x - 46 Find the second derivative of 2cfj2 + 16268cfj - 3034793cj*2 + 4404c - 5j2 wrt j. 4cf - 6069586c - 10 What is the third derivative of -12455504a2l*3 - 2a*2l*2 + 18a*2 + 112182a wrt l? -74733024a2 What is the derivative of -137188193at2 - 6a - 1504788 wrt t? -274376386at Differentiate -559n3p*2 - 102280160n*3 - 2n*2 + 174864np + 2n wrt p. -1118n3p + 174864n What is the second derivative of 8729818a*5 + 17250744a wrt a? 174596360a3 What is the third derivative of -776090a*5 - 17a*3 + 5455257a*2? -46565400a*2 - 102 Find the second derivative of -635i*3y*2 - 111672i*2y*3 - 25iy2 - 7i + 16y3 + 2y*2 + 89 wrt i. -3810iy2 - 223344y*3 Find the third derivative of 281m*5 + 45473m4 - m3 + 38229922m2. 16860m*2 + 1091352m - 6 What is the derivative of -26y3 + 14337y - 15346549 wrt y? -78y2 + 14337 What is the second derivative of 1816194f*2v*2 - 2f*2 + 2fv2 - fv - 2f + 386v*2 - 4150 wrt f? 3632388v*2 - 4 What is the third derivative of 14620206j3 - j2 + 2j - 211729? 87721236 Find the third derivative of 238318397iu3 - 400iu2 - 718iu - 25i wrt u. 1429910382i Find the second derivative of -3d*3 + 486789d*2v + 2d2 - 642dv + 24545v wrt d. -18d + 973578v + 4 What is the third derivative of 351l5 + 6401l*4 - 7464402l*2? 21060l*2 + 153624l What is the second derivative of -l*3t + 52606424l3 - 6lt - 5824l + 727t - 3 wrt l? -6lt + 315638544l Find the third derivative of -2h3q*2 + 2414604h*3r - 6h2q*2r + hqr + 13qr - 27r + 201 wrt h. -12q*2 + 14487624r What is the third derivative of -5756203ln*3 - ln*2 - 3145l + n*5 - 113n*2 wrt n? -34537218l + 60n2 Find the second derivative of 1845000a*2 - 16180619a. 3690000 Differentiate -1060634b4z - 2896273z wrt b. -4242536b*3z Differentiate 30745504g4 - 16611953 wrt g. 122982016g*3 Find the third derivative of 91171712w3 - w2 + 13532565w + 5. 547030272 What is the second derivative of 27670f*2i*3 - 106f*2i*2 + fi*3 + 4fi - 3515f - 18i - 3 wrt f? 55340i*3 - 212i*2 What is the second derivative of -13869bn2 + 276879b - 25n4 + 4n*3 - 3n + 2 wrt n? -27738b - 300n*2 + 24n What is the second derivative of -4577846y2 + 3072349y wrt y? -9155692 What is the third derivative of 12804593c3 - 354c*2 + 14404? 76827558 What is the third derivative of 284294r4 - r3 + 4r2 + 9818r + 18 wrt r? 6823056r - 6 What is the second derivative of 203g*2j*2rw - 24g*2jw - 30g*2r - 3gj*2rw + grw + 10gr - 3441204rw wrt g? 406j*2rw - 48jw - 60r What is the first derivative of -6199hk*2 + 69hk + 9h - 44k - 7100614 wrt k? -12398hk + 69h - 44 Find the third derivative of 640hk*3ow2 + hk*2o*3w + 2hk*2 - 39009hko*3w*2 - ho*3w*2 - 3h - 416k3o*3w2 - o3 + 4o2 wrt k. 3840how*2 - 2496o*3w*2 What is the first derivative of 4136370ow + 307289o wrt w? 4136370o Find the second derivative of 209dv2 + 2dv - 30d - 86078v2 - 87v + 3299 wrt v. 418d - 172156 What is the derivative of -2g*2v + g*2 + 652gv - 1257g - 12083044v wrt g? -4gv + 2g + 652v - 1257 What is the second derivative of 5987757v*4 + 1581477v + 2? 71853084v2 Find the third derivative of -182274h*3l*3u - 65h3u - 2h2l2 - h2lu - 3h2u - 4hlu + 42352l*3 + 2l wrt h. -1093644l3u - 390u What is the first derivative of -27543z*2 - 333z - 874427158? -55086z - 333 What is the third derivative of 45004026i*5 + 54652700i*2? 2700241560i*2 What is the second derivative of -120060471z*2 - 21246873z? -240120942 Find the second derivative of -678h3 + 4676h*2 + 14822150h wrt h. -4068h + 9352 What is the third derivative of 355vw4 + 1534vw2 + 329vw + 3518w*6 wrt w? 8520vw + 422160w*3 Find the first derivative of -808m*2 + 23410m - 15468236. -1616m + 23410 Find the second derivative of -25085577s*4 - 52044531s. -301026924s2 Differentiate -3668251k*3w + 19k2w - 290635404w wrt k. -11004753k*2w + 38kw What is the second derivative of -519837572p3 + 96p - 196505? -3119025432p Find the third derivative of -990x*4 + 13791x*3 + 389x*2 + 222x - 7. -23760x + 82746 What is the third derivative of -2238i*3l4 + i3l2 - 3i*3l - 1760il*4 + 4il2 - 11i - 2l3 - l2 - 1247l wrt l? -53712i3l - 42240il - 12 What is the second derivative of -555d5 + 23d*4 - 31d*2 - 17768447d - 2 wrt d? -11100d3 + 276d*2 - 62 Find the second derivative of 700887ar2 - 179ar + 2a + 24r2 + 3511 wrt r. 1401774a + 48 Find the second derivative of 8928502a5 + 7886345a. 178570040a3 What is the third derivative of -80404145t*5 - 2136t*2 - 1094t - 7 wrt t? -4824248700t2 Find the third derivative of -13201074d*6 - 2d*2 + 95687d - 38. -1584128880d3 What is the third derivative of -43345237n*3y*3 - 292n*3y*2 - 58n*3y + 3n3 + ny wrt y? -260071422n3 What is the third derivative of d6 + d4 - 20815d*3 - 10611948d*2 wrt d? 120d*3 + 24d - 124890 Differentiate -62306547w - 1019330685 wrt w. -62306547 What is the derivative of 2770jy	{ "pile_set_name": "DM Mathematics" }
is the ten millions digit of 2814486911? 1 What is the hundreds digit of 94833997? 9 What is the millions digit of 974295569? 4 What is the millions digit of 1848263763? 8 What is the hundreds digit of 10926920? 9 What is the units digit of 15576361? 1 What is the hundred thousands digit of 17538993? 5 What is the ten millions digit of 60135684? 6 What is the ten thousands digit of 19020983? 2 What is the thousands digit of 105265672? 5 What is the hundreds digit of 24169964? 9 What is the tens digit of 24105467? 6 What is the thousands digit of 543802612? 2 What is the hundreds digit of 1621998551? 5 What is the units digit of 200979573? 3 What is the hundreds digit of 681537754? 7 What is the hundreds digit of 2841635123? 1 What is the tens digit of 82654444? 4 What is the hundred thousands digit of 365647? 3 What is the tens digit of 856011906? 0 What is the thousands digit of 2418580600? 0 What is the ten millions digit of 352014915? 5 What is the thousands digit of 1867506641? 6 What is the hundred millions digit of 1599836494? 5 What is the hundred thousands digit of 13870722? 8 What is the hundred thousands digit of 1027650971? 6 What is the thousands digit of 4935006? 5 What is the units digit of 706246353? 3 What is the hundreds digit of 654994? 9 What is the hundred thousands digit of 221923868? 9 What is the billions digit of 4405617941? 4 What is the millions digit of 131083029? 1 What is the millions digit of 34191045? 4 What is the thousands digit of 4889674926? 4 What is the hundreds digit of 182801206? 2 What is the millions digit of 480826441? 0 What is the hundreds digit of 1232231877? 8 What is the units digit of 5456815? 5 What is the tens digit of 22803449? 4 What is the millions digit of 19825007? 9 What is the thousands digit of 1653509399? 9 What is the hundred millions digit of 392219734? 3 What is the millions digit of 489643794? 9 What is the ten thousands digit of 507980928? 8 What is the hundred thousands digit of 146255588? 2 What is the ten thousands digit of 72834288? 3 What is the ten millions digit of 17912379? 1 What is the hundred thousands digit of 22116892? 1 What is the millions digit of 335527795? 5 What is the hundred thousands digit of 124395348? 3 What is the ten millions digit of 5200588735? 0 What is the thousands digit of 581287283? 7 What is the tens digit of 661655172? 7 What is the thousands digit of 51385401? 5 What is the billions digit of 5270303049? 5 What is the hundreds digit of 154068895? 8 What is the tens digit of 426705831? 3 What is the ten millions digit of 1830703641? 3 What is the thousands digit of 5359146016? 6 What is the tens digit of 1065049842? 4 What is the hundred thousands digit of 1812393865? 3 What is the units digit of 20841136? 6 What is the tens digit of 363695665? 6 What is the millions digit of 529221638? 9 What is the millions digit of 277020970? 7 What is the hundreds digit of 2903944453? 4 What is the hundred millions digit of 5193657785? 1 What is the units digit of 3895778279? 9 What is the thousands digit of 1513914966? 4 What is the tens digit of 3685791218? 1 What is the ten millions digit of 517553625? 1 What is the units digit of 4503466110? 0 What is the millions digit of 1048383332? 8 What is the thousands digit of 9901795? 1 What is the hundred thousands digit of 471610187? 6 What is the tens digit of 759403107? 0 What is the units digit of 1403854327? 7 What is the tens digit of 134457528? 2 What is the billions digit of 1256390253? 1 What is the tens digit of 219275123? 2 What is the thousands digit of 2584467338? 7 What is the millions digit of 1834938518? 4 What is the hundreds digit of 630280039? 0 What is the ten thousands digit of 10801532? 0 What is the thousands digit of 59545697? 5 What is the tens digit of 711146802? 0 What is the millions digit of 223200972? 3 What is the tens digit of 2226143153? 5 What is the hundreds digit of 6639618? 6 What is the hundreds digit of 9176343? 3 What is the millions digit of 1375331049? 5 What is the ten millions digit of 1510186071? 1 What is the units digit of 116297019? 9 What is the ten millions digit of 273519839? 7 What is the hundreds digit of 43976435? 4 What is the hundred thousands digit of 300231148? 2 What is the units digit of 234861347? 7 What is the hundreds digit of 50127203? 2 What is the thousands digit of 39360027? 0 What is the ten thousands digit of 1215412662? 1 What is the thousands digit of 202311415? 1 What is the hundreds digit of 107076857? 8 What is the ten millions digit of 25065916? 2 What is the thousands digit of 2013563516? 3 What is the units digit of 220260011? 1 What is the hundred millions digit of 4671619913? 6 What is the millions digit of 96703385? 6 What is the hundred thousands digit of 37696677? 6 What is the ten thousands digit of 287435635? 3 What is the ten millions digit of 990506866? 9 What is the hundreds digit of 20742224? 2 What is the ten thousands digit of 107016565? 1 What is the units digit of 530277825? 5 What is the hundred thousands digit of 26183196? 1 What is the billions digit of 3333434412? 3 What is the hundred millions digit of 996560150? 9 What is the tens digit of 1164919858? 5 What is the tens digit of 454395357? 5 What is the thousands digit of 1976672754? 2 What is the tens digit of 7809403656? 5 What is the hundreds digit of 203185911? 9 What is the tens digit of 44759983? 8 What is the thousands digit of 926502742? 2 What is the hundred millions digit of 347691241? 3 What is the thousands digit of 988422? 8 What is the millions digit of 3953601528? 3 What is the hundreds digit of 2263849314? 3 What is the tens digit of 3664547250? 5 What is the ten thousands digit of 5823615346? 1 What is the ten millions digit of 10623547? 1 What is the units digit of 416939017? 7 What is the tens digit of 7205947390? 9 What is the hundreds digit of 179892936? 9 What is the thousands digit of 32120588? 0 What is the units digit of 2659458550? 0 What is the ten thousands digit of 1058763563? 6 What is the hundreds digit of 255761309? 3 What is the billions digit of 1650142831? 1 What is the hundred millions digit of 6502444434? 5 What is the hundred millions digit of 666496203? 6 What is the units digit of 56594954? 4 What is the units digit of 1237974752? 2 What is the hundred millions digit of 517037661? 5 What is the hundred millions digit of 241412748? 2 What is the millions digit of 371410979? 1 What is the millions digit of 466237088? 6 What is the ten thousands digit of 1943100087? 0 What is the units digit of 133377494? 4 What is the hundred millions digit of 304395581? 3 What is the ten thousands digit of 34311505? 1 What is the tens digit of 46978601? 0 What is the ten millions digit of 391589697? 9 What is the millions digit of 2175765839? 5 What is the hundred thousands digit of 43459807? 4 What is the hundreds digit of 7526968? 9 What is the millions digit of 4679558020? 9 What is the ten thousands digit of 15347717? 4 What is the ten millions digit of 1234055326? 3 What is the ten millions digit of 3117606542? 1 What is the hundreds digit of 228191010? 0 What is the ten thousands digit of 5655525025? 2 What is the hundred millions digit of 595584004? 5 What is the ten thousands digit of 1934282495? 8 What is the hundreds digit of 6403155904? 9 What is the millions digit of 12328748? 2 What is the ten millions digit of 389306041? 8 What is the ten thousands digit of 615070917? 7 What is the hundreds digit of 2001977160? 1 What is the units digit of 73257673? 3 What is the thousands digit of 61480073? 0 What is the hundreds digit of 77768014? 0 What is the ten thousands digit of 1466128192? 2 What is the ten millions digit of 77826804? 7 What is the ten thousands digit of 15648280? 4 What is the millions digit of 92031313? 2 What is the hundred thousands digit of 12072441? 0 What is the millions digit of 17843451? 7 What is the millions digit of 9573073? 9 What is the tens digit of 982558978? 7 What is the ten millions digit of 3715341422? 1 What is the tens digit of 43885219? 1 What is the millions digit of 123786782? 3 What is the hundred thousands digit of 2082220355? 2 What is the hundred thousands digit of 638885956? 8 What is the t	{ "pile_set_name": "DM Mathematics" }
ind the third derivative of 5hm*4 + 19hm2 + 4hm + 6479m*4 - 29m*3 + 3m*2 - 4864m wrt m. 120hm + 155496m - 174 Find the third derivative of -236575bm4 + 3bm2 + 2942456b - 105m4 - m2 wrt m. -5677800bm - 2520m Find the third derivative of 1599a4y*3 - 75a*4y + 2a3y + a*2y + 2ay*3 + 33y*3 - 62y*2 - 4 wrt a. 38376ay3 - 1800ay + 12y Find the third derivative of -2b3lw3 - 1518b*3lw + 421b*3o + 3b2low*3 + 2b*2 - blw3 + 8low*3 - 62710low - w*2 wrt b. -12lw3 - 9108lw + 2526o Differentiate -7l2wy + 29l*2y - 17140lw*2 - 16ly - 438l - 10wy wrt w. -7l2y - 34280lw - 10y What is the second derivative of -681u*2z*2 + 7u*2z - 4904uz*4 - 8u - 84620 wrt z? -1362u2 - 58848uz2 What is the first derivative of -4p*2 - 24538465p - 444028917? -8p - 24538465 Find the third derivative of -o3v*3 + 66900541o*3 - 4o*2v*3 + 301o*2v2 + v3 - 1362v2 wrt o. -6v*3 + 401403246 What is the third derivative of -935193143h*3 - 426038302h2 wrt h? -5611158858 What is the second derivative of -m4 + 194m3 + 244327m*2 + 571535084m? -12m2 + 1164m + 488654 Find the third derivative of -7343251i6 - 2i*3 + 2i*2 - 2455i + 90 wrt i. -881190120i3 - 12 Differentiate 957w*2z - 56w2 - wz - 33w - 21z + 2215974 with respect to w. 1914wz - 112w - z - 33 Differentiate -7087380a*3c + 127a3 - 5a + 18405 with respect to c. -7087380a3 What is the second derivative of 43055320d*2 + 18d + 2100696 wrt d? 86110640 Differentiate 304n3 - 3481n*2 + 40328837. 912n*2 - 6962n Differentiate -3o4 + 41592450o - 357237526 wrt o. -12o3 + 41592450 Find the first derivative of -40v*4 - 102338v*3 - 64164600 wrt v. -160v*3 - 307014v*2 Find the third derivative of 328782733m*3 - 415859871m*2 wrt m. 1972696398 Find the third derivative of 133045383c*3 - 61c*2 - 4472660c. 798272298 What is the second derivative of -i*5 - 12i*3n*2 + 54522i*2 - in*2 - 214207i wrt i? -20i3 - 72in2 + 109044 What is the first derivative of 84629106l - 7057051 wrt l? 84629106 Find the second derivative of 2u4 + 27819u*3 - 52u*2 - 587460826u wrt u. 24u2 + 166914u - 104 Find the third derivative of -293fv*4 + 143742f + 19616v6 - 12v*2 wrt v. -7032fv + 2353920v3 Find the first derivative of f3 - 23f2g*2 - 6752251fg - 23g*2 - g + 1727459 wrt f. 3f*2 - 46fg2 - 6752251g What is the third derivative of -1376048901c3 + 19748c*2 + 6116c wrt c? -8256293406 What is the second derivative of 4092877g3 - g2 + 1644388g? 24557262g - 2 What is the second derivative of -54n*5 - 1064601n*4 + 266448700n? -1080n3 - 12775212n*2 What is the first derivative of 2761161ac - 119869726a wrt c? 2761161a Find the third derivative of 10093x*5 + 4157x4 + x3 + 9180457x2 - 2x - 2. 605580x2 + 99768x + 6 Find the second derivative of 8242a2s*2 - 2615a*2s + 102s2 - 1074s wrt s. 16484a2 + 204 Find the third derivative of 74148439r*3 - 78889253r*2 wrt r. 444890634 What is the second derivative of 12802w*4 + 23w*3 + 14400918w? 153624w2 + 138w Find the second derivative of 64123o3 + 31o*2 + 2045o + 169 wrt o. 384738o + 62 What is the third derivative of 8282x*5 + 168x*4 + 11956x*2 + x + 85? 496920x*2 + 4032x Find the third derivative of -52171635jk*3 + 1901jk2 + 31149k*2 wrt k. -313029810j Find the second derivative of -i*4 - 1736i*3 + 13953i*2 + 442215005i wrt i. -12i2 - 10416i + 27906 Find the second derivative of 10219i2u*2 + 602i*2u + 24iu + 275892u2 wrt i. 20438u*2 + 1204u Find the second derivative of 24a2b*2x + 4a2hx + 51262ab2h + abh - 2ax - 33bh + 15hx wrt b. 48a2x + 102524ah What is the second derivative of -607a2p*3 - 13a*2p*2 + 502a*2 - 31ap3 + 5885ap + 2a + p - 8 wrt a? -1214p3 - 26p*2 + 1004 What is the derivative of 60i*3 - 408562i*2 + 28761067? 180i*2 - 817124i What is the second derivative of -24955687l2y*3 - 56ly3 + 26517ly2 + l wrt l? -49911374y*3 Differentiate 14492330hj + 5572h - 4660 with respect to j. 14492330h Find the second derivative of -282h*3k*2t + 2h3k - h*2k*2t + h*2t - 18k2t - 235988k wrt k. -564h*3t - 2h2t - 36t What is the third derivative of -14845881r*3y*4 + 15r*3y*3 + 253995408r*3y*2 wrt y? -356301144r*3y + 90r3 What is the first derivative of 3894437p*4 - 4p - 239928255 wrt p? 15577748p3 - 4 Find the second derivative of -5a*2it + 943696a*2t*2 + ait2 - 2at2 - 9971a + it2 + t2 wrt a. -10it + 1887392t*2 Find the third derivative of 4686k*4 + 16597k*3 + 346869609k*2 wrt k. 112464k + 99582 Find the second derivative of 32550451w3 - 13152w + 28 wrt w. 195302706w Find the third derivative of 8993525k*3o*3 + 24045k*2o*3 + 13k*2 wrt k. 53961150o*3 Find the second derivative of -1729sy2 + 2s - 734y2 + 1004159y wrt y. -3458s - 1468 Find the third derivative of -22692048k*3m*2 - 3k*2m2 + k2m - 478km2 - 1971km wrt k. -136152288m*2 Differentiate -9551vy4 - 4436528v + 15y4 + 3y*2 with respect to y. -38204vy3 + 60y*3 + 6y What is the third derivative of -769123220o6 - 719804308o*2 wrt o? -92294786400o*3 What is the first derivative of 140808775c*2x + 12609578c2 - 6 wrt x? 140808775c*2 Find the third derivative of -289644897x*3 - 747582229x*2 wrt x. -1737869382 What is the second derivative of -328c*4 + 30c*3 - 420c*2 - 258528c + 2 wrt c? -3936c2 + 180c - 840 What is the second derivative of 12531011q3 - 2q*2 - 20q + 1248634 wrt q? 75186066q - 4 What is the third derivative of -151645a*2v*3 - 2a*2v*2 + 1178411a*2v + 14av*3 + 2v*3 - 38v*2 wrt v? -909870a*2 + 84a + 12 Find the third derivative of 3036m3r*2 - 518m*3rw - m3r + 8m2rw + 12m*2w + 2m + 2r*2w + 32rw + 18w - 2 wrt m. 18216r*2 - 3108rw - 6r What is the derivative of -h*4 - 4791h*3 + 202h + 32892338 wrt h? -4h3 - 14373h*2 + 202 Find the third derivative of -289641hy3 + 2hy2 + 4775h + 19y3 - 21y - 6 wrt y. -1737846h + 114 Differentiate -239851j + 1768893 wrt j. -239851 What is the second derivative of 83236068f2 + 55097431f? 166472136 Differentiate -17798i3 + 3223i - 122246695 wrt i. -53394i2 + 3223 Find the second derivative of 49ow2x*3 + 2owx*3 - 4owx - 100ox - 3o - 26472w*2x*3 - 280wx3 + 17x wrt w. 98ox*3 - 52944x*3 Differentiate 117425454jn - 32j - 289564 wrt n. 117425454j What is the derivative of -192a*2my - 777a*2m + 4a2y - 8am - 2a + 157749y wrt m? -192a2y - 777a2 - 8a Find the second derivative of 30156603y2 - 154995521y wrt y. 60313206 Differentiate 4143a2hm - ah*2m - 91am3 + h2m3 - h2m - 64hm*3 - 6hm - 1205m wrt a. 8286ahm - h2m - 91m3 What is the third derivative of -3fg3 - 2fg + 7485f + 15285g5 - 2g*2 - 2g + 2 wrt g? -18f + 917100g*2 Differentiate 79506c*2j + c*2 + 2cj - 10c - 1105577408j with respect to c. 159012cj + 2c + 2j - 10 What is the third derivative of 250x*5 - 2x*4 + 95095x*3 - 2710152x*2 - 9 wrt x? 15000x*2 - 48x + 570570 Differentiate 1851285dt - 2d + 25599367t - 1 wrt d. 1851285t - 2 Find the third derivative of -16592290t*3 - 858837t*2 + 12. -99553740 What is the second derivative of -13088z*3 + 5544z*2 + 385439212z wrt z? -78528z + 11088 What is the derivative of 5541ht3 + 3064ht2 + 98t*3 - 2t*2 + 262851t wrt h? 5541t3 + 3064t*2 Differentiate 221u*2 + 8730u - 71166251 with respect to u. 442u + 8730 What is the second derivative of -5367962j*2q*2 - 5jq - 4j + 1403q2 + 3 wrt j? -10735924q*2 What is the second derivative of -5hz2 + 213h + 78327946z2 - 2213741z wrt z? -10h + 156655892 Find the first derivative of 496157d*2h*2 + 2dh2 + 3d + 81h2 + 8h + 1391 wrt d. 992314dh*2 + 2h**2 + 3 What is the f	{ "pile_set_name": "DM Mathematics" }
is next in -10, -33, -74, -133, -210, -305? -418 What comes next: 680, 682, 684, 686, 688? 690 What comes next: 76, 113, 148, 181? 212 What is next in -47, -78, -129, -200, -291? -402 What comes next: 20, 35, 60, 95, 140? 195 What is the next term in 183, 186, 189? 192 What comes next: -77, -176, -275, -374, -473? -572 What is the next term in 214, 259, 304, 349, 394? 439 What is the next term in 1219, 1221, 1223, 1225? 1227 What comes next: -64, -130, -194, -256, -316, -374? -430 What comes next: 11, 18, 27, 38? 51 What is next in -75, -133, -203, -291, -403? -545 What is next in 139, 251, 363? 475 What is next in -638, -1279, -1920, -2561, -3202? -3843 What is next in 2, -2, -2, 2? 10 What comes next: 149, 289, 429, 569, 709, 849? 989 What is next in 48, 116, 198, 282, 356, 408, 426, 398? 312 What comes next: -530, -1058, -1586, -2114, -2642, -3170? -3698 What is the next term in -250, -989, -2220, -3943, -6158? -8865 What is the next term in 12, 45, 114, 231, 408? 657 What is next in 127, 470, 811, 1150? 1487 What comes next: 23, 86, 177, 290, 419? 558 What is next in 0, -35, -130, -315, -620, -1075? -1710 What is the next term in -73, -76, -87, -112, -157, -228? -331 What is the next term in 124, 261, 398, 535, 672, 809? 946 What is next in 266, 506, 736, 950, 1142, 1306? 1436 What comes next: -162, -160, -158, -156? -154 What is the next term in 47, 122, 197, 272, 347, 422? 497 What is the next term in -2, 11, 36, 79, 146, 243? 376 What is the next term in -3703, -3713, -3735, -3775, -3839, -3933, -4063? -4235 What comes next: -745, -752, -759, -766? -773 What comes next: -69, -304, -693, -1236? -1933 What is the next term in 274, 288, 302, 316, 330? 344 What comes next: 208, 418, 628, 838, 1048? 1258 What is the next term in -3345, -3350, -3359, -3372, -3389, -3410? -3435 What is next in 426, 854, 1282, 1710, 2138, 2566? 2994 What comes next: 89, 109, 141, 191, 265? 369 What is the next term in -51, -128, -205? -282 What is the next term in -19, -5, 21, 65, 133, 231? 365 What comes next: 5, 22, 51, 98, 169, 270? 407 What is the next term in -13, -36, -73, -130, -213, -328, -481? -678 What is the next term in -134, -129, -126, -125? -126 What is next in 202, 405, 608? 811 What is next in -9, -8, -7? -6 What comes next: 15, 9, 3, -3? -9 What comes next: -1378, -1367, -1340, -1291, -1214, -1103? -952 What comes next: 1028, 2057, 3086, 4115, 5144, 6173? 7202 What is the next term in 56, 113, 168, 221, 272? 321 What is next in 98, 31, -80, -235, -434? -677 What comes next: 67, 68, 69, 70, 71, 72? 73 What is the next term in 14168, 28337, 42506? 56675 What is the next term in 2390, 4779, 7168, 9557, 11946? 14335 What is the next term in 13851, 13852, 13853? 13854 What is next in -5, 0, 3, 4? 3 What comes next: 62, 128, 208, 308, 434, 592? 788 What is the next term in 3, -47, -129, -243, -389, -567, -777? -1019 What is next in 7878, 7866, 7842, 7800, 7734? 7638 What is the next term in 27, 44, 55, 60, 59, 52, 39? 20 What is the next term in 4539, 4528, 4515, 4500, 4483, 4464, 4443? 4420 What is next in -5385, -5366, -5329, -5268, -5177, -5050, -4881? -4664 What is next in 137, 276, 415, 554, 693, 832? 971 What is the next term in -76, -149, -222, -295, -368, -441? -514 What is the next term in -19, -20, -19, -16, -11, -4? 5 What comes next: 32, 52, 96, 176, 304? 492 What is next in -111, -190, -269, -348, -427? -506 What is the next term in -20, -59, -188, -461, -932, -1655? -2684 What comes next: 94, 112, 130, 148, 166, 184? 202 What comes next: 22, 45, 66, 85? 102 What comes next: -19, -29, -29, -19, 1, 31? 71 What is the next term in 45, 62, 91, 132, 185, 250? 327 What is the next term in 158, 1271, 4302, 10211, 19958, 34503, 54806? 81827 What is the next term in 191, 216, 239, 260, 279, 296? 311 What is the next term in -2, 1, 14, 43, 94, 173? 286 What is next in -26, -60, -102, -146, -186? -216 What is next in -161, -611, -1351, -2375, -3677, -5251? -7091 What is next in -38, -16, 24, 88, 182, 312? 484 What is next in -99, -398, -889, -1566, -2423, -3454, -4653? -6014 What is the next term in 203, 429, 655, 881? 1107 What comes next: -252, -498, -744, -990, -1236, -1482? -1728 What comes next: 7302, 7299, 7294, 7287, 7278, 7267? 7254 What comes next: -63, -57, -47, -33, -15, 7? 33 What is the next term in -1699, -1697, -1695, -1693? -1691 What comes next: -449, -457, -471, -491, -517, -549, -587? -631 What is the next term in 1538, 1544, 1552, 1562, 1574, 1588? 1604 What comes next: -12, -25, -36, -45, -52? -57 What is next in 144, 146, 148, 150, 152, 154? 156 What comes next: -88, -81, -72, -61, -48, -33? -16 What is the next term in 87, 188, 289, 390, 491? 592 What is the next term in -1469, -1470, -1471, -1472, -1473, -1474? -1475 What is next in -37, -333, -1179, -2863, -5673? -9897 What comes next: -168, -339, -510? -681 What comes next: -54, -118, -266, -540, -982, -1634, -2538? -3736 What is the next term in 54, 95, 136, 177, 218, 259? 300 What is the next term in -54, -118, -190, -270, -358, -454? -558 What is the next term in -58, -75, -82, -73, -42, 17, 110? 243 What is the next term in 20, 92, 212, 380, 596, 860? 1172 What is next in 186, 197, 224, 273, 350, 461, 612? 809 What is next in -136, -146, -170, -214, -284? -386 What comes next: -26, -67, -122, -191, -274, -371? -482 What is next in -109, -87, -51, -1, 63, 141, 233? 339 What comes next: 5, -14, -45, -88, -143, -210, -289? -380 What is the next term in -300, -595, -884, -1167, -1444, -1715? -1980 What is the next term in 151, 154, 157, 160? 163 What comes next: -339, -331, -315, -291, -259, -219, -171? -115 What comes next: 18, 38, 58, 78, 98? 118 What is next in -29, -208, -513, -950, -1525, -2244, -3113, -4138? -5325 What is next in -6, 3, 38, 111, 234, 419, 678, 1023? 1466 What comes next: 1930, 1923, 1912, 1897, 1878, 1855? 1828 What is next in -196, -397, -596, -793, -988, -1181, -1372? -1561 What comes next: 1130, 2252, 3374, 4496? 5618 What is the next term in -110, -104, -98, -92? -86 What comes next: -51, -71, -105, -159, -239, -351, -501? -695 What is next in -79, -89, -107, -139, -191, -269? -379 What is the next term in 32, 21, 10? -1 What is next in 139, 125, 111, 97? 83 What is the next term in -7, 2, 11, 20, 29, 38? 47 What is next in 24, 58, 114, 192, 292, 414, 558? 724 What is next in -63, -124, -185? -246 What comes next: 95, 374, 841, 1496, 2339? 3370 What comes next: 9, -7, -39, -93, -175, -291? -447 What is the next term in -1091, -1088, -1083, -1076? -1067 What is the next term in 47, 95, 143, 191, 239? 287 What is next in -21827, -21825, -21823? -21821 What is the next term in -64, -281, -648, -1165? -1832 What comes next: 18, 37, 56, 75, 94, 113? 132 What is the next term in 445, 920, 1427, 1960, 2513, 3080, 3655, 4232? 4805 What is next in 17, 18, 19, 20? 21 What is next in -124, -100, -62, -10, 56? 136 What comes next: -166, -330, -494, -658, -822, -986? -1150 What is the next term in -28, -26, -24, -22? -20 What is the next term in 244, 491, 738? 985 What comes next: -97, -411, -945, -1705, -2697? -3927 What comes next: 1167, 1165, 1161, 1155, 1147, 1137, 1125? 1111 What comes next: 25, 27, 31, 37? 45 What is next in -11, 23, 103, 247, 473? 799 What comes next: 7, -10, -39, -80? -133 What is next in 27, 38, 55, 78? 107 What is next in -6383, -6382, -6381, -6380, -6379, -6378? -6377 What is next in 23, 82, 179, 314, 487? 698 What is next in 136, 230, 324, 418, 512, 606? 700 What comes next: -816, -1634, -2452, -3270, -4088? -4906 What is the next term in -974, -1950, -2928, -3908, -4890? -5874 What comes next: 9, 18, 21, 12, -15? -66 What is next in 22, 31, 38, 43, 46, 47? 46 What comes next: -45, -61, -73, -75, -61, -25, 39, 137? 275 What is next in 140, 285, 436, 593, 756, 925, 1100? 1281 What is next in -270, -1047, -2338, -4137, -6438, -9235, -12522, -16293? -20542 What is the next term in -138, -140, -140, -138, -134, -128, -120? -110 What is the next term in -8, -33, -94, -209, -396, -673, -1058, -1569? -2224 What is next in -69, -132, -195? -258 What is the next term in -2289, -2308, -2353, -2436, -2569, -2764, -3033, -3388? -3841 What comes next: -776, -782, -790, -800, -812, -826? -842 What is the next term in -664, -669, -674, -	{ "pile_set_name": "DM Mathematics" }
+ 57t + 352, -12r - t - 4 = -13r for r. -2 Solve 3k = 89a - 220, -3932k + 3927k - 62 = 4a for k. -14 Solve 70w + 40803 = -5m + 41193, 2m - w - 11 = 0 for m. 8 Solve 80i + 272 = 3y - 7y, 0i - 2y + 44 = -5i for i. -4 Solve 7r + 5t - 5 + 0 = 1, -9r + 4t - 3t + 24 = -2r for r. 3 Solve -4n - 20z = -32, n - 4n + 14z + 22z - 38 = 20z for n. -2 Solve -8j - 2i = 9 - 3, 3j - 6i + 14 + 22 = -0i for j. -2 Solve -2c - 11y = 27, 5c + 36 = -2y + 37 + 59 for c. 14 Solve 0 = 3p + 4h - 86, 7p - 8p - 7004h + 42 = -7002h for p. 2 Solve 3036h + 28 = 3032h - 3j, -16 = 4j for h. -4 Solve 16y - 12y - 274d + 137d = -133d + 24, 0 = -5d for y. 6 Solve -4d = -6t - 10, -7642 = 3d - 7672 for t. 5 Solve 0 = 2w - 2l + 6, 0 = -w + 6545l - 6542l - 9 for w. 0 Solve 9 + 31 = 14j + 5c + 13, 2j - 4c - 18 = 0 for j. 3 Solve 5p + 29 = -0g - 4g, 39p - 453g = -456g - 198 for p. -5 Solve -3l + 61 = 2156w - 2160w, -74w = 5l - 263 for l. 23 Solve -3j + 16x + 265 = 1010 + 288, 5j + x + 528 = 577 for j. -3 Solve 37385 = b + 3l + 37377, 53b + 391 = 4l for b. -7 Solve -4z = -5w - 42, 714z = 717z + 6w - 12 for z. 8 Solve -20o - 5o = 0, 3u - 2u - 9o = -27o + 4 - 0 for u. 4 Solve 7131 - 7116 = 5z, -29r - z - 142 = 0 for r. -5 Solve 4q + 96 = 24h, 141h + 2q = 136h + 20q + 329 for h. 1 Solve -2m = -8, -8m + 12m + 6m + 36 = 5j - 12 - 112 for j. 40 Solve 5b - 22j = -453 + 389, 4b + 116 = -4j for b. -26 Solve 29v - k + 2k + 238 - 343 = 0, k + 0k - 18 = 0 for v. 3 Solve -168g + 16 = 2y - 167g, -6g + 40 = 5y for y. 8 Solve 257y + 12 = 260y, -5y - 91 = 3r for r. -37 Solve 164 = 2n - 3j, -588j + 289j - 83 = -n - 297j for n. 79 Solve 0 = 2w - 104h - 2808, -2w - 48 = -5w + 5h + 36 + 51 for w. 0 Solve -6f - 4o + 26 = 0, f - 17 = 408854o - 408858o - 6 for f. 3 Solve 3h + 4c = c, 0h = h + 15c - 8c - 10c for h. 0 Solve 69 = -3z, -3r - 39385z + 39381z - 101 = 0 for r. -3 Solve -i + 17 = 3r, -1864r = -1893r - 5i + 155 for r. 5 Solve -2z + 4c = -16, -z - 80c + 161c + 38 = 85c for z. 18 Solve -4m - 4l + 12 = -0l, 0 = 17l - 4l - 9l for m. 3 Solve 0 = -s - 248485a + 248481a - 21, 0 = -3s - 4a - 23 for s. -1 Solve 96q - 2h = 252, -108q + 110q + 190 = 3h for q. 4 Solve 2n - 24 = -3d + 26 - 99, d = -2n - 15 for n. 1 Solve 4c - 22 = -27u + 5c + 90, -3c = 12 for u. 4 Solve -4a + 5i = -112, 83 = a - 3912i + 3908i for a. 3 Solve -22 = 2l + 2x, -4l + 2x = x - 73 + 106 - 69 for l. 5 Solve -13y = 80y - 54c + 52c + 245 + 232, 5y - 5c = -55 for y. -5 Solve -23 = -4w + 3z + 14, -z + 793 - 413 = -3w + 404 for w. 7 Solve 2y - 10 = 0, 0q = -5q + q + q + 135y - 798 for q. -41 Solve f + 0f = -o - 48, 26 + 120 = 5f - 2o + 22 for f. 4 Solve -1922 = 2j - 3v - 1905, -35j - 241 = 4v for j. -7 Solve -2u + 6q = q - 53, 5u + 498 = 65u + 6q for u. 9 Solve -9x + 301 = 5q, 94x - 68 - 72 = 4q + 90x for q. -1 Solve 4t + 1027 = 3n + 995, 0t - 6t = n + 48 for t. -8 Solve -163u + 4c - 859 = 0, u + 653c = 1288c - 636c + 6 for u. -5 Solve 0 = -8a - 4472d + 4474d + 6 + 20, -5a + 18 = -d for a. 5 Solve 2y - 18 = o, 2y - o + o - 294 = -3y - o - 228 for y. 12 Solve 3n = 2t + 32, 6 + 4 = 81t - 79t + 18n for t. -13 Solve 10i - 55 = 5k, -3i - 1161k + 1172k = -7 for i. 6 Solve -3b + 30q - 195 = 0, 27q - 110 = 7b + 26q for b. -15 Solve 10203r - 2q = 10205r + 44, 3q = -12r - 246 for r. -20 Solve 5x = 5q + 175, 4x - 185096q + 185093q = 135 for x. 30 Solve 4a - 4i + 11422 = 11486, 4a + 2i = 70 for a. 17 Solve y + 6 = 4s, 18s - 1 = -248y + 250y + 21s for y. -2 Solve -5k - 7z - 31 = 0, 787z - 790z = -18k - 168 for k. -9 Solve 0 = -5h - 15, -18d - h = 27d - 40d - 67 for d. 14 Solve 191l - 11o + 542 = -3333, -4l - 3o = 65 for l. -20 Solve -2 = -2t - 41v + 56v, 5v = 5t - 4 - 66 for t. 16 Solve 41925v - 41926v = -y, -104y = -3v for v. 0 Solve -5h + 13r = 82, -2h + r + 357 = 2r + 365 for h. -6 Solve 8q + 4n - 2n = 22, 35q - 30q = -4n for q. 4 Solve -m - 3l = -3m + 228, -5l = 12412m - 12416m + 378 for m. -3 Solve 3w + 4m = -129, -3w + 2w + 200 = -6w - 5m + 45 for w. 5 Solve -2q - 2 = 0, -15q - 11 - 5 = 4a - 12q + 3 for a. -4 Solve 0 = 4j - 3q - 99, -4j + j - q - 89 + 56 = 0 for j. 0 Solve 6895i - 6894i + 171 = 5x, 3x = -2i + 100 for x. 34 Solve -p = 3y, 914y - 918y - 1 = p for p. 3 Solve i - 23192h = 3i - 23197h + 4, 26i - 4h + 42 = -132 for i. -7 Solve -4y + 107 = 4i + 499, 7i = -5y + 9y - i - 724 for y. -5 Solve 3x + 4l + 122661 = 122692, -5l + 20 = 0 for x. 5 Solve 0 = -2o - 5c + 497 - 431, 0 = -4o + 3c - 24 for o. 3 Solve 36 = -3f - 0f + 4o, 61f + 16o - 364 = -10o + 16o for f. 4 Solve -6q - 1 - 4 = -5q, -5f - 27q = 161 + 4 for f. -6 Solve 8215 = 4j + 3z + 8312, 2j + 62 = -2z for j. -4 Solve 14b - 12b = -2g - 10, -2g + 4g = -4b - 5g - 26 for b. -3 Solve -b = -0b + 34l + 172, -23 = 4b + 59l - 56l for b. -2 Solve -61i - 19i - 3n = 12, -3i = -2n - 2233 + 2225 for i. 0 Solve 4m + 5s - 6 = 3m, -3s + 30673 = 2m + 30682 for m. -9 Solve -4p + 41 = -4d + d + 32, 1 = -5d + 2p for d. 1 Solve -4m - 2f = -40, 18f - 279 + 183 = 14f for m. -2 Solve -2r = 435p - 438p - 86, 4r = -5p - 180 for p. -32 Solve 116j - 2k = 231j - 117j, -2k = -8j - 30 + 6 for j. -4 Solve 5l - 16 + 36 = -45n, 4n - 12 = -7l + 10l for n. 0 Solve 0 = -3b - 2o + 33, 3b + 7704o = 7709o - 6 - 3 for b. 7 Solve -28d + 4w = -1308, 0d + 2w = 2d - 0 - 90 for d. 47 Solve 2j - 22 = 4n, 40 = -1351209n + 1351219n for j. 19 Solve 4y - 5w + 97 = 0, 5y - 2w + 39 = -3y - 2y - 151 for y. -18 Solve -2z = -7w - 64, -2z - 525 + 473 = -5z + 5w for z. 4 Solve 4t - 44v + 1687 = 1939, -2t + 3v = -31 for t. 8 Solve 10x - 63 = -v, -10321v - 27 = -4x - 10322v for x. 6 Solve 4h + 52 - 15 - 5 = -2q - 38, 14q + 3h + 115 = 0 for q. -5 Solve 3n + 1 = 7m, -5m - 16 = -2639n + 2635n for m. 4 Solve 5h = 11695g - 11690g - 95, -3g = 4h - 92 for g. 24 Solve -117451z - 2w - 258 = -117459z, -5z = 4w - 177 for z. 33 Solve -2u = 143v + 564, -5u = 3v - 0v + 108 - 116 for v. -4 Solve 11x + 11h + 77 = 0, -210x - 5h - 34 = -206x for x. -1 Solve 333v = 2t + 337v - 154, 3t - 108 = -3v for t. -5 Solve 2j + 283 = 2y + 608 - 293, 2y = 142j - 2132 for j. 15 Solve -175b + 42n - 40n = 1577, 4b + 4n = -b - 41 for b. -9 Solve -2s - 5a = 153, 132a - 146a = 4s + 294 for s. -84 Solve 516 = -92m - 4o, 558291m + o + 29 = 558288m for m. -5 Solve g = -4f - 12, -19852f - 1 + 17 = -19851f + 5g for f. -4 Solve 8q - d = -16, -2q + 85d - 82d = 2q + 88 for q. 2 Solve 6m + 62h + 4h = 759 - 555, -7m + 4h = -76 for m. 12 Solve -474q + 1 = -471q - g, 13g + 4 = 3q - 45 for q. -1 Solve -59 = -5v + 5d - 19, -1273v + 1276v + 3d = -30 for v. -1 Solve -k + 17 = 5y - 4k, -7y + k + 60 - 17 = 32 for y. 1 Solve -q = 5a + 32, 5a + 10 - 83 = 11q + 39 for a. -4 Solve -w = -12d - 17, 6d + 21 = -1035w + 1038w for w. 5 Solve 4q - 195 = -7m, 6q - 2517 = 3m - 2292 for m. 5 Solve 501 = -71s - 2g, 975s - 973s + 5g = -24 for s. -7 Solve 304618p - r = 304614p + 41, -2r - 77 = -3p for p. 1 Solve 13v - 11 + 25 = -3s + 107, 2s = 9v - 44 for v. 6 Solve 0 = -2c + 20i + 86, 0 = -c + 156i - 161i - 17 for c. 3 Solve 0 = i + 5u - 7, -232i + 0u - 6u + 35 = -227i for i. 7 Solve 12 = -4y, -49366w + 3y = -49370w + 7 for w. 4 Solve -18 = 17a - 23a - i - 3i, -29a + i = -148 for a. 5 Solve 6 = -360n + 365n - 4c, 0 = 3n - 8n + 2c - 2 for n. -2 Solve 2r + 248007f = 248004f + 25, 3r - 2f = 5 for r. 5 Solve -2q + 18 = -5a, 6a - 10a + 3q - 29 + 9 = 0 for a. -2 Solve -1503v - 7 = z - 1501v, 0 = 96z + 2v + 1432 for z. -15 Solve w - 6m + 20 + 1 = -3m, 4w + 100 = 4m for w. -27 Solve i + 10 = 3c - 20, 4c = 5i + 18 + 22 for i. 0 Solve -4z - 72i = -69i - 115, -5z = -3z - 18i + 586 for z. 4 Solve 2n = 3b + 6 - 0, 54n = 1459b - 1456b + 51n + 6 for b. -2 Solve 2f - 3c + 34 = 0, -45 - 45 = -10781f + 10786f - 10c for f. -14 Solve 3a + 95 = -6*n	{ "pile_set_name": "DM Mathematics" }
+ 3g - 18 = -3o. Let u(z) = -z*2 + 9z + 4. What is the smallest common multiple of 6 and u(o)? 66 Suppose -3t - 15 = 0, -2q + 41 = -2t - 25. Calculate the smallest common multiple of 18 and q. 252 Let n = -19411/2210 - 70/221. Calculate the common denominator of -27/43 and n. 430 Suppose 0 = 5c + r + 4, 5 - 13 = 5c - 3r. Calculate the smallest common multiple of (-1 + c)(-44)/8 and 9. 99 Let o(i) = -i - 1. Let w(q) = 25q + 5. Let x(u) = 5o(u) + w(u). Let l be x(-1). Calculate the least common multiple of l/6-13 and 2. 10 Let z = 53791/20 - 2686. Calculate the common denominator of 1/34 and z. 340 Suppose -3z + 762 = 2a, a = -3z - z + 391. Let c = -2615/7 + a. Suppose o + 2v = 46, -2o + 2v = -36 - 50. Find the common denominator of o and c. 7 What is the common denominator of 83/10 and (765/126 + -6)/((-5)/118)? 70 Let z(u) = -u3 + 2u*2 + u. Let b be z(-1). What is the least common multiple of (-18)/(1/((-1)/b)) and 4/(-5)10/(-4)? 18 Let j = 10 + -4. Calculate the least common multiple of 3 and j. 6 Let b = -518/13 - -2883/104. What is the common denominator of -71/8 and b? 8 Let l = -26 - -38. What is the lowest common multiple of 80 and l? 240 Let p = -12 + 26. What is the common denominator of (-4)/((-160)/p) + 2 and -73/18? 180 Suppose 7v = 4v + 12792. Suppose -v = 5o + 9206. Let p = -26879/10 - o. What is the common denominator of -107/14 and p? 70 Find the common denominator of (0 - 3) + -1114/(-22) and 93/8. 88 Let j = -471251/52950 - 2/26475. What is the common denominator of j and 17/6? 30 Calculate the common denominator of 28/238 - 1435/(-374) and 57/58. 638 Let z = 4251 - 7524. Let r = z + 32777/10. Find the common denominator of -11 - 130/16 and r. 40 Calculate the common denominator of 2/9 - 41/6 and -113/20. 180 Let t = -37 - -39. Calculate the least common multiple of t and 10. 10 Suppose 0 = -t + 3q + 17, -t + 2q = -5t - 2. Let z = 11 - -7. Calculate the least common multiple of t and z. 18 Let m = 1961 - 21551/11. Find the common denominator of (-1)/(-4) - (0 + 2) and m. 44 Let a(z) = 2z2 - 4z - 4. Calculate the smallest common multiple of 7 and a(-2). 84 Let k be 4/14 - (-4)/(-14). Suppose -y - 3y + 8 = k. What is the smallest common multiple of 9 and y? 18 Let g be 37/4 + (-1)/4. Let d be (-1)/((-15)/g + 2). What is the lowest common multiple of (-3)/(((-9)/(-2))/d) and 4? 4 Find the common denominator of 925/10(-2)/40 and 101/6. 24 Calculate the common denominator of (2/30)/(4/74) and (-62)/(-6)(-3)/(-20). 60 Let d = 9 - 6. Suppose -da + 8 = -10. What is the smallest common multiple of a and 7? 42 Suppose -z = -4l + 13, 6l - 21 = 3l - 3z. Calculate the least common multiple of l and 2. 4 Let p = -4051/8 + 508. Let q be ((-2)/(-3))/(1/(-3)). Calculate the common denominator of q + 1 - 249/(-18) and p. 24 Let b(d) = -d3 + d2 + d + 5. Let w be b(0). Suppose 0 = -wu + 3u. Find the common denominator of -65/14 and u + (-30)/(-32) + -1. 112 Find the common denominator of (-4)/5 - 332/110 and 11/5. 55 Let h(f) = f*3 + 6f*2 + 2f - 1. Let g be h(-6). Let b = g - -4. Let r(q) = q*3 + 9q*2 + q + 13. What is the smallest common multiple of r(b) and 8? 8 Let p(g) be the third derivative of -5g4/12 - g3/3 - 2g2. Calculate the smallest common multiple of p(-2) and (-1 + 13)/(-3 + 4). 36 Let m = -40505/6 + 6772. Calculate the common denominator of m and 140/(-30)21/(-10). 30 Suppose d - 8 = 51. Find the common denominator of 2 + 1 + d/2 and (-9)/(-6) - ((-1275)/42)/5. 14 Find the common denominator of 71/18 and (-6)/105(-230)/8. 126 Let i = 1844 + -18461/10. What is the common denominator of i and 17/18? 90 Find the common denominator of 85/8 and 3 + 1/(60/(-129)) + 3. 40 Let a = 33147/8 - 4138. Find the common denominator of a and 37/28. 56 Let s = -2 + 6. Suppose -sf + 5w + 1 + 26 = 0, -f + 2w = -6. Calculate the least common multiple of 11 and f. 88 Suppose 10u - 15 = 5u. What is the smallest common multiple of u and 4? 12 Let p = 340959/56 + -6088. What is the common denominator of p and 43/22? 616 Suppose -c - 4c = -2p + 18, 0 = 5c + 10. What is the least common multiple of p and 1/(182/35 - 5)? 20 Let c = 22729/6 + -3801. Find the common denominator of c and 29/8. 24 Find the common denominator of -6/5 and (-2)/24(259 + -9). 30 Suppose -4p = -7p - 126. Find the common denominator of -69/10 and p. 10 Let d = -125/369 + -32995/16974. Find the common denominator of d and -43/24. 552 Let q(w) = w*2 - 2w + 3. Suppose 5t = -25, 3z - t + 9 = 29. Suppose 0 = o - zo + 20. Calculate the smallest common multiple of 12 and q(o). 36 Suppose -5b = n - b + 11, -3n + 9 = -2b. Let t = 8 - n. Calculate the least common multiple of t and 9. 63 Let s = 795 - 2981. Let g = 15276/7 + s. Calculate the common denominator of 0 + 0 + 146/8 and g. 28 Suppose -2v - 3v - 40 = 0. Let r = 6 + -11. Let w = r - v. Calculate the smallest common multiple of w and 10. 30 Suppose 0n - 5n = -25. Calculate the smallest common multiple of (-16)/(-20)(-5)/(-2) and n. 10 Let r be 9/(-1141)616258/636. Let p = -1/8639 - r. Let l = 23371/522 + -1126/29. Calculate the common denominator of l and p. 126 Let m(v) = -v*2 - 7v - 15. Let k be m(-8). Calculate the common denominator of 17/2 and (15/21)/(-5)k. 14 Suppose 5m - 3m = 4. Find the common denominator of 67/2 and 63/(-30)15/m. 4 Let h be (-53805593)/5268 + (-1)/3. Let a = -10214 - h. Let u = a - 11407/12292. Calculate the common denominator of u and 43/4. 28 Let v = -9911 + 158509/16. What is the common denominator of v and -49/118? 944 Suppose -2t + t + 3 = 0. Let o be (7 - -1) + (t - 1). Suppose m - 3m = -o. What is the lowest common multiple of 2 and m? 10 Suppose -5a = -3x, -5x + 22 = -0a - a. Let r = 0 - -2. Suppose -p = g - 6g + 4, rp - xg = 2. What is the least common multiple of p and 7? 42 Suppose n = 4n + 33. Let a = n - -5. What is the lowest common multiple of 6 and (8/a)/((-16)/24)? 6 Suppose -l = -2l + 4x - 14, -4l - 11 = -x. What is the smallest common multiple of (5 + -13)2/l and 4? 8 Let m = -7/6 - -7/18. Let o = -18763/6 - -3138. Find the common denominator of m and o. 18 Let z = 347089/22 - 15774. Suppose -3i + 0i = 594. What is the common denominator of (i/8)/(6 - 1) and z? 220 Let p = -7655 - -122433/16. Find the common denominator of 107/14 and p. 112 Let q be 16/(-10)25/(-10). Let x = -2 + q. What is the least common multiple of (-33)/(-4) + x/(-8) and 12? 24 Let r = -57179/20 + 2864. Find the common denominator of -59/8 and r. 40 Suppose 4n = n + 12. Let h(c) = -c*3 + 5c*2 - 2. Calculate the smallest common multiple of 22 and h(n). 154 Let k(y) = 2y2 + y. Let m(x) = x3 + 2x2 - 4x. Suppose -5j = 1 + 14. Calculate the least common multiple of m(j) and k(-1). 3 Let k(q) = q - 1. Let x be k(1). Let d = 10 + x. Calculate the lowest common multiple of d and 7. 70 Let d(g) = 9g*2 - 6g - 11. Let p(y) = 14y2 - 9y - 17. Let c(w) = 8d(w) - 5p(w). What is the lowest common multiple of c(-2) and (-1)/(-12/12)? 66 Let k(t) = -t - 15. What is the smallest common multiple of 9 and k(-19)? 36 Suppose -5l + 4h = -42, 2l = h - 5h. Calculate the smallest common multiple of 9 and l. 18 Let d = -11 + 23. Suppose -1 - 17 = u. What is the lowest common multiple of d and (-4)/u - 88/(-9)? 60 Suppose 6b + 40 = 4b. Let v = b + 24. Calculate the lowest common multiple of 11 and v. 44 Let o(y) = 2y - 4. Calculate the lowest common multiple of (0 - (0 - 2)) + 8 and o(4). 20 Let j be 2/4 - (-6)/4. Let u(w) = 8 - 5w2 - jw + 4w2 + 9w. What is the least common multiple of u(6) and 18? 126 Suppose c = 3z + 38, 3z - 48 = -c + 20. Let l be (c/(-30))/((-4)/10). Let u = l - 7. What is the common denominator of u and -77/18? 36 Suppose 3 = 5w - 7. Let s = 0 + w. What is the least common multiple of 10 and s? 10 Let g = 148/15 + -4579/420. Calculate the common denominator of g and 67/48. 336 Suppose 2a + 150 = 3x, x - 153 = -2x + a. Calculate the lowest common multiple of x and 12. 156 Suppose -2r + 15 = -3r - 3t, -2r = 5t + 27. Calculate the common denominator of (18/(-21))/(4/22) and (-429)/(-135) - r/10. 63 Suppose 2t - 5 = -1. Calculate the common denominator of 1/t*52	{ "pile_set_name": "DM Mathematics" }
the prime factors of 288392. 2, 13, 47, 59 What are the prime factors of 11083496? 2, 1385437 List the prime factors of 3857835. 3, 5, 257189 List the prime factors of 89705. 5, 7, 11, 233 List the prime factors of 245067. 3, 81689 What are the prime factors of 19449? 3, 2161 List the prime factors of 27429. 3, 41, 223 List the prime factors of 2713162. 2, 19, 71399 List the prime factors of 34351. 34351 What are the prime factors of 4431976? 2, 73, 7589 List the prime factors of 4885089. 3, 11, 179, 827 What are the prime factors of 7425948? 2, 3, 137, 4517 What are the prime factors of 238700? 2, 5, 7, 11, 31 List the prime factors of 4463529. 3, 7, 43, 4943 What are the prime factors of 133930? 2, 5, 59, 227 List the prime factors of 6404409. 3, 11, 5881 List the prime factors of 1546705. 5, 83, 3727 What are the prime factors of 1348? 2, 337 List the prime factors of 94112. 2, 17, 173 What are the prime factors of 1986747? 3, 7, 89, 1063 What are the prime factors of 6288123? 3, 751, 2791 What are the prime factors of 288431? 11, 13, 2017 List the prime factors of 4462590. 2, 3, 5, 11, 13523 List the prime factors of 431535. 3, 5, 13, 2213 What are the prime factors of 2257042? 2, 1128521 What are the prime factors of 160713? 3, 7, 2551 What are the prime factors of 21816983? 439, 49697 What are the prime factors of 793016? 2, 7, 17 What are the prime factors of 469149? 3, 17, 9199 List the prime factors of 638079. 3, 13, 16361 What are the prime factors of 28064790? 2, 3, 5, 13, 17, 83 What are the prime factors of 570993? 3, 190331 List the prime factors of 307242. 2, 3, 13, 101 List the prime factors of 2331628. 2, 13, 44839 What are the prime factors of 364231? 7, 61, 853 List the prime factors of 4368774. 2, 3, 728129 List the prime factors of 2942849. 7, 13, 73, 443 What are the prime factors of 5320222? 2, 23, 115657 List the prime factors of 23089841. 229, 100829 List the prime factors of 3948675. 3, 5, 17, 19, 163 List the prime factors of 1277349. 3, 425783 List the prime factors of 130586. 2, 65293 List the prime factors of 9904547. 9904547 What are the prime factors of 1236508? 2, 7, 13, 43, 79 What are the prime factors of 967911? 3, 7, 46091 List the prime factors of 2361914. 2, 1180957 List the prime factors of 1173628. 2, 59, 4973 List the prime factors of 136392. 2, 3, 5683 List the prime factors of 652665. 3, 5, 13, 3347 List the prime factors of 21582718. 2, 10791359 List the prime factors of 17424014. 2, 17, 643, 797 What are the prime factors of 178980? 2, 3, 5, 19, 157 What are the prime factors of 345178? 2, 172589 What are the prime factors of 1023639? 3, 83, 4111 What are the prime factors of 180918? 2, 3, 19, 23 List the prime factors of 154319. 11, 14029 What are the prime factors of 531698? 2, 83, 3203 What are the prime factors of 3265930? 2, 5, 326593 List the prime factors of 7963922. 2, 17, 29, 41, 197 List the prime factors of 13030687. 17, 766511 What are the prime factors of 2293708? 2, 17, 89, 379 List the prime factors of 2771811. 3, 7, 43997 What are the prime factors of 150647? 7, 21521 List the prime factors of 198783. 3, 13, 1699 What are the prime factors of 86475? 3, 5, 1153 List the prime factors of 513581. 509, 1009 List the prime factors of 4330263. 3, 7, 206203 What are the prime factors of 1003106? 2, 13, 41, 941 List the prime factors of 5422693. 727, 7459 List the prime factors of 20020843. 43, 563, 827 List the prime factors of 2058095. 5, 13, 31663 List the prime factors of 1641507. 3, 7, 78167 List the prime factors of 27897. 3, 17, 547 What are the prime factors of 73768? 2, 9221 What are the prime factors of 20715? 3, 5, 1381 What are the prime factors of 68577? 3, 22859 List the prime factors of 1030010. 2, 5, 103001 List the prime factors of 2954733. 3, 984911 What are the prime factors of 27156280? 2, 5, 678907 What are the prime factors of 286736? 2, 17921 List the prime factors of 1866609. 3, 207401 What are the prime factors of 2403391? 53, 137, 331 What are the prime factors of 17509906? 2, 19, 460787 List the prime factors of 1006958. 2, 409, 1231 What are the prime factors of 562874? 2, 13, 21649 List the prime factors of 6661543. 7, 951649 What are the prime factors of 8877798? 2, 3, 493211 List the prime factors of 3432. 2, 3, 11, 13 List the prime factors of 68572. 2, 7, 31, 79 What are the prime factors of 1081275? 3, 5, 13, 1109 List the prime factors of 59159. 59159 List the prime factors of 910203. 3, 7, 89, 487 What are the prime factors of 156741? 3, 13, 4019 What are the prime factors of 757290? 2, 3, 5, 25243 List the prime factors of 382031. 13, 29387 What are the prime factors of 12451442? 2, 61, 102061 What are the prime factors of 248826? 2, 3, 113, 367 List the prime factors of 7143. 3, 2381 List the prime factors of 3498547. 13, 191, 1409 List the prime factors of 287852. 2, 71963 List the prime factors of 19435727. 19, 1022933 List the prime factors of 3920341. 829, 4729 List the prime factors of 652073. 23, 28351 List the prime factors of 207682. 2, 103841 List the prime factors of 1668689. 11, 29, 5231 What are the prime factors of 17455112? 2, 2181889 What are the prime factors of 238120? 2, 5, 5953 List the prime factors of 459712. 2, 11, 653 What are the prime factors of 331677? 3, 137, 269 What are the prime factors of 230847? 3, 76949 List the prime factors of 1767750. 2, 3, 5, 2357 List the prime factors of 450744. 2, 3, 7, 2683 What are the prime factors of 33275614? 2, 223, 74609 What are the prime factors of 14096501? 107, 131743 List the prime factors of 3198157. 79, 40483 What are the prime factors of 30925? 5, 1237 List the prime factors of 5432982. 2, 3, 905497 List the prime factors of 4023442. 2, 53, 37957 List the prime factors of 8939389. 2003, 4463 List the prime factors of 698337. 3, 31, 2503 List the prime factors of 142004. 2, 131, 271 What are the prime factors of 6394038? 2, 3, 7, 152239 List the prime factors of 2883528. 2, 3, 29, 1381 What are the prime factors of 17171488? 2, 536609 List the prime factors of 172632. 2, 3, 7193 List the prime factors of 6523662. 2, 3, 79, 13763 List the prime factors of 526343. 53, 9931 What are the prime factors of 225021? 3, 107, 701 What are the prime factors of 785319? 3, 261773 List the prime factors of 1524483. 3, 113, 1499 List the prime factors of 325943. 325943 List the prime factors of 1110159. 3, 41117 List the prime factors of 132290. 2, 5, 13229 List the prime factors of 5575242. 2, 3, 929207 What are the prime factors of 250311? 3, 83437 What are the prime factors of 329362? 2, 11, 1361 What are the prime factors of 4023663? 3, 7, 29, 6607 What are the prime factors of 1610062? 2, 805031 What are the prime factors of 141640? 2, 5, 3541 What are the prime factors of 665098? 2, 7, 47507 What are the prime factors of 767292? 2, 3, 43, 1487 What are the prime factors of 2815784? 2, 29, 53, 229 What are the prime factors of 47876? 2, 11969 List the prime factors of 38084. 2, 9521 What are the prime factors of 13252320? 2, 3, 5, 9203 List the prime factors of 4994167. 1231, 4057 List the prime factors of 25943181. 3, 11, 229, 3433 What are the prime factors of 7056945? 3, 5, 7, 43, 521 List the prime factors of 565702. 2, 282851 What are the prime factors of 92652? 2, 3, 7, 1103 What are the prime factors of 4385695? 5, 317, 2767 What are the prime factors of 11973191? 11973191 List the prime factors of 295878. 2, 3, 11, 4483 What are the prime factors of 9082224? 2, 3, 59, 1069 What are the prime factors of 289906? 2, 43, 3371 What are the prime factors of 3184008? 2, 3, 132667 What are the prime factors of 3441? 3, 31, 37 List the prime factors of 3286561. 3286561 What are the prime factors of 1380055? 5, 276011 List the prime factors of 32091106. 2, 16045553 What are the prime factors of 883951? 43, 61, 337 What are the prime factors of 237955? 5, 47591 What are the prime factors of 222356? 2, 55589 List the prime factors of 67477. 67477 What are the prime factors of 1693182? 2, 3, 59, 4783 List the prime factors of 722264. 2, 137, 659 List the prime factors of 4251728. 2, 13, 20441 List the prime factors of 514556. 2, 7, 17, 23, 47 List the prime factors of 176261. 176261 List the	{ "pile_set_name": "DM Mathematics" }
from ooooooooo. Give prob of sequence oooo. 1 Two letters picked without replacement from {a: 2, e: 5, i: 2, p: 1, l: 4}. Give prob of sequence pl. 2/91 Calculate prob of sequence qx when two letters picked without replacement from xyxrqiuq. 1/14 Calculate prob of sequence ppz when three letters picked without replacement from {p: 9, u: 2, z: 7}. 7/68 Calculate prob of sequence xyy when three letters picked without replacement from ydxydyxddy. 1/30 What is prob of sequence jne when three letters picked without replacement from {o: 4, j: 9, n: 1, e: 1, l: 3}? 1/544 Calculate prob of sequence zz when two letters picked without replacement from nnnnnznnznnn. 1/66 What is prob of sequence hs when two letters picked without replacement from {s: 2, q: 2, c: 1, h: 1, k: 1}? 1/21 Calculate prob of sequence ef when two letters picked without replacement from eff. 1/3 Three letters picked without replacement from {j: 7, i: 1, f: 6, e: 6}. What is prob of sequence fjj? 7/190 Four letters picked without replacement from {j: 4, i: 5, r: 1}. Give prob of sequence jrrj. 0 Two letters picked without replacement from ujjjjmjmuuujggjj. Give prob of sequence mm. 1/120 What is prob of sequence bt when two letters picked without replacement from {c: 5, i: 4, y: 1, b: 6, t: 4}? 6/95 Four letters picked without replacement from ewawaaaeb. Give prob of sequence eaae. 1/126 Two letters picked without replacement from {z: 5, g: 3, k: 6, e: 2, c: 2}. Give prob of sequence gk. 1/17 Two letters picked without replacement from {n: 1, e: 2, g: 2, q: 1}. Give prob of sequence ng. 1/15 What is prob of sequence lll when three letters picked without replacement from {l: 4, b: 6}? 1/30 What is prob of sequence fd when two letters picked without replacement from ssdeltfe? 1/56 What is prob of sequence mf when two letters picked without replacement from mmfe? 1/6 What is prob of sequence ytz when three letters picked without replacement from ztyvy? 1/30 Two letters picked without replacement from {d: 4, v: 1, h: 3, a: 2, i: 2}. Give prob of sequence vi. 1/66 What is prob of sequence bvvb when four letters picked without replacement from vvvvvvbvb? 1/36 Calculate prob of sequence gj when two letters picked without replacement from {g: 2, j: 1}. 1/3 Calculate prob of sequence bh when two letters picked without replacement from {k: 1, z: 1, u: 1, h: 1, b: 1}. 1/20 Four letters picked without replacement from {o: 2, t: 2, h: 1, p: 9, f: 3}. Give prob of sequence tpfo. 9/4760 Four letters picked without replacement from {w: 2, c: 2, k: 1, i: 4, v: 1, q: 5}. What is prob of sequence cqik? 1/819 Three letters picked without replacement from rsrwswwslrwssls. Give prob of sequence wwl. 4/455 What is prob of sequence qqt when three letters picked without replacement from {t: 1, q: 5, k: 1, p: 3, u: 1}? 2/99 Calculate prob of sequence pss when three letters picked without replacement from {s: 6, p: 3, k: 8}. 3/136 Three letters picked without replacement from {x: 1, u: 2, q: 1, p: 3}. Give prob of sequence qux. 1/105 Two letters picked without replacement from {m: 1, v: 1, i: 1, j: 3, a: 4, t: 2}. What is prob of sequence ji? 1/44 Four letters picked without replacement from cbbbbbcccbbbbb. Give prob of sequence bbcc. 45/1001 Three letters picked without replacement from fkkfbkkkkkokkkrkrf. Give prob of sequence rbk. 11/2448 Three letters picked without replacement from {s: 1, v: 1, k: 3, i: 8, a: 4}. What is prob of sequence aik? 2/85 Calculate prob of sequence qd when two letters picked without replacement from {l: 2, k: 2, f: 1, q: 1, d: 1, z: 2}. 1/72 Two letters picked without replacement from nbbbbbbb. What is prob of sequence bb? 3/4 Three letters picked without replacement from {x: 6, i: 3, k: 8}. Give prob of sequence kxk. 7/85 Four letters picked without replacement from {g: 4, x: 4, t: 1, k: 1}. What is prob of sequence tgxg? 1/105 Four letters picked without replacement from {u: 1, q: 1, v: 2, x: 1}. Give prob of sequence xuqv. 1/60 Two letters picked without replacement from {a: 5, i: 1, n: 3, t: 1, m: 2}. What is prob of sequence na? 5/44 Calculate prob of sequence rge when three letters picked without replacement from eeregrgr. 3/56 Calculate prob of sequence lz when two letters picked without replacement from lllzlcz. 4/21 Two letters picked without replacement from zdzlzldzzdzddz. Give prob of sequence ll. 1/91 Three letters picked without replacement from ololllllbloolbool. What is prob of sequence blo? 9/340 What is prob of sequence sqf when three letters picked without replacement from bswfq? 1/60 Four letters picked without replacement from vkkvggcgkggg. Give prob of sequence vkkk. 1/990 Calculate prob of sequence nga when three letters picked without replacement from wwwggawwwannbab. 2/455 What is prob of sequence xusp when four letters picked without replacement from tudtxsxxtdupttusdtxx? 1/3876 Calculate prob of sequence qgq when three letters picked without replacement from {g: 2, q: 8, c: 9}. 56/2907 Calculate prob of sequence nnkk when four letters picked without replacement from {n: 4, k: 3}. 3/35 Three letters picked without replacement from {c: 1, f: 4, d: 1, z: 2}. Give prob of sequence cff. 1/28 What is prob of sequence bq when two letters picked without replacement from {q: 5, v: 7, b: 3, u: 4}? 5/114 Four letters picked without replacement from ffffpphtkfttfffhf. What is prob of sequence fthf? 9/1190 Three letters picked without replacement from zlm. Give prob of sequence mlz. 1/6 Calculate prob of sequence ba when two letters picked without replacement from {a: 2, x: 2, b: 9}. 3/26 What is prob of sequence xia when three letters picked without replacement from {t: 3, b: 3, s: 5, x: 6, a: 2, i: 1}? 1/570 Three letters picked without replacement from {w: 1, k: 2}. Give prob of sequence kkw. 1/3 Three letters picked without replacement from {y: 4, w: 3, i: 2, z: 3, a: 4, m: 4}. What is prob of sequence iya? 4/855 Calculate prob of sequence mqq when three letters picked without replacement from qmm. 0 What is prob of sequence ppl when three letters picked without replacement from {t: 2, p: 1, l: 1}? 0 Three letters picked without replacement from fojogjgjjjjijgffgf. Give prob of sequence fff. 1/204 Three letters picked without replacement from {h: 2, i: 4, j: 4, v: 1, a: 2, e: 1}. What is prob of sequence iaj? 4/273 Calculate prob of sequence vlll when four letters picked without replacement from {l: 4, h: 1, j: 1, w: 1, v: 3, e: 2}. 1/165 Two letters picked without replacement from {t: 1, v: 10, d: 2, j: 2, k: 5}. What is prob of sequence tj? 1/190 Three letters picked without replacement from {p: 10, l: 1, m: 1, i: 1}. What is prob of sequence iml? 1/1716 Calculate prob of sequence wu when two letters picked without replacement from {h: 5, u: 2, w: 2}. 1/18 What is prob of sequence jdd when three letters picked without replacement from {e: 4, m: 6, j: 1, d: 4}? 2/455 Calculate prob of sequence jd when two letters picked without replacement from jdj. 1/3 Two letters picked without replacement from pwggggwrprrg. What is prob of sequence gw? 5/66 Calculate prob of sequence ff when two letters picked without replacement from {n: 1, f: 2, x: 1}. 1/6 Four letters picked without replacement from aayyayyyva. Give prob of sequence ayyv. 1/63 Calculate prob of sequence rr when two letters picked without replacement from jrraa. 1/10 Three letters picked without replacement from qffqiqgqqqifi. Give prob of sequence ifi. 3/286 Calculate prob of sequence usbs when four letters picked without replacement from bussububu. 1/126 Two letters picked without replacement from isu. What is prob of sequence su? 1/6 What is prob of sequence uagy when four letters picked without replacement from {a: 1, u: 4, y: 1, r: 1, g: 2}? 1/378 Two letters picked without replacement from aaayy. What is prob of sequence aa? 3/10 What is prob of sequence kx when two letters picked without replacement from xkx? 1/3 What is prob of sequence ukuu when four letters picked without replacement from {k: 3, o: 6, u: 4}? 3/715 Calculate prob of sequence xx when two letters picked without replacement from {x: 7}. 1 Two letters picked without replacement from {u: 9, n: 2}. What is prob of sequence un? 9/	{ "pile_set_name": "DM Mathematics" }
lacement from tsjssstjsssj. Give prob of sequence tjs. 7/220 Calculate prob of sequence jjjj when four letters picked without replacement from {j: 6, p: 2}. 3/14 Four letters picked without replacement from bvnsnbmv. Give prob of sequence mbvv. 1/420 Three letters picked without replacement from bobhm. What is prob of sequence mho? 1/60 Two letters picked without replacement from {f: 2, z: 1, r: 1, e: 1}. Give prob of sequence zr. 1/20 What is prob of sequence ii when two letters picked without replacement from {i: 10, x: 5, p: 4}? 5/19 Four letters picked without replacement from rtosrrocssscqcr. What is prob of sequence sroc? 4/1365 Calculate prob of sequence cj when two letters picked without replacement from jccj. 1/3 What is prob of sequence iiiv when four letters picked without replacement from irrvvvbviiibbvi? 5/546 Four letters picked without replacement from {q: 2, h: 4, r: 1, p: 2, f: 3}. What is prob of sequence qfrq? 1/1980 Calculate prob of sequence tt when two letters picked without replacement from oototjttoojt. 5/33 Four letters picked without replacement from {p: 1, f: 2, t: 1, x: 2, z: 2, o: 7}. What is prob of sequence fozx? 1/585 Three letters picked without replacement from {z: 2, p: 4, u: 1, k: 1, i: 1}. Give prob of sequence kpu. 1/126 Three letters picked without replacement from mzzzzzzzzmzz. What is prob of sequence mmz? 1/66 Calculate prob of sequence srws when four letters picked without replacement from ewsswwsrsxfwxswxewxe. 1/969 Three letters picked without replacement from {t: 8, h: 5}. Give prob of sequence ttt. 28/143 What is prob of sequence mm when two letters picked without replacement from {p: 1, m: 2}? 1/3 What is prob of sequence vv when two letters picked without replacement from {n: 2, k: 2, c: 3, v: 2}? 1/36 What is prob of sequence kko when three letters picked without replacement from {k: 3, o: 2}? 1/5 What is prob of sequence zg when two letters picked without replacement from bzzhhzzzzgzzz? 3/52 Three letters picked without replacement from {y: 16, o: 4}. Give prob of sequence ooo. 1/285 What is prob of sequence zg when two letters picked without replacement from {e: 1, z: 1, d: 1, g: 1, v: 5}? 1/72 Three letters picked without replacement from {x: 2, l: 3, f: 2, a: 5}. Give prob of sequence all. 1/44 Three letters picked without replacement from {v: 2, o: 6, w: 2, d: 1}. Give prob of sequence vww. 2/495 Calculate prob of sequence df when two letters picked without replacement from dfddtfqnd. 1/9 Two letters picked without replacement from yyxxyyy. Give prob of sequence xy. 5/21 Three letters picked without replacement from {n: 2, q: 3, a: 2, h: 1, f: 3, o: 1}. Give prob of sequence hno. 1/660 What is prob of sequence vv when two letters picked without replacement from {v: 7, i: 2}? 7/12 What is prob of sequence pppp when four letters picked without replacement from {p: 5, s: 1, q: 3, r: 11}? 1/969 Two letters picked without replacement from balllabalbllllllll. What is prob of sequence lb? 2/17 Four letters picked without replacement from kkiqkkqqiikkkikikqik. Give prob of sequence iiii. 1/323 Two letters picked without replacement from rerrer. Give prob of sequence rr. 2/5 Four letters picked without replacement from {d: 9, f: 3}. What is prob of sequence fddd? 7/55 What is prob of sequence vii when three letters picked without replacement from {i: 2, v: 1}? 1/3 Two letters picked without replacement from {s: 1, r: 1, i: 1, z: 1, q: 1, b: 2}. Give prob of sequence is. 1/42 What is prob of sequence iv when two letters picked without replacement from hevteeheeiehhtii? 1/80 Calculate prob of sequence ps when two letters picked without replacement from smdpppmsssssf. 3/26 What is prob of sequence bm when two letters picked without replacement from bglhllmggggglggmmmml? 1/76 Calculate prob of sequence xxj when three letters picked without replacement from jjjjxjjxjxjjjjxjjjj. 10/323 Four letters picked without replacement from {m: 9, s: 9}. Give prob of sequence sssm. 21/340 What is prob of sequence llb when three letters picked without replacement from tnllllllwnblltnwl? 3/170 What is prob of sequence qtn when three letters picked without replacement from bntqbnhbqtbbqq? 2/273 What is prob of sequence fiix when four letters picked without replacement from {i: 5, x: 2, f: 5}? 5/297 Two letters picked without replacement from xtxttxxxxxxtttttxxtt. What is prob of sequence xt? 5/19 Two letters picked without replacement from dobwzxd. What is prob of sequence dd? 1/21 Two letters picked without replacement from {c: 1, r: 4, f: 2}. What is prob of sequence cr? 2/21 Four letters picked without replacement from glxxgglgglxgl. What is prob of sequence glgg? 4/143 What is prob of sequence ujuj when four letters picked without replacement from {v: 5, j: 3, u: 6, g: 1}? 1/182 Two letters picked without replacement from rrrrrrrrr. Give prob of sequence rr. 1 Three letters picked without replacement from rrssasrssarr. What is prob of sequence ras? 5/132 What is prob of sequence aa when two letters picked without replacement from {b: 5, q: 5, a: 2}? 1/66 Four letters picked without replacement from {y: 2, n: 1, h: 8, o: 2, u: 2}. Give prob of sequence hyun. 4/4095 Calculate prob of sequence rz when two letters picked without replacement from {z: 4, r: 3, x: 1}. 3/14 What is prob of sequence ppp when three letters picked without replacement from ppppppppp? 1 Calculate prob of sequence vv when two letters picked without replacement from vvevevv. 10/21 What is prob of sequence njn when three letters picked without replacement from {x: 1, l: 2, i: 1, n: 5, j: 1}? 1/36 Two letters picked without replacement from {y: 5, q: 7}. What is prob of sequence yy? 5/33 Three letters picked without replacement from oppprpaapu. Give prob of sequence arp. 1/72 Four letters picked without replacement from wwyywywwywfwwwffww. Give prob of sequence wwff. 11/1224 What is prob of sequence slqq when four letters picked without replacement from pssslsqxpqxssx? 1/2002 Calculate prob of sequence troo when four letters picked without replacement from {r: 8, o: 4, t: 2}. 8/1001 Calculate prob of sequence hjqj when four letters picked without replacement from jqjhjqjmja. 1/126 Two letters picked without replacement from {c: 1, r: 1, e: 1, z: 1, l: 1, j: 2}. Give prob of sequence re. 1/42 What is prob of sequence is when two letters picked without replacement from {s: 2, i: 16}? 16/153 Three letters picked without replacement from {d: 2, k: 1, j: 4, o: 1, h: 3}. Give prob of sequence hoj. 2/165 Four letters picked without replacement from {x: 4, e: 6, n: 2, g: 1}. What is prob of sequence nxen? 2/715 Two letters picked without replacement from {q: 4, b: 2, c: 1, w: 1, u: 3}. What is prob of sequence uw? 3/110 Calculate prob of sequence tb when two letters picked without replacement from burrtdbbb. 1/18 What is prob of sequence rjz when three letters picked without replacement from scjcrcsrrcjjszcsscc? 1/646 What is prob of sequence hq when two letters picked without replacement from vvvkqvqkh? 1/36 What is prob of sequence vk when two letters picked without replacement from akarhachavhh? 1/132 Three letters picked without replacement from kkkekke. What is prob of sequence kek? 4/21 Calculate prob of sequence jjjj when four letters picked without replacement from jejjjjjjejjj. 14/33 Three letters picked without replacement from uooqaod. What is prob of sequence aqu? 1/210 Calculate prob of sequence su when two letters picked without replacement from ouussmssjm. 4/45 What is prob of sequence vi when two letters picked without replacement from kivxomv? 1/21 Three letters picked without replacement from otottttttttttto. Give prob of sequence oot. 12/455 Calculate prob of sequence pp when two letters picked without replacement from {i: 3, f: 4, p: 4}. 6/55 What is prob of sequence dux when three letters picked without replacement from {a: 1, u: 3, x: 1, d: 5}? 1/48 Three letters picked without replacement from {c: 4, n: 5, u: 8}. Give prob of sequence ccc. 1/170 What is prob of sequence qjvj when four letters picked without replacement from {q: 8, x: 2, v: 2, j: 6}? 1/153 Three letters picked without replacement from {j: 2, p: 2, k: 2, b: 1, u:	{ "pile_set_name": "DM Mathematics" }
368 = 34w. Sort 6, w, -18, -10 in increasing order. -18, -10, w, 6 Let n = -782 + 679. Let c = 461.7 - 565. Let r = n - c. Put 2, -4, 1/9, r in decreasing order. 2, r, 1/9, -4 Suppose -105f = -15 - 81 - 219. Sort 4, -1, f, -87 in decreasing order. 4, f, -1, -87 Let m(b) = 23b - 770. Let v be m(33). Let i(j) = -j2 - 6j + 2. Let c be i(-6). Put -0.1, 1, v, c in descending order. c, 1, -0.1, v Let a(u) = -4u2 + 2u - 1. Let l be a(1). Let c = 27 - 23. Let x be (-153)/(-9) - 9 - 7. Sort c, 3, x, l in ascending order. l, x, 3, c Let a = 529 - 528.384. Let b = -1.116 + a. Put 2/11, 4, 0, b in ascending order. b, 0, 2/11, 4 Suppose 0 = 4w - 300 - 40. Suppose -27h = 29h + 49h - 210. Sort -2, w, h in decreasing order. w, h, -2 Let o = -0.03 + 6.13. Let t = 721 + -727. Let w = o + t. Put w, -2, 3 in decreasing order. 3, w, -2 Let x = -0.3 - -0.4. Suppose 0 = 3i - b - 5, -71 = -3i + 4b - 42. Sort -0.5, i, x, 2/3. i, -0.5, x, 2/3 Let l = 11 + -16. Suppose 0 = -3n - 3d - 72, 2n - 5d - 12 = 3n. Let t = n + 30. Put t, 0, l, -3 in decreasing order. t, 0, -3, l Let h = -790 - -794. Suppose -2f + hf = -4b - 6, 3f - 5b = -20. Put f, 22, -3 in decreasing order. 22, -3, f Suppose -5n + y = 327 - 308, -13 = 2n - y. Sort -5, -699, n. -699, -5, n Suppose -j + 26 = 4m, 0 = 4j + 2m - 47 - 29. Suppose 16q + 46 + j = 0. Sort q, 33, 3 in increasing order. q, 3, 33 Suppose 0 = -5r - 4y + 6, y + 9 = 14r - 10r. Sort -4, r, -1/141, 1 in increasing order. -4, -1/141, 1, r Let l(k) = 1900k + 11403. Let o be l(-6). Let y be 5 + (-1)/11. Sort -2, y, o. -2, o, y Let o be (-29 + 30)(9 - -2). Let z be 32 - ((-560)/176 + 2/o). Sort 2, z, -2, -3 in descending order. z, 2, -2, -3 Suppose 14n - 16n = 8. Let j be ((-6)/n)/((-27)/6 + 6). Let k be (-24 + 24)/(-1 - 0). Sort k, 4, j. k, j, 4 Let y = -182 + 182.5. Suppose -m = 3g + 20, -2m + 3m + 5 = 0. Put y, g, -4, 5/4 in ascending order. g, -4, y, 5/4 Let w(d) = 3d*3 - 2d + 1. Let k be w(1). Let o = -0.029307 - -0.019307. Let f = 0.1 + 0.1. Sort o, k, 2/17, f in descending order. k, f, 2/17, o Suppose -4x = -b - 6, -4x - 3 = 7b - 57. Sort -3, x, -0.0848, -0.2, -1/4 in decreasing order. x, -0.0848, -0.2, -1/4, -3 Let g(q) = q3 - 5q*2 + 5q - 3. Let y be g(4). Suppose -5s + y = -4. Let w(t) = -11t - 282. Let z be w(-26). Put s, z, -7 in increasing order. -7, s, z Let y(d) = d*3 + 25d*2 + 26d + 48. Let p be y(-24). Suppose -12c = -8c - k + 11, c + 2k - 4 = p. Let v = -13 - -8. Sort v, c, 5 in ascending order. v, c, 5 Suppose 0 = 30o - 34o - 568. Let i = -145 - o. Sort i, -2, 3/2 in decreasing order. 3/2, -2, i Suppose 29642 = 5r - 34299 + 14476. Sort 5, r, 1 in increasing order. 1, 5, r Let b = -0.2 - 0.8. Let p be 24/10385/(-308)160/6. Sort 3/7, p, b in increasing order. p, b, 3/7 Suppose -r + 13 = -161q + 165q, 41 = -4q + 5r. Sort -3, q, -4, 496 in descending order. 496, q, -3, -4 Let s = -415 + 373. Sort s, 59, -5, 4 in descending order. 59, 4, -5, s Let k(r) = -38r3 + r2 - 8r - 8. Let i be k(-1). Let y(t) = t*3 - 38t*2 - 38t - 49. Let x be y(i). Sort 7, -2, x in ascending order. x, -2, 7 Suppose -25 = -5g + 5j, 0 = 3g - 2j - 3j - 17. Suppose -988s + 992s + 84 = -4v, -2s - 4v - 40 = 0. Put -1, s, g, 0 in descending order. g, 0, -1, s Let g = 22 - 177/8. Let j = -367785/7 + 52541. Sort -5/11, 0.04, g, j in ascending order. -5/11, g, 0.04, j Let s = 7 + -3. Let t = 52 + -47. Let d be 8/((-2)/4(t - 1)). Put -5, s, d in increasing order. -5, d, s Let k = -1295 + 1291.3. Sort 0, 1, k in increasing order. k, 0, 1 Let w = -33.4674 - 2.2326. Sort -2, 1, w, -5, 1/4 in descending order. 1, 1/4, -2, -5, w Let s = 16 + -1. Suppose -5b - 15 - 20 = 0. Let d be b + 148/20 + -1. Sort 3, s, d in increasing order. d, 3, s Suppose -a - 3n + 17 = 0, 7a - n - 16 = 3a. Suppose at - 123 = 57. Suppose -33 + t = i. Sort -6, 1, i. -6, 1, i Let m(f) = -119f - 709. Let v be m(-6). Sort 0, -3, 3, -5, v in descending order. v, 3, 0, -3, -5 Let c(q) = 6q + 20. Let n be c(1). Let k(x) = -3x + 71. Let l be k(22). Put 1, l, n, -2 in ascending order. -2, 1, l, n Let v(o) = o2 + 8o + 6. Let m(h) be the second derivative of h*3/3 + 7h*2/2 - 4h. Let z be m(-7). Let j be v(z). Sort -5, 0, j in decreasing order. 0, j, -5 Let u = 233.0106 - 0.0106. Let r = -236 + u. Put r, 4, -4, 0.4 in decreasing order. 4, 0.4, r, -4 Let q(s) = -2s3 + 5s*2 + 2s + 5. Let j be q(3). Let w be j/10 - (-4 + (-96)/(-20)). Let h = 4 + -3. Put h, -6, w in descending order. h, w, -6 Let x = -165 - -24. Let j be (81/(-36))/((-6)/(-400)). Let q = x - j. Sort 7, 1, q in increasing order. 1, 7, q Suppose -13 = -12d + 35. Suppose -2v - 3f + 1 + 12 = 0, dv + 2f - 22 = 0. Suppose vr - 20 = -0r. Put -3, r, 10 in decreasing order. 10, r, -3 Let t = 13715 + -13712. Put t, 0, 2, 1, 50 in descending order. 50, t, 2, 1, 0 Let k = 54.9 + -54.5. Sort -0.05, k, -3, -25 in descending order. k, -0.05, -3, -25 Let p = -723 - -1449/2. Sort 2.9, p, -2. -2, p, 2.9 Let s = 425/4 - 107. Let z(n) = n3 - 7n*2 - 72n + 486. Let h be z(9). Sort 1/5, h, -0.3, s in decreasing order. 1/5, h, -0.3, s Suppose 0 = 161d - 118 + 601. Let m(k) be the second derivative of k5/20 + k4/4 + 2k*2 + k. Let l be m(d). Put -4, 2, -2, l in decreasing order. l, 2, -2, -4 Let v(l) = -8l + l*2 + 4l - 6 - 9l + 22 - 5l2. Let f be v(-4). Sort f, 2, -2, 5. -2, 2, f, 5 Let p be (-3)/1 + (-72)/(-28). Let y(n) = -n + 9. Let x be y(8). Let b(v) = v2 + 15v + 46. Let g be b(-4). Sort p, x, g in increasing order. p, x, g Let x = 62.1 + -62. Let t be (-46 + 53 + 338/(-48))2. Sort t, x, -2/3. -2/3, t, x Let f = -5 + 3. Let p = 761.541 - 762. Let m = p + 0.159. Put 0.3, m, f, 0.4 in increasing order. f, m, 0.3, 0.4 Let j = -2 - -3. Let x = 3757 - 3757.5. Put -2/7, j, 5, x in increasing order. x, -2/7, j, 5 Let d = -17 - -21.25. Let c = d - 0.25. Sort 0.4, 0.1, 0.3, c in descending order. c, 0.4, 0.3, 0.1 Let h(k) be the third derivative of -k4/12 - k3/2 + k*2. Suppose 5m - 10 - 10 = 0, -12 = 2q - 3m. Let b be h(q). Put 4, b, 2 in descending order. 4, 2, b Let w be -19 - (1035880/1881)/(-29). Put -0.07, 3, w in decreasing order. 3, w, -0.07 Let n(h) = h*2 + 855h - 6039. Let p be n(7). Let s(t) = -t*3 - 6t*2 + 7t - 1. Let o be s(-7). Sort o, -6, p. -6, p, o Suppose -31 + 11 = 4b. Let z = 59 - 54. Sort b, z, -2, 4. b, -2, 4, z Let d be -10(-10 + (-846)/(-90))5/(-6). Sort 33, d, 0, 5 in decreasing order. 33, 5, 0, d Let p = -21 - -17.6. Let i = -17.6 + p. Let z = -21.1 - i. Put 21, 1/5, z, 0.5 in decreasing order. 21, 0.5, 1/5, z Let j(y) = y3 + 18y*2 - 3y - 3. Let n be j(-18). Suppose -18 = 54q - nq. Let w = 16 + -19. Sort -2, -4, q, w in decreasing order. -2, w, -4, q Suppose -2 = -4u + 18. Let o be ((-43)/(602/(-112)) - (-4 + 4/2)) + -9. Put u, o, 2, 5/8 in ascending order. 5/8, o, 2, u Let q = -4 + 5. Let t be 3 - 1 - (-3316)/(-18). Let n = 182 + t. Put 3/4, q, n in descending order. q, 3/4, n Suppose 4t - 1575 + 343 = 0. Let h be (-110)/t + 1/2 - 0. Let r = 4 + -4.3. Put h, 0, r in decreasing order. h, 0, r Let m be (-6)/(-2) - 12724(-9)/(-50832). Let b = 1/353 + m. Put 3, -1, 2, b in decreasing order. 3, 2, b, -1 Let q(j) = -j3 + 5j*2 - 80j + 152. Let y be q(2). Let x(a) = -7a. Let b be x(2). Let d be (-1)/(-2) + b/4. Sort 1/3, d, y, -0.1. d, -0.1, 1/3, y Let g = -4.98244 - 0.01756. Sort -370, g, 3 in descending order. 3, g, -370 Let a = 32728 - 32689. Put a, -3, -5, 15 in increasing order. -5, -3, 15, a Let c = -0.9 - -0.4. Let w = -2189 - -2189. Sort w, c, 2, 1 in decreasing order. 2, 1, w, c Let o(m) = -m2 - 47m - 168. Let c be o(-43). Let i(b) = -2b2 + 19b - 6. Let p be i(9). Sort -6, p, c. -6, p, c Let p = 26 + -31. Let f = 104 - 107. Let w = 3.13 - 0.13. Sort p, f, w. p, f, w Suppose 138k + 3b = 135k + 21, 3k - 28 = 4b. Sort 1, -23, k, -5 in ascending order. -23, -5, 1, k Suppose 17n - 20n + 184 = 5k, -3k = 4n - 117. Suppose w = 8w - 35. Put k, 4, w in descending order. k, w, 4 Suppose -4t + 33 = t - g, -t + 5g = 3. Suppose 1 + t = -4u. Let r = -17.53 - -12.53. Sort -1/2, u, r, -4 in descending order. -1/2, u, -4, r Let d = -5/3 + 4/3. Let x = -0.717 - 22.343.	{ "pile_set_name": "DM Mathematics" }
- 148d2. -287d*2 Collect the terms in -10a - 24991a2 - 53a + 4a + 24980a*2. -11a*2 - 59a Collect the terms in 863k2 - 116k*2 + 979k*2 + 8123k - 8123k. 1726k*2 Collect the terms in 4c*3 - 9c*3 + 3c*3 - 1014126c + 2. -2c3 - 1014126c + 2 Collect the terms in -49 - 2o2 - 2o*2 - 14828o - 76 - 4 + 14828o. -4o*2 - 129 Collect the terms in -30 + 24 - 17y + 5 + 3 - 2. -17y Collect the terms in -62 + 47293g*2 - 4153g*2 - 67 + 129. 43140g*2 Collect the terms in 269a - 13a2 - 97a + 14a + 15a*2 - 127a. 2a2 + 59a Collect the terms in -309z3 + 534z*3 - 81z*3 - 67z*3 - 66z*3. 11z*3 Collect the terms in 11908535y*3 - 2622301y*3 + 14731794y*3. 24018028y*3 Collect the terms in 489y*3 - 16422y + 16422y. 489y*3 Collect the terms in 10010575201l + 207l2 - 10010575201l. 207l2 Collect the terms in 123d*2 + 126d*2 + 1036 - 1036 - 232d*2 - 24d*2. -7d*2 Collect the terms in -4h + 98h + 57h - 178h. -27h Collect the terms in -4a2 + a + 3306901a*3 + 5a*2 + 6a*2 - 3306964a*3. -63a*3 + 7a*2 + a Collect the terms in -13210 - 57a*2 - 13219 + 39656 - 13227 + 62a*2. 5a*2 Collect the terms in -907831 + 2723570 - 907859 - 907880 - 7d*2. -7d*2 Collect the terms in w + 4706 - 14w - 11w - 4540. -24w + 166 Collect the terms in -596 + 986 - 390 + 20n - 281n*2. -281n*2 + 20n Collect the terms in -74 + 7230n2 - 253 + 11528n*2 + 9936n*2. 28694n*2 - 327 Collect the terms in -20d*2 - 28d*2 - 28d*2 + 1091d*3 + 78d*2. 1091d*3 + 2d*2 Collect the terms in 339o + 78o - 119o + 681o. 979o Collect the terms in -63h + 737h - 146h - 129h - 201h. 198h Collect the terms in 2 + 19628f - 4110f + 4 - 6. 15518f Collect the terms in -10 + 110s + 70s - 1642s + 10. -1462s Collect the terms in 4c*3 + 7 + 1053427148779c*2 - 1053427148779c*2. 4c*3 + 7 Collect the terms in 53y + 1206y3 - 55y + 1214y3 - 2515y*3. -95y*3 - 2y Collect the terms in -21975v + 760649v + 825221v + 99766v. 1663661v Collect the terms in -170348y + 32942y2 + 170348y. 32942y2 Collect the terms in -591 + 299 + 11981q + 292 + 2682q. 14663q Collect the terms in 16n - 44n*2 - 144n + 45n2 - 5n*3. -5n3 + n2 - 128n Collect the terms in -5551d*2 - 7179d*2 + 12853d*2. 123d*2 Collect the terms in 1082161z*2 + 34390z*2 - 80310z*2 + 1073158z*2. 2109399z*2 Collect the terms in -182653178d*2 + 91326595d*2 + 91326578d*2. -5d*2 Collect the terms in 1397 + 1370 - 4135 - 6b + 1368 - 28b. -34b Collect the terms in 9669601 - 9669601 - 14d2. -14d*2 Collect the terms in -1262 + 46839w*3 - 46840w3 - 3028. -w3 - 4290 Collect the terms in -14m2 + 2m + 35 - 30 - 9m + 3m. -14m2 - 4m + 5 Collect the terms in -3p + 3p - 1 - 2p - 422p*2 + 247p*2 + 225p*2. 50p*2 - 2p - 1 Collect the terms in 796 - 544 - 6z + 804. -6z + 1056 Collect the terms in -311 + 292s + 160 + 156. 292s + 5 Collect the terms in -209 + 86o + 71 + 50 - 267o + 88. -181o Collect the terms in -3991i*3 - 3045i*3 - 4269i*3 + 3230i*3. -8075i*3 Collect the terms in -72 + 246 - 64 + 50m*3 - 55 - 55. 50m*3 Collect the terms in 11347n*3 - 2n*2 + 232 + 2n*2 - 11346n3 - 232. n3 Collect the terms in 1439d2 - 2659d*2 + 1228d*2. 8d*2 Collect the terms in 9540488661 + 2570l - 9540488661. 2570l Collect the terms in 1538n*2 - 6533n*2 + 917n*2 - 4972n*2 - 3243n*2 + 463n*2. -11830n*2 Collect the terms in 156v*2 + 144v*2 + 159v*2 + v - 603v*2 + 176v*2. 32v*2 + v Collect the terms in 253v*3 - 2769 + 2769 - 263v*3 + 23v*2. -10v*3 + 23v2 Collect the terms in -m3 - 7247413762746 + 7247413762746. -m*3 Collect the terms in 4878w*2 - 1236w*2 - 1224w*2 - 1208w*2 - 1215w*2. -5w*2 Collect the terms in -141850a + 70930a - 398a*3 + 70920a. -398a3 Collect the terms in 254g + 135g - 369g + 1170g + 578g. 1768g Collect the terms in 33627a - 31684a + 81962a - 11627a + 90513a. 162791a Collect the terms in -30f*2 - 10583757806f + 10583757806f. -30f*2 Collect the terms in 117 + 930 - 1047 - 594n. -594n Collect the terms in -2 + 1200928x - 1210937x + 3. -10009x + 1 Collect the terms in -12 + 3165t2 + 20509t*2 + 6 + 6. 23674t*2 Collect the terms in 802q*2 - 802q*2 + 994497q*3 - 994502q*3. -5q*3 Collect the terms in 51 - 28 - 3w*2 + 117w - 21. -3w2 + 117w + 2 Collect the terms in 10 - 12 + 9 + 197q - 223q. -26q + 7 Collect the terms in 5621o*3 + 3879o*3 + 4 - 5 + 3o*2 - 2o*2. 9500o3 + o2 - 1 Collect the terms in -276p + 1541p - 68p + 40p + 769p. 2006p Collect the terms in -455747 + 2h3 - 455752 + 911499. 2h*3 Collect the terms in 16969c + 14135c - 2032c. 29072c Collect the terms in -229k*2 - 840k*2 - 1557k*2 - 43k*2 + 2k*3. 2k*3 - 2669k*2 Collect the terms in -2w + 1075w3 + 1110w*3 - 1965w*3. 220w*3 - 2w Collect the terms in 7 - 282204z - 4z*2 + 282204z. -4z2 + 7 Collect the terms in 257p + 464p2 + 224p - 481p + 1457 - 1457. 464p*2 Collect the terms in -5 + 207a - 12 - 10 + 27 + 2018a. 2225a Collect the terms in 666385709i - 1890i*2 - 666385709i. -1890i2 Collect the terms in -589c - 20 + 146c + 23c*2 + 137c + 153c + 153c. 23c2 - 20 Collect the terms in -725139380p - 3p2 + 11 + 725139380p. -3p2 + 11 Collect the terms in -1941n*2 + 653n*2 + 646n*2 + 647n*2. 5n*2 Collect the terms in -13840x + 13840x - 4657x*3. -4657x*3 Collect the terms in 7j*2 + 107299 + 107304 - 321918 + 107315 + 2j. 7j2 + 2j Collect the terms in 3q + 102q + 75q - 8763q*3 + 8765q*3. 2q*3 + 180q Collect the terms in -841826q2 - 3 + 4 + 3 + 841835q*2. 9q*2 + 4 Collect the terms in 18584o - 49624o - 26667o. -57707o Collect the terms in 921h + 2765h + 3143h - 3h3. -3h*3 + 6829h Collect the terms in 15565333a2 - 15565331a*2 - 634a*3 - 487a*3. -1121a*3 + 2a*2 Collect the terms in -512113b*2 - 464590b*2 + 197994b*2. -778709b*2 Collect the terms in 5885768g*3 - 10g*2 + 10g*2 + 3611018g*3. 9496786g*3 Collect the terms in -132745m + 66472m + 66398m. 125m Collect the terms in -19839027l*2 + 39678247l*2 - 1 + 1 - 19839221l2 + 0. -l2 Collect the terms in -93k2 + 47k*3 - 277 - 79k*2 - 86k*2 + 258k*2. 47k*3 - 277 Collect the terms in 1663 - 1663 - 137024r*3 + 137011r*3. -13r*3 Collect the terms in 7 + 99r*2 - 2r - 1232r3 - 99r*2. -1232r*3 - 2r + 7 Collect the terms in -169o3 - 199o*3 - 159o*3 - 217o*3 + 709o*3. -35o*3 Collect the terms in -5s - 58s + 112s - 36s - 321s - 109s. -417s Collect the terms in -3y2 - 528664 + 0y*2 - 5y + 528664 - 8y + 13y. -3y2 Collect the terms in -2u3 - 6 + u3 + 2u3 + 325u*2 - 198u - 325u2. u3 - 198u - 6 Collect the terms in -4m + 814m*3 + 114 - 238 + 120. 814m*3 - 4m - 4 Collect the terms in -138210a2 - 138208a*2 - 138219a*2 - 138225a*2 + 691047a*2 - 138224a*2. -39a*2 Collect the terms in 1718m + 4812m + 4892m - 1627m + 3762m. 13557m Collect the terms in 12331x - 8 - 16874x + 8 - 14563x. -19106x Collect the terms in -1225029 - 1225033 - 1225023 + 3675085 - 15t*2. -15t*2 Collect the terms in 4 + 15335o*2 - 27605o*2 - 4 + 12426o*2. 156o*2 Collect the terms in 8 - 184 + 155 + 7 + 14 + 2m*2. 2m*2 Collect the terms in 4 + 8 - 56a - 2 - 13 + 34. -56a + 31 Collect the terms in -2691s*2 + 3 + 4271s*2 - 3 - 1580s*2 - 5s*3 + 0. -5s3 Collect the terms in -s3 - 5s3 + 488423s + 488419s + 5s*3 + 0s*3 - 976842s. -s*3 Collect the terms in 3040j*2 - 5910j*2 + 2872j*2. 2j*2 Collect the terms in -276c + 23 - 4595c - 23 - 10675c. -15546c Collect the terms in -1534 - 492y + 3060 - 1526. -492y Collect the terms in 4 + 2 + 2777w - 2755w - 5 - 3. 22w - 2 Collect the terms in -25 + 650x3 - 1336x*3 + 4 + 658x*3. -28x*3 - 21 Collect the terms in 2669h + 2667h + 655h*2 - 5336h. 655h2 Collect the terms in 115143277 - 115143277 - 29j*3. -29j**3 Collect the terms i	{ "pile_set_name": "DM Mathematics" }
t of o? 7 Suppose 6f = -8f + 6678. What is the tens digit of f? 7 Suppose 4f + 17464 = 5d + 5603, 11869 = 5d + 4f. What is the units digit of d? 3 Let d be (-6)/(-1)(-20)/(-24). Let m(w) = w2 - 5w + 5. Let p be m(d). Suppose 0x + 173 = 4r + 3x, pr - 2x = 199. What is the tens digit of r? 4 What is the tens digit of ((-12)/(-16))/(3/1836)? 5 Suppose -337g = -339g + 10. Suppose -16 = -5j - 2i - 2i, -3j + 12 = 3i. Suppose x - 5a - 32 = j, gx + 0a = -2a + 295. What is the tens digit of x? 5 Let a = 4 + -3. Suppose -2t = 4t - 36. Let k = t - a. What is the units digit of k? 5 Let t = 2336 - 1343. What is the units digit of t? 3 Let p = 1060 + -523. What is the hundreds digit of p? 5 What is the hundreds digit of (264/14)/((-124)/(-20398))? 1 Let z(a) = -5a3 - 4a*2 + 10a + 17. Let p be z(-5). Suppose 66t = 62t + p. What is the tens digit of t? 2 Suppose -10752 = -9b - 7b. What is the units digit of b? 2 Suppose 175 = 4w + 5k - 57, -122 = -2w - 4k. Let u = w + 21. What is the units digit of u? 4 Suppose 2k - 3m = 11 + 24, 3k + 3m - 45 = 0. Let s = 31 + k. What is the units digit of s? 7 Suppose 0 = 3h - 4l - 7954, -8h + 2l + 7952 = -5h. What is the thousands digit of h? 2 Let h(n) = n2 + n - 18. Let i be h(8). Suppose 2g = j - i, -5j - 2g = 3g - 270. What is the tens digit of j? 5 Let r(s) = 93s - 100. What is the hundreds digit of r(11)? 9 Let z(a) = 15a - 6a - 11a + 21 - 14. Let s(v) = v2 - 3v. Let o be s(3). What is the units digit of z(o)? 7 Let q(h) = h*3 + 9h*2 - 8h + 7. Let k be q(-10). Let u be k/(-52) + (-767)/(-4). Suppose -12z + 16z = u. What is the tens digit of z? 4 Let r(g) = 2g - 3. Let d be r(6). Let s(w) = w3 - 8w*2 - 10w + 5. Let l be s(d). What is the tens digit of (l/12)/(1/(-36))? 1 Let i(g) be the first derivative of g*2 - 1/4g*4 + 2 + 2g + 1/3g3. What is the units digit of i(-1)? 2 Let x(r) = 12r - 47. What is the hundreds digit of x(29)? 3 Let f = 2 - -38. What is the units digit of (-1)/((f/15)/(-8))? 3 Let y = 555 + -429. What is the tens digit of y? 2 Suppose -5d + 36 = -11d. What is the tens digit of ((-128)/d)/(4/18)? 9 Let k(l) = 13l2 - 36l. What is the units digit of k(12)? 0 Suppose -5d = 2w, -d = 3w - 8w. Suppose -3r - 5 - 4 = w. Let h(n) = n3 + 3n*2 - 4n - 3. What is the units digit of h(r)? 9 Suppose 0 = -28v + 56320 - 1776. What is the thousands digit of v? 1 Let f = -1100 + 754. Let y = 531 + f. What is the tens digit of y? 8 Suppose 3y + 19 = -4k, -y = 2k - 3y + 6. Let l be ((-9)/k - 3)-72. Suppose -2c + 18 = -l. What is the tens digit of c? 3 What is the tens digit of (1/(-3))/((-11)/91146)? 6 Let f = 182 + 132. What is the units digit of f? 4 Let k be 1(-10)/(-4)16. Let d = 0 - -4. Suppose -dg - k = -140. What is the units digit of g? 5 Let r be (-3)/((-12)/(-32)) - 3. Let y = r + 14. Suppose 0 = 3m - 15 + y. What is the units digit of m? 4 Let q(k) = 3k*2 - 7k - 1. Let o(j) = 6j - 30. Let v be o(6). What is the units digit of q(v)? 5 Suppose 3470 - 503 = 3f. What is the units digit of f? 9 Let u(j) = -j*2 - 7j - 7. Let x be u(-5). Suppose -2l - xl + 10 = 0. Suppose o = r + 13, lo + 67 = 6o - r. What is the tens digit of o? 1 Let m(h) = h*3 - 3h*2 - 7h - 11. Let w be m(5). Suppose -2u - 5a = -wu + 382, 5a = -20. What is the units digit of u? 1 Let s be ((4 - 1) + -4)227-1. Suppose -109 - s = -4f. What is the tens digit of f? 8 What is the units digit of (1 + 352/(-4))/((-2)/2)? 7 Let k(h) = -h3 - 11h2 + 5. Let x(v) = v3 + 12v2 - v - 4. Let r(g) = 6k(g) + 5x(g). Let b = -1063 + 1057. What is the tens digit of r(b)? 4 Let r(j) = -6j - 1. Let b(i) = i*2 - 6i - 7. Let l be b(7). Suppose 5z + 0t + 2t + 6 = l, -5z = -t + 12. What is the units digit of r(z)? 1 Let u(c) = -c*3 - 5c*2 - 3c + 2001. What is the units digit of u(0)? 1 Let a = -37 - -23. Let c = 17 - a. What is the units digit of c? 1 Suppose -60 = -0p - 4p. Suppose -16r = -pr + 9. What is the units digit of (-2)/(6/r) + -2? 1 Suppose 0s - 20 = -2s. Suppose -4y = y - 5h - 535, 2h = s. Suppose -65 = -3w + 2u, -4w - 3u = 31 - y. What is the units digit of w? 1 Let o(n) be the first derivative of n4/4 - 5n*3/3 + 2n*2 + 3n + 4. Let p be o(4). Suppose ps - 2s = 22. What is the units digit of s? 2 Let c = 696 + -208. What is the hundreds digit of c? 4 Let m = 2833 + -94. What is the units digit of m? 9 Suppose -3k + 21 - 6 = 0. Let q = k - 3. Suppose 2i = qt - i - 3, 27 = 4t + i. What is the units digit of t? 6 Let s(m) = -4m - 32. Let b be s(-8). Suppose 5v - 445 - 280 = b. What is the hundreds digit of v? 1 Let y = -118 - -108. Suppose -2w = -w + 60. What is the units digit of ((-10)/(-3))/(y/w)? 0 Suppose -4z + 2x + 748 = 0, -z + 88 = -2x - 96. What is the units digit of z? 8 Suppose 0 = 3z + j - 917, z - 3j + 0j - 289 = 0. What is the units digit of z? 4 Let w(f) = 8f*2 + 8 - 7f2 + f3 + 5f2 + 11f + 4f2. What is the tens digit of w(-8)? 4 Let j = 1541 - -1199. What is the thousands digit of j? 2 Let z = 6042 + -4102. What is the units digit of z? 0 Suppose 0 = j - 2j. Suppose 0 = -4b - jp - p + 14, 2b - 5p - 18 = 0. Suppose -9 = -l - n - bn, -n = 5l - 93. What is the units digit of l? 9 Suppose -5y = 3m - 3340, 0 = 4y - 2m + 4m - 2672. Let c = y + -475. What is the hundreds digit of c? 1 Suppose -k + 17 = -3u, 4k - 2u = u + 23. Suppose -kc - c = -42. What is the units digit of c? 4 Let g be (-23 - 0)(-2 + 1 + -1). Let x = 361 - g. What is the tens digit of x? 1 Let t(c) = -2c + 6. Suppose -w - 9 = -0w. Let j be t(w). Suppose 0y + j = 2y. What is the tens digit of y? 1 Let g(j) = 30j + 130. What is the units digit of g(23)? 0 What is the units digit of 338 + ((-2)/(-8) - 70/(-40))? 0 Let t = -171 + 567. Let d = t + -209. What is the tens digit of d? 8 Let h = 42 + -42. Suppose 5o - 150 = 4k, hk = -2k + 10. What is the tens digit of o? 3 Let i = -44 - -50. Let b(l) = 7l - 22. What is the units digit of b(i)? 0 What is the thousands digit of (-1 + 0)((-1 - 1819) + 5)? 1 Suppose -2q + 37 = -25. Suppose 77 + q = 3m. What is the tens digit of m? 3 Suppose 90 = f - 4d - 0d, -3f + 277 = -5d. Suppose -3x = -8m + 4m - 334, x + 3m - f = 0. What is the hundreds digit of x? 1 Let k = -79 + 232. What is the hundreds digit of k? 1 Suppose 0 = o + o. Suppose ov = v - 5. Suppose 0t - 90 = -vt. What is the tens digit of t? 1 Suppose -u + 5k + 32 = -3, 4u = 3k + 55. Suppose -3x - 1 = -u. Suppose 3n - n + 8 = 0, -xd + 65 = 4n. What is the units digit of d? 7 Let a = -134 + 137. Let j(l) = 24l*2 - l. What is the tens digit of j(a)? 1 Let p(d) = -3d - 3. Let g be p(-5). Suppose -4y = -29 - 11. Let o = g - y. What is the units digit of o? 2 Let o(x) be the third derivative of -x5/60 - 3x4/8 - x3/6 - 4x2. Let r be o(-4). Suppose i + 0i = r. What is the units digit of i? 9 Suppose 3k = 4m - 3m + 58, 4m + 266 = -5k. What is the units digit of (2/(-1) - (m + -2)) + 0? 4 Suppose -5s = x - 75, 0s + s = -4x - 4. Let y = 34 - s. Suppose y - 102 = -4g. What is the tens digit of g? 2 Suppose 65l = -c + 63l + 1469, -5816 = -4c + 4l. What is the units digit of c? 9 Let c(a) = 412a*3 - 4a*2 + 5a - 1. What is the units digit of c(1)? 2 Suppose 5w - 579 = -g + 2743, -3g = 3w - 1986. Suppose -m - 4m + w = 0. What is the hundreds digit of m? 1 Suppose 0 = 2v + 3 - 11. Suppose vi + 342 = 4j + 2i, -5j + 405 = 2i. What is the tens digit of j? 8 Suppose 15q - 19q = -492. Let t(j) = -q + 0j + 137 - j. What is the units digit of t(10)? 4 Suppose 5w = -0w. Suppose w = -3h + 24 + 570. Suppose 3n = 4t - 143, -5t - 4n - 27 = -h. What is the units digit of t? 5 Let f(c) = 336c + 130. What is the units digit of f(2)? 2 Let w(v) = 2216v*2 - 5v + 3. What is the tens digit of w(1)? 1 What is the tens digit of (-4)/(7 + 5)-4509? 0 Let y be 28/5 + 24/(-40). Suppose 13 = yz - 17. Let d(u) = -u*2 + 8u - 8. What is the units digit of d(z)? 4 Let r = -79 - -81. Let w = 2 - 0. Suppose 0n - r = -wn. What is the units digit of n? 1 Let a(x) = x*2 - x. Let o(c) = 4c*2 + 4. Let y(n) = 3n**2 - n + 5. Let m(	{ "pile_set_name": "DM Mathematics" }
. Let y(l) = ms(l) - n(l). Determine j, given that y(j) = 0. -1, 0 Suppose -l - 9x = -4x, -x - 26 = -5l. Let f = 95/412 - -2/103. Solve -1/4 - 1/4q - 1/4q*l - fq*4 + 1/2q*2 + 1/2q*3 = 0. -1, 1 Let z(w) be the second derivative of 1/3w*2 - 2/9w*3 - 3w + 0 + 1/18w4. Factor z(o). 2(o - 1)*2/3 Let u = -11/4 + 3. Determine g, given that -ug*5 + 3/4g*3 - 1/4g*4 - 1/2g + 1/4g2 + 0 = 0. -2, -1, 0, 1 Suppose -4y = y - 135. Let p be y/12 + (-2)/8. Let 2mp - m2 - m3 + 0m*3 = 0. Calculate m. 0, 1 Let n(g) be the third derivative of -1/20g*6 + 0 - 4g*2 + 0g - 1/10g5 - 1/112g*8 + 3/8g*4 - 1/2g*3 + 3/70g*7. Factor n(f). -3(f - 1)*4(f + 1) Let g(z) be the second derivative of -2/27z3 - 3z + 0 - 1/9z2 - 1/54z*4. What is v in g(v) = 0? -1 Let d = -1/590 - -1183/1770. Determine f so that df*4 - 2/3f*3 - 2/3 - 8/3f*2 - 7/3f + 1/3f5 = 0. -1, 2 Suppose 94 = -2j + 100. Factor -2/9 - 2/9k4 + 4/9k*2 + 0k + 0kj. -2(k - 1)*2(k + 1)2/9 Let v(x) be the first derivative of x3/6 + 2x2 + 8x + 2. Factor v(o). (o + 4)2/2 Let p(k) be the second derivative of -k4/8 - 3k3/4 - 3k*2/2 - 3k. Find n such that p(n) = 0. -2, -1 Let n = 638 + -5735/9. Let y(q) be the first derivative of -1/3q4 - 1/3q + nq3 - 1/3q2 - 3. Factor y(z). -(z - 1)2(4z + 1)/3 Let r = 8 - 5. Let w = 26 + -26. Solve wa + 2/3a*r - 2/3a*4 + 0a*2 + 0 = 0. 0, 1 Solve -8/5 + 2u*3 - 2/5u*2 - 2/5u*5 - 16/5u + 2/5u4 = 0. -1, 2 Let k = 8 - 0. Let t = k - 5. Factor -4/5 + 2h - 8/5h2 + 2/5h*t. 2(h - 2)(h - 1)2/5 Find h such that 9h + 10h4 - 14h*2 + 4 - 2h*3 - 11h + 4h5 + 0h*3 = 0. -2, -1, 1/2, 1 Let n(y) be the second derivative of -2y*7/21 - 4y*6/15 + 3y*5/5 + 4y*4/3 - 8y*3/3 + 24y. Factor n(t). -4t(t - 1)*2(t + 2)2 Let t(v) = v4. Let m(r) = r*5 + 8r4 + r3. Suppose -3a - 42 = -2x, x + 0a + a = 11. Suppose 4j + 9 = -x. Let g(c) = jt(c) + m(c). Factor g(l). l3(l + 1)*2 Factor -702t + 705t + 0t*2 - 3t*2. -3t(t - 1) Let l(y) be the second derivative of 2/9y*3 + 0y*2 - 1/18y*4 + 0 - 1/30y*5 + 4y. Factor l(j). -2j(j - 1)(j + 2)/3 Let 4a*3 - 16 + 4a*2 - 16a + 6a3 - 6a3 = 0. What is a? -2, -1, 2 Let a(u) be the first derivative of u4/8 + u3/2 + u2/2 - 1. Factor a(r). r(r + 1)(r + 2)/2 Let u(t) be the third derivative of -13t6/120 - 19t*5/15 - 35t*4/8 + 3t*3 - 22t*2. Suppose u(d) = 0. What is d? -3, 2/13 Factor -13t*2 + 20 - 8t + 28t + 18t*2. 5(t + 2)*2 Suppose 3 = 4l - 3l. Suppose 3 = w - 5h, 5h + 9 = lw + h. Factor 5 + 2g + 4g*w - 5 + 8g*4 - 6g*3 - 8g*2. 2g(g - 1)(g + 1)(4g - 1) Let s(w) = -w2 + 1. Let o(y) be the first derivative of -y3/3 - y*2 + 2y - 5. Let x(r) = -3o(r) + 6s(r). Determine c so that x(c) = 0. 0, 2 Let q(j) = j*2 + 11j + 3. Let n be q(-10). Let l = -4 - n. Solve -5dl + 6d2 + d4 - d + 3d + 2d - 8 = 0 for d. -1, 2 Suppose -4h + s + 301 = -0h, 2h - 2s = 146. Let b be h/18 + (-8)/36. Factor -15 - 2xb - 2x*3 + 2x*2 + 15 + 2x*5. 2x*2(x - 1)*2(x + 1) Let p = -1416 - -9920/7. Find b such that -18/7b4 + 0 + 16/7b*2 - 6/7b*3 + pb = 0. -2/3, 0, 1 Suppose -2a + 6 + 0 = 0. Factor -4v*3 + 3v*3 - 3v*3 - v + 3v*a - 2v*2. -v(v + 1)2 Let c(o) be the third derivative of o7/7560 - o5/360 + o4/6 + 2o2. Let w(n) be the second derivative of c(n). Factor w(h). (h - 1)(h + 1)/3 Let r be 2 - (7 + 2)/(-3). Factor -b*3 - 10b*r + 4b5 - b2 + b*4 + 7b5. b2(b - 1)(b + 1)2 Let w(y) be the first derivative of -y4/4 + 2y3/3 + y2/2 - 2y - 1. Factor w(u). -(u - 2)(u - 1)(u + 1) Let q(f) = f4 - f2 + 1. Let h(p) = -3p4 + 39p*3 - 39p*2 - 3p + 18. Let t(a) = -h(a) + 12q(a). Factor t(m). 3(m - 1)*3(5m + 2) Let q be ((-4)/7)/(-2) - (-186)/84. Let -9/2u + 7/2u4 - 1 - qu*2 + 9/2u*3 = 0. What is u? -1, -2/7, 1 Suppose -q + 695 = 691. Factor 1/3 + 1/2y - 1/6y2 - 1/2y*3 - 1/6y*q. -(y - 1)(y + 1)*2(y + 2)/6 Suppose -5i + l + 47 + 54 = 0, -4i + 3l + 83 = 0. Find b such that -22b + 8 - 7b + ib*2 - 9b - 6b = 0. 1/5, 2 Let h be (0 + 4 - (-82)/(-20))-12. Determine y so that 0 - hy2 + 2/5y*3 + 4/5y = 0. 0, 1, 2 Let h(p) be the third derivative of -p7/42 + p6/12 + p*5/3 - 5p*4/12 - 5p*3/2 + 3p*2 - 4p. Find y such that h(y) = 0. -1, 1, 3 Suppose -8 + 4 = -2p. Suppose -py + 6y = 0. Suppose y + 0u*2 + 1/4u*3 + 0u = 0. Calculate u. 0 Suppose -19/4w4 - 1/4w*3 - 7/4w*5 + 2w + 23/4w2 - 1 = 0. What is w? -2, -1, 2/7, 1 Let g(k) be the first derivative of -k4/20 + k3/5 - 27. What is w in g(w) = 0? 0, 3 Let s(f) = f3 + 7f*2 - f - 5. Let j be s(-7). Factor -2c*3 - 2c*2 - 6c*3 - 6c*j - 2c*4. -2c*2(c + 2)*2 Let i(r) be the second derivative of 3r7/56 + r6/20 - 27r5/80 + r3/2 + 28r. What is b in i(b) = 0? -2, -2/3, 0, 1 Let m(a) be the first derivative of a*4/10 - 4a*2/5 - 11. Factor m(d). 2d(d - 2)(d + 2)/5 Suppose -22o = 2b - 24o, -2b - 5o + 35 = 0. Find y such that 1/2 - 3/4y - 5/4y2 - 9/4y*4 + 1/2y*b + 13/4y*3 = 0. -1/2, 1, 2 Suppose 2q - 2s + 2 = 0, 0 = 5s - 7s + 10. Let r(n) be the first derivative of -1 - 3/4n*q - 4n*3 + 0n - 6n2. Solve r(v) = 0 for v. -2, 0 Let j(g) = -g2 - 6g + 4. Let w(u) = 4u2 + 17u - 12. Let k(h) = 7j(h) + 2w(h). Let v be k(8). Factor -vz2 - z2 + 3z*2. -2z2 Let r(i) = i2 - 7i + 3. Let v be r(7). Factor 0nv - n3 - n + 2n3. n(n - 1)(n + 1) Let k(u) be the third derivative of 0u*5 + 7/30u*6 + 0 + 0u - 1/3u4 + 1/3u*3 - 17/105u*7 + 1/28u8 - u2. Determine b so that k(b) = 0. -1/2, 1/3, 1 Let u(h) = 5h5 + 9h*4 + 2h*2 + 6h + 6. Let b(r) = 4r5 + 8r4 + r2 + 5r + 5. Let j(c) = -6b(c) + 5u(c). Let j(o) = 0. Calculate o. -1, 0, 2 Let f(r) be the first derivative of 4r*5/15 - 2r*4/3 + 4r*3/9 + 6. Factor f(c). 4c*2(c - 1)2/3 Let c(x) be the third derivative of x8/33600 - x7/2100 + x6/300 - x*5/15 - 2x*2. Let b(n) be the third derivative of c(n). Factor b(f). 3(f - 2)*2/5 Let d(s) = -5s*3 + 6s2 - 5. Let p(h) = -h3 + 1. Let c(z) = d(z) - 3p(z). Determine x so that c(x) = 0. -1, 2 Let z(o) = -3o*3 - 5o*2 + 2o - 2. Let i(p) = -7p3 - 11p*2 + 5p - 5. Let a(q) = 2i(q) - 5z(q). Solve a(b) = 0. -3, 0 Let z(k) be the second derivative of -2/15k3 - 19/75k*6 + 3/10k*5 - 1/30k*4 + 0k*2 + 3k + 1/15k7 + 0. Suppose z(o) = 0. What is o? -2/7, 0, 1 Let v be 2/(-14)(-16 + 6 + 8). Factor 8/7c + 6/7 + vc*2. 2(c + 1)(c + 3)/7 Let b be 2(30/(-8) - -4). Let n(g) be the first derivative of 0g + 0g*5 - bg*4 + 1 + 0g*3 + 1/2g*2 + 1/6g*6. What is a in n(a) = 0? -1, 0, 1 Let y be (-2)/3 - 17/(-3). Determine v so that 0v + 9vy + v - 8v*5 - 2v*3 = 0. -1, 0, 1 Let s(j) = 6j*4 + 5j*3 + j - 4. Let d(b) = 13b*4 + 9b3 - b2 + 3b - 10. Let r(h) = 2d(h) - 5s(h). Factor r(u). -u(u + 1)*2(4u - 1) Let l(x) = -3 - 1 - x - x. Let i be l(-3). What is m in -im*2 + 0m*2 + 0m - 2m = 0? -1, 0 Factor -2/3h + 1/3h4 - h3 + 1/3h*5 - 5/3h*2 + 0. h(h - 2)(h + 1)3/3 Let n = -5 + 5. Suppose 3o + c = 3, -5o - c + nc + 7 = 0. Suppose oh3 + 2h*3 - 10h*2 + 6 + 2h - 2 = 0. What is h? -1/2, 1, 2 Let g(i) be the second derivative of -3/4i2 + 3/40i*5 - 10i + 1/8i4 + 0 - 1/4i*3. Let g(j) = 0. Calculate j. -1, 1 Let a = -1 - -5. Let v(u) be the second derivative of 0 + 2/3u*3 - 2u + 1/6ua + 0u*2. Factor v(i). 2i(i + 2) Factor -21d*2 - 6d - 3/7. -3(7d + 1)*2/7 Let q(b) be the third derivative of 0b*4 - 1/120b*5 + 0 + 6b*2 + 0b + 0b3 + 3/160b*6 + 5/1344b*8 - 1/70b7. Find d such that q(d) = 0. 0, 2/5, 1 Let m be 5/(-5) - 4/(-1). Let l(k) = k3 + 5k2 + 3k + 5. Let v be l(-4). Factor 2r3 - 2r + 4r - vr2 + rm + 4r4. r(r - 1)(r + 2)(4r - 1) Let p = -1/134 - -673/402. Suppose -ph5 + h3 + 0 + 7/3h2 - 7/3h*4 + 2/3h = 0. What is h? -1, -2/5, 0, 1 Let q(f) be the second derivative of f*4/3 - 2f*3 + 4f*2 + 5f. Factor q(j). 4(j - 2)(j - 1) Solve	{ "pile_set_name": "DM Mathematics" }
8 -0.3 times -436 130.8 What is the product of 4 and 97? 388 Work out 167 * 2.7. 450.9 5-63 -315 What is -0.5 times -900? 450 0.03 0.06 0.0018 Multiply -0.1 and 9.31. -0.931 2 * -255 -510 Multiply -28 and -0.032. 0.896 1.54.1 6.15 301 30 Calculate 5-51. -255 248 0.05 12.4 Work out -85 * -5. 425 What is the product of -38 and 0.7? -26.6 What is 0.09 times 2.44? 0.2196 Work out 5.9 * -5.6. -33.04 What is 0.1 times -0.53? -0.053 0.051624 81.2 Multiply 17 and -0.1. -1.7 0.250.21 0.0525 What is 7 times -60.7? -424.9 What is 2.06 times -0.2? -0.412 Work out -0.03 * -2.3. 0.069 Product of 0.3 and -0.02. -0.006 What is the product of 2.74 and 96? 263.04 Calculate -24240.02. -48.48 Multiply -10 and -3.2. 32 Work out 11 628. 6908 0.005-98 -0.49 -13 -0.0298 0.3874 What is 0.6 times 108? 64.8 Calculate 5514-0.5. -2757 30.7 2.1 -1 * -374 374 What is 26 times -0.6? -15.6 92 times -7 -644 Multiply -2 and 5.3. -10.6 What is the product of -0.2358 and -0.2? 0.04716 0.0624 1.44 60.225 1.35 Work out -2 * -0.43. 0.86 Multiply 7 and -2.4. -16.8 163-0.4 -65.2 What is 2 times 62? 124 Multiply 4 and -66. -264 Calculate -20.53. -1.06 Work out 1.6 * -0.06. -0.096 Work out 0.03 * -0.4. -0.012 Calculate 0.9440.1. 0.0944 Multiply 0.3 and -109. -32.7 What is the product of 2 and -385? -770 What is 4 times -668? -2672 Product of 12 and -8.8. -105.6 0.5 times 0.068 0.034 Multiply 3 and 17. 51 -133 -1 133 -69900.5 -3495 What is 0.118 times -0.2? -0.0236 0.04 times 188 7.52 What is the product of 4 and -56? -224 -2 -34 68 10 * 131 1310 3907 * -2 -7814 Product of -0.01 and 27. -0.27 -0.1-2421 242.1 -0.1 times -9.6 0.96 What is the product of 0.4 and -3.2? -1.28 Work out -366 0.41. -150.06 Product of 0.04 and 22. 0.88 -1043 times -4 4172 -49 * -1 49 Calculate 29.3-10. -293 Product of 0.06 and 5.6. 0.336 Work out 0 -407. 0 What is -0.045 times -0.013? 0.000585 Work out 3 * -9. -27 Product of -0.2 and -82. 16.4 -4-2 8 -14830.1 -148.3 What is 4 times 0.11? 0.44 -8.267-0.3 2.4801 What is 6 times -292? -1752 Calculate 61620.5. 3081 What is -4 times 7.6? -30.4 Calculate 7-94. -658 -2.5 times -9 22.5 What is the product of 13.4 and 0.4? 5.36 Calculate -28.7. -17.4 What is the product of -2 and -251? 502 -9275 times 0 0 3.239 * -1 -3.239 Calculate 2.90.25. 0.725 Multiply -20 and 0.37. -7.4 Calculate -0.3-3.76. 1.128 What is the product of 0.04 and -0.098? -0.00392 What is -8 times -2.3? 18.4 Product of -18 and 0.5. -9 -0.2 * -323.1 64.62 Work out 0 * 3.436. 0 Product of -0.07 and 447. -31.29 0.091323 119.07 Work out -0.1 5367. -536.7 Calculate -3-2.476. 7.428 Multiply -0.3 and 416. -124.8 Calculate -1767.43. -5302.2 0 * 2243 0 -0.239 times 0.4 -0.0956 What is 6.2 times -1? -6.2 What is the product of -0.07 and 667? -46.69 Multiply 0.4 and 0.077. 0.0308 What is -66 times 0.4? -26.4 2 times -0.31 -0.62 Multiply -16 and 0.877. -14.032 -0.5 * -3.3 1.65 What is the product of 0 and -81? 0 -1 * -41 41 0.4 * 0.056 0.0224 What is 44 times 0.2? 8.8 What is -0.029 times -0.28? 0.00812 0.5135 67.5 What is the product of -0.66 and 0.105? -0.0693 -0.069260.2 -0.013852 Product of 80 and 0.17. 13.6 Multiply 0.0578 and 3. 0.1734 Multiply 8 and -5. -40 -139 times 0.1 -13.9 126 * -9 -1134 What is the product of -56 and 184? -10304 Calculate -8.50.9. -7.65 -0.3-1549 464.7 -25 times 17 -425 24 times 0.403 9.672 343.4 * 1 343.4 Calculate -1.357-0.16. 0.21712 What is the product of 0.2 and -0.63? -0.126 Calculate 17680.05. 88.4 Product of -6 and 0.0259. -0.1554 What is -0.1 times -0.94? 0.094 -1 times -0.106 0.106 -0.0965 * 3 -0.2895 -92 * -0.2 18.4 8.1 * -2 -16.2 Multiply 124 and -8. -992 What is 33 times 10? 330 What is -0.7 times -317? 221.9 Calculate 0.510.29. 5.145 What is 0.1081 times -2? -0.2162 Work out 44 -5. -220 What is the product of 4 and -932? -3728 -13121 -1573 1-0.029 -0.029 -1.522 -33 5011.1 555 6.9 times -2 -13.8 Product of 0.4 and 4.19. 1.676 -2 times 0.115 -0.23 -0.02 * 0.1747 -0.003494 Multiply -4.7 and 125. -587.5 Work out 2 * -240. -480 What is the product of 7.33 and -0.6? -4.398 What is the product of 131 and -0.5? -65.5 What is the product of 0.2 and -0.058? -0.0116 -4 * 1.12 -4.48 What is the product of -0.5 and 216? -108 Calculate -1.520. -30 What is -0.6 times 18? -10.8 -1.73 2 -3.46 -0.3 times 108 -32.4 0.47 times 0.13 0.0611 -83.7 * -0.1 8.37 Product of 16 and -158. -2528 What is -0.2 times 12? -2.4 3916 * -5 -19580 0.2-28 -5.6 Work out 335 0.23. 77.05 -13125 -6560 Product of -30 and -0.3. 9 What is 0.129 times -40? -5.16 Multiply -399 and 0.4. -159.6 Product of 0.5 and -130.5. -65.25 What is -15 times -2167? 32505 What is -0.3 times -695? 208.5 -4.743 -14.22 Product of -282 and 10. -2820 What is the product of 5.4 and 3? 16.2 What is -3 times 65? -195 Product of 0.07 and 167. 11.69 Calculate -22-145. 3190 1 times -7304 -7304 -7.3 -13 94.9 Work out -0.1 * -0.203. 0.0203 Multiply 30.7 and 0.5. 15.35 -0.2 * 641 -128.2 0.0526-0.3 -0.01578 Multiply 32 and -12. -384 -12 0.05 -0.6 2-456.8 -913.6 0.0994 -4 -0.3976 11.06 * 1.1 12.166 Multiply -334 and 0.5. -167 Multiply 29.73 and 3. 89.19 Product of 0.45 and -1. -0.45 -0.015 times 6.06 -0.0909 What is 0.4443 times 0.4? 0.17772 Calculate -2.90. 0 What is the product of -0.07 and -22? 1.54 Work out -0.2 -0.068. 0.0136 What is -17.66 times -0.1? 1.766 0.3 times -0.2039 -0.06117 Calculate 0.37-68. -25.16 0.8 3 2.4 What is 0 times -0.141? 0 Calculate -26.9-5. 134.5 What is 103 times 0.046? 4.738 Calculate -0.3-0.001. 0.0003 What is the product of -79.9 and 0.4? -31.96 Work out -0.23322 * -0.5. 0.11661 What is the product of -317 and -5? 1585 -0.04566 * -5 0.2283 Multiply 0.1 and 5. 0.5 Product of 0.6 and -422. -253.2 Calculate -0.056-6.3. 0.3528 20 times 19 380 Work out 0.2 -454. -90.8 What is -1.1 times -12? 13.2 What is -0.4 times -0.061? 0.0244 4.501 times -4 -18.004 Multiply -0.2025 and -0.1. 0.02025 4 * 883 3532 Calculate -4-130. 520 Calculate -4-5. 20 Work out 70.1 * 0.1. 7.01 What is the product of 0.1 and 6? 0.6 Work out -423 * 0. 0 What is -34207 times 0.5? -17103.5 Multiply 1 and -406. -406 Product of 0.1668 and -5. -0.834 Multiply -15 and -3.3. 49.5 Work out -17.7 * -0.6. 10.62 Calculate 2120. 420 0.20147-0.4 -0.080588 0 times -0.28 0 Work out 124 * -302. -37448 Work out -0.118 * 0.1. -0.0118 Multiply 5 and -4715. -23575 What is -116 times -0.1? 11.6 Work out -74 * -2.5. 185 Product of -0.05 and 20.1. -1.005 0.548 24 Work out -2619 1. -2619 -0.9 times 5.2 -4.68 -43 * 0.4 -17.2 What is the product of 0.011 and -0.061? -0.000671 Work out -651.5 * -4. 2606 Work out 1 * 14. 14 What is the product of 5 and 0.032? 0.16 Work out -3 * -2.9. 8.7 29 times -0.4 -11.6 Calculate -54.50.06. -3.27 -0.1 -336 33.6 What is the product of 0.1 and 0.06? 0.006 What is 0.136 times 44? 5.984 What is the product of 148.5 and -0.3? -44.55 0.01 times -1.6 -0.016 Product of 0 and 0.0374. 0 5.294 488.8 Calculate -0.09-223. 20.07 -1.8 times -0.2 0.36 Product of 0.5 and -3471. -1735.5 0.346 * -99 -34.254 Work out -0.1656 * 4. -0.6624 Product of 1.409 and -3. -4.227 What is the product of 0.1 and 4.3? 0.43 What is -0.1 times -0.296? 0.0296 338-0.8 -270.4 0.30.49 0.147 Work out -0.5 * -0.365. 0.1825 -387 -261 Multiply -33 and -1.1. 36.3 Multiply -0.013 and -25. 0.325 -0.055 -0.017 0.000935 Work out 1 * 2.59. 2.59 60 times 0.4 24 Calculate 0.50.01. 0.005 0.45.3 2.12 -1 times -0.01 0.01 Work out -3 * -0.1727. 0.5181 44.3 * 3 132.9 What is 0.2 times -0.151? -0.0302 Calculate -0.1-0.4. 0.04 Product of -2.2 and -239. 525.8 What is -0.3 times -11? 3.3 Multiply 5 and -0.057. -0.285 Calculate -0.168. -6.8 Work out -501 * -0.2. 100.2 What is 1.5 times -19.1? -28.65 -16-3 48 Work out -6 0.35. -2.1 Multiply 155 and 35. 5425 Calculate -5-1072. 5360 Calculate 2-104. -208 What is the product of 5 and -75.2? -376 What is -1.034 times -1? 1.034 -40 * -3.1 124 What is -2.57 times -5? 12.85 Work out -4032 * 0.1. -403.2 Calculate -0.42. -0.8 What is -710 times -1? 710 What is the product of 0.3 and -49? -14.7 Product of 3 and -83. -249 Work out -1978 0.06. -118.68 Multiply -0.1697 and -5. 0.8485 Product of -5.2 and -0.133. 0.6916 What is the product of -0.1 an	{ "pile_set_name": "DM Mathematics" }
rt(1331) - sqrt(1331)4))-1. -2702 + 231sqrt(11) Simplify (6(-5(-2sqrt(66) - sqrt(66)) + (sqrt(66) - sqrt(66)-2)-2))/(4sqrt(66)/sqrt(11) + sqrt(42)/sqrt(252)). 324sqrt(11)/25 Simplify 5-1((sqrt(448) - (3 + sqrt(448) + 0)) + sqrt(70)/((sqrt(40)/sqrt(2))/sqrt(2) + sqrt(10)))*2. -215/4 + 15sqrt(7) Simplify ((-3 + (sqrt(1377) - sqrt(1377)1)-3 - (sqrt(1377) - (-3 + (sqrt(1377) - sqrt(1377)1)))2)-2)25. 6480sqrt(17) + 111780 Simplify (-15(0 + sqrt(343)) + -5(sqrt(847) - (-4sqrt(847) + 2)))2. -6200sqrt(7) + 672800 Simplify 3(-4 + (4 + sqrt(272) + (sqrt(272) - (0 + sqrt(272))) + 0 - (sqrt(272)-15 + (sqrt(272) - (sqrt(272) + sqrt(272) + sqrt(272)-12))))2). 480sqrt(17) + 20436 Simplify ((2 + 4((sqrt(475) + -1 + -1)1 + 4))3)2 + 3. 3600sqrt(19) + 69303 Simplify 5 + ((1sqrt(360)2)/(-5(sqrt(8) + sqrt(72))))/(-3((-1sqrt(36) - sqrt(36))5)/sqrt(4)). -sqrt(5)/300 + 5 Simplify (sqrt(121) - (sqrt(121)1 - sqrt(121)))/sqrt(11) + sqrt(33)/(sqrt(6)/sqrt(2)) + ((1sqrt(99)6)/(-4(sqrt(9) + sqrt(36)/sqrt(4))))*2. 99/16 + 2sqrt(11) Simplify ((sqrt(81)/(sqrt(15)/sqrt(5)) + sqrt(27) - (-2sqrt(1728) + sqrt(1728)))/(sqrt(225) + 2sqrt(225) + sqrt(99)/(sqrt(22)/sqrt(2))))*2. 75/64 Simplify (5-52sqrt(1008))/(sqrt(576)-31-3). -25sqrt(7)/9 Simplify ((sqrt(156)/sqrt(192) - (sqrt(13) + sqrt(1872) + -1))1-5)*2 - (3(sqrt(117) - (sqrt(117) + -1))-5-2)*2. -1275sqrt(13)/2 + 831325/16 Simplify -4((sqrt(4200)-1)/sqrt(6) - ((sqrt(14)/sqrt(2) - sqrt(7))6 - sqrt(84)/(sqrt(12)1))) + 2 + 2. 4 + 36sqrt(7) Simplify ((sqrt(6000) + (sqrt(6000) - (1sqrt(6000) - sqrt(6000))) - sqrt(6000))/(sqrt(5) - sqrt(20)/sqrt(4)2))/(sqrt(66)/(sqrt(99)/sqrt(81))5). -2sqrt(2)/3 Simplify 4(1 + 0 + (0 + sqrt(405) + 2sqrt(405))2 + 4)-5-6. 438000 Simplify ((5((sqrt(63) - (-1 + sqrt(63))) + sqrt(63)))*2 - ((sqrt(63)1 - sqrt(63))*2 + 1 - sqrt(63))) + 5 + ((3(sqrt(84)3 - sqrt(84)))/sqrt(12))2. 153sqrt(7) + 1856 Simplify (3((sqrt(245)1-3 - sqrt(245))2 + -3 + sqrt(245) + -1) - (5 + (5 + sqrt(245) + -1 + -4sqrt(245)-1)2))6. -1554sqrt(5) + 33612 Simplify -3sqrt(152)/sqrt(8) + sqrt(152)/(sqrt(64)/sqrt(8)) - ((sqrt(931) + -1)-62)*2. -134208 + 2014sqrt(19) Simplify -3 + (sqrt(2736) - sqrt(2736)-26)*2 - (6sqrt(190)2)/(sqrt(360)-2 + sqrt(360) - sqrt(360)). sqrt(19) + 462381 Simplify 0 + sqrt(2) + (sqrt(50))2 + (-5 + (sqrt(128) - sqrt(2)))2 + (-6(-1 + sqrt(72) + sqrt(72) + sqrt(72)))2 + -4. -1365sqrt(2) + 23533 Simplify -5 + sqrt(209)/(sqrt(11)-33 + sqrt(11) + sqrt(11))-1 + ((sqrt(190)-2-4)/(sqrt(70)/(sqrt(21)/sqrt(3))))2 + 2. sqrt(19)/7 + 1213 Simplify (2 + (sqrt(1100) - (sqrt(1100) - (2 + (sqrt(1100) + -2 - sqrt(1100))))))2 + 1((2 + sqrt(539) + sqrt(539))*2 + -4). 56sqrt(11) + 2160 Simplify ((sqrt(200) + 2 + sqrt(200) + sqrt(200) + -1)3 + (2 + 2 + sqrt(200) - (-1 + sqrt(200) + 0)))2-3. -48792 - 4320sqrt(2) Simplify 1 + ((sqrt(3159)1-1 - -2(2sqrt(3159) + sqrt(3159)))/(sqrt(147)1 + (sqrt(9)/sqrt(48) - sqrt(3))))*2. 16873/25 Simplify (-3 + (sqrt(567) - (sqrt(567) + -2(-1 + sqrt(567))))3 + 5)2-2 + -2. -40858 + 864sqrt(7) Simplify (2(1 + sqrt(448))-2-1-6 + 2)2. 8448sqrt(7) + 258532 Simplify -3 + ((-4sqrt(66)/(2sqrt(6)) - sqrt(121)/(sqrt(176)-5)) + 0)2. 15531/400 Simplify 641((-2sqrt(180) + -2)-6 - (sqrt(180)1 + -3 - (sqrt(180) + 1 + -1))2). 72 + 1728sqrt(5) Simplify 1 + (sqrt(605) + -2 + (sqrt(605) + -2sqrt(605))2)-3 + (sqrt(210)/(-1sqrt(7)))/(sqrt(6) - -6(2sqrt(6) - sqrt(6))). -1808 - 232sqrt(5)/7 Simplify -1(sqrt(190)/((sqrt(5) - -1sqrt(5))-1)-4)/((sqrt(128) - (-1sqrt(128) - sqrt(128))4) + sqrt(128) + sqrt(128) - 6(sqrt(128) + sqrt(128)-2)) + 0. -sqrt(19)/68 Simplify 2-3(-2sqrt(272)6 + 3)*21-4. -6912sqrt(17) + 940248 Simplify ((1 + (sqrt(52) - sqrt(104)/sqrt(32) - (sqrt(208)-1 + sqrt(52)))/(sqrt(176)/(sqrt(11) + sqrt(11)-2)) + -3)2)2. 14sqrt(13) + 893/16 Simplify (-4(-6(-4sqrt(6)/sqrt(2) + -1 - 2-1(-1 + sqrt(3) - sqrt(3))) + -4))2. 10752sqrt(3) + 30784 Simplify (sqrt(39)/(sqrt(24)/sqrt(8)) + 4sqrt(39)/sqrt(3))2 + (sqrt(117) + (51sqrt(117) + sqrt(117))2)-6. -24947 - 18sqrt(13) Simplify 1-3(0 + (-31(1 + sqrt(2736))-6)*2). -2660364 - 23328sqrt(19) Simplify (-4 + sqrt(833)16 + -4 + -3)*2 + -5. -924sqrt(17) + 30104 Simplify (3sqrt(1600))/(sqrt(180)-6 - sqrt(5)) - ((sqrt(60)/(sqrt(36)/sqrt(3)-1))2 - (sqrt(5)-1 + 5 + -3)). -61sqrt(5)/37 - 3 Simplify -5 + sqrt(91)/sqrt(7) + (sqrt(468) + 1 - sqrt(13)) + ((sqrt(117)3)/sqrt(9))2 + ((sqrt(325) - sqrt(13)) + 2)2. 22sqrt(13) + 325 Simplify (4 + (-4sqrt(7623)1 - sqrt(7623))/(sqrt(144)/sqrt(4) + sqrt(9) + sqrt(9) - (sqrt(144) + sqrt(9))-1) + -2)*2. -220sqrt(7)/9 + 21499/81 Simplify ((-5 + 5(sqrt(252) + 0 - sqrt(252)) - -4-5(sqrt(252) - (0 + sqrt(252))))-3)*2 + 2. 227 Simplify 3(1 + -3sqrt(17)4 + -5) + (4sqrt(102)-1 - sqrt(102))/((sqrt(864) - -2sqrt(864)) + sqrt(6)). -1337sqrt(17)/37 - 12 Simplify (((sqrt(5082)2 - sqrt(5082) - sqrt(5082))5)/(sqrt(6)-2-3-5))2. 0 Simplify -4 + ((sqrt(28)/sqrt(4) + 5 - (-5 + (sqrt(7) - (-1 + sqrt(7))) + sqrt(7))) + -5 - (sqrt(336)/(sqrt(12)-1))/(sqrt(144)-1)) + 4. -sqrt(7)/6 + 4 Simplify -4 + -2sqrt(180)1 + ((sqrt(55)/(-3sqrt(11)))*2 - sqrt(1000)/sqrt(8)) + -4. -17sqrt(5) - 67/9 Simplify 4 + (1sqrt(4500) + -3)2 - ((13sqrt(500))2 + sqrt(500) + 3 + -5). -190sqrt(5) + 15 Simplify ((sqrt(425) + (sqrt(425) - (sqrt(425) + 0)) + 4)-1 + (sqrt(425) + (sqrt(425) - sqrt(425)2) + -2 - sqrt(425)) + -2)*2 + 3 + -5. 160sqrt(17) + 1762 Simplify ((1sqrt(6300))/(sqrt(36) - -2sqrt(36)) + 5(sqrt(700) + -2 + sqrt(700)) + -1)2. -6710sqrt(7)/3 + 652264/9 Simplify (-36(sqrt(3388) + sqrt(3388) + -3))*2 + (-1-3-2sqrt(112))*2. -85536sqrt(7) + 4397796 Simplify (-5(sqrt(170) - (2sqrt(170) - sqrt(170))6 - sqrt(170) - -5(sqrt(170) + 2sqrt(170))))/(2(-4-2sqrt(490) + sqrt(490))). -5sqrt(17)/14 Simplify -4 + (((sqrt(162)-12 + -2)6)*2 - (((2 + 0 + sqrt(162))4)*2 + 3)). 2016sqrt(2) + 20809 Simplify 2 + sqrt(2) + -5 + 1(sqrt(2) + sqrt(16)/sqrt(8)) - (-5 + (sqrt(10) - sqrt(1000)-2)/sqrt(5))*2. -910 + 213sqrt(2) Simplify ((42sqrt(153) + sqrt(153) + (-2sqrt(153) + sqrt(153))-3)/((sqrt(99) - 1-1sqrt(99))/(sqrt(77)/(sqrt(28)/sqrt(4)))))*2. 612 Simplify (-3(-5sqrt(171)2 - sqrt(171)2-4))/(-3sqrt(576)-2 + sqrt(576) + 2sqrt(576)-4). -3sqrt(19)/4 Simplify -4-4(sqrt(242)-2)*2 + ((sqrt(8) - (sqrt(24)/sqrt(3)-4 + sqrt(8)))/(sqrt(4) - ((sqrt(28)/sqrt(28) - sqrt(4)) + sqrt(4))))*2. 15616 Simplify (sqrt(512) - (sqrt(512)2-4 - sqrt(512)) - 4(sqrt(512)1 - sqrt(512)))/(-1(sqrt(4) + sqrt(16)) - (sqrt(1764) - sqrt(4))). -80sqrt(2)/23 Simplify -3(2 + -1 + (sqrt(63) - (2 + sqrt(63))) + 2)5-64. 360 Simplify ((-4 + 2 + sqrt(704) + sqrt(704))1-3 + (sqrt(33)/sqrt(3)5 + 4 + sqrt(22)/sqrt(2))-1 + 5)2. -756sqrt(11) + 32125 Simplify ((-5sqrt(152)2 - (sqrt(152) - -2sqrt(152))1)1)/((sqrt(216)-3)/(4sqrt(6)/sqrt(2)))-2. -104sqrt(19)/9 Simplify -3sqrt(24)/(sqrt(36)/sqrt(3)-4) - (sqrt(12)21)/(sqrt(60)/(2sqrt(10))). -13sqrt(2)/4 Simplify -2(-2 + (sqrt(243) + ((sqrt(243) + -1 + sqrt(243))*2 - sqrt(243)))4) + (2 + (sqrt(192) - (sqrt(192) + 0)) + 5 + 1)*2. -7716 + 288sqrt(3) Simplify -4((2(0 + sqrt(176))4)2 + -1 + (1 + sqrt(891) + sqrt(891) + 5 + sqrt(891))2). -77272 - 1296sqrt(11) Simplify -3 + sqrt(147) + 1 + 5 + ((sqrt(132)/(sqrt(8)/sqrt(2)))/((sqrt(11)1 + sqrt(11))5))*2 + 1. 403/100 + 7sqrt(3) Simplify -2 + -6(((sqrt(288) - (-2 + -3 + sqrt(288))2) + sqrt(288))-2 - (((sqrt(288) - (sqrt(288) + -3 - sqrt(288)))-5)2 + 4)). 12528sqrt(2) + 40816 Simplify -5(-6sqrt(48) + 0 + -1sqrt(1728) + 1)2. -34565 + 480sqrt(3) Simplify (3 + 2-3(2 + sqrt(704) + -4 - sqrt(704) - sqrt(704) - (sqrt(704) + 0 + sqrt(704) + 5)))*2. 12960sqrt(11) + 230121 Simplify -1(3 + 1 + (-3 + sqrt(171)-1 - sqrt(171) - -5-1sqrt(171))*2). -8392 - 126sqrt(19) Simplify (-5(sqrt(36) + sqrt(36)-4)-4)/(sqrt(432)-2-5). -sqrt(3) Simplify 1 + (-4 + -1(sqrt(2299) - (-2 + -2sqrt(2299))2) - (sqrt(2299)-3 + -5 + (sqrt(2299) + ((sqrt(2299) - -3*sqrt(2299)) + sqrt(2299)	{ "pile_set_name": "DM Mathematics" }
- 6. Let r be a(5). Let o = 202 - r. Let h = 190 + -179. What is the highest common factor of h and o? 11 Let s = 313 - 2008. Let n be s/(-27) + 4/18. What is the highest common divisor of 7 and n? 7 Let o(h) = h*3 + 14h*2 + 14. Let p be o(-14). Let g = 27 - p. Calculate the greatest common factor of g and 13. 13 Let f(i) = 6i*2 - 2i - 11. Let l be f(5). Let j = l + -30. What is the highest common factor of 9 and j? 9 Let g = 2693 + -1856. Calculate the highest common divisor of g and 31. 31 Let h be (-15 + 16)/((-1)/(-62)). Let f be (-2)/(-8) - (-1855)/20. What is the greatest common factor of f and h? 31 Let r be 0/(-15) + (69 - -1). What is the greatest common divisor of r and 4? 2 Let b be 3 - (1 + 3) - 78/(-6). Let f be 2 + -2 - (4 + -4). Let g = f + 3. Calculate the greatest common factor of g and b. 3 Suppose -4z = 64 - 196. Let g = z - -5. What is the highest common divisor of 266 and g? 38 Let l = 192 - 172. What is the highest common divisor of l and 540? 20 Let y(f) = -4f + 162. Let k be y(33). What is the highest common divisor of 195 and k? 15 Suppose 0 = -5t + 13 + 12. Suppose -tq - 5 = -20. Calculate the greatest common factor of 2 and q. 1 Let p be (-2)/(-6) + 195/9. Let t(c) = 5c - 9. Let v be t(4). Let q = v + 22. Calculate the highest common factor of q and p. 11 Suppose 0 = 2y + 3n + 8, 3n - 4n - 12 = -4y. Suppose 150 = 3f + yf. What is the greatest common divisor of 45 and f? 15 Let d be ((-11)/(-3))/((-1)/(-33)). Suppose 8l + 32 = 120. What is the highest common factor of d and l? 11 Let h = 1424 - 1209. What is the highest common divisor of h and 15? 5 Let p be (((-27)/(-6))/(-1))/(33/(-44)). Calculate the greatest common divisor of p and 12. 6 Suppose -405 = -5u + 65. What is the highest common factor of 47 and u? 47 Suppose 2v - 3d = v + 12, 6 = v - d. Suppose -15 = 2l + vl. Let n be l - -19 - (-2 - 0). What is the greatest common divisor of n and 45? 9 Suppose -5z = s - 316, -s - 54 - 78 = -2z. What is the highest common divisor of 120 and z? 8 Let r be ((-16110)/450)/(2/20-2). Calculate the highest common divisor of r and 1. 1 Suppose -418n + 419n = 50. Calculate the highest common divisor of n and 2. 2 Suppose 80n - 100 = 75n. Suppose o - 45 = -5i, -2i + 27 = 2o + 1. Calculate the highest common divisor of i and n. 4 Let c(m) = -229m - 3. Let g be c(-2). Calculate the greatest common divisor of g and 35. 35 Suppose -3n + 2n = -33. Let g = 40 - n. What is the greatest common factor of 7 and g? 7 Let t = 501 + -225. Suppose 2i = -5v + 126, 4i - 3v + v = t. What is the greatest common divisor of 51 and i? 17 Suppose -7v + 716 = 639. Suppose w = 3q + 166, 0 = w + 5q + 41 - 191. Suppose 5a = w + 5. Calculate the highest common factor of v and a. 11 Suppose f - r = -2r + 29, -57 = -2f - r. What is the greatest common divisor of f and 8? 4 Suppose -2c + 16 + 58 = 0. Let r be 7/(-21) + c/3 - 1. What is the highest common divisor of r and 176? 11 Suppose n + 1 - 4 = 0. Suppose 7f - 48 = nf. Let m be (1 - 3)(-378)/f. What is the greatest common factor of m and 7? 7 Let i(y) = -136y - 214. Let n be i(-6). What is the highest common factor of 14 and n? 14 Let f(b) = b*3 + 9b*2 - 12b - 7. Let g be f(-10). Calculate the highest common factor of g and 1651. 13 Suppose 0 = u, -i = 2i + 4u - 12. Suppose -y - 2q + 48 = 3q, -y + 43 = iq. Calculate the highest common divisor of 115 and y. 23 Let z(y) = -2y*2 + 17y + 11. Let p be z(9). Let x be 85/p + 5/(-10). What is the highest common divisor of x and 210? 42 Suppose 4d - 50 = -d. Suppose -3v - 1 = -d. Suppose -y + 1 = h, 2y + 2h = -vh - 1. What is the greatest common factor of 22 and y? 2 Suppose -947 = -5m + 2b, -946 = -17m + 12m + b. What is the greatest common factor of m and 81? 27 Let n = 5 - 2. Suppose u + 2s - 8 = 1, -4s + 16 = 0. Suppose -u = ni - 7. What is the highest common factor of i and 10? 2 Let i(y) = -8y - 36. Let w be i(7). Let f = w - -102. Calculate the highest common divisor of 20 and f. 10 Let s = 83 - 61. Suppose 0 = 3h - 2n - 140 - 578, -4h = -5n - 948. Calculate the greatest common divisor of s and h. 22 Let i be (480/(-1280))/((-5)/80). Suppose 2q = -5o - 0q + 266, 5o - 2q = 274. Let d = o + -36. Calculate the greatest common divisor of i and d. 6 Let p(n) = -8n - 49. Let o be p(-5). Let r be 5015/(-10)3/o. What is the highest common factor of 25 and r? 25 Suppose -2q - 1120 = -6q. Let c = 1301 + -1266. What is the greatest common divisor of q and c? 35 Let a(c) = c2 - 3c - 5. Let l be a(9). Let b = 26 - 18. Suppose bx - 53 - 3 = 0. Calculate the greatest common factor of l and x. 7 Let h = -11 + 171. Suppose 4d + 100 = 9d. What is the highest common divisor of h and d? 20 Suppose -4i - 1 - 3 = -5o, -3i = 2o - 20. Let l be 4/(i/(-162)-3). Suppose 7h - h = 108. What is the highest common factor of l and h? 18 Let o(v) = v3 + 5v*2 + 2v - 3. Let n be o(-4). Suppose -18 = ny - 6y. Suppose -p + y = 2p. What is the highest common factor of 42 and p? 6 Let x = -9 + 21. Suppose -4 = 10i - xi. Suppose 0 = 5g - q - 60, ig + 5q + 4 = 1. Calculate the highest common divisor of 99 and g. 11 Let q = 183 - 106. Suppose 3j = -3g + 15, 0 = 5j - j - g - 30. Calculate the greatest common factor of q and j. 7 Suppose 0 = -5x + 2y + 75, 4x - y = -6y + 60. Let u be 2/(-3) + 1990/x + 1. What is the highest common factor of 19 and u? 19 Let t be (-8)/(-14) - (33704/(-28))/11. What is the greatest common factor of t and 165? 55 Let y = 211 - 117. Suppose o - 11o = -7o. Suppose -5m + 56 + y = o. What is the highest common factor of m and 20? 10 Let w(g) = g*3 + 3g*2 - 11g - 1. Let s be w(-5). Let i be 6 + s5/20. Calculate the highest common factor of i and 1. 1 Let b = 11 + -21. Let l be -32 + -1 - (-30)/b. Let n = l + 53. What is the highest common factor of 153 and n? 17 Suppose 0 = -5z + 4t + 2974, z + 40 = 5t + 639. What is the highest common divisor of 36 and z? 18 Suppose -3t + 899 = m, 3m - 1671 = -2t + 1019. What is the highest common factor of 7 and m? 7 Let d be 1/(1/(-463) - 0). Suppose -q - q = -c + 658, -q - 3c - 343 = 0. Let l = q - d. Calculate the greatest common divisor of l and 22. 22 Suppose 6a - 22a + 12000 = 0. Suppose -9u - a = -19u. What is the highest common divisor of u and 15? 15 Let x(h) = 21h3 - 2h*2 + 3h - 1. Let n be x(2). Suppose -2b + 3m = 389 - 428, 69 = 5b + 2m. What is the highest common factor of n and b? 15 Let u(m) be the first derivative of m*4/4 + 8m3/3 + m2/2 + 18m + 13. Let v be u(-8). Calculate the highest common divisor of 80 and v. 10 Let n be -2(-4 + 0)/4. Suppose 12 - n = x. Let l = x - -2. Calculate the greatest common divisor of l and 60. 12 Suppose -8s = 54 + 42. Let c be (8/s - -1)66. What is the highest common factor of 66 and c? 22 Let c = -1 + -2. Let o be (12 - 5)/(c2/(-162)). What is the highest common factor of 21 and o? 21 Let j(o) = -9o*2 + 83o - 5. Let h be j(9). What is the highest common factor of h and 767? 13 Suppose -2n - 23 = -383. Let s be ((-2)/(-4))/(6/n). Suppose -3p = -t + s, t + 3p - 4p - 25 = 0. What is the highest common factor of 15 and t? 15 Let a(q) = 23q - 11. Let l be a(7). Calculate the highest common factor of 75 and l. 75 Let c be (-273)/(-5) - 6/(-15). Let m = c + -24. What is the highest common divisor of 155 and m? 31 Let l(c) = c3 + 5c2 + c + 5. Let b be l(-3). Calculate the greatest common divisor of 40 and b. 20 Let o(r) = r2 + r + 93. Let a be o(0). Suppose -u + 3u - 5p - 114 = 0, 4u = 4p + 240. What is the highest common divisor of u and a? 31 Let k = 1370 + -1258. What is the greatest common divisor of k and 128? 16 Suppose 4x = -5a + 3x + 2100, 5x + 1260 = 3a. What is the greatest common divisor of a and 5? 5 Suppose -19c + 375 = 14. Calculate the highest common factor of c and 589. 19 Let v be ((-5)/5)/((-1)/65). Let p be (4 - -2)/((-27)/(-117)). What is the highest common factor of v and p? 13 Let h(p) = -p*2 - 7p - 6. Let o be h(-5). Suppose -3g - 3w + 54 = 0, -og + 4w + 5 = -27. What is the highest common factor of 104 and g? 13 Suppose -4s - 667 = 15i - 18i, 5i - 1131 = -3*s. What is the	{ "pile_set_name": "DM Mathematics" }
, 5, -2? 120 Which is the smallest value? (a) -3 (b) 0.6 (c) -2/137 a What is the third smallest value in 153, 3, 1/7, 7? 7 Which is the third biggest value? (a) 5/3 (b) -0.4 (c) -31 c What is the biggest value in 2, 0, 0.29? 2 Which is the third biggest value? (a) -3/4 (b) -0.4 (c) -0.08 a Which is the second smallest value? (a) 5 (b) 0.6 (c) 0.2 (d) 25 (e) 14 b What is the third smallest value in -0.5, -1, -79, 0.4? -0.5 What is the fourth biggest value in 0, -2/17, -0.04073, -2/3, 0.5? -2/17 Which is the second smallest value? (a) -1.2 (b) 0.192 (c) -2 a Which is the fourth biggest value? (a) -0.5 (b) -5/2 (c) 0.5 (d) 6 b Which is the second smallest value? (a) 0.2 (b) -0.5 (c) -12/25 c What is the third biggest value in 2.44, -1, -5? -5 Which is the third biggest value? (a) -3 (b) -21 (c) 9 b Which is the second biggest value? (a) 1/7 (b) -13 (c) -2/37 c Which is the second biggest value? (a) 1 (b) 0.095 (c) 1/3 (d) -3 (e) -1/4 c Which is the biggest value? (a) -3/2 (b) -2 (c) 89 c What is the third smallest value in 5, -4, 6, 106? 6 Which is the second smallest value? (a) -3/2 (b) 5 (c) -2 (d) -2/55 a Which is the third smallest value? (a) 1/3 (b) -1/4 (c) 0 (d) -14/5 c What is the biggest value in 2/9, 2/11, -2? 2/9 What is the second smallest value in -1/6, -19, 3? -1/6 Which is the smallest value? (a) -1/3 (b) -25 (c) 0.038 b Which is the third biggest value? (a) -2 (b) 2 (c) -15 c What is the biggest value in -0.5, 1/3, 1/27? 1/3 What is the third smallest value in -0.07, -0.5, 0.1, 4? 0.1 What is the second smallest value in -0.96, 0, -2/29? -2/29 What is the second smallest value in -6/7, 0.01, 2.8? 0.01 What is the fifth biggest value in -3/5, 220, 2/13, 1, 4/3? -3/5 What is the fourth smallest value in 2/9, 0, 4.3, 1? 4.3 Which is the third biggest value? (a) 5.4 (b) 2/11 (c) -0.4 (d) -2 (e) -1/5 e What is the second smallest value in -1/20, 2/29, 11? 2/29 What is the fourth smallest value in 2/11, -2/185, -0.2, -4? 2/11 Which is the second biggest value? (a) 15 (b) -1 (c) -924 b Which is the fourth biggest value? (a) -4 (b) 6/5 (c) -43.2 (d) -0.1 (e) -0.2 a What is the smallest value in -2/3, 40/33, -4? -4 What is the second biggest value in -5, 9, -1/2, 5? 5 Which is the second biggest value? (a) 0.5 (b) -0.5 (c) 6/79 (d) 3/8 d Which is the third smallest value? (a) 45 (b) -0.1 (c) -0.3 a Which is the third biggest value? (a) -1 (b) 0 (c) 100 (d) -5 a Which is the third biggest value? (a) -22 (b) -5 (c) 3 (d) 0 (e) 0.4 d Which is the smallest value? (a) 0.4 (b) -4 (c) 3 (d) 0.3 b Which is the biggest value? (a) 3/4 (b) -5/3 (c) 0 (d) 0.29 a What is the third smallest value in -2/19, -235, 0.2, -0.1? -0.1 What is the biggest value in -10/19, -1.4, -2/5, 3, -3/8? 3 Which is the third smallest value? (a) -2/9 (b) -0.2 (c) 0.6 (d) -0.1 (e) 1/43 d What is the second smallest value in 0.13, -5/4, 2, 1? 0.13 What is the smallest value in -1/32, 1/2, 0.07? -1/32 Which is the smallest value? (a) -5 (b) 1 (c) 59/3 a What is the fourth biggest value in -5, 3, 2/9, -1/4, -83? -5 What is the fifth smallest value in -5/3, 2, -2, -0.03, -1? 2 What is the third biggest value in -396/25, 3/2, -0.3? -396/25 What is the second biggest value in 0.5, 1, 0.1, 2.5, 5? 2.5 What is the fifth biggest value in -4, -3, -33, -5, 35.1? -33 Which is the second biggest value? (a) -2/11 (b) 24 (c) -4 (d) -3 (e) -5 a What is the second smallest value in 1/3, -0.1, 1/6, 1/5, 12/7? 1/6 What is the third smallest value in 1, 0, -123.1, 2, 1/4? 1/4 What is the smallest value in 2/9, 0.05, -5, -2/5? -5 Which is the second biggest value? (a) 0.2 (b) 2/5 (c) -3 (d) 2/337 a What is the biggest value in 0.3, 0.13, -126? 0.3 Which is the smallest value? (a) -5 (b) -1/6 (c) -0.02 (d) -15 d Which is the biggest value? (a) -6/17 (b) -22 (c) -0.3 (d) 5 d Which is the smallest value? (a) 0.3 (b) -18/7 (c) -5 (d) 1/10 c Which is the second biggest value? (a) 5 (b) -70/9 (c) -0.5 c What is the smallest value in -2, 1, 0.014? -2 What is the second biggest value in -2/7, 4, -0.3? -2/7 Which is the biggest value? (a) 1514 (b) 5 (c) -4 (d) -2/17 a What is the third biggest value in 12, -0.5, -2, -1? -1 Which is the second smallest value? (a) -2.2 (b) -1 (c) -8 a Which is the second biggest value? (a) -0.3 (b) -1.3 (c) 1/5 (d) 0.4 c Which is the third biggest value? (a) 4 (b) -17 (c) -2/7 b What is the biggest value in -3, 5, -1/6, -17? 5 Which is the biggest value? (a) 2/11 (b) -11 (c) -1 (d) 9 d What is the second smallest value in 0.4, -0.2, -1/9, -1, 1/7? -0.2 What is the fifth smallest value in -26, 0.4, 3, -2/17, 19? 19 Which is the third smallest value? (a) -2/9 (b) -0.05 (c) 3 (d) -3 (e) 0.1 b Which is the smallest value? (a) 57 (b) 0.3 (c) -5 c What is the fifth smallest value in -0.2, -5, -2, -16/5, -0.3? -0.2 Which is the second smallest value? (a) -1/7 (b) 3 (c) 0.26 c What is the smallest value in 14, 0.2, -4, 2/23? -4 What is the fourth biggest value in 1/2, -4, 2/13, 2/85? -4 Which is the smallest value? (a) 7 (b) 3 (c) 1/3 c What is the second smallest value in 318, 4, 0.09? 4 What is the smallest value in 6/11, -0.1, 6/5, -3/74? -0.1 What is the smallest value in 26, 2/5, -3? -3 What is the third biggest value in 40, 2, -2/3, -2, 0.2? 0.2 Which is the biggest value? (a) 1/6 (b) 6 (c) -1 (d) -1/5 b Which is the second smallest value? (a) -0.7 (b) 0.1 (c) 3 (d) 5 b Which is the biggest value? (a) 0.18 (b) 4 (c) 0.5 (d) 0.04 b Which is the second smallest value? (a) 0.21 (b) 2/23 (c) -2 b What is the second biggest value in 0.9, -3, 3? 0.9 Which is the biggest value? (a) 0 (b) -5 (c) 1 (d) -16 c What is the second smallest value in 0, -0.055, 2/3, 4? 0 What is the second biggest value in 2/3, 1/2, 1? 2/3 Which is the third smallest value? (a) 1 (b) -29 (c) 0.7 a What is the smallest value in 2/3, -4, -44? -44 What is the second smallest value in -202, -29, -0.3? -29 Which is the smallest value? (a) -4 (b) 2/7 (c) -10/3 (d) 0.2 (e) -0.4 a What is the biggest value in 1, 4, -258? 4 What is the second smallest value in -4/11, 24, -0.09? -0.09 Which is the second smallest value? (a) -0.4 (b) -1 (c) -4 (d) 0.5 b What is the third biggest value in 2, 3, -4/9? -4/9 What is the smallest value in 5, -3, -101? -101 Which is the third smallest value? (a) -3/11 (b) -7/4 (c) 15 c What is the second smallest value in 3, -5, -1, 0.4? -1 What is the third biggest value in -4, -5, -1, 2, 19/4? -1 Which is the third smallest value? (a) -0.1 (b) 1 (c) -2.6 b What is the smallest value in 2, 310, -0.2, -3/7? -3/7 Which is the biggest value? (a) 1 (b) -0.1 (c) -16 (d) 109 d What is the third smallest value in 1/10, 17/3, -0.034? 17/3 What is the third biggest value in -4, -0.1, 41? -4 What is the third biggest value in -11, -7, -1/5? -11 Which is the third smallest value? (a) -2/5 (b) 60 (c) -2 b Which is the third biggest value? (a) 5 (b) -66 (c) -3 (d) -1/4 c Which is the second biggest value? (a) 11 (b) 1142 (c) -1 a Which is the second biggest value? (a) 0.5 (b) -3 (c) -68 b What is the third smallest value in 0.4, -38, 2, -6/11? 0.4 Which is the third smallest value? (a) 3.4 (b) 10/9 (c) 0.02 a What is the biggest value in 2/3, -4, 1, 2, -2? 2 Which is the fourth smallest value? (a) -0.5 (b) -5.9 (c) -0.2 (d) 24/5 d Which is the second smallest value? (a) 3 (b) 0.46 (c) -2/7 (d) -1/7 (e) 0.5 d What is the fourth biggest value in 2, 3/5, 0, 964? 0 Which is the biggest value? (a) 2 (b) -1/7 (c) 1/8 (d) -1 (e) 2/5 a Which is the fourth biggest value? (a) 1 (b) 0.047 (c) 2/15 (d) -0.05 d Which is the fourth smallest value? (a) -0.1 (b) 2 (c) 0.1 (d) 1/4 (e) 2/7 e What is the second smallest value in 6, -2/21, -1/3? -2/21 What is the second biggest value in -2/1753, 1, -2, 0.2, -0.1? 0.2 Which is the third biggest value? (a) 0.2 (b) 2/39 (c) 3 (d) -5 (e) 3/5 a Which is the second biggest value? (a) 0 (b) 5 (c) -0.3 (d) 741 b Which is the second smallest value? (a) 1 (b) -2 (c) -1/4 (d) -12 b What is the biggest value in -1/7, 48, 2/9? 48 What i	{ "pile_set_name": "DM Mathematics" }
be the second derivative of -5l3/6 - 20l. Let h(p) = -67p + 140p - 72p. What is c(h(i))? -5i Let y(i) = 19i2. Let c(o) = -202303o. Determine y(c(f)). 777603572371f2 Let q(k) = 2k*2. Let b(z) = -393159z*2. Give q(b(j)). 309147998562j*4 Let l(m) = 186m. Let a(k) = k*2 - 5k + 1. Let i(s) = 8s2 - 45s + 9. Let n(p) = -18a(p) + 2i(p). What is l(n(w))? -372w2 Let o(r) = 662r2. Let p(x) = -x2 - 20x. What is p(o(j))? -438244j*4 - 13240j*2 Let f(u) be the second derivative of -3u*4/4 + 253u. Let o(x) = x*2 + 2x*2 - 4x*2. What is f(o(v))? -9v*4 Suppose 5r - 23 = -33. Let d(g) = 38g - 4. Let j(c) = 19c - 2. Let a(x) = rd(x) + 5j(x). Let p(z) = z. Determine a(p(s)). 19s - 2 Let v(g) = 4g - 7. Let k(d) = 5d2. Let s(b) = -28b*2. Let f(c) = 11k(c) + 2s(c). Give f(v(w)). -16w*2 + 56w - 49 Let z(y) = 24y. Let b(x) be the second derivative of 7x*3/6 + 2x + 6. Give z(b(j)). 168j Let c(d) = 21d - 53d - 3d2 - 158 + 158 + d2. Let x(i) = 6i. Give x(c(z)). -12z*2 - 192z Let d(r) = 31r2 + r. Let f(n) = -3n - 6. Let u(c) = 12c + 26. Let a(k) = -26f(k) - 6u(k). What is a(d(j))? 186j*2 + 6j Let x(h) = -2h. Let z(p) = 223573p*2. What is z(x(k))? 894292k*2 Let h(b) be the first derivative of 28b*3/3 - b + 549. Let c(f) = 8f*2. Calculate h(c(q)). 1792q4 - 1 Let w(c) = -c2. Let p(r) be the first derivative of 7r6/360 + 7r*3/3 + 30. Let q(u) be the third derivative of p(u). Calculate q(w(f)). 7f*4 Let f(i) = 205i - 392i + 196i. Let y(p) = 2p. Let b(z) = -2z. Let k(r) = -2b(r) - 3y(r). Determine f(k(u)). -18u Let q(i) = 144i + 4. Let n(s) = 18s2. What is q(n(c))? 2592c*2 + 4 Let n(m) = -22m*2. Let k = 4 + 4. Suppose -3w - 29 = -z - kw, -3z = -4w - 11. Let p(a) = -z - a + 9. Calculate n(p(b)). -22b*2 Let r(y) = 4 - 7y - 4. Let u(n) = -2n2 - 3. Let j(q) = q2 + 1. Let w(d) = 6j(d) + 2u(d). What is r(w(b))? -14b*2 Let f(z) be the third derivative of 0 + 0z - 8z2 + 0z*3 - 7/8z*4. Let o(v) = -v. Calculate f(o(s)). 21s Let l(k) = 3k - 6201. Let q(m) = -m. Calculate l(q(h)). -3h - 6201 Let d(a) = -a + 312 + 0a - 292 + 2a. Let x(i) = -i. Give x(d(u)). -u - 20 Let g(t) be the first derivative of -t*5/15 + 10t*2 - 31. Let o(h) be the second derivative of g(h). Let j(a) = 6a. What is j(o(u))? -24u2 Let h(k) = -k + 1. Let c(q) = -6q + 7 + 6q - 5q - 3q. Let b(l) = 3c(l) - 21h(l). Let t(f) = -13f. What is t(b(i))? 39i Let w(z) be the second derivative of -z4/12 - 33z. Let s(n) = -2n + 22. Determine s(w(m)). 2m*2 + 22 Let p(a) = -8a2. Let l(x) be the third derivative of x4/6 - 22x2 + 3. What is l(p(k))? -32k*2 Let i(j) = 8j. Let h(k) = 11590k2. Give h(i(l)). 741760l*2 Let b(t) = -2t*2. Let v(o) = -17o*2 - 6o. Suppose 0r - 5r = 30. Let l(y) = y*2 + y. Let s(d) = rl(d) - v(d). Give b(s(f)). -242f4 Let w(d) = 102d*2 - 17d - 17. Let v(r) = -25r2 + 4r + 4. Let q(i) = 17v(i) + 4w(i). Let o(l) = -4l2. Determine o(q(y)). -1156y*4 Let n(z) = -2z. Let k(i) = 7i2 + 158i + 12. Let c(m) = 6m2 + 159m + 10. Let w(o) = -6c(o) + 5k(o). Calculate n(w(a)). 2a2 + 328a Let m(u) = -13u2 - 3 + 3 + 15u*2. Let i(c) = 2c - c + 3c + 2c. Let y(b) = -19b. Let r(s) = 7i(s) + 2y(s). Give r(m(p)). 8p2 Let f(u) = u2 + 10u + 23. Let t be f(-7). Let o(y) = 190 + 2yt + 189 - 379. Let k(z) be the third derivative of -z5/30 - z*2. What is o(k(m))? 8m*4 Let q = -102 - -106. Let a(n) = qn - 32n + 4n - 31n. Let t(w) = -2w*2. Give a(t(s)). 110s*2 Let w(m) = m + 4. Let q(d) = -2. Let z(t) = -2q(t) - w(t). Let k(o) = 110o2. Give k(z(u)). 110u*2 Let y(k) = 24k*2 + 2k - 6k + 4k - 19k2. Let v(g) = g + 6g + 2g. Give y(v(b)). 405b*2 Let a(g) be the first derivative of 4g*3/3 + 27. Let f = -7 - -10. Let c(q) = q - fq + 5q. What is c(a(x))? 12x*2 Suppose 0 = -2j + 7 - 1. Let o(c) = 3 + 1 - 2 - j. Let w(d) = 4d - 22. Let h(y) = -132o(y) + 6w(y). Let b(l) = l2. Calculate b(h(t)). 576t*2 Let c(x) = 28110x*2. Let l(i) = -5i*2. What is l(c(n))? -3950860500n*4 Let k(v) = 3v*2. Let g = -77 - -79. Let w(a) = -23a*g + 20a*2 - 5 + 5. Calculate k(w(s)). 27s*4 Let w(n) = 22n - 26. Let k(v) = 16v. What is k(w(h))? 352h - 416 Let n(f) = 28f - 3. Let j(i) = -2181i*2 + 1092i*2 + 1090i*2. Give j(n(s)). 784s*2 - 168s + 9 Let y(x) = 21x. Let u(j) = 551j - 58. Let r(q) = 29q - 3. Let p(k) = 58r(k) - 3u(k). Give p(y(o)). 609o Let o(x) = -2x. Let q(t) = -258t*2 - 4t - 3. What is o(q(s))? 516s2 + 8s + 6 Let t(g) = -257g. Let v(m) = 2 + 2381m - 2 - 2382m. Determine v(t(q)). 257q Let u(k) = 1293k2. Let m(c) = 116c. Give m(u(n)). 149988n2 Let c(z) = 413z*2. Let g(t) = -532t. Give g(c(r)). -219716r2 Let n(g) be the second derivative of -g3 - 46g. Let y(c) = c*2. Calculate n(y(k)). -6k2 Let s(w) = -w2. Let b(p) = -6993p2 + 185p. Let d(n) = 76n2 - 2n. Let i(a) = -4b(a) - 370d(a). What is i(s(t))? -148t4 Let k(c) = -2c2. Let t(y) be the third derivative of y4/24 - 502y2. Calculate t(k(p)). -2p*2 Let n(h) = -442106h. Let d(x) = -2x2. What is d(n(a))? -390915430472a*2 Let b(i) = 2i*2. Suppose -4p + 36 = -5a, 0a = -2p + 5a + 28. Let x(w) = p - 3w2 - 4. Give x(b(f)). -12f4 Let m(c) be the third derivative of -c7/84 + c*5/20 - 29c*2. Let u(d) be the third derivative of m(d). Let q(i) = i. Give q(u(k)). -60k Let a(s) = s. Let n(m) = -57m. Let r(t) = -285t + 1 - 599t - 1. Let l(f) = -78n(f) + 5r(f). Determine l(a(b)). 26b Let f(m) = 3m + 6m - 5m. Let i(q) = q3 - 14q*2 - 30q + 4. Let s be i(16). Let w(x) = -s - 3x - 2x + 36. Give w(f(c)). -20c Let h(m) be the second derivative of m4/4 - 16m. Let u = 7 + -2. Let y(o) = 3o2 - uo2 - o2. Give h(y(b)). 27b4 Let c(z) = z. Let n(f) = f2 + 10f. Let y(u) = u*2 + 11u. Let v(q) = -4n(q) + 3y(q). Give c(v(r)). -r*2 - 7r Let q(a) = 7a2 - 5a - 5. Let h(z) = -4z2 + 3z + 3. Let l(y) = 5h(y) + 3q(y). Let t(f) = -4f2 + 5 - 79f - 75f + 154f. Determine l(t(u)). 16u4 - 40u*2 + 25 Let p(l) = -2l*2. Let r(w) = 28 - 3w*2 + 25 - 50. Calculate r(p(v)). -12v4 + 3 Let k(g) be the second derivative of g4/12 - g. Let r(h) = -225h - 5. Let q(p) = 313p + 7. Let m(t) = -13q(t) - 18r(t). Give k(m(o)). 361o2 + 38o + 1 Let v(c) = -2c2. Let a(w) = 4254w*2 + 1. Determine a(v(y)). 17016y4 + 1 Let t(x) = -x2 - 3. Let z(o) = -2o2 - 7. Suppose -3j - 4 = 23. Let n = j - -2. Let m(c) = nt(c) + 3z(c). Let f(k) = -2k. Calculate f(m(r)). -2r*2 Let s(b) = 76b2 + b. Let k(d) be the first derivative of -d2/2 - 18. Calculate k(s(o)). -76o2 - o Let j(q) = 13q. Let l(o) be the first derivative of 12o2 - 106. Give l(j(f)). 312f Let c(n) = -74 + 76n + 52 + 22. Let d(x) = -3x*2. Calculate d(c(k)). -17328k*2 Let i(l) = -5l*2. Let a(w) be the third derivative of 7w*4/4 + 75w*2. Give a(i(b)). -210b*2 Let x(q) be the second derivative of -3q*3 + 14q. Let r(f) be the third derivative of f*4/12 + 4f*2. What is r(x(l))? -36l Let y(p) = 21p + 6. Let f(k) = 24k + 7. Let l(s) = 6f(s) - 7y(s). Let u(m) = -2m - 16. What is u(l(z))? 6z - 16 Suppose q - 3k + 5k + 5 = 0, -7 = -5q - 2k. Let c(o) = -o - 3. Let g(u) = 2u + 7. Let i(n) = qg(n) + 7c(n). Let p(d) = 2d*2. What is p(i(x))? 2x*2 Let f(d) = -2d. Let r(q) = 12 - 5 - 15q - 5 - 21q. Determine r(f(g)). 72g + 2 Let b(r) = 268r. Let z(q) = -6q2 + 16. Give b(z(s)). -1608s*2 + 4288 Let p(i) = 57i*2. Let t(u) = 917u*2. What is t(p(b))? 2979333b*4 Let n(z) = 2z*2. Let u(y) = 16183y. Calculate u(n(x)). 32366x2 Let x(s) = -2227s - 1. Let v(y) = -92y - 6. Determine v(x(r)). 204884r + 86 Let f(i) = -i + 1. Let l(w) = -8w + 7. Let k(m) = 42f(m) - 6l(m). Let b(s) be the third derivative of -s4/3 - 581s*2. Determine b(k(h)). -48h Let h(t) = 20t2 - 3194t + 3194t. Let n(z) be the third derivative of z5/60 + z2. Determine h(n(y)). 20y*4 Let u(h) = 180h - 2. Let o(b) = -b*2 - 117b. Give o(u(y)). -32400y2 - 20340y + 230 Let b(v) be the first derivative	{ "pile_set_name": "DM Mathematics" }
es next: -26, -19, -12? -5 What comes next: -215, -229, -255, -299, -367, -465? -599 What comes next: -37, -33, -27, -19, -9? 3 What is next in 402, 401, 400, 399, 398, 397? 396 What is the next term in 100, 118, 138, 160, 184, 210, 238? 268 What is the next term in -629, -630, -631, -632? -633 What is the next term in -41, -72, -103? -134 What comes next: 7, 7, 1, -11, -29? -53 What is next in -37, -143, -315, -547, -833, -1167, -1543? -1955 What is the next term in -140, -125, -94, -41, 40? 155 What comes next: -73, -156, -239, -322, -405, -488? -571 What comes next: -839, -1679, -2519, -3359? -4199 What is the next term in 38, 26, -16, -106, -262, -502, -844, -1306? -1906 What comes next: 233, 460, 687, 914, 1141, 1368? 1595 What comes next: 7177, 7179, 7181, 7183, 7185? 7187 What is the next term in -13, 8, 45, 98, 167, 252? 353 What comes next: 15, 47, 53, 27, -37, -145, -303? -517 What is next in -2173, -2173, -2165, -2143, -2101? -2033 What comes next: -40, -69, -84, -79, -48, 15, 116, 261? 456 What is next in 138, -12, -270, -642, -1134, -1752, -2502, -3390? -4422 What is the next term in -19714, -19708, -19692, -19660, -19606, -19524? -19408 What is the next term in 36, 62, 88, 114? 140 What is the next term in 68, 123, 178, 233, 288? 343 What is the next term in -8, 7, 32, 67, 112? 167 What is the next term in 146, 159, 194, 263, 378, 551, 794, 1119? 1538 What comes next: -139, -155, -171? -187 What is next in 1237, 1239, 1241? 1243 What is the next term in 42, 103, 200, 351, 574, 887, 1308? 1855 What comes next: 7, 0, -21, -62, -129, -228, -365, -546? -777 What comes next: -21901, -43807, -65715, -87625? -109537 What comes next: -914, -1833, -2766, -3719, -4698, -5709? -6758 What is next in 2417, 4834, 7251, 9668? 12085 What is next in 7634, 15270, 22906, 30542, 38178? 45814 What is next in -84, -99, -110, -117, -120, -119? -114 What is the next term in 19, 5, -21, -65, -133, -231, -365, -541? -765 What comes next: -3707, -3710, -3727, -3764, -3827, -3922, -4055, -4232? -4459 What comes next: 102, 60, -52, -270, -630, -1168, -1920? -2922 What comes next: -5, -19, -43, -77, -121, -175? -239 What is next in -112, -54, 4? 62 What is the next term in 47, 121, 223, 353, 511, 697, 911? 1153 What comes next: -84, -171, -256, -333, -396? -439 What comes next: 772, 790, 808, 826, 844? 862 What is the next term in -21, -26, -43, -78, -137, -226, -351? -518 What comes next: -158, -627, -1408, -2501? -3906 What is next in -47, -67, -93, -119, -139, -147, -137, -103? -39 What is next in 52, 52, 46, 28, -8? -68 What comes next: 1215, 1216, 1219, 1224? 1231 What comes next: -877, -947, -1071, -1255, -1505? -1827 What is the next term in 772, 770, 768? 766 What is next in -113, -107, -99, -89, -77? -63 What comes next: 839, 1683, 2529, 3377, 4227? 5079 What is next in 10, 13, 18, 25, 34, 45, 58? 73 What comes next: -198, -195, -192, -189, -186? -183 What is next in -41, -34, -23, -8, 11? 34 What is next in 76, 158, 240, 322? 404 What is the next term in -22, -136, -444, -1042, -2026, -3492? -5536 What is next in 98, 393, 882, 1565, 2442, 3513? 4778 What is next in 9, 10, 23, 54, 109? 194 What is next in 185, 738, 1659, 2948, 4605? 6630 What comes next: 216, 167, 118, 69, 20, -29? -78 What is next in 4, -20, -84, -206, -404, -696, -1100, -1634? -2316 What comes next: 50, 34, 2, -52, -134? -250 What is the next term in 4, -19, -46, -71, -88, -91? -74 What comes next: -24, -11, 12, 45, 88? 141 What is next in 309, 299, 275, 231, 161? 59 What is the next term in 295, 275, 245, 199, 131, 35, -95, -265? -481 What is the next term in 267, 271, 277, 285, 295, 307, 321? 337 What is next in -29, -44, -59, -74? -89 What is the next term in -84, -105, -142, -201, -288, -409? -570 What comes next: 72, 68, 52, 18, -40, -128, -252, -418? -632 What is next in -82, -84, -86, -88, -90? -92 What comes next: -184, -366, -548, -730, -912, -1094? -1276 What is the next term in 1424, 5692, 12804, 22760? 35560 What is next in -30, -48, -92, -174, -306, -500, -768? -1122 What is the next term in -193, -382, -571? -760 What is the next term in 2033, 2031, 2019, 1991, 1941, 1863? 1751 What comes next: -263, -261, -259, -257? -255 What is the next term in -199, -213, -253, -331, -459? -649 What is next in -466, -468, -470, -472, -474? -476 What is the next term in -20, 34, 88, 142, 196, 250? 304 What comes next: 70, 99, 128, 157, 186, 215? 244 What is next in 911, 965, 1115, 1409, 1895, 2621? 3635 What is the next term in -35, -136, -237, -338, -439, -540? -641 What is the next term in -20, -22, -24, -26, -28, -30? -32 What is the next term in -114, -213, -310, -405, -498? -589 What comes next: -91, -94, -97? -100 What is the next term in -243, -528, -827, -1146, -1491, -1868, -2283? -2742 What is next in 113, 99, 81, 59? 33 What is next in -18, -39, -58, -75? -90 What is next in -54, -106, -146, -174, -190, -194, -186? -166 What is next in 27, 104, 233, 414, 647, 932? 1269 What comes next: 16, 74, 170, 304, 476, 686? 934 What comes next: 63, 66, 69? 72 What is the next term in 230, 217, 184, 119, 10? -155 What comes next: 279, 557, 833, 1107, 1379? 1649 What is the next term in 38, 35, 30, 23, 14, 3, -10? -25 What comes next: 34, 15, -40, -149, -330, -601, -980, -1485? -2134 What is next in 94, 70, 32, -20, -86, -166, -260? -368 What is next in -355, -741, -1137, -1549, -1983, -2445, -2941? -3477 What comes next: 1012, 1013, 1024, 1051, 1100, 1177? 1288 What comes next: -146, -145, -144, -143, -142? -141 What comes next: 294, 290, 286, 282? 278 What is next in 1, 0, 1, 4, 9, 16, 25? 36 What is next in -10, -8, 4, 32, 82, 160, 272, 424? 622 What is next in 3863, 7731, 11601, 15473, 19347, 23223, 27101? 30981 What comes next: 5, 2, -1, -4, -7, -10? -13 What is the next term in 1059, 2117, 3177, 4239, 5303? 6369 What is the next term in -72, -150, -232, -318? -408 What is the next term in 289, 278, 263, 244, 221, 194? 163 What is the next term in 124, 114, 98, 76? 48 What comes next: -435, -428, -407, -366, -299? -200 What is next in 522, 517, 502, 471, 418, 337? 222 What is the next term in 16, 8, -2, -14, -28? -44 What is the next term in -1481, -2963, -4445, -5927, -7409? -8891 What is the next term in 135, 533, 1199, 2133, 3335? 4805 What comes next: 169, 722, 1635, 2902, 4517, 6474? 8767 What is next in 74, 169, 264, 359, 454, 549? 644 What is next in 16, 22, 30, 40, 52, 66? 82 What is the next term in 2729, 5479, 8241, 11021, 13825? 16659 What is the next term in -233, -236, -239, -242? -245 What is the next term in 5, 29, 71, 131, 209, 305? 419 What comes next: 37, 72, 105, 136? 165 What comes next: -97, -412, -937, -1672, -2617? -3772 What comes next: -137, -104, -59, -8, 43, 88, 121, 136? 127 What is the next term in -152, -315, -478? -641 What is next in -8, -34, -80, -146? -232 What is next in -586, -2353, -5298, -9421, -14722? -21201 What is next in 20, 49, 88, 143, 220, 325, 464? 643 What comes next: -27, -17, 5, 33, 61, 83? 93 What is the next term in -22, -60, -112, -178, -258, -352, -460? -582 What comes next: -15, -34, -65, -108, -163, -230, -309? -400 What is the next term in 411, 805, 1199? 1593 What comes next: 73, 147, 219, 289, 357, 423, 487? 549 What comes next: -27, -51, -81, -117, -159, -207, -261? -321 What is the next term in 7, 15, 33, 67, 123, 207? 325 What is the next term in -4389, -4393, -4399, -4407, -4417, -4429? -4443 What is the next term in -2050, -4107, -6164? -8221 What is the next term in -13, -14, -15, -16, -17, -18? -19 What is next in -13, 2, 17, 32, 47, 62? 77 What is the next term in 3107, 6218, 9329? 12440 What is next in -73, -290, -665, -1210, -1937? -2858 What is next in -33, -27, -11, 21, 75? 157 What is the next term in 2301, 2297, 2291, 2283, 2273? 2261 What is the next term in 250, 259, 282, 325, 394, 495, 634, 817? 1050 What is the next term in 3159, 12637, 28443, 50583, 79063? 113889 What comes next: -22, -24, -26, -28, -30, -32? -34 What comes next: -182, -173, -164, -155, -146? -137 What is the next term in -7, 10, 53, 134, 265, 458, 725, 1078? 1529 What comes next: -655, -651, -645, -637, -627, -615? -601 What is the next term in -9, -12, -17, -24, -33? -44 What comes next: -14, -5, 8, 25, 46? 71 What is the next te	{ "pile_set_name": "DM Mathematics" }
6 Let z be 615/124 - (4 + 0). Suppose -2u + 3j = 191, 291 = -7u + 4u + 3j. Let t = u + z. What is the hundreds digit of t? 1 Let u = 41 - -843. Suppose -2n - 3j + 2402 = 0, -n + u = -3j - 317. What is the tens digit of n? 0 Let q(m) = -m3 + 25m*2 + 7m + 5. Let o be q(26). Let f = o - -1259. What is the units digit of f? 0 Let n be 123(-3)/62. Let l = n - -346. What is the tens digit of l? 2 Suppose 145v - 5199388 + 2018170 = 1536357. What is the hundreds digit of v? 5 Let a(f) = -f2 - 8f - 1. Let v be a(-7). Suppose 22 = -vm + 106. Suppose 0 = mg - 12g - 224. What is the tens digit of g? 1 Suppose -11q - 5 + 27 = 0. Suppose qd = p - 281, 5p + d = -0d + 1438. What is the tens digit of p? 8 Let o be 45528/48 + (-2)/4. Let g = 143 + o. What is the hundreds digit of g? 0 Suppose 56m - 599891 = 91485. What is the hundreds digit of m? 3 Let m(p) = 20p2 + 34p + 277. What is the tens digit of m(-11)? 2 Suppose n + 4h = 2, -6 = -n - 2n + 5h. Suppose 2f = 4d - 4882, -437 + 2873 = nd - 2f. What is the thousands digit of d? 1 Let x = -5194 - -3649. Let t = -337 - x. What is the hundreds digit of t? 2 Suppose -3q - j - 134 = -6q, 4q - 196 = -3j. Let p = 94 - q. Suppose -348 + p = -4w. What is the units digit of w? 5 Let m(d) = -12d - 45. Let f be m(-4). Suppose -4k = 19 - 3, 0 = fu - k - 190. Let g = 279 - u. What is the hundreds digit of g? 2 Let h(m) be the first derivative of -72m*2 - 18m + 41. Let f be h(-8). Suppose 5w = -0l - 3l + f, 0 = 4w - 3l - 891. What is the hundreds digit of w? 2 Suppose 0 = 3a - 3x - 75, -x + 4 = -5x. Let i be (a/18)/(2/3) + -84. Let f = 3 - i. What is the units digit of f? 5 Let f(z) = -11z + 18. Let h(w) = 30w + 29w - 1 - 58w. Let a(p) = -f(p) - 2h(p). What is the tens digit of a(13)? 0 Let u be (1 - 6)/(-1 + 0). Suppose 107 = uv + 5n - 83, 5v - 3n - 230 = 0. What is the tens digit of v? 4 What is the units digit of ((10 - 54)/4 + -307)134/(-3)? 4 Suppose -9s + 4s + 4a = -66, 4s - 2a = 54. Let p(k) = 6k*2 + 24k - 27. What is the thousands digit of p(s)? 1 Let i = 150 + -144. Let a be (-8)/i + 84/63. Suppose -3t + 4t - 236 = a. What is the hundreds digit of t? 2 Suppose -4201 = -b + 4a, -29b + 24b + 21053 = 4a. What is the thousands digit of b? 4 Let a(w) = -w + 18. Let z be a(-6). Suppose 3b + 44 = -5s, 0b + z = -2b - 2s. Let g(x) = -12x - 12. What is the tens digit of g(b)? 8 What is the hundreds digit of 3 + -11 + (999 - 0/4)? 9 Suppose -10 - 21 = -3y - 4s, 0 = -5y + 4s + 41. Suppose -5m + ym = 840. What is the tens digit of m? 1 Let l(y) be the second derivative of 1/4y4 + 0 - 3/2y*2 + 31y + 1/3y3. What is the units digit of l(6)? 7 Suppose 0 = 5f - 5g - 50, f - 61g + 56g - 30 = 0. Let i be 1/(-1 + 2)323. Suppose -4q = 2u + 77 - 341, i = fq - u. What is the tens digit of q? 6 Let m = 28 + -44. Let q be (m - -15)/(-2 - (-170)/86). Suppose 2i + 109 = 5t - 118, q = t - i. What is the units digit of t? 7 Suppose 97d - 475 = 2d. Let l(m) = 5 + 9m + 36m - 4m. What is the hundreds digit of l(d)? 2 Suppose -4v - 2d = 4, 0d + 6 = 2v - d. Let j be ((-3)/2)/(v/(-10)). What is the tens digit of (-1041)/(-5) + 6 + (-93)/j? 0 Suppose 2p = 4c - 43086, 5c - 122p - 53865 = -117p. What is the hundreds digit of c? 7 Suppose -3p + 3x = -7776, -7778 = 3p - 6p + x. Let m = p + -1783. What is the units digit of m? 0 Let n(a) = 2665a*2 + 266a + 1331. What is the tens digit of n(-5)? 2 Let v(i) = 5808i - 2297. What is the ten thousands digit of v(3)? 1 Suppose 3p = 2u + 5407, -u - 1393 - 2213 = -2p. Let y = p + -834. What is the tens digit of y? 7 Let s(r) be the second derivative of 0 - 16r + 1/12r*4 - 13/6r*3 - 49/2r*2. What is the tens digit of s(20)? 9 Let l(g) = 6g*2 - 41g + 2. Let n be l(-9). Let f = n + -257. What is the hundreds digit of f? 6 What is the hundreds digit of (6641/(-551) - 4/(-76))4118/(-4)? 3 Suppose 43c = -2y + 40c + 11231, 22454 = 4y - 2c. What is the hundreds digit of y? 6 Let p = -7138 + 19422. What is the units digit of p? 4 Suppose -u = -3d + 7, 2d - u - 11 = -2d. Let t be ((-66)/55)/(d/(-310)). Suppose -6g + t = -3g. What is the units digit of g? 1 Suppose 3b - 4g = -5g + 54151, -3b - 5g = -54179. What is the hundreds digit of b? 0 Suppose -16b - 105 = -25. What is the hundreds digit of (3 + b + 0)-250? 5 Let n(r) = -r*2 - 9r - 5. Let v be n(-8). Let x be (428/20 + v)-5. Let g = x + 325. What is the hundreds digit of g? 2 Suppose 3z - 2p + 35 = 0, -2z - 27 = p - 6. Let v = -15 - z. What is the tens digit of 0 + v + (-1 - -122)? 1 Let h = 4322 - 2808. Suppose -15j + h = -721. What is the tens digit of j? 4 Let y = -263 - -281. Suppose -yr = -16r - 2374. What is the units digit of r? 7 Suppose -28930 = -2l + 5j, -21j - 14487 = -l - 24j. What is the ten thousands digit of l? 1 Suppose -17u + 654 = -468. Suppose -u = -4c + 3x + 490, -5c - 2x = -695. Suppose r = 81 + c. What is the units digit of r? 0 Let u(b) = 45b - 23b - 21b + 16. Let n be u(-14). What is the tens digit of ((n + -3)10)/((-4)/34)? 8 Let v(g) = 26g + 77. Suppose -3l + 12 = -4x - 14, -29 = -3l + x. What is the hundreds digit of v(l)? 3 Let p(a) = -2a3 - 5a*2 - 24a + 136. What is the hundreds digit of p(-14)? 9 Let y(s) = 95s2 - 139s - 926. What is the thousands digit of y(-6)? 3 Let i = 3350 + -1430. Suppose 0 = -228j + 223j + i. What is the tens digit of j? 8 What is the units digit of (1 - (1 + 1))/((-16)/32)? 2 Let y = 22851 + 4021. What is the ten thousands digit of y? 2 Suppose 0 = -37n - 1816 + 28308. What is the tens digit of n? 1 Suppose -p + 532 = 530. What is the units digit of (p107)/(-35 + 37)? 7 Let h(p) = -p*3 - 5p*2 - 7p - 8. Let d be h(-4). Suppose -dt - 7t = 0. Suppose -5l = -to - o + 170, -2o - 4l + 298 = 0. What is the tens digit of o? 5 Let y(a) = 2a3 + 23a*2 - 22a - 1. Let b be y(-17). What is the hundreds digit of 2/5 + b/(-10)? 2 Let m(z) = 18 + 464z - 463z - 7. Let t be m(-9). Suppose -3l = tf - 123 - 166, 5l - 486 = f. What is the tens digit of l? 9 Let j(k) = -2k*2 - 218k + 55059. What is the hundreds digit of j(0)? 0 Suppose 340c - 393c + 2909912 = 0. What is the thousands digit of c? 4 Let h(n) = 19n3 - n. Let q be 3/22(-329)/21. Let j = 48 + q. What is the tens digit of h(j)? 1 Let f be 4 + 2/(-3 + 1 - -4). Suppose fx = -2x - 98. What is the tens digit of (-45)/(-2)(x/(-10) + 1)? 5 Suppose 0 = a + 3o - 25, 0 = -a - 2a + 2o + 42. Suppose -am + 36 = -15m. Suppose z - 5k - m = -k, 3z - k = 64. What is the units digit of z? 0 Let g(p) = -3p + p - 1754 + 1723 - p. Let s be g(-11). Suppose -4c - 2x + 644 = sx, 0 = -x - 2. What is the hundreds digit of c? 1 Suppose -88180 - 156561 = -26i - 54109. What is the units digit of i? 2 Suppose 5o + b = -5, 4o = 3b + 2b - 33. What is the tens digit of 36/(-54)(1 - (-179)/o)? 5 Suppose 316 = 3c + c - 4n, 3c - 5n - 237 = 0. Let q = c + -77. What is the tens digit of (-183)/((q/(-3))/(32/36))? 4 Let o(s) = -18s - 34. Let t be (((-21)/12)/7)/((-3)/60). Let p be o(t). Let q = p - -138. What is the tens digit of q? 1 Let k = -8515 + 14403. What is the units digit of k? 8 What is the tens digit of (-2 + 4/8)5/((-60)/204904)? 1 Suppose 29q - 114 = 83638. What is the hundreds digit of q? 8 Suppose -5d + 2r + 317 = 0, -5r = -5d - 0r + 320. What is the hundreds digit of -11 - (-679)/d - 3550/(-18)? 1 Let n = -255 + 258. Suppose -5i - 838 = -nx + 5, 4i = 4x - 1132. What is the units digit of x? 6 Suppose -2308 = -4r + 4m, 6r - 2m + 2332 = 10r. Suppose -5a = 161 - r. What is the tens digit of a? 8 Let j(n) = -44n*2 - 4n - 3. Let o be j(-2). Let c be 4/1-1 - (o - 8). Suppose -81 = -2h + 5d, 6d = -4h + 3d + c. What is the units digit of h? 3 Let l(f) = 21f - 4. Let r be l(6). Let i = -1946 - -1951. Suppose 5o - ig - 245 = 0, 4o - 5g - r - 79 = 0. What is the tens digit of o? 4 Let o(m) = 1701m - 4788. What is the hundreds digit of o(11)? 9 Suppose 2s = 6s - 1856. Suppose 4j + 3i - s + 45 = 0, -315 = -3j - 2i. What is the hundreds digit of j? 1 Let n(b) = -b*3 - 16b*2 - 3b + 15. Let j = -52 + 54. Suppos	{ "pile_set_name": "DM Mathematics" }
7g to l + yg*3 + zg + kg2 and give z. 2 Rearrange -646d - 450d + 356d to gd + x and give g. -740 Rearrange 59u*3 + 25u*3 + 3u*2 - 3u*2 + (5 - 5 + 2u*2)(11u - 15u - 5u) to q + bu*2 + vu*3 + xu and give q. 0 Rearrange 45p3 + 152p*2 - 301p*2 + 151p*2 to jp*3 + op + x + tp2 and give j. 45 Express 428x*4 - 265x*4 - 2x - 2x2 - 2 - 273x*4 in the form rx*4 + ix*2 + tx + o + fx3 and give o. -2 Rearrange 3v - 26 - 26 + 1 to dv + w and give d. 3 Express (-3l + 6l + l)(-3l + 0l - l)(21 + 2l - 25 + 5l) in the form jl*3 + s + wl + ol2 and give o. 64 Rearrange ((2 - 1 - 2)(-2 - 2v + 2) + 0v + v + v)(4v*2 + 0v*2 - 2v*2 + (-4 + 3 - 11)(-1 - 5v2 + 1)) to mv*3 + tv*2 + wv + q and give m. 248 Rearrange (-133 - 185 + 35)(4 - 3 - 2)(-q2 + q2 - 3q2) to oq*2 + iq + a and give o. -849 Rearrange 0k + 2k + k + (-6 + 1 + 3)(2 - 2 + 2k) + (-2k + k + 3k)(26 - 13 + 27) to a + nk and give a. 0 Express (-2g2 - 4 + 4)(40 - 40 - 33g + 2g + 0g - g - 3g - 1 + 1 + (-2 + 2g + 2)(-3 + 2 + 3) + 2g + 4 - 4) as yg*2 + j + ug*3 + qg and give u. 58 Rearrange -1 - 407d3 - 8d - 405d3 + d2 + 813d*3 to the form ld + md2 + o + td*3 and give o. -1 Express -203k + 218k + k2 + 174k in the form jk + u + dk*2 and give d. 1 Rearrange (51 - 9 + 127 - 42)(-2 - 3k + 2) to sk + r and give s. -381 Rearrange -283s2 - 376s*2 + 247s*2 to bs + rs2 + t and give r. -412 Express (-1 - 2 + 5)(-3a2 - 2a*3 + 3a*2) - 2a*3 + 188a*2 + 250a*2 - 113a*2 in the form p + ya*3 + xa + ha2 and give y. -6 Express 193 + 401u*2 - 2u*4 - 193 + (0 + 2u*3 + 0)(3u - 5u + u) in the form mu4 + a + xu + vu3 + lu*2 and give m. -4 Rearrange 2 + n + 2n - 6n - 2 - 2n + 2 - n + 2n + n + (2n - n + 2n)(-2 + 3 + 2) to l + kn and give k. 6 Rearrange 2g + 2 + 949g2 - 4 - 952g*2 - 3g*3 to qg*3 + ug + bg2 + i and give b. -3 Express 127n*3 + 130n*2 - 228 - 130n*2 + 230 in the form zn + yn3 + i + hn*2 and give i. 2 Express -838 - 18h + 2h + 2h*2 + 836 in the form qh + xh2 + l and give q. -16 Rearrange 77 - 9 + 70 - 2x to g + px and give p. -2 Express (-2253n + 2253n - 157n*3)(n + 2n - 7n) in the form vn + ln*2 + qn*4 + s + tn*3 and give q. 628 Express (4 - 11 + 14)(-2v2 + 0v*2 + 0v*2) + (2v + v - 5v)(v - 5v + 3v) as n + cv2 + tv and give c. -12 Express (3057 + p*2 - 2p*2 - 3393)(p - p - p) as hp3 + sp + ip2 + j and give h. 1 Express (q2 - 3 + 3)(-4 + 2q + 4) + 0 + 2q*3 + 0 + (-9q*2 - 10q*2 + 26q*2)(-q + 4 - 4) as lq3 + uq*2 + hq + t and give l. -3 Rearrange -6z + 38z + 64z + 55z + 57z to the form f + hz and give h. 208 Express (-b + b - b*2)(0b + 3b - b) - 5b3 - 6b*3 + 718b*2 - 717b*2 in the form kb*3 + ob + g + ub2 and give u. 1 Express (-6n - n + 46 + 5n)(1 - 1 + 2n) + (n + 1 - 1)(2n - 5n + n) + 0n2 - 2n2 + n2 as r + yn + mn*2 and give m. -7 Rearrange -17t - 4t + 1 + 68t - 12t + 3t*2 to the form pt + a + jt2 and give j. 3 Rearrange -10c*3 - 3 - 4c - 18c3 + 3c + 0c3 to wc + kc3 + mc*2 + f and give w. -1 Rearrange 28o*3 + 99o*2 - 101o*2 - 1 - 2 - 1 to jo*3 + d + ro + co2 and give d. -4 Express (-321n + 1612 - 1612)(5n + n - 4n) as kn + rn2 + u and give r. -642 Rearrange 427z - 426z + 63z*3 + 2 + 16z*3 to the form p + rz*2 + fz*3 + dz and give r. 0 Express -66n + 434n + 40n - 65n + 337n as on + r and give o. 680 Express -9h - 44 + 14h + 35 in the form l + vh and give v. 5 Rearrange (-3 + 3 + 3 - 1)(5993 - 2997 + 13x - 2990) to the form d + nx and give n. 26 Express -2q3 - 2q*3 + 6q + q*2 + 2q as zq2 + cq + yq3 + b and give z. 1 Express (-3w*4 + 2 - 2)(4 + 0 + 0 + (0 - 1 - 3)(4 + 3 - 5) - 1 - 1 + 3) as cw*2 + sw*3 + a + uw + hw4 and give s. 0 Express -3 + 10s*3 - 2s2 + s2 + 2133s - 2136s as rs3 + zs*2 + as + d and give d. -3 Express q*3 - 13q - 1223q2 + 1221q*2 - 14 + 15 as xq*2 + w + jq*3 + mq and give x. -2 Rearrange (4 + 2 - 4)(11x*4 - 15x*4 - 18x*4) - 3x*2 + 3x*2 - 4x*4 to r + ox*2 + ax + lx3 + qx*4 and give q. -48 Rearrange (-292h + 114h + 80h)(h2 + 2h2 - h2) + 0h2 + 0h*2 + 2h*3 to g + oh + wh3 + ih*2 and give o. 0 Rearrange 20 - 2l - 2l - 10l + 16l to o + vl and give o. 20 Express -61 + 61 - 34f + (1 - 2f - 1)((3 - 2 + 1)(3 + 2 - 7) + 3 - 3 + 8) - f - 2f + f in the form gf + d and give g. -44 Express -3g + 1475g2 + g3 + 6 - 1477g2 + 4g + 3g4 as ig*4 + bg*2 + pg*3 + yg + c and give i. 3 Rearrange 12o4 - o2 + 7o - 57o - 13o*4 to the form to*3 + io*2 + mo + f + wo4 and give w. -1 Express -g4 + 0 + 0 + 40g*4 + 3g*4 + 8g*4 + (3g - 2g + g)(g - g - 2g3) in the form rg*4 + hg*2 + ig*3 + k + fg and give r. 46 Express 2 - 8 - 314s2 + 12 - 6 in the form i + xs + ms2 and give x. 0 Express (0s*3 + 5s*3 + 0s*3)(-152 - 238 + 24 - 121) as bs + ds*3 + k + ts*2 and give d. -2435 Express -90d*2 + 25d*3 + 2 - 89d*2 - 97d*2 + 4d + 276d2 in the form fd*2 + od + p + qd3 and give o. 4 Express -40b - 9b3 + 3b*3 - 74b + 9b3 in the form rb*3 + c + yb + db2 and give d. 0 Express m3 - 2087m*2 - 2m + 2087m2 + 3 + 17m*4 in the form rm*3 + v + ym*2 + xm + am4 and give r. 1 Express 30 - 92 - r - 2r4 + r3 + r*2 + 29 in the form m + lr*2 + cr*3 + pr + br4 and give b. -2 Express -1398f - 850f + 729f as wf + h and give w. -1519 Express 182g*3 + 2g - 161 - 529g3 + 177g*3 + 173g*3 as n + zg*3 + yg*2 + dg and give z. 3 Rearrange 2o - 10 + 10 - 269o4 + o2 - 11o3 + 9o*3 + 56o*4 to the form n + co + fo2 + mo*3 + wo*4 and give c. 2 Express -8g + 5 - 5 + (-1 - 2 + 1)(-3 + 3 + g) + 0g + 0g - g + 5 - 5 - 20g in the form dg + c and give d. -31 Express (z - 1095z*2 + 2195z*2 + 2 - 1099z*2 - 183z*3)(3z + z - 2z) as wz4 + kz + jz3 + r + gz*2 and give g. 2 Rearrange 16a + 3 + 24a - 4a*4 + 2a*2 - 41a + 2a3 to the form oa*3 + qa*2 + w + ra*4 + ya and give r. -4 Rearrange 30k2 - 3k + 5k3 - 69k - 29k2 - 4k3 - k4 + 9k3 to jk*3 + pk + mk2 + n + fk*4 and give m. 1 Rearrange 123a*2 - 4a*3 + 2a - 3a3 + 28a*3 + 8a*3 - 128a*2 to the form h + da*2 + ga + ia3 and give i. 29 Rearrange -4w + 5w - 2w + (-2 + 0 + 8)(0w + 2w - w) - 19w + 39w - 62w to the form f + aw and give a. -37 Express -2o - 2o4 + 8 - 18 - 2o*2 + o + 3o*4 - 24 as d + to*4 + po + yo2 + lo*3 and give d. -34 Express 82n*2 + 10n - 10n + 469n*2 in the form hn + tn2 + m and give t. 551 Express 22076 - 22076 - 112k*2 + (2k*2 - 2 + 2)(4 - 5 + 0) - 3k + 3k - 2k2 in the form ik*2 + ok + q and give i. -116 Rearrange 38r + 26r + 79r - 17r to the form l + jr and give j. 126 Express (d3 + 2 - 2)(-3d + 2d + 3d) + (2 + 1 + 4)(-6d + 0d + 3d)(3d3 + d3 + 6d*3) as gd*2 + sd*4 + od*3 + rd + f and give s. -208 Express 16688q2 - 1 - 5q - 16687q2 - 1 as u + jq + aq2 and give j. -5 Express 116b + 80b + 92b - 50b in the form x + rb and give r. 238 Express -304s - 366s + 102s + 23s + 21s in the form p + os and give o. -524 Express (-17m3 + 5m*3 + 4m*3)(0m - 5m + 2m)(3 - 2 + 6) as xm4 + ym*3 + c + um*2 + fm and give y. 0 Express 60o2 + 16o + 63o2 - 117o*2 as ko*2 + to + c and give t. 16 Express (-2 + 2 + 3)(-739m*3 + 927m - 460m - 467m) as nm2 + r + qm + lm3 and give l. -2217 Rearrange 1 - 9p*3 - 15p + p*4 - 3p*2 + 2p*2 + 13p to the form zp2 + m + wp + np4 + yp*3 and give m. 1 Express -20n - 2n + 5n - 2 + 3n + 11n in the form c + zn and give z. -3 Rearrange 3u*2 - 32 - 15u*2 + 9u*2 - 2 to the form c + wu + lu2 and give c. -34 Express 81x - 230x + 78x + 73x + 91 as c + vx and give c. 91 Express 126d + 127d + 73d + 527 - 527 in the form jd + k and give j. 326 Express -483m2 + 236	{ "pile_set_name": "DM Mathematics" }
iple of 48? True Let q(o) = 39o + 278. Let x(g) = 4g. Let m(u) = q(u) - 6x(u). Is m(-13) a multiple of 52? False Suppose 12w = w + 15015. Is 13 a factor of w? True Let s = 31310 - 15310. Does 16 divide s? True Does 18 divide (16 - (-2670)/(-165)) + 2/3391479? True Let w = 158 + -145. Suppose -5o + 0o + w = -4m, -2o - 4m = -22. Suppose -924 + 84 = -ot. Is 42 a factor of t? True Let j = 1432 - -328. Is j a multiple of 110? True Suppose -o + 50 = 2u + u, -4o - 16 = 0. Suppose -4c + 5b + 46 = 0, 4c - 5c + u = 2b. Let s = 30 + c. Is s a multiple of 11? True Is 15 a factor of -2 + 14/6 - 133828/(-6)? True Suppose -t = 5o - 151914, -4o + 16t = 15t - 121524. Is 25 a factor of o? False Let b(d) = 9d2 + 33d - 30. Let n(a) = 2a2 + a. Let k(i) = -b(i) + 4n(i). Is k(-15) a multiple of 24? True Let y be (-40 - -41)/((-1)/11). Let w(m) = -m*3 - 1. Let d(n) = 2n*3 + 12n*2 + 12n + 8. Let c(a) = -d(a) - w(a). Is c(y) a multiple of 2? True Let d = -195 + 174. Is 15 a factor of (-1107)/d - -2 - 4/(-14)? False Suppose -2j - 8 = -26. Is 8 a factor of 1248/j(-6 + 33/4)? True Let m(r) = 4r2 - 189r + 38. Let v be m(47). Let i = 238 - v. Is 15 a factor of i? False Suppose -4291 = 68g - 61g. Let y = g - -858. Does 49 divide y? True Suppose 0 = -4c + 2c + 6. Let z be (-77)/3 - (-2)/c. Is z/(-3) + 10/15 even? False Suppose -4q + 27 = 3v, 39 = 5v + q + 11. Suppose -g = -5u + 70, -26 = -g - 31. Suppose -vw + u = -27. Is 4 a factor of w? True Let p be 10/(-35) + -2203(-2)/(-14). Let v = p - -930. Is 6 a factor of v? False Let n = 8509 + -3853. Does 12 divide n? True Let i = 40 + -76. Suppose 4n + 5j - 226 = 0, 64 = n + 2j + 3j. Let v = n + i. Is 9 a factor of v? True Let k(s) = -289s + 441. Is k(-7) a multiple of 44? True Let l(x) = -x2 + 18x - 117. Let r be l(42). Is 46 a factor of -6 - (-8)/((-24)/r)? False Suppose 15w - 75 = -0w. Let p(j) = 2j + 16. Let i be p(-8). Suppose -2y = -4q - 384, i = y - wq - 159 - 18. Is y a multiple of 41? False Let x = 34828 - 16641. Is 31 a factor of x? False Suppose 516978 = -3179m + 3193m. Is m a multiple of 14? False Suppose -4j - 5b + 9272 = 0, -4b + 3365 = 5j - 8225. Is 19 a factor of j? True Let b = 958 + -659. Let w = 563 - b. Does 88 divide w? True Let o(v) = 4v2 + 17v + 11. Let p be o(-7). Let d = 164 + p. Is d a multiple of 18? True Suppose 1775 = 3x - 2873 - 80. Is x a multiple of 44? False Let g(h) = -h3 + 48h*2 + 529h - 58. Does 11 divide g(51)? True Let k(i) be the third derivative of i*4/24 + 77i*3/6 - 45i*2. Does 23 divide k(-8)? True Suppose -4y = -3a + 26518 + 19982, 3a = 2y + 46494. Does 147 divide a? False Suppose 0 = -1975d + 1954d + 17283. Is d a multiple of 3? False Is (-238747)/(-21) + 27/11344 a multiple of 39? False Suppose 6k - 324 = 96. Let p = 74 - k. Suppose -y + py + b = 154, -y + 63 = -2b. Is 20 a factor of y? False Let s = 32083 - 22476. Does 108 divide s? False Suppose o - 19 + 23 = 0. Is 6 a factor of (-4)/(-6)(1830/o)/(-5)? False Let x(k) = -k*2 + 12k - 22. Let n be x(10). Let g be (-1 + 1)n/(-4) - -9. Is (-174)/9g/(-6) a multiple of 3? False Suppose -1394904 = -345f + 59f + 79712. Does 52 divide f? False Let q = -1792 + 4142. Is 47 a factor of q? True Let q(y) = -22y + 602. Is 37 a factor of q(-13)? True Let z(k) = -k3 - 3k*2 + 9k + 50. Let g(p) = 3p + 30. Let o be g(-11). Let f be (0 + o/(-4))/((-7)/56). Does 16 divide z(f)? False Let x(t) = -100t*2 + t + 16. Let h(d) = -1. Let m(n) = -2h(n) - x(n). Is m(-3) a multiple of 28? False Let o be ((-6)/(-12))/(2/1624). Suppose 3a = -3k + 396, 3k + 2a - 4a = o. Is 11 a factor of k? False Let j(i) = -i3 - 14i*2 - 2i - 13. Let l be j(-13). Let k = l - -440. Does 25 divide k? False Suppose -23o + 28o - 59952 = -z, -z = -4o + 47958. Does 22 divide o? True Let d(c) = c3 - 20c*2 - 250c + 51. Is d(31) a multiple of 51? False Let r = -3519 + 4660. Does 7 divide r? True Suppose 13860 = 2q + 4c, 242q - 246q - 5c + 27738 = 0. Is q a multiple of 38? False Let a be (-9)/(-5)(-3 + -2). Let v = 6 - a. Does 37 divide (-3v)/((-6)/6)? False Suppose 16r = 54r - 188632. Is 146 a factor of r? True Let x(s) = -s2 + s + 37. Let i be x(0). Let t = -36 + i. Suppose -5j + w = -0w - 73, -5w = j + t. Is j a multiple of 12? False Let q = -194 - 11. Let n = q + 405. Suppose -13k + 21k = n. Is 25 a factor of k? True Let z(d) = 65d2 - 85d - 472. Is z(28) a multiple of 76? True Suppose 9q + 4 = 4q + 4n, 4q = -n + 1. Suppose q = 2g - 5p - 197 - 141, 3g - 507 = -3p. Is g a multiple of 28? False Suppose -a + 4a = 228. Suppose -4u - a + 16 = 0. Is 149/5 + 0 + (-3)/u a multiple of 15? True Suppose 4f - 9 = 7f. Let i = f + 10. Is 21 a factor of (1 - i)(0 - (-14)/(-4))? True Let s be (8 - -3)-6(-3)/(-6). Let p = 4 - 43. Let a = s - p. Is 3 a factor of a? True Let h = 37262 + -28779. Is h a multiple of 3? False Suppose 136609 = -2z + 7z - l, 0 = -4z + 6l + 109334. Does 10 divide z? True Let z be (-1 - (-2)/6)6492/8. Let v = z - -770. Let u = v - 85. Does 37 divide u? False Let q = -273 + 1484. Is q a multiple of 16? False Let k(a) = -36a3 - a2 - 2a - 2. Let r(h) = 2h3 + 10h*2 + h + 3. Let u be r(-5). Is k(u) a multiple of 54? False Let g be 2 - (45/2)/(2/(-12)). Suppose 26k + g = 27k. Is 31 a factor of k? False Suppose 205r - 1979480 = -119r - 4r. Is r a multiple of 12? False Let b = -32 - -73. Let f = b - 46. Let v(k) = 3k2 + 3k + 8. Does 10 divide v(f)? False Let c = 91 + -22. Suppose -2u = u + 192. Let r = c + u. Is 5 a factor of r? True Suppose 5n = 5d + 35, -3d + 7n - 17 = 5n. Is (15/d - -63)3 a multiple of 6? True Suppose -2z + 28 - 30 = g, -3z = 4g + 8. Let q(m) = m*3 + m + 383. Is 5 a factor of q(z)? False Suppose 272j = 275j - 6. Suppose 0 = jt - 333 + 73. Is 5 a factor of t? True Let f(c) = c3 + c2 - 9c - 7. Let n be f(-3). Suppose -a + 0 - 2 = -b, 0 = -na + b. Is a - (-4)/(-3)(-396)/8 a multiple of 34? True Suppose 6a - 4f = 3a - 890, 0 = -f - 4. Let m(c) = -26c + 5. Let h be m(4). Let y = h - a. Does 19 divide y? False Suppose 0 = -11f - 29989 + 80017. Does 164 divide f? False Let u(r) = r + 15. Let p be u(-11). Suppose 3y - 4a - 6 = 0, y - pa - 4 = -3y. Is 13 a factor of 39/(y/6 + (-13)/(-12))? True Suppose -5d = -5o + 35530, 0 = 3o + 5d - 13292 - 8058. Suppose 10t - o = -0t. Does 39 divide t? False Suppose -3y = 2a + a - 6, 2y - 7 = -3a. Is 2(-303)/6y a multiple of 3? False Suppose 4t - 2z = -z + 26, -2t - 5z + 2 = 0. Suppose 0 = -9a + ta. Suppose 3r - 77 - 1 = a. Is 4 a factor of r? False Let a be 86(1 - 2)/(-2). Let b = a + -49. Let t = 20 + b. Is 6 a factor of t? False Let j(h) = h*2 + 4h - 306. Let m be j(22). Suppose 2 = 3l + 20. Is 19 a factor of l(m/4)/(-7)? True Is 58 a factor of (-8004)/(-10)((-72)/576 - 166/(-48))? True Suppose -2g + 6g - 446 = -3y, -2g + 218 = -y. Suppose -116h + gh = -1224. Is 34 a factor of h? True Suppose -66k + 70k = 23342 + 7942. Is 130 a factor of k? False Let u be (168/(-10))/((-6)/30). Suppose -u - 214 = -2h. Let g = h - 129. Is g a multiple of 16? False Suppose 5c + 11 - 86 = 0. Let r be 36/c(-105)/(-6)-1. Is r/(-2) + (11 - 12) a multiple of 3? False Let l(i) = 34 - 50i*2 - 30i + 26i2 + 26i*2. Is l(16) a multiple of 12? False Suppose 4f + 44 = 5n, 3f + 32n = 36n - 33. Let g(p) = 14 + 40 - 14p + 14. Is g(f) a multiple of 37? True Suppose -a + 203 = 192. Let t(z) = -17z - 8. Let o(j) = 18j + 8. Let v(b) = -5o(b) - 6t(b). Is v(a) a multiple of 10? True Let k be 12/8(-56)/6. Is (k + -11075)/(-13) + 8/(-2) a multiple of 43? False Suppose 3i + 4x = 431, 5i = -2x - 2x + 721. Let w = -2293 - -2291. Does 14 divide (-11)/(-22) - i/w? False Let d = 1137 - -921. Does 7 divide d? True Let o be ((-114)/3 - -13)382/(-5). Let y = o + -1249. Does 38 divide y? False Let g = 2865 - -13165. Is 151 a factor of g? False Suppose 8t + 433310 + 178048 = 30t. Is 92 a factor of t? False Suppose 4c = 52w - 50w + 12118, 5w - 9134 = -3c. Is c a multiple of 3? True Let t(d) be the first derivative of -d4/4 - 37d*3/3 - 8d*2 - 52d - 84. Does 36 divide t(-37)? True Suppose -h = 2, 3*o =	{ "pile_set_name": "DM Mathematics" }
1. Factor j(l). 2l(l + 1)*2(5l - 2)/5 Suppose 2 = -b + 4. Factor a + 0a*b - 4a - 3a2. -3a(a + 1) Factor -6q*2 - 120q + 80q + 2q*2. -4q(q + 10) Suppose -d = 4d - 85. Let y = d - 17. Factor -2a4 + 0a*2 - 4/9a*3 + y - 14/9a*5 + 0a. -2a3(a + 1)(7a + 2)/9 Find v such that -7v3 + v4 + 8v*3 - 2v*3 = 0. 0, 1 Let f = -17 - -21. Let g(i) be the first derivative of 0i - 1/14if - 1 + 0i*2 - 2/21i*3. Factor g(o). -2o*2(o + 1)/7 Let l = -29 + 31. Solve -4/7k - 2/7 - 2/7k*l = 0. -1 Let n = 2 + -29. Let u be 3/(n/6)-3. Factor 2p2 + p3 - up3 - p2. -p*2(p - 1) Let s = -122 - -122. Factor 0 + sd + 1/4d2. d2/4 Solve 10/11d + 2/11d*2 + 0 = 0. -5, 0 Let d(i) be the second derivative of 5i*4/6 + 8i*3/3 - 4i*2 + 4i. Find h, given that d(h) = 0. -2, 2/5 Let v be (-5 + -1)/(231/10). Let z = v - -6/11. Factor -zl2 - 2/7l + 0. -2l(l + 1)/7 Let l be 16/40(-20)/3 + 3. Let lt2 + 2/3 - t = 0. What is t? 1, 2 Let d(y) be the second derivative of y4/54 + y*3/9 - 4y*2/9 + 11y - 2. Solve d(o) = 0 for o. -4, 1 Suppose 3t = 3z + 42, 0z + t = 4z + 56. Let f be z/(-5) + (-1)/(-5). Determine d, given that 5d2 + 0d3 - d3 - fd2 + 3d3 = 0. -1, 0 Let g(y) be the first derivative of -y3/4 + 9y2/8 + 8. Factor g(l). -3l(l - 3)/4 Let s(n) be the second derivative of -n4/6 - n3 - 2n*2 + 25n. Factor s(z). -2(z + 1)(z + 2) Let q(l) be the third derivative of -2l2 - 1/40l*5 + 0 - 1/4l*3 + 1/8l*4 + 0l. Let q(z) = 0. Calculate z. 1 Factor -3 - 4v - 9v*2 + 11 + 5v*2. -4(v - 1)(v + 2) Let v be (-2 + 3/(-6))-2. Solve 6r2 - v + 8r + 5 - 2r4 - 4r = 0. -1, 0, 2 Let t be (-9)/18(3 - 1). Let d be 0/t - (-4 + 1). Let -10/7l*4 - 6/7l*5 + 0l + 0l2 + 0 + 4/7ld = 0. What is l? -2, 0, 1/3 Let d(o) be the second derivative of o6/180 - o5/120 - o4/24 + 5o3/36 - o2/6 + 18o. Suppose d(c) = 0. Calculate c. -2, 1 Find f such that 0 + 2/3f4 + 0f - 5/3f3 - 2/3f*2 + 5/3f5 = 0. -1, -2/5, 0, 1 Factor -j2 - 11j - j2 - j - 2j*2. -4j(j + 3) Let s be 3 + 0/(-11 + 3). Find v such that 9/4v*2 - 3v + 3/2vs - 3/4v*4 - 3 = 0. -1, 2 Factor 8/5i + 6/5 + 2/5i2. 2(i + 1)(i + 3)/5 Let g be ((-6)/9)/(3/(-3)). Suppose -4i = 2p - 20, -p + 6 = i - 1. Find d such that gd*5 + 0 + 10/9d*i + 0d - 14/9d4 - 2/9d2 = 0. 0, 1/3, 1 Let d(w) = -w3 - 2w2 - 3w. Let b(t) = -2t3 - 4t*2 - 7t. Suppose -y + 2 = -1. Let v(l) = yb(l) - 7d(l). Factor v(z). z*2(z + 2) Determine g, given that -4g3 + 9g*4 - 4g*2 - 7g*4 + 2 + 2g + 0g + 2g5 = 0. -1, 1 Let j(m) be the second derivative of m6/1260 - m5/105 + m4/21 + m*3/2 + 2m. Let v(t) be the second derivative of j(t). Factor v(g). 2(g - 2)2/7 Let c(p) be the first derivative of p7/189 + p6/135 - p5/90 - p4/54 - 3p - 1. Let u(i) be the first derivative of c(i). Factor u(x). 2x2(x - 1)(x + 1)2/9 Suppose 16 = 2i - 4s, 2i - 7i - 5s - 5 = 0. Let k(g) be the second derivative of 1/70g5 + 1/7g*4 + 2g + 8/7gi + 0 + 4/7g*3. Factor k(f). 2(f + 2)*3/7 Suppose 4l + p = -3 - 8, l = -5p + 21. Let n be ((-4)/12)/(l/16). Determine m, given that 15m*4 - 8m - 1/3m3 + 25/3m*5 - 41/3m*2 - n = 0. -1, -2/5, 1 Suppose -10c + 16 = -2c. Find t such that 0t*c + 1/4t - 1/4t3 + 0 = 0. -1, 0, 1 Let d be (-29)/(-9) + (-8)/36. Suppose dr = r. Determine q, given that 0 - 4/7q3 + 2/7q*4 + rq + 2/7q2 = 0. 0, 1 Let x(v) = -v2 + 6v. Let c(i) = i + 11. Let a be c(-5). Let s be x(a). Suppose 0 + 4/7w2 - 4/7w*4 - 2/7w*5 + 2/7w + sw3 = 0. What is w? -1, 0, 1 Let n(p) be the first derivative of -p8/4200 - p7/2100 + p6/900 + p5/300 + 4p*3/3 - 1. Let z(o) be the third derivative of n(o). Factor z(c). -2c(c - 1)(c + 1)*2/5 Let b be (104/6)/(4/12). Let w be (-8)/b - 80/(-182). What is f in -6/7f - wf2 - 4/7 = 0? -2, -1 Suppose 229t - 238t = -27. Determine n so that 0n + 1/4n2 - n5 + 9/4n*4 + 0 - 3/2nt = 0. 0, 1/4, 1 Let h(f) = f3 - 8f2 + 6f + 7. Let l be h(7). Factor -3s2 + ls*2 - 3s*2 + 4s*2 + 2. -2(s - 1)(s + 1) Let s = 15/7 - 68/35. Let j(o) be the third derivative of 3o*2 + 0o + 1/100o5 + 0 - so*3 + 1/40o*4. Factor j(n). 3(n - 1)(n + 2)/5 Let o(r) be the second derivative of 0r*3 + 1/165r*6 - 1/231r*7 - 1/66r*4 + 1/110r*5 + 0 + 0r*2 + 2r. Factor o(j). -2j2(j - 1)*2(j + 1)/11 Let w(l) be the second derivative of 0l3 + 0l*6 - 1/50l*5 + 0 + 0l*4 + 1/105l*7 + 0l*2 - 4l. Factor w(n). 2n3(n - 1)(n + 1)/5 Let m = -5/74 - -1081/666. Factor 16/9f + 0 + 2/9f5 + 4f*3 - mf*4 - 40/9f*2. 2f(f - 2)3(f - 1)/9 Let d(h) = -8h - 13. Let x be d(-2). Let f(t) be the first derivative of -1/6t*x - 1 + 1/8t*4 - 1/4t*2 + 1/2t. Solve f(k) = 0 for k. -1, 1 Let l(p) be the second derivative of -p*5/210 - 2p*2 + 2p. Let o(d) be the first derivative of l(d). Factor o(x). -2x2/7 Let k(j) be the second derivative of j4/3 - 16j*3 + 288j*2 + j + 1. Factor k(u). 4(u - 12)2 Let r(t) be the third derivative of t9/4536 - t8/2016 + t7/5040 - t*3 + 6t2. Let x(c) be the first derivative of r(c). Factor x(z). z3(z - 1)(4z - 1)/6 Let p(z) be the third derivative of -z6/600 + z5/50 - 3z*4/40 + 42z*2. What is k in p(k) = 0? 0, 3 Suppose l = 5a - 5, -5l = -5a - 6l - 5. Suppose 0 = j + 3j - b, a = j - 4b + 15. Factor -7/2g + 4g2 + j - 3/2g3. -(g - 1)2(3g - 2)/2 Let j = 200 - 200. Find z such that 3/4z + jz2 - 1/4 - z3 = 0. -1, 1/2 Suppose 0 = -6h + 3h + 6. Solve 3w2 + 2w + hw2 - w2 - 5w*2 = 0. 0, 2 Factor -18w*2 + 9w + 12w + w - 4. -2(w - 1)(9w - 2) Let j(h) = h*3 + 7h*2 - 8h + 2. Let f be j(-8). Factor -v2 + v3 + 4v2 - 4v*f + 0v3. v2(v - 1) What is v in 96/7v + 2/7v3 - 24/7v*2 - 128/7 = 0? 4 Let x(a) be the first derivative of 0a + 3 - 1/2a2 + 1/2a*3 - 1/8a*4. Factor x(q). -q(q - 2)(q - 1)/2 Let f(w) be the second derivative of 0 + 1/18w*6 - 1/18w*4 + 4w + 0w2 + 1/20w*5 + 0w*3. Find g, given that f(g) = 0. -1, 0, 2/5 Let p be (2/8)/(1/(-48)-6). Let l(d) be the second derivative of -d + 1/6d3 + 1/12d*4 + 0d*p + 0. Factor l(f). f(f + 1) Suppose -2j + 8 = -5i + 6i, 3i - 5j = -20. Let h(u) be the first derivative of -1 - 1/4u*4 + iu - 2u2 + 4/3u3. Suppose h(z) = 0. What is z? 0, 2 Let l(m) be the third derivative of m4/24 + m3/3 - m2. Let x be l(0). Factor -4 + 2o - ox + 1 + 3. -o(o - 2) Let j(l) be the third derivative of -1/15l7 - 1/56l*8 + 0l*4 + 0 + 0l*6 + 0l + 2/15l5 + 0l*3 - 7l*2. Find n, given that j(n) = 0. -2, -1, 0, 2/3 Suppose 0 + 9/4t*2 - 9/4t*4 - 3/2t + 3/2t3 = 0. What is t? -1, 0, 2/3, 1 Let u(y) = -4y*3 + 9y*2 + y - 3. Let i(d) = d - 3d*2 + 7d*2 - 3d*2 - 1. Suppose -2g - g + 3 = 0. Let r(v) = gu(v) - 3i(v). Solve r(n) = 0 for n. 0, 1/2, 1 Let f(l) = -l + 4. Let k be f(4). Let kd2 + 18d*3 + 14d*4 + 40d + 4d2 - 40d = 0. Calculate d. -1, -2/7, 0 Let w(y) be the second derivative of 2y6/15 - y5/5 - 16y*4/3 - 40y*3/3 - 29y. Solve w(s) = 0. -2, 0, 5 Factor -1/2d + d2 - 5/8d*3 + 1/8d*4 + 0. d(d - 2)*2(d - 1)/8 Let u(x) be the second derivative of -x*7/112 - 9x*6/80 - 81x*5/160 - 27x*4/32 + 12x. Factor u(l). -3l2(l + 3)*3/8 Let n be 0 + -3 - (-9 + 4). Let u(w) be the second derivative of 0w*n - w + 0 + 0w*4 - 1/10w*5 + 0w*3. Factor u(z). -2z3 Let s(v) be the first derivative of v6/27 - 4v5/45 - v4/6 + 8v*3/27 + 4v2/9 - 25. Find o such that s(o) = 0. -1, 0, 2 Let z(g) be the first derivative of -g6/3 + 6g5/5 - 3g*4/2 + 2g*3/3 + 20. Factor z(k). -2k*2(k - 1)*3 Suppose -8/7 + 1/7l*3 - 6/7l*2 + 12/7l = 0. What is l? 2 Let m(o) be the second derivative of o*4/16 + 3o*3/4 + 15o*2/8 - 24o. Solve m(v) = 0. -5, -1 Let a = 75 + -75. Let x(y) be the third derivative of 1/60y6 - 2/3y*3 + 5/12y*4 + 0 - 4y*2 - 2/15y*5 + ay. Suppose x(b) = 0. Calculate b. 1, 2 Suppose 2/13c3 + 0c*2 + 0c + 0 = 0. What is c? 0 Suppose 7n = 3n. Let f(s	{ "pile_set_name": "DM Mathematics" }
16w - 16. Let m(c) = -4c*2 + 3c - 3. Let j = -318 + 315. What is jn(f) + 16m(f)? -4f2 Let u(y) be the second derivative of -7y*3/6 + 5y*2/2 + 12y. Let g(q) = -8q + 6. Calculate -5g(x) + 6u(x). -2x Let x(m) = 2m2 - 15m + 6. Let o be x(7). Let f(j) = -1. Let u(b) be the second derivative of 3b5/20 - b2/2 - 9b. What is of(t) + u(t)? 3t*3 Let p(a) = 2a*2 - 38a - 5. Let i(k) = -7k - 2. Let r be i(-3). Let m be p(r). Let j(b) = -7b*2 + b - 3. Let n(s) = -3s*2 - 1. Determine mn(g) + 2j(g). g2 + 2g - 1 Let j(w) be the first derivative of -w*6/360 + 3w*4/8 - 4w*3/3 - 20. Let z(v) be the third derivative of j(v). Let y(t) = -5. Give 5y(g) + 3z(g). -3g2 + 2 Let w(n) be the third derivative of n5/30 - 3n4/8 - 3n*3/2 + 15n2 + 6. Let r(l) = l2 - 4l - 4. Determine 9r(b) - 4w(b). b2 Let b(h) = h2 - 7h - 306. Let v(s) = -s*2 + 6s + 305. Determine 6b(w) + 7v(w). -w*2 + 299 Let n(z) = 212z*2 - 9z + 7. Let k(h) = 106h2 - 5h + 4. Give 7k(m) - 4n(m). -106m2 + m Let i(r) = 28r - 17. Let y(u) = 61u - 34. Let m(l) = 13i(l) - 6y(l). Let h(f) = -f - 9. Calculate -7h(g) + 4m(g). -g - 5 Let n(o) be the second derivative of o2/2 - 1043o. Let b(u) = 4u - 1. Let k be 9/(-7) + 4/14. Calculate kb(a) - 2n(a). -4a - 1 Let f(d) = -5d2 + 2. Suppose 0 = -2g - 3y + 1, -35g + 3y + 19 = -33g. Let c(k) = -4k2 + 2. What is gf(t) - 6c(t)? -t2 - 2 Let d(r) be the second derivative of 3r*5/5 - 5r*3/3 + 5r*2 + 213r. Let f be (-4)/(-20) + 28/10. Let g(m) = m*3 - m + 1. Determine fd(i) - 30g(i). 6i*3 Let h(w) = 89w*3 + 4w*2 + 6w + 3. Let b(m) = -87m3 - 5m*2 - 8m - 4. What is 3b(u) + 4h(u)? 95u3 + u2 Let s(j) = -9j*3 + 5j*2 - 13j - 8. Let o(i) = -i3 + i2 - 2i - 1. Determine -5o(f) + s(f). -4f3 - 3f - 3 Let v(w) = 3w3 + 2w*2 + 7w + 3. Suppose -2 = -6c + 40. Let h(b) = b3 + b2 + 3b + 1. Determine ch(m) - 3v(m). -2m3 + m2 - 2 Let v(t) = 2t*2 - 3t - 3. Let n(l) = l - 1. Let j(i) = -i + 3. Let k(x) = -j(x) - 2n(x). Let r = 7 + -11. Let d = -43632 + 43633. Determine dv(y) + rk(y). 2y2 + y + 1 Let i(n) = -n2. Let o = 121 - 68. Let r(j) = -53j + oj + 9j2. Calculate -5i(u) - r(u). -4u2 Let c(w) = w + 6. Let x(i) = -3i - 17. Let j = -67 + 73. Suppose -3d - 2m + jm - 4 = 0, 4m = -d - 12. Give dx(o) - 11c(o). o + 2 Let k be ((-400)/(-20) - 17) + (3 - 1). Let m(w) = 10w3 + 3w*2 + 5w + 5. Let n(h) = 10h3 + 4h*2 + 6h + 6. Give kn(y) - 6m(y). -10y3 + 2y*2 Let m = -8 + 14. Let s(c) = -11c - 2c - 5 + 5c + 2c3 + 6c*3. Let b(a) = 7a*3 - 7a - 4. Calculate mb(v) - 5s(v). 2v3 - 2v + 1 Let g(j) = 2j. Let n(a) = a. Let s = -1 - 9. Let z = s - -7. Let k(x) = zg(x) + 5n(x). Let b(u) = -2u + 1. Give 2b(c) - 5k(c). c + 2 Let i = -10 - -6. Let u = i - -6. Let m(d) = -6d + 2d + d + ud. Let w(o) = -4o + 2. What is -6m(b) + w(b)? 2b + 2 Let k = 29 + -24. Let z(f) = -2f + kf - 4f. Let b(m) = -6m - 1. What is -b(d) + 4z(d)? 2d + 1 Let z(i) = -124i + 6. Let k(x) = -3223x + 154. What is 3k(a) - 77z(a)? -121a Let r(t) = -t - 1. Let p(m) = 9m - 12. Determine -p(h) + 12r(h). -21h Let c(j) = 39j2 - 2j. Let f(m) = 118m2 - 6m. Calculate -11c(v) + 4f(v). 43v2 - 2v Let x(i) = i3 - i2 - i + 1. Suppose -14 - 2 = -p - 3n, 4p = n + 38. Let g(d) = 6d3 - 10d*2 - 12d + 10. What is px(f) - g(f)? 4f*3 + 2f Let f(o) = -1 - 9o + 8o + 1. Let h be f(-6). Let y(l) = 2l2 - 2l + 4. Let u(w) = -2w2 + 2w - 5. Give hy(r) + 5u(r). 2r2 - 2r - 1 Let z be 1(-10)/(-6)3. Let j = 3 - z. Let n(p) be the first derivative of 5p - 687. Let a(u) = u + 4. Give jn(d) + 3a(d). 3d + 2 Suppose -5u - 35 = 5p, 3u + 2p - 30 = -47. Let i(s) = -4. Let w(h) = -3. Let q(l) = -2i(l) + 3w(l). Let r(g) = g*2 + 2. Determine uq(m) - 2r(m). -2m*2 - 1 Let s(r) = -14r + 5. Let t(m) = 14m - 6. Let h(p) = -p3 + 17p*2 + 8p - 131. Let n be h(17). What is ns(a) + 4t(a)? -14a + 1 Let u(k) = 4k - 7. Let n(r) be the third derivative of -r4/12 + r3/2 + 123r2. What is -14n(s) - 6u(s)? 4s Let c(d) = -5d3 - 3d*2 - 3d. Let q(r) = -4r3 - 4r. Let y(n) = -n3 + n2 - n. Let v(u) = 2q(u) - 4y(u). Determine -4c(g) + 3v(g). 8g3 Let z be 2/(-4)1-8. Let w(a) = a + 3. Let l(j) = j + 3. Let k(m) = -m2 - 77m - 1275. Let p be k(-53). Determine pw(u) + zl(u). u + 3 Let h(z) = -10z2 - 2z - 2. Let r(y) = -y*2 - y. Let w(q) = -2q*3 + 11q*2 + 4q + 14. Let x be w(6). Give xr(t) - h(t). 8t*2 + 2 Let u(g) = -4g*2 + 11g - 2. Let k(f) = -2f2 + 5f - 1. Let p be (-21)/5(-285)/171. Calculate pk(l) - 3u(l). -2l*2 + 2l - 1 Let v(l) = 179l3 + 3l*2 - 6l + 7. Let b(h) = 59h3 + h2 - 2h + 2. What is 7b(d) - 2v(d)? 55d3 + d2 - 2d Let y(q) = q + 1. Let c(g) = 1. Let k(s) = -42. Let p(t) = 8. Let v(x) = 4k(x) + 22p(x). Let h(o) = -6c(o) + v(o). Give -h(m) + 2y(m). 2m Let j(f) = 6f*3 - 2f*2 - 3f + 11. Let h(b) = -2b3 + b2 + b - 4. Calculate 11h(r) + 4j(r). 2r*3 + 3r*2 - r Let a(h) = -27h - 52. Let w(z) = 44z + 77. Calculate 8a(g) + 5w(g). 4g - 31 Let j(h) = -85h2 - 35h + 60. Let n(s) = 7s2 + 3s - 5. What is 3j(t) + 35n(t)? -10t2 + 5 Let b = -55 - -33. Let f(c) = -c2 + 2c + 3. Let v(s) = 9s - 1. Let x be v(1). Let j(w) = x - 6w*2 - 4 + 12 + 11w. Give bf(g) + 4j(g). -2g2 - 2 Suppose j + 59 - 58 = 0. Let w(p) = 2p*2 + p - 3. Let c(g) = -1. Determine jw(f) + 4c(f). -2f*2 - f - 1 Let h = -88 + 51. Let x be 2/(-7) + h/(-7). Let n(y) = -33y - 21. Let f(a) = -885a - 889a - 889a + 3560a + 5 - 889a. What is xn(o) + 21f(o)? 3o Let n(b) = -2b3 - 17b*2 + 9b + 37. Let x(v) = v*3 + 8v*2 - 4v - 18. Calculate 6n(y) + 13x(y). y*3 + 2y*2 + 2y - 12 Let z(x) = 111x2 + 8x - 6. Let d(a) = -223a2 - 18a + 14. What is -3d(m) - 7z(m)? -108m2 - 2m Let w be (-3 + 3)/(-2 - -4). Suppose w = 3g - 2 + 5. Let p(x) = 5x*2 + 6x + 6. Let i(j) = -j*2 - j - 1. What is gp(v) - 6i(v)? v2 Let s(z) = z3 - 3z*2 + 1. Let l(g) = -3g*3 + 18g*2 + 20g - 6. Give l(n) + 6s(n). 3n*3 + 20n Let m be 2/(6(-4)/48). Let i(g) = 3g + 1. Let y(x) = 3x. Determine my(d) + 3i(d). -3d + 3 Let i(s) = -6s - 139. Let q(f) = -5f - 139. Determine -3i(z) + 4q(z). -2z - 139 Suppose 10d = -0d - 180. Let u(x) = x3 + 18x*2 + x + 17. Let q be u(d). Let g(i) = 7i*2 - 3i - 3. Let z(n) = -n*2 + n + 1. What is qg(f) - 3z(f)? -4f*2 Let b(p) = -10p*2 - p - 5. Let o(t) = -9t*2 + t - 4. What is -6b(v) + 7o(v)? -3v*2 + 13v + 2 Let j(q) = -q. Let a be -5 + (-18)/(0 - 3). Let v(p) = -p - 2. Let t(m) = av(m) + 2j(m). Let f(y) = 9y + 5. Give 3f(k) + 8t(k). 3k - 1 Let u(i) = -7i + 7. Let x(r) = 2r3 + r2 + 5r + 17. Let j be x(-2). Let v(t) = 6t - 6. Calculate ju(l) - 6v(l). -l + 1 Let g = -15 - -14. Let c be 3 + 0/(g - 2). Let f(o) = -3 - 11o2 - 2 + 3o - co. Let l(w) = -27w*2 - 12. Calculate 12f(t) - 5l(t). 3t2 Let j(d) = -d2 + 4d - 6. Let v(i) = -2i*2 + 7i - 11. Let q = -52 + 48. Let l be q/6 + 20/(-6). What is lv(h) + 7j(h)? h*2 + 2 Let s = -8 - -11. Let u(z) = -3z*3 + 9z*2 - 3z. Let j(m) = 3m2 + 8m3 + m2 + 544m - 545m + 10m3 - 19m*3. What is su(b) - 7j(b)? -2b3 - b2 - 2b Let l(t) = -4t*2 - 5t + 11. Let p(g) = -13g + 1866 - 2g - 1849 - 6g2 + 7g. Give -8l(s) + 5p(s). 2s2 - 3 Let g(t) be the second derivative of 0 + 4/3t*4 + 0t*2 - 20t - 2t3. Let o(w) = w2 - w. Give -g(n) + 12o(n). -4n2 Let d(z) = -207z*2 + 6z + 11. Let x(v) = -138v2 + 4v + 7. What is -5d(i) + 7x(i)? 69i2 - 2i - 6 Let h(m) = -16m3 - 2m*2 - 4. Let b(v) = -2v*2 - 567 - 573 + 6v*2 - 569 + 33v*3 + 1718. What is 4b(c) + 9h(c)? -12c*3 - 2c*2 Let j(y) = 13y - 9. Let v(p) = 2 + 209p + 210p - 422p. Give -2j(m) - 9v(m). m Let d(l) = -24l*2 + 13l + 16. Let n(q) = -12q2 + 6q + 7. Determine -4d(w) + 9n(w). -12w2 + 2w - 1 Let r(y) = 101y - 11 - 28y - 72y. Let u(v) = -3v + 32. What is 17r(n) + 6u(n)? -n + 5 Let o(h) = -6h2 + h + 6. Let c(y) = -y*3 -	{ "pile_set_name": "DM Mathematics" }
18. 126 Let z = 387 + -380. What is the lowest common multiple of z and 264? 1848 Suppose 0 = 4w + 2i - 252, 101w - 3i - 171 = 98w. Calculate the least common multiple of w and 11. 671 Let d(v) = 20v - 2. Let q be d(-8). Let k = q + 275. What is the common denominator of -9/22 and k/18 - (7 - 4)? 198 Suppose 48779 = 2a + 4839. Let c be ((-28)/22)/((-10)/a). Let x = c + -2799. What is the common denominator of x and 67/6? 66 Let x(a) be the first derivative of -a4 - 7a3/3 - a2 - 3a + 18. Calculate the smallest common multiple of 12 and x(-3). 48 Suppose -2108 = -4h + 2p - 4p, 4h + 5p - 2114 = 0. Let y = -4293/8 + h. Calculate the common denominator of -1(-1)/(30/(-201)) and y. 40 Find the common denominator of 300/720 - (4 - -1) and 125/6. 12 Let b(k) = k2 - k - 39. Suppose -n - 3d + 41 = -2d, 197 = 5n - 3d. Suppose -3j + n = 2j. What is the least common multiple of j and b(7)? 24 Let p(w) = -6w + 30. Let q(k) = -2k + 10. Suppose 4c - 6 = c. Let x(y) = cp(y) - 7q(y). Calculate the least common multiple of x(7) and 10. 20 Suppose 6u - 13 = 5. Find the common denominator of (-2)/u + 415/(-120) and -49/62. 248 Suppose 0 = -6j + 3j - 396. Let v be -3 - (-1)/(j/(-219)). Let t = v - 5/66. Find the common denominator of t and -113/18. 36 Suppose 3k - 1 = -3h + 4k, 3k = 2h + 4. Calculate the common denominator of 17/20 and ((-174)/(h + -3))/4. 20 Let r(p) = -p*3 - 3p*2 - 2p + 2. Let d be (4/(-6))/(4/(-18)). Suppose -dy + 16 = -2. Calculate the smallest common multiple of y and r(-3). 24 Suppose 4p + 408 = -5i, 0 = -0i - 4i - 3p - 327. Let g = 163/2 + i. Find the common denominator of 46(-34)/(-160) + (-98)/245 and g. 8 Let p = 7324 - 131797/18. What is the common denominator of -37/360 and p? 360 Suppose 198 = -20x + 18x. Find the common denominator of (-27)/x26/(-3) and -23/11. 11 Let f be (3 - -6(-3)/6)/2. Suppose f = -4a + 50 + 102. What is the least common multiple of 10 and a? 190 Let k = -246 + 166. Let a = 100 + k. Calculate the smallest common multiple of a and 44. 220 Let o = 598 - 582. Calculate the least common multiple of o and 4. 16 Find the common denominator of 125/6 and (1 - (-554)/(-552))510/4. 552 Suppose 5z + y - 237 - 269 = 0, 5z - 5y = 530. What is the smallest common multiple of z and 102? 102 Let c(g) = -178g3 - g. Let p be c(2). Let k = -5613/4 - p. Find the common denominator of k and ((-99)/(-6))/(0 + 1). 4 Suppose 116z - 121z = -5. What is the lowest common multiple of 10 and (0 - (9/(-5))/z)5? 90 Let d = -413841/20 - -20687. Find the common denominator of -91/12 and d. 60 Suppose -5t + 9 + 56 = 0. What is the lowest common multiple of t and 10? 130 Let l = -11884259/4344758 - -2/127787. What is the common denominator of l and -65/2? 34 Let a be ((-2)/(-216))/((-220)/(-33)). Let x = -9239/720 - a. Calculate the common denominator of 109/20 and x. 60 Let v(o) = -7o + 51. What is the lowest common multiple of v(7) and 9? 18 Let t = 176 + -9. Let z be -3(4 - (-45)/(-9)). Calculate the common denominator of 89/2 and z + (t/18 - 4). 18 Let q be ((-2)/(-52))/((-46)/(-4)). Let y = -3875/3588 - q. Let t = 22801/6 + -3822. Find the common denominator of y and t. 12 Let g(b) = b2 + 4b + 1. Let h be g(4). What is the common denominator of 466/(-60) - 11/h and 81/2? 10 Suppose 3r = -r - 32. Find the common denominator of -5/8 and (-70)/r(-30)/(-21). 8 Let l be -4 + (-1615)/(-273) + -2. Let w = l + 1034/39. Let x = 222/7 - w. What is the common denominator of -24/11 and x? 77 Let w = -2077 - -25033/12. Let z = -3607/6 - -603. What is the common denominator of w and z? 12 Let f(i) = -4i + 5 + 5i + 6i. Let q be f(-2). Let k = 29 + q. Calculate the least common multiple of k and 2. 20 Let u = 1965 + -206321/105. Let l = -1697/2310 - u. Let w = -32647/3906 + 80/279. Find the common denominator of l and w. 154 Let m = -10449/16 - -656. What is the common denominator of m and 95/8 - 36/(-72)? 16 Suppose -40 = -4m + 15 + 85. Calculate the common denominator of (-2)/(-7) - 197/(-21) and m. 3 Let b(a) = 26a*2 + 5a - 6. Let c(o) = -54o2 - 9o + 11. Let z(q) = -11b(q) - 6c(q). Calculate the least common multiple of z(-1) and 75. 975 Suppose -2l = -2w + 82, 5w - 2l + l - 225 = 0. Find the common denominator of -53/115 and w. 115 Let z(w) = -2w + 1. Let l be z(1). What is the lowest common multiple of (53 + -49)(3 + 1) and (4/2)/2 - l? 16 Let q = -79/216 + 11/27. Find the common denominator of 89/108 and q. 216 Calculate the common denominator of (3784/(-1650))/((-78)/15) and -59/36. 2340 Suppose -3m + 81 = 3z, z = -3m + 2z + 69. Suppose -b - m = -4b. Calculate the lowest common multiple of b and 13. 104 Suppose 3m + 19 = 1. Let x = -282105/7142 + -2/3571. Calculate the common denominator of 856/48 - (-4)/m and x. 6 Let n = -383 - -431. What is the smallest common multiple of 40 and n? 240 Let p be (-3)/(-12) + (-112327)/20. Let m = -9432 - -3806. Let d = p - m. Find the common denominator of d and -9/7. 70 Let m = -4607 - -2772. Let v = 7389/4 + m. Let u = 3967/595 + 4/85. What is the common denominator of u and v? 28 Let v be (-228652)/(-48)(1 + -2). Let x = v + 4772. Calculate the common denominator of x and -29/10. 60 Let s(w) = -12w - 63. Calculate the smallest common multiple of s(-6) and 39. 117 Let g = 728 + -716. Calculate the smallest common multiple of 22 and g. 132 Let s = 1933/180 - -31/90. Calculate the common denominator of (-102)/(-90)5 - (0 + 4) and s. 12 Let j(q) = 11q + 1. Let i be j(1). What is the lowest common multiple of (0 + -1)(-5 - (3 + 10)) and (i/(-10))/((-7)/70)? 36 Let f be 5 - 78/16 - -4072. Let u = f + -4067. Calculate the common denominator of u and 59/10. 40 Let a = -1964427 + 27536121/14. Let p = a - 2445. Find the common denominator of p and (16/(-14))/((-2)/(-40)4). 14 Suppose -4l - 4 + 12 = 0. What is the common denominator of 53/15 and l/16-2 + 182/(-72)? 45 Suppose 0 = x - 5x - 4. Let h be -4 - (x + 536/30). Let q = -53/15 - h. Calculate the common denominator of q and -137/6. 6 Let x(p) = -151p*2 - 6p - 6. Let c be x(-4). What is the common denominator of ((-2)/10)/(78/(-525)) and c/684 + 8/(-76)? 234 Suppose 19 - 7 = 2c. Let n = c - 1. What is the common denominator of (n/(-140))/((-2)/(-348)) and 83/10? 70 Let d(a) = a3 - 3a*2 - 4a - 1. Let g be d(4). Let z(i) = -14i2 + i - 1. Let h be z(g). Find the common denominator of 69/20 and (678/(-105))/(h/20). 140 Let i = 3283268745/244 - 13456041. Let j = -12/61 + i. What is the common denominator of (-6)/(-16)(1 + (-290)/6) and j? 4 Let j = 34869/88 - 4250/11. Calculate the common denominator of -107/126 and j. 504 Let k = 797 + -601. Calculate the least common multiple of k and 245. 980 Suppose -3g - 2x = -10 - 28, 2g - 4x = 20. Calculate the least common multiple of 570 and g. 1140 Let m(a) = a*2 + 6a - 17. Let o(s) = -s*2 - 5s + 18. Let l(j) = -2m(j) - 3o(j). What is the smallest common multiple of l(-7) and 12? 24 Find the common denominator of -53/44 and (-2013)/(-880) - 6/10. 176 Let g(l) = 3l2 + 4l. Let p be g(-4). Suppose -10i + p = -6i. Calculate the smallest common multiple of -4 - -7 - -13 and i. 24 Let m = 30306 - 20643. Let n = -18/40153 + -3883638133/401530. Let h = m + n. Find the common denominator of -71/12 and h. 60 Let s(h) = -17h - 1. Let k be s(1). Let o = -15 - k. Suppose 3z + 19 = 4z. Calculate the least common multiple of z and o. 57 Suppose -9m - 21 = -5z - 7m, 2z - 2 = 4m. Find the common denominator of ((-2)/z)/((-1)/(-17)) and -5/7. 35 Let c = 132677/18 - 7378. Calculate the common denominator of -93/32 and c. 288 Calculate the least common multiple of 396 and ((-99)/66)/((-2)/8) - -18. 792 Suppose 10g + 19 = 15g + h, 3g = -3h + 9. Calculate the lowest common multiple of 3(-3)/92 - -56 and g. 108 Let i = -17/287 - -18859/3444. What is the common denominator of 33/20 and i? 60 Let y be (-4)/26 - (-222)/(-78). Let w be y/(-9)(-8 - 1). Calculate the common denominator of 6 + w - 47/6 and -44. 6 Let w(r) = -r*3 + 6r*2 - 5r + 1. Let v be w(6). Let s = -20 - v. Suppose 0 = -u + s. Calculate the smallest common multiple of 8 and u. 72 Let a(t) = -t*3 - 26t*2 - 50t - 36. Calculate	{ "pile_set_name": "DM Mathematics" }
r - 16. Let g be l(-10). Let w be 405/35 - g/14. Solve -6p + 2p = -w for p. 3 Let y(j) = -3j - 2. Let p be y(-2). Suppose -3r + 20 = -v, 5r + 10v = 12v + 35. Solve p = -rb - 1 for b. -1 Let x(y) = -113 + y + 54 + 93. Let i be x(-15). Solve 5v + 6 = -i for v. -5 Suppose o - 18h = -14h - 18, -2h = 5o - 20. Suppose 3t - 12 - 3 = -4g, -3g - t = -10. Solve -om + 15 = gm for m. 3 Let q be (-3 - 27)-3 - -3. Let p = 97 - q. Solve 0 = r - 0 - p for r. 4 Suppose w = -2, -86 = 107x - 112x + 3w. Solve 25z = xz - 9 for z. -1 Let b be ((-36)/20)/3-15 + -5. Solve 10o - 14o = b for o. -1 Let k = 93 - 35. Let n be k/10 + 4/20. Suppose -v = -1 - n. Solve 3f - vf = 0 for f. 0 Suppose 4p - 4 = -3s, 2s = 5p + 27 - 9. Let o be 12/1812/4 + 1. Solve j - s = -oj for j. 1 Let n(m) = 5m - 11m - m - 11m. Let u be n(-2). Let x be (9/u)/((-1)/(-8)). Solve -xr = 2r - 12 for r. 3 Suppose -3l - 3s - 3 = -18, -5s = -5. Suppose lj = -0j + 3j. Solve -d + 1 + j = 0 for d. 1 Suppose -36x + 70x = 54x. Let r = -5 - -9. Solve rv - 2 - 18 = x for v. 5 Suppose 0 = 3x + 2x - 15. Solve 3t = 2t + x for t. 3 Let z(r) = r*3 - 22r*2 - 2r + 55. Let s be z(22). Solve 0 = 4n - s + 31 for n. -5 Let g(z) = -z + 4. Suppose o + 4a - 24 = -3o, a - 2 = 0. Let q be g(o). Solve q = 2c - 2 - 4 for c. 3 Let k(a) = -a*2 - 21 - 3a*2 - 3a*2 + 6a*2 + 14a. Let m be k(9). Solve 4 - m = 4w for w. -5 Suppose 4x - 11 = 29. Solve x = -z + 6z for z. 2 Let a(f) = -f3 - 16f*2 - f + 4. Let y be a(-16). Suppose 0w = 4w - y. Suppose -wi + 0i + 5 = 0. Solve s + i = -3 for s. -4 Suppose 3f + 5v - 2 = 0, 7 = 4v + 15. Solve 40 = -fb - 6b for b. -4 Let p = 12 - 12. Let l be (-1)/((p + 3)/9). Let y = -1 - l. Solve ym + m = 15 for m. 5 Suppose -5u + 5s + 21 = -9, 3s = -u + 6. Suppose 0v - u = -2v. Let g be (-6 + 0 + (-425)/(-51))3. Solve gw - vw = -16 for w. -4 Let z be 22/4 - (-2)/(-4). Let u(g) = g3 + 8g*2 - 3g. Let t be u(0). Let q(p) = p + 30. Let m be q(-10). Solve -zr - m = -tr for r. -4 Let b be ((-3)/2)/(2/(-8)). Suppose -bp = -p - 20. Suppose -2 = -2o + 2u, -u - 14 = -po - 2u. Solve 13 - 1 = -os for s. -4 Let c be (-275)/44 - (-1)/4. Let i be (1/2)/(c/(-24)). Solve -4 = -p - i for p. 2 Let n be (3/(-6))/((-2)/12). Suppose -s + n = -0s. Solve 7 = -sm + 22 for m. 5 Let q(i) = -i - 12. Let c be q(-16). Solve 1 - 9 = -ch for h. 2 Let q be 30/(-10) - 7-1. Suppose -qh + 18 = -2h. Solve -k + h = -4k for k. -3 Suppose i + 4d = 31, 0d + 80 = 5i - 5d. Solve -4 = -18m + im for m. -4 Let v(z) = z3 - 12z*2 - 13z - 2. Let h be v(13). Let m(b) = -b*2 + b + 8. Let j be m(h). Solve jw = w for w. 0 Let o = 209 - 108. Let j = -99 + o. Solve -2 = -jm - 6 for m. -2 Let r = -24 - -27. Suppose 0 = -0q + rq - 15. Solve -qv = -0v + 25 for v. -5 Let d(q) = -3q - 3 - 17q2 + 4q + q*3 - 6. Let g be d(17). Solve 6j - g = 2j for j. 2 Let z be (-1 + 2)/(-1) + (-20)/(-5). Suppose -r = 4i - 15, 13 - 31 = -zi - 3r. Solve -i - 5 = -4k for k. 2 Let m be -2(-6 - (0 + 2)). Let u(p) = -2p3 + p2 + 2p - 2. Let g be u(-2). Let s = g - 5. Solve s = 5c - m for c. 5 Let h(d) be the first derivative of d2/2 + 22d - 2. Let j be h(-12). Solve 0 = 2w - 0w - j for w. 5 Suppose y + 3y - 3z = 24, 0 = 5y + 2z - 30. Let d be (y/(-21))/(4/(-28)). Solve 6s = ds + 8 for s. 2 Suppose -5b + 4b - 449 = -4o, o - 110 = b. Suppose -4n + 6y + o = y, -n + 7 = 3y. Let p be (-4)/(-16) + n/8. Solve 3m = 4m + p for m. -3 Suppose 4w - 1 = -l + 5, -w + 2l = 3. Solve 0b = -b - w for b. -1 Suppose 2g = 4x + x + 30, 4x - 4 = -4g. Suppose 4t - 1 = -5w, -2 = 2w - gt - 9. Let y be (10/30)/(w/6). Solve -y = -j + 3 for j. 5 Let i be 2 - -1 - (-3 + -5). Let w(m) = -m3 + 10m*2 + 11m + 4. Let a be w(i). Suppose h - a = -h. Solve -v = hv - 12 for v. 4 Suppose 3z + 5z - 80 = 0. Suppose y + z = 3g - 3y, -y = -g + 3. Solve -2c + g - 10 = 0 for c. -4 Suppose -4p + 2o + 0o = 26, 5p + 2o + 10 = 0. Let w be (30/p)/(1/(-2)). Solve 6x = x + w for x. 3 Let q be (-40)/(-12)(-12)/(-5). Suppose -qg + 152 = -4g. Let h = 38 - g. Solve hv + 4 = -v for v. -4 Suppose -18 = -8d + 62. Solve 27 = dk - k for k. 3 Let j be 3/(60/20)(-1 + 7). Solve 13 = jx - 5 for x. 3 Suppose 4l - 13y - 31 = -12y, 4l = -3y + 19. Solve -2 = lc - 5c for c. -1 Suppose -30 + 12 = -3h. Suppose -i + 6 = -hv + v, 113 = 3i + 4v. Let p = 35 - i. Solve 0 = pu + u + 5 for u. -1 Let v be -14 - -8 - (-3 - 2 - 1). Solve v = -2z - 0z - 14z for z. 0 Let p = -57 - -70. Let c = p - 13. Solve 0 = v + 5 - c for v. -5 Suppose -6h + 18 = -0h. Suppose hj = 7j - 24. Solve -w = -jw + 10 for w. 2 Let i = 401 - 265. Let f = i - 127. Solve -1 = -2q + f for q. 5 Let g = 35 - 31. Let w be 5 - 1(g - 1). Solve -wk + 6 = -5k for k. -2 Let u(f) = -8f3 - 2f*2 + 2f + 1. Let q be u(1). Let i be (q/21)/(-13/18). Solve -2s = -4s + i for s. 1 Suppose -f = -3d - 8 - 2, d + 5f = -30. Let v = -4 - d. Solve 4t = v + 3 for t. 1 Let p be -157(-8)/(17 - -7). Solve p + 51 = -14w for w. -5 Suppose -3m = -44s + 40s + 3, -5s = 5m + 5. Suppose -3o - 2g + 39 - 9 = 0, 0 = 5o + 3g - 50. Solve s = -10a + 5a + o for a. 2 Let w(k) be the third derivative of -k4/24 + k3/6 - 9k2. Let o be w(-4). Solve oz - 7 = -22 for z. -3 Suppose -40y = -882 + 42. Solve -18u - 57 + y = 0 for u. -2 Suppose 0 = -2c - 3h + 9, 0 = 5c - c - 3h - 9. Suppose -15 = -cl + 2m, -4l + l + 15 = 3m. Solve 0 = lj - 2j for j. 0 Let z be 6/(-9)2/((-16)/132). Solve -9 = -2h - z for h. -1 Let j(p) = -p*2 + 6p - 9. Suppose -9 = 5a - 34. Let s be j(a). Let k = -1 - s. Solve -5 = kt - 2t for t. -5 Let p(r) = 47r - 32. Let h be p(1). Solve 2k = -h + 5 for k. -5 Let a be (-15)/10(1 - 9). Suppose -7p + a - 12 = 0. Solve -5x = -px - 25 for x. 5 Let i = 1 - -2. Let c = -80 - -85. Suppose cd + j - 25 = 0, -ij + j = 0. Solve dq + 0 = -10 for q. -2 Suppose 5v - 8 = -3y - 0, -2 = -2y. Solve 0 = k - v + 4 for k. -3 Let r(g) = g - 7. Let u be r(9). Suppose -3b + ub = -4. Suppose 0 = 3f + bw - 6w - 10, -4f = w - 6. Solve 3v + 1 + f = 0 for v. -1 Let j be ((-12)/8)/(36/8 - 5). Solve -9y + jy = -6 for y. 1 Let s be (4 + 0)(-6)/(-12). Let b = s - 20. Let m be b/30 + (-36)/(-10). Solve -mx + 8 = 23 for x. -5 Let l(x) = x*3 + 42x*2 - 186x - 85. Let u be l(-46). Solve 41 = -uc + 41 for c. 0 Let n = 216 - 216. Solve -4w = -nw + 4 for w. -1 Let r(w) = 3w - 36. Let c be (-159)/(-15) - 6/10 - -2. Let y be r(c). Solve 2i + 3i = y for i. 0 Suppose 21 = 9x + 219. Let o be (-4)/x + 62/22. Solve o = y + 2y for y. 1 Suppose -3g + 9 = 0, -29 + 9 = -2l - 2g. Solve -lp + 12 = -9 for p. 3 Suppose -2q + l + 0l - 9 = 0, -3l = 9. Let z be (q/(-2))/(18/(-18)). Let j be 5 + (z - -1)1. Solve -v + jv = -2 for v. -1 Let a(k) = k + 12. Let v be a(-9). Let t(o) = 3 - 3o - 10o - 4o + 15o. Let z be t(-1). Solve 0 = zn - 4n - v for n. 3 Let s(i) = -i3 + i2 + 3i + 7. Let x(w) = -w*3 + 5w*2 - 6w + 5. Let c be x(4). Let t be s(c). Let j = t + -32. Solve 1 - 7 = -ju for u. 3 Let h(r) = -8r - 2. Let j be (24/(-2))/(1 + -3). Let l(x) = -7x - 1. Let b(s) = jl(s) - 5h(s). Let c be b(2). Solve -4t + t = c for t. 0 Suppose 217j - 225j = 0. Solve -12b + jb = 36 for b. -3 Let t = 6910 - 6906. Let x be 2 - (-2 - -3)0. Solve -th + x + 14 = 0 for h. 4 Suppose 11y + 4a + 38 = 13y, -y = -4a - 27. Solve -yu + 28 = -4u for u. 4 Let t(f) = -f. Let s(y) = 15y - 23. Let r(p) = 8p - 11. Let c(w) = -5r(w) + 3s(w). Let d(x) = -c(x) - 6t(x). Let j be d(-10). Solve 2k + j = 6k for k. 1 Suppose 0 = -6k + 17k - 99. Solve -kz - 4 = 5 for z. -1 Let j(f) = -2f3 + f2. Let h be j(-1). Let b(m) = -m + 13. Let y = 19 + -12. Let x be b(y). Solve -x = -0c + hc for c. -2 Suppose 12u - 15u = -5p + 3, -9 = -3u + p. Solve -m = um + 20 for m. -4 Let l(f) be the first derivative of -2f2 + 12f + 3. Let h be l(3). Solve 2b + 1 - 3 = h for b. 1 Let w be (8/(-7))/(-2)7. Solve -u = 3u + w for u. -1 Let w(t) = 1. Let j(u) = 3u + 22. Let q(h) = j(h) - 2w(h). Suppose 2c - 3 = -5g + 2g, g = -2c + 1. Let p be q(c). Solve -4k = k - p for	{ "pile_set_name": "DM Mathematics" }
- -254.1. Let l = 254.00000143 - m. Round l to seven decimal places. 0.0000014 Let d = -4.6 + 31.6. Let j = -0.30372358 - -27.30371778. Let q = d - j. What is q rounded to 6 dps? 0.000006 Let o = -22.6 - -26. Let s = o + -7. Let d = s - -8.3. Round d to zero dps. 5 Suppose -30 = -5j + 45. Suppose 0i + j = 3i, -2f - 5i = 43975. Round f to the nearest ten thousand. -20000 Let c(g) = -53g + 280. Let s be c(54). What is s rounded to the nearest one hundred? -2600 Suppose 0 = 2s - 5l - 115575, -s - 4l = s - 115620. Round s to the nearest 1000. 58000 Suppose 32m - 1146630 = -5m. Round m to the nearest ten thousand. 30000 Let a = -25.008 + 0.008. Let h = 81 + -100.5. Let o = h - a. What is o rounded to the nearest integer? 6 Let x(u) = 68504u*3 - 2u*2 + u + 1. Let r be x(1). Suppose -5s = 4z + r, -9z = -3s - 4z - 41095. What is s rounded to the nearest 1000? -14000 Suppose 0 = 9p - 17357128 - 6897872. What is p rounded to the nearest one hundred thousand? 2700000 Let s = -89 - -26. Let j = -62.999905 - s. Round j to 5 decimal places. 0.0001 Let m = 0.1627 + -0.242. Let d = 0.087 + m. Let s = 0.011 - d. Round s to 3 dps. 0.003 Let j = 19 + -17. Suppose -z = -3t + 3598, -jt - 4z + 3405 = 997. Suppose t = 3v - 0v. What is v rounded to the nearest one hundred? 400 Let l = -72.999644 + 73. Round l to 5 decimal places. 0.00036 Let r = 17 - 15. Suppose 7n = 8n - r. Suppose -z - 4u = 66, -2u + 0u = -nz - 122. What is z rounded to the nearest ten? -60 Let x = 38 - 40.5. Let l = -0.0397 + 2.5097. Let d = l + x. Round d to 2 dps. -0.03 Let p = 0.0512 - -0.2603. What is p rounded to two decimal places? 0.31 Let n = -3980 + 3979.999989983. Round n to 6 dps. -0.00001 Let v = 196 - 195.853. Let m = 1.12209 + -0.9767. Let d = m - v. What is d rounded to 4 decimal places? -0.0016 Let k = 3577 - 3532.624. Let p = k + -45.1. What is p rounded to one dp? -0.7 Let f be 2 - -6(-40)/(-15). Suppose -8c + 6c = -f. Let a be (-14404)/3 + 12/c. Round a to the nearest one thousand. -5000 Let j = -348546 + 243733. Let s be (-1 - -5) + -2 + -184815. Let c = s - j. Round c to the nearest 100000. -100000 Let n = 24.29594 - 24.25. Let s = 0.046 - n. Round s to 5 dps. 0.00006 Let n = -0.0392 - -0.1732. What is n rounded to one decimal place? 0.1 Let j = 182.67 + 0.33. Let t = 171.85 - 354.12. Let m = j + t. What is m rounded to 1 dp? 0.7 Let b = -60597.9850086 + 60598. Let t = b - 0.015. What is t rounded to six decimal places? -0.000009 Let f(o) = o2 - 2o - 6. Suppose 3g + m + m - 20 = 0, -2g - 2m + 16 = 0. Let b be f(g). Suppose -d + bd = 14000. Round d to the nearest one thousand. 14000 Let o = 118 + -103.4. Let m = -10.4 + -0.6. Let l = m + o. What is l rounded to the nearest integer? 4 Let a = -17.54 + 19. Round a to one decimal place. 1.5 Let g = -5.66 - 0.44. Let l = -0.1 - g. Let r = l + -6.0000024. What is r rounded to six decimal places? -0.000002 Let p = 1.089 + -78.289. What is p rounded to the nearest 10? -80 Let r = 0.4539945 - 0.454. Round r to 5 decimal places. -0.00001 Let y = -1.626 + -0.074. Let h = 12667624 - 12667622.30000224. Let c = h + y. What is c rounded to 7 decimal places? -0.0000022 Let o = 33 + -33. Suppose oq = -2q + 4. Suppose qz - 4 = -5f, -z - 2 + 4 = 2f. Round f to the nearest 10000. 0 Let a = 0.78307 - -476.20693. Let g = -479 + a. Round g to 1 decimal place. -2 Let f = 19.27 + -0.27. Let k = f - 19.000021. What is k rounded to 6 dps? -0.000021 Let r = -70.9418317 + -0.0643683. Let x = -71 - r. What is x rounded to three dps? 0.006 Let i(j) = -710001j*2 + j + 6. Let g be i(3). Let f be (-1)/((-2)/(-4)) + 2 - g. What is f rounded to the nearest 1000000? 6000000 Let r = -142.4 + 153.155. Let w = -11 + r. What is w rounded to 1 dp? -0.2 Let d = -20.423 - 0.177. Round d to 0 decimal places. -21 Suppose 17 = 2n - 7. Let l = -112 - -108. Let q be l/n - 1797/9. What is q rounded to the nearest 100? -200 Let j = -754.8908 + 820.891. Let i = j - 66. Round i to five dps. 0.0002 Let p = -770056.9699568 - -770058. Let z = p + -1.03. What is z rounded to six decimal places? 0.000043 Let j = 42.9 + 8.1. Let o = j - 51.27. Let l = o - -0.05. What is l rounded to 1 decimal place? -0.2 Let f = -3025606 + 4356806. Suppose 3v + v = f. Let q = -172800 + v. What is q rounded to the nearest ten thousand? 160000 Let i = 66.08 - 0.08. Let g = i - 65.99933. Round g to 4 decimal places. 0.0007 Let g = -293.184 - -0.184. Let r = g - -293.00251. What is r rounded to four decimal places? 0.0025 Let g = 0.52 - 0.51999463. Round g to 6 decimal places. 0.000005 Let g(u) = -47867u - 29 - 114036u - 2 - 6. Let v be g(21). What is v rounded to the nearest one million? -3000000 Let u = 1.0869996864 + -1.087. What is u rounded to 7 decimal places? -0.0000003 Let b = 496 - 495.999999688. What is b rounded to seven decimal places? 0.0000003 Suppose 4v - k - 54 = 0, 6k = -4v + 2k + 44. Let h = v - 27. Let o be 8h/(-8)21. What is o rounded to the nearest 10? 290 Let s = -10.18 - -10.1800438. Round s to six decimal places. 0.000044 Let l(q) = -14q + 2q2 + 0q - 3q2 + 8q - 6. Let t be l(-4). Suppose -28800 = -tn - 2n. What is n rounded to the nearest 1000? 7000 Let d = 0.06380236 + -0.0638. Round d to 7 decimal places. 0.0000024 Let y = 0.017 + 14.383. Let x = -14.400159 + y. Round x to five dps. -0.00016 Let k = 246 + -162. Let u = -85.2 + k. What is u rounded to 1 decimal place? -1.2 Let u = 10.3827 - 10.993. Round u to two decimal places. -0.61 Suppose 33 - 15 = 3a. Suppose am + 6m + 26160000 = 0. What is m rounded to the nearest one million? -2000000 Let i = 19.71 + 0.29. Let g = -25 + i. Let v = g - -5.00000022. What is v rounded to 7 decimal places? 0.0000002 Let d = -1.13 - -1.1300000372. Round d to seven dps. 0 Suppose 5z = 7z. Suppose -5w + zw + 4500000 = 0. Round w to the nearest one hundred thousand. 900000 Suppose -3s + 1953259 = -1149956. Suppose -8y = -1053595 - s. Round y to the nearest 10000. 260000 Let y = 3.99 - 0.91. Let x = -1 - -3. Let p = y - x. Round p to one dp. 1.1 Let w = -1996 - 14. What is w rounded to the nearest 100? -2000 Let d = -3570.655861 + 3572.406. Let r = d + 125.237561. Let l = 127 - r. What is l rounded to 3 dps? 0.012 Let l = -0.86 - -22.46. Let c = 4832.73 + -4812. Let w = l - c. Round w to one dp. 0.9 Let b(g) = 25g + 19. Let w be b(5). Let j be 31679996/18 + 32/w. Round j to the nearest one hundred thousand. 1800000 Let d = 107 + 41. Suppose f - d - 852 = 0. What is f rounded to the nearest 100? 1000 Suppose -3m = 2x - 2 + 8, -4m = -4x + 8. Suppose xw + 3w = 102. Let r = -64 + w. Round r to the nearest 100. 0 Let p = 9.24 - 9.239999066. Round p to 7 decimal places. 0.0000009 Let t = -35 - -44.4. Let l = 9.4000323 - t. Round l to six dps. 0.000032 Let q = 0.0001 - 380.0001. Let h = -139 - q. Let l = h + -241.000101. What is l rounded to 5 decimal places? -0.0001 Let d(c) = -c*3 - 9c*2 - 8c - 2. Suppose -2 = 2z - 6. Suppose -zi - 2b - 14 = -b, 4b + 35 = -5i. Let n be d(i). Round n to the nearest 10. -40 Let s = -745.855 + 765.8. Let y = -32 - -52. Let v = y - s. Round v to 2 dps. 0.06 Let n = -3.4114 - -3.58. Round n to two dps. 0.17 Suppose -3s - 4s + 455 = 0. Suppose -5h + 4w = -35980, -h = -w - s - 7130. What is h rounded to the nearest one thousand? 7000 Let j = 0.34064 - 0.3129. Round j to two decimal places. 0.03 Let k = 3.424778 + -3.3808. Let a = -0.0435 + k. Round a to 4 dps. 0.0005 Let o(n) be the first derivative of -42698n*2 - 20n - 21. Let r be o(5). What is r rounded to the nearest 100000? -400000 Let o = -0.087999271 - -0.088. What is o rounded to seven dps? 0.0000007 Let a(n) be the first derivative of -217n4/4 - 16n*3/3 - 9n*2/2 + 10n - 12. Let q be a(-11). Suppose j - q = -0j. Round j to the nearest ten thousand. 290000 Let f = 0.4325 + -0.0265. Let h = -169.594 - f. Let z = -162.7 - h. Round z to zero decimal places. 7 Let c = -36.3057172 - -7.3056957. Let z = 29 + c. Round z to six dps. -0.000022 Let h = -3.64 + 3.6664. Round h to three dps. 0.026 Let q be ((-9)/27)/(1/(-12)). Suppose qp - 150006 = p. Let x be 0 + (-4)/(-2) - p. What is x rounded to the nearest 10000? -50000 Let l = -769728.000056 - -769740. Let k = -	{ "pile_set_name": "DM Mathematics" }
divide 578? False Is 4 a factor of 199? False Is 469 a multiple of 39? False Is 2075 a multiple of 31? False Is 884 a multiple of 4? True Does 100 divide 2762? False Is 4 a factor of 723? False Is 2140 a multiple of 26? False Is 31 a factor of 1028? False Is 68 a factor of 10465? False Does 3 divide 490? False Does 6 divide 212? False Is 23 a factor of 874? True Is 119426 a multiple of 8? False Is 34960 a multiple of 40? True Is 11 a factor of 1064? False Is 744 a multiple of 93? True Is 20988 a multiple of 92? False Is 11 a factor of 18139? True Is 17523 a multiple of 59? True Is 2585 a multiple of 33? False Does 18 divide 432? True Is 368 a multiple of 16? True Does 57 divide 1539? True Is 31 a factor of 4727? False Does 42 divide 917? False Is 23 a factor of 11868? True Does 7 divide 2494? False Does 13 divide 1385? False Does 6 divide 4276? False Does 32 divide 352? True Does 11 divide 1108? False Is 15985 a multiple of 217? False Is 158 a factor of 7019? False Is 14 a factor of 462? True Does 114 divide 2140? False Is 4336 a multiple of 13? False Is 1116 a multiple of 31? True Is 93 a factor of 38332? False Is 43604 a multiple of 14? False Does 23 divide 26404? True Is 1740 a multiple of 13? False Is 17 a factor of 61151? False Is 19 a factor of 2831? True Does 6 divide 3174? True Does 52 divide 1997? False Is 8903 a multiple of 14? False Is 599 a multiple of 59? False Does 30 divide 30? True Does 6 divide 178? False Is 17451 a multiple of 21? True Does 29 divide 833? False Is 15 a factor of 20475? True Does 87 divide 12789? True Is 425 a multiple of 6? False Is 7676 a multiple of 101? True Does 20 divide 108440? True Is 3762 a multiple of 57? True Does 62 divide 36642? True Is 37 a factor of 1517? True Does 15 divide 26355? True Is 181 a multiple of 47? False Is 11 a factor of 97988? True Is 7 a factor of 11240? False Is 2 a factor of 1663? False Is 5 a factor of 3010? True Is 5695 a multiple of 19? False Is 36078 a multiple of 14? True Is 73 a factor of 987? False Does 29 divide 1913? False Is 33819 a multiple of 248? False Is 25 a factor of 106? False Is 33 a factor of 1071? False Is 9 a factor of 284? False Is 1932 a multiple of 84? True Is 375 a multiple of 5? True Is 216 a multiple of 8? True Is 15078 a multiple of 51? False Does 13 divide 720? False Is 210 a multiple of 10? True Does 64 divide 832? True Is 44 a factor of 9611? False Is 13 a factor of 1157? True Is 10794 a multiple of 14? True Is 9400 a multiple of 50? True Is 25 a factor of 414? False Is 546 a multiple of 3? True Does 65 divide 24765? True Is 33285 a multiple of 105? True Is 30 a factor of 8450? False Is 103 a factor of 109901? True Is 31960 a multiple of 3? False Does 47 divide 2021? True Does 7 divide 1568? True Does 31 divide 325? False Does 24 divide 31692? False Is 23291 a multiple of 227? False Does 35 divide 35? True Is 12819 a multiple of 11? False Does 20 divide 64220? True Does 25 divide 537? False Is 4092 a multiple of 51? False Is 186 a multiple of 9? False Is 37 a factor of 15910? True Is 405 a multiple of 31? False Does 15 divide 1489? False Does 19 divide 4598? True Is 4848 a multiple of 101? True Is 479 a multiple of 13? False Is 26840 a multiple of 44? True Does 10 divide 6522? False Is 2440 a multiple of 61? True Is 5 a factor of 2005? True Is 170 a factor of 860? False Is 2448 a multiple of 3? True Is 25546 a multiple of 26? False Is 1082 a multiple of 7? False Is 65 a factor of 1837? False Is 514 a factor of 26005? False Does 144 divide 24012? False Is 2588 a multiple of 104? False Is 1554 a multiple of 16? False Is 28 a factor of 1064? True Is 14 a factor of 461? False Is 1304 a multiple of 8? True Is 7075 a multiple of 25? True Is 4 a factor of 41628? True Is 14 a factor of 278? False Is 50 a factor of 9164? False Is 5840 a multiple of 80? True Is 20 a factor of 13541? False Does 62 divide 9055? False Is 10686 a multiple of 26? True Is 11040 a multiple of 92? True Is 9 a factor of 1341? True Is 10 a factor of 361? False Is 2 a factor of 11141? False Is 11 a factor of 23738? True Is 193 a factor of 65782? False Does 26 divide 277? False Is 1169 a multiple of 19? False Does 12 divide 2025? False Is 1461 a multiple of 62? False Is 560 a multiple of 70? True Is 28914 a multiple of 183? True Is 25389 a multiple of 88? False Is 1582 a multiple of 7? True Is 14 a factor of 322? True Does 27 divide 714? False Is 576 a multiple of 38? False Is 31198 a multiple of 279? False Does 12 divide 1826? False Is 59 a factor of 19488? False Is 6 a factor of 538? False Is 456 a multiple of 5? False Is 95 a factor of 1045? True Is 49 a factor of 7742? True Does 8 divide 313? False Does 41 divide 385? False Does 9 divide 20637? True Does 101 divide 50931? False Is 1394 even? True Is 12 a factor of 2100? True Is 135 a multiple of 5? True Is 2792 a multiple of 4? True Is 577 a multiple of 11? False Does 10 divide 222? False Is 9 a factor of 1140? False Is 2 a factor of 101? False Is 5518 a multiple of 89? True Is 1262 a multiple of 2? True Is 312 a multiple of 12? True Is 19176 a multiple of 7? False Is 6513 a multiple of 3? True Is 472 a multiple of 44? False Is 53 a factor of 1219? True Does 29 divide 3973? True Is 45 a multiple of 2? False Is 3801 a multiple of 181? True Is 2 a factor of 214? True Is 4485 a multiple of 3? True Is 36 a factor of 86508? True Is 78 a factor of 1248? True Is 1932 a multiple of 28? True Is 88 a factor of 946? False Does 8 divide 11913? False Is 91127 a multiple of 27? False Is 66 a factor of 10692? True Does 4 divide 3716? True Does 82 divide 1394? True Does 79 divide 5350? False Does 21 divide 588? True Is 403 a multiple of 23? False Is 9852 a multiple of 6? True Does 10 divide 11555? False Does 11 divide 350? False Does 10 divide 3150? True Does 95 divide 38789? False Is 595 a multiple of 11? False Is 336 a multiple of 28? True Does 2 divide 5094? True Is 25749 a multiple of 22? False Is 130 a factor of 55120? True Does 29 divide 447? False Is 1690 a multiple of 86? False Does 57 divide 3330? False Is 61 a factor of 3209? False Is 84 a factor of 2113? False Is 27 a factor of 1053? True Is 11 a factor of 275? True Is 35 a factor of 735? True Is 28 a factor of 225? False Does 27 divide 27578? False Is 37108 a multiple of 21? False Is 31 a factor of 41834? False Does 2 divide 607? False Does 5 divide 45581? False Is 42275 a multiple of 31? False Does 2 divide 341? False Is 6567 a multiple of 10? False Is 14 a factor of 74? False Is 40 a factor of 11160? True Is 140 a factor of 3673? False Is 6 a factor of 1380? True Does 11 divide 737? True Is 53527 a multiple of 85? False Is 56 a factor of 4480? True Is 2788 a multiple of 10? False Does 6 divide 324? True Does 20 divide 758? False Is 8482 a multiple of 19? False Is 4535 a multiple of 123? False Is 19043 a multiple of 139? True Does 54 divide 49410? True Does 30 divide 38220? True Does 35 divide 2685? False Does 72 divide 24140? False Is 8008 a multiple of 77? True Is 1836 a multiple of 34? True Does 6 divide 1996? False Is 13 a factor of 2158? True Does 47 divide 611? True Is 16656 a multiple of 41? False Is 1056 a multiple of 22? True Does 24 divide 336? True Is 9 a factor of 2470? False Is 4692 a multiple of 16? False Does 5 divide 49605? True Is 3686 a multiple of 21? False Is 9809 a multiple of 83? False Is 172 a factor of 4472? True Does 11 divide 12565? False Is 1229 a multiple of 48? False Does 4 divide 224? True Is 2 a factor of 529? False Is 34 a factor of 185? False Is 108 a factor of 3672? True Does 189 divide 4158? True Is 1599 a multiple of 41? True Is 504 a multiple of 38? False Is 19 a factor of 30020? True Does 80 divide 303? False Is 4 a factor of 1628? True Is 15943 a multiple of 2? False Is 2912 a multiple of 32? True Is 765 a multiple of 6? False Does 17 divide 149? False Is 2223 a multiple of 19? True Does 3 divide 7986? True Does 81 divide 5055? False Is 1236 a multiple of 6? True Does 68 divide 1224? True Does 17 divide 1205? False Does 17 divide 306? True Is 17 a factor of 238? True Is 13 a factor of 736? False Is 628 a multiple of 3? False Is 62 a factor of 53871? False Does 9 divide 655? False Is 12850 a multiple of 22? False Does 23 divide 2875? True Is	{ "pile_set_name": "DM Mathematics" }
-2254759w2 + 63803w + 15? -4509518 What is the third derivative of -68404pq*4 + 7822pq3 + 3487159pq - 5p + q*2 - q wrt q? -1641696pq + 46932p Find the third derivative of -116446679i6 - 123830416i*2. -13973601480i*3 What is the first derivative of -302582624q + 556525637 wrt q? -302582624 What is the derivative of -15009756n + 519268970? -15009756 What is the derivative of 6300769q*4 - 1867277? 25203076q*3 Find the second derivative of -235911659z*5 - 4z - 6837662. -4718233180z3 What is the third derivative of 35157452z*4 + 201z*2 - 262302z? 843778848z Find the second derivative of -3904400c*3 - 24c + 59801. -23426400c Find the second derivative of -265g*4mz - 13262g*2mz + 81gmz - gm + 2gz + 2mz + 3m + 27 wrt g. -3180g2mz - 26524mz What is the second derivative of -142194696dp2 - 6dp - 644d - 3202 wrt p? -284389392d What is the third derivative of 328199896z*3 - 1093048z*2 + 94z? 1969199376 Find the second derivative of -80f2u*3 - 8294f*2u + 3f2 + 5f + 29664u3 + 2u - 1 wrt u. -480f2u + 177984u What is the second derivative of 233611902r*4 + r - 11058913? 2803342824r*2 Find the third derivative of 27q*4 + 128483q*3 + 36687066q*2 wrt q. 648q + 770898 What is the second derivative of 2f4 - 113f*3 - 14784f*2 + 10f - 11117 wrt f? 24f2 - 678f - 29568 What is the third derivative of -33453816o5 - o2 - 246o - 21708? -2007228960o2 Differentiate -5530741bf4 + 380b - f*3 + 3074 with respect to f. -22122964bf3 - 3f*2 What is the second derivative of -97325p*4 + 898p*2 + 813030p - 716? -1167900p2 + 1796 Differentiate 7g*3k - g*3 + 32711g*2k + 70g + 5k - 619 with respect to k. 7g3 + 32711g*2 + 5 What is the third derivative of -52965255w4 - w2 + 17172w - 150 wrt w? -1271166120w What is the second derivative of 2am*3x*2 - 2am3x - 863404am*2x + 44amx + 153ax2 - 74390m*3x*2 wrt x? 4am3 + 306a - 148780m3 What is the first derivative of -3ch2 + 33030719c - 1359222h4 wrt h? -6ch - 5436888h*3 What is the second derivative of -124r*3s*2 + 49r*3 - 3r*2s*2 - 15rs2 + 14rs + 32s*2 - 90s wrt s? -248r3 - 6r*2 - 30r + 64 What is the derivative of 88957146w + 36614389 wrt w? 88957146 Differentiate 94rx + 15557380r + 2272x wrt x. 94r + 2272 Find the second derivative of in3 - 2in2 - 27604193in - 335182n*3 - 6n*2 wrt n. 6in - 4i - 2011092n - 12 Find the first derivative of -1220dk3 + 1283019572d - 2929k3 + k2 wrt k. -3660dk2 - 8787k*2 + 2k What is the second derivative of 2g3r*3 + 10507607g*3r*2 - 3gr3 + 502742gr2 wrt g? 12gr3 + 63045642gr2 Find the third derivative of 864337k*2vx4 + 1893k*2vx2 - 888k*2x*2 + 3k*2x + 74vx*4 - v wrt x. 20744088k*2vx + 1776vx Find the second derivative of -131227208n*2 - 89631613n. -262454416 What is the second derivative of 361759445m2 + 784261m - 95? 723518890 What is the second derivative of 140065a3i*2 + 3a*3 + 5ai + a - 47i*2 + 2i + 490 wrt a? 840390ai*2 + 18a What is the second derivative of -51q3 + 40819q*2 - 53618101q wrt q? -306q + 81638 What is the third derivative of -364668gk3 + 82gk2 + 89gk + 2k*6 + 4k*3 + 5k*2 wrt k? -2188008g + 240k3 + 24 What is the derivative of 316278958z - 429302026 wrt z? 316278958 Find the third derivative of -2v6 - 8v*5 + 1087903v*3 - 17876293v*2 - v - 2. -240v*3 - 480v*2 + 6527418 Find the third derivative of -15994048z*3 - 9648601z*2 wrt z. -95964288 Differentiate 78013121a - 48373127 with respect to a. 78013121 Differentiate 1062666029a2 + 28875350 with respect to a. 2125332058a What is the second derivative of 15272f2lo2 - 4f*2ou + 10flu - 12fo*2u + 2463fo + 8l + 20o*2 wrt o? 30544f*2l - 24fu + 40 Differentiate -15186656np - 75n - p - 151236 wrt p. -15186656n - 1 What is the derivative of -8r2 + 201077r - 6183555? -16r + 201077 Find the first derivative of 80z*3 - 3771341z*2 - 2z + 260962919 wrt z. 240z2 - 7542682z - 2 Find the second derivative of -9720370i2q*2 + 399i*2q - 2i2 + 716iq - 3q - 1 wrt q. -19440740i2 What is the second derivative of 164386217h*2 - 136851482h? 328772434 What is the first derivative of 3609368p2 - 9429823? 7218736p What is the second derivative of 3140404y5 - 164806482y wrt y? 62808080y3 What is the second derivative of -1086884125i*3 - 647896084i wrt i? -6521304750i Find the second derivative of 241140l*2y*2 - 594l*2 + 347ly - 6l - 5y5 - 2y wrt y. 482280l2 - 100y*3 Find the second derivative of -10214935t*3 + 3t*2 + 364437639t. -61289610t + 6 What is the third derivative of -1296956b*3m*2 - 5b3 + b2m2 + 2b*2m - 24b2 + bm*2 + 23 wrt b? -7781736m*2 - 30 What is the second derivative of -2lw4x + 7997201lw*2x + 33415lwx + 9lx - 4w - 2x wrt w? -24lw2x + 15994402lx What is the third derivative of 29925347km*3 - 10km2 + 6km + 49m + 1692 wrt m? 179552082k Find the third derivative of 5442974n*2o*6 + 2n*2o2 + n2o - no + 114803n + o wrt o. 653156880n*2o*3 Find the third derivative of -326o*6 + 108500o*4 - 140403090o*2 wrt o. -39120o*3 + 2604000o Find the first derivative of -75081942g2 + 234802371 wrt g. -150163884g What is the third derivative of 2f3kl - 111192f*3l + 15f3 - 2915f*2l + 768kl wrt f? 12kl - 667152l + 90 What is the second derivative of 4m*2r*3 + 16m*2r*2 - 4886m*2 - mr*3 + 3m - 3254r3 - 7r*2 wrt m? 8r*3 + 32r*2 - 9772 Find the first derivative of -614d*2w + 2178d2 + 5769dw + 4w - 63431 wrt w. -614d2 + 5769d + 4 What is the third derivative of 2j2s*3 - 2j*2s*2 + 225j*2s - 82js*3 - js*2 - 229js - 22664s*3 + 3s*2 + 3s wrt s? 12j2 - 492j - 135984 Find the third derivative of -96776726a6 + 11a*2 - 124237a - 9. -11613207120a3 What is the derivative of -2302650r + 5242581 wrt r? -2302650 Find the second derivative of 1299z5 - 7878z*2 - 69546969z wrt z. 25980z3 - 15756 Find the first derivative of 239j*2p - 397j2 + 1111j + 1661992p - 128 wrt p. 239j*2 + 1661992 What is the second derivative of -6v*3 - 165470v*2 - 5241v - 331 wrt v? -36v - 330940 What is the third derivative of -4s*5 + 3071970s*3 + 2s*2 + 7s - 16212? -240s2 + 18431820 What is the third derivative of -7722200h*4 + 2h*2 + 883794h - 2 wrt h? -185332800h Find the second derivative of -23699957o*2 - 73166034o. -47399914 What is the second derivative of 160f3i*2 - 17826f*2i*2 - 2fi + 232f + 9i2 + 540 wrt f? 960fi2 - 35652i*2 What is the first derivative of -420l*2v + 28006186l2 - 250313lv + 10l wrt v? -420l2 - 250313l What is the derivative of -189912053j3 - 155459676 wrt j? -569736159j*2 Find the second derivative of 7313333z*2 + 901798z + 4. 14626666 What is the derivative of 1597q3 - 1549q - 6065872 wrt q? 4791q2 - 1549 Find the third derivative of -197260o6 + o4 - 3o3 + 21o*2 + 54175o - 1 wrt o. -23671200o3 + 24o - 18 Find the second derivative of 2xz*4 + 23009xz2 - 16545xz + 103z*3 + 114z + 5 wrt z. 24xz*2 + 46018x + 618z Find the third derivative of -51c*4n*2 + 5c*3n*2 + 470c*3 + 3797c*2n - cn2 + 20n wrt c. -1224cn*2 + 30n*2 + 2820 What is the second derivative of -694cd2oz + 82847cd2 - cdo - 15cdz - cd + 115152coz + 2doz + dz wrt d? -1388coz + 165694c What is the third derivative of 67463463r3 - 122653r*2 - 67 wrt r? 404780778 Find the second derivative of 12313749o*2 - 2552529o + 2 wrt o. 24627498 What is the third derivative of -263hw*4 - 2hw2 - 11836hw + 2h - 3w4 + 585w*3 + 7w*2 wrt w? -6312hw - 72w + 3510 Find the third derivative of 110938c4 + 44c*3 - 4c*2 - 2304693c. 2662512c + 264 Find the second derivative of -1524240p*3 + 140p*2 - 2p - 175134194. -9145440*p + 280 Find the third derivative of -2410455	{ "pile_set_name": "DM Mathematics" }
8164, 42430, 56696, 70962? 85228 What is the next term in -6517, -52298, -176567, -418570, -817553, -1412762, -2243443? -3348842 What is the next term in 6820, 7164, 7508? 7852 What comes next: 38327, 76445, 114353, 152051, 189539, 226817, 263885? 300743 What is next in -53, -105, -261, -521? -885 What is next in 3444, 7609, 11776, 15945, 20116? 24289 What is the next term in 40128, 160636, 361522, 642786, 1004428, 1446448, 1968846? 2571622 What is next in 105665374, 105665372, 105665370, 105665368, 105665366, 105665364? 105665362 What comes next: -53527, -50498, -47469, -44440? -41411 What is next in 119376, 237937, 356494, 475041, 593572, 712081, 830562, 949009? 1067416 What is the next term in 233908, 467857, 701804, 935749, 1169692, 1403633? 1637572 What comes next: -131819, -132124, -132429, -132734, -133039, -133344? -133649 What is next in -421, -1245, -3445, -7699, -14685? -25081 What is the next term in -60732759, -121465516, -182198273? -242931030 What is next in -236490882, -236490862, -236490828, -236490774, -236490694, -236490582, -236490432, -236490238? -236489994 What is next in 13606105, 13606095, 13606085, 13606075? 13606065 What is the next term in -110094, -110127, -110160, -110193, -110226? -110259 What comes next: -18842719, -37685410, -56528085, -75370738, -94213363? -113055954 What is the next term in 95981, 95964, 95935, 95894, 95841? 95776 What comes next: 3017, 5595, 8173, 10751, 13329, 15907? 18485 What is next in 1488, 3291, 5088, 6879, 8664, 10443? 12216 What is the next term in 4004, 12459, 20914, 29369, 37824, 46279? 54734 What is next in -104797, -839040, -2831989, -6712996, -13111413, -22656592? -35977885 What is next in -6983, -55698, -187959, -445550, -870255, -1503858, -2388143? -3564894 What is next in -53592, -428672, -1446758, -3429354, -6697964, -11574092, -18379242, -27434918? -39062624 What is next in 2113, 16856, 56809, 134578, 262769? 453988 What is next in -131887, -128825, -125759, -122689, -119615, -116537? -113455 What comes next: -872, -1367, -1830, -2249, -2612, -2907, -3122, -3245? -3264 What is next in 5412, 21438, 48130, 85488? 133512 What is next in 197629, 395269, 592907, 790543, 988177? 1185809 What is next in 10604391, 10604383, 10604375, 10604367, 10604359, 10604351? 10604343 What is next in -2963, -5667, -10175, -16487, -24603, -34523, -46247? -59775 What comes next: -15144, -30287, -45434, -60585, -75740? -90899 What comes next: -48038, -85240, -122428, -159596, -196738, -233848? -270920 What comes next: -1700669, -3401346, -5102023? -6802700 What comes next: 60177, 60483, 60989, 61695, 62601? 63707 What comes next: -1316, -2340, -3652, -5252? -7140 What is next in 4363, 1674, -2823, -9140, -17289, -27282, -39131? -52848 What is the next term in 5327, 47976, 163731, 389144, 760767, 1315152? 2088851 What is the next term in -184194, -184245, -184296, -184347? -184398 What comes next: 55570, 56133, 56700, 57271, 57846? 58425 What comes next: 4260, 8912, 13958, 19392, 25208? 31400 What is the next term in -1993, -1380, 4431, 18038, 42039, 79032? 131615 What is the next term in -36143015, -36143011, -36143009, -36143009, -36143011, -36143015? -36143021 What comes next: -17378, -69482, -156306, -277844, -434090, -625038, -850682? -1111016 What comes next: 133834, 133988, 134142, 134296? 134450 What comes next: -17884340, -35768676, -53653012, -71537348? -89421684 What is the next term in 179, 289, 443, 647, 907, 1229, 1619? 2083 What is the next term in 1882, 3669, 5450, 7225, 8994? 10757 What is next in 13122330, 13122329, 13122328, 13122327, 13122326, 13122325? 13122324 What comes next: 76915, 153814, 230713? 307612 What is next in 244411, 977583, 2199535, 3910267, 6109779? 8798071 What is next in 67320, 67412, 67504, 67596? 67688 What comes next: 304626464, 304626467, 304626472, 304626479, 304626488, 304626499? 304626512 What comes next: -24, 40, 136, 264, 424? 616 What comes next: -7394, -7391, -7392, -7397, -7406, -7419? -7436 What is the next term in 20276, 162397, 548266, 1299785, 2538856, 4387381, 6967262? 10400401 What is next in -138037, -276084, -414121, -552148, -690165, -828172, -966169? -1104156 What is the next term in 4320, 6069, 9006, 13131, 18444? 24945 What is the next term in 1496, 1328, 1122, 878? 596 What is the next term in 263378, 526752, 790120, 1053476, 1316814? 1580128 What comes next: 7353452, 7353443, 7353432, 7353419, 7353404, 7353387, 7353368? 7353347 What is the next term in -2055, -8211, -18479, -32865, -51375, -74015, -100791? -131709 What comes next: -1318, -1091, -774, -367, 130, 717, 1394? 2161 What is next in 21844, 22826, 23808, 24790, 25772, 26754? 27736 What is the next term in -187532673, -375065351, -562598031, -750130713? -937663397 What is the next term in 6768634, 6768627, 6768616, 6768601, 6768582, 6768559? 6768532 What is next in -22841, -82232, -178175, -310664, -479693, -685256? -927347 What comes next: 54814134, 109628273, 164442412? 219256551 What is next in 7510, 25856, 55036, 95050, 145898, 207580, 280096? 363446 What is the next term in 5539218, 5539212, 5539204, 5539194, 5539182, 5539168, 5539152? 5539134 What comes next: -572, -4979, -12322, -22601, -35816? -51967 What is the next term in -150, -111, 212, 1029, 2550, 4985, 8544, 13437? 19874 What comes next: -2936, -5524, -8028, -10406, -12616, -14616, -16364, -17818? -18936 What comes next: -2382197, -2382167, -2382123, -2382059, -2381969, -2381847? -2381687 What is the next term in -208280, -208326, -208436, -208640, -208968? -209450 What is the next term in 87733, 175598, 263463? 351328 What comes next: -283792, -284601, -285412, -286225, -287040, -287857? -288676 What is the next term in 8904, 9166, 9604, 10218, 11008, 11974, 13116? 14434 What is the next term in 983, 8210, 28071, 66962, 131279, 227418, 361775, 540746? 770727 What comes next: 11443429, 11443427, 11443425, 11443423, 11443421, 11443419? 11443417 What comes next: 96, 455, 1070, 1941, 3068? 4451 What is the next term in 577719, 2312559, 5203967, 9251949, 14456511, 20817659, 28335399? 37009737 What is the next term in -14300, -14148, -13996, -13844? -13692 What is next in 677, 816, 1053, 1382, 1797, 2292, 2861? 3498 What is the next term in -5460, -16733, -28006, -39273, -50528, -61765, -72978, -84161? -95308 What comes next: -1074, -1973, -2724, -3327, -3782, -4089, -4248? -4259 What comes next: 13767, 27765, 42003, 56493, 71247, 86277, 101595, 117213? 133143 What is next in 9489, 9503, 9543, 9615, 9725, 9879? 10083 What is next in -5959, -12051, -18145, -24241, -30339? -36439 What is the next term in -4348, -4284, -4220, -4156, -4092, -4028? -3964 What comes next: 197, 1134, 2647, 4712, 7305? 10402 What is the next term in 2433453, 4866911, 7300369, 9733827? 12167285 What comes next: -249, -1001, -2277, -4071, -6377? -9189 What is next in -1642346, -1642448, -1642550? -1642652 What is next in 2380686, 2380897, 2381108, 2381319, 2381530? 2381741 What is the next term in -3644303, -7288620, -10932937, -14577254, -18221571? -21865888 What is the next term in -303, -616, -1057, -1620, -2299, -3088? -3981 What is the next term in 2670, 2746, 2852, 2988, 3154, 3350, 3576? 3832 What is next in 961667549, 961667550, 961667561, 961667588, 961667637? 961667714 What comes next: 450, 3457, 11594, 27429, 53530, 92465? 146802 What is the next term in -13847, -13104, -11865, -10130, -7899, -5172, -1949? 1770 What is next in -486400, -970910, -1455406, -1939882, -2424332, -2908750? -3393130 What comes next: -12668, -12607, -12548, -12491, -12436, -12383, -12332? -12283 What is the next term in 8876, 17635, 26280, 34805, 43204, 51471, 59600, 67585? 75420 What comes next: -8000782, -16001562, -24002342? -32003122 What is the next term in -3041124, -3041109, -3041092, -3041073, -3041052, -3041029? -3041004 What is the next term in -6154, -13215, -20276, -27337, -34398, -41459? -48520 What is next in -150616643, -150616646, -150616649, -150616652, -150616655? -150616658 What comes next: 434182303, 434182306, 434182309, 434182312, 434182315? 434182318 What comes next: 78368, 78412, 78488, 78596, 78736, 78908? 79112 What is the next term in -1969, -2024, -2061, -2074, -2057? -2004 What comes next: 320778, 641592, 962394, 1283178, 16	{ "pile_set_name": "DM Mathematics" }
22 + 13, 3p = 4x + 77. Let m = -29 + p. Which is bigger: m or b? b Let h be 4 - 0/(-5 + 4). Suppose 2 = hk + 10, 3v - 4k - 8 = 0. Which is smaller: v or 13/62? v Let g be 2/(-5) - (141/(-15) + 4). Suppose 20h + go - 26 = 17h, -3o = -12. Suppose -8 = -8v + 4v. Are v and h equal? True Suppose 3p + 630 = -3l, -2l + 6p - 429 = 5p. Let f = -213 - l. Which is smaller: f or 24/31? f Let q be 12/(-8) - (15/20)/(10/4). Let i = 2 + -2. Is q less than or equal to i? True Suppose 5 = 5r, 2f - r - 31 - 38 = 0. Suppose 79 = 3s + b, 4s - 63 = -5b + f. Let n = s - 5. Is 21 equal to n? False Suppose 67d + 57d + 543 = -57d. Is d at most -577? False Let y be 272/(-170) + (-1)/(-2)(1 - -3). Is -2543 at most as big as y? True Suppose 0g = -2g + g. Let o be (6/33)/(9/(-27) - -1). Is g at most o? True Suppose 414c - 382c = 28896. Which is smaller: 905 or c? c Let h = 30280 - 30270. Suppose -o + 40 = 4o. Suppose -v - 5s - o = 0, -6 = -3v + 3s + 42. Which is bigger: h or v? v Let l be 0 - 4 - (-23 - -18). Let v be -1(l4 + (-13250)/3310). Is v != -1? True Let x(q) = 56q - 83. Let u be x(8). Suppose 4w = -11 - u. Which is greater: 0 or w? 0 Suppose -17a + 96 = -20a. Let h = 958 - 2969/3. Is h at most a? False Let p = -104257/195510 - 1/13034. Let c = 0.7 - -0.2. Let j = 0.1 + c. Is j equal to p? False Let v = -9098 - -16519. Which is bigger: 7420 or v? v Let o = 6671/1986 + -17/662. Suppose 5k + 20 = -0k. Let q = k - -6. Which is smaller: o or q? q Let o = 96755 - 1839481/19. Is -2/9 > o? True Let n = -0.617 + 3.535. Let v = n + -2.9. Let r = -18.018 + v. Which is smaller: -0.1 or r? r Let o be (1 + -1)/(-4)(0 - 1). Suppose -3k + 15 = 4u, 2k + 3u + 0 - 11 = o. Let n be (-69)/12 - -3 - 6/(-2). Which is smaller: k or n? n Suppose 0 = 17n + 7n + 192. Let i be (6/4)/(n + (-47)/(-6)). Which is bigger: i or 2? 2 Let m be ((-260)/(-48))/(3510/23760). Suppose -4z + j = 215, -5z - 5j - 197 = -z. Let c = z + 89. Is m != c? True Let j(y) = -y2 + 40y + 1269. Let r be j(-49). Is -3092 at most r? True Suppose -400 = -7b + 62. Let r be b/(-10) - 36/(-60). Let z be (r/(-35))/(4/(-20)). Is 0 at most z? False Let n = 56/61 + -4770/5063. Let y = 7/69 - 10/23. Is y smaller than n? True Let k(s) = 2s + 20. Let l be k(0). Let m be -15(64/l - 4). Let x = m + -13. Which is smaller: x or -2? -2 Let u = -96 - -164. Let x = -9773 + 9768. Which is greater: x or u? u Let w(p) = -2p*3 + 3p*2 - 7p - 7. Let r be w(4). Let s = -118 - r. Does s = -27/7? False Let l(o) = o*3 + 2o*2 - 1. Let g be (-27)/18 + (-81)/(-2). Let y = g - 40. Let z be l(y). Do 4/7 and z have the same value? False Suppose -5z - 5c - 35 = 0, z - c = -0c - 11. Let u = 11141 - 11151. Which is smaller: z or u? u Let q = -177 + 135. Let y be 5 - (-198)/q - 9/7. Is y != 3/64? True Suppose -5r = 3g - 212, 0 = -g - g - 3r + 142. Let l = g + -98. Is l <= -24? True Let x be (1646844/(-120))/31 - (-6)/(-20). Is -445 greater than or equal to x? False Let h(q) = -q - 4. Let v be h(-5). Let a = -3/2141 + -3079/858541. Which is smaller: a or v? a Suppose 5a - 2j = 3 + 13, 4j - 20 = -3a. Let r(d) = -3d + 17. Let b be r(a). Let c be (1/6)/(4 - (-85)/(-20)). Are c and b equal? False Let k = 19018 - 19185. Which is smaller: k or -164? k Let n = 2/331 - 1996/1655. Let f = 48 - 50. Are n and f non-equal? True Let c = 47 - 50. Let p be c/(-222)(-28)/35. Is p smaller than 1? True Let m = -13661/30 + 911/2. Which is bigger: m or -602? m Suppose 5i - 8s - 11007 = -9s, 0 = 4s - 28. Are i and 2202 equal? False Let j = 7253/3 - 616493/255. Let y be (-3)/2(-2)/(-3). Is j at least y? True Let g = -0.1144 - 0.3456. Let w = 102 - 105. Which is greater: g or w? g Let a = 17 - 15. Suppose -6j = -aj - 4. Let h be 3/((-30)/28) - -4. Is j smaller than h? True Suppose 15c = 39 - 204. Let d be 3 + -1 + 6/c3. Suppose 0 = -u - u - 2. Is d smaller than u? False Let t be (4/2)/(-6 - 2712/(-453)). Let p = t - -152. Do p and -4/87 have different values? True Let g be (-56)/(-10) - 6/10. Suppose -65 = gd + s, -s - 2s = -2d - 26. Let j be (725/(-50) - (-7)/2) + 0. Which is greater: d or j? j Let r be (-6)/11745/100(-8)/798. Which is bigger: 1 or r? 1 Suppose -3x = 3p + 27, 8x = 4p + 4x + 12. Let g be p/(8 - (6 + 0)). Is -0.3 not equal to g? True Suppose 0 = -5u + 9 + 16. Suppose j = 4z - 20, 4j - uz + 20 = -4z. Which is smaller: -45/13 or j? j Let i = -3801 - -163457/43. Suppose -5t = 4n + 15, 38 = 5n - 5t + 23. Which is greater: n or i? i Let f be 3 + (-272)/46 + 5. Let s = f + -1273/621. Is s <= 0.02? False Suppose 2w - 1 - 8 = 5u, 4u - 4w + 12 = 0. Let x be (81916/(-84))/((-1)/u). Let h = x + 975. Is -1 at least as big as h? False Let r(l) = l3 + 13l*2 + 14l + 28. Let s be r(-12). Let w be -260/16 - s. Let v = w + 13. Which is smaller: 3 or v? v Let r = 13 + -28. Let z = -16.55 - r. Let n = -0.15 + z. Is 0 > n? True Let a(q) = q2 - 4q - 31. Let f be (-7 - (-76)/12) + (-26)/(-3). Let h be a(f). Which is smaller: -3/332 or h? -3/332 Suppose 0 = -122l + 118l + 724. Suppose 719 = -6f - l. Is -452/3 > f? False Suppose 0 = -g + 3t - 9 + 5, 5t = 15. Suppose -3a = gi + 22, 9i - 12i - 16 = -a. Which is greater: a or 1/219? a Let r = 206.6 + -22.6. Let a = r + -186. Which is greater: a or -0.06? -0.06 Suppose 0 = -65g + 60g + 20. Suppose -gm - 8 = 0, z + m - 4m - 5 = 0. Let s be 12/(-2)(-2)/(-124). Which is smaller: z or s? z Let k = 8268 + -8268. Is k at most -47/137? False Let o be (7/(-3))/((-7)/126). Suppose -4n + 2n = -o. Suppose 11h - 56 = n. Is h >= 7? True Suppose -407 = -4t - 207. Let r be t/12 + (-31 - -27). Which is smaller: r or 1? r Suppose 0 = -2v + v + 3. Suppose -4a + 22 - 121 = -vq, 0 = -a + 2q - 21. Let b be (-53 + 54)(-28 + 1 + 0). Do a and b have different values? False Let t = 3022 + -3008.27. Let a = t - 11. Which is smaller: -2/5 or a? -2/5 Let d be 693744/(-49567) - (-15 + 1). Is 0.1 greater than d? True Let g be 251/(-166) + 48/32. Let p = 12 - 34. Let f be (-13)/(143/(-2)) + (-18)/p. Is g at least as big as f? False Let n be 0((-14)/77 - 100/660). Which is bigger: 2/11557 or n? 2/11557 Let n be (-2)/(-11) + 35192/44. Suppose 0u - n = 4u. Let z be 0 + (34/u - 1/(-4)). Is -1 greater than z? False Let f = 4333 - 4332. Is -2/47 >= f? False Suppose 3b = 2t + 42, -t + 4b = -5t - 64. Let h be t(1 - 3)/((-32)/(-8)). Is h at most as big as 11? True Let r = -6870 - -9518. Which is greater: 2647 or r? r Let k be (-36)/(-8)12/27. Suppose 0 = s + kr + 11, 0r + 16 = -4r. Is 4 < s? False Suppose -21p - 1872 = 38p - 7p. Which is smaller: p or -103? -103 Suppose 56i - 13d - 2885 = 61i, 0 = -5i - 5d - 2845. Which is smaller: i or -1? i Let w be 108/(-72)8/(-30). Is w at least as big as -13545? True Let l(n) = 9n - 3n*2 + 15n + 18n - 24n*3 - 41n. Let x be l(-1). Is x at most 22? True Suppose -3p - 918 = -93. Suppose 9u + 317 = -2158. Is p less than or equal to u? True Suppose -14g + 2g = -5136. Suppose 96 = 436h - gh. Let j = 5623/532 + 24/133. Which is smaller: h or j? j Suppose 48839 = -7c + 175903. Is 18151 less than c? True Let p = -932/97 + 2523118/262579. Which is bigger: 1 or p? 1 Suppose 4d - 3c = -455, 1221 = -4d + 2c + 775. Let i = 48 - 153. Which is smaller: d or i? d Suppose 3w + k = -4k + 32, 4k = -2w + 24. Suppose -3y = wx - 34, x = 3y - x - 28. Let v = -18 + 27. Which is bigger: v or y? y Let y = -1.0821 + 1.0821. Are y and 80/21 non-equal? True Let w(r) = r*3 - 4r*2 + 2r + 12. Let p be w(5). Let l = -43 + p. Let b be ((-8)/(-3))/(l/(-36)). Do b and -25 have the same value? False Let u = 0.61 - 58.31. Let n = u + 5.7. Let d = -2 + n. Which is smaller: 1 or d? d Suppose 2q + 10 = 2c, 0 = -3q - 6. Let z(u) = -cu + 5u - u - 2u. Let w be z(0). Is w at most as big as 5/4? True Let s(a) = 4a. Let n be s(-1). Let m(f) = -f3 + 24f*2 + 26f + 22. Let t be m(25). Suppose 42p - tp = 45. Which is bigger: n or p? n Let i = 266 - -5. Let a be 10/(-3) - ((4 - -4) + 66300/(-234)). Which is bigger: i or a? a Let a = -20.393 + 20.5. Let p = a - 0.007. Is p bigger than 325? False Suppose -8j - 18j - 32616 = -34*j. Is j at least 4078? False Let j = 2.1 - 0.1. Let n = 1.97 -	{ "pile_set_name": "DM Mathematics" }
mallest value? (a) -4 (b) 3 (c) -0.2 (d) -55 c What is the biggest value in 2/379, 3, -2/11, 19? 19 Which is the second biggest value? (a) -0.9 (b) 0.06 (c) -5 a What is the biggest value in 5, 3/29, 0.12? 5 What is the third smallest value in 2/17, -41, -1/4, 3/5? 2/17 Which is the second smallest value? (a) 0 (b) 11 (c) 0.07 c Which is the second smallest value? (a) -26 (b) -2 (c) 9 (d) 2 b Which is the third biggest value? (a) -0.5 (b) -285/2 (c) 4/7 (d) 1 a What is the biggest value in 28/11, -2/45, 2? 28/11 Which is the second smallest value? (a) -0.014 (b) -0.5 (c) 1 a Which is the second smallest value? (a) 37/6 (b) -4 (c) -2/3 c What is the smallest value in 7, -2/7, 4/7, 0.1? -2/7 What is the second biggest value in 2, 5, 2/319, 1? 2 What is the smallest value in -4, 105, 5, -0.3? -4 What is the third biggest value in -1/3, 0.023, -2/11? -1/3 What is the second biggest value in -58, 5, -5/4? -5/4 Which is the biggest value? (a) -6/13 (b) -6 (c) -2 (d) 1/3 d What is the third smallest value in -3, 0.5, -70? 0.5 Which is the smallest value? (a) -2/5 (b) -1/3 (c) 2/17 a What is the smallest value in -15/31, -4, -9/2? -9/2 Which is the biggest value? (a) -0.5 (b) -5 (c) -12/35 (d) 1 d Which is the third biggest value? (a) 5 (b) -0.009 (c) -1/7 c What is the fourth biggest value in 0.2, -9, 5, -0.5? -9 Which is the fourth smallest value? (a) 2/7 (b) -6 (c) -4 (d) 0 (e) 4 a What is the third biggest value in 0.19, -4, 2/3? -4 Which is the smallest value? (a) -3 (b) 56 (c) -0.03 a What is the third biggest value in -3, 4/5, 48? -3 Which is the third biggest value? (a) -1 (b) 0.2 (c) -5 (d) 2/25 a Which is the second biggest value? (a) -7 (b) -2/13 (c) 4 (d) 1/4 d What is the second smallest value in -1/26, 0.8, 1/11, -2/7? -1/26 What is the smallest value in -0.1, -4, 79, 5? -4 What is the third smallest value in 2, 19, 1, -0.1? 2 Which is the second biggest value? (a) -1 (b) 5 (c) 2/9 (d) 1/7 (e) -4 c Which is the smallest value? (a) 38 (b) -4 (c) -2 b What is the second biggest value in 0, -4, 1278, 2? 2 What is the second smallest value in 2, 0.2, 0, -258? 0 Which is the biggest value? (a) 5 (b) -2 (c) 54 (d) -1 c What is the fourth smallest value in 4, -3/8, 0, -4? 4 Which is the second biggest value? (a) 2/5 (b) -0.4 (c) -3/4 b Which is the third biggest value? (a) -13 (b) 186/11 (c) -3 a What is the biggest value in -5, 15, 3? 15 Which is the fourth biggest value? (a) 4 (b) 5 (c) -1/12 (d) -0.1 d What is the fourth smallest value in -0.1, -1.1, 0.3, 5? 5 What is the smallest value in 7, 7/6, -9, -1/2? -9 What is the second smallest value in -273, 0.5, 0? 0 Which is the third biggest value? (a) -5 (b) 369 (c) 0.8 (d) 1 (e) -1 c Which is the third biggest value? (a) 2 (b) -0.1 (c) -2 (d) -2/3 d Which is the biggest value? (a) -0.5 (b) 0.91 (c) 6 c What is the biggest value in -4, 1/7, 1/6? 1/6 Which is the third smallest value? (a) -35 (b) -1 (c) -7/4 (d) -0.2 b Which is the second biggest value? (a) -0.3 (b) 1/12 (c) -2 a Which is the fourth smallest value? (a) 1/5 (b) 1 (c) -1 (d) 11 d Which is the third smallest value? (a) -2/3 (b) 3 (c) 0.026 (d) -1/10 (e) 0 e Which is the smallest value? (a) -2/9 (b) -22 (c) 2.55 b What is the third smallest value in -2, -12.09, 2? 2 What is the fourth biggest value in 246, -5/2, 0.5, 0.3? -5/2 What is the smallest value in 1/40, 1/4, -2, 0.2, 2/19? -2 What is the third smallest value in 2/321, -0.2, 1/3? 1/3 Which is the second smallest value? (a) 0.1 (b) -1.405 (c) 0.3 a What is the second smallest value in 0.079, 3, 0.1? 0.1 Which is the third biggest value? (a) -1/2 (b) -2/63 (c) -0.06 a What is the fourth biggest value in -3, -0.4, 4, 0? -3 Which is the fourth smallest value? (a) -3/8 (b) 0 (c) -3 (d) -0.07 b What is the fifth smallest value in 4, -4, 0.3, -4/3, -3? 4 What is the smallest value in 1, -73, -2/9? -73 What is the biggest value in -1, -2/3, -17, 4? 4 Which is the second biggest value? (a) 1/2 (b) -0.7 (c) 0 (d) -1 c Which is the fifth smallest value? (a) -0.1 (b) 9 (c) 2 (d) 1 (e) -60 b What is the third biggest value in 2/9, -6, -1, -2? -2 What is the fourth biggest value in 0.3, 2, -4, -14? -14 Which is the second biggest value? (a) 6 (b) -3/8 (c) 3 (d) -4 (e) 1/3 c What is the second smallest value in 5, 0.01, 4, -4? 0.01 Which is the smallest value? (a) 6/11 (b) -190 (c) -1/6 b Which is the smallest value? (a) 2/3 (b) -0.1 (c) 0.49 b Which is the third smallest value? (a) 1.2 (b) 2 (c) -1 (d) 3 b Which is the third biggest value? (a) 113 (b) -2/5 (c) -0.1 (d) 2.2 c What is the second smallest value in -2/5, 2546, 2? 2 Which is the second smallest value? (a) 17 (b) 0.21 (c) 3 c What is the third smallest value in 2, 12, 5? 12 What is the second biggest value in 4, 24, 2, -3/7? 4 Which is the third biggest value? (a) 0 (b) -1411 (c) 1 b Which is the biggest value? (a) -7 (b) -0.2 (c) 2/81 (d) 0 c Which is the third smallest value? (a) -0.5 (b) -30 (c) -1.1 (d) 4/9 (e) -3 c What is the smallest value in 2, -1, -0.1? -1 What is the fourth biggest value in 7, -0.2, -3, -459? -459 What is the biggest value in 5, -1/2, -0.03, -4? 5 Which is the smallest value? (a) 141 (b) 1 (c) -1/4 c Which is the second biggest value? (a) 0.4 (b) -0.4 (c) 1 (d) -16 (e) 7 c Which is the second biggest value? (a) 0 (b) 2/7 (c) 7/2 (d) -16.4 (e) -0.4 b What is the fourth biggest value in 0.3, 0.097, -3/8, -0.1? -3/8 Which is the third biggest value? (a) -5 (b) -1/12 (c) -1/3 (d) 1/11 c What is the fourth biggest value in -1/3, 0, 1, 584? -1/3 What is the smallest value in 7/11, 2, -1/5, 3/2? -1/5 Which is the smallest value? (a) 3/4 (b) 362 (c) -5 c Which is the biggest value? (a) 5 (b) -0.1 (c) -0.11 (d) 1/3 a Which is the fourth biggest value? (a) 1/6 (b) 1 (c) 2/11 (d) -21 d Which is the fifth biggest value? (a) -1/3 (b) 4 (c) 1/5 (d) -0.1 (e) -5 e What is the third smallest value in 3, -0.1, 23? 23 What is the smallest value in 5, 1, 3, 1/4? 1/4 Which is the third smallest value? (a) 0 (b) -2/7 (c) 3 (d) 1 d What is the second smallest value in 2/3, -72, 0.3, -5? -5 Which is the third biggest value? (a) -0.1 (b) -9 (c) -2/7 b Which is the smallest value? (a) -1 (b) 0.003 (c) -0.3 a What is the smallest value in -5, 1/6, -4, 1/4, 2/15? -5 Which is the third smallest value? (a) 2/11 (b) -2 (c) -4 (d) -0.08 d What is the second biggest value in 0.3, -0.031, 1/5? 1/5 Which is the fourth biggest value? (a) 5 (b) -2/13 (c) 1/9 (d) -2 d What is the second biggest value in 5, -0.01, 0.35? 0.35 What is the fourth smallest value in 4, 1/7, -4/27, -4/5? 4 Which is the smallest value? (a) -1 (b) -5 (c) 0.1 (d) 3.1 b What is the third smallest value in 6, -7, 8? 8 Which is the second biggest value? (a) -0.109 (b) -4 (c) -2/5 c Which is the biggest value? (a) 22 (b) 1 (c) 5 a Which is the third biggest value? (a) 26 (b) 0.4 (c) -0.2 (d) 0.5 (e) 4 d What is the fourth smallest value in 3, 6, -10, -0.01, -3? 3 Which is the second smallest value? (a) -31 (b) -0.4 (c) 1/4 (d) 3 b What is the third biggest value in 1/3, -6, -0.05, -5, 7? -0.05 Which is the second biggest value? (a) 0.5 (b) 2/3 (c) -2/7 (d) -109 (e) 1/61 a Which is the biggest value? (a) 1 (b) -0.1 (c) 452 (d) 0.4 (e) 0 c What is the second smallest value in 1/3, 1/11, -4, 12? 1/11 Which is the second smallest value? (a) 0.19 (b) 4 (c) -4 (d) -1/5 d Which is the biggest value? (a) -5 (b) -0.7 (c) -3 (d) 0 d Which is the biggest value? (a) -5 (b) 1/34 (c) 0 b Which is the biggest value? (a) 1/2 (b) -22 (c) -3 a Which is the biggest value? (a) -19 (b) 4 (c) -2 b What is the smallest value in -2, -5, -1.2, 4? -5 Which is the third smallest value? (a) -22 (b) -4 (c) -46.9 b What is the smallest value in 2, -4, 27/8, 1/2, 0? -4 Which is the second biggest value? (a) -1137 (b) -3/4 (c) -11 c What is the second smallest value in 2, -0.038, 0.3, 1? 0.3 What is the third smallest value in -6, -5/9, 5, 2, 0.5? 0.5 What is the second smallest value in -0.043, -1/3, -0.2? -0.2 Which is the smallest va	{ "pile_set_name": "DM Mathematics" }
he value of 4/((-36)/(-45)) - 10? -5 What is 55/275 + 99/105? 8/7 -5 + (-3 - -8) - 2 -2 (-5364)/1043 - (-7 - -21) -1/7 Calculate (-5 - -2)-1 + 25/(-5). -2 Evaluate -38/(-6)40/(-720). -2/9 What is the value of (-2)/(-6) - (1 - 114/198)? -1/11 What is the value of (-15)/(-45)1-1? -1/3 What is the value of 5/(-70)-6(-8)/(-12)? 2/7 -8(-10 - (-324)/32) -1 Evaluate (-3 + 12/4)/(4 - 3). 0 What is 4/16(-480)/12? -10 Calculate (14/(-14))/((-1)/(-5)). -5 72/4816/36 2/3 Evaluate (88/66)/(((-4)/(-3))/2). 2 What is 10512/200 - (-2 + 8)? 3/10 0 + (-46)/6 + 7 -2/3 What is ((-9)/(189/(-28)))/(14/3)? 2/7 Calculate 0 - (-17)/34 - (-14)/4. 4 What is the value of (-1 - (-12)/15)/((-783)/435)? 1/9 (-36)/276/4-1 2 2 + (-114)/(-21) + -3 + -4 3/7 What is 4/(-38) - 64/114? -2/3 What is 4 + -2 + -5 + 26/10? -2/5 (2 - (-151)/(-52)) + 2/13 -3/4 10/(-45) - 16/9 -2 What is the value of (77/(-22))/((-3)/(-6))? -7 Evaluate (-4)/36/20. -2/5 What is the value of 5 + (365/75)/(-1)? 2/15 What is the value of (((-3)/(-2))/1)/(15/15)? 3/2 What is the value of -4 + 232/60 + 0? -2/15 (21 - 15) + -144/8 -1 What is the value of (6/10 - 3/(-45))-1? -2/3 What is 8 + -8 + 3 - 1/(-1)? 4 160/(-275) + (-4 - (-138)/33) -2/5 What is 1/36(-47 - -43)? -1/9 What is the value of 189/(-81)12/4? -7 (496/168 - 3)/(1/(-12)) 4/7 Calculate (27/(-6))/(-9)2. 1 Calculate 225/1802/(-35)-2. 1/7 Calculate (-3)/(-10 + 5 + -16). 1/7 What is the value of (-3)/((-6)/(-4)) + 4? 2 (3 + -4)/(20/(-12) + 2) -3 What is the value of -7 - (-20 + 5) - 6? 2 5 - (3 - (-1)/22) 1 Evaluate (-504)/(-420) + (-1)/(10/32). -2 (252/(-108))/(1/3) -7 What is the value of (13 + 12)/((-30)/(-4))? 10/3 Calculate 11 + -12 + (-10)/(-14). -2/7 What is 9/(-3) + ((-448)/(-21))/8? -1/3 231/242 - (-18)/33 3/2 Calculate (0 - (-6)/(-4))/(14/(-28)). 3 Calculate (60/48)/((-3)/(-12)). 5 What is 6(-1 + 4 - (-51)/(-18))? 1 Evaluate (110/(-5))/2. -1 What is -10 - 2244/(-221) - 4/195? 2/15 ((-54)/(-12) + -4)-10 -5 (-3)/18 - (-208)/(-480) -3/5 Calculate 1/(-3)(-5 + 6). -1/3 What is the value of (1 + (-4)/5)20/(-6)? -2/3 Evaluate ((-2)/3)/(4/(6 - -18)). -4 What is the value of (4/18)/((-5)/1620-9)? 8 Evaluate (-4)/1 + 18 + -15. -1 Evaluate (4/6)/(120/108). 3/5 ((-35)/(-10) + -3)/((-42)/(-8)) 2/21 What is the value of 10/36 + 24/108? 1/2 What is (10/(-175))/((-1)/(-5))? -2/7 Calculate (-1)/((-2)/6-9). -1/3 Calculate -4 + (-96)/(-10) + 12/30. 6 Calculate 5(-15)/((-1350)/24). 4/3 Calculate 962/156 + 2 + (-26)/12. 6 Calculate (-202)/909 + 104/(-18). -6 What is the value of (2/1 - 3)3? -3 What is ((-14)/(-5))/(315/900)? 8 What is (-14)/(-10) + -1 + 85/(-25)? -3 What is the value of 234/162 - 2/(-9)? 5/3 30/9(-48)/64 -5/2 What is (-2)/79/(-6)? 3/7 What is the value of (35/10 - 3)/(25/10)? 1/5 What is the value of -2 + 44/24 + 92/120? 3/5 Evaluate (8/36)/((-8)/6 + 2). 1/3 What is -7 + 4 + -216/(-10)? 1/5 (1755/(-130))/((-1)/(-4)-6) 9 -21/10 + 0 -1/5 What is (-3)/4 - (-9)/12? 0 What is the value of (9 - (-4 + 7)) + -6? 0 Calculate 3(377/39 + -10). -1 (1/(-5))/((-5)/125) 5 -6 + (486/8)/9 3/4 Evaluate (-6)/15 - (21/5 + -5). 2/5 What is 3 - ((-1)/(-2))/(63/462)? -2/3 What is the value of 0 + -2 - (-58 + 55)? 1 What is (-22 - -19)/((-9)/(-16)) + 3? -7/3 What is the value of (-2)/1 + 65/20? 5/4 Calculate (20/(-4) + 8)/(-2). -3/2 Evaluate -7(-1)/(8/(-8)). -7 Evaluate 26/52 + 7/2. 4 Evaluate (1 - 18/15)/((-49)/980). 4 What is the value of (5 - 0)(-4)/(-70)? 2/7 What is 4 + 346/(-84) + (-2)/(-7)? 1/6 What is the value of ((-92)/299)/((-10)/13)? 2/5 What is the value of (-1)/((-26)/3)12/9? 2/13 What is the value of ((-168)/63 + 2)(-42)/4? 7 Calculate (-8)/88 - (-696)/(-88). -8 What is -6 + 192/(-28) - -14? 8/7 Calculate (-5 - (-15)/5) + (-3 - -2). -3 Calculate (-1)/7(-130)/(-195). -2/21 What is 7 + -7 - 5/1? -5 Evaluate 2(8 + (-206)/26). 2/13 Calculate (-80)/100 - 0/1. -4/5 What is the value of -3 - (-6)/(-18)(-45)/5? 0 Calculate 0 + 0 - (35/(-11) + 3). 2/11 Evaluate 0 + 0 + 6/4. 3/2 Evaluate 0/(-6)(3 + -6 - -2). 0 Evaluate 2 - 27/242. -1/4 Calculate (-1)/(21)(37 - 37). 0 What is -1 - 29/((-232)/80)? 9 Evaluate 0(3/9)/(1/(-3)). 0 Evaluate 0 + (3 - 2/(-6) - 3). 1/3 Calculate (-3)/1 - (2 - (-9)/(-9)). -4 What is the value of (-19 - -23)(-1)/(-8)-6? -3 7/(((-1)/4-8)/(-2)) -7 What is the value of 8/(-60) - (-396)/945? 2/7 Calculate ((-850)/(-35))/(-17) + 4/7. -6/7 313/(-12) + 3 -1/4 Evaluate 1/39/(-21). -1/7 Calculate 3 + -13 - 1024/(-104). -2/13 Calculate (-28)/631/(-2). 2/9 What is the value of (1/15)/(4/(-12))? -1/5 Evaluate -2(-5)/(5 + -1 + 2). 5/3 What is the value of (-48)/(-12) - 0(-1)/(-3)? 4 What is 234/24? 1 (-72)/154 - 16/(-88) -2/7 Calculate ((-4)/(-3))/(-2(-2)/(-12)). -4 What is the value of ((-9)/304)/((-2)/5)? 3 What is the value of (126/112)/((-24)/16)? -3/4 What is 0((-55)/15)/11? 0 What is -2(-2 + 64/36)? 4/9 Calculate 23/(-115) + (-5)/((-50)/52). 5 Calculate 3(-20)/150(-10)/(-12). -1/3 Calculate (-13)/4 - (-4 - -3)3. -1/4 Calculate 7/(-4) - (-407)/148. 1 What is 0 + 28/4 + -12? -5 Calculate ((-2)/(-8))/((-23)/(-644)). 7 (3 - 1)/((-17)/3 - -3) -3/4 What is ((-38)/(-40) - 2/10)/(-6)? -1/8 Calculate (10 - 3)3/(-15)5. -7 Evaluate (2 + (-12)/5)50/(-10). 2 1079/(-332) - 12/(-8) -3 What is (56/7 - 9) + (-3 - 2)? -6 Evaluate (0/(-2))/(15/906). 0 What is -6((-2)/12 + 7/(-21))? 3 What is 413/(-546) - (-128)/21? 6 Evaluate 20/8 - (-84)/(-48). 3/4 Calculate 28 + -31 + (5 - -1). 3 What is the value of 32/(-80)(-1 - -6)? -2 Evaluate (-62)/527 - (-38)/34. 1 Calculate (1610/40)/((-2)/1). -2 -1(-10)/(-12) - 33/(-18) 1 ((-6)/33)/(96/(-264)) 1/2 What is (0 - (-12)/(-40)) + 2/4? 1/5 Calculate 10/(-75) - (-2)/15. 0 What is (-2)/(-17) - (-264)/935? 2/5 10/(-40)(-17 - 3) 5 What is (0 - -1)((-100)/70 + 1)? -3/7 ((-40)/(-50))/((-1)/(-5)) 4 What is the value of (12/21)/(16/(-14) + 2)? 2/3 (10 - 11) + (-10)/(-4) 3/2 Evaluate (-98)/(-42) - 78/45. 3/5 What is the value of -12 - (-1 + -9) - (0 + -4)? 2 Calculate 2/7 + 99/21. 5 What is (3/12)/((-56)/672)? -3 What is (-21)/7 - -1(1 - 0)? -2 What is (14/8 - 3)/((-3)/(-12))? -5 What is (-4)/(-6)(17/68 - 0)? 1/6 Evaluate (-1)/3 - 9/9. -4/3 Evaluate (2/24)/(4/61). 1/8 What is the value of 13/52((-36)/(-15))/(-1)? -3/5 (-10)/4(-4)/(-85) -2/17 Calculate (-16)/(7 - -1) + -2. -4 What is the value of 4/66/16? 1/4 What is (-4 - (-63)/15)20/6? 2/3 (5 + -1 - -4) + (-138)/18 1/3 0 + -2 + 1/(6/18) 1 22/(-24) - (114/8)/19 -5/3 Evaluate ((-6)/4)/(33/4). -2/11 Evaluate 4 + (24 - -6)/(-5) + -1. -3 Evaluate (3/(-15))/((-12)/(-75))-4. 5 Evaluate 86/(-301) + (-30)/(-7). 4 Calculate (-6 + 38/6)-21. -7 What is (-2)/5 + (-64)/(-210)? -2/21 What is the value of -2 - ((-18)/4)/(38/16)? -2/19 Evaluate 4 + (4 - (-1 - -5)). 4 Calculate 20/360-9 - 11/(-14). 2/7 Evaluate (3/7)/(12/(-84)). -3 What is 44/(-22)(-2)/58? 2/29 What is 720/(-168) - (1 - 5)? -2/7 What is the value of 33/(-21) + 1 + 0? -4/7 Evaluate 44/(-33) - (-3 - -3). -4/3 What is 1 - (-108)/(-110) - 4/20? -2/11 What is 2 - (-1 - 3)/(-2)? 0 Evaluate (-7)/((-49)/(-2)) + 0. -2/7 24/(-14) + (4 - 2) 2/7 Calculate (-3)/12 - ((-100)/16 + 2). 4 What is 5((-198)/225)/11? -2/5 Calculate 5 + -8 - (4 - (-434)/(-63)). -1/9 Evaluate (-2)/1 + 10 + 210/(-20). -5/2 What is the value of ((-16)/(-36))/(4/18)? 2 -1 + 5(-7)/(-175) -4/5 What is the value of ((-4)/(-16))/((-16)/32)? -1/2 Evaluate (8 - 220/35)/(0 - -3). 4/7 Evaluate (-10)/43/(-9)2. 5/3 6/(2/(-1)) + 91/35 -2/5 What is the value of (-18)/(-45) - (-418)/(-95)? -4 Evaluate ((-2)/(-6))/(1 - (-30)/(-27)). -3 What is (9/(-18))/(6/4)? -1/3 What is (-8)/(-10)5/2? 2 Calculate 3/12 + (-2)/8. 0 What is (-4)/16(20 + -32)? 3 (-9)/6 - (2 + (-28)/8) 0 Evaluate (-7)/4 + (10 + 2)/6. 1/4 Evaluate 5 + 2(2 + -7). -5 Evaluate ((-1)/(-3))/(2 - 5/2). -2/3 Calculate (-1 + 15/18)/1. -1/6 Evaluate 2/(6/27)4/(-12). -3 Evaluate 1-2 - (-4320)/2080. 1/13 Evaluate (3 - 13/3)/(0 - -14). -2/21 Calculate 1 + 04/24. 1 What is the value of (-12)/(-78) + 280/(-637)? -2/7 225/(-125) + (-1)/5 -2 What is the value of (10/26)/(235/94)? 2/13 44/308 + (-58)/14 -4 What is 1/((-22)/10 - -2) + 2? -3 What is (-3 - -7)(-3 - 2/(-1))? -4 What is the value of 1/(-2) + -2(-3)/(-4)? -2 What is the value of 34/	{ "pile_set_name": "DM Mathematics" }
-3l2 + 295297l - 3 What is the h'th term of 780, 1291, 1816, 2355, 2908? 7h2 + 490h + 283 What is the a'th term of 40435, 80824, 121121, 161284, 201271, 241040? -7a3 - 4a*2 + 40450a - 4 What is the d'th term of 65441, 523413, 1766481, 4187195, 8178105? 65425d3 - 2d*2 + 3d + 15 What is the j'th term of 7721, 7591, 7477, 7379, 7297, 7231? 8j2 - 154j + 7867 What is the v'th term of -355426, -710585, -1065744, -1420903, -1776062? -355159v - 267 What is the k'th term of 68391, 77272, 86153, 95034, 103915? 8881k + 59510 What is the z'th term of 52239660, 104479318, 156718976? 52239658z + 2 What is the n'th term of -95708, -95188, -94682, -94196, -93736, -93308, -92918, -92572? -n3 - n2 + 530n - 96236 What is the l'th term of -191982, -382813, -573644, -764475, -955306, -1146137? -190831l - 1151 What is the j'th term of 95290684, 190581366, 285872048, 381162730? 95290682j + 2 What is the t'th term of -1173013, -9384049, -31671147, -75072337, -146625649, -253369113? -1173005t3 - t2 + 2t - 9 What is the o'th term of -15103, -58463, -130723, -231877, -361919? o*3 - 14456o*2 + o - 649 What is the y'th term of 284410, 288597, 292784, 296971, 301158, 305345? 4187y + 280223 What is the x'th term of -94489, -188895, -283215, -377449, -471597, -565659? 43x2 - 94535x + 3 What is the u'th term of 516484, 1032966, 1549446, 2065924, 2582400? -u*2 + 516485u What is the x'th term of 1454761, 1454764, 1454767, 1454770? 3x + 1454758 What is the l'th term of 73789, 147547, 221271, 294961, 368617, 442239? -17l*2 + 73809l - 3 What is the i'th term of 66924, 66908, 66882, 66840, 66776, 66684, 66558? -i3 + i2 - 12i + 66936 What is the c'th term of 84775550, 84775555, 84775562, 84775571, 84775582, 84775595? c2 + 2c + 84775547 What is the u'th term of 222462, 450586, 678710? 228124u - 5662 What is the l'th term of -222, 7, 1112, 3525, 7678, 14003, 22932, 34897? 72l*3 + 6l*2 - 293l - 7 What is the q'th term of 679433, 679439, 679445, 679451? 6q + 679427 What is the f'th term of -89682, -179319, -268914, -358467? 21f*2 - 89700f - 3 What is the y'th term of -8368, -16541, -24554, -32407, -40100? 80y2 - 8413y - 35 What is the o'th term of 14603, 23397, 32203, 41027, 49875, 58753? o*3 + 8787o + 5815 What is the n'th term of -69199, -138283, -207245, -276025, -344563, -412799, -480673, -548125? 10n3 + n2 - 69157n - 53 What is the t'th term of 705, 1733, 3417, 5757, 8753, 12405, 16713? 328t2 + 44t + 333 What is the h'th term of -1383, -5452, -12295, -21912? -1387h2 + 92h - 88 What is the q'th term of -4192, -3358, -2524? 834q - 5026 What is the q'th term of 34375944, 68751884, 103127824, 137503764, 171879704? 34375940q + 4 What is the i'th term of 118897, 118858, 118795, 118708, 118597, 118462, 118303? -12i2 - 3i + 118912 What is the a'th term of 89616, 358448, 806484, 1433712, 2240120, 3225696? -2a3 + 89614a*2 + 4a What is the z'th term of -3524, -3550, -3576, -3590, -3580? 2z3 - 12z*2 - 4z - 3510 What is the s'th term of 11362, 22970, 34564, 46138, 57686, 69202? -s3 - s2 + 11618s - 254 What is the t'th term of 357709946, 357709943, 357709938, 357709931, 357709922, 357709911? -t2 + 357709947 What is the z'th term of 8948428, 17896858, 26845288, 35793718, 44742148? 8948430z - 2 What is the h'th term of -26131774, -52263541, -78395298, -104527045, -130658782? 5h2 - 26131782h + 3 What is the r'th term of -233735730, -233735727, -233735724, -233735721, -233735718? 3r - 233735733 What is the s'th term of 14123, 113233, 382423, 906791, 1771435, 3061453, 4861943, 7258003? 14183s*3 - 58s*2 + 3s - 5 What is the s'th term of 13473, 55300, 125017, 222630, 348145, 501568? s*3 + 13939s*2 + 3s - 470 What is the q'th term of 100, 613, 1972, 4597, 8908? 70q3 + 3q*2 + 14q + 13 What is the h'th term of 418588, 1674360, 3767312, 6697444? 418590h2 + 2h - 4 What is the r'th term of 5132811, 5132804, 5132785, 5132748, 5132687, 5132596, 5132469? -r*3 + 5132812 What is the m'th term of 10750101, 10750099, 10750101, 10750107, 10750117, 10750131, 10750149? 2m*2 - 8m + 10750107 What is the m'th term of -5373362, -10746721, -16120082, -21493445, -26866810, -32240177? -m*2 - 5373356m - 5 What is the o'th term of 1188, 7262, 17394, 31590, 49856, 72198, 98622, 129134? o*3 + 2023o*2 - 2o - 834 What is the c'th term of 339860, 1359464, 3058818, 5437928, 8496800? c*3 + 339869c*2 - 10c What is the t'th term of -27516, -27692, -27986, -28398? -59t2 + t - 27458 What is the v'th term of 104, 272, 440, 560, 584, 464, 152, -400? -8v*3 + 48v*2 + 80v - 16 What is the z'th term of 9702, 19437, 29172, 38907, 48642? 9735z - 33 What is the f'th term of 249006, 248200, 247394, 246588, 245782? -806f + 249812 What is the w'th term of 1633200, 3266354, 4899508, 6532662? 1633154w + 46 What is the d'th term of 176573892, 176573887, 176573880, 176573871, 176573860? -d2 - 2d + 176573895 What is the c'th term of -209464, -209390, -209328, -209284, -209264, -209274, -209320? -c*3 + 81c - 209544 What is the c'th term of 7553, 33617, 77057, 137873, 216065, 311633? 8688c2 - 1135 What is the p'th term of 5778006, 5778003, 5778000? -3p + 5778009 What is the u'th term of 4356, 4490, 4642, 4824, 5048? 2u3 - 3u*2 + 129u + 4228 What is the s'th term of 60887, 60840, 60793? -47s + 60934 What is the j'th term of 3868, 7839, 11830, 15853, 19920, 24043, 28234, 32505? 2j*3 - 2j*2 + 3963j - 95 What is the b'th term of 53869, 215511, 484915, 862081, 1347009? 53881b2 - b - 11 What is the l'th term of -10045, -40095, -90149, -160207, -250269, -360335? -10002l*2 - 44l + 1 What is the m'th term of 5344234, 10688464, 16032694, 21376924, 26721154, 32065384? 5344230m + 4 What is the u'th term of -8487, -33576, -75391, -133932, -209199, -301192, -409911? -8363u*2 - 124 What is the s'th term of -1654134, -1654131, -1654128, -1654125, -1654122, -1654119? 3s - 1654137 What is the h'th term of 25759524, 25759526, 25759534, 25759554, 25759592, 25759654, 25759746, 25759874? h*3 - 3h*2 + 4h + 25759522 What is the d'th term of 54315, 53946, 53577, 53208, 52839, 52470? -369d + 54684 What is the r'th term of 562214, 562221, 562220, 562205, 562170, 562109, 562016? -r3 + 2r*2 + 8r + 562205 What is the c'th term of 38285, 153088, 344411, 612254, 956617, 1377500? 38260c2 + 23c + 2 What is the c'th term of -213297, -427164, -642161, -858852, -1077801? -94c3 - c2 - 213206c + 4 What is the b'th term of 24342, 97017, 218024, 387363, 605034, 871037, 1185372? 24166b2 + 177b - 1 What is the n'th term of -124, -153, -156, -133, -84? 13n2 - 68n - 69 What is the d'th term of 187, 3780, 14103, 34702, 69123, 120912, 193615? 591d3 - 181d*2 - d - 222 What is the q'th term of -99092644, -198185280, -297277916, -396370552, -495463188, -594555824? -99092636q - 8 What is the g'th term of -1321386, -1321404, -1321424, -1321446, -1321470, -1321496, -1321524? -g*2 - 15g - 1321370 What is the d'th term of -281535, -1126148, -2533821, -4504542, -7038299? 2d3 - 281542d*2 - d + 6 What is the f'th term of -80083, -160143, -240153, -320089, -399927? 4f3 + f2 - 80091f + 3 What is the n'th term of 72933, 73366, 73795, 74220, 74641, 75058? -2n*2 + 439n + 72496 What is the b'th term of 789, 1233, 2145, 3759, 6309, 10029, 15153? 39b3 + 171b + 579 What is the g'th term of 9516, 37287, 83570, 148365, 231672, 333491? 9256g2 + 3g + 257 What is the c'th term of 28438, 31513, 36638, 43813, 53038, 64313? 1025c2 + 27413 What is the n'th term of -163668, -654720, -1473140, -2618928, -4092084, -5892608, -8020500? -163684n*2 + 16 What is the z'th term of -55756, -446307, -1506382, -3570745, -6974160, -12051391? -55794z*3 + 2z*2 + z + 35 What is the k'th term of 499957, 999919, 1499881, 1999843? 499962k - 5 What is the j'th term of -2511543, -2511548, -2511563, -2511594, -2511647, -2511728, -2511843, -2511998? -j3 + j2 - j - 2511542 What is the k'th term of 56, -162, -448, -838, -1368, -2074? -6k3 + 2k*2 - 182k + 242 What is the g'th term of -491314, -1965256, -4421826, -7861024, -12282850? -491314g*2 What is the w'th term of -328, -940,	{ "pile_set_name": "DM Mathematics" }
8668889 to the power of 1/9, to the nearest integer? 6 What is the square root of 619579 to the nearest integer? 787 What is the sixth root of 9982107 to the nearest integer? 15 What is the cube root of 3048600 to the nearest integer? 145 What is 429004 to the power of 1/2, to the nearest integer? 655 What is the square root of 16816669 to the nearest integer? 4101 What is the cube root of 35999 to the nearest integer? 33 What is 1502015 to the power of 1/2, to the nearest integer? 1226 What is 4332 to the power of 1/6, to the nearest integer? 4 What is the square root of 27613668 to the nearest integer? 5255 What is the cube root of 214292 to the nearest integer? 60 What is 919846 to the power of 1/2, to the nearest integer? 959 What is 200608 to the power of 1/2, to the nearest integer? 448 What is the square root of 126582 to the nearest integer? 356 What is 116791 to the power of 1/8, to the nearest integer? 4 What is the third root of 1075573 to the nearest integer? 102 What is 2115427 to the power of 1/2, to the nearest integer? 1454 What is the cube root of 154627 to the nearest integer? 54 What is the third root of 162587 to the nearest integer? 55 What is the seventh root of 32391468 to the nearest integer? 12 What is 887707 to the power of 1/4, to the nearest integer? 31 What is the cube root of 157300 to the nearest integer? 54 What is the third root of 1814308 to the nearest integer? 122 What is the square root of 3553029 to the nearest integer? 1885 What is the seventh root of 1552712 to the nearest integer? 8 What is 1931264 to the power of 1/8, to the nearest integer? 6 What is the fifth root of 27375 to the nearest integer? 8 What is 2531837 to the power of 1/3, to the nearest integer? 136 What is the cube root of 831034 to the nearest integer? 94 What is 2971235 to the power of 1/9, to the nearest integer? 5 What is 358902 to the power of 1/8, to the nearest integer? 5 What is the sixth root of 3058998 to the nearest integer? 12 What is the fifth root of 109698 to the nearest integer? 10 What is the eighth root of 100121 to the nearest integer? 4 What is 1038135 to the power of 1/2, to the nearest integer? 1019 What is 22948798 to the power of 1/9, to the nearest integer? 7 What is the tenth root of 2465451 to the nearest integer? 4 What is the square root of 9405495 to the nearest integer? 3067 What is 3542082 to the power of 1/6, to the nearest integer? 12 What is 7200331 to the power of 1/3, to the nearest integer? 193 What is the square root of 2835196 to the nearest integer? 1684 What is 254481 to the power of 1/2, to the nearest integer? 504 What is the third root of 27474684 to the nearest integer? 302 What is 61879 to the power of 1/7, to the nearest integer? 5 What is the third root of 2033707 to the nearest integer? 127 What is 2214934 to the power of 1/2, to the nearest integer? 1488 What is 1655069 to the power of 1/8, to the nearest integer? 6 What is 575958 to the power of 1/4, to the nearest integer? 28 What is 2234681 to the power of 1/2, to the nearest integer? 1495 What is the fifth root of 12858792 to the nearest integer? 26 What is 1014287 to the power of 1/10, to the nearest integer? 4 What is the seventh root of 124816 to the nearest integer? 5 What is 320314 to the power of 1/5, to the nearest integer? 13 What is 282355 to the power of 1/6, to the nearest integer? 8 What is 1993335 to the power of 1/2, to the nearest integer? 1412 What is the square root of 1053205 to the nearest integer? 1026 What is the cube root of 574445 to the nearest integer? 83 What is the fifth root of 174536 to the nearest integer? 11 What is 95740 to the power of 1/3, to the nearest integer? 46 What is the seventh root of 22043607 to the nearest integer? 11 What is 87150 to the power of 1/6, to the nearest integer? 7 What is 503775 to the power of 1/2, to the nearest integer? 710 What is the cube root of 2363346 to the nearest integer? 133 What is 860564 to the power of 1/8, to the nearest integer? 6 What is 436283 to the power of 1/4, to the nearest integer? 26 What is the tenth root of 4366885 to the nearest integer? 5 What is the eighth root of 12161727 to the nearest integer? 8 What is 7770 to the power of 1/2, to the nearest integer? 88 What is the tenth root of 85269 to the nearest integer? 3 What is the square root of 230598 to the nearest integer? 480 What is the seventh root of 148357 to the nearest integer? 5 What is 854167 to the power of 1/9, to the nearest integer? 5 What is 53844 to the power of 1/6, to the nearest integer? 6 What is 9445899 to the power of 1/10, to the nearest integer? 5 What is the third root of 3097910 to the nearest integer? 146 What is the fifth root of 32318984 to the nearest integer? 32 What is 2993411 to the power of 1/2, to the nearest integer? 1730 What is 1888723 to the power of 1/2, to the nearest integer? 1374 What is the ninth root of 3351687 to the nearest integer? 5 What is the cube root of 247041 to the nearest integer? 63 What is 281868 to the power of 1/2, to the nearest integer? 531 What is the cube root of 336680 to the nearest integer? 70 What is the third root of 1459402 to the nearest integer? 113 What is the square root of 5793579 to the nearest integer? 2407 What is 744339 to the power of 1/3, to the nearest integer? 91 What is the square root of 11647263 to the nearest integer? 3413 What is 229081 to the power of 1/2, to the nearest integer? 479 What is the eighth root of 266396 to the nearest integer? 5 What is 347126 to the power of 1/2, to the nearest integer? 589 What is 8934817 to the power of 1/2, to the nearest integer? 2989 What is 271122 to the power of 1/10, to the nearest integer? 3 What is 178697 to the power of 1/8, to the nearest integer? 5 What is the sixth root of 459257 to the nearest integer? 9 What is 90898 to the power of 1/2, to the nearest integer? 301 What is the square root of 7781 to the nearest integer? 88 What is the third root of 21931874 to the nearest integer? 280 What is 1299534 to the power of 1/2, to the nearest integer? 1140 What is the square root of 1502289 to the nearest integer? 1226 What is the third root of 12206 to the nearest integer? 23 What is the square root of 1148004 to the nearest integer? 1071 What is 5687407 to the power of 1/5, to the nearest integer? 22 What is the square root of 2343146 to the nearest integer? 1531 What is the square root of 82553 to the nearest integer? 287 What is 803888 to the power of 1/3, to the nearest integer? 93 What is the square root of 1931605 to the nearest integer? 1390 What is the ninth root of 2637084 to the nearest integer? 5 What is the seventh root of 641833 to the nearest integer? 7 What is the third root of 1370461 to the nearest integer? 111 What is the ninth root of 22697680 to the nearest integer? 7 What is the square root of 681224 to the nearest integer? 825 What is 14755552 to the power of 1/2, to the nearest integer? 3841 What is 458293 to the power of 1/5, to the nearest integer? 14 What is the square root of 3341150 to the nearest integer? 1828 What is the cube root of 1381321 to the nearest integer? 111 What is 278079 to the power of 1/3, to the nearest integer? 65 What is the square root of 29722344 to the nearest integer? 5452 What is 4429140 to the power of 1/2, to the nearest integer? 2105 What is 56257 to the power of 1/9, to the nearest integer? 3 What is the sixth root of 4863717 to the nearest integer? 13 What is 4600370 to the power of 1/2, to the nearest integer? 2145 What is 188701 to the power of 1/6, to the nearest integer? 8 What is 26802 to the power of 1/5, to the nearest integer? 8 What is the cube root of 1969966 to the nearest integer? 125 What is 42646 to the power of 1/2, to the nearest integer? 207 What is 4564526 to the power of 1/4, to the nearest integer? 46 What is 23192431 to the power of 1/4, to the nearest integer? 69 What is the seventh root of 16417211 to the nearest integer? 11 What is 62040 to the power of 1/8, to the nearest integer? 4 What is the third root of 39365853 to the nearest integer? 340 What is the square root of 267848 to the nearest integer? 518 What is 2789367 to the power of 1/2, to the nearest integer? 1670 What is 17	{ "pile_set_name": "DM Mathematics" }
nominator of (o/28)/(6/67) and (-4)/(-14) + 354/280. 40 Suppose 20 = -t + 6t, 0 = 2p - 2t - 4. Suppose -65 = -6i + i + 4z, -5z = -25. Let k = 25 - i. Calculate the lowest common multiple of p and k. 24 Suppose 324 = 26u - 248. Let t = -33 + 57. Suppose -2v = v - t. Calculate the lowest common multiple of u and v. 88 What is the least common multiple of 24 and -1024/166/(-5)? 72 Suppose -66b + 4691 + 1645 = 0. What is the smallest common multiple of 9 and b? 288 Let z be (-14)/10(-2)/7-65. Let i = z - -29. Calculate the least common multiple of 30 and i. 30 Let d = -817 - -6519/8. Let o = 3704741/6 - 621957. Let y = -4512 - o. What is the common denominator of d and y? 24 Let x be ((-6)/(-15))/(2/10). Suppose t = -5, -xt - 18 = -5z - 3. Calculate the common denominator of ((-22)/(-40))/(-11) + z and -33/2. 20 Find the common denominator of 21/(-81) - -3 - 11/33 and 74/15. 135 Calculate the common denominator of -37/5 and -2 - ((-1490)/450 + 3). 45 Let u(j) = -j2 + 4j - 2. Let k be u(3). Let f be 5 + (-8)/4 + 1. Calculate the common denominator of -123/10 and (k - f)/((-513)/360). 190 Let h(i) = 5i2 - i. Suppose 0 = -4y + g + 4g + 152, 0 = -3y - 3g + 87. Calculate the least common multiple of (y + 0)32/48 and h(-1). 66 Suppose -4t - 5f - 22 - 22 = 0, 11 = -t - 3f. Calculate the common denominator of -67/2 and (4 - 6)t/6. 6 Let g = -6389 + 95797/15. Find the common denominator of -29/225 and g. 225 Suppose -2b + 2 = -4. Let h = -26 - -21. Let n(y) = y + 12. What is the least common multiple of b and n(h)? 21 Find the common denominator of -111/50 and ((-609)/490)/((-3)/4). 350 Let p be ((-2)/4)/((-5)/(-20260)). Let f = p - -8201/4. Find the common denominator of f and 7/5. 20 Let q = -9 + 14. Suppose 0 = -h + 2d - 1, -d - 4 = -4h + qh. Let m(i) = -i3 - i2 + i - 3. What is the smallest common multiple of m(h) and 6? 12 Suppose 5j = -4x + 3, 3j = 2x + 3x - 13. Let c = 1367 - 1223. Calculate the lowest common multiple of c and x. 144 Suppose 5w + 3g = -g + 326, -4g = 4. What is the lowest common multiple of 90 and w? 990 Suppose 0n - 3n = -714. Let c = n + -1669/7. Let r = 6/145 - 11757/290. Calculate the common denominator of c and r. 14 Let a = -30 + -4. Find the common denominator of -23/3 and a/63/5. 15 Let y(w) = w - 1. Let x(j) = -11j + 3. Let m(z) = -x(z) - 4y(z). Let n be m(3). Let d = n + -10. What is the least common multiple of 20 and d? 60 Find the common denominator of ((-27)/(-300))/(((-70)/(-25))/(-7)) and 93/8. 40 Let g = -1796 + 48523/27. Calculate the common denominator of 121/30 and g. 270 Calculate the smallest common multiple of ((-130)/(-39))/(10/36) and (6/(-18)3)/((-1)/4). 12 Let k = 920709 + -635289031/690. What is the common denominator of k and 27/10? 690 Let s = 11 - 11. Suppose -2m = -5g - 55, 2g = -sm - m + 5. Suppose 0 = -6l + 3l + m. What is the least common multiple of l and 4? 20 Let q(s) = s*3 - 4s*2 - 13s + 9. Let b be q(6). Suppose 0 = p - b - 7. What is the smallest common multiple of (-13 + 1)(-3)/2 and p? 90 Let h be 18/45 - (0 - (-524)/10). What is the common denominator of (34/(-4))/((-91)/h) - -2 and -101/44? 308 Let f(z) = -2z*3 - 4z*2 + 6z + 1. Let p be f(5). Let d = p - -454. Find the common denominator of ((-4)/((-24)/d))/4 and 21/10. 40 Let d(z) = z*3 - 15z*2 + 42z + 18. Let q be d(15). Suppose 0 = -32y + 20y + q. What is the smallest common multiple of y and 9? 54 Let m = -6 - -33. What is the least common multiple of 21 and m? 189 Calculate the common denominator of -5 + ((-28)/42 - (-458)/102) and 112/18 + -12. 153 Suppose 6u = u - 5c + 785, c = 2u - 320. Calculate the smallest common multiple of u and 6. 318 Let s = -76 + 76. Find the common denominator of (-7626)/1312(-4 + s)/(-2) and 2/5 + 194/(-35). 56 What is the smallest common multiple of 429 and (-68)/442 + -2119/(-26)? 1287 Find the common denominator of 17/144 and (7 - (-1729)/(-210)) + 4/10. 144 What is the smallest common multiple of 116 and 130/845 - 48/(-26)? 116 Let q be 848/8 + 1 + 1. What is the common denominator of 4 + 4 + (-644)/q and 7/33? 297 Suppose 5 = -t + 19. Let a(i) = 13i. Let y be a(t). What is the common denominator of (-4 + y/54)-6 and -7/5? 45 Let b(f) = -f - 27. Let q be b(-9). What is the common denominator of -91/6 and (219/q)/((-40)/(-12))? 60 Calculate the common denominator of (-213/4)/((-496)/(-93)) and 49/344. 1376 Let x(o) = 2o2 + 7 - o2 + 6o + 0o*2. Let f be x(-9). Suppose -4k = -2j - 72, 5j - 88 + f = -3k. Calculate the smallest common multiple of k and 10. 90 Let u = -18/853 - -221791/40944. Let m = -29/6 + u. What is the common denominator of -23/10 and m? 80 Let j = 23089/39416 - 7/379. Calculate the common denominator of -7/32 and j. 416 Let y(c) = -c3 + 9c*2 + 5c - 37. Let j(i) = i*2 - i. Calculate the smallest common multiple of j(-3) and y(9). 24 Let h(f) = 13f - 23. Calculate the least common multiple of h(15) and 20. 860 Find the common denominator of -31/32 and ((-8)/(-128)-7)/(18/88). 288 Suppose 0x + 16x = 2912. Calculate the least common multiple of 10 and x. 910 Let s = -365 + 387. What is the lowest common multiple of 77 and s? 154 Suppose -2k - 5a + 7 + 6 = 0, -a = -1. Suppose k = -w + 22. Calculate the lowest common multiple of w and 20. 180 Let r be 8/(-2) - -2 - -12. Suppose -3g - 7f = -3f + r, -f = -4g + 12. Calculate the common denominator of (-26)/(-65)(-3)/g and 87/2. 10 Suppose -980 = 14r - 42r. Calculate the lowest common multiple of 4 and r. 140 Let z = 5411/4 + -1363. What is the common denominator of -31/286 and z? 572 Calculate the common denominator of (7 - 308/(-99))/(4/(-6)) and -39/46. 138 Find the common denominator of ((12/(-124))/(-3))/(36/(-66)) and -89/8. 744 Let z = 326 - 54. What is the smallest common multiple of z/12 - (-2)/(-3) and 24? 264 What is the least common multiple of 32 and (4 - 28)20/(-6)? 160 Let a = -16472/95 - -2200/19. Let s = a + 12281/210. Find the common denominator of 83/6 and s. 42 Let z = 7 - 10. Let x(c) = 7c. Let b be x(z). What is the smallest common multiple of 1 and 20/6 + (-14)/b? 4 Let c be (-7)/3620765/35. Let h = c + 838/9. What is the common denominator of 12/1(-88)/(-640) and h? 20 Find the common denominator of (-145)/(-6) + (0 - 1) and 56/8 - 484/52. 78 Suppose 4u - 67 = -3n, 4n - 68 = -6u + 2u. Let k be 25/((-1)/(-1) - 0). Calculate the lowest common multiple of u and (-20)/k25/(-2). 80 Suppose 3z + 7 = 2k, 3z = -z + 2k - 6. Let q be 8/(-3)6/(-4). Suppose -qm + 1 = -11. What is the smallest common multiple of z and m? 3 Suppose 5w - 14447 - 16808 = 0. Let s be ((-149806)/(-36))/(2/3). Let i = s - w. What is the common denominator of i and 27/2? 12 Suppose -k - 12 = -60. Let y = k - 30. Suppose h = -h + 16. Calculate the smallest common multiple of y and h. 72 Let q = -2 - 0. Calculate the smallest common multiple of -22 + 14 - (-32)/2 and q/(-3) - (-16)/3. 24 Suppose 3j - 2u = 17, 29 = 4j + 2u + 11. Suppose 0 = -4v - 5c + 164, -5c = v - jv + 204. What is the least common multiple of v and 14? 322 Let n be 2 - 73146/13112 - (-2)/8. Let r = 12/149 - n. What is the common denominator of r and -101/14? 154 Let x(u) = u3 + 8u*2 + 8u + 6. Let m be x(-7). Find the common denominator of -63/10 and -2 + -1 + (58/4)/m. 10 Let o = -17 + 20. What is the smallest common multiple of 12 and -1 - (-4 - (o - -8))? 84 Calculate the common denominator of ((-80)/800)/(1/(-11)) and -19/105. 210 Let x be (-13)/65 + (-182)/(-10). Suppose 4h = -2 + x. Calculate the lowest common multiple of h and 33. 132 Suppose 164 + 96 = 5m. Calculate the least common multiple of 6 and m. 156 Let r = 12 - 9. Suppose -ru + 4 = -u. Suppose 12 = p + u. Calculate the lowest common multiple of p and 1. 10 Let d(t) = -t2 - 60t - 597. Calculate the smallest common multiple of d(-15) and 204. 2652 Let v = 1707 + -3339/2. Let b = 530497/32 - 16581. Calculate the common denominator of v and b. 32 Let f = 74/35 + -7/5. Calculate the common denominator of -58/3 and f. 21 Let f be (19 + 2)/(10/(-10)). Let h = 24 + f. Suppose -h*i + 5 = -13. Calculate the least common multiple of 2 and i. 6 Let g be (-1)/(-1) - (-7876 - -2). Let l	{ "pile_set_name": "DM Mathematics" }
t p be (2/1 + -3)/(-1). What is the units digit of (1 + p)5/10? 1 Suppose -t - 22 = -2p + 37, t = -2p + 65. What is the units digit of p? 1 Let s(q) = 11q. What is the units digit of s(2)? 2 Let n = -39 - -160. What is the hundreds digit of n? 1 Let l(q) = -6q + 2. Let g be l(-3). Suppose -3r + 5r - g = 0. What is the tens digit of r? 1 Let g = 4 + -12. Let s = -4 - g. What is the units digit of s? 4 Let k be (-56)/3(-36)/24. Let r = k + -9. What is the units digit of r? 9 Suppose 310 = 2o - 3q, q = 2o - 0q - 302. What is the tens digit of o? 4 Suppose 2z + 3b - b - 42 = 0, -75 = -5z + b. What is the tens digit of z/1 + 2 + -2? 1 Suppose 2r - 71 = -2r + 3b, 2b = -10. What is the tens digit of r? 1 Suppose -4x = -2z - 96, -2x + 4z = -0x - 60. What is the tens digit of x? 2 Suppose 53 = v + 2m, 4v + 4m - 60 - 160 = 0. Suppose -4z + v = z + d, -3z = 2d - 37. What is the tens digit of z? 1 Suppose 5a = -0a + 775. Suppose -s + a = 4s. What is the tens digit of s? 3 Suppose 0 = -3c + 3, 2a = -3c + 17 + 4. Suppose 4 - a = -v. What is the units digit of v? 5 Let k(p) = -105p3 - p2 - p - 1. What is the units digit of k(-1)? 4 Let b(z) = 2z*2 + 2z - 3. Let f be b(5). Suppose i + f = 4i. What is the tens digit of i? 1 Let u(y) = y3 - y2 + y + 11. Let c be u(0). Let t be c - 1/(1 + 0). What is the units digit of ((-6)/(-10))/(2/t)? 3 Suppose 2s + 10 = 0, 2h = 2s + 3s + 29. Let i(x) = -x3 - 2 + 3 - x2 + 5x*h. What is the units digit of i(3)? 0 Let h(d) = -d - 7. Let r be h(-7). Suppose 3l - 8 - 10 = r. What is the units digit of 3(-3)/l-2? 3 Suppose 0 = -5t + 5y, -4t + y = -3 - 0. Let o = 2 - t. Let n = 2 + o. What is the units digit of n? 3 Suppose -4q = -0a + a + 13, 4a - 5q = 53. What is the units digit of a? 7 Let g be (-9)/(-45) + (-38)/(-10). Let p(o) = o3 + o2 + 2o - 3. Let t be p(g). Suppose 6a = a + t. What is the units digit of a? 7 Let v(w) = 44w3 + w2 + w - 1. What is the tens digit of v(1)? 4 Suppose 2m - 15 - 5 = 0. What is the units digit of 4/m + 16/10? 2 What is the units digit of (-2)/(-11) - 2590/(-154)? 7 Suppose -4r = -c - 7r + 80, 3c - 4r - 305 = 0. Suppose o = -4o + c. What is the tens digit of o? 1 Let t(d) = -d*3 - 2d*2 + 2d + 2. Let b be t(-3). Suppose 29 = bg + x, 4g + 1 - 29 = -2x. What is the units digit of g? 5 Let g = 26 + -30. Let t(u) be the second derivative of -2u*3/3 - 2u*2 - u. What is the tens digit of t(g)? 1 Let h(z) = 3z*3 + 11z*3 - 4z*2 - 1 + 3z*2 + 2z*2 + z. What is the tens digit of h(1)? 1 Let z(r) be the second derivative of 0 + 1/2r*3 - 3/4r*4 + 1/20r*5 - 13/2r*2 - 3r. What is the tens digit of z(9)? 1 Let k = 452 - 269. What is the units digit of k? 3 Let o = -73 + 291. What is the hundreds digit of o? 2 Suppose -4t = -57 - 43. What is the tens digit of t? 2 Let b(q) = -4q - 2. Let t(k) = k. Let r be t(-4). What is the tens digit of b(r)? 1 Suppose 0 = -b + 2t + 33, -4b + 152 = b + 3t. Suppose 5i = 3v - 94, -2v - 3i + b = -19. What is the units digit of v? 8 Let x(r) = -4r + 0r - 9r*2 + 21 - 17. Let v(w) = -8w*2 - 3w + 3. Let g(s) = -6v(s) + 5x(s). What is the tens digit of g(2)? 1 Let k = -9 - -95. What is the tens digit of k? 8 Suppose 2 = -5p + 3u, 4p + u - 14 = -p. Suppose 0 = w - 5, 0w = po + w + 11. What is the units digit of 0 + 0 + o/(-1)? 8 Let g = -14 + 10. Let s = g - -8. Let n = s + -1. What is the units digit of n? 3 Suppose -2r = 4h - 36, -3r - h + 9 = -40. What is the units digit of r? 6 Let j = 8 - 3. Suppose 2y = 4y - q - 51, -126 = -jy + 2q. What is the units digit of y? 4 Let x(o) be the first derivative of -o*3/3 - 3o*2/2 + 2o - 2. Let t be x(-4). What is the units digit of 5/3 - t/6? 2 Let s be (6/(-10))/((-3)/45). Let z be s(3 - -1)/2. Suppose -q - 23 = -j, z = 4j - 2j + 5q. What is the units digit of j? 9 Let o(u) be the third derivative of u6/120 + u5/20 - u3/6 - u2. Let f be o(-2). Suppose 4s = -12, -7 = l + l + fs. What is the units digit of l? 1 Let s(p) = 4p - 4. Let n be (4 + -1)(-2)/(-3). Let d be 26/8 - n/8. What is the units digit of s(d)? 8 Suppose -3l = 2o, -o - 4l = l + 7. Suppose -4v + o + 9 = 0. Suppose 0 = -8d + vd + 70. What is the tens digit of d? 1 Let b be 1-3(-56)/6. Let s(o) = -2o2 + 24o - 20. Let d be s(11). Suppose -4v + b = -dv. What is the tens digit of v? 1 Suppose -3j - 70 = -f, 0 = -4f - j + 129 + 99. What is the units digit of f? 8 Let m be -11 - (-8)/2. Suppose -8 = mh - 5h. Suppose -3 = -ht + 1. What is the units digit of t? 1 Suppose -2o = -7o + 3h + 1506, 0 = o - h - 302. What is the tens digit of o? 0 Let l = -4 - -7. Let x = 4 - l. Suppose 5w - 4 = x. What is the units digit of w? 1 Let g = -28 + 38. Let t = 27 - 8. Let n = t - g. What is the units digit of n? 9 Let y(w) be the third derivative of w4/24 - w3/3 - 2w2. Let m be y(4). Suppose -x - 5l = -5 - m, 0 = -4x - 4l + 28. What is the units digit of x? 7 Let g(h) = 25h2 + h. Let l be g(-1). Let u be (4 + -2)-2 + 2. What is the units digit of (3/u)/((-9)/l)? 4 Suppose 2z - 44 = -3v, z + 4z + v - 84 = 0. Let i = -4 + z. What is the units digit of i? 2 What is the units digit of (-164)/312/(-8)? 2 Suppose 2f = 2t + t + 4, -4t - 8 = -4f. Suppose 4s - 8 = -t. What is the units digit of s? 2 Suppose -4t + 55 = t. Let w = t + 25. Suppose -3q - 4l + w = -q, -2q = -l - 21. What is the tens digit of q? 1 Let j(x) = x2 + 7x - 1. Let q be j(-6). Let a = -5 - q. Suppose 2d + 3h = -a, 2h + 4 = -4. What is the units digit of d? 5 Let b = -13 + 19. Suppose 0 = -3x + bx + 9. Let q(p) = -p + 1. What is the units digit of q(x)? 4 Suppose 0 = 6b - 2b - 92. Suppose -4z - 2 = 3c - b, 4z = 5c - 3. What is the units digit of z? 3 Suppose -3n - 1453 = -3k - 322, 1883 = 5k - 3n. What is the units digit of k? 6 Let g be ((-4)/(-3))/(4/(-18)). Let z = g + 17. What is the tens digit of z? 1 Suppose 4u - 6 - 6 = 0. Suppose -ud = -12 - 15. Suppose dj - 10j = -1. What is the units digit of j? 1 Let m = -78 + 126. What is the units digit of m? 8 What is the hundreds digit of 130 - (0 + (3 - 4))? 1 Suppose -2t + 78 = 2p, 3p = 6t - t + 101. Let b = 62 - p. What is the tens digit of b? 2 Let n be 1/1(6 + -5). Let f = 13 + n. What is the tens digit of f? 1 Suppose -9 = -3d, d + 0d - 8 = -q. What is the tens digit of (q - -3)/(-4)-9? 1 Let z(x) be the second derivative of -1/12x*4 - x - 2x*2 + 0 + 4/3x*3. What is the tens digit of z(3)? 1 Let z(a) = 2a + 30. What is the tens digit of z(0)? 3 Let x(o) = o*2 + o + 52. What is the units digit of x(0)? 2 Suppose -3j - 3v + v = -115, v + 72 = 2j. Suppose -3f - 2b = -b - 29, 3f - j = -5b. What is the units digit of f? 9 Suppose -3d + 15 = 3. Let p be 10/d4/5. What is the units digit of (-15)/(-12) + p/(-8)? 1 Let t(x) = 8x3 + 1. Let h be t(-1). Let u = 8 + h. Suppose -4 + u = -w. What is the units digit of w? 3 Suppose 0 = 3p + 2p - 5l - 1630, 2p - 4l - 646 = 0. What is the tens digit of p? 2 Suppose -5r + 3r + 6 = 0. Suppose -ra + 0 = -9. Suppose -al = 3 - 21. What is the units digit of l? 6 Suppose 3o + o = 0, 3b = o + 138. What is the tens digit of b? 4 Suppose -15 = 3v - 6v. Suppose -4n + 16 + 144 = 0. Suppose o = vo - n. What is the units digit of o? 0 Let l(m) = 11m + 3. Let p be l(7). What is the units digit of ((-12)/10)/((-12)/p)? 8 Suppose 4w = -w + 45. Let m(v) = v - 11. Let r be m(w). Let i = r + 7. What is the units digit of i? 5 Let s = 2 + 18. Suppose -5h - 3k + 9 = 24, 4k = 2h - s. Suppose 2q + 5a + 19 = h, 3a + 13 + 14 = 4q. What is the units digit of q? 3 Let v be (7/(-14))/(2/(-28)). Suppose 3l - v = 5. Suppose 2n + 2m + 1 = 7, -ln + 12 = -m. What is the units digit of n? 3 Let t = 13 - 14. What is the units digit of 8 + t - (9 + -7)? 5 Suppose 4p + o + 36 = 5p, 0 = p + 3o - 36. What is the units digit of p? 6 Let c(r) = -3r + 3. Let z be c(2). Let m = z + 8. What is the units digit of m? 5 Let x(y) = -4y + 1. Let z be x(-1). Suppose 0p - 4p = 5v - 41, 2p + zv = 23. Let q = p + 2. What is the units digit of q? 1 Let t(v) = -v - v*3 - 3 + 2 + 0v. Let j be ((-8)/(-16))	{ "pile_set_name": "DM Mathematics" }
(a) -5 (b) i (c) r c Suppose -w + 0 = 5. Let b = 0.2 - 0.3. What is the nearest to 1 in b, w, 1? 1 Let g = 0.7 - -3.3. Let r = 8 - 2. Let u = r - 1. What is the nearest to -2/7 in 0.2, u, g? 0.2 Let l = 7.6 + -15. Let d = l + 1.4. Let o = 6.1 + d. Which is the nearest to o? (a) 0.1 (b) 3 (c) 4/7 a Let x = 292/429 - 2/143. Which is the closest to x? (a) 3/4 (b) -1/6 (c) 1/10 a Let i = -32 + 30. Which is the nearest to i? (a) -0.4 (b) 3/4 (c) 1 a Suppose -m - 5 - 12 = 4s, -12 = 4s. Let n be ((-1)/6)/(4/12). Suppose 5c + 2 - 1 = 4g, -5c + 3g = 2. What is the nearest to -2/7 in m, c, n? n Let v = 1.5 - 2.5. What is the nearest to -3/5 in 3/4, 1/5, v? v Let t be ((-2)/(-4))/((-7)/14 - 5). What is the closest to -1.1 in 0.3, -0.5, t? -0.5 Let g = -0.1 + 0.1. Suppose -7 - 3 = -5m. Suppose 3z - 8 = 3t + 1, 2z - 10 = -mt. What is the nearest to g in -5, 1, z? 1 Let c = 417026/3 - 6697895/48. Let f = -531 - c. Let x = -11/112 + f. What is the nearest to 1/2 in -1/6, x, -4? -1/6 Let f = 8.65 + -9. Let o = f - -0.05. What is the closest to 0.1 in o, -2, -1? o Let k be (7/10 - 1)-2. Suppose -2w - 17 = 3v, -v + 3w - 1 = -w. What is the closest to -0.1 in v, 0.2, k? 0.2 Suppose -y - 1 = -b, -5y - 13 - 16 = 3b. What is the nearest to -1 in y, -3, 4? -3 Let f = 87 - 83.3. Let l = -4 + f. Let s = 6 - 5.5. Which is the nearest to -2? (a) -3 (b) l (c) s a Let u = 0 - -0.4. Let x be ((-6)/(-4))/(6/8). Let n = -1.6 - -1.7. Which is the closest to n? (a) u (b) x (c) -0.3 a Let s = -0.4 - -2.4. Let i = 4.12 - -0.08. Let y = 4 - i. Which is the closest to 0? (a) y (b) -1 (c) s a Let v = 58 - 57. Let w = 227 + -1592/7. What is the nearest to v in w, -2, 2/9? 2/9 Let w = 0.4 - 1.4. Let x = w + 0.9. Let y = -1/185 + 149/185. Which is the closest to 0? (a) 2/15 (b) x (c) y b Let k = 4 + -4.07. Let q = k - -0.07. Which is the closest to -1? (a) 1 (b) q (c) -1/7 c Let j = -26 + 16. Let m = -7 - j. Suppose mx = -c - 2x - 9, -x = 3c - 1. What is the nearest to c in -2, 0.4, 0.5? 0.5 Let y = 93 - 559/6. Which is the nearest to -2? (a) 3 (b) 0 (c) y c Let k = -4.9 - -2.9. Let r = 0.1 + -5.1. What is the nearest to k in 0.5, r, 0? 0 Let o(d) = -d*2 - 10d - 9. Let f be o(-9). Let t = 3 - 2. Which is the closest to t? (a) 0.1 (b) f (c) 0.5 c Let k be (2/6 + 1)3. Let t = -8/3 + 7/6. Which is the nearest to 0.1? (a) -1 (b) t (c) k a Let g be (-2)/(-10) + 20/900. Which is the closest to 0? (a) 0.2 (b) g (c) -2 a Let x be ((-1)/(-3))/(1/9). Suppose -2d = d + x. Let w = 3.3 - 0.3. Which is the closest to d? (a) 2/11 (b) w (c) 2 a Let t be (-30)/(-45)26/(-28). Which is the nearest to t? (a) 4 (b) -3 (c) 0.2 c Let j = -34 - -31. Which is the closest to -0.1? (a) -2 (b) -5 (c) j a Let w = -211/45 + 24/5. What is the nearest to -1 in -1/7, w, -1? -1 Let l be -2 - (-2 - 8/(-14)). Let s = 13 + -12. Which is the closest to s? (a) 0.8 (b) l (c) 5 a Suppose 4o - 5g + 21 = 0, 3g - 10 = -3o + 8o. Let f = 0 - 0.4. Let y = f + 0.9. What is the closest to o in y, 2/9, -1/5? y Let g = -27/10 + 11/5. Which is the nearest to 1? (a) 4 (b) 1/2 (c) g b Let l = 12 + -12.44. Let o = l - 0.06. Which is the closest to 0? (a) -1 (b) o (c) 0.2 c Let p = 33 - 35. What is the closest to p in 2/5, 5, -4? -4 Let j be 6/8 + (-105)/108. Which is the closest to -5? (a) j (b) 0.4 (c) 0.2 a Let j = 1.2 + -1.2. Let f = -0.1 - 0.12. Let l = f + -0.08. Which is the nearest to j? (a) 2/7 (b) l (c) -0.2 c Let c = -11 - -10.9. Let l = -1 + 0. What is the closest to l in c, -1/5, 1/4? -1/5 Let j = -7689293657 + 591368196773747/76908. Let x = 523/348 - j. Let f = -16/13 - x. Which is the closest to -2/5? (a) -2 (b) f (c) 2/7 b Let t = 33/2 + -17. Let i = -1.85 - 0.15. Which is the closest to t? (a) 3/7 (b) -10 (c) i a Let b = 0.5 + -0.53. What is the closest to 1 in 0.5, -2, b? 0.5 Let u = -21.9 - -22. Which is the nearest to u? (a) -5 (b) -2 (c) -3 b Let b = 133 + -138. What is the closest to -1 in 0, 1, b? 0 Let y be (-2)/(-12)3/(-4). Let t = -12 + 17. What is the closest to -2/5 in t, 2/15, y? y Let c = -3/35 + -26/105. What is the closest to 2/5 in c, -5, -2? c Let u = 5 - 18. Let j = -11.9 - u. Let t = 2.9 + j. Which is the nearest to -0.1? (a) -3/2 (b) t (c) 2/13 c Let h = -1.8 + 2.5. Let x = -0.5 + h. Suppose q + 0q = 0. Which is the nearest to q? (a) 0.3 (b) x (c) 1/4 b Let o be (1/(-26))/(3/12). Let i be (1/(-2))/(3/4). Which is the nearest to -1? (a) o (b) i (c) 3 b Let m = 60 + -60. What is the closest to -9 in m, -2/3, 1/4? -2/3 Let s(y) = -y2 + y. Let j be s(0). Let x = 0.03 + 0.47. Which is the nearest to -1/4? (a) j (b) -3/2 (c) x a Suppose 0 = z + 2j - 6 - 3, -15 = -z - 5j. Suppose -2 = 2i - 0. Let u be 1 + -1 + i/(-5). What is the nearest to -2/3 in 2/7, u, z? u Let q = -148 + 148.1. What is the closest to q in -8, 3/4, -2/3? 3/4 Let q = -14 + 15. What is the closest to q in 0.4, 1, -3? 1 Let h = 0.3 - 0.5. Let y = 25/57 - 2/19. Which is the closest to y? (a) 5 (b) -0.4 (c) h c Let f = -21449 - -108077/5. Let p = f - 167. Which is the closest to 3? (a) -1/4 (b) p (c) 0 c Let v = 11 + -19. Let o = v - -13. What is the nearest to 1 in -3/4, o, -0.4? -0.4 Let d = 17 - 17. Let t = -1.2 + -2.8. Which is the nearest to d? (a) -5 (b) t (c) 0.5 c Let t be ((-1)/(-2))/(9/(-18)). Let i(n) = -2n2 - n2 + 5n + 5 - 4n2 + n3. Let w be i(6). Which is the closest to t? (a) w (b) -0.5 (c) -2/7 a Let x = 1 - 8. Which is the nearest to -0.1? (a) 3 (b) 0.4 (c) x b Suppose 0 = 2d + z + 1, -4z + 3 = 5d - 4d. Let y = -2/15 - -7/15. Which is the nearest to 0? (a) 2/5 (b) y (c) d b Let k = -18 + 22. What is the closest to 2/3 in -4, 0.2, k? 0.2 Let r = 1190 - 3701/3. Let b = 44 + r. What is the closest to 2/3 in 0.3, b, 2/11? b Let x = 2.7 + 0.3. Let q = -2/65 + 69/130. Which is the closest to q? (a) -0.2 (b) 5 (c) x a Let u be (-2)/(-5) + 20/75. What is the nearest to u in 1/2, 5, -2/11? 1/2 Let p be ((-9)/25)/((-48)/80). Which is the closest to p? (a) 5 (b) -0.1 (c) 0 c Let j = 0.64 + 0.06. Let c = j + -0.8. What is the nearest to c in -0.1, -2, 2? -0.1 Let n(o) = -o3 - o2 + 3o + 2. Let y be n(-2). Suppose y - 6 = 3d. Let g = -0.05 - 0.25. Which is the closest to 0.1? (a) d (b) g (c) 3 b Let r = 5.7 + -6. Let i = 0.2 + r. Let y = 7 + -8. What is the closest to 0.2 in i, y, 2/17? 2/17 Let x be -1(0 + 0 + -1). Let i = -6.7 - -6.4. What is the nearest to x in 3/8, 5, i? 3/8 Let o = 0.11 - 0.11. Let z = -3.3 + 3. Let g = -3.3 - z. Which is the closest to o? (a) -1/4 (b) -1 (c) g a Suppose 0 = -4v + 5g + 2, 2v = v - 5g - 12. Let d be v/2 - 1/(-2). Let o = -236 + 234. What is the closest to d in 4, 0.5, o? 0.5 Let f = -5 - -7. Let s = 0.2 + -0.4. What is the nearest to f in 0, s, 2? 2 Let o = 4 - 6. Let x = -34 + 101/3. Which is the nearest to 1? (a) x (b) o (c) 1/5 c Let d = 1.1 + -0.8. Which is the closest to d? (a) -5 (b) -0.2 (c) -3/2 b Let m = 0.3 - 0.2. Let r = -9291/46 + 202. Let v = r - -79/598. Which is the nearest to m? (a) 0.4 (b) v (c) 0.1 c Let z = -8/7 - -9/14. What is the nearest to z in 0.3, 2, 17? 0.3 Let p = -0.06 - -2.06. Let n = -68/3 - -22. Which is the nearest to 0? (a) -3 (b) n (c) p b Let m = 2.1 - 1.4. Let j = 4.7 - m. Let s = j - 4. What is the nearest to s in 4/7, 1/2, -1/6? -1/6 Let s = 427/1881 - 1/209. Let h = -0.133 - -0.033. What is the nearest to 0.1 in -0.2, s, h? s Let r = -0.3 + 0.2. Let t = 1 + -2. Let l = -4 + 5. What is the nearest to l in t, r, 0.2? 0.2 Let g = -1 - -1.2. Let t = 1327/6 - 761/3. Let h = -32 - t. Which is the nearest to -2? (a) h (b) 0.3 (c) g c Let y = -0.3 - -0.3. Let t = 0.25 - 0.15. Let k = 0.6 - 0.1. Which is the nearest to t? (a) -2 (b) k (c) y c Let i be 14/(-24) + (-3)/(-4). Let u be (14/21)/((-1)/2). What is the nearest to -0.1 in -0.5, u, i? i Let r(d) = -2d3 - 3d*2 - 3d. Let n be r(-2). Let i be ((-9)/15)/(2/n). Let p = 2 - 2. Which is the nearest to 1? (a) -4 (b) i (c) p c Let w = -0.041 - 0.059. What is the closest to w in -1/7, -1, -4? -1/7 Let r = -0.2 + 0.2. Let d = -0.02 + 1.62. Let n = d - 1.4. Which is the nearest to n? (a) 2 (b) r (c) -5 b Let u = -469 + 2	{ "pile_set_name": "DM Mathematics" }
he second derivative of -70l4 + 2l*3 - 2217l*2 + 227l - 161. -840l2 + 12l - 4434 Find the first derivative of -231s2w - 2s2 - sw*2 - sw + 282723w2 wrt s. -462sw - 4s - w*2 - w Find the third derivative of 64a*4 - 1232a*3 - 10a*2 + 376a + 1 wrt a. 1536a - 7392 Differentiate -5889aj + 8240a - j*4 + 5 with respect to j. -5889a - 4j3 What is the derivative of -682p*3w - p*3 - 3pw - 47p + 3w - 539 wrt w? -682p*3 - 3p + 3 What is the derivative of -4d2q*2 + 2313d*2 + dq*2 + 19q*2 + 10q + 121 wrt d? -8dq*2 + 4626d + q*2 Find the third derivative of 3879c*3k*4 - 2c*3k*3 + 5c*3k - c3 + c2k2 - 3ck2 wrt k. 93096c*3k - 12c3 Find the third derivative of 161712v5 - v4 - 1701066v2. 9702720v*2 - 24v What is the derivative of -24m2 - 12237m - 31239? -48m - 12237 What is the derivative of 1376104x + 2340102 wrt x? 1376104 Find the second derivative of 20t5 - 2937t*2 - 86016t wrt t. 400t3 - 5874 Find the second derivative of 129h*3 + 1106h*2 - 991220h wrt h. 774h + 2212 Find the second derivative of -127248k*3 - 89060k wrt k. -763488k What is the third derivative of 277237cr4 - 2921cr - c + 19r*2 wrt r? 6653688cr What is the second derivative of 5or3 + or*2 - or - 29o - r3 + 839r*2 - r + 98 wrt r? 30or + 2o - 6r + 1678 Differentiate -214520x*4 + 3x*3 + 557884. -858080x*3 + 9x*2 Differentiate -64v*2 - 556v + 103098 wrt v. -128v - 556 Differentiate -195525g*4 - 258880. -782100g*3 Find the first derivative of -1745148c*2 + 2cx3 + 18x*3 + 77x*2 - x + 40 wrt c. -3490296c + 2x3 What is the third derivative of 41012z*3 + 39z*2 + 174 wrt z? 246072 What is the second derivative of -3136695s*3 - 233491s - 2? -18820170s What is the second derivative of -3q*4 + 30q*3 + 8q*2 + 29q - 313? -36q2 + 180q + 16 Find the second derivative of 209228p2 + 3p + 14965 wrt p. 418456 Differentiate -3l2 - 1621l - 500507. -6l - 1621 Find the second derivative of 11i*5v + 2i5 + 1462i*3 + 2iv - 2i - 5v + 895 wrt i. 220i*3v + 40i3 + 8772i What is the third derivative of -88227l4 - 73540l*2? -2117448l What is the third derivative of 59213n3 - n2 + 2n + 33 wrt n? 355278 What is the first derivative of 3z3 + 6123z*2 - 25441 wrt z? 9z*2 + 12246z What is the first derivative of -8k3w*2 + 24256k*3 - 199kw wrt w? -16k*3w - 199k What is the second derivative of -256br2 - br + 6704b - 122r*2 + 3r wrt r? -512b - 244 What is the first derivative of 478hq2 - 2hqy + 2hy - 3354q2 + 3y wrt h? 478q2 - 2qy + 2y What is the third derivative of 27577d4 + d3 - 2098443d*2 + 1? 661848d + 6 Find the third derivative of -44l3s*3 - 155l*3s*2 - 222415l*2s2 + s3 wrt l. -264s3 - 930s*2 What is the derivative of 1256j*4 + 46j*2 - 64980? 5024j*3 + 92j What is the derivative of -l*2v*2 - 1497l*2v + 3lv - 23289v2 wrt l? -2lv2 - 2994lv + 3v Find the second derivative of -3d3t - 151d2t + 30d2 + 461dt - 20d wrt d. -18dt - 302t + 60 Find the third derivative of d3w*3 + 1533d*3w*2 + 2d*3 + 46dw3 - 788w*3 + 11 wrt w. 6d*3 + 276d - 4728 What is the third derivative of -17c3d*2f*2 + 1599c*3d*2f - 7c2d2 - c2d + 15c*2 + cdf2 - 2cf wrt c? -102d*2f*2 + 9594d*2f What is the first derivative of 61006d3 + 46577 wrt d? 183018d*2 What is the third derivative of 4238t3 + t2 + 46t - 3? 25428 What is the first derivative of v3 - 13049v*2 + 12v - 1722974? 3v2 - 26098v + 12 Find the second derivative of -15653a3n - a*2 + 6an + 31a + 127n wrt a. -93918an - 2 What is the derivative of -11548bil*2 + 62bil + 3bi + 451b + 26i + 1 wrt l? -23096bil + 62bi Find the second derivative of -58n*4 + 75n*3 - 3n*2 + 48793n wrt n. -696n2 + 450n - 6 What is the third derivative of -212580h3 - 2816h*2 + 21 wrt h? -1275480 What is the second derivative of -947h*2n*2x + 12h2nx + 223hn2 - n2 + 76nx wrt h? -1894n*2x + 24nx What is the second derivative of c*4f + 7965c2f*2 + 66cf + 7c - 19f2 wrt c? 12c*2f + 15930f2 Find the second derivative of -43575d*5 + 2d*2 - d + 280889. -871500d*3 + 4 Find the third derivative of -29973d*6 + 19490d*2 - d. -3596760d*3 What is the third derivative of -2099j*4z*3 - 100j*4z - 2j3 - 11j*2z3 + z3 - 45335z2 wrt j? -50376jz3 - 2400jz - 12 Find the second derivative of 381772j*2x*3 - 2j*2x*2 + 67jx3 - 3973jx2 wrt j. 763544x*3 - 4x*2 What is the first derivative of 43834o*4 + 68534? 175336o*3 Differentiate 11b*4j + 855b2j*3 - 41067j*3 with respect to b. 44b*3j + 1710bj*3 Find the second derivative of 2df3z + 96df*3 + 5df2z + 6dfz - 2df + 88dz + 2d - z wrt f. 12dfz + 576df + 10dz Find the second derivative of 190680l*2 - 124l + 15. 381360 Differentiate -r*3 - 33982r*2 + r - 831185 wrt r. -3r*2 - 67964r + 1 Differentiate -607jkn3 + 17jk - 5j - 2641k2n - 160k2 - 1 wrt n. -1821jkn*2 - 2641k*2 What is the derivative of 5079j*3o - j*2 + 895o - 31 wrt j? 15237j2o - 2j What is the second derivative of 5b*5v + 37921b2v*3 + 15bv3 - 910v*3 wrt b? 100b*3v + 75842v3 Differentiate -h2k*4 + 39341h*2k + 1664504h2 with respect to k. -4h*2k*3 + 39341h*2 What is the second derivative of 16955a*3 + 7a*2 + 91525a? 101730a + 14 What is the second derivative of 3o*5 - 31618o*2 - 5o - 48928 wrt o? 60o3 - 63236 What is the derivative of 9633o*3r + 3o3 - 312o - r*4 + 4r*3 - 31 wrt r? 9633o*3 - 4r*3 + 12r*2 What is the first derivative of -2826h*3w + 15h2w*2 + 44058w*2 wrt h? -8478h*2w + 30hw*2 Find the third derivative of 231178w*5 + 7454w*2 - 2w - 1. 13870680w2 What is the second derivative of -14jt2 - 16jt + 88t*2 + 16t + 2 wrt t? -28j + 176 What is the second derivative of 2z*5 - 395033z*2 + 191z + 559 wrt z? 40z3 - 790066 Find the third derivative of -121695l*5 + 3479l*2 + 7l + 3. -7301700l2 What is the first derivative of -2270i*3 - 7i*2 - 30955? -6810i*2 - 14i Find the second derivative of 364104x4 + 3249x + 10 wrt x. 4369248x2 Find the second derivative of 83225j*2 + 16100j wrt j. 166450 Differentiate 2o3 - 3609o*2p - 75op - 34730p + 7 wrt o. 6o*2 - 7218op - 75p Find the third derivative of -4q6 - 21q*5 - 11q*4 + 349q*2 - 2q + 11. -480q3 - 1260q*2 - 264q What is the first derivative of 3a2 + 4agu + 71ag - 76645gu + 2g + 2u wrt a? 6a + 4gu + 71g What is the derivative of 255550n4 + 131310? 1022200n*3 What is the first derivative of -36578q*4 + 40701 wrt q? -146312q*3 Find the third derivative of 1296589b*5 - 1363515b*2 wrt b. 77795340b*2 Find the second derivative of -269lq2t + 164lqt + 2lq + q2t + 282q2 - 19qt + 4q - 9t wrt q. -538lt + 2t + 564 What is the second derivative of 18h4m + 35h3m + 47h3 + 4hm - 151h + m - 1 wrt h? 216h2m + 210hm + 282h Find the second derivative of q5 + 34357q*4 + 5q*3 + 1312740q. 20q3 + 412284q*2 + 30q Find the third derivative of -43f2o*3 - 8f*2o*2 - 2f*2o + 6118fo + 1191o3 wrt o. -258f*2 + 7146 What is the derivative of -254c*3g - 27394c3 - 283cg - 4 wrt g? -254c*3 - 283c Find the first derivative of 2073c2dq + 2c*2d - 66c2q - 190c2 - 125cd - c + 3q*2 + 2 wrt q. 2073c*2d - 66c2 + 6q What is the second derivative of 13l3x + 52l3 + 3l*2x*2 + 5l*2x + 5075lx*2 + 5lx + x - 2 wrt l? 78lx + 312l + 6x2 + 10x Find the third derivative of 4t4 + 18746t3 - t2 + t + 7596. 96t + 112476 What is the derivative of 25856d*3hny + d*3hn + d3ny - d3y + 38dy + ny - 4n + y wrt h? 25856d3ny + d3n Find the third derivative of -4bdi3 - bdi2 + 5bdix + 4bi3x - 176bi*3 + 11bi2x - 2bi + b - 2i*3	{ "pile_set_name": "DM Mathematics" }
5) - (-16 + 1)? 25 Evaluate (2941 - 2960) + (0 + 94 - 0). 75 Calculate (53 - 31) + (-209 - -114). -73 Calculate 16 + -21 + 14 - (-1 + (-5 - -17)). -2 Evaluate (18 + -32 - (-30 + 9)) + -68. -61 What is 0 - (-10 - (9 - 14)) - (-48 - -2)? 51 What is the value of -53 + 157 - 18 - 25? 61 What is -1 - 3 - (-25 - 16 - -117)? -80 What is (44 - (-18 + 79)) + 50 + -1 + -4? 28 41 - 21 - (70 + -10) -40 What is the value of 1 + -12 - (-3 + 1)? -9 Calculate 48 + -55 + -106 + 54. -59 What is the value of 28 - 7 - (39 - (69 + -14))? 37 What is the value of (0 + 4 - (37 + 0 + 1)) + 1586 + -1598? -46 Evaluate -3 - -1 - 126 - (-69 - -19 - -33). -111 What is the value of 20 + -48 + -2 - -54? 24 Evaluate -106 - (-75 + 93 - 65). -59 Calculate 12 - ((1 - -2) + 3 + -24 + 33). -3 -6 - (-5 + (18 - 38) + 27) -8 -25 + (-38 - (21 + -55)) + -35 -64 What is 12 + -2 - ((4 - -29) + 6)? -29 Evaluate (0 - 21) + 12 + 19 + -42. -32 What is -125 + 216 + (-127 - -11)? -25 -155 + 175 - (9 + -29 - 5) 45 What is the value of -30 + (19 - 13) + 9 + 13? -2 Evaluate 0 + -62 - (29 + 41 + (-48 - 32)). -52 What is 1 + -64 - (-6336 + 6324)? -51 What is 44 - (70 - 42) - -43? 59 Evaluate (-4 - -1 - -4) + 3 + 42 + -20. 26 What is (14 - (19 + -1 + -13) - -23) + (-2 - 0)? 30 What is -14 - ((11 - (0 + 18)) + -5)? -2 -9 + (-39 - -43 - (-37 + 34 - (5 + 1))) 4 What is the value of 6084 + -6102 + (0 + 2 - -115) + 1? 100 What is -55 + 100 + -57 - (34 + 3)? -49 What is the value of -27 + (-124 - (-190 + 139))? -100 Calculate -30078 + 30070 - ((0 + 0 - -2) + -66 + -2). 58 Calculate -1 - -1 - -49 - (7 + (37 - 11 - 24)). 40 What is the value of -3 + -2 + 7 + -5 + (63 - -7 - 65)? 2 Calculate 9 + -44 + 19 - 9 - (1 + 10). -36 Calculate (8 - (10 - (6 + 6))) + -26. -16 What is -14 + 1 + 874 + -859? 2 Calculate 3415 + -3392 + (-1 - -7). 29 Evaluate 42 + (-23 - -22) + -1 + 9. 49 What is (10 - (6 + -17 + 1 + (1 - 4))) + 3? 26 What is the value of (-3 - -49) + (-1068 - -987)? -35 Evaluate -172 + 166 + (-20 + 7 - -1). -18 Calculate 7 + 1 + (6 - (-11 + 9)). 16 Evaluate 3 - (-6 + -57) - (104 - 109). 71 Calculate 16 + 0 + 35 + -152 + 105. 4 What is the value of -8 + 49 + -2 + (-12 - 2) + 0 + 8? 33 What is (38 - 27) + 16 - (-4 + -7)? 38 Evaluate -26 + -14 + 20 + 94 + -26. 48 Evaluate (-1 - -12) + -6 + (0 - 0) - (2 + -42). 45 8 + 1 + 78 + (-26 - (-38 - -4)) + -7 88 Evaluate (7 - (-32 - 11)) + -54. -4 0 + 0 + 2 + -74 - (400 + -383) -89 What is 3 - (-20 - -35) - 36 - 26? -74 What is 33 + -8 - (-22 - (-29 + 3))? 21 4 + (3 - 4) - (18 - (-15 + 15)) - -152 137 What is the value of (8 + -4 - 15 - -5) + 86 + -14 - -6? 72 Evaluate 253 + 101 + -271 + -38 + 0. 45 What is 0 + -12 + (-2322 - -2345)? 11 Evaluate 33 + (91 - 38 - (29 - 16)). 73 What is the value of -12 + -89 + 73 - -80? 52 What is 13 + (-2 - (-12 + 18 + 7)) - 21? -23 Evaluate 14 - 1 - (-2655 + 2719). -51 What is the value of -3 + (-54 - -27) + 7? -23 What is -11903 + 11787 - (-1 + -118)? 3 Calculate (9 - 19) + 30 - (123 + -37). -66 (-20 - (2 - 11)) + (27 - 44) -28 Calculate 94 - (47 + 66 + 67). -86 Calculate 53 - ((1 - 5) + (-261 - -283)). 35 What is -32 - -35 - (0 + 0 - (-7 - -13 - 74))? -65 Evaluate (-3 - -16 - (4 - 3)) + (53 - -1) + 12. 78 3837 - 3930 - (0 - 114) 21 Evaluate -5 + 19 + 6 + -4 - 40 - (-14 + -2). -8 Calculate -20 + -43 + 60 - -73. 70 53 + -3 + -126 - -61 -15 Evaluate -103 - ((-22 + 2 - -1) + 2469 + -2469). -84 Evaluate (1 + -21 - (-17 - (13 - 20))) + 1 + 2. -7 What is the value of 2 - 47 - 1 - (14 + (11 - 24))? -47 Calculate (3 - 13) + (-16 + (1 - 11) + 3 - 13). -46 What is 46 + -2 + 1 + (-65 - -21 - -45)? 46 Calculate -22 + (15 - 14) + 10 + 0 + -24. -35 What is the value of -23 + 1 - (7 - (-5 + 21)) - -7? -6 Evaluate 8 - 2 - ((82 + -23 - 23) + -25). -5 What is the value of 65 + (37 - 85) + (-12 - (-6 - -1))? 10 What is the value of 4 + -12 + 2 - (12 + -34 + 88)? -72 What is (-1 - -21) + -8 - (-28 + -41)? 81 Calculate -12 + 12 + -12 + 18 - -53. 59 What is -32 + -1 + (25 + -28 - (2 - 13))? -25 Evaluate 344 + -423 - (14 + -86). -7 What is (-26 + 36 - 41) + 62? 31 -91 - (6 + -24 + 32 + -17) -88 What is the value of 2 + (-73 - -43) - -46? 18 What is the value of 2 + (3 - -5) + (-27 - (-2 - -21) - -15)? -21 What is 13 - (-17 - (-26 + (-26 - -106)))? 84 Evaluate 305 + 67 - 260 - (-1 - -34). 79 What is the value of -31 - (-63 + 54) - (-11 - -9 - -23)? -43 What is the value of -10 + (5 - 1) - (-17 - -16) - 10? -15 What is the value of 495 - 494 - (-3 + 19)? -15 110 + -168 - ((6 - 0 - (4 + 2)) + -10) -48 Calculate -30 + 11 + 17 - (-10 - -6). 2 Calculate 1 - (-2 + -1) - (8 + (57 - (-47 + 93))). -15 Calculate 24 + 8 + -98 + 56. -10 1 + -28 + (208 - 315) - (1 - -2) -137 What is the value of -4 - (11 + 9 + 3 + -29) - (3 + -36)? 35 What is the value of 3 + 2 + (18 - (12 + 22) - -40)? 29 What is the value of 38 - ((74 - 43) + -1 + -17)? 25 What is 81 + 4 + -19 + -63? 3 Evaluate 9 + 4 + 0 + -3 + (12 - (77 + 3)). -58 What is the value of -81 - (5 + -21 + 42 + -12)? -95 What is 66 + 83 + -117 - -78? 110 Calculate 1437 + -1457 + 2 + -15 + 31. -2 Calculate -13 + -2 + (-16 - (-37 + 114)) + (1 - -8). -99 What is 13 - (390 + -405 + -29 + 3)? 54 Calculate -52 - ((71 - 43) + -63). -17 What is (42 - (30 - 0)) + (6 - -11)? 29 What is the value of 2 + -4 + -52 + 4 - (-16 - (3 - 10))? -41 Evaluate (5 - 1 - -5) + (43 - 36 - 27). -11 What is the value of (0 - 18) + (16 - -19) + 18 + -36? -1 Evaluate (6 + -20 - (2 + -43) - 11) + -106. -90 Evaluate (-1 - 6) + (19 + -3 + -41 - 32). -64 What is the value of -2 + -27 - (89 - 211 - -78)? 15 0 + -9 + 2 - ((76 - 147) + -57) 121 Evaluate -26 + 86 + -120 + 5. -55 Evaluate -15 + (28 - 7) - (-2 - (2 + -7)). 3 (-18 - ((-41 - -27) + -14)) + 44 54 What is -65 + (58 - -25) + -26? -8 Calculate -1 + 80 - -31 - 57. 53 What is -5 + (31 - 9) - 31 - 23? -37 (0 - 11 - (-95 + 38 + 29)) + 8 25 What is (116 - 2) + (-51 - (-53 + 1 - -14))? 101 Calculate 97 + -100 + (-9 - -5 - -3) + 8 + -70. -66 What is 11 + 70 - ((-15 + 36 - 18) + -19)? 97 (-4 - (3 - 2 - 3)) + (-10 + 5 - -61) 54 What is -10 - ((6 - (14 + 0)) + -14 + 147 - 6)? -129 Calculate (-119 - -133) + 5 + 25. 44 Evaluate 11 + -2 - (80 + -115 + (10 - 18) + 13). 39 Calculate -23 + (1 - (-112 + 109 - (-1 + -6))). -26 What is the value of -25 + (-1 - 23) + 10 + 6? -33 What is -101 - (16 + -94) - 29? -52 What is the value of (-1 - 12) + 244 + -250 - -26? 7 Calculate -57 - (26 + -33 + 15 - 14). -51 What is the value of 52 + -4 + -68 - -26? 6 What is the value of 0 - 14 - (-1197 - -1145)? 38 Calculate 8 + (107 - 138) + (0 - -1) + (33 - 34). -23 Evaluate -9 - (29 + (-42 - -24 - 23)) - (135 - -2). -134 What is the value of 74 + 20 + (-16 - (10 + 11 + 1))? 56 Calculate (1 - 7 - -5 - 5) + (15 - -66). 75 Evaluate -71 + -14 + (-29 - -20). -94 Evaluate -6 + (2 - 3 - -8) + -51 + (27 - 25). -48 Calculate -59 - (-15 + (-10 - (0 - -9 - 40)) - 5). -60 What is (-3 - (-5 - -13) - (-1 + -19)) + 33? 42 Evaluate -235 + -192 + 451 - (-7 - (1 - 2)). 30 Calculate (-27 + -33 + 27 - -17) + 41. 25 What is 57 - 94 - (-7 - 0 - -9)? -39 31 + -64 + -1 + 54 20 What is -144 + (30 - 10) + 18 + -18? -124 What is the value of -6 + -47 - (0 - 4 - (-1 + 10))? -40 Calculate -6 + 1 - (-6170 - -6182 - (67 + 0 + -1)). 49 4 - (22 - (-14 + 15)) - (2 + -38) 19 What is 39 + (-8 + -55 - 26)? -50 What is the value of -322 + 225 - (1 - -11 - (-6 + 40))? -75 What is 71 + -27 + -57 - -103? 90 What is the value of 4239 + -4363 + (18 - (-3 + 2)) + 22? -83 Calculate (147 - -70) + -83 - (-3 + -1 - 9). 147 What is the value of 101 - (20 + -5 + -15 + 17 + -3)? 87 Calculate (9 - -38) + 21 + -3 + (-36 - -14). 43 Evaluate -15 + (41 - 12 - 67). -53 Calculate (1 - -20) + 43 + -10 + -31. 23 Evaluate (23 - -40) + -227 + 126. -38 Evaluate (5 + -2 - (2 - -7)) + 76 + -14. 56 Calculate 4722 + -4739 - (-16 - 5 - (1 - 2)). 3 Calculate (-5 - (9 - (8 + -8))) + -72 - 20. -106 What is the value of (-36 - -49) + (2 - 1) + (7 - (-10 - -18))? 13 Evaluate (-183 - -183) + 3 + -5 + -15. -17 Evaluate 19 - (3 + (2 + 2 - (-23 - -33))). 22 Evaluate 15 + -7 + 1 + (-83 - -80) + 22. 28 What is the value of 10 - (-18 + 23 + 11) - 2 - 34? -42 Calculate (390 - 422) + 10 + 1 + (0 - 14). -35 Calculate -12 + 61 + -9 - (-7 + 8). 39 What is the value of (-10 - 2) + (31 - (151 + -28 - -33)) - -6? -	{ "pile_set_name": "DM Mathematics" }
.1? 0.1 Let f = -1/20 + -1/20. Let w = 3 - 1. What is the nearest to w in f, 2, 1/5? 2 Let p = 61 + -306/5. Let h = 5 + -17/4. Let x = 105 + -104.6. Which is the closest to -1? (a) x (b) h (c) p c Let y = 16.5 + -16. Which is the nearest to 3? (a) 5 (b) y (c) 3/5 a Let w be (-1 + (-2)/((-4)/(-1)))/3. What is the nearest to w in -2/9, -4, 5? -2/9 Let l be (-20)/8(-8)/50. Which is the closest to -1? (a) -3 (b) 2/3 (c) l c Let q = 4 - 3. Suppose m - 2 = q. Suppose 13 = p - 4i, -p + 5 = -5i - 10. Which is the nearest to 1? (a) 2/19 (b) m (c) p a Suppose 2 = -t + 2t. Let a be 0/t + (-1)/(-4). Let f = 0.16 - 2.16. What is the closest to -0.1 in f, a, 1? a Let h = 7/2 + -25/6. Let l = -0.1 - -0.1. Let n = 0.2 - l. Which is the nearest to 0.1? (a) n (b) h (c) 0.3 a Let j be (-18)/(-63) - (-16)/(-7). What is the closest to 0.1 in -3, j, -4/3? -4/3 Suppose -3 - 12 = -3s. Which is the closest to -1? (a) 0.5 (b) -2/7 (c) s b Let j = 0.6 - 0.4. Let z = -0.1 - j. Let t = 0.8 + z. What is the nearest to -1 in t, -3, -5? t Let y = 72 - 10. Let j = 433/7 - y. What is the closest to -0.1 in 4, j, 2? j Suppose 2r + 2 = 0, 5f - r - 9 - 17 = 0. What is the closest to -2 in -2/5, f, 2? -2/5 Suppose -4n + 0y + y - 22 = 0, 0 = -3n - 3y - 9. What is the closest to 0.2 in n, 0.2, 1? 0.2 Let d = -2 + 2. Let n = 0.5 + d. Let v = -6.3 - -6. Which is the closest to -1? (a) 0.1 (b) v (c) n b Let j = -0.87 + 0.07. Let q = j - -6.8. Let z = 1 - q. Which is the closest to 1? (a) -4 (b) 3 (c) z b Let m = 216.14 + -214. Let q = 0.14 - m. Which is the closest to 0.1? (a) 5 (b) q (c) -4 b Let v = -13/63 - 1/63. Let x(j) = j + 3. Let n be x(0). What is the nearest to -1 in 0, v, n? v Let w(l) be the second derivative of -l5 + l4/6 - 2l3/3 + l2 - 4l. Let u be w(2). Let f = -1424/9 - u. What is the nearest to -0.2 in f, 0.1, -2? f Suppose -4c + 8 = 4d, 2c - 5d + 0d = -31. Let y be c/28/(-6). Let g be 1(y - (-22)/(-12)). What is the nearest to 2/3 in 1, 0, g? 1 Let f = -57 - -56.8. Which is the nearest to f? (a) 5 (b) 0 (c) -1 b Let m = 0.1 - -0.1. Let c = -0.3 - -0.6. What is the nearest to -2/5 in c, -5, m? m Let k = 0.8 - 0.4. Let l = -0.129 + 0.029. What is the nearest to l in 3, k, -3? k Let w = -0.65 - -0.75. What is the closest to w in -5/4, -3, -2/5? -2/5 Let v = 10 + -19/2. Let r = 30 - 29.9. Which is the nearest to r? (a) 0 (b) 2 (c) v a Let o be 6/(-20)12/(-27). What is the closest to o in -0.5, 2/15, -2? 2/15 Let j = -19 + 29. Let o = j - 9.9. What is the closest to o in 4/7, -0.1, -2/9? -0.1 Let r = -3.96 - 0.04. Let g = r - -4.2. Let o = 2.5 + -0.5. Which is the nearest to -1? (a) o (b) g (c) 2/5 b Let w = 0.9 - 1. Let b = 313/9 - 35. Let n = -0.8 + -3.2. What is the closest to w in b, n, -3? b Let l = -11.07 + 11. Let f = 1.87 + l. Let g = 2 - f. What is the nearest to 1/4 in -0.1, 3, g? g Let s = -1.2 - -1.7. Which is the nearest to -1? (a) s (b) -2 (c) 0.1 b Let h = 60.1 + -60. Which is the closest to h? (a) 11 (b) 1/4 (c) 3 b Let c = -29 - -30.3. Let a = c - 2.2. Let n = 1 + a. What is the nearest to n in 0.2, 1, -5? 0.2 Let t = 81411 - 17014933/209. Let h = t + -4/209. What is the closest to -2 in 1/10, 3, h? h Let f = 0.68 - 0.38. Which is the nearest to -0.1? (a) f (b) 0.4 (c) 1 a Let l = 32255/8 + -4043. Let k = l - -11. Let p = -1/8 + k. Which is the nearest to p? (a) 0 (b) -2 (c) 2/13 a Let h = 1.5 + -1. Let x = -24 - -49/2. Which is the closest to x? (a) 0 (b) -2 (c) h c Let l be (9/6 + 0)28/210. Which is the nearest to 0? (a) -0.5 (b) l (c) -0.1 c Let t = -8 + 6. Let d = -4.4 - -4. What is the nearest to t in d, 5, 4? d Let s = -7 - -11. Let q = 2 + 2. Let f = 4.5 - q. What is the closest to 2/5 in f, s, -1? f Let i = 7 + -6. Which is the nearest to i? (a) 2/3 (b) 4 (c) -3 a Suppose 0 = 8t - 7t - 2. What is the closest to 1/4 in -2, 5, t? t Let z be (2/(-24))/((-6)/(-16)). Which is the nearest to z? (a) 0.5 (b) 3/2 (c) 0.1 c Let m = 5 - 2. Let s be (-323)/(-51) - (0 + 6). What is the closest to s in 4/3, -1/2, m? -1/2 Let n = 3.04 - 0.04. Let s = 0.47 + -0.5. Let p = s + -0.07. Which is the nearest to p? (a) -4 (b) n (c) -0.5 c Let t = 5.2 + -0.2. What is the closest to -2/7 in t, 1, -4? 1 Let y = 4/13 + -33/65. Let w be (-1396)/(-10) + -9 + 5. Let z = w + -136. Which is the closest to 1? (a) z (b) y (c) 0.5 c Let a = -3 - -2.5. Let d = 4 + 0. What is the nearest to 0.1 in -1/6, a, d? -1/6 Let p = 0.47 - 0.77. Which is the closest to -0.1? (a) 1 (b) -0.4 (c) p c Let p be (-51)/21 - 1/(35/(-15)). What is the closest to 0.7 in p, 2/7, -1? 2/7 Let l = -0.03 - -0.33. Let d = -12 + 8. What is the closest to 2/3 in d, 1, l? 1 Let y = -5 - -9. Let s = -34.9 - -35. Which is the closest to s? (a) 0.3 (b) 0.2 (c) y b Let u = -51 - -149/3. Let j = 6 + -1. Let y = 947/7 - 135. What is the closest to y in j, u, 3? u Let s = 148/5 - 30. What is the nearest to 1 in s, -2, 2? 2 Suppose -2w - 2w + 4 = 0. Let m = -8.21 - -0.21. Let u = m + 3. Which is the closest to w? (a) -0.3 (b) u (c) 2 c Let m = -377/8 - -47. What is the nearest to 26 in -5, -0.4, m? m Let f = 20 - 23. What is the nearest to 2/3 in -1, f, -2? -1 Let g = -4 + 3. Let v = 0 + g. Which is the closest to v? (a) 0.3 (b) 5 (c) -3 a Let q = 113/30 + -25/6. What is the closest to -0.1 in -5, q, 3? q Let x be (-4)/(-6)23. Let v = 0.5 - 0.1. What is the nearest to -1/4 in x, v, -0.2? -0.2 Let t be 28/(-18)((-5)/(-35) - 1). Let z be (-1)/12(1 - 11). Which is the nearest to -2? (a) t (b) z (c) -0.1 c Let u be (-8)/36 - 1/(-45). Which is the nearest to -2/17? (a) 3/8 (b) u (c) -1 b Let s = -2 - -2. Let g = -2.3 - -1.3. What is the nearest to s in g, -0.4, 1/4? 1/4 Let r = 0.5 + -0.1. Let m = 0.0024 + 0.0976. Let q = 2 + 0. Which is the closest to m? (a) 0 (b) r (c) q a Let f be (-2)/(-9) - ((-238)/9)/7. Which is the closest to 1? (a) -3/5 (b) f (c) -5 a Let m be 2/(-12)(-36)/(-24). Let g = 2 - 2. What is the nearest to m in -4, 3/7, g? g Let j = 19.1 + -29.2. Let w = j + 10. Let l = -0.1 - -0.1. What is the nearest to l in 3, w, 2/11? w Let y = -22 - -21. Let i(v) = -v3 + 7v*2 + 8v + 1. Let w be i(8). Let o = w - 1. What is the nearest to -1/4 in y, o, -1/5? -1/5 Let b = -40 - -161/4. Let t = 9 + -9.16. Let w = t + 1.16. What is the nearest to w in b, 5, 2/11? b Let r = 0.15 + -1.15. Let w = -0.17 + 0.07. What is the closest to w in -2/5, r, -0.1? -0.1 Let h = 0.59 - 0.89. Let y(w) = -2w - 5. Let j be y(-4). Which is the nearest to -1? (a) -2 (b) h (c) j b Let u be 1((-126)/4 - 0). Suppose -2t - 128 = 2t. Let v = u - t. Which is the nearest to -1/4? (a) 4/5 (b) v (c) 1 b Let a = 3 - 2.6. Let m = -9 - -11. Suppose 3i + 2 = mi. What is the closest to i in 2/3, 1, a? a Let q = -5 - -9. Suppose 5z = 9z. Let u be ((-2)/(-4))/(-1 + 0). What is the nearest to z in q, u, -0.1? -0.1 Let q be -3 - 45/3 - -3. Let d = q + 10. Let w be (1/2)/(d/(-4)). Which is the closest to -0.3? (a) -1/3 (b) w (c) -4 a Let g = -1.2 + 1.3. Which is the nearest to g? (a) 1/3 (b) 1 (c) 4 a Let d = 0.198 + 0.002. What is the nearest to 0.1 in d, -0.3, 2/15? 2/15 Let p = 0.5 - 0.2. Let s = -0.38 + 0.88. Which is the closest to 1/3? (a) s (b) p (c) -5 b Let v = 10 - 15. Let i = 5.2 + v. Which is the nearest to -1/3? (a) -3 (b) -2 (c) i c Let n be -1 + (4/14 - (-6)/21). Which is the nearest to n? (a) -0.2 (b) -2 (c) 2/3 a Let o be (3/20)/(34/85). What is the nearest to -2/5 in 0.1, o, 1/3? 0.1 Let y = -0.8 + 0.6. Which is the closest to y? (a) 4 (b) -1/5 (c) -5 b Let v be ((-30)/8)/(3/(-12)). Let y be 5/(v/(-9)) + -2. What is the nearest to -0.1 in -1/8, y, 2/7? -1/8 Let p(i) = -i*3 + 2i*2 + i + 1. Let m be p(4). Let z = m + 28. Let y be 0((-6)/(-4) - 1). What is the nearest to y in z, -5, -0.5? -0.5 Let b(j) = -j*3 - 5j*2 - 2j - 6. Let q be b(-5). Suppose -qx = -8x. Let a be 0 - (-2 + 1 + x). What is the closest to a in 2/15, -0.5, 1/7? 1/7 Let u = 0.09 - -0.71. Let f = 14.2 + u. Let q = f + -11. Which is the nearest to 2/5? (a) q (b) 5 (c) 0.2 c Let z = 6 - 11.5. Let s = 5 + z. Which is the nearest to 0.1? (a) 2 (b) s (c) -1 b Let n = -246/5 - -4192/85. Which is the cl	{ "pile_set_name": "DM Mathematics" }
(-1/14))(3/8)s*(-11)s(-3/16) assuming s is positive. s(-157/14) Simplify j*4j*(-1/3)jj(1/2)/jjj(2/7)j assuming j is positive. j(271/42) Simplify (s(-2/11)s)39((ss/s1ss)/s)/(s(1/3)s) assuming s is positive. s*(1075/33) Simplify (ww(-5/4))50w(-2/21)/(w/(www(-6/13))) assuming w is positive. w(-6583/546) Simplify (p/p(-4/3)p)(-11/3)/(p1/p(-14)) assuming p is positive. p(-245/9) Simplify (jj30jj(1/7))(-2/127) assuming j is positive. j(-450/889) Simplify (((vv/(v*(-8)v))/v)/vvv*(1/7)/vv*(-2/5)vv(-10))18 assuming v is positive. v(-1422/35) Simplify ((a8)(-25))(18/7) assuming a is positive. a(-3600/7) Simplify (tt/((ttt*(-6)/t)/t)tt24)/(t/(tt*(4/3))tt/(tt13)) assuming t is positive. t(139/3) Simplify (j*(-3/16)j*(-9)jj)/(j4/(jj(1/19))) assuming j is positive. j(-3081/304) Simplify vvvv(-23)vv/((v(2/41)v)/v)v(vv/(v(v/((v/(v*(-2)/v))/vv))/v))(2/25) assuming v is positive. v(-3413/205) Simplify ((t/t(2/19))(-30))(-7) assuming t is positive. t(3570/19) Simplify (z*7zz(-1/17)z)/((z*(2/25)z)/z(-6)) assuming z is positive. z(791/425) Simplify (s/s(1/17))49(sss14)(1/19) assuming s is positive. s(15168/323) Simplify ((g(-1/2))5/(g7g(-4/9)/g))(3/4) assuming g is positive. g(-145/24) Simplify (x(3/2)/(x/x*(-20/7)))/((xx*(-10)x)/(x*(-2)x)) assuming x is positive. x(65/14) Simplify (r(17/4)rr)/r*(-11)(r*5r)/(rr/r(-3/5)) assuming r is positive. r(413/20) Simplify ((c(-2/59)/c)/c)(1/16)c*(-2/47)c(-1/8) assuming c is positive. c(-6537/22184) Simplify ((kk(2/19))/(k/(((k/(kk*(1/2)))/kk)/k))k(2/5)/kk(1/6))(-1/49) assuming k is positive. k(521/13965) Simplify ((t/t(1/4))*(-6/11)/(tt3)(-7))(-8) assuming t is positive. t(-2428/11) Simplify (((q/q(-6))/q(-3))/((qq0)/qq*4q))(1/22) assuming q is positive. q(5/22) Simplify ((l*(-6)lll)/l)/lll*(-1/4)l*(4/3)/ll(-4/5) assuming l is positive. l(-283/60) Simplify ((mm(-14))/((m/(m/m(-11)))/m))/(mm/(m/m*(-9))mm/(mm*(2/9)m)) assuming m is positive. m(65/9) Simplify ((q9/q(-2/31))(-14/9))(-7) assuming q is positive. q(27538/279) Simplify ss(-5)s*(-13/6)(s/(s/s*31)s)/sss(-34) assuming s is positive. s(-49/6) Simplify (q*(4/19)/q)/qq*0q*(-32)qq(-23) assuming q is positive. q(-1060/19) Simplify (y/(yy(2/5)))/y(-18)y(2/27)/(yy(7/2)) assuming y is positive. y(3557/270) Simplify ((pp/p(8/7)p12)(1/16))(-42) assuming p is positive. p(-135/4) Simplify ((u*(-1/3)u)/u)*(-14)/((u/(uu/(uu(1/4)/uuu)u))/uu/u(-7)u) assuming u is positive. u(-43/12) Simplify (r(1/3)/r(-2/3))/((r/r(-5))/r)(-5/9) assuming r is positive. r(34/9) Simplify ((rr(-10/11))/r(1/31))/(r(-1))(-5) assuming r is positive. r(-1685/341) Simplify (a/a(1/7)a*(-11)/a)/(a/((aa*(-4))/a)a10) assuming a is positive. a(-183/7) Simplify (y/(yy(-5))y)/y*(2/5)y*2(y/y(-2/15))/y assuming y is positive. y(116/15) Simplify (r/r*(1/3)r*(-1/2)r*(2/11)r/(r/(r/(rrr/r*4rr))))(-1/2) assuming r is positive. r(-23/132) Simplify ((d((dd(-19))/d)/d)/(d(2/13)d))(-22) assuming d is positive. d(5764/13) Simplify ((b(b(b*(-13/6)/bb)/bbbb)/bb)/(bbb/(bb(-21/4))))(1/41) assuming b is positive. b(-65/492) Simplify (xx/x*(4/9)xxx(x/((x(-2/81)xx)/x))/x)/(x(-4/5)x*1/xx) assuming x is positive. x(1369/405) Simplify ((z(-5)z(z/z*(1/7)z)/zzz)/((zz(4/3))/z4))(-2/5) assuming z is positive. z(-22/105) Simplify ((z((zz(-2/41)z)/z)/z)/(zz(z/(z/(z/((zz(1/3))/z))))/z))/((z/(z3/z))/z)25 assuming z is positive. z(6062/123) Simplify (z7/zz10)/(z(-6)/zz(1/5)) assuming z is positive. z(114/5) Simplify (j(j/(((j/((j/j*(-3)j)/j))/j)/j))/jj)(6/5)j/j*(2/17)j(2/9) assuming j is positive. j(7271/765) Simplify (f(-2))(2/25)f(-12)f14 assuming f is positive. f(46/25) Simplify ((r1/r)/r)/r(1/17)(r/(r/r(-25)r))/r15 assuming r is positive. r(-715/17) Simplify (((((q/(qq/q(2/29)q))/q)/q)/q)/q*(-1/9)(q/q*9qq)/qq/q(-5))(-14) assuming q is positive. q*(21266/261) Simplify (((mm*2m)/m)*(-2/13)/(m/(mm*(-2/29)m)m/(m((m/m*(-1))/m)/mm)))(1/16) assuming m is positive. m(277/3016) Simplify (s1)(-36/11)/(s*(1/4)/ss*(-2/13)s) assuming s is positive. s(-1927/572) Simplify (r(-5))(-1/29)/((r(-2/5)/r)/(rr(2/13))) assuming r is positive. r(5139/1885) Simplify (i(-7/5))(16/7)/(ii(-10/9)/i)(1/17) assuming i is positive. i(-2398/765) Simplify ((s/(s/(s/s(2/45)s)))/s)/(ss*(12/7)s)s(-24)/((s/(ss/s*27)ss)/s) assuming s is positive. s(-16934/315) Simplify (d/(dd/(d*7/dd)))/((d/d*(-1/3))/d)d*(1/12)d/(dd/((ddd1)/d)) assuming d is positive. d(27/4) Simplify ((pp*3p)3)11 assuming p is positive. p165 Simplify ((r(-2/21)/rr/(r(-6)/rr))(-29))(1/37) assuming r is positive. r(-3596/777) Simplify (n28nn)/(n*29/n)(n6)(-11/4) assuming n is positive. n(-29/2) Simplify (n/n0n)/n(-11)n*6n(-2) assuming n is positive. n17 Simplify ((ss(3/11))/s(-2/113))/(((s/s(-1/5))/s)/(s/(((s(-29/5)s)/s)/s))) assuming s is positive. s(55254/6215) Simplify (r(4/9))*(-46)/(r/(rrr(2/7)r)r19/r) assuming r is positive. r(-2278/63) Simplify (((x8/x)(-41))(-16))(-33) assuming x is positive. x(-151536) Simplify ((o(-1)/ooo)/((o/(o/o(-8)))/oo))/(o(1/4))(1/15) assuming o is positive. o*(479/60) Simplify (cc/c*(2/9)c)/(c/(c/c*(-21))c)(cc*5/cc)(-26) assuming c is positive. c(-1199/9) Simplify (n/(((nn(-12)/n)/n)/n))/((nn*14/n)/nnn)(((n/n*0)/nn)/n)(-9) assuming n is positive. 1 Simplify (((l(-1)l)/(ll18))5)(-45) assuming l is positive. l4275 Simplify (b*(-2/51)b*29b)39 assuming b is positive. b(19864/17) Simplify (m*(-2/41)m(17/2))(-29/3) assuming m is positive. m*(-6699/82) Simplify ((w/(w/(w/(ww*(3/2))w))ww(1/2))/(w(-4/3)ww(-6)))50 assuming w is positive. w*(1100/3) Simplify (nnnn/n(4/3))/(n16nn)(n(-1/3)/nn)(3/13) assuming n is positive. n(-601/39) Simplify (l/l(1/7))/(l/(l(2/11)/l))(l(-2))(5/12) assuming l is positive. l(-829/462) Simplify (uu*12u/u21)/(u7/(u/(u(-10)/u))) assuming u is positive. u(-2) Simplify (((ww(2/9))/w)/wwww*(-3)w)/(w(-1/7))(-14) assuming w is positive. w(-25/9) Simplify (l(-4)l)(-3/4)l6/l(3/5) assuming l is positive. l(153/20) Simplify (((z/z7)/(zz/(z/(z/((z/z(-8))/z)))z))32)(-33/2) assuming z is positive. z528 Simplify (((w2w)(-11))1)(-3/17) assuming w is positive. w(99/17) Simplify (p/p(2/9)p)/p*(-4/11)((p4/p)/p)(-11/5) assuming p is positive. p(-1118/495) Simplify (b(-11)/(b/((b/(b*1b))/bbb)b))/(b/(bb*(6/7)/b)b*(-10)b) assuming b is positive. b(-29/7) Simplify ((p0)*(-49)(p(-1))(-24))16 assuming p is positive. p384 Simplify (i/i(-7))(-12/19)/(i*(20/3)i/i(-2/3)) assuming i is positive. i(-763/57) Simplify (t(-1))(3/20)t(5/4)tt(-5)/t assuming t is positive. t(-39/10) Simplify (aa(3/7))(-45)(aa(-3/4)/a)(-2/71) assuming a is positive. a(-63879/994) Simplify ((b/b21)/bb(-1/5))/(b(18/11)/b(-3/10)) assuming b is positive. b(-509/22) Simplify (cccc/(c(c/(ccc(-3)))/c))/cc/(c/(c*10/cc))c(c(-3/10)/c)/(c/c(4/5)) assuming c is positive. c(21/2) Simplify (z(-4/9))*4z(2/75)/(z/z(2/17)) assuming z is positive. z*(-10073/3825) Simplify (iii/(i/i15)ii)/i(1/13)((i/(i/i8))/i)/i(-18) assuming i is positive. i*(571/13) Simplify (tt10)/t(-2/7)(t(-10)/t)/t1 assuming t is positive. t(-5/7) Simplify (d(3/14)((dd(-5))/dd)/d)(-4/41) assuming d is positive. d(134/287) Simplify (k(k((k/(k/(kkk*(-4)))k)/k)/kk)/kk*(1/7)k(k(2/7)k)25)(-1/20) assuming k is positive. k*(-113/70) Simplify (o/(o((o*(2/13)/o)/oo)/o))/(o*(-25)/o)(o(-13))5 assuming o is positive.	{ "pile_set_name": "DM Mathematics" }
asing order. 8/3, d, -1 Let t be (-18)/(-48) + (0 - 0). Let b be (8/(-28))/((-5)/(-10)). Put -2/19, t, -2/5, b in ascending order. b, -2/5, -2/19, t Let u = 2704 + -2702. Put -2, -5, -3, u in increasing order. -5, -3, -2, u Let x be (-45)/12 - (1 + -4). Let s = 345 - 295. Put s, x, -5 in increasing order. -5, x, s Let p be 35/5 - 1-1. Suppose 3w - 3x = 27, 4w + w + 2x = 17. Suppose -p = wc - 3. Sort -4, c, 4. -4, c, 4 Let h = -960 + 957. Sort -8.3, h, 5 in decreasing order. 5, h, -8.3 Let u be 1/3 - (-144)/54. Let j be (2/u)/((-20)/15). Put j, -0.3, 3 in increasing order. j, -0.3, 3 Suppose 0 = 4a - 2o + 32, a - 5o - 1 = -0a. Let t = a + 16. Suppose -25s + 22s - 6 = 0. Sort -4, t, s in ascending order. -4, s, t Let a be 8/(-6)(-6)/72. Suppose 10 = 2t + 4. Suppose tv - q = 12, 4q - 1 = v + 6. Sort v, -5, a. -5, a, v Let o be (-2)/9 - (-4)/18. Let m be (-4)/(-8) + o - -1. Let v = -6 + 7. Put m, v, 2 in ascending order. v, m, 2 Suppose -h - 2h + 72 = 0. Suppose -11r + h = -5r. Put 5, -2, r in decreasing order. 5, r, -2 Let t = -540/77 - -74/11. Sort -0.35, 0.2, t. -0.35, t, 0.2 Suppose -m + 2z = 3, -4m - 4z + z + 43 = 0. Let p = 9 - m. Suppose -pw - 2w - k = 0, -4k = -2w. Put w, 1, 4 in descending order. 4, 1, w Suppose 11 = 2x - 3s + 1, 5x - 5s = 15. Put 3, 23, -5, x in ascending order. -5, x, 3, 23 Let i = -10.8 - -6.8. Let k = 4 + -4. Sort k, i, 0.04 in ascending order. i, k, 0.04 Let h be (-28)/(-21)151 + 1. Sort 5, 2, 3, h in increasing order. 2, 3, 5, h Suppose 0 = 5m + 4l - 53, -2l - 3l = -4m + 26. Sort -4, 0, m, -1 in decreasing order. m, 0, -1, -4 Let x(k) = k3 - 37k*2 + 57. Let w be x(37). Sort 1, w, 0 in descending order. w, 1, 0 Let q = 8 - 27. Sort q, -5, 3, -1 in ascending order. q, -5, -1, 3 Let l = 0.477 + 0.023. Let k be 12/30 + 21/(-15). Suppose 16 = 5v + 3y, -4v + y + 26 = -y. Sort v, k, l in descending order. v, l, k Let r = -379 + 380. Let x(d) = -d - 5. Let h be x(-10). Sort -4, 0, h, r. -4, 0, r, h Let q be ((-37)/(-222))/((-1)/(-3)). Sort q, -2/7, -0.0127. -2/7, -0.0127, q Let k = 163 + -158. Suppose 2u = ku - 9. Sort -3, -5, -1, u in increasing order. -5, -3, -1, u Suppose -o = 2x - 68, 4o + 4x = -o + 334. Let y = o + -74. Sort -4, y, 4. y, -4, 4 Let h(j) = 2j*3 + 21j*2 - 6j + 69. Let n be h(-11). Let g be 2/3 - 4/(-3). Put n, g, 3 in descending order. n, 3, g Let d = 17.75 - -0.25. Let o = -17.79 + d. Let w = 6.21 - o. Sort w, -1, 0.2 in decreasing order. w, 0.2, -1 Let m be (-10)/(-65) + 126/26 - 3. Put m, 4, -4, 6 in decreasing order. 6, 4, m, -4 Let d = 0.8 - 0.4. Let b = 696 - 697. Sort -0.03, b, d, 5 in decreasing order. 5, d, -0.03, b Let q = -1902/19 - -100. Let g = 2 + -8. Put q, g, 1/5 in decreasing order. 1/5, q, g Let n(s) = s*2 + 6s + 2. Let k be n(-6). Let a(j) = -5 + 7j2 - j3 + 3j - 3j. Let i be a(7). Put 0, k, i in descending order. k, 0, i Let o = -760 - -452. Put 1, -5, o, 2 in descending order. 2, 1, -5, o Suppose -79c - 48 = 347. Put 3, c, 5, 8 in increasing order. c, 3, 5, 8 Let o = 2 - -1. Let k = -215 - -149. Let h be (-11)/k8/2. Put o, 4/5, h in descending order. o, 4/5, h Suppose -3 = s - 0s, 5w + s + 13 = 0. Put w, 46, 2, -3 in increasing order. -3, w, 2, 46 Let a = 0.5 - 0. Let v = 0.2 - a. Let h = 3161/171 + -347/19. Sort v, 0.2, h. v, 0.2, h Let l be (-1 + 34)4/84-2. Let d = l + 23/7. Put 4, d, -1 in ascending order. -1, d, 4 Suppose -2r - 12t = -7t - 11, 5r = 2t - 16. Sort -1, r, 4, 9 in ascending order. r, -1, 4, 9 Let p = -917 - -920. Sort 1, -3, p, -20 in descending order. p, 1, -3, -20 Let o be 3/(1/(-44)(-168)/(-28)). Sort 4, o, 8. o, 4, 8 Let n = -43 + 22. Let y = n + 6. Let c = -14.7 - y. Sort -1/7, c, -5 in descending order. c, -1/7, -5 Let g(i) = -i3 - i2 - 14i + 15. Let o be g(1). Let j be (-92)/22 + (-10)/(-55). Put -55, o, 4, j in descending order. 4, o, j, -55 Let r = 11671/21855 + -1/1457. Let l = 29011/34620 + -70/577. Let a = l + r. Put 2/13, 0.3, a in ascending order. 2/13, 0.3, a Let w = 6017 + -6017. Let d be ((-9)/6)/(3/(-4)). Sort -4, d, 5, w in descending order. 5, d, w, -4 Suppose w - 3m + 16 = -7, w = -m - 7. Let j = w - -15. Let o = 2 - 4. Sort j, 1, o in descending order. j, 1, o Let p = 11 + -32. Put -4, p, 1/4, 0.5 in ascending order. p, -4, 1/4, 0.5 Let w be (16/(-144)6)/(1 + 1). Sort 3, 13, w, -3. -3, w, 3, 13 Let j = 296 - 296.2. Sort j, -7, 0.1, 2. -7, j, 0.1, 2 Let l = 0.264 + -126.264. Let j = l + 131.9. Let m = j + -0.9. Put 2, -4, m in ascending order. -4, 2, m Let i(p) = -p*2 - 12p + 13. Let b be i(-12). Let n be (3/b)/(-6 - (-18)/4). Sort 0.3, 1, -1, n in decreasing order. 1, 0.3, n, -1 Let i = -146 - -142. Let g(d) be the third derivative of d5/60 + d4/3 - 7d3/6 + 3d*2. Let p be g(-9). Put p, i, 3 in decreasing order. 3, p, i Let b = 10 + -9.81. Put 0.5, b, 0.4 in ascending order. b, 0.4, 0.5 Let o(s) = s + 11. Let f = -2 - -9. Suppose 0 = -d - 0d - f. Let j be o(d). Put j, 3/4, 0.4 in descending order. j, 3/4, 0.4 Suppose 0 = -27z + 102 - 21. Suppose 2s - 7s = 15. Sort z, s, 12 in descending order. 12, z, s Let k = 8 - 5. Suppose 5i - 15 = -0r - 2r, -kr + 6 = 2i. Let t(o) = 5o - 35. Let x be t(6). Put i, 4, x in decreasing order. 4, i, x Let f = -2136 - -2141. Sort 12, f, 2, 1 in descending order. 12, f, 2, 1 Let m = -14 + 15. Let h = 654 + -644. Suppose 4w + 20 = 0, -50 = -2g + 5w - 15. Sort g, m, h. m, g, h Let b = -9 - -12. Let m be (-9 - b)/2 - -4. Sort 4, -5, m. -5, m, 4 Suppose 0 = -5k + k + 24. Suppose kx - 4x - 6 = 0. Sort -0.2, x, -2/3 in increasing order. -2/3, -0.2, x Suppose -151 = 34q - 15. Sort 3, -14, q. -14, q, 3 Let k = -60 + 68. Suppose -2t + 18 = -kt. Sort 3, -4, t, 0.2 in increasing order. -4, t, 0.2, 3 Let q = 3547/6 + -24841/42. Suppose 0m + 5o - 21 = -m, 0 = 3m + 4o - 19. Suppose -y = 2 - m. Put q, -4, y in ascending order. -4, y, q Let x be (18/45)/(1/(-5)-2). Sort x, 0.08, 0.11. 0.08, 0.11, x Let g(y) = 2y*2 - y - 1. Let f be g(-1). Let s(v) = -5 + v - 6 + f. Let m be s(8). Sort m, -5, 2 in increasing order. -5, m, 2 Suppose -s - 4 + 2 = 0. Let x be s/6 + 24/18. Sort 4, -1, x in increasing order. -1, x, 4 Let g be 4-1 - (-6)/3. Let z(x) = x. Let s be z(g). Sort -6, 0, s in ascending order. -6, s, 0 Let j = 15.73 - -0.37. Let n = -0.1 + j. Let x = n + -18. Put -1, -0.4, x in descending order. -0.4, -1, x Let r be 25/(-5 + 0) + (-2 - -6). Suppose 3x = 6x. Put 2, x, r, -2 in increasing order. -2, r, x, 2 Suppose -19w - 4 = -80. Put -2, w, 3, -7 in decreasing order. w, 3, -2, -7 Let k(f) = 2f*3 + 10f + 3f2 + 2f*2 - 3f3 - f2 + 7. Let n be k(6). Suppose -4j - 1 = 3. Sort j, 13, n in decreasing order. 13, j, n Let f = 415 - 261. Sort 4, f, 0 in descending order. f, 4, 0 Let v be 1 - -2 - (-16)/(-6). Let l = -1 + 10. Let z = -8 + l. Put z, -5, v in increasing order. -5, v, z Let n(l) = -l2 - 11l + 9. Let d be (117/(-26))/(2 - 13/8). Let k be n(d). Suppose 4f + 10 = 2f. Sort k, f, -1 in decreasing order. -1, k, f Let f be 55/(-8 - -3). Suppose -6s - 21 = -3s. Let t(b) = -b2 - 6b + 3. Let w be t(s). Put w, f, 2 in ascending order. f, w, 2 Let l = 116.2 + -115.28. Put l, -1, -2/3 in increasing order. -1, -2/3, l Let j = 136 + -136.4. Sort 1, -2, j, 0.01. -2, j, 0.01, 1 Suppose -18 = -0o - 2o. Let p be ((-27)/6)/((-5)/(-10)). Let d = -6 - p. Sort 0, d, o. 0, d, o Suppose 0 = 4w + w. Let h(z) = 2z*2 - 17z - 1. Let f be h(8). Let u(m) = m*2 + 10m + 11. Let q be u(f). Put q, w, 3 in decreasing order. 3, q, w Let q = -0.06 - 0. Let b = 2.94 - q. Let u = -2 + 1. Sort u, b, -4 in ascending order. -4, u, b Let z = -53 + 93. Let r be 5/(z/(-26)) + (-9)/12. Let j = -2 + 7. Put r, j, 6 in descending order. 6, j, r Let o = 3.38 - -1.62. Sort -11, -0.3, o in ascending order. -11, -0.3, o Let x = 7 - 5. Suppose -4l + 3 = -5r, 0r = r + 3. Suppose 18h + 22 + 14 = 0. Sort x, l, h in decreasing order. x, h, l Let l = 15.5 + 0.5. Let u = -9 + l. Let b = u - 7.2. Put 2, b, 3 in descending order. 3, 2, b Suppose 70 + 2 = 18b. Sort -3/2, 2, 1, b in descending order. b, 2, 1, -3/2 Let l be ((-6)/(-4))/(1/(4/3)). Suppose -ln + 13 = -3m, n + n + 2m = 8. Sort 0, -1, -3, n. -3, -1, 0, n Let n(q) = -2	{ "pile_set_name": "DM Mathematics" }
est common factor of 30 and y? 10 Let j = -7 + 10. Let d be (j + 6)(-6 - -7). Suppose 0 = -5r + d + 11. Calculate the greatest common divisor of r and 12. 4 Let d = 1 - -4. Suppose 0 = 2s - 2a - 18, -ds + 2a + 51 = 0. Let z be ((-3)/(-2))/((-3)/(-198)). Calculate the greatest common divisor of s and z. 11 Suppose -z + 5z - 32 = 0. Let g be -2-7(2 - 1). Let j be (-4)/g + (-452)/(-14). What is the greatest common factor of z and j? 8 Let l(y) = y2 + 6y - 15. Suppose 5a - 5f = -90, -12 - 24 = 2a + f. Let m be a/4(3 + -1). Let p be l(m). Calculate the highest common factor of p and 12. 12 Let n be (125 + -4)/((-8)/(-32)). What is the highest common factor of n and 22? 22 Let b be ((-1)/2)/(1/(-12)). Suppose -77 + 329 = 6z. What is the greatest common divisor of b and z? 6 Let y(x) = 4x + 6. Let o be y(-2). Let z be o/(-8) - (-58)/(-8). Let k = z - -11. What is the greatest common divisor of k and 8? 4 Suppose -s = 2i + 1, 4s + 4i = 3i + 17. Suppose 0 = 4d + d - x - 22, sd = 2x + 19. What is the highest common divisor of d and 85? 5 Suppose 0 = 85p - 90p + 285. Calculate the greatest common factor of p and 3. 3 Let v(k) = k3 - 4k*2 + 3. Let t be v(4). Let l(c) = -2c*3 + 9c*2 + 24c + 3. Let m be l(6). What is the greatest common factor of t and m? 3 Let a(t) = -5t - 31. Let q be a(-8). Let z = 57 - 30. Calculate the greatest common divisor of z and q. 9 Let f = 12 + -5. Suppose 5n = 37 - f. Suppose -233 - 397 = -15a. What is the greatest common divisor of n and a? 6 Suppose 0 = -i - 5, r + 2i = 5r - 74. Let u(v) = v3 - v. Let q be u(-1). Suppose 5f - 13 - 7 = q. What is the highest common factor of r and f? 4 Let k = 5 + -3. Suppose 9 = ko - p, -5o - p + 18 = p. Let t be 8/(-4) - -4 - -6. What is the highest common factor of o and t? 4 Suppose 2x - 5w + 2w = 0, x = -3w. Suppose o - 21 = -3r, xr - 5o + 28 = 4r. Suppose 46 - 270 = -4j. Calculate the highest common factor of j and r. 7 Suppose -5z - i = -35, -i + 5i = -4z + 12. Calculate the highest common factor of z and 40. 8 Suppose 2x - 197 = -15o + 16o, -x + 3o + 101 = 0. What is the highest common divisor of x and 476? 14 Let y(d) = -124d - 5. Let c be y(-1). Calculate the greatest common divisor of 34 and c. 17 Suppose -21 - 34 = -5h. Let t(f) = 2f2 - 12f + 4. Let p be t(6). Suppose -5l + 11 = -pl. Calculate the highest common factor of l and h. 11 Suppose f - 9 = 7. Suppose 0 = -5y + 44 + f. Suppose -3m + 2m + y = 0. Calculate the greatest common factor of 12 and m. 12 Let w(b) = -b2 - 28b + 5. Let i be w(-23). Suppose -5x + 3x = j - 64, 2j - 4x = i. What is the highest common factor of 93 and j? 31 Let i(w) = -36w + 63. Let q be i(5). Let x = q + 147. Calculate the highest common divisor of x and 15. 15 Suppose -13a = 28a - 1640. What is the greatest common divisor of a and 15? 5 Suppose -108 = -3l + h, -5h + 126 = 3l - 0l. Calculate the greatest common divisor of l and 592. 37 Let t = -223 + 370. Calculate the highest common divisor of t and 42. 21 Let h(w) = 3w*3 - 11w*2 + 7 - 2w*3 + 10w - 2. Let x be h(10). Suppose xg - 22 = 8. What is the greatest common factor of g and 6? 6 Suppose -36s - 30 = -41s. What is the highest common divisor of 156 and s? 6 Suppose 0 = -o - 2k - 2, 3k - 1 + 4 = -2o. Suppose r = -3v - 191, -v - 3r - 77 = -ov. Let a = v - -95. What is the greatest common factor of 11 and a? 11 Suppose 18 - 7 = g. Suppose 129 = 3b - 102. What is the highest common divisor of g and b? 11 Let f be -9(-20)/84/6. Let d(g) = -g*2 + 6g + 7. Let z be d(8). Let i(x) = 3x2 + 13x + 9. Let k be i(z). What is the greatest common factor of k and f? 15 Let q = 1275 - 1161. Calculate the greatest common factor of q and 2622. 114 Let u be 14 - 12 - (-565)/5. What is the greatest common factor of u and 2990? 115 Suppose -428 - 692 = -14w. Calculate the greatest common divisor of w and 20. 20 Suppose -2t - 3f = -4t + 1, 0 = -5t - 2f + 31. Suppose -2u - 56 = -76. Suppose 0 = -v - v + u. What is the highest common divisor of t and v? 5 Suppose -k + 4q = -0q + 11, 7 = -k + 3q. Suppose -ky + 934 = -91. Suppose -2c = -y - 257. What is the greatest common divisor of 33 and c? 33 Suppose 0 = -1481y + 1486y - 4485. What is the greatest common factor of y and 13? 13 Let r = 10 + -8. Suppose -25 = rx - 7x. Let p(y) = y + 18. Let o be p(-8). Calculate the greatest common divisor of o and x. 5 Suppose -o - o = 8, 2k + 2o = 346. Suppose -51 = -3i + k. Suppose 5f - 99 = -n, 4f + n + 6 = 86. Calculate the highest common divisor of f and i. 19 Let j be (-11)/(-3) + -4 + 242/6. Let u be (1 - 4/2)0. Let i = j + u. What is the greatest common factor of i and 16? 8 Suppose 0 = 3c - 4c + 202. What is the highest common factor of 1313 and c? 101 Let s = -820 + 798. Suppose 3g - 72 = 4k, -3g + 120 = 2g - 3k. Let r = g + s. What is the highest common factor of 16 and r? 2 Let w = 7 + -5. Let t be ((-1)/w)/((-5)/70). Calculate the greatest common factor of t and 1. 1 Let p(n) be the third derivative of -41n4/24 - n3/3 - 9n2. Let y be p(-1). What is the highest common factor of y and 13? 13 Let a be 2/3 + (-21)/(-9). Suppose ac + 2c = 135. Calculate the greatest common factor of c and 3. 3 Let t be ((-10)/(-4))/((-9)/(-18)). Suppose ts + 0s = 440. Calculate the highest common divisor of s and 11. 11 Let w(s) be the first derivative of s3/3 - s2/2 - 11. Let y be w(9). Suppose 3u - 6u = -24. What is the highest common factor of u and y? 8 Suppose -5c - 2t = -2862, 0 = -2t + 5t - 3. Calculate the highest common factor of 156 and c. 52 Let w(l) = -l + 24. Let u(i) = 2i - 23. Let m(z) = 3u(z) + 4w(z). Let n be m(-13). Calculate the greatest common factor of 7 and n. 1 Suppose -6d - 27 = -7d. Calculate the greatest common divisor of d and 63. 9 Suppose -40b + 60 = -20b. What is the greatest common divisor of b and 141? 3 Suppose 0 = 2n + 6, -2o + n = -2n - 531. Suppose 4q + f = 351, -5f - 96 = -4q + o. What is the greatest common factor of 220 and q? 44 Let s be -1 + 382/4. Suppose 2q + 450 = 4m, -5m + 273 + 302 = -5q. Let a = m - 65. What is the greatest common divisor of s and a? 9 Suppose 3d + 3j - 1336 = 5j, 4d - 1770 = -3j. Suppose 2i - d = -i. Suppose 3v - 281 = i. Calculate the greatest common factor of v and 13. 13 Let x(p) = 322p2 + 2p + 8. Let f be x(-2). What is the highest common divisor of f and 68? 68 Let z = 2122 + -2111. Suppose 51 = v - 70. Calculate the greatest common factor of z and v. 11 Suppose 5o - 3679 = -8o. Suppose 2g = -4d + 230, 0 = 5d + 2g - g - o. Let y = 73 - 45. Calculate the highest common factor of y and d. 28 Let q = 255 - 171. Suppose 4z = q - 24. Calculate the greatest common factor of 165 and z. 15 Let h = -307 + 442. What is the highest common factor of h and 180? 45 Let i(h) = -h3 - 3h*2 - 13h - 10. Let w be i(-5). Calculate the greatest common divisor of w and 175. 35 Let y = 59 + -55. Let s(h) be the third derivative of -h*4/24 - 2h3/3 - h2. Let g be s(-6). What is the greatest common factor of y and g? 2 Let f = -5851 - -5866. Let k(o) = -4o3 - 5o*2 + 3o + 1. Let u be k(-4). Calculate the greatest common divisor of f and u. 15 Let p(y) = 23y + 123. Let o be p(11). Calculate the highest common divisor of 47 and o. 47 Let a be 76/(7/(924/6)) - -2. What is the greatest common divisor of a and 62? 62 Let d = -25 - -66. Let j(x) = x2 + 2x - 22. Let u be j(7). Calculate the highest common factor of u and d. 41 Let a = 271 + -235. Calculate the greatest common factor of 132 and a. 12 Let b = 964 - 722. Calculate the greatest common factor of b and 1089. 121 Let h be (-144)/(-30)110. Calculate the highest common factor of 24 and h. 24 Let n = -391 - -511. What is the greatest common factor of n and 15? 15 Let u(d) = 2d2 + 2d - 5. Let a(i) = i*3 + 3i*2 - 4i + 3. Let j be a(-4). Let z be u(j). Calculate the highest common divisor of z and 209. 19 Suppose -3y + 8 - 2 = 0. Suppose -yj = 4j - 6. Let k be (j - -2)/(2/22). What is the highest common divisor of 22 and k? 11 Suppose 0k - 8 = 2k, 0 = 3a + 5k + 20. Let g be a + (-195)/(-4 - -1). Let r be -21 - 1*-28. Ca	{ "pile_set_name": "DM Mathematics" }

Subsets and Splits

No community queries yet

The top public SQL queries from the community will appear here once available.