instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_50>.
CC(C)(C)OC(=O)N1CCC(CN)CC12CCC2
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCC(CN)CC12CCC2
<BB_50>
What is the molecular formula for <BB_50>?
The molecular formula for <BB_50> (CC(C)(C)OC(=O)N1CCC(CN)CC12CCC2) is C14H26N2O2.
Describe the ring structures in building block <BB_50>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 4.
List the primary functional groups present in <BB_50>.
The molecule contains the following groups: Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_50>.
**Token:** <BB_50> **SMILES:** CC(C)(C)OC(=O)N1CCC(CN)CC12CCC2 **Molecular Formula:** C14H26N2O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_51>.
Clc1ccc2ncc(I)n2n1
What is the building block token for the following molecule?
Clc1ccc2ncc(I)n2n1
<BB_51>
What is the molecular formula for <BB_51>?
The molecular formula for <BB_51> (Clc1ccc2ncc(I)n2n1) is C6H3ClIN3.
Describe the ring structures in building block <BB_51>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_51>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_51>.
**Token:** <BB_51> **SMILES:** Clc1ccc2ncc(I)n2n1 **Molecular Formula:** C6H3ClIN3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_52>.
COc1cccc2c1CCCNC2=O
What is the building block token for the following molecule?
COc1cccc2c1CCCNC2=O
<BB_52>
What is the molecular formula for <BB_52>?
The molecular formula for <BB_52> (COc1cccc2c1CCCNC2=O) is C11H13NO2.
Describe the ring structures in building block <BB_52>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 7.
List the primary functional groups present in <BB_52>.
The molecule contains the following groups: Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_52>.
**Token:** <BB_52> **SMILES:** COc1cccc2c1CCCNC2=O **Molecular Formula:** C11H13NO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 7. **Functional Groups:** Amide, Ether
Provide the SMILES representation for the building block token <BB_53>.
CC(C)(C(=O)O)c1c(F)cccc1Cl
What is the building block token for the following molecule?
CC(C)(C(=O)O)c1c(F)cccc1Cl
<BB_53>
What is the molecular formula for <BB_53>?
The molecular formula for <BB_53> (CC(C)(C(=O)O)c1c(F)cccc1Cl) is C10H10ClFO2.
Describe the ring structures in building block <BB_53>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_53>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_53>.
**Token:** <BB_53> **SMILES:** CC(C)(C(=O)O)c1c(F)cccc1Cl **Molecular Formula:** C10H10ClFO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_54>.
CC(C)C[C@@H](N)C(=O)OC(C)(C)C.Cl
What is the building block token for the following molecule?
CC(C)C[C@@H](N)C(=O)OC(C)(C)C.Cl
<BB_54>
What is the molecular formula for <BB_54>?
The molecular formula for <BB_54> (CC(C)C[C@@H](N)C(=O)OC(C)(C)C.Cl) is C10H22ClNO2.
Describe the ring structures in building block <BB_54>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_54>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_54>.
**Token:** <BB_54> **SMILES:** CC(C)C[C@@H](N)C(=O)OC(C)(C)C.Cl **Molecular Formula:** C10H22ClNO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_55>.
Cc1cccnc1CCCN
What is the building block token for the following molecule?
Cc1cccnc1CCCN
<BB_55>
What is the molecular formula for <BB_55>?
The molecular formula for <BB_55> (Cc1cccnc1CCCN) is C9H14N2.
Describe the ring structures in building block <BB_55>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_55>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_55>.
**Token:** <BB_55> **SMILES:** Cc1cccnc1CCCN **Molecular Formula:** C9H14N2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_56>.
CC1(C)CNCC2(CCCOC2)O1
What is the building block token for the following molecule?
CC1(C)CNCC2(CCCOC2)O1
<BB_56>
What is the molecular formula for <BB_56>?
The molecular formula for <BB_56> (CC1(C)CNCC2(CCCOC2)O1) is C10H19NO2.
Describe the ring structures in building block <BB_56>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_56>.
The molecule contains the following groups: Secondary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_56>.
**Token:** <BB_56> **SMILES:** CC1(C)CNCC2(CCCOC2)O1 **Molecular Formula:** C10H19NO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Ether
Provide the SMILES representation for the building block token <BB_57>.
COC(=O)C1(C(=O)OC)CCN1C(=O)OC(C)(C)C
What is the building block token for the following molecule?
COC(=O)C1(C(=O)OC)CCN1C(=O)OC(C)(C)C
<BB_57>
What is the molecular formula for <BB_57>?
The molecular formula for <BB_57> (COC(=O)C1(C(=O)OC)CCN1C(=O)OC(C)(C)C) is C12H19NO6.
Describe the ring structures in building block <BB_57>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_57>.
The molecule contains the following groups: Amide, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_57>.
**Token:** <BB_57> **SMILES:** COC(=O)C1(C(=O)OC)CCN1C(=O)OC(C)(C)C **Molecular Formula:** C12H19NO6 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Amide, Ester, Ether
Provide the SMILES representation for the building block token <BB_58>.
O=C(O)c1cc(OCc2ccccc2)cs1
What is the building block token for the following molecule?
O=C(O)c1cc(OCc2ccccc2)cs1
<BB_58>
What is the molecular formula for <BB_58>?
The molecular formula for <BB_58> (O=C(O)c1cc(OCc2ccccc2)cs1) is C12H10O3S.
Describe the ring structures in building block <BB_58>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_58>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_58>.
**Token:** <BB_58> **SMILES:** O=C(O)c1cc(OCc2ccccc2)cs1 **Molecular Formula:** C12H10O3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_59>.
COC(=O)c1cnc(OC)c(CN)c1.Cl
What is the building block token for the following molecule?
COC(=O)c1cnc(OC)c(CN)c1.Cl
<BB_59>
What is the molecular formula for <BB_59>?
The molecular formula for <BB_59> (COC(=O)c1cnc(OC)c(CN)c1.Cl) is C9H13ClN2O3.
Describe the ring structures in building block <BB_59>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_59>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_59>.
**Token:** <BB_59> **SMILES:** COC(=O)c1cnc(OC)c(CN)c1.Cl **Molecular Formula:** C9H13ClN2O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_60>.
CCOc1ccc(-n2nnc3cnc(Cl)nc32)cc1
What is the building block token for the following molecule?
CCOc1ccc(-n2nnc3cnc(Cl)nc32)cc1
<BB_60>
What is the molecular formula for <BB_60>?
The molecular formula for <BB_60> (CCOc1ccc(-n2nnc3cnc(Cl)nc32)cc1) is C12H10ClN5O.
Describe the ring structures in building block <BB_60>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_60>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_60>.
**Token:** <BB_60> **SMILES:** CCOc1ccc(-n2nnc3cnc(Cl)nc32)cc1 **Molecular Formula:** C12H10ClN5O **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_61>.
CC12CC3(C)CC(C)(C1)CC(CN)(C2)C3.Cl
What is the building block token for the following molecule?
CC12CC3(C)CC(C)(C1)CC(CN)(C2)C3.Cl
<BB_61>
What is the molecular formula for <BB_61>?
The molecular formula for <BB_61> (CC12CC3(C)CC(C)(C1)CC(CN)(C2)C3.Cl) is C14H26ClN.
Describe the ring structures in building block <BB_61>.
The molecule contains 4 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_61>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_61>.
**Token:** <BB_61> **SMILES:** CC12CC3(C)CC(C)(C1)CC(CN)(C2)C3.Cl **Molecular Formula:** C14H26ClN **Ring System:** The molecule contains 4 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_62>.
O=Cc1cc(C(F)(F)F)c(F)cc1Br
What is the building block token for the following molecule?
O=Cc1cc(C(F)(F)F)c(F)cc1Br
<BB_62>
What is the molecular formula for <BB_62>?
The molecular formula for <BB_62> (O=Cc1cc(C(F)(F)F)c(F)cc1Br) is C8H3BrF4O.
Describe the ring structures in building block <BB_62>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_62>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_62>.
**Token:** <BB_62> **SMILES:** O=Cc1cc(C(F)(F)F)c(F)cc1Br **Molecular Formula:** C8H3BrF4O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_63>.
COC(=O)c1cnc(O)c2c1NCCC2
What is the building block token for the following molecule?
COC(=O)c1cnc(O)c2c1NCCC2
<BB_63>
What is the molecular formula for <BB_63>?
The molecular formula for <BB_63> (COC(=O)c1cnc(O)c2c1NCCC2) is C10H12N2O3.
Describe the ring structures in building block <BB_63>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_63>.
The molecule contains the following groups: Secondary Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_63>.
**Token:** <BB_63> **SMILES:** COC(=O)c1cnc(O)c2c1NCCC2 **Molecular Formula:** C10H12N2O3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_64>.
CN(C)Cc1cccc(C(=O)O)c1.Cl
What is the building block token for the following molecule?
CN(C)Cc1cccc(C(=O)O)c1.Cl
<BB_64>
What is the molecular formula for <BB_64>?
The molecular formula for <BB_64> (CN(C)Cc1cccc(C(=O)O)c1.Cl) is C10H14ClNO2.
Describe the ring structures in building block <BB_64>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_64>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_64>.
**Token:** <BB_64> **SMILES:** CN(C)Cc1cccc(C(=O)O)c1.Cl **Molecular Formula:** C10H14ClNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_65>.
Oc1cc(F)c2[nH]ccc2c1
What is the building block token for the following molecule?
Oc1cc(F)c2[nH]ccc2c1
<BB_65>
What is the molecular formula for <BB_65>?
The molecular formula for <BB_65> (Oc1cc(F)c2[nH]ccc2c1) is C8H6FNO.
Describe the ring structures in building block <BB_65>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_65>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_65>.
**Token:** <BB_65> **SMILES:** Oc1cc(F)c2[nH]ccc2c1 **Molecular Formula:** C8H6FNO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_66>.
Cn1c(I)c(C#N)c(=O)n(C)c1=O
What is the building block token for the following molecule?
Cn1c(I)c(C#N)c(=O)n(C)c1=O
<BB_66>
What is the molecular formula for <BB_66>?
The molecular formula for <BB_66> (Cn1c(I)c(C#N)c(=O)n(C)c1=O) is C7H6IN3O2.
Describe the ring structures in building block <BB_66>.
The molecule contains 1 ring(s): an aromatic ring of size 6.