instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_83>?
The molecular formula for <BB_83> (O=C([O-])c1nc(C2CC2)cs1.[Na+]) is C7H6NNaO2S.
Describe the ring structures in building block <BB_83>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_83>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_83>.
**Token:** <BB_83> **SMILES:** O=C([O-])c1nc(C2CC2)cs1.[Na+] **Molecular Formula:** C7H6NNaO2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_84>.
Cl.NC1CCCC(C2CC2)C1
What is the building block token for the following molecule?
Cl.NC1CCCC(C2CC2)C1
<BB_84>
What is the molecular formula for <BB_84>?
The molecular formula for <BB_84> (Cl.NC1CCCC(C2CC2)C1) is C9H18ClN.
Describe the ring structures in building block <BB_84>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_84>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_84>.
**Token:** <BB_84> **SMILES:** Cl.NC1CCCC(C2CC2)C1 **Molecular Formula:** C9H18ClN **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_85>.
CC(=O)c1ccc(Cl)c(F)c1
What is the building block token for the following molecule?
CC(=O)c1ccc(Cl)c(F)c1
<BB_85>
What is the molecular formula for <BB_85>?
The molecular formula for <BB_85> (CC(=O)c1ccc(Cl)c(F)c1) is C8H6ClFO.
Describe the ring structures in building block <BB_85>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_85>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_85>.
**Token:** <BB_85> **SMILES:** CC(=O)c1ccc(Cl)c(F)c1 **Molecular Formula:** C8H6ClFO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_86>.
CC1C(C(=O)O)CCN1c1cnn(C)c1.Cl.Cl
What is the building block token for the following molecule?
CC1C(C(=O)O)CCN1c1cnn(C)c1.Cl.Cl
<BB_86>
What is the molecular formula for <BB_86>?
The molecular formula for <BB_86> (CC1C(C(=O)O)CCN1c1cnn(C)c1.Cl.Cl) is C10H17Cl2N3O2.
Describe the ring structures in building block <BB_86>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_86>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_86>.
**Token:** <BB_86> **SMILES:** CC1C(C(=O)O)CCN1c1cnn(C)c1.Cl.Cl **Molecular Formula:** C10H17Cl2N3O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_87>.
COc1cccc(O)c1OCCN.Cl
What is the building block token for the following molecule?
COc1cccc(O)c1OCCN.Cl
<BB_87>
What is the molecular formula for <BB_87>?
The molecular formula for <BB_87> (COc1cccc(O)c1OCCN.Cl) is C9H14ClNO3.
Describe the ring structures in building block <BB_87>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_87>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_87>.
**Token:** <BB_87> **SMILES:** COc1cccc(O)c1OCCN.Cl **Molecular Formula:** C9H14ClNO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_88>.
CCOCCCS
What is the building block token for the following molecule?
CCOCCCS
<BB_88>
What is the molecular formula for <BB_88>?
The molecular formula for <BB_88> (CCOCCCS) is C5H12OS.
Describe the ring structures in building block <BB_88>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_88>.
The molecule contains the following groups: Ether, Thiol.
Provide a comprehensive chemical profile for the building block <BB_88>.
**Token:** <BB_88> **SMILES:** CCOCCCS **Molecular Formula:** C5H12OS **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ether, Thiol
Provide the SMILES representation for the building block token <BB_89>.
OCc1nnc2ccccc2n1
What is the building block token for the following molecule?
OCc1nnc2ccccc2n1
<BB_89>
What is the molecular formula for <BB_89>?
The molecular formula for <BB_89> (OCc1nnc2ccccc2n1) is C8H7N3O.
Describe the ring structures in building block <BB_89>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_89>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_89>.
**Token:** <BB_89> **SMILES:** OCc1nnc2ccccc2n1 **Molecular Formula:** C8H7N3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_90>.
Cc1ccc(CN)c(N2CCCC2)n1
What is the building block token for the following molecule?
Cc1ccc(CN)c(N2CCCC2)n1
<BB_90>
What is the molecular formula for <BB_90>?
The molecular formula for <BB_90> (Cc1ccc(CN)c(N2CCCC2)n1) is C11H17N3.
Describe the ring structures in building block <BB_90>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_90>.
The molecule contains the following groups: Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_90>.
**Token:** <BB_90> **SMILES:** Cc1ccc(CN)c(N2CCCC2)n1 **Molecular Formula:** C11H17N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_91>.
C#CCC1CCCCN1C
What is the building block token for the following molecule?
C#CCC1CCCCN1C
<BB_91>
What is the molecular formula for <BB_91>?
The molecular formula for <BB_91> (C#CCC1CCCCN1C) is C9H15N.
Describe the ring structures in building block <BB_91>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_91>.
The molecule contains the following groups: Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_91>.
**Token:** <BB_91> **SMILES:** C#CCC1CCCCN1C **Molecular Formula:** C9H15N **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Tertiary Amine
Provide the SMILES representation for the building block token <BB_92>.
O=C(O)c1cccnc1SCc1ccco1
What is the building block token for the following molecule?
O=C(O)c1cccnc1SCc1ccco1
<BB_92>
What is the molecular formula for <BB_92>?
The molecular formula for <BB_92> (O=C(O)c1cccnc1SCc1ccco1) is C11H9NO3S.
Describe the ring structures in building block <BB_92>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_92>.
The molecule contains the following groups: Carboxylic Acid, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_92>.
**Token:** <BB_92> **SMILES:** O=C(O)c1cccnc1SCc1ccco1 **Molecular Formula:** C11H9NO3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Sulfide
Provide the SMILES representation for the building block token <BB_93>.
CC(C)c1nccnc1Cl
What is the building block token for the following molecule?
CC(C)c1nccnc1Cl
<BB_93>
What is the molecular formula for <BB_93>?
The molecular formula for <BB_93> (CC(C)c1nccnc1Cl) is C7H9ClN2.
Describe the ring structures in building block <BB_93>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_93>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_93>.
**Token:** <BB_93> **SMILES:** CC(C)c1nccnc1Cl **Molecular Formula:** C7H9ClN2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_94>.
N#Cc1cc(Br)cc(I)c1
What is the building block token for the following molecule?
N#Cc1cc(Br)cc(I)c1
<BB_94>
What is the molecular formula for <BB_94>?
The molecular formula for <BB_94> (N#Cc1cc(Br)cc(I)c1) is C7H3BrIN.
Describe the ring structures in building block <BB_94>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_94>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_94>.
**Token:** <BB_94> **SMILES:** N#Cc1cc(Br)cc(I)c1 **Molecular Formula:** C7H3BrIN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_95>.
O=C(O)c1ccc2nn(C(F)F)cc2c1
What is the building block token for the following molecule?
O=C(O)c1ccc2nn(C(F)F)cc2c1
<BB_95>
What is the molecular formula for <BB_95>?
The molecular formula for <BB_95> (O=C(O)c1ccc2nn(C(F)F)cc2c1) is C9H6F2N2O2.
Describe the ring structures in building block <BB_95>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_95>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_95>.
**Token:** <BB_95> **SMILES:** O=C(O)c1ccc2nn(C(F)F)cc2c1 **Molecular Formula:** C9H6F2N2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_96>.
N#Cc1cccc(OCc2nc(C(=O)O)cs2)c1
What is the building block token for the following molecule?
N#Cc1cccc(OCc2nc(C(=O)O)cs2)c1
<BB_96>
What is the molecular formula for <BB_96>?
The molecular formula for <BB_96> (N#Cc1cccc(OCc2nc(C(=O)O)cs2)c1) is C12H8N2O3S.
Describe the ring structures in building block <BB_96>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_96>.
The molecule contains the following groups: Carboxylic Acid, Ether, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_96>.
**Token:** <BB_96> **SMILES:** N#Cc1cccc(OCc2nc(C(=O)O)cs2)c1 **Molecular Formula:** C12H8N2O3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Ether, Nitrile
Provide the SMILES representation for the building block token <BB_97>.
CC(Oc1ccc(Cl)cc1C1CCCCC1)C(=O)O
What is the building block token for the following molecule?
CC(Oc1ccc(Cl)cc1C1CCCCC1)C(=O)O
<BB_97>
What is the molecular formula for <BB_97>?
The molecular formula for <BB_97> (CC(Oc1ccc(Cl)cc1C1CCCCC1)C(=O)O) is C15H19ClO3.
Describe the ring structures in building block <BB_97>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_97>.
The molecule contains the following groups: Carboxylic Acid, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_97>.
**Token:** <BB_97> **SMILES:** CC(Oc1ccc(Cl)cc1C1CCCCC1)C(=O)O **Molecular Formula:** C15H19ClO3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_98>.
CC1(CC2CO2)CCCO1
What is the building block token for the following molecule?
CC1(CC2CO2)CCCO1
<BB_98>
What is the molecular formula for <BB_98>?
The molecular formula for <BB_98> (CC1(CC2CO2)CCCO1) is C8H14O2.
Describe the ring structures in building block <BB_98>.
The molecule contains 2 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 5.
List the primary functional groups present in <BB_98>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_98>.
**Token:** <BB_98> **SMILES:** CC1(CC2CO2)CCCO1 **Molecular Formula:** C8H14O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 3, an aliphatic ring of size 5. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_99>.
CC1COc2cc(C(=O)O)ccc21
What is the building block token for the following molecule?
CC1COc2cc(C(=O)O)ccc21
<BB_99>
What is the molecular formula for <BB_99>?
The molecular formula for <BB_99> (CC1COc2cc(C(=O)O)ccc21) is C10H10O3.
Describe the ring structures in building block <BB_99>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_99>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_99>.
**Token:** <BB_99> **SMILES:** CC1COc2cc(C(=O)O)ccc21 **Molecular Formula:** C10H10O3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether