instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_66>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_66>.
**Token:** <BB_66> **SMILES:** Cn1c(I)c(C#N)c(=O)n(C)c1=O **Molecular Formula:** C7H6IN3O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_67>.
Cc1ccc(S(=O)(=O)NCC2CCCCC2)cc1
What is the building block token for the following molecule?
Cc1ccc(S(=O)(=O)NCC2CCCCC2)cc1
<BB_67>
What is the molecular formula for <BB_67>?
The molecular formula for <BB_67> (Cc1ccc(S(=O)(=O)NCC2CCCCC2)cc1) is C14H21NO2S.
Describe the ring structures in building block <BB_67>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_67>.
The molecule contains the following groups: Secondary Amine, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_67>.
**Token:** <BB_67> **SMILES:** Cc1ccc(S(=O)(=O)NCC2CCCCC2)cc1 **Molecular Formula:** C14H21NO2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Sulfonamide
Provide the SMILES representation for the building block token <BB_68>.
Cc1ccc(NC(=N)N)c(C)c1
What is the building block token for the following molecule?
Cc1ccc(NC(=N)N)c(C)c1
<BB_68>
What is the molecular formula for <BB_68>?
The molecular formula for <BB_68> (Cc1ccc(NC(=N)N)c(C)c1) is C9H13N3.
Describe the ring structures in building block <BB_68>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_68>.
The molecule contains the following groups: Amine, Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_68>.
**Token:** <BB_68> **SMILES:** Cc1ccc(NC(=N)N)c(C)c1 **Molecular Formula:** C9H13N3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine
Provide the SMILES representation for the building block token <BB_69>.
Cl.NCc1c[nH]c(=O)c2ccccc12
What is the building block token for the following molecule?
Cl.NCc1c[nH]c(=O)c2ccccc12
<BB_69>
What is the molecular formula for <BB_69>?
The molecular formula for <BB_69> (Cl.NCc1c[nH]c(=O)c2ccccc12) is C10H11ClN2O.
Describe the ring structures in building block <BB_69>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_69>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_69>.
**Token:** <BB_69> **SMILES:** Cl.NCc1c[nH]c(=O)c2ccccc12 **Molecular Formula:** C10H11ClN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_70>.
C[N+](C)(C)COCN=[N+]=[N-].[Cl-]
What is the building block token for the following molecule?
C[N+](C)(C)COCN=[N+]=[N-].[Cl-]
<BB_70>
What is the molecular formula for <BB_70>?
The molecular formula for <BB_70> (C[N+](C)(C)COCN=[N+]=[N-].[Cl-]) is C5H13ClN4O.
Describe the ring structures in building block <BB_70>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_70>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_70>.
**Token:** <BB_70> **SMILES:** C[N+](C)(C)COCN=[N+]=[N-].[Cl-] **Molecular Formula:** C5H13ClN4O **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_71>.
CC(C)C(=O)c1ccc2c(c1)CCCC2
What is the building block token for the following molecule?
CC(C)C(=O)c1ccc2c(c1)CCCC2
<BB_71>
What is the molecular formula for <BB_71>?
The molecular formula for <BB_71> (CC(C)C(=O)c1ccc2c(c1)CCCC2) is C14H18O.
Describe the ring structures in building block <BB_71>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_71>.
The molecule contains the following groups: Ketone.
Provide a comprehensive chemical profile for the building block <BB_71>.
**Token:** <BB_71> **SMILES:** CC(C)C(=O)c1ccc2c(c1)CCCC2 **Molecular Formula:** C14H18O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Ketone
Provide the SMILES representation for the building block token <BB_72>.
Clc1nccc2c(Cl)nccc12
What is the building block token for the following molecule?
Clc1nccc2c(Cl)nccc12
<BB_72>
What is the molecular formula for <BB_72>?
The molecular formula for <BB_72> (Clc1nccc2c(Cl)nccc12) is C8H4Cl2N2.
Describe the ring structures in building block <BB_72>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_72>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_72>.
**Token:** <BB_72> **SMILES:** Clc1nccc2c(Cl)nccc12 **Molecular Formula:** C8H4Cl2N2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_73>.
CN1C[C@H](OC(C)(C)C)C[C@H]1C(=O)O
What is the building block token for the following molecule?
CN1C[C@H](OC(C)(C)C)C[C@H]1C(=O)O
<BB_73>
What is the molecular formula for <BB_73>?
The molecular formula for <BB_73> (CN1C[C@H](OC(C)(C)C)C[C@H]1C(=O)O) is C10H19NO3.
Describe the ring structures in building block <BB_73>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_73>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_73>.
**Token:** <BB_73> **SMILES:** CN1C[C@H](OC(C)(C)C)C[C@H]1C(=O)O **Molecular Formula:** C10H19NO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Tertiary Amine, Ether
Provide the SMILES representation for the building block token <BB_74>.
CCNC(CC)c1ccccc1
What is the building block token for the following molecule?
CCNC(CC)c1ccccc1
<BB_74>
What is the molecular formula for <BB_74>?
The molecular formula for <BB_74> (CCNC(CC)c1ccccc1) is C11H17N.
Describe the ring structures in building block <BB_74>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_74>.
The molecule contains the following groups: Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_74>.
**Token:** <BB_74> **SMILES:** CCNC(CC)c1ccccc1 **Molecular Formula:** C11H17N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Secondary Amine
Provide the SMILES representation for the building block token <BB_75>.
Nc1cccc(NC(=O)CO)c1
What is the building block token for the following molecule?
Nc1cccc(NC(=O)CO)c1
<BB_75>
What is the molecular formula for <BB_75>?
The molecular formula for <BB_75> (Nc1cccc(NC(=O)CO)c1) is C8H10N2O2.
Describe the ring structures in building block <BB_75>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_75>.
The molecule contains the following groups: Amine, Amide, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_75>.
**Token:** <BB_75> **SMILES:** Nc1cccc(NC(=O)CO)c1 **Molecular Formula:** C8H10N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Amide, Alcohol
Provide the SMILES representation for the building block token <BB_76>.
c1ccc(-c2cnn(C3CCNCC3)c2)cc1
What is the building block token for the following molecule?
c1ccc(-c2cnn(C3CCNCC3)c2)cc1
<BB_76>
What is the molecular formula for <BB_76>?
The molecular formula for <BB_76> (c1ccc(-c2cnn(C3CCNCC3)c2)cc1) is C14H17N3.
Describe the ring structures in building block <BB_76>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_76>.
The molecule contains the following groups: Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_76>.
**Token:** <BB_76> **SMILES:** c1ccc(-c2cnn(C3CCNCC3)c2)cc1 **Molecular Formula:** C14H17N3 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine
Provide the SMILES representation for the building block token <BB_77>.
CN(C)c1ccc(F)cc1O
What is the building block token for the following molecule?
CN(C)c1ccc(F)cc1O
<BB_77>
What is the molecular formula for <BB_77>?
The molecular formula for <BB_77> (CN(C)c1ccc(F)cc1O) is C8H10FNO.
Describe the ring structures in building block <BB_77>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_77>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_77>.
**Token:** <BB_77> **SMILES:** CN(C)c1ccc(F)cc1O **Molecular Formula:** C8H10FNO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_78>.
CCOC(=O)Cn1ccc(N)n1
What is the building block token for the following molecule?
CCOC(=O)Cn1ccc(N)n1
<BB_78>
What is the molecular formula for <BB_78>?
The molecular formula for <BB_78> (CCOC(=O)Cn1ccc(N)n1) is C7H11N3O2.
Describe the ring structures in building block <BB_78>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_78>.
The molecule contains the following groups: Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_78>.
**Token:** <BB_78> **SMILES:** CCOC(=O)Cn1ccc(N)n1 **Molecular Formula:** C7H11N3O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_79>.
OB(O)c1cccc(CC(F)F)c1
What is the building block token for the following molecule?
OB(O)c1cccc(CC(F)F)c1
<BB_79>
What is the molecular formula for <BB_79>?
The molecular formula for <BB_79> (OB(O)c1cccc(CC(F)F)c1) is C8H9BF2O2.
Describe the ring structures in building block <BB_79>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_79>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_79>.
**Token:** <BB_79> **SMILES:** OB(O)c1cccc(CC(F)F)c1 **Molecular Formula:** C8H9BF2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_80>.
O=C(O)Cc1cc(Cl)cc2c1OCOC2
What is the building block token for the following molecule?
O=C(O)Cc1cc(Cl)cc2c1OCOC2
<BB_80>
What is the molecular formula for <BB_80>?
The molecular formula for <BB_80> (O=C(O)Cc1cc(Cl)cc2c1OCOC2) is C10H9ClO4.
Describe the ring structures in building block <BB_80>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_80>.
The molecule contains the following groups: Carboxylic Acid, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_80>.
**Token:** <BB_80> **SMILES:** O=C(O)Cc1cc(Cl)cc2c1OCOC2 **Molecular Formula:** C10H9ClO4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_81>.
CCCNC(=O)CN1CCNCC1
What is the building block token for the following molecule?
CCCNC(=O)CN1CCNCC1
<BB_81>
What is the molecular formula for <BB_81>?
The molecular formula for <BB_81> (CCCNC(=O)CN1CCNCC1) is C9H19N3O.
Describe the ring structures in building block <BB_81>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_81>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_81>.
**Token:** <BB_81> **SMILES:** CCCNC(=O)CN1CCNCC1 **Molecular Formula:** C9H19N3O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Amide
Provide the SMILES representation for the building block token <BB_82>.
CCOC(=O)CC(C)NC
What is the building block token for the following molecule?
CCOC(=O)CC(C)NC
<BB_82>
What is the molecular formula for <BB_82>?
The molecular formula for <BB_82> (CCOC(=O)CC(C)NC) is C7H15NO2.
Describe the ring structures in building block <BB_82>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_82>.
The molecule contains the following groups: Secondary Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_82>.
**Token:** <BB_82> **SMILES:** CCOC(=O)CC(C)NC **Molecular Formula:** C7H15NO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Secondary Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_83>.
O=C([O-])c1nc(C2CC2)cs1.[Na+]
What is the building block token for the following molecule?
O=C([O-])c1nc(C2CC2)cs1.[Na+]
<BB_83>