instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_8950>.
O=C(O)c1ccc2ncc(Br)n2c1
What is the building block token for the following molecule?
O=C(O)c1ccc2ncc(Br)n2c1
<BB_8950>
What is the molecular formula for <BB_8950>?
The molecular formula for <BB_8950> (O=C(O)c1ccc2ncc(Br)n2c1) is C8H5BrN2O2.
Describe the ring structures in building block <BB_8950>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_8950>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_8950>.
**Token:** <BB_8950> **SMILES:** O=C(O)c1ccc2ncc(Br)n2c1 **Molecular Formula:** C8H5BrN2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_8951>.
C#Cc1cccnc1F
What is the building block token for the following molecule?
C#Cc1cccnc1F
<BB_8951>
What is the molecular formula for <BB_8951>?
The molecular formula for <BB_8951> (C#Cc1cccnc1F) is C7H4FN.
Describe the ring structures in building block <BB_8951>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_8951>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_8951>.
**Token:** <BB_8951> **SMILES:** C#Cc1cccnc1F **Molecular Formula:** C7H4FN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_8952>.
O=S(=O)(Cl)Cc1ccn(CC(F)(F)F)n1
What is the building block token for the following molecule?
O=S(=O)(Cl)Cc1ccn(CC(F)(F)F)n1
<BB_8952>
What is the molecular formula for <BB_8952>?
The molecular formula for <BB_8952> (O=S(=O)(Cl)Cc1ccn(CC(F)(F)F)n1) is C6H6ClF3N2O2S.
Describe the ring structures in building block <BB_8952>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_8952>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_8952>.
**Token:** <BB_8952> **SMILES:** O=S(=O)(Cl)Cc1ccn(CC(F)(F)F)n1 **Molecular Formula:** C6H6ClF3N2O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_8953>.
CN(C[C@H]1C[C@@H](O)C1)C(=O)OC(C)(C)C
What is the building block token for the following molecule?
CN(C[C@H]1C[C@@H](O)C1)C(=O)OC(C)(C)C
<BB_8953>
What is the molecular formula for <BB_8953>?
The molecular formula for <BB_8953> (CN(C[C@H]1C[C@@H](O)C1)C(=O)OC(C)(C)C) is C11H21NO3.
Describe the ring structures in building block <BB_8953>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_8953>.
The molecule contains the following groups: Amide, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_8953>.
**Token:** <BB_8953> **SMILES:** CN(C[C@H]1C[C@@H](O)C1)C(=O)OC(C)(C)C **Molecular Formula:** C11H21NO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Amide, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_8954>.
Cl.Cn1ncc(N)c1C(F)F
What is the building block token for the following molecule?
Cl.Cn1ncc(N)c1C(F)F
<BB_8954>
What is the molecular formula for <BB_8954>?
The molecular formula for <BB_8954> (Cl.Cn1ncc(N)c1C(F)F) is C5H8ClF2N3.
Describe the ring structures in building block <BB_8954>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_8954>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_8954>.
**Token:** <BB_8954> **SMILES:** Cl.Cn1ncc(N)c1C(F)F **Molecular Formula:** C5H8ClF2N3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_8955>.
Nc1ccccc1I
What is the building block token for the following molecule?
Nc1ccccc1I
<BB_8955>
What is the molecular formula for <BB_8955>?
The molecular formula for <BB_8955> (Nc1ccccc1I) is C6H6IN.
Describe the ring structures in building block <BB_8955>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_8955>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_8955>.
**Token:** <BB_8955> **SMILES:** Nc1ccccc1I **Molecular Formula:** C6H6IN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_8956>.
COC(=O)c1ccc(Br)c2c1OCO2
What is the building block token for the following molecule?
COC(=O)c1ccc(Br)c2c1OCO2
<BB_8956>
What is the molecular formula for <BB_8956>?
The molecular formula for <BB_8956> (COC(=O)c1ccc(Br)c2c1OCO2) is C9H7BrO4.
Describe the ring structures in building block <BB_8956>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_8956>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_8956>.
**Token:** <BB_8956> **SMILES:** COC(=O)c1ccc(Br)c2c1OCO2 **Molecular Formula:** C9H7BrO4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_8957>.
Cl.O=C(O)[C@H]1CO[C@@H](C(F)(F)F)CN1
What is the building block token for the following molecule?
Cl.O=C(O)[C@H]1CO[C@@H](C(F)(F)F)CN1
<BB_8957>
What is the molecular formula for <BB_8957>?
The molecular formula for <BB_8957> (Cl.O=C(O)[C@H]1CO[C@@H](C(F)(F)F)CN1) is C6H9ClF3NO3.
Describe the ring structures in building block <BB_8957>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_8957>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_8957>.
**Token:** <BB_8957> **SMILES:** Cl.O=C(O)[C@H]1CO[C@@H](C(F)(F)F)CN1 **Molecular Formula:** C6H9ClF3NO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_8958>.
NNC(=O)c1ccc(COc2ccccc2)cc1
What is the building block token for the following molecule?
NNC(=O)c1ccc(COc2ccccc2)cc1
<BB_8958>
What is the molecular formula for <BB_8958>?
The molecular formula for <BB_8958> (NNC(=O)c1ccc(COc2ccccc2)cc1) is C14H14N2O2.
Describe the ring structures in building block <BB_8958>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_8958>.
The molecule contains the following groups: Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_8958>.
**Token:** <BB_8958> **SMILES:** NNC(=O)c1ccc(COc2ccccc2)cc1 **Molecular Formula:** C14H14N2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_8959>.
CC1CCc2[nH]c(=O)c(C#N)cc2C1
What is the building block token for the following molecule?
CC1CCc2[nH]c(=O)c(C#N)cc2C1
<BB_8959>
What is the molecular formula for <BB_8959>?
The molecular formula for <BB_8959> (CC1CCc2[nH]c(=O)c(C#N)cc2C1) is C11H12N2O.
Describe the ring structures in building block <BB_8959>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_8959>.
The molecule contains the following groups: Nitrile.
Provide a comprehensive chemical profile for the building block <BB_8959>.
**Token:** <BB_8959> **SMILES:** CC1CCc2[nH]c(=O)c(C#N)cc2C1 **Molecular Formula:** C11H12N2O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Nitrile
Provide the SMILES representation for the building block token <BB_8960>.
COc1ccc2sc(C)nc2c1
What is the building block token for the following molecule?
COc1ccc2sc(C)nc2c1
<BB_8960>
What is the molecular formula for <BB_8960>?
The molecular formula for <BB_8960> (COc1ccc2sc(C)nc2c1) is C9H9NOS.
Describe the ring structures in building block <BB_8960>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_8960>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_8960>.
**Token:** <BB_8960> **SMILES:** COc1ccc2sc(C)nc2c1 **Molecular Formula:** C9H9NOS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_8961>.
C=CC(=O)c1ccc(F)cc1
What is the building block token for the following molecule?
C=CC(=O)c1ccc(F)cc1
<BB_8961>
What is the molecular formula for <BB_8961>?
The molecular formula for <BB_8961> (C=CC(=O)c1ccc(F)cc1) is C9H7FO.
Describe the ring structures in building block <BB_8961>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_8961>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_8961>.
**Token:** <BB_8961> **SMILES:** C=CC(=O)c1ccc(F)cc1 **Molecular Formula:** C9H7FO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_8962>.
Nc1ncccc1OCC1CC(F)(F)C1
What is the building block token for the following molecule?
Nc1ncccc1OCC1CC(F)(F)C1
<BB_8962>
What is the molecular formula for <BB_8962>?
The molecular formula for <BB_8962> (Nc1ncccc1OCC1CC(F)(F)C1) is C10H12F2N2O.
Describe the ring structures in building block <BB_8962>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4.
List the primary functional groups present in <BB_8962>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_8962>.
**Token:** <BB_8962> **SMILES:** Nc1ncccc1OCC1CC(F)(F)C1 **Molecular Formula:** C10H12F2N2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_8963>.
Fc1c(Br)c(Cl)cc2c(Cl)nc(Cl)nc12
What is the building block token for the following molecule?
Fc1c(Br)c(Cl)cc2c(Cl)nc(Cl)nc12
<BB_8963>
What is the molecular formula for <BB_8963>?
The molecular formula for <BB_8963> (Fc1c(Br)c(Cl)cc2c(Cl)nc(Cl)nc12) is C8HBrCl3FN2.
Describe the ring structures in building block <BB_8963>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_8963>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_8963>.
**Token:** <BB_8963> **SMILES:** Fc1c(Br)c(Cl)cc2c(Cl)nc(Cl)nc12 **Molecular Formula:** C8HBrCl3FN2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_8964>.
COC(=O)c1ccc(O)c(C(C)=O)c1
What is the building block token for the following molecule?
COC(=O)c1ccc(O)c(C(C)=O)c1
<BB_8964>
What is the molecular formula for <BB_8964>?
The molecular formula for <BB_8964> (COC(=O)c1ccc(O)c(C(C)=O)c1) is C10H10O4.
Describe the ring structures in building block <BB_8964>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_8964>.
The molecule contains the following groups: Ester, Ketone, Ether.
Provide a comprehensive chemical profile for the building block <BB_8964>.
**Token:** <BB_8964> **SMILES:** COC(=O)c1ccc(O)c(C(C)=O)c1 **Molecular Formula:** C10H10O4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ketone, Ether
Provide the SMILES representation for the building block token <BB_8965>.
COC(=O)C1CC(C(=O)O)N1.Cl
What is the building block token for the following molecule?
COC(=O)C1CC(C(=O)O)N1.Cl
<BB_8965>
What is the molecular formula for <BB_8965>?
The molecular formula for <BB_8965> (COC(=O)C1CC(C(=O)O)N1.Cl) is C6H10ClNO4.
Describe the ring structures in building block <BB_8965>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_8965>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_8965>.
**Token:** <BB_8965> **SMILES:** COC(=O)C1CC(C(=O)O)N1.Cl **Molecular Formula:** C6H10ClNO4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Carboxylic Acid, Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_8966>.
Cn1nc(C=O)c2c1CCC(C)(C)C2
What is the building block token for the following molecule?
Cn1nc(C=O)c2c1CCC(C)(C)C2
<BB_8966>
What is the molecular formula for <BB_8966>?
The molecular formula for <BB_8966> (Cn1nc(C=O)c2c1CCC(C)(C)C2) is C11H16N2O.
Describe the ring structures in building block <BB_8966>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.