instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_8983>?
The molecular formula for <BB_8983> (COC(=O)c1ccc(Cl)c(CC(=O)O)c1) is C10H9ClO4.
Describe the ring structures in building block <BB_8983>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_8983>.
The molecule contains the following groups: Carboxylic Acid, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_8983>.
**Token:** <BB_8983> **SMILES:** COC(=O)c1ccc(Cl)c(CC(=O)O)c1 **Molecular Formula:** C10H9ClO4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_8984>.
Fc1cc(F)c(CS)c(F)c1
What is the building block token for the following molecule?
Fc1cc(F)c(CS)c(F)c1
<BB_8984>
What is the molecular formula for <BB_8984>?
The molecular formula for <BB_8984> (Fc1cc(F)c(CS)c(F)c1) is C7H5F3S.
Describe the ring structures in building block <BB_8984>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_8984>.
The molecule contains the following groups: Thiol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_8984>.
**Token:** <BB_8984> **SMILES:** Fc1cc(F)c(CS)c(F)c1 **Molecular Formula:** C7H5F3S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Thiol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_8985>.
CCC1=NOC(C)(C(=O)O)C1
What is the building block token for the following molecule?
CCC1=NOC(C)(C(=O)O)C1
<BB_8985>
What is the molecular formula for <BB_8985>?
The molecular formula for <BB_8985> (CCC1=NOC(C)(C(=O)O)C1) is C7H11NO3.
Describe the ring structures in building block <BB_8985>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_8985>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_8985>.
**Token:** <BB_8985> **SMILES:** CCC1=NOC(C)(C(=O)O)C1 **Molecular Formula:** C7H11NO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_8986>.
Cl.O=C(O)c1ccc2c(c1)COCCN2
What is the building block token for the following molecule?
Cl.O=C(O)c1ccc2c(c1)COCCN2
<BB_8986>
What is the molecular formula for <BB_8986>?
The molecular formula for <BB_8986> (Cl.O=C(O)c1ccc2c(c1)COCCN2) is C10H12ClNO3.
Describe the ring structures in building block <BB_8986>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 7.
List the primary functional groups present in <BB_8986>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_8986>.
**Token:** <BB_8986> **SMILES:** Cl.O=C(O)c1ccc2c(c1)COCCN2 **Molecular Formula:** C10H12ClNO3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 7. **Functional Groups:** Carboxylic Acid, Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_8987>.
Oc1ccc2c(c1)OC(F)(F)O2
What is the building block token for the following molecule?
Oc1ccc2c(c1)OC(F)(F)O2
<BB_8987>
What is the molecular formula for <BB_8987>?
The molecular formula for <BB_8987> (Oc1ccc2c(c1)OC(F)(F)O2) is C7H4F2O3.
Describe the ring structures in building block <BB_8987>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_8987>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_8987>.
**Token:** <BB_8987> **SMILES:** Oc1ccc2c(c1)OC(F)(F)O2 **Molecular Formula:** C7H4F2O3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_8988>.
[N-]=[N+]=Nc1cccc(C(F)(F)F)c1F
What is the building block token for the following molecule?
[N-]=[N+]=Nc1cccc(C(F)(F)F)c1F
<BB_8988>
What is the molecular formula for <BB_8988>?
The molecular formula for <BB_8988> ([N-]=[N+]=Nc1cccc(C(F)(F)F)c1F) is C7H3F4N3.
Describe the ring structures in building block <BB_8988>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_8988>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_8988>.
**Token:** <BB_8988> **SMILES:** [N-]=[N+]=Nc1cccc(C(F)(F)F)c1F **Molecular Formula:** C7H3F4N3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_8989>.
Cl.FC(F)(F)c1ccnc(C2CCCN2)n1
What is the building block token for the following molecule?
Cl.FC(F)(F)c1ccnc(C2CCCN2)n1
<BB_8989>
What is the molecular formula for <BB_8989>?
The molecular formula for <BB_8989> (Cl.FC(F)(F)c1ccnc(C2CCCN2)n1) is C9H11ClF3N3.
Describe the ring structures in building block <BB_8989>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_8989>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_8989>.
**Token:** <BB_8989> **SMILES:** Cl.FC(F)(F)c1ccnc(C2CCCN2)n1 **Molecular Formula:** C9H11ClF3N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_8990>.
COC(=O)c1ccc2c(c1)CCN2.Cl
What is the building block token for the following molecule?
COC(=O)c1ccc2c(c1)CCN2.Cl
<BB_8990>
What is the molecular formula for <BB_8990>?
The molecular formula for <BB_8990> (COC(=O)c1ccc2c(c1)CCN2.Cl) is C10H12ClNO2.
Describe the ring structures in building block <BB_8990>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_8990>.
The molecule contains the following groups: Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_8990>.
**Token:** <BB_8990> **SMILES:** COC(=O)c1ccc2c(c1)CCN2.Cl **Molecular Formula:** C10H12ClNO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_8991>.
CCOC(=O)c1conc1CN=[N+]=[N-]
What is the building block token for the following molecule?
CCOC(=O)c1conc1CN=[N+]=[N-]
<BB_8991>
What is the molecular formula for <BB_8991>?
The molecular formula for <BB_8991> (CCOC(=O)c1conc1CN=[N+]=[N-]) is C7H8N4O3.
Describe the ring structures in building block <BB_8991>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_8991>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_8991>.
**Token:** <BB_8991> **SMILES:** CCOC(=O)c1conc1CN=[N+]=[N-] **Molecular Formula:** C7H8N4O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_8992>.
C1CNCC2(C1)CCSC2.Cl
What is the building block token for the following molecule?
C1CNCC2(C1)CCSC2.Cl
<BB_8992>
What is the molecular formula for <BB_8992>?
The molecular formula for <BB_8992> (C1CNCC2(C1)CCSC2.Cl) is C8H16ClNS.
Describe the ring structures in building block <BB_8992>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_8992>.
The molecule contains the following groups: Secondary Amine, Sulfide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_8992>.
**Token:** <BB_8992> **SMILES:** C1CNCC2(C1)CCSC2.Cl **Molecular Formula:** C8H16ClNS **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Sulfide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_8993>.
CN(C)c1ccc2c(c1)NC(=O)C2
What is the building block token for the following molecule?
CN(C)c1ccc2c(c1)NC(=O)C2
<BB_8993>
What is the molecular formula for <BB_8993>?
The molecular formula for <BB_8993> (CN(C)c1ccc2c(c1)NC(=O)C2) is C10H12N2O.
Describe the ring structures in building block <BB_8993>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_8993>.
The molecule contains the following groups: Tertiary Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_8993>.
**Token:** <BB_8993> **SMILES:** CN(C)c1ccc2c(c1)NC(=O)C2 **Molecular Formula:** C10H12N2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Tertiary Amine, Amide
Provide the SMILES representation for the building block token <BB_8994>.
Cl.Cn1cncc1CCC(=O)O
What is the building block token for the following molecule?
Cl.Cn1cncc1CCC(=O)O
<BB_8994>
What is the molecular formula for <BB_8994>?
The molecular formula for <BB_8994> (Cl.Cn1cncc1CCC(=O)O) is C7H11ClN2O2.
Describe the ring structures in building block <BB_8994>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_8994>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_8994>.
**Token:** <BB_8994> **SMILES:** Cl.Cn1cncc1CCC(=O)O **Molecular Formula:** C7H11ClN2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_8995>.
CC(=O)O[C@@H]1CC[C@H]1Br
What is the building block token for the following molecule?
CC(=O)O[C@@H]1CC[C@H]1Br
<BB_8995>
What is the molecular formula for <BB_8995>?
The molecular formula for <BB_8995> (CC(=O)O[C@@H]1CC[C@H]1Br) is C6H9BrO2.
Describe the ring structures in building block <BB_8995>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_8995>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_8995>.
**Token:** <BB_8995> **SMILES:** CC(=O)O[C@@H]1CC[C@H]1Br **Molecular Formula:** C6H9BrO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_8996>.
Cc1cc(C(N)=S)ccn1
What is the building block token for the following molecule?
Cc1cc(C(N)=S)ccn1
<BB_8996>
What is the molecular formula for <BB_8996>?
The molecular formula for <BB_8996> (Cc1cc(C(N)=S)ccn1) is C7H8N2S.
Describe the ring structures in building block <BB_8996>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_8996>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_8996>.
**Token:** <BB_8996> **SMILES:** Cc1cc(C(N)=S)ccn1 **Molecular Formula:** C7H8N2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_8997>.
NS(=O)(=O)CCc1ccc2c(c1)CCO2
What is the building block token for the following molecule?
NS(=O)(=O)CCc1ccc2c(c1)CCO2
<BB_8997>
What is the molecular formula for <BB_8997>?
The molecular formula for <BB_8997> (NS(=O)(=O)CCc1ccc2c(c1)CCO2) is C10H13NO3S.
Describe the ring structures in building block <BB_8997>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_8997>.
The molecule contains the following groups: Amine, Ether, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_8997>.
**Token:** <BB_8997> **SMILES:** NS(=O)(=O)CCc1ccc2c(c1)CCO2 **Molecular Formula:** C10H13NO3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amine, Ether, Sulfonamide
Provide the SMILES representation for the building block token <BB_8998>.
CON1CCC(=O)CC1
What is the building block token for the following molecule?
CON1CCC(=O)CC1
<BB_8998>
What is the molecular formula for <BB_8998>?
The molecular formula for <BB_8998> (CON1CCC(=O)CC1) is C6H11NO2.
Describe the ring structures in building block <BB_8998>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_8998>.
The molecule contains the following groups: Tertiary Amine, Ketone.
Provide a comprehensive chemical profile for the building block <BB_8998>.
**Token:** <BB_8998> **SMILES:** CON1CCC(=O)CC1 **Molecular Formula:** C6H11NO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Tertiary Amine, Ketone
Provide the SMILES representation for the building block token <BB_8999>.
CCn1c(NC)cc(=O)[nH]c1=O
What is the building block token for the following molecule?
CCn1c(NC)cc(=O)[nH]c1=O
<BB_8999>
What is the molecular formula for <BB_8999>?
The molecular formula for <BB_8999> (CCn1c(NC)cc(=O)[nH]c1=O) is C7H11N3O2.
Describe the ring structures in building block <BB_8999>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_8999>.
The molecule contains the following groups: Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_8999>.
**Token:** <BB_8999> **SMILES:** CCn1c(NC)cc(=O)[nH]c1=O **Molecular Formula:** C7H11N3O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Secondary Amine