instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_9016>.
The molecule contains the following groups: Amine, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_9016>.
**Token:** <BB_9016> **SMILES:** Nc1ccc2c(S(N)(=O)=O)cccc2c1 **Molecular Formula:** C10H10N2O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Sulfonamide
Provide the SMILES representation for the building block token <BB_9017>.
C=C(CO)c1ccc(Br)cc1
What is the building block token for the following molecule?
C=C(CO)c1ccc(Br)cc1
<BB_9017>
What is the molecular formula for <BB_9017>?
The molecular formula for <BB_9017> (C=C(CO)c1ccc(Br)cc1) is C9H9BrO.
Describe the ring structures in building block <BB_9017>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9017>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9017>.
**Token:** <BB_9017> **SMILES:** C=C(CO)c1ccc(Br)cc1 **Molecular Formula:** C9H9BrO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9018>.
O=c1[nH]ccc2occc12
What is the building block token for the following molecule?
O=c1[nH]ccc2occc12
<BB_9018>
What is the molecular formula for <BB_9018>?
The molecular formula for <BB_9018> (O=c1[nH]ccc2occc12) is C7H5NO2.
Describe the ring structures in building block <BB_9018>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9018>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_9018>.
**Token:** <BB_9018> **SMILES:** O=c1[nH]ccc2occc12 **Molecular Formula:** C7H5NO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_9019>.
CC(C)(C)OC(=O)CCC1(N)CCC1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)CCC1(N)CCC1
<BB_9019>
What is the molecular formula for <BB_9019>?
The molecular formula for <BB_9019> (CC(C)(C)OC(=O)CCC1(N)CCC1) is C11H21NO2.
Describe the ring structures in building block <BB_9019>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_9019>.
The molecule contains the following groups: Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_9019>.
**Token:** <BB_9019> **SMILES:** CC(C)(C)OC(=O)CCC1(N)CCC1 **Molecular Formula:** C11H21NO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_9020>.
COCCCC(N)C(=O)N(C)C.Cl
What is the building block token for the following molecule?
COCCCC(N)C(=O)N(C)C.Cl
<BB_9020>
What is the molecular formula for <BB_9020>?
The molecular formula for <BB_9020> (COCCCC(N)C(=O)N(C)C.Cl) is C8H19ClN2O2.
Describe the ring structures in building block <BB_9020>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9020>.
The molecule contains the following groups: Amine, Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9020>.
**Token:** <BB_9020> **SMILES:** COCCCC(N)C(=O)N(C)C.Cl **Molecular Formula:** C8H19ClN2O2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9021>.
Cl.N#Cc1ccccc1CNC1CCCC1
What is the building block token for the following molecule?
Cl.N#Cc1ccccc1CNC1CCCC1
<BB_9021>
What is the molecular formula for <BB_9021>?
The molecular formula for <BB_9021> (Cl.N#Cc1ccccc1CNC1CCCC1) is C13H17ClN2.
Describe the ring structures in building block <BB_9021>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9021>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_9021>.
**Token:** <BB_9021> **SMILES:** Cl.N#Cc1ccccc1CNC1CCCC1 **Molecular Formula:** C13H17ClN2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_9022>.
CCN1CCc2c(Cl)cccc2C1C
What is the building block token for the following molecule?
CCN1CCc2c(Cl)cccc2C1C
<BB_9022>
What is the molecular formula for <BB_9022>?
The molecular formula for <BB_9022> (CCN1CCc2c(Cl)cccc2C1C) is C12H16ClN.
Describe the ring structures in building block <BB_9022>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9022>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9022>.
**Token:** <BB_9022> **SMILES:** CCN1CCc2c(Cl)cccc2C1C **Molecular Formula:** C12H16ClN **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9023>.
O=C(Cl)CCN1C(=O)C=CC1=O
What is the building block token for the following molecule?
O=C(Cl)CCN1C(=O)C=CC1=O
<BB_9023>
What is the molecular formula for <BB_9023>?
The molecular formula for <BB_9023> (O=C(Cl)CCN1C(=O)C=CC1=O) is C7H6ClNO3.
Describe the ring structures in building block <BB_9023>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_9023>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9023>.
**Token:** <BB_9023> **SMILES:** O=C(Cl)CCN1C(=O)C=CC1=O **Molecular Formula:** C7H6ClNO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9024>.
O=C(O)c1cnc2[nH]c(=O)[nH]c2n1
What is the building block token for the following molecule?
O=C(O)c1cnc2[nH]c(=O)[nH]c2n1
<BB_9024>
What is the molecular formula for <BB_9024>?
The molecular formula for <BB_9024> (O=C(O)c1cnc2[nH]c(=O)[nH]c2n1) is C6H4N4O3.
Describe the ring structures in building block <BB_9024>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9024>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_9024>.
**Token:** <BB_9024> **SMILES:** O=C(O)c1cnc2[nH]c(=O)[nH]c2n1 **Molecular Formula:** C6H4N4O3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_9025>.
FC(F)(F)C1NCCOc2ccccc21
What is the building block token for the following molecule?
FC(F)(F)C1NCCOc2ccccc21
<BB_9025>
What is the molecular formula for <BB_9025>?
The molecular formula for <BB_9025> (FC(F)(F)C1NCCOc2ccccc21) is C10H10F3NO.
Describe the ring structures in building block <BB_9025>.
The molecule contains 2 ring(s): an aliphatic ring of size 7, an aromatic ring of size 6.
List the primary functional groups present in <BB_9025>.
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9025>.
**Token:** <BB_9025> **SMILES:** FC(F)(F)C1NCCOc2ccccc21 **Molecular Formula:** C10H10F3NO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 7, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9026>.
CC(=O)CC1(O)CN(C(=O)OC(C)(C)C)C1
What is the building block token for the following molecule?
CC(=O)CC1(O)CN(C(=O)OC(C)(C)C)C1
<BB_9026>
What is the molecular formula for <BB_9026>?
The molecular formula for <BB_9026> (CC(=O)CC1(O)CN(C(=O)OC(C)(C)C)C1) is C11H19NO4.
Describe the ring structures in building block <BB_9026>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_9026>.
The molecule contains the following groups: Amide, Ketone, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_9026>.
**Token:** <BB_9026> **SMILES:** CC(=O)CC1(O)CN(C(=O)OC(C)(C)C)C1 **Molecular Formula:** C11H19NO4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Amide, Ketone, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_9027>.
NCc1ccc(S(=O)(=O)c2cccc(Cl)c2)cc1
What is the building block token for the following molecule?
NCc1ccc(S(=O)(=O)c2cccc(Cl)c2)cc1
<BB_9027>
What is the molecular formula for <BB_9027>?
The molecular formula for <BB_9027> (NCc1ccc(S(=O)(=O)c2cccc(Cl)c2)cc1) is C13H12ClNO2S.
Describe the ring structures in building block <BB_9027>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9027>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9027>.
**Token:** <BB_9027> **SMILES:** NCc1ccc(S(=O)(=O)c2cccc(Cl)c2)cc1 **Molecular Formula:** C13H12ClNO2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9028>.
Cc1n[nH]c(C)c1CC(C)N
What is the building block token for the following molecule?
Cc1n[nH]c(C)c1CC(C)N
<BB_9028>
What is the molecular formula for <BB_9028>?
The molecular formula for <BB_9028> (Cc1n[nH]c(C)c1CC(C)N) is C8H15N3.
Describe the ring structures in building block <BB_9028>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9028>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_9028>.
**Token:** <BB_9028> **SMILES:** Cc1n[nH]c(C)c1CC(C)N **Molecular Formula:** C8H15N3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_9029>.
CC(C)(C)OC(=O)N1CC=CC(C(=O)O)C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CC=CC(C(=O)O)C1
<BB_9029>
What is the molecular formula for <BB_9029>?
The molecular formula for <BB_9029> (CC(C)(C)OC(=O)N1CC=CC(C(=O)O)C1) is C11H17NO4.
Describe the ring structures in building block <BB_9029>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9029>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_9029>.
**Token:** <BB_9029> **SMILES:** CC(C)(C)OC(=O)N1CC=CC(C(=O)O)C1 **Molecular Formula:** C11H17NO4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide, Ether
Provide the SMILES representation for the building block token <BB_9030>.
COC(=O)c1cc2c(s1)CNC2.Cl
What is the building block token for the following molecule?
COC(=O)c1cc2c(s1)CNC2.Cl
<BB_9030>
What is the molecular formula for <BB_9030>?
The molecular formula for <BB_9030> (COC(=O)c1cc2c(s1)CNC2.Cl) is C8H10ClNO2S.
Describe the ring structures in building block <BB_9030>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9030>.
The molecule contains the following groups: Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9030>.
**Token:** <BB_9030> **SMILES:** COC(=O)c1cc2c(s1)CNC2.Cl **Molecular Formula:** C8H10ClNO2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9031>.
Cc1occc1-c1cc(N)n(CCO)n1
What is the building block token for the following molecule?
Cc1occc1-c1cc(N)n(CCO)n1
<BB_9031>
What is the molecular formula for <BB_9031>?
The molecular formula for <BB_9031> (Cc1occc1-c1cc(N)n(CCO)n1) is C10H13N3O2.
Describe the ring structures in building block <BB_9031>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_9031>.
The molecule contains the following groups: Amine, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_9031>.
**Token:** <BB_9031> **SMILES:** Cc1occc1-c1cc(N)n(CCO)n1 **Molecular Formula:** C10H13N3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** Amine, Alcohol
Provide the SMILES representation for the building block token <BB_9032>.
Cl.NCCNC(=O)c1ccc(-c2ccccc2)cc1
What is the building block token for the following molecule?
Cl.NCCNC(=O)c1ccc(-c2ccccc2)cc1
<BB_9032>
What is the molecular formula for <BB_9032>?
The molecular formula for <BB_9032> (Cl.NCCNC(=O)c1ccc(-c2ccccc2)cc1) is C15H17ClN2O.
Describe the ring structures in building block <BB_9032>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9032>.
The molecule contains the following groups: Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9032>.
**Token:** <BB_9032> **SMILES:** Cl.NCCNC(=O)c1ccc(-c2ccccc2)cc1 **Molecular Formula:** C15H17ClN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9033>.
O=Cc1c(F)c(Br)cc(Br)c1F
What is the building block token for the following molecule?
O=Cc1c(F)c(Br)cc(Br)c1F
<BB_9033>