instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_9983>?
The molecular formula for <BB_9983> (CC(C)(C)OC(=O)N1CCC[C@@H]1CCC(=O)O) is C12H21NO4.
Describe the ring structures in building block <BB_9983>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_9983>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_9983>.
**Token:** <BB_9983> **SMILES:** CC(C)(C)OC(=O)N1CCC[C@@H]1CCC(=O)O **Molecular Formula:** C12H21NO4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amide, Ether
Provide the SMILES representation for the building block token <BB_9984>.
Oc1ccc2c(c1)CCC2
What is the building block token for the following molecule?
Oc1ccc2c(c1)CCC2
<BB_9984>
What is the molecular formula for <BB_9984>?
The molecular formula for <BB_9984> (Oc1ccc2c(c1)CCC2) is C9H10O.
Describe the ring structures in building block <BB_9984>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9984>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_9984>.
**Token:** <BB_9984> **SMILES:** Oc1ccc2c(c1)CCC2 **Molecular Formula:** C9H10O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_9985>.
NC(=O)c1cc(Br)cc2ccccc12
What is the building block token for the following molecule?
NC(=O)c1cc(Br)cc2ccccc12
<BB_9985>
What is the molecular formula for <BB_9985>?
The molecular formula for <BB_9985> (NC(=O)c1cc(Br)cc2ccccc12) is C11H8BrNO.
Describe the ring structures in building block <BB_9985>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9985>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9985>.
**Token:** <BB_9985> **SMILES:** NC(=O)c1cc(Br)cc2ccccc12 **Molecular Formula:** C11H8BrNO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9986>.
Brc1ccc2cc[nH]c2c1
What is the building block token for the following molecule?
Brc1ccc2cc[nH]c2c1
<BB_9986>
What is the molecular formula for <BB_9986>?
The molecular formula for <BB_9986> (Brc1ccc2cc[nH]c2c1) is C8H6BrN.
Describe the ring structures in building block <BB_9986>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9986>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9986>.
**Token:** <BB_9986> **SMILES:** Brc1ccc2cc[nH]c2c1 **Molecular Formula:** C8H6BrN **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9987>.
O=C(O)c1ncn2c1C(=O)NCC2
What is the building block token for the following molecule?
O=C(O)c1ncn2c1C(=O)NCC2
<BB_9987>
What is the molecular formula for <BB_9987>?
The molecular formula for <BB_9987> (O=C(O)c1ncn2c1C(=O)NCC2) is C7H7N3O3.
Describe the ring structures in building block <BB_9987>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9987>.
The molecule contains the following groups: Carboxylic Acid, Amide.
Provide a comprehensive chemical profile for the building block <BB_9987>.
**Token:** <BB_9987> **SMILES:** O=C(O)c1ncn2c1C(=O)NCC2 **Molecular Formula:** C7H7N3O3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide
Provide the SMILES representation for the building block token <BB_9988>.
COC(=O)CCSCc1ccccc1OC
What is the building block token for the following molecule?
COC(=O)CCSCc1ccccc1OC
<BB_9988>
What is the molecular formula for <BB_9988>?
The molecular formula for <BB_9988> (COC(=O)CCSCc1ccccc1OC) is C12H16O3S.
Describe the ring structures in building block <BB_9988>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9988>.
The molecule contains the following groups: Ester, Ether, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_9988>.
**Token:** <BB_9988> **SMILES:** COC(=O)CCSCc1ccccc1OC **Molecular Formula:** C12H16O3S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ether, Sulfide
Provide the SMILES representation for the building block token <BB_9989>.
CC1(C)OB(C2COC2)OC1(C)C
What is the building block token for the following molecule?
CC1(C)OB(C2COC2)OC1(C)C
<BB_9989>
What is the molecular formula for <BB_9989>?
The molecular formula for <BB_9989> (CC1(C)OB(C2COC2)OC1(C)C) is C9H17BO3.
Describe the ring structures in building block <BB_9989>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 4.
List the primary functional groups present in <BB_9989>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_9989>.
**Token:** <BB_9989> **SMILES:** CC1(C)OB(C2COC2)OC1(C)C **Molecular Formula:** C9H17BO3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 4. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_9990>.
COC(=O)c1cc2ncc(S(C)(=O)=O)cn2n1
What is the building block token for the following molecule?
COC(=O)c1cc2ncc(S(C)(=O)=O)cn2n1
<BB_9990>
What is the molecular formula for <BB_9990>?
The molecular formula for <BB_9990> (COC(=O)c1cc2ncc(S(C)(=O)=O)cn2n1) is C9H9N3O4S.
Describe the ring structures in building block <BB_9990>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9990>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_9990>.
**Token:** <BB_9990> **SMILES:** COC(=O)c1cc2ncc(S(C)(=O)=O)cn2n1 **Molecular Formula:** C9H9N3O4S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_9991>.
N#Cc1csc(C(=O)O)c1
What is the building block token for the following molecule?
N#Cc1csc(C(=O)O)c1
<BB_9991>
What is the molecular formula for <BB_9991>?
The molecular formula for <BB_9991> (N#Cc1csc(C(=O)O)c1) is C6H3NO2S.
Describe the ring structures in building block <BB_9991>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9991>.
The molecule contains the following groups: Carboxylic Acid, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_9991>.
**Token:** <BB_9991> **SMILES:** N#Cc1csc(C(=O)O)c1 **Molecular Formula:** C6H3NO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Nitrile
Provide the SMILES representation for the building block token <BB_9992>.
Cc1c[nH]c(=O)nc1N
What is the building block token for the following molecule?
Cc1c[nH]c(=O)nc1N
<BB_9992>
What is the molecular formula for <BB_9992>?
The molecular formula for <BB_9992> (Cc1c[nH]c(=O)nc1N) is C5H7N3O.
Describe the ring structures in building block <BB_9992>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9992>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_9992>.
**Token:** <BB_9992> **SMILES:** Cc1c[nH]c(=O)nc1N **Molecular Formula:** C5H7N3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_9993>.
CCOC(=O)CC(=O)c1cc(F)c(F)c(F)c1F
What is the building block token for the following molecule?
CCOC(=O)CC(=O)c1cc(F)c(F)c(F)c1F
<BB_9993>
What is the molecular formula for <BB_9993>?
The molecular formula for <BB_9993> (CCOC(=O)CC(=O)c1cc(F)c(F)c(F)c1F) is C11H8F4O3.
Describe the ring structures in building block <BB_9993>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9993>.
The molecule contains the following groups: Ester, Ketone, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9993>.
**Token:** <BB_9993> **SMILES:** CCOC(=O)CC(=O)c1cc(F)c(F)c(F)c1F **Molecular Formula:** C11H8F4O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ketone, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9994>.
O=C(O)c1cc(C2CC2)[nH]n1
What is the building block token for the following molecule?
O=C(O)c1cc(C2CC2)[nH]n1
<BB_9994>
What is the molecular formula for <BB_9994>?
The molecular formula for <BB_9994> (O=C(O)c1cc(C2CC2)[nH]n1) is C7H8N2O2.
Describe the ring structures in building block <BB_9994>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_9994>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_9994>.
**Token:** <BB_9994> **SMILES:** O=C(O)c1cc(C2CC2)[nH]n1 **Molecular Formula:** C7H8N2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_9995>.
CNS(=O)(=O)CC1CCCNC1.Cl
What is the building block token for the following molecule?
CNS(=O)(=O)CC1CCCNC1.Cl
<BB_9995>
What is the molecular formula for <BB_9995>?
The molecular formula for <BB_9995> (CNS(=O)(=O)CC1CCCNC1.Cl) is C7H17ClN2O2S.
Describe the ring structures in building block <BB_9995>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9995>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_9995>.
**Token:** <BB_9995> **SMILES:** CNS(=O)(=O)CC1CCCNC1.Cl **Molecular Formula:** C7H17ClN2O2S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_9996>.
CC(C)(C)OC(=O)N1C[C@H](CN)O[C@@H]2CCC[C@H]21.Cl
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1C[C@H](CN)O[C@@H]2CCC[C@H]21.Cl
<BB_9996>
What is the molecular formula for <BB_9996>?
The molecular formula for <BB_9996> (CC(C)(C)OC(=O)N1C[C@H](CN)O[C@@H]2CCC[C@H]21.Cl) is C13H25ClN2O3.
Describe the ring structures in building block <BB_9996>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9996>.
The molecule contains the following groups: Amine, Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9996>.
**Token:** <BB_9996> **SMILES:** CC(C)(C)OC(=O)N1C[C@H](CN)O[C@@H]2CCC[C@H]21.Cl **Molecular Formula:** C13H25ClN2O3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amine, Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9997>.
CC(C)(C)OC(=O)N[C@@H](Cc1nccs1)C(=O)O
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N[C@@H](Cc1nccs1)C(=O)O
<BB_9997>
What is the molecular formula for <BB_9997>?
The molecular formula for <BB_9997> (CC(C)(C)OC(=O)N[C@@H](Cc1nccs1)C(=O)O) is C11H16N2O4S.
Describe the ring structures in building block <BB_9997>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9997>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_9997>.
**Token:** <BB_9997> **SMILES:** CC(C)(C)OC(=O)N[C@@H](Cc1nccs1)C(=O)O **Molecular Formula:** C11H16N2O4S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amide, Ether
Provide the SMILES representation for the building block token <BB_9998>.
CC(C(=O)O)N(C)C(=O)OC(C)(C)C
What is the building block token for the following molecule?
CC(C(=O)O)N(C)C(=O)OC(C)(C)C
<BB_9998>
What is the molecular formula for <BB_9998>?
The molecular formula for <BB_9998> (CC(C(=O)O)N(C)C(=O)OC(C)(C)C) is C9H17NO4.
Describe the ring structures in building block <BB_9998>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9998>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_9998>.
**Token:** <BB_9998> **SMILES:** CC(C(=O)O)N(C)C(=O)OC(C)(C)C **Molecular Formula:** C9H17NO4 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Amide, Ether
Provide the SMILES representation for the building block token <BB_9999>.
CCOC(=O)C=C(C)c1cccnc1
What is the building block token for the following molecule?
CCOC(=O)C=C(C)c1cccnc1
<BB_9999>
What is the molecular formula for <BB_9999>?
The molecular formula for <BB_9999> (CCOC(=O)C=C(C)c1cccnc1) is C11H13NO2.
Describe the ring structures in building block <BB_9999>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9999>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_9999>.
**Token:** <BB_9999> **SMILES:** CCOC(=O)C=C(C)c1cccnc1 **Molecular Formula:** C11H13NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ether