instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_9950>.
CC1(O)CCCCC12CCCCC2
What is the building block token for the following molecule?
CC1(O)CCCCC12CCCCC2
<BB_9950>
What is the molecular formula for <BB_9950>?
The molecular formula for <BB_9950> (CC1(O)CCCCC12CCCCC2) is C12H22O.
Describe the ring structures in building block <BB_9950>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9950>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_9950>.
**Token:** <BB_9950> **SMILES:** CC1(O)CCCCC12CCCCC2 **Molecular Formula:** C12H22O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_9951>.
COc1ccc(C(=O)O)cc1OC
What is the building block token for the following molecule?
COc1ccc(C(=O)O)cc1OC
<BB_9951>
What is the molecular formula for <BB_9951>?
The molecular formula for <BB_9951> (COc1ccc(C(=O)O)cc1OC) is C9H10O4.
Describe the ring structures in building block <BB_9951>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9951>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_9951>.
**Token:** <BB_9951> **SMILES:** COc1ccc(C(=O)O)cc1OC **Molecular Formula:** C9H10O4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_9952>.
CC1(C)OC2OCCC(=O)C2O1
What is the building block token for the following molecule?
CC1(C)OC2OCCC(=O)C2O1
<BB_9952>
What is the molecular formula for <BB_9952>?
The molecular formula for <BB_9952> (CC1(C)OC2OCCC(=O)C2O1) is C8H12O4.
Describe the ring structures in building block <BB_9952>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9952>.
The molecule contains the following groups: Ketone, Ether.
Provide a comprehensive chemical profile for the building block <BB_9952>.
**Token:** <BB_9952> **SMILES:** CC1(C)OC2OCCC(=O)C2O1 **Molecular Formula:** C8H12O4 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Ketone, Ether
Provide the SMILES representation for the building block token <BB_9953>.
CC(C)(CN)c1ccc(Br)cc1Cl
What is the building block token for the following molecule?
CC(C)(CN)c1ccc(Br)cc1Cl
<BB_9953>
What is the molecular formula for <BB_9953>?
The molecular formula for <BB_9953> (CC(C)(CN)c1ccc(Br)cc1Cl) is C10H13BrClN.
Describe the ring structures in building block <BB_9953>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9953>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9953>.
**Token:** <BB_9953> **SMILES:** CC(C)(CN)c1ccc(Br)cc1Cl **Molecular Formula:** C10H13BrClN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9954>.
CNCCc1ccc(Cl)s1.Cl
What is the building block token for the following molecule?
CNCCc1ccc(Cl)s1.Cl
<BB_9954>
What is the molecular formula for <BB_9954>?
The molecular formula for <BB_9954> (CNCCc1ccc(Cl)s1.Cl) is C7H11Cl2NS.
Describe the ring structures in building block <BB_9954>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9954>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9954>.
**Token:** <BB_9954> **SMILES:** CNCCc1ccc(Cl)s1.Cl **Molecular Formula:** C7H11Cl2NS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9955>.
O=C1C=CC(=O)C1
What is the building block token for the following molecule?
O=C1C=CC(=O)C1
<BB_9955>
What is the molecular formula for <BB_9955>?
The molecular formula for <BB_9955> (O=C1C=CC(=O)C1) is C5H4O2.
Describe the ring structures in building block <BB_9955>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_9955>.
The molecule contains the following groups: Ketone.
Provide a comprehensive chemical profile for the building block <BB_9955>.
**Token:** <BB_9955> **SMILES:** O=C1C=CC(=O)C1 **Molecular Formula:** C5H4O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Ketone
Provide the SMILES representation for the building block token <BB_9956>.
Cc1nnc(SCCN2CCOCC2)[nH]1.Cl
What is the building block token for the following molecule?
Cc1nnc(SCCN2CCOCC2)[nH]1.Cl
<BB_9956>
What is the molecular formula for <BB_9956>?
The molecular formula for <BB_9956> (Cc1nnc(SCCN2CCOCC2)[nH]1.Cl) is C9H17ClN4OS.
Describe the ring structures in building block <BB_9956>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9956>.
The molecule contains the following groups: Tertiary Amine, Ether, Sulfide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9956>.
**Token:** <BB_9956> **SMILES:** Cc1nnc(SCCN2CCOCC2)[nH]1.Cl **Molecular Formula:** C9H17ClN4OS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Tertiary Amine, Ether, Sulfide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9957>.
CC1(C)OB(C2=CCC(N)C2)OC1(C)C.Cl
What is the building block token for the following molecule?
CC1(C)OB(C2=CCC(N)C2)OC1(C)C.Cl
<BB_9957>
What is the molecular formula for <BB_9957>?
The molecular formula for <BB_9957> (CC1(C)OB(C2=CCC(N)C2)OC1(C)C.Cl) is C11H21BClNO2.
Describe the ring structures in building block <BB_9957>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9957>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9957>.
**Token:** <BB_9957> **SMILES:** CC1(C)OB(C2=CCC(N)C2)OC1(C)C.Cl **Molecular Formula:** C11H21BClNO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9958>.
COc1ccc(CS(C)(=O)=O)cc1N.Cl
What is the building block token for the following molecule?
COc1ccc(CS(C)(=O)=O)cc1N.Cl
<BB_9958>
What is the molecular formula for <BB_9958>?
The molecular formula for <BB_9958> (COc1ccc(CS(C)(=O)=O)cc1N.Cl) is C9H14ClNO3S.
Describe the ring structures in building block <BB_9958>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9958>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9958>.
**Token:** <BB_9958> **SMILES:** COc1ccc(CS(C)(=O)=O)cc1N.Cl **Molecular Formula:** C9H14ClNO3S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9959>.
COC(=O)CCN.Cl
What is the building block token for the following molecule?
COC(=O)CCN.Cl
<BB_9959>
What is the molecular formula for <BB_9959>?
The molecular formula for <BB_9959> (COC(=O)CCN.Cl) is C4H10ClNO2.
Describe the ring structures in building block <BB_9959>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9959>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9959>.
**Token:** <BB_9959> **SMILES:** COC(=O)CCN.Cl **Molecular Formula:** C4H10ClNO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9960>.
Cl.Cl.N[C@H]1CC[C@@H]2CCN(Cc3ccccc3)[C@@H]21
What is the building block token for the following molecule?
Cl.Cl.N[C@H]1CC[C@@H]2CCN(Cc3ccccc3)[C@@H]21
<BB_9960>
What is the molecular formula for <BB_9960>?
The molecular formula for <BB_9960> (Cl.Cl.N[C@H]1CC[C@@H]2CCN(Cc3ccccc3)[C@@H]21) is C14H22Cl2N2.
Describe the ring structures in building block <BB_9960>.
The molecule contains 3 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9960>.
The molecule contains the following groups: Amine, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9960>.
**Token:** <BB_9960> **SMILES:** Cl.Cl.N[C@H]1CC[C@@H]2CCN(Cc3ccccc3)[C@@H]21 **Molecular Formula:** C14H22Cl2N2 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9961>.
c1cnc2c(c1)ccc1cccnc12
What is the building block token for the following molecule?
c1cnc2c(c1)ccc1cccnc12
<BB_9961>
What is the molecular formula for <BB_9961>?
The molecular formula for <BB_9961> (c1cnc2c(c1)ccc1cccnc12) is C12H8N2.
Describe the ring structures in building block <BB_9961>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9961>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_9961>.
**Token:** <BB_9961> **SMILES:** c1cnc2c(c1)ccc1cccnc12 **Molecular Formula:** C12H8N2 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_9962>.
Cn1ccnc1C(O)c1ccc(N)cc1
What is the building block token for the following molecule?
Cn1ccnc1C(O)c1ccc(N)cc1
<BB_9962>
What is the molecular formula for <BB_9962>?
The molecular formula for <BB_9962> (Cn1ccnc1C(O)c1ccc(N)cc1) is C11H13N3O.
Describe the ring structures in building block <BB_9962>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9962>.
The molecule contains the following groups: Amine, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_9962>.
**Token:** <BB_9962> **SMILES:** Cn1ccnc1C(O)c1ccc(N)cc1 **Molecular Formula:** C11H13N3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Alcohol
Provide the SMILES representation for the building block token <BB_9963>.
O=C(O)c1cc(O)c(O)cc1C(=O)O
What is the building block token for the following molecule?
O=C(O)c1cc(O)c(O)cc1C(=O)O
<BB_9963>
What is the molecular formula for <BB_9963>?
The molecular formula for <BB_9963> (O=C(O)c1cc(O)c(O)cc1C(=O)O) is C8H6O6.
Describe the ring structures in building block <BB_9963>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9963>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_9963>.
**Token:** <BB_9963> **SMILES:** O=C(O)c1cc(O)c(O)cc1C(=O)O **Molecular Formula:** C8H6O6 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_9964>.
OC1CCCC1(F)F
What is the building block token for the following molecule?
OC1CCCC1(F)F
<BB_9964>
What is the molecular formula for <BB_9964>?
The molecular formula for <BB_9964> (OC1CCCC1(F)F) is C5H8F2O.
Describe the ring structures in building block <BB_9964>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_9964>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9964>.
**Token:** <BB_9964> **SMILES:** OC1CCCC1(F)F **Molecular Formula:** C5H8F2O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9965>.
CCc1ccc(CN)c(F)c1.Cl
What is the building block token for the following molecule?
CCc1ccc(CN)c(F)c1.Cl
<BB_9965>
What is the molecular formula for <BB_9965>?
The molecular formula for <BB_9965> (CCc1ccc(CN)c(F)c1.Cl) is C9H13ClFN.
Describe the ring structures in building block <BB_9965>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9965>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9965>.
**Token:** <BB_9965> **SMILES:** CCc1ccc(CN)c(F)c1.Cl **Molecular Formula:** C9H13ClFN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9966>.
Cc1nc2c(F)c(F)ccc2cc1O
What is the building block token for the following molecule?
Cc1nc2c(F)c(F)ccc2cc1O
<BB_9966>
What is the molecular formula for <BB_9966>?
The molecular formula for <BB_9966> (Cc1nc2c(F)c(F)ccc2cc1O) is C10H7F2NO.
Describe the ring structures in building block <BB_9966>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.