Instruction stringlengths 45 106 | input_code stringlengths 1 13.7k | output_code stringlengths 1 13.7k |
|---|---|---|
Ensure the translated Go code behaves exactly like the original Python snippet. | import re as RegEx
def Commatize( _string, _startPos=0, _periodLen=3, _separator="," ):
outString = ""
strPos = 0
matches = RegEx.findall( "[0-9]*", _string )
for match in matches[:-1]:
if not match:
outString += _string[ strPos ]
strPos += 1
else:
if len(match) > _periodLen:
leadIn = match[:_startPos]
periods = [ match [ i:i + _periodLen ] for i in range ( _startPos, len ( match ), _periodLen ) ]
outString += leadIn + _separator.join( periods )
else:
outString += match
strPos += len( match )
return outString
print ( Commatize( "pi=3.14159265358979323846264338327950288419716939937510582097494459231", 0, 5, " " ) )
print ( Commatize( "The author has two Z$100000000000000 Zimbabwe notes (100 trillion).", 0, 3, "." ))
print ( Commatize( "\"-in Aus$+1411.8millions\"" ))
print ( Commatize( "===US$0017440 millions=== (in 2000 dollars)" ))
print ( Commatize( "123.e8000 is pretty big." ))
print ( Commatize( "The land area of the earth is 57268900(29% of the surface) square miles." ))
print ( Commatize( "Ain't no numbers in this here words, nohow, no way, Jose." ))
print ( Commatize( "James was never known as 0000000007" ))
print ( Commatize( "Arthur Eddington wrote: I believe there are 15747724136275002577605653961181555468044717914527116709366231425076185631031296 protons in the universe." ))
print ( Commatize( "␢␢␢$-140000±100 millions." ))
print ( Commatize( "6/9/1946 was a good year for some." ))
| package main
import (
"fmt"
"regexp"
"strings"
)
var reg = regexp.MustCompile(`(\.[0-9]+|[1-9]([0-9]+)?(\.[0-9]+)?)`)
func reverse(s string) string {
r := []rune(s)
for i, j := 0, len(r)-1; i < len(r)/2; i, j = i+1, j-1 {
r[i], r[j] = r[j], r[i]
}
return string(r)
}
func commatize(s string, startIndex, period int, sep string) string {
if startIndex < 0 || startIndex >= len(s) || period < 1 || sep == "" {
return s
}
m := reg.FindString(s[startIndex:])
if m == "" {
return s
}
splits := strings.Split(m, ".")
ip := splits[0]
if len(ip) > period {
pi := reverse(ip)
for i := (len(ip) - 1) / period * period; i >= period; i -= period {
pi = pi[:i] + sep + pi[i:]
}
ip = reverse(pi)
}
if strings.Contains(m, ".") {
dp := splits[1]
if len(dp) > period {
for i := (len(dp) - 1) / period * period; i >= period; i -= period {
dp = dp[:i] + sep + dp[i:]
}
}
ip += "." + dp
}
return s[:startIndex] + strings.Replace(s[startIndex:], m, ip, 1)
}
func main() {
tests := [...]string{
"123456789.123456789",
".123456789",
"57256.1D-4",
"pi=3.14159265358979323846264338327950288419716939937510582097494459231",
"The author has two Z$100000000000000 Zimbabwe notes (100 trillion).",
"-in Aus$+1411.8millions",
"===US$0017440 millions=== (in 2000 dollars)",
"123.e8000 is pretty big.",
"The land area of the earth is 57268900(29% of the surface) square miles.",
"Ain't no numbers in this here words, nohow, no way, Jose.",
"James was never known as 0000000007",
"Arthur Eddington wrote: I believe there are " +
"15747724136275002577605653961181555468044717914527116709366231425076185631031296" +
" protons in the universe.",
" $-140000±100 millions.",
"6/9/1946 was a good year for some.",
}
fmt.Println(commatize(tests[0], 0, 2, "*"))
fmt.Println(commatize(tests[1], 0, 3, "-"))
fmt.Println(commatize(tests[2], 0, 4, "__"))
fmt.Println(commatize(tests[3], 0, 5, " "))
fmt.Println(commatize(tests[4], 0, 3, "."))
for _, test := range tests[5:] {
fmt.Println(commatize(test, 0, 3, ","))
}
}
|
Write the same algorithm in Go as shown in this Python implementation. | import re as RegEx
def Commatize( _string, _startPos=0, _periodLen=3, _separator="," ):
outString = ""
strPos = 0
matches = RegEx.findall( "[0-9]*", _string )
for match in matches[:-1]:
if not match:
outString += _string[ strPos ]
strPos += 1
else:
if len(match) > _periodLen:
leadIn = match[:_startPos]
periods = [ match [ i:i + _periodLen ] for i in range ( _startPos, len ( match ), _periodLen ) ]
outString += leadIn + _separator.join( periods )
else:
outString += match
strPos += len( match )
return outString
print ( Commatize( "pi=3.14159265358979323846264338327950288419716939937510582097494459231", 0, 5, " " ) )
print ( Commatize( "The author has two Z$100000000000000 Zimbabwe notes (100 trillion).", 0, 3, "." ))
print ( Commatize( "\"-in Aus$+1411.8millions\"" ))
print ( Commatize( "===US$0017440 millions=== (in 2000 dollars)" ))
print ( Commatize( "123.e8000 is pretty big." ))
print ( Commatize( "The land area of the earth is 57268900(29% of the surface) square miles." ))
print ( Commatize( "Ain't no numbers in this here words, nohow, no way, Jose." ))
print ( Commatize( "James was never known as 0000000007" ))
print ( Commatize( "Arthur Eddington wrote: I believe there are 15747724136275002577605653961181555468044717914527116709366231425076185631031296 protons in the universe." ))
print ( Commatize( "␢␢␢$-140000±100 millions." ))
print ( Commatize( "6/9/1946 was a good year for some." ))
| package main
import (
"fmt"
"regexp"
"strings"
)
var reg = regexp.MustCompile(`(\.[0-9]+|[1-9]([0-9]+)?(\.[0-9]+)?)`)
func reverse(s string) string {
r := []rune(s)
for i, j := 0, len(r)-1; i < len(r)/2; i, j = i+1, j-1 {
r[i], r[j] = r[j], r[i]
}
return string(r)
}
func commatize(s string, startIndex, period int, sep string) string {
if startIndex < 0 || startIndex >= len(s) || period < 1 || sep == "" {
return s
}
m := reg.FindString(s[startIndex:])
if m == "" {
return s
}
splits := strings.Split(m, ".")
ip := splits[0]
if len(ip) > period {
pi := reverse(ip)
for i := (len(ip) - 1) / period * period; i >= period; i -= period {
pi = pi[:i] + sep + pi[i:]
}
ip = reverse(pi)
}
if strings.Contains(m, ".") {
dp := splits[1]
if len(dp) > period {
for i := (len(dp) - 1) / period * period; i >= period; i -= period {
dp = dp[:i] + sep + dp[i:]
}
}
ip += "." + dp
}
return s[:startIndex] + strings.Replace(s[startIndex:], m, ip, 1)
}
func main() {
tests := [...]string{
"123456789.123456789",
".123456789",
"57256.1D-4",
"pi=3.14159265358979323846264338327950288419716939937510582097494459231",
"The author has two Z$100000000000000 Zimbabwe notes (100 trillion).",
"-in Aus$+1411.8millions",
"===US$0017440 millions=== (in 2000 dollars)",
"123.e8000 is pretty big.",
"The land area of the earth is 57268900(29% of the surface) square miles.",
"Ain't no numbers in this here words, nohow, no way, Jose.",
"James was never known as 0000000007",
"Arthur Eddington wrote: I believe there are " +
"15747724136275002577605653961181555468044717914527116709366231425076185631031296" +
" protons in the universe.",
" $-140000±100 millions.",
"6/9/1946 was a good year for some.",
}
fmt.Println(commatize(tests[0], 0, 2, "*"))
fmt.Println(commatize(tests[1], 0, 3, "-"))
fmt.Println(commatize(tests[2], 0, 4, "__"))
fmt.Println(commatize(tests[3], 0, 5, " "))
fmt.Println(commatize(tests[4], 0, 3, "."))
for _, test := range tests[5:] {
fmt.Println(commatize(test, 0, 3, ","))
}
}
|
Produce a language-to-language conversion: from Python to Go, same semantics. | from collections import Counter
def cumulative_freq(freq):
cf = {}
total = 0
for b in range(256):
if b in freq:
cf[b] = total
total += freq[b]
return cf
def arithmethic_coding(bytes, radix):
freq = Counter(bytes)
cf = cumulative_freq(freq)
base = len(bytes)
lower = 0
pf = 1
for b in bytes:
lower = lower*base + cf[b]*pf
pf *= freq[b]
upper = lower+pf
pow = 0
while True:
pf //= radix
if pf==0: break
pow += 1
enc = (upper-1) // radix**pow
return enc, pow, freq
def arithmethic_decoding(enc, radix, pow, freq):
enc *= radix**pow;
base = sum(freq.values())
cf = cumulative_freq(freq)
dict = {}
for k,v in cf.items():
dict[v] = k
lchar = None
for i in range(base):
if i in dict:
lchar = dict[i]
elif lchar is not None:
dict[i] = lchar
decoded = bytearray()
for i in range(base-1, -1, -1):
pow = base**i
div = enc//pow
c = dict[div]
fv = freq[c]
cv = cf[c]
rem = (enc - pow*cv) // fv
enc = rem
decoded.append(c)
return bytes(decoded)
radix = 10
for str in b'DABDDB DABDDBBDDBA ABRACADABRA TOBEORNOTTOBEORTOBEORNOT'.split():
enc, pow, freq = arithmethic_coding(str, radix)
dec = arithmethic_decoding(enc, radix, pow, freq)
print("%-25s=> %19s * %d^%s" % (str, enc, radix, pow))
if str != dec:
raise Exception("\tHowever that is incorrect!")
| package main
import (
"fmt"
"math/big"
)
func cumulative_freq(freq map[byte]int64) map[byte]int64 {
total := int64(0)
cf := make(map[byte]int64)
for i := 0; i < 256; i++ {
b := byte(i)
if v, ok := freq[b]; ok {
cf[b] = total
total += v
}
}
return cf
}
func arithmethic_coding(str string, radix int64) (*big.Int,
*big.Int, map[byte]int64) {
chars := []byte(str)
freq := make(map[byte]int64)
for _, c := range chars {
freq[c] += 1
}
cf := cumulative_freq(freq)
base := len(chars)
L := big.NewInt(0)
pf := big.NewInt(1)
bigBase := big.NewInt(int64(base))
for _, c := range chars {
x := big.NewInt(cf[c])
L.Mul(L, bigBase)
L.Add(L, x.Mul(x, pf))
pf.Mul(pf, big.NewInt(freq[c]))
}
U := big.NewInt(0)
U.Set(L)
U.Add(U, pf)
bigOne := big.NewInt(1)
bigZero := big.NewInt(0)
bigRadix := big.NewInt(radix)
tmp := big.NewInt(0).Set(pf)
powr := big.NewInt(0)
for {
tmp.Div(tmp, bigRadix)
if tmp.Cmp(bigZero) == 0 {
break
}
powr.Add(powr, bigOne)
}
diff := big.NewInt(0)
diff.Sub(U, bigOne)
diff.Div(diff, big.NewInt(0).Exp(bigRadix, powr, nil))
return diff, powr, freq
}
func arithmethic_decoding(num *big.Int, radix int64,
pow *big.Int, freq map[byte]int64) string {
powr := big.NewInt(radix)
enc := big.NewInt(0).Set(num)
enc.Mul(enc, powr.Exp(powr, pow, nil))
base := int64(0)
for _, v := range freq {
base += v
}
cf := cumulative_freq(freq)
dict := make(map[int64]byte)
for k, v := range cf {
dict[v] = k
}
lchar := -1
for i := int64(0); i < base; i++ {
if v, ok := dict[i]; ok {
lchar = int(v)
} else if lchar != -1 {
dict[i] = byte(lchar)
}
}
decoded := make([]byte, base)
bigBase := big.NewInt(base)
for i := base - 1; i >= 0; i-- {
pow := big.NewInt(0)
pow.Exp(bigBase, big.NewInt(i), nil)
div := big.NewInt(0)
div.Div(enc, pow)
c := dict[div.Int64()]
fv := freq[c]
cv := cf[c]
prod := big.NewInt(0).Mul(pow, big.NewInt(cv))
diff := big.NewInt(0).Sub(enc, prod)
enc.Div(diff, big.NewInt(fv))
decoded[base-i-1] = c
}
return string(decoded)
}
func main() {
var radix = int64(10)
strSlice := []string{
`DABDDB`,
`DABDDBBDDBA`,
`ABRACADABRA`,
`TOBEORNOTTOBEORTOBEORNOT`,
}
for _, str := range strSlice {
enc, pow, freq := arithmethic_coding(str, radix)
dec := arithmethic_decoding(enc, radix, pow, freq)
fmt.Printf("%-25s=> %19s * %d^%s\n", str, enc, radix, pow)
if str != dec {
panic("\tHowever that is incorrect!")
}
}
}
|
Convert the following code from Python to Go, ensuring the logic remains intact. | from collections import Counter
def cumulative_freq(freq):
cf = {}
total = 0
for b in range(256):
if b in freq:
cf[b] = total
total += freq[b]
return cf
def arithmethic_coding(bytes, radix):
freq = Counter(bytes)
cf = cumulative_freq(freq)
base = len(bytes)
lower = 0
pf = 1
for b in bytes:
lower = lower*base + cf[b]*pf
pf *= freq[b]
upper = lower+pf
pow = 0
while True:
pf //= radix
if pf==0: break
pow += 1
enc = (upper-1) // radix**pow
return enc, pow, freq
def arithmethic_decoding(enc, radix, pow, freq):
enc *= radix**pow;
base = sum(freq.values())
cf = cumulative_freq(freq)
dict = {}
for k,v in cf.items():
dict[v] = k
lchar = None
for i in range(base):
if i in dict:
lchar = dict[i]
elif lchar is not None:
dict[i] = lchar
decoded = bytearray()
for i in range(base-1, -1, -1):
pow = base**i
div = enc//pow
c = dict[div]
fv = freq[c]
cv = cf[c]
rem = (enc - pow*cv) // fv
enc = rem
decoded.append(c)
return bytes(decoded)
radix = 10
for str in b'DABDDB DABDDBBDDBA ABRACADABRA TOBEORNOTTOBEORTOBEORNOT'.split():
enc, pow, freq = arithmethic_coding(str, radix)
dec = arithmethic_decoding(enc, radix, pow, freq)
print("%-25s=> %19s * %d^%s" % (str, enc, radix, pow))
if str != dec:
raise Exception("\tHowever that is incorrect!")
| package main
import (
"fmt"
"math/big"
)
func cumulative_freq(freq map[byte]int64) map[byte]int64 {
total := int64(0)
cf := make(map[byte]int64)
for i := 0; i < 256; i++ {
b := byte(i)
if v, ok := freq[b]; ok {
cf[b] = total
total += v
}
}
return cf
}
func arithmethic_coding(str string, radix int64) (*big.Int,
*big.Int, map[byte]int64) {
chars := []byte(str)
freq := make(map[byte]int64)
for _, c := range chars {
freq[c] += 1
}
cf := cumulative_freq(freq)
base := len(chars)
L := big.NewInt(0)
pf := big.NewInt(1)
bigBase := big.NewInt(int64(base))
for _, c := range chars {
x := big.NewInt(cf[c])
L.Mul(L, bigBase)
L.Add(L, x.Mul(x, pf))
pf.Mul(pf, big.NewInt(freq[c]))
}
U := big.NewInt(0)
U.Set(L)
U.Add(U, pf)
bigOne := big.NewInt(1)
bigZero := big.NewInt(0)
bigRadix := big.NewInt(radix)
tmp := big.NewInt(0).Set(pf)
powr := big.NewInt(0)
for {
tmp.Div(tmp, bigRadix)
if tmp.Cmp(bigZero) == 0 {
break
}
powr.Add(powr, bigOne)
}
diff := big.NewInt(0)
diff.Sub(U, bigOne)
diff.Div(diff, big.NewInt(0).Exp(bigRadix, powr, nil))
return diff, powr, freq
}
func arithmethic_decoding(num *big.Int, radix int64,
pow *big.Int, freq map[byte]int64) string {
powr := big.NewInt(radix)
enc := big.NewInt(0).Set(num)
enc.Mul(enc, powr.Exp(powr, pow, nil))
base := int64(0)
for _, v := range freq {
base += v
}
cf := cumulative_freq(freq)
dict := make(map[int64]byte)
for k, v := range cf {
dict[v] = k
}
lchar := -1
for i := int64(0); i < base; i++ {
if v, ok := dict[i]; ok {
lchar = int(v)
} else if lchar != -1 {
dict[i] = byte(lchar)
}
}
decoded := make([]byte, base)
bigBase := big.NewInt(base)
for i := base - 1; i >= 0; i-- {
pow := big.NewInt(0)
pow.Exp(bigBase, big.NewInt(i), nil)
div := big.NewInt(0)
div.Div(enc, pow)
c := dict[div.Int64()]
fv := freq[c]
cv := cf[c]
prod := big.NewInt(0).Mul(pow, big.NewInt(cv))
diff := big.NewInt(0).Sub(enc, prod)
enc.Div(diff, big.NewInt(fv))
decoded[base-i-1] = c
}
return string(decoded)
}
func main() {
var radix = int64(10)
strSlice := []string{
`DABDDB`,
`DABDDBBDDBA`,
`ABRACADABRA`,
`TOBEORNOTTOBEORTOBEORNOT`,
}
for _, str := range strSlice {
enc, pow, freq := arithmethic_coding(str, radix)
dec := arithmethic_decoding(enc, radix, pow, freq)
fmt.Printf("%-25s=> %19s * %d^%s\n", str, enc, radix, pow)
if str != dec {
panic("\tHowever that is incorrect!")
}
}
}
|
Generate a Go translation of this Python snippet without changing its computational steps. | def kosaraju(g):
class nonlocal: pass
size = len(g)
vis = [False]*size
l = [0]*size
nonlocal.x = size
t = [[]]*size
def visit(u):
if not vis[u]:
vis[u] = True
for v in g[u]:
visit(v)
t[v] = t[v] + [u]
nonlocal.x = nonlocal.x - 1
l[nonlocal.x] = u
for u in range(len(g)):
visit(u)
c = [0]*size
def assign(u, root):
if vis[u]:
vis[u] = False
c[u] = root
for v in t[u]:
assign(v, root)
for u in l:
assign(u, u)
return c
g = [[1], [2], [0], [1,2,4], [3,5], [2,6], [5], [4,6,7]]
print kosaraju(g)
| package main
import "fmt"
var g = [][]int{
0: {1},
1: {2},
2: {0},
3: {1, 2, 4},
4: {3, 5},
5: {2, 6},
6: {5},
7: {4, 6, 7},
}
func main() {
fmt.Println(kosaraju(g))
}
func kosaraju(g [][]int) []int {
vis := make([]bool, len(g))
L := make([]int, len(g))
x := len(L)
t := make([][]int, len(g))
var Visit func(int)
Visit = func(u int) {
if !vis[u] {
vis[u] = true
for _, v := range g[u] {
Visit(v)
t[v] = append(t[v], u)
}
x--
L[x] = u
}
}
for u := range g {
Visit(u)
}
c := make([]int, len(g))
var Assign func(int, int)
Assign = func(u, root int) {
if vis[u] {
vis[u] = false
c[u] = root
for _, v := range t[u] {
Assign(v, root)
}
}
}
for _, u := range L {
Assign(u, u)
}
return c
}
|
Port the provided Python code into Go while preserving the original functionality. | import inspect
class Super(object):
def __init__(self, name):
self.name = name
def __str__(self):
return "Super(%s)" % (self.name,)
def doSup(self):
return 'did super stuff'
@classmethod
def cls(cls):
return 'cls method (in sup)'
@classmethod
def supCls(cls):
return 'Super method'
@staticmethod
def supStatic():
return 'static method'
class Other(object):
def otherMethod(self):
return 'other method'
class Sub(Other, Super):
def __init__(self, name, *args):
super(Sub, self).__init__(name);
self.rest = args;
self.methods = {}
def __dir__(self):
return list(set( \
sum([dir(base) for base in type(self).__bases__], []) \
+ type(self).__dict__.keys() \
+ self.__dict__.keys() \
+ self.methods.keys() \
))
def __getattr__(self, name):
if name in self.methods:
if callable(self.methods[name]) and self.methods[name].__code__.co_argcount > 0:
if self.methods[name].__code__.co_varnames[0] == 'self':
return self.methods[name].__get__(self, type(self))
if self.methods[name].__code__.co_varnames[0] == 'cls':
return self.methods[name].__get__(type(self), type)
return self.methods[name]
raise AttributeError("'%s' object has no attribute '%s'" % (type(self).__name__, name))
def __str__(self):
return "Sub(%s)" % self.name
def doSub():
return 'did sub stuff'
@classmethod
def cls(cls):
return 'cls method (in Sub)'
@classmethod
def subCls(cls):
return 'Sub method'
@staticmethod
def subStatic():
return 'Sub method'
sup = Super('sup')
sub = Sub('sub', 0, 'I', 'two')
sub.methods['incr'] = lambda x: x+1
sub.methods['strs'] = lambda self, x: str(self) * x
[method for method in dir(sub) if callable(getattr(sub, method))]
[method for method in dir(sub) if callable(getattr(sub, method)) and hasattr(getattr(sub, method), '__self__') and getattr(sub, method).__self__ == sub]
[method for method in dir(sub) if callable(getattr(sub, method)) and hasattr(getattr(sub, method), '__self__') and getattr(sub, method).__self__ == type(sub)]
[method for method in dir(sub) if callable(getattr(sub, method)) and type(getattr(sub, method)) == type(lambda:nil)]
inspect.getmembers(sub, predicate=inspect.ismethod)
map(lambda t: t[0], inspect.getmembers(sub, predicate=inspect.ismethod))
| package main
import (
"fmt"
"image"
"reflect"
)
type t int
func (r t) Twice() t { return r * 2 }
func (r t) Half() t { return r / 2 }
func (r t) Less(r2 t) bool { return r < r2 }
func (r t) privateMethod() {}
func main() {
report(t(0))
report(image.Point{})
}
func report(x interface{}) {
v := reflect.ValueOf(x)
t := reflect.TypeOf(x)
n := t.NumMethod()
fmt.Printf("Type %v has %d exported methods:\n", t, n)
const format = "%-6s %-46s %s\n"
fmt.Printf(format, "Name", "Method expression", "Method value")
for i := 0; i < n; i++ {
fmt.Printf(format,
t.Method(i).Name,
t.Method(i).Func.Type(),
v.Method(i).Type(),
)
}
fmt.Println()
}
|
Change the programming language of this snippet from Python to Go without modifying what it does. | from itertools import product
minos = (((197123, 7, 6), (1797, 6, 7), (1287, 6, 7), (196867, 7, 6)),
((263937, 6, 6), (197126, 6, 6), (393731, 6, 6), (67332, 6, 6)),
((16843011, 7, 5), (2063, 5, 7), (3841, 5, 7), (271, 5, 7), (3848, 5, 7), (50463234, 7, 5), (50397441, 7, 5), (33686019, 7, 5)),
((131843, 7, 6), (1798, 6, 7), (775, 6, 7), (1795, 6, 7), (1543, 6, 7), (197377, 7, 6), (197378, 7, 6), (66307, 7, 6)),
((132865, 6, 6), (131846, 6, 6), (198146, 6, 6), (132611, 6, 6), (393986, 6, 6), (263938, 6, 6), (67330, 6, 6), (132868, 6, 6)),
((1039, 5, 7), (33751554, 7, 5), (16843521, 7, 5), (16974081, 7, 5), (33686274, 7, 5), (3842, 5, 7), (3844, 5, 7), (527, 5, 7)),
((1804, 5, 7), (33751297, 7, 5), (33686273, 7, 5), (16974338, 7, 5), (16843522, 7, 5), (782, 5, 7), (3079, 5, 7), (3587, 5, 7)),
((263683, 6, 6), (198148, 6, 6), (66310, 6, 6), (393985, 6, 6)),
((67329, 6, 6), (131591, 6, 6), (459266, 6, 6), (263940, 6, 6)),
((459780, 6, 6), (459009, 6, 6), (263175, 6, 6), (65799, 6, 6)),
((4311810305, 8, 4), (31, 4, 8)),
((132866, 6, 6),))
boxchar_double_width = ' ╶╺╵└┕╹┖┗╴─╼┘┴┶┚┸┺╸╾━┙┵┷┛┹┻╷┌┍│├┝╿┞┡┐┬┮┤┼┾┦╀╄┑┭┯┥┽┿┩╃╇╻┎┏╽┟┢┃┠┣┒┰┲┧╁╆┨╂╊┓┱┳┪╅╈┫╉╋'
boxchar_single_width = [c + ' ─━'[i%3] for i, c in enumerate(boxchar_double_width)]
patterns = boxchar_single_width
tiles = []
for row in reversed(minos):
tiles.append([])
for n, x, y in row:
for shift in (b*8 + a for a, b in product(range(x), range(y))):
tiles[-1].append(n << shift)
def img(seq):
b = [[0]*10 for _ in range(10)]
for i, s in enumerate(seq):
for j, k in product(range(8), range(8)):
if s & (1<<(j*8 + k)):
b[j + 1][k + 1] = i + 1
idices = [[0]*9 for _ in range(9)]
for i, j in product(range(9), range(9)):
n = (b[i+1][j+1], b[i][j+1], b[i][j], b[i+1][j], b[i+1][j+1])
idices[i][j] = sum((a != b)*(1 + (not a or not b))*3**i for i, (a,b) in enumerate(zip(n, n[1:])))
return '\n'.join(''.join(patterns[i] for i in row) for row in idices)
def tile(board=0, seq=tuple(), tiles=tiles):
if not tiles:
yield img(seq)
return
for c in tiles[0]:
b = board | c
tnext = []
for t in tiles[1:]:
tnext.append(tuple(n for n in t if not n&b))
if not tnext[-1]: break
else:
yield from tile(b, seq + (c,), tnext)
for x in tile():
print(x)
| package main
import (
"fmt"
"math/rand"
"time"
)
var F = [][]int{
{1, -1, 1, 0, 1, 1, 2, 1}, {0, 1, 1, -1, 1, 0, 2, 0},
{1, 0, 1, 1, 1, 2, 2, 1}, {1, 0, 1, 1, 2, -1, 2, 0},
{1, -2, 1, -1, 1, 0, 2, -1}, {0, 1, 1, 1, 1, 2, 2, 1},
{1, -1, 1, 0, 1, 1, 2, -1}, {1, -1, 1, 0, 2, 0, 2, 1},
}
var I = [][]int{{0, 1, 0, 2, 0, 3, 0, 4}, {1, 0, 2, 0, 3, 0, 4, 0}}
var L = [][]int{
{1, 0, 1, 1, 1, 2, 1, 3}, {1, 0, 2, 0, 3, -1, 3, 0},
{0, 1, 0, 2, 0, 3, 1, 3}, {0, 1, 1, 0, 2, 0, 3, 0}, {0, 1, 1, 1, 2, 1, 3, 1},
{0, 1, 0, 2, 0, 3, 1, 0}, {1, 0, 2, 0, 3, 0, 3, 1}, {1, -3, 1, -2, 1, -1, 1, 0},
}
var N = [][]int{
{0, 1, 1, -2, 1, -1, 1, 0}, {1, 0, 1, 1, 2, 1, 3, 1},
{0, 1, 0, 2, 1, -1, 1, 0}, {1, 0, 2, 0, 2, 1, 3, 1}, {0, 1, 1, 1, 1, 2, 1, 3},
{1, 0, 2, -1, 2, 0, 3, -1}, {0, 1, 0, 2, 1, 2, 1, 3}, {1, -1, 1, 0, 2, -1, 3, -1},
}
var P = [][]int{
{0, 1, 1, 0, 1, 1, 2, 1}, {0, 1, 0, 2, 1, 0, 1, 1},
{1, 0, 1, 1, 2, 0, 2, 1}, {0, 1, 1, -1, 1, 0, 1, 1}, {0, 1, 1, 0, 1, 1, 1, 2},
{1, -1, 1, 0, 2, -1, 2, 0}, {0, 1, 0, 2, 1, 1, 1, 2}, {0, 1, 1, 0, 1, 1, 2, 0},
}
var T = [][]int{
{0, 1, 0, 2, 1, 1, 2, 1}, {1, -2, 1, -1, 1, 0, 2, 0},
{1, 0, 2, -1, 2, 0, 2, 1}, {1, 0, 1, 1, 1, 2, 2, 0},
}
var U = [][]int{
{0, 1, 0, 2, 1, 0, 1, 2}, {0, 1, 1, 1, 2, 0, 2, 1},
{0, 2, 1, 0, 1, 1, 1, 2}, {0, 1, 1, 0, 2, 0, 2, 1},
}
var V = [][]int{
{1, 0, 2, 0, 2, 1, 2, 2}, {0, 1, 0, 2, 1, 0, 2, 0},
{1, 0, 2, -2, 2, -1, 2, 0}, {0, 1, 0, 2, 1, 2, 2, 2},
}
var W = [][]int{
{1, 0, 1, 1, 2, 1, 2, 2}, {1, -1, 1, 0, 2, -2, 2, -1},
{0, 1, 1, 1, 1, 2, 2, 2}, {0, 1, 1, -1, 1, 0, 2, -1},
}
var X = [][]int{{1, -1, 1, 0, 1, 1, 2, 0}}
var Y = [][]int{
{1, -2, 1, -1, 1, 0, 1, 1}, {1, -1, 1, 0, 2, 0, 3, 0},
{0, 1, 0, 2, 0, 3, 1, 1}, {1, 0, 2, 0, 2, 1, 3, 0}, {0, 1, 0, 2, 0, 3, 1, 2},
{1, 0, 1, 1, 2, 0, 3, 0}, {1, -1, 1, 0, 1, 1, 1, 2}, {1, 0, 2, -1, 2, 0, 3, 0},
}
var Z = [][]int{
{0, 1, 1, 0, 2, -1, 2, 0}, {1, 0, 1, 1, 1, 2, 2, 2},
{0, 1, 1, 1, 2, 1, 2, 2}, {1, -2, 1, -1, 1, 0, 2, -2},
}
var shapes = [][][]int{F, I, L, N, P, T, U, V, W, X, Y, Z}
var symbols = []byte("FILNPTUVWXYZ-")
const (
nRows = 8
nCols = 8
blank = 12
)
var grid [nRows][nCols]int
var placed [12]bool
func tryPlaceOrientation(o []int, r, c, shapeIndex int) bool {
for i := 0; i < len(o); i += 2 {
x := c + o[i+1]
y := r + o[i]
if x < 0 || x >= nCols || y < 0 || y >= nRows || grid[y][x] != -1 {
return false
}
}
grid[r][c] = shapeIndex
for i := 0; i < len(o); i += 2 {
grid[r+o[i]][c+o[i+1]] = shapeIndex
}
return true
}
func removeOrientation(o []int, r, c int) {
grid[r][c] = -1
for i := 0; i < len(o); i += 2 {
grid[r+o[i]][c+o[i+1]] = -1
}
}
func solve(pos, numPlaced int) bool {
if numPlaced == len(shapes) {
return true
}
row := pos / nCols
col := pos % nCols
if grid[row][col] != -1 {
return solve(pos+1, numPlaced)
}
for i := range shapes {
if !placed[i] {
for _, orientation := range shapes[i] {
if !tryPlaceOrientation(orientation, row, col, i) {
continue
}
placed[i] = true
if solve(pos+1, numPlaced+1) {
return true
}
removeOrientation(orientation, row, col)
placed[i] = false
}
}
}
return false
}
func shuffleShapes() {
rand.Shuffle(len(shapes), func(i, j int) {
shapes[i], shapes[j] = shapes[j], shapes[i]
symbols[i], symbols[j] = symbols[j], symbols[i]
})
}
func printResult() {
for _, r := range grid {
for _, i := range r {
fmt.Printf("%c ", symbols[i])
}
fmt.Println()
}
}
func main() {
rand.Seed(time.Now().UnixNano())
shuffleShapes()
for r := 0; r < nRows; r++ {
for i := range grid[r] {
grid[r][i] = -1
}
}
for i := 0; i < 4; i++ {
var randRow, randCol int
for {
randRow = rand.Intn(nRows)
randCol = rand.Intn(nCols)
if grid[randRow][randCol] != blank {
break
}
}
grid[randRow][randCol] = blank
}
if solve(0, 0) {
printResult()
} else {
fmt.Println("No solution")
}
}
|
Change the following Python code into Go without altering its purpose. | class Example(object):
def foo(self, x):
return 42 + x
name = "foo"
getattr(Example(), name)(5)
| package main
import (
"fmt"
"reflect"
)
type example struct{}
func (example) Foo() int {
return 42
}
func main() {
var e example
m := reflect.ValueOf(e).MethodByName("Foo")
r := m.Call(nil)
fmt.Println(r[0].Int())
}
|
Convert the following code from Python to Go, ensuring the logic remains intact. |
example1 = 3
example2 = 3.0
example3 = True
example4 = "hello"
example1 = "goodbye"
| x := 3
|
Generate a Go translation of this Python snippet without changing its computational steps. | import math
import random
INFINITY = 1 << 127
MAX_INT = 1 << 31
class Parameters:
def __init__(self, omega, phip, phig):
self.omega = omega
self.phip = phip
self.phig = phig
class State:
def __init__(self, iter, gbpos, gbval, min, max, parameters, pos, vel, bpos, bval, nParticles, nDims):
self.iter = iter
self.gbpos = gbpos
self.gbval = gbval
self.min = min
self.max = max
self.parameters = parameters
self.pos = pos
self.vel = vel
self.bpos = bpos
self.bval = bval
self.nParticles = nParticles
self.nDims = nDims
def report(self, testfunc):
print "Test Function :", testfunc
print "Iterations :", self.iter
print "Global Best Position :", self.gbpos
print "Global Best Value : %.16f" % self.gbval
def uniform01():
v = random.random()
assert 0.0 <= v and v < 1.0
return v
def psoInit(min, max, parameters, nParticles):
nDims = len(min)
pos = [min[:]] * nParticles
vel = [[0.0] * nDims] * nParticles
bpos = [min[:]] * nParticles
bval = [INFINITY] * nParticles
iter = 0
gbpos = [INFINITY] * nDims
gbval = INFINITY
return State(iter, gbpos, gbval, min, max, parameters, pos, vel, bpos, bval, nParticles, nDims);
def pso(fn, y):
p = y.parameters
v = [0.0] * (y.nParticles)
bpos = [y.min[:]] * (y.nParticles)
bval = [0.0] * (y.nParticles)
gbpos = [0.0] * (y.nDims)
gbval = INFINITY
for j in xrange(0, y.nParticles):
v[j] = fn(y.pos[j])
if v[j] < y.bval[j]:
bpos[j] = y.pos[j][:]
bval[j] = v[j]
else:
bpos[j] = y.bpos[j][:]
bval[j] = y.bval[j]
if bval[j] < gbval:
gbval = bval[j]
gbpos = bpos[j][:]
rg = uniform01()
pos = [[None] * (y.nDims)] * (y.nParticles)
vel = [[None] * (y.nDims)] * (y.nParticles)
for j in xrange(0, y.nParticles):
rp = uniform01()
ok = True
vel[j] = [0.0] * (len(vel[j]))
pos[j] = [0.0] * (len(pos[j]))
for k in xrange(0, y.nDims):
vel[j][k] = p.omega * y.vel[j][k] \
+ p.phip * rp * (bpos[j][k] - y.pos[j][k]) \
+ p.phig * rg * (gbpos[k] - y.pos[j][k])
pos[j][k] = y.pos[j][k] + vel[j][k]
ok = ok and y.min[k] < pos[j][k] and y.max[k] > pos[j][k]
if not ok:
for k in xrange(0, y.nDims):
pos[j][k] = y.min[k] + (y.max[k] - y.min[k]) * uniform01()
iter = 1 + y.iter
return State(iter, gbpos, gbval, y.min, y.max, y.parameters, pos, vel, bpos, bval, y.nParticles, y.nDims);
def iterate(fn, n, y):
r = y
old = y
if n == MAX_INT:
while True:
r = pso(fn, r)
if r == old:
break
old = r
else:
for _ in xrange(0, n):
r = pso(fn, r)
return r
def mccormick(x):
(a, b) = x
return math.sin(a + b) + (a - b) * (a - b) + 1.0 + 2.5 * b - 1.5 * a
def michalewicz(x):
m = 10
d = len(x)
sum = 0.0
for i in xrange(1, d):
j = x[i - 1]
k = math.sin(i * j * j / math.pi)
sum += math.sin(j) * k ** (2.0 * m)
return -sum
def main():
state = psoInit([-1.5, -3.0], [4.0, 4.0], Parameters(0.0, 0.6, 0.3), 100)
state = iterate(mccormick, 40, state)
state.report("McCormick")
print "f(-.54719, -1.54719) : %.16f" % (mccormick([-.54719, -1.54719]))
print
state = psoInit([0.0, 0.0], [math.pi, math.pi], Parameters(0.3, 0.3, 0.3), 1000)
state = iterate(michalewicz, 30, state)
state.report("Michalewicz (2D)")
print "f(2.20, 1.57) : %.16f" % (michalewicz([2.2, 1.57]))
main()
| package main
import (
"fmt"
"math"
"math/rand"
"time"
)
type ff = func([]float64) float64
type parameters struct{ omega, phip, phig float64 }
type state struct {
iter int
gbpos []float64
gbval float64
min []float64
max []float64
params parameters
pos [][]float64
vel [][]float64
bpos [][]float64
bval []float64
nParticles int
nDims int
}
func (s state) report(testfunc string) {
fmt.Println("Test Function :", testfunc)
fmt.Println("Iterations :", s.iter)
fmt.Println("Global Best Position :", s.gbpos)
fmt.Println("Global Best Value :", s.gbval)
}
func psoInit(min, max []float64, params parameters, nParticles int) *state {
nDims := len(min)
pos := make([][]float64, nParticles)
vel := make([][]float64, nParticles)
bpos := make([][]float64, nParticles)
bval := make([]float64, nParticles)
for i := 0; i < nParticles; i++ {
pos[i] = min
vel[i] = make([]float64, nDims)
bpos[i] = min
bval[i] = math.Inf(1)
}
iter := 0
gbpos := make([]float64, nDims)
for i := 0; i < nDims; i++ {
gbpos[i] = math.Inf(1)
}
gbval := math.Inf(1)
return &state{iter, gbpos, gbval, min, max, params,
pos, vel, bpos, bval, nParticles, nDims}
}
func pso(fn ff, y *state) *state {
p := y.params
v := make([]float64, y.nParticles)
bpos := make([][]float64, y.nParticles)
bval := make([]float64, y.nParticles)
gbpos := make([]float64, y.nDims)
gbval := math.Inf(1)
for j := 0; j < y.nParticles; j++ {
v[j] = fn(y.pos[j])
if v[j] < y.bval[j] {
bpos[j] = y.pos[j]
bval[j] = v[j]
} else {
bpos[j] = y.bpos[j]
bval[j] = y.bval[j]
}
if bval[j] < gbval {
gbval = bval[j]
gbpos = bpos[j]
}
}
rg := rand.Float64()
pos := make([][]float64, y.nParticles)
vel := make([][]float64, y.nParticles)
for j := 0; j < y.nParticles; j++ {
pos[j] = make([]float64, y.nDims)
vel[j] = make([]float64, y.nDims)
rp := rand.Float64()
ok := true
for z := 0; z < y.nDims; z++ {
pos[j][z] = 0
vel[j][z] = 0
}
for k := 0; k < y.nDims; k++ {
vel[j][k] = p.omega*y.vel[j][k] +
p.phip*rp*(bpos[j][k]-y.pos[j][k]) +
p.phig*rg*(gbpos[k]-y.pos[j][k])
pos[j][k] = y.pos[j][k] + vel[j][k]
ok = ok && y.min[k] < pos[j][k] && y.max[k] > pos[j][k]
}
if !ok {
for k := 0; k < y.nDims; k++ {
pos[j][k] = y.min[k] + (y.max[k]-y.min[k])*rand.Float64()
}
}
}
iter := 1 + y.iter
return &state{iter, gbpos, gbval, y.min, y.max, y.params,
pos, vel, bpos, bval, y.nParticles, y.nDims}
}
func iterate(fn ff, n int, y *state) *state {
r := y
for i := 0; i < n; i++ {
r = pso(fn, r)
}
return r
}
func mccormick(x []float64) float64 {
a, b := x[0], x[1]
return math.Sin(a+b) + (a-b)*(a-b) + 1.0 + 2.5*b - 1.5*a
}
func michalewicz(x []float64) float64 {
m := 10.0
sum := 0.0
for i := 1; i <= len(x); i++ {
j := x[i-1]
k := math.Sin(float64(i) * j * j / math.Pi)
sum += math.Sin(j) * math.Pow(k, 2*m)
}
return -sum
}
func main() {
rand.Seed(time.Now().UnixNano())
st := psoInit(
[]float64{-1.5, -3.0},
[]float64{4.0, 4.0},
parameters{0.0, 0.6, 0.3},
100,
)
st = iterate(mccormick, 40, st)
st.report("McCormick")
fmt.Println("f(-.54719, -1.54719) :", mccormick([]float64{-.54719, -1.54719}))
fmt.Println()
st = psoInit(
[]float64{0.0, 0.0},
[]float64{math.Pi, math.Pi},
parameters{0.3, 0.3, 0.3},
1000,
)
st = iterate(michalewicz, 30, st)
st.report("Michalewicz (2D)")
fmt.Println("f(2.20, 1.57) :", michalewicz([]float64{2.2, 1.57}))
|
Transform the following Python implementation into Go, maintaining the same output and logic. | python
Python 2.6.1 (r261:67517, Dec 4 2008, 16:51:00) [MSC v.1500 32 bit (Intel)] on
win32
Type "help", "copyright", "credits" or "license" for more information.
>>> def f(string1, string2, separator):
return separator.join([string1, '', string2])
>>> f('Rosetta', 'Code', ':')
'Rosetta::Code'
>>>
| package main
import "fmt"
func f(s1, s2, sep string) string {
return s1 + sep + sep + s2
}
func main() {
fmt.Println(f("Rosetta", "Code", ":"))
}
|
Convert this Python snippet to Go and keep its semantics consistent. | python
Python 2.6.1 (r261:67517, Dec 4 2008, 16:51:00) [MSC v.1500 32 bit (Intel)] on
win32
Type "help", "copyright", "credits" or "license" for more information.
>>> def f(string1, string2, separator):
return separator.join([string1, '', string2])
>>> f('Rosetta', 'Code', ':')
'Rosetta::Code'
>>>
| package main
import "fmt"
func f(s1, s2, sep string) string {
return s1 + sep + sep + s2
}
func main() {
fmt.Println(f("Rosetta", "Code", ":"))
}
|
Change the following Python code into Go without altering its purpose. | def rank(x): return int('a'.join(map(str, [1] + x)), 11)
def unrank(n):
s = ''
while n: s,n = "0123456789a"[n%11] + s, n//11
return map(int, s.split('a'))[1:]
l = [1, 2, 3, 10, 100, 987654321]
print l
n = rank(l)
print n
l = unrank(n)
print l
| package main
import (
"fmt"
"math/big"
)
func rank(l []uint) (r big.Int) {
for _, n := range l {
r.Lsh(&r, n+1)
r.SetBit(&r, int(n), 1)
}
return
}
func unrank(n big.Int) (l []uint) {
m := new(big.Int).Set(&n)
for a := m.BitLen(); a > 0; {
m.SetBit(m, a-1, 0)
b := m.BitLen()
l = append(l, uint(a-b-1))
a = b
}
return
}
func main() {
var b big.Int
for i := 0; i <= 10; i++ {
b.SetInt64(int64(i))
u := unrank(b)
r := rank(u)
fmt.Println(i, u, &r)
}
b.SetString("12345678901234567890", 10)
u := unrank(b)
r := rank(u)
fmt.Printf("\n%v\n%d\n%d\n", &b, u, &r)
}
|
Please provide an equivalent version of this Python code in Go. | import os
targetfile = "pycon-china"
os.rename(os.path.realpath(targetfile), os.path.realpath(targetfile)+".bak")
f = open(os.path.realpath(targetfile), "w")
f.write("this task was solved during a talk about rosettacode at the PyCon China in 2011")
f.close()
| package main
import (
"fmt"
"io/ioutil"
"os"
)
func main() {
fn := "myth"
bx := ".backup"
var err error
if tf, err := os.Readlink(fn); err == nil {
fn = tf
}
var fi os.FileInfo
if fi, err = os.Stat(fn); err != nil {
fmt.Println(err)
return
}
if err = os.Rename(fn, fn+bx); err != nil {
fmt.Println(err)
return
}
err = ioutil.WriteFile(fn, []byte("you too!\n"), fi.Mode().Perm())
if err != nil {
fmt.Println(err)
}
}
|
Port the provided Python code into Go while preserving the original functionality. | import os
targetfile = "pycon-china"
os.rename(os.path.realpath(targetfile), os.path.realpath(targetfile)+".bak")
f = open(os.path.realpath(targetfile), "w")
f.write("this task was solved during a talk about rosettacode at the PyCon China in 2011")
f.close()
| package main
import (
"fmt"
"io/ioutil"
"os"
)
func main() {
fn := "myth"
bx := ".backup"
var err error
if tf, err := os.Readlink(fn); err == nil {
fn = tf
}
var fi os.FileInfo
if fi, err = os.Stat(fn); err != nil {
fmt.Println(err)
return
}
if err = os.Rename(fn, fn+bx); err != nil {
fmt.Println(err)
return
}
err = ioutil.WriteFile(fn, []byte("you too!\n"), fi.Mode().Perm())
if err != nil {
fmt.Println(err)
}
}
|
Change the programming language of this snippet from Python to Go without modifying what it does. | import os
targetfile = "pycon-china"
os.rename(os.path.realpath(targetfile), os.path.realpath(targetfile)+".bak")
f = open(os.path.realpath(targetfile), "w")
f.write("this task was solved during a talk about rosettacode at the PyCon China in 2011")
f.close()
| package main
import (
"fmt"
"io/ioutil"
"os"
)
func main() {
fn := "myth"
bx := ".backup"
var err error
if tf, err := os.Readlink(fn); err == nil {
fn = tf
}
var fi os.FileInfo
if fi, err = os.Stat(fn); err != nil {
fmt.Println(err)
return
}
if err = os.Rename(fn, fn+bx); err != nil {
fmt.Println(err)
return
}
err = ioutil.WriteFile(fn, []byte("you too!\n"), fi.Mode().Perm())
if err != nil {
fmt.Println(err)
}
}
|
Change the following Python code into Go without altering its purpose. |
import re
male2female=u
re_nl=re.compile(r",[ \n]*")
m2f=[ tok.split(" ") for tok in re_nl.split(male2female) ]
switch={}
words=[]
re_plural=re.compile("E*S$")
re_ES=re.compile("ES$")
def gen_pluralize(m,f):
yield re_plural.sub("",m),re_plural.sub("",f)
yield re_ES.sub("es",m),re_ES.sub("es",f)
yield re_plural.sub("s",m),re_plural.sub("s",f)
def gen_capitalize_pluralize(m,f):
for m,f in gen_pluralize(m,f):
yield m.capitalize(), f.capitalize()
yield m,f
def gen_switch_role_capitalize_pluralize(m,f):
for m,f in gen_capitalize_pluralize(m,f):
yield m,f
yield f,m
for m,f in m2f:
for xy,xx in gen_switch_role_capitalize_pluralize(m,f):
if xy not in switch:
switch[xy]=xx
words.append(xy)
words="|".join(words)
re_word=re.compile(ur"\b("+words+ur")\b")
text=u
def rev_gender(text):
text=re_word.split(text)
return "".join([ word+switch[gen] for word,gen in zip(text[::2],text[1::2])])+text[-1]
print rev_gender(text)
| package main
import (
"fmt"
"strings"
)
func reverseGender(s string) string {
if strings.Contains(s, "She") {
return strings.Replace(s, "She", "He", -1)
} else if strings.Contains(s, "He") {
return strings.Replace(s, "He", "She", -1)
}
return s
}
func main() {
s := "She was a soul stripper. She took my heart!"
t := reverseGender(s)
fmt.Println(t)
fmt.Println(reverseGender(t))
}
|
Change the programming language of this snippet from Python to Go without modifying what it does. |
import re
male2female=u
re_nl=re.compile(r",[ \n]*")
m2f=[ tok.split(" ") for tok in re_nl.split(male2female) ]
switch={}
words=[]
re_plural=re.compile("E*S$")
re_ES=re.compile("ES$")
def gen_pluralize(m,f):
yield re_plural.sub("",m),re_plural.sub("",f)
yield re_ES.sub("es",m),re_ES.sub("es",f)
yield re_plural.sub("s",m),re_plural.sub("s",f)
def gen_capitalize_pluralize(m,f):
for m,f in gen_pluralize(m,f):
yield m.capitalize(), f.capitalize()
yield m,f
def gen_switch_role_capitalize_pluralize(m,f):
for m,f in gen_capitalize_pluralize(m,f):
yield m,f
yield f,m
for m,f in m2f:
for xy,xx in gen_switch_role_capitalize_pluralize(m,f):
if xy not in switch:
switch[xy]=xx
words.append(xy)
words="|".join(words)
re_word=re.compile(ur"\b("+words+ur")\b")
text=u
def rev_gender(text):
text=re_word.split(text)
return "".join([ word+switch[gen] for word,gen in zip(text[::2],text[1::2])])+text[-1]
print rev_gender(text)
| package main
import (
"fmt"
"strings"
)
func reverseGender(s string) string {
if strings.Contains(s, "She") {
return strings.Replace(s, "She", "He", -1)
} else if strings.Contains(s, "He") {
return strings.Replace(s, "He", "She", -1)
}
return s
}
func main() {
s := "She was a soul stripper. She took my heart!"
t := reverseGender(s)
fmt.Println(t)
fmt.Println(reverseGender(t))
}
|
Generate an equivalent Go version of this Python code. | import time
import os
seconds = input("Enter a number of seconds: ")
sound = input("Enter an mp3 filename: ")
time.sleep(float(seconds))
os.startfile(sound + ".mp3")
| package main
import (
"bufio"
"fmt"
"log"
"os"
"os/exec"
"strconv"
"time"
)
func main() {
scanner := bufio.NewScanner(os.Stdin)
number := 0
for number < 1 {
fmt.Print("Enter number of seconds delay > 0 : ")
scanner.Scan()
input := scanner.Text()
if err := scanner.Err(); err != nil {
log.Fatal(err)
}
number, _ = strconv.Atoi(input)
}
filename := ""
for filename == "" {
fmt.Print("Enter name of .mp3 file to play (without extension) : ")
scanner.Scan()
filename = scanner.Text()
if err := scanner.Err(); err != nil {
log.Fatal(err)
}
}
cls := "\033[2J\033[0;0H"
fmt.Printf("%sAlarm will sound in %d seconds...", cls, number)
time.Sleep(time.Duration(number) * time.Second)
fmt.Printf(cls)
cmd := exec.Command("play", filename+".mp3")
if err := cmd.Run(); err != nil {
log.Fatal(err)
}
}
|
Convert this Python snippet to Go and keep its semantics consistent. | hex2bin = dict('{:x} {:04b}'.format(x,x).split() for x in range(16))
bin2hex = dict('{:b} {:x}'.format(x,x).split() for x in range(16))
def float_dec2bin(d):
neg = False
if d < 0:
d = -d
neg = True
hx = float(d).hex()
p = hx.index('p')
bn = ''.join(hex2bin.get(char, char) for char in hx[2:p])
return (('-' if neg else '') + bn.strip('0') + hx[p:p+2]
+ bin(int(hx[p+2:]))[2:])
def float_bin2dec(bn):
neg = False
if bn[0] == '-':
bn = bn[1:]
neg = True
dp = bn.index('.')
extra0 = '0' * (4 - (dp % 4))
bn2 = extra0 + bn
dp = bn2.index('.')
p = bn2.index('p')
hx = ''.join(bin2hex.get(bn2[i:min(i+4, p)].lstrip('0'), bn2[i])
for i in range(0, dp+1, 4))
bn3 = bn2[dp+1:p]
extra0 = '0' * (4 - (len(bn3) % 4))
bn4 = bn3 + extra0
hx += ''.join(bin2hex.get(bn4[i:i+4].lstrip('0'))
for i in range(0, len(bn4), 4))
hx = (('-' if neg else '') + '0x' + hx + bn2[p:p+2]
+ str(int('0b' + bn2[p+2:], 2)))
return float.fromhex(hx)
| package main
import (
"fmt"
"math"
"strconv"
"strings"
)
func decToBin(d float64) string {
whole := int64(math.Floor(d))
binary := strconv.FormatInt(whole, 2) + "."
dd := d - float64(whole)
for dd > 0.0 {
r := dd * 2.0
if r >= 1.0 {
binary += "1"
dd = r - 1.0
} else {
binary += "0"
dd = r
}
}
return binary
}
func binToDec(s string) float64 {
ss := strings.Replace(s, ".", "", 1)
num, _ := strconv.ParseInt(ss, 2, 64)
ss = strings.Split(s, ".")[1]
ss = strings.Replace(ss, "1", "0", -1)
den, _ := strconv.ParseInt("1" + ss, 2, 64)
return float64(num) / float64(den)
}
func main() {
f := 23.34375
fmt.Printf("%v\t => %s\n", f, decToBin(f))
s := "1011.11101"
fmt.Printf("%s\t => %v\n", s, binToDec(s))
}
|
Transform the following Python implementation into Go, maintaining the same output and logic. | hex2bin = dict('{:x} {:04b}'.format(x,x).split() for x in range(16))
bin2hex = dict('{:b} {:x}'.format(x,x).split() for x in range(16))
def float_dec2bin(d):
neg = False
if d < 0:
d = -d
neg = True
hx = float(d).hex()
p = hx.index('p')
bn = ''.join(hex2bin.get(char, char) for char in hx[2:p])
return (('-' if neg else '') + bn.strip('0') + hx[p:p+2]
+ bin(int(hx[p+2:]))[2:])
def float_bin2dec(bn):
neg = False
if bn[0] == '-':
bn = bn[1:]
neg = True
dp = bn.index('.')
extra0 = '0' * (4 - (dp % 4))
bn2 = extra0 + bn
dp = bn2.index('.')
p = bn2.index('p')
hx = ''.join(bin2hex.get(bn2[i:min(i+4, p)].lstrip('0'), bn2[i])
for i in range(0, dp+1, 4))
bn3 = bn2[dp+1:p]
extra0 = '0' * (4 - (len(bn3) % 4))
bn4 = bn3 + extra0
hx += ''.join(bin2hex.get(bn4[i:i+4].lstrip('0'))
for i in range(0, len(bn4), 4))
hx = (('-' if neg else '') + '0x' + hx + bn2[p:p+2]
+ str(int('0b' + bn2[p+2:], 2)))
return float.fromhex(hx)
| package main
import (
"fmt"
"math"
"strconv"
"strings"
)
func decToBin(d float64) string {
whole := int64(math.Floor(d))
binary := strconv.FormatInt(whole, 2) + "."
dd := d - float64(whole)
for dd > 0.0 {
r := dd * 2.0
if r >= 1.0 {
binary += "1"
dd = r - 1.0
} else {
binary += "0"
dd = r
}
}
return binary
}
func binToDec(s string) float64 {
ss := strings.Replace(s, ".", "", 1)
num, _ := strconv.ParseInt(ss, 2, 64)
ss = strings.Split(s, ".")[1]
ss = strings.Replace(ss, "1", "0", -1)
den, _ := strconv.ParseInt("1" + ss, 2, 64)
return float64(num) / float64(den)
}
func main() {
f := 23.34375
fmt.Printf("%v\t => %s\n", f, decToBin(f))
s := "1011.11101"
fmt.Printf("%s\t => %v\n", s, binToDec(s))
}
|
Please provide an equivalent version of this Python code in Go. | hex2bin = dict('{:x} {:04b}'.format(x,x).split() for x in range(16))
bin2hex = dict('{:b} {:x}'.format(x,x).split() for x in range(16))
def float_dec2bin(d):
neg = False
if d < 0:
d = -d
neg = True
hx = float(d).hex()
p = hx.index('p')
bn = ''.join(hex2bin.get(char, char) for char in hx[2:p])
return (('-' if neg else '') + bn.strip('0') + hx[p:p+2]
+ bin(int(hx[p+2:]))[2:])
def float_bin2dec(bn):
neg = False
if bn[0] == '-':
bn = bn[1:]
neg = True
dp = bn.index('.')
extra0 = '0' * (4 - (dp % 4))
bn2 = extra0 + bn
dp = bn2.index('.')
p = bn2.index('p')
hx = ''.join(bin2hex.get(bn2[i:min(i+4, p)].lstrip('0'), bn2[i])
for i in range(0, dp+1, 4))
bn3 = bn2[dp+1:p]
extra0 = '0' * (4 - (len(bn3) % 4))
bn4 = bn3 + extra0
hx += ''.join(bin2hex.get(bn4[i:i+4].lstrip('0'))
for i in range(0, len(bn4), 4))
hx = (('-' if neg else '') + '0x' + hx + bn2[p:p+2]
+ str(int('0b' + bn2[p+2:], 2)))
return float.fromhex(hx)
| package main
import (
"fmt"
"math"
"strconv"
"strings"
)
func decToBin(d float64) string {
whole := int64(math.Floor(d))
binary := strconv.FormatInt(whole, 2) + "."
dd := d - float64(whole)
for dd > 0.0 {
r := dd * 2.0
if r >= 1.0 {
binary += "1"
dd = r - 1.0
} else {
binary += "0"
dd = r
}
}
return binary
}
func binToDec(s string) float64 {
ss := strings.Replace(s, ".", "", 1)
num, _ := strconv.ParseInt(ss, 2, 64)
ss = strings.Split(s, ".")[1]
ss = strings.Replace(ss, "1", "0", -1)
den, _ := strconv.ParseInt("1" + ss, 2, 64)
return float64(num) / float64(den)
}
func main() {
f := 23.34375
fmt.Printf("%v\t => %s\n", f, decToBin(f))
s := "1011.11101"
fmt.Printf("%s\t => %v\n", s, binToDec(s))
}
|
Generate an equivalent Go version of this Python code. | >>> def eval_with_x(code, a, b):
return eval(code, {'x':b}) - eval(code, {'x':a})
>>> eval_with_x('2 ** x', 3, 5)
24
| package main
import (
"bitbucket.org/binet/go-eval/pkg/eval"
"fmt"
"go/parser"
"go/token"
)
func main() {
squareExpr := "x*x"
fset := token.NewFileSet()
squareAst, err := parser.ParseExpr(squareExpr)
if err != nil {
fmt.Println(err)
return
}
w := eval.NewWorld()
wVar := new(intV)
err = w.DefineVar("x", eval.IntType, wVar)
if err != nil {
fmt.Println(err)
return
}
squareCode, err := w.CompileExpr(fset, squareAst)
if err != nil {
fmt.Println(err)
return
}
*wVar = 5
r0, err := squareCode.Run()
if err != nil {
fmt.Println(err)
return
}
*wVar--
r1, err := squareCode.Run()
if err != nil {
fmt.Println(err)
return
}
fmt.Println(r0.(eval.IntValue).Get(nil) - r1.(eval.IntValue).Get(nil))
}
type intV int64
func (v *intV) String() string { return fmt.Sprint(*v) }
func (v *intV) Get(*eval.Thread) int64 { return int64(*v) }
func (v *intV) Set(_ *eval.Thread, x int64) { *v = intV(x) }
func (v *intV) Assign(t *eval.Thread, o eval.Value) {
*v = intV(o.(eval.IntValue).Get(t))
}
|
Ensure the translated Go code behaves exactly like the original Python snippet. | >>> def eval_with_x(code, a, b):
return eval(code, {'x':b}) - eval(code, {'x':a})
>>> eval_with_x('2 ** x', 3, 5)
24
| package main
import (
"bitbucket.org/binet/go-eval/pkg/eval"
"fmt"
"go/parser"
"go/token"
)
func main() {
squareExpr := "x*x"
fset := token.NewFileSet()
squareAst, err := parser.ParseExpr(squareExpr)
if err != nil {
fmt.Println(err)
return
}
w := eval.NewWorld()
wVar := new(intV)
err = w.DefineVar("x", eval.IntType, wVar)
if err != nil {
fmt.Println(err)
return
}
squareCode, err := w.CompileExpr(fset, squareAst)
if err != nil {
fmt.Println(err)
return
}
*wVar = 5
r0, err := squareCode.Run()
if err != nil {
fmt.Println(err)
return
}
*wVar--
r1, err := squareCode.Run()
if err != nil {
fmt.Println(err)
return
}
fmt.Println(r0.(eval.IntValue).Get(nil) - r1.(eval.IntValue).Get(nil))
}
type intV int64
func (v *intV) String() string { return fmt.Sprint(*v) }
func (v *intV) Get(*eval.Thread) int64 { return int64(*v) }
func (v *intV) Set(_ *eval.Thread, x int64) { *v = intV(x) }
func (v *intV) Assign(t *eval.Thread, o eval.Value) {
*v = intV(o.(eval.IntValue).Get(t))
}
|
Produce a functionally identical Go code for the snippet given in Python. | import re
from fractions import Fraction
from pprint import pprint as pp
equationtext =
def parse_eqn(equationtext=equationtext):
eqn_re = re.compile(r)
found = eqn_re.findall(equationtext)
machins, part = [], []
for lhs, sign, mult, numer, denom in eqn_re.findall(equationtext):
if lhs and part:
machins.append(part)
part = []
part.append( ( (-1 if sign == '-' else 1) * ( int(mult) if mult else 1),
Fraction(int(numer), (int(denom) if denom else 1)) ) )
machins.append(part)
return machins
def tans(xs):
xslen = len(xs)
if xslen == 1:
return tanEval(*xs[0])
aa, bb = xs[:xslen//2], xs[xslen//2:]
a, b = tans(aa), tans(bb)
return (a + b) / (1 - a * b)
def tanEval(coef, f):
if coef == 1:
return f
if coef < 0:
return -tanEval(-coef, f)
ca = coef // 2
cb = coef - ca
a, b = tanEval(ca, f), tanEval(cb, f)
return (a + b) / (1 - a * b)
if __name__ == '__main__':
machins = parse_eqn()
for machin, eqn in zip(machins, equationtext.split('\n')):
ans = tans(machin)
print('%5s: %s' % ( ('OK' if ans == 1 else 'ERROR'), eqn))
| package main
import (
"fmt"
"math/big"
)
type mTerm struct {
a, n, d int64
}
var testCases = [][]mTerm{
{{1, 1, 2}, {1, 1, 3}},
{{2, 1, 3}, {1, 1, 7}},
{{4, 1, 5}, {-1, 1, 239}},
{{5, 1, 7}, {2, 3, 79}},
{{1, 1, 2}, {1, 1, 5}, {1, 1, 8}},
{{4, 1, 5}, {-1, 1, 70}, {1, 1, 99}},
{{5, 1, 7}, {4, 1, 53}, {2, 1, 4443}},
{{6, 1, 8}, {2, 1, 57}, {1, 1, 239}},
{{8, 1, 10}, {-1, 1, 239}, {-4, 1, 515}},
{{12, 1, 18}, {8, 1, 57}, {-5, 1, 239}},
{{16, 1, 21}, {3, 1, 239}, {4, 3, 1042}},
{{22, 1, 28}, {2, 1, 443}, {-5, 1, 1393}, {-10, 1, 11018}},
{{22, 1, 38}, {17, 7, 601}, {10, 7, 8149}},
{{44, 1, 57}, {7, 1, 239}, {-12, 1, 682}, {24, 1, 12943}},
{{88, 1, 172}, {51, 1, 239}, {32, 1, 682}, {44, 1, 5357}, {68, 1, 12943}},
{{88, 1, 172}, {51, 1, 239}, {32, 1, 682}, {44, 1, 5357}, {68, 1, 12944}},
}
func main() {
for _, m := range testCases {
fmt.Printf("tan %v = %v\n", m, tans(m))
}
}
var one = big.NewRat(1, 1)
func tans(m []mTerm) *big.Rat {
if len(m) == 1 {
return tanEval(m[0].a, big.NewRat(m[0].n, m[0].d))
}
half := len(m) / 2
a := tans(m[:half])
b := tans(m[half:])
r := new(big.Rat)
return r.Quo(new(big.Rat).Add(a, b), r.Sub(one, r.Mul(a, b)))
}
func tanEval(coef int64, f *big.Rat) *big.Rat {
if coef == 1 {
return f
}
if coef < 0 {
r := tanEval(-coef, f)
return r.Neg(r)
}
ca := coef / 2
cb := coef - ca
a := tanEval(ca, f)
b := tanEval(cb, f)
r := new(big.Rat)
return r.Quo(new(big.Rat).Add(a, b), r.Sub(one, r.Mul(a, b)))
}
|
Change the following Python code into Go without altering its purpose. | import re
from fractions import Fraction
from pprint import pprint as pp
equationtext =
def parse_eqn(equationtext=equationtext):
eqn_re = re.compile(r)
found = eqn_re.findall(equationtext)
machins, part = [], []
for lhs, sign, mult, numer, denom in eqn_re.findall(equationtext):
if lhs and part:
machins.append(part)
part = []
part.append( ( (-1 if sign == '-' else 1) * ( int(mult) if mult else 1),
Fraction(int(numer), (int(denom) if denom else 1)) ) )
machins.append(part)
return machins
def tans(xs):
xslen = len(xs)
if xslen == 1:
return tanEval(*xs[0])
aa, bb = xs[:xslen//2], xs[xslen//2:]
a, b = tans(aa), tans(bb)
return (a + b) / (1 - a * b)
def tanEval(coef, f):
if coef == 1:
return f
if coef < 0:
return -tanEval(-coef, f)
ca = coef // 2
cb = coef - ca
a, b = tanEval(ca, f), tanEval(cb, f)
return (a + b) / (1 - a * b)
if __name__ == '__main__':
machins = parse_eqn()
for machin, eqn in zip(machins, equationtext.split('\n')):
ans = tans(machin)
print('%5s: %s' % ( ('OK' if ans == 1 else 'ERROR'), eqn))
| package main
import (
"fmt"
"math/big"
)
type mTerm struct {
a, n, d int64
}
var testCases = [][]mTerm{
{{1, 1, 2}, {1, 1, 3}},
{{2, 1, 3}, {1, 1, 7}},
{{4, 1, 5}, {-1, 1, 239}},
{{5, 1, 7}, {2, 3, 79}},
{{1, 1, 2}, {1, 1, 5}, {1, 1, 8}},
{{4, 1, 5}, {-1, 1, 70}, {1, 1, 99}},
{{5, 1, 7}, {4, 1, 53}, {2, 1, 4443}},
{{6, 1, 8}, {2, 1, 57}, {1, 1, 239}},
{{8, 1, 10}, {-1, 1, 239}, {-4, 1, 515}},
{{12, 1, 18}, {8, 1, 57}, {-5, 1, 239}},
{{16, 1, 21}, {3, 1, 239}, {4, 3, 1042}},
{{22, 1, 28}, {2, 1, 443}, {-5, 1, 1393}, {-10, 1, 11018}},
{{22, 1, 38}, {17, 7, 601}, {10, 7, 8149}},
{{44, 1, 57}, {7, 1, 239}, {-12, 1, 682}, {24, 1, 12943}},
{{88, 1, 172}, {51, 1, 239}, {32, 1, 682}, {44, 1, 5357}, {68, 1, 12943}},
{{88, 1, 172}, {51, 1, 239}, {32, 1, 682}, {44, 1, 5357}, {68, 1, 12944}},
}
func main() {
for _, m := range testCases {
fmt.Printf("tan %v = %v\n", m, tans(m))
}
}
var one = big.NewRat(1, 1)
func tans(m []mTerm) *big.Rat {
if len(m) == 1 {
return tanEval(m[0].a, big.NewRat(m[0].n, m[0].d))
}
half := len(m) / 2
a := tans(m[:half])
b := tans(m[half:])
r := new(big.Rat)
return r.Quo(new(big.Rat).Add(a, b), r.Sub(one, r.Mul(a, b)))
}
func tanEval(coef int64, f *big.Rat) *big.Rat {
if coef == 1 {
return f
}
if coef < 0 {
r := tanEval(-coef, f)
return r.Neg(r)
}
ca := coef / 2
cb := coef - ca
a := tanEval(ca, f)
b := tanEval(cb, f)
r := new(big.Rat)
return r.Quo(new(big.Rat).Add(a, b), r.Sub(one, r.Mul(a, b)))
}
|
Port the provided Python code into Go while preserving the original functionality. | import math
rotate_amounts = [7, 12, 17, 22, 7, 12, 17, 22, 7, 12, 17, 22, 7, 12, 17, 22,
5, 9, 14, 20, 5, 9, 14, 20, 5, 9, 14, 20, 5, 9, 14, 20,
4, 11, 16, 23, 4, 11, 16, 23, 4, 11, 16, 23, 4, 11, 16, 23,
6, 10, 15, 21, 6, 10, 15, 21, 6, 10, 15, 21, 6, 10, 15, 21]
constants = [int(abs(math.sin(i+1)) * 2**32) & 0xFFFFFFFF for i in range(64)]
init_values = [0x67452301, 0xefcdab89, 0x98badcfe, 0x10325476]
functions = 16*[lambda b, c, d: (b & c) | (~b & d)] + \
16*[lambda b, c, d: (d & b) | (~d & c)] + \
16*[lambda b, c, d: b ^ c ^ d] + \
16*[lambda b, c, d: c ^ (b | ~d)]
index_functions = 16*[lambda i: i] + \
16*[lambda i: (5*i + 1)%16] + \
16*[lambda i: (3*i + 5)%16] + \
16*[lambda i: (7*i)%16]
def left_rotate(x, amount):
x &= 0xFFFFFFFF
return ((x<<amount) | (x>>(32-amount))) & 0xFFFFFFFF
def md5(message):
message = bytearray(message)
orig_len_in_bits = (8 * len(message)) & 0xffffffffffffffff
message.append(0x80)
while len(message)%64 != 56:
message.append(0)
message += orig_len_in_bits.to_bytes(8, byteorder='little')
hash_pieces = init_values[:]
for chunk_ofst in range(0, len(message), 64):
a, b, c, d = hash_pieces
chunk = message[chunk_ofst:chunk_ofst+64]
for i in range(64):
f = functions[i](b, c, d)
g = index_functions[i](i)
to_rotate = a + f + constants[i] + int.from_bytes(chunk[4*g:4*g+4], byteorder='little')
new_b = (b + left_rotate(to_rotate, rotate_amounts[i])) & 0xFFFFFFFF
a, b, c, d = d, new_b, b, c
for i, val in enumerate([a, b, c, d]):
hash_pieces[i] += val
hash_pieces[i] &= 0xFFFFFFFF
return sum(x<<(32*i) for i, x in enumerate(hash_pieces))
def md5_to_hex(digest):
raw = digest.to_bytes(16, byteorder='little')
return '{:032x}'.format(int.from_bytes(raw, byteorder='big'))
if __name__=='__main__':
demo = [b"", b"a", b"abc", b"message digest", b"abcdefghijklmnopqrstuvwxyz",
b"ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789",
b"12345678901234567890123456789012345678901234567890123456789012345678901234567890"]
for message in demo:
print(md5_to_hex(md5(message)),' <= "',message.decode('ascii'),'"', sep='')
| package main
import (
"fmt"
"math"
"bytes"
"encoding/binary"
)
type testCase struct {
hashCode string
string
}
var testCases = []testCase{
{"d41d8cd98f00b204e9800998ecf8427e", ""},
{"0cc175b9c0f1b6a831c399e269772661", "a"},
{"900150983cd24fb0d6963f7d28e17f72", "abc"},
{"f96b697d7cb7938d525a2f31aaf161d0", "message digest"},
{"c3fcd3d76192e4007dfb496cca67e13b", "abcdefghijklmnopqrstuvwxyz"},
{"d174ab98d277d9f5a5611c2c9f419d9f",
"ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789"},
{"57edf4a22be3c955ac49da2e2107b67a", "12345678901234567890" +
"123456789012345678901234567890123456789012345678901234567890"},
}
func main() {
for _, tc := range testCases {
fmt.Printf("%s\n%x\n\n", tc.hashCode, md5(tc.string))
}
}
var shift = [...]uint{7, 12, 17, 22, 5, 9, 14, 20, 4, 11, 16, 23, 6, 10, 15, 21}
var table [64]uint32
func init() {
for i := range table {
table[i] = uint32((1 << 32) * math.Abs(math.Sin(float64(i + 1))))
}
}
func md5(s string) (r [16]byte) {
padded := bytes.NewBuffer([]byte(s))
padded.WriteByte(0x80)
for padded.Len() % 64 != 56 {
padded.WriteByte(0)
}
messageLenBits := uint64(len(s)) * 8
binary.Write(padded, binary.LittleEndian, messageLenBits)
var a, b, c, d uint32 = 0x67452301, 0xEFCDAB89, 0x98BADCFE, 0x10325476
var buffer [16]uint32
for binary.Read(padded, binary.LittleEndian, buffer[:]) == nil {
a1, b1, c1, d1 := a, b, c, d
for j := 0; j < 64; j++ {
var f uint32
bufferIndex := j
round := j >> 4
switch round {
case 0:
f = (b1 & c1) | (^b1 & d1)
case 1:
f = (b1 & d1) | (c1 & ^d1)
bufferIndex = (bufferIndex*5 + 1) & 0x0F
case 2:
f = b1 ^ c1 ^ d1
bufferIndex = (bufferIndex*3 + 5) & 0x0F
case 3:
f = c1 ^ (b1 | ^d1)
bufferIndex = (bufferIndex * 7) & 0x0F
}
sa := shift[(round<<2)|(j&3)]
a1 += f + buffer[bufferIndex] + table[j]
a1, d1, c1, b1 = d1, c1, b1, a1<<sa|a1>>(32-sa)+b1
}
a, b, c, d = a+a1, b+b1, c+c1, d+d1
}
binary.Write(bytes.NewBuffer(r[:0]), binary.LittleEndian, []uint32{a, b, c, d})
return
}
|
Translate this program into Go but keep the logic exactly as in Python. | from math import pi, sin, cos
from collections import namedtuple
from random import random, choice
from copy import copy
try:
import psyco
psyco.full()
except ImportError:
pass
FLOAT_MAX = 1e100
class Point:
__slots__ = ["x", "y", "group"]
def __init__(self, x=0.0, y=0.0, group=0):
self.x, self.y, self.group = x, y, group
def generate_points(npoints, radius):
points = [Point() for _ in xrange(npoints)]
for p in points:
r = random() * radius
ang = random() * 2 * pi
p.x = r * cos(ang)
p.y = r * sin(ang)
return points
def nearest_cluster_center(point, cluster_centers):
def sqr_distance_2D(a, b):
return (a.x - b.x) ** 2 + (a.y - b.y) ** 2
min_index = point.group
min_dist = FLOAT_MAX
for i, cc in enumerate(cluster_centers):
d = sqr_distance_2D(cc, point)
if min_dist > d:
min_dist = d
min_index = i
return (min_index, min_dist)
def kpp(points, cluster_centers):
cluster_centers[0] = copy(choice(points))
d = [0.0 for _ in xrange(len(points))]
for i in xrange(1, len(cluster_centers)):
sum = 0
for j, p in enumerate(points):
d[j] = nearest_cluster_center(p, cluster_centers[:i])[1]
sum += d[j]
sum *= random()
for j, di in enumerate(d):
sum -= di
if sum > 0:
continue
cluster_centers[i] = copy(points[j])
break
for p in points:
p.group = nearest_cluster_center(p, cluster_centers)[0]
def lloyd(points, nclusters):
cluster_centers = [Point() for _ in xrange(nclusters)]
kpp(points, cluster_centers)
lenpts10 = len(points) >> 10
changed = 0
while True:
for cc in cluster_centers:
cc.x = 0
cc.y = 0
cc.group = 0
for p in points:
cluster_centers[p.group].group += 1
cluster_centers[p.group].x += p.x
cluster_centers[p.group].y += p.y
for cc in cluster_centers:
cc.x /= cc.group
cc.y /= cc.group
changed = 0
for p in points:
min_i = nearest_cluster_center(p, cluster_centers)[0]
if min_i != p.group:
changed += 1
p.group = min_i
if changed <= lenpts10:
break
for i, cc in enumerate(cluster_centers):
cc.group = i
return cluster_centers
def print_eps(points, cluster_centers, W=400, H=400):
Color = namedtuple("Color", "r g b");
colors = []
for i in xrange(len(cluster_centers)):
colors.append(Color((3 * (i + 1) % 11) / 11.0,
(7 * i % 11) / 11.0,
(9 * i % 11) / 11.0))
max_x = max_y = -FLOAT_MAX
min_x = min_y = FLOAT_MAX
for p in points:
if max_x < p.x: max_x = p.x
if min_x > p.x: min_x = p.x
if max_y < p.y: max_y = p.y
if min_y > p.y: min_y = p.y
scale = min(W / (max_x - min_x),
H / (max_y - min_y))
cx = (max_x + min_x) / 2
cy = (max_y + min_y) / 2
print "%%!PS-Adobe-3.0\n%%%%BoundingBox: -5 -5 %d %d" % (W + 10, H + 10)
print ("/l {rlineto} def /m {rmoveto} def\n" +
"/c { .25 sub exch .25 sub exch .5 0 360 arc fill } def\n" +
"/s { moveto -2 0 m 2 2 l 2 -2 l -2 -2 l closepath " +
" gsave 1 setgray fill grestore gsave 3 setlinewidth" +
" 1 setgray stroke grestore 0 setgray stroke }def")
for i, cc in enumerate(cluster_centers):
print ("%g %g %g setrgbcolor" %
(colors[i].r, colors[i].g, colors[i].b))
for p in points:
if p.group != i:
continue
print ("%.3f %.3f c" % ((p.x - cx) * scale + W / 2,
(p.y - cy) * scale + H / 2))
print ("\n0 setgray %g %g s" % ((cc.x - cx) * scale + W / 2,
(cc.y - cy) * scale + H / 2))
print "\n%%%%EOF"
def main():
npoints = 30000
k = 7
points = generate_points(npoints, 10)
cluster_centers = lloyd(points, k)
print_eps(points, cluster_centers)
main()
| package main
import (
"fmt"
"image"
"image/color"
"image/draw"
"image/png"
"math"
"math/rand"
"os"
"time"
)
type r2 struct {
x, y float64
}
type r2c struct {
r2
c int
}
func kmpp(k int, data []r2c) {
kMeans(data, kmppSeeds(k, data))
}
func kmppSeeds(k int, data []r2c) []r2 {
s := make([]r2, k)
s[0] = data[rand.Intn(len(data))].r2
d2 := make([]float64, len(data))
for i := 1; i < k; i++ {
var sum float64
for j, p := range data {
_, dMin := nearest(p, s[:i])
d2[j] = dMin * dMin
sum += d2[j]
}
target := rand.Float64() * sum
j := 0
for sum = d2[0]; sum < target; sum += d2[j] {
j++
}
s[i] = data[j].r2
}
return s
}
func nearest(p r2c, mean []r2) (int, float64) {
iMin := 0
dMin := math.Hypot(p.x-mean[0].x, p.y-mean[0].y)
for i := 1; i < len(mean); i++ {
d := math.Hypot(p.x-mean[i].x, p.y-mean[i].y)
if d < dMin {
dMin = d
iMin = i
}
}
return iMin, dMin
}
func kMeans(data []r2c, mean []r2) {
for i, p := range data {
cMin, _ := nearest(p, mean)
data[i].c = cMin
}
mLen := make([]int, len(mean))
for {
for i := range mean {
mean[i] = r2{}
mLen[i] = 0
}
for _, p := range data {
mean[p.c].x += p.x
mean[p.c].y += p.y
mLen[p.c]++
}
for i := range mean {
inv := 1 / float64(mLen[i])
mean[i].x *= inv
mean[i].y *= inv
}
var changes int
for i, p := range data {
if cMin, _ := nearest(p, mean); cMin != p.c {
changes++
data[i].c = cMin
}
}
if changes == 0 {
return
}
}
}
type ecParam struct {
k int
nPoints int
xBox, yBox int
stdv int
}
func main() {
ec := &ecParam{6, 30000, 300, 200, 30}
origin, data := genECData(ec)
vis(ec, data, "origin")
fmt.Println("Data set origins:")
fmt.Println(" x y")
for _, o := range origin {
fmt.Printf("%5.1f %5.1f\n", o.x, o.y)
}
kmpp(ec.k, data)
fmt.Println(
"\nCluster centroids, mean distance from centroid, number of points:")
fmt.Println(" x y distance points")
cent := make([]r2, ec.k)
cLen := make([]int, ec.k)
inv := make([]float64, ec.k)
for _, p := range data {
cent[p.c].x += p.x
cent[p.c].y += p.y
cLen[p.c]++
}
for i, iLen := range cLen {
inv[i] = 1 / float64(iLen)
cent[i].x *= inv[i]
cent[i].y *= inv[i]
}
dist := make([]float64, ec.k)
for _, p := range data {
dist[p.c] += math.Hypot(p.x-cent[p.c].x, p.y-cent[p.c].y)
}
for i, iLen := range cLen {
fmt.Printf("%5.1f %5.1f %8.1f %6d\n",
cent[i].x, cent[i].y, dist[i]*inv[i], iLen)
}
vis(ec, data, "clusters")
}
func genECData(ec *ecParam) (orig []r2, data []r2c) {
rand.Seed(time.Now().UnixNano())
orig = make([]r2, ec.k)
data = make([]r2c, ec.nPoints)
for i, n := 0, 0; i < ec.k; i++ {
x := rand.Float64() * float64(ec.xBox)
y := rand.Float64() * float64(ec.yBox)
orig[i] = r2{x, y}
for j := ec.nPoints / ec.k; j > 0; j-- {
data[n].x = rand.NormFloat64()*float64(ec.stdv) + x
data[n].y = rand.NormFloat64()*float64(ec.stdv) + y
data[n].c = i
n++
}
}
return
}
func vis(ec *ecParam, data []r2c, fn string) {
colors := make([]color.NRGBA, ec.k)
for i := range colors {
i3 := i * 3
third := i3 / ec.k
frac := uint8((i3 % ec.k) * 255 / ec.k)
switch third {
case 0:
colors[i] = color.NRGBA{frac, 255 - frac, 0, 255}
case 1:
colors[i] = color.NRGBA{0, frac, 255 - frac, 255}
case 2:
colors[i] = color.NRGBA{255 - frac, 0, frac, 255}
}
}
bounds := image.Rect(-ec.stdv, -ec.stdv, ec.xBox+ec.stdv, ec.yBox+ec.stdv)
im := image.NewNRGBA(bounds)
draw.Draw(im, bounds, image.NewUniform(color.White), image.ZP, draw.Src)
fMinX := float64(bounds.Min.X)
fMaxX := float64(bounds.Max.X)
fMinY := float64(bounds.Min.Y)
fMaxY := float64(bounds.Max.Y)
for _, p := range data {
imx := math.Floor(p.x)
imy := math.Floor(float64(ec.yBox) - p.y)
if imx >= fMinX && imx < fMaxX && imy >= fMinY && imy < fMaxY {
im.SetNRGBA(int(imx), int(imy), colors[p.c])
}
}
f, err := os.Create(fn + ".png")
if err != nil {
fmt.Println(err)
return
}
err = png.Encode(f, im)
if err != nil {
fmt.Println(err)
}
err = f.Close()
if err != nil {
fmt.Println(err)
}
}
|
Generate a Go translation of this Python snippet without changing its computational steps. |
def Dijkstra(Graph, source):
infinity = float('infinity')
n = len(graph)
dist = [infinity]*n
previous = [infinity]*n
dist[source] = 0
Q = list(range(n))
while Q:
u = min(Q, key=lambda n:dist[n])
Q.remove(u)
if dist[u] == infinity:
break
for v in range(n):
if Graph[u][v] and (v in Q):
alt = dist[u] + Graph[u][v]
if alt < dist[v]:
dist[v] = alt
previous[v] = u
return dist,previous
def display_solution(predecessor):
cell = len(predecessor)-1
while cell:
print(cell,end='<')
cell = predecessor[cell]
print(0)
| package main
import (
"bytes"
"fmt"
"math/rand"
"time"
)
type maze struct {
c2 [][]byte
h2 [][]byte
v2 [][]byte
}
func newMaze(rows, cols int) *maze {
c := make([]byte, rows*cols)
h := bytes.Repeat([]byte{'-'}, rows*cols)
v := bytes.Repeat([]byte{'|'}, rows*cols)
c2 := make([][]byte, rows)
h2 := make([][]byte, rows)
v2 := make([][]byte, rows)
for i := range h2 {
c2[i] = c[i*cols : (i+1)*cols]
h2[i] = h[i*cols : (i+1)*cols]
v2[i] = v[i*cols : (i+1)*cols]
}
return &maze{c2, h2, v2}
}
func (m *maze) String() string {
hWall := []byte("+---")
hOpen := []byte("+ ")
vWall := []byte("| ")
vOpen := []byte(" ")
rightCorner := []byte("+\n")
rightWall := []byte("|\n")
var b []byte
for r, hw := range m.h2 {
for _, h := range hw {
if h == '-' || r == 0 {
b = append(b, hWall...)
} else {
b = append(b, hOpen...)
if h != '-' && h != 0 {
b[len(b)-2] = h
}
}
}
b = append(b, rightCorner...)
for c, vw := range m.v2[r] {
if vw == '|' || c == 0 {
b = append(b, vWall...)
} else {
b = append(b, vOpen...)
if vw != '|' && vw != 0 {
b[len(b)-4] = vw
}
}
if m.c2[r][c] != 0 {
b[len(b)-2] = m.c2[r][c]
}
}
b = append(b, rightWall...)
}
for _ = range m.h2[0] {
b = append(b, hWall...)
}
b = append(b, rightCorner...)
return string(b)
}
func (m *maze) gen() {
m.g2(rand.Intn(len(m.c2)), rand.Intn(len(m.c2[0])))
}
const (
up = iota
dn
rt
lf
)
func (m *maze) g2(r, c int) {
m.c2[r][c] = ' '
for _, dir := range rand.Perm(4) {
switch dir {
case up:
if r > 0 && m.c2[r-1][c] == 0 {
m.h2[r][c] = 0
m.g2(r-1, c)
}
case lf:
if c > 0 && m.c2[r][c-1] == 0 {
m.v2[r][c] = 0
m.g2(r, c-1)
}
case dn:
if r < len(m.c2)-1 && m.c2[r+1][c] == 0 {
m.h2[r+1][c] = 0
m.g2(r+1, c)
}
case rt:
if c < len(m.c2[0])-1 && m.c2[r][c+1] == 0 {
m.v2[r][c+1] = 0
m.g2(r, c+1)
}
}
}
}
func main() {
rand.Seed(time.Now().UnixNano())
const height = 4
const width = 7
m := newMaze(height, width)
m.gen()
m.solve(
rand.Intn(height), rand.Intn(width),
rand.Intn(height), rand.Intn(width))
fmt.Print(m)
}
func (m *maze) solve(ra, ca, rz, cz int) {
var rSolve func(ra, ca, dir int) bool
rSolve = func(r, c, dir int) bool {
if r == rz && c == cz {
m.c2[r][c] = 'F'
return true
}
if dir != dn && m.h2[r][c] == 0 {
if rSolve(r-1, c, up) {
m.c2[r][c] = '^'
m.h2[r][c] = '^'
return true
}
}
if dir != up && r+1 < len(m.h2) && m.h2[r+1][c] == 0 {
if rSolve(r+1, c, dn) {
m.c2[r][c] = 'v'
m.h2[r+1][c] = 'v'
return true
}
}
if dir != lf && c+1 < len(m.v2[0]) && m.v2[r][c+1] == 0 {
if rSolve(r, c+1, rt) {
m.c2[r][c] = '>'
m.v2[r][c+1] = '>'
return true
}
}
if dir != rt && m.v2[r][c] == 0 {
if rSolve(r, c-1, lf) {
m.c2[r][c] = '<'
m.v2[r][c] = '<'
return true
}
}
return false
}
rSolve(ra, ca, -1)
m.c2[ra][ca] = 'S'
}
|
Write the same code in Go as shown below in Python. | import random
print(random.sample(range(1, 21), 20))
| package main
import (
"fmt"
"log"
"math/rand"
"time"
)
func generate(from, to int64) {
if to < from || from < 0 {
log.Fatal("Invalid range.")
}
span := to - from + 1
generated := make([]bool, span)
count := span
for count > 0 {
n := from + rand.Int63n(span)
if !generated[n-from] {
generated[n-from] = true
fmt.Printf("%2d ", n)
count--
}
}
fmt.Println()
}
func main() {
rand.Seed(time.Now().UnixNano())
for i := 1; i <= 5; i++ {
generate(1, 20)
}
}
|
Maintain the same structure and functionality when rewriting this code in Go. |
def DrawBoard(board):
peg = [0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0]
for n in xrange(1,16):
peg[n] = '.'
if n in board:
peg[n] = "%X" % n
print " %s" % peg[1]
print " %s %s" % (peg[2],peg[3])
print " %s %s %s" % (peg[4],peg[5],peg[6])
print " %s %s %s %s" % (peg[7],peg[8],peg[9],peg[10])
print " %s %s %s %s %s" % (peg[11],peg[12],peg[13],peg[14],peg[15])
def RemovePeg(board,n):
board.remove(n)
def AddPeg(board,n):
board.append(n)
def IsPeg(board,n):
return n in board
JumpMoves = { 1: [ (2,4),(3,6) ],
2: [ (4,7),(5,9) ],
3: [ (5,8),(6,10) ],
4: [ (2,1),(5,6),(7,11),(8,13) ],
5: [ (8,12),(9,14) ],
6: [ (3,1),(5,4),(9,13),(10,15) ],
7: [ (4,2),(8,9) ],
8: [ (5,3),(9,10) ],
9: [ (5,2),(8,7) ],
10: [ (9,8) ],
11: [ (12,13) ],
12: [ (8,5),(13,14) ],
13: [ (8,4),(9,6),(12,11),(14,15) ],
14: [ (9,5),(13,12) ],
15: [ (10,6),(14,13) ]
}
Solution = []
def Solve(board):
if len(board) == 1:
return board
for peg in xrange(1,16):
if IsPeg(board,peg):
movelist = JumpMoves[peg]
for over,land in movelist:
if IsPeg(board,over) and not IsPeg(board,land):
saveboard = board[:]
RemovePeg(board,peg)
RemovePeg(board,over)
AddPeg(board,land)
Solution.append((peg,over,land))
board = Solve(board)
if len(board) == 1:
return board
board = saveboard[:]
del Solution[-1]
return board
def InitSolve(empty):
board = [1,2,3,4,5,6,7,8,9,10,11,12,13,14,15]
RemovePeg(board,empty_start)
Solve(board)
empty_start = 1
InitSolve(empty_start)
board = [1,2,3,4,5,6,7,8,9,10,11,12,13,14,15]
RemovePeg(board,empty_start)
for peg,over,land in Solution:
RemovePeg(board,peg)
RemovePeg(board,over)
AddPeg(board,land)
DrawBoard(board)
print "Peg %X jumped over %X to land on %X\n" % (peg,over,land)
| package main
import "fmt"
type solution struct{ peg, over, land int }
type move struct{ from, to int }
var emptyStart = 1
var board [16]bool
var jumpMoves = [16][]move{
{},
{{2, 4}, {3, 6}},
{{4, 7}, {5, 9}},
{{5, 8}, {6, 10}},
{{2, 1}, {5, 6}, {7, 11}, {8, 13}},
{{8, 12}, {9, 14}},
{{3, 1}, {5, 4}, {9, 13}, {10, 15}},
{{4, 2}, {8, 9}},
{{5, 3}, {9, 10}},
{{5, 2}, {8, 7}},
{{9, 8}},
{{12, 13}},
{{8, 5}, {13, 14}},
{{8, 4}, {9, 6}, {12, 11}, {14, 15}},
{{9, 5}, {13, 12}},
{{10, 6}, {14, 13}},
}
var solutions []solution
func initBoard() {
for i := 1; i < 16; i++ {
board[i] = true
}
board[emptyStart] = false
}
func (sol solution) split() (int, int, int) {
return sol.peg, sol.over, sol.land
}
func (mv move) split() (int, int) {
return mv.from, mv.to
}
func drawBoard() {
var pegs [16]byte
for i := 1; i < 16; i++ {
if board[i] {
pegs[i] = fmt.Sprintf("%X", i)[0]
} else {
pegs[i] = '-'
}
}
fmt.Printf(" %c\n", pegs[1])
fmt.Printf(" %c %c\n", pegs[2], pegs[3])
fmt.Printf(" %c %c %c\n", pegs[4], pegs[5], pegs[6])
fmt.Printf(" %c %c %c %c\n", pegs[7], pegs[8], pegs[9], pegs[10])
fmt.Printf(" %c %c %c %c %c\n", pegs[11], pegs[12], pegs[13], pegs[14], pegs[15])
}
func solved() bool {
count := 0
for _, b := range board {
if b {
count++
}
}
return count == 1
}
func solve() {
if solved() {
return
}
for peg := 1; peg < 16; peg++ {
if board[peg] {
for _, mv := range jumpMoves[peg] {
over, land := mv.split()
if board[over] && !board[land] {
saveBoard := board
board[peg] = false
board[over] = false
board[land] = true
solutions = append(solutions, solution{peg, over, land})
solve()
if solved() {
return
}
board = saveBoard
solutions = solutions[:len(solutions)-1]
}
}
}
}
}
func main() {
initBoard()
solve()
initBoard()
drawBoard()
fmt.Printf("Starting with peg %X removed\n\n", emptyStart)
for _, solution := range solutions {
peg, over, land := solution.split()
board[peg] = false
board[over] = false
board[land] = true
drawBoard()
fmt.Printf("Peg %X jumped over %X to land on %X\n\n", peg, over, land)
}
}
|
Convert this Python block to Go, preserving its control flow and logic. | from itertools import combinations_with_replacement as cmbr
from time import time
def dice_gen(n, faces, m):
dice = list(cmbr(faces, n))
succ = [set(j for j, b in enumerate(dice)
if sum((x>y) - (x<y) for x in a for y in b) > 0)
for a in dice]
def loops(seq):
s = succ[seq[-1]]
if len(seq) == m:
if seq[0] in s: yield seq
return
for d in (x for x in s if x > seq[0] and not x in seq):
yield from loops(seq + (d,))
yield from (tuple(''.join(dice[s]) for s in x)
for i, v in enumerate(succ)
for x in loops((i,)))
t = time()
for n, faces, loop_len in [(4, '1234', 3), (4, '1234', 4), (6, '123456', 3), (6, '1234567', 3)]:
for i, x in enumerate(dice_gen(n, faces, loop_len)): pass
print(f'{n}-sided, markings {faces}, loop length {loop_len}:')
print(f'\t{i + 1}*{loop_len} solutions, e.g. {" > ".join(x)} > [loop]')
t, t0 = time(), t
print(f'\ttime: {t - t0:.4f} seconds\n')
| package main
import (
"fmt"
"sort"
)
func fourFaceCombs() (res [][4]int) {
found := make([]bool, 256)
for i := 1; i <= 4; i++ {
for j := 1; j <= 4; j++ {
for k := 1; k <= 4; k++ {
for l := 1; l <= 4; l++ {
c := [4]int{i, j, k, l}
sort.Ints(c[:])
key := 64*(c[0]-1) + 16*(c[1]-1) + 4*(c[2]-1) + (c[3] - 1)
if !found[key] {
found[key] = true
res = append(res, c)
}
}
}
}
}
return
}
func cmp(x, y [4]int) int {
xw := 0
yw := 0
for i := 0; i < 4; i++ {
for j := 0; j < 4; j++ {
if x[i] > y[j] {
xw++
} else if y[j] > x[i] {
yw++
}
}
}
if xw < yw {
return -1
} else if xw > yw {
return 1
}
return 0
}
func findIntransitive3(cs [][4]int) (res [][3][4]int) {
var c = len(cs)
for i := 0; i < c; i++ {
for j := 0; j < c; j++ {
for k := 0; k < c; k++ {
first := cmp(cs[i], cs[j])
if first == -1 {
second := cmp(cs[j], cs[k])
if second == -1 {
third := cmp(cs[i], cs[k])
if third == 1 {
res = append(res, [3][4]int{cs[i], cs[j], cs[k]})
}
}
}
}
}
}
return
}
func findIntransitive4(cs [][4]int) (res [][4][4]int) {
c := len(cs)
for i := 0; i < c; i++ {
for j := 0; j < c; j++ {
for k := 0; k < c; k++ {
for l := 0; l < c; l++ {
first := cmp(cs[i], cs[j])
if first == -1 {
second := cmp(cs[j], cs[k])
if second == -1 {
third := cmp(cs[k], cs[l])
if third == -1 {
fourth := cmp(cs[i], cs[l])
if fourth == 1 {
res = append(res, [4][4]int{cs[i], cs[j], cs[k], cs[l]})
}
}
}
}
}
}
}
}
return
}
func main() {
combs := fourFaceCombs()
fmt.Println("Number of eligible 4-faced dice", len(combs))
it3 := findIntransitive3(combs)
fmt.Printf("\n%d ordered lists of 3 non-transitive dice found, namely:\n", len(it3))
for _, a := range it3 {
fmt.Println(a)
}
it4 := findIntransitive4(combs)
fmt.Printf("\n%d ordered lists of 4 non-transitive dice found, namely:\n", len(it4))
for _, a := range it4 {
fmt.Println(a)
}
}
|
Write the same code in Go as shown below in Python. | from itertools import combinations_with_replacement as cmbr
from time import time
def dice_gen(n, faces, m):
dice = list(cmbr(faces, n))
succ = [set(j for j, b in enumerate(dice)
if sum((x>y) - (x<y) for x in a for y in b) > 0)
for a in dice]
def loops(seq):
s = succ[seq[-1]]
if len(seq) == m:
if seq[0] in s: yield seq
return
for d in (x for x in s if x > seq[0] and not x in seq):
yield from loops(seq + (d,))
yield from (tuple(''.join(dice[s]) for s in x)
for i, v in enumerate(succ)
for x in loops((i,)))
t = time()
for n, faces, loop_len in [(4, '1234', 3), (4, '1234', 4), (6, '123456', 3), (6, '1234567', 3)]:
for i, x in enumerate(dice_gen(n, faces, loop_len)): pass
print(f'{n}-sided, markings {faces}, loop length {loop_len}:')
print(f'\t{i + 1}*{loop_len} solutions, e.g. {" > ".join(x)} > [loop]')
t, t0 = time(), t
print(f'\ttime: {t - t0:.4f} seconds\n')
| package main
import (
"fmt"
"sort"
)
func fourFaceCombs() (res [][4]int) {
found := make([]bool, 256)
for i := 1; i <= 4; i++ {
for j := 1; j <= 4; j++ {
for k := 1; k <= 4; k++ {
for l := 1; l <= 4; l++ {
c := [4]int{i, j, k, l}
sort.Ints(c[:])
key := 64*(c[0]-1) + 16*(c[1]-1) + 4*(c[2]-1) + (c[3] - 1)
if !found[key] {
found[key] = true
res = append(res, c)
}
}
}
}
}
return
}
func cmp(x, y [4]int) int {
xw := 0
yw := 0
for i := 0; i < 4; i++ {
for j := 0; j < 4; j++ {
if x[i] > y[j] {
xw++
} else if y[j] > x[i] {
yw++
}
}
}
if xw < yw {
return -1
} else if xw > yw {
return 1
}
return 0
}
func findIntransitive3(cs [][4]int) (res [][3][4]int) {
var c = len(cs)
for i := 0; i < c; i++ {
for j := 0; j < c; j++ {
for k := 0; k < c; k++ {
first := cmp(cs[i], cs[j])
if first == -1 {
second := cmp(cs[j], cs[k])
if second == -1 {
third := cmp(cs[i], cs[k])
if third == 1 {
res = append(res, [3][4]int{cs[i], cs[j], cs[k]})
}
}
}
}
}
}
return
}
func findIntransitive4(cs [][4]int) (res [][4][4]int) {
c := len(cs)
for i := 0; i < c; i++ {
for j := 0; j < c; j++ {
for k := 0; k < c; k++ {
for l := 0; l < c; l++ {
first := cmp(cs[i], cs[j])
if first == -1 {
second := cmp(cs[j], cs[k])
if second == -1 {
third := cmp(cs[k], cs[l])
if third == -1 {
fourth := cmp(cs[i], cs[l])
if fourth == 1 {
res = append(res, [4][4]int{cs[i], cs[j], cs[k], cs[l]})
}
}
}
}
}
}
}
}
return
}
func main() {
combs := fourFaceCombs()
fmt.Println("Number of eligible 4-faced dice", len(combs))
it3 := findIntransitive3(combs)
fmt.Printf("\n%d ordered lists of 3 non-transitive dice found, namely:\n", len(it3))
for _, a := range it3 {
fmt.Println(a)
}
it4 := findIntransitive4(combs)
fmt.Printf("\n%d ordered lists of 4 non-transitive dice found, namely:\n", len(it4))
for _, a := range it4 {
fmt.Println(a)
}
}
|
Ensure the translated Go code behaves exactly like the original Python snippet. | import sys
HIST = {}
def trace(frame, event, arg):
for name,val in frame.f_locals.items():
if name not in HIST:
HIST[name] = []
else:
if HIST[name][-1] is val:
continue
HIST[name].append(val)
return trace
def undo(name):
HIST[name].pop(-1)
return HIST[name][-1]
def main():
a = 10
a = 20
for i in range(5):
c = i
print "c:", c, "-> undo x3 ->",
c = undo('c')
c = undo('c')
c = undo('c')
print c
print 'HIST:', HIST
sys.settrace(trace)
main()
| package main
import (
"fmt"
"sort"
"sync"
"time"
)
type history struct {
timestamp tsFunc
hs []hset
}
type tsFunc func() time.Time
type hset struct {
int
t time.Time
}
func newHistory(ts tsFunc) history {
return history{ts, []hset{{t: ts()}}}
}
func (h history) int() int {
return h.hs[len(h.hs)-1].int
}
func (h *history) set(x int) time.Time {
t := h.timestamp()
h.hs = append(h.hs, hset{x, t})
return t
}
func (h history) dump() {
for _, hs := range h.hs {
fmt.Println(hs.t.Format(time.StampNano), hs.int)
}
}
func (h history) recall(t time.Time) (int, bool) {
i := sort.Search(len(h.hs), func(i int) bool {
return h.hs[i].t.After(t)
})
if i > 0 {
return h.hs[i-1].int, true
}
return 0, false
}
func newTimestamper() tsFunc {
var last time.Time
return func() time.Time {
if t := time.Now(); t.After(last) {
last = t
} else {
last.Add(1)
}
return last
}
}
func newProtectedTimestamper() tsFunc {
var last time.Time
var m sync.Mutex
return func() (t time.Time) {
t = time.Now()
m.Lock()
if t.After(last) {
last = t
} else {
last.Add(1)
t = last
}
m.Unlock()
return
}
}
func main() {
ts := newTimestamper()
h := newHistory(ts)
ref := []time.Time{h.set(3), h.set(1), h.set(4)}
fmt.Println("History of variable h:")
h.dump()
fmt.Println("Recalling values:")
for _, t := range ref {
rv, _ := h.recall(t)
fmt.Println(rv)
}
}
|
Keep all operations the same but rewrite the snippet in Go. | import random
TRAINING_LENGTH = 2000
class Perceptron:
def __init__(self,n):
self.c = .01
self.weights = [random.uniform(-1.0, 1.0) for _ in range(n)]
def feed_forward(self, inputs):
vars = []
for i in range(len(inputs)):
vars.append(inputs[i] * self.weights[i])
return self.activate(sum(vars))
def activate(self, value):
return 1 if value > 0 else -1
def train(self, inputs, desired):
guess = self.feed_forward(inputs)
error = desired - guess
for i in range(len(inputs)):
self.weights[i] += self.c * error * inputs[i]
class Trainer():
def __init__(self, x, y, a):
self.inputs = [x, y, 1]
self.answer = a
def F(x):
return 2 * x + 1
if __name__ == "__main__":
ptron = Perceptron(3)
training = []
for i in range(TRAINING_LENGTH):
x = random.uniform(-10,10)
y = random.uniform(-10,10)
answer = 1
if y < F(x): answer = -1
training.append(Trainer(x,y,answer))
result = []
for y in range(-10,10):
temp = []
for x in range(-10,10):
if ptron.feed_forward([x,y,1]) == 1:
temp.append('^')
else:
temp.append('.')
result.append(temp)
print('Untrained')
for row in result:
print(''.join(v for v in row))
for t in training:
ptron.train(t.inputs, t.answer)
result = []
for y in range(-10,10):
temp = []
for x in range(-10,10):
if ptron.feed_forward([x,y,1]) == 1:
temp.append('^')
else:
temp.append('.')
result.append(temp)
print('Trained')
for row in result:
print(''.join(v for v in row))
| package main
import (
"github.com/fogleman/gg"
"math/rand"
"time"
)
const c = 0.00001
func linear(x float64) float64 {
return x*0.7 + 40
}
type trainer struct {
inputs []float64
answer int
}
func newTrainer(x, y float64, a int) *trainer {
return &trainer{[]float64{x, y, 1}, a}
}
type perceptron struct {
weights []float64
training []*trainer
}
func newPerceptron(n, w, h int) *perceptron {
weights := make([]float64, n)
for i := 0; i < n; i++ {
weights[i] = rand.Float64()*2 - 1
}
training := make([]*trainer, 2000)
for i := 0; i < 2000; i++ {
x := rand.Float64() * float64(w)
y := rand.Float64() * float64(h)
answer := 1
if y < linear(x) {
answer = -1
}
training[i] = newTrainer(x, y, answer)
}
return &perceptron{weights, training}
}
func (p *perceptron) feedForward(inputs []float64) int {
if len(inputs) != len(p.weights) {
panic("weights and input length mismatch, program terminated")
}
sum := 0.0
for i, w := range p.weights {
sum += inputs[i] * w
}
if sum > 0 {
return 1
}
return -1
}
func (p *perceptron) train(inputs []float64, desired int) {
guess := p.feedForward(inputs)
err := float64(desired - guess)
for i := range p.weights {
p.weights[i] += c * err * inputs[i]
}
}
func (p *perceptron) draw(dc *gg.Context, iterations int) {
le := len(p.training)
for i, count := 0, 0; i < iterations; i, count = i+1, (count+1)%le {
p.train(p.training[count].inputs, p.training[count].answer)
}
x := float64(dc.Width())
y := linear(x)
dc.SetLineWidth(2)
dc.SetRGB255(0, 0, 0)
dc.DrawLine(0, linear(0), x, y)
dc.Stroke()
dc.SetLineWidth(1)
for i := 0; i < le; i++ {
guess := p.feedForward(p.training[i].inputs)
x := p.training[i].inputs[0] - 4
y := p.training[i].inputs[1] - 4
if guess > 0 {
dc.SetRGB(0, 0, 1)
} else {
dc.SetRGB(1, 0, 0)
}
dc.DrawCircle(x, y, 8)
dc.Stroke()
}
}
func main() {
rand.Seed(time.Now().UnixNano())
w, h := 640, 360
perc := newPerceptron(3, w, h)
dc := gg.NewContext(w, h)
dc.SetRGB(1, 1, 1)
dc.Clear()
perc.draw(dc, 2000)
dc.SavePNG("perceptron.png")
}
|
Translate this program into Go but keep the logic exactly as in Python. | >>> exec
10
| package main
import (
"fmt"
"bitbucket.org/binet/go-eval/pkg/eval"
"go/token"
)
func main() {
w := eval.NewWorld();
fset := token.NewFileSet();
code, err := w.Compile(fset, "1 + 2")
if err != nil {
fmt.Println("Compile error");
return
}
val, err := code.Run();
if err != nil {
fmt.Println("Run time error");
return;
}
fmt.Println("Return value:", val)
}
|
Generate a Go translation of this Python snippet without changing its computational steps. | >>> exec
10
| package main
import (
"fmt"
"bitbucket.org/binet/go-eval/pkg/eval"
"go/token"
)
func main() {
w := eval.NewWorld();
fset := token.NewFileSet();
code, err := w.Compile(fset, "1 + 2")
if err != nil {
fmt.Println("Compile error");
return
}
val, err := code.Run();
if err != nil {
fmt.Println("Run time error");
return;
}
fmt.Println("Return value:", val)
}
|
Change the programming language of this snippet from Python to Go without modifying what it does. | from sympy import isprime, lcm, factorint, primerange
from functools import reduce
def pisano1(m):
"Simple definition"
if m < 2:
return 1
lastn, n = 0, 1
for i in range(m ** 2):
lastn, n = n, (lastn + n) % m
if lastn == 0 and n == 1:
return i + 1
return 1
def pisanoprime(p, k):
"Use conjecture π(p ** k) == p ** (k − 1) * π(p) for prime p and int k > 1"
assert isprime(p) and k > 0
return p ** (k - 1) * pisano1(p)
def pisano_mult(m, n):
"pisano(m*n) where m and n assumed coprime integers"
return lcm(pisano1(m), pisano1(n))
def pisano2(m):
"Uses prime factorization of m"
return reduce(lcm, (pisanoprime(prime, mult)
for prime, mult in factorint(m).items()), 1)
if __name__ == '__main__':
for n in range(1, 181):
assert pisano1(n) == pisano2(n), "Wall-Sun-Sun prime exists??!!"
print("\nPisano period (p, 2) for primes less than 50\n ",
[pisanoprime(prime, 2) for prime in primerange(1, 50)])
print("\nPisano period (p, 1) for primes less than 180\n ",
[pisanoprime(prime, 1) for prime in primerange(1, 180)])
print("\nPisano period (p) for integers 1 to 180")
for i in range(1, 181):
print(" %3d" % pisano2(i), end="" if i % 10 else "\n")
| package main
import "fmt"
func gcd(a, b uint) uint {
if b == 0 {
return a
}
return gcd(b, a%b)
}
func lcm(a, b uint) uint {
return a / gcd(a, b) * b
}
func ipow(x, p uint) uint {
prod := uint(1)
for p > 0 {
if p&1 != 0 {
prod *= x
}
p >>= 1
x *= x
}
return prod
}
func getPrimes(n uint) []uint {
var primes []uint
for i := uint(2); i <= n; i++ {
div := n / i
mod := n % i
for mod == 0 {
primes = append(primes, i)
n = div
div = n / i
mod = n % i
}
}
return primes
}
func isPrime(n uint) bool {
switch {
case n < 2:
return false
case n%2 == 0:
return n == 2
case n%3 == 0:
return n == 3
default:
d := uint(5)
for d*d <= n {
if n%d == 0 {
return false
}
d += 2
if n%d == 0 {
return false
}
d += 4
}
return true
}
}
func pisanoPeriod(m uint) uint {
var p, c uint = 0, 1
for i := uint(0); i < m*m; i++ {
p, c = c, (p+c)%m
if p == 0 && c == 1 {
return i + 1
}
}
return 1
}
func pisanoPrime(p uint, k uint) uint {
if !isPrime(p) || k == 0 {
return 0
}
return ipow(p, k-1) * pisanoPeriod(p)
}
func pisano(m uint) uint {
primes := getPrimes(m)
primePowers := make(map[uint]uint)
for _, p := range primes {
primePowers[p]++
}
var pps []uint
for k, v := range primePowers {
pps = append(pps, pisanoPrime(k, v))
}
if len(pps) == 0 {
return 1
}
if len(pps) == 1 {
return pps[0]
}
f := pps[0]
for i := 1; i < len(pps); i++ {
f = lcm(f, pps[i])
}
return f
}
func main() {
for p := uint(2); p < 15; p++ {
pp := pisanoPrime(p, 2)
if pp > 0 {
fmt.Printf("pisanoPrime(%2d: 2) = %d\n", p, pp)
}
}
fmt.Println()
for p := uint(2); p < 180; p++ {
pp := pisanoPrime(p, 1)
if pp > 0 {
fmt.Printf("pisanoPrime(%3d: 1) = %d\n", p, pp)
}
}
fmt.Println()
fmt.Println("pisano(n) for integers 'n' from 1 to 180 are:")
for n := uint(1); n <= 180; n++ {
fmt.Printf("%3d ", pisano(n))
if n != 1 && n%15 == 0 {
fmt.Println()
}
}
fmt.Println()
}
|
Write the same code in Go as shown below in Python. | from itertools import count, islice
import numpy as np
from numpy import sin, cos, pi
ANGDIV = 12
ANG = 2*pi/ANGDIV
def draw_all(sols):
import matplotlib.pyplot as plt
def draw_track(ax, s):
turn, xend, yend = 0, [0], [0]
for d in s:
x0, y0 = xend[-1], yend[-1]
a = turn*ANG
cs, sn = cos(a), sin(a)
ang = a + d*pi/2
cx, cy = x0 + cos(ang), y0 + sin(ang)
da = np.linspace(ang, ang + d*ANG, 10)
xs = cx - cos(da)
ys = cy - sin(da)
ax.plot(xs, ys, 'green' if d == -1 else 'orange')
xend.append(xs[-1])
yend.append(ys[-1])
turn += d
ax.plot(xend, yend, 'k.', markersize=1)
ax.set_aspect(1)
ls = len(sols)
if ls == 0: return
w, h = min((abs(w*2 - h*3) + w*h - ls, w, h)
for w, h in ((w, (ls + w - 1)//w)
for w in range(1, ls + 1)))[1:]
fig, ax = plt.subplots(h, w, squeeze=False)
for a in ax.ravel(): a.set_axis_off()
for i, s in enumerate(sols):
draw_track(ax[i//w, i%w], s)
plt.show()
def match_up(this, that, equal_lr, seen):
if not this or not that: return
n = len(this[0][-1])
n2 = n*2
l_lo, l_hi, r_lo, r_hi = 0, 0, 0, 0
def record(m):
for _ in range(n2):
seen[m] = True
m = (m&1) << (n2 - 1) | (m >> 1)
if equal_lr:
m ^= (1<<n2) - 1
for _ in range(n2):
seen[m] = True
m = (m&1) << (n2 - 1) | (m >> 1)
l_n, r_n = len(this), len(that)
tol = 1e-3
while l_lo < l_n:
while l_hi < l_n and this[l_hi][0] - this[l_lo][0] <= tol:
l_hi += 1
while r_lo < r_n and that[r_lo][0] < this[l_lo][0] - tol:
r_lo += 1
r_hi = r_lo
while r_hi < r_n and that[r_hi][0] < this[l_lo][0] + tol:
r_hi += 1
for a in this[l_lo:l_hi]:
m_left = a[-2]<<n
for b in that[r_lo:r_hi]:
if (m := m_left | b[-2]) not in seen:
if np.abs(a[1] + b[2]) < tol:
record(m)
record(int(f'{m:b}'[::-1], base=2))
yield(a[-1] + b[-1])
l_lo, r_lo = l_hi, r_hi
def track_combo(left, right):
n = (left + right)//2
n1 = left + right - n
alphas = np.exp(1j*ANG*np.arange(ANGDIV))
def half_track(m, n):
turns = tuple(1 - 2*(m>>i & 1) for i in range(n))
rcnt = np.cumsum(turns)%ANGDIV
asum = np.sum(alphas[rcnt])
want = asum/alphas[rcnt[-1]]
return np.abs(asum), asum, want, m, turns
res = [[] for _ in range(right + 1)]
for i in range(1<<n):
b = i.bit_count()
if b <= right:
res[b].append(half_track(i, n))
for v in res: v.sort()
if n1 == n:
return res, res
res1 = [[] for _ in range(right + 1)]
for i in range(1<<n1):
b = i.bit_count()
if b <= right:
res1[b].append(half_track(i, n1))
for v in res: v.sort()
return res, res1
def railway(n):
seen = {}
for l in range(n//2, n + 1):
r = n - l
if not l >= r: continue
if (l - r)%ANGDIV == 0:
res_l, res_r = track_combo(l, r)
for i, this in enumerate(res_l):
if 2*i < r: continue
that = res_r[r - i]
for s in match_up(this, that, l == r, seen):
yield s
sols = []
for i, s in enumerate(railway(30)):
print(i + 1, s)
sols.append(s)
draw_all(sols[:40])
| package main
import "fmt"
const (
right = 1
left = -1
straight = 0
)
func normalize(tracks []int) string {
size := len(tracks)
a := make([]byte, size)
for i := 0; i < size; i++ {
a[i] = "abc"[tracks[i]+1]
}
norm := string(a)
for i := 0; i < size; i++ {
s := string(a)
if s < norm {
norm = s
}
tmp := a[0]
copy(a, a[1:])
a[size-1] = tmp
}
return norm
}
func fullCircleStraight(tracks []int, nStraight int) bool {
if nStraight == 0 {
return true
}
count := 0
for _, track := range tracks {
if track == straight {
count++
}
}
if count != nStraight {
return false
}
var straightTracks [12]int
for i, idx := 0, 0; i < len(tracks) && idx >= 0; i++ {
if tracks[i] == straight {
straightTracks[idx%12]++
}
idx += tracks[i]
}
any1, any2 := false, false
for i := 0; i <= 5; i++ {
if straightTracks[i] != straightTracks[i+6] {
any1 = true
break
}
}
for i := 0; i <= 7; i++ {
if straightTracks[i] != straightTracks[i+4] {
any2 = true
break
}
}
return !any1 || !any2
}
func fullCircleRight(tracks []int) bool {
sum := 0
for _, track := range tracks {
sum += track * 30
}
if sum%360 != 0 {
return false
}
var rTurns [12]int
for i, idx := 0, 0; i < len(tracks) && idx >= 0; i++ {
if tracks[i] == right {
rTurns[idx%12]++
}
idx += tracks[i]
}
any1, any2 := false, false
for i := 0; i <= 5; i++ {
if rTurns[i] != rTurns[i+6] {
any1 = true
break
}
}
for i := 0; i <= 7; i++ {
if rTurns[i] != rTurns[i+4] {
any2 = true
break
}
}
return !any1 || !any2
}
func circuits(nCurved, nStraight int) {
solutions := make(map[string][]int)
gen := getPermutationsGen(nCurved, nStraight)
for gen.hasNext() {
tracks := gen.next()
if !fullCircleStraight(tracks, nStraight) {
continue
}
if !fullCircleRight(tracks) {
continue
}
tracks2 := make([]int, len(tracks))
copy(tracks2, tracks)
solutions[normalize(tracks)] = tracks2
}
report(solutions, nCurved, nStraight)
}
func getPermutationsGen(nCurved, nStraight int) PermutationsGen {
if (nCurved+nStraight-12)%4 != 0 {
panic("input must be 12 + k * 4")
}
var trackTypes []int
switch nStraight {
case 0:
trackTypes = []int{right, left}
case 12:
trackTypes = []int{right, straight}
default:
trackTypes = []int{right, left, straight}
}
return NewPermutationsGen(nCurved+nStraight, trackTypes)
}
func report(sol map[string][]int, numC, numS int) {
size := len(sol)
fmt.Printf("\n%d solution(s) for C%d,%d \n", size, numC, numS)
if numC <= 20 {
for _, tracks := range sol {
for _, track := range tracks {
fmt.Printf("%2d ", track)
}
fmt.Println()
}
}
}
type PermutationsGen struct {
NumPositions int
choices []int
indices []int
sequence []int
carry int
}
func NewPermutationsGen(numPositions int, choices []int) PermutationsGen {
indices := make([]int, numPositions)
sequence := make([]int, numPositions)
carry := 0
return PermutationsGen{numPositions, choices, indices, sequence, carry}
}
func (p *PermutationsGen) next() []int {
p.carry = 1
for i := 1; i < len(p.indices) && p.carry > 0; i++ {
p.indices[i] += p.carry
p.carry = 0
if p.indices[i] == len(p.choices) {
p.carry = 1
p.indices[i] = 0
}
}
for j := 0; j < len(p.indices); j++ {
p.sequence[j] = p.choices[p.indices[j]]
}
return p.sequence
}
func (p *PermutationsGen) hasNext() bool {
return p.carry != 1
}
func main() {
for n := 12; n <= 28; n += 4 {
circuits(n, 0)
}
circuits(12, 4)
}
|
Ensure the translated Go code behaves exactly like the original Python snippet. | from itertools import imap, imap, groupby, chain, imap
from operator import itemgetter
from sys import argv
from array import array
def concat_map(func, it):
return list(chain.from_iterable(imap(func, it)))
def minima(poly):
return (min(pt[0] for pt in poly), min(pt[1] for pt in poly))
def translate_to_origin(poly):
(minx, miny) = minima(poly)
return [(x - minx, y - miny) for (x, y) in poly]
rotate90 = lambda (x, y): ( y, -x)
rotate180 = lambda (x, y): (-x, -y)
rotate270 = lambda (x, y): (-y, x)
reflect = lambda (x, y): (-x, y)
def rotations_and_reflections(poly):
return (poly,
map(rotate90, poly),
map(rotate180, poly),
map(rotate270, poly),
map(reflect, poly),
[reflect(rotate90(pt)) for pt in poly],
[reflect(rotate180(pt)) for pt in poly],
[reflect(rotate270(pt)) for pt in poly])
def canonical(poly):
return min(sorted(translate_to_origin(pl)) for pl in rotations_and_reflections(poly))
def unique(lst):
lst.sort()
return map(next, imap(itemgetter(1), groupby(lst)))
contiguous = lambda (x, y): [(x - 1, y), (x + 1, y), (x, y - 1), (x, y + 1)]
def new_points(poly):
return unique([pt for pt in concat_map(contiguous, poly) if pt not in poly])
def new_polys(poly):
return unique([canonical(poly + [pt]) for pt in new_points(poly)])
monomino = [(0, 0)]
monominoes = [monomino]
def rank(n):
assert n >= 0
if n == 0: return []
if n == 1: return monominoes
return unique(concat_map(new_polys, rank(n - 1)))
def text_representation(poly):
min_pt = minima(poly)
max_pt = (max(p[0] for p in poly), max(p[1] for p in poly))
table = [array('c', ' ') * (max_pt[1] - min_pt[1] + 1)
for _ in xrange(max_pt[0] - min_pt[0] + 1)]
for pt in poly:
table[pt[0] - min_pt[0]][pt[1] - min_pt[1]] = '
return "\n".join(row.tostring() for row in table)
def main():
print [len(rank(n)) for n in xrange(1, 11)]
n = int(argv[1]) if (len(argv) == 2) else 5
print "\nAll free polyominoes of rank %d:" % n
for poly in rank(n):
print text_representation(poly), "\n"
main()
| package main
import (
"fmt"
"sort"
)
type point struct{ x, y int }
type polyomino []point
type pointset map[point]bool
func (p point) rotate90() point { return point{p.y, -p.x} }
func (p point) rotate180() point { return point{-p.x, -p.y} }
func (p point) rotate270() point { return point{-p.y, p.x} }
func (p point) reflect() point { return point{-p.x, p.y} }
func (p point) String() string { return fmt.Sprintf("(%d, %d)", p.x, p.y) }
func (p point) contiguous() polyomino {
return polyomino{point{p.x - 1, p.y}, point{p.x + 1, p.y},
point{p.x, p.y - 1}, point{p.x, p.y + 1}}
}
func (po polyomino) minima() (int, int) {
minx := po[0].x
miny := po[0].y
for i := 1; i < len(po); i++ {
if po[i].x < minx {
minx = po[i].x
}
if po[i].y < miny {
miny = po[i].y
}
}
return minx, miny
}
func (po polyomino) translateToOrigin() polyomino {
minx, miny := po.minima()
res := make(polyomino, len(po))
for i, p := range po {
res[i] = point{p.x - minx, p.y - miny}
}
sort.Slice(res, func(i, j int) bool {
return res[i].x < res[j].x || (res[i].x == res[j].x && res[i].y < res[j].y)
})
return res
}
func (po polyomino) rotationsAndReflections() []polyomino {
rr := make([]polyomino, 8)
for i := 0; i < 8; i++ {
rr[i] = make(polyomino, len(po))
}
copy(rr[0], po)
for j := 0; j < len(po); j++ {
rr[1][j] = po[j].rotate90()
rr[2][j] = po[j].rotate180()
rr[3][j] = po[j].rotate270()
rr[4][j] = po[j].reflect()
rr[5][j] = po[j].rotate90().reflect()
rr[6][j] = po[j].rotate180().reflect()
rr[7][j] = po[j].rotate270().reflect()
}
return rr
}
func (po polyomino) canonical() polyomino {
rr := po.rotationsAndReflections()
minr := rr[0].translateToOrigin()
mins := minr.String()
for i := 1; i < 8; i++ {
r := rr[i].translateToOrigin()
s := r.String()
if s < mins {
minr = r
mins = s
}
}
return minr
}
func (po polyomino) String() string {
return fmt.Sprintf("%v", []point(po))
}
func (po polyomino) toPointset() pointset {
pset := make(pointset, len(po))
for _, p := range po {
pset[p] = true
}
return pset
}
func (po polyomino) newPoints() polyomino {
pset := po.toPointset()
m := make(pointset)
for _, p := range po {
pts := p.contiguous()
for _, pt := range pts {
if !pset[pt] {
m[pt] = true
}
}
}
poly := make(polyomino, 0, len(m))
for k := range m {
poly = append(poly, k)
}
return poly
}
func (po polyomino) newPolys() []polyomino {
pts := po.newPoints()
res := make([]polyomino, len(pts))
for i, pt := range pts {
poly := make(polyomino, len(po))
copy(poly, po)
poly = append(poly, pt)
res[i] = poly.canonical()
}
return res
}
var monomino = polyomino{point{0, 0}}
var monominoes = []polyomino{monomino}
func rank(n int) []polyomino {
switch {
case n < 0:
panic("n cannot be negative. Program terminated.")
case n == 0:
return []polyomino{}
case n == 1:
return monominoes
default:
r := rank(n - 1)
m := make(map[string]bool)
var polys []polyomino
for _, po := range r {
for _, po2 := range po.newPolys() {
if s := po2.String(); !m[s] {
polys = append(polys, po2)
m[s] = true
}
}
}
sort.Slice(polys, func(i, j int) bool {
return polys[i].String() < polys[j].String()
})
return polys
}
}
func main() {
const n = 5
fmt.Printf("All free polyominoes of rank %d:\n\n", n)
for _, poly := range rank(n) {
for _, pt := range poly {
fmt.Printf("%s ", pt)
}
fmt.Println()
}
const k = 10
fmt.Printf("\nNumber of free polyominoes of ranks 1 to %d:\n", k)
for i := 1; i <= k; i++ {
fmt.Printf("%d ", len(rank(i)))
}
fmt.Println()
}
|
Transform the following Python implementation into Go, maintaining the same output and logic. |
import requests
import json
city = None
topic = None
def getEvent(url_path, key) :
responseString = ""
params = {'city':city, 'key':key,'topic':topic}
r = requests.get(url_path, params = params)
print(r.url)
responseString = r.text
return responseString
def getApiKey(key_path):
key = ""
f = open(key_path, 'r')
key = f.read()
return key
def submitEvent(url_path,params):
r = requests.post(url_path, data=json.dumps(params))
print(r.text+" : Event Submitted")
| package main
import (
"bytes"
"encoding/json"
"fmt"
"io/ioutil"
"log"
"net/http"
"net/url"
"os"
"strings"
"time"
)
var key string
func init() {
const keyFile = "api_key.txt"
f, err := os.Open(keyFile)
if err != nil {
log.Fatal(err)
}
keydata, err := ioutil.ReadAll(f)
if err != nil {
log.Fatal(err)
}
key = strings.TrimSpace(string(keydata))
}
type EventResponse struct {
Results []Result
}
type Result struct {
ID string
Status string
Name string
EventURL string `json:"event_url"`
Description string
Time EventTime
}
type EventTime struct{ time.Time }
func (et *EventTime) UnmarshalJSON(data []byte) error {
var msec int64
if err := json.Unmarshal(data, &msec); err != nil {
return err
}
et.Time = time.Unix(0, msec*int64(time.Millisecond))
return nil
}
func (et EventTime) MarshalJSON() ([]byte, error) {
msec := et.UnixNano() / int64(time.Millisecond)
return json.Marshal(msec)
}
func (r *Result) String() string {
var b bytes.Buffer
fmt.Fprintln(&b, "ID:", r.ID)
fmt.Fprintln(&b, "URL:", r.EventURL)
fmt.Fprintln(&b, "Time:", r.Time.Format(time.UnixDate))
d := r.Description
const limit = 65
if len(d) > limit {
d = d[:limit-1] + "…"
}
fmt.Fprintln(&b, "Description:", d)
return b.String()
}
func main() {
v := url.Values{
"topic": []string{"photo"},
"time": []string{",1w"},
"key": []string{key},
}
u := url.URL{
Scheme: "http",
Host: "api.meetup.com",
Path: "2/open_events.json",
RawQuery: v.Encode(),
}
resp, err := http.Get(u.String())
if err != nil {
log.Fatal(err)
}
defer resp.Body.Close()
log.Println("HTTP Status:", resp.Status)
body, err := ioutil.ReadAll(resp.Body)
if err != nil {
log.Fatal(err)
}
var buf bytes.Buffer
if err = json.Indent(&buf, body, "", " "); err != nil {
log.Fatal(err)
}
var evresp EventResponse
json.Unmarshal(body, &evresp)
fmt.Println("Got", len(evresp.Results), "events")
if len(evresp.Results) > 0 {
fmt.Println("First event:\n", &evresp.Results[0])
}
}
|
Produce a functionally identical Go code for the snippet given in Python. | from itertools import product
constraintinfo = (
(lambda st: len(st) == 12 ,(1, 'This is a numbered list of twelve statements')),
(lambda st: sum(st[-6:]) == 3 ,(2, 'Exactly 3 of the last 6 statements are true')),
(lambda st: sum(st[1::2]) == 2 ,(3, 'Exactly 2 of the even-numbered statements are true')),
(lambda st: (st[5]&st[6]) if st[4] else 1 ,(4, 'If statement 5 is true, then statements 6 and 7 are both true')),
(lambda st: sum(st[1:4]) == 0 ,(5, 'The 3 preceding statements are all false')),
(lambda st: sum(st[0::2]) == 4 ,(6, 'Exactly 4 of the odd-numbered statements are true')),
(lambda st: sum(st[1:3]) == 1 ,(7, 'Either statement 2 or 3 is true, but not both')),
(lambda st: (st[4]&st[5]) if st[6] else 1 ,(8, 'If statement 7 is true, then 5 and 6 are both true')),
(lambda st: sum(st[:6]) == 3 ,(9, 'Exactly 3 of the first 6 statements are true')),
(lambda st: (st[10]&st[11]) ,(10, 'The next two statements are both true')),
(lambda st: sum(st[6:9]) == 1 ,(11, 'Exactly 1 of statements 7, 8 and 9 are true')),
(lambda st: sum(st[0:11]) == 4 ,(12, 'Exactly 4 of the preceding statements are true')),
)
def printer(st, matches):
if False in matches:
print('Missed by one statement: %i, %s' % docs[matches.index(False)])
else:
print('Full match:')
print(' ' + ', '.join('%i:%s' % (i, 'T' if t else 'F') for i, t in enumerate(st, 1)))
funcs, docs = zip(*constraintinfo)
full, partial = [], []
for st in product( *([(False, True)] * 12) ):
truths = [bool(func(st)) for func in funcs]
matches = [s == t for s,t in zip(st, truths)]
mcount = sum(matches)
if mcount == 12:
full.append((st, matches))
elif mcount == 11:
partial.append((st, matches))
for stm in full + partial:
printer(*stm)
| package main
import "fmt"
var solution = make(chan int)
var nearMiss = make(chan int)
var done = make(chan bool)
func main() {
for i := 0; i < 4096; i++ {
go checkPerm(i)
}
var ms []int
for i := 0; i < 4096; {
select {
case <-done:
i++
case s := <-solution:
print12("solution", s)
case m := <-nearMiss:
ms = append(ms, m)
}
}
for _, m := range ms {
print12("near miss", m)
}
}
func print12(label string, bits int) {
fmt.Print(label, ":")
for i := 1; i <= 12; i++ {
if bits&1 == 1 {
fmt.Print(" ", i)
}
bits >>= 1
}
fmt.Println()
}
func checkPerm(tz int) {
ts := func(n uint) bool {
return tz>>(n-1)&1 == 1
}
ntrue := func(xs ...uint) int {
nt := 0
for _, x := range xs {
if ts(x) {
nt++
}
}
return nt
}
var con bool
test := func(statement uint, b bool) {
switch {
case ts(statement) == b:
case con:
panic("bail")
default:
con = true
}
}
defer func() {
if x := recover(); x != nil {
if msg, ok := x.(string); !ok && msg != "bail" {
panic(x)
}
}
done <- true
}()
test(1, true)
test(2, ntrue(7, 8, 9, 10, 11, 12) == 3)
test(3, ntrue(2, 4, 6, 8, 10, 12) == 2)
test(4, !ts(5) || ts(6) && ts(7))
test(5, !ts(4) && !ts(3) && !ts(2))
test(6, ntrue(1, 3, 5, 7, 9, 11) == 4)
test(7, ts(2) != ts(3))
test(8, !ts(7) || ts(5) && ts(6))
test(9, ntrue(1, 2, 3, 4, 5, 6) == 3)
test(10, ts(11) && ts(12))
test(11, ntrue(7, 8, 9) == 1)
test(12, ntrue(1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11) == 4)
if con {
nearMiss <- tz
} else {
solution <- tz
}
}
|
Maintain the same structure and functionality when rewriting this code in Go. | from itertools import product
constraintinfo = (
(lambda st: len(st) == 12 ,(1, 'This is a numbered list of twelve statements')),
(lambda st: sum(st[-6:]) == 3 ,(2, 'Exactly 3 of the last 6 statements are true')),
(lambda st: sum(st[1::2]) == 2 ,(3, 'Exactly 2 of the even-numbered statements are true')),
(lambda st: (st[5]&st[6]) if st[4] else 1 ,(4, 'If statement 5 is true, then statements 6 and 7 are both true')),
(lambda st: sum(st[1:4]) == 0 ,(5, 'The 3 preceding statements are all false')),
(lambda st: sum(st[0::2]) == 4 ,(6, 'Exactly 4 of the odd-numbered statements are true')),
(lambda st: sum(st[1:3]) == 1 ,(7, 'Either statement 2 or 3 is true, but not both')),
(lambda st: (st[4]&st[5]) if st[6] else 1 ,(8, 'If statement 7 is true, then 5 and 6 are both true')),
(lambda st: sum(st[:6]) == 3 ,(9, 'Exactly 3 of the first 6 statements are true')),
(lambda st: (st[10]&st[11]) ,(10, 'The next two statements are both true')),
(lambda st: sum(st[6:9]) == 1 ,(11, 'Exactly 1 of statements 7, 8 and 9 are true')),
(lambda st: sum(st[0:11]) == 4 ,(12, 'Exactly 4 of the preceding statements are true')),
)
def printer(st, matches):
if False in matches:
print('Missed by one statement: %i, %s' % docs[matches.index(False)])
else:
print('Full match:')
print(' ' + ', '.join('%i:%s' % (i, 'T' if t else 'F') for i, t in enumerate(st, 1)))
funcs, docs = zip(*constraintinfo)
full, partial = [], []
for st in product( *([(False, True)] * 12) ):
truths = [bool(func(st)) for func in funcs]
matches = [s == t for s,t in zip(st, truths)]
mcount = sum(matches)
if mcount == 12:
full.append((st, matches))
elif mcount == 11:
partial.append((st, matches))
for stm in full + partial:
printer(*stm)
| package main
import "fmt"
var solution = make(chan int)
var nearMiss = make(chan int)
var done = make(chan bool)
func main() {
for i := 0; i < 4096; i++ {
go checkPerm(i)
}
var ms []int
for i := 0; i < 4096; {
select {
case <-done:
i++
case s := <-solution:
print12("solution", s)
case m := <-nearMiss:
ms = append(ms, m)
}
}
for _, m := range ms {
print12("near miss", m)
}
}
func print12(label string, bits int) {
fmt.Print(label, ":")
for i := 1; i <= 12; i++ {
if bits&1 == 1 {
fmt.Print(" ", i)
}
bits >>= 1
}
fmt.Println()
}
func checkPerm(tz int) {
ts := func(n uint) bool {
return tz>>(n-1)&1 == 1
}
ntrue := func(xs ...uint) int {
nt := 0
for _, x := range xs {
if ts(x) {
nt++
}
}
return nt
}
var con bool
test := func(statement uint, b bool) {
switch {
case ts(statement) == b:
case con:
panic("bail")
default:
con = true
}
}
defer func() {
if x := recover(); x != nil {
if msg, ok := x.(string); !ok && msg != "bail" {
panic(x)
}
}
done <- true
}()
test(1, true)
test(2, ntrue(7, 8, 9, 10, 11, 12) == 3)
test(3, ntrue(2, 4, 6, 8, 10, 12) == 2)
test(4, !ts(5) || ts(6) && ts(7))
test(5, !ts(4) && !ts(3) && !ts(2))
test(6, ntrue(1, 3, 5, 7, 9, 11) == 4)
test(7, ts(2) != ts(3))
test(8, !ts(7) || ts(5) && ts(6))
test(9, ntrue(1, 2, 3, 4, 5, 6) == 3)
test(10, ts(11) && ts(12))
test(11, ntrue(7, 8, 9) == 1)
test(12, ntrue(1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11) == 4)
if con {
nearMiss <- tz
} else {
solution <- tz
}
}
|
Can you help me rewrite this code in Go instead of Python, keeping it the same logically? | import math
dxs = [-0.533, 0.27, 0.859, -0.043, -0.205, -0.127, -0.071, 0.275, 1.251,
-0.231, -0.401, 0.269, 0.491, 0.951, 1.15, 0.001, -0.382, 0.161, 0.915,
2.08, -2.337, 0.034, -0.126, 0.014, 0.709, 0.129, -1.093, -0.483, -1.193,
0.02, -0.051, 0.047, -0.095, 0.695, 0.34, -0.182, 0.287, 0.213, -0.423,
-0.021, -0.134, 1.798, 0.021, -1.099, -0.361, 1.636, -1.134, 1.315, 0.201,
0.034, 0.097, -0.17, 0.054, -0.553, -0.024, -0.181, -0.7, -0.361, -0.789,
0.279, -0.174, -0.009, -0.323, -0.658, 0.348, -0.528, 0.881, 0.021, -0.853,
0.157, 0.648, 1.774, -1.043, 0.051, 0.021, 0.247, -0.31, 0.171, 0.0, 0.106,
0.024, -0.386, 0.962, 0.765, -0.125, -0.289, 0.521, 0.017, 0.281, -0.749,
-0.149, -2.436, -0.909, 0.394, -0.113, -0.598, 0.443, -0.521, -0.799,
0.087]
dys = [0.136, 0.717, 0.459, -0.225, 1.392, 0.385, 0.121, -0.395, 0.49, -0.682,
-0.065, 0.242, -0.288, 0.658, 0.459, 0.0, 0.426, 0.205, -0.765, -2.188,
-0.742, -0.01, 0.089, 0.208, 0.585, 0.633, -0.444, -0.351, -1.087, 0.199,
0.701, 0.096, -0.025, -0.868, 1.051, 0.157, 0.216, 0.162, 0.249, -0.007,
0.009, 0.508, -0.79, 0.723, 0.881, -0.508, 0.393, -0.226, 0.71, 0.038,
-0.217, 0.831, 0.48, 0.407, 0.447, -0.295, 1.126, 0.38, 0.549, -0.445,
-0.046, 0.428, -0.074, 0.217, -0.822, 0.491, 1.347, -0.141, 1.23, -0.044,
0.079, 0.219, 0.698, 0.275, 0.056, 0.031, 0.421, 0.064, 0.721, 0.104,
-0.729, 0.65, -1.103, 0.154, -1.72, 0.051, -0.385, 0.477, 1.537, -0.901,
0.939, -0.411, 0.341, -0.411, 0.106, 0.224, -0.947, -1.424, -0.542, -1.032]
def funnel(dxs, rule):
x, rxs = 0, []
for dx in dxs:
rxs.append(x + dx)
x = rule(x, dx)
return rxs
def mean(xs): return sum(xs) / len(xs)
def stddev(xs):
m = mean(xs)
return math.sqrt(sum((x-m)**2 for x in xs) / len(xs))
def experiment(label, rule):
rxs, rys = funnel(dxs, rule), funnel(dys, rule)
print label
print 'Mean x, y : %.4f, %.4f' % (mean(rxs), mean(rys))
print 'Std dev x, y : %.4f, %.4f' % (stddev(rxs), stddev(rys))
print
experiment('Rule 1:', lambda z, dz: 0)
experiment('Rule 2:', lambda z, dz: -dz)
experiment('Rule 3:', lambda z, dz: -(z+dz))
experiment('Rule 4:', lambda z, dz: z+dz)
| package main
import (
"fmt"
"math"
)
type rule func(float64, float64) float64
var dxs = []float64{
-0.533, 0.270, 0.859, -0.043, -0.205, -0.127, -0.071, 0.275,
1.251, -0.231, -0.401, 0.269, 0.491, 0.951, 1.150, 0.001,
-0.382, 0.161, 0.915, 2.080, -2.337, 0.034, -0.126, 0.014,
0.709, 0.129, -1.093, -0.483, -1.193, 0.020, -0.051, 0.047,
-0.095, 0.695, 0.340, -0.182, 0.287, 0.213, -0.423, -0.021,
-0.134, 1.798, 0.021, -1.099, -0.361, 1.636, -1.134, 1.315,
0.201, 0.034, 0.097, -0.170, 0.054, -0.553, -0.024, -0.181,
-0.700, -0.361, -0.789, 0.279, -0.174, -0.009, -0.323, -0.658,
0.348, -0.528, 0.881, 0.021, -0.853, 0.157, 0.648, 1.774,
-1.043, 0.051, 0.021, 0.247, -0.310, 0.171, 0.000, 0.106,
0.024, -0.386, 0.962, 0.765, -0.125, -0.289, 0.521, 0.017,
0.281, -0.749, -0.149, -2.436, -0.909, 0.394, -0.113, -0.598,
0.443, -0.521, -0.799, 0.087,
}
var dys = []float64{
0.136, 0.717, 0.459, -0.225, 1.392, 0.385, 0.121, -0.395,
0.490, -0.682, -0.065, 0.242, -0.288, 0.658, 0.459, 0.000,
0.426, 0.205, -0.765, -2.188, -0.742, -0.010, 0.089, 0.208,
0.585, 0.633, -0.444, -0.351, -1.087, 0.199, 0.701, 0.096,
-0.025, -0.868, 1.051, 0.157, 0.216, 0.162, 0.249, -0.007,
0.009, 0.508, -0.790, 0.723, 0.881, -0.508, 0.393, -0.226,
0.710, 0.038, -0.217, 0.831, 0.480, 0.407, 0.447, -0.295,
1.126, 0.380, 0.549, -0.445, -0.046, 0.428, -0.074, 0.217,
-0.822, 0.491, 1.347, -0.141, 1.230, -0.044, 0.079, 0.219,
0.698, 0.275, 0.056, 0.031, 0.421, 0.064, 0.721, 0.104,
-0.729, 0.650, -1.103, 0.154, -1.720, 0.051, -0.385, 0.477,
1.537, -0.901, 0.939, -0.411, 0.341, -0.411, 0.106, 0.224,
-0.947, -1.424, -0.542, -1.032,
}
func funnel(fa []float64, r rule) []float64 {
x := 0.0
result := make([]float64, len(fa))
for i, f := range fa {
result[i] = x + f
x = r(x, f)
}
return result
}
func mean(fa []float64) float64 {
sum := 0.0
for _, f := range fa {
sum += f
}
return sum / float64(len(fa))
}
func stdDev(fa []float64) float64 {
m := mean(fa)
sum := 0.0
for _, f := range fa {
sum += (f - m) * (f - m)
}
return math.Sqrt(sum / float64(len(fa)))
}
func experiment(label string, r rule) {
rxs := funnel(dxs, r)
rys := funnel(dys, r)
fmt.Println(label, " : x y")
fmt.Printf("Mean : %7.4f, %7.4f\n", mean(rxs), mean(rys))
fmt.Printf("Std Dev : %7.4f, %7.4f\n", stdDev(rxs), stdDev(rys))
fmt.Println()
}
func main() {
experiment("Rule 1", func(_, _ float64) float64 {
return 0.0
})
experiment("Rule 2", func(_, dz float64) float64 {
return -dz
})
experiment("Rule 3", func(z, dz float64) float64 {
return -(z + dz)
})
experiment("Rule 4", func(z, dz float64) float64 {
return z + dz
})
}
|
Translate this program into Go but keep the logic exactly as in Python. | import math
dxs = [-0.533, 0.27, 0.859, -0.043, -0.205, -0.127, -0.071, 0.275, 1.251,
-0.231, -0.401, 0.269, 0.491, 0.951, 1.15, 0.001, -0.382, 0.161, 0.915,
2.08, -2.337, 0.034, -0.126, 0.014, 0.709, 0.129, -1.093, -0.483, -1.193,
0.02, -0.051, 0.047, -0.095, 0.695, 0.34, -0.182, 0.287, 0.213, -0.423,
-0.021, -0.134, 1.798, 0.021, -1.099, -0.361, 1.636, -1.134, 1.315, 0.201,
0.034, 0.097, -0.17, 0.054, -0.553, -0.024, -0.181, -0.7, -0.361, -0.789,
0.279, -0.174, -0.009, -0.323, -0.658, 0.348, -0.528, 0.881, 0.021, -0.853,
0.157, 0.648, 1.774, -1.043, 0.051, 0.021, 0.247, -0.31, 0.171, 0.0, 0.106,
0.024, -0.386, 0.962, 0.765, -0.125, -0.289, 0.521, 0.017, 0.281, -0.749,
-0.149, -2.436, -0.909, 0.394, -0.113, -0.598, 0.443, -0.521, -0.799,
0.087]
dys = [0.136, 0.717, 0.459, -0.225, 1.392, 0.385, 0.121, -0.395, 0.49, -0.682,
-0.065, 0.242, -0.288, 0.658, 0.459, 0.0, 0.426, 0.205, -0.765, -2.188,
-0.742, -0.01, 0.089, 0.208, 0.585, 0.633, -0.444, -0.351, -1.087, 0.199,
0.701, 0.096, -0.025, -0.868, 1.051, 0.157, 0.216, 0.162, 0.249, -0.007,
0.009, 0.508, -0.79, 0.723, 0.881, -0.508, 0.393, -0.226, 0.71, 0.038,
-0.217, 0.831, 0.48, 0.407, 0.447, -0.295, 1.126, 0.38, 0.549, -0.445,
-0.046, 0.428, -0.074, 0.217, -0.822, 0.491, 1.347, -0.141, 1.23, -0.044,
0.079, 0.219, 0.698, 0.275, 0.056, 0.031, 0.421, 0.064, 0.721, 0.104,
-0.729, 0.65, -1.103, 0.154, -1.72, 0.051, -0.385, 0.477, 1.537, -0.901,
0.939, -0.411, 0.341, -0.411, 0.106, 0.224, -0.947, -1.424, -0.542, -1.032]
def funnel(dxs, rule):
x, rxs = 0, []
for dx in dxs:
rxs.append(x + dx)
x = rule(x, dx)
return rxs
def mean(xs): return sum(xs) / len(xs)
def stddev(xs):
m = mean(xs)
return math.sqrt(sum((x-m)**2 for x in xs) / len(xs))
def experiment(label, rule):
rxs, rys = funnel(dxs, rule), funnel(dys, rule)
print label
print 'Mean x, y : %.4f, %.4f' % (mean(rxs), mean(rys))
print 'Std dev x, y : %.4f, %.4f' % (stddev(rxs), stddev(rys))
print
experiment('Rule 1:', lambda z, dz: 0)
experiment('Rule 2:', lambda z, dz: -dz)
experiment('Rule 3:', lambda z, dz: -(z+dz))
experiment('Rule 4:', lambda z, dz: z+dz)
| package main
import (
"fmt"
"math"
)
type rule func(float64, float64) float64
var dxs = []float64{
-0.533, 0.270, 0.859, -0.043, -0.205, -0.127, -0.071, 0.275,
1.251, -0.231, -0.401, 0.269, 0.491, 0.951, 1.150, 0.001,
-0.382, 0.161, 0.915, 2.080, -2.337, 0.034, -0.126, 0.014,
0.709, 0.129, -1.093, -0.483, -1.193, 0.020, -0.051, 0.047,
-0.095, 0.695, 0.340, -0.182, 0.287, 0.213, -0.423, -0.021,
-0.134, 1.798, 0.021, -1.099, -0.361, 1.636, -1.134, 1.315,
0.201, 0.034, 0.097, -0.170, 0.054, -0.553, -0.024, -0.181,
-0.700, -0.361, -0.789, 0.279, -0.174, -0.009, -0.323, -0.658,
0.348, -0.528, 0.881, 0.021, -0.853, 0.157, 0.648, 1.774,
-1.043, 0.051, 0.021, 0.247, -0.310, 0.171, 0.000, 0.106,
0.024, -0.386, 0.962, 0.765, -0.125, -0.289, 0.521, 0.017,
0.281, -0.749, -0.149, -2.436, -0.909, 0.394, -0.113, -0.598,
0.443, -0.521, -0.799, 0.087,
}
var dys = []float64{
0.136, 0.717, 0.459, -0.225, 1.392, 0.385, 0.121, -0.395,
0.490, -0.682, -0.065, 0.242, -0.288, 0.658, 0.459, 0.000,
0.426, 0.205, -0.765, -2.188, -0.742, -0.010, 0.089, 0.208,
0.585, 0.633, -0.444, -0.351, -1.087, 0.199, 0.701, 0.096,
-0.025, -0.868, 1.051, 0.157, 0.216, 0.162, 0.249, -0.007,
0.009, 0.508, -0.790, 0.723, 0.881, -0.508, 0.393, -0.226,
0.710, 0.038, -0.217, 0.831, 0.480, 0.407, 0.447, -0.295,
1.126, 0.380, 0.549, -0.445, -0.046, 0.428, -0.074, 0.217,
-0.822, 0.491, 1.347, -0.141, 1.230, -0.044, 0.079, 0.219,
0.698, 0.275, 0.056, 0.031, 0.421, 0.064, 0.721, 0.104,
-0.729, 0.650, -1.103, 0.154, -1.720, 0.051, -0.385, 0.477,
1.537, -0.901, 0.939, -0.411, 0.341, -0.411, 0.106, 0.224,
-0.947, -1.424, -0.542, -1.032,
}
func funnel(fa []float64, r rule) []float64 {
x := 0.0
result := make([]float64, len(fa))
for i, f := range fa {
result[i] = x + f
x = r(x, f)
}
return result
}
func mean(fa []float64) float64 {
sum := 0.0
for _, f := range fa {
sum += f
}
return sum / float64(len(fa))
}
func stdDev(fa []float64) float64 {
m := mean(fa)
sum := 0.0
for _, f := range fa {
sum += (f - m) * (f - m)
}
return math.Sqrt(sum / float64(len(fa)))
}
func experiment(label string, r rule) {
rxs := funnel(dxs, r)
rys := funnel(dys, r)
fmt.Println(label, " : x y")
fmt.Printf("Mean : %7.4f, %7.4f\n", mean(rxs), mean(rys))
fmt.Printf("Std Dev : %7.4f, %7.4f\n", stdDev(rxs), stdDev(rys))
fmt.Println()
}
func main() {
experiment("Rule 1", func(_, _ float64) float64 {
return 0.0
})
experiment("Rule 2", func(_, dz float64) float64 {
return -dz
})
experiment("Rule 3", func(z, dz float64) float64 {
return -(z + dz)
})
experiment("Rule 4", func(z, dz float64) float64 {
return z + dz
})
}
|
Ensure the translated Go code behaves exactly like the original Python snippet. |
from re import sub
testtexts = [
,
,
]
for txt in testtexts:
text2 = sub(r'<lang\s+\"?([\w\d\s]+)\"?\s?>', r'<syntaxhighlight lang=\1>', txt)
text2 = sub(r'<lang\s*>', r'<syntaxhighlight lang=text>', text2)
text2 = sub(r'</lang\s*>', r'
| package main
import "fmt"
import "io/ioutil"
import "log"
import "os"
import "regexp"
import "strings"
func main() {
err := fix()
if err != nil {
log.Fatalln(err)
}
}
func fix() (err error) {
buf, err := ioutil.ReadAll(os.Stdin)
if err != nil {
return err
}
out, err := Lang(string(buf))
if err != nil {
return err
}
fmt.Println(out)
return nil
}
func Lang(in string) (out string, err error) {
reg := regexp.MustCompile("<[^>]+>")
out = reg.ReplaceAllStringFunc(in, repl)
return out, nil
}
func repl(in string) (out string) {
if in == "</code>" {
return "</"+"lang>"
}
mid := in[1 : len(in)-1]
var langs = []string{
"abap", "actionscript", "actionscript3", "ada", "apache", "applescript",
"apt_sources", "asm", "asp", "autoit", "avisynth", "bash", "basic4gl",
"bf", "blitzbasic", "bnf", "boo", "c", "caddcl", "cadlisp", "cfdg", "cfm",
"cil", "c_mac", "cobol", "cpp", "cpp-qt", "csharp", "css", "d", "delphi",
"diff", "_div", "dos", "dot", "eiffel", "email", "fortran", "freebasic",
"genero", "gettext", "glsl", "gml", "gnuplot", "go", "groovy", "haskell",
"hq9plus", "html4strict", "idl", "ini", "inno", "intercal", "io", "java",
"java5", "javascript", "kixtart", "klonec", "klonecpp", "latex", "lisp",
"lolcode", "lotusformulas", "lotusscript", "lscript", "lua", "m68k",
"make", "matlab", "mirc", "modula3", "mpasm", "mxml", "mysql", "nsis",
"objc", "ocaml", "ocaml-brief", "oobas", "oracle11", "oracle8", "pascal",
"per", "perl", "php", "php-brief", "pic16", "pixelbender", "plsql",
"povray", "powershell", "progress", "prolog", "providex", "python",
"qbasic", "rails", "reg", "robots", "ruby", "sas", "scala", "scheme",
"scilab", "sdlbasic", "smalltalk", "smarty", "sql", "tcl", "teraterm",
"text", "thinbasic", "tsql", "typoscript", "vb", "vbnet", "verilog",
"vhdl", "vim", "visualfoxpro", "visualprolog", "whitespace", "winbatch",
"xml", "xorg_conf", "xpp", "z80",
}
for _, lang := range langs {
if mid == lang {
return fmt.Sprintf("<lang %s>", lang)
}
if strings.HasPrefix(mid, "/") {
if mid[len("/"):] == lang {
return "</"+"lang>"
}
}
if strings.HasPrefix(mid, "code ") {
if mid[len("code "):] == lang {
return fmt.Sprintf("<lang %s>", lang)
}
}
}
return in
}
|
Rewrite this program in Go while keeping its functionality equivalent to the Python version. |
from itertools import product
def replicateM(n):
def rep(m):
def go(x):
return [[]] if 1 > x else (
liftA2List(lambda a, b: [a] + b)(m)(go(x - 1))
)
return go(n)
return lambda m: rep(m)
def main():
print(
fTable(main.__doc__ + ':\n')(repr)(showList)(
replicateM(2)
)([[1, 2, 3], 'abc'])
)
def liftA2List(f):
return lambda xs: lambda ys: [
f(*xy) for xy in product(xs, ys)
]
def fTable(s):
def go(xShow, fxShow, f, xs):
ys = [xShow(x) for x in xs]
w = max(map(len, ys))
return s + '\n' + '\n'.join(map(
lambda x, y: y.rjust(w, ' ') + ' -> ' + fxShow(f(x)),
xs, ys
))
return lambda xShow: lambda fxShow: lambda f: lambda xs: go(
xShow, fxShow, f, xs
)
def showList(xs):
return '[' + ','.join(
showList(x) if isinstance(x, list) else repr(x) for x in xs
) + ']'
if __name__ == '__main__':
main()
| package main
import "fmt"
var (
n = 3
values = []string{"A", "B", "C", "D"}
k = len(values)
decide = func(p []string) bool {
return p[0] == "B" && p[1] == "C"
}
)
func main() {
pn := make([]int, n)
p := make([]string, n)
for {
for i, x := range pn {
p[i] = values[x]
}
fmt.Println(p)
if decide(p) {
return
}
for i := 0; ; {
pn[i]++
if pn[i] < k {
break
}
pn[i] = 0
i++
if i == n {
return
}
}
}
}
|
Rewrite the snippet below in Go so it works the same as the original Python code. |
from itertools import product
def replicateM(n):
def rep(m):
def go(x):
return [[]] if 1 > x else (
liftA2List(lambda a, b: [a] + b)(m)(go(x - 1))
)
return go(n)
return lambda m: rep(m)
def main():
print(
fTable(main.__doc__ + ':\n')(repr)(showList)(
replicateM(2)
)([[1, 2, 3], 'abc'])
)
def liftA2List(f):
return lambda xs: lambda ys: [
f(*xy) for xy in product(xs, ys)
]
def fTable(s):
def go(xShow, fxShow, f, xs):
ys = [xShow(x) for x in xs]
w = max(map(len, ys))
return s + '\n' + '\n'.join(map(
lambda x, y: y.rjust(w, ' ') + ' -> ' + fxShow(f(x)),
xs, ys
))
return lambda xShow: lambda fxShow: lambda f: lambda xs: go(
xShow, fxShow, f, xs
)
def showList(xs):
return '[' + ','.join(
showList(x) if isinstance(x, list) else repr(x) for x in xs
) + ']'
if __name__ == '__main__':
main()
| package main
import "fmt"
var (
n = 3
values = []string{"A", "B", "C", "D"}
k = len(values)
decide = func(p []string) bool {
return p[0] == "B" && p[1] == "C"
}
)
func main() {
pn := make([]int, n)
p := make([]string, n)
for {
for i, x := range pn {
p[i] = values[x]
}
fmt.Println(p)
if decide(p) {
return
}
for i := 0; ; {
pn[i]++
if pn[i] < k {
break
}
pn[i] = 0
i++
if i == n {
return
}
}
}
}
|
Transform the following Python implementation into Go, maintaining the same output and logic. | def ownCalcPass (password, nonce, test=False) :
start = True
num1 = 0
num2 = 0
password = int(password)
if test:
print("password: %08x" % (password))
for c in nonce :
if c != "0":
if start:
num2 = password
start = False
if test:
print("c: %s num1: %08x num2: %08x" % (c, num1, num2))
if c == '1':
num1 = (num2 & 0xFFFFFF80) >> 7
num2 = num2 << 25
elif c == '2':
num1 = (num2 & 0xFFFFFFF0) >> 4
num2 = num2 << 28
elif c == '3':
num1 = (num2 & 0xFFFFFFF8) >> 3
num2 = num2 << 29
elif c == '4':
num1 = num2 << 1
num2 = num2 >> 31
elif c == '5':
num1 = num2 << 5
num2 = num2 >> 27
elif c == '6':
num1 = num2 << 12
num2 = num2 >> 20
elif c == '7':
num1 = num2 & 0x0000FF00 | (( num2 & 0x000000FF ) << 24 ) | (( num2 & 0x00FF0000 ) >> 16 )
num2 = ( num2 & 0xFF000000 ) >> 8
elif c == '8':
num1 = (num2 & 0x0000FFFF) << 16 | ( num2 >> 24 )
num2 = (num2 & 0x00FF0000) >> 8
elif c == '9':
num1 = ~num2
else :
num1 = num2
num1 &= 0xFFFFFFFF
num2 &= 0xFFFFFFFF
if (c not in "09"):
num1 |= num2
if test:
print(" num1: %08x num2: %08x" % (num1, num2))
num2 = num1
return num1
def test_passwd_calc(passwd, nonce, expected):
res = ownCalcPass(passwd, nonce, False)
m = passwd+' '+nonce+' '+str(res)+' '+str(expected)
if res == int(expected) :
print('PASS '+m)
else :
print('FAIL '+m)
if __name__ == '__main__':
test_passwd_calc('12345','603356072','25280520')
test_passwd_calc('12345','410501656','119537670')
test_passwd_calc('12345','630292165','4269684735')
| package main
import (
"fmt"
"strconv"
)
func ownCalcPass(password, nonce string) uint32 {
start := true
num1 := uint32(0)
num2 := num1
i, _ := strconv.Atoi(password)
pwd := uint32(i)
for _, c := range nonce {
if c != '0' {
if start {
num2 = pwd
}
start = false
}
switch c {
case '1':
num1 = (num2 & 0xFFFFFF80) >> 7
num2 = num2 << 25
case '2':
num1 = (num2 & 0xFFFFFFF0) >> 4
num2 = num2 << 28
case '3':
num1 = (num2 & 0xFFFFFFF8) >> 3
num2 = num2 << 29
case '4':
num1 = num2 << 1
num2 = num2 >> 31
case '5':
num1 = num2 << 5
num2 = num2 >> 27
case '6':
num1 = num2 << 12
num2 = num2 >> 20
case '7':
num3 := num2 & 0x0000FF00
num4 := ((num2 & 0x000000FF) << 24) | ((num2 & 0x00FF0000) >> 16)
num1 = num3 | num4
num2 = (num2 & 0xFF000000) >> 8
case '8':
num1 = (num2&0x0000FFFF)<<16 | (num2 >> 24)
num2 = (num2 & 0x00FF0000) >> 8
case '9':
num1 = ^num2
default:
num1 = num2
}
num1 &= 0xFFFFFFFF
num2 &= 0xFFFFFFFF
if c != '0' && c != '9' {
num1 |= num2
}
num2 = num1
}
return num1
}
func testPasswordCalc(password, nonce string, expected uint32) {
res := ownCalcPass(password, nonce)
m := fmt.Sprintf("%s %s %-10d %-10d", password, nonce, res, expected)
if res == expected {
fmt.Println("PASS", m)
} else {
fmt.Println("FAIL", m)
}
}
func main() {
testPasswordCalc("12345", "603356072", 25280520)
testPasswordCalc("12345", "410501656", 119537670)
testPasswordCalc("12345", "630292165", 4269684735)
}
|
Write a version of this Python function in Go with identical behavior. |
from random import shuffle, choice
from itertools import product, accumulate
from numpy import floor, sqrt
class ADFGVX:
def __init__(self, spoly, k, alph='ADFGVX'):
self.polybius = list(spoly.upper())
self.pdim = int(floor(sqrt(len(self.polybius))))
self.key = list(k.upper())
self.keylen = len(self.key)
self.alphabet = list(alph)
pairs = [p[0] + p[1] for p in product(self.alphabet, self.alphabet)]
self.encode = dict(zip(self.polybius, pairs))
self.decode = dict((v, k) for (k, v) in self.encode.items())
def encrypt(self, msg):
chars = list(''.join([self.encode[c] for c in msg.upper() if c in self.polybius]))
colvecs = [(lett, chars[i:len(chars):self.keylen]) \
for (i, lett) in enumerate(self.key)]
colvecs.sort(key=lambda x: x[0])
return ''.join([''.join(a[1]) for a in colvecs])
def decrypt(self, cod):
chars = [c for c in cod if c in self.alphabet]
sortedkey = sorted(self.key)
order = [self.key.index(ch) for ch in sortedkey]
originalorder = [sortedkey.index(ch) for ch in self.key]
base, extra = divmod(len(chars), self.keylen)
strides = [base + (1 if extra > i else 0) for i in order]
starts = list(accumulate(strides[:-1], lambda x, y: x + y))
starts = [0] + starts
ends = [starts[i] + strides[i] for i in range(self.keylen)]
cols = [chars[starts[i]:ends[i]] for i in originalorder]
pairs = []
for i in range((len(chars) - 1) // self.keylen + 1):
for j in range(self.keylen):
if i * self.keylen + j < len(chars):
pairs.append(cols[j][i])
return ''.join([self.decode[pairs[i] + pairs[i + 1]] for i in range(0, len(pairs), 2)])
if __name__ == '__main__':
PCHARS = list('ABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789')
shuffle(PCHARS)
POLYBIUS = ''.join(PCHARS)
with open('unixdict.txt') as fh:
WORDS = [w for w in (fh.read()).split() \
if len(w) == 9 and len(w) == len(set(list(w)))]
KEY = choice(WORDS)
SECRET, MESSAGE = ADFGVX(POLYBIUS, KEY), 'ATTACKAT1200AM'
print(f'Polybius: {POLYBIUS}, key: {KEY}')
print('Message: ', MESSAGE)
ENCODED = SECRET.encrypt(MESSAGE)
DECODED = SECRET.decrypt(ENCODED)
print('Encoded: ', ENCODED)
print('Decoded: ', DECODED)
| package main
import (
"bytes"
"fmt"
"io/ioutil"
"log"
"math/rand"
"sort"
"strings"
"time"
)
var adfgvx = "ADFGVX"
var alphabet = "ABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789"
func distinct(bs []byte) []byte {
var u []byte
for _, b := range bs {
if !bytes.Contains(u, []byte{b}) {
u = append(u, b)
}
}
return u
}
func allAsciiAlphaNum(word []byte) bool {
for _, b := range word {
if !((b >= 48 && b <= 57) || (b >= 65 && b <= 90) || (b >= 97 && b <= 122)) {
return false
}
}
return true
}
func orderKey(key string) []int {
temp := make([][2]byte, len(key))
for i := 0; i < len(key); i++ {
temp[i] = [2]byte{key[i], byte(i)}
}
sort.Slice(temp, func(i, j int) bool { return temp[i][0] < temp[j][0] })
res := make([]int, len(key))
for i := 0; i < len(key); i++ {
res[i] = int(temp[i][1])
}
return res
}
func createPolybius() []string {
temp := []byte(alphabet)
rand.Shuffle(36, func(i, j int) {
temp[i], temp[j] = temp[j], temp[i]
})
alphabet = string(temp)
fmt.Println("6 x 6 Polybius square:\n")
fmt.Println(" | A D F G V X")
fmt.Println("---------------")
p := make([]string, 6)
for i := 0; i < 6; i++ {
fmt.Printf("%c | ", adfgvx[i])
p[i] = alphabet[6*i : 6*(i+1)]
for _, c := range p[i] {
fmt.Printf("%c ", c)
}
fmt.Println()
}
return p
}
func createKey(n int) string {
if n < 7 || n > 12 {
log.Fatal("Key should be within 7 and 12 letters long.")
}
bs, err := ioutil.ReadFile("unixdict.txt")
if err != nil {
log.Fatal("Error reading file")
}
words := bytes.Split(bs, []byte{'\n'})
var candidates [][]byte
for _, word := range words {
if len(word) == n && len(distinct(word)) == n && allAsciiAlphaNum(word) {
candidates = append(candidates, word)
}
}
k := string(bytes.ToUpper(candidates[rand.Intn(len(candidates))]))
fmt.Println("\nThe key is", k)
return k
}
func encrypt(polybius []string, key, plainText string) string {
temp := ""
outer:
for _, ch := range []byte(plainText) {
for r := 0; r <= 5; r++ {
for c := 0; c <= 5; c++ {
if polybius[r][c] == ch {
temp += fmt.Sprintf("%c%c", adfgvx[r], adfgvx[c])
continue outer
}
}
}
}
colLen := len(temp) / len(key)
if len(temp)%len(key) > 0 {
colLen++
}
table := make([][]string, colLen)
for i := 0; i < colLen; i++ {
table[i] = make([]string, len(key))
}
for i := 0; i < len(temp); i++ {
table[i/len(key)][i%len(key)] = string(temp[i])
}
order := orderKey(key)
cols := make([][]string, len(key))
for i := 0; i < len(key); i++ {
cols[i] = make([]string, colLen)
for j := 0; j < colLen; j++ {
cols[i][j] = table[j][order[i]]
}
}
res := make([]string, len(cols))
for i := 0; i < len(cols); i++ {
res[i] = strings.Join(cols[i], "")
}
return strings.Join(res, " ")
}
func decrypt(polybius []string, key, cipherText string) string {
colStrs := strings.Split(cipherText, " ")
maxColLen := 0
for _, s := range colStrs {
if len(s) > maxColLen {
maxColLen = len(s)
}
}
cols := make([][]string, len(colStrs))
for i, s := range colStrs {
var ls []string
for _, c := range s {
ls = append(ls, string(c))
}
if len(s) < maxColLen {
cols[i] = make([]string, maxColLen)
copy(cols[i], ls)
} else {
cols[i] = ls
}
}
table := make([][]string, maxColLen)
order := orderKey(key)
for i := 0; i < maxColLen; i++ {
table[i] = make([]string, len(key))
for j := 0; j < len(key); j++ {
table[i][order[j]] = cols[j][i]
}
}
temp := ""
for i := 0; i < len(table); i++ {
temp += strings.Join(table[i], "")
}
plainText := ""
for i := 0; i < len(temp); i += 2 {
r := strings.IndexByte(adfgvx, temp[i])
c := strings.IndexByte(adfgvx, temp[i+1])
plainText = plainText + string(polybius[r][c])
}
return plainText
}
func main() {
rand.Seed(time.Now().UnixNano())
plainText := "ATTACKAT1200AM"
polybius := createPolybius()
key := createKey(9)
fmt.Println("\nPlaintext :", plainText)
cipherText := encrypt(polybius, key, plainText)
fmt.Println("\nEncrypted :", cipherText)
plainText2 := decrypt(polybius, key, cipherText)
fmt.Println("\nDecrypted :", plainText2)
}
|
Translate the given Python code snippet into Go without altering its behavior. |
from random import shuffle, choice
from itertools import product, accumulate
from numpy import floor, sqrt
class ADFGVX:
def __init__(self, spoly, k, alph='ADFGVX'):
self.polybius = list(spoly.upper())
self.pdim = int(floor(sqrt(len(self.polybius))))
self.key = list(k.upper())
self.keylen = len(self.key)
self.alphabet = list(alph)
pairs = [p[0] + p[1] for p in product(self.alphabet, self.alphabet)]
self.encode = dict(zip(self.polybius, pairs))
self.decode = dict((v, k) for (k, v) in self.encode.items())
def encrypt(self, msg):
chars = list(''.join([self.encode[c] for c in msg.upper() if c in self.polybius]))
colvecs = [(lett, chars[i:len(chars):self.keylen]) \
for (i, lett) in enumerate(self.key)]
colvecs.sort(key=lambda x: x[0])
return ''.join([''.join(a[1]) for a in colvecs])
def decrypt(self, cod):
chars = [c for c in cod if c in self.alphabet]
sortedkey = sorted(self.key)
order = [self.key.index(ch) for ch in sortedkey]
originalorder = [sortedkey.index(ch) for ch in self.key]
base, extra = divmod(len(chars), self.keylen)
strides = [base + (1 if extra > i else 0) for i in order]
starts = list(accumulate(strides[:-1], lambda x, y: x + y))
starts = [0] + starts
ends = [starts[i] + strides[i] for i in range(self.keylen)]
cols = [chars[starts[i]:ends[i]] for i in originalorder]
pairs = []
for i in range((len(chars) - 1) // self.keylen + 1):
for j in range(self.keylen):
if i * self.keylen + j < len(chars):
pairs.append(cols[j][i])
return ''.join([self.decode[pairs[i] + pairs[i + 1]] for i in range(0, len(pairs), 2)])
if __name__ == '__main__':
PCHARS = list('ABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789')
shuffle(PCHARS)
POLYBIUS = ''.join(PCHARS)
with open('unixdict.txt') as fh:
WORDS = [w for w in (fh.read()).split() \
if len(w) == 9 and len(w) == len(set(list(w)))]
KEY = choice(WORDS)
SECRET, MESSAGE = ADFGVX(POLYBIUS, KEY), 'ATTACKAT1200AM'
print(f'Polybius: {POLYBIUS}, key: {KEY}')
print('Message: ', MESSAGE)
ENCODED = SECRET.encrypt(MESSAGE)
DECODED = SECRET.decrypt(ENCODED)
print('Encoded: ', ENCODED)
print('Decoded: ', DECODED)
| package main
import (
"bytes"
"fmt"
"io/ioutil"
"log"
"math/rand"
"sort"
"strings"
"time"
)
var adfgvx = "ADFGVX"
var alphabet = "ABCDEFGHIJKLMNOPQRSTUVWXYZ0123456789"
func distinct(bs []byte) []byte {
var u []byte
for _, b := range bs {
if !bytes.Contains(u, []byte{b}) {
u = append(u, b)
}
}
return u
}
func allAsciiAlphaNum(word []byte) bool {
for _, b := range word {
if !((b >= 48 && b <= 57) || (b >= 65 && b <= 90) || (b >= 97 && b <= 122)) {
return false
}
}
return true
}
func orderKey(key string) []int {
temp := make([][2]byte, len(key))
for i := 0; i < len(key); i++ {
temp[i] = [2]byte{key[i], byte(i)}
}
sort.Slice(temp, func(i, j int) bool { return temp[i][0] < temp[j][0] })
res := make([]int, len(key))
for i := 0; i < len(key); i++ {
res[i] = int(temp[i][1])
}
return res
}
func createPolybius() []string {
temp := []byte(alphabet)
rand.Shuffle(36, func(i, j int) {
temp[i], temp[j] = temp[j], temp[i]
})
alphabet = string(temp)
fmt.Println("6 x 6 Polybius square:\n")
fmt.Println(" | A D F G V X")
fmt.Println("---------------")
p := make([]string, 6)
for i := 0; i < 6; i++ {
fmt.Printf("%c | ", adfgvx[i])
p[i] = alphabet[6*i : 6*(i+1)]
for _, c := range p[i] {
fmt.Printf("%c ", c)
}
fmt.Println()
}
return p
}
func createKey(n int) string {
if n < 7 || n > 12 {
log.Fatal("Key should be within 7 and 12 letters long.")
}
bs, err := ioutil.ReadFile("unixdict.txt")
if err != nil {
log.Fatal("Error reading file")
}
words := bytes.Split(bs, []byte{'\n'})
var candidates [][]byte
for _, word := range words {
if len(word) == n && len(distinct(word)) == n && allAsciiAlphaNum(word) {
candidates = append(candidates, word)
}
}
k := string(bytes.ToUpper(candidates[rand.Intn(len(candidates))]))
fmt.Println("\nThe key is", k)
return k
}
func encrypt(polybius []string, key, plainText string) string {
temp := ""
outer:
for _, ch := range []byte(plainText) {
for r := 0; r <= 5; r++ {
for c := 0; c <= 5; c++ {
if polybius[r][c] == ch {
temp += fmt.Sprintf("%c%c", adfgvx[r], adfgvx[c])
continue outer
}
}
}
}
colLen := len(temp) / len(key)
if len(temp)%len(key) > 0 {
colLen++
}
table := make([][]string, colLen)
for i := 0; i < colLen; i++ {
table[i] = make([]string, len(key))
}
for i := 0; i < len(temp); i++ {
table[i/len(key)][i%len(key)] = string(temp[i])
}
order := orderKey(key)
cols := make([][]string, len(key))
for i := 0; i < len(key); i++ {
cols[i] = make([]string, colLen)
for j := 0; j < colLen; j++ {
cols[i][j] = table[j][order[i]]
}
}
res := make([]string, len(cols))
for i := 0; i < len(cols); i++ {
res[i] = strings.Join(cols[i], "")
}
return strings.Join(res, " ")
}
func decrypt(polybius []string, key, cipherText string) string {
colStrs := strings.Split(cipherText, " ")
maxColLen := 0
for _, s := range colStrs {
if len(s) > maxColLen {
maxColLen = len(s)
}
}
cols := make([][]string, len(colStrs))
for i, s := range colStrs {
var ls []string
for _, c := range s {
ls = append(ls, string(c))
}
if len(s) < maxColLen {
cols[i] = make([]string, maxColLen)
copy(cols[i], ls)
} else {
cols[i] = ls
}
}
table := make([][]string, maxColLen)
order := orderKey(key)
for i := 0; i < maxColLen; i++ {
table[i] = make([]string, len(key))
for j := 0; j < len(key); j++ {
table[i][order[j]] = cols[j][i]
}
}
temp := ""
for i := 0; i < len(table); i++ {
temp += strings.Join(table[i], "")
}
plainText := ""
for i := 0; i < len(temp); i += 2 {
r := strings.IndexByte(adfgvx, temp[i])
c := strings.IndexByte(adfgvx, temp[i+1])
plainText = plainText + string(polybius[r][c])
}
return plainText
}
func main() {
rand.Seed(time.Now().UnixNano())
plainText := "ATTACKAT1200AM"
polybius := createPolybius()
key := createKey(9)
fmt.Println("\nPlaintext :", plainText)
cipherText := encrypt(polybius, key, plainText)
fmt.Println("\nEncrypted :", cipherText)
plainText2 := decrypt(polybius, key, cipherText)
fmt.Println("\nDecrypted :", plainText2)
}
|
Keep all operations the same but rewrite the snippet in Go. | from itertools import product
xx = '-5 +5'.split()
pp = '2 3'.split()
texts = '-x**p -(x)**p (-x)**p -(x**p)'.split()
print('Integer variable exponentiation')
for x, p in product(xx, pp):
print(f' x,p = {x:2},{p}; ', end=' ')
x, p = int(x), int(p)
print('; '.join(f"{t} =={eval(t):4}" for t in texts))
print('\nBonus integer literal exponentiation')
X, P = 'xp'
xx.insert(0, ' 5')
texts.insert(0, 'x**p')
for x, p in product(xx, pp):
texts2 = [t.replace(X, x).replace(P, p) for t in texts]
print(' ', '; '.join(f"{t2} =={eval(t2):4}" for t2 in texts2))
| package main
import (
"fmt"
"math"
)
type float float64
func (f float) p(e float) float { return float(math.Pow(float64(f), float64(e))) }
func main() {
ops := []string{"-x.p(e)", "-(x).p(e)", "(-x).p(e)", "-(x.p(e))"}
for _, x := range []float{float(-5), float(5)} {
for _, e := range []float{float(2), float(3)} {
fmt.Printf("x = %2.0f e = %0.0f | ", x, e)
fmt.Printf("%s = %4.0f | ", ops[0], -x.p(e))
fmt.Printf("%s = %4.0f | ", ops[1], -(x).p(e))
fmt.Printf("%s = %4.0f | ", ops[2], (-x).p(e))
fmt.Printf("%s = %4.0f\n", ops[3], -(x.p(e)))
}
}
}
|
Translate this program into Go but keep the logic exactly as in Python. | from itertools import product
xx = '-5 +5'.split()
pp = '2 3'.split()
texts = '-x**p -(x)**p (-x)**p -(x**p)'.split()
print('Integer variable exponentiation')
for x, p in product(xx, pp):
print(f' x,p = {x:2},{p}; ', end=' ')
x, p = int(x), int(p)
print('; '.join(f"{t} =={eval(t):4}" for t in texts))
print('\nBonus integer literal exponentiation')
X, P = 'xp'
xx.insert(0, ' 5')
texts.insert(0, 'x**p')
for x, p in product(xx, pp):
texts2 = [t.replace(X, x).replace(P, p) for t in texts]
print(' ', '; '.join(f"{t2} =={eval(t2):4}" for t2 in texts2))
| package main
import (
"fmt"
"math"
)
type float float64
func (f float) p(e float) float { return float(math.Pow(float64(f), float64(e))) }
func main() {
ops := []string{"-x.p(e)", "-(x).p(e)", "(-x).p(e)", "-(x.p(e))"}
for _, x := range []float{float(-5), float(5)} {
for _, e := range []float{float(2), float(3)} {
fmt.Printf("x = %2.0f e = %0.0f | ", x, e)
fmt.Printf("%s = %4.0f | ", ops[0], -x.p(e))
fmt.Printf("%s = %4.0f | ", ops[1], -(x).p(e))
fmt.Printf("%s = %4.0f | ", ops[2], (-x).p(e))
fmt.Printf("%s = %4.0f\n", ops[3], -(x.p(e)))
}
}
}
|
Convert this Python block to Go, preserving its control flow and logic. | Plataanstraat 5 split as (Plataanstraat, 5)
Straat 12 split as (Straat, 12)
Straat 12 II split as (Straat, 12 II)
Dr. J. Straat 12 split as (Dr. J. Straat , 12)
Dr. J. Straat 12 a split as (Dr. J. Straat, 12 a)
Dr. J. Straat 12-14 split as (Dr. J. Straat, 12-14)
Laan 1940 – 1945 37 split as (Laan 1940 – 1945, 37)
Plein 1940 2 split as (Plein 1940, 2)
1213-laan 11 split as (1213-laan, 11)
16 april 1944 Pad 1 split as (16 april 1944 Pad, 1)
1e Kruisweg 36 split as (1e Kruisweg, 36)
Laan 1940-’45 66 split as (Laan 1940-’45, 66)
Laan ’40-’45 split as (Laan ’40-’45,)
Langeloërduinen 3 46 split as (Langeloërduinen, 3 46)
Marienwaerdt 2e Dreef 2 split as (Marienwaerdt 2e Dreef, 2)
Provincialeweg N205 1 split as (Provincialeweg N205, 1)
Rivium 2e Straat 59. split as (Rivium 2e Straat, 59.)
Nieuwe gracht 20rd split as (Nieuwe gracht, 20rd)
Nieuwe gracht 20rd 2 split as (Nieuwe gracht, 20rd 2)
Nieuwe gracht 20zw /2 split as (Nieuwe gracht, 20zw /2)
Nieuwe gracht 20zw/3 split as (Nieuwe gracht, 20zw/3)
Nieuwe gracht 20 zw/4 split as (Nieuwe gracht, 20 zw/4)
Bahnhofstr. 4 split as (Bahnhofstr., 4)
Wertstr. 10 split as (Wertstr., 10)
Lindenhof 1 split as (Lindenhof, 1)
Nordesch 20 split as (Nordesch, 20)
Weilstr. 6 split as (Weilstr., 6)
Harthauer Weg 2 split as (Harthauer Weg, 2)
Mainaustr. 49 split as (Mainaustr., 49)
August-Horch-Str. 3 split as (August-Horch-Str., 3)
Marktplatz 31 split as (Marktplatz, 31)
Schmidener Weg 3 split as (Schmidener Weg, 3)
Karl-Weysser-Str. 6 split as (Karl-Weysser-Str., 6)''')
| package main
import (
"fmt"
"strings"
)
func isDigit(b byte) bool {
return '0' <= b && b <= '9'
}
func separateHouseNumber(address string) (street string, house string) {
length := len(address)
fields := strings.Fields(address)
size := len(fields)
last := fields[size-1]
penult := fields[size-2]
if isDigit(last[0]) {
isdig := isDigit(penult[0])
if size > 2 && isdig && !strings.HasPrefix(penult, "194") {
house = fmt.Sprintf("%s %s", penult, last)
} else {
house = last
}
} else if size > 2 {
house = fmt.Sprintf("%s %s", penult, last)
}
street = strings.TrimRight(address[:length-len(house)], " ")
return
}
func main() {
addresses := [...]string{
"Plataanstraat 5",
"Straat 12",
"Straat 12 II",
"Dr. J. Straat 12",
"Dr. J. Straat 12 a",
"Dr. J. Straat 12-14",
"Laan 1940 - 1945 37",
"Plein 1940 2",
"1213-laan 11",
"16 april 1944 Pad 1",
"1e Kruisweg 36",
"Laan 1940-'45 66",
"Laan '40-'45",
"Langeloërduinen 3 46",
"Marienwaerdt 2e Dreef 2",
"Provincialeweg N205 1",
"Rivium 2e Straat 59.",
"Nieuwe gracht 20rd",
"Nieuwe gracht 20rd 2",
"Nieuwe gracht 20zw /2",
"Nieuwe gracht 20zw/3",
"Nieuwe gracht 20 zw/4",
"Bahnhofstr. 4",
"Wertstr. 10",
"Lindenhof 1",
"Nordesch 20",
"Weilstr. 6",
"Harthauer Weg 2",
"Mainaustr. 49",
"August-Horch-Str. 3",
"Marktplatz 31",
"Schmidener Weg 3",
"Karl-Weysser-Str. 6",
}
fmt.Println("Street House Number")
fmt.Println("--------------------- ------------")
for _, address := range addresses {
street, house := separateHouseNumber(address)
if house == "" {
house = "(none)"
}
fmt.Printf("%-22s %s\n", street, house)
}
}
|
Generate a Go translation of this Python snippet without changing its computational steps. |
import itertools
import re
import sys
from collections import deque
from typing import NamedTuple
RE_OUTLINE = re.compile(r"^((?: |\t)*)(.+)$", re.M)
COLORS = itertools.cycle(
[
"
"
"
"
"
]
)
class Node:
def __init__(self, indent, value, parent, children=None):
self.indent = indent
self.value = value
self.parent = parent
self.children = children or []
self.color = None
def depth(self):
if self.parent:
return self.parent.depth() + 1
return -1
def height(self):
if not self.children:
return 0
return max(child.height() for child in self.children) + 1
def colspan(self):
if self.leaf:
return 1
return sum(child.colspan() for child in self.children)
@property
def leaf(self):
return not bool(self.children)
def __iter__(self):
q = deque()
q.append(self)
while q:
node = q.popleft()
yield node
q.extend(node.children)
class Token(NamedTuple):
indent: int
value: str
def tokenize(outline):
for match in RE_OUTLINE.finditer(outline):
indent, value = match.groups()
yield Token(len(indent), value)
def parse(outline):
tokens = list(tokenize(outline))
temp_root = Node(-1, "", None)
_parse(tokens, 0, temp_root)
root = temp_root.children[0]
pad_tree(root, root.height())
return root
def _parse(tokens, index, node):
if index >= len(tokens):
return
token = tokens[index]
if token.indent == node.indent:
current = Node(token.indent, token.value, node.parent)
node.parent.children.append(current)
_parse(tokens, index + 1, current)
elif token.indent > node.indent:
current = Node(token.indent, token.value, node)
node.children.append(current)
_parse(tokens, index + 1, current)
elif token.indent < node.indent:
_parse(tokens, index, node.parent)
def pad_tree(node, height):
if node.leaf and node.depth() < height:
pad_node = Node(node.indent + 1, "", node)
node.children.append(pad_node)
for child in node.children:
pad_tree(child, height)
def color_tree(node):
if not node.value:
node.color = "
elif node.depth() <= 1:
node.color = next(COLORS)
else:
node.color = node.parent.color
for child in node.children:
color_tree(child)
def table_data(node):
indent = " "
if node.colspan() > 1:
colspan = f'colspan="{node.colspan()}"'
else:
colspan = ""
if node.color:
style = f'style="background-color: {node.color};"'
else:
style = ""
attrs = " ".join([colspan, style])
return f"{indent}<td{attrs}>{node.value}</td>"
def html_table(tree):
table_cols = tree.colspan()
row_cols = 0
buf = ["<table style='text-align: center;'>"]
for node in tree:
if row_cols == 0:
buf.append(" <tr>")
buf.append(table_data(node))
row_cols += node.colspan()
if row_cols == table_cols:
buf.append(" </tr>")
row_cols = 0
buf.append("</table>")
return "\n".join(buf)
def wiki_table_data(node):
if not node.value:
return "| |"
if node.colspan() > 1:
colspan = f"colspan={node.colspan()}"
else:
colspan = ""
if node.color:
style = f'style="background: {node.color};"'
else:
style = ""
attrs = " ".join([colspan, style])
return f"| {attrs} | {node.value}"
def wiki_table(tree):
table_cols = tree.colspan()
row_cols = 0
buf = ['{| class="wikitable" style="text-align: center;"']
for node in tree:
if row_cols == 0:
buf.append("|-")
buf.append(wiki_table_data(node))
row_cols += node.colspan()
if row_cols == table_cols:
row_cols = 0
buf.append("|}")
return "\n".join(buf)
def example(table_format="wiki"):
outline = (
"Display an outline as a nested table.\n"
" Parse the outline to a tree,\n"
" measuring the indent of each line,\n"
" translating the indentation to a nested structure,\n"
" and padding the tree to even depth.\n"
" count the leaves descending from each node,\n"
" defining the width of a leaf as 1,\n"
" and the width of a parent node as a sum.\n"
" (The sum of the widths of its children)\n"
" and write out a table with 'colspan' values\n"
" either as a wiki table,\n"
" or as HTML."
)
tree = parse(outline)
color_tree(tree)
if table_format == "wiki":
print(wiki_table(tree))
else:
print(html_table(tree))
if __name__ == "__main__":
args = sys.argv[1:]
if len(args) == 1:
table_format = args[0]
else:
table_format = "wiki"
example(table_format)
| package main
import (
"fmt"
"strings"
)
type nNode struct {
name string
children []nNode
}
type iNode struct {
level int
name string
}
func toNest(iNodes []iNode, start, level int, n *nNode) {
if level == 0 {
n.name = iNodes[0].name
}
for i := start + 1; i < len(iNodes); i++ {
if iNodes[i].level == level+1 {
c := nNode{iNodes[i].name, nil}
toNest(iNodes, i, level+1, &c)
n.children = append(n.children, c)
} else if iNodes[i].level <= level {
return
}
}
}
func makeIndent(outline string, tab int) []iNode {
lines := strings.Split(outline, "\n")
iNodes := make([]iNode, len(lines))
for i, line := range lines {
line2 := strings.TrimLeft(line, " ")
le, le2 := len(line), len(line2)
level := (le - le2) / tab
iNodes[i] = iNode{level, line2}
}
return iNodes
}
func toMarkup(n nNode, cols []string, depth int) string {
var span int
var colSpan func(nn nNode)
colSpan = func(nn nNode) {
for i, c := range nn.children {
if i > 0 {
span++
}
colSpan(c)
}
}
for _, c := range n.children {
span = 1
colSpan(c)
}
var lines []string
lines = append(lines, `{| class="wikitable" style="text-align: center;"`)
const l1, l2 = "|-", "| |"
lines = append(lines, l1)
span = 1
colSpan(n)
s := fmt.Sprintf(`| style="background: %s " colSpan=%d | %s`, cols[0], span, n.name)
lines = append(lines, s, l1)
var nestedFor func(nn nNode, level, maxLevel, col int)
nestedFor = func(nn nNode, level, maxLevel, col int) {
if level == 1 && maxLevel > level {
for i, c := range nn.children {
nestedFor(c, 2, maxLevel, i)
}
} else if level < maxLevel {
for _, c := range nn.children {
nestedFor(c, level+1, maxLevel, col)
}
} else {
if len(nn.children) > 0 {
for i, c := range nn.children {
span = 1
colSpan(c)
cn := col + 1
if maxLevel == 1 {
cn = i + 1
}
s := fmt.Sprintf(`| style="background: %s " colspan=%d | %s`, cols[cn], span, c.name)
lines = append(lines, s)
}
} else {
lines = append(lines, l2)
}
}
}
for maxLevel := 1; maxLevel < depth; maxLevel++ {
nestedFor(n, 1, maxLevel, 0)
if maxLevel < depth-1 {
lines = append(lines, l1)
}
}
lines = append(lines, "|}")
return strings.Join(lines, "\n")
}
func main() {
const outline = `Display an outline as a nested table.
Parse the outline to a tree,
measuring the indent of each line,
translating the indentation to a nested structure,
and padding the tree to even depth.
count the leaves descending from each node,
defining the width of a leaf as 1,
and the width of a parent node as a sum.
(The sum of the widths of its children)
and write out a table with 'colspan' values
either as a wiki table,
or as HTML.`
const (
yellow = "#ffffe6;"
orange = "#ffebd2;"
green = "#f0fff0;"
blue = "#e6ffff;"
pink = "#ffeeff;"
)
cols := []string{yellow, orange, green, blue, pink}
iNodes := makeIndent(outline, 4)
var n nNode
toNest(iNodes, 0, 0, &n)
fmt.Println(toMarkup(n, cols, 4))
fmt.Println("\n")
const outline2 = `Display an outline as a nested table.
Parse the outline to a tree,
measuring the indent of each line,
translating the indentation to a nested structure,
and padding the tree to even depth.
count the leaves descending from each node,
defining the width of a leaf as 1,
and the width of a parent node as a sum.
(The sum of the widths of its children)
Propagating the sums upward as necessary.
and write out a table with 'colspan' values
either as a wiki table,
or as HTML.
Optionally add color to the nodes.`
cols2 := []string{blue, yellow, orange, green, pink}
var n2 nNode
iNodes2 := makeIndent(outline2, 4)
toNest(iNodes2, 0, 0, &n2)
fmt.Println(toMarkup(n2, cols2, 4))
}
|
Translate this program into Go but keep the logic exactly as in Python. |
def common_list_elements(*lists):
return list(set.intersection(*(set(list_) for list_ in lists)))
if __name__ == "__main__":
test_cases = [
([2, 5, 1, 3, 8, 9, 4, 6], [3, 5, 6, 2, 9, 8, 4], [1, 3, 7, 6, 9]),
([2, 2, 1, 3, 8, 9, 4, 6], [3, 5, 6, 2, 2, 2, 4], [2, 3, 7, 6, 2]),
]
for case in test_cases:
result = common_list_elements(*case)
print(f"Intersection of {case} is {result}")
| package main
import "fmt"
func indexOf(l []int, n int) int {
for i := 0; i < len(l); i++ {
if l[i] == n {
return i
}
}
return -1
}
func common2(l1, l2 []int) []int {
c1, c2 := len(l1), len(l2)
shortest, longest := l1, l2
if c1 > c2 {
shortest, longest = l2, l1
}
longest2 := make([]int, len(longest))
copy(longest2, longest)
var res []int
for _, e := range shortest {
ix := indexOf(longest2, e)
if ix >= 0 {
res = append(res, e)
longest2 = append(longest2[:ix], longest2[ix+1:]...)
}
}
return res
}
func commonN(ll [][]int) []int {
n := len(ll)
if n == 0 {
return []int{}
}
if n == 1 {
return ll[0]
}
res := common2(ll[0], ll[1])
if n == 2 {
return res
}
for _, l := range ll[2:] {
res = common2(res, l)
}
return res
}
func main() {
lls := [][][]int{
{{2, 5, 1, 3, 8, 9, 4, 6}, {3, 5, 6, 2, 9, 8, 4}, {1, 3, 7, 6, 9}},
{{2, 2, 1, 3, 8, 9, 4, 6}, {3, 5, 6, 2, 2, 2, 4}, {2, 3, 7, 6, 2}},
}
for _, ll := range lls {
fmt.Println("Intersection of", ll, "is:")
fmt.Println(commonN(ll))
fmt.Println()
}
}
|
Write a version of this Python function in Go with identical behavior. |
def common_list_elements(*lists):
return list(set.intersection(*(set(list_) for list_ in lists)))
if __name__ == "__main__":
test_cases = [
([2, 5, 1, 3, 8, 9, 4, 6], [3, 5, 6, 2, 9, 8, 4], [1, 3, 7, 6, 9]),
([2, 2, 1, 3, 8, 9, 4, 6], [3, 5, 6, 2, 2, 2, 4], [2, 3, 7, 6, 2]),
]
for case in test_cases:
result = common_list_elements(*case)
print(f"Intersection of {case} is {result}")
| package main
import "fmt"
func indexOf(l []int, n int) int {
for i := 0; i < len(l); i++ {
if l[i] == n {
return i
}
}
return -1
}
func common2(l1, l2 []int) []int {
c1, c2 := len(l1), len(l2)
shortest, longest := l1, l2
if c1 > c2 {
shortest, longest = l2, l1
}
longest2 := make([]int, len(longest))
copy(longest2, longest)
var res []int
for _, e := range shortest {
ix := indexOf(longest2, e)
if ix >= 0 {
res = append(res, e)
longest2 = append(longest2[:ix], longest2[ix+1:]...)
}
}
return res
}
func commonN(ll [][]int) []int {
n := len(ll)
if n == 0 {
return []int{}
}
if n == 1 {
return ll[0]
}
res := common2(ll[0], ll[1])
if n == 2 {
return res
}
for _, l := range ll[2:] {
res = common2(res, l)
}
return res
}
func main() {
lls := [][][]int{
{{2, 5, 1, 3, 8, 9, 4, 6}, {3, 5, 6, 2, 9, 8, 4}, {1, 3, 7, 6, 9}},
{{2, 2, 1, 3, 8, 9, 4, 6}, {3, 5, 6, 2, 2, 2, 4}, {2, 3, 7, 6, 2}},
}
for _, ll := range lls {
fmt.Println("Intersection of", ll, "is:")
fmt.Println(commonN(ll))
fmt.Println()
}
}
|
Produce a language-to-language conversion: from Python to Go, same semantics. |
from __future__ import annotations
import functools
import math
import os
from typing import Any
from typing import Callable
from typing import Generic
from typing import List
from typing import TypeVar
from typing import Union
T = TypeVar("T")
class Writer(Generic[T]):
def __init__(self, value: Union[T, Writer[T]], *msgs: str):
if isinstance(value, Writer):
self.value: T = value.value
self.msgs: List[str] = value.msgs + list(msgs)
else:
self.value = value
self.msgs = list(f"{msg}: {self.value}" for msg in msgs)
def bind(self, func: Callable[[T], Writer[Any]]) -> Writer[Any]:
writer = func(self.value)
return Writer(writer, *self.msgs)
def __rshift__(self, func: Callable[[T], Writer[Any]]) -> Writer[Any]:
return self.bind(func)
def __str__(self):
return f"{self.value}\n{os.linesep.join(reversed(self.msgs))}"
def __repr__(self):
return f"Writer({self.value}, \"{', '.join(reversed(self.msgs))}\")"
def lift(func: Callable, msg: str) -> Callable[[Any], Writer[Any]]:
@functools.wraps(func)
def wrapped(value):
return Writer(func(value), msg)
return wrapped
if __name__ == "__main__":
square_root = lift(math.sqrt, "square root")
add_one = lift(lambda x: x + 1, "add one")
half = lift(lambda x: x / 2, "div two")
print(Writer(5, "initial") >> square_root >> add_one >> half)
| package main
import (
"fmt"
"math"
)
type mwriter struct {
value float64
log string
}
func (m mwriter) bind(f func(v float64) mwriter) mwriter {
n := f(m.value)
n.log = m.log + n.log
return n
}
func unit(v float64, s string) mwriter {
return mwriter{v, fmt.Sprintf(" %-17s: %g\n", s, v)}
}
func root(v float64) mwriter {
return unit(math.Sqrt(v), "Took square root")
}
func addOne(v float64) mwriter {
return unit(v+1, "Added one")
}
func half(v float64) mwriter {
return unit(v/2, "Divided by two")
}
func main() {
mw1 := unit(5, "Initial value")
mw2 := mw1.bind(root).bind(addOne).bind(half)
fmt.Println("The Golden Ratio is", mw2.value)
fmt.Println("\nThis was derived as follows:-")
fmt.Println(mw2.log)
}
|
Transform the following Python implementation into Go, maintaining the same output and logic. |
from mip import Model, BINARY, xsum, minimize
def n_queens_min(N):
if N < 4:
brd = [[0 for i in range(N)] for j in range(N)]
brd[0 if N < 2 else 1][0 if N < 2 else 1] = 1
return 1, brd
model = Model()
board = [[model.add_var(var_type=BINARY) for j in range(N)] for i in range(N)]
for k in range(N):
model += xsum(board[k][j] for j in range(N)) <= 1
model += xsum(board[i][k] for i in range(N)) <= 1
for k in range(1, 2 * N - 2):
model += xsum(board[k - j][j] for j in range(max(0, k - N + 1), min(k + 1, N))) <= 1
for k in range(2 - N, N - 1):
model += xsum(board[k + j][j] for j in range(max(0, -k), min(N - k, N))) <= 1
for i in range(N):
for j in range(N):
model += xsum([xsum(board[i][k] for k in range(N)),
xsum(board[k][j] for k in range(N)),
xsum(board[i + k][j + k] for k in range(-N, N)
if 0 <= i + k < N and 0 <= j + k < N),
xsum(board[i - k][j + k] for k in range(-N, N)
if 0 <= i - k < N and 0 <= j + k < N)]) >= 1
model.objective = minimize(xsum(board[i][j] for i in range(N) for j in range(N)))
model.optimize()
return model.objective_value, [[board[i][j].x for i in range(N)] for j in range(N)]
def n_bishops_min(N):
model = Model()
board = [[model.add_var(var_type=BINARY) for j in range(N)] for i in range(N)]
for i in range(N):
for j in range(N):
model += xsum([
xsum(board[i + k][j + k] for k in range(-N, N)
if 0 <= i + k < N and 0 <= j + k < N),
xsum(board[i - k][j + k] for k in range(-N, N)
if 0 <= i - k < N and 0 <= j + k < N)]) >= 1
model.objective = minimize(xsum(board[i][j] for i in range(N) for j in range(N)))
model.optimize()
return model.objective_value, [[board[i][j].x for i in range(N)] for j in range(N)]
def n_knights_min(N):
if N < 2:
return 1, "N"
knightdeltas = [(1, 2), (2, 1), (2, -1), (1, -2), (-1, -2), (-2, -1), (-2, 1), (-1, 2)]
model = Model()
board = [[model.add_var(var_type=BINARY) for j in range(N + 4)] for i in range(N + 4)]
for i in range(N + 4):
model += xsum(board[i][j] for j in [0, 1, N + 2, N + 3]) == 0
for j in range(N + 4):
model += xsum(board[i][j] for i in [0, 1, N + 2, N + 3]) == 0
for i in range(2, N + 2):
for j in range(2, N + 2):
model += xsum([board[i][j]] + [board[i + d[0]][j + d[1]]
for d in knightdeltas]) >= 1
model += xsum([board[i + d[0]][j + d[1]]
for d in knightdeltas] + [100 * board[i][j]]) <= 100
model.objective = minimize(xsum(board[i][j] for i in range(2, N + 2) for j in range(2, N + 2)))
model.optimize()
minresult = model.objective_value
return minresult, [[board[i][j].x for i in range(2, N + 2)] for j in range(2, N + 2)]
if __name__ == '__main__':
examples, pieces, chars = [[], [], []], ["Queens", "Bishops", "Knights"], ['Q', 'B', 'N']
print(" Squares Queens Bishops Knights")
for nrows in range(1, 11):
print(str(nrows * nrows).rjust(10), end='')
minval, examples[0] = n_queens_min(nrows)
print(str(int(minval)).rjust(10), end='')
minval, examples[1] = n_bishops_min(nrows)
print(str(int(minval)).rjust(10), end='')
minval, examples[2] = n_knights_min(nrows)
print(str(int(minval)).rjust(10))
if nrows == 10:
print("\nExamples for N = 10:")
for idx, piece in enumerate(chars):
print(f"\n{pieces[idx]}:")
for row in examples[idx]:
for sqr in row:
print(chars[idx] if sqr == 1 else '.', '', end = '')
print()
print()
| package main
import (
"fmt"
"math"
"strings"
"time"
)
var board [][]bool
var diag1, diag2 [][]int
var diag1Lookup, diag2Lookup []bool
var n, minCount int
var layout string
func isAttacked(piece string, row, col int) bool {
if piece == "Q" {
for i := 0; i < n; i++ {
if board[i][col] || board[row][i] {
return true
}
}
if diag1Lookup[diag1[row][col]] || diag2Lookup[diag2[row][col]] {
return true
}
} else if piece == "B" {
if diag1Lookup[diag1[row][col]] || diag2Lookup[diag2[row][col]] {
return true
}
} else {
if board[row][col] {
return true
}
if row+2 < n && col-1 >= 0 && board[row+2][col-1] {
return true
}
if row-2 >= 0 && col-1 >= 0 && board[row-2][col-1] {
return true
}
if row+2 < n && col+1 < n && board[row+2][col+1] {
return true
}
if row-2 >= 0 && col+1 < n && board[row-2][col+1] {
return true
}
if row+1 < n && col+2 < n && board[row+1][col+2] {
return true
}
if row-1 >= 0 && col+2 < n && board[row-1][col+2] {
return true
}
if row+1 < n && col-2 >= 0 && board[row+1][col-2] {
return true
}
if row-1 >= 0 && col-2 >= 0 && board[row-1][col-2] {
return true
}
}
return false
}
func abs(i int) int {
if i < 0 {
i = -i
}
return i
}
func attacks(piece string, row, col, trow, tcol int) bool {
if piece == "Q" {
return row == trow || col == tcol || abs(row-trow) == abs(col-tcol)
} else if piece == "B" {
return abs(row-trow) == abs(col-tcol)
} else {
rd := abs(trow - row)
cd := abs(tcol - col)
return (rd == 1 && cd == 2) || (rd == 2 && cd == 1)
}
}
func storeLayout(piece string) {
var sb strings.Builder
for _, row := range board {
for _, cell := range row {
if cell {
sb.WriteString(piece + " ")
} else {
sb.WriteString(". ")
}
}
sb.WriteString("\n")
}
layout = sb.String()
}
func placePiece(piece string, countSoFar, maxCount int) {
if countSoFar >= minCount {
return
}
allAttacked := true
ti := 0
tj := 0
for i := 0; i < n; i++ {
for j := 0; j < n; j++ {
if !isAttacked(piece, i, j) {
allAttacked = false
ti = i
tj = j
break
}
}
if !allAttacked {
break
}
}
if allAttacked {
minCount = countSoFar
storeLayout(piece)
return
}
if countSoFar <= maxCount {
si := ti
sj := tj
if piece == "K" {
si = si - 2
sj = sj - 2
if si < 0 {
si = 0
}
if sj < 0 {
sj = 0
}
}
for i := si; i < n; i++ {
for j := sj; j < n; j++ {
if !isAttacked(piece, i, j) {
if (i == ti && j == tj) || attacks(piece, i, j, ti, tj) {
board[i][j] = true
if piece != "K" {
diag1Lookup[diag1[i][j]] = true
diag2Lookup[diag2[i][j]] = true
}
placePiece(piece, countSoFar+1, maxCount)
board[i][j] = false
if piece != "K" {
diag1Lookup[diag1[i][j]] = false
diag2Lookup[diag2[i][j]] = false
}
}
}
}
}
}
}
func main() {
start := time.Now()
pieces := []string{"Q", "B", "K"}
limits := map[string]int{"Q": 10, "B": 10, "K": 10}
names := map[string]string{"Q": "Queens", "B": "Bishops", "K": "Knights"}
for _, piece := range pieces {
fmt.Println(names[piece])
fmt.Println("=======\n")
for n = 1; ; n++ {
board = make([][]bool, n)
for i := 0; i < n; i++ {
board[i] = make([]bool, n)
}
if piece != "K" {
diag1 = make([][]int, n)
for i := 0; i < n; i++ {
diag1[i] = make([]int, n)
for j := 0; j < n; j++ {
diag1[i][j] = i + j
}
}
diag2 = make([][]int, n)
for i := 0; i < n; i++ {
diag2[i] = make([]int, n)
for j := 0; j < n; j++ {
diag2[i][j] = i - j + n - 1
}
}
diag1Lookup = make([]bool, 2*n-1)
diag2Lookup = make([]bool, 2*n-1)
}
minCount = math.MaxInt32
layout = ""
for maxCount := 1; maxCount <= n*n; maxCount++ {
placePiece(piece, 0, maxCount)
if minCount <= n*n {
break
}
}
fmt.Printf("%2d x %-2d : %d\n", n, n, minCount)
if n == limits[piece] {
fmt.Printf("\n%s on a %d x %d board:\n", names[piece], n, n)
fmt.Println("\n" + layout)
break
}
}
}
elapsed := time.Now().Sub(start)
fmt.Printf("Took %s\n", elapsed)
}
|
Translate the given Python code snippet into Go without altering its behavior. |
from functools import reduce
from operator import add
def wordleScore(target, guess):
return mapAccumL(amber)(
*first(charCounts)(
mapAccumL(green)(
[], zip(target, guess)
)
)
)[1]
def green(residue, tg):
t, g = tg
return (residue, (g, 2)) if t == g else (
[t] + residue, (g, 0)
)
def amber(tally, cn):
c, n = cn
return (tally, 2) if 2 == n else (
adjust(
lambda x: x - 1,
c, tally
),
1
) if 0 < tally.get(c, 0) else (tally, 0)
def main():
print(' -> '.join(['Target', 'Guess', 'Scores']))
print()
print(
'\n'.join([
wordleReport(*tg) for tg in [
("ALLOW", "LOLLY"),
("CHANT", "LATTE"),
("ROBIN", "ALERT"),
("ROBIN", "SONIC"),
("ROBIN", "ROBIN"),
("BULLY", "LOLLY"),
("ADAPT", "SÅLÅD"),
("Ukraine", "Ukraíne"),
("BBAAB", "BBBBBAA"),
("BBAABBB", "AABBBAA")
]
])
)
def wordleReport(target, guess):
scoreName = {2: 'green', 1: 'amber', 0: 'gray'}
if 5 != len(target):
return f'{target}: Expected 5 character target.'
elif 5 != len(guess):
return f'{guess}: Expected 5 character guess.'
else:
scores = wordleScore(target, guess)
return ' -> '.join([
target, guess, repr(scores),
' '.join([
scoreName[n] for n in scores
])
])
def adjust(f, k, dct):
return dict(
dct,
**{k: f(dct[k]) if k in dct else None}
)
def charCounts(s):
return reduce(
lambda a, c: insertWith(add)(c)(1)(a),
list(s),
{}
)
def first(f):
return lambda xy: (f(xy[0]), xy[1])
def insertWith(f):
return lambda k: lambda x: lambda dct: dict(
dct,
**{k: f(dct[k], x) if k in dct else x}
)
def mapAccumL(f):
def nxt(a, x):
return second(lambda v: a[1] + [v])(
f(a[0], x)
)
return lambda acc, xs: reduce(
nxt, xs, (acc, [])
)
def second(f):
return lambda xy: (xy[0], f(xy[1]))
if __name__ == '__main__':
main()
| package main
import (
"bytes"
"fmt"
"log"
)
func wordle(answer, guess string) []int {
n := len(guess)
if n != len(answer) {
log.Fatal("The words must be of the same length.")
}
answerBytes := []byte(answer)
result := make([]int, n)
for i := 0; i < n; i++ {
if guess[i] == answerBytes[i] {
answerBytes[i] = '\000'
result[i] = 2
}
}
for i := 0; i < n; i++ {
ix := bytes.IndexByte(answerBytes, guess[i])
if ix >= 0 {
answerBytes[ix] = '\000'
result[i] = 1
}
}
return result
}
func main() {
colors := []string{"grey", "yellow", "green"}
pairs := [][]string{
{"ALLOW", "LOLLY"},
{"BULLY", "LOLLY"},
{"ROBIN", "ALERT"},
{"ROBIN", "SONIC"},
{"ROBIN", "ROBIN"},
}
for _, pair := range pairs {
res := wordle(pair[0], pair[1])
res2 := make([]string, len(res))
for i := 0; i < len(res); i++ {
res2[i] = colors[res[i]]
}
fmt.Printf("%s v %s => %v => %v\n", pair[0], pair[1], res, res2)
}
}
|
Preserve the algorithm and functionality while converting the code from Python to Go. |
from math import prod
def maxproduct(mat, length):
nrow, ncol = len(mat), len(mat[0])
maxprod, maxrow, maxcol, arr = 0, [0, 0], [0, 0], [0]
for row in range(nrow):
for col in range(ncol):
row2, col2 = row + length, col + length
if row < nrow - length:
array = [r[col] for r in mat[row:row2]]
pro = prod(array)
if pro > maxprod:
maxprod, maxrow, maxcol, arr = pro, [row, row2], col, array
if col < ncol - length:
pro = prod(mat[row][col:col2])
if pro > maxprod:
maxprod, maxrow, maxcol, arr = pro, row, [col, col2], mat[row][col:col2]
print(f"The max {length}-product is {maxprod}, product of {arr} at row {maxrow}, col {maxcol}.")
MATRIX = [
[ 8, 2, 22, 97, 38, 15, 0, 40, 0, 75, 4, 5, 7, 78, 52, 12, 50, 77, 91, 8],
[49, 49, 99, 40, 17, 81, 18, 57, 60, 87, 17, 40, 98, 43, 69, 48, 4, 56, 62, 0],
[81, 49, 31, 73, 55, 79, 14, 29, 93, 71, 40, 67, 53, 88, 30, 3, 49, 13, 36, 65],
[52, 70, 95, 23, 4, 60, 11, 42, 69, 24, 68, 56, 1, 32, 56, 71, 37, 2, 36, 91],
[22, 31, 16, 71, 51, 67, 63, 89, 41, 92, 36, 54, 22, 40, 40, 28, 66, 33, 13, 80],
[24, 47, 32, 60, 99, 3, 45, 2, 44, 75, 33, 53, 78, 36, 84, 20, 35, 17, 12, 50],
[32, 98, 81, 28, 64, 23, 67, 10, 26, 38, 40, 67, 59, 54, 70, 66, 18, 38, 64, 70],
[67, 26, 20, 68, 2, 62, 12, 20, 95, 63, 94, 39, 63, 8, 40, 91, 66, 49, 94, 21],
[24, 55, 58, 5, 66, 73, 99, 26, 97, 17, 78, 78, 96, 83, 14, 88, 34, 89, 63, 72],
[21, 36, 23, 9, 75, 0, 76, 44, 20, 45, 35, 14, 0, 61, 33, 97, 34, 31, 33, 95],
[78, 17, 53, 28, 22, 75, 31, 67, 15, 94, 3, 80, 4, 62, 16, 14, 9, 53, 56, 92],
[16, 39, 5, 42, 96, 35, 31, 47, 55, 58, 88, 24, 0, 17, 54, 24, 36, 29, 85, 57],
[86, 56, 0, 48, 35, 71, 89, 7, 5, 44, 44, 37, 44, 60, 21, 58, 51, 54, 17, 58],
[19, 80, 81, 68, 5, 94, 47, 69, 28, 73, 92, 13, 86, 52, 17, 77, 4, 89, 55, 40],
[ 4, 52, 8, 83, 97, 35, 99, 16, 7, 97, 57, 32, 16, 26, 26, 79, 33, 27, 98, 66],
[88, 36, 68, 87, 57, 62, 20, 72, 3, 46, 33, 67, 46, 55, 12, 32, 63, 93, 53, 69],
[ 4, 42, 16, 73, 38, 25, 39, 11, 24, 94, 72, 18, 8, 46, 29, 32, 40, 62, 76, 36],
[20, 69, 36, 41, 72, 30, 23, 88, 34, 62, 99, 69, 82, 67, 59, 85, 74, 4, 36, 16],
[20, 73, 35, 29, 78, 31, 90, 1, 74, 31, 49, 71, 48, 86, 81, 16, 23, 57, 5, 54],
[ 1, 70, 54, 71, 83, 51, 54, 69, 16, 92, 33, 48, 61, 43, 52, 1, 89, 19, 67, 48]
]
for n in range(2, 6):
maxproduct(MATRIX, n)
| package main
import (
"fmt"
"rcu"
"strings"
)
var grid = [][]int {
{ 8, 2, 22, 97, 38, 15, 0, 40, 0, 75, 4, 5, 7, 78, 52, 12, 50, 77, 91, 8},
{49, 49, 99, 40, 17, 81, 18, 57, 60, 87, 17, 40, 98, 43, 69, 48, 4, 56, 62, 0},
{81, 49, 31, 73, 55, 79, 14, 29, 93, 71, 40, 67, 53, 88, 30, 3, 49, 13, 36, 65},
{52, 70, 95, 23, 4, 60, 11, 42, 69, 24, 68, 56, 1, 32, 56, 71, 37, 2, 36, 91},
{22, 31, 16, 71, 51, 67, 63, 89, 41, 92, 36, 54, 22, 40, 40, 28, 66, 33, 13, 80},
{24, 47, 32, 60, 99, 3, 45, 2, 44, 75, 33, 53, 78, 36, 84, 20, 35, 17, 12, 50},
{32, 98, 81, 28, 64, 23, 67, 10, 26, 38, 40, 67, 59, 54, 70, 66, 18, 38, 64, 70},
{67, 26, 20, 68, 2, 62, 12, 20, 95, 63, 94, 39, 63, 8, 40, 91, 66, 49, 94, 21},
{24, 55, 58, 5, 66, 73, 99, 26, 97, 17, 78, 78, 96, 83, 14, 88, 34, 89, 63, 72},
{21, 36, 23, 9, 75, 0, 76, 44, 20, 45, 35, 14, 0, 61, 33, 97, 34, 31, 33, 95},
{78, 17, 53, 28, 22, 75, 31, 67, 15, 94, 3, 80, 4, 62, 16, 14, 9, 53, 56, 92},
{16, 39, 5, 42, 96, 35, 31, 47, 55, 58, 88, 24, 0, 17, 54, 24, 36, 29, 85, 57},
{86, 56, 0, 48, 35, 71, 89, 7, 5, 44, 44, 37, 44, 60, 21, 58, 51, 54, 17, 58},
{19, 80, 81, 68, 5, 94, 47, 69, 28, 73, 92, 13, 86, 52, 17, 77, 4, 89, 55, 40},
{ 4, 52, 8, 83, 97, 35, 99, 16, 7, 97, 57, 32, 16, 26, 26, 79, 33, 27, 98, 66},
{88, 36, 68, 87, 57, 62, 20, 72, 3, 46, 33, 67, 46, 55, 12, 32, 63, 93, 53, 69},
{ 4, 42, 16, 73, 38, 25, 39, 11, 24, 94, 72, 18, 8, 46, 29, 32, 40, 62, 76, 36},
{20, 69, 36, 41, 72, 30, 23, 88, 34, 62, 99, 69, 82, 67, 59, 85, 74, 4, 36, 16},
{20, 73, 35, 29, 78, 31, 90, 1, 74, 31, 49, 71, 48, 86, 81, 16, 23, 57, 5, 54},
{ 1, 70, 54, 71, 83, 51, 54, 69, 16, 92, 33, 48, 61, 43, 52, 1, 89, 19, 67, 48},
}
func main() {
maxProd, maxR1, maxR2, maxC1, maxC2 := 0, 0, 0, 0, 0
var maxNums [4]int
h, w := len(grid), len(grid[0])
for r := 0; r < h; r++ {
for c := 0; c < w-4; c++ {
prod := 1
for i := c; i < c+4; i++ {
prod *= grid[r][i]
}
if prod > maxProd {
maxProd = prod
for n := 0; n < 4; n++ {
maxNums[n] = grid[r][c+n]
}
maxR1, maxR2 = r, r
maxC1, maxC2 = c, c+3
}
}
}
for c := 0; c < w; c++ {
for r := 0; r < h-4; r++ {
prod := 1
for i := r; i < r+4; i++ {
prod *= grid[i][c]
}
if prod > maxProd {
maxProd = prod
for n := 0; n < 4; n++ {
maxNums[n] = grid[r+n][c]
}
maxR1, maxR2 = r, r+3
maxC1, maxC2 = c, c
}
}
}
fmt.Println("The greatest product of four adjacent numbers in the same direction (down or right) in the grid is:")
var maxNumStrs [4]string
for i := 0; i < 4; i++ {
maxNumStrs[i] = fmt.Sprintf("%d", maxNums[i])
}
fmt.Printf(" %s = %s\n", strings.Join(maxNumStrs[:], " x "), rcu.Commatize(maxProd))
fmt.Print(" at indices (one based): ")
for r := maxR1; r <= maxR2; r++ {
for c := maxC1; c <= maxC2; c++ {
fmt.Printf("(%d, %d) ", r+1, c+1)
}
}
fmt.Println()
}
|
Transform the following Python implementation into Go, maintaining the same output and logic. |
def isPrime(n):
for i in range(2, int(n**0.5) + 1):
if n % i == 0:
return False
return True
if __name__ == '__main__':
print("p q pq+2")
print("-----------------------")
for p in range(2, 499):
if not isPrime(p):
continue
q = p + 1
while not isPrime(q):
q += 1
if not isPrime(2 + p*q):
continue
print(p, "\t", q, "\t", 2+p*q)
| package main
import (
"fmt"
"rcu"
)
func main() {
primes := rcu.Primes(504)
var nprimes []int
fmt.Println("Neighbour primes < 500:")
for i := 0; i < len(primes)-1; i++ {
p := primes[i]*primes[i+1] + 2
if rcu.IsPrime(p) {
nprimes = append(nprimes, primes[i])
}
}
rcu.PrintTable(nprimes, 10, 3, false)
fmt.Println("\nFound", len(nprimes), "such primes.")
}
|
Rewrite the snippet below in Go so it works the same as the original Python code. |
def isPrime(n):
for i in range(2, int(n**0.5) + 1):
if n % i == 0:
return False
return True
if __name__ == '__main__':
print("p q pq+2")
print("-----------------------")
for p in range(2, 499):
if not isPrime(p):
continue
q = p + 1
while not isPrime(q):
q += 1
if not isPrime(2 + p*q):
continue
print(p, "\t", q, "\t", 2+p*q)
| package main
import (
"fmt"
"rcu"
)
func main() {
primes := rcu.Primes(504)
var nprimes []int
fmt.Println("Neighbour primes < 500:")
for i := 0; i < len(primes)-1; i++ {
p := primes[i]*primes[i+1] + 2
if rcu.IsPrime(p) {
nprimes = append(nprimes, primes[i])
}
}
rcu.PrintTable(nprimes, 10, 3, false)
fmt.Println("\nFound", len(nprimes), "such primes.")
}
|
Produce a functionally identical Go code for the snippet given in Python. | import strutils, strformat
type
Node = ref object
kind: char
resistance: float
voltage: float
a: Node
b: Node
proc res(node: Node): float =
if node.kind == '+': return node.a.res + node.b.res
if node.kind == '*': return 1 / (1 / node.a.res + 1 / node.b.res)
node.resistance
proc current(node: Node): float = node.voltage / node.res
proc effect (node: Node): float = node.current * node.voltage
proc report(node: Node, level: string = "") =
echo fmt"{node.res:8.3f} {node.voltage:8.3f} {node.current:8.3f} {node.effect:8.3f} {level}{node.kind}"
if node.kind in "+*":
node.a.report level & "| "
node.b.report level & "| "
proc setVoltage(node: Node, voltage: float) =
node.voltage = voltage
if node.kind == '+':
let ra = node.a.res
let rb = node.b.res
node.a.setVoltage ra / (ra+rb) * voltage
node.b.setVoltage rb / (ra+rb) * voltage
if node.kind == '*':
node.a.setVoltage voltage
node.b.setVoltage voltage
proc build(tokens: seq[string]): Node =
var stack: seq[Node]
for token in tokens:
stack.add if token == "+": Node(kind: '+', a: stack.pop, b: stack.pop)
elif token == "*": Node(kind: '*', a: stack.pop, b: stack.pop)
else: Node(kind: 'r', resistance: parseFloat(token))
stack.pop
proc calculate(voltage: float, tokens: seq[string]): Node =
echo ""
echo " Ohm Volt Ampere Watt Network tree"
let node = build tokens
node.setVoltage voltage
node.report
node
| package main
import "fmt"
type Resistor struct {
symbol rune
resistance, voltage float64
a, b *Resistor
}
func (r *Resistor) res() float64 {
switch r.symbol {
case '+':
return r.a.res() + r.b.res()
case '*':
return 1 / (1/r.a.res() + 1/r.b.res())
default:
return r.resistance
}
}
func (r *Resistor) setVoltage(voltage float64) {
switch r.symbol {
case '+':
ra := r.a.res()
rb := r.b.res()
r.a.setVoltage(ra / (ra + rb) * voltage)
r.b.setVoltage(rb / (ra + rb) * voltage)
case '*':
r.a.setVoltage(voltage)
r.b.setVoltage(voltage)
}
r.voltage = voltage
}
func (r *Resistor) current() float64 {
return r.voltage / r.res()
}
func (r *Resistor) effect() float64 {
return r.current() * r.voltage
}
func (r *Resistor) report(level string) {
fmt.Printf("%8.3f %8.3f %8.3f %8.3f %s%c\n", r.res(), r.voltage, r.current(), r.effect(), level, r.symbol)
if r.a != nil {
r.a.report(level + "| ")
}
if r.b != nil {
r.b.report(level + "| ")
}
}
func (r *Resistor) add(other *Resistor) *Resistor {
return &Resistor{'+', 0, 0, r, other}
}
func (r *Resistor) mul(other *Resistor) *Resistor {
return &Resistor{'*', 0, 0, r, other}
}
func main() {
var r [10]*Resistor
resistances := []float64{6, 8, 4, 8, 4, 6, 8, 10, 6, 2}
for i := 0; i < 10; i++ {
r[i] = &Resistor{'r', resistances[i], 0, nil, nil}
}
node := r[7].add(r[9]).mul(r[8]).add(r[6]).mul(r[5]).add(r[4]).mul(r[3]).add(r[2]).mul(r[1]).add(r[0])
node.setVoltage(18)
fmt.Println(" Ohm Volt Ampere Watt Network tree")
node.report("")
}
|
Port the provided Python code into Go while preserving the original functionality. |
def gen_upside_down_number():
wrappings = [[1, 9], [2, 8], [3, 7], [4, 6],
[5, 5], [6, 4], [7, 3], [8, 2], [9, 1]]
evens = [19, 28, 37, 46, 55, 64, 73, 82, 91]
odds = [5]
odd_index, even_index = 0, 0
ndigits = 1
while True:
if ndigits % 2 == 1:
if len(odds) > odd_index:
yield odds[odd_index]
odd_index += 1
else:
odds = sorted([hi * 10**(ndigits + 1) + 10 *
i + lo for i in odds for hi, lo in wrappings])
ndigits += 1
odd_index = 0
else:
if len(evens) > even_index:
yield evens[even_index]
even_index += 1
else:
evens = sorted([hi * 10**(ndigits + 1) + 10 *
i + lo for i in evens for hi, lo in wrappings])
ndigits += 1
even_index = 0
print('First fifty upside-downs:')
for (udcount, udnumber) in enumerate(gen_upside_down_number()):
if udcount < 50:
print(f'{udnumber : 5}', end='\n' if (udcount + 1) % 10 == 0 else '')
elif udcount == 499:
print(f'\nFive hundredth: {udnumber: ,}')
elif udcount == 4999:
print(f'\nFive thousandth: {udnumber: ,}')
elif udcount == 49_999:
print(f'\nFifty thousandth: {udnumber: ,}')
elif udcount == 499_999:
print(f'\nFive hundred thousandth: {udnumber: ,}')
elif udcount == 4_999_999:
print(f'\nFive millionth: {udnumber: ,}')
break
| package main
import (
"fmt"
"rcu"
)
func genUpsideDown(limit int) chan int {
ch := make(chan int)
wrappings := [][2]int{
{1, 9}, {2, 8}, {3, 7}, {4, 6}, {5, 5},
{6, 4}, {7, 3}, {8, 2}, {9, 1},
}
evens := []int{19, 28, 37, 46, 55, 64, 73, 82, 91}
odds := []int{5}
oddIndex := 0
evenIndex := 0
ndigits := 1
pow := 100
count := 0
go func() {
for count < limit {
if ndigits%2 == 1 {
if len(odds) > oddIndex {
ch <- odds[oddIndex]
count++
oddIndex++
} else {
var nextOdds []int
for _, w := range wrappings {
for _, i := range odds {
nextOdds = append(nextOdds, w[0]*pow+i*10+w[1])
}
}
odds = nextOdds
ndigits++
pow *= 10
oddIndex = 0
}
} else {
if len(evens) > evenIndex {
ch <- evens[evenIndex]
count++
evenIndex++
} else {
var nextEvens []int
for _, w := range wrappings {
for _, i := range evens {
nextEvens = append(nextEvens, w[0]*pow+i*10+w[1])
}
}
evens = nextEvens
ndigits++
pow *= 10
evenIndex = 0
}
}
}
close(ch)
}()
return ch
}
func main() {
const limit = 50_000_000
count := 0
var ud50s []int
pow := 50
for n := range genUpsideDown(limit) {
count++
if count < 50 {
ud50s = append(ud50s, n)
} else if count == 50 {
ud50s = append(ud50s, n)
fmt.Println("First 50 upside down numbers:")
rcu.PrintTable(ud50s, 10, 5, true)
fmt.Println()
pow = 500
} else if count == pow {
fmt.Printf("%sth : %s\n", rcu.Commatize(pow), rcu.Commatize(n))
pow *= 10
}
}
}
|
Please provide an equivalent version of this Python code in Go. | print(
"{:19.16f} {:19.16f}".format(
minkowski(minkowski_inv(4.04145188432738056)),
minkowski_inv(minkowski(4.04145188432738056)),
)
)
| package main
import (
"fmt"
"math"
)
const MAXITER = 151
func minkowski(x float64) float64 {
if x > 1 || x < 0 {
return math.Floor(x) + minkowski(x-math.Floor(x))
}
p := uint64(x)
q := uint64(1)
r := p + 1
s := uint64(1)
d := 1.0
y := float64(p)
for {
d = d / 2
if y+d == y {
break
}
m := p + r
if m < 0 || p < 0 {
break
}
n := q + s
if n < 0 {
break
}
if x < float64(m)/float64(n) {
r = m
s = n
} else {
y = y + d
p = m
q = n
}
}
return y + d
}
func minkowskiInv(x float64) float64 {
if x > 1 || x < 0 {
return math.Floor(x) + minkowskiInv(x-math.Floor(x))
}
if x == 1 || x == 0 {
return x
}
contFrac := []uint32{0}
curr := uint32(0)
count := uint32(1)
i := 0
for {
x *= 2
if curr == 0 {
if x < 1 {
count++
} else {
i++
t := contFrac
contFrac = make([]uint32, i+1)
copy(contFrac, t)
contFrac[i-1] = count
count = 1
curr = 1
x--
}
} else {
if x > 1 {
count++
x--
} else {
i++
t := contFrac
contFrac = make([]uint32, i+1)
copy(contFrac, t)
contFrac[i-1] = count
count = 1
curr = 0
}
}
if x == math.Floor(x) {
contFrac[i] = count
break
}
if i == MAXITER {
break
}
}
ret := 1.0 / float64(contFrac[i])
for j := i - 1; j >= 0; j-- {
ret = float64(contFrac[j]) + 1.0/ret
}
return 1.0 / ret
}
func main() {
fmt.Printf("%19.16f %19.16f\n", minkowski(0.5*(1+math.Sqrt(5))), 5.0/3.0)
fmt.Printf("%19.16f %19.16f\n", minkowskiInv(-5.0/9.0), (math.Sqrt(13)-7)/6)
fmt.Printf("%19.16f %19.16f\n", minkowski(minkowskiInv(0.718281828)),
minkowskiInv(minkowski(0.1213141516171819)))
}
|
Write the same algorithm in Go as shown in this Python implementation. |
import numpy as np
from scipy.ndimage.filters import convolve, gaussian_filter
from scipy.misc import imread, imshow
def CannyEdgeDetector(im, blur = 1, highThreshold = 91, lowThreshold = 31):
im = np.array(im, dtype=float)
im2 = gaussian_filter(im, blur)
im3h = convolve(im2,[[-1,0,1],[-2,0,2],[-1,0,1]])
im3v = convolve(im2,[[1,2,1],[0,0,0],[-1,-2,-1]])
grad = np.power(np.power(im3h, 2.0) + np.power(im3v, 2.0), 0.5)
theta = np.arctan2(im3v, im3h)
thetaQ = (np.round(theta * (5.0 / np.pi)) + 5) % 5
gradSup = grad.copy()
for r in range(im.shape[0]):
for c in range(im.shape[1]):
if r == 0 or r == im.shape[0]-1 or c == 0 or c == im.shape[1] - 1:
gradSup[r, c] = 0
continue
tq = thetaQ[r, c] % 4
if tq == 0:
if grad[r, c] <= grad[r, c-1] or grad[r, c] <= grad[r, c+1]:
gradSup[r, c] = 0
if tq == 1:
if grad[r, c] <= grad[r-1, c+1] or grad[r, c] <= grad[r+1, c-1]:
gradSup[r, c] = 0
if tq == 2:
if grad[r, c] <= grad[r-1, c] or grad[r, c] <= grad[r+1, c]:
gradSup[r, c] = 0
if tq == 3:
if grad[r, c] <= grad[r-1, c-1] or grad[r, c] <= grad[r+1, c+1]:
gradSup[r, c] = 0
strongEdges = (gradSup > highThreshold)
thresholdedEdges = np.array(strongEdges, dtype=np.uint8) + (gradSup > lowThreshold)
finalEdges = strongEdges.copy()
currentPixels = []
for r in range(1, im.shape[0]-1):
for c in range(1, im.shape[1]-1):
if thresholdedEdges[r, c] != 1:
continue
localPatch = thresholdedEdges[r-1:r+2,c-1:c+2]
patchMax = localPatch.max()
if patchMax == 2:
currentPixels.append((r, c))
finalEdges[r, c] = 1
while len(currentPixels) > 0:
newPix = []
for r, c in currentPixels:
for dr in range(-1, 2):
for dc in range(-1, 2):
if dr == 0 and dc == 0: continue
r2 = r+dr
c2 = c+dc
if thresholdedEdges[r2, c2] == 1 and finalEdges[r2, c2] == 0:
newPix.append((r2, c2))
finalEdges[r2, c2] = 1
currentPixels = newPix
return finalEdges
if __name__=="__main__":
im = imread("test.jpg", mode="L")
finalEdges = CannyEdgeDetector(im)
imshow(finalEdges)
| package main
import (
ed "github.com/Ernyoke/Imger/edgedetection"
"github.com/Ernyoke/Imger/imgio"
"log"
)
func main() {
img, err := imgio.ImreadRGBA("Valve_original_(1).png")
if err != nil {
log.Fatal("Could not read image", err)
}
cny, err := ed.CannyRGBA(img, 15, 45, 5)
if err != nil {
log.Fatal("Could not perform Canny Edge detection")
}
err = imgio.Imwrite(cny, "Valve_canny_(1).png")
if err != nil {
log.Fatal("Could not write Canny image to disk")
}
}
|
Maintain the same structure and functionality when rewriting this code in Go. |
from numpy.random import shuffle
SUITS = ['♣', '♦', '♥', '♠']
FACES = ['2', '3', '4', '5', '6', '7', '8', '9', '10', 'J', 'Q', 'K', 'A']
DECK = [f + s for f in FACES for s in SUITS]
CARD_TO_RANK = dict((DECK[i], (i + 3) // 4) for i in range(len(DECK)))
class WarCardGame:
def __init__(self):
deck = DECK.copy()
shuffle(deck)
self.deck1, self.deck2 = deck[:26], deck[26:]
self.pending = []
def turn(self):
if len(self.deck1) == 0 or len(self.deck2) == 0:
return self.gameover()
card1, card2 = self.deck1.pop(0), self.deck2.pop(0)
rank1, rank2 = CARD_TO_RANK[card1], CARD_TO_RANK[card2]
print("{:10}{:10}".format(card1, card2), end='')
if rank1 > rank2:
print('Player 1 takes the cards.')
self.deck1.extend([card1, card2])
self.deck1.extend(self.pending)
self.pending = []
elif rank1 < rank2:
print('Player 2 takes the cards.')
self.deck2.extend([card2, card1])
self.deck2.extend(self.pending)
self.pending = []
else:
print('Tie!')
if len(self.deck1) == 0 or len(self.deck2) == 0:
return self.gameover()
card3, card4 = self.deck1.pop(0), self.deck2.pop(0)
self.pending.extend([card1, card2, card3, card4])
print("{:10}{:10}".format("?", "?"), 'Cards are face down.', sep='')
return self.turn()
return True
def gameover(self):
if len(self.deck2) == 0:
if len(self.deck1) == 0:
print('\nGame ends as a tie.')
else:
print('\nPlayer 1 wins the game.')
else:
print('\nPlayer 2 wins the game.')
return False
if __name__ == '__main__':
WG = WarCardGame()
while WG.turn():
continue
| package main
import (
"fmt"
"math/rand"
"time"
)
var suits = []string{"♣", "♦", "♥", "♠"}
var faces = []string{"2", "3", "4", "5", "6", "7", "8", "9", "T", "J", "Q", "K", "A"}
var cards = make([]string, 52)
var ranks = make([]int, 52)
func init() {
for i := 0; i < 52; i++ {
cards[i] = fmt.Sprintf("%s%s", faces[i%13], suits[i/13])
ranks[i] = i % 13
}
}
func war() {
deck := make([]int, 52)
for i := 0; i < 52; i++ {
deck[i] = i
}
rand.Shuffle(52, func(i, j int) {
deck[i], deck[j] = deck[j], deck[i]
})
hand1 := make([]int, 26, 52)
hand2 := make([]int, 26, 52)
for i := 0; i < 26; i++ {
hand1[25-i] = deck[2*i]
hand2[25-i] = deck[2*i+1]
}
for len(hand1) > 0 && len(hand2) > 0 {
card1 := hand1[0]
copy(hand1[0:], hand1[1:])
hand1[len(hand1)-1] = 0
hand1 = hand1[0 : len(hand1)-1]
card2 := hand2[0]
copy(hand2[0:], hand2[1:])
hand2[len(hand2)-1] = 0
hand2 = hand2[0 : len(hand2)-1]
played1 := []int{card1}
played2 := []int{card2}
numPlayed := 2
for {
fmt.Printf("%s\t%s\t", cards[card1], cards[card2])
if ranks[card1] > ranks[card2] {
hand1 = append(hand1, played1...)
hand1 = append(hand1, played2...)
fmt.Printf("Player 1 takes the %d cards. Now has %d.\n", numPlayed, len(hand1))
break
} else if ranks[card1] < ranks[card2] {
hand2 = append(hand2, played2...)
hand2 = append(hand2, played1...)
fmt.Printf("Player 2 takes the %d cards. Now has %d.\n", numPlayed, len(hand2))
break
} else {
fmt.Println("War!")
if len(hand1) < 2 {
fmt.Println("Player 1 has insufficient cards left.")
hand2 = append(hand2, played2...)
hand2 = append(hand2, played1...)
hand2 = append(hand2, hand1...)
hand1 = hand1[0:0]
break
}
if len(hand2) < 2 {
fmt.Println("Player 2 has insufficient cards left.")
hand1 = append(hand1, played1...)
hand1 = append(hand1, played2...)
hand1 = append(hand1, hand2...)
hand2 = hand2[0:0]
break
}
fdCard1 := hand1[0]
card1 = hand1[1]
copy(hand1[0:], hand1[2:])
hand1[len(hand1)-1] = 0
hand1[len(hand1)-2] = 0
hand1 = hand1[0 : len(hand1)-2]
played1 = append(played1, fdCard1, card1)
fdCard2 := hand2[0]
card2 = hand2[1]
copy(hand2[0:], hand2[2:])
hand2[len(hand2)-1] = 0
hand2[len(hand2)-2] = 0
hand2 = hand2[0 : len(hand2)-2]
played2 = append(played2, fdCard2, card2)
numPlayed += 4
fmt.Println("? \t? \tFace down cards.")
}
}
}
if len(hand1) == 52 {
fmt.Println("Player 1 wins the game!")
} else {
fmt.Println("Player 2 wins the game!")
}
}
func main() {
rand.Seed(time.Now().UnixNano())
war()
}
|
Change the programming language of this snippet from Python to Go without modifying what it does. |
from numpy.random import shuffle
SUITS = ['♣', '♦', '♥', '♠']
FACES = ['2', '3', '4', '5', '6', '7', '8', '9', '10', 'J', 'Q', 'K', 'A']
DECK = [f + s for f in FACES for s in SUITS]
CARD_TO_RANK = dict((DECK[i], (i + 3) // 4) for i in range(len(DECK)))
class WarCardGame:
def __init__(self):
deck = DECK.copy()
shuffle(deck)
self.deck1, self.deck2 = deck[:26], deck[26:]
self.pending = []
def turn(self):
if len(self.deck1) == 0 or len(self.deck2) == 0:
return self.gameover()
card1, card2 = self.deck1.pop(0), self.deck2.pop(0)
rank1, rank2 = CARD_TO_RANK[card1], CARD_TO_RANK[card2]
print("{:10}{:10}".format(card1, card2), end='')
if rank1 > rank2:
print('Player 1 takes the cards.')
self.deck1.extend([card1, card2])
self.deck1.extend(self.pending)
self.pending = []
elif rank1 < rank2:
print('Player 2 takes the cards.')
self.deck2.extend([card2, card1])
self.deck2.extend(self.pending)
self.pending = []
else:
print('Tie!')
if len(self.deck1) == 0 or len(self.deck2) == 0:
return self.gameover()
card3, card4 = self.deck1.pop(0), self.deck2.pop(0)
self.pending.extend([card1, card2, card3, card4])
print("{:10}{:10}".format("?", "?"), 'Cards are face down.', sep='')
return self.turn()
return True
def gameover(self):
if len(self.deck2) == 0:
if len(self.deck1) == 0:
print('\nGame ends as a tie.')
else:
print('\nPlayer 1 wins the game.')
else:
print('\nPlayer 2 wins the game.')
return False
if __name__ == '__main__':
WG = WarCardGame()
while WG.turn():
continue
| package main
import (
"fmt"
"math/rand"
"time"
)
var suits = []string{"♣", "♦", "♥", "♠"}
var faces = []string{"2", "3", "4", "5", "6", "7", "8", "9", "T", "J", "Q", "K", "A"}
var cards = make([]string, 52)
var ranks = make([]int, 52)
func init() {
for i := 0; i < 52; i++ {
cards[i] = fmt.Sprintf("%s%s", faces[i%13], suits[i/13])
ranks[i] = i % 13
}
}
func war() {
deck := make([]int, 52)
for i := 0; i < 52; i++ {
deck[i] = i
}
rand.Shuffle(52, func(i, j int) {
deck[i], deck[j] = deck[j], deck[i]
})
hand1 := make([]int, 26, 52)
hand2 := make([]int, 26, 52)
for i := 0; i < 26; i++ {
hand1[25-i] = deck[2*i]
hand2[25-i] = deck[2*i+1]
}
for len(hand1) > 0 && len(hand2) > 0 {
card1 := hand1[0]
copy(hand1[0:], hand1[1:])
hand1[len(hand1)-1] = 0
hand1 = hand1[0 : len(hand1)-1]
card2 := hand2[0]
copy(hand2[0:], hand2[1:])
hand2[len(hand2)-1] = 0
hand2 = hand2[0 : len(hand2)-1]
played1 := []int{card1}
played2 := []int{card2}
numPlayed := 2
for {
fmt.Printf("%s\t%s\t", cards[card1], cards[card2])
if ranks[card1] > ranks[card2] {
hand1 = append(hand1, played1...)
hand1 = append(hand1, played2...)
fmt.Printf("Player 1 takes the %d cards. Now has %d.\n", numPlayed, len(hand1))
break
} else if ranks[card1] < ranks[card2] {
hand2 = append(hand2, played2...)
hand2 = append(hand2, played1...)
fmt.Printf("Player 2 takes the %d cards. Now has %d.\n", numPlayed, len(hand2))
break
} else {
fmt.Println("War!")
if len(hand1) < 2 {
fmt.Println("Player 1 has insufficient cards left.")
hand2 = append(hand2, played2...)
hand2 = append(hand2, played1...)
hand2 = append(hand2, hand1...)
hand1 = hand1[0:0]
break
}
if len(hand2) < 2 {
fmt.Println("Player 2 has insufficient cards left.")
hand1 = append(hand1, played1...)
hand1 = append(hand1, played2...)
hand1 = append(hand1, hand2...)
hand2 = hand2[0:0]
break
}
fdCard1 := hand1[0]
card1 = hand1[1]
copy(hand1[0:], hand1[2:])
hand1[len(hand1)-1] = 0
hand1[len(hand1)-2] = 0
hand1 = hand1[0 : len(hand1)-2]
played1 = append(played1, fdCard1, card1)
fdCard2 := hand2[0]
card2 = hand2[1]
copy(hand2[0:], hand2[2:])
hand2[len(hand2)-1] = 0
hand2[len(hand2)-2] = 0
hand2 = hand2[0 : len(hand2)-2]
played2 = append(played2, fdCard2, card2)
numPlayed += 4
fmt.Println("? \t? \tFace down cards.")
}
}
}
if len(hand1) == 52 {
fmt.Println("Player 1 wins the game!")
} else {
fmt.Println("Player 2 wins the game!")
}
}
func main() {
rand.Seed(time.Now().UnixNano())
war()
}
|
Change the following Python code into Go without altering its purpose. | from PIL import Image
if __name__=="__main__":
im = Image.open("frog.png")
im2 = im.quantize(16)
im2.show()
| package main
import (
"container/heap"
"image"
"image/color"
"image/png"
"log"
"math"
"os"
"sort"
)
func main() {
f, err := os.Open("Quantum_frog.png")
if err != nil {
log.Fatal(err)
}
img, err := png.Decode(f)
if ec := f.Close(); err != nil {
log.Fatal(err)
} else if ec != nil {
log.Fatal(ec)
}
fq, err := os.Create("frog16.png")
if err != nil {
log.Fatal(err)
}
if err = png.Encode(fq, quant(img, 16)); err != nil {
log.Fatal(err)
}
}
func quant(img image.Image, nq int) image.Image {
qz := newQuantizer(img, nq)
qz.cluster()
return qz.Paletted()
}
type quantizer struct {
img image.Image
cs []cluster
px []point
ch chValues
eq []point
}
type cluster struct {
px []point
widestCh int
chRange uint32
}
type point struct{ x, y int }
type chValues []uint32
type queue []*cluster
const (
rx = iota
gx
bx
)
func newQuantizer(img image.Image, nq int) *quantizer {
b := img.Bounds()
npx := (b.Max.X - b.Min.X) * (b.Max.Y - b.Min.Y)
qz := &quantizer{
img: img,
ch: make(chValues, npx),
cs: make([]cluster, nq),
}
c := &qz.cs[0]
px := make([]point, npx)
c.px = px
i := 0
for y := b.Min.Y; y < b.Max.Y; y++ {
for x := b.Min.X; x < b.Max.X; x++ {
px[i].x = x
px[i].y = y
i++
}
}
return qz
}
func (qz *quantizer) cluster() {
pq := new(queue)
c := &qz.cs[0]
for i := 1; ; {
qz.setColorRange(c)
if c.chRange > 0 {
heap.Push(pq, c)
}
if len(*pq) == 0 {
qz.cs = qz.cs[:i]
break
}
s := heap.Pop(pq).(*cluster)
c = &qz.cs[i]
i++
m := qz.Median(s)
qz.Split(s, c, m)
if i == len(qz.cs) {
break
}
qz.setColorRange(s)
if s.chRange > 0 {
heap.Push(pq, s)
}
}
}
func (q *quantizer) setColorRange(c *cluster) {
var maxR, maxG, maxB uint32
minR := uint32(math.MaxUint32)
minG := uint32(math.MaxUint32)
minB := uint32(math.MaxUint32)
for _, p := range c.px {
r, g, b, _ := q.img.At(p.x, p.y).RGBA()
if r < minR {
minR = r
}
if r > maxR {
maxR = r
}
if g < minG {
minG = g
}
if g > maxG {
maxG = g
}
if b < minB {
minB = b
}
if b > maxB {
maxB = b
}
}
s := gx
min := minG
max := maxG
if maxR-minR > max-min {
s = rx
min = minR
max = maxR
}
if maxB-minB > max-min {
s = bx
min = minB
max = maxB
}
c.widestCh = s
c.chRange = max - min
}
func (q *quantizer) Median(c *cluster) uint32 {
px := c.px
ch := q.ch[:len(px)]
switch c.widestCh {
case rx:
for i, p := range c.px {
ch[i], _, _, _ = q.img.At(p.x, p.y).RGBA()
}
case gx:
for i, p := range c.px {
_, ch[i], _, _ = q.img.At(p.x, p.y).RGBA()
}
case bx:
for i, p := range c.px {
_, _, ch[i], _ = q.img.At(p.x, p.y).RGBA()
}
}
sort.Sort(ch)
half := len(ch) / 2
m := ch[half]
if len(ch)%2 == 0 {
m = (m + ch[half-1]) / 2
}
return m
}
func (q *quantizer) Split(s, c *cluster, m uint32) {
px := s.px
var v uint32
i := 0
lt := 0
gt := len(px) - 1
eq := q.eq[:0]
for i <= gt {
r, g, b, _ := q.img.At(px[i].x, px[i].y).RGBA()
switch s.widestCh {
case rx:
v = r
case gx:
v = g
case bx:
v = b
}
switch {
case v < m:
px[lt] = px[i]
lt++
i++
case v > m:
px[gt], px[i] = px[i], px[gt]
gt--
default:
eq = append(eq, px[i])
i++
}
}
if len(eq) > 0 {
copy(px[lt:], eq)
if len(px)-i < lt {
i = lt
}
q.eq = eq
}
s.px = px[:i]
c.px = px[i:]
}
func (qz *quantizer) Paletted() *image.Paletted {
cp := make(color.Palette, len(qz.cs))
pi := image.NewPaletted(qz.img.Bounds(), cp)
for i := range qz.cs {
px := qz.cs[i].px
var rsum, gsum, bsum int64
for _, p := range px {
r, g, b, _ := qz.img.At(p.x, p.y).RGBA()
rsum += int64(r)
gsum += int64(g)
bsum += int64(b)
}
n64 := int64(len(px))
cp[i] = color.NRGBA64{
uint16(rsum / n64),
uint16(gsum / n64),
uint16(bsum / n64),
0xffff,
}
for _, p := range px {
pi.SetColorIndex(p.x, p.y, uint8(i))
}
}
return pi
}
func (c chValues) Len() int { return len(c) }
func (c chValues) Less(i, j int) bool { return c[i] < c[j] }
func (c chValues) Swap(i, j int) { c[i], c[j] = c[j], c[i] }
func (q queue) Len() int { return len(q) }
func (q queue) Less(i, j int) bool {
return len(q[j].px) < len(q[i].px)
}
func (q queue) Swap(i, j int) {
q[i], q[j] = q[j], q[i]
}
func (pq *queue) Push(x interface{}) {
c := x.(*cluster)
*pq = append(*pq, c)
}
func (pq *queue) Pop() interface{} {
q := *pq
n := len(q) - 1
c := q[n]
*pq = q[:n]
return c
}
|
Keep all operations the same but rewrite the snippet in Go. | import random
from typing import List, Callable, Optional
def modifier(x: float) -> float:
return 2*(.5 - x) if x < 0.5 else 2*(x - .5)
def modified_random_distribution(modifier: Callable[[float], float],
n: int) -> List[float]:
d: List[float] = []
while len(d) < n:
r1 = prob = random.random()
if random.random() < modifier(prob):
d.append(r1)
return d
if __name__ == '__main__':
from collections import Counter
data = modified_random_distribution(modifier, 50_000)
bins = 15
counts = Counter(d // (1 / bins) for d in data)
mx = max(counts.values())
print(" BIN, COUNTS, DELTA: HISTOGRAM\n")
last: Optional[float] = None
for b, count in sorted(counts.items()):
delta = 'N/A' if last is None else str(count - last)
print(f" {b / bins:5.2f}, {count:4}, {delta:>4}: "
f"{'
last = count
| package main
import (
"fmt"
"math"
"math/rand"
"strings"
"time"
)
func rng(modifier func(x float64) float64) float64 {
for {
r1 := rand.Float64()
r2 := rand.Float64()
if r2 < modifier(r1) {
return r1
}
}
}
func commatize(n int) string {
s := fmt.Sprintf("%d", n)
if n < 0 {
s = s[1:]
}
le := len(s)
for i := le - 3; i >= 1; i -= 3 {
s = s[0:i] + "," + s[i:]
}
if n >= 0 {
return s
}
return "-" + s
}
func main() {
rand.Seed(time.Now().UnixNano())
modifier := func(x float64) float64 {
if x < 0.5 {
return 2 * (0.5 - x)
}
return 2 * (x - 0.5)
}
const (
N = 100000
NUM_BINS = 20
HIST_CHAR = "■"
HIST_CHAR_SIZE = 125
)
bins := make([]int, NUM_BINS)
binSize := 1.0 / NUM_BINS
for i := 0; i < N; i++ {
rn := rng(modifier)
bn := int(math.Floor(rn / binSize))
bins[bn]++
}
fmt.Println("Modified random distribution with", commatize(N), "samples in range [0, 1):\n")
fmt.Println(" Range Number of samples within that range")
for i := 0; i < NUM_BINS; i++ {
hist := strings.Repeat(HIST_CHAR, int(math.Round(float64(bins[i])/HIST_CHAR_SIZE)))
fi := float64(i)
fmt.Printf("%4.2f ..< %4.2f %s %s\n", binSize*fi, binSize*(fi+1), hist, commatize(bins[i]))
}
}
|
Convert the following code from Python to Go, ensuring the logic remains intact. | import random
from typing import List, Callable, Optional
def modifier(x: float) -> float:
return 2*(.5 - x) if x < 0.5 else 2*(x - .5)
def modified_random_distribution(modifier: Callable[[float], float],
n: int) -> List[float]:
d: List[float] = []
while len(d) < n:
r1 = prob = random.random()
if random.random() < modifier(prob):
d.append(r1)
return d
if __name__ == '__main__':
from collections import Counter
data = modified_random_distribution(modifier, 50_000)
bins = 15
counts = Counter(d // (1 / bins) for d in data)
mx = max(counts.values())
print(" BIN, COUNTS, DELTA: HISTOGRAM\n")
last: Optional[float] = None
for b, count in sorted(counts.items()):
delta = 'N/A' if last is None else str(count - last)
print(f" {b / bins:5.2f}, {count:4}, {delta:>4}: "
f"{'
last = count
| package main
import (
"fmt"
"math"
"math/rand"
"strings"
"time"
)
func rng(modifier func(x float64) float64) float64 {
for {
r1 := rand.Float64()
r2 := rand.Float64()
if r2 < modifier(r1) {
return r1
}
}
}
func commatize(n int) string {
s := fmt.Sprintf("%d", n)
if n < 0 {
s = s[1:]
}
le := len(s)
for i := le - 3; i >= 1; i -= 3 {
s = s[0:i] + "," + s[i:]
}
if n >= 0 {
return s
}
return "-" + s
}
func main() {
rand.Seed(time.Now().UnixNano())
modifier := func(x float64) float64 {
if x < 0.5 {
return 2 * (0.5 - x)
}
return 2 * (x - 0.5)
}
const (
N = 100000
NUM_BINS = 20
HIST_CHAR = "■"
HIST_CHAR_SIZE = 125
)
bins := make([]int, NUM_BINS)
binSize := 1.0 / NUM_BINS
for i := 0; i < N; i++ {
rn := rng(modifier)
bn := int(math.Floor(rn / binSize))
bins[bn]++
}
fmt.Println("Modified random distribution with", commatize(N), "samples in range [0, 1):\n")
fmt.Println(" Range Number of samples within that range")
for i := 0; i < NUM_BINS; i++ {
hist := strings.Repeat(HIST_CHAR, int(math.Round(float64(bins[i])/HIST_CHAR_SIZE)))
fi := float64(i)
fmt.Printf("%4.2f ..< %4.2f %s %s\n", binSize*fi, binSize*(fi+1), hist, commatize(bins[i]))
}
}
|
Produce a language-to-language conversion: from Python to Go, same semantics. | import random
from typing import List, Callable, Optional
def modifier(x: float) -> float:
return 2*(.5 - x) if x < 0.5 else 2*(x - .5)
def modified_random_distribution(modifier: Callable[[float], float],
n: int) -> List[float]:
d: List[float] = []
while len(d) < n:
r1 = prob = random.random()
if random.random() < modifier(prob):
d.append(r1)
return d
if __name__ == '__main__':
from collections import Counter
data = modified_random_distribution(modifier, 50_000)
bins = 15
counts = Counter(d // (1 / bins) for d in data)
mx = max(counts.values())
print(" BIN, COUNTS, DELTA: HISTOGRAM\n")
last: Optional[float] = None
for b, count in sorted(counts.items()):
delta = 'N/A' if last is None else str(count - last)
print(f" {b / bins:5.2f}, {count:4}, {delta:>4}: "
f"{'
last = count
| package main
import (
"fmt"
"math"
"math/rand"
"strings"
"time"
)
func rng(modifier func(x float64) float64) float64 {
for {
r1 := rand.Float64()
r2 := rand.Float64()
if r2 < modifier(r1) {
return r1
}
}
}
func commatize(n int) string {
s := fmt.Sprintf("%d", n)
if n < 0 {
s = s[1:]
}
le := len(s)
for i := le - 3; i >= 1; i -= 3 {
s = s[0:i] + "," + s[i:]
}
if n >= 0 {
return s
}
return "-" + s
}
func main() {
rand.Seed(time.Now().UnixNano())
modifier := func(x float64) float64 {
if x < 0.5 {
return 2 * (0.5 - x)
}
return 2 * (x - 0.5)
}
const (
N = 100000
NUM_BINS = 20
HIST_CHAR = "■"
HIST_CHAR_SIZE = 125
)
bins := make([]int, NUM_BINS)
binSize := 1.0 / NUM_BINS
for i := 0; i < N; i++ {
rn := rng(modifier)
bn := int(math.Floor(rn / binSize))
bins[bn]++
}
fmt.Println("Modified random distribution with", commatize(N), "samples in range [0, 1):\n")
fmt.Println(" Range Number of samples within that range")
for i := 0; i < NUM_BINS; i++ {
hist := strings.Repeat(HIST_CHAR, int(math.Round(float64(bins[i])/HIST_CHAR_SIZE)))
fi := float64(i)
fmt.Printf("%4.2f ..< %4.2f %s %s\n", binSize*fi, binSize*(fi+1), hist, commatize(bins[i]))
}
}
|
Maintain the same structure and functionality when rewriting this code in Go. | import math
print("working...")
list = [(3,4,34,25,9,12,36,56,36),(2,8,81,169,34,55,76,49,7),(75,121,75,144,35,16,46,35)]
Squares = []
def issquare(x):
for p in range(x):
if x == p*p:
return 1
for n in range(3):
for m in range(len(list[n])):
if issquare(list[n][m]):
Squares.append(list[n][m])
Squares.sort()
print(Squares)
print("done...")
| package main
import (
"fmt"
"math"
"sort"
)
func isSquare(n int) bool {
s := int(math.Sqrt(float64(n)))
return s*s == n
}
func main() {
lists := [][]int{
{3, 4, 34, 25, 9, 12, 36, 56, 36},
{2, 8, 81, 169, 34, 55, 76, 49, 7},
{75, 121, 75, 144, 35, 16, 46, 35},
}
var squares []int
for _, list := range lists {
for _, e := range list {
if isSquare(e) {
squares = append(squares, e)
}
}
}
sort.Ints(squares)
fmt.Println(squares)
}
|
Ensure the translated Go code behaves exactly like the original Python snippet. | import math
print("working...")
list = [(3,4,34,25,9,12,36,56,36),(2,8,81,169,34,55,76,49,7),(75,121,75,144,35,16,46,35)]
Squares = []
def issquare(x):
for p in range(x):
if x == p*p:
return 1
for n in range(3):
for m in range(len(list[n])):
if issquare(list[n][m]):
Squares.append(list[n][m])
Squares.sort()
print(Squares)
print("done...")
| package main
import (
"fmt"
"math"
"sort"
)
func isSquare(n int) bool {
s := int(math.Sqrt(float64(n)))
return s*s == n
}
func main() {
lists := [][]int{
{3, 4, 34, 25, 9, 12, 36, 56, 36},
{2, 8, 81, 169, 34, 55, 76, 49, 7},
{75, 121, 75, 144, 35, 16, 46, 35},
}
var squares []int
for _, list := range lists {
for _, e := range list {
if isSquare(e) {
squares = append(squares, e)
}
}
}
sort.Ints(squares)
fmt.Println(squares)
}
|
Write the same algorithm in Go as shown in this Python implementation. | import math
import os
def suffize(num, digits=None, base=10):
suffixes = ['', 'K', 'M', 'G', 'T', 'P', 'E', 'Z', 'Y', 'X', 'W', 'V', 'U', 'googol']
exponent_distance = 10 if base == 2 else 3
num = num.strip().replace(',', '')
num_sign = num[0] if num[0] in '+-' else ''
num = abs(float(num))
if base == 10 and num >= 1e100:
suffix_index = 13
num /= 1e100
elif num > 1:
magnitude = math.floor(math.log(num, base))
suffix_index = min(math.floor(magnitude / exponent_distance), 12)
num /= base ** (exponent_distance * suffix_index)
else:
suffix_index = 0
if digits is not None:
num_str = f'{num:.{digits}f}'
else:
num_str = f'{num:.3f}'.strip('0').strip('.')
return num_sign + num_str + suffixes[suffix_index] + ('i' if base == 2 else '')
tests = [('87,654,321',),
('-998,877,665,544,332,211,000', 3),
('+112,233', 0),
('16,777,216', 1),
('456,789,100,000,000', 2),
('456,789,100,000,000', 2, 10),
('456,789,100,000,000', 5, 2),
('456,789,100,000.000e+00', 0, 10),
('+16777216', None, 2),
('1.2e101',)]
for test in tests:
print(' '.join(str(i) for i in test) + ' : ' + suffize(*test))
| package main
import (
"fmt"
"math/big"
"strconv"
"strings"
)
var suffixes = " KMGTPEZYXWVU"
var ggl = googol()
func googol() *big.Float {
g1 := new(big.Float).SetPrec(500)
g1.SetInt64(10000000000)
g := new(big.Float)
g.Set(g1)
for i := 2; i <= 10; i++ {
g.Mul(g, g1)
}
return g
}
func suffize(arg string) {
fields := strings.Fields(arg)
a := fields[0]
if a == "" {
a = "0"
}
var places, base int
var frac, radix string
switch len(fields) {
case 1:
places = -1
base = 10
case 2:
places, _ = strconv.Atoi(fields[1])
base = 10
frac = strconv.Itoa(places)
case 3:
if fields[1] == "," {
places = 0
frac = ","
} else {
places, _ = strconv.Atoi(fields[1])
frac = strconv.Itoa(places)
}
base, _ = strconv.Atoi(fields[2])
if base != 2 && base != 10 {
base = 10
}
radix = strconv.Itoa(base)
}
a = strings.Replace(a, ",", "", -1)
sign := ""
if a[0] == '+' || a[0] == '-' {
sign = string(a[0])
a = a[1:]
}
b := new(big.Float).SetPrec(500)
d := new(big.Float).SetPrec(500)
b.SetString(a)
g := false
if b.Cmp(ggl) >= 0 {
g = true
}
if !g && base == 2 {
d.SetUint64(1024)
} else if !g && base == 10 {
d.SetUint64(1000)
} else {
d.Set(ggl)
}
c := 0
for b.Cmp(d) >= 0 && c < 12 {
b.Quo(b, d)
c++
}
var suffix string
if !g {
suffix = string(suffixes[c])
} else {
suffix = "googol"
}
if base == 2 {
suffix += "i"
}
fmt.Println(" input number =", fields[0])
fmt.Println(" fraction digs =", frac)
fmt.Println("specified radix =", radix)
fmt.Print(" new number = ")
if places >= 0 {
fmt.Printf("%s%.*f%s\n", sign, places, b, suffix)
} else {
fmt.Printf("%s%s%s\n", sign, b.Text('g', 50), suffix)
}
fmt.Println()
}
func main() {
tests := []string{
"87,654,321",
"-998,877,665,544,332,211,000 3",
"+112,233 0",
"16,777,216 1",
"456,789,100,000,000",
"456,789,100,000,000 2 10",
"456,789,100,000,000 5 2",
"456,789,100,000.000e+00 0 10",
"+16777216 , 2",
"1.2e101",
"446,835,273,728 1",
"1e36",
"1e39",
}
for _, test := range tests {
suffize(test)
}
}
|
Translate the given Python code snippet into Go without altering its behavior. | import math
import os
def suffize(num, digits=None, base=10):
suffixes = ['', 'K', 'M', 'G', 'T', 'P', 'E', 'Z', 'Y', 'X', 'W', 'V', 'U', 'googol']
exponent_distance = 10 if base == 2 else 3
num = num.strip().replace(',', '')
num_sign = num[0] if num[0] in '+-' else ''
num = abs(float(num))
if base == 10 and num >= 1e100:
suffix_index = 13
num /= 1e100
elif num > 1:
magnitude = math.floor(math.log(num, base))
suffix_index = min(math.floor(magnitude / exponent_distance), 12)
num /= base ** (exponent_distance * suffix_index)
else:
suffix_index = 0
if digits is not None:
num_str = f'{num:.{digits}f}'
else:
num_str = f'{num:.3f}'.strip('0').strip('.')
return num_sign + num_str + suffixes[suffix_index] + ('i' if base == 2 else '')
tests = [('87,654,321',),
('-998,877,665,544,332,211,000', 3),
('+112,233', 0),
('16,777,216', 1),
('456,789,100,000,000', 2),
('456,789,100,000,000', 2, 10),
('456,789,100,000,000', 5, 2),
('456,789,100,000.000e+00', 0, 10),
('+16777216', None, 2),
('1.2e101',)]
for test in tests:
print(' '.join(str(i) for i in test) + ' : ' + suffize(*test))
| package main
import (
"fmt"
"math/big"
"strconv"
"strings"
)
var suffixes = " KMGTPEZYXWVU"
var ggl = googol()
func googol() *big.Float {
g1 := new(big.Float).SetPrec(500)
g1.SetInt64(10000000000)
g := new(big.Float)
g.Set(g1)
for i := 2; i <= 10; i++ {
g.Mul(g, g1)
}
return g
}
func suffize(arg string) {
fields := strings.Fields(arg)
a := fields[0]
if a == "" {
a = "0"
}
var places, base int
var frac, radix string
switch len(fields) {
case 1:
places = -1
base = 10
case 2:
places, _ = strconv.Atoi(fields[1])
base = 10
frac = strconv.Itoa(places)
case 3:
if fields[1] == "," {
places = 0
frac = ","
} else {
places, _ = strconv.Atoi(fields[1])
frac = strconv.Itoa(places)
}
base, _ = strconv.Atoi(fields[2])
if base != 2 && base != 10 {
base = 10
}
radix = strconv.Itoa(base)
}
a = strings.Replace(a, ",", "", -1)
sign := ""
if a[0] == '+' || a[0] == '-' {
sign = string(a[0])
a = a[1:]
}
b := new(big.Float).SetPrec(500)
d := new(big.Float).SetPrec(500)
b.SetString(a)
g := false
if b.Cmp(ggl) >= 0 {
g = true
}
if !g && base == 2 {
d.SetUint64(1024)
} else if !g && base == 10 {
d.SetUint64(1000)
} else {
d.Set(ggl)
}
c := 0
for b.Cmp(d) >= 0 && c < 12 {
b.Quo(b, d)
c++
}
var suffix string
if !g {
suffix = string(suffixes[c])
} else {
suffix = "googol"
}
if base == 2 {
suffix += "i"
}
fmt.Println(" input number =", fields[0])
fmt.Println(" fraction digs =", frac)
fmt.Println("specified radix =", radix)
fmt.Print(" new number = ")
if places >= 0 {
fmt.Printf("%s%.*f%s\n", sign, places, b, suffix)
} else {
fmt.Printf("%s%s%s\n", sign, b.Text('g', 50), suffix)
}
fmt.Println()
}
func main() {
tests := []string{
"87,654,321",
"-998,877,665,544,332,211,000 3",
"+112,233 0",
"16,777,216 1",
"456,789,100,000,000",
"456,789,100,000,000 2 10",
"456,789,100,000,000 5 2",
"456,789,100,000.000e+00 0 10",
"+16777216 , 2",
"1.2e101",
"446,835,273,728 1",
"1e36",
"1e39",
}
for _, test := range tests {
suffize(test)
}
}
|
Write a version of this Python function in Go with identical behavior. |
def longestPalindromes(s):
k = s.lower()
palindromes = [
palExpansion(k)(ab) for ab
in palindromicNuclei(k)
]
maxLength = max([
len(x) for x in palindromes
]) if palindromes else 1
return (
[
x for x in palindromes if maxLength == len(x)
] if palindromes else list(s),
maxLength
) if s else ([], 0)
def palindromicNuclei(s):
cs = list(s)
return [
(i, 1 + i) for (i, (a, b))
in enumerate(zip(cs, cs[1:]))
if a == b
] + [
(i, 2 + i) for (i, (a, b, c))
in enumerate(zip(cs, cs[1:], cs[2:]))
if a == c
]
def palExpansion(s):
iEnd = len(s) - 1
def limit(ij):
i, j = ij
return 0 == i or iEnd == j or s[i-1] != s[j+1]
def expansion(ij):
i, j = ij
return (i - 1, 1 + j)
def go(ij):
ab = until(limit)(expansion)(ij)
return s[ab[0]:ab[1] + 1]
return go
def main():
print(
fTable(main.__doc__ + ':\n')(repr)(repr)(
longestPalindromes
)([
'three old rotators',
'never reverse',
'stable was I ere I saw elbatrosses',
'abracadabra',
'drome',
'the abbatial palace',
''
])
)
def until(p):
def go(f):
def g(x):
v = x
while not p(v):
v = f(v)
return v
return g
return go
def fTable(s):
def gox(xShow):
def gofx(fxShow):
def gof(f):
def goxs(xs):
ys = [xShow(x) for x in xs]
w = max(map(len, ys))
def arrowed(x, y):
return y.rjust(w, ' ') + ' -> ' + (
fxShow(f(x))
)
return s + '\n' + '\n'.join(
map(arrowed, xs, ys)
)
return goxs
return gof
return gofx
return gox
if __name__ == '__main__':
main()
| package main
import (
"fmt"
"sort"
)
func reverse(s string) string {
var r = []rune(s)
for i, j := 0, len(r)-1; i < j; i, j = i+1, j-1 {
r[i], r[j] = r[j], r[i]
}
return string(r)
}
func longestPalSubstring(s string) []string {
var le = len(s)
if le <= 1 {
return []string{s}
}
targetLen := le
var longest []string
i := 0
for {
j := i + targetLen - 1
if j < le {
ss := s[i : j+1]
if reverse(ss) == ss {
longest = append(longest, ss)
}
i++
} else {
if len(longest) > 0 {
return longest
}
i = 0
targetLen--
}
}
return longest
}
func distinct(sa []string) []string {
sort.Strings(sa)
duplicated := make([]bool, len(sa))
for i := 1; i < len(sa); i++ {
if sa[i] == sa[i-1] {
duplicated[i] = true
}
}
var res []string
for i := 0; i < len(sa); i++ {
if !duplicated[i] {
res = append(res, sa[i])
}
}
return res
}
func main() {
strings := []string{"babaccd", "rotator", "reverse", "forever", "several", "palindrome", "abaracadaraba"}
fmt.Println("The palindromic substrings having the longest length are:")
for _, s := range strings {
longest := distinct(longestPalSubstring(s))
fmt.Printf(" %-13s Length %d -> %v\n", s, len(longest[0]), longest)
}
}
|
Write the same code in Go as shown below in Python. | import random
class WumpusGame(object):
def __init__(self, edges=[]):
if edges:
cave = {}
N = max([edges[i][0] for i in range(len(edges))])
for i in range(N):
exits = [edge[1] for edge in edges if edge[0] == i]
cave[i] = exits
else:
cave = {1: [2,3,4], 2: [1,5,6], 3: [1,7,8], 4: [1,9,10], 5:[2,9,11],
6: [2,7,12], 7: [3,6,13], 8: [3,10,14], 9: [4,5,15], 10: [4,8,16],
11: [5,12,17], 12: [6,11,18], 13: [7,14,18], 14: [8,13,19],
15: [9,16,17], 16: [10,15,19], 17: [11,20,15], 18: [12,13,20],
19: [14,16,20], 20: [17,18,19]}
self.cave = cave
self.threats = {}
self.arrows = 5
self.arrow_travel_distance = 5
self.player_pos = -1
def get_safe_rooms(self):
return list(set(self.cave.keys()).difference(self.threats.keys()))
def populate_cave(self):
for threat in ['bat', 'bat', 'pit', 'pit', 'wumpus']:
pos = random.choice(self.get_safe_rooms())
self.threats[pos] = threat
self.player_pos = random.choice(self.get_safe_rooms())
def breadth_first_search(self, source, target, max_depth=5):
graph = self.cave
depth = 0
def search(stack, visited, target, depth):
if stack == []:
return False, -1
if target in stack:
return True, depth
visited = visited + stack
stack = list(set([graph[v][i] for v in stack for i in range(len(graph[v]))]).difference(visited))
depth += 1
if depth > max_depth:
return False, depth
else:
return search(stack, visited, target, depth)
return search([source], [], target, depth)
def print_warning(self, threat):
if threat == 'bat':
print("You hear a rustling.")
elif threat == 'pit':
print("You feel a cold wind blowing from a nearby cavern.")
elif threat == 'wumpus':
print("You smell something terrible nearby.")
def get_players_input(self):
while 1:
inpt = input("Shoot or move (S-M)? ")
try:
mode = str(inpt).lower()
assert mode in ['s', 'm', 'q']
break
except (ValueError, AssertionError):
print("This is not a valid action: pick 'S' to shoot and 'M' to move.")
if mode == 'q':
return 'q', 0
while 1:
inpt = input("Where to? ")
try:
target = int(inpt)
except ValueError:
print("This is not even a real number.")
continue
if mode == 'm':
try:
assert target in self.cave[self.player_pos]
break
except AssertionError:
print("You cannot walk that far. Please use one of the tunnels.")
elif mode == 's':
try:
bfs = self.breadth_first_search(self.player_pos, target)
assert bfs[0] == True
break
except AssertionError:
if bfs[1] == -1:
print("There is no room with this number in the cave. Your arrow travels randomly.")
target = random.choice(self.cave.keys())
if bfs[1] > self.arrow_travel_distance:
print("Arrows aren't that croocked.")
return mode, target
def enter_room(self, room_number):
print("Entering room {}...".format(room_number))
if self.threats.get(room_number) == 'bat':
print("You encounter a bat, it transports you to a random empty room.")
new_pos = random.choice(self.get_safe_rooms())
return self.enter_room(new_pos)
elif self.threats.get(room_number) == 'wumpus':
print("Wumpus eats you.")
return -1
elif self.threats.get(room_number) == 'pit':
print("You fall into a pit.")
return -1
for i in self.cave[room_number]:
self.print_warning(self.threats.get(i))
return room_number
def shoot_room(self, room_number):
print("Shooting an arrow into room {}...".format(room_number))
self.arrows -= 1
threat = self.threats.get(room_number)
if threat in ['bat', 'wumpus']:
del self.threats[room_number]
if threat == 'wumpus':
print("Hurra, you killed the wumpus!")
return -1
elif threat == 'bat':
print("You killed a bat.")
elif threat in ['pit', None]:
print("This arrow is lost.")
if self.arrows < 1:
print("Your quiver is empty.")
return -1
if random.random() < 0.75:
for room_number, threat in self.threats.items():
if threat == 'wumpus':
wumpus_pos = room_number
new_pos = random.choice(list(set(self.cave[wumpus_pos]).difference(self.threats.keys())))
del self.threats[room_number]
self.threats[new_pos] = 'wumpus'
if new_pos == self.player_pos:
print("Wumpus enters your room and eats you!")
return -1
return self.player_pos
def gameloop(self):
print("HUNT THE WUMPUS")
print("===============")
print()
self.populate_cave()
self.enter_room(self.player_pos)
while 1:
print("You are in room {}.".format(self.player_pos), end=" ")
print("Tunnels lead to: {0} {1} {2}".format(*self.cave[self.player_pos]))
inpt = self.get_players_input()
print()
if inpt[0] == 'm':
target = inpt[1]
self.player_pos = self.enter_room(target)
elif inpt[0] == 's':
target = inpt[1]
self.player_pos = self.shoot_room(target)
elif inpt[0] == 'q':
self.player_pos = -1
if self.player_pos == -1:
break
print()
print("Game over!")
if __name__ == '__main__':
WG = WumpusGame()
WG.gameloop()
| package main
import (
"bufio"
"fmt"
"log"
"math/rand"
"os"
"strconv"
"strings"
"time"
)
var cave = map[int][3]int{
1: {2, 3, 4}, 2: {1, 5, 6}, 3: {1, 7, 8}, 4: {1, 9, 10}, 5: {2, 9, 11},
6: {2, 7, 12}, 7: {3, 6, 13}, 8: {3, 10, 14}, 9: {4, 5, 15}, 10: {4, 8, 16},
11: {5, 12, 17}, 12: {6, 11, 18}, 13: {7, 14, 18}, 14: {8, 13, 19},
15: {9, 16, 17}, 16: {10, 15, 19}, 17: {11, 20, 15}, 18: {12, 13, 20},
19: {14, 16, 20}, 20: {17, 18, 19},
}
var player, wumpus, bat1, bat2, pit1, pit2 int
var arrows = 5
func isEmpty(r int) bool {
if r != player && r != wumpus && r != bat1 && r != bat2 && r != pit1 && r != pit2 {
return true
}
return false
}
func sense(adj [3]int) {
bat := false
pit := false
for _, ar := range adj {
if ar == wumpus {
fmt.Println("You smell something terrible nearby.")
}
switch ar {
case bat1, bat2:
if !bat {
fmt.Println("You hear a rustling.")
bat = true
}
case pit1, pit2:
if !pit {
fmt.Println("You feel a cold wind blowing from a nearby cavern.")
pit = true
}
}
}
fmt.Println()
}
func check(err error) {
if err != nil {
log.Fatal(err)
}
}
func plural(n int) string {
if n != 1 {
return "s"
}
return ""
}
func main() {
rand.Seed(time.Now().UnixNano())
player = 1
wumpus = rand.Intn(19) + 2
bat1 = rand.Intn(19) + 2
for {
bat2 = rand.Intn(19) + 2
if bat2 != bat1 {
break
}
}
for {
pit1 = rand.Intn(19) + 2
if pit1 != bat1 && pit1 != bat2 {
break
}
}
for {
pit2 = rand.Intn(19) + 2
if pit2 != bat1 && pit2 != bat2 && pit2 != pit1 {
break
}
}
scanner := bufio.NewScanner(os.Stdin)
for {
fmt.Printf("\nYou are in room %d with %d arrow%s left\n", player, arrows, plural(arrows))
adj := cave[player]
fmt.Printf("The adjacent rooms are %v\n", adj)
sense(adj)
var room int
for {
fmt.Print("Choose an adjacent room : ")
scanner.Scan()
room, _ = strconv.Atoi(scanner.Text())
if room != adj[0] && room != adj[1] && room != adj[2] {
fmt.Println("Invalid response, try again")
} else {
break
}
}
check(scanner.Err())
var action byte
for {
fmt.Print("Walk or shoot w/s : ")
scanner.Scan()
reply := strings.ToLower(scanner.Text())
if len(reply) != 1 || (len(reply) == 1 && reply[0] != 'w' && reply[0] != 's') {
fmt.Println("Invalid response, try again")
} else {
action = reply[0]
break
}
}
check(scanner.Err())
if action == 'w' {
player = room
switch player {
case wumpus:
fmt.Println("You have been eaten by the Wumpus and lost the game!")
return
case pit1, pit2:
fmt.Println("You have fallen down a bottomless pit and lost the game!")
return
case bat1, bat2:
for {
room = rand.Intn(19) + 2
if isEmpty(room) {
fmt.Println("A bat has transported you to a random empty room")
player = room
break
}
}
}
} else {
if room == wumpus {
fmt.Println("You have killed the Wumpus and won the game!!")
return
} else {
chance := rand.Intn(4)
if chance > 0 {
wumpus = cave[wumpus][rand.Intn(3)]
if player == wumpus {
fmt.Println("You have been eaten by the Wumpus and lost the game!")
return
}
}
}
arrows--
if arrows == 0 {
fmt.Println("You have run out of arrows and lost the game!")
return
}
}
}
}
|
Translate this program into Go but keep the logic exactly as in Python. |
import sys
if len(sys.argv)!=2:
print("Usage : python " + sys.argv[0] + " <filename>")
exit()
dataFile = open(sys.argv[1],"r")
fileData = dataFile.read().split('\n')
dataFile.close()
[print(i) for i in fileData[::-1]]
| package main
import (
"bytes"
"fmt"
"io/ioutil"
"log"
"runtime"
)
func main() {
fileName1 := "rodgers.txt"
fileName2 := "rodgers_reversed.txt"
lineBreak := "\n"
if runtime.GOOS == "windows" {
lineBreak = "\r\n"
}
b, err := ioutil.ReadFile(fileName1)
if err != nil {
log.Fatal(err)
}
lines := bytes.Split(b, []byte(lineBreak))
if len(lines[len(lines)-1]) == 0 {
lines = lines[:len(lines)-1]
}
for i, j := 0, len(lines)-1; i < j; i, j = i+1, j-1 {
lines[i], lines[j] = lines[j], lines[i]
}
b = bytes.Join(lines, []byte(lineBreak))
if err = ioutil.WriteFile(fileName2, b, 0o666); err != nil {
log.Fatal(err)
}
b, err = ioutil.ReadFile(fileName2)
if err != nil {
log.Fatal(err)
}
fmt.Println(string(b))
}
|
Maintain the same structure and functionality when rewriting this code in Go. | def hourglass_puzzle():
t4 = 0
while t4 < 10_000:
t7_left = 7 - t4 % 7
if t7_left == 9 - 4:
break
t4 += 4
else:
print('Not found')
return
print(f)
hourglass_puzzle()
| package main
import (
"fmt"
"log"
)
func minimum(a []int) int {
min := a[0]
for i := 1; i < len(a); i++ {
if a[i] < min {
min = a[i]
}
}
return min
}
func sum(a []int) int {
s := 0
for _, i := range a {
s = s + i
}
return s
}
func hourglassFlipper(hourglasses []int, target int) (int, []int) {
flippers := make([]int, len(hourglasses))
copy(flippers, hourglasses)
var series []int
for iter := 0; iter < 10000; iter++ {
n := minimum(flippers)
series = append(series, n)
for i := 0; i < len(flippers); i++ {
flippers[i] -= n
}
for i, flipper := range flippers {
if flipper == 0 {
flippers[i] = hourglasses[i]
}
}
for start := len(series) - 1; start >= 0; start-- {
if sum(series[start:]) == target {
return start, series
}
}
}
log.Fatal("Unable to find an answer within 10,000 iterations.")
return 0, nil
}
func main() {
fmt.Print("Flip an hourglass every time it runs out of grains, ")
fmt.Println("and note the interval in time.")
hgs := [][]int{{4, 7}, {5, 7, 31}}
ts := []int{9, 36}
for i := 0; i < len(hgs); i++ {
start, series := hourglassFlipper(hgs[i], ts[i])
end := len(series) - 1
fmt.Println("\nSeries:", series)
fmt.Printf("Use hourglasses from indices %d to %d (inclusive) to sum ", start, end)
fmt.Println(ts[i], "using", hgs[i])
}
}
|
Ensure the translated Go code behaves exactly like the original Python snippet. | def hourglass_puzzle():
t4 = 0
while t4 < 10_000:
t7_left = 7 - t4 % 7
if t7_left == 9 - 4:
break
t4 += 4
else:
print('Not found')
return
print(f)
hourglass_puzzle()
| package main
import (
"fmt"
"log"
)
func minimum(a []int) int {
min := a[0]
for i := 1; i < len(a); i++ {
if a[i] < min {
min = a[i]
}
}
return min
}
func sum(a []int) int {
s := 0
for _, i := range a {
s = s + i
}
return s
}
func hourglassFlipper(hourglasses []int, target int) (int, []int) {
flippers := make([]int, len(hourglasses))
copy(flippers, hourglasses)
var series []int
for iter := 0; iter < 10000; iter++ {
n := minimum(flippers)
series = append(series, n)
for i := 0; i < len(flippers); i++ {
flippers[i] -= n
}
for i, flipper := range flippers {
if flipper == 0 {
flippers[i] = hourglasses[i]
}
}
for start := len(series) - 1; start >= 0; start-- {
if sum(series[start:]) == target {
return start, series
}
}
}
log.Fatal("Unable to find an answer within 10,000 iterations.")
return 0, nil
}
func main() {
fmt.Print("Flip an hourglass every time it runs out of grains, ")
fmt.Println("and note the interval in time.")
hgs := [][]int{{4, 7}, {5, 7, 31}}
ts := []int{9, 36}
for i := 0; i < len(hgs); i++ {
start, series := hourglassFlipper(hgs[i], ts[i])
end := len(series) - 1
fmt.Println("\nSeries:", series)
fmt.Printf("Use hourglasses from indices %d to %d (inclusive) to sum ", start, end)
fmt.Println(ts[i], "using", hgs[i])
}
}
|
Please provide an equivalent version of this Python code in Go. | LIST = ["1a3c52debeffd", "2b6178c97a938stf", "3ycxdb1fgxa2yz"]
print(sorted([ch for ch in set([c for c in ''.join(LIST)]) if all(w.count(ch) == 1 for w in LIST)]))
| package main
import (
"fmt"
"sort"
)
func main() {
strings := []string{"1a3c52debeffd", "2b6178c97a938stf", "3ycxdb1fgxa2yz"}
u := make(map[rune]int)
for _, s := range strings {
m := make(map[rune]int)
for _, c := range s {
m[c]++
}
for k, v := range m {
if v == 1 {
u[k]++
}
}
}
var chars []rune
for k, v := range u {
if v == 3 {
chars = append(chars, k)
}
}
sort.Slice(chars, func(i, j int) bool { return chars[i] < chars[j] })
fmt.Println(string(chars))
}
|
Translate the given Python code snippet into Go without altering its behavior. | class FibonacciHeap:
class Node:
def __init__(self, data):
self.data = data
self.parent = self.child = self.left = self.right = None
self.degree = 0
self.mark = False
def iterate(self, head):
node = stop = head
flag = False
while True:
if node == stop and flag is True:
break
elif node == stop:
flag = True
yield node
node = node.right
root_list, min_node = None, None
total_nodes = 0
def find_min(self):
return self.min_node
def extract_min(self):
z = self.min_node
if z is not None:
if z.child is not None:
children = [x for x in self.iterate(z.child)]
for i in xrange(0, len(children)):
self.merge_with_root_list(children[i])
children[i].parent = None
self.remove_from_root_list(z)
if z == z.right:
self.min_node = self.root_list = None
else:
self.min_node = z.right
self.consolidate()
self.total_nodes -= 1
return z
def insert(self, data):
n = self.Node(data)
n.left = n.right = n
self.merge_with_root_list(n)
if self.min_node is None or n.data < self.min_node.data:
self.min_node = n
self.total_nodes += 1
def decrease_key(self, x, k):
if k > x.data:
return None
x.data = k
y = x.parent
if y is not None and x.data < y.data:
self.cut(x, y)
self.cascading_cut(y)
if x.data < self.min_node.data:
self.min_node = x
def merge(self, h2):
H = FibonacciHeap()
H.root_list, H.min_node = self.root_list, self.min_node
last = h2.root_list.left
h2.root_list.left = H.root_list.left
H.root_list.left.right = h2.root_list
H.root_list.left = last
H.root_list.left.right = H.root_list
if h2.min_node.data < H.min_node.data:
H.min_node = h2.min_node
H.total_nodes = self.total_nodes + h2.total_nodes
return H
def cut(self, x, y):
self.remove_from_child_list(y, x)
y.degree -= 1
self.merge_with_root_list(x)
x.parent = None
x.mark = False
def cascading_cut(self, y):
z = y.parent
if z is not None:
if y.mark is False:
y.mark = True
else:
self.cut(y, z)
self.cascading_cut(z)
def consolidate(self):
A = [None] * self.total_nodes
nodes = [w for w in self.iterate(self.root_list)]
for w in xrange(0, len(nodes)):
x = nodes[w]
d = x.degree
while A[d] != None:
y = A[d]
if x.data > y.data:
temp = x
x, y = y, temp
self.heap_link(y, x)
A[d] = None
d += 1
A[d] = x
for i in xrange(0, len(A)):
if A[i] is not None:
if A[i].data < self.min_node.data:
self.min_node = A[i]
def heap_link(self, y, x):
self.remove_from_root_list(y)
y.left = y.right = y
self.merge_with_child_list(x, y)
x.degree += 1
y.parent = x
y.mark = False
def merge_with_root_list(self, node):
if self.root_list is None:
self.root_list = node
else:
node.right = self.root_list.right
node.left = self.root_list
self.root_list.right.left = node
self.root_list.right = node
def merge_with_child_list(self, parent, node):
if parent.child is None:
parent.child = node
else:
node.right = parent.child.right
node.left = parent.child
parent.child.right.left = node
parent.child.right = node
def remove_from_root_list(self, node):
if node == self.root_list:
self.root_list = node.right
node.left.right = node.right
node.right.left = node.left
def remove_from_child_list(self, parent, node):
if parent.child == parent.child.right:
parent.child = None
elif parent.child == node:
parent.child = node.right
node.right.parent = parent
node.left.right = node.right
node.right.left = node.left
| package fib
import "fmt"
type Value interface {
LT(Value) bool
}
type Node struct {
value Value
parent *Node
child *Node
prev, next *Node
rank int
mark bool
}
func (n Node) Value() Value { return n.value }
type Heap struct{ *Node }
func MakeHeap() *Heap { return &Heap{} }
func (h *Heap) Insert(v Value) *Node {
x := &Node{value: v}
if h.Node == nil {
x.next = x
x.prev = x
h.Node = x
} else {
meld1(h.Node, x)
if x.value.LT(h.value) {
h.Node = x
}
}
return x
}
func meld1(list, single *Node) {
list.prev.next = single
single.prev = list.prev
single.next = list
list.prev = single
}
func (h *Heap) Union(h2 *Heap) {
switch {
case h.Node == nil:
*h = *h2
case h2.Node != nil:
meld2(h.Node, h2.Node)
if h2.value.LT(h.value) {
*h = *h2
}
}
h2.Node = nil
}
func meld2(a, b *Node) {
a.prev.next = b
b.prev.next = a
a.prev, b.prev = b.prev, a.prev
}
func (h Heap) Minimum() (min Value, ok bool) {
if h.Node == nil {
return
}
return h.value, true
}
func (h *Heap) ExtractMin() (min Value, ok bool) {
if h.Node == nil {
return
}
min = h.value
roots := map[int]*Node{}
add := func(r *Node) {
r.prev = r
r.next = r
for {
x, ok := roots[r.rank]
if !ok {
break
}
delete(roots, r.rank)
if x.value.LT(r.value) {
r, x = x, r
}
x.parent = r
x.mark = false
if r.child == nil {
x.next = x
x.prev = x
r.child = x
} else {
meld1(r.child, x)
}
r.rank++
}
roots[r.rank] = r
}
for r := h.next; r != h.Node; {
n := r.next
add(r)
r = n
}
if c := h.child; c != nil {
c.parent = nil
r := c.next
add(c)
for r != c {
n := r.next
r.parent = nil
add(r)
r = n
}
}
if len(roots) == 0 {
h.Node = nil
return min, true
}
var mv *Node
var d int
for d, mv = range roots {
break
}
delete(roots, d)
mv.next = mv
mv.prev = mv
for _, r := range roots {
r.prev = mv
r.next = mv.next
mv.next.prev = r
mv.next = r
if r.value.LT(mv.value) {
mv = r
}
}
h.Node = mv
return min, true
}
func (h *Heap) DecreaseKey(n *Node, v Value) error {
if n.value.LT(v) {
return fmt.Errorf("DecreaseKey new value greater than existing value")
}
n.value = v
if n == h.Node {
return nil
}
p := n.parent
if p == nil {
if v.LT(h.value) {
h.Node = n
}
return nil
}
h.cutAndMeld(n)
return nil
}
func (h Heap) cut(x *Node) {
p := x.parent
p.rank--
if p.rank == 0 {
p.child = nil
} else {
p.child = x.next
x.prev.next = x.next
x.next.prev = x.prev
}
if p.parent == nil {
return
}
if !p.mark {
p.mark = true
return
}
h.cutAndMeld(p)
}
func (h Heap) cutAndMeld(x *Node) {
h.cut(x)
x.parent = nil
meld1(h.Node, x)
}
func (h *Heap) Delete(n *Node) {
p := n.parent
if p == nil {
if n == h.Node {
h.ExtractMin()
return
}
n.prev.next = n.next
n.next.prev = n.prev
} else {
h.cut(n)
}
c := n.child
if c == nil {
return
}
for {
c.parent = nil
c = c.next
if c == n.child {
break
}
}
meld2(h.Node, c)
}
func (h Heap) Vis() {
if h.Node == nil {
fmt.Println("<empty>")
return
}
var f func(*Node, string)
f = func(n *Node, pre string) {
pc := "│ "
for x := n; ; x = x.next {
if x.next != n {
fmt.Print(pre, "├─")
} else {
fmt.Print(pre, "└─")
pc = " "
}
if x.child == nil {
fmt.Println("╴", x.value)
} else {
fmt.Println("┐", x.value)
f(x.child, pre+pc)
}
if x.next == n {
break
}
}
}
f(h.Node, "")
}
|
Preserve the algorithm and functionality while converting the code from Python to Go. | import datetime
def g2m(date, gtm_correlation=True):
correlation = 584283 if gtm_correlation else 584285
long_count_days = [144000, 7200, 360, 20, 1]
tzolkin_months = ['Imix’', 'Ik’', 'Ak’bal', 'K’an', 'Chikchan', 'Kimi', 'Manik’', 'Lamat', 'Muluk', 'Ok', 'Chuwen',
'Eb', 'Ben', 'Hix', 'Men', 'K’ib’', 'Kaban', 'Etz’nab’', 'Kawak', 'Ajaw']
haad_months = ['Pop', 'Wo’', 'Sip', 'Sotz’', 'Sek', 'Xul', 'Yaxk’in', 'Mol', 'Ch’en', 'Yax', 'Sak’', 'Keh', 'Mak',
'K’ank’in', 'Muwan', 'Pax', 'K’ayab', 'Kumk’u', 'Wayeb’']
gregorian_days = datetime.datetime.strptime(date, '%Y-%m-%d').toordinal()
julian_days = gregorian_days + 1721425
long_date = list()
remainder = julian_days - correlation
for days in long_count_days:
result, remainder = divmod(remainder, days)
long_date.append(int(result))
long_date = '.'.join(['{:02d}'.format(d) for d in long_date])
tzolkin_month = (julian_days + 16) % 20
tzolkin_day = ((julian_days + 5) % 13) + 1
haab_month = int(((julian_days + 65) % 365) / 20)
haab_day = ((julian_days + 65) % 365) % 20
haab_day = haab_day if haab_day else 'Chum'
lord_number = (julian_days - correlation) % 9
lord_number = lord_number if lord_number else 9
round_date = f'{tzolkin_day} {tzolkin_months[tzolkin_month]} {haab_day} {haad_months[haab_month]} G{lord_number}'
return long_date, round_date
if __name__ == '__main__':
dates = ['2004-06-19', '2012-12-18', '2012-12-21', '2019-01-19', '2019-03-27', '2020-02-29', '2020-03-01']
for date in dates:
long, round = g2m(date)
print(date, long, round)
| package main
import (
"fmt"
"strconv"
"strings"
"time"
)
var sacred = strings.Fields("Imix’ Ik’ Ak’bal K’an Chikchan Kimi Manik’ Lamat Muluk Ok Chuwen Eb Ben Hix Men K’ib’ Kaban Etz’nab’ Kawak Ajaw")
var civil = strings.Fields("Pop Wo’ Sip Sotz’ Sek Xul Yaxk’in Mol Ch’en Yax Sak’ Keh Mak K’ank’in Muwan’ Pax K’ayab Kumk’u Wayeb’")
var (
date1 = time.Date(2012, time.December, 21, 0, 0, 0, 0, time.UTC)
date2 = time.Date(2019, time.April, 2, 0, 0, 0, 0, time.UTC)
)
func tzolkin(date time.Time) (int, string) {
diff := int(date.Sub(date1).Hours()) / 24
rem := diff % 13
if rem < 0 {
rem = 13 + rem
}
var num int
if rem <= 9 {
num = rem + 4
} else {
num = rem - 9
}
rem = diff % 20
if rem <= 0 {
rem = 20 + rem
}
return num, sacred[rem-1]
}
func haab(date time.Time) (string, string) {
diff := int(date.Sub(date2).Hours()) / 24
rem := diff % 365
if rem < 0 {
rem = 365 + rem
}
month := civil[(rem+1)/20]
last := 20
if month == "Wayeb’" {
last = 5
}
d := rem%20 + 1
if d < last {
return strconv.Itoa(d), month
}
return "Chum", month
}
func longCount(date time.Time) string {
diff := int(date.Sub(date1).Hours()) / 24
diff += 13 * 400 * 360
baktun := diff / (400 * 360)
diff %= 400 * 360
katun := diff / (20 * 360)
diff %= 20 * 360
tun := diff / 360
diff %= 360
winal := diff / 20
kin := diff % 20
return fmt.Sprintf("%d.%d.%d.%d.%d", baktun, katun, tun, winal, kin)
}
func lord(date time.Time) string {
diff := int(date.Sub(date1).Hours()) / 24
rem := diff % 9
if rem <= 0 {
rem = 9 + rem
}
return fmt.Sprintf("G%d", rem)
}
func main() {
const shortForm = "2006-01-02"
dates := []string{
"2004-06-19",
"2012-12-18",
"2012-12-21",
"2019-01-19",
"2019-03-27",
"2020-02-29",
"2020-03-01",
"2071-05-16",
}
fmt.Println(" Gregorian Tzolk’in Haab’ Long Lord of")
fmt.Println(" Date # Name Day Month Count the Night")
fmt.Println("---------- -------- ------------- -------------- ---------")
for _, dt := range dates {
date, _ := time.Parse(shortForm, dt)
n, s := tzolkin(date)
d, m := haab(date)
lc := longCount(date)
l := lord(date)
fmt.Printf("%s %2d %-8s %4s %-9s %-14s %s\n", dt, n, s, d, m, lc, l)
}
}
|
Write a version of this Python function in Go with identical behavior. |
import sys
if len(sys.argv)!=2:
print("Usage : python " + sys.argv[0] + " <whole number>")
exit()
numLimit = int(sys.argv[1])
resultSet = {}
base = 1
while len(resultSet)!=numLimit:
result = base**base
for i in range(0,numLimit):
if str(i) in str(result) and i not in resultSet:
resultSet[i] = base
base+=1
[print(resultSet[i], end=' ') for i in sorted(resultSet)]
| package main
import (
"fmt"
"math/big"
"strconv"
"strings"
)
func main() {
var res []int64
for n := 0; n <= 50; n++ {
ns := strconv.Itoa(n)
k := int64(1)
for {
bk := big.NewInt(k)
s := bk.Exp(bk, bk, nil).String()
if strings.Contains(s, ns) {
res = append(res, k)
break
}
k++
}
}
fmt.Println("The smallest positive integers K where K ^ K contains N (0..50) are:")
for i, n := range res {
fmt.Printf("%2d ", n)
if (i+1)%17 == 0 {
fmt.Println()
}
}
}
|
Please provide an equivalent version of this Python code in Go. | print("working...")
row = 0
limit = 1500
Sophie = []
def isPrime(n):
for i in range(2,int(n**0.5)+1):
if n%i==0:
return False
return True
for n in range(2,limit):
p = 2*n + 1
if isPrime(n) and isPrime(p):
Sophie.append(n)
print("Found ",end = "")
print(len(Sophie),end = "")
print(" Safe and Sophie primes.")
print(Sophie)
print("done...")
| package main
import (
"fmt"
"rcu"
)
func main() {
var sgp []int
p := 2
count := 0
for count < 50 {
if rcu.IsPrime(p) && rcu.IsPrime(2*p+1) {
sgp = append(sgp, p)
count++
}
if p != 2 {
p = p + 2
} else {
p = 3
}
}
fmt.Println("The first 50 Sophie Germain primes are:")
for i := 0; i < len(sgp); i++ {
fmt.Printf("%5s ", rcu.Commatize(sgp[i]))
if (i+1)%10 == 0 {
fmt.Println()
}
}
}
|
Translate this program into Go but keep the logic exactly as in Python. | print("working...")
row = 0
limit = 1500
Sophie = []
def isPrime(n):
for i in range(2,int(n**0.5)+1):
if n%i==0:
return False
return True
for n in range(2,limit):
p = 2*n + 1
if isPrime(n) and isPrime(p):
Sophie.append(n)
print("Found ",end = "")
print(len(Sophie),end = "")
print(" Safe and Sophie primes.")
print(Sophie)
print("done...")
| package main
import (
"fmt"
"rcu"
)
func main() {
var sgp []int
p := 2
count := 0
for count < 50 {
if rcu.IsPrime(p) && rcu.IsPrime(2*p+1) {
sgp = append(sgp, p)
count++
}
if p != 2 {
p = p + 2
} else {
p = 3
}
}
fmt.Println("The first 50 Sophie Germain primes are:")
for i := 0; i < len(sgp); i++ {
fmt.Printf("%5s ", rcu.Commatize(sgp[i]))
if (i+1)%10 == 0 {
fmt.Println()
}
}
}
|
Produce a functionally identical Go code for the snippet given in Python. |
from __future__ import unicode_literals
import argparse
import fileinput
import os
import sys
from functools import partial
from itertools import count
from itertools import takewhile
ANSI_RESET = "\u001b[0m"
RED = (255, 0, 0)
GREEN = (0, 255, 0)
YELLOW = (255, 255, 0)
BLUE = (0, 0, 255)
MAGENTA = (255, 0, 255)
CYAN = (0, 255, 255)
ANSI_PALETTE = {
RED: "\u001b[31m",
GREEN: "\u001b[32m",
YELLOW: "\u001b[33m",
BLUE: "\u001b[34m",
MAGENTA: "\u001b[35m",
CYAN: "\u001b[36m",
}
_8BIT_PALETTE = {
(0xAF, 0x00, 0x00): "\u001b[38;5;124m",
(0xAF, 0x00, 0x5F): "\u001b[38;5;125m",
(0xAF, 0x00, 0x87): "\u001b[38;5;126m",
(0xAF, 0x00, 0xAF): "\u001b[38;5;127m",
(0xAF, 0x00, 0xD7): "\u001b[38;5;128m",
(0xAF, 0x00, 0xFF): "\u001b[38;5;129m",
(0xAF, 0x5F, 0x00): "\u001b[38;5;130m",
(0xAF, 0x5F, 0x5F): "\u001b[38;5;131m",
(0xAF, 0x5F, 0x87): "\u001b[38;5;132m",
(0xAF, 0x5F, 0xAF): "\u001b[38;5;133m",
(0xAF, 0x5F, 0xD7): "\u001b[38;5;134m",
(0xAF, 0x5F, 0xFF): "\u001b[38;5;135m",
(0xAF, 0x87, 0x00): "\u001b[38;5;136m",
(0xAF, 0x87, 0x5F): "\u001b[38;5;137m",
(0xAF, 0x87, 0x87): "\u001b[38;5;138m",
(0xAF, 0x87, 0xAF): "\u001b[38;5;139m",
(0xAF, 0x87, 0xD7): "\u001b[38;5;140m",
(0xAF, 0x87, 0xFF): "\u001b[38;5;141m",
(0xAF, 0xAF, 0x00): "\u001b[38;5;142m",
(0xAF, 0xAF, 0x5F): "\u001b[38;5;143m",
(0xAF, 0xAF, 0x87): "\u001b[38;5;144m",
(0xAF, 0xAF, 0xAF): "\u001b[38;5;145m",
(0xAF, 0xAF, 0xD7): "\u001b[38;5;146m",
(0xAF, 0xAF, 0xFF): "\u001b[38;5;147m",
(0xAF, 0xD7, 0x00): "\u001b[38;5;148m",
(0xAF, 0xD7, 0x5F): "\u001b[38;5;149m",
(0xAF, 0xD7, 0x87): "\u001b[38;5;150m",
(0xAF, 0xD7, 0xAF): "\u001b[38;5;151m",
(0xAF, 0xD7, 0xD7): "\u001b[38;5;152m",
(0xAF, 0xD7, 0xFF): "\u001b[38;5;153m",
(0xAF, 0xFF, 0x00): "\u001b[38;5;154m",
(0xAF, 0xFF, 0x5F): "\u001b[38;5;155m",
(0xAF, 0xFF, 0x87): "\u001b[38;5;156m",
(0xAF, 0xFF, 0xAF): "\u001b[38;5;157m",
(0xAF, 0xFF, 0xD7): "\u001b[38;5;158m",
(0xAF, 0xFF, 0xFF): "\u001b[38;5;159m",
}
def error(msg):
sys.stderr.write(msg)
sys.stderr.write(os.linesep)
sys.exit(1)
def rgb(group):
nibbles_per_channel = len(group) // 3
max_val = 16 ** nibbles_per_channel - 1
nibbles = chunked(group, nibbles_per_channel)
return tuple((int(n, 16) * 255) // max_val for n in nibbles)
def distance(color, other):
return sum((o - s) ** 2 for s, o in zip(color, other))
def chunked(seq, n):
return takewhile(len, (seq[i : i + n] for i in count(0, n)))
def escape(group, palette):
key = partial(distance, other=rgb(group.ljust(3, "0")))
ansi_color = min(palette, key=key)
return "".join([palette[ansi_color], group, ANSI_RESET])
def colorize(line, group_size=3, palette=ANSI_PALETTE):
checksum, filename = line.split(None, 1)
escaped = [escape(group, palette) for group in chunked(checksum, group_size)]
sys.stdout.write(" ".join(["".join(escaped), filename]))
def html_colorize(checksum, group_size=3, palette=ANSI_PALETTE):
def span(group):
key = partial(distance, other=rgb(group.ljust(3, "0")))
ansi_color = min(palette, key=key)
int_val = int.from_bytes(ansi_color, byteorder="big")
hex_val = hex(int_val)[2:].rjust(6, "0")
return '<span style="color:
checksum, filename = line.split(None, 1)
escaped = [span(group) for group in chunked(checksum, group_size)]
sys.stdout.write(" ".join(["".join(escaped), filename]))
if __name__ == "__main__":
parser = argparse.ArgumentParser(description="Color checksum.")
parser.add_argument(
"-n",
type=int,
default=3,
help="Color the checksum in groups of size N. Defaults to 3.",
)
parser.add_argument(
"-e",
"--extended-palette",
action="store_true",
help="Use the extended 8-bit palette. Defaults to False.",
)
parser.add_argument(
"--html",
action="store_true",
help="Output checksum groups wrapped with 'span' tags instead of ANSI escape sequences.",
)
parser.add_argument("files", nargs="*", default="-", metavar="FILE")
args = parser.parse_args()
if sys.stdout.isatty():
palette = ANSI_PALETTE
if args.extended_palette:
palette = _8BIT_PALETTE
colorize_func = colorize
if args.html:
colorize_func = html_colorize
for line in fileinput.input(files=args.files):
colorize_func(line, group_size=args.n, palette=palette)
else:
for line in fileinput.input(files=args.files):
sys.stdout.write(line)
| package main
import (
"bufio"
"fmt"
"golang.org/x/crypto/ssh/terminal"
"log"
"os"
"regexp"
"strconv"
)
type Color struct{ r, g, b int }
type ColorEx struct {
color Color
code string
}
var colors = []ColorEx{
{Color{15, 0, 0}, "31"},
{Color{0, 15, 0}, "32"},
{Color{15, 15, 0}, "33"},
{Color{0, 0, 15}, "34"},
{Color{15, 0, 15}, "35"},
{Color{0, 15, 15}, "36"},
}
func squareDist(c1, c2 Color) int {
xd := c2.r - c1.r
yd := c2.g - c1.g
zd := c2.b - c1.b
return xd*xd + yd*yd + zd*zd
}
func printColor(s string) {
n := len(s)
k := 0
for i := 0; i < n/3; i++ {
j := i * 3
c1 := s[j]
c2 := s[j+1]
c3 := s[j+2]
k = j + 3
r, err := strconv.ParseInt(fmt.Sprintf("0x%c", c1), 0, 64)
check(err)
g, err := strconv.ParseInt(fmt.Sprintf("0x%c", c2), 0, 64)
check(err)
b, err := strconv.ParseInt(fmt.Sprintf("0x%c", c3), 0, 64)
check(err)
rgb := Color{int(r), int(g), int(b)}
m := 676
colorCode := ""
for _, cex := range colors {
sqd := squareDist(cex.color, rgb)
if sqd < m {
colorCode = cex.code
m = sqd
}
}
fmt.Printf("\033[%s;1m%c%c%c\033[00m", colorCode, c1, c2, c3)
}
for j := k; j < n; j++ {
c := s[j]
fmt.Printf("\033[0;1m%c\033[00m", c)
}
}
var (
r = regexp.MustCompile("^([A-Fa-f0-9]+)([ \t]+.+)$")
scanner = bufio.NewScanner(os.Stdin)
err error
)
func colorChecksum() {
for scanner.Scan() {
line := scanner.Text()
if r.MatchString(line) {
submatches := r.FindStringSubmatch(line)
s1 := submatches[1]
s2 := submatches[2]
printColor(s1)
fmt.Println(s2)
} else {
fmt.Println(line)
}
}
check(scanner.Err())
}
func cat() {
for scanner.Scan() {
line := scanner.Text()
fmt.Println(line)
}
check(scanner.Err())
}
func check(err error) {
if err != nil {
log.Fatal(err)
}
}
func main() {
if terminal.IsTerminal(int(os.Stdout.Fd())) {
colorChecksum()
} else {
cat()
}
}
|
Write the same code in Go as shown below in Python. |
import sqlite3
import string
import random
from http import HTTPStatus
from flask import Flask
from flask import Blueprint
from flask import abort
from flask import current_app
from flask import g
from flask import jsonify
from flask import redirect
from flask import request
from flask import url_for
CHARS = frozenset(string.ascii_letters + string.digits)
MIN_URL_SIZE = 8
RANDOM_ATTEMPTS = 3
def create_app(*, db=None, server_name=None) -> Flask:
app = Flask(__name__)
app.config.from_mapping(
DATABASE=db or "shorten.sqlite",
SERVER_NAME=server_name,
)
with app.app_context():
init_db()
app.teardown_appcontext(close_db)
app.register_blueprint(shortener)
return app
def get_db():
if "db" not in g:
g.db = sqlite3.connect(current_app.config["DATABASE"])
g.db.row_factory = sqlite3.Row
return g.db
def close_db(_):
db = g.pop("db", None)
if db is not None:
db.close()
def init_db():
db = get_db()
with db:
db.execute(
"CREATE TABLE IF NOT EXISTS shorten ("
"url TEXT PRIMARY KEY, "
"short TEXT NOT NULL UNIQUE ON CONFLICT FAIL)"
)
shortener = Blueprint("shorten", "short")
def random_short(size=MIN_URL_SIZE):
return "".join(random.sample(CHARS, size))
@shortener.errorhandler(HTTPStatus.NOT_FOUND)
def short_url_not_found(_):
return "short url not found", HTTPStatus.NOT_FOUND
@shortener.route("/<path:key>", methods=("GET",))
def short(key):
db = get_db()
cursor = db.execute("SELECT url FROM shorten WHERE short = ?", (key,))
row = cursor.fetchone()
if row is None:
abort(HTTPStatus.NOT_FOUND)
return redirect(row["url"], code=HTTPStatus.FOUND)
class URLExistsError(Exception):
class ShortCollisionError(Exception):
def _insert_short(long_url, short):
db = get_db()
if (
db.execute("SELECT * FROM shorten WHERE url = ?", (long_url,)).fetchone()
is not None
):
raise URLExistsError(long_url)
if (
db.execute("SELECT * FROM shorten WHERE short = ?", (short,)).fetchone()
is not None
):
raise ShortCollisionError(short)
with db:
db.execute("INSERT INTO shorten VALUES (?, ?)", (long_url, short))
def make_short(long_url):
size = MIN_URL_SIZE
attempts = 1
short = random_short(size=size)
while True:
try:
_insert_short(long_url, short)
except ShortCollisionError:
if not attempts % RANDOM_ATTEMPTS:
size += 1
attempts += 1
short = random_short(size=size)
else:
break
return short
@shortener.route("/", methods=("POST",))
def shorten():
data = request.get_json()
if data is None:
abort(HTTPStatus.BAD_REQUEST)
long_url = data.get("long")
if long_url is None:
abort(HTTPStatus.BAD_REQUEST)
db = get_db()
cursor = db.execute("SELECT short FROM shorten WHERE url = ?", (long_url,))
row = cursor.fetchone()
if row is not None:
short_url = url_for("shorten.short", _external=True, key=row["short"])
status_code = HTTPStatus.OK
else:
short_url = url_for("shorten.short", _external=True, key=make_short(long_url))
status_code = HTTPStatus.CREATED
mimetype = request.accept_mimetypes.best_match(
matches=["text/plain", "application/json"], default="text/plain"
)
if mimetype == "application/json":
return jsonify(long=long_url, short=short_url), status_code
else:
return short_url, status_code
if __name__ == "__main__":
app = create_app()
app.env = "development"
app.run(debug=True)
|
package main
import (
"encoding/json"
"fmt"
"io/ioutil"
"log"
"math/rand"
"net/http"
"time"
)
const (
chars = "0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ"
host = "localhost:8000"
)
type database map[string]string
type shortener struct {
Long string `json:"long"`
}
func (db database) ServeHTTP(w http.ResponseWriter, req *http.Request) {
switch req.Method {
case http.MethodPost:
body, err := ioutil.ReadAll(req.Body)
if err != nil {
w.WriteHeader(http.StatusBadRequest)
return
}
var sh shortener
err = json.Unmarshal(body, &sh)
if err != nil {
w.WriteHeader(http.StatusUnprocessableEntity)
return
}
short := generateKey(8)
db[short] = sh.Long
fmt.Fprintf(w, "The shortened URL: http:
case http.MethodGet:
path := req.URL.Path[1:]
if v, ok := db[path]; ok {
http.Redirect(w, req, v, http.StatusFound)
} else {
w.WriteHeader(http.StatusNotFound)
fmt.Fprintf(w, "No such shortened url: http:
}
default:
w.WriteHeader(http.StatusNotFound)
fmt.Fprintf(w, "Unsupprted method: %s\n", req.Method)
}
}
func generateKey(size int) string {
key := make([]byte, size)
le := len(chars)
for i := 0; i < size; i++ {
key[i] = chars[rand.Intn(le)]
}
return string(key)
}
func main() {
rand.Seed(time.Now().UnixNano())
db := make(database)
log.Fatal(http.ListenAndServe(host, db))
}
|
Maintain the same structure and functionality when rewriting this code in Go. |
import sqlite3
import string
import random
from http import HTTPStatus
from flask import Flask
from flask import Blueprint
from flask import abort
from flask import current_app
from flask import g
from flask import jsonify
from flask import redirect
from flask import request
from flask import url_for
CHARS = frozenset(string.ascii_letters + string.digits)
MIN_URL_SIZE = 8
RANDOM_ATTEMPTS = 3
def create_app(*, db=None, server_name=None) -> Flask:
app = Flask(__name__)
app.config.from_mapping(
DATABASE=db or "shorten.sqlite",
SERVER_NAME=server_name,
)
with app.app_context():
init_db()
app.teardown_appcontext(close_db)
app.register_blueprint(shortener)
return app
def get_db():
if "db" not in g:
g.db = sqlite3.connect(current_app.config["DATABASE"])
g.db.row_factory = sqlite3.Row
return g.db
def close_db(_):
db = g.pop("db", None)
if db is not None:
db.close()
def init_db():
db = get_db()
with db:
db.execute(
"CREATE TABLE IF NOT EXISTS shorten ("
"url TEXT PRIMARY KEY, "
"short TEXT NOT NULL UNIQUE ON CONFLICT FAIL)"
)
shortener = Blueprint("shorten", "short")
def random_short(size=MIN_URL_SIZE):
return "".join(random.sample(CHARS, size))
@shortener.errorhandler(HTTPStatus.NOT_FOUND)
def short_url_not_found(_):
return "short url not found", HTTPStatus.NOT_FOUND
@shortener.route("/<path:key>", methods=("GET",))
def short(key):
db = get_db()
cursor = db.execute("SELECT url FROM shorten WHERE short = ?", (key,))
row = cursor.fetchone()
if row is None:
abort(HTTPStatus.NOT_FOUND)
return redirect(row["url"], code=HTTPStatus.FOUND)
class URLExistsError(Exception):
class ShortCollisionError(Exception):
def _insert_short(long_url, short):
db = get_db()
if (
db.execute("SELECT * FROM shorten WHERE url = ?", (long_url,)).fetchone()
is not None
):
raise URLExistsError(long_url)
if (
db.execute("SELECT * FROM shorten WHERE short = ?", (short,)).fetchone()
is not None
):
raise ShortCollisionError(short)
with db:
db.execute("INSERT INTO shorten VALUES (?, ?)", (long_url, short))
def make_short(long_url):
size = MIN_URL_SIZE
attempts = 1
short = random_short(size=size)
while True:
try:
_insert_short(long_url, short)
except ShortCollisionError:
if not attempts % RANDOM_ATTEMPTS:
size += 1
attempts += 1
short = random_short(size=size)
else:
break
return short
@shortener.route("/", methods=("POST",))
def shorten():
data = request.get_json()
if data is None:
abort(HTTPStatus.BAD_REQUEST)
long_url = data.get("long")
if long_url is None:
abort(HTTPStatus.BAD_REQUEST)
db = get_db()
cursor = db.execute("SELECT short FROM shorten WHERE url = ?", (long_url,))
row = cursor.fetchone()
if row is not None:
short_url = url_for("shorten.short", _external=True, key=row["short"])
status_code = HTTPStatus.OK
else:
short_url = url_for("shorten.short", _external=True, key=make_short(long_url))
status_code = HTTPStatus.CREATED
mimetype = request.accept_mimetypes.best_match(
matches=["text/plain", "application/json"], default="text/plain"
)
if mimetype == "application/json":
return jsonify(long=long_url, short=short_url), status_code
else:
return short_url, status_code
if __name__ == "__main__":
app = create_app()
app.env = "development"
app.run(debug=True)
|
package main
import (
"encoding/json"
"fmt"
"io/ioutil"
"log"
"math/rand"
"net/http"
"time"
)
const (
chars = "0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ"
host = "localhost:8000"
)
type database map[string]string
type shortener struct {
Long string `json:"long"`
}
func (db database) ServeHTTP(w http.ResponseWriter, req *http.Request) {
switch req.Method {
case http.MethodPost:
body, err := ioutil.ReadAll(req.Body)
if err != nil {
w.WriteHeader(http.StatusBadRequest)
return
}
var sh shortener
err = json.Unmarshal(body, &sh)
if err != nil {
w.WriteHeader(http.StatusUnprocessableEntity)
return
}
short := generateKey(8)
db[short] = sh.Long
fmt.Fprintf(w, "The shortened URL: http:
case http.MethodGet:
path := req.URL.Path[1:]
if v, ok := db[path]; ok {
http.Redirect(w, req, v, http.StatusFound)
} else {
w.WriteHeader(http.StatusNotFound)
fmt.Fprintf(w, "No such shortened url: http:
}
default:
w.WriteHeader(http.StatusNotFound)
fmt.Fprintf(w, "Unsupprted method: %s\n", req.Method)
}
}
func generateKey(size int) string {
key := make([]byte, size)
le := len(chars)
for i := 0; i < size; i++ {
key[i] = chars[rand.Intn(le)]
}
return string(key)
}
func main() {
rand.Seed(time.Now().UnixNano())
db := make(database)
log.Fatal(http.ListenAndServe(host, db))
}
|
Can you help me rewrite this code in Go instead of Python, keeping it the same logically? |
import sys
black_pawn = " \u265f "
white_pawn = " \u2659 "
empty_square = " "
def draw_board(board_data):
bg_black = "\u001b[48;5;237m"
bg_white = "\u001b[48;5;245m"
clear_to_eol = "\u001b[0m\u001b[K\n"
board = ["1 ", bg_black, board_data[0][0], bg_white, board_data[0][1], bg_black, board_data[0][2], clear_to_eol,
"2 ", bg_white, board_data[1][0], bg_black, board_data[1][1], bg_white, board_data[1][2], clear_to_eol,
"3 ", bg_black, board_data[2][0], bg_white, board_data[2][1], bg_black, board_data[2][2], clear_to_eol,
" A B C\n"];
sys.stdout.write("".join(board))
def get_movement_direction(colour):
direction = -1
if colour == black_pawn:
direction = 1
elif colour == white_pawn:
direction = -1
else:
raise ValueError("Invalid piece colour")
return direction
def get_other_colour(colour):
if colour == black_pawn:
return white_pawn
elif colour == white_pawn:
return black_pawn
else:
raise ValueError("Invalid piece colour")
def get_allowed_moves(board_data, row, col):
if board_data[row][col] == empty_square:
return set()
colour = board_data[row][col]
other_colour = get_other_colour(colour)
direction = get_movement_direction(colour)
if (row + direction < 0 or row + direction > 2):
return set()
allowed_moves = set()
if board_data[row + direction][col] == empty_square:
allowed_moves.add('f')
if col > 0 and board_data[row + direction][col - 1] == other_colour:
allowed_moves.add('dl')
if col < 2 and board_data[row + direction][col + 1] == other_colour:
allowed_moves.add('dr')
return allowed_moves
def get_human_move(board_data, colour):
direction = get_movement_direction(colour)
while True:
piece_posn = input(f'What {colour} do you want to move? ')
valid_inputs = {'a1': (0,0), 'b1': (0,1), 'c1': (0,2),
'a2': (1,0), 'b2': (1,1), 'c2': (1,2),
'a3': (2,0), 'b3': (2,1), 'c3': (2,2)}
if piece_posn not in valid_inputs:
print("LOL that's not a valid position! Try again.")
continue
(row, col) = valid_inputs[piece_posn]
piece = board_data[row][col]
if piece == empty_square:
print("What are you trying to pull, there's no piece in that space!")
continue
if piece != colour:
print("LOL that's not your piece, try again!")
continue
allowed_moves = get_allowed_moves(board_data, row, col)
if len(allowed_moves) == 0:
print('LOL nice try. That piece has no valid moves.')
continue
move = list(allowed_moves)[0]
if len(allowed_moves) > 1:
move = input(f'What move do you want to make ({",".join(list(allowed_moves))})? ')
if move not in allowed_moves:
print('LOL that move is not allowed. Try again.')
continue
if move == 'f':
board_data[row + direction][col] = board_data[row][col]
elif move == 'dl':
board_data[row + direction][col - 1] = board_data[row][col]
elif move == 'dr':
board_data[row + direction][col + 1] = board_data[row][col]
board_data[row][col] = empty_square
return board_data
def is_game_over(board_data):
if board_data[0][0] == white_pawn or board_data[0][1] == white_pawn or board_data[0][2] == white_pawn:
return white_pawn
if board_data[2][0] == black_pawn or board_data[2][1] == black_pawn or board_data[2][2] == black_pawn:
return black_pawn
white_count = 0
black_count = 0
black_allowed_moves = []
white_allowed_moves = []
for i in range(3):
for j in range(3):
moves = get_allowed_moves(board_data, i, j)
if board_data[i][j] == white_pawn:
white_count += 1
if len(moves) > 0:
white_allowed_moves.append((i,j,moves))
if board_data[i][j] == black_pawn:
black_count += 1
if len(moves) > 0:
black_allowed_moves.append((i,j,moves))
if white_count == 0 or len(white_allowed_moves) == 0:
return black_pawn
if black_count == 0 or len(black_allowed_moves) == 0:
return white_pawn
return "LOL NOPE"
def play_game(black_move, white_move):
board_data = [[black_pawn, black_pawn, black_pawn],
[empty_square, empty_square, empty_square],
[white_pawn, white_pawn, white_pawn]]
last_player = black_pawn
next_player = white_pawn
while is_game_over(board_data) == "LOL NOPE":
draw_board(board_data)
if (next_player == black_pawn):
board_data = black_move(board_data, next_player)
else:
board_data = white_move(board_data, next_player)
temp = last_player
last_player = next_player
next_player = temp
winner = is_game_over(board_data)
print(f'Congratulations {winner}!')
play_game(get_human_move, get_human_move)
| package main
import (
"bytes"
"errors"
"flag"
"fmt"
"io"
"io/ioutil"
"log"
"math/rand"
"os"
"time"
)
const (
Rows = 3
Cols = 3
)
var vlog *log.Logger
func main() {
verbose := flag.Bool("v", false, "verbose")
flag.Parse()
if flag.NArg() != 0 {
flag.Usage()
os.Exit(2)
}
logOutput := ioutil.Discard
if *verbose {
logOutput = os.Stderr
}
vlog = log.New(logOutput, "hexapawn: ", 0)
rand.Seed(time.Now().UnixNano())
wins := make(map[spot]int, 2)
for {
h := New()
var s herGameState
for c := false; h[stateIdx] == empty; c = !c {
if c {
h = s.Move(h)
} else {
h = h.HumanMove()
}
}
fmt.Printf("Board:\n%v is a win for %v\n", h, h[stateIdx])
s.Result(h[stateIdx])
wins[h[stateIdx]]++
fmt.Printf("Wins: Black=%d, White=%d\n", wins[black], wins[white])
fmt.Println()
}
}
func (h Hexapawn) HumanMove() Hexapawn {
fmt.Print("Board:\n", h, "\n")
var from, to int
for {
fmt.Print("Your move: ")
_, err := fmt.Scanln(&from, &to)
if err != nil {
fmt.Println(err)
if err == io.EOF {
os.Exit(0)
}
continue
}
if err := h.doMove(white, from-1, to-1); err != nil {
fmt.Println(err)
continue
}
return h
}
}
var herNextMove = make(map[Hexapawn][]move)
type herGameState struct {
h Hexapawn
i int
}
func (s *herGameState) Move(h Hexapawn) Hexapawn {
known := false
moves := herNextMove[h]
if moves == nil {
moves = possibleMoves(black, h)
herNextMove[h] = moves
} else if len(moves) == 0 {
vlog.Println("no good moves left to black, picking a random looser")
known = true
moves = possibleMoves(black, h)
}
vlog.Println("considering", moves)
i := rand.Intn(len(moves))
if !known {
s.h = h
s.i = i
}
fmt.Println("Computer moves", moves[i])
if err := h.doMove(black, moves[i].from, moves[i].to); err != nil {
panic(err)
}
return h
}
func (s herGameState) Result(winner spot) {
if winner == black {
return
}
moves := herNextMove[s.h]
vlog.Printf("Training:\n%v will no longer do %v\n", s.h, moves[s.i])
herNextMove[s.h] = append(moves[:s.i], moves[s.i+1:]...)
vlog.Println("will instead do one of:", herNextMove[s.h])
}
type move struct{ from, to int }
func (m move) String() string { return fmt.Sprintf("%d→%d", m.from+1, m.to+1) }
var cachedMoves = []map[Hexapawn][]move{
black: make(map[Hexapawn][]move),
white: make(map[Hexapawn][]move),
}
func possibleMoves(s spot, h Hexapawn) []move {
m := cachedMoves[s][h]
if m != nil {
return m
}
m = make([]move, 0)
for from := 0; from < Rows*Cols; from++ {
for to := 0; to < Rows*Cols; to++ {
if err := h.checkMove(s, from, to); err == nil {
m = append(m, move{from, to})
}
}
}
cachedMoves[s][h] = m
vlog.Printf("caclulated possible moves for %v\n%v as %v\n", s, h, m)
return m
}
func (h *Hexapawn) doMove(p spot, from, to int) error {
if err := h.checkMove(p, from, to); err != nil {
return err
}
h[from] = empty
h[to] = p
if (p == white && to/Rows == Rows-1) || (p == black && to/Rows == 0) {
h[stateIdx] = p
} else if len(possibleMoves(p.Other(), *h)) == 0 {
h[stateIdx] = p
}
return nil
}
func (h *Hexapawn) checkMove(p spot, from, to int) error {
if h[from] != p {
return fmt.Errorf("No %v located at spot %v", p, from+1)
}
if h[to] == p {
return fmt.Errorf("%v already occupies spot %v", p, to+1)
}
Δr := from/Rows - to/Rows
if (p == white && Δr != -1) || (p == black && Δr != 1) {
return errors.New("must move forward one row")
}
Δc := from%Rows - to%Rows
capture := h[to] != empty
if (capture || Δc != 0) && (!capture || (Δc != 1 && Δc != -1)) {
return errors.New("ilegal move")
}
return nil
}
type Hexapawn [Rows*Cols + 1]spot
func New() Hexapawn {
return Hexapawn{
white, white, white,
empty, empty, empty,
black, black, black,
}
}
func idx(r, c int) int { return r*Cols + c }
const stateIdx = Rows * Cols
func (h Hexapawn) String() string {
var b bytes.Buffer
for r := Rows - 1; r >= 0; r-- {
for c := 0; c < Cols; c++ {
b.WriteByte(h[idx(r, c)].Byte())
}
b.WriteByte('\n')
}
return string(b.Next(Rows*(Cols+1) - 1))
}
type spot uint8
const (
empty spot = iota
black
white
)
func (s spot) String() string {
switch s {
case black:
return "Black"
case white:
return "White"
}
panic(s)
}
func (s spot) Byte() byte {
switch s {
case empty:
return '.'
case black:
return 'B'
case white:
return 'W'
}
panic(s)
}
func (s spot) Other() spot {
if s == black {
return white
}
return black
}
|
Maintain the same structure and functionality when rewriting this code in Go. |
import sys
black_pawn = " \u265f "
white_pawn = " \u2659 "
empty_square = " "
def draw_board(board_data):
bg_black = "\u001b[48;5;237m"
bg_white = "\u001b[48;5;245m"
clear_to_eol = "\u001b[0m\u001b[K\n"
board = ["1 ", bg_black, board_data[0][0], bg_white, board_data[0][1], bg_black, board_data[0][2], clear_to_eol,
"2 ", bg_white, board_data[1][0], bg_black, board_data[1][1], bg_white, board_data[1][2], clear_to_eol,
"3 ", bg_black, board_data[2][0], bg_white, board_data[2][1], bg_black, board_data[2][2], clear_to_eol,
" A B C\n"];
sys.stdout.write("".join(board))
def get_movement_direction(colour):
direction = -1
if colour == black_pawn:
direction = 1
elif colour == white_pawn:
direction = -1
else:
raise ValueError("Invalid piece colour")
return direction
def get_other_colour(colour):
if colour == black_pawn:
return white_pawn
elif colour == white_pawn:
return black_pawn
else:
raise ValueError("Invalid piece colour")
def get_allowed_moves(board_data, row, col):
if board_data[row][col] == empty_square:
return set()
colour = board_data[row][col]
other_colour = get_other_colour(colour)
direction = get_movement_direction(colour)
if (row + direction < 0 or row + direction > 2):
return set()
allowed_moves = set()
if board_data[row + direction][col] == empty_square:
allowed_moves.add('f')
if col > 0 and board_data[row + direction][col - 1] == other_colour:
allowed_moves.add('dl')
if col < 2 and board_data[row + direction][col + 1] == other_colour:
allowed_moves.add('dr')
return allowed_moves
def get_human_move(board_data, colour):
direction = get_movement_direction(colour)
while True:
piece_posn = input(f'What {colour} do you want to move? ')
valid_inputs = {'a1': (0,0), 'b1': (0,1), 'c1': (0,2),
'a2': (1,0), 'b2': (1,1), 'c2': (1,2),
'a3': (2,0), 'b3': (2,1), 'c3': (2,2)}
if piece_posn not in valid_inputs:
print("LOL that's not a valid position! Try again.")
continue
(row, col) = valid_inputs[piece_posn]
piece = board_data[row][col]
if piece == empty_square:
print("What are you trying to pull, there's no piece in that space!")
continue
if piece != colour:
print("LOL that's not your piece, try again!")
continue
allowed_moves = get_allowed_moves(board_data, row, col)
if len(allowed_moves) == 0:
print('LOL nice try. That piece has no valid moves.')
continue
move = list(allowed_moves)[0]
if len(allowed_moves) > 1:
move = input(f'What move do you want to make ({",".join(list(allowed_moves))})? ')
if move not in allowed_moves:
print('LOL that move is not allowed. Try again.')
continue
if move == 'f':
board_data[row + direction][col] = board_data[row][col]
elif move == 'dl':
board_data[row + direction][col - 1] = board_data[row][col]
elif move == 'dr':
board_data[row + direction][col + 1] = board_data[row][col]
board_data[row][col] = empty_square
return board_data
def is_game_over(board_data):
if board_data[0][0] == white_pawn or board_data[0][1] == white_pawn or board_data[0][2] == white_pawn:
return white_pawn
if board_data[2][0] == black_pawn or board_data[2][1] == black_pawn or board_data[2][2] == black_pawn:
return black_pawn
white_count = 0
black_count = 0
black_allowed_moves = []
white_allowed_moves = []
for i in range(3):
for j in range(3):
moves = get_allowed_moves(board_data, i, j)
if board_data[i][j] == white_pawn:
white_count += 1
if len(moves) > 0:
white_allowed_moves.append((i,j,moves))
if board_data[i][j] == black_pawn:
black_count += 1
if len(moves) > 0:
black_allowed_moves.append((i,j,moves))
if white_count == 0 or len(white_allowed_moves) == 0:
return black_pawn
if black_count == 0 or len(black_allowed_moves) == 0:
return white_pawn
return "LOL NOPE"
def play_game(black_move, white_move):
board_data = [[black_pawn, black_pawn, black_pawn],
[empty_square, empty_square, empty_square],
[white_pawn, white_pawn, white_pawn]]
last_player = black_pawn
next_player = white_pawn
while is_game_over(board_data) == "LOL NOPE":
draw_board(board_data)
if (next_player == black_pawn):
board_data = black_move(board_data, next_player)
else:
board_data = white_move(board_data, next_player)
temp = last_player
last_player = next_player
next_player = temp
winner = is_game_over(board_data)
print(f'Congratulations {winner}!')
play_game(get_human_move, get_human_move)
| package main
import (
"bytes"
"errors"
"flag"
"fmt"
"io"
"io/ioutil"
"log"
"math/rand"
"os"
"time"
)
const (
Rows = 3
Cols = 3
)
var vlog *log.Logger
func main() {
verbose := flag.Bool("v", false, "verbose")
flag.Parse()
if flag.NArg() != 0 {
flag.Usage()
os.Exit(2)
}
logOutput := ioutil.Discard
if *verbose {
logOutput = os.Stderr
}
vlog = log.New(logOutput, "hexapawn: ", 0)
rand.Seed(time.Now().UnixNano())
wins := make(map[spot]int, 2)
for {
h := New()
var s herGameState
for c := false; h[stateIdx] == empty; c = !c {
if c {
h = s.Move(h)
} else {
h = h.HumanMove()
}
}
fmt.Printf("Board:\n%v is a win for %v\n", h, h[stateIdx])
s.Result(h[stateIdx])
wins[h[stateIdx]]++
fmt.Printf("Wins: Black=%d, White=%d\n", wins[black], wins[white])
fmt.Println()
}
}
func (h Hexapawn) HumanMove() Hexapawn {
fmt.Print("Board:\n", h, "\n")
var from, to int
for {
fmt.Print("Your move: ")
_, err := fmt.Scanln(&from, &to)
if err != nil {
fmt.Println(err)
if err == io.EOF {
os.Exit(0)
}
continue
}
if err := h.doMove(white, from-1, to-1); err != nil {
fmt.Println(err)
continue
}
return h
}
}
var herNextMove = make(map[Hexapawn][]move)
type herGameState struct {
h Hexapawn
i int
}
func (s *herGameState) Move(h Hexapawn) Hexapawn {
known := false
moves := herNextMove[h]
if moves == nil {
moves = possibleMoves(black, h)
herNextMove[h] = moves
} else if len(moves) == 0 {
vlog.Println("no good moves left to black, picking a random looser")
known = true
moves = possibleMoves(black, h)
}
vlog.Println("considering", moves)
i := rand.Intn(len(moves))
if !known {
s.h = h
s.i = i
}
fmt.Println("Computer moves", moves[i])
if err := h.doMove(black, moves[i].from, moves[i].to); err != nil {
panic(err)
}
return h
}
func (s herGameState) Result(winner spot) {
if winner == black {
return
}
moves := herNextMove[s.h]
vlog.Printf("Training:\n%v will no longer do %v\n", s.h, moves[s.i])
herNextMove[s.h] = append(moves[:s.i], moves[s.i+1:]...)
vlog.Println("will instead do one of:", herNextMove[s.h])
}
type move struct{ from, to int }
func (m move) String() string { return fmt.Sprintf("%d→%d", m.from+1, m.to+1) }
var cachedMoves = []map[Hexapawn][]move{
black: make(map[Hexapawn][]move),
white: make(map[Hexapawn][]move),
}
func possibleMoves(s spot, h Hexapawn) []move {
m := cachedMoves[s][h]
if m != nil {
return m
}
m = make([]move, 0)
for from := 0; from < Rows*Cols; from++ {
for to := 0; to < Rows*Cols; to++ {
if err := h.checkMove(s, from, to); err == nil {
m = append(m, move{from, to})
}
}
}
cachedMoves[s][h] = m
vlog.Printf("caclulated possible moves for %v\n%v as %v\n", s, h, m)
return m
}
func (h *Hexapawn) doMove(p spot, from, to int) error {
if err := h.checkMove(p, from, to); err != nil {
return err
}
h[from] = empty
h[to] = p
if (p == white && to/Rows == Rows-1) || (p == black && to/Rows == 0) {
h[stateIdx] = p
} else if len(possibleMoves(p.Other(), *h)) == 0 {
h[stateIdx] = p
}
return nil
}
func (h *Hexapawn) checkMove(p spot, from, to int) error {
if h[from] != p {
return fmt.Errorf("No %v located at spot %v", p, from+1)
}
if h[to] == p {
return fmt.Errorf("%v already occupies spot %v", p, to+1)
}
Δr := from/Rows - to/Rows
if (p == white && Δr != -1) || (p == black && Δr != 1) {
return errors.New("must move forward one row")
}
Δc := from%Rows - to%Rows
capture := h[to] != empty
if (capture || Δc != 0) && (!capture || (Δc != 1 && Δc != -1)) {
return errors.New("ilegal move")
}
return nil
}
type Hexapawn [Rows*Cols + 1]spot
func New() Hexapawn {
return Hexapawn{
white, white, white,
empty, empty, empty,
black, black, black,
}
}
func idx(r, c int) int { return r*Cols + c }
const stateIdx = Rows * Cols
func (h Hexapawn) String() string {
var b bytes.Buffer
for r := Rows - 1; r >= 0; r-- {
for c := 0; c < Cols; c++ {
b.WriteByte(h[idx(r, c)].Byte())
}
b.WriteByte('\n')
}
return string(b.Next(Rows*(Cols+1) - 1))
}
type spot uint8
const (
empty spot = iota
black
white
)
func (s spot) String() string {
switch s {
case black:
return "Black"
case white:
return "White"
}
panic(s)
}
func (s spot) Byte() byte {
switch s {
case empty:
return '.'
case black:
return 'B'
case white:
return 'W'
}
panic(s)
}
func (s spot) Other() spot {
if s == black {
return white
}
return black
}
|
Translate this program into Go but keep the logic exactly as in Python. | import re
from collections import defaultdict
from itertools import count
connection_re = r
class Graph:
def __init__(self, name, connections):
self.name = name
self.connections = connections
g = self.graph = defaultdict(list)
matches = re.finditer(connection_re, connections,
re.MULTILINE | re.VERBOSE)
for match in matches:
n1, n2, n = match.groups()
if n:
g[n] += []
else:
g[n1].append(n2)
g[n2].append(n1)
def greedy_colour(self, order=None):
"Greedy colourisation algo."
if order is None:
order = self.graph
colour = self.colour = {}
neighbours = self.graph
for node in order:
used_neighbour_colours = (colour[nbr] for nbr in neighbours[node]
if nbr in colour)
colour[node] = first_avail_int(used_neighbour_colours)
self.pp_colours()
return colour
def pp_colours(self):
print(f"\n{self.name}")
c = self.colour
e = canonical_edges = set()
for n1, neighbours in sorted(self.graph.items()):
if neighbours:
for n2 in neighbours:
edge = tuple(sorted([n1, n2]))
if edge not in canonical_edges:
print(f" {n1}-{n2}: Colour: {c[n1]}, {c[n2]}")
canonical_edges.add(edge)
else:
print(f" {n1}: Colour: {c[n1]}")
lc = len(set(c.values()))
print(f"
def first_avail_int(data):
"return lowest int 0... not in data"
d = set(data)
for i in count():
if i not in d:
return i
if __name__ == '__main__':
for name, connections in [
('Ex1', "0-1 1-2 2-0 3"),
('Ex2', "1-6 1-7 1-8 2-5 2-7 2-8 3-5 3-6 3-8 4-5 4-6 4-7"),
('Ex3', "1-4 1-6 1-8 3-2 3-6 3-8 5-2 5-4 5-8 7-2 7-4 7-6"),
('Ex4', "1-6 7-1 8-1 5-2 2-7 2-8 3-5 6-3 3-8 4-5 4-6 4-7"),
]:
g = Graph(name, connections)
g.greedy_colour()
| package main
import (
"fmt"
"sort"
)
type graph struct {
nn int
st int
nbr [][]int
}
type nodeval struct {
n int
v int
}
func contains(s []int, n int) bool {
for _, e := range s {
if e == n {
return true
}
}
return false
}
func newGraph(nn, st int) graph {
nbr := make([][]int, nn)
return graph{nn, st, nbr}
}
func (g graph) addEdge(n1, n2 int) {
n1, n2 = n1-g.st, n2-g.st
g.nbr[n1] = append(g.nbr[n1], n2)
if n1 != n2 {
g.nbr[n2] = append(g.nbr[n2], n1)
}
}
func (g graph) greedyColoring() []int {
cols := make([]int, g.nn)
for i := 1; i < g.nn; i++ {
cols[i] = -1
}
available := make([]bool, g.nn)
for i := 1; i < g.nn; i++ {
for _, j := range g.nbr[i] {
if cols[j] != -1 {
available[cols[j]] = true
}
}
c := 0
for ; c < g.nn; c++ {
if !available[c] {
break
}
}
cols[i] = c
for _, j := range g.nbr[i] {
if cols[j] != -1 {
available[cols[j]] = false
}
}
}
return cols
}
func (g graph) wpColoring() []int {
nvs := make([]nodeval, g.nn)
for i := 0; i < g.nn; i++ {
v := len(g.nbr[i])
if v == 1 && g.nbr[i][0] == i {
v = 0
}
nvs[i] = nodeval{i, v}
}
sort.Slice(nvs, func(i, j int) bool {
return nvs[i].v > nvs[j].v
})
cols := make([]int, g.nn)
for i := range cols {
cols[i] = -1
}
currCol := 0
for f := 0; f < g.nn-1; f++ {
h := nvs[f].n
if cols[h] != -1 {
continue
}
cols[h] = currCol
outer:
for i := f + 1; i < g.nn; i++ {
j := nvs[i].n
if cols[j] != -1 {
continue
}
for k := f; k < i; k++ {
l := nvs[k].n
if cols[l] == -1 {
continue
}
if contains(g.nbr[j], l) {
continue outer
}
}
cols[j] = currCol
}
currCol++
}
return cols
}
func main() {
fns := [](func(graph) []int){graph.greedyColoring, graph.wpColoring}
titles := []string{"'Greedy'", "Welsh-Powell"}
nns := []int{4, 8, 8, 8}
starts := []int{0, 1, 1, 1}
edges1 := [][2]int{{0, 1}, {1, 2}, {2, 0}, {3, 3}}
edges2 := [][2]int{{1, 6}, {1, 7}, {1, 8}, {2, 5}, {2, 7}, {2, 8},
{3, 5}, {3, 6}, {3, 8}, {4, 5}, {4, 6}, {4, 7}}
edges3 := [][2]int{{1, 4}, {1, 6}, {1, 8}, {3, 2}, {3, 6}, {3, 8},
{5, 2}, {5, 4}, {5, 8}, {7, 2}, {7, 4}, {7, 6}}
edges4 := [][2]int{{1, 6}, {7, 1}, {8, 1}, {5, 2}, {2, 7}, {2, 8},
{3, 5}, {6, 3}, {3, 8}, {4, 5}, {4, 6}, {4, 7}}
for j, fn := range fns {
fmt.Println("Using the", titles[j], "algorithm:\n")
for i, edges := range [][][2]int{edges1, edges2, edges3, edges4} {
fmt.Println(" Example", i+1)
g := newGraph(nns[i], starts[i])
for _, e := range edges {
g.addEdge(e[0], e[1])
}
cols := fn(g)
ecount := 0
for _, e := range edges {
if e[0] != e[1] {
fmt.Printf(" Edge %d-%d -> Color %d, %d\n", e[0], e[1],
cols[e[0]-g.st], cols[e[1]-g.st])
ecount++
} else {
fmt.Printf(" Node %d -> Color %d\n", e[0], cols[e[0]-g.st])
}
}
maxCol := 0
for _, col := range cols {
if col > maxCol {
maxCol = col
}
}
fmt.Println(" Number of nodes :", nns[i])
fmt.Println(" Number of edges :", ecount)
fmt.Println(" Number of colors :", maxCol+1)
fmt.Println()
}
}
}
|
Write a version of this Python function in Go with identical behavior. | print("working...")
print("Primes are:")
def isprime(m):
for i in range(2,int(m**0.5)+1):
if m%i==0:
return False
return True
Primes = [2,43,81,122,63,13,7,95,103]
Temp = []
for n in range(len(Primes)):
if isprime(Primes[n]):
Temp.append(Primes[n])
Temp.sort()
print(Temp)
print("done...")
| package main
import (
"fmt"
"rcu"
"sort"
)
func main() {
list := []int{2, 43, 81, 122, 63, 13, 7, 95, 103}
var primes []int
for _, e := range list {
if rcu.IsPrime(e) {
primes = append(primes, e)
}
}
sort.Ints(primes)
fmt.Println(primes)
}
|
Rewrite the snippet below in Go so it works the same as the original Python code. | from itertools import product, compress
fact = lambda n: n and n*fact(n - 1) or 1
combo_count = lambda total, coins, perm:\
sum(perm and fact(len(x)) or 1
for x in (list(compress(coins, c))
for c in product(*([(0, 1)]*len(coins))))
if sum(x) == total)
cases = [(6, [1, 2, 3, 4, 5]),
(6, [1, 1, 2, 3, 3, 4, 5]),
(40, [1, 2, 3, 4, 5, 5, 5, 5, 15, 15, 10, 10, 10, 10, 25, 100])]
for perm in [False, True]:
print(f'Order matters: {perm}')
for s, c in cases:
print(f'{combo_count(s, c, perm):7d} ways for {s:2d} total from coins {c}')
print()
| package main
import "fmt"
var cnt = 0
var cnt2 = 0
var wdth = 0
func factorial(n int) int {
prod := 1
for i := 2; i <= n; i++ {
prod *= i
}
return prod
}
func count(want int, used []int, sum int, have, uindices, rindices []int) {
if sum == want {
cnt++
cnt2 += factorial(len(used))
if cnt < 11 {
uindicesStr := fmt.Sprintf("%v", uindices)
fmt.Printf(" indices %*s => used %v\n", wdth, uindicesStr, used)
}
} else if sum < want && len(have) != 0 {
thisCoin := have[0]
index := rindices[0]
rest := have[1:]
rindices := rindices[1:]
count(want, append(used, thisCoin), sum+thisCoin, rest,
append(uindices, index), rindices)
count(want, used, sum, rest, uindices, rindices)
}
}
func countCoins(want int, coins []int, width int) {
fmt.Printf("Sum %d from coins %v\n", want, coins)
cnt = 0
cnt2 = 0
wdth = -width
rindices := make([]int, len(coins))
for i := range rindices {
rindices[i] = i
}
count(want, []int{}, 0, coins, []int{}, rindices)
if cnt > 10 {
fmt.Println(" .......")
fmt.Println(" (only the first 10 ways generated are shown)")
}
fmt.Println("Number of ways - order unimportant :", cnt, "(as above)")
fmt.Println("Number of ways - order important :", cnt2, "(all perms of above indices)\n")
}
func main() {
countCoins(6, []int{1, 2, 3, 4, 5}, 7)
countCoins(6, []int{1, 1, 2, 3, 3, 4, 5}, 9)
countCoins(40, []int{1, 2, 3, 4, 5, 5, 5, 5, 15, 15, 10, 10, 10, 10, 25, 100}, 20)
}
|
Rewrite the snippet below in Go so it works the same as the original Python code. | from itertools import product, compress
fact = lambda n: n and n*fact(n - 1) or 1
combo_count = lambda total, coins, perm:\
sum(perm and fact(len(x)) or 1
for x in (list(compress(coins, c))
for c in product(*([(0, 1)]*len(coins))))
if sum(x) == total)
cases = [(6, [1, 2, 3, 4, 5]),
(6, [1, 1, 2, 3, 3, 4, 5]),
(40, [1, 2, 3, 4, 5, 5, 5, 5, 15, 15, 10, 10, 10, 10, 25, 100])]
for perm in [False, True]:
print(f'Order matters: {perm}')
for s, c in cases:
print(f'{combo_count(s, c, perm):7d} ways for {s:2d} total from coins {c}')
print()
| package main
import "fmt"
var cnt = 0
var cnt2 = 0
var wdth = 0
func factorial(n int) int {
prod := 1
for i := 2; i <= n; i++ {
prod *= i
}
return prod
}
func count(want int, used []int, sum int, have, uindices, rindices []int) {
if sum == want {
cnt++
cnt2 += factorial(len(used))
if cnt < 11 {
uindicesStr := fmt.Sprintf("%v", uindices)
fmt.Printf(" indices %*s => used %v\n", wdth, uindicesStr, used)
}
} else if sum < want && len(have) != 0 {
thisCoin := have[0]
index := rindices[0]
rest := have[1:]
rindices := rindices[1:]
count(want, append(used, thisCoin), sum+thisCoin, rest,
append(uindices, index), rindices)
count(want, used, sum, rest, uindices, rindices)
}
}
func countCoins(want int, coins []int, width int) {
fmt.Printf("Sum %d from coins %v\n", want, coins)
cnt = 0
cnt2 = 0
wdth = -width
rindices := make([]int, len(coins))
for i := range rindices {
rindices[i] = i
}
count(want, []int{}, 0, coins, []int{}, rindices)
if cnt > 10 {
fmt.Println(" .......")
fmt.Println(" (only the first 10 ways generated are shown)")
}
fmt.Println("Number of ways - order unimportant :", cnt, "(as above)")
fmt.Println("Number of ways - order important :", cnt2, "(all perms of above indices)\n")
}
func main() {
countCoins(6, []int{1, 2, 3, 4, 5}, 7)
countCoins(6, []int{1, 1, 2, 3, 3, 4, 5}, 9)
countCoins(40, []int{1, 2, 3, 4, 5, 5, 5, 5, 15, 15, 10, 10, 10, 10, 25, 100}, 20)
}
|
Produce a language-to-language conversion: from Python to Go, same semantics. | from functools import reduce
from operator import mul
from decimal import *
getcontext().prec = MAX_PREC
def expand(num):
suffixes = [
('greatgross', 7, 12, 3),
('gross', 2, 12, 2),
('dozens', 3, 12, 1),
('pairs', 4, 2, 1),
('scores', 3, 20, 1),
('googols', 6, 10, 100),
('ki', 2, 2, 10),
('mi', 2, 2, 20),
('gi', 2, 2, 30),
('ti', 2, 2, 40),
('pi', 2, 2, 50),
('ei', 2, 2, 60),
('zi', 2, 2, 70),
('yi', 2, 2, 80),
('xi', 2, 2, 90),
('wi', 2, 2, 100),
('vi', 2, 2, 110),
('ui', 2, 2, 120),
('k', 1, 10, 3),
('m', 1, 10, 6),
('g', 1, 10, 9),
('t', 1, 10, 12),
('p', 1, 10, 15),
('e', 1, 10, 18),
('z', 1, 10, 21),
('y', 1, 10, 24),
('x', 1, 10, 27),
('w', 1, 10, 30)
]
num = num.replace(',', '').strip().lower()
if num[-1].isdigit():
return float(num)
for i, char in enumerate(reversed(num)):
if char.isdigit():
input_suffix = num[-i:]
num = Decimal(num[:-i])
break
if input_suffix[0] == '!':
return reduce(mul, range(int(num), 0, -len(input_suffix)))
while len(input_suffix) > 0:
for suffix, min_abbrev, base, power in suffixes:
if input_suffix[:min_abbrev] == suffix[:min_abbrev]:
for i in range(min_abbrev, len(input_suffix) + 1):
if input_suffix[:i+1] != suffix[:i+1]:
num *= base ** power
input_suffix = input_suffix[i:]
break
break
return num
test = "2greatGRo 24Gros 288Doz 1,728pairs 172.8SCOre\n\
1,567 +1.567k 0.1567e-2m\n\
25.123kK 25.123m 2.5123e-00002G\n\
25.123kiKI 25.123Mi 2.5123e-00002Gi +.25123E-7Ei\n\
-.25123e-34Vikki 2e-77gooGols\n\
9! 9!! 9!!! 9!!!! 9!!!!! 9!!!!!! 9!!!!!!! 9!!!!!!!! 9!!!!!!!!!"
for test_line in test.split("\n"):
test_cases = test_line.split()
print("Input:", ' '.join(test_cases))
print("Output:", ' '.join(format(result, ',f').strip('0').strip('.') for result in map(expand, test_cases)))
| package main
import (
"fmt"
"math"
"math/big"
"strconv"
"strings"
)
type minmult struct {
min int
mult float64
}
var abbrevs = map[string]minmult{
"PAIRs": {4, 2}, "SCOres": {3, 20}, "DOZens": {3, 12},
"GRoss": {2, 144}, "GREATGRoss": {7, 1728}, "GOOGOLs": {6, 1e100},
}
var metric = map[string]float64{
"K": 1e3, "M": 1e6, "G": 1e9, "T": 1e12, "P": 1e15, "E": 1e18,
"Z": 1e21, "Y": 1e24, "X": 1e27, "W": 1e30, "V": 1e33, "U": 1e36,
}
var binary = map[string]float64{
"Ki": b(10), "Mi": b(20), "Gi": b(30), "Ti": b(40), "Pi": b(50), "Ei": b(60),
"Zi": b(70), "Yi": b(80), "Xi": b(90), "Wi": b(100), "Vi": b(110), "Ui": b(120),
}
func b(e float64) float64 {
return math.Pow(2, e)
}
func googol() *big.Float {
g1 := new(big.Float).SetPrec(500)
g1.SetInt64(10000000000)
g := new(big.Float)
g.Set(g1)
for i := 2; i <= 10; i++ {
g.Mul(g, g1)
}
return g
}
func fact(num string, d int) int {
prod := 1
n, _ := strconv.Atoi(num)
for i := n; i > 0; i -= d {
prod *= i
}
return prod
}
func parse(number string) *big.Float {
bf := new(big.Float).SetPrec(500)
t1 := new(big.Float).SetPrec(500)
t2 := new(big.Float).SetPrec(500)
var i int
for i = len(number) - 1; i >= 0; i-- {
if '0' <= number[i] && number[i] <= '9' {
break
}
}
num := number[:i+1]
num = strings.Replace(num, ",", "", -1)
suf := strings.ToUpper(number[i+1:])
if suf == "" {
bf.SetString(num)
return bf
}
if suf[0] == '!' {
prod := fact(num, len(suf))
bf.SetInt64(int64(prod))
return bf
}
for k, v := range abbrevs {
kk := strings.ToUpper(k)
if strings.HasPrefix(kk, suf) && len(suf) >= v.min {
t1.SetString(num)
if k != "GOOGOLs" {
t2.SetFloat64(v.mult)
} else {
t2 = googol()
}
bf.Mul(t1, t2)
return bf
}
}
bf.SetString(num)
for k, v := range metric {
for j := 0; j < len(suf); j++ {
if k == suf[j:j+1] {
if j < len(suf)-1 && suf[j+1] == 'I' {
t1.SetFloat64(binary[k+"i"])
bf.Mul(bf, t1)
j++
} else {
t1.SetFloat64(v)
bf.Mul(bf, t1)
}
}
}
}
return bf
}
func commatize(s string) string {
if len(s) == 0 {
return ""
}
neg := s[0] == '-'
if neg {
s = s[1:]
}
frac := ""
if ix := strings.Index(s, "."); ix >= 0 {
frac = s[ix:]
s = s[:ix]
}
le := len(s)
for i := le - 3; i >= 1; i -= 3 {
s = s[0:i] + "," + s[i:]
}
if !neg {
return s + frac
}
return "-" + s + frac
}
func process(numbers []string) {
fmt.Print("numbers = ")
for _, number := range numbers {
fmt.Printf("%s ", number)
}
fmt.Print("\nresults = ")
for _, number := range numbers {
res := parse(number)
t := res.Text('g', 50)
fmt.Printf("%s ", commatize(t))
}
fmt.Println("\n")
}
func main() {
numbers := []string{"2greatGRo", "24Gros", "288Doz", "1,728pairs", "172.8SCOre"}
process(numbers)
numbers = []string{"1,567", "+1.567k", "0.1567e-2m"}
process(numbers)
numbers = []string{"25.123kK", "25.123m", "2.5123e-00002G"}
process(numbers)
numbers = []string{"25.123kiKI", "25.123Mi", "2.5123e-00002Gi", "+.25123E-7Ei"}
process(numbers)
numbers = []string{"-.25123e-34Vikki", "2e-77gooGols"}
process(numbers)
numbers = []string{"9!", "9!!", "9!!!", "9!!!!", "9!!!!!", "9!!!!!!",
"9!!!!!!!", "9!!!!!!!!", "9!!!!!!!!!"}
process(numbers)
}
|
Preserve the algorithm and functionality while converting the code from Python to Go. | from functools import reduce
from operator import mul
from decimal import *
getcontext().prec = MAX_PREC
def expand(num):
suffixes = [
('greatgross', 7, 12, 3),
('gross', 2, 12, 2),
('dozens', 3, 12, 1),
('pairs', 4, 2, 1),
('scores', 3, 20, 1),
('googols', 6, 10, 100),
('ki', 2, 2, 10),
('mi', 2, 2, 20),
('gi', 2, 2, 30),
('ti', 2, 2, 40),
('pi', 2, 2, 50),
('ei', 2, 2, 60),
('zi', 2, 2, 70),
('yi', 2, 2, 80),
('xi', 2, 2, 90),
('wi', 2, 2, 100),
('vi', 2, 2, 110),
('ui', 2, 2, 120),
('k', 1, 10, 3),
('m', 1, 10, 6),
('g', 1, 10, 9),
('t', 1, 10, 12),
('p', 1, 10, 15),
('e', 1, 10, 18),
('z', 1, 10, 21),
('y', 1, 10, 24),
('x', 1, 10, 27),
('w', 1, 10, 30)
]
num = num.replace(',', '').strip().lower()
if num[-1].isdigit():
return float(num)
for i, char in enumerate(reversed(num)):
if char.isdigit():
input_suffix = num[-i:]
num = Decimal(num[:-i])
break
if input_suffix[0] == '!':
return reduce(mul, range(int(num), 0, -len(input_suffix)))
while len(input_suffix) > 0:
for suffix, min_abbrev, base, power in suffixes:
if input_suffix[:min_abbrev] == suffix[:min_abbrev]:
for i in range(min_abbrev, len(input_suffix) + 1):
if input_suffix[:i+1] != suffix[:i+1]:
num *= base ** power
input_suffix = input_suffix[i:]
break
break
return num
test = "2greatGRo 24Gros 288Doz 1,728pairs 172.8SCOre\n\
1,567 +1.567k 0.1567e-2m\n\
25.123kK 25.123m 2.5123e-00002G\n\
25.123kiKI 25.123Mi 2.5123e-00002Gi +.25123E-7Ei\n\
-.25123e-34Vikki 2e-77gooGols\n\
9! 9!! 9!!! 9!!!! 9!!!!! 9!!!!!! 9!!!!!!! 9!!!!!!!! 9!!!!!!!!!"
for test_line in test.split("\n"):
test_cases = test_line.split()
print("Input:", ' '.join(test_cases))
print("Output:", ' '.join(format(result, ',f').strip('0').strip('.') for result in map(expand, test_cases)))
| package main
import (
"fmt"
"math"
"math/big"
"strconv"
"strings"
)
type minmult struct {
min int
mult float64
}
var abbrevs = map[string]minmult{
"PAIRs": {4, 2}, "SCOres": {3, 20}, "DOZens": {3, 12},
"GRoss": {2, 144}, "GREATGRoss": {7, 1728}, "GOOGOLs": {6, 1e100},
}
var metric = map[string]float64{
"K": 1e3, "M": 1e6, "G": 1e9, "T": 1e12, "P": 1e15, "E": 1e18,
"Z": 1e21, "Y": 1e24, "X": 1e27, "W": 1e30, "V": 1e33, "U": 1e36,
}
var binary = map[string]float64{
"Ki": b(10), "Mi": b(20), "Gi": b(30), "Ti": b(40), "Pi": b(50), "Ei": b(60),
"Zi": b(70), "Yi": b(80), "Xi": b(90), "Wi": b(100), "Vi": b(110), "Ui": b(120),
}
func b(e float64) float64 {
return math.Pow(2, e)
}
func googol() *big.Float {
g1 := new(big.Float).SetPrec(500)
g1.SetInt64(10000000000)
g := new(big.Float)
g.Set(g1)
for i := 2; i <= 10; i++ {
g.Mul(g, g1)
}
return g
}
func fact(num string, d int) int {
prod := 1
n, _ := strconv.Atoi(num)
for i := n; i > 0; i -= d {
prod *= i
}
return prod
}
func parse(number string) *big.Float {
bf := new(big.Float).SetPrec(500)
t1 := new(big.Float).SetPrec(500)
t2 := new(big.Float).SetPrec(500)
var i int
for i = len(number) - 1; i >= 0; i-- {
if '0' <= number[i] && number[i] <= '9' {
break
}
}
num := number[:i+1]
num = strings.Replace(num, ",", "", -1)
suf := strings.ToUpper(number[i+1:])
if suf == "" {
bf.SetString(num)
return bf
}
if suf[0] == '!' {
prod := fact(num, len(suf))
bf.SetInt64(int64(prod))
return bf
}
for k, v := range abbrevs {
kk := strings.ToUpper(k)
if strings.HasPrefix(kk, suf) && len(suf) >= v.min {
t1.SetString(num)
if k != "GOOGOLs" {
t2.SetFloat64(v.mult)
} else {
t2 = googol()
}
bf.Mul(t1, t2)
return bf
}
}
bf.SetString(num)
for k, v := range metric {
for j := 0; j < len(suf); j++ {
if k == suf[j:j+1] {
if j < len(suf)-1 && suf[j+1] == 'I' {
t1.SetFloat64(binary[k+"i"])
bf.Mul(bf, t1)
j++
} else {
t1.SetFloat64(v)
bf.Mul(bf, t1)
}
}
}
}
return bf
}
func commatize(s string) string {
if len(s) == 0 {
return ""
}
neg := s[0] == '-'
if neg {
s = s[1:]
}
frac := ""
if ix := strings.Index(s, "."); ix >= 0 {
frac = s[ix:]
s = s[:ix]
}
le := len(s)
for i := le - 3; i >= 1; i -= 3 {
s = s[0:i] + "," + s[i:]
}
if !neg {
return s + frac
}
return "-" + s + frac
}
func process(numbers []string) {
fmt.Print("numbers = ")
for _, number := range numbers {
fmt.Printf("%s ", number)
}
fmt.Print("\nresults = ")
for _, number := range numbers {
res := parse(number)
t := res.Text('g', 50)
fmt.Printf("%s ", commatize(t))
}
fmt.Println("\n")
}
func main() {
numbers := []string{"2greatGRo", "24Gros", "288Doz", "1,728pairs", "172.8SCOre"}
process(numbers)
numbers = []string{"1,567", "+1.567k", "0.1567e-2m"}
process(numbers)
numbers = []string{"25.123kK", "25.123m", "2.5123e-00002G"}
process(numbers)
numbers = []string{"25.123kiKI", "25.123Mi", "2.5123e-00002Gi", "+.25123E-7Ei"}
process(numbers)
numbers = []string{"-.25123e-34Vikki", "2e-77gooGols"}
process(numbers)
numbers = []string{"9!", "9!!", "9!!!", "9!!!!", "9!!!!!", "9!!!!!!",
"9!!!!!!!", "9!!!!!!!!", "9!!!!!!!!!"}
process(numbers)
}
|
Transform the following Python implementation into Go, maintaining the same output and logic. |
import math
def apply_perm(omega,fbn):
for m in range(len(fbn)):
g = fbn[m]
if g > 0:
new_first = omega[m+g]
omega[m+1:m+g+1] = omega[m:m+g]
omega[m] = new_first
return omega
def int_to_fbn(i):
current = i
divisor = 2
new_fbn = []
while current > 0:
remainder = current % divisor
current = current // divisor
new_fbn.append(remainder)
divisor += 1
return list(reversed(new_fbn))
def leading_zeros(l,n):
if len(l) < n:
return(([0] * (n - len(l))) + l)
else:
return l
def get_fbn(n):
max = math.factorial(n)
for i in range(max):
current = i
divisor = 1
new_fbn = int_to_fbn(i)
yield leading_zeros(new_fbn,n-1)
def print_write(f, line):
print(line)
f.write(str(line)+'\n')
def dot_format(l):
if len(l) < 1:
return ""
dot_string = str(l[0])
for e in l[1:]:
dot_string += "."+str(e)
return dot_string
def str_format(l):
if len(l) < 1:
return ""
new_string = ""
for e in l:
new_string += str(e)
return new_string
with open("output.html", "w", encoding="utf-8") as f:
f.write("<pre>\n")
omega=[0,1,2,3]
four_list = get_fbn(4)
for l in four_list:
print_write(f,dot_format(l)+' -> '+str_format(apply_perm(omega[:],l)))
print_write(f," ")
num_permutations = 0
for p in get_fbn(11):
num_permutations += 1
if num_permutations % 1000000 == 0:
print_write(f,"permutations so far = "+str(num_permutations))
print_write(f," ")
print_write(f,"Permutations generated = "+str(num_permutations))
print_write(f,"compared to 11! which = "+str(math.factorial(11)))
print_write(f," ")
shoe = []
for suit in [u"\u2660",u"\u2665",u"\u2666",u"\u2663"]:
for value in ['A','K','Q','J','10','9','8','7','6','5','4','3','2']:
shoe.append(value+suit)
print_write(f,str_format(shoe))
p1 = [39,49,7,47,29,30,2,12,10,3,29,37,33,17,12,31,29,34,17,25,2,4,25,4,1,14,20,6,21,18,1,1,1,4,0,5,15,12,4,3,10,10,9,1,6,5,5,3,0,0,0]
p2 = [51,48,16,22,3,0,19,34,29,1,36,30,12,32,12,29,30,26,14,21,8,12,1,3,10,4,7,17,6,21,8,12,15,15,13,15,7,3,12,11,9,5,5,6,6,3,4,0,3,2,1]
print_write(f," ")
print_write(f,dot_format(p1))
print_write(f," ")
print_write(f,str_format(apply_perm(shoe[:],p1)))
print_write(f," ")
print_write(f,dot_format(p2))
print_write(f," ")
print_write(f,str_format(apply_perm(shoe[:],p2)))
import random
max = math.factorial(52)
random_int = random.randint(0, max-1)
myperm = leading_zeros(int_to_fbn(random_int),51)
print(len(myperm))
print_write(f," ")
print_write(f,dot_format(myperm))
print_write(f," ")
print_write(f,str_format(apply_perm(shoe[:],myperm)))
f.write("</pre>\n")
| package main
import (
"fmt"
"math/rand"
"strconv"
"strings"
"time"
)
func factorial(n int) int {
fact := 1
for i := 2; i <= n; i++ {
fact *= i
}
return fact
}
func genFactBaseNums(size int, countOnly bool) ([][]int, int) {
var results [][]int
count := 0
for n := 0; ; n++ {
radix := 2
var res []int = nil
if !countOnly {
res = make([]int, size)
}
k := n
for k > 0 {
div := k / radix
rem := k % radix
if !countOnly {
if radix <= size+1 {
res[size-radix+1] = rem
}
}
k = div
radix++
}
if radix > size+2 {
break
}
count++
if !countOnly {
results = append(results, res)
}
}
return results, count
}
func mapToPerms(factNums [][]int) [][]int {
var perms [][]int
psize := len(factNums[0]) + 1
start := make([]int, psize)
for i := 0; i < psize; i++ {
start[i] = i
}
for _, fn := range factNums {
perm := make([]int, psize)
copy(perm, start)
for m := 0; m < len(fn); m++ {
g := fn[m]
if g == 0 {
continue
}
first := m
last := m + g
for i := 1; i <= g; i++ {
temp := perm[first]
for j := first + 1; j <= last; j++ {
perm[j-1] = perm[j]
}
perm[last] = temp
}
}
perms = append(perms, perm)
}
return perms
}
func join(is []int, sep string) string {
ss := make([]string, len(is))
for i := 0; i < len(is); i++ {
ss[i] = strconv.Itoa(is[i])
}
return strings.Join(ss, sep)
}
func undot(s string) []int {
ss := strings.Split(s, ".")
is := make([]int, len(ss))
for i := 0; i < len(ss); i++ {
is[i], _ = strconv.Atoi(ss[i])
}
return is
}
func main() {
rand.Seed(time.Now().UnixNano())
factNums, _ := genFactBaseNums(3, false)
perms := mapToPerms(factNums)
for i, fn := range factNums {
fmt.Printf("%v -> %v\n", join(fn, "."), join(perms[i], ""))
}
_, count := genFactBaseNums(10, true)
fmt.Println("\nPermutations generated =", count)
fmt.Println("compared to 11! which =", factorial(11))
fmt.Println()
fbn51s := []string{
"39.49.7.47.29.30.2.12.10.3.29.37.33.17.12.31.29.34.17.25.2.4.25.4.1.14.20.6.21.18.1.1.1.4.0.5.15.12.4.3.10.10.9.1.6.5.5.3.0.0.0",
"51.48.16.22.3.0.19.34.29.1.36.30.12.32.12.29.30.26.14.21.8.12.1.3.10.4.7.17.6.21.8.12.15.15.13.15.7.3.12.11.9.5.5.6.6.3.4.0.3.2.1",
}
factNums = [][]int{undot(fbn51s[0]), undot(fbn51s[1])}
perms = mapToPerms(factNums)
shoe := []rune("A♠K♠Q♠J♠T♠9♠8♠7♠6♠5♠4♠3♠2♠A♥K♥Q♥J♥T♥9♥8♥7♥6♥5♥4♥3♥2♥A♦K♦Q♦J♦T♦9♦8♦7♦6♦5♦4♦3♦2♦A♣K♣Q♣J♣T♣9♣8♣7♣6♣5♣4♣3♣2♣")
cards := make([]string, 52)
for i := 0; i < 52; i++ {
cards[i] = string(shoe[2*i : 2*i+2])
if cards[i][0] == 'T' {
cards[i] = "10" + cards[i][1:]
}
}
for i, fbn51 := range fbn51s {
fmt.Println(fbn51)
for _, d := range perms[i] {
fmt.Print(cards[d])
}
fmt.Println("\n")
}
fbn51 := make([]int, 51)
for i := 0; i < 51; i++ {
fbn51[i] = rand.Intn(52 - i)
}
fmt.Println(join(fbn51, "."))
perms = mapToPerms([][]int{fbn51})
for _, d := range perms[0] {
fmt.Print(cards[d])
}
fmt.Println()
}
|
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.