prompt
stringlengths
189
761
answer
stringclasses
2 values
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: NNC(=O)NN=C1C(=O)N(c2nccs2)C(=O)C(=O)C1c1nc2ccccc2s1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C(O)CNS(=O)(=O)c1ccc(NC(=O)c2ccccc2[N+](=O)[O-])cc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: C=CCCCC(C#N)(c1ccccc1)N(C)C
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCOC(=O)c1nc2cc(C(F)(F)F)ccc2nc1Oc1ccc(F)cc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COC12C=CC(CC1)c1c2c(O)c2nc(C)c(C)nc2c1O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C1NCCCCCCCCNC(=O)c2cccc1c2
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCOCc1cc(=O)c2c(OC)cc3c(c2o1)CCC(C)(C)O3
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1ccc(NS(=O)c2c(C)cc(C)cc2C)cc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: NCCNC(=Nc1ccccc1)Nc1ccccc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCOC(=O)c1sc2nc(SC)nc3c2c1ncn3-c1ccccc1Cl
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cl.NCc1ccc(-c2ccc(CN)s2)s1
No
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cl.NCCCCC(NC(=O)C(N)Cc1ccc(O)cc1)C(=O)NC(CCCCN)C(=O)NC(CCCCN)C(=O)ON1C(=O)CCC1=O
No
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCOC(=O)CCc1c(C)c2ccc(O)cc2oc1=O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=c1c2ccccc2nc2sc(N=CC=Cc3ccccc3)nn12
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCOc1ccc(NC(=O)C(Cc2nc3ccccc3nc2O)=NO)cc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cc1ccc(C=C2CN(C)CC3=C2OC(N)=C(C#N)C3c2ccc(C)cc2)cc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C(O)c1ccc(C2C(=O)NC3CCCC32)cc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Nc1nc(SSc2nc(N)nc3c2ncn3C2OC(CO)C(O)C2O)c2ncn(C3OC(CO)C(O)C3O)c2n1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=c1[nH]c(=O)n(C2OC(CO)C(O)C2O)cc1Oc1ccccc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C1CCC2CCC(=O)N12
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(Nc1ccc(Cl)cc1)c1ccncc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCOC(=O)N1CC2OC(n3cc(C)c(=O)[nH]c3=O)CC2O1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCOC(=O)C(=Cc1ccc[nH]1)C(=O)c1ccccc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(C=C(C#N)C#N)=Cc1cccc(F)c1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCOC(=O)C(CS)NC(=O)CCCCCCCC(=O)O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CN(C)Cc1nc(O)nc(O)c1O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCC1(N=[N+]=[N-])C(=O)c2ccccc2N(C)C1=O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C(O)C1CSCN1C(=O)C1CCC(=S)N1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCN1C(=O)C(C)C=C(C)C=C1C
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C(CC(=O)Nc1ccccc1F)NN=Cc1ccccc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(=O)C(C)C(=O)N1C(=O)N(C)C2(C)N(C)C(=O)NC12C
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COCn1cc(C2=C(C)C(=O)C(C)=C(C)C2=O)cn1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: NCCN1C(=O)c2ccccc2C1(O)c1ccccc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=P(Nc1ccccn1)(N1CC1)N1CC1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CN(C)CN(C)c1nc(N(C)C)nc(N(C)CN(C)C)n1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: S=C(Nc1ccccc1)N(N=CC=Cc1ccccc1)c1nnc(-c2ccccc2)c(-c2ccccc2)n1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCCCCCCCCCCCS(=O)(=O)O.CCC[N+](C)(C)C
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1ccc(C=CC(=O)Oc2cc(O)cc(O)c2)cc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCCCCCc1nn2c(-c3ccc(C)cc3)nnc2s1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCOC(=O)c1ccc2c(=O)n3c(C(=O)OCC)ccc3c(=O)n12
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1cc(OC)c2c(=O)c(OC)c(-c3ccc4c(c3)OCO4)oc2c1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCCCC1(N=[N+]=[N-])C(=O)c2cccc3c2N(CCC3)C1=O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCCCN1CC(OC(=O)CCC)C(OC(=O)CCC)C(OC(=O)CCC)C1COC(=O)CCC
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: C=C1C(OC(C)=O)CC(=O)C(C)(C)C=CC(C)C(=O)C2(OC(C)=O)CC(C)(OC(C)=O)C(OC(C)=O)C2C1OC(C)=O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CSc1nc2c(c(=O)n1C)N=C(c1ccccc1)C(C(CC(=O)c1ccccc1)c1ccccc1)C(c1ccccc1)N2
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC12C(=O)OCC1C1CCC2C1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=c1c2nn3c(=O)n(-c4ccccc4)c(=O)c3nn2c(=O)n1-c1ccccc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: c1ccc2c(c1)nc1nc3c(cn12)CCCC3
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC1OC(=O)C2(CO)N(C)C(=O)C(C)C12O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCOC(=O)C1([Se]c2ccccc2)CCCC1=O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC1(C)COC(CCCCCNC2=NCCCCC2)=N1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C(O)c1nc2ccccc2nc1Nc1ccc(Cl)c(Cl)c1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC1(C)CCCCCCCCCC(C)(CCCCCCCCCCCCO)C1=O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=NN(CCCl)C(=O)NCCCl
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(=C(SSC(C(=O)O)=C(C)c1cccc(O)c1)C(=O)O)c1cccc(O)c1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=[Sb](O)(O)c1ccccc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COC1C=CC=C(C)C(=O)NC2=CC(=O)C(N)=C(CC(C)CC(OC)C(O)C(C)C=C(C)C1OC(N)=O)C2=O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1ccc2c(c1)OCC1c3cc4c(cc3OC21)OCO4
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1cc2c3c(c1)C(=NN)CCN3CCC2
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1cc(C)cc2c(-c3c(OC(C)=O)cc(OC(C)=O)c4c3CC(C)N(C(C)=O)C4C)cc(-c3cc(-c4c(OC(C)=O)cc(OC(C)=O)c5c4CC(C)N(C(C)=O)C5C)c4cc(C)cc(OC)c4c3O)c(O)c12
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CNC(=S)NN=C1CC(c2ccccc2)Oc2ccccc21
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cc1ccc2ccc(-c3cc4ccccc4s3)nc2c1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCOC(=O)C(=O)Nc1ccc(Cl)cc1C
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: S=C1CC(c2ccccc2)Sc2cc(Cl)ccc2N1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC1=NC(=O)C(C)(c2ccccc2)N1CCc1ccccc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C(CN1CCCC1)Nc1ccc2c(c1)C1Oc3ccccc3CC1CO2
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(c1ccccc1)C(CC#N)C1CCCC1(O)C#Cc1ccc2c(c1)OCO2
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: NC12CCC(N)(c3ccccc31)c1ccccc12
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: [N-]=[N+]=Nc1cc(O)nnc1-c1ccccc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1ccc(-c2nc(-c3cnccn3)n(CC=Cc3ccccc3)n2)cc1
No
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C1CNNC(Cn2nc(-c3ccccc3)c3ccccc3c2=O)=N1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=S(=O)(c1ccccc1)C1(CCC2OCCO2)C=CC2(CC1)OCCO2
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: [O-][n+]1cc(SCc2ccccc2)ncc1SCc1ccccc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C1CSc2ccncc2N1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cc1cn(C2COC(CO)C2CO)c(=O)[nH]c1=O
No
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1ccc2c(c1)OCC(O)(c1ccccc1)C2=O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=CC1=CCCN(CCc2c[nH]c3ccccc23)C1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cn1cncc1CC1COC(=O)C1C(O)c1ccccc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(=NNC(=O)c1ccccc1S(N)(=O)=O)C(CN1CCCCC1)C(C1=C(O)C2C=CC=CC2OC1=O)c1ccccc1.Cl
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Nc1ncnc2[nH]c(C3OC(CO)C(O)C3O)nc12
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=CC1=C(C(=O)OC(c2ccccc2)c2ccccc2)N2C(=O)C(NC(=O)Cc3cccs3)C2SC1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCN1CCN=c2c3cc(OC)ccc3n3cnc4ccc1c2c43
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1ccc(-c2cc(-c3ccco3)c(C#N)c(=O)n2C2OC(OC(=O)c3ccccc3)C(OC(=O)c3ccccc3)C2OC(=O)c2ccccc2)cc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COCc1c(C(=O)NCCO)[n+]([O-])c2ccccc2[n+]1[O-]
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(C)=CCCC(C)C1=C(O)C(=O)C(C)=C(NC(C)c2ccccc2)C1=O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCOC1(c2ccccc2)OC(=O)c2ccccc21
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1cc(C=O)c(-c2cc3c(cc2C2(C)OCCS2)OCO3)c(OC)c1OC
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCN(CC)CCNC(=O)c1ccc(C)c(OCc2ccccc2)c1[N+](=O)[O-]
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCOP(=O)(Nc1ccccc1CC)OCC
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCN1C(Cl)=NS(=O)(=O)c2ccccc21
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cc1cn(C2CC(n3cncn3)C(C(C)O)O2)c(=O)[nH]c1=O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CN1C(=O)C2(C=CCC2)c2ccccc21
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1cccc(C=C(C#N)C#N)c1OC
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COC(=O)c1ccc(OCc2nc3ccccc3[nH]2)cc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COC1(OC)C2(Cl)C(Cl)=C(Cl)C1(Cl)C1C(=O)C=CC(=O)C12
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COCC(N=CN1CCc2ccccc2C1)c1ccccc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: C=CCC12C=C(OC)C(O)C(OC)(C(c3cc(OC)c4c(c3)OCO4)C1C)C2OC(C)=O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: N=S(=O)(c1ccccc1)c1ccccc1[N+](=O)[O-]
No
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1ccc(-c2cc(C(=O)Nc3cc(C(F)(F)F)cc(C(F)(F)F)c3)c3ccccc3n2)cc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1cc(C(=O)C=Cc2ccc(OCCSCCCCCCCCCCSCCOc3ccc(C=CC(=O)c4cc(OC)c(OC)c(OC)c4)cc3)cc2)cc(OC)c1OC
Yes