prompt
stringlengths
189
761
answer
stringclasses
2 values
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: NCCSC12CC3CC(CC(C3)C1)C2
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CN1c2ccccc2C(=O)NC12CCN(CCCC(=O)c1ccc(F)cc1)CC2.Cl
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=c1[nH]nc(Cc2ccccc2)[nH]1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: N#CC(NNC(=O)c1ccccc1O)c1ccc(O)cc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: C=C(CN(C)C)C(=O)c1ccccc1[N+](=O)[O-]
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: NS(=O)(=O)c1ccc(NC(=O)c2ccccc2SSc2ccccc2C(=O)Nc2ccc(S(N)(=O)=O)cc2)cc1
No
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CN(C)CCNC(=O)c1cccc2c1Oc1cccc([N+](=O)[O-])c1O2.Cl
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COC(C(=O)NCCCCNC(=O)C(OC)c1ccccc1)c1ccccc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(SC(=S)Nc1cccc(F)c1)C(=O)O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cc1ncc([N+](=O)[O-])n1CCNC(=O)CCn1ccnc1[N+](=O)[O-]
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(C)=CCOc1cc(NC(=S)c2ccoc2C)ccc1Cl
No
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CN=c1ncn(C)c2ncn(CC=C(C)CCC3(C)C(C)CCC4(O)C3CCCC4(C)C)c12
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(O)C(C(=O)[O-])[N+]1=Cc2ccccc2[OH+][Co-2]12[OH+]c1ccccc1C=[N+]2C(C(=O)[O-])C(C)O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1ccc(-n2c(N)c(C#N)c3c(c2=S)CCC3)cc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Oc1ccccc1C=NCCSSCCN=Cc1ccccc1O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COC1C=COC2(C)Oc3c(C)c(O)c4c(O)c(c(C=NO)c(O)c4c3C2=O)NC(=O)C(C)=CC=CC(C)C(O)C(C)C(O)C(C)C(OC(C)=O)C1C
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(C)(C)NNc1c([N+](=O)[O-])cnn(-c2ccccc2)c1=O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: N[Pt-2]1(N)OC(=O)C2(CCC2)C(=O)O1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cc1ccc(C=C2N=C(N3CCCC(CO)C3)NC2=O)cc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C(N(O)c1ccccc1Cl)C(O)(c1ccccc1)c1ccccc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCOP(=O)(OCC)C(C)(C)N.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: N#Cc1ccccc1NC(=O)C(=NNC(=O)c1ccncc1)C(c1cnc2ccc([N+](=O)[O-])cc2n1)[N+](=O)[O-]
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cc1cc(C#N)c(Nc2ccccc2[N+](=O)[O-])s1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC1=NN(c2ccccc2)C(=O)C1=Nc1c(C)nn(-c2ccccc2)c1O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCCC1C(=O)Nc2cccc3ncn(c23)C1=O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Oc1nc(S)nc2nc3c4cccnc4c4ccccc4c3nc12
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(CSC(=O)c1ccccc1)C(=O)N1c2ccccc2CC1C(=O)O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(C)CC(NC(=O)C(CCC(=O)O)NC(=O)CNC(=O)CNC(=O)C(CO)NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C(CO)NC(=O)C(C)NC(=O)C(CCCNC(=N)N)NC(=O)C(C)NC(=O)CN)C(C)C)C(=O)NC(CC(=O)O)C(=O)NC(CCCNC(=N)N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(Cc1ccc(O)cc1)C(N)=O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CSc1nc(O)c(N)c(NC2OCC(O)C(O)C2O)n1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCCCCC=C(c1cc(F)c(OC)c(C(=O)OC)c1)c1cc(F)c(OC)c(C(=O)OC)c1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CN(C)CCNc1nc(-c2cccs2)cc(-c2cccs2)n1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCOP(=O)(OCC)C1(O)CC(n2cc(C)c(=O)[nH]c2=O)OC1CO
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Fc1cccc2c(SCc3ccc(Cl)cc3Cl)cnnc12
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1nc2ccc(CNc3ccc(C(=O)O)cc3)cc2nc1OC
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COC(=O)CCCN(C)c1n[nH]c(=N)[nH]1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cc1cccc(-n2c(N)c(-c3nc4ccccc4[nH]3)sc2=S)c1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COC(=O)C(Cc1ccccc1)OC(=O)C(N)CC(=O)O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: S=c1[nH]nc(-c2ccccc2Nc2ccccc2-c2n[nH]c(=S)n2-c2ccccc2)n1-c1ccccc1
No
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: NNC(=O)C(=O)NN=C(C(Cl)(Cl)CO)C(Cl)(Cl)CO
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(C)(C)OC(=O)NC(Cc1ccc(OCc2ccccc2)cc1)C(=O)NC(CCCCNC(=O)OCc1ccccc1)C(=O)ON1C(=O)CCC1=O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: ON=C1C(=Cc2ccc(Oc3ccccc3)cc2)CCCC1C(NO)c1ccc(Oc2ccccc2)cc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC1(C)CCCC2(C)C1CCC1(CO1)C2C=CC(C=O)CC=O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC1Nc2ccccc2NC1C=C(C#N)C#N
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: C=CC1c2ccccc2C=CC12C=CC(=O)CC2
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(=Nc1cc(Cl)cc(Cl)c1)c1ccncc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COC(=O)C=C1C2CC3CC(C2)C(O)C1C3
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COC(OC)c1cccc2c1C1(O)CCC3(CC21)OCCCCO3
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCOC(=O)c1c(NS(=O)(=O)c2ccccc2)sc2c1CCCC2
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1ccc(-c2c(C(C)=O)c(-c3ccccc3)n(C3OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C3OC(C)=O)c(=S)c2C#N)cc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(C)(C)C(=O)OC1C=CC(O)C2C3C=CC(C3)C12
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCC(=O)N(CCn1ccc(=N)[nH]c1=O)CCn1cnc2nc(N)nc(O)c21
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C1OC2C=CCC1C2
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(=O)Nc1ccc(C=Nc2ccc(SSc3ccc(N=Cc4ccc(NC(C)=O)cc4)cc3)cc2)cc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1c(C)c(-c2c(C)c(OC)c3c(c2OC)OCO3)c(OC)c2c1OCO2
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1cccc(C(CC(O)(C(F)(F)F)C(F)(F)F)=NN(C)C)c1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCCCCCCn1ccnc1NCCCCCCCCCCNc1nccn1CCCCCCC
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCOC(=O)c1ncoc1C1COC(C)(C)O1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=[N+]([O-])c1ccc(O)c(C=NCC2CCCN3CCCCC23)c1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: OC1C=CCC2C(F)(F)C(F)(Cl)C12Cl
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCOC(=O)C1=C(C)C(C(=O)OC)C2(C)C(C(=O)OCC)=C(O)C(C(=O)OC)C12C.[NaH]
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC1(C)OC2OC(COC(=S)SSC(=S)OCC3OC4OC(C)(C)OC4C4OC(C)(C)OC34)C3OC(C)(C)OC3C2O1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: C1CCCCCC2=C(CCCC1)CSCCCS2
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCOP(=O)(OCC)C(C#N)=Cc1ccc(C)o1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: NC(=O)c1nnsc1NC=O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCCCCCCCCCCCCCCC(=O)Nc1ccn(C2CC(OP(=O)(O)OCC3OC(n4cc(C)c(=O)[nH]c4=O)CC3N=[N+]=[N-])C(CO)O2)c(=O)n1
No
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=[N+]([O-])c1ccc(CSSCc2ccc([N+](=O)[O-])cc2)cc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CSC(=NC(=O)c1ccc(Br)cc1)Nc1ccccc1Cl.I
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=S1CC(c2ccccc2)=C(c2ccccc2)CS1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CN(C)C(n1cc2c(c1)-c1ccc(Cl)cc1C(c1ccccc1F)=NC2)n1cc2c(c1)-c1ccc(Cl)cc1C(c1ccccc1F)=NC2
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COC(=O)C1=C(C)N(NC(=O)Nc2ccccc2)C2(N)N(NC(=O)Nc3ccccc3)C(C)=C(C(=O)OC)C12C(=O)OC
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(NC(=O)C(Cc1c[nH]cn1)NC(=O)C1CCC(=O)N1)C(N)=O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(NC(=O)C(Cc1ccccc1)NC(=O)C(Cc1ccccc1)NC(=O)OC(C)(C)C)C(=O)OCc1ccccc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(C)(C)C1=C(Br)C(O)(C(C)(C)C)OP1(=O)c1ccccc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CNC1C(O)C(OC2C(N)CC(N)C(OC3OC(CN)=CCC3N)C2O)OCC1(C)O.O=S(=O)(O)O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COP1(=S)OCC2CCCC2O1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CN(N=Cc1ccc(Cl)c(Cl)c1)C1=NCCN1.I
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cc1c(C=NN(C)C)oc2c1cc(O)c1ncccc12
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC1=NC(C)(C)CC2CCC(O)C12
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC1=NC(C)(C)[N+]([O-])=C1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: [N-]=[N+]=C1N=CN=C1c1ncn[nH]1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1cccc(C=C2SC(=S)N(C=C(C(C)=O)C(=O)NCC(=O)O)C2=O)c1O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(=O)Nc1[nH]c(C#N)nc1C#N
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C(c1ccc(Cl)cc1)N(C(=S)N1CCN(c2ccccc2)CC1)c1ccccc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: NS(=O)(=O)c1ccc(NC(=O)c2cccc3c(Nc4ccc(S(N)(=O)=O)cc4)c4ccccc4nc23)cc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cc1cccc(C)c1NC(=S)NC=C(C(N)=O)C(N)=O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COC(=O)C=Cc1ccc(Cl)cc1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cc1cn(C2CC(O)C(COC(=O)CCCCCCCCCCBr)O2)c(=O)[nH]c1=O
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Cn1cnc([N+](=O)[O-])c1Sc1ccccn1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C1CCCC2CCCCN12
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: C=C(Cn1cnc2c(N)ncnc21)C(=O)OCC
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC1CC(C)CC(C)C(O)C(C#N)=CC=CCC(C2CCCC2C(=O)O)OC(=O)CC(O)C(C)C1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=[N+]([O-])c1cccc(Nc2nc(Cl)nc(Cl)n2)c1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COc1cc2c(cc1-c1coc3cc(O)ccc3c1=O)OCO2
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: ClCc1ccccc1NC1=Nc2ccccc2CO1.O=C(Nc1ccccc1CCl)Nc1ccccc1CCl
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: O=C(O)c1ccccc1C(=O)NC(Cc1cccc(NP(=O)(N2CC2)N2CC2)c1)C(=O)O
No
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC1=CC(C)(C)N=C2SC(c3ccc(N)cc3)=NN12
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CCOC(=O)c1ncn(CCc2ccc(Cl)cc2)c1C
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: Brc1ccc2[nH]c3nc(NN=Cc4cccnc4)nnc3c2c1
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: COCC(N=Cc1ccc(OC)cc1)C(C)C
Yes
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No. The SMILES string is: CC(C)(C)C1CCC2c3c([nH]c4ccccc34)C3C(=O)N(c4cc(Cl)ccc4Cl)C(=O)C3C2C1
Yes