prompt stringlengths 189 761 | answer stringclasses 2 values |
|---|---|
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1ccc2c(-c3ccc(OCCN(C)C)cc3)c(Oc3ccccc3)c(=O)oc2c1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: OCC1(CO)CCCC(CO)(CO)C1O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COC(=O)C1(C)CCCC2(C)C1CCC13OCC(CC21)C1(C(C)C)OC31
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: N#[N+]c1nc2c(O)ncnc2[nH]1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1cc(NC(=O)C(=O)Cc2nc3ccccc3s2)ccc1Cl
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C(ON=C1CCCCC1=Cc1ccccc1)c1ccc(Cl)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCCCCCCCCCCC(O)S(=O)(=O)O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Nc1nc(O)cc(Nc2cc(F)c(Cl)c(F)c2)n1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CN1CCN(C2=C(Cl)C3(OCCS3)C(F)(F)C2(F)F)CC1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C1NCC2(CCNCC2)N1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C(NCCCl)Nc1ccc(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1cc(-c2nn3c(=O)n(-c4ccc(Cl)cc4)c(=O)nc3s2)cc(OC)c1OC
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCOC(=O)c1nc2ccc(Cl)cc2c2c1CCO2
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC1(C)CC2=NO[Se]3=C2C(=NO3)C1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C1OC(=O)C2C1CC1C(=O)OC(=O)C12
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC1=[N+]2[N-]C(N3CC4CCC(CC4)C3)=[S+][Fe-]2[n+]2nc(C)ccc21
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1ccc2c(ccc3[nH]c4c(C)cnc(NCCCN(C)C)c4c32)c1.CS(=O)(=O)O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCOC(=O)c1c2ccccc2n2c(=O)n(-c3ccccc3)nnc12
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(C)NC(=O)OCCN=C1c2ccccc2CCc2ccccc21
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1cccnc1NC(=O)NCCCl
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(=O)NC(=CC=CCC=O)SC12CC3CC(CC(C3)C1)C2
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCOC(=O)Cc1nn2c(=O)cc(C)nc2s1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC1=COC2OC3(C)CCC4C(C)CCC1C24OO3
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1ccc(Nc2cc(O)nc(O)n2)cc1CS
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CN(CC(O)C(O)CN(C)C(=S)S)C(=S)S
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=c1ccn(C2CC2CO)c(=O)[nH]1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(=O)Oc1cc2c(c3ncccc13)OC(C)(C)C2
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCOC(=O)C#CCCOC1CCCCO1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1cc(C2c3cc4c(cc3CC3COC(=O)N32)OCO4)cc(OC)c1OC
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(=O)Oc1ccccc1C(=O)C1c2cccc(O)c2C(=O)c2c(O)cccc21
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=[N+]([O-])c1ccc(-c2nnc(C34CC5CC(CC(C5)C3)C4)o2)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCSc1ccc(N=[N+]([O-])c2ccc(SCC)c(Cl)c2)cc1Cl
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(C)[Si](OC1=C(C(=O)Nc2ccccc2Cl)CCCCC1)(C(C)C)C(C)C
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1c(C=NNC(=O)c2cc(Br)cc(Br)c2O)c(=O)n(-c2ccccc2)n1C
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=[N+]([O-])c1ccccc1C1N2CCCCC2C2c3[nH]c4ccccc4c3CCN21
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1ncnc2c1ncn2C1OC(CO)(C(F)(F)F)C(O)C1O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1ncc([N+](=O)[O-])n1CCN(C)CCCCn1ccnc1[N+](=O)[O-]
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Brc1ccccc1C1SCc2nc3ccccc3n21
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCCCc1ccc(Nc2nc(S)c3ncn(COCCO)c3n2)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1ccc(S(=O)(=O)N(C)C)cc1C(=O)c1cc(S(=O)(=O)N(C)C)ccc1OC
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC1CCCC2=C1C(=O)N(CSCN1C(=O)C3=C(C1=O)C(C)CCC3)C2=O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: N#Cc1c2c(c(Nc3ccc(F)cc3)n3c1nc1ccccc13)CCCC2
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCN(CC)c1ccc2cc(C(=O)Nc3ccccc3)c(=N)oc2c1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COC(c1ccsc1)C(C#N)(C#N)N=Cc1ccsc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CSc1nc(O)c2c(n1)NC(c1ccccc1)CC(c1ccccc1)=N2
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C1C(CN2CCCCC2)CCCC1CN1CCCCC1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=[N+]([O-])c1nccn1CCCNc1c2ccccc2[n+](O)c2ccccc12.[Cl-]
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCOC(=O)NC(NC(C)CC)(C(F)(F)F)C(F)(F)F
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Nc1nc(N)c2nc(-c3ccccc3)c(N)nc2n1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: C=C1C(O)CCC2(C)C3OC(C)(C)OC3C3=C(C)C(=O)CC4(OC(C)(C)OC4C12)C3(C)C
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC1C2CC(CC2O)C1(C)C
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(C)(C)C1=CC(=Nc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])C=C(C(C)(C)C)C1=O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=c1ccc(=O)n(CO)[nH]1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=[N+]([O-])c1cc2c(cc1O)[nH]c1cccc([N+](=O)[O-])c12
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: N=C(N)SCN1C(=O)c2ccccc2C1=O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1cccc2c1c1ccc3c(c1n2C)C(=O)C=CC3=O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1ccc(NC(=O)CC(=O)N2N=C(N(CCC#N)c3ccccc3Cl)CC2c2ccccc2)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC12CC3(C)CC(C)(C1)CC(C(NC(C)(C)C)C(=O)O)(C2)C3
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COC(=O)Cc1c(C2C(CC(=O)OC)c3ccccc3N2C2OC(CO)C(O)C(O)C2O)[nH]c2ccccc12
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1ccccc1NC(=O)CC(=O)n1nc(-c2ccccc2)c(N=Nc2ccc([N+](=O)[O-])cc2)c1-c1ccccc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1cc(C)c(C2=NOC3c4ccccc4OCC23)c(C)c1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1cc(N=Nc2ccc(NC(=O)c3ccc(N)cc3)cc2C)ccc1N=Nc1ccc2c(O)c(N=Nc3ccc(S(=O)(=O)O)cc3)c(S(=O)(=O)O)cc2c1
| No |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Nc1ccc(C(=O)NN2C(=O)C(Cl)C2c2ccccc2Cl)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: N=C(N)NCCC(NC(=O)OCCCCCn1ccc(=O)[nH]c1=O)C(=O)O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCCNC(=O)C1C(=O)C(=O)N(CCC)C1=O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCN(CC)C1Oc2cc3c(cc2C(c2cc(OC)c(O)c(OC)c2)C1C)OCO3
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COC(=O)CCC12CCC(O1)c1ccccc12
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(C)(C)C(C#N)(C#N)c1ccc(C(C#N)(C#N)C(C)(C)C)nn1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(=O)Nc1cc2cc(NS(=O)(=O)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)ccc2oc1=O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCOC(=O)C(Cc1ccccc1)P(=O)(OCC)OCC
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: [I-].c1ccc([P+](CCCCCCCC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)(c2ccccc2)c2ccccc2)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C(Nc1ccc(CCC2=NCCCN2)cc1)c1ccc(C(=O)Nc2ccc(CCC3=NCCCN3)cc2)cc1
| No |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COC(=O)C(Cc1nc2ccc(Cl)cc2nc1O)C(=NN)C(=O)Nc1cc(C)c(Cl)cc1S(=O)(=O)O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: OC(c1ccccc1)c1c(-c2ccccc2)[nH]c(-c2ccccc2)c1C(O)c1ccccc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCc1c(O)nc2ccc(N)cc2c1C
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(C)(C)C1(c2ccc(C3(c4ccccc4)Oc4ccccc4S3)[nH]2)Oc2ccccc2S1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1cc(OC)c(C(=O)C=Cc2ccc(OC)c(OC)c2)c(OC)c1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1ccc(CC2NCCc3cc(OC)c(OC)cc32)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=S(=O)(O[IH2](O[IH2](OS(=O)(=O)C(F)(F)F)c1ccccc1)c1ccccc1)C(F)(F)F
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: OCC1CC1n1cnc2c(O)ncnc21
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCOC(=O)C1=NN(c2ccccc2)C(=O)C1=CN1CCNC1=S
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(=O)N(CN1C(=O)CCC1C(=O)O)c1ccccc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: C=CCOC(=O)NC1C(OC(C)C(NC(=O)OCc2ccccc2)C(=O)OC(C)(C)C)OC(COC(C)=O)C(OC(C)=O)C1OC(C)=O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCOc1ccccc1NC(=O)C(=O)CC(=O)C1=C(C)Nc2ccccc2S1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: C1CCC(N=C(NC2CCCCC2)N2CCOCC2)CC1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COC(=O)c1ccc(C(=O)OC)c2nc3cc(Cl)ccc3nc12
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1[nH]c(=N)sc1C(=O)C=Cc1ccc2c(c1)OCO2
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C(O)CN1CCSc2ccccc2CN(CC(=O)O)CCSc2ccccc2C1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C1CCCN1CO
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCN(CC)CCCCC1CCN(CC(=O)N2c3ccccc3NC(=O)CC2C)CC1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: Cc1ccc(Nc2nc(-c3ccc(-c4ccc([N+](=O)[O-])cc4)o3)cs2)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=C(O)c1cc(Cl)nnc1O
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COC(OC)c1cccc2c1C(=O)CCC1(O)c3ccccc3C1C2
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: c1ccc(NN=C2CC(c3ccccc3)Oc3ccccc32)cc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: C=CCNC(=S)NC=C(C#N)c1nc2ccccc2s1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: O=c1[nH]c(=O)n(C2CC(O)C(CO)O2)cc1N=NNCCCc1ccccc1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COc1ccc2[nH]c3c([N+](=O)[O-])ccc(NCCCN(C)C)c3c(=NCCCN(C)C)c2c1
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CC(C)(C)C(=CS(=O)N=Cc1ccccc1)C(C)(C)C
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: CCCCCCCCCCCC(=O)OCCOCCOCCOCCOCCOC(=O)CCCCCCCCCCC
| Yes |
Given a SMILES string of a molecule, the task is to determine whether the molecule can inhibit HIV replication. You should format your answer as Yes or No.
The SMILES string is: COC(=O)C1CC2(C3C=CN(C(=O)C(F)(F)F)C=C3)c3ccccc3N(C(=O)C(F)(F)F)C2N1C(=O)OC
| Yes |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.