prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule Cc1ccc(NC(=O)C2=NO[C@@H](c3ccccc3)C2)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)C2=NO[C@@H](c3ccccc3Cl)C2)c(Cl)c1 | Cc1ccc(NC(=O)C2=NO[C@@H](c3ccccc3)C2)c(Cl)c1 | Cc1ccc(NC(=O)C2=NO[C@@H](c3ccccc3Cl)C2)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccccc1Cl",
"old_substring": "c16ccccc1"
} |
Can you make molecule Cc1ccc(NC(=O)C2=NO[C@@H](c3ccccc3)C2)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)C2=NO[C@@H](c3ccc(I)cc3)C2)c(Cl)c1 | Cc1ccc(NC(=O)C2=NO[C@@H](c3ccccc3)C2)c(Cl)c1 | Cc1ccc(NC(=O)C2=NO[C@@H](c3ccc(I)cc3)C2)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(I)cc1",
"old_substring": "c16ccccc1"
} |
Can you make molecule Cc1ccc(NC(=O)C2=NO[C@@H](c3ccccc3)C2)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)C2=NO[C@@H](c3ccc(C)c(I)c3)C2)c(Cl)c1 | Cc1ccc(NC(=O)C2=NO[C@@H](c3ccccc3)C2)c(Cl)c1 | Cc1ccc(NC(=O)C2=NO[C@@H](c3ccc(C)c(I)c3)C2)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1ccc&cc1I",
"old_substring": "c16ccccc1"
} |
Can you make molecule Cc1ccc(NC(=O)C2=NO[C@@H](c3ccccc3)C2)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)C2=NO[C@@H](c3cccc(Br)c3)C2)c(Cl)c1 | Cc1ccc(NC(=O)C2=NO[C@@H](c3ccccc3)C2)c(Cl)c1 | Cc1ccc(NC(=O)C2=NO[C@@H](c3cccc(Br)c3)C2)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "Brc1cccc&c1",
"old_substring": "c16ccccc1"
} |
Can you make molecule Cc1ccc(NC(=O)C2=NO[C@@H](c3ccccc3)C2)c(Cl)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(NC(=O)C2=NO[C@@H](c3cccc(C)c3C)C2)c(Cl)c1 | Cc1ccc(NC(=O)C2=NO[C@@H](c3ccccc3)C2)c(Cl)c1 | Cc1ccc(NC(=O)C2=NO[C@@H](c3cccc(C)c3C)C2)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc(C)c1C",
"old_substring": "c16ccccc1"
} |
Can you make molecule COc1ccc([C@H](C)NC(=O)Nc2ccc(CC(=O)N(C)C)cc2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CCC[C@@H](CCl)NC(=O)Nc2ccc(CC(=O)N(C)C)cc2)cc1F | COc1ccc([C@H](C)NC(=O)Nc2ccc(CC(=O)N(C)C)cc2)cc1F | COc1ccc(CCC[C@@H](CCl)NC(=O)Nc2ccc(CC(=O)N(C)C)cc2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "[C@@H]79C"
} |
Can you make molecule COc1ccc([C@H](C)NC(=O)Nc2ccc(CC(=O)N(C)C)cc2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CCC2=CN=N[C@H]2NC(=O)Nc2ccc(CC(=O)N(C)C)cc2)cc1F | COc1ccc([C@H](C)NC(=O)Nc2ccc(CC(=O)N(C)C)cc2)cc1F | COc1ccc(CCC2=CN=N[C@H]2NC(=O)Nc2ccc(CC(=O)N(C)C)cc2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&N=NC=C1CC&",
"old_substring": "[C@@H]79C"
} |
Can you make molecule COc1ccc([C@H](C)NC(=O)Nc2ccc(CC(=O)N(C)C)cc2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc([C@@H]2CC[C@@H](NC(=O)Nc3ccc(CC(=O)N(C)C)cc3)C2)cc1F | COc1ccc([C@H](C)NC(=O)Nc2ccc(CC(=O)N(C)C)cc2)cc1F | COc1ccc([C@@H]2CC[C@@H](NC(=O)Nc3ccc(CC(=O)N(C)C)cc3)C2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC[C@@H]&C1",
"old_substring": "[C@@H]79C"
} |
Can you make molecule COc1ccc([C@H](C)NC(=O)Nc2ccc(CC(=O)N(C)C)cc2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(CC(C)(C)[C@@H](C)NC(=O)Nc2ccc(CC(=O)N(C)C)cc2)cc1F | COc1ccc([C@H](C)NC(=O)Nc2ccc(CC(=O)N(C)C)cc2)cc1F | COc1ccc(CC(C)(C)[C@@H](C)NC(=O)Nc2ccc(CC(=O)N(C)C)cc2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(C)C(C)(C)C&",
"old_substring": "[C@@H]79C"
} |
Can you make molecule COc1ccc([C@H](C)NC(=O)Nc2ccc(CC(=O)N(C)C)cc2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CCc1ccc(OC)c(F)c1)NC(=O)Nc1ccc(CC(=O)N(C)C)cc1 | COc1ccc([C@H](C)NC(=O)Nc2ccc(CC(=O)N(C)C)cc2)cc1F | CC[C@@H](CCc1ccc(OC)c(F)c1)NC(=O)Nc1ccc(CC(=O)N(C)C)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CC)CC&",
"old_substring": "[C@@H]79C"
} |
Can you make molecule CS(=O)(=O)c1ccc(F)c(S(=O)(=O)[N-]c2cccc(NC(=O)C3CC3)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)c1ccc(F)c(S(=O)(=O)[N-]c2cccc(NC(=O)C3CCCCC3)c2)c1 | CS(=O)(=O)c1ccc(F)c(S(=O)(=O)[N-]c2cccc(NC(=O)C3CC3)c2)c1 | CS(=O)(=O)c1ccc(F)c(S(=O)(=O)[N-]c2cccc(NC(=O)C3CCCCC3)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCC1",
"old_substring": "C18CC1"
} |
Can you make molecule CS(=O)(=O)c1ccc(F)c(S(=O)(=O)[N-]c2cccc(NC(=O)C3CC3)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)c1ccc(F)c(S(=O)(=O)[N-]c2cccc(NC(=O)C3SCCCS3)c2)c1 | CS(=O)(=O)c1ccc(F)c(S(=O)(=O)[N-]c2cccc(NC(=O)C3CC3)c2)c1 | CS(=O)(=O)c1ccc(F)c(S(=O)(=O)[N-]c2cccc(NC(=O)C3SCCCS3)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "C18CC1"
} |
Can you make molecule CS(=O)(=O)c1ccc(F)c(S(=O)(=O)[N-]c2cccc(NC(=O)C3CC3)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)c1ccc(F)c(S(=O)(=O)[N-]c2cccc(NC(=O)C3SCSCS3)c2)c1 | CS(=O)(=O)c1ccc(F)c(S(=O)(=O)[N-]c2cccc(NC(=O)C3CC3)c2)c1 | CS(=O)(=O)c1ccc(F)c(S(=O)(=O)[N-]c2cccc(NC(=O)C3SCSCS3)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCSCS1",
"old_substring": "C18CC1"
} |
Can you make molecule CS(=O)(=O)c1ccc(F)c(S(=O)(=O)[N-]c2cccc(NC(=O)C3CC3)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)c1ccc(F)c(S(=O)(=O)[N-]c2cccc(NC(=O)C3CCCCCC3)c2)c1 | CS(=O)(=O)c1ccc(F)c(S(=O)(=O)[N-]c2cccc(NC(=O)C3CC3)c2)c1 | CS(=O)(=O)c1ccc(F)c(S(=O)(=O)[N-]c2cccc(NC(=O)C3CCCCCC3)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCC1",
"old_substring": "C18CC1"
} |
Can you make molecule CS(=O)(=O)c1ccc(F)c(S(=O)(=O)[N-]c2cccc(NC(=O)C3CC3)c2)c1 less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)c1ccc(F)c(S(=O)(=O)[N-]c2cccc(NC(=O)C3CSCCSC3)c2)c1 | CS(=O)(=O)c1ccc(F)c(S(=O)(=O)[N-]c2cccc(NC(=O)C3CC3)c2)c1 | CS(=O)(=O)c1ccc(F)c(S(=O)(=O)[N-]c2cccc(NC(=O)C3CSCCSC3)c2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CSCCSC1",
"old_substring": "C18CC1"
} |
Can you make molecule CN(CCc1cccs1)C(=O)c1ccc(OCC(F)(F)F)nc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(CCc1ccc(Cl)s1)C(=O)c1ccc(OCC(F)(F)F)nc1 | CN(CCc1cccs1)C(=O)c1ccc(OCC(F)(F)F)nc1 | CN(CCc1ccc(Cl)s1)C(=O)c1ccc(OCC(F)(F)F)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)s1",
"old_substring": "c17cccs1"
} |
Can you make molecule CN(CCc1cccs1)C(=O)c1ccc(OCC(F)(F)F)nc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(CCc1ccc(Br)s1)C(=O)c1ccc(OCC(F)(F)F)nc1 | CN(CCc1cccs1)C(=O)c1ccc(OCC(F)(F)F)nc1 | CN(CCc1ccc(Br)s1)C(=O)c1ccc(OCC(F)(F)F)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)s1",
"old_substring": "c17cccs1"
} |
Can you make molecule CN(CCc1cccs1)C(=O)c1ccc(OCC(F)(F)F)nc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(CCc1sccc1Br)C(=O)c1ccc(OCC(F)(F)F)nc1 | CN(CCc1cccs1)C(=O)c1ccc(OCC(F)(F)F)nc1 | CN(CCc1sccc1Br)C(=O)c1ccc(OCC(F)(F)F)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1Br",
"old_substring": "c17cccs1"
} |
Can you make molecule CN(CCc1cccs1)C(=O)c1ccc(OCC(F)(F)F)nc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(CCc1csc(I)c1)C(=O)c1ccc(OCC(F)(F)F)nc1 | CN(CCc1cccs1)C(=O)c1ccc(OCC(F)(F)F)nc1 | CN(CCc1csc(I)c1)C(=O)c1ccc(OCC(F)(F)F)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc(I)c1",
"old_substring": "c17cccs1"
} |
Can you make molecule CN(CCc1cccs1)C(=O)c1ccc(OCC(F)(F)F)nc1 less soluble in water? The output molecule should be similar to the input molecule. | CN(CCc1cc2c(s1)CSC2)C(=O)c1ccc(OCC(F)(F)F)nc1 | CN(CCc1cccs1)C(=O)c1ccc(OCC(F)(F)F)nc1 | CN(CCc1cc2c(s1)CSC2)C(=O)c1ccc(OCC(F)(F)F)nc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2c(s1)CSC2",
"old_substring": "c17cccs1"
} |
Can you make molecule CCCCC[NH+]1CCN(C(=O)N(C)C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC[NH+]1CCN(C(=O)CC(C)(C)N(C)C)CC1 | CCCCC[NH+]1CCN(C(=O)N(C)C)CC1 | CCCCC[NH+]1CCN(C(=O)CC(C)(C)N(C)C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule CCCCC[NH+]1CCN(C(=O)N(C)C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC[NH+]1CCN(C(=O)CCC(C)(C)N(C)C)CC1 | CCCCC[NH+]1CCN(C(=O)N(C)C)CC1 | CCCCC[NH+]1CCN(C(=O)CCC(C)(C)N(C)C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule CCCCC[NH+]1CCN(C(=O)N(C)C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC[NH+]1CCN(C(=O)C[C@@H](Br)N(C)C)CC1 | CCCCC[NH+]1CCN(C(=O)N(C)C)CC1 | CCCCC[NH+]1CCN(C(=O)C[C@@H](Br)N(C)C)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C23=O"
} |
Can you make molecule CCCCC[NH+]1CCN(C(=O)N(C)C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC[NH+]1CCN(c2cc(C)n(N(C)C)c(=O)c2)CC1 | CCCCC[NH+]1CCN(C(=O)N(C)C)CC1 | CCCCC[NH+]1CCN(c2cc(C)n(N(C)C)c(=O)c2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C23=O"
} |
Can you make molecule CCCCC[NH+]1CCN(C(=O)N(C)C)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC[NH+]1CCN(c2c(C)n(N(C)C)ccc2=O)CC1 | CCCCC[NH+]1CCN(C(=O)N(C)C)CC1 | CCCCC[NH+]1CCN(c2c(C)n(N(C)C)ccc2=O)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C23=O"
} |
Can you make molecule Fc1ccc(C[NH+](C[C@H]2CCCO2)[C@@H]2CCSC2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | Fc1ccc(C[NH+]2CCC(C[C@H]3CCCO3)([C@@H]3CCSC3)C2)cc1F | Fc1ccc(C[NH+](C[C@H]2CCCO2)[C@@H]2CCSC2)cc1F | Fc1ccc(C[NH+]2CCC(C[C@H]3CCCO3)([C@@H]3CCSC3)C2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC&&C1",
"old_substring": "[NH+]345"
} |
Can you make molecule Fc1ccc(C[NH+](C[C@H]2CCCO2)[C@@H]2CCSC2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | Fc1ccc(C[NH+]2CCC[C@](C[C@H]3CCCO3)([C@@H]3CCSC3)C2)cc1F | Fc1ccc(C[NH+](C[C@H]2CCCO2)[C@@H]2CCSC2)cc1F | Fc1ccc(C[NH+]2CCC[C@](C[C@H]3CCCO3)([C@@H]3CCSC3)C2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC[C@]&&C1",
"old_substring": "[NH+]345"
} |
Can you make molecule Fc1ccc(C[NH+](C[C@H]2CCCO2)[C@@H]2CCSC2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | Fc1ccc(Cc2[nH+]cn(C[C@H]3CCCO3)c2[C@@H]2CCSC2)cc1F | Fc1ccc(C[NH+](C[C@H]2CCCO2)[C@@H]2CCSC2)cc1F | Fc1ccc(Cc2[nH+]cn(C[C@H]3CCCO3)c2[C@@H]2CCSC2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]cn&c1&",
"old_substring": "[NH+]345"
} |
Can you make molecule Fc1ccc(C[NH+](C[C@H]2CCCO2)[C@@H]2CCSC2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | Fc1ccc(Cn2[nH+]c(C[C@H]3CCCO3)cc2[C@@H]2CCSC2)cc1F | Fc1ccc(C[NH+](C[C@H]2CCCO2)[C@@H]2CCSC2)cc1F | Fc1ccc(Cn2[nH+]c(C[C@H]3CCCO3)cc2[C@@H]2CCSC2)cc1F | 102 | {
"fragment_index": 0,
"new_substring": "n1&[nH+]c&cc1&",
"old_substring": "[NH+]345"
} |
Can you make molecule Fc1ccc(C[NH+](C[C@H]2CCCO2)[C@@H]2CCSC2)cc1F less soluble in water? The output molecule should be similar to the input molecule. | Cn1[nH+]c(Cc2ccc(F)c(F)c2)c([C@@H]2CCSC2)c1C[C@H]1CCCO1 | Fc1ccc(C[NH+](C[C@H]2CCCO2)[C@@H]2CCSC2)cc1F | Cn1[nH+]c(Cc2ccc(F)c(F)c2)c([C@@H]2CCSC2)c1C[C@H]1CCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]n(C)c&c1&",
"old_substring": "[NH+]345"
} |
Can you make molecule Cc1ccc(N2C(=O)C[C@@H](C(=O)N[C@]3(C)CCS(=O)(=O)C3)[C@@H]2c2cccs2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(N2C(=O)C[C@@H](C(=O)N[C@]3(C)CCS(=O)(=O)C3)[C@@H]2c2ccc(Cl)s2)cc1 | Cc1ccc(N2C(=O)C[C@@H](C(=O)N[C@]3(C)CCS(=O)(=O)C3)[C@@H]2c2cccs2)cc1 | Cc1ccc(N2C(=O)C[C@@H](C(=O)N[C@]3(C)CCS(=O)(=O)C3)[C@@H]2c2ccc(Cl)s2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)s1",
"old_substring": "c18cccs1"
} |
Can you make molecule Cc1ccc(N2C(=O)C[C@@H](C(=O)N[C@]3(C)CCS(=O)(=O)C3)[C@@H]2c2cccs2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(N2C(=O)C[C@@H](C(=O)N[C@]3(C)CCS(=O)(=O)C3)[C@@H]2c2ccc(Br)s2)cc1 | Cc1ccc(N2C(=O)C[C@@H](C(=O)N[C@]3(C)CCS(=O)(=O)C3)[C@@H]2c2cccs2)cc1 | Cc1ccc(N2C(=O)C[C@@H](C(=O)N[C@]3(C)CCS(=O)(=O)C3)[C@@H]2c2ccc(Br)s2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Br)s1",
"old_substring": "c18cccs1"
} |
Can you make molecule Cc1ccc(N2C(=O)C[C@@H](C(=O)N[C@]3(C)CCS(=O)(=O)C3)[C@@H]2c2cccs2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(N2C(=O)C[C@@H](C(=O)N[C@]3(C)CCS(=O)(=O)C3)[C@@H]2c2sccc2Br)cc1 | Cc1ccc(N2C(=O)C[C@@H](C(=O)N[C@]3(C)CCS(=O)(=O)C3)[C@@H]2c2cccs2)cc1 | Cc1ccc(N2C(=O)C[C@@H](C(=O)N[C@]3(C)CCS(=O)(=O)C3)[C@@H]2c2sccc2Br)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&sccc1Br",
"old_substring": "c18cccs1"
} |
Can you make molecule Cc1ccc(N2C(=O)C[C@@H](C(=O)N[C@]3(C)CCS(=O)(=O)C3)[C@@H]2c2cccs2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(N2C(=O)C[C@@H](C(=O)N[C@]3(C)CCS(=O)(=O)C3)[C@@H]2c2csc(I)c2)cc1 | Cc1ccc(N2C(=O)C[C@@H](C(=O)N[C@]3(C)CCS(=O)(=O)C3)[C@@H]2c2cccs2)cc1 | Cc1ccc(N2C(=O)C[C@@H](C(=O)N[C@]3(C)CCS(=O)(=O)C3)[C@@H]2c2csc(I)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&csc(I)c1",
"old_substring": "c18cccs1"
} |
Can you make molecule Cc1ccc(N2C(=O)C[C@@H](C(=O)N[C@]3(C)CCS(=O)(=O)C3)[C@@H]2c2cccs2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc(N2C(=O)C[C@@H](C(=O)N[C@]3(C)CCS(=O)(=O)C3)[C@@H]2c2cc3c(s2)CSC3)cc1 | Cc1ccc(N2C(=O)C[C@@H](C(=O)N[C@]3(C)CCS(=O)(=O)C3)[C@@H]2c2cccs2)cc1 | Cc1ccc(N2C(=O)C[C@@H](C(=O)N[C@]3(C)CCS(=O)(=O)C3)[C@@H]2c2cc3c(s2)CSC3)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc2c(s1)CSC2",
"old_substring": "c18cccs1"
} |
Can you make molecule O=C(Cc1ccccc1)N[C@H](N[C@H]1CCS(=O)(=O)C1)C(Cl)(Cl)Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1ccccc1)N[C@H](N[C@H]1CCS(=O)(=O)C1)C(Cl)(Cl)Cl | O=C(Cc1ccccc1)N[C@H](N[C@H]1CCS(=O)(=O)C1)C(Cl)(Cl)Cl | O=C(/C=C/Sc1ccccc1)N[C@H](N[C@H]1CCS(=O)(=O)C1)C(Cl)(Cl)Cl | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C2C6"
} |
Can you make molecule O=C(Cc1ccccc1)N[C@H](N[C@H]1CCS(=O)(=O)C1)C(Cl)(Cl)Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=C1CCC(c2ccccc2)CC1)N[C@H](N[C@H]1CCS(=O)(=O)C1)C(Cl)(Cl)Cl | O=C(Cc1ccccc1)N[C@H](N[C@H]1CCS(=O)(=O)C1)C(Cl)(Cl)Cl | O=C(NN=C1CCC(c2ccccc2)CC1)N[C@H](N[C@H]1CCS(=O)(=O)C1)C(Cl)(Cl)Cl | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCC&CC1",
"old_substring": "O=C2C6"
} |
Can you make molecule O=C(Cc1ccccc1)N[C@H](N[C@H]1CCS(=O)(=O)C1)C(Cl)(Cl)Cl less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N\ON[C@H](N[C@H]1CCS(=O)(=O)C1)C(Cl)(Cl)Cl)C(=O)Sc1ccccc1 | O=C(Cc1ccccc1)N[C@H](N[C@H]1CCS(=O)(=O)C1)C(Cl)(Cl)Cl | C/C(=N\ON[C@H](N[C@H]1CCS(=O)(=O)C1)C(Cl)(Cl)Cl)C(=O)Sc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C(\\C)C(=O)S&",
"old_substring": "O=C2C6"
} |
Can you make molecule O=C(Cc1ccccc1)N[C@H](N[C@H]1CCS(=O)(=O)C1)C(Cl)(Cl)Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(N[C@H](N[C@H]1CCS(=O)(=O)C1)C(Cl)(Cl)Cl)C1=CC[C@H](c2ccccc2)S1 | O=C(Cc1ccccc1)N[C@H](N[C@H]1CCS(=O)(=O)C1)C(Cl)(Cl)Cl | O=C(N[C@H](N[C@H]1CCS(=O)(=O)C1)C(Cl)(Cl)Cl)C1=CC[C@H](c2ccccc2)S1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&C1=CC[C@H]&S1",
"old_substring": "O=C2C6"
} |
Can you make molecule O=C(Cc1ccccc1)N[C@H](N[C@H]1CCS(=O)(=O)C1)C(Cl)(Cl)Cl less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=Cc1ccc(-c2ccccc2)cc1)N[C@H](N[C@H]1CCS(=O)(=O)C1)C(Cl)(Cl)Cl | O=C(Cc1ccccc1)N[C@H](N[C@H]1CCS(=O)(=O)C1)C(Cl)(Cl)Cl | O=C(NN=Cc1ccc(-c2ccccc2)cc1)N[C@H](N[C@H]1CCS(=O)(=O)C1)C(Cl)(Cl)Cl | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=Cc1ccc&cc1",
"old_substring": "O=C2C6"
} |
Can you make molecule O=C(c1ccc(O)cc1)N1CCN(CCc2ccccc2Cl)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sc1ccc(O)cc1)N1CCN(CCc2ccccc2Cl)CC1 | O=C(c1ccc(O)cc1)N1CCN(CCc2ccccc2Cl)CC1 | O=C(/C=C/Sc1ccc(O)cc1)N1CCN(CCc2ccccc2Cl)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(c1ccc(O)cc1)N1CCN(CCc2ccccc2Cl)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(N2CCN(CCc3ccccc3Cl)CC2)nc1-c1ccc(O)cc1 | O=C(c1ccc(O)cc1)N1CCN(CCc2ccccc2Cl)CC1 | O=Cc1sc(N2CCN(CCc3ccccc3Cl)CC2)nc1-c1ccc(O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(c1ccc(O)cc1)N1CCN(CCc2ccccc2Cl)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(N2CCN(CCc3ccccc3Cl)CC2)sc1-c1ccc(O)cc1 | O=C(c1ccc(O)cc1)N1CCN(CCc2ccccc2Cl)CC1 | O=Cc1nc(N2CCN(CCc3ccccc3Cl)CC2)sc1-c1ccc(O)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(c1ccc(O)cc1)N1CCN(CCc2ccccc2Cl)CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N1CCN(CCc2ccccc2Cl)CC1)n1nc(-c2ccc(O)cc2)oc1=S | O=C(c1ccc(O)cc1)N1CCN(CCc2ccccc2Cl)CC1 | O=C(N1CCN(CCc2ccccc2Cl)CC1)n1nc(-c2ccc(O)cc2)oc1=S | 102 | {
"fragment_index": 0,
"new_substring": "O=C&n1nc&oc1=S",
"old_substring": "O=C35"
} |
Can you make molecule O=C(c1ccc(O)cc1)N1CCN(CCc2ccccc2Cl)CC1 less soluble in water? The output molecule should be similar to the input molecule. | Oc1ccc(-c2ccc(/C=N/ON3CCN(CCc4ccccc4Cl)CC3)o2)cc1 | O=C(c1ccc(O)cc1)N1CCN(CCc2ccccc2Cl)CC1 | Oc1ccc(-c2ccc(/C=N/ON3CCN(CCc4ccccc4Cl)CC3)o2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C/c1ccc&o1",
"old_substring": "O=C35"
} |
Can you make molecule CC(C)c1cc(Br)ccc1OCC(=O)Nc1ccc(C(=O)N2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1cc(Br)ccc1OCCC(CO)=Nc1ccc(C(=O)N2CCOCC2)cc1 | CC(C)c1cc(Br)ccc1OCC(=O)Nc1ccc(C(=O)N2CCOCC2)cc1 | CC(C)c1cc(Br)ccc1OCCC(CO)=Nc1ccc(C(=O)N2CCOCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CC=&CO",
"old_substring": "C5C3=O"
} |
Can you make molecule CC(C)c1cc(Br)ccc1OCC(=O)Nc1ccc(C(=O)N2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(COc1ccc(Br)cc1C(C)C)=N/ONc1ccc(C(=O)N2CCOCC2)cc1 | CC(C)c1cc(Br)ccc1OCC(=O)Nc1ccc(C(=O)N2CCOCC2)cc1 | C/C(COc1ccc(Br)cc1C(C)C)=N/ONc1ccc(C(=O)N2CCOCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C/C(C&)=N/O&",
"old_substring": "C5C3=O"
} |
Can you make molecule CC(C)c1cc(Br)ccc1OCC(=O)Nc1ccc(C(=O)N2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(Oc1ccc(Br)cc1C(C)C)C(=O)CNc1ccc(C(=O)N2CCOCC2)cc1 | CC(C)c1cc(Br)ccc1OCC(=O)Nc1ccc(C(=O)N2CCOCC2)cc1 | CCC(CC)(Oc1ccc(Br)cc1C(C)C)C(=O)CNc1ccc(C(=O)N2CCOCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)C&",
"old_substring": "C5C3=O"
} |
Can you make molecule CC(C)c1cc(Br)ccc1OCC(=O)Nc1ccc(C(=O)N2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1cc(Br)ccc1OSSC(=O)Nc1ccc(C(=O)N2CCOCC2)cc1 | CC(C)c1cc(Br)ccc1OCC(=O)Nc1ccc(C(=O)N2CCOCC2)cc1 | CC(C)c1cc(Br)ccc1OSSC(=O)Nc1ccc(C(=O)N2CCOCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&SC&=O",
"old_substring": "C5C3=O"
} |
Can you make molecule CC(C)c1cc(Br)ccc1OCC(=O)Nc1ccc(C(=O)N2CCOCC2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(CC)(Oc1ccc(Br)cc1C(C)C)C(=O)CCNc1ccc(C(=O)N2CCOCC2)cc1 | CC(C)c1cc(Br)ccc1OCC(=O)Nc1ccc(C(=O)N2CCOCC2)cc1 | CCC(CC)(Oc1ccc(Br)cc1C(C)C)C(=O)CCNc1ccc(C(=O)N2CCOCC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)CC&",
"old_substring": "C5C3=O"
} |
Can you make molecule CC[C@@H](O)[C@@H]1CCCC[NH+]1Cc1nc2ccccc2n1CC less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](O)[C@@H]1CCCC[NH+]1CCCCc1nc2ccccc2n1CC | CC[C@@H](O)[C@@H]1CCCC[NH+]1Cc1nc2ccccc2n1CC | CC[C@@H](O)[C@@H]1CCCC[NH+]1CCCCc1nc2ccccc2n1CC | 102 | {
"fragment_index": 0,
"new_substring": "C&CCC&",
"old_substring": "C36"
} |
Can you make molecule CC[C@@H](O)[C@@H]1CCCC[NH+]1Cc1nc2ccccc2n1CC less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](O)[C@@H]1CCCC[NH+]1CCCCCc1nc2ccccc2n1CC | CC[C@@H](O)[C@@H]1CCCC[NH+]1Cc1nc2ccccc2n1CC | CC[C@@H](O)[C@@H]1CCCC[NH+]1CCCCCc1nc2ccccc2n1CC | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCC&",
"old_substring": "C36"
} |
Can you make molecule CC[C@@H](O)[C@@H]1CCCC[NH+]1Cc1nc2ccccc2n1CC less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](O)[C@@H]1CCCC[NH+]1C1CC(c2nc3ccccc3n2CC)C1 | CC[C@@H](O)[C@@H]1CCCC[NH+]1Cc1nc2ccccc2n1CC | CC[C@@H](O)[C@@H]1CCCC[NH+]1C1CC(c2nc3ccccc3n2CC)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&C1",
"old_substring": "C36"
} |
Can you make molecule CC[C@@H](O)[C@@H]1CCCC[NH+]1Cc1nc2ccccc2n1CC less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](O)[C@@H]1CCCC[NH+]1OC(=S)Sc1nc2ccccc2n1CC | CC[C@@H](O)[C@@H]1CCCC[NH+]1Cc1nc2ccccc2n1CC | CC[C@@H](O)[C@@H]1CCCC[NH+]1OC(=S)Sc1nc2ccccc2n1CC | 102 | {
"fragment_index": 0,
"new_substring": "O&C(=S)S&",
"old_substring": "C36"
} |
Can you make molecule CC[C@@H](O)[C@@H]1CCCC[NH+]1Cc1nc2ccccc2n1CC less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](O)[C@@H]1CCCC[NH+]1SC(=S)Nc1nc2ccccc2n1CC | CC[C@@H](O)[C@@H]1CCCC[NH+]1Cc1nc2ccccc2n1CC | CC[C@@H](O)[C@@H]1CCCC[NH+]1SC(=S)Nc1nc2ccccc2n1CC | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=S)N&",
"old_substring": "C36"
} |
Can you make molecule COc1cc(F)c([C@@H]([NH3+])C2(CC(C)C)CCCC2)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC1([C@H]2C[C@@H]3c4c(F)cc(cc4F)N3C2)CCCC1.CO | COc1cc(F)c([C@@H]([NH3+])C2(CC(C)C)CCCC2)c(F)c1 | CC(C)CC1([C@H]2C[C@@H]3c4c(F)cc(cc4F)N3C2)CCCC1.CO | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C[C@H]&N&C1",
"old_substring": "[C@H]46[NH3+]"
} |
Can you make molecule COc1cc(F)c([C@@H]([NH3+])C2(CC(C)C)CCCC2)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC1([C@H]2C[C@H]3c4c(F)cc(cc4F)N3C2)CCCC1.CO | COc1cc(F)c([C@@H]([NH3+])C2(CC(C)C)CCCC2)c(F)c1 | CC(C)CC1([C@H]2C[C@H]3c4c(F)cc(cc4F)N3C2)CCCC1.CO | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C[C@@H]&N&C1",
"old_substring": "[C@H]46[NH3+]"
} |
Can you make molecule COc1cc(F)c([C@@H]([NH3+])C2(CC(C)C)CCCC2)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC1([C@H]2CS[C@H]3c4c(F)cc(cc4F)N32)CCCC1.CO | COc1cc(F)c([C@@H]([NH3+])C2(CC(C)C)CCCC2)c(F)c1 | CC(C)CC1([C@H]2CS[C@H]3c4c(F)cc(cc4F)N32)CCCC1.CO | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CS[C@@H]&N1&",
"old_substring": "[C@H]46[NH3+]"
} |
Can you make molecule COc1cc(F)c([C@@H]([NH3+])C2(CC(C)C)CCCC2)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC1([C@H]2SC[C@H]3c4c(F)cc(cc4F)N32)CCCC1.CO | COc1cc(F)c([C@@H]([NH3+])C2(CC(C)C)CCCC2)c(F)c1 | CC(C)CC1([C@H]2SC[C@H]3c4c(F)cc(cc4F)N32)CCCC1.CO | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&SC[C@@H]&N1&",
"old_substring": "[C@H]46[NH3+]"
} |
Can you make molecule COc1cc(F)c([C@@H]([NH3+])C2(CC(C)C)CCCC2)c(F)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)CC1([C@H]2C[C@H]3CN(C2)c2cc(F)c3c(F)c2)CCCC1.CO | COc1cc(F)c([C@@H]([NH3+])C2(CC(C)C)CCCC2)c(F)c1 | CC(C)CC1([C@H]2C[C@H]3CN(C2)c2cc(F)c3c(F)c2)CCCC1.CO | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&C[C@H]&CN&C1",
"old_substring": "[C@H]46[NH3+]"
} |
Can you make molecule Cc1cc(F)cc(C(=O)NNC(=O)c2cc(Br)cn2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(F)cc(C(=O)NNC(=O)C(C)(C)c2cc(Br)cn2C)c1 | Cc1cc(F)cc(C(=O)NNC(=O)c2cc(Br)cn2C)c1 | Cc1cc(F)cc(C(=O)NNC(=O)C(C)(C)c2cc(Br)cn2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)NNC(=O)C&(C)C",
"old_substring": "C4(=O)NNC3=O"
} |
Can you make molecule Cc1cc(F)cc(C(=O)NNC(=O)c2cc(Br)cn2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CO/C(=N\C(=O)c1cc(C)cc(F)c1)Nc1cc(Br)cn1C | Cc1cc(F)cc(C(=O)NNC(=O)c2cc(Br)cn2C)c1 | CO/C(=N\C(=O)c1cc(C)cc(F)c1)Nc1cc(Br)cn1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)/N=C(/N&)OC",
"old_substring": "C4(=O)NNC3=O"
} |
Can you make molecule Cc1cc(F)cc(C(=O)NNC(=O)c2cc(Br)cn2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(F)cc(C(=O)N2CCCCN2C(=O)c2cc(Br)cn2C)c1 | Cc1cc(F)cc(C(=O)NNC(=O)c2cc(Br)cn2C)c1 | Cc1cc(F)cc(C(=O)N2CCCCN2C(=O)c2cc(Br)cn2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)N1CCCCN1C&=O",
"old_substring": "C4(=O)NNC3=O"
} |
Can you make molecule Cc1cc(F)cc(C(=O)NNC(=O)c2cc(Br)cn2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(F)cc(C(=O)CCCC(=O)c2cc(Br)cn2C)c1 | Cc1cc(F)cc(C(=O)NNC(=O)c2cc(Br)cn2C)c1 | Cc1cc(F)cc(C(=O)CCCC(=O)c2cc(Br)cn2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C4(=O)NNC3=O"
} |
Can you make molecule Cc1cc(F)cc(C(=O)NNC(=O)c2cc(Br)cn2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cc(F)cc(C(=O)N2N=CC[C@@]2(O)c2cc(Br)cn2C)c1 | Cc1cc(F)cc(C(=O)NNC(=O)c2cc(Br)cn2C)c1 | Cc1cc(F)cc(C(=O)N2N=CC[C@@]2(O)c2cc(Br)cn2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)N1N=CC[C@]1&O",
"old_substring": "C4(=O)NNC3=O"
} |
Can you make molecule COc1cccc(CNC(=O)CC2CCN(C(=O)[C@@H]3N=C(C)C=C3C)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CNSC(=O)CC2CCN(C(=O)[C@@H]3N=C(C)C=C3C)CC2)c1 | COc1cccc(CNC(=O)CC2CCN(C(=O)[C@@H]3N=C(C)C=C3C)CC2)c1 | COc1cccc(CNSC(=O)CC2CCN(C(=O)[C@@H]3N=C(C)C=C3C)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C4(=O)C9"
} |
Can you make molecule COc1cccc(CNC(=O)CC2CCN(C(=O)[C@@H]3N=C(C)C=C3C)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CNC(=O)CC(C)(C)C2CCN(C(=O)[C@@H]3N=C(C)C=C3C)CC2)c1 | COc1cccc(CNC(=O)CC2CCN(C(=O)[C@@H]3N=C(C)C=C3C)CC2)c1 | COc1cccc(CNC(=O)CC(C)(C)C2CCN(C(=O)[C@@H]3N=C(C)C=C3C)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C4(=O)C9"
} |
Can you make molecule COc1cccc(CNC(=O)CC2CCN(C(=O)[C@@H]3N=C(C)C=C3C)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CNC[S@+]([O-])CCCC2CCN(C(=O)[C@@H]3N=C(C)C=C3C)CC2)c1 | COc1cccc(CNC(=O)CC2CCN(C(=O)[C@@H]3N=C(C)C=C3C)CC2)c1 | COc1cccc(CNC[S@+]([O-])CCCC2CCN(C(=O)[C@@H]3N=C(C)C=C3C)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C4(=O)C9"
} |
Can you make molecule COc1cccc(CNC(=O)CC2CCN(C(=O)[C@@H]3N=C(C)C=C3C)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CNC(=O)CCC(C)(C)C2CCN(C(=O)[C@@H]3N=C(C)C=C3C)CC2)c1 | COc1cccc(CNC(=O)CC2CCN(C(=O)[C@@H]3N=C(C)C=C3C)CC2)c1 | COc1cccc(CNC(=O)CCC(C)(C)C2CCN(C(=O)[C@@H]3N=C(C)C=C3C)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C4(=O)C9"
} |
Can you make molecule COc1cccc(CNC(=O)CC2CCN(C(=O)[C@@H]3N=C(C)C=C3C)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cccc(CNC(=O)C[C@H](C)C2CCN(C(=O)[C@@H]3N=C(C)C=C3C)CC2)c1 | COc1cccc(CNC(=O)CC2CCN(C(=O)[C@@H]3N=C(C)C=C3C)CC2)c1 | COc1cccc(CNC(=O)C[C@H](C)C2CCN(C(=O)[C@@H]3N=C(C)C=C3C)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@@H]&C",
"old_substring": "C4(=O)C9"
} |
Can you make molecule C[C@H]1OCC[C@H]1C(=O)N1CCO[C@H](C#N)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H]1[C@@H](C)CCN1C(=O)N1CCO[C@H](C#N)C1 | C[C@H]1OCC[C@H]1C(=O)N1CCO[C@H](C#N)C1 | C[C@@H]1[C@@H](C)CCN1C(=O)N1CCO[C@H](C#N)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1CCN&[C@@H]1C",
"old_substring": "C[C@H]1OCC[C@H]13"
} |
Can you make molecule C[C@H]1OCC[C@H]1C(=O)N1CCO[C@H](C#N)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC=CC[C@H]1C(=O)N1CCO[C@H](C#N)C1 | C[C@H]1OCC[C@H]1C(=O)N1CCO[C@H](C#N)C1 | C[C@H]1CC=CC[C@H]1C(=O)N1CCO[C@H](C#N)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1CC=CC[C@H]1&",
"old_substring": "C[C@H]1OCC[C@H]13"
} |
Can you make molecule C[C@H]1OCC[C@H]1C(=O)N1CCO[C@H](C#N)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1SCCC[C@@H]1C(=O)N1CCO[C@H](C#N)C1 | C[C@H]1OCC[C@H]1C(=O)N1CCO[C@H](C#N)C1 | C[C@H]1SCCC[C@@H]1C(=O)N1CCO[C@H](C#N)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1SCCC[C@@H]1&",
"old_substring": "C[C@H]1OCC[C@H]13"
} |
Can you make molecule C[C@H]1OCC[C@H]1C(=O)N1CCO[C@H](C#N)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC[C@@]1(C#N)C(=O)N1CCO[C@H](C#N)C1 | C[C@H]1OCC[C@H]1C(=O)N1CCO[C@H](C#N)C1 | C[C@H]1CC[C@@]1(C#N)C(=O)N1CCO[C@H](C#N)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1CC[C@]1&C#N",
"old_substring": "C[C@H]1OCC[C@H]13"
} |
Can you make molecule C[C@H]1OCC[C@H]1C(=O)N1CCO[C@H](C#N)C1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CC[C@]1(C#N)C(=O)N1CCO[C@H](C#N)C1 | C[C@H]1OCC[C@H]1C(=O)N1CCO[C@H](C#N)C1 | C[C@H]1CC[C@]1(C#N)C(=O)N1CCO[C@H](C#N)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1CC[C@@]1&C#N",
"old_substring": "C[C@H]1OCC[C@H]13"
} |
Can you make molecule CS[C@H](C)CNC(=O)C(=O)Nc1nn(-c2ccccc2Cl)cc1C less soluble in water? The output molecule should be similar to the input molecule. | CS[C@H](C)CNC(=O)C(=O)Nc1nn(-c2cc(I)ccc2Cl)cc1C | CS[C@H](C)CNC(=O)C(=O)Nc1nn(-c2ccccc2Cl)cc1C | CS[C@H](C)CNC(=O)C(=O)Nc1nn(-c2cc(I)ccc2Cl)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(I)ccc1Cl",
"old_substring": "c18ccccc1Cl"
} |
Can you make molecule CS[C@H](C)CNC(=O)C(=O)Nc1nn(-c2ccccc2Cl)cc1C less soluble in water? The output molecule should be similar to the input molecule. | CS[C@H](C)CNC(=O)C(=O)Nc1nn(-c2cc(Br)ccc2Cl)cc1C | CS[C@H](C)CNC(=O)C(=O)Nc1nn(-c2ccccc2Cl)cc1C | CS[C@H](C)CNC(=O)C(=O)Nc1nn(-c2cc(Br)ccc2Cl)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)ccc1Cl",
"old_substring": "c18ccccc1Cl"
} |
Can you make molecule CS[C@H](C)CNC(=O)C(=O)Nc1nn(-c2ccccc2Cl)cc1C less soluble in water? The output molecule should be similar to the input molecule. | CS[C@H](C)CNC(=O)C(=O)Nc1nn(-c2sc3sccc3c2Cl)cc1C | CS[C@H](C)CNC(=O)C(=O)Nc1nn(-c2ccccc2Cl)cc1C | CS[C@H](C)CNC(=O)C(=O)Nc1nn(-c2sc3sccc3c2Cl)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc2sccc2c1Cl",
"old_substring": "c18ccccc1Cl"
} |
Can you make molecule CS[C@H](C)CNC(=O)C(=O)Nc1nn(-c2ccccc2Cl)cc1C less soluble in water? The output molecule should be similar to the input molecule. | CS[C@H](C)CNC(=O)C(=O)Nc1nn(-c2sc3ccccc3c2Cl)cc1C | CS[C@H](C)CNC(=O)C(=O)Nc1nn(-c2ccccc2Cl)cc1C | CS[C@H](C)CNC(=O)C(=O)Nc1nn(-c2sc3ccccc3c2Cl)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&sc2ccccc2c1Cl",
"old_substring": "c18ccccc1Cl"
} |
Can you make molecule CS[C@H](C)CNC(=O)C(=O)Nc1nn(-c2ccccc2Cl)cc1C less soluble in water? The output molecule should be similar to the input molecule. | CS[C@H](C)CNC(=O)C(=O)Nc1nn(-c2cc(Br)c(F)cc2Cl)cc1C | CS[C@H](C)CNC(=O)C(=O)Nc1nn(-c2ccccc2Cl)cc1C | CS[C@H](C)CNC(=O)C(=O)Nc1nn(-c2cc(Br)c(F)cc2Cl)cc1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc(Br)c(F)cc1Cl",
"old_substring": "c18ccccc1Cl"
} |
Can you make molecule Cc1cccc(CN2CCN(c3nc(C)ccc3C#N)C[C@@H]2CCO)n1 less soluble in water? The output molecule should be similar to the input molecule. | C=CO[C@H]1CN(c2nc(C)ccc2C#N)CCN1Cc1cccc(C)n1 | Cc1cccc(CN2CCN(c3nc(C)ccc3C#N)C[C@@H]2CCO)n1 | C=CO[C@H]1CN(c2nc(C)ccc2C#N)CCN1Cc1cccc(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CO&",
"old_substring": "C6CO"
} |
Can you make molecule Cc1cccc(CN2CCN(c3nc(C)ccc3C#N)C[C@@H]2CCO)n1 less soluble in water? The output molecule should be similar to the input molecule. | CCC(=O)[C@H]1CN(c2nc(C)ccc2C#N)CCN1Cc1cccc(C)n1 | Cc1cccc(CN2CCN(c3nc(C)ccc3C#N)C[C@@H]2CCO)n1 | CCC(=O)[C@H]1CN(c2nc(C)ccc2C#N)CCN1Cc1cccc(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&=O",
"old_substring": "C6CO"
} |
Can you make molecule Cc1cccc(CN2CCN(c3nc(C)ccc3C#N)C[C@@H]2CCO)n1 less soluble in water? The output molecule should be similar to the input molecule. | C=C=CO[C@H]1CN(c2nc(C)ccc2C#N)CCN1Cc1cccc(C)n1 | Cc1cccc(CN2CCN(c3nc(C)ccc3C#N)C[C@@H]2CCO)n1 | C=C=CO[C@H]1CN(c2nc(C)ccc2C#N)CCN1Cc1cccc(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C=C=CO&",
"old_substring": "C6CO"
} |
Can you make molecule Cc1cccc(CN2CCN(c3nc(C)ccc3C#N)C[C@@H]2CCO)n1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H]1CN(c2nc(C)ccc2C#N)CCN1Cc1cccc(C)n1 | Cc1cccc(CN2CCN(c3nc(C)ccc3C#N)C[C@@H]2CCO)n1 | CC[C@H]1CN(c2nc(C)ccc2C#N)CCN1Cc1cccc(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "CC&",
"old_substring": "C6CO"
} |
Can you make molecule Cc1cccc(CN2CCN(c3nc(C)ccc3C#N)C[C@@H]2CCO)n1 less soluble in water? The output molecule should be similar to the input molecule. | C/C=N/O[C@H]1CN(c2nc(C)ccc2C#N)CCN1Cc1cccc(C)n1 | Cc1cccc(CN2CCN(c3nc(C)ccc3C#N)C[C@@H]2CCO)n1 | C/C=N/O[C@H]1CN(c2nc(C)ccc2C#N)CCN1Cc1cccc(C)n1 | 102 | {
"fragment_index": 0,
"new_substring": "C/C=N/O&",
"old_substring": "C6CO"
} |
Can you make molecule COc1ccc(OCCOc2cccc(Br)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(OCCOc2cccc(Br)c2)cc1 | COc1ccc(OCCOc2cccc(Br)c2)cc1 | COCc1ccc(OCCOc2cccc(Br)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(OCCOc2cccc(Br)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc(OCCOc2cccc(Br)c2)cc1 | COc1ccc(OCCOc2cccc(Br)c2)cc1 | COCSc1ccc(OCCOc2cccc(Br)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(OCCOc2cccc(Br)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1ccc(OCCOc2cccc(Br)c2)cc1 | COc1ccc(OCCOc2cccc(Br)c2)cc1 | CC(=O)Sc1ccc(OCCOc2cccc(Br)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(OCCOc2cccc(Br)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CS)c1ccc(OCCOc2cccc(Br)c2)cc1 | COc1ccc(OCCOc2cccc(Br)c2)cc1 | O=C(CS)c1ccc(OCCOc2cccc(Br)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO5"
} |
Can you make molecule COc1ccc(OCCOc2cccc(Br)c2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CI)c1ccc(OCCOc2cccc(Br)c2)cc1 | COc1ccc(OCCOc2cccc(Br)c2)cc1 | O=C(CI)c1ccc(OCCOc2cccc(Br)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO5"
} |
Can you make molecule C=C(C)[C@@](C)(O)C#CC[NH+]1CCCC[C@@H]1c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)[C@@](C)(O)C#CC[C@H]1CN(c2cccnc2)C[C@@H]1C | C=C(C)[C@@](C)(O)C#CC[NH+]1CCCC[C@@H]1c1cccnc1 | C=C(C)[C@@](C)(O)C#CC[C@H]1CN(c2cccnc2)C[C@@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CN&C[C@@H]1C",
"old_substring": "[NH+]12CCCC[C@@H]13"
} |
Can you make molecule C=C(C)[C@@](C)(O)C#CC[NH+]1CCCC[C@@H]1c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)[C@@](C)(O)C#CC[C@H]1CCC[C@H](c2cccnc2)C1 | C=C(C)[C@@](C)(O)C#CC[NH+]1CCCC[C@@H]1c1cccnc1 | C=C(C)[C@@](C)(O)C#CC[C@H]1CCC[C@H](c2cccnc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&C1",
"old_substring": "[NH+]12CCCC[C@@H]13"
} |
Can you make molecule C=C(C)[C@@](C)(O)C#CC[NH+]1CCCC[C@@H]1c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)[C@@](C)(O)C#CC[C@H]1CCC[C@H](c2cccnc2)CC1 | C=C(C)[C@@](C)(O)C#CC[NH+]1CCCC[C@@H]1c1cccnc1 | C=C(C)[C@@](C)(O)C#CC[C@H]1CCC[C@H](c2cccnc2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&CC1",
"old_substring": "[NH+]12CCCC[C@@H]13"
} |
Can you make molecule C=C(C)[C@@](C)(O)C#CC[NH+]1CCCC[C@@H]1c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)[C@@](C)(O)C#CC[C@@H]1NC[C@@H](c2cccnc2)S1 | C=C(C)[C@@](C)(O)C#CC[NH+]1CCCC[C@@H]1c1cccnc1 | C=C(C)[C@@](C)(O)C#CC[C@@H]1NC[C@@H](c2cccnc2)S1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&NC[C@@H]&S1",
"old_substring": "[NH+]12CCCC[C@@H]13"
} |
Can you make molecule C=C(C)[C@@](C)(O)C#CC[NH+]1CCCC[C@@H]1c1cccnc1 less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)[C@@](C)(O)C#CC[C@@H]1CN(c2cccnc2)C[C@H]1C | C=C(C)[C@@](C)(O)C#CC[NH+]1CCCC[C@@H]1c1cccnc1 | C=C(C)[C@@](C)(O)C#CC[C@@H]1CN(c2cccnc2)C[C@H]1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CN&C[C@H]1C",
"old_substring": "[NH+]12CCCC[C@@H]13"
} |
Can you make molecule COc1cc(C[NH+]2CCC[C@]3(CCC(=O)N(C4CC4)C3)C2)cc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1cc(C[NH+]2CCC[C@]3(CCC(=O)N(C4CC4)C3)C2)cc(OC)c1 | COc1cc(C[NH+]2CCC[C@]3(CCC(=O)N(C4CC4)C3)C2)cc(OC)c1 | COCc1cc(C[NH+]2CCC[C@]3(CCC(=O)N(C4CC4)C3)C2)cc(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO5"
} |
Can you make molecule COc1cc(C[NH+]2CCC[C@]3(CCC(=O)N(C4CC4)C3)C2)cc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1cc(C[NH+]2CCC[C@]3(CCC(=O)N(C4CC4)C3)C2)cc(OC)c1 | COc1cc(C[NH+]2CCC[C@]3(CCC(=O)N(C4CC4)C3)C2)cc(OC)c1 | COCSc1cc(C[NH+]2CCC[C@]3(CCC(=O)N(C4CC4)C3)C2)cc(OC)c1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO5"
} |
Can you make molecule COc1cc(C[NH+]2CCC[C@]3(CCC(=O)N(C4CC4)C3)C2)cc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C[NH+]2CCC[C@]3(CCC(=O)N(C4CC4)C3)C2)cc(SC(C)=O)c1 | COc1cc(C[NH+]2CCC[C@]3(CCC(=O)N(C4CC4)C3)C2)cc(OC)c1 | COc1cc(C[NH+]2CCC[C@]3(CCC(=O)N(C4CC4)C3)C2)cc(SC(C)=O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO5"
} |
Can you make molecule COc1cc(C[NH+]2CCC[C@]3(CCC(=O)N(C4CC4)C3)C2)cc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C[NH+]2CCC[C@]3(CCC(=O)N(C4CC4)C3)C2)cc(C(=O)CS)c1 | COc1cc(C[NH+]2CCC[C@]3(CCC(=O)N(C4CC4)C3)C2)cc(OC)c1 | COc1cc(C[NH+]2CCC[C@]3(CCC(=O)N(C4CC4)C3)C2)cc(C(=O)CS)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO5"
} |
Can you make molecule COc1cc(C[NH+]2CCC[C@]3(CCC(=O)N(C4CC4)C3)C2)cc(OC)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1cc(C[NH+]2CCC[C@]3(CCC(=O)N(C4CC4)C3)C2)cc(C(=O)CI)c1 | COc1cc(C[NH+]2CCC[C@]3(CCC(=O)N(C4CC4)C3)C2)cc(OC)c1 | COc1cc(C[NH+]2CCC[C@]3(CCC(=O)N(C4CC4)C3)C2)cc(C(=O)CI)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO5"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.