prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CCCc1cc(C(=O)NNC(=O)c2cccc(Br)c2)[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | CCCc1cc(C(=O)NNC(=O)c2cccc(Br)c2)c[nH]1 | CCCc1cc(C(=O)NNC(=O)c2cccc(Br)c2)[nH]n1 | CCCc1cc(C(=O)NNC(=O)c2cccc(Br)c2)c[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c[nH]1",
"old_substring": "c15cc3[nH]n1"
} |
Can you make molecule CCCc1cc(C(=O)NNC(=O)c2cccc(Br)c2)[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | CCCc1ccc(C(=O)NNC(=O)c2cccc(Br)c2)[nH]1 | CCCc1cc(C(=O)NNC(=O)c2cccc(Br)c2)[nH]n1 | CCCc1ccc(C(=O)NNC(=O)c2cccc(Br)c2)[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&[nH]1",
"old_substring": "c15cc3[nH]n1"
} |
Can you make molecule CCCc1cc(C(=O)NNC(=O)c2cccc(Br)c2)[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | CCCc1ccc2[nH]c(C(=O)NNC(=O)c3cccc(Br)c3)nc2c1 | CCCc1cc(C(=O)NNC(=O)c2cccc(Br)c2)[nH]n1 | CCCc1ccc2[nH]c(C(=O)NNC(=O)c3cccc(Br)c3)nc2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2[nH]c&nc2c1",
"old_substring": "c15cc3[nH]n1"
} |
Can you make molecule CCCc1cc(C(=O)NNC(=O)c2cccc(Br)c2)[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | CCCc1ccc2[nH]cc(C(=O)NNC(=O)c3cccc(Br)c3)c2n1 | CCCc1cc(C(=O)NNC(=O)c2cccc(Br)c2)[nH]n1 | CCCc1ccc2[nH]cc(C(=O)NNC(=O)c3cccc(Br)c3)c2n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc2[nH]cc&c2n1",
"old_substring": "c15cc3[nH]n1"
} |
Can you make molecule CCCc1cc(C(=O)NNC(=O)c2cccc(Br)c2)[nH]n1 less soluble in water? The output molecule should be similar to the input molecule. | CCCc1cc(C(=O)NNC(=O)c2cccc(Br)c2)c2cc[nH]c2n1 | CCCc1cc(C(=O)NNC(=O)c2cccc(Br)c2)[nH]n1 | CCCc1cc(C(=O)NNC(=O)c2cccc(Br)c2)c2cc[nH]c2n1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&c2cc[nH]c2n1",
"old_substring": "c15cc3[nH]n1"
} |
Can you make molecule O=[N+]([O-])c1c(Nc2ccc(F)c(F)c2)ncnc1Oc1cccc2cccnc12 less soluble in water? The output molecule should be similar to the input molecule. | O=[N+]([O-])c1c(NCSc2ccc(F)c(F)c2)ncnc1Oc1cccc2cccnc12 | O=[N+]([O-])c1c(Nc2ccc(F)c(F)c2)ncnc1Oc1cccc2cccnc12 | O=[N+]([O-])c1c(NCSc2ccc(F)c(F)c2)ncnc1Oc1cccc2cccnc12 | 102 | {
"fragment_index": 0,
"new_substring": "N&CS&",
"old_substring": "N56"
} |
Can you make molecule O=[N+]([O-])c1c(Nc2ccc(F)c(F)c2)ncnc1Oc1cccc2cccnc12 less soluble in water? The output molecule should be similar to the input molecule. | N=C(Nc1ncnc(Oc2cccc3cccnc23)c1[N+](=O)[O-])Sc1ccc(F)c(F)c1 | O=[N+]([O-])c1c(Nc2ccc(F)c(F)c2)ncnc1Oc1cccc2cccnc12 | N=C(Nc1ncnc(Oc2cccc3cccnc23)c1[N+](=O)[O-])Sc1ccc(F)c(F)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=N)S&",
"old_substring": "N56"
} |
Can you make molecule O=[N+]([O-])c1c(Nc2ccc(F)c(F)c2)ncnc1Oc1cccc2cccnc12 less soluble in water? The output molecule should be similar to the input molecule. | CN(C(=S)Sc1ccc(F)c(F)c1)c1ncnc(Oc2cccc3cccnc23)c1[N+](=O)[O-] | O=[N+]([O-])c1c(Nc2ccc(F)c(F)c2)ncnc1Oc1cccc2cccnc12 | CN(C(=S)Sc1ccc(F)c(F)c1)c1ncnc(Oc2cccc3cccnc23)c1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N56"
} |
Can you make molecule O=[N+]([O-])c1c(Nc2ccc(F)c(F)c2)ncnc1Oc1cccc2cccnc12 less soluble in water? The output molecule should be similar to the input molecule. | O=[N+]([O-])c1c(CN2CCC(c3ccc(F)c(F)c3)CC2)ncnc1Oc1cccc2cccnc12 | O=[N+]([O-])c1c(Nc2ccc(F)c(F)c2)ncnc1Oc1cccc2cccnc12 | O=[N+]([O-])c1c(CN2CCC(c3ccc(F)c(F)c3)CC2)ncnc1Oc1cccc2cccnc12 | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "N56"
} |
Can you make molecule O=[N+]([O-])c1c(Nc2ccc(F)c(F)c2)ncnc1Oc1cccc2cccnc12 less soluble in water? The output molecule should be similar to the input molecule. | Nc1c(-c2ccc(F)c(F)c2)cccc1-c1ncnc(Oc2cccc3cccnc23)c1[N+](=O)[O-] | O=[N+]([O-])c1c(Nc2ccc(F)c(F)c2)ncnc1Oc1cccc2cccnc12 | Nc1c(-c2ccc(F)c(F)c2)cccc1-c1ncnc(Oc2cccc3cccnc23)c1[N+](=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "Nc1c&cccc1&",
"old_substring": "N56"
} |
Can you make molecule CC(C)(C)n1ncc2c1CCC[C@H]2NC(=O)CSc1nc2ccccc2o1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)n1ncc2c1CCC[C@H]2NSC(=O)CSc1nc2ccccc2o1 | CC(C)(C)n1ncc2c1CCC[C@H]2NC(=O)CSc1nc2ccccc2o1 | CC(C)(C)n1ncc2c1CCC[C@H]2NSC(=O)CSc1nc2ccccc2o1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C3(=O)C4"
} |
Can you make molecule CC(C)(C)n1ncc2c1CCC[C@H]2NC(=O)CSc1nc2ccccc2o1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)n1ncc2c1CCC[C@H]2NC(=O)CCCC(=O)Sc1nc2ccccc2o1 | CC(C)(C)n1ncc2c1CCC[C@H]2NC(=O)CSc1nc2ccccc2o1 | CC(C)(C)n1ncc2c1CCC[C@H]2NC(=O)CCCC(=O)Sc1nc2ccccc2o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C3(=O)C4"
} |
Can you make molecule CC(C)(C)n1ncc2c1CCC[C@H]2NC(=O)CSc1nc2ccccc2o1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CC(=O)N[C@@H]1CCCc2c1cnn2C(C)(C)C)Sc1nc2ccccc2o1 | CC(C)(C)n1ncc2c1CCC[C@H]2NC(=O)CSc1nc2ccccc2o1 | CC(C)(CC(=O)N[C@@H]1CCCc2c1cnn2C(C)(C)C)Sc1nc2ccccc2o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C3(=O)C4"
} |
Can you make molecule CC(C)(C)n1ncc2c1CCC[C@H]2NC(=O)CSc1nc2ccccc2o1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)n1ncc2c1CCC[C@H]2NC[S@+]([O-])CCCSc1nc2ccccc2o1 | CC(C)(C)n1ncc2c1CCC[C@H]2NC(=O)CSc1nc2ccccc2o1 | CC(C)(C)n1ncc2c1CCC[C@H]2NC[S@+]([O-])CCCSc1nc2ccccc2o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C3(=O)C4"
} |
Can you make molecule CC(C)(C)n1ncc2c1CCC[C@H]2NC(=O)CSc1nc2ccccc2o1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(CCC(=O)N[C@@H]1CCCc2c1cnn2C(C)(C)C)Sc1nc2ccccc2o1 | CC(C)(C)n1ncc2c1CCC[C@H]2NC(=O)CSc1nc2ccccc2o1 | CC(C)(CCC(=O)N[C@@H]1CCCc2c1cnn2C(C)(C)C)Sc1nc2ccccc2o1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C3(=O)C4"
} |
Can you make molecule Cc1ccc([C@@H](C)NC(=O)N[C@@H](CCO)c2cccs2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@@H](C)NC(=O)N[C@@H]2CC[C@H](c3cccs3)O2)cc1 | Cc1ccc([C@@H](C)NC(=O)N[C@@H](CCO)c2cccs2)cc1 | Cc1ccc([C@@H](C)NC(=O)N[C@@H]2CC[C@H](c3cccs3)O2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC[C@H]&O1",
"old_substring": "[C@@H]67CCO"
} |
Can you make molecule Cc1ccc([C@@H](C)NC(=O)N[C@@H](CCO)c2cccs2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@@H](C)NC(=O)N[C@@H]2CC[C@@H](c3cccs3)O2)cc1 | Cc1ccc([C@@H](C)NC(=O)N[C@@H](CCO)c2cccs2)cc1 | Cc1ccc([C@@H](C)NC(=O)N[C@@H]2CC[C@@H](c3cccs3)O2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CC[C@@H]&O1",
"old_substring": "[C@@H]67CCO"
} |
Can you make molecule Cc1ccc([C@@H](C)NC(=O)N[C@@H](CCO)c2cccs2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@@H](C)NC(=O)N[C@@H]2CCCN(c3cccs3)CC2)cc1 | Cc1ccc([C@@H](C)NC(=O)N[C@@H](CCO)c2cccs2)cc1 | Cc1ccc([C@@H](C)NC(=O)N[C@@H]2CCCN(c3cccs3)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&CCCN&CC1",
"old_substring": "[C@@H]67CCO"
} |
Can you make molecule Cc1ccc([C@@H](C)NC(=O)N[C@@H](CCO)c2cccs2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@@H](C)NC(=O)N[C@H](CCl)CCCc2cccs2)cc1 | Cc1ccc([C@@H](C)NC(=O)N[C@@H](CCO)c2cccs2)cc1 | Cc1ccc([C@@H](C)NC(=O)N[C@H](CCl)CCCc2cccs2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "[C@@H]67CCO"
} |
Can you make molecule Cc1ccc([C@@H](C)NC(=O)N[C@@H](CCO)c2cccs2)cc1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@@H](C)NC(=O)N[C@@H]2N=NC=C2CCc2cccs2)cc1 | Cc1ccc([C@@H](C)NC(=O)N[C@@H](CCO)c2cccs2)cc1 | Cc1ccc([C@@H](C)NC(=O)N[C@@H]2N=NC=C2CCc2cccs2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]1&N=NC=C1CC&",
"old_substring": "[C@@H]67CCO"
} |
Can you make molecule CCN(CC)S(=O)(=O)c1ccc2nc(-c3ccncc3)cc(C(=O)[O-])c2c1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(CC)S(=O)(=O)c1ccc2nc(-c3ccncc3)cc(CCS(=O)(=O)[O-])c2c1 | CCN(CC)S(=O)(=O)c1ccc2nc(-c3ccncc3)cc(C(=O)[O-])c2c1 | CCN(CC)S(=O)(=O)c1ccc2nc(-c3ccncc3)cc(CCS(=O)(=O)[O-])c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CS(=O)(=O)[O-]",
"old_substring": "C7(=O)[O-]"
} |
Can you make molecule CCN(CC)S(=O)(=O)c1ccc2nc(-c3ccncc3)cc(C(=O)[O-])c2c1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(CC)S(=O)(=O)c1ccc2nc(-c3ccncc3)cc(C(=O)CO)c2c1 | CCN(CC)S(=O)(=O)c1ccc2nc(-c3ccncc3)cc(C(=O)[O-])c2c1 | CCN(CC)S(=O)(=O)c1ccc2nc(-c3ccncc3)cc(C(=O)CO)c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CO",
"old_substring": "C7(=O)[O-]"
} |
Can you make molecule CCN(CC)S(=O)(=O)c1ccc2nc(-c3ccncc3)cc(C(=O)[O-])c2c1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(CC)S(=O)(=O)c1ccc2nc(-c3ccncc3)cc(C(O)O)c2c1 | CCN(CC)S(=O)(=O)c1ccc2nc(-c3ccncc3)cc(C(=O)[O-])c2c1 | CCN(CC)S(=O)(=O)c1ccc2nc(-c3ccncc3)cc(C(O)O)c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(O)O",
"old_substring": "C7(=O)[O-]"
} |
Can you make molecule CCN(CC)S(=O)(=O)c1ccc2nc(-c3ccncc3)cc(C(=O)[O-])c2c1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(CC)S(=O)(=O)c1ccc2nc(-c3ccncc3)cc(C(CC)(CC)C(=O)[O-])c2c1 | CCN(CC)S(=O)(=O)c1ccc2nc(-c3ccncc3)cc(C(=O)[O-])c2c1 | CCN(CC)S(=O)(=O)c1ccc2nc(-c3ccncc3)cc(C(CC)(CC)C(=O)[O-])c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)[O-]",
"old_substring": "C7(=O)[O-]"
} |
Can you make molecule CCN(CC)S(=O)(=O)c1ccc2nc(-c3ccncc3)cc(C(=O)[O-])c2c1 less soluble in water? The output molecule should be similar to the input molecule. | CCN(CC)S(=O)(=O)c1ccc2nc(-c3ccncc3)cc(CCCS(=O)(=O)[O-])c2c1 | CCN(CC)S(=O)(=O)c1ccc2nc(-c3ccncc3)cc(C(=O)[O-])c2c1 | CCN(CC)S(=O)(=O)c1ccc2nc(-c3ccncc3)cc(CCCS(=O)(=O)[O-])c2c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCS(=O)(=O)[O-]",
"old_substring": "C7(=O)[O-]"
} |
Can you make molecule CCCN(CC)c1cc[nH+]c(C(=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | CCCN(CC)c1cc[nH+]c(CCS(=O)(=O)[O-])c1 | CCCN(CC)c1cc[nH+]c(C(=O)[O-])c1 | CCCN(CC)c1cc[nH+]c(CCS(=O)(=O)[O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CS(=O)(=O)[O-]",
"old_substring": "C5(=O)[O-]"
} |
Can you make molecule CCCN(CC)c1cc[nH+]c(C(=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | CCCN(CC)c1cc[nH+]c(C(=O)CO)c1 | CCCN(CC)c1cc[nH+]c(C(=O)[O-])c1 | CCCN(CC)c1cc[nH+]c(C(=O)CO)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CO",
"old_substring": "C5(=O)[O-]"
} |
Can you make molecule CCCN(CC)c1cc[nH+]c(C(=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | CCCN(CC)c1cc[nH+]c(C(O)O)c1 | CCCN(CC)c1cc[nH+]c(C(=O)[O-])c1 | CCCN(CC)c1cc[nH+]c(C(O)O)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(O)O",
"old_substring": "C5(=O)[O-]"
} |
Can you make molecule CCCN(CC)c1cc[nH+]c(C(=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | CCCN(CC)c1cc[nH+]c(C(CC)(CC)C(=O)[O-])c1 | CCCN(CC)c1cc[nH+]c(C(=O)[O-])c1 | CCCN(CC)c1cc[nH+]c(C(CC)(CC)C(=O)[O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC&(CC)C(=O)[O-]",
"old_substring": "C5(=O)[O-]"
} |
Can you make molecule CCCN(CC)c1cc[nH+]c(C(=O)[O-])c1 less soluble in water? The output molecule should be similar to the input molecule. | CCCN(CC)c1cc[nH+]c(CCCS(=O)(=O)[O-])c1 | CCCN(CC)c1cc[nH+]c(C(=O)[O-])c1 | CCCN(CC)c1cc[nH+]c(CCCS(=O)(=O)[O-])c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCS(=O)(=O)[O-]",
"old_substring": "C5(=O)[O-]"
} |
Can you make molecule Cc1ccccc1N1C(=O)C[C@H]([NH+](C2CCCCC2)C2CCCCC2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1N1C(=O)C[C@H]([NH+](C2CCCCCCC2)C2CCCCC2)C1=O | Cc1ccccc1N1C(=O)C[C@H]([NH+](C2CCCCC2)C2CCCCC2)C1=O | Cc1ccccc1N1C(=O)C[C@H]([NH+](C2CCCCCCC2)C2CCCCC2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCC1",
"old_substring": "C15CCCCC1"
} |
Can you make molecule Cc1ccccc1N1C(=O)C[C@H]([NH+](C2CCCCC2)C2CCCCC2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1N1C(=O)C[C@H]([NH+](SC2=CCCCCC2)C2CCCCC2)C1=O | Cc1ccccc1N1C(=O)C[C@H]([NH+](C2CCCCC2)C2CCCCC2)C1=O | Cc1ccccc1N1C(=O)C[C@H]([NH+](SC2=CCCCCC2)C2CCCCC2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C1=C(S&)CCCCC1",
"old_substring": "C15CCCCC1"
} |
Can you make molecule Cc1ccccc1N1C(=O)C[C@H]([NH+](C2CCCCC2)C2CCCCC2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1N1C(=O)C[C@H]([NH+](C2CCCCCCCCCCC2)C2CCCCC2)C1=O | Cc1ccccc1N1C(=O)C[C@H]([NH+](C2CCCCC2)C2CCCCC2)C1=O | Cc1ccccc1N1C(=O)C[C@H]([NH+](C2CCCCCCCCCCC2)C2CCCCC2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C1&CCCCCCCCCCC1",
"old_substring": "C15CCCCC1"
} |
Can you make molecule Cc1ccccc1N1C(=O)C[C@H]([NH+](C2CCCCC2)C2CCCCC2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1N1C(=O)C[C@H]([NH+](C2CCCCC2)C2(C#N)CCCCCCC2)C1=O | Cc1ccccc1N1C(=O)C[C@H]([NH+](C2CCCCC2)C2CCCCC2)C1=O | Cc1ccccc1N1C(=O)C[C@H]([NH+](C2CCCCC2)C2(C#N)CCCCCCC2)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C1&(C#N)CCCCCCC1",
"old_substring": "C15CCCCC1"
} |
Can you make molecule Cc1ccccc1N1C(=O)C[C@H]([NH+](C2CCCCC2)C2CCCCC2)C1=O less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccccc1N1C(=O)C[C@H]([NH+](C2CCCCC2)C2C3=CC=CC=C2CCCC3)C1=O | Cc1ccccc1N1C(=O)C[C@H]([NH+](C2CCCCC2)C2CCCCC2)C1=O | Cc1ccccc1N1C(=O)C[C@H]([NH+](C2CCCCC2)C2C3=CC=CC=C2CCCC3)C1=O | 102 | {
"fragment_index": 0,
"new_substring": "C1&C2=CC=CC=C1CCCC2",
"old_substring": "C15CCCCC1"
} |
Can you make molecule CS(=O)(=O)[C@H]1O[C@H]1c1ccc(Cl)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)Sc1ccc(Cl)cc1Cl | CS(=O)(=O)[C@H]1O[C@H]1c1ccc(Cl)cc1Cl | CS(=O)(=O)Sc1ccc(Cl)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "CS(=O)(=O)S&",
"old_substring": "CS(=O)(=O)[C@H]1O[C@H]12"
} |
Can you make molecule CS(=O)(=O)[C@H]1O[C@H]1c1ccc(Cl)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | CS(=O)(=O)c1ccc(-c2ccc(Cl)cc2Cl)cn1 | CS(=O)(=O)[C@H]1O[C@H]1c1ccc(Cl)cc1Cl | CS(=O)(=O)c1ccc(-c2ccc(Cl)cc2Cl)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "CS(=O)(=O)c1ccc&cn1",
"old_substring": "CS(=O)(=O)[C@H]1O[C@H]12"
} |
Can you make molecule CS(=O)(=O)[C@H]1O[C@H]1c1ccc(Cl)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1NN[C@H](c2ccc(Cl)cc2Cl)S1 | CS(=O)(=O)[C@H]1O[C@H]1c1ccc(Cl)cc1Cl | C[C@H]1NN[C@H](c2ccc(Cl)cc2Cl)S1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1NN[C@H]&S1",
"old_substring": "CS(=O)(=O)[C@H]1O[C@H]12"
} |
Can you make molecule CS(=O)(=O)[C@H]1O[C@H]1c1ccc(Cl)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | C[C@H]1CN[C@H](c2ccc(Cl)cc2Cl)S1 | CS(=O)(=O)[C@H]1O[C@H]1c1ccc(Cl)cc1Cl | C[C@H]1CN[C@H](c2ccc(Cl)cc2Cl)S1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]1CN[C@H]&S1",
"old_substring": "CS(=O)(=O)[C@H]1O[C@H]12"
} |
Can you make molecule CS(=O)(=O)[C@H]1O[C@H]1c1ccc(Cl)cc1Cl less soluble in water? The output molecule should be similar to the input molecule. | CC(C)(C)[C@@H](O)c1ccc(Cl)cc1Cl | CS(=O)(=O)[C@H]1O[C@H]1c1ccc(Cl)cc1Cl | CC(C)(C)[C@@H](O)c1ccc(Cl)cc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)(C)[C@H]&O",
"old_substring": "CS(=O)(=O)[C@H]1O[C@H]12"
} |
Can you make molecule C[C@H](CSc1ccc(C(=O)N(C)C)cn1)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C(=O)c1ccc(SC[C@@H](C)C(=O)[O-])nc1 | C[C@H](CSc1ccc(C(=O)N(C)C)cn1)C(=O)[O-] | CC(C)C(=O)c1ccc(SC[C@@H](C)C(=O)[O-])nc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "N2(C)C"
} |
Can you make molecule C[C@H](CSc1ccc(C(=O)N(C)C)cn1)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CSc1ccc(C(=O)CC(=N)S)cn1)C(=O)[O-] | C[C@H](CSc1ccc(C(=O)N(C)C)cn1)C(=O)[O-] | C[C@H](CSc1ccc(C(=O)CC(=N)S)cn1)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "N=C(S)C&",
"old_substring": "N2(C)C"
} |
Can you make molecule C[C@H](CSc1ccc(C(=O)N(C)C)cn1)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CSc1ccc(C(=O)N(C)C2=CCCC2)cn1)C(=O)[O-] | C[C@H](CSc1ccc(C(=O)N(C)C)cn1)C(=O)[O-] | C[C@H](CSc1ccc(C(=O)N(C)C2=CCCC2)cn1)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "N&(C)C1=CCCC1",
"old_substring": "N2(C)C"
} |
Can you make molecule C[C@H](CSc1ccc(C(=O)N(C)C)cn1)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CSc1ccc(C(=O)C(F)(F)C#N)cn1)C(=O)[O-] | C[C@H](CSc1ccc(C(=O)N(C)C)cn1)C(=O)[O-] | C[C@H](CSc1ccc(C(=O)C(F)(F)C#N)cn1)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "N#CC&(F)F",
"old_substring": "N2(C)C"
} |
Can you make molecule C[C@H](CSc1ccc(C(=O)N(C)C)cn1)C(=O)[O-] less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CSc1ccc(C(=O)c2c3c(nn2C)CCC3)cn1)C(=O)[O-] | C[C@H](CSc1ccc(C(=O)N(C)C)cn1)C(=O)[O-] | C[C@H](CSc1ccc(C(=O)c2c3c(nn2C)CCC3)cn1)C(=O)[O-] | 102 | {
"fragment_index": 0,
"new_substring": "c1&c2c(nn1C)CCC2",
"old_substring": "N2(C)C"
} |
Can you make molecule CCOC(=O)[C@H]1C=C(C#N)O[C@@H](c2ccc(C)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C=CSOC(=O)[C@H]1C=C(C#N)O[C@@H](c2ccc(C)cc2)C1 | CCOC(=O)[C@H]1C=C(C#N)O[C@@H](c2ccc(C)cc2)C1 | C=CSOC(=O)[C@H]1C=C(C#N)O[C@@H](c2ccc(C)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC4"
} |
Can you make molecule CCOC(=O)[C@H]1C=C(C#N)O[C@@H](c2ccc(C)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCOC(=O)[C@H]1C=C(C#N)O[C@@H](c2ccc(C)cc2)C1 | CCOC(=O)[C@H]1C=C(C#N)O[C@@H](c2ccc(C)cc2)C1 | C=CCCOC(=O)[C@H]1C=C(C#N)O[C@@H](c2ccc(C)cc2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC4"
} |
Can you make molecule CCOC(=O)[C@H]1C=C(C#N)O[C@@H](c2ccc(C)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@H]2C[C@@H](C(=O)OCCCCl)C=C(C#N)O2)cc1 | CCOC(=O)[C@H]1C=C(C#N)O[C@@H](c2ccc(C)cc2)C1 | Cc1ccc([C@H]2C[C@@H](C(=O)OCCCCl)C=C(C#N)O2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC4"
} |
Can you make molecule CCOC(=O)[C@H]1C=C(C#N)O[C@@H](c2ccc(C)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@H]2C[C@@H](C(=O)OCCCCS)C=C(C#N)O2)cc1 | CCOC(=O)[C@H]1C=C(C#N)O[C@@H](c2ccc(C)cc2)C1 | Cc1ccc([C@H]2C[C@@H](C(=O)OCCCCS)C=C(C#N)O2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC4"
} |
Can you make molecule CCOC(=O)[C@H]1C=C(C#N)O[C@@H](c2ccc(C)cc2)C1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc([C@H]2C[C@@H](C(=O)OCCCBr)C=C(C#N)O2)cc1 | CCOC(=O)[C@H]1C=C(C#N)O[C@@H](c2ccc(C)cc2)C1 | Cc1ccc([C@H]2C[C@@H](C(=O)OCCCBr)C=C(C#N)O2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC4"
} |
Can you make molecule CCC[NH2+]C1CCC(O)(Cc2nc(C)cs2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCC1(C2CCC(O)(Cc3nc(C)cs3)CC2)CC[NH2+]C1 | CCC[NH2+]C1CCC(O)(Cc2nc(C)cs2)CC1 | CCCC1(C2CCC(O)(Cc3nc(C)cs3)CC2)CC[NH2+]C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC&&C1",
"old_substring": "[NH2+]34"
} |
Can you make molecule CCC[NH2+]C1CCC(O)(Cc2nc(C)cs2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCC[C@]1(C2CCC(O)(Cc3nc(C)cs3)CC2)CCC[NH2+]C1 | CCC[NH2+]C1CCC(O)(Cc2nc(C)cs2)CC1 | CCC[C@]1(C2CCC(O)(Cc3nc(C)cs3)CC2)CCC[NH2+]C1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC[C@]&&C1",
"old_substring": "[NH2+]34"
} |
Can you make molecule CCC[NH2+]C1CCC(O)(Cc2nc(C)cs2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCn1c[nH+]cc1C1CCC(O)(Cc2nc(C)cs2)CC1 | CCC[NH2+]C1CCC(O)(Cc2nc(C)cs2)CC1 | CCCn1c[nH+]cc1C1CCC(O)(Cc2nc(C)cs2)CC1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]cn&c1&",
"old_substring": "[NH2+]34"
} |
Can you make molecule CCC[NH2+]C1CCC(O)(Cc2nc(C)cs2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCc1cc(C2CCC(O)(Cc3nc(C)cs3)CC2)[nH][nH+]1 | CCC[NH2+]C1CCC(O)(Cc2nc(C)cs2)CC1 | CCCc1cc(C2CCC(O)(Cc3nc(C)cs3)CC2)[nH][nH+]1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&[nH+]c&cc1&",
"old_substring": "[NH2+]34"
} |
Can you make molecule CCC[NH2+]C1CCC(O)(Cc2nc(C)cs2)CC1 less soluble in water? The output molecule should be similar to the input molecule. | CCCc1c(C2CCC(O)(Cc3nc(C)cs3)CC2)c[nH+]n1C | CCC[NH2+]C1CCC(O)(Cc2nc(C)cs2)CC1 | CCCc1c(C2CCC(O)(Cc3nc(C)cs3)CC2)c[nH+]n1C | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]n(C)c&c1&",
"old_substring": "[NH2+]34"
} |
Can you make molecule O=C1c2ccccc2N[C@H](CSC2=NC=NC3=NC=N[C@@H]32)N1c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1c2ccccc2N[C@H](CSC2=NC=NC3=NC=N[C@@H]32)N1c1ccc(Cl)cc1I | O=C1c2ccccc2N[C@H](CSC2=NC=NC3=NC=N[C@@H]32)N1c1ccc(Cl)cc1 | O=C1c2ccccc2N[C@H](CSC2=NC=NC3=NC=N[C@@H]32)N1c1ccc(Cl)cc1I | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1I",
"old_substring": "c16ccc(Cl)cc1"
} |
Can you make molecule O=C1c2ccccc2N[C@H](CSC2=NC=NC3=NC=N[C@@H]32)N1c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1c2ccccc2N[C@H](CSC2=NC=NC3=NC=N[C@@H]32)N1c1ccc(Cl)cc1Br | O=C1c2ccccc2N[C@H](CSC2=NC=NC3=NC=N[C@@H]32)N1c1ccc(Cl)cc1 | O=C1c2ccccc2N[C@H](CSC2=NC=NC3=NC=N[C@@H]32)N1c1ccc(Cl)cc1Br | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)cc1Br",
"old_substring": "c16ccc(Cl)cc1"
} |
Can you make molecule O=C1c2ccccc2N[C@H](CSC2=NC=NC3=NC=N[C@@H]32)N1c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1c2ccccc2N[C@H](CSC2=NC=NC3=NC=N[C@@H]32)N1c1ccc(Cl)c(I)c1 | O=C1c2ccccc2N[C@H](CSC2=NC=NC3=NC=N[C@@H]32)N1c1ccc(Cl)cc1 | O=C1c2ccccc2N[C@H](CSC2=NC=NC3=NC=N[C@@H]32)N1c1ccc(Cl)c(I)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(I)c1",
"old_substring": "c16ccc(Cl)cc1"
} |
Can you make molecule O=C1c2ccccc2N[C@H](CSC2=NC=NC3=NC=N[C@@H]32)N1c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1c2ccccc2N[C@H](CSC2=NC=NC3=NC=N[C@@H]32)N1c1cc(Cl)ccc1Cl | O=C1c2ccccc2N[C@H](CSC2=NC=NC3=NC=N[C@@H]32)N1c1ccc(Cl)cc1 | O=C1c2ccccc2N[C@H](CSC2=NC=NC3=NC=N[C@@H]32)N1c1cc(Cl)ccc1Cl | 102 | {
"fragment_index": 0,
"new_substring": "Clc1ccc(Cl)c&c1",
"old_substring": "c16ccc(Cl)cc1"
} |
Can you make molecule O=C1c2ccccc2N[C@H](CSC2=NC=NC3=NC=N[C@@H]32)N1c1ccc(Cl)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1c2ccccc2N[C@H](CSC2=NC=NC3=NC=N[C@@H]32)N1c1ccc(Cl)c(Cl)c1 | O=C1c2ccccc2N[C@H](CSC2=NC=NC3=NC=N[C@@H]32)N1c1ccc(Cl)cc1 | O=C1c2ccccc2N[C@H](CSC2=NC=NC3=NC=N[C@@H]32)N1c1ccc(Cl)c(Cl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc(Cl)c(Cl)c1",
"old_substring": "c16ccc(Cl)cc1"
} |
Can you make molecule CCc1nc2ccccc2c(C(=O)NCc2ccc(OC)c(C(=O)OC)c2)c1C less soluble in water? The output molecule should be similar to the input molecule. | CCc1nc2ccccc2c(C(=O)NCc2ccc(OC)c(CC(=O)SOC)c2)c1C | CCc1nc2ccccc2c(C(=O)NCc2ccc(OC)c(C(=O)OC)c2)c1C | CCc1nc2ccccc2c(C(=O)NCc2ccc(OC)c(CC(=O)SOC)c2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C38=O"
} |
Can you make molecule CCc1nc2ccccc2c(C(=O)NCc2ccc(OC)c(C(=O)OC)c2)c1C less soluble in water? The output molecule should be similar to the input molecule. | CCc1nc2ccccc2c(C(=O)NCc2ccc(OC)c(C(=O)CCCC(=O)OC)c2)c1C | CCc1nc2ccccc2c(C(=O)NCc2ccc(OC)c(C(=O)OC)c2)c1C | CCc1nc2ccccc2c(C(=O)NCc2ccc(OC)c(C(=O)CCCC(=O)OC)c2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C38=O"
} |
Can you make molecule CCc1nc2ccccc2c(C(=O)NCc2ccc(OC)c(C(=O)OC)c2)c1C less soluble in water? The output molecule should be similar to the input molecule. | CCc1nc2ccccc2c(C(=O)NCc2ccc(OC)c(C(C)(C)CC(=O)OC)c2)c1C | CCc1nc2ccccc2c(C(=O)NCc2ccc(OC)c(C(=O)OC)c2)c1C | CCc1nc2ccccc2c(C(=O)NCc2ccc(OC)c(C(C)(C)CC(=O)OC)c2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C38=O"
} |
Can you make molecule CCc1nc2ccccc2c(C(=O)NCc2ccc(OC)c(C(=O)OC)c2)c1C less soluble in water? The output molecule should be similar to the input molecule. | CCc1nc2ccccc2c(C(=O)NCc2ccc(OC)c(C(C)(C)CCC(=O)OC)c2)c1C | CCc1nc2ccccc2c(C(=O)NCc2ccc(OC)c(C(=O)OC)c2)c1C | CCc1nc2ccccc2c(C(=O)NCc2ccc(OC)c(C(C)(C)CCC(=O)OC)c2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C38=O"
} |
Can you make molecule CCc1nc2ccccc2c(C(=O)NCc2ccc(OC)c(C(=O)OC)c2)c1C less soluble in water? The output molecule should be similar to the input molecule. | CCc1nc2ccccc2c(C(=O)NCc2ccc(OC)c([C@H](C)C(=O)SOC)c2)c1C | CCc1nc2ccccc2c(C(=O)NCc2ccc(OC)c(C(=O)OC)c2)c1C | CCc1nc2ccccc2c(C(=O)NCc2ccc(OC)c([C@H](C)C(=O)SOC)c2)c1C | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C38=O"
} |
Can you make molecule Cc1nn(-c2nncc(-c3ccc(Cl)cc3)n2)c2c1[C@H](c1ccccc1)CC(=O)N2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(-c2nn3cc(-c4ccc(Cl)cc4)nc3s2)c2c1[C@H](c1ccccc1)CC(=O)N2 | Cc1nn(-c2nncc(-c3ccc(Cl)cc3)n2)c2c1[C@H](c1ccccc1)CC(=O)N2 | Cc1nn(-c2nn3cc(-c4ccc(Cl)cc4)nc3s2)c2c1[C@H](c1ccccc1)CC(=O)N2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nn2cc&nc2s1",
"old_substring": "c14nncc5n1"
} |
Can you make molecule Cc1nn(-c2nncc(-c3ccc(Cl)cc3)n2)c2c1[C@H](c1ccccc1)CC(=O)N2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(-c2nnc3scc(-c4ccc(Cl)cc4)n23)c2c1[C@H](c1ccccc1)CC(=O)N2 | Cc1nn(-c2nncc(-c3ccc(Cl)cc3)n2)c2c1[C@H](c1ccccc1)CC(=O)N2 | Cc1nn(-c2nnc3scc(-c4ccc(Cl)cc4)n23)c2c1[C@H](c1ccccc1)CC(=O)N2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nnc2scc&n12",
"old_substring": "c14nncc5n1"
} |
Can you make molecule Cc1nn(-c2nncc(-c3ccc(Cl)cc3)n2)c2c1[C@H](c1ccccc1)CC(=O)N2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(-c2nnc3sc(-c4ccc(Cl)cc4)cn23)c2c1[C@H](c1ccccc1)CC(=O)N2 | Cc1nn(-c2nncc(-c3ccc(Cl)cc3)n2)c2c1[C@H](c1ccccc1)CC(=O)N2 | Cc1nn(-c2nnc3sc(-c4ccc(Cl)cc4)cn23)c2c1[C@H](c1ccccc1)CC(=O)N2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nnc2sc&cn12",
"old_substring": "c14nncc5n1"
} |
Can you make molecule Cc1nn(-c2nncc(-c3ccc(Cl)cc3)n2)c2c1[C@H](c1ccccc1)CC(=O)N2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(-c2nnc(-c3ccc(Cl)cc3)c3cccn23)c2c1[C@H](c1ccccc1)CC(=O)N2 | Cc1nn(-c2nncc(-c3ccc(Cl)cc3)n2)c2c1[C@H](c1ccccc1)CC(=O)N2 | Cc1nn(-c2nnc(-c3ccc(Cl)cc3)c3cccn23)c2c1[C@H](c1ccccc1)CC(=O)N2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nnc&c2cccn12",
"old_substring": "c14nncc5n1"
} |
Can you make molecule Cc1nn(-c2nncc(-c3ccc(Cl)cc3)n2)c2c1[C@H](c1ccccc1)CC(=O)N2 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nn(-c2nnc3ccc(-c4ccc(Cl)cc4)cn23)c2c1[C@H](c1ccccc1)CC(=O)N2 | Cc1nn(-c2nncc(-c3ccc(Cl)cc3)n2)c2c1[C@H](c1ccccc1)CC(=O)N2 | Cc1nn(-c2nnc3ccc(-c4ccc(Cl)cc4)cn23)c2c1[C@H](c1ccccc1)CC(=O)N2 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nnc2ccc&cn12",
"old_substring": "c14nncc5n1"
} |
Can you make molecule CC(C)NC(=O)Nc1cccc(C(=O)N(C)Cc2nnc(C3CC3)n2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)SCNC(=O)Nc1cccc(C(=O)N(C)Cc2nnc(C3CC3)n2C)c1 | CC(C)NC(=O)Nc1cccc(C(=O)N(C)Cc2nnc(C3CC3)n2C)c1 | CC(C)SCNC(=O)Nc1cccc(C(=O)N(C)Cc2nnc(C3CC3)n2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N&CS&",
"old_substring": "N47"
} |
Can you make molecule CC(C)NC(=O)Nc1cccc(C(=O)N(C)Cc2nnc(C3CC3)n2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)C1CN(C(=O)Nc2cccc(C(=O)N(C)Cc3nnc(C4CC4)n3C)c2)C1 | CC(C)NC(=O)Nc1cccc(C(=O)N(C)Cc2nnc(C3CC3)n2C)c1 | CC(C)C1CN(C(=O)Nc2cccc(C(=O)N(C)Cc3nnc(C4CC4)n3C)c2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "N1&CC&C1",
"old_substring": "N47"
} |
Can you make molecule CC(C)NC(=O)Nc1cccc(C(=O)N(C)Cc2nnc(C3CC3)n2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)SC(=N)NC(=O)Nc1cccc(C(=O)N(C)Cc2nnc(C3CC3)n2C)c1 | CC(C)NC(=O)Nc1cccc(C(=O)N(C)Cc2nnc(C3CC3)n2C)c1 | CC(C)SC(=N)NC(=O)Nc1cccc(C(=O)N(C)Cc2nnc(C3CC3)n2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=N)S&",
"old_substring": "N47"
} |
Can you make molecule CC(C)NC(=O)Nc1cccc(C(=O)N(C)Cc2nnc(C3CC3)n2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)SC(=S)N(C)C(=O)Nc1cccc(C(=O)N(C)Cc2nnc(C3CC3)n2C)c1 | CC(C)NC(=O)Nc1cccc(C(=O)N(C)Cc2nnc(C3CC3)n2C)c1 | CC(C)SC(=S)N(C)C(=O)Nc1cccc(C(=O)N(C)Cc2nnc(C3CC3)n2C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N47"
} |
Can you make molecule CC(C)NC(=O)Nc1cccc(C(=O)N(C)Cc2nnc(C3CC3)n2C)c1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)c1cc(C(=O)Nc2cccc(C(=O)N(C)Cc3nnc(C4CC4)n3C)c2)oc1N | CC(C)NC(=O)Nc1cccc(C(=O)N(C)Cc2nnc(C3CC3)n2C)c1 | CC(C)c1cc(C(=O)Nc2cccc(C(=O)N(C)Cc3nnc(C4CC4)n3C)c2)oc1N | 102 | {
"fragment_index": 0,
"new_substring": "Nc1oc&cc1&",
"old_substring": "N47"
} |
Can you make molecule Cc1nnccc1C(=O)N[C@H](C)c1ccc(Cl)s1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CCc1ccc(Cl)s1)NC(=O)c1ccnnc1C | Cc1nnccc1C(=O)N[C@H](C)c1ccc(Cl)s1 | CC[C@@H](CCc1ccc(Cl)s1)NC(=O)c1ccnnc1C | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CC)CC&",
"old_substring": "[C@H]35C"
} |
Can you make molecule Cc1nnccc1C(=O)N[C@H](C)c1ccc(Cl)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nnccc1C(=O)N[C@@H](CBr)CCc1ccc(Cl)s1 | Cc1nnccc1C(=O)N[C@H](C)c1ccc(Cl)s1 | Cc1nnccc1C(=O)N[C@@H](CBr)CCc1ccc(Cl)s1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CC&",
"old_substring": "[C@H]35C"
} |
Can you make molecule Cc1nnccc1C(=O)N[C@H](C)c1ccc(Cl)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nnccc1C(=O)N[C@@H](CBr)CCCc1ccc(Cl)s1 | Cc1nnccc1C(=O)N[C@H](C)c1ccc(Cl)s1 | Cc1nnccc1C(=O)N[C@@H](CBr)CCCc1ccc(Cl)s1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]&(CBr)CCC&",
"old_substring": "[C@H]35C"
} |
Can you make molecule Cc1nnccc1C(=O)N[C@H](C)c1ccc(Cl)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nnccc1C(=O)N[C@H](CCl)CCCc1ccc(Cl)s1 | Cc1nnccc1C(=O)N[C@H](C)c1ccc(Cl)s1 | Cc1nnccc1C(=O)N[C@H](CCl)CCCc1ccc(Cl)s1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@@H]&(CCl)CCC&",
"old_substring": "[C@H]35C"
} |
Can you make molecule Cc1nnccc1C(=O)N[C@H](C)c1ccc(Cl)s1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1nnccc1C(=O)N[C@H]1CCC[C@H](c2ccc(Cl)s2)C1 | Cc1nnccc1C(=O)N[C@H](C)c1ccc(Cl)s1 | Cc1nnccc1C(=O)N[C@H]1CCC[C@H](c2ccc(Cl)s2)C1 | 102 | {
"fragment_index": 0,
"new_substring": "[C@H]1&CCC[C@H]&C1",
"old_substring": "[C@H]35C"
} |
Can you make molecule O=C(NCCCc1nc(-c2ccc(Br)o2)no1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/SC1CC1)NCCCc1nc(-c2ccc(Br)o2)no1 | O=C(NCCCc1nc(-c2ccc(Br)o2)no1)C1CC1 | O=C(/C=C/SC1CC1)NCCCc1nc(-c2ccc(Br)o2)no1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(NCCCc1nc(-c2ccc(Br)o2)no1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1sc(NCCCc2nc(-c3ccc(Br)o3)no2)nc1C1CC1 | O=C(NCCCc1nc(-c2ccc(Br)o2)no1)C1CC1 | O=Cc1sc(NCCCc2nc(-c3ccc(Br)o3)no2)nc1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1sc&nc1&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(NCCCc1nc(-c2ccc(Br)o2)no1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=Cc1nc(NCCCc2nc(-c3ccc(Br)o3)no2)sc1C1CC1 | O=C(NCCCc1nc(-c2ccc(Br)o2)no1)C1CC1 | O=Cc1nc(NCCCc2nc(-c3ccc(Br)o3)no2)sc1C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=Cc1nc&sc1&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(NCCCc1nc(-c2ccc(Br)o2)no1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NCCCc1nc(-c2ccc(Br)o2)no1)N/N=C/CC1CC1 | O=C(NCCCc1nc(-c2ccc(Br)o2)no1)C1CC1 | O=C(NCCCc1nc(-c2ccc(Br)o2)no1)N/N=C/CC1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&N/N=C/C&",
"old_substring": "O=C35"
} |
Can you make molecule O=C(NCCCc1nc(-c2ccc(Br)o2)no1)C1CC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C(=NCCCc2nc(-c3ccc(Br)o3)no2)CCC1=C1CC1 | O=C(NCCCc1nc(-c2ccc(Br)o2)no1)C1CC1 | O=C1C(=NCCCc2nc(-c3ccc(Br)o3)no2)CCC1=C1CC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C1C=&CCC1=&",
"old_substring": "O=C35"
} |
Can you make molecule CCOc1cccc(NC(=O)CCc2ccc(N)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C=CSOc1cccc(NC(=O)CCc2ccc(N)cc2)c1 | CCOc1cccc(NC(=O)CCc2ccc(N)cc2)c1 | C=CSOc1cccc(NC(=O)CCc2ccc(N)cc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CS&",
"old_substring": "CC4"
} |
Can you make molecule CCOc1cccc(NC(=O)CCc2ccc(N)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCOc1cccc(NC(=O)CCc2ccc(N)cc2)c1 | CCOc1cccc(NC(=O)CCc2ccc(N)cc2)c1 | C=CCCOc1cccc(NC(=O)CCc2ccc(N)cc2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC4"
} |
Can you make molecule CCOc1cccc(NC(=O)CCc2ccc(N)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1ccc(CCC(=O)Nc2cccc(OCCCCl)c2)cc1 | CCOc1cccc(NC(=O)CCc2ccc(N)cc2)c1 | Nc1ccc(CCC(=O)Nc2cccc(OCCCCl)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC4"
} |
Can you make molecule CCOc1cccc(NC(=O)CCc2ccc(N)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1ccc(CCC(=O)Nc2cccc(OCCCCS)c2)cc1 | CCOc1cccc(NC(=O)CCc2ccc(N)cc2)c1 | Nc1ccc(CCC(=O)Nc2cccc(OCCCCS)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC4"
} |
Can you make molecule CCOc1cccc(NC(=O)CCc2ccc(N)cc2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Nc1ccc(CCC(=O)Nc2cccc(OCCCBr)c2)cc1 | CCOc1cccc(NC(=O)CCc2ccc(N)cc2)c1 | Nc1ccc(CCC(=O)Nc2cccc(OCCCBr)c2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC4"
} |
Can you make molecule COc1ccc(C=C2SC(=O)N(CC(=O)Nc3ccc(F)cc3)C2=O)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C=C2SC(C=CC(=O)Nc3ccc(F)cc3)=NC2=O)cc1OC | COc1ccc(C=C2SC(=O)N(CC(=O)Nc3ccc(F)cc3)C2=O)cc1OC | COc1ccc(C=C2SC(C=CC(=O)Nc3ccc(F)cc3)=NC2=O)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "C1=&SC(C=&)=NC1=O",
"old_substring": "C1=8SC(=O)N9C1=O"
} |
Can you make molecule COc1ccc(C=C2SC(=O)N(CC(=O)Nc3ccc(F)cc3)C2=O)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C=CC2=CN=N[C@H]2CC(=O)Nc2ccc(F)cc2)cc1OC | COc1ccc(C=C2SC(=O)N(CC(=O)Nc3ccc(F)cc3)C2=O)cc1OC | COc1ccc(C=CC2=CN=N[C@H]2CC(=O)Nc2ccc(F)cc2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "C1=C(C&)[C@H]&N=N1",
"old_substring": "C1=8SC(=O)N9C1=O"
} |
Can you make molecule COc1ccc(C=C2SC(=O)N(CC(=O)Nc3ccc(F)cc3)C2=O)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C=C2CC(F)(CC(=O)Nc3ccc(F)cc3)C2)cc1OC | COc1ccc(C=C2SC(=O)N(CC(=O)Nc3ccc(F)cc3)C2=O)cc1OC | COc1ccc(C=C2CC(F)(CC(=O)Nc3ccc(F)cc3)C2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "C1&CC&(F)C1",
"old_substring": "C1=8SC(=O)N9C1=O"
} |
Can you make molecule COc1ccc(C=C2SC(=O)N(CC(=O)Nc3ccc(F)cc3)C2=O)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C=NC(=S)N2CCC(CC(=O)Nc3ccc(F)cc3)CC2)cc1OC | COc1ccc(C=C2SC(=O)N(CC(=O)Nc3ccc(F)cc3)C2=O)cc1OC | COc1ccc(C=NC(=S)N2CCC(CC(=O)Nc3ccc(F)cc3)CC2)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=S)N1CCC&CC1",
"old_substring": "C1=8SC(=O)N9C1=O"
} |
Can you make molecule COc1ccc(C=C2SC(=O)N(CC(=O)Nc3ccc(F)cc3)C2=O)cc1OC less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C=C2CSCC(=CC(=O)Nc3ccc(F)cc3)C2=O)cc1OC | COc1ccc(C=C2SC(=O)N(CC(=O)Nc3ccc(F)cc3)C2=O)cc1OC | COc1ccc(C=C2CSCC(=CC(=O)Nc3ccc(F)cc3)C2=O)cc1OC | 102 | {
"fragment_index": 0,
"new_substring": "C1=&CSCC=&C1=O",
"old_substring": "C1=8SC(=O)N9C1=O"
} |
Can you make molecule CC(C)N(C)C(=O)[C@H]1CSCN1C(=O)/C=C/SCc1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)N(C)C(=O)[C@H]1CSCN1C(=O)/N=c1/sccn1Cc1ccco1 | CC(C)N(C)C(=O)[C@H]1CSCN1C(=O)/C=C/SCc1ccco1 | CC(C)N(C)C(=O)[C@H]1CSCN1C(=O)/N=c1/sccn1Cc1ccco1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)/N=c1/sccn1&",
"old_substring": "C3(=O)/C=C/S5"
} |
Can you make molecule CC(C)N(C)C(=O)[C@H]1CSCN1C(=O)/C=C/SCc1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)N(C)C(=O)[C@H]1CSCN1C(=O)CCC(C)(C)Cc1ccco1 | CC(C)N(C)C(=O)[C@H]1CSCN1C(=O)/C=C/SCc1ccco1 | CC(C)N(C)C(=O)[C@H]1CSCN1C(=O)CCC(C)(C)Cc1ccco1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C3(=O)/C=C/S5"
} |
Can you make molecule CC(C)N(C)C(=O)[C@H]1CSCN1C(=O)/C=C/SCc1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)N(C)C(=O)[C@H]1CSCN1C(=O)C(C)(C)CCCCc1ccco1 | CC(C)N(C)C(=O)[C@H]1CSCN1C(=O)/C=C/SCc1ccco1 | CC(C)N(C)C(=O)[C@H]1CSCN1C(=O)C(C)(C)CCCCc1ccco1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(C)(C)CCC&",
"old_substring": "C3(=O)/C=C/S5"
} |
Can you make molecule CC(C)N(C)C(=O)[C@H]1CSCN1C(=O)/C=C/SCc1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)N(C)C(=O)[C@H]1CSCN1C(=O)C(CCc1ccco1)=C(Cl)Cl | CC(C)N(C)C(=O)[C@H]1CSCN1C(=O)/C=C/SCc1ccco1 | CC(C)N(C)C(=O)[C@H]1CSCN1C(=O)C(CCc1ccco1)=C(Cl)Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(C&)=C(Cl)Cl",
"old_substring": "C3(=O)/C=C/S5"
} |
Can you make molecule CC(C)N(C)C(=O)[C@H]1CSCN1C(=O)/C=C/SCc1ccco1 less soluble in water? The output molecule should be similar to the input molecule. | CC(C)N(C)C(=O)[C@H]1CSCN1C(=O)C(C)(C)C(C)(C)Cc1ccco1 | CC(C)N(C)C(=O)[C@H]1CSCN1C(=O)/C=C/SCc1ccco1 | CC(C)N(C)C(=O)[C@H]1CSCN1C(=O)C(C)(C)C(C)(C)Cc1ccco1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(C)(C)C&(C)C",
"old_substring": "C3(=O)/C=C/S5"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.