prompt stringlengths 120 209 | completion stringlengths 15 103 | input_smiles stringlengths 14 103 | output_smiles stringlengths 15 103 | task_id int64 102 102 | winner_action dict |
|---|---|---|---|---|---|
Can you make molecule CCC1(CC)[C@@H](NC(=O)Nc2ccc(C(=O)NC)cc2)[C@H](C)[C@@H]1OC less soluble in water? The output molecule should be similar to the input molecule. | CCC1(CC)[C@@H](NC(=O)N(C)C(=S)Sc2ccc(C(=O)NC)cc2)[C@H](C)[C@@H]1OC | CCC1(CC)[C@@H](NC(=O)Nc2ccc(C(=O)NC)cc2)[C@H](C)[C@@H]1OC | CCC1(CC)[C@@H](NC(=O)N(C)C(=S)Sc2ccc(C(=O)NC)cc2)[C@H](C)[C@@H]1OC | 102 | {
"fragment_index": 0,
"new_substring": "CN&C(=S)S&",
"old_substring": "N47"
} |
Can you make molecule CCC1(CC)[C@@H](NC(=O)Nc2ccc(C(=O)NC)cc2)[C@H](C)[C@@H]1OC less soluble in water? The output molecule should be similar to the input molecule. | CCC1(CC)[C@@H](NC(=O)N2CCN=C2Sc2ccc(C(=O)NC)cc2)[C@H](C)[C@@H]1OC | CCC1(CC)[C@@H](NC(=O)Nc2ccc(C(=O)NC)cc2)[C@H](C)[C@@H]1OC | CCC1(CC)[C@@H](NC(=O)N2CCN=C2Sc2ccc(C(=O)NC)cc2)[C@H](C)[C@@H]1OC | 102 | {
"fragment_index": 0,
"new_substring": "N1&CCN=C1S&",
"old_substring": "N47"
} |
Can you make molecule CCC1(CC)[C@@H](NC(=O)Nc2ccc(C(=O)NC)cc2)[C@H](C)[C@@H]1OC less soluble in water? The output molecule should be similar to the input molecule. | CCC1(CC)[C@@H](NC(=O)CN2CCC(c3ccc(C(=O)NC)cc3)CC2)[C@H](C)[C@@H]1OC | CCC1(CC)[C@@H](NC(=O)Nc2ccc(C(=O)NC)cc2)[C@H](C)[C@@H]1OC | CCC1(CC)[C@@H](NC(=O)CN2CCC(c3ccc(C(=O)NC)cc3)CC2)[C@H](C)[C@@H]1OC | 102 | {
"fragment_index": 0,
"new_substring": "C&N1CCC&CC1",
"old_substring": "N47"
} |
Can you make molecule CCC1(CC)[C@@H](NC(=O)Nc2ccc(C(=O)NC)cc2)[C@H](C)[C@@H]1OC less soluble in water? The output molecule should be similar to the input molecule. | CCC1(CC)[C@@H](NC(=O)c2cc(C#N)c(-c3ccc(C(=O)NC)cc3)s2)[C@H](C)[C@@H]1OC | CCC1(CC)[C@@H](NC(=O)Nc2ccc(C(=O)NC)cc2)[C@H](C)[C@@H]1OC | CCC1(CC)[C@@H](NC(=O)c2cc(C#N)c(-c3ccc(C(=O)NC)cc3)s2)[C@H](C)[C@@H]1OC | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&sc1&",
"old_substring": "N47"
} |
Can you make molecule CCC1(CC)[C@@H](NC(=O)Nc2ccc(C(=O)NC)cc2)[C@H](C)[C@@H]1OC less soluble in water? The output molecule should be similar to the input molecule. | CCC1(CC)[C@@H](NC(=O)c2ccc(-c3ccc(C(=O)NC)cc3)c(C#N)c2)[C@H](C)[C@@H]1OC | CCC1(CC)[C@@H](NC(=O)Nc2ccc(C(=O)NC)cc2)[C@H](C)[C@@H]1OC | CCC1(CC)[C@@H](NC(=O)c2ccc(-c3ccc(C(=O)NC)cc3)c(C#N)c2)[C@H](C)[C@@H]1OC | 102 | {
"fragment_index": 0,
"new_substring": "N#Cc1cc&ccc1&",
"old_substring": "N47"
} |
Can you make molecule Cc1ccc2ncc(C(=O)Nc3ncccc3OCc3ccncc3)n2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2ncc(C(=O)Nc3nccc(OCc4ccncc4)c3I)n2c1 | Cc1ccc2ncc(C(=O)Nc3ncccc3OCc3ccncc3)n2c1 | Cc1ccc2ncc(C(=O)Nc3nccc(OCc4ccncc4)c3I)n2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nccc&c1I",
"old_substring": "c17ncccc16"
} |
Can you make molecule Cc1ccc2ncc(C(=O)Nc3ncccc3OCc3ccncc3)n2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2ncc(C(=O)Nc3ncc(OCc4ccncc4)cc3Cl)n2c1 | Cc1ccc2ncc(C(=O)Nc3ncccc3OCc3ccncc3)n2c1 | Cc1ccc2ncc(C(=O)Nc3ncc(OCc4ccncc4)cc3Cl)n2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncc&cc1Cl",
"old_substring": "c17ncccc16"
} |
Can you make molecule Cc1ccc2ncc(C(=O)Nc3ncccc3OCc3ccncc3)n2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2ncc(C(=O)Nc3nc(OCc4ccncc4)ccc3Cl)n2c1 | Cc1ccc2ncc(C(=O)Nc3ncccc3OCc3ccncc3)n2c1 | Cc1ccc2ncc(C(=O)Nc3nc(OCc4ccncc4)ccc3Cl)n2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&ccc1Cl",
"old_substring": "c17ncccc16"
} |
Can you make molecule Cc1ccc2ncc(C(=O)Nc3ncccc3OCc3ccncc3)n2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2ncc(C(=O)Nc3nc(OCc4ccncc4)ccc3Br)n2c1 | Cc1ccc2ncc(C(=O)Nc3ncccc3OCc3ccncc3)n2c1 | Cc1ccc2ncc(C(=O)Nc3nc(OCc4ccncc4)ccc3Br)n2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&nc&ccc1Br",
"old_substring": "c17ncccc16"
} |
Can you make molecule Cc1ccc2ncc(C(=O)Nc3ncccc3OCc3ccncc3)n2c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1ccc2ncc(C(=O)Nc3ncc(C)c(OCc4ccncc4)c3C)n2c1 | Cc1ccc2ncc(C(=O)Nc3ncccc3OCc3ccncc3)n2c1 | Cc1ccc2ncc(C(=O)Nc3ncc(C)c(OCc4ccncc4)c3C)n2c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ncc(C)c&c1C",
"old_substring": "c17ncccc16"
} |
Can you make molecule N#Cc1ccnc(N2CCC([NH2+]C[C@@H]3CCCO3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1ccnc(N2CCC(C3(C[C@@H]4CCCO4)CC[NH2+]C3)CC2)c1 | N#Cc1ccnc(N2CCC([NH2+]C[C@@H]3CCCO3)CC2)c1 | N#Cc1ccnc(N2CCC(C3(C[C@@H]4CCCO4)CC[NH2+]C3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC&&C1",
"old_substring": "[NH2+]46"
} |
Can you make molecule N#Cc1ccnc(N2CCC([NH2+]C[C@@H]3CCCO3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1ccnc(N2CCC([C@@]3(C[C@@H]4CCCO4)CCC[NH2+]C3)CC2)c1 | N#Cc1ccnc(N2CCC([NH2+]C[C@@H]3CCCO3)CC2)c1 | N#Cc1ccnc(N2CCC([C@@]3(C[C@@H]4CCCO4)CCC[NH2+]C3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "[NH+]1&CCC[C@]&&C1",
"old_substring": "[NH2+]46"
} |
Can you make molecule N#Cc1ccnc(N2CCC([NH2+]C[C@@H]3CCCO3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1ccnc(N2CCC(c3c[nH+]cn3C[C@@H]3CCCO3)CC2)c1 | N#Cc1ccnc(N2CCC([NH2+]C[C@@H]3CCCO3)CC2)c1 | N#Cc1ccnc(N2CCC(c3c[nH+]cn3C[C@@H]3CCCO3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]cn&c1&",
"old_substring": "[NH2+]46"
} |
Can you make molecule N#Cc1ccnc(N2CCC([NH2+]C[C@@H]3CCCO3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | N#Cc1ccnc(N2CCC(c3cc(C[C@@H]4CCCO4)[nH+][nH]3)CC2)c1 | N#Cc1ccnc(N2CCC([NH2+]C[C@@H]3CCCO3)CC2)c1 | N#Cc1ccnc(N2CCC(c3cc(C[C@@H]4CCCO4)[nH+][nH]3)CC2)c1 | 102 | {
"fragment_index": 0,
"new_substring": "n1&[nH+]c&cc1&",
"old_substring": "[NH2+]46"
} |
Can you make molecule N#Cc1ccnc(N2CCC([NH2+]C[C@@H]3CCCO3)CC2)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cn1[nH+]cc(C2CCN(c3cc(C#N)ccn3)CC2)c1C[C@@H]1CCCO1 | N#Cc1ccnc(N2CCC([NH2+]C[C@@H]3CCCO3)CC2)c1 | Cn1[nH+]cc(C2CCN(c3cc(C#N)ccn3)CC2)c1C[C@@H]1CCCO1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&[nH+]n(C)c&c1&",
"old_substring": "[NH2+]46"
} |
Can you make molecule O=C(Cn1nnn(-c2cccs2)c1=O)OC1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(/C=C/Sn1nnn(-c2cccs2)c1=O)OC1CCCCC1 | O=C(Cn1nnn(-c2cccs2)c1=O)OC1CCCCC1 | O=C(/C=C/Sn1nnn(-c2cccs2)c1=O)OC1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&/C=C/S&",
"old_substring": "O=C3C5"
} |
Can you make molecule O=C(Cn1nnn(-c2cccs2)c1=O)OC1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=C1CCC(n2nnn(-c3cccs3)c2=O)CC1)OC1CCCCC1 | O=C(Cn1nnn(-c2cccs2)c1=O)OC1CCCCC1 | O=C(NN=C1CCC(n2nnn(-c3cccs3)c2=O)CC1)OC1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCC&CC1",
"old_substring": "O=C3C5"
} |
Can you make molecule O=C(Cn1nnn(-c2cccs2)c1=O)OC1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | C/C(=N\OOC1CCCCC1)C(=O)Sn1nnn(-c2cccs2)c1=O | O=C(Cn1nnn(-c2cccs2)c1=O)OC1CCCCC1 | C/C(=N\OOC1CCCCC1)C(=O)Sn1nnn(-c2cccs2)c1=O | 102 | {
"fragment_index": 0,
"new_substring": "O&/N=C(\\C)C(=O)S&",
"old_substring": "O=C3C5"
} |
Can you make molecule O=C(Cn1nnn(-c2cccs2)c1=O)OC1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(OC1CCCCC1)C1=CC[C@H](n2nnn(-c3cccs3)c2=O)S1 | O=C(Cn1nnn(-c2cccs2)c1=O)OC1CCCCC1 | O=C(OC1CCCCC1)C1=CC[C@H](n2nnn(-c3cccs3)c2=O)S1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&C1=CC[C@H]&S1",
"old_substring": "O=C3C5"
} |
Can you make molecule O=C(Cn1nnn(-c2cccs2)c1=O)OC1CCCCC1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=Cc1ccc(-n2nnn(-c3cccs3)c2=O)cc1)OC1CCCCC1 | O=C(Cn1nnn(-c2cccs2)c1=O)OC1CCCCC1 | O=C(NN=Cc1ccc(-n2nnn(-c3cccs3)c2=O)cc1)OC1CCCCC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=Cc1ccc&cc1",
"old_substring": "O=C3C5"
} |
Can you make molecule COc1cccc(COc2ccc(OC)cc2CCl)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(OCc2ccc(OC)c(I)c2)c(CCl)c1 | COc1cccc(COc2ccc(OC)cc2CCl)c1 | COc1ccc(OCc2ccc(OC)c(I)c2)c(CCl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1I",
"old_substring": "c14cccc7c1"
} |
Can you make molecule COc1cccc(COc2ccc(OC)cc2CCl)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(OCc2ccc(Br)c(OC)c2)c(CCl)c1 | COc1cccc(COc2ccc(OC)cc2CCl)c1 | COc1ccc(OCc2ccc(Br)c(OC)c2)c(CCl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cc&ccc1Br",
"old_substring": "c14cccc7c1"
} |
Can you make molecule COc1cccc(COc2ccc(OC)cc2CCl)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(OCc2ccc(OC)c(Cl)c2)c(CCl)c1 | COc1cccc(COc2ccc(OC)cc2CCl)c1 | COc1ccc(OCc2ccc(OC)c(Cl)c2)c(CCl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&ccc&cc1Cl",
"old_substring": "c14cccc7c1"
} |
Can you make molecule COc1cccc(COc2ccc(OC)cc2CCl)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(OCc2cccc(OC)c2Br)c(CCl)c1 | COc1cccc(COc2ccc(OC)cc2CCl)c1 | COc1ccc(OCc2cccc(OC)c2Br)c(CCl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Br",
"old_substring": "c14cccc7c1"
} |
Can you make molecule COc1cccc(COc2ccc(OC)cc2CCl)c1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(OCc2cccc(OC)c2Cl)c(CCl)c1 | COc1cccc(COc2ccc(OC)cc2CCl)c1 | COc1ccc(OCc2cccc(OC)c2Cl)c(CCl)c1 | 102 | {
"fragment_index": 0,
"new_substring": "c1&cccc&c1Cl",
"old_substring": "c14cccc7c1"
} |
Can you make molecule CC[C@H](NC(=O)NCc1c(C)noc1C)c1ccc(OC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](NC(=O)CC(C)(C)NCc1c(C)noc1C)c1ccc(OC)cc1 | CC[C@H](NC(=O)NCc1c(C)noc1C)c1ccc(OC)cc1 | CC[C@H](NC(=O)CC(C)(C)NCc1c(C)noc1C)c1ccc(OC)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule CC[C@H](NC(=O)NCc1c(C)noc1C)c1ccc(OC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](NC(=O)CCC(C)(C)NCc1c(C)noc1C)c1ccc(OC)cc1 | CC[C@H](NC(=O)NCc1c(C)noc1C)c1ccc(OC)cc1 | CC[C@H](NC(=O)CCC(C)(C)NCc1c(C)noc1C)c1ccc(OC)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C23=O"
} |
Can you make molecule CC[C@H](NC(=O)NCc1c(C)noc1C)c1ccc(OC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](Nc1c(C)n(C)n(NCc2c(C)noc2C)c1=O)c1ccc(OC)cc1 | CC[C@H](NC(=O)NCc1c(C)noc1C)c1ccc(OC)cc1 | CC[C@H](Nc1c(C)n(C)n(NCc2c(C)noc2C)c1=O)c1ccc(OC)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)n&n1C",
"old_substring": "C23=O"
} |
Can you make molecule CC[C@H](NC(=O)NCc1c(C)noc1C)c1ccc(OC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](Nc1nn(NCc2c(C)noc2C)c(C)cc1=O)c1ccc(OC)cc1 | CC[C@H](NC(=O)NCc1c(C)noc1C)c1ccc(OC)cc1 | CC[C@H](Nc1nn(NCc2c(C)noc2C)c(C)cc1=O)c1ccc(OC)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc(=O)c&nn1&",
"old_substring": "C23=O"
} |
Can you make molecule CC[C@H](NC(=O)NCc1c(C)noc1C)c1ccc(OC)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@H](NC(=O)C[C@@H](Br)NCc1c(C)noc1C)c1ccc(OC)cc1 | CC[C@H](NC(=O)NCc1c(C)noc1C)c1ccc(OC)cc1 | CC[C@H](NC(=O)C[C@@H](Br)NCc1c(C)noc1C)c1ccc(OC)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C23=O"
} |
Can you make molecule CCc1c(C(=O)Nc2ccc3c(c2)NC(=O)CS3)[nH]c(C)c1C(C)=O less soluble in water? The output molecule should be similar to the input molecule. | CCc1c(C(=O)Nc2ccc3c(c2)NC(=O)CS3)[nH]c(C)c1C(=O)C(C)C | CCc1c(C(=O)Nc2ccc3c(c2)NC(=O)CS3)[nH]c(C)c1C(C)=O | CCc1c(C(=O)Nc2ccc3c(c2)NC(=O)CS3)[nH]c(C)c1C(=O)C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)C&=O",
"old_substring": "C7(C)=O"
} |
Can you make molecule CCc1c(C(=O)Nc2ccc3c(c2)NC(=O)CS3)[nH]c(C)c1C(C)=O less soluble in water? The output molecule should be similar to the input molecule. | C=C(C)C(=O)c1c(C)[nH]c(C(=O)Nc2ccc3c(c2)NC(=O)CS3)c1CC | CCc1c(C(=O)Nc2ccc3c(c2)NC(=O)CS3)[nH]c(C)c1C(C)=O | C=C(C)C(=O)c1c(C)[nH]c(C(=O)Nc2ccc3c(c2)NC(=O)CS3)c1CC | 102 | {
"fragment_index": 0,
"new_substring": "C=C(C)C&=O",
"old_substring": "C7(C)=O"
} |
Can you make molecule CCc1c(C(=O)Nc2ccc3c(c2)NC(=O)CS3)[nH]c(C)c1C(C)=O less soluble in water? The output molecule should be similar to the input molecule. | CCc1c(C(=O)Nc2ccc3c(c2)NC(=O)CS3)[nH]c(C)c1C(=O)CC(C)C | CCc1c(C(=O)Nc2ccc3c(c2)NC(=O)CS3)[nH]c(C)c1C(C)=O | CCc1c(C(=O)Nc2ccc3c(c2)NC(=O)CS3)[nH]c(C)c1C(=O)CC(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CC&=O",
"old_substring": "C7(C)=O"
} |
Can you make molecule CCc1c(C(=O)Nc2ccc3c(c2)NC(=O)CS3)[nH]c(C)c1C(C)=O less soluble in water? The output molecule should be similar to the input molecule. | CCc1c(C(=O)Nc2ccc3c(c2)NC(=O)CS3)[nH]c(C)c1C(C)C | CCc1c(C(=O)Nc2ccc3c(c2)NC(=O)CS3)[nH]c(C)c1C(C)=O | CCc1c(C(=O)Nc2ccc3c(c2)NC(=O)CS3)[nH]c(C)c1C(C)C | 102 | {
"fragment_index": 0,
"new_substring": "C&(C)C",
"old_substring": "C7(C)=O"
} |
Can you make molecule CCc1c(C(=O)Nc2ccc3c(c2)NC(=O)CS3)[nH]c(C)c1C(C)=O less soluble in water? The output molecule should be similar to the input molecule. | CCc1c(C(=O)Nc2ccc3c(c2)NC(=O)CS3)[nH]c(C)c1C(=O)CCC(C)C | CCc1c(C(=O)Nc2ccc3c(c2)NC(=O)CS3)[nH]c(C)c1C(C)=O | CCc1c(C(=O)Nc2ccc3c(c2)NC(=O)CS3)[nH]c(C)c1C(=O)CCC(C)C | 102 | {
"fragment_index": 0,
"new_substring": "CC(C)CCC&=O",
"old_substring": "C7(C)=O"
} |
Can you make molecule CSc1ccc(/C=c2\sc3ncnn3c2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=c1/c(=C/c2ccc(C3SCCS3)cc2)sc2ncnn12 | CSc1ccc(/C=c2\sc3ncnn3c2=O)cc1 | O=c1/c(=C/c2ccc(C3SCCS3)cc2)sc2ncnn12 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCS1",
"old_substring": "CS4"
} |
Can you make molecule CSc1ccc(/C=c2\sc3ncnn3c2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=c1/c(=C/c2ccc(C3SCCCS3)cc2)sc2ncnn12 | CSc1ccc(/C=c2\sc3ncnn3c2=O)cc1 | O=c1/c(=C/c2ccc(C3SCCCS3)cc2)sc2ncnn12 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCCCS1",
"old_substring": "CS4"
} |
Can you make molecule CSc1ccc(/C=c2\sc3ncnn3c2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | CC1(c2ccc(/C=c3\sc4ncnn4c3=O)cc2)SCCS1 | CSc1ccc(/C=c2\sc3ncnn3c2=O)cc1 | CC1(c2ccc(/C=c3\sc4ncnn4c3=O)cc2)SCCS1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1&SCCS1",
"old_substring": "CS4"
} |
Can you make molecule CSc1ccc(/C=c2\sc3ncnn3c2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=c1/c(=C/c2ccc(C3SCSCS3)cc2)sc2ncnn12 | CSc1ccc(/C=c2\sc3ncnn3c2=O)cc1 | O=c1/c(=C/c2ccc(C3SCSCS3)cc2)sc2ncnn12 | 102 | {
"fragment_index": 0,
"new_substring": "C1&SCSCS1",
"old_substring": "CS4"
} |
Can you make molecule CSc1ccc(/C=c2\sc3ncnn3c2=O)cc1 less soluble in water? The output molecule should be similar to the input molecule. | O=c1/c(=C/c2ccc(C3CSCCSC3)cc2)sc2ncnn12 | CSc1ccc(/C=c2\sc3ncnn3c2=O)cc1 | O=c1/c(=C/c2ccc(C3CSCCSC3)cc2)sc2ncnn12 | 102 | {
"fragment_index": 0,
"new_substring": "C1&CSCCSC1",
"old_substring": "CS4"
} |
Can you make molecule COc1ccc(C(=O)C=C(C)Nc2ccc(F)cc2F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)C=C(C)CCc2ccc(F)cc2F)cc1 | COc1ccc(C(=O)C=C(C)Nc2ccc(F)cc2F)cc1 | COc1ccc(C(=O)C=C(C)CCc2ccc(F)cc2F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&(C)CC&",
"old_substring": "C=6(C)N4"
} |
Can you make molecule COc1ccc(C(=O)C=C(C)Nc2ccc(F)cc2F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)C=CC2=CN=N[C@H]2c2ccc(F)cc2F)cc1 | COc1ccc(C(=O)C=C(C)Nc2ccc(F)cc2F)cc1 | COc1ccc(C(=O)C=CC2=CN=N[C@H]2c2ccc(F)cc2F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "C1=C(C&)[C@H]&N=N1",
"old_substring": "C=6(C)N4"
} |
Can you make molecule COc1ccc(C(=O)C=C(C)Nc2ccc(F)cc2F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)C=NC(=S)N2CCC(c3ccc(F)cc3F)CC2)cc1 | COc1ccc(C(=O)C=C(C)Nc2ccc(F)cc2F)cc1 | COc1ccc(C(=O)C=NC(=S)N2CCC(c3ccc(F)cc3F)CC2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "N&C(=S)N1CCC&CC1",
"old_substring": "C=6(C)N4"
} |
Can you make molecule COc1ccc(C(=O)C=C(C)Nc2ccc(F)cc2F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)C=CN2N=C(C)C[C@H]2c2ccc(F)cc2F)cc1 | COc1ccc(C(=O)C=C(C)Nc2ccc(F)cc2F)cc1 | COc1ccc(C(=O)C=CN2N=C(C)C[C@H]2c2ccc(F)cc2F)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "CC1=NN(C&)[C@H]&C1",
"old_substring": "C=6(C)N4"
} |
Can you make molecule COc1ccc(C(=O)C=C(C)Nc2ccc(F)cc2F)cc1 less soluble in water? The output molecule should be similar to the input molecule. | COc1ccc(C(=O)C=C/C(O)=N/c2nc(-c3ccc(F)cc3F)cs2)cc1 | COc1ccc(C(=O)C=C(C)Nc2ccc(F)cc2F)cc1 | COc1ccc(C(=O)C=C/C(O)=N/c2nc(-c3ccc(F)cc3F)cs2)cc1 | 102 | {
"fragment_index": 0,
"new_substring": "O/C(C&)=N\\c1nc&cs1",
"old_substring": "C=6(C)N4"
} |
Can you make molecule O=C(C=C1CCSCC1)N[C@@H]1CCC[C@H]1Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C(=N[C@@H]2CCC[C@H]2Cc2ccccc2)CCC1=C1CCSCC1 | O=C(C=C1CCSCC1)N[C@@H]1CCC[C@H]1Cc1ccccc1 | O=C1C(=N[C@@H]2CCC[C@H]2Cc2ccccc2)CCC1=C1CCSCC1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C1C=&CCC1=&",
"old_substring": "O=C2C=4"
} |
Can you make molecule O=C(C=C1CCSCC1)N[C@@H]1CCC[C@H]1Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C(=O)C(=C2CCSCC2)CCCC1=N[C@@H]1CCC[C@H]1Cc1ccccc1 | O=C(C=C1CCSCC1)N[C@@H]1CCC[C@H]1Cc1ccccc1 | O=C1C(=O)C(=C2CCSCC2)CCCC1=N[C@@H]1CCC[C@H]1Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C1C=&CCCC=&C1=O",
"old_substring": "O=C2C=4"
} |
Can you make molecule O=C(C=C1CCSCC1)N[C@@H]1CCC[C@H]1Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(NN=C1CCC(=C2CCSCC2)CC1)N[C@@H]1CCC[C@H]1Cc1ccccc1 | O=C(C=C1CCSCC1)N[C@@H]1CCC[C@H]1Cc1ccccc1 | O=C(NN=C1CCC(=C2CCSCC2)CC1)N[C@@H]1CCC[C@H]1Cc1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "O=C&NN=C1CCC&CC1",
"old_substring": "O=C2C=4"
} |
Can you make molecule O=C(C=C1CCSCC1)N[C@@H]1CCC[C@H]1Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N[C@@H]1CCC[C@H]1Cc1ccccc1)C1=C(N=C2CCSCC2)CCS1 | O=C(C=C1CCSCC1)N[C@@H]1CCC[C@H]1Cc1ccccc1 | O=C(N[C@@H]1CCC[C@H]1Cc1ccccc1)C1=C(N=C2CCSCC2)CCS1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C1=C(N&)CCS1",
"old_substring": "O=C2C=4"
} |
Can you make molecule O=C(C=C1CCSCC1)N[C@@H]1CCC[C@H]1Cc1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(N[C@@H]1CCC[C@H]1Cc1ccccc1)C(N=C1CCSCC1)=C(Cl)Cl | O=C(C=C1CCSCC1)N[C@@H]1CCC[C@H]1Cc1ccccc1 | O=C(N[C@@H]1CCC[C@H]1Cc1ccccc1)C(N=C1CCSCC1)=C(Cl)Cl | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C(N&)=C(Cl)Cl",
"old_substring": "O=C2C=4"
} |
Can you make molecule C[C@@H](Sc1nc(C=Cc2cccs2)n[nH]1)C(=O)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCSc1nc(C=Cc2cccs2)n[nH]1)CC(=O)N1CCOCC1 | C[C@@H](Sc1nc(C=Cc2cccs2)n[nH]1)C(=O)N1CCOCC1 | C[C@@H](CCSc1nc(C=Cc2cccs2)n[nH]1)CC(=O)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H](CC&)CC&=O",
"old_substring": "C[C@@H]4C3=O"
} |
Can you make molecule C[C@@H](Sc1nc(C=Cc2cccs2)n[nH]1)C(=O)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CCSc1nc(C=Cc2cccs2)n[nH]1)CC(=O)N1CCOCC1 | C[C@@H](Sc1nc(C=Cc2cccs2)n[nH]1)C(=O)N1CCOCC1 | C[C@H](CCSc1nc(C=Cc2cccs2)n[nH]1)CC(=O)N1CCOCC1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H](CC&)CC&=O",
"old_substring": "C[C@@H]4C3=O"
} |
Can you make molecule C[C@@H](Sc1nc(C=Cc2cccs2)n[nH]1)C(=O)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](CCN1CCOCC1)Sc1nc(C=Cc2cccs2)n[nH]1 | C[C@@H](Sc1nc(C=Cc2cccs2)n[nH]1)C(=O)N1CCOCC1 | C[C@@H](CCN1CCOCC1)Sc1nc(C=Cc2cccs2)n[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@H]&CC&",
"old_substring": "C[C@@H]4C3=O"
} |
Can you make molecule C[C@@H](Sc1nc(C=Cc2cccs2)n[nH]1)C(=O)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@H](CC(C)(C)N1CCOCC1)Sc1nc(C=Cc2cccs2)n[nH]1 | C[C@@H](Sc1nc(C=Cc2cccs2)n[nH]1)C(=O)N1CCOCC1 | C[C@H](CC(C)(C)N1CCOCC1)Sc1nc(C=Cc2cccs2)n[nH]1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@H]&CC&(C)C",
"old_substring": "C[C@@H]4C3=O"
} |
Can you make molecule C[C@@H](Sc1nc(C=Cc2cccs2)n[nH]1)C(=O)N1CCOCC1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@]1(Sc2nc(C=Cc3cccs3)n[nH]2)O[C@@H](N2CCOCC2)CS1 | C[C@@H](Sc1nc(C=Cc2cccs2)n[nH]1)C(=O)N1CCOCC1 | C[C@@]1(Sc2nc(C=Cc3cccs3)n[nH]2)O[C@@H](N2CCOCC2)CS1 | 102 | {
"fragment_index": 0,
"new_substring": "C[C@@]1&O[C@@H]&CS1",
"old_substring": "C[C@@H]4C3=O"
} |
Can you make molecule Cc1cccc(C(=O)N[C@@H](C(=O)N2CCC[C@@H](C)C2)C(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(CC(=O)SN[C@@H](C(=O)N2CCC[C@@H](C)C2)C(C)C)c1 | Cc1cccc(C(=O)N[C@@H](C(=O)N2CCC[C@@H](C)C2)C(C)C)c1 | Cc1cccc(CC(=O)SN[C@@H](C(=O)N2CCC[C@@H](C)C2)C(C)C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C36=O"
} |
Can you make molecule Cc1cccc(C(=O)N[C@@H](C(=O)N2CCC[C@@H](C)C2)C(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C(=O)CCCC(=O)N[C@@H](C(=O)N2CCC[C@@H](C)C2)C(C)C)c1 | Cc1cccc(C(=O)N[C@@H](C(=O)N2CCC[C@@H](C)C2)C(C)C)c1 | Cc1cccc(C(=O)CCCC(=O)N[C@@H](C(=O)N2CCC[C@@H](C)C2)C(C)C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C36=O"
} |
Can you make molecule Cc1cccc(C(=O)N[C@@H](C(=O)N2CCC[C@@H](C)C2)C(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C(C)(C)CC(=O)N[C@@H](C(=O)N2CCC[C@@H](C)C2)C(C)C)c1 | Cc1cccc(C(=O)N[C@@H](C(=O)N2CCC[C@@H](C)C2)C(C)C)c1 | Cc1cccc(C(C)(C)CC(=O)N[C@@H](C(=O)N2CCC[C@@H](C)C2)C(C)C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule Cc1cccc(C(=O)N[C@@H](C(=O)N2CCC[C@@H](C)C2)C(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc(C(C)(C)CCC(=O)N[C@@H](C(=O)N2CCC[C@@H](C)C2)C(C)C)c1 | Cc1cccc(C(=O)N[C@@H](C(=O)N2CCC[C@@H](C)C2)C(C)C)c1 | Cc1cccc(C(C)(C)CCC(=O)N[C@@H](C(=O)N2CCC[C@@H](C)C2)C(C)C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C36=O"
} |
Can you make molecule Cc1cccc(C(=O)N[C@@H](C(=O)N2CCC[C@@H](C)C2)C(C)C)c1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cccc([C@H](C)C(=O)SN[C@@H](C(=O)N2CCC[C@@H](C)C2)C(C)C)c1 | Cc1cccc(C(=O)N[C@@H](C(=O)N2CCC[C@@H](C)C2)C(C)C)c1 | Cc1cccc([C@H](C)C(=O)SN[C@@H](C(=O)N2CCC[C@@H](C)C2)C(C)C)c1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C36=O"
} |
Can you make molecule COC(=O)[C@@H](C)Sc1nnc(Nc2cccc(Br)c2)s1 less soluble in water? The output molecule should be similar to the input molecule. | COCSC(=O)[C@@H](C)Sc1nnc(Nc2cccc(Br)c2)s1 | COC(=O)[C@@H](C)Sc1nnc(Nc2cccc(Br)c2)s1 | COCSC(=O)[C@@H](C)Sc1nnc(Nc2cccc(Br)c2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO3"
} |
Can you make molecule COC(=O)[C@@H](C)Sc1nnc(Nc2cccc(Br)c2)s1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)SC(=O)[C@@H](C)Sc1nnc(Nc2cccc(Br)c2)s1 | COC(=O)[C@@H](C)Sc1nnc(Nc2cccc(Br)c2)s1 | CC(=O)SC(=O)[C@@H](C)Sc1nnc(Nc2cccc(Br)c2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO3"
} |
Can you make molecule COC(=O)[C@@H](C)Sc1nnc(Nc2cccc(Br)c2)s1 less soluble in water? The output molecule should be similar to the input molecule. | CON(C)CCCC(=O)[C@@H](C)Sc1nnc(Nc2cccc(Br)c2)s1 | COC(=O)[C@@H](C)Sc1nnc(Nc2cccc(Br)c2)s1 | CON(C)CCCC(=O)[C@@H](C)Sc1nnc(Nc2cccc(Br)c2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "CON(C)CCC&",
"old_substring": "CO3"
} |
Can you make molecule COC(=O)[C@@H](C)Sc1nnc(Nc2cccc(Br)c2)s1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)CCCC(=O)[C@@H](C)Sc1nnc(Nc2cccc(Br)c2)s1 | COC(=O)[C@@H](C)Sc1nnc(Nc2cccc(Br)c2)s1 | CC(=O)CCCC(=O)[C@@H](C)Sc1nnc(Nc2cccc(Br)c2)s1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)CCC&",
"old_substring": "CO3"
} |
Can you make molecule COC(=O)[C@@H](C)Sc1nnc(Nc2cccc(Br)c2)s1 less soluble in water? The output molecule should be similar to the input molecule. | C[C@@H](Sc1nnc(Nc2cccc(Br)c2)s1)C(=O)C(=O)CCBr | COC(=O)[C@@H](C)Sc1nnc(Nc2cccc(Br)c2)s1 | C[C@@H](Sc1nnc(Nc2cccc(Br)c2)s1)C(=O)C(=O)CCBr | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCBr",
"old_substring": "CO3"
} |
Can you make molecule Cc1cnc(C(=O)Nc2ccc(N(C)C3CC[NH+](C)CC3)cc2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc(CC(=O)SNc2ccc(N(C)C3CC[NH+](C)CC3)cc2)cn1 | Cc1cnc(C(=O)Nc2ccc(N(C)C3CC[NH+](C)CC3)cc2)cn1 | Cc1cnc(CC(=O)SNc2ccc(N(C)C3CC[NH+](C)CC3)cc2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C48=O"
} |
Can you make molecule Cc1cnc(C(=O)Nc2ccc(N(C)C3CC[NH+](C)CC3)cc2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc(C(=O)CCCC(=O)Nc2ccc(N(C)C3CC[NH+](C)CC3)cc2)cn1 | Cc1cnc(C(=O)Nc2ccc(N(C)C3CC[NH+](C)CC3)cc2)cn1 | Cc1cnc(C(=O)CCCC(=O)Nc2ccc(N(C)C3CC[NH+](C)CC3)cc2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C48=O"
} |
Can you make molecule Cc1cnc(C(=O)Nc2ccc(N(C)C3CC[NH+](C)CC3)cc2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc(C(C)(C)CC(=O)Nc2ccc(N(C)C3CC[NH+](C)CC3)cc2)cn1 | Cc1cnc(C(=O)Nc2ccc(N(C)C3CC[NH+](C)CC3)cc2)cn1 | Cc1cnc(C(C)(C)CC(=O)Nc2ccc(N(C)C3CC[NH+](C)CC3)cc2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C48=O"
} |
Can you make molecule Cc1cnc(C(=O)Nc2ccc(N(C)C3CC[NH+](C)CC3)cc2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc(C(C)(C)CCC(=O)Nc2ccc(N(C)C3CC[NH+](C)CC3)cc2)cn1 | Cc1cnc(C(=O)Nc2ccc(N(C)C3CC[NH+](C)CC3)cc2)cn1 | Cc1cnc(C(C)(C)CCC(=O)Nc2ccc(N(C)C3CC[NH+](C)CC3)cc2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C48=O"
} |
Can you make molecule Cc1cnc(C(=O)Nc2ccc(N(C)C3CC[NH+](C)CC3)cc2)cn1 less soluble in water? The output molecule should be similar to the input molecule. | Cc1cnc([C@H](C)C(=O)SNc2ccc(N(C)C3CC[NH+](C)CC3)cc2)cn1 | Cc1cnc(C(=O)Nc2ccc(N(C)C3CC[NH+](C)CC3)cc2)cn1 | Cc1cnc([C@H](C)C(=O)SNc2ccc(N(C)C3CC[NH+](C)CC3)cc2)cn1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)[C@H]&C",
"old_substring": "C48=O"
} |
Can you make molecule CC(=O)Nc1nc2ccc(NC(=O)NCc3ccccc3)cc2s1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1nc2ccc(NC(=O)CC(C)(C)NCc3ccccc3)cc2s1 | CC(=O)Nc1nc2ccc(NC(=O)NCc3ccccc3)cc2s1 | CC(=O)Nc1nc2ccc(NC(=O)CC(C)(C)NCc3ccccc3)cc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C56=O"
} |
Can you make molecule CC(=O)Nc1nc2ccc(NC(=O)NCc3ccccc3)cc2s1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1nc2ccc(NC(=O)CCC(C)(C)NCc3ccccc3)cc2s1 | CC(=O)Nc1nc2ccc(NC(=O)NCc3ccccc3)cc2s1 | CC(=O)Nc1nc2ccc(NC(=O)CCC(C)(C)NCc3ccccc3)cc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCC&(C)C",
"old_substring": "C56=O"
} |
Can you make molecule CC(=O)Nc1nc2ccc(NC(=O)NCc3ccccc3)cc2s1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1nc2ccc(NC(=O)C[C@@H](Br)NCc3ccccc3)cc2s1 | CC(=O)Nc1nc2ccc(NC(=O)NCc3ccccc3)cc2s1 | CC(=O)Nc1nc2ccc(NC(=O)C[C@@H](Br)NCc3ccccc3)cc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)C[C@H]&Br",
"old_substring": "C56=O"
} |
Can you make molecule CC(=O)Nc1nc2ccc(NC(=O)NCc3ccccc3)cc2s1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1nc2ccc(Nc3cc(C)n(NCc4ccccc4)c(=O)c3)cc2s1 | CC(=O)Nc1nc2ccc(NC(=O)NCc3ccccc3)cc2s1 | CC(=O)Nc1nc2ccc(Nc3cc(C)n(NCc4ccccc4)c(=O)c3)cc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1cc&cc(=O)n1&",
"old_substring": "C56=O"
} |
Can you make molecule CC(=O)Nc1nc2ccc(NC(=O)NCc3ccccc3)cc2s1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Nc1nc2ccc(Nc3c(C)n(NCc4ccccc4)ccc3=O)cc2s1 | CC(=O)Nc1nc2ccc(NC(=O)NCc3ccccc3)cc2s1 | CC(=O)Nc1nc2ccc(Nc3c(C)n(NCc4ccccc4)ccc3=O)cc2s1 | 102 | {
"fragment_index": 0,
"new_substring": "Cc1c&c(=O)ccn1&",
"old_substring": "C56=O"
} |
Can you make molecule C=CCN1C(=O)C(=Cc2ccccc2F)S/C1=N\S(=O)(=O)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCN1C(=O)C(=Cc2cc(Br)ccc2F)S/C1=N\S(=O)(=O)c1cccs1 | C=CCN1C(=O)C(=Cc2ccccc2F)S/C1=N\S(=O)(=O)c1cccs1 | C=CCN1C(=O)C(=Cc2cc(Br)ccc2F)S/C1=N\S(=O)(=O)c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&c1cc(Br)ccc1F",
"old_substring": "C=3c1ccccc1F"
} |
Can you make molecule C=CCN1C(=O)C(=Cc2ccccc2F)S/C1=N\S(=O)(=O)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCN1C(=O)C(=Cc2ccccc2Br)S/C1=N\S(=O)(=O)c1cccs1 | C=CCN1C(=O)C(=Cc2ccccc2F)S/C1=N\S(=O)(=O)c1cccs1 | C=CCN1C(=O)C(=Cc2ccccc2Br)S/C1=N\S(=O)(=O)c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&c1ccccc1Br",
"old_substring": "C=3c1ccccc1F"
} |
Can you make molecule C=CCN1C(=O)C(=Cc2ccccc2F)S/C1=N\S(=O)(=O)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCN1C(=O)C(=Cc2ccccc2Cl)S/C1=N\S(=O)(=O)c1cccs1 | C=CCN1C(=O)C(=Cc2ccccc2F)S/C1=N\S(=O)(=O)c1cccs1 | C=CCN1C(=O)C(=Cc2ccccc2Cl)S/C1=N\S(=O)(=O)c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&c1ccccc1Cl",
"old_substring": "C=3c1ccccc1F"
} |
Can you make molecule C=CCN1C(=O)C(=Cc2ccccc2F)S/C1=N\S(=O)(=O)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCN1C(=O)C(=C(CC)c2ccccc2)S/C1=N\S(=O)(=O)c1cccs1 | C=CCN1C(=O)C(=Cc2ccccc2F)S/C1=N\S(=O)(=O)c1cccs1 | C=CCN1C(=O)C(=C(CC)c2ccccc2)S/C1=N\S(=O)(=O)c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "CCC=&c1ccccc1",
"old_substring": "C=3c1ccccc1F"
} |
Can you make molecule C=CCN1C(=O)C(=Cc2ccccc2F)S/C1=N\S(=O)(=O)c1cccs1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCN1C(=O)C(=Cc2c(F)cccc2Cl)S/C1=N\S(=O)(=O)c1cccs1 | C=CCN1C(=O)C(=Cc2ccccc2F)S/C1=N\S(=O)(=O)c1cccs1 | C=CCN1C(=O)C(=Cc2c(F)cccc2Cl)S/C1=N\S(=O)(=O)c1cccs1 | 102 | {
"fragment_index": 0,
"new_substring": "C=&c1c(F)cccc1Cl",
"old_substring": "C=3c1ccccc1F"
} |
Can you make molecule CC[C@H]1CC(=O)N(Cc2ccccc2C#CCCO)C1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCC[C@H]1CC(=O)N(Cc2ccccc2C#CCCO)C1 | CC[C@H]1CC(=O)N(Cc2ccccc2C#CCCO)C1 | C=CCC[C@H]1CC(=O)N(Cc2ccccc2C#CCCO)C1 | 102 | {
"fragment_index": 0,
"new_substring": "C=CCC&",
"old_substring": "CC4"
} |
Can you make molecule CC[C@H]1CC(=O)N(Cc2ccccc2C#CCCO)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C[C@H](CCCCl)CN1Cc1ccccc1C#CCCO | CC[C@H]1CC(=O)N(Cc2ccccc2C#CCCO)C1 | O=C1C[C@H](CCCCl)CN1Cc1ccccc1C#CCCO | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCl",
"old_substring": "CC4"
} |
Can you make molecule CC[C@H]1CC(=O)N(Cc2ccccc2C#CCCO)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C[C@H](CCCCS)CN1Cc1ccccc1C#CCCO | CC[C@H]1CC(=O)N(Cc2ccccc2C#CCCO)C1 | O=C1C[C@H](CCCCS)CN1Cc1ccccc1C#CCCO | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCS",
"old_substring": "CC4"
} |
Can you make molecule CC[C@H]1CC(=O)N(Cc2ccccc2C#CCCO)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C[C@H](CCCBr)CN1Cc1ccccc1C#CCCO | CC[C@H]1CC(=O)N(Cc2ccccc2C#CCCO)C1 | O=C1C[C@H](CCCBr)CN1Cc1ccccc1C#CCCO | 102 | {
"fragment_index": 0,
"new_substring": "C&CCBr",
"old_substring": "CC4"
} |
Can you make molecule CC[C@H]1CC(=O)N(Cc2ccccc2C#CCCO)C1 less soluble in water? The output molecule should be similar to the input molecule. | O=C1C[C@H](CCCCF)CN1Cc1ccccc1C#CCCO | CC[C@H]1CC(=O)N(Cc2ccccc2C#CCCO)C1 | O=C1C[C@H](CCCCF)CN1Cc1ccccc1C#CCCO | 102 | {
"fragment_index": 0,
"new_substring": "C&CCCF",
"old_substring": "CC4"
} |
Can you make molecule COc1ccc(F)cc1C(=O)Nc1nccs1 less soluble in water? The output molecule should be similar to the input molecule. | COCc1ccc(F)cc1C(=O)Nc1nccs1 | COc1ccc(F)cc1C(=O)Nc1nccs1 | COCc1ccc(F)cc1C(=O)Nc1nccs1 | 102 | {
"fragment_index": 0,
"new_substring": "COC&",
"old_substring": "CO3"
} |
Can you make molecule COc1ccc(F)cc1C(=O)Nc1nccs1 less soluble in water? The output molecule should be similar to the input molecule. | COCSc1ccc(F)cc1C(=O)Nc1nccs1 | COc1ccc(F)cc1C(=O)Nc1nccs1 | COCSc1ccc(F)cc1C(=O)Nc1nccs1 | 102 | {
"fragment_index": 0,
"new_substring": "COCS&",
"old_substring": "CO3"
} |
Can you make molecule COc1ccc(F)cc1C(=O)Nc1nccs1 less soluble in water? The output molecule should be similar to the input molecule. | CC(=O)Sc1ccc(F)cc1C(=O)Nc1nccs1 | COc1ccc(F)cc1C(=O)Nc1nccs1 | CC(=O)Sc1ccc(F)cc1C(=O)Nc1nccs1 | 102 | {
"fragment_index": 0,
"new_substring": "CC(=O)S&",
"old_substring": "CO3"
} |
Can you make molecule COc1ccc(F)cc1C(=O)Nc1nccs1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CS)c1ccc(F)cc1C(=O)Nc1nccs1 | COc1ccc(F)cc1C(=O)Nc1nccs1 | O=C(CS)c1ccc(F)cc1C(=O)Nc1nccs1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CS",
"old_substring": "CO3"
} |
Can you make molecule COc1ccc(F)cc1C(=O)Nc1nccs1 less soluble in water? The output molecule should be similar to the input molecule. | O=C(CI)c1ccc(F)cc1C(=O)Nc1nccs1 | COc1ccc(F)cc1C(=O)Nc1nccs1 | O=C(CI)c1ccc(F)cc1C(=O)Nc1nccs1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CI",
"old_substring": "CO3"
} |
Can you make molecule CC[C@@H](CC(=O)NC1(C(=O)OC)CCSCC1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CC(=O)NC1(CC(=O)SOC)CCSCC1)c1ccccc1 | CC[C@@H](CC(=O)NC1(C(=O)OC)CCSCC1)c1ccccc1 | CC[C@@H](CC(=O)NC1(CC(=O)SOC)CCSCC1)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "S&C(=O)C&",
"old_substring": "C25=O"
} |
Can you make molecule CC[C@@H](CC(=O)NC1(C(=O)OC)CCSCC1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CC(=O)NC1(CC(=C=O)COC)CCSCC1)c1ccccc1 | CC[C@@H](CC(=O)NC1(C(=O)OC)CCSCC1)c1ccccc1 | CC[C@@H](CC(=O)NC1(CC(=C=O)COC)CCSCC1)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&C(=C=O)C&",
"old_substring": "C25=O"
} |
Can you make molecule CC[C@@H](CC(=O)NC1(C(=O)OC)CCSCC1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CC(=O)NC1(C(=O)CCCC(=O)OC)CCSCC1)c1ccccc1 | CC[C@@H](CC(=O)NC1(C(=O)OC)CCSCC1)c1ccccc1 | CC[C@@H](CC(=O)NC1(C(=O)CCCC(=O)OC)CCSCC1)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CCCC&=O",
"old_substring": "C25=O"
} |
Can you make molecule CC[C@@H](CC(=O)NC1(C(=O)OC)CCSCC1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CC(=O)NC1(C(C)(C)CC(=O)OC)CCSCC1)c1ccccc1 | CC[C@@H](CC(=O)NC1(C(=O)OC)CCSCC1)c1ccccc1 | CC[C@@H](CC(=O)NC1(C(C)(C)CC(=O)OC)CCSCC1)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&(=O)CC&(C)C",
"old_substring": "C25=O"
} |
Can you make molecule CC[C@@H](CC(=O)NC1(C(=O)OC)CCSCC1)c1ccccc1 less soluble in water? The output molecule should be similar to the input molecule. | CC[C@@H](CC(=O)NC1(CCC[S@@+]([O-])COC)CCSCC1)c1ccccc1 | CC[C@@H](CC(=O)NC1(C(=O)OC)CCSCC1)c1ccccc1 | CC[C@@H](CC(=O)NC1(CCC[S@@+]([O-])COC)CCSCC1)c1ccccc1 | 102 | {
"fragment_index": 0,
"new_substring": "C&[S@](=O)CCC&",
"old_substring": "C25=O"
} |
Can you make molecule Cc1ccc(C)c(-n2c(SCCCCCO)nc3ccccc3c2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCC(=O)Sc1nc2ccccc2c(=O)n1-c1cc(C)ccc1C | Cc1ccc(C)c(-n2c(SCCCCCO)nc3ccccc3c2=O)c1 | CCCCC(=O)Sc1nc2ccccc2c(=O)n1-c1cc(C)ccc1C | 102 | {
"fragment_index": 0,
"new_substring": "CCCCC&=O",
"old_substring": "C4CCCCO"
} |
Can you make molecule Cc1ccc(C)c(-n2c(SCCCCCO)nc3ccccc3c2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCCC(=O)Sc1nc2ccccc2c(=O)n1-c1cc(C)ccc1C | Cc1ccc(C)c(-n2c(SCCCCCO)nc3ccccc3c2=O)c1 | CCCCCC(=O)Sc1nc2ccccc2c(=O)n1-c1cc(C)ccc1C | 102 | {
"fragment_index": 0,
"new_substring": "CCCCCC&=O",
"old_substring": "C4CCCCO"
} |
Can you make molecule Cc1ccc(C)c(-n2c(SCCCCCO)nc3ccccc3c2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCC(=O)Sc1nc2ccccc2c(=O)n1-c1cc(C)ccc1C | Cc1ccc(C)c(-n2c(SCCCCCO)nc3ccccc3c2=O)c1 | C=CCCCC(=O)Sc1nc2ccccc2c(=O)n1-c1cc(C)ccc1C | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCCC&=O",
"old_substring": "C4CCCCO"
} |
Can you make molecule Cc1ccc(C)c(-n2c(SCCCCCO)nc3ccccc3c2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | CCCCCCC(=O)Sc1nc2ccccc2c(=O)n1-c1cc(C)ccc1C | Cc1ccc(C)c(-n2c(SCCCCCO)nc3ccccc3c2=O)c1 | CCCCCCC(=O)Sc1nc2ccccc2c(=O)n1-c1cc(C)ccc1C | 102 | {
"fragment_index": 0,
"new_substring": "CCCCCCC&=O",
"old_substring": "C4CCCCO"
} |
Can you make molecule Cc1ccc(C)c(-n2c(SCCCCCO)nc3ccccc3c2=O)c1 less soluble in water? The output molecule should be similar to the input molecule. | C=CCCCSc1nc2ccccc2c(=O)n1-c1cc(C)ccc1C | Cc1ccc(C)c(-n2c(SCCCCCO)nc3ccccc3c2=O)c1 | C=CCCCSc1nc2ccccc2c(=O)n1-c1cc(C)ccc1C | 102 | {
"fragment_index": 0,
"new_substring": "C=CCCC&",
"old_substring": "C4CCCCO"
} |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.