instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_2733>?
The molecular formula for <BB_2733> (COc1cncc(CCCO)c1) is C9H13NO2.
Describe the ring structures in building block <BB_2733>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2733>.
The molecule contains the following groups: Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_2733>.
**Token:** <BB_2733> **SMILES:** COc1cncc(CCCO)c1 **Molecular Formula:** C9H13NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Alcohol, Ether
Provide the SMILES representation for the building block token <BB_2734>.
Cc1nn(CC(F)(F)F)c(C)c1C(C)C(=O)O
What is the building block token for the following molecule?
Cc1nn(CC(F)(F)F)c(C)c1C(C)C(=O)O
<BB_2734>
What is the molecular formula for <BB_2734>?
The molecular formula for <BB_2734> (Cc1nn(CC(F)(F)F)c(C)c1C(C)C(=O)O) is C10H13F3N2O2.
Describe the ring structures in building block <BB_2734>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2734>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2734>.
**Token:** <BB_2734> **SMILES:** Cc1nn(CC(F)(F)F)c(C)c1C(C)C(=O)O **Molecular Formula:** C10H13F3N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2735>.
OC(Cn1ccnc1)c1cccc(Br)c1
What is the building block token for the following molecule?
OC(Cn1ccnc1)c1cccc(Br)c1
<BB_2735>
What is the molecular formula for <BB_2735>?
The molecular formula for <BB_2735> (OC(Cn1ccnc1)c1cccc(Br)c1) is C11H11BrN2O.
Describe the ring structures in building block <BB_2735>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2735>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2735>.
**Token:** <BB_2735> **SMILES:** OC(Cn1ccnc1)c1cccc(Br)c1 **Molecular Formula:** C11H11BrN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2736>.
Cl.O=C(O)CC1CC2(CCC2)CN1
What is the building block token for the following molecule?
Cl.O=C(O)CC1CC2(CCC2)CN1
<BB_2736>
What is the molecular formula for <BB_2736>?
The molecular formula for <BB_2736> (Cl.O=C(O)CC1CC2(CCC2)CN1) is C9H16ClNO2.
Describe the ring structures in building block <BB_2736>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 4.
List the primary functional groups present in <BB_2736>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2736>.
**Token:** <BB_2736> **SMILES:** Cl.O=C(O)CC1CC2(CCC2)CN1 **Molecular Formula:** C9H16ClNO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 4. **Functional Groups:** Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2737>.
Cc1nc(C)c(C(=O)O)s1
What is the building block token for the following molecule?
Cc1nc(C)c(C(=O)O)s1
<BB_2737>
What is the molecular formula for <BB_2737>?
The molecular formula for <BB_2737> (Cc1nc(C)c(C(=O)O)s1) is C6H7NO2S.
Describe the ring structures in building block <BB_2737>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2737>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_2737>.
**Token:** <BB_2737> **SMILES:** Cc1nc(C)c(C(=O)O)s1 **Molecular Formula:** C6H7NO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_2738>.
CCc1cn[nH]c1Cl
What is the building block token for the following molecule?
CCc1cn[nH]c1Cl
<BB_2738>
What is the molecular formula for <BB_2738>?
The molecular formula for <BB_2738> (CCc1cn[nH]c1Cl) is C5H7ClN2.
Describe the ring structures in building block <BB_2738>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2738>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2738>.
**Token:** <BB_2738> **SMILES:** CCc1cn[nH]c1Cl **Molecular Formula:** C5H7ClN2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2739>.
O=C(O)[C@@H]1CN(Cc2ccccc2)C[C@H]1C(F)(F)F
What is the building block token for the following molecule?
O=C(O)[C@@H]1CN(Cc2ccccc2)C[C@H]1C(F)(F)F
<BB_2739>
What is the molecular formula for <BB_2739>?
The molecular formula for <BB_2739> (O=C(O)[C@@H]1CN(Cc2ccccc2)C[C@H]1C(F)(F)F) is C13H14F3NO2.
Describe the ring structures in building block <BB_2739>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2739>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2739>.
**Token:** <BB_2739> **SMILES:** O=C(O)[C@@H]1CN(Cc2ccccc2)C[C@H]1C(F)(F)F **Molecular Formula:** C13H14F3NO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2740>.
COc1cscn1
What is the building block token for the following molecule?
COc1cscn1
<BB_2740>
What is the molecular formula for <BB_2740>?
The molecular formula for <BB_2740> (COc1cscn1) is C4H5NOS.
Describe the ring structures in building block <BB_2740>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2740>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_2740>.
**Token:** <BB_2740> **SMILES:** COc1cscn1 **Molecular Formula:** C4H5NOS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_2741>.
Cl.Cl.NCc1nnc2ccccn12
What is the building block token for the following molecule?
Cl.Cl.NCc1nnc2ccccn12
<BB_2741>
What is the molecular formula for <BB_2741>?
The molecular formula for <BB_2741> (Cl.Cl.NCc1nnc2ccccn12) is C7H10Cl2N4.
Describe the ring structures in building block <BB_2741>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2741>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2741>.
**Token:** <BB_2741> **SMILES:** Cl.Cl.NCc1nnc2ccccn12 **Molecular Formula:** C7H10Cl2N4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2742>.
O=Cc1ccc(OC(F)(F)C(F)F)cc1
What is the building block token for the following molecule?
O=Cc1ccc(OC(F)(F)C(F)F)cc1
<BB_2742>
What is the molecular formula for <BB_2742>?
The molecular formula for <BB_2742> (O=Cc1ccc(OC(F)(F)C(F)F)cc1) is C9H6F4O2.
Describe the ring structures in building block <BB_2742>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2742>.
The molecule contains the following groups: Aldehyde, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2742>.
**Token:** <BB_2742> **SMILES:** O=Cc1ccc(OC(F)(F)C(F)F)cc1 **Molecular Formula:** C9H6F4O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2743>.
CC(C)(CO)C(C)(C)CC(=O)[O-].[K+]
What is the building block token for the following molecule?
CC(C)(CO)C(C)(C)CC(=O)[O-].[K+]
<BB_2743>
What is the molecular formula for <BB_2743>?
The molecular formula for <BB_2743> (CC(C)(CO)C(C)(C)CC(=O)[O-].[K+]) is C9H17KO3.
Describe the ring structures in building block <BB_2743>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2743>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_2743>.
**Token:** <BB_2743> **SMILES:** CC(C)(CO)C(C)(C)CC(=O)[O-].[K+] **Molecular Formula:** C9H17KO3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_2744>.
O=S(=O)(Cl)NCc1ccc(Br)cc1
What is the building block token for the following molecule?
O=S(=O)(Cl)NCc1ccc(Br)cc1
<BB_2744>
What is the molecular formula for <BB_2744>?
The molecular formula for <BB_2744> (O=S(=O)(Cl)NCc1ccc(Br)cc1) is C7H7BrClNO2S.
Describe the ring structures in building block <BB_2744>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2744>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_2744>.
**Token:** <BB_2744> **SMILES:** O=S(=O)(Cl)NCc1ccc(Br)cc1 **Molecular Formula:** C7H7BrClNO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_2745>.
CN(C)C(C)(C)CS.Cl
What is the building block token for the following molecule?
CN(C)C(C)(C)CS.Cl
<BB_2745>
What is the molecular formula for <BB_2745>?
The molecular formula for <BB_2745> (CN(C)C(C)(C)CS.Cl) is C6H16ClNS.
Describe the ring structures in building block <BB_2745>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2745>.
The molecule contains the following groups: Tertiary Amine, Thiol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2745>.
**Token:** <BB_2745> **SMILES:** CN(C)C(C)(C)CS.Cl **Molecular Formula:** C6H16ClNS **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Tertiary Amine, Thiol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2746>.
COCC(CN)c1ccc(Cl)cc1
What is the building block token for the following molecule?
COCC(CN)c1ccc(Cl)cc1
<BB_2746>
What is the molecular formula for <BB_2746>?
The molecular formula for <BB_2746> (COCC(CN)c1ccc(Cl)cc1) is C10H14ClNO.
Describe the ring structures in building block <BB_2746>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2746>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2746>.
**Token:** <BB_2746> **SMILES:** COCC(CN)c1ccc(Cl)cc1 **Molecular Formula:** C10H14ClNO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2747>.
Cl.Cl.Clc1nnnc2[nH]cnc12
What is the building block token for the following molecule?
Cl.Cl.Clc1nnnc2[nH]cnc12
<BB_2747>
What is the molecular formula for <BB_2747>?
The molecular formula for <BB_2747> (Cl.Cl.Clc1nnnc2[nH]cnc12) is C4H4Cl3N5.
Describe the ring structures in building block <BB_2747>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2747>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2747>.
**Token:** <BB_2747> **SMILES:** Cl.Cl.Clc1nnnc2[nH]cnc12 **Molecular Formula:** C4H4Cl3N5 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2748>.
Cl.Cl.NNC(=O)C1(N)CC1
What is the building block token for the following molecule?
Cl.Cl.NNC(=O)C1(N)CC1
<BB_2748>
What is the molecular formula for <BB_2748>?
The molecular formula for <BB_2748> (Cl.Cl.NNC(=O)C1(N)CC1) is C4H11Cl2N3O.
Describe the ring structures in building block <BB_2748>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_2748>.
The molecule contains the following groups: Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2748>.
**Token:** <BB_2748> **SMILES:** Cl.Cl.NNC(=O)C1(N)CC1 **Molecular Formula:** C4H11Cl2N3O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2749>.
O=C(O)[C@H]1C[C@H]1C(F)F
What is the building block token for the following molecule?
O=C(O)[C@H]1C[C@H]1C(F)F
<BB_2749>
What is the molecular formula for <BB_2749>?
The molecular formula for <BB_2749> (O=C(O)[C@H]1C[C@H]1C(F)F) is C5H6F2O2.
Describe the ring structures in building block <BB_2749>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_2749>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2749>.
**Token:** <BB_2749> **SMILES:** O=C(O)[C@H]1C[C@H]1C(F)F **Molecular Formula:** C5H6F2O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)