instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_2700>.
CC(C)NCC(O)c1ccccc1
What is the building block token for the following molecule?
CC(C)NCC(O)c1ccccc1
<BB_2700>
What is the molecular formula for <BB_2700>?
The molecular formula for <BB_2700> (CC(C)NCC(O)c1ccccc1) is C11H17NO.
Describe the ring structures in building block <BB_2700>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2700>.
The molecule contains the following groups: Secondary Amine, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_2700>.
**Token:** <BB_2700> **SMILES:** CC(C)NCC(O)c1ccccc1 **Molecular Formula:** C11H17NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Alcohol
Provide the SMILES representation for the building block token <BB_2701>.
BrCCc1ccc(Br)cc1
What is the building block token for the following molecule?
BrCCc1ccc(Br)cc1
<BB_2701>
What is the molecular formula for <BB_2701>?
The molecular formula for <BB_2701> (BrCCc1ccc(Br)cc1) is C8H8Br2.
Describe the ring structures in building block <BB_2701>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2701>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2701>.
**Token:** <BB_2701> **SMILES:** BrCCc1ccc(Br)cc1 **Molecular Formula:** C8H8Br2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2702>.
ClCc1cc(Cl)cc2c1OC(c1ccccc1)OC2
What is the building block token for the following molecule?
ClCc1cc(Cl)cc2c1OC(c1ccccc1)OC2
<BB_2702>
What is the molecular formula for <BB_2702>?
The molecular formula for <BB_2702> (ClCc1cc(Cl)cc2c1OC(c1ccccc1)OC2) is C15H12Cl2O2.
Describe the ring structures in building block <BB_2702>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2702>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2702>.
**Token:** <BB_2702> **SMILES:** ClCc1cc(Cl)cc2c1OC(c1ccccc1)OC2 **Molecular Formula:** C15H12Cl2O2 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2703>.
COc1cccc(OCC(N)c2ccccc2)c1
What is the building block token for the following molecule?
COc1cccc(OCC(N)c2ccccc2)c1
<BB_2703>
What is the molecular formula for <BB_2703>?
The molecular formula for <BB_2703> (COc1cccc(OCC(N)c2ccccc2)c1) is C15H17NO2.
Describe the ring structures in building block <BB_2703>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2703>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_2703>.
**Token:** <BB_2703> **SMILES:** COc1cccc(OCC(N)c2ccccc2)c1 **Molecular Formula:** C15H17NO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_2704>.
C[C@H](CN)c1nc(-c2cn[nH]c2)no1.Cl.Cl
What is the building block token for the following molecule?
C[C@H](CN)c1nc(-c2cn[nH]c2)no1.Cl.Cl
<BB_2704>
What is the molecular formula for <BB_2704>?
The molecular formula for <BB_2704> (C[C@H](CN)c1nc(-c2cn[nH]c2)no1.Cl.Cl) is C8H13Cl2N5O.
Describe the ring structures in building block <BB_2704>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_2704>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2704>.
**Token:** <BB_2704> **SMILES:** C[C@H](CN)c1nc(-c2cn[nH]c2)no1.Cl.Cl **Molecular Formula:** C8H13Cl2N5O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2705>.
COc1ccc(N=[N+]=[N-])cc1F
What is the building block token for the following molecule?
COc1ccc(N=[N+]=[N-])cc1F
<BB_2705>
What is the molecular formula for <BB_2705>?
The molecular formula for <BB_2705> (COc1ccc(N=[N+]=[N-])cc1F) is C7H6FN3O.
Describe the ring structures in building block <BB_2705>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2705>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2705>.
**Token:** <BB_2705> **SMILES:** COc1ccc(N=[N+]=[N-])cc1F **Molecular Formula:** C7H6FN3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2706>.
COc1ccccc1C12CNCC(CO)(C1)C2
What is the building block token for the following molecule?
COc1ccccc1C12CNCC(CO)(C1)C2
<BB_2706>
What is the molecular formula for <BB_2706>?
The molecular formula for <BB_2706> (COc1ccccc1C12CNCC(CO)(C1)C2) is C14H19NO2.
Describe the ring structures in building block <BB_2706>.
The molecule contains 4 ring(s): an aliphatic ring of size 4, an aromatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2706>.
The molecule contains the following groups: Secondary Amine, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_2706>.
**Token:** <BB_2706> **SMILES:** COc1ccccc1C12CNCC(CO)(C1)C2 **Molecular Formula:** C14H19NO2 **Ring System:** The molecule contains 4 ring(s): an aliphatic ring of size 4, an aromatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_2707>.
CC(CCNC(=O)OC(C)(C)C)C(=O)O
What is the building block token for the following molecule?
CC(CCNC(=O)OC(C)(C)C)C(=O)O
<BB_2707>
What is the molecular formula for <BB_2707>?
The molecular formula for <BB_2707> (CC(CCNC(=O)OC(C)(C)C)C(=O)O) is C10H19NO4.
Describe the ring structures in building block <BB_2707>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2707>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2707>.
**Token:** <BB_2707> **SMILES:** CC(CCNC(=O)OC(C)(C)C)C(=O)O **Molecular Formula:** C10H19NO4 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Amide, Ether
Provide the SMILES representation for the building block token <BB_2708>.
CC(N)COc1ccc(C(=O)O)cc1.Cl
What is the building block token for the following molecule?
CC(N)COc1ccc(C(=O)O)cc1.Cl
<BB_2708>
What is the molecular formula for <BB_2708>?
The molecular formula for <BB_2708> (CC(N)COc1ccc(C(=O)O)cc1.Cl) is C10H14ClNO3.
Describe the ring structures in building block <BB_2708>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2708>.
The molecule contains the following groups: Carboxylic Acid, Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2708>.
**Token:** <BB_2708> **SMILES:** CC(N)COc1ccc(C(=O)O)cc1.Cl **Molecular Formula:** C10H14ClNO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2709>.
COC(=O)c1cc(F)c[nH]1
What is the building block token for the following molecule?
COC(=O)c1cc(F)c[nH]1
<BB_2709>
What is the molecular formula for <BB_2709>?
The molecular formula for <BB_2709> (COC(=O)c1cc(F)c[nH]1) is C6H6FNO2.
Describe the ring structures in building block <BB_2709>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2709>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2709>.
**Token:** <BB_2709> **SMILES:** COC(=O)c1cc(F)c[nH]1 **Molecular Formula:** C6H6FNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2710>.
CC(F)(F)c1nnc(N)o1
What is the building block token for the following molecule?
CC(F)(F)c1nnc(N)o1
<BB_2710>
What is the molecular formula for <BB_2710>?
The molecular formula for <BB_2710> (CC(F)(F)c1nnc(N)o1) is C4H5F2N3O.
Describe the ring structures in building block <BB_2710>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2710>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2710>.
**Token:** <BB_2710> **SMILES:** CC(F)(F)c1nnc(N)o1 **Molecular Formula:** C4H5F2N3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2711>.
O=C(O)Cc1cc(=O)oc2cc(O)ccc12
What is the building block token for the following molecule?
O=C(O)Cc1cc(=O)oc2cc(O)ccc12
<BB_2711>
What is the molecular formula for <BB_2711>?
The molecular formula for <BB_2711> (O=C(O)Cc1cc(=O)oc2cc(O)ccc12) is C11H8O5.
Describe the ring structures in building block <BB_2711>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2711>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_2711>.
**Token:** <BB_2711> **SMILES:** O=C(O)Cc1cc(=O)oc2cc(O)ccc12 **Molecular Formula:** C11H8O5 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_2712>.
CC(C(=O)O)C(C)C(C)(C)C
What is the building block token for the following molecule?
CC(C(=O)O)C(C)C(C)(C)C
<BB_2712>
What is the molecular formula for <BB_2712>?
The molecular formula for <BB_2712> (CC(C(=O)O)C(C)C(C)(C)C) is C9H18O2.
Describe the ring structures in building block <BB_2712>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2712>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_2712>.
**Token:** <BB_2712> **SMILES:** CC(C(=O)O)C(C)C(C)(C)C **Molecular Formula:** C9H18O2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_2713>.
C[C@H]1[C@H](O)CCN1C(=O)OC(C)(C)C
What is the building block token for the following molecule?
C[C@H]1[C@H](O)CCN1C(=O)OC(C)(C)C
<BB_2713>
What is the molecular formula for <BB_2713>?
The molecular formula for <BB_2713> (C[C@H]1[C@H](O)CCN1C(=O)OC(C)(C)C) is C10H19NO3.
Describe the ring structures in building block <BB_2713>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2713>.
The molecule contains the following groups: Amide, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_2713>.
**Token:** <BB_2713> **SMILES:** C[C@H]1[C@H](O)CCN1C(=O)OC(C)(C)C **Molecular Formula:** C10H19NO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amide, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_2714>.
C#CCCC(=O)C=C
What is the building block token for the following molecule?
C#CCCC(=O)C=C
<BB_2714>
What is the molecular formula for <BB_2714>?
The molecular formula for <BB_2714> (C#CCCC(=O)C=C) is C7H8O.
Describe the ring structures in building block <BB_2714>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2714>.
The molecule contains the following groups: Ketone.
Provide a comprehensive chemical profile for the building block <BB_2714>.
**Token:** <BB_2714> **SMILES:** C#CCCC(=O)C=C **Molecular Formula:** C7H8O **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ketone
Provide the SMILES representation for the building block token <BB_2715>.
COc1cc(OC)c(F)c(CBr)c1F
What is the building block token for the following molecule?
COc1cc(OC)c(F)c(CBr)c1F
<BB_2715>
What is the molecular formula for <BB_2715>?
The molecular formula for <BB_2715> (COc1cc(OC)c(F)c(CBr)c1F) is C9H9BrF2O2.
Describe the ring structures in building block <BB_2715>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2715>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2715>.
**Token:** <BB_2715> **SMILES:** COc1cc(OC)c(F)c(CBr)c1F **Molecular Formula:** C9H9BrF2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2716>.
[N-]=[N+]=Nc1ccccc1OC(F)(F)F
What is the building block token for the following molecule?
[N-]=[N+]=Nc1ccccc1OC(F)(F)F
<BB_2716>
What is the molecular formula for <BB_2716>?
The molecular formula for <BB_2716> ([N-]=[N+]=Nc1ccccc1OC(F)(F)F) is C7H4F3N3O.
Describe the ring structures in building block <BB_2716>.
The molecule contains 1 ring(s): an aromatic ring of size 6.