instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_2750>.
Clc1ccc2scnc2n1
What is the building block token for the following molecule?
Clc1ccc2scnc2n1
<BB_2750>
What is the molecular formula for <BB_2750>?
The molecular formula for <BB_2750> (Clc1ccc2scnc2n1) is C6H3ClN2S.
Describe the ring structures in building block <BB_2750>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2750>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2750>.
**Token:** <BB_2750> **SMILES:** Clc1ccc2scnc2n1 **Molecular Formula:** C6H3ClN2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2751>.
NS(=O)(=O)C1CCN(CCF)CC1
What is the building block token for the following molecule?
NS(=O)(=O)C1CCN(CCF)CC1
<BB_2751>
What is the molecular formula for <BB_2751>?
The molecular formula for <BB_2751> (NS(=O)(=O)C1CCN(CCF)CC1) is C7H15FN2O2S.
Describe the ring structures in building block <BB_2751>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2751>.
The molecule contains the following groups: Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_2751>.
**Token:** <BB_2751> **SMILES:** NS(=O)(=O)C1CCN(CCF)CC1 **Molecular Formula:** C7H15FN2O2S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_2752>.
O=[N+]([O-])c1cnc2ccccc2c1Cl
What is the building block token for the following molecule?
O=[N+]([O-])c1cnc2ccccc2c1Cl
<BB_2752>
What is the molecular formula for <BB_2752>?
The molecular formula for <BB_2752> (O=[N+]([O-])c1cnc2ccccc2c1Cl) is C9H5ClN2O2.
Describe the ring structures in building block <BB_2752>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2752>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_2752>.
**Token:** <BB_2752> **SMILES:** O=[N+]([O-])c1cnc2ccccc2c1Cl **Molecular Formula:** C9H5ClN2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_2753>.
O=C([O-])C1CCC2(COC2)NC1.[Na+]
What is the building block token for the following molecule?
O=C([O-])C1CCC2(COC2)NC1.[Na+]
<BB_2753>
What is the molecular formula for <BB_2753>?
The molecular formula for <BB_2753> (O=C([O-])C1CCC2(COC2)NC1.[Na+]) is C8H12NNaO3.
Describe the ring structures in building block <BB_2753>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 4.
List the primary functional groups present in <BB_2753>.
The molecule contains the following groups: Secondary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_2753>.
**Token:** <BB_2753> **SMILES:** O=C([O-])C1CCC2(COC2)NC1.[Na+] **Molecular Formula:** C8H12NNaO3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** Secondary Amine, Ether
Provide the SMILES representation for the building block token <BB_2754>.
Cl.NCC#CC(F)F
What is the building block token for the following molecule?
Cl.NCC#CC(F)F
<BB_2754>
What is the molecular formula for <BB_2754>?
The molecular formula for <BB_2754> (Cl.NCC#CC(F)F) is C4H6ClF2N.
Describe the ring structures in building block <BB_2754>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2754>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2754>.
**Token:** <BB_2754> **SMILES:** Cl.NCC#CC(F)F **Molecular Formula:** C4H6ClF2N **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2755>.
O=[N+]([O-])c1c(Br)nc2ccccn12
What is the building block token for the following molecule?
O=[N+]([O-])c1c(Br)nc2ccccn12
<BB_2755>
What is the molecular formula for <BB_2755>?
The molecular formula for <BB_2755> (O=[N+]([O-])c1c(Br)nc2ccccn12) is C7H4BrN3O2.
Describe the ring structures in building block <BB_2755>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2755>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_2755>.
**Token:** <BB_2755> **SMILES:** O=[N+]([O-])c1c(Br)nc2ccccn12 **Molecular Formula:** C7H4BrN3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_2756>.
Cl.Cn1c(N)nc2c1CCOC2
What is the building block token for the following molecule?
Cl.Cn1c(N)nc2c1CCOC2
<BB_2756>
What is the molecular formula for <BB_2756>?
The molecular formula for <BB_2756> (Cl.Cn1c(N)nc2c1CCOC2) is C7H12ClN3O.
Describe the ring structures in building block <BB_2756>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2756>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2756>.
**Token:** <BB_2756> **SMILES:** Cl.Cn1c(N)nc2c1CCOC2 **Molecular Formula:** C7H12ClN3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2757>.
CC[C@H](NC(=O)OC(C)(C)C)C(=O)O
What is the building block token for the following molecule?
CC[C@H](NC(=O)OC(C)(C)C)C(=O)O
<BB_2757>
What is the molecular formula for <BB_2757>?
The molecular formula for <BB_2757> (CC[C@H](NC(=O)OC(C)(C)C)C(=O)O) is C9H17NO4.
Describe the ring structures in building block <BB_2757>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2757>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2757>.
**Token:** <BB_2757> **SMILES:** CC[C@H](NC(=O)OC(C)(C)C)C(=O)O **Molecular Formula:** C9H17NO4 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Amide, Ether
Provide the SMILES representation for the building block token <BB_2758>.
O=C(O)c1ccc(C2CC2)c(C(F)(F)F)c1
What is the building block token for the following molecule?
O=C(O)c1ccc(C2CC2)c(C(F)(F)F)c1
<BB_2758>
What is the molecular formula for <BB_2758>?
The molecular formula for <BB_2758> (O=C(O)c1ccc(C2CC2)c(C(F)(F)F)c1) is C11H9F3O2.
Describe the ring structures in building block <BB_2758>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_2758>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2758>.
**Token:** <BB_2758> **SMILES:** O=C(O)c1ccc(C2CC2)c(C(F)(F)F)c1 **Molecular Formula:** C11H9F3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2759>.
[C-]#[N+]CCCN(C)C
What is the building block token for the following molecule?
[C-]#[N+]CCCN(C)C
<BB_2759>
What is the molecular formula for <BB_2759>?
The molecular formula for <BB_2759> ([C-]#[N+]CCCN(C)C) is C6H12N2.
Describe the ring structures in building block <BB_2759>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2759>.
The molecule contains the following groups: Tertiary Amine, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2759>.
**Token:** <BB_2759> **SMILES:** [C-]#[N+]CCCN(C)C **Molecular Formula:** C6H12N2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Tertiary Amine, Nitrile
Provide the SMILES representation for the building block token <BB_2760>.
Nc1cc(O)nn1-c1ccc(C(F)(F)F)cn1
What is the building block token for the following molecule?
Nc1cc(O)nn1-c1ccc(C(F)(F)F)cn1
<BB_2760>
What is the molecular formula for <BB_2760>?
The molecular formula for <BB_2760> (Nc1cc(O)nn1-c1ccc(C(F)(F)F)cn1) is C9H7F3N4O.
Describe the ring structures in building block <BB_2760>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2760>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2760>.
**Token:** <BB_2760> **SMILES:** Nc1cc(O)nn1-c1ccc(C(F)(F)F)cn1 **Molecular Formula:** C9H7F3N4O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2761>.
CC(=O)c1ncnn1-c1ccccc1
What is the building block token for the following molecule?
CC(=O)c1ncnn1-c1ccccc1
<BB_2761>
What is the molecular formula for <BB_2761>?
The molecular formula for <BB_2761> (CC(=O)c1ncnn1-c1ccccc1) is C10H9N3O.
Describe the ring structures in building block <BB_2761>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2761>.
The molecule contains the following groups: Ketone.
Provide a comprehensive chemical profile for the building block <BB_2761>.
**Token:** <BB_2761> **SMILES:** CC(=O)c1ncnn1-c1ccccc1 **Molecular Formula:** C10H9N3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Ketone
Provide the SMILES representation for the building block token <BB_2762>.
O=S(=O)(/C=C/c1ccccc1)NCc1ccccc1
What is the building block token for the following molecule?
O=S(=O)(/C=C/c1ccccc1)NCc1ccccc1
<BB_2762>
What is the molecular formula for <BB_2762>?
The molecular formula for <BB_2762> (O=S(=O)(/C=C/c1ccccc1)NCc1ccccc1) is C15H15NO2S.
Describe the ring structures in building block <BB_2762>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2762>.
The molecule contains the following groups: Secondary Amine, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_2762>.
**Token:** <BB_2762> **SMILES:** O=S(=O)(/C=C/c1ccccc1)NCc1ccccc1 **Molecular Formula:** C15H15NO2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Sulfonamide
Provide the SMILES representation for the building block token <BB_2763>.
OCc1ccsc1Cl
What is the building block token for the following molecule?
OCc1ccsc1Cl
<BB_2763>
What is the molecular formula for <BB_2763>?
The molecular formula for <BB_2763> (OCc1ccsc1Cl) is C5H5ClOS.
Describe the ring structures in building block <BB_2763>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2763>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2763>.
**Token:** <BB_2763> **SMILES:** OCc1ccsc1Cl **Molecular Formula:** C5H5ClOS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2764>.
O=S(=O)(F)c1cccc(S(=O)(=O)Cl)c1
What is the building block token for the following molecule?
O=S(=O)(F)c1cccc(S(=O)(=O)Cl)c1
<BB_2764>
What is the molecular formula for <BB_2764>?
The molecular formula for <BB_2764> (O=S(=O)(F)c1cccc(S(=O)(=O)Cl)c1) is C6H4ClFO4S2.
Describe the ring structures in building block <BB_2764>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2764>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2764>.
**Token:** <BB_2764> **SMILES:** O=S(=O)(F)c1cccc(S(=O)(=O)Cl)c1 **Molecular Formula:** C6H4ClFO4S2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2765>.
C1CCCC2CNCC2CC1.Cl
What is the building block token for the following molecule?
C1CCCC2CNCC2CC1.Cl
<BB_2765>
What is the molecular formula for <BB_2765>?
The molecular formula for <BB_2765> (C1CCCC2CNCC2CC1.Cl) is C10H20ClN.
Describe the ring structures in building block <BB_2765>.
The molecule contains 2 ring(s): an aliphatic ring of size 8, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2765>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2765>.
**Token:** <BB_2765> **SMILES:** C1CCCC2CNCC2CC1.Cl **Molecular Formula:** C10H20ClN **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 8, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2766>.
C#CCn1cc(I)c2c(Cl)nc(Cl)nc21
What is the building block token for the following molecule?
C#CCn1cc(I)c2c(Cl)nc(Cl)nc21
<BB_2766>
What is the molecular formula for <BB_2766>?
The molecular formula for <BB_2766> (C#CCn1cc(I)c2c(Cl)nc(Cl)nc21) is C9H4Cl2IN3.
Describe the ring structures in building block <BB_2766>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.