instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_2716>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2716>.
**Token:** <BB_2716> **SMILES:** [N-]=[N+]=Nc1ccccc1OC(F)(F)F **Molecular Formula:** C7H4F3N3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2717>.
CCNC1CCOc2c(C)cc(F)cc21
What is the building block token for the following molecule?
CCNC1CCOc2c(C)cc(F)cc21
<BB_2717>
What is the molecular formula for <BB_2717>?
The molecular formula for <BB_2717> (CCNC1CCOc2c(C)cc(F)cc21) is C12H16FNO.
Describe the ring structures in building block <BB_2717>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2717>.
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2717>.
**Token:** <BB_2717> **SMILES:** CCNC1CCOc2c(C)cc(F)cc21 **Molecular Formula:** C12H16FNO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2718>.
CNCC1CCCCN1C(=O)OC(C)(C)C
What is the building block token for the following molecule?
CNCC1CCCCN1C(=O)OC(C)(C)C
<BB_2718>
What is the molecular formula for <BB_2718>?
The molecular formula for <BB_2718> (CNCC1CCCCN1C(=O)OC(C)(C)C) is C12H24N2O2.
Describe the ring structures in building block <BB_2718>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2718>.
The molecule contains the following groups: Secondary Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2718>.
**Token:** <BB_2718> **SMILES:** CNCC1CCCCN1C(=O)OC(C)(C)C **Molecular Formula:** C12H24N2O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_2719>.
COC(=O)c1cc(Cl)nnc1N
What is the building block token for the following molecule?
COC(=O)c1cc(Cl)nnc1N
<BB_2719>
What is the molecular formula for <BB_2719>?
The molecular formula for <BB_2719> (COC(=O)c1cc(Cl)nnc1N) is C6H6ClN3O2.
Describe the ring structures in building block <BB_2719>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2719>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2719>.
**Token:** <BB_2719> **SMILES:** COC(=O)c1cc(Cl)nnc1N **Molecular Formula:** C6H6ClN3O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2720>.
CC(C)c1ncc(Br)c(Cl)n1
What is the building block token for the following molecule?
CC(C)c1ncc(Br)c(Cl)n1
<BB_2720>
What is the molecular formula for <BB_2720>?
The molecular formula for <BB_2720> (CC(C)c1ncc(Br)c(Cl)n1) is C7H8BrClN2.
Describe the ring structures in building block <BB_2720>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2720>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2720>.
**Token:** <BB_2720> **SMILES:** CC(C)c1ncc(Br)c(Cl)n1 **Molecular Formula:** C7H8BrClN2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2721>.
N[C@H](CC1CCC(F)(F)C1)C(=O)O
What is the building block token for the following molecule?
N[C@H](CC1CCC(F)(F)C1)C(=O)O
<BB_2721>
What is the molecular formula for <BB_2721>?
The molecular formula for <BB_2721> (N[C@H](CC1CCC(F)(F)C1)C(=O)O) is C8H13F2NO2.
Describe the ring structures in building block <BB_2721>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2721>.
The molecule contains the following groups: Carboxylic Acid, Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2721>.
**Token:** <BB_2721> **SMILES:** N[C@H](CC1CCC(F)(F)C1)C(=O)O **Molecular Formula:** C8H13F2NO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2722>.
O=Cc1ccc2c(c1)CCOC2
What is the building block token for the following molecule?
O=Cc1ccc2c(c1)CCOC2
<BB_2722>
What is the molecular formula for <BB_2722>?
The molecular formula for <BB_2722> (O=Cc1ccc2c(c1)CCOC2) is C10H10O2.
Describe the ring structures in building block <BB_2722>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2722>.
The molecule contains the following groups: Aldehyde, Ether.
Provide a comprehensive chemical profile for the building block <BB_2722>.
**Token:** <BB_2722> **SMILES:** O=Cc1ccc2c(c1)CCOC2 **Molecular Formula:** C10H10O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Aldehyde, Ether
Provide the SMILES representation for the building block token <BB_2723>.
O=C(O)c1[nH]c(=O)[nH]c(=O)c1Cl
What is the building block token for the following molecule?
O=C(O)c1[nH]c(=O)[nH]c(=O)c1Cl
<BB_2723>
What is the molecular formula for <BB_2723>?
The molecular formula for <BB_2723> (O=C(O)c1[nH]c(=O)[nH]c(=O)c1Cl) is C5H3ClN2O4.
Describe the ring structures in building block <BB_2723>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2723>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2723>.
**Token:** <BB_2723> **SMILES:** O=C(O)c1[nH]c(=O)[nH]c(=O)c1Cl **Molecular Formula:** C5H3ClN2O4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2724>.
CC(C)(C)OC(=O)N1CCNC(=O)C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCNC(=O)C1
<BB_2724>
What is the molecular formula for <BB_2724>?
The molecular formula for <BB_2724> (CC(C)(C)OC(=O)N1CCNC(=O)C1) is C9H16N2O3.
Describe the ring structures in building block <BB_2724>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2724>.
The molecule contains the following groups: Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2724>.
**Token:** <BB_2724> **SMILES:** CC(C)(C)OC(=O)N1CCNC(=O)C1 **Molecular Formula:** C9H16N2O3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amide, Ether
Provide the SMILES representation for the building block token <BB_2725>.
O=c1[nH]nc(-c2ccc(Br)cc2)[nH]1
What is the building block token for the following molecule?
O=c1[nH]nc(-c2ccc(Br)cc2)[nH]1
<BB_2725>
What is the molecular formula for <BB_2725>?
The molecular formula for <BB_2725> (O=c1[nH]nc(-c2ccc(Br)cc2)[nH]1) is C8H6BrN3O.
Describe the ring structures in building block <BB_2725>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2725>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2725>.
**Token:** <BB_2725> **SMILES:** O=c1[nH]nc(-c2ccc(Br)cc2)[nH]1 **Molecular Formula:** C8H6BrN3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2726>.
Cl.c1cc2c3c(cccc3c1)CNC2
What is the building block token for the following molecule?
Cl.c1cc2c3c(cccc3c1)CNC2
<BB_2726>
What is the molecular formula for <BB_2726>?
The molecular formula for <BB_2726> (Cl.c1cc2c3c(cccc3c1)CNC2) is C12H12ClN.
Describe the ring structures in building block <BB_2726>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2726>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2726>.
**Token:** <BB_2726> **SMILES:** Cl.c1cc2c3c(cccc3c1)CNC2 **Molecular Formula:** C12H12ClN **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2727>.
O=C(O)c1ccc(-c2ccccc2)c(F)c1
What is the building block token for the following molecule?
O=C(O)c1ccc(-c2ccccc2)c(F)c1
<BB_2727>
What is the molecular formula for <BB_2727>?
The molecular formula for <BB_2727> (O=C(O)c1ccc(-c2ccccc2)c(F)c1) is C13H9FO2.
Describe the ring structures in building block <BB_2727>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2727>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2727>.
**Token:** <BB_2727> **SMILES:** O=C(O)c1ccc(-c2ccccc2)c(F)c1 **Molecular Formula:** C13H9FO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2728>.
Cc1cc(B2OC(C)(C)C(C)(C)O2)ccc1O
What is the building block token for the following molecule?
Cc1cc(B2OC(C)(C)C(C)(C)O2)ccc1O
<BB_2728>
What is the molecular formula for <BB_2728>?
The molecular formula for <BB_2728> (Cc1cc(B2OC(C)(C)C(C)(C)O2)ccc1O) is C13H19BO3.
Describe the ring structures in building block <BB_2728>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2728>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_2728>.
**Token:** <BB_2728> **SMILES:** Cc1cc(B2OC(C)(C)C(C)(C)O2)ccc1O **Molecular Formula:** C13H19BO3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_2729>.
CC1(C)CNC1c1ccco1
What is the building block token for the following molecule?
CC1(C)CNC1c1ccco1
<BB_2729>
What is the molecular formula for <BB_2729>?
The molecular formula for <BB_2729> (CC1(C)CNC1c1ccco1) is C9H13NO.
Describe the ring structures in building block <BB_2729>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aromatic ring of size 5.
List the primary functional groups present in <BB_2729>.
The molecule contains the following groups: Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_2729>.
**Token:** <BB_2729> **SMILES:** CC1(C)CNC1c1ccco1 **Molecular Formula:** C9H13NO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aromatic ring of size 5. **Functional Groups:** Secondary Amine
Provide the SMILES representation for the building block token <BB_2730>.
COc1cc(N2CCC(N(C)C)CC2)ccc1N
What is the building block token for the following molecule?
COc1cc(N2CCC(N(C)C)CC2)ccc1N
<BB_2730>
What is the molecular formula for <BB_2730>?
The molecular formula for <BB_2730> (COc1cc(N2CCC(N(C)C)CC2)ccc1N) is C14H23N3O.
Describe the ring structures in building block <BB_2730>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2730>.
The molecule contains the following groups: Amine, Tertiary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_2730>.
**Token:** <BB_2730> **SMILES:** COc1cc(N2CCC(N(C)C)CC2)ccc1N **Molecular Formula:** C14H23N3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Ether
Provide the SMILES representation for the building block token <BB_2731>.
Cl.O=C(O)C1CC2(CCNCC2)C1
What is the building block token for the following molecule?
Cl.O=C(O)C1CC2(CCNCC2)C1
<BB_2731>
What is the molecular formula for <BB_2731>?
The molecular formula for <BB_2731> (Cl.O=C(O)C1CC2(CCNCC2)C1) is C9H16ClNO2.
Describe the ring structures in building block <BB_2731>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2731>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2731>.
**Token:** <BB_2731> **SMILES:** Cl.O=C(O)C1CC2(CCNCC2)C1 **Molecular Formula:** C9H16ClNO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2732>.
CCCOc1ccccc1C(N)=S
What is the building block token for the following molecule?
CCCOc1ccccc1C(N)=S
<BB_2732>
What is the molecular formula for <BB_2732>?
The molecular formula for <BB_2732> (CCCOc1ccccc1C(N)=S) is C10H13NOS.
Describe the ring structures in building block <BB_2732>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2732>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_2732>.
**Token:** <BB_2732> **SMILES:** CCCOc1ccccc1C(N)=S **Molecular Formula:** C10H13NOS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_2733>.
COc1cncc(CCCO)c1
What is the building block token for the following molecule?
COc1cncc(CCCO)c1
<BB_2733>