instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_2783>?
The molecular formula for <BB_2783> (O=C(Nc1cccc(Cl)c1)c1ccc(Cl)nc1) is C12H8Cl2N2O.
Describe the ring structures in building block <BB_2783>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2783>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2783>.
**Token:** <BB_2783> **SMILES:** O=C(Nc1cccc(Cl)c1)c1ccc(Cl)nc1 **Molecular Formula:** C12H8Cl2N2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2784>.
OC1CN(c2ccc(C(F)(F)F)cn2)C1
What is the building block token for the following molecule?
OC1CN(c2ccc(C(F)(F)F)cn2)C1
<BB_2784>
What is the molecular formula for <BB_2784>?
The molecular formula for <BB_2784> (OC1CN(c2ccc(C(F)(F)F)cn2)C1) is C9H9F3N2O.
Describe the ring structures in building block <BB_2784>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aromatic ring of size 6.
List the primary functional groups present in <BB_2784>.
The molecule contains the following groups: Tertiary Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2784>.
**Token:** <BB_2784> **SMILES:** OC1CN(c2ccc(C(F)(F)F)cn2)C1 **Molecular Formula:** C9H9F3N2O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2785>.
Cc1nn(-c2ccccc2)c(N)c1N.O=S(=O)(O)O
What is the building block token for the following molecule?
Cc1nn(-c2ccccc2)c(N)c1N.O=S(=O)(O)O
<BB_2785>
What is the molecular formula for <BB_2785>?
The molecular formula for <BB_2785> (Cc1nn(-c2ccccc2)c(N)c1N.O=S(=O)(O)O) is C10H14N4O4S.
Describe the ring structures in building block <BB_2785>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2785>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_2785>.
**Token:** <BB_2785> **SMILES:** Cc1nn(-c2ccccc2)c(N)c1N.O=S(=O)(O)O **Molecular Formula:** C10H14N4O4S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_2786>.
C=CCC[C@@H](O)CC
What is the building block token for the following molecule?
C=CCC[C@@H](O)CC
<BB_2786>
What is the molecular formula for <BB_2786>?
The molecular formula for <BB_2786> (C=CCC[C@@H](O)CC) is C7H14O.
Describe the ring structures in building block <BB_2786>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2786>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_2786>.
**Token:** <BB_2786> **SMILES:** C=CCC[C@@H](O)CC **Molecular Formula:** C7H14O **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_2787>.
O=NN1CCCc2ccc(-c3ccccc3)cc21
What is the building block token for the following molecule?
O=NN1CCCc2ccc(-c3ccccc3)cc21
<BB_2787>
What is the molecular formula for <BB_2787>?
The molecular formula for <BB_2787> (O=NN1CCCc2ccc(-c3ccccc3)cc21) is C15H14N2O.
Describe the ring structures in building block <BB_2787>.
The molecule contains 3 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2787>.
The molecule contains the following groups: Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_2787>.
**Token:** <BB_2787> **SMILES:** O=NN1CCCc2ccc(-c3ccccc3)cc21 **Molecular Formula:** C15H14N2O **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Tertiary Amine
Provide the SMILES representation for the building block token <BB_2788>.
CC1N(C)CCOC12CNC2
What is the building block token for the following molecule?
CC1N(C)CCOC12CNC2
<BB_2788>
What is the molecular formula for <BB_2788>?
The molecular formula for <BB_2788> (CC1N(C)CCOC12CNC2) is C8H16N2O.
Describe the ring structures in building block <BB_2788>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 4.
List the primary functional groups present in <BB_2788>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_2788>.
**Token:** <BB_2788> **SMILES:** CC1N(C)CCOC12CNC2 **Molecular Formula:** C8H16N2O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** Secondary Amine, Tertiary Amine, Ether
Provide the SMILES representation for the building block token <BB_2789>.
NC1(Cc2cccc(F)c2)CCOCC1
What is the building block token for the following molecule?
NC1(Cc2cccc(F)c2)CCOCC1
<BB_2789>
What is the molecular formula for <BB_2789>?
The molecular formula for <BB_2789> (NC1(Cc2cccc(F)c2)CCOCC1) is C12H16FNO.
Describe the ring structures in building block <BB_2789>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2789>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2789>.
**Token:** <BB_2789> **SMILES:** NC1(Cc2cccc(F)c2)CCOCC1 **Molecular Formula:** C12H16FNO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2790>.
Nc1cc(C2OCCO2)ccc1[N+](=O)[O-]
What is the building block token for the following molecule?
Nc1cc(C2OCCO2)ccc1[N+](=O)[O-]
<BB_2790>
What is the molecular formula for <BB_2790>?
The molecular formula for <BB_2790> (Nc1cc(C2OCCO2)ccc1[N+](=O)[O-]) is C9H10N2O4.
Describe the ring structures in building block <BB_2790>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2790>.
The molecule contains the following groups: Amine, Tertiary Amine, Ether, Nitro.
Provide a comprehensive chemical profile for the building block <BB_2790>.
**Token:** <BB_2790> **SMILES:** Nc1cc(C2OCCO2)ccc1[N+](=O)[O-] **Molecular Formula:** C9H10N2O4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amine, Tertiary Amine, Ether, Nitro
Provide the SMILES representation for the building block token <BB_2791>.
CC(C)(C)OC(=O)N1CCCC(OCCN)C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCCC(OCCN)C1
<BB_2791>
What is the molecular formula for <BB_2791>?
The molecular formula for <BB_2791> (CC(C)(C)OC(=O)N1CCCC(OCCN)C1) is C12H24N2O3.
Describe the ring structures in building block <BB_2791>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2791>.
The molecule contains the following groups: Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2791>.
**Token:** <BB_2791> **SMILES:** CC(C)(C)OC(=O)N1CCCC(OCCN)C1 **Molecular Formula:** C12H24N2O3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_2792>.
Cc1nc2ccc(Br)cc2cc1C(=O)O
What is the building block token for the following molecule?
Cc1nc2ccc(Br)cc2cc1C(=O)O
<BB_2792>
What is the molecular formula for <BB_2792>?
The molecular formula for <BB_2792> (Cc1nc2ccc(Br)cc2cc1C(=O)O) is C11H8BrNO2.
Describe the ring structures in building block <BB_2792>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2792>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2792>.
**Token:** <BB_2792> **SMILES:** Cc1nc2ccc(Br)cc2cc1C(=O)O **Molecular Formula:** C11H8BrNO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2793>.
Cl.N[C@H]1CCCC[C@H]1n1cc(C(=O)O)nn1
What is the building block token for the following molecule?
Cl.N[C@H]1CCCC[C@H]1n1cc(C(=O)O)nn1
<BB_2793>
What is the molecular formula for <BB_2793>?
The molecular formula for <BB_2793> (Cl.N[C@H]1CCCC[C@H]1n1cc(C(=O)O)nn1) is C9H15ClN4O2.
Describe the ring structures in building block <BB_2793>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2793>.
The molecule contains the following groups: Carboxylic Acid, Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2793>.
**Token:** <BB_2793> **SMILES:** Cl.N[C@H]1CCCC[C@H]1n1cc(C(=O)O)nn1 **Molecular Formula:** C9H15ClN4O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2794>.
Nc1cnc2c(Cl)cccn12
What is the building block token for the following molecule?
Nc1cnc2c(Cl)cccn12
<BB_2794>
What is the molecular formula for <BB_2794>?
The molecular formula for <BB_2794> (Nc1cnc2c(Cl)cccn12) is C7H6ClN3.
Describe the ring structures in building block <BB_2794>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2794>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2794>.
**Token:** <BB_2794> **SMILES:** Nc1cnc2c(Cl)cccn12 **Molecular Formula:** C7H6ClN3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2795>.
CC(C)(C)OC1CC(=O)C1n1cccn1
What is the building block token for the following molecule?
CC(C)(C)OC1CC(=O)C1n1cccn1
<BB_2795>
What is the molecular formula for <BB_2795>?
The molecular formula for <BB_2795> (CC(C)(C)OC1CC(=O)C1n1cccn1) is C11H16N2O2.
Describe the ring structures in building block <BB_2795>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aromatic ring of size 5.
List the primary functional groups present in <BB_2795>.
The molecule contains the following groups: Ketone, Ether.
Provide a comprehensive chemical profile for the building block <BB_2795>.
**Token:** <BB_2795> **SMILES:** CC(C)(C)OC1CC(=O)C1n1cccn1 **Molecular Formula:** C11H16N2O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aromatic ring of size 5. **Functional Groups:** Ketone, Ether
Provide the SMILES representation for the building block token <BB_2796>.
CC(C)(C)OC(=O)NC1CCC(S(C)(=N)=O)C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NC1CCC(S(C)(=N)=O)C1
<BB_2796>
What is the molecular formula for <BB_2796>?
The molecular formula for <BB_2796> (CC(C)(C)OC(=O)NC1CCC(S(C)(=N)=O)C1) is C11H22N2O3S.
Describe the ring structures in building block <BB_2796>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2796>.
The molecule contains the following groups: Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2796>.
**Token:** <BB_2796> **SMILES:** CC(C)(C)OC(=O)NC1CCC(S(C)(=N)=O)C1 **Molecular Formula:** C11H22N2O3S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amide, Ether
Provide the SMILES representation for the building block token <BB_2797>.
O=C(O)C1CCN(C(=O)c2cccs2)CC1
What is the building block token for the following molecule?
O=C(O)C1CCN(C(=O)c2cccs2)CC1
<BB_2797>
What is the molecular formula for <BB_2797>?
The molecular formula for <BB_2797> (O=C(O)C1CCN(C(=O)c2cccs2)CC1) is C11H13NO3S.
Describe the ring structures in building block <BB_2797>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2797>.
The molecule contains the following groups: Carboxylic Acid, Amide.
Provide a comprehensive chemical profile for the building block <BB_2797>.
**Token:** <BB_2797> **SMILES:** O=C(O)C1CCN(C(=O)c2cccs2)CC1 **Molecular Formula:** C11H13NO3S **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Amide
Provide the SMILES representation for the building block token <BB_2798>.
CC(=O)C1(C)CCCC1
What is the building block token for the following molecule?
CC(=O)C1(C)CCCC1
<BB_2798>
What is the molecular formula for <BB_2798>?
The molecular formula for <BB_2798> (CC(=O)C1(C)CCCC1) is C8H14O.
Describe the ring structures in building block <BB_2798>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2798>.
The molecule contains the following groups: Ketone.
Provide a comprehensive chemical profile for the building block <BB_2798>.
**Token:** <BB_2798> **SMILES:** CC(=O)C1(C)CCCC1 **Molecular Formula:** C8H14O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Ketone
Provide the SMILES representation for the building block token <BB_2799>.
CCOC(=O)c1[nH]c(C)c(C(=O)OCCOC)c1C
What is the building block token for the following molecule?
CCOC(=O)c1[nH]c(C)c(C(=O)OCCOC)c1C
<BB_2799>
What is the molecular formula for <BB_2799>?
The molecular formula for <BB_2799> (CCOC(=O)c1[nH]c(C)c(C(=O)OCCOC)c1C) is C13H19NO5.
Describe the ring structures in building block <BB_2799>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2799>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_2799>.
**Token:** <BB_2799> **SMILES:** CCOC(=O)c1[nH]c(C)c(C(=O)OCCOC)c1C **Molecular Formula:** C13H19NO5 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ester, Ether