instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_2816>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_2816>.
**Token:** <BB_2816> **SMILES:** O=Cc1nc(C2CC2)no1 **Molecular Formula:** C6H6N2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_2817>.
CC(C)CCC(=O)CCN(C)C
What is the building block token for the following molecule?
CC(C)CCC(=O)CCN(C)C
<BB_2817>
What is the molecular formula for <BB_2817>?
The molecular formula for <BB_2817> (CC(C)CCC(=O)CCN(C)C) is C10H21NO.
Describe the ring structures in building block <BB_2817>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_2817>.
The molecule contains the following groups: Tertiary Amine, Ketone.
Provide a comprehensive chemical profile for the building block <BB_2817>.
**Token:** <BB_2817> **SMILES:** CC(C)CCC(=O)CCN(C)C **Molecular Formula:** C10H21NO **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Tertiary Amine, Ketone
Provide the SMILES representation for the building block token <BB_2818>.
NCC1CCCS1(=O)=O
What is the building block token for the following molecule?
NCC1CCCS1(=O)=O
<BB_2818>
What is the molecular formula for <BB_2818>?
The molecular formula for <BB_2818> (NCC1CCCS1(=O)=O) is C5H11NO2S.
Describe the ring structures in building block <BB_2818>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2818>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_2818>.
**Token:** <BB_2818> **SMILES:** NCC1CCCS1(=O)=O **Molecular Formula:** C5H11NO2S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_2819>.
Cc1nn(CCCO)c(C)c1Cl
What is the building block token for the following molecule?
Cc1nn(CCCO)c(C)c1Cl
<BB_2819>
What is the molecular formula for <BB_2819>?
The molecular formula for <BB_2819> (Cc1nn(CCCO)c(C)c1Cl) is C8H13ClN2O.
Describe the ring structures in building block <BB_2819>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2819>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2819>.
**Token:** <BB_2819> **SMILES:** Cc1nn(CCCO)c(C)c1Cl **Molecular Formula:** C8H13ClN2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2820>.
CCCc1cc(CCl)on1
What is the building block token for the following molecule?
CCCc1cc(CCl)on1
<BB_2820>
What is the molecular formula for <BB_2820>?
The molecular formula for <BB_2820> (CCCc1cc(CCl)on1) is C7H10ClNO.
Describe the ring structures in building block <BB_2820>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2820>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2820>.
**Token:** <BB_2820> **SMILES:** CCCc1cc(CCl)on1 **Molecular Formula:** C7H10ClNO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2821>.
CC(C)(C)OC(=O)N1CCC(C23CC(C=O)(C2)C3)C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCC(C23CC(C=O)(C2)C3)C1
<BB_2821>
What is the molecular formula for <BB_2821>?
The molecular formula for <BB_2821> (CC(C)(C)OC(=O)N1CCC(C23CC(C=O)(C2)C3)C1) is C15H23NO3.
Describe the ring structures in building block <BB_2821>.
The molecule contains 4 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4, an aliphatic ring of size 5, an aliphatic ring of size 4.
List the primary functional groups present in <BB_2821>.
The molecule contains the following groups: Amide, Aldehyde, Ether.
Provide a comprehensive chemical profile for the building block <BB_2821>.
**Token:** <BB_2821> **SMILES:** CC(C)(C)OC(=O)N1CCC(C23CC(C=O)(C2)C3)C1 **Molecular Formula:** C15H23NO3 **Ring System:** The molecule contains 4 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4, an aliphatic ring of size 5, an aliphatic ring of size 4. **Functional Groups:** Amide, Aldehyde, Ether
Provide the SMILES representation for the building block token <BB_2822>.
CCCCCOc1ccc(C=O)cc1
What is the building block token for the following molecule?
CCCCCOc1ccc(C=O)cc1
<BB_2822>
What is the molecular formula for <BB_2822>?
The molecular formula for <BB_2822> (CCCCCOc1ccc(C=O)cc1) is C12H16O2.
Describe the ring structures in building block <BB_2822>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2822>.
The molecule contains the following groups: Aldehyde, Ether.
Provide a comprehensive chemical profile for the building block <BB_2822>.
**Token:** <BB_2822> **SMILES:** CCCCCOc1ccc(C=O)cc1 **Molecular Formula:** C12H16O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde, Ether
Provide the SMILES representation for the building block token <BB_2823>.
Cl.NCc1nnc(S)n1C1CC1
What is the building block token for the following molecule?
Cl.NCc1nnc(S)n1C1CC1
<BB_2823>
What is the molecular formula for <BB_2823>?
The molecular formula for <BB_2823> (Cl.NCc1nnc(S)n1C1CC1) is C6H11ClN4S.
Describe the ring structures in building block <BB_2823>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_2823>.
The molecule contains the following groups: Amine, Thiol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2823>.
**Token:** <BB_2823> **SMILES:** Cl.NCc1nnc(S)n1C1CC1 **Molecular Formula:** C6H11ClN4S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Amine, Thiol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2824>.
OC1CC2(CCOC2)C1
What is the building block token for the following molecule?
OC1CC2(CCOC2)C1
<BB_2824>
What is the molecular formula for <BB_2824>?
The molecular formula for <BB_2824> (OC1CC2(CCOC2)C1) is C7H12O2.
Describe the ring structures in building block <BB_2824>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2824>.
The molecule contains the following groups: Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_2824>.
**Token:** <BB_2824> **SMILES:** OC1CC2(CCOC2)C1 **Molecular Formula:** C7H12O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 5. **Functional Groups:** Alcohol, Ether
Provide the SMILES representation for the building block token <BB_2825>.
COC(=O)c1ccc([N+](=O)[O-])c(CBr)c1
What is the building block token for the following molecule?
COC(=O)c1ccc([N+](=O)[O-])c(CBr)c1
<BB_2825>
What is the molecular formula for <BB_2825>?
The molecular formula for <BB_2825> (COC(=O)c1ccc([N+](=O)[O-])c(CBr)c1) is C9H8BrNO4.
Describe the ring structures in building block <BB_2825>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2825>.
The molecule contains the following groups: Tertiary Amine, Ester, Ether, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_2825>.
**Token:** <BB_2825> **SMILES:** COC(=O)c1ccc([N+](=O)[O-])c(CBr)c1 **Molecular Formula:** C9H8BrNO4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Ester, Ether, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_2826>.
COC(=O)NCC1CCCNC1.Cl
What is the building block token for the following molecule?
COC(=O)NCC1CCCNC1.Cl
<BB_2826>
What is the molecular formula for <BB_2826>?
The molecular formula for <BB_2826> (COC(=O)NCC1CCCNC1.Cl) is C8H17ClN2O2.
Describe the ring structures in building block <BB_2826>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2826>.
The molecule contains the following groups: Secondary Amine, Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2826>.
**Token:** <BB_2826> **SMILES:** COC(=O)NCC1CCCNC1.Cl **Molecular Formula:** C8H17ClN2O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2827>.
Cc1cc(C)c(I)c(CO)c1
What is the building block token for the following molecule?
Cc1cc(C)c(I)c(CO)c1
<BB_2827>
What is the molecular formula for <BB_2827>?
The molecular formula for <BB_2827> (Cc1cc(C)c(I)c(CO)c1) is C9H11IO.
Describe the ring structures in building block <BB_2827>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2827>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2827>.
**Token:** <BB_2827> **SMILES:** Cc1cc(C)c(I)c(CO)c1 **Molecular Formula:** C9H11IO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2828>.
CC(C)(C)OC(=O)N1CCC(CO)C12CCC2
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCC(CO)C12CCC2
<BB_2828>
What is the molecular formula for <BB_2828>?
The molecular formula for <BB_2828> (CC(C)(C)OC(=O)N1CCC(CO)C12CCC2) is C13H23NO3.
Describe the ring structures in building block <BB_2828>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 4.
List the primary functional groups present in <BB_2828>.
The molecule contains the following groups: Amide, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_2828>.
**Token:** <BB_2828> **SMILES:** CC(C)(C)OC(=O)N1CCC(CO)C12CCC2 **Molecular Formula:** C13H23NO3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 4. **Functional Groups:** Amide, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_2829>.
Cl.O=C(O)C1CSCC(C(=O)O)N1
What is the building block token for the following molecule?
Cl.O=C(O)C1CSCC(C(=O)O)N1
<BB_2829>
What is the molecular formula for <BB_2829>?
The molecular formula for <BB_2829> (Cl.O=C(O)C1CSCC(C(=O)O)N1) is C6H10ClNO4S.
Describe the ring structures in building block <BB_2829>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2829>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Sulfide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2829>.
**Token:** <BB_2829> **SMILES:** Cl.O=C(O)C1CSCC(C(=O)O)N1 **Molecular Formula:** C6H10ClNO4S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Secondary Amine, Sulfide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2830>.
O=S(=O)(Cl)c1[nH]nc2c1CCC2
What is the building block token for the following molecule?
O=S(=O)(Cl)c1[nH]nc2c1CCC2
<BB_2830>
What is the molecular formula for <BB_2830>?
The molecular formula for <BB_2830> (O=S(=O)(Cl)c1[nH]nc2c1CCC2) is C6H7ClN2O2S.
Describe the ring structures in building block <BB_2830>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2830>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2830>.
**Token:** <BB_2830> **SMILES:** O=S(=O)(Cl)c1[nH]nc2c1CCC2 **Molecular Formula:** C6H7ClN2O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2831>.
Cl.Fc1cccc(F)c1C1CCCN1
What is the building block token for the following molecule?
Cl.Fc1cccc(F)c1C1CCCN1
<BB_2831>
What is the molecular formula for <BB_2831>?
The molecular formula for <BB_2831> (Cl.Fc1cccc(F)c1C1CCCN1) is C10H12ClF2N.
Describe the ring structures in building block <BB_2831>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2831>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2831>.
**Token:** <BB_2831> **SMILES:** Cl.Fc1cccc(F)c1C1CCCN1 **Molecular Formula:** C10H12ClF2N **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2832>.
CNC(=O)[C@H]1CC[C@@H](c2ccccc2)N1.Cl
What is the building block token for the following molecule?
CNC(=O)[C@H]1CC[C@@H](c2ccccc2)N1.Cl
<BB_2832>
What is the molecular formula for <BB_2832>?
The molecular formula for <BB_2832> (CNC(=O)[C@H]1CC[C@@H](c2ccccc2)N1.Cl) is C12H17ClN2O.
Describe the ring structures in building block <BB_2832>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2832>.
The molecule contains the following groups: Secondary Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2832>.
**Token:** <BB_2832> **SMILES:** CNC(=O)[C@H]1CC[C@@H](c2ccccc2)N1.Cl **Molecular Formula:** C12H17ClN2O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2833>.
C[C@H]1C[C@H](N)CCN1C(=O)OC(C)(C)C.Cl
What is the building block token for the following molecule?
C[C@H]1C[C@H](N)CCN1C(=O)OC(C)(C)C.Cl
<BB_2833>