instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_2800>.
Cl.Cn1nccc1C(N)C(F)F
What is the building block token for the following molecule?
Cl.Cn1nccc1C(N)C(F)F
<BB_2800>
What is the molecular formula for <BB_2800>?
The molecular formula for <BB_2800> (Cl.Cn1nccc1C(N)C(F)F) is C6H10ClF2N3.
Describe the ring structures in building block <BB_2800>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2800>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2800>.
**Token:** <BB_2800> **SMILES:** Cl.Cn1nccc1C(N)C(F)F **Molecular Formula:** C6H10ClF2N3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2801>.
CC(C)c1cccc(NC(N)=S)c1
What is the building block token for the following molecule?
CC(C)c1cccc(NC(N)=S)c1
<BB_2801>
What is the molecular formula for <BB_2801>?
The molecular formula for <BB_2801> (CC(C)c1cccc(NC(N)=S)c1) is C10H14N2S.
Describe the ring structures in building block <BB_2801>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2801>.
The molecule contains the following groups: Amine, Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_2801>.
**Token:** <BB_2801> **SMILES:** CC(C)c1cccc(NC(N)=S)c1 **Molecular Formula:** C10H14N2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine
Provide the SMILES representation for the building block token <BB_2802>.
COC(=O)c1ccco1
What is the building block token for the following molecule?
COC(=O)c1ccco1
<BB_2802>
What is the molecular formula for <BB_2802>?
The molecular formula for <BB_2802> (COC(=O)c1ccco1) is C6H6O3.
Describe the ring structures in building block <BB_2802>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2802>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_2802>.
**Token:** <BB_2802> **SMILES:** COC(=O)c1ccco1 **Molecular Formula:** C6H6O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_2803>.
CC(C)(C)OC(=O)N1CC2(CC(O)CNC2=O)C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CC2(CC(O)CNC2=O)C1
<BB_2803>
What is the molecular formula for <BB_2803>?
The molecular formula for <BB_2803> (CC(C)(C)OC(=O)N1CC2(CC(O)CNC2=O)C1) is C12H20N2O4.
Describe the ring structures in building block <BB_2803>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2803>.
The molecule contains the following groups: Amide, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_2803>.
**Token:** <BB_2803> **SMILES:** CC(C)(C)OC(=O)N1CC2(CC(O)CNC2=O)C1 **Molecular Formula:** C12H20N2O4 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 6. **Functional Groups:** Amide, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_2804>.
[N-]=[N+]=NCc1cnn(-c2ccccc2)c1
What is the building block token for the following molecule?
[N-]=[N+]=NCc1cnn(-c2ccccc2)c1
<BB_2804>
What is the molecular formula for <BB_2804>?
The molecular formula for <BB_2804> ([N-]=[N+]=NCc1cnn(-c2ccccc2)c1) is C10H9N5.
Describe the ring structures in building block <BB_2804>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2804>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_2804>.
**Token:** <BB_2804> **SMILES:** [N-]=[N+]=NCc1cnn(-c2ccccc2)c1 **Molecular Formula:** C10H9N5 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_2805>.
Cc1cc(Cl)cc(C=O)n1
What is the building block token for the following molecule?
Cc1cc(Cl)cc(C=O)n1
<BB_2805>
What is the molecular formula for <BB_2805>?
The molecular formula for <BB_2805> (Cc1cc(Cl)cc(C=O)n1) is C7H6ClNO.
Describe the ring structures in building block <BB_2805>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2805>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2805>.
**Token:** <BB_2805> **SMILES:** Cc1cc(Cl)cc(C=O)n1 **Molecular Formula:** C7H6ClNO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2806>.
Fc1sccc1I
What is the building block token for the following molecule?
Fc1sccc1I
<BB_2806>
What is the molecular formula for <BB_2806>?
The molecular formula for <BB_2806> (Fc1sccc1I) is C4H2FIS.
Describe the ring structures in building block <BB_2806>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2806>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2806>.
**Token:** <BB_2806> **SMILES:** Fc1sccc1I **Molecular Formula:** C4H2FIS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2807>.
Nc1ccccc1CN1CCCC1
What is the building block token for the following molecule?
Nc1ccccc1CN1CCCC1
<BB_2807>
What is the molecular formula for <BB_2807>?
The molecular formula for <BB_2807> (Nc1ccccc1CN1CCCC1) is C11H16N2.
Describe the ring structures in building block <BB_2807>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2807>.
The molecule contains the following groups: Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_2807>.
**Token:** <BB_2807> **SMILES:** Nc1ccccc1CN1CCCC1 **Molecular Formula:** C11H16N2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_2808>.
Cc1c(Cl)ccnc1CCl.Cl
What is the building block token for the following molecule?
Cc1c(Cl)ccnc1CCl.Cl
<BB_2808>
What is the molecular formula for <BB_2808>?
The molecular formula for <BB_2808> (Cc1c(Cl)ccnc1CCl.Cl) is C7H8Cl3N.
Describe the ring structures in building block <BB_2808>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2808>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2808>.
**Token:** <BB_2808> **SMILES:** Cc1c(Cl)ccnc1CCl.Cl **Molecular Formula:** C7H8Cl3N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2809>.
CCC(CCl)c1cccc(Br)c1
What is the building block token for the following molecule?
CCC(CCl)c1cccc(Br)c1
<BB_2809>
What is the molecular formula for <BB_2809>?
The molecular formula for <BB_2809> (CCC(CCl)c1cccc(Br)c1) is C10H12BrCl.
Describe the ring structures in building block <BB_2809>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2809>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2809>.
**Token:** <BB_2809> **SMILES:** CCC(CCl)c1cccc(Br)c1 **Molecular Formula:** C10H12BrCl **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2810>.
O=C(O)c1cc2cnccc2s1
What is the building block token for the following molecule?
O=C(O)c1cc2cnccc2s1
<BB_2810>
What is the molecular formula for <BB_2810>?
The molecular formula for <BB_2810> (O=C(O)c1cc2cnccc2s1) is C8H5NO2S.
Describe the ring structures in building block <BB_2810>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2810>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_2810>.
**Token:** <BB_2810> **SMILES:** O=C(O)c1cc2cnccc2s1 **Molecular Formula:** C8H5NO2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_2811>.
Cl.O=C(O)CCCN1CCCC1
What is the building block token for the following molecule?
Cl.O=C(O)CCCN1CCCC1
<BB_2811>
What is the molecular formula for <BB_2811>?
The molecular formula for <BB_2811> (Cl.O=C(O)CCCN1CCCC1) is C8H16ClNO2.
Describe the ring structures in building block <BB_2811>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_2811>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2811>.
**Token:** <BB_2811> **SMILES:** Cl.O=C(O)CCCN1CCCC1 **Molecular Formula:** C8H16ClNO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2812>.
CC(C)(C)OC(=O)NC1CC=CCC1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NC1CC=CCC1
<BB_2812>
What is the molecular formula for <BB_2812>?
The molecular formula for <BB_2812> (CC(C)(C)OC(=O)NC1CC=CCC1) is C11H19NO2.
Describe the ring structures in building block <BB_2812>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2812>.
The molecule contains the following groups: Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_2812>.
**Token:** <BB_2812> **SMILES:** CC(C)(C)OC(=O)NC1CC=CCC1 **Molecular Formula:** C11H19NO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amide, Ether
Provide the SMILES representation for the building block token <BB_2813>.
COc1cc(CN)ccc1OCCO
What is the building block token for the following molecule?
COc1cc(CN)ccc1OCCO
<BB_2813>
What is the molecular formula for <BB_2813>?
The molecular formula for <BB_2813> (COc1cc(CN)ccc1OCCO) is C10H15NO3.
Describe the ring structures in building block <BB_2813>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2813>.
The molecule contains the following groups: Amine, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_2813>.
**Token:** <BB_2813> **SMILES:** COc1cc(CN)ccc1OCCO **Molecular Formula:** C10H15NO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_2814>.
COC(=O)CC(C)Nc1ccc2c(c1)OCO2
What is the building block token for the following molecule?
COC(=O)CC(C)Nc1ccc2c(c1)OCO2
<BB_2814>
What is the molecular formula for <BB_2814>?
The molecular formula for <BB_2814> (COC(=O)CC(C)Nc1ccc2c(c1)OCO2) is C12H15NO4.
Describe the ring structures in building block <BB_2814>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2814>.
The molecule contains the following groups: Secondary Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_2814>.
**Token:** <BB_2814> **SMILES:** COC(=O)CC(C)Nc1ccc2c(c1)OCO2 **Molecular Formula:** C12H15NO4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_2815>.
NC[C@@H]1CCO[C@H]1c1ccccc1
What is the building block token for the following molecule?
NC[C@@H]1CCO[C@H]1c1ccccc1
<BB_2815>
What is the molecular formula for <BB_2815>?
The molecular formula for <BB_2815> (NC[C@@H]1CCO[C@H]1c1ccccc1) is C11H15NO.
Describe the ring structures in building block <BB_2815>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_2815>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_2815>.
**Token:** <BB_2815> **SMILES:** NC[C@@H]1CCO[C@H]1c1ccccc1 **Molecular Formula:** C11H15NO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_2816>.
O=Cc1nc(C2CC2)no1
What is the building block token for the following molecule?
O=Cc1nc(C2CC2)no1
<BB_2816>
What is the molecular formula for <BB_2816>?
The molecular formula for <BB_2816> (O=Cc1nc(C2CC2)no1) is C6H6N2O2.
Describe the ring structures in building block <BB_2816>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3.