instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_2833>?
The molecular formula for <BB_2833> (C[C@H]1C[C@H](N)CCN1C(=O)OC(C)(C)C.Cl) is C11H23ClN2O2.
Describe the ring structures in building block <BB_2833>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2833>.
The molecule contains the following groups: Amine, Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2833>.
**Token:** <BB_2833> **SMILES:** C[C@H]1C[C@H](N)CCN1C(=O)OC(C)(C)C.Cl **Molecular Formula:** C11H23ClN2O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2834>.
Nc1ccc(NC2CCCC2)nc1
What is the building block token for the following molecule?
Nc1ccc(NC2CCCC2)nc1
<BB_2834>
What is the molecular formula for <BB_2834>?
The molecular formula for <BB_2834> (Nc1ccc(NC2CCCC2)nc1) is C10H15N3.
Describe the ring structures in building block <BB_2834>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_2834>.
The molecule contains the following groups: Amine, Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_2834>.
**Token:** <BB_2834> **SMILES:** Nc1ccc(NC2CCCC2)nc1 **Molecular Formula:** C10H15N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amine, Secondary Amine
Provide the SMILES representation for the building block token <BB_2835>.
CC(=O)c1nc(C)c(C)n1C
What is the building block token for the following molecule?
CC(=O)c1nc(C)c(C)n1C
<BB_2835>
What is the molecular formula for <BB_2835>?
The molecular formula for <BB_2835> (CC(=O)c1nc(C)c(C)n1C) is C8H12N2O.
Describe the ring structures in building block <BB_2835>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2835>.
The molecule contains the following groups: Ketone.
Provide a comprehensive chemical profile for the building block <BB_2835>.
**Token:** <BB_2835> **SMILES:** CC(=O)c1nc(C)c(C)n1C **Molecular Formula:** C8H12N2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ketone
Provide the SMILES representation for the building block token <BB_2836>.
CC(C#N)Sc1ccccc1
What is the building block token for the following molecule?
CC(C#N)Sc1ccccc1
<BB_2836>
What is the molecular formula for <BB_2836>?
The molecular formula for <BB_2836> (CC(C#N)Sc1ccccc1) is C9H9NS.
Describe the ring structures in building block <BB_2836>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2836>.
The molecule contains the following groups: Sulfide, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_2836>.
**Token:** <BB_2836> **SMILES:** CC(C#N)Sc1ccccc1 **Molecular Formula:** C9H9NS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Sulfide, Nitrile
Provide the SMILES representation for the building block token <BB_2837>.
Cc1cc(C)n(C2CCCCO2)n1
What is the building block token for the following molecule?
Cc1cc(C)n(C2CCCCO2)n1
<BB_2837>
What is the molecular formula for <BB_2837>?
The molecular formula for <BB_2837> (Cc1cc(C)n(C2CCCCO2)n1) is C10H16N2O.
Describe the ring structures in building block <BB_2837>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_2837>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_2837>.
**Token:** <BB_2837> **SMILES:** Cc1cc(C)n(C2CCCCO2)n1 **Molecular Formula:** C10H16N2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_2838>.
CC[C@H](N)c1cccc(F)c1.Cl
What is the building block token for the following molecule?
CC[C@H](N)c1cccc(F)c1.Cl
<BB_2838>
What is the molecular formula for <BB_2838>?
The molecular formula for <BB_2838> (CC[C@H](N)c1cccc(F)c1.Cl) is C9H13ClFN.
Describe the ring structures in building block <BB_2838>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2838>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2838>.
**Token:** <BB_2838> **SMILES:** CC[C@H](N)c1cccc(F)c1.Cl **Molecular Formula:** C9H13ClFN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2839>.
Cc1cc(F)c(B(O)O)cc1F
What is the building block token for the following molecule?
Cc1cc(F)c(B(O)O)cc1F
<BB_2839>
What is the molecular formula for <BB_2839>?
The molecular formula for <BB_2839> (Cc1cc(F)c(B(O)O)cc1F) is C7H7BF2O2.
Describe the ring structures in building block <BB_2839>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2839>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2839>.
**Token:** <BB_2839> **SMILES:** Cc1cc(F)c(B(O)O)cc1F **Molecular Formula:** C7H7BF2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2840>.
CC(C)c1nnc(CBr)s1
What is the building block token for the following molecule?
CC(C)c1nnc(CBr)s1
<BB_2840>
What is the molecular formula for <BB_2840>?
The molecular formula for <BB_2840> (CC(C)c1nnc(CBr)s1) is C6H9BrN2S.
Describe the ring structures in building block <BB_2840>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2840>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2840>.
**Token:** <BB_2840> **SMILES:** CC(C)c1nnc(CBr)s1 **Molecular Formula:** C6H9BrN2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2841>.
OCc1nc[nH]n1
What is the building block token for the following molecule?
OCc1nc[nH]n1
<BB_2841>
What is the molecular formula for <BB_2841>?
The molecular formula for <BB_2841> (OCc1nc[nH]n1) is C3H5N3O.
Describe the ring structures in building block <BB_2841>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2841>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_2841>.
**Token:** <BB_2841> **SMILES:** OCc1nc[nH]n1 **Molecular Formula:** C3H5N3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_2842>.
CC1CCN(C(=O)CCCc2ccccc2)CC1
What is the building block token for the following molecule?
CC1CCN(C(=O)CCCc2ccccc2)CC1
<BB_2842>
What is the molecular formula for <BB_2842>?
The molecular formula for <BB_2842> (CC1CCN(C(=O)CCCc2ccccc2)CC1) is C16H23NO.
Describe the ring structures in building block <BB_2842>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_2842>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_2842>.
**Token:** <BB_2842> **SMILES:** CC1CCN(C(=O)CCCc2ccccc2)CC1 **Molecular Formula:** C16H23NO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_2843>.
CCOC(=O)C(F)(F)C1CCCC(=O)C1
What is the building block token for the following molecule?
CCOC(=O)C(F)(F)C1CCCC(=O)C1
<BB_2843>
What is the molecular formula for <BB_2843>?
The molecular formula for <BB_2843> (CCOC(=O)C(F)(F)C1CCCC(=O)C1) is C10H14F2O3.
Describe the ring structures in building block <BB_2843>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_2843>.
The molecule contains the following groups: Ester, Ketone, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2843>.
**Token:** <BB_2843> **SMILES:** CCOC(=O)C(F)(F)C1CCCC(=O)C1 **Molecular Formula:** C10H14F2O3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Ester, Ketone, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2844>.
COC(=O)c1sc(NC(=O)OC(C)(C)C)nc1C
What is the building block token for the following molecule?
COC(=O)c1sc(NC(=O)OC(C)(C)C)nc1C
<BB_2844>
What is the molecular formula for <BB_2844>?
The molecular formula for <BB_2844> (COC(=O)c1sc(NC(=O)OC(C)(C)C)nc1C) is C11H16N2O4S.
Describe the ring structures in building block <BB_2844>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2844>.
The molecule contains the following groups: Amide, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_2844>.
**Token:** <BB_2844> **SMILES:** COC(=O)c1sc(NC(=O)OC(C)(C)C)nc1C **Molecular Formula:** C11H16N2O4S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amide, Ester, Ether
Provide the SMILES representation for the building block token <BB_2845>.
Fc1cncc(Br)c1Br
What is the building block token for the following molecule?
Fc1cncc(Br)c1Br
<BB_2845>
What is the molecular formula for <BB_2845>?
The molecular formula for <BB_2845> (Fc1cncc(Br)c1Br) is C5H2Br2FN.
Describe the ring structures in building block <BB_2845>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2845>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2845>.
**Token:** <BB_2845> **SMILES:** Fc1cncc(Br)c1Br **Molecular Formula:** C5H2Br2FN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2846>.
CNC(=O)Cn1cc(NC(=O)CCl)cn1
What is the building block token for the following molecule?
CNC(=O)Cn1cc(NC(=O)CCl)cn1
<BB_2846>
What is the molecular formula for <BB_2846>?
The molecular formula for <BB_2846> (CNC(=O)Cn1cc(NC(=O)CCl)cn1) is C8H11ClN4O2.
Describe the ring structures in building block <BB_2846>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_2846>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2846>.
**Token:** <BB_2846> **SMILES:** CNC(=O)Cn1cc(NC(=O)CCl)cn1 **Molecular Formula:** C8H11ClN4O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2847>.
CCOC(=O)c1ncc(Cl)c(C=O)c1Cl
What is the building block token for the following molecule?
CCOC(=O)c1ncc(Cl)c(C=O)c1Cl
<BB_2847>
What is the molecular formula for <BB_2847>?
The molecular formula for <BB_2847> (CCOC(=O)c1ncc(Cl)c(C=O)c1Cl) is C9H7Cl2NO3.
Describe the ring structures in building block <BB_2847>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_2847>.
The molecule contains the following groups: Ester, Aldehyde, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2847>.
**Token:** <BB_2847> **SMILES:** CCOC(=O)c1ncc(Cl)c(C=O)c1Cl **Molecular Formula:** C9H7Cl2NO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Aldehyde, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2848>.
CC1(CN)CC2(CCC2)C1.Cl
What is the building block token for the following molecule?
CC1(CN)CC2(CCC2)C1.Cl
<BB_2848>
What is the molecular formula for <BB_2848>?
The molecular formula for <BB_2848> (CC1(CN)CC2(CCC2)C1.Cl) is C9H18ClN.
Describe the ring structures in building block <BB_2848>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4.
List the primary functional groups present in <BB_2848>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2848>.
**Token:** <BB_2848> **SMILES:** CC1(CN)CC2(CCC2)C1.Cl **Molecular Formula:** C9H18ClN **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_2849>.
Cl.Fc1ccc2c(C3CCCNC3)c[nH]c2c1
What is the building block token for the following molecule?
Cl.Fc1ccc2c(C3CCCNC3)c[nH]c2c1
<BB_2849>
What is the molecular formula for <BB_2849>?
The molecular formula for <BB_2849> (Cl.Fc1ccc2c(C3CCCNC3)c[nH]c2c1) is C13H16ClFN2.
Describe the ring structures in building block <BB_2849>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_2849>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_2849>.
**Token:** <BB_2849> **SMILES:** Cl.Fc1ccc2c(C3CCCNC3)c[nH]c2c1 **Molecular Formula:** C13H16ClFN2 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)