instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_3066>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3066>.
**Token:** <BB_3066> **SMILES:** Fc1ccc2c(c1)sc1nc(-c3ccccc3)cn12 **Molecular Formula:** C15H9FN2S **Ring System:** The molecule contains 4 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3067>.
CCC(C(=O)NN)n1nc(C)c(Br)c1C
What is the building block token for the following molecule?
CCC(C(=O)NN)n1nc(C)c(Br)c1C
<BB_3067>
What is the molecular formula for <BB_3067>?
The molecular formula for <BB_3067> (CCC(C(=O)NN)n1nc(C)c(Br)c1C) is C9H15BrN4O.
Describe the ring structures in building block <BB_3067>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_3067>.
The molecule contains the following groups: Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3067>.
**Token:** <BB_3067> **SMILES:** CCC(C(=O)NN)n1nc(C)c(Br)c1C **Molecular Formula:** C9H15BrN4O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3068>.
COCC(C)(C)C(N)C(=O)O.Cl
What is the building block token for the following molecule?
COCC(C)(C)C(N)C(=O)O.Cl
<BB_3068>
What is the molecular formula for <BB_3068>?
The molecular formula for <BB_3068> (COCC(C)(C)C(N)C(=O)O.Cl) is C7H16ClNO3.
Describe the ring structures in building block <BB_3068>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_3068>.
The molecule contains the following groups: Carboxylic Acid, Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3068>.
**Token:** <BB_3068> **SMILES:** COCC(C)(C)C(N)C(=O)O.Cl **Molecular Formula:** C7H16ClNO3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3069>.
Cl.NCCC1CCCS(=O)(=O)C1
What is the building block token for the following molecule?
Cl.NCCC1CCCS(=O)(=O)C1
<BB_3069>
What is the molecular formula for <BB_3069>?
The molecular formula for <BB_3069> (Cl.NCCC1CCCS(=O)(=O)C1) is C7H16ClNO2S.
Describe the ring structures in building block <BB_3069>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_3069>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3069>.
**Token:** <BB_3069> **SMILES:** Cl.NCCC1CCCS(=O)(=O)C1 **Molecular Formula:** C7H16ClNO2S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3070>.
CC1(C2CCNCC2)OCCO1
What is the building block token for the following molecule?
CC1(C2CCNCC2)OCCO1
<BB_3070>
What is the molecular formula for <BB_3070>?
The molecular formula for <BB_3070> (CC1(C2CCNCC2)OCCO1) is C9H17NO2.
Describe the ring structures in building block <BB_3070>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_3070>.
The molecule contains the following groups: Secondary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_3070>.
**Token:** <BB_3070> **SMILES:** CC1(C2CCNCC2)OCCO1 **Molecular Formula:** C9H17NO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Ether
Provide the SMILES representation for the building block token <BB_3071>.
CC(N=C=S)c1ccccc1
What is the building block token for the following molecule?
CC(N=C=S)c1ccccc1
<BB_3071>
What is the molecular formula for <BB_3071>?
The molecular formula for <BB_3071> (CC(N=C=S)c1ccccc1) is C9H9NS.
Describe the ring structures in building block <BB_3071>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3071>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_3071>.
**Token:** <BB_3071> **SMILES:** CC(N=C=S)c1ccccc1 **Molecular Formula:** C9H9NS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_3072>.
Oc1cc(OC2CCCCC2)ccn1
What is the building block token for the following molecule?
Oc1cc(OC2CCCCC2)ccn1
<BB_3072>
What is the molecular formula for <BB_3072>?
The molecular formula for <BB_3072> (Oc1cc(OC2CCCCC2)ccn1) is C11H15NO2.
Describe the ring structures in building block <BB_3072>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_3072>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_3072>.
**Token:** <BB_3072> **SMILES:** Oc1cc(OC2CCCCC2)ccn1 **Molecular Formula:** C11H15NO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_3073>.
Cn1cc(Br)c(CN2C(=O)c3ccccc3C2=O)n1
What is the building block token for the following molecule?
Cn1cc(Br)c(CN2C(=O)c3ccccc3C2=O)n1
<BB_3073>
What is the molecular formula for <BB_3073>?
The molecular formula for <BB_3073> (Cn1cc(Br)c(CN2C(=O)c3ccccc3C2=O)n1) is C13H10BrN3O2.
Describe the ring structures in building block <BB_3073>.
The molecule contains 3 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_3073>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3073>.
**Token:** <BB_3073> **SMILES:** Cn1cc(Br)c(CN2C(=O)c3ccccc3C2=O)n1 **Molecular Formula:** C13H10BrN3O2 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3074>.
Nc1ccn([C@@H]2CS[C@H](CO)O2)c(=O)n1
What is the building block token for the following molecule?
Nc1ccn([C@@H]2CS[C@H](CO)O2)c(=O)n1
<BB_3074>
What is the molecular formula for <BB_3074>?
The molecular formula for <BB_3074> (Nc1ccn([C@@H]2CS[C@H](CO)O2)c(=O)n1) is C8H11N3O3S.
Describe the ring structures in building block <BB_3074>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_3074>.
The molecule contains the following groups: Amine, Alcohol, Ether, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_3074>.
**Token:** <BB_3074> **SMILES:** Nc1ccn([C@@H]2CS[C@H](CO)O2)c(=O)n1 **Molecular Formula:** C8H11N3O3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amine, Alcohol, Ether, Sulfide
Provide the SMILES representation for the building block token <BB_3075>.
c1ccc(CN2CCC(NC3CC3)CC2)cc1
What is the building block token for the following molecule?
c1ccc(CN2CCC(NC3CC3)CC2)cc1
<BB_3075>
What is the molecular formula for <BB_3075>?
The molecular formula for <BB_3075> (c1ccc(CN2CCC(NC3CC3)CC2)cc1) is C15H22N2.
Describe the ring structures in building block <BB_3075>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_3075>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_3075>.
**Token:** <BB_3075> **SMILES:** c1ccc(CN2CCC(NC3CC3)CC2)cc1 **Molecular Formula:** C15H22N2 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Secondary Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_3076>.
CC(=O)c1ccc(S(=O)(=O)NCCCN(C)C)cc1
What is the building block token for the following molecule?
CC(=O)c1ccc(S(=O)(=O)NCCCN(C)C)cc1
<BB_3076>
What is the molecular formula for <BB_3076>?
The molecular formula for <BB_3076> (CC(=O)c1ccc(S(=O)(=O)NCCCN(C)C)cc1) is C13H20N2O3S.
Describe the ring structures in building block <BB_3076>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3076>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Ketone, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_3076>.
**Token:** <BB_3076> **SMILES:** CC(=O)c1ccc(S(=O)(=O)NCCCN(C)C)cc1 **Molecular Formula:** C13H20N2O3S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Ketone, Sulfonamide
Provide the SMILES representation for the building block token <BB_3077>.
CC(C)(C)OC(=O)C1CC2(CCC(CI)O2)C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)C1CC2(CCC(CI)O2)C1
<BB_3077>
What is the molecular formula for <BB_3077>?
The molecular formula for <BB_3077> (CC(C)(C)OC(=O)C1CC2(CCC(CI)O2)C1) is C13H21IO3.
Describe the ring structures in building block <BB_3077>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 5.
List the primary functional groups present in <BB_3077>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3077>.
**Token:** <BB_3077> **SMILES:** CC(C)(C)OC(=O)C1CC2(CCC(CI)O2)C1 **Molecular Formula:** C13H21IO3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 5. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3078>.
Cn1cnc2c(B3OC(C)(C)C(C)(C)O3)cccc21
What is the building block token for the following molecule?
Cn1cnc2c(B3OC(C)(C)C(C)(C)O3)cccc21
<BB_3078>
What is the molecular formula for <BB_3078>?
The molecular formula for <BB_3078> (Cn1cnc2c(B3OC(C)(C)C(C)(C)O3)cccc21) is C14H19BN2O2.
Describe the ring structures in building block <BB_3078>.
The molecule contains 3 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_3078>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_3078>.
**Token:** <BB_3078> **SMILES:** Cn1cnc2c(B3OC(C)(C)C(C)(C)O3)cccc21 **Molecular Formula:** C14H19BN2O2 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_3079>.
NCC1=COCCO1
What is the building block token for the following molecule?
NCC1=COCCO1
<BB_3079>
What is the molecular formula for <BB_3079>?
The molecular formula for <BB_3079> (NCC1=COCCO1) is C5H9NO2.
Describe the ring structures in building block <BB_3079>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_3079>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_3079>.
**Token:** <BB_3079> **SMILES:** NCC1=COCCO1 **Molecular Formula:** C5H9NO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_3080>.
NC(=O)NC(CC(=O)O)c1cccc(Br)c1
What is the building block token for the following molecule?
NC(=O)NC(CC(=O)O)c1cccc(Br)c1
<BB_3080>
What is the molecular formula for <BB_3080>?
The molecular formula for <BB_3080> (NC(=O)NC(CC(=O)O)c1cccc(Br)c1) is C10H11BrN2O3.
Describe the ring structures in building block <BB_3080>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3080>.
The molecule contains the following groups: Carboxylic Acid, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3080>.
**Token:** <BB_3080> **SMILES:** NC(=O)NC(CC(=O)O)c1cccc(Br)c1 **Molecular Formula:** C10H11BrN2O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3081>.
Cc1cccc(CN)c1
What is the building block token for the following molecule?
Cc1cccc(CN)c1
<BB_3081>
What is the molecular formula for <BB_3081>?
The molecular formula for <BB_3081> (Cc1cccc(CN)c1) is C8H11N.
Describe the ring structures in building block <BB_3081>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3081>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_3081>.
**Token:** <BB_3081> **SMILES:** Cc1cccc(CN)c1 **Molecular Formula:** C8H11N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_3082>.
CC(F)(F)c1nnc(Br)o1
What is the building block token for the following molecule?
CC(F)(F)c1nnc(Br)o1
<BB_3082>
What is the molecular formula for <BB_3082>?
The molecular formula for <BB_3082> (CC(F)(F)c1nnc(Br)o1) is C4H3BrF2N2O.
Describe the ring structures in building block <BB_3082>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_3082>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3082>.
**Token:** <BB_3082> **SMILES:** CC(F)(F)c1nnc(Br)o1 **Molecular Formula:** C4H3BrF2N2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3083>.
CNCC(O)COc1ccc2c(c1)OCO2
What is the building block token for the following molecule?
CNCC(O)COc1ccc2c(c1)OCO2
<BB_3083>