instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_3033>?
The molecular formula for <BB_3033> (CCOC(=O)CCC(=O)C(F)(F)F) is C7H9F3O3.
Describe the ring structures in building block <BB_3033>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_3033>.
The molecule contains the following groups: Ester, Ketone, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3033>.
**Token:** <BB_3033> **SMILES:** CCOC(=O)CCC(=O)C(F)(F)F **Molecular Formula:** C7H9F3O3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ester, Ketone, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3034>.
COC(=O)c1cccc2c(C(=O)O)c[nH]c12
What is the building block token for the following molecule?
COC(=O)c1cccc2c(C(=O)O)c[nH]c12
<BB_3034>
What is the molecular formula for <BB_3034>?
The molecular formula for <BB_3034> (COC(=O)c1cccc2c(C(=O)O)c[nH]c12) is C11H9NO4.
Describe the ring structures in building block <BB_3034>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_3034>.
The molecule contains the following groups: Carboxylic Acid, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_3034>.
**Token:** <BB_3034> **SMILES:** COC(=O)c1cccc2c(C(=O)O)c[nH]c12 **Molecular Formula:** C11H9NO4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Ester, Ether
Provide the SMILES representation for the building block token <BB_3035>.
COc1ccc(Cn2[nH]ccc2=N)c(OC)c1
What is the building block token for the following molecule?
COc1ccc(Cn2[nH]ccc2=N)c(OC)c1
<BB_3035>
What is the molecular formula for <BB_3035>?
The molecular formula for <BB_3035> (COc1ccc(Cn2[nH]ccc2=N)c(OC)c1) is C12H15N3O2.
Describe the ring structures in building block <BB_3035>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_3035>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_3035>.
**Token:** <BB_3035> **SMILES:** COc1ccc(Cn2[nH]ccc2=N)c(OC)c1 **Molecular Formula:** C12H15N3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_3036>.
COCC1(C(=O)O)CCCO1
What is the building block token for the following molecule?
COCC1(C(=O)O)CCCO1
<BB_3036>
What is the molecular formula for <BB_3036>?
The molecular formula for <BB_3036> (COCC1(C(=O)O)CCCO1) is C7H12O4.
Describe the ring structures in building block <BB_3036>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_3036>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_3036>.
**Token:** <BB_3036> **SMILES:** COCC1(C(=O)O)CCCO1 **Molecular Formula:** C7H12O4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_3037>.
O=NN1CC(O)C1
What is the building block token for the following molecule?
O=NN1CC(O)C1
<BB_3037>
What is the molecular formula for <BB_3037>?
The molecular formula for <BB_3037> (O=NN1CC(O)C1) is C3H6N2O2.
Describe the ring structures in building block <BB_3037>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_3037>.
The molecule contains the following groups: Tertiary Amine, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_3037>.
**Token:** <BB_3037> **SMILES:** O=NN1CC(O)C1 **Molecular Formula:** C3H6N2O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Tertiary Amine, Alcohol
Provide the SMILES representation for the building block token <BB_3038>.
COc1cc(C(=O)[O-])no1.[Na+]
What is the building block token for the following molecule?
COc1cc(C(=O)[O-])no1.[Na+]
<BB_3038>
What is the molecular formula for <BB_3038>?
The molecular formula for <BB_3038> (COc1cc(C(=O)[O-])no1.[Na+]) is C5H4NNaO4.
Describe the ring structures in building block <BB_3038>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_3038>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_3038>.
**Token:** <BB_3038> **SMILES:** COc1cc(C(=O)[O-])no1.[Na+] **Molecular Formula:** C5H4NNaO4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_3039>.
Nc1cc(Cl)cnn1
What is the building block token for the following molecule?
Nc1cc(Cl)cnn1
<BB_3039>
What is the molecular formula for <BB_3039>?
The molecular formula for <BB_3039> (Nc1cc(Cl)cnn1) is C4H4ClN3.
Describe the ring structures in building block <BB_3039>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3039>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3039>.
**Token:** <BB_3039> **SMILES:** Nc1cc(Cl)cnn1 **Molecular Formula:** C4H4ClN3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3040>.
Nc1ccnn1-c1ccc(F)cc1
What is the building block token for the following molecule?
Nc1ccnn1-c1ccc(F)cc1
<BB_3040>
What is the molecular formula for <BB_3040>?
The molecular formula for <BB_3040> (Nc1ccnn1-c1ccc(F)cc1) is C9H8FN3.
Describe the ring structures in building block <BB_3040>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_3040>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3040>.
**Token:** <BB_3040> **SMILES:** Nc1ccnn1-c1ccc(F)cc1 **Molecular Formula:** C9H8FN3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3041>.
Cc1ccc(CN)cc1B1OC(C)(C)C(C)(C)O1.Cl
What is the building block token for the following molecule?
Cc1ccc(CN)cc1B1OC(C)(C)C(C)(C)O1.Cl
<BB_3041>
What is the molecular formula for <BB_3041>?
The molecular formula for <BB_3041> (Cc1ccc(CN)cc1B1OC(C)(C)C(C)(C)O1.Cl) is C14H23BClNO2.
Describe the ring structures in building block <BB_3041>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_3041>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3041>.
**Token:** <BB_3041> **SMILES:** Cc1ccc(CN)cc1B1OC(C)(C)C(C)(C)O1.Cl **Molecular Formula:** C14H23BClNO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3042>.
COC(=O)c1cccc(N)c1N
What is the building block token for the following molecule?
COC(=O)c1cccc(N)c1N
<BB_3042>
What is the molecular formula for <BB_3042>?
The molecular formula for <BB_3042> (COC(=O)c1cccc(N)c1N) is C8H10N2O2.
Describe the ring structures in building block <BB_3042>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3042>.
The molecule contains the following groups: Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_3042>.
**Token:** <BB_3042> **SMILES:** COC(=O)c1cccc(N)c1N **Molecular Formula:** C8H10N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_3043>.
Cc1c(Br)cc([N+](=O)[O-])cc1C(F)(F)F
What is the building block token for the following molecule?
Cc1c(Br)cc([N+](=O)[O-])cc1C(F)(F)F
<BB_3043>
What is the molecular formula for <BB_3043>?
The molecular formula for <BB_3043> (Cc1c(Br)cc([N+](=O)[O-])cc1C(F)(F)F) is C8H5BrF3NO2.
Describe the ring structures in building block <BB_3043>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3043>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_3043>.
**Token:** <BB_3043> **SMILES:** Cc1c(Br)cc([N+](=O)[O-])cc1C(F)(F)F **Molecular Formula:** C8H5BrF3NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_3044>.
CC1(C)OB(c2cc(F)ccc2[N+](=O)[O-])OC1(C)C
What is the building block token for the following molecule?
CC1(C)OB(c2cc(F)ccc2[N+](=O)[O-])OC1(C)C
<BB_3044>
What is the molecular formula for <BB_3044>?
The molecular formula for <BB_3044> (CC1(C)OB(c2cc(F)ccc2[N+](=O)[O-])OC1(C)C) is C12H15BFNO4.
Describe the ring structures in building block <BB_3044>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_3044>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_3044>.
**Token:** <BB_3044> **SMILES:** CC1(C)OB(c2cc(F)ccc2[N+](=O)[O-])OC1(C)C **Molecular Formula:** C12H15BFNO4 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_3045>.
CCC=C(F)C(=O)O
What is the building block token for the following molecule?
CCC=C(F)C(=O)O
<BB_3045>
What is the molecular formula for <BB_3045>?
The molecular formula for <BB_3045> (CCC=C(F)C(=O)O) is C5H7FO2.
Describe the ring structures in building block <BB_3045>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_3045>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3045>.
**Token:** <BB_3045> **SMILES:** CCC=C(F)C(=O)O **Molecular Formula:** C5H7FO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3046>.
CC(N)(C(=O)O)c1ccccc1Br.Cl
What is the building block token for the following molecule?
CC(N)(C(=O)O)c1ccccc1Br.Cl
<BB_3046>
What is the molecular formula for <BB_3046>?
The molecular formula for <BB_3046> (CC(N)(C(=O)O)c1ccccc1Br.Cl) is C9H11BrClNO2.
Describe the ring structures in building block <BB_3046>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3046>.
The molecule contains the following groups: Carboxylic Acid, Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3046>.
**Token:** <BB_3046> **SMILES:** CC(N)(C(=O)O)c1ccccc1Br.Cl **Molecular Formula:** C9H11BrClNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3047>.
CCc1ccc(O)cc1O
What is the building block token for the following molecule?
CCc1ccc(O)cc1O
<BB_3047>
What is the molecular formula for <BB_3047>?
The molecular formula for <BB_3047> (CCc1ccc(O)cc1O) is C8H10O2.
Describe the ring structures in building block <BB_3047>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3047>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_3047>.
**Token:** <BB_3047> **SMILES:** CCc1ccc(O)cc1O **Molecular Formula:** C8H10O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_3048>.
O=C(O)c1ccc2nc(N3CCNCC3)oc2c1
What is the building block token for the following molecule?
O=C(O)c1ccc2nc(N3CCNCC3)oc2c1
<BB_3048>
What is the molecular formula for <BB_3048>?
The molecular formula for <BB_3048> (O=C(O)c1ccc2nc(N3CCNCC3)oc2c1) is C12H13N3O3.
Describe the ring structures in building block <BB_3048>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_3048>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_3048>.
**Token:** <BB_3048> **SMILES:** O=C(O)c1ccc2nc(N3CCNCC3)oc2c1 **Molecular Formula:** C12H13N3O3 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Secondary Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_3049>.
O=c1[nH]cnc2cc(F)c(Cl)cc12
What is the building block token for the following molecule?
O=c1[nH]cnc2cc(F)c(Cl)cc12
<BB_3049>
What is the molecular formula for <BB_3049>?
The molecular formula for <BB_3049> (O=c1[nH]cnc2cc(F)c(Cl)cc12) is C8H4ClFN2O.
Describe the ring structures in building block <BB_3049>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_3049>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3049>.
**Token:** <BB_3049> **SMILES:** O=c1[nH]cnc2cc(F)c(Cl)cc12 **Molecular Formula:** C8H4ClFN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)