instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_3083>?
The molecular formula for <BB_3083> (CNCC(O)COc1ccc2c(c1)OCO2) is C11H15NO4.
Describe the ring structures in building block <BB_3083>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_3083>.
The molecule contains the following groups: Secondary Amine, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_3083>.
**Token:** <BB_3083> **SMILES:** CNCC(O)COc1ccc2c(c1)OCO2 **Molecular Formula:** C11H15NO4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_3084>.
CCOC(=O)[C@H](Cc1ccc(O)cc1)NC(C)=O
What is the building block token for the following molecule?
CCOC(=O)[C@H](Cc1ccc(O)cc1)NC(C)=O
<BB_3084>
What is the molecular formula for <BB_3084>?
The molecular formula for <BB_3084> (CCOC(=O)[C@H](Cc1ccc(O)cc1)NC(C)=O) is C13H17NO4.
Describe the ring structures in building block <BB_3084>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3084>.
The molecule contains the following groups: Amide, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_3084>.
**Token:** <BB_3084> **SMILES:** CCOC(=O)[C@H](Cc1ccc(O)cc1)NC(C)=O **Molecular Formula:** C13H17NO4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Ester, Ether
Provide the SMILES representation for the building block token <BB_3085>.
Cl.Cl.NCCCn1cc(CO)nn1
What is the building block token for the following molecule?
Cl.Cl.NCCCn1cc(CO)nn1
<BB_3085>
What is the molecular formula for <BB_3085>?
The molecular formula for <BB_3085> (Cl.Cl.NCCCn1cc(CO)nn1) is C6H14Cl2N4O.
Describe the ring structures in building block <BB_3085>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_3085>.
The molecule contains the following groups: Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3085>.
**Token:** <BB_3085> **SMILES:** Cl.Cl.NCCCn1cc(CO)nn1 **Molecular Formula:** C6H14Cl2N4O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3086>.
CC1(C)CC(=O)c2cc(C(=O)O)ccc2O1
What is the building block token for the following molecule?
CC1(C)CC(=O)c2cc(C(=O)O)ccc2O1
<BB_3086>
What is the molecular formula for <BB_3086>?
The molecular formula for <BB_3086> (CC1(C)CC(=O)c2cc(C(=O)O)ccc2O1) is C12H12O4.
Describe the ring structures in building block <BB_3086>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_3086>.
The molecule contains the following groups: Carboxylic Acid, Ketone, Ether.
Provide a comprehensive chemical profile for the building block <BB_3086>.
**Token:** <BB_3086> **SMILES:** CC1(C)CC(=O)c2cc(C(=O)O)ccc2O1 **Molecular Formula:** C12H12O4 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ketone, Ether
Provide the SMILES representation for the building block token <BB_3087>.
COC(=O)CNC(=O)C(=O)OC
What is the building block token for the following molecule?
COC(=O)CNC(=O)C(=O)OC
<BB_3087>
What is the molecular formula for <BB_3087>?
The molecular formula for <BB_3087> (COC(=O)CNC(=O)C(=O)OC) is C6H9NO5.
Describe the ring structures in building block <BB_3087>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_3087>.
The molecule contains the following groups: Amide, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_3087>.
**Token:** <BB_3087> **SMILES:** COC(=O)CNC(=O)C(=O)OC **Molecular Formula:** C6H9NO5 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amide, Ester, Ether
Provide the SMILES representation for the building block token <BB_3088>.
COC(=O)c1cc(C(F)(F)F)ccc1C#N
What is the building block token for the following molecule?
COC(=O)c1cc(C(F)(F)F)ccc1C#N
<BB_3088>
What is the molecular formula for <BB_3088>?
The molecular formula for <BB_3088> (COC(=O)c1cc(C(F)(F)F)ccc1C#N) is C10H6F3NO2.
Describe the ring structures in building block <BB_3088>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3088>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_3088>.
**Token:** <BB_3088> **SMILES:** COC(=O)c1cc(C(F)(F)F)ccc1C#N **Molecular Formula:** C10H6F3NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_3089>.
Cc1c(Cl)ccnc1C(=O)O.Cl
What is the building block token for the following molecule?
Cc1c(Cl)ccnc1C(=O)O.Cl
<BB_3089>
What is the molecular formula for <BB_3089>?
The molecular formula for <BB_3089> (Cc1c(Cl)ccnc1C(=O)O.Cl) is C7H7Cl2NO2.
Describe the ring structures in building block <BB_3089>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3089>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3089>.
**Token:** <BB_3089> **SMILES:** Cc1c(Cl)ccnc1C(=O)O.Cl **Molecular Formula:** C7H7Cl2NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3090>.
O=C(O)CC(Br)C(=O)c1ccc(Cl)cc1
What is the building block token for the following molecule?
O=C(O)CC(Br)C(=O)c1ccc(Cl)cc1
<BB_3090>
What is the molecular formula for <BB_3090>?
The molecular formula for <BB_3090> (O=C(O)CC(Br)C(=O)c1ccc(Cl)cc1) is C10H8BrClO3.
Describe the ring structures in building block <BB_3090>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3090>.
The molecule contains the following groups: Carboxylic Acid, Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3090>.
**Token:** <BB_3090> **SMILES:** O=C(O)CC(Br)C(=O)c1ccc(Cl)cc1 **Molecular Formula:** C10H8BrClO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3091>.
Brc1ccc2ccccc2c1I
What is the building block token for the following molecule?
Brc1ccc2ccccc2c1I
<BB_3091>
What is the molecular formula for <BB_3091>?
The molecular formula for <BB_3091> (Brc1ccc2ccccc2c1I) is C10H6BrI.
Describe the ring structures in building block <BB_3091>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_3091>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3091>.
**Token:** <BB_3091> **SMILES:** Brc1ccc2ccccc2c1I **Molecular Formula:** C10H6BrI **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3092>.
Brc1ccc(C2=CCCCC2)nc1
What is the building block token for the following molecule?
Brc1ccc(C2=CCCCC2)nc1
<BB_3092>
What is the molecular formula for <BB_3092>?
The molecular formula for <BB_3092> (Brc1ccc(C2=CCCCC2)nc1) is C11H12BrN.
Describe the ring structures in building block <BB_3092>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_3092>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3092>.
**Token:** <BB_3092> **SMILES:** Brc1ccc(C2=CCCCC2)nc1 **Molecular Formula:** C11H12BrN **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3093>.
Fc1cccc(F)c1Cl
What is the building block token for the following molecule?
Fc1cccc(F)c1Cl
<BB_3093>
What is the molecular formula for <BB_3093>?
The molecular formula for <BB_3093> (Fc1cccc(F)c1Cl) is C6H3ClF2.
Describe the ring structures in building block <BB_3093>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3093>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3093>.
**Token:** <BB_3093> **SMILES:** Fc1cccc(F)c1Cl **Molecular Formula:** C6H3ClF2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3094>.
COC(=O)c1ccc2c(=O)n(CCO)c(S)nc2c1
What is the building block token for the following molecule?
COC(=O)c1ccc2c(=O)n(CCO)c(S)nc2c1
<BB_3094>
What is the molecular formula for <BB_3094>?
The molecular formula for <BB_3094> (COC(=O)c1ccc2c(=O)n(CCO)c(S)nc2c1) is C12H12N2O4S.
Describe the ring structures in building block <BB_3094>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_3094>.
The molecule contains the following groups: Ester, Alcohol, Ether, Thiol.
Provide a comprehensive chemical profile for the building block <BB_3094>.
**Token:** <BB_3094> **SMILES:** COC(=O)c1ccc2c(=O)n(CCO)c(S)nc2c1 **Molecular Formula:** C12H12N2O4S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Ester, Alcohol, Ether, Thiol
Provide the SMILES representation for the building block token <BB_3095>.
Clc1ccc(OCCCN2CCCC2)cn1
What is the building block token for the following molecule?
Clc1ccc(OCCCN2CCCC2)cn1
<BB_3095>
What is the molecular formula for <BB_3095>?
The molecular formula for <BB_3095> (Clc1ccc(OCCCN2CCCC2)cn1) is C12H17ClN2O.
Describe the ring structures in building block <BB_3095>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_3095>.
The molecule contains the following groups: Tertiary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3095>.
**Token:** <BB_3095> **SMILES:** Clc1ccc(OCCCN2CCCC2)cn1 **Molecular Formula:** C12H17ClN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Tertiary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3096>.
C#CCC1CCC(=O)C2CC12
What is the building block token for the following molecule?
C#CCC1CCC(=O)C2CC12
<BB_3096>
What is the molecular formula for <BB_3096>?
The molecular formula for <BB_3096> (C#CCC1CCC(=O)C2CC12) is C10H12O.
Describe the ring structures in building block <BB_3096>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_3096>.
The molecule contains the following groups: Ketone.
Provide a comprehensive chemical profile for the building block <BB_3096>.
**Token:** <BB_3096> **SMILES:** C#CCC1CCC(=O)C2CC12 **Molecular Formula:** C10H12O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Ketone
Provide the SMILES representation for the building block token <BB_3097>.
OCC1Cc2ccccc21
What is the building block token for the following molecule?
OCC1Cc2ccccc21
<BB_3097>
What is the molecular formula for <BB_3097>?
The molecular formula for <BB_3097> (OCC1Cc2ccccc21) is C9H10O.
Describe the ring structures in building block <BB_3097>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aromatic ring of size 6.
List the primary functional groups present in <BB_3097>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_3097>.
**Token:** <BB_3097> **SMILES:** OCC1Cc2ccccc21 **Molecular Formula:** C9H10O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aromatic ring of size 6. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_3098>.
O=C(O)CC1CCC2(CC1)CCC2O
What is the building block token for the following molecule?
O=C(O)CC1CCC2(CC1)CCC2O
<BB_3098>
What is the molecular formula for <BB_3098>?
The molecular formula for <BB_3098> (O=C(O)CC1CCC2(CC1)CCC2O) is C11H18O3.
Describe the ring structures in building block <BB_3098>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 4.
List the primary functional groups present in <BB_3098>.
The molecule contains the following groups: Carboxylic Acid, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_3098>.
**Token:** <BB_3098> **SMILES:** O=C(O)CC1CCC2(CC1)CCC2O **Molecular Formula:** C11H18O3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** Carboxylic Acid, Alcohol
Provide the SMILES representation for the building block token <BB_3099>.
CC(C)(C)OC(=O)C#Cc1ccncc1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)C#Cc1ccncc1
<BB_3099>
What is the molecular formula for <BB_3099>?
The molecular formula for <BB_3099> (CC(C)(C)OC(=O)C#Cc1ccncc1) is C12H13NO2.
Describe the ring structures in building block <BB_3099>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3099>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_3099>.
**Token:** <BB_3099> **SMILES:** CC(C)(C)OC(=O)C#Cc1ccncc1 **Molecular Formula:** C12H13NO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ether