instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_3050>.
CCCNS(=O)(=O)c1ccc(F)cc1
What is the building block token for the following molecule?
CCCNS(=O)(=O)c1ccc(F)cc1
<BB_3050>
What is the molecular formula for <BB_3050>?
The molecular formula for <BB_3050> (CCCNS(=O)(=O)c1ccc(F)cc1) is C9H12FNO2S.
Describe the ring structures in building block <BB_3050>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3050>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_3050>.
**Token:** <BB_3050> **SMILES:** CCCNS(=O)(=O)c1ccc(F)cc1 **Molecular Formula:** C9H12FNO2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_3051>.
CN1CCCC2(CCNC2)C1
What is the building block token for the following molecule?
CN1CCCC2(CCNC2)C1
<BB_3051>
What is the molecular formula for <BB_3051>?
The molecular formula for <BB_3051> (CN1CCCC2(CCNC2)C1) is C9H18N2.
Describe the ring structures in building block <BB_3051>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_3051>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_3051>.
**Token:** <BB_3051> **SMILES:** CN1CCCC2(CCNC2)C1 **Molecular Formula:** C9H18N2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_3052>.
O=C(NCC1(F)CCC1)c1ccccc1
What is the building block token for the following molecule?
O=C(NCC1(F)CCC1)c1ccccc1
<BB_3052>
What is the molecular formula for <BB_3052>?
The molecular formula for <BB_3052> (O=C(NCC1(F)CCC1)c1ccccc1) is C12H14FNO.
Describe the ring structures in building block <BB_3052>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aromatic ring of size 6.
List the primary functional groups present in <BB_3052>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3052>.
**Token:** <BB_3052> **SMILES:** O=C(NCC1(F)CCC1)c1ccccc1 **Molecular Formula:** C12H14FNO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aromatic ring of size 6. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3053>.
CC1CCCC1C
What is the building block token for the following molecule?
CC1CCCC1C
<BB_3053>
What is the molecular formula for <BB_3053>?
The molecular formula for <BB_3053> (CC1CCCC1C) is C7H14.
Describe the ring structures in building block <BB_3053>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_3053>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_3053>.
**Token:** <BB_3053> **SMILES:** CC1CCCC1C **Molecular Formula:** C7H14 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_3054>.
CC1(C)CCCN(c2ccnc(Cl)n2)C1
What is the building block token for the following molecule?
CC1(C)CCCN(c2ccnc(Cl)n2)C1
<BB_3054>
What is the molecular formula for <BB_3054>?
The molecular formula for <BB_3054> (CC1(C)CCCN(c2ccnc(Cl)n2)C1) is C11H16ClN3.
Describe the ring structures in building block <BB_3054>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_3054>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3054>.
**Token:** <BB_3054> **SMILES:** CC1(C)CCCN(c2ccnc(Cl)n2)C1 **Molecular Formula:** C11H16ClN3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3055>.
CC(C)(C)OC(=O)Nc1cncc(F)c1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)Nc1cncc(F)c1
<BB_3055>
What is the molecular formula for <BB_3055>?
The molecular formula for <BB_3055> (CC(C)(C)OC(=O)Nc1cncc(F)c1) is C10H13FN2O2.
Describe the ring structures in building block <BB_3055>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3055>.
The molecule contains the following groups: Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3055>.
**Token:** <BB_3055> **SMILES:** CC(C)(C)OC(=O)Nc1cncc(F)c1 **Molecular Formula:** C10H13FN2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3056>.
COc1ccc2c(c1)C(CO)NCC2.Cl
What is the building block token for the following molecule?
COc1ccc2c(c1)C(CO)NCC2.Cl
<BB_3056>
What is the molecular formula for <BB_3056>?
The molecular formula for <BB_3056> (COc1ccc2c(c1)C(CO)NCC2.Cl) is C11H16ClNO2.
Describe the ring structures in building block <BB_3056>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_3056>.
The molecule contains the following groups: Secondary Amine, Alcohol, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3056>.
**Token:** <BB_3056> **SMILES:** COc1ccc2c(c1)C(CO)NCC2.Cl **Molecular Formula:** C11H16ClNO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Alcohol, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3057>.
Brc1cccc(OC2CC2)c1
What is the building block token for the following molecule?
Brc1cccc(OC2CC2)c1
<BB_3057>
What is the molecular formula for <BB_3057>?
The molecular formula for <BB_3057> (Brc1cccc(OC2CC2)c1) is C9H9BrO.
Describe the ring structures in building block <BB_3057>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_3057>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3057>.
**Token:** <BB_3057> **SMILES:** Brc1cccc(OC2CC2)c1 **Molecular Formula:** C9H9BrO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3058>.
CC1(c2ccc(C#N)cc2)NC(=O)NC1=O
What is the building block token for the following molecule?
CC1(c2ccc(C#N)cc2)NC(=O)NC1=O
<BB_3058>
What is the molecular formula for <BB_3058>?
The molecular formula for <BB_3058> (CC1(c2ccc(C#N)cc2)NC(=O)NC1=O) is C11H9N3O2.
Describe the ring structures in building block <BB_3058>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_3058>.
The molecule contains the following groups: Amide, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_3058>.
**Token:** <BB_3058> **SMILES:** CC1(c2ccc(C#N)cc2)NC(=O)NC1=O **Molecular Formula:** C11H9N3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amide, Nitrile
Provide the SMILES representation for the building block token <BB_3059>.
NC(=O)c1ccc2c(n1)NCCC2
What is the building block token for the following molecule?
NC(=O)c1ccc2c(n1)NCCC2
<BB_3059>
What is the molecular formula for <BB_3059>?
The molecular formula for <BB_3059> (NC(=O)c1ccc2c(n1)NCCC2) is C9H11N3O.
Describe the ring structures in building block <BB_3059>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_3059>.
The molecule contains the following groups: Secondary Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_3059>.
**Token:** <BB_3059> **SMILES:** NC(=O)c1ccc2c(n1)NCCC2 **Molecular Formula:** C9H11N3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Amide
Provide the SMILES representation for the building block token <BB_3060>.
CON(C)C(=O)CN
What is the building block token for the following molecule?
CON(C)C(=O)CN
<BB_3060>
What is the molecular formula for <BB_3060>?
The molecular formula for <BB_3060> (CON(C)C(=O)CN) is C4H10N2O2.
Describe the ring structures in building block <BB_3060>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_3060>.
The molecule contains the following groups: Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_3060>.
**Token:** <BB_3060> **SMILES:** CON(C)C(=O)CN **Molecular Formula:** C4H10N2O2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Amide
Provide the SMILES representation for the building block token <BB_3061>.
COC(=O)CS(=O)(=O)c1ccc(OC)cc1
What is the building block token for the following molecule?
COC(=O)CS(=O)(=O)c1ccc(OC)cc1
<BB_3061>
What is the molecular formula for <BB_3061>?
The molecular formula for <BB_3061> (COC(=O)CS(=O)(=O)c1ccc(OC)cc1) is C10H12O5S.
Describe the ring structures in building block <BB_3061>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3061>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_3061>.
**Token:** <BB_3061> **SMILES:** COC(=O)CS(=O)(=O)c1ccc(OC)cc1 **Molecular Formula:** C10H12O5S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_3062>.
Cl.NC1Cc2ccccc2C1=O
What is the building block token for the following molecule?
Cl.NC1Cc2ccccc2C1=O
<BB_3062>
What is the molecular formula for <BB_3062>?
The molecular formula for <BB_3062> (Cl.NC1Cc2ccccc2C1=O) is C9H10ClNO.
Describe the ring structures in building block <BB_3062>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_3062>.
The molecule contains the following groups: Amine, Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3062>.
**Token:** <BB_3062> **SMILES:** Cl.NC1Cc2ccccc2C1=O **Molecular Formula:** C9H10ClNO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3063>.
OC1CC(CC(F)(F)F)C1
What is the building block token for the following molecule?
OC1CC(CC(F)(F)F)C1
<BB_3063>
What is the molecular formula for <BB_3063>?
The molecular formula for <BB_3063> (OC1CC(CC(F)(F)F)C1) is C6H9F3O.
Describe the ring structures in building block <BB_3063>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_3063>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3063>.
**Token:** <BB_3063> **SMILES:** OC1CC(CC(F)(F)F)C1 **Molecular Formula:** C6H9F3O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3064>.
C=C(B1OC(C)(C)C(C)(C)O1)C1CCCCC1
What is the building block token for the following molecule?
C=C(B1OC(C)(C)C(C)(C)O1)C1CCCCC1
<BB_3064>
What is the molecular formula for <BB_3064>?
The molecular formula for <BB_3064> (C=C(B1OC(C)(C)C(C)(C)O1)C1CCCCC1) is C14H25BO2.
Describe the ring structures in building block <BB_3064>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_3064>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_3064>.
**Token:** <BB_3064> **SMILES:** C=C(B1OC(C)(C)C(C)(C)O1)C1CCCCC1 **Molecular Formula:** C14H25BO2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_3065>.
CCc1nc(C)ccc1N
What is the building block token for the following molecule?
CCc1nc(C)ccc1N
<BB_3065>
What is the molecular formula for <BB_3065>?
The molecular formula for <BB_3065> (CCc1nc(C)ccc1N) is C8H12N2.
Describe the ring structures in building block <BB_3065>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3065>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_3065>.
**Token:** <BB_3065> **SMILES:** CCc1nc(C)ccc1N **Molecular Formula:** C8H12N2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_3066>.
Fc1ccc2c(c1)sc1nc(-c3ccccc3)cn12
What is the building block token for the following molecule?
Fc1ccc2c(c1)sc1nc(-c3ccccc3)cn12
<BB_3066>
What is the molecular formula for <BB_3066>?
The molecular formula for <BB_3066> (Fc1ccc2c(c1)sc1nc(-c3ccccc3)cn12) is C15H9FN2S.
Describe the ring structures in building block <BB_3066>.
The molecule contains 4 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 5, an aromatic ring of size 6.