instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_3116>.
The molecule contains the following groups: Amine, Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3116>.
**Token:** <BB_3116> **SMILES:** NNc1cc(Cl)nc(C2CCOCC2)n1 **Molecular Formula:** C9H13ClN4O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3117>.
COc1ccc2c(c1)OCCNC2=O
What is the building block token for the following molecule?
COc1ccc2c(c1)OCCNC2=O
<BB_3117>
What is the molecular formula for <BB_3117>?
The molecular formula for <BB_3117> (COc1ccc2c(c1)OCCNC2=O) is C10H11NO3.
Describe the ring structures in building block <BB_3117>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 7.
List the primary functional groups present in <BB_3117>.
The molecule contains the following groups: Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_3117>.
**Token:** <BB_3117> **SMILES:** COc1ccc2c(c1)OCCNC2=O **Molecular Formula:** C10H11NO3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 7. **Functional Groups:** Amide, Ether
Provide the SMILES representation for the building block token <BB_3118>.
CC(C)(C)OC(=O)N1CCC(CO)(C(F)(F)F)C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCC(CO)(C(F)(F)F)C1
<BB_3118>
What is the molecular formula for <BB_3118>?
The molecular formula for <BB_3118> (CC(C)(C)OC(=O)N1CCC(CO)(C(F)(F)F)C1) is C11H18F3NO3.
Describe the ring structures in building block <BB_3118>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_3118>.
The molecule contains the following groups: Amide, Alcohol, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3118>.
**Token:** <BB_3118> **SMILES:** CC(C)(C)OC(=O)N1CCC(CO)(C(F)(F)F)C1 **Molecular Formula:** C11H18F3NO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amide, Alcohol, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3119>.
FC1(c2csc(Br)n2)CC1
What is the building block token for the following molecule?
FC1(c2csc(Br)n2)CC1
<BB_3119>
What is the molecular formula for <BB_3119>?
The molecular formula for <BB_3119> (FC1(c2csc(Br)n2)CC1) is C6H5BrFNS.
Describe the ring structures in building block <BB_3119>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_3119>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3119>.
**Token:** <BB_3119> **SMILES:** FC1(c2csc(Br)n2)CC1 **Molecular Formula:** C6H5BrFNS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3120>.
Cc1ccc(C(=O)OC(C)(C)C)s1
What is the building block token for the following molecule?
Cc1ccc(C(=O)OC(C)(C)C)s1
<BB_3120>
What is the molecular formula for <BB_3120>?
The molecular formula for <BB_3120> (Cc1ccc(C(=O)OC(C)(C)C)s1) is C10H14O2S.
Describe the ring structures in building block <BB_3120>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_3120>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_3120>.
**Token:** <BB_3120> **SMILES:** Cc1ccc(C(=O)OC(C)(C)C)s1 **Molecular Formula:** C10H14O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_3121>.
Cl.OC[C@@H]1CC(F)(F)CN1
What is the building block token for the following molecule?
Cl.OC[C@@H]1CC(F)(F)CN1
<BB_3121>
What is the molecular formula for <BB_3121>?
The molecular formula for <BB_3121> (Cl.OC[C@@H]1CC(F)(F)CN1) is C5H10ClF2NO.
Describe the ring structures in building block <BB_3121>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_3121>.
The molecule contains the following groups: Secondary Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3121>.
**Token:** <BB_3121> **SMILES:** Cl.OC[C@@H]1CC(F)(F)CN1 **Molecular Formula:** C5H10ClF2NO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3122>.
Nc1ncc(Br)cc1C(F)F
What is the building block token for the following molecule?
Nc1ncc(Br)cc1C(F)F
<BB_3122>
What is the molecular formula for <BB_3122>?
The molecular formula for <BB_3122> (Nc1ncc(Br)cc1C(F)F) is C6H5BrF2N2.
Describe the ring structures in building block <BB_3122>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3122>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3122>.
**Token:** <BB_3122> **SMILES:** Nc1ncc(Br)cc1C(F)F **Molecular Formula:** C6H5BrF2N2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3123>.
CS(=O)(=O)c1ccc(C2(C#N)CC2)cc1
What is the building block token for the following molecule?
CS(=O)(=O)c1ccc(C2(C#N)CC2)cc1
<BB_3123>
What is the molecular formula for <BB_3123>?
The molecular formula for <BB_3123> (CS(=O)(=O)c1ccc(C2(C#N)CC2)cc1) is C11H11NO2S.
Describe the ring structures in building block <BB_3123>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3.
List the primary functional groups present in <BB_3123>.
The molecule contains the following groups: Nitrile.
Provide a comprehensive chemical profile for the building block <BB_3123>.
**Token:** <BB_3123> **SMILES:** CS(=O)(=O)c1ccc(C2(C#N)CC2)cc1 **Molecular Formula:** C11H11NO2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3. **Functional Groups:** Nitrile
Provide the SMILES representation for the building block token <BB_3124>.
Brc1cc2cnoc2cn1
What is the building block token for the following molecule?
Brc1cc2cnoc2cn1
<BB_3124>
What is the molecular formula for <BB_3124>?
The molecular formula for <BB_3124> (Brc1cc2cnoc2cn1) is C6H3BrN2O.
Describe the ring structures in building block <BB_3124>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_3124>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3124>.
**Token:** <BB_3124> **SMILES:** Brc1cc2cnoc2cn1 **Molecular Formula:** C6H3BrN2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3125>.
Fc1cc(CBr)cc(F)c1Br
What is the building block token for the following molecule?
Fc1cc(CBr)cc(F)c1Br
<BB_3125>
What is the molecular formula for <BB_3125>?
The molecular formula for <BB_3125> (Fc1cc(CBr)cc(F)c1Br) is C7H4Br2F2.
Describe the ring structures in building block <BB_3125>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3125>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3125>.
**Token:** <BB_3125> **SMILES:** Fc1cc(CBr)cc(F)c1Br **Molecular Formula:** C7H4Br2F2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3126>.
CC(C)(C)NC(=O)CN1CCN(C(=O)CCl)CC1
What is the building block token for the following molecule?
CC(C)(C)NC(=O)CN1CCN(C(=O)CCl)CC1
<BB_3126>
What is the molecular formula for <BB_3126>?
The molecular formula for <BB_3126> (CC(C)(C)NC(=O)CN1CCN(C(=O)CCl)CC1) is C12H22ClN3O2.
Describe the ring structures in building block <BB_3126>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_3126>.
The molecule contains the following groups: Tertiary Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3126>.
**Token:** <BB_3126> **SMILES:** CC(C)(C)NC(=O)CN1CCN(C(=O)CCl)CC1 **Molecular Formula:** C12H22ClN3O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Tertiary Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3127>.
Clc1ccc(-c2n[nH]cc2Br)cc1
What is the building block token for the following molecule?
Clc1ccc(-c2n[nH]cc2Br)cc1
<BB_3127>
What is the molecular formula for <BB_3127>?
The molecular formula for <BB_3127> (Clc1ccc(-c2n[nH]cc2Br)cc1) is C9H6BrClN2.
Describe the ring structures in building block <BB_3127>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_3127>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3127>.
**Token:** <BB_3127> **SMILES:** Clc1ccc(-c2n[nH]cc2Br)cc1 **Molecular Formula:** C9H6BrClN2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3128>.
NS(=O)(=O)CC12CC3CC(CC(C3)C1)C2
What is the building block token for the following molecule?
NS(=O)(=O)CC12CC3CC(CC(C3)C1)C2
<BB_3128>
What is the molecular formula for <BB_3128>?
The molecular formula for <BB_3128> (NS(=O)(=O)CC12CC3CC(CC(C3)C1)C2) is C11H19NO2S.
Describe the ring structures in building block <BB_3128>.
The molecule contains 4 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_3128>.
The molecule contains the following groups: Amine, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_3128>.
**Token:** <BB_3128> **SMILES:** NS(=O)(=O)CC12CC3CC(CC(C3)C1)C2 **Molecular Formula:** C11H19NO2S **Ring System:** The molecule contains 4 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Sulfonamide
Provide the SMILES representation for the building block token <BB_3129>.
CC1(C)O[C@H]2[C@@H](O)CC[C@H]2O1
What is the building block token for the following molecule?
CC1(C)O[C@H]2[C@@H](O)CC[C@H]2O1
<BB_3129>
What is the molecular formula for <BB_3129>?
The molecular formula for <BB_3129> (CC1(C)O[C@H]2[C@@H](O)CC[C@H]2O1) is C8H14O3.
Describe the ring structures in building block <BB_3129>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_3129>.
The molecule contains the following groups: Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_3129>.
**Token:** <BB_3129> **SMILES:** CC1(C)O[C@H]2[C@@H](O)CC[C@H]2O1 **Molecular Formula:** C8H14O3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Alcohol, Ether
Provide the SMILES representation for the building block token <BB_3130>.
N#Cc1ccc(Oc2cccc([N+](=O)[O-])c2)cc1
What is the building block token for the following molecule?
N#Cc1ccc(Oc2cccc([N+](=O)[O-])c2)cc1
<BB_3130>
What is the molecular formula for <BB_3130>?
The molecular formula for <BB_3130> (N#Cc1ccc(Oc2cccc([N+](=O)[O-])c2)cc1) is C13H8N2O3.
Describe the ring structures in building block <BB_3130>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_3130>.
The molecule contains the following groups: Tertiary Amine, Ether, Nitrile, Nitro.
Provide a comprehensive chemical profile for the building block <BB_3130>.
**Token:** <BB_3130> **SMILES:** N#Cc1ccc(Oc2cccc([N+](=O)[O-])c2)cc1 **Molecular Formula:** C13H8N2O3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Ether, Nitrile, Nitro
Provide the SMILES representation for the building block token <BB_3131>.
COC(=O)C(C)(N)Cc1ccc(F)cc1.Cl
What is the building block token for the following molecule?
COC(=O)C(C)(N)Cc1ccc(F)cc1.Cl
<BB_3131>
What is the molecular formula for <BB_3131>?
The molecular formula for <BB_3131> (COC(=O)C(C)(N)Cc1ccc(F)cc1.Cl) is C11H15ClFNO2.
Describe the ring structures in building block <BB_3131>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3131>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3131>.
**Token:** <BB_3131> **SMILES:** COC(=O)C(C)(N)Cc1ccc(F)cc1.Cl **Molecular Formula:** C11H15ClFNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3132>.
Cc1ccc(C2CC(C(F)(F)F)n3nccc3N2)s1
What is the building block token for the following molecule?
Cc1ccc(C2CC(C(F)(F)F)n3nccc3N2)s1
<BB_3132>
What is the molecular formula for <BB_3132>?
The molecular formula for <BB_3132> (Cc1ccc(C2CC(C(F)(F)F)n3nccc3N2)s1) is C12H12F3N3S.
Describe the ring structures in building block <BB_3132>.
The molecule contains 3 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_3132>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3132>.
**Token:** <BB_3132> **SMILES:** Cc1ccc(C2CC(C(F)(F)F)n3nccc3N2)s1 **Molecular Formula:** C12H12F3N3S **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3133>.
Fc1nccc(Cl)c1I
What is the building block token for the following molecule?
Fc1nccc(Cl)c1I
<BB_3133>