instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_3150>.
CCOC(=O)c1[nH]c(C)c(C)c1Br
What is the building block token for the following molecule?
CCOC(=O)c1[nH]c(C)c(C)c1Br
<BB_3150>
What is the molecular formula for <BB_3150>?
The molecular formula for <BB_3150> (CCOC(=O)c1[nH]c(C)c(C)c1Br) is C9H12BrNO2.
Describe the ring structures in building block <BB_3150>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_3150>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3150>.
**Token:** <BB_3150> **SMILES:** CCOC(=O)c1[nH]c(C)c(C)c1Br **Molecular Formula:** C9H12BrNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3151>.
COC(=O)c1cncc(C(=O)O)c1
What is the building block token for the following molecule?
COC(=O)c1cncc(C(=O)O)c1
<BB_3151>
What is the molecular formula for <BB_3151>?
The molecular formula for <BB_3151> (COC(=O)c1cncc(C(=O)O)c1) is C8H7NO4.
Describe the ring structures in building block <BB_3151>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3151>.
The molecule contains the following groups: Carboxylic Acid, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_3151>.
**Token:** <BB_3151> **SMILES:** COC(=O)c1cncc(C(=O)O)c1 **Molecular Formula:** C8H7NO4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ester, Ether
Provide the SMILES representation for the building block token <BB_3152>.
O=Cc1ccc(SCc2ccccc2Cl)cc1
What is the building block token for the following molecule?
O=Cc1ccc(SCc2ccccc2Cl)cc1
<BB_3152>
What is the molecular formula for <BB_3152>?
The molecular formula for <BB_3152> (O=Cc1ccc(SCc2ccccc2Cl)cc1) is C14H11ClOS.
Describe the ring structures in building block <BB_3152>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_3152>.
The molecule contains the following groups: Aldehyde, Sulfide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3152>.
**Token:** <BB_3152> **SMILES:** O=Cc1ccc(SCc2ccccc2Cl)cc1 **Molecular Formula:** C14H11ClOS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Aldehyde, Sulfide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3153>.
CC1(C)OB(C2C3CCCC32)OC1(C)C
What is the building block token for the following molecule?
CC1(C)OB(C2C3CCCC32)OC1(C)C
<BB_3153>
What is the molecular formula for <BB_3153>?
The molecular formula for <BB_3153> (CC1(C)OB(C2C3CCCC32)OC1(C)C) is C12H21BO2.
Describe the ring structures in building block <BB_3153>.
The molecule contains 3 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_3153>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_3153>.
**Token:** <BB_3153> **SMILES:** CC1(C)OB(C2C3CCCC32)OC1(C)C **Molecular Formula:** C12H21BO2 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_3154>.
COCCNC(=O)N(C)C(C)CCSC
What is the building block token for the following molecule?
COCCNC(=O)N(C)C(C)CCSC
<BB_3154>
What is the molecular formula for <BB_3154>?
The molecular formula for <BB_3154> (COCCNC(=O)N(C)C(C)CCSC) is C10H22N2O2S.
Describe the ring structures in building block <BB_3154>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_3154>.
The molecule contains the following groups: Amide, Ether, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_3154>.
**Token:** <BB_3154> **SMILES:** COCCNC(=O)N(C)C(C)CCSC **Molecular Formula:** C10H22N2O2S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amide, Ether, Sulfide
Provide the SMILES representation for the building block token <BB_3155>.
CNC(c1ccc(Cl)cc1)c1ccc(Cl)cc1
What is the building block token for the following molecule?
CNC(c1ccc(Cl)cc1)c1ccc(Cl)cc1
<BB_3155>
What is the molecular formula for <BB_3155>?
The molecular formula for <BB_3155> (CNC(c1ccc(Cl)cc1)c1ccc(Cl)cc1) is C14H13Cl2N.
Describe the ring structures in building block <BB_3155>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_3155>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3155>.
**Token:** <BB_3155> **SMILES:** CNC(c1ccc(Cl)cc1)c1ccc(Cl)cc1 **Molecular Formula:** C14H13Cl2N **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3156>.
O=S(=O)(F)c1ccc2[nH]ccc2c1
What is the building block token for the following molecule?
O=S(=O)(F)c1ccc2[nH]ccc2c1
<BB_3156>
What is the molecular formula for <BB_3156>?
The molecular formula for <BB_3156> (O=S(=O)(F)c1ccc2[nH]ccc2c1) is C8H6FNO2S.
Describe the ring structures in building block <BB_3156>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_3156>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3156>.
**Token:** <BB_3156> **SMILES:** O=S(=O)(F)c1ccc2[nH]ccc2c1 **Molecular Formula:** C8H6FNO2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3157>.
C=CCc1ccc(OC)cc1
What is the building block token for the following molecule?
C=CCc1ccc(OC)cc1
<BB_3157>
What is the molecular formula for <BB_3157>?
The molecular formula for <BB_3157> (C=CCc1ccc(OC)cc1) is C10H12O.
Describe the ring structures in building block <BB_3157>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3157>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_3157>.
**Token:** <BB_3157> **SMILES:** C=CCc1ccc(OC)cc1 **Molecular Formula:** C10H12O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_3158>.
CNc1cc(F)cc(Cl)c1.Cl
What is the building block token for the following molecule?
CNc1cc(F)cc(Cl)c1.Cl
<BB_3158>
What is the molecular formula for <BB_3158>?
The molecular formula for <BB_3158> (CNc1cc(F)cc(Cl)c1.Cl) is C7H8Cl2FN.
Describe the ring structures in building block <BB_3158>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3158>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3158>.
**Token:** <BB_3158> **SMILES:** CNc1cc(F)cc(Cl)c1.Cl **Molecular Formula:** C7H8Cl2FN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3159>.
O=C(CCl)c1cccs1
What is the building block token for the following molecule?
O=C(CCl)c1cccs1
<BB_3159>
What is the molecular formula for <BB_3159>?
The molecular formula for <BB_3159> (O=C(CCl)c1cccs1) is C6H5ClOS.
Describe the ring structures in building block <BB_3159>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_3159>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3159>.
**Token:** <BB_3159> **SMILES:** O=C(CCl)c1cccs1 **Molecular Formula:** C6H5ClOS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3160>.
C[Si](C)(C)C(F)F
What is the building block token for the following molecule?
C[Si](C)(C)C(F)F
<BB_3160>
What is the molecular formula for <BB_3160>?
The molecular formula for <BB_3160> (C[Si](C)(C)C(F)F) is C4H10F2Si.
Describe the ring structures in building block <BB_3160>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_3160>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3160>.
**Token:** <BB_3160> **SMILES:** C[Si](C)(C)C(F)F **Molecular Formula:** C4H10F2Si **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3161>.
CC1(C)[C@H](N)[C@H]1c1ccccc1
What is the building block token for the following molecule?
CC1(C)[C@H](N)[C@H]1c1ccccc1
<BB_3161>
What is the molecular formula for <BB_3161>?
The molecular formula for <BB_3161> (CC1(C)[C@H](N)[C@H]1c1ccccc1) is C11H15N.
Describe the ring structures in building block <BB_3161>.
The molecule contains 2 ring(s): an aliphatic ring of size 3, an aromatic ring of size 6.
List the primary functional groups present in <BB_3161>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_3161>.
**Token:** <BB_3161> **SMILES:** CC1(C)[C@H](N)[C@H]1c1ccccc1 **Molecular Formula:** C11H15N **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 3, an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_3162>.
Cl.NCCn1cnc2sccc2c1=O
What is the building block token for the following molecule?
Cl.NCCn1cnc2sccc2c1=O
<BB_3162>
What is the molecular formula for <BB_3162>?
The molecular formula for <BB_3162> (Cl.NCCn1cnc2sccc2c1=O) is C8H10ClN3OS.
Describe the ring structures in building block <BB_3162>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_3162>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3162>.
**Token:** <BB_3162> **SMILES:** Cl.NCCn1cnc2sccc2c1=O **Molecular Formula:** C8H10ClN3OS **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3163>.
CC(C)(C)OC(=O)NC1CN(c2ccc(N)cc2)C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NC1CN(c2ccc(N)cc2)C1
<BB_3163>
What is the molecular formula for <BB_3163>?
The molecular formula for <BB_3163> (CC(C)(C)OC(=O)NC1CN(c2ccc(N)cc2)C1) is C14H21N3O2.
Describe the ring structures in building block <BB_3163>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aromatic ring of size 6.
List the primary functional groups present in <BB_3163>.
The molecule contains the following groups: Amine, Tertiary Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_3163>.
**Token:** <BB_3163> **SMILES:** CC(C)(C)OC(=O)NC1CN(c2ccc(N)cc2)C1 **Molecular Formula:** C14H21N3O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_3164>.
Nc1nnc(C2CCC2)s1
What is the building block token for the following molecule?
Nc1nnc(C2CCC2)s1
<BB_3164>
What is the molecular formula for <BB_3164>?
The molecular formula for <BB_3164> (Nc1nnc(C2CCC2)s1) is C6H9N3S.
Describe the ring structures in building block <BB_3164>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 4.
List the primary functional groups present in <BB_3164>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_3164>.
**Token:** <BB_3164> **SMILES:** Nc1nnc(C2CCC2)s1 **Molecular Formula:** C6H9N3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 4. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_3165>.
S=C1CCCC2CCCCC2N1
What is the building block token for the following molecule?
S=C1CCCC2CCCCC2N1
<BB_3165>
What is the molecular formula for <BB_3165>?
The molecular formula for <BB_3165> (S=C1CCCC2CCCCC2N1) is C10H17NS.
Describe the ring structures in building block <BB_3165>.
The molecule contains 2 ring(s): an aliphatic ring of size 7, an aliphatic ring of size 6.
List the primary functional groups present in <BB_3165>.
The molecule contains the following groups: Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_3165>.
**Token:** <BB_3165> **SMILES:** S=C1CCCC2CCCCC2N1 **Molecular Formula:** C10H17NS **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 7, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine
Provide the SMILES representation for the building block token <BB_3166>.
COC(=O)c1cnc(CCl)nc1Cl
What is the building block token for the following molecule?
COC(=O)c1cnc(CCl)nc1Cl
<BB_3166>
What is the molecular formula for <BB_3166>?
The molecular formula for <BB_3166> (COC(=O)c1cnc(CCl)nc1Cl) is C7H6Cl2N2O2.
Describe the ring structures in building block <BB_3166>.
The molecule contains 1 ring(s): an aromatic ring of size 6.