instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_3133>?
The molecular formula for <BB_3133> (Fc1nccc(Cl)c1I) is C5H2ClFIN.
Describe the ring structures in building block <BB_3133>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3133>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3133>.
**Token:** <BB_3133> **SMILES:** Fc1nccc(Cl)c1I **Molecular Formula:** C5H2ClFIN **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3134>.
CC(C)C(O)Cc1ccccc1
What is the building block token for the following molecule?
CC(C)C(O)Cc1ccccc1
<BB_3134>
What is the molecular formula for <BB_3134>?
The molecular formula for <BB_3134> (CC(C)C(O)Cc1ccccc1) is C11H16O.
Describe the ring structures in building block <BB_3134>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3134>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_3134>.
**Token:** <BB_3134> **SMILES:** CC(C)C(O)Cc1ccccc1 **Molecular Formula:** C11H16O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_3135>.
Cc1cccc(Cl)c1N1CCNCC1.Cl
What is the building block token for the following molecule?
Cc1cccc(Cl)c1N1CCNCC1.Cl
<BB_3135>
What is the molecular formula for <BB_3135>?
The molecular formula for <BB_3135> (Cc1cccc(Cl)c1N1CCNCC1.Cl) is C11H16Cl2N2.
Describe the ring structures in building block <BB_3135>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_3135>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3135>.
**Token:** <BB_3135> **SMILES:** Cc1cccc(Cl)c1N1CCNCC1.Cl **Molecular Formula:** C11H16Cl2N2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3136>.
COc1ccc(CN2C(=O)CSC2=S)cc1
What is the building block token for the following molecule?
COc1ccc(CN2C(=O)CSC2=S)cc1
<BB_3136>
What is the molecular formula for <BB_3136>?
The molecular formula for <BB_3136> (COc1ccc(CN2C(=O)CSC2=S)cc1) is C11H11NO2S2.
Describe the ring structures in building block <BB_3136>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_3136>.
The molecule contains the following groups: Amide, Ether, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_3136>.
**Token:** <BB_3136> **SMILES:** COc1ccc(CN2C(=O)CSC2=S)cc1 **Molecular Formula:** C11H11NO2S2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amide, Ether, Sulfide
Provide the SMILES representation for the building block token <BB_3137>.
Cc1cccc(-c2nc3cc(Cl)ccc3[nH]2)c1O
What is the building block token for the following molecule?
Cc1cccc(-c2nc3cc(Cl)ccc3[nH]2)c1O
<BB_3137>
What is the molecular formula for <BB_3137>?
The molecular formula for <BB_3137> (Cc1cccc(-c2nc3cc(Cl)ccc3[nH]2)c1O) is C14H11ClN2O.
Describe the ring structures in building block <BB_3137>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_3137>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3137>.
**Token:** <BB_3137> **SMILES:** Cc1cccc(-c2nc3cc(Cl)ccc3[nH]2)c1O **Molecular Formula:** C14H11ClN2O **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3138>.
Clc1cc(Cl)c(Cl)c(Br)c1
What is the building block token for the following molecule?
Clc1cc(Cl)c(Cl)c(Br)c1
<BB_3138>
What is the molecular formula for <BB_3138>?
The molecular formula for <BB_3138> (Clc1cc(Cl)c(Cl)c(Br)c1) is C6H2BrCl3.
Describe the ring structures in building block <BB_3138>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3138>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3138>.
**Token:** <BB_3138> **SMILES:** Clc1cc(Cl)c(Cl)c(Br)c1 **Molecular Formula:** C6H2BrCl3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3139>.
CN(C)C(=O)CCOc1ccc(N)cc1Cl
What is the building block token for the following molecule?
CN(C)C(=O)CCOc1ccc(N)cc1Cl
<BB_3139>
What is the molecular formula for <BB_3139>?
The molecular formula for <BB_3139> (CN(C)C(=O)CCOc1ccc(N)cc1Cl) is C11H15ClN2O2.
Describe the ring structures in building block <BB_3139>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3139>.
The molecule contains the following groups: Amine, Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3139>.
**Token:** <BB_3139> **SMILES:** CN(C)C(=O)CCOc1ccc(N)cc1Cl **Molecular Formula:** C11H15ClN2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3140>.
CC1(C)OB(/C=C/CBr)OC1(C)C
What is the building block token for the following molecule?
CC1(C)OB(/C=C/CBr)OC1(C)C
<BB_3140>
What is the molecular formula for <BB_3140>?
The molecular formula for <BB_3140> (CC1(C)OB(/C=C/CBr)OC1(C)C) is C9H16BBrO2.
Describe the ring structures in building block <BB_3140>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_3140>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3140>.
**Token:** <BB_3140> **SMILES:** CC1(C)OB(/C=C/CBr)OC1(C)C **Molecular Formula:** C9H16BBrO2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3141>.
CCCc1nc(=N)s[nH]1.Cl
What is the building block token for the following molecule?
CCCc1nc(=N)s[nH]1.Cl
<BB_3141>
What is the molecular formula for <BB_3141>?
The molecular formula for <BB_3141> (CCCc1nc(=N)s[nH]1.Cl) is C5H10ClN3S.
Describe the ring structures in building block <BB_3141>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_3141>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3141>.
**Token:** <BB_3141> **SMILES:** CCCc1nc(=N)s[nH]1.Cl **Molecular Formula:** C5H10ClN3S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3142>.
CC[C@H]1C[C@H]1CC(=O)CCl
What is the building block token for the following molecule?
CC[C@H]1C[C@H]1CC(=O)CCl
<BB_3142>
What is the molecular formula for <BB_3142>?
The molecular formula for <BB_3142> (CC[C@H]1C[C@H]1CC(=O)CCl) is C8H13ClO.
Describe the ring structures in building block <BB_3142>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_3142>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3142>.
**Token:** <BB_3142> **SMILES:** CC[C@H]1C[C@H]1CC(=O)CCl **Molecular Formula:** C8H13ClO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3143>.
O=C(O)C1CC(=O)C12CCCCC2
What is the building block token for the following molecule?
O=C(O)C1CC(=O)C12CCCCC2
<BB_3143>
What is the molecular formula for <BB_3143>?
The molecular formula for <BB_3143> (O=C(O)C1CC(=O)C12CCCCC2) is C10H14O3.
Describe the ring structures in building block <BB_3143>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 6.
List the primary functional groups present in <BB_3143>.
The molecule contains the following groups: Carboxylic Acid, Ketone.
Provide a comprehensive chemical profile for the building block <BB_3143>.
**Token:** <BB_3143> **SMILES:** O=C(O)C1CC(=O)C12CCCCC2 **Molecular Formula:** C10H14O3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ketone
Provide the SMILES representation for the building block token <BB_3144>.
[N-]=[N+]=Nc1cc(F)ccc1C(=O)O
What is the building block token for the following molecule?
[N-]=[N+]=Nc1cc(F)ccc1C(=O)O
<BB_3144>
What is the molecular formula for <BB_3144>?
The molecular formula for <BB_3144> ([N-]=[N+]=Nc1cc(F)ccc1C(=O)O) is C7H4FN3O2.
Describe the ring structures in building block <BB_3144>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3144>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3144>.
**Token:** <BB_3144> **SMILES:** [N-]=[N+]=Nc1cc(F)ccc1C(=O)O **Molecular Formula:** C7H4FN3O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3145>.
CN1CCNC(C(C)(C)C)C1.Cl.Cl
What is the building block token for the following molecule?
CN1CCNC(C(C)(C)C)C1.Cl.Cl
<BB_3145>
What is the molecular formula for <BB_3145>?
The molecular formula for <BB_3145> (CN1CCNC(C(C)(C)C)C1.Cl.Cl) is C9H22Cl2N2.
Describe the ring structures in building block <BB_3145>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_3145>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3145>.
**Token:** <BB_3145> **SMILES:** CN1CCNC(C(C)(C)C)C1.Cl.Cl **Molecular Formula:** C9H22Cl2N2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3146>.
C#CCNCC(F)F.Cl
What is the building block token for the following molecule?
C#CCNCC(F)F.Cl
<BB_3146>
What is the molecular formula for <BB_3146>?
The molecular formula for <BB_3146> (C#CCNCC(F)F.Cl) is C5H8ClF2N.
Describe the ring structures in building block <BB_3146>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_3146>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3146>.
**Token:** <BB_3146> **SMILES:** C#CCNCC(F)F.Cl **Molecular Formula:** C5H8ClF2N **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3147>.
CCN(CC)CCOc1ccc(C#N)cc1
What is the building block token for the following molecule?
CCN(CC)CCOc1ccc(C#N)cc1
<BB_3147>
What is the molecular formula for <BB_3147>?
The molecular formula for <BB_3147> (CCN(CC)CCOc1ccc(C#N)cc1) is C13H18N2O.
Describe the ring structures in building block <BB_3147>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3147>.
The molecule contains the following groups: Tertiary Amine, Ether, Nitrile.
Provide a comprehensive chemical profile for the building block <BB_3147>.
**Token:** <BB_3147> **SMILES:** CCN(CC)CCOc1ccc(C#N)cc1 **Molecular Formula:** C13H18N2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Ether, Nitrile
Provide the SMILES representation for the building block token <BB_3148>.
CC1(C)C(CN)CC1(F)F.Cl
What is the building block token for the following molecule?
CC1(C)C(CN)CC1(F)F.Cl
<BB_3148>
What is the molecular formula for <BB_3148>?
The molecular formula for <BB_3148> (CC1(C)C(CN)CC1(F)F.Cl) is C7H14ClF2N.
Describe the ring structures in building block <BB_3148>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_3148>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3148>.
**Token:** <BB_3148> **SMILES:** CC1(C)C(CN)CC1(F)F.Cl **Molecular Formula:** C7H14ClF2N **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3149>.
Cc1c(CBr)noc1C1CC1
What is the building block token for the following molecule?
Cc1c(CBr)noc1C1CC1
<BB_3149>
What is the molecular formula for <BB_3149>?
The molecular formula for <BB_3149> (Cc1c(CBr)noc1C1CC1) is C8H10BrNO.
Describe the ring structures in building block <BB_3149>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_3149>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3149>.
**Token:** <BB_3149> **SMILES:** Cc1c(CBr)noc1C1CC1 **Molecular Formula:** C8H10BrNO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Halogen (F,Cl,Br,I)