instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_3166>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3166>.
**Token:** <BB_3166> **SMILES:** COC(=O)c1cnc(CCl)nc1Cl **Molecular Formula:** C7H6Cl2N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3167>.
CCc1ncc(CN)o1
What is the building block token for the following molecule?
CCc1ncc(CN)o1
<BB_3167>
What is the molecular formula for <BB_3167>?
The molecular formula for <BB_3167> (CCc1ncc(CN)o1) is C6H10N2O.
Describe the ring structures in building block <BB_3167>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_3167>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_3167>.
**Token:** <BB_3167> **SMILES:** CCc1ncc(CN)o1 **Molecular Formula:** C6H10N2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_3168>.
COc1cccc(C#CCCl)c1
What is the building block token for the following molecule?
COc1cccc(C#CCCl)c1
<BB_3168>
What is the molecular formula for <BB_3168>?
The molecular formula for <BB_3168> (COc1cccc(C#CCCl)c1) is C10H9ClO.
Describe the ring structures in building block <BB_3168>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3168>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3168>.
**Token:** <BB_3168> **SMILES:** COc1cccc(C#CCCl)c1 **Molecular Formula:** C10H9ClO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3169>.
Cl.Cl.NCc1nc(C2CC2)n[nH]1
What is the building block token for the following molecule?
Cl.Cl.NCc1nc(C2CC2)n[nH]1
<BB_3169>
What is the molecular formula for <BB_3169>?
The molecular formula for <BB_3169> (Cl.Cl.NCc1nc(C2CC2)n[nH]1) is C6H12Cl2N4.
Describe the ring structures in building block <BB_3169>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_3169>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3169>.
**Token:** <BB_3169> **SMILES:** Cl.Cl.NCc1nc(C2CC2)n[nH]1 **Molecular Formula:** C6H12Cl2N4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3170>.
C[C@H](N)C(=O)NCC(=O)OC(C)(C)C
What is the building block token for the following molecule?
C[C@H](N)C(=O)NCC(=O)OC(C)(C)C
<BB_3170>
What is the molecular formula for <BB_3170>?
The molecular formula for <BB_3170> (C[C@H](N)C(=O)NCC(=O)OC(C)(C)C) is C9H18N2O3.
Describe the ring structures in building block <BB_3170>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_3170>.
The molecule contains the following groups: Amine, Amide, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_3170>.
**Token:** <BB_3170> **SMILES:** C[C@H](N)C(=O)NCC(=O)OC(C)(C)C **Molecular Formula:** C9H18N2O3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Amide, Ester, Ether
Provide the SMILES representation for the building block token <BB_3171>.
CCCN1CCC(CN)CC1.Cl.Cl
What is the building block token for the following molecule?
CCCN1CCC(CN)CC1.Cl.Cl
<BB_3171>
What is the molecular formula for <BB_3171>?
The molecular formula for <BB_3171> (CCCN1CCC(CN)CC1.Cl.Cl) is C9H22Cl2N2.
Describe the ring structures in building block <BB_3171>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_3171>.
The molecule contains the following groups: Amine, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3171>.
**Token:** <BB_3171> **SMILES:** CCCN1CCC(CN)CC1.Cl.Cl **Molecular Formula:** C9H22Cl2N2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3172>.
Cc1cc(S(=O)(=O)Cl)cc(C(=O)O)c1F
What is the building block token for the following molecule?
Cc1cc(S(=O)(=O)Cl)cc(C(=O)O)c1F
<BB_3172>
What is the molecular formula for <BB_3172>?
The molecular formula for <BB_3172> (Cc1cc(S(=O)(=O)Cl)cc(C(=O)O)c1F) is C8H6ClFO4S.
Describe the ring structures in building block <BB_3172>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3172>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3172>.
**Token:** <BB_3172> **SMILES:** Cc1cc(S(=O)(=O)Cl)cc(C(=O)O)c1F **Molecular Formula:** C8H6ClFO4S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3173>.
C/C=C/S(C)(=O)=O
What is the building block token for the following molecule?
C/C=C/S(C)(=O)=O
<BB_3173>
What is the molecular formula for <BB_3173>?
The molecular formula for <BB_3173> (C/C=C/S(C)(=O)=O) is C4H8O2S.
Describe the ring structures in building block <BB_3173>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_3173>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_3173>.
**Token:** <BB_3173> **SMILES:** C/C=C/S(C)(=O)=O **Molecular Formula:** C4H8O2S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_3174>.
O=C(O)/C=C(\Br)C(=O)O
What is the building block token for the following molecule?
O=C(O)/C=C(\Br)C(=O)O
<BB_3174>
What is the molecular formula for <BB_3174>?
The molecular formula for <BB_3174> (O=C(O)/C=C(\Br)C(=O)O) is C4H3BrO4.
Describe the ring structures in building block <BB_3174>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_3174>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3174>.
**Token:** <BB_3174> **SMILES:** O=C(O)/C=C(\Br)C(=O)O **Molecular Formula:** C4H3BrO4 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3175>.
COC(=O)c1cc(C(C)C)n[nH]1
What is the building block token for the following molecule?
COC(=O)c1cc(C(C)C)n[nH]1
<BB_3175>
What is the molecular formula for <BB_3175>?
The molecular formula for <BB_3175> (COC(=O)c1cc(C(C)C)n[nH]1) is C8H12N2O2.
Describe the ring structures in building block <BB_3175>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_3175>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_3175>.
**Token:** <BB_3175> **SMILES:** COC(=O)c1cc(C(C)C)n[nH]1 **Molecular Formula:** C8H12N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_3176>.
Nc1cccc(OCC(=O)N2CCCC2)c1
What is the building block token for the following molecule?
Nc1cccc(OCC(=O)N2CCCC2)c1
<BB_3176>
What is the molecular formula for <BB_3176>?
The molecular formula for <BB_3176> (Nc1cccc(OCC(=O)N2CCCC2)c1) is C12H16N2O2.
Describe the ring structures in building block <BB_3176>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_3176>.
The molecule contains the following groups: Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_3176>.
**Token:** <BB_3176> **SMILES:** Nc1cccc(OCC(=O)N2CCCC2)c1 **Molecular Formula:** C12H16N2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_3177>.
COc1ccc(C(N)C(F)(F)F)cc1
What is the building block token for the following molecule?
COc1ccc(C(N)C(F)(F)F)cc1
<BB_3177>
What is the molecular formula for <BB_3177>?
The molecular formula for <BB_3177> (COc1ccc(C(N)C(F)(F)F)cc1) is C9H10F3NO.
Describe the ring structures in building block <BB_3177>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3177>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3177>.
**Token:** <BB_3177> **SMILES:** COc1ccc(C(N)C(F)(F)F)cc1 **Molecular Formula:** C9H10F3NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3178>.
CC(C)COCC(O)CN
What is the building block token for the following molecule?
CC(C)COCC(O)CN
<BB_3178>
What is the molecular formula for <BB_3178>?
The molecular formula for <BB_3178> (CC(C)COCC(O)CN) is C7H17NO2.
Describe the ring structures in building block <BB_3178>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_3178>.
The molecule contains the following groups: Amine, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_3178>.
**Token:** <BB_3178> **SMILES:** CC(C)COCC(O)CN **Molecular Formula:** C7H17NO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_3179>.
COC(=O)c1cc(Cl)c(N)c(Cl)n1
What is the building block token for the following molecule?
COC(=O)c1cc(Cl)c(N)c(Cl)n1
<BB_3179>
What is the molecular formula for <BB_3179>?
The molecular formula for <BB_3179> (COC(=O)c1cc(Cl)c(N)c(Cl)n1) is C7H6Cl2N2O2.
Describe the ring structures in building block <BB_3179>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3179>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3179>.
**Token:** <BB_3179> **SMILES:** COC(=O)c1cc(Cl)c(N)c(Cl)n1 **Molecular Formula:** C7H6Cl2N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3180>.
Cl.Cl.N[C@H]1C[C@]2(CCNC(=O)C2)C1
What is the building block token for the following molecule?
Cl.Cl.N[C@H]1C[C@]2(CCNC(=O)C2)C1
<BB_3180>
What is the molecular formula for <BB_3180>?
The molecular formula for <BB_3180> (Cl.Cl.N[C@H]1C[C@]2(CCNC(=O)C2)C1) is C8H16Cl2N2O.
Describe the ring structures in building block <BB_3180>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 6.
List the primary functional groups present in <BB_3180>.
The molecule contains the following groups: Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3180>.
**Token:** <BB_3180> **SMILES:** Cl.Cl.N[C@H]1C[C@]2(CCNC(=O)C2)C1 **Molecular Formula:** C8H16Cl2N2O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 6. **Functional Groups:** Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3181>.
Cc1cc(CO)cnc1C
What is the building block token for the following molecule?
Cc1cc(CO)cnc1C
<BB_3181>
What is the molecular formula for <BB_3181>?
The molecular formula for <BB_3181> (Cc1cc(CO)cnc1C) is C8H11NO.
Describe the ring structures in building block <BB_3181>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3181>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_3181>.
**Token:** <BB_3181> **SMILES:** Cc1cc(CO)cnc1C **Molecular Formula:** C8H11NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_3182>.
COc1cc(F)ccc1N
What is the building block token for the following molecule?
COc1cc(F)ccc1N
<BB_3182>
What is the molecular formula for <BB_3182>?
The molecular formula for <BB_3182> (COc1cc(F)ccc1N) is C7H8FNO.
Describe the ring structures in building block <BB_3182>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3182>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3182>.
**Token:** <BB_3182> **SMILES:** COc1cc(F)ccc1N **Molecular Formula:** C7H8FNO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3183>.
O=C(O)Cc1ccsc1
What is the building block token for the following molecule?
O=C(O)Cc1ccsc1
<BB_3183>