instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_3200>.
Cl.Cl.NCCNC(=O)NN
What is the building block token for the following molecule?
Cl.Cl.NCCNC(=O)NN
<BB_3200>
What is the molecular formula for <BB_3200>?
The molecular formula for <BB_3200> (Cl.Cl.NCCNC(=O)NN) is C3H12Cl2N4O.
Describe the ring structures in building block <BB_3200>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_3200>.
The molecule contains the following groups: Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3200>.
**Token:** <BB_3200> **SMILES:** Cl.Cl.NCCNC(=O)NN **Molecular Formula:** C3H12Cl2N4O **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3201>.
CC(C)(C)OC(=O)N1CCC2(CCN2)CC1.Cl
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCC2(CCN2)CC1.Cl
<BB_3201>
What is the molecular formula for <BB_3201>?
The molecular formula for <BB_3201> (CC(C)(C)OC(=O)N1CCC2(CCN2)CC1.Cl) is C12H23ClN2O2.
Describe the ring structures in building block <BB_3201>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 4.
List the primary functional groups present in <BB_3201>.
The molecule contains the following groups: Secondary Amine, Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3201>.
**Token:** <BB_3201> **SMILES:** CC(C)(C)OC(=O)N1CCC2(CCN2)CC1.Cl **Molecular Formula:** C12H23ClN2O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** Secondary Amine, Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3202>.
CN1C(=O)CCC(C(N)=O)C1c1cnn(C)c1
What is the building block token for the following molecule?
CN1C(=O)CCC(C(N)=O)C1c1cnn(C)c1
<BB_3202>
What is the molecular formula for <BB_3202>?
The molecular formula for <BB_3202> (CN1C(=O)CCC(C(N)=O)C1c1cnn(C)c1) is C11H16N4O2.
Describe the ring structures in building block <BB_3202>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_3202>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_3202>.
**Token:** <BB_3202> **SMILES:** CN1C(=O)CCC(C(N)=O)C1c1cnn(C)c1 **Molecular Formula:** C11H16N4O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_3203>.
Cl.NC(c1ccc(Cl)cc1)[C@@H]1C[C@H]1c1ccccc1
What is the building block token for the following molecule?
Cl.NC(c1ccc(Cl)cc1)[C@@H]1C[C@H]1c1ccccc1
<BB_3203>
What is the molecular formula for <BB_3203>?
The molecular formula for <BB_3203> (Cl.NC(c1ccc(Cl)cc1)[C@@H]1C[C@H]1c1ccccc1) is C16H17Cl2N.
Describe the ring structures in building block <BB_3203>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3, an aromatic ring of size 6.
List the primary functional groups present in <BB_3203>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3203>.
**Token:** <BB_3203> **SMILES:** Cl.NC(c1ccc(Cl)cc1)[C@@H]1C[C@H]1c1ccccc1 **Molecular Formula:** C16H17Cl2N **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aliphatic ring of size 3, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3204>.
OC1CCC(OC(F)F)CC1
What is the building block token for the following molecule?
OC1CCC(OC(F)F)CC1
<BB_3204>
What is the molecular formula for <BB_3204>?
The molecular formula for <BB_3204> (OC1CCC(OC(F)F)CC1) is C7H12F2O2.
Describe the ring structures in building block <BB_3204>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_3204>.
The molecule contains the following groups: Alcohol, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3204>.
**Token:** <BB_3204> **SMILES:** OC1CCC(OC(F)F)CC1 **Molecular Formula:** C7H12F2O2 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Alcohol, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3205>.
CCNCc1cc(C2CC2)on1
What is the building block token for the following molecule?
CCNCc1cc(C2CC2)on1
<BB_3205>
What is the molecular formula for <BB_3205>?
The molecular formula for <BB_3205> (CCNCc1cc(C2CC2)on1) is C9H14N2O.
Describe the ring structures in building block <BB_3205>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3.
List the primary functional groups present in <BB_3205>.
The molecule contains the following groups: Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_3205>.
**Token:** <BB_3205> **SMILES:** CCNCc1cc(C2CC2)on1 **Molecular Formula:** C9H14N2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 3. **Functional Groups:** Secondary Amine
Provide the SMILES representation for the building block token <BB_3206>.
CN(C)CCc1ccccc1CO.Cl
What is the building block token for the following molecule?
CN(C)CCc1ccccc1CO.Cl
<BB_3206>
What is the molecular formula for <BB_3206>?
The molecular formula for <BB_3206> (CN(C)CCc1ccccc1CO.Cl) is C11H18ClNO.
Describe the ring structures in building block <BB_3206>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3206>.
The molecule contains the following groups: Tertiary Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3206>.
**Token:** <BB_3206> **SMILES:** CN(C)CCc1ccccc1CO.Cl **Molecular Formula:** C11H18ClNO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Tertiary Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3207>.
CCOC(=O)c1cnc(Nc2ccc(C)cc2)s1
What is the building block token for the following molecule?
CCOC(=O)c1cnc(Nc2ccc(C)cc2)s1
<BB_3207>
What is the molecular formula for <BB_3207>?
The molecular formula for <BB_3207> (CCOC(=O)c1cnc(Nc2ccc(C)cc2)s1) is C13H14N2O2S.
Describe the ring structures in building block <BB_3207>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_3207>.
The molecule contains the following groups: Secondary Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_3207>.
**Token:** <BB_3207> **SMILES:** CCOC(=O)c1cnc(Nc2ccc(C)cc2)s1 **Molecular Formula:** C13H14N2O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_3208>.
CN1CCN(C)C(CN)C1
What is the building block token for the following molecule?
CN1CCN(C)C(CN)C1
<BB_3208>
What is the molecular formula for <BB_3208>?
The molecular formula for <BB_3208> (CN1CCN(C)C(CN)C1) is C7H17N3.
Describe the ring structures in building block <BB_3208>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_3208>.
The molecule contains the following groups: Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_3208>.
**Token:** <BB_3208> **SMILES:** CN1CCN(C)C(CN)C1 **Molecular Formula:** C7H17N3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_3209>.
CC(=O)C12CC3CC(CC(C3)C1)C2
What is the building block token for the following molecule?
CC(=O)C12CC3CC(CC(C3)C1)C2
<BB_3209>
What is the molecular formula for <BB_3209>?
The molecular formula for <BB_3209> (CC(=O)C12CC3CC(CC(C3)C1)C2) is C12H18O.
Describe the ring structures in building block <BB_3209>.
The molecule contains 4 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_3209>.
The molecule contains the following groups: Ketone.
Provide a comprehensive chemical profile for the building block <BB_3209>.
**Token:** <BB_3209> **SMILES:** CC(=O)C12CC3CC(CC(C3)C1)C2 **Molecular Formula:** C12H18O **Ring System:** The molecule contains 4 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Ketone
Provide the SMILES representation for the building block token <BB_3210>.
C=C1CC(C(=O)COC(C)=O)C1
What is the building block token for the following molecule?
C=C1CC(C(=O)COC(C)=O)C1
<BB_3210>
What is the molecular formula for <BB_3210>?
The molecular formula for <BB_3210> (C=C1CC(C(=O)COC(C)=O)C1) is C9H12O3.
Describe the ring structures in building block <BB_3210>.
The molecule contains 1 ring(s): an aliphatic ring of size 4.
List the primary functional groups present in <BB_3210>.
The molecule contains the following groups: Ester, Ketone, Ether.
Provide a comprehensive chemical profile for the building block <BB_3210>.
**Token:** <BB_3210> **SMILES:** C=C1CC(C(=O)COC(C)=O)C1 **Molecular Formula:** C9H12O3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 4. **Functional Groups:** Ester, Ketone, Ether
Provide the SMILES representation for the building block token <BB_3211>.
CC(C)(C)OC(=O)c1cc(N)cc(I)c1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)c1cc(N)cc(I)c1
<BB_3211>
What is the molecular formula for <BB_3211>?
The molecular formula for <BB_3211> (CC(C)(C)OC(=O)c1cc(N)cc(I)c1) is C11H14INO2.
Describe the ring structures in building block <BB_3211>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3211>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3211>.
**Token:** <BB_3211> **SMILES:** CC(C)(C)OC(=O)c1cc(N)cc(I)c1 **Molecular Formula:** C11H14INO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3212>.
O=C(O)CCCNS(=O)(=O)c1ccc(Cl)cc1
What is the building block token for the following molecule?
O=C(O)CCCNS(=O)(=O)c1ccc(Cl)cc1
<BB_3212>
What is the molecular formula for <BB_3212>?
The molecular formula for <BB_3212> (O=C(O)CCCNS(=O)(=O)c1ccc(Cl)cc1) is C10H12ClNO4S.
Describe the ring structures in building block <BB_3212>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3212>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I), Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_3212>.
**Token:** <BB_3212> **SMILES:** O=C(O)CCCNS(=O)(=O)c1ccc(Cl)cc1 **Molecular Formula:** C10H12ClNO4S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I), Sulfonamide
Provide the SMILES representation for the building block token <BB_3213>.
CC1(C)CC2(CC(O)C2)C1
What is the building block token for the following molecule?
CC1(C)CC2(CC(O)C2)C1
<BB_3213>
What is the molecular formula for <BB_3213>?
The molecular formula for <BB_3213> (CC1(C)CC2(CC(O)C2)C1) is C9H16O.
Describe the ring structures in building block <BB_3213>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4.
List the primary functional groups present in <BB_3213>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_3213>.
**Token:** <BB_3213> **SMILES:** CC1(C)CC2(CC(O)C2)C1 **Molecular Formula:** C9H16O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_3214>.
COCCNCCC(=O)OC
What is the building block token for the following molecule?
COCCNCCC(=O)OC
<BB_3214>
What is the molecular formula for <BB_3214>?
The molecular formula for <BB_3214> (COCCNCCC(=O)OC) is C7H15NO3.
Describe the ring structures in building block <BB_3214>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_3214>.
The molecule contains the following groups: Secondary Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_3214>.
**Token:** <BB_3214> **SMILES:** COCCNCCC(=O)OC **Molecular Formula:** C7H15NO3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Secondary Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_3215>.
CC(C)(C)OC(=O)N1CCC(O)C(F)(F)CC1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCC(O)C(F)(F)CC1
<BB_3215>
What is the molecular formula for <BB_3215>?
The molecular formula for <BB_3215> (CC(C)(C)OC(=O)N1CCC(O)C(F)(F)CC1) is C11H19F2NO3.
Describe the ring structures in building block <BB_3215>.
The molecule contains 1 ring(s): an aliphatic ring of size 7.
List the primary functional groups present in <BB_3215>.
The molecule contains the following groups: Amide, Alcohol, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3215>.
**Token:** <BB_3215> **SMILES:** CC(C)(C)OC(=O)N1CCC(O)C(F)(F)CC1 **Molecular Formula:** C11H19F2NO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 7. **Functional Groups:** Amide, Alcohol, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3216>.
C[N+](C)(C)CC=O.O.[Cl-]
What is the building block token for the following molecule?
C[N+](C)(C)CC=O.O.[Cl-]
<BB_3216>
What is the molecular formula for <BB_3216>?
The molecular formula for <BB_3216> (C[N+](C)(C)CC=O.O.[Cl-]) is C5H14ClNO2.
Describe the ring structures in building block <BB_3216>.
The molecule is acyclic (contains no rings).