instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_3183>?
The molecular formula for <BB_3183> (O=C(O)Cc1ccsc1) is C6H6O2S.
Describe the ring structures in building block <BB_3183>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_3183>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_3183>.
**Token:** <BB_3183> **SMILES:** O=C(O)Cc1ccsc1 **Molecular Formula:** C6H6O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_3184>.
CSC1(SC)C(=O)NC12CCOCC2
What is the building block token for the following molecule?
CSC1(SC)C(=O)NC12CCOCC2
<BB_3184>
What is the molecular formula for <BB_3184>?
The molecular formula for <BB_3184> (CSC1(SC)C(=O)NC12CCOCC2) is C9H15NO2S2.
Describe the ring structures in building block <BB_3184>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 6.
List the primary functional groups present in <BB_3184>.
The molecule contains the following groups: Amide, Ether, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_3184>.
**Token:** <BB_3184> **SMILES:** CSC1(SC)C(=O)NC12CCOCC2 **Molecular Formula:** C9H15NO2S2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 6. **Functional Groups:** Amide, Ether, Sulfide
Provide the SMILES representation for the building block token <BB_3185>.
Cl.FC1CNCC1(F)F
What is the building block token for the following molecule?
Cl.FC1CNCC1(F)F
<BB_3185>
What is the molecular formula for <BB_3185>?
The molecular formula for <BB_3185> (Cl.FC1CNCC1(F)F) is C4H7ClF3N.
Describe the ring structures in building block <BB_3185>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_3185>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3185>.
**Token:** <BB_3185> **SMILES:** Cl.FC1CNCC1(F)F **Molecular Formula:** C4H7ClF3N **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3186>.
CC(C)(C)OC(=O)NCc1ccc(CN)cc1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NCc1ccc(CN)cc1
<BB_3186>
What is the molecular formula for <BB_3186>?
The molecular formula for <BB_3186> (CC(C)(C)OC(=O)NCc1ccc(CN)cc1) is C13H20N2O2.
Describe the ring structures in building block <BB_3186>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3186>.
The molecule contains the following groups: Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_3186>.
**Token:** <BB_3186> **SMILES:** CC(C)(C)OC(=O)NCc1ccc(CN)cc1 **Molecular Formula:** C13H20N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_3187>.
Cn1ccc(C(=O)O)c1C1CCC1
What is the building block token for the following molecule?
Cn1ccc(C(=O)O)c1C1CCC1
<BB_3187>
What is the molecular formula for <BB_3187>?
The molecular formula for <BB_3187> (Cn1ccc(C(=O)O)c1C1CCC1) is C10H13NO2.
Describe the ring structures in building block <BB_3187>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 4.
List the primary functional groups present in <BB_3187>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_3187>.
**Token:** <BB_3187> **SMILES:** Cn1ccc(C(=O)O)c1C1CCC1 **Molecular Formula:** C10H13NO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 4. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_3188>.
Cl.NC(CF)c1ccc(F)cc1
What is the building block token for the following molecule?
Cl.NC(CF)c1ccc(F)cc1
<BB_3188>
What is the molecular formula for <BB_3188>?
The molecular formula for <BB_3188> (Cl.NC(CF)c1ccc(F)cc1) is C8H10ClF2N.
Describe the ring structures in building block <BB_3188>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_3188>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3188>.
**Token:** <BB_3188> **SMILES:** Cl.NC(CF)c1ccc(F)cc1 **Molecular Formula:** C8H10ClF2N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3189>.
[N-]=[N+]=NCc1cc(Br)cc2c1OCC2
What is the building block token for the following molecule?
[N-]=[N+]=NCc1cc(Br)cc2c1OCC2
<BB_3189>
What is the molecular formula for <BB_3189>?
The molecular formula for <BB_3189> ([N-]=[N+]=NCc1cc(Br)cc2c1OCC2) is C9H8BrN3O.
Describe the ring structures in building block <BB_3189>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_3189>.
The molecule contains the following groups: Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3189>.
**Token:** <BB_3189> **SMILES:** [N-]=[N+]=NCc1cc(Br)cc2c1OCC2 **Molecular Formula:** C9H8BrN3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3190>.
Cl.NC(c1ccc(F)cc1)C1CCOCC1
What is the building block token for the following molecule?
Cl.NC(c1ccc(F)cc1)C1CCOCC1
<BB_3190>
What is the molecular formula for <BB_3190>?
The molecular formula for <BB_3190> (Cl.NC(c1ccc(F)cc1)C1CCOCC1) is C12H17ClFNO.
Describe the ring structures in building block <BB_3190>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_3190>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3190>.
**Token:** <BB_3190> **SMILES:** Cl.NC(c1ccc(F)cc1)C1CCOCC1 **Molecular Formula:** C12H17ClFNO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3191>.
CC1CNc2cc(Cl)ccc2O1
What is the building block token for the following molecule?
CC1CNc2cc(Cl)ccc2O1
<BB_3191>
What is the molecular formula for <BB_3191>?
The molecular formula for <BB_3191> (CC1CNc2cc(Cl)ccc2O1) is C9H10ClNO.
Describe the ring structures in building block <BB_3191>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_3191>.
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3191>.
**Token:** <BB_3191> **SMILES:** CC1CNc2cc(Cl)ccc2O1 **Molecular Formula:** C9H10ClNO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3192>.
Nc1cc(F)c(OC(F)F)cc1-n1cncn1
What is the building block token for the following molecule?
Nc1cc(F)c(OC(F)F)cc1-n1cncn1
<BB_3192>
What is the molecular formula for <BB_3192>?
The molecular formula for <BB_3192> (Nc1cc(F)c(OC(F)F)cc1-n1cncn1) is C9H7F3N4O.
Describe the ring structures in building block <BB_3192>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_3192>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3192>.
**Token:** <BB_3192> **SMILES:** Nc1cc(F)c(OC(F)F)cc1-n1cncn1 **Molecular Formula:** C9H7F3N4O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3193>.
CC(C)(C)OC(=O)N1CCCCC1CO
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCCCC1CO
<BB_3193>
What is the molecular formula for <BB_3193>?
The molecular formula for <BB_3193> (CC(C)(C)OC(=O)N1CCCCC1CO) is C11H21NO3.
Describe the ring structures in building block <BB_3193>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_3193>.
The molecule contains the following groups: Amide, Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_3193>.
**Token:** <BB_3193> **SMILES:** CC(C)(C)OC(=O)N1CCCCC1CO **Molecular Formula:** C11H21NO3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amide, Alcohol, Ether
Provide the SMILES representation for the building block token <BB_3194>.
C#CCNC1CCOc2ccc(Br)cc21
What is the building block token for the following molecule?
C#CCNC1CCOc2ccc(Br)cc21
<BB_3194>
What is the molecular formula for <BB_3194>?
The molecular formula for <BB_3194> (C#CCNC1CCOc2ccc(Br)cc21) is C12H12BrNO.
Describe the ring structures in building block <BB_3194>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_3194>.
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3194>.
**Token:** <BB_3194> **SMILES:** C#CCNC1CCOc2ccc(Br)cc21 **Molecular Formula:** C12H12BrNO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3195>.
O=Cc1csc(C(F)(F)F)n1
What is the building block token for the following molecule?
O=Cc1csc(C(F)(F)F)n1
<BB_3195>
What is the molecular formula for <BB_3195>?
The molecular formula for <BB_3195> (O=Cc1csc(C(F)(F)F)n1) is C5H2F3NOS.
Describe the ring structures in building block <BB_3195>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_3195>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3195>.
**Token:** <BB_3195> **SMILES:** O=Cc1csc(C(F)(F)F)n1 **Molecular Formula:** C5H2F3NOS **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3196>.
CSc1nnc(CN)s1
What is the building block token for the following molecule?
CSc1nnc(CN)s1
<BB_3196>
What is the molecular formula for <BB_3196>?
The molecular formula for <BB_3196> (CSc1nnc(CN)s1) is C4H7N3S2.
Describe the ring structures in building block <BB_3196>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_3196>.
The molecule contains the following groups: Amine, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_3196>.
**Token:** <BB_3196> **SMILES:** CSc1nnc(CN)s1 **Molecular Formula:** C4H7N3S2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Sulfide
Provide the SMILES representation for the building block token <BB_3197>.
CC1(c2ccccc2)CCC1=O
What is the building block token for the following molecule?
CC1(c2ccccc2)CCC1=O
<BB_3197>
What is the molecular formula for <BB_3197>?
The molecular formula for <BB_3197> (CC1(c2ccccc2)CCC1=O) is C11H12O.
Describe the ring structures in building block <BB_3197>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4.
List the primary functional groups present in <BB_3197>.
The molecule contains the following groups: Ketone.
Provide a comprehensive chemical profile for the building block <BB_3197>.
**Token:** <BB_3197> **SMILES:** CC1(c2ccccc2)CCC1=O **Molecular Formula:** C11H12O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 4. **Functional Groups:** Ketone
Provide the SMILES representation for the building block token <BB_3198>.
COC(=O)C(CN)C(F)(F)F.Cl
What is the building block token for the following molecule?
COC(=O)C(CN)C(F)(F)F.Cl
<BB_3198>
What is the molecular formula for <BB_3198>?
The molecular formula for <BB_3198> (COC(=O)C(CN)C(F)(F)F.Cl) is C5H9ClF3NO2.
Describe the ring structures in building block <BB_3198>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_3198>.
The molecule contains the following groups: Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_3198>.
**Token:** <BB_3198> **SMILES:** COC(=O)C(CN)C(F)(F)F.Cl **Molecular Formula:** C5H9ClF3NO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_3199>.
O=C(O)CCc1cnoc1
What is the building block token for the following molecule?
O=C(O)CCc1cnoc1
<BB_3199>
What is the molecular formula for <BB_3199>?
The molecular formula for <BB_3199> (O=C(O)CCc1cnoc1) is C6H7NO3.
Describe the ring structures in building block <BB_3199>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_3199>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_3199>.
**Token:** <BB_3199> **SMILES:** O=C(O)CCc1cnoc1 **Molecular Formula:** C6H7NO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid