instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_100>.
COC(=O)c1onc(O)c1Br
What is the building block token for the following molecule?
COC(=O)c1onc(O)c1Br
<BB_100>
What is the molecular formula for <BB_100>?
The molecular formula for <BB_100> (COC(=O)c1onc(O)c1Br) is C5H4BrNO4.
Describe the ring structures in building block <BB_100>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_100>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_100>.
**Token:** <BB_100> **SMILES:** COC(=O)c1onc(O)c1Br **Molecular Formula:** C5H4BrNO4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_101>.
CC1(c2ccc(OC(F)(F)F)cc2)NC(=O)NC1=O
What is the building block token for the following molecule?
CC1(c2ccc(OC(F)(F)F)cc2)NC(=O)NC1=O
<BB_101>
What is the molecular formula for <BB_101>?
The molecular formula for <BB_101> (CC1(c2ccc(OC(F)(F)F)cc2)NC(=O)NC1=O) is C11H9F3N2O3.
Describe the ring structures in building block <BB_101>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_101>.
The molecule contains the following groups: Amide, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_101>.
**Token:** <BB_101> **SMILES:** CC1(c2ccc(OC(F)(F)F)cc2)NC(=O)NC1=O **Molecular Formula:** C11H9F3N2O3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amide, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_102>.
CC(C)(C)OC(=O)N1CC[C@H]2CNCC[C@H]21
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CC[C@H]2CNCC[C@H]21
<BB_102>
What is the molecular formula for <BB_102>?
The molecular formula for <BB_102> (CC(C)(C)OC(=O)N1CC[C@H]2CNCC[C@H]21) is C12H22N2O2.
Describe the ring structures in building block <BB_102>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_102>.
The molecule contains the following groups: Secondary Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_102>.
**Token:** <BB_102> **SMILES:** CC(C)(C)OC(=O)N1CC[C@H]2CNCC[C@H]21 **Molecular Formula:** C12H22N2O2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_103>.
Cl.NCc1cnn(-c2ccc(Cl)cc2)c1
What is the building block token for the following molecule?
Cl.NCc1cnn(-c2ccc(Cl)cc2)c1
<BB_103>
What is the molecular formula for <BB_103>?
The molecular formula for <BB_103> (Cl.NCc1cnn(-c2ccc(Cl)cc2)c1) is C10H11Cl2N3.
Describe the ring structures in building block <BB_103>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_103>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_103>.
**Token:** <BB_103> **SMILES:** Cl.NCc1cnn(-c2ccc(Cl)cc2)c1 **Molecular Formula:** C10H11Cl2N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_104>.
O=S(=O)(Cl)CC1Cc2ccccc21
What is the building block token for the following molecule?
O=S(=O)(Cl)CC1Cc2ccccc21
<BB_104>
What is the molecular formula for <BB_104>?
The molecular formula for <BB_104> (O=S(=O)(Cl)CC1Cc2ccccc21) is C9H9ClO2S.
Describe the ring structures in building block <BB_104>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aromatic ring of size 6.
List the primary functional groups present in <BB_104>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_104>.
**Token:** <BB_104> **SMILES:** O=S(=O)(Cl)CC1Cc2ccccc21 **Molecular Formula:** C9H9ClO2S **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_105>.
O=Cc1ccc(Cn2cc(Br)c([N+](=O)[O-])n2)o1
What is the building block token for the following molecule?
O=Cc1ccc(Cn2cc(Br)c([N+](=O)[O-])n2)o1
<BB_105>
What is the molecular formula for <BB_105>?
The molecular formula for <BB_105> (O=Cc1ccc(Cn2cc(Br)c([N+](=O)[O-])n2)o1) is C9H6BrN3O4.
Describe the ring structures in building block <BB_105>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_105>.
The molecule contains the following groups: Tertiary Amine, Aldehyde, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_105>.
**Token:** <BB_105> **SMILES:** O=Cc1ccc(Cn2cc(Br)c([N+](=O)[O-])n2)o1 **Molecular Formula:** C9H6BrN3O4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** Tertiary Amine, Aldehyde, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_106>.
Fc1cccc(-c2nc(S)c(-c3ccccc3)[nH]2)c1
What is the building block token for the following molecule?
Fc1cccc(-c2nc(S)c(-c3ccccc3)[nH]2)c1
<BB_106>
What is the molecular formula for <BB_106>?
The molecular formula for <BB_106> (Fc1cccc(-c2nc(S)c(-c3ccccc3)[nH]2)c1) is C15H11FN2S.
Describe the ring structures in building block <BB_106>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_106>.
The molecule contains the following groups: Thiol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_106>.
**Token:** <BB_106> **SMILES:** Fc1cccc(-c2nc(S)c(-c3ccccc3)[nH]2)c1 **Molecular Formula:** C15H11FN2S **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Thiol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_107>.
NC1CCCC1CCc1ccccc1
What is the building block token for the following molecule?
NC1CCCC1CCc1ccccc1
<BB_107>
What is the molecular formula for <BB_107>?
The molecular formula for <BB_107> (NC1CCCC1CCc1ccccc1) is C13H19N.
Describe the ring structures in building block <BB_107>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_107>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_107>.
**Token:** <BB_107> **SMILES:** NC1CCCC1CCc1ccccc1 **Molecular Formula:** C13H19N **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_108>.
CC1CC1(N)c1ccc(Cl)cc1
What is the building block token for the following molecule?
CC1CC1(N)c1ccc(Cl)cc1
<BB_108>
What is the molecular formula for <BB_108>?
The molecular formula for <BB_108> (CC1CC1(N)c1ccc(Cl)cc1) is C10H12ClN.
Describe the ring structures in building block <BB_108>.
The molecule contains 2 ring(s): an aliphatic ring of size 3, an aromatic ring of size 6.
List the primary functional groups present in <BB_108>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_108>.
**Token:** <BB_108> **SMILES:** CC1CC1(N)c1ccc(Cl)cc1 **Molecular Formula:** C10H12ClN **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 3, an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_109>.
FC(F)(F)CNc1nc(Cl)cc(Cl)n1
What is the building block token for the following molecule?
FC(F)(F)CNc1nc(Cl)cc(Cl)n1
<BB_109>
What is the molecular formula for <BB_109>?
The molecular formula for <BB_109> (FC(F)(F)CNc1nc(Cl)cc(Cl)n1) is C6H4Cl2F3N3.
Describe the ring structures in building block <BB_109>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_109>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_109>.
**Token:** <BB_109> **SMILES:** FC(F)(F)CNc1nc(Cl)cc(Cl)n1 **Molecular Formula:** C6H4Cl2F3N3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_110>.
O=C1NCCC1Br
What is the building block token for the following molecule?
O=C1NCCC1Br
<BB_110>
What is the molecular formula for <BB_110>?
The molecular formula for <BB_110> (O=C1NCCC1Br) is C4H6BrNO.
Describe the ring structures in building block <BB_110>.
The molecule contains 1 ring(s): an aliphatic ring of size 5.
List the primary functional groups present in <BB_110>.
The molecule contains the following groups: Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_110>.
**Token:** <BB_110> **SMILES:** O=C1NCCC1Br **Molecular Formula:** C4H6BrNO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 5. **Functional Groups:** Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_111>.
COC(=O)c1cccc(NCCN)c1.Cl.Cl
What is the building block token for the following molecule?
COC(=O)c1cccc(NCCN)c1.Cl.Cl
<BB_111>
What is the molecular formula for <BB_111>?
The molecular formula for <BB_111> (COC(=O)c1cccc(NCCN)c1.Cl.Cl) is C10H16Cl2N2O2.
Describe the ring structures in building block <BB_111>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_111>.
The molecule contains the following groups: Amine, Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_111>.
**Token:** <BB_111> **SMILES:** COC(=O)c1cccc(NCCN)c1.Cl.Cl **Molecular Formula:** C10H16Cl2N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_112>.
CSc1ncc(B2OC(C)(C)C(C)(C)O2)o1
What is the building block token for the following molecule?
CSc1ncc(B2OC(C)(C)C(C)(C)O2)o1
<BB_112>
What is the molecular formula for <BB_112>?
The molecular formula for <BB_112> (CSc1ncc(B2OC(C)(C)C(C)(C)O2)o1) is C10H16BNO3S.
Describe the ring structures in building block <BB_112>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_112>.
The molecule contains the following groups: Sulfide.
Provide a comprehensive chemical profile for the building block <BB_112>.
**Token:** <BB_112> **SMILES:** CSc1ncc(B2OC(C)(C)C(C)(C)O2)o1 **Molecular Formula:** C10H16BNO3S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Sulfide
Provide the SMILES representation for the building block token <BB_113>.
COCC(C)(COC)NCCC(=O)O.Cl
What is the building block token for the following molecule?
COCC(C)(COC)NCCC(=O)O.Cl
<BB_113>
What is the molecular formula for <BB_113>?
The molecular formula for <BB_113> (COCC(C)(COC)NCCC(=O)O.Cl) is C9H20ClNO4.
Describe the ring structures in building block <BB_113>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_113>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_113>.
**Token:** <BB_113> **SMILES:** COCC(C)(COC)NCCC(=O)O.Cl **Molecular Formula:** C9H20ClNO4 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid, Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_114>.
CNCC(CO)CO.Cl
What is the building block token for the following molecule?
CNCC(CO)CO.Cl
<BB_114>
What is the molecular formula for <BB_114>?
The molecular formula for <BB_114> (CNCC(CO)CO.Cl) is C5H14ClNO2.
Describe the ring structures in building block <BB_114>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_114>.
The molecule contains the following groups: Secondary Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_114>.
**Token:** <BB_114> **SMILES:** CNCC(CO)CO.Cl **Molecular Formula:** C5H14ClNO2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Secondary Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_115>.
Cc1c(-c2ccccc2)c2ccccc2[nH]c1=O
What is the building block token for the following molecule?
Cc1c(-c2ccccc2)c2ccccc2[nH]c1=O
<BB_115>
What is the molecular formula for <BB_115>?
The molecular formula for <BB_115> (Cc1c(-c2ccccc2)c2ccccc2[nH]c1=O) is C16H13NO.
Describe the ring structures in building block <BB_115>.
The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_115>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_115>.
**Token:** <BB_115> **SMILES:** Cc1c(-c2ccccc2)c2ccccc2[nH]c1=O **Molecular Formula:** C16H13NO **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 6, an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_116>.
CCCCc1nnc(N)s1
What is the building block token for the following molecule?
CCCCc1nnc(N)s1
<BB_116>
What is the molecular formula for <BB_116>?
The molecular formula for <BB_116> (CCCCc1nnc(N)s1) is C6H11N3S.
Describe the ring structures in building block <BB_116>.
The molecule contains 1 ring(s): an aromatic ring of size 5.