instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_9050>.
N#CCCn1ncc2c(Cl)ncnc21
What is the building block token for the following molecule?
N#CCCn1ncc2c(Cl)ncnc21
<BB_9050>
What is the molecular formula for <BB_9050>?
The molecular formula for <BB_9050> (N#CCCn1ncc2c(Cl)ncnc21) is C8H6ClN5.
Describe the ring structures in building block <BB_9050>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9050>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_9050>.
**Token:** <BB_9050> **SMILES:** N#CCCn1ncc2c(Cl)ncnc21 **Molecular Formula:** C8H6ClN5 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_9051>.
CS(=O)(=O)c1cccnc1C(=O)O
What is the building block token for the following molecule?
CS(=O)(=O)c1cccnc1C(=O)O
<BB_9051>
What is the molecular formula for <BB_9051>?
The molecular formula for <BB_9051> (CS(=O)(=O)c1cccnc1C(=O)O) is C7H7NO4S.
Describe the ring structures in building block <BB_9051>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9051>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_9051>.
**Token:** <BB_9051> **SMILES:** CS(=O)(=O)c1cccnc1C(=O)O **Molecular Formula:** C7H7NO4S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_9052>.
Oc1ncc(Br)c2ccccc12
What is the building block token for the following molecule?
Oc1ncc(Br)c2ccccc12
<BB_9052>
What is the molecular formula for <BB_9052>?
The molecular formula for <BB_9052> (Oc1ncc(Br)c2ccccc12) is C9H6BrNO.
Describe the ring structures in building block <BB_9052>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9052>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9052>.
**Token:** <BB_9052> **SMILES:** Oc1ncc(Br)c2ccccc12 **Molecular Formula:** C9H6BrNO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9053>.
O=C(OCc1ccccc1)c1cc(C(F)(F)F)c[nH]1
What is the building block token for the following molecule?
O=C(OCc1ccccc1)c1cc(C(F)(F)F)c[nH]1
<BB_9053>
What is the molecular formula for <BB_9053>?
The molecular formula for <BB_9053> (O=C(OCc1ccccc1)c1cc(C(F)(F)F)c[nH]1) is C13H10F3NO2.
Describe the ring structures in building block <BB_9053>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9053>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9053>.
**Token:** <BB_9053> **SMILES:** O=C(OCc1ccccc1)c1cc(C(F)(F)F)c[nH]1 **Molecular Formula:** C13H10F3NO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9054>.
CCC(N)C(C)(F)F.Cl
What is the building block token for the following molecule?
CCC(N)C(C)(F)F.Cl
<BB_9054>
What is the molecular formula for <BB_9054>?
The molecular formula for <BB_9054> (CCC(N)C(C)(F)F.Cl) is C5H12ClF2N.
Describe the ring structures in building block <BB_9054>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9054>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9054>.
**Token:** <BB_9054> **SMILES:** CCC(N)C(C)(F)F.Cl **Molecular Formula:** C5H12ClF2N **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9055>.
CC(C)c1c(C(=O)O)cnn1Cc1ccccc1
What is the building block token for the following molecule?
CC(C)c1c(C(=O)O)cnn1Cc1ccccc1
<BB_9055>
What is the molecular formula for <BB_9055>?
The molecular formula for <BB_9055> (CC(C)c1c(C(=O)O)cnn1Cc1ccccc1) is C14H16N2O2.
Describe the ring structures in building block <BB_9055>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9055>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_9055>.
**Token:** <BB_9055> **SMILES:** CC(C)c1c(C(=O)O)cnn1Cc1ccccc1 **Molecular Formula:** C14H16N2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_9056>.
CCC1(C(=O)O)CCN(C(=O)c2ccccc2)CC1
What is the building block token for the following molecule?
CCC1(C(=O)O)CCN(C(=O)c2ccccc2)CC1
<BB_9056>
What is the molecular formula for <BB_9056>?
The molecular formula for <BB_9056> (CCC1(C(=O)O)CCN(C(=O)c2ccccc2)CC1) is C15H19NO3.
Describe the ring structures in building block <BB_9056>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9056>.
The molecule contains the following groups: Carboxylic Acid, Amide.
Provide a comprehensive chemical profile for the building block <BB_9056>.
**Token:** <BB_9056> **SMILES:** CCC1(C(=O)O)CCN(C(=O)c2ccccc2)CC1 **Molecular Formula:** C15H19NO3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide
Provide the SMILES representation for the building block token <BB_9057>.
N#Cc1cccnc1NCc1ccc(F)cc1F
What is the building block token for the following molecule?
N#Cc1cccnc1NCc1ccc(F)cc1F
<BB_9057>
What is the molecular formula for <BB_9057>?
The molecular formula for <BB_9057> (N#Cc1cccnc1NCc1ccc(F)cc1F) is C13H9F2N3.
Describe the ring structures in building block <BB_9057>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9057>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_9057>.
**Token:** <BB_9057> **SMILES:** N#Cc1cccnc1NCc1ccc(F)cc1F **Molecular Formula:** C13H9F2N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_9058>.
Cn1c(=O)c2c(ncn2C)n(C)c1=O
What is the building block token for the following molecule?
Cn1c(=O)c2c(ncn2C)n(C)c1=O
<BB_9058>
What is the molecular formula for <BB_9058>?
The molecular formula for <BB_9058> (Cn1c(=O)c2c(ncn2C)n(C)c1=O) is C8H10N4O2.
Describe the ring structures in building block <BB_9058>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9058>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_9058>.
**Token:** <BB_9058> **SMILES:** Cn1c(=O)c2c(ncn2C)n(C)c1=O **Molecular Formula:** C8H10N4O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_9059>.
Cl.NCC1(C2CCC2)CCC1
What is the building block token for the following molecule?
Cl.NCC1(C2CCC2)CCC1
<BB_9059>
What is the molecular formula for <BB_9059>?
The molecular formula for <BB_9059> (Cl.NCC1(C2CCC2)CCC1) is C9H18ClN.
Describe the ring structures in building block <BB_9059>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4.
List the primary functional groups present in <BB_9059>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9059>.
**Token:** <BB_9059> **SMILES:** Cl.NCC1(C2CCC2)CCC1 **Molecular Formula:** C9H18ClN **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aliphatic ring of size 4. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9060>.
ClCc1nnc(C2CCC2)s1
What is the building block token for the following molecule?
ClCc1nnc(C2CCC2)s1
<BB_9060>
What is the molecular formula for <BB_9060>?
The molecular formula for <BB_9060> (ClCc1nnc(C2CCC2)s1) is C7H9ClN2S.
Describe the ring structures in building block <BB_9060>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 4.
List the primary functional groups present in <BB_9060>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9060>.
**Token:** <BB_9060> **SMILES:** ClCc1nnc(C2CCC2)s1 **Molecular Formula:** C7H9ClN2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 4. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9061>.
c1cn(CCCNCc2ccc3c(c2)OCO3)cn1
What is the building block token for the following molecule?
c1cn(CCCNCc2ccc3c(c2)OCO3)cn1
<BB_9061>
What is the molecular formula for <BB_9061>?
The molecular formula for <BB_9061> (c1cn(CCCNCc2ccc3c(c2)OCO3)cn1) is C14H17N3O2.
Describe the ring structures in building block <BB_9061>.
The molecule contains 3 ring(s): an aromatic ring of size 5, an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9061>.
The molecule contains the following groups: Secondary Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_9061>.
**Token:** <BB_9061> **SMILES:** c1cn(CCCNCc2ccc3c(c2)OCO3)cn1 **Molecular Formula:** C14H17N3O2 **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 5, an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Ether
Provide the SMILES representation for the building block token <BB_9062>.
O=Cc1c(Br)ccc(C(F)(F)F)c1F
What is the building block token for the following molecule?
O=Cc1c(Br)ccc(C(F)(F)F)c1F
<BB_9062>
What is the molecular formula for <BB_9062>?
The molecular formula for <BB_9062> (O=Cc1c(Br)ccc(C(F)(F)F)c1F) is C8H3BrF4O.
Describe the ring structures in building block <BB_9062>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9062>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9062>.
**Token:** <BB_9062> **SMILES:** O=Cc1c(Br)ccc(C(F)(F)F)c1F **Molecular Formula:** C8H3BrF4O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9063>.
O=Cc1cnn(C2CCCC2)c1-c1ccccc1
What is the building block token for the following molecule?
O=Cc1cnn(C2CCCC2)c1-c1ccccc1
<BB_9063>
What is the molecular formula for <BB_9063>?
The molecular formula for <BB_9063> (O=Cc1cnn(C2CCCC2)c1-c1ccccc1) is C15H16N2O.
Describe the ring structures in building block <BB_9063>.
The molecule contains 3 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9063>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_9063>.
**Token:** <BB_9063> **SMILES:** O=Cc1cnn(C2CCCC2)c1-c1ccccc1 **Molecular Formula:** C15H16N2O **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 5, an aliphatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_9064>.
NC1=NC(=O)C2CCCN12
What is the building block token for the following molecule?
NC1=NC(=O)C2CCCN12
<BB_9064>
What is the molecular formula for <BB_9064>?
The molecular formula for <BB_9064> (NC1=NC(=O)C2CCCN12) is C6H9N3O.
Describe the ring structures in building block <BB_9064>.
The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9064>.
The molecule contains the following groups: Amine, Tertiary Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_9064>.
**Token:** <BB_9064> **SMILES:** NC1=NC(=O)C2CCCN12 **Molecular Formula:** C6H9N3O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aliphatic ring of size 5. **Functional Groups:** Amine, Tertiary Amine, Amide
Provide the SMILES representation for the building block token <BB_9065>.
CC(C)[C@H](Nc1ccc(F)cc1)C(=O)O
What is the building block token for the following molecule?
CC(C)[C@H](Nc1ccc(F)cc1)C(=O)O
<BB_9065>
What is the molecular formula for <BB_9065>?
The molecular formula for <BB_9065> (CC(C)[C@H](Nc1ccc(F)cc1)C(=O)O) is C11H14FNO2.
Describe the ring structures in building block <BB_9065>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9065>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9065>.
**Token:** <BB_9065> **SMILES:** CC(C)[C@H](Nc1ccc(F)cc1)C(=O)O **Molecular Formula:** C11H14FNO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9066>.
CC1(CN)CN(Cc2ccccc2)C1.Cl.Cl
What is the building block token for the following molecule?
CC1(CN)CN(Cc2ccccc2)C1.Cl.Cl
<BB_9066>
What is the molecular formula for <BB_9066>?
The molecular formula for <BB_9066> (CC1(CN)CN(Cc2ccccc2)C1.Cl.Cl) is C12H20Cl2N2.
Describe the ring structures in building block <BB_9066>.
The molecule contains 2 ring(s): an aliphatic ring of size 4, an aromatic ring of size 6.