instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_9033>?
The molecular formula for <BB_9033> (O=Cc1c(F)c(Br)cc(Br)c1F) is C7H2Br2F2O.
Describe the ring structures in building block <BB_9033>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9033>.
The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9033>.
**Token:** <BB_9033> **SMILES:** O=Cc1c(F)c(Br)cc(Br)c1F **Molecular Formula:** C7H2Br2F2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9034>.
COc1ccccc1OCc1csc(N)n1
What is the building block token for the following molecule?
COc1ccccc1OCc1csc(N)n1
<BB_9034>
What is the molecular formula for <BB_9034>?
The molecular formula for <BB_9034> (COc1ccccc1OCc1csc(N)n1) is C11H12N2O2S.
Describe the ring structures in building block <BB_9034>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9034>.
The molecule contains the following groups: Amine, Ether.
Provide a comprehensive chemical profile for the building block <BB_9034>.
**Token:** <BB_9034> **SMILES:** COc1ccccc1OCc1csc(N)n1 **Molecular Formula:** C11H12N2O2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine, Ether
Provide the SMILES representation for the building block token <BB_9035>.
CC1(C(=O)O)CCOCC1
What is the building block token for the following molecule?
CC1(C(=O)O)CCOCC1
<BB_9035>
What is the molecular formula for <BB_9035>?
The molecular formula for <BB_9035> (CC1(C(=O)O)CCOCC1) is C7H12O3.
Describe the ring structures in building block <BB_9035>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9035>.
The molecule contains the following groups: Carboxylic Acid, Ether.
Provide a comprehensive chemical profile for the building block <BB_9035>.
**Token:** <BB_9035> **SMILES:** CC1(C(=O)O)CCOCC1 **Molecular Formula:** C7H12O3 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Ether
Provide the SMILES representation for the building block token <BB_9036>.
Cl.O=C(O)COCCN1CCOCC1
What is the building block token for the following molecule?
Cl.O=C(O)COCCN1CCOCC1
<BB_9036>
What is the molecular formula for <BB_9036>?
The molecular formula for <BB_9036> (Cl.O=C(O)COCCN1CCOCC1) is C8H16ClNO4.
Describe the ring structures in building block <BB_9036>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9036>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9036>.
**Token:** <BB_9036> **SMILES:** Cl.O=C(O)COCCN1CCOCC1 **Molecular Formula:** C8H16ClNO4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Tertiary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9037>.
OCCCCCCCCCCCBr
What is the building block token for the following molecule?
OCCCCCCCCCCCBr
<BB_9037>
What is the molecular formula for <BB_9037>?
The molecular formula for <BB_9037> (OCCCCCCCCCCCBr) is C11H23BrO.
Describe the ring structures in building block <BB_9037>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9037>.
The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9037>.
**Token:** <BB_9037> **SMILES:** OCCCCCCCCCCCBr **Molecular Formula:** C11H23BrO **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9038>.
CC(=O)Nc1cccc2ccccc12
What is the building block token for the following molecule?
CC(=O)Nc1cccc2ccccc12
<BB_9038>
What is the molecular formula for <BB_9038>?
The molecular formula for <BB_9038> (CC(=O)Nc1cccc2ccccc12) is C12H11NO.
Describe the ring structures in building block <BB_9038>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9038>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_9038>.
**Token:** <BB_9038> **SMILES:** CC(=O)Nc1cccc2ccccc12 **Molecular Formula:** C12H11NO **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_9039>.
COCCC1(c2nc(C(C)C)no2)CCNCC1.Cl
What is the building block token for the following molecule?
COCCC1(c2nc(C(C)C)no2)CCNCC1.Cl
<BB_9039>
What is the molecular formula for <BB_9039>?
The molecular formula for <BB_9039> (COCCC1(c2nc(C(C)C)no2)CCNCC1.Cl) is C13H24ClN3O2.
Describe the ring structures in building block <BB_9039>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9039>.
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9039>.
**Token:** <BB_9039> **SMILES:** COCCC1(c2nc(C(C)C)no2)CCNCC1.Cl **Molecular Formula:** C13H24ClN3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9040>.
CSCC1(N)CCOCC1
What is the building block token for the following molecule?
CSCC1(N)CCOCC1
<BB_9040>
What is the molecular formula for <BB_9040>?
The molecular formula for <BB_9040> (CSCC1(N)CCOCC1) is C7H15NOS.
Describe the ring structures in building block <BB_9040>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9040>.
The molecule contains the following groups: Amine, Ether, Sulfide.
Provide a comprehensive chemical profile for the building block <BB_9040>.
**Token:** <BB_9040> **SMILES:** CSCC1(N)CCOCC1 **Molecular Formula:** C7H15NOS **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amine, Ether, Sulfide
Provide the SMILES representation for the building block token <BB_9041>.
CCS(=O)(=O)CC(=O)O
What is the building block token for the following molecule?
CCS(=O)(=O)CC(=O)O
<BB_9041>
What is the molecular formula for <BB_9041>?
The molecular formula for <BB_9041> (CCS(=O)(=O)CC(=O)O) is C4H8O4S.
Describe the ring structures in building block <BB_9041>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9041>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_9041>.
**Token:** <BB_9041> **SMILES:** CCS(=O)(=O)CC(=O)O **Molecular Formula:** C4H8O4S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_9042>.
O=[N+]([O-])OCCCCBr
What is the building block token for the following molecule?
O=[N+]([O-])OCCCCBr
<BB_9042>
What is the molecular formula for <BB_9042>?
The molecular formula for <BB_9042> (O=[N+]([O-])OCCCCBr) is C4H8BrNO3.
Describe the ring structures in building block <BB_9042>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9042>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_9042>.
**Token:** <BB_9042> **SMILES:** O=[N+]([O-])OCCCCBr **Molecular Formula:** C4H8BrNO3 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_9043>.
CCOC(=O)COc1ccc(OCCCl)cc1
What is the building block token for the following molecule?
CCOC(=O)COc1ccc(OCCCl)cc1
<BB_9043>
What is the molecular formula for <BB_9043>?
The molecular formula for <BB_9043> (CCOC(=O)COc1ccc(OCCCl)cc1) is C12H15ClO4.
Describe the ring structures in building block <BB_9043>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9043>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9043>.
**Token:** <BB_9043> **SMILES:** CCOC(=O)COc1ccc(OCCCl)cc1 **Molecular Formula:** C12H15ClO4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9044>.
Clc1ccccc1-c1cnn[nH]1
What is the building block token for the following molecule?
Clc1ccccc1-c1cnn[nH]1
<BB_9044>
What is the molecular formula for <BB_9044>?
The molecular formula for <BB_9044> (Clc1ccccc1-c1cnn[nH]1) is C8H6ClN3.
Describe the ring structures in building block <BB_9044>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9044>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9044>.
**Token:** <BB_9044> **SMILES:** Clc1ccccc1-c1cnn[nH]1 **Molecular Formula:** C8H6ClN3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9045>.
FC(F)(F)c1cnc(CBr)c(Cl)c1
What is the building block token for the following molecule?
FC(F)(F)c1cnc(CBr)c(Cl)c1
<BB_9045>
What is the molecular formula for <BB_9045>?
The molecular formula for <BB_9045> (FC(F)(F)c1cnc(CBr)c(Cl)c1) is C7H4BrClF3N.
Describe the ring structures in building block <BB_9045>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9045>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9045>.
**Token:** <BB_9045> **SMILES:** FC(F)(F)c1cnc(CBr)c(Cl)c1 **Molecular Formula:** C7H4BrClF3N **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9046>.
Cl.N#CCc1ccc(OCCN)cc1
What is the building block token for the following molecule?
Cl.N#CCc1ccc(OCCN)cc1
<BB_9046>
What is the molecular formula for <BB_9046>?
The molecular formula for <BB_9046> (Cl.N#CCc1ccc(OCCN)cc1) is C10H13ClN2O.
Describe the ring structures in building block <BB_9046>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9046>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_9046>.
**Token:** <BB_9046> **SMILES:** Cl.N#CCc1ccc(OCCN)cc1 **Molecular Formula:** C10H13ClN2O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_9047>.
Cc1ccc(CNc2nc(Cl)nc3nc[nH]c23)o1
What is the building block token for the following molecule?
Cc1ccc(CNc2nc(Cl)nc3nc[nH]c23)o1
<BB_9047>
What is the molecular formula for <BB_9047>?
The molecular formula for <BB_9047> (Cc1ccc(CNc2nc(Cl)nc3nc[nH]c23)o1) is C11H10ClN5O.
Describe the ring structures in building block <BB_9047>.
The molecule contains 3 ring(s): an aromatic ring of size 5, an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9047>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9047>.
**Token:** <BB_9047> **SMILES:** Cc1ccc(CNc2nc(Cl)nc3nc[nH]c23)o1 **Molecular Formula:** C11H10ClN5O **Ring System:** The molecule contains 3 ring(s): an aromatic ring of size 5, an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9048>.
COc1c(Br)cc(Br)cc1C=O
What is the building block token for the following molecule?
COc1c(Br)cc(Br)cc1C=O
<BB_9048>
What is the molecular formula for <BB_9048>?
The molecular formula for <BB_9048> (COc1c(Br)cc(Br)cc1C=O) is C8H6Br2O2.
Describe the ring structures in building block <BB_9048>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9048>.
The molecule contains the following groups: Aldehyde, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9048>.
**Token:** <BB_9048> **SMILES:** COc1c(Br)cc(Br)cc1C=O **Molecular Formula:** C8H6Br2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Aldehyde, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9049>.
C1CN[C@@H]2CCO[C@@H]2C1.Cl
What is the building block token for the following molecule?
C1CN[C@@H]2CCO[C@@H]2C1.Cl
<BB_9049>
What is the molecular formula for <BB_9049>?
The molecular formula for <BB_9049> (C1CN[C@@H]2CCO[C@@H]2C1.Cl) is C7H14ClNO.
Describe the ring structures in building block <BB_9049>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9049>.
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9049>.
**Token:** <BB_9049> **SMILES:** C1CN[C@@H]2CCO[C@@H]2C1.Cl **Molecular Formula:** C7H14ClNO **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)