instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_9066>.
The molecule contains the following groups: Amine, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9066>.
**Token:** <BB_9066> **SMILES:** CC1(CN)CN(Cc2ccccc2)C1.Cl.Cl **Molecular Formula:** C12H20Cl2N2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 4, an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9067>.
Cn1cc(-c2ccccc2Cl)cn1
What is the building block token for the following molecule?
Cn1cc(-c2ccccc2Cl)cn1
<BB_9067>
What is the molecular formula for <BB_9067>?
The molecular formula for <BB_9067> (Cn1cc(-c2ccccc2Cl)cn1) is C10H9ClN2.
Describe the ring structures in building block <BB_9067>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9067>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9067>.
**Token:** <BB_9067> **SMILES:** Cn1cc(-c2ccccc2Cl)cn1 **Molecular Formula:** C10H9ClN2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9068>.
O=C(ON1C(=O)c2ccccc2C1=O)c1ccco1
What is the building block token for the following molecule?
O=C(ON1C(=O)c2ccccc2C1=O)c1ccco1
<BB_9068>
What is the molecular formula for <BB_9068>?
The molecular formula for <BB_9068> (O=C(ON1C(=O)c2ccccc2C1=O)c1ccco1) is C13H7NO5.
Describe the ring structures in building block <BB_9068>.
The molecule contains 3 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9068>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_9068>.
**Token:** <BB_9068> **SMILES:** O=C(ON1C(=O)c2ccccc2C1=O)c1ccco1 **Molecular Formula:** C13H7NO5 **Ring System:** The molecule contains 3 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_9069>.
CC(CN)S(C)(=O)=O
What is the building block token for the following molecule?
CC(CN)S(C)(=O)=O
<BB_9069>
What is the molecular formula for <BB_9069>?
The molecular formula for <BB_9069> (CC(CN)S(C)(=O)=O) is C4H11NO2S.
Describe the ring structures in building block <BB_9069>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9069>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_9069>.
**Token:** <BB_9069> **SMILES:** CC(CN)S(C)(=O)=O **Molecular Formula:** C4H11NO2S **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_9070>.
Cl.Cl.Cn1cnc(CC(N)CO)c1
What is the building block token for the following molecule?
Cl.Cl.Cn1cnc(CC(N)CO)c1
<BB_9070>
What is the molecular formula for <BB_9070>?
The molecular formula for <BB_9070> (Cl.Cl.Cn1cnc(CC(N)CO)c1) is C7H15Cl2N3O.
Describe the ring structures in building block <BB_9070>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9070>.
The molecule contains the following groups: Amine, Alcohol, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9070>.
**Token:** <BB_9070> **SMILES:** Cl.Cl.Cn1cnc(CC(N)CO)c1 **Molecular Formula:** C7H15Cl2N3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Alcohol, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9071>.
Cc1nc(C)n(CCCCCCl)n1.Cl
What is the building block token for the following molecule?
Cc1nc(C)n(CCCCCCl)n1.Cl
<BB_9071>
What is the molecular formula for <BB_9071>?
The molecular formula for <BB_9071> (Cc1nc(C)n(CCCCCCl)n1.Cl) is C9H17Cl2N3.
Describe the ring structures in building block <BB_9071>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9071>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9071>.
**Token:** <BB_9071> **SMILES:** Cc1nc(C)n(CCCCCCl)n1.Cl **Molecular Formula:** C9H17Cl2N3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9072>.
CS(=O)(=O)C1(C=O)CCOCC1
What is the building block token for the following molecule?
CS(=O)(=O)C1(C=O)CCOCC1
<BB_9072>
What is the molecular formula for <BB_9072>?
The molecular formula for <BB_9072> (CS(=O)(=O)C1(C=O)CCOCC1) is C7H12O4S.
Describe the ring structures in building block <BB_9072>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9072>.
The molecule contains the following groups: Aldehyde, Ether.
Provide a comprehensive chemical profile for the building block <BB_9072>.
**Token:** <BB_9072> **SMILES:** CS(=O)(=O)C1(C=O)CCOCC1 **Molecular Formula:** C7H12O4S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Aldehyde, Ether
Provide the SMILES representation for the building block token <BB_9073>.
O=C(O)C1CCN(C(=O)c2ccc(F)cc2F)CC1
What is the building block token for the following molecule?
O=C(O)C1CCN(C(=O)c2ccc(F)cc2F)CC1
<BB_9073>
What is the molecular formula for <BB_9073>?
The molecular formula for <BB_9073> (O=C(O)C1CCN(C(=O)c2ccc(F)cc2F)CC1) is C13H13F2NO3.
Describe the ring structures in building block <BB_9073>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9073>.
The molecule contains the following groups: Carboxylic Acid, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9073>.
**Token:** <BB_9073> **SMILES:** O=C(O)C1CCN(C(=O)c2ccc(F)cc2F)CC1 **Molecular Formula:** C13H13F2NO3 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9074>.
NC(CC1CC1)c1ccccc1
What is the building block token for the following molecule?
NC(CC1CC1)c1ccccc1
<BB_9074>
What is the molecular formula for <BB_9074>?
The molecular formula for <BB_9074> (NC(CC1CC1)c1ccccc1) is C11H15N.
Describe the ring structures in building block <BB_9074>.
The molecule contains 2 ring(s): an aliphatic ring of size 3, an aromatic ring of size 6.
List the primary functional groups present in <BB_9074>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_9074>.
**Token:** <BB_9074> **SMILES:** NC(CC1CC1)c1ccccc1 **Molecular Formula:** C11H15N **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 3, an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_9075>.
CC(C)(C)OC(=O)N1CCCC[C@@H]1CCC(=O)O
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N1CCCC[C@@H]1CCC(=O)O
<BB_9075>
What is the molecular formula for <BB_9075>?
The molecular formula for <BB_9075> (CC(C)(C)OC(=O)N1CCCC[C@@H]1CCC(=O)O) is C13H23NO4.
Describe the ring structures in building block <BB_9075>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9075>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_9075>.
**Token:** <BB_9075> **SMILES:** CC(C)(C)OC(=O)N1CCCC[C@@H]1CCC(=O)O **Molecular Formula:** C13H23NO4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide, Ether
Provide the SMILES representation for the building block token <BB_9076>.
CC(C)(C)OC(=O)NC(C=O)CC1CCOCC1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)NC(C=O)CC1CCOCC1
<BB_9076>
What is the molecular formula for <BB_9076>?
The molecular formula for <BB_9076> (CC(C)(C)OC(=O)NC(C=O)CC1CCOCC1) is C13H23NO4.
Describe the ring structures in building block <BB_9076>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9076>.
The molecule contains the following groups: Amide, Aldehyde, Ether.
Provide a comprehensive chemical profile for the building block <BB_9076>.
**Token:** <BB_9076> **SMILES:** CC(C)(C)OC(=O)NC(C=O)CC1CCOCC1 **Molecular Formula:** C13H23NO4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Amide, Aldehyde, Ether
Provide the SMILES representation for the building block token <BB_9077>.
C1COCCN1.Cl
What is the building block token for the following molecule?
C1COCCN1.Cl
<BB_9077>
What is the molecular formula for <BB_9077>?
The molecular formula for <BB_9077> (C1COCCN1.Cl) is C4H10ClNO.
Describe the ring structures in building block <BB_9077>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9077>.
The molecule contains the following groups: Secondary Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9077>.
**Token:** <BB_9077> **SMILES:** C1COCCN1.Cl **Molecular Formula:** C4H10ClNO **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9078>.
O=C1NCCCc2cccnc21
What is the building block token for the following molecule?
O=C1NCCCc2cccnc21
<BB_9078>
What is the molecular formula for <BB_9078>?
The molecular formula for <BB_9078> (O=C1NCCCc2cccnc21) is C9H10N2O.
Describe the ring structures in building block <BB_9078>.
The molecule contains 2 ring(s): an aliphatic ring of size 7, an aromatic ring of size 6.
List the primary functional groups present in <BB_9078>.
The molecule contains the following groups: Amide.
Provide a comprehensive chemical profile for the building block <BB_9078>.
**Token:** <BB_9078> **SMILES:** O=C1NCCCc2cccnc21 **Molecular Formula:** C9H10N2O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 7, an aromatic ring of size 6. **Functional Groups:** Amide
Provide the SMILES representation for the building block token <BB_9079>.
O=Cc1cc(-c2ccoc2)on1
What is the building block token for the following molecule?
O=Cc1cc(-c2ccoc2)on1
<BB_9079>
What is the molecular formula for <BB_9079>?
The molecular formula for <BB_9079> (O=Cc1cc(-c2ccoc2)on1) is C8H5NO3.
Describe the ring structures in building block <BB_9079>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_9079>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_9079>.
**Token:** <BB_9079> **SMILES:** O=Cc1cc(-c2ccoc2)on1 **Molecular Formula:** C8H5NO3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_9080>.
NC1CCN(CCc2ccccc2)CC1
What is the building block token for the following molecule?
NC1CCN(CCc2ccccc2)CC1
<BB_9080>
What is the molecular formula for <BB_9080>?
The molecular formula for <BB_9080> (NC1CCN(CCc2ccccc2)CC1) is C13H20N2.
Describe the ring structures in building block <BB_9080>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9080>.
The molecule contains the following groups: Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_9080>.
**Token:** <BB_9080> **SMILES:** NC1CCN(CCc2ccccc2)CC1 **Molecular Formula:** C13H20N2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_9081>.
CC[SiH](CC)CC
What is the building block token for the following molecule?
CC[SiH](CC)CC
<BB_9081>
What is the molecular formula for <BB_9081>?
The molecular formula for <BB_9081> (CC[SiH](CC)CC) is C6H16Si.
Describe the ring structures in building block <BB_9081>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9081>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_9081>.
**Token:** <BB_9081> **SMILES:** CC[SiH](CC)CC **Molecular Formula:** C6H16Si **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_9082>.
CCc1ccccc1NC(=O)CN1CCNCC1
What is the building block token for the following molecule?
CCc1ccccc1NC(=O)CN1CCNCC1
<BB_9082>
What is the molecular formula for <BB_9082>?
The molecular formula for <BB_9082> (CCc1ccccc1NC(=O)CN1CCNCC1) is C14H21N3O.
Describe the ring structures in building block <BB_9082>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9082>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_9082>.
**Token:** <BB_9082> **SMILES:** CCc1ccccc1NC(=O)CN1CCNCC1 **Molecular Formula:** C14H21N3O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Tertiary Amine, Amide
Provide the SMILES representation for the building block token <BB_9083>.
COC(OC)C(O)Cc1ccc(Cl)cc1
What is the building block token for the following molecule?
COC(OC)C(O)Cc1ccc(Cl)cc1
<BB_9083>