instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
Provide the SMILES representation for the building block token <BB_9500>.
CN1Cc2ccccc2C(N)C1
What is the building block token for the following molecule?
CN1Cc2ccccc2C(N)C1
<BB_9500>
What is the molecular formula for <BB_9500>?
The molecular formula for <BB_9500> (CN1Cc2ccccc2C(N)C1) is C10H14N2.
Describe the ring structures in building block <BB_9500>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9500>.
The molecule contains the following groups: Amine, Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_9500>.
**Token:** <BB_9500> **SMILES:** CN1Cc2ccccc2C(N)C1 **Molecular Formula:** C10H14N2 **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Amine, Tertiary Amine
Provide the SMILES representation for the building block token <BB_9501>.
O=c1[nH]cc(I)c(=O)[nH]1
What is the building block token for the following molecule?
O=c1[nH]cc(I)c(=O)[nH]1
<BB_9501>
What is the molecular formula for <BB_9501>?
The molecular formula for <BB_9501> (O=c1[nH]cc(I)c(=O)[nH]1) is C4H3IN2O2.
Describe the ring structures in building block <BB_9501>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9501>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9501>.
**Token:** <BB_9501> **SMILES:** O=c1[nH]cc(I)c(=O)[nH]1 **Molecular Formula:** C4H3IN2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9502>.
COC(=O)c1ccc(-n2c(C)ccc2C)s1
What is the building block token for the following molecule?
COC(=O)c1ccc(-n2c(C)ccc2C)s1
<BB_9502>
What is the molecular formula for <BB_9502>?
The molecular formula for <BB_9502> (COC(=O)c1ccc(-n2c(C)ccc2C)s1) is C12H13NO2S.
Describe the ring structures in building block <BB_9502>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5.
List the primary functional groups present in <BB_9502>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_9502>.
**Token:** <BB_9502> **SMILES:** COC(=O)c1ccc(-n2c(C)ccc2C)s1 **Molecular Formula:** C12H13NO2S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 5. **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_9503>.
COc1ccc2ccc(OC)cc2c1
What is the building block token for the following molecule?
COc1ccc2ccc(OC)cc2c1
<BB_9503>
What is the molecular formula for <BB_9503>?
The molecular formula for <BB_9503> (COc1ccc2ccc(OC)cc2c1) is C12H12O2.
Describe the ring structures in building block <BB_9503>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9503>.
The molecule contains the following groups: Ether.
Provide a comprehensive chemical profile for the building block <BB_9503>.
**Token:** <BB_9503> **SMILES:** COc1ccc2ccc(OC)cc2c1 **Molecular Formula:** C12H12O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Ether
Provide the SMILES representation for the building block token <BB_9504>.
CN(Cc1cccc2ccccc12)N=O
What is the building block token for the following molecule?
CN(Cc1cccc2ccccc12)N=O
<BB_9504>
What is the molecular formula for <BB_9504>?
The molecular formula for <BB_9504> (CN(Cc1cccc2ccccc12)N=O) is C12H12N2O.
Describe the ring structures in building block <BB_9504>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9504>.
The molecule contains the following groups: Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_9504>.
**Token:** <BB_9504> **SMILES:** CN(Cc1cccc2ccccc12)N=O **Molecular Formula:** C12H12N2O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Tertiary Amine
Provide the SMILES representation for the building block token <BB_9505>.
O=NN1CCN(c2ccccn2)CC1
What is the building block token for the following molecule?
O=NN1CCN(c2ccccn2)CC1
<BB_9505>
What is the molecular formula for <BB_9505>?
The molecular formula for <BB_9505> (O=NN1CCN(c2ccccn2)CC1) is C9H12N4O.
Describe the ring structures in building block <BB_9505>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6.
List the primary functional groups present in <BB_9505>.
The molecule contains the following groups: Tertiary Amine.
Provide a comprehensive chemical profile for the building block <BB_9505>.
**Token:** <BB_9505> **SMILES:** O=NN1CCN(c2ccccn2)CC1 **Molecular Formula:** C9H12N4O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aromatic ring of size 6. **Functional Groups:** Tertiary Amine
Provide the SMILES representation for the building block token <BB_9506>.
Nc1ccnc(F)n1
What is the building block token for the following molecule?
Nc1ccnc(F)n1
<BB_9506>
What is the molecular formula for <BB_9506>?
The molecular formula for <BB_9506> (Nc1ccnc(F)n1) is C4H4FN3.
Describe the ring structures in building block <BB_9506>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9506>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9506>.
**Token:** <BB_9506> **SMILES:** Nc1ccnc(F)n1 **Molecular Formula:** C4H4FN3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9507>.
O=S(=O)(Cl)c1ccc(C(F)F)cc1Cl
What is the building block token for the following molecule?
O=S(=O)(Cl)c1ccc(C(F)F)cc1Cl
<BB_9507>
What is the molecular formula for <BB_9507>?
The molecular formula for <BB_9507> (O=S(=O)(Cl)c1ccc(C(F)F)cc1Cl) is C7H4Cl2F2O2S.
Describe the ring structures in building block <BB_9507>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9507>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9507>.
**Token:** <BB_9507> **SMILES:** O=S(=O)(Cl)c1ccc(C(F)F)cc1Cl **Molecular Formula:** C7H4Cl2F2O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9508>.
Nc1ccc(-c2nnn[nH]2)cc1
What is the building block token for the following molecule?
Nc1ccc(-c2nnn[nH]2)cc1
<BB_9508>
What is the molecular formula for <BB_9508>?
The molecular formula for <BB_9508> (Nc1ccc(-c2nnn[nH]2)cc1) is C7H7N5.
Describe the ring structures in building block <BB_9508>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9508>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_9508>.
**Token:** <BB_9508> **SMILES:** Nc1ccc(-c2nnn[nH]2)cc1 **Molecular Formula:** C7H7N5 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_9509>.
Cc1nn(C)c(C(N)=O)c1N
What is the building block token for the following molecule?
Cc1nn(C)c(C(N)=O)c1N
<BB_9509>
What is the molecular formula for <BB_9509>?
The molecular formula for <BB_9509> (Cc1nn(C)c(C(N)=O)c1N) is C6H10N4O.
Describe the ring structures in building block <BB_9509>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9509>.
The molecule contains the following groups: Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_9509>.
**Token:** <BB_9509> **SMILES:** Cc1nn(C)c(C(N)=O)c1N **Molecular Formula:** C6H10N4O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Amide
Provide the SMILES representation for the building block token <BB_9510>.
O=C(O)Cc1ccc(F)c(F)c1
What is the building block token for the following molecule?
O=C(O)Cc1ccc(F)c(F)c1
<BB_9510>
What is the molecular formula for <BB_9510>?
The molecular formula for <BB_9510> (O=C(O)Cc1ccc(F)c(F)c1) is C8H6F2O2.
Describe the ring structures in building block <BB_9510>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9510>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9510>.
**Token:** <BB_9510> **SMILES:** O=C(O)Cc1ccc(F)c(F)c1 **Molecular Formula:** C8H6F2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9511>.
CC(=O)c1cn(C2COC2)nn1
What is the building block token for the following molecule?
CC(=O)c1cn(C2COC2)nn1
<BB_9511>
What is the molecular formula for <BB_9511>?
The molecular formula for <BB_9511> (CC(=O)c1cn(C2COC2)nn1) is C7H9N3O2.
Describe the ring structures in building block <BB_9511>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 4.
List the primary functional groups present in <BB_9511>.
The molecule contains the following groups: Ketone, Ether.
Provide a comprehensive chemical profile for the building block <BB_9511>.
**Token:** <BB_9511> **SMILES:** CC(=O)c1cn(C2COC2)nn1 **Molecular Formula:** C7H9N3O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 4. **Functional Groups:** Ketone, Ether
Provide the SMILES representation for the building block token <BB_9512>.
Cl.Cl.Cn1cnc(CCN)n1
What is the building block token for the following molecule?
Cl.Cl.Cn1cnc(CCN)n1
<BB_9512>
What is the molecular formula for <BB_9512>?
The molecular formula for <BB_9512> (Cl.Cl.Cn1cnc(CCN)n1) is C5H12Cl2N4.
Describe the ring structures in building block <BB_9512>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9512>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9512>.
**Token:** <BB_9512> **SMILES:** Cl.Cl.Cn1cnc(CCN)n1 **Molecular Formula:** C5H12Cl2N4 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9513>.
O=c1[nH]c2cc(B(O)O)ccc2o1
What is the building block token for the following molecule?
O=c1[nH]c2cc(B(O)O)ccc2o1
<BB_9513>
What is the molecular formula for <BB_9513>?
The molecular formula for <BB_9513> (O=c1[nH]c2cc(B(O)O)ccc2o1) is C7H6BNO4.
Describe the ring structures in building block <BB_9513>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9513>.
The molecule contains the following groups: None specific.
Provide a comprehensive chemical profile for the building block <BB_9513>.
**Token:** <BB_9513> **SMILES:** O=c1[nH]c2cc(B(O)O)ccc2o1 **Molecular Formula:** C7H6BNO4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** None specific
Provide the SMILES representation for the building block token <BB_9514>.
O=[N+]([O-])c1ccc2c(S(=O)(=O)Cl)c[nH]c2c1
What is the building block token for the following molecule?
O=[N+]([O-])c1ccc2c(S(=O)(=O)Cl)c[nH]c2c1
<BB_9514>
What is the molecular formula for <BB_9514>?
The molecular formula for <BB_9514> (O=[N+]([O-])c1ccc2c(S(=O)(=O)Cl)c[nH]c2c1) is C8H5ClN2O4S.
Describe the ring structures in building block <BB_9514>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5.
List the primary functional groups present in <BB_9514>.
The molecule contains the following groups: Tertiary Amine, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_9514>.
**Token:** <BB_9514> **SMILES:** O=[N+]([O-])c1ccc2c(S(=O)(=O)Cl)c[nH]c2c1 **Molecular Formula:** C8H5ClN2O4S **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aromatic ring of size 5. **Functional Groups:** Tertiary Amine, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_9515>.
OC(c1ccccc1)C1CCCC1
What is the building block token for the following molecule?
OC(c1ccccc1)C1CCCC1
<BB_9515>
What is the molecular formula for <BB_9515>?
The molecular formula for <BB_9515> (OC(c1ccccc1)C1CCCC1) is C12H16O.
Describe the ring structures in building block <BB_9515>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9515>.
The molecule contains the following groups: Alcohol.
Provide a comprehensive chemical profile for the building block <BB_9515>.
**Token:** <BB_9515> **SMILES:** OC(c1ccccc1)C1CCCC1 **Molecular Formula:** C12H16O **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Alcohol
Provide the SMILES representation for the building block token <BB_9516>.
COC(=O)C(O)CCSC
What is the building block token for the following molecule?
COC(=O)C(O)CCSC
<BB_9516>
What is the molecular formula for <BB_9516>?
The molecular formula for <BB_9516> (COC(=O)C(O)CCSC) is C6H12O3S.
Describe the ring structures in building block <BB_9516>.
The molecule is acyclic (contains no rings).