instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
List the primary functional groups present in <BB_9466>.
The molecule contains the following groups: Tertiary Amine, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_9466>.
**Token:** <BB_9466> **SMILES:** CC(C)(C)OC(=O)N1CCN(S(C)(=N)=O)CC1 **Molecular Formula:** C10H21N3O3S **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Tertiary Amine, Amide, Ether
Provide the SMILES representation for the building block token <BB_9467>.
C=C(C)C(=O)OC(C)C
What is the building block token for the following molecule?
C=C(C)C(=O)OC(C)C
<BB_9467>
What is the molecular formula for <BB_9467>?
The molecular formula for <BB_9467> (C=C(C)C(=O)OC(C)C) is C7H12O2.
Describe the ring structures in building block <BB_9467>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9467>.
The molecule contains the following groups: Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_9467>.
**Token:** <BB_9467> **SMILES:** C=C(C)C(=O)OC(C)C **Molecular Formula:** C7H12O2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Ester, Ether
Provide the SMILES representation for the building block token <BB_9468>.
CS(=O)(=O)NCCc1ccc(C(=O)O)cc1
What is the building block token for the following molecule?
CS(=O)(=O)NCCc1ccc(C(=O)O)cc1
<BB_9468>
What is the molecular formula for <BB_9468>?
The molecular formula for <BB_9468> (CS(=O)(=O)NCCc1ccc(C(=O)O)cc1) is C10H13NO4S.
Describe the ring structures in building block <BB_9468>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9468>.
The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_9468>.
**Token:** <BB_9468> **SMILES:** CS(=O)(=O)NCCc1ccc(C(=O)O)cc1 **Molecular Formula:** C10H13NO4S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Secondary Amine, Sulfonamide
Provide the SMILES representation for the building block token <BB_9469>.
c1c[nH]c(C2CCCNC2)n1
What is the building block token for the following molecule?
c1c[nH]c(C2CCCNC2)n1
<BB_9469>
What is the molecular formula for <BB_9469>?
The molecular formula for <BB_9469> (c1c[nH]c(C2CCCNC2)n1) is C8H13N3.
Describe the ring structures in building block <BB_9469>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9469>.
The molecule contains the following groups: Secondary Amine.
Provide a comprehensive chemical profile for the building block <BB_9469>.
**Token:** <BB_9469> **SMILES:** c1c[nH]c(C2CCCNC2)n1 **Molecular Formula:** C8H13N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine
Provide the SMILES representation for the building block token <BB_9470>.
N#CCCn1ccc(Br)n1
What is the building block token for the following molecule?
N#CCCn1ccc(Br)n1
<BB_9470>
What is the molecular formula for <BB_9470>?
The molecular formula for <BB_9470> (N#CCCn1ccc(Br)n1) is C6H6BrN3.
Describe the ring structures in building block <BB_9470>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9470>.
The molecule contains the following groups: Halogen (F,Cl,Br,I), Nitrile.
Provide a comprehensive chemical profile for the building block <BB_9470>.
**Token:** <BB_9470> **SMILES:** N#CCCn1ccc(Br)n1 **Molecular Formula:** C6H6BrN3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Halogen (F,Cl,Br,I), Nitrile
Provide the SMILES representation for the building block token <BB_9471>.
CC/C=C\CN.Cl
What is the building block token for the following molecule?
CC/C=C\CN.Cl
<BB_9471>
What is the molecular formula for <BB_9471>?
The molecular formula for <BB_9471> (CC/C=C\CN.Cl) is C5H12ClN.
Describe the ring structures in building block <BB_9471>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9471>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9471>.
**Token:** <BB_9471> **SMILES:** CC/C=C\CN.Cl **Molecular Formula:** C5H12ClN **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9472>.
NS(=O)(=O)c1ccc2c(c1)CS(=O)(=O)C2
What is the building block token for the following molecule?
NS(=O)(=O)c1ccc2c(c1)CS(=O)(=O)C2
<BB_9472>
What is the molecular formula for <BB_9472>?
The molecular formula for <BB_9472> (NS(=O)(=O)c1ccc2c(c1)CS(=O)(=O)C2) is C8H9NO4S2.
Describe the ring structures in building block <BB_9472>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5.
List the primary functional groups present in <BB_9472>.
The molecule contains the following groups: Amine, Sulfonamide.
Provide a comprehensive chemical profile for the building block <BB_9472>.
**Token:** <BB_9472> **SMILES:** NS(=O)(=O)c1ccc2c(c1)CS(=O)(=O)C2 **Molecular Formula:** C8H9NO4S2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 5. **Functional Groups:** Amine, Sulfonamide
Provide the SMILES representation for the building block token <BB_9473>.
COC(C)CO
What is the building block token for the following molecule?
COC(C)CO
<BB_9473>
What is the molecular formula for <BB_9473>?
The molecular formula for <BB_9473> (COC(C)CO) is C4H10O2.
Describe the ring structures in building block <BB_9473>.
The molecule is acyclic (contains no rings).
List the primary functional groups present in <BB_9473>.
The molecule contains the following groups: Alcohol, Ether.
Provide a comprehensive chemical profile for the building block <BB_9473>.
**Token:** <BB_9473> **SMILES:** COC(C)CO **Molecular Formula:** C4H10O2 **Ring System:** The molecule is acyclic (contains no rings). **Functional Groups:** Alcohol, Ether
Provide the SMILES representation for the building block token <BB_9474>.
CC(c1ccccc1)C(O)CN
What is the building block token for the following molecule?
CC(c1ccccc1)C(O)CN
<BB_9474>
What is the molecular formula for <BB_9474>?
The molecular formula for <BB_9474> (CC(c1ccccc1)C(O)CN) is C10H15NO.
Describe the ring structures in building block <BB_9474>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9474>.
The molecule contains the following groups: Amine, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_9474>.
**Token:** <BB_9474> **SMILES:** CC(c1ccccc1)C(O)CN **Molecular Formula:** C10H15NO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Alcohol
Provide the SMILES representation for the building block token <BB_9475>.
CCOC(=O)c1ccc(Br)c(Cl)c1
What is the building block token for the following molecule?
CCOC(=O)c1ccc(Br)c(Cl)c1
<BB_9475>
What is the molecular formula for <BB_9475>?
The molecular formula for <BB_9475> (CCOC(=O)c1ccc(Br)c(Cl)c1) is C9H8BrClO2.
Describe the ring structures in building block <BB_9475>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9475>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9475>.
**Token:** <BB_9475> **SMILES:** CCOC(=O)c1ccc(Br)c(Cl)c1 **Molecular Formula:** C9H8BrClO2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9476>.
Cc1nc(-c2cccc(N)c2)[nH]c1C
What is the building block token for the following molecule?
Cc1nc(-c2cccc(N)c2)[nH]c1C
<BB_9476>
What is the molecular formula for <BB_9476>?
The molecular formula for <BB_9476> (Cc1nc(-c2cccc(N)c2)[nH]c1C) is C11H13N3.
Describe the ring structures in building block <BB_9476>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9476>.
The molecule contains the following groups: Amine.
Provide a comprehensive chemical profile for the building block <BB_9476>.
**Token:** <BB_9476> **SMILES:** Cc1nc(-c2cccc(N)c2)[nH]c1C **Molecular Formula:** C11H13N3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Amine
Provide the SMILES representation for the building block token <BB_9477>.
COC(=O)c1ccc2c(c1)CC(O)CN2.Cl
What is the building block token for the following molecule?
COC(=O)c1ccc2c(c1)CC(O)CN2.Cl
<BB_9477>
What is the molecular formula for <BB_9477>?
The molecular formula for <BB_9477> (COC(=O)c1ccc2c(c1)CC(O)CN2.Cl) is C11H14ClNO3.
Describe the ring structures in building block <BB_9477>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9477>.
The molecule contains the following groups: Secondary Amine, Ester, Alcohol, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9477>.
**Token:** <BB_9477> **SMILES:** COC(=O)c1ccc2c(c1)CC(O)CN2.Cl **Molecular Formula:** C11H14ClNO3 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Ester, Alcohol, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9478>.
CN(C)C(=O)CNCC1CC1
What is the building block token for the following molecule?
CN(C)C(=O)CNCC1CC1
<BB_9478>
What is the molecular formula for <BB_9478>?
The molecular formula for <BB_9478> (CN(C)C(=O)CNCC1CC1) is C8H16N2O.
Describe the ring structures in building block <BB_9478>.
The molecule contains 1 ring(s): an aliphatic ring of size 3.
List the primary functional groups present in <BB_9478>.
The molecule contains the following groups: Secondary Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_9478>.
**Token:** <BB_9478> **SMILES:** CN(C)C(=O)CNCC1CC1 **Molecular Formula:** C8H16N2O **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 3. **Functional Groups:** Secondary Amine, Amide
Provide the SMILES representation for the building block token <BB_9479>.
O=C(O)c1sc([N+](=O)[O-])cc1Cl
What is the building block token for the following molecule?
O=C(O)c1sc([N+](=O)[O-])cc1Cl
<BB_9479>
What is the molecular formula for <BB_9479>?
The molecular formula for <BB_9479> (O=C(O)c1sc([N+](=O)[O-])cc1Cl) is C5H2ClNO4S.
Describe the ring structures in building block <BB_9479>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9479>.
The molecule contains the following groups: Carboxylic Acid, Tertiary Amine, Halogen (F,Cl,Br,I), Nitro.
Provide a comprehensive chemical profile for the building block <BB_9479>.
**Token:** <BB_9479> **SMILES:** O=C(O)c1sc([N+](=O)[O-])cc1Cl **Molecular Formula:** C5H2ClNO4S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Carboxylic Acid, Tertiary Amine, Halogen (F,Cl,Br,I), Nitro
Provide the SMILES representation for the building block token <BB_9480>.
Cl.Cl.Cl.c1n[nH]cc1N1CCCNCC1
What is the building block token for the following molecule?
Cl.Cl.Cl.c1n[nH]cc1N1CCCNCC1
<BB_9480>
What is the molecular formula for <BB_9480>?
The molecular formula for <BB_9480> (Cl.Cl.Cl.c1n[nH]cc1N1CCCNCC1) is C8H17Cl3N4.
Describe the ring structures in building block <BB_9480>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 7.
List the primary functional groups present in <BB_9480>.
The molecule contains the following groups: Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9480>.
**Token:** <BB_9480> **SMILES:** Cl.Cl.Cl.c1n[nH]cc1N1CCCNCC1 **Molecular Formula:** C8H17Cl3N4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 7. **Functional Groups:** Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9481>.
Cc1c(N)nn(C)c1Br
What is the building block token for the following molecule?
Cc1c(N)nn(C)c1Br
<BB_9481>
What is the molecular formula for <BB_9481>?
The molecular formula for <BB_9481> (Cc1c(N)nn(C)c1Br) is C5H8BrN3.
Describe the ring structures in building block <BB_9481>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9481>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9481>.
**Token:** <BB_9481> **SMILES:** Cc1c(N)nn(C)c1Br **Molecular Formula:** C5H8BrN3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9482>.
CC(C)(C)n1ncnc1C=O
What is the building block token for the following molecule?
CC(C)(C)n1ncnc1C=O
<BB_9482>
What is the molecular formula for <BB_9482>?
The molecular formula for <BB_9482> (CC(C)(C)n1ncnc1C=O) is C7H11N3O.
Describe the ring structures in building block <BB_9482>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9482>.
The molecule contains the following groups: Aldehyde.
Provide a comprehensive chemical profile for the building block <BB_9482>.
**Token:** <BB_9482> **SMILES:** CC(C)(C)n1ncnc1C=O **Molecular Formula:** C7H11N3O **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Aldehyde
Provide the SMILES representation for the building block token <BB_9483>.
Nc1nccc(Cl)c1S(=O)(=O)F
What is the building block token for the following molecule?
Nc1nccc(Cl)c1S(=O)(=O)F
<BB_9483>