instruction
stringlengths
41
142
input
stringlengths
0
478
output
stringlengths
4
382
What is the molecular formula for <BB_9483>?
The molecular formula for <BB_9483> (Nc1nccc(Cl)c1S(=O)(=O)F) is C5H4ClFN2O2S.
Describe the ring structures in building block <BB_9483>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9483>.
The molecule contains the following groups: Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9483>.
**Token:** <BB_9483> **SMILES:** Nc1nccc(Cl)c1S(=O)(=O)F **Molecular Formula:** C5H4ClFN2O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9484>.
COC(=O)c1cc(F)nc(F)n1
What is the building block token for the following molecule?
COC(=O)c1cc(F)nc(F)n1
<BB_9484>
What is the molecular formula for <BB_9484>?
The molecular formula for <BB_9484> (COC(=O)c1cc(F)nc(F)n1) is C6H4F2N2O2.
Describe the ring structures in building block <BB_9484>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9484>.
The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9484>.
**Token:** <BB_9484> **SMILES:** COC(=O)c1cc(F)nc(F)n1 **Molecular Formula:** C6H4F2N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9485>.
CCOC(=O)C(NC)c1cccnc1.Cl.Cl
What is the building block token for the following molecule?
CCOC(=O)C(NC)c1cccnc1.Cl.Cl
<BB_9485>
What is the molecular formula for <BB_9485>?
The molecular formula for <BB_9485> (CCOC(=O)C(NC)c1cccnc1.Cl.Cl) is C10H16Cl2N2O2.
Describe the ring structures in building block <BB_9485>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9485>.
The molecule contains the following groups: Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9485>.
**Token:** <BB_9485> **SMILES:** CCOC(=O)C(NC)c1cccnc1.Cl.Cl **Molecular Formula:** C10H16Cl2N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Ester, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9486>.
CCNCC(=O)Nc1ccc(NC(C)=O)cc1
What is the building block token for the following molecule?
CCNCC(=O)Nc1ccc(NC(C)=O)cc1
<BB_9486>
What is the molecular formula for <BB_9486>?
The molecular formula for <BB_9486> (CCNCC(=O)Nc1ccc(NC(C)=O)cc1) is C12H17N3O2.
Describe the ring structures in building block <BB_9486>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9486>.
The molecule contains the following groups: Secondary Amine, Amide.
Provide a comprehensive chemical profile for the building block <BB_9486>.
**Token:** <BB_9486> **SMILES:** CCNCC(=O)Nc1ccc(NC(C)=O)cc1 **Molecular Formula:** C12H17N3O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Secondary Amine, Amide
Provide the SMILES representation for the building block token <BB_9487>.
O=C(Cl)Cc1noc2cc(F)ccc12
What is the building block token for the following molecule?
O=C(Cl)Cc1noc2cc(F)ccc12
<BB_9487>
What is the molecular formula for <BB_9487>?
The molecular formula for <BB_9487> (O=C(Cl)Cc1noc2cc(F)ccc12) is C9H5ClFNO2.
Describe the ring structures in building block <BB_9487>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9487>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9487>.
**Token:** <BB_9487> **SMILES:** O=C(Cl)Cc1noc2cc(F)ccc12 **Molecular Formula:** C9H5ClFNO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9488>.
CC(C)(C)OC(=O)N[C@@H]1CCC[C@H](C(=O)O)C1
What is the building block token for the following molecule?
CC(C)(C)OC(=O)N[C@@H]1CCC[C@H](C(=O)O)C1
<BB_9488>
What is the molecular formula for <BB_9488>?
The molecular formula for <BB_9488> (CC(C)(C)OC(=O)N[C@@H]1CCC[C@H](C(=O)O)C1) is C12H21NO4.
Describe the ring structures in building block <BB_9488>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9488>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_9488>.
**Token:** <BB_9488> **SMILES:** CC(C)(C)OC(=O)N[C@@H]1CCC[C@H](C(=O)O)C1 **Molecular Formula:** C12H21NO4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide, Ether
Provide the SMILES representation for the building block token <BB_9489>.
CC(C)(C)n1nc2c(c1C(=O)O)CCCC2
What is the building block token for the following molecule?
CC(C)(C)n1nc2c(c1C(=O)O)CCCC2
<BB_9489>
What is the molecular formula for <BB_9489>?
The molecular formula for <BB_9489> (CC(C)(C)n1nc2c(c1C(=O)O)CCCC2) is C12H18N2O2.
Describe the ring structures in building block <BB_9489>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9489>.
The molecule contains the following groups: Carboxylic Acid.
Provide a comprehensive chemical profile for the building block <BB_9489>.
**Token:** <BB_9489> **SMILES:** CC(C)(C)n1nc2c(c1C(=O)O)CCCC2 **Molecular Formula:** C12H18N2O2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid
Provide the SMILES representation for the building block token <BB_9490>.
Cn1c(F)nc2ccccc21
What is the building block token for the following molecule?
Cn1c(F)nc2ccccc21
<BB_9490>
What is the molecular formula for <BB_9490>?
The molecular formula for <BB_9490> (Cn1c(F)nc2ccccc21) is C8H7FN2.
Describe the ring structures in building block <BB_9490>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
List the primary functional groups present in <BB_9490>.
The molecule contains the following groups: Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9490>.
**Token:** <BB_9490> **SMILES:** Cn1c(F)nc2ccccc21 **Molecular Formula:** C8H7FN2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. **Functional Groups:** Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9491>.
Cl.O=C1CCC2CCNCC2N1
What is the building block token for the following molecule?
Cl.O=C1CCC2CCNCC2N1
<BB_9491>
What is the molecular formula for <BB_9491>?
The molecular formula for <BB_9491> (Cl.O=C1CCC2CCNCC2N1) is C8H15ClN2O.
Describe the ring structures in building block <BB_9491>.
The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9491>.
The molecule contains the following groups: Secondary Amine, Amide, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9491>.
**Token:** <BB_9491> **SMILES:** Cl.O=C1CCC2CCNCC2N1 **Molecular Formula:** C8H15ClN2O **Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Amide, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9492>.
Cl.Cl.Cl.Cn1ccnc1C1CNCCN1
What is the building block token for the following molecule?
Cl.Cl.Cl.Cn1ccnc1C1CNCCN1
<BB_9492>
What is the molecular formula for <BB_9492>?
The molecular formula for <BB_9492> (Cl.Cl.Cl.Cn1ccnc1C1CNCCN1) is C8H17Cl3N4.
Describe the ring structures in building block <BB_9492>.
The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9492>.
The molecule contains the following groups: Secondary Amine, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9492>.
**Token:** <BB_9492> **SMILES:** Cl.Cl.Cl.Cn1ccnc1C1CNCCN1 **Molecular Formula:** C8H17Cl3N4 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9493>.
O=C(O)c1cccc(Cl)c1O
What is the building block token for the following molecule?
O=C(O)c1cccc(Cl)c1O
<BB_9493>
What is the molecular formula for <BB_9493>?
The molecular formula for <BB_9493> (O=C(O)c1cccc(Cl)c1O) is C7H5ClO3.
Describe the ring structures in building block <BB_9493>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9493>.
The molecule contains the following groups: Carboxylic Acid, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9493>.
**Token:** <BB_9493> **SMILES:** O=C(O)c1cccc(Cl)c1O **Molecular Formula:** C7H5ClO3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Carboxylic Acid, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9494>.
COC(=O)C(C)(O)Cn1cc(Br)cn1
What is the building block token for the following molecule?
COC(=O)C(C)(O)Cn1cc(Br)cn1
<BB_9494>
What is the molecular formula for <BB_9494>?
The molecular formula for <BB_9494> (COC(=O)C(C)(O)Cn1cc(Br)cn1) is C8H11BrN2O3.
Describe the ring structures in building block <BB_9494>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9494>.
The molecule contains the following groups: Ester, Alcohol, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9494>.
**Token:** <BB_9494> **SMILES:** COC(=O)C(C)(O)Cn1cc(Br)cn1 **Molecular Formula:** C8H11BrN2O3 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ester, Alcohol, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9495>.
CCc1ccc(C(=O)CO)s1
What is the building block token for the following molecule?
CCc1ccc(C(=O)CO)s1
<BB_9495>
What is the molecular formula for <BB_9495>?
The molecular formula for <BB_9495> (CCc1ccc(C(=O)CO)s1) is C8H10O2S.
Describe the ring structures in building block <BB_9495>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9495>.
The molecule contains the following groups: Ketone, Alcohol.
Provide a comprehensive chemical profile for the building block <BB_9495>.
**Token:** <BB_9495> **SMILES:** CCc1ccc(C(=O)CO)s1 **Molecular Formula:** C8H10O2S **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ketone, Alcohol
Provide the SMILES representation for the building block token <BB_9496>.
COC(=O)c1cc(C)c2c(c1)CCCN2
What is the building block token for the following molecule?
COC(=O)c1cc(C)c2c(c1)CCCN2
<BB_9496>
What is the molecular formula for <BB_9496>?
The molecular formula for <BB_9496> (COC(=O)c1cc(C)c2c(c1)CCCN2) is C12H15NO2.
Describe the ring structures in building block <BB_9496>.
The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6.
List the primary functional groups present in <BB_9496>.
The molecule contains the following groups: Secondary Amine, Ester, Ether.
Provide a comprehensive chemical profile for the building block <BB_9496>.
**Token:** <BB_9496> **SMILES:** COC(=O)c1cc(C)c2c(c1)CCCN2 **Molecular Formula:** C12H15NO2 **Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. **Functional Groups:** Secondary Amine, Ester, Ether
Provide the SMILES representation for the building block token <BB_9497>.
COc1cccc(C(N)CF)c1
What is the building block token for the following molecule?
COc1cccc(C(N)CF)c1
<BB_9497>
What is the molecular formula for <BB_9497>?
The molecular formula for <BB_9497> (COc1cccc(C(N)CF)c1) is C9H12FNO.
Describe the ring structures in building block <BB_9497>.
The molecule contains 1 ring(s): an aromatic ring of size 6.
List the primary functional groups present in <BB_9497>.
The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9497>.
**Token:** <BB_9497> **SMILES:** COc1cccc(C(N)CF)c1 **Molecular Formula:** C9H12FNO **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6. **Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I)
Provide the SMILES representation for the building block token <BB_9498>.
C[C@@H](NC(=O)C1CCOCC1)C(=O)O
What is the building block token for the following molecule?
C[C@@H](NC(=O)C1CCOCC1)C(=O)O
<BB_9498>
What is the molecular formula for <BB_9498>?
The molecular formula for <BB_9498> (C[C@@H](NC(=O)C1CCOCC1)C(=O)O) is C9H15NO4.
Describe the ring structures in building block <BB_9498>.
The molecule contains 1 ring(s): an aliphatic ring of size 6.
List the primary functional groups present in <BB_9498>.
The molecule contains the following groups: Carboxylic Acid, Amide, Ether.
Provide a comprehensive chemical profile for the building block <BB_9498>.
**Token:** <BB_9498> **SMILES:** C[C@@H](NC(=O)C1CCOCC1)C(=O)O **Molecular Formula:** C9H15NO4 **Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6. **Functional Groups:** Carboxylic Acid, Amide, Ether
Provide the SMILES representation for the building block token <BB_9499>.
CCn1cc(C(=O)CC(=O)C(F)F)c(C)n1
What is the building block token for the following molecule?
CCn1cc(C(=O)CC(=O)C(F)F)c(C)n1
<BB_9499>
What is the molecular formula for <BB_9499>?
The molecular formula for <BB_9499> (CCn1cc(C(=O)CC(=O)C(F)F)c(C)n1) is C10H12F2N2O2.
Describe the ring structures in building block <BB_9499>.
The molecule contains 1 ring(s): an aromatic ring of size 5.
List the primary functional groups present in <BB_9499>.
The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I).
Provide a comprehensive chemical profile for the building block <BB_9499>.
**Token:** <BB_9499> **SMILES:** CCn1cc(C(=O)CC(=O)C(F)F)c(C)n1 **Molecular Formula:** C10H12F2N2O2 **Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 5. **Functional Groups:** Ketone, Halogen (F,Cl,Br,I)